Version Description
Download this release
Release Info
| Developer | machothemes |
| Plugin | |
| Version | 1.2.0 |
| Comparing to | |
| See all releases | |
Code changes from version 1.1.13 to 1.2.0
- Modula.php +840 -901
- README.txt +251 -195
- admin/add-gallery.php +112 -107
- admin/css/style.css +1486 -1489
- admin/edit-gallery.php +392 -401
- admin/fix.php +108 -111
- admin/header.php +1 -9
- admin/images/material-design.gif +0 -0
- admin/images/modula-logo.jpg +0 -0
- admin/import.php +81 -76
- admin/overview.php +174 -187
- admin/scripts/materialize.js +10021 -0
- admin/scripts/materialize.min.js +6 -9
- admin/scripts/modula-admin.js +1003 -1008
- admin/upgrade.php +30 -4
- admin/welcome-screen/assets/welcome.css +87 -0
- admin/welcome-screen/sections/comparison-table.php +91 -0
- admin/welcome-screen/sections/getting-started.php +133 -0
- lib/db-class.php +112 -87
- lib/gallery-class.php +271 -273
- scripts/jquery.modula.js +0 -453
Modula.php
CHANGED
|
@@ -1,138 +1,136 @@
|
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
-
Plugin Name: Gallery - A WordPress Modula Gallery
|
| 4 |
-
Plugin URI:
|
| 5 |
-
Description:
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
|
| 13 |
-
|
|
|
|
|
|
|
|
|
|
| 14 |
modula_lite_install_db();
|
| 15 |
}
|
| 16 |
|
| 17 |
-
if (!class_exists("ModulaLite"))
|
| 18 |
-
{
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
|
| 27 |
-
|
| 28 |
-
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
|
| 37 |
-
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
|
| 46 |
-
|
| 47 |
-
|
| 48 |
-
|
| 49 |
-
|
| 50 |
-
|
| 51 |
-
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
|
| 55 |
-
|
| 56 |
-
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
'hoverEffect' => 'pufrobo',
|
| 60 |
'hasResizedImages' => false,
|
| 61 |
-
|
| 62 |
);
|
| 63 |
|
| 64 |
-
public function __construct()
|
| 65 |
-
|
| 66 |
-
$this->
|
| 67 |
-
$this->plugin_url = plugins_url('', __FILE__);
|
| 68 |
$this->define_constants();
|
| 69 |
$this->define_db_tables();
|
| 70 |
$this->define_hover_effects();
|
| 71 |
$this->ModulaDB = $this->create_db_conn();
|
| 72 |
|
| 73 |
-
add_filter('widget_text', 'do_shortcode');
|
| 74 |
-
add_filter('mce_buttons', array($this, 'editor_button'));
|
| 75 |
-
add_filter('mce_external_plugins', array($this, 'register_editor_plugin'));
|
| 76 |
|
| 77 |
-
add_action('init', array($this, 'create_textdomain'));
|
| 78 |
|
| 79 |
-
add_action('wp_enqueue_scripts', array($this, 'add_gallery_scripts'));
|
| 80 |
|
| 81 |
-
add_action( 'admin_menu', array($this, 'add_gallery_admin_menu') );
|
| 82 |
|
| 83 |
-
add_shortcode( 'Modula', array($this, 'gallery_shortcode_handler') );
|
| 84 |
|
| 85 |
-
add_action('wp_ajax_modula_save_gallery', array($this,'save_gallery'));
|
| 86 |
-
add_action('wp_ajax_modula_save_image', array($this,'save_image'));
|
| 87 |
-
add_action('wp_ajax_modula_add_image', array($this,'add_image'));
|
| 88 |
-
add_action('wp_ajax_modula_list_images', array($this,'list_images'));
|
| 89 |
-
add_action('wp_ajax_modula_sort_images', array($this,'sort_images'));
|
| 90 |
-
add_action('wp_ajax_modula_delete_image', array($this,'delete_image'));
|
| 91 |
-
add_action('wp_ajax_modula_resize_images', array($this,'resize_images'));
|
| 92 |
-
add_action('wp_ajax_modula_delete_gallery', array($this,'delete_gallery'));
|
| 93 |
-
add_action('wp_ajax_modula_clone_gallery', array($this,'clone_gallery'));
|
| 94 |
-
add_action('wp_ajax_modula_create_gallery', array($this,'create_gallery'));
|
| 95 |
-
add_action('wp_ajax_mtg_shortcode_editor', array($this, 'mtg_shortcode_editor'));
|
| 96 |
-
add_action('wp_ajax_modula_get_config', array($this, 'get_config'));
|
| 97 |
-
add_action('wp_ajax_modula_update_config', array($this, 'update_config'));
|
| 98 |
-
add_action('wp_ajax_modula_get_ext_galleries', array($this,'get_ext_galleries'));
|
| 99 |
-
add_action('wp_ajax_modula_do_import_galleries', array($this,'do_import_galleries'));
|
| 100 |
|
| 101 |
-
add_filter( 'plugin_row_meta',array( $this, 'register_links' ),10,2);
|
|
|
|
| 102 |
}
|
| 103 |
|
| 104 |
//Define textdomain
|
| 105 |
-
public function create_textdomain()
|
| 106 |
-
|
| 107 |
-
$plugin_dir
|
| 108 |
-
load_plugin_textdomain( 'modula-gallery', false, $plugin_dir.'/lib/languages' );
|
| 109 |
}
|
| 110 |
|
| 111 |
-
function define_hover_effects()
|
| 112 |
-
|
| 113 |
-
$this->hoverEffects[] = new ModulaLiteHoverEffect('
|
| 114 |
-
$this->hoverEffects[] = new ModulaLiteHoverEffect('
|
| 115 |
-
$this->hoverEffects[] = new ModulaLiteHoverEffect(
|
| 116 |
-
$this->hoverEffects[] = new ModulaLiteHoverEffect('
|
| 117 |
-
$this->hoverEffects[] = new ModulaLiteHoverEffect('
|
| 118 |
-
$this->hoverEffects[] = new ModulaLiteHoverEffect('
|
| 119 |
-
$this->hoverEffects[] = new ModulaLiteHoverEffect('
|
| 120 |
-
$this->hoverEffects[] = new ModulaLiteHoverEffect('
|
| 121 |
-
$this->hoverEffects[] = new ModulaLiteHoverEffect('
|
| 122 |
-
$this->hoverEffects[] = new ModulaLiteHoverEffect('
|
| 123 |
-
$this->hoverEffects[] = new ModulaLiteHoverEffect('
|
| 124 |
-
$this->hoverEffects[] = new ModulaLiteHoverEffect('
|
| 125 |
-
$this->hoverEffects[] = new ModulaLiteHoverEffect('Comodo', '', true, false, 4);
|
| 126 |
}
|
| 127 |
|
| 128 |
-
public function get_ext_galleries()
|
| 129 |
-
|
| 130 |
-
header("Content-type: application/json");
|
| 131 |
|
| 132 |
global $wpdb;
|
| 133 |
|
| 134 |
-
if(check_admin_referer("Modula","Modula"))
|
| 135 |
-
{
|
| 136 |
$res = array( "success" => 0 );
|
| 137 |
|
| 138 |
$source = $_POST['source'];
|
|
@@ -143,9 +141,9 @@ if (!class_exists("ModulaLite"))
|
|
| 143 |
switch ( $source ) {
|
| 144 |
case 'Envira':
|
| 145 |
$galleries = get_posts( array(
|
| 146 |
-
|
| 147 |
-
|
| 148 |
-
|
| 149 |
foreach ( $galleries as $g ) {
|
| 150 |
$item = array();
|
| 151 |
$item['id'] = $g->ID;
|
|
@@ -154,7 +152,7 @@ if (!class_exists("ModulaLite"))
|
|
| 154 |
}
|
| 155 |
break;
|
| 156 |
case 'NextGen':
|
| 157 |
-
$galleries = $wpdb->get_results("SELECT title, gid FROM $wpdb->nggallery");
|
| 158 |
foreach ( $galleries as $g ) {
|
| 159 |
$item = array();
|
| 160 |
$item['id'] = $g->gid;
|
|
@@ -170,90 +168,89 @@ if (!class_exists("ModulaLite"))
|
|
| 170 |
die();
|
| 171 |
}
|
| 172 |
|
| 173 |
-
public function
|
| 174 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 175 |
global $wpdb;
|
| 176 |
|
| 177 |
-
header("Content-type: application/json");
|
| 178 |
-
if(check_admin_referer("Modula","Modula"))
|
| 179 |
-
|
| 180 |
-
$res = array("success" => 0);
|
| 181 |
$source = $_POST['source'];
|
| 182 |
-
$ids
|
| 183 |
-
switch ($source)
|
| 184 |
-
{
|
| 185 |
case 'Envira':
|
| 186 |
-
foreach ($ids as $id)
|
| 187 |
-
|
| 188 |
-
$
|
| 189 |
-
$
|
| 190 |
-
|
| 191 |
-
|
| 192 |
-
|
| 193 |
-
|
| 194 |
-
|
| 195 |
-
|
| 196 |
-
|
| 197 |
);
|
| 198 |
-
$gdb = array_merge($this->defaultValues, $g);
|
| 199 |
|
| 200 |
-
$saved = $this->ModulaDB->addGallery($gdb);
|
| 201 |
$newId = $this->ModulaDB->getNewGalleryId();
|
| 202 |
|
| 203 |
-
if($newId && count($data['gallery']))
|
| 204 |
-
{
|
| 205 |
$images = array();
|
| 206 |
//TODO only active images
|
| 207 |
-
foreach ( $data['gallery'] as $item )
|
| 208 |
-
|
| 209 |
-
$toAdd
|
| 210 |
-
$toAdd->
|
| 211 |
-
$toAdd->title = $item['title'];
|
| 212 |
$toAdd->description = $item['caption'];
|
| 213 |
-
$toAdd->imagePath
|
| 214 |
|
| 215 |
-
$images []= $toAdd;
|
| 216 |
}
|
| 217 |
-
$imgResult = $this->ModulaDB->addImages($newId, $images);
|
| 218 |
}
|
| 219 |
}
|
| 220 |
$res['success'] = 1;
|
| 221 |
break;
|
| 222 |
case 'NextGen':
|
| 223 |
-
foreach ($ids as $id)
|
| 224 |
-
|
| 225 |
-
$gallery = $wpdb->get_row(
|
| 226 |
-
$wpdb->prepare( "SELECT title, gid, path FROM $wpdb->nggallery WHERE gid=%s", $id)
|
| 227 |
-
);
|
| 228 |
|
| 229 |
-
$dbimages = $wpdb->get_results(
|
| 230 |
-
$wpdb->prepare( "SELECT filename, description, alttext FROM $wpdb->nggpictures WHERE exclude <> 1 AND galleryid=%s", $id )
|
| 231 |
-
);
|
| 232 |
|
| 233 |
-
$g
|
| 234 |
-
|
| 235 |
-
|
| 236 |
-
|
|
|
|
| 237 |
);
|
| 238 |
-
$gdb = array_merge($this->defaultValues, $g);
|
| 239 |
|
| 240 |
-
$saved = $this->ModulaDB->addGallery($gdb);
|
| 241 |
$newId = $this->ModulaDB->getNewGalleryId();
|
| 242 |
|
| 243 |
-
if($newId && count($dbimages))
|
| 244 |
-
{
|
| 245 |
$images = array();
|
| 246 |
-
foreach ( $dbimages as $item )
|
| 247 |
-
|
| 248 |
-
$toAdd
|
| 249 |
-
$toAdd->
|
| 250 |
-
$toAdd->title = $item->alttext;
|
| 251 |
$toAdd->description = $item->description;
|
| 252 |
-
$toAdd->imagePath
|
| 253 |
|
| 254 |
-
$images []= $toAdd;
|
| 255 |
}
|
| 256 |
-
$imgResult = $this->ModulaDB->addImages($newId, $images);
|
| 257 |
|
| 258 |
}
|
| 259 |
}
|
|
@@ -261,58 +258,51 @@ if (!class_exists("ModulaLite"))
|
|
| 261 |
break;
|
| 262 |
}
|
| 263 |
|
| 264 |
-
echo json_encode($res);
|
| 265 |
}
|
| 266 |
die();
|
| 267 |
}
|
| 268 |
|
| 269 |
-
public function register_links($links, $file)
|
| 270 |
-
|
| 271 |
-
$base
|
| 272 |
-
|
| 273 |
-
|
| 274 |
-
|
| 275 |
-
|
| 276 |
-
|
| 277 |
-
|
| 278 |
-
return $links;
|
| 279 |
|
| 280 |
}
|
| 281 |
|
| 282 |
//delete gallery
|
| 283 |
-
function delete_gallery()
|
| 284 |
-
|
| 285 |
-
|
| 286 |
-
|
| 287 |
-
$id= intval($_POST['gid']);
|
| 288 |
-
$this->ModulaDB->deleteGallery($id);
|
| 289 |
}
|
| 290 |
|
| 291 |
die();
|
| 292 |
}
|
| 293 |
|
| 294 |
-
public function update_config()
|
| 295 |
-
|
| 296 |
-
|
| 297 |
-
|
| 298 |
-
$id = $_POST['id'];
|
| 299 |
-
$config = stripslashes($_POST['config']);
|
| 300 |
|
| 301 |
-
|
| 302 |
}
|
| 303 |
|
| 304 |
die();
|
| 305 |
}
|
| 306 |
|
| 307 |
-
public function get_config()
|
| 308 |
-
|
| 309 |
-
|
| 310 |
-
{
|
| 311 |
-
$id = $_POST['id'];
|
| 312 |
|
| 313 |
-
|
| 314 |
|
| 315 |
-
|
| 316 |
|
| 317 |
}
|
| 318 |
|
|
@@ -321,27 +311,24 @@ if (!class_exists("ModulaLite"))
|
|
| 321 |
|
| 322 |
//add gallery
|
| 323 |
|
| 324 |
-
function create_gallery()
|
| 325 |
-
|
| 326 |
-
|
| 327 |
-
|
| 328 |
-
$data
|
| 329 |
-
$data["
|
| 330 |
-
$data["
|
| 331 |
-
$data["
|
| 332 |
-
$data["height"] = $_POST['height'];
|
| 333 |
-
$data["img_size"] = intval($_POST['img_size']);
|
| 334 |
$data["hasResizedImages"] = true;
|
| 335 |
|
| 336 |
-
$this->ModulaDB->addGallery($data);
|
| 337 |
$id = $this->ModulaDB->getLastGalleryId()->Id;
|
| 338 |
|
| 339 |
-
if($id > 0 && array_key_exists('images', $_POST) && strlen($_POST['images']))
|
| 340 |
-
|
| 341 |
-
$
|
| 342 |
-
$images = array_splice(json_decode($enc_images), 0, 11 + 9);
|
| 343 |
ModulaLiteTools::check_and_resize( $images, $data['img_size'] );
|
| 344 |
-
$result = $this->ModulaDB->addImages($id, $images);
|
| 345 |
}
|
| 346 |
print $id;
|
| 347 |
}
|
|
@@ -349,24 +336,21 @@ if (!class_exists("ModulaLite"))
|
|
| 349 |
}
|
| 350 |
|
| 351 |
//clone gallery
|
| 352 |
-
function clone_gallery()
|
| 353 |
-
|
| 354 |
-
|
| 355 |
-
|
| 356 |
-
$
|
| 357 |
-
$
|
| 358 |
-
$
|
| 359 |
-
$this->ModulaDB->
|
| 360 |
-
|
| 361 |
-
$images
|
| 362 |
-
|
| 363 |
-
foreach($images as &$image)
|
| 364 |
-
{
|
| 365 |
-
$image->Id = null;
|
| 366 |
$image->gid = $id;
|
| 367 |
}
|
| 368 |
|
| 369 |
-
$this->ModulaDB->addImages($id, $images);
|
| 370 |
}
|
| 371 |
|
| 372 |
die();
|
|
@@ -374,54 +358,53 @@ if (!class_exists("ModulaLite"))
|
|
| 374 |
|
| 375 |
|
| 376 |
//Define constants
|
| 377 |
-
public function define_constants()
|
| 378 |
-
|
| 379 |
-
if ( ! defined( 'Modula_PLUGIN_BASENAME' ) )
|
| 380 |
define( 'Modula_PLUGIN_BASENAME', plugin_basename( __FILE__ ) );
|
|
|
|
| 381 |
|
| 382 |
-
if ( ! defined( 'Modula_PLUGIN_NAME' ) )
|
| 383 |
define( 'Modula_PLUGIN_NAME', trim( dirname( Modula_PLUGIN_BASENAME ), '/' ) );
|
|
|
|
| 384 |
|
| 385 |
-
if ( ! defined( 'Modula_PLUGIN_DIR' ) )
|
| 386 |
define( 'Modula_PLUGIN_DIR', WP_PLUGIN_DIR . '/' . Modula_PLUGIN_NAME );
|
|
|
|
| 387 |
}
|
| 388 |
|
| 389 |
//delete Gallery
|
| 390 |
|
| 391 |
|
| 392 |
-
|
| 393 |
//Define DB tables
|
| 394 |
-
public function define_db_tables()
|
| 395 |
-
{
|
| 396 |
global $wpdb;
|
| 397 |
|
| 398 |
$wpdb->ModulaGalleries = $wpdb->prefix . 'modula';
|
| 399 |
-
$wpdb->ModulaImages
|
| 400 |
}
|
| 401 |
|
| 402 |
|
| 403 |
-
public function create_db_conn()
|
| 404 |
-
|
| 405 |
-
require('lib/db-class.php');
|
| 406 |
$ModulaDB = ModulaLiteDB::getInstance();
|
|
|
|
| 407 |
return $ModulaDB;
|
| 408 |
}
|
| 409 |
|
| 410 |
-
public function editor_button($buttons)
|
| 411 |
-
|
| 412 |
-
|
| 413 |
return $buttons;
|
| 414 |
}
|
| 415 |
|
| 416 |
-
public function register_editor_plugin($plugin_array)
|
| 417 |
-
|
| 418 |
-
|
| 419 |
return $plugin_array;
|
| 420 |
}
|
| 421 |
|
| 422 |
-
public function mtg_shortcode_editor()
|
| 423 |
-
|
| 424 |
-
$css_path = plugins_url( 'assets/css/admin.css', __FILE__ );
|
| 425 |
$admin_url = admin_url();
|
| 426 |
|
| 427 |
$galleries = $this->ModulaDB->getGalleries(); //load all galleries
|
|
@@ -431,259 +414,229 @@ if (!class_exists("ModulaLite"))
|
|
| 431 |
}
|
| 432 |
|
| 433 |
//Add gallery scripts
|
| 434 |
-
public function add_gallery_scripts()
|
| 435 |
-
|
| 436 |
-
wp_enqueue_script('jquery');
|
| 437 |
|
| 438 |
-
wp_register_script('modula', plugins_url().'/modula-best-grid-gallery/scripts/jquery.modula.js', array('jquery'));
|
| 439 |
-
wp_enqueue_script('modula');
|
| 440 |
|
| 441 |
|
| 442 |
-
wp_register_style('modula_stylesheet', plugins_url() . '/modula-best-grid-gallery/scripts/modula.css');
|
| 443 |
-
wp_enqueue_style('modula_stylesheet');
|
| 444 |
|
| 445 |
-
wp_register_style('effects_stylesheet', plugins_url() . '/modula-best-grid-gallery/scripts/effects.css', null, $this->version);
|
| 446 |
-
wp_enqueue_style('effects_stylesheet');
|
| 447 |
|
| 448 |
-
wp_register_script('lightbox2_script', plugins_url() . '/modula-best-grid-gallery/lightbox/lightbox2/js/script.js', array('jquery'));
|
| 449 |
-
wp_register_style('lightbox2_stylesheet', plugins_url() . '/modula-best-grid-gallery/lightbox/lightbox2/css/style.css');
|
| 450 |
}
|
| 451 |
|
| 452 |
//Admin Section - register scripts and styles
|
| 453 |
-
public function gallery_admin_init()
|
| 454 |
-
|
| 455 |
-
if(function_exists( 'wp_enqueue_media' ))
|
| 456 |
-
{
|
| 457 |
wp_enqueue_media();
|
| 458 |
}
|
| 459 |
|
| 460 |
-
wp_enqueue_script('jquery');
|
| 461 |
|
| 462 |
wp_enqueue_script( 'wp-color-picker' );
|
| 463 |
wp_enqueue_style( 'wp-color-picker' );
|
| 464 |
|
| 465 |
-
wp_enqueue_script('media-upload');
|
| 466 |
-
wp_enqueue_script('thickbox');
|
| 467 |
|
| 468 |
-
wp_register_style('materialize', plugins_url().'/modula-best-grid-gallery/admin/css/materialize.css');
|
| 469 |
-
wp_enqueue_style('materialize');
|
| 470 |
|
| 471 |
-
wp_register_style('styles', plugins_url().'/modula-best-grid-gallery/admin/css/style.css');
|
| 472 |
-
wp_enqueue_style('styles');
|
| 473 |
|
| 474 |
-
wp_register_style('effects', plugins_url().'/modula-best-grid-gallery/scripts/effects.css');
|
| 475 |
-
wp_enqueue_style('effects');
|
| 476 |
|
| 477 |
-
wp_register_script('
|
| 478 |
-
wp_enqueue_script('modula');
|
| 479 |
|
| 480 |
-
wp_register_script('
|
| 481 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 482 |
|
| 483 |
-
|
| 484 |
-
wp_enqueue_style('materialdesign-icons');
|
| 485 |
|
| 486 |
-
|
|
|
|
|
|
|
|
|
|
| 487 |
|
| 488 |
$tg_db_version = '1.0';
|
| 489 |
$installed_ver = get_option( "Modula_db_version" );
|
| 490 |
|
| 491 |
-
if($installed_ver != $tg_db_version )
|
| 492 |
-
{
|
| 493 |
modula_lite_create_db_tables();
|
| 494 |
update_option( "Modula_db_version", $tg_db_version );
|
| 495 |
}
|
| 496 |
}
|
| 497 |
|
| 498 |
|
| 499 |
-
|
| 500 |
//Create Admin Menu
|
| 501 |
-
public function add_gallery_admin_menu()
|
| 502 |
-
|
| 503 |
-
|
|
|
|
|
|
|
| 504 |
|
| 505 |
|
| 506 |
-
if(! get_option( "Modula_skip_fix" ) && get_option( "Modula_db_version" ) && count($this->ModulaDB->getGalleries()) > 0) {
|
| 507 |
|
| 508 |
$imageUrl = null;
|
| 509 |
-
foreach($this->ModulaDB->getGalleries() as $gallery)
|
| 510 |
-
|
| 511 |
-
$
|
| 512 |
-
|
| 513 |
-
if(count($images) > 0) {
|
| 514 |
$imageUrl = $images[0]->imagePath;
|
| 515 |
break;
|
| 516 |
}
|
| 517 |
}
|
| 518 |
|
| 519 |
-
if($imageUrl)
|
| 520 |
-
|
| 521 |
-
|
| 522 |
-
|
| 523 |
-
|
| 524 |
-
|
|
|
|
| 525 |
}
|
| 526 |
}
|
| 527 |
} else {
|
| 528 |
-
add_option('Modula_skip_fix', true);
|
| 529 |
}
|
| 530 |
|
| 531 |
-
$
|
| 532 |
-
|
| 533 |
-
|
| 534 |
-
|
| 535 |
-
$
|
| 536 |
-
|
| 537 |
-
|
| 538 |
-
|
| 539 |
-
|
| 540 |
-
|
| 541 |
-
|
| 542 |
-
|
| 543 |
-
|
| 544 |
-
|
| 545 |
-
|
| 546 |
-
|
| 547 |
-
|
| 548 |
-
|
| 549 |
-
{
|
| 550 |
-
include("admin/overview.php");
|
| 551 |
-
}
|
| 552 |
-
|
| 553 |
-
public function other_galleries()
|
| 554 |
-
{
|
| 555 |
-
include("admin/galleries.php");
|
| 556 |
-
}
|
| 557 |
|
| 558 |
-
public function tutorial()
|
| 559 |
-
{
|
| 560 |
-
include("admin/tutorial.php");
|
| 561 |
}
|
| 562 |
|
| 563 |
-
|
| 564 |
-
{
|
| 565 |
-
include("admin/
|
| 566 |
}
|
| 567 |
|
| 568 |
-
public function
|
| 569 |
-
|
| 570 |
-
include("admin/add-gallery.php");
|
| 571 |
}
|
| 572 |
|
| 573 |
-
public function
|
| 574 |
-
|
| 575 |
-
include("admin/import.php");
|
| 576 |
}
|
| 577 |
|
| 578 |
-
public function fix()
|
| 579 |
-
{
|
| 580 |
global $wpdb;
|
| 581 |
-
include("admin/fix.php");
|
| 582 |
}
|
| 583 |
|
| 584 |
-
public function delete_image()
|
| 585 |
-
|
| 586 |
-
|
| 587 |
-
|
| 588 |
-
foreach (explode(",", $_POST["id"]) as $id) {
|
| 589 |
-
$this->ModulaDB->deleteImage(intval($id));
|
| 590 |
}
|
| 591 |
}
|
| 592 |
die();
|
| 593 |
}
|
| 594 |
|
| 595 |
-
public function add_image()
|
| 596 |
-
|
| 597 |
-
|
| 598 |
-
|
| 599 |
-
$
|
| 600 |
-
$this->loadedData = $this->ModulaDB->getGalleryById($gid, $this->defaultValues);
|
| 601 |
-
$prev = $this->ModulaDB->getImagesByGalleryId($gid);
|
| 602 |
|
| 603 |
-
$enc_images = stripslashes($_POST["enc_images"]);
|
| 604 |
-
$images
|
| 605 |
|
| 606 |
-
$d
|
| 607 |
-
$images = array_slice($images, 0, $d - count($prev));
|
| 608 |
$images = ModulaLiteTools::check_and_resize( $images, $this->loadedData->img_size );
|
| 609 |
-
$result = $this->ModulaDB->addImages($gid, $images);
|
| 610 |
|
| 611 |
-
header("Content-type: application/json");
|
| 612 |
-
if($result === false)
|
| 613 |
-
{
|
| 614 |
print "{\"success\":false}";
|
| 615 |
-
}
|
| 616 |
-
else
|
| 617 |
-
{
|
| 618 |
print "{\"success\":true}";
|
| 619 |
}
|
| 620 |
}
|
| 621 |
die();
|
| 622 |
}
|
| 623 |
|
| 624 |
-
public function sort_images()
|
| 625 |
-
|
| 626 |
-
|
| 627 |
-
{
|
| 628 |
-
$result = $this->ModulaDB->sortImages(explode(',', $_POST['ids']));
|
| 629 |
|
| 630 |
-
header("Content-type: application/json");
|
| 631 |
-
if($result === false)
|
| 632 |
-
{
|
| 633 |
print "{\"success\":false}";
|
| 634 |
-
}
|
| 635 |
-
else
|
| 636 |
-
{
|
| 637 |
print "{\"success\":true}";
|
| 638 |
}
|
| 639 |
}
|
| 640 |
die();
|
| 641 |
}
|
| 642 |
|
| 643 |
-
public function save_image()
|
| 644 |
-
|
| 645 |
-
if(check_admin_referer('Modula','Modula'))
|
| 646 |
-
{
|
| 647 |
$result = false;
|
| 648 |
// $type = $_POST['type'];
|
| 649 |
-
$imageUrl
|
| 650 |
-
$imageCaption = stripslashes($_POST['description']);
|
| 651 |
-
$title
|
| 652 |
-
$target
|
| 653 |
-
$link
|
| 654 |
-
$imageId
|
| 655 |
-
|
| 656 |
-
|
| 657 |
-
|
| 658 |
-
|
| 659 |
-
$data = array(
|
| 660 |
-
|
| 661 |
-
|
| 662 |
-
|
| 663 |
-
|
| 664 |
-
|
| 665 |
-
|
| 666 |
-
|
| 667 |
-
|
| 668 |
-
|
| 669 |
-
|
| 670 |
-
|
| 671 |
-
$
|
| 672 |
-
|
| 673 |
-
else
|
| 674 |
-
|
| 675 |
-
$
|
| 676 |
-
$result = $this->ModulaDB->addFullImage($data);
|
| 677 |
}
|
| 678 |
|
| 679 |
-
header("Content-type: application/json");
|
| 680 |
|
| 681 |
-
if($result === false)
|
| 682 |
-
{
|
| 683 |
print "{\"success\":false}";
|
| 684 |
-
}
|
| 685 |
-
else
|
| 686 |
-
{
|
| 687 |
print "{\"success\":true}";
|
| 688 |
}
|
| 689 |
|
|
@@ -691,584 +644,572 @@ if (!class_exists("ModulaLite"))
|
|
| 691 |
die();
|
| 692 |
}
|
| 693 |
|
| 694 |
-
public function list_images()
|
| 695 |
-
|
| 696 |
-
|
| 697 |
-
|
| 698 |
-
$gid = intval($_POST["gid"]);
|
| 699 |
-
$gallery = $this->ModulaDB->getGalleryById($gid, $this->defaultValues);
|
| 700 |
|
| 701 |
-
$imageResults = $this->ModulaDB->getImagesByGalleryId($gid);
|
| 702 |
|
| 703 |
-
include('admin/include/image-list.php');
|
| 704 |
}
|
| 705 |
die();
|
| 706 |
}
|
| 707 |
|
| 708 |
-
private function checkboxVal($field)
|
| 709 |
-
|
| 710 |
-
|
| 711 |
-
//return 'checked';
|
| 712 |
return 'T';
|
|
|
|
|
|
|
| 713 |
//return '';
|
| 714 |
return 'F';
|
| 715 |
}
|
| 716 |
|
| 717 |
-
public function save_gallery()
|
| 718 |
-
|
| 719 |
-
|
| 720 |
-
|
| 721 |
-
$
|
| 722 |
-
$
|
| 723 |
-
$
|
| 724 |
-
$
|
| 725 |
-
|
| 726 |
-
|
| 727 |
-
|
| 728 |
-
|
| 729 |
-
|
| 730 |
-
|
| 731 |
-
|
| 732 |
-
|
| 733 |
-
|
| 734 |
-
|
| 735 |
-
|
| 736 |
-
|
| 737 |
-
|
| 738 |
-
|
| 739 |
-
|
| 740 |
-
|
| 741 |
-
|
| 742 |
-
|
| 743 |
-
|
| 744 |
-
|
| 745 |
-
|
| 746 |
-
|
| 747 |
-
|
| 748 |
-
|
| 749 |
-
|
| 750 |
-
|
| 751 |
-
|
| 752 |
-
$
|
| 753 |
-
|
| 754 |
-
|
| 755 |
-
|
| 756 |
-
|
| 757 |
-
|
| 758 |
-
|
| 759 |
-
|
| 760 |
-
|
| 761 |
-
|
| 762 |
-
|
| 763 |
-
|
| 764 |
-
|
| 765 |
-
|
| 766 |
-
|
| 767 |
-
|
| 768 |
-
|
| 769 |
-
|
| 770 |
-
|
| 771 |
-
|
| 772 |
-
|
| 773 |
-
|
| 774 |
-
|
| 775 |
-
|
| 776 |
-
|
| 777 |
-
|
| 778 |
-
|
| 779 |
-
|
| 780 |
-
|
| 781 |
-
|
| 782 |
-
|
| 783 |
-
|
| 784 |
-
|
| 785 |
-
|
| 786 |
-
|
| 787 |
-
|
| 788 |
-
|
| 789 |
-
|
| 790 |
-
|
| 791 |
-
|
| 792 |
-
|
| 793 |
-
$result = $this->ModulaDB->editGallery($id, $data);
|
| 794 |
-
|
| 795 |
-
if(intval($this->loadedData->img_size) != $data['img_size'])
|
| 796 |
-
{
|
| 797 |
$images = $this->ModulaDB->getImagesByGalleryId( $id );
|
| 798 |
-
|
| 799 |
|
| 800 |
-
|
| 801 |
-
|
| 802 |
-
|
| 803 |
-
|
| 804 |
|
| 805 |
-
|
| 806 |
-
}
|
| 807 |
-
|
| 808 |
-
|
| 809 |
-
$result = $this->ModulaDB->addGallery($data);
|
| 810 |
-
$id = $this->ModulaDB->getNewGalleryId();
|
| 811 |
}
|
| 812 |
|
| 813 |
-
if($result)
|
| 814 |
-
print "{\"success\":true,\"id\":" . $id ."}";
|
| 815 |
-
else
|
| 816 |
print "{\"success\":false}";
|
|
|
|
| 817 |
}
|
| 818 |
die();
|
| 819 |
}
|
| 820 |
|
| 821 |
-
public function edit_gallery()
|
| 822 |
-
|
| 823 |
-
|
| 824 |
-
$
|
| 825 |
-
$modula_fields = $this->fields;
|
| 826 |
$modula_parent_page = "dashboard";
|
| 827 |
|
| 828 |
-
include("admin/edit-gallery.php");
|
| 829 |
} else {
|
| 830 |
-
$redir
|
| 831 |
$nobanner = true;
|
| 832 |
-
include("admin/overview.php");
|
| 833 |
-
}
|
| 834 |
}
|
| 835 |
|
| 836 |
-
public function list_thumbnail_sizes()
|
| 837 |
-
{
|
| 838 |
global $_wp_additional_image_sizes;
|
| 839 |
$sizes = array();
|
| 840 |
-
|
| 841 |
-
|
| 842 |
-
|
| 843 |
-
|
| 844 |
-
|
| 845 |
-
|
| 846 |
-
|
| 847 |
-
|
| 848 |
-
|
| 849 |
-
|
| 850 |
-
|
| 851 |
-
|
| 852 |
-
|
| 853 |
-
|
| 854 |
-
|
| 855 |
-
|
| 856 |
-
|
| 857 |
-
|
| 858 |
-
|
| 859 |
-
|
| 860 |
-
{
|
| 861 |
-
require_once('lib/gallery-class.php');
|
| 862 |
global $Modula;
|
| 863 |
|
| 864 |
-
if (class_exists( 'ModulaLiteFE' ))
|
| 865 |
-
|
| 866 |
-
$Modula = new ModulaLiteFE($this->ModulaDB, $atts['id'], $this->defaultValues);
|
| 867 |
|
| 868 |
$settings = $Modula->getGallery();
|
| 869 |
-
switch($settings->lightbox)
|
| 870 |
-
{
|
| 871 |
case "lightbox2":
|
| 872 |
-
wp_enqueue_style('lightbox2_stylesheet');
|
| 873 |
-
wp_enqueue_script('lightbox2_script');
|
| 874 |
break;
|
| 875 |
}
|
|
|
|
| 876 |
return $Modula->render();
|
| 877 |
-
}
|
| 878 |
-
else
|
| 879 |
-
{
|
| 880 |
return "Gallery not found.";
|
| 881 |
}
|
| 882 |
}
|
| 883 |
|
| 884 |
var $fields = array(
|
| 885 |
|
| 886 |
-
|
| 887 |
-
|
| 888 |
-
"fields" => array(
|
| 889 |
-
"name" => array(
|
| 890 |
-
"name" => "Name",
|
| 891 |
-
"type" => "text",
|
| 892 |
-
"description" => "Name of the gallery, for internal use.",
|
| 893 |
-
"excludeFrom" => array()
|
| 894 |
-
),
|
| 895 |
-
"description" => array(
|
| 896 |
-
"name" => "Description",
|
| 897 |
-
"type" => "text",
|
| 898 |
-
"description" => "This description is for internal use.",
|
| 899 |
-
"excludeFrom" => array()
|
| 900 |
-
),
|
| 901 |
-
"width" => array(
|
| 902 |
-
"name" => "Width",
|
| 903 |
-
"type" => "text",
|
| 904 |
-
"description" => "Width of the gallery (i.e.: 100% or 500px)",
|
| 905 |
-
"mu" => "px or %",
|
| 906 |
-
"excludeFrom" => array()
|
| 907 |
-
),
|
| 908 |
-
"height" => array(
|
| 909 |
-
"name" => "Height",
|
| 910 |
-
"type" => "number",
|
| 911 |
-
"description" => "Height of the gallery in pixels",
|
| 912 |
-
"mu" => "px",
|
| 913 |
-
"excludeFrom" => array()
|
| 914 |
-
),
|
| 915 |
-
"img_size" => array(
|
| 916 |
-
"name" => "Minimum image size",
|
| 917 |
-
"type" => "number",
|
| 918 |
-
"description" => "Minimum width or height of the images",
|
| 919 |
-
"mu" => "px or %",
|
| 920 |
-
"excludeFrom" => array()
|
| 921 |
-
),
|
| 922 |
-
"margin" => array(
|
| 923 |
-
"name" => "Margin",
|
| 924 |
-
"type" => "number",
|
| 925 |
-
"description" => "Margin between images",
|
| 926 |
-
"mu" => "px",
|
| 927 |
-
"excludeFrom" => array()
|
| 928 |
-
),
|
| 929 |
-
"randomFactor" => array(
|
| 930 |
-
"name" => "Random factor",
|
| 931 |
-
"type" => "ui-slider",
|
| 932 |
-
"description" => "",
|
| 933 |
-
"min" => 0,
|
| 934 |
-
"max" => 100,
|
| 935 |
-
"mu" => "%",
|
| 936 |
-
"default"=>20,
|
| 937 |
-
"excludeFrom" => array()
|
| 938 |
-
),
|
| 939 |
-
"filters" => array(
|
| 940 |
-
"name" => "Filters",
|
| 941 |
-
"type" => "PRO_FEATURE",
|
| 942 |
-
"description" => "Add your own filters here. Each image can have one or more filters.",
|
| 943 |
-
"excludeFrom" => array()
|
| 944 |
-
),
|
| 945 |
-
"filterClick" => array(
|
| 946 |
-
"name" => "Reload Page on filter click",
|
| 947 |
-
"type" => "PRO_FEATURE",
|
| 948 |
-
"description" => "Turn this feature ON if you want to use filters with most lightboxes",
|
| 949 |
-
"excludeFrom" => array()
|
| 950 |
-
),
|
| 951 |
-
"allFilterLabel" => array(
|
| 952 |
-
"name" => "Text for 'All' filter",
|
| 953 |
-
"type" => "PRO_FEATURE",
|
| 954 |
-
"description" => "Write here the label for the 'All' filter",
|
| 955 |
-
"default"=>"All",
|
| 956 |
-
"excludeFrom" => array()
|
| 957 |
-
),
|
| 958 |
-
"lightbox" => array(
|
| 959 |
-
"name" => "Lightbox & Links",
|
| 960 |
-
"type" => "select",
|
| 961 |
-
"description" => "<strong><a href='http://modula.greentreelabs.net/its-time-to-evolve/' target='_blank'>Buy Modula PRO</a> and get 5 more lightboxes!</strong><br>Define here what happens when user click on the images.",
|
| 962 |
-
"values" => array(
|
| 963 |
-
"Link" => array("|No link", "direct|Direct link to image", "|Attachment page"),
|
| 964 |
-
"Lightboxes" => array("lightbox2|Lightbox")
|
| 965 |
-
),
|
| 966 |
-
"disabled" => array(
|
| 967 |
-
"Lightboxes with PRO license" => array("magnific|Magnific popup", "prettyphoto|PrettyPhoto", "fancybox|FancyBox", "swipebox|SwipeBox", "lightbox2|Lightbox")
|
| 968 |
-
),
|
| 969 |
-
"excludeFrom" => array()
|
| 970 |
-
),
|
| 971 |
-
"shuffle" => array(
|
| 972 |
-
"name" => "Shuffle images",
|
| 973 |
-
"type" => "toggle",
|
| 974 |
-
"default" => "T",
|
| 975 |
-
"description" => "Flag it if you want to shuffle the gallery at each page load",
|
| 976 |
-
"excludeFrom" => array()
|
| 977 |
-
)
|
| 978 |
-
)
|
| 979 |
-
),
|
| 980 |
-
"Captions" => array(
|
| 981 |
-
"icon" => "mdi mdi-comment-text-outline",
|
| 982 |
-
"fields" => array(
|
| 983 |
-
"captionColor" => array(
|
| 984 |
-
"name" => "Caption color",
|
| 985 |
-
"type" => "color",
|
| 986 |
-
"description" => "Color of the caption.",
|
| 987 |
-
"default" => "#ffffff",
|
| 988 |
-
"excludeFrom" => array()
|
| 989 |
-
),
|
| 990 |
-
"wp_field_caption" => array(
|
| 991 |
-
"name" => "WordPress caption field",
|
| 992 |
-
"type" => "select",
|
| 993 |
-
"description" => "WordPress field used for captions. <strong>This field is used ONLY when images are added to the gallery, </strong> however, if you want to ignore captions just set it to '<i>Don't use captions</i>'.",
|
| 994 |
-
"values" => array(
|
| 995 |
-
"Field" => array("none|Don't use captions", "title|Title", "caption|Caption", "description|Description")
|
| 996 |
-
),
|
| 997 |
-
"excludeFrom" => array("shortcode")
|
| 998 |
-
),
|
| 999 |
-
"wp_field_title" => array(
|
| 1000 |
-
"name" => "WordPress title field",
|
| 1001 |
-
"type" => "select",
|
| 1002 |
-
"description" => "WordPress field used for titles. <strong>This field is used ONLY when images are added to the gallery, </strong> however, if you want to ignore titles just set it to '<i>Don't use titles</i>'.",
|
| 1003 |
-
"values" => array(
|
| 1004 |
-
"Field" => array("none|Don't use titles", "title|Title", "description|Description")
|
| 1005 |
-
),
|
| 1006 |
-
"excludeFrom" => array("shortcode")
|
| 1007 |
-
),
|
| 1008 |
-
"captionFontSize" => array(
|
| 1009 |
-
"name" => "Caption Font Size",
|
| 1010 |
-
"type" => "number",
|
| 1011 |
-
"description" => "",
|
| 1012 |
-
"mu" => "px",
|
| 1013 |
-
"excludeFrom" => array()
|
| 1014 |
-
),
|
| 1015 |
-
"titleFontSize" => array(
|
| 1016 |
-
"name" => "Title Font Size",
|
| 1017 |
-
"type" => "number",
|
| 1018 |
-
"description" => "",
|
| 1019 |
-
"mu" => "px",
|
| 1020 |
-
"excludeFrom" => array()
|
| 1021 |
-
),
|
| 1022 |
-
)
|
| 1023 |
-
|
| 1024 |
-
),
|
| 1025 |
-
"Social" => array(
|
| 1026 |
-
"icon" => "mdi mdi-link-variant",
|
| 1027 |
-
"fields" => array(
|
| 1028 |
-
"enableTwitter" => array(
|
| 1029 |
-
"name" => "Add Twitter icon",
|
| 1030 |
-
"type" => "toggle",
|
| 1031 |
-
"default" => "T",
|
| 1032 |
-
"description" => "Enable Twitter Sharing",
|
| 1033 |
-
"excludeFrom" => array()
|
| 1034 |
-
),
|
| 1035 |
-
"enableFacebook" => array(
|
| 1036 |
-
"name" => "Add Facebook icon",
|
| 1037 |
-
"type" => "toggle",
|
| 1038 |
-
"default" => "T",
|
| 1039 |
-
"description" => "Enable Facebook Sharing",
|
| 1040 |
-
"excludeFrom" => array()
|
| 1041 |
-
),
|
| 1042 |
-
"enableGplus" => array(
|
| 1043 |
-
"name" => "Add Google Plus icon",
|
| 1044 |
-
"type" => "toggle",
|
| 1045 |
-
"default" => "T",
|
| 1046 |
-
"description" => "Enable Google Plus Sharing",
|
| 1047 |
-
"excludeFrom" => array()
|
| 1048 |
-
),
|
| 1049 |
-
"enablePinterest" => array(
|
| 1050 |
-
"name" => "Add Pinterest icon",
|
| 1051 |
-
"type" => "toggle",
|
| 1052 |
-
"default" => "T",
|
| 1053 |
-
"description" => "Enable Pinterest Sharing",
|
| 1054 |
-
"excludeFrom" => array()
|
| 1055 |
-
),
|
| 1056 |
-
"socialIconColor" => array(
|
| 1057 |
-
"name" => "Color of social sharing icons",
|
| 1058 |
-
"type" => "color",
|
| 1059 |
-
"description" => "Set the color of the social sharing icons",
|
| 1060 |
-
"default" => "#ffffff",
|
| 1061 |
-
"excludeFrom" => array()
|
| 1062 |
-
)
|
| 1063 |
-
)
|
| 1064 |
-
|
| 1065 |
-
),
|
| 1066 |
-
"Image loaded effects" => array(
|
| 1067 |
-
"icon" => "mdi mdi-reload",
|
| 1068 |
"fields" => array(
|
| 1069 |
-
"
|
| 1070 |
-
"name"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1071 |
"description" => "Choose a value below 100% for a zoom-in effect. Choose a value over 100% for a zoom-out effect",
|
| 1072 |
-
"type"
|
| 1073 |
-
"min"
|
| 1074 |
-
"max"
|
| 1075 |
-
"mu"
|
| 1076 |
-
"default"=>100,
|
| 1077 |
-
"excludeFrom" => array()
|
| 1078 |
),
|
| 1079 |
"loadedRotate" => array(
|
| 1080 |
-
"name"
|
| 1081 |
"description" => "",
|
| 1082 |
-
"type"
|
| 1083 |
-
"min"
|
| 1084 |
-
"max"
|
| 1085 |
-
"default"
|
| 1086 |
-
"mu"
|
| 1087 |
-
"excludeFrom" => array()
|
| 1088 |
),
|
| 1089 |
"loadedHSlide" => array(
|
| 1090 |
-
"name"
|
| 1091 |
"description" => "",
|
| 1092 |
-
"type"
|
| 1093 |
-
"min"
|
| 1094 |
-
"max"
|
| 1095 |
-
"mu"
|
| 1096 |
-
"default"
|
| 1097 |
-
"excludeFrom" => array()
|
| 1098 |
),
|
| 1099 |
"loadedVSlide" => array(
|
| 1100 |
-
"name"
|
| 1101 |
"description" => "",
|
| 1102 |
-
"type"
|
| 1103 |
-
"min"
|
| 1104 |
-
"max"
|
| 1105 |
-
"mu"
|
| 1106 |
-
"default"
|
| 1107 |
-
"excludeFrom" => array()
|
| 1108 |
-
)
|
| 1109 |
-
|
| 1110 |
-
)
|
| 1111 |
),
|
| 1112 |
-
|
| 1113 |
-
"icon"
|
| 1114 |
"fields" => array(
|
| 1115 |
"Effect" => array(
|
| 1116 |
-
"name"
|
| 1117 |
"description" => "Select an hover effect",
|
| 1118 |
-
"type"
|
| 1119 |
-
"excludeFrom" => array()
|
| 1120 |
-
)
|
| 1121 |
-
)
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1122 |
),
|
| 1123 |
-
|
| 1124 |
-
|
| 1125 |
-
|
| 1126 |
-
|
| 1127 |
-
|
| 1128 |
-
|
| 1129 |
-
|
| 1130 |
-
"mu" => "px",
|
| 1131 |
-
"min" => 0,
|
| 1132 |
-
"max" => 10,
|
| 1133 |
-
"default" => 0,
|
| 1134 |
-
"excludeFrom" => array()
|
| 1135 |
-
),
|
| 1136 |
-
"borderRadius" => array(
|
| 1137 |
-
"name" => "Border Radius",
|
| 1138 |
-
"type" => "ui-slider",
|
| 1139 |
-
"description" => "",
|
| 1140 |
-
"mu" => "px",
|
| 1141 |
-
"min" => 0,
|
| 1142 |
-
"max" => 100,
|
| 1143 |
-
"default" => 0,
|
| 1144 |
-
"excludeFrom" => array()
|
| 1145 |
-
),
|
| 1146 |
-
"borderColor" => array(
|
| 1147 |
-
"name" => "Border Color",
|
| 1148 |
-
"type" => "color",
|
| 1149 |
-
"description" => "",
|
| 1150 |
-
"default" => "#ffffff",
|
| 1151 |
-
"excludeFrom" => array()
|
| 1152 |
-
),
|
| 1153 |
-
"shadowSize" => array(
|
| 1154 |
-
"name" => "Shadow Size",
|
| 1155 |
-
"type" => "ui-slider",
|
| 1156 |
-
"description" => "",
|
| 1157 |
-
"mu" => "px",
|
| 1158 |
-
"min" => 0,
|
| 1159 |
-
"max" => 20,
|
| 1160 |
-
"default" => 0,
|
| 1161 |
-
"excludeFrom" => array()
|
| 1162 |
-
),
|
| 1163 |
-
"shadowColor" => array(
|
| 1164 |
-
"name" => "Shadow Color",
|
| 1165 |
-
"type" => "color",
|
| 1166 |
-
"description" => "",
|
| 1167 |
-
"default" => "#ffffff",
|
| 1168 |
-
"excludeFrom" => array()
|
| 1169 |
-
),
|
| 1170 |
-
|
| 1171 |
-
)
|
| 1172 |
-
),
|
| 1173 |
-
"Customizations" => array(
|
| 1174 |
-
"icon" => "mdi mdi-puzzle",
|
| 1175 |
-
"fields" => array(
|
| 1176 |
-
"script" => array(
|
| 1177 |
-
"name" => "Custom scripts",
|
| 1178 |
-
"type" => "textarea",
|
| 1179 |
-
"description" => "This script will be called after the gallery initialization. Useful for custom lightboxes.
|
| 1180 |
<br />
|
| 1181 |
<br />
|
| 1182 |
<strong>Write just the code without using the <script></script> tags</strong>",
|
| 1183 |
-
|
| 1184 |
-
|
| 1185 |
-
|
| 1186 |
-
|
| 1187 |
-
|
| 1188 |
-
|
| 1189 |
-
|
| 1190 |
-
|
| 1191 |
-
|
| 1192 |
-
|
| 1193 |
-
|
| 1194 |
-
|
| 1195 |
}
|
| 1196 |
|
| 1197 |
-
class ModulaLiteHoverEffect
|
| 1198 |
-
|
| 1199 |
var $name;
|
| 1200 |
var $code;
|
| 1201 |
var $allowTitle;
|
| 1202 |
var $allowSubtitle;
|
| 1203 |
var $maxSocial;
|
| 1204 |
|
| 1205 |
-
public function __construct($name, $code, $allowTitle, $allowSubtitle, $maxSocial)
|
| 1206 |
-
|
| 1207 |
-
$this->
|
| 1208 |
-
$this->
|
| 1209 |
-
$this->allowTitle = $allowTitle;
|
| 1210 |
$this->allowSubtitle = $allowSubtitle;
|
| 1211 |
-
$this->maxSocial
|
| 1212 |
}
|
| 1213 |
}
|
| 1214 |
}
|
| 1215 |
|
| 1216 |
-
class ModulaLiteTools
|
| 1217 |
-
|
| 1218 |
-
public static function get_image_size_links($id)
|
| 1219 |
-
|
| 1220 |
-
$
|
| 1221 |
-
$sizes = get_intermediate_image_sizes();
|
| 1222 |
$sizes[] = 'full';
|
| 1223 |
|
| 1224 |
-
foreach ( $sizes as $size )
|
| 1225 |
-
{
|
| 1226 |
$image = wp_get_attachment_image_src( $id, $size );
|
| 1227 |
|
| 1228 |
-
if ( !empty( $image ) && ( true == $image[3] || 'full' == $size ) )
|
| 1229 |
$result["$image[1]x$image[2]"] = $image[0];
|
|
|
|
| 1230 |
}
|
| 1231 |
|
| 1232 |
return $result;
|
| 1233 |
}
|
| 1234 |
|
| 1235 |
-
public static function resize_image($id, $img_size)
|
| 1236 |
-
|
| 1237 |
-
$
|
| 1238 |
-
$
|
| 1239 |
-
$size
|
| 1240 |
-
|
| 1241 |
-
{
|
| 1242 |
-
$editor->resize(
|
| 1243 |
}
|
| 1244 |
-
|
| 1245 |
-
|
| 1246 |
-
|
|
|
|
|
|
|
| 1247 |
}
|
| 1248 |
-
$path_parts = pathinfo($file);
|
| 1249 |
-
$filename = $path_parts['dirname'] . "/" . $path_parts['filename'] . "-" . $img_size . "x" . $img_size . "." . $path_parts["extension"];
|
| 1250 |
|
| 1251 |
-
if(! file_exists( $filename ))
|
| 1252 |
-
$editor->save($filename);
|
| 1253 |
return basename( $filename );
|
| 1254 |
}
|
| 1255 |
|
| 1256 |
-
public static function check_and_resize(&$images, $size)
|
| 1257 |
-
|
| 1258 |
-
foreach ($images as &$img)
|
| 1259 |
-
{
|
| 1260 |
$metadata = wp_get_attachment_metadata( $img->imageId );
|
| 1261 |
|
| 1262 |
-
if($img->imageId > 0)
|
| 1263 |
-
{
|
| 1264 |
$wpdata = get_post( $img->imageId );
|
| 1265 |
$baseurl = str_replace( basename( $wpdata->guid ), "", $wpdata->guid );
|
| 1266 |
$res_name = ModulaLiteTools::resize_image( $img->imageId, $size );
|
| 1267 |
|
| 1268 |
-
if ( ! ( array_key_exists( "image_meta", $metadata ) &&
|
| 1269 |
-
array_key_exists( "resized_images", $metadata["image_meta"] ) &&
|
| 1270 |
-
in_array( $size . "x" . $size, $metadata["image_meta"]["resized_images"] ) )
|
| 1271 |
-
) {
|
| 1272 |
if ( isset( $metadata['image_meta'] ) ) {
|
| 1273 |
$md = $size . 'x' . $size;
|
| 1274 |
$metadata['image_meta']['resized_images'][] = $md;
|
|
@@ -1277,19 +1218,17 @@ class ModulaLiteTools
|
|
| 1277 |
}
|
| 1278 |
|
| 1279 |
$img->imagePath = $baseurl . $res_name;
|
| 1280 |
-
}
|
| 1281 |
-
|
| 1282 |
-
{
|
| 1283 |
-
$img->imagePath = preg_replace("/w=(\d+)/", "w=" . $size, $img->imagePath);
|
| 1284 |
}
|
| 1285 |
}
|
|
|
|
| 1286 |
return $images;
|
| 1287 |
}
|
| 1288 |
}
|
| 1289 |
|
| 1290 |
-
if (class_exists("ModulaLite"))
|
| 1291 |
-
|
| 1292 |
-
global $ob_ModulaLite;
|
| 1293 |
$ob_ModulaLite = new ModulaLite();
|
| 1294 |
}
|
| 1295 |
?>
|
| 1 |
<?php
|
| 2 |
/**
|
| 3 |
+
* Plugin Name: Gallery - A WordPress Modula Gallery
|
| 4 |
+
* Plugin URI: https://wp-modula.com/
|
| 5 |
+
* Description: Modula is one of the best & most creative WordPress gallery plugins. Use it to create a great grid or
|
| 6 |
+
* masonry image gallery.
|
| 7 |
+
* Author: Macho Themes
|
| 8 |
+
* Version: 1.2.0
|
| 9 |
+
* Author URI: https://www.machothemes.com/
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
define( 'MODULA_PLUGIN_DIR_PATH', plugin_dir_path( __FILE__ ) );
|
| 13 |
+
define( 'MODULA_PLUGIN_DIR_URL', plugin_dir_url( __FILE__ ) );
|
| 14 |
+
|
| 15 |
+
function modula_lite_create_db_tables() {
|
| 16 |
+
include_once( WP_PLUGIN_DIR . '/modula-best-grid-gallery/lib/install-db.php' );
|
| 17 |
modula_lite_install_db();
|
| 18 |
}
|
| 19 |
|
| 20 |
+
if ( ! class_exists( "ModulaLite" ) ) {
|
| 21 |
+
class ModulaLite {
|
| 22 |
+
|
| 23 |
+
private $loadedData;
|
| 24 |
+
|
| 25 |
+
private $version = "1.2.0";
|
| 26 |
+
|
| 27 |
+
private $defaultValues = array(
|
| 28 |
+
'width' => 100,
|
| 29 |
+
'height' => 800,
|
| 30 |
+
'img_size' => 500,
|
| 31 |
+
'margin' => 10,
|
| 32 |
+
'filters' => '',
|
| 33 |
+
'filterClick' => 'F',
|
| 34 |
+
'allFilterLabel' => 'All',
|
| 35 |
+
'lightbox' => 'lightbox2',
|
| 36 |
+
'shuffle' => 'F',
|
| 37 |
+
'captionColor' => '#ffffff',
|
| 38 |
+
'wp_field_caption' => 'caption',
|
| 39 |
+
'wp_field_title' => 'title',
|
| 40 |
+
'captionFontSize' => 14,
|
| 41 |
+
'titleFontSize' => 16,
|
| 42 |
+
'enableTwitter' => 'T',
|
| 43 |
+
'enableFacebook' => 'T',
|
| 44 |
+
'enableGplus' => 'T',
|
| 45 |
+
'enablePinterest' => 'T',
|
| 46 |
+
'socialIconColor' => '#ffffff',
|
| 47 |
+
'loadedScale' => 100,
|
| 48 |
+
'loadedRotate' => 0,
|
| 49 |
+
'loadedHSlide' => 0,
|
| 50 |
+
'loadedVSlide' => 0,
|
| 51 |
+
'borderSize' => 0,
|
| 52 |
+
'borderRadius' => 0,
|
| 53 |
+
'borderColor' => '#ffffff',
|
| 54 |
+
'shadowSize' => 0,
|
| 55 |
+
'shadowColor' => '#ffffff',
|
| 56 |
+
'style' => '',
|
| 57 |
+
'script' => '',
|
| 58 |
+
'randomFactor' => 50,
|
| 59 |
+
'hoverColor' => '#000000',
|
| 60 |
+
'hoverOpacity' => '50',
|
| 61 |
+
'hoverEffect' => 'pufrobo',
|
|
|
|
| 62 |
'hasResizedImages' => false,
|
| 63 |
+
'importedFrom' => '',
|
| 64 |
);
|
| 65 |
|
| 66 |
+
public function __construct() {
|
| 67 |
+
$this->plugin_name = plugin_basename( __FILE__ );
|
| 68 |
+
$this->plugin_url = plugins_url( '', __FILE__ );
|
|
|
|
| 69 |
$this->define_constants();
|
| 70 |
$this->define_db_tables();
|
| 71 |
$this->define_hover_effects();
|
| 72 |
$this->ModulaDB = $this->create_db_conn();
|
| 73 |
|
| 74 |
+
add_filter( 'widget_text', 'do_shortcode' );
|
| 75 |
+
add_filter( 'mce_buttons', array( $this, 'editor_button' ) );
|
| 76 |
+
add_filter( 'mce_external_plugins', array( $this, 'register_editor_plugin' ) );
|
| 77 |
|
| 78 |
+
add_action( 'init', array( $this, 'create_textdomain' ) );
|
| 79 |
|
| 80 |
+
add_action( 'wp_enqueue_scripts', array( $this, 'add_gallery_scripts' ) );
|
| 81 |
|
| 82 |
+
add_action( 'admin_menu', array( $this, 'add_gallery_admin_menu' ) );
|
| 83 |
|
| 84 |
+
add_shortcode( 'Modula', array( $this, 'gallery_shortcode_handler' ) );
|
| 85 |
|
| 86 |
+
add_action( 'wp_ajax_modula_save_gallery', array( $this, 'save_gallery' ) );
|
| 87 |
+
add_action( 'wp_ajax_modula_save_image', array( $this, 'save_image' ) );
|
| 88 |
+
add_action( 'wp_ajax_modula_add_image', array( $this, 'add_image' ) );
|
| 89 |
+
add_action( 'wp_ajax_modula_list_images', array( $this, 'list_images' ) );
|
| 90 |
+
add_action( 'wp_ajax_modula_sort_images', array( $this, 'sort_images' ) );
|
| 91 |
+
add_action( 'wp_ajax_modula_delete_image', array( $this, 'delete_image' ) );
|
| 92 |
+
add_action( 'wp_ajax_modula_resize_images', array( $this, 'resize_images' ) );
|
| 93 |
+
add_action( 'wp_ajax_modula_delete_gallery', array( $this, 'delete_gallery' ) );
|
| 94 |
+
add_action( 'wp_ajax_modula_clone_gallery', array( $this, 'clone_gallery' ) );
|
| 95 |
+
add_action( 'wp_ajax_modula_create_gallery', array( $this, 'create_gallery' ) );
|
| 96 |
+
add_action( 'wp_ajax_mtg_shortcode_editor', array( $this, 'mtg_shortcode_editor' ) );
|
| 97 |
+
add_action( 'wp_ajax_modula_get_config', array( $this, 'get_config' ) );
|
| 98 |
+
add_action( 'wp_ajax_modula_update_config', array( $this, 'update_config' ) );
|
| 99 |
+
add_action( 'wp_ajax_modula_get_ext_galleries', array( $this, 'get_ext_galleries' ) );
|
| 100 |
+
add_action( 'wp_ajax_modula_do_import_galleries', array( $this, 'do_import_galleries' ) );
|
| 101 |
|
| 102 |
+
add_filter( 'plugin_row_meta', array( $this, 'register_links' ), 10, 2 );
|
| 103 |
+
add_filter( 'admin_footer_text', array( $this, 'admin_footer' ), 1, 2 );
|
| 104 |
}
|
| 105 |
|
| 106 |
//Define textdomain
|
| 107 |
+
public function create_textdomain() {
|
| 108 |
+
$plugin_dir = basename( dirname( __FILE__ ) );
|
| 109 |
+
load_plugin_textdomain( 'modula-gallery', false, $plugin_dir . '/lib/languages' );
|
|
|
|
| 110 |
}
|
| 111 |
|
| 112 |
+
function define_hover_effects() {
|
| 113 |
+
$this->hoverEffects[] = new ModulaLiteHoverEffect( 'None', 'none', false, false, 0 );
|
| 114 |
+
$this->hoverEffects[] = new ModulaLiteHoverEffect( 'Pufrobo', 'pufrobo', true, true, 4 );
|
| 115 |
+
$this->hoverEffects[] = new ModulaLiteHoverEffect( 'Fluid Up', '', true, true, 0 );
|
| 116 |
+
$this->hoverEffects[] = new ModulaLiteHoverEffect( 'Hide', '', true, true, 4 );
|
| 117 |
+
$this->hoverEffects[] = new ModulaLiteHoverEffect( 'Quiet', '', true, false, 4 );
|
| 118 |
+
$this->hoverEffects[] = new ModulaLiteHoverEffect( 'Catinelle', '', false, false, 4 );
|
| 119 |
+
$this->hoverEffects[] = new ModulaLiteHoverEffect( 'Reflex', '', true, true, 4 );
|
| 120 |
+
$this->hoverEffects[] = new ModulaLiteHoverEffect( 'Curtain', '', true, false, 4 );
|
| 121 |
+
$this->hoverEffects[] = new ModulaLiteHoverEffect( 'Lens', '', true, true, 4 );
|
| 122 |
+
$this->hoverEffects[] = new ModulaLiteHoverEffect( 'Appear', '', true, false, 4 );
|
| 123 |
+
$this->hoverEffects[] = new ModulaLiteHoverEffect( 'Crafty', '', true, true, 0 );
|
| 124 |
+
$this->hoverEffects[] = new ModulaLiteHoverEffect( 'Seemo', '', true, false, 4 );
|
| 125 |
+
$this->hoverEffects[] = new ModulaLiteHoverEffect( 'Comodo', '', true, false, 4 );
|
|
|
|
| 126 |
}
|
| 127 |
|
| 128 |
+
public function get_ext_galleries() {
|
| 129 |
+
header( "Content-type: application/json" );
|
|
|
|
| 130 |
|
| 131 |
global $wpdb;
|
| 132 |
|
| 133 |
+
if ( check_admin_referer( "Modula", "Modula" ) ) {
|
|
|
|
| 134 |
$res = array( "success" => 0 );
|
| 135 |
|
| 136 |
$source = $_POST['source'];
|
| 141 |
switch ( $source ) {
|
| 142 |
case 'Envira':
|
| 143 |
$galleries = get_posts( array(
|
| 144 |
+
'post_type' => 'envira',
|
| 145 |
+
'posts_per_page' => 1000,
|
| 146 |
+
) );
|
| 147 |
foreach ( $galleries as $g ) {
|
| 148 |
$item = array();
|
| 149 |
$item['id'] = $g->ID;
|
| 152 |
}
|
| 153 |
break;
|
| 154 |
case 'NextGen':
|
| 155 |
+
$galleries = $wpdb->get_results( "SELECT title, gid FROM $wpdb->nggallery" );
|
| 156 |
foreach ( $galleries as $g ) {
|
| 157 |
$item = array();
|
| 158 |
$item['id'] = $g->gid;
|
| 168 |
die();
|
| 169 |
}
|
| 170 |
|
| 171 |
+
public function admin_footer( $text ) {
|
| 172 |
+
global $current_screen;
|
| 173 |
+
if ( ! empty( $current_screen->id ) && strpos( $current_screen->id, 'modula-lite' ) !== false ) {
|
| 174 |
+
$url = 'https://wordpress.org/support/plugin/modula-best-grid-gallery/reviews/?rate=5#new-post';
|
| 175 |
+
$text = sprintf( __( 'Please rate <strong>Modula Gallery</strong> <a href="%s" target="_blank">★★★★★</a> on <a href="%s" target="_blank">WordPress.org</a> to help us spread the word. Thank you, on behalf of the Modula team!', 'modula-gallery' ), $url, $url );
|
| 176 |
+
}
|
| 177 |
+
|
| 178 |
+
return $text;
|
| 179 |
+
}
|
| 180 |
+
|
| 181 |
+
public function do_import_galleries() {
|
| 182 |
global $wpdb;
|
| 183 |
|
| 184 |
+
header( "Content-type: application/json" );
|
| 185 |
+
if ( check_admin_referer( "Modula", "Modula" ) ) {
|
| 186 |
+
$res = array( "success" => 0 );
|
|
|
|
| 187 |
$source = $_POST['source'];
|
| 188 |
+
$ids = explode( ",", $_POST['ids'] );
|
| 189 |
+
switch ( $source ) {
|
|
|
|
| 190 |
case 'Envira':
|
| 191 |
+
foreach ( $ids as $id ) {
|
| 192 |
+
$gallery = get_post( $id );
|
| 193 |
+
$meta = get_post_meta( $id );
|
| 194 |
+
$data = unserialize( $meta['_eg_gallery_data'][0] );
|
| 195 |
+
|
| 196 |
+
$g = array(
|
| 197 |
+
'name' => $data['config']['title'],
|
| 198 |
+
'description' => 'Imported from Envira (' . $id . ') on ' . date( 'M, d Y' ),
|
| 199 |
+
'margin' => $data['config']['gutter'],
|
| 200 |
+
'hasResizedImages' => true,
|
| 201 |
+
'importedFrom' => 'Envira',
|
| 202 |
);
|
| 203 |
+
$gdb = array_merge( $this->defaultValues, $g );
|
| 204 |
|
| 205 |
+
$saved = $this->ModulaDB->addGallery( $gdb );
|
| 206 |
$newId = $this->ModulaDB->getNewGalleryId();
|
| 207 |
|
| 208 |
+
if ( $newId && count( $data['gallery'] ) ) {
|
|
|
|
| 209 |
$images = array();
|
| 210 |
//TODO only active images
|
| 211 |
+
foreach ( $data['gallery'] as $item ) {
|
| 212 |
+
$toAdd = new stdClass();
|
| 213 |
+
$toAdd->imageId = $this->ModulaDB->getIDbyGUID( $item['src'] );
|
| 214 |
+
$toAdd->title = $item['title'];
|
|
|
|
| 215 |
$toAdd->description = $item['caption'];
|
| 216 |
+
$toAdd->imagePath = $item['src'];
|
| 217 |
|
| 218 |
+
$images [] = $toAdd;
|
| 219 |
}
|
| 220 |
+
$imgResult = $this->ModulaDB->addImages( $newId, $images );
|
| 221 |
}
|
| 222 |
}
|
| 223 |
$res['success'] = 1;
|
| 224 |
break;
|
| 225 |
case 'NextGen':
|
| 226 |
+
foreach ( $ids as $id ) {
|
| 227 |
+
$gallery = $wpdb->get_row( $wpdb->prepare( "SELECT title, gid, path FROM $wpdb->nggallery WHERE gid=%s", $id ) );
|
|
|
|
|
|
|
|
|
|
| 228 |
|
| 229 |
+
$dbimages = $wpdb->get_results( $wpdb->prepare( "SELECT filename, description, alttext FROM $wpdb->nggpictures WHERE exclude <> 1 AND galleryid=%s", $id ) );
|
|
|
|
|
|
|
| 230 |
|
| 231 |
+
$g = array(
|
| 232 |
+
'name' => $gallery->title,
|
| 233 |
+
'description' => 'Imported from NextGet (' . $id . ') on ' . date( 'M, d Y' ),
|
| 234 |
+
'hasResizedImages' => true,
|
| 235 |
+
'importedFrom' => 'NextGen',
|
| 236 |
);
|
| 237 |
+
$gdb = array_merge( $this->defaultValues, $g );
|
| 238 |
|
| 239 |
+
$saved = $this->ModulaDB->addGallery( $gdb );
|
| 240 |
$newId = $this->ModulaDB->getNewGalleryId();
|
| 241 |
|
| 242 |
+
if ( $newId && count( $dbimages ) ) {
|
|
|
|
| 243 |
$images = array();
|
| 244 |
+
foreach ( $dbimages as $item ) {
|
| 245 |
+
$toAdd = new stdClass();
|
| 246 |
+
$toAdd->imageId = - 1;
|
| 247 |
+
$toAdd->title = $item->alttext;
|
|
|
|
| 248 |
$toAdd->description = $item->description;
|
| 249 |
+
$toAdd->imagePath = plugins_url( 'image.php', __FILE__ ) . "?w=" . $this->defaultValues['img_size'] . "&src=" . $gallery->path . "/" . $item->filename;
|
| 250 |
|
| 251 |
+
$images [] = $toAdd;
|
| 252 |
}
|
| 253 |
+
$imgResult = $this->ModulaDB->addImages( $newId, $images );
|
| 254 |
|
| 255 |
}
|
| 256 |
}
|
| 258 |
break;
|
| 259 |
}
|
| 260 |
|
| 261 |
+
echo json_encode( $res );
|
| 262 |
}
|
| 263 |
die();
|
| 264 |
}
|
| 265 |
|
| 266 |
+
public function register_links( $links, $file ) {
|
| 267 |
+
$base = plugin_basename( __FILE__ );
|
| 268 |
+
if ( $file == $base ) {
|
| 269 |
+
$links[] = '<a href="admin.php?page=modula-lite-admin" title="Modula Grid Gallery Dashboard">Dashboard</a>';
|
| 270 |
+
$links[] = '<a href="https://twitter.com/MachoThemez" title="@MachoThemez on Twitter">Twitter</a>';
|
| 271 |
+
$links[] = '<a href="https://www.facebook.com/machothemes" title="MachoThemes on Facebook">Facebook</a>';
|
| 272 |
+
}
|
| 273 |
+
|
| 274 |
+
return $links;
|
|
|
|
| 275 |
|
| 276 |
}
|
| 277 |
|
| 278 |
//delete gallery
|
| 279 |
+
function delete_gallery() {
|
| 280 |
+
if ( check_admin_referer( "Modula", "Modula" ) ) {
|
| 281 |
+
$id = intval( $_POST['gid'] );
|
| 282 |
+
$this->ModulaDB->deleteGallery( $id );
|
|
|
|
|
|
|
| 283 |
}
|
| 284 |
|
| 285 |
die();
|
| 286 |
}
|
| 287 |
|
| 288 |
+
public function update_config() {
|
| 289 |
+
if ( check_admin_referer( "Modula", "Modula" ) ) {
|
| 290 |
+
$id = $_POST['id'];
|
| 291 |
+
$config = stripslashes( $_POST['config'] );
|
|
|
|
|
|
|
| 292 |
|
| 293 |
+
$this->ModulaDB->update_config( $id, $config );
|
| 294 |
}
|
| 295 |
|
| 296 |
die();
|
| 297 |
}
|
| 298 |
|
| 299 |
+
public function get_config() {
|
| 300 |
+
if ( check_admin_referer( "Modula", "Modula" ) ) {
|
| 301 |
+
$id = $_POST['id'];
|
|
|
|
|
|
|
| 302 |
|
| 303 |
+
$data = $this->ModulaDB->getConfig( $id );
|
| 304 |
|
| 305 |
+
print json_encode( $data );
|
| 306 |
|
| 307 |
}
|
| 308 |
|
| 311 |
|
| 312 |
//add gallery
|
| 313 |
|
| 314 |
+
function create_gallery() {
|
| 315 |
+
if ( check_admin_referer( "Modula", "Modula" ) ) {
|
| 316 |
+
$data = $this->defaultValues;
|
| 317 |
+
$data["name"] = $_POST['name'];
|
| 318 |
+
$data["description"] = $_POST['description'];
|
| 319 |
+
$data["width"] = $_POST['width'];
|
| 320 |
+
$data["height"] = $_POST['height'];
|
| 321 |
+
$data["img_size"] = intval( $_POST['img_size'] );
|
|
|
|
|
|
|
| 322 |
$data["hasResizedImages"] = true;
|
| 323 |
|
| 324 |
+
$this->ModulaDB->addGallery( $data );
|
| 325 |
$id = $this->ModulaDB->getLastGalleryId()->Id;
|
| 326 |
|
| 327 |
+
if ( $id > 0 && array_key_exists( 'images', $_POST ) && strlen( $_POST['images'] ) ) {
|
| 328 |
+
$enc_images = stripslashes( $_POST["images"] );
|
| 329 |
+
$images = array_splice( json_decode( $enc_images ), 0, 11 + 9 );
|
|
|
|
| 330 |
ModulaLiteTools::check_and_resize( $images, $data['img_size'] );
|
| 331 |
+
$result = $this->ModulaDB->addImages( $id, $images );
|
| 332 |
}
|
| 333 |
print $id;
|
| 334 |
}
|
| 336 |
}
|
| 337 |
|
| 338 |
//clone gallery
|
| 339 |
+
function clone_gallery() {
|
| 340 |
+
if ( check_admin_referer( 'Modula', 'Modula' ) ) {
|
| 341 |
+
$sourceId = intval( $_POST['gid'] );
|
| 342 |
+
$g = $this->ModulaDB->getGalleryById( $sourceId, $this->defaultValues );
|
| 343 |
+
$g->name .= "(copy)";
|
| 344 |
+
$this->ModulaDB->addGallery( $g );
|
| 345 |
+
$id = $this->ModulaDB->getNewGalleryId();
|
| 346 |
+
$images = $this->ModulaDB->getImagesByGalleryId( $sourceId );
|
| 347 |
+
|
| 348 |
+
foreach ( $images as &$image ) {
|
| 349 |
+
$image->Id = null;
|
|
|
|
|
|
|
|
|
|
| 350 |
$image->gid = $id;
|
| 351 |
}
|
| 352 |
|
| 353 |
+
$this->ModulaDB->addImages( $id, $images );
|
| 354 |
}
|
| 355 |
|
| 356 |
die();
|
| 358 |
|
| 359 |
|
| 360 |
//Define constants
|
| 361 |
+
public function define_constants() {
|
| 362 |
+
if ( ! defined( 'Modula_PLUGIN_BASENAME' ) ) {
|
|
|
|
| 363 |
define( 'Modula_PLUGIN_BASENAME', plugin_basename( __FILE__ ) );
|
| 364 |
+
}
|
| 365 |
|
| 366 |
+
if ( ! defined( 'Modula_PLUGIN_NAME' ) ) {
|
| 367 |
define( 'Modula_PLUGIN_NAME', trim( dirname( Modula_PLUGIN_BASENAME ), '/' ) );
|
| 368 |
+
}
|
| 369 |
|
| 370 |
+
if ( ! defined( 'Modula_PLUGIN_DIR' ) ) {
|
| 371 |
define( 'Modula_PLUGIN_DIR', WP_PLUGIN_DIR . '/' . Modula_PLUGIN_NAME );
|
| 372 |
+
}
|
| 373 |
}
|
| 374 |
|
| 375 |
//delete Gallery
|
| 376 |
|
| 377 |
|
|
|
|
| 378 |
//Define DB tables
|
| 379 |
+
public function define_db_tables() {
|
|
|
|
| 380 |
global $wpdb;
|
| 381 |
|
| 382 |
$wpdb->ModulaGalleries = $wpdb->prefix . 'modula';
|
| 383 |
+
$wpdb->ModulaImages = $wpdb->prefix . 'modula_images';
|
| 384 |
}
|
| 385 |
|
| 386 |
|
| 387 |
+
public function create_db_conn() {
|
| 388 |
+
require( 'lib/db-class.php' );
|
|
|
|
| 389 |
$ModulaDB = ModulaLiteDB::getInstance();
|
| 390 |
+
|
| 391 |
return $ModulaDB;
|
| 392 |
}
|
| 393 |
|
| 394 |
+
public function editor_button( $buttons ) {
|
| 395 |
+
array_push( $buttons, 'separator', 'mtg_shortcode_editor' );
|
| 396 |
+
|
| 397 |
return $buttons;
|
| 398 |
}
|
| 399 |
|
| 400 |
+
public function register_editor_plugin( $plugin_array ) {
|
| 401 |
+
$plugin_array['mtg_shortcode_editor'] = plugins_url( '/admin/scripts/editor-plugin.js', __file__ );
|
| 402 |
+
|
| 403 |
return $plugin_array;
|
| 404 |
}
|
| 405 |
|
| 406 |
+
public function mtg_shortcode_editor() {
|
| 407 |
+
$css_path = plugins_url( 'assets/css/admin.css', __FILE__ );
|
|
|
|
| 408 |
$admin_url = admin_url();
|
| 409 |
|
| 410 |
$galleries = $this->ModulaDB->getGalleries(); //load all galleries
|
| 414 |
}
|
| 415 |
|
| 416 |
//Add gallery scripts
|
| 417 |
+
public function add_gallery_scripts() {
|
| 418 |
+
wp_enqueue_script( 'jquery' );
|
|
|
|
| 419 |
|
| 420 |
+
wp_register_script( 'modula', plugins_url() . '/modula-best-grid-gallery/scripts/jquery.modula.js', array( 'jquery' ) );
|
| 421 |
+
wp_enqueue_script( 'modula' );
|
| 422 |
|
| 423 |
|
| 424 |
+
wp_register_style( 'modula_stylesheet', plugins_url() . '/modula-best-grid-gallery/scripts/modula.css' );
|
| 425 |
+
wp_enqueue_style( 'modula_stylesheet' );
|
| 426 |
|
| 427 |
+
wp_register_style( 'effects_stylesheet', plugins_url() . '/modula-best-grid-gallery/scripts/effects.css', null, $this->version );
|
| 428 |
+
wp_enqueue_style( 'effects_stylesheet' );
|
| 429 |
|
| 430 |
+
wp_register_script( 'lightbox2_script', plugins_url() . '/modula-best-grid-gallery/lightbox/lightbox2/js/script.js', array( 'jquery' ) );
|
| 431 |
+
wp_register_style( 'lightbox2_stylesheet', plugins_url() . '/modula-best-grid-gallery/lightbox/lightbox2/css/style.css' );
|
| 432 |
}
|
| 433 |
|
| 434 |
//Admin Section - register scripts and styles
|
| 435 |
+
public function gallery_admin_init() {
|
| 436 |
+
if ( function_exists( 'wp_enqueue_media' ) ) {
|
|
|
|
|
|
|
| 437 |
wp_enqueue_media();
|
| 438 |
}
|
| 439 |
|
| 440 |
+
wp_enqueue_script( 'jquery' );
|
| 441 |
|
| 442 |
wp_enqueue_script( 'wp-color-picker' );
|
| 443 |
wp_enqueue_style( 'wp-color-picker' );
|
| 444 |
|
| 445 |
+
wp_enqueue_script( 'media-upload' );
|
| 446 |
+
wp_enqueue_script( 'thickbox' );
|
| 447 |
|
| 448 |
+
wp_register_style( 'materialize', plugins_url() . '/modula-best-grid-gallery/admin/css/materialize.css' );
|
| 449 |
+
wp_enqueue_style( 'materialize' );
|
| 450 |
|
| 451 |
+
wp_register_style( 'styles', plugins_url() . '/modula-best-grid-gallery/admin/css/style.css' );
|
| 452 |
+
wp_enqueue_style( 'styles' );
|
| 453 |
|
| 454 |
+
wp_register_style( 'effects', plugins_url() . '/modula-best-grid-gallery/scripts/effects.css' );
|
| 455 |
+
wp_enqueue_style( 'effects' );
|
| 456 |
|
| 457 |
+
wp_register_script( 'materialize', plugins_url() . '/modula-best-grid-gallery/admin/scripts/materialize.js', array( 'jquery' ) );
|
|
|
|
| 458 |
|
| 459 |
+
wp_register_script( 'modula', plugins_url() . '/modula-best-grid-gallery/admin/scripts/modula-admin.js', array(
|
| 460 |
+
'materialize',
|
| 461 |
+
'jquery',
|
| 462 |
+
'media-upload',
|
| 463 |
+
'thickbox',
|
| 464 |
+
), false, false );
|
| 465 |
|
| 466 |
+
wp_enqueue_script( 'modula' );
|
|
|
|
| 467 |
|
| 468 |
+
wp_register_style( 'materialdesign-icons', plugins_url() . '/modula-best-grid-gallery/admin/css/materialdesignicons.css' );
|
| 469 |
+
wp_enqueue_style( 'materialdesign-icons' );
|
| 470 |
+
|
| 471 |
+
wp_enqueue_style( 'thickbox' );
|
| 472 |
|
| 473 |
$tg_db_version = '1.0';
|
| 474 |
$installed_ver = get_option( "Modula_db_version" );
|
| 475 |
|
| 476 |
+
if ( $installed_ver != $tg_db_version ) {
|
|
|
|
| 477 |
modula_lite_create_db_tables();
|
| 478 |
update_option( "Modula_db_version", $tg_db_version );
|
| 479 |
}
|
| 480 |
}
|
| 481 |
|
| 482 |
|
|
|
|
| 483 |
//Create Admin Menu
|
| 484 |
+
public function add_gallery_admin_menu() {
|
| 485 |
+
$overview = add_menu_page( 'Manage Galleries', 'Modula', 'edit_posts', 'modula-lite-admin', array(
|
| 486 |
+
$this,
|
| 487 |
+
'add_overview',
|
| 488 |
+
), plugins_url() . '/modula-best-grid-gallery/admin/icon.png' );
|
| 489 |
|
| 490 |
|
| 491 |
+
if ( ! get_option( "Modula_skip_fix" ) && get_option( "Modula_db_version" ) && count( $this->ModulaDB->getGalleries() ) > 0 ) {
|
| 492 |
|
| 493 |
$imageUrl = null;
|
| 494 |
+
foreach ( $this->ModulaDB->getGalleries() as $gallery ) {
|
| 495 |
+
$gid = $gallery->Id;
|
| 496 |
+
$images = $this->ModulaDB->getImagesByGalleryId( $gid );
|
| 497 |
+
if ( count( $images ) > 0 ) {
|
|
|
|
| 498 |
$imageUrl = $images[0]->imagePath;
|
| 499 |
break;
|
| 500 |
}
|
| 501 |
}
|
| 502 |
|
| 503 |
+
if ( $imageUrl ) {
|
| 504 |
+
if ( strncmp( strtolower( $imageUrl ), strtolower( site_url() ), strlen( site_url() ) ) != 0 ) {
|
| 505 |
+
$fix = add_submenu_page( 'modula-lite-admin', __( 'Modula >> Fix', 'Modula' ), '❗️ ' . __( 'Fix', 'Modula' ), 'edit_posts', 'modula-lite-gallery-fix', array(
|
| 506 |
+
$this,
|
| 507 |
+
'fix',
|
| 508 |
+
) );
|
| 509 |
+
add_action( 'load-' . $fix, array( $this, 'gallery_admin_init' ) );
|
| 510 |
}
|
| 511 |
}
|
| 512 |
} else {
|
| 513 |
+
add_option( 'Modula_skip_fix', true );
|
| 514 |
}
|
| 515 |
|
| 516 |
+
$add_gallery = add_submenu_page( 'modula-lite-admin', __( 'Modula - Add Gallery', 'Modula' ), __( 'Add Gallery', 'Modula' ), 'edit_posts', 'modula-lite-add', array(
|
| 517 |
+
$this,
|
| 518 |
+
'add_gallery',
|
| 519 |
+
) );
|
| 520 |
+
$edit_gallery = add_submenu_page( 'modula-lite-admin', __( 'Modula - Edit Gallery', 'Modula' ), __( 'Edit Gallery', 'Modula' ), 'edit_posts', 'modula-lite-edit', array(
|
| 521 |
+
$this,
|
| 522 |
+
'edit_gallery',
|
| 523 |
+
) );
|
| 524 |
+
$upgrade = add_submenu_page( 'modula-lite-admin', __( 'Modula - Upgrade to PRO', 'Modula' ), __( 'Upgrade to PRO', 'Modula' ), 'edit_posts', 'modula-lite-gallery-upgrade', array(
|
| 525 |
+
$this,
|
| 526 |
+
'upgrade',
|
| 527 |
+
) );
|
| 528 |
+
|
| 529 |
+
|
| 530 |
+
add_action( 'load-' . $overview, array( $this, 'gallery_admin_init' ) );
|
| 531 |
+
add_action( 'load-' . $add_gallery, array( $this, 'gallery_admin_init' ) );
|
| 532 |
+
add_action( 'load-' . $edit_gallery, array( $this, 'gallery_admin_init' ) );
|
| 533 |
+
add_action( 'load-' . $upgrade, array( $this, 'gallery_admin_init' ) );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 534 |
|
|
|
|
|
|
|
|
|
|
| 535 |
}
|
| 536 |
|
| 537 |
+
//Create Admin Pages
|
| 538 |
+
public function add_overview() {
|
| 539 |
+
include( "admin/overview.php" );
|
| 540 |
}
|
| 541 |
|
| 542 |
+
public function upgrade() {
|
| 543 |
+
include( "admin/upgrade.php" );
|
|
|
|
| 544 |
}
|
| 545 |
|
| 546 |
+
public function add_gallery() {
|
| 547 |
+
include( "admin/add-gallery.php" );
|
|
|
|
| 548 |
}
|
| 549 |
|
| 550 |
+
public function fix() {
|
|
|
|
| 551 |
global $wpdb;
|
| 552 |
+
include( "admin/fix.php" );
|
| 553 |
}
|
| 554 |
|
| 555 |
+
public function delete_image() {
|
| 556 |
+
if ( check_admin_referer( 'Modula', 'Modula' ) ) {
|
| 557 |
+
foreach ( explode( ",", $_POST["id"] ) as $id ) {
|
| 558 |
+
$this->ModulaDB->deleteImage( intval( $id ) );
|
|
|
|
|
|
|
| 559 |
}
|
| 560 |
}
|
| 561 |
die();
|
| 562 |
}
|
| 563 |
|
| 564 |
+
public function add_image() {
|
| 565 |
+
if ( check_admin_referer( 'Modula', 'Modula' ) ) {
|
| 566 |
+
$gid = intval( $_POST['galleryId'] );
|
| 567 |
+
$this->loadedData = $this->ModulaDB->getGalleryById( $gid, $this->defaultValues );
|
| 568 |
+
$prev = $this->ModulaDB->getImagesByGalleryId( $gid );
|
|
|
|
|
|
|
| 569 |
|
| 570 |
+
$enc_images = stripslashes( $_POST["enc_images"] );
|
| 571 |
+
$images = json_decode( $enc_images );
|
| 572 |
|
| 573 |
+
$d = 18 + log10( 100 );
|
| 574 |
+
$images = array_slice( $images, 0, $d - count( $prev ) );
|
| 575 |
$images = ModulaLiteTools::check_and_resize( $images, $this->loadedData->img_size );
|
| 576 |
+
$result = $this->ModulaDB->addImages( $gid, $images );
|
| 577 |
|
| 578 |
+
header( "Content-type: application/json" );
|
| 579 |
+
if ( $result === false ) {
|
|
|
|
| 580 |
print "{\"success\":false}";
|
| 581 |
+
} else {
|
|
|
|
|
|
|
| 582 |
print "{\"success\":true}";
|
| 583 |
}
|
| 584 |
}
|
| 585 |
die();
|
| 586 |
}
|
| 587 |
|
| 588 |
+
public function sort_images() {
|
| 589 |
+
if ( check_admin_referer( 'Modula', 'Modula' ) ) {
|
| 590 |
+
$result = $this->ModulaDB->sortImages( explode( ',', $_POST['ids'] ) );
|
|
|
|
|
|
|
| 591 |
|
| 592 |
+
header( "Content-type: application/json" );
|
| 593 |
+
if ( $result === false ) {
|
|
|
|
| 594 |
print "{\"success\":false}";
|
| 595 |
+
} else {
|
|
|
|
|
|
|
| 596 |
print "{\"success\":true}";
|
| 597 |
}
|
| 598 |
}
|
| 599 |
die();
|
| 600 |
}
|
| 601 |
|
| 602 |
+
public function save_image() {
|
| 603 |
+
if ( check_admin_referer( 'Modula', 'Modula' ) ) {
|
|
|
|
|
|
|
| 604 |
$result = false;
|
| 605 |
// $type = $_POST['type'];
|
| 606 |
+
$imageUrl = stripslashes( $_POST['img_url'] );
|
| 607 |
+
$imageCaption = stripslashes( $_POST['description'] );
|
| 608 |
+
$title = $_POST['title'];
|
| 609 |
+
$target = $_POST['target'];
|
| 610 |
+
$link = isset( $_POST['link'] ) ? stripslashes( $_POST['link'] ) : null;
|
| 611 |
+
$imageId = intval( $_POST['img_id'] );
|
| 612 |
+
$sortOrder = intval( $_POST['sortOrder'] );
|
| 613 |
+
$halign = $_POST['halign'];
|
| 614 |
+
$valign = $_POST['valign'];
|
| 615 |
+
|
| 616 |
+
$data = array(
|
| 617 |
+
"target" => $target,
|
| 618 |
+
"link" => $link,
|
| 619 |
+
"imageId" => $imageId,
|
| 620 |
+
"description" => $imageCaption,
|
| 621 |
+
'title' => $title,
|
| 622 |
+
"halign" => $halign,
|
| 623 |
+
"valign" => $valign,
|
| 624 |
+
"sortOrder" => $sortOrder,
|
| 625 |
+
);
|
| 626 |
+
|
| 627 |
+
if ( ! empty( $_POST['id'] ) ) {
|
| 628 |
+
$imageId = intval( $_POST['id'] );
|
| 629 |
+
$result = $this->ModulaDB->editImage( $imageId, $data );
|
| 630 |
+
} else {
|
| 631 |
+
$data["gid"] = intval( $_POST['galleryId'] );
|
| 632 |
+
$result = $this->ModulaDB->addFullImage( $data );
|
|
|
|
| 633 |
}
|
| 634 |
|
| 635 |
+
header( "Content-type: application/json" );
|
| 636 |
|
| 637 |
+
if ( $result === false ) {
|
|
|
|
| 638 |
print "{\"success\":false}";
|
| 639 |
+
} else {
|
|
|
|
|
|
|
| 640 |
print "{\"success\":true}";
|
| 641 |
}
|
| 642 |
|
| 644 |
die();
|
| 645 |
}
|
| 646 |
|
| 647 |
+
public function list_images() {
|
| 648 |
+
if ( check_admin_referer( 'Modula', 'Modula' ) ) {
|
| 649 |
+
$gid = intval( $_POST["gid"] );
|
| 650 |
+
$gallery = $this->ModulaDB->getGalleryById( $gid, $this->defaultValues );
|
|
|
|
|
|
|
| 651 |
|
| 652 |
+
$imageResults = $this->ModulaDB->getImagesByGalleryId( $gid );
|
| 653 |
|
| 654 |
+
include( 'admin/include/image-list.php' );
|
| 655 |
}
|
| 656 |
die();
|
| 657 |
}
|
| 658 |
|
| 659 |
+
private function checkboxVal( $field ) {
|
| 660 |
+
if ( isset( $_POST[ $field ] ) ) //return 'checked';
|
| 661 |
+
{
|
|
|
|
| 662 |
return 'T';
|
| 663 |
+
}
|
| 664 |
+
|
| 665 |
//return '';
|
| 666 |
return 'F';
|
| 667 |
}
|
| 668 |
|
| 669 |
+
public function save_gallery() {
|
| 670 |
+
if ( check_admin_referer( 'Modula', 'Modula' ) ) {
|
| 671 |
+
$galleryName = stripslashes( $_POST['tg_name'] );
|
| 672 |
+
$galleryDescription = stripslashes( $_POST['tg_description'] );
|
| 673 |
+
$slug = strtolower( str_replace( " ", "", $galleryName ) );
|
| 674 |
+
$margin = intval( $_POST['tg_margin'] );
|
| 675 |
+
$shuffle = $this->checkboxVal( 'tg_shuffle' );
|
| 676 |
+
$width = $_POST['tg_width'];
|
| 677 |
+
$height = $_POST['tg_height'];
|
| 678 |
+
$enableTwitter = $this->checkboxVal( 'tg_enableTwitter' );
|
| 679 |
+
$enableFacebook = $this->checkboxVal( 'tg_enableFacebook' );
|
| 680 |
+
$enableGplus = $this->checkboxVal( 'tg_enableGplus' );
|
| 681 |
+
$enablePinterest = $this->checkboxVal( 'tg_enablePinterest' );
|
| 682 |
+
$lightbox = $_POST['tg_lightbox'];
|
| 683 |
+
$wp_field_caption = $_POST['tg_wp_field_caption'];
|
| 684 |
+
$wp_field_title = $_POST['tg_wp_field_title'];
|
| 685 |
+
$captionColor = $_POST['tg_captionColor'];
|
| 686 |
+
$borderSize = intval( $_POST['tg_borderSize'] );
|
| 687 |
+
$loadedScale = intval( $_POST['tg_loadedScale'] );
|
| 688 |
+
$loadedRotate = intval( $_POST['tg_loadedRotate'] );
|
| 689 |
+
$loadedVSlide = intval( $_POST['tg_loadedVSlide'] );
|
| 690 |
+
$loadedHSlide = intval( $_POST['tg_loadedHSlide'] );
|
| 691 |
+
$socialIconColor = $_POST['tg_socialIconColor'];
|
| 692 |
+
$hoverEffect = $_POST['tg_hoverEffect'];
|
| 693 |
+
$titleFontSize = intval( $_POST['tg_titleFontSize'] );
|
| 694 |
+
$captionFontSize = intval( $_POST['tg_captionFontSize'] );
|
| 695 |
+
$borderColor = $_POST['tg_borderColor'];
|
| 696 |
+
$borderRadius = intval( $_POST['tg_borderRadius'] );
|
| 697 |
+
$shadowColor = $_POST['tg_shadowColor'];
|
| 698 |
+
$shadowSize = intval( $_POST['tg_shadowSize'] );
|
| 699 |
+
$style = $_POST['tg_style'];
|
| 700 |
+
$script = $_POST['tg_script'];
|
| 701 |
+
|
| 702 |
+
$id = isset( $_POST['ftg_gallery_edit'] ) ? intval( $_POST['ftg_gallery_edit'] ) : 0;
|
| 703 |
+
|
| 704 |
+
$data = array(
|
| 705 |
+
'name' => $galleryName,
|
| 706 |
+
'slug' => $slug,
|
| 707 |
+
'description' => $galleryDescription,
|
| 708 |
+
'lightbox' => $lightbox,
|
| 709 |
+
'img_size' => intval( $_POST['tg_img_size'] ),
|
| 710 |
+
'hasResizedImages' => true,
|
| 711 |
+
'wp_field_caption' => $wp_field_caption,
|
| 712 |
+
'wp_field_title' => $wp_field_title,
|
| 713 |
+
'margin' => $margin,
|
| 714 |
+
'randomFactor' => $_POST['tg_randomFactor'],
|
| 715 |
+
'shuffle' => $shuffle,
|
| 716 |
+
'enableTwitter' => $enableTwitter,
|
| 717 |
+
'enableFacebook' => $enableFacebook,
|
| 718 |
+
'enableGplus' => $enableGplus,
|
| 719 |
+
'enablePinterest' => $enablePinterest,
|
| 720 |
+
'captionColor' => $captionColor,
|
| 721 |
+
'hoverEffect' => $hoverEffect,
|
| 722 |
+
'borderSize' => $borderSize,
|
| 723 |
+
'loadedScale' => $loadedScale,
|
| 724 |
+
'loadedHSlide' => $loadedHSlide,
|
| 725 |
+
'loadedVSlide' => $loadedVSlide,
|
| 726 |
+
'loadedRotate' => $loadedRotate,
|
| 727 |
+
'socialIconColor' => $socialIconColor,
|
| 728 |
+
'captionFontSize' => $captionFontSize,
|
| 729 |
+
'titleFontSize' => $titleFontSize,
|
| 730 |
+
'borderColor' => $borderColor,
|
| 731 |
+
'borderRadius' => $borderRadius,
|
| 732 |
+
'shadowSize' => $shadowSize,
|
| 733 |
+
'shadowColor' => $shadowColor,
|
| 734 |
+
'width' => $width,
|
| 735 |
+
'height' => $height,
|
| 736 |
+
'style' => $style,
|
| 737 |
+
'script' => $script,
|
| 738 |
+
);
|
| 739 |
+
|
| 740 |
+
header( "Content-type: application/json" );
|
| 741 |
+
if ( $id > 0 ) {
|
| 742 |
+
$result = $this->ModulaDB->editGallery( $id, $data );
|
| 743 |
+
|
| 744 |
+
if ( intval( $this->loadedData->img_size ) != $data['img_size'] ) {
|
|
|
|
|
|
|
|
|
|
|
|
|
| 745 |
$images = $this->ModulaDB->getImagesByGalleryId( $id );
|
| 746 |
+
$images = ModulaLiteTools::check_and_resize( $images, $data['img_size'] );
|
| 747 |
|
| 748 |
+
foreach ( $images as $img ) {
|
| 749 |
+
$this->ModulaDB->editImage( $img->Id, (array) $img );
|
| 750 |
+
}
|
| 751 |
+
}
|
| 752 |
|
| 753 |
+
$this->loadedData = $this->ModulaDB->getGalleryById( $id, $this->defaultValues );
|
| 754 |
+
} else {
|
| 755 |
+
$result = $this->ModulaDB->addGallery( $data );
|
| 756 |
+
$id = $this->ModulaDB->getNewGalleryId();
|
|
|
|
|
|
|
| 757 |
}
|
| 758 |
|
| 759 |
+
if ( $result ) {
|
| 760 |
+
print "{\"success\":true,\"id\":" . $id . "}";
|
| 761 |
+
} else {
|
| 762 |
print "{\"success\":false}";
|
| 763 |
+
}
|
| 764 |
}
|
| 765 |
die();
|
| 766 |
}
|
| 767 |
|
| 768 |
+
public function edit_gallery() {
|
| 769 |
+
if ( isset( $_GET['galleryId'] ) ) {
|
| 770 |
+
$this->loadedData = $this->ModulaDB->getGalleryById( intval( $_GET['galleryId'] ), $this->defaultValues );
|
| 771 |
+
$modula_fields = $this->fields;
|
|
|
|
| 772 |
$modula_parent_page = "dashboard";
|
| 773 |
|
| 774 |
+
include( "admin/edit-gallery.php" );
|
| 775 |
} else {
|
| 776 |
+
$redir = true;
|
| 777 |
$nobanner = true;
|
| 778 |
+
include( "admin/overview.php" );
|
| 779 |
+
}
|
| 780 |
}
|
| 781 |
|
| 782 |
+
public function list_thumbnail_sizes() {
|
|
|
|
| 783 |
global $_wp_additional_image_sizes;
|
| 784 |
$sizes = array();
|
| 785 |
+
foreach ( get_intermediate_image_sizes() as $s ) {
|
| 786 |
+
$sizes[ $s ] = array( 0, 0 );
|
| 787 |
+
if ( in_array( $s, array( 'thumbnail', 'medium', 'large' ) ) ) {
|
| 788 |
+
$sizes[ $s ][0] = get_option( $s . '_size_w' );
|
| 789 |
+
$sizes[ $s ][1] = get_option( $s . '_size_h' );
|
| 790 |
+
} else {
|
| 791 |
+
if ( isset( $_wp_additional_image_sizes ) && isset( $_wp_additional_image_sizes[ $s ] ) ) {
|
| 792 |
+
$sizes[ $s ] = array(
|
| 793 |
+
$_wp_additional_image_sizes[ $s ]['width'],
|
| 794 |
+
$_wp_additional_image_sizes[ $s ]['height'],
|
| 795 |
+
);
|
| 796 |
+
}
|
| 797 |
+
}
|
| 798 |
+
}
|
| 799 |
+
|
| 800 |
+
return $sizes;
|
| 801 |
+
}
|
| 802 |
+
|
| 803 |
+
public function gallery_shortcode_handler( $atts ) {
|
| 804 |
+
require_once( 'lib/gallery-class.php' );
|
|
|
|
|
|
|
| 805 |
global $Modula;
|
| 806 |
|
| 807 |
+
if ( class_exists( 'ModulaLiteFE' ) ) {
|
| 808 |
+
$Modula = new ModulaLiteFE( $this->ModulaDB, $atts['id'], $this->defaultValues );
|
|
|
|
| 809 |
|
| 810 |
$settings = $Modula->getGallery();
|
| 811 |
+
switch ( $settings->lightbox ) {
|
|
|
|
| 812 |
case "lightbox2":
|
| 813 |
+
wp_enqueue_style( 'lightbox2_stylesheet' );
|
| 814 |
+
wp_enqueue_script( 'lightbox2_script' );
|
| 815 |
break;
|
| 816 |
}
|
| 817 |
+
|
| 818 |
return $Modula->render();
|
| 819 |
+
} else {
|
|
|
|
|
|
|
| 820 |
return "Gallery not found.";
|
| 821 |
}
|
| 822 |
}
|
| 823 |
|
| 824 |
var $fields = array(
|
| 825 |
|
| 826 |
+
"General" => array(
|
| 827 |
+
"icon" => "mdi mdi-settings",
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 828 |
"fields" => array(
|
| 829 |
+
"name" => array(
|
| 830 |
+
"name" => "Name",
|
| 831 |
+
"type" => "text",
|
| 832 |
+
"description" => "Name of the gallery, for internal use.",
|
| 833 |
+
"excludeFrom" => array(),
|
| 834 |
+
),
|
| 835 |
+
"description" => array(
|
| 836 |
+
"name" => "Description",
|
| 837 |
+
"type" => "text",
|
| 838 |
+
"description" => "This description is for internal use.",
|
| 839 |
+
"excludeFrom" => array(),
|
| 840 |
+
),
|
| 841 |
+
"width" => array(
|
| 842 |
+
"name" => "Width",
|
| 843 |
+
"type" => "text",
|
| 844 |
+
"description" => "Width of the gallery (i.e.: 100% or 500px)",
|
| 845 |
+
"mu" => "px or %",
|
| 846 |
+
"excludeFrom" => array(),
|
| 847 |
+
),
|
| 848 |
+
"height" => array(
|
| 849 |
+
"name" => "Height",
|
| 850 |
+
"type" => "number",
|
| 851 |
+
"description" => "Height of the gallery in pixels",
|
| 852 |
+
"mu" => "px",
|
| 853 |
+
"excludeFrom" => array(),
|
| 854 |
+
),
|
| 855 |
+
"img_size" => array(
|
| 856 |
+
"name" => "Minimum image size",
|
| 857 |
+
"type" => "number",
|
| 858 |
+
"description" => "Minimum width or height of the images",
|
| 859 |
+
"mu" => "px or %",
|
| 860 |
+
"excludeFrom" => array(),
|
| 861 |
+
),
|
| 862 |
+
"margin" => array(
|
| 863 |
+
"name" => "Margin",
|
| 864 |
+
"type" => "number",
|
| 865 |
+
"description" => "Margin between images",
|
| 866 |
+
"mu" => "px",
|
| 867 |
+
"excludeFrom" => array(),
|
| 868 |
+
),
|
| 869 |
+
"randomFactor" => array(
|
| 870 |
+
"name" => "Random factor",
|
| 871 |
+
"type" => "ui-slider",
|
| 872 |
+
"description" => "",
|
| 873 |
+
"min" => 0,
|
| 874 |
+
"max" => 100,
|
| 875 |
+
"mu" => "%",
|
| 876 |
+
"default" => 20,
|
| 877 |
+
"excludeFrom" => array(),
|
| 878 |
+
),
|
| 879 |
+
"filters" => array(
|
| 880 |
+
"name" => "Filters",
|
| 881 |
+
"type" => "PRO_FEATURE",
|
| 882 |
+
"description" => "Add your own filters here. Each image can have one or more filters.",
|
| 883 |
+
"excludeFrom" => array(),
|
| 884 |
+
),
|
| 885 |
+
"filterClick" => array(
|
| 886 |
+
"name" => "Reload Page on filter click",
|
| 887 |
+
"type" => "PRO_FEATURE",
|
| 888 |
+
"description" => "Turn this feature ON if you want to use filters with most lightboxes",
|
| 889 |
+
"excludeFrom" => array(),
|
| 890 |
+
),
|
| 891 |
+
"allFilterLabel" => array(
|
| 892 |
+
"name" => "Text for 'All' filter",
|
| 893 |
+
"type" => "PRO_FEATURE",
|
| 894 |
+
"description" => "Write here the label for the 'All' filter",
|
| 895 |
+
"default" => "All",
|
| 896 |
+
"excludeFrom" => array(),
|
| 897 |
+
),
|
| 898 |
+
"lightbox" => array(
|
| 899 |
+
"name" => "Lightbox & Links",
|
| 900 |
+
"type" => "select",
|
| 901 |
+
"description" => "Define here what happens when user click on the images.",
|
| 902 |
+
"values" => array(
|
| 903 |
+
"Link" => array( "|No link", "direct|Direct link to image", "|Attachment page" ),
|
| 904 |
+
"Lightboxes" => array( "lightbox2|Lightbox" ),
|
| 905 |
+
),
|
| 906 |
+
"disabled" => array(
|
| 907 |
+
"Lightboxes with PRO license" => array(
|
| 908 |
+
"magnific|Magnific popup",
|
| 909 |
+
"prettyphoto|PrettyPhoto",
|
| 910 |
+
"fancybox|FancyBox",
|
| 911 |
+
"swipebox|SwipeBox",
|
| 912 |
+
"lightbox2|Lightbox",
|
| 913 |
+
),
|
| 914 |
+
),
|
| 915 |
+
"excludeFrom" => array(),
|
| 916 |
+
),
|
| 917 |
+
"shuffle" => array(
|
| 918 |
+
"name" => "Shuffle images",
|
| 919 |
+
"type" => "toggle",
|
| 920 |
+
"default" => "T",
|
| 921 |
+
"description" => "Flag it if you want to shuffle the gallery at each page load",
|
| 922 |
+
"excludeFrom" => array(),
|
| 923 |
+
),
|
| 924 |
+
),
|
| 925 |
+
),
|
| 926 |
+
"Captions" => array(
|
| 927 |
+
"icon" => "mdi mdi-comment-text-outline",
|
| 928 |
+
"fields" => array(
|
| 929 |
+
"captionColor" => array(
|
| 930 |
+
"name" => "Caption color",
|
| 931 |
+
"type" => "color",
|
| 932 |
+
"description" => "Color of the caption.",
|
| 933 |
+
"default" => "#ffffff",
|
| 934 |
+
"excludeFrom" => array(),
|
| 935 |
+
),
|
| 936 |
+
"wp_field_caption" => array(
|
| 937 |
+
"name" => "WordPress caption field",
|
| 938 |
+
"type" => "select",
|
| 939 |
+
"description" => "WordPress field used for captions. <strong>This field is used ONLY when images are added to the gallery, </strong> however, if you want to ignore captions just set it to '<i>Don't use captions</i>'.",
|
| 940 |
+
"values" => array(
|
| 941 |
+
"Field" => array(
|
| 942 |
+
"none|Don't use captions",
|
| 943 |
+
"title|Title",
|
| 944 |
+
"caption|Caption",
|
| 945 |
+
"description|Description",
|
| 946 |
+
),
|
| 947 |
+
),
|
| 948 |
+
"excludeFrom" => array( "shortcode" ),
|
| 949 |
+
),
|
| 950 |
+
"wp_field_title" => array(
|
| 951 |
+
"name" => "WordPress title field",
|
| 952 |
+
"type" => "select",
|
| 953 |
+
"description" => "WordPress field used for titles. <strong>This field is used ONLY when images are added to the gallery, </strong> however, if you want to ignore titles just set it to '<i>Don't use titles</i>'.",
|
| 954 |
+
"values" => array(
|
| 955 |
+
"Field" => array( "none|Don't use titles", "title|Title", "description|Description" ),
|
| 956 |
+
),
|
| 957 |
+
"excludeFrom" => array( "shortcode" ),
|
| 958 |
+
),
|
| 959 |
+
"captionFontSize" => array(
|
| 960 |
+
"name" => "Caption Font Size",
|
| 961 |
+
"type" => "number",
|
| 962 |
+
"description" => "",
|
| 963 |
+
"mu" => "px",
|
| 964 |
+
"excludeFrom" => array(),
|
| 965 |
+
),
|
| 966 |
+
"titleFontSize" => array(
|
| 967 |
+
"name" => "Title Font Size",
|
| 968 |
+
"type" => "number",
|
| 969 |
+
"description" => "",
|
| 970 |
+
"mu" => "px",
|
| 971 |
+
"excludeFrom" => array(),
|
| 972 |
+
),
|
| 973 |
+
),
|
| 974 |
+
|
| 975 |
+
),
|
| 976 |
+
"Social" => array(
|
| 977 |
+
"icon" => "mdi mdi-link-variant",
|
| 978 |
+
"fields" => array(
|
| 979 |
+
"enableTwitter" => array(
|
| 980 |
+
"name" => "Add Twitter icon",
|
| 981 |
+
"type" => "toggle",
|
| 982 |
+
"default" => "T",
|
| 983 |
+
"description" => "Enable Twitter Sharing",
|
| 984 |
+
"excludeFrom" => array(),
|
| 985 |
+
),
|
| 986 |
+
"enableFacebook" => array(
|
| 987 |
+
"name" => "Add Facebook icon",
|
| 988 |
+
"type" => "toggle",
|
| 989 |
+
"default" => "T",
|
| 990 |
+
"description" => "Enable Facebook Sharing",
|
| 991 |
+
"excludeFrom" => array(),
|
| 992 |
+
),
|
| 993 |
+
"enableGplus" => array(
|
| 994 |
+
"name" => "Add Google Plus icon",
|
| 995 |
+
"type" => "toggle",
|
| 996 |
+
"default" => "T",
|
| 997 |
+
"description" => "Enable Google Plus Sharing",
|
| 998 |
+
"excludeFrom" => array(),
|
| 999 |
+
),
|
| 1000 |
+
"enablePinterest" => array(
|
| 1001 |
+
"name" => "Add Pinterest icon",
|
| 1002 |
+
"type" => "toggle",
|
| 1003 |
+
"default" => "T",
|
| 1004 |
+
"description" => "Enable Pinterest Sharing",
|
| 1005 |
+
"excludeFrom" => array(),
|
| 1006 |
+
),
|
| 1007 |
+
"socialIconColor" => array(
|
| 1008 |
+
"name" => "Color of social sharing icons",
|
| 1009 |
+
"type" => "color",
|
| 1010 |
+
"description" => "Set the color of the social sharing icons",
|
| 1011 |
+
"default" => "#ffffff",
|
| 1012 |
+
"excludeFrom" => array(),
|
| 1013 |
+
),
|
| 1014 |
+
),
|
| 1015 |
+
|
| 1016 |
+
),
|
| 1017 |
+
"Image loaded effects" => array(
|
| 1018 |
+
"icon" => "mdi mdi-reload",
|
| 1019 |
+
"fields" => array(
|
| 1020 |
+
"loadedScale" => array(
|
| 1021 |
+
"name" => "Scale",
|
| 1022 |
"description" => "Choose a value below 100% for a zoom-in effect. Choose a value over 100% for a zoom-out effect",
|
| 1023 |
+
"type" => "ui-slider",
|
| 1024 |
+
"min" => 0,
|
| 1025 |
+
"max" => 200,
|
| 1026 |
+
"mu" => "%",
|
| 1027 |
+
"default" => 100,
|
| 1028 |
+
"excludeFrom" => array(),
|
| 1029 |
),
|
| 1030 |
"loadedRotate" => array(
|
| 1031 |
+
"name" => "Rotate",
|
| 1032 |
"description" => "",
|
| 1033 |
+
"type" => "PRO_FEATURE",
|
| 1034 |
+
"min" => - 180,
|
| 1035 |
+
"max" => 180,
|
| 1036 |
+
"default" => 0,
|
| 1037 |
+
"mu" => "deg",
|
| 1038 |
+
"excludeFrom" => array(),
|
| 1039 |
),
|
| 1040 |
"loadedHSlide" => array(
|
| 1041 |
+
"name" => "Horizontal slide",
|
| 1042 |
"description" => "",
|
| 1043 |
+
"type" => "PRO_FEATURE",
|
| 1044 |
+
"min" => - 100,
|
| 1045 |
+
"max" => 100,
|
| 1046 |
+
"mu" => "px",
|
| 1047 |
+
"default" => 0,
|
| 1048 |
+
"excludeFrom" => array(),
|
| 1049 |
),
|
| 1050 |
"loadedVSlide" => array(
|
| 1051 |
+
"name" => "Vertical slide",
|
| 1052 |
"description" => "",
|
| 1053 |
+
"type" => "PRO_FEATURE",
|
| 1054 |
+
"min" => - 100,
|
| 1055 |
+
"max" => 100,
|
| 1056 |
+
"mu" => "px",
|
| 1057 |
+
"default" => 0,
|
| 1058 |
+
"excludeFrom" => array(),
|
| 1059 |
+
),
|
| 1060 |
+
|
| 1061 |
+
),
|
| 1062 |
),
|
| 1063 |
+
"Hover effect" => array(
|
| 1064 |
+
"icon" => "mdi mdi-blur",
|
| 1065 |
"fields" => array(
|
| 1066 |
"Effect" => array(
|
| 1067 |
+
"name" => "Effect",
|
| 1068 |
"description" => "Select an hover effect",
|
| 1069 |
+
"type" => "hover-effect",
|
| 1070 |
+
"excludeFrom" => array(),
|
| 1071 |
+
),
|
| 1072 |
+
),
|
| 1073 |
+
),
|
| 1074 |
+
"Style" => array(
|
| 1075 |
+
"icon" => "mdi mdi-format-paint",
|
| 1076 |
+
"fields" => array(
|
| 1077 |
+
"borderSize" => array(
|
| 1078 |
+
"name" => "Border Size",
|
| 1079 |
+
"type" => "ui-slider",
|
| 1080 |
+
"description" => "",
|
| 1081 |
+
"mu" => "px",
|
| 1082 |
+
"min" => 0,
|
| 1083 |
+
"max" => 10,
|
| 1084 |
+
"default" => 0,
|
| 1085 |
+
"excludeFrom" => array(),
|
| 1086 |
+
),
|
| 1087 |
+
"borderRadius" => array(
|
| 1088 |
+
"name" => "Border Radius",
|
| 1089 |
+
"type" => "ui-slider",
|
| 1090 |
+
"description" => "",
|
| 1091 |
+
"mu" => "px",
|
| 1092 |
+
"min" => 0,
|
| 1093 |
+
"max" => 100,
|
| 1094 |
+
"default" => 0,
|
| 1095 |
+
"excludeFrom" => array(),
|
| 1096 |
+
),
|
| 1097 |
+
"borderColor" => array(
|
| 1098 |
+
"name" => "Border Color",
|
| 1099 |
+
"type" => "color",
|
| 1100 |
+
"description" => "",
|
| 1101 |
+
"default" => "#ffffff",
|
| 1102 |
+
"excludeFrom" => array(),
|
| 1103 |
+
),
|
| 1104 |
+
"shadowSize" => array(
|
| 1105 |
+
"name" => "Shadow Size",
|
| 1106 |
+
"type" => "ui-slider",
|
| 1107 |
+
"description" => "",
|
| 1108 |
+
"mu" => "px",
|
| 1109 |
+
"min" => 0,
|
| 1110 |
+
"max" => 20,
|
| 1111 |
+
"default" => 0,
|
| 1112 |
+
"excludeFrom" => array(),
|
| 1113 |
+
),
|
| 1114 |
+
"shadowColor" => array(
|
| 1115 |
+
"name" => "Shadow Color",
|
| 1116 |
+
"type" => "color",
|
| 1117 |
+
"description" => "",
|
| 1118 |
+
"default" => "#ffffff",
|
| 1119 |
+
"excludeFrom" => array(),
|
| 1120 |
+
),
|
| 1121 |
+
|
| 1122 |
+
),
|
| 1123 |
),
|
| 1124 |
+
"Customizations" => array(
|
| 1125 |
+
"icon" => "mdi mdi-puzzle",
|
| 1126 |
+
"fields" => array(
|
| 1127 |
+
"script" => array(
|
| 1128 |
+
"name" => "Custom scripts",
|
| 1129 |
+
"type" => "textarea",
|
| 1130 |
+
"description" => "This script will be called after the gallery initialization. Useful for custom lightboxes.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1131 |
<br />
|
| 1132 |
<br />
|
| 1133 |
<strong>Write just the code without using the <script></script> tags</strong>",
|
| 1134 |
+
"excludeFrom" => array( "shortcode" ),
|
| 1135 |
+
),
|
| 1136 |
+
"style" => array(
|
| 1137 |
+
"name" => "Custom css",
|
| 1138 |
+
"type" => "textarea",
|
| 1139 |
+
"description" => "<strong>Write just the code without using the <style></style> tags</strong>",
|
| 1140 |
+
"excludeFrom" => array( "shortcode" ),
|
| 1141 |
+
),
|
| 1142 |
+
),
|
| 1143 |
+
),
|
| 1144 |
+
|
| 1145 |
+
);
|
| 1146 |
}
|
| 1147 |
|
| 1148 |
+
class ModulaLiteHoverEffect {
|
| 1149 |
+
|
| 1150 |
var $name;
|
| 1151 |
var $code;
|
| 1152 |
var $allowTitle;
|
| 1153 |
var $allowSubtitle;
|
| 1154 |
var $maxSocial;
|
| 1155 |
|
| 1156 |
+
public function __construct( $name, $code, $allowTitle, $allowSubtitle, $maxSocial ) {
|
| 1157 |
+
$this->name = $name;
|
| 1158 |
+
$this->code = $code;
|
| 1159 |
+
$this->allowTitle = $allowTitle;
|
|
|
|
| 1160 |
$this->allowSubtitle = $allowSubtitle;
|
| 1161 |
+
$this->maxSocial = $maxSocial;
|
| 1162 |
}
|
| 1163 |
}
|
| 1164 |
}
|
| 1165 |
|
| 1166 |
+
class ModulaLiteTools {
|
| 1167 |
+
|
| 1168 |
+
public static function get_image_size_links( $id ) {
|
| 1169 |
+
$result = array();
|
| 1170 |
+
$sizes = get_intermediate_image_sizes();
|
|
|
|
| 1171 |
$sizes[] = 'full';
|
| 1172 |
|
| 1173 |
+
foreach ( $sizes as $size ) {
|
|
|
|
| 1174 |
$image = wp_get_attachment_image_src( $id, $size );
|
| 1175 |
|
| 1176 |
+
if ( ! empty( $image ) && ( true == $image[3] || 'full' == $size ) ) {
|
| 1177 |
$result["$image[1]x$image[2]"] = $image[0];
|
| 1178 |
+
}
|
| 1179 |
}
|
| 1180 |
|
| 1181 |
return $result;
|
| 1182 |
}
|
| 1183 |
|
| 1184 |
+
public static function resize_image( $id, $img_size ) {
|
| 1185 |
+
$file = get_attached_file( $id );
|
| 1186 |
+
$editor = wp_get_image_editor( $file );
|
| 1187 |
+
$size = $editor->get_size();
|
| 1188 |
+
if ( $size["width"] > $size["height"] ) {
|
| 1189 |
+
$editor->resize( 10000, $img_size );
|
| 1190 |
+
} else {
|
| 1191 |
+
$editor->resize( $img_size, 10000 );
|
| 1192 |
}
|
| 1193 |
+
$path_parts = pathinfo( $file );
|
| 1194 |
+
$filename = $path_parts['dirname'] . "/" . $path_parts['filename'] . "-" . $img_size . "x" . $img_size . "." . $path_parts["extension"];
|
| 1195 |
+
|
| 1196 |
+
if ( ! file_exists( $filename ) ) {
|
| 1197 |
+
$editor->save( $filename );
|
| 1198 |
}
|
|
|
|
|
|
|
| 1199 |
|
|
|
|
|
|
|
| 1200 |
return basename( $filename );
|
| 1201 |
}
|
| 1202 |
|
| 1203 |
+
public static function check_and_resize( &$images, $size ) {
|
| 1204 |
+
foreach ( $images as &$img ) {
|
|
|
|
|
|
|
| 1205 |
$metadata = wp_get_attachment_metadata( $img->imageId );
|
| 1206 |
|
| 1207 |
+
if ( $img->imageId > 0 ) {
|
|
|
|
| 1208 |
$wpdata = get_post( $img->imageId );
|
| 1209 |
$baseurl = str_replace( basename( $wpdata->guid ), "", $wpdata->guid );
|
| 1210 |
$res_name = ModulaLiteTools::resize_image( $img->imageId, $size );
|
| 1211 |
|
| 1212 |
+
if ( ! ( array_key_exists( "image_meta", $metadata ) && array_key_exists( "resized_images", $metadata["image_meta"] ) && in_array( $size . "x" . $size, $metadata["image_meta"]["resized_images"] ) ) ) {
|
|
|
|
|
|
|
|
|
|
| 1213 |
if ( isset( $metadata['image_meta'] ) ) {
|
| 1214 |
$md = $size . 'x' . $size;
|
| 1215 |
$metadata['image_meta']['resized_images'][] = $md;
|
| 1218 |
}
|
| 1219 |
|
| 1220 |
$img->imagePath = $baseurl . $res_name;
|
| 1221 |
+
} else {
|
| 1222 |
+
$img->imagePath = preg_replace( "/w=(\d+)/", "w=" . $size, $img->imagePath );
|
|
|
|
|
|
|
| 1223 |
}
|
| 1224 |
}
|
| 1225 |
+
|
| 1226 |
return $images;
|
| 1227 |
}
|
| 1228 |
}
|
| 1229 |
|
| 1230 |
+
if ( class_exists( "ModulaLite" ) ) {
|
| 1231 |
+
global $ob_ModulaLite;
|
|
|
|
| 1232 |
$ob_ModulaLite = new ModulaLite();
|
| 1233 |
}
|
| 1234 |
?>
|
README.txt
CHANGED
|
@@ -1,196 +1,252 @@
|
|
| 1 |
-
=== Gallery -
|
| 2 |
-
Contributors:
|
| 3 |
-
Tags: gallery,
|
| 4 |
-
Requires at least:
|
| 5 |
-
Tested up to: 4.
|
| 6 |
-
Stable tag:
|
| 7 |
-
License:
|
| 8 |
-
License URI: http://www.gnu.org/licenses/gpl-
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
== Description ==
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
|
| 27 |
-
|
| 28 |
-
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
[
|
| 32 |
-
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
|
| 37 |
-
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
|
| 46 |
-
|
| 47 |
-
|
| 48 |
-
|
| 49 |
-
|
| 50 |
-
|
| 51 |
-
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
|
| 55 |
-
|
| 56 |
-
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
|
| 60 |
-
|
| 61 |
-
|
| 62 |
-
|
| 63 |
-
|
| 64 |
-
|
| 65 |
-
|
| 66 |
-
|
| 67 |
-
|
| 68 |
-
|
| 69 |
-
|
| 70 |
-
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
|
| 74 |
-
|
| 75 |
-
|
| 76 |
-
|
| 77 |
-
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
|
| 81 |
-
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
|
| 88 |
-
|
| 89 |
-
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
|
| 97 |
-
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
|
| 101 |
-
==
|
| 102 |
-
|
| 103 |
-
|
| 104 |
-
|
| 105 |
-
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
|
| 109 |
-
|
| 110 |
-
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
|
| 118 |
-
|
| 119 |
-
|
| 120 |
-
|
| 121 |
-
|
| 122 |
-
|
| 123 |
-
|
| 124 |
-
|
| 125 |
-
=
|
| 126 |
-
|
| 127 |
-
|
| 128 |
-
|
| 129 |
-
|
| 130 |
-
|
| 131 |
-
|
| 132 |
-
|
| 133 |
-
|
| 134 |
-
=
|
| 135 |
-
|
| 136 |
-
|
| 137 |
-
|
| 138 |
-
|
| 139 |
-
|
| 140 |
-
|
| 141 |
-
|
| 142 |
-
|
| 143 |
-
|
| 144 |
-
*
|
| 145 |
-
|
| 146 |
-
|
| 147 |
-
|
| 148 |
-
|
| 149 |
-
|
| 150 |
-
|
| 151 |
-
|
| 152 |
-
|
| 153 |
-
|
| 154 |
-
|
| 155 |
-
|
| 156 |
-
|
| 157 |
-
|
| 158 |
-
|
| 159 |
-
|
| 160 |
-
= 1.
|
| 161 |
-
*
|
| 162 |
-
|
| 163 |
-
|
| 164 |
-
*
|
| 165 |
-
|
| 166 |
-
|
| 167 |
-
*
|
| 168 |
-
|
| 169 |
-
= 1.
|
| 170 |
-
*
|
| 171 |
-
|
| 172 |
-
= 1.
|
| 173 |
-
*
|
| 174 |
-
|
| 175 |
-
= 1.
|
| 176 |
-
*
|
| 177 |
-
|
| 178 |
-
= 1.
|
| 179 |
-
*
|
| 180 |
-
|
| 181 |
-
= 1.
|
| 182 |
-
*
|
| 183 |
-
|
| 184 |
-
= 1.
|
| 185 |
-
*
|
| 186 |
-
|
| 187 |
-
= 1.
|
| 188 |
-
*
|
| 189 |
-
|
| 190 |
-
|
| 191 |
-
|
| 192 |
-
|
| 193 |
-
|
| 194 |
-
|
| 195 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 196 |
* This update contains a tool to fix broken images.
|
| 1 |
+
=== Gallery - Photo Gallery - Image Gallery ===
|
| 2 |
+
Contributors: machothemes, imagegallery, xphotogallery
|
| 3 |
+
Tags: image gallery, photo gallery, responsive gallery, wordpress gallery plugin, wordpress portfolio plugin, lightbox gallery, masonry gallery, envira, envira gallery, nextgen, nextgen gallery, album, content gallery, fancy gallery, gallery widget, media gallery, mosaic gallery, photo album, polaroid gallery, portfolio gallery, post gallery, thumbnail gallery, video gallery, youtube gallery, filterable portfolio, portfolio gallery, responsive portfolio, wordpress portfolio plugin
|
| 4 |
+
Requires at least: 3.8
|
| 5 |
+
Tested up to: 4.8
|
| 6 |
+
Stable tag: 1.2.0
|
| 7 |
+
License: GPLv3 or later
|
| 8 |
+
License URI: http://www.gnu.org/licenses/gpl-3.0.html
|
| 9 |
+
|
| 10 |
+
Photo Gallery by Modula - an advanced solution for Photo Gallery users. Create beautiful image galleries in minutes or less.
|
| 11 |
+
|
| 12 |
+
== Description ==
|
| 13 |
+
|
| 14 |
+
Modula WordPress Photo Gallery, Image Gallery & Portfolio Gallery Plugin, the creative WordPress image gallery, photo gallery, portfolio gallery & responsive gallery, is now available also in Lite version. Modula is currently the easiest and fastest photo gallery plugin for WordPress. With its wizard you are able to build an image gallery in a few seconds, unlike many other WordPress gallery plugins.
|
| 15 |
+
|
| 16 |
+
= See a 60s video of Modula in action =
|
| 17 |
+
|
| 18 |
+
https://www.youtube.com/watch?v=tq8yUYxgtnA
|
| 19 |
+
|
| 20 |
+
|
| 21 |
+
> **Time-saving features available in the FULL version:**
|
| 22 |
+
>
|
| 23 |
+
> * Use more than 20 images per gallery
|
| 24 |
+
> * Get access to gallery filters. Each image can have one or more filters.
|
| 25 |
+
> * Get access to 5 more lightbox libraries & effects with the PRO version.
|
| 26 |
+
> * Image effects on finishing image loading. Rotate or Horizontally / Vertically slide the images.
|
| 27 |
+
> * Get access to more than 15 hover image effects.
|
| 28 |
+
> * Priority email support from the developer of the plugin
|
| 29 |
+
> * Support and updates for 12 months
|
| 30 |
+
>
|
| 31 |
+
> **[Learn more about Modula Full version]( https://wp-modula.com/?utm_source=wordpress.org&utm_medium=web&utm_campaign=Modula%20Lite )**
|
| 32 |
+
|
| 33 |
+
|
| 34 |
+
= See how Modula can integrate with your website =
|
| 35 |
+
|
| 36 |
+
* [Modula Grid Gallery](http://wp-modula.com/?utm_source=wordpress.org&utm_medium=web&utm_campaign=Modula%20Lite)
|
| 37 |
+
* [Example: Margins](https://wp-modula.com/demo/margins/?utm_source=wordpress.org&utm_medium=web&utm_campaign=Modula%20Lite)
|
| 38 |
+
* [Example: Shuffle](https://wp-modula.com/demo/shuffle/?utm_source=wordpress.org&utm_medium=web&utm_campaign=Modula%20Lite)
|
| 39 |
+
* [Example: Social icons](https://wp-modula.com/demo/social-effect/?utm_source=wordpress.org&utm_medium=web&utm_campaign=Modula%20Lite)
|
| 40 |
+
* [Example: Custom styling](https://wp-modula.com/demo/styling/?utm_source=wordpress.org&utm_medium=web&utm_campaign=Modula%20Lite)
|
| 41 |
+
* [Architecture portfolio](https://wp-modula.com/demo/applications/architecture/?utm_source=wordpress.org&utm_medium=web&utm_campaign=Modula%20Lite)
|
| 42 |
+
* [Art showcase](https://wp-modula.com/demo/applications/art-gallery/?utm_source=wordpress.org&utm_medium=web&utm_campaign=Modula%20Lite)
|
| 43 |
+
* [Photography portfolio](https://wp-modula.com/demo/applications/blackwhite-photography/?utm_source=wordpress.org&utm_medium=web&utm_campaign=Modula%20Lite)
|
| 44 |
+
* [Food gallery](https://wp-modula.com/demo/applications/food/?utm_source=wordpress.org&utm_medium=web&utm_campaign=Modula%20Lite)
|
| 45 |
+
* [Pets gallery](https://wp-modula.com/demo/applications/pets-animals/?utm_source=wordpress.org&utm_medium=web&utm_campaign=Modula%20Lite)
|
| 46 |
+
* [Tattoo showcase](https://wp-modula.com/demo/applications/tattoo-attitude/?utm_source=wordpress.org&utm_medium=web&utm_campaign=Modula%20Lite)
|
| 47 |
+
* [Travel gallery](https://wp-modula.com/demo/applications/travel-gallery/?utm_source=wordpress.org&utm_medium=web&utm_campaign=Modula%20Lite)
|
| 48 |
+
* [Wedding album](https://wp-modula.com/demo/applications/wedding-album/?utm_source=wordpress.org&utm_medium=web&utm_campaign=Modula%20Lite)
|
| 49 |
+
|
| 50 |
+
= Shortcode Parameters =
|
| 51 |
+
|
| 52 |
+
`
|
| 53 |
+
* id
|
| 54 |
+
`
|
| 55 |
+
|
| 56 |
+
|
| 57 |
+
**Plugin is now using the TinyMCE API to improve UI and makes it easy to insert shortcodes!**
|
| 58 |
+
|
| 59 |
+
|
| 60 |
+
= Basic example =
|
| 61 |
+
|
| 62 |
+
`[Modula id="1"]`
|
| 63 |
+
|
| 64 |
+
|
| 65 |
+
= Some Modula demo applications / usages =
|
| 66 |
+
|
| 67 |
+
Do you wonder why this gallery is the best one? Look at the other galleries, see their demos, you’ll notice something weird ... THEY ALL LOOK THE SAME!
|
| 68 |
+
|
| 69 |
+
Modula is creative! Modula is dynamic! Modula doesn’t always look the same. Just have fun with it! Modula uses a new concept to build its internal grid. After you set a width and a height for the gallery, Modula will create a random but smart grid inside. The result is a dynamic, creative, interesting and attractive gallery.
|
| 70 |
+
|
| 71 |
+
You can control how much randomness to use in each gallery, so you can obtain a more traditional layout by switching off the “random factor,” or you can make something much more different by incrementing this factor.
|
| 72 |
+
|
| 73 |
+
Modula is a justified grid gallery because YOU decide the width and the height of the gallery, and the images to put inside. Modula will think about everything else. Images will never exceed their container.
|
| 74 |
+
|
| 75 |
+
To achieve such a result, images will be cropped, but that’s not a problem at all, because you can set a custom alignment for those images where the subject is not at the center of the image.
|
| 76 |
+
|
| 77 |
+
Modula Grid Gallery is not only responsive but also fluid, which means you’ll see images organize themselves with an impressive animation even on mobile devices thanks to the CSS3 engine.
|
| 78 |
+
|
| 79 |
+
**Ease of use doesn’t mean trivial galleries, indeed!**
|
| 80 |
+
By using the Modula Admin Panel you’re able to fine tune every aspect of the gallery. Choose a gallery size, margins between images, the color and the size of captions. Each photo can have a title and a subtitle so you’re able to best describe every image.
|
| 81 |
+
|
| 82 |
+
= What is Modula good for? =
|
| 83 |
+
|
| 84 |
+
Modula is also the best WordPress portfolio plugin, as it allows you to build gorgeous, creative portfolios. Applications are:
|
| 85 |
+
|
| 86 |
+
* architecture
|
| 87 |
+
* art
|
| 88 |
+
* photography
|
| 89 |
+
* food blogs
|
| 90 |
+
* pets and animals
|
| 91 |
+
* tattoos
|
| 92 |
+
* travel
|
| 93 |
+
* also wedding albums.
|
| 94 |
+
|
| 95 |
+
If you're frustated because your current galleries looks boring and too standard then you can use the importer which is included with Modula. The importer is currently able to import Envira and NextGen galleries.
|
| 96 |
+
|
| 97 |
+
> This plugin is maintained and supported by Macho Themes.
|
| 98 |
+
> Check out some of the other <a href="//machothemes.com/plugins/">WordPress plugins</a> we've developed.
|
| 99 |
+
> Check out some of the other <a href="//machothemes.com/themes/free/">free WordPress themes</a> we've developed.
|
| 100 |
+
|
| 101 |
+
== Installation ==
|
| 102 |
+
= For automatic installation: =
|
| 103 |
+
|
| 104 |
+
The simplest way to install is to click on \'Plugins\' then \'Add\' and type \'Modula\' in the search field.
|
| 105 |
+
|
| 106 |
+
= For manual installation 1: =
|
| 107 |
+
|
| 108 |
+
1. Login to your website and go to the Plugins section of your admin panel.
|
| 109 |
+
2. Click the Add New button.
|
| 110 |
+
3. Under Install Plugins, click the Upload link.
|
| 111 |
+
4. Select the plugin zip file (modula.x.x.x.zip) from your computer then click the Install Now button.
|
| 112 |
+
5. You should see a message stating that the plugin was installed successfully.
|
| 113 |
+
6. Click the Activate Plugin link.
|
| 114 |
+
|
| 115 |
+
= For manual installation 2: =
|
| 116 |
+
|
| 117 |
+
1. You should have access to the server where WordPress is installed. If you don\'t, see your system administrator.
|
| 118 |
+
2. Copy the plugin zip file (modula.x.x.x.zip) up to your server and unzip it somewhere on the file system.
|
| 119 |
+
3. Copy the \"modula-lite\" folder into the /wp-content/plugins directory of your WordPress installation.
|
| 120 |
+
4. Login to your website and go to the Plugins section of your admin panel.
|
| 121 |
+
5. Look for \"Modula\" and click Activate.
|
| 122 |
+
|
| 123 |
+
== Frequently Asked Questions ==
|
| 124 |
+
|
| 125 |
+
= The layout doesnt' look correct =
|
| 126 |
+
|
| 127 |
+
Check the console of the browser and look if you see any error like: "Uncaught TypeError: undefined is not a function"
|
| 128 |
+
This errors means that the browser doesn't know the Modula JavaScript plugin, most of the time the problem is caused by a wrong jQuery inclusion by the theme or another plugin.
|
| 129 |
+
|
| 130 |
+
= Why does some image look blurry ? =
|
| 131 |
+
|
| 132 |
+
If you get blurry and pixellated images then you need to raise the "Minimum image width" parameter inside the "General" section.
|
| 133 |
+
|
| 134 |
+
= I want to use another lightbox instead of the provided one =
|
| 135 |
+
|
| 136 |
+
The PRO license bundles 6 different lightboxes. However you can use any other lightbox you want also with the Lite license. If you have installed a lightbox plugin then you just need to select "Direct link to image" in the "Lightbox" settings.
|
| 137 |
+
|
| 138 |
+
= How can I get support? =
|
| 139 |
+
|
| 140 |
+
Free support is included only with a PRO license: [Buy Modula PRO](https://wp-modula.com/#buy "Buy Modula PRO")
|
| 141 |
+
|
| 142 |
+
= How can I say thanks? =
|
| 143 |
+
|
| 144 |
+
* Just recommend our plugin to your friends! or
|
| 145 |
+
* Like and share our [Facebook page](https://www.facebook.com/machothemes "Facebook fan page")
|
| 146 |
+
|
| 147 |
+
|
| 148 |
+
== Screenshots ==
|
| 149 |
+
|
| 150 |
+
1. Gallery with Appear effect
|
| 151 |
+
2. Gallery with Crafty effect and round corners
|
| 152 |
+
3. Gallery with Catinelle effect
|
| 153 |
+
4. Gallery with Appear effect
|
| 154 |
+
5. Gallery with Pufrobo effect
|
| 155 |
+
6. Lightgallery lightbox
|
| 156 |
+
7. Admin panel with Material design
|
| 157 |
+
|
| 158 |
+
== Changelog ==
|
| 159 |
+
|
| 160 |
+
= 1.2 =
|
| 161 |
+
* Removed sub-menu entry: Tutorial
|
| 162 |
+
* Removed sub-menu entry: Other Galleries
|
| 163 |
+
* Removed fixed action button
|
| 164 |
+
* Removed Modula Survey by Diego Imbriani
|
| 165 |
+
* Re-worked the "Upgrade" page.
|
| 166 |
+
* Removed the "languages" folder. We'll be using GlotPress to handle these
|
| 167 |
+
* Fixed an issue with WPML plugin
|
| 168 |
+
|
| 169 |
+
= 1.1.13 =
|
| 170 |
+
* Enhanced lightbox compatibility
|
| 171 |
+
|
| 172 |
+
= 1.1.10 =
|
| 173 |
+
* Enhancement in backend UI
|
| 174 |
+
|
| 175 |
+
= 1.1.9 =
|
| 176 |
+
* Minor change in backend UI
|
| 177 |
+
|
| 178 |
+
= 1.1.8 =
|
| 179 |
+
* Fixed broken css for backends under SSL
|
| 180 |
+
|
| 181 |
+
= 1.1.7 =
|
| 182 |
+
* Tool to fix broken images after version 1.1.0
|
| 183 |
+
|
| 184 |
+
= 1.1.6 =
|
| 185 |
+
* Bug fix (impossible to select effect "None")
|
| 186 |
+
|
| 187 |
+
= 1.1.5 =
|
| 188 |
+
* Fixed issue on admin panel when images are too tall
|
| 189 |
+
|
| 190 |
+
= 1.1.4 =
|
| 191 |
+
* Changed CSS icon prefix to avoid conflicts
|
| 192 |
+
|
| 193 |
+
= 1.1.3 =
|
| 194 |
+
* Fixed bug (linked images opening in lightbox)
|
| 195 |
+
|
| 196 |
+
= 1.1.2 =
|
| 197 |
+
* Fixed social icons bug
|
| 198 |
+
|
| 199 |
+
= 1.1.1 =
|
| 200 |
+
* Bug fix
|
| 201 |
+
|
| 202 |
+
= 1.1.0 =
|
| 203 |
+
* New image management
|
| 204 |
+
* Import tool for Envira galleries
|
| 205 |
+
* Import tool for NextGen galleries
|
| 206 |
+
|
| 207 |
+
= 1.0.12 =
|
| 208 |
+
* Added link to ShortPixel plugin for image optimization
|
| 209 |
+
|
| 210 |
+
= 1.0.11 =
|
| 211 |
+
* Minor bug fix: fixed missing preview effect image
|
| 212 |
+
|
| 213 |
+
= 1.0.10 =
|
| 214 |
+
* Bug fix: now Lightbox opens image at full size
|
| 215 |
+
|
| 216 |
+
= 1.0.9 =
|
| 217 |
+
* Fixed url to upgrade
|
| 218 |
+
|
| 219 |
+
= 1.0.8 =
|
| 220 |
+
* Fixed url to upgrade
|
| 221 |
+
|
| 222 |
+
= 1.0.7 =
|
| 223 |
+
* Changed call to action for the survey
|
| 224 |
+
|
| 225 |
+
= 1.0.6 =
|
| 226 |
+
* Fixed CSS issue with Lightbox and some themes. New page in admin panel to show other gallery plugins. Enhancements of the UI of admin panel.
|
| 227 |
+
|
| 228 |
+
= 1.0.5 =
|
| 229 |
+
* Added handy links on plugins page
|
| 230 |
+
|
| 231 |
+
= 1.0.4 =
|
| 232 |
+
* Updated pot file for translations
|
| 233 |
+
|
| 234 |
+
= 1.0.3 =
|
| 235 |
+
* Bug fix: now images can be sorted also in the "Add gallery" wizard
|
| 236 |
+
|
| 237 |
+
= 1.0.2 =
|
| 238 |
+
* Added link to survey to help us making a better plugin
|
| 239 |
+
|
| 240 |
+
= 1.0.1 =
|
| 241 |
+
* Fixed issue when activating the plugin
|
| 242 |
+
|
| 243 |
+
= 1.0.0 =
|
| 244 |
+
* This is the launch version. No changes yet.
|
| 245 |
+
|
| 246 |
+
== Upgrade Notice ==
|
| 247 |
+
|
| 248 |
+
= 1.1.8 =
|
| 249 |
+
* This update will fix broken CSS of admin panel under SSL
|
| 250 |
+
|
| 251 |
+
= 1.1.7 =
|
| 252 |
* This update contains a tool to fix broken images.
|
admin/add-gallery.php
CHANGED
|
@@ -1,116 +1,121 @@
|
|
| 1 |
<?php
|
| 2 |
-
|
| 3 |
-
|
| 4 |
-
|
|
|
|
|
|
|
| 5 |
?>
|
| 6 |
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 10 |
|
| 11 |
-
|
| 12 |
-
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
|
| 16 |
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
<input name="tg_name" id="name" type="text" class="validate" required="required">
|
| 21 |
-
<label for="name"><?php _e('Name of the gallery','modula-gallery')?></label>
|
| 22 |
-
</div>
|
| 23 |
-
</div>
|
| 24 |
-
<div class="row">
|
| 25 |
-
<div class="input-field">
|
| 26 |
-
<input name="tg_description" id="description" type="text" class="validate">
|
| 27 |
-
<label for="description"><?php _e('Description of the gallery (for internal use)','modula-gallery')?></label>
|
| 28 |
-
</div>
|
| 29 |
-
</div>
|
| 30 |
-
<div class="row">
|
| 31 |
-
<div class="input-field col s6">
|
| 32 |
-
<input name="tg_width" id="width" type="text" value="100%">
|
| 33 |
-
<label for="width"><?php _e('Gallery width','modula-gallery')?></label>
|
| 34 |
-
</div>
|
| 35 |
-
<div class="input-field col s6">
|
| 36 |
-
<input name="tg_height" id="height" type="text" value="800">
|
| 37 |
-
<label for="height"><?php _e('Gallery height in pixels','modula-gallery')?></label>
|
| 38 |
-
</div>
|
| 39 |
-
</div>
|
| 40 |
-
</fieldset>
|
| 41 |
-
<fieldset data-step="2" data-branch="images">
|
| 42 |
-
<div class="field">
|
| 43 |
-
<h5><?php _e('WordPress field for titles:','modula')?></h5>
|
| 44 |
-
<select class="browser-default" name="ftg_wp_field_title">
|
| 45 |
-
<option value="none">Don't use titles</option>
|
| 46 |
-
<option value="title" selected>Title</option>
|
| 47 |
-
<option value="description">Description</option>
|
| 48 |
-
</select>
|
| 49 |
-
</div>
|
| 50 |
-
<div class="field">
|
| 51 |
-
<h5><?php _e('WordPress field for captions:','modula')?></h5>
|
| 52 |
-
<select class="browser-default" name="ftg_wp_field_caption">
|
| 53 |
-
<option value="none">Don't use captions</option>
|
| 54 |
-
<option value="title">Title</option>
|
| 55 |
-
<option value="caption" selected>Caption</option>
|
| 56 |
-
<option value="description">Description</option>
|
| 57 |
-
</select>
|
| 58 |
-
</div>
|
| 59 |
-
</fieldset>
|
| 60 |
-
<fieldset data-step="3" data-save="true">
|
| 61 |
-
<div class="field">
|
| 62 |
-
<h5><?php _e('Image size','modula-gallery')?></h5>
|
| 63 |
-
<div class="row">
|
| 64 |
-
<div class="input-field">
|
| 65 |
-
<input name="tg_img_size" id="img_size" type="text" class="validate" required="required" value="500">
|
| 66 |
-
<label for="name"><?php _e('Minimum width or height of images','modula-gallery')?></label>
|
| 67 |
-
</div>
|
| 68 |
-
</div>
|
| 69 |
-
<label class="shortpixel">
|
| 70 |
-
<img src="<?php echo plugins_url('',__file__) ?>/images/icon-shortpixel.png" alt="ShortPixel">
|
| 71 |
-
<a target="_blank" href="https://shortpixel.com/wp/af/N8LKGGT72393"><?php _e('We suggest you to use ShortPixel image optimization plugin for best SEO results.','modula-gallery')?></a></label>
|
| 72 |
-
</div>
|
| 73 |
-
<div class="field select-images">
|
| 74 |
-
<a class="waves-effect waves-light btn add-images">
|
| 75 |
-
<i class="mdi mdi-plus left"></i> <?php _e('Add images','modula-gallery')?></a>
|
| 76 |
-
<br>
|
| 77 |
-
<label><?php _e('You can add images now or later.','modula-gallery')?></label>
|
| 78 |
-
|
| 79 |
-
<div class="images list-group"></div>
|
| 80 |
-
</div>
|
| 81 |
-
</fieldset>
|
| 82 |
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
|
| 86 |
-
|
| 87 |
|
| 88 |
-
|
| 89 |
-
|
| 90 |
-
|
| 91 |
|
| 92 |
-
|
| 93 |
-
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
|
| 97 |
-
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
|
| 101 |
-
|
| 102 |
-
|
| 103 |
-
|
| 104 |
-
|
| 105 |
-
|
|
|
|
|
|
|
| 106 |
|
| 107 |
-
|
| 108 |
-
|
| 109 |
-
|
| 110 |
-
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
|
| 1 |
<?php
|
| 2 |
+
if ( preg_match( '#' . basename( __FILE__ ) . '#', $_SERVER['PHP_SELF'] ) ) {
|
| 3 |
+
die( _e( 'You are not allowed to call this page directly.', 'modula-gallery' ) );
|
| 4 |
+
}
|
| 5 |
+
|
| 6 |
+
$tg_subtitle = "New Gallery";
|
| 7 |
?>
|
| 8 |
|
| 9 |
+
<?php include( "header.php" ) ?>
|
| 10 |
+
|
| 11 |
+
|
| 12 |
+
<div id="modula-wizard">
|
| 13 |
+
<h2> <?php _e( 'Add New Gallery', 'modula-gallery' ); ?> </h2>
|
| 14 |
+
<form action="#" method="post">
|
| 15 |
+
<?php wp_nonce_field( 'Modula', 'Modula' ); ?>
|
| 16 |
+
<input type="hidden" name="enc_images" value=""/>
|
| 17 |
+
|
| 18 |
+
<fieldset data-step="1">
|
| 19 |
+
<div class="row">
|
| 20 |
+
<div class="input-field">
|
| 21 |
+
<input name="tg_name" id="name" type="text" class="validate" required="required">
|
| 22 |
+
<label for="name"><?php echo esc_html__( 'Name of the gallery', 'modula-gallery' ) ?></label>
|
| 23 |
+
</div>
|
| 24 |
+
</div>
|
| 25 |
+
<div class="row">
|
| 26 |
+
<div class="input-field">
|
| 27 |
+
<input name="tg_description" id="description" type="text" class="validate">
|
| 28 |
+
<label for="description"><?php echo esc_html__( 'Description of the gallery (for internal use)', 'modula-gallery' ) ?></label>
|
| 29 |
+
</div>
|
| 30 |
+
</div>
|
| 31 |
+
<div class="row">
|
| 32 |
+
<div class="input-field col s6">
|
| 33 |
+
<input name="tg_width" id="width" type="text" value="100%">
|
| 34 |
+
<label for="width"><?php echo esc_html__( 'Gallery width', 'modula-gallery' ) ?></label>
|
| 35 |
+
</div>
|
| 36 |
+
<div class="input-field col s6">
|
| 37 |
+
<input name="tg_height" id="height" type="text" value="800">
|
| 38 |
+
<label for="height"><?php echo esc_html__( 'Gallery height in pixels', 'modula-gallery' ) ?></label>
|
| 39 |
+
</div>
|
| 40 |
+
</div>
|
| 41 |
+
</fieldset>
|
| 42 |
+
<fieldset data-step="2" data-branch="images">
|
| 43 |
+
<div class="field">
|
| 44 |
+
<h5><?php echo esc_html__( 'WordPress field for titles:', 'modula-gallery' ) ?></h5>
|
| 45 |
+
<select class="browser-default" name="ftg_wp_field_title">
|
| 46 |
+
<option value="none"><?php echo esc_html__( 'Don\'t use titles', 'modula-gallery' ); ?></option>
|
| 47 |
+
<option value="title" selected><?php echo esc_html__( 'Title', 'modula-gallery' ); ?></option>
|
| 48 |
+
<option value="description"><?php echo esc_html__( 'Description', 'modula-gallery' ); ?></option>
|
| 49 |
+
</select>
|
| 50 |
+
</div>
|
| 51 |
+
<div class="field">
|
| 52 |
+
<h5><?php echo esc_html__( 'WordPress field for captions:', 'modula-gallery' ) ?></h5>
|
| 53 |
+
<select class="browser-default" name="ftg_wp_field_caption">
|
| 54 |
+
<option value="none"><?php echo esc_html( 'Don\'t use captions', 'modula-gallery' ); ?></option>
|
| 55 |
+
<option value="title"><?php echo esc_html( 'Title', 'modula-gallery' ); ?></option>
|
| 56 |
+
<option value="caption" selected><?php echo esc_html( 'Captions', 'modula-gallery' ); ?></option>
|
| 57 |
+
<option value="description"><?php echo esc_html( 'Description', 'modula-gallery' ); ?></option>
|
| 58 |
+
</select>
|
| 59 |
+
</div>
|
| 60 |
+
</fieldset>
|
| 61 |
+
<fieldset data-step="3" data-save="true">
|
| 62 |
+
<div class="field">
|
| 63 |
+
<h5><?php echo esc_html__( 'Image size', 'modula-gallery' ) ?></h5>
|
| 64 |
+
<div class="row">
|
| 65 |
+
<div class="input-field">
|
| 66 |
+
<input name="tg_img_size" id="img_size" type="text" class="validate" required="required" value="500">
|
| 67 |
+
<label for="name"><?php echo esc_html__( 'Minimum width or height of images', 'modula-gallery' ) ?></label>
|
| 68 |
+
</div>
|
| 69 |
+
</div>
|
| 70 |
+
|
| 71 |
+
<label class="shortpixel">
|
| 72 |
+
<img src="<?php echo esc_url( plugins_url( '', __file__ ) ); ?>/images/icon-shortpixel.png" alt="ShortPixel">
|
| 73 |
+
<a target="_blank" href="https://shortpixel.com/h/af/HUOYEBB31472"><?php echo esc_html__( 'We suggest using the ShortPixel image optimization plugin to optimize your images and get the best possible SEO results & load speed..', 'modula-gallery' ) ?></a>
|
| 74 |
+
</label>
|
| 75 |
|
| 76 |
+
</div>
|
| 77 |
+
<div class="field select-images">
|
| 78 |
+
<a class="waves-effect waves-light btn add-images">
|
| 79 |
+
<i class="mdi mdi-plus left"></i> <?php echo esc_html__( 'Add images', 'modula-gallery' ) ?></a>
|
| 80 |
+
<br> <label><?php echo esc_html__( 'You can add images now or later.', 'modula-gallery' ) ?></label>
|
| 81 |
|
| 82 |
+
<div class="images list-group"></div>
|
| 83 |
+
</div>
|
| 84 |
+
</fieldset>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 85 |
|
| 86 |
+
<footer class="page-footer">
|
| 87 |
+
<div class="progress loading hide">
|
| 88 |
+
<div class="indeterminate"></div>
|
| 89 |
+
</div>
|
| 90 |
|
| 91 |
+
<a class="waves-effect waves-yellow btn-flat prev"><?php echo esc_html__( 'Previous', 'modula-gallery' ) ?></a>
|
| 92 |
+
<a class="waves-effect waves-green btn-flat next"><?php echo esc_html__( 'Next', 'modula-gallery' ) ?></a>
|
| 93 |
+
</footer>
|
| 94 |
|
| 95 |
+
</form>
|
| 96 |
+
<div id="success" class="modal">
|
| 97 |
+
<div class="modal-content">
|
| 98 |
+
<h4><?php echo esc_html__( 'Success!', 'modula-gallery' ) ?></h4>
|
| 99 |
+
<p><?php echo esc_html__( 'Your gallery', 'modula-gallery' ) ?>
|
| 100 |
+
"<span class="gallery-name"></span>" <?php echo esc_html__( 'has been created. Copy the following shortcode:', 'modula-gallery' ) ?>
|
| 101 |
+
<br> <input type="text" class="code"><br>
|
| 102 |
+
<?php echo esc_html__( 'and paste it inside a post or a page. Otherwise click', 'modula-gallery' ) ?>
|
| 103 |
+
<a class='customize'><?php echo esc_html__( 'here', 'modula-gallery' ) ?></a> <?php echo esc_html__( 'to customize
|
| 104 |
+
the gallery.', 'modula-gallery' ) ?>
|
| 105 |
+
</p>
|
| 106 |
+
</div>
|
| 107 |
+
<div class="modal-'footer">
|
| 108 |
+
<a href="?page=modula-lite-admin" id="modal-close" class="waves-effect waves-green btn-flat modal-action"><?php echo esc_html__( 'Close', 'modula-gallery' ) ?></a>
|
| 109 |
+
</div>
|
| 110 |
+
</div>
|
| 111 |
|
| 112 |
+
<div id="error" class="modal">
|
| 113 |
+
<div class="modal-content">
|
| 114 |
+
<h4><?php echo esc_html__( 'Error!', 'modula-gallery' ) ?></h4>
|
| 115 |
+
<p><?php echo esc_html__( 'For some reason it was not possible to save your gallery', 'modula-gallery' ) ?></p>
|
| 116 |
+
</div>
|
| 117 |
+
<div class="modal-footer">
|
| 118 |
+
<a href="?page=modula-lite-admin" class="waves-effect waves-green btn-flat modal-action"><?php echo esc_html__( 'Close', 'modula-gallery' ) ?></a>
|
| 119 |
+
</div>
|
| 120 |
+
</div>
|
| 121 |
+
</div>
|
admin/css/style.css
CHANGED
|
@@ -1,1490 +1,1487 @@
|
|
| 1 |
-
@charset "UTF-8";
|
| 2 |
-
|
| 3 |
-
@font-face {
|
| 4 |
-
font-family: "modula-icons";
|
| 5 |
-
src:url("../font/modula/modula-icons.eot");
|
| 6 |
-
src:url("../font/modula/modula-icons.eot?#iefix") format("embedded-opentype"),
|
| 7 |
-
url("../font/modula/modula-icons.woff") format("woff"),
|
| 8 |
-
url("../font/modula/modula-icons.ttf") format("truetype"),
|
| 9 |
-
url("../font/modula/modula-icons.svg#modula-icons") format("svg");
|
| 10 |
-
font-weight: normal;
|
| 11 |
-
font-style: normal;
|
| 12 |
-
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
@font-face {
|
| 16 |
-
font-family: 'Roboto';
|
| 17 |
-
src: url('../font/roboto/Roboto-Regular-webfont.eot');
|
| 18 |
-
src: url('../font/roboto/Roboto-Regular-webfont.eot?#iefix') format('embedded-opentype'),
|
| 19 |
-
url('../font/roboto/Roboto-Regular-webfont.woff') format('woff'),
|
| 20 |
-
url('../font/roboto/Roboto-Regular-webfont.ttf') format('truetype'),
|
| 21 |
-
url('../font/roboto/Roboto-Regular-webfont.svg#robotoregular') format('svg');
|
| 22 |
-
font-weight: normal;
|
| 23 |
-
font-style: normal;
|
| 24 |
-
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
|
| 28 |
-
|
| 29 |
-
[data-icon]:before {
|
| 30 |
-
font-family: "modula-icons" !important;
|
| 31 |
-
content: attr(data-icon);
|
| 32 |
-
font-style: normal !important;
|
| 33 |
-
font-weight: normal !important;
|
| 34 |
-
font-variant: normal !important;
|
| 35 |
-
text-transform: none !important;
|
| 36 |
-
speak: none;
|
| 37 |
-
line-height: 1;
|
| 38 |
-
-webkit-font-smoothing: antialiased;
|
| 39 |
-
-moz-osx-font-smoothing: grayscale;
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
[class^="icon-"]:before,
|
| 43 |
-
[class*=" icon-"]:before {
|
| 44 |
-
font-family: "modula-icons" !important;
|
| 45 |
-
font-style: normal !important;
|
| 46 |
-
font-weight: normal !important;
|
| 47 |
-
font-variant: normal !important;
|
| 48 |
-
text-transform: none !important;
|
| 49 |
-
speak: none;
|
| 50 |
-
line-height: 1;
|
| 51 |
-
-webkit-font-smoothing: antialiased;
|
| 52 |
-
-moz-osx-font-smoothing: grayscale;
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
.icon-facebook:before {
|
| 56 |
-
content: "a";
|
| 57 |
-
}
|
| 58 |
-
.icon-pinterest:before {
|
| 59 |
-
content: "b";
|
| 60 |
-
}
|
| 61 |
-
.icon-twitter:before {
|
| 62 |
-
content: "c";
|
| 63 |
-
}
|
| 64 |
-
.icon-google-plus:before {
|
| 65 |
-
content: "d";
|
| 66 |
-
}
|
| 67 |
-
.icon-save-disk:before {
|
| 68 |
-
content: "e";
|
| 69 |
-
}
|
| 70 |
-
.icon-angle-up:before {
|
| 71 |
-
content: "f";
|
| 72 |
-
}
|
| 73 |
-
.icon-plus:before {
|
| 74 |
-
content: "g";
|
| 75 |
-
}
|
| 76 |
-
.icon-check-mark-2:before {
|
| 77 |
-
content: "h";
|
| 78 |
-
}
|
| 79 |
-
.icon-chevron-right:before {
|
| 80 |
-
content: "i";
|
| 81 |
-
}
|
| 82 |
-
.dark-content{
|
| 83 |
-
opacity: 0.5;
|
| 84 |
-
}
|
| 85 |
-
body
|
| 86 |
-
{
|
| 87 |
-
margin:0px;
|
| 88 |
-
padding-bottom: 65px;
|
| 89 |
-
float: left;
|
| 90 |
-
width: 100%;
|
| 91 |
-
overflow: visible!important;
|
| 92 |
-
}
|
| 93 |
-
.image-size-section
|
| 94 |
-
{
|
| 95 |
-
margin: 10px;
|
| 96 |
-
padding: 5px;
|
| 97 |
-
}
|
| 98 |
-
strong {
|
| 99 |
-
font-weight:700;
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
/*.shortcode-section
|
| 103 |
-
{
|
| 104 |
-
margin: 48px 0;
|
| 105 |
-
padding-left: 43px;
|
| 106 |
-
font-size: 1rem;
|
| 107 |
-
}*/
|
| 108 |
-
|
| 109 |
-
.image-size-section select{
|
| 110 |
-
margin-top: 5px;
|
| 111 |
-
width: 100%;
|
| 112 |
-
}
|
| 113 |
-
.page-footer .progress {
|
| 114 |
-
display: none;
|
| 115 |
-
}
|
| 116 |
-
.hide
|
| 117 |
-
{
|
| 118 |
-
display: none;
|
| 119 |
-
}
|
| 120 |
-
.editimage-right
|
| 121 |
-
{
|
| 122 |
-
float:right;
|
| 123 |
-
width:60%;
|
| 124 |
-
display: block;
|
| 125 |
-
margin-left:5px;
|
| 126 |
-
}
|
| 127 |
-
#image-panel textarea
|
| 128 |
-
{
|
| 129 |
-
color:black;
|
| 130 |
-
}
|
| 131 |
-
#image-panel select:not([name=halign]):not([name=valign])
|
| 132 |
-
{
|
| 133 |
-
width:100%;
|
| 134 |
-
}
|
| 135 |
-
#image-panel select
|
| 136 |
-
{
|
| 137 |
-
color:black;
|
| 138 |
-
}
|
| 139 |
-
.text-input
|
| 140 |
-
{
|
| 141 |
-
border:1px solid #aaa;
|
| 142 |
-
width: 100%;
|
| 143 |
-
display: block;
|
| 144 |
-
}
|
| 145 |
-
.label-text
|
| 146 |
-
{
|
| 147 |
-
color:black;
|
| 148 |
-
font-size: 1rem;
|
| 149 |
-
margin: 0px 5px 0px 0px;
|
| 150 |
-
font-weight: bold;
|
| 151 |
-
}
|
| 152 |
-
.label-panel
|
| 153 |
-
{
|
| 154 |
-
width: 80px;
|
| 155 |
-
float:left;
|
| 156 |
-
}
|
| 157 |
-
.shortpixel {
|
| 158 |
-
display: block;
|
| 159 |
-
}
|
| 160 |
-
.shortpixel img {
|
| 161 |
-
position:relative;
|
| 162 |
-
top:5px;
|
| 163 |
-
}
|
| 164 |
-
.dropdown-menu
|
| 165 |
-
{
|
| 166 |
-
width: 100%;
|
| 167 |
-
}
|
| 168 |
-
#modula-wizard {
|
| 169 |
-
margin: 40px auto;
|
| 170 |
-
padding: 20px;
|
| 171 |
-
max-width: 600px;
|
| 172 |
-
box-shadow: #ccc 0px 0px 40px;
|
| 173 |
-
border-radius: 4px;
|
| 174 |
-
background: #fff;
|
| 175 |
-
}
|
| 176 |
-
#modula-wizard fieldset {
|
| 177 |
-
border: 0;
|
| 178 |
-
display: none;
|
| 179 |
-
}
|
| 180 |
-
#modula-wizard fieldset:first-of-type {
|
| 181 |
-
display: block;
|
| 182 |
-
}
|
| 183 |
-
#modula-wizard fieldset select {
|
| 184 |
-
height: 3rem;
|
| 185 |
-
}
|
| 186 |
-
#modula-wizard h1 {
|
| 187 |
-
font-size: 32px;
|
| 188 |
-
text-transform: uppercase;
|
| 189 |
-
text-align: center;
|
| 190 |
-
margin: 0;
|
| 191 |
-
}
|
| 192 |
-
#modula-wizard h1 small {
|
| 193 |
-
font-size: 12px;
|
| 194 |
-
}
|
| 195 |
-
#modula-wizard h2 {
|
| 196 |
-
font-size: 16px;
|
| 197 |
-
text-transform: uppercase;
|
| 198 |
-
text-align: center;
|
| 199 |
-
margin: 0;
|
| 200 |
-
margin-bottom: 50px;
|
| 201 |
-
line-height: 1;
|
| 202 |
-
}
|
| 203 |
-
#modula-wizard h5 {
|
| 204 |
-
margin-bottom: 20px;
|
| 205 |
-
}
|
| 206 |
-
#modula-wizard .field {
|
| 207 |
-
margin-bottom: 40px;
|
| 208 |
-
}
|
| 209 |
-
#modula-wizard .images {
|
| 210 |
-
padding: 10px;
|
| 211 |
-
max-height: 300px;
|
| 212 |
-
overflow: auto;
|
| 213 |
-
}
|
| 214 |
-
#modula-wizard .images .tile {
|
| 215 |
-
margin: 0 10px 10px 0;
|
| 216 |
-
width: 23%;
|
| 217 |
-
display: inline-block;
|
| 218 |
-
position: relative;
|
| 219 |
-
}
|
| 220 |
-
#modula-wizard .images .tile img {
|
| 221 |
-
width: 100%;
|
| 222 |
-
}
|
| 223 |
-
#modula-wizard .images .tile a {
|
| 224 |
-
position: absolute;
|
| 225 |
-
top: -5px;
|
| 226 |
-
right: -5px;
|
| 227 |
-
z-index: 10;
|
| 228 |
-
display: none;
|
| 229 |
-
width: 26px;
|
| 230 |
-
height: 26px;
|
| 231 |
-
line-height: 26px;
|
| 232 |
-
}
|
| 233 |
-
|
| 234 |
-
#modula-wizard .images .tile a i {
|
| 235 |
-
line-height: 26px;
|
| 236 |
-
font-size: 1.2rem;
|
| 237 |
-
}
|
| 238 |
-
#modula-wizard .images .tile:hover a {
|
| 239 |
-
display: block;
|
| 240 |
-
}
|
| 241 |
-
#modula-wizard .images .tile:nth-child(4n) {
|
| 242 |
-
margin-right: 0;
|
| 243 |
-
}
|
| 244 |
-
#modula-wizard footer {
|
| 245 |
-
background: transparent;
|
| 246 |
-
text-align: right;
|
| 247 |
-
}
|
| 248 |
-
#modula-wizard footer .prev {
|
| 249 |
-
visibility: hidden;
|
| 250 |
-
}
|
| 251 |
-
#wpcontent {
|
| 252 |
-
padding-left: 0;
|
| 253 |
-
}
|
| 254 |
-
#gallery-list {
|
| 255 |
-
margin-top: 2rem;
|
| 256 |
-
}
|
| 257 |
-
#gallery-list .card {
|
| 258 |
-
background-color: #6C838B;
|
| 259 |
-
padding: 0;
|
| 260 |
-
border: none !important;
|
| 261 |
-
}
|
| 262 |
-
#gallery-list .card .data {
|
| 263 |
-
background-size: cover;
|
| 264 |
-
background-position: 50% 50%;
|
| 265 |
-
}
|
| 266 |
-
|
| 267 |
-
.waves-light.btn {
|
| 268 |
-
color: #fff;
|
| 269 |
-
}
|
| 270 |
-
.waves-light.btn:hover {
|
| 271 |
-
color: #fff;
|
| 272 |
-
}
|
| 273 |
-
.card {
|
| 274 |
-
padding: 0;
|
| 275 |
-
min-width: 0;
|
| 276 |
-
max-width: 999em;
|
| 277 |
-
}
|
| 278 |
-
#top {
|
| 279 |
-
padding: 1rem 0 3rem 40px;
|
| 280 |
-
/*background-image: url('../images/colors.jpg');*/
|
| 281 |
-
background-repeat: repeat-x;
|
| 282 |
-
background-position: left bottom;
|
| 283 |
-
font-family: Roboto, 'sans-serif';
|
| 284 |
-
}
|
| 285 |
-
#top h1 {
|
| 286 |
-
color: #fff;
|
| 287 |
-
font-size: 3.4rem;
|
| 288 |
-
margin: 16px 0 25px 0;
|
| 289 |
-
font-weight: 300;
|
| 290 |
-
}
|
| 291 |
-
#top h1 small {
|
| 292 |
-
font-size: 1rem;
|
| 293 |
-
}
|
| 294 |
-
#top h4 {
|
| 295 |
-
margin: 17px 0 13px 0;
|
| 296 |
-
}
|
| 297 |
-
#support-page {
|
| 298 |
-
background: #fff;
|
| 299 |
-
font-family: Roboto, 'sans-serif';
|
| 300 |
-
padding: 40px;
|
| 301 |
-
}
|
| 302 |
-
.widefat .edit_image_form td {
|
| 303 |
-
border-bottom: 0;
|
| 304 |
-
border-top: 0;
|
| 305 |
-
}
|
| 306 |
-
|
| 307 |
-
.widefat th, .widefat td {
|
| 308 |
-
overflow: visible;
|
| 309 |
-
}
|
| 310 |
-
|
| 311 |
-
.widefat tfoot th:first-of-type {
|
| 312 |
-
-webkit-border-bottom-left-radius: 0;
|
| 313 |
-
border-bottom-left-radius: 0;
|
| 314 |
-
}
|
| 315 |
-
.widefat tfoot th:last-of-type {
|
| 316 |
-
-webkit-border-bottom-right-radius: 0;
|
| 317 |
-
border-bottom-rigth-radius: 0;
|
| 318 |
-
}
|
| 319 |
-
.widefat thead th:first-of-type {
|
| 320 |
-
-webkit-border-top-left-radius: 0;
|
| 321 |
-
border-bottom-top-radius: 0;
|
| 322 |
-
}
|
| 323 |
-
.widefat thead th:last-of-type {
|
| 324 |
-
-webkit-border-top-rigth-radius: 0;
|
| 325 |
-
border-top-right-radius: 0;
|
| 326 |
-
}
|
| 327 |
-
|
| 328 |
-
#wpcontent {
|
| 329 |
-
margin-left: 146px;
|
| 330 |
-
padding-left: 20px;
|
| 331 |
-
}
|
| 332 |
-
#support-page p {
|
| 333 |
-
font-size: 16px;
|
| 334 |
-
color: #666;
|
| 335 |
-
}
|
| 336 |
-
#support-page ul {
|
| 337 |
-
margin: 40px 20px;
|
| 338 |
-
}
|
| 339 |
-
#support-page ul li {
|
| 340 |
-
list-style-type: circle;
|
| 341 |
-
font-size: 18px;
|
| 342 |
-
line-height: 1.5;
|
| 343 |
-
}
|
| 344 |
-
#support-page .buttons {
|
| 345 |
-
margin-top: 40px;
|
| 346 |
-
}
|
| 347 |
-
.ui-dialog.noTitle .ui-dialog-titlebar {
|
| 348 |
-
display: none;
|
| 349 |
-
}
|
| 350 |
-
.modula-header
|
| 351 |
-
{
|
| 352 |
-
background-color: #51AD31;
|
| 353 |
-
margin-left:-10px;
|
| 354 |
-
}
|
| 355 |
-
|
| 356 |
-
.modula-header h1
|
| 357 |
-
{
|
| 358 |
-
font-weight: bolder !important;
|
| 359 |
-
}
|
| 360 |
-
.modula-header h4
|
| 361 |
-
{
|
| 362 |
-
color: white;
|
| 363 |
-
}
|
| 364 |
-
|
| 365 |
-
.ui-dialog .loading {
|
| 366 |
-
background: url(../loading.gif) no-repeat;
|
| 367 |
-
width: 220px;
|
| 368 |
-
height: 19px;
|
| 369 |
-
margin:50px auto 0 auto;
|
| 370 |
-
}
|
| 371 |
-
.collapsible {
|
| 372 |
-
padding:20px 70px 0px 40px !important;
|
| 373 |
-
border: none !important;
|
| 374 |
-
box-shadow: none !important;
|
| 375 |
-
}
|
| 376 |
-
.bd .gallery-hd {
|
| 377 |
-
margin: 60px 0;
|
| 378 |
-
}
|
| 379 |
-
.bd .gallery-hd code {
|
| 380 |
-
font-size: 1rem;
|
| 381 |
-
}
|
| 382 |
-
.input-field {
|
| 383 |
-
margin-bottom: 20px;
|
| 384 |
-
}
|
| 385 |
-
.input-field label {
|
| 386 |
-
left: 0;
|
| 387 |
-
}
|
| 388 |
-
#ftg-wizard {
|
| 389 |
-
margin: 40px auto;
|
| 390 |
-
padding: 20px;
|
| 391 |
-
max-width: 600px;
|
| 392 |
-
box-shadow: #ccc 0px 0px 40px;
|
| 393 |
-
border-radius: 4px;
|
| 394 |
-
background: #fff;
|
| 395 |
-
}
|
| 396 |
-
#ftg-wizard fieldset {
|
| 397 |
-
border: 0;
|
| 398 |
-
display: none;
|
| 399 |
-
}
|
| 400 |
-
#ftg-wizard fieldset:first-of-type {
|
| 401 |
-
display: block;
|
| 402 |
-
}
|
| 403 |
-
#ftg-wizard fieldset select {
|
| 404 |
-
height: 3rem;
|
| 405 |
-
}
|
| 406 |
-
#ftg-wizard h1 {
|
| 407 |
-
font-size: 32px;
|
| 408 |
-
text-transform: uppercase;
|
| 409 |
-
text-align: center;
|
| 410 |
-
margin: 0;
|
| 411 |
-
}
|
| 412 |
-
#ftg-wizard h1 small {
|
| 413 |
-
font-size: 12px;
|
| 414 |
-
}
|
| 415 |
-
#ftg-wizard h2 {
|
| 416 |
-
font-size: 16px;
|
| 417 |
-
text-transform: uppercase;
|
| 418 |
-
text-align: center;
|
| 419 |
-
margin: 0;
|
| 420 |
-
margin-bottom: 50px;
|
| 421 |
-
line-height: 1;
|
| 422 |
-
}
|
| 423 |
-
#ftg-wizard h5 {
|
| 424 |
-
margin-bottom: 20px;
|
| 425 |
-
}
|
| 426 |
-
#ftg-wizard .field {
|
| 427 |
-
margin-bottom: 40px;
|
| 428 |
-
}
|
| 429 |
-
#ftg-wizard .images {
|
| 430 |
-
padding: 10px;
|
| 431 |
-
max-height: 300px;
|
| 432 |
-
overflow: auto;
|
| 433 |
-
}
|
| 434 |
-
#ftg-wizard .images .tile {
|
| 435 |
-
margin: 0 10px 10px 0;
|
| 436 |
-
width: 23%;
|
| 437 |
-
display: inline-block;
|
| 438 |
-
position: relative;
|
| 439 |
-
}
|
| 440 |
-
#ftg-wizard .images .tile img {
|
| 441 |
-
width: 100%;
|
| 442 |
-
}
|
| 443 |
-
#ftg-wizard .images .tile a {
|
| 444 |
-
position: absolute;
|
| 445 |
-
top: -5px;
|
| 446 |
-
right: -5px;
|
| 447 |
-
z-index: 10;
|
| 448 |
-
display: none;
|
| 449 |
-
width: 26px;
|
| 450 |
-
height: 26px;
|
| 451 |
-
line-height: 26px;
|
| 452 |
-
}
|
| 453 |
-
#ftg-wizard .images .tile a i {
|
| 454 |
-
line-height: 26px;
|
| 455 |
-
font-size: 1.2rem;
|
| 456 |
-
}
|
| 457 |
-
#ftg-wizard .images .tile:hover a {
|
| 458 |
-
display: block;
|
| 459 |
-
}
|
| 460 |
-
#ftg-wizard .images .tile:nth-child(4n) {
|
| 461 |
-
margin-right: 0;
|
| 462 |
-
}
|
| 463 |
-
#ftg-wizard footer {
|
| 464 |
-
background: transparent;
|
| 465 |
-
text-align: right;
|
| 466 |
-
}
|
| 467 |
-
#ftg-wizard footer .prev {
|
| 468 |
-
visibility: hidden;
|
| 469 |
-
}
|
| 470 |
-
#ftg-wizard .loading {
|
| 471 |
-
display: none;
|
| 472 |
-
}
|
| 473 |
-
.modal p {
|
| 474 |
-
font-size: 16px;
|
| 475 |
-
}
|
| 476 |
-
.modal #modal-close
|
| 477 |
-
{
|
| 478 |
-
float: right;
|
| 479 |
-
}
|
| 480 |
-
.modal .code {
|
| 481 |
-
display: block;
|
| 482 |
-
margin: 20px;
|
| 483 |
-
padding: 10px;
|
| 484 |
-
font-size: 16px;
|
| 485 |
-
}
|
| 486 |
-
.modal a {
|
| 487 |
-
outline: 0;
|
| 488 |
-
}
|
| 489 |
-
.modal .modal-content,
|
| 490 |
-
.modal .modal-footer {
|
| 491 |
-
background: #fff;
|
| 492 |
-
}
|
| 493 |
-
#gallery-list .card p {
|
| 494 |
-
height: 40px;
|
| 495 |
-
overflow: hidden;
|
| 496 |
-
padding: 4px 8px;
|
| 497 |
-
border-radius: 4px;
|
| 498 |
-
}
|
| 499 |
-
#gallery-list .card .card-action {
|
| 500 |
-
padding: 5px 5px;
|
| 501 |
-
text-align: center;
|
| 502 |
-
border:0;
|
| 503 |
-
}
|
| 504 |
-
#gallery-list .card.with-image .card-action a {
|
| 505 |
-
transition:all .2s;
|
| 506 |
-
}
|
| 507 |
-
#gallery-list .card .card-action a {
|
| 508 |
-
margin: 0 10px;
|
| 509 |
-
font-size: 20px;
|
| 510 |
-
color: #fff;
|
| 511 |
-
padding: 4px;
|
| 512 |
-
}
|
| 513 |
-
#gallery-list .card .card-image {
|
| 514 |
-
display: inline-block;
|
| 515 |
-
width: 150px;
|
| 516 |
-
height: 150px;
|
| 517 |
-
overflow: hidden;
|
| 518 |
-
}
|
| 519 |
-
#gallery-list .card .card-content {
|
| 520 |
-
height: 180px;
|
| 521 |
-
cursor: pointer;
|
| 522 |
-
letter-spacing: 0.3px;
|
| 523 |
-
}
|
| 524 |
-
#gallery-list .card.with-image .card-action,
|
| 525 |
-
#gallery-list .card.with-image .card-content {
|
| 526 |
-
background: rgba(0, 0, 0, .30);
|
| 527 |
-
transition:background .4s;
|
| 528 |
-
}
|
| 529 |
-
#gallery-list .card.with-image:hover .card-action,
|
| 530 |
-
#gallery-list .card.with-image:hover .card-content {
|
| 531 |
-
background: rgba(0, 0, 0, .60);
|
| 532 |
-
}
|
| 533 |
-
#gallery-list .card .card-title {
|
| 534 |
-
line-height: 32px;
|
| 535 |
-
margin-bottom: 18px;
|
| 536 |
-
display: block;
|
| 537 |
-
font-weight: 400;
|
| 538 |
-
padding: 4px 8px;
|
| 539 |
-
border-radius: 4px;
|
| 540 |
-
}
|
| 541 |
-
|
| 542 |
-
#edit-gallery .tab {
|
| 543 |
-
padding: 20px;
|
| 544 |
-
}
|
| 545 |
-
#edit-gallery label {
|
| 546 |
-
color: #333;
|
| 547 |
-
font-size: 1rem;
|
| 548 |
-
top: 0.1rem;
|
| 549 |
-
height: auto;
|
| 550 |
-
}
|
| 551 |
-
#edit-gallery .input-field {
|
| 552 |
-
margin-bottom: 0;
|
| 553 |
-
}
|
| 554 |
-
#edit-gallery .input-field input[type=text],
|
| 555 |
-
#edit-gallery .input-field input[type=password],
|
| 556 |
-
#edit-gallery .input-field input[type=email],
|
| 557 |
-
#edit-gallery .input-field input[type=url],
|
| 558 |
-
#edit-gallery .input-field input[type=date],
|
| 559 |
-
#edit-gallery .input-field input[type=tel],
|
| 560 |
-
#edit-gallery .input-field input[type=number],
|
| 561 |
-
#edit-gallery .input-field input[type=search],
|
| 562 |
-
#edit-gallery .input-field textarea.materialize-textarea {
|
| 563 |
-
font-size: 2rem;
|
| 564 |
-
}
|
| 565 |
-
#edit-gallery select {
|
| 566 |
-
font-size: 1rem;
|
| 567 |
-
background: #fff;
|
| 568 |
-
}
|
| 569 |
-
#edit-gallery .jump-head {
|
| 570 |
-
border-bottom: 2px solid rgba(0, 0, 0, 0.3);
|
| 571 |
-
padding: 20px 0;
|
| 572 |
-
}
|
| 573 |
-
#edit-gallery .jump-head select {
|
| 574 |
-
height: 2rem;
|
| 575 |
-
display: inline;
|
| 576 |
-
}
|
| 577 |
-
#edit-gallery .jump {
|
| 578 |
-
width: auto;
|
| 579 |
-
}
|
| 580 |
-
.jump-head
|
| 581 |
-
{
|
| 582 |
-
padding: 40px 0px 40px 10px;
|
| 583 |
-
}
|
| 584 |
-
.bullet-menu {
|
| 585 |
-
position: fixed;
|
| 586 |
-
bottom: 20px;
|
| 587 |
-
right: 50px;
|
| 588 |
-
}
|
| 589 |
-
.update-gallery {
|
| 590 |
-
position: fixed;
|
| 591 |
-
bottom: 20px;
|
| 592 |
-
right:
|
| 593 |
-
}
|
| 594 |
-
.collapsible li {
|
| 595 |
-
margin-bottom: 7px;
|
| 596 |
-
margin-left:-20px;
|
| 597 |
-
}
|
| 598 |
-
.collapsible li .alternate {
|
| 599 |
-
background: transparent;
|
| 600 |
-
}
|
| 601 |
-
.collapsible li .collapsible-header {
|
| 602 |
-
font-size: 2rem;
|
| 603 |
-
height: 5rem;
|
| 604 |
-
line-height: 5rem;
|
| 605 |
-
}
|
| 606 |
-
.collapsible li .collapsible-header .fa-chevron-right{
|
| 607 |
-
float: right;
|
| 608 |
-
color: darkgray;
|
| 609 |
-
}
|
| 610 |
-
.collapsible li .collapsible-header i {
|
| 611 |
-
color: #51AD31;
|
| 612 |
-
line-height: 5rem;
|
| 613 |
-
}
|
| 614 |
-
.collapsible li .collapsible-header span{
|
| 615 |
-
color: #51AD31;
|
| 616 |
-
}
|
| 617 |
-
.collapsible li .field .text {
|
| 618 |
-
background: #fff;
|
| 619 |
-
padding: 20px;
|
| 620 |
-
}
|
| 621 |
-
.collapsible li .field .text .pickColor {
|
| 622 |
-
height: auto;
|
| 623 |
-
}
|
| 624 |
-
.collapsible li .field .text .wp-color-result {
|
| 625 |
-
border-radius: 0;
|
| 626 |
-
-webkit-border-radius: 0;
|
| 627 |
-
height: 24px;
|
| 628 |
-
}
|
| 629 |
-
.collapsible li .field .text .wp-color-result::after {
|
| 630 |
-
border-radius: 0;
|
| 631 |
-
-webkit-border-radius: 0;
|
| 632 |
-
}
|
| 633 |
-
.collapsible li textarea {
|
| 634 |
-
height: 100px;
|
| 635 |
-
}
|
| 636 |
-
.collapsible li th,
|
| 637 |
-
.collapsible li td {
|
| 638 |
-
vertical-align:
|
| 639 |
-
}
|
| 640 |
-
.collapsible li th {
|
| 641 |
-
border-radius: 0;
|
| 642 |
-
}
|
| 643 |
-
.collapsible li th[scope=row] {
|
| 644 |
-
width: 200px;
|
| 645 |
-
|
| 646 |
-
|
| 647 |
-
|
| 648 |
-
|
| 649 |
-
|
| 650 |
-
|
| 651 |
-
|
| 652 |
-
|
| 653 |
-
|
| 654 |
-
|
| 655 |
-
|
| 656 |
-
|
| 657 |
-
|
| 658 |
-
|
| 659 |
-
|
| 660 |
-
|
| 661 |
-
|
| 662 |
-
|
| 663 |
-
|
| 664 |
-
|
| 665 |
-
|
| 666 |
-
|
| 667 |
-
|
| 668 |
-
|
| 669 |
-
|
| 670 |
-
|
| 671 |
-
|
| 672 |
-
|
| 673 |
-
|
| 674 |
-
|
| 675 |
-
|
| 676 |
-
|
| 677 |
-
|
| 678 |
-
|
| 679 |
-
|
| 680 |
-
|
| 681 |
-
|
| 682 |
-
|
| 683 |
-
border-top-
|
| 684 |
-
border-
|
| 685 |
-
border-bottom-
|
| 686 |
-
|
| 687 |
-
|
| 688 |
-
|
| 689 |
-
|
| 690 |
-
|
| 691 |
-
|
| 692 |
-
|
| 693 |
-
|
| 694 |
-
|
| 695 |
-
|
| 696 |
-
|
| 697 |
-
|
| 698 |
-
|
| 699 |
-
|
| 700 |
-
|
| 701 |
-
|
| 702 |
-
|
| 703 |
-
|
| 704 |
-
|
| 705 |
-
|
| 706 |
-
|
| 707 |
-
|
| 708 |
-
|
| 709 |
-
|
| 710 |
-
|
| 711 |
-
|
| 712 |
-
padding-
|
| 713 |
-
|
| 714 |
-
|
| 715 |
-
|
| 716 |
-
|
| 717 |
-
|
| 718 |
-
|
| 719 |
-
|
| 720 |
-
|
| 721 |
-
|
| 722 |
-
|
| 723 |
-
|
| 724 |
-
|
| 725 |
-
|
| 726 |
-
|
| 727 |
-
|
| 728 |
-
|
| 729 |
-
|
| 730 |
-
|
| 731 |
-
|
| 732 |
-
/*
|
| 733 |
-
|
| 734 |
-
|
| 735 |
-
|
| 736 |
-
|
| 737 |
-
|
| 738 |
-
|
| 739 |
-
|
| 740 |
-
|
| 741 |
-
|
| 742 |
-
|
| 743 |
-
|
| 744 |
-
|
| 745 |
-
|
| 746 |
-
|
| 747 |
-
|
| 748 |
-
font-
|
| 749 |
-
|
| 750 |
-
|
| 751 |
-
|
| 752 |
-
|
| 753 |
-
|
| 754 |
-
|
| 755 |
-
|
| 756 |
-
|
| 757 |
-
|
| 758 |
-
|
| 759 |
-
|
| 760 |
-
|
| 761 |
-
|
| 762 |
-
|
| 763 |
-
|
| 764 |
-
|
| 765 |
-
|
| 766 |
-
|
| 767 |
-
|
| 768 |
-
|
| 769 |
-
|
| 770 |
-
|
| 771 |
-
|
| 772 |
-
|
| 773 |
-
|
| 774 |
-
|
| 775 |
-
|
| 776 |
-
|
| 777 |
-
|
| 778 |
-
|
| 779 |
-
|
| 780 |
-
|
| 781 |
-
|
| 782 |
-
|
| 783 |
-
|
| 784 |
-
|
| 785 |
-
|
| 786 |
-
|
| 787 |
-
|
| 788 |
-
|
| 789 |
-
|
| 790 |
-
|
| 791 |
-
|
| 792 |
-
|
| 793 |
-
|
| 794 |
-
|
| 795 |
-
|
| 796 |
-
|
| 797 |
-
|
| 798 |
-
|
| 799 |
-
|
| 800 |
-
|
| 801 |
-
|
| 802 |
-
|
| 803 |
-
|
| 804 |
-
|
| 805 |
-
|
| 806 |
-
|
| 807 |
-
|
| 808 |
-
|
| 809 |
-
|
| 810 |
-
|
| 811 |
-
|
| 812 |
-
|
| 813 |
-
|
| 814 |
-
|
| 815 |
-
|
| 816 |
-
|
| 817 |
-
|
| 818 |
-
|
| 819 |
-
|
| 820 |
-
|
| 821 |
-
|
| 822 |
-
|
| 823 |
-
|
| 824 |
-
|
| 825 |
-
|
| 826 |
-
|
| 827 |
-
|
| 828 |
-
|
| 829 |
-
|
| 830 |
-
|
| 831 |
-
|
| 832 |
-
|
| 833 |
-
|
| 834 |
-
|
| 835 |
-
|
| 836 |
-
|
| 837 |
-
|
| 838 |
-
|
| 839 |
-
|
| 840 |
-
|
| 841 |
-
|
| 842 |
-
|
| 843 |
-
|
| 844 |
-
|
| 845 |
-
|
| 846 |
-
|
| 847 |
-
|
| 848 |
-
|
| 849 |
-
|
| 850 |
-
|
| 851 |
-
|
| 852 |
-
|
| 853 |
-
|
| 854 |
-
|
| 855 |
-
|
| 856 |
-
|
| 857 |
-
|
| 858 |
-
|
| 859 |
-
|
| 860 |
-
|
| 861 |
-
|
| 862 |
-
|
| 863 |
-
|
| 864 |
-
|
| 865 |
-
|
| 866 |
-
|
| 867 |
-
|
| 868 |
-
|
| 869 |
-
|
| 870 |
-
|
| 871 |
-
|
| 872 |
-
|
| 873 |
-
|
| 874 |
-
|
| 875 |
-
|
| 876 |
-
height:
|
| 877 |
-
|
| 878 |
-
text-
|
| 879 |
-
|
| 880 |
-
|
| 881 |
-
font-
|
| 882 |
-
|
| 883 |
-
|
| 884 |
-
|
| 885 |
-
|
| 886 |
-
|
| 887 |
-
|
| 888 |
-
|
| 889 |
-
#images .
|
| 890 |
-
|
| 891 |
-
|
| 892 |
-
|
| 893 |
-
margin
|
| 894 |
-
}
|
| 895 |
-
#images .bulk h4 {
|
| 896 |
-
margin:0 0 4px 0;
|
| 897 |
-
color: #fff;
|
| 898 |
-
}
|
| 899 |
-
#images .bulk .checkbox {
|
| 900 |
-
display: inline-block;
|
| 901 |
-
padding-left: 20px;
|
| 902 |
-
margin-right: 15px;
|
| 903 |
-
}
|
| 904 |
-
#images .bulk .options a {
|
| 905 |
-
display: inline-block;
|
| 906 |
-
margin-right: 10px;
|
| 907 |
-
color: #fff;
|
| 908 |
-
text-decoration: none;
|
| 909 |
-
}
|
| 910 |
-
#images .bulk .options a:hover {
|
| 911 |
-
/*color: #fff;*/
|
| 912 |
-
}
|
| 913 |
-
#images .bulk .panel {
|
| 914 |
-
display: none;
|
| 915 |
-
padding: 12px;
|
| 916 |
-
background: transparent;
|
| 917 |
-
margin-top: 5px;
|
| 918 |
-
/*border: 1px solid #333222;*/
|
| 919 |
-
}
|
| 920 |
-
#images .bulk .panel strong {
|
| 921 |
-
color: black;
|
| 922 |
-
display: block;
|
| 923 |
-
margin-bottom: 4px;
|
| 924 |
-
}
|
| 925 |
-
|
| 926 |
-
#images .bulk .panel p {
|
| 927 |
-
padding: 10px 0px 10px 0px;
|
| 928 |
-
margin-bottom: 0;
|
| 929 |
-
color: black;
|
| 930 |
-
}
|
| 931 |
-
#images .tips {
|
| 932 |
-
margin-bottom: 15px;
|
| 933 |
-
}
|
| 934 |
-
#images .tip {
|
| 935 |
-
background: url('../images/tip.png') no-repeat;
|
| 936 |
-
text-indent: 21px;
|
| 937 |
-
display: block;
|
| 938 |
-
margin: 0 0 0 15px;
|
| 939 |
-
}
|
| 940 |
-
#images .shortpixel {
|
| 941 |
-
|
| 942 |
-
}
|
| 943 |
-
#images .btn.action {
|
| 944 |
-
margin-bottom: 0;
|
| 945 |
-
}
|
| 946 |
-
|
| 947 |
-
.clearfix:after {
|
| 948 |
-
content: ".";
|
| 949 |
-
display: block;
|
| 950 |
-
clear: both;
|
| 951 |
-
visibility: hidden;
|
| 952 |
-
line-height: 0;
|
| 953 |
-
height: 0;
|
| 954 |
-
}
|
| 955 |
-
#image-panel .buttons {
|
| 956 |
-
text-align: right;
|
| 957 |
-
margin-top: 10px;
|
| 958 |
-
clear: both;
|
| 959 |
-
}
|
| 960 |
-
#image-panel .buttons a {
|
| 961 |
-
margin-left: 10px;
|
| 962 |
-
}
|
| 963 |
-
|
| 964 |
-
|
| 965 |
-
|
| 966 |
-
|
| 967 |
-
|
| 968 |
-
|
| 969 |
-
|
| 970 |
-
|
| 971 |
-
|
| 972 |
-
|
| 973 |
-
}
|
| 974 |
-
#images .actions
|
| 975 |
-
|
| 976 |
-
|
| 977 |
-
|
| 978 |
-
|
| 979 |
-
|
| 980 |
-
|
| 981 |
-
|
| 982 |
-
|
| 983 |
-
|
| 984 |
-
|
| 985 |
-
|
| 986 |
-
|
| 987 |
-
|
| 988 |
-
|
| 989 |
-
#
|
| 990 |
-
|
| 991 |
-
|
| 992 |
-
|
| 993 |
-
|
| 994 |
-
|
| 995 |
-
|
| 996 |
-
|
| 997 |
-
|
| 998 |
-
|
| 999 |
-
|
| 1000 |
-
|
| 1001 |
-
|
| 1002 |
-
|
| 1003 |
-
|
| 1004 |
-
|
| 1005 |
-
|
| 1006 |
-
|
| 1007 |
-
|
| 1008 |
-
|
| 1009 |
-
|
| 1010 |
-
|
| 1011 |
-
|
| 1012 |
-
|
| 1013 |
-
|
| 1014 |
-
|
| 1015 |
-
|
| 1016 |
-
|
| 1017 |
-
|
| 1018 |
-
|
| 1019 |
-
|
| 1020 |
-
|
| 1021 |
-
|
| 1022 |
-
|
| 1023 |
-
|
| 1024 |
-
|
| 1025 |
-
|
| 1026 |
-
|
| 1027 |
-
#image-panel-model .right-side textarea {
|
| 1028 |
-
|
| 1029 |
-
}
|
| 1030 |
-
#image-panel-model .right-side
|
| 1031 |
-
|
| 1032 |
-
|
| 1033 |
-
|
| 1034 |
-
|
| 1035 |
-
|
| 1036 |
-
}
|
| 1037 |
-
#
|
| 1038 |
-
|
| 1039 |
-
|
| 1040 |
-
|
| 1041 |
-
|
| 1042 |
-
|
| 1043 |
-
|
| 1044 |
-
|
| 1045 |
-
|
| 1046 |
-
|
| 1047 |
-
|
| 1048 |
-
|
| 1049 |
-
|
| 1050 |
-
|
| 1051 |
-
|
| 1052 |
-
}
|
| 1053 |
-
#image-list .card
|
| 1054 |
-
|
| 1055 |
-
|
| 1056 |
-
|
| 1057 |
-
|
| 1058 |
-
|
| 1059 |
-
|
| 1060 |
-
|
| 1061 |
-
|
| 1062 |
-
|
| 1063 |
-
|
| 1064 |
-
|
| 1065 |
-
|
| 1066 |
-
|
| 1067 |
-
|
| 1068 |
-
}
|
| 1069 |
-
#
|
| 1070 |
-
|
| 1071 |
-
|
| 1072 |
-
|
| 1073 |
-
|
| 1074 |
-
|
| 1075 |
-
|
| 1076 |
-
|
| 1077 |
-
|
| 1078 |
-
|
| 1079 |
-
|
| 1080 |
-
|
| 1081 |
-
|
| 1082 |
-
|
| 1083 |
-
|
| 1084 |
-
|
| 1085 |
-
|
| 1086 |
-
|
| 1087 |
-
|
| 1088 |
-
|
| 1089 |
-
|
| 1090 |
-
|
| 1091 |
-
|
| 1092 |
-
|
| 1093 |
-
|
| 1094 |
-
|
| 1095 |
-
|
| 1096 |
-
|
| 1097 |
-
|
| 1098 |
-
|
| 1099 |
-
|
| 1100 |
-
|
| 1101 |
-
|
| 1102 |
-
|
| 1103 |
-
|
| 1104 |
-
|
| 1105 |
-
|
| 1106 |
-
*
|
| 1107 |
-
*
|
| 1108 |
-
|
| 1109 |
-
|
| 1110 |
-
|
| 1111 |
-
|
| 1112 |
-
|
| 1113 |
-
|
| 1114 |
-
|
| 1115 |
-
|
| 1116 |
-
|
| 1117 |
-
|
| 1118 |
-
|
| 1119 |
-
|
| 1120 |
-
|
| 1121 |
-
.
|
| 1122 |
-
|
| 1123 |
-
|
| 1124 |
-
|
| 1125 |
-
|
| 1126 |
-
|
| 1127 |
-
|
| 1128 |
-
|
| 1129 |
-
|
| 1130 |
-
|
| 1131 |
-
|
| 1132 |
-
|
| 1133 |
-
|
| 1134 |
-
|
| 1135 |
-
|
| 1136 |
-
|
| 1137 |
-
|
| 1138 |
-
|
| 1139 |
-
|
| 1140 |
-
|
| 1141 |
-
|
| 1142 |
-
|
| 1143 |
-
|
| 1144 |
-
|
| 1145 |
-
|
| 1146 |
-
|
| 1147 |
-
|
| 1148 |
-
|
| 1149 |
-
|
| 1150 |
-
|
| 1151 |
-
|
| 1152 |
-
|
| 1153 |
-
|
| 1154 |
-
|
| 1155 |
-
|
| 1156 |
-
|
| 1157 |
-
|
| 1158 |
-
|
| 1159 |
-
|
| 1160 |
-
|
| 1161 |
-
|
| 1162 |
-
.
|
| 1163 |
-
{
|
| 1164 |
-
|
| 1165 |
-
}
|
| 1166 |
-
|
| 1167 |
-
#image-list .small .card-
|
| 1168 |
-
{
|
| 1169 |
-
|
| 1170 |
-
}
|
| 1171 |
-
|
| 1172 |
-
|
| 1173 |
-
|
| 1174 |
-
|
| 1175 |
-
|
| 1176 |
-
|
| 1177 |
-
|
| 1178 |
-
|
| 1179 |
-
|
| 1180 |
-
|
| 1181 |
-
|
| 1182 |
-
|
| 1183 |
-
|
| 1184 |
-
|
| 1185 |
-
|
| 1186 |
-
|
| 1187 |
-
|
| 1188 |
-
|
| 1189 |
-
|
| 1190 |
-
|
| 1191 |
-
|
| 1192 |
-
|
| 1193 |
-
|
| 1194 |
-
|
| 1195 |
-
|
| 1196 |
-
|
| 1197 |
-
|
| 1198 |
-
|
| 1199 |
-
|
| 1200 |
-
|
| 1201 |
-
|
| 1202 |
-
|
| 1203 |
-
|
| 1204 |
-
|
| 1205 |
-
|
| 1206 |
-
|
| 1207 |
-
|
| 1208 |
-
|
| 1209 |
-
|
| 1210 |
-
|
| 1211 |
-
|
| 1212 |
-
{
|
| 1213 |
-
|
| 1214 |
-
|
| 1215 |
-
|
| 1216 |
-
|
| 1217 |
-
|
| 1218 |
-
|
| 1219 |
-
|
| 1220 |
-
|
| 1221 |
-
|
| 1222 |
-
|
| 1223 |
-
|
| 1224 |
-
|
| 1225 |
-
|
| 1226 |
-
{
|
| 1227 |
-
float: left;
|
| 1228 |
-
|
| 1229 |
-
|
| 1230 |
-
|
| 1231 |
-
|
| 1232 |
-
|
| 1233 |
-
|
| 1234 |
-
|
| 1235 |
-
|
| 1236 |
-
|
| 1237 |
-
|
| 1238 |
-
|
| 1239 |
-
|
| 1240 |
-
|
| 1241 |
-
}
|
| 1242 |
-
|
| 1243 |
-
.
|
| 1244 |
-
{
|
| 1245 |
-
|
| 1246 |
-
|
| 1247 |
-
|
| 1248 |
-
|
| 1249 |
-
|
| 1250 |
-
|
| 1251 |
-
|
| 1252 |
-
|
| 1253 |
-
|
| 1254 |
-
|
| 1255 |
-
|
| 1256 |
-
|
| 1257 |
-
|
| 1258 |
-
|
| 1259 |
-
|
| 1260 |
-
|
| 1261 |
-
|
| 1262 |
-
|
| 1263 |
-
|
| 1264 |
-
|
| 1265 |
-
|
| 1266 |
-
|
| 1267 |
-
|
| 1268 |
-
|
| 1269 |
-
|
| 1270 |
-
|
| 1271 |
-
|
| 1272 |
-
{
|
| 1273 |
-
|
| 1274 |
-
}
|
| 1275 |
-
|
| 1276 |
-
.collapsible .active .collapsible-header
|
| 1277 |
-
{
|
| 1278 |
-
|
| 1279 |
-
}
|
| 1280 |
-
|
| 1281 |
-
|
| 1282 |
-
{
|
| 1283 |
-
color: white;
|
| 1284 |
-
}
|
| 1285 |
-
|
| 1286 |
-
.
|
| 1287 |
-
{
|
| 1288 |
-
background
|
| 1289 |
-
}
|
| 1290 |
-
|
| 1291 |
-
.
|
| 1292 |
-
{
|
| 1293 |
-
|
| 1294 |
-
|
| 1295 |
-
|
| 1296 |
-
|
| 1297 |
-
|
| 1298 |
-
|
| 1299 |
-
|
| 1300 |
-
|
| 1301 |
-
|
| 1302 |
-
|
| 1303 |
-
|
| 1304 |
-
|
| 1305 |
-
|
| 1306 |
-
|
| 1307 |
-
|
| 1308 |
-
|
| 1309 |
-
|
| 1310 |
-
|
| 1311 |
-
|
| 1312 |
-
|
| 1313 |
-
|
| 1314 |
-
|
| 1315 |
-
|
| 1316 |
-
|
| 1317 |
-
|
| 1318 |
-
|
| 1319 |
-
|
| 1320 |
-
}
|
| 1321 |
-
|
| 1322 |
-
#hover-effect .
|
| 1323 |
-
{
|
| 1324 |
-
display:
|
| 1325 |
-
}
|
| 1326 |
-
|
| 1327 |
-
|
| 1328 |
-
|
| 1329 |
-
|
| 1330 |
-
}
|
| 1331 |
-
|
| 1332 |
-
|
| 1333 |
-
|
| 1334 |
-
|
| 1335 |
-
}
|
| 1336 |
-
|
| 1337 |
-
#hover-effect .effect-compatibility
|
| 1338 |
-
{
|
| 1339 |
-
|
| 1340 |
-
|
| 1341 |
-
|
| 1342 |
-
|
| 1343 |
-
|
| 1344 |
-
|
| 1345 |
-
|
| 1346 |
-
|
| 1347 |
-
|
| 1348 |
-
|
| 1349 |
-
|
| 1350 |
-
|
| 1351 |
-
|
| 1352 |
-
|
| 1353 |
-
}
|
| 1354 |
-
|
| 1355 |
-
#hover-effect .
|
| 1356 |
-
{
|
| 1357 |
-
|
| 1358 |
-
}
|
| 1359 |
-
|
| 1360 |
-
|
| 1361 |
-
|
| 1362 |
-
|
| 1363 |
-
|
| 1364 |
-
|
| 1365 |
-
|
| 1366 |
-
|
| 1367 |
-
|
| 1368 |
-
|
| 1369 |
-
|
| 1370 |
-
|
| 1371 |
-
|
| 1372 |
-
|
| 1373 |
-
|
| 1374 |
-
|
| 1375 |
-
|
| 1376 |
-
|
| 1377 |
-
|
| 1378 |
-
|
| 1379 |
-
|
| 1380 |
-
|
| 1381 |
-
|
| 1382 |
-
|
| 1383 |
-
|
| 1384 |
-
|
| 1385 |
-
|
| 1386 |
-
|
| 1387 |
-
|
| 1388 |
-
|
| 1389 |
-
|
| 1390 |
-
|
| 1391 |
-
|
| 1392 |
-
|
| 1393 |
-
|
| 1394 |
-
|
| 1395 |
-
|
| 1396 |
-
|
| 1397 |
-
|
| 1398 |
-
|
| 1399 |
-
|
| 1400 |
-
|
| 1401 |
-
|
| 1402 |
-
|
| 1403 |
-
|
| 1404 |
-
|
| 1405 |
-
font-size:
|
| 1406 |
-
|
| 1407 |
-
}
|
| 1408 |
-
.modula .
|
| 1409 |
-
|
| 1410 |
-
|
| 1411 |
-
|
| 1412 |
-
|
| 1413 |
-
|
| 1414 |
-
|
| 1415 |
-
|
| 1416 |
-
|
| 1417 |
-
|
| 1418 |
-
|
| 1419 |
-
|
| 1420 |
-
|
| 1421 |
-
|
| 1422 |
-
|
| 1423 |
-
|
| 1424 |
-
|
| 1425 |
-
|
| 1426 |
-
|
| 1427 |
-
|
| 1428 |
-
|
| 1429 |
-
|
| 1430 |
-
|
| 1431 |
-
|
| 1432 |
-
|
| 1433 |
-
|
| 1434 |
-
}
|
| 1435 |
-
#
|
| 1436 |
-
|
| 1437 |
-
|
| 1438 |
-
|
| 1439 |
-
|
| 1440 |
-
|
| 1441 |
-
|
| 1442 |
-
|
| 1443 |
-
|
| 1444 |
-
|
| 1445 |
-
|
| 1446 |
-
|
| 1447 |
-
|
| 1448 |
-
|
| 1449 |
-
|
| 1450 |
-
|
| 1451 |
-
|
| 1452 |
-
|
| 1453 |
-
|
| 1454 |
-
|
| 1455 |
-
|
| 1456 |
-
|
| 1457 |
-
|
| 1458 |
-
|
| 1459 |
-
|
| 1460 |
-
|
| 1461 |
-
|
| 1462 |
-
|
| 1463 |
-
|
| 1464 |
-
|
| 1465 |
-
|
| 1466 |
-
|
| 1467 |
-
|
| 1468 |
-
|
| 1469 |
-
|
| 1470 |
-
|
| 1471 |
-
|
| 1472 |
-
|
| 1473 |
-
|
| 1474 |
-
|
| 1475 |
-
|
| 1476 |
-
|
| 1477 |
-
|
| 1478 |
-
|
| 1479 |
-
|
| 1480 |
-
}
|
| 1481 |
-
|
| 1482 |
-
|
| 1483 |
-
|
| 1484 |
-
#
|
| 1485 |
-
|
| 1486 |
-
|
| 1487 |
-
}
|
| 1488 |
-
#external-galleries input[type=checkbox] {
|
| 1489 |
-
position: static;
|
| 1490 |
}
|
| 1 |
+
@charset "UTF-8";
|
| 2 |
+
|
| 3 |
+
@font-face {
|
| 4 |
+
font-family: "modula-icons";
|
| 5 |
+
src:url("../font/modula/modula-icons.eot");
|
| 6 |
+
src:url("../font/modula/modula-icons.eot?#iefix") format("embedded-opentype"),
|
| 7 |
+
url("../font/modula/modula-icons.woff") format("woff"),
|
| 8 |
+
url("../font/modula/modula-icons.ttf") format("truetype"),
|
| 9 |
+
url("../font/modula/modula-icons.svg#modula-icons") format("svg");
|
| 10 |
+
font-weight: normal;
|
| 11 |
+
font-style: normal;
|
| 12 |
+
|
| 13 |
+
}
|
| 14 |
+
|
| 15 |
+
@font-face {
|
| 16 |
+
font-family: 'Roboto';
|
| 17 |
+
src: url('../font/roboto/Roboto-Regular-webfont.eot');
|
| 18 |
+
src: url('../font/roboto/Roboto-Regular-webfont.eot?#iefix') format('embedded-opentype'),
|
| 19 |
+
url('../font/roboto/Roboto-Regular-webfont.woff') format('woff'),
|
| 20 |
+
url('../font/roboto/Roboto-Regular-webfont.ttf') format('truetype'),
|
| 21 |
+
url('../font/roboto/Roboto-Regular-webfont.svg#robotoregular') format('svg');
|
| 22 |
+
font-weight: normal;
|
| 23 |
+
font-style: normal;
|
| 24 |
+
|
| 25 |
+
}
|
| 26 |
+
|
| 27 |
+
|
| 28 |
+
|
| 29 |
+
[data-icon]:before {
|
| 30 |
+
font-family: "modula-icons" !important;
|
| 31 |
+
content: attr(data-icon);
|
| 32 |
+
font-style: normal !important;
|
| 33 |
+
font-weight: normal !important;
|
| 34 |
+
font-variant: normal !important;
|
| 35 |
+
text-transform: none !important;
|
| 36 |
+
speak: none;
|
| 37 |
+
line-height: 1;
|
| 38 |
+
-webkit-font-smoothing: antialiased;
|
| 39 |
+
-moz-osx-font-smoothing: grayscale;
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
[class^="icon-"]:before,
|
| 43 |
+
[class*=" icon-"]:before {
|
| 44 |
+
font-family: "modula-icons" !important;
|
| 45 |
+
font-style: normal !important;
|
| 46 |
+
font-weight: normal !important;
|
| 47 |
+
font-variant: normal !important;
|
| 48 |
+
text-transform: none !important;
|
| 49 |
+
speak: none;
|
| 50 |
+
line-height: 1;
|
| 51 |
+
-webkit-font-smoothing: antialiased;
|
| 52 |
+
-moz-osx-font-smoothing: grayscale;
|
| 53 |
+
}
|
| 54 |
+
|
| 55 |
+
.icon-facebook:before {
|
| 56 |
+
content: "a";
|
| 57 |
+
}
|
| 58 |
+
.icon-pinterest:before {
|
| 59 |
+
content: "b";
|
| 60 |
+
}
|
| 61 |
+
.icon-twitter:before {
|
| 62 |
+
content: "c";
|
| 63 |
+
}
|
| 64 |
+
.icon-google-plus:before {
|
| 65 |
+
content: "d";
|
| 66 |
+
}
|
| 67 |
+
.icon-save-disk:before {
|
| 68 |
+
content: "e";
|
| 69 |
+
}
|
| 70 |
+
.icon-angle-up:before {
|
| 71 |
+
content: "f";
|
| 72 |
+
}
|
| 73 |
+
.icon-plus:before {
|
| 74 |
+
content: "g";
|
| 75 |
+
}
|
| 76 |
+
.icon-check-mark-2:before {
|
| 77 |
+
content: "h";
|
| 78 |
+
}
|
| 79 |
+
.icon-chevron-right:before {
|
| 80 |
+
content: "i";
|
| 81 |
+
}
|
| 82 |
+
.dark-content{
|
| 83 |
+
opacity: 0.5;
|
| 84 |
+
}
|
| 85 |
+
body
|
| 86 |
+
{
|
| 87 |
+
margin:0px;
|
| 88 |
+
padding-bottom: 65px;
|
| 89 |
+
float: left;
|
| 90 |
+
width: 100%;
|
| 91 |
+
overflow: visible!important;
|
| 92 |
+
}
|
| 93 |
+
.image-size-section
|
| 94 |
+
{
|
| 95 |
+
margin: 10px;
|
| 96 |
+
padding: 5px;
|
| 97 |
+
}
|
| 98 |
+
strong {
|
| 99 |
+
font-weight:700;
|
| 100 |
+
}
|
| 101 |
+
|
| 102 |
+
/*.shortcode-section
|
| 103 |
+
{
|
| 104 |
+
margin: 48px 0;
|
| 105 |
+
padding-left: 43px;
|
| 106 |
+
font-size: 1rem;
|
| 107 |
+
}*/
|
| 108 |
+
|
| 109 |
+
.image-size-section select{
|
| 110 |
+
margin-top: 5px;
|
| 111 |
+
width: 100%;
|
| 112 |
+
}
|
| 113 |
+
.page-footer .progress {
|
| 114 |
+
display: none;
|
| 115 |
+
}
|
| 116 |
+
.hide
|
| 117 |
+
{
|
| 118 |
+
display: none;
|
| 119 |
+
}
|
| 120 |
+
.editimage-right
|
| 121 |
+
{
|
| 122 |
+
float:right;
|
| 123 |
+
width:60%;
|
| 124 |
+
display: block;
|
| 125 |
+
margin-left:5px;
|
| 126 |
+
}
|
| 127 |
+
#image-panel textarea
|
| 128 |
+
{
|
| 129 |
+
color:black;
|
| 130 |
+
}
|
| 131 |
+
#image-panel select:not([name=halign]):not([name=valign])
|
| 132 |
+
{
|
| 133 |
+
width:100%;
|
| 134 |
+
}
|
| 135 |
+
#image-panel select
|
| 136 |
+
{
|
| 137 |
+
color:black;
|
| 138 |
+
}
|
| 139 |
+
.text-input
|
| 140 |
+
{
|
| 141 |
+
border:1px solid #aaa;
|
| 142 |
+
width: 100%;
|
| 143 |
+
display: block;
|
| 144 |
+
}
|
| 145 |
+
.label-text
|
| 146 |
+
{
|
| 147 |
+
color:black;
|
| 148 |
+
font-size: 1rem;
|
| 149 |
+
margin: 0px 5px 0px 0px;
|
| 150 |
+
font-weight: bold;
|
| 151 |
+
}
|
| 152 |
+
.label-panel
|
| 153 |
+
{
|
| 154 |
+
width: 80px;
|
| 155 |
+
float:left;
|
| 156 |
+
}
|
| 157 |
+
.shortpixel {
|
| 158 |
+
display: block;
|
| 159 |
+
}
|
| 160 |
+
.shortpixel img {
|
| 161 |
+
position:relative;
|
| 162 |
+
top:5px;
|
| 163 |
+
}
|
| 164 |
+
.dropdown-menu
|
| 165 |
+
{
|
| 166 |
+
width: 100%;
|
| 167 |
+
}
|
| 168 |
+
#modula-wizard {
|
| 169 |
+
margin: 40px auto;
|
| 170 |
+
padding: 20px;
|
| 171 |
+
max-width: 600px;
|
| 172 |
+
box-shadow: #ccc 0px 0px 40px;
|
| 173 |
+
border-radius: 4px;
|
| 174 |
+
background: #fff;
|
| 175 |
+
}
|
| 176 |
+
#modula-wizard fieldset {
|
| 177 |
+
border: 0;
|
| 178 |
+
display: none;
|
| 179 |
+
}
|
| 180 |
+
#modula-wizard fieldset:first-of-type {
|
| 181 |
+
display: block;
|
| 182 |
+
}
|
| 183 |
+
#modula-wizard fieldset select {
|
| 184 |
+
height: 3rem;
|
| 185 |
+
}
|
| 186 |
+
#modula-wizard h1 {
|
| 187 |
+
font-size: 32px;
|
| 188 |
+
text-transform: uppercase;
|
| 189 |
+
text-align: center;
|
| 190 |
+
margin: 0;
|
| 191 |
+
}
|
| 192 |
+
#modula-wizard h1 small {
|
| 193 |
+
font-size: 12px;
|
| 194 |
+
}
|
| 195 |
+
#modula-wizard h2 {
|
| 196 |
+
font-size: 16px;
|
| 197 |
+
text-transform: uppercase;
|
| 198 |
+
text-align: center;
|
| 199 |
+
margin: 0;
|
| 200 |
+
margin-bottom: 50px;
|
| 201 |
+
line-height: 1;
|
| 202 |
+
}
|
| 203 |
+
#modula-wizard h5 {
|
| 204 |
+
margin-bottom: 20px;
|
| 205 |
+
}
|
| 206 |
+
#modula-wizard .field {
|
| 207 |
+
margin-bottom: 40px;
|
| 208 |
+
}
|
| 209 |
+
#modula-wizard .images {
|
| 210 |
+
padding: 10px;
|
| 211 |
+
max-height: 300px;
|
| 212 |
+
overflow: auto;
|
| 213 |
+
}
|
| 214 |
+
#modula-wizard .images .tile {
|
| 215 |
+
margin: 0 10px 10px 0;
|
| 216 |
+
width: 23%;
|
| 217 |
+
display: inline-block;
|
| 218 |
+
position: relative;
|
| 219 |
+
}
|
| 220 |
+
#modula-wizard .images .tile img {
|
| 221 |
+
width: 100%;
|
| 222 |
+
}
|
| 223 |
+
#modula-wizard .images .tile a {
|
| 224 |
+
position: absolute;
|
| 225 |
+
top: -5px;
|
| 226 |
+
right: -5px;
|
| 227 |
+
z-index: 10;
|
| 228 |
+
display: none;
|
| 229 |
+
width: 26px;
|
| 230 |
+
height: 26px;
|
| 231 |
+
line-height: 26px;
|
| 232 |
+
}
|
| 233 |
+
|
| 234 |
+
#modula-wizard .images .tile a i {
|
| 235 |
+
line-height: 26px;
|
| 236 |
+
font-size: 1.2rem;
|
| 237 |
+
}
|
| 238 |
+
#modula-wizard .images .tile:hover a {
|
| 239 |
+
display: block;
|
| 240 |
+
}
|
| 241 |
+
#modula-wizard .images .tile:nth-child(4n) {
|
| 242 |
+
margin-right: 0;
|
| 243 |
+
}
|
| 244 |
+
#modula-wizard footer {
|
| 245 |
+
background: transparent;
|
| 246 |
+
text-align: right;
|
| 247 |
+
}
|
| 248 |
+
#modula-wizard footer .prev {
|
| 249 |
+
visibility: hidden;
|
| 250 |
+
}
|
| 251 |
+
#wpcontent {
|
| 252 |
+
padding-left: 0;
|
| 253 |
+
}
|
| 254 |
+
#gallery-list {
|
| 255 |
+
margin-top: 2rem;
|
| 256 |
+
}
|
| 257 |
+
#gallery-list .card {
|
| 258 |
+
background-color: #6C838B;
|
| 259 |
+
padding: 0;
|
| 260 |
+
border: none !important;
|
| 261 |
+
}
|
| 262 |
+
#gallery-list .card .data {
|
| 263 |
+
background-size: cover;
|
| 264 |
+
background-position: 50% 50%;
|
| 265 |
+
}
|
| 266 |
+
|
| 267 |
+
.waves-light.btn {
|
| 268 |
+
color: #fff;
|
| 269 |
+
}
|
| 270 |
+
.waves-light.btn:hover {
|
| 271 |
+
color: #fff;
|
| 272 |
+
}
|
| 273 |
+
.card {
|
| 274 |
+
padding: 0;
|
| 275 |
+
min-width: 0;
|
| 276 |
+
max-width: 999em;
|
| 277 |
+
}
|
| 278 |
+
#top {
|
| 279 |
+
padding: 1rem 0 3rem 40px;
|
| 280 |
+
/*background-image: url('../images/colors.jpg');*/
|
| 281 |
+
background-repeat: repeat-x;
|
| 282 |
+
background-position: left bottom;
|
| 283 |
+
font-family: Roboto, 'sans-serif';
|
| 284 |
+
}
|
| 285 |
+
#top h1 {
|
| 286 |
+
color: #fff;
|
| 287 |
+
font-size: 3.4rem;
|
| 288 |
+
margin: 16px 0 25px 0;
|
| 289 |
+
font-weight: 300;
|
| 290 |
+
}
|
| 291 |
+
#top h1 small {
|
| 292 |
+
font-size: 1rem;
|
| 293 |
+
}
|
| 294 |
+
#top h4 {
|
| 295 |
+
margin: 17px 0 13px 0;
|
| 296 |
+
}
|
| 297 |
+
#support-page {
|
| 298 |
+
background: #fff;
|
| 299 |
+
font-family: Roboto, 'sans-serif';
|
| 300 |
+
padding: 40px;
|
| 301 |
+
}
|
| 302 |
+
.widefat .edit_image_form td {
|
| 303 |
+
border-bottom: 0;
|
| 304 |
+
border-top: 0;
|
| 305 |
+
}
|
| 306 |
+
|
| 307 |
+
.widefat th, .widefat td {
|
| 308 |
+
overflow: visible;
|
| 309 |
+
}
|
| 310 |
+
|
| 311 |
+
.widefat tfoot th:first-of-type {
|
| 312 |
+
-webkit-border-bottom-left-radius: 0;
|
| 313 |
+
border-bottom-left-radius: 0;
|
| 314 |
+
}
|
| 315 |
+
.widefat tfoot th:last-of-type {
|
| 316 |
+
-webkit-border-bottom-right-radius: 0;
|
| 317 |
+
border-bottom-rigth-radius: 0;
|
| 318 |
+
}
|
| 319 |
+
.widefat thead th:first-of-type {
|
| 320 |
+
-webkit-border-top-left-radius: 0;
|
| 321 |
+
border-bottom-top-radius: 0;
|
| 322 |
+
}
|
| 323 |
+
.widefat thead th:last-of-type {
|
| 324 |
+
-webkit-border-top-rigth-radius: 0;
|
| 325 |
+
border-top-right-radius: 0;
|
| 326 |
+
}
|
| 327 |
+
|
| 328 |
+
#wpcontent {
|
| 329 |
+
margin-left: 146px;
|
| 330 |
+
padding-left: 20px;
|
| 331 |
+
}
|
| 332 |
+
#support-page p {
|
| 333 |
+
font-size: 16px;
|
| 334 |
+
color: #666;
|
| 335 |
+
}
|
| 336 |
+
#support-page ul {
|
| 337 |
+
margin: 40px 20px;
|
| 338 |
+
}
|
| 339 |
+
#support-page ul li {
|
| 340 |
+
list-style-type: circle;
|
| 341 |
+
font-size: 18px;
|
| 342 |
+
line-height: 1.5;
|
| 343 |
+
}
|
| 344 |
+
#support-page .buttons {
|
| 345 |
+
margin-top: 40px;
|
| 346 |
+
}
|
| 347 |
+
.ui-dialog.noTitle .ui-dialog-titlebar {
|
| 348 |
+
display: none;
|
| 349 |
+
}
|
| 350 |
+
.modula-header
|
| 351 |
+
{
|
| 352 |
+
background-color: #51AD31;
|
| 353 |
+
margin-left:-10px;
|
| 354 |
+
}
|
| 355 |
+
|
| 356 |
+
.modula-header h1
|
| 357 |
+
{
|
| 358 |
+
font-weight: bolder !important;
|
| 359 |
+
}
|
| 360 |
+
.modula-header h4
|
| 361 |
+
{
|
| 362 |
+
color: white;
|
| 363 |
+
}
|
| 364 |
+
|
| 365 |
+
.ui-dialog .loading {
|
| 366 |
+
background: url(../loading.gif) no-repeat;
|
| 367 |
+
width: 220px;
|
| 368 |
+
height: 19px;
|
| 369 |
+
margin:50px auto 0 auto;
|
| 370 |
+
}
|
| 371 |
+
.collapsible {
|
| 372 |
+
padding:20px 70px 0px 40px !important;
|
| 373 |
+
border: none !important;
|
| 374 |
+
box-shadow: none !important;
|
| 375 |
+
}
|
| 376 |
+
.bd .gallery-hd {
|
| 377 |
+
margin: 60px 0;
|
| 378 |
+
}
|
| 379 |
+
.bd .gallery-hd code {
|
| 380 |
+
font-size: 1rem;
|
| 381 |
+
}
|
| 382 |
+
.input-field {
|
| 383 |
+
margin-bottom: 20px;
|
| 384 |
+
}
|
| 385 |
+
.input-field label {
|
| 386 |
+
left: 0;
|
| 387 |
+
}
|
| 388 |
+
#ftg-wizard {
|
| 389 |
+
margin: 40px auto;
|
| 390 |
+
padding: 20px;
|
| 391 |
+
max-width: 600px;
|
| 392 |
+
box-shadow: #ccc 0px 0px 40px;
|
| 393 |
+
border-radius: 4px;
|
| 394 |
+
background: #fff;
|
| 395 |
+
}
|
| 396 |
+
#ftg-wizard fieldset {
|
| 397 |
+
border: 0;
|
| 398 |
+
display: none;
|
| 399 |
+
}
|
| 400 |
+
#ftg-wizard fieldset:first-of-type {
|
| 401 |
+
display: block;
|
| 402 |
+
}
|
| 403 |
+
#ftg-wizard fieldset select {
|
| 404 |
+
height: 3rem;
|
| 405 |
+
}
|
| 406 |
+
#ftg-wizard h1 {
|
| 407 |
+
font-size: 32px;
|
| 408 |
+
text-transform: uppercase;
|
| 409 |
+
text-align: center;
|
| 410 |
+
margin: 0;
|
| 411 |
+
}
|
| 412 |
+
#ftg-wizard h1 small {
|
| 413 |
+
font-size: 12px;
|
| 414 |
+
}
|
| 415 |
+
#ftg-wizard h2 {
|
| 416 |
+
font-size: 16px;
|
| 417 |
+
text-transform: uppercase;
|
| 418 |
+
text-align: center;
|
| 419 |
+
margin: 0;
|
| 420 |
+
margin-bottom: 50px;
|
| 421 |
+
line-height: 1;
|
| 422 |
+
}
|
| 423 |
+
#ftg-wizard h5 {
|
| 424 |
+
margin-bottom: 20px;
|
| 425 |
+
}
|
| 426 |
+
#ftg-wizard .field {
|
| 427 |
+
margin-bottom: 40px;
|
| 428 |
+
}
|
| 429 |
+
#ftg-wizard .images {
|
| 430 |
+
padding: 10px;
|
| 431 |
+
max-height: 300px;
|
| 432 |
+
overflow: auto;
|
| 433 |
+
}
|
| 434 |
+
#ftg-wizard .images .tile {
|
| 435 |
+
margin: 0 10px 10px 0;
|
| 436 |
+
width: 23%;
|
| 437 |
+
display: inline-block;
|
| 438 |
+
position: relative;
|
| 439 |
+
}
|
| 440 |
+
#ftg-wizard .images .tile img {
|
| 441 |
+
width: 100%;
|
| 442 |
+
}
|
| 443 |
+
#ftg-wizard .images .tile a {
|
| 444 |
+
position: absolute;
|
| 445 |
+
top: -5px;
|
| 446 |
+
right: -5px;
|
| 447 |
+
z-index: 10;
|
| 448 |
+
display: none;
|
| 449 |
+
width: 26px;
|
| 450 |
+
height: 26px;
|
| 451 |
+
line-height: 26px;
|
| 452 |
+
}
|
| 453 |
+
#ftg-wizard .images .tile a i {
|
| 454 |
+
line-height: 26px;
|
| 455 |
+
font-size: 1.2rem;
|
| 456 |
+
}
|
| 457 |
+
#ftg-wizard .images .tile:hover a {
|
| 458 |
+
display: block;
|
| 459 |
+
}
|
| 460 |
+
#ftg-wizard .images .tile:nth-child(4n) {
|
| 461 |
+
margin-right: 0;
|
| 462 |
+
}
|
| 463 |
+
#ftg-wizard footer {
|
| 464 |
+
background: transparent;
|
| 465 |
+
text-align: right;
|
| 466 |
+
}
|
| 467 |
+
#ftg-wizard footer .prev {
|
| 468 |
+
visibility: hidden;
|
| 469 |
+
}
|
| 470 |
+
#ftg-wizard .loading {
|
| 471 |
+
display: none;
|
| 472 |
+
}
|
| 473 |
+
.modal p {
|
| 474 |
+
font-size: 16px;
|
| 475 |
+
}
|
| 476 |
+
.modal #modal-close
|
| 477 |
+
{
|
| 478 |
+
float: right;
|
| 479 |
+
}
|
| 480 |
+
.modal .code {
|
| 481 |
+
display: block;
|
| 482 |
+
margin: 20px;
|
| 483 |
+
padding: 10px;
|
| 484 |
+
font-size: 16px;
|
| 485 |
+
}
|
| 486 |
+
.modal a {
|
| 487 |
+
outline: 0;
|
| 488 |
+
}
|
| 489 |
+
.modal .modal-content,
|
| 490 |
+
.modal .modal-footer {
|
| 491 |
+
background: #fff;
|
| 492 |
+
}
|
| 493 |
+
#gallery-list .card p {
|
| 494 |
+
height: 40px;
|
| 495 |
+
overflow: hidden;
|
| 496 |
+
padding: 4px 8px;
|
| 497 |
+
border-radius: 4px;
|
| 498 |
+
}
|
| 499 |
+
#gallery-list .card .card-action {
|
| 500 |
+
padding: 5px 5px;
|
| 501 |
+
text-align: center;
|
| 502 |
+
border:0;
|
| 503 |
+
}
|
| 504 |
+
#gallery-list .card.with-image .card-action a {
|
| 505 |
+
transition:all .2s;
|
| 506 |
+
}
|
| 507 |
+
#gallery-list .card .card-action a {
|
| 508 |
+
margin: 0 10px;
|
| 509 |
+
font-size: 20px;
|
| 510 |
+
color: #fff;
|
| 511 |
+
padding: 4px;
|
| 512 |
+
}
|
| 513 |
+
#gallery-list .card .card-image {
|
| 514 |
+
display: inline-block;
|
| 515 |
+
width: 150px;
|
| 516 |
+
height: 150px;
|
| 517 |
+
overflow: hidden;
|
| 518 |
+
}
|
| 519 |
+
#gallery-list .card .card-content {
|
| 520 |
+
height: 180px;
|
| 521 |
+
cursor: pointer;
|
| 522 |
+
letter-spacing: 0.3px;
|
| 523 |
+
}
|
| 524 |
+
#gallery-list .card.with-image .card-action,
|
| 525 |
+
#gallery-list .card.with-image .card-content {
|
| 526 |
+
background: rgba(0, 0, 0, .30);
|
| 527 |
+
transition:background .4s;
|
| 528 |
+
}
|
| 529 |
+
#gallery-list .card.with-image:hover .card-action,
|
| 530 |
+
#gallery-list .card.with-image:hover .card-content {
|
| 531 |
+
background: rgba(0, 0, 0, .60);
|
| 532 |
+
}
|
| 533 |
+
#gallery-list .card .card-title {
|
| 534 |
+
line-height: 32px;
|
| 535 |
+
margin-bottom: 18px;
|
| 536 |
+
display: block;
|
| 537 |
+
font-weight: 400;
|
| 538 |
+
padding: 4px 8px;
|
| 539 |
+
border-radius: 4px;
|
| 540 |
+
}
|
| 541 |
+
|
| 542 |
+
#edit-gallery .tab {
|
| 543 |
+
padding: 20px;
|
| 544 |
+
}
|
| 545 |
+
#edit-gallery label {
|
| 546 |
+
color: #333;
|
| 547 |
+
font-size: 1rem;
|
| 548 |
+
top: 0.1rem;
|
| 549 |
+
height: auto;
|
| 550 |
+
}
|
| 551 |
+
#edit-gallery .input-field {
|
| 552 |
+
margin-bottom: 0;
|
| 553 |
+
}
|
| 554 |
+
#edit-gallery .input-field input[type=text],
|
| 555 |
+
#edit-gallery .input-field input[type=password],
|
| 556 |
+
#edit-gallery .input-field input[type=email],
|
| 557 |
+
#edit-gallery .input-field input[type=url],
|
| 558 |
+
#edit-gallery .input-field input[type=date],
|
| 559 |
+
#edit-gallery .input-field input[type=tel],
|
| 560 |
+
#edit-gallery .input-field input[type=number],
|
| 561 |
+
#edit-gallery .input-field input[type=search],
|
| 562 |
+
#edit-gallery .input-field textarea.materialize-textarea {
|
| 563 |
+
font-size: 2rem;
|
| 564 |
+
}
|
| 565 |
+
#edit-gallery select {
|
| 566 |
+
font-size: 1rem;
|
| 567 |
+
background: #fff;
|
| 568 |
+
}
|
| 569 |
+
#edit-gallery .jump-head {
|
| 570 |
+
border-bottom: 2px solid rgba(0, 0, 0, 0.3);
|
| 571 |
+
padding: 20px 0;
|
| 572 |
+
}
|
| 573 |
+
#edit-gallery .jump-head select {
|
| 574 |
+
height: 2rem;
|
| 575 |
+
display: inline;
|
| 576 |
+
}
|
| 577 |
+
#edit-gallery .jump {
|
| 578 |
+
width: auto;
|
| 579 |
+
}
|
| 580 |
+
.jump-head
|
| 581 |
+
{
|
| 582 |
+
padding: 40px 0px 40px 10px;
|
| 583 |
+
}
|
| 584 |
+
.bullet-menu {
|
| 585 |
+
position: fixed;
|
| 586 |
+
bottom: 20px;
|
| 587 |
+
right: 50px;
|
| 588 |
+
}
|
| 589 |
+
.update-gallery {
|
| 590 |
+
position: fixed;
|
| 591 |
+
bottom: 20px;
|
| 592 |
+
right: 20px;
|
| 593 |
+
}
|
| 594 |
+
.collapsible li {
|
| 595 |
+
margin-bottom: 7px;
|
| 596 |
+
margin-left:-20px;
|
| 597 |
+
}
|
| 598 |
+
.collapsible li .alternate {
|
| 599 |
+
background: transparent;
|
| 600 |
+
}
|
| 601 |
+
.collapsible li .collapsible-header {
|
| 602 |
+
font-size: 2rem;
|
| 603 |
+
height: 5rem;
|
| 604 |
+
line-height: 5rem;
|
| 605 |
+
}
|
| 606 |
+
.collapsible li .collapsible-header .fa-chevron-right{
|
| 607 |
+
float: right;
|
| 608 |
+
color: darkgray;
|
| 609 |
+
}
|
| 610 |
+
.collapsible li .collapsible-header i {
|
| 611 |
+
color: #51AD31;
|
| 612 |
+
line-height: 5rem;
|
| 613 |
+
}
|
| 614 |
+
.collapsible li .collapsible-header span{
|
| 615 |
+
color: #51AD31;
|
| 616 |
+
}
|
| 617 |
+
.collapsible li .field .text {
|
| 618 |
+
background: #fff;
|
| 619 |
+
padding: 20px;
|
| 620 |
+
}
|
| 621 |
+
.collapsible li .field .text .pickColor {
|
| 622 |
+
height: auto;
|
| 623 |
+
}
|
| 624 |
+
.collapsible li .field .text .wp-color-result {
|
| 625 |
+
border-radius: 0;
|
| 626 |
+
-webkit-border-radius: 0;
|
| 627 |
+
height: 24px;
|
| 628 |
+
}
|
| 629 |
+
.collapsible li .field .text .wp-color-result::after {
|
| 630 |
+
border-radius: 0;
|
| 631 |
+
-webkit-border-radius: 0;
|
| 632 |
+
}
|
| 633 |
+
.collapsible li textarea {
|
| 634 |
+
height: 100px;
|
| 635 |
+
}
|
| 636 |
+
.collapsible li th,
|
| 637 |
+
.collapsible li td {
|
| 638 |
+
vertical-align: baseline;
|
| 639 |
+
}
|
| 640 |
+
.collapsible li th {
|
| 641 |
+
border-radius: 0;
|
| 642 |
+
}
|
| 643 |
+
.collapsible li th[scope=row] {
|
| 644 |
+
width: 200px;
|
| 645 |
+
}
|
| 646 |
+
.collapsible li tr.ui-slider {
|
| 647 |
+
height: auto;
|
| 648 |
+
}
|
| 649 |
+
.collapsible li tr.filter {
|
| 650 |
+
float: none;
|
| 651 |
+
margin: 0;
|
| 652 |
+
}
|
| 653 |
+
.collapsible li .toggle div.help {
|
| 654 |
+
display: none;
|
| 655 |
+
}
|
| 656 |
+
.collapsible li .toggle div.help strong {
|
| 657 |
+
font-weight: bold;
|
| 658 |
+
}
|
| 659 |
+
|
| 660 |
+
.collapsible li .toggle [type="checkbox"]:not(:checked) + label:before {
|
| 661 |
+
top: 4px;
|
| 662 |
+
}
|
| 663 |
+
|
| 664 |
+
.checkbox, .checkbox-light, .radio, .radio-light {
|
| 665 |
+
background: url("../images/checkbox/square.png") 0 0 no-repeat;
|
| 666 |
+
color: #dddddd;
|
| 667 |
+
cursor: pointer;
|
| 668 |
+
padding: 1px 0 3px 25px;
|
| 669 |
+
position: relative; }
|
| 670 |
+
.checkbox:hover, .checkbox-light:hover, .radio:hover, .radio-light:hover {
|
| 671 |
+
background-position: 0 -26px;
|
| 672 |
+
color: white; }
|
| 673 |
+
.checkbox.checked, .checked.checkbox-light, .checked.radio, .checked.radio-light {
|
| 674 |
+
background-position: 0 -53px; }
|
| 675 |
+
.checkbox.checked:hover, .checked.checkbox-light:hover, .checked.radio:hover, .checked.radio-light:hover {
|
| 676 |
+
background-position: 0 -80px; }
|
| 677 |
+
|
| 678 |
+
.checkbox-light {
|
| 679 |
+
background-image: url("../images/checkbox/square-light.png"); }
|
| 680 |
+
.collapsible li div.help {
|
| 681 |
+
background: rgba(255, 255, 255, 0.5);
|
| 682 |
+
border-top-left-radius: 0;
|
| 683 |
+
border-top-right-radius: 0;
|
| 684 |
+
border-bottom-left-radius: 6px;
|
| 685 |
+
border-bottom-right-radius: 6px;
|
| 686 |
+
padding: 10px;
|
| 687 |
+
color: #666;
|
| 688 |
+
}
|
| 689 |
+
.collapsible li .custom_isf td th {
|
| 690 |
+
background: #333;
|
| 691 |
+
color: #fff;
|
| 692 |
+
}
|
| 693 |
+
.collapsible li .custom_isf td td input[type=text] {
|
| 694 |
+
background: #fff;
|
| 695 |
+
}
|
| 696 |
+
.collapsible li .dynamic-table tr {
|
| 697 |
+
background: #fff;
|
| 698 |
+
}
|
| 699 |
+
.collapsible li .dynamic-table .btn {
|
| 700 |
+
outline: 0;
|
| 701 |
+
color: #fff;
|
| 702 |
+
}
|
| 703 |
+
.collapsible li .dynamic-table .btn:hover {
|
| 704 |
+
color: #fff;
|
| 705 |
+
}
|
| 706 |
+
.collapsible li .dynamic-table .btn.add {
|
| 707 |
+
width: 100%;
|
| 708 |
+
}
|
| 709 |
+
.collapsible li .dynamic-table .del {
|
| 710 |
+
width: 50px;
|
| 711 |
+
padding-left: 10px;
|
| 712 |
+
padding-top: 18px;
|
| 713 |
+
}
|
| 714 |
+
.collapsible li td .filters .text p {
|
| 715 |
+
padding: 0;
|
| 716 |
+
}
|
| 717 |
+
.collapsible li td .filters .text p a {
|
| 718 |
+
display: inline-block;
|
| 719 |
+
margin-right: 20px;
|
| 720 |
+
}
|
| 721 |
+
.collapsible li td .filters .text p input[type=text] {
|
| 722 |
+
width: 77%;
|
| 723 |
+
}
|
| 724 |
+
#tutorial h5 {
|
| 725 |
+
margin: 60px 0 20px;
|
| 726 |
+
}
|
| 727 |
+
#images .item
|
| 728 |
+
{
|
| 729 |
+
width:160px;
|
| 730 |
+
padding:0px 10px 0px 0px;
|
| 731 |
+
/*background:#333;*/
|
| 732 |
+
/*border:1px solid #111;*/
|
| 733 |
+
float:left;
|
| 734 |
+
height:295px;
|
| 735 |
+
margin:10px 10px 0 0;
|
| 736 |
+
position: relative;
|
| 737 |
+
}
|
| 738 |
+
|
| 739 |
+
#images .item .size {
|
| 740 |
+
position: absolute;
|
| 741 |
+
bottom: 6px;
|
| 742 |
+
left: 10px;
|
| 743 |
+
background: #333;
|
| 744 |
+
color: #ccc;
|
| 745 |
+
padding: 4px;
|
| 746 |
+
display: block;
|
| 747 |
+
font-size: 9px;
|
| 748 |
+
font-family: monaco,courier, monospace;
|
| 749 |
+
}
|
| 750 |
+
#images .item .name {
|
| 751 |
+
position:absolute;
|
| 752 |
+
top:35px;
|
| 753 |
+
width:150px;
|
| 754 |
+
background: rgba(0,0,0,.5);
|
| 755 |
+
color: #fff;
|
| 756 |
+
font-size:10px;
|
| 757 |
+
left:10px;
|
| 758 |
+
z-index:100;
|
| 759 |
+
height:20px;
|
| 760 |
+
overflow: hidden;
|
| 761 |
+
}
|
| 762 |
+
#images .item .del {
|
| 763 |
+
position: absolute;
|
| 764 |
+
top:4px;
|
| 765 |
+
right:4px;
|
| 766 |
+
width: 20px;
|
| 767 |
+
height: 20px;
|
| 768 |
+
text-decoration: none;
|
| 769 |
+
color: #000;
|
| 770 |
+
display: none;
|
| 771 |
+
background:#111;
|
| 772 |
+
}
|
| 773 |
+
#images .item .icons {
|
| 774 |
+
/*border-bottom: 1px solid #222;*/
|
| 775 |
+
margin-bottom: 9px;
|
| 776 |
+
}
|
| 777 |
+
#images .item .selection {
|
| 778 |
+
float: right;
|
| 779 |
+
margin-top: 5px;
|
| 780 |
+
height: 12px;
|
| 781 |
+
}
|
| 782 |
+
|
| 783 |
+
#images .figure {
|
| 784 |
+
margin:0;
|
| 785 |
+
padding: 0;
|
| 786 |
+
width:90%;
|
| 787 |
+
height: 120px;
|
| 788 |
+
overflow: hidden;
|
| 789 |
+
display: table-cell;
|
| 790 |
+
vertical-align: middle;
|
| 791 |
+
text-align: center;
|
| 792 |
+
background-size: cover;
|
| 793 |
+
}
|
| 794 |
+
#images .figure img {
|
| 795 |
+
width:160px;
|
| 796 |
+
cursor: pointer;
|
| 797 |
+
}
|
| 798 |
+
#images .item .data {
|
| 799 |
+
display: none;
|
| 800 |
+
}
|
| 801 |
+
|
| 802 |
+
#image-panel {
|
| 803 |
+
background: white;
|
| 804 |
+
width:700px;
|
| 805 |
+
height:auto;
|
| 806 |
+
margin-left: -300px;
|
| 807 |
+
position: absolute;
|
| 808 |
+
top: 30%;
|
| 809 |
+
left: 50%;
|
| 810 |
+
z-index: 1001;
|
| 811 |
+
box-shadow: #000 0px 0px 20px;
|
| 812 |
+
/*border:4px solid #111;*/
|
| 813 |
+
padding: 10px;
|
| 814 |
+
}
|
| 815 |
+
#image-panel .filters {
|
| 816 |
+
clear: both;
|
| 817 |
+
margin-top: 10px;
|
| 818 |
+
}
|
| 819 |
+
#image-panel .filters .checkbox {
|
| 820 |
+
float: left;
|
| 821 |
+
margin-right: 20px;
|
| 822 |
+
padding-left: 20px;
|
| 823 |
+
}
|
| 824 |
+
#image-panel .left {
|
| 825 |
+
float:left;
|
| 826 |
+
}
|
| 827 |
+
#image-panel .figure {
|
| 828 |
+
width:200px;
|
| 829 |
+
height:200px;
|
| 830 |
+
overflow:hidden;
|
| 831 |
+
padding: 0;
|
| 832 |
+
margin: 0 0 10px 0;
|
| 833 |
+
padding: 2px;
|
| 834 |
+
border: 1px solid #999;
|
| 835 |
+
background: white;
|
| 836 |
+
}
|
| 837 |
+
#image-panel .figure img {
|
| 838 |
+
width:100%;
|
| 839 |
+
}
|
| 840 |
+
#image-panel .right {
|
| 841 |
+
float:left;
|
| 842 |
+
margin-left:20px;
|
| 843 |
+
}
|
| 844 |
+
#image-panel .field {
|
| 845 |
+
padding-bottom: 5px;
|
| 846 |
+
color: #aaa;
|
| 847 |
+
/*border-bottom: 1px solid #555;*/
|
| 848 |
+
margin-bottom: 5px;
|
| 849 |
+
}
|
| 850 |
+
#image-panel .field:last-of-type {
|
| 851 |
+
border-bottom: 0;
|
| 852 |
+
}
|
| 853 |
+
#image-panel .field label {
|
| 854 |
+
margin-bottom: 5px;
|
| 855 |
+
display: block;
|
| 856 |
+
font-weight: bold;
|
| 857 |
+
color: black;
|
| 858 |
+
}
|
| 859 |
+
#image-panel .field textarea {
|
| 860 |
+
width: 100%;
|
| 861 |
+
height: 60px;
|
| 862 |
+
}
|
| 863 |
+
#image-panel .actions li {
|
| 864 |
+
height: 22px;
|
| 865 |
+
margin:0;
|
| 866 |
+
}
|
| 867 |
+
#image-panel .close {
|
| 868 |
+
position: absolute;
|
| 869 |
+
top:0;
|
| 870 |
+
right:0;
|
| 871 |
+
display: block;
|
| 872 |
+
background: white;
|
| 873 |
+
border-bottom-left-radius: 30px;
|
| 874 |
+
width: 30px;
|
| 875 |
+
height: 30px;
|
| 876 |
+
line-height: 24px;
|
| 877 |
+
text-indent: 15px;
|
| 878 |
+
text-decoration: none;
|
| 879 |
+
color: #fff;
|
| 880 |
+
font-family: arial;
|
| 881 |
+
font-weight: bold;
|
| 882 |
+
}
|
| 883 |
+
|
| 884 |
+
#images .actions {
|
| 885 |
+
padding: 10px 10px 10px 10px;
|
| 886 |
+
background: #242521;
|
| 887 |
+
}
|
| 888 |
+
#images .bulk ,
|
| 889 |
+
#images .actions {
|
| 890 |
+
background: #FAFAFA;
|
| 891 |
+
border:1px solid #EEE;
|
| 892 |
+
padding: 25px;
|
| 893 |
+
margin: 10px;
|
| 894 |
+
}
|
| 895 |
+
#images .bulk h4 {
|
| 896 |
+
margin:0 0 4px 0;
|
| 897 |
+
color: #fff;
|
| 898 |
+
}
|
| 899 |
+
#images .bulk .checkbox {
|
| 900 |
+
display: inline-block;
|
| 901 |
+
padding-left: 20px;
|
| 902 |
+
margin-right: 15px;
|
| 903 |
+
}
|
| 904 |
+
#images .bulk .options a {
|
| 905 |
+
display: inline-block;
|
| 906 |
+
margin-right: 10px;
|
| 907 |
+
color: #fff;
|
| 908 |
+
text-decoration: none;
|
| 909 |
+
}
|
| 910 |
+
#images .bulk .options a:hover {
|
| 911 |
+
/*color: #fff;*/
|
| 912 |
+
}
|
| 913 |
+
#images .bulk .panel {
|
| 914 |
+
display: none;
|
| 915 |
+
padding: 12px;
|
| 916 |
+
background: transparent;
|
| 917 |
+
margin-top: 5px;
|
| 918 |
+
/*border: 1px solid #333222;*/
|
| 919 |
+
}
|
| 920 |
+
#images .bulk .panel strong {
|
| 921 |
+
color: black;
|
| 922 |
+
display: block;
|
| 923 |
+
margin-bottom: 4px;
|
| 924 |
+
}
|
| 925 |
+
|
| 926 |
+
#images .bulk .panel p {
|
| 927 |
+
padding: 10px 0px 10px 0px;
|
| 928 |
+
margin-bottom: 0;
|
| 929 |
+
color: black;
|
| 930 |
+
}
|
| 931 |
+
#images .tips {
|
| 932 |
+
margin-bottom: 15px;
|
| 933 |
+
}
|
| 934 |
+
#images .tip {
|
| 935 |
+
background: url('../images/tip.png') no-repeat;
|
| 936 |
+
text-indent: 21px;
|
| 937 |
+
display: block;
|
| 938 |
+
margin: 0 0 0 15px;
|
| 939 |
+
}
|
| 940 |
+
#images .shortpixel {
|
| 941 |
+
|
| 942 |
+
}
|
| 943 |
+
#images .btn.action {
|
| 944 |
+
margin-bottom: 0;
|
| 945 |
+
}
|
| 946 |
+
|
| 947 |
+
.clearfix:after {
|
| 948 |
+
content: ".";
|
| 949 |
+
display: block;
|
| 950 |
+
clear: both;
|
| 951 |
+
visibility: hidden;
|
| 952 |
+
line-height: 0;
|
| 953 |
+
height: 0;
|
| 954 |
+
}
|
| 955 |
+
#image-panel .buttons {
|
| 956 |
+
text-align: right;
|
| 957 |
+
margin-top: 10px;
|
| 958 |
+
clear: both;
|
| 959 |
+
}
|
| 960 |
+
#image-panel .buttons a {
|
| 961 |
+
margin-left: 10px;
|
| 962 |
+
}
|
| 963 |
+
|
| 964 |
+
#images .actions label {
|
| 965 |
+
font-weight: bold;
|
| 966 |
+
cursor: default;
|
| 967 |
+
display: block;
|
| 968 |
+
margin-bottom: 10px;
|
| 969 |
+
}
|
| 970 |
+
#images .actions label span {
|
| 971 |
+
font-weight: normal;
|
| 972 |
+
padding-left: 10px;
|
| 973 |
+
}
|
| 974 |
+
#images .actions .row {
|
| 975 |
+
margin: 0 0 10px 0;
|
| 976 |
+
}
|
| 977 |
+
#images .actions .bulk .panel {
|
| 978 |
+
display: none;
|
| 979 |
+
}
|
| 980 |
+
#images p label{
|
| 981 |
+
display: inline-block;
|
| 982 |
+
margin-right: 30px;
|
| 983 |
+
padding-left: 28px;
|
| 984 |
+
}
|
| 985 |
+
#image-panel .filters label
|
| 986 |
+
{
|
| 987 |
+
margin-right: 30px;
|
| 988 |
+
padding-left:28px;
|
| 989 |
+
color: #333;
|
| 990 |
+
float:left;
|
| 991 |
+
font-size: 1rem;
|
| 992 |
+
top: .1rem;
|
| 993 |
+
height: auto;
|
| 994 |
+
}
|
| 995 |
+
.filters-bulk-label {
|
| 996 |
+
display: inline-block;
|
| 997 |
+
margin-right: 30px;
|
| 998 |
+
line-height: 30px;
|
| 999 |
+
padding-left: 28px;
|
| 1000 |
+
}
|
| 1001 |
+
#images .actions .bulk .panel p {
|
| 1002 |
+
padding: 1rem 0;
|
| 1003 |
+
}
|
| 1004 |
+
#images .actions .tips {
|
| 1005 |
+
font-style: italic;
|
| 1006 |
+
color: #777;
|
| 1007 |
+
padding: 5px 10px;
|
| 1008 |
+
background: rgba(255, 255, 255, 0.7);
|
| 1009 |
+
border-radius: 4px;
|
| 1010 |
+
}
|
| 1011 |
+
#images .actions .tips strong {
|
| 1012 |
+
font-weight: 700;
|
| 1013 |
+
}
|
| 1014 |
+
#image-panel-model[data-source=posts] {
|
| 1015 |
+
width: 300px;
|
| 1016 |
+
}
|
| 1017 |
+
#image-panel-model[data-source=posts] .right-side {
|
| 1018 |
+
display: none;
|
| 1019 |
+
}
|
| 1020 |
+
#image-panel-model .right-side {
|
| 1021 |
+
margin-left: 170px;
|
| 1022 |
+
}
|
| 1023 |
+
#image-panel-model .right-side textarea {
|
| 1024 |
+
height: 3.75rem;
|
| 1025 |
+
}
|
| 1026 |
+
#image-panel-model .right-side input[type=text],
|
| 1027 |
+
#image-panel-model .right-side textarea {
|
| 1028 |
+
border: 1px solid #9E9E9E;
|
| 1029 |
+
}
|
| 1030 |
+
#image-panel-model .right-side .filters {
|
| 1031 |
+
margin-top: 15px;
|
| 1032 |
+
}
|
| 1033 |
+
#image-panel-model .right-side .filters label {
|
| 1034 |
+
margin-right: 30px;
|
| 1035 |
+
padding-left: 28px;
|
| 1036 |
+
}
|
| 1037 |
+
#video-panel-model textarea {
|
| 1038 |
+
height: 160px;
|
| 1039 |
+
}
|
| 1040 |
+
#image-list .card.selected {
|
| 1041 |
+
border: 2px solid #000;
|
| 1042 |
+
}
|
| 1043 |
+
#image-list .card .card-image {
|
| 1044 |
+
cursor: move;
|
| 1045 |
+
}
|
| 1046 |
+
#image-list .card .card-image iframe {
|
| 1047 |
+
width: 100%;
|
| 1048 |
+
}
|
| 1049 |
+
#image-list .card p {
|
| 1050 |
+
padding: 0;
|
| 1051 |
+
min-height: 20px;
|
| 1052 |
+
}
|
| 1053 |
+
#image-list .card .filters {
|
| 1054 |
+
position: absolute;
|
| 1055 |
+
top: 10px;
|
| 1056 |
+
left: 0px;
|
| 1057 |
+
}
|
| 1058 |
+
#image-list .card .filters li {
|
| 1059 |
+
background: #fff;
|
| 1060 |
+
color: #666;
|
| 1061 |
+
padding: 2px 10px;
|
| 1062 |
+
margin: 0 0 2px 0;
|
| 1063 |
+
border-top-right-radius: 4px;
|
| 1064 |
+
}
|
| 1065 |
+
#delete-gallery-modal span {
|
| 1066 |
+
color: #ff8a0b;
|
| 1067 |
+
font-weight: bold;
|
| 1068 |
+
}
|
| 1069 |
+
#spinner {
|
| 1070 |
+
display: none;
|
| 1071 |
+
position: fixed;
|
| 1072 |
+
top: 50px;
|
| 1073 |
+
right: 50px;
|
| 1074 |
+
}
|
| 1075 |
+
#spinner.shown {
|
| 1076 |
+
display: block;
|
| 1077 |
+
}
|
| 1078 |
+
.pro-cell {
|
| 1079 |
+
padding: 15px 25px;
|
| 1080 |
+
border: 1px solid #EEE;
|
| 1081 |
+
background-color: #FAFAFA;
|
| 1082 |
+
display: inline-block;
|
| 1083 |
+
}
|
| 1084 |
+
.button-bg {
|
| 1085 |
+
background: #DAA308;
|
| 1086 |
+
}
|
| 1087 |
+
.btn.button-bg:hover {
|
| 1088 |
+
background: #bc8f15;
|
| 1089 |
+
}
|
| 1090 |
+
.btn:hover {
|
| 1091 |
+
color:#fff;
|
| 1092 |
+
}
|
| 1093 |
+
.pro-cell:hover {
|
| 1094 |
+
opacity: .8;
|
| 1095 |
+
}
|
| 1096 |
+
.pro-cell a {
|
| 1097 |
+
transition: all .3s;
|
| 1098 |
+
color: #fff;
|
| 1099 |
+
}
|
| 1100 |
+
/**
|
| 1101 |
+
* For modern browsers
|
| 1102 |
+
* 1. The space content is one way to avoid an Opera bug when the
|
| 1103 |
+
* contenteditable attribute is included anywhere else in the document.
|
| 1104 |
+
* Otherwise it causes space to appear at the top and bottom of elements
|
| 1105 |
+
* that are clearfixed.
|
| 1106 |
+
* 2. The use of `table` rather than `block` is only necessary if using
|
| 1107 |
+
* `:before` to contain the top-margins of child elements.
|
| 1108 |
+
*/
|
| 1109 |
+
.cf:before,
|
| 1110 |
+
.cf:after {
|
| 1111 |
+
content: " ";
|
| 1112 |
+
/* 1 */
|
| 1113 |
+
display: table;
|
| 1114 |
+
/* 2 */
|
| 1115 |
+
}
|
| 1116 |
+
.cf:after {
|
| 1117 |
+
clear: both;
|
| 1118 |
+
}
|
| 1119 |
+
/**
|
| 1120 |
+
* For IE 6/7 only
|
| 1121 |
+
* Include this rule to trigger hasLayout and contain floats.
|
| 1122 |
+
*/
|
| 1123 |
+
.cf {
|
| 1124 |
+
*zoom: 1;
|
| 1125 |
+
}
|
| 1126 |
+
|
| 1127 |
+
.li
|
| 1128 |
+
{
|
| 1129 |
+
cursor:pointer;
|
| 1130 |
+
font-size:16px;
|
| 1131 |
+
display:inline;
|
| 1132 |
+
float:left;
|
| 1133 |
+
margin-left:7px;
|
| 1134 |
+
}
|
| 1135 |
+
|
| 1136 |
+
.listview
|
| 1137 |
+
{
|
| 1138 |
+
font-size:16px;
|
| 1139 |
+
display:inline;
|
| 1140 |
+
float:left;
|
| 1141 |
+
margin-left:7px;
|
| 1142 |
+
}
|
| 1143 |
+
|
| 1144 |
+
.menu_activ
|
| 1145 |
+
{
|
| 1146 |
+
cursor: pointer;
|
| 1147 |
+
font-size:16px;
|
| 1148 |
+
display:inline;
|
| 1149 |
+
float:left;
|
| 1150 |
+
margin-left:7px;
|
| 1151 |
+
color:red;
|
| 1152 |
+
}
|
| 1153 |
+
/*.hide
|
| 1154 |
+
{
|
| 1155 |
+
display:none;
|
| 1156 |
+
}
|
| 1157 |
+
.padd
|
| 1158 |
+
{
|
| 1159 |
+
padding:2px;
|
| 1160 |
+
}*/
|
| 1161 |
+
|
| 1162 |
+
#image-list .small .card-title
|
| 1163 |
+
{
|
| 1164 |
+
display: none;
|
| 1165 |
+
}
|
| 1166 |
+
|
| 1167 |
+
#image-list .small .card-content
|
| 1168 |
+
{
|
| 1169 |
+
display: none;
|
| 1170 |
+
}
|
| 1171 |
+
|
| 1172 |
+
#image-list .small .card-action
|
| 1173 |
+
{
|
| 1174 |
+
background-color:#402723;
|
| 1175 |
+
padding:5px;
|
| 1176 |
+
text-align: center;
|
| 1177 |
+
}
|
| 1178 |
+
|
| 1179 |
+
|
| 1180 |
+
#image-list .medium .card-action i
|
| 1181 |
+
{
|
| 1182 |
+
text-align: center;
|
| 1183 |
+
display: none;
|
| 1184 |
+
}
|
| 1185 |
+
|
| 1186 |
+
#image-list .big .card-action i
|
| 1187 |
+
{
|
| 1188 |
+
text-align: center;
|
| 1189 |
+
|
| 1190 |
+
display: none;
|
| 1191 |
+
}
|
| 1192 |
+
|
| 1193 |
+
|
| 1194 |
+
#image-list .small .card-action a span
|
| 1195 |
+
{
|
| 1196 |
+
display:none;
|
| 1197 |
+
}
|
| 1198 |
+
#image-list .small .card-action .remove span
|
| 1199 |
+
{
|
| 1200 |
+
display: none;
|
| 1201 |
+
}
|
| 1202 |
+
|
| 1203 |
+
{
|
| 1204 |
+
display:none;
|
| 1205 |
+
}
|
| 1206 |
+
#image-list .small .card-action a i
|
| 1207 |
+
{
|
| 1208 |
+
color:white;
|
| 1209 |
+
}
|
| 1210 |
+
|
| 1211 |
+
.filter-list
|
| 1212 |
+
{
|
| 1213 |
+
border-radius: 3px;
|
| 1214 |
+
margin-left: 10px;
|
| 1215 |
+
margin-right: 10px;
|
| 1216 |
+
padding: 12px;
|
| 1217 |
+
background-color: #FFF9F0;
|
| 1218 |
+
}
|
| 1219 |
+
|
| 1220 |
+
.list-view
|
| 1221 |
+
{
|
| 1222 |
+
float: left;
|
| 1223 |
+
font-size: 16px;
|
| 1224 |
+
}
|
| 1225 |
+
|
| 1226 |
+
.filter-select-control{
|
| 1227 |
+
float: left;
|
| 1228 |
+
}
|
| 1229 |
+
.filter-item
|
| 1230 |
+
{
|
| 1231 |
+
cursor: pointer;
|
| 1232 |
+
display: inline;
|
| 1233 |
+
float: left;
|
| 1234 |
+
font-size: 16px;
|
| 1235 |
+
margin-left: 10px !important;
|
| 1236 |
+
}
|
| 1237 |
+
|
| 1238 |
+
.menu-activ
|
| 1239 |
+
{
|
| 1240 |
+
color: red;
|
| 1241 |
+
}
|
| 1242 |
+
|
| 1243 |
+
.import-export
|
| 1244 |
+
{
|
| 1245 |
+
padding-left: 42px;
|
| 1246 |
+
margin-top: 20px;
|
| 1247 |
+
padding-bottom: 50px;
|
| 1248 |
+
}
|
| 1249 |
+
.import-export a
|
| 1250 |
+
{
|
| 1251 |
+
display: block;
|
| 1252 |
+
padding: 10px 21px 11px 49px;
|
| 1253 |
+
width: 145px;
|
| 1254 |
+
float: left;
|
| 1255 |
+
margin-right: 15px;
|
| 1256 |
+
color: #ADACAC;
|
| 1257 |
+
background-color: white;
|
| 1258 |
+
}
|
| 1259 |
+
|
| 1260 |
+
.import-export a:hover
|
| 1261 |
+
{
|
| 1262 |
+
background-color: #51AD31;
|
| 1263 |
+
color: white;
|
| 1264 |
+
}
|
| 1265 |
+
|
| 1266 |
+
#import-modal textarea, #export-modal textarea
|
| 1267 |
+
{
|
| 1268 |
+
height: 100px;
|
| 1269 |
+
}
|
| 1270 |
+
|
| 1271 |
+
.collapsible .active .collapsible-header
|
| 1272 |
+
{
|
| 1273 |
+
background-color: #51AD31 !important;
|
| 1274 |
+
}
|
| 1275 |
+
.collapsible .active .collapsible-header span,
|
| 1276 |
+
.collapsible .active .collapsible-header i
|
| 1277 |
+
{
|
| 1278 |
+
color: white;
|
| 1279 |
+
}
|
| 1280 |
+
|
| 1281 |
+
.collapsible .active .collapsible-body
|
| 1282 |
+
{
|
| 1283 |
+
background-color: white;
|
| 1284 |
+
}
|
| 1285 |
+
|
| 1286 |
+
.backdrop
|
| 1287 |
+
{
|
| 1288 |
+
background: green;
|
| 1289 |
+
}
|
| 1290 |
+
|
| 1291 |
+
.select-effect
|
| 1292 |
+
{
|
| 1293 |
+
display: block;
|
| 1294 |
+
width: 34%;
|
| 1295 |
+
height: 50px !important;
|
| 1296 |
+
border-radius: 5px;
|
| 1297 |
+
}
|
| 1298 |
+
|
| 1299 |
+
|
| 1300 |
+
#hover-effect th
|
| 1301 |
+
{
|
| 1302 |
+
display: none;
|
| 1303 |
+
}
|
| 1304 |
+
#hover-effect .panel {
|
| 1305 |
+
padding: 20px;
|
| 1306 |
+
background: #fafafa;
|
| 1307 |
+
}
|
| 1308 |
+
#hover-effect .effect-description
|
| 1309 |
+
{
|
| 1310 |
+
display: block;
|
| 1311 |
+
color: #51AD31;
|
| 1312 |
+
padding-bottom: 12px;
|
| 1313 |
+
font-size: 18px;
|
| 1314 |
+
font-weight: normal;
|
| 1315 |
+
}
|
| 1316 |
+
|
| 1317 |
+
#hover-effect .help
|
| 1318 |
+
{
|
| 1319 |
+
display: none;
|
| 1320 |
+
}
|
| 1321 |
+
|
| 1322 |
+
#hover-effect .effect-color
|
| 1323 |
+
{
|
| 1324 |
+
display: block !important;
|
| 1325 |
+
}
|
| 1326 |
+
#hover-effect .effect-img
|
| 1327 |
+
{
|
| 1328 |
+
padding: 17px 0px;
|
| 1329 |
+
float: left;
|
| 1330 |
+
}
|
| 1331 |
+
|
| 1332 |
+
#hover-effect .effect-compatibility
|
| 1333 |
+
{
|
| 1334 |
+
margin-left: 430px;
|
| 1335 |
+
}
|
| 1336 |
+
|
| 1337 |
+
#hover-effect .effect-compatibility label
|
| 1338 |
+
{
|
| 1339 |
+
display: block;
|
| 1340 |
+
margin-bottom: 5px;
|
| 1341 |
+
}
|
| 1342 |
+
|
| 1343 |
+
#hover-effect .effect-compatibility label span
|
| 1344 |
+
{
|
| 1345 |
+
display: block;
|
| 1346 |
+
font-size: 14px;
|
| 1347 |
+
margin: 10px;
|
| 1348 |
+
}
|
| 1349 |
+
|
| 1350 |
+
#hover-effect .jump-head
|
| 1351 |
+
{
|
| 1352 |
+
display: none;
|
| 1353 |
+
}
|
| 1354 |
+
|
| 1355 |
+
#hover-effect .fa-check
|
| 1356 |
+
{
|
| 1357 |
+
color: green;
|
| 1358 |
+
}
|
| 1359 |
+
#hover-effect .fa-times
|
| 1360 |
+
{
|
| 1361 |
+
color: red;
|
| 1362 |
+
}
|
| 1363 |
+
#hover-effect .preview {
|
| 1364 |
+
float: none;
|
| 1365 |
+
}
|
| 1366 |
+
#hover-effect .preview .item {
|
| 1367 |
+
width:400px;
|
| 1368 |
+
height:267px;
|
| 1369 |
+
overflow: hidden;
|
| 1370 |
+
position: relative;
|
| 1371 |
+
float: left;
|
| 1372 |
+
}
|
| 1373 |
+
#hover-effect .preview .item img {
|
| 1374 |
+
position: absolute;
|
| 1375 |
+
}
|
| 1376 |
+
.modula .items .item .figc {
|
| 1377 |
+
display: flex;
|
| 1378 |
+
align-items: center;
|
| 1379 |
+
justify-content: center;
|
| 1380 |
+
color: #fff;
|
| 1381 |
+
font-size: 11px;
|
| 1382 |
+
text-align: center;
|
| 1383 |
+
position: absolute;
|
| 1384 |
+
left: 0;
|
| 1385 |
+
width: 100%;
|
| 1386 |
+
padding: 0;
|
| 1387 |
+
}
|
| 1388 |
+
.modula .items .item .figc {
|
| 1389 |
+
width:400px;
|
| 1390 |
+
height:267px;
|
| 1391 |
+
color: #fff;
|
| 1392 |
+
font-size: 11px;
|
| 1393 |
+
text-align: center;
|
| 1394 |
+
position: absolute;
|
| 1395 |
+
left: 0;
|
| 1396 |
+
width: 100%;
|
| 1397 |
+
padding: 0;
|
| 1398 |
+
}
|
| 1399 |
+
.modula .items .item .figc h2 {
|
| 1400 |
+
font-size: 21px;
|
| 1401 |
+
color:#fff;
|
| 1402 |
+
}
|
| 1403 |
+
.modula .items .item .figc p {
|
| 1404 |
+
color:#fff;
|
| 1405 |
+
font-size: 15px;
|
| 1406 |
+
font-style: normal;
|
| 1407 |
+
}
|
| 1408 |
+
.modula .item .jtg-social a {
|
| 1409 |
+
font-size: 17px;
|
| 1410 |
+
}
|
| 1411 |
+
.all-effects {
|
| 1412 |
+
display: inline-block;
|
| 1413 |
+
margin: 20px 0;
|
| 1414 |
+
color:#fff;
|
| 1415 |
+
font-size: 16px;
|
| 1416 |
+
background: #DAA308;
|
| 1417 |
+
padding: 6px 12px;
|
| 1418 |
+
transition:all .2s;
|
| 1419 |
+
}
|
| 1420 |
+
.all-effects:hover {
|
| 1421 |
+
opacity: .8;
|
| 1422 |
+
color:#fff;
|
| 1423 |
+
}
|
| 1424 |
+
.setting
|
| 1425 |
+
{
|
| 1426 |
+
color: #ADACAC;
|
| 1427 |
+
padding-left: 45px;
|
| 1428 |
+
margin-bottom: 15px;
|
| 1429 |
+
}
|
| 1430 |
+
|
| 1431 |
+
#other-galleries .cta {
|
| 1432 |
+
width:170px;
|
| 1433 |
+
text-align: right;
|
| 1434 |
+
}
|
| 1435 |
+
#other-galleries .text {
|
| 1436 |
+
font-size: 17px;
|
| 1437 |
+
width:calc(100% - 180px);
|
| 1438 |
+
padding-right: 20px;
|
| 1439 |
+
height: 150px;
|
| 1440 |
+
}
|
| 1441 |
+
#other-galleries .text h4 {
|
| 1442 |
+
font-size: 19px;
|
| 1443 |
+
font-weight: bold;
|
| 1444 |
+
}
|
| 1445 |
+
#other-galleries .text,
|
| 1446 |
+
#other-galleries .cta {
|
| 1447 |
+
display: inline-block;
|
| 1448 |
+
vertical-align: top;
|
| 1449 |
+
}
|
| 1450 |
+
#other-galleries .cta a {
|
| 1451 |
+
margin-right: 0;
|
| 1452 |
+
margin-top: 69px;
|
| 1453 |
+
}
|
| 1454 |
+
#other-galleries * {
|
| 1455 |
+
outline: 0;
|
| 1456 |
+
}
|
| 1457 |
+
#adminmenu .wp-submenu .modula-jump-pro-menu {
|
| 1458 |
+
color:#22e34f;
|
| 1459 |
+
font-weight: bold;
|
| 1460 |
+
}
|
| 1461 |
+
#external-galleries input[type=checkbox] {
|
| 1462 |
+
position: static;
|
| 1463 |
+
}
|
| 1464 |
+
|
| 1465 |
+
/* Added in 1.2.0 */
|
| 1466 |
+
#toplevel_page_modula-lite-admin ul li:last-of-type a {
|
| 1467 |
+
color: #7cc048 !important;
|
| 1468 |
+
}
|
| 1469 |
+
|
| 1470 |
+
#toplevel_page_modula-lite-admin ul li:nth-child(4),
|
| 1471 |
+
#toplevel_page_modula-lite-admin ul li:nth-child(4):hover {
|
| 1472 |
+
display: none;
|
| 1473 |
+
}
|
| 1474 |
+
|
| 1475 |
+
body .modula-wrap .wp-badge {
|
| 1476 |
+
background: url('../images/modula-logo.jpg') center 35px no-repeat #50ad31;
|
| 1477 |
+
padding-top: 160px;
|
| 1478 |
+
height: 0;
|
| 1479 |
+
background-size: 80px 80px;
|
| 1480 |
+
}
|
| 1481 |
+
|
| 1482 |
+
.shortpixel {
|
| 1483 |
+
display: block;
|
| 1484 |
+
background: #fafafa;
|
| 1485 |
+
border: 1px solid #DDD;
|
| 1486 |
+
padding: 20px;
|
|
|
|
|
|
|
|
|
|
| 1487 |
}
|
admin/edit-gallery.php
CHANGED
|
@@ -1,412 +1,403 @@
|
|
| 1 |
-
|
| 2 |
-
if(preg_match('#' . basename(__FILE__) . '#', $_SERVER['PHP_SELF'])) {
|
| 3 |
-
|
| 4 |
-
|
| 5 |
-
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
|
| 27 |
-
|
| 28 |
-
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
|
| 37 |
-
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
|
| 46 |
-
|
| 47 |
-
|
| 48 |
-
|
| 49 |
-
|
| 50 |
-
|
| 51 |
-
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
|
| 55 |
-
|
| 56 |
-
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
|
| 60 |
-
|
| 61 |
-
|
| 62 |
-
|
| 63 |
-
|
| 64 |
-
|
| 65 |
-
|
| 66 |
-
|
| 67 |
-
|
| 68 |
-
|
| 69 |
-
|
| 70 |
-
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
|
| 74 |
-
|
| 75 |
-
|
| 76 |
-
|
| 77 |
-
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
|
| 81 |
-
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
|
| 88 |
-
|
| 89 |
-
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
|
| 97 |
-
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
|
| 101 |
-
|
| 102 |
-
|
| 103 |
-
|
| 104 |
-
|
| 105 |
-
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
|
| 109 |
-
|
| 110 |
-
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
|
| 118 |
-
|
| 119 |
-
|
| 120 |
-
|
| 121 |
-
|
| 122 |
-
|
| 123 |
-
|
| 124 |
-
|
| 125 |
-
|
| 126 |
-
|
| 127 |
-
|
| 128 |
-
|
| 129 |
-
|
| 130 |
-
|
| 131 |
-
|
| 132 |
-
|
| 133 |
-
|
| 134 |
-
|
| 135 |
-
|
| 136 |
-
|
| 137 |
-
|
| 138 |
-
|
| 139 |
-
|
| 140 |
-
|
| 141 |
-
|
| 142 |
-
|
| 143 |
-
|
| 144 |
-
|
| 145 |
-
|
| 146 |
-
|
| 147 |
-
|
| 148 |
-
|
| 149 |
-
|
| 150 |
-
|
| 151 |
-
|
| 152 |
-
|
| 153 |
-
|
| 154 |
-
|
| 155 |
-
|
| 156 |
-
|
| 157 |
-
|
| 158 |
-
|
| 159 |
-
|
| 160 |
-
|
| 161 |
-
|
| 162 |
-
|
| 163 |
-
|
| 164 |
-
|
| 165 |
-
|
| 166 |
-
|
| 167 |
-
"
|
| 168 |
-
|
| 169 |
-
|
| 170 |
-
|
| 171 |
-
|
| 172 |
-
|
| 173 |
-
|
| 174 |
-
|
| 175 |
-
|
| 176 |
-
|
| 177 |
-
|
| 178 |
-
|
| 179 |
-
|
| 180 |
-
|
| 181 |
-
|
| 182 |
-
|
| 183 |
-
|
| 184 |
-
|
| 185 |
-
|
| 186 |
-
|
| 187 |
-
|
| 188 |
-
|
| 189 |
-
|
| 190 |
-
|
| 191 |
-
|
| 192 |
-
|
| 193 |
-
|
| 194 |
-
|
| 195 |
-
|
| 196 |
-
|
| 197 |
-
|
| 198 |
-
|
| 199 |
-
|
| 200 |
-
|
| 201 |
-
|
| 202 |
-
|
| 203 |
-
|
| 204 |
-
|
| 205 |
-
|
| 206 |
-
|
| 207 |
-
|
| 208 |
-
|
| 209 |
-
|
| 210 |
-
|
| 211 |
-
|
| 212 |
-
|
| 213 |
-
|
| 214 |
-
|
| 215 |
-
|
| 216 |
-
|
| 217 |
-
|
| 218 |
-
|
| 219 |
-
|
| 220 |
-
|
| 221 |
-
|
| 222 |
-
|
| 223 |
-
|
| 224 |
-
|
| 225 |
-
|
| 226 |
-
|
| 227 |
-
|
| 228 |
-
|
| 229 |
-
|
| 230 |
-
|
| 231 |
-
|
| 232 |
-
|
| 233 |
-
|
| 234 |
-
|
| 235 |
-
|
| 236 |
-
|
| 237 |
-
|
| 238 |
-
|
| 239 |
-
|
| 240 |
-
|
| 241 |
-
|
| 242 |
-
|
| 243 |
-
|
| 244 |
-
|
| 245 |
-
|
| 246 |
-
|
| 247 |
-
<li id="images">
|
| 248 |
-
<div class="collapsible-header white-text white darken-2">
|
| 249 |
-
<i class="mdi mdi-image-filter"></i> <span><?php _e('Images','Modula-gallery')?> </span>
|
| 250 |
-
<i class="icon icon-chevron-right"></i>
|
| 251 |
-
</div>
|
| 252 |
-
|
| 253 |
-
<div class="collapsible-body white lighten-5">
|
| 254 |
-
<div class="image-size-section">
|
| 255 |
-
<div>
|
| 256 |
-
<div class="tips">
|
| 257 |
<span class="shortpixel">
|
| 258 |
-
<img src="<?php echo plugins_url('',__file__) ?>/images/icon-shortpixel.png" alt="ShortPixel">
|
| 259 |
-
<a target="_blank" href="https://shortpixel.com/
|
| 260 |
-
|
| 261 |
-
|
| 262 |
-
|
| 263 |
-
|
| 264 |
-
|
| 265 |
-
|
| 266 |
-
|
| 267 |
-
|
| 268 |
-
|
| 269 |
-
|
| 270 |
-
|
| 271 |
-
|
| 272 |
-
|
| 273 |
-
|
| 274 |
-
|
| 275 |
-
|
| 276 |
-
|
| 277 |
-
|
| 278 |
-
|
| 279 |
-
|
| 280 |
-
|
| 281 |
-
|
| 282 |
-
|
| 283 |
-
|
| 284 |
-
|
| 285 |
-
|
| 286 |
-
|
| 287 |
-
|
| 288 |
-
|
| 289 |
-
|
| 290 |
-
|
| 291 |
-
|
| 292 |
-
|
| 293 |
-
|
| 294 |
-
|
| 295 |
-
|
| 296 |
-
|
| 297 |
-
|
| 298 |
-
|
| 299 |
-
|
| 300 |
-
|
| 301 |
-
|
| 302 |
-
|
| 303 |
-
|
| 304 |
-
|
| 305 |
-
|
| 306 |
-
|
| 307 |
-
|
| 308 |
-
|
| 309 |
-
|
| 310 |
-
|
| 311 |
-
|
| 312 |
-
|
| 313 |
-
|
| 314 |
-
|
| 315 |
-
|
| 316 |
-
|
| 317 |
-
|
| 318 |
-
|
| 319 |
-
|
| 320 |
-
|
| 321 |
-
|
| 322 |
-
|
| 323 |
-
|
| 324 |
-
|
| 325 |
-
|
| 326 |
-
|
| 327 |
-
|
| 328 |
-
|
| 329 |
-
|
| 330 |
-
|
| 331 |
-
|
| 332 |
-
|
| 333 |
-
|
| 334 |
-
|
| 335 |
-
|
| 336 |
-
|
| 337 |
-
|
| 338 |
-
|
| 339 |
-
|
| 340 |
-
|
| 341 |
-
|
| 342 |
-
|
| 343 |
-
|
| 344 |
-
|
| 345 |
-
|
| 346 |
-
|
| 347 |
-
|
| 348 |
-
|
| 349 |
-
|
| 350 |
-
|
| 351 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 352 |
|
| 353 |
<a id="edit-gallery" data-tooltip="Update gallery" data-position="top" data-delay="10" class="tooltipped btn-floating btn-large waves-effect waves-light green update-gallery">
|
| 354 |
-
<i class="icon icon-save-disk"> </i>
|
| 355 |
-
</a>
|
| 356 |
-
<div class="fixed-action-btn bullet-menu">
|
| 357 |
-
<a class="btn-floating btn-large green darken-1 right back-to-top">
|
| 358 |
-
<i class="icon icon-angle-up"></i>
|
| 359 |
-
</a>
|
| 360 |
-
<ul>
|
| 361 |
-
<?php foreach($modula_fields as $section => $s) : ?>
|
| 362 |
-
<li>
|
| 363 |
-
<a class="btn-floating green" rel="<?php print strtolower(str_replace(' ', '-', $section)) ?>"><i class="small <?php _e($s["icon"]) ?>"></i></a>
|
| 364 |
-
</li>
|
| 365 |
-
<?php endforeach ?>
|
| 366 |
-
<li><a class="btn-floating green" rel="images"><i class="small mdi mdi-image-filter"></i></a></li>
|
| 367 |
-
</ul>
|
| 368 |
-
</div>
|
| 369 |
|
| 370 |
<div class="preloader-wrapper big active" id="spinner">
|
| 371 |
-
|
| 372 |
-
|
| 373 |
-
|
| 374 |
-
|
| 375 |
-
|
| 376 |
-
|
| 377 |
-
|
| 378 |
-
|
| 379 |
-
|
| 380 |
-
|
| 381 |
-
|
| 382 |
-
|
| 383 |
-
|
| 384 |
-
|
| 385 |
-
|
| 386 |
-
|
| 387 |
-
|
| 388 |
-
|
| 389 |
-
|
| 390 |
-
|
| 391 |
-
|
| 392 |
-
|
| 393 |
-
|
|
|
|
|
|
|
| 394 |
</div>
|
| 395 |
|
| 396 |
<div id="export-modal" class="modal">
|
| 397 |
-
|
| 398 |
-
|
| 399 |
-
|
| 400 |
-
|
| 401 |
-
|
| 402 |
-
|
| 403 |
-
|
| 404 |
-
|
| 405 |
</div>
|
| 406 |
|
| 407 |
<script>
|
| 408 |
-
|
| 409 |
-
|
| 410 |
-
|
| 411 |
-
|
| 412 |
-
|
| 1 |
+
<?php
|
| 2 |
+
if ( preg_match( '#' . basename( __FILE__ ) . '#', $_SERVER['PHP_SELF'] ) ) {
|
| 3 |
+
die( _e( 'You are not allowed to call this page directly.', 'modula-gallery' ) );
|
| 4 |
+
}
|
| 5 |
+
|
| 6 |
+
function modula_print_value( $gallery, $field, $default = null ) {
|
| 7 |
+
if ( $gallery == null || $gallery->$field === null ) {
|
| 8 |
+
if ( $default === null ) {
|
| 9 |
+
print "";
|
| 10 |
+
} else {
|
| 11 |
+
print stripslashes( $default );
|
| 12 |
+
}
|
| 13 |
+
} else {
|
| 14 |
+
print stripslashes( $gallery->$field );
|
| 15 |
+
}
|
| 16 |
+
}
|
| 17 |
+
|
| 18 |
+
$galleryResults = $this->ModulaDB->getGalleries();
|
| 19 |
+
|
| 20 |
+
$gallery = $this->loadedData;
|
| 21 |
+
$tg_subtitle = "Edit Gallery: " . $gallery->name;
|
| 22 |
+
|
| 23 |
+
include( "header.php" );
|
| 24 |
+
|
| 25 |
+
?>
|
| 26 |
+
|
| 27 |
+
<script>
|
| 28 |
+
var modula_wp_caption_field = '<?php modula_print_value( $gallery, "wp_field_caption" ) ?>';
|
| 29 |
+
</script>
|
| 30 |
+
<div class="container">
|
| 31 |
+
<div class="row collapsible">
|
| 32 |
+
<div class="card-panel light-green lighten-4">
|
| 33 |
+
<span> Shortcode: </span>
|
| 34 |
+
<input type="text" readonly value="[Modula id='<?php print $gallery->id; ?>']"> </input>
|
| 35 |
+
</div>
|
| 36 |
+
</div>
|
| 37 |
+
</div>
|
| 38 |
+
|
| 39 |
+
<div class="container">
|
| 40 |
+
<div class="row">
|
| 41 |
+
<ul class="collapsible" data-collapsible="accordion">
|
| 42 |
+
<?php foreach ( $modula_fields as $section => $s ): ?>
|
| 43 |
+
<li id="<?php echo strtolower( str_replace( ' ', '-', $section ) ); ?>">
|
| 44 |
+
<div class="collapsible-header white-text darken-2">
|
| 45 |
+
<i class="<?php echo esc_attr( $s["icon"] ); ?>"></i>
|
| 46 |
+
<span><?php echo esc_html( $section ) ?> </span> <i class="fa fa-chevron-right"></i>
|
| 47 |
+
</div>
|
| 48 |
+
|
| 49 |
+
<div class="collapsible-body lighten-5 tab form-fields">
|
| 50 |
+
|
| 51 |
+
<input type="hidden" id="wp_caption" value="<?php echo esc_attr( $gallery->wp_field_caption ); ?>">
|
| 52 |
+
<input type="hidden" id="wp_title" value="<?php echo esc_attr( $gallery->wp_field_title ); ?>">
|
| 53 |
+
|
| 54 |
+
<form name="gallery_form" id="gallery_form" action="<?php echo str_replace( '%7E', '~', $_SERVER['REQUEST_URI'] ); ?>" method="post">
|
| 55 |
+
<?php wp_nonce_field( 'Modula', 'Modula' ); ?>
|
| 56 |
+
<input type="hidden" name="ftg_gallery_edit" id="gallery-id" value="<?php echo esc_attr( $gallery->id ); ?>"/>
|
| 57 |
+
<table class="widefat post fixed" cellspacing="0">
|
| 58 |
+
</tbody>
|
| 59 |
+
</table>
|
| 60 |
+
</form>
|
| 61 |
+
|
| 62 |
+
<table>
|
| 63 |
+
<tbody>
|
| 64 |
+
<?php foreach ( $s["fields"] as $f => $data ) : ?><?php if ( is_array( $data["excludeFrom"] ) && ! in_array( $modula_parent_page, $data["excludeFrom"] ) ) : ?>
|
| 65 |
+
<tr class="row-<?php echo esc_attr( $f ); ?> <?php echo esc_attr( $data["type"] ); ?>">
|
| 66 |
+
<th scope="row">
|
| 67 |
+
<label class="label-text"><?php echo esc_html( $data["name"] ); ?>
|
| 68 |
+
<?php if ( isset( $data["mu"] ) ) : ?>
|
| 69 |
+
(<?php echo esc_html( $data["mu"] ) ?>)
|
| 70 |
+
<?php endif ?>
|
| 71 |
+
</label>
|
| 72 |
+
</th>
|
| 73 |
+
<td>
|
| 74 |
+
<div class="field">
|
| 75 |
+
<?php if ( $data["type"] == "text" ) : ?>
|
| 76 |
+
<div class="text">
|
| 77 |
+
<input type="text" size="30" name="tg_<?php echo esc_attr( $f ); ?>" value="<?php echo esc_attr( $gallery->$f ); ?>"/>
|
| 78 |
+
</div>
|
| 79 |
+
<?php elseif ( $data["type"] == "select" ) : ?>
|
| 80 |
+
|
| 81 |
+
<div class="text">
|
| 82 |
+
<select class="browser-default dropdown-menu" name="tg_<?php echo esc_attr( $f ); ?>">
|
| 83 |
+
<?php foreach ( array_keys( $data["values"] ) as $optgroup ) : ?>
|
| 84 |
+
<optgroup label="<?php echo esc_attr( $optgroup ); ?>">
|
| 85 |
+
<?php foreach ( $data["values"][ $optgroup ] as $option ) : ?><?php $v = explode( "|", $option ); ?>
|
| 86 |
+
<option value="<?php echo esc_attr( $v[0] ); ?>" <?php echo $v[0] == $gallery->$f ? "selected" : "" ?> ><?php echo esc_html( $v[1] ); ?></option>
|
| 87 |
+
<?php endforeach ?>
|
| 88 |
+
</optgroup>
|
| 89 |
+
<?php endforeach ?>
|
| 90 |
+
<?php if ( isset( $data["disabled"] ) ) : ?><?php foreach ( array_keys( $data["disabled"] ) as $optgroup ) : ?>
|
| 91 |
+
<optgroup label="<?php echo esc_attr( $optgroup ); ?>">
|
| 92 |
+
<?php foreach ( $data["disabled"][ $optgroup ] as $option ) : ?>
|
| 93 |
+
|
| 94 |
+
<?php $v = explode( "|", $option ); ?>
|
| 95 |
+
<option disabled><?php echo esc_html( $v[1] ) ?></option>
|
| 96 |
+
<?php endforeach ?>
|
| 97 |
+
</optgroup>
|
| 98 |
+
<?php endforeach ?>
|
| 99 |
+
|
| 100 |
+
<?php endif ?>
|
| 101 |
+
</select>
|
| 102 |
+
</div>
|
| 103 |
+
<?php elseif ( $data["type"] == "toggle" ) : ?>
|
| 104 |
+
<div class="text">
|
| 105 |
+
<input type="checkbox" id="ftg_<?php echo esc_attr( $f ); ?>" name="tg_<?php echo esc_attr( $f ); ?>" value="<?php echo esc_attr( $gallery->$f ); ?>" <?php echo $gallery->$f == 'T' ? 'checked' : '' ?> />
|
| 106 |
+
<label for="ftg_<?php echo esc_attr( $f ); ?>"><?php echo esc_html( $data["description"] ); ?></label>
|
| 107 |
+
</div>
|
| 108 |
+
|
| 109 |
+
<?php elseif ( $data["type"] == "ui-slider" || $data['type'] == 'slider' ) : ?>
|
| 110 |
+
<div class="text">
|
| 111 |
+
<label class="effect-description"><?php echo esc_html( $data['description'] ); ?></label>
|
| 112 |
+
<p class="range-field">
|
| 113 |
+
<input name="tg_<?php echo esc_attr( $f ); ?>" value="<?php echo esc_attr( $gallery->$f ); ?>" type="range" min="<?php echo esc_attr( $data["min"] ); ?>" max="<?php echo esc_attr( $data["max"] ); ?>"/>
|
| 114 |
+
</p>
|
| 115 |
+
</div>
|
| 116 |
+
|
| 117 |
+
<?php elseif ( $data["type"] == "number" ) : ?>
|
| 118 |
+
<div class="text">
|
| 119 |
+
<input type="text" name="tg_<?php echo esc_attr( $f ); ?>" class="integer-only" value="<?php echo esc_attr( $gallery->$f ); ?>">
|
| 120 |
+
</div>
|
| 121 |
+
|
| 122 |
+
<?php elseif ( $data["type"] == "color" ) : ?>
|
| 123 |
+
<div class="text">
|
| 124 |
+
<label class="effect-description effect-color" style="display:none;"> <?php echo esc_html( $data['description'] ); ?></label>
|
| 125 |
+
<input type="text" size="6" data-default-color="<?php echo esc_attr( $data["default"] ); ?>" name="tg_<?php echo esc_attr( $f ); ?>" value="<?php echo esc_attr( $gallery->$f ); ?>" class='pickColor'/>
|
| 126 |
+
</div>
|
| 127 |
+
<?php elseif ( $data["type"] == "PRO_FEATURE" ) : ?>
|
| 128 |
+
|
| 129 |
+
<div class="pro-cell">
|
| 130 |
+
<h6><?php echo esc_html__( 'This feature is available only in the PRO version of Modula', 'modula-lite' ); ?></h6>
|
| 131 |
+
<br/>
|
| 132 |
+
<a class="button button-secondary" href="<?php echo esc_url( admin_url( 'admin.php?page=modula-lite-gallery-upgrade&tab=comparison_table' ) ); ?>" target="_blank">
|
| 133 |
+
<?php echo esc_html__( 'See LITE vs PRO Differences', 'modula-gallery' ); ?></a>
|
| 134 |
+
<a class="button button-primary" href="https://wp-modula.com/?utm_source=modulalite_inst&utm_medium=banner&utm_campaign=Modula%20Lite#buy" target="_blank"><span class="dashicons dashicons-cart"></span>
|
| 135 |
+
<?php echo esc_html__( 'Get Modula Pro!', 'modula-gallery' ); ?>
|
| 136 |
+
</a>
|
| 137 |
+
</div>
|
| 138 |
+
|
| 139 |
+
<?php elseif ( $data["type"] == "textarea" ) : ?>
|
| 140 |
+
<div class="text">
|
| 141 |
+
<textarea name="tg_<?php echo esc_attr( $f ); ?>"><?php echo esc_html( $gallery->$f ); ?></textarea>
|
| 142 |
+
</div>
|
| 143 |
+
<?php elseif ( $data["type"] == "hover-effect" ): ?>
|
| 144 |
+
|
| 145 |
+
<div class="text">
|
| 146 |
+
<label class="effect-description"> <?php print $data['description']; ?> </label>
|
| 147 |
+
<select name="tg_hoverEffect" class="select-effect">
|
| 148 |
+
<?php $hoverEffectIdx = 0 ?>
|
| 149 |
+
<option value="none"><?php echo esc_html__( 'None', 'modula-gallery' ); ?></option>
|
| 150 |
+
<optgroup label="Buy a PRO license to unlock all hover effects">
|
| 151 |
+
<option disabled></option>
|
| 152 |
+
<?php foreach ( $this->hoverEffects as $effect ) : ?>
|
| 153 |
+
<option <?php echo $effect->code != "pufrobo" ? "disabled" : null ?> <?php echo( $gallery->hoverEffect == strtolower( $effect->code ) ? "selected" : null ) ?> value="<?php echo esc_attr( $effect->code ); ?>"><?php echo esc_attr( $effect->name ); ?></option>
|
| 154 |
+
<?php endforeach ?>
|
| 155 |
+
</optgroup>
|
| 156 |
+
</select>
|
| 157 |
+
<a class="all-effects" href="https://wp-modula.com/demo/effects/appear/?utm_source=modulalite_inst&utm_campaign=Modula%20Lite&utm_medium=banner&utm_term=all%20effects" target="_blank"><i class="mdi mdi-comment-alert-outline"></i>
|
| 158 |
+
<?php echo esc_html__( 'Click to see all available effects', 'modula-gallery' ); ?>
|
| 159 |
+
</a>
|
| 160 |
+
|
| 161 |
+
<!-- all effects preview -->
|
| 162 |
+
<div class="preview modula">
|
| 163 |
+
<div class="panel panel-pufrobo items clearfix">
|
| 164 |
+
<!-- show preview -->
|
| 165 |
+
|
| 166 |
+
<div class="item effect-pufrobo">
|
| 167 |
+
<img src="<?php print plugins_url() ?>/modula-best-grid-gallery/admin/images/effect.jpg" class="pic">
|
| 168 |
+
<div class="figc">
|
| 169 |
+
<div class="figc-inner">
|
| 170 |
+
|
| 171 |
+
<h2>Lorem ipsum</h2>
|
| 172 |
+
<p class="description">Quisque diam erat, mollis
|
| 173 |
+
vitae enim eget</p>
|
| 174 |
+
<div class="jtg-social">
|
| 175 |
+
<a class="fa fa-twitter" href="#"></a>
|
| 176 |
+
<a class="fa fa-facebook" href="#"></a>
|
| 177 |
+
<a class="fa fa-google-plus" href="#"></a>
|
| 178 |
+
<a class="fa fa-pinterest" href="#"></a>
|
| 179 |
+
</div>
|
| 180 |
+
</div>
|
| 181 |
+
</div>
|
| 182 |
+
</div>
|
| 183 |
+
|
| 184 |
+
<div class="effect-compatibility">
|
| 185 |
+
|
| 186 |
+
<label class="effect-description"> <?php echo esc_html( 'This effect is
|
| 187 |
+
compatible with:', 'modula-gallery' ); ?>
|
| 188 |
+
<?php if ( $effect->allowTitle ): ?>
|
| 189 |
+
<span><i class="fa fa-check"></i> <?php echo esc_html( 'Title', 'modula-gallery' ); ?></span>
|
| 190 |
+
<?php endif; ?>
|
| 191 |
+
|
| 192 |
+
<?php if ( $effect->allowSubtitle ): ?>
|
| 193 |
+
<span><i class="fa fa-check"></i> <?php echo esc_html( 'Subtitle', 'modula-gallery' ); ?> </span>
|
| 194 |
+
<?php endif; ?>
|
| 195 |
+
|
| 196 |
+
<?php if ( $effect->maxSocial > 0 ): ?>
|
| 197 |
+
<span><i class="fa fa-check"></i> <?php echo esc_html( 'Social Icons', 'modula-gallery' ); ?> </span>
|
| 198 |
+
<?php endif; ?>
|
| 199 |
+
|
| 200 |
+
</label>
|
| 201 |
+
|
| 202 |
+
</div>
|
| 203 |
+
</div>
|
| 204 |
+
</div>
|
| 205 |
+
<input type="hidden" name="ftg_hoverColor" value="#000">
|
| 206 |
+
<input type="hidden" name="ftg_hoverOpacity" value="#.8"> <br/>
|
| 207 |
+
<div class="pro-cell">
|
| 208 |
+
<h6><?php echo esc_html__( 'The PRO version of Modula bundles over 12 different hover effects.', 'modula-gallery' ); ?></h6>
|
| 209 |
+
<br/>
|
| 210 |
+
<a class="button button-secondary" href="<?php echo esc_url( admin_url( 'admin.php?page=modula-lite-gallery-upgrade&tab=comparison_table' ) ); ?>" target="_blank">
|
| 211 |
+
<?php echo esc_html__( 'See LITE vs PRO Differences', 'modula-gallery' ); ?>
|
| 212 |
+
</a>
|
| 213 |
+
<a class="button button-primary" href="https://wp-modula.com/?utm_source=modulalite_inst&utm_medium=banner&utm_campaign=Modula%20Lite#buy" target="_blank"><span class="dashicons dashicons-cart"></span>
|
| 214 |
+
<?php echo esc_html__( 'Get Modula Pro!', 'modula-gallery' ); ?>
|
| 215 |
+
</a>
|
| 216 |
+
</div>
|
| 217 |
+
</div>
|
| 218 |
+
<?php endif ?>
|
| 219 |
+
<div class="help">
|
| 220 |
+
<?php _e( $data["description"] ); ?>
|
| 221 |
+
</div>
|
| 222 |
+
|
| 223 |
+
</div>
|
| 224 |
+
</td>
|
| 225 |
+
</tr>
|
| 226 |
+
<?php endif ?><?php endforeach ?>
|
| 227 |
+
|
| 228 |
+
</tbody>
|
| 229 |
+
</table>
|
| 230 |
+
</div>
|
| 231 |
+
</li>
|
| 232 |
+
<?php endforeach; ?>
|
| 233 |
+
|
| 234 |
+
<li id="images">
|
| 235 |
+
<div class="collapsible-header white-text white darken-2">
|
| 236 |
+
<i class="mdi mdi-image-filter"></i>
|
| 237 |
+
<span><?php echo esc_html__( 'Images', 'Modula-gallery' ) ?> </span>
|
| 238 |
+
<i class="fa fa-chevron-right"></i>
|
| 239 |
+
</div>
|
| 240 |
+
|
| 241 |
+
<div class="collapsible-body white lighten-5">
|
| 242 |
+
|
| 243 |
+
<div class="image-size-section">
|
| 244 |
+
<div>
|
| 245 |
+
<div class="tips">
|
| 246 |
+
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 247 |
<span class="shortpixel">
|
| 248 |
+
<img src="<?php echo plugins_url( '', __file__ ) ?>/images/icon-shortpixel.png" alt="ShortPixel">
|
| 249 |
+
<a target="_blank" href="https://shortpixel.com/h/af/HUOYEBB31472"><?php echo esc_html__( 'We suggest using the ShortPixel image optimization plugin to optimize your images and get the best possible SEO results & load speed..', 'modula-gallery' ) ?></a>
|
| 250 |
+
</span>
|
| 251 |
+
|
| 252 |
+
</div>
|
| 253 |
+
</div>
|
| 254 |
+
</div>
|
| 255 |
+
|
| 256 |
+
<div>
|
| 257 |
+
<div class="pro-cell">
|
| 258 |
+
<h6><?php echo esc_html__( 'Add more than 20 images per gallery. Upgrade to PRO', 'modula-gallery' ); ?></h6>
|
| 259 |
+
<br/>
|
| 260 |
+
<a class="button button-secondary" href="<?php echo esc_url( admin_url( 'admin.php?page=modula-lite-gallery-upgrade&tab=comparison_table' ) ); ?>" target="_blank">See
|
| 261 |
+
<?php echo esc_html__( 'LITE vs PRO Differences', 'modula-gallery' ); ?></a>
|
| 262 |
+
<a class="button button-primary" href="https://wp-modula.com/?utm_source=modulalite_inst&utm_medium=banner&utm_campaign=Modula%20Lite#buy" target="_blank"><span class="dashicons dashicons-cart"></span>
|
| 263 |
+
<?php echo esc_html__( 'Get Modula Pro!', 'modula-gallery' ); ?></a>
|
| 264 |
+
</div>
|
| 265 |
+
|
| 266 |
+
<div class="actions row">
|
| 267 |
+
<label class="label-text row"><?php echo esc_html__( 'Add Images', 'modula-gallery' ) ?></label>
|
| 268 |
+
<a href="#" class="open-media-panel waves-effect button-bg waves-light btn action"><i class="mdi-image-photo"></i> <?php echo esc_html__( 'Add images', 'modula-gallery' ) ?>
|
| 269 |
+
</a>
|
| 270 |
+
</div>
|
| 271 |
+
|
| 272 |
+
<div class="bulk row">
|
| 273 |
+
<label class="label-text row"><?php echo esc_html__( 'Bulk Actions', 'modula-gallery' ) ?></label>
|
| 274 |
+
<div class="options">
|
| 275 |
+
<a class="btn button-bg waves-effect waves-light" href="#" data-action="select"><?php echo esc_html__( 'Select all', 'modula-gallery' ) ?></a>
|
| 276 |
+
<a class="btn button-bg waves-effect waves-light" href="#" data-action="deselect"><?php echo esc_html__( 'Deselect all', 'modula-gallery' ) ?></a>
|
| 277 |
+
<a class="btn button-bg waves-effect waves-light" href="#" data-action="toggle"><?php echo esc_html__( 'Toggle selection', 'modula-gallery' ) ?></a>
|
| 278 |
+
<a class="btn button-bg waves-effect waves-light" href="#" data-action="remove"><?php echo esc_html__( 'Remove', 'modula-gallery' ) ?></a>
|
| 279 |
+
</div>
|
| 280 |
+
<div class="panel">
|
| 281 |
+
<strong></strong>
|
| 282 |
+
<p class="text"></p>
|
| 283 |
+
<p class="buttons">
|
| 284 |
+
<a class="btn deep-orange darken-2 mrm cancel" href="#"><?php echo esc_html__( 'Cancel', 'modula-gallery' ) ?></a>
|
| 285 |
+
<a class="btn green mrm proceed firm" href="#"><?php echo esc_html__( 'Proceed', 'modula-gallery' ) ?></a>
|
| 286 |
+
</p>
|
| 287 |
+
</div>
|
| 288 |
+
</div>
|
| 289 |
+
|
| 290 |
+
<div class="row">
|
| 291 |
+
<span class="tip"><?php echo esc_html__( 'Drag images to change order.', 'modula-gallery' ) ?></span>
|
| 292 |
+
</div>
|
| 293 |
+
|
| 294 |
+
<div id="image-list"></div>
|
| 295 |
+
|
| 296 |
+
<!-- image panel -->
|
| 297 |
+
<div id="image-panel-model" style="display:none">
|
| 298 |
+
<a href="#" class="close" title="Close">X</a>
|
| 299 |
+
<h4> <?php _e( 'Edit Image', 'modula-gallery' ) ?> </h4>
|
| 300 |
+
<div class="clearfix">
|
| 301 |
+
<div class="left">
|
| 302 |
+
<div class="figure"></div>
|
| 303 |
+
</div>
|
| 304 |
+
<div class="editimage-right">
|
| 305 |
+
<div class="field">
|
| 306 |
+
<label><?php echo esc_html__( 'Title', 'modula-gallery' ) ?></label>
|
| 307 |
+
<div class="text">
|
| 308 |
+
<textarea id="item-title" name="title"></textarea>
|
| 309 |
+
</div>
|
| 310 |
+
<label><?php echo esc_html__( 'Caption', 'modula-gallery' ) ?></label>
|
| 311 |
+
<div class="text">
|
| 312 |
+
<textarea id="item-description" name="description"></textarea>
|
| 313 |
+
</div>
|
| 314 |
+
</div>
|
| 315 |
+
|
| 316 |
+
<div class="field">
|
| 317 |
+
<label for="alignment"><?php echo esc_html__( 'Alignment', 'modula-gallery' ) ?></label>
|
| 318 |
+
<select name="halign">
|
| 319 |
+
<option><?php _e( 'left', 'modula-gallery' ) ?></option>
|
| 320 |
+
<option selected><?php _e( 'center', 'modula-gallery' ) ?></option>
|
| 321 |
+
<option><?php _e( 'right', 'modula-gallery' ) ?></option>
|
| 322 |
+
</select> <select name="valign">
|
| 323 |
+
<option><?php _e( 'top', 'modula-gallery' ) ?></option>
|
| 324 |
+
<option selected><?php _e( 'middle', 'modula-gallery' ) ?></option>
|
| 325 |
+
<option><?php _e( 'bottom', 'modula-gallery' ) ?></option>
|
| 326 |
+
</select>
|
| 327 |
+
</div>
|
| 328 |
+
<div class="field">
|
| 329 |
+
<label><?php _e( 'Link', 'modula-gallery' ) ?></label>
|
| 330 |
+
<div class="text">
|
| 331 |
+
<!-- <input type="text" name="link" value="" class="text-input row"> -->
|
| 332 |
+
<textarea id="item-link" name="link"></textarea> <select name="target">
|
| 333 |
+
<option value=""><?php echo esc_html__( 'Default target', 'modula-gallery' ) ?></option>
|
| 334 |
+
<option value="_self"><?php echo esc_html__( 'Open in same page', 'modula-gallery' ) ?></option>
|
| 335 |
+
<option value="_blank"><?php echo esc_html__( 'Open in new page', 'modula-gallery' ) ?></option>
|
| 336 |
+
</select>
|
| 337 |
+
</div>
|
| 338 |
+
</div>
|
| 339 |
+
<div class="field filters clearfix"></div>
|
| 340 |
+
</div>
|
| 341 |
+
</div>
|
| 342 |
+
<div class="field buttons">
|
| 343 |
+
<a href="#" data-action="cancel" class="action modal-action modal-close waves-effect waves-yellow btn-flat"><i class="mdi-content-reply"></i> <?php echo esc_html__( 'Cancel', 'modula-gallery' ) ?>
|
| 344 |
+
</a>
|
| 345 |
+
<a href="#" data-action="save" class="action modal-action modal-close waves-effect waves-green btn-flat"><i class="fa fa-save"></i> <?php echo esc_html__( 'Save', 'modula-gallery' ) ?>
|
| 346 |
+
</a>
|
| 347 |
+
</div>
|
| 348 |
+
</div>
|
| 349 |
+
</div>
|
| 350 |
+
</div>
|
| 351 |
+
</li>
|
| 352 |
+
</ul>
|
| 353 |
+
</div>
|
| 354 |
+
</div>
|
| 355 |
|
| 356 |
<a id="edit-gallery" data-tooltip="Update gallery" data-position="top" data-delay="10" class="tooltipped btn-floating btn-large waves-effect waves-light green update-gallery">
|
| 357 |
+
<i class="icon icon-save-disk"> </i> </a>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 358 |
|
| 359 |
<div class="preloader-wrapper big active" id="spinner">
|
| 360 |
+
<div class="spinner-layer spinner-blue-only">
|
| 361 |
+
<div class="circle-clipper left">
|
| 362 |
+
<div class="circle"></div>
|
| 363 |
+
</div>
|
| 364 |
+
<div class="gap-patch">
|
| 365 |
+
<div class="circle"></div>
|
| 366 |
+
</div>
|
| 367 |
+
<div class="circle-clipper right">
|
| 368 |
+
<div class="circle"></div>
|
| 369 |
+
</div>
|
| 370 |
+
</div>
|
| 371 |
+
</div>
|
| 372 |
+
|
| 373 |
+
<div id="import-modal" class="modal">
|
| 374 |
+
<div class="modal-content">
|
| 375 |
+
<h3><?php echo esc_html__( 'Import Configuration', 'modula-gallery' ); ?></h3>
|
| 376 |
+
<p><?php echo esc_html__( 'Paste here the configuration code', 'modula-gallery' ); ?></p>
|
| 377 |
+
<textarea> </textarea>
|
| 378 |
+
|
| 379 |
+
</div>
|
| 380 |
+
<div class="modal-footer">
|
| 381 |
+
<a id="save" href="#!" class=" modal-action modal-close waves-effect waves-green btn-flat"><?php _e( 'Import', 'modula-gallery' ) ?></a>
|
| 382 |
+
|
| 383 |
+
<a href="#!" class=" modal-action modal-close waves-effect waves-green btn-flat"><?php _e( 'Close', 'modula-gallery' ) ?></a>
|
| 384 |
+
</div>
|
| 385 |
</div>
|
| 386 |
|
| 387 |
<div id="export-modal" class="modal">
|
| 388 |
+
<div class="modal-content">
|
| 389 |
+
<h3><?php echo esc_html__( 'Export Configuration', 'modula-gallery' ); ?></h3>
|
| 390 |
+
<p><?php echo esc_html__( 'Copy the configuration code', 'modula-gallery' ); ?></p>
|
| 391 |
+
<textarea readonly></textarea>
|
| 392 |
+
</div>
|
| 393 |
+
<div class="modal-footer">
|
| 394 |
+
<a href="#!" class=" modal-action modal-close waves-effect waves-green btn-flat"><?php _e( 'OK', 'modula-gallery' ) ?></a>
|
| 395 |
+
</div>
|
| 396 |
</div>
|
| 397 |
|
| 398 |
<script>
|
| 399 |
+
(function( $ ) {
|
| 400 |
+
TG.load_images();
|
| 401 |
+
TG.init_gallery();
|
| 402 |
+
})( jQuery );
|
| 403 |
+
</script>
|
admin/fix.php
CHANGED
|
@@ -1,112 +1,109 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if(preg_match('#' . basename(__FILE__) . '#', $_SERVER['PHP_SELF'])) {
|
| 3 |
-
|
| 4 |
-
|
| 5 |
-
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
{
|
| 13 |
-
$gid
|
| 14 |
-
$images = $this->ModulaDB->getImagesByGalleryId($gid);
|
| 15 |
-
if(count($images) > 0) {
|
| 16 |
-
$imageUrl = $images[0]->imagePath;
|
| 17 |
-
break;
|
| 18 |
-
}
|
| 19 |
-
}
|
| 20 |
-
$oldUrl = "<OLD URL>";
|
| 21 |
-
if(strpos($imageUrl, '/wp-content') > 0)
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
|
| 27 |
-
|
| 28 |
-
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
font-
|
| 32 |
-
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
|
| 37 |
-
#fix-panel pre {
|
| 38 |
-
background: #fff;
|
| 39 |
-
padding:10px;
|
| 40 |
-
}
|
| 41 |
-
</style>
|
| 42 |
-
<?php if(isset($_GET['fix']) && $_GET['fix'] == '1') : ?>
|
| 43 |
-
|
| 44 |
-
<?php
|
| 45 |
-
|
| 46 |
-
$lines = array();
|
| 47 |
-
foreach($this->ModulaDB->getGalleries() as $gallery)
|
| 48 |
-
|
| 49 |
-
$
|
| 50 |
-
$images
|
| 51 |
-
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
|
| 55 |
-
|
| 56 |
-
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
|
| 60 |
-
|
| 61 |
-
|
| 62 |
-
|
| 63 |
-
|
| 64 |
-
|
| 65 |
-
|
| 66 |
-
|
| 67 |
-
|
| 68 |
-
|
| 69 |
-
|
| 70 |
-
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
|
| 74 |
-
|
| 75 |
-
|
| 76 |
-
|
| 77 |
-
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
|
| 81 |
-
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
<div class="
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
|
| 88 |
-
|
| 89 |
-
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
|
| 97 |
-
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
|
| 101 |
-
|
| 102 |
-
|
| 103 |
-
|
| 104 |
-
|
| 105 |
-
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
|
| 109 |
-
</div>
|
| 110 |
-
</div>
|
| 111 |
-
</div>
|
| 112 |
<?php endif ?>
|
| 1 |
+
<?php
|
| 2 |
+
if ( preg_match( '#' . basename( __FILE__ ) . '#', $_SERVER['PHP_SELF'] ) ) {
|
| 3 |
+
die( _e( 'You are not allowed to call this page directly.', 'modula-gallery' ) );
|
| 4 |
+
}
|
| 5 |
+
|
| 6 |
+
$nobanner = true;
|
| 7 |
+
if ( empty( $tg_subtitle ) ) {
|
| 8 |
+
$tg_subtitle = "Fix images";
|
| 9 |
+
}
|
| 10 |
+
|
| 11 |
+
$imageUrl = null;
|
| 12 |
+
foreach ( $this->ModulaDB->getGalleries() as $gallery ) {
|
| 13 |
+
$gid = $gallery->Id;
|
| 14 |
+
$images = $this->ModulaDB->getImagesByGalleryId( $gid );
|
| 15 |
+
if ( count( $images ) > 0 ) {
|
| 16 |
+
$imageUrl = $images[0]->imagePath;
|
| 17 |
+
break;
|
| 18 |
+
}
|
| 19 |
+
}
|
| 20 |
+
$oldUrl = "<OLD URL>";
|
| 21 |
+
if ( strpos( $imageUrl, '/wp-content' ) > 0 ) {
|
| 22 |
+
$oldUrl = strtolower( substr( $imageUrl, 0, strpos( $imageUrl, '/wp-content' ) ) );
|
| 23 |
+
}
|
| 24 |
+
|
| 25 |
+
?>
|
| 26 |
+
|
| 27 |
+
<?php include( "header.php" ); ?>
|
| 28 |
+
<style>
|
| 29 |
+
#fix-panel h2 {
|
| 30 |
+
font-size: 18px;
|
| 31 |
+
font-weight: bold;
|
| 32 |
+
margin-bottom: 4px;
|
| 33 |
+
padding-bottom: 0;
|
| 34 |
+
line-height: 1;
|
| 35 |
+
}
|
| 36 |
+
|
| 37 |
+
#fix-panel pre {
|
| 38 |
+
background: #fff;
|
| 39 |
+
padding: 10px;
|
| 40 |
+
}
|
| 41 |
+
</style>
|
| 42 |
+
<?php if ( isset( $_GET['fix'] ) && $_GET['fix'] == '1' ) : ?>
|
| 43 |
+
|
| 44 |
+
<?php
|
| 45 |
+
|
| 46 |
+
$lines = array();
|
| 47 |
+
foreach ( $this->ModulaDB->getGalleries() as $gallery ) {
|
| 48 |
+
$gid = $gallery->Id;
|
| 49 |
+
$images = $this->ModulaDB->getImagesByGalleryId( $gid );
|
| 50 |
+
foreach ( $images as $image ) {
|
| 51 |
+
if ( strpos( strtolower( $image->imagePath ), $oldUrl ) === 0 ) {
|
| 52 |
+
$lines [] = $image->imagePath;
|
| 53 |
+
}
|
| 54 |
+
}
|
| 55 |
+
}
|
| 56 |
+
|
| 57 |
+
?>
|
| 58 |
+
<div class="row">
|
| 59 |
+
<div class="col">
|
| 60 |
+
<div class="card-panel lime lighten-4" id="fix-panel">
|
| 61 |
+
<?php echo count( $lines ) ?> <?php echo esc_html__( 'image to be processed:', 'modula-gallery' ); ?>
|
| 62 |
+
<pre><?php echo implode( "\n", $lines ) ?></pre>
|
| 63 |
+
|
| 64 |
+
<?php
|
| 65 |
+
$dir = wp_upload_dir();
|
| 66 |
+
file_put_contents( $dir['basedir'] . "/old-images.txt", implode( "\n", $lines ) );
|
| 67 |
+
|
| 68 |
+
$res = $wpdb->query( 'UPDATE ' . $wpdb->prefix . 'modula_images SET imagePath=REPLACE(imagePath, "' . $oldUrl . '", "' . site_url() . '")' );
|
| 69 |
+
add_option( 'Modula_skip_fix', true );
|
| 70 |
+
?>
|
| 71 |
+
|
| 72 |
+
<?php if ( $res > 0 ) : ?>
|
| 73 |
+
<h2><?php echo esc_html__( 'Fix completed successfully!', 'modula-gallery' ); ?></h2>
|
| 74 |
+
<?php else : ?>
|
| 75 |
+
<h2><?php echo esc_html__( 'No images where updated', 'modula-gallery' ); ?></h2>
|
| 76 |
+
<?php endif ?>
|
| 77 |
+
<a class="btn" href="?page=modula-lite-admin"><?php echo esc_html__( 'Go to dashboard', 'modula-gallery' ); ?></a>
|
| 78 |
+
</div>
|
| 79 |
+
</div>
|
| 80 |
+
</div>
|
| 81 |
+
<?php else : ?>
|
| 82 |
+
|
| 83 |
+
<div class="row">
|
| 84 |
+
<div class="col">
|
| 85 |
+
<div class="card-panel lime lighten-4" id="fix-panel">
|
| 86 |
+
<strong>FIX</strong>: version 1.1.0 introduced a new way to resize images, now you can choose a custom
|
| 87 |
+
image size for your galleries, regardless the sizes defined by your theme.<br> Although we thoroughly
|
| 88 |
+
tested the new feature, <strong>some website may encounter an issue where images don't appear
|
| 89 |
+
anymore</strong>.<br>
|
| 90 |
+
<h2>For tech savvy:</h2>
|
| 91 |
+
The cause is a wrong url inside the MySQL table <strong><?php echo $wpdb->prefix ?>
|
| 92 |
+
modula_images</strong><br> If you know how to do it, you can easily fix the wrong urls inside the
|
| 93 |
+
field <strong>imagePath</strong>. The query to use is:
|
| 94 |
+
<pre>UPDATE <?php echo $wpdb->prefix ?>modula_images REPLACE(imagePath, '<?php echo $oldUrl ?>
|
| 95 |
+
', '<?php echo site_url() ?>');</pre>
|
| 96 |
+
|
| 97 |
+
<?php if ( $oldUrl == "<OLD URL>" ) : ?>
|
| 98 |
+
where <old URL> is the previous URL of this site.
|
| 99 |
+
<?php endif ?>
|
| 100 |
+
<h2>For everyone:</h2>
|
| 101 |
+
If you have updated the plugin and you have run into this issue then you can use the <strong>Fix
|
| 102 |
+
tool</strong> by clicking the following button: <br> <br>
|
| 103 |
+
<a href="?page=modula-lite-gallery-fix&fix=1" class="btn">Fix image paths</a> <br> <strong>If you're
|
| 104 |
+
unsure about what to do then please contact
|
| 105 |
+
<a href="mailto:diego@greentreelabs.net?subject=Help with Modula fix tool">diego@greentreelabs.net</a></strong>.
|
| 106 |
+
</div>
|
| 107 |
+
</div>
|
| 108 |
+
</div>
|
|
|
|
|
|
|
|
|
|
| 109 |
<?php endif ?>
|
admin/header.php
CHANGED
|
@@ -1,12 +1,4 @@
|
|
| 1 |
<header id="top" class="modula-header" >
|
| 2 |
<h1 class="header center-on-small-only">Modula Lite</h1>
|
| 3 |
<h4 class="light text-lighten-4 center-on-small-only"><?php print $tg_subtitle ?></h4>
|
| 4 |
-
</header>
|
| 5 |
-
|
| 6 |
-
<?php if(! isset($nobanner)) : ?>
|
| 7 |
-
<a id="modula-survey" class="typeform-share button" href="https://greentreelabs.typeform.com/to/Ieyk9T" data-mode="1" target="_blank">
|
| 8 |
-
<img src="<?php print plugins_url('/images/survey.png',__file__) ?>" alt="Survey">
|
| 9 |
-
<span>I'd love a feedback from you! Please complete a short survey and get a <strong>10% discount</strong> for a Modula full license!</span>
|
| 10 |
-
</a>
|
| 11 |
-
<script>(function(){var qs,js,q,s,d=document,gi=d.getElementById,ce=d.createElement,gt=d.getElementsByTagName,id='typef_orm',b='https://s3-eu-west-1.amazonaws.com/share.typeform.com/';if(!gi.call(d,id)){js=ce.call(d,'script');js.id=id;js.src=b+'share.js';q=gt.call(d,'script')[0];q.parentNode.insertBefore(js,q)}id=id+'_';if(!gi.call(d,id)){qs=ce.call(d,'link');qs.rel='stylesheet';qs.id=id;qs.href=b+'share-button.css';s=gt.call(d,'head')[0];s.appendChild(qs,s)}})()</script>
|
| 12 |
-
<?php endif ?>
|
| 1 |
<header id="top" class="modula-header" >
|
| 2 |
<h1 class="header center-on-small-only">Modula Lite</h1>
|
| 3 |
<h4 class="light text-lighten-4 center-on-small-only"><?php print $tg_subtitle ?></h4>
|
| 4 |
+
</header>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
admin/images/material-design.gif
ADDED
|
Binary file
|
admin/images/modula-logo.jpg
ADDED
|
Binary file
|
admin/import.php
CHANGED
|
@@ -1,76 +1,81 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
if(preg_match('#' . basename(__FILE__) . '#', $_SERVER['PHP_SELF'])) {
|
| 3 |
-
|
| 4 |
-
|
| 5 |
-
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
|
| 13 |
-
|
| 14 |
-
<
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
<
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
<?php
|
| 27 |
-
|
| 28 |
-
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
<
|
| 37 |
-
|
| 38 |
-
<
|
| 39 |
-
|
| 40 |
-
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
|
| 46 |
-
|
| 47 |
-
|
| 48 |
-
|
| 49 |
-
|
| 50 |
-
|
| 51 |
-
<
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
|
| 55 |
-
|
| 56 |
-
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
|
| 60 |
-
|
| 61 |
-
|
| 62 |
-
|
| 63 |
-
<
|
| 64 |
-
|
| 65 |
-
|
| 66 |
-
|
| 67 |
-
|
| 68 |
-
|
| 69 |
-
|
| 70 |
-
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
|
| 74 |
-
|
| 75 |
-
|
| 76 |
-
</div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if ( preg_match( '#' . basename( __FILE__ ) . '#', $_SERVER['PHP_SELF'] ) ) {
|
| 3 |
+
die( _e( 'You are not allowed to call this page directly.', 'modula-gallery' ) );
|
| 4 |
+
}
|
| 5 |
+
|
| 6 |
+
if ( empty( $tg_subtitle ) ) {
|
| 7 |
+
$tg_subtitle = "Import galleries";
|
| 8 |
+
}
|
| 9 |
+
|
| 10 |
+
?>
|
| 11 |
+
<?php include( "header.php" ); ?>
|
| 12 |
+
|
| 13 |
+
<div id="modula-wizard">
|
| 14 |
+
<h2> <?php echo esc_html__( 'Import galleries', 'modula-gallery' ); ?> </h2>
|
| 15 |
+
<form action="#" method="post" onsubmit="return false;">
|
| 16 |
+
<?php wp_nonce_field( 'Modula', 'Modula' ); ?>
|
| 17 |
+
|
| 18 |
+
<fieldset data-step="1">
|
| 19 |
+
<div class="row">
|
| 20 |
+
<div class="input-field">
|
| 21 |
+
<p><?php echo esc_html__( 'Select an external source from which you want to import existing galleries', 'modula-gallery' ); ?></p>
|
| 22 |
+
<select class="import-source">
|
| 23 |
+
<option value=""><?php _e( 'Choose a source', 'modula-gallery' ) ?></option>
|
| 24 |
+
<?php if ( class_exists( "Envira_Gallery_Lite" ) || class_exists( "Envira_Gallery" ) ) : ?>
|
| 25 |
+
<option>Envira</option>
|
| 26 |
+
<?php endif ?>
|
| 27 |
+
<?php if ( class_exists( "nggGallery" ) ) : ?>
|
| 28 |
+
<option>NextGen</option>
|
| 29 |
+
<?php endif ?>
|
| 30 |
+
</select>
|
| 31 |
+
</div>
|
| 32 |
+
</div>
|
| 33 |
+
</fieldset>
|
| 34 |
+
<fieldset data-step="2" data-branch="galleries">
|
| 35 |
+
<div class="field">
|
| 36 |
+
<h5><?php echo esc_html__( 'List of galleries', 'modula-gallery' ) ?></h5>
|
| 37 |
+
<div id="external-galleries">
|
| 38 |
+
<ul></ul>
|
| 39 |
+
<button class="waves-effect button-bg green lighten-3 waves-light btn js-select-all"><?php echo esc_html__( 'Select all', 'modula-gallery' ); ?>
|
| 40 |
+
</button>
|
| 41 |
+
</div>
|
| 42 |
+
</div>
|
| 43 |
+
</fieldset>
|
| 44 |
+
<fieldset data-step="3" data-save="true">
|
| 45 |
+
<h5><?php echo esc_html__( 'You are going to import ', 'modula-gallery' ) ?>
|
| 46 |
+
<strong class="galleries-count"></strong> <?php echo esc_html__( 'galleries.', 'modula-gallery' ) ?>
|
| 47 |
+
</h5>
|
| 48 |
+
</fieldset>
|
| 49 |
+
|
| 50 |
+
<footer class="page-footer">
|
| 51 |
+
<div class="progress loading hide">
|
| 52 |
+
<div class="indeterminate"></div>
|
| 53 |
+
</div>
|
| 54 |
+
|
| 55 |
+
<a class="waves-effect waves-yellow btn-flat prev"><?php echo esc_html__( 'Previous', 'modula-gallery' ) ?></a>
|
| 56 |
+
<a class="waves-effect waves-green btn-flat next"><?php echo esc_html__( 'Next', 'modula-gallery' ) ?></a>
|
| 57 |
+
</footer>
|
| 58 |
+
|
| 59 |
+
</form>
|
| 60 |
+
<div id="success" class="modal">
|
| 61 |
+
<div class="modal-content">
|
| 62 |
+
<h4><?php echo esc_html__( 'Success!', 'modula-gallery' ) ?></h4>
|
| 63 |
+
<p><?php echo esc_html__( 'All selected galleries have been imported!', 'modula-gallery' ) ?></p>
|
| 64 |
+
<p> <?php printf( esc_html__( 'Go to the %s and copy the shortcode to paste inside your
|
| 65 |
+
pages and posts', 'medzone' ), '<a href="?page=ModulaLite-admin">' . esc_html__( 'dashboard page', 'modula-gallery' ) . '</a>' ); ?></p>
|
| 66 |
+
</div>
|
| 67 |
+
<div class="modal-'footer">
|
| 68 |
+
<a href="?page=modula-lite-admin" id="modal-close" class="waves-effect waves-green btn-flat modal-action"><?php echo esc_html__( 'Close', 'modula-gallery' ) ?></a>
|
| 69 |
+
</div>
|
| 70 |
+
</div>
|
| 71 |
+
|
| 72 |
+
<div id="error" class="modal">
|
| 73 |
+
<div class="modal-content">
|
| 74 |
+
<h4><?php echo esc_html__( 'Error!', 'modula-gallery' ) ?></h4>
|
| 75 |
+
<p><?php echo esc_html__( 'For some reason it was not possible to import one or more galleries', 'modula-gallery' ) ?></p>
|
| 76 |
+
</div>
|
| 77 |
+
<div class="modal-footer">
|
| 78 |
+
<a href="?page=modula-lite-admin" class="waves-effect waves-green btn-flat modal-action"><?php echo esc_html__( 'Close', 'modula-gallery' ) ?></a>
|
| 79 |
+
</div>
|
| 80 |
+
</div>
|
| 81 |
+
</div>
|
admin/overview.php
CHANGED
|
@@ -1,190 +1,177 @@
|
|
| 1 |
<?php
|
| 2 |
-
|
| 3 |
-
|
| 4 |
-
|
| 5 |
-
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
|
| 27 |
-
|
| 28 |
-
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
|
| 37 |
-
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
|
| 46 |
-
|
| 47 |
-
|
| 48 |
-
|
| 49 |
-
|
| 50 |
-
|
| 51 |
-
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
|
| 55 |
-
|
| 56 |
-
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
|
| 60 |
-
|
| 61 |
-
|
| 62 |
-
|
| 63 |
-
|
| 64 |
-
|
| 65 |
-
|
| 66 |
-
|
| 67 |
-
|
| 68 |
-
|
| 69 |
-
|
| 70 |
-
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
|
| 74 |
-
|
| 75 |
-
|
| 76 |
-
|
| 77 |
-
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
|
| 81 |
-
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
|
| 88 |
-
|
| 89 |
-
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
<div
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
|
| 97 |
-
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
|
| 101 |
-
|
| 102 |
-
|
| 103 |
-
|
| 104 |
-
|
| 105 |
-
<div
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
|
| 109 |
-
|
| 110 |
-
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
|
| 114 |
-
</div>
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
<
|
| 118 |
-
|
| 119 |
-
<div class="circle-clipper left">
|
| 120 |
-
<div class="circle"></div>
|
| 121 |
-
</div><div class="gap-patch">
|
| 122 |
-
<div class="circle"></div>
|
| 123 |
-
</div><div class="circle-clipper right">
|
| 124 |
-
<div class="circle"></div>
|
| 125 |
-
</div>
|
| 126 |
-
</div>
|
| 127 |
-
</div>
|
| 128 |
-
|
| 129 |
-
|
| 130 |
-
<script>
|
| 131 |
-
(function ($){
|
| 132 |
var galleryId;
|
| 133 |
var galleryName;
|
| 134 |
-
|
| 135 |
-
$(
|
| 136 |
-
|
| 137 |
-
|
| 138 |
-
});
|
| 139 |
-
|
| 140 |
-
$(
|
| 141 |
-
|
| 142 |
-
|
| 143 |
-
|
| 144 |
-
|
| 145 |
-
|
| 146 |
-
|
| 147 |
-
|
| 148 |
-
|
| 149 |
-
|
| 150 |
-
|
| 151 |
-
|
| 152 |
-
|
| 153 |
-
|
| 154 |
-
|
| 155 |
-
|
| 156 |
-
|
| 157 |
-
|
| 158 |
-
|
| 159 |
-
|
| 160 |
-
|
| 161 |
-
|
| 162 |
-
|
| 163 |
-
});
|
| 164 |
-
|
| 165 |
-
$(
|
| 166 |
-
|
| 167 |
-
|
| 168 |
-
|
| 169 |
-
|
| 170 |
-
|
| 171 |
-
|
| 172 |
-
|
| 173 |
-
|
| 174 |
-
|
| 175 |
-
|
| 176 |
-
|
| 177 |
-
|
| 178 |
-
|
| 179 |
-
|
| 180 |
-
|
| 181 |
-
|
| 182 |
-
|
| 183 |
-
|
| 184 |
-
|
| 185 |
-
|
| 186 |
-
|
| 187 |
-
|
| 188 |
-
});
|
| 189 |
-
|
| 190 |
-
</script>
|
| 1 |
<?php
|
| 2 |
+
if ( preg_match( '#' . basename( __FILE__ ) . '#', $_SERVER['PHP_SELF'] ) ) {
|
| 3 |
+
die( _e( 'You are not allowed to call this page directly.', 'modula-gallery' ) );
|
| 4 |
+
}
|
| 5 |
+
|
| 6 |
+
if ( empty( $tg_subtitle ) ) {
|
| 7 |
+
$tg_subtitle = "Dashboard";
|
| 8 |
+
}
|
| 9 |
+
|
| 10 |
+
$galleries = $this->ModulaDB->getGalleries();
|
| 11 |
+
|
| 12 |
+
$idx = 0;
|
| 13 |
+
?>
|
| 14 |
+
|
| 15 |
+
|
| 16 |
+
<?php include( "header.php" ); ?>
|
| 17 |
+
|
| 18 |
+
<div class="bd">
|
| 19 |
+
|
| 20 |
+
<?php if ( isset( $redir ) && $redir ) : ?>
|
| 21 |
+
<div class="row ">
|
| 22 |
+
<div class="col s12 m6 l4">
|
| 23 |
+
<div class="card-panel light-green lighten-4">
|
| 24 |
+
<h5 class="cyan-text text-darken-3"><?php echo esc_html__( 'Redirecting....', 'modula-gallery' ) ?></h5>
|
| 25 |
+
<p>
|
| 26 |
+
<?php echo esc_html__( 'Click a gallery to edit', 'modula-gallery' ) ?>. </p>
|
| 27 |
+
</div>
|
| 28 |
+
</div>
|
| 29 |
+
</div>
|
| 30 |
+
<script>location.href = '?page=modula-lite-admin';</script>
|
| 31 |
+
<?php endif ?>
|
| 32 |
+
|
| 33 |
+
<?php if ( count( $galleries ) == 0 ) : ?>
|
| 34 |
+
<div class="row ">
|
| 35 |
+
<div class="col s12 m6 l4">
|
| 36 |
+
<div class="card-panel light-green lighten-4">
|
| 37 |
+
<h5 class="cyan-text text-darken-3"><?php echo esc_html__( 'Welcome to Modula Gallery!', 'modula-gallery' ) ?></h5>
|
| 38 |
+
<p>
|
| 39 |
+
<?php echo esc_html__( 'Create your first awesome gallery, click', 'modula-gallery' ) ?>
|
| 40 |
+
<a href="?page=add-modula-lite"><?php echo esc_html__( 'here', 'modula-gallery' ) ?></a>. </p>
|
| 41 |
+
</div>
|
| 42 |
+
</div>
|
| 43 |
+
</div>
|
| 44 |
+
<?php else : ?>
|
| 45 |
+
|
| 46 |
+
<div id="gallery-list" class="row">
|
| 47 |
+
<?php foreach ( $galleries as $gallery ) : ?><?php
|
| 48 |
+
$gid = $gallery->Id;
|
| 49 |
+
$images = $this->ModulaDB->getImagesByGalleryId( $gid );
|
| 50 |
+
$bg = count( $images ) ? "url('" . $images[0]->imagePath . "')" : "none";
|
| 51 |
+
$gallery = json_decode( $gallery->configuration );
|
| 52 |
+
?><?php wp_nonce_field( 'Modula', 'Modula' ); ?>
|
| 53 |
+
<div class="col s12 m6 l4">
|
| 54 |
+
<div class="card <?php echo count( $images ) ? "with-image" : "" ?>" id="gallery-<?php echo esc_attr( $gid ); ?>" data-gid="<?php echo esc_attr( $gid ); ?>">
|
| 55 |
+
|
| 56 |
+
<div class="data" style="background-image:<?php echo esc_attr( $bg ); ?>">
|
| 57 |
+
<div class="card-content white-text">
|
| 58 |
+
<span class="card-title"><?php echo esc_html( $gallery->name ); ?></span> <br>
|
| 59 |
+
<?php if ( strlen( $gallery->description ) ) : ?>
|
| 60 |
+
<p><?php echo esc_html( $gallery->description ) ?></p>
|
| 61 |
+
<?php endif ?>
|
| 62 |
+
</div>
|
| 63 |
+
<div class="card-action darken-4">
|
| 64 |
+
<a href="#" data-tooltip="Show shortcode" data-position="top" data-delay="10" class="tooltipped waves-effect show-shortcode" data-gid="<?php echo esc_attr( $gid ); ?>"><i class="mdi mdi-code-array"></i></a>
|
| 65 |
+
<a href="?page=modula-lite-edit&galleryId=<?php echo absint( $gid ); ?>" data-tooltip="Edit gallery" data-position="top" data-delay="10" class="tooltipped
|
| 66 |
+
waves-effect waves"><i class="mdi mdi-pencil"></i></a>
|
| 67 |
+
<a data-tooltip="Clone gallery" data-position="top" data-delay="10" class="tooltipped waves-effect waves clone-gallery" data-gid="<?php echo esc_attr( $gid ); ?>"><i class="mdi mdi-content-copy"></i></a>
|
| 68 |
+
|
| 69 |
+
<a data-tooltip="Delete gallery" datacolor="red" data-position="top" data-delay="10" class="tooltipped waves-effect waves delete-gallery" data-gid="<?php echo esc_attr( $gid ); ?>"><i class="mdi mdi-delete"></i></a>
|
| 70 |
+
</div>
|
| 71 |
+
</div>
|
| 72 |
+
</div>
|
| 73 |
+
</div>
|
| 74 |
+
<?php endforeach ?>
|
| 75 |
+
</div>
|
| 76 |
+
<?php endif ?>
|
| 77 |
+
|
| 78 |
+
<!-- Delete gallery modal -->
|
| 79 |
+
<div id="delete-gallery-modal" class="modal">
|
| 80 |
+
<div class="modal-content">
|
| 81 |
+
<h4><?php echo esc_html__( 'Confirmation', 'modula-gallery' ) ?></h4>
|
| 82 |
+
<p><?php echo esc_html__( 'Do you really want to delete the gallery', 'modula-gallery' ) ?> <span></span> ?
|
| 83 |
+
</p>
|
| 84 |
+
</div>
|
| 85 |
+
<div class="modal-footer">
|
| 86 |
+
<a href="#!" class=" modal-action modal-close waves-effect waves-green btn-flat yes"><?php echo esc_html__( 'Yes', 'modula-gallery' ) ?></a>
|
| 87 |
+
<a href="#!" class=" modal-action modal-close waves-effect waves-green btn-flat"><?php echo esc_html__( 'No', 'modula-gallery' ) ?></a>
|
| 88 |
+
</div>
|
| 89 |
+
</div>
|
| 90 |
+
|
| 91 |
+
<!-- Shortcode gallery modal -->
|
| 92 |
+
<div id="shortcode-gallery-modal" class="modal">
|
| 93 |
+
<div class="modal-content">
|
| 94 |
+
<h4></h4>
|
| 95 |
+
<p><?php echo esc_html__( 'Copy and paste the following shortcode inside a post, page or widget:', 'modula-gallery' ) ?></p>
|
| 96 |
+
<code></code>
|
| 97 |
+
</div>
|
| 98 |
+
<div class="modal-footer">
|
| 99 |
+
<a href="#!" class=" modal-action modal-close waves-effect waves-green btn-flat"><?php echo esc_html__( 'Close', 'modula-gallery' ) ?></a>
|
| 100 |
+
</div>
|
| 101 |
+
</div>
|
| 102 |
+
|
| 103 |
+
<div class="preloader-wrapper big active" id="spinner">
|
| 104 |
+
<div class="spinner-layer spinner-blue-only">
|
| 105 |
+
<div class="circle-clipper left">
|
| 106 |
+
<div class="circle"></div>
|
| 107 |
+
</div>
|
| 108 |
+
<div class="gap-patch">
|
| 109 |
+
<div class="circle"></div>
|
| 110 |
+
</div>
|
| 111 |
+
<div class="circle-clipper right">
|
| 112 |
+
<div class="circle"></div>
|
| 113 |
+
</div>
|
| 114 |
+
</div>
|
| 115 |
+
</div>
|
| 116 |
+
|
| 117 |
+
<script>
|
| 118 |
+
(function( $ ) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 119 |
var galleryId;
|
| 120 |
var galleryName;
|
| 121 |
+
|
| 122 |
+
$( '.card .card-content' ).click( function() {
|
| 123 |
+
var id = $( this ).parents( '.card' ).data( 'gid' );
|
| 124 |
+
location.href = '?page=modula-lite-edit&galleryId=' + id;
|
| 125 |
+
} );
|
| 126 |
+
|
| 127 |
+
$( '.delete-gallery' ).click( function( e ) {
|
| 128 |
+
e.preventDefault();
|
| 129 |
+
galleryId = $( this ).data( 'gid' );
|
| 130 |
+
galleryName = $( this ).parents( '.data' ).find( '.card-title' ).text();
|
| 131 |
+
$( '#delete-gallery-modal span' ).text( galleryName );
|
| 132 |
+
$( '#delete-gallery-modal' ).modal();
|
| 133 |
+
$( '#delete-gallery-modal' ).modal( 'open' );
|
| 134 |
+
} );
|
| 135 |
+
|
| 136 |
+
$( '.clone-gallery' ).click( function( e ) {
|
| 137 |
+
e.preventDefault();
|
| 138 |
+
var id = $( this ).data( 'gid' );
|
| 139 |
+
var name = $( this ).parents( '.data' ).find( '.card-title' ).text();
|
| 140 |
+
|
| 141 |
+
var data = { 'action': 'modula_clone_gallery', 'gid': id, 'Modula': $( '#Modula' ).val() };
|
| 142 |
+
TG.show_loading();
|
| 143 |
+
jQuery.post( ajaxurl, data, function( response ) {
|
| 144 |
+
Materialize.toast( 'Gallery "' + name + '" cloned', 2000 );
|
| 145 |
+
location.reload();
|
| 146 |
+
TG.hide_loading();
|
| 147 |
+
|
| 148 |
+
} );
|
| 149 |
+
|
| 150 |
+
} );
|
| 151 |
+
|
| 152 |
+
$( '.show-shortcode' ).click( function( e ) {
|
| 153 |
+
e.preventDefault();
|
| 154 |
+
|
| 155 |
+
var id = $( this ).data( 'gid' );
|
| 156 |
+
var name = $( this ).parents( '.data' ).find( '.card-title' ).text();
|
| 157 |
+
$( '#shortcode-gallery-modal h4' ).text( name );
|
| 158 |
+
$( '#shortcode-gallery-modal code' ).text( '[Modula id=\'' + id + '\']' );
|
| 159 |
+
$( '#shortcode-gallery-modal' ).modal();
|
| 160 |
+
$( '#shortcode-gallery-modal' ).modal( 'open' );
|
| 161 |
+
} );
|
| 162 |
+
|
| 163 |
+
$( 'body' ).on( 'click', '#delete-gallery-modal .yes', function() {
|
| 164 |
+
|
| 165 |
+
var data = { 'action': 'modula_delete_gallery', 'gid': galleryId, 'Modula': $( '#Modula' ).val() };
|
| 166 |
+
TG.show_loading();
|
| 167 |
+
|
| 168 |
+
jQuery.post( ajaxurl, data, function( response ) {
|
| 169 |
+
Materialize.toast( 'Gallery "' + galleryName + '" deleted', 2000 );
|
| 170 |
+
$( '#gallery-' + galleryId ).remove();
|
| 171 |
+
TG.hide_loading();
|
| 172 |
+
location.reload();
|
| 173 |
+
} );
|
| 174 |
+
|
| 175 |
+
} );
|
| 176 |
+
})( jQuery );
|
| 177 |
+
</script>
|
admin/scripts/materialize.js
ADDED
|
@@ -0,0 +1,10021 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*!
|
| 2 |
+
* Materialize v0.100.2 (http://materializecss.com)
|
| 3 |
+
* Copyright 2014-2017 Materialize
|
| 4 |
+
* MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
|
| 5 |
+
*/
|
| 6 |
+
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
| 7 |
+
|
| 8 |
+
function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
|
| 9 |
+
|
| 10 |
+
// Check for jQuery.
|
| 11 |
+
if (typeof jQuery === 'undefined') {
|
| 12 |
+
// Check if require is a defined function.
|
| 13 |
+
if (typeof require === 'function') {
|
| 14 |
+
jQuery = $ = require('jquery');
|
| 15 |
+
// Else use the dollar sign alias.
|
| 16 |
+
} else {
|
| 17 |
+
jQuery = $;
|
| 18 |
+
}
|
| 19 |
+
}
|
| 20 |
+
; /*
|
| 21 |
+
* jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
|
| 22 |
+
* Open source under the BSD License.
|
| 23 |
+
* Copyright © 2008 George McGinley Smith
|
| 24 |
+
* All rights reserved.
|
| 25 |
+
* https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
|
| 26 |
+
*/
|
| 27 |
+
|
| 28 |
+
(function (factory) {
|
| 29 |
+
if (typeof define === "function" && define.amd) {
|
| 30 |
+
define(['jquery'], function ($) {
|
| 31 |
+
return factory($);
|
| 32 |
+
});
|
| 33 |
+
} else if (typeof module === "object" && typeof module.exports === "object") {
|
| 34 |
+
exports = factory(require('jquery'));
|
| 35 |
+
} else {
|
| 36 |
+
factory(jQuery);
|
| 37 |
+
}
|
| 38 |
+
})(function ($) {
|
| 39 |
+
|
| 40 |
+
// Preserve the original jQuery "swing" easing as "jswing"
|
| 41 |
+
$.easing['jswing'] = $.easing['swing'];
|
| 42 |
+
|
| 43 |
+
var pow = Math.pow,
|
| 44 |
+
sqrt = Math.sqrt,
|
| 45 |
+
sin = Math.sin,
|
| 46 |
+
cos = Math.cos,
|
| 47 |
+
PI = Math.PI,
|
| 48 |
+
c1 = 1.70158,
|
| 49 |
+
c2 = c1 * 1.525,
|
| 50 |
+
c3 = c1 + 1,
|
| 51 |
+
c4 = 2 * PI / 3,
|
| 52 |
+
c5 = 2 * PI / 4.5;
|
| 53 |
+
|
| 54 |
+
// x is the fraction of animation progress, in the range 0..1
|
| 55 |
+
function bounceOut(x) {
|
| 56 |
+
var n1 = 7.5625,
|
| 57 |
+
d1 = 2.75;
|
| 58 |
+
if (x < 1 / d1) {
|
| 59 |
+
return n1 * x * x;
|
| 60 |
+
} else if (x < 2 / d1) {
|
| 61 |
+
return n1 * (x -= 1.5 / d1) * x + .75;
|
| 62 |
+
} else if (x < 2.5 / d1) {
|
| 63 |
+
return n1 * (x -= 2.25 / d1) * x + .9375;
|
| 64 |
+
} else {
|
| 65 |
+
return n1 * (x -= 2.625 / d1) * x + .984375;
|
| 66 |
+
}
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
$.extend($.easing, {
|
| 70 |
+
def: 'easeOutQuad',
|
| 71 |
+
swing: function (x) {
|
| 72 |
+
return $.easing[$.easing.def](x);
|
| 73 |
+
},
|
| 74 |
+
easeInQuad: function (x) {
|
| 75 |
+
return x * x;
|
| 76 |
+
},
|
| 77 |
+
easeOutQuad: function (x) {
|
| 78 |
+
return 1 - (1 - x) * (1 - x);
|
| 79 |
+
},
|
| 80 |
+
easeInOutQuad: function (x) {
|
| 81 |
+
return x < 0.5 ? 2 * x * x : 1 - pow(-2 * x + 2, 2) / 2;
|
| 82 |
+
},
|
| 83 |
+
easeInCubic: function (x) {
|
| 84 |
+
return x * x * x;
|
| 85 |
+
},
|
| 86 |
+
easeOutCubic: function (x) {
|
| 87 |
+
return 1 - pow(1 - x, 3);
|
| 88 |
+
},
|
| 89 |
+
easeInOutCubic: function (x) {
|
| 90 |
+
return x < 0.5 ? 4 * x * x * x : 1 - pow(-2 * x + 2, 3) / 2;
|
| 91 |
+
},
|
| 92 |
+
easeInQuart: function (x) {
|
| 93 |
+
return x * x * x * x;
|
| 94 |
+
},
|
| 95 |
+
easeOutQuart: function (x) {
|
| 96 |
+
return 1 - pow(1 - x, 4);
|
| 97 |
+
},
|
| 98 |
+
easeInOutQuart: function (x) {
|
| 99 |
+
return x < 0.5 ? 8 * x * x * x * x : 1 - pow(-2 * x + 2, 4) / 2;
|
| 100 |
+
},
|
| 101 |
+
easeInQuint: function (x) {
|
| 102 |
+
return x * x * x * x * x;
|
| 103 |
+
},
|
| 104 |
+
easeOutQuint: function (x) {
|
| 105 |
+
return 1 - pow(1 - x, 5);
|
| 106 |
+
},
|
| 107 |
+
easeInOutQuint: function (x) {
|
| 108 |
+
return x < 0.5 ? 16 * x * x * x * x * x : 1 - pow(-2 * x + 2, 5) / 2;
|
| 109 |
+
},
|
| 110 |
+
easeInSine: function (x) {
|
| 111 |
+
return 1 - cos(x * PI / 2);
|
| 112 |
+
},
|
| 113 |
+
easeOutSine: function (x) {
|
| 114 |
+
return sin(x * PI / 2);
|
| 115 |
+
},
|
| 116 |
+
easeInOutSine: function (x) {
|
| 117 |
+
return -(cos(PI * x) - 1) / 2;
|
| 118 |
+
},
|
| 119 |
+
easeInExpo: function (x) {
|
| 120 |
+
return x === 0 ? 0 : pow(2, 10 * x - 10);
|
| 121 |
+
},
|
| 122 |
+
easeOutExpo: function (x) {
|
| 123 |
+
return x === 1 ? 1 : 1 - pow(2, -10 * x);
|
| 124 |
+
},
|
| 125 |
+
easeInOutExpo: function (x) {
|
| 126 |
+
return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? pow(2, 20 * x - 10) / 2 : (2 - pow(2, -20 * x + 10)) / 2;
|
| 127 |
+
},
|
| 128 |
+
easeInCirc: function (x) {
|
| 129 |
+
return 1 - sqrt(1 - pow(x, 2));
|
| 130 |
+
},
|
| 131 |
+
easeOutCirc: function (x) {
|
| 132 |
+
return sqrt(1 - pow(x - 1, 2));
|
| 133 |
+
},
|
| 134 |
+
easeInOutCirc: function (x) {
|
| 135 |
+
return x < 0.5 ? (1 - sqrt(1 - pow(2 * x, 2))) / 2 : (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2;
|
| 136 |
+
},
|
| 137 |
+
easeInElastic: function (x) {
|
| 138 |
+
return x === 0 ? 0 : x === 1 ? 1 : -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4);
|
| 139 |
+
},
|
| 140 |
+
easeOutElastic: function (x) {
|
| 141 |
+
return x === 0 ? 0 : x === 1 ? 1 : pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1;
|
| 142 |
+
},
|
| 143 |
+
easeInOutElastic: function (x) {
|
| 144 |
+
return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 : pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1;
|
| 145 |
+
},
|
| 146 |
+
easeInBack: function (x) {
|
| 147 |
+
return c3 * x * x * x - c1 * x * x;
|
| 148 |
+
},
|
| 149 |
+
easeOutBack: function (x) {
|
| 150 |
+
return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2);
|
| 151 |
+
},
|
| 152 |
+
easeInOutBack: function (x) {
|
| 153 |
+
return x < 0.5 ? pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2) / 2 : (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2;
|
| 154 |
+
},
|
| 155 |
+
easeInBounce: function (x) {
|
| 156 |
+
return 1 - bounceOut(1 - x);
|
| 157 |
+
},
|
| 158 |
+
easeOutBounce: bounceOut,
|
| 159 |
+
easeInOutBounce: function (x) {
|
| 160 |
+
return x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2;
|
| 161 |
+
}
|
| 162 |
+
});
|
| 163 |
+
});; // Custom Easing
|
| 164 |
+
jQuery.extend(jQuery.easing, {
|
| 165 |
+
easeInOutMaterial: function (x, t, b, c, d) {
|
| 166 |
+
if ((t /= d / 2) < 1) return c / 2 * t * t + b;
|
| 167 |
+
return c / 4 * ((t -= 2) * t * t + 2) + b;
|
| 168 |
+
}
|
| 169 |
+
});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */
|
| 170 |
+
/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */
|
| 171 |
+
/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */
|
| 172 |
+
jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (!function (e) {
|
| 173 |
+
function t(e) {
|
| 174 |
+
var t = e.length,
|
| 175 |
+
a = r.type(e);return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e;
|
| 176 |
+
}if (!e.jQuery) {
|
| 177 |
+
var r = function (e, t) {
|
| 178 |
+
return new r.fn.init(e, t);
|
| 179 |
+
};r.isWindow = function (e) {
|
| 180 |
+
return null != e && e == e.window;
|
| 181 |
+
}, r.type = function (e) {
|
| 182 |
+
return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e;
|
| 183 |
+
}, r.isArray = Array.isArray || function (e) {
|
| 184 |
+
return "array" === r.type(e);
|
| 185 |
+
}, r.isPlainObject = function (e) {
|
| 186 |
+
var t;if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;try {
|
| 187 |
+
if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1;
|
| 188 |
+
} catch (a) {
|
| 189 |
+
return !1;
|
| 190 |
+
}for (t in e) {}return void 0 === t || o.call(e, t);
|
| 191 |
+
}, r.each = function (e, r, a) {
|
| 192 |
+
var n,
|
| 193 |
+
o = 0,
|
| 194 |
+
i = e.length,
|
| 195 |
+
s = t(e);if (a) {
|
| 196 |
+
if (s) for (; i > o && (n = r.apply(e[o], a), n !== !1); o++) {} else for (o in e) {
|
| 197 |
+
if (n = r.apply(e[o], a), n === !1) break;
|
| 198 |
+
}
|
| 199 |
+
} else if (s) for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++) {} else for (o in e) {
|
| 200 |
+
if (n = r.call(e[o], o, e[o]), n === !1) break;
|
| 201 |
+
}return e;
|
| 202 |
+
}, r.data = function (e, t, n) {
|
| 203 |
+
if (void 0 === n) {
|
| 204 |
+
var o = e[r.expando],
|
| 205 |
+
i = o && a[o];if (void 0 === t) return i;if (i && t in i) return i[t];
|
| 206 |
+
} else if (void 0 !== t) {
|
| 207 |
+
var o = e[r.expando] || (e[r.expando] = ++r.uuid);return a[o] = a[o] || {}, a[o][t] = n, n;
|
| 208 |
+
}
|
| 209 |
+
}, r.removeData = function (e, t) {
|
| 210 |
+
var n = e[r.expando],
|
| 211 |
+
o = n && a[n];o && r.each(t, function (e, t) {
|
| 212 |
+
delete o[t];
|
| 213 |
+
});
|
| 214 |
+
}, r.extend = function () {
|
| 215 |
+
var e,
|
| 216 |
+
t,
|
| 217 |
+
a,
|
| 218 |
+
n,
|
| 219 |
+
o,
|
| 220 |
+
i,
|
| 221 |
+
s = arguments[0] || {},
|
| 222 |
+
l = 1,
|
| 223 |
+
u = arguments.length,
|
| 224 |
+
c = !1;for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++) {
|
| 225 |
+
if (null != (o = arguments[l])) for (n in o) {
|
| 226 |
+
e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a));
|
| 227 |
+
}
|
| 228 |
+
}return s;
|
| 229 |
+
}, r.queue = function (e, a, n) {
|
| 230 |
+
function o(e, r) {
|
| 231 |
+
var a = r || [];return null != e && (t(Object(e)) ? !function (e, t) {
|
| 232 |
+
for (var r = +t.length, a = 0, n = e.length; r > a;) {
|
| 233 |
+
e[n++] = t[a++];
|
| 234 |
+
}if (r !== r) for (; void 0 !== t[a];) {
|
| 235 |
+
e[n++] = t[a++];
|
| 236 |
+
}return e.length = n, e;
|
| 237 |
+
}(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a;
|
| 238 |
+
}if (e) {
|
| 239 |
+
a = (a || "fx") + "queue";var i = r.data(e, a);return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || [];
|
| 240 |
+
}
|
| 241 |
+
}, r.dequeue = function (e, t) {
|
| 242 |
+
r.each(e.nodeType ? [e] : e, function (e, a) {
|
| 243 |
+
t = t || "fx";var n = r.queue(a, t),
|
| 244 |
+
o = n.shift();"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () {
|
| 245 |
+
r.dequeue(a, t);
|
| 246 |
+
}));
|
| 247 |
+
});
|
| 248 |
+
}, r.fn = r.prototype = { init: function (e) {
|
| 249 |
+
if (e.nodeType) return this[0] = e, this;throw new Error("Not a DOM node.");
|
| 250 |
+
}, offset: function () {
|
| 251 |
+
var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : { top: 0, left: 0 };return { top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0), left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0) };
|
| 252 |
+
}, position: function () {
|
| 253 |
+
function e() {
|
| 254 |
+
for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) {
|
| 255 |
+
e = e.offsetParent;
|
| 256 |
+
}return e || document;
|
| 257 |
+
}var t = this[0],
|
| 258 |
+
e = e.apply(t),
|
| 259 |
+
a = this.offset(),
|
| 260 |
+
n = /^(?:body|html)$/i.test(e.nodeName) ? { top: 0, left: 0 } : r(e).offset();return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), { top: a.top - n.top, left: a.left - n.left };
|
| 261 |
+
} };var a = {};r.expando = "velocity" + new Date().getTime(), r.uuid = 0;for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) {
|
| 262 |
+
n["[object " + s[l] + "]"] = s[l].toLowerCase();
|
| 263 |
+
}r.fn.init.prototype = r.fn, e.Velocity = { Utilities: r };
|
| 264 |
+
}
|
| 265 |
+
}(window), function (e) {
|
| 266 |
+
"object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e();
|
| 267 |
+
}(function () {
|
| 268 |
+
return function (e, t, r, a) {
|
| 269 |
+
function n(e) {
|
| 270 |
+
for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) {
|
| 271 |
+
var n = e[t];n && a.push(n);
|
| 272 |
+
}return a;
|
| 273 |
+
}function o(e) {
|
| 274 |
+
return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e;
|
| 275 |
+
}function i(e) {
|
| 276 |
+
var t = f.data(e, "velocity");return null === t ? a : t;
|
| 277 |
+
}function s(e) {
|
| 278 |
+
return function (t) {
|
| 279 |
+
return Math.round(t * e) * (1 / e);
|
| 280 |
+
};
|
| 281 |
+
}function l(e, r, a, n) {
|
| 282 |
+
function o(e, t) {
|
| 283 |
+
return 1 - 3 * t + 3 * e;
|
| 284 |
+
}function i(e, t) {
|
| 285 |
+
return 3 * t - 6 * e;
|
| 286 |
+
}function s(e) {
|
| 287 |
+
return 3 * e;
|
| 288 |
+
}function l(e, t, r) {
|
| 289 |
+
return ((o(t, r) * e + i(t, r)) * e + s(t)) * e;
|
| 290 |
+
}function u(e, t, r) {
|
| 291 |
+
return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t);
|
| 292 |
+
}function c(t, r) {
|
| 293 |
+
for (var n = 0; m > n; ++n) {
|
| 294 |
+
var o = u(r, e, a);if (0 === o) return r;var i = l(r, e, a) - t;r -= i / o;
|
| 295 |
+
}return r;
|
| 296 |
+
}function p() {
|
| 297 |
+
for (var t = 0; b > t; ++t) {
|
| 298 |
+
w[t] = l(t * x, e, a);
|
| 299 |
+
}
|
| 300 |
+
}function f(t, r, n) {
|
| 301 |
+
var o,
|
| 302 |
+
i,
|
| 303 |
+
s = 0;do {
|
| 304 |
+
i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i;
|
| 305 |
+
} while (Math.abs(o) > h && ++s < v);return i;
|
| 306 |
+
}function d(t) {
|
| 307 |
+
for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) {
|
| 308 |
+
r += x;
|
| 309 |
+
}--n;var i = (t - w[n]) / (w[n + 1] - w[n]),
|
| 310 |
+
s = r + i * x,
|
| 311 |
+
l = u(s, e, a);return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x);
|
| 312 |
+
}function g() {
|
| 313 |
+
V = !0, (e != r || a != n) && p();
|
| 314 |
+
}var m = 4,
|
| 315 |
+
y = .001,
|
| 316 |
+
h = 1e-7,
|
| 317 |
+
v = 10,
|
| 318 |
+
b = 11,
|
| 319 |
+
x = 1 / (b - 1),
|
| 320 |
+
S = "Float32Array" in t;if (4 !== arguments.length) return !1;for (var P = 0; 4 > P; ++P) {
|
| 321 |
+
if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1;
|
| 322 |
+
}e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);var w = S ? new Float32Array(b) : new Array(b),
|
| 323 |
+
V = !1,
|
| 324 |
+
C = function (t) {
|
| 325 |
+
return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n);
|
| 326 |
+
};C.getControlPoints = function () {
|
| 327 |
+
return [{ x: e, y: r }, { x: a, y: n }];
|
| 328 |
+
};var T = "generateBezier(" + [e, r, a, n] + ")";return C.toString = function () {
|
| 329 |
+
return T;
|
| 330 |
+
}, C;
|
| 331 |
+
}function u(e, t) {
|
| 332 |
+
var r = e;return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r;
|
| 333 |
+
}function c(e) {
|
| 334 |
+
if (e) {
|
| 335 |
+
var t = new Date().getTime(),
|
| 336 |
+
r = b.State.calls.length;r > 1e4 && (b.State.calls = n(b.State.calls));for (var o = 0; r > o; o++) {
|
| 337 |
+
if (b.State.calls[o]) {
|
| 338 |
+
var s = b.State.calls[o],
|
| 339 |
+
l = s[0],
|
| 340 |
+
u = s[2],
|
| 341 |
+
d = s[3],
|
| 342 |
+
g = !!d,
|
| 343 |
+
y = null;d || (d = b.State.calls[o][3] = t - 16);for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) {
|
| 344 |
+
var P = l[v],
|
| 345 |
+
V = P.element;if (i(V)) {
|
| 346 |
+
var C = !1;if (u.display !== a && null !== u.display && "none" !== u.display) {
|
| 347 |
+
if ("flex" === u.display) {
|
| 348 |
+
var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];f.each(T, function (e, t) {
|
| 349 |
+
S.setPropertyValue(V, "display", t);
|
| 350 |
+
});
|
| 351 |
+
}S.setPropertyValue(V, "display", u.display);
|
| 352 |
+
}u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);for (var k in P) {
|
| 353 |
+
if ("element" !== k) {
|
| 354 |
+
var A,
|
| 355 |
+
F = P[k],
|
| 356 |
+
j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;if (1 === h) A = F.endValue;else {
|
| 357 |
+
var E = F.endValue - F.startValue;if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue;
|
| 358 |
+
}if (F.currentValue = A, "tween" === k) y = A;else {
|
| 359 |
+
if (S.Hooks.registered[k]) {
|
| 360 |
+
var H = S.Hooks.getRoot(k),
|
| 361 |
+
N = i(V).rootPropertyValueCache[H];N && (F.rootPropertyValue = N);
|
| 362 |
+
}var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0);
|
| 363 |
+
}
|
| 364 |
+
}
|
| 365 |
+
}u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V);
|
| 366 |
+
}
|
| 367 |
+
}u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o);
|
| 368 |
+
}
|
| 369 |
+
}
|
| 370 |
+
}b.State.isTicking && w(c);
|
| 371 |
+
}function p(e, t) {
|
| 372 |
+
if (!b.State.calls[e]) return !1;for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) {
|
| 373 |
+
var p = r[u].element;if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) {
|
| 374 |
+
i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};var d = !1;f.each(S.Lists.transforms3D, function (e, t) {
|
| 375 |
+
var r = /^scale/.test(t) ? 1 : 0,
|
| 376 |
+
n = i(p).transformCache[t];i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t]);
|
| 377 |
+
}), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating");
|
| 378 |
+
}if (!t && o.complete && !o.loop && u === c - 1) try {
|
| 379 |
+
o.complete.call(n, n);
|
| 380 |
+
} catch (g) {
|
| 381 |
+
setTimeout(function () {
|
| 382 |
+
throw g;
|
| 383 |
+
}, 1);
|
| 384 |
+
}s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) {
|
| 385 |
+
/^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100);
|
| 386 |
+
}), b(p, "reverse", { loop: !0, delay: o.delay })), o.queue !== !1 && f.dequeue(p, o.queue);
|
| 387 |
+
}b.State.calls[e] = !1;for (var m = 0, y = b.State.calls.length; y > m; m++) {
|
| 388 |
+
if (b.State.calls[m] !== !1) {
|
| 389 |
+
l = !0;break;
|
| 390 |
+
}
|
| 391 |
+
}l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = []);
|
| 392 |
+
}var f,
|
| 393 |
+
d = function () {
|
| 394 |
+
if (r.documentMode) return r.documentMode;for (var e = 7; e > 4; e--) {
|
| 395 |
+
var t = r.createElement("div");if (t.innerHTML = "<!--[if IE " + e + "]><span></span><![endif]-->", t.getElementsByTagName("span").length) return t = null, e;
|
| 396 |
+
}return a;
|
| 397 |
+
}(),
|
| 398 |
+
g = function () {
|
| 399 |
+
var e = 0;return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) {
|
| 400 |
+
var r,
|
| 401 |
+
a = new Date().getTime();return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () {
|
| 402 |
+
t(a + r);
|
| 403 |
+
}, r);
|
| 404 |
+
};
|
| 405 |
+
}(),
|
| 406 |
+
m = { isString: function (e) {
|
| 407 |
+
return "string" == typeof e;
|
| 408 |
+
}, isArray: Array.isArray || function (e) {
|
| 409 |
+
return "[object Array]" === Object.prototype.toString.call(e);
|
| 410 |
+
}, isFunction: function (e) {
|
| 411 |
+
return "[object Function]" === Object.prototype.toString.call(e);
|
| 412 |
+
}, isNode: function (e) {
|
| 413 |
+
return e && e.nodeType;
|
| 414 |
+
}, isNodeList: function (e) {
|
| 415 |
+
return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0);
|
| 416 |
+
}, isWrapped: function (e) {
|
| 417 |
+
return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e));
|
| 418 |
+
}, isSVG: function (e) {
|
| 419 |
+
return t.SVGElement && e instanceof t.SVGElement;
|
| 420 |
+
}, isEmptyObject: function (e) {
|
| 421 |
+
for (var t in e) {
|
| 422 |
+
return !1;
|
| 423 |
+
}return !0;
|
| 424 |
+
} },
|
| 425 |
+
y = !1;if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if (7 >= d) return void (jQuery.fn.velocity = jQuery.fn.animate);var h = 400,
|
| 426 |
+
v = "swing",
|
| 427 |
+
b = { State: { isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent), isAndroid: /Android/i.test(navigator.userAgent), isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent), isChrome: t.chrome, isFirefox: /Firefox/i.test(navigator.userAgent), prefixElement: r.createElement("div"), prefixMatches: {}, scrollAnchor: null, scrollPropertyLeft: null, scrollPropertyTop: null, isTicking: !1, calls: [] }, CSS: {}, Utilities: f, Redirects: {}, Easings: {}, Promise: t.Promise, defaults: { queue: "", duration: h, easing: v, begin: a, complete: a, progress: a, display: a, visibility: a, loop: !1, delay: !1, mobileHA: !0, _cacheValues: !0 }, init: function (e) {
|
| 428 |
+
f.data(e, "velocity", { isSVG: m.isSVG(e), isAnimating: !1, computedStyle: null, tweensContainer: null, rootPropertyValueCache: {}, transformCache: {} });
|
| 429 |
+
}, hook: null, mock: !1, version: { major: 1, minor: 2, patch: 2 }, debug: !1 };t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");var x = function () {
|
| 430 |
+
function e(e) {
|
| 431 |
+
return -e.tension * e.x - e.friction * e.v;
|
| 432 |
+
}function t(t, r, a) {
|
| 433 |
+
var n = { x: t.x + a.dx * r, v: t.v + a.dv * r, tension: t.tension, friction: t.friction };return { dx: n.v, dv: e(n) };
|
| 434 |
+
}function r(r, a) {
|
| 435 |
+
var n = { dx: r.v, dv: e(r) },
|
| 436 |
+
o = t(r, .5 * a, n),
|
| 437 |
+
i = t(r, .5 * a, o),
|
| 438 |
+
s = t(r, a, i),
|
| 439 |
+
l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx),
|
| 440 |
+
u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);return r.x = r.x + l * a, r.v = r.v + u * a, r;
|
| 441 |
+
}return function a(e, t, n) {
|
| 442 |
+
var o,
|
| 443 |
+
i,
|
| 444 |
+
s,
|
| 445 |
+
l = { x: -1, v: 0, tension: null, friction: null },
|
| 446 |
+
u = [0],
|
| 447 |
+
c = 0,
|
| 448 |
+
p = 1e-4,
|
| 449 |
+
f = .016;for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;) {}return o ? function (e) {
|
| 450 |
+
return u[e * (u.length - 1) | 0];
|
| 451 |
+
} : c;
|
| 452 |
+
};
|
| 453 |
+
}();b.Easings = { linear: function (e) {
|
| 454 |
+
return e;
|
| 455 |
+
}, swing: function (e) {
|
| 456 |
+
return .5 - Math.cos(e * Math.PI) / 2;
|
| 457 |
+
}, spring: function (e) {
|
| 458 |
+
return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e);
|
| 459 |
+
} }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) {
|
| 460 |
+
b.Easings[t[0]] = l.apply(null, t[1]);
|
| 461 |
+
});var S = b.CSS = { RegEx: { isHex: /^#([A-f\d]{3}){1,2}$/i, valueUnwrap: /^[A-z]+\((.*)\)$/i, wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/, valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi }, Lists: { colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"], transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"], transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"] }, Hooks: { templates: { textShadow: ["Color X Y Blur", "black 0px 0px 0px"], boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"], clip: ["Top Right Bottom Left", "0px 0px 0px 0px"], backgroundPosition: ["X Y", "0% 0%"], transformOrigin: ["X Y Z", "50% 50% 0px"], perspectiveOrigin: ["X Y", "50% 50%"] }, registered: {}, register: function () {
|
| 462 |
+
for (var e = 0; e < S.Lists.colors.length; e++) {
|
| 463 |
+
var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t];
|
| 464 |
+
}var r, a, n;if (d) for (r in S.Hooks.templates) {
|
| 465 |
+
a = S.Hooks.templates[r], n = a[0].split(" ");var o = a[1].match(S.RegEx.valueSplit);"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")]);
|
| 466 |
+
}for (r in S.Hooks.templates) {
|
| 467 |
+
a = S.Hooks.templates[r], n = a[0].split(" ");for (var e in n) {
|
| 468 |
+
var i = r + n[e],
|
| 469 |
+
s = e;S.Hooks.registered[i] = [r, s];
|
| 470 |
+
}
|
| 471 |
+
}
|
| 472 |
+
}, getRoot: function (e) {
|
| 473 |
+
var t = S.Hooks.registered[e];return t ? t[0] : e;
|
| 474 |
+
}, cleanRootPropertyValue: function (e, t) {
|
| 475 |
+
return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t;
|
| 476 |
+
}, extractValue: function (e, t) {
|
| 477 |
+
var r = S.Hooks.registered[e];if (r) {
|
| 478 |
+
var a = r[0],
|
| 479 |
+
n = r[1];return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n];
|
| 480 |
+
}return t;
|
| 481 |
+
}, injectValue: function (e, t, r) {
|
| 482 |
+
var a = S.Hooks.registered[e];if (a) {
|
| 483 |
+
var n,
|
| 484 |
+
o,
|
| 485 |
+
i = a[0],
|
| 486 |
+
s = a[1];return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" ");
|
| 487 |
+
}return r;
|
| 488 |
+
} }, Normalizations: { registered: { clip: function (e, t, r) {
|
| 489 |
+
switch (e) {case "name":
|
| 490 |
+
return "clip";case "extract":
|
| 491 |
+
var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;case "inject":
|
| 492 |
+
return "rect(" + r + ")";}
|
| 493 |
+
}, blur: function (e, t, r) {
|
| 494 |
+
switch (e) {case "name":
|
| 495 |
+
return b.State.isFirefox ? "filter" : "-webkit-filter";case "extract":
|
| 496 |
+
var a = parseFloat(r);if (!a && 0 !== a) {
|
| 497 |
+
var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a = n ? n[1] : 0;
|
| 498 |
+
}return a;case "inject":
|
| 499 |
+
return parseFloat(r) ? "blur(" + r + ")" : "none";}
|
| 500 |
+
}, opacity: function (e, t, r) {
|
| 501 |
+
if (8 >= d) switch (e) {case "name":
|
| 502 |
+
return "filter";case "extract":
|
| 503 |
+
var a = r.toString().match(/alpha\(opacity=(.*)\)/i);return r = a ? a[1] / 100 : 1;case "inject":
|
| 504 |
+
return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")";} else switch (e) {case "name":
|
| 505 |
+
return "opacity";case "extract":
|
| 506 |
+
return r;case "inject":
|
| 507 |
+
return r;}
|
| 508 |
+
} }, register: function () {
|
| 509 |
+
9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));for (var e = 0; e < S.Lists.transformsBase.length; e++) {
|
| 510 |
+
!function () {
|
| 511 |
+
var t = S.Lists.transformsBase[e];S.Normalizations.registered[t] = function (e, r, n) {
|
| 512 |
+
switch (e) {case "name":
|
| 513 |
+
return "transform";case "extract":
|
| 514 |
+
return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");case "inject":
|
| 515 |
+
var o = !1;switch (t.substr(0, t.length - 1)) {case "translate":
|
| 516 |
+
o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case "scal":case "scale":
|
| 517 |
+
b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);break;case "skew":
|
| 518 |
+
o = !/(deg|\d)$/i.test(n);break;case "rotate":
|
| 519 |
+
o = !/(deg|\d)$/i.test(n);}return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t];}
|
| 520 |
+
};
|
| 521 |
+
}();
|
| 522 |
+
}for (var e = 0; e < S.Lists.colors.length; e++) {
|
| 523 |
+
!function () {
|
| 524 |
+
var t = S.Lists.colors[e];S.Normalizations.registered[t] = function (e, r, n) {
|
| 525 |
+
switch (e) {case "name":
|
| 526 |
+
return t;case "extract":
|
| 527 |
+
var o;if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;else {
|
| 528 |
+
var i,
|
| 529 |
+
s = { black: "rgb(0, 0, 0)", blue: "rgb(0, 0, 255)", gray: "rgb(128, 128, 128)", green: "rgb(0, 128, 0)", red: "rgb(255, 0, 0)", white: "rgb(255, 255, 255)" };/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " ");
|
| 530 |
+
}return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;case "inject":
|
| 531 |
+
return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")";}
|
| 532 |
+
};
|
| 533 |
+
}();
|
| 534 |
+
}
|
| 535 |
+
} }, Names: { camelCase: function (e) {
|
| 536 |
+
return e.replace(/-(\w)/g, function (e, t) {
|
| 537 |
+
return t.toUpperCase();
|
| 538 |
+
});
|
| 539 |
+
}, SVGAttribute: function (e) {
|
| 540 |
+
var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e);
|
| 541 |
+
}, prefixCheck: function (e) {
|
| 542 |
+
if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) {
|
| 543 |
+
var n;if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) {
|
| 544 |
+
return e.toUpperCase();
|
| 545 |
+
}), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0];
|
| 546 |
+
}return [e, !1];
|
| 547 |
+
} }, Values: { hexToRgb: function (e) {
|
| 548 |
+
var t,
|
| 549 |
+
r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i,
|
| 550 |
+
a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e = e.replace(r, function (e, t, r, a) {
|
| 551 |
+
return t + t + r + r + a + a;
|
| 552 |
+
}), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0];
|
| 553 |
+
}, isCSSNullValue: function (e) {
|
| 554 |
+
return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e);
|
| 555 |
+
}, getUnitType: function (e) {
|
| 556 |
+
return (/^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px"
|
| 557 |
+
);
|
| 558 |
+
}, getDisplayType: function (e) {
|
| 559 |
+
var t = e && e.tagName.toString().toLowerCase();return (/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block"
|
| 560 |
+
);
|
| 561 |
+
}, addClass: function (e, t) {
|
| 562 |
+
e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t;
|
| 563 |
+
}, removeClass: function (e, t) {
|
| 564 |
+
e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " ");
|
| 565 |
+
} }, getPropertyValue: function (e, r, n, o) {
|
| 566 |
+
function s(e, r) {
|
| 567 |
+
function n() {
|
| 568 |
+
u && S.setPropertyValue(e, "display", "none");
|
| 569 |
+
}var l = 0;if (8 >= d) l = f.css(e, r);else {
|
| 570 |
+
var u = !1;if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) {
|
| 571 |
+
if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
|
| 572 |
+
var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);return n(), c;
|
| 573 |
+
}if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
|
| 574 |
+
var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);return n(), p;
|
| 575 |
+
}
|
| 576 |
+
}var g;g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n();
|
| 577 |
+
}if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) {
|
| 578 |
+
var m = s(e, "position");("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px");
|
| 579 |
+
}return l;
|
| 580 |
+
}var l;if (S.Hooks.registered[r]) {
|
| 581 |
+
var u = r,
|
| 582 |
+
c = S.Hooks.getRoot(u);n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n);
|
| 583 |
+
} else if (S.Normalizations.registered[r]) {
|
| 584 |
+
var p, g;p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g);
|
| 585 |
+
}if (!/^[\d-]/.test(l)) if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r)) {
|
| 586 |
+
if (/^(height|width)$/i.test(r)) try {
|
| 587 |
+
l = e.getBBox()[r];
|
| 588 |
+
} catch (m) {
|
| 589 |
+
l = 0;
|
| 590 |
+
} else l = e.getAttribute(r);
|
| 591 |
+
} else l = s(e, S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l;
|
| 592 |
+
}, setPropertyValue: function (e, r, a, n, o) {
|
| 593 |
+
var s = r;if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];else {
|
| 594 |
+
if (S.Hooks.registered[r]) {
|
| 595 |
+
var l = r,
|
| 596 |
+
u = S.Hooks.getRoot(r);n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u;
|
| 597 |
+
}if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try {
|
| 598 |
+
e.style[s] = a;
|
| 599 |
+
} catch (c) {
|
| 600 |
+
b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]");
|
| 601 |
+
} else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a);
|
| 602 |
+
}return [s, a];
|
| 603 |
+
}, flushTransformCache: function (e) {
|
| 604 |
+
function t(t) {
|
| 605 |
+
return parseFloat(S.getPropertyValue(e, t));
|
| 606 |
+
}var r = "";if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) {
|
| 607 |
+
var a = { translate: [t("translateX"), t("translateY")], skewX: [t("skewX")], skewY: [t("skewY")], scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")], rotate: [t("rotateZ"), 0, 0] };f.each(i(e).transformCache, function (e) {
|
| 608 |
+
/^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e]);
|
| 609 |
+
});
|
| 610 |
+
} else {
|
| 611 |
+
var n, o;f.each(i(e).transformCache, function (t) {
|
| 612 |
+
return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void (r += t + n + " "));
|
| 613 |
+
}), o && (r = "perspective" + o + " " + r);
|
| 614 |
+
}S.setPropertyValue(e, "transform", r);
|
| 615 |
+
} };S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) {
|
| 616 |
+
var n = a;return e = o(e), f.each(e, function (e, o) {
|
| 617 |
+
if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));else {
|
| 618 |
+
var s = b.CSS.setPropertyValue(o, t, r);"transform" === s[0] && b.CSS.flushTransformCache(o), n = s;
|
| 619 |
+
}
|
| 620 |
+
}), n;
|
| 621 |
+
};var P = function () {
|
| 622 |
+
function e() {
|
| 623 |
+
return s ? k.promise || null : l;
|
| 624 |
+
}function n() {
|
| 625 |
+
function e(e) {
|
| 626 |
+
function p(e, t) {
|
| 627 |
+
var r = a,
|
| 628 |
+
n = a,
|
| 629 |
+
i = a;return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i];
|
| 630 |
+
}function d(e, t) {
|
| 631 |
+
var r, a;return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) {
|
| 632 |
+
return r = e, "";
|
| 633 |
+
}), r || (r = S.Values.getUnitType(e)), [a, r];
|
| 634 |
+
}function h() {
|
| 635 |
+
var e = { myParent: o.parentNode || r.body, position: S.getPropertyValue(o, "position"), fontSize: S.getPropertyValue(o, "fontSize") },
|
| 636 |
+
a = e.position === L.lastPosition && e.myParent === L.lastParent,
|
| 637 |
+
n = e.fontSize === L.lastFontSize;L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;var s = 100,
|
| 638 |
+
l = {};if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;else {
|
| 639 |
+
var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) {
|
| 640 |
+
b.CSS.setPropertyValue(u, t, "hidden");
|
| 641 |
+
}), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) {
|
| 642 |
+
b.CSS.setPropertyValue(u, t, s + "%");
|
| 643 |
+
}), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u);
|
| 644 |
+
}return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l;
|
| 645 |
+
}if (s.begin && 0 === V) try {
|
| 646 |
+
s.begin.call(g, g);
|
| 647 |
+
} catch (x) {
|
| 648 |
+
setTimeout(function () {
|
| 649 |
+
throw x;
|
| 650 |
+
}, 1);
|
| 651 |
+
}if ("scroll" === A) {
|
| 652 |
+
var P,
|
| 653 |
+
C,
|
| 654 |
+
T,
|
| 655 |
+
F = /^x$/i.test(s.axis) ? "Left" : "Top",
|
| 656 |
+
j = parseFloat(s.offset) || 0;s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = { scroll: { rootPropertyValue: !1, startValue: P, currentValue: P, endValue: T, unitType: "", easing: s.easing, scrollData: { container: s.container, direction: F, alternateValue: C } }, element: o }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o);
|
| 657 |
+
} else if ("reverse" === A) {
|
| 658 |
+
if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);var E = f.extend(!0, {}, i(o).tweensContainer);for (var H in E) {
|
| 659 |
+
if ("element" !== H) {
|
| 660 |
+
var N = E[H].startValue;E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o);
|
| 661 |
+
}
|
| 662 |
+
}l = E;
|
| 663 |
+
} else if ("start" === A) {
|
| 664 |
+
var E;i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) {
|
| 665 |
+
if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) {
|
| 666 |
+
var r = p(t, !0),
|
| 667 |
+
n = r[0],
|
| 668 |
+
o = r[1],
|
| 669 |
+
i = r[2];if (S.RegEx.isHex.test(n)) {
|
| 670 |
+
for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) {
|
| 671 |
+
var f = [l[c]];o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f;
|
| 672 |
+
}delete y[e];
|
| 673 |
+
}
|
| 674 |
+
}
|
| 675 |
+
});for (var z in y) {
|
| 676 |
+
var O = p(y[z]),
|
| 677 |
+
q = O[0],
|
| 678 |
+
$ = O[1],
|
| 679 |
+
M = O[2];z = S.Names.camelCase(z);var I = S.Hooks.getRoot(z),
|
| 680 |
+
B = !1;if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) {
|
| 681 |
+
(s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));var W,
|
| 682 |
+
G,
|
| 683 |
+
Y,
|
| 684 |
+
D = !1;if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) {
|
| 685 |
+
return D = t, "";
|
| 686 |
+
}), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;else if (Y !== G && 0 !== M) if (0 === q) G = Y;else {
|
| 687 |
+
n = n || h();var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";switch (Y) {case "%":
|
| 688 |
+
M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;break;case "px":
|
| 689 |
+
break;default:
|
| 690 |
+
M *= n[Y + "ToPx"];}switch (G) {case "%":
|
| 691 |
+
M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);break;case "px":
|
| 692 |
+
break;default:
|
| 693 |
+
M *= 1 / n[G + "ToPx"];}
|
| 694 |
+
}switch (D) {case "+":
|
| 695 |
+
q = M + q;break;case "-":
|
| 696 |
+
q = M - q;break;case "*":
|
| 697 |
+
q = M * q;break;case "/":
|
| 698 |
+
q = M / q;}l[z] = { rootPropertyValue: B, startValue: M, currentValue: M, endValue: q, unitType: G, easing: $ }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o);
|
| 699 |
+
} else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support.");
|
| 700 |
+
}l.element = o;
|
| 701 |
+
}l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++);
|
| 702 |
+
}var n,
|
| 703 |
+
o = this,
|
| 704 |
+
s = f.extend({}, b.defaults, v),
|
| 705 |
+
l = {};switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) {
|
| 706 |
+
b.velocityQueueEntryFlag = !0, i(o).delayTimer = { setTimeout: setTimeout(e, parseFloat(s.delay)), next: e };
|
| 707 |
+
}), s.duration.toString().toLowerCase()) {case "fast":
|
| 708 |
+
s.duration = 200;break;case "normal":
|
| 709 |
+
s.duration = h;break;case "slow":
|
| 710 |
+
s.duration = 600;break;default:
|
| 711 |
+
s.duration = parseFloat(s.duration) || 1;}b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) {
|
| 712 |
+
return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t));
|
| 713 |
+
}), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o);
|
| 714 |
+
}var s,
|
| 715 |
+
l,
|
| 716 |
+
d,
|
| 717 |
+
g,
|
| 718 |
+
y,
|
| 719 |
+
v,
|
| 720 |
+
x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) {
|
| 721 |
+
x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);var w = g.length,
|
| 722 |
+
V = 0;if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) {
|
| 723 |
+
var C = d + 1;v = {};for (var T = C; T < arguments.length; T++) {
|
| 724 |
+
m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T];
|
| 725 |
+
}
|
| 726 |
+
}var k = { promise: null, resolver: null, rejecter: null };s && b.Promise && (k.promise = new b.Promise(function (e, t) {
|
| 727 |
+
k.resolver = e, k.rejecter = t;
|
| 728 |
+
}));var A;switch (y) {case "scroll":
|
| 729 |
+
A = "scroll";break;case "reverse":
|
| 730 |
+
A = "reverse";break;case "finish":case "stop":
|
| 731 |
+
f.each(g, function (e, t) {
|
| 732 |
+
i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer);
|
| 733 |
+
});var F = [];return f.each(b.State.calls, function (e, t) {
|
| 734 |
+
t && f.each(t[1], function (r, n) {
|
| 735 |
+
var o = v === a ? "" : v;return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) {
|
| 736 |
+
a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) {
|
| 737 |
+
m.isFunction(t) && t(null, !0);
|
| 738 |
+
}), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) {
|
| 739 |
+
t.endValue = t.currentValue;
|
| 740 |
+
}), F.push(e)) : "finish" === y && (t[2].duration = 1));
|
| 741 |
+
}) : !0;
|
| 742 |
+
});
|
| 743 |
+
}), "stop" === y && (f.each(F, function (e, t) {
|
| 744 |
+
p(t, !0);
|
| 745 |
+
}), k.promise && k.resolver(g)), e();default:
|
| 746 |
+
if (!f.isPlainObject(y) || m.isEmptyObject(y)) {
|
| 747 |
+
if (m.isString(y) && b.Redirects[y]) {
|
| 748 |
+
var j = f.extend({}, v),
|
| 749 |
+
E = j.duration,
|
| 750 |
+
H = j.delay || 0;return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) {
|
| 751 |
+
parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a);
|
| 752 |
+
}), e();
|
| 753 |
+
}var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise ? k.rejecter(new Error(N)) : console.log(N), e();
|
| 754 |
+
}A = "start";}var L = { lastParent: null, lastPosition: null, lastFontSize: null, lastPercentToPxWidth: null, lastPercentToPxHeight: null, lastEmToPx: null, remToPx: null, vwToPx: null, vhToPx: null },
|
| 755 |
+
R = [];f.each(g, function (e, t) {
|
| 756 |
+
m.isNode(t) && n.call(t);
|
| 757 |
+
});var z,
|
| 758 |
+
j = f.extend({}, b.defaults, v);if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop) for (var O = 0; z > O; O++) {
|
| 759 |
+
var q = { delay: j.delay, progress: j.progress };O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q);
|
| 760 |
+
}return e();
|
| 761 |
+
}
|
| 762 |
+
};b = f.extend(P, b), b.animate = P;var w = t.requestAnimationFrame || g;return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () {
|
| 763 |
+
r.hidden ? (w = function (e) {
|
| 764 |
+
return setTimeout(function () {
|
| 765 |
+
e(!0);
|
| 766 |
+
}, 16);
|
| 767 |
+
}, c()) : w = t.requestAnimationFrame || g;
|
| 768 |
+
}), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) {
|
| 769 |
+
b.Redirects["slide" + t] = function (e, r, n, o, i, s) {
|
| 770 |
+
var l = f.extend({}, r),
|
| 771 |
+
u = l.begin,
|
| 772 |
+
c = l.complete,
|
| 773 |
+
p = { height: "", marginTop: "", marginBottom: "", paddingTop: "", paddingBottom: "" },
|
| 774 |
+
d = {};l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () {
|
| 775 |
+
u && u.call(i, i);for (var r in p) {
|
| 776 |
+
d[r] = e.style[r];var a = b.CSS.getPropertyValue(e, r);p[r] = "Down" === t ? [a, 0] : [0, a];
|
| 777 |
+
}d.overflow = e.style.overflow, e.style.overflow = "hidden";
|
| 778 |
+
}, l.complete = function () {
|
| 779 |
+
for (var t in d) {
|
| 780 |
+
e.style[t] = d[t];
|
| 781 |
+
}c && c.call(i, i), s && s.resolver(i);
|
| 782 |
+
}, b(e, p, l);
|
| 783 |
+
};
|
| 784 |
+
}), f.each(["In", "Out"], function (e, t) {
|
| 785 |
+
b.Redirects["fade" + t] = function (e, r, n, o, i, s) {
|
| 786 |
+
var l = f.extend({}, r),
|
| 787 |
+
u = { opacity: "In" === t ? 1 : 0 },
|
| 788 |
+
c = l.complete;l.complete = n !== o - 1 ? l.begin = null : function () {
|
| 789 |
+
c && c.call(i, i), s && s.resolver(i);
|
| 790 |
+
}, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l);
|
| 791 |
+
};
|
| 792 |
+
}), b;
|
| 793 |
+
}(window.jQuery || window.Zepto || window, window, document);
|
| 794 |
+
}));
|
| 795 |
+
;!function (a, b, c, d) {
|
| 796 |
+
"use strict";
|
| 797 |
+
function k(a, b, c) {
|
| 798 |
+
return setTimeout(q(a, c), b);
|
| 799 |
+
}function l(a, b, c) {
|
| 800 |
+
return Array.isArray(a) ? (m(a, c[b], c), !0) : !1;
|
| 801 |
+
}function m(a, b, c) {
|
| 802 |
+
var e;if (a) if (a.forEach) a.forEach(b, c);else if (a.length !== d) for (e = 0; e < a.length;) {
|
| 803 |
+
b.call(c, a[e], e, a), e++;
|
| 804 |
+
} else for (e in a) {
|
| 805 |
+
a.hasOwnProperty(e) && b.call(c, a[e], e, a);
|
| 806 |
+
}
|
| 807 |
+
}function n(a, b, c) {
|
| 808 |
+
for (var e = Object.keys(b), f = 0; f < e.length;) {
|
| 809 |
+
(!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++;
|
| 810 |
+
}return a;
|
| 811 |
+
}function o(a, b) {
|
| 812 |
+
return n(a, b, !0);
|
| 813 |
+
}function p(a, b, c) {
|
| 814 |
+
var e,
|
| 815 |
+
d = b.prototype;e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c);
|
| 816 |
+
}function q(a, b) {
|
| 817 |
+
return function () {
|
| 818 |
+
return a.apply(b, arguments);
|
| 819 |
+
};
|
| 820 |
+
}function r(a, b) {
|
| 821 |
+
return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a;
|
| 822 |
+
}function s(a, b) {
|
| 823 |
+
return a === d ? b : a;
|
| 824 |
+
}function t(a, b, c) {
|
| 825 |
+
m(x(b), function (b) {
|
| 826 |
+
a.addEventListener(b, c, !1);
|
| 827 |
+
});
|
| 828 |
+
}function u(a, b, c) {
|
| 829 |
+
m(x(b), function (b) {
|
| 830 |
+
a.removeEventListener(b, c, !1);
|
| 831 |
+
});
|
| 832 |
+
}function v(a, b) {
|
| 833 |
+
for (; a;) {
|
| 834 |
+
if (a == b) return !0;a = a.parentNode;
|
| 835 |
+
}return !1;
|
| 836 |
+
}function w(a, b) {
|
| 837 |
+
return a.indexOf(b) > -1;
|
| 838 |
+
}function x(a) {
|
| 839 |
+
return a.trim().split(/\s+/g);
|
| 840 |
+
}function y(a, b, c) {
|
| 841 |
+
if (a.indexOf && !c) return a.indexOf(b);for (var d = 0; d < a.length;) {
|
| 842 |
+
if (c && a[d][c] == b || !c && a[d] === b) return d;d++;
|
| 843 |
+
}return -1;
|
| 844 |
+
}function z(a) {
|
| 845 |
+
return Array.prototype.slice.call(a, 0);
|
| 846 |
+
}function A(a, b, c) {
|
| 847 |
+
for (var d = [], e = [], f = 0; f < a.length;) {
|
| 848 |
+
var g = b ? a[f][b] : a[f];y(e, g) < 0 && d.push(a[f]), e[f] = g, f++;
|
| 849 |
+
}return c && (d = b ? d.sort(function (a, c) {
|
| 850 |
+
return a[b] > c[b];
|
| 851 |
+
}) : d.sort()), d;
|
| 852 |
+
}function B(a, b) {
|
| 853 |
+
for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) {
|
| 854 |
+
if (c = e[h], f = c ? c + g : b, f in a) return f;h++;
|
| 855 |
+
}return d;
|
| 856 |
+
}function D() {
|
| 857 |
+
return C++;
|
| 858 |
+
}function E(a) {
|
| 859 |
+
var b = a.ownerDocument;return b.defaultView || b.parentWindow;
|
| 860 |
+
}function ab(a, b) {
|
| 861 |
+
var c = this;this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) {
|
| 862 |
+
r(a.options.enable, [a]) && c.handler(b);
|
| 863 |
+
}, this.init();
|
| 864 |
+
}function bb(a) {
|
| 865 |
+
var b,
|
| 866 |
+
c = a.options.inputClass;return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb);
|
| 867 |
+
}function cb(a, b, c) {
|
| 868 |
+
var d = c.pointers.length,
|
| 869 |
+
e = c.changedPointers.length,
|
| 870 |
+
f = b & O && 0 === d - e,
|
| 871 |
+
g = b & (Q | R) && 0 === d - e;c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c;
|
| 872 |
+
}function db(a, b) {
|
| 873 |
+
var c = a.session,
|
| 874 |
+
d = b.pointers,
|
| 875 |
+
e = d.length;c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);var f = c.firstInput,
|
| 876 |
+
g = c.firstMultiple,
|
| 877 |
+
h = g ? g.center : f.center,
|
| 878 |
+
i = b.center = hb(d);b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);var k = a.element;v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k;
|
| 879 |
+
}function eb(a, b) {
|
| 880 |
+
var c = b.center,
|
| 881 |
+
d = a.offsetDelta || {},
|
| 882 |
+
e = a.prevDelta || {},
|
| 883 |
+
f = a.prevInput || {};(b.eventType === O || f.eventType === Q) && (e = a.prevDelta = { x: f.deltaX || 0, y: f.deltaY || 0 }, d = a.offsetDelta = { x: c.x, y: c.y }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y);
|
| 884 |
+
}function fb(a, b) {
|
| 885 |
+
var f,
|
| 886 |
+
g,
|
| 887 |
+
h,
|
| 888 |
+
j,
|
| 889 |
+
c = a.lastInterval || b,
|
| 890 |
+
e = b.timeStamp - c.timeStamp;if (b.eventType != R && (e > N || c.velocity === d)) {
|
| 891 |
+
var k = c.deltaX - b.deltaX,
|
| 892 |
+
l = c.deltaY - b.deltaY,
|
| 893 |
+
m = ib(e, k, l);g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b;
|
| 894 |
+
} else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j;
|
| 895 |
+
}function gb(a) {
|
| 896 |
+
for (var b = [], c = 0; c < a.pointers.length;) {
|
| 897 |
+
b[c] = { clientX: h(a.pointers[c].clientX), clientY: h(a.pointers[c].clientY) }, c++;
|
| 898 |
+
}return { timeStamp: j(), pointers: b, center: hb(b), deltaX: a.deltaX, deltaY: a.deltaY };
|
| 899 |
+
}function hb(a) {
|
| 900 |
+
var b = a.length;if (1 === b) return { x: h(a[0].clientX), y: h(a[0].clientY) };for (var c = 0, d = 0, e = 0; b > e;) {
|
| 901 |
+
c += a[e].clientX, d += a[e].clientY, e++;
|
| 902 |
+
}return { x: h(c / b), y: h(d / b) };
|
| 903 |
+
}function ib(a, b, c) {
|
| 904 |
+
return { x: b / a || 0, y: c / a || 0 };
|
| 905 |
+
}function jb(a, b) {
|
| 906 |
+
return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W;
|
| 907 |
+
}function kb(a, b, c) {
|
| 908 |
+
c || (c = $);var d = b[c[0]] - a[c[0]],
|
| 909 |
+
e = b[c[1]] - a[c[1]];return Math.sqrt(d * d + e * e);
|
| 910 |
+
}function lb(a, b, c) {
|
| 911 |
+
c || (c = $);var d = b[c[0]] - a[c[0]],
|
| 912 |
+
e = b[c[1]] - a[c[1]];return 180 * Math.atan2(e, d) / Math.PI;
|
| 913 |
+
}function mb(a, b) {
|
| 914 |
+
return lb(b[1], b[0], _) - lb(a[1], a[0], _);
|
| 915 |
+
}function nb(a, b) {
|
| 916 |
+
return kb(b[0], b[1], _) / kb(a[0], a[1], _);
|
| 917 |
+
}function rb() {
|
| 918 |
+
this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments);
|
| 919 |
+
}function wb() {
|
| 920 |
+
this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = [];
|
| 921 |
+
}function Ab() {
|
| 922 |
+
this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments);
|
| 923 |
+
}function Bb(a, b) {
|
| 924 |
+
var c = z(a.touches),
|
| 925 |
+
d = z(a.changedTouches);return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d];
|
| 926 |
+
}function Eb() {
|
| 927 |
+
this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments);
|
| 928 |
+
}function Fb(a, b) {
|
| 929 |
+
var c = z(a.touches),
|
| 930 |
+
d = this.targetIds;if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];var e,
|
| 931 |
+
f,
|
| 932 |
+
g = z(a.changedTouches),
|
| 933 |
+
h = [],
|
| 934 |
+
i = this.target;if (f = c.filter(function (a) {
|
| 935 |
+
return v(a.target, i);
|
| 936 |
+
}), b === O) for (e = 0; e < f.length;) {
|
| 937 |
+
d[f[e].identifier] = !0, e++;
|
| 938 |
+
}for (e = 0; e < g.length;) {
|
| 939 |
+
d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++;
|
| 940 |
+
}return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0;
|
| 941 |
+
}function Gb() {
|
| 942 |
+
ab.apply(this, arguments);var a = q(this.handler, this);this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a);
|
| 943 |
+
}function Pb(a, b) {
|
| 944 |
+
this.manager = a, this.set(b);
|
| 945 |
+
}function Qb(a) {
|
| 946 |
+
if (w(a, Mb)) return Mb;var b = w(a, Nb),
|
| 947 |
+
c = w(a, Ob);return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb;
|
| 948 |
+
}function Yb(a) {
|
| 949 |
+
this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = [];
|
| 950 |
+
}function Zb(a) {
|
| 951 |
+
return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : "";
|
| 952 |
+
}function $b(a) {
|
| 953 |
+
return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : "";
|
| 954 |
+
}function _b(a, b) {
|
| 955 |
+
var c = b.manager;return c ? c.get(a) : a;
|
| 956 |
+
}function ac() {
|
| 957 |
+
Yb.apply(this, arguments);
|
| 958 |
+
}function bc() {
|
| 959 |
+
ac.apply(this, arguments), this.pX = null, this.pY = null;
|
| 960 |
+
}function cc() {
|
| 961 |
+
ac.apply(this, arguments);
|
| 962 |
+
}function dc() {
|
| 963 |
+
Yb.apply(this, arguments), this._timer = null, this._input = null;
|
| 964 |
+
}function ec() {
|
| 965 |
+
ac.apply(this, arguments);
|
| 966 |
+
}function fc() {
|
| 967 |
+
ac.apply(this, arguments);
|
| 968 |
+
}function gc() {
|
| 969 |
+
Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0;
|
| 970 |
+
}function hc(a, b) {
|
| 971 |
+
return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b);
|
| 972 |
+
}function kc(a, b) {
|
| 973 |
+
b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) {
|
| 974 |
+
var b = this.add(new a[0](a[1]));a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3]);
|
| 975 |
+
}, this);
|
| 976 |
+
}function lc(a, b) {
|
| 977 |
+
var c = a.element;m(a.options.cssProps, function (a, d) {
|
| 978 |
+
c.style[B(c.style, d)] = b ? a : "";
|
| 979 |
+
});
|
| 980 |
+
}function mc(a, c) {
|
| 981 |
+
var d = b.createEvent("Event");d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d);
|
| 982 |
+
}var e = ["", "webkit", "moz", "MS", "ms", "o"],
|
| 983 |
+
f = b.createElement("div"),
|
| 984 |
+
g = "function",
|
| 985 |
+
h = Math.round,
|
| 986 |
+
i = Math.abs,
|
| 987 |
+
j = Date.now,
|
| 988 |
+
C = 1,
|
| 989 |
+
F = /mobile|tablet|ip(ad|hone|od)|android/i,
|
| 990 |
+
G = "ontouchstart" in a,
|
| 991 |
+
H = B(a, "PointerEvent") !== d,
|
| 992 |
+
I = G && F.test(navigator.userAgent),
|
| 993 |
+
J = "touch",
|
| 994 |
+
K = "pen",
|
| 995 |
+
L = "mouse",
|
| 996 |
+
M = "kinect",
|
| 997 |
+
N = 25,
|
| 998 |
+
O = 1,
|
| 999 |
+
P = 2,
|
| 1000 |
+
Q = 4,
|
| 1001 |
+
R = 8,
|
| 1002 |
+
S = 1,
|
| 1003 |
+
T = 2,
|
| 1004 |
+
U = 4,
|
| 1005 |
+
V = 8,
|
| 1006 |
+
W = 16,
|
| 1007 |
+
X = T | U,
|
| 1008 |
+
Y = V | W,
|
| 1009 |
+
Z = X | Y,
|
| 1010 |
+
$ = ["x", "y"],
|
| 1011 |
+
_ = ["clientX", "clientY"];ab.prototype = { handler: function () {}, init: function () {
|
| 1012 |
+
this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler);
|
| 1013 |
+
}, destroy: function () {
|
| 1014 |
+
this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler);
|
| 1015 |
+
} };var ob = { mousedown: O, mousemove: P, mouseup: Q },
|
| 1016 |
+
pb = "mousedown",
|
| 1017 |
+
qb = "mousemove mouseup";p(rb, ab, { handler: function (a) {
|
| 1018 |
+
var b = ob[a.type];b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, { pointers: [a], changedPointers: [a], pointerType: L, srcEvent: a }));
|
| 1019 |
+
} });var sb = { pointerdown: O, pointermove: P, pointerup: Q, pointercancel: R, pointerout: R },
|
| 1020 |
+
tb = { 2: J, 3: K, 4: L, 5: M },
|
| 1021 |
+
ub = "pointerdown",
|
| 1022 |
+
vb = "pointermove pointerup pointercancel";a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, { handler: function (a) {
|
| 1023 |
+
var b = this.store,
|
| 1024 |
+
c = !1,
|
| 1025 |
+
d = a.type.toLowerCase().replace("ms", ""),
|
| 1026 |
+
e = sb[d],
|
| 1027 |
+
f = tb[a.pointerType] || a.pointerType,
|
| 1028 |
+
g = f == J,
|
| 1029 |
+
h = y(b, a.pointerId, "pointerId");e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, { pointers: b, changedPointers: [a], pointerType: f, srcEvent: a }), c && b.splice(h, 1));
|
| 1030 |
+
} });var xb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
|
| 1031 |
+
yb = "touchstart",
|
| 1032 |
+
zb = "touchstart touchmove touchend touchcancel";p(Ab, ab, { handler: function (a) {
|
| 1033 |
+
var b = xb[a.type];if (b === O && (this.started = !0), this.started) {
|
| 1034 |
+
var c = Bb.call(this, a, b);b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
|
| 1035 |
+
}
|
| 1036 |
+
} });var Cb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
|
| 1037 |
+
Db = "touchstart touchmove touchend touchcancel";p(Eb, ab, { handler: function (a) {
|
| 1038 |
+
var b = Cb[a.type],
|
| 1039 |
+
c = Fb.call(this, a, b);c && this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
|
| 1040 |
+
} }), p(Gb, ab, { handler: function (a, b, c) {
|
| 1041 |
+
var d = c.pointerType == J,
|
| 1042 |
+
e = c.pointerType == L;if (d) this.mouse.allow = !1;else if (e && !this.mouse.allow) return;b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c);
|
| 1043 |
+
}, destroy: function () {
|
| 1044 |
+
this.touch.destroy(), this.mouse.destroy();
|
| 1045 |
+
} });var Hb = B(f.style, "touchAction"),
|
| 1046 |
+
Ib = Hb !== d,
|
| 1047 |
+
Jb = "compute",
|
| 1048 |
+
Kb = "auto",
|
| 1049 |
+
Lb = "manipulation",
|
| 1050 |
+
Mb = "none",
|
| 1051 |
+
Nb = "pan-x",
|
| 1052 |
+
Ob = "pan-y";Pb.prototype = { set: function (a) {
|
| 1053 |
+
a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim();
|
| 1054 |
+
}, update: function () {
|
| 1055 |
+
this.set(this.manager.options.touchAction);
|
| 1056 |
+
}, compute: function () {
|
| 1057 |
+
var a = [];return m(this.manager.recognizers, function (b) {
|
| 1058 |
+
r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction()));
|
| 1059 |
+
}), Qb(a.join(" "));
|
| 1060 |
+
}, preventDefaults: function (a) {
|
| 1061 |
+
if (!Ib) {
|
| 1062 |
+
var b = a.srcEvent,
|
| 1063 |
+
c = a.offsetDirection;if (this.manager.session.prevented) return b.preventDefault(), void 0;var d = this.actions,
|
| 1064 |
+
e = w(d, Mb),
|
| 1065 |
+
f = w(d, Ob),
|
| 1066 |
+
g = w(d, Nb);return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0;
|
| 1067 |
+
}
|
| 1068 |
+
}, preventSrc: function (a) {
|
| 1069 |
+
this.manager.session.prevented = !0, a.preventDefault();
|
| 1070 |
+
} };var Rb = 1,
|
| 1071 |
+
Sb = 2,
|
| 1072 |
+
Tb = 4,
|
| 1073 |
+
Ub = 8,
|
| 1074 |
+
Vb = Ub,
|
| 1075 |
+
Wb = 16,
|
| 1076 |
+
Xb = 32;Yb.prototype = { defaults: {}, set: function (a) {
|
| 1077 |
+
return n(this.options, a), this.manager && this.manager.touchAction.update(), this;
|
| 1078 |
+
}, recognizeWith: function (a) {
|
| 1079 |
+
if (l(a, "recognizeWith", this)) return this;var b = this.simultaneous;return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this;
|
| 1080 |
+
}, dropRecognizeWith: function (a) {
|
| 1081 |
+
return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this);
|
| 1082 |
+
}, requireFailure: function (a) {
|
| 1083 |
+
if (l(a, "requireFailure", this)) return this;var b = this.requireFail;return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this;
|
| 1084 |
+
}, dropRequireFailure: function (a) {
|
| 1085 |
+
if (l(a, "dropRequireFailure", this)) return this;a = _b(a, this);var b = y(this.requireFail, a);return b > -1 && this.requireFail.splice(b, 1), this;
|
| 1086 |
+
}, hasRequireFailures: function () {
|
| 1087 |
+
return this.requireFail.length > 0;
|
| 1088 |
+
}, canRecognizeWith: function (a) {
|
| 1089 |
+
return !!this.simultaneous[a.id];
|
| 1090 |
+
}, emit: function (a) {
|
| 1091 |
+
function d(d) {
|
| 1092 |
+
b.manager.emit(b.options.event + (d ? Zb(c) : ""), a);
|
| 1093 |
+
}var b = this,
|
| 1094 |
+
c = this.state;Ub > c && d(!0), d(), c >= Ub && d(!0);
|
| 1095 |
+
}, tryEmit: function (a) {
|
| 1096 |
+
return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0);
|
| 1097 |
+
}, canEmit: function () {
|
| 1098 |
+
for (var a = 0; a < this.requireFail.length;) {
|
| 1099 |
+
if (!(this.requireFail[a].state & (Xb | Rb))) return !1;a++;
|
| 1100 |
+
}return !0;
|
| 1101 |
+
}, recognize: function (a) {
|
| 1102 |
+
var b = n({}, a);return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0);
|
| 1103 |
+
}, process: function () {}, getTouchAction: function () {}, reset: function () {} }, p(ac, Yb, { defaults: { pointers: 1 }, attrTest: function (a) {
|
| 1104 |
+
var b = this.options.pointers;return 0 === b || a.pointers.length === b;
|
| 1105 |
+
}, process: function (a) {
|
| 1106 |
+
var b = this.state,
|
| 1107 |
+
c = a.eventType,
|
| 1108 |
+
d = b & (Sb | Tb),
|
| 1109 |
+
e = this.attrTest(a);return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb;
|
| 1110 |
+
} }), p(bc, ac, { defaults: { event: "pan", threshold: 10, pointers: 1, direction: Z }, getTouchAction: function () {
|
| 1111 |
+
var a = this.options.direction,
|
| 1112 |
+
b = [];return a & X && b.push(Ob), a & Y && b.push(Nb), b;
|
| 1113 |
+
}, directionTest: function (a) {
|
| 1114 |
+
var b = this.options,
|
| 1115 |
+
c = !0,
|
| 1116 |
+
d = a.distance,
|
| 1117 |
+
e = a.direction,
|
| 1118 |
+
f = a.deltaX,
|
| 1119 |
+
g = a.deltaY;return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction;
|
| 1120 |
+
}, attrTest: function (a) {
|
| 1121 |
+
return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a));
|
| 1122 |
+
}, emit: function (a) {
|
| 1123 |
+
this.pX = a.deltaX, this.pY = a.deltaY;var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a);
|
| 1124 |
+
} }), p(cc, ac, { defaults: { event: "pinch", threshold: 0, pointers: 2 }, getTouchAction: function () {
|
| 1125 |
+
return [Mb];
|
| 1126 |
+
}, attrTest: function (a) {
|
| 1127 |
+
return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb);
|
| 1128 |
+
}, emit: function (a) {
|
| 1129 |
+
if (this._super.emit.call(this, a), 1 !== a.scale) {
|
| 1130 |
+
var b = a.scale < 1 ? "in" : "out";this.manager.emit(this.options.event + b, a);
|
| 1131 |
+
}
|
| 1132 |
+
} }), p(dc, Yb, { defaults: { event: "press", pointers: 1, time: 500, threshold: 5 }, getTouchAction: function () {
|
| 1133 |
+
return [Kb];
|
| 1134 |
+
}, process: function (a) {
|
| 1135 |
+
var b = this.options,
|
| 1136 |
+
c = a.pointers.length === b.pointers,
|
| 1137 |
+
d = a.distance < b.threshold,
|
| 1138 |
+
e = a.deltaTime > b.time;if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();else if (a.eventType & O) this.reset(), this._timer = k(function () {
|
| 1139 |
+
this.state = Vb, this.tryEmit();
|
| 1140 |
+
}, b.time, this);else if (a.eventType & Q) return Vb;return Xb;
|
| 1141 |
+
}, reset: function () {
|
| 1142 |
+
clearTimeout(this._timer);
|
| 1143 |
+
}, emit: function (a) {
|
| 1144 |
+
this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input)));
|
| 1145 |
+
} }), p(ec, ac, { defaults: { event: "rotate", threshold: 0, pointers: 2 }, getTouchAction: function () {
|
| 1146 |
+
return [Mb];
|
| 1147 |
+
}, attrTest: function (a) {
|
| 1148 |
+
return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb);
|
| 1149 |
+
} }), p(fc, ac, { defaults: { event: "swipe", threshold: 10, velocity: .65, direction: X | Y, pointers: 1 }, getTouchAction: function () {
|
| 1150 |
+
return bc.prototype.getTouchAction.call(this);
|
| 1151 |
+
}, attrTest: function (a) {
|
| 1152 |
+
var c,
|
| 1153 |
+
b = this.options.direction;return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q;
|
| 1154 |
+
}, emit: function (a) {
|
| 1155 |
+
var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a);
|
| 1156 |
+
} }), p(gc, Yb, { defaults: { event: "tap", pointers: 1, taps: 1, interval: 300, time: 250, threshold: 2, posThreshold: 10 }, getTouchAction: function () {
|
| 1157 |
+
return [Lb];
|
| 1158 |
+
}, process: function (a) {
|
| 1159 |
+
var b = this.options,
|
| 1160 |
+
c = a.pointers.length === b.pointers,
|
| 1161 |
+
d = a.distance < b.threshold,
|
| 1162 |
+
e = a.deltaTime < b.time;if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();if (d && e && c) {
|
| 1163 |
+
if (a.eventType != Q) return this.failTimeout();var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0,
|
| 1164 |
+
g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;var h = this.count % b.taps;if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () {
|
| 1165 |
+
this.state = Vb, this.tryEmit();
|
| 1166 |
+
}, b.interval, this), Sb) : Vb;
|
| 1167 |
+
}return Xb;
|
| 1168 |
+
}, failTimeout: function () {
|
| 1169 |
+
return this._timer = k(function () {
|
| 1170 |
+
this.state = Xb;
|
| 1171 |
+
}, this.options.interval, this), Xb;
|
| 1172 |
+
}, reset: function () {
|
| 1173 |
+
clearTimeout(this._timer);
|
| 1174 |
+
}, emit: function () {
|
| 1175 |
+
this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input));
|
| 1176 |
+
} }), hc.VERSION = "2.0.4", hc.defaults = { domEvents: !1, touchAction: Jb, enable: !0, inputTarget: null, inputClass: null, preset: [[ec, { enable: !1 }], [cc, { enable: !1 }, ["rotate"]], [fc, { direction: X }], [bc, { direction: X }, ["swipe"]], [gc], [gc, { event: "doubletap", taps: 2 }, ["tap"]], [dc]], cssProps: { userSelect: "default", touchSelect: "none", touchCallout: "none", contentZooming: "none", userDrag: "none", tapHighlightColor: "rgba(0,0,0,0)" } };var ic = 1,
|
| 1177 |
+
jc = 2;kc.prototype = { set: function (a) {
|
| 1178 |
+
return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this;
|
| 1179 |
+
}, stop: function (a) {
|
| 1180 |
+
this.session.stopped = a ? jc : ic;
|
| 1181 |
+
}, recognize: function (a) {
|
| 1182 |
+
var b = this.session;if (!b.stopped) {
|
| 1183 |
+
this.touchAction.preventDefaults(a);var c,
|
| 1184 |
+
d = this.recognizers,
|
| 1185 |
+
e = b.curRecognizer;(!e || e && e.state & Vb) && (e = b.curRecognizer = null);for (var f = 0; f < d.length;) {
|
| 1186 |
+
c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++;
|
| 1187 |
+
}
|
| 1188 |
+
}
|
| 1189 |
+
}, get: function (a) {
|
| 1190 |
+
if (a instanceof Yb) return a;for (var b = this.recognizers, c = 0; c < b.length; c++) {
|
| 1191 |
+
if (b[c].options.event == a) return b[c];
|
| 1192 |
+
}return null;
|
| 1193 |
+
}, add: function (a) {
|
| 1194 |
+
if (l(a, "add", this)) return this;var b = this.get(a.options.event);return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a;
|
| 1195 |
+
}, remove: function (a) {
|
| 1196 |
+
if (l(a, "remove", this)) return this;var b = this.recognizers;return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this;
|
| 1197 |
+
}, on: function (a, b) {
|
| 1198 |
+
var c = this.handlers;return m(x(a), function (a) {
|
| 1199 |
+
c[a] = c[a] || [], c[a].push(b);
|
| 1200 |
+
}), this;
|
| 1201 |
+
}, off: function (a, b) {
|
| 1202 |
+
var c = this.handlers;return m(x(a), function (a) {
|
| 1203 |
+
b ? c[a].splice(y(c[a], b), 1) : delete c[a];
|
| 1204 |
+
}), this;
|
| 1205 |
+
}, emit: function (a, b) {
|
| 1206 |
+
this.options.domEvents && mc(a, b);var c = this.handlers[a] && this.handlers[a].slice();if (c && c.length) {
|
| 1207 |
+
b.type = a, b.preventDefault = function () {
|
| 1208 |
+
b.srcEvent.preventDefault();
|
| 1209 |
+
};for (var d = 0; d < c.length;) {
|
| 1210 |
+
c[d](b), d++;
|
| 1211 |
+
}
|
| 1212 |
+
}
|
| 1213 |
+
}, destroy: function () {
|
| 1214 |
+
this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null;
|
| 1215 |
+
} }, n(hc, { INPUT_START: O, INPUT_MOVE: P, INPUT_END: Q, INPUT_CANCEL: R, STATE_POSSIBLE: Rb, STATE_BEGAN: Sb, STATE_CHANGED: Tb, STATE_ENDED: Ub, STATE_RECOGNIZED: Vb, STATE_CANCELLED: Wb, STATE_FAILED: Xb, DIRECTION_NONE: S, DIRECTION_LEFT: T, DIRECTION_RIGHT: U, DIRECTION_UP: V, DIRECTION_DOWN: W, DIRECTION_HORIZONTAL: X, DIRECTION_VERTICAL: Y, DIRECTION_ALL: Z, Manager: kc, Input: ab, TouchAction: Pb, TouchInput: Eb, MouseInput: rb, PointerEventInput: wb, TouchMouseInput: Gb, SingleTouchInput: Ab, Recognizer: Yb, AttrRecognizer: ac, Tap: gc, Pan: bc, Swipe: fc, Pinch: cc, Rotate: ec, Press: dc, on: t, off: u, each: m, merge: o, extend: n, inherit: p, bindFn: q, prefixed: B }), typeof define == g && define.amd ? define(function () {
|
| 1216 |
+
return hc;
|
| 1217 |
+
}) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc;
|
| 1218 |
+
}(window, document, "Hammer");;(function (factory) {
|
| 1219 |
+
if (typeof define === 'function' && define.amd) {
|
| 1220 |
+
define(['jquery', 'hammerjs'], factory);
|
| 1221 |
+
} else if (typeof exports === 'object') {
|
| 1222 |
+
factory(require('jquery'), require('hammerjs'));
|
| 1223 |
+
} else {
|
| 1224 |
+
factory(jQuery, Hammer);
|
| 1225 |
+
}
|
| 1226 |
+
})(function ($, Hammer) {
|
| 1227 |
+
function hammerify(el, options) {
|
| 1228 |
+
var $el = $(el);
|
| 1229 |
+
if (!$el.data("hammer")) {
|
| 1230 |
+
$el.data("hammer", new Hammer($el[0], options));
|
| 1231 |
+
}
|
| 1232 |
+
}
|
| 1233 |
+
|
| 1234 |
+
$.fn.hammer = function (options) {
|
| 1235 |
+
return this.each(function () {
|
| 1236 |
+
hammerify(this, options);
|
| 1237 |
+
});
|
| 1238 |
+
};
|
| 1239 |
+
|
| 1240 |
+
// extend the emit method to also trigger jQuery events
|
| 1241 |
+
Hammer.Manager.prototype.emit = function (originalEmit) {
|
| 1242 |
+
return function (type, data) {
|
| 1243 |
+
originalEmit.call(this, type, data);
|
| 1244 |
+
$(this.element).trigger({
|
| 1245 |
+
type: type,
|
| 1246 |
+
gesture: data
|
| 1247 |
+
});
|
| 1248 |
+
};
|
| 1249 |
+
}(Hammer.Manager.prototype.emit);
|
| 1250 |
+
});
|
| 1251 |
+
; // Required for Meteor package, the use of window prevents export by Meteor
|
| 1252 |
+
(function (window) {
|
| 1253 |
+
if (window.Package) {
|
| 1254 |
+
Materialize = {};
|
| 1255 |
+
} else {
|
| 1256 |
+
window.Materialize = {};
|
| 1257 |
+
}
|
| 1258 |
+
})(window);
|
| 1259 |
+
|
| 1260 |
+
if (typeof exports !== 'undefined' && !exports.nodeType) {
|
| 1261 |
+
if (typeof module !== 'undefined' && !module.nodeType && module.exports) {
|
| 1262 |
+
exports = module.exports = Materialize;
|
| 1263 |
+
}
|
| 1264 |
+
exports.default = Materialize;
|
| 1265 |
+
}
|
| 1266 |
+
|
| 1267 |
+
/*
|
| 1268 |
+
* raf.js
|
| 1269 |
+
* https://github.com/ngryman/raf.js
|
| 1270 |
+
*
|
| 1271 |
+
* original requestAnimationFrame polyfill by Erik Möller
|
| 1272 |
+
* inspired from paul_irish gist and post
|
| 1273 |
+
*
|
| 1274 |
+
* Copyright (c) 2013 ngryman
|
| 1275 |
+
* Licensed under the MIT license.
|
| 1276 |
+
*/
|
| 1277 |
+
(function (window) {
|
| 1278 |
+
var lastTime = 0,
|
| 1279 |
+
vendors = ['webkit', 'moz'],
|
| 1280 |
+
requestAnimationFrame = window.requestAnimationFrame,
|
| 1281 |
+
cancelAnimationFrame = window.cancelAnimationFrame,
|
| 1282 |
+
i = vendors.length;
|
| 1283 |
+
|
| 1284 |
+
// try to un-prefix existing raf
|
| 1285 |
+
while (--i >= 0 && !requestAnimationFrame) {
|
| 1286 |
+
requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
|
| 1287 |
+
cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
|
| 1288 |
+
}
|
| 1289 |
+
|
| 1290 |
+
// polyfill with setTimeout fallback
|
| 1291 |
+
// heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
|
| 1292 |
+
if (!requestAnimationFrame || !cancelAnimationFrame) {
|
| 1293 |
+
requestAnimationFrame = function (callback) {
|
| 1294 |
+
var now = +Date.now(),
|
| 1295 |
+
nextTime = Math.max(lastTime + 16, now);
|
| 1296 |
+
return setTimeout(function () {
|
| 1297 |
+
callback(lastTime = nextTime);
|
| 1298 |
+
}, nextTime - now);
|
| 1299 |
+
};
|
| 1300 |
+
|
| 1301 |
+
cancelAnimationFrame = clearTimeout;
|
| 1302 |
+
}
|
| 1303 |
+
|
| 1304 |
+
// export to window
|
| 1305 |
+
window.requestAnimationFrame = requestAnimationFrame;
|
| 1306 |
+
window.cancelAnimationFrame = cancelAnimationFrame;
|
| 1307 |
+
})(window);
|
| 1308 |
+
|
| 1309 |
+
/**
|
| 1310 |
+
* Generate approximated selector string for a jQuery object
|
| 1311 |
+
* @param {jQuery} obj jQuery object to be parsed
|
| 1312 |
+
* @returns {string}
|
| 1313 |
+
*/
|
| 1314 |
+
Materialize.objectSelectorString = function (obj) {
|
| 1315 |
+
var tagStr = obj.prop('tagName') || '';
|
| 1316 |
+
var idStr = obj.attr('id') || '';
|
| 1317 |
+
var classStr = obj.attr('class') || '';
|
| 1318 |
+
return (tagStr + idStr + classStr).replace(/\s/g, '');
|
| 1319 |
+
};
|
| 1320 |
+
|
| 1321 |
+
// Unique Random ID
|
| 1322 |
+
Materialize.guid = function () {
|
| 1323 |
+
function s4() {
|
| 1324 |
+
return Math.floor((1 + Math.random()) * 0x10000).toString(16).substring(1);
|
| 1325 |
+
}
|
| 1326 |
+
return function () {
|
| 1327 |
+
return s4() + s4() + '-' + s4() + '-' + s4() + '-' + s4() + '-' + s4() + s4() + s4();
|
| 1328 |
+
};
|
| 1329 |
+
}();
|
| 1330 |
+
|
| 1331 |
+
/**
|
| 1332 |
+
* Escapes hash from special characters
|
| 1333 |
+
* @param {string} hash String returned from this.hash
|
| 1334 |
+
* @returns {string}
|
| 1335 |
+
*/
|
| 1336 |
+
Materialize.escapeHash = function (hash) {
|
| 1337 |
+
return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1");
|
| 1338 |
+
};
|
| 1339 |
+
|
| 1340 |
+
Materialize.elementOrParentIsFixed = function (element) {
|
| 1341 |
+
var $element = $(element);
|
| 1342 |
+
var $checkElements = $element.add($element.parents());
|
| 1343 |
+
var isFixed = false;
|
| 1344 |
+
$checkElements.each(function () {
|
| 1345 |
+
if ($(this).css("position") === "fixed") {
|
| 1346 |
+
isFixed = true;
|
| 1347 |
+
return false;
|
| 1348 |
+
}
|
| 1349 |
+
});
|
| 1350 |
+
return isFixed;
|
| 1351 |
+
};
|
| 1352 |
+
|
| 1353 |
+
/**
|
| 1354 |
+
* Get time in ms
|
| 1355 |
+
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
|
| 1356 |
+
* @type {function}
|
| 1357 |
+
* @return {number}
|
| 1358 |
+
*/
|
| 1359 |
+
var getTime = Date.now || function () {
|
| 1360 |
+
return new Date().getTime();
|
| 1361 |
+
};
|
| 1362 |
+
|
| 1363 |
+
/**
|
| 1364 |
+
* Returns a function, that, when invoked, will only be triggered at most once
|
| 1365 |
+
* during a given window of time. Normally, the throttled function will run
|
| 1366 |
+
* as much as it can, without ever going more than once per `wait` duration;
|
| 1367 |
+
* but if you'd like to disable the execution on the leading edge, pass
|
| 1368 |
+
* `{leading: false}`. To disable execution on the trailing edge, ditto.
|
| 1369 |
+
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
|
| 1370 |
+
* @param {function} func
|
| 1371 |
+
* @param {number} wait
|
| 1372 |
+
* @param {Object=} options
|
| 1373 |
+
* @returns {Function}
|
| 1374 |
+
*/
|
| 1375 |
+
Materialize.throttle = function (func, wait, options) {
|
| 1376 |
+
var context, args, result;
|
| 1377 |
+
var timeout = null;
|
| 1378 |
+
var previous = 0;
|
| 1379 |
+
options || (options = {});
|
| 1380 |
+
var later = function () {
|
| 1381 |
+
previous = options.leading === false ? 0 : getTime();
|
| 1382 |
+
timeout = null;
|
| 1383 |
+
result = func.apply(context, args);
|
| 1384 |
+
context = args = null;
|
| 1385 |
+
};
|
| 1386 |
+
return function () {
|
| 1387 |
+
var now = getTime();
|
| 1388 |
+
if (!previous && options.leading === false) previous = now;
|
| 1389 |
+
var remaining = wait - (now - previous);
|
| 1390 |
+
context = this;
|
| 1391 |
+
args = arguments;
|
| 1392 |
+
if (remaining <= 0) {
|
| 1393 |
+
clearTimeout(timeout);
|
| 1394 |
+
timeout = null;
|
| 1395 |
+
previous = now;
|
| 1396 |
+
result = func.apply(context, args);
|
| 1397 |
+
context = args = null;
|
| 1398 |
+
} else if (!timeout && options.trailing !== false) {
|
| 1399 |
+
timeout = setTimeout(later, remaining);
|
| 1400 |
+
}
|
| 1401 |
+
return result;
|
| 1402 |
+
};
|
| 1403 |
+
};
|
| 1404 |
+
|
| 1405 |
+
// Velocity has conflicts when loaded with jQuery, this will check for it
|
| 1406 |
+
// First, check if in noConflict mode
|
| 1407 |
+
var Vel;
|
| 1408 |
+
if (jQuery) {
|
| 1409 |
+
Vel = jQuery.Velocity;
|
| 1410 |
+
} else if ($) {
|
| 1411 |
+
Vel = $.Velocity;
|
| 1412 |
+
} else {
|
| 1413 |
+
Vel = Velocity;
|
| 1414 |
+
}
|
| 1415 |
+
|
| 1416 |
+
if (Vel) {
|
| 1417 |
+
Materialize.Vel = Vel;
|
| 1418 |
+
} else {
|
| 1419 |
+
Materialize.Vel = Velocity;
|
| 1420 |
+
}
|
| 1421 |
+
;(function ($) {
|
| 1422 |
+
$.fn.collapsible = function (options, methodParam) {
|
| 1423 |
+
var defaults = {
|
| 1424 |
+
accordion: undefined,
|
| 1425 |
+
onOpen: undefined,
|
| 1426 |
+
onClose: undefined
|
| 1427 |
+
};
|
| 1428 |
+
|
| 1429 |
+
var methodName = options;
|
| 1430 |
+
options = $.extend(defaults, options);
|
| 1431 |
+
|
| 1432 |
+
return this.each(function () {
|
| 1433 |
+
|
| 1434 |
+
var $this = $(this);
|
| 1435 |
+
|
| 1436 |
+
var $panel_headers = $(this).find('> li > .collapsible-header');
|
| 1437 |
+
|
| 1438 |
+
var collapsible_type = $this.data("collapsible");
|
| 1439 |
+
|
| 1440 |
+
/****************
|
| 1441 |
+
Helper Functions
|
| 1442 |
+
****************/
|
| 1443 |
+
|
| 1444 |
+
// Accordion Open
|
| 1445 |
+
function accordionOpen(object) {
|
| 1446 |
+
$panel_headers = $this.find('> li > .collapsible-header');
|
| 1447 |
+
if (object.hasClass('active')) {
|
| 1448 |
+
object.parent().addClass('active');
|
| 1449 |
+
} else {
|
| 1450 |
+
object.parent().removeClass('active');
|
| 1451 |
+
}
|
| 1452 |
+
if (object.parent().hasClass('active')) {
|
| 1453 |
+
object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
|
| 1454 |
+
$(this).css('height', '');
|
| 1455 |
+
} });
|
| 1456 |
+
} else {
|
| 1457 |
+
object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
|
| 1458 |
+
$(this).css('height', '');
|
| 1459 |
+
} });
|
| 1460 |
+
}
|
| 1461 |
+
|
| 1462 |
+
$panel_headers.not(object).removeClass('active').parent().removeClass('active');
|
| 1463 |
+
|
| 1464 |
+
// Close previously open accordion elements.
|
| 1465 |
+
$panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () {
|
| 1466 |
+
if ($(this).is(':visible')) {
|
| 1467 |
+
$(this).slideUp({
|
| 1468 |
+
duration: 350,
|
| 1469 |
+
easing: "easeOutQuart",
|
| 1470 |
+
queue: false,
|
| 1471 |
+
complete: function () {
|
| 1472 |
+
$(this).css('height', '');
|
| 1473 |
+
execCallbacks($(this).siblings('.collapsible-header'));
|
| 1474 |
+
}
|
| 1475 |
+
});
|
| 1476 |
+
}
|
| 1477 |
+
});
|
| 1478 |
+
}
|
| 1479 |
+
|
| 1480 |
+
// Expandable Open
|
| 1481 |
+
function expandableOpen(object) {
|
| 1482 |
+
if (object.hasClass('active')) {
|
| 1483 |
+
object.parent().addClass('active');
|
| 1484 |
+
} else {
|
| 1485 |
+
object.parent().removeClass('active');
|
| 1486 |
+
}
|
| 1487 |
+
if (object.parent().hasClass('active')) {
|
| 1488 |
+
object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
|
| 1489 |
+
$(this).css('height', '');
|
| 1490 |
+
} });
|
| 1491 |
+
} else {
|
| 1492 |
+
object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
|
| 1493 |
+
$(this).css('height', '');
|
| 1494 |
+
} });
|
| 1495 |
+
}
|
| 1496 |
+
}
|
| 1497 |
+
|
| 1498 |
+
// Open collapsible. object: .collapsible-header
|
| 1499 |
+
function collapsibleOpen(object, noToggle) {
|
| 1500 |
+
if (!noToggle) {
|
| 1501 |
+
object.toggleClass('active');
|
| 1502 |
+
}
|
| 1503 |
+
|
| 1504 |
+
if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
|
| 1505 |
+
// Handle Accordion
|
| 1506 |
+
accordionOpen(object);
|
| 1507 |
+
} else {
|
| 1508 |
+
// Handle Expandables
|
| 1509 |
+
expandableOpen(object);
|
| 1510 |
+
}
|
| 1511 |
+
|
| 1512 |
+
execCallbacks(object);
|
| 1513 |
+
}
|
| 1514 |
+
|
| 1515 |
+
// Handle callbacks
|
| 1516 |
+
function execCallbacks(object) {
|
| 1517 |
+
if (object.hasClass('active')) {
|
| 1518 |
+
if (typeof options.onOpen === "function") {
|
| 1519 |
+
options.onOpen.call(this, object.parent());
|
| 1520 |
+
}
|
| 1521 |
+
} else {
|
| 1522 |
+
if (typeof options.onClose === "function") {
|
| 1523 |
+
options.onClose.call(this, object.parent());
|
| 1524 |
+
}
|
| 1525 |
+
}
|
| 1526 |
+
}
|
| 1527 |
+
|
| 1528 |
+
/**
|
| 1529 |
+
* Check if object is children of panel header
|
| 1530 |
+
* @param {Object} object Jquery object
|
| 1531 |
+
* @return {Boolean} true if it is children
|
| 1532 |
+
*/
|
| 1533 |
+
function isChildrenOfPanelHeader(object) {
|
| 1534 |
+
|
| 1535 |
+
var panelHeader = getPanelHeader(object);
|
| 1536 |
+
|
| 1537 |
+
return panelHeader.length > 0;
|
| 1538 |
+
}
|
| 1539 |
+
|
| 1540 |
+
/**
|
| 1541 |
+
* Get panel header from a children element
|
| 1542 |
+
* @param {Object} object Jquery object
|
| 1543 |
+
* @return {Object} panel header object
|
| 1544 |
+
*/
|
| 1545 |
+
function getPanelHeader(object) {
|
| 1546 |
+
|
| 1547 |
+
return object.closest('li > .collapsible-header');
|
| 1548 |
+
}
|
| 1549 |
+
|
| 1550 |
+
// Turn off any existing event handlers
|
| 1551 |
+
function removeEventHandlers() {
|
| 1552 |
+
$this.off('click.collapse', '> li > .collapsible-header');
|
| 1553 |
+
}
|
| 1554 |
+
|
| 1555 |
+
/***** End Helper Functions *****/
|
| 1556 |
+
|
| 1557 |
+
// Methods
|
| 1558 |
+
if (methodName === 'destroy') {
|
| 1559 |
+
removeEventHandlers();
|
| 1560 |
+
return;
|
| 1561 |
+
} else if (methodParam >= 0 && methodParam < $panel_headers.length) {
|
| 1562 |
+
var $curr_header = $panel_headers.eq(methodParam);
|
| 1563 |
+
if ($curr_header.length && (methodName === 'open' || methodName === 'close' && $curr_header.hasClass('active'))) {
|
| 1564 |
+
collapsibleOpen($curr_header);
|
| 1565 |
+
}
|
| 1566 |
+
return;
|
| 1567 |
+
}
|
| 1568 |
+
|
| 1569 |
+
removeEventHandlers();
|
| 1570 |
+
|
| 1571 |
+
// Add click handler to only direct collapsible header children
|
| 1572 |
+
$this.on('click.collapse', '> li > .collapsible-header', function (e) {
|
| 1573 |
+
var element = $(e.target);
|
| 1574 |
+
|
| 1575 |
+
if (isChildrenOfPanelHeader(element)) {
|
| 1576 |
+
element = getPanelHeader(element);
|
| 1577 |
+
}
|
| 1578 |
+
|
| 1579 |
+
collapsibleOpen(element);
|
| 1580 |
+
});
|
| 1581 |
+
|
| 1582 |
+
// Open first active
|
| 1583 |
+
if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
|
| 1584 |
+
// Handle Accordion
|
| 1585 |
+
collapsibleOpen($panel_headers.filter('.active').first(), true);
|
| 1586 |
+
} else {
|
| 1587 |
+
// Handle Expandables
|
| 1588 |
+
$panel_headers.filter('.active').each(function () {
|
| 1589 |
+
collapsibleOpen($(this), true);
|
| 1590 |
+
});
|
| 1591 |
+
}
|
| 1592 |
+
});
|
| 1593 |
+
};
|
| 1594 |
+
|
| 1595 |
+
$(document).ready(function () {
|
| 1596 |
+
$('.collapsible').collapsible();
|
| 1597 |
+
});
|
| 1598 |
+
})(jQuery);;(function ($) {
|
| 1599 |
+
|
| 1600 |
+
// Add posibility to scroll to selected option
|
| 1601 |
+
// usefull for select for example
|
| 1602 |
+
$.fn.scrollTo = function (elem) {
|
| 1603 |
+
$(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
|
| 1604 |
+
return this;
|
| 1605 |
+
};
|
| 1606 |
+
|
| 1607 |
+
$.fn.dropdown = function (options) {
|
| 1608 |
+
var defaults = {
|
| 1609 |
+
inDuration: 300,
|
| 1610 |
+
outDuration: 225,
|
| 1611 |
+
constrainWidth: true, // Constrains width of dropdown to the activator
|
| 1612 |
+
hover: false,
|
| 1613 |
+
gutter: 0, // Spacing from edge
|
| 1614 |
+
belowOrigin: false,
|
| 1615 |
+
alignment: 'left',
|
| 1616 |
+
stopPropagation: false
|
| 1617 |
+
};
|
| 1618 |
+
|
| 1619 |
+
// Open dropdown.
|
| 1620 |
+
if (options === "open") {
|
| 1621 |
+
this.each(function () {
|
| 1622 |
+
$(this).trigger('open');
|
| 1623 |
+
});
|
| 1624 |
+
return false;
|
| 1625 |
+
}
|
| 1626 |
+
|
| 1627 |
+
// Close dropdown.
|
| 1628 |
+
if (options === "close") {
|
| 1629 |
+
this.each(function () {
|
| 1630 |
+
$(this).trigger('close');
|
| 1631 |
+
});
|
| 1632 |
+
return false;
|
| 1633 |
+
}
|
| 1634 |
+
|
| 1635 |
+
this.each(function () {
|
| 1636 |
+
var origin = $(this);
|
| 1637 |
+
var curr_options = $.extend({}, defaults, options);
|
| 1638 |
+
var isFocused = false;
|
| 1639 |
+
|
| 1640 |
+
// Dropdown menu
|
| 1641 |
+
var activates = $("#" + origin.attr('data-activates'));
|
| 1642 |
+
|
| 1643 |
+
function updateOptions() {
|
| 1644 |
+
if (origin.data('induration') !== undefined) curr_options.inDuration = origin.data('induration');
|
| 1645 |
+
if (origin.data('outduration') !== undefined) curr_options.outDuration = origin.data('outduration');
|
| 1646 |
+
if (origin.data('constrainwidth') !== undefined) curr_options.constrainWidth = origin.data('constrainwidth');
|
| 1647 |
+
if (origin.data('hover') !== undefined) curr_options.hover = origin.data('hover');
|
| 1648 |
+
if (origin.data('gutter') !== undefined) curr_options.gutter = origin.data('gutter');
|
| 1649 |
+
if (origin.data('beloworigin') !== undefined) curr_options.belowOrigin = origin.data('beloworigin');
|
| 1650 |
+
if (origin.data('alignment') !== undefined) curr_options.alignment = origin.data('alignment');
|
| 1651 |
+
if (origin.data('stoppropagation') !== undefined) curr_options.stopPropagation = origin.data('stoppropagation');
|
| 1652 |
+
}
|
| 1653 |
+
|
| 1654 |
+
updateOptions();
|
| 1655 |
+
|
| 1656 |
+
// Attach dropdown to its activator
|
| 1657 |
+
origin.after(activates);
|
| 1658 |
+
|
| 1659 |
+
/*
|
| 1660 |
+
Helper function to position and resize dropdown.
|
| 1661 |
+
Used in hover and click handler.
|
| 1662 |
+
*/
|
| 1663 |
+
function placeDropdown(eventType) {
|
| 1664 |
+
// Check for simultaneous focus and click events.
|
| 1665 |
+
if (eventType === 'focus') {
|
| 1666 |
+
isFocused = true;
|
| 1667 |
+
}
|
| 1668 |
+
|
| 1669 |
+
// Check html data attributes
|
| 1670 |
+
updateOptions();
|
| 1671 |
+
|
| 1672 |
+
// Set Dropdown state
|
| 1673 |
+
activates.addClass('active');
|
| 1674 |
+
origin.addClass('active');
|
| 1675 |
+
|
| 1676 |
+
var originWidth = origin[0].getBoundingClientRect().width;
|
| 1677 |
+
|
| 1678 |
+
// Constrain width
|
| 1679 |
+
if (curr_options.constrainWidth === true) {
|
| 1680 |
+
activates.css('width', originWidth);
|
| 1681 |
+
} else {
|
| 1682 |
+
activates.css('white-space', 'nowrap');
|
| 1683 |
+
}
|
| 1684 |
+
|
| 1685 |
+
// Offscreen detection
|
| 1686 |
+
var windowHeight = window.innerHeight;
|
| 1687 |
+
var originHeight = origin.innerHeight();
|
| 1688 |
+
var offsetLeft = origin.offset().left;
|
| 1689 |
+
var offsetTop = origin.offset().top - $(window).scrollTop();
|
| 1690 |
+
var currAlignment = curr_options.alignment;
|
| 1691 |
+
var gutterSpacing = 0;
|
| 1692 |
+
var leftPosition = 0;
|
| 1693 |
+
|
| 1694 |
+
// Below Origin
|
| 1695 |
+
var verticalOffset = 0;
|
| 1696 |
+
if (curr_options.belowOrigin === true) {
|
| 1697 |
+
verticalOffset = originHeight;
|
| 1698 |
+
}
|
| 1699 |
+
|
| 1700 |
+
// Check for scrolling positioned container.
|
| 1701 |
+
var scrollYOffset = 0;
|
| 1702 |
+
var scrollXOffset = 0;
|
| 1703 |
+
var wrapper = origin.parent();
|
| 1704 |
+
if (!wrapper.is('body')) {
|
| 1705 |
+
if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
|
| 1706 |
+
scrollYOffset = wrapper[0].scrollTop;
|
| 1707 |
+
}
|
| 1708 |
+
if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
|
| 1709 |
+
scrollXOffset = wrapper[0].scrollLeft;
|
| 1710 |
+
}
|
| 1711 |
+
}
|
| 1712 |
+
|
| 1713 |
+
if (offsetLeft + activates.innerWidth() > $(window).width()) {
|
| 1714 |
+
// Dropdown goes past screen on right, force right alignment
|
| 1715 |
+
currAlignment = 'right';
|
| 1716 |
+
} else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
|
| 1717 |
+
// Dropdown goes past screen on left, force left alignment
|
| 1718 |
+
currAlignment = 'left';
|
| 1719 |
+
}
|
| 1720 |
+
// Vertical bottom offscreen detection
|
| 1721 |
+
if (offsetTop + activates.innerHeight() > windowHeight) {
|
| 1722 |
+
// If going upwards still goes offscreen, just crop height of dropdown.
|
| 1723 |
+
if (offsetTop + originHeight - activates.innerHeight() < 0) {
|
| 1724 |
+
var adjustedHeight = windowHeight - offsetTop - verticalOffset;
|
| 1725 |
+
activates.css('max-height', adjustedHeight);
|
| 1726 |
+
} else {
|
| 1727 |
+
// Flow upwards.
|
| 1728 |
+
if (!verticalOffset) {
|
| 1729 |
+
verticalOffset += originHeight;
|
| 1730 |
+
}
|
| 1731 |
+
verticalOffset -= activates.innerHeight();
|
| 1732 |
+
}
|
| 1733 |
+
}
|
| 1734 |
+
|
| 1735 |
+
// Handle edge alignment
|
| 1736 |
+
if (currAlignment === 'left') {
|
| 1737 |
+
gutterSpacing = curr_options.gutter;
|
| 1738 |
+
leftPosition = origin.position().left + gutterSpacing;
|
| 1739 |
+
} else if (currAlignment === 'right') {
|
| 1740 |
+
// Material icons fix
|
| 1741 |
+
activates.stop(true, true).css({
|
| 1742 |
+
opacity: 0,
|
| 1743 |
+
left: 0
|
| 1744 |
+
});
|
| 1745 |
+
|
| 1746 |
+
var offsetRight = origin.position().left + originWidth - activates.width();
|
| 1747 |
+
gutterSpacing = -curr_options.gutter;
|
| 1748 |
+
leftPosition = offsetRight + gutterSpacing;
|
| 1749 |
+
}
|
| 1750 |
+
|
| 1751 |
+
// Position dropdown
|
| 1752 |
+
activates.css({
|
| 1753 |
+
position: 'absolute',
|
| 1754 |
+
top: origin.position().top + verticalOffset + scrollYOffset,
|
| 1755 |
+
left: leftPosition + scrollXOffset
|
| 1756 |
+
});
|
| 1757 |
+
|
| 1758 |
+
// Show dropdown
|
| 1759 |
+
activates.slideDown({
|
| 1760 |
+
queue: false,
|
| 1761 |
+
duration: curr_options.inDuration,
|
| 1762 |
+
easing: 'easeOutCubic',
|
| 1763 |
+
complete: function () {
|
| 1764 |
+
$(this).css('height', '');
|
| 1765 |
+
}
|
| 1766 |
+
}).animate({ opacity: 1 }, { queue: false, duration: curr_options.inDuration, easing: 'easeOutSine' });
|
| 1767 |
+
|
| 1768 |
+
// Add click close handler to document
|
| 1769 |
+
setTimeout(function () {
|
| 1770 |
+
$(document).on('click.' + activates.attr('id'), function (e) {
|
| 1771 |
+
hideDropdown();
|
| 1772 |
+
$(document).off('click.' + activates.attr('id'));
|
| 1773 |
+
});
|
| 1774 |
+
}, 0);
|
| 1775 |
+
}
|
| 1776 |
+
|
| 1777 |
+
function hideDropdown() {
|
| 1778 |
+
// Check for simultaneous focus and click events.
|
| 1779 |
+
isFocused = false;
|
| 1780 |
+
activates.fadeOut(curr_options.outDuration);
|
| 1781 |
+
activates.removeClass('active');
|
| 1782 |
+
origin.removeClass('active');
|
| 1783 |
+
$(document).off('click.' + activates.attr('id'));
|
| 1784 |
+
setTimeout(function () {
|
| 1785 |
+
activates.css('max-height', '');
|
| 1786 |
+
}, curr_options.outDuration);
|
| 1787 |
+
}
|
| 1788 |
+
|
| 1789 |
+
// Hover
|
| 1790 |
+
if (curr_options.hover) {
|
| 1791 |
+
var open = false;
|
| 1792 |
+
origin.off('click.' + origin.attr('id'));
|
| 1793 |
+
// Hover handler to show dropdown
|
| 1794 |
+
origin.on('mouseenter', function (e) {
|
| 1795 |
+
// Mouse over
|
| 1796 |
+
if (open === false) {
|
| 1797 |
+
placeDropdown();
|
| 1798 |
+
open = true;
|
| 1799 |
+
}
|
| 1800 |
+
});
|
| 1801 |
+
origin.on('mouseleave', function (e) {
|
| 1802 |
+
// If hover on origin then to something other than dropdown content, then close
|
| 1803 |
+
var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
|
| 1804 |
+
if (!$(toEl).closest('.dropdown-content').is(activates)) {
|
| 1805 |
+
activates.stop(true, true);
|
| 1806 |
+
hideDropdown();
|
| 1807 |
+
open = false;
|
| 1808 |
+
}
|
| 1809 |
+
});
|
| 1810 |
+
|
| 1811 |
+
activates.on('mouseleave', function (e) {
|
| 1812 |
+
// Mouse out
|
| 1813 |
+
var toEl = e.toElement || e.relatedTarget;
|
| 1814 |
+
if (!$(toEl).closest('.dropdown-button').is(origin)) {
|
| 1815 |
+
activates.stop(true, true);
|
| 1816 |
+
hideDropdown();
|
| 1817 |
+
open = false;
|
| 1818 |
+
}
|
| 1819 |
+
});
|
| 1820 |
+
|
| 1821 |
+
// Click
|
| 1822 |
+
} else {
|
| 1823 |
+
// Click handler to show dropdown
|
| 1824 |
+
origin.off('click.' + origin.attr('id'));
|
| 1825 |
+
origin.on('click.' + origin.attr('id'), function (e) {
|
| 1826 |
+
if (!isFocused) {
|
| 1827 |
+
if (origin[0] == e.currentTarget && !origin.hasClass('active') && $(e.target).closest('.dropdown-content').length === 0) {
|
| 1828 |
+
e.preventDefault(); // Prevents button click from moving window
|
| 1829 |
+
if (curr_options.stopPropagation) {
|
| 1830 |
+
e.stopPropagation();
|
| 1831 |
+
}
|
| 1832 |
+
placeDropdown('click');
|
| 1833 |
+
}
|
| 1834 |
+
// If origin is clicked and menu is open, close menu
|
| 1835 |
+
else if (origin.hasClass('active')) {
|
| 1836 |
+
hideDropdown();
|
| 1837 |
+
$(document).off('click.' + activates.attr('id'));
|
| 1838 |
+
}
|
| 1839 |
+
}
|
| 1840 |
+
});
|
| 1841 |
+
} // End else
|
| 1842 |
+
|
| 1843 |
+
// Listen to open and close event - useful for select component
|
| 1844 |
+
origin.on('open', function (e, eventType) {
|
| 1845 |
+
placeDropdown(eventType);
|
| 1846 |
+
});
|
| 1847 |
+
origin.on('close', hideDropdown);
|
| 1848 |
+
});
|
| 1849 |
+
}; // End dropdown plugin
|
| 1850 |
+
|
| 1851 |
+
$(document).ready(function () {
|
| 1852 |
+
$('.dropdown-button').dropdown();
|
| 1853 |
+
});
|
| 1854 |
+
})(jQuery);
|
| 1855 |
+
;(function ($, Vel) {
|
| 1856 |
+
'use strict';
|
| 1857 |
+
|
| 1858 |
+
var _defaults = {
|
| 1859 |
+
opacity: 0.5,
|
| 1860 |
+
inDuration: 250,
|
| 1861 |
+
outDuration: 250,
|
| 1862 |
+
ready: undefined,
|
| 1863 |
+
complete: undefined,
|
| 1864 |
+
dismissible: true,
|
| 1865 |
+
startingTop: '4%',
|
| 1866 |
+
endingTop: '10%'
|
| 1867 |
+
};
|
| 1868 |
+
|
| 1869 |
+
/**
|
| 1870 |
+
* @class
|
| 1871 |
+
*
|
| 1872 |
+
*/
|
| 1873 |
+
|
| 1874 |
+
var Modal = function () {
|
| 1875 |
+
/**
|
| 1876 |
+
* Construct Modal instance and set up overlay
|
| 1877 |
+
* @constructor
|
| 1878 |
+
* @param {jQuery} $el
|
| 1879 |
+
* @param {Object} options
|
| 1880 |
+
*/
|
| 1881 |
+
function Modal($el, options) {
|
| 1882 |
+
_classCallCheck(this, Modal);
|
| 1883 |
+
|
| 1884 |
+
// If exists, destroy and reinitialize
|
| 1885 |
+
if (!!$el[0].M_Modal) {
|
| 1886 |
+
$el[0].M_Modal.destroy();
|
| 1887 |
+
}
|
| 1888 |
+
|
| 1889 |
+
/**
|
| 1890 |
+
* The jQuery element
|
| 1891 |
+
* @type {jQuery}
|
| 1892 |
+
*/
|
| 1893 |
+
this.$el = $el;
|
| 1894 |
+
|
| 1895 |
+
/**
|
| 1896 |
+
* Options for the modal
|
| 1897 |
+
* @member Modal#options
|
| 1898 |
+
* @prop {Number} [opacity=0.5] - Opacity of the modal overlay
|
| 1899 |
+
* @prop {Number} [inDuration=250] - Length in ms of enter transition
|
| 1900 |
+
* @prop {Number} [outDuration=250] - Length in ms of exit transition
|
| 1901 |
+
* @prop {Function} ready - Callback function called when modal is finished entering
|
| 1902 |
+
* @prop {Function} complete - Callback function called when modal is finished exiting
|
| 1903 |
+
* @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click
|
| 1904 |
+
* @prop {String} [startingTop='4%'] - startingTop
|
| 1905 |
+
* @prop {String} [endingTop='10%'] - endingTop
|
| 1906 |
+
*/
|
| 1907 |
+
this.options = $.extend({}, Modal.defaults, options);
|
| 1908 |
+
|
| 1909 |
+
/**
|
| 1910 |
+
* Describes open/close state of modal
|
| 1911 |
+
* @type {Boolean}
|
| 1912 |
+
*/
|
| 1913 |
+
this.isOpen = false;
|
| 1914 |
+
|
| 1915 |
+
this.$el[0].M_Modal = this;
|
| 1916 |
+
this.id = $el.attr('id');
|
| 1917 |
+
this.openingTrigger = undefined;
|
| 1918 |
+
this.$overlay = $('<div class="modal-overlay"></div>');
|
| 1919 |
+
|
| 1920 |
+
Modal._increment++;
|
| 1921 |
+
Modal._count++;
|
| 1922 |
+
this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2;
|
| 1923 |
+
this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1;
|
| 1924 |
+
this.setupEventHandlers();
|
| 1925 |
+
}
|
| 1926 |
+
|
| 1927 |
+
_createClass(Modal, [{
|
| 1928 |
+
key: 'getInstance',
|
| 1929 |
+
|
| 1930 |
+
|
| 1931 |
+
/**
|
| 1932 |
+
* Get Instance
|
| 1933 |
+
*/
|
| 1934 |
+
value: function getInstance() {
|
| 1935 |
+
return this;
|
| 1936 |
+
}
|
| 1937 |
+
|
| 1938 |
+
/**
|
| 1939 |
+
* Teardown component
|
| 1940 |
+
*/
|
| 1941 |
+
|
| 1942 |
+
}, {
|
| 1943 |
+
key: 'destroy',
|
| 1944 |
+
value: function destroy() {
|
| 1945 |
+
this.removeEventHandlers();
|
| 1946 |
+
this.$el[0].removeAttribute('style');
|
| 1947 |
+
if (!!this.$overlay[0].parentNode) {
|
| 1948 |
+
this.$overlay[0].parentNode.removeChild(this.$overlay[0]);
|
| 1949 |
+
}
|
| 1950 |
+
this.$el[0].M_Modal = undefined;
|
| 1951 |
+
Modal._count--;
|
| 1952 |
+
}
|
| 1953 |
+
|
| 1954 |
+
/**
|
| 1955 |
+
* Setup Event Handlers
|
| 1956 |
+
*/
|
| 1957 |
+
|
| 1958 |
+
}, {
|
| 1959 |
+
key: 'setupEventHandlers',
|
| 1960 |
+
value: function setupEventHandlers() {
|
| 1961 |
+
this.handleOverlayClickBound = this.handleOverlayClick.bind(this);
|
| 1962 |
+
this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this);
|
| 1963 |
+
|
| 1964 |
+
if (Modal._count === 1) {
|
| 1965 |
+
document.body.addEventListener('click', this.handleTriggerClick);
|
| 1966 |
+
}
|
| 1967 |
+
this.$overlay[0].addEventListener('click', this.handleOverlayClickBound);
|
| 1968 |
+
this.$el[0].addEventListener('click', this.handleModalCloseClickBound);
|
| 1969 |
+
}
|
| 1970 |
+
|
| 1971 |
+
/**
|
| 1972 |
+
* Remove Event Handlers
|
| 1973 |
+
*/
|
| 1974 |
+
|
| 1975 |
+
}, {
|
| 1976 |
+
key: 'removeEventHandlers',
|
| 1977 |
+
value: function removeEventHandlers() {
|
| 1978 |
+
if (Modal._count === 0) {
|
| 1979 |
+
document.body.removeEventListener('click', this.handleTriggerClick);
|
| 1980 |
+
}
|
| 1981 |
+
this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound);
|
| 1982 |
+
this.$el[0].removeEventListener('click', this.handleModalCloseClickBound);
|
| 1983 |
+
}
|
| 1984 |
+
|
| 1985 |
+
/**
|
| 1986 |
+
* Handle Trigger Click
|
| 1987 |
+
* @param {Event} e
|
| 1988 |
+
*/
|
| 1989 |
+
|
| 1990 |
+
}, {
|
| 1991 |
+
key: 'handleTriggerClick',
|
| 1992 |
+
value: function handleTriggerClick(e) {
|
| 1993 |
+
var $trigger = $(e.target).closest('.modal-trigger');
|
| 1994 |
+
if (e.target && $trigger.length) {
|
| 1995 |
+
var modalId = $trigger[0].getAttribute('href');
|
| 1996 |
+
if (modalId) {
|
| 1997 |
+
modalId = modalId.slice(1);
|
| 1998 |
+
} else {
|
| 1999 |
+
modalId = $trigger[0].getAttribute('data-target');
|
| 2000 |
+
}
|
| 2001 |
+
var modalInstance = document.getElementById(modalId).M_Modal;
|
| 2002 |
+
if (modalInstance) {
|
| 2003 |
+
modalInstance.open($trigger);
|
| 2004 |
+
}
|
| 2005 |
+
e.preventDefault();
|
| 2006 |
+
}
|
| 2007 |
+
}
|
| 2008 |
+
|
| 2009 |
+
/**
|
| 2010 |
+
* Handle Overlay Click
|
| 2011 |
+
*/
|
| 2012 |
+
|
| 2013 |
+
}, {
|
| 2014 |
+
key: 'handleOverlayClick',
|
| 2015 |
+
value: function handleOverlayClick() {
|
| 2016 |
+
if (this.options.dismissible) {
|
| 2017 |
+
this.close();
|
| 2018 |
+
}
|
| 2019 |
+
}
|
| 2020 |
+
|
| 2021 |
+
/**
|
| 2022 |
+
* Handle Modal Close Click
|
| 2023 |
+
* @param {Event} e
|
| 2024 |
+
*/
|
| 2025 |
+
|
| 2026 |
+
}, {
|
| 2027 |
+
key: 'handleModalCloseClick',
|
| 2028 |
+
value: function handleModalCloseClick(e) {
|
| 2029 |
+
var $closeTrigger = $(e.target).closest('.modal-close');
|
| 2030 |
+
if (e.target && $closeTrigger.length) {
|
| 2031 |
+
this.close();
|
| 2032 |
+
}
|
| 2033 |
+
}
|
| 2034 |
+
|
| 2035 |
+
/**
|
| 2036 |
+
* Handle Keydown
|
| 2037 |
+
* @param {Event} e
|
| 2038 |
+
*/
|
| 2039 |
+
|
| 2040 |
+
}, {
|
| 2041 |
+
key: 'handleKeydown',
|
| 2042 |
+
value: function handleKeydown(e) {
|
| 2043 |
+
// ESC key
|
| 2044 |
+
if (e.keyCode === 27 && this.options.dismissible) {
|
| 2045 |
+
this.close();
|
| 2046 |
+
}
|
| 2047 |
+
}
|
| 2048 |
+
|
| 2049 |
+
/**
|
| 2050 |
+
* Animate in modal
|
| 2051 |
+
*/
|
| 2052 |
+
|
| 2053 |
+
}, {
|
| 2054 |
+
key: 'animateIn',
|
| 2055 |
+
value: function animateIn() {
|
| 2056 |
+
var _this = this;
|
| 2057 |
+
|
| 2058 |
+
// Set initial styles
|
| 2059 |
+
$.extend(this.$el[0].style, {
|
| 2060 |
+
display: 'block',
|
| 2061 |
+
opacity: 0
|
| 2062 |
+
});
|
| 2063 |
+
$.extend(this.$overlay[0].style, {
|
| 2064 |
+
display: 'block',
|
| 2065 |
+
opacity: 0
|
| 2066 |
+
});
|
| 2067 |
+
|
| 2068 |
+
// Animate overlay
|
| 2069 |
+
Vel(this.$overlay[0], { opacity: this.options.opacity }, { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic' });
|
| 2070 |
+
|
| 2071 |
+
// Define modal animation options
|
| 2072 |
+
var enterVelocityOptions = {
|
| 2073 |
+
duration: this.options.inDuration,
|
| 2074 |
+
queue: false,
|
| 2075 |
+
ease: 'easeOutCubic',
|
| 2076 |
+
// Handle modal ready callback
|
| 2077 |
+
complete: function () {
|
| 2078 |
+
if (typeof _this.options.ready === 'function') {
|
| 2079 |
+
_this.options.ready.call(_this, _this.$el, _this.openingTrigger);
|
| 2080 |
+
}
|
| 2081 |
+
}
|
| 2082 |
+
};
|
| 2083 |
+
|
| 2084 |
+
// Bottom sheet animation
|
| 2085 |
+
if (this.$el[0].classList.contains('bottom-sheet')) {
|
| 2086 |
+
Vel(this.$el[0], { bottom: 0, opacity: 1 }, enterVelocityOptions);
|
| 2087 |
+
|
| 2088 |
+
// Normal modal animation
|
| 2089 |
+
} else {
|
| 2090 |
+
Vel.hook(this.$el[0], 'scaleX', 0.7);
|
| 2091 |
+
this.$el[0].style.top = this.options.startingTop;
|
| 2092 |
+
Vel(this.$el[0], { top: this.options.endingTop, opacity: 1, scaleX: 1 }, enterVelocityOptions);
|
| 2093 |
+
}
|
| 2094 |
+
}
|
| 2095 |
+
|
| 2096 |
+
/**
|
| 2097 |
+
* Animate out modal
|
| 2098 |
+
*/
|
| 2099 |
+
|
| 2100 |
+
}, {
|
| 2101 |
+
key: 'animateOut',
|
| 2102 |
+
value: function animateOut() {
|
| 2103 |
+
var _this2 = this;
|
| 2104 |
+
|
| 2105 |
+
// Animate overlay
|
| 2106 |
+
Vel(this.$overlay[0], { opacity: 0 }, { duration: this.options.outDuration, queue: false, ease: 'easeOutQuart' });
|
| 2107 |
+
|
| 2108 |
+
// Define modal animation options
|
| 2109 |
+
var exitVelocityOptions = {
|
| 2110 |
+
duration: this.options.outDuration,
|
| 2111 |
+
queue: false,
|
| 2112 |
+
ease: 'easeOutCubic',
|
| 2113 |
+
// Handle modal ready callback
|
| 2114 |
+
complete: function () {
|
| 2115 |
+
_this2.$el[0].style.display = 'none';
|
| 2116 |
+
// Call complete callback
|
| 2117 |
+
if (typeof _this2.options.complete === 'function') {
|
| 2118 |
+
_this2.options.complete.call(_this2, _this2.$el);
|
| 2119 |
+
}
|
| 2120 |
+
_this2.$overlay[0].parentNode.removeChild(_this2.$overlay[0]);
|
| 2121 |
+
}
|
| 2122 |
+
};
|
| 2123 |
+
|
| 2124 |
+
// Bottom sheet animation
|
| 2125 |
+
if (this.$el[0].classList.contains('bottom-sheet')) {
|
| 2126 |
+
Vel(this.$el[0], { bottom: '-100%', opacity: 0 }, exitVelocityOptions);
|
| 2127 |
+
|
| 2128 |
+
// Normal modal animation
|
| 2129 |
+
} else {
|
| 2130 |
+
Vel(this.$el[0], { top: this.options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions);
|
| 2131 |
+
}
|
| 2132 |
+
}
|
| 2133 |
+
|
| 2134 |
+
/**
|
| 2135 |
+
* Open Modal
|
| 2136 |
+
* @param {jQuery} [$trigger]
|
| 2137 |
+
*/
|
| 2138 |
+
|
| 2139 |
+
}, {
|
| 2140 |
+
key: 'open',
|
| 2141 |
+
value: function open($trigger) {
|
| 2142 |
+
if (this.isOpen) {
|
| 2143 |
+
return;
|
| 2144 |
+
}
|
| 2145 |
+
|
| 2146 |
+
this.isOpen = true;
|
| 2147 |
+
var body = document.body;
|
| 2148 |
+
body.style.overflow = 'hidden';
|
| 2149 |
+
this.$el[0].classList.add('open');
|
| 2150 |
+
body.appendChild(this.$overlay[0]);
|
| 2151 |
+
|
| 2152 |
+
// Set opening trigger, undefined indicates modal was opened by javascript
|
| 2153 |
+
this.openingTrigger = !!$trigger ? $trigger : undefined;
|
| 2154 |
+
|
| 2155 |
+
if (this.options.dismissible) {
|
| 2156 |
+
this.handleKeydownBound = this.handleKeydown.bind(this);
|
| 2157 |
+
document.addEventListener('keydown', this.handleKeydownBound);
|
| 2158 |
+
}
|
| 2159 |
+
|
| 2160 |
+
this.animateIn();
|
| 2161 |
+
|
| 2162 |
+
return this;
|
| 2163 |
+
}
|
| 2164 |
+
|
| 2165 |
+
/**
|
| 2166 |
+
* Close Modal
|
| 2167 |
+
*/
|
| 2168 |
+
|
| 2169 |
+
}, {
|
| 2170 |
+
key: 'close',
|
| 2171 |
+
value: function close() {
|
| 2172 |
+
if (!this.isOpen) {
|
| 2173 |
+
return;
|
| 2174 |
+
}
|
| 2175 |
+
|
| 2176 |
+
this.isOpen = false;
|
| 2177 |
+
this.$el[0].classList.remove('open');
|
| 2178 |
+
document.body.style.overflow = '';
|
| 2179 |
+
|
| 2180 |
+
if (this.options.dismissible) {
|
| 2181 |
+
document.removeEventListener('keydown', this.handleKeydownBound);
|
| 2182 |
+
}
|
| 2183 |
+
|
| 2184 |
+
this.animateOut();
|
| 2185 |
+
|
| 2186 |
+
return this;
|
| 2187 |
+
}
|
| 2188 |
+
}], [{
|
| 2189 |
+
key: 'init',
|
| 2190 |
+
value: function init($els, options) {
|
| 2191 |
+
var arr = [];
|
| 2192 |
+
$els.each(function () {
|
| 2193 |
+
arr.push(new Modal($(this), options));
|
| 2194 |
+
});
|
| 2195 |
+
return arr;
|
| 2196 |
+
}
|
| 2197 |
+
}, {
|
| 2198 |
+
key: 'defaults',
|
| 2199 |
+
get: function () {
|
| 2200 |
+
return _defaults;
|
| 2201 |
+
}
|
| 2202 |
+
}]);
|
| 2203 |
+
|
| 2204 |
+
return Modal;
|
| 2205 |
+
}();
|
| 2206 |
+
|
| 2207 |
+
/**
|
| 2208 |
+
* @static
|
| 2209 |
+
* @memberof Modal
|
| 2210 |
+
*/
|
| 2211 |
+
|
| 2212 |
+
|
| 2213 |
+
Modal._increment = 0;
|
| 2214 |
+
|
| 2215 |
+
/**
|
| 2216 |
+
* @static
|
| 2217 |
+
* @memberof Modal
|
| 2218 |
+
*/
|
| 2219 |
+
Modal._count = 0;
|
| 2220 |
+
|
| 2221 |
+
Materialize.Modal = Modal;
|
| 2222 |
+
|
| 2223 |
+
$.fn.modal = function (methodOrOptions) {
|
| 2224 |
+
// Call plugin method if valid method name is passed in
|
| 2225 |
+
if (Modal.prototype[methodOrOptions]) {
|
| 2226 |
+
// Getter methods
|
| 2227 |
+
if (methodOrOptions.slice(0, 3) === 'get') {
|
| 2228 |
+
return this.first()[0].M_Modal[methodOrOptions]();
|
| 2229 |
+
|
| 2230 |
+
// Void methods
|
| 2231 |
+
} else {
|
| 2232 |
+
return this.each(function () {
|
| 2233 |
+
this.M_Modal[methodOrOptions]();
|
| 2234 |
+
});
|
| 2235 |
+
}
|
| 2236 |
+
|
| 2237 |
+
// Initialize plugin if options or no argument is passed in
|
| 2238 |
+
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
|
| 2239 |
+
Modal.init(this, arguments[0]);
|
| 2240 |
+
return this;
|
| 2241 |
+
|
| 2242 |
+
// Return error if an unrecognized method name is passed in
|
| 2243 |
+
} else {
|
| 2244 |
+
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal');
|
| 2245 |
+
}
|
| 2246 |
+
};
|
| 2247 |
+
})(jQuery, Materialize.Vel);
|
| 2248 |
+
;(function ($) {
|
| 2249 |
+
|
| 2250 |
+
$.fn.materialbox = function () {
|
| 2251 |
+
|
| 2252 |
+
return this.each(function () {
|
| 2253 |
+
|
| 2254 |
+
if ($(this).hasClass('initialized')) {
|
| 2255 |
+
return;
|
| 2256 |
+
}
|
| 2257 |
+
|
| 2258 |
+
$(this).addClass('initialized');
|
| 2259 |
+
|
| 2260 |
+
var overlayActive = false;
|
| 2261 |
+
var doneAnimating = true;
|
| 2262 |
+
var inDuration = 275;
|
| 2263 |
+
var outDuration = 200;
|
| 2264 |
+
var origin = $(this);
|
| 2265 |
+
var placeholder = $('<div></div>').addClass('material-placeholder');
|
| 2266 |
+
var originalWidth = 0;
|
| 2267 |
+
var originalHeight = 0;
|
| 2268 |
+
var ancestorsChanged;
|
| 2269 |
+
var ancestor;
|
| 2270 |
+
var originInlineStyles = origin.attr('style');
|
| 2271 |
+
origin.wrap(placeholder);
|
| 2272 |
+
|
| 2273 |
+
// Start click handler
|
| 2274 |
+
origin.on('click', function () {
|
| 2275 |
+
var placeholder = origin.parent('.material-placeholder');
|
| 2276 |
+
var windowWidth = window.innerWidth;
|
| 2277 |
+
var windowHeight = window.innerHeight;
|
| 2278 |
+
var originalWidth = origin.width();
|
| 2279 |
+
var originalHeight = origin.height();
|
| 2280 |
+
|
| 2281 |
+
// If already modal, return to original
|
| 2282 |
+
if (doneAnimating === false) {
|
| 2283 |
+
returnToOriginal();
|
| 2284 |
+
return false;
|
| 2285 |
+
} else if (overlayActive && doneAnimating === true) {
|
| 2286 |
+
returnToOriginal();
|
| 2287 |
+
return false;
|
| 2288 |
+
}
|
| 2289 |
+
|
| 2290 |
+
// Set states
|
| 2291 |
+
doneAnimating = false;
|
| 2292 |
+
origin.addClass('active');
|
| 2293 |
+
overlayActive = true;
|
| 2294 |
+
|
| 2295 |
+
// Set positioning for placeholder
|
| 2296 |
+
placeholder.css({
|
| 2297 |
+
width: placeholder[0].getBoundingClientRect().width,
|
| 2298 |
+
height: placeholder[0].getBoundingClientRect().height,
|
| 2299 |
+
position: 'relative',
|
| 2300 |
+
top: 0,
|
| 2301 |
+
left: 0
|
| 2302 |
+
});
|
| 2303 |
+
|
| 2304 |
+
// Find ancestor with overflow: hidden; and remove it
|
| 2305 |
+
ancestorsChanged = undefined;
|
| 2306 |
+
ancestor = placeholder[0].parentNode;
|
| 2307 |
+
var count = 0;
|
| 2308 |
+
while (ancestor !== null && !$(ancestor).is(document)) {
|
| 2309 |
+
var curr = $(ancestor);
|
| 2310 |
+
if (curr.css('overflow') !== 'visible') {
|
| 2311 |
+
curr.css('overflow', 'visible');
|
| 2312 |
+
if (ancestorsChanged === undefined) {
|
| 2313 |
+
ancestorsChanged = curr;
|
| 2314 |
+
} else {
|
| 2315 |
+
ancestorsChanged = ancestorsChanged.add(curr);
|
| 2316 |
+
}
|
| 2317 |
+
}
|
| 2318 |
+
ancestor = ancestor.parentNode;
|
| 2319 |
+
}
|
| 2320 |
+
|
| 2321 |
+
// Set css on origin
|
| 2322 |
+
origin.css({
|
| 2323 |
+
position: 'absolute',
|
| 2324 |
+
'z-index': 1000,
|
| 2325 |
+
'will-change': 'left, top, width, height'
|
| 2326 |
+
}).data('width', originalWidth).data('height', originalHeight);
|
| 2327 |
+
|
| 2328 |
+
// Add overlay
|
| 2329 |
+
var overlay = $('<div id="materialbox-overlay"></div>').css({
|
| 2330 |
+
opacity: 0
|
| 2331 |
+
}).click(function () {
|
| 2332 |
+
if (doneAnimating === true) returnToOriginal();
|
| 2333 |
+
});
|
| 2334 |
+
|
| 2335 |
+
// Put before in origin image to preserve z-index layering.
|
| 2336 |
+
origin.before(overlay);
|
| 2337 |
+
|
| 2338 |
+
// Set dimensions if needed
|
| 2339 |
+
var overlayOffset = overlay[0].getBoundingClientRect();
|
| 2340 |
+
overlay.css({
|
| 2341 |
+
width: windowWidth,
|
| 2342 |
+
height: windowHeight,
|
| 2343 |
+
left: -1 * overlayOffset.left,
|
| 2344 |
+
top: -1 * overlayOffset.top
|
| 2345 |
+
});
|
| 2346 |
+
|
| 2347 |
+
// Animate Overlay
|
| 2348 |
+
overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
|
| 2349 |
+
|
| 2350 |
+
// Add and animate caption if it exists
|
| 2351 |
+
if (origin.data('caption') !== "") {
|
| 2352 |
+
var $photo_caption = $('<div class="materialbox-caption"></div>');
|
| 2353 |
+
$photo_caption.text(origin.data('caption'));
|
| 2354 |
+
$('body').append($photo_caption);
|
| 2355 |
+
$photo_caption.css({ "display": "inline" });
|
| 2356 |
+
$photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
|
| 2357 |
+
}
|
| 2358 |
+
|
| 2359 |
+
// Resize Image
|
| 2360 |
+
var ratio = 0;
|
| 2361 |
+
var widthPercent = originalWidth / windowWidth;
|
| 2362 |
+
var heightPercent = originalHeight / windowHeight;
|
| 2363 |
+
var newWidth = 0;
|
| 2364 |
+
var newHeight = 0;
|
| 2365 |
+
|
| 2366 |
+
if (widthPercent > heightPercent) {
|
| 2367 |
+
ratio = originalHeight / originalWidth;
|
| 2368 |
+
newWidth = windowWidth * 0.9;
|
| 2369 |
+
newHeight = windowWidth * 0.9 * ratio;
|
| 2370 |
+
} else {
|
| 2371 |
+
ratio = originalWidth / originalHeight;
|
| 2372 |
+
newWidth = windowHeight * 0.9 * ratio;
|
| 2373 |
+
newHeight = windowHeight * 0.9;
|
| 2374 |
+
}
|
| 2375 |
+
|
| 2376 |
+
// Animate image + set z-index
|
| 2377 |
+
if (origin.hasClass('responsive-img')) {
|
| 2378 |
+
origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false,
|
| 2379 |
+
complete: function () {
|
| 2380 |
+
origin.css({ left: 0, top: 0 }).velocity({
|
| 2381 |
+
height: newHeight,
|
| 2382 |
+
width: newWidth,
|
| 2383 |
+
left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
|
| 2384 |
+
top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
|
| 2385 |
+
}, {
|
| 2386 |
+
duration: inDuration,
|
| 2387 |
+
queue: false,
|
| 2388 |
+
easing: 'easeOutQuad',
|
| 2389 |
+
complete: function () {
|
| 2390 |
+
doneAnimating = true;
|
| 2391 |
+
}
|
| 2392 |
+
});
|
| 2393 |
+
} // End Complete
|
| 2394 |
+
}); // End Velocity
|
| 2395 |
+
} else {
|
| 2396 |
+
origin.css('left', 0).css('top', 0).velocity({
|
| 2397 |
+
height: newHeight,
|
| 2398 |
+
width: newWidth,
|
| 2399 |
+
left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
|
| 2400 |
+
top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
|
| 2401 |
+
}, {
|
| 2402 |
+
duration: inDuration,
|
| 2403 |
+
queue: false,
|
| 2404 |
+
easing: 'easeOutQuad',
|
| 2405 |
+
complete: function () {
|
| 2406 |
+
doneAnimating = true;
|
| 2407 |
+
}
|
| 2408 |
+
}); // End Velocity
|
| 2409 |
+
}
|
| 2410 |
+
|
| 2411 |
+
// Handle Exit triggers
|
| 2412 |
+
$(window).on('scroll.materialbox', function () {
|
| 2413 |
+
if (overlayActive) {
|
| 2414 |
+
returnToOriginal();
|
| 2415 |
+
}
|
| 2416 |
+
});
|
| 2417 |
+
|
| 2418 |
+
$(window).on('resize.materialbox', function () {
|
| 2419 |
+
if (overlayActive) {
|
| 2420 |
+
returnToOriginal();
|
| 2421 |
+
}
|
| 2422 |
+
});
|
| 2423 |
+
|
| 2424 |
+
$(document).on('keyup.materialbox', function (e) {
|
| 2425 |
+
// ESC key
|
| 2426 |
+
if (e.keyCode === 27 && doneAnimating === true && overlayActive) {
|
| 2427 |
+
returnToOriginal();
|
| 2428 |
+
}
|
| 2429 |
+
});
|
| 2430 |
+
}); // End click handler
|
| 2431 |
+
|
| 2432 |
+
|
| 2433 |
+
// This function returns the modaled image to the original spot
|
| 2434 |
+
function returnToOriginal() {
|
| 2435 |
+
|
| 2436 |
+
doneAnimating = false;
|
| 2437 |
+
|
| 2438 |
+
var placeholder = origin.parent('.material-placeholder');
|
| 2439 |
+
var windowWidth = window.innerWidth;
|
| 2440 |
+
var windowHeight = window.innerHeight;
|
| 2441 |
+
var originalWidth = origin.data('width');
|
| 2442 |
+
var originalHeight = origin.data('height');
|
| 2443 |
+
|
| 2444 |
+
origin.velocity("stop", true);
|
| 2445 |
+
$('#materialbox-overlay').velocity("stop", true);
|
| 2446 |
+
$('.materialbox-caption').velocity("stop", true);
|
| 2447 |
+
|
| 2448 |
+
// disable exit handlers
|
| 2449 |
+
$(window).off('scroll.materialbox');
|
| 2450 |
+
$(document).off('keyup.materialbox');
|
| 2451 |
+
$(window).off('resize.materialbox');
|
| 2452 |
+
|
| 2453 |
+
$('#materialbox-overlay').velocity({ opacity: 0 }, {
|
| 2454 |
+
duration: outDuration, // Delay prevents animation overlapping
|
| 2455 |
+
queue: false, easing: 'easeOutQuad',
|
| 2456 |
+
complete: function () {
|
| 2457 |
+
// Remove Overlay
|
| 2458 |
+
overlayActive = false;
|
| 2459 |
+
$(this).remove();
|
| 2460 |
+
}
|
| 2461 |
+
});
|
| 2462 |
+
|
| 2463 |
+
// Resize Image
|
| 2464 |
+
origin.velocity({
|
| 2465 |
+
width: originalWidth,
|
| 2466 |
+
height: originalHeight,
|
| 2467 |
+
left: 0,
|
| 2468 |
+
top: 0
|
| 2469 |
+
}, {
|
| 2470 |
+
duration: outDuration,
|
| 2471 |
+
queue: false, easing: 'easeOutQuad',
|
| 2472 |
+
complete: function () {
|
| 2473 |
+
placeholder.css({
|
| 2474 |
+
height: '',
|
| 2475 |
+
width: '',
|
| 2476 |
+
position: '',
|
| 2477 |
+
top: '',
|
| 2478 |
+
left: ''
|
| 2479 |
+
});
|
| 2480 |
+
|
| 2481 |
+
origin.removeAttr('style');
|
| 2482 |
+
origin.attr('style', originInlineStyles);
|
| 2483 |
+
|
| 2484 |
+
// Remove class
|
| 2485 |
+
origin.removeClass('active');
|
| 2486 |
+
doneAnimating = true;
|
| 2487 |
+
|
| 2488 |
+
// Remove overflow overrides on ancestors
|
| 2489 |
+
if (ancestorsChanged) {
|
| 2490 |
+
ancestorsChanged.css('overflow', '');
|
| 2491 |
+
}
|
| 2492 |
+
}
|
| 2493 |
+
});
|
| 2494 |
+
|
| 2495 |
+
// Remove Caption + reset css settings on image
|
| 2496 |
+
$('.materialbox-caption').velocity({ opacity: 0 }, {
|
| 2497 |
+
duration: outDuration, // Delay prevents animation overlapping
|
| 2498 |
+
queue: false, easing: 'easeOutQuad',
|
| 2499 |
+
complete: function () {
|
| 2500 |
+
$(this).remove();
|
| 2501 |
+
}
|
| 2502 |
+
});
|
| 2503 |
+
}
|
| 2504 |
+
});
|
| 2505 |
+
};
|
| 2506 |
+
|
| 2507 |
+
$(document).ready(function () {
|
| 2508 |
+
$('.materialboxed').materialbox();
|
| 2509 |
+
});
|
| 2510 |
+
})(jQuery);
|
| 2511 |
+
;(function ($) {
|
| 2512 |
+
|
| 2513 |
+
$.fn.parallax = function () {
|
| 2514 |
+
var window_width = $(window).width();
|
| 2515 |
+
// Parallax Scripts
|
| 2516 |
+
return this.each(function (i) {
|
| 2517 |
+
var $this = $(this);
|
| 2518 |
+
$this.addClass('parallax');
|
| 2519 |
+
|
| 2520 |
+
function updateParallax(initial) {
|
| 2521 |
+
var container_height;
|
| 2522 |
+
if (window_width < 601) {
|
| 2523 |
+
container_height = $this.height() > 0 ? $this.height() : $this.children("img").height();
|
| 2524 |
+
} else {
|
| 2525 |
+
container_height = $this.height() > 0 ? $this.height() : 500;
|
| 2526 |
+
}
|
| 2527 |
+
var $img = $this.children("img").first();
|
| 2528 |
+
var img_height = $img.height();
|
| 2529 |
+
var parallax_dist = img_height - container_height;
|
| 2530 |
+
var bottom = $this.offset().top + container_height;
|
| 2531 |
+
var top = $this.offset().top;
|
| 2532 |
+
var scrollTop = $(window).scrollTop();
|
| 2533 |
+
var windowHeight = window.innerHeight;
|
| 2534 |
+
var windowBottom = scrollTop + windowHeight;
|
| 2535 |
+
var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
|
| 2536 |
+
var parallax = Math.round(parallax_dist * percentScrolled);
|
| 2537 |
+
|
| 2538 |
+
if (initial) {
|
| 2539 |
+
$img.css('display', 'block');
|
| 2540 |
+
}
|
| 2541 |
+
if (bottom > scrollTop && top < scrollTop + windowHeight) {
|
| 2542 |
+
$img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
|
| 2543 |
+
}
|
| 2544 |
+
}
|
| 2545 |
+
|
| 2546 |
+
// Wait for image load
|
| 2547 |
+
$this.children("img").one("load", function () {
|
| 2548 |
+
updateParallax(true);
|
| 2549 |
+
}).each(function () {
|
| 2550 |
+
if (this.complete) $(this).trigger("load");
|
| 2551 |
+
});
|
| 2552 |
+
|
| 2553 |
+
$(window).scroll(function () {
|
| 2554 |
+
window_width = $(window).width();
|
| 2555 |
+
updateParallax(false);
|
| 2556 |
+
});
|
| 2557 |
+
|
| 2558 |
+
$(window).resize(function () {
|
| 2559 |
+
window_width = $(window).width();
|
| 2560 |
+
updateParallax(false);
|
| 2561 |
+
});
|
| 2562 |
+
});
|
| 2563 |
+
};
|
| 2564 |
+
})(jQuery);
|
| 2565 |
+
;(function ($) {
|
| 2566 |
+
|
| 2567 |
+
var methods = {
|
| 2568 |
+
init: function (options) {
|
| 2569 |
+
var defaults = {
|
| 2570 |
+
onShow: null,
|
| 2571 |
+
swipeable: false,
|
| 2572 |
+
responsiveThreshold: Infinity // breakpoint for swipeable
|
| 2573 |
+
};
|
| 2574 |
+
options = $.extend(defaults, options);
|
| 2575 |
+
var namespace = Materialize.objectSelectorString($(this));
|
| 2576 |
+
|
| 2577 |
+
return this.each(function (i) {
|
| 2578 |
+
|
| 2579 |
+
var uniqueNamespace = namespace + i;
|
| 2580 |
+
|
| 2581 |
+
// For each set of tabs, we want to keep track of
|
| 2582 |
+
// which tab is active and its associated content
|
| 2583 |
+
var $this = $(this),
|
| 2584 |
+
window_width = $(window).width();
|
| 2585 |
+
|
| 2586 |
+
var $active,
|
| 2587 |
+
$content,
|
| 2588 |
+
$links = $this.find('li.tab a'),
|
| 2589 |
+
$tabs_width = $this.width(),
|
| 2590 |
+
$tabs_content = $(),
|
| 2591 |
+
$tabs_wrapper,
|
| 2592 |
+
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
|
| 2593 |
+
$indicator,
|
| 2594 |
+
index = 0,
|
| 2595 |
+
prev_index = 0,
|
| 2596 |
+
clicked = false,
|
| 2597 |
+
clickedTimeout,
|
| 2598 |
+
transition = 300;
|
| 2599 |
+
|
| 2600 |
+
// Finds right attribute for indicator based on active tab.
|
| 2601 |
+
// el: jQuery Object
|
| 2602 |
+
var calcRightPos = function (el) {
|
| 2603 |
+
return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft());
|
| 2604 |
+
};
|
| 2605 |
+
|
| 2606 |
+
// Finds left attribute for indicator based on active tab.
|
| 2607 |
+
// el: jQuery Object
|
| 2608 |
+
var calcLeftPos = function (el) {
|
| 2609 |
+
return Math.floor(el.position().left + $this.scrollLeft());
|
| 2610 |
+
};
|
| 2611 |
+
|
| 2612 |
+
// Animates Indicator to active tab.
|
| 2613 |
+
// prev_index: Number
|
| 2614 |
+
var animateIndicator = function (prev_index) {
|
| 2615 |
+
if (index - prev_index >= 0) {
|
| 2616 |
+
$indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
|
| 2617 |
+
$indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
|
| 2618 |
+
} else {
|
| 2619 |
+
$indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
|
| 2620 |
+
$indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
|
| 2621 |
+
}
|
| 2622 |
+
};
|
| 2623 |
+
|
| 2624 |
+
// Change swipeable according to responsive threshold
|
| 2625 |
+
if (options.swipeable) {
|
| 2626 |
+
if (window_width > options.responsiveThreshold) {
|
| 2627 |
+
options.swipeable = false;
|
| 2628 |
+
}
|
| 2629 |
+
}
|
| 2630 |
+
|
| 2631 |
+
// If the location.hash matches one of the links, use that as the active tab.
|
| 2632 |
+
$active = $($links.filter('[href="' + location.hash + '"]'));
|
| 2633 |
+
|
| 2634 |
+
// If no match is found, use the first link or any with class 'active' as the initial active tab.
|
| 2635 |
+
if ($active.length === 0) {
|
| 2636 |
+
$active = $(this).find('li.tab a.active').first();
|
| 2637 |
+
}
|
| 2638 |
+
if ($active.length === 0) {
|
| 2639 |
+
$active = $(this).find('li.tab a').first();
|
| 2640 |
+
}
|
| 2641 |
+
|
| 2642 |
+
$active.addClass('active');
|
| 2643 |
+
index = $links.index($active);
|
| 2644 |
+
if (index < 0) {
|
| 2645 |
+
index = 0;
|
| 2646 |
+
}
|
| 2647 |
+
|
| 2648 |
+
if ($active[0] !== undefined) {
|
| 2649 |
+
$content = $($active[0].hash);
|
| 2650 |
+
$content.addClass('active');
|
| 2651 |
+
}
|
| 2652 |
+
|
| 2653 |
+
// append indicator then set indicator width to tab width
|
| 2654 |
+
if (!$this.find('.indicator').length) {
|
| 2655 |
+
$this.append('<li class="indicator"></li>');
|
| 2656 |
+
}
|
| 2657 |
+
$indicator = $this.find('.indicator');
|
| 2658 |
+
|
| 2659 |
+
// we make sure that the indicator is at the end of the tabs
|
| 2660 |
+
$this.append($indicator);
|
| 2661 |
+
|
| 2662 |
+
if ($this.is(":visible")) {
|
| 2663 |
+
// $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
|
| 2664 |
+
// $indicator.css({"left": index * $tab_width});
|
| 2665 |
+
setTimeout(function () {
|
| 2666 |
+
$indicator.css({ "right": calcRightPos($active) });
|
| 2667 |
+
$indicator.css({ "left": calcLeftPos($active) });
|
| 2668 |
+
}, 0);
|
| 2669 |
+
}
|
| 2670 |
+
$(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () {
|
| 2671 |
+
$tabs_width = $this.width();
|
| 2672 |
+
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
|
| 2673 |
+
if (index < 0) {
|
| 2674 |
+
index = 0;
|
| 2675 |
+
}
|
| 2676 |
+
if ($tab_width !== 0 && $tabs_width !== 0) {
|
| 2677 |
+
$indicator.css({ "right": calcRightPos($active) });
|
| 2678 |
+
$indicator.css({ "left": calcLeftPos($active) });
|
| 2679 |
+
}
|
| 2680 |
+
});
|
| 2681 |
+
|
| 2682 |
+
// Initialize Tabs Content.
|
| 2683 |
+
if (options.swipeable) {
|
| 2684 |
+
// TODO: Duplicate calls with swipeable? handle multiple div wrapping.
|
| 2685 |
+
$links.each(function () {
|
| 2686 |
+
var $curr_content = $(Materialize.escapeHash(this.hash));
|
| 2687 |
+
$curr_content.addClass('carousel-item');
|
| 2688 |
+
$tabs_content = $tabs_content.add($curr_content);
|
| 2689 |
+
});
|
| 2690 |
+
$tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>');
|
| 2691 |
+
$tabs_content.css('display', '');
|
| 2692 |
+
$('.tabs-content.carousel').carousel({
|
| 2693 |
+
fullWidth: true,
|
| 2694 |
+
noWrap: true,
|
| 2695 |
+
onCycleTo: function (item) {
|
| 2696 |
+
if (!clicked) {
|
| 2697 |
+
var prev_index = index;
|
| 2698 |
+
index = $tabs_wrapper.index(item);
|
| 2699 |
+
$active.removeClass('active');
|
| 2700 |
+
$active = $links.eq(index);
|
| 2701 |
+
$active.addClass('active');
|
| 2702 |
+
animateIndicator(prev_index);
|
| 2703 |
+
if (typeof options.onShow === "function") {
|
| 2704 |
+
options.onShow.call($this[0], $content);
|
| 2705 |
+
}
|
| 2706 |
+
}
|
| 2707 |
+
}
|
| 2708 |
+
});
|
| 2709 |
+
} else {
|
| 2710 |
+
// Hide the remaining content
|
| 2711 |
+
$links.not($active).each(function () {
|
| 2712 |
+
$(Materialize.escapeHash(this.hash)).hide();
|
| 2713 |
+
});
|
| 2714 |
+
}
|
| 2715 |
+
|
| 2716 |
+
// Bind the click event handler
|
| 2717 |
+
$this.off('click.tabs').on('click.tabs', 'a', function (e) {
|
| 2718 |
+
if ($(this).parent().hasClass('disabled')) {
|
| 2719 |
+
e.preventDefault();
|
| 2720 |
+
return;
|
| 2721 |
+
}
|
| 2722 |
+
|
| 2723 |
+
// Act as regular link if target attribute is specified.
|
| 2724 |
+
if (!!$(this).attr("target")) {
|
| 2725 |
+
return;
|
| 2726 |
+
}
|
| 2727 |
+
|
| 2728 |
+
clicked = true;
|
| 2729 |
+
$tabs_width = $this.width();
|
| 2730 |
+
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
|
| 2731 |
+
|
| 2732 |
+
// Make the old tab inactive.
|
| 2733 |
+
$active.removeClass('active');
|
| 2734 |
+
var $oldContent = $content;
|
| 2735 |
+
|
| 2736 |
+
// Update the variables with the new link and content
|
| 2737 |
+
$active = $(this);
|
| 2738 |
+
$content = $(Materialize.escapeHash(this.hash));
|
| 2739 |
+
$links = $this.find('li.tab a');
|
| 2740 |
+
var activeRect = $active.position();
|
| 2741 |
+
|
| 2742 |
+
// Make the tab active.
|
| 2743 |
+
$active.addClass('active');
|
| 2744 |
+
prev_index = index;
|
| 2745 |
+
index = $links.index($(this));
|
| 2746 |
+
if (index < 0) {
|
| 2747 |
+
index = 0;
|
| 2748 |
+
}
|
| 2749 |
+
// Change url to current tab
|
| 2750 |
+
// window.location.hash = $active.attr('href');
|
| 2751 |
+
|
| 2752 |
+
// Swap content
|
| 2753 |
+
if (options.swipeable) {
|
| 2754 |
+
if ($tabs_content.length) {
|
| 2755 |
+
$tabs_content.carousel('set', index, function () {
|
| 2756 |
+
if (typeof options.onShow === "function") {
|
| 2757 |
+
options.onShow.call($this[0], $content);
|
| 2758 |
+
}
|
| 2759 |
+
});
|
| 2760 |
+
}
|
| 2761 |
+
} else {
|
| 2762 |
+
if ($content !== undefined) {
|
| 2763 |
+
$content.show();
|
| 2764 |
+
$content.addClass('active');
|
| 2765 |
+
if (typeof options.onShow === "function") {
|
| 2766 |
+
options.onShow.call(this, $content);
|
| 2767 |
+
}
|
| 2768 |
+
}
|
| 2769 |
+
|
| 2770 |
+
if ($oldContent !== undefined && !$oldContent.is($content)) {
|
| 2771 |
+
$oldContent.hide();
|
| 2772 |
+
$oldContent.removeClass('active');
|
| 2773 |
+
}
|
| 2774 |
+
}
|
| 2775 |
+
|
| 2776 |
+
// Reset clicked state
|
| 2777 |
+
clickedTimeout = setTimeout(function () {
|
| 2778 |
+
clicked = false;
|
| 2779 |
+
}, transition);
|
| 2780 |
+
|
| 2781 |
+
// Update indicator
|
| 2782 |
+
animateIndicator(prev_index);
|
| 2783 |
+
|
| 2784 |
+
// Prevent the anchor's default click action
|
| 2785 |
+
e.preventDefault();
|
| 2786 |
+
});
|
| 2787 |
+
});
|
| 2788 |
+
},
|
| 2789 |
+
select_tab: function (id) {
|
| 2790 |
+
this.find('a[href="#' + id + '"]').trigger('click');
|
| 2791 |
+
}
|
| 2792 |
+
};
|
| 2793 |
+
|
| 2794 |
+
$.fn.tabs = function (methodOrOptions) {
|
| 2795 |
+
if (methods[methodOrOptions]) {
|
| 2796 |
+
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
|
| 2797 |
+
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
|
| 2798 |
+
// Default to "init"
|
| 2799 |
+
return methods.init.apply(this, arguments);
|
| 2800 |
+
} else {
|
| 2801 |
+
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs');
|
| 2802 |
+
}
|
| 2803 |
+
};
|
| 2804 |
+
|
| 2805 |
+
$(document).ready(function () {
|
| 2806 |
+
$('ul.tabs').tabs();
|
| 2807 |
+
});
|
| 2808 |
+
})(jQuery);
|
| 2809 |
+
;(function ($) {
|
| 2810 |
+
$.fn.tooptipZ = function (options) {
|
| 2811 |
+
var timeout = null,
|
| 2812 |
+
margin = 5;
|
| 2813 |
+
|
| 2814 |
+
// Defaults
|
| 2815 |
+
var defaults = {
|
| 2816 |
+
delay: 350,
|
| 2817 |
+
tooltip: '',
|
| 2818 |
+
position: 'bottom',
|
| 2819 |
+
html: false
|
| 2820 |
+
};
|
| 2821 |
+
|
| 2822 |
+
// Remove tooltip from the activator
|
| 2823 |
+
if (options === "remove") {
|
| 2824 |
+
this.each(function () {
|
| 2825 |
+
$('#' + $(this).attr('data-tooltip-id')).remove();
|
| 2826 |
+
$(this).removeAttr('data-tooltip-id');
|
| 2827 |
+
$(this).off('mouseenter.tooltip mouseleave.tooltip');
|
| 2828 |
+
});
|
| 2829 |
+
return false;
|
| 2830 |
+
}
|
| 2831 |
+
|
| 2832 |
+
options = $.extend(defaults, options);
|
| 2833 |
+
|
| 2834 |
+
return this.each(function () {
|
| 2835 |
+
var tooltipId = Materialize.guid();
|
| 2836 |
+
var origin = $(this);
|
| 2837 |
+
|
| 2838 |
+
// Destroy old tooltip
|
| 2839 |
+
if (origin.attr('data-tooltip-id')) {
|
| 2840 |
+
$('#' + origin.attr('data-tooltip-id')).remove();
|
| 2841 |
+
}
|
| 2842 |
+
|
| 2843 |
+
origin.attr('data-tooltip-id', tooltipId);
|
| 2844 |
+
|
| 2845 |
+
// Get attributes.
|
| 2846 |
+
var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop;
|
| 2847 |
+
var setAttributes = function () {
|
| 2848 |
+
allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
|
| 2849 |
+
tooltipDelay = origin.attr('data-delay');
|
| 2850 |
+
tooltipDelay = tooltipDelay === undefined || tooltipDelay === '' ? options.delay : tooltipDelay;
|
| 2851 |
+
tooltipPosition = origin.attr('data-position');
|
| 2852 |
+
tooltipPosition = tooltipPosition === undefined || tooltipPosition === '' ? options.position : tooltipPosition;
|
| 2853 |
+
tooltipText = origin.attr('data-tooltip');
|
| 2854 |
+
tooltipText = tooltipText === undefined || tooltipText === '' ? options.tooltip : tooltipText;
|
| 2855 |
+
};
|
| 2856 |
+
setAttributes();
|
| 2857 |
+
|
| 2858 |
+
var renderTooltipEl = function () {
|
| 2859 |
+
var tooltip = $('<div class="material-tooltip"></div>');
|
| 2860 |
+
|
| 2861 |
+
// Create Text span
|
| 2862 |
+
if (allowHtml) {
|
| 2863 |
+
tooltipText = $('<span></span>').html(tooltipText);
|
| 2864 |
+
} else {
|
| 2865 |
+
tooltipText = $('<span></span>').text(tooltipText);
|
| 2866 |
+
}
|
| 2867 |
+
|
| 2868 |
+
// Create tooltip
|
| 2869 |
+
tooltip.append(tooltipText).appendTo($('body')).attr('id', tooltipId);
|
| 2870 |
+
|
| 2871 |
+
// Create backdrop
|
| 2872 |
+
backdrop = $('<div class="backdrop"></div>');
|
| 2873 |
+
backdrop.appendTo(tooltip);
|
| 2874 |
+
return tooltip;
|
| 2875 |
+
};
|
| 2876 |
+
tooltipEl = renderTooltipEl();
|
| 2877 |
+
|
| 2878 |
+
// Destroy previously binded events
|
| 2879 |
+
origin.off('mouseenter.tooltip mouseleave.tooltip');
|
| 2880 |
+
// Mouse In
|
| 2881 |
+
var started = false,
|
| 2882 |
+
timeoutRef;
|
| 2883 |
+
origin.on({ 'mouseenter.tooltip': function (e) {
|
| 2884 |
+
var showTooltip = function () {
|
| 2885 |
+
setAttributes();
|
| 2886 |
+
started = true;
|
| 2887 |
+
tooltipEl.velocity('stop');
|
| 2888 |
+
backdrop.velocity('stop');
|
| 2889 |
+
tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
|
| 2890 |
+
|
| 2891 |
+
// Tooltip positioning
|
| 2892 |
+
var originWidth = origin.outerWidth();
|
| 2893 |
+
var originHeight = origin.outerHeight();
|
| 2894 |
+
var tooltipHeight = tooltipEl.outerHeight();
|
| 2895 |
+
var tooltipWidth = tooltipEl.outerWidth();
|
| 2896 |
+
var tooltipVerticalMovement = '0px';
|
| 2897 |
+
var tooltipHorizontalMovement = '0px';
|
| 2898 |
+
var backdropOffsetWidth = backdrop[0].offsetWidth;
|
| 2899 |
+
var backdropOffsetHeight = backdrop[0].offsetHeight;
|
| 2900 |
+
var scaleXFactor = 8;
|
| 2901 |
+
var scaleYFactor = 8;
|
| 2902 |
+
var scaleFactor = 0;
|
| 2903 |
+
var targetTop, targetLeft, newCoordinates;
|
| 2904 |
+
|
| 2905 |
+
if (tooltipPosition === "top") {
|
| 2906 |
+
// Top Position
|
| 2907 |
+
targetTop = origin.offset().top - tooltipHeight - margin;
|
| 2908 |
+
targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
|
| 2909 |
+
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
|
| 2910 |
+
tooltipVerticalMovement = '-10px';
|
| 2911 |
+
backdrop.css({
|
| 2912 |
+
bottom: 0,
|
| 2913 |
+
left: 0,
|
| 2914 |
+
borderRadius: '14px 14px 0 0',
|
| 2915 |
+
transformOrigin: '50% 100%',
|
| 2916 |
+
marginTop: tooltipHeight,
|
| 2917 |
+
marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
|
| 2918 |
+
});
|
| 2919 |
+
}
|
| 2920 |
+
// Left Position
|
| 2921 |
+
else if (tooltipPosition === "left") {
|
| 2922 |
+
targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
|
| 2923 |
+
targetLeft = origin.offset().left - tooltipWidth - margin;
|
| 2924 |
+
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
|
| 2925 |
+
|
| 2926 |
+
tooltipHorizontalMovement = '-10px';
|
| 2927 |
+
backdrop.css({
|
| 2928 |
+
top: '-7px',
|
| 2929 |
+
right: 0,
|
| 2930 |
+
width: '14px',
|
| 2931 |
+
height: '14px',
|
| 2932 |
+
borderRadius: '14px 0 0 14px',
|
| 2933 |
+
transformOrigin: '95% 50%',
|
| 2934 |
+
marginTop: tooltipHeight / 2,
|
| 2935 |
+
marginLeft: tooltipWidth
|
| 2936 |
+
});
|
| 2937 |
+
}
|
| 2938 |
+
// Right Position
|
| 2939 |
+
else if (tooltipPosition === "right") {
|
| 2940 |
+
targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
|
| 2941 |
+
targetLeft = origin.offset().left + originWidth + margin;
|
| 2942 |
+
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
|
| 2943 |
+
|
| 2944 |
+
tooltipHorizontalMovement = '+10px';
|
| 2945 |
+
backdrop.css({
|
| 2946 |
+
top: '-7px',
|
| 2947 |
+
left: 0,
|
| 2948 |
+
width: '14px',
|
| 2949 |
+
height: '14px',
|
| 2950 |
+
borderRadius: '0 14px 14px 0',
|
| 2951 |
+
transformOrigin: '5% 50%',
|
| 2952 |
+
marginTop: tooltipHeight / 2,
|
| 2953 |
+
marginLeft: '0px'
|
| 2954 |
+
});
|
| 2955 |
+
} else {
|
| 2956 |
+
// Bottom Position
|
| 2957 |
+
targetTop = origin.offset().top + origin.outerHeight() + margin;
|
| 2958 |
+
targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
|
| 2959 |
+
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
|
| 2960 |
+
tooltipVerticalMovement = '+10px';
|
| 2961 |
+
backdrop.css({
|
| 2962 |
+
top: 0,
|
| 2963 |
+
left: 0,
|
| 2964 |
+
marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
|
| 2965 |
+
});
|
| 2966 |
+
}
|
| 2967 |
+
|
| 2968 |
+
// Set tooptip css placement
|
| 2969 |
+
tooltipEl.css({
|
| 2970 |
+
top: newCoordinates.y,
|
| 2971 |
+
left: newCoordinates.x
|
| 2972 |
+
});
|
| 2973 |
+
|
| 2974 |
+
// Calculate Scale to fill
|
| 2975 |
+
scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
|
| 2976 |
+
scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
|
| 2977 |
+
scaleFactor = Math.max(scaleXFactor, scaleYFactor);
|
| 2978 |
+
|
| 2979 |
+
tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }).velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false });
|
| 2980 |
+
backdrop.css({ visibility: 'visible' }).velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }).velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' });
|
| 2981 |
+
};
|
| 2982 |
+
|
| 2983 |
+
timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
|
| 2984 |
+
|
| 2985 |
+
// Mouse Out
|
| 2986 |
+
},
|
| 2987 |
+
'mouseleave.tooltip': function () {
|
| 2988 |
+
// Reset State
|
| 2989 |
+
started = false;
|
| 2990 |
+
clearTimeout(timeoutRef);
|
| 2991 |
+
|
| 2992 |
+
// Animate back
|
| 2993 |
+
setTimeout(function () {
|
| 2994 |
+
if (started !== true) {
|
| 2995 |
+
tooltipEl.velocity({
|
| 2996 |
+
opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false });
|
| 2997 |
+
backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, {
|
| 2998 |
+
duration: 225,
|
| 2999 |
+
queue: false,
|
| 3000 |
+
complete: function () {
|
| 3001 |
+
backdrop.css({ visibility: 'hidden' });
|
| 3002 |
+
tooltipEl.css({ visibility: 'hidden' });
|
| 3003 |
+
started = false;
|
| 3004 |
+
}
|
| 3005 |
+
});
|
| 3006 |
+
}
|
| 3007 |
+
}, 225);
|
| 3008 |
+
}
|
| 3009 |
+
});
|
| 3010 |
+
});
|
| 3011 |
+
};
|
| 3012 |
+
|
| 3013 |
+
var repositionWithinScreen = function (x, y, width, height) {
|
| 3014 |
+
var newX = x;
|
| 3015 |
+
var newY = y;
|
| 3016 |
+
|
| 3017 |
+
if (newX < 0) {
|
| 3018 |
+
newX = 4;
|
| 3019 |
+
} else if (newX + width > window.innerWidth) {
|
| 3020 |
+
newX -= newX + width - window.innerWidth;
|
| 3021 |
+
}
|
| 3022 |
+
|
| 3023 |
+
if (newY < 0) {
|
| 3024 |
+
newY = 4;
|
| 3025 |
+
} else if (newY + height > window.innerHeight + $(window).scrollTop) {
|
| 3026 |
+
newY -= newY + height - window.innerHeight;
|
| 3027 |
+
}
|
| 3028 |
+
|
| 3029 |
+
return { x: newX, y: newY };
|
| 3030 |
+
};
|
| 3031 |
+
|
| 3032 |
+
$(document).ready(function () {
|
| 3033 |
+
$('.tooltipped').tooptipZ();
|
| 3034 |
+
});
|
| 3035 |
+
})(jQuery);
|
| 3036 |
+
; /*!
|
| 3037 |
+
* Waves v0.6.4
|
| 3038 |
+
* http://fian.my.id/Waves
|
| 3039 |
+
*
|
| 3040 |
+
* Copyright 2014 Alfiana E. Sibuea and other contributors
|
| 3041 |
+
* Released under the MIT license
|
| 3042 |
+
* https://github.com/fians/Waves/blob/master/LICENSE
|
| 3043 |
+
*/
|
| 3044 |
+
|
| 3045 |
+
;(function (window) {
|
| 3046 |
+
'use strict';
|
| 3047 |
+
|
| 3048 |
+
var Waves = Waves || {};
|
| 3049 |
+
var $$ = document.querySelectorAll.bind(document);
|
| 3050 |
+
|
| 3051 |
+
// Find exact position of element
|
| 3052 |
+
function isWindow(obj) {
|
| 3053 |
+
return obj !== null && obj === obj.window;
|
| 3054 |
+
}
|
| 3055 |
+
|
| 3056 |
+
function getWindow(elem) {
|
| 3057 |
+
return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
|
| 3058 |
+
}
|
| 3059 |
+
|
| 3060 |
+
function offset(elem) {
|
| 3061 |
+
var docElem,
|
| 3062 |
+
win,
|
| 3063 |
+
box = { top: 0, left: 0 },
|
| 3064 |
+
doc = elem && elem.ownerDocument;
|
| 3065 |
+
|
| 3066 |
+
docElem = doc.documentElement;
|
| 3067 |
+
|
| 3068 |
+
if (typeof elem.getBoundingClientRect !== typeof undefined) {
|
| 3069 |
+
box = elem.getBoundingClientRect();
|
| 3070 |
+
}
|
| 3071 |
+
win = getWindow(doc);
|
| 3072 |
+
return {
|
| 3073 |
+
top: box.top + win.pageYOffset - docElem.clientTop,
|
| 3074 |
+
left: box.left + win.pageXOffset - docElem.clientLeft
|
| 3075 |
+
};
|
| 3076 |
+
}
|
| 3077 |
+
|
| 3078 |
+
function convertStyle(obj) {
|
| 3079 |
+
var style = '';
|
| 3080 |
+
|
| 3081 |
+
for (var a in obj) {
|
| 3082 |
+
if (obj.hasOwnProperty(a)) {
|
| 3083 |
+
style += a + ':' + obj[a] + ';';
|
| 3084 |
+
}
|
| 3085 |
+
}
|
| 3086 |
+
|
| 3087 |
+
return style;
|
| 3088 |
+
}
|
| 3089 |
+
|
| 3090 |
+
var Effect = {
|
| 3091 |
+
|
| 3092 |
+
// Effect delay
|
| 3093 |
+
duration: 750,
|
| 3094 |
+
|
| 3095 |
+
show: function (e, element) {
|
| 3096 |
+
|
| 3097 |
+
// Disable right click
|
| 3098 |
+
if (e.button === 2) {
|
| 3099 |
+
return false;
|
| 3100 |
+
}
|
| 3101 |
+
|
| 3102 |
+
var el = element || this;
|
| 3103 |
+
|
| 3104 |
+
// Create ripple
|
| 3105 |
+
var ripple = document.createElement('div');
|
| 3106 |
+
ripple.className = 'waves-ripple';
|
| 3107 |
+
el.appendChild(ripple);
|
| 3108 |
+
|
| 3109 |
+
// Get click coordinate and element witdh
|
| 3110 |
+
var pos = offset(el);
|
| 3111 |
+
var relativeY = e.pageY - pos.top;
|
| 3112 |
+
var relativeX = e.pageX - pos.left;
|
| 3113 |
+
var scale = 'scale(' + el.clientWidth / 100 * 10 + ')';
|
| 3114 |
+
|
| 3115 |
+
// Support for touch devices
|
| 3116 |
+
if ('touches' in e) {
|
| 3117 |
+
relativeY = e.touches[0].pageY - pos.top;
|
| 3118 |
+
relativeX = e.touches[0].pageX - pos.left;
|
| 3119 |
+
}
|
| 3120 |
+
|
| 3121 |
+
// Attach data to element
|
| 3122 |
+
ripple.setAttribute('data-hold', Date.now());
|
| 3123 |
+
ripple.setAttribute('data-scale', scale);
|
| 3124 |
+
ripple.setAttribute('data-x', relativeX);
|
| 3125 |
+
ripple.setAttribute('data-y', relativeY);
|
| 3126 |
+
|
| 3127 |
+
// Set ripple position
|
| 3128 |
+
var rippleStyle = {
|
| 3129 |
+
'top': relativeY + 'px',
|
| 3130 |
+
'left': relativeX + 'px'
|
| 3131 |
+
};
|
| 3132 |
+
|
| 3133 |
+
ripple.className = ripple.className + ' waves-notransition';
|
| 3134 |
+
ripple.setAttribute('style', convertStyle(rippleStyle));
|
| 3135 |
+
ripple.className = ripple.className.replace('waves-notransition', '');
|
| 3136 |
+
|
| 3137 |
+
// Scale the ripple
|
| 3138 |
+
rippleStyle['-webkit-transform'] = scale;
|
| 3139 |
+
rippleStyle['-moz-transform'] = scale;
|
| 3140 |
+
rippleStyle['-ms-transform'] = scale;
|
| 3141 |
+
rippleStyle['-o-transform'] = scale;
|
| 3142 |
+
rippleStyle.transform = scale;
|
| 3143 |
+
rippleStyle.opacity = '1';
|
| 3144 |
+
|
| 3145 |
+
rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
|
| 3146 |
+
rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
|
| 3147 |
+
rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
|
| 3148 |
+
rippleStyle['transition-duration'] = Effect.duration + 'ms';
|
| 3149 |
+
|
| 3150 |
+
rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
|
| 3151 |
+
rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
|
| 3152 |
+
rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
|
| 3153 |
+
rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
|
| 3154 |
+
|
| 3155 |
+
ripple.setAttribute('style', convertStyle(rippleStyle));
|
| 3156 |
+
},
|
| 3157 |
+
|
| 3158 |
+
hide: function (e) {
|
| 3159 |
+
TouchHandler.touchup(e);
|
| 3160 |
+
|
| 3161 |
+
var el = this;
|
| 3162 |
+
var width = el.clientWidth * 1.4;
|
| 3163 |
+
|
| 3164 |
+
// Get first ripple
|
| 3165 |
+
var ripple = null;
|
| 3166 |
+
var ripples = el.getElementsByClassName('waves-ripple');
|
| 3167 |
+
if (ripples.length > 0) {
|
| 3168 |
+
ripple = ripples[ripples.length - 1];
|
| 3169 |
+
} else {
|
| 3170 |
+
return false;
|
| 3171 |
+
}
|
| 3172 |
+
|
| 3173 |
+
var relativeX = ripple.getAttribute('data-x');
|
| 3174 |
+
var relativeY = ripple.getAttribute('data-y');
|
| 3175 |
+
var scale = ripple.getAttribute('data-scale');
|
| 3176 |
+
|
| 3177 |
+
// Get delay beetween mousedown and mouse leave
|
| 3178 |
+
var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
|
| 3179 |
+
var delay = 350 - diff;
|
| 3180 |
+
|
| 3181 |
+
if (delay < 0) {
|
| 3182 |
+
delay = 0;
|
| 3183 |
+
}
|
| 3184 |
+
|
| 3185 |
+
// Fade out ripple after delay
|
| 3186 |
+
setTimeout(function () {
|
| 3187 |
+
var style = {
|
| 3188 |
+
'top': relativeY + 'px',
|
| 3189 |
+
'left': relativeX + 'px',
|
| 3190 |
+
'opacity': '0',
|
| 3191 |
+
|
| 3192 |
+
// Duration
|
| 3193 |
+
'-webkit-transition-duration': Effect.duration + 'ms',
|
| 3194 |
+
'-moz-transition-duration': Effect.duration + 'ms',
|
| 3195 |
+
'-o-transition-duration': Effect.duration + 'ms',
|
| 3196 |
+
'transition-duration': Effect.duration + 'ms',
|
| 3197 |
+
'-webkit-transform': scale,
|
| 3198 |
+
'-moz-transform': scale,
|
| 3199 |
+
'-ms-transform': scale,
|
| 3200 |
+
'-o-transform': scale,
|
| 3201 |
+
'transform': scale
|
| 3202 |
+
};
|
| 3203 |
+
|
| 3204 |
+
ripple.setAttribute('style', convertStyle(style));
|
| 3205 |
+
|
| 3206 |
+
setTimeout(function () {
|
| 3207 |
+
try {
|
| 3208 |
+
el.removeChild(ripple);
|
| 3209 |
+
} catch (e) {
|
| 3210 |
+
return false;
|
| 3211 |
+
}
|
| 3212 |
+
}, Effect.duration);
|
| 3213 |
+
}, delay);
|
| 3214 |
+
},
|
| 3215 |
+
|
| 3216 |
+
// Little hack to make <input> can perform waves effect
|
| 3217 |
+
wrapInput: function (elements) {
|
| 3218 |
+
for (var a = 0; a < elements.length; a++) {
|
| 3219 |
+
var el = elements[a];
|
| 3220 |
+
|
| 3221 |
+
if (el.tagName.toLowerCase() === 'input') {
|
| 3222 |
+
var parent = el.parentNode;
|
| 3223 |
+
|
| 3224 |
+
// If input already have parent just pass through
|
| 3225 |
+
if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
|
| 3226 |
+
continue;
|
| 3227 |
+
}
|
| 3228 |
+
|
| 3229 |
+
// Put element class and style to the specified parent
|
| 3230 |
+
var wrapper = document.createElement('i');
|
| 3231 |
+
wrapper.className = el.className + ' waves-input-wrapper';
|
| 3232 |
+
|
| 3233 |
+
var elementStyle = el.getAttribute('style');
|
| 3234 |
+
|
| 3235 |
+
if (!elementStyle) {
|
| 3236 |
+
elementStyle = '';
|
| 3237 |
+
}
|
| 3238 |
+
|
| 3239 |
+
wrapper.setAttribute('style', elementStyle);
|
| 3240 |
+
|
| 3241 |
+
el.className = 'waves-button-input';
|
| 3242 |
+
el.removeAttribute('style');
|
| 3243 |
+
|
| 3244 |
+
// Put element as child
|
| 3245 |
+
parent.replaceChild(wrapper, el);
|
| 3246 |
+
wrapper.appendChild(el);
|
| 3247 |
+
}
|
| 3248 |
+
}
|
| 3249 |
+
}
|
| 3250 |
+
};
|
| 3251 |
+
|
| 3252 |
+
/**
|
| 3253 |
+
* Disable mousedown event for 500ms during and after touch
|
| 3254 |
+
*/
|
| 3255 |
+
var TouchHandler = {
|
| 3256 |
+
/* uses an integer rather than bool so there's no issues with
|
| 3257 |
+
* needing to clear timeouts if another touch event occurred
|
| 3258 |
+
* within the 500ms. Cannot mouseup between touchstart and
|
| 3259 |
+
* touchend, nor in the 500ms after touchend. */
|
| 3260 |
+
touches: 0,
|
| 3261 |
+
allowEvent: function (e) {
|
| 3262 |
+
var allow = true;
|
| 3263 |
+
|
| 3264 |
+
if (e.type === 'touchstart') {
|
| 3265 |
+
TouchHandler.touches += 1; //push
|
| 3266 |
+
} else if (e.type === 'touchend' || e.type === 'touchcancel') {
|
| 3267 |
+
setTimeout(function () {
|
| 3268 |
+
if (TouchHandler.touches > 0) {
|
| 3269 |
+
TouchHandler.touches -= 1; //pop after 500ms
|
| 3270 |
+
}
|
| 3271 |
+
}, 500);
|
| 3272 |
+
} else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
|
| 3273 |
+
allow = false;
|
| 3274 |
+
}
|
| 3275 |
+
|
| 3276 |
+
return allow;
|
| 3277 |
+
},
|
| 3278 |
+
touchup: function (e) {
|
| 3279 |
+
TouchHandler.allowEvent(e);
|
| 3280 |
+
}
|
| 3281 |
+
};
|
| 3282 |
+
|
| 3283 |
+
/**
|
| 3284 |
+
* Delegated click handler for .waves-effect element.
|
| 3285 |
+
* returns null when .waves-effect element not in "click tree"
|
| 3286 |
+
*/
|
| 3287 |
+
function getWavesEffectElement(e) {
|
| 3288 |
+
if (TouchHandler.allowEvent(e) === false) {
|
| 3289 |
+
return null;
|
| 3290 |
+
}
|
| 3291 |
+
|
| 3292 |
+
var element = null;
|
| 3293 |
+
var target = e.target || e.srcElement;
|
| 3294 |
+
|
| 3295 |
+
while (target.parentNode !== null) {
|
| 3296 |
+
if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
|
| 3297 |
+
element = target;
|
| 3298 |
+
break;
|
| 3299 |
+
}
|
| 3300 |
+
target = target.parentNode;
|
| 3301 |
+
}
|
| 3302 |
+
return element;
|
| 3303 |
+
}
|
| 3304 |
+
|
| 3305 |
+
/**
|
| 3306 |
+
* Bubble the click and show effect if .waves-effect elem was found
|
| 3307 |
+
*/
|
| 3308 |
+
function showEffect(e) {
|
| 3309 |
+
var element = getWavesEffectElement(e);
|
| 3310 |
+
|
| 3311 |
+
if (element !== null) {
|
| 3312 |
+
Effect.show(e, element);
|
| 3313 |
+
|
| 3314 |
+
if ('ontouchstart' in window) {
|
| 3315 |
+
element.addEventListener('touchend', Effect.hide, false);
|
| 3316 |
+
element.addEventListener('touchcancel', Effect.hide, false);
|
| 3317 |
+
}
|
| 3318 |
+
|
| 3319 |
+
element.addEventListener('mouseup', Effect.hide, false);
|
| 3320 |
+
element.addEventListener('mouseleave', Effect.hide, false);
|
| 3321 |
+
element.addEventListener('dragend', Effect.hide, false);
|
| 3322 |
+
}
|
| 3323 |
+
}
|
| 3324 |
+
|
| 3325 |
+
Waves.displayEffect = function (options) {
|
| 3326 |
+
options = options || {};
|
| 3327 |
+
|
| 3328 |
+
if ('duration' in options) {
|
| 3329 |
+
Effect.duration = options.duration;
|
| 3330 |
+
}
|
| 3331 |
+
|
| 3332 |
+
//Wrap input inside <i> tag
|
| 3333 |
+
Effect.wrapInput($$('.waves-effect'));
|
| 3334 |
+
|
| 3335 |
+
if ('ontouchstart' in window) {
|
| 3336 |
+
document.body.addEventListener('touchstart', showEffect, false);
|
| 3337 |
+
}
|
| 3338 |
+
|
| 3339 |
+
document.body.addEventListener('mousedown', showEffect, false);
|
| 3340 |
+
};
|
| 3341 |
+
|
| 3342 |
+
/**
|
| 3343 |
+
* Attach Waves to an input element (or any element which doesn't
|
| 3344 |
+
* bubble mouseup/mousedown events).
|
| 3345 |
+
* Intended to be used with dynamically loaded forms/inputs, or
|
| 3346 |
+
* where the user doesn't want a delegated click handler.
|
| 3347 |
+
*/
|
| 3348 |
+
Waves.attach = function (element) {
|
| 3349 |
+
//FUTURE: automatically add waves classes and allow users
|
| 3350 |
+
// to specify them with an options param? Eg. light/classic/button
|
| 3351 |
+
if (element.tagName.toLowerCase() === 'input') {
|
| 3352 |
+
Effect.wrapInput([element]);
|
| 3353 |
+
element = element.parentNode;
|
| 3354 |
+
}
|
| 3355 |
+
|
| 3356 |
+
if ('ontouchstart' in window) {
|
| 3357 |
+
element.addEventListener('touchstart', showEffect, false);
|
| 3358 |
+
}
|
| 3359 |
+
|
| 3360 |
+
element.addEventListener('mousedown', showEffect, false);
|
| 3361 |
+
};
|
| 3362 |
+
|
| 3363 |
+
window.Waves = Waves;
|
| 3364 |
+
|
| 3365 |
+
document.addEventListener('DOMContentLoaded', function () {
|
| 3366 |
+
Waves.displayEffect();
|
| 3367 |
+
}, false);
|
| 3368 |
+
})(window);
|
| 3369 |
+
;(function ($, Vel) {
|
| 3370 |
+
'use strict';
|
| 3371 |
+
|
| 3372 |
+
var _defaults = {
|
| 3373 |
+
displayLength: Infinity,
|
| 3374 |
+
inDuration: 300,
|
| 3375 |
+
outDuration: 375,
|
| 3376 |
+
className: undefined,
|
| 3377 |
+
completeCallback: undefined,
|
| 3378 |
+
activationPercent: 0.8
|
| 3379 |
+
};
|
| 3380 |
+
|
| 3381 |
+
var Toast = function () {
|
| 3382 |
+
function Toast(message, displayLength, className, completeCallback) {
|
| 3383 |
+
_classCallCheck(this, Toast);
|
| 3384 |
+
|
| 3385 |
+
if (!message) {
|
| 3386 |
+
return;
|
| 3387 |
+
}
|
| 3388 |
+
|
| 3389 |
+
/**
|
| 3390 |
+
* Options for the toast
|
| 3391 |
+
* @member Toast#options
|
| 3392 |
+
*/
|
| 3393 |
+
this.options = {
|
| 3394 |
+
displayLength: displayLength,
|
| 3395 |
+
className: className,
|
| 3396 |
+
completeCallback: completeCallback
|
| 3397 |
+
};
|
| 3398 |
+
|
| 3399 |
+
this.options = $.extend({}, Toast.defaults, this.options);
|
| 3400 |
+
this.message = message;
|
| 3401 |
+
|
| 3402 |
+
/**
|
| 3403 |
+
* Describes current pan state toast
|
| 3404 |
+
* @type {Boolean}
|
| 3405 |
+
*/
|
| 3406 |
+
this.panning = false;
|
| 3407 |
+
|
| 3408 |
+
/**
|
| 3409 |
+
* Time remaining until toast is removed
|
| 3410 |
+
*/
|
| 3411 |
+
this.timeRemaining = this.options.displayLength;
|
| 3412 |
+
|
| 3413 |
+
if (Toast._toasts.length === 0) {
|
| 3414 |
+
Toast._createContainer();
|
| 3415 |
+
}
|
| 3416 |
+
|
| 3417 |
+
// Create new toast
|
| 3418 |
+
Toast._toasts.push(this);
|
| 3419 |
+
var toastElement = this.createToast();
|
| 3420 |
+
toastElement.M_Toast = this;
|
| 3421 |
+
this.el = toastElement;
|
| 3422 |
+
this._animateIn();
|
| 3423 |
+
this.setTimer();
|
| 3424 |
+
}
|
| 3425 |
+
|
| 3426 |
+
_createClass(Toast, [{
|
| 3427 |
+
key: 'createToast',
|
| 3428 |
+
|
| 3429 |
+
|
| 3430 |
+
/**
|
| 3431 |
+
* Create toast and append it to toast container
|
| 3432 |
+
*/
|
| 3433 |
+
value: function createToast() {
|
| 3434 |
+
var toast = document.createElement('div');
|
| 3435 |
+
toast.classList.add('toast');
|
| 3436 |
+
|
| 3437 |
+
// Add custom classes onto toast
|
| 3438 |
+
if (this.options.className) {
|
| 3439 |
+
var classes = this.options.className.split(' ');
|
| 3440 |
+
var i = void 0,
|
| 3441 |
+
count = void 0;
|
| 3442 |
+
for (i = 0, count = classes.length; i < count; i++) {
|
| 3443 |
+
toast.classList.add(classes[i]);
|
| 3444 |
+
}
|
| 3445 |
+
}
|
| 3446 |
+
|
| 3447 |
+
// Set content
|
| 3448 |
+
if (typeof HTMLElement === 'object' ? this.message instanceof HTMLElement : this.message && typeof this.message === 'object' && this.message !== null && this.message.nodeType === 1 && typeof this.message.nodeName === 'string') {
|
| 3449 |
+
toast.appendChild(this.message);
|
| 3450 |
+
|
| 3451 |
+
// Check if it is jQuery object
|
| 3452 |
+
} else if (this.message instanceof jQuery) {
|
| 3453 |
+
$(toast).append(this.message);
|
| 3454 |
+
|
| 3455 |
+
// Insert as text;
|
| 3456 |
+
} else {
|
| 3457 |
+
toast.innerHTML = this.message;
|
| 3458 |
+
}
|
| 3459 |
+
|
| 3460 |
+
// Append toasft
|
| 3461 |
+
Toast._container.appendChild(toast);
|
| 3462 |
+
return toast;
|
| 3463 |
+
}
|
| 3464 |
+
|
| 3465 |
+
/**
|
| 3466 |
+
* Animate in toast
|
| 3467 |
+
*/
|
| 3468 |
+
|
| 3469 |
+
}, {
|
| 3470 |
+
key: '_animateIn',
|
| 3471 |
+
value: function _animateIn() {
|
| 3472 |
+
// Animate toast in
|
| 3473 |
+
Vel(this.el, { top: 0, opacity: 1 }, {
|
| 3474 |
+
duration: 300,
|
| 3475 |
+
easing: 'easeOutCubic',
|
| 3476 |
+
queue: false
|
| 3477 |
+
});
|
| 3478 |
+
}
|
| 3479 |
+
|
| 3480 |
+
/**
|
| 3481 |
+
* Create setInterval which automatically removes toast when timeRemaining >= 0
|
| 3482 |
+
* has been reached
|
| 3483 |
+
*/
|
| 3484 |
+
|
| 3485 |
+
}, {
|
| 3486 |
+
key: 'setTimer',
|
| 3487 |
+
value: function setTimer() {
|
| 3488 |
+
var _this3 = this;
|
| 3489 |
+
|
| 3490 |
+
if (this.timeRemaining !== Infinity) {
|
| 3491 |
+
this.counterInterval = setInterval(function () {
|
| 3492 |
+
// If toast is not being dragged, decrease its time remaining
|
| 3493 |
+
if (!_this3.panning) {
|
| 3494 |
+
_this3.timeRemaining -= 20;
|
| 3495 |
+
}
|
| 3496 |
+
|
| 3497 |
+
// Animate toast out
|
| 3498 |
+
if (_this3.timeRemaining <= 0) {
|
| 3499 |
+
_this3.remove();
|
| 3500 |
+
}
|
| 3501 |
+
}, 20);
|
| 3502 |
+
}
|
| 3503 |
+
}
|
| 3504 |
+
|
| 3505 |
+
/**
|
| 3506 |
+
* Dismiss toast with animation
|
| 3507 |
+
*/
|
| 3508 |
+
|
| 3509 |
+
}, {
|
| 3510 |
+
key: 'remove',
|
| 3511 |
+
value: function remove() {
|
| 3512 |
+
var _this4 = this;
|
| 3513 |
+
|
| 3514 |
+
window.clearInterval(this.counterInterval);
|
| 3515 |
+
var activationDistance = this.el.offsetWidth * this.options.activationPercent;
|
| 3516 |
+
|
| 3517 |
+
if (this.wasSwiped) {
|
| 3518 |
+
this.el.style.transition = 'transform .05s, opacity .05s';
|
| 3519 |
+
this.el.style.transform = 'translateX(' + activationDistance + 'px)';
|
| 3520 |
+
this.el.style.opacity = 0;
|
| 3521 |
+
}
|
| 3522 |
+
|
| 3523 |
+
Vel(this.el, { opacity: 0, marginTop: '-40px' }, {
|
| 3524 |
+
duration: this.options.outDuration,
|
| 3525 |
+
easing: 'easeOutExpo',
|
| 3526 |
+
queue: false,
|
| 3527 |
+
complete: function () {
|
| 3528 |
+
// Call the optional callback
|
| 3529 |
+
if (typeof _this4.options.completeCallback === 'function') {
|
| 3530 |
+
_this4.options.completeCallback();
|
| 3531 |
+
}
|
| 3532 |
+
// Remove toast from DOM
|
| 3533 |
+
_this4.el.parentNode.removeChild(_this4.el);
|
| 3534 |
+
Toast._toasts.splice(Toast._toasts.indexOf(_this4), 1);
|
| 3535 |
+
if (Toast._toasts.length === 0) {
|
| 3536 |
+
Toast._removeContainer();
|
| 3537 |
+
}
|
| 3538 |
+
}
|
| 3539 |
+
});
|
| 3540 |
+
}
|
| 3541 |
+
}], [{
|
| 3542 |
+
key: '_createContainer',
|
| 3543 |
+
|
| 3544 |
+
|
| 3545 |
+
/**
|
| 3546 |
+
* Append toast container and add event handlers
|
| 3547 |
+
*/
|
| 3548 |
+
value: function _createContainer() {
|
| 3549 |
+
var container = document.createElement('div');
|
| 3550 |
+
container.setAttribute('id', 'toast-container');
|
| 3551 |
+
|
| 3552 |
+
// Add event handler
|
| 3553 |
+
container.addEventListener('touchstart', Toast._onDragStart);
|
| 3554 |
+
container.addEventListener('touchmove', Toast._onDragMove);
|
| 3555 |
+
container.addEventListener('touchend', Toast._onDragEnd);
|
| 3556 |
+
|
| 3557 |
+
container.addEventListener('mousedown', Toast._onDragStart);
|
| 3558 |
+
document.addEventListener('mousemove', Toast._onDragMove);
|
| 3559 |
+
document.addEventListener('mouseup', Toast._onDragEnd);
|
| 3560 |
+
|
| 3561 |
+
document.body.appendChild(container);
|
| 3562 |
+
Toast._container = container;
|
| 3563 |
+
}
|
| 3564 |
+
|
| 3565 |
+
/**
|
| 3566 |
+
* Remove toast container and event handlers
|
| 3567 |
+
*/
|
| 3568 |
+
|
| 3569 |
+
}, {
|
| 3570 |
+
key: '_removeContainer',
|
| 3571 |
+
value: function _removeContainer() {
|
| 3572 |
+
// Add event handler
|
| 3573 |
+
document.removeEventListener('mousemove', Toast._onDragMove);
|
| 3574 |
+
document.removeEventListener('mouseup', Toast._onDragEnd);
|
| 3575 |
+
|
| 3576 |
+
Toast._container.parentNode.removeChild(Toast._container);
|
| 3577 |
+
Toast._container = null;
|
| 3578 |
+
}
|
| 3579 |
+
|
| 3580 |
+
/**
|
| 3581 |
+
* Begin drag handler
|
| 3582 |
+
* @param {Event} e
|
| 3583 |
+
*/
|
| 3584 |
+
|
| 3585 |
+
}, {
|
| 3586 |
+
key: '_onDragStart',
|
| 3587 |
+
value: function _onDragStart(e) {
|
| 3588 |
+
if (e.target && $(e.target).closest('.toast').length) {
|
| 3589 |
+
var $toast = $(e.target).closest('.toast');
|
| 3590 |
+
var toast = $toast[0].M_Toast;
|
| 3591 |
+
toast.panning = true;
|
| 3592 |
+
Toast._draggedToast = toast;
|
| 3593 |
+
toast.el.classList.add('panning');
|
| 3594 |
+
toast.el.style.transition = '';
|
| 3595 |
+
toast.startingXPos = Toast._xPos(e);
|
| 3596 |
+
toast.time = Date.now();
|
| 3597 |
+
toast.xPos = Toast._xPos(e);
|
| 3598 |
+
}
|
| 3599 |
+
}
|
| 3600 |
+
|
| 3601 |
+
/**
|
| 3602 |
+
* Drag move handler
|
| 3603 |
+
* @param {Event} e
|
| 3604 |
+
*/
|
| 3605 |
+
|
| 3606 |
+
}, {
|
| 3607 |
+
key: '_onDragMove',
|
| 3608 |
+
value: function _onDragMove(e) {
|
| 3609 |
+
if (!!Toast._draggedToast) {
|
| 3610 |
+
e.preventDefault();
|
| 3611 |
+
var toast = Toast._draggedToast;
|
| 3612 |
+
toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e));
|
| 3613 |
+
toast.xPos = Toast._xPos(e);
|
| 3614 |
+
toast.velocityX = toast.deltaX / (Date.now() - toast.time);
|
| 3615 |
+
toast.time = Date.now();
|
| 3616 |
+
|
| 3617 |
+
var totalDeltaX = toast.xPos - toast.startingXPos;
|
| 3618 |
+
var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
|
| 3619 |
+
toast.el.style.transform = 'translateX(' + totalDeltaX + 'px)';
|
| 3620 |
+
toast.el.style.opacity = 1 - Math.abs(totalDeltaX / activationDistance);
|
| 3621 |
+
}
|
| 3622 |
+
}
|
| 3623 |
+
|
| 3624 |
+
/**
|
| 3625 |
+
* End drag handler
|
| 3626 |
+
* @param {Event} e
|
| 3627 |
+
*/
|
| 3628 |
+
|
| 3629 |
+
}, {
|
| 3630 |
+
key: '_onDragEnd',
|
| 3631 |
+
value: function _onDragEnd(e) {
|
| 3632 |
+
if (!!Toast._draggedToast) {
|
| 3633 |
+
var toast = Toast._draggedToast;
|
| 3634 |
+
toast.panning = false;
|
| 3635 |
+
toast.el.classList.remove('panning');
|
| 3636 |
+
|
| 3637 |
+
var totalDeltaX = toast.xPos - toast.startingXPos;
|
| 3638 |
+
var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
|
| 3639 |
+
var shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance || toast.velocityX > 1;
|
| 3640 |
+
|
| 3641 |
+
// Remove toast
|
| 3642 |
+
if (shouldBeDismissed) {
|
| 3643 |
+
toast.wasSwiped = true;
|
| 3644 |
+
toast.remove();
|
| 3645 |
+
|
| 3646 |
+
// Animate toast back to original position
|
| 3647 |
+
} else {
|
| 3648 |
+
toast.el.style.transition = 'transform .2s, opacity .2s';
|
| 3649 |
+
toast.el.style.transform = '';
|
| 3650 |
+
toast.el.style.opacity = '';
|
| 3651 |
+
}
|
| 3652 |
+
Toast._draggedToast = null;
|
| 3653 |
+
}
|
| 3654 |
+
}
|
| 3655 |
+
|
| 3656 |
+
/**
|
| 3657 |
+
* Get x position of mouse or touch event
|
| 3658 |
+
* @param {Event} e
|
| 3659 |
+
*/
|
| 3660 |
+
|
| 3661 |
+
}, {
|
| 3662 |
+
key: '_xPos',
|
| 3663 |
+
value: function _xPos(e) {
|
| 3664 |
+
if (e.targetTouches && e.targetTouches.length >= 1) {
|
| 3665 |
+
return e.targetTouches[0].clientX;
|
| 3666 |
+
}
|
| 3667 |
+
// mouse event
|
| 3668 |
+
return e.clientX;
|
| 3669 |
+
}
|
| 3670 |
+
|
| 3671 |
+
/**
|
| 3672 |
+
* Remove all toasts
|
| 3673 |
+
*/
|
| 3674 |
+
|
| 3675 |
+
}, {
|
| 3676 |
+
key: 'removeAll',
|
| 3677 |
+
value: function removeAll() {
|
| 3678 |
+
for (var toastIndex in Toast._toasts) {
|
| 3679 |
+
Toast._toasts[toastIndex].remove();
|
| 3680 |
+
}
|
| 3681 |
+
}
|
| 3682 |
+
}, {
|
| 3683 |
+
key: 'defaults',
|
| 3684 |
+
get: function () {
|
| 3685 |
+
return _defaults;
|
| 3686 |
+
}
|
| 3687 |
+
}]);
|
| 3688 |
+
|
| 3689 |
+
return Toast;
|
| 3690 |
+
}();
|
| 3691 |
+
|
| 3692 |
+
/**
|
| 3693 |
+
* @static
|
| 3694 |
+
* @memberof Toast
|
| 3695 |
+
* @type {Array.<Toast>}
|
| 3696 |
+
*/
|
| 3697 |
+
|
| 3698 |
+
|
| 3699 |
+
Toast._toasts = [];
|
| 3700 |
+
|
| 3701 |
+
/**
|
| 3702 |
+
* @static
|
| 3703 |
+
* @memberof Toast
|
| 3704 |
+
*/
|
| 3705 |
+
Toast._container = null;
|
| 3706 |
+
|
| 3707 |
+
/**
|
| 3708 |
+
* @static
|
| 3709 |
+
* @memberof Toast
|
| 3710 |
+
* @type {Toast}
|
| 3711 |
+
*/
|
| 3712 |
+
Toast._draggedToast = null;
|
| 3713 |
+
|
| 3714 |
+
Materialize.Toast = Toast;
|
| 3715 |
+
Materialize.toast = function (message, displayLength, className, completeCallback) {
|
| 3716 |
+
return new Toast(message, displayLength, className, completeCallback);
|
| 3717 |
+
};
|
| 3718 |
+
})(jQuery, Materialize.Vel);
|
| 3719 |
+
;(function ($) {
|
| 3720 |
+
|
| 3721 |
+
var methods = {
|
| 3722 |
+
init: function (options) {
|
| 3723 |
+
var defaults = {
|
| 3724 |
+
menuWidth: 300,
|
| 3725 |
+
edge: 'left',
|
| 3726 |
+
closeOnClick: false,
|
| 3727 |
+
draggable: true,
|
| 3728 |
+
onOpen: null,
|
| 3729 |
+
onClose: null
|
| 3730 |
+
};
|
| 3731 |
+
options = $.extend(defaults, options);
|
| 3732 |
+
|
| 3733 |
+
$(this).each(function () {
|
| 3734 |
+
var $this = $(this);
|
| 3735 |
+
var menuId = $this.attr('data-activates');
|
| 3736 |
+
var menu = $("#" + menuId);
|
| 3737 |
+
|
| 3738 |
+
// Set to width
|
| 3739 |
+
if (options.menuWidth != 300) {
|
| 3740 |
+
menu.css('width', options.menuWidth);
|
| 3741 |
+
}
|
| 3742 |
+
|
| 3743 |
+
// Add Touch Area
|
| 3744 |
+
var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
|
| 3745 |
+
if (options.draggable) {
|
| 3746 |
+
// Regenerate dragTarget
|
| 3747 |
+
if ($dragTarget.length) {
|
| 3748 |
+
$dragTarget.remove();
|
| 3749 |
+
}
|
| 3750 |
+
|
| 3751 |
+
$dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId);
|
| 3752 |
+
$('body').append($dragTarget);
|
| 3753 |
+
} else {
|
| 3754 |
+
$dragTarget = $();
|
| 3755 |
+
}
|
| 3756 |
+
|
| 3757 |
+
if (options.edge == 'left') {
|
| 3758 |
+
menu.css('transform', 'translateX(-100%)');
|
| 3759 |
+
$dragTarget.css({ 'left': 0 }); // Add Touch Area
|
| 3760 |
+
} else {
|
| 3761 |
+
menu.addClass('right-aligned') // Change text-alignment to right
|
| 3762 |
+
.css('transform', 'translateX(100%)');
|
| 3763 |
+
$dragTarget.css({ 'right': 0 }); // Add Touch Area
|
| 3764 |
+
}
|
| 3765 |
+
|
| 3766 |
+
// If fixed sidenav, bring menu out
|
| 3767 |
+
if (menu.hasClass('fixed')) {
|
| 3768 |
+
if (window.innerWidth > 992) {
|
| 3769 |
+
menu.css('transform', 'translateX(0)');
|
| 3770 |
+
}
|
| 3771 |
+
}
|
| 3772 |
+
|
| 3773 |
+
// Window resize to reset on large screens fixed
|
| 3774 |
+
if (menu.hasClass('fixed')) {
|
| 3775 |
+
$(window).resize(function () {
|
| 3776 |
+
if (window.innerWidth > 992) {
|
| 3777 |
+
// Close menu if window is resized bigger than 992 and user has fixed sidenav
|
| 3778 |
+
if ($('#sidenav-overlay').length !== 0 && menuOut) {
|
| 3779 |
+
removeMenu(true);
|
| 3780 |
+
} else {
|
| 3781 |
+
// menu.removeAttr('style');
|
| 3782 |
+
menu.css('transform', 'translateX(0%)');
|
| 3783 |
+
// menu.css('width', options.menuWidth);
|
| 3784 |
+
}
|
| 3785 |
+
} else if (menuOut === false) {
|
| 3786 |
+
if (options.edge === 'left') {
|
| 3787 |
+
menu.css('transform', 'translateX(-100%)');
|
| 3788 |
+
} else {
|
| 3789 |
+
menu.css('transform', 'translateX(100%)');
|
| 3790 |
+
}
|
| 3791 |
+
}
|
| 3792 |
+
});
|
| 3793 |
+
}
|
| 3794 |
+
|
| 3795 |
+
// if closeOnClick, then add close event for all a tags in side sideNav
|
| 3796 |
+
if (options.closeOnClick === true) {
|
| 3797 |
+
menu.on("click.itemclick", "a:not(.collapsible-header)", function () {
|
| 3798 |
+
if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) {
|
| 3799 |
+
removeMenu();
|
| 3800 |
+
}
|
| 3801 |
+
});
|
| 3802 |
+
}
|
| 3803 |
+
|
| 3804 |
+
var removeMenu = function (restoreNav) {
|
| 3805 |
+
panning = false;
|
| 3806 |
+
menuOut = false;
|
| 3807 |
+
// Reenable scrolling
|
| 3808 |
+
$('body').css({
|
| 3809 |
+
overflow: '',
|
| 3810 |
+
width: ''
|
| 3811 |
+
});
|
| 3812 |
+
|
| 3813 |
+
$('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200,
|
| 3814 |
+
queue: false, easing: 'easeOutQuad',
|
| 3815 |
+
complete: function () {
|
| 3816 |
+
$(this).remove();
|
| 3817 |
+
} });
|
| 3818 |
+
if (options.edge === 'left') {
|
| 3819 |
+
// Reset phantom div
|
| 3820 |
+
$dragTarget.css({ width: '', right: '', left: '0' });
|
| 3821 |
+
menu.velocity({ 'translateX': '-100%' }, { duration: 200,
|
| 3822 |
+
queue: false,
|
| 3823 |
+
easing: 'easeOutCubic',
|
| 3824 |
+
complete: function () {
|
| 3825 |
+
if (restoreNav === true) {
|
| 3826 |
+
// Restore Fixed sidenav
|
| 3827 |
+
menu.removeAttr('style');
|
| 3828 |
+
menu.css('width', options.menuWidth);
|
| 3829 |
+
}
|
| 3830 |
+
}
|
| 3831 |
+
|
| 3832 |
+
});
|
| 3833 |
+
} else {
|
| 3834 |
+
// Reset phantom div
|
| 3835 |
+
$dragTarget.css({ width: '', right: '0', left: '' });
|
| 3836 |
+
menu.velocity({ 'translateX': '100%' }, { duration: 200,
|
| 3837 |
+
queue: false,
|
| 3838 |
+
easing: 'easeOutCubic',
|
| 3839 |
+
complete: function () {
|
| 3840 |
+
if (restoreNav === true) {
|
| 3841 |
+
// Restore Fixed sidenav
|
| 3842 |
+
menu.removeAttr('style');
|
| 3843 |
+
menu.css('width', options.menuWidth);
|
| 3844 |
+
}
|
| 3845 |
+
}
|
| 3846 |
+
});
|
| 3847 |
+
}
|
| 3848 |
+
|
| 3849 |
+
// Callback
|
| 3850 |
+
if (typeof options.onClose === 'function') {
|
| 3851 |
+
options.onClose.call(this, menu);
|
| 3852 |
+
}
|
| 3853 |
+
};
|
| 3854 |
+
|
| 3855 |
+
// Touch Event
|
| 3856 |
+
var panning = false;
|
| 3857 |
+
var menuOut = false;
|
| 3858 |
+
|
| 3859 |
+
if (options.draggable) {
|
| 3860 |
+
$dragTarget.on('click', function () {
|
| 3861 |
+
if (menuOut) {
|
| 3862 |
+
removeMenu();
|
| 3863 |
+
}
|
| 3864 |
+
});
|
| 3865 |
+
|
| 3866 |
+
$dragTarget.hammer({
|
| 3867 |
+
prevent_default: false
|
| 3868 |
+
}).on('pan', function (e) {
|
| 3869 |
+
|
| 3870 |
+
if (e.gesture.pointerType == "touch") {
|
| 3871 |
+
|
| 3872 |
+
var direction = e.gesture.direction;
|
| 3873 |
+
var x = e.gesture.center.x;
|
| 3874 |
+
var y = e.gesture.center.y;
|
| 3875 |
+
var velocityX = e.gesture.velocityX;
|
| 3876 |
+
|
| 3877 |
+
// Vertical scroll bugfix
|
| 3878 |
+
if (x === 0 && y === 0) {
|
| 3879 |
+
return;
|
| 3880 |
+
}
|
| 3881 |
+
|
| 3882 |
+
// Disable Scrolling
|
| 3883 |
+
var $body = $('body');
|
| 3884 |
+
var $overlay = $('#sidenav-overlay');
|
| 3885 |
+
var oldWidth = $body.innerWidth();
|
| 3886 |
+
$body.css('overflow', 'hidden');
|
| 3887 |
+
$body.width(oldWidth);
|
| 3888 |
+
|
| 3889 |
+
// If overlay does not exist, create one and if it is clicked, close menu
|
| 3890 |
+
if ($overlay.length === 0) {
|
| 3891 |
+
$overlay = $('<div id="sidenav-overlay"></div>');
|
| 3892 |
+
$overlay.css('opacity', 0).click(function () {
|
| 3893 |
+
removeMenu();
|
| 3894 |
+
});
|
| 3895 |
+
|
| 3896 |
+
// Run 'onOpen' when sidenav is opened via touch/swipe if applicable
|
| 3897 |
+
if (typeof options.onOpen === 'function') {
|
| 3898 |
+
options.onOpen.call(this, menu);
|
| 3899 |
+
}
|
| 3900 |
+
|
| 3901 |
+
$('body').append($overlay);
|
| 3902 |
+
}
|
| 3903 |
+
|
| 3904 |
+
// Keep within boundaries
|
| 3905 |
+
if (options.edge === 'left') {
|
| 3906 |
+
if (x > options.menuWidth) {
|
| 3907 |
+
x = options.menuWidth;
|
| 3908 |
+
} else if (x < 0) {
|
| 3909 |
+
x = 0;
|
| 3910 |
+
}
|
| 3911 |
+
}
|
| 3912 |
+
|
| 3913 |
+
if (options.edge === 'left') {
|
| 3914 |
+
// Left Direction
|
| 3915 |
+
if (x < options.menuWidth / 2) {
|
| 3916 |
+
menuOut = false;
|
| 3917 |
+
}
|
| 3918 |
+
// Right Direction
|
| 3919 |
+
else if (x >= options.menuWidth / 2) {
|
| 3920 |
+
menuOut = true;
|
| 3921 |
+
}
|
| 3922 |
+
menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
|
| 3923 |
+
} else {
|
| 3924 |
+
// Left Direction
|
| 3925 |
+
if (x < window.innerWidth - options.menuWidth / 2) {
|
| 3926 |
+
menuOut = true;
|
| 3927 |
+
}
|
| 3928 |
+
// Right Direction
|
| 3929 |
+
else if (x >= window.innerWidth - options.menuWidth / 2) {
|
| 3930 |
+
menuOut = false;
|
| 3931 |
+
}
|
| 3932 |
+
var rightPos = x - options.menuWidth / 2;
|
| 3933 |
+
if (rightPos < 0) {
|
| 3934 |
+
rightPos = 0;
|
| 3935 |
+
}
|
| 3936 |
+
|
| 3937 |
+
menu.css('transform', 'translateX(' + rightPos + 'px)');
|
| 3938 |
+
}
|
| 3939 |
+
|
| 3940 |
+
// Percentage overlay
|
| 3941 |
+
var overlayPerc;
|
| 3942 |
+
if (options.edge === 'left') {
|
| 3943 |
+
overlayPerc = x / options.menuWidth;
|
| 3944 |
+
$overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
|
| 3945 |
+
} else {
|
| 3946 |
+
overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
|
| 3947 |
+
$overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
|
| 3948 |
+
}
|
| 3949 |
+
}
|
| 3950 |
+
}).on('panend', function (e) {
|
| 3951 |
+
|
| 3952 |
+
if (e.gesture.pointerType == "touch") {
|
| 3953 |
+
var $overlay = $('#sidenav-overlay');
|
| 3954 |
+
var velocityX = e.gesture.velocityX;
|
| 3955 |
+
var x = e.gesture.center.x;
|
| 3956 |
+
var leftPos = x - options.menuWidth;
|
| 3957 |
+
var rightPos = x - options.menuWidth / 2;
|
| 3958 |
+
if (leftPos > 0) {
|
| 3959 |
+
leftPos = 0;
|
| 3960 |
+
}
|
| 3961 |
+
if (rightPos < 0) {
|
| 3962 |
+
rightPos = 0;
|
| 3963 |
+
}
|
| 3964 |
+
panning = false;
|
| 3965 |
+
|
| 3966 |
+
if (options.edge === 'left') {
|
| 3967 |
+
// If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
|
| 3968 |
+
if (menuOut && velocityX <= 0.3 || velocityX < -0.5) {
|
| 3969 |
+
// Return menu to open
|
| 3970 |
+
if (leftPos !== 0) {
|
| 3971 |
+
menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
|
| 3972 |
+
}
|
| 3973 |
+
|
| 3974 |
+
$overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
|
| 3975 |
+
$dragTarget.css({ width: '50%', right: 0, left: '' });
|
| 3976 |
+
menuOut = true;
|
| 3977 |
+
} else if (!menuOut || velocityX > 0.3) {
|
| 3978 |
+
// Enable Scrolling
|
| 3979 |
+
$('body').css({
|
| 3980 |
+
overflow: '',
|
| 3981 |
+
width: ''
|
| 3982 |
+
});
|
| 3983 |
+
// Slide menu closed
|
| 3984 |
+
menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
|
| 3985 |
+
$overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
|
| 3986 |
+
complete: function () {
|
| 3987 |
+
// Run 'onClose' when sidenav is closed via touch/swipe if applicable
|
| 3988 |
+
if (typeof options.onClose === 'function') {
|
| 3989 |
+
options.onClose.call(this, menu);
|
| 3990 |
+
}
|
| 3991 |
+
|
| 3992 |
+
$(this).remove();
|
| 3993 |
+
} });
|
| 3994 |
+
$dragTarget.css({ width: '10px', right: '', left: 0 });
|
| 3995 |
+
}
|
| 3996 |
+
} else {
|
| 3997 |
+
if (menuOut && velocityX >= -0.3 || velocityX > 0.5) {
|
| 3998 |
+
// Return menu to open
|
| 3999 |
+
if (rightPos !== 0) {
|
| 4000 |
+
menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
|
| 4001 |
+
}
|
| 4002 |
+
|
| 4003 |
+
$overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
|
| 4004 |
+
$dragTarget.css({ width: '50%', right: '', left: 0 });
|
| 4005 |
+
menuOut = true;
|
| 4006 |
+
} else if (!menuOut || velocityX < -0.3) {
|
| 4007 |
+
// Enable Scrolling
|
| 4008 |
+
$('body').css({
|
| 4009 |
+
overflow: '',
|
| 4010 |
+
width: ''
|
| 4011 |
+
});
|
| 4012 |
+
|
| 4013 |
+
// Slide menu closed
|
| 4014 |
+
menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
|
| 4015 |
+
$overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
|
| 4016 |
+
complete: function () {
|
| 4017 |
+
// Run 'onClose' when sidenav is closed via touch/swipe if applicable
|
| 4018 |
+
if (typeof options.onClose === 'function') {
|
| 4019 |
+
options.onClose.call(this, menu);
|
| 4020 |
+
}
|
| 4021 |
+
|
| 4022 |
+
$(this).remove();
|
| 4023 |
+
} });
|
| 4024 |
+
$dragTarget.css({ width: '10px', right: 0, left: '' });
|
| 4025 |
+
}
|
| 4026 |
+
}
|
| 4027 |
+
}
|
| 4028 |
+
});
|
| 4029 |
+
}
|
| 4030 |
+
|
| 4031 |
+
$this.off('click.sidenav').on('click.sidenav', function () {
|
| 4032 |
+
if (menuOut === true) {
|
| 4033 |
+
menuOut = false;
|
| 4034 |
+
panning = false;
|
| 4035 |
+
removeMenu();
|
| 4036 |
+
} else {
|
| 4037 |
+
|
| 4038 |
+
// Disable Scrolling
|
| 4039 |
+
var $body = $('body');
|
| 4040 |
+
var $overlay = $('<div id="sidenav-overlay"></div>');
|
| 4041 |
+
var oldWidth = $body.innerWidth();
|
| 4042 |
+
$body.css('overflow', 'hidden');
|
| 4043 |
+
$body.width(oldWidth);
|
| 4044 |
+
|
| 4045 |
+
// Push current drag target on top of DOM tree
|
| 4046 |
+
$('body').append($dragTarget);
|
| 4047 |
+
|
| 4048 |
+
if (options.edge === 'left') {
|
| 4049 |
+
$dragTarget.css({ width: '50%', right: 0, left: '' });
|
| 4050 |
+
menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
|
| 4051 |
+
} else {
|
| 4052 |
+
$dragTarget.css({ width: '50%', right: '', left: 0 });
|
| 4053 |
+
menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
|
| 4054 |
+
}
|
| 4055 |
+
|
| 4056 |
+
// Overlay close on click
|
| 4057 |
+
$overlay.css('opacity', 0).click(function () {
|
| 4058 |
+
menuOut = false;
|
| 4059 |
+
panning = false;
|
| 4060 |
+
removeMenu();
|
| 4061 |
+
$overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad',
|
| 4062 |
+
complete: function () {
|
| 4063 |
+
$(this).remove();
|
| 4064 |
+
}
|
| 4065 |
+
});
|
| 4066 |
+
});
|
| 4067 |
+
|
| 4068 |
+
// Append body
|
| 4069 |
+
$('body').append($overlay);
|
| 4070 |
+
$overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad',
|
| 4071 |
+
complete: function () {
|
| 4072 |
+
menuOut = true;
|
| 4073 |
+
panning = false;
|
| 4074 |
+
}
|
| 4075 |
+
});
|
| 4076 |
+
|
| 4077 |
+
// Callback
|
| 4078 |
+
if (typeof options.onOpen === 'function') {
|
| 4079 |
+
options.onOpen.call(this, menu);
|
| 4080 |
+
}
|
| 4081 |
+
}
|
| 4082 |
+
|
| 4083 |
+
return false;
|
| 4084 |
+
});
|
| 4085 |
+
});
|
| 4086 |
+
},
|
| 4087 |
+
destroy: function () {
|
| 4088 |
+
var $overlay = $('#sidenav-overlay');
|
| 4089 |
+
var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
|
| 4090 |
+
$overlay.trigger('click');
|
| 4091 |
+
$dragTarget.remove();
|
| 4092 |
+
$(this).off('click');
|
| 4093 |
+
$overlay.remove();
|
| 4094 |
+
},
|
| 4095 |
+
show: function () {
|
| 4096 |
+
this.trigger('click');
|
| 4097 |
+
},
|
| 4098 |
+
hide: function () {
|
| 4099 |
+
$('#sidenav-overlay').trigger('click');
|
| 4100 |
+
}
|
| 4101 |
+
};
|
| 4102 |
+
|
| 4103 |
+
$.fn.sideNav = function (methodOrOptions) {
|
| 4104 |
+
if (methods[methodOrOptions]) {
|
| 4105 |
+
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
|
| 4106 |
+
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
|
| 4107 |
+
// Default to "init"
|
| 4108 |
+
return methods.init.apply(this, arguments);
|
| 4109 |
+
} else {
|
| 4110 |
+
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav');
|
| 4111 |
+
}
|
| 4112 |
+
}; // Plugin end
|
| 4113 |
+
})(jQuery);
|
| 4114 |
+
; /**
|
| 4115 |
+
* Extend jquery with a scrollspy plugin.
|
| 4116 |
+
* This watches the window scroll and fires events when elements are scrolled into viewport.
|
| 4117 |
+
*
|
| 4118 |
+
* throttle() and getTime() taken from Underscore.js
|
| 4119 |
+
* https://github.com/jashkenas/underscore
|
| 4120 |
+
*
|
| 4121 |
+
* @author Copyright 2013 John Smart
|
| 4122 |
+
* @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
|
| 4123 |
+
* @see https://github.com/thesmart
|
| 4124 |
+
* @version 0.1.2
|
| 4125 |
+
*/
|
| 4126 |
+
(function ($) {
|
| 4127 |
+
|
| 4128 |
+
var jWindow = $(window);
|
| 4129 |
+
var elements = [];
|
| 4130 |
+
var elementsInView = [];
|
| 4131 |
+
var isSpying = false;
|
| 4132 |
+
var ticks = 0;
|
| 4133 |
+
var unique_id = 1;
|
| 4134 |
+
var offset = {
|
| 4135 |
+
top: 0,
|
| 4136 |
+
right: 0,
|
| 4137 |
+
bottom: 0,
|
| 4138 |
+
left: 0
|
| 4139 |
+
|
| 4140 |
+
/**
|
| 4141 |
+
* Find elements that are within the boundary
|
| 4142 |
+
* @param {number} top
|
| 4143 |
+
* @param {number} right
|
| 4144 |
+
* @param {number} bottom
|
| 4145 |
+
* @param {number} left
|
| 4146 |
+
* @return {jQuery} A collection of elements
|
| 4147 |
+
*/
|
| 4148 |
+
};function findElements(top, right, bottom, left) {
|
| 4149 |
+
var hits = $();
|
| 4150 |
+
$.each(elements, function (i, element) {
|
| 4151 |
+
if (element.height() > 0) {
|
| 4152 |
+
var elTop = element.offset().top,
|
| 4153 |
+
elLeft = element.offset().left,
|
| 4154 |
+
elRight = elLeft + element.width(),
|
| 4155 |
+
elBottom = elTop + element.height();
|
| 4156 |
+
|
| 4157 |
+
var isIntersect = !(elLeft > right || elRight < left || elTop > bottom || elBottom < top);
|
| 4158 |
+
|
| 4159 |
+
if (isIntersect) {
|
| 4160 |
+
hits.push(element);
|
| 4161 |
+
}
|
| 4162 |
+
}
|
| 4163 |
+
});
|
| 4164 |
+
|
| 4165 |
+
return hits;
|
| 4166 |
+
}
|
| 4167 |
+
|
| 4168 |
+
/**
|
| 4169 |
+
* Called when the user scrolls the window
|
| 4170 |
+
*/
|
| 4171 |
+
function onScroll(scrollOffset) {
|
| 4172 |
+
// unique tick id
|
| 4173 |
+
++ticks;
|
| 4174 |
+
|
| 4175 |
+
// viewport rectangle
|
| 4176 |
+
var top = jWindow.scrollTop(),
|
| 4177 |
+
left = jWindow.scrollLeft(),
|
| 4178 |
+
right = left + jWindow.width(),
|
| 4179 |
+
bottom = top + jWindow.height();
|
| 4180 |
+
|
| 4181 |
+
// determine which elements are in view
|
| 4182 |
+
var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left);
|
| 4183 |
+
$.each(intersections, function (i, element) {
|
| 4184 |
+
|
| 4185 |
+
var lastTick = element.data('scrollSpy:ticks');
|
| 4186 |
+
if (typeof lastTick != 'number') {
|
| 4187 |
+
// entered into view
|
| 4188 |
+
element.triggerHandler('scrollSpy:enter');
|
| 4189 |
+
}
|
| 4190 |
+
|
| 4191 |
+
// update tick id
|
| 4192 |
+
element.data('scrollSpy:ticks', ticks);
|
| 4193 |
+
});
|
| 4194 |
+
|
| 4195 |
+
// determine which elements are no longer in view
|
| 4196 |
+
$.each(elementsInView, function (i, element) {
|
| 4197 |
+
var lastTick = element.data('scrollSpy:ticks');
|
| 4198 |
+
if (typeof lastTick == 'number' && lastTick !== ticks) {
|
| 4199 |
+
// exited from view
|
| 4200 |
+
element.triggerHandler('scrollSpy:exit');
|
| 4201 |
+
element.data('scrollSpy:ticks', null);
|
| 4202 |
+
}
|
| 4203 |
+
});
|
| 4204 |
+
|
| 4205 |
+
// remember elements in view for next tick
|
| 4206 |
+
elementsInView = intersections;
|
| 4207 |
+
}
|
| 4208 |
+
|
| 4209 |
+
/**
|
| 4210 |
+
* Called when window is resized
|
| 4211 |
+
*/
|
| 4212 |
+
function onWinSize() {
|
| 4213 |
+
jWindow.trigger('scrollSpy:winSize');
|
| 4214 |
+
}
|
| 4215 |
+
|
| 4216 |
+
/**
|
| 4217 |
+
* Enables ScrollSpy using a selector
|
| 4218 |
+
* @param {jQuery|string} selector The elements collection, or a selector
|
| 4219 |
+
* @param {Object=} options Optional.
|
| 4220 |
+
throttle : number -> scrollspy throttling. Default: 100 ms
|
| 4221 |
+
offsetTop : number -> offset from top. Default: 0
|
| 4222 |
+
offsetRight : number -> offset from right. Default: 0
|
| 4223 |
+
offsetBottom : number -> offset from bottom. Default: 0
|
| 4224 |
+
offsetLeft : number -> offset from left. Default: 0
|
| 4225 |
+
activeClass : string -> Class name to be added to the active link. Default: active
|
| 4226 |
+
* @returns {jQuery}
|
| 4227 |
+
*/
|
| 4228 |
+
$.scrollSpy = function (selector, options) {
|
| 4229 |
+
var defaults = {
|
| 4230 |
+
throttle: 100,
|
| 4231 |
+
scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
|
| 4232 |
+
activeClass: 'active',
|
| 4233 |
+
getActiveElement: function (id) {
|
| 4234 |
+
return 'a[href="#' + id + '"]';
|
| 4235 |
+
}
|
| 4236 |
+
};
|
| 4237 |
+
options = $.extend(defaults, options);
|
| 4238 |
+
|
| 4239 |
+
var visible = [];
|
| 4240 |
+
selector = $(selector);
|
| 4241 |
+
selector.each(function (i, element) {
|
| 4242 |
+
elements.push($(element));
|
| 4243 |
+
$(element).data("scrollSpy:id", i);
|
| 4244 |
+
// Smooth scroll to section
|
| 4245 |
+
$('a[href="#' + $(element).attr('id') + '"]').click(function (e) {
|
| 4246 |
+
e.preventDefault();
|
| 4247 |
+
var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
|
| 4248 |
+
$('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' });
|
| 4249 |
+
});
|
| 4250 |
+
});
|
| 4251 |
+
|
| 4252 |
+
offset.top = options.offsetTop || 0;
|
| 4253 |
+
offset.right = options.offsetRight || 0;
|
| 4254 |
+
offset.bottom = options.offsetBottom || 0;
|
| 4255 |
+
offset.left = options.offsetLeft || 0;
|
| 4256 |
+
|
| 4257 |
+
var throttledScroll = Materialize.throttle(function () {
|
| 4258 |
+
onScroll(options.scrollOffset);
|
| 4259 |
+
}, options.throttle || 100);
|
| 4260 |
+
var readyScroll = function () {
|
| 4261 |
+
$(document).ready(throttledScroll);
|
| 4262 |
+
};
|
| 4263 |
+
|
| 4264 |
+
if (!isSpying) {
|
| 4265 |
+
jWindow.on('scroll', readyScroll);
|
| 4266 |
+
jWindow.on('resize', readyScroll);
|
| 4267 |
+
isSpying = true;
|
| 4268 |
+
}
|
| 4269 |
+
|
| 4270 |
+
// perform a scan once, after current execution context, and after dom is ready
|
| 4271 |
+
setTimeout(readyScroll, 0);
|
| 4272 |
+
|
| 4273 |
+
selector.on('scrollSpy:enter', function () {
|
| 4274 |
+
visible = $.grep(visible, function (value) {
|
| 4275 |
+
return value.height() != 0;
|
| 4276 |
+
});
|
| 4277 |
+
|
| 4278 |
+
var $this = $(this);
|
| 4279 |
+
|
| 4280 |
+
if (visible[0]) {
|
| 4281 |
+
$(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
|
| 4282 |
+
if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
|
| 4283 |
+
visible.unshift($(this));
|
| 4284 |
+
} else {
|
| 4285 |
+
visible.push($(this));
|
| 4286 |
+
}
|
| 4287 |
+
} else {
|
| 4288 |
+
visible.push($(this));
|
| 4289 |
+
}
|
| 4290 |
+
|
| 4291 |
+
$(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
|
| 4292 |
+
});
|
| 4293 |
+
selector.on('scrollSpy:exit', function () {
|
| 4294 |
+
visible = $.grep(visible, function (value) {
|
| 4295 |
+
return value.height() != 0;
|
| 4296 |
+
});
|
| 4297 |
+
|
| 4298 |
+
if (visible[0]) {
|
| 4299 |
+
$(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
|
| 4300 |
+
var $this = $(this);
|
| 4301 |
+
visible = $.grep(visible, function (value) {
|
| 4302 |
+
return value.attr('id') != $this.attr('id');
|
| 4303 |
+
});
|
| 4304 |
+
if (visible[0]) {
|
| 4305 |
+
// Check if empty
|
| 4306 |
+
$(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
|
| 4307 |
+
}
|
| 4308 |
+
}
|
| 4309 |
+
});
|
| 4310 |
+
|
| 4311 |
+
return selector;
|
| 4312 |
+
};
|
| 4313 |
+
|
| 4314 |
+
/**
|
| 4315 |
+
* Listen for window resize events
|
| 4316 |
+
* @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms
|
| 4317 |
+
* @returns {jQuery} $(window)
|
| 4318 |
+
*/
|
| 4319 |
+
$.winSizeSpy = function (options) {
|
| 4320 |
+
$.winSizeSpy = function () {
|
| 4321 |
+
return jWindow;
|
| 4322 |
+
}; // lock from multiple calls
|
| 4323 |
+
options = options || {
|
| 4324 |
+
throttle: 100
|
| 4325 |
+
};
|
| 4326 |
+
return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
|
| 4327 |
+
};
|
| 4328 |
+
|
| 4329 |
+
/**
|
| 4330 |
+
* Enables ScrollSpy on a collection of elements
|
| 4331 |
+
* e.g. $('.scrollSpy').scrollSpy()
|
| 4332 |
+
* @param {Object=} options Optional.
|
| 4333 |
+
throttle : number -> scrollspy throttling. Default: 100 ms
|
| 4334 |
+
offsetTop : number -> offset from top. Default: 0
|
| 4335 |
+
offsetRight : number -> offset from right. Default: 0
|
| 4336 |
+
offsetBottom : number -> offset from bottom. Default: 0
|
| 4337 |
+
offsetLeft : number -> offset from left. Default: 0
|
| 4338 |
+
* @returns {jQuery}
|
| 4339 |
+
*/
|
| 4340 |
+
$.fn.scrollSpy = function (options) {
|
| 4341 |
+
return $.scrollSpy($(this), options);
|
| 4342 |
+
};
|
| 4343 |
+
})(jQuery);
|
| 4344 |
+
;(function ($) {
|
| 4345 |
+
$(document).ready(function () {
|
| 4346 |
+
|
| 4347 |
+
// Function to update labels of text fields
|
| 4348 |
+
Materialize.updateTextFields = function () {
|
| 4349 |
+
var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
|
| 4350 |
+
$(input_selector).each(function (index, element) {
|
| 4351 |
+
var $this = $(this);
|
| 4352 |
+
if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
|
| 4353 |
+
$this.siblings('label').addClass('active');
|
| 4354 |
+
} else if ($(element)[0].validity) {
|
| 4355 |
+
$this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
|
| 4356 |
+
} else {
|
| 4357 |
+
$this.siblings('label').removeClass('active');
|
| 4358 |
+
}
|
| 4359 |
+
});
|
| 4360 |
+
};
|
| 4361 |
+
|
| 4362 |
+
// Text based inputs
|
| 4363 |
+
var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
|
| 4364 |
+
|
| 4365 |
+
// Add active if form auto complete
|
| 4366 |
+
$(document).on('change', input_selector, function () {
|
| 4367 |
+
if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
|
| 4368 |
+
$(this).siblings('label').addClass('active');
|
| 4369 |
+
}
|
| 4370 |
+
validate_field($(this));
|
| 4371 |
+
});
|
| 4372 |
+
|
| 4373 |
+
// Add active if input element has been pre-populated on document ready
|
| 4374 |
+
$(document).ready(function () {
|
| 4375 |
+
Materialize.updateTextFields();
|
| 4376 |
+
});
|
| 4377 |
+
|
| 4378 |
+
// HTML DOM FORM RESET handling
|
| 4379 |
+
$(document).on('reset', function (e) {
|
| 4380 |
+
var formReset = $(e.target);
|
| 4381 |
+
if (formReset.is('form')) {
|
| 4382 |
+
formReset.find(input_selector).removeClass('valid').removeClass('invalid');
|
| 4383 |
+
formReset.find(input_selector).each(function () {
|
| 4384 |
+
if ($(this).attr('value') === '') {
|
| 4385 |
+
$(this).siblings('label').removeClass('active');
|
| 4386 |
+
}
|
| 4387 |
+
});
|
| 4388 |
+
|
| 4389 |
+
// Reset select
|
| 4390 |
+
formReset.find('select.initialized').each(function () {
|
| 4391 |
+
var reset_text = formReset.find('option[selected]').text();
|
| 4392 |
+
formReset.siblings('input.select-dropdown').val(reset_text);
|
| 4393 |
+
});
|
| 4394 |
+
}
|
| 4395 |
+
});
|
| 4396 |
+
|
| 4397 |
+
// Add active when element has focus
|
| 4398 |
+
$(document).on('focus', input_selector, function () {
|
| 4399 |
+
$(this).siblings('label, .prefix').addClass('active');
|
| 4400 |
+
});
|
| 4401 |
+
|
| 4402 |
+
$(document).on('blur', input_selector, function () {
|
| 4403 |
+
var $inputElement = $(this);
|
| 4404 |
+
var selector = ".prefix";
|
| 4405 |
+
|
| 4406 |
+
if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
|
| 4407 |
+
selector += ", label";
|
| 4408 |
+
}
|
| 4409 |
+
|
| 4410 |
+
$inputElement.siblings(selector).removeClass('active');
|
| 4411 |
+
|
| 4412 |
+
validate_field($inputElement);
|
| 4413 |
+
});
|
| 4414 |
+
|
| 4415 |
+
window.validate_field = function (object) {
|
| 4416 |
+
var hasLength = object.attr('data-length') !== undefined;
|
| 4417 |
+
var lenAttr = parseInt(object.attr('data-length'));
|
| 4418 |
+
var len = object.val().length;
|
| 4419 |
+
|
| 4420 |
+
if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) {
|
| 4421 |
+
if (object.hasClass('validate')) {
|
| 4422 |
+
object.removeClass('valid');
|
| 4423 |
+
object.removeClass('invalid');
|
| 4424 |
+
}
|
| 4425 |
+
} else {
|
| 4426 |
+
if (object.hasClass('validate')) {
|
| 4427 |
+
// Check for character counter attributes
|
| 4428 |
+
if (object.is(':valid') && hasLength && len <= lenAttr || object.is(':valid') && !hasLength) {
|
| 4429 |
+
object.removeClass('invalid');
|
| 4430 |
+
object.addClass('valid');
|
| 4431 |
+
} else {
|
| 4432 |
+
object.removeClass('valid');
|
| 4433 |
+
object.addClass('invalid');
|
| 4434 |
+
}
|
| 4435 |
+
}
|
| 4436 |
+
}
|
| 4437 |
+
};
|
| 4438 |
+
|
| 4439 |
+
// Radio and Checkbox focus class
|
| 4440 |
+
var radio_checkbox = 'input[type=radio], input[type=checkbox]';
|
| 4441 |
+
$(document).on('keyup.radio', radio_checkbox, function (e) {
|
| 4442 |
+
// TAB, check if tabbing to radio or checkbox.
|
| 4443 |
+
if (e.which === 9) {
|
| 4444 |
+
$(this).addClass('tabbed');
|
| 4445 |
+
var $this = $(this);
|
| 4446 |
+
$this.one('blur', function (e) {
|
| 4447 |
+
|
| 4448 |
+
$(this).removeClass('tabbed');
|
| 4449 |
+
});
|
| 4450 |
+
return;
|
| 4451 |
+
}
|
| 4452 |
+
});
|
| 4453 |
+
|
| 4454 |
+
// Textarea Auto Resize
|
| 4455 |
+
var hiddenDiv = $('.hiddendiv').first();
|
| 4456 |
+
if (!hiddenDiv.length) {
|
| 4457 |
+
hiddenDiv = $('<div class="hiddendiv common"></div>');
|
| 4458 |
+
$('body').append(hiddenDiv);
|
| 4459 |
+
}
|
| 4460 |
+
var text_area_selector = '.materialize-textarea';
|
| 4461 |
+
|
| 4462 |
+
function textareaAutoResize($textarea) {
|
| 4463 |
+
// Set font properties of hiddenDiv
|
| 4464 |
+
|
| 4465 |
+
var fontFamily = $textarea.css('font-family');
|
| 4466 |
+
var fontSize = $textarea.css('font-size');
|
| 4467 |
+
var lineHeight = $textarea.css('line-height');
|
| 4468 |
+
var padding = $textarea.css('padding');
|
| 4469 |
+
|
| 4470 |
+
if (fontSize) {
|
| 4471 |
+
hiddenDiv.css('font-size', fontSize);
|
| 4472 |
+
}
|
| 4473 |
+
if (fontFamily) {
|
| 4474 |
+
hiddenDiv.css('font-family', fontFamily);
|
| 4475 |
+
}
|
| 4476 |
+
if (lineHeight) {
|
| 4477 |
+
hiddenDiv.css('line-height', lineHeight);
|
| 4478 |
+
}
|
| 4479 |
+
if (padding) {
|
| 4480 |
+
hiddenDiv.css('padding', padding);
|
| 4481 |
+
}
|
| 4482 |
+
|
| 4483 |
+
// Set original-height, if none
|
| 4484 |
+
if (!$textarea.data('original-height')) {
|
| 4485 |
+
$textarea.data('original-height', $textarea.height());
|
| 4486 |
+
}
|
| 4487 |
+
|
| 4488 |
+
if ($textarea.attr('wrap') === 'off') {
|
| 4489 |
+
hiddenDiv.css('overflow-wrap', 'normal').css('white-space', 'pre');
|
| 4490 |
+
}
|
| 4491 |
+
|
| 4492 |
+
hiddenDiv.text($textarea.val() + '\n');
|
| 4493 |
+
var content = hiddenDiv.html().replace(/\n/g, '<br>');
|
| 4494 |
+
hiddenDiv.html(content);
|
| 4495 |
+
|
| 4496 |
+
// When textarea is hidden, width goes crazy.
|
| 4497 |
+
// Approximate with half of window size
|
| 4498 |
+
|
| 4499 |
+
if ($textarea.is(':visible')) {
|
| 4500 |
+
hiddenDiv.css('width', $textarea.width());
|
| 4501 |
+
} else {
|
| 4502 |
+
hiddenDiv.css('width', $(window).width() / 2);
|
| 4503 |
+
}
|
| 4504 |
+
|
| 4505 |
+
/**
|
| 4506 |
+
* Resize if the new height is greater than the
|
| 4507 |
+
* original height of the textarea
|
| 4508 |
+
*/
|
| 4509 |
+
if ($textarea.data('original-height') <= hiddenDiv.height()) {
|
| 4510 |
+
$textarea.css('height', hiddenDiv.height());
|
| 4511 |
+
} else if ($textarea.val().length < $textarea.data('previous-length')) {
|
| 4512 |
+
/**
|
| 4513 |
+
* In case the new height is less than original height, it
|
| 4514 |
+
* means the textarea has less text than before
|
| 4515 |
+
* So we set the height to the original one
|
| 4516 |
+
*/
|
| 4517 |
+
$textarea.css('height', $textarea.data('original-height'));
|
| 4518 |
+
}
|
| 4519 |
+
$textarea.data('previous-length', $textarea.val().length);
|
| 4520 |
+
}
|
| 4521 |
+
|
| 4522 |
+
$(text_area_selector).each(function () {
|
| 4523 |
+
var $textarea = $(this);
|
| 4524 |
+
/**
|
| 4525 |
+
* Instead of resizing textarea on document load,
|
| 4526 |
+
* store the original height and the original length
|
| 4527 |
+
*/
|
| 4528 |
+
$textarea.data('original-height', $textarea.height());
|
| 4529 |
+
$textarea.data('previous-length', $textarea.val().length);
|
| 4530 |
+
});
|
| 4531 |
+
|
| 4532 |
+
$('body').on('keyup keydown autoresize', text_area_selector, function () {
|
| 4533 |
+
textareaAutoResize($(this));
|
| 4534 |
+
});
|
| 4535 |
+
|
| 4536 |
+
// File Input Path
|
| 4537 |
+
$(document).on('change', '.file-field input[type="file"]', function () {
|
| 4538 |
+
var file_field = $(this).closest('.file-field');
|
| 4539 |
+
var path_input = file_field.find('input.file-path');
|
| 4540 |
+
var files = $(this)[0].files;
|
| 4541 |
+
var file_names = [];
|
| 4542 |
+
for (var i = 0; i < files.length; i++) {
|
| 4543 |
+
file_names.push(files[i].name);
|
| 4544 |
+
}
|
| 4545 |
+
path_input.val(file_names.join(", "));
|
| 4546 |
+
path_input.trigger('change');
|
| 4547 |
+
});
|
| 4548 |
+
|
| 4549 |
+
/****************
|
| 4550 |
+
* Range Input *
|
| 4551 |
+
****************/
|
| 4552 |
+
|
| 4553 |
+
var range_type = 'input[type=range]';
|
| 4554 |
+
var range_mousedown = false;
|
| 4555 |
+
var left;
|
| 4556 |
+
|
| 4557 |
+
$(range_type).each(function () {
|
| 4558 |
+
var thumb = $('<span class="thumb"><span class="value"></span></span>');
|
| 4559 |
+
$(this).after(thumb);
|
| 4560 |
+
});
|
| 4561 |
+
|
| 4562 |
+
var showRangeBubble = function (thumb) {
|
| 4563 |
+
var paddingLeft = parseInt(thumb.parent().css('padding-left'));
|
| 4564 |
+
var marginLeft = -7 + paddingLeft + 'px';
|
| 4565 |
+
thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' });
|
| 4566 |
+
};
|
| 4567 |
+
|
| 4568 |
+
var calcRangeOffset = function (range) {
|
| 4569 |
+
var width = range.width() - 15;
|
| 4570 |
+
var max = parseFloat(range.attr('max'));
|
| 4571 |
+
var min = parseFloat(range.attr('min'));
|
| 4572 |
+
var percent = (parseFloat(range.val()) - min) / (max - min);
|
| 4573 |
+
return percent * width;
|
| 4574 |
+
};
|
| 4575 |
+
|
| 4576 |
+
var range_wrapper = '.range-field';
|
| 4577 |
+
$(document).on('change', range_type, function (e) {
|
| 4578 |
+
var thumb = $(this).siblings('.thumb');
|
| 4579 |
+
thumb.find('.value').html($(this).val());
|
| 4580 |
+
|
| 4581 |
+
if (!thumb.hasClass('active')) {
|
| 4582 |
+
showRangeBubble(thumb);
|
| 4583 |
+
}
|
| 4584 |
+
|
| 4585 |
+
var offsetLeft = calcRangeOffset($(this));
|
| 4586 |
+
thumb.addClass('active').css('left', offsetLeft);
|
| 4587 |
+
});
|
| 4588 |
+
|
| 4589 |
+
$(document).on('mousedown touchstart', range_type, function (e) {
|
| 4590 |
+
var thumb = $(this).siblings('.thumb');
|
| 4591 |
+
|
| 4592 |
+
// If thumb indicator does not exist yet, create it
|
| 4593 |
+
if (thumb.length <= 0) {
|
| 4594 |
+
thumb = $('<span class="thumb"><span class="value"></span></span>');
|
| 4595 |
+
$(this).after(thumb);
|
| 4596 |
+
}
|
| 4597 |
+
|
| 4598 |
+
// Set indicator value
|
| 4599 |
+
thumb.find('.value').html($(this).val());
|
| 4600 |
+
|
| 4601 |
+
range_mousedown = true;
|
| 4602 |
+
$(this).addClass('active');
|
| 4603 |
+
|
| 4604 |
+
if (!thumb.hasClass('active')) {
|
| 4605 |
+
showRangeBubble(thumb);
|
| 4606 |
+
}
|
| 4607 |
+
|
| 4608 |
+
if (e.type !== 'input') {
|
| 4609 |
+
var offsetLeft = calcRangeOffset($(this));
|
| 4610 |
+
thumb.addClass('active').css('left', offsetLeft);
|
| 4611 |
+
}
|
| 4612 |
+
});
|
| 4613 |
+
|
| 4614 |
+
$(document).on('mouseup touchend', range_wrapper, function () {
|
| 4615 |
+
range_mousedown = false;
|
| 4616 |
+
$(this).removeClass('active');
|
| 4617 |
+
});
|
| 4618 |
+
|
| 4619 |
+
$(document).on('input mousemove touchmove', range_wrapper, function (e) {
|
| 4620 |
+
var thumb = $(this).children('.thumb');
|
| 4621 |
+
var left;
|
| 4622 |
+
var input = $(this).find(range_type);
|
| 4623 |
+
|
| 4624 |
+
if (range_mousedown) {
|
| 4625 |
+
if (!thumb.hasClass('active')) {
|
| 4626 |
+
showRangeBubble(thumb);
|
| 4627 |
+
}
|
| 4628 |
+
|
| 4629 |
+
var offsetLeft = calcRangeOffset(input);
|
| 4630 |
+
thumb.addClass('active').css('left', offsetLeft);
|
| 4631 |
+
thumb.find('.value').html(thumb.siblings(range_type).val());
|
| 4632 |
+
}
|
| 4633 |
+
});
|
| 4634 |
+
|
| 4635 |
+
$(document).on('mouseout touchleave', range_wrapper, function () {
|
| 4636 |
+
if (!range_mousedown) {
|
| 4637 |
+
|
| 4638 |
+
var thumb = $(this).children('.thumb');
|
| 4639 |
+
var paddingLeft = parseInt($(this).css('padding-left'));
|
| 4640 |
+
var marginLeft = 7 + paddingLeft + 'px';
|
| 4641 |
+
|
| 4642 |
+
if (thumb.hasClass('active')) {
|
| 4643 |
+
thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 });
|
| 4644 |
+
}
|
| 4645 |
+
thumb.removeClass('active');
|
| 4646 |
+
}
|
| 4647 |
+
});
|
| 4648 |
+
|
| 4649 |
+
/**************************
|
| 4650 |
+
* Auto complete plugin *
|
| 4651 |
+
*************************/
|
| 4652 |
+
$.fn.autocomplete = function (options) {
|
| 4653 |
+
// Defaults
|
| 4654 |
+
var defaults = {
|
| 4655 |
+
data: {},
|
| 4656 |
+
limit: Infinity,
|
| 4657 |
+
onAutocomplete: null,
|
| 4658 |
+
minLength: 1
|
| 4659 |
+
};
|
| 4660 |
+
|
| 4661 |
+
options = $.extend(defaults, options);
|
| 4662 |
+
|
| 4663 |
+
return this.each(function () {
|
| 4664 |
+
var $input = $(this);
|
| 4665 |
+
var data = options.data,
|
| 4666 |
+
count = 0,
|
| 4667 |
+
activeIndex = -1,
|
| 4668 |
+
oldVal,
|
| 4669 |
+
$inputDiv = $input.closest('.input-field'); // Div to append on
|
| 4670 |
+
|
| 4671 |
+
// Check if data isn't empty
|
| 4672 |
+
if (!$.isEmptyObject(data)) {
|
| 4673 |
+
var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>');
|
| 4674 |
+
var $oldAutocomplete;
|
| 4675 |
+
|
| 4676 |
+
// Append autocomplete element.
|
| 4677 |
+
// Prevent double structure init.
|
| 4678 |
+
if ($inputDiv.length) {
|
| 4679 |
+
$oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
|
| 4680 |
+
if (!$oldAutocomplete.length) {
|
| 4681 |
+
$inputDiv.append($autocomplete); // Set ul in body
|
| 4682 |
+
}
|
| 4683 |
+
} else {
|
| 4684 |
+
$oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
|
| 4685 |
+
if (!$oldAutocomplete.length) {
|
| 4686 |
+
$input.after($autocomplete);
|
| 4687 |
+
}
|
| 4688 |
+
}
|
| 4689 |
+
if ($oldAutocomplete.length) {
|
| 4690 |
+
$autocomplete = $oldAutocomplete;
|
| 4691 |
+
}
|
| 4692 |
+
|
| 4693 |
+
// Highlight partial match.
|
| 4694 |
+
var highlight = function (string, $el) {
|
| 4695 |
+
var img = $el.find('img');
|
| 4696 |
+
var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
|
| 4697 |
+
matchEnd = matchStart + string.length - 1,
|
| 4698 |
+
beforeMatch = $el.text().slice(0, matchStart),
|
| 4699 |
+
matchText = $el.text().slice(matchStart, matchEnd + 1),
|
| 4700 |
+
afterMatch = $el.text().slice(matchEnd + 1);
|
| 4701 |
+
$el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>");
|
| 4702 |
+
if (img.length) {
|
| 4703 |
+
$el.prepend(img);
|
| 4704 |
+
}
|
| 4705 |
+
};
|
| 4706 |
+
|
| 4707 |
+
// Reset current element position
|
| 4708 |
+
var resetCurrentElement = function () {
|
| 4709 |
+
activeIndex = -1;
|
| 4710 |
+
$autocomplete.find('.active').removeClass('active');
|
| 4711 |
+
};
|
| 4712 |
+
|
| 4713 |
+
// Remove autocomplete elements
|
| 4714 |
+
var removeAutocomplete = function () {
|
| 4715 |
+
$autocomplete.empty();
|
| 4716 |
+
resetCurrentElement();
|
| 4717 |
+
oldVal = undefined;
|
| 4718 |
+
};
|
| 4719 |
+
|
| 4720 |
+
$input.off('blur.autocomplete').on('blur.autocomplete', function () {
|
| 4721 |
+
removeAutocomplete();
|
| 4722 |
+
});
|
| 4723 |
+
|
| 4724 |
+
// Perform search
|
| 4725 |
+
$input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
|
| 4726 |
+
// Reset count.
|
| 4727 |
+
count = 0;
|
| 4728 |
+
var val = $input.val().toLowerCase();
|
| 4729 |
+
|
| 4730 |
+
// Don't capture enter or arrow key usage.
|
| 4731 |
+
if (e.which === 13 || e.which === 38 || e.which === 40) {
|
| 4732 |
+
return;
|
| 4733 |
+
}
|
| 4734 |
+
|
| 4735 |
+
// Check if the input isn't empty
|
| 4736 |
+
if (oldVal !== val) {
|
| 4737 |
+
removeAutocomplete();
|
| 4738 |
+
|
| 4739 |
+
if (val.length >= options.minLength) {
|
| 4740 |
+
for (var key in data) {
|
| 4741 |
+
if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1) {
|
| 4742 |
+
// Break if past limit
|
| 4743 |
+
if (count >= options.limit) {
|
| 4744 |
+
break;
|
| 4745 |
+
}
|
| 4746 |
+
|
| 4747 |
+
var autocompleteOption = $('<li></li>');
|
| 4748 |
+
if (!!data[key]) {
|
| 4749 |
+
autocompleteOption.append('<img src="' + data[key] + '" class="right circle"><span>' + key + '</span>');
|
| 4750 |
+
} else {
|
| 4751 |
+
autocompleteOption.append('<span>' + key + '</span>');
|
| 4752 |
+
}
|
| 4753 |
+
|
| 4754 |
+
$autocomplete.append(autocompleteOption);
|
| 4755 |
+
highlight(val, autocompleteOption);
|
| 4756 |
+
count++;
|
| 4757 |
+
}
|
| 4758 |
+
}
|
| 4759 |
+
}
|
| 4760 |
+
}
|
| 4761 |
+
|
| 4762 |
+
// Update oldVal
|
| 4763 |
+
oldVal = val;
|
| 4764 |
+
});
|
| 4765 |
+
|
| 4766 |
+
$input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
|
| 4767 |
+
// Arrow keys and enter key usage
|
| 4768 |
+
var keyCode = e.which,
|
| 4769 |
+
liElement,
|
| 4770 |
+
numItems = $autocomplete.children('li').length,
|
| 4771 |
+
$active = $autocomplete.children('.active').first();
|
| 4772 |
+
|
| 4773 |
+
// select element on Enter
|
| 4774 |
+
if (keyCode === 13 && activeIndex >= 0) {
|
| 4775 |
+
liElement = $autocomplete.children('li').eq(activeIndex);
|
| 4776 |
+
if (liElement.length) {
|
| 4777 |
+
liElement.trigger('mousedown.autocomplete');
|
| 4778 |
+
e.preventDefault();
|
| 4779 |
+
}
|
| 4780 |
+
return;
|
| 4781 |
+
}
|
| 4782 |
+
|
| 4783 |
+
// Capture up and down key
|
| 4784 |
+
if (keyCode === 38 || keyCode === 40) {
|
| 4785 |
+
e.preventDefault();
|
| 4786 |
+
|
| 4787 |
+
if (keyCode === 38 && activeIndex > 0) {
|
| 4788 |
+
activeIndex--;
|
| 4789 |
+
}
|
| 4790 |
+
|
| 4791 |
+
if (keyCode === 40 && activeIndex < numItems - 1) {
|
| 4792 |
+
activeIndex++;
|
| 4793 |
+
}
|
| 4794 |
+
|
| 4795 |
+
$active.removeClass('active');
|
| 4796 |
+
if (activeIndex >= 0) {
|
| 4797 |
+
$autocomplete.children('li').eq(activeIndex).addClass('active');
|
| 4798 |
+
}
|
| 4799 |
+
}
|
| 4800 |
+
});
|
| 4801 |
+
|
| 4802 |
+
// Set input value
|
| 4803 |
+
$autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
|
| 4804 |
+
var text = $(this).text().trim();
|
| 4805 |
+
$input.val(text);
|
| 4806 |
+
$input.trigger('change');
|
| 4807 |
+
removeAutocomplete();
|
| 4808 |
+
|
| 4809 |
+
// Handle onAutocomplete callback.
|
| 4810 |
+
if (typeof options.onAutocomplete === "function") {
|
| 4811 |
+
options.onAutocomplete.call(this, text);
|
| 4812 |
+
}
|
| 4813 |
+
});
|
| 4814 |
+
|
| 4815 |
+
// Empty data
|
| 4816 |
+
} else {
|
| 4817 |
+
$input.off('keyup.autocomplete focus.autocomplete');
|
| 4818 |
+
}
|
| 4819 |
+
});
|
| 4820 |
+
};
|
| 4821 |
+
}); // End of $(document).ready
|
| 4822 |
+
|
| 4823 |
+
/*******************
|
| 4824 |
+
* Select Plugin *
|
| 4825 |
+
******************/
|
| 4826 |
+
$.fn.material_select = function (callback) {
|
| 4827 |
+
$(this).each(function () {
|
| 4828 |
+
var $select = $(this);
|
| 4829 |
+
|
| 4830 |
+
if ($select.hasClass('browser-default')) {
|
| 4831 |
+
return; // Continue to next (return false breaks out of entire loop)
|
| 4832 |
+
}
|
| 4833 |
+
|
| 4834 |
+
var multiple = $select.attr('multiple') ? true : false,
|
| 4835 |
+
lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt
|
| 4836 |
+
|
| 4837 |
+
if (lastID) {
|
| 4838 |
+
$select.parent().find('span.caret').remove();
|
| 4839 |
+
$select.parent().find('input').remove();
|
| 4840 |
+
|
| 4841 |
+
$select.unwrap();
|
| 4842 |
+
$('ul#select-options-' + lastID).remove();
|
| 4843 |
+
}
|
| 4844 |
+
|
| 4845 |
+
// If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
|
| 4846 |
+
if (callback === 'destroy') {
|
| 4847 |
+
$select.removeAttr('data-select-id').removeClass('initialized');
|
| 4848 |
+
$(window).off('click.select');
|
| 4849 |
+
return;
|
| 4850 |
+
}
|
| 4851 |
+
|
| 4852 |
+
var uniqueID = Materialize.guid();
|
| 4853 |
+
$select.attr('data-select-id', uniqueID);
|
| 4854 |
+
var wrapper = $('<div class="select-wrapper"></div>');
|
| 4855 |
+
wrapper.addClass($select.attr('class'));
|
| 4856 |
+
if ($select.is(':disabled')) wrapper.addClass('disabled');
|
| 4857 |
+
var options = $('<ul id="select-options-' + uniqueID + '" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'),
|
| 4858 |
+
selectChildren = $select.children('option, optgroup'),
|
| 4859 |
+
valuesSelected = [],
|
| 4860 |
+
optionsHover = false;
|
| 4861 |
+
|
| 4862 |
+
var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
|
| 4863 |
+
|
| 4864 |
+
// Function that renders and appends the option taking into
|
| 4865 |
+
// account type and possible image icon.
|
| 4866 |
+
var appendOptionWithIcon = function (select, option, type) {
|
| 4867 |
+
// Add disabled attr if disabled
|
| 4868 |
+
var disabledClass = option.is(':disabled') ? 'disabled ' : '';
|
| 4869 |
+
var optgroupClass = type === 'optgroup-option' ? 'optgroup-option ' : '';
|
| 4870 |
+
var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : '';
|
| 4871 |
+
|
| 4872 |
+
// add icons
|
| 4873 |
+
var icon_url = option.data('icon');
|
| 4874 |
+
var classes = option.attr('class');
|
| 4875 |
+
if (!!icon_url) {
|
| 4876 |
+
var classString = '';
|
| 4877 |
+
if (!!classes) classString = ' class="' + classes + '"';
|
| 4878 |
+
|
| 4879 |
+
// Check for multiple type.
|
| 4880 |
+
options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + multipleCheckbox + option.html() + '</span></li>'));
|
| 4881 |
+
return true;
|
| 4882 |
+
}
|
| 4883 |
+
|
| 4884 |
+
// Check for multiple type.
|
| 4885 |
+
options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + multipleCheckbox + option.html() + '</span></li>'));
|
| 4886 |
+
};
|
| 4887 |
+
|
| 4888 |
+
/* Create dropdown structure. */
|
| 4889 |
+
if (selectChildren.length) {
|
| 4890 |
+
selectChildren.each(function () {
|
| 4891 |
+
if ($(this).is('option')) {
|
| 4892 |
+
// Direct descendant option.
|
| 4893 |
+
if (multiple) {
|
| 4894 |
+
appendOptionWithIcon($select, $(this), 'multiple');
|
| 4895 |
+
} else {
|
| 4896 |
+
appendOptionWithIcon($select, $(this));
|
| 4897 |
+
}
|
| 4898 |
+
} else if ($(this).is('optgroup')) {
|
| 4899 |
+
// Optgroup.
|
| 4900 |
+
var selectOptions = $(this).children('option');
|
| 4901 |
+
options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>'));
|
| 4902 |
+
|
| 4903 |
+
selectOptions.each(function () {
|
| 4904 |
+
appendOptionWithIcon($select, $(this), 'optgroup-option');
|
| 4905 |
+
});
|
| 4906 |
+
}
|
| 4907 |
+
});
|
| 4908 |
+
}
|
| 4909 |
+
|
| 4910 |
+
options.find('li:not(.optgroup)').each(function (i) {
|
| 4911 |
+
$(this).click(function (e) {
|
| 4912 |
+
// Check if option element is disabled
|
| 4913 |
+
if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
|
| 4914 |
+
var selected = true;
|
| 4915 |
+
|
| 4916 |
+
if (multiple) {
|
| 4917 |
+
$('input[type="checkbox"]', this).prop('checked', function (i, v) {
|
| 4918 |
+
return !v;
|
| 4919 |
+
});
|
| 4920 |
+
selected = toggleEntryFromArray(valuesSelected, i, $select);
|
| 4921 |
+
$newSelect.trigger('focus');
|
| 4922 |
+
} else {
|
| 4923 |
+
options.find('li').removeClass('active');
|
| 4924 |
+
$(this).toggleClass('active');
|
| 4925 |
+
$newSelect.val($(this).text());
|
| 4926 |
+
}
|
| 4927 |
+
|
| 4928 |
+
activateOption(options, $(this));
|
| 4929 |
+
$select.find('option').eq(i).prop('selected', selected);
|
| 4930 |
+
// Trigger onchange() event
|
| 4931 |
+
$select.trigger('change');
|
| 4932 |
+
if (typeof callback !== 'undefined') callback();
|
| 4933 |
+
}
|
| 4934 |
+
|
| 4935 |
+
e.stopPropagation();
|
| 4936 |
+
});
|
| 4937 |
+
});
|
| 4938 |
+
|
| 4939 |
+
// Wrap Elements
|
| 4940 |
+
$select.wrap(wrapper);
|
| 4941 |
+
// Add Select Display Element
|
| 4942 |
+
var dropdownIcon = $('<span class="caret">▼</span>');
|
| 4943 |
+
|
| 4944 |
+
// escape double quotes
|
| 4945 |
+
var sanitizedLabelHtml = label.replace(/"/g, '"');
|
| 4946 |
+
|
| 4947 |
+
var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + ($select.is(':disabled') ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID + '" value="' + sanitizedLabelHtml + '"/>');
|
| 4948 |
+
$select.before($newSelect);
|
| 4949 |
+
$newSelect.before(dropdownIcon);
|
| 4950 |
+
|
| 4951 |
+
$newSelect.after(options);
|
| 4952 |
+
// Check if section element is disabled
|
| 4953 |
+
if (!$select.is(':disabled')) {
|
| 4954 |
+
$newSelect.dropdown({ 'hover': false });
|
| 4955 |
+
}
|
| 4956 |
+
|
| 4957 |
+
// Copy tabindex
|
| 4958 |
+
if ($select.attr('tabindex')) {
|
| 4959 |
+
$($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
|
| 4960 |
+
}
|
| 4961 |
+
|
| 4962 |
+
$select.addClass('initialized');
|
| 4963 |
+
|
| 4964 |
+
$newSelect.on({
|
| 4965 |
+
'focus': function () {
|
| 4966 |
+
if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
|
| 4967 |
+
$('input.select-dropdown').trigger('close');
|
| 4968 |
+
$(window).off('click.select');
|
| 4969 |
+
}
|
| 4970 |
+
if (!options.is(':visible')) {
|
| 4971 |
+
$(this).trigger('open', ['focus']);
|
| 4972 |
+
var label = $(this).val();
|
| 4973 |
+
if (multiple && label.indexOf(',') >= 0) {
|
| 4974 |
+
label = label.split(',')[0];
|
| 4975 |
+
}
|
| 4976 |
+
|
| 4977 |
+
var selectedOption = options.find('li').filter(function () {
|
| 4978 |
+
return $(this).text().toLowerCase() === label.toLowerCase();
|
| 4979 |
+
})[0];
|
| 4980 |
+
activateOption(options, selectedOption, true);
|
| 4981 |
+
|
| 4982 |
+
$(window).off('click.select').on('click.select', function () {
|
| 4983 |
+
multiple && (optionsHover || $newSelect.trigger('close'));
|
| 4984 |
+
$(window).off('click.select');
|
| 4985 |
+
});
|
| 4986 |
+
}
|
| 4987 |
+
},
|
| 4988 |
+
'click': function (e) {
|
| 4989 |
+
e.stopPropagation();
|
| 4990 |
+
}
|
| 4991 |
+
});
|
| 4992 |
+
|
| 4993 |
+
$newSelect.on('blur', function () {
|
| 4994 |
+
if (!multiple) {
|
| 4995 |
+
$(this).trigger('close');
|
| 4996 |
+
$(window).off('click.select');
|
| 4997 |
+
}
|
| 4998 |
+
options.find('li.selected').removeClass('selected');
|
| 4999 |
+
});
|
| 5000 |
+
|
| 5001 |
+
options.hover(function () {
|
| 5002 |
+
optionsHover = true;
|
| 5003 |
+
}, function () {
|
| 5004 |
+
optionsHover = false;
|
| 5005 |
+
});
|
| 5006 |
+
|
| 5007 |
+
// Add initial multiple selections.
|
| 5008 |
+
if (multiple) {
|
| 5009 |
+
$select.find("option:selected:not(:disabled)").each(function () {
|
| 5010 |
+
var index = this.index;
|
| 5011 |
+
|
| 5012 |
+
toggleEntryFromArray(valuesSelected, index, $select);
|
| 5013 |
+
options.find("li:not(.optgroup)").eq(index).find(":checkbox").prop("checked", true);
|
| 5014 |
+
});
|
| 5015 |
+
}
|
| 5016 |
+
|
| 5017 |
+
/**
|
| 5018 |
+
* Make option as selected and scroll to selected position
|
| 5019 |
+
* @param {jQuery} collection Select options jQuery element
|
| 5020 |
+
* @param {Element} newOption element of the new option
|
| 5021 |
+
* @param {Boolean} firstActivation If on first activation of select
|
| 5022 |
+
*/
|
| 5023 |
+
var activateOption = function (collection, newOption, firstActivation) {
|
| 5024 |
+
if (newOption) {
|
| 5025 |
+
collection.find('li.selected').removeClass('selected');
|
| 5026 |
+
var option = $(newOption);
|
| 5027 |
+
option.addClass('selected');
|
| 5028 |
+
if (!multiple || !!firstActivation) {
|
| 5029 |
+
options.scrollTo(option);
|
| 5030 |
+
}
|
| 5031 |
+
}
|
| 5032 |
+
};
|
| 5033 |
+
|
| 5034 |
+
// Allow user to search by typing
|
| 5035 |
+
// this array is cleared after 1 second
|
| 5036 |
+
var filterQuery = [],
|
| 5037 |
+
onKeyDown = function (e) {
|
| 5038 |
+
// TAB - switch to another input
|
| 5039 |
+
if (e.which == 9) {
|
| 5040 |
+
$newSelect.trigger('close');
|
| 5041 |
+
return;
|
| 5042 |
+
}
|
| 5043 |
+
|
| 5044 |
+
// ARROW DOWN WHEN SELECT IS CLOSED - open select options
|
| 5045 |
+
if (e.which == 40 && !options.is(':visible')) {
|
| 5046 |
+
$newSelect.trigger('open');
|
| 5047 |
+
return;
|
| 5048 |
+
}
|
| 5049 |
+
|
| 5050 |
+
// ENTER WHEN SELECT IS CLOSED - submit form
|
| 5051 |
+
if (e.which == 13 && !options.is(':visible')) {
|
| 5052 |
+
return;
|
| 5053 |
+
}
|
| 5054 |
+
|
| 5055 |
+
e.preventDefault();
|
| 5056 |
+
|
| 5057 |
+
// CASE WHEN USER TYPE LETTERS
|
| 5058 |
+
var letter = String.fromCharCode(e.which).toLowerCase(),
|
| 5059 |
+
nonLetters = [9, 13, 27, 38, 40];
|
| 5060 |
+
if (letter && nonLetters.indexOf(e.which) === -1) {
|
| 5061 |
+
filterQuery.push(letter);
|
| 5062 |
+
|
| 5063 |
+
var string = filterQuery.join(''),
|
| 5064 |
+
newOption = options.find('li').filter(function () {
|
| 5065 |
+
return $(this).text().toLowerCase().indexOf(string) === 0;
|
| 5066 |
+
})[0];
|
| 5067 |
+
|
| 5068 |
+
if (newOption) {
|
| 5069 |
+
activateOption(options, newOption);
|
| 5070 |
+
}
|
| 5071 |
+
}
|
| 5072 |
+
|
| 5073 |
+
// ENTER - select option and close when select options are opened
|
| 5074 |
+
if (e.which == 13) {
|
| 5075 |
+
var activeOption = options.find('li.selected:not(.disabled)')[0];
|
| 5076 |
+
if (activeOption) {
|
| 5077 |
+
$(activeOption).trigger('click');
|
| 5078 |
+
if (!multiple) {
|
| 5079 |
+
$newSelect.trigger('close');
|
| 5080 |
+
}
|
| 5081 |
+
}
|
| 5082 |
+
}
|
| 5083 |
+
|
| 5084 |
+
// ARROW DOWN - move to next not disabled option
|
| 5085 |
+
if (e.which == 40) {
|
| 5086 |
+
if (options.find('li.selected').length) {
|
| 5087 |
+
newOption = options.find('li.selected').next('li:not(.disabled)')[0];
|
| 5088 |
+
} else {
|
| 5089 |
+
newOption = options.find('li:not(.disabled)')[0];
|
| 5090 |
+
}
|
| 5091 |
+
activateOption(options, newOption);
|
| 5092 |
+
}
|
| 5093 |
+
|
| 5094 |
+
// ESC - close options
|
| 5095 |
+
if (e.which == 27) {
|
| 5096 |
+
$newSelect.trigger('close');
|
| 5097 |
+
}
|
| 5098 |
+
|
| 5099 |
+
// ARROW UP - move to previous not disabled option
|
| 5100 |
+
if (e.which == 38) {
|
| 5101 |
+
newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
|
| 5102 |
+
if (newOption) activateOption(options, newOption);
|
| 5103 |
+
}
|
| 5104 |
+
|
| 5105 |
+
// Automaticaly clean filter query so user can search again by starting letters
|
| 5106 |
+
setTimeout(function () {
|
| 5107 |
+
filterQuery = [];
|
| 5108 |
+
}, 1000);
|
| 5109 |
+
};
|
| 5110 |
+
|
| 5111 |
+
$newSelect.on('keydown', onKeyDown);
|
| 5112 |
+
});
|
| 5113 |
+
|
| 5114 |
+
function toggleEntryFromArray(entriesArray, entryIndex, select) {
|
| 5115 |
+
var index = entriesArray.indexOf(entryIndex),
|
| 5116 |
+
notAdded = index === -1;
|
| 5117 |
+
|
| 5118 |
+
if (notAdded) {
|
| 5119 |
+
entriesArray.push(entryIndex);
|
| 5120 |
+
} else {
|
| 5121 |
+
entriesArray.splice(index, 1);
|
| 5122 |
+
}
|
| 5123 |
+
|
| 5124 |
+
select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
|
| 5125 |
+
|
| 5126 |
+
// use notAdded instead of true (to detect if the option is selected or not)
|
| 5127 |
+
select.find('option').eq(entryIndex).prop('selected', notAdded);
|
| 5128 |
+
setValueToInput(entriesArray, select);
|
| 5129 |
+
|
| 5130 |
+
return notAdded;
|
| 5131 |
+
}
|
| 5132 |
+
|
| 5133 |
+
function setValueToInput(entriesArray, select) {
|
| 5134 |
+
var value = '';
|
| 5135 |
+
|
| 5136 |
+
for (var i = 0, count = entriesArray.length; i < count; i++) {
|
| 5137 |
+
var text = select.find('option').eq(entriesArray[i]).text();
|
| 5138 |
+
|
| 5139 |
+
i === 0 ? value += text : value += ', ' + text;
|
| 5140 |
+
}
|
| 5141 |
+
|
| 5142 |
+
if (value === '') {
|
| 5143 |
+
value = select.find('option:disabled').eq(0).text();
|
| 5144 |
+
}
|
| 5145 |
+
|
| 5146 |
+
select.siblings('input.select-dropdown').val(value);
|
| 5147 |
+
}
|
| 5148 |
+
};
|
| 5149 |
+
})(jQuery);
|
| 5150 |
+
;(function ($) {
|
| 5151 |
+
|
| 5152 |
+
var methods = {
|
| 5153 |
+
|
| 5154 |
+
init: function (options) {
|
| 5155 |
+
var defaults = {
|
| 5156 |
+
indicators: true,
|
| 5157 |
+
height: 400,
|
| 5158 |
+
transition: 500,
|
| 5159 |
+
interval: 6000
|
| 5160 |
+
};
|
| 5161 |
+
options = $.extend(defaults, options);
|
| 5162 |
+
|
| 5163 |
+
return this.each(function () {
|
| 5164 |
+
|
| 5165 |
+
// For each slider, we want to keep track of
|
| 5166 |
+
// which slide is active and its associated content
|
| 5167 |
+
var $this = $(this);
|
| 5168 |
+
var $slider = $this.find('ul.slides').first();
|
| 5169 |
+
var $slides = $slider.find('> li');
|
| 5170 |
+
var $active_index = $slider.find('.active').index();
|
| 5171 |
+
var $active, $indicators, $interval;
|
| 5172 |
+
if ($active_index != -1) {
|
| 5173 |
+
$active = $slides.eq($active_index);
|
| 5174 |
+
}
|
| 5175 |
+
|
| 5176 |
+
// Transitions the caption depending on alignment
|
| 5177 |
+
function captionTransition(caption, duration) {
|
| 5178 |
+
if (caption.hasClass("center-align")) {
|
| 5179 |
+
caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false });
|
| 5180 |
+
} else if (caption.hasClass("right-align")) {
|
| 5181 |
+
caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false });
|
| 5182 |
+
} else if (caption.hasClass("left-align")) {
|
| 5183 |
+
caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false });
|
| 5184 |
+
}
|
| 5185 |
+
}
|
| 5186 |
+
|
| 5187 |
+
// This function will transition the slide to any index of the next slide
|
| 5188 |
+
function moveToSlide(index) {
|
| 5189 |
+
// Wrap around indices.
|
| 5190 |
+
if (index >= $slides.length) index = 0;else if (index < 0) index = $slides.length - 1;
|
| 5191 |
+
|
| 5192 |
+
$active_index = $slider.find('.active').index();
|
| 5193 |
+
|
| 5194 |
+
// Only do if index changes
|
| 5195 |
+
if ($active_index != index) {
|
| 5196 |
+
$active = $slides.eq($active_index);
|
| 5197 |
+
$caption = $active.find('.caption');
|
| 5198 |
+
|
| 5199 |
+
$active.removeClass('active');
|
| 5200 |
+
$active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad',
|
| 5201 |
+
complete: function () {
|
| 5202 |
+
$slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false });
|
| 5203 |
+
} });
|
| 5204 |
+
captionTransition($caption, options.transition);
|
| 5205 |
+
|
| 5206 |
+
// Update indicators
|
| 5207 |
+
if (options.indicators) {
|
| 5208 |
+
$indicators.eq($active_index).removeClass('active');
|
| 5209 |
+
}
|
| 5210 |
+
|
| 5211 |
+
$slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
|
| 5212 |
+
$slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' });
|
| 5213 |
+
$slides.eq(index).addClass('active');
|
| 5214 |
+
|
| 5215 |
+
// Update indicators
|
| 5216 |
+
if (options.indicators) {
|
| 5217 |
+
$indicators.eq(index).addClass('active');
|
| 5218 |
+
}
|
| 5219 |
+
}
|
| 5220 |
+
}
|
| 5221 |
+
|
| 5222 |
+
// Set height of slider
|
| 5223 |
+
// If fullscreen, do nothing
|
| 5224 |
+
if (!$this.hasClass('fullscreen')) {
|
| 5225 |
+
if (options.indicators) {
|
| 5226 |
+
// Add height if indicators are present
|
| 5227 |
+
$this.height(options.height + 40);
|
| 5228 |
+
} else {
|
| 5229 |
+
$this.height(options.height);
|
| 5230 |
+
}
|
| 5231 |
+
$slider.height(options.height);
|
| 5232 |
+
}
|
| 5233 |
+
|
| 5234 |
+
// Set initial positions of captions
|
| 5235 |
+
$slides.find('.caption').each(function () {
|
| 5236 |
+
captionTransition($(this), 0);
|
| 5237 |
+
});
|
| 5238 |
+
|
| 5239 |
+
// Move img src into background-image
|
| 5240 |
+
$slides.find('img').each(function () {
|
| 5241 |
+
var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
|
| 5242 |
+
if ($(this).attr('src') !== placeholderBase64) {
|
| 5243 |
+
$(this).css('background-image', 'url("' + $(this).attr('src') + '")');
|
| 5244 |
+
$(this).attr('src', placeholderBase64);
|
| 5245 |
+
}
|
| 5246 |
+
});
|
| 5247 |
+
|
| 5248 |
+
// dynamically add indicators
|
| 5249 |
+
if (options.indicators) {
|
| 5250 |
+
$indicators = $('<ul class="indicators"></ul>');
|
| 5251 |
+
$slides.each(function (index) {
|
| 5252 |
+
var $indicator = $('<li class="indicator-item"></li>');
|
| 5253 |
+
|
| 5254 |
+
// Handle clicks on indicators
|
| 5255 |
+
$indicator.click(function () {
|
| 5256 |
+
var $parent = $slider.parent();
|
| 5257 |
+
var curr_index = $parent.find($(this)).index();
|
| 5258 |
+
moveToSlide(curr_index);
|
| 5259 |
+
|
| 5260 |
+
// reset interval
|
| 5261 |
+
clearInterval($interval);
|
| 5262 |
+
$interval = setInterval(function () {
|
| 5263 |
+
$active_index = $slider.find('.active').index();
|
| 5264 |
+
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
|
| 5265 |
+
else $active_index += 1;
|
| 5266 |
+
|
| 5267 |
+
moveToSlide($active_index);
|
| 5268 |
+
}, options.transition + options.interval);
|
| 5269 |
+
});
|
| 5270 |
+
$indicators.append($indicator);
|
| 5271 |
+
});
|
| 5272 |
+
$this.append($indicators);
|
| 5273 |
+
$indicators = $this.find('ul.indicators').find('li.indicator-item');
|
| 5274 |
+
}
|
| 5275 |
+
|
| 5276 |
+
if ($active) {
|
| 5277 |
+
$active.show();
|
| 5278 |
+
} else {
|
| 5279 |
+
$slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
|
| 5280 |
+
|
| 5281 |
+
$active_index = 0;
|
| 5282 |
+
$active = $slides.eq($active_index);
|
| 5283 |
+
|
| 5284 |
+
// Update indicators
|
| 5285 |
+
if (options.indicators) {
|
| 5286 |
+
$indicators.eq($active_index).addClass('active');
|
| 5287 |
+
}
|
| 5288 |
+
}
|
| 5289 |
+
|
| 5290 |
+
// Adjust height to current slide
|
| 5291 |
+
$active.find('img').each(function () {
|
| 5292 |
+
$active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
|
| 5293 |
+
});
|
| 5294 |
+
|
| 5295 |
+
// auto scroll
|
| 5296 |
+
$interval = setInterval(function () {
|
| 5297 |
+
$active_index = $slider.find('.active').index();
|
| 5298 |
+
moveToSlide($active_index + 1);
|
| 5299 |
+
}, options.transition + options.interval);
|
| 5300 |
+
|
| 5301 |
+
// HammerJS, Swipe navigation
|
| 5302 |
+
|
| 5303 |
+
// Touch Event
|
| 5304 |
+
var panning = false;
|
| 5305 |
+
var swipeLeft = false;
|
| 5306 |
+
var swipeRight = false;
|
| 5307 |
+
|
| 5308 |
+
$this.hammer({
|
| 5309 |
+
prevent_default: false
|
| 5310 |
+
}).on('pan', function (e) {
|
| 5311 |
+
if (e.gesture.pointerType === "touch") {
|
| 5312 |
+
|
| 5313 |
+
// reset interval
|
| 5314 |
+
clearInterval($interval);
|
| 5315 |
+
|
| 5316 |
+
var direction = e.gesture.direction;
|
| 5317 |
+
var x = e.gesture.deltaX;
|
| 5318 |
+
var velocityX = e.gesture.velocityX;
|
| 5319 |
+
var velocityY = e.gesture.velocityY;
|
| 5320 |
+
|
| 5321 |
+
$curr_slide = $slider.find('.active');
|
| 5322 |
+
if (Math.abs(velocityX) > Math.abs(velocityY)) {
|
| 5323 |
+
$curr_slide.velocity({ translateX: x
|
| 5324 |
+
}, { duration: 50, queue: false, easing: 'easeOutQuad' });
|
| 5325 |
+
}
|
| 5326 |
+
|
| 5327 |
+
// Swipe Left
|
| 5328 |
+
if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.65)) {
|
| 5329 |
+
swipeRight = true;
|
| 5330 |
+
}
|
| 5331 |
+
// Swipe Right
|
| 5332 |
+
else if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.65)) {
|
| 5333 |
+
swipeLeft = true;
|
| 5334 |
+
}
|
| 5335 |
+
|
| 5336 |
+
// Make Slide Behind active slide visible
|
| 5337 |
+
var next_slide;
|
| 5338 |
+
if (swipeLeft) {
|
| 5339 |
+
next_slide = $curr_slide.next();
|
| 5340 |
+
if (next_slide.length === 0) {
|
| 5341 |
+
next_slide = $slides.first();
|
| 5342 |
+
}
|
| 5343 |
+
next_slide.velocity({ opacity: 1
|
| 5344 |
+
}, { duration: 300, queue: false, easing: 'easeOutQuad' });
|
| 5345 |
+
}
|
| 5346 |
+
if (swipeRight) {
|
| 5347 |
+
next_slide = $curr_slide.prev();
|
| 5348 |
+
if (next_slide.length === 0) {
|
| 5349 |
+
next_slide = $slides.last();
|
| 5350 |
+
}
|
| 5351 |
+
next_slide.velocity({ opacity: 1
|
| 5352 |
+
}, { duration: 300, queue: false, easing: 'easeOutQuad' });
|
| 5353 |
+
}
|
| 5354 |
+
}
|
| 5355 |
+
}).on('panend', function (e) {
|
| 5356 |
+
if (e.gesture.pointerType === "touch") {
|
| 5357 |
+
|
| 5358 |
+
$curr_slide = $slider.find('.active');
|
| 5359 |
+
panning = false;
|
| 5360 |
+
curr_index = $slider.find('.active').index();
|
| 5361 |
+
|
| 5362 |
+
if (!swipeRight && !swipeLeft || $slides.length <= 1) {
|
| 5363 |
+
// Return to original spot
|
| 5364 |
+
$curr_slide.velocity({ translateX: 0
|
| 5365 |
+
}, { duration: 300, queue: false, easing: 'easeOutQuad' });
|
| 5366 |
+
} else if (swipeLeft) {
|
| 5367 |
+
moveToSlide(curr_index + 1);
|
| 5368 |
+
$curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
|
| 5369 |
+
complete: function () {
|
| 5370 |
+
$curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
|
| 5371 |
+
} });
|
| 5372 |
+
} else if (swipeRight) {
|
| 5373 |
+
moveToSlide(curr_index - 1);
|
| 5374 |
+
$curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
|
| 5375 |
+
complete: function () {
|
| 5376 |
+
$curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
|
| 5377 |
+
} });
|
| 5378 |
+
}
|
| 5379 |
+
swipeLeft = false;
|
| 5380 |
+
swipeRight = false;
|
| 5381 |
+
|
| 5382 |
+
// Restart interval
|
| 5383 |
+
clearInterval($interval);
|
| 5384 |
+
$interval = setInterval(function () {
|
| 5385 |
+
$active_index = $slider.find('.active').index();
|
| 5386 |
+
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
|
| 5387 |
+
else $active_index += 1;
|
| 5388 |
+
|
| 5389 |
+
moveToSlide($active_index);
|
| 5390 |
+
}, options.transition + options.interval);
|
| 5391 |
+
}
|
| 5392 |
+
});
|
| 5393 |
+
|
| 5394 |
+
$this.on('sliderPause', function () {
|
| 5395 |
+
clearInterval($interval);
|
| 5396 |
+
});
|
| 5397 |
+
|
| 5398 |
+
$this.on('sliderStart', function () {
|
| 5399 |
+
clearInterval($interval);
|
| 5400 |
+
$interval = setInterval(function () {
|
| 5401 |
+
$active_index = $slider.find('.active').index();
|
| 5402 |
+
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
|
| 5403 |
+
else $active_index += 1;
|
| 5404 |
+
|
| 5405 |
+
moveToSlide($active_index);
|
| 5406 |
+
}, options.transition + options.interval);
|
| 5407 |
+
});
|
| 5408 |
+
|
| 5409 |
+
$this.on('sliderNext', function () {
|
| 5410 |
+
$active_index = $slider.find('.active').index();
|
| 5411 |
+
moveToSlide($active_index + 1);
|
| 5412 |
+
});
|
| 5413 |
+
|
| 5414 |
+
$this.on('sliderPrev', function () {
|
| 5415 |
+
$active_index = $slider.find('.active').index();
|
| 5416 |
+
moveToSlide($active_index - 1);
|
| 5417 |
+
});
|
| 5418 |
+
});
|
| 5419 |
+
},
|
| 5420 |
+
pause: function () {
|
| 5421 |
+
$(this).trigger('sliderPause');
|
| 5422 |
+
},
|
| 5423 |
+
start: function () {
|
| 5424 |
+
$(this).trigger('sliderStart');
|
| 5425 |
+
},
|
| 5426 |
+
next: function () {
|
| 5427 |
+
$(this).trigger('sliderNext');
|
| 5428 |
+
},
|
| 5429 |
+
prev: function () {
|
| 5430 |
+
$(this).trigger('sliderPrev');
|
| 5431 |
+
}
|
| 5432 |
+
};
|
| 5433 |
+
|
| 5434 |
+
$.fn.sliderZ = function (methodOrOptions) {
|
| 5435 |
+
if (methods[methodOrOptions]) {
|
| 5436 |
+
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
|
| 5437 |
+
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
|
| 5438 |
+
// Default to "init"
|
| 5439 |
+
return methods.init.apply(this, arguments);
|
| 5440 |
+
} else {
|
| 5441 |
+
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip');
|
| 5442 |
+
}
|
| 5443 |
+
}; // Plugin end
|
| 5444 |
+
})(jQuery);
|
| 5445 |
+
;(function ($) {
|
| 5446 |
+
$(document).ready(function () {
|
| 5447 |
+
|
| 5448 |
+
$(document).on('click.card', '.card', function (e) {
|
| 5449 |
+
if ($(this).find('> .card-reveal').length) {
|
| 5450 |
+
var $card = $(e.target).closest('.card');
|
| 5451 |
+
if ($card.data('initialOverflow') === undefined) {
|
| 5452 |
+
$card.data('initialOverflow', $card.css('overflow') === undefined ? '' : $card.css('overflow'));
|
| 5453 |
+
}
|
| 5454 |
+
if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
|
| 5455 |
+
// Make Reveal animate down and display none
|
| 5456 |
+
$(this).find('.card-reveal').velocity({ translateY: 0 }, {
|
| 5457 |
+
duration: 225,
|
| 5458 |
+
queue: false,
|
| 5459 |
+
easing: 'easeInOutQuad',
|
| 5460 |
+
complete: function () {
|
| 5461 |
+
$(this).css({ display: 'none' });
|
| 5462 |
+
$card.css('overflow', $card.data('initialOverflow'));
|
| 5463 |
+
}
|
| 5464 |
+
});
|
| 5465 |
+
} else if ($(e.target).is($('.card .activator')) || $(e.target).is($('.card .activator i'))) {
|
| 5466 |
+
$card.css('overflow', 'hidden');
|
| 5467 |
+
$(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' });
|
| 5468 |
+
}
|
| 5469 |
+
}
|
| 5470 |
+
});
|
| 5471 |
+
});
|
| 5472 |
+
})(jQuery);
|
| 5473 |
+
;(function ($) {
|
| 5474 |
+
var materialChipsDefaults = {
|
| 5475 |
+
data: [],
|
| 5476 |
+
placeholder: '',
|
| 5477 |
+
secondaryPlaceholder: '',
|
| 5478 |
+
autocompleteOptions: {}
|
| 5479 |
+
};
|
| 5480 |
+
|
| 5481 |
+
$(document).ready(function () {
|
| 5482 |
+
// Handle removal of static chips.
|
| 5483 |
+
$(document).on('click', '.chip .close', function (e) {
|
| 5484 |
+
var $chips = $(this).closest('.chips');
|
| 5485 |
+
if ($chips.attr('data-initialized')) {
|
| 5486 |
+
return;
|
| 5487 |
+
}
|
| 5488 |
+
$(this).closest('.chip').remove();
|
| 5489 |
+
});
|
| 5490 |
+
});
|
| 5491 |
+
|
| 5492 |
+
$.fn.material_chip = function (options) {
|
| 5493 |
+
var self = this;
|
| 5494 |
+
this.$el = $(this);
|
| 5495 |
+
this.$document = $(document);
|
| 5496 |
+
this.SELS = {
|
| 5497 |
+
CHIPS: '.chips',
|
| 5498 |
+
CHIP: '.chip',
|
| 5499 |
+
INPUT: 'input',
|
| 5500 |
+
DELETE: '.material-icons',
|
| 5501 |
+
SELECTED_CHIP: '.selected'
|
| 5502 |
+
};
|
| 5503 |
+
|
| 5504 |
+
if ('data' === options) {
|
| 5505 |
+
return this.$el.data('chips');
|
| 5506 |
+
}
|
| 5507 |
+
|
| 5508 |
+
var curr_options = $.extend({}, materialChipsDefaults, options);
|
| 5509 |
+
self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
|
| 5510 |
+
|
| 5511 |
+
// Initialize
|
| 5512 |
+
this.init = function () {
|
| 5513 |
+
var i = 0;
|
| 5514 |
+
var chips;
|
| 5515 |
+
self.$el.each(function () {
|
| 5516 |
+
var $chips = $(this);
|
| 5517 |
+
var chipId = Materialize.guid();
|
| 5518 |
+
self.chipId = chipId;
|
| 5519 |
+
|
| 5520 |
+
if (!curr_options.data || !(curr_options.data instanceof Array)) {
|
| 5521 |
+
curr_options.data = [];
|
| 5522 |
+
}
|
| 5523 |
+
$chips.data('chips', curr_options.data);
|
| 5524 |
+
$chips.attr('data-index', i);
|
| 5525 |
+
$chips.attr('data-initialized', true);
|
| 5526 |
+
|
| 5527 |
+
if (!$chips.hasClass(self.SELS.CHIPS)) {
|
| 5528 |
+
$chips.addClass('chips');
|
| 5529 |
+
}
|
| 5530 |
+
|
| 5531 |
+
self.chips($chips, chipId);
|
| 5532 |
+
i++;
|
| 5533 |
+
});
|
| 5534 |
+
};
|
| 5535 |
+
|
| 5536 |
+
this.handleEvents = function () {
|
| 5537 |
+
var SELS = self.SELS;
|
| 5538 |
+
|
| 5539 |
+
self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) {
|
| 5540 |
+
$(e.target).find(SELS.INPUT).focus();
|
| 5541 |
+
});
|
| 5542 |
+
|
| 5543 |
+
self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) {
|
| 5544 |
+
var $chip = $(e.target);
|
| 5545 |
+
if ($chip.length) {
|
| 5546 |
+
var wasSelected = $chip.hasClass('selected');
|
| 5547 |
+
var $chips = $chip.closest(SELS.CHIPS);
|
| 5548 |
+
$(SELS.CHIP).removeClass('selected');
|
| 5549 |
+
|
| 5550 |
+
if (!wasSelected) {
|
| 5551 |
+
self.selectChip($chip.index(), $chips);
|
| 5552 |
+
}
|
| 5553 |
+
}
|
| 5554 |
+
});
|
| 5555 |
+
|
| 5556 |
+
self.$document.off('keydown.chips').on('keydown.chips', function (e) {
|
| 5557 |
+
if ($(e.target).is('input, textarea')) {
|
| 5558 |
+
return;
|
| 5559 |
+
}
|
| 5560 |
+
|
| 5561 |
+
// delete
|
| 5562 |
+
var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
|
| 5563 |
+
var $chips = $chip.closest(SELS.CHIPS);
|
| 5564 |
+
var length = $chip.siblings(SELS.CHIP).length;
|
| 5565 |
+
var index;
|
| 5566 |
+
|
| 5567 |
+
if (!$chip.length) {
|
| 5568 |
+
return;
|
| 5569 |
+
}
|
| 5570 |
+
|
| 5571 |
+
if (e.which === 8 || e.which === 46) {
|
| 5572 |
+
e.preventDefault();
|
| 5573 |
+
|
| 5574 |
+
index = $chip.index();
|
| 5575 |
+
self.deleteChip(index, $chips);
|
| 5576 |
+
|
| 5577 |
+
var selectIndex = null;
|
| 5578 |
+
if (index + 1 < length) {
|
| 5579 |
+
selectIndex = index;
|
| 5580 |
+
} else if (index === length || index + 1 === length) {
|
| 5581 |
+
selectIndex = length - 1;
|
| 5582 |
+
}
|
| 5583 |
+
|
| 5584 |
+
if (selectIndex < 0) selectIndex = null;
|
| 5585 |
+
|
| 5586 |
+
if (null !== selectIndex) {
|
| 5587 |
+
self.selectChip(selectIndex, $chips);
|
| 5588 |
+
}
|
| 5589 |
+
if (!length) $chips.find('input').focus();
|
| 5590 |
+
|
| 5591 |
+
// left
|
| 5592 |
+
} else if (e.which === 37) {
|
| 5593 |
+
index = $chip.index() - 1;
|
| 5594 |
+
if (index < 0) {
|
| 5595 |
+
return;
|
| 5596 |
+
}
|
| 5597 |
+
$(SELS.CHIP).removeClass('selected');
|
| 5598 |
+
self.selectChip(index, $chips);
|
| 5599 |
+
|
| 5600 |
+
// right
|
| 5601 |
+
} else if (e.which === 39) {
|
| 5602 |
+
index = $chip.index() + 1;
|
| 5603 |
+
$(SELS.CHIP).removeClass('selected');
|
| 5604 |
+
if (index > length) {
|
| 5605 |
+
$chips.find('input').focus();
|
| 5606 |
+
return;
|
| 5607 |
+
}
|
| 5608 |
+
self.selectChip(index, $chips);
|
| 5609 |
+
}
|
| 5610 |
+
});
|
| 5611 |
+
|
| 5612 |
+
self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
|
| 5613 |
+
var $currChips = $(e.target).closest(SELS.CHIPS);
|
| 5614 |
+
$currChips.addClass('focus');
|
| 5615 |
+
$currChips.siblings('label, .prefix').addClass('active');
|
| 5616 |
+
$(SELS.CHIP).removeClass('selected');
|
| 5617 |
+
});
|
| 5618 |
+
|
| 5619 |
+
self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
|
| 5620 |
+
var $currChips = $(e.target).closest(SELS.CHIPS);
|
| 5621 |
+
$currChips.removeClass('focus');
|
| 5622 |
+
|
| 5623 |
+
// Remove active if empty
|
| 5624 |
+
if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
|
| 5625 |
+
$currChips.siblings('label').removeClass('active');
|
| 5626 |
+
}
|
| 5627 |
+
$currChips.siblings('.prefix').removeClass('active');
|
| 5628 |
+
});
|
| 5629 |
+
|
| 5630 |
+
self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
|
| 5631 |
+
var $target = $(e.target);
|
| 5632 |
+
var $chips = $target.closest(SELS.CHIPS);
|
| 5633 |
+
var chipsLength = $chips.children(SELS.CHIP).length;
|
| 5634 |
+
|
| 5635 |
+
// enter
|
| 5636 |
+
if (13 === e.which) {
|
| 5637 |
+
// Override enter if autocompleting.
|
| 5638 |
+
if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) {
|
| 5639 |
+
return;
|
| 5640 |
+
}
|
| 5641 |
+
|
| 5642 |
+
e.preventDefault();
|
| 5643 |
+
self.addChip({ tag: $target.val() }, $chips);
|
| 5644 |
+
$target.val('');
|
| 5645 |
+
return;
|
| 5646 |
+
}
|
| 5647 |
+
|
| 5648 |
+
// delete or left
|
| 5649 |
+
if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) {
|
| 5650 |
+
e.preventDefault();
|
| 5651 |
+
self.selectChip(chipsLength - 1, $chips);
|
| 5652 |
+
$target.blur();
|
| 5653 |
+
return;
|
| 5654 |
+
}
|
| 5655 |
+
});
|
| 5656 |
+
|
| 5657 |
+
// Click on delete icon in chip.
|
| 5658 |
+
self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) {
|
| 5659 |
+
var $target = $(e.target);
|
| 5660 |
+
var $chips = $target.closest(SELS.CHIPS);
|
| 5661 |
+
var $chip = $target.closest(SELS.CHIP);
|
| 5662 |
+
e.stopPropagation();
|
| 5663 |
+
self.deleteChip($chip.index(), $chips);
|
| 5664 |
+
$chips.find('input').focus();
|
| 5665 |
+
});
|
| 5666 |
+
};
|
| 5667 |
+
|
| 5668 |
+
this.chips = function ($chips, chipId) {
|
| 5669 |
+
$chips.empty();
|
| 5670 |
+
$chips.data('chips').forEach(function (elem) {
|
| 5671 |
+
$chips.append(self.renderChip(elem));
|
| 5672 |
+
});
|
| 5673 |
+
$chips.append($('<input id="' + chipId + '" class="input" placeholder="">'));
|
| 5674 |
+
self.setPlaceholder($chips);
|
| 5675 |
+
|
| 5676 |
+
// Set for attribute for label
|
| 5677 |
+
var label = $chips.next('label');
|
| 5678 |
+
if (label.length) {
|
| 5679 |
+
label.attr('for', chipId);
|
| 5680 |
+
|
| 5681 |
+
if ($chips.data('chips') !== undefined && $chips.data('chips').length) {
|
| 5682 |
+
label.addClass('active');
|
| 5683 |
+
}
|
| 5684 |
+
}
|
| 5685 |
+
|
| 5686 |
+
// Setup autocomplete if needed.
|
| 5687 |
+
var input = $('#' + chipId);
|
| 5688 |
+
if (self.hasAutocomplete) {
|
| 5689 |
+
curr_options.autocompleteOptions.onAutocomplete = function (val) {
|
| 5690 |
+
self.addChip({ tag: val }, $chips);
|
| 5691 |
+
input.val('');
|
| 5692 |
+
input.focus();
|
| 5693 |
+
};
|
| 5694 |
+
input.autocomplete(curr_options.autocompleteOptions);
|
| 5695 |
+
}
|
| 5696 |
+
};
|
| 5697 |
+
|
| 5698 |
+
/**
|
| 5699 |
+
* Render chip jQuery element.
|
| 5700 |
+
* @param {Object} elem
|
| 5701 |
+
* @return {jQuery}
|
| 5702 |
+
*/
|
| 5703 |
+
this.renderChip = function (elem) {
|
| 5704 |
+
if (!elem.tag) return;
|
| 5705 |
+
|
| 5706 |
+
var $renderedChip = $('<div class="chip"></div>');
|
| 5707 |
+
$renderedChip.text(elem.tag);
|
| 5708 |
+
if (elem.image) {
|
| 5709 |
+
$renderedChip.prepend($('<img />').attr('src', elem.image));
|
| 5710 |
+
}
|
| 5711 |
+
$renderedChip.append($('<i class="material-icons close">close</i>'));
|
| 5712 |
+
return $renderedChip;
|
| 5713 |
+
};
|
| 5714 |
+
|
| 5715 |
+
this.setPlaceholder = function ($chips) {
|
| 5716 |
+
if ($chips.data('chips') !== undefined && !$chips.data('chips').length && curr_options.placeholder) {
|
| 5717 |
+
$chips.find('input').prop('placeholder', curr_options.placeholder);
|
| 5718 |
+
} else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
|
| 5719 |
+
$chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
|
| 5720 |
+
}
|
| 5721 |
+
};
|
| 5722 |
+
|
| 5723 |
+
this.isValid = function ($chips, elem) {
|
| 5724 |
+
var chips = $chips.data('chips');
|
| 5725 |
+
var exists = false;
|
| 5726 |
+
for (var i = 0; i < chips.length; i++) {
|
| 5727 |
+
if (chips[i].tag === elem.tag) {
|
| 5728 |
+
exists = true;
|
| 5729 |
+
return;
|
| 5730 |
+
}
|
| 5731 |
+
}
|
| 5732 |
+
return '' !== elem.tag && !exists;
|
| 5733 |
+
};
|
| 5734 |
+
|
| 5735 |
+
this.addChip = function (elem, $chips) {
|
| 5736 |
+
if (!self.isValid($chips, elem)) {
|
| 5737 |
+
return;
|
| 5738 |
+
}
|
| 5739 |
+
var $renderedChip = self.renderChip(elem);
|
| 5740 |
+
var newData = [];
|
| 5741 |
+
var oldData = $chips.data('chips');
|
| 5742 |
+
for (var i = 0; i < oldData.length; i++) {
|
| 5743 |
+
newData.push(oldData[i]);
|
| 5744 |
+
}
|
| 5745 |
+
newData.push(elem);
|
| 5746 |
+
|
| 5747 |
+
$chips.data('chips', newData);
|
| 5748 |
+
$renderedChip.insertBefore($chips.find('input'));
|
| 5749 |
+
$chips.trigger('chip.add', elem);
|
| 5750 |
+
self.setPlaceholder($chips);
|
| 5751 |
+
};
|
| 5752 |
+
|
| 5753 |
+
this.deleteChip = function (chipIndex, $chips) {
|
| 5754 |
+
var chip = $chips.data('chips')[chipIndex];
|
| 5755 |
+
$chips.find('.chip').eq(chipIndex).remove();
|
| 5756 |
+
|
| 5757 |
+
var newData = [];
|
| 5758 |
+
var oldData = $chips.data('chips');
|
| 5759 |
+
for (var i = 0; i < oldData.length; i++) {
|
| 5760 |
+
if (i !== chipIndex) {
|
| 5761 |
+
newData.push(oldData[i]);
|
| 5762 |
+
}
|
| 5763 |
+
}
|
| 5764 |
+
|
| 5765 |
+
$chips.data('chips', newData);
|
| 5766 |
+
$chips.trigger('chip.delete', chip);
|
| 5767 |
+
self.setPlaceholder($chips);
|
| 5768 |
+
};
|
| 5769 |
+
|
| 5770 |
+
this.selectChip = function (chipIndex, $chips) {
|
| 5771 |
+
var $chip = $chips.find('.chip').eq(chipIndex);
|
| 5772 |
+
if ($chip && false === $chip.hasClass('selected')) {
|
| 5773 |
+
$chip.addClass('selected');
|
| 5774 |
+
$chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
|
| 5775 |
+
}
|
| 5776 |
+
};
|
| 5777 |
+
|
| 5778 |
+
this.getChipsElement = function (index, $chips) {
|
| 5779 |
+
return $chips.eq(index);
|
| 5780 |
+
};
|
| 5781 |
+
|
| 5782 |
+
// init
|
| 5783 |
+
this.init();
|
| 5784 |
+
|
| 5785 |
+
this.handleEvents();
|
| 5786 |
+
};
|
| 5787 |
+
})(jQuery);
|
| 5788 |
+
;(function ($) {
|
| 5789 |
+
$.fn.pushpin = function (options) {
|
| 5790 |
+
// Defaults
|
| 5791 |
+
var defaults = {
|
| 5792 |
+
top: 0,
|
| 5793 |
+
bottom: Infinity,
|
| 5794 |
+
offset: 0
|
| 5795 |
+
};
|
| 5796 |
+
|
| 5797 |
+
// Remove pushpin event and classes
|
| 5798 |
+
if (options === "remove") {
|
| 5799 |
+
this.each(function () {
|
| 5800 |
+
if (id = $(this).data('pushpin-id')) {
|
| 5801 |
+
$(window).off('scroll.' + id);
|
| 5802 |
+
$(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
|
| 5803 |
+
}
|
| 5804 |
+
});
|
| 5805 |
+
return false;
|
| 5806 |
+
}
|
| 5807 |
+
|
| 5808 |
+
options = $.extend(defaults, options);
|
| 5809 |
+
|
| 5810 |
+
$index = 0;
|
| 5811 |
+
return this.each(function () {
|
| 5812 |
+
var $uniqueId = Materialize.guid(),
|
| 5813 |
+
$this = $(this),
|
| 5814 |
+
$original_offset = $(this).offset().top;
|
| 5815 |
+
|
| 5816 |
+
function removePinClasses(object) {
|
| 5817 |
+
object.removeClass('pin-top');
|
| 5818 |
+
object.removeClass('pinned');
|
| 5819 |
+
object.removeClass('pin-bottom');
|
| 5820 |
+
}
|
| 5821 |
+
|
| 5822 |
+
function updateElements(objects, scrolled) {
|
| 5823 |
+
objects.each(function () {
|
| 5824 |
+
// Add position fixed (because its between top and bottom)
|
| 5825 |
+
if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
|
| 5826 |
+
removePinClasses($(this));
|
| 5827 |
+
$(this).css('top', options.offset);
|
| 5828 |
+
$(this).addClass('pinned');
|
| 5829 |
+
}
|
| 5830 |
+
|
| 5831 |
+
// Add pin-top (when scrolled position is above top)
|
| 5832 |
+
if (scrolled < options.top && !$(this).hasClass('pin-top')) {
|
| 5833 |
+
removePinClasses($(this));
|
| 5834 |
+
$(this).css('top', 0);
|
| 5835 |
+
$(this).addClass('pin-top');
|
| 5836 |
+
}
|
| 5837 |
+
|
| 5838 |
+
// Add pin-bottom (when scrolled position is below bottom)
|
| 5839 |
+
if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
|
| 5840 |
+
removePinClasses($(this));
|
| 5841 |
+
$(this).addClass('pin-bottom');
|
| 5842 |
+
$(this).css('top', options.bottom - $original_offset);
|
| 5843 |
+
}
|
| 5844 |
+
});
|
| 5845 |
+
}
|
| 5846 |
+
|
| 5847 |
+
$(this).data('pushpin-id', $uniqueId);
|
| 5848 |
+
updateElements($this, $(window).scrollTop());
|
| 5849 |
+
$(window).on('scroll.' + $uniqueId, function () {
|
| 5850 |
+
var $scrolled = $(window).scrollTop() + options.offset;
|
| 5851 |
+
updateElements($this, $scrolled);
|
| 5852 |
+
});
|
| 5853 |
+
});
|
| 5854 |
+
};
|
| 5855 |
+
})(jQuery);;(function ($) {
|
| 5856 |
+
$(document).ready(function () {
|
| 5857 |
+
|
| 5858 |
+
// jQuery reverse
|
| 5859 |
+
$.fn.reverse = [].reverse;
|
| 5860 |
+
|
| 5861 |
+
// Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
|
| 5862 |
+
$(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
|
| 5863 |
+
var $this = $(this);
|
| 5864 |
+
openFABMenu($this);
|
| 5865 |
+
});
|
| 5866 |
+
$(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
|
| 5867 |
+
var $this = $(this);
|
| 5868 |
+
closeFABMenu($this);
|
| 5869 |
+
});
|
| 5870 |
+
|
| 5871 |
+
// Toggle-on-click behaviour.
|
| 5872 |
+
$(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) {
|
| 5873 |
+
var $this = $(this);
|
| 5874 |
+
var $menu = $this.parent();
|
| 5875 |
+
if ($menu.hasClass('active')) {
|
| 5876 |
+
closeFABMenu($menu);
|
| 5877 |
+
} else {
|
| 5878 |
+
openFABMenu($menu);
|
| 5879 |
+
}
|
| 5880 |
+
});
|
| 5881 |
+
|
| 5882 |
+
// Toolbar transition behaviour.
|
| 5883 |
+
$(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) {
|
| 5884 |
+
var $this = $(this);
|
| 5885 |
+
var $menu = $this.parent();
|
| 5886 |
+
FABtoToolbar($menu);
|
| 5887 |
+
});
|
| 5888 |
+
});
|
| 5889 |
+
|
| 5890 |
+
$.fn.extend({
|
| 5891 |
+
openFAB: function () {
|
| 5892 |
+
openFABMenu($(this));
|
| 5893 |
+
},
|
| 5894 |
+
closeFAB: function () {
|
| 5895 |
+
closeFABMenu($(this));
|
| 5896 |
+
},
|
| 5897 |
+
openToolbar: function () {
|
| 5898 |
+
FABtoToolbar($(this));
|
| 5899 |
+
},
|
| 5900 |
+
closeToolbar: function () {
|
| 5901 |
+
toolbarToFAB($(this));
|
| 5902 |
+
}
|
| 5903 |
+
});
|
| 5904 |
+
|
| 5905 |
+
var openFABMenu = function (btn) {
|
| 5906 |
+
var $this = btn;
|
| 5907 |
+
if ($this.hasClass('active') === false) {
|
| 5908 |
+
|
| 5909 |
+
// Get direction option
|
| 5910 |
+
var horizontal = $this.hasClass('horizontal');
|
| 5911 |
+
var offsetY, offsetX;
|
| 5912 |
+
|
| 5913 |
+
if (horizontal === true) {
|
| 5914 |
+
offsetX = 40;
|
| 5915 |
+
} else {
|
| 5916 |
+
offsetY = 40;
|
| 5917 |
+
}
|
| 5918 |
+
|
| 5919 |
+
$this.addClass('active');
|
| 5920 |
+
$this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 });
|
| 5921 |
+
|
| 5922 |
+
var time = 0;
|
| 5923 |
+
$this.find('ul .btn-floating').reverse().each(function () {
|
| 5924 |
+
$(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time });
|
| 5925 |
+
time += 40;
|
| 5926 |
+
});
|
| 5927 |
+
}
|
| 5928 |
+
};
|
| 5929 |
+
|
| 5930 |
+
var closeFABMenu = function (btn) {
|
| 5931 |
+
var $this = btn;
|
| 5932 |
+
// Get direction option
|
| 5933 |
+
var horizontal = $this.hasClass('horizontal');
|
| 5934 |
+
var offsetY, offsetX;
|
| 5935 |
+
|
| 5936 |
+
if (horizontal === true) {
|
| 5937 |
+
offsetX = 40;
|
| 5938 |
+
} else {
|
| 5939 |
+
offsetY = 40;
|
| 5940 |
+
}
|
| 5941 |
+
|
| 5942 |
+
$this.removeClass('active');
|
| 5943 |
+
var time = 0;
|
| 5944 |
+
$this.find('ul .btn-floating').velocity("stop", true);
|
| 5945 |
+
$this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 });
|
| 5946 |
+
};
|
| 5947 |
+
|
| 5948 |
+
/**
|
| 5949 |
+
* Transform FAB into toolbar
|
| 5950 |
+
* @param {Object} object jQuery object
|
| 5951 |
+
*/
|
| 5952 |
+
var FABtoToolbar = function (btn) {
|
| 5953 |
+
if (btn.attr('data-open') === "true") {
|
| 5954 |
+
return;
|
| 5955 |
+
}
|
| 5956 |
+
|
| 5957 |
+
var offsetX, offsetY, scaleFactor;
|
| 5958 |
+
var windowWidth = window.innerWidth;
|
| 5959 |
+
var windowHeight = window.innerHeight;
|
| 5960 |
+
var btnRect = btn[0].getBoundingClientRect();
|
| 5961 |
+
var anchor = btn.find('> a').first();
|
| 5962 |
+
var menu = btn.find('> ul').first();
|
| 5963 |
+
var backdrop = $('<div class="fab-backdrop"></div>');
|
| 5964 |
+
var fabColor = anchor.css('background-color');
|
| 5965 |
+
anchor.append(backdrop);
|
| 5966 |
+
|
| 5967 |
+
offsetX = btnRect.left - windowWidth / 2 + btnRect.width / 2;
|
| 5968 |
+
offsetY = windowHeight - btnRect.bottom;
|
| 5969 |
+
scaleFactor = windowWidth / backdrop.width();
|
| 5970 |
+
btn.attr('data-origin-bottom', btnRect.bottom);
|
| 5971 |
+
btn.attr('data-origin-left', btnRect.left);
|
| 5972 |
+
btn.attr('data-origin-width', btnRect.width);
|
| 5973 |
+
|
| 5974 |
+
// Set initial state
|
| 5975 |
+
btn.addClass('active');
|
| 5976 |
+
btn.attr('data-open', true);
|
| 5977 |
+
btn.css({
|
| 5978 |
+
'text-align': 'center',
|
| 5979 |
+
width: '100%',
|
| 5980 |
+
bottom: 0,
|
| 5981 |
+
left: 0,
|
| 5982 |
+
transform: 'translateX(' + offsetX + 'px)',
|
| 5983 |
+
transition: 'none'
|
| 5984 |
+
});
|
| 5985 |
+
anchor.css({
|
| 5986 |
+
transform: 'translateY(' + -offsetY + 'px)',
|
| 5987 |
+
transition: 'none'
|
| 5988 |
+
});
|
| 5989 |
+
backdrop.css({
|
| 5990 |
+
'background-color': fabColor
|
| 5991 |
+
});
|
| 5992 |
+
|
| 5993 |
+
setTimeout(function () {
|
| 5994 |
+
btn.css({
|
| 5995 |
+
transform: '',
|
| 5996 |
+
transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
|
| 5997 |
+
});
|
| 5998 |
+
anchor.css({
|
| 5999 |
+
overflow: 'visible',
|
| 6000 |
+
transform: '',
|
| 6001 |
+
transition: 'transform .2s'
|
| 6002 |
+
});
|
| 6003 |
+
|
| 6004 |
+
setTimeout(function () {
|
| 6005 |
+
btn.css({
|
| 6006 |
+
overflow: 'hidden',
|
| 6007 |
+
'background-color': fabColor
|
| 6008 |
+
});
|
| 6009 |
+
backdrop.css({
|
| 6010 |
+
transform: 'scale(' + scaleFactor + ')',
|
| 6011 |
+
transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
|
| 6012 |
+
});
|
| 6013 |
+
menu.find('> li > a').css({
|
| 6014 |
+
opacity: 1
|
| 6015 |
+
});
|
| 6016 |
+
|
| 6017 |
+
// Scroll to close.
|
| 6018 |
+
$(window).on('scroll.fabToolbarClose', function () {
|
| 6019 |
+
toolbarToFAB(btn);
|
| 6020 |
+
$(window).off('scroll.fabToolbarClose');
|
| 6021 |
+
$(document).off('click.fabToolbarClose');
|
| 6022 |
+
});
|
| 6023 |
+
|
| 6024 |
+
$(document).on('click.fabToolbarClose', function (e) {
|
| 6025 |
+
if (!$(e.target).closest(menu).length) {
|
| 6026 |
+
toolbarToFAB(btn);
|
| 6027 |
+
$(window).off('scroll.fabToolbarClose');
|
| 6028 |
+
$(document).off('click.fabToolbarClose');
|
| 6029 |
+
}
|
| 6030 |
+
});
|
| 6031 |
+
}, 100);
|
| 6032 |
+
}, 0);
|
| 6033 |
+
};
|
| 6034 |
+
|
| 6035 |
+
/**
|
| 6036 |
+
* Transform toolbar back into FAB
|
| 6037 |
+
* @param {Object} object jQuery object
|
| 6038 |
+
*/
|
| 6039 |
+
var toolbarToFAB = function (btn) {
|
| 6040 |
+
if (btn.attr('data-open') !== "true") {
|
| 6041 |
+
return;
|
| 6042 |
+
}
|
| 6043 |
+
|
| 6044 |
+
var offsetX, offsetY, scaleFactor;
|
| 6045 |
+
var windowWidth = window.innerWidth;
|
| 6046 |
+
var windowHeight = window.innerHeight;
|
| 6047 |
+
var btnWidth = btn.attr('data-origin-width');
|
| 6048 |
+
var btnBottom = btn.attr('data-origin-bottom');
|
| 6049 |
+
var btnLeft = btn.attr('data-origin-left');
|
| 6050 |
+
var anchor = btn.find('> .btn-floating').first();
|
| 6051 |
+
var menu = btn.find('> ul').first();
|
| 6052 |
+
var backdrop = btn.find('.fab-backdrop');
|
| 6053 |
+
var fabColor = anchor.css('background-color');
|
| 6054 |
+
|
| 6055 |
+
offsetX = btnLeft - windowWidth / 2 + btnWidth / 2;
|
| 6056 |
+
offsetY = windowHeight - btnBottom;
|
| 6057 |
+
scaleFactor = windowWidth / backdrop.width();
|
| 6058 |
+
|
| 6059 |
+
// Hide backdrop
|
| 6060 |
+
btn.removeClass('active');
|
| 6061 |
+
btn.attr('data-open', false);
|
| 6062 |
+
btn.css({
|
| 6063 |
+
'background-color': 'transparent',
|
| 6064 |
+
transition: 'none'
|
| 6065 |
+
});
|
| 6066 |
+
anchor.css({
|
| 6067 |
+
transition: 'none'
|
| 6068 |
+
});
|
| 6069 |
+
backdrop.css({
|
| 6070 |
+
transform: 'scale(0)',
|
| 6071 |
+
'background-color': fabColor
|
| 6072 |
+
});
|
| 6073 |
+
menu.find('> li > a').css({
|
| 6074 |
+
opacity: ''
|
| 6075 |
+
});
|
| 6076 |
+
|
| 6077 |
+
setTimeout(function () {
|
| 6078 |
+
backdrop.remove();
|
| 6079 |
+
|
| 6080 |
+
// Set initial state.
|
| 6081 |
+
btn.css({
|
| 6082 |
+
'text-align': '',
|
| 6083 |
+
width: '',
|
| 6084 |
+
bottom: '',
|
| 6085 |
+
left: '',
|
| 6086 |
+
overflow: '',
|
| 6087 |
+
'background-color': '',
|
| 6088 |
+
transform: 'translate3d(' + -offsetX + 'px,0,0)'
|
| 6089 |
+
});
|
| 6090 |
+
anchor.css({
|
| 6091 |
+
overflow: '',
|
| 6092 |
+
transform: 'translate3d(0,' + offsetY + 'px,0)'
|
| 6093 |
+
});
|
| 6094 |
+
|
| 6095 |
+
setTimeout(function () {
|
| 6096 |
+
btn.css({
|
| 6097 |
+
transform: 'translate3d(0,0,0)',
|
| 6098 |
+
transition: 'transform .2s'
|
| 6099 |
+
});
|
| 6100 |
+
anchor.css({
|
| 6101 |
+
transform: 'translate3d(0,0,0)',
|
| 6102 |
+
transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
|
| 6103 |
+
});
|
| 6104 |
+
}, 20);
|
| 6105 |
+
}, 200);
|
| 6106 |
+
};
|
| 6107 |
+
})(jQuery);
|
| 6108 |
+
;(function ($) {
|
| 6109 |
+
// Image transition function
|
| 6110 |
+
Materialize.fadeInImage = function (selectorOrEl) {
|
| 6111 |
+
var element;
|
| 6112 |
+
if (typeof selectorOrEl === 'string') {
|
| 6113 |
+
element = $(selectorOrEl);
|
| 6114 |
+
} else if (typeof selectorOrEl === 'object') {
|
| 6115 |
+
element = selectorOrEl;
|
| 6116 |
+
} else {
|
| 6117 |
+
return;
|
| 6118 |
+
}
|
| 6119 |
+
element.css({ opacity: 0 });
|
| 6120 |
+
$(element).velocity({ opacity: 1 }, {
|
| 6121 |
+
duration: 650,
|
| 6122 |
+
queue: false,
|
| 6123 |
+
easing: 'easeOutSine'
|
| 6124 |
+
});
|
| 6125 |
+
$(element).velocity({ opacity: 1 }, {
|
| 6126 |
+
duration: 1300,
|
| 6127 |
+
queue: false,
|
| 6128 |
+
easing: 'swing',
|
| 6129 |
+
step: function (now, fx) {
|
| 6130 |
+
fx.start = 100;
|
| 6131 |
+
var grayscale_setting = now / 100;
|
| 6132 |
+
var brightness_setting = 150 - (100 - now) / 1.75;
|
| 6133 |
+
|
| 6134 |
+
if (brightness_setting < 100) {
|
| 6135 |
+
brightness_setting = 100;
|
| 6136 |
+
}
|
| 6137 |
+
if (now >= 0) {
|
| 6138 |
+
$(this).css({
|
| 6139 |
+
"-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)",
|
| 6140 |
+
"filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)"
|
| 6141 |
+
});
|
| 6142 |
+
}
|
| 6143 |
+
}
|
| 6144 |
+
});
|
| 6145 |
+
};
|
| 6146 |
+
|
| 6147 |
+
// Horizontal staggered list
|
| 6148 |
+
Materialize.showStaggeredList = function (selectorOrEl) {
|
| 6149 |
+
var element;
|
| 6150 |
+
if (typeof selectorOrEl === 'string') {
|
| 6151 |
+
element = $(selectorOrEl);
|
| 6152 |
+
} else if (typeof selectorOrEl === 'object') {
|
| 6153 |
+
element = selectorOrEl;
|
| 6154 |
+
} else {
|
| 6155 |
+
return;
|
| 6156 |
+
}
|
| 6157 |
+
var time = 0;
|
| 6158 |
+
element.find('li').velocity({ translateX: "-100px" }, { duration: 0 });
|
| 6159 |
+
|
| 6160 |
+
element.find('li').each(function () {
|
| 6161 |
+
$(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] });
|
| 6162 |
+
time += 120;
|
| 6163 |
+
});
|
| 6164 |
+
};
|
| 6165 |
+
|
| 6166 |
+
$(document).ready(function () {
|
| 6167 |
+
// Hardcoded .staggered-list scrollFire
|
| 6168 |
+
// var staggeredListOptions = [];
|
| 6169 |
+
// $('ul.staggered-list').each(function (i) {
|
| 6170 |
+
|
| 6171 |
+
// var label = 'scrollFire-' + i;
|
| 6172 |
+
// $(this).addClass(label);
|
| 6173 |
+
// staggeredListOptions.push(
|
| 6174 |
+
// {selector: 'ul.staggered-list.' + label,
|
| 6175 |
+
// offset: 200,
|
| 6176 |
+
// callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
|
| 6177 |
+
// });
|
| 6178 |
+
// scrollFire(staggeredListOptions);
|
| 6179 |
+
|
| 6180 |
+
// HammerJS, Swipe navigation
|
| 6181 |
+
|
| 6182 |
+
// Touch Event
|
| 6183 |
+
var swipeLeft = false;
|
| 6184 |
+
var swipeRight = false;
|
| 6185 |
+
|
| 6186 |
+
// Dismissible Collections
|
| 6187 |
+
$('.dismissable').each(function () {
|
| 6188 |
+
$(this).hammer({
|
| 6189 |
+
prevent_default: false
|
| 6190 |
+
}).on('pan', function (e) {
|
| 6191 |
+
if (e.gesture.pointerType === "touch") {
|
| 6192 |
+
var $this = $(this);
|
| 6193 |
+
var direction = e.gesture.direction;
|
| 6194 |
+
var x = e.gesture.deltaX;
|
| 6195 |
+
var velocityX = e.gesture.velocityX;
|
| 6196 |
+
|
| 6197 |
+
$this.velocity({ translateX: x
|
| 6198 |
+
}, { duration: 50, queue: false, easing: 'easeOutQuad' });
|
| 6199 |
+
|
| 6200 |
+
// Swipe Left
|
| 6201 |
+
if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.75)) {
|
| 6202 |
+
swipeLeft = true;
|
| 6203 |
+
}
|
| 6204 |
+
|
| 6205 |
+
// Swipe Right
|
| 6206 |
+
if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.75)) {
|
| 6207 |
+
swipeRight = true;
|
| 6208 |
+
}
|
| 6209 |
+
}
|
| 6210 |
+
}).on('panend', function (e) {
|
| 6211 |
+
// Reset if collection is moved back into original position
|
| 6212 |
+
if (Math.abs(e.gesture.deltaX) < $(this).innerWidth() / 2) {
|
| 6213 |
+
swipeRight = false;
|
| 6214 |
+
swipeLeft = false;
|
| 6215 |
+
}
|
| 6216 |
+
|
| 6217 |
+
if (e.gesture.pointerType === "touch") {
|
| 6218 |
+
var $this = $(this);
|
| 6219 |
+
if (swipeLeft || swipeRight) {
|
| 6220 |
+
var fullWidth;
|
| 6221 |
+
if (swipeLeft) {
|
| 6222 |
+
fullWidth = $this.innerWidth();
|
| 6223 |
+
} else {
|
| 6224 |
+
fullWidth = -1 * $this.innerWidth();
|
| 6225 |
+
}
|
| 6226 |
+
|
| 6227 |
+
$this.velocity({ translateX: fullWidth
|
| 6228 |
+
}, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () {
|
| 6229 |
+
$this.css('border', 'none');
|
| 6230 |
+
$this.velocity({ height: 0, padding: 0
|
| 6231 |
+
}, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () {
|
| 6232 |
+
$this.remove();
|
| 6233 |
+
}
|
| 6234 |
+
});
|
| 6235 |
+
}
|
| 6236 |
+
});
|
| 6237 |
+
} else {
|
| 6238 |
+
$this.velocity({ translateX: 0
|
| 6239 |
+
}, { duration: 100, queue: false, easing: 'easeOutQuad' });
|
| 6240 |
+
}
|
| 6241 |
+
swipeLeft = false;
|
| 6242 |
+
swipeRight = false;
|
| 6243 |
+
}
|
| 6244 |
+
});
|
| 6245 |
+
});
|
| 6246 |
+
|
| 6247 |
+
// time = 0
|
| 6248 |
+
// // Vertical Staggered list
|
| 6249 |
+
// $('ul.staggered-list.vertical li').velocity(
|
| 6250 |
+
// { translateY: "100px"},
|
| 6251 |
+
// { duration: 0 });
|
| 6252 |
+
|
| 6253 |
+
// $('ul.staggered-list.vertical li').each(function() {
|
| 6254 |
+
// $(this).velocity(
|
| 6255 |
+
// { opacity: "1", translateY: "0"},
|
| 6256 |
+
// { duration: 800, delay: time, easing: [60, 25] });
|
| 6257 |
+
// time += 120;
|
| 6258 |
+
// });
|
| 6259 |
+
|
| 6260 |
+
// // Fade in and Scale
|
| 6261 |
+
// $('.fade-in.scale').velocity(
|
| 6262 |
+
// { scaleX: .4, scaleY: .4, translateX: -600},
|
| 6263 |
+
// { duration: 0});
|
| 6264 |
+
// $('.fade-in').each(function() {
|
| 6265 |
+
// $(this).velocity(
|
| 6266 |
+
// { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
|
| 6267 |
+
// { duration: 800, easing: [60, 10] });
|
| 6268 |
+
// });
|
| 6269 |
+
});
|
| 6270 |
+
})(jQuery);
|
| 6271 |
+
;(function ($) {
|
| 6272 |
+
|
| 6273 |
+
var scrollFireEventsHandled = false;
|
| 6274 |
+
|
| 6275 |
+
// Input: Array of JSON objects {selector, offset, callback}
|
| 6276 |
+
Materialize.scrollFire = function (options) {
|
| 6277 |
+
var onScroll = function () {
|
| 6278 |
+
var windowScroll = window.pageYOffset + window.innerHeight;
|
| 6279 |
+
|
| 6280 |
+
for (var i = 0; i < options.length; i++) {
|
| 6281 |
+
// Get options from each line
|
| 6282 |
+
var value = options[i];
|
| 6283 |
+
var selector = value.selector,
|
| 6284 |
+
offset = value.offset,
|
| 6285 |
+
callback = value.callback;
|
| 6286 |
+
|
| 6287 |
+
var currentElement = document.querySelector(selector);
|
| 6288 |
+
if (currentElement !== null) {
|
| 6289 |
+
var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
|
| 6290 |
+
|
| 6291 |
+
if (windowScroll > elementOffset + offset) {
|
| 6292 |
+
if (value.done !== true) {
|
| 6293 |
+
if (typeof callback === 'function') {
|
| 6294 |
+
callback.call(this, currentElement);
|
| 6295 |
+
} else if (typeof callback === 'string') {
|
| 6296 |
+
var callbackFunc = new Function(callback);
|
| 6297 |
+
callbackFunc(currentElement);
|
| 6298 |
+
}
|
| 6299 |
+
value.done = true;
|
| 6300 |
+
}
|
| 6301 |
+
}
|
| 6302 |
+
}
|
| 6303 |
+
}
|
| 6304 |
+
};
|
| 6305 |
+
|
| 6306 |
+
var throttledScroll = Materialize.throttle(function () {
|
| 6307 |
+
onScroll();
|
| 6308 |
+
}, options.throttle || 100);
|
| 6309 |
+
|
| 6310 |
+
if (!scrollFireEventsHandled) {
|
| 6311 |
+
window.addEventListener("scroll", throttledScroll);
|
| 6312 |
+
window.addEventListener("resize", throttledScroll);
|
| 6313 |
+
scrollFireEventsHandled = true;
|
| 6314 |
+
}
|
| 6315 |
+
|
| 6316 |
+
// perform a scan once, after current execution context, and after dom is ready
|
| 6317 |
+
setTimeout(throttledScroll, 0);
|
| 6318 |
+
};
|
| 6319 |
+
})(jQuery);
|
| 6320 |
+
; /*!
|
| 6321 |
+
* pickadate.js v3.5.0, 2014/04/13
|
| 6322 |
+
* By Amsul, http://amsul.ca
|
| 6323 |
+
* Hosted on http://amsul.github.io/pickadate.js
|
| 6324 |
+
* Licensed under MIT
|
| 6325 |
+
*/
|
| 6326 |
+
|
| 6327 |
+
(function (factory) {
|
| 6328 |
+
|
| 6329 |
+
Materialize.Picker = factory(jQuery);
|
| 6330 |
+
})(function ($) {
|
| 6331 |
+
|
| 6332 |
+
var $window = $(window);
|
| 6333 |
+
var $document = $(document);
|
| 6334 |
+
var $html = $(document.documentElement);
|
| 6335 |
+
|
| 6336 |
+
/**
|
| 6337 |
+
* The picker constructor that creates a blank picker.
|
| 6338 |
+
*/
|
| 6339 |
+
function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {
|
| 6340 |
+
|
| 6341 |
+
// If there’s no element, return the picker constructor.
|
| 6342 |
+
if (!ELEMENT) return PickerConstructor;
|
| 6343 |
+
|
| 6344 |
+
var IS_DEFAULT_THEME = false,
|
| 6345 |
+
|
| 6346 |
+
|
| 6347 |
+
// The state of the picker.
|
| 6348 |
+
STATE = {
|
| 6349 |
+
id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date()))
|
| 6350 |
+
},
|
| 6351 |
+
|
| 6352 |
+
|
| 6353 |
+
// Merge the defaults and options passed.
|
| 6354 |
+
SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {},
|
| 6355 |
+
|
| 6356 |
+
|
| 6357 |
+
// Merge the default classes with the settings classes.
|
| 6358 |
+
CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),
|
| 6359 |
+
|
| 6360 |
+
|
| 6361 |
+
// The element node wrapper into a jQuery object.
|
| 6362 |
+
$ELEMENT = $(ELEMENT),
|
| 6363 |
+
|
| 6364 |
+
|
| 6365 |
+
// Pseudo picker constructor.
|
| 6366 |
+
PickerInstance = function () {
|
| 6367 |
+
return this.start();
|
| 6368 |
+
},
|
| 6369 |
+
|
| 6370 |
+
|
| 6371 |
+
// The picker prototype.
|
| 6372 |
+
P = PickerInstance.prototype = {
|
| 6373 |
+
|
| 6374 |
+
constructor: PickerInstance,
|
| 6375 |
+
|
| 6376 |
+
$node: $ELEMENT,
|
| 6377 |
+
|
| 6378 |
+
/**
|
| 6379 |
+
* Initialize everything
|
| 6380 |
+
*/
|
| 6381 |
+
start: function () {
|
| 6382 |
+
|
| 6383 |
+
// If it’s already started, do nothing.
|
| 6384 |
+
if (STATE && STATE.start) return P;
|
| 6385 |
+
|
| 6386 |
+
// Update the picker states.
|
| 6387 |
+
STATE.methods = {};
|
| 6388 |
+
STATE.start = true;
|
| 6389 |
+
STATE.open = false;
|
| 6390 |
+
STATE.type = ELEMENT.type;
|
| 6391 |
+
|
| 6392 |
+
// Confirm focus state, convert into text input to remove UA stylings,
|
| 6393 |
+
// and set as readonly to prevent keyboard popup.
|
| 6394 |
+
ELEMENT.autofocus = ELEMENT == getActiveElement();
|
| 6395 |
+
ELEMENT.readOnly = !SETTINGS.editable;
|
| 6396 |
+
ELEMENT.id = ELEMENT.id || STATE.id;
|
| 6397 |
+
if (ELEMENT.type != 'text') {
|
| 6398 |
+
ELEMENT.type = 'text';
|
| 6399 |
+
}
|
| 6400 |
+
|
| 6401 |
+
// Create a new picker component with the settings.
|
| 6402 |
+
P.component = new COMPONENT(P, SETTINGS);
|
| 6403 |
+
|
| 6404 |
+
// Create the picker root with a holder and then prepare it.
|
| 6405 |
+
P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"'));
|
| 6406 |
+
prepareElementRoot();
|
| 6407 |
+
|
| 6408 |
+
// If there’s a format for the hidden input element, create the element.
|
| 6409 |
+
if (SETTINGS.formatSubmit) {
|
| 6410 |
+
prepareElementHidden();
|
| 6411 |
+
}
|
| 6412 |
+
|
| 6413 |
+
// Prepare the input element.
|
| 6414 |
+
prepareElement();
|
| 6415 |
+
|
| 6416 |
+
// Insert the root as specified in the settings.
|
| 6417 |
+
if (SETTINGS.container) $(SETTINGS.container).append(P.$root);else $ELEMENT.before(P.$root);
|
| 6418 |
+
|
| 6419 |
+
// Bind the default component and settings events.
|
| 6420 |
+
P.on({
|
| 6421 |
+
start: P.component.onStart,
|
| 6422 |
+
render: P.component.onRender,
|
| 6423 |
+
stop: P.component.onStop,
|
| 6424 |
+
open: P.component.onOpen,
|
| 6425 |
+
close: P.component.onClose,
|
| 6426 |
+
set: P.component.onSet
|
| 6427 |
+
}).on({
|
| 6428 |
+
start: SETTINGS.onStart,
|
| 6429 |
+
render: SETTINGS.onRender,
|
| 6430 |
+
stop: SETTINGS.onStop,
|
| 6431 |
+
open: SETTINGS.onOpen,
|
| 6432 |
+
close: SETTINGS.onClose,
|
| 6433 |
+
set: SETTINGS.onSet
|
| 6434 |
+
});
|
| 6435 |
+
|
| 6436 |
+
// Once we’re all set, check the theme in use.
|
| 6437 |
+
IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0]);
|
| 6438 |
+
|
| 6439 |
+
// If the element has autofocus, open the picker.
|
| 6440 |
+
if (ELEMENT.autofocus) {
|
| 6441 |
+
P.open();
|
| 6442 |
+
}
|
| 6443 |
+
|
| 6444 |
+
// Trigger queued the “start” and “render” events.
|
| 6445 |
+
return P.trigger('start').trigger('render');
|
| 6446 |
+
}, //start
|
| 6447 |
+
|
| 6448 |
+
|
| 6449 |
+
/**
|
| 6450 |
+
* Render a new picker
|
| 6451 |
+
*/
|
| 6452 |
+
render: function (entireComponent) {
|
| 6453 |
+
|
| 6454 |
+
// Insert a new component holder in the root or box.
|
| 6455 |
+
if (entireComponent) P.$root.html(createWrappedComponent());else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open));
|
| 6456 |
+
|
| 6457 |
+
// Trigger the queued “render” events.
|
| 6458 |
+
return P.trigger('render');
|
| 6459 |
+
}, //render
|
| 6460 |
+
|
| 6461 |
+
|
| 6462 |
+
/**
|
| 6463 |
+
* Destroy everything
|
| 6464 |
+
*/
|
| 6465 |
+
stop: function () {
|
| 6466 |
+
|
| 6467 |
+
// If it’s already stopped, do nothing.
|
| 6468 |
+
if (!STATE.start) return P;
|
| 6469 |
+
|
| 6470 |
+
// Then close the picker.
|
| 6471 |
+
P.close();
|
| 6472 |
+
|
| 6473 |
+
// Remove the hidden field.
|
| 6474 |
+
if (P._hidden) {
|
| 6475 |
+
P._hidden.parentNode.removeChild(P._hidden);
|
| 6476 |
+
}
|
| 6477 |
+
|
| 6478 |
+
// Remove the root.
|
| 6479 |
+
P.$root.remove();
|
| 6480 |
+
|
| 6481 |
+
// Remove the input class, remove the stored data, and unbind
|
| 6482 |
+
// the events (after a tick for IE - see `P.close`).
|
| 6483 |
+
$ELEMENT.removeClass(CLASSES.input).removeData(NAME);
|
| 6484 |
+
setTimeout(function () {
|
| 6485 |
+
$ELEMENT.off('.' + STATE.id);
|
| 6486 |
+
}, 0);
|
| 6487 |
+
|
| 6488 |
+
// Restore the element state
|
| 6489 |
+
ELEMENT.type = STATE.type;
|
| 6490 |
+
ELEMENT.readOnly = false;
|
| 6491 |
+
|
| 6492 |
+
// Trigger the queued “stop” events.
|
| 6493 |
+
P.trigger('stop');
|
| 6494 |
+
|
| 6495 |
+
// Reset the picker states.
|
| 6496 |
+
STATE.methods = {};
|
| 6497 |
+
STATE.start = false;
|
| 6498 |
+
|
| 6499 |
+
return P;
|
| 6500 |
+
}, //stop
|
| 6501 |
+
|
| 6502 |
+
|
| 6503 |
+
/**
|
| 6504 |
+
* Open up the picker
|
| 6505 |
+
*/
|
| 6506 |
+
open: function (dontGiveFocus) {
|
| 6507 |
+
|
| 6508 |
+
// If it’s already open, do nothing.
|
| 6509 |
+
if (STATE.open) return P;
|
| 6510 |
+
|
| 6511 |
+
// Add the “active” class.
|
| 6512 |
+
$ELEMENT.addClass(CLASSES.active);
|
| 6513 |
+
aria(ELEMENT, 'expanded', true);
|
| 6514 |
+
|
| 6515 |
+
// * A Firefox bug, when `html` has `overflow:hidden`, results in
|
| 6516 |
+
// killing transitions :(. So add the “opened” state on the next tick.
|
| 6517 |
+
// Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
|
| 6518 |
+
setTimeout(function () {
|
| 6519 |
+
|
| 6520 |
+
// Add the “opened” class to the picker root.
|
| 6521 |
+
P.$root.addClass(CLASSES.opened);
|
| 6522 |
+
aria(P.$root[0], 'hidden', false);
|
| 6523 |
+
}, 0);
|
| 6524 |
+
|
| 6525 |
+
// If we have to give focus, bind the element and doc events.
|
| 6526 |
+
if (dontGiveFocus !== false) {
|
| 6527 |
+
|
| 6528 |
+
// Set it as open.
|
| 6529 |
+
STATE.open = true;
|
| 6530 |
+
|
| 6531 |
+
// Prevent the page from scrolling.
|
| 6532 |
+
if (IS_DEFAULT_THEME) {
|
| 6533 |
+
$html.css('overflow', 'hidden').css('padding-right', '+=' + getScrollbarWidth());
|
| 6534 |
+
}
|
| 6535 |
+
|
| 6536 |
+
// Pass focus to the root element’s jQuery object.
|
| 6537 |
+
// * Workaround for iOS8 to bring the picker’s root into view.
|
| 6538 |
+
P.$root.eq(0).focus();
|
| 6539 |
+
|
| 6540 |
+
// Bind the document events.
|
| 6541 |
+
$document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {
|
| 6542 |
+
|
| 6543 |
+
var target = event.target;
|
| 6544 |
+
|
| 6545 |
+
// If the target of the event is not the element, close the picker picker.
|
| 6546 |
+
// * Don’t worry about clicks or focusins on the root because those don’t bubble up.
|
| 6547 |
+
// Also, for Firefox, a click on an `option` element bubbles up directly
|
| 6548 |
+
// to the doc. So make sure the target wasn't the doc.
|
| 6549 |
+
// * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
|
| 6550 |
+
// which causes the picker to unexpectedly close when right-clicking it. So make
|
| 6551 |
+
// sure the event wasn’t a right-click.
|
| 6552 |
+
if (target != ELEMENT && target != document && event.which != 3) {
|
| 6553 |
+
|
| 6554 |
+
// If the target was the holder that covers the screen,
|
| 6555 |
+
// keep the element focused to maintain tabindex.
|
| 6556 |
+
P.close(target === P.$root.children()[0]);
|
| 6557 |
+
}
|
| 6558 |
+
}).on('keydown.' + STATE.id, function (event) {
|
| 6559 |
+
|
| 6560 |
+
var
|
| 6561 |
+
// Get the keycode.
|
| 6562 |
+
keycode = event.keyCode,
|
| 6563 |
+
|
| 6564 |
+
|
| 6565 |
+
// Translate that to a selection change.
|
| 6566 |
+
keycodeToMove = P.component.key[keycode],
|
| 6567 |
+
|
| 6568 |
+
|
| 6569 |
+
// Grab the target.
|
| 6570 |
+
target = event.target;
|
| 6571 |
+
|
| 6572 |
+
// On escape, close the picker and give focus.
|
| 6573 |
+
if (keycode == 27) {
|
| 6574 |
+
P.close(true);
|
| 6575 |
+
}
|
| 6576 |
+
|
| 6577 |
+
// Check if there is a key movement or “enter” keypress on the element.
|
| 6578 |
+
else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) {
|
| 6579 |
+
|
| 6580 |
+
// Prevent the default action to stop page movement.
|
| 6581 |
+
event.preventDefault();
|
| 6582 |
+
|
| 6583 |
+
// Trigger the key movement action.
|
| 6584 |
+
if (keycodeToMove) {
|
| 6585 |
+
PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]);
|
| 6586 |
+
}
|
| 6587 |
+
|
| 6588 |
+
// On “enter”, if the highlighted item isn’t disabled, set the value and close.
|
| 6589 |
+
else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) {
|
| 6590 |
+
P.set('select', P.component.item.highlight);
|
| 6591 |
+
if (SETTINGS.closeOnSelect) {
|
| 6592 |
+
P.close(true);
|
| 6593 |
+
}
|
| 6594 |
+
}
|
| 6595 |
+
}
|
| 6596 |
+
|
| 6597 |
+
// If the target is within the root and “enter” is pressed,
|
| 6598 |
+
// prevent the default action and trigger a click on the target instead.
|
| 6599 |
+
else if ($.contains(P.$root[0], target) && keycode == 13) {
|
| 6600 |
+
event.preventDefault();
|
| 6601 |
+
target.click();
|
| 6602 |
+
}
|
| 6603 |
+
});
|
| 6604 |
+
}
|
| 6605 |
+
|
| 6606 |
+
// Trigger the queued “open” events.
|
| 6607 |
+
return P.trigger('open');
|
| 6608 |
+
}, //open
|
| 6609 |
+
|
| 6610 |
+
|
| 6611 |
+
/**
|
| 6612 |
+
* Close the picker
|
| 6613 |
+
*/
|
| 6614 |
+
close: function (giveFocus) {
|
| 6615 |
+
|
| 6616 |
+
// If we need to give focus, do it before changing states.
|
| 6617 |
+
if (giveFocus) {
|
| 6618 |
+
// ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
|
| 6619 |
+
// The focus is triggered *after* the close has completed - causing it
|
| 6620 |
+
// to open again. So unbind and rebind the event at the next tick.
|
| 6621 |
+
P.$root.off('focus.toOpen').eq(0).focus();
|
| 6622 |
+
setTimeout(function () {
|
| 6623 |
+
P.$root.on('focus.toOpen', handleFocusToOpenEvent);
|
| 6624 |
+
}, 0);
|
| 6625 |
+
}
|
| 6626 |
+
|
| 6627 |
+
// Remove the “active” class.
|
| 6628 |
+
$ELEMENT.removeClass(CLASSES.active);
|
| 6629 |
+
aria(ELEMENT, 'expanded', false);
|
| 6630 |
+
|
| 6631 |
+
// * A Firefox bug, when `html` has `overflow:hidden`, results in
|
| 6632 |
+
// killing transitions :(. So remove the “opened” state on the next tick.
|
| 6633 |
+
// Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
|
| 6634 |
+
setTimeout(function () {
|
| 6635 |
+
|
| 6636 |
+
// Remove the “opened” and “focused” class from the picker root.
|
| 6637 |
+
P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused);
|
| 6638 |
+
aria(P.$root[0], 'hidden', true);
|
| 6639 |
+
}, 0);
|
| 6640 |
+
|
| 6641 |
+
// If it’s already closed, do nothing more.
|
| 6642 |
+
if (!STATE.open) return P;
|
| 6643 |
+
|
| 6644 |
+
// Set it as closed.
|
| 6645 |
+
STATE.open = false;
|
| 6646 |
+
|
| 6647 |
+
// Allow the page to scroll.
|
| 6648 |
+
if (IS_DEFAULT_THEME) {
|
| 6649 |
+
$html.css('overflow', '').css('padding-right', '-=' + getScrollbarWidth());
|
| 6650 |
+
}
|
| 6651 |
+
|
| 6652 |
+
// Unbind the document events.
|
| 6653 |
+
$document.off('.' + STATE.id);
|
| 6654 |
+
|
| 6655 |
+
// Trigger the queued “close” events.
|
| 6656 |
+
return P.trigger('close');
|
| 6657 |
+
}, //close
|
| 6658 |
+
|
| 6659 |
+
|
| 6660 |
+
/**
|
| 6661 |
+
* Clear the values
|
| 6662 |
+
*/
|
| 6663 |
+
clear: function (options) {
|
| 6664 |
+
return P.set('clear', null, options);
|
| 6665 |
+
}, //clear
|
| 6666 |
+
|
| 6667 |
+
|
| 6668 |
+
/**
|
| 6669 |
+
* Set something
|
| 6670 |
+
*/
|
| 6671 |
+
set: function (thing, value, options) {
|
| 6672 |
+
|
| 6673 |
+
var thingItem,
|
| 6674 |
+
thingValue,
|
| 6675 |
+
thingIsObject = $.isPlainObject(thing),
|
| 6676 |
+
thingObject = thingIsObject ? thing : {};
|
| 6677 |
+
|
| 6678 |
+
// Make sure we have usable options.
|
| 6679 |
+
options = thingIsObject && $.isPlainObject(value) ? value : options || {};
|
| 6680 |
+
|
| 6681 |
+
if (thing) {
|
| 6682 |
+
|
| 6683 |
+
// If the thing isn’t an object, make it one.
|
| 6684 |
+
if (!thingIsObject) {
|
| 6685 |
+
thingObject[thing] = value;
|
| 6686 |
+
}
|
| 6687 |
+
|
| 6688 |
+
// Go through the things of items to set.
|
| 6689 |
+
for (thingItem in thingObject) {
|
| 6690 |
+
|
| 6691 |
+
// Grab the value of the thing.
|
| 6692 |
+
thingValue = thingObject[thingItem];
|
| 6693 |
+
|
| 6694 |
+
// First, if the item exists and there’s a value, set it.
|
| 6695 |
+
if (thingItem in P.component.item) {
|
| 6696 |
+
if (thingValue === undefined) thingValue = null;
|
| 6697 |
+
P.component.set(thingItem, thingValue, options);
|
| 6698 |
+
}
|
| 6699 |
+
|
| 6700 |
+
// Then, check to update the element value and broadcast a change.
|
| 6701 |
+
if (thingItem == 'select' || thingItem == 'clear') {
|
| 6702 |
+
$ELEMENT.val(thingItem == 'clear' ? '' : P.get(thingItem, SETTINGS.format)).trigger('change');
|
| 6703 |
+
}
|
| 6704 |
+
}
|
| 6705 |
+
|
| 6706 |
+
// Render a new picker.
|
| 6707 |
+
P.render();
|
| 6708 |
+
}
|
| 6709 |
+
|
| 6710 |
+
// When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
|
| 6711 |
+
return options.muted ? P : P.trigger('set', thingObject);
|
| 6712 |
+
}, //set
|
| 6713 |
+
|
| 6714 |
+
|
| 6715 |
+
/**
|
| 6716 |
+
* Get something
|
| 6717 |
+
*/
|
| 6718 |
+
get: function (thing, format) {
|
| 6719 |
+
|
| 6720 |
+
// Make sure there’s something to get.
|
| 6721 |
+
thing = thing || 'value';
|
| 6722 |
+
|
| 6723 |
+
// If a picker state exists, return that.
|
| 6724 |
+
if (STATE[thing] != null) {
|
| 6725 |
+
return STATE[thing];
|
| 6726 |
+
}
|
| 6727 |
+
|
| 6728 |
+
// Return the submission value, if that.
|
| 6729 |
+
if (thing == 'valueSubmit') {
|
| 6730 |
+
if (P._hidden) {
|
| 6731 |
+
return P._hidden.value;
|
| 6732 |
+
}
|
| 6733 |
+
thing = 'value';
|
| 6734 |
+
}
|
| 6735 |
+
|
| 6736 |
+
// Return the value, if that.
|
| 6737 |
+
if (thing == 'value') {
|
| 6738 |
+
return ELEMENT.value;
|
| 6739 |
+
}
|
| 6740 |
+
|
| 6741 |
+
// Check if a component item exists, return that.
|
| 6742 |
+
if (thing in P.component.item) {
|
| 6743 |
+
if (typeof format == 'string') {
|
| 6744 |
+
var thingValue = P.component.get(thing);
|
| 6745 |
+
return thingValue ? PickerConstructor._.trigger(P.component.formats.toString, P.component, [format, thingValue]) : '';
|
| 6746 |
+
}
|
| 6747 |
+
return P.component.get(thing);
|
| 6748 |
+
}
|
| 6749 |
+
}, //get
|
| 6750 |
+
|
| 6751 |
+
|
| 6752 |
+
/**
|
| 6753 |
+
* Bind events on the things.
|
| 6754 |
+
*/
|
| 6755 |
+
on: function (thing, method, internal) {
|
| 6756 |
+
|
| 6757 |
+
var thingName,
|
| 6758 |
+
thingMethod,
|
| 6759 |
+
thingIsObject = $.isPlainObject(thing),
|
| 6760 |
+
thingObject = thingIsObject ? thing : {};
|
| 6761 |
+
|
| 6762 |
+
if (thing) {
|
| 6763 |
+
|
| 6764 |
+
// If the thing isn’t an object, make it one.
|
| 6765 |
+
if (!thingIsObject) {
|
| 6766 |
+
thingObject[thing] = method;
|
| 6767 |
+
}
|
| 6768 |
+
|
| 6769 |
+
// Go through the things to bind to.
|
| 6770 |
+
for (thingName in thingObject) {
|
| 6771 |
+
|
| 6772 |
+
// Grab the method of the thing.
|
| 6773 |
+
thingMethod = thingObject[thingName];
|
| 6774 |
+
|
| 6775 |
+
// If it was an internal binding, prefix it.
|
| 6776 |
+
if (internal) {
|
| 6777 |
+
thingName = '_' + thingName;
|
| 6778 |
+
}
|
| 6779 |
+
|
| 6780 |
+
// Make sure the thing methods collection exists.
|
| 6781 |
+
STATE.methods[thingName] = STATE.methods[thingName] || [];
|
| 6782 |
+
|
| 6783 |
+
// Add the method to the relative method collection.
|
| 6784 |
+
STATE.methods[thingName].push(thingMethod);
|
| 6785 |
+
}
|
| 6786 |
+
}
|
| 6787 |
+
|
| 6788 |
+
return P;
|
| 6789 |
+
}, //on
|
| 6790 |
+
|
| 6791 |
+
|
| 6792 |
+
/**
|
| 6793 |
+
* Unbind events on the things.
|
| 6794 |
+
*/
|
| 6795 |
+
off: function () {
|
| 6796 |
+
var i,
|
| 6797 |
+
thingName,
|
| 6798 |
+
names = arguments;
|
| 6799 |
+
for (i = 0, namesCount = names.length; i < namesCount; i += 1) {
|
| 6800 |
+
thingName = names[i];
|
| 6801 |
+
if (thingName in STATE.methods) {
|
| 6802 |
+
delete STATE.methods[thingName];
|
| 6803 |
+
}
|
| 6804 |
+
}
|
| 6805 |
+
return P;
|
| 6806 |
+
},
|
| 6807 |
+
|
| 6808 |
+
/**
|
| 6809 |
+
* Fire off method events.
|
| 6810 |
+
*/
|
| 6811 |
+
trigger: function (name, data) {
|
| 6812 |
+
var _trigger = function (name) {
|
| 6813 |
+
var methodList = STATE.methods[name];
|
| 6814 |
+
if (methodList) {
|
| 6815 |
+
methodList.map(function (method) {
|
| 6816 |
+
PickerConstructor._.trigger(method, P, [data]);
|
| 6817 |
+
});
|
| 6818 |
+
}
|
| 6819 |
+
};
|
| 6820 |
+
_trigger('_' + name);
|
| 6821 |
+
_trigger(name);
|
| 6822 |
+
return P;
|
| 6823 |
+
} //trigger
|
| 6824 |
+
//PickerInstance.prototype
|
| 6825 |
+
|
| 6826 |
+
|
| 6827 |
+
/**
|
| 6828 |
+
* Wrap the picker holder components together.
|
| 6829 |
+
*/
|
| 6830 |
+
};function createWrappedComponent() {
|
| 6831 |
+
|
| 6832 |
+
// Create a picker wrapper holder
|
| 6833 |
+
return PickerConstructor._.node('div',
|
| 6834 |
+
|
| 6835 |
+
// Create a picker wrapper node
|
| 6836 |
+
PickerConstructor._.node('div',
|
| 6837 |
+
|
| 6838 |
+
// Create a picker frame
|
| 6839 |
+
PickerConstructor._.node('div',
|
| 6840 |
+
|
| 6841 |
+
// Create a picker box node
|
| 6842 |
+
PickerConstructor._.node('div',
|
| 6843 |
+
|
| 6844 |
+
// Create the components nodes.
|
| 6845 |
+
P.component.nodes(STATE.open),
|
| 6846 |
+
|
| 6847 |
+
// The picker box class
|
| 6848 |
+
CLASSES.box),
|
| 6849 |
+
|
| 6850 |
+
// Picker wrap class
|
| 6851 |
+
CLASSES.wrap),
|
| 6852 |
+
|
| 6853 |
+
// Picker frame class
|
| 6854 |
+
CLASSES.frame),
|
| 6855 |
+
|
| 6856 |
+
// Picker holder class
|
| 6857 |
+
CLASSES.holder); //endreturn
|
| 6858 |
+
} //createWrappedComponent
|
| 6859 |
+
|
| 6860 |
+
|
| 6861 |
+
/**
|
| 6862 |
+
* Prepare the input element with all bindings.
|
| 6863 |
+
*/
|
| 6864 |
+
function prepareElement() {
|
| 6865 |
+
|
| 6866 |
+
$ELEMENT.
|
| 6867 |
+
|
| 6868 |
+
// Store the picker data by component name.
|
| 6869 |
+
data(NAME, P).
|
| 6870 |
+
|
| 6871 |
+
// Add the “input” class name.
|
| 6872 |
+
addClass(CLASSES.input).
|
| 6873 |
+
|
| 6874 |
+
// Remove the tabindex.
|
| 6875 |
+
attr('tabindex', -1).
|
| 6876 |
+
|
| 6877 |
+
// If there’s a `data-value`, update the value of the element.
|
| 6878 |
+
val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value);
|
| 6879 |
+
|
| 6880 |
+
// Only bind keydown events if the element isn’t editable.
|
| 6881 |
+
if (!SETTINGS.editable) {
|
| 6882 |
+
|
| 6883 |
+
$ELEMENT.
|
| 6884 |
+
|
| 6885 |
+
// On focus/click, focus onto the root to open it up.
|
| 6886 |
+
on('focus.' + STATE.id + ' click.' + STATE.id, function (event) {
|
| 6887 |
+
event.preventDefault();
|
| 6888 |
+
P.$root.eq(0).focus();
|
| 6889 |
+
}).
|
| 6890 |
+
|
| 6891 |
+
// Handle keyboard event based on the picker being opened or not.
|
| 6892 |
+
on('keydown.' + STATE.id, handleKeydownEvent);
|
| 6893 |
+
}
|
| 6894 |
+
|
| 6895 |
+
// Update the aria attributes.
|
| 6896 |
+
aria(ELEMENT, {
|
| 6897 |
+
haspopup: true,
|
| 6898 |
+
expanded: false,
|
| 6899 |
+
readonly: false,
|
| 6900 |
+
owns: ELEMENT.id + '_root'
|
| 6901 |
+
});
|
| 6902 |
+
}
|
| 6903 |
+
|
| 6904 |
+
/**
|
| 6905 |
+
* Prepare the root picker element with all bindings.
|
| 6906 |
+
*/
|
| 6907 |
+
function prepareElementRoot() {
|
| 6908 |
+
|
| 6909 |
+
P.$root.on({
|
| 6910 |
+
|
| 6911 |
+
// For iOS8.
|
| 6912 |
+
keydown: handleKeydownEvent,
|
| 6913 |
+
|
| 6914 |
+
// When something within the root is focused, stop from bubbling
|
| 6915 |
+
// to the doc and remove the “focused” state from the root.
|
| 6916 |
+
focusin: function (event) {
|
| 6917 |
+
P.$root.removeClass(CLASSES.focused);
|
| 6918 |
+
event.stopPropagation();
|
| 6919 |
+
},
|
| 6920 |
+
|
| 6921 |
+
// When something within the root holder is clicked, stop it
|
| 6922 |
+
// from bubbling to the doc.
|
| 6923 |
+
'mousedown click': function (event) {
|
| 6924 |
+
|
| 6925 |
+
var target = event.target;
|
| 6926 |
+
|
| 6927 |
+
// Make sure the target isn’t the root holder so it can bubble up.
|
| 6928 |
+
if (target != P.$root.children()[0]) {
|
| 6929 |
+
|
| 6930 |
+
event.stopPropagation();
|
| 6931 |
+
|
| 6932 |
+
// * For mousedown events, cancel the default action in order to
|
| 6933 |
+
// prevent cases where focus is shifted onto external elements
|
| 6934 |
+
// when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
|
| 6935 |
+
// Also, for Firefox, don’t prevent action on the `option` element.
|
| 6936 |
+
if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {
|
| 6937 |
+
|
| 6938 |
+
event.preventDefault();
|
| 6939 |
+
|
| 6940 |
+
// Re-focus onto the root so that users can click away
|
| 6941 |
+
// from elements focused within the picker.
|
| 6942 |
+
P.$root.eq(0).focus();
|
| 6943 |
+
}
|
| 6944 |
+
}
|
| 6945 |
+
}
|
| 6946 |
+
}).
|
| 6947 |
+
|
| 6948 |
+
// Add/remove the “target” class on focus and blur.
|
| 6949 |
+
on({
|
| 6950 |
+
focus: function () {
|
| 6951 |
+
$ELEMENT.addClass(CLASSES.target);
|
| 6952 |
+
},
|
| 6953 |
+
blur: function () {
|
| 6954 |
+
$ELEMENT.removeClass(CLASSES.target);
|
| 6955 |
+
}
|
| 6956 |
+
}).
|
| 6957 |
+
|
| 6958 |
+
// Open the picker and adjust the root “focused” state
|
| 6959 |
+
on('focus.toOpen', handleFocusToOpenEvent).
|
| 6960 |
+
|
| 6961 |
+
// If there’s a click on an actionable element, carry out the actions.
|
| 6962 |
+
on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {
|
| 6963 |
+
|
| 6964 |
+
var $target = $(this),
|
| 6965 |
+
targetData = $target.data(),
|
| 6966 |
+
targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled),
|
| 6967 |
+
|
| 6968 |
+
|
| 6969 |
+
// * For IE, non-focusable elements can be active elements as well
|
| 6970 |
+
// (http://stackoverflow.com/a/2684561).
|
| 6971 |
+
activeElement = getActiveElement();
|
| 6972 |
+
activeElement = activeElement && (activeElement.type || activeElement.href) && activeElement;
|
| 6973 |
+
|
| 6974 |
+
// If it’s disabled or nothing inside is actively focused, re-focus the element.
|
| 6975 |
+
if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) {
|
| 6976 |
+
P.$root.eq(0).focus();
|
| 6977 |
+
}
|
| 6978 |
+
|
| 6979 |
+
// If something is superficially changed, update the `highlight` based on the `nav`.
|
| 6980 |
+
if (!targetDisabled && targetData.nav) {
|
| 6981 |
+
P.set('highlight', P.component.item.highlight, { nav: targetData.nav });
|
| 6982 |
+
}
|
| 6983 |
+
|
| 6984 |
+
// If something is picked, set `select` then close with focus.
|
| 6985 |
+
else if (!targetDisabled && 'pick' in targetData) {
|
| 6986 |
+
P.set('select', targetData.pick);
|
| 6987 |
+
if (SETTINGS.closeOnSelect) {
|
| 6988 |
+
P.close(true);
|
| 6989 |
+
}
|
| 6990 |
+
}
|
| 6991 |
+
|
| 6992 |
+
// If a “clear” button is pressed, empty the values and close with focus.
|
| 6993 |
+
else if (targetData.clear) {
|
| 6994 |
+
P.clear();
|
| 6995 |
+
if (SETTINGS.closeOnSelect) {
|
| 6996 |
+
P.close(true);
|
| 6997 |
+
}
|
| 6998 |
+
} else if (targetData.close) {
|
| 6999 |
+
P.close(true);
|
| 7000 |
+
}
|
| 7001 |
+
}); //P.$root
|
| 7002 |
+
|
| 7003 |
+
aria(P.$root[0], 'hidden', true);
|
| 7004 |
+
}
|
| 7005 |
+
|
| 7006 |
+
/**
|
| 7007 |
+
* Prepare the hidden input element along with all bindings.
|
| 7008 |
+
*/
|
| 7009 |
+
function prepareElementHidden() {
|
| 7010 |
+
|
| 7011 |
+
var name;
|
| 7012 |
+
|
| 7013 |
+
if (SETTINGS.hiddenName === true) {
|
| 7014 |
+
name = ELEMENT.name;
|
| 7015 |
+
ELEMENT.name = '';
|
| 7016 |
+
} else {
|
| 7017 |
+
name = [typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'];
|
| 7018 |
+
name = name[0] + ELEMENT.name + name[1];
|
| 7019 |
+
}
|
| 7020 |
+
|
| 7021 |
+
P._hidden = $('<input ' + 'type=hidden ' +
|
| 7022 |
+
|
| 7023 |
+
// Create the name using the original input’s with a prefix and suffix.
|
| 7024 |
+
'name="' + name + '"' + (
|
| 7025 |
+
|
| 7026 |
+
// If the element has a value, set the hidden value as well.
|
| 7027 |
+
$ELEMENT.data('value') || ELEMENT.value ? ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' : '') + '>')[0];
|
| 7028 |
+
|
| 7029 |
+
$ELEMENT.
|
| 7030 |
+
|
| 7031 |
+
// If the value changes, update the hidden input with the correct format.
|
| 7032 |
+
on('change.' + STATE.id, function () {
|
| 7033 |
+
P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : '';
|
| 7034 |
+
});
|
| 7035 |
+
|
| 7036 |
+
// Insert the hidden input as specified in the settings.
|
| 7037 |
+
if (SETTINGS.container) $(SETTINGS.container).append(P._hidden);else $ELEMENT.before(P._hidden);
|
| 7038 |
+
}
|
| 7039 |
+
|
| 7040 |
+
// For iOS8.
|
| 7041 |
+
function handleKeydownEvent(event) {
|
| 7042 |
+
|
| 7043 |
+
var keycode = event.keyCode,
|
| 7044 |
+
|
| 7045 |
+
|
| 7046 |
+
// Check if one of the delete keys was pressed.
|
| 7047 |
+
isKeycodeDelete = /^(8|46)$/.test(keycode);
|
| 7048 |
+
|
| 7049 |
+
// For some reason IE clears the input value on “escape”.
|
| 7050 |
+
if (keycode == 27) {
|
| 7051 |
+
P.close();
|
| 7052 |
+
return false;
|
| 7053 |
+
}
|
| 7054 |
+
|
| 7055 |
+
// Check if `space` or `delete` was pressed or the picker is closed with a key movement.
|
| 7056 |
+
if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) {
|
| 7057 |
+
|
| 7058 |
+
// Prevent it from moving the page and bubbling to doc.
|
| 7059 |
+
event.preventDefault();
|
| 7060 |
+
event.stopPropagation();
|
| 7061 |
+
|
| 7062 |
+
// If `delete` was pressed, clear the values and close the picker.
|
| 7063 |
+
// Otherwise open the picker.
|
| 7064 |
+
if (isKeycodeDelete) {
|
| 7065 |
+
P.clear().close();
|
| 7066 |
+
} else {
|
| 7067 |
+
P.open();
|
| 7068 |
+
}
|
| 7069 |
+
}
|
| 7070 |
+
}
|
| 7071 |
+
|
| 7072 |
+
// Separated for IE
|
| 7073 |
+
function handleFocusToOpenEvent(event) {
|
| 7074 |
+
|
| 7075 |
+
// Stop the event from propagating to the doc.
|
| 7076 |
+
event.stopPropagation();
|
| 7077 |
+
|
| 7078 |
+
// If it’s a focus event, add the “focused” class to the root.
|
| 7079 |
+
if (event.type == 'focus') {
|
| 7080 |
+
P.$root.addClass(CLASSES.focused);
|
| 7081 |
+
}
|
| 7082 |
+
|
| 7083 |
+
// And then finally open the picker.
|
| 7084 |
+
P.open();
|
| 7085 |
+
}
|
| 7086 |
+
|
| 7087 |
+
// Return a new picker instance.
|
| 7088 |
+
return new PickerInstance();
|
| 7089 |
+
} //PickerConstructor
|
| 7090 |
+
|
| 7091 |
+
|
| 7092 |
+
/**
|
| 7093 |
+
* The default classes and prefix to use for the HTML classes.
|
| 7094 |
+
*/
|
| 7095 |
+
PickerConstructor.klasses = function (prefix) {
|
| 7096 |
+
prefix = prefix || 'picker';
|
| 7097 |
+
return {
|
| 7098 |
+
|
| 7099 |
+
picker: prefix,
|
| 7100 |
+
opened: prefix + '--opened',
|
| 7101 |
+
focused: prefix + '--focused',
|
| 7102 |
+
|
| 7103 |
+
input: prefix + '__input',
|
| 7104 |
+
active: prefix + '__input--active',
|
| 7105 |
+
target: prefix + '__input--target',
|
| 7106 |
+
|
| 7107 |
+
holder: prefix + '__holder',
|
| 7108 |
+
|
| 7109 |
+
frame: prefix + '__frame',
|
| 7110 |
+
wrap: prefix + '__wrap',
|
| 7111 |
+
|
| 7112 |
+
box: prefix + '__box'
|
| 7113 |
+
};
|
| 7114 |
+
}; //PickerConstructor.klasses
|
| 7115 |
+
|
| 7116 |
+
|
| 7117 |
+
/**
|
| 7118 |
+
* Check if the default theme is being used.
|
| 7119 |
+
*/
|
| 7120 |
+
function isUsingDefaultTheme(element) {
|
| 7121 |
+
|
| 7122 |
+
var theme,
|
| 7123 |
+
prop = 'position';
|
| 7124 |
+
|
| 7125 |
+
// For IE.
|
| 7126 |
+
if (element.currentStyle) {
|
| 7127 |
+
theme = element.currentStyle[prop];
|
| 7128 |
+
}
|
| 7129 |
+
|
| 7130 |
+
// For normal browsers.
|
| 7131 |
+
else if (window.getComputedStyle) {
|
| 7132 |
+
theme = getComputedStyle(element)[prop];
|
| 7133 |
+
}
|
| 7134 |
+
|
| 7135 |
+
return theme == 'fixed';
|
| 7136 |
+
}
|
| 7137 |
+
|
| 7138 |
+
/**
|
| 7139 |
+
* Get the width of the browser’s scrollbar.
|
| 7140 |
+
* Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
|
| 7141 |
+
*/
|
| 7142 |
+
function getScrollbarWidth() {
|
| 7143 |
+
|
| 7144 |
+
if ($html.height() <= $window.height()) {
|
| 7145 |
+
return 0;
|
| 7146 |
+
}
|
| 7147 |
+
|
| 7148 |
+
var $outer = $('<div style="visibility:hidden;width:100px" />').appendTo('body');
|
| 7149 |
+
|
| 7150 |
+
// Get the width without scrollbars.
|
| 7151 |
+
var widthWithoutScroll = $outer[0].offsetWidth;
|
| 7152 |
+
|
| 7153 |
+
// Force adding scrollbars.
|
| 7154 |
+
$outer.css('overflow', 'scroll');
|
| 7155 |
+
|
| 7156 |
+
// Add the inner div.
|
| 7157 |
+
var $inner = $('<div style="width:100%" />').appendTo($outer);
|
| 7158 |
+
|
| 7159 |
+
// Get the width with scrollbars.
|
| 7160 |
+
var widthWithScroll = $inner[0].offsetWidth;
|
| 7161 |
+
|
| 7162 |
+
// Remove the divs.
|
| 7163 |
+
$outer.remove();
|
| 7164 |
+
|
| 7165 |
+
// Return the difference between the widths.
|
| 7166 |
+
return widthWithoutScroll - widthWithScroll;
|
| 7167 |
+
}
|
| 7168 |
+
|
| 7169 |
+
/**
|
| 7170 |
+
* PickerConstructor helper methods.
|
| 7171 |
+
*/
|
| 7172 |
+
PickerConstructor._ = {
|
| 7173 |
+
|
| 7174 |
+
/**
|
| 7175 |
+
* Create a group of nodes. Expects:
|
| 7176 |
+
* `
|
| 7177 |
+
{
|
| 7178 |
+
min: {Integer},
|
| 7179 |
+
max: {Integer},
|
| 7180 |
+
i: {Integer},
|
| 7181 |
+
node: {String},
|
| 7182 |
+
item: {Function}
|
| 7183 |
+
}
|
| 7184 |
+
* `
|
| 7185 |
+
*/
|
| 7186 |
+
group: function (groupObject) {
|
| 7187 |
+
|
| 7188 |
+
var
|
| 7189 |
+
// Scope for the looped object
|
| 7190 |
+
loopObjectScope,
|
| 7191 |
+
|
| 7192 |
+
|
| 7193 |
+
// Create the nodes list
|
| 7194 |
+
nodesList = '',
|
| 7195 |
+
|
| 7196 |
+
|
| 7197 |
+
// The counter starts from the `min`
|
| 7198 |
+
counter = PickerConstructor._.trigger(groupObject.min, groupObject);
|
| 7199 |
+
|
| 7200 |
+
// Loop from the `min` to `max`, incrementing by `i`
|
| 7201 |
+
for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {
|
| 7202 |
+
|
| 7203 |
+
// Trigger the `item` function within scope of the object
|
| 7204 |
+
loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter]);
|
| 7205 |
+
|
| 7206 |
+
// Splice the subgroup and create nodes out of the sub nodes
|
| 7207 |
+
nodesList += PickerConstructor._.node(groupObject.node, loopObjectScope[0], // the node
|
| 7208 |
+
loopObjectScope[1], // the classes
|
| 7209 |
+
loopObjectScope[2] // the attributes
|
| 7210 |
+
);
|
| 7211 |
+
}
|
| 7212 |
+
|
| 7213 |
+
// Return the list of nodes
|
| 7214 |
+
return nodesList;
|
| 7215 |
+
}, //group
|
| 7216 |
+
|
| 7217 |
+
|
| 7218 |
+
/**
|
| 7219 |
+
* Create a dom node string
|
| 7220 |
+
*/
|
| 7221 |
+
node: function (wrapper, item, klass, attribute) {
|
| 7222 |
+
|
| 7223 |
+
// If the item is false-y, just return an empty string
|
| 7224 |
+
if (!item) return '';
|
| 7225 |
+
|
| 7226 |
+
// If the item is an array, do a join
|
| 7227 |
+
item = $.isArray(item) ? item.join('') : item;
|
| 7228 |
+
|
| 7229 |
+
// Check for the class
|
| 7230 |
+
klass = klass ? ' class="' + klass + '"' : '';
|
| 7231 |
+
|
| 7232 |
+
// Check for any attributes
|
| 7233 |
+
attribute = attribute ? ' ' + attribute : '';
|
| 7234 |
+
|
| 7235 |
+
// Return the wrapped item
|
| 7236 |
+
return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>';
|
| 7237 |
+
}, //node
|
| 7238 |
+
|
| 7239 |
+
|
| 7240 |
+
/**
|
| 7241 |
+
* Lead numbers below 10 with a zero.
|
| 7242 |
+
*/
|
| 7243 |
+
lead: function (number) {
|
| 7244 |
+
return (number < 10 ? '0' : '') + number;
|
| 7245 |
+
},
|
| 7246 |
+
|
| 7247 |
+
/**
|
| 7248 |
+
* Trigger a function otherwise return the value.
|
| 7249 |
+
*/
|
| 7250 |
+
trigger: function (callback, scope, args) {
|
| 7251 |
+
return typeof callback == 'function' ? callback.apply(scope, args || []) : callback;
|
| 7252 |
+
},
|
| 7253 |
+
|
| 7254 |
+
/**
|
| 7255 |
+
* If the second character is a digit, length is 2 otherwise 1.
|
| 7256 |
+
*/
|
| 7257 |
+
digits: function (string) {
|
| 7258 |
+
return (/\d/.test(string[1]) ? 2 : 1
|
| 7259 |
+
);
|
| 7260 |
+
},
|
| 7261 |
+
|
| 7262 |
+
/**
|
| 7263 |
+
* Tell if something is a date object.
|
| 7264 |
+
*/
|
| 7265 |
+
isDate: function (value) {
|
| 7266 |
+
return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate());
|
| 7267 |
+
},
|
| 7268 |
+
|
| 7269 |
+
/**
|
| 7270 |
+
* Tell if something is an integer.
|
| 7271 |
+
*/
|
| 7272 |
+
isInteger: function (value) {
|
| 7273 |
+
return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0;
|
| 7274 |
+
},
|
| 7275 |
+
|
| 7276 |
+
/**
|
| 7277 |
+
* Create ARIA attribute strings.
|
| 7278 |
+
*/
|
| 7279 |
+
ariaAttr: ariaAttr //PickerConstructor._
|
| 7280 |
+
|
| 7281 |
+
|
| 7282 |
+
/**
|
| 7283 |
+
* Extend the picker with a component and defaults.
|
| 7284 |
+
*/
|
| 7285 |
+
};PickerConstructor.extend = function (name, Component) {
|
| 7286 |
+
|
| 7287 |
+
// Extend jQuery.
|
| 7288 |
+
$.fn[name] = function (options, action) {
|
| 7289 |
+
|
| 7290 |
+
// Grab the component data.
|
| 7291 |
+
var componentData = this.data(name);
|
| 7292 |
+
|
| 7293 |
+
// If the picker is requested, return the data object.
|
| 7294 |
+
if (options == 'picker') {
|
| 7295 |
+
return componentData;
|
| 7296 |
+
}
|
| 7297 |
+
|
| 7298 |
+
// If the component data exists and `options` is a string, carry out the action.
|
| 7299 |
+
if (componentData && typeof options == 'string') {
|
| 7300 |
+
return PickerConstructor._.trigger(componentData[options], componentData, [action]);
|
| 7301 |
+
}
|
| 7302 |
+
|
| 7303 |
+
// Otherwise go through each matched element and if the component
|
| 7304 |
+
// doesn’t exist, create a new picker using `this` element
|
| 7305 |
+
// and merging the defaults and options with a deep copy.
|
| 7306 |
+
return this.each(function () {
|
| 7307 |
+
var $this = $(this);
|
| 7308 |
+
if (!$this.data(name)) {
|
| 7309 |
+
new PickerConstructor(this, name, Component, options);
|
| 7310 |
+
}
|
| 7311 |
+
});
|
| 7312 |
+
};
|
| 7313 |
+
|
| 7314 |
+
// Set the defaults.
|
| 7315 |
+
$.fn[name].defaults = Component.defaults;
|
| 7316 |
+
}; //PickerConstructor.extend
|
| 7317 |
+
|
| 7318 |
+
|
| 7319 |
+
function aria(element, attribute, value) {
|
| 7320 |
+
if ($.isPlainObject(attribute)) {
|
| 7321 |
+
for (var key in attribute) {
|
| 7322 |
+
ariaSet(element, key, attribute[key]);
|
| 7323 |
+
}
|
| 7324 |
+
} else {
|
| 7325 |
+
ariaSet(element, attribute, value);
|
| 7326 |
+
}
|
| 7327 |
+
}
|
| 7328 |
+
function ariaSet(element, attribute, value) {
|
| 7329 |
+
element.setAttribute((attribute == 'role' ? '' : 'aria-') + attribute, value);
|
| 7330 |
+
}
|
| 7331 |
+
function ariaAttr(attribute, data) {
|
| 7332 |
+
if (!$.isPlainObject(attribute)) {
|
| 7333 |
+
attribute = { attribute: data };
|
| 7334 |
+
}
|
| 7335 |
+
data = '';
|
| 7336 |
+
for (var key in attribute) {
|
| 7337 |
+
var attr = (key == 'role' ? '' : 'aria-') + key,
|
| 7338 |
+
attrVal = attribute[key];
|
| 7339 |
+
data += attrVal == null ? '' : attr + '="' + attribute[key] + '"';
|
| 7340 |
+
}
|
| 7341 |
+
return data;
|
| 7342 |
+
}
|
| 7343 |
+
|
| 7344 |
+
// IE8 bug throws an error for activeElements within iframes.
|
| 7345 |
+
function getActiveElement() {
|
| 7346 |
+
try {
|
| 7347 |
+
return document.activeElement;
|
| 7348 |
+
} catch (err) {}
|
| 7349 |
+
}
|
| 7350 |
+
|
| 7351 |
+
// Expose the picker constructor.
|
| 7352 |
+
return PickerConstructor;
|
| 7353 |
+
});
|
| 7354 |
+
; /*!
|
| 7355 |
+
* Date picker for pickadate.js v3.5.0
|
| 7356 |
+
* http://amsul.github.io/pickadate.js/date.htm
|
| 7357 |
+
*/
|
| 7358 |
+
|
| 7359 |
+
(function (factory) {
|
| 7360 |
+
factory(Materialize.Picker, jQuery);
|
| 7361 |
+
})(function (Picker, $) {
|
| 7362 |
+
|
| 7363 |
+
/**
|
| 7364 |
+
* Globals and constants
|
| 7365 |
+
*/
|
| 7366 |
+
var DAYS_IN_WEEK = 7,
|
| 7367 |
+
WEEKS_IN_CALENDAR = 6,
|
| 7368 |
+
_ = Picker._;
|
| 7369 |
+
|
| 7370 |
+
/**
|
| 7371 |
+
* The date picker constructor
|
| 7372 |
+
*/
|
| 7373 |
+
function DatePicker(picker, settings) {
|
| 7374 |
+
|
| 7375 |
+
var calendar = this,
|
| 7376 |
+
element = picker.$node[0],
|
| 7377 |
+
elementValue = element.value,
|
| 7378 |
+
elementDataValue = picker.$node.data('value'),
|
| 7379 |
+
valueString = elementDataValue || elementValue,
|
| 7380 |
+
formatString = elementDataValue ? settings.formatSubmit : settings.format,
|
| 7381 |
+
isRTL = function () {
|
| 7382 |
+
|
| 7383 |
+
return element.currentStyle ?
|
| 7384 |
+
|
| 7385 |
+
// For IE.
|
| 7386 |
+
element.currentStyle.direction == 'rtl' :
|
| 7387 |
+
|
| 7388 |
+
// For normal browsers.
|
| 7389 |
+
getComputedStyle(picker.$root[0]).direction == 'rtl';
|
| 7390 |
+
};
|
| 7391 |
+
|
| 7392 |
+
calendar.settings = settings;
|
| 7393 |
+
calendar.$node = picker.$node;
|
| 7394 |
+
|
| 7395 |
+
// The queue of methods that will be used to build item objects.
|
| 7396 |
+
calendar.queue = {
|
| 7397 |
+
min: 'measure create',
|
| 7398 |
+
max: 'measure create',
|
| 7399 |
+
now: 'now create',
|
| 7400 |
+
select: 'parse create validate',
|
| 7401 |
+
highlight: 'parse navigate create validate',
|
| 7402 |
+
view: 'parse create validate viewset',
|
| 7403 |
+
disable: 'deactivate',
|
| 7404 |
+
enable: 'activate'
|
| 7405 |
+
|
| 7406 |
+
// The component's item object.
|
| 7407 |
+
};calendar.item = {};
|
| 7408 |
+
|
| 7409 |
+
calendar.item.clear = null;
|
| 7410 |
+
calendar.item.disable = (settings.disable || []).slice(0);
|
| 7411 |
+
calendar.item.enable = -function (collectionDisabled) {
|
| 7412 |
+
return collectionDisabled[0] === true ? collectionDisabled.shift() : -1;
|
| 7413 |
+
}(calendar.item.disable);
|
| 7414 |
+
|
| 7415 |
+
calendar.set('min', settings.min).set('max', settings.max).set('now');
|
| 7416 |
+
|
| 7417 |
+
// When there’s a value, set the `select`, which in turn
|
| 7418 |
+
// also sets the `highlight` and `view`.
|
| 7419 |
+
if (valueString) {
|
| 7420 |
+
calendar.set('select', valueString, { format: formatString });
|
| 7421 |
+
}
|
| 7422 |
+
|
| 7423 |
+
// If there’s no value, default to highlighting “today”.
|
| 7424 |
+
else {
|
| 7425 |
+
calendar.set('select', null).set('highlight', calendar.item.now);
|
| 7426 |
+
}
|
| 7427 |
+
|
| 7428 |
+
// The keycode to movement mapping.
|
| 7429 |
+
calendar.key = {
|
| 7430 |
+
40: 7, // Down
|
| 7431 |
+
38: -7, // Up
|
| 7432 |
+
39: function () {
|
| 7433 |
+
return isRTL() ? -1 : 1;
|
| 7434 |
+
}, // Right
|
| 7435 |
+
37: function () {
|
| 7436 |
+
return isRTL() ? 1 : -1;
|
| 7437 |
+
}, // Left
|
| 7438 |
+
go: function (timeChange) {
|
| 7439 |
+
var highlightedObject = calendar.item.highlight,
|
| 7440 |
+
targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange);
|
| 7441 |
+
calendar.set('highlight', targetDate, { interval: timeChange });
|
| 7442 |
+
this.render();
|
| 7443 |
+
}
|
| 7444 |
+
|
| 7445 |
+
// Bind some picker events.
|
| 7446 |
+
};picker.on('render', function () {
|
| 7447 |
+
picker.$root.find('.' + settings.klass.selectMonth).on('change', function () {
|
| 7448 |
+
var value = this.value;
|
| 7449 |
+
if (value) {
|
| 7450 |
+
picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]);
|
| 7451 |
+
picker.$root.find('.' + settings.klass.selectMonth).trigger('focus');
|
| 7452 |
+
}
|
| 7453 |
+
});
|
| 7454 |
+
picker.$root.find('.' + settings.klass.selectYear).on('change', function () {
|
| 7455 |
+
var value = this.value;
|
| 7456 |
+
if (value) {
|
| 7457 |
+
picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]);
|
| 7458 |
+
picker.$root.find('.' + settings.klass.selectYear).trigger('focus');
|
| 7459 |
+
}
|
| 7460 |
+
});
|
| 7461 |
+
}, 1).on('open', function () {
|
| 7462 |
+
var includeToday = '';
|
| 7463 |
+
if (calendar.disabled(calendar.get('now'))) {
|
| 7464 |
+
includeToday = ':not(.' + settings.klass.buttonToday + ')';
|
| 7465 |
+
}
|
| 7466 |
+
picker.$root.find('button' + includeToday + ', select').attr('disabled', false);
|
| 7467 |
+
}, 1).on('close', function () {
|
| 7468 |
+
picker.$root.find('button, select').attr('disabled', true);
|
| 7469 |
+
}, 1);
|
| 7470 |
+
} //DatePicker
|
| 7471 |
+
|
| 7472 |
+
|
| 7473 |
+
/**
|
| 7474 |
+
* Set a datepicker item object.
|
| 7475 |
+
*/
|
| 7476 |
+
DatePicker.prototype.set = function (type, value, options) {
|
| 7477 |
+
|
| 7478 |
+
var calendar = this,
|
| 7479 |
+
calendarItem = calendar.item;
|
| 7480 |
+
|
| 7481 |
+
// If the value is `null` just set it immediately.
|
| 7482 |
+
if (value === null) {
|
| 7483 |
+
if (type == 'clear') type = 'select';
|
| 7484 |
+
calendarItem[type] = value;
|
| 7485 |
+
return calendar;
|
| 7486 |
+
}
|
| 7487 |
+
|
| 7488 |
+
// Otherwise go through the queue of methods, and invoke the functions.
|
| 7489 |
+
// Update this as the time unit, and set the final value as this item.
|
| 7490 |
+
// * In the case of `enable`, keep the queue but set `disable` instead.
|
| 7491 |
+
// And in the case of `flip`, keep the queue but set `enable` instead.
|
| 7492 |
+
calendarItem[type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type] = calendar.queue[type].split(' ').map(function (method) {
|
| 7493 |
+
value = calendar[method](type, value, options);
|
| 7494 |
+
return value;
|
| 7495 |
+
}).pop();
|
| 7496 |
+
|
| 7497 |
+
// Check if we need to cascade through more updates.
|
| 7498 |
+
if (type == 'select') {
|
| 7499 |
+
calendar.set('highlight', calendarItem.select, options);
|
| 7500 |
+
} else if (type == 'highlight') {
|
| 7501 |
+
calendar.set('view', calendarItem.highlight, options);
|
| 7502 |
+
} else if (type.match(/^(flip|min|max|disable|enable)$/)) {
|
| 7503 |
+
if (calendarItem.select && calendar.disabled(calendarItem.select)) {
|
| 7504 |
+
calendar.set('select', calendarItem.select, options);
|
| 7505 |
+
}
|
| 7506 |
+
if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) {
|
| 7507 |
+
calendar.set('highlight', calendarItem.highlight, options);
|
| 7508 |
+
}
|
| 7509 |
+
}
|
| 7510 |
+
|
| 7511 |
+
return calendar;
|
| 7512 |
+
}; //DatePicker.prototype.set
|
| 7513 |
+
|
| 7514 |
+
|
| 7515 |
+
/**
|
| 7516 |
+
* Get a datepicker item object.
|
| 7517 |
+
*/
|
| 7518 |
+
DatePicker.prototype.get = function (type) {
|
| 7519 |
+
return this.item[type];
|
| 7520 |
+
}; //DatePicker.prototype.get
|
| 7521 |
+
|
| 7522 |
+
|
| 7523 |
+
/**
|
| 7524 |
+
* Create a picker date object.
|
| 7525 |
+
*/
|
| 7526 |
+
DatePicker.prototype.create = function (type, value, options) {
|
| 7527 |
+
|
| 7528 |
+
var isInfiniteValue,
|
| 7529 |
+
calendar = this;
|
| 7530 |
+
|
| 7531 |
+
// If there’s no value, use the type as the value.
|
| 7532 |
+
value = value === undefined ? type : value;
|
| 7533 |
+
|
| 7534 |
+
// If it’s infinity, update the value.
|
| 7535 |
+
if (value == -Infinity || value == Infinity) {
|
| 7536 |
+
isInfiniteValue = value;
|
| 7537 |
+
}
|
| 7538 |
+
|
| 7539 |
+
// If it’s an object, use the native date object.
|
| 7540 |
+
else if ($.isPlainObject(value) && _.isInteger(value.pick)) {
|
| 7541 |
+
value = value.obj;
|
| 7542 |
+
}
|
| 7543 |
+
|
| 7544 |
+
// If it’s an array, convert it into a date and make sure
|
| 7545 |
+
// that it’s a valid date – otherwise default to today.
|
| 7546 |
+
else if ($.isArray(value)) {
|
| 7547 |
+
value = new Date(value[0], value[1], value[2]);
|
| 7548 |
+
value = _.isDate(value) ? value : calendar.create().obj;
|
| 7549 |
+
}
|
| 7550 |
+
|
| 7551 |
+
// If it’s a number or date object, make a normalized date.
|
| 7552 |
+
else if (_.isInteger(value) || _.isDate(value)) {
|
| 7553 |
+
value = calendar.normalize(new Date(value), options);
|
| 7554 |
+
}
|
| 7555 |
+
|
| 7556 |
+
// If it’s a literal true or any other case, set it to now.
|
| 7557 |
+
else /*if ( value === true )*/{
|
| 7558 |
+
value = calendar.now(type, value, options);
|
| 7559 |
+
}
|
| 7560 |
+
|
| 7561 |
+
// Return the compiled object.
|
| 7562 |
+
return {
|
| 7563 |
+
year: isInfiniteValue || value.getFullYear(),
|
| 7564 |
+
month: isInfiniteValue || value.getMonth(),
|
| 7565 |
+
date: isInfiniteValue || value.getDate(),
|
| 7566 |
+
day: isInfiniteValue || value.getDay(),
|
| 7567 |
+
obj: isInfiniteValue || value,
|
| 7568 |
+
pick: isInfiniteValue || value.getTime()
|
| 7569 |
+
};
|
| 7570 |
+
}; //DatePicker.prototype.create
|
| 7571 |
+
|
| 7572 |
+
|
| 7573 |
+
/**
|
| 7574 |
+
* Create a range limit object using an array, date object,
|
| 7575 |
+
* literal “true”, or integer relative to another time.
|
| 7576 |
+
*/
|
| 7577 |
+
DatePicker.prototype.createRange = function (from, to) {
|
| 7578 |
+
|
| 7579 |
+
var calendar = this,
|
| 7580 |
+
createDate = function (date) {
|
| 7581 |
+
if (date === true || $.isArray(date) || _.isDate(date)) {
|
| 7582 |
+
return calendar.create(date);
|
| 7583 |
+
}
|
| 7584 |
+
return date;
|
| 7585 |
+
};
|
| 7586 |
+
|
| 7587 |
+
// Create objects if possible.
|
| 7588 |
+
if (!_.isInteger(from)) {
|
| 7589 |
+
from = createDate(from);
|
| 7590 |
+
}
|
| 7591 |
+
if (!_.isInteger(to)) {
|
| 7592 |
+
to = createDate(to);
|
| 7593 |
+
}
|
| 7594 |
+
|
| 7595 |
+
// Create relative dates.
|
| 7596 |
+
if (_.isInteger(from) && $.isPlainObject(to)) {
|
| 7597 |
+
from = [to.year, to.month, to.date + from];
|
| 7598 |
+
} else if (_.isInteger(to) && $.isPlainObject(from)) {
|
| 7599 |
+
to = [from.year, from.month, from.date + to];
|
| 7600 |
+
}
|
| 7601 |
+
|
| 7602 |
+
return {
|
| 7603 |
+
from: createDate(from),
|
| 7604 |
+
to: createDate(to)
|
| 7605 |
+
};
|
| 7606 |
+
}; //DatePicker.prototype.createRange
|
| 7607 |
+
|
| 7608 |
+
|
| 7609 |
+
/**
|
| 7610 |
+
* Check if a date unit falls within a date range object.
|
| 7611 |
+
*/
|
| 7612 |
+
DatePicker.prototype.withinRange = function (range, dateUnit) {
|
| 7613 |
+
range = this.createRange(range.from, range.to);
|
| 7614 |
+
return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick;
|
| 7615 |
+
};
|
| 7616 |
+
|
| 7617 |
+
/**
|
| 7618 |
+
* Check if two date range objects overlap.
|
| 7619 |
+
*/
|
| 7620 |
+
DatePicker.prototype.overlapRanges = function (one, two) {
|
| 7621 |
+
|
| 7622 |
+
var calendar = this;
|
| 7623 |
+
|
| 7624 |
+
// Convert the ranges into comparable dates.
|
| 7625 |
+
one = calendar.createRange(one.from, one.to);
|
| 7626 |
+
two = calendar.createRange(two.from, two.to);
|
| 7627 |
+
|
| 7628 |
+
return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) || calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to);
|
| 7629 |
+
};
|
| 7630 |
+
|
| 7631 |
+
/**
|
| 7632 |
+
* Get the date today.
|
| 7633 |
+
*/
|
| 7634 |
+
DatePicker.prototype.now = function (type, value, options) {
|
| 7635 |
+
value = new Date();
|
| 7636 |
+
if (options && options.rel) {
|
| 7637 |
+
value.setDate(value.getDate() + options.rel);
|
| 7638 |
+
}
|
| 7639 |
+
return this.normalize(value, options);
|
| 7640 |
+
};
|
| 7641 |
+
|
| 7642 |
+
/**
|
| 7643 |
+
* Navigate to next/prev month.
|
| 7644 |
+
*/
|
| 7645 |
+
DatePicker.prototype.navigate = function (type, value, options) {
|
| 7646 |
+
|
| 7647 |
+
var targetDateObject,
|
| 7648 |
+
targetYear,
|
| 7649 |
+
targetMonth,
|
| 7650 |
+
targetDate,
|
| 7651 |
+
isTargetArray = $.isArray(value),
|
| 7652 |
+
isTargetObject = $.isPlainObject(value),
|
| 7653 |
+
viewsetObject = this.item.view; /*,
|
| 7654 |
+
safety = 100*/
|
| 7655 |
+
|
| 7656 |
+
if (isTargetArray || isTargetObject) {
|
| 7657 |
+
|
| 7658 |
+
if (isTargetObject) {
|
| 7659 |
+
targetYear = value.year;
|
| 7660 |
+
targetMonth = value.month;
|
| 7661 |
+
targetDate = value.date;
|
| 7662 |
+
} else {
|
| 7663 |
+
targetYear = +value[0];
|
| 7664 |
+
targetMonth = +value[1];
|
| 7665 |
+
targetDate = +value[2];
|
| 7666 |
+
}
|
| 7667 |
+
|
| 7668 |
+
// If we’re navigating months but the view is in a different
|
| 7669 |
+
// month, navigate to the view’s year and month.
|
| 7670 |
+
if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) {
|
| 7671 |
+
targetYear = viewsetObject.year;
|
| 7672 |
+
targetMonth = viewsetObject.month;
|
| 7673 |
+
}
|
| 7674 |
+
|
| 7675 |
+
// Figure out the expected target year and month.
|
| 7676 |
+
targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1);
|
| 7677 |
+
targetYear = targetDateObject.getFullYear();
|
| 7678 |
+
targetMonth = targetDateObject.getMonth();
|
| 7679 |
+
|
| 7680 |
+
// If the month we’re going to doesn’t have enough days,
|
| 7681 |
+
// keep decreasing the date until we reach the month’s last date.
|
| 7682 |
+
while ( /*safety &&*/new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) {
|
| 7683 |
+
targetDate -= 1;
|
| 7684 |
+
/*safety -= 1
|
| 7685 |
+
if ( !safety ) {
|
| 7686 |
+
throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
|
| 7687 |
+
}*/
|
| 7688 |
+
}
|
| 7689 |
+
|
| 7690 |
+
value = [targetYear, targetMonth, targetDate];
|
| 7691 |
+
}
|
| 7692 |
+
|
| 7693 |
+
return value;
|
| 7694 |
+
}; //DatePicker.prototype.navigate
|
| 7695 |
+
|
| 7696 |
+
|
| 7697 |
+
/**
|
| 7698 |
+
* Normalize a date by setting the hours to midnight.
|
| 7699 |
+
*/
|
| 7700 |
+
DatePicker.prototype.normalize = function (value /*, options*/) {
|
| 7701 |
+
value.setHours(0, 0, 0, 0);
|
| 7702 |
+
return value;
|
| 7703 |
+
};
|
| 7704 |
+
|
| 7705 |
+
/**
|
| 7706 |
+
* Measure the range of dates.
|
| 7707 |
+
*/
|
| 7708 |
+
DatePicker.prototype.measure = function (type, value /*, options*/) {
|
| 7709 |
+
|
| 7710 |
+
var calendar = this;
|
| 7711 |
+
|
| 7712 |
+
// If it’s anything false-y, remove the limits.
|
| 7713 |
+
if (!value) {
|
| 7714 |
+
value = type == 'min' ? -Infinity : Infinity;
|
| 7715 |
+
}
|
| 7716 |
+
|
| 7717 |
+
// If it’s a string, parse it.
|
| 7718 |
+
else if (typeof value == 'string') {
|
| 7719 |
+
value = calendar.parse(type, value);
|
| 7720 |
+
}
|
| 7721 |
+
|
| 7722 |
+
// If it's an integer, get a date relative to today.
|
| 7723 |
+
else if (_.isInteger(value)) {
|
| 7724 |
+
value = calendar.now(type, value, { rel: value });
|
| 7725 |
+
}
|
| 7726 |
+
|
| 7727 |
+
return value;
|
| 7728 |
+
}; ///DatePicker.prototype.measure
|
| 7729 |
+
|
| 7730 |
+
|
| 7731 |
+
/**
|
| 7732 |
+
* Create a viewset object based on navigation.
|
| 7733 |
+
*/
|
| 7734 |
+
DatePicker.prototype.viewset = function (type, dateObject /*, options*/) {
|
| 7735 |
+
return this.create([dateObject.year, dateObject.month, 1]);
|
| 7736 |
+
};
|
| 7737 |
+
|
| 7738 |
+
/**
|
| 7739 |
+
* Validate a date as enabled and shift if needed.
|
| 7740 |
+
*/
|
| 7741 |
+
DatePicker.prototype.validate = function (type, dateObject, options) {
|
| 7742 |
+
|
| 7743 |
+
var calendar = this,
|
| 7744 |
+
|
| 7745 |
+
|
| 7746 |
+
// Keep a reference to the original date.
|
| 7747 |
+
originalDateObject = dateObject,
|
| 7748 |
+
|
| 7749 |
+
|
| 7750 |
+
// Make sure we have an interval.
|
| 7751 |
+
interval = options && options.interval ? options.interval : 1,
|
| 7752 |
+
|
| 7753 |
+
|
| 7754 |
+
// Check if the calendar enabled dates are inverted.
|
| 7755 |
+
isFlippedBase = calendar.item.enable === -1,
|
| 7756 |
+
|
| 7757 |
+
|
| 7758 |
+
// Check if we have any enabled dates after/before now.
|
| 7759 |
+
hasEnabledBeforeTarget,
|
| 7760 |
+
hasEnabledAfterTarget,
|
| 7761 |
+
|
| 7762 |
+
|
| 7763 |
+
// The min & max limits.
|
| 7764 |
+
minLimitObject = calendar.item.min,
|
| 7765 |
+
maxLimitObject = calendar.item.max,
|
| 7766 |
+
|
| 7767 |
+
|
| 7768 |
+
// Check if we’ve reached the limit during shifting.
|
| 7769 |
+
reachedMin,
|
| 7770 |
+
reachedMax,
|
| 7771 |
+
|
| 7772 |
+
|
| 7773 |
+
// Check if the calendar is inverted and at least one weekday is enabled.
|
| 7774 |
+
hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {
|
| 7775 |
+
|
| 7776 |
+
// If there’s a date, check where it is relative to the target.
|
| 7777 |
+
if ($.isArray(value)) {
|
| 7778 |
+
var dateTime = calendar.create(value).pick;
|
| 7779 |
+
if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true;else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true;
|
| 7780 |
+
}
|
| 7781 |
+
|
| 7782 |
+
// Return only integers for enabled weekdays.
|
| 7783 |
+
return _.isInteger(value);
|
| 7784 |
+
}).length; /*,
|
| 7785 |
+
safety = 100*/
|
| 7786 |
+
|
| 7787 |
+
// Cases to validate for:
|
| 7788 |
+
// [1] Not inverted and date disabled.
|
| 7789 |
+
// [2] Inverted and some dates enabled.
|
| 7790 |
+
// [3] Not inverted and out of range.
|
| 7791 |
+
//
|
| 7792 |
+
// Cases to **not** validate for:
|
| 7793 |
+
// • Navigating months.
|
| 7794 |
+
// • Not inverted and date enabled.
|
| 7795 |
+
// • Inverted and all dates disabled.
|
| 7796 |
+
// • ..and anything else.
|
| 7797 |
+
if (!options || !options.nav) if (
|
| 7798 |
+
/* 1 */!isFlippedBase && calendar.disabled(dateObject) ||
|
| 7799 |
+
/* 2 */isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget) ||
|
| 7800 |
+
/* 3 */!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick)) {
|
| 7801 |
+
|
| 7802 |
+
// When inverted, flip the direction if there aren’t any enabled weekdays
|
| 7803 |
+
// and there are no enabled dates in the direction of the interval.
|
| 7804 |
+
if (isFlippedBase && !hasEnabledWeekdays && (!hasEnabledAfterTarget && interval > 0 || !hasEnabledBeforeTarget && interval < 0)) {
|
| 7805 |
+
interval *= -1;
|
| 7806 |
+
}
|
| 7807 |
+
|
| 7808 |
+
// Keep looping until we reach an enabled date.
|
| 7809 |
+
while ( /*safety &&*/calendar.disabled(dateObject)) {
|
| 7810 |
+
|
| 7811 |
+
/*safety -= 1
|
| 7812 |
+
if ( !safety ) {
|
| 7813 |
+
throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
|
| 7814 |
+
}*/
|
| 7815 |
+
|
| 7816 |
+
// If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
|
| 7817 |
+
if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) {
|
| 7818 |
+
dateObject = originalDateObject;
|
| 7819 |
+
interval = interval > 0 ? 1 : -1;
|
| 7820 |
+
}
|
| 7821 |
+
|
| 7822 |
+
// If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
|
| 7823 |
+
if (dateObject.pick <= minLimitObject.pick) {
|
| 7824 |
+
reachedMin = true;
|
| 7825 |
+
interval = 1;
|
| 7826 |
+
dateObject = calendar.create([minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)]);
|
| 7827 |
+
} else if (dateObject.pick >= maxLimitObject.pick) {
|
| 7828 |
+
reachedMax = true;
|
| 7829 |
+
interval = -1;
|
| 7830 |
+
dateObject = calendar.create([maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)]);
|
| 7831 |
+
}
|
| 7832 |
+
|
| 7833 |
+
// If we’ve reached both limits, just break out of the loop.
|
| 7834 |
+
if (reachedMin && reachedMax) {
|
| 7835 |
+
break;
|
| 7836 |
+
}
|
| 7837 |
+
|
| 7838 |
+
// Finally, create the shifted date using the interval and keep looping.
|
| 7839 |
+
dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]);
|
| 7840 |
+
}
|
| 7841 |
+
} //endif
|
| 7842 |
+
|
| 7843 |
+
|
| 7844 |
+
// Return the date object settled on.
|
| 7845 |
+
return dateObject;
|
| 7846 |
+
}; //DatePicker.prototype.validate
|
| 7847 |
+
|
| 7848 |
+
|
| 7849 |
+
/**
|
| 7850 |
+
* Check if a date is disabled.
|
| 7851 |
+
*/
|
| 7852 |
+
DatePicker.prototype.disabled = function (dateToVerify) {
|
| 7853 |
+
|
| 7854 |
+
var calendar = this,
|
| 7855 |
+
|
| 7856 |
+
|
| 7857 |
+
// Filter through the disabled dates to check if this is one.
|
| 7858 |
+
isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {
|
| 7859 |
+
|
| 7860 |
+
// If the date is a number, match the weekday with 0index and `firstDay` check.
|
| 7861 |
+
if (_.isInteger(dateToDisable)) {
|
| 7862 |
+
return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7;
|
| 7863 |
+
}
|
| 7864 |
+
|
| 7865 |
+
// If it’s an array or a native JS date, create and match the exact date.
|
| 7866 |
+
if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) {
|
| 7867 |
+
return dateToVerify.pick === calendar.create(dateToDisable).pick;
|
| 7868 |
+
}
|
| 7869 |
+
|
| 7870 |
+
// If it’s an object, match a date within the “from” and “to” range.
|
| 7871 |
+
if ($.isPlainObject(dateToDisable)) {
|
| 7872 |
+
return calendar.withinRange(dateToDisable, dateToVerify);
|
| 7873 |
+
}
|
| 7874 |
+
});
|
| 7875 |
+
|
| 7876 |
+
// If this date matches a disabled date, confirm it’s not inverted.
|
| 7877 |
+
isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) {
|
| 7878 |
+
return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' || $.isPlainObject(dateToDisable) && dateToDisable.inverted;
|
| 7879 |
+
}).length;
|
| 7880 |
+
|
| 7881 |
+
// Check the calendar “enabled” flag and respectively flip the
|
| 7882 |
+
// disabled state. Then also check if it’s beyond the min/max limits.
|
| 7883 |
+
return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || dateToVerify.pick < calendar.item.min.pick || dateToVerify.pick > calendar.item.max.pick;
|
| 7884 |
+
}; //DatePicker.prototype.disabled
|
| 7885 |
+
|
| 7886 |
+
|
| 7887 |
+
/**
|
| 7888 |
+
* Parse a string into a usable type.
|
| 7889 |
+
*/
|
| 7890 |
+
DatePicker.prototype.parse = function (type, value, options) {
|
| 7891 |
+
|
| 7892 |
+
var calendar = this,
|
| 7893 |
+
parsingObject = {};
|
| 7894 |
+
|
| 7895 |
+
// If it’s already parsed, we’re good.
|
| 7896 |
+
if (!value || typeof value != 'string') {
|
| 7897 |
+
return value;
|
| 7898 |
+
}
|
| 7899 |
+
|
| 7900 |
+
// We need a `.format` to parse the value with.
|
| 7901 |
+
if (!(options && options.format)) {
|
| 7902 |
+
options = options || {};
|
| 7903 |
+
options.format = calendar.settings.format;
|
| 7904 |
+
}
|
| 7905 |
+
|
| 7906 |
+
// Convert the format into an array and then map through it.
|
| 7907 |
+
calendar.formats.toArray(options.format).map(function (label) {
|
| 7908 |
+
|
| 7909 |
+
var
|
| 7910 |
+
// Grab the formatting label.
|
| 7911 |
+
formattingLabel = calendar.formats[label],
|
| 7912 |
+
|
| 7913 |
+
|
| 7914 |
+
// The format length is from the formatting label function or the
|
| 7915 |
+
// label length without the escaping exclamation (!) mark.
|
| 7916 |
+
formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, '').length;
|
| 7917 |
+
|
| 7918 |
+
// If there's a format label, split the value up to the format length.
|
| 7919 |
+
// Then add it to the parsing object with appropriate label.
|
| 7920 |
+
if (formattingLabel) {
|
| 7921 |
+
parsingObject[label] = value.substr(0, formatLength);
|
| 7922 |
+
}
|
| 7923 |
+
|
| 7924 |
+
// Update the value as the substring from format length to end.
|
| 7925 |
+
value = value.substr(formatLength);
|
| 7926 |
+
});
|
| 7927 |
+
|
| 7928 |
+
// Compensate for month 0index.
|
| 7929 |
+
return [parsingObject.yyyy || parsingObject.yy, +(parsingObject.mm || parsingObject.m) - 1, parsingObject.dd || parsingObject.d];
|
| 7930 |
+
}; //DatePicker.prototype.parse
|
| 7931 |
+
|
| 7932 |
+
|
| 7933 |
+
/**
|
| 7934 |
+
* Various formats to display the object in.
|
| 7935 |
+
*/
|
| 7936 |
+
DatePicker.prototype.formats = function () {
|
| 7937 |
+
|
| 7938 |
+
// Return the length of the first word in a collection.
|
| 7939 |
+
function getWordLengthFromCollection(string, collection, dateObject) {
|
| 7940 |
+
|
| 7941 |
+
// Grab the first word from the string.
|
| 7942 |
+
var word = string.match(/\w+/)[0];
|
| 7943 |
+
|
| 7944 |
+
// If there's no month index, add it to the date object
|
| 7945 |
+
if (!dateObject.mm && !dateObject.m) {
|
| 7946 |
+
dateObject.m = collection.indexOf(word) + 1;
|
| 7947 |
+
}
|
| 7948 |
+
|
| 7949 |
+
// Return the length of the word.
|
| 7950 |
+
return word.length;
|
| 7951 |
+
}
|
| 7952 |
+
|
| 7953 |
+
// Get the length of the first word in a string.
|
| 7954 |
+
function getFirstWordLength(string) {
|
| 7955 |
+
return string.match(/\w+/)[0].length;
|
| 7956 |
+
}
|
| 7957 |
+
|
| 7958 |
+
return {
|
| 7959 |
+
|
| 7960 |
+
d: function (string, dateObject) {
|
| 7961 |
+
|
| 7962 |
+
// If there's string, then get the digits length.
|
| 7963 |
+
// Otherwise return the selected date.
|
| 7964 |
+
return string ? _.digits(string) : dateObject.date;
|
| 7965 |
+
},
|
| 7966 |
+
dd: function (string, dateObject) {
|
| 7967 |
+
|
| 7968 |
+
// If there's a string, then the length is always 2.
|
| 7969 |
+
// Otherwise return the selected date with a leading zero.
|
| 7970 |
+
return string ? 2 : _.lead(dateObject.date);
|
| 7971 |
+
},
|
| 7972 |
+
ddd: function (string, dateObject) {
|
| 7973 |
+
|
| 7974 |
+
// If there's a string, then get the length of the first word.
|
| 7975 |
+
// Otherwise return the short selected weekday.
|
| 7976 |
+
return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day];
|
| 7977 |
+
},
|
| 7978 |
+
dddd: function (string, dateObject) {
|
| 7979 |
+
|
| 7980 |
+
// If there's a string, then get the length of the first word.
|
| 7981 |
+
// Otherwise return the full selected weekday.
|
| 7982 |
+
return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day];
|
| 7983 |
+
},
|
| 7984 |
+
m: function (string, dateObject) {
|
| 7985 |
+
|
| 7986 |
+
// If there's a string, then get the length of the digits
|
| 7987 |
+
// Otherwise return the selected month with 0index compensation.
|
| 7988 |
+
return string ? _.digits(string) : dateObject.month + 1;
|
| 7989 |
+
},
|
| 7990 |
+
mm: function (string, dateObject) {
|
| 7991 |
+
|
| 7992 |
+
// If there's a string, then the length is always 2.
|
| 7993 |
+
// Otherwise return the selected month with 0index and leading zero.
|
| 7994 |
+
return string ? 2 : _.lead(dateObject.month + 1);
|
| 7995 |
+
},
|
| 7996 |
+
mmm: function (string, dateObject) {
|
| 7997 |
+
|
| 7998 |
+
var collection = this.settings.monthsShort;
|
| 7999 |
+
|
| 8000 |
+
// If there's a string, get length of the relevant month from the short
|
| 8001 |
+
// months collection. Otherwise return the selected month from that collection.
|
| 8002 |
+
return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
|
| 8003 |
+
},
|
| 8004 |
+
mmmm: function (string, dateObject) {
|
| 8005 |
+
|
| 8006 |
+
var collection = this.settings.monthsFull;
|
| 8007 |
+
|
| 8008 |
+
// If there's a string, get length of the relevant month from the full
|
| 8009 |
+
// months collection. Otherwise return the selected month from that collection.
|
| 8010 |
+
return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
|
| 8011 |
+
},
|
| 8012 |
+
yy: function (string, dateObject) {
|
| 8013 |
+
|
| 8014 |
+
// If there's a string, then the length is always 2.
|
| 8015 |
+
// Otherwise return the selected year by slicing out the first 2 digits.
|
| 8016 |
+
return string ? 2 : ('' + dateObject.year).slice(2);
|
| 8017 |
+
},
|
| 8018 |
+
yyyy: function (string, dateObject) {
|
| 8019 |
+
|
| 8020 |
+
// If there's a string, then the length is always 4.
|
| 8021 |
+
// Otherwise return the selected year.
|
| 8022 |
+
return string ? 4 : dateObject.year;
|
| 8023 |
+
},
|
| 8024 |
+
|
| 8025 |
+
// Create an array by splitting the formatting string passed.
|
| 8026 |
+
toArray: function (formatString) {
|
| 8027 |
+
return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g);
|
| 8028 |
+
},
|
| 8029 |
+
|
| 8030 |
+
// Format an object into a string using the formatting options.
|
| 8031 |
+
toString: function (formatString, itemObject) {
|
| 8032 |
+
var calendar = this;
|
| 8033 |
+
return calendar.formats.toArray(formatString).map(function (label) {
|
| 8034 |
+
return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, '');
|
| 8035 |
+
}).join('');
|
| 8036 |
+
}
|
| 8037 |
+
};
|
| 8038 |
+
}(); //DatePicker.prototype.formats
|
| 8039 |
+
|
| 8040 |
+
|
| 8041 |
+
/**
|
| 8042 |
+
* Check if two date units are the exact.
|
| 8043 |
+
*/
|
| 8044 |
+
DatePicker.prototype.isDateExact = function (one, two) {
|
| 8045 |
+
|
| 8046 |
+
var calendar = this;
|
| 8047 |
+
|
| 8048 |
+
// When we’re working with weekdays, do a direct comparison.
|
| 8049 |
+
if (_.isInteger(one) && _.isInteger(two) || typeof one == 'boolean' && typeof two == 'boolean') {
|
| 8050 |
+
return one === two;
|
| 8051 |
+
}
|
| 8052 |
+
|
| 8053 |
+
// When we’re working with date representations, compare the “pick” value.
|
| 8054 |
+
if ((_.isDate(one) || $.isArray(one)) && (_.isDate(two) || $.isArray(two))) {
|
| 8055 |
+
return calendar.create(one).pick === calendar.create(two).pick;
|
| 8056 |
+
}
|
| 8057 |
+
|
| 8058 |
+
// When we’re working with range objects, compare the “from” and “to”.
|
| 8059 |
+
if ($.isPlainObject(one) && $.isPlainObject(two)) {
|
| 8060 |
+
return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to);
|
| 8061 |
+
}
|
| 8062 |
+
|
| 8063 |
+
return false;
|
| 8064 |
+
};
|
| 8065 |
+
|
| 8066 |
+
/**
|
| 8067 |
+
* Check if two date units overlap.
|
| 8068 |
+
*/
|
| 8069 |
+
DatePicker.prototype.isDateOverlap = function (one, two) {
|
| 8070 |
+
|
| 8071 |
+
var calendar = this,
|
| 8072 |
+
firstDay = calendar.settings.firstDay ? 1 : 0;
|
| 8073 |
+
|
| 8074 |
+
// When we’re working with a weekday index, compare the days.
|
| 8075 |
+
if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) {
|
| 8076 |
+
one = one % 7 + firstDay;
|
| 8077 |
+
return one === calendar.create(two).day + 1;
|
| 8078 |
+
}
|
| 8079 |
+
if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) {
|
| 8080 |
+
two = two % 7 + firstDay;
|
| 8081 |
+
return two === calendar.create(one).day + 1;
|
| 8082 |
+
}
|
| 8083 |
+
|
| 8084 |
+
// When we’re working with range objects, check if the ranges overlap.
|
| 8085 |
+
if ($.isPlainObject(one) && $.isPlainObject(two)) {
|
| 8086 |
+
return calendar.overlapRanges(one, two);
|
| 8087 |
+
}
|
| 8088 |
+
|
| 8089 |
+
return false;
|
| 8090 |
+
};
|
| 8091 |
+
|
| 8092 |
+
/**
|
| 8093 |
+
* Flip the “enabled” state.
|
| 8094 |
+
*/
|
| 8095 |
+
DatePicker.prototype.flipEnable = function (val) {
|
| 8096 |
+
var itemObject = this.item;
|
| 8097 |
+
itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1);
|
| 8098 |
+
};
|
| 8099 |
+
|
| 8100 |
+
/**
|
| 8101 |
+
* Mark a collection of dates as “disabled”.
|
| 8102 |
+
*/
|
| 8103 |
+
DatePicker.prototype.deactivate = function (type, datesToDisable) {
|
| 8104 |
+
|
| 8105 |
+
var calendar = this,
|
| 8106 |
+
disabledItems = calendar.item.disable.slice(0);
|
| 8107 |
+
|
| 8108 |
+
// If we’re flipping, that’s all we need to do.
|
| 8109 |
+
if (datesToDisable == 'flip') {
|
| 8110 |
+
calendar.flipEnable();
|
| 8111 |
+
} else if (datesToDisable === false) {
|
| 8112 |
+
calendar.flipEnable(1);
|
| 8113 |
+
disabledItems = [];
|
| 8114 |
+
} else if (datesToDisable === true) {
|
| 8115 |
+
calendar.flipEnable(-1);
|
| 8116 |
+
disabledItems = [];
|
| 8117 |
+
}
|
| 8118 |
+
|
| 8119 |
+
// Otherwise go through the dates to disable.
|
| 8120 |
+
else {
|
| 8121 |
+
|
| 8122 |
+
datesToDisable.map(function (unitToDisable) {
|
| 8123 |
+
|
| 8124 |
+
var matchFound;
|
| 8125 |
+
|
| 8126 |
+
// When we have disabled items, check for matches.
|
| 8127 |
+
// If something is matched, immediately break out.
|
| 8128 |
+
for (var index = 0; index < disabledItems.length; index += 1) {
|
| 8129 |
+
if (calendar.isDateExact(unitToDisable, disabledItems[index])) {
|
| 8130 |
+
matchFound = true;
|
| 8131 |
+
break;
|
| 8132 |
+
}
|
| 8133 |
+
}
|
| 8134 |
+
|
| 8135 |
+
// If nothing was found, add the validated unit to the collection.
|
| 8136 |
+
if (!matchFound) {
|
| 8137 |
+
if (_.isInteger(unitToDisable) || _.isDate(unitToDisable) || $.isArray(unitToDisable) || $.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) {
|
| 8138 |
+
disabledItems.push(unitToDisable);
|
| 8139 |
+
}
|
| 8140 |
+
}
|
| 8141 |
+
});
|
| 8142 |
+
}
|
| 8143 |
+
|
| 8144 |
+
// Return the updated collection.
|
| 8145 |
+
return disabledItems;
|
| 8146 |
+
}; //DatePicker.prototype.deactivate
|
| 8147 |
+
|
| 8148 |
+
|
| 8149 |
+
/**
|
| 8150 |
+
* Mark a collection of dates as “enabled”.
|
| 8151 |
+
*/
|
| 8152 |
+
DatePicker.prototype.activate = function (type, datesToEnable) {
|
| 8153 |
+
|
| 8154 |
+
var calendar = this,
|
| 8155 |
+
disabledItems = calendar.item.disable,
|
| 8156 |
+
disabledItemsCount = disabledItems.length;
|
| 8157 |
+
|
| 8158 |
+
// If we’re flipping, that’s all we need to do.
|
| 8159 |
+
if (datesToEnable == 'flip') {
|
| 8160 |
+
calendar.flipEnable();
|
| 8161 |
+
} else if (datesToEnable === true) {
|
| 8162 |
+
calendar.flipEnable(1);
|
| 8163 |
+
disabledItems = [];
|
| 8164 |
+
} else if (datesToEnable === false) {
|
| 8165 |
+
calendar.flipEnable(-1);
|
| 8166 |
+
disabledItems = [];
|
| 8167 |
+
}
|
| 8168 |
+
|
| 8169 |
+
// Otherwise go through the disabled dates.
|
| 8170 |
+
else {
|
| 8171 |
+
|
| 8172 |
+
datesToEnable.map(function (unitToEnable) {
|
| 8173 |
+
|
| 8174 |
+
var matchFound, disabledUnit, index, isExactRange;
|
| 8175 |
+
|
| 8176 |
+
// Go through the disabled items and try to find a match.
|
| 8177 |
+
for (index = 0; index < disabledItemsCount; index += 1) {
|
| 8178 |
+
|
| 8179 |
+
disabledUnit = disabledItems[index];
|
| 8180 |
+
|
| 8181 |
+
// When an exact match is found, remove it from the collection.
|
| 8182 |
+
if (calendar.isDateExact(disabledUnit, unitToEnable)) {
|
| 8183 |
+
matchFound = disabledItems[index] = null;
|
| 8184 |
+
isExactRange = true;
|
| 8185 |
+
break;
|
| 8186 |
+
}
|
| 8187 |
+
|
| 8188 |
+
// When an overlapped match is found, add the “inverted” state to it.
|
| 8189 |
+
else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) {
|
| 8190 |
+
if ($.isPlainObject(unitToEnable)) {
|
| 8191 |
+
unitToEnable.inverted = true;
|
| 8192 |
+
matchFound = unitToEnable;
|
| 8193 |
+
} else if ($.isArray(unitToEnable)) {
|
| 8194 |
+
matchFound = unitToEnable;
|
| 8195 |
+
if (!matchFound[3]) matchFound.push('inverted');
|
| 8196 |
+
} else if (_.isDate(unitToEnable)) {
|
| 8197 |
+
matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted'];
|
| 8198 |
+
}
|
| 8199 |
+
break;
|
| 8200 |
+
}
|
| 8201 |
+
}
|
| 8202 |
+
|
| 8203 |
+
// If a match was found, remove a previous duplicate entry.
|
| 8204 |
+
if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) {
|
| 8205 |
+
if (calendar.isDateExact(disabledItems[index], unitToEnable)) {
|
| 8206 |
+
disabledItems[index] = null;
|
| 8207 |
+
break;
|
| 8208 |
+
}
|
| 8209 |
+
}
|
| 8210 |
+
|
| 8211 |
+
// In the event that we’re dealing with an exact range of dates,
|
| 8212 |
+
// make sure there are no “inverted” dates because of it.
|
| 8213 |
+
if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) {
|
| 8214 |
+
if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) {
|
| 8215 |
+
disabledItems[index] = null;
|
| 8216 |
+
break;
|
| 8217 |
+
}
|
| 8218 |
+
}
|
| 8219 |
+
|
| 8220 |
+
// If something is still matched, add it into the collection.
|
| 8221 |
+
if (matchFound) {
|
| 8222 |
+
disabledItems.push(matchFound);
|
| 8223 |
+
}
|
| 8224 |
+
});
|
| 8225 |
+
}
|
| 8226 |
+
|
| 8227 |
+
// Return the updated collection.
|
| 8228 |
+
return disabledItems.filter(function (val) {
|
| 8229 |
+
return val != null;
|
| 8230 |
+
});
|
| 8231 |
+
}; //DatePicker.prototype.activate
|
| 8232 |
+
|
| 8233 |
+
|
| 8234 |
+
/**
|
| 8235 |
+
* Create a string for the nodes in the picker.
|
| 8236 |
+
*/
|
| 8237 |
+
DatePicker.prototype.nodes = function (isOpen) {
|
| 8238 |
+
|
| 8239 |
+
var calendar = this,
|
| 8240 |
+
settings = calendar.settings,
|
| 8241 |
+
calendarItem = calendar.item,
|
| 8242 |
+
nowObject = calendarItem.now,
|
| 8243 |
+
selectedObject = calendarItem.select,
|
| 8244 |
+
highlightedObject = calendarItem.highlight,
|
| 8245 |
+
viewsetObject = calendarItem.view,
|
| 8246 |
+
disabledCollection = calendarItem.disable,
|
| 8247 |
+
minLimitObject = calendarItem.min,
|
| 8248 |
+
maxLimitObject = calendarItem.max,
|
| 8249 |
+
|
| 8250 |
+
|
| 8251 |
+
// Create the calendar table head using a copy of weekday labels collection.
|
| 8252 |
+
// * We do a copy so we don't mutate the original array.
|
| 8253 |
+
tableHead = function (collection, fullCollection) {
|
| 8254 |
+
|
| 8255 |
+
// If the first day should be Monday, move Sunday to the end.
|
| 8256 |
+
if (settings.firstDay) {
|
| 8257 |
+
collection.push(collection.shift());
|
| 8258 |
+
fullCollection.push(fullCollection.shift());
|
| 8259 |
+
}
|
| 8260 |
+
|
| 8261 |
+
// Create and return the table head group.
|
| 8262 |
+
return _.node('thead', _.node('tr', _.group({
|
| 8263 |
+
min: 0,
|
| 8264 |
+
max: DAYS_IN_WEEK - 1,
|
| 8265 |
+
i: 1,
|
| 8266 |
+
node: 'th',
|
| 8267 |
+
item: function (counter) {
|
| 8268 |
+
return [collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"'];
|
| 8269 |
+
}
|
| 8270 |
+
}))); //endreturn
|
| 8271 |
+
|
| 8272 |
+
// Materialize modified
|
| 8273 |
+
}((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)),
|
| 8274 |
+
//tableHead
|
| 8275 |
+
|
| 8276 |
+
|
| 8277 |
+
// Create the nav for next/prev month.
|
| 8278 |
+
createMonthNav = function (next) {
|
| 8279 |
+
|
| 8280 |
+
// Otherwise, return the created month tag.
|
| 8281 |
+
return _.node('div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + (
|
| 8282 |
+
|
| 8283 |
+
// If the focused month is outside the range, disabled the button.
|
| 8284 |
+
next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month || !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ? ' ' + settings.klass.navDisabled : ''), 'data-nav=' + (next || -1) + ' ' + _.ariaAttr({
|
| 8285 |
+
role: 'button',
|
| 8286 |
+
controls: calendar.$node[0].id + '_table'
|
| 8287 |
+
}) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'); //endreturn
|
| 8288 |
+
},
|
| 8289 |
+
//createMonthNav
|
| 8290 |
+
|
| 8291 |
+
|
| 8292 |
+
// Create the month label.
|
| 8293 |
+
//Materialize modified
|
| 8294 |
+
createMonthLabel = function (override) {
|
| 8295 |
+
|
| 8296 |
+
var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull;
|
| 8297 |
+
|
| 8298 |
+
// Materialize modified
|
| 8299 |
+
if (override == "short_months") {
|
| 8300 |
+
monthsCollection = settings.monthsShort;
|
| 8301 |
+
}
|
| 8302 |
+
|
| 8303 |
+
// If there are months to select, add a dropdown menu.
|
| 8304 |
+
if (settings.selectMonths && override == undefined) {
|
| 8305 |
+
|
| 8306 |
+
return _.node('select', _.group({
|
| 8307 |
+
min: 0,
|
| 8308 |
+
max: 11,
|
| 8309 |
+
i: 1,
|
| 8310 |
+
node: 'option',
|
| 8311 |
+
item: function (loopedMonth) {
|
| 8312 |
+
|
| 8313 |
+
return [
|
| 8314 |
+
|
| 8315 |
+
// The looped month and no classes.
|
| 8316 |
+
monthsCollection[loopedMonth], 0,
|
| 8317 |
+
|
| 8318 |
+
// Set the value and selected index.
|
| 8319 |
+
'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : '') + (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month || viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ? ' disabled' : '')];
|
| 8320 |
+
}
|
| 8321 |
+
}), settings.klass.selectMonth + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"');
|
| 8322 |
+
}
|
| 8323 |
+
|
| 8324 |
+
// Materialize modified
|
| 8325 |
+
if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month];else return monthsCollection[viewsetObject.month];
|
| 8326 |
+
|
| 8327 |
+
// If there's a need for a month selector
|
| 8328 |
+
return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month);
|
| 8329 |
+
},
|
| 8330 |
+
//createMonthLabel
|
| 8331 |
+
|
| 8332 |
+
|
| 8333 |
+
// Create the year label.
|
| 8334 |
+
// Materialize modified
|
| 8335 |
+
createYearLabel = function (override) {
|
| 8336 |
+
|
| 8337 |
+
var focusedYear = viewsetObject.year,
|
| 8338 |
+
|
| 8339 |
+
|
| 8340 |
+
// If years selector is set to a literal "true", set it to 5. Otherwise
|
| 8341 |
+
// divide in half to get half before and half after focused year.
|
| 8342 |
+
numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2);
|
| 8343 |
+
|
| 8344 |
+
// If there are years to select, add a dropdown menu.
|
| 8345 |
+
if (numberYears) {
|
| 8346 |
+
|
| 8347 |
+
var minYear = minLimitObject.year,
|
| 8348 |
+
maxYear = maxLimitObject.year,
|
| 8349 |
+
lowestYear = focusedYear - numberYears,
|
| 8350 |
+
highestYear = focusedYear + numberYears;
|
| 8351 |
+
|
| 8352 |
+
// If the min year is greater than the lowest year, increase the highest year
|
| 8353 |
+
// by the difference and set the lowest year to the min year.
|
| 8354 |
+
if (minYear > lowestYear) {
|
| 8355 |
+
highestYear += minYear - lowestYear;
|
| 8356 |
+
lowestYear = minYear;
|
| 8357 |
+
}
|
| 8358 |
+
|
| 8359 |
+
// If the max year is less than the highest year, decrease the lowest year
|
| 8360 |
+
// by the lower of the two: available and needed years. Then set the
|
| 8361 |
+
// highest year to the max year.
|
| 8362 |
+
if (maxYear < highestYear) {
|
| 8363 |
+
|
| 8364 |
+
var availableYears = lowestYear - minYear,
|
| 8365 |
+
neededYears = highestYear - maxYear;
|
| 8366 |
+
|
| 8367 |
+
lowestYear -= availableYears > neededYears ? neededYears : availableYears;
|
| 8368 |
+
highestYear = maxYear;
|
| 8369 |
+
}
|
| 8370 |
+
|
| 8371 |
+
if (settings.selectYears && override == undefined) {
|
| 8372 |
+
return _.node('select', _.group({
|
| 8373 |
+
min: lowestYear,
|
| 8374 |
+
max: highestYear,
|
| 8375 |
+
i: 1,
|
| 8376 |
+
node: 'option',
|
| 8377 |
+
item: function (loopedYear) {
|
| 8378 |
+
return [
|
| 8379 |
+
|
| 8380 |
+
// The looped year and no classes.
|
| 8381 |
+
loopedYear, 0,
|
| 8382 |
+
|
| 8383 |
+
// Set the value and selected index.
|
| 8384 |
+
'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : '')];
|
| 8385 |
+
}
|
| 8386 |
+
}), settings.klass.selectYear + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"');
|
| 8387 |
+
}
|
| 8388 |
+
}
|
| 8389 |
+
|
| 8390 |
+
// Materialize modified
|
| 8391 |
+
if (override === 'raw' && selectedObject != null) {
|
| 8392 |
+
return _.node('div', selectedObject.year);
|
| 8393 |
+
}
|
| 8394 |
+
|
| 8395 |
+
// Otherwise just return the year focused
|
| 8396 |
+
return _.node('div', focusedYear, settings.klass.year);
|
| 8397 |
+
}; //createYearLabel
|
| 8398 |
+
|
| 8399 |
+
|
| 8400 |
+
// Materialize modified
|
| 8401 |
+
createDayLabel = function () {
|
| 8402 |
+
if (selectedObject != null) return selectedObject.date;else return nowObject.date;
|
| 8403 |
+
};
|
| 8404 |
+
createWeekdayLabel = function () {
|
| 8405 |
+
var display_day;
|
| 8406 |
+
|
| 8407 |
+
if (selectedObject != null) display_day = selectedObject.day;else display_day = nowObject.day;
|
| 8408 |
+
var weekday = settings.weekdaysShort[display_day];
|
| 8409 |
+
return weekday;
|
| 8410 |
+
};
|
| 8411 |
+
|
| 8412 |
+
// Create and return the entire calendar.
|
| 8413 |
+
|
| 8414 |
+
return _.node(
|
| 8415 |
+
// Date presentation View
|
| 8416 |
+
'div', _.node(
|
| 8417 |
+
// Div for Year
|
| 8418 |
+
'div', createYearLabel("raw"), settings.klass.year_display) + _.node('span', createWeekdayLabel() + ', ', "picker__weekday-display") + _.node(
|
| 8419 |
+
// Div for short Month
|
| 8420 |
+
'span', createMonthLabel("short_months") + ' ', settings.klass.month_display) + _.node(
|
| 8421 |
+
// Div for Day
|
| 8422 |
+
'span', createDayLabel(), settings.klass.day_display), settings.klass.date_display) +
|
| 8423 |
+
// Calendar container
|
| 8424 |
+
_.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header) + _.node('table', tableHead + _.node('tbody', _.group({
|
| 8425 |
+
min: 0,
|
| 8426 |
+
max: WEEKS_IN_CALENDAR - 1,
|
| 8427 |
+
i: 1,
|
| 8428 |
+
node: 'tr',
|
| 8429 |
+
item: function (rowCounter) {
|
| 8430 |
+
|
| 8431 |
+
// If Monday is the first day and the month starts on Sunday, shift the date back a week.
|
| 8432 |
+
var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0;
|
| 8433 |
+
|
| 8434 |
+
return [_.group({
|
| 8435 |
+
min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
|
| 8436 |
+
max: function () {
|
| 8437 |
+
return this.min + DAYS_IN_WEEK - 1;
|
| 8438 |
+
},
|
| 8439 |
+
i: 1,
|
| 8440 |
+
node: 'td',
|
| 8441 |
+
item: function (targetDate) {
|
| 8442 |
+
|
| 8443 |
+
// Convert the time date from a relative date to a target date.
|
| 8444 |
+
targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)]);
|
| 8445 |
+
|
| 8446 |
+
var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
|
| 8447 |
+
isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
|
| 8448 |
+
isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
|
| 8449 |
+
formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate]);
|
| 8450 |
+
|
| 8451 |
+
return [_.node('div', targetDate.date, function (klasses) {
|
| 8452 |
+
|
| 8453 |
+
// Add the `infocus` or `outfocus` classes based on month in view.
|
| 8454 |
+
klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus);
|
| 8455 |
+
|
| 8456 |
+
// Add the `today` class if needed.
|
| 8457 |
+
if (nowObject.pick == targetDate.pick) {
|
| 8458 |
+
klasses.push(settings.klass.now);
|
| 8459 |
+
}
|
| 8460 |
+
|
| 8461 |
+
// Add the `selected` class if something's selected and the time matches.
|
| 8462 |
+
if (isSelected) {
|
| 8463 |
+
klasses.push(settings.klass.selected);
|
| 8464 |
+
}
|
| 8465 |
+
|
| 8466 |
+
// Add the `highlighted` class if something's highlighted and the time matches.
|
| 8467 |
+
if (isHighlighted) {
|
| 8468 |
+
klasses.push(settings.klass.highlighted);
|
| 8469 |
+
}
|
| 8470 |
+
|
| 8471 |
+
// Add the `disabled` class if something's disabled and the object matches.
|
| 8472 |
+
if (isDisabled) {
|
| 8473 |
+
klasses.push(settings.klass.disabled);
|
| 8474 |
+
}
|
| 8475 |
+
|
| 8476 |
+
return klasses.join(' ');
|
| 8477 |
+
}([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
|
| 8478 |
+
role: 'gridcell',
|
| 8479 |
+
label: formattedDate,
|
| 8480 |
+
selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
|
| 8481 |
+
activedescendant: isHighlighted ? true : null,
|
| 8482 |
+
disabled: isDisabled ? true : null
|
| 8483 |
+
}) + ' ' + (isDisabled ? '' : 'tabindex="0"')), '', _.ariaAttr({ role: 'presentation' })]; //endreturn
|
| 8484 |
+
}
|
| 8485 |
+
})]; //endreturn
|
| 8486 |
+
}
|
| 8487 |
+
})), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
|
| 8488 |
+
role: 'grid',
|
| 8489 |
+
controls: calendar.$node[0].id,
|
| 8490 |
+
readonly: true
|
| 8491 |
+
})), settings.klass.calendar_container) // end calendar
|
| 8492 |
+
|
| 8493 |
+
+
|
| 8494 |
+
|
| 8495 |
+
// * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
|
| 8496 |
+
_.node('div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer), 'picker__container__wrapper'); //endreturn
|
| 8497 |
+
}; //DatePicker.prototype.nodes
|
| 8498 |
+
|
| 8499 |
+
|
| 8500 |
+
/**
|
| 8501 |
+
* The date picker defaults.
|
| 8502 |
+
*/
|
| 8503 |
+
DatePicker.defaults = function (prefix) {
|
| 8504 |
+
|
| 8505 |
+
return {
|
| 8506 |
+
|
| 8507 |
+
// The title label to use for the month nav buttons
|
| 8508 |
+
labelMonthNext: 'Next month',
|
| 8509 |
+
labelMonthPrev: 'Previous month',
|
| 8510 |
+
|
| 8511 |
+
// The title label to use for the dropdown selectors
|
| 8512 |
+
labelMonthSelect: 'Select a month',
|
| 8513 |
+
labelYearSelect: 'Select a year',
|
| 8514 |
+
|
| 8515 |
+
// Months and weekdays
|
| 8516 |
+
monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'],
|
| 8517 |
+
monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
|
| 8518 |
+
weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
|
| 8519 |
+
weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
|
| 8520 |
+
|
| 8521 |
+
// Materialize modified
|
| 8522 |
+
weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],
|
| 8523 |
+
|
| 8524 |
+
// Today and clear
|
| 8525 |
+
today: 'Today',
|
| 8526 |
+
clear: 'Clear',
|
| 8527 |
+
close: 'Ok',
|
| 8528 |
+
|
| 8529 |
+
// Picker close behavior (Prevent a change in behaviour for backwards compatibility)
|
| 8530 |
+
closeOnSelect: false,
|
| 8531 |
+
|
| 8532 |
+
// The format to show on the `input` element
|
| 8533 |
+
format: 'd mmmm, yyyy',
|
| 8534 |
+
|
| 8535 |
+
// Classes
|
| 8536 |
+
klass: {
|
| 8537 |
+
|
| 8538 |
+
table: prefix + 'table',
|
| 8539 |
+
|
| 8540 |
+
header: prefix + 'header',
|
| 8541 |
+
|
| 8542 |
+
// Materialize Added klasses
|
| 8543 |
+
date_display: prefix + 'date-display',
|
| 8544 |
+
day_display: prefix + 'day-display',
|
| 8545 |
+
month_display: prefix + 'month-display',
|
| 8546 |
+
year_display: prefix + 'year-display',
|
| 8547 |
+
calendar_container: prefix + 'calendar-container',
|
| 8548 |
+
// end
|
| 8549 |
+
|
| 8550 |
+
|
| 8551 |
+
navPrev: prefix + 'nav--prev',
|
| 8552 |
+
navNext: prefix + 'nav--next',
|
| 8553 |
+
navDisabled: prefix + 'nav--disabled',
|
| 8554 |
+
|
| 8555 |
+
month: prefix + 'month',
|
| 8556 |
+
year: prefix + 'year',
|
| 8557 |
+
|
| 8558 |
+
selectMonth: prefix + 'select--month',
|
| 8559 |
+
selectYear: prefix + 'select--year',
|
| 8560 |
+
|
| 8561 |
+
weekdays: prefix + 'weekday',
|
| 8562 |
+
|
| 8563 |
+
day: prefix + 'day',
|
| 8564 |
+
disabled: prefix + 'day--disabled',
|
| 8565 |
+
selected: prefix + 'day--selected',
|
| 8566 |
+
highlighted: prefix + 'day--highlighted',
|
| 8567 |
+
now: prefix + 'day--today',
|
| 8568 |
+
infocus: prefix + 'day--infocus',
|
| 8569 |
+
outfocus: prefix + 'day--outfocus',
|
| 8570 |
+
|
| 8571 |
+
footer: prefix + 'footer',
|
| 8572 |
+
|
| 8573 |
+
buttonClear: prefix + 'button--clear',
|
| 8574 |
+
buttonToday: prefix + 'button--today',
|
| 8575 |
+
buttonClose: prefix + 'button--close'
|
| 8576 |
+
}
|
| 8577 |
+
};
|
| 8578 |
+
}(Picker.klasses().picker + '__');
|
| 8579 |
+
|
| 8580 |
+
/**
|
| 8581 |
+
* Extend the picker to add the date picker.
|
| 8582 |
+
*/
|
| 8583 |
+
Picker.extend('pickadate', DatePicker);
|
| 8584 |
+
});
|
| 8585 |
+
; /*!
|
| 8586 |
+
* ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
|
| 8587 |
+
* Copyright 2014 Wang Shenwei.
|
| 8588 |
+
* Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
|
| 8589 |
+
*
|
| 8590 |
+
* Further modified
|
| 8591 |
+
* Copyright 2015 Ching Yaw Hao.
|
| 8592 |
+
*/
|
| 8593 |
+
|
| 8594 |
+
(function ($) {
|
| 8595 |
+
var $win = $(window),
|
| 8596 |
+
$doc = $(document);
|
| 8597 |
+
|
| 8598 |
+
// Can I use inline svg ?
|
| 8599 |
+
var svgNS = 'http://www.w3.org/2000/svg',
|
| 8600 |
+
svgSupported = 'SVGAngle' in window && function () {
|
| 8601 |
+
var supported,
|
| 8602 |
+
el = document.createElement('div');
|
| 8603 |
+
el.innerHTML = '<svg/>';
|
| 8604 |
+
supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
|
| 8605 |
+
el.innerHTML = '';
|
| 8606 |
+
return supported;
|
| 8607 |
+
}();
|
| 8608 |
+
|
| 8609 |
+
// Can I use transition ?
|
| 8610 |
+
var transitionSupported = function () {
|
| 8611 |
+
var style = document.createElement('div').style;
|
| 8612 |
+
return 'transition' in style || 'WebkitTransition' in style || 'MozTransition' in style || 'msTransition' in style || 'OTransition' in style;
|
| 8613 |
+
}();
|
| 8614 |
+
|
| 8615 |
+
// Listen touch events in touch screen device, instead of mouse events in desktop.
|
| 8616 |
+
var touchSupported = 'ontouchstart' in window,
|
| 8617 |
+
mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ''),
|
| 8618 |
+
mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ''),
|
| 8619 |
+
mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : '');
|
| 8620 |
+
|
| 8621 |
+
// Vibrate the device if supported
|
| 8622 |
+
var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
|
| 8623 |
+
|
| 8624 |
+
function createSvgElement(name) {
|
| 8625 |
+
return document.createElementNS(svgNS, name);
|
| 8626 |
+
}
|
| 8627 |
+
|
| 8628 |
+
function leadingZero(num) {
|
| 8629 |
+
return (num < 10 ? '0' : '') + num;
|
| 8630 |
+
}
|
| 8631 |
+
|
| 8632 |
+
// Get a unique id
|
| 8633 |
+
var idCounter = 0;
|
| 8634 |
+
function uniqueId(prefix) {
|
| 8635 |
+
var id = ++idCounter + '';
|
| 8636 |
+
return prefix ? prefix + id : id;
|
| 8637 |
+
}
|
| 8638 |
+
|
| 8639 |
+
// Clock size
|
| 8640 |
+
var dialRadius = 135,
|
| 8641 |
+
outerRadius = 105,
|
| 8642 |
+
|
| 8643 |
+
// innerRadius = 80 on 12 hour clock
|
| 8644 |
+
innerRadius = 70,
|
| 8645 |
+
tickRadius = 20,
|
| 8646 |
+
diameter = dialRadius * 2,
|
| 8647 |
+
duration = transitionSupported ? 350 : 1;
|
| 8648 |
+
|
| 8649 |
+
// Popover template
|
| 8650 |
+
var tpl = ['<div class="clockpicker picker">', '<div class="picker__holder">', '<div class="picker__frame">', '<div class="picker__wrap">', '<div class="picker__box">', '<div class="picker__date-display">', '<div class="clockpicker-display">', '<div class="clockpicker-display-column">', '<span class="clockpicker-span-hours text-primary"></span>', ':', '<span class="clockpicker-span-minutes"></span>', '</div>', '<div class="clockpicker-display-column clockpicker-display-am-pm">', '<div class="clockpicker-span-am-pm"></div>', '</div>', '</div>', '</div>', '<div class="picker__container__wrapper">', '<div class="picker__calendar-container">', '<div class="clockpicker-plate">', '<div class="clockpicker-canvas"></div>', '<div class="clockpicker-dial clockpicker-hours"></div>', '<div class="clockpicker-dial clockpicker-minutes clockpicker-dial-out"></div>', '</div>', '<div class="clockpicker-am-pm-block">', '</div>', '</div>', '<div class="picker__footer">', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>'].join('');
|
| 8651 |
+
|
| 8652 |
+
// ClockPicker
|
| 8653 |
+
function ClockPicker(element, options) {
|
| 8654 |
+
var popover = $(tpl),
|
| 8655 |
+
plate = popover.find('.clockpicker-plate'),
|
| 8656 |
+
holder = popover.find('.picker__holder'),
|
| 8657 |
+
hoursView = popover.find('.clockpicker-hours'),
|
| 8658 |
+
minutesView = popover.find('.clockpicker-minutes'),
|
| 8659 |
+
amPmBlock = popover.find('.clockpicker-am-pm-block'),
|
| 8660 |
+
isInput = element.prop('tagName') === 'INPUT',
|
| 8661 |
+
input = isInput ? element : element.find('input'),
|
| 8662 |
+
label = $("label[for=" + input.attr("id") + "]"),
|
| 8663 |
+
self = this;
|
| 8664 |
+
|
| 8665 |
+
this.id = uniqueId('cp');
|
| 8666 |
+
this.element = element;
|
| 8667 |
+
this.holder = holder;
|
| 8668 |
+
this.options = options;
|
| 8669 |
+
this.isAppended = false;
|
| 8670 |
+
this.isShown = false;
|
| 8671 |
+
this.currentView = 'hours';
|
| 8672 |
+
this.isInput = isInput;
|
| 8673 |
+
this.input = input;
|
| 8674 |
+
this.label = label;
|
| 8675 |
+
this.popover = popover;
|
| 8676 |
+
this.plate = plate;
|
| 8677 |
+
this.hoursView = hoursView;
|
| 8678 |
+
this.minutesView = minutesView;
|
| 8679 |
+
this.amPmBlock = amPmBlock;
|
| 8680 |
+
this.spanHours = popover.find('.clockpicker-span-hours');
|
| 8681 |
+
this.spanMinutes = popover.find('.clockpicker-span-minutes');
|
| 8682 |
+
this.spanAmPm = popover.find('.clockpicker-span-am-pm');
|
| 8683 |
+
this.footer = popover.find('.picker__footer');
|
| 8684 |
+
this.amOrPm = "PM";
|
| 8685 |
+
|
| 8686 |
+
// Setup for for 12 hour clock if option is selected
|
| 8687 |
+
if (options.twelvehour) {
|
| 8688 |
+
if (!options.ampmclickable) {
|
| 8689 |
+
this.spanAmPm.empty();
|
| 8690 |
+
$('<div id="click-am">AM</div>').appendTo(this.spanAmPm);
|
| 8691 |
+
$('<div id="click-pm">PM</div>').appendTo(this.spanAmPm);
|
| 8692 |
+
} else {
|
| 8693 |
+
this.spanAmPm.empty();
|
| 8694 |
+
$('<div id="click-am">AM</div>').on("click", function () {
|
| 8695 |
+
self.spanAmPm.children('#click-am').addClass("text-primary");
|
| 8696 |
+
self.spanAmPm.children('#click-pm').removeClass("text-primary");
|
| 8697 |
+
self.amOrPm = "AM";
|
| 8698 |
+
}).appendTo(this.spanAmPm);
|
| 8699 |
+
$('<div id="click-pm">PM</div>').on("click", function () {
|
| 8700 |
+
self.spanAmPm.children('#click-pm').addClass("text-primary");
|
| 8701 |
+
self.spanAmPm.children('#click-am').removeClass("text-primary");
|
| 8702 |
+
self.amOrPm = 'PM';
|
| 8703 |
+
}).appendTo(this.spanAmPm);
|
| 8704 |
+
}
|
| 8705 |
+
}
|
| 8706 |
+
|
| 8707 |
+
// Add buttons to footer
|
| 8708 |
+
$('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer);
|
| 8709 |
+
$('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer);
|
| 8710 |
+
$('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);
|
| 8711 |
+
|
| 8712 |
+
this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
|
| 8713 |
+
this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));
|
| 8714 |
+
|
| 8715 |
+
// Show or toggle
|
| 8716 |
+
input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));
|
| 8717 |
+
|
| 8718 |
+
// Build ticks
|
| 8719 |
+
var tickTpl = $('<div class="clockpicker-tick"></div>'),
|
| 8720 |
+
i,
|
| 8721 |
+
tick,
|
| 8722 |
+
radian,
|
| 8723 |
+
radius;
|
| 8724 |
+
|
| 8725 |
+
// Hours view
|
| 8726 |
+
if (options.twelvehour) {
|
| 8727 |
+
for (i = 1; i < 13; i += 1) {
|
| 8728 |
+
tick = tickTpl.clone();
|
| 8729 |
+
radian = i / 6 * Math.PI;
|
| 8730 |
+
radius = outerRadius;
|
| 8731 |
+
tick.css({
|
| 8732 |
+
left: dialRadius + Math.sin(radian) * radius - tickRadius,
|
| 8733 |
+
top: dialRadius - Math.cos(radian) * radius - tickRadius
|
| 8734 |
+
});
|
| 8735 |
+
tick.html(i === 0 ? '00' : i);
|
| 8736 |
+
hoursView.append(tick);
|
| 8737 |
+
tick.on(mousedownEvent, mousedown);
|
| 8738 |
+
}
|
| 8739 |
+
} else {
|
| 8740 |
+
for (i = 0; i < 24; i += 1) {
|
| 8741 |
+
tick = tickTpl.clone();
|
| 8742 |
+
radian = i / 6 * Math.PI;
|
| 8743 |
+
var inner = i > 0 && i < 13;
|
| 8744 |
+
radius = inner ? innerRadius : outerRadius;
|
| 8745 |
+
tick.css({
|
| 8746 |
+
left: dialRadius + Math.sin(radian) * radius - tickRadius,
|
| 8747 |
+
top: dialRadius - Math.cos(radian) * radius - tickRadius
|
| 8748 |
+
});
|
| 8749 |
+
tick.html(i === 0 ? '00' : i);
|
| 8750 |
+
hoursView.append(tick);
|
| 8751 |
+
tick.on(mousedownEvent, mousedown);
|
| 8752 |
+
}
|
| 8753 |
+
}
|
| 8754 |
+
|
| 8755 |
+
// Minutes view
|
| 8756 |
+
for (i = 0; i < 60; i += 5) {
|
| 8757 |
+
tick = tickTpl.clone();
|
| 8758 |
+
radian = i / 30 * Math.PI;
|
| 8759 |
+
tick.css({
|
| 8760 |
+
left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
|
| 8761 |
+
top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
|
| 8762 |
+
});
|
| 8763 |
+
tick.html(leadingZero(i));
|
| 8764 |
+
minutesView.append(tick);
|
| 8765 |
+
tick.on(mousedownEvent, mousedown);
|
| 8766 |
+
}
|
| 8767 |
+
|
| 8768 |
+
// Clicking on minutes view space
|
| 8769 |
+
plate.on(mousedownEvent, function (e) {
|
| 8770 |
+
if ($(e.target).closest('.clockpicker-tick').length === 0) {
|
| 8771 |
+
mousedown(e, true);
|
| 8772 |
+
}
|
| 8773 |
+
});
|
| 8774 |
+
|
| 8775 |
+
// Mousedown or touchstart
|
| 8776 |
+
function mousedown(e, space) {
|
| 8777 |
+
var offset = plate.offset(),
|
| 8778 |
+
isTouch = /^touch/.test(e.type),
|
| 8779 |
+
x0 = offset.left + dialRadius,
|
| 8780 |
+
y0 = offset.top + dialRadius,
|
| 8781 |
+
dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
|
| 8782 |
+
dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
|
| 8783 |
+
z = Math.sqrt(dx * dx + dy * dy),
|
| 8784 |
+
moved = false;
|
| 8785 |
+
|
| 8786 |
+
// When clicking on minutes view space, check the mouse position
|
| 8787 |
+
if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) {
|
| 8788 |
+
return;
|
| 8789 |
+
}
|
| 8790 |
+
e.preventDefault();
|
| 8791 |
+
|
| 8792 |
+
// Set cursor style of body after 200ms
|
| 8793 |
+
var movingTimer = setTimeout(function () {
|
| 8794 |
+
self.popover.addClass('clockpicker-moving');
|
| 8795 |
+
}, 200);
|
| 8796 |
+
|
| 8797 |
+
// Clock
|
| 8798 |
+
self.setHand(dx, dy, !space, true);
|
| 8799 |
+
|
| 8800 |
+
// Mousemove on document
|
| 8801 |
+
$doc.off(mousemoveEvent).on(mousemoveEvent, function (e) {
|
| 8802 |
+
e.preventDefault();
|
| 8803 |
+
var isTouch = /^touch/.test(e.type),
|
| 8804 |
+
x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
|
| 8805 |
+
y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
|
| 8806 |
+
if (!moved && x === dx && y === dy) {
|
| 8807 |
+
// Clicking in chrome on windows will trigger a mousemove event
|
| 8808 |
+
return;
|
| 8809 |
+
}
|
| 8810 |
+
moved = true;
|
| 8811 |
+
self.setHand(x, y, false, true);
|
| 8812 |
+
});
|
| 8813 |
+
|
| 8814 |
+
// Mouseup on document
|
| 8815 |
+
$doc.off(mouseupEvent).on(mouseupEvent, function (e) {
|
| 8816 |
+
$doc.off(mouseupEvent);
|
| 8817 |
+
e.preventDefault();
|
| 8818 |
+
var isTouch = /^touch/.test(e.type),
|
| 8819 |
+
x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
|
| 8820 |
+
y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
|
| 8821 |
+
if ((space || moved) && x === dx && y === dy) {
|
| 8822 |
+
self.setHand(x, y);
|
| 8823 |
+
}
|
| 8824 |
+
|
| 8825 |
+
if (self.currentView === 'hours') {
|
| 8826 |
+
self.toggleView('minutes', duration / 2);
|
| 8827 |
+
} else if (options.autoclose) {
|
| 8828 |
+
self.minutesView.addClass('clockpicker-dial-out');
|
| 8829 |
+
setTimeout(function () {
|
| 8830 |
+
self.done();
|
| 8831 |
+
}, duration / 2);
|
| 8832 |
+
}
|
| 8833 |
+
plate.prepend(canvas);
|
| 8834 |
+
|
| 8835 |
+
// Reset cursor style of body
|
| 8836 |
+
clearTimeout(movingTimer);
|
| 8837 |
+
self.popover.removeClass('clockpicker-moving');
|
| 8838 |
+
|
| 8839 |
+
// Unbind mousemove event
|
| 8840 |
+
$doc.off(mousemoveEvent);
|
| 8841 |
+
});
|
| 8842 |
+
}
|
| 8843 |
+
|
| 8844 |
+
if (svgSupported) {
|
| 8845 |
+
// Draw clock hands and others
|
| 8846 |
+
var canvas = popover.find('.clockpicker-canvas'),
|
| 8847 |
+
svg = createSvgElement('svg');
|
| 8848 |
+
svg.setAttribute('class', 'clockpicker-svg');
|
| 8849 |
+
svg.setAttribute('width', diameter);
|
| 8850 |
+
svg.setAttribute('height', diameter);
|
| 8851 |
+
var g = createSvgElement('g');
|
| 8852 |
+
g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
|
| 8853 |
+
var bearing = createSvgElement('circle');
|
| 8854 |
+
bearing.setAttribute('class', 'clockpicker-canvas-bearing');
|
| 8855 |
+
bearing.setAttribute('cx', 0);
|
| 8856 |
+
bearing.setAttribute('cy', 0);
|
| 8857 |
+
bearing.setAttribute('r', 4);
|
| 8858 |
+
var hand = createSvgElement('line');
|
| 8859 |
+
hand.setAttribute('x1', 0);
|
| 8860 |
+
hand.setAttribute('y1', 0);
|
| 8861 |
+
var bg = createSvgElement('circle');
|
| 8862 |
+
bg.setAttribute('class', 'clockpicker-canvas-bg');
|
| 8863 |
+
bg.setAttribute('r', tickRadius);
|
| 8864 |
+
g.appendChild(hand);
|
| 8865 |
+
g.appendChild(bg);
|
| 8866 |
+
g.appendChild(bearing);
|
| 8867 |
+
svg.appendChild(g);
|
| 8868 |
+
canvas.append(svg);
|
| 8869 |
+
|
| 8870 |
+
this.hand = hand;
|
| 8871 |
+
this.bg = bg;
|
| 8872 |
+
this.bearing = bearing;
|
| 8873 |
+
this.g = g;
|
| 8874 |
+
this.canvas = canvas;
|
| 8875 |
+
}
|
| 8876 |
+
|
| 8877 |
+
raiseCallback(this.options.init);
|
| 8878 |
+
}
|
| 8879 |
+
|
| 8880 |
+
function raiseCallback(callbackFunction) {
|
| 8881 |
+
if (callbackFunction && typeof callbackFunction === "function") callbackFunction();
|
| 8882 |
+
}
|
| 8883 |
+
|
| 8884 |
+
// Default options
|
| 8885 |
+
ClockPicker.DEFAULTS = {
|
| 8886 |
+
'default': '', // default time, 'now' or '13:14' e.g.
|
| 8887 |
+
fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
|
| 8888 |
+
donetext: 'Ok', // done button text
|
| 8889 |
+
cleartext: 'Clear',
|
| 8890 |
+
canceltext: 'Cancel',
|
| 8891 |
+
autoclose: false, // auto close when minute is selected
|
| 8892 |
+
ampmclickable: true, // set am/pm button on itself
|
| 8893 |
+
darktheme: false, // set to dark theme
|
| 8894 |
+
twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
|
| 8895 |
+
vibrate: true // vibrate the device when dragging clock hand
|
| 8896 |
+
};
|
| 8897 |
+
|
| 8898 |
+
// Show or hide popover
|
| 8899 |
+
ClockPicker.prototype.toggle = function () {
|
| 8900 |
+
this[this.isShown ? 'hide' : 'show']();
|
| 8901 |
+
};
|
| 8902 |
+
|
| 8903 |
+
// Set popover position
|
| 8904 |
+
ClockPicker.prototype.locate = function () {
|
| 8905 |
+
var element = this.element,
|
| 8906 |
+
popover = this.popover,
|
| 8907 |
+
offset = element.offset(),
|
| 8908 |
+
width = element.outerWidth(),
|
| 8909 |
+
height = element.outerHeight(),
|
| 8910 |
+
align = this.options.align,
|
| 8911 |
+
self = this;
|
| 8912 |
+
|
| 8913 |
+
popover.show();
|
| 8914 |
+
};
|
| 8915 |
+
|
| 8916 |
+
// Show popover
|
| 8917 |
+
ClockPicker.prototype.show = function (e) {
|
| 8918 |
+
// Not show again
|
| 8919 |
+
if (this.isShown) {
|
| 8920 |
+
return;
|
| 8921 |
+
}
|
| 8922 |
+
raiseCallback(this.options.beforeShow);
|
| 8923 |
+
$(':input').each(function () {
|
| 8924 |
+
$(this).attr('tabindex', -1);
|
| 8925 |
+
});
|
| 8926 |
+
var self = this;
|
| 8927 |
+
// Initialize
|
| 8928 |
+
this.input.blur();
|
| 8929 |
+
this.popover.addClass('picker--opened');
|
| 8930 |
+
this.input.addClass('picker__input picker__input--active');
|
| 8931 |
+
$(document.body).css('overflow', 'hidden');
|
| 8932 |
+
// Get the time
|
| 8933 |
+
var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':');
|
| 8934 |
+
if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
|
| 8935 |
+
if (value[1].indexOf("AM") > 0) {
|
| 8936 |
+
this.amOrPm = 'AM';
|
| 8937 |
+
} else {
|
| 8938 |
+
this.amOrPm = 'PM';
|
| 8939 |
+
}
|
| 8940 |
+
value[1] = value[1].replace("AM", "").replace("PM", "");
|
| 8941 |
+
}
|
| 8942 |
+
if (value[0] === 'now') {
|
| 8943 |
+
var now = new Date(+new Date() + this.options.fromnow);
|
| 8944 |
+
value = [now.getHours(), now.getMinutes()];
|
| 8945 |
+
if (this.options.twelvehour) {
|
| 8946 |
+
this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM';
|
| 8947 |
+
}
|
| 8948 |
+
}
|
| 8949 |
+
this.hours = +value[0] || 0;
|
| 8950 |
+
this.minutes = +value[1] || 0;
|
| 8951 |
+
this.spanHours.html(this.hours);
|
| 8952 |
+
this.spanMinutes.html(leadingZero(this.minutes));
|
| 8953 |
+
if (!this.isAppended) {
|
| 8954 |
+
|
| 8955 |
+
// Append popover to input by default
|
| 8956 |
+
var containerEl = document.querySelector(this.options.container);
|
| 8957 |
+
if (this.options.container && containerEl) {
|
| 8958 |
+
containerEl.appendChild(this.popover[0]);
|
| 8959 |
+
} else {
|
| 8960 |
+
this.popover.insertAfter(this.input);
|
| 8961 |
+
}
|
| 8962 |
+
|
| 8963 |
+
if (this.options.twelvehour) {
|
| 8964 |
+
if (this.amOrPm === 'PM') {
|
| 8965 |
+
this.spanAmPm.children('#click-pm').addClass("text-primary");
|
| 8966 |
+
this.spanAmPm.children('#click-am').removeClass("text-primary");
|
| 8967 |
+
} else {
|
| 8968 |
+
this.spanAmPm.children('#click-am').addClass("text-primary");
|
| 8969 |
+
this.spanAmPm.children('#click-pm').removeClass("text-primary");
|
| 8970 |
+
}
|
| 8971 |
+
}
|
| 8972 |
+
// Reset position when resize
|
| 8973 |
+
$win.on('resize.clockpicker' + this.id, function () {
|
| 8974 |
+
if (self.isShown) {
|
| 8975 |
+
self.locate();
|
| 8976 |
+
}
|
| 8977 |
+
});
|
| 8978 |
+
this.isAppended = true;
|
| 8979 |
+
}
|
| 8980 |
+
// Toggle to hours view
|
| 8981 |
+
this.toggleView('hours');
|
| 8982 |
+
// Set position
|
| 8983 |
+
this.locate();
|
| 8984 |
+
this.isShown = true;
|
| 8985 |
+
// Hide when clicking or tabbing on any element except the clock and input
|
| 8986 |
+
$doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) {
|
| 8987 |
+
var target = $(e.target);
|
| 8988 |
+
if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
|
| 8989 |
+
self.hide();
|
| 8990 |
+
}
|
| 8991 |
+
});
|
| 8992 |
+
// Hide when ESC is pressed
|
| 8993 |
+
$doc.on('keyup.clockpicker.' + this.id, function (e) {
|
| 8994 |
+
if (e.keyCode === 27) {
|
| 8995 |
+
self.hide();
|
| 8996 |
+
}
|
| 8997 |
+
});
|
| 8998 |
+
raiseCallback(this.options.afterShow);
|
| 8999 |
+
};
|
| 9000 |
+
// Hide popover
|
| 9001 |
+
ClockPicker.prototype.hide = function () {
|
| 9002 |
+
raiseCallback(this.options.beforeHide);
|
| 9003 |
+
this.input.removeClass('picker__input picker__input--active');
|
| 9004 |
+
this.popover.removeClass('picker--opened');
|
| 9005 |
+
$(document.body).css('overflow', 'visible');
|
| 9006 |
+
this.isShown = false;
|
| 9007 |
+
$(':input').each(function (index) {
|
| 9008 |
+
$(this).attr('tabindex', index + 1);
|
| 9009 |
+
});
|
| 9010 |
+
// Unbinding events on document
|
| 9011 |
+
$doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
|
| 9012 |
+
$doc.off('keyup.clockpicker.' + this.id);
|
| 9013 |
+
this.popover.hide();
|
| 9014 |
+
raiseCallback(this.options.afterHide);
|
| 9015 |
+
};
|
| 9016 |
+
// Toggle to hours or minutes view
|
| 9017 |
+
ClockPicker.prototype.toggleView = function (view, delay) {
|
| 9018 |
+
var raiseAfterHourSelect = false;
|
| 9019 |
+
if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
|
| 9020 |
+
raiseCallback(this.options.beforeHourSelect);
|
| 9021 |
+
raiseAfterHourSelect = true;
|
| 9022 |
+
}
|
| 9023 |
+
var isHours = view === 'hours',
|
| 9024 |
+
nextView = isHours ? this.hoursView : this.minutesView,
|
| 9025 |
+
hideView = isHours ? this.minutesView : this.hoursView;
|
| 9026 |
+
this.currentView = view;
|
| 9027 |
+
|
| 9028 |
+
this.spanHours.toggleClass('text-primary', isHours);
|
| 9029 |
+
this.spanMinutes.toggleClass('text-primary', !isHours);
|
| 9030 |
+
|
| 9031 |
+
// Let's make transitions
|
| 9032 |
+
hideView.addClass('clockpicker-dial-out');
|
| 9033 |
+
nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');
|
| 9034 |
+
|
| 9035 |
+
// Reset clock hand
|
| 9036 |
+
this.resetClock(delay);
|
| 9037 |
+
|
| 9038 |
+
// After transitions ended
|
| 9039 |
+
clearTimeout(this.toggleViewTimer);
|
| 9040 |
+
this.toggleViewTimer = setTimeout(function () {
|
| 9041 |
+
hideView.css('visibility', 'hidden');
|
| 9042 |
+
}, duration);
|
| 9043 |
+
|
| 9044 |
+
if (raiseAfterHourSelect) {
|
| 9045 |
+
raiseCallback(this.options.afterHourSelect);
|
| 9046 |
+
}
|
| 9047 |
+
};
|
| 9048 |
+
|
| 9049 |
+
// Reset clock hand
|
| 9050 |
+
ClockPicker.prototype.resetClock = function (delay) {
|
| 9051 |
+
var view = this.currentView,
|
| 9052 |
+
value = this[view],
|
| 9053 |
+
isHours = view === 'hours',
|
| 9054 |
+
unit = Math.PI / (isHours ? 6 : 30),
|
| 9055 |
+
radian = value * unit,
|
| 9056 |
+
radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
|
| 9057 |
+
x = Math.sin(radian) * radius,
|
| 9058 |
+
y = -Math.cos(radian) * radius,
|
| 9059 |
+
self = this;
|
| 9060 |
+
|
| 9061 |
+
if (svgSupported && delay) {
|
| 9062 |
+
self.canvas.addClass('clockpicker-canvas-out');
|
| 9063 |
+
setTimeout(function () {
|
| 9064 |
+
self.canvas.removeClass('clockpicker-canvas-out');
|
| 9065 |
+
self.setHand(x, y);
|
| 9066 |
+
}, delay);
|
| 9067 |
+
} else this.setHand(x, y);
|
| 9068 |
+
};
|
| 9069 |
+
|
| 9070 |
+
// Set clock hand to (x, y)
|
| 9071 |
+
ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) {
|
| 9072 |
+
var radian = Math.atan2(x, -y),
|
| 9073 |
+
isHours = this.currentView === 'hours',
|
| 9074 |
+
unit = Math.PI / (isHours || roundBy5 ? 6 : 30),
|
| 9075 |
+
z = Math.sqrt(x * x + y * y),
|
| 9076 |
+
options = this.options,
|
| 9077 |
+
inner = isHours && z < (outerRadius + innerRadius) / 2,
|
| 9078 |
+
radius = inner ? innerRadius : outerRadius,
|
| 9079 |
+
value;
|
| 9080 |
+
|
| 9081 |
+
if (options.twelvehour) {
|
| 9082 |
+
radius = outerRadius;
|
| 9083 |
+
}
|
| 9084 |
+
|
| 9085 |
+
// Radian should in range [0, 2PI]
|
| 9086 |
+
if (radian < 0) {
|
| 9087 |
+
radian = Math.PI * 2 + radian;
|
| 9088 |
+
}
|
| 9089 |
+
|
| 9090 |
+
// Get the round value
|
| 9091 |
+
value = Math.round(radian / unit);
|
| 9092 |
+
|
| 9093 |
+
// Get the round radian
|
| 9094 |
+
radian = value * unit;
|
| 9095 |
+
|
| 9096 |
+
// Correct the hours or minutes
|
| 9097 |
+
if (options.twelvehour) {
|
| 9098 |
+
if (isHours) {
|
| 9099 |
+
if (value === 0) value = 12;
|
| 9100 |
+
} else {
|
| 9101 |
+
if (roundBy5) value *= 5;
|
| 9102 |
+
if (value === 60) value = 0;
|
| 9103 |
+
}
|
| 9104 |
+
} else {
|
| 9105 |
+
if (isHours) {
|
| 9106 |
+
if (value === 12) value = 0;
|
| 9107 |
+
value = inner ? value === 0 ? 12 : value : value === 0 ? 0 : value + 12;
|
| 9108 |
+
} else {
|
| 9109 |
+
if (roundBy5) value *= 5;
|
| 9110 |
+
if (value === 60) value = 0;
|
| 9111 |
+
}
|
| 9112 |
+
}
|
| 9113 |
+
|
| 9114 |
+
// Once hours or minutes changed, vibrate the device
|
| 9115 |
+
if (this[this.currentView] !== value) {
|
| 9116 |
+
if (vibrate && this.options.vibrate) {
|
| 9117 |
+
// Do not vibrate too frequently
|
| 9118 |
+
if (!this.vibrateTimer) {
|
| 9119 |
+
navigator[vibrate](10);
|
| 9120 |
+
this.vibrateTimer = setTimeout($.proxy(function () {
|
| 9121 |
+
this.vibrateTimer = null;
|
| 9122 |
+
}, this), 100);
|
| 9123 |
+
}
|
| 9124 |
+
}
|
| 9125 |
+
}
|
| 9126 |
+
|
| 9127 |
+
this[this.currentView] = value;
|
| 9128 |
+
if (isHours) {
|
| 9129 |
+
this['spanHours'].html(value);
|
| 9130 |
+
} else {
|
| 9131 |
+
this['spanMinutes'].html(leadingZero(value));
|
| 9132 |
+
}
|
| 9133 |
+
|
| 9134 |
+
// If svg is not supported, just add an active class to the tick
|
| 9135 |
+
if (!svgSupported) {
|
| 9136 |
+
this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () {
|
| 9137 |
+
var tick = $(this);
|
| 9138 |
+
tick.toggleClass('active', value === +tick.html());
|
| 9139 |
+
});
|
| 9140 |
+
return;
|
| 9141 |
+
}
|
| 9142 |
+
|
| 9143 |
+
// Set clock hand and others' position
|
| 9144 |
+
var cx1 = Math.sin(radian) * (radius - tickRadius),
|
| 9145 |
+
cy1 = -Math.cos(radian) * (radius - tickRadius),
|
| 9146 |
+
cx2 = Math.sin(radian) * radius,
|
| 9147 |
+
cy2 = -Math.cos(radian) * radius;
|
| 9148 |
+
this.hand.setAttribute('x2', cx1);
|
| 9149 |
+
this.hand.setAttribute('y2', cy1);
|
| 9150 |
+
this.bg.setAttribute('cx', cx2);
|
| 9151 |
+
this.bg.setAttribute('cy', cy2);
|
| 9152 |
+
};
|
| 9153 |
+
|
| 9154 |
+
// Hours and minutes are selected
|
| 9155 |
+
ClockPicker.prototype.done = function () {
|
| 9156 |
+
raiseCallback(this.options.beforeDone);
|
| 9157 |
+
this.hide();
|
| 9158 |
+
this.label.addClass('active');
|
| 9159 |
+
|
| 9160 |
+
var last = this.input.prop('value'),
|
| 9161 |
+
value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
|
| 9162 |
+
if (this.options.twelvehour) {
|
| 9163 |
+
value = value + this.amOrPm;
|
| 9164 |
+
}
|
| 9165 |
+
|
| 9166 |
+
this.input.prop('value', value);
|
| 9167 |
+
if (value !== last) {
|
| 9168 |
+
this.input.triggerHandler('change');
|
| 9169 |
+
if (!this.isInput) {
|
| 9170 |
+
this.element.trigger('change');
|
| 9171 |
+
}
|
| 9172 |
+
}
|
| 9173 |
+
|
| 9174 |
+
if (this.options.autoclose) this.input.trigger('blur');
|
| 9175 |
+
|
| 9176 |
+
raiseCallback(this.options.afterDone);
|
| 9177 |
+
};
|
| 9178 |
+
|
| 9179 |
+
// Clear input field
|
| 9180 |
+
ClockPicker.prototype.clear = function () {
|
| 9181 |
+
this.hide();
|
| 9182 |
+
this.label.removeClass('active');
|
| 9183 |
+
|
| 9184 |
+
var last = this.input.prop('value'),
|
| 9185 |
+
value = '';
|
| 9186 |
+
|
| 9187 |
+
this.input.prop('value', value);
|
| 9188 |
+
if (value !== last) {
|
| 9189 |
+
this.input.triggerHandler('change');
|
| 9190 |
+
if (!this.isInput) {
|
| 9191 |
+
this.element.trigger('change');
|
| 9192 |
+
}
|
| 9193 |
+
}
|
| 9194 |
+
|
| 9195 |
+
if (this.options.autoclose) {
|
| 9196 |
+
this.input.trigger('blur');
|
| 9197 |
+
}
|
| 9198 |
+
};
|
| 9199 |
+
|
| 9200 |
+
// Remove clockpicker from input
|
| 9201 |
+
ClockPicker.prototype.remove = function () {
|
| 9202 |
+
this.element.removeData('clockpicker');
|
| 9203 |
+
this.input.off('focus.clockpicker click.clockpicker');
|
| 9204 |
+
if (this.isShown) {
|
| 9205 |
+
this.hide();
|
| 9206 |
+
}
|
| 9207 |
+
if (this.isAppended) {
|
| 9208 |
+
$win.off('resize.clockpicker' + this.id);
|
| 9209 |
+
this.popover.remove();
|
| 9210 |
+
}
|
| 9211 |
+
};
|
| 9212 |
+
|
| 9213 |
+
// Extends $.fn.clockpicker
|
| 9214 |
+
$.fn.pickatime = function (option) {
|
| 9215 |
+
var args = Array.prototype.slice.call(arguments, 1);
|
| 9216 |
+
return this.each(function () {
|
| 9217 |
+
var $this = $(this),
|
| 9218 |
+
data = $this.data('clockpicker');
|
| 9219 |
+
if (!data) {
|
| 9220 |
+
var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
|
| 9221 |
+
$this.data('clockpicker', new ClockPicker($this, options));
|
| 9222 |
+
} else {
|
| 9223 |
+
// Manual operatsions. show, hide, remove, e.g.
|
| 9224 |
+
if (typeof data[option] === 'function') {
|
| 9225 |
+
data[option].apply(data, args);
|
| 9226 |
+
}
|
| 9227 |
+
}
|
| 9228 |
+
});
|
| 9229 |
+
};
|
| 9230 |
+
})(jQuery);
|
| 9231 |
+
;(function ($) {
|
| 9232 |
+
|
| 9233 |
+
$.fn.characterCounter = function () {
|
| 9234 |
+
return this.each(function () {
|
| 9235 |
+
var $input = $(this);
|
| 9236 |
+
var $counterElement = $input.parent().find('span[class="character-counter"]');
|
| 9237 |
+
|
| 9238 |
+
// character counter has already been added appended to the parent container
|
| 9239 |
+
if ($counterElement.length) {
|
| 9240 |
+
return;
|
| 9241 |
+
}
|
| 9242 |
+
|
| 9243 |
+
var itHasLengthAttribute = $input.attr('data-length') !== undefined;
|
| 9244 |
+
|
| 9245 |
+
if (itHasLengthAttribute) {
|
| 9246 |
+
$input.on('input', updateCounter);
|
| 9247 |
+
$input.on('focus', updateCounter);
|
| 9248 |
+
$input.on('blur', removeCounterElement);
|
| 9249 |
+
|
| 9250 |
+
addCounterElement($input);
|
| 9251 |
+
}
|
| 9252 |
+
});
|
| 9253 |
+
};
|
| 9254 |
+
|
| 9255 |
+
function updateCounter() {
|
| 9256 |
+
var maxLength = +$(this).attr('data-length'),
|
| 9257 |
+
actualLength = +$(this).val().length,
|
| 9258 |
+
isValidLength = actualLength <= maxLength;
|
| 9259 |
+
|
| 9260 |
+
$(this).parent().find('span[class="character-counter"]').html(actualLength + '/' + maxLength);
|
| 9261 |
+
|
| 9262 |
+
addInputStyle(isValidLength, $(this));
|
| 9263 |
+
}
|
| 9264 |
+
|
| 9265 |
+
function addCounterElement($input) {
|
| 9266 |
+
var $counterElement = $input.parent().find('span[class="character-counter"]');
|
| 9267 |
+
|
| 9268 |
+
if ($counterElement.length) {
|
| 9269 |
+
return;
|
| 9270 |
+
}
|
| 9271 |
+
|
| 9272 |
+
$counterElement = $('<span/>').addClass('character-counter').css('float', 'right').css('font-size', '12px').css('height', 1);
|
| 9273 |
+
|
| 9274 |
+
$input.parent().append($counterElement);
|
| 9275 |
+
}
|
| 9276 |
+
|
| 9277 |
+
function removeCounterElement() {
|
| 9278 |
+
$(this).parent().find('span[class="character-counter"]').html('');
|
| 9279 |
+
}
|
| 9280 |
+
|
| 9281 |
+
function addInputStyle(isValidLength, $input) {
|
| 9282 |
+
var inputHasInvalidClass = $input.hasClass('invalid');
|
| 9283 |
+
if (isValidLength && inputHasInvalidClass) {
|
| 9284 |
+
$input.removeClass('invalid');
|
| 9285 |
+
} else if (!isValidLength && !inputHasInvalidClass) {
|
| 9286 |
+
$input.removeClass('valid');
|
| 9287 |
+
$input.addClass('invalid');
|
| 9288 |
+
}
|
| 9289 |
+
}
|
| 9290 |
+
|
| 9291 |
+
$(document).ready(function () {
|
| 9292 |
+
$('input, textarea').characterCounter();
|
| 9293 |
+
});
|
| 9294 |
+
})(jQuery);
|
| 9295 |
+
;(function ($) {
|
| 9296 |
+
|
| 9297 |
+
var methods = {
|
| 9298 |
+
|
| 9299 |
+
init: function (options) {
|
| 9300 |
+
var defaults = {
|
| 9301 |
+
duration: 200, // ms
|
| 9302 |
+
dist: -100, // zoom scale TODO: make this more intuitive as an option
|
| 9303 |
+
shift: 0, // spacing for center image
|
| 9304 |
+
padding: 0, // Padding between non center items
|
| 9305 |
+
fullWidth: false, // Change to full width styles
|
| 9306 |
+
indicators: false, // Toggle indicators
|
| 9307 |
+
noWrap: false, // Don't wrap around and cycle through items.
|
| 9308 |
+
onCycleTo: null // Callback for when a new slide is cycled to.
|
| 9309 |
+
};
|
| 9310 |
+
options = $.extend(defaults, options);
|
| 9311 |
+
var namespace = Materialize.objectSelectorString($(this));
|
| 9312 |
+
|
| 9313 |
+
return this.each(function (i) {
|
| 9314 |
+
|
| 9315 |
+
var images, item_width, item_height, offset, center, pressed, dim, count, reference, referenceY, amplitude, target, velocity, scrolling, xform, frame, timestamp, ticker, dragged, vertical_dragged;
|
| 9316 |
+
var $indicators = $('<ul class="indicators"></ul>');
|
| 9317 |
+
var scrollingTimeout = null;
|
| 9318 |
+
var oneTimeCallback = null;
|
| 9319 |
+
|
| 9320 |
+
// Initialize
|
| 9321 |
+
var view = $(this);
|
| 9322 |
+
var hasMultipleSlides = view.find('.carousel-item').length > 1;
|
| 9323 |
+
var showIndicators = (view.attr('data-indicators') || options.indicators) && hasMultipleSlides;
|
| 9324 |
+
var noWrap = view.attr('data-no-wrap') || options.noWrap || !hasMultipleSlides;
|
| 9325 |
+
var uniqueNamespace = view.attr('data-namespace') || namespace + i;
|
| 9326 |
+
view.attr('data-namespace', uniqueNamespace);
|
| 9327 |
+
|
| 9328 |
+
// Options
|
| 9329 |
+
var setCarouselHeight = function (imageOnly) {
|
| 9330 |
+
var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first();
|
| 9331 |
+
var firstImage = firstSlide.find('img').first();
|
| 9332 |
+
if (firstImage.length) {
|
| 9333 |
+
if (firstImage[0].complete) {
|
| 9334 |
+
// If image won't trigger the load event
|
| 9335 |
+
var imageHeight = firstImage.height();
|
| 9336 |
+
if (imageHeight > 0) {
|
| 9337 |
+
view.css('height', firstImage.height());
|
| 9338 |
+
} else {
|
| 9339 |
+
// If image still has no height, use the natural dimensions to calculate
|
| 9340 |
+
var naturalWidth = firstImage[0].naturalWidth;
|
| 9341 |
+
var naturalHeight = firstImage[0].naturalHeight;
|
| 9342 |
+
var adjustedHeight = view.width() / naturalWidth * naturalHeight;
|
| 9343 |
+
view.css('height', adjustedHeight);
|
| 9344 |
+
}
|
| 9345 |
+
} else {
|
| 9346 |
+
// Get height when image is loaded normally
|
| 9347 |
+
firstImage.on('load', function () {
|
| 9348 |
+
view.css('height', $(this).height());
|
| 9349 |
+
});
|
| 9350 |
+
}
|
| 9351 |
+
} else if (!imageOnly) {
|
| 9352 |
+
var slideHeight = firstSlide.height();
|
| 9353 |
+
view.css('height', slideHeight);
|
| 9354 |
+
}
|
| 9355 |
+
};
|
| 9356 |
+
|
| 9357 |
+
if (options.fullWidth) {
|
| 9358 |
+
options.dist = 0;
|
| 9359 |
+
setCarouselHeight();
|
| 9360 |
+
|
| 9361 |
+
// Offset fixed items when indicators.
|
| 9362 |
+
if (showIndicators) {
|
| 9363 |
+
view.find('.carousel-fixed-item').addClass('with-indicators');
|
| 9364 |
+
}
|
| 9365 |
+
}
|
| 9366 |
+
|
| 9367 |
+
// Don't double initialize.
|
| 9368 |
+
if (view.hasClass('initialized')) {
|
| 9369 |
+
// Recalculate variables
|
| 9370 |
+
$(window).trigger('resize');
|
| 9371 |
+
|
| 9372 |
+
// Redraw carousel.
|
| 9373 |
+
view.trigger('carouselNext', [0.000001]);
|
| 9374 |
+
return true;
|
| 9375 |
+
}
|
| 9376 |
+
|
| 9377 |
+
view.addClass('initialized');
|
| 9378 |
+
pressed = false;
|
| 9379 |
+
offset = target = 0;
|
| 9380 |
+
images = [];
|
| 9381 |
+
item_width = view.find('.carousel-item').first().innerWidth();
|
| 9382 |
+
item_height = view.find('.carousel-item').first().innerHeight();
|
| 9383 |
+
dim = item_width * 2 + options.padding;
|
| 9384 |
+
|
| 9385 |
+
view.find('.carousel-item').each(function (i) {
|
| 9386 |
+
images.push($(this)[0]);
|
| 9387 |
+
if (showIndicators) {
|
| 9388 |
+
var $indicator = $('<li class="indicator-item"></li>');
|
| 9389 |
+
|
| 9390 |
+
// Add active to first by default.
|
| 9391 |
+
if (i === 0) {
|
| 9392 |
+
$indicator.addClass('active');
|
| 9393 |
+
}
|
| 9394 |
+
|
| 9395 |
+
// Handle clicks on indicators.
|
| 9396 |
+
$indicator.click(function (e) {
|
| 9397 |
+
e.stopPropagation();
|
| 9398 |
+
|
| 9399 |
+
var index = $(this).index();
|
| 9400 |
+
cycleTo(index);
|
| 9401 |
+
});
|
| 9402 |
+
$indicators.append($indicator);
|
| 9403 |
+
}
|
| 9404 |
+
});
|
| 9405 |
+
|
| 9406 |
+
if (showIndicators) {
|
| 9407 |
+
view.append($indicators);
|
| 9408 |
+
}
|
| 9409 |
+
count = images.length;
|
| 9410 |
+
|
| 9411 |
+
function setupEvents() {
|
| 9412 |
+
if (typeof window.ontouchstart !== 'undefined') {
|
| 9413 |
+
view.on('touchstart.carousel', tap);
|
| 9414 |
+
view.on('touchmove.carousel', drag);
|
| 9415 |
+
view.on('touchend.carousel', release);
|
| 9416 |
+
}
|
| 9417 |
+
view.on('mousedown.carousel', tap);
|
| 9418 |
+
view.on('mousemove.carousel', drag);
|
| 9419 |
+
view.on('mouseup.carousel', release);
|
| 9420 |
+
view.on('mouseleave.carousel', release);
|
| 9421 |
+
view.on('click.carousel', click);
|
| 9422 |
+
}
|
| 9423 |
+
|
| 9424 |
+
function xpos(e) {
|
| 9425 |
+
// touch event
|
| 9426 |
+
if (e.targetTouches && e.targetTouches.length >= 1) {
|
| 9427 |
+
return e.targetTouches[0].clientX;
|
| 9428 |
+
}
|
| 9429 |
+
|
| 9430 |
+
// mouse event
|
| 9431 |
+
return e.clientX;
|
| 9432 |
+
}
|
| 9433 |
+
|
| 9434 |
+
function ypos(e) {
|
| 9435 |
+
// touch event
|
| 9436 |
+
if (e.targetTouches && e.targetTouches.length >= 1) {
|
| 9437 |
+
return e.targetTouches[0].clientY;
|
| 9438 |
+
}
|
| 9439 |
+
|
| 9440 |
+
// mouse event
|
| 9441 |
+
return e.clientY;
|
| 9442 |
+
}
|
| 9443 |
+
|
| 9444 |
+
function wrap(x) {
|
| 9445 |
+
return x >= count ? x % count : x < 0 ? wrap(count + x % count) : x;
|
| 9446 |
+
}
|
| 9447 |
+
|
| 9448 |
+
function scroll(x) {
|
| 9449 |
+
// Track scrolling state
|
| 9450 |
+
scrolling = true;
|
| 9451 |
+
if (!view.hasClass('scrolling')) {
|
| 9452 |
+
view.addClass('scrolling');
|
| 9453 |
+
}
|
| 9454 |
+
if (scrollingTimeout != null) {
|
| 9455 |
+
window.clearTimeout(scrollingTimeout);
|
| 9456 |
+
}
|
| 9457 |
+
scrollingTimeout = window.setTimeout(function () {
|
| 9458 |
+
scrolling = false;
|
| 9459 |
+
view.removeClass('scrolling');
|
| 9460 |
+
}, options.duration);
|
| 9461 |
+
|
| 9462 |
+
// Start actual scroll
|
| 9463 |
+
var i, half, delta, dir, tween, el, alignment, xTranslation;
|
| 9464 |
+
var lastCenter = center;
|
| 9465 |
+
|
| 9466 |
+
offset = typeof x === 'number' ? x : offset;
|
| 9467 |
+
center = Math.floor((offset + dim / 2) / dim);
|
| 9468 |
+
delta = offset - center * dim;
|
| 9469 |
+
dir = delta < 0 ? 1 : -1;
|
| 9470 |
+
tween = -dir * delta * 2 / dim;
|
| 9471 |
+
half = count >> 1;
|
| 9472 |
+
|
| 9473 |
+
if (!options.fullWidth) {
|
| 9474 |
+
alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
|
| 9475 |
+
alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
|
| 9476 |
+
} else {
|
| 9477 |
+
alignment = 'translateX(0)';
|
| 9478 |
+
}
|
| 9479 |
+
|
| 9480 |
+
// Set indicator active
|
| 9481 |
+
if (showIndicators) {
|
| 9482 |
+
var diff = center % count;
|
| 9483 |
+
var activeIndicator = $indicators.find('.indicator-item.active');
|
| 9484 |
+
if (activeIndicator.index() !== diff) {
|
| 9485 |
+
activeIndicator.removeClass('active');
|
| 9486 |
+
$indicators.find('.indicator-item').eq(diff).addClass('active');
|
| 9487 |
+
}
|
| 9488 |
+
}
|
| 9489 |
+
|
| 9490 |
+
// center
|
| 9491 |
+
// Don't show wrapped items.
|
| 9492 |
+
if (!noWrap || center >= 0 && center < count) {
|
| 9493 |
+
el = images[wrap(center)];
|
| 9494 |
+
|
| 9495 |
+
// Add active class to center item.
|
| 9496 |
+
if (!$(el).hasClass('active')) {
|
| 9497 |
+
view.find('.carousel-item').removeClass('active');
|
| 9498 |
+
$(el).addClass('active');
|
| 9499 |
+
}
|
| 9500 |
+
el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween * i + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
|
| 9501 |
+
el.style.zIndex = 0;
|
| 9502 |
+
if (options.fullWidth) {
|
| 9503 |
+
tweenedOpacity = 1;
|
| 9504 |
+
} else {
|
| 9505 |
+
tweenedOpacity = 1 - 0.2 * tween;
|
| 9506 |
+
}
|
| 9507 |
+
el.style.opacity = tweenedOpacity;
|
| 9508 |
+
el.style.display = 'block';
|
| 9509 |
+
}
|
| 9510 |
+
|
| 9511 |
+
for (i = 1; i <= half; ++i) {
|
| 9512 |
+
// right side
|
| 9513 |
+
if (options.fullWidth) {
|
| 9514 |
+
zTranslation = options.dist;
|
| 9515 |
+
tweenedOpacity = i === half && delta < 0 ? 1 - tween : 1;
|
| 9516 |
+
} else {
|
| 9517 |
+
zTranslation = options.dist * (i * 2 + tween * dir);
|
| 9518 |
+
tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
|
| 9519 |
+
}
|
| 9520 |
+
// Don't show wrapped items.
|
| 9521 |
+
if (!noWrap || center + i < count) {
|
| 9522 |
+
el = images[wrap(center + i)];
|
| 9523 |
+
el.style[xform] = alignment + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
|
| 9524 |
+
el.style.zIndex = -i;
|
| 9525 |
+
el.style.opacity = tweenedOpacity;
|
| 9526 |
+
el.style.display = 'block';
|
| 9527 |
+
}
|
| 9528 |
+
|
| 9529 |
+
// left side
|
| 9530 |
+
if (options.fullWidth) {
|
| 9531 |
+
zTranslation = options.dist;
|
| 9532 |
+
tweenedOpacity = i === half && delta > 0 ? 1 - tween : 1;
|
| 9533 |
+
} else {
|
| 9534 |
+
zTranslation = options.dist * (i * 2 - tween * dir);
|
| 9535 |
+
tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
|
| 9536 |
+
}
|
| 9537 |
+
// Don't show wrapped items.
|
| 9538 |
+
if (!noWrap || center - i >= 0) {
|
| 9539 |
+
el = images[wrap(center - i)];
|
| 9540 |
+
el.style[xform] = alignment + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
|
| 9541 |
+
el.style.zIndex = -i;
|
| 9542 |
+
el.style.opacity = tweenedOpacity;
|
| 9543 |
+
el.style.display = 'block';
|
| 9544 |
+
}
|
| 9545 |
+
}
|
| 9546 |
+
|
| 9547 |
+
// center
|
| 9548 |
+
// Don't show wrapped items.
|
| 9549 |
+
if (!noWrap || center >= 0 && center < count) {
|
| 9550 |
+
el = images[wrap(center)];
|
| 9551 |
+
el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
|
| 9552 |
+
el.style.zIndex = 0;
|
| 9553 |
+
if (options.fullWidth) {
|
| 9554 |
+
tweenedOpacity = 1;
|
| 9555 |
+
} else {
|
| 9556 |
+
tweenedOpacity = 1 - 0.2 * tween;
|
| 9557 |
+
}
|
| 9558 |
+
el.style.opacity = tweenedOpacity;
|
| 9559 |
+
el.style.display = 'block';
|
| 9560 |
+
}
|
| 9561 |
+
|
| 9562 |
+
// onCycleTo callback
|
| 9563 |
+
if (lastCenter !== center && typeof options.onCycleTo === "function") {
|
| 9564 |
+
var $curr_item = view.find('.carousel-item').eq(wrap(center));
|
| 9565 |
+
options.onCycleTo.call(this, $curr_item, dragged);
|
| 9566 |
+
}
|
| 9567 |
+
|
| 9568 |
+
// One time callback
|
| 9569 |
+
if (typeof oneTimeCallback === "function") {
|
| 9570 |
+
oneTimeCallback.call(this, $curr_item, dragged);
|
| 9571 |
+
oneTimeCallback = null;
|
| 9572 |
+
}
|
| 9573 |
+
}
|
| 9574 |
+
|
| 9575 |
+
function track() {
|
| 9576 |
+
var now, elapsed, delta, v;
|
| 9577 |
+
|
| 9578 |
+
now = Date.now();
|
| 9579 |
+
elapsed = now - timestamp;
|
| 9580 |
+
timestamp = now;
|
| 9581 |
+
delta = offset - frame;
|
| 9582 |
+
frame = offset;
|
| 9583 |
+
|
| 9584 |
+
v = 1000 * delta / (1 + elapsed);
|
| 9585 |
+
velocity = 0.8 * v + 0.2 * velocity;
|
| 9586 |
+
}
|
| 9587 |
+
|
| 9588 |
+
function autoScroll() {
|
| 9589 |
+
var elapsed, delta;
|
| 9590 |
+
|
| 9591 |
+
if (amplitude) {
|
| 9592 |
+
elapsed = Date.now() - timestamp;
|
| 9593 |
+
delta = amplitude * Math.exp(-elapsed / options.duration);
|
| 9594 |
+
if (delta > 2 || delta < -2) {
|
| 9595 |
+
scroll(target - delta);
|
| 9596 |
+
requestAnimationFrame(autoScroll);
|
| 9597 |
+
} else {
|
| 9598 |
+
scroll(target);
|
| 9599 |
+
}
|
| 9600 |
+
}
|
| 9601 |
+
}
|
| 9602 |
+
|
| 9603 |
+
function click(e) {
|
| 9604 |
+
// Disable clicks if carousel was dragged.
|
| 9605 |
+
if (dragged) {
|
| 9606 |
+
e.preventDefault();
|
| 9607 |
+
e.stopPropagation();
|
| 9608 |
+
return false;
|
| 9609 |
+
} else if (!options.fullWidth) {
|
| 9610 |
+
var clickedIndex = $(e.target).closest('.carousel-item').index();
|
| 9611 |
+
var diff = wrap(center) - clickedIndex;
|
| 9612 |
+
|
| 9613 |
+
// Disable clicks if carousel was shifted by click
|
| 9614 |
+
if (diff !== 0) {
|
| 9615 |
+
e.preventDefault();
|
| 9616 |
+
e.stopPropagation();
|
| 9617 |
+
}
|
| 9618 |
+
cycleTo(clickedIndex);
|
| 9619 |
+
}
|
| 9620 |
+
}
|
| 9621 |
+
|
| 9622 |
+
function cycleTo(n) {
|
| 9623 |
+
var diff = center % count - n;
|
| 9624 |
+
|
| 9625 |
+
// Account for wraparound.
|
| 9626 |
+
if (!noWrap) {
|
| 9627 |
+
if (diff < 0) {
|
| 9628 |
+
if (Math.abs(diff + count) < Math.abs(diff)) {
|
| 9629 |
+
diff += count;
|
| 9630 |
+
}
|
| 9631 |
+
} else if (diff > 0) {
|
| 9632 |
+
if (Math.abs(diff - count) < diff) {
|
| 9633 |
+
diff -= count;
|
| 9634 |
+
}
|
| 9635 |
+
}
|
| 9636 |
+
}
|
| 9637 |
+
|
| 9638 |
+
// Call prev or next accordingly.
|
| 9639 |
+
if (diff < 0) {
|
| 9640 |
+
view.trigger('carouselNext', [Math.abs(diff)]);
|
| 9641 |
+
} else if (diff > 0) {
|
| 9642 |
+
view.trigger('carouselPrev', [diff]);
|
| 9643 |
+
}
|
| 9644 |
+
}
|
| 9645 |
+
|
| 9646 |
+
function tap(e) {
|
| 9647 |
+
// Fixes firefox draggable image bug
|
| 9648 |
+
if (e.type === 'mousedown' && $(e.target).is('img')) {
|
| 9649 |
+
e.preventDefault();
|
| 9650 |
+
}
|
| 9651 |
+
pressed = true;
|
| 9652 |
+
dragged = false;
|
| 9653 |
+
vertical_dragged = false;
|
| 9654 |
+
reference = xpos(e);
|
| 9655 |
+
referenceY = ypos(e);
|
| 9656 |
+
|
| 9657 |
+
velocity = amplitude = 0;
|
| 9658 |
+
frame = offset;
|
| 9659 |
+
timestamp = Date.now();
|
| 9660 |
+
clearInterval(ticker);
|
| 9661 |
+
ticker = setInterval(track, 100);
|
| 9662 |
+
}
|
| 9663 |
+
|
| 9664 |
+
function drag(e) {
|
| 9665 |
+
var x, delta, deltaY;
|
| 9666 |
+
if (pressed) {
|
| 9667 |
+
x = xpos(e);
|
| 9668 |
+
y = ypos(e);
|
| 9669 |
+
delta = reference - x;
|
| 9670 |
+
deltaY = Math.abs(referenceY - y);
|
| 9671 |
+
if (deltaY < 30 && !vertical_dragged) {
|
| 9672 |
+
// If vertical scrolling don't allow dragging.
|
| 9673 |
+
if (delta > 2 || delta < -2) {
|
| 9674 |
+
dragged = true;
|
| 9675 |
+
reference = x;
|
| 9676 |
+
scroll(offset + delta);
|
| 9677 |
+
}
|
| 9678 |
+
} else if (dragged) {
|
| 9679 |
+
// If dragging don't allow vertical scroll.
|
| 9680 |
+
e.preventDefault();
|
| 9681 |
+
e.stopPropagation();
|
| 9682 |
+
return false;
|
| 9683 |
+
} else {
|
| 9684 |
+
// Vertical scrolling.
|
| 9685 |
+
vertical_dragged = true;
|
| 9686 |
+
}
|
| 9687 |
+
}
|
| 9688 |
+
|
| 9689 |
+
if (dragged) {
|
| 9690 |
+
// If dragging don't allow vertical scroll.
|
| 9691 |
+
e.preventDefault();
|
| 9692 |
+
e.stopPropagation();
|
| 9693 |
+
return false;
|
| 9694 |
+
}
|
| 9695 |
+
}
|
| 9696 |
+
|
| 9697 |
+
function release(e) {
|
| 9698 |
+
if (pressed) {
|
| 9699 |
+
pressed = false;
|
| 9700 |
+
} else {
|
| 9701 |
+
return;
|
| 9702 |
+
}
|
| 9703 |
+
|
| 9704 |
+
clearInterval(ticker);
|
| 9705 |
+
target = offset;
|
| 9706 |
+
if (velocity > 10 || velocity < -10) {
|
| 9707 |
+
amplitude = 0.9 * velocity;
|
| 9708 |
+
target = offset + amplitude;
|
| 9709 |
+
}
|
| 9710 |
+
target = Math.round(target / dim) * dim;
|
| 9711 |
+
|
| 9712 |
+
// No wrap of items.
|
| 9713 |
+
if (noWrap) {
|
| 9714 |
+
if (target >= dim * (count - 1)) {
|
| 9715 |
+
target = dim * (count - 1);
|
| 9716 |
+
} else if (target < 0) {
|
| 9717 |
+
target = 0;
|
| 9718 |
+
}
|
| 9719 |
+
}
|
| 9720 |
+
amplitude = target - offset;
|
| 9721 |
+
timestamp = Date.now();
|
| 9722 |
+
requestAnimationFrame(autoScroll);
|
| 9723 |
+
|
| 9724 |
+
if (dragged) {
|
| 9725 |
+
e.preventDefault();
|
| 9726 |
+
e.stopPropagation();
|
| 9727 |
+
}
|
| 9728 |
+
return false;
|
| 9729 |
+
}
|
| 9730 |
+
|
| 9731 |
+
xform = 'transform';
|
| 9732 |
+
['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
|
| 9733 |
+
var e = prefix + 'Transform';
|
| 9734 |
+
if (typeof document.body.style[e] !== 'undefined') {
|
| 9735 |
+
xform = e;
|
| 9736 |
+
return false;
|
| 9737 |
+
}
|
| 9738 |
+
return true;
|
| 9739 |
+
});
|
| 9740 |
+
|
| 9741 |
+
var throttledResize = Materialize.throttle(function () {
|
| 9742 |
+
if (options.fullWidth) {
|
| 9743 |
+
item_width = view.find('.carousel-item').first().innerWidth();
|
| 9744 |
+
var imageHeight = view.find('.carousel-item.active').height();
|
| 9745 |
+
dim = item_width * 2 + options.padding;
|
| 9746 |
+
offset = center * 2 * item_width;
|
| 9747 |
+
target = offset;
|
| 9748 |
+
setCarouselHeight(true);
|
| 9749 |
+
} else {
|
| 9750 |
+
scroll();
|
| 9751 |
+
}
|
| 9752 |
+
}, 200);
|
| 9753 |
+
$(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, throttledResize);
|
| 9754 |
+
|
| 9755 |
+
setupEvents();
|
| 9756 |
+
scroll(offset);
|
| 9757 |
+
|
| 9758 |
+
$(this).on('carouselNext', function (e, n, callback) {
|
| 9759 |
+
if (n === undefined) {
|
| 9760 |
+
n = 1;
|
| 9761 |
+
}
|
| 9762 |
+
if (typeof callback === "function") {
|
| 9763 |
+
oneTimeCallback = callback;
|
| 9764 |
+
}
|
| 9765 |
+
|
| 9766 |
+
target = dim * Math.round(offset / dim) + dim * n;
|
| 9767 |
+
if (offset !== target) {
|
| 9768 |
+
amplitude = target - offset;
|
| 9769 |
+
timestamp = Date.now();
|
| 9770 |
+
requestAnimationFrame(autoScroll);
|
| 9771 |
+
}
|
| 9772 |
+
});
|
| 9773 |
+
|
| 9774 |
+
$(this).on('carouselPrev', function (e, n, callback) {
|
| 9775 |
+
if (n === undefined) {
|
| 9776 |
+
n = 1;
|
| 9777 |
+
}
|
| 9778 |
+
if (typeof callback === "function") {
|
| 9779 |
+
oneTimeCallback = callback;
|
| 9780 |
+
}
|
| 9781 |
+
|
| 9782 |
+
target = dim * Math.round(offset / dim) - dim * n;
|
| 9783 |
+
if (offset !== target) {
|
| 9784 |
+
amplitude = target - offset;
|
| 9785 |
+
timestamp = Date.now();
|
| 9786 |
+
requestAnimationFrame(autoScroll);
|
| 9787 |
+
}
|
| 9788 |
+
});
|
| 9789 |
+
|
| 9790 |
+
$(this).on('carouselSet', function (e, n, callback) {
|
| 9791 |
+
if (n === undefined) {
|
| 9792 |
+
n = 0;
|
| 9793 |
+
}
|
| 9794 |
+
if (typeof callback === "function") {
|
| 9795 |
+
oneTimeCallback = callback;
|
| 9796 |
+
}
|
| 9797 |
+
|
| 9798 |
+
cycleTo(n);
|
| 9799 |
+
});
|
| 9800 |
+
});
|
| 9801 |
+
},
|
| 9802 |
+
next: function (n, callback) {
|
| 9803 |
+
$(this).trigger('carouselNext', [n, callback]);
|
| 9804 |
+
},
|
| 9805 |
+
prev: function (n, callback) {
|
| 9806 |
+
$(this).trigger('carouselPrev', [n, callback]);
|
| 9807 |
+
},
|
| 9808 |
+
set: function (n, callback) {
|
| 9809 |
+
$(this).trigger('carouselSet', [n, callback]);
|
| 9810 |
+
},
|
| 9811 |
+
destroy: function () {
|
| 9812 |
+
var uniqueNamespace = $(this).attr('data-namespace');
|
| 9813 |
+
$(this).removeAttr('data-namespace');
|
| 9814 |
+
$(this).removeClass('initialized');
|
| 9815 |
+
$(this).find('.indicators').remove();
|
| 9816 |
+
|
| 9817 |
+
// Remove event handlers
|
| 9818 |
+
$(this).off('carouselNext carouselPrev carouselSet');
|
| 9819 |
+
$(window).off('resize.carousel-' + uniqueNamespace);
|
| 9820 |
+
if (typeof window.ontouchstart !== 'undefined') {
|
| 9821 |
+
$(this).off('touchstart.carousel touchmove.carousel touchend.carousel');
|
| 9822 |
+
}
|
| 9823 |
+
$(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel');
|
| 9824 |
+
}
|
| 9825 |
+
};
|
| 9826 |
+
|
| 9827 |
+
$.fn.carousel = function (methodOrOptions) {
|
| 9828 |
+
if (methods[methodOrOptions]) {
|
| 9829 |
+
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
|
| 9830 |
+
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
|
| 9831 |
+
// Default to "init"
|
| 9832 |
+
return methods.init.apply(this, arguments);
|
| 9833 |
+
} else {
|
| 9834 |
+
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel');
|
| 9835 |
+
}
|
| 9836 |
+
}; // Plugin end
|
| 9837 |
+
})(jQuery);
|
| 9838 |
+
;(function ($) {
|
| 9839 |
+
|
| 9840 |
+
var methods = {
|
| 9841 |
+
init: function (options) {
|
| 9842 |
+
return this.each(function () {
|
| 9843 |
+
var origin = $('#' + $(this).attr('data-activates'));
|
| 9844 |
+
var screen = $('body');
|
| 9845 |
+
|
| 9846 |
+
// Creating tap target
|
| 9847 |
+
var tapTargetEl = $(this);
|
| 9848 |
+
var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
|
| 9849 |
+
var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
|
| 9850 |
+
var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
|
| 9851 |
+
var tapTargetContentEl = tapTargetEl.find('.tap-target-content');
|
| 9852 |
+
|
| 9853 |
+
// Creating wrapper
|
| 9854 |
+
if (!tapTargetWrapper.length) {
|
| 9855 |
+
tapTargetWrapper = tapTargetEl.wrap($('<div class="tap-target-wrapper"></div>')).parent();
|
| 9856 |
+
}
|
| 9857 |
+
|
| 9858 |
+
// Creating content
|
| 9859 |
+
if (!tapTargetContentEl.length) {
|
| 9860 |
+
tapTargetContentEl = $('<div class="tap-target-content"></div>');
|
| 9861 |
+
tapTargetEl.append(tapTargetContentEl);
|
| 9862 |
+
}
|
| 9863 |
+
|
| 9864 |
+
// Creating foreground wave
|
| 9865 |
+
if (!tapTargetWave.length) {
|
| 9866 |
+
tapTargetWave = $('<div class="tap-target-wave"></div>');
|
| 9867 |
+
|
| 9868 |
+
// Creating origin
|
| 9869 |
+
if (!tapTargetOriginEl.length) {
|
| 9870 |
+
tapTargetOriginEl = origin.clone(true, true);
|
| 9871 |
+
tapTargetOriginEl.addClass('tap-target-origin');
|
| 9872 |
+
tapTargetOriginEl.removeAttr('id');
|
| 9873 |
+
tapTargetOriginEl.removeAttr('style');
|
| 9874 |
+
tapTargetWave.append(tapTargetOriginEl);
|
| 9875 |
+
}
|
| 9876 |
+
|
| 9877 |
+
tapTargetWrapper.append(tapTargetWave);
|
| 9878 |
+
}
|
| 9879 |
+
|
| 9880 |
+
// Open
|
| 9881 |
+
var openTapTarget = function () {
|
| 9882 |
+
if (tapTargetWrapper.is('.open')) {
|
| 9883 |
+
return;
|
| 9884 |
+
}
|
| 9885 |
+
|
| 9886 |
+
// Adding open class
|
| 9887 |
+
tapTargetWrapper.addClass('open');
|
| 9888 |
+
|
| 9889 |
+
setTimeout(function () {
|
| 9890 |
+
tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) {
|
| 9891 |
+
closeTapTarget();
|
| 9892 |
+
tapTargetOriginEl.off('click.tapTarget');
|
| 9893 |
+
});
|
| 9894 |
+
|
| 9895 |
+
$(document).off('click.tapTarget').on('click.tapTarget', function (e) {
|
| 9896 |
+
closeTapTarget();
|
| 9897 |
+
$(document).off('click.tapTarget');
|
| 9898 |
+
});
|
| 9899 |
+
|
| 9900 |
+
var throttledCalc = Materialize.throttle(function () {
|
| 9901 |
+
calculateTapTarget();
|
| 9902 |
+
}, 200);
|
| 9903 |
+
$(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
|
| 9904 |
+
}, 0);
|
| 9905 |
+
};
|
| 9906 |
+
|
| 9907 |
+
// Close
|
| 9908 |
+
var closeTapTarget = function () {
|
| 9909 |
+
if (!tapTargetWrapper.is('.open')) {
|
| 9910 |
+
return;
|
| 9911 |
+
}
|
| 9912 |
+
|
| 9913 |
+
tapTargetWrapper.removeClass('open');
|
| 9914 |
+
tapTargetOriginEl.off('click.tapTarget');
|
| 9915 |
+
$(document).off('click.tapTarget');
|
| 9916 |
+
$(window).off('resize.tapTarget');
|
| 9917 |
+
};
|
| 9918 |
+
|
| 9919 |
+
// Pre calculate
|
| 9920 |
+
var calculateTapTarget = function () {
|
| 9921 |
+
// Element or parent is fixed position?
|
| 9922 |
+
var isFixed = origin.css('position') === 'fixed';
|
| 9923 |
+
if (!isFixed) {
|
| 9924 |
+
var parents = origin.parents();
|
| 9925 |
+
for (var i = 0; i < parents.length; i++) {
|
| 9926 |
+
isFixed = $(parents[i]).css('position') == 'fixed';
|
| 9927 |
+
if (isFixed) {
|
| 9928 |
+
break;
|
| 9929 |
+
}
|
| 9930 |
+
}
|
| 9931 |
+
}
|
| 9932 |
+
|
| 9933 |
+
// Calculating origin
|
| 9934 |
+
var originWidth = origin.outerWidth();
|
| 9935 |
+
var originHeight = origin.outerHeight();
|
| 9936 |
+
var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
|
| 9937 |
+
var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;
|
| 9938 |
+
|
| 9939 |
+
// Calculating screen
|
| 9940 |
+
var windowWidth = $(window).width();
|
| 9941 |
+
var windowHeight = $(window).height();
|
| 9942 |
+
var centerX = windowWidth / 2;
|
| 9943 |
+
var centerY = windowHeight / 2;
|
| 9944 |
+
var isLeft = originLeft <= centerX;
|
| 9945 |
+
var isRight = originLeft > centerX;
|
| 9946 |
+
var isTop = originTop <= centerY;
|
| 9947 |
+
var isBottom = originTop > centerY;
|
| 9948 |
+
var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75;
|
| 9949 |
+
var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75;
|
| 9950 |
+
|
| 9951 |
+
// Calculating tap target
|
| 9952 |
+
var tapTargetWidth = tapTargetEl.outerWidth();
|
| 9953 |
+
var tapTargetHeight = tapTargetEl.outerHeight();
|
| 9954 |
+
var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2;
|
| 9955 |
+
var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2;
|
| 9956 |
+
var tapTargetPosition = isFixed ? 'fixed' : 'absolute';
|
| 9957 |
+
|
| 9958 |
+
// Calculating content
|
| 9959 |
+
var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth;
|
| 9960 |
+
var tapTargetTextHeight = tapTargetHeight / 2;
|
| 9961 |
+
var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0;
|
| 9962 |
+
var tapTargetTextBottom = 0;
|
| 9963 |
+
var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0;
|
| 9964 |
+
var tapTargetTextRight = 0;
|
| 9965 |
+
var tapTargetTextPadding = originWidth;
|
| 9966 |
+
var tapTargetTextAlign = isBottom ? 'bottom' : 'top';
|
| 9967 |
+
|
| 9968 |
+
// Calculating wave
|
| 9969 |
+
var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2;
|
| 9970 |
+
var tapTargetWaveHeight = tapTargetWaveWidth;
|
| 9971 |
+
var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2;
|
| 9972 |
+
var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2;
|
| 9973 |
+
|
| 9974 |
+
// Setting tap target
|
| 9975 |
+
var tapTargetWrapperCssObj = {};
|
| 9976 |
+
tapTargetWrapperCssObj.top = isTop ? tapTargetTop : '';
|
| 9977 |
+
tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : '';
|
| 9978 |
+
tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : '';
|
| 9979 |
+
tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : '';
|
| 9980 |
+
tapTargetWrapperCssObj.position = tapTargetPosition;
|
| 9981 |
+
tapTargetWrapper.css(tapTargetWrapperCssObj);
|
| 9982 |
+
|
| 9983 |
+
// Setting content
|
| 9984 |
+
tapTargetContentEl.css({
|
| 9985 |
+
width: tapTargetTextWidth,
|
| 9986 |
+
height: tapTargetTextHeight,
|
| 9987 |
+
top: tapTargetTextTop,
|
| 9988 |
+
right: tapTargetTextRight,
|
| 9989 |
+
bottom: tapTargetTextBottom,
|
| 9990 |
+
left: tapTargetTextLeft,
|
| 9991 |
+
padding: tapTargetTextPadding,
|
| 9992 |
+
verticalAlign: tapTargetTextAlign
|
| 9993 |
+
});
|
| 9994 |
+
|
| 9995 |
+
// Setting wave
|
| 9996 |
+
tapTargetWave.css({
|
| 9997 |
+
top: tapTargetWaveTop,
|
| 9998 |
+
left: tapTargetWaveLeft,
|
| 9999 |
+
width: tapTargetWaveWidth,
|
| 10000 |
+
height: tapTargetWaveHeight
|
| 10001 |
+
});
|
| 10002 |
+
};
|
| 10003 |
+
|
| 10004 |
+
if (options == 'open') {
|
| 10005 |
+
calculateTapTarget();
|
| 10006 |
+
openTapTarget();
|
| 10007 |
+
}
|
| 10008 |
+
|
| 10009 |
+
if (options == 'close') closeTapTarget();
|
| 10010 |
+
});
|
| 10011 |
+
},
|
| 10012 |
+
open: function () {},
|
| 10013 |
+
close: function () {}
|
| 10014 |
+
};
|
| 10015 |
+
|
| 10016 |
+
$.fn.tapTarget = function (methodOrOptions) {
|
| 10017 |
+
if (methods[methodOrOptions] || typeof methodOrOptions === 'object') return methods.init.apply(this, arguments);
|
| 10018 |
+
|
| 10019 |
+
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target');
|
| 10020 |
+
};
|
| 10021 |
+
})(jQuery);
|
admin/scripts/materialize.min.js
CHANGED
|
@@ -1,9 +1,6 @@
|
|
| 1 |
-
/*!
|
| 2 |
-
* Materialize v0.
|
| 3 |
-
* Copyright 2014-
|
| 4 |
-
* MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
|
| 5 |
-
*/
|
| 6 |
-
function toast(a,b,c,d){function e(a){var b=jQuery("<div class='toast'></div>").addClass(c).html(a);return b.hammer({prevent_default:!1}).bind("pan",function(a){var c=a.gesture.deltaX,d=80;b.hasClass("panning")||b.addClass("panning");var e=1-Math.abs(c/d);0>e&&(e=0),b.velocity({left:c,opacity:e},{duration:50,queue:!1,easing:"easeOutQuad"})}).bind("panend",function(a){var c=a.gesture.deltaX,e=80;Math.abs(c)>e?b.velocity({marginTop:"-40px"},{duration:375,easing:"easeOutExpo",queue:!1,complete:function(){"function"==typeof d&&d(),b.remove()}}):(b.removeClass("panning"),b.velocity({left:0,opacity:1},{duration:300,easing:"easeOutExpo",queue:!1}))}),b}if(c=c||"",0==jQuery("#toast-container").length){var f=jQuery("<div></div>").attr("id","toast-container");jQuery("body").append(f)}var f=jQuery("#toast-container"),g=e(a);f.append(g),g.css({top:parseFloat(g.css("top"))+35+"px",opacity:0}),g.velocity({top:"0px",opacity:1},{duration:300,easing:"easeOutCubic",queue:!1});var h=b,i=setInterval(function(){0===g.parent().length&&window.clearInterval(i),g.hasClass("panning")||(h-=100),0>=h&&(g.velocity({opacity:0,marginTop:"-40px"},{duration:375,easing:"easeOutExpo",queue:!1,complete:function(){"function"==typeof d&&d(),$(this).remove()}}),window.clearInterval(i))},100)}jQuery.easing.jswing=jQuery.easing.swing,jQuery.extend(jQuery.easing,{def:"easeOutQuad",swing:function(a,b,c,d,e){return jQuery.easing[jQuery.easing.def](a,b,c,d,e)},easeInQuad:function(a,b,c,d,e){return d*(b/=e)*b+c},easeOutQuad:function(a,b,c,d,e){return-d*(b/=e)*(b-2)+c},easeInOutQuad:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:-d/2*(--b*(b-2)-1)+c},easeInCubic:function(a,b,c,d,e){return d*(b/=e)*b*b+c},easeOutCubic:function(a,b,c,d,e){return d*((b=b/e-1)*b*b+1)+c},easeInOutCubic:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b+c:d/2*((b-=2)*b*b+2)+c},easeInQuart:function(a,b,c,d,e){return d*(b/=e)*b*b*b+c},easeOutQuart:function(a,b,c,d,e){return-d*((b=b/e-1)*b*b*b-1)+c},easeInOutQuart:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b+c:-d/2*((b-=2)*b*b*b-2)+c},easeInQuint:function(a,b,c,d,e){return d*(b/=e)*b*b*b*b+c},easeOutQuint:function(a,b,c,d,e){return d*((b=b/e-1)*b*b*b*b+1)+c},easeInOutQuint:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b*b+c:d/2*((b-=2)*b*b*b*b+2)+c},easeInSine:function(a,b,c,d,e){return-d*Math.cos(b/e*(Math.PI/2))+d+c},easeOutSine:function(a,b,c,d,e){return d*Math.sin(b/e*(Math.PI/2))+c},easeInOutSine:function(a,b,c,d,e){return-d/2*(Math.cos(Math.PI*b/e)-1)+c},easeInExpo:function(a,b,c,d,e){return 0==b?c:d*Math.pow(2,10*(b/e-1))+c},easeOutExpo:function(a,b,c,d,e){return b==e?c+d:d*(-Math.pow(2,-10*b/e)+1)+c},easeInOutExpo:function(a,b,c,d,e){return 0==b?c:b==e?c+d:(b/=e/2)<1?d/2*Math.pow(2,10*(b-1))+c:d/2*(-Math.pow(2,-10*--b)+2)+c},easeInCirc:function(a,b,c,d,e){return-d*(Math.sqrt(1-(b/=e)*b)-1)+c},easeOutCirc:function(a,b,c,d,e){return d*Math.sqrt(1-(b=b/e-1)*b)+c},easeInOutCirc:function(a,b,c,d,e){return(b/=e/2)<1?-d/2*(Math.sqrt(1-b*b)-1)+c:d/2*(Math.sqrt(1-(b-=2)*b)+1)+c},easeInElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(0==b)return c;if(1==(b/=e))return c+d;if(g||(g=.3*e),h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(b-=1))*Math.sin(2*(b*e-f)*Math.PI/g))+c},easeOutElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(0==b)return c;if(1==(b/=e))return c+d;if(g||(g=.3*e),h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*b)*Math.sin(2*(b*e-f)*Math.PI/g)+d+c},easeInOutElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(0==b)return c;if(2==(b/=e/2))return c+d;if(g||(g=.3*e*1.5),h<Math.abs(d)){h=d;var f=g/4}else var f=g/(2*Math.PI)*Math.asin(d/h);return 1>b?-.5*h*Math.pow(2,10*(b-=1))*Math.sin(2*(b*e-f)*Math.PI/g)+c:h*Math.pow(2,-10*(b-=1))*Math.sin(2*(b*e-f)*Math.PI/g)*.5+d+c},easeInBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),d*(b/=e)*b*((f+1)*b-f)+c},easeOutBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),d*((b=b/e-1)*b*((f+1)*b+f)+1)+c},easeInOutBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),(b/=e/2)<1?d/2*b*b*(((f*=1.525)+1)*b-f)+c:d/2*((b-=2)*b*(((f*=1.525)+1)*b+f)+2)+c},easeInBounce:function(a,b,c,d,e){return d-jQuery.easing.easeOutBounce(a,e-b,0,d,e)+c},easeOutBounce:function(a,b,c,d,e){return(b/=e)<1/2.75?7.5625*d*b*b+c:2/2.75>b?d*(7.5625*(b-=1.5/2.75)*b+.75)+c:2.5/2.75>b?d*(7.5625*(b-=2.25/2.75)*b+.9375)+c:d*(7.5625*(b-=2.625/2.75)*b+.984375)+c},easeInOutBounce:function(a,b,c,d,e){return e/2>b?.5*jQuery.easing.easeInBounce(a,2*b,0,d,e)+c:.5*jQuery.easing.easeOutBounce(a,2*b-e,0,d,e)+.5*d+c}}),jQuery.extend(jQuery.easing,{easeInOutMaterial:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:d/4*((b-=2)*b*b+2)+c}}),!function(a){function b(a){var b=a.length,d=c.type(a);return"function"===d||c.isWindow(a)?!1:1===a.nodeType&&b?!0:"array"===d||0===b||"number"==typeof b&&b>0&&b-1 in a}if(!a.jQuery){var c=function(a,b){return new c.fn.init(a,b)};c.isWindow=function(a){return null!=a&&a==a.window},c.type=function(a){return null==a?a+"":"object"==typeof a||"function"==typeof a?e[g.call(a)]||"object":typeof a},c.isArray=Array.isArray||function(a){return"array"===c.type(a)},c.isPlainObject=function(a){var b;if(!a||"object"!==c.type(a)||a.nodeType||c.isWindow(a))return!1;try{if(a.constructor&&!f.call(a,"constructor")&&!f.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(d){return!1}for(b in a);return void 0===b||f.call(a,b)},c.each=function(a,c,d){var e,f=0,g=a.length,h=b(a);if(d){if(h)for(;g>f&&(e=c.apply(a[f],d),e!==!1);f++);else for(f in a)if(e=c.apply(a[f],d),e===!1)break}else if(h)for(;g>f&&(e=c.call(a[f],f,a[f]),e!==!1);f++);else for(f in a)if(e=c.call(a[f],f,a[f]),e===!1)break;return a},c.data=function(a,b,e){if(void 0===e){var f=a[c.expando],g=f&&d[f];if(void 0===b)return g;if(g&&b in g)return g[b]}else if(void 0!==b){var f=a[c.expando]||(a[c.expando]=++c.uuid);return d[f]=d[f]||{},d[f][b]=e,e}},c.removeData=function(a,b){var e=a[c.expando],f=e&&d[e];f&&c.each(b,function(a,b){delete f[b]})},c.extend=function(){var a,b,d,e,f,g,h=arguments[0]||{},i=1,j=arguments.length,k=!1;for("boolean"==typeof h&&(k=h,h=arguments[i]||{},i++),"object"!=typeof h&&"function"!==c.type(h)&&(h={}),i===j&&(h=this,i--);j>i;i++)if(null!=(f=arguments[i]))for(e in f)a=h[e],d=f[e],h!==d&&(k&&d&&(c.isPlainObject(d)||(b=c.isArray(d)))?(b?(b=!1,g=a&&c.isArray(a)?a:[]):g=a&&c.isPlainObject(a)?a:{},h[e]=c.extend(k,g,d)):void 0!==d&&(h[e]=d));return h},c.queue=function(a,d,e){function f(a,c){var d=c||[];return null!=a&&(b(Object(a))?!function(a,b){for(var c=+b.length,d=0,e=a.length;c>d;)a[e++]=b[d++];if(c!==c)for(;void 0!==b[d];)a[e++]=b[d++];return a.length=e,a}(d,"string"==typeof a?[a]:a):[].push.call(d,a)),d}if(a){d=(d||"fx")+"queue";var g=c.data(a,d);return e?(!g||c.isArray(e)?g=c.data(a,d,f(e)):g.push(e),g):g||[]}},c.dequeue=function(a,b){c.each(a.nodeType?[a]:a,function(a,d){b=b||"fx";var e=c.queue(d,b),f=e.shift();"inprogress"===f&&(f=e.shift()),f&&("fx"===b&&e.unshift("inprogress"),f.call(d,function(){c.dequeue(d,b)}))})},c.fn=c.prototype={init:function(a){if(a.nodeType)return this[0]=a,this;throw new Error("Not a DOM node.")},offset:function(){var b=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:b.top+(a.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:b.left+(a.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function a(){for(var a=this.offsetParent||document;a&&"html"===!a.nodeType.toLowerCase&&"static"===a.style.position;)a=a.offsetParent;return a||document}var b=this[0],a=a.apply(b),d=this.offset(),e=/^(?:body|html)$/i.test(a.nodeName)?{top:0,left:0}:c(a).offset();return d.top-=parseFloat(b.style.marginTop)||0,d.left-=parseFloat(b.style.marginLeft)||0,a.style&&(e.top+=parseFloat(a.style.borderTopWidth)||0,e.left+=parseFloat(a.style.borderLeftWidth)||0),{top:d.top-e.top,left:d.left-e.left}}};var d={};c.expando="velocity"+(new Date).getTime(),c.uuid=0;for(var e={},f=e.hasOwnProperty,g=e.toString,h="Boolean Number String Function Array Date RegExp Object Error".split(" "),i=0;i<h.length;i++)e["[object "+h[i]+"]"]=h[i].toLowerCase();c.fn.init.prototype=c.fn,a.Velocity={Utilities:c}}}(window),function(a){"object"==typeof module&&"object"==typeof module.exports?module.exports=a():"function"==typeof define&&define.amd?define(a):a()}(function(){return function(a,b,c,d){function e(a){for(var b=-1,c=a?a.length:0,d=[];++b<c;){var e=a[b];e&&d.push(e)}return d}function f(a){return p.isWrapped(a)?a=[].slice.call(a):p.isNode(a)&&(a=[a]),a}function g(a){var b=m.data(a,"velocity");return null===b?d:b}function h(a){return function(b){return Math.round(b*a)*(1/a)}}function i(a,c,d,e){function f(a,b){return 1-3*b+3*a}function g(a,b){return 3*b-6*a}function h(a){return 3*a}function i(a,b,c){return((f(b,c)*a+g(b,c))*a+h(b))*a}function j(a,b,c){return 3*f(b,c)*a*a+2*g(b,c)*a+h(b)}function k(b,c){for(var e=0;p>e;++e){var f=j(c,a,d);if(0===f)return c;var g=i(c,a,d)-b;c-=g/f}return c}function l(){for(var b=0;t>b;++b)x[b]=i(b*u,a,d)}function m(b,c,e){var f,g,h=0;do g=c+(e-c)/2,f=i(g,a,d)-b,f>0?e=g:c=g;while(Math.abs(f)>r&&++h<s);return g}function n(b){for(var c=0,e=1,f=t-1;e!=f&&x[e]<=b;++e)c+=u;--e;var g=(b-x[e])/(x[e+1]-x[e]),h=c+g*u,i=j(h,a,d);return i>=q?k(b,h):0==i?h:m(b,c,c+u)}function o(){y=!0,(a!=c||d!=e)&&l()}var p=4,q=.001,r=1e-7,s=10,t=11,u=1/(t-1),v="Float32Array"in b;if(4!==arguments.length)return!1;for(var w=0;4>w;++w)if("number"!=typeof arguments[w]||isNaN(arguments[w])||!isFinite(arguments[w]))return!1;a=Math.min(a,1),d=Math.min(d,1),a=Math.max(a,0),d=Math.max(d,0);var x=v?new Float32Array(t):new Array(t),y=!1,z=function(b){return y||o(),a===c&&d===e?b:0===b?0:1===b?1:i(n(b),c,e)};z.getControlPoints=function(){return[{x:a,y:c},{x:d,y:e}]};var A="generateBezier("+[a,c,d,e]+")";return z.toString=function(){return A},z}function j(a,b){var c=a;return p.isString(a)?t.Easings[a]||(c=!1):c=p.isArray(a)&&1===a.length?h.apply(null,a):p.isArray(a)&&2===a.length?u.apply(null,a.concat([b])):p.isArray(a)&&4===a.length?i.apply(null,a):!1,c===!1&&(c=t.Easings[t.defaults.easing]?t.defaults.easing:s),c}function k(a){if(a)for(var b=(new Date).getTime(),c=0,e=t.State.calls.length;e>c;c++)if(t.State.calls[c]){var f=t.State.calls[c],h=f[0],i=f[2],j=f[3],n=!!j;j||(j=t.State.calls[c][3]=b-16);for(var o=Math.min((b-j)/i.duration,1),q=0,r=h.length;r>q;q++){var s=h[q],u=s.element;if(g(u)){var w=!1;if(i.display!==d&&null!==i.display&&"none"!==i.display){if("flex"===i.display){var y=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];m.each(y,function(a,b){v.setPropertyValue(u,"display",b)})}v.setPropertyValue(u,"display",i.display)}i.visibility!==d&&"hidden"!==i.visibility&&v.setPropertyValue(u,"visibility",i.visibility);for(var z in s)if("element"!==z){var A,B=s[z],C=p.isString(B.easing)?t.Easings[B.easing]:B.easing;if(1===o)A=B.endValue;else if(A=B.startValue+(B.endValue-B.startValue)*C(o),!n&&A===B.currentValue)continue;if(B.currentValue=A,v.Hooks.registered[z]){var D=v.Hooks.getRoot(z),E=g(u).rootPropertyValueCache[D];E&&(B.rootPropertyValue=E)}var F=v.setPropertyValue(u,z,B.currentValue+(0===parseFloat(A)?"":B.unitType),B.rootPropertyValue,B.scrollData);v.Hooks.registered[z]&&(g(u).rootPropertyValueCache[D]=v.Normalizations.registered[D]?v.Normalizations.registered[D]("extract",null,F[1]):F[1]),"transform"===F[0]&&(w=!0)}i.mobileHA&&g(u).transformCache.translate3d===d&&(g(u).transformCache.translate3d="(0px, 0px, 0px)",w=!0),w&&v.flushTransformCache(u)}}i.display!==d&&"none"!==i.display&&(t.State.calls[c][2].display=!1),i.visibility!==d&&"hidden"!==i.visibility&&(t.State.calls[c][2].visibility=!1),i.progress&&i.progress.call(f[1],f[1],o,Math.max(0,j+i.duration-b),j),1===o&&l(c)}t.State.isTicking&&x(k)}function l(a,b){if(!t.State.calls[a])return!1;for(var c=t.State.calls[a][0],e=t.State.calls[a][1],f=t.State.calls[a][2],h=t.State.calls[a][4],i=!1,j=0,k=c.length;k>j;j++){var l=c[j].element;if(b||f.loop||("none"===f.display&&v.setPropertyValue(l,"display",f.display),"hidden"===f.visibility&&v.setPropertyValue(l,"visibility",f.visibility)),f.loop!==!0&&(m.queue(l)[1]===d||!/\.velocityQueueEntryFlag/i.test(m.queue(l)[1]))&&g(l)){g(l).isAnimating=!1,g(l).rootPropertyValueCache={};var n=!1;m.each(v.Lists.transforms3D,function(a,b){var c=/^scale/.test(b)?1:0,e=g(l).transformCache[b];g(l).transformCache[b]!==d&&new RegExp("^\\("+c+"[^.]").test(e)&&(n=!0,delete g(l).transformCache[b])}),f.mobileHA&&(n=!0,delete g(l).transformCache.translate3d),n&&v.flushTransformCache(l),v.Values.removeClass(l,"velocity-animating")}if(!b&&f.complete&&!f.loop&&j===k-1)try{f.complete.call(e,e)}catch(o){setTimeout(function(){throw o},1)}h&&f.loop!==!0&&h(e),f.loop!==!0||b||(m.each(g(l).tweensContainer,function(a,b){/^rotate/.test(a)&&360===parseFloat(b.endValue)&&(b.endValue=0,b.startValue=360)}),t(l,"reverse",{loop:!0,delay:f.delay})),f.queue!==!1&&m.dequeue(l,f.queue)}t.State.calls[a]=!1;for(var p=0,q=t.State.calls.length;q>p;p++)if(t.State.calls[p]!==!1){i=!0;break}i===!1&&(t.State.isTicking=!1,delete t.State.calls,t.State.calls=[])}var m,n=function(){if(c.documentMode)return c.documentMode;for(var a=7;a>4;a--){var b=c.createElement("div");if(b.innerHTML="<!--[if IE "+a+"]><span></span><![endif]-->",b.getElementsByTagName("span").length)return b=null,a}return d}(),o=function(){var a=0;return b.webkitRequestAnimationFrame||b.mozRequestAnimationFrame||function(b){var c,d=(new Date).getTime();return c=Math.max(0,16-(d-a)),a=d+c,setTimeout(function(){b(d+c)},c)}}(),p={isString:function(a){return"string"==typeof a},isArray:Array.isArray||function(a){return"[object Array]"===Object.prototype.toString.call(a)},isFunction:function(a){return"[object Function]"===Object.prototype.toString.call(a)},isNode:function(a){return a&&a.nodeType},isNodeList:function(a){return"object"==typeof a&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(a))&&a.length!==d&&(0===a.length||"object"==typeof a[0]&&a[0].nodeType>0)},isWrapped:function(a){return a&&(a.jquery||b.Zepto&&b.Zepto.zepto.isZ(a))},isSVG:function(a){return b.SVGElement&&a instanceof b.SVGElement},isEmptyObject:function(a){for(var b in a)return!1;return!0}},q=!1;if(a.fn&&a.fn.jquery?(m=a,q=!0):m=b.Velocity.Utilities,8>=n&&!q)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if(7>=n)return void(jQuery.fn.velocity=jQuery.fn.animate);var r=400,s="swing",t={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:b.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:c.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:m,Redirects:{},Easings:{},Promise:b.Promise,defaults:{queue:"",duration:r,easing:s,begin:d,complete:d,progress:d,display:d,visibility:d,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(a){m.data(a,"velocity",{isSVG:p.isSVG(a),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:1,patch:0},debug:!1};b.pageYOffset!==d?(t.State.scrollAnchor=b,t.State.scrollPropertyLeft="pageXOffset",t.State.scrollPropertyTop="pageYOffset"):(t.State.scrollAnchor=c.documentElement||c.body.parentNode||c.body,t.State.scrollPropertyLeft="scrollLeft",t.State.scrollPropertyTop="scrollTop");var u=function(){function a(a){return-a.tension*a.x-a.friction*a.v}function b(b,c,d){var e={x:b.x+d.dx*c,v:b.v+d.dv*c,tension:b.tension,friction:b.friction};return{dx:e.v,dv:a(e)}}function c(c,d){var e={dx:c.v,dv:a(c)},f=b(c,.5*d,e),g=b(c,.5*d,f),h=b(c,d,g),i=1/6*(e.dx+2*(f.dx+g.dx)+h.dx),j=1/6*(e.dv+2*(f.dv+g.dv)+h.dv);return c.x=c.x+i*d,c.v=c.v+j*d,c}return function d(a,b,e){var f,g,h,i={x:-1,v:0,tension:null,friction:null},j=[0],k=0,l=1e-4,m=.016;for(a=parseFloat(a)||500,b=parseFloat(b)||20,e=e||null,i.tension=a,i.friction=b,f=null!==e,f?(k=d(a,b),g=k/e*m):g=m;h=c(h||i,g),j.push(1+h.x),k+=16,Math.abs(h.x)>l&&Math.abs(h.v)>l;);return f?function(a){return j[a*(j.length-1)|0]}:k}}();t.Easings={linear:function(a){return a},swing:function(a){return.5-Math.cos(a*Math.PI)/2},spring:function(a){return 1-Math.cos(4.5*a*Math.PI)*Math.exp(6*-a)}},m.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(a,b){t.Easings[b[0]]=i.apply(null,b[1])});var v=t.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(var a=0;a<v.Lists.colors.length;a++){var b="color"===v.Lists.colors[a]?"0 0 0 1":"255 255 255 1";v.Hooks.templates[v.Lists.colors[a]]=["Red Green Blue Alpha",b]}var c,d,e;if(n)for(c in v.Hooks.templates){d=v.Hooks.templates[c],e=d[0].split(" ");var f=d[1].match(v.RegEx.valueSplit);"Color"===e[0]&&(e.push(e.shift()),f.push(f.shift()),v.Hooks.templates[c]=[e.join(" "),f.join(" ")])}for(c in v.Hooks.templates){d=v.Hooks.templates[c],e=d[0].split(" ");for(var a in e){var g=c+e[a],h=a;v.Hooks.registered[g]=[c,h]}}},getRoot:function(a){var b=v.Hooks.registered[a];return b?b[0]:a},cleanRootPropertyValue:function(a,b){return v.RegEx.valueUnwrap.test(b)&&(b=b.match(v.RegEx.valueUnwrap)[1]),v.Values.isCSSNullValue(b)&&(b=v.Hooks.templates[a][1]),b},extractValue:function(a,b){var c=v.Hooks.registered[a];if(c){var d=c[0],e=c[1];return b=v.Hooks.cleanRootPropertyValue(d,b),b.toString().match(v.RegEx.valueSplit)[e]}return b},injectValue:function(a,b,c){var d=v.Hooks.registered[a];if(d){var e,f,g=d[0],h=d[1];return c=v.Hooks.cleanRootPropertyValue(g,c),e=c.toString().match(v.RegEx.valueSplit),e[h]=b,f=e.join(" ")}return c}},Normalizations:{registered:{clip:function(a,b,c){switch(a){case"name":return"clip";case"extract":var d;return v.RegEx.wrappedValueAlreadyExtracted.test(c)?d=c:(d=c.toString().match(v.RegEx.valueUnwrap),d=d?d[1].replace(/,(\s+)?/g," "):c),d;case"inject":return"rect("+c+")"}},blur:function(a,b,c){switch(a){case"name":return"-webkit-filter";case"extract":var d=parseFloat(c);if(!d&&0!==d){var e=c.toString().match(/blur\(([0-9]+[A-z]+)\)/i);d=e?e[1]:0}return d;case"inject":return parseFloat(c)?"blur("+c+")":"none"}},opacity:function(a,b,c){if(8>=n)switch(a){case"name":return"filter";case"extract":var d=c.toString().match(/alpha\(opacity=(.*)\)/i);return c=d?d[1]/100:1;case"inject":return b.style.zoom=1,parseFloat(c)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(c),10)+")"}else switch(a){case"name":return"opacity";case"extract":return c;case"inject":return c}}},register:function(){9>=n||t.State.isGingerbread||(v.Lists.transformsBase=v.Lists.transformsBase.concat(v.Lists.transforms3D));for(var a=0;a<v.Lists.transformsBase.length;a++)!function(){var b=v.Lists.transformsBase[a];v.Normalizations.registered[b]=function(a,c,e){switch(a){case"name":return"transform";case"extract":return g(c)===d||g(c).transformCache[b]===d?/^scale/i.test(b)?1:0:g(c).transformCache[b].replace(/[()]/g,"");case"inject":var f=!1;switch(b.substr(0,b.length-1)){case"translate":f=!/(%|px|em|rem|vw|vh|\d)$/i.test(e);break;case"scal":case"scale":t.State.isAndroid&&g(c).transformCache[b]===d&&1>e&&(e=1),f=!/(\d)$/i.test(e);break;case"skew":f=!/(deg|\d)$/i.test(e);break;case"rotate":f=!/(deg|\d)$/i.test(e)}return f||(g(c).transformCache[b]="("+e+")"),g(c).transformCache[b]}}}();for(var a=0;a<v.Lists.colors.length;a++)!function(){var b=v.Lists.colors[a];v.Normalizations.registered[b]=function(a,c,e){switch(a){case"name":return b;case"extract":var f;if(v.RegEx.wrappedValueAlreadyExtracted.test(e))f=e;else{var g,h={black:"rgb(0, 0, 0)",blue:"rgb(0, 0, 255)",gray:"rgb(128, 128, 128)",green:"rgb(0, 128, 0)",red:"rgb(255, 0, 0)",white:"rgb(255, 255, 255)"};/^[A-z]+$/i.test(e)?g=h[e]!==d?h[e]:h.black:v.RegEx.isHex.test(e)?g="rgb("+v.Values.hexToRgb(e).join(" ")+")":/^rgba?\(/i.test(e)||(g=h.black),f=(g||e).toString().match(v.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g," ")}return 8>=n||3!==f.split(" ").length||(f+=" 1"),f;case"inject":return 8>=n?4===e.split(" ").length&&(e=e.split(/\s+/).slice(0,3).join(" ")):3===e.split(" ").length&&(e+=" 1"),(8>=n?"rgb":"rgba")+"("+e.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(a){return a.replace(/-(\w)/g,function(a,b){return b.toUpperCase()})},SVGAttribute:function(a){var b="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(n||t.State.isAndroid&&!t.State.isChrome)&&(b+="|transform"),new RegExp("^("+b+")$","i").test(a)},prefixCheck:function(a){if(t.State.prefixMatches[a])return[t.State.prefixMatches[a],!0];for(var b=["","Webkit","Moz","ms","O"],c=0,d=b.length;d>c;c++){var e;if(e=0===c?a:b[c]+a.replace(/^\w/,function(a){return a.toUpperCase()}),p.isString(t.State.prefixElement.style[e]))return t.State.prefixMatches[a]=e,[e,!0]}return[a,!1]}},Values:{hexToRgb:function(a){var b,c=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,d=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return a=a.replace(c,function(a,b,c,d){return b+b+c+c+d+d}),b=d.exec(a),b?[parseInt(b[1],16),parseInt(b[2],16),parseInt(b[3],16)]:[0,0,0]},isCSSNullValue:function(a){return 0==a||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(a)},getUnitType:function(a){return/^(rotate|skew)/i.test(a)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(a)?"":"px"},getDisplayType:function(a){var b=a&&a.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(b)?"inline":/^(li)$/i.test(b)?"list-item":/^(tr)$/i.test(b)?"table-row":"block"},addClass:function(a,b){a.classList?a.classList.add(b):a.className+=(a.className.length?" ":"")+b},removeClass:function(a,b){a.classList?a.classList.remove(b):a.className=a.className.toString().replace(new RegExp("(^|\\s)"+b.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(a,c,e,f){function h(a,c){function e(){j&&v.setPropertyValue(a,"display","none")}var i=0;if(8>=n)i=m.css(a,c);else{var j=!1;if(/^(width|height)$/.test(c)&&0===v.getPropertyValue(a,"display")&&(j=!0,v.setPropertyValue(a,"display",v.Values.getDisplayType(a))),!f){if("height"===c&&"border-box"!==v.getPropertyValue(a,"boxSizing").toString().toLowerCase()){var k=a.offsetHeight-(parseFloat(v.getPropertyValue(a,"borderTopWidth"))||0)-(parseFloat(v.getPropertyValue(a,"borderBottomWidth"))||0)-(parseFloat(v.getPropertyValue(a,"paddingTop"))||0)-(parseFloat(v.getPropertyValue(a,"paddingBottom"))||0);return e(),k}if("width"===c&&"border-box"!==v.getPropertyValue(a,"boxSizing").toString().toLowerCase()){var l=a.offsetWidth-(parseFloat(v.getPropertyValue(a,"borderLeftWidth"))||0)-(parseFloat(v.getPropertyValue(a,"borderRightWidth"))||0)-(parseFloat(v.getPropertyValue(a,"paddingLeft"))||0)-(parseFloat(v.getPropertyValue(a,"paddingRight"))||0);return e(),l}}var o;o=g(a)===d?b.getComputedStyle(a,null):g(a).computedStyle?g(a).computedStyle:g(a).computedStyle=b.getComputedStyle(a,null),(n||t.State.isFirefox)&&"borderColor"===c&&(c="borderTopColor"),i=9===n&&"filter"===c?o.getPropertyValue(c):o[c],(""===i||null===i)&&(i=a.style[c]),e()}if("auto"===i&&/^(top|right|bottom|left)$/i.test(c)){var p=h(a,"position");("fixed"===p||"absolute"===p&&/top|left/i.test(c))&&(i=m(a).position()[c]+"px")}return i}var i;if(v.Hooks.registered[c]){var j=c,k=v.Hooks.getRoot(j);e===d&&(e=v.getPropertyValue(a,v.Names.prefixCheck(k)[0])),v.Normalizations.registered[k]&&(e=v.Normalizations.registered[k]("extract",a,e)),i=v.Hooks.extractValue(j,e)}else if(v.Normalizations.registered[c]){var l,o;l=v.Normalizations.registered[c]("name",a),"transform"!==l&&(o=h(a,v.Names.prefixCheck(l)[0]),v.Values.isCSSNullValue(o)&&v.Hooks.templates[c]&&(o=v.Hooks.templates[c][1])),i=v.Normalizations.registered[c]("extract",a,o)}return/^[\d-]/.test(i)||(i=g(a)&&g(a).isSVG&&v.Names.SVGAttribute(c)?/^(height|width)$/i.test(c)?a.getBBox()[c]:a.getAttribute(c):h(a,v.Names.prefixCheck(c)[0])),v.Values.isCSSNullValue(i)&&(i=0),t.debug>=2&&console.log("Get "+c+": "+i),i},setPropertyValue:function(a,c,d,e,f){var h=c;if("scroll"===c)f.container?f.container["scroll"+f.direction]=d:"Left"===f.direction?b.scrollTo(d,f.alternateValue):b.scrollTo(f.alternateValue,d);else if(v.Normalizations.registered[c]&&"transform"===v.Normalizations.registered[c]("name",a))v.Normalizations.registered[c]("inject",a,d),h="transform",d=g(a).transformCache[c];else{if(v.Hooks.registered[c]){var i=c,j=v.Hooks.getRoot(c);e=e||v.getPropertyValue(a,j),d=v.Hooks.injectValue(i,d,e),c=j}if(v.Normalizations.registered[c]&&(d=v.Normalizations.registered[c]("inject",a,d),c=v.Normalizations.registered[c]("name",a)),h=v.Names.prefixCheck(c)[0],8>=n)try{a.style[h]=d}catch(k){t.debug&&console.log("Browser does not support ["+d+"] for ["+h+"]")}else g(a)&&g(a).isSVG&&v.Names.SVGAttribute(c)?a.setAttribute(c,d):a.style[h]=d;t.debug>=2&&console.log("Set "+c+" ("+h+"): "+d)}return[h,d]},flushTransformCache:function(a){function b(b){return parseFloat(v.getPropertyValue(a,b))}var c="";if((n||t.State.isAndroid&&!t.State.isChrome)&&g(a).isSVG){var d={translate:[b("translateX"),b("translateY")],skewX:[b("skewX")],skewY:[b("skewY")],scale:1!==b("scale")?[b("scale"),b("scale")]:[b("scaleX"),b("scaleY")],rotate:[b("rotateZ"),0,0]};m.each(g(a).transformCache,function(a){/^translate/i.test(a)?a="translate":/^scale/i.test(a)?a="scale":/^rotate/i.test(a)&&(a="rotate"),d[a]&&(c+=a+"("+d[a].join(" ")+") ",delete d[a])})}else{var e,f;m.each(g(a).transformCache,function(b){return e=g(a).transformCache[b],"transformPerspective"===b?(f=e,!0):(9===n&&"rotateZ"===b&&(b="rotate"),void(c+=b+e+" "))}),f&&(c="perspective"+f+" "+c)}v.setPropertyValue(a,"transform",c)}};v.Hooks.register(),v.Normalizations.register(),t.hook=function(a,b,c){var e=d;return a=f(a),m.each(a,function(a,f){if(g(f)===d&&t.init(f),c===d)e===d&&(e=t.CSS.getPropertyValue(f,b));else{var h=t.CSS.setPropertyValue(f,b,c);"transform"===h[0]&&t.CSS.flushTransformCache(f),e=h}}),e};var w=function(){function a(){return i?C.promise||null:n}function h(){function a(){function a(a,b){var c=d,e=d,f=d;return p.isArray(a)?(c=a[0],!p.isArray(a[1])&&/^[\d-]/.test(a[1])||p.isFunction(a[1])||v.RegEx.isHex.test(a[1])?f=a[1]:(p.isString(a[1])&&!v.RegEx.isHex.test(a[1])||p.isArray(a[1]))&&(e=b?a[1]:j(a[1],i.duration),a[2]!==d&&(f=a[2]))):c=a,b||(e=e||i.easing),p.isFunction(c)&&(c=c.call(h,z,y)),p.isFunction(f)&&(f=f.call(h,z,y)),[c||0,e,f]}function n(a,b){var c,d;return d=(b||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(a){return c=a,""}),c||(c=v.Values.getUnitType(a)),[d,c]}function o(){var a={myParent:h.parentNode||c.body,position:v.getPropertyValue(h,"position"),fontSize:v.getPropertyValue(h,"fontSize")},d=a.position===J.lastPosition&&a.myParent===J.lastParent,e=a.fontSize===J.lastFontSize;J.lastParent=a.myParent,J.lastPosition=a.position,J.lastFontSize=a.fontSize;var f=100,i={};if(e&&d)i.emToPx=J.lastEmToPx,i.percentToPxWidth=J.lastPercentToPxWidth,i.percentToPxHeight=J.lastPercentToPxHeight;else{var j=g(h).isSVG?c.createElementNS("http://www.w3.org/2000/svg","rect"):c.createElement("div");t.init(j),a.myParent.appendChild(j),m.each(["overflow","overflowX","overflowY"],function(a,b){t.CSS.setPropertyValue(j,b,"hidden")}),t.CSS.setPropertyValue(j,"position",a.position),t.CSS.setPropertyValue(j,"fontSize",a.fontSize),t.CSS.setPropertyValue(j,"boxSizing","content-box"),m.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(a,b){t.CSS.setPropertyValue(j,b,f+"%")}),t.CSS.setPropertyValue(j,"paddingLeft",f+"em"),i.percentToPxWidth=J.lastPercentToPxWidth=(parseFloat(v.getPropertyValue(j,"width",null,!0))||1)/f,i.percentToPxHeight=J.lastPercentToPxHeight=(parseFloat(v.getPropertyValue(j,"height",null,!0))||1)/f,i.emToPx=J.lastEmToPx=(parseFloat(v.getPropertyValue(j,"paddingLeft"))||1)/f,a.myParent.removeChild(j)}return null===J.remToPx&&(J.remToPx=parseFloat(v.getPropertyValue(c.body,"fontSize"))||16),null===J.vwToPx&&(J.vwToPx=parseFloat(b.innerWidth)/100,J.vhToPx=parseFloat(b.innerHeight)/100),i.remToPx=J.remToPx,i.vwToPx=J.vwToPx,i.vhToPx=J.vhToPx,t.debug>=1&&console.log("Unit ratios: "+JSON.stringify(i),h),i}if(i.begin&&0===z)try{i.begin.call(q,q)}catch(r){setTimeout(function(){throw r},1)}if("scroll"===D){var w,x,A,B=/^x$/i.test(i.axis)?"Left":"Top",E=parseFloat(i.offset)||0;i.container?p.isWrapped(i.container)||p.isNode(i.container)?(i.container=i.container[0]||i.container,w=i.container["scroll"+B],A=w+m(h).position()[B.toLowerCase()]+E):i.container=null:(w=t.State.scrollAnchor[t.State["scrollProperty"+B]],x=t.State.scrollAnchor[t.State["scrollProperty"+("Left"===B?"Top":"Left")]],A=m(h).offset()[B.toLowerCase()]+E),l={scroll:{rootPropertyValue:!1,startValue:w,currentValue:w,endValue:A,unitType:"",easing:i.easing,scrollData:{container:i.container,direction:B,alternateValue:x}},element:h},t.debug&&console.log("tweensContainer (scroll): ",l.scroll,h)}else if("reverse"===D){if(!g(h).tweensContainer)return void m.dequeue(h,i.queue);"none"===g(h).opts.display&&(g(h).opts.display="auto"),"hidden"===g(h).opts.visibility&&(g(h).opts.visibility="visible"),g(h).opts.loop=!1,g(h).opts.begin=null,g(h).opts.complete=null,u.easing||delete i.easing,u.duration||delete i.duration,i=m.extend({},g(h).opts,i);var F=m.extend(!0,{},g(h).tweensContainer);for(var G in F)if("element"!==G){var H=F[G].startValue;F[G].startValue=F[G].currentValue=F[G].endValue,F[G].endValue=H,p.isEmptyObject(u)||(F[G].easing=i.easing),t.debug&&console.log("reverse tweensContainer ("+G+"): "+JSON.stringify(F[G]),h)}l=F}else if("start"===D){var F;g(h).tweensContainer&&g(h).isAnimating===!0&&(F=g(h).tweensContainer),m.each(s,function(b,c){if(RegExp("^"+v.Lists.colors.join("$|^")+"$").test(b)){var e=a(c,!0),f=e[0],g=e[1],h=e[2];if(v.RegEx.isHex.test(f)){for(var i=["Red","Green","Blue"],j=v.Values.hexToRgb(f),k=h?v.Values.hexToRgb(h):d,l=0;l<i.length;l++){var m=[j[l]];g&&m.push(g),k!==d&&m.push(k[l]),s[b+i[l]]=m}delete s[b]}}});for(var I in s){var L=a(s[I]),M=L[0],N=L[1],O=L[2];I=v.Names.camelCase(I);var P=v.Hooks.getRoot(I),Q=!1;if(g(h).isSVG||v.Names.prefixCheck(P)[1]!==!1||v.Normalizations.registered[P]!==d){(i.display!==d&&null!==i.display&&"none"!==i.display||i.visibility!==d&&"hidden"!==i.visibility)&&/opacity|filter/.test(I)&&!O&&0!==M&&(O=0),i._cacheValues&&F&&F[I]?(O===d&&(O=F[I].endValue+F[I].unitType),Q=g(h).rootPropertyValueCache[P]):v.Hooks.registered[I]?O===d?(Q=v.getPropertyValue(h,P),O=v.getPropertyValue(h,I,Q)):Q=v.Hooks.templates[P][1]:O===d&&(O=v.getPropertyValue(h,I));
|
| 7 |
-
var R,S,T,U=!1;if(R=n(I,O),O=R[0],T=R[1],R=n(I,M),M=R[0].replace(/^([+-\/*])=/,function(a,b){return U=b,""}),S=R[1],O=parseFloat(O)||0,M=parseFloat(M)||0,"%"===S&&(/^(fontSize|lineHeight)$/.test(I)?(M/=100,S="em"):/^scale/.test(I)?(M/=100,S=""):/(Red|Green|Blue)$/i.test(I)&&(M=M/100*255,S="")),/[\/*]/.test(U))S=T;else if(T!==S&&0!==O)if(0===M)S=T;else{f=f||o();var V=/margin|padding|left|right|width|text|word|letter/i.test(I)||/X$/.test(I)||"x"===I?"x":"y";switch(T){case"%":O*="x"===V?f.percentToPxWidth:f.percentToPxHeight;break;case"px":break;default:O*=f[T+"ToPx"]}switch(S){case"%":O*=1/("x"===V?f.percentToPxWidth:f.percentToPxHeight);break;case"px":break;default:O*=1/f[S+"ToPx"]}}switch(U){case"+":M=O+M;break;case"-":M=O-M;break;case"*":M=O*M;break;case"/":M=O/M}l[I]={rootPropertyValue:Q,startValue:O,currentValue:O,endValue:M,unitType:S,easing:N},t.debug&&console.log("tweensContainer ("+I+"): "+JSON.stringify(l[I]),h)}else t.debug&&console.log("Skipping ["+P+"] due to a lack of browser support.")}l.element=h}l.element&&(v.Values.addClass(h,"velocity-animating"),K.push(l),""===i.queue&&(g(h).tweensContainer=l,g(h).opts=i),g(h).isAnimating=!0,z===y-1?(t.State.calls.length>1e4&&(t.State.calls=e(t.State.calls)),t.State.calls.push([K,q,i,null,C.resolver]),t.State.isTicking===!1&&(t.State.isTicking=!0,k())):z++)}var f,h=this,i=m.extend({},t.defaults,u),l={};switch(g(h)===d&&t.init(h),parseFloat(i.delay)&&i.queue!==!1&&m.queue(h,i.queue,function(a){t.velocityQueueEntryFlag=!0,g(h).delayTimer={setTimeout:setTimeout(a,parseFloat(i.delay)),next:a}}),i.duration.toString().toLowerCase()){case"fast":i.duration=200;break;case"normal":i.duration=r;break;case"slow":i.duration=600;break;default:i.duration=parseFloat(i.duration)||1}t.mock!==!1&&(t.mock===!0?i.duration=i.delay=1:(i.duration*=parseFloat(t.mock)||1,i.delay*=parseFloat(t.mock)||1)),i.easing=j(i.easing,i.duration),i.begin&&!p.isFunction(i.begin)&&(i.begin=null),i.progress&&!p.isFunction(i.progress)&&(i.progress=null),i.complete&&!p.isFunction(i.complete)&&(i.complete=null),i.display!==d&&null!==i.display&&(i.display=i.display.toString().toLowerCase(),"auto"===i.display&&(i.display=t.CSS.Values.getDisplayType(h))),i.visibility!==d&&null!==i.visibility&&(i.visibility=i.visibility.toString().toLowerCase()),i.mobileHA=i.mobileHA&&t.State.isMobile&&!t.State.isGingerbread,i.queue===!1?i.delay?setTimeout(a,i.delay):a():m.queue(h,i.queue,function(b,c){return c===!0?(C.promise&&C.resolver(q),!0):(t.velocityQueueEntryFlag=!0,void a(b))}),""!==i.queue&&"fx"!==i.queue||"inprogress"===m.queue(h)[0]||m.dequeue(h)}var i,n,o,q,s,u,x=arguments[0]&&(m.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||p.isString(arguments[0].properties));if(p.isWrapped(this)?(i=!1,o=0,q=this,n=this):(i=!0,o=1,q=x?arguments[0].elements:arguments[0]),q=f(q)){x?(s=arguments[0].properties,u=arguments[0].options):(s=arguments[o],u=arguments[o+1]);var y=q.length,z=0;if("stop"!==s&&!m.isPlainObject(u)){var A=o+1;u={};for(var B=A;B<arguments.length;B++)p.isArray(arguments[B])||!/^(fast|normal|slow)$/i.test(arguments[B])&&!/^\d/.test(arguments[B])?p.isString(arguments[B])||p.isArray(arguments[B])?u.easing=arguments[B]:p.isFunction(arguments[B])&&(u.complete=arguments[B]):u.duration=arguments[B]}var C={promise:null,resolver:null,rejecter:null};i&&t.Promise&&(C.promise=new t.Promise(function(a,b){C.resolver=a,C.rejecter=b}));var D;switch(s){case"scroll":D="scroll";break;case"reverse":D="reverse";break;case"stop":m.each(q,function(a,b){g(b)&&g(b).delayTimer&&(clearTimeout(g(b).delayTimer.setTimeout),g(b).delayTimer.next&&g(b).delayTimer.next(),delete g(b).delayTimer)});var E=[];return m.each(t.State.calls,function(a,b){b&&m.each(b[1],function(c,e){var f=p.isString(u)?u:"";return u!==d&&b[2].queue!==f?!0:void m.each(q,function(b,c){c===e&&(u!==d&&(m.each(m.queue(c,f),function(a,b){p.isFunction(b)&&b(null,!0)}),m.queue(c,f,[])),g(c)&&""===f&&m.each(g(c).tweensContainer,function(a,b){b.endValue=b.currentValue}),E.push(a))})})}),m.each(E,function(a,b){l(b,!0)}),C.promise&&C.resolver(q),a();default:if(!m.isPlainObject(s)||p.isEmptyObject(s)){if(p.isString(s)&&t.Redirects[s]){var F=m.extend({},u),G=F.duration,H=F.delay||0;return F.backwards===!0&&(q=m.extend(!0,[],q).reverse()),m.each(q,function(a,b){parseFloat(F.stagger)?F.delay=H+parseFloat(F.stagger)*a:p.isFunction(F.stagger)&&(F.delay=H+F.stagger.call(b,a,y)),F.drag&&(F.duration=parseFloat(G)||(/^(callout|transition)/.test(s)?1e3:r),F.duration=Math.max(F.duration*(F.backwards?1-a/y:(a+1)/y),.75*F.duration,200)),t.Redirects[s].call(b,b,F||{},a,y,q,C.promise?C:d)}),a()}var I="Velocity: First argument ("+s+") was not a property map, a known action, or a registered redirect. Aborting.";return C.promise?C.rejecter(new Error(I)):console.log(I),a()}D="start"}var J={lastParent:null,lastPosition:null,lastFontSize:null,lastPercentToPxWidth:null,lastPercentToPxHeight:null,lastEmToPx:null,remToPx:null,vwToPx:null,vhToPx:null},K=[];m.each(q,function(a,b){p.isNode(b)&&h.call(b)});var L,F=m.extend({},t.defaults,u);if(F.loop=parseInt(F.loop),L=2*F.loop-1,F.loop)for(var M=0;L>M;M++){var N={delay:F.delay,progress:F.progress};M===L-1&&(N.display=F.display,N.visibility=F.visibility,N.complete=F.complete),w(q,"reverse",N)}return a()}};t=m.extend(w,t),t.animate=w;var x=b.requestAnimationFrame||o;return t.State.isMobile||c.hidden===d||c.addEventListener("visibilitychange",function(){c.hidden?(x=function(a){return setTimeout(function(){a(!0)},16)},k()):x=b.requestAnimationFrame||o}),a.Velocity=t,a!==b&&(a.fn.velocity=w,a.fn.velocity.defaults=t.defaults),m.each(["Down","Up"],function(a,b){t.Redirects["slide"+b]=function(a,c,e,f,g,h){var i=m.extend({},c),j=i.begin,k=i.complete,l={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},n={};i.display===d&&(i.display="Down"===b?"inline"===t.CSS.Values.getDisplayType(a)?"inline-block":"block":"none"),i.begin=function(){j&&j.call(g,g);for(var c in l){n[c]=a.style[c];var d=t.CSS.getPropertyValue(a,c);l[c]="Down"===b?[d,0]:[0,d]}n.overflow=a.style.overflow,a.style.overflow="hidden"},i.complete=function(){for(var b in n)a.style[b]=n[b];k&&k.call(g,g),h&&h.resolver(g)},t(a,l,i)}}),m.each(["In","Out"],function(a,b){t.Redirects["fade"+b]=function(a,c,e,f,g,h){var i=m.extend({},c),j={opacity:"In"===b?1:0},k=i.complete;i.complete=e!==f-1?i.begin=null:function(){k&&k.call(g,g),h&&h.resolver(g)},i.display===d&&(i.display="In"===b?"auto":"none"),t(this,j,i)}}),t}(window.jQuery||window.Zepto||window,window,document)}),!function(a,b,c,d){"use strict";function e(a,b,c){return setTimeout(k(a,c),b)}function f(a,b,c){return Array.isArray(a)?(g(a,c[b],c),!0):!1}function g(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e<a.length;)b.call(c,a[e],e,a),e++;else for(e in a)a.hasOwnProperty(e)&&b.call(c,a[e],e,a)}function h(a,b,c){for(var e=Object.keys(b),f=0;f<e.length;)(!c||c&&a[e[f]]===d)&&(a[e[f]]=b[e[f]]),f++;return a}function i(a,b){return h(a,b,!0)}function j(a,b,c){var d,e=b.prototype;d=a.prototype=Object.create(e),d.constructor=a,d._super=e,c&&h(d,c)}function k(a,b){return function(){return a.apply(b,arguments)}}function l(a,b){return typeof a==kb?a.apply(b?b[0]||d:d,b):a}function m(a,b){return a===d?b:a}function n(a,b,c){g(r(b),function(b){a.addEventListener(b,c,!1)})}function o(a,b,c){g(r(b),function(b){a.removeEventListener(b,c,!1)})}function p(a,b){for(;a;){if(a==b)return!0;a=a.parentNode}return!1}function q(a,b){return a.indexOf(b)>-1}function r(a){return a.trim().split(/\s+/g)}function s(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;d<a.length;){if(c&&a[d][c]==b||!c&&a[d]===b)return d;d++}return-1}function t(a){return Array.prototype.slice.call(a,0)}function u(a,b,c){for(var d=[],e=[],f=0;f<a.length;){var g=b?a[f][b]:a[f];s(e,g)<0&&d.push(a[f]),e[f]=g,f++}return c&&(d=b?d.sort(function(a,c){return a[b]>c[b]}):d.sort()),d}function v(a,b){for(var c,e,f=b[0].toUpperCase()+b.slice(1),g=0;g<ib.length;){if(c=ib[g],e=c?c+f:b,e in a)return e;g++}return d}function w(){return ob++}function x(a){var b=a.ownerDocument;return b.defaultView||b.parentWindow}function y(a,b){var c=this;this.manager=a,this.callback=b,this.element=a.element,this.target=a.options.inputTarget,this.domHandler=function(b){l(a.options.enable,[a])&&c.handler(b)},this.init()}function z(a){var b,c=a.options.inputClass;return new(b=c?c:rb?N:sb?Q:qb?S:M)(a,A)}function A(a,b,c){var d=c.pointers.length,e=c.changedPointers.length,f=b&yb&&0===d-e,g=b&(Ab|Bb)&&0===d-e;c.isFirst=!!f,c.isFinal=!!g,f&&(a.session={}),c.eventType=b,B(a,c),a.emit("hammer.input",c),a.recognize(c),a.session.prevInput=c}function B(a,b){var c=a.session,d=b.pointers,e=d.length;c.firstInput||(c.firstInput=E(b)),e>1&&!c.firstMultiple?c.firstMultiple=E(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=F(d);b.timeStamp=nb(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=J(h,i),b.distance=I(h,i),C(c,b),b.offsetDirection=H(b.deltaX,b.deltaY),b.scale=g?L(g.pointers,d):1,b.rotation=g?K(g.pointers,d):0,D(c,b);var j=a.element;p(b.srcEvent.target,j)&&(j=b.srcEvent.target),b.target=j}function C(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};(b.eventType===yb||f.eventType===Ab)&&(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function D(a,b){var c,e,f,g,h=a.lastInterval||b,i=b.timeStamp-h.timeStamp;if(b.eventType!=Bb&&(i>xb||h.velocity===d)){var j=h.deltaX-b.deltaX,k=h.deltaY-b.deltaY,l=G(i,j,k);e=l.x,f=l.y,c=mb(l.x)>mb(l.y)?l.x:l.y,g=H(j,k),a.lastInterval=b}else c=h.velocity,e=h.velocityX,f=h.velocityY,g=h.direction;b.velocity=c,b.velocityX=e,b.velocityY=f,b.direction=g}function E(a){for(var b=[],c=0;c<a.pointers.length;)b[c]={clientX:lb(a.pointers[c].clientX),clientY:lb(a.pointers[c].clientY)},c++;return{timeStamp:nb(),pointers:b,center:F(b),deltaX:a.deltaX,deltaY:a.deltaY}}function F(a){var b=a.length;if(1===b)return{x:lb(a[0].clientX),y:lb(a[0].clientY)};for(var c=0,d=0,e=0;b>e;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:lb(c/b),y:lb(d/b)}}function G(a,b,c){return{x:b/a||0,y:c/a||0}}function H(a,b){return a===b?Cb:mb(a)>=mb(b)?a>0?Db:Eb:b>0?Fb:Gb}function I(a,b,c){c||(c=Kb);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function J(a,b,c){c||(c=Kb);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function K(a,b){return J(b[1],b[0],Lb)-J(a[1],a[0],Lb)}function L(a,b){return I(b[0],b[1],Lb)/I(a[0],a[1],Lb)}function M(){this.evEl=Nb,this.evWin=Ob,this.allow=!0,this.pressed=!1,y.apply(this,arguments)}function N(){this.evEl=Rb,this.evWin=Sb,y.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function O(){this.evTarget=Ub,this.evWin=Vb,this.started=!1,y.apply(this,arguments)}function P(a,b){var c=t(a.touches),d=t(a.changedTouches);return b&(Ab|Bb)&&(c=u(c.concat(d),"identifier",!0)),[c,d]}function Q(){this.evTarget=Xb,this.targetIds={},y.apply(this,arguments)}function R(a,b){var c=t(a.touches),d=this.targetIds;if(b&(yb|zb)&&1===c.length)return d[c[0].identifier]=!0,[c,c];var e,f,g=t(a.changedTouches),h=[],i=this.target;if(f=c.filter(function(a){return p(a.target,i)}),b===yb)for(e=0;e<f.length;)d[f[e].identifier]=!0,e++;for(e=0;e<g.length;)d[g[e].identifier]&&h.push(g[e]),b&(Ab|Bb)&&delete d[g[e].identifier],e++;return h.length?[u(f.concat(h),"identifier",!0),h]:void 0}function S(){y.apply(this,arguments);var a=k(this.handler,this);this.touch=new Q(this.manager,a),this.mouse=new M(this.manager,a)}function T(a,b){this.manager=a,this.set(b)}function U(a){if(q(a,bc))return bc;var b=q(a,cc),c=q(a,dc);return b&&c?cc+" "+dc:b||c?b?cc:dc:q(a,ac)?ac:_b}function V(a){this.id=w(),this.manager=null,this.options=i(a||{},this.defaults),this.options.enable=m(this.options.enable,!0),this.state=ec,this.simultaneous={},this.requireFail=[]}function W(a){return a&jc?"cancel":a&hc?"end":a&gc?"move":a&fc?"start":""}function X(a){return a==Gb?"down":a==Fb?"up":a==Db?"left":a==Eb?"right":""}function Y(a,b){var c=b.manager;return c?c.get(a):a}function Z(){V.apply(this,arguments)}function $(){Z.apply(this,arguments),this.pX=null,this.pY=null}function _(){Z.apply(this,arguments)}function ab(){V.apply(this,arguments),this._timer=null,this._input=null}function bb(){Z.apply(this,arguments)}function cb(){Z.apply(this,arguments)}function db(){V.apply(this,arguments),this.pTime=!1,this.pCenter=!1,this._timer=null,this._input=null,this.count=0}function eb(a,b){return b=b||{},b.recognizers=m(b.recognizers,eb.defaults.preset),new fb(a,b)}function fb(a,b){b=b||{},this.options=i(b,eb.defaults),this.options.inputTarget=this.options.inputTarget||a,this.handlers={},this.session={},this.recognizers=[],this.element=a,this.input=z(this),this.touchAction=new T(this,this.options.touchAction),gb(this,!0),g(b.recognizers,function(a){var b=this.add(new a[0](a[1]));a[2]&&b.recognizeWith(a[2]),a[3]&&b.requireFailure(a[3])},this)}function gb(a,b){var c=a.element;g(a.options.cssProps,function(a,d){c.style[v(c.style,d)]=b?a:""})}function hb(a,c){var d=b.createEvent("Event");d.initEvent(a,!0,!0),d.gesture=c,c.target.dispatchEvent(d)}var ib=["","webkit","moz","MS","ms","o"],jb=b.createElement("div"),kb="function",lb=Math.round,mb=Math.abs,nb=Date.now,ob=1,pb=/mobile|tablet|ip(ad|hone|od)|android/i,qb="ontouchstart"in a,rb=v(a,"PointerEvent")!==d,sb=qb&&pb.test(navigator.userAgent),tb="touch",ub="pen",vb="mouse",wb="kinect",xb=25,yb=1,zb=2,Ab=4,Bb=8,Cb=1,Db=2,Eb=4,Fb=8,Gb=16,Hb=Db|Eb,Ib=Fb|Gb,Jb=Hb|Ib,Kb=["x","y"],Lb=["clientX","clientY"];y.prototype={handler:function(){},init:function(){this.evEl&&n(this.element,this.evEl,this.domHandler),this.evTarget&&n(this.target,this.evTarget,this.domHandler),this.evWin&&n(x(this.element),this.evWin,this.domHandler)},destroy:function(){this.evEl&&o(this.element,this.evEl,this.domHandler),this.evTarget&&o(this.target,this.evTarget,this.domHandler),this.evWin&&o(x(this.element),this.evWin,this.domHandler)}};var Mb={mousedown:yb,mousemove:zb,mouseup:Ab},Nb="mousedown",Ob="mousemove mouseup";j(M,y,{handler:function(a){var b=Mb[a.type];b&yb&&0===a.button&&(this.pressed=!0),b&zb&&1!==a.which&&(b=Ab),this.pressed&&this.allow&&(b&Ab&&(this.pressed=!1),this.callback(this.manager,b,{pointers:[a],changedPointers:[a],pointerType:vb,srcEvent:a}))}});var Pb={pointerdown:yb,pointermove:zb,pointerup:Ab,pointercancel:Bb,pointerout:Bb},Qb={2:tb,3:ub,4:vb,5:wb},Rb="pointerdown",Sb="pointermove pointerup pointercancel";a.MSPointerEvent&&(Rb="MSPointerDown",Sb="MSPointerMove MSPointerUp MSPointerCancel"),j(N,y,{handler:function(a){var b=this.store,c=!1,d=a.type.toLowerCase().replace("ms",""),e=Pb[d],f=Qb[a.pointerType]||a.pointerType,g=f==tb,h=s(b,a.pointerId,"pointerId");e&yb&&(0===a.button||g)?0>h&&(b.push(a),h=b.length-1):e&(Ab|Bb)&&(c=!0),0>h||(b[h]=a,this.callback(this.manager,e,{pointers:b,changedPointers:[a],pointerType:f,srcEvent:a}),c&&b.splice(h,1))}});var Tb={touchstart:yb,touchmove:zb,touchend:Ab,touchcancel:Bb},Ub="touchstart",Vb="touchstart touchmove touchend touchcancel";j(O,y,{handler:function(a){var b=Tb[a.type];if(b===yb&&(this.started=!0),this.started){var c=P.call(this,a,b);b&(Ab|Bb)&&0===c[0].length-c[1].length&&(this.started=!1),this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:tb,srcEvent:a})}}});var Wb={touchstart:yb,touchmove:zb,touchend:Ab,touchcancel:Bb},Xb="touchstart touchmove touchend touchcancel";j(Q,y,{handler:function(a){var b=Wb[a.type],c=R.call(this,a,b);c&&this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:tb,srcEvent:a})}}),j(S,y,{handler:function(a,b,c){var d=c.pointerType==tb,e=c.pointerType==vb;if(d)this.mouse.allow=!1;else if(e&&!this.mouse.allow)return;b&(Ab|Bb)&&(this.mouse.allow=!0),this.callback(a,b,c)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Yb=v(jb.style,"touchAction"),Zb=Yb!==d,$b="compute",_b="auto",ac="manipulation",bc="none",cc="pan-x",dc="pan-y";T.prototype={set:function(a){a==$b&&(a=this.compute()),Zb&&(this.manager.element.style[Yb]=a),this.actions=a.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var a=[];return g(this.manager.recognizers,function(b){l(b.options.enable,[b])&&(a=a.concat(b.getTouchAction()))}),U(a.join(" "))},preventDefaults:function(a){if(!Zb){var b=a.srcEvent,c=a.offsetDirection;if(this.manager.session.prevented)return void b.preventDefault();var d=this.actions,e=q(d,bc),f=q(d,dc),g=q(d,cc);return e||f&&c&Hb||g&&c&Ib?this.preventSrc(b):void 0}},preventSrc:function(a){this.manager.session.prevented=!0,a.preventDefault()}};var ec=1,fc=2,gc=4,hc=8,ic=hc,jc=16,kc=32;V.prototype={defaults:{},set:function(a){return h(this.options,a),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(a){if(f(a,"recognizeWith",this))return this;var b=this.simultaneous;return a=Y(a,this),b[a.id]||(b[a.id]=a,a.recognizeWith(this)),this},dropRecognizeWith:function(a){return f(a,"dropRecognizeWith",this)?this:(a=Y(a,this),delete this.simultaneous[a.id],this)},requireFailure:function(a){if(f(a,"requireFailure",this))return this;var b=this.requireFail;return a=Y(a,this),-1===s(b,a)&&(b.push(a),a.requireFailure(this)),this},dropRequireFailure:function(a){if(f(a,"dropRequireFailure",this))return this;a=Y(a,this);var b=s(this.requireFail,a);return b>-1&&this.requireFail.splice(b,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(a){return!!this.simultaneous[a.id]},emit:function(a){function b(b){c.manager.emit(c.options.event+(b?W(d):""),a)}var c=this,d=this.state;hc>d&&b(!0),b(),d>=hc&&b(!0)},tryEmit:function(a){return this.canEmit()?this.emit(a):void(this.state=kc)},canEmit:function(){for(var a=0;a<this.requireFail.length;){if(!(this.requireFail[a].state&(kc|ec)))return!1;a++}return!0},recognize:function(a){var b=h({},a);return l(this.options.enable,[this,b])?(this.state&(ic|jc|kc)&&(this.state=ec),this.state=this.process(b),void(this.state&(fc|gc|hc|jc)&&this.tryEmit(b))):(this.reset(),void(this.state=kc))},process:function(){},getTouchAction:function(){},reset:function(){}},j(Z,V,{defaults:{pointers:1},attrTest:function(a){var b=this.options.pointers;return 0===b||a.pointers.length===b},process:function(a){var b=this.state,c=a.eventType,d=b&(fc|gc),e=this.attrTest(a);return d&&(c&Bb||!e)?b|jc:d||e?c&Ab?b|hc:b&fc?b|gc:fc:kc}}),j($,Z,{defaults:{event:"pan",threshold:10,pointers:1,direction:Jb},getTouchAction:function(){var a=this.options.direction,b=[];return a&Hb&&b.push(dc),a&Ib&&b.push(cc),b},directionTest:function(a){var b=this.options,c=!0,d=a.distance,e=a.direction,f=a.deltaX,g=a.deltaY;return e&b.direction||(b.direction&Hb?(e=0===f?Cb:0>f?Db:Eb,c=f!=this.pX,d=Math.abs(a.deltaX)):(e=0===g?Cb:0>g?Fb:Gb,c=g!=this.pY,d=Math.abs(a.deltaY))),a.direction=e,c&&d>b.threshold&&e&b.direction},attrTest:function(a){return Z.prototype.attrTest.call(this,a)&&(this.state&fc||!(this.state&fc)&&this.directionTest(a))},emit:function(a){this.pX=a.deltaX,this.pY=a.deltaY;var b=X(a.direction);b&&this.manager.emit(this.options.event+b,a),this._super.emit.call(this,a)}}),j(_,Z,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[bc]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.scale-1)>this.options.threshold||this.state&fc)},emit:function(a){if(this._super.emit.call(this,a),1!==a.scale){var b=a.scale<1?"in":"out";this.manager.emit(this.options.event+b,a)}}}),j(ab,V,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[_b]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,f=a.deltaTime>b.time;if(this._input=a,!d||!c||a.eventType&(Ab|Bb)&&!f)this.reset();else if(a.eventType&yb)this.reset(),this._timer=e(function(){this.state=ic,this.tryEmit()},b.time,this);else if(a.eventType&Ab)return ic;return kc},reset:function(){clearTimeout(this._timer)},emit:function(a){this.state===ic&&(a&&a.eventType&Ab?this.manager.emit(this.options.event+"up",a):(this._input.timeStamp=nb(),this.manager.emit(this.options.event,this._input)))}}),j(bb,Z,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[bc]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.rotation)>this.options.threshold||this.state&fc)}}),j(cb,Z,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:Hb|Ib,pointers:1},getTouchAction:function(){return $.prototype.getTouchAction.call(this)},attrTest:function(a){var b,c=this.options.direction;return c&(Hb|Ib)?b=a.velocity:c&Hb?b=a.velocityX:c&Ib&&(b=a.velocityY),this._super.attrTest.call(this,a)&&c&a.direction&&a.distance>this.options.threshold&&mb(b)>this.options.velocity&&a.eventType&Ab},emit:function(a){var b=X(a.direction);b&&this.manager.emit(this.options.event+b,a),this.manager.emit(this.options.event,a)}}),j(db,V,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[ac]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,f=a.deltaTime<b.time;if(this.reset(),a.eventType&yb&&0===this.count)return this.failTimeout();if(d&&f&&c){if(a.eventType!=Ab)return this.failTimeout();var g=this.pTime?a.timeStamp-this.pTime<b.interval:!0,h=!this.pCenter||I(this.pCenter,a.center)<b.posThreshold;this.pTime=a.timeStamp,this.pCenter=a.center,h&&g?this.count+=1:this.count=1,this._input=a;var i=this.count%b.taps;if(0===i)return this.hasRequireFailures()?(this._timer=e(function(){this.state=ic,this.tryEmit()},b.interval,this),fc):ic}return kc},failTimeout:function(){return this._timer=e(function(){this.state=kc},this.options.interval,this),kc},reset:function(){clearTimeout(this._timer)},emit:function(){this.state==ic&&(this._input.tapCount=this.count,this.manager.emit(this.options.event,this._input))}}),eb.VERSION="2.0.4",eb.defaults={domEvents:!1,touchAction:$b,enable:!0,inputTarget:null,inputClass:null,preset:[[bb,{enable:!1}],[_,{enable:!1},["rotate"]],[cb,{direction:Hb}],[$,{direction:Hb},["swipe"]],[db],[db,{event:"doubletap",taps:2},["tap"]],[ab]],cssProps:{userSelect:"default",touchSelect:"none",touchCallout:"none",contentZooming:"none",userDrag:"none",tapHighlightColor:"rgba(0,0,0,0)"}};var lc=1,mc=2;fb.prototype={set:function(a){return h(this.options,a),a.touchAction&&this.touchAction.update(),a.inputTarget&&(this.input.destroy(),this.input.target=a.inputTarget,this.input.init()),this},stop:function(a){this.session.stopped=a?mc:lc},recognize:function(a){var b=this.session;if(!b.stopped){this.touchAction.preventDefaults(a);var c,d=this.recognizers,e=b.curRecognizer;(!e||e&&e.state&ic)&&(e=b.curRecognizer=null);for(var f=0;f<d.length;)c=d[f],b.stopped===mc||e&&c!=e&&!c.canRecognizeWith(e)?c.reset():c.recognize(a),!e&&c.state&(fc|gc|hc)&&(e=b.curRecognizer=c),f++}},get:function(a){if(a instanceof V)return a;for(var b=this.recognizers,c=0;c<b.length;c++)if(b[c].options.event==a)return b[c];return null},add:function(a){if(f(a,"add",this))return this;var b=this.get(a.options.event);return b&&this.remove(b),this.recognizers.push(a),a.manager=this,this.touchAction.update(),a},remove:function(a){if(f(a,"remove",this))return this;var b=this.recognizers;return a=this.get(a),b.splice(s(b,a),1),this.touchAction.update(),this},on:function(a,b){var c=this.handlers;return g(r(a),function(a){c[a]=c[a]||[],c[a].push(b)}),this},off:function(a,b){var c=this.handlers;return g(r(a),function(a){b?c[a].splice(s(c[a],b),1):delete c[a]}),this},emit:function(a,b){this.options.domEvents&&hb(a,b);var c=this.handlers[a]&&this.handlers[a].slice();if(c&&c.length){b.type=a,b.preventDefault=function(){b.srcEvent.preventDefault()};for(var d=0;d<c.length;)c[d](b),d++}},destroy:function(){this.element&&gb(this,!1),this.handlers={},this.session={},this.input.destroy(),this.element=null}},h(eb,{INPUT_START:yb,INPUT_MOVE:zb,INPUT_END:Ab,INPUT_CANCEL:Bb,STATE_POSSIBLE:ec,STATE_BEGAN:fc,STATE_CHANGED:gc,STATE_ENDED:hc,STATE_RECOGNIZED:ic,STATE_CANCELLED:jc,STATE_FAILED:kc,DIRECTION_NONE:Cb,DIRECTION_LEFT:Db,DIRECTION_RIGHT:Eb,DIRECTION_UP:Fb,DIRECTION_DOWN:Gb,DIRECTION_HORIZONTAL:Hb,DIRECTION_VERTICAL:Ib,DIRECTION_ALL:Jb,Manager:fb,Input:y,TouchAction:T,TouchInput:Q,MouseInput:M,PointerEventInput:N,TouchMouseInput:S,SingleTouchInput:O,Recognizer:V,AttrRecognizer:Z,Tap:db,Pan:$,Swipe:cb,Pinch:_,Rotate:bb,Press:ab,on:n,off:o,each:g,merge:i,extend:h,inherit:j,bindFn:k,prefixed:v}),typeof define==kb&&define.amd?define(function(){return eb}):"undefined"!=typeof module&&module.exports?module.exports=eb:a[c]=eb}(window,document,"Hammer"),function(a){"function"==typeof define&&define.amd?define(["jquery","hammerjs"],a):"object"==typeof exports?a(require("jquery"),require("hammerjs")):a(jQuery,Hammer)}(function(a,b){function c(c,d){var e=a(c);e.data("hammer")||e.data("hammer",new b(e[0],d))}a.fn.hammer=function(a){return this.each(function(){c(this,a)})},b.Manager.prototype.emit=function(b){return function(c,d){b.call(this,c,d),a(this.element).trigger({type:c,gesture:d})}}(b.Manager.prototype.emit)}),function(a){a.fn.collapsible=function(b){var c={accordion:void 0};return b=a.extend(c,b),this.each(function(){function c(a){f=e.find(".collapsible-header"),a.parent().toggleClass("active"),a.parent().hasClass("active")?a.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1}):a.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1}),f.not(a).parent().removeClass("active"),f.not(a).parent().children(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1})}function d(a){a.parent().toggleClass("active"),a.parent().hasClass("active")?a.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1}):a.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1})}var e=a(this),f=a(this).find(".collapsible-header"),g=e.data("collapsible");e.off("click.collapse",".collapsible-header"),f.off("click.collapse"),b.accordion||"accordion"==g||void 0==g?(e.on("click.collapse",".collapsible-header",function(b){c(a(b.currentTarget))}),c(f.filter(".active").first())):f.each(function(){a(this).on("click.collapse",function(b){d(a(b.currentTarget))}),a(this).hasClass("active")&&d(a(this))})})},a(document).ready(function(){a(".collapsible").collapsible()})}(jQuery),function(a){a.fn.scrollTo=function(b){return a(this).scrollTop(a(this).scrollTop()-a(this).offset().top+a(b).offset().top),this},a.fn.dropdown=function(b){var c={inDuration:300,outDuration:225,constrain_width:!0,hover:!0,alignment:"left",gutter:0,belowOrigin:!1};b=a.extend(c,b),this.each(function(){function c(){void 0!=g.data("inDuration")&&(b.inDuration=g.data("inDuration")),void 0!=g.data("outDuration")&&(b.outDuration=g.data("outDuration")),void 0!=g.data("constrainwidth")&&(b.constrain_width=g.data("constrainwidth")),void 0!=g.data("hover")&&(b.hover=g.data("hover")),void 0!=g.data("alignment")&&(b.alignment=g.data("alignment")),void 0!=g.data("gutter")&&(b.gutter=g.data("gutter")),void 0!=g.data("beloworigin")&&(b.belowOrigin=g.data("beloworigin"))}function d(){c(),1==b.constrain_width&&h.css("width",g.outerWidth());var d=0;1==b.belowOrigin&&(d=g.height());var f=0,j=b.gutter;"right"==b.alignment&&(f=g.innerWidth()-h.innerWidth(),j=-1*j),h.css(e(g[0])?{display:"block",position:"fixed",height:0,top:g.offset().top-a(window).scrollTop()+d,left:g.offset().left+f+j}:{display:"block",top:g.offset().top+d,left:g.offset().left+f+j,height:0}),h.velocity({opacity:1},{duration:b.inDuration,queue:!1,easing:"easeOutQuad"}).velocity({height:i},{duration:b.inDuration,queue:!1,easing:"easeOutCubic",complete:function(){h.css("overflow-y","auto")}})}function e(b){var c=a(b),d=c.add(c.parents()),e=!1;return d.each(function(){return"fixed"===a(this).css("position")?(e=!0,!1):void 0}),e}function f(){h.velocity({opacity:0},{duration:b.outDuration,easing:"easeOutQuad",complete:function(){h.css({display:"none","overflow-y":""})}})}var g=a(this),h=a("#"+g.attr("data-activates"));c(),h.parent().is(a("body"))||(h.detach(),a("body").append(h));var i=h.height();if(b.hover)g.on("mouseover",function(){d()}),h.on("mouseleave",function(){f()});else{g.unbind("click."+g.attr("id")),g.bind("click."+g.attr("id"),function(b){g[0]==b.currentTarget&&(b.preventDefault(),d()),a(document).bind("click."+h.attr("id"),function(b){!h.is(b.target)&&!g.is(b.target)&&!g.find(b.target).length>0&&(f(),a(document).unbind("click."+h.attr("id")))})})}g.on("open",d),g.on("close",f)})}}(jQuery),function(a){a.fn.extend({openModal:function(b){var c=this,d=a('<div id="lean-overlay"></div>');a("body").append(d);var e={opacity:.5,in_duration:300,out_duration:200,ready:void 0,complete:void 0,dismissible:!0};b=a.extend(e,b),b.dismissible&&(a("#lean-overlay").click(function(){a(c).closeModal(b)}),a(document).keyup(function(d){27===d.keyCode&&(a(c).closeModal(b),a(this).off())})),a(c).find(".modal-close").click(function(d){d.preventDefault(),a(c).closeModal(b)}),a("#lean-overlay").css({display:"block",opacity:0}),a(c).css({display:"block",top:"4%",opacity:0}),a("#lean-overlay").velocity({opacity:b.opacity},{duration:b.in_duration,queue:!1,ease:"easeOutCubic"}),a(c).velocity({top:"10%",opacity:1},{duration:b.in_duration,queue:!1,ease:"easeOutCubic",complete:function(){"function"==typeof b.ready&&b.ready()}})}}),a.fn.extend({closeModal:function(b){var c={out_duration:200,complete:void 0},b=a.extend(c,b);a(".modal-close").off(),a("#lean-overlay").velocity({opacity:0},{duration:b.out_duration,queue:!1,ease:"easeOutQuart"}),a(this).fadeOut(b.out_duration,function(){a(this).css({top:0}),a("#lean-overlay").css({display:"none"}),"function"==typeof b.complete&&b.complete(),a("#lean-overlay").remove()})}}),a.fn.extend({leanModal:function(b){return this.each(function(){a(this).click(function(c){var d=a(this).attr("href");a(d).openModal(b),c.preventDefault()})})}})}(jQuery),function(a){a.fn.materialbox=function(){return this.each(function(){function b(){d=!1;var b=g.parent(".material-placeholder"),e=(window.innerWidth,window.innerHeight,g.data("width")),h=g.data("height");a("#materialbox-overlay").fadeOut(f,function(){c=!1,a(this).remove()}),g.velocity({width:e,height:h,left:0,top:0},{duration:f,queue:!1,easing:"easeOutQuad"}),a(".materialbox-caption").velocity({opacity:0},{duration:f+200,queue:!1,easing:"easeOutQuad",complete:function(){b.css({height:"",width:"",position:"",top:"",left:""}),g.css({height:"",top:"",left:"",width:"","max-width":"",position:"","z-index":""}),g.removeClass("active"),d=!0,a(this).remove()}})}if(!a(this).hasClass("intialized")){a(this).addClass("intialized");var c=!1,d=!0,e=275,f=200,g=a(this),h=a("<div></div>").addClass("material-placeholder");g.wrap(h),g.on("click",function(){var f=g.parent(".material-placeholder"),h=window.innerWidth,i=window.innerHeight,j=g.width(),k=g.height();if(d===!1)return!1;if(c&&d===!0)return b(),!1;d=!1,g.addClass("active"),c=!0,f.css({width:f[0].getBoundingClientRect().width,height:f[0].getBoundingClientRect().height,position:"relative",top:0,left:0}),g.css({position:"absolute","z-index":1e3}).data("width",j).data("height",k);var l=a('<div id="materialbox-overlay"></div>').css({opacity:0}).click(function(){d===!0&&b()});if(a("body").append(l),l.velocity({opacity:1},{duration:e,queue:!1,easing:"easeOutQuad"}),""!==g.data("caption")){var m=a('<div class="materialbox-caption"></div>');m.text(g.data("caption")),a("body").append(m),m.css({display:"inline"}),m.velocity({opacity:1},{duration:e,queue:!1,easing:"easeOutQuad"})}var n=0,o=j/h,p=k/i,q=0,r=0;o>p?(n=k/j,q=.9*h,r=.9*h*n):(n=j/k,q=.9*i*n,r=.9*i),g.hasClass("responsive-img")?g.velocity({"max-width":q,width:j},{duration:0,queue:!1,complete:function(){g.css({left:0,top:0}).velocity({height:r,width:q,left:a(document).scrollLeft()+h/2-g.parent(".material-placeholder").offset().left-q/2,top:a(document).scrollTop()+i/2-g.parent(".material-placeholder").offset().top-r/2},{duration:e,queue:!1,easing:"easeOutQuad",complete:function(){d=!0
|
| 8 |
-
}})}}):g.css("left",0).css("top",0).velocity({height:r,width:q,left:a(document).scrollLeft()+h/2-g.parent(".material-placeholder").offset().left-q/2,top:a(document).scrollTop()+i/2-g.parent(".material-placeholder").offset().top-r/2},{duration:e,queue:!1,easing:"easeOutQuad",complete:function(){d=!0}})}),a(window).scroll(function(){c&&b()}),a(document).keyup(function(a){27===a.keyCode&&d===!0&&c&&b()})}})},a(document).ready(function(){a(".materialboxed").materialbox()})}(jQuery),function(a){a.fn.parallax=function(){var b=a(window).width();return this.each(function(){function c(c){var e;e=992>b?d.height()>0?d.height():d.children("img").height():d.height()>0?d.height():500;var f=d.children("img").height(),g=f-e,h=d.offset().top+e,i=d.offset().top,j=a(window).scrollTop(),k=window.innerHeight,l=j+k,m=(l-i)/(e+k),n=-1*g*m;h>j&&j+k>i&&d.children("img").first().css("bottom",n+"px"),c&&d.children("img").first().css("display","block")}var d=a(this);d.addClass("parallax"),d.find("img").each(function(){a(this).css("background-image","url("+a(this).attr("src")+")"),a(this).attr("src","data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==")}),d.children("img").one("load",function(){c(!0)}).each(function(){this.complete&&a(this).load()}),a(window).scroll(function(){b=a(window).width(),c(!1)}),a(window).resize(function(){b=a(window).width(),c(!1)})})}}(jQuery),function(a){var b={init:function(){return this.each(function(){{var b=a(this);a(window).width()}b.width("100%");var c=a(this).children("li").length;b.children("li").each(function(){a(this).width(100/c+"%")});var d,e,f=b.find("li.tab a"),g=b.width(),h=b.find("li").first().outerWidth(),i=0;d=a(f.filter('[href="'+location.hash+'"]')),0===d.length&&(d=a(this).find("li.tab a.active").first()),0===d.length&&(d=a(this).find("li.tab a").first()),d.addClass("active"),i=f.index(d),0>i&&(i=0),e=a(d[0].hash),b.append('<div class="indicator"></div>');var j=b.find(".indicator");b.is(":visible")&&(j.css({right:g-(i+1)*h}),j.css({left:i*h})),a(window).resize(function(){g=b.width(),h=b.find("li").first().outerWidth(),0>i&&(i=0),0!==h&&0!==g&&(j.css({right:g-(i+1)*h}),j.css({left:i*h}))}),f.not(d).each(function(){a(this.hash).hide()}),b.on("click","a",function(c){g=b.width(),h=b.find("li").first().outerWidth(),d.removeClass("active"),e.hide(),d=a(this),e=a(this.hash),f=b.find("li.tab a"),d.addClass("active");var k=i;i=f.index(a(this)),0>i&&(i=0),e.show(),i-k>=0?(j.velocity({right:g-(i+1)*h},{duration:300,queue:!1,easing:"easeOutQuad"}),j.velocity({left:i*h},{duration:300,queue:!1,easing:"easeOutQuad",delay:90})):(j.velocity({left:i*h},{duration:300,queue:!1,easing:"easeOutQuad"}),j.velocity({right:g-(i+1)*h},{duration:300,queue:!1,easing:"easeOutQuad",delay:90})),c.preventDefault()})})},select_tab:function(a){this.find('a[href="#'+a+'"]').trigger("click")}};a.fn.tabs=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.tooltip"):b.init.apply(this,arguments)},a(document).ready(function(){a("ul.tabs").tabs()})}(jQuery),function(a){a.fn.tooltip=function(b){var c=null,d=!1,e=null,f=5,g={delay:350};return b=a.extend(g,b),a(".material-tooltip").remove(),this.each(function(){var g=a(this),h=a("<span></span>").text(g.attr("data-tooltip")),i=a("<div></div>");i.addClass("material-tooltip").append(h),i.appendTo(a("body"));var j=a("<div></div>").addClass("backdrop");j.appendTo(i),j.css({top:0,left:0}),a(this).off("mouseenter mouseleave"),a(this).on({mouseenter:function(){var a=g.data("delay");a=void 0==a||""==a?b.delay:a,c=0,e=setInterval(function(){if(c+=10,c>=a&&0==d){d=!0,i.css({display:"block",left:"0px",top:"0px"}),i.children("span").text(g.attr("data-tooltip"));var b=g.outerWidth(),e=g.outerHeight(),h=g.attr("data-position"),k=i.outerHeight(),l=i.outerWidth(),m="0px",n="0px",o=8;"top"===h?(i.css({top:g.offset().top-k-f,left:g.offset().left+b/2-l/2}),m="-10px",j.css({borderRadius:"14px 14px 0 0",transformOrigin:"50% 90%",marginTop:k,marginLeft:l/2-j.width()/2})):"left"===h?(i.css({top:g.offset().top+e/2-k/2,left:g.offset().left-l-f}),n="-10px",j.css({width:"14px",height:"14px",borderRadius:"14px 0 0 14px",transformOrigin:"95% 50%",marginTop:k/2,marginLeft:l})):"right"===h?(i.css({top:g.offset().top+e/2-k/2,left:g.offset().left+b+f}),n="+10px",j.css({width:"14px",height:"14px",borderRadius:"0 14px 14px 0",transformOrigin:"5% 50%",marginTop:k/2,marginLeft:"0px"})):(i.css({top:g.offset().top+g.outerHeight()+f,left:g.offset().left+b/2-l/2}),m="+10px",j.css({marginLeft:l/2-j.width()/2})),o=l/8,8>o&&(o=8),("right"===h||"left"===h)&&(o=l/10,6>o&&(o=6)),i.velocity({opacity:1,marginTop:m,marginLeft:n},{duration:350,queue:!1}),j.css({display:"block"}).velocity({opacity:1},{duration:55,delay:0,queue:!1}).velocity({scale:o},{duration:300,delay:0,queue:!1,easing:"easeInOutQuad"})}},10)},mouseleave:function(){clearInterval(e),c=0,i.velocity({opacity:0,marginTop:0,marginLeft:0},{duration:225,queue:!1,delay:275}),j.velocity({opacity:0,scale:1},{duration:225,delay:275,queue:!1,complete:function(){j.css("display","none"),i.css("display","none"),d=!1}})}})})},a(document).ready(function(){a(".tooltipped").tooltip()})}(jQuery),function(a){"use strict";function b(a){return null!==a&&a===a.window}function c(a){return b(a)?a:9===a.nodeType&&a.defaultView}function d(a){var b,d,e={top:0,left:0},f=a&&a.ownerDocument;return b=f.documentElement,"undefined"!=typeof a.getBoundingClientRect&&(e=a.getBoundingClientRect()),d=c(f),{top:e.top+d.pageYOffset-b.clientTop,left:e.left+d.pageXOffset-b.clientLeft}}function e(a){var b="";for(var c in a)a.hasOwnProperty(c)&&(b+=c+":"+a[c]+";");return b}function f(a){if(k.allowEvent(a)===!1)return null;for(var b=null,c=a.target||a.srcElement;null!==c.parentElement;){if(-1!==c.className.indexOf("waves-effect")){b=c;break}c=c.parentElement}return b}function g(b){var c=f(b);null!==c&&(j.show(b,c),"ontouchstart"in a&&(c.addEventListener("touchend",j.hide,!1),c.addEventListener("touchcancel",j.hide,!1)),c.addEventListener("mouseup",j.hide,!1),c.addEventListener("mouseleave",j.hide,!1))}var h=h||{},i=document.querySelectorAll.bind(document),j={duration:750,show:function(a,b){if(2===a.button)return!1;var c=b||this,f=document.createElement("div");f.className="waves-ripple",c.appendChild(f);var g=d(c),h=a.pageY-g.top,i=a.pageX-g.left,k="scale("+c.clientWidth/100*10+")";"touches"in a&&(h=a.touches[0].pageY-g.top,i=a.touches[0].pageX-g.left),f.setAttribute("data-hold",Date.now()),f.setAttribute("data-scale",k),f.setAttribute("data-x",i),f.setAttribute("data-y",h);var l={top:h+"px",left:i+"px"};f.className=f.className+" waves-notransition",f.setAttribute("style",e(l)),f.className=f.className.replace("waves-notransition",""),l["-webkit-transform"]=k,l["-moz-transform"]=k,l["-ms-transform"]=k,l["-o-transform"]=k,l.transform=k,l.opacity="1",l["-webkit-transition-duration"]=j.duration+"ms",l["-moz-transition-duration"]=j.duration+"ms",l["-o-transition-duration"]=j.duration+"ms",l["transition-duration"]=j.duration+"ms",l["-webkit-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["-moz-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["-o-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",f.setAttribute("style",e(l))},hide:function(a){k.touchup(a);var b=this,c=(1.4*b.clientWidth,null),d=b.getElementsByClassName("waves-ripple");if(!(d.length>0))return!1;c=d[d.length-1];var f=c.getAttribute("data-x"),g=c.getAttribute("data-y"),h=c.getAttribute("data-scale"),i=Date.now()-Number(c.getAttribute("data-hold")),l=350-i;0>l&&(l=0),setTimeout(function(){var a={top:g+"px",left:f+"px",opacity:"0","-webkit-transition-duration":j.duration+"ms","-moz-transition-duration":j.duration+"ms","-o-transition-duration":j.duration+"ms","transition-duration":j.duration+"ms","-webkit-transform":h,"-moz-transform":h,"-ms-transform":h,"-o-transform":h,transform:h};c.setAttribute("style",e(a)),setTimeout(function(){try{b.removeChild(c)}catch(a){return!1}},j.duration)},l)},wrapInput:function(a){for(var b=0;b<a.length;b++){var c=a[b];if("input"===c.tagName.toLowerCase()){var d=c.parentNode;if("i"===d.tagName.toLowerCase()&&-1!==d.className.indexOf("waves-effect"))continue;var e=document.createElement("i");e.className=c.className+" waves-input-wrapper";var f=c.getAttribute("style");f||(f=""),e.setAttribute("style",f),c.className="waves-button-input",c.removeAttribute("style"),d.replaceChild(e,c),e.appendChild(c)}}}},k={touches:0,allowEvent:function(a){var b=!0;return"touchstart"===a.type?k.touches+=1:"touchend"===a.type||"touchcancel"===a.type?setTimeout(function(){k.touches>0&&(k.touches-=1)},500):"mousedown"===a.type&&k.touches>0&&(b=!1),b},touchup:function(a){k.allowEvent(a)}};h.displayEffect=function(b){b=b||{},"duration"in b&&(j.duration=b.duration),j.wrapInput(i(".waves-effect")),"ontouchstart"in a&&document.body.addEventListener("touchstart",g,!1),document.body.addEventListener("mousedown",g,!1)},h.attach=function(b){"input"===b.tagName.toLowerCase()&&(j.wrapInput([b]),b=b.parentElement),"ontouchstart"in a&&b.addEventListener("touchstart",g,!1),b.addEventListener("mousedown",g,!1)},a.Waves=h,document.addEventListener("DOMContentLoaded",function(){h.displayEffect()},!1)}(window),function(a){var b={init:function(b){var c={menuWidth:240,edge:"left",closeOnClick:!1};b=a.extend(c,b),a(this).each(function(){function c(){f=!1,g=!1,a("#sidenav-overlay").velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),"left"===b.edge?(a(".drag-target").css({width:"",right:"",left:"0"}),e.velocity({left:-1*(b.menuWidth+10)},{duration:200,queue:!1,easing:"easeOutCubic"})):(a(".drag-target").css({width:"",right:"0",left:""}),e.velocity({right:-1*(b.menuWidth+10)},{duration:200,queue:!1,easing:"easeOutCubic"}))}var d=a(this),e=a("#"+d.attr("data-activates"));240!=b.menuWidth&&(e.css("width",b.menuWidth),e.hasClass("fixed")||e.css("left",-1*(b.menuWidth+10))),"left"!=b.edge&&e.addClass("right-aligned"),a("body").append(a('<div class="drag-target"></div>')),a(".drag-target").css("left"===b.edge?{left:0}:{right:0}),e.hasClass("fixed")&&a(window).resize(function(){a(window).width()>1200&&e.attr("style")&&(e.removeAttr("style"),e.css("width",b.menuWidth)),0!=a("#sidenav-overlay").css("opacity")&&g&&a("#sidenav-overlay").trigger("click")}),1==b.closeOnClick&&e.on("click.itemclick","a:not(.collapsible-header)",function(){c()});var f=!1,g=!1;a(".drag-target").hammer({prevent_default:!1}).bind("tap",function(){a("#sidenav-overlay").trigger("click")}).bind("pan",function(d){if("touch"===d.gesture.pointerType){{var f=(d.gesture.direction,d.gesture.center.x);d.gesture.center.y,d.gesture.velocityX}if(!a("#sidenav-overlay").length){var h=a('<div id="sidenav-overlay"></div>');h.css("opacity",0).click(function(){c()}),a("body").append(h)}if("left"===b.edge?f>b.menuWidth?f=b.menuWidth:0>f&&(f=0):f<a(window).width()-b.menuWidth&&(f=a(window).width()-b.menuWidth),"left"===b.edge?(f<b.menuWidth/2?g=!1:f>=b.menuWidth/2&&(g=!0),e.css("left",f-b.menuWidth)):(f<a(window).width()-b.menuWidth/2?g=!0:f>=a(window).width()-b.menuWidth/2&&(g=!1),e.css("right",-1*(f-b.menuWidth/2))),"left"===b.edge){var i=f/b.menuWidth;a("#sidenav-overlay").velocity({opacity:i},{duration:50,queue:!1,easing:"easeOutQuad"})}else{var i=Math.abs((f-a(window).width())/b.menuWidth);a("#sidenav-overlay").velocity({opacity:i},{duration:50,queue:!1,easing:"easeOutQuad"})}}}).bind("panend",function(c){if("touch"===c.gesture.pointerType){var d=c.gesture.velocityX;f=!1,"left"===b.edge?g&&.3>=d||-.5>d?(e.velocity({left:0},{duration:300,queue:!1,easing:"easeOutQuad"}),a("#sidenav-overlay").velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),a(".drag-target").css({width:"50%",right:0,left:""})):(!g||d>.3)&&(e.velocity({left:-240},{duration:300,queue:!1,easing:"easeOutQuad"}),a("#sidenav-overlay").velocity({opacity:0},{duration:50,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),a(".drag-target").css({width:"10%",right:"",left:0})):g&&d>=-.3||d>.5?(e.velocity({right:0},{duration:300,queue:!1,easing:"easeOutQuad"}),a("#sidenav-overlay").velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),a(".drag-target").css({width:"50%",right:"",left:0})):(!g||-.3>d)&&(e.velocity({right:-240},{duration:300,queue:!1,easing:"easeOutQuad"}),a("#sidenav-overlay").velocity({opacity:0},{duration:50,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),a(".drag-target").css({width:"10%",right:0,left:""}))}}),d.click(function(){if(1==g)g=!1,f=!1,c();else{"left"===b.edge?(a(".drag-target").css({width:"50%",right:0,left:""}),e.velocity({left:0},{duration:300,queue:!1,easing:"easeOutQuad"})):(a(".drag-target").css({width:"50%",right:"",left:0}),e.velocity({right:0},{duration:300,queue:!1,easing:"easeOutQuad"}),e.css("left",""));var d=a('<div id="sidenav-overlay"></div>');d.css("opacity",0).click(function(){g=!1,f=!1,c(),d.animate({opacity:0},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}})}),a("body").append(d),d.animate({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){g=!0,f=!1}})}return!1})})},show:function(){this.trigger("click")},hide:function(){a("#sidenav-overlay").trigger("click")}};a.fn.sideNav=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.tooltip"):b.init.apply(this,arguments)}}(jQuery),function(a){function b(b,c,d,e){var f=a();return a.each(g,function(a,g){if(g.height()>0){var h=g.offset().top,i=g.offset().left,j=i+g.width(),k=h+g.height(),l=!(i>c||e>j||h>d||b>k);l&&f.push(g)}}),f}function c(){++j;var c=f.scrollTop(),d=f.scrollLeft(),e=d+f.width(),g=c+f.height(),i=b(c+k.top+200,e+k.right,g+k.bottom,d+k.left);a.each(i,function(a,b){var c=b.data("scrollSpy:ticks");"number"!=typeof c&&b.triggerHandler("scrollSpy:enter"),b.data("scrollSpy:ticks",j)}),a.each(h,function(a,b){var c=b.data("scrollSpy:ticks");"number"==typeof c&&c!==j&&(b.triggerHandler("scrollSpy:exit"),b.data("scrollSpy:ticks",null))}),h=i}function d(){f.trigger("scrollSpy:winSize")}function e(a,b,c){var d,e,f,g=null,h=0;c||(c={});var i=function(){h=c.leading===!1?0:l(),g=null,f=a.apply(d,e),d=e=null};return function(){var j=l();h||c.leading!==!1||(h=j);var k=b-(j-h);return d=this,e=arguments,0>=k?(clearTimeout(g),g=null,h=j,f=a.apply(d,e),d=e=null):g||c.trailing===!1||(g=setTimeout(i,k)),f}}var f=a(window),g=[],h=[],i=!1,j=0,k={top:0,right:0,bottom:0,left:0},l=Date.now||function(){return(new Date).getTime()};a.scrollSpy=function(b,d){var h=[];b=a(b),b.each(function(b,c){g.push(a(c)),a(c).data("scrollSpy:id",b),a("a[href=#"+a(c).attr("id")+"]").click(function(b){b.preventDefault();var c=a(this.hash).offset().top+1;a(".tabs-wrapper").length?a("html, body").animate({scrollTop:c-60},{duration:400,easing:"easeOutCubic"}):a("html, body").animate({scrollTop:c},{duration:400,easing:"easeOutCubic"})})}),d=d||{throttle:100},k.top=d.offsetTop||0,k.right=d.offsetRight||0,k.bottom=d.offsetBottom||0,k.left=d.offsetLeft||0;var j=e(c,d.throttle||100),l=function(){a(document).ready(j)};return i||(f.on("scroll",l),f.on("resize",l),i=!0),setTimeout(l,0),b.on("scrollSpy:enter",function(){h=a.grep(h,function(a){return 0!=a.height()});var b=a(this);h[0]?(a("a[href=#"+h[0].attr("id")+"]").removeClass("active"),b.data("scrollSpy:id")<h[0].data("scrollSpy:id")?h.unshift(a(this)):h.push(a(this))):h.push(a(this)),a("a[href=#"+h[0].attr("id")+"]").addClass("active")}),b.on("scrollSpy:exit",function(){if(h=a.grep(h,function(a){return 0!=a.height()}),h[0]){a("a[href=#"+h[0].attr("id")+"]").removeClass("active");var b=a(this);h=a.grep(h,function(a){return a.attr("id")!=b.attr("id")}),h[0]&&a("a[href=#"+h[0].attr("id")+"]").addClass("active")}}),b},a.winSizeSpy=function(b){return a.winSizeSpy=function(){return f},b=b||{throttle:100},f.on("resize",e(d,b.throttle||100))},a.fn.scrollSpy=function(b){return a.scrollSpy(a(this),b)}}(jQuery),function(a){a(document).ready(function(){var b="input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea";if(a(document).on("change",b,function(){0!==a(this).val().length&&a(this).siblings("label, i").addClass("active"),validate_field(a(this))}),a(document).ready(function(){a(b).each(function(b,c){a(c).val().length>0&&a(this).siblings("label, i").addClass("active")})}),a(document).on("reset",function(c){a(c.target).is("form")&&(a(this).find(b).removeClass("valid").removeClass("invalid"),a(this).find("select.initialized").each(function(){var b=a(this).find("option[selected]").text();a(this).siblings("input.select-dropdown").val(b)}))}),a(document).on("focus",b,function(){a(this).siblings("label, i").addClass("active")}),a(document).on("blur",b,function(){0===a(this).val().length&&a(this).siblings("label, i").removeClass("active"),validate_field(a(this))}),validate_field=function(a){0===a.val().length?a.hasClass("validate")&&(a.removeClass("valid"),a.removeClass("invalid")):a.hasClass("validate")&&(a.is(":valid")?(a.removeClass("invalid"),a.addClass("valid")):(a.removeClass("valid"),a.addClass("invalid")))},0===a(".hiddendiv").length){var c=a('<div class="hiddendiv common"></div>'),d=null;a("body").append(c)}var e=".materialize-textarea";a(".hiddendiv").css("width",a(e).width()),a(e).each(function(){a(this).val().length&&(d=a(this).val(),d=d.replace(/\n/g,"<br>"),c.html(d+"<br>"),a(this).css("height",c.height()))}),a("body").on("keyup keydown",e,function(){d=a(this).val(),d=d.replace(/\n/g,"<br>"),c.html(d+"<br>"),a(this).css("height",c.height())}),a(".file-field").each(function(){var b=a(this).find("input.file-path");a(this).find('input[type="file"]').change(function(){b.val(a(this).val()),b.trigger("change")})});var f="input[type=range]",g=!1;a(f).each(function(){var b=a('<span class="thumb"><span class="value"></span></span>');a(this).after(b)});var h=".range-field";a(document).on("mousedown",h,function(b){var c=a(this).children(".thumb");c.length<=0&&(c=a('<span class="thumb"><span class="value"></span></span>'),a(this).append(c)),g=!0,a(this).addClass("active"),c.hasClass("active")||c.velocity({height:"30px",width:"30px",top:"-20px",marginLeft:"-15px"},{duration:300,easing:"easeOutExpo"});var d=b.pageX-a(this).offset().left,e=a(this).outerWidth();0>d?d=0:d>e&&(d=e),c.addClass("active").css("left",d),c.find(".value").html(a(this).children("input[type=range]").val())}),a(document).on("mouseup",h,function(){g=!1,a(this).removeClass("active")}),a(document).on("mousemove",h,function(b){var c=a(this).children(".thumb");if(g){c.hasClass("active")||c.velocity({height:"30px",width:"30px",top:"-20px",marginLeft:"-15px"},{duration:300,easing:"easeOutExpo"});var d=b.pageX-a(this).offset().left,e=a(this).outerWidth();0>d?d=0:d>e&&(d=e),c.addClass("active").css("left",d),c.find(".value").html(a(this).children("input[type=range]").val())}}),a(document).on("mouseout",h,function(){if(!g){var b=a(this).children(".thumb");b.hasClass("active")&&b.velocity({height:"0",width:"0",top:"10px",marginLeft:"-6px"},{duration:100}),b.removeClass("active")}}),a.fn.material_select=function(b){a(this).each(function(){if($select=a(this),!$select.hasClass("browser-default")&&!$select.hasClass("initialized")){var c=i(),d=a('<div class="select-wrapper"></div>'),e=a('<ul id="select-options-'+c+'" class="dropdown-content select-dropdown"></ul>'),f=$select.children("option");if(void 0!==$select.find("option:selected"))var g=$select.find("option:selected");else var g=e.first();f.each(function(){e.append(a('<li class="'+(a(this).is(":disabled")?"disabled":"")+'"><span>'+a(this).html()+"</span></li>"))}),e.find("li").each(function(c){var d=$select;a(this).click(function(){a(this).hasClass("disabled")||(d.find("option").eq(c).prop("selected",!0),d.trigger("change"),d.siblings("input.select-dropdown").val(a(this).text()),"undefined"!=typeof b&&b())})}),$select.wrap(d);var h=a('<input type="text" class="select-dropdown" readonly="true" '+($select.is(":disabled")?"disabled":"")+' data-activates="select-options-'+c+'" value="'+g.html()+'"/><i class="mdi-navigation-arrow-drop-down">');$select.before(h),a("body").append(e),$select.is(":disabled")||h.dropdown({hover:!1}),$select.addClass("initialized"),h.on("focus",function(){a(this).trigger("open"),g=a(this).val(),selectedOption=e.find("li").filter(function(){return a(this).text().toLowerCase()===g.toLowerCase()})[0],activateOption(e,selectedOption)}),h.on("blur",function(){a(this).trigger("close")}),activateOption=function(b,c){b.find("li.active").removeClass("active"),a(c).addClass("active"),b.scrollTo(c)},filterQuery=[],onKeyDown=function(b){return 9==b.which?void h.trigger("close"):40!=b.which||e.is(":visible")?void((13!=b.which||e.is(":visible"))&&(b.preventDefault(),letter=String.fromCharCode(b.which).toLowerCase(),letter&&(filterQuery.push(letter),string=filterQuery.join(""),newOption=e.find("li").filter(function(){return 0===a(this).text().toLowerCase().indexOf(string)})[0],newOption&&activateOption(e,newOption)),13==b.which&&(activeOption=e.find("li.active:not(.disabled)")[0],activeOption&&(a(activeOption).trigger("click"),h.trigger("close"))),40==b.which&&(newOption=e.find("li.active").next("li:not(.disabled)")[0],newOption&&activateOption(e,newOption)),27==b.which&&h.trigger("close"),38==b.which&&(newOption=e.find("li.active").prev("li:not(.disabled)")[0],newOption&&activateOption(e,newOption)),setTimeout(function(){filterQuery=[]},1e3))):void h.trigger("open")},h.on("keydown",onKeyDown)}})};var i=function(){function a(){return Math.floor(65536*(1+Math.random())).toString(16).substring(1)}return function(){return a()+a()+"-"+a()+"-"+a()+"-"+a()+"-"+a()+a()+a()}}()})}(jQuery),function(a){a.fn.slider=function(b){var c={indicators:!0,height:400,transition:500,interval:6e4};return b=a.extend(c,b),this.each(function(){function c(a,b){a.hasClass("center-align")?a.velocity({opacity:0,translateY:-100},{duration:b,queue:!1}):a.hasClass("right-align")?a.velocity({opacity:0,translateX:100},{duration:b,queue:!1}):a.hasClass("left-align")&&a.velocity({opacity:0,translateX:-100},{duration:b,queue:!1})}function d(a){a>=h.length?a=0:0>a&&(a=h.length-1),i=g.find(".active").index(),i!=a&&(e=h.eq(i),$caption=e.find(".caption"),e.removeClass("active"),e.velocity({opacity:0},{duration:b.transition,queue:!1,easing:"easeOutQuad",complete:function(){h.not(".active").velocity({opacity:0,translateX:0,translateY:0},{duration:0,queue:!1})}}),c($caption,b.transition),b.indicators&&j.eq(i).removeClass("active"),h.eq(a).velocity({opacity:1},{duration:b.transition,queue:!1,easing:"easeOutQuad"}),h.eq(a).find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:b.transition,delay:b.transition,queue:!1,easing:"easeOutQuad"}),h.eq(a).addClass("active"),b.indicators&&j.eq(a).addClass("active"))}var e,f=a(this),g=f.find("ul.slides").first(),h=g.find("li"),i=g.find(".active").index();if(-1!=i&&(e=h.eq(i)),400!=b.height&&(f.height(b.height+40),g.height(b.height)),h.find(".caption").each(function(){c(a(this),0)}),h.find("img").each(function(){a(this).css("background-image","url("+a(this).attr("src")+")"),a(this).attr("src","data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==")}),b.indicators){var j=a('<ul class="indicators"></ul>');h.each(function(){var c=a('<li class="indicator-item"></li>');c.click(function(){var c=g.parent(),e=c.find(a(this)).index();d(e),clearInterval($interval),$interval=setInterval(function(){i=g.find(".active").index(),h.length==i+1?i=0:i+=1,d(i)},b.transition+b.interval)}),j.append(c)}),f.append(j),j=f.find("ul.indicators").find("li.indicator-item")}e?e.show():(h.first().addClass("active").velocity({opacity:1},{duration:b.transition,queue:!1,easing:"easeOutQuad"}),i=0,e=h.eq(i),b.indicators&&j.eq(i).addClass("active")),e.find("img").each(function(){e.find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:b.transition,queue:!1,easing:"easeOutQuad"})}),$interval=setInterval(function(){i=g.find(".active").index(),d(i+1)},b.transition+b.interval);var k=!1,l=!1,m=!1;f.hammer({prevent_default:!1}).bind("pan",function(a){if("touch"===a.gesture.pointerType){clearInterval($interval);var b=a.gesture.direction,c=a.gesture.deltaX,d=a.gesture.velocityX;$curr_slide=g.find(".active"),$curr_slide.velocity({translateX:c},{duration:50,queue:!1,easing:"easeOutQuad"}),4===b&&(c>f.innerWidth()/2||-.65>d)?m=!0:2===b&&(c<-1*f.innerWidth()/2||d>.65)&&(l=!0);var e;l&&(e=$curr_slide.next(),0===e.length&&(e=h.first()),e.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"})),m&&(e=$curr_slide.prev(),0===e.length&&(e=h.last()),e.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"}))}}).bind("panend",function(a){"touch"===a.gesture.pointerType&&($curr_slide=g.find(".active"),k=!1,curr_index=g.find(".active").index(),m||l?l?(d(curr_index+1),$curr_slide.velocity({translateX:-1*f.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})):m&&(d(curr_index-1),$curr_slide.velocity({translateX:f.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})):$curr_slide.velocity({translateX:0},{duration:300,queue:!1,easing:"easeOutQuad"}),l=!1,m=!1,clearInterval($interval),$interval=setInterval(function(){i=g.find(".active").index(),h.length==i+1?i=0:i+=1,d(i)},b.transition+b.interval))})})}}(jQuery),function(a){a(document).ready(function(){a(document).on("click.card",".card",function(b){a(this).find(".card-reveal").length&&(a(b.target).is(a(".card-reveal .card-title"))||a(b.target).is(a(".card-reveal .card-title i"))?a(this).find(".card-reveal").velocity({translateY:0},{duration:225,queue:!1,easing:"easeInOutQuad"}):(a(b.target).is(a(".card .activator"))||a(b.target).is(a(".card .activator i")))&&a(this).find(".card-reveal").velocity({translateY:"-100%"},{duration:300,queue:!1,easing:"easeInOutQuad"}))})})}(jQuery),function(a){a(document).ready(function(){var b=function(){function a(){return Math.floor(65536*(1+Math.random())).toString(16).substring(1)}return function(){return a()+a()+"-"+a()+"-"+a()+"-"+a()+"-"+a()+a()+a()}}();a.fn.pushpin=function(c){var d={top:0,bottom:1/0,offset:0};return c=a.extend(d,c),$index=0,this.each(function(){function d(a){a.removeClass("pin-top"),a.removeClass("pinned"),a.removeClass("pin-bottom")}function e(b,e){b.each(function(){c.top<=e&&c.bottom>=e&&!a(this).hasClass("pinned")&&(d(a(this)),a(this).css("top",c.offset),a(this).addClass("pinned")),e<c.top&&!a(this).hasClass("pin-top")&&(d(a(this)),a(this).css("top",0),a(this).addClass("pin-top")),e>c.bottom&&!a(this).hasClass("pin-bottom")&&(d(a(this)),a(this).addClass("pin-bottom"),a(this).css("top",c.bottom-h))})}var f=b(),g=a(this),h=a(this).offset().top;e(g,a(window).scrollTop()),a(window).on("scroll."+f,function(){var b=a(window).scrollTop()+c.offset;e(g,b)})})}})}(jQuery),function(a){a(document).ready(function(){a.fn.reverse=[].reverse,a(document).on("mouseenter.fixedActionBtn",".fixed-action-btn",function(){var b=a(this);b.find("ul a.btn-floating").velocity({scaleY:".4",scaleX:".4",translateY:"40px"},{duration:0});var c=0;b.find("ul a.btn-floating").reverse().each(function(){a(this).velocity({opacity:"1",scaleX:"1",scaleY:"1",translateY:"0"},{duration:80,delay:c}),c+=40})}),a(document).on("mouseleave.fixedActionBtn",".fixed-action-btn",function(){var b=a(this);b.find("ul a.btn-floating").velocity("stop",!0),b.find("ul a.btn-floating").velocity({opacity:"0",scaleX:".4",scaleY:".4",translateY:"40px"},{duration:80})})})}(jQuery),function(a){a(document).ready(function(){showStaggeredList=function(b){var c=0;a(b).find("li").velocity({translateX:"-100px"},{duration:0}),a(b).find("li").each(function(){a(this).velocity({opacity:"1",translateX:"0"},{duration:800,delay:c,easing:[60,10]}),c+=120})};var b=[];a("ul.staggered-list").each(function(c){var d="scrollFire-"+c;a(this).addClass(d),b.push({selector:"ul.staggered-list."+d,offset:200,callback:'showStaggeredList("ul.staggered-list.'+d+'")'})}),scrollFire(b);var c=!1,d=!1;a(".dismissable").each(function(){a(this).hammer({prevent_default:!1}).bind("pan",function(b){if("touch"===b.gesture.pointerType){var e=a(this),f=b.gesture.direction,g=b.gesture.deltaX,h=b.gesture.velocityX;e.velocity({translateX:g},{duration:50,queue:!1,easing:"easeOutQuad"}),4===f&&(g>e.innerWidth()/2||-.75>h)?c=!0:2===f&&(g<-1*e.innerWidth()/2||h>.75)&&(d=!0)}}).bind("panend",function(b){if("touch"===b.gesture.pointerType){var e=a(this);if(c||d){var f;f=c?e.innerWidth():-1*e.innerWidth(),e.velocity({translateX:f},{duration:100,queue:!1,easing:"easeOutQuad",complete:function(){e.css("border","none"),e.velocity({height:0,padding:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){e.remove()}})}})}else e.velocity({translateX:0},{duration:100,queue:!1,easing:"easeOutQuad"});c=!1,d=!1}})}),fadeInImage=function(b){var c=a(b);c.css({opacity:0}),a(c).velocity({opacity:1},{duration:650,queue:!1,easing:"easeOutSine"}),a(c).animate({opacity:1},{duration:1300,queue:!1,easing:"swing",step:function(b,c){c.start=100;var d=b/100,e=150-(100-b)/1.75;100>e&&(e=100),b>=0&&a(this).css({"-webkit-filter":"grayscale("+d+")brightness("+e+"%)",filter:"grayscale("+d+")brightness("+e+"%)"})}})}})}(jQuery),function(a){scrollFire=function(b){a(window).scroll(function(){var c=a(window).scrollTop()+a(window).height();a.each(b,function(b,d){var e=d.selector,f=d.offset,g=d.callback,h=a(e).offset().top;if(c>h+f&&1!=d.done){var i=new Function(g);i(),d.done=!0}})})}}(jQuery),function(a){"function"==typeof define&&define.amd?define("picker",["jquery"],a):"object"==typeof exports?module.exports=a(require("jquery")):this.Picker=a(jQuery)}(function(a){function b(f,g,i,l){function m(){return b._.node("div",b._.node("div",b._.node("div",b._.node("div",y.component.nodes(t.open),v.box),v.wrap),v.frame),v.holder)}function n(){w.data(g,y).addClass(v.input).attr("tabindex",-1).val(w.data("value")?y.get("select",u.format):f.value),u.editable||w.on("focus."+t.id+" click."+t.id,function(a){a.preventDefault(),y.$root[0].focus()}).on("keydown."+t.id,q),e(f,{haspopup:!0,expanded:!1,readonly:!1,owns:f.id+"_root"})}function o(){y.$root.on({keydown:q,focusin:function(a){y.$root.removeClass(v.focused),a.stopPropagation()},"mousedown click":function(b){var c=b.target;c!=y.$root.children()[0]&&(b.stopPropagation(),"mousedown"!=b.type||a(c).is("input, select, textarea, button, option")||(b.preventDefault(),y.$root[0].focus()))}}).on({focus:function(){w.addClass(v.target)},blur:function(){w.removeClass(v.target)}}).on("focus.toOpen",r).on("click","[data-pick], [data-nav], [data-clear], [data-close]",function(){var b=a(this),c=b.data(),d=b.hasClass(v.navDisabled)||b.hasClass(v.disabled),e=h();e=e&&(e.type||e.href),(d||e&&!a.contains(y.$root[0],e))&&y.$root[0].focus(),!d&&c.nav?y.set("highlight",y.component.item.highlight,{nav:c.nav}):!d&&"pick"in c?y.set("select",c.pick):c.clear?y.clear().close(!0):c.close&&y.close(!0)}),e(y.$root[0],"hidden",!0)}function p(){var b;u.hiddenName===!0?(b=f.name,f.name=""):(b=["string"==typeof u.hiddenPrefix?u.hiddenPrefix:"","string"==typeof u.hiddenSuffix?u.hiddenSuffix:"_submit"],b=b[0]+f.name+b[1]),y._hidden=a('<input type=hidden name="'+b+'"'+(w.data("value")||f.value?' value="'+y.get("select",u.formatSubmit)+'"':"")+">")[0],w.on("change."+t.id,function(){y._hidden.value=f.value?y.get("select",u.formatSubmit):""}),u.container?a(u.container).append(y._hidden):w.after(y._hidden)}function q(a){var b=a.keyCode,c=/^(8|46)$/.test(b);return 27==b?(y.close(),!1):void((32==b||c||!t.open&&y.component.key[b])&&(a.preventDefault(),a.stopPropagation(),c?y.clear().close():y.open()))
|
| 9 |
-
}function r(a){a.stopPropagation(),"focus"==a.type&&y.$root.addClass(v.focused),y.open()}if(!f)return b;var s=!1,t={id:f.id||"P"+Math.abs(~~(Math.random()*new Date))},u=i?a.extend(!0,{},i.defaults,l):l||{},v=a.extend({},b.klasses(),u.klass),w=a(f),x=function(){return this.start()},y=x.prototype={constructor:x,$node:w,start:function(){return t&&t.start?y:(t.methods={},t.start=!0,t.open=!1,t.type=f.type,f.autofocus=f==h(),f.readOnly=!u.editable,f.id=f.id||t.id,"text"!=f.type&&(f.type="text"),y.component=new i(y,u),y.$root=a(b._.node("div",m(),v.picker,'id="'+f.id+'_root" tabindex="0"')),o(),u.formatSubmit&&p(),n(),u.container?a(u.container).append(y.$root):w.after(y.$root),y.on({start:y.component.onStart,render:y.component.onRender,stop:y.component.onStop,open:y.component.onOpen,close:y.component.onClose,set:y.component.onSet}).on({start:u.onStart,render:u.onRender,stop:u.onStop,open:u.onOpen,close:u.onClose,set:u.onSet}),s=c(y.$root.children()[0]),f.autofocus&&y.open(),y.trigger("start").trigger("render"))},render:function(a){return a?y.$root.html(m()):y.$root.find("."+v.box).html(y.component.nodes(t.open)),y.trigger("render")},stop:function(){return t.start?(y.close(),y._hidden&&y._hidden.parentNode.removeChild(y._hidden),y.$root.remove(),w.removeClass(v.input).removeData(g),setTimeout(function(){w.off("."+t.id)},0),f.type=t.type,f.readOnly=!1,y.trigger("stop"),t.methods={},t.start=!1,y):y},open:function(c){return t.open?y:(w.addClass(v.active),e(f,"expanded",!0),setTimeout(function(){y.$root.addClass(v.opened),e(y.$root[0],"hidden",!1)},0),c!==!1&&(t.open=!0,s&&k.css("overflow","hidden").css("padding-right","+="+d()),y.$root[0].focus(),j.on("click."+t.id+" focusin."+t.id,function(a){var b=a.target;b!=f&&b!=document&&3!=a.which&&y.close(b===y.$root.children()[0])}).on("keydown."+t.id,function(c){var d=c.keyCode,e=y.component.key[d],f=c.target;27==d?y.close(!0):f!=y.$root[0]||!e&&13!=d?a.contains(y.$root[0],f)&&13==d&&(c.preventDefault(),f.click()):(c.preventDefault(),e?b._.trigger(y.component.key.go,y,[b._.trigger(e)]):y.$root.find("."+v.highlighted).hasClass(v.disabled)||y.set("select",y.component.item.highlight).close())})),y.trigger("open"))},close:function(a){return a&&(y.$root.off("focus.toOpen")[0].focus(),setTimeout(function(){y.$root.on("focus.toOpen",r)},0)),w.removeClass(v.active),e(f,"expanded",!1),setTimeout(function(){y.$root.removeClass(v.opened+" "+v.focused),e(y.$root[0],"hidden",!0)},0),t.open?(t.open=!1,s&&k.css("overflow","").css("padding-right","-="+d()),j.off("."+t.id),y.trigger("close")):y},clear:function(a){return y.set("clear",null,a)},set:function(b,c,d){var e,f,g=a.isPlainObject(b),h=g?b:{};if(d=g&&a.isPlainObject(c)?c:d||{},b){g||(h[b]=c);for(e in h)f=h[e],e in y.component.item&&(void 0===f&&(f=null),y.component.set(e,f,d)),("select"==e||"clear"==e)&&w.val("clear"==e?"":y.get(e,u.format)).trigger("change");y.render()}return d.muted?y:y.trigger("set",h)},get:function(a,c){if(a=a||"value",null!=t[a])return t[a];if("valueSubmit"==a){if(y._hidden)return y._hidden.value;a="value"}if("value"==a)return f.value;if(a in y.component.item){if("string"==typeof c){var d=y.component.get(a);return d?b._.trigger(y.component.formats.toString,y.component,[c,d]):""}return y.component.get(a)}},on:function(b,c,d){var e,f,g=a.isPlainObject(b),h=g?b:{};if(b){g||(h[b]=c);for(e in h)f=h[e],d&&(e="_"+e),t.methods[e]=t.methods[e]||[],t.methods[e].push(f)}return y},off:function(){var a,b,c=arguments;for(a=0,namesCount=c.length;a<namesCount;a+=1)b=c[a],b in t.methods&&delete t.methods[b];return y},trigger:function(a,c){var d=function(a){var d=t.methods[a];d&&d.map(function(a){b._.trigger(a,y,[c])})};return d("_"+a),d(a),y}};return new x}function c(a){var b,c="position";return a.currentStyle?b=a.currentStyle[c]:window.getComputedStyle&&(b=getComputedStyle(a)[c]),"fixed"==b}function d(){if(k.height()<=i.height())return 0;var b=a('<div style="visibility:hidden;width:100px" />').appendTo("body"),c=b[0].offsetWidth;b.css("overflow","scroll");var d=a('<div style="width:100%" />').appendTo(b),e=d[0].offsetWidth;return b.remove(),c-e}function e(b,c,d){if(a.isPlainObject(c))for(var e in c)f(b,e,c[e]);else f(b,c,d)}function f(a,b,c){a.setAttribute(("role"==b?"":"aria-")+b,c)}function g(b,c){a.isPlainObject(b)||(b={attribute:c}),c="";for(var d in b){var e=("role"==d?"":"aria-")+d,f=b[d];c+=null==f?"":e+'="'+b[d]+'"'}return c}function h(){try{return document.activeElement}catch(a){}}var i=a(window),j=a(document),k=a(document.documentElement);return b.klasses=function(a){return a=a||"picker",{picker:a,opened:a+"--opened",focused:a+"--focused",input:a+"__input",active:a+"__input--active",target:a+"__input--target",holder:a+"__holder",frame:a+"__frame",wrap:a+"__wrap",box:a+"__box"}},b._={group:function(a){for(var c,d="",e=b._.trigger(a.min,a);e<=b._.trigger(a.max,a,[e]);e+=a.i)c=b._.trigger(a.item,a,[e]),d+=b._.node(a.node,c[0],c[1],c[2]);return d},node:function(b,c,d,e){return c?(c=a.isArray(c)?c.join(""):c,d=d?' class="'+d+'"':"",e=e?" "+e:"","<"+b+d+e+">"+c+"</"+b+">"):""},lead:function(a){return(10>a?"0":"")+a},trigger:function(a,b,c){return"function"==typeof a?a.apply(b,c||[]):a},digits:function(a){return/\d/.test(a[1])?2:1},isDate:function(a){return{}.toString.call(a).indexOf("Date")>-1&&this.isInteger(a.getDate())},isInteger:function(a){return{}.toString.call(a).indexOf("Number")>-1&&a%1===0},ariaAttr:g},b.extend=function(c,d){a.fn[c]=function(e,f){var g=this.data(c);return"picker"==e?g:g&&"string"==typeof e?b._.trigger(g[e],g,[f]):this.each(function(){var f=a(this);f.data(c)||new b(this,c,d,e)})},a.fn[c].defaults=d.defaults},b}),function(a){"function"==typeof define&&define.amd?define(["picker","jquery"],a):"object"==typeof exports?module.exports=a(require("./picker.js"),require("jquery")):a(Picker,jQuery)}(function(a,b){function c(a,b){var c=this,d=a.$node[0],e=d.value,f=a.$node.data("value"),g=f||e,h=f?b.formatSubmit:b.format,i=function(){return d.currentStyle?"rtl"==d.currentStyle.direction:"rtl"==getComputedStyle(a.$root[0]).direction};c.settings=b,c.$node=a.$node,c.queue={min:"measure create",max:"measure create",now:"now create",select:"parse create validate",highlight:"parse navigate create validate",view:"parse create validate viewset",disable:"deactivate",enable:"activate"},c.item={},c.item.clear=null,c.item.disable=(b.disable||[]).slice(0),c.item.enable=-function(a){return a[0]===!0?a.shift():-1}(c.item.disable),c.set("min",b.min).set("max",b.max).set("now"),g?c.set("select",g,{format:h}):c.set("select",null).set("highlight",c.item.now),c.key={40:7,38:-7,39:function(){return i()?-1:1},37:function(){return i()?1:-1},go:function(a){var b=c.item.highlight,d=new Date(b.year,b.month,b.date+a);c.set("highlight",d,{interval:a}),this.render()}},a.on("render",function(){a.$root.find("."+b.klass.selectMonth).on("change",function(){var c=this.value;c&&(a.set("highlight",[a.get("view").year,c,a.get("highlight").date]),a.$root.find("."+b.klass.selectMonth).trigger("focus"))}),a.$root.find("."+b.klass.selectYear).on("change",function(){var c=this.value;c&&(a.set("highlight",[c,a.get("view").month,a.get("highlight").date]),a.$root.find("."+b.klass.selectYear).trigger("focus"))})},1).on("open",function(){var d="";c.disabled(c.get("now"))&&(d=":not(."+b.klass.buttonToday+")"),a.$root.find("button"+d+", select").attr("disabled",!1)},1).on("close",function(){a.$root.find("button, select").attr("disabled",!0)},1)}var d=7,e=6,f=a._;c.prototype.set=function(a,b,c){var d=this,e=d.item;return null===b?("clear"==a&&(a="select"),e[a]=b,d):(e["enable"==a?"disable":"flip"==a?"enable":a]=d.queue[a].split(" ").map(function(e){return b=d[e](a,b,c)}).pop(),"select"==a?d.set("highlight",e.select,c):"highlight"==a?d.set("view",e.highlight,c):a.match(/^(flip|min|max|disable|enable)$/)&&(e.select&&d.disabled(e.select)&&d.set("select",e.select,c),e.highlight&&d.disabled(e.highlight)&&d.set("highlight",e.highlight,c)),d)},c.prototype.get=function(a){return this.item[a]},c.prototype.create=function(a,c,d){var e,g=this;return c=void 0===c?a:c,c==-1/0||1/0==c?e=c:b.isPlainObject(c)&&f.isInteger(c.pick)?c=c.obj:b.isArray(c)?(c=new Date(c[0],c[1],c[2]),c=f.isDate(c)?c:g.create().obj):c=f.isInteger(c)||f.isDate(c)?g.normalize(new Date(c),d):g.now(a,c,d),{year:e||c.getFullYear(),month:e||c.getMonth(),date:e||c.getDate(),day:e||c.getDay(),obj:e||c,pick:e||c.getTime()}},c.prototype.createRange=function(a,c){var d=this,e=function(a){return a===!0||b.isArray(a)||f.isDate(a)?d.create(a):a};return f.isInteger(a)||(a=e(a)),f.isInteger(c)||(c=e(c)),f.isInteger(a)&&b.isPlainObject(c)?a=[c.year,c.month,c.date+a]:f.isInteger(c)&&b.isPlainObject(a)&&(c=[a.year,a.month,a.date+c]),{from:e(a),to:e(c)}},c.prototype.withinRange=function(a,b){return a=this.createRange(a.from,a.to),b.pick>=a.from.pick&&b.pick<=a.to.pick},c.prototype.overlapRanges=function(a,b){var c=this;return a=c.createRange(a.from,a.to),b=c.createRange(b.from,b.to),c.withinRange(a,b.from)||c.withinRange(a,b.to)||c.withinRange(b,a.from)||c.withinRange(b,a.to)},c.prototype.now=function(a,b,c){return b=new Date,c&&c.rel&&b.setDate(b.getDate()+c.rel),this.normalize(b,c)},c.prototype.navigate=function(a,c,d){var e,f,g,h,i=b.isArray(c),j=b.isPlainObject(c),k=this.item.view;if(i||j){for(j?(f=c.year,g=c.month,h=c.date):(f=+c[0],g=+c[1],h=+c[2]),d&&d.nav&&k&&k.month!==g&&(f=k.year,g=k.month),e=new Date(f,g+(d&&d.nav?d.nav:0),1),f=e.getFullYear(),g=e.getMonth();new Date(f,g,h).getMonth()!==g;)h-=1;c=[f,g,h]}return c},c.prototype.normalize=function(a){return a.setHours(0,0,0,0),a},c.prototype.measure=function(a,b){var c=this;return b?"string"==typeof b?b=c.parse(a,b):f.isInteger(b)&&(b=c.now(a,b,{rel:b})):b="min"==a?-1/0:1/0,b},c.prototype.viewset=function(a,b){return this.create([b.year,b.month,1])},c.prototype.validate=function(a,c,d){var e,g,h,i,j=this,k=c,l=d&&d.interval?d.interval:1,m=-1===j.item.enable,n=j.item.min,o=j.item.max,p=m&&j.item.disable.filter(function(a){if(b.isArray(a)){var d=j.create(a).pick;d<c.pick?e=!0:d>c.pick&&(g=!0)}return f.isInteger(a)}).length;if((!d||!d.nav)&&(!m&&j.disabled(c)||m&&j.disabled(c)&&(p||e||g)||!m&&(c.pick<=n.pick||c.pick>=o.pick)))for(m&&!p&&(!g&&l>0||!e&&0>l)&&(l*=-1);j.disabled(c)&&(Math.abs(l)>1&&(c.month<k.month||c.month>k.month)&&(c=k,l=l>0?1:-1),c.pick<=n.pick?(h=!0,l=1,c=j.create([n.year,n.month,n.date+(c.pick===n.pick?0:-1)])):c.pick>=o.pick&&(i=!0,l=-1,c=j.create([o.year,o.month,o.date+(c.pick===o.pick?0:1)])),!h||!i);)c=j.create([c.year,c.month,c.date+l]);return c},c.prototype.disabled=function(a){var c=this,d=c.item.disable.filter(function(d){return f.isInteger(d)?a.day===(c.settings.firstDay?d:d-1)%7:b.isArray(d)||f.isDate(d)?a.pick===c.create(d).pick:b.isPlainObject(d)?c.withinRange(d,a):void 0});return d=d.length&&!d.filter(function(a){return b.isArray(a)&&"inverted"==a[3]||b.isPlainObject(a)&&a.inverted}).length,-1===c.item.enable?!d:d||a.pick<c.item.min.pick||a.pick>c.item.max.pick},c.prototype.parse=function(a,b,c){var d=this,e={};return b&&"string"==typeof b?(c&&c.format||(c=c||{},c.format=d.settings.format),d.formats.toArray(c.format).map(function(a){var c=d.formats[a],g=c?f.trigger(c,d,[b,e]):a.replace(/^!/,"").length;c&&(e[a]=b.substr(0,g)),b=b.substr(g)}),[e.yyyy||e.yy,+(e.mm||e.m)-1,e.dd||e.d]):b},c.prototype.formats=function(){function a(a,b,c){var d=a.match(/\w+/)[0];return c.mm||c.m||(c.m=b.indexOf(d)+1),d.length}function b(a){return a.match(/\w+/)[0].length}return{d:function(a,b){return a?f.digits(a):b.date},dd:function(a,b){return a?2:f.lead(b.date)},ddd:function(a,c){return a?b(a):this.settings.weekdaysShort[c.day]},dddd:function(a,c){return a?b(a):this.settings.weekdaysFull[c.day]},m:function(a,b){return a?f.digits(a):b.month+1},mm:function(a,b){return a?2:f.lead(b.month+1)},mmm:function(b,c){var d=this.settings.monthsShort;return b?a(b,d,c):d[c.month]},mmmm:function(b,c){var d=this.settings.monthsFull;return b?a(b,d,c):d[c.month]},yy:function(a,b){return a?2:(""+b.year).slice(2)},yyyy:function(a,b){return a?4:b.year},toArray:function(a){return a.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)},toString:function(a,b){var c=this;return c.formats.toArray(a).map(function(a){return f.trigger(c.formats[a],c,[0,b])||a.replace(/^!/,"")}).join("")}}}(),c.prototype.isDateExact=function(a,c){var d=this;return f.isInteger(a)&&f.isInteger(c)||"boolean"==typeof a&&"boolean"==typeof c?a===c:(f.isDate(a)||b.isArray(a))&&(f.isDate(c)||b.isArray(c))?d.create(a).pick===d.create(c).pick:b.isPlainObject(a)&&b.isPlainObject(c)?d.isDateExact(a.from,c.from)&&d.isDateExact(a.to,c.to):!1},c.prototype.isDateOverlap=function(a,c){var d=this,e=d.settings.firstDay?1:0;return f.isInteger(a)&&(f.isDate(c)||b.isArray(c))?(a=a%7+e,a===d.create(c).day+1):f.isInteger(c)&&(f.isDate(a)||b.isArray(a))?(c=c%7+e,c===d.create(a).day+1):b.isPlainObject(a)&&b.isPlainObject(c)?d.overlapRanges(a,c):!1},c.prototype.flipEnable=function(a){var b=this.item;b.enable=a||(-1==b.enable?1:-1)},c.prototype.deactivate=function(a,c){var d=this,e=d.item.disable.slice(0);return"flip"==c?d.flipEnable():c===!1?(d.flipEnable(1),e=[]):c===!0?(d.flipEnable(-1),e=[]):c.map(function(a){for(var c,g=0;g<e.length;g+=1)if(d.isDateExact(a,e[g])){c=!0;break}c||(f.isInteger(a)||f.isDate(a)||b.isArray(a)||b.isPlainObject(a)&&a.from&&a.to)&&e.push(a)}),e},c.prototype.activate=function(a,c){var d=this,e=d.item.disable,g=e.length;return"flip"==c?d.flipEnable():c===!0?(d.flipEnable(1),e=[]):c===!1?(d.flipEnable(-1),e=[]):c.map(function(a){var c,h,i,j;for(i=0;g>i;i+=1){if(h=e[i],d.isDateExact(h,a)){c=e[i]=null,j=!0;break}if(d.isDateOverlap(h,a)){b.isPlainObject(a)?(a.inverted=!0,c=a):b.isArray(a)?(c=a,c[3]||c.push("inverted")):f.isDate(a)&&(c=[a.getFullYear(),a.getMonth(),a.getDate(),"inverted"]);break}}if(c)for(i=0;g>i;i+=1)if(d.isDateExact(e[i],a)){e[i]=null;break}if(j)for(i=0;g>i;i+=1)if(d.isDateOverlap(e[i],a)){e[i]=null;break}c&&e.push(c)}),e.filter(function(a){return null!=a})},c.prototype.nodes=function(a){var b=this,c=b.settings,g=b.item,h=g.now,i=g.select,j=g.highlight,k=g.view,l=g.disable,m=g.min,n=g.max,o=function(a,b){return c.firstDay&&(a.push(a.shift()),b.push(b.shift())),f.node("thead",f.node("tr",f.group({min:0,max:d-1,i:1,node:"th",item:function(d){return[a[d],c.klass.weekdays,'scope=col title="'+b[d]+'"']}})))}((c.showWeekdaysFull?c.weekdaysFull:c.weekdaysLetter).slice(0),c.weekdaysFull.slice(0)),p=function(a){return f.node("div"," ",c.klass["nav"+(a?"Next":"Prev")]+(a&&k.year>=n.year&&k.month>=n.month||!a&&k.year<=m.year&&k.month<=m.month?" "+c.klass.navDisabled:""),"data-nav="+(a||-1)+" "+f.ariaAttr({role:"button",controls:b.$node[0].id+"_table"})+' title="'+(a?c.labelMonthNext:c.labelMonthPrev)+'"')},q=function(d){var e=c.showMonthsShort?c.monthsShort:c.monthsFull;return"short_months"==d&&(e=c.monthsShort),c.selectMonths&&void 0==d?f.node("select",f.group({min:0,max:11,i:1,node:"option",item:function(a){return[e[a],0,"value="+a+(k.month==a?" selected":"")+(k.year==m.year&&a<m.month||k.year==n.year&&a>n.month?" disabled":"")]}}),c.klass.selectMonth+" browser-default",(a?"":"disabled")+" "+f.ariaAttr({controls:b.$node[0].id+"_table"})+' title="'+c.labelMonthSelect+'"'):"short_months"==d?null!=i?f.node("div",e[i.month]):f.node("div",e[k.month]):f.node("div",e[k.month],c.klass.month)},r=function(d){var e=k.year,g=c.selectYears===!0?5:~~(c.selectYears/2);if(g){var h=m.year,i=n.year,j=e-g,l=e+g;if(h>j&&(l+=h-j,j=h),l>i){var o=j-h,p=l-i;j-=o>p?p:o,l=i}if(c.selectYears&&void 0==d)return f.node("select",f.group({min:j,max:l,i:1,node:"option",item:function(a){return[a,0,"value="+a+(e==a?" selected":"")]}}),c.klass.selectYear+" browser-default",(a?"":"disabled")+" "+f.ariaAttr({controls:b.$node[0].id+"_table"})+' title="'+c.labelYearSelect+'"')}return"raw"==d?f.node("div",e):f.node("div",e,c.klass.year)};return createDayLabel=function(){return null!=i?f.node("div",i.date):f.node("div",h.date)},createWeekdayLabel=function(){var a;a=null!=i?i.day:h.day;var b=c.weekdaysFull[a];return b},f.node("div",f.node("div",createWeekdayLabel(),"picker__weekday-display")+f.node("div",q("short_months"),c.klass.month_display)+f.node("div",createDayLabel(),c.klass.day_display)+f.node("div",r("raw"),c.klass.year_display),c.klass.date_display)+f.node("div",f.node("div",(c.selectYears?q()+r():q()+r())+p()+p(1),c.klass.header)+f.node("table",o+f.node("tbody",f.group({min:0,max:e-1,i:1,node:"tr",item:function(a){var e=c.firstDay&&0===b.create([k.year,k.month,1]).day?-7:0;return[f.group({min:d*a-k.day+e+1,max:function(){return this.min+d-1},i:1,node:"td",item:function(a){a=b.create([k.year,k.month,a+(c.firstDay?1:0)]);var d=i&&i.pick==a.pick,e=j&&j.pick==a.pick,g=l&&b.disabled(a)||a.pick<m.pick||a.pick>n.pick,o=f.trigger(b.formats.toString,b,[c.format,a]);return[f.node("div",a.date,function(b){return b.push(k.month==a.month?c.klass.infocus:c.klass.outfocus),h.pick==a.pick&&b.push(c.klass.now),d&&b.push(c.klass.selected),e&&b.push(c.klass.highlighted),g&&b.push(c.klass.disabled),b.join(" ")}([c.klass.day]),"data-pick="+a.pick+" "+f.ariaAttr({role:"gridcell",label:o,selected:d&&b.$node.val()===o?!0:null,activedescendant:e?!0:null,disabled:g?!0:null})),"",f.ariaAttr({role:"presentation"})]}})]}})),c.klass.table,'id="'+b.$node[0].id+'_table" '+f.ariaAttr({role:"grid",controls:b.$node[0].id,readonly:!0})),c.klass.calendar_container)+f.node("div",f.node("button",c.today,"btn-flat picker__today","type=button data-pick="+h.pick+(a&&!b.disabled(h)?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id}))+f.node("button",c.clear,"btn-flat picker__clear","type=button data-clear=1"+(a?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id}))+f.node("button",c.close,"btn-flat picker__close","type=button data-close=true "+(a?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id})),c.klass.footer)},c.defaults=function(a){return{labelMonthNext:"Next month",labelMonthPrev:"Previous month",labelMonthSelect:"Select a month",labelYearSelect:"Select a year",monthsFull:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],weekdaysFull:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],weekdaysShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],weekdaysLetter:["S","M","T","W","T","F","S"],today:"Today",clear:"Clear",close:"Close",format:"d mmmm, yyyy",klass:{table:a+"table",header:a+"header",date_display:a+"date-display",day_display:a+"day-display",month_display:a+"month-display",year_display:a+"year-display",calendar_container:a+"calendar-container",navPrev:a+"nav--prev",navNext:a+"nav--next",navDisabled:a+"nav--disabled",month:a+"month",year:a+"year",selectMonth:a+"select--month",selectYear:a+"select--year",weekdays:a+"weekday",day:a+"day",disabled:a+"day--disabled",selected:a+"day--selected",highlighted:a+"day--highlighted",now:a+"day--today",infocus:a+"day--infocus",outfocus:a+"day--outfocus",footer:a+"footer",buttonClear:a+"button--clear",buttonToday:a+"button--today",buttonClose:a+"button--close"}}}(a.klasses().picker+"__"),a.extend("pickadate",c)});
|
| 1 |
+
/*!
|
| 2 |
+
* Materialize v0.100.2 (http://materializecss.com)
|
| 3 |
+
* Copyright 2014-2017 Materialize
|
| 4 |
+
* MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
|
| 5 |
+
*/
|
| 6 |
+
function _classCallCheck(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}var _createClass=function(){function t(t,e){for(var i=0;i<e.length;i++){var n=e[i];n.enumerable=n.enumerable||!1,n.configurable=!0,"value"in n&&(n.writable=!0),Object.defineProperty(t,n.key,n)}}return function(e,i,n){return i&&t(e.prototype,i),n&&t(e,n),e}}();"undefined"==typeof jQuery&&("function"==typeof require?jQuery=$=require("jquery"):jQuery=$),function(t){"function"==typeof define&&define.amd?define(["jquery"],function(e){return t(e)}):"object"==typeof module&&"object"==typeof module.exports?exports=t(require("jquery")):t(jQuery)}(function(t){function e(t){var e=7.5625,i=2.75;return t<1/i?e*t*t:t<2/i?e*(t-=1.5/i)*t+.75:t<2.5/i?e*(t-=2.25/i)*t+.9375:e*(t-=2.625/i)*t+.984375}t.easing.jswing=t.easing.swing;var i=Math.pow,n=Math.sqrt,o=Math.sin,a=Math.cos,r=Math.PI,s=1.70158,l=1.525*s,c=2*r/3,u=2*r/4.5;t.extend(t.easing,{def:"easeOutQuad",swing:function(e){return t.easing[t.easing.def](e)},easeInQuad:function(t){return t*t},easeOutQuad:function(t){return 1-(1-t)*(1-t)},easeInOutQuad:function(t){return t<.5?2*t*t:1-i(-2*t+2,2)/2},easeInCubic:function(t){return t*t*t},easeOutCubic:function(t){return 1-i(1-t,3)},easeInOutCubic:function(t){return t<.5?4*t*t*t:1-i(-2*t+2,3)/2},easeInQuart:function(t){return t*t*t*t},easeOutQuart:function(t){return 1-i(1-t,4)},easeInOutQuart:function(t){return t<.5?8*t*t*t*t:1-i(-2*t+2,4)/2},easeInQuint:function(t){return t*t*t*t*t},easeOutQuint:function(t){return 1-i(1-t,5)},easeInOutQuint:function(t){return t<.5?16*t*t*t*t*t:1-i(-2*t+2,5)/2},easeInSine:function(t){return 1-a(t*r/2)},easeOutSine:function(t){return o(t*r/2)},easeInOutSine:function(t){return-(a(r*t)-1)/2},easeInExpo:function(t){return 0===t?0:i(2,10*t-10)},easeOutExpo:function(t){return 1===t?1:1-i(2,-10*t)},easeInOutExpo:function(t){return 0===t?0:1===t?1:t<.5?i(2,20*t-10)/2:(2-i(2,-20*t+10))/2},easeInCirc:function(t){return 1-n(1-i(t,2))},easeOutCirc:function(t){return n(1-i(t-1,2))},easeInOutCirc:function(t){return t<.5?(1-n(1-i(2*t,2)))/2:(n(1-i(-2*t+2,2))+1)/2},easeInElastic:function(t){return 0===t?0:1===t?1:-i(2,10*t-10)*o((10*t-10.75)*c)},easeOutElastic:function(t){return 0===t?0:1===t?1:i(2,-10*t)*o((10*t-.75)*c)+1},easeInOutElastic:function(t){return 0===t?0:1===t?1:t<.5?-i(2,20*t-10)*o((20*t-11.125)*u)/2:i(2,-20*t+10)*o((20*t-11.125)*u)/2+1},easeInBack:function(t){return 2.70158*t*t*t-s*t*t},easeOutBack:function(t){return 1+2.70158*i(t-1,3)+s*i(t-1,2)},easeInOutBack:function(t){return t<.5?i(2*t,2)*(7.189819*t-l)/2:(i(2*t-2,2)*((l+1)*(2*t-2)+l)+2)/2},easeInBounce:function(t){return 1-e(1-t)},easeOutBounce:e,easeInOutBounce:function(t){return t<.5?(1-e(1-2*t))/2:(1+e(2*t-1))/2}})}),jQuery.extend(jQuery.easing,{easeInOutMaterial:function(t,e,i,n,o){return(e/=o/2)<1?n/2*e*e+i:n/4*((e-=2)*e*e+2)+i}}),jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(function(t){function e(t){var e=t.length,n=i.type(t);return"function"!==n&&!i.isWindow(t)&&(!(1!==t.nodeType||!e)||("array"===n||0===e||"number"==typeof e&&e>0&&e-1 in t))}if(!t.jQuery){var i=function(t,e){return new i.fn.init(t,e)};i.isWindow=function(t){return null!=t&&t==t.window},i.type=function(t){return null==t?t+"":"object"==typeof t||"function"==typeof t?o[r.call(t)]||"object":typeof t},i.isArray=Array.isArray||function(t){return"array"===i.type(t)},i.isPlainObject=function(t){var e;if(!t||"object"!==i.type(t)||t.nodeType||i.isWindow(t))return!1;try{if(t.constructor&&!a.call(t,"constructor")&&!a.call(t.constructor.prototype,"isPrototypeOf"))return!1}catch(t){return!1}for(e in t);return void 0===e||a.call(t,e)},i.each=function(t,i,n){var o=0,a=t.length,r=e(t);if(n){if(r)for(;a>o&&!1!==i.apply(t[o],n);o++);else for(o in t)if(!1===i.apply(t[o],n))break}else if(r)for(;a>o&&!1!==i.call(t[o],o,t[o]);o++);else for(o in t)if(!1===i.call(t[o],o,t[o]))break;return t},i.data=function(t,e,o){if(void 0===o){var a=(r=t[i.expando])&&n[r];if(void 0===e)return a;if(a&&e in a)return a[e]}else if(void 0!==e){var r=t[i.expando]||(t[i.expando]=++i.uuid);return n[r]=n[r]||{},n[r][e]=o,o}},i.removeData=function(t,e){var o=t[i.expando],a=o&&n[o];a&&i.each(e,function(t,e){delete a[e]})},i.extend=function(){var t,e,n,o,a,r,s=arguments[0]||{},l=1,c=arguments.length,u=!1;for("boolean"==typeof s&&(u=s,s=arguments[l]||{},l++),"object"!=typeof s&&"function"!==i.type(s)&&(s={}),l===c&&(s=this,l--);c>l;l++)if(null!=(a=arguments[l]))for(o in a)t=s[o],s!==(n=a[o])&&(u&&n&&(i.isPlainObject(n)||(e=i.isArray(n)))?(e?(e=!1,r=t&&i.isArray(t)?t:[]):r=t&&i.isPlainObject(t)?t:{},s[o]=i.extend(u,r,n)):void 0!==n&&(s[o]=n));return s},i.queue=function(t,n,o){if(t){n=(n||"fx")+"queue";var a=i.data(t,n);return o?(!a||i.isArray(o)?a=i.data(t,n,function(t,i){var n=i||[];return null!=t&&(e(Object(t))?function(t,e){for(var i=+e.length,n=0,o=t.length;i>n;)t[o++]=e[n++];if(i!==i)for(;void 0!==e[n];)t[o++]=e[n++];t.length=o}(n,"string"==typeof t?[t]:t):[].push.call(n,t)),n}(o)):a.push(o),a):a||[]}},i.dequeue=function(t,e){i.each(t.nodeType?[t]:t,function(t,n){e=e||"fx";var o=i.queue(n,e),a=o.shift();"inprogress"===a&&(a=o.shift()),a&&("fx"===e&&o.unshift("inprogress"),a.call(n,function(){i.dequeue(n,e)}))})},i.fn=i.prototype={init:function(t){if(t.nodeType)return this[0]=t,this;throw new Error("Not a DOM node.")},offset:function(){var e=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:e.top+(t.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:e.left+(t.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function t(){for(var t=this.offsetParent||document;t&&"html"===!t.nodeType.toLowerCase&&"static"===t.style.position;)t=t.offsetParent;return t||document}var e=this[0],t=t.apply(e),n=this.offset(),o=/^(?:body|html)$/i.test(t.nodeName)?{top:0,left:0}:i(t).offset();return n.top-=parseFloat(e.style.marginTop)||0,n.left-=parseFloat(e.style.marginLeft)||0,t.style&&(o.top+=parseFloat(t.style.borderTopWidth)||0,o.left+=parseFloat(t.style.borderLeftWidth)||0),{top:n.top-o.top,left:n.left-o.left}}};var n={};i.expando="velocity"+(new Date).getTime(),i.uuid=0;for(var o={},a=o.hasOwnProperty,r=o.toString,s="Boolean Number String Function Array Date RegExp Object Error".split(" "),l=0;l<s.length;l++)o["[object "+s[l]+"]"]=s[l].toLowerCase();i.fn.init.prototype=i.fn,t.Velocity={Utilities:i}}}(window),function(t){"object"==typeof module&&"object"==typeof module.exports?module.exports=t():"function"==typeof define&&define.amd?define(t):t()}(function(){return function(t,e,i,n){function o(t){for(var e=-1,i=t?t.length:0,n=[];++e<i;){var o=t[e];o&&n.push(o)}return n}function a(t){return v.isWrapped(t)?t=[].slice.call(t):v.isNode(t)&&(t=[t]),t}function r(t){var e=p.data(t,"velocity");return null===e?n:e}function s(t){return function(e){return Math.round(e*t)*(1/t)}}function l(t,i,n,o){function a(t,e){return 1-3*e+3*t}function r(t,e){return 3*e-6*t}function s(t){return 3*t}function l(t,e,i){return((a(e,i)*t+r(e,i))*t+s(e))*t}function c(t,e,i){return 3*a(e,i)*t*t+2*r(e,i)*t+s(e)}function u(e,i){for(var o=0;v>o;++o){var a=c(i,t,n);if(0===a)return i;i-=(l(i,t,n)-e)/a}return i}function d(){for(var e=0;b>e;++e)C[e]=l(e*w,t,n)}function p(e,i,o){var a,r,s=0;do{(a=l(r=i+(o-i)/2,t,n)-e)>0?o=r:i=r}while(Math.abs(a)>g&&++s<y);return r}function h(e){for(var i=0,o=1,a=b-1;o!=a&&C[o]<=e;++o)i+=w;var r=i+(e-C[--o])/(C[o+1]-C[o])*w,s=c(r,t,n);return s>=m?u(e,r):0==s?r:p(e,i,i+w)}function f(){T=!0,(t!=i||n!=o)&&d()}var v=4,m=.001,g=1e-7,y=10,b=11,w=1/(b-1),k="Float32Array"in e;if(4!==arguments.length)return!1;for(var x=0;4>x;++x)if("number"!=typeof arguments[x]||isNaN(arguments[x])||!isFinite(arguments[x]))return!1;t=Math.min(t,1),n=Math.min(n,1),t=Math.max(t,0),n=Math.max(n,0);var C=k?new Float32Array(b):new Array(b),T=!1,S=function(e){return T||f(),t===i&&n===o?e:0===e?0:1===e?1:l(h(e),i,o)};S.getControlPoints=function(){return[{x:t,y:i},{x:n,y:o}]};var P="generateBezier("+[t,i,n,o]+")";return S.toString=function(){return P},S}function c(t,e){var i=t;return v.isString(t)?b.Easings[t]||(i=!1):i=v.isArray(t)&&1===t.length?s.apply(null,t):v.isArray(t)&&2===t.length?w.apply(null,t.concat([e])):!(!v.isArray(t)||4!==t.length)&&l.apply(null,t),!1===i&&(i=b.Easings[b.defaults.easing]?b.defaults.easing:y),i}function u(t){if(t){var e=(new Date).getTime(),i=b.State.calls.length;i>1e4&&(b.State.calls=o(b.State.calls));for(var a=0;i>a;a++)if(b.State.calls[a]){var s=b.State.calls[a],l=s[0],c=s[2],h=s[3],f=!!h,m=null;h||(h=b.State.calls[a][3]=e-16);for(var g=Math.min((e-h)/c.duration,1),y=0,w=l.length;w>y;y++){var x=l[y],T=x.element;if(r(T)){var S=!1;if(c.display!==n&&null!==c.display&&"none"!==c.display){if("flex"===c.display){var P=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];p.each(P,function(t,e){k.setPropertyValue(T,"display",e)})}k.setPropertyValue(T,"display",c.display)}c.visibility!==n&&"hidden"!==c.visibility&&k.setPropertyValue(T,"visibility",c.visibility);for(var A in x)if("element"!==A){var O,E=x[A],_=v.isString(E.easing)?b.Easings[E.easing]:E.easing;if(1===g)O=E.endValue;else{var M=E.endValue-E.startValue;if(O=E.startValue+M*_(g,c,M),!f&&O===E.currentValue)continue}if(E.currentValue=O,"tween"===A)m=O;else{if(k.Hooks.registered[A]){var I=k.Hooks.getRoot(A),D=r(T).rootPropertyValueCache[I];D&&(E.rootPropertyValue=D)}var q=k.setPropertyValue(T,A,E.currentValue+(0===parseFloat(O)?"":E.unitType),E.rootPropertyValue,E.scrollData);k.Hooks.registered[A]&&(r(T).rootPropertyValueCache[I]=k.Normalizations.registered[I]?k.Normalizations.registered[I]("extract",null,q[1]):q[1]),"transform"===q[0]&&(S=!0)}}c.mobileHA&&r(T).transformCache.translate3d===n&&(r(T).transformCache.translate3d="(0px, 0px, 0px)",S=!0),S&&k.flushTransformCache(T)}}c.display!==n&&"none"!==c.display&&(b.State.calls[a][2].display=!1),c.visibility!==n&&"hidden"!==c.visibility&&(b.State.calls[a][2].visibility=!1),c.progress&&c.progress.call(s[1],s[1],g,Math.max(0,h+c.duration-e),h,m),1===g&&d(a)}}b.State.isTicking&&C(u)}function d(t,e){if(!b.State.calls[t])return!1;for(var i=b.State.calls[t][0],o=b.State.calls[t][1],a=b.State.calls[t][2],s=b.State.calls[t][4],l=!1,c=0,u=i.length;u>c;c++){var d=i[c].element;if(e||a.loop||("none"===a.display&&k.setPropertyValue(d,"display",a.display),"hidden"===a.visibility&&k.setPropertyValue(d,"visibility",a.visibility)),!0!==a.loop&&(p.queue(d)[1]===n||!/\.velocityQueueEntryFlag/i.test(p.queue(d)[1]))&&r(d)){r(d).isAnimating=!1,r(d).rootPropertyValueCache={};var h=!1;p.each(k.Lists.transforms3D,function(t,e){var i=/^scale/.test(e)?1:0,o=r(d).transformCache[e];r(d).transformCache[e]!==n&&new RegExp("^\\("+i+"[^.]").test(o)&&(h=!0,delete r(d).transformCache[e])}),a.mobileHA&&(h=!0,delete r(d).transformCache.translate3d),h&&k.flushTransformCache(d),k.Values.removeClass(d,"velocity-animating")}if(!e&&a.complete&&!a.loop&&c===u-1)try{a.complete.call(o,o)}catch(t){setTimeout(function(){throw t},1)}s&&!0!==a.loop&&s(o),r(d)&&!0===a.loop&&!e&&(p.each(r(d).tweensContainer,function(t,e){/^rotate/.test(t)&&360===parseFloat(e.endValue)&&(e.endValue=0,e.startValue=360),/^backgroundPosition/.test(t)&&100===parseFloat(e.endValue)&&"%"===e.unitType&&(e.endValue=0,e.startValue=100)}),b(d,"reverse",{loop:!0,delay:a.delay})),!1!==a.queue&&p.dequeue(d,a.queue)}b.State.calls[t]=!1;for(var f=0,v=b.State.calls.length;v>f;f++)if(!1!==b.State.calls[f]){l=!0;break}!1===l&&(b.State.isTicking=!1,delete b.State.calls,b.State.calls=[])}var p,h=function(){if(i.documentMode)return i.documentMode;for(var t=7;t>4;t--){var e=i.createElement("div");if(e.innerHTML="\x3c!--[if IE "+t+"]><span></span><![endif]--\x3e",e.getElementsByTagName("span").length)return e=null,t}return n}(),f=function(){var t=0;return e.webkitRequestAnimationFrame||e.mozRequestAnimationFrame||function(e){var i,n=(new Date).getTime();return i=Math.max(0,16-(n-t)),t=n+i,setTimeout(function(){e(n+i)},i)}}(),v={isString:function(t){return"string"==typeof t},isArray:Array.isArray||function(t){return"[object Array]"===Object.prototype.toString.call(t)},isFunction:function(t){return"[object Function]"===Object.prototype.toString.call(t)},isNode:function(t){return t&&t.nodeType},isNodeList:function(t){return"object"==typeof t&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(t))&&t.length!==n&&(0===t.length||"object"==typeof t[0]&&t[0].nodeType>0)},isWrapped:function(t){return t&&(t.jquery||e.Zepto&&e.Zepto.zepto.isZ(t))},isSVG:function(t){return e.SVGElement&&t instanceof e.SVGElement},isEmptyObject:function(t){for(var e in t)return!1;return!0}},m=!1;if(t.fn&&t.fn.jquery?(p=t,m=!0):p=e.Velocity.Utilities,8>=h&&!m)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");{if(!(7>=h)){var g=400,y="swing",b={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:e.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:i.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:p,Redirects:{},Easings:{},Promise:e.Promise,defaults:{queue:"",duration:g,easing:y,begin:n,complete:n,progress:n,display:n,visibility:n,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(t){p.data(t,"velocity",{isSVG:v.isSVG(t),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};e.pageYOffset!==n?(b.State.scrollAnchor=e,b.State.scrollPropertyLeft="pageXOffset",b.State.scrollPropertyTop="pageYOffset"):(b.State.scrollAnchor=i.documentElement||i.body.parentNode||i.body,b.State.scrollPropertyLeft="scrollLeft",b.State.scrollPropertyTop="scrollTop");var w=function(){function t(t){return-t.tension*t.x-t.friction*t.v}function e(e,i,n){var o={x:e.x+n.dx*i,v:e.v+n.dv*i,tension:e.tension,friction:e.friction};return{dx:o.v,dv:t(o)}}function i(i,n){var o={dx:i.v,dv:t(i)},a=e(i,.5*n,o),r=e(i,.5*n,a),s=e(i,n,r),l=1/6*(o.dx+2*(a.dx+r.dx)+s.dx),c=1/6*(o.dv+2*(a.dv+r.dv)+s.dv);return i.x=i.x+l*n,i.v=i.v+c*n,i}return function t(e,n,o){var a,r,s,l={x:-1,v:0,tension:null,friction:null},c=[0],u=0;for(e=parseFloat(e)||500,n=parseFloat(n)||20,o=o||null,l.tension=e,l.friction=n,(a=null!==o)?(u=t(e,n),r=u/o*.016):r=.016;s=i(s||l,r),c.push(1+s.x),u+=16,Math.abs(s.x)>1e-4&&Math.abs(s.v)>1e-4;);return a?function(t){return c[t*(c.length-1)|0]}:u}}();b.Easings={linear:function(t){return t},swing:function(t){return.5-Math.cos(t*Math.PI)/2},spring:function(t){return 1-Math.cos(4.5*t*Math.PI)*Math.exp(6*-t)}},p.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(t,e){b.Easings[e[0]]=l.apply(null,e[1])});var k=b.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(a=0;a<k.Lists.colors.length;a++){var t="color"===k.Lists.colors[a]?"0 0 0 1":"255 255 255 1";k.Hooks.templates[k.Lists.colors[a]]=["Red Green Blue Alpha",t]}var e,i,n;if(h)for(e in k.Hooks.templates){n=(i=k.Hooks.templates[e])[0].split(" ");var o=i[1].match(k.RegEx.valueSplit);"Color"===n[0]&&(n.push(n.shift()),o.push(o.shift()),k.Hooks.templates[e]=[n.join(" "),o.join(" ")])}for(e in k.Hooks.templates){n=(i=k.Hooks.templates[e])[0].split(" ");for(var a in n){var r=e+n[a],s=a;k.Hooks.registered[r]=[e,s]}}},getRoot:function(t){var e=k.Hooks.registered[t];return e?e[0]:t},cleanRootPropertyValue:function(t,e){return k.RegEx.valueUnwrap.test(e)&&(e=e.match(k.RegEx.valueUnwrap)[1]),k.Values.isCSSNullValue(e)&&(e=k.Hooks.templates[t][1]),e},extractValue:function(t,e){var i=k.Hooks.registered[t];if(i){var n=i[0],o=i[1];return(e=k.Hooks.cleanRootPropertyValue(n,e)).toString().match(k.RegEx.valueSplit)[o]}return e},injectValue:function(t,e,i){var n=k.Hooks.registered[t];if(n){var o,a=n[0],r=n[1];return i=k.Hooks.cleanRootPropertyValue(a,i),o=i.toString().match(k.RegEx.valueSplit),o[r]=e,o.join(" ")}return i}},Normalizations:{registered:{clip:function(t,e,i){switch(t){case"name":return"clip";case"extract":var n;return k.RegEx.wrappedValueAlreadyExtracted.test(i)?n=i:(n=i.toString().match(k.RegEx.valueUnwrap),n=n?n[1].replace(/,(\s+)?/g," "):i),n;case"inject":return"rect("+i+")"}},blur:function(t,e,i){switch(t){case"name":return b.State.isFirefox?"filter":"-webkit-filter";case"extract":var n=parseFloat(i);if(!n&&0!==n){var o=i.toString().match(/blur\(([0-9]+[A-z]+)\)/i);n=o?o[1]:0}return n;case"inject":return parseFloat(i)?"blur("+i+")":"none"}},opacity:function(t,e,i){if(8>=h)switch(t){case"name":return"filter";case"extract":var n=i.toString().match(/alpha\(opacity=(.*)\)/i);return i=n?n[1]/100:1;case"inject":return e.style.zoom=1,parseFloat(i)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(i),10)+")"}else switch(t){case"name":return"opacity";case"extract":case"inject":return i}}},register:function(){9>=h||b.State.isGingerbread||(k.Lists.transformsBase=k.Lists.transformsBase.concat(k.Lists.transforms3D));for(t=0;t<k.Lists.transformsBase.length;t++)!function(){var e=k.Lists.transformsBase[t];k.Normalizations.registered[e]=function(t,i,o){switch(t){case"name":return"transform";case"extract":return r(i)===n||r(i).transformCache[e]===n?/^scale/i.test(e)?1:0:r(i).transformCache[e].replace(/[()]/g,"");case"inject":var a=!1;switch(e.substr(0,e.length-1)){case"translate":a=!/(%|px|em|rem|vw|vh|\d)$/i.test(o);break;case"scal":case"scale":b.State.isAndroid&&r(i).transformCache[e]===n&&1>o&&(o=1),a=!/(\d)$/i.test(o);break;case"skew":a=!/(deg|\d)$/i.test(o);break;case"rotate":a=!/(deg|\d)$/i.test(o)}return a||(r(i).transformCache[e]="("+o+")"),r(i).transformCache[e]}}}();for(var t=0;t<k.Lists.colors.length;t++)!function(){var e=k.Lists.colors[t];k.Normalizations.registered[e]=function(t,i,o){switch(t){case"name":return e;case"extract":var a;if(k.RegEx.wrappedValueAlreadyExtracted.test(o))a=o;else{var r,s={black:"rgb(0, 0, 0)",blue:"rgb(0, 0, 255)",gray:"rgb(128, 128, 128)",green:"rgb(0, 128, 0)",red:"rgb(255, 0, 0)",white:"rgb(255, 255, 255)"};/^[A-z]+$/i.test(o)?r=s[o]!==n?s[o]:s.black:k.RegEx.isHex.test(o)?r="rgb("+k.Values.hexToRgb(o).join(" ")+")":/^rgba?\(/i.test(o)||(r=s.black),a=(r||o).toString().match(k.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g," ")}return 8>=h||3!==a.split(" ").length||(a+=" 1"),a;case"inject":return 8>=h?4===o.split(" ").length&&(o=o.split(/\s+/).slice(0,3).join(" ")):3===o.split(" ").length&&(o+=" 1"),(8>=h?"rgb":"rgba")+"("+o.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(t){return t.replace(/-(\w)/g,function(t,e){return e.toUpperCase()})},SVGAttribute:function(t){var e="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(h||b.State.isAndroid&&!b.State.isChrome)&&(e+="|transform"),new RegExp("^("+e+")$","i").test(t)},prefixCheck:function(t){if(b.State.prefixMatches[t])return[b.State.prefixMatches[t],!0];for(var e=["","Webkit","Moz","ms","O"],i=0,n=e.length;n>i;i++){var o;if(o=0===i?t:e[i]+t.replace(/^\w/,function(t){return t.toUpperCase()}),v.isString(b.State.prefixElement.style[o]))return b.State.prefixMatches[t]=o,[o,!0]}return[t,!1]}},Values:{hexToRgb:function(t){var e,i=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,n=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return t=t.replace(i,function(t,e,i,n){return e+e+i+i+n+n}),e=n.exec(t),e?[parseInt(e[1],16),parseInt(e[2],16),parseInt(e[3],16)]:[0,0,0]},isCSSNullValue:function(t){return 0==t||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(t)},getUnitType:function(t){return/^(rotate|skew)/i.test(t)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(t)?"":"px"},getDisplayType:function(t){var e=t&&t.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(e)?"inline":/^(li)$/i.test(e)?"list-item":/^(tr)$/i.test(e)?"table-row":/^(table)$/i.test(e)?"table":/^(tbody)$/i.test(e)?"table-row-group":"block"},addClass:function(t,e){t.classList?t.classList.add(e):t.className+=(t.className.length?" ":"")+e},removeClass:function(t,e){t.classList?t.classList.remove(e):t.className=t.className.toString().replace(new RegExp("(^|\\s)"+e.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(t,i,o,a){function s(t,i){function o(){c&&k.setPropertyValue(t,"display","none")}var l=0;if(8>=h)l=p.css(t,i);else{var c=!1;if(/^(width|height)$/.test(i)&&0===k.getPropertyValue(t,"display")&&(c=!0,k.setPropertyValue(t,"display",k.Values.getDisplayType(t))),!a){if("height"===i&&"border-box"!==k.getPropertyValue(t,"boxSizing").toString().toLowerCase()){var u=t.offsetHeight-(parseFloat(k.getPropertyValue(t,"borderTopWidth"))||0)-(parseFloat(k.getPropertyValue(t,"borderBottomWidth"))||0)-(parseFloat(k.getPropertyValue(t,"paddingTop"))||0)-(parseFloat(k.getPropertyValue(t,"paddingBottom"))||0);return o(),u}if("width"===i&&"border-box"!==k.getPropertyValue(t,"boxSizing").toString().toLowerCase()){var d=t.offsetWidth-(parseFloat(k.getPropertyValue(t,"borderLeftWidth"))||0)-(parseFloat(k.getPropertyValue(t,"borderRightWidth"))||0)-(parseFloat(k.getPropertyValue(t,"paddingLeft"))||0)-(parseFloat(k.getPropertyValue(t,"paddingRight"))||0);return o(),d}}var f;f=r(t)===n?e.getComputedStyle(t,null):r(t).computedStyle?r(t).computedStyle:r(t).computedStyle=e.getComputedStyle(t,null),"borderColor"===i&&(i="borderTopColor"),(""===(l=9===h&&"filter"===i?f.getPropertyValue(i):f[i])||null===l)&&(l=t.style[i]),o()}if("auto"===l&&/^(top|right|bottom|left)$/i.test(i)){var v=s(t,"position");("fixed"===v||"absolute"===v&&/top|left/i.test(i))&&(l=p(t).position()[i]+"px")}return l}var l;if(k.Hooks.registered[i]){var c=i,u=k.Hooks.getRoot(c);o===n&&(o=k.getPropertyValue(t,k.Names.prefixCheck(u)[0])),k.Normalizations.registered[u]&&(o=k.Normalizations.registered[u]("extract",t,o)),l=k.Hooks.extractValue(c,o)}else if(k.Normalizations.registered[i]){var d,f;"transform"!==(d=k.Normalizations.registered[i]("name",t))&&(f=s(t,k.Names.prefixCheck(d)[0]),k.Values.isCSSNullValue(f)&&k.Hooks.templates[i]&&(f=k.Hooks.templates[i][1])),l=k.Normalizations.registered[i]("extract",t,f)}if(!/^[\d-]/.test(l))if(r(t)&&r(t).isSVG&&k.Names.SVGAttribute(i))if(/^(height|width)$/i.test(i))try{l=t.getBBox()[i]}catch(t){l=0}else l=t.getAttribute(i);else l=s(t,k.Names.prefixCheck(i)[0]);return k.Values.isCSSNullValue(l)&&(l=0),b.debug>=2&&console.log("Get "+i+": "+l),l},setPropertyValue:function(t,i,n,o,a){var s=i;if("scroll"===i)a.container?a.container["scroll"+a.direction]=n:"Left"===a.direction?e.scrollTo(n,a.alternateValue):e.scrollTo(a.alternateValue,n);else if(k.Normalizations.registered[i]&&"transform"===k.Normalizations.registered[i]("name",t))k.Normalizations.registered[i]("inject",t,n),s="transform",n=r(t).transformCache[i];else{if(k.Hooks.registered[i]){var l=i,c=k.Hooks.getRoot(i);o=o||k.getPropertyValue(t,c),n=k.Hooks.injectValue(l,n,o),i=c}if(k.Normalizations.registered[i]&&(n=k.Normalizations.registered[i]("inject",t,n),i=k.Normalizations.registered[i]("name",t)),s=k.Names.prefixCheck(i)[0],8>=h)try{t.style[s]=n}catch(t){b.debug&&console.log("Browser does not support ["+n+"] for ["+s+"]")}else r(t)&&r(t).isSVG&&k.Names.SVGAttribute(i)?t.setAttribute(i,n):t.style[s]=n;b.debug>=2&&console.log("Set "+i+" ("+s+"): "+n)}return[s,n]},flushTransformCache:function(t){function e(e){return parseFloat(k.getPropertyValue(t,e))}var i="";if((h||b.State.isAndroid&&!b.State.isChrome)&&r(t).isSVG){var n={translate:[e("translateX"),e("translateY")],skewX:[e("skewX")],skewY:[e("skewY")],scale:1!==e("scale")?[e("scale"),e("scale")]:[e("scaleX"),e("scaleY")],rotate:[e("rotateZ"),0,0]};p.each(r(t).transformCache,function(t){/^translate/i.test(t)?t="translate":/^scale/i.test(t)?t="scale":/^rotate/i.test(t)&&(t="rotate"),n[t]&&(i+=t+"("+n[t].join(" ")+") ",delete n[t])})}else{var o,a;p.each(r(t).transformCache,function(e){return o=r(t).transformCache[e],"transformPerspective"===e?(a=o,!0):(9===h&&"rotateZ"===e&&(e="rotate"),void(i+=e+o+" "))}),a&&(i="perspective"+a+" "+i)}k.setPropertyValue(t,"transform",i)}};k.Hooks.register(),k.Normalizations.register(),b.hook=function(t,e,i){var o=n;return t=a(t),p.each(t,function(t,a){if(r(a)===n&&b.init(a),i===n)o===n&&(o=b.CSS.getPropertyValue(a,e));else{var s=b.CSS.setPropertyValue(a,e,i);"transform"===s[0]&&b.CSS.flushTransformCache(a),o=s}}),o};var x=function(){function t(){return s?P.promise||null:l}function o(){function t(t){function d(t,e){var i=n,o=n,r=n;return v.isArray(t)?(i=t[0],!v.isArray(t[1])&&/^[\d-]/.test(t[1])||v.isFunction(t[1])||k.RegEx.isHex.test(t[1])?r=t[1]:(v.isString(t[1])&&!k.RegEx.isHex.test(t[1])||v.isArray(t[1]))&&(o=e?t[1]:c(t[1],s.duration),t[2]!==n&&(r=t[2]))):i=t,e||(o=o||s.easing),v.isFunction(i)&&(i=i.call(a,T,C)),v.isFunction(r)&&(r=r.call(a,T,C)),[i||0,o,r]}function h(t,e){var i,n;return n=(e||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(t){return i=t,""}),i||(i=k.Values.getUnitType(t)),[n,i]}if(s.begin&&0===T)try{s.begin.call(f,f)}catch(t){setTimeout(function(){throw t},1)}if("scroll"===A){var g,w,x,S=/^x$/i.test(s.axis)?"Left":"Top",O=parseFloat(s.offset)||0;s.container?v.isWrapped(s.container)||v.isNode(s.container)?(s.container=s.container[0]||s.container,g=s.container["scroll"+S],x=g+p(a).position()[S.toLowerCase()]+O):s.container=null:(g=b.State.scrollAnchor[b.State["scrollProperty"+S]],w=b.State.scrollAnchor[b.State["scrollProperty"+("Left"===S?"Top":"Left")]],x=p(a).offset()[S.toLowerCase()]+O),l={scroll:{rootPropertyValue:!1,startValue:g,currentValue:g,endValue:x,unitType:"",easing:s.easing,scrollData:{container:s.container,direction:S,alternateValue:w}},element:a},b.debug&&console.log("tweensContainer (scroll): ",l.scroll,a)}else if("reverse"===A){if(!r(a).tweensContainer)return void p.dequeue(a,s.queue);"none"===r(a).opts.display&&(r(a).opts.display="auto"),"hidden"===r(a).opts.visibility&&(r(a).opts.visibility="visible"),r(a).opts.loop=!1,r(a).opts.begin=null,r(a).opts.complete=null,y.easing||delete s.easing,y.duration||delete s.duration,s=p.extend({},r(a).opts,s);M=p.extend(!0,{},r(a).tweensContainer);for(var E in M)if("element"!==E){var _=M[E].startValue;M[E].startValue=M[E].currentValue=M[E].endValue,M[E].endValue=_,v.isEmptyObject(y)||(M[E].easing=s.easing),b.debug&&console.log("reverse tweensContainer ("+E+"): "+JSON.stringify(M[E]),a)}l=M}else if("start"===A){var M;r(a).tweensContainer&&!0===r(a).isAnimating&&(M=r(a).tweensContainer),p.each(m,function(t,e){if(RegExp("^"+k.Lists.colors.join("$|^")+"$").test(t)){var i=d(e,!0),o=i[0],a=i[1],r=i[2];if(k.RegEx.isHex.test(o)){for(var s=["Red","Green","Blue"],l=k.Values.hexToRgb(o),c=r?k.Values.hexToRgb(r):n,u=0;u<s.length;u++){var p=[l[u]];a&&p.push(a),c!==n&&p.push(c[u]),m[t+s[u]]=p}delete m[t]}}});for(var q in m){var z=d(m[q]),V=z[0],H=z[1],L=z[2];q=k.Names.camelCase(q);var j=k.Hooks.getRoot(q),$=!1;if(r(a).isSVG||"tween"===j||!1!==k.Names.prefixCheck(j)[1]||k.Normalizations.registered[j]!==n){(s.display!==n&&null!==s.display&&"none"!==s.display||s.visibility!==n&&"hidden"!==s.visibility)&&/opacity|filter/.test(q)&&!L&&0!==V&&(L=0),s._cacheValues&&M&&M[q]?(L===n&&(L=M[q].endValue+M[q].unitType),$=r(a).rootPropertyValueCache[j]):k.Hooks.registered[q]?L===n?($=k.getPropertyValue(a,j),L=k.getPropertyValue(a,q,$)):$=k.Hooks.templates[j][1]:L===n&&(L=k.getPropertyValue(a,q));var N,W,F,Q=!1;if(N=h(q,L),L=N[0],F=N[1],N=h(q,V),V=N[0].replace(/^([+-\/*])=/,function(t,e){return Q=e,""}),W=N[1],L=parseFloat(L)||0,V=parseFloat(V)||0,"%"===W&&(/^(fontSize|lineHeight)$/.test(q)?(V/=100,W="em"):/^scale/.test(q)?(V/=100,W=""):/(Red|Green|Blue)$/i.test(q)&&(V=V/100*255,W="")),/[\/*]/.test(Q))W=F;else if(F!==W&&0!==L)if(0===V)W=F;else{o=o||function(){var t={myParent:a.parentNode||i.body,position:k.getPropertyValue(a,"position"),fontSize:k.getPropertyValue(a,"fontSize")},n=t.position===I.lastPosition&&t.myParent===I.lastParent,o=t.fontSize===I.lastFontSize;I.lastParent=t.myParent,I.lastPosition=t.position,I.lastFontSize=t.fontSize;var s=100,l={};if(o&&n)l.emToPx=I.lastEmToPx,l.percentToPxWidth=I.lastPercentToPxWidth,l.percentToPxHeight=I.lastPercentToPxHeight;else{var c=r(a).isSVG?i.createElementNS("http://www.w3.org/2000/svg","rect"):i.createElement("div");b.init(c),t.myParent.appendChild(c),p.each(["overflow","overflowX","overflowY"],function(t,e){b.CSS.setPropertyValue(c,e,"hidden")}),b.CSS.setPropertyValue(c,"position",t.position),b.CSS.setPropertyValue(c,"fontSize",t.fontSize),b.CSS.setPropertyValue(c,"boxSizing","content-box"),p.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(t,e){b.CSS.setPropertyValue(c,e,s+"%")}),b.CSS.setPropertyValue(c,"paddingLeft",s+"em"),l.percentToPxWidth=I.lastPercentToPxWidth=(parseFloat(k.getPropertyValue(c,"width",null,!0))||1)/s,l.percentToPxHeight=I.lastPercentToPxHeight=(parseFloat(k.getPropertyValue(c,"height",null,!0))||1)/s,l.emToPx=I.lastEmToPx=(parseFloat(k.getPropertyValue(c,"paddingLeft"))||1)/s,t.myParent.removeChild(c)}return null===I.remToPx&&(I.remToPx=parseFloat(k.getPropertyValue(i.body,"fontSize"))||16),null===I.vwToPx&&(I.vwToPx=parseFloat(e.innerWidth)/100,I.vhToPx=parseFloat(e.innerHeight)/100),l.remToPx=I.remToPx,l.vwToPx=I.vwToPx,l.vhToPx=I.vhToPx,b.debug>=1&&console.log("Unit ratios: "+JSON.stringify(l),a),l}();var X=/margin|padding|left|right|width|text|word|letter/i.test(q)||/X$/.test(q)||"x"===q?"x":"y";switch(F){case"%":L*="x"===X?o.percentToPxWidth:o.percentToPxHeight;break;case"px":break;default:L*=o[F+"ToPx"]}switch(W){case"%":L*=1/("x"===X?o.percentToPxWidth:o.percentToPxHeight);break;case"px":break;default:L*=1/o[W+"ToPx"]}}switch(Q){case"+":V=L+V;break;case"-":V=L-V;break;case"*":V*=L;break;case"/":V=L/V}l[q]={rootPropertyValue:$,startValue:L,currentValue:L,endValue:V,unitType:W,easing:H},b.debug&&console.log("tweensContainer ("+q+"): "+JSON.stringify(l[q]),a)}else b.debug&&console.log("Skipping ["+j+"] due to a lack of browser support.")}l.element=a}l.element&&(k.Values.addClass(a,"velocity-animating"),D.push(l),""===s.queue&&(r(a).tweensContainer=l,r(a).opts=s),r(a).isAnimating=!0,T===C-1?(b.State.calls.push([D,f,s,null,P.resolver]),!1===b.State.isTicking&&(b.State.isTicking=!0,u())):T++)}var o,a=this,s=p.extend({},b.defaults,y),l={};switch(r(a)===n&&b.init(a),parseFloat(s.delay)&&!1!==s.queue&&p.queue(a,s.queue,function(t){b.velocityQueueEntryFlag=!0,r(a).delayTimer={setTimeout:setTimeout(t,parseFloat(s.delay)),next:t}}),s.duration.toString().toLowerCase()){case"fast":s.duration=200;break;case"normal":s.duration=g;break;case"slow":s.duration=600;break;default:s.duration=parseFloat(s.duration)||1}!1!==b.mock&&(!0===b.mock?s.duration=s.delay=1:(s.duration*=parseFloat(b.mock)||1,s.delay*=parseFloat(b.mock)||1)),s.easing=c(s.easing,s.duration),s.begin&&!v.isFunction(s.begin)&&(s.begin=null),s.progress&&!v.isFunction(s.progress)&&(s.progress=null),s.complete&&!v.isFunction(s.complete)&&(s.complete=null),s.display!==n&&null!==s.display&&(s.display=s.display.toString().toLowerCase(),"auto"===s.display&&(s.display=b.CSS.Values.getDisplayType(a))),s.visibility!==n&&null!==s.visibility&&(s.visibility=s.visibility.toString().toLowerCase()),s.mobileHA=s.mobileHA&&b.State.isMobile&&!b.State.isGingerbread,!1===s.queue?s.delay?setTimeout(t,s.delay):t():p.queue(a,s.queue,function(e,i){return!0===i?(P.promise&&P.resolver(f),!0):(b.velocityQueueEntryFlag=!0,void t(e))}),""!==s.queue&&"fx"!==s.queue||"inprogress"===p.queue(a)[0]||p.dequeue(a)}var s,l,h,f,m,y,w=arguments[0]&&(arguments[0].p||p.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||v.isString(arguments[0].properties));if(v.isWrapped(this)?(s=!1,h=0,f=this,l=this):(s=!0,h=1,f=w?arguments[0].elements||arguments[0].e:arguments[0]),f=a(f)){w?(m=arguments[0].properties||arguments[0].p,y=arguments[0].options||arguments[0].o):(m=arguments[h],y=arguments[h+1]);var C=f.length,T=0;if(!/^(stop|finish)$/i.test(m)&&!p.isPlainObject(y)){y={};for(var S=h+1;S<arguments.length;S++)v.isArray(arguments[S])||!/^(fast|normal|slow)$/i.test(arguments[S])&&!/^\d/.test(arguments[S])?v.isString(arguments[S])||v.isArray(arguments[S])?y.easing=arguments[S]:v.isFunction(arguments[S])&&(y.complete=arguments[S]):y.duration=arguments[S]}var P={promise:null,resolver:null,rejecter:null};s&&b.Promise&&(P.promise=new b.Promise(function(t,e){P.resolver=t,P.rejecter=e}));var A;switch(m){case"scroll":A="scroll";break;case"reverse":A="reverse";break;case"finish":case"stop":p.each(f,function(t,e){r(e)&&r(e).delayTimer&&(clearTimeout(r(e).delayTimer.setTimeout),r(e).delayTimer.next&&r(e).delayTimer.next(),delete r(e).delayTimer)});var O=[];return p.each(b.State.calls,function(t,e){e&&p.each(e[1],function(i,o){var a=y===n?"":y;return!0!==a&&e[2].queue!==a&&(y!==n||!1!==e[2].queue)||void p.each(f,function(i,n){n===o&&((!0===y||v.isString(y))&&(p.each(p.queue(n,v.isString(y)?y:""),function(t,e){v.isFunction(e)&&e(null,!0)}),p.queue(n,v.isString(y)?y:"",[])),"stop"===m?(r(n)&&r(n).tweensContainer&&!1!==a&&p.each(r(n).tweensContainer,function(t,e){e.endValue=e.currentValue}),O.push(t)):"finish"===m&&(e[2].duration=1))})})}),"stop"===m&&(p.each(O,function(t,e){d(e,!0)}),P.promise&&P.resolver(f)),t();default:if(!p.isPlainObject(m)||v.isEmptyObject(m)){if(v.isString(m)&&b.Redirects[m]){var E=(z=p.extend({},y)).duration,_=z.delay||0;return!0===z.backwards&&(f=p.extend(!0,[],f).reverse()),p.each(f,function(t,e){parseFloat(z.stagger)?z.delay=_+parseFloat(z.stagger)*t:v.isFunction(z.stagger)&&(z.delay=_+z.stagger.call(e,t,C)),z.drag&&(z.duration=parseFloat(E)||(/^(callout|transition)/.test(m)?1e3:g),z.duration=Math.max(z.duration*(z.backwards?1-t/C:(t+1)/C),.75*z.duration,200)),b.Redirects[m].call(e,e,z||{},t,C,f,P.promise?P:n)}),t()}var M="Velocity: First argument ("+m+") was not a property map, a known action, or a registered redirect. Aborting.";return P.promise?P.rejecter(new Error(M)):console.log(M),t()}A="start"}var I={lastParent:null,lastPosition:null,lastFontSize:null,lastPercentToPxWidth:null,lastPercentToPxHeight:null,lastEmToPx:null,remToPx:null,vwToPx:null,vhToPx:null},D=[];p.each(f,function(t,e){v.isNode(e)&&o.call(e)});var q,z=p.extend({},b.defaults,y);if(z.loop=parseInt(z.loop),q=2*z.loop-1,z.loop)for(var V=0;q>V;V++){var H={delay:z.delay,progress:z.progress};V===q-1&&(H.display=z.display,H.visibility=z.visibility,H.complete=z.complete),x(f,"reverse",H)}return t()}};(b=p.extend(x,b)).animate=x;var C=e.requestAnimationFrame||f;return b.State.isMobile||i.hidden===n||i.addEventListener("visibilitychange",function(){i.hidden?(C=function(t){return setTimeout(function(){t(!0)},16)},u()):C=e.requestAnimationFrame||f}),t.Velocity=b,t!==e&&(t.fn.velocity=x,t.fn.velocity.defaults=b.defaults),p.each(["Down","Up"],function(t,e){b.Redirects["slide"+e]=function(t,i,o,a,r,s){var l=p.extend({},i),c=l.begin,u=l.complete,d={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},h={};l.display===n&&(l.display="Down"===e?"inline"===b.CSS.Values.getDisplayType(t)?"inline-block":"block":"none"),l.begin=function(){c&&c.call(r,r);for(var i in d){h[i]=t.style[i];var n=b.CSS.getPropertyValue(t,i);d[i]="Down"===e?[n,0]:[0,n]}h.overflow=t.style.overflow,t.style.overflow="hidden"},l.complete=function(){for(var e in h)t.style[e]=h[e];u&&u.call(r,r),s&&s.resolver(r)},b(t,d,l)}}),p.each(["In","Out"],function(t,e){b.Redirects["fade"+e]=function(t,i,o,a,r,s){var l=p.extend({},i),c={opacity:"In"===e?1:0},u=l.complete;l.complete=o!==a-1?l.begin=null:function(){u&&u.call(r,r),s&&s.resolver(r)},l.display===n&&(l.display="In"===e?"auto":"none"),b(this,c,l)}}),b}jQuery.fn.velocity=jQuery.fn.animate}}(window.jQuery||window.Zepto||window,window,document)})),function(t,e,i,n){"use strict";function o(t,e,i){return setTimeout(u(t,i),e)}function a(t,e,i){return!!Array.isArray(t)&&(r(t,i[e],i),!0)}function r(t,e,i){var o;if(t)if(t.forEach)t.forEach(e,i);else if(t.length!==n)for(o=0;o<t.length;)e.call(i,t[o],o,t),o++;else for(o in t)t.hasOwnProperty(o)&&e.call(i,t[o],o,t)}function s(t,e,i){for(var o=Object.keys(e),a=0;a<o.length;)(!i||i&&t[o[a]]===n)&&(t[o[a]]=e[o[a]]),a++;return t}function l(t,e){return s(t,e,!0)}function c(t,e,i){var n,o=e.prototype;(n=t.prototype=Object.create(o)).constructor=t,n._super=o,i&&s(n,i)}function u(t,e){return function(){return t.apply(e,arguments)}}function d(t,e){return typeof t==ut?t.apply(e?e[0]||n:n,e):t}function p(t,e){return t===n?e:t}function h(t,e,i){r(g(e),function(e){t.addEventListener(e,i,!1)})}function f(t,e,i){r(g(e),function(e){t.removeEventListener(e,i,!1)})}function v(t,e){for(;t;){if(t==e)return!0;t=t.parentNode}return!1}function m(t,e){return t.indexOf(e)>-1}function g(t){return t.trim().split(/\s+/g)}function y(t,e,i){if(t.indexOf&&!i)return t.indexOf(e);for(var n=0;n<t.length;){if(i&&t[n][i]==e||!i&&t[n]===e)return n;n++}return-1}function b(t){return Array.prototype.slice.call(t,0)}function w(t,e,i){for(var n=[],o=[],a=0;a<t.length;){var r=e?t[a][e]:t[a];y(o,r)<0&&n.push(t[a]),o[a]=r,a++}return i&&(n=e?n.sort(function(t,i){return t[e]>i[e]}):n.sort()),n}function k(t,e){for(var i,o,a=e[0].toUpperCase()+e.slice(1),r=0;r<lt.length;){if(i=lt[r],(o=i?i+a:e)in t)return o;r++}return n}function x(){return ft++}function C(t){var e=t.ownerDocument;return e.defaultView||e.parentWindow}function T(t,e){var i=this;this.manager=t,this.callback=e,this.element=t.element,this.target=t.options.inputTarget,this.domHandler=function(e){d(t.options.enable,[t])&&i.handler(e)},this.init()}function S(t){var e=t.options.inputClass;return new(e||(gt?j:yt?W:mt?Q:L))(t,P)}function P(t,e,i){var n=i.pointers.length,o=i.changedPointers.length,a=e&xt&&0==n-o,r=e&(Tt|St)&&0==n-o;i.isFirst=!!a,i.isFinal=!!r,a&&(t.session={}),i.eventType=e,A(t,i),t.emit("hammer.input",i),t.recognize(i),t.session.prevInput=i}function A(t,e){var i=t.session,n=e.pointers,o=n.length;i.firstInput||(i.firstInput=_(e)),o>1&&!i.firstMultiple?i.firstMultiple=_(e):1===o&&(i.firstMultiple=!1);var a=i.firstInput,r=i.firstMultiple,s=r?r.center:a.center,l=e.center=M(n);e.timeStamp=ht(),e.deltaTime=e.timeStamp-a.timeStamp,e.angle=z(s,l),e.distance=q(s,l),O(i,e),e.offsetDirection=D(e.deltaX,e.deltaY),e.scale=r?H(r.pointers,n):1,e.rotation=r?V(r.pointers,n):0,E(i,e);var c=t.element;v(e.srcEvent.target,c)&&(c=e.srcEvent.target),e.target=c}function O(t,e){var i=e.center,n=t.offsetDelta||{},o=t.prevDelta||{},a=t.prevInput||{};(e.eventType===xt||a.eventType===Tt)&&(o=t.prevDelta={x:a.deltaX||0,y:a.deltaY||0},n=t.offsetDelta={x:i.x,y:i.y}),e.deltaX=o.x+(i.x-n.x),e.deltaY=o.y+(i.y-n.y)}function E(t,e){var i,o,a,r,s=t.lastInterval||e,l=e.timeStamp-s.timeStamp;if(e.eventType!=St&&(l>kt||s.velocity===n)){var c=s.deltaX-e.deltaX,u=s.deltaY-e.deltaY,d=I(l,c,u);o=d.x,a=d.y,i=pt(d.x)>pt(d.y)?d.x:d.y,r=D(c,u),t.lastInterval=e}else i=s.velocity,o=s.velocityX,a=s.velocityY,r=s.direction;e.velocity=i,e.velocityX=o,e.velocityY=a,e.direction=r}function _(t){for(var e=[],i=0;i<t.pointers.length;)e[i]={clientX:dt(t.pointers[i].clientX),clientY:dt(t.pointers[i].clientY)},i++;return{timeStamp:ht(),pointers:e,center:M(e),deltaX:t.deltaX,deltaY:t.deltaY}}function M(t){var e=t.length;if(1===e)return{x:dt(t[0].clientX),y:dt(t[0].clientY)};for(var i=0,n=0,o=0;e>o;)i+=t[o].clientX,n+=t[o].clientY,o++;return{x:dt(i/e),y:dt(n/e)}}function I(t,e,i){return{x:e/t||0,y:i/t||0}}function D(t,e){return t===e?Pt:pt(t)>=pt(e)?t>0?At:Ot:e>0?Et:_t}function q(t,e,i){i||(i=qt);var n=e[i[0]]-t[i[0]],o=e[i[1]]-t[i[1]];return Math.sqrt(n*n+o*o)}function z(t,e,i){i||(i=qt);var n=e[i[0]]-t[i[0]],o=e[i[1]]-t[i[1]];return 180*Math.atan2(o,n)/Math.PI}function V(t,e){return z(e[1],e[0],zt)-z(t[1],t[0],zt)}function H(t,e){return q(e[0],e[1],zt)/q(t[0],t[1],zt)}function L(){this.evEl=Ht,this.evWin=Lt,this.allow=!0,this.pressed=!1,T.apply(this,arguments)}function j(){this.evEl=Nt,this.evWin=Wt,T.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function $(){this.evTarget=Qt,this.evWin=Xt,this.started=!1,T.apply(this,arguments)}function N(t,e){var i=b(t.touches),n=b(t.changedTouches);return e&(Tt|St)&&(i=w(i.concat(n),"identifier",!0)),[i,n]}function W(){this.evTarget=Yt,this.targetIds={},T.apply(this,arguments)}function F(t,e){var i=b(t.touches),n=this.targetIds;if(e&(xt|Ct)&&1===i.length)return n[i[0].identifier]=!0,[i,i];var o,a,r=b(t.changedTouches),s=[],l=this.target;if(a=i.filter(function(t){return v(t.target,l)}),e===xt)for(o=0;o<a.length;)n[a[o].identifier]=!0,o++;for(o=0;o<r.length;)n[r[o].identifier]&&s.push(r[o]),e&(Tt|St)&&delete n[r[o].identifier],o++;return s.length?[w(a.concat(s),"identifier",!0),s]:void 0}function Q(){T.apply(this,arguments);var t=u(this.handler,this);this.touch=new W(this.manager,t),this.mouse=new L(this.manager,t)}function X(t,e){this.manager=t,this.set(e)}function R(t){if(m(t,Kt))return Kt;var e=m(t,te),i=m(t,ee);return e&&i?te+" "+ee:e||i?e?te:ee:m(t,Jt)?Jt:Zt}function Y(t){this.id=x(),this.manager=null,this.options=l(t||{},this.defaults),this.options.enable=p(this.options.enable,!0),this.state=ie,this.simultaneous={},this.requireFail=[]}function B(t){return t&se?"cancel":t&ae?"end":t&oe?"move":t&ne?"start":""}function U(t){return t==_t?"down":t==Et?"up":t==At?"left":t==Ot?"right":""}function G(t,e){var i=e.manager;return i?i.get(t):t}function Z(){Y.apply(this,arguments)}function J(){Z.apply(this,arguments),this.pX=null,this.pY=null}function K(){Z.apply(this,arguments)}function tt(){Y.apply(this,arguments),this._timer=null,this._input=null}function et(){Z.apply(this,arguments)}function it(){Z.apply(this,arguments)}function nt(){Y.apply(this,arguments),this.pTime=!1,this.pCenter=!1,this._timer=null,this._input=null,this.count=0}function ot(t,e){return e=e||{},e.recognizers=p(e.recognizers,ot.defaults.preset),new at(t,e)}function at(t,e){e=e||{},this.options=l(e,ot.defaults),this.options.inputTarget=this.options.inputTarget||t,this.handlers={},this.session={},this.recognizers=[],this.element=t,this.input=S(this),this.touchAction=new X(this,this.options.touchAction),rt(this,!0),r(e.recognizers,function(t){var e=this.add(new t[0](t[1]));t[2]&&e.recognizeWith(t[2]),t[3]&&e.requireFailure(t[3])},this)}function rt(t,e){var i=t.element;r(t.options.cssProps,function(t,n){i.style[k(i.style,n)]=e?t:""})}function st(t,i){var n=e.createEvent("Event");n.initEvent(t,!0,!0),n.gesture=i,i.target.dispatchEvent(n)}var lt=["","webkit","moz","MS","ms","o"],ct=e.createElement("div"),ut="function",dt=Math.round,pt=Math.abs,ht=Date.now,ft=1,vt=/mobile|tablet|ip(ad|hone|od)|android/i,mt="ontouchstart"in t,gt=k(t,"PointerEvent")!==n,yt=mt&&vt.test(navigator.userAgent),bt="touch",wt="mouse",kt=25,xt=1,Ct=2,Tt=4,St=8,Pt=1,At=2,Ot=4,Et=8,_t=16,Mt=At|Ot,It=Et|_t,Dt=Mt|It,qt=["x","y"],zt=["clientX","clientY"];T.prototype={handler:function(){},init:function(){this.evEl&&h(this.element,this.evEl,this.domHandler),this.evTarget&&h(this.target,this.evTarget,this.domHandler),this.evWin&&h(C(this.element),this.evWin,this.domHandler)},destroy:function(){this.evEl&&f(this.element,this.evEl,this.domHandler),this.evTarget&&f(this.target,this.evTarget,this.domHandler),this.evWin&&f(C(this.element),this.evWin,this.domHandler)}};var Vt={mousedown:xt,mousemove:Ct,mouseup:Tt},Ht="mousedown",Lt="mousemove mouseup";c(L,T,{handler:function(t){var e=Vt[t.type];e&xt&&0===t.button&&(this.pressed=!0),e&Ct&&1!==t.which&&(e=Tt),this.pressed&&this.allow&&(e&Tt&&(this.pressed=!1),this.callback(this.manager,e,{pointers:[t],changedPointers:[t],pointerType:wt,srcEvent:t}))}});var jt={pointerdown:xt,pointermove:Ct,pointerup:Tt,pointercancel:St,pointerout:St},$t={2:bt,3:"pen",4:wt,5:"kinect"},Nt="pointerdown",Wt="pointermove pointerup pointercancel";t.MSPointerEvent&&(Nt="MSPointerDown",Wt="MSPointerMove MSPointerUp MSPointerCancel"),c(j,T,{handler:function(t){var e=this.store,i=!1,n=t.type.toLowerCase().replace("ms",""),o=jt[n],a=$t[t.pointerType]||t.pointerType,r=a==bt,s=y(e,t.pointerId,"pointerId");o&xt&&(0===t.button||r)?0>s&&(e.push(t),s=e.length-1):o&(Tt|St)&&(i=!0),0>s||(e[s]=t,this.callback(this.manager,o,{pointers:e,changedPointers:[t],pointerType:a,srcEvent:t}),i&&e.splice(s,1))}});var Ft={touchstart:xt,touchmove:Ct,touchend:Tt,touchcancel:St},Qt="touchstart",Xt="touchstart touchmove touchend touchcancel";c($,T,{handler:function(t){var e=Ft[t.type];if(e===xt&&(this.started=!0),this.started){var i=N.call(this,t,e);e&(Tt|St)&&0==i[0].length-i[1].length&&(this.started=!1),this.callback(this.manager,e,{pointers:i[0],changedPointers:i[1],pointerType:bt,srcEvent:t})}}});var Rt={touchstart:xt,touchmove:Ct,touchend:Tt,touchcancel:St},Yt="touchstart touchmove touchend touchcancel";c(W,T,{handler:function(t){var e=Rt[t.type],i=F.call(this,t,e);i&&this.callback(this.manager,e,{pointers:i[0],changedPointers:i[1],pointerType:bt,srcEvent:t})}}),c(Q,T,{handler:function(t,e,i){var n=i.pointerType==bt,o=i.pointerType==wt;if(n)this.mouse.allow=!1;else if(o&&!this.mouse.allow)return;e&(Tt|St)&&(this.mouse.allow=!0),this.callback(t,e,i)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Bt=k(ct.style,"touchAction"),Ut=Bt!==n,Gt="compute",Zt="auto",Jt="manipulation",Kt="none",te="pan-x",ee="pan-y";X.prototype={set:function(t){t==Gt&&(t=this.compute()),Ut&&(this.manager.element.style[Bt]=t),this.actions=t.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var t=[];return r(this.manager.recognizers,function(e){d(e.options.enable,[e])&&(t=t.concat(e.getTouchAction()))}),R(t.join(" "))},preventDefaults:function(t){if(!Ut){var e=t.srcEvent,i=t.offsetDirection;if(this.manager.session.prevented)return void e.preventDefault();var n=this.actions,o=m(n,Kt),a=m(n,ee),r=m(n,te);return o||a&&i&Mt||r&&i&It?this.preventSrc(e):void 0}},preventSrc:function(t){this.manager.session.prevented=!0,t.preventDefault()}};var ie=1,ne=2,oe=4,ae=8,re=ae,se=16;Y.prototype={defaults:{},set:function(t){return s(this.options,t),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(t){if(a(t,"recognizeWith",this))return this;var e=this.simultaneous;return t=G(t,this),e[t.id]||(e[t.id]=t,t.recognizeWith(this)),this},dropRecognizeWith:function(t){return a(t,"dropRecognizeWith",this)?this:(t=G(t,this),delete this.simultaneous[t.id],this)},requireFailure:function(t){if(a(t,"requireFailure",this))return this;var e=this.requireFail;return t=G(t,this),-1===y(e,t)&&(e.push(t),t.requireFailure(this)),this},dropRequireFailure:function(t){if(a(t,"dropRequireFailure",this))return this;t=G(t,this);var e=y(this.requireFail,t);return e>-1&&this.requireFail.splice(e,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(t){return!!this.simultaneous[t.id]},emit:function(t){function e(e){i.manager.emit(i.options.event+(e?B(n):""),t)}var i=this,n=this.state;ae>n&&e(!0),e(),n>=ae&&e(!0)},tryEmit:function(t){return this.canEmit()?this.emit(t):void(this.state=32)},canEmit:function(){for(var t=0;t<this.requireFail.length;){if(!(this.requireFail[t].state&(32|ie)))return!1;t++}return!0},recognize:function(t){var e=s({},t);return d(this.options.enable,[this,e])?(this.state&(re|se|32)&&(this.state=ie),this.state=this.process(e),void(this.state&(ne|oe|ae|se)&&this.tryEmit(e))):(this.reset(),void(this.state=32))},process:function(){},getTouchAction:function(){},reset:function(){}},c(Z,Y,{defaults:{pointers:1},attrTest:function(t){var e=this.options.pointers;return 0===e||t.pointers.length===e},process:function(t){var e=this.state,i=t.eventType,n=e&(ne|oe),o=this.attrTest(t);return n&&(i&St||!o)?e|se:n||o?i&Tt?e|ae:e&ne?e|oe:ne:32}}),c(J,Z,{defaults:{event:"pan",threshold:10,pointers:1,direction:Dt},getTouchAction:function(){var t=this.options.direction,e=[];return t&Mt&&e.push(ee),t&It&&e.push(te),e},directionTest:function(t){var e=this.options,i=!0,n=t.distance,o=t.direction,a=t.deltaX,r=t.deltaY;return o&e.direction||(e.direction&Mt?(o=0===a?Pt:0>a?At:Ot,i=a!=this.pX,n=Math.abs(t.deltaX)):(o=0===r?Pt:0>r?Et:_t,i=r!=this.pY,n=Math.abs(t.deltaY))),t.direction=o,i&&n>e.threshold&&o&e.direction},attrTest:function(t){return Z.prototype.attrTest.call(this,t)&&(this.state&ne||!(this.state&ne)&&this.directionTest(t))},emit:function(t){this.pX=t.deltaX,this.pY=t.deltaY;var e=U(t.direction);e&&this.manager.emit(this.options.event+e,t),this._super.emit.call(this,t)}}),c(K,Z,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[Kt]},attrTest:function(t){return this._super.attrTest.call(this,t)&&(Math.abs(t.scale-1)>this.options.threshold||this.state&ne)},emit:function(t){if(this._super.emit.call(this,t),1!==t.scale){var e=t.scale<1?"in":"out";this.manager.emit(this.options.event+e,t)}}}),c(tt,Y,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[Zt]},process:function(t){var e=this.options,i=t.pointers.length===e.pointers,n=t.distance<e.threshold,a=t.deltaTime>e.time;if(this._input=t,!n||!i||t.eventType&(Tt|St)&&!a)this.reset();else if(t.eventType&xt)this.reset(),this._timer=o(function(){this.state=re,this.tryEmit()},e.time,this);else if(t.eventType&Tt)return re;return 32},reset:function(){clearTimeout(this._timer)},emit:function(t){this.state===re&&(t&&t.eventType&Tt?this.manager.emit(this.options.event+"up",t):(this._input.timeStamp=ht(),this.manager.emit(this.options.event,this._input)))}}),c(et,Z,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[Kt]},attrTest:function(t){return this._super.attrTest.call(this,t)&&(Math.abs(t.rotation)>this.options.threshold||this.state&ne)}}),c(it,Z,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:Mt|It,pointers:1},getTouchAction:function(){return J.prototype.getTouchAction.call(this)},attrTest:function(t){var e,i=this.options.direction;return i&(Mt|It)?e=t.velocity:i&Mt?e=t.velocityX:i&It&&(e=t.velocityY),this._super.attrTest.call(this,t)&&i&t.direction&&t.distance>this.options.threshold&&pt(e)>this.options.velocity&&t.eventType&Tt},emit:function(t){var e=U(t.direction);e&&this.manager.emit(this.options.event+e,t),this.manager.emit(this.options.event,t)}}),c(nt,Y,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[Jt]},process:function(t){var e=this.options,i=t.pointers.length===e.pointers,n=t.distance<e.threshold,a=t.deltaTime<e.time;if(this.reset(),t.eventType&xt&&0===this.count)return this.failTimeout();if(n&&a&&i){if(t.eventType!=Tt)return this.failTimeout();var r=!this.pTime||t.timeStamp-this.pTime<e.interval,s=!this.pCenter||q(this.pCenter,t.center)<e.posThreshold;if(this.pTime=t.timeStamp,this.pCenter=t.center,s&&r?this.count+=1:this.count=1,this._input=t,0===this.count%e.taps)return this.hasRequireFailures()?(this._timer=o(function(){this.state=re,this.tryEmit()},e.interval,this),ne):re}return 32},failTimeout:function(){return this._timer=o(function(){this.state=32},this.options.interval,this),32},reset:function(){clearTimeout(this._timer)},emit:function(){this.state==re&&(this._input.tapCount=this.count,this.manager.emit(this.options.event,this._input))}}),ot.VERSION="2.0.4",ot.defaults={domEvents:!1,touchAction:Gt,enable:!0,inputTarget:null,inputClass:null,preset:[[et,{enable:!1}],[K,{enable:!1},["rotate"]],[it,{direction:Mt}],[J,{direction:Mt},["swipe"]],[nt],[nt,{event:"doubletap",taps:2},["tap"]],[tt]],cssProps:{userSelect:"default",touchSelect:"none",touchCallout:"none",contentZooming:"none",userDrag:"none",tapHighlightColor:"rgba(0,0,0,0)"}};at.prototype={set:function(t){return s(this.options,t),t.touchAction&&this.touchAction.update(),t.inputTarget&&(this.input.destroy(),this.input.target=t.inputTarget,this.input.init()),this},stop:function(t){this.session.stopped=t?2:1},recognize:function(t){var e=this.session;if(!e.stopped){this.touchAction.preventDefaults(t);var i,n=this.recognizers,o=e.curRecognizer;(!o||o&&o.state&re)&&(o=e.curRecognizer=null);for(var a=0;a<n.length;)i=n[a],2===e.stopped||o&&i!=o&&!i.canRecognizeWith(o)?i.reset():i.recognize(t),!o&&i.state&(ne|oe|ae)&&(o=e.curRecognizer=i),a++}},get:function(t){if(t instanceof Y)return t;for(var e=this.recognizers,i=0;i<e.length;i++)if(e[i].options.event==t)return e[i];return null},add:function(t){if(a(t,"add",this))return this;var e=this.get(t.options.event);return e&&this.remove(e),this.recognizers.push(t),t.manager=this,this.touchAction.update(),t},remove:function(t){if(a(t,"remove",this))return this;var e=this.recognizers;return t=this.get(t),e.splice(y(e,t),1),this.touchAction.update(),this},on:function(t,e){var i=this.handlers;return r(g(t),function(t){i[t]=i[t]||[],i[t].push(e)}),this},off:function(t,e){var i=this.handlers;return r(g(t),function(t){e?i[t].splice(y(i[t],e),1):delete i[t]}),this},emit:function(t,e){this.options.domEvents&&st(t,e);var i=this.handlers[t]&&this.handlers[t].slice();if(i&&i.length){e.type=t,e.preventDefault=function(){e.srcEvent.preventDefault()};for(var n=0;n<i.length;)i[n](e),n++}},destroy:function(){this.element&&rt(this,!1),this.handlers={},this.session={},this.input.destroy(),this.element=null}},s(ot,{INPUT_START:xt,INPUT_MOVE:Ct,INPUT_END:Tt,INPUT_CANCEL:St,STATE_POSSIBLE:ie,STATE_BEGAN:ne,STATE_CHANGED:oe,STATE_ENDED:ae,STATE_RECOGNIZED:re,STATE_CANCELLED:se,STATE_FAILED:32,DIRECTION_NONE:Pt,DIRECTION_LEFT:At,DIRECTION_RIGHT:Ot,DIRECTION_UP:Et,DIRECTION_DOWN:_t,DIRECTION_HORIZONTAL:Mt,DIRECTION_VERTICAL:It,DIRECTION_ALL:Dt,Manager:at,Input:T,TouchAction:X,TouchInput:W,MouseInput:L,PointerEventInput:j,TouchMouseInput:Q,SingleTouchInput:$,Recognizer:Y,AttrRecognizer:Z,Tap:nt,Pan:J,Swipe:it,Pinch:K,Rotate:et,Press:tt,on:h,off:f,each:r,merge:l,extend:s,inherit:c,bindFn:u,prefixed:k}),typeof define==ut&&define.amd?define(function(){return ot}):"undefined"!=typeof module&&module.exports?module.exports=ot:t.Hammer=ot}(window,document),function(t){"function"==typeof define&&define.amd?define(["jquery","hammerjs"],t):"object"==typeof exports?t(require("jquery"),require("hammerjs")):t(jQuery,Hammer)}(function(t,e){function i(i,n){var o=t(i);o.data("hammer")||o.data("hammer",new e(o[0],n))}t.fn.hammer=function(t){return this.each(function(){i(this,t)})},e.Manager.prototype.emit=function(e){return function(i,n){e.call(this,i,n),t(this.element).trigger({type:i,gesture:n})}}(e.Manager.prototype.emit)}),function(t){t.Package?Materialize={}:t.Materialize={}}(window),"undefined"==typeof exports||exports.nodeType||("undefined"!=typeof module&&!module.nodeType&&module.exports&&(exports=module.exports=Materialize),exports.default=Materialize),function(t){for(var e=0,i=["webkit","moz"],n=t.requestAnimationFrame,o=t.cancelAnimationFrame,a=i.length;--a>=0&&!n;)n=t[i[a]+"RequestAnimationFrame"],o=t[i[a]+"CancelRequestAnimationFrame"];n&&o||(n=function(t){var i=+Date.now(),n=Math.max(e+16,i);return setTimeout(function(){t(e=n)},n-i)},o=clearTimeout),t.requestAnimationFrame=n,t.cancelAnimationFrame=o}(window),Materialize.objectSelectorString=function(t){return((t.prop("tagName")||"")+(t.attr("id")||"")+(t.attr("class")||"")).replace(/\s/g,"")},Materialize.guid=function(){function t(){return Math.floor(65536*(1+Math.random())).toString(16).substring(1)}return function(){return t()+t()+"-"+t()+"-"+t()+"-"+t()+"-"+t()+t()+t()}}(),Materialize.escapeHash=function(t){return t.replace(/(:|\.|\[|\]|,|=)/g,"\\$1")},Materialize.elementOrParentIsFixed=function(t){var e=$(t),i=!1;return e.add(e.parents()).each(function(){if("fixed"===$(this).css("position"))return i=!0,!1}),i};var getTime=Date.now||function(){return(new Date).getTime()};Materialize.throttle=function(t,e,i){var n,o,a,r=null,s=0;i||(i={});var l=function(){s=!1===i.leading?0:getTime(),r=null,a=t.apply(n,o),n=o=null};return function(){var c=getTime();s||!1!==i.leading||(s=c);var u=e-(c-s);return n=this,o=arguments,u<=0?(clearTimeout(r),r=null,s=c,a=t.apply(n,o),n=o=null):r||!1===i.trailing||(r=setTimeout(l,u)),a}};var Vel;Vel=jQuery?jQuery.Velocity:$?$.Velocity:Velocity,Materialize.Vel=Vel||Velocity,function(t){t.fn.collapsible=function(e,i){var n={accordion:void 0,onOpen:void 0,onClose:void 0},o=e;return e=t.extend(n,e),this.each(function(){function n(e){p=d.find("> li > .collapsible-header"),e.hasClass("active")?e.parent().addClass("active"):e.parent().removeClass("active"),e.parent().hasClass("active")?e.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}):e.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}),p.not(e).removeClass("active").parent().removeClass("active"),p.not(e).parent().children(".collapsible-body").stop(!0,!1).each(function(){t(this).is(":visible")&&t(this).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height",""),s(t(this).siblings(".collapsible-header"))}})})}function a(e){e.hasClass("active")?e.parent().addClass("active"):e.parent().removeClass("active"),e.parent().hasClass("active")?e.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}):e.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}})}function r(t,i){i||t.toggleClass("active"),e.accordion||"accordion"===h||void 0===h?n(t):a(t),s(t)}function s(t){t.hasClass("active")?"function"==typeof e.onOpen&&e.onOpen.call(this,t.parent()):"function"==typeof e.onClose&&e.onClose.call(this,t.parent())}function l(t){return c(t).length>0}function c(t){return t.closest("li > .collapsible-header")}function u(){d.off("click.collapse","> li > .collapsible-header")}var d=t(this),p=t(this).find("> li > .collapsible-header"),h=d.data("collapsible");if("destroy"!==o)if(i>=0&&i<p.length){var f=p.eq(i);f.length&&("open"===o||"close"===o&&f.hasClass("active"))&&r(f)}else u(),d.on("click.collapse","> li > .collapsible-header",function(e){var i=t(e.target);l(i)&&(i=c(i)),r(i)}),e.accordion||"accordion"===h||void 0===h?r(p.filter(".active").first(),!0):p.filter(".active").each(function(){r(t(this),!0)});else u()})},t(document).ready(function(){t(".collapsible").collapsible()})}(jQuery),function(t){t.fn.scrollTo=function(e){return t(this).scrollTop(t(this).scrollTop()-t(this).offset().top+t(e).offset().top),this},t.fn.dropdown=function(e){var i={inDuration:300,outDuration:225,constrainWidth:!0,hover:!1,gutter:0,belowOrigin:!1,alignment:"left",stopPropagation:!1};return"open"===e?(this.each(function(){t(this).trigger("open")}),!1):"close"===e?(this.each(function(){t(this).trigger("close")}),!1):void this.each(function(){function n(){void 0!==r.data("induration")&&(s.inDuration=r.data("induration")),void 0!==r.data("outduration")&&(s.outDuration=r.data("outduration")),void 0!==r.data("constrainwidth")&&(s.constrainWidth=r.data("constrainwidth")),void 0!==r.data("hover")&&(s.hover=r.data("hover")),void 0!==r.data("gutter")&&(s.gutter=r.data("gutter")),void 0!==r.data("beloworigin")&&(s.belowOrigin=r.data("beloworigin")),void 0!==r.data("alignment")&&(s.alignment=r.data("alignment")),void 0!==r.data("stoppropagation")&&(s.stopPropagation=r.data("stoppropagation"))}function o(e){"focus"===e&&(l=!0),n(),c.addClass("active"),r.addClass("active");var i=r[0].getBoundingClientRect().width;!0===s.constrainWidth?c.css("width",i):c.css("white-space","nowrap");var o=window.innerHeight,u=r.innerHeight(),d=r.offset().left,p=r.offset().top-t(window).scrollTop(),h=s.alignment,f=0,v=0,m=0;!0===s.belowOrigin&&(m=u);var g=0,y=0,b=r.parent();if(b.is("body")||(b[0].scrollHeight>b[0].clientHeight&&(g=b[0].scrollTop),b[0].scrollWidth>b[0].clientWidth&&(y=b[0].scrollLeft)),d+c.innerWidth()>t(window).width()?h="right":d-c.innerWidth()+r.innerWidth()<0&&(h="left"),p+c.innerHeight()>o)if(p+u-c.innerHeight()<0){var w=o-p-m;c.css("max-height",w)}else m||(m+=u),m-=c.innerHeight();"left"===h?(f=s.gutter,v=r.position().left+f):"right"===h&&(c.stop(!0,!0).css({opacity:0,left:0}),v=r.position().left+i-c.width()+(f=-s.gutter)),c.css({position:"absolute",top:r.position().top+m+g,left:v+y}),c.slideDown({queue:!1,duration:s.inDuration,easing:"easeOutCubic",complete:function(){t(this).css("height","")}}).animate({opacity:1},{queue:!1,duration:s.inDuration,easing:"easeOutSine"}),setTimeout(function(){t(document).on("click."+c.attr("id"),function(e){a(),t(document).off("click."+c.attr("id"))})},0)}function a(){l=!1,c.fadeOut(s.outDuration),c.removeClass("active"),r.removeClass("active"),t(document).off("click."+c.attr("id")),setTimeout(function(){c.css("max-height","")},s.outDuration)}var r=t(this),s=t.extend({},i,e),l=!1,c=t("#"+r.attr("data-activates"));if(n(),r.after(c),s.hover){var u=!1;r.off("click."+r.attr("id")),r.on("mouseenter",function(t){!1===u&&(o(),u=!0)}),r.on("mouseleave",function(e){var i=e.toElement||e.relatedTarget;t(i).closest(".dropdown-content").is(c)||(c.stop(!0,!0),a(),u=!1)}),c.on("mouseleave",function(e){var i=e.toElement||e.relatedTarget;t(i).closest(".dropdown-button").is(r)||(c.stop(!0,!0),a(),u=!1)})}else r.off("click."+r.attr("id")),r.on("click."+r.attr("id"),function(e){l||(r[0]!=e.currentTarget||r.hasClass("active")||0!==t(e.target).closest(".dropdown-content").length?r.hasClass("active")&&(a(),t(document).off("click."+c.attr("id"))):(e.preventDefault(),s.stopPropagation&&e.stopPropagation(),o("click")))});r.on("open",function(t,e){o(e)}),r.on("close",a)})},t(document).ready(function(){t(".dropdown-button").dropdown()})}(jQuery),function(t,e){"use strict";var i={opacity:.5,inDuration:250,outDuration:250,ready:void 0,complete:void 0,dismissible:!0,startingTop:"4%",endingTop:"10%"},n=function(){function n(e,i){_classCallCheck(this,n),e[0].M_Modal&&e[0].M_Modal.destroy(),this.$el=e,this.options=t.extend({},n.defaults,i),this.isOpen=!1,this.$el[0].M_Modal=this,this.id=e.attr("id"),this.openingTrigger=void 0,this.$overlay=t('<div class="modal-overlay"></div>'),n._increment++,n._count++,this.$overlay[0].style.zIndex=1e3+2*n._increment,this.$el[0].style.zIndex=1e3+2*n._increment+1,this.setupEventHandlers()}return _createClass(n,[{key:"getInstance",value:function(){return this}},{key:"destroy",value:function(){this.removeEventHandlers(),this.$el[0].removeAttribute("style"),this.$overlay[0].parentNode&&this.$overlay[0].parentNode.removeChild(this.$overlay[0]),this.$el[0].M_Modal=void 0,n._count--}},{key:"setupEventHandlers",value:function(){this.handleOverlayClickBound=this.handleOverlayClick.bind(this),this.handleModalCloseClickBound=this.handleModalCloseClick.bind(this),1===n._count&&document.body.addEventListener("click",this.handleTriggerClick),this.$overlay[0].addEventListener("click",this.handleOverlayClickBound),this.$el[0].addEventListener("click",this.handleModalCloseClickBound)}},{key:"removeEventHandlers",value:function(){0===n._count&&document.body.removeEventListener("click",this.handleTriggerClick),this.$overlay[0].removeEventListener("click",this.handleOverlayClickBound),this.$el[0].removeEventListener("click",this.handleModalCloseClickBound)}},{key:"handleTriggerClick",value:function(e){var i=t(e.target).closest(".modal-trigger");if(e.target&&i.length){var n=i[0].getAttribute("href");n=n?n.slice(1):i[0].getAttribute("data-target");var o=document.getElementById(n).M_Modal;o&&o.open(i),e.preventDefault()}}},{key:"handleOverlayClick",value:function(){this.options.dismissible&&this.close()}},{key:"handleModalCloseClick",value:function(e){var i=t(e.target).closest(".modal-close");e.target&&i.length&&this.close()}},{key:"handleKeydown",value:function(t){27===t.keyCode&&this.options.dismissible&&this.close()}},{key:"animateIn",value:function(){var i=this;t.extend(this.$el[0].style,{display:"block",opacity:0}),t.extend(this.$overlay[0].style,{display:"block",opacity:0}),e(this.$overlay[0],{opacity:this.options.opacity},{duration:this.options.inDuration,queue:!1,ease:"easeOutCubic"});var n={duration:this.options.inDuration,queue:!1,ease:"easeOutCubic",complete:function(){"function"==typeof i.options.ready&&i.options.ready.call(i,i.$el,i.openingTrigger)}};this.$el[0].classList.contains("bottom-sheet")?e(this.$el[0],{bottom:0,opacity:1},n):(e.hook(this.$el[0],"scaleX",.7),this.$el[0].style.top=this.options.startingTop,e(this.$el[0],{top:this.options.endingTop,opacity:1,scaleX:1},n))}},{key:"animateOut",value:function(){var t=this;e(this.$overlay[0],{opacity:0},{duration:this.options.outDuration,queue:!1,ease:"easeOutQuart"});var i={duration:this.options.outDuration,queue:!1,ease:"easeOutCubic",complete:function(){t.$el[0].style.display="none","function"==typeof t.options.complete&&t.options.complete.call(t,t.$el),t.$overlay[0].parentNode.removeChild(t.$overlay[0])}};this.$el[0].classList.contains("bottom-sheet")?e(this.$el[0],{bottom:"-100%",opacity:0},i):e(this.$el[0],{top:this.options.startingTop,opacity:0,scaleX:.7},i)}},{key:"open",value:function(t){if(!this.isOpen){this.isOpen=!0;var e=document.body;return e.style.overflow="hidden",this.$el[0].classList.add("open"),e.appendChild(this.$overlay[0]),this.openingTrigger=t||void 0,this.options.dismissible&&(this.handleKeydownBound=this.handleKeydown.bind(this),document.addEventListener("keydown",this.handleKeydownBound)),this.animateIn(),this}}},{key:"close",value:function(){if(this.isOpen)return this.isOpen=!1,this.$el[0].classList.remove("open"),document.body.style.overflow="",this.options.dismissible&&document.removeEventListener("keydown",this.handleKeydownBound),this.animateOut(),this}}],[{key:"init",value:function(e,i){var o=[];return e.each(function(){o.push(new n(t(this),i))}),o}},{key:"defaults",get:function(){return i}}]),n}();n._increment=0,n._count=0,Materialize.Modal=n,t.fn.modal=function(e){return n.prototype[e]?"get"===e.slice(0,3)?this.first()[0].M_Modal[e]():this.each(function(){this.M_Modal[e]()}):"object"!=typeof e&&e?void t.error("Method "+e+" does not exist on jQuery.modal"):(n.init(this,arguments[0]),this)}}(jQuery,Materialize.Vel),function(t){t.fn.materialbox=function(){return this.each(function(){function e(){a=!1;var e=s.parent(".material-placeholder"),n=(window.innerWidth,window.innerHeight,s.data("width")),l=s.data("height");s.velocity("stop",!0),t("#materialbox-overlay").velocity("stop",!0),t(".materialbox-caption").velocity("stop",!0),t(window).off("scroll.materialbox"),t(document).off("keyup.materialbox"),t(window).off("resize.materialbox"),t("#materialbox-overlay").velocity({opacity:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){o=!1,t(this).remove()}}),s.velocity({width:n,height:l,left:0,top:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){e.css({height:"",width:"",position:"",top:"",left:""}),s.removeAttr("style"),s.attr("style",c),s.removeClass("active"),a=!0,i&&i.css("overflow","")}}),t(".materialbox-caption").velocity({opacity:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}})}if(!t(this).hasClass("initialized")){t(this).addClass("initialized");var i,n,o=!1,a=!0,r=200,s=t(this),l=t("<div></div>").addClass("material-placeholder"),c=s.attr("style");s.wrap(l),s.on("click",function(){var r=s.parent(".material-placeholder"),l=window.innerWidth,c=window.innerHeight,u=s.width(),d=s.height();if(!1===a)return e(),!1;if(o&&!0===a)return e(),!1;a=!1,s.addClass("active"),o=!0,r.css({width:r[0].getBoundingClientRect().width,height:r[0].getBoundingClientRect().height,position:"relative",top:0,left:0}),i=void 0,n=r[0].parentNode;for(;null!==n&&!t(n).is(document);){var p=t(n);"visible"!==p.css("overflow")&&(p.css("overflow","visible"),i=void 0===i?p:i.add(p)),n=n.parentNode}s.css({position:"absolute","z-index":1e3,"will-change":"left, top, width, height"}).data("width",u).data("height",d);var h=t('<div id="materialbox-overlay"></div>').css({opacity:0}).click(function(){!0===a&&e()});s.before(h);var f=h[0].getBoundingClientRect();if(h.css({width:l,height:c,left:-1*f.left,top:-1*f.top}),h.velocity({opacity:1},{duration:275,queue:!1,easing:"easeOutQuad"}),""!==s.data("caption")){var v=t('<div class="materialbox-caption"></div>');v.text(s.data("caption")),t("body").append(v),v.css({display:"inline"}),v.velocity({opacity:1},{duration:275,queue:!1,easing:"easeOutQuad"})}var m=0,g=0;u/l>d/c?(m=.9*l,g=.9*l*(d/u)):(m=.9*c*(u/d),g=.9*c),s.hasClass("responsive-img")?s.velocity({"max-width":m,width:u},{duration:0,queue:!1,complete:function(){s.css({left:0,top:0}).velocity({height:g,width:m,left:t(document).scrollLeft()+l/2-s.parent(".material-placeholder").offset().left-m/2,top:t(document).scrollTop()+c/2-s.parent(".material-placeholder").offset().top-g/2},{duration:275,queue:!1,easing:"easeOutQuad",complete:function(){a=!0}})}}):s.css("left",0).css("top",0).velocity({height:g,width:m,left:t(document).scrollLeft()+l/2-s.parent(".material-placeholder").offset().left-m/2,top:t(document).scrollTop()+c/2-s.parent(".material-placeholder").offset().top-g/2},{duration:275,queue:!1,easing:"easeOutQuad",complete:function(){a=!0}}),t(window).on("scroll.materialbox",function(){o&&e()}),t(window).on("resize.materialbox",function(){o&&e()}),t(document).on("keyup.materialbox",function(t){27===t.keyCode&&!0===a&&o&&e()})})}})},t(document).ready(function(){t(".materialboxed").materialbox()})}(jQuery),function(t){t.fn.parallax=function(){var e=t(window).width();return this.each(function(i){function n(i){var n;n=e<601?o.height()>0?o.height():o.children("img").height():o.height()>0?o.height():500;var a=o.children("img").first(),r=a.height()-n,s=o.offset().top+n,l=o.offset().top,c=t(window).scrollTop(),u=window.innerHeight,d=(c+u-l)/(n+u),p=Math.round(r*d);i&&a.css("display","block"),s>c&&l<c+u&&a.css("transform","translate3D(-50%,"+p+"px, 0)")}var o=t(this);o.addClass("parallax"),o.children("img").one("load",function(){n(!0)}).each(function(){this.complete&&t(this).trigger("load")}),t(window).scroll(function(){e=t(window).width(),n(!1)}),t(window).resize(function(){e=t(window).width(),n(!1)})})}}(jQuery),function(t){var e={init:function(e){var i={onShow:null,swipeable:!1,responsiveThreshold:1/0};e=t.extend(i,e);var n=Materialize.objectSelectorString(t(this));return this.each(function(i){var o,a,r,s,l,c=n+i,u=t(this),d=t(window).width(),p=u.find("li.tab a"),h=u.width(),f=t(),v=Math.max(h,u[0].scrollWidth)/p.length,m=0,g=0,y=!1,b=function(t){return Math.ceil(h-t.position().left-t[0].getBoundingClientRect().width-u.scrollLeft())},w=function(t){return Math.floor(t.position().left+u.scrollLeft())},k=function(t){m-t>=0?(s.velocity({right:b(o)},{duration:300,queue:!1,easing:"easeOutQuad"}),s.velocity({left:w(o)},{duration:300,queue:!1,easing:"easeOutQuad",delay:90})):(s.velocity({left:w(o)},{duration:300,queue:!1,easing:"easeOutQuad"}),s.velocity({right:b(o)},{duration:300,queue:!1,easing:"easeOutQuad",delay:90}))};e.swipeable&&d>e.responsiveThreshold&&(e.swipeable=!1),0===(o=t(p.filter('[href="'+location.hash+'"]'))).length&&(o=t(this).find("li.tab a.active").first()),0===o.length&&(o=t(this).find("li.tab a").first()),o.addClass("active"),(m=p.index(o))<0&&(m=0),void 0!==o[0]&&(a=t(o[0].hash)).addClass("active"),u.find(".indicator").length||u.append('<li class="indicator"></li>'),s=u.find(".indicator"),u.append(s),u.is(":visible")&&setTimeout(function(){s.css({right:b(o)}),s.css({left:w(o)})},0),t(window).off("resize.tabs-"+c).on("resize.tabs-"+c,function(){h=u.width(),v=Math.max(h,u[0].scrollWidth)/p.length,m<0&&(m=0),0!==v&&0!==h&&(s.css({right:b(o)}),s.css({left:w(o)}))}),e.swipeable?(p.each(function(){var e=t(Materialize.escapeHash(this.hash));e.addClass("carousel-item"),f=f.add(e)}),r=f.wrapAll('<div class="tabs-content carousel"></div>'),f.css("display",""),t(".tabs-content.carousel").carousel({fullWidth:!0,noWrap:!0,onCycleTo:function(t){if(!y){var i=m;m=r.index(t),o.removeClass("active"),(o=p.eq(m)).addClass("active"),k(i),"function"==typeof e.onShow&&e.onShow.call(u[0],a)}}})):p.not(o).each(function(){t(Materialize.escapeHash(this.hash)).hide()}),u.off("click.tabs").on("click.tabs","a",function(i){if(t(this).parent().hasClass("disabled"))i.preventDefault();else if(!t(this).attr("target")){y=!0,h=u.width(),v=Math.max(h,u[0].scrollWidth)/p.length,o.removeClass("active");var n=a;o=t(this),a=t(Materialize.escapeHash(this.hash)),p=u.find("li.tab a");o.position();o.addClass("active"),g=m,(m=p.index(t(this)))<0&&(m=0),e.swipeable?f.length&&f.carousel("set",m,function(){"function"==typeof e.onShow&&e.onShow.call(u[0],a)}):(void 0!==a&&(a.show(),a.addClass("active"),"function"==typeof e.onShow&&e.onShow.call(this,a)),void 0===n||n.is(a)||(n.hide(),n.removeClass("active"))),l=setTimeout(function(){y=!1},300),k(g),i.preventDefault()}})})},select_tab:function(t){this.find('a[href="#'+t+'"]').trigger("click")}};t.fn.tabs=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.tabs"):e.init.apply(this,arguments)},t(document).ready(function(){t("ul.tabs").tabs()})}(jQuery),function(t){t.fn.tooltip=function(i){var n={delay:350,tooltip:"",position:"bottom",html:!1};return"remove"===i?(this.each(function(){t("#"+t(this).attr("data-tooltip-id")).remove(),t(this).removeAttr("data-tooltip-id"),t(this).off("mouseenter.tooltip mouseleave.tooltip")}),!1):(i=t.extend(n,i),this.each(function(){var n=Materialize.guid(),o=t(this);o.attr("data-tooltip-id")&&t("#"+o.attr("data-tooltip-id")).remove(),o.attr("data-tooltip-id",n);var a,r,s,l,c,u,d=function(){a=o.attr("data-html")?"true"===o.attr("data-html"):i.html,r=o.attr("data-delay"),r=void 0===r||""===r?i.delay:r,s=o.attr("data-position"),s=void 0===s||""===s?i.position:s,l=o.attr("data-tooltip"),l=void 0===l||""===l?i.tooltip:l};d();c=function(){var e=t('<div class="material-tooltip"></div>');return l=a?t("<span></span>").html(l):t("<span></span>").text(l),e.append(l).appendTo(t("body")).attr("id",n),(u=t('<div class="backdrop"></div>')).appendTo(e),e}(),o.off("mouseenter.tooltip mouseleave.tooltip");var p,h=!1;o.on({"mouseenter.tooltip":function(t){p=setTimeout(function(){d(),h=!0,c.velocity("stop"),u.velocity("stop"),c.css({visibility:"visible",left:"0px",top:"0px"});var t,i,n,a=o.outerWidth(),r=o.outerHeight(),l=c.outerHeight(),p=c.outerWidth(),f="0px",v="0px",m=u[0].offsetWidth,g=u[0].offsetHeight,y=8,b=8,w=0;"top"===s?(t=o.offset().top-l-5,i=o.offset().left+a/2-p/2,n=e(i,t,p,l),f="-10px",u.css({bottom:0,left:0,borderRadius:"14px 14px 0 0",transformOrigin:"50% 100%",marginTop:l,marginLeft:p/2-m/2})):"left"===s?(t=o.offset().top+r/2-l/2,i=o.offset().left-p-5,n=e(i,t,p,l),v="-10px",u.css({top:"-7px",right:0,width:"14px",height:"14px",borderRadius:"14px 0 0 14px",transformOrigin:"95% 50%",marginTop:l/2,marginLeft:p})):"right"===s?(t=o.offset().top+r/2-l/2,i=o.offset().left+a+5,n=e(i,t,p,l),v="+10px",u.css({top:"-7px",left:0,width:"14px",height:"14px",borderRadius:"0 14px 14px 0",transformOrigin:"5% 50%",marginTop:l/2,marginLeft:"0px"})):(t=o.offset().top+o.outerHeight()+5,i=o.offset().left+a/2-p/2,n=e(i,t,p,l),f="+10px",u.css({top:0,left:0,marginLeft:p/2-m/2})),c.css({top:n.y,left:n.x}),y=Math.SQRT2*p/parseInt(m),b=Math.SQRT2*l/parseInt(g),w=Math.max(y,b),c.velocity({translateY:f,translateX:v},{duration:350,queue:!1}).velocity({opacity:1},{duration:300,delay:50,queue:!1}),u.css({visibility:"visible"}).velocity({opacity:1},{duration:55,delay:0,queue:!1}).velocity({scaleX:w,scaleY:w},{duration:300,delay:0,queue:!1,easing:"easeInOutQuad"})},r)},"mouseleave.tooltip":function(){h=!1,clearTimeout(p),setTimeout(function(){!0!==h&&(c.velocity({opacity:0,translateY:0,translateX:0},{duration:225,queue:!1}),u.velocity({opacity:0,scaleX:1,scaleY:1},{duration:225,queue:!1,complete:function(){u.css({visibility:"hidden"}),c.css({visibility:"hidden"}),h=!1}}))},225)}})}))};var e=function(e,i,n,o){var a=e,r=i;return a<0?a=4:a+n>window.innerWidth&&(a-=a+n-window.innerWidth),r<0?r=4:r+o>window.innerHeight+t(window).scrollTop&&(r-=r+o-window.innerHeight),{x:a,y:r}};t(document).ready(function(){t(".tooltipped").tooltipZ()})}(jQuery),function(t){"use strict";function e(t){return null!==t&&t===t.window}function i(t){return e(t)?t:9===t.nodeType&&t.defaultView}function n(t){var e,n,o={top:0,left:0},a=t&&t.ownerDocument;return e=a.documentElement,void 0!==t.getBoundingClientRect&&(o=t.getBoundingClientRect()),n=i(a),{top:o.top+n.pageYOffset-e.clientTop,left:o.left+n.pageXOffset-e.clientLeft}}function o(t){var e="";for(var i in t)t.hasOwnProperty(i)&&(e+=i+":"+t[i]+";");return e}function a(t){if(!1===u.allowEvent(t))return null;for(var e=null,i=t.target||t.srcElement;null!==i.parentNode;){if(!(i instanceof SVGElement)&&-1!==i.className.indexOf("waves-effect")){e=i;break}i=i.parentNode}return e}function r(e){var i=a(e);null!==i&&(c.show(e,i),"ontouchstart"in t&&(i.addEventListener("touchend",c.hide,!1),i.addEventListener("touchcancel",c.hide,!1)),i.addEventListener("mouseup",c.hide,!1),i.addEventListener("mouseleave",c.hide,!1),i.addEventListener("dragend",c.hide,!1))}var s=s||{},l=document.querySelectorAll.bind(document),c={duration:750,show:function(t,e){if(2===t.button)return!1;var i=e||this,a=document.createElement("div");a.className="waves-ripple",i.appendChild(a);var r=n(i),s=t.pageY-r.top,l=t.pageX-r.left,u="scale("+i.clientWidth/100*10+")";"touches"in t&&(s=t.touches[0].pageY-r.top,l=t.touches[0].pageX-r.left),a.setAttribute("data-hold",Date.now()),a.setAttribute("data-scale",u),a.setAttribute("data-x",l),a.setAttribute("data-y",s);var d={top:s+"px",left:l+"px"};a.className=a.className+" waves-notransition",a.setAttribute("style",o(d)),a.className=a.className.replace("waves-notransition",""),d["-webkit-transform"]=u,d["-moz-transform"]=u,d["-ms-transform"]=u,d["-o-transform"]=u,d.transform=u,d.opacity="1",d["-webkit-transition-duration"]=c.duration+"ms",d["-moz-transition-duration"]=c.duration+"ms",d["-o-transition-duration"]=c.duration+"ms",d["transition-duration"]=c.duration+"ms",d["-webkit-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["-moz-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["-o-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",a.setAttribute("style",o(d))},hide:function(t){u.touchup(t);var e=this,i=(e.clientWidth,null),n=e.getElementsByClassName("waves-ripple");if(!(n.length>0))return!1;var a=(i=n[n.length-1]).getAttribute("data-x"),r=i.getAttribute("data-y"),s=i.getAttribute("data-scale"),l=350-(Date.now()-Number(i.getAttribute("data-hold")));l<0&&(l=0),setTimeout(function(){var t={top:r+"px",left:a+"px",opacity:"0","-webkit-transition-duration":c.duration+"ms","-moz-transition-duration":c.duration+"ms","-o-transition-duration":c.duration+"ms","transition-duration":c.duration+"ms","-webkit-transform":s,"-moz-transform":s,"-ms-transform":s,"-o-transform":s,transform:s};i.setAttribute("style",o(t)),setTimeout(function(){try{e.removeChild(i)}catch(t){return!1}},c.duration)},l)},wrapInput:function(t){for(var e=0;e<t.length;e++){var i=t[e];if("input"===i.tagName.toLowerCase()){var n=i.parentNode;if("i"===n.tagName.toLowerCase()&&-1!==n.className.indexOf("waves-effect"))continue;var o=document.createElement("i");o.className=i.className+" waves-input-wrapper";var a=i.getAttribute("style");a||(a=""),o.setAttribute("style",a),i.className="waves-button-input",i.removeAttribute("style"),n.replaceChild(o,i),o.appendChild(i)}}}},u={touches:0,allowEvent:function(t){var e=!0;return"touchstart"===t.type?u.touches+=1:"touchend"===t.type||"touchcancel"===t.type?setTimeout(function(){u.touches>0&&(u.touches-=1)},500):"mousedown"===t.type&&u.touches>0&&(e=!1),e},touchup:function(t){u.allowEvent(t)}};s.displayEffect=function(e){"duration"in(e=e||{})&&(c.duration=e.duration),c.wrapInput(l(".waves-effect")),"ontouchstart"in t&&document.body.addEventListener("touchstart",r,!1),document.body.addEventListener("mousedown",r,!1)},s.attach=function(e){"input"===e.tagName.toLowerCase()&&(c.wrapInput([e]),e=e.parentNode),"ontouchstart"in t&&e.addEventListener("touchstart",r,!1),e.addEventListener("mousedown",r,!1)},t.Waves=s,document.addEventListener("DOMContentLoaded",function(){s.displayEffect()},!1)}(window),function(t,e){"use strict";var i={displayLength:1/0,inDuration:300,outDuration:375,className:void 0,completeCallback:void 0,activationPercent:.8},n=function(){function n(e,i,o,a){if(_classCallCheck(this,n),e){this.options={displayLength:i,className:o,completeCallback:a},this.options=t.extend({},n.defaults,this.options),this.message=e,this.panning=!1,this.timeRemaining=this.options.displayLength,0===n._toasts.length&&n._createContainer(),n._toasts.push(this);var r=this.createToast();r.M_Toast=this,this.el=r,this._animateIn(),this.setTimer()}}return _createClass(n,[{key:"createToast",value:function(){var e=document.createElement("div");if(e.classList.add("toast"),this.options.className){var i=this.options.className.split(" "),o=void 0,a=void 0;for(o=0,a=i.length;o<a;o++)e.classList.add(i[o])}return("object"==typeof HTMLElement?this.message instanceof HTMLElement:this.message&&"object"==typeof this.message&&null!==this.message&&1===this.message.nodeType&&"string"==typeof this.message.nodeName)?e.appendChild(this.message):this.message instanceof jQuery?t(e).append(this.message):e.innerHTML=this.message,n._container.appendChild(e),e}},{key:"_animateIn",value:function(){e(this.el,{top:0,opacity:1},{duration:300,easing:"easeOutCubic",queue:!1})}},{key:"setTimer",value:function(){var t=this;this.timeRemaining!==1/0&&(this.counterInterval=setInterval(function(){t.panning||(t.timeRemaining-=20),t.timeRemaining<=0&&t.remove()},20))}},{key:"remove",value:function(){var t=this;window.clearInterval(this.counterInterval);var i=this.el.offsetWidth*this.options.activationPercent;this.wasSwiped&&(this.el.style.transition="transform .05s, opacity .05s",this.el.style.transform="translateX("+i+"px)",this.el.style.opacity=0),e(this.el,{opacity:0,marginTop:"-40px"},{duration:this.options.outDuration,easing:"easeOutExpo",queue:!1,complete:function(){"function"==typeof t.options.completeCallback&&t.options.completeCallback(),t.el.parentNode.removeChild(t.el),n._toasts.splice(n._toasts.indexOf(t),1),0===n._toasts.length&&n._removeContainer()}})}}],[{key:"_createContainer",value:function(){var t=document.createElement("div");t.setAttribute("id","toast-container"),t.addEventListener("touchstart",n._onDragStart),t.addEventListener("touchmove",n._onDragMove),t.addEventListener("touchend",n._onDragEnd),t.addEventListener("mousedown",n._onDragStart),document.addEventListener("mousemove",n._onDragMove),document.addEventListener("mouseup",n._onDragEnd),document.body.appendChild(t),n._container=t}},{key:"_removeContainer",value:function(){document.removeEventListener("mousemove",n._onDragMove),document.removeEventListener("mouseup",n._onDragEnd),n._container.parentNode.removeChild(n._container),n._container=null}},{key:"_onDragStart",value:function(e){if(e.target&&t(e.target).closest(".toast").length){var i=t(e.target).closest(".toast")[0].M_Toast;i.panning=!0,n._draggedToast=i,i.el.classList.add("panning"),i.el.style.transition="",i.startingXPos=n._xPos(e),i.time=Date.now(),i.xPos=n._xPos(e)}}},{key:"_onDragMove",value:function(t){if(n._draggedToast){t.preventDefault();var e=n._draggedToast;e.deltaX=Math.abs(e.xPos-n._xPos(t)),e.xPos=n._xPos(t),e.velocityX=e.deltaX/(Date.now()-e.time),e.time=Date.now();var i=e.xPos-e.startingXPos,o=e.el.offsetWidth*e.options.activationPercent;e.el.style.transform="translateX("+i+"px)",e.el.style.opacity=1-Math.abs(i/o)}}},{key:"_onDragEnd",value:function(t){if(n._draggedToast){var e=n._draggedToast;e.panning=!1,e.el.classList.remove("panning");var i=e.xPos-e.startingXPos,o=e.el.offsetWidth*e.options.activationPercent;Math.abs(i)>o||e.velocityX>1?(e.wasSwiped=!0,e.remove()):(e.el.style.transition="transform .2s, opacity .2s",e.el.style.transform="",e.el.style.opacity=""),n._draggedToast=null}}},{key:"_xPos",value:function(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientX:t.clientX}},{key:"removeAll",value:function(){for(var t in n._toasts)n._toasts[t].remove()}},{key:"defaults",get:function(){return i}}]),n}();n._toasts=[],n._container=null,n._draggedToast=null,Materialize.Toast=n,Materialize.toast=function(t,e,i,o){return new n(t,e,i,o)}}(jQuery,Materialize.Vel),function(t){var e={init:function(e){var i={menuWidth:300,edge:"left",closeOnClick:!1,draggable:!0,onOpen:null,onClose:null};e=t.extend(i,e),t(this).each(function(){var i=t(this),n=i.attr("data-activates"),o=t("#"+n);300!=e.menuWidth&&o.css("width",e.menuWidth);var a=t('.drag-target[data-sidenav="'+n+'"]');e.draggable?(a.length&&a.remove(),a=t('<div class="drag-target"></div>').attr("data-sidenav",n),t("body").append(a)):a=t(),"left"==e.edge?(o.css("transform","translateX(-100%)"),a.css({left:0})):(o.addClass("right-aligned").css("transform","translateX(100%)"),a.css({right:0})),o.hasClass("fixed")&&window.innerWidth>992&&o.css("transform","translateX(0)"),o.hasClass("fixed")&&t(window).resize(function(){window.innerWidth>992?0!==t("#sidenav-overlay").length&&l?r(!0):o.css("transform","translateX(0%)"):!1===l&&("left"===e.edge?o.css("transform","translateX(-100%)"):o.css("transform","translateX(100%)"))}),!0===e.closeOnClick&&o.on("click.itemclick","a:not(.collapsible-header)",function(){window.innerWidth>992&&o.hasClass("fixed")||r()});var r=function(i){s=!1,l=!1,t("body").css({overflow:"",width:""}),t("#sidenav-overlay").velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}}),"left"===e.edge?(a.css({width:"",right:"",left:"0"}),o.velocity({translateX:"-100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){!0===i&&(o.removeAttr("style"),o.css("width",e.menuWidth))}})):(a.css({width:"",right:"0",left:""}),o.velocity({translateX:"100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){!0===i&&(o.removeAttr("style"),o.css("width",e.menuWidth))}})),"function"==typeof e.onClose&&e.onClose.call(this,o)},s=!1,l=!1;e.draggable&&(a.on("click",function(){l&&r()}),a.hammer({prevent_default:!1}).on("pan",function(i){if("touch"==i.gesture.pointerType){i.gesture.direction;var n=i.gesture.center.x,a=i.gesture.center.y;i.gesture.velocityX;if(0===n&&0===a)return;var s=t("body"),c=t("#sidenav-overlay"),u=s.innerWidth();if(s.css("overflow","hidden"),s.width(u),0===c.length&&((c=t('<div id="sidenav-overlay"></div>')).css("opacity",0).click(function(){r()}),"function"==typeof e.onOpen&&e.onOpen.call(this,o),t("body").append(c)),"left"===e.edge&&(n>e.menuWidth?n=e.menuWidth:n<0&&(n=0)),"left"===e.edge)n<e.menuWidth/2?l=!1:n>=e.menuWidth/2&&(l=!0),o.css("transform","translateX("+(n-e.menuWidth)+"px)");else{n<window.innerWidth-e.menuWidth/2?l=!0:n>=window.innerWidth-e.menuWidth/2&&(l=!1);var d=n-e.menuWidth/2;d<0&&(d=0),o.css("transform","translateX("+d+"px)")}var p;"left"===e.edge?(p=n/e.menuWidth,c.velocity({opacity:p},{duration:10,queue:!1,easing:"easeOutQuad"})):(p=Math.abs((n-window.innerWidth)/e.menuWidth),c.velocity({opacity:p},{duration:10,queue:!1,easing:"easeOutQuad"}))}}).on("panend",function(i){if("touch"==i.gesture.pointerType){var n=t("#sidenav-overlay"),r=i.gesture.velocityX,c=i.gesture.center.x,u=c-e.menuWidth,d=c-e.menuWidth/2;u>0&&(u=0),d<0&&(d=0),s=!1,"left"===e.edge?l&&r<=.3||r<-.5?(0!==u&&o.velocity({translateX:[0,u]},{duration:300,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),a.css({width:"50%",right:0,left:""}),l=!0):(!l||r>.3)&&(t("body").css({overflow:"",width:""}),o.velocity({translateX:[-1*e.menuWidth-10,u]},{duration:200,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){"function"==typeof e.onClose&&e.onClose.call(this,o),t(this).remove()}}),a.css({width:"10px",right:"",left:0})):l&&r>=-.3||r>.5?(0!==d&&o.velocity({translateX:[0,d]},{duration:300,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),a.css({width:"50%",right:"",left:0}),l=!0):(!l||r<-.3)&&(t("body").css({overflow:"",width:""}),o.velocity({translateX:[e.menuWidth+10,d]},{duration:200,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){"function"==typeof e.onClose&&e.onClose.call(this,o),t(this).remove()}}),a.css({width:"10px",right:0,left:""}))}})),i.off("click.sidenav").on("click.sidenav",function(){if(!0===l)l=!1,s=!1,r();else{var i=t("body"),n=t('<div id="sidenav-overlay"></div>'),c=i.innerWidth();i.css("overflow","hidden"),i.width(c),t("body").append(a),"left"===e.edge?(a.css({width:"50%",right:0,left:""}),o.velocity({translateX:[0,-1*e.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})):(a.css({width:"50%",right:"",left:0}),o.velocity({translateX:[0,e.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})),n.css("opacity",0).click(function(){l=!1,s=!1,r(),n.velocity({opacity:0},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}})}),t("body").append(n),n.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){l=!0,s=!1}}),"function"==typeof e.onOpen&&e.onOpen.call(this,o)}return!1})})},destroy:function(){var e=t("#sidenav-overlay"),i=t('.drag-target[data-sidenav="'+t(this).attr("data-activates")+'"]');e.trigger("click"),i.remove(),t(this).off("click"),e.remove()},show:function(){this.trigger("click")},hide:function(){t("#sidenav-overlay").trigger("click")}};t.fn.sideNav=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.sideNav"):e.init.apply(this,arguments)}}(jQuery),function(t){function e(e,i,n,o){var r=t();return t.each(a,function(t,a){if(a.height()>0){var s=a.offset().top,l=a.offset().left,c=l+a.width(),u=s+a.height();!(l>i||c<o||s>n||u<e)&&r.push(a)}}),r}function i(i){++l;var n=o.scrollTop(),a=o.scrollLeft(),s=a+o.width(),u=n+o.height(),d=e(n+c.top+i||200,s+c.right,u+c.bottom,a+c.left);t.each(d,function(t,e){"number"!=typeof e.data("scrollSpy:ticks")&&e.triggerHandler("scrollSpy:enter"),e.data("scrollSpy:ticks",l)}),t.each(r,function(t,e){var i=e.data("scrollSpy:ticks");"number"==typeof i&&i!==l&&(e.triggerHandler("scrollSpy:exit"),e.data("scrollSpy:ticks",null))}),r=d}function n(){o.trigger("scrollSpy:winSize")}var o=t(window),a=[],r=[],s=!1,l=0,c={top:0,right:0,bottom:0,left:0};t.scrollSpy=function(e,n){var r={throttle:100,scrollOffset:200,activeClass:"active",getActiveElement:function(t){return'a[href="#'+t+'"]'}};n=t.extend(r,n);var l=[];(e=t(e)).each(function(e,i){a.push(t(i)),t(i).data("scrollSpy:id",e),t('a[href="#'+t(i).attr("id")+'"]').click(function(e){e.preventDefault();var i=t(Materialize.escapeHash(this.hash)).offset().top+1;t("html, body").animate({scrollTop:i-n.scrollOffset},{duration:400,queue:!1,easing:"easeOutCubic"})})}),c.top=n.offsetTop||0,c.right=n.offsetRight||0,c.bottom=n.offsetBottom||0,c.left=n.offsetLeft||0;var u=Materialize.throttle(function(){i(n.scrollOffset)},n.throttle||100),d=function(){t(document).ready(u)};return s||(o.on("scroll",d),o.on("resize",d),s=!0),setTimeout(d,0),e.on("scrollSpy:enter",function(){l=t.grep(l,function(t){return 0!=t.height()});var e=t(this);l[0]?(t(n.getActiveElement(l[0].attr("id"))).removeClass(n.activeClass),e.data("scrollSpy:id")<l[0].data("scrollSpy:id")?l.unshift(t(this)):l.push(t(this))):l.push(t(this)),t(n.getActiveElement(l[0].attr("id"))).addClass(n.activeClass)}),e.on("scrollSpy:exit",function(){if((l=t.grep(l,function(t){return 0!=t.height()}))[0]){t(n.getActiveElement(l[0].attr("id"))).removeClass(n.activeClass);var e=t(this);(l=t.grep(l,function(t){return t.attr("id")!=e.attr("id")}))[0]&&t(n.getActiveElement(l[0].attr("id"))).addClass(n.activeClass)}}),e},t.winSizeSpy=function(e){return t.winSizeSpy=function(){return o},e=e||{throttle:100},o.on("resize",Materialize.throttle(n,e.throttle||100))},t.fn.scrollSpy=function(e){return t.scrollSpy(t(this),e)}}(jQuery),function(t){t(document).ready(function(){function e(e){var i=e.css("font-family"),o=e.css("font-size"),a=e.css("line-height"),r=e.css("padding");o&&n.css("font-size",o),i&&n.css("font-family",i),a&&n.css("line-height",a),r&&n.css("padding",r),e.data("original-height")||e.data("original-height",e.height()),"off"===e.attr("wrap")&&n.css("overflow-wrap","normal").css("white-space","pre"),n.text(e.val()+"\n");var s=n.html().replace(/\n/g,"<br>");n.html(s),e.is(":visible")?n.css("width",e.width()):n.css("width",t(window).width()/2),e.data("original-height")<=n.height()?e.css("height",n.height()):e.val().length<e.data("previous-length")&&e.css("height",e.data("original-height")),e.data("previous-length",e.val().length)}Materialize.updateTextFields=function(){t("input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea").each(function(e,i){var n=t(this);t(i).val().length>0||t(i).is(":focus")||i.autofocus||void 0!==n.attr("placeholder")?n.siblings("label").addClass("active"):t(i)[0].validity?n.siblings("label").toggleClass("active",!0===t(i)[0].validity.badInput):n.siblings("label").removeClass("active")})};var i="input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea";t(document).on("change",i,function(){0===t(this).val().length&&void 0===t(this).attr("placeholder")||t(this).siblings("label").addClass("active"),validate_field(t(this))}),t(document).ready(function(){Materialize.updateTextFields()}),t(document).on("reset",function(e){var n=t(e.target);n.is("form")&&(n.find(i).removeClass("valid").removeClass("invalid"),n.find(i).each(function(){""===t(this).attr("value")&&t(this).siblings("label").removeClass("active")}),n.find("select.initialized").each(function(){var t=n.find("option[selected]").text();n.siblings("input.select-dropdown").val(t)}))}),t(document).on("focus",i,function(){t(this).siblings("label, .prefix").addClass("active")}),t(document).on("blur",i,function(){var e=t(this),i=".prefix";0===e.val().length&&!0!==e[0].validity.badInput&&void 0===e.attr("placeholder")&&(i+=", label"),e.siblings(i).removeClass("active"),validate_field(e)}),window.validate_field=function(t){var e=void 0!==t.attr("data-length"),i=parseInt(t.attr("data-length")),n=t.val().length;0!==t.val().length||!1!==t[0].validity.badInput||t.is(":required")?t.hasClass("validate")&&(t.is(":valid")&&e&&n<=i||t.is(":valid")&&!e?(t.removeClass("invalid"),t.addClass("valid")):(t.removeClass("valid"),t.addClass("invalid"))):t.hasClass("validate")&&(t.removeClass("valid"),t.removeClass("invalid"))};t(document).on("keyup.radio","input[type=radio], input[type=checkbox]",function(e){if(9===e.which)return t(this).addClass("tabbed"),void t(this).one("blur",function(e){t(this).removeClass("tabbed")})});var n=t(".hiddendiv").first();n.length||(n=t('<div class="hiddendiv common"></div>'),t("body").append(n));t(".materialize-textarea").each(function(){var e=t(this);e.data("original-height",e.height()),e.data("previous-length",e.val().length)}),t("body").on("keyup keydown autoresize",".materialize-textarea",function(){e(t(this))}),t(document).on("change",'.file-field input[type="file"]',function(){for(var e=t(this).closest(".file-field").find("input.file-path"),i=t(this)[0].files,n=[],o=0;o<i.length;o++)n.push(i[o].name);e.val(n.join(", ")),e.trigger("change")});var o="input[type=range]",a=!1;t(o).each(function(){var e=t('<span class="thumb"><span class="value"></span></span>');t(this).after(e)});var r=function(t){var e=-7+parseInt(t.parent().css("padding-left"))+"px";t.velocity({height:"30px",width:"30px",top:"-30px",marginLeft:e},{duration:300,easing:"easeOutExpo"})},s=function(t){var e=t.width()-15,i=parseFloat(t.attr("max")),n=parseFloat(t.attr("min"));return(parseFloat(t.val())-n)/(i-n)*e};t(document).on("change",o,function(e){var i=t(this).siblings(".thumb");i.find(".value").html(t(this).val()),i.hasClass("active")||r(i);var n=s(t(this));i.addClass("active").css("left",n)}),t(document).on("mousedown touchstart",o,function(e){var i=t(this).siblings(".thumb");if(i.length<=0&&(i=t('<span class="thumb"><span class="value"></span></span>'),t(this).after(i)),i.find(".value").html(t(this).val()),a=!0,t(this).addClass("active"),i.hasClass("active")||r(i),"input"!==e.type){var n=s(t(this));i.addClass("active").css("left",n)}}),t(document).on("mouseup touchend",".range-field",function(){a=!1,t(this).removeClass("active")}),t(document).on("input mousemove touchmove",".range-field",function(e){var i=t(this).children(".thumb"),n=t(this).find(o);if(a){i.hasClass("active")||r(i);var l=s(n);i.addClass("active").css("left",l),i.find(".value").html(i.siblings(o).val())}}),t(document).on("mouseout touchleave",".range-field",function(){if(!a){var e=t(this).children(".thumb"),i=7+parseInt(t(this).css("padding-left"))+"px";e.hasClass("active")&&e.velocity({height:"0",width:"0",top:"10px",marginLeft:i},{duration:100}),e.removeClass("active")}}),t.fn.autocomplete=function(e){var i={data:{},limit:1/0,onAutocomplete:null,minLength:1};return e=t.extend(i,e),this.each(function(){var i,n=t(this),o=e.data,a=0,r=-1,s=n.closest(".input-field");if(t.isEmptyObject(o))n.off("keyup.autocomplete focus.autocomplete");else{var l,c=t('<ul class="autocomplete-content dropdown-content"></ul>');s.length?(l=s.children(".autocomplete-content.dropdown-content").first()).length||s.append(c):(l=n.next(".autocomplete-content.dropdown-content")).length||n.after(c),l.length&&(c=l);var u=function(t,e){var i=e.find("img"),n=e.text().toLowerCase().indexOf(""+t.toLowerCase()),o=n+t.length-1,a=e.text().slice(0,n),r=e.text().slice(n,o+1),s=e.text().slice(o+1);e.html("<span>"+a+"<span class='highlight'>"+r+"</span>"+s+"</span>"),i.length&&e.prepend(i)},d=function(){r=-1,c.find(".active").removeClass("active")},p=function(){c.empty(),d(),i=void 0};n.off("blur.autocomplete").on("blur.autocomplete",function(){p()}),n.off("keyup.autocomplete focus.autocomplete").on("keyup.autocomplete focus.autocomplete",function(r){a=0;var s=n.val().toLowerCase();if(13!==r.which&&38!==r.which&&40!==r.which){if(i!==s&&(p(),s.length>=e.minLength))for(var l in o)if(o.hasOwnProperty(l)&&-1!==l.toLowerCase().indexOf(s)){if(a>=e.limit)break;var d=t("<li></li>");o[l]?d.append('<img src="'+o[l]+'" class="right circle"><span>'+l+"</span>"):d.append("<span>"+l+"</span>"),c.append(d),u(s,d),a++}i=s}}),n.off("keydown.autocomplete").on("keydown.autocomplete",function(t){var e,i=t.which,n=c.children("li").length,o=c.children(".active").first();13===i&&r>=0?(e=c.children("li").eq(r)).length&&(e.trigger("mousedown.autocomplete"),t.preventDefault()):38!==i&&40!==i||(t.preventDefault(),38===i&&r>0&&r--,40===i&&r<n-1&&r++,o.removeClass("active"),r>=0&&c.children("li").eq(r).addClass("active"))}),c.off("mousedown.autocomplete touchstart.autocomplete").on("mousedown.autocomplete touchstart.autocomplete","li",function(){var i=t(this).text().trim();n.val(i),n.trigger("change"),p(),"function"==typeof e.onAutocomplete&&e.onAutocomplete.call(this,i)})}})}}),t.fn.material_select=function(e){function i(t,e,i){var o=t.indexOf(e),a=-1===o;return a?t.push(e):t.splice(o,1),i.siblings("ul.dropdown-content").find("li:not(.optgroup)").eq(e).toggleClass("active"),i.find("option").eq(e).prop("selected",a),n(t,i),a}function n(t,e){for(var i="",n=0,o=t.length;n<o;n++){var a=e.find("option").eq(t[n]).text();i+=0===n?a:", "+a}""===i&&(i=e.find("option:disabled").eq(0).text()),e.siblings("input.select-dropdown").val(i)}t(this).each(function(){var n=t(this);if(!n.hasClass("browser-default")){var o=!!n.attr("multiple"),a=n.attr("data-select-id");if(a&&(n.parent().find("span.caret").remove(),n.parent().find("input").remove(),n.unwrap(),t("ul#select-options-"+a).remove()),"destroy"===e)return n.removeAttr("data-select-id").removeClass("initialized"),void t(window).off("click.select");var r=Materialize.guid();n.attr("data-select-id",r);var s=t('<div class="select-wrapper"></div>');s.addClass(n.attr("class")),n.is(":disabled")&&s.addClass("disabled");var l=t('<ul id="select-options-'+r+'" class="dropdown-content select-dropdown '+(o?"multiple-select-dropdown":"")+'"></ul>'),c=n.children("option, optgroup"),u=[],d=!1,p=n.find("option:selected").html()||n.find("option:first").html()||"",h=function(e,i,n){var a=i.is(":disabled")?"disabled ":"",r="optgroup-option"===n?"optgroup-option ":"",s=o?'<input type="checkbox"'+a+"/><label></label>":"",c=i.data("icon"),u=i.attr("class");if(c){var d="";return u&&(d=' class="'+u+'"'),l.append(t('<li class="'+a+r+'"><img alt="" src="'+c+'"'+d+"><span>"+s+i.html()+"</span></li>")),!0}l.append(t('<li class="'+a+r+'"><span>'+s+i.html()+"</span></li>"))};c.length&&c.each(function(){if(t(this).is("option"))o?h(0,t(this),"multiple"):h(0,t(this));else if(t(this).is("optgroup")){var e=t(this).children("option");l.append(t('<li class="optgroup"><span>'+t(this).attr("label")+"</span></li>")),e.each(function(){h(0,t(this),"optgroup-option")})}}),l.find("li:not(.optgroup)").each(function(a){t(this).click(function(r){if(!t(this).hasClass("disabled")&&!t(this).hasClass("optgroup")){var s=!0;o?(t('input[type="checkbox"]',this).prop("checked",function(t,e){return!e}),s=i(u,a,n),m.trigger("focus")):(l.find("li").removeClass("active"),t(this).toggleClass("active"),m.val(t(this).text())),g(l,t(this)),n.find("option").eq(a).prop("selected",s),n.trigger("change"),void 0!==e&&e()}r.stopPropagation()})}),n.wrap(s);var f=t('<span class="caret">▼</span>'),v=p.replace(/"/g,"""),m=t('<input type="text" class="select-dropdown" readonly="true" '+(n.is(":disabled")?"disabled":"")+' data-activates="select-options-'+r+'" value="'+v+'"/>');n.before(m),m.before(f),m.after(l),n.is(":disabled")||m.dropdown({hover:!1}),n.attr("tabindex")&&t(m[0]).attr("tabindex",n.attr("tabindex")),n.addClass("initialized"),m.on({focus:function(){if(t("ul.select-dropdown").not(l[0]).is(":visible")&&(t("input.select-dropdown").trigger("close"),t(window).off("click.select")),!l.is(":visible")){t(this).trigger("open",["focus"]);var e=t(this).val();o&&e.indexOf(",")>=0&&(e=e.split(",")[0]);var i=l.find("li").filter(function(){return t(this).text().toLowerCase()===e.toLowerCase()})[0];g(l,i,!0),t(window).off("click.select").on("click.select",function(){o&&(d||m.trigger("close")),t(window).off("click.select")})}},click:function(t){t.stopPropagation()}}),m.on("blur",function(){o||(t(this).trigger("close"),t(window).off("click.select")),l.find("li.selected").removeClass("selected")}),l.hover(function(){d=!0},function(){d=!1}),o&&n.find("option:selected:not(:disabled)").each(function(){var t=this.index;i(u,t,n),l.find("li:not(.optgroup)").eq(t).find(":checkbox").prop("checked",!0)});var g=function(e,i,n){if(i){e.find("li.selected").removeClass("selected");var a=t(i);a.addClass("selected"),o&&!n||l.scrollTo(a)}},y=[];m.on("keydown",function(e){if(9!=e.which)if(40!=e.which||l.is(":visible")){if(13!=e.which||l.is(":visible")){e.preventDefault();var i=String.fromCharCode(e.which).toLowerCase(),n=[9,13,27,38,40];if(i&&-1===n.indexOf(e.which)){y.push(i);var a=y.join(""),r=l.find("li").filter(function(){return 0===t(this).text().toLowerCase().indexOf(a)})[0];r&&g(l,r)}if(13==e.which){var s=l.find("li.selected:not(.disabled)")[0];s&&(t(s).trigger("click"),o||m.trigger("close"))}40==e.which&&(r=l.find("li.selected").length?l.find("li.selected").next("li:not(.disabled)")[0]:l.find("li:not(.disabled)")[0],g(l,r)),27==e.which&&m.trigger("close"),38==e.which&&(r=l.find("li.selected").prev("li:not(.disabled)")[0])&&g(l,r),setTimeout(function(){y=[]},1e3)}}else m.trigger("open");else m.trigger("close")})}})}}(jQuery),function(t){var e={init:function(e){var i={indicators:!0,height:400,transition:500,interval:6e3};return e=t.extend(i,e),this.each(function(){function i(t,e){t.hasClass("center-align")?t.velocity({opacity:0,translateY:-100},{duration:e,queue:!1}):t.hasClass("right-align")?t.velocity({opacity:0,translateX:100},{duration:e,queue:!1}):t.hasClass("left-align")&&t.velocity({opacity:0,translateX:-100},{duration:e,queue:!1})}function n(t){t>=c.length?t=0:t<0&&(t=c.length-1),(u=l.find(".active").index())!=t&&(o=c.eq(u),$caption=o.find(".caption"),o.removeClass("active"),o.velocity({opacity:0},{duration:e.transition,queue:!1,easing:"easeOutQuad",complete:function(){c.not(".active").velocity({opacity:0,translateX:0,translateY:0},{duration:0,queue:!1})}}),i($caption,e.transition),e.indicators&&a.eq(u).removeClass("active"),c.eq(t).velocity({opacity:1},{duration:e.transition,queue:!1,easing:"easeOutQuad"}),c.eq(t).find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:e.transition,delay:e.transition,queue:!1,easing:"easeOutQuad"}),c.eq(t).addClass("active"),e.indicators&&a.eq(t).addClass("active"))}var o,a,r,s=t(this),l=s.find("ul.slides").first(),c=l.find("> li"),u=l.find(".active").index();-1!=u&&(o=c.eq(u)),s.hasClass("fullscreen")||(e.indicators?s.height(e.height+40):s.height(e.height),l.height(e.height)),c.find(".caption").each(function(){i(t(this),0)}),c.find("img").each(function(){var e="data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==";t(this).attr("src")!==e&&(t(this).css("background-image",'url("'+t(this).attr("src")+'")'),t(this).attr("src",e))}),e.indicators&&(a=t('<ul class="indicators"></ul>'),c.each(function(i){var o=t('<li class="indicator-item"></li>');o.click(function(){n(l.parent().find(t(this)).index()),clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval)}),a.append(o)}),s.append(a),a=s.find("ul.indicators").find("li.indicator-item")),o?o.show():(c.first().addClass("active").velocity({opacity:1},{duration:e.transition,queue:!1,easing:"easeOutQuad"}),u=0,o=c.eq(u),e.indicators&&a.eq(u).addClass("active")),o.find("img").each(function(){o.find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:e.transition,queue:!1,easing:"easeOutQuad"})}),r=setInterval(function(){n((u=l.find(".active").index())+1)},e.transition+e.interval);var d=!1,p=!1,h=!1;s.hammer({prevent_default:!1}).on("pan",function(t){if("touch"===t.gesture.pointerType){clearInterval(r);var e=t.gesture.direction,i=t.gesture.deltaX,n=t.gesture.velocityX,o=t.gesture.velocityY;$curr_slide=l.find(".active"),Math.abs(n)>Math.abs(o)&&$curr_slide.velocity({translateX:i},{duration:50,queue:!1,easing:"easeOutQuad"}),4===e&&(i>s.innerWidth()/2||n<-.65)?h=!0:2===e&&(i<-1*s.innerWidth()/2||n>.65)&&(p=!0);var a;p&&(0===(a=$curr_slide.next()).length&&(a=c.first()),a.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"})),h&&(0===(a=$curr_slide.prev()).length&&(a=c.last()),a.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"}))}}).on("panend",function(t){"touch"===t.gesture.pointerType&&($curr_slide=l.find(".active"),d=!1,curr_index=l.find(".active").index(),!h&&!p||c.length<=1?$curr_slide.velocity({translateX:0},{duration:300,queue:!1,easing:"easeOutQuad"}):p?(n(curr_index+1),$curr_slide.velocity({translateX:-1*s.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})):h&&(n(curr_index-1),$curr_slide.velocity({translateX:s.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})),p=!1,h=!1,clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval))}),s.on("sliderPause",function(){clearInterval(r)}),s.on("sliderStart",function(){clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval)}),s.on("sliderNext",function(){n((u=l.find(".active").index())+1)}),s.on("sliderPrev",function(){n((u=l.find(".active").index())-1)})})},pause:function(){t(this).trigger("sliderPause")},start:function(){t(this).trigger("sliderStart")},next:function(){t(this).trigger("sliderNext")},prev:function(){t(this).trigger("sliderPrev")}};t.fn.slider=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.tooltip"):e.init.apply(this,arguments)}}(jQuery),function(t){t(document).ready(function(){t(document).on("click.card",".card",function(e){if(t(this).find("> .card-reveal").length){var i=t(e.target).closest(".card");void 0===i.data("initialOverflow")&&i.data("initialOverflow",void 0===i.css("overflow")?"":i.css("overflow")),t(e.target).is(t(".card-reveal .card-title"))||t(e.target).is(t(".card-reveal .card-title i"))?t(this).find(".card-reveal").velocity({translateY:0},{duration:225,queue:!1,easing:"easeInOutQuad",complete:function(){t(this).css({display:"none"}),i.css("overflow",i.data("initialOverflow"))}}):(t(e.target).is(t(".card .activator"))||t(e.target).is(t(".card .activator i")))&&(i.css("overflow","hidden"),t(this).find(".card-reveal").css({display:"block"}).velocity("stop",!1).velocity({translateY:"-100%"},{duration:300,queue:!1,easing:"easeInOutQuad"}))}})})}(jQuery),function(t){var e={data:[],placeholder:"",secondaryPlaceholder:"",autocompleteOptions:{}};t(document).ready(function(){t(document).on("click",".chip .close",function(e){t(this).closest(".chips").attr("data-initialized")||t(this).closest(".chip").remove()})}),t.fn.material_chip=function(i){var n=this;if(this.$el=t(this),this.$document=t(document),this.SELS={CHIPS:".chips",CHIP:".chip",INPUT:"input",DELETE:".material-icons",SELECTED_CHIP:".selected"},"data"===i)return this.$el.data("chips");var o=t.extend({},e,i);n.hasAutocomplete=!t.isEmptyObject(o.autocompleteOptions.data),this.init=function(){var e=0;n.$el.each(function(){var i=t(this),a=Materialize.guid();n.chipId=a,o.data&&o.data instanceof Array||(o.data=[]),i.data("chips",o.data),i.attr("data-index",e),i.attr("data-initialized",!0),i.hasClass(n.SELS.CHIPS)||i.addClass("chips"),n.chips(i,a),e++})},this.handleEvents=function(){var e=n.SELS;n.$document.off("click.chips-focus",e.CHIPS).on("click.chips-focus",e.CHIPS,function(i){t(i.target).find(e.INPUT).focus()}),n.$document.off("click.chips-select",e.CHIP).on("click.chips-select",e.CHIP,function(i){var o=t(i.target);if(o.length){var a=o.hasClass("selected"),r=o.closest(e.CHIPS);t(e.CHIP).removeClass("selected"),a||n.selectChip(o.index(),r)}}),n.$document.off("keydown.chips").on("keydown.chips",function(i){if(!t(i.target).is("input, textarea")){var o,a=n.$document.find(e.CHIP+e.SELECTED_CHIP),r=a.closest(e.CHIPS),s=a.siblings(e.CHIP).length;if(a.length)if(8===i.which||46===i.which){i.preventDefault(),o=a.index(),n.deleteChip(o,r);var l=null;o+1<s?l=o:o!==s&&o+1!==s||(l=s-1),l<0&&(l=null),null!==l&&n.selectChip(l,r),s||r.find("input").focus()}else if(37===i.which){if((o=a.index()-1)<0)return;t(e.CHIP).removeClass("selected"),n.selectChip(o,r)}else if(39===i.which){if(o=a.index()+1,t(e.CHIP).removeClass("selected"),o>s)return void r.find("input").focus();n.selectChip(o,r)}}}),n.$document.off("focusin.chips",e.CHIPS+" "+e.INPUT).on("focusin.chips",e.CHIPS+" "+e.INPUT,function(i){var n=t(i.target).closest(e.CHIPS);n.addClass("focus"),n.siblings("label, .prefix").addClass("active"),t(e.CHIP).removeClass("selected")}),n.$document.off("focusout.chips",e.CHIPS+" "+e.INPUT).on("focusout.chips",e.CHIPS+" "+e.INPUT,function(i){var n=t(i.target).closest(e.CHIPS);n.removeClass("focus"),void 0!==n.data("chips")&&n.data("chips").length||n.siblings("label").removeClass("active"),n.siblings(".prefix").removeClass("active")}),n.$document.off("keydown.chips-add",e.CHIPS+" "+e.INPUT).on("keydown.chips-add",e.CHIPS+" "+e.INPUT,function(i){var o=t(i.target),a=o.closest(e.CHIPS),r=a.children(e.CHIP).length;if(13===i.which){if(n.hasAutocomplete&&a.find(".autocomplete-content.dropdown-content").length&&a.find(".autocomplete-content.dropdown-content").children().length)return;return i.preventDefault(),n.addChip({tag:o.val()},a),void o.val("")}if((8===i.keyCode||37===i.keyCode)&&""===o.val()&&r)return i.preventDefault(),n.selectChip(r-1,a),void o.blur()}),n.$document.off("click.chips-delete",e.CHIPS+" "+e.DELETE).on("click.chips-delete",e.CHIPS+" "+e.DELETE,function(i){var o=t(i.target),a=o.closest(e.CHIPS),r=o.closest(e.CHIP);i.stopPropagation(),n.deleteChip(r.index(),a),a.find("input").focus()})},this.chips=function(e,i){e.empty(),e.data("chips").forEach(function(t){e.append(n.renderChip(t))}),e.append(t('<input id="'+i+'" class="input" placeholder="">')),n.setPlaceholder(e);var a=e.next("label");a.length&&(a.attr("for",i),void 0!==e.data("chips")&&e.data("chips").length&&a.addClass("active"));var r=t("#"+i);n.hasAutocomplete&&(o.autocompleteOptions.onAutocomplete=function(t){n.addChip({tag:t},e),r.val(""),r.focus()},r.autocomplete(o.autocompleteOptions))},this.renderChip=function(e){if(e.tag){var i=t('<div class="chip"></div>');return i.text(e.tag),e.image&&i.prepend(t("<img />").attr("src",e.image)),i.append(t('<i class="material-icons close">close</i>')),i}},this.setPlaceholder=function(t){void 0!==t.data("chips")&&!t.data("chips").length&&o.placeholder?t.find("input").prop("placeholder",o.placeholder):(void 0===t.data("chips")||t.data("chips").length)&&o.secondaryPlaceholder&&t.find("input").prop("placeholder",o.secondaryPlaceholder)},this.isValid=function(t,e){for(var i=t.data("chips"),n=!1,o=0;o<i.length;o++)if(i[o].tag===e.tag)return void(n=!0);return""!==e.tag&&!n},this.addChip=function(t,e){if(n.isValid(e,t)){for(var i=n.renderChip(t),o=[],a=e.data("chips"),r=0;r<a.length;r++)o.push(a[r]);o.push(t),e.data("chips",o),i.insertBefore(e.find("input")),e.trigger("chip.add",t),n.setPlaceholder(e)}},this.deleteChip=function(t,e){var i=e.data("chips")[t];e.find(".chip").eq(t).remove();for(var o=[],a=e.data("chips"),r=0;r<a.length;r++)r!==t&&o.push(a[r]);e.data("chips",o),e.trigger("chip.delete",i),n.setPlaceholder(e)},this.selectChip=function(t,e){var i=e.find(".chip").eq(t);i&&!1===i.hasClass("selected")&&(i.addClass("selected"),e.trigger("chip.select",e.data("chips")[t]))},this.getChipsElement=function(t,e){return e.eq(t)},this.init(),this.handleEvents()}}(jQuery),function(t){t.fn.pushpin=function(e){var i={top:0,bottom:1/0,offset:0};return"remove"===e?(this.each(function(){(id=t(this).data("pushpin-id"))&&(t(window).off("scroll."+id),t(this).removeData("pushpin-id").removeClass("pin-top pinned pin-bottom").removeAttr("style"))}),!1):(e=t.extend(i,e),$index=0,this.each(function(){function i(t){t.removeClass("pin-top"),t.removeClass("pinned"),t.removeClass("pin-bottom")}function n(n,o){n.each(function(){e.top<=o&&e.bottom>=o&&!t(this).hasClass("pinned")&&(i(t(this)),t(this).css("top",e.offset),t(this).addClass("pinned")),o<e.top&&!t(this).hasClass("pin-top")&&(i(t(this)),t(this).css("top",0),t(this).addClass("pin-top")),o>e.bottom&&!t(this).hasClass("pin-bottom")&&(i(t(this)),t(this).addClass("pin-bottom"),t(this).css("top",e.bottom-r))})}var o=Materialize.guid(),a=t(this),r=t(this).offset().top;t(this).data("pushpin-id",o),n(a,t(window).scrollTop()),t(window).on("scroll."+o,function(){var i=t(window).scrollTop()+e.offset;n(a,i)})}))}}(jQuery),function(t){t(document).ready(function(){t.fn.reverse=[].reverse,t(document).on("mouseenter.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(i){var n=t(this);e(n)}),t(document).on("mouseleave.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(e){var n=t(this);i(n)}),t(document).on("click.fabClickToggle",".fixed-action-btn.click-to-toggle > a",function(n){var o=t(this).parent();o.hasClass("active")?i(o):e(o)}),t(document).on("click.fabToolbar",".fixed-action-btn.toolbar > a",function(e){var i=t(this).parent();n(i)})}),t.fn.extend({openFAB:function(){e(t(this))},closeFAB:function(){i(t(this))},openToolbar:function(){n(t(this))},closeToolbar:function(){o(t(this))}});var e=function(e){var i=e;if(!1===i.hasClass("active")){var n,o;!0===i.hasClass("horizontal")?o=40:n=40,i.addClass("active"),i.find("ul .btn-floating").velocity({scaleY:".4",scaleX:".4",translateY:n+"px",translateX:o+"px"},{duration:0});var a=0;i.find("ul .btn-floating").reverse().each(function(){t(this).velocity({opacity:"1",scaleX:"1",scaleY:"1",translateY:"0",translateX:"0"},{duration:80,delay:a}),a+=40})}},i=function(t){var e,i,n=t;!0===n.hasClass("horizontal")?i=40:e=40,n.removeClass("active");n.find("ul .btn-floating").velocity("stop",!0),n.find("ul .btn-floating").velocity({opacity:"0",scaleX:".4",scaleY:".4",translateY:e+"px",translateX:i+"px"},{duration:80})},n=function(e){if("true"!==e.attr("data-open")){var i,n,a,r=window.innerWidth,s=window.innerHeight,l=e[0].getBoundingClientRect(),c=e.find("> a").first(),u=e.find("> ul").first(),d=t('<div class="fab-backdrop"></div>'),p=c.css("background-color");c.append(d),i=l.left-r/2+l.width/2,n=s-l.bottom,a=r/d.width(),e.attr("data-origin-bottom",l.bottom),e.attr("data-origin-left",l.left),e.attr("data-origin-width",l.width),e.addClass("active"),e.attr("data-open",!0),e.css({"text-align":"center",width:"100%",bottom:0,left:0,transform:"translateX("+i+"px)",transition:"none"}),c.css({transform:"translateY("+-n+"px)",transition:"none"}),d.css({"background-color":p}),setTimeout(function(){e.css({transform:"",transition:"transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s"}),c.css({overflow:"visible",transform:"",transition:"transform .2s"}),setTimeout(function(){e.css({overflow:"hidden","background-color":p}),d.css({transform:"scale("+a+")",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"}),u.find("> li > a").css({opacity:1}),t(window).on("scroll.fabToolbarClose",function(){o(e),t(window).off("scroll.fabToolbarClose"),t(document).off("click.fabToolbarClose")}),t(document).on("click.fabToolbarClose",function(i){t(i.target).closest(u).length||(o(e),t(window).off("scroll.fabToolbarClose"),t(document).off("click.fabToolbarClose"))})},100)},0)}},o=function(t){if("true"===t.attr("data-open")){var e,i,n=window.innerWidth,o=window.innerHeight,a=t.attr("data-origin-width"),r=t.attr("data-origin-bottom"),s=t.attr("data-origin-left"),l=t.find("> .btn-floating").first(),c=t.find("> ul").first(),u=t.find(".fab-backdrop"),d=l.css("background-color");e=s-n/2+a/2,i=o-r,n/u.width(),t.removeClass("active"),t.attr("data-open",!1),t.css({"background-color":"transparent",transition:"none"}),l.css({transition:"none"}),u.css({transform:"scale(0)","background-color":d}),c.find("> li > a").css({opacity:""}),setTimeout(function(){u.remove(),t.css({"text-align":"",width:"",bottom:"",left:"",overflow:"","background-color":"",transform:"translate3d("+-e+"px,0,0)"}),l.css({overflow:"",transform:"translate3d(0,"+i+"px,0)"}),setTimeout(function(){t.css({transform:"translate3d(0,0,0)",transition:"transform .2s"}),l.css({transform:"translate3d(0,0,0)",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"})},20)},200)}}}(jQuery),function(t){Materialize.fadeInImage=function(e){var i;if("string"==typeof e)i=t(e);else{if("object"!=typeof e)return;i=e}i.css({opacity:0}),t(i).velocity({opacity:1},{duration:650,queue:!1,easing:"easeOutSine"}),t(i).velocity({opacity:1},{duration:1300,queue:!1,easing:"swing",step:function(e,i){i.start=100;var n=e/100,o=150-(100-e)/1.75;o<100&&(o=100),e>=0&&t(this).css({"-webkit-filter":"grayscale("+n+")brightness("+o+"%)",filter:"grayscale("+n+")brightness("+o+"%)"})}})},Materialize.showStaggeredList=function(e){var i;if("string"==typeof e)i=t(e);else{if("object"!=typeof e)return;i=e}var n=0;i.find("li").velocity({translateX:"-100px"},{duration:0}),i.find("li").each(function(){t(this).velocity({opacity:"1",translateX:"0"},{duration:800,delay:n,easing:[60,10]}),n+=120})},t(document).ready(function(){var e=!1,i=!1;t(".dismissable").each(function(){t(this).hammer({prevent_default:!1}).on("pan",function(n){if("touch"===n.gesture.pointerType){var o=t(this),a=n.gesture.direction,r=n.gesture.deltaX,s=n.gesture.velocityX;o.velocity({translateX:r},{duration:50,queue:!1,easing:"easeOutQuad"}),4===a&&(r>o.innerWidth()/2||s<-.75)&&(e=!0),2===a&&(r<-1*o.innerWidth()/2||s>.75)&&(i=!0)}}).on("panend",function(n){if(Math.abs(n.gesture.deltaX)<t(this).innerWidth()/2&&(i=!1,e=!1),"touch"===n.gesture.pointerType){var o=t(this);if(e||i){var a;a=e?o.innerWidth():-1*o.innerWidth(),o.velocity({translateX:a},{duration:100,queue:!1,easing:"easeOutQuad",complete:function(){o.css("border","none"),o.velocity({height:0,padding:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){o.remove()}})}})}else o.velocity({translateX:0},{duration:100,queue:!1,easing:"easeOutQuad"});e=!1,i=!1}})})})}(jQuery),function(t){var e=!1;Materialize.scrollFire=function(t){var i=function(){for(var e=window.pageYOffset+window.innerHeight,i=0;i<t.length;i++){var n=t[i],o=n.selector,a=n.offset,r=n.callback,s=document.querySelector(o);null!==s&&e>s.getBoundingClientRect().top+window.pageYOffset+a&&!0!==n.done&&("function"==typeof r?r.call(this,s):"string"==typeof r&&new Function(r)(s),n.done=!0)}},n=Materialize.throttle(function(){i()},t.throttle||100);e||(window.addEventListener("scroll",n),window.addEventListener("resize",n),e=!0),setTimeout(n,0)}}(jQuery),function(t){Materialize.Picker=t(jQuery)}(function(t){function e(a,s,u,d){function p(){return e._.node("div",e._.node("div",e._.node("div",e._.node("div",T.component.nodes(b.open),k.box),k.wrap),k.frame),k.holder)}function h(){x.data(s,T).addClass(k.input).attr("tabindex",-1).val(x.data("value")?T.get("select",w.format):a.value),w.editable||x.on("focus."+b.id+" click."+b.id,function(t){t.preventDefault(),T.$root.eq(0).focus()}).on("keydown."+b.id,m),o(a,{haspopup:!0,expanded:!1,readonly:!1,owns:a.id+"_root"})}function f(){T.$root.on({keydown:m,focusin:function(t){T.$root.removeClass(k.focused),t.stopPropagation()},"mousedown click":function(e){var i=e.target;i!=T.$root.children()[0]&&(e.stopPropagation(),"mousedown"!=e.type||t(i).is("input, select, textarea, button, option")||(e.preventDefault(),T.$root.eq(0).focus()))}}).on({focus:function(){x.addClass(k.target)},blur:function(){x.removeClass(k.target)}}).on("focus.toOpen",g).on("click","[data-pick], [data-nav], [data-clear], [data-close]",function(){var e=t(this),i=e.data(),n=e.hasClass(k.navDisabled)||e.hasClass(k.disabled),o=r();o=o&&(o.type||o.href)&&o,(n||o&&!t.contains(T.$root[0],o))&&T.$root.eq(0).focus(),!n&&i.nav?T.set("highlight",T.component.item.highlight,{nav:i.nav}):!n&&"pick"in i?(T.set("select",i.pick),w.closeOnSelect&&T.close(!0)):i.clear?(T.clear(),w.closeOnSelect&&T.close(!0)):i.close&&T.close(!0)}),o(T.$root[0],"hidden",!0)}function v(){var e;!0===w.hiddenName?(e=a.name,a.name=""):e=(e=["string"==typeof w.hiddenPrefix?w.hiddenPrefix:"","string"==typeof w.hiddenSuffix?w.hiddenSuffix:"_submit"])[0]+a.name+e[1],T._hidden=t('<input type=hidden name="'+e+'"'+(x.data("value")||a.value?' value="'+T.get("select",w.formatSubmit)+'"':"")+">")[0],x.on("change."+b.id,function(){T._hidden.value=a.value?T.get("select",w.formatSubmit):""}),w.container?t(w.container).append(T._hidden):x.before(T._hidden)}function m(t){var e=t.keyCode,i=/^(8|46)$/.test(e);if(27==e)return T.close(),!1;(32==e||i||!b.open&&T.component.key[e])&&(t.preventDefault(),t.stopPropagation(),i?T.clear().close():T.open())}function g(t){t.stopPropagation(),"focus"==t.type&&T.$root.addClass(k.focused),T.open()}if(!a)return e;var y=!1,b={id:a.id||"P"+Math.abs(~~(Math.random()*new Date))},w=u?t.extend(!0,{},u.defaults,d):d||{},k=t.extend({},e.klasses(),w.klass),x=t(a),C=function(){return this.start()},T=C.prototype={constructor:C,$node:x,start:function(){return b&&b.start?T:(b.methods={},b.start=!0,b.open=!1,b.type=a.type,a.autofocus=a==r(),a.readOnly=!w.editable,a.id=a.id||b.id,"text"!=a.type&&(a.type="text"),T.component=new u(T,w),T.$root=t(e._.node("div",p(),k.picker,'id="'+a.id+'_root" tabindex="0"')),f(),w.formatSubmit&&v(),h(),w.container?t(w.container).append(T.$root):x.before(T.$root),T.on({start:T.component.onStart,render:T.component.onRender,stop:T.component.onStop,open:T.component.onOpen,close:T.component.onClose,set:T.component.onSet}).on({start:w.onStart,render:w.onRender,stop:w.onStop,open:w.onOpen,close:w.onClose,set:w.onSet}),y=i(T.$root.children()[0]),a.autofocus&&T.open(),T.trigger("start").trigger("render"))},render:function(t){return t?T.$root.html(p()):T.$root.find("."+k.box).html(T.component.nodes(b.open)),T.trigger("render")},stop:function(){return b.start?(T.close(),T._hidden&&T._hidden.parentNode.removeChild(T._hidden),T.$root.remove(),x.removeClass(k.input).removeData(s),setTimeout(function(){x.off("."+b.id)},0),a.type=b.type,a.readOnly=!1,T.trigger("stop"),b.methods={},b.start=!1,T):T},open:function(i){return b.open?T:(x.addClass(k.active),o(a,"expanded",!0),setTimeout(function(){T.$root.addClass(k.opened),o(T.$root[0],"hidden",!1)},0),!1!==i&&(b.open=!0,y&&c.css("overflow","hidden").css("padding-right","+="+n()),T.$root.eq(0).focus(),l.on("click."+b.id+" focusin."+b.id,function(t){var e=t.target;e!=a&&e!=document&&3!=t.which&&T.close(e===T.$root.children()[0])}).on("keydown."+b.id,function(i){var n=i.keyCode,o=T.component.key[n],a=i.target;27==n?T.close(!0):a!=T.$root[0]||!o&&13!=n?t.contains(T.$root[0],a)&&13==n&&(i.preventDefault(),a.click()):(i.preventDefault(),o?e._.trigger(T.component.key.go,T,[e._.trigger(o)]):T.$root.find("."+k.highlighted).hasClass(k.disabled)||(T.set("select",T.component.item.highlight),w.closeOnSelect&&T.close(!0)))})),T.trigger("open"))},close:function(t){return t&&(T.$root.off("focus.toOpen").eq(0).focus(),setTimeout(function(){T.$root.on("focus.toOpen",g)},0)),x.removeClass(k.active),o(a,"expanded",!1),setTimeout(function(){T.$root.removeClass(k.opened+" "+k.focused),o(T.$root[0],"hidden",!0)},0),b.open?(b.open=!1,y&&c.css("overflow","").css("padding-right","-="+n()),l.off("."+b.id),T.trigger("close")):T},clear:function(t){return T.set("clear",null,t)},set:function(e,i,n){var o,a,r=t.isPlainObject(e),s=r?e:{};if(n=r&&t.isPlainObject(i)?i:n||{},e){r||(s[e]=i);for(o in s)a=s[o],o in T.component.item&&(void 0===a&&(a=null),T.component.set(o,a,n)),"select"!=o&&"clear"!=o||x.val("clear"==o?"":T.get(o,w.format)).trigger("change");T.render()}return n.muted?T:T.trigger("set",s)},get:function(t,i){if(t=t||"value",null!=b[t])return b[t];if("valueSubmit"==t){if(T._hidden)return T._hidden.value;t="value"}if("value"==t)return a.value;if(t in T.component.item){if("string"==typeof i){var n=T.component.get(t);return n?e._.trigger(T.component.formats.toString,T.component,[i,n]):""}return T.component.get(t)}},on:function(e,i,n){var o,a,r=t.isPlainObject(e),s=r?e:{};if(e){r||(s[e]=i);for(o in s)a=s[o],n&&(o="_"+o),b.methods[o]=b.methods[o]||[],b.methods[o].push(a)}return T},off:function(){var t,e,i=arguments;for(t=0,namesCount=i.length;t<namesCount;t+=1)(e=i[t])in b.methods&&delete b.methods[e];return T},trigger:function(t,i){var n=function(t){var n=b.methods[t];n&&n.map(function(t){e._.trigger(t,T,[i])})};return n("_"+t),n(t),T}};return new C}function i(t){var e;return t.currentStyle?e=t.currentStyle.position:window.getComputedStyle&&(e=getComputedStyle(t).position),"fixed"==e}function n(){if(c.height()<=s.height())return 0;var e=t('<div style="visibility:hidden;width:100px" />').appendTo("body"),i=e[0].offsetWidth;e.css("overflow","scroll");var n=t('<div style="width:100%" />').appendTo(e)[0].offsetWidth;return e.remove(),i-n}function o(e,i,n){if(t.isPlainObject(i))for(var o in i)a(e,o,i[o]);else a(e,i,n)}function a(t,e,i){t.setAttribute(("role"==e?"":"aria-")+e,i)}function r(){try{return document.activeElement}catch(t){}}var s=t(window),l=t(document),c=t(document.documentElement);return e.klasses=function(t){return t=t||"picker",{picker:t,opened:t+"--opened",focused:t+"--focused",input:t+"__input",active:t+"__input--active",target:t+"__input--target",holder:t+"__holder",frame:t+"__frame",wrap:t+"__wrap",box:t+"__box"}},e._={group:function(t){for(var i,n="",o=e._.trigger(t.min,t);o<=e._.trigger(t.max,t,[o]);o+=t.i)i=e._.trigger(t.item,t,[o]),n+=e._.node(t.node,i[0],i[1],i[2]);return n},node:function(e,i,n,o){return i?(i=t.isArray(i)?i.join(""):i,n=n?' class="'+n+'"':"",o=o?" "+o:"","<"+e+n+o+">"+i+"</"+e+">"):""},lead:function(t){return(t<10?"0":"")+t},trigger:function(t,e,i){return"function"==typeof t?t.apply(e,i||[]):t},digits:function(t){return/\d/.test(t[1])?2:1},isDate:function(t){return{}.toString.call(t).indexOf("Date")>-1&&this.isInteger(t.getDate())},isInteger:function(t){return{}.toString.call(t).indexOf("Number")>-1&&t%1==0},ariaAttr:function(e,i){t.isPlainObject(e)||(e={attribute:i}),i="";for(var n in e){var o=("role"==n?"":"aria-")+n;i+=null==e[n]?"":o+'="'+e[n]+'"'}return i}},e.extend=function(i,n){t.fn[i]=function(o,a){var r=this.data(i);return"picker"==o?r:r&&"string"==typeof o?e._.trigger(r[o],r,[a]):this.each(function(){t(this).data(i)||new e(this,i,n,o)})},t.fn[i].defaults=n.defaults},e}),function(t){t(Materialize.Picker,jQuery)}(function(t,e){function i(t,e){var i=this,n=t.$node[0],o=n.value,a=t.$node.data("value"),r=a||o,s=a?e.formatSubmit:e.format,l=function(){return n.currentStyle?"rtl"==n.currentStyle.direction:"rtl"==getComputedStyle(t.$root[0]).direction};i.settings=e,i.$node=t.$node,i.queue={min:"measure create",max:"measure create",now:"now create",select:"parse create validate",highlight:"parse navigate create validate",view:"parse create validate viewset",disable:"deactivate",enable:"activate"},i.item={},i.item.clear=null,i.item.disable=(e.disable||[]).slice(0),i.item.enable=-function(t){return!0===t[0]?t.shift():-1}(i.item.disable),i.set("min",e.min).set("max",e.max).set("now"),r?i.set("select",r,{format:s}):i.set("select",null).set("highlight",i.item.now),i.key={40:7,38:-7,39:function(){return l()?-1:1},37:function(){return l()?1:-1},go:function(t){var e=i.item.highlight,n=new Date(e.year,e.month,e.date+t);i.set("highlight",n,{interval:t}),this.render()}},t.on("render",function(){t.$root.find("."+e.klass.selectMonth).on("change",function(){var i=this.value;i&&(t.set("highlight",[t.get("view").year,i,t.get("highlight").date]),t.$root.find("."+e.klass.selectMonth).trigger("focus"))}),t.$root.find("."+e.klass.selectYear).on("change",function(){var i=this.value;i&&(t.set("highlight",[i,t.get("view").month,t.get("highlight").date]),t.$root.find("."+e.klass.selectYear).trigger("focus"))})},1).on("open",function(){var n="";i.disabled(i.get("now"))&&(n=":not(."+e.klass.buttonToday+")"),t.$root.find("button"+n+", select").attr("disabled",!1)},1).on("close",function(){t.$root.find("button, select").attr("disabled",!0)},1)}var n=t._;i.prototype.set=function(t,e,i){var n=this,o=n.item;return null===e?("clear"==t&&(t="select"),o[t]=e,n):(o["enable"==t?"disable":"flip"==t?"enable":t]=n.queue[t].split(" ").map(function(o){return e=n[o](t,e,i)}).pop(),"select"==t?n.set("highlight",o.select,i):"highlight"==t?n.set("view",o.highlight,i):t.match(/^(flip|min|max|disable|enable)$/)&&(o.select&&n.disabled(o.select)&&n.set("select",o.select,i),o.highlight&&n.disabled(o.highlight)&&n.set("highlight",o.highlight,i)),n)},i.prototype.get=function(t){return this.item[t]},i.prototype.create=function(t,i,o){var a,r=this;return i=void 0===i?t:i,i==-1/0||i==1/0?a=i:e.isPlainObject(i)&&n.isInteger(i.pick)?i=i.obj:e.isArray(i)?(i=new Date(i[0],i[1],i[2]),i=n.isDate(i)?i:r.create().obj):i=n.isInteger(i)||n.isDate(i)?r.normalize(new Date(i),o):r.now(t,i,o),{year:a||i.getFullYear(),month:a||i.getMonth(),date:a||i.getDate(),day:a||i.getDay(),obj:a||i,pick:a||i.getTime()}},i.prototype.createRange=function(t,i){var o=this,a=function(t){return!0===t||e.isArray(t)||n.isDate(t)?o.create(t):t};return n.isInteger(t)||(t=a(t)),n.isInteger(i)||(i=a(i)),n.isInteger(t)&&e.isPlainObject(i)?t=[i.year,i.month,i.date+t]:n.isInteger(i)&&e.isPlainObject(t)&&(i=[t.year,t.month,t.date+i]),{from:a(t),to:a(i)}},i.prototype.withinRange=function(t,e){return t=this.createRange(t.from,t.to),e.pick>=t.from.pick&&e.pick<=t.to.pick},i.prototype.overlapRanges=function(t,e){var i=this;return t=i.createRange(t.from,t.to),e=i.createRange(e.from,e.to),i.withinRange(t,e.from)||i.withinRange(t,e.to)||i.withinRange(e,t.from)||i.withinRange(e,t.to)},i.prototype.now=function(t,e,i){return e=new Date,i&&i.rel&&e.setDate(e.getDate()+i.rel),this.normalize(e,i)},i.prototype.navigate=function(t,i,n){var o,a,r,s,l=e.isArray(i),c=e.isPlainObject(i),u=this.item.view;if(l||c){for(c?(a=i.year,r=i.month,s=i.date):(a=+i[0],r=+i[1],s=+i[2]),n&&n.nav&&u&&u.month!==r&&(a=u.year,r=u.month),a=(o=new Date(a,r+(n&&n.nav?n.nav:0),1)).getFullYear(),r=o.getMonth();new Date(a,r,s).getMonth()!==r;)s-=1;i=[a,r,s]}return i},i.prototype.normalize=function(t){return t.setHours(0,0,0,0),t},i.prototype.measure=function(t,e){var i=this;return e?"string"==typeof e?e=i.parse(t,e):n.isInteger(e)&&(e=i.now(t,e,{rel:e})):e="min"==t?-1/0:1/0,e},i.prototype.viewset=function(t,e){return this.create([e.year,e.month,1])},i.prototype.validate=function(t,i,o){var a,r,s,l,c=this,u=i,d=o&&o.interval?o.interval:1,p=-1===c.item.enable,h=c.item.min,f=c.item.max,v=p&&c.item.disable.filter(function(t){if(e.isArray(t)){var o=c.create(t).pick;o<i.pick?a=!0:o>i.pick&&(r=!0)}return n.isInteger(t)}).length;if((!o||!o.nav)&&(!p&&c.disabled(i)||p&&c.disabled(i)&&(v||a||r)||!p&&(i.pick<=h.pick||i.pick>=f.pick)))for(p&&!v&&(!r&&d>0||!a&&d<0)&&(d*=-1);c.disabled(i)&&(Math.abs(d)>1&&(i.month<u.month||i.month>u.month)&&(i=u,d=d>0?1:-1),i.pick<=h.pick?(s=!0,d=1,i=c.create([h.year,h.month,h.date+(i.pick===h.pick?0:-1)])):i.pick>=f.pick&&(l=!0,d=-1,i=c.create([f.year,f.month,f.date+(i.pick===f.pick?0:1)])),!s||!l);)i=c.create([i.year,i.month,i.date+d]);return i},i.prototype.disabled=function(t){var i=this,o=i.item.disable.filter(function(o){return n.isInteger(o)?t.day===(i.settings.firstDay?o:o-1)%7:e.isArray(o)||n.isDate(o)?t.pick===i.create(o).pick:e.isPlainObject(o)?i.withinRange(o,t):void 0});return o=o.length&&!o.filter(function(t){return e.isArray(t)&&"inverted"==t[3]||e.isPlainObject(t)&&t.inverted}).length,-1===i.item.enable?!o:o||t.pick<i.item.min.pick||t.pick>i.item.max.pick},i.prototype.parse=function(t,e,i){var o=this,a={};return e&&"string"==typeof e?(i&&i.format||((i=i||{}).format=o.settings.format),o.formats.toArray(i.format).map(function(t){var i=o.formats[t],r=i?n.trigger(i,o,[e,a]):t.replace(/^!/,"").length;i&&(a[t]=e.substr(0,r)),e=e.substr(r)}),[a.yyyy||a.yy,+(a.mm||a.m)-1,a.dd||a.d]):e},i.prototype.formats=function(){function t(t,e,i){var n=t.match(/\w+/)[0];return i.mm||i.m||(i.m=e.indexOf(n)+1),n.length}function e(t){return t.match(/\w+/)[0].length}return{d:function(t,e){return t?n.digits(t):e.date},dd:function(t,e){return t?2:n.lead(e.date)},ddd:function(t,i){return t?e(t):this.settings.weekdaysShort[i.day]},dddd:function(t,i){return t?e(t):this.settings.weekdaysFull[i.day]},m:function(t,e){return t?n.digits(t):e.month+1},mm:function(t,e){return t?2:n.lead(e.month+1)},mmm:function(e,i){var n=this.settings.monthsShort;return e?t(e,n,i):n[i.month]},mmmm:function(e,i){var n=this.settings.monthsFull;return e?t(e,n,i):n[i.month]},yy:function(t,e){return t?2:(""+e.year).slice(2)},yyyy:function(t,e){return t?4:e.year},toArray:function(t){return t.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)},toString:function(t,e){var i=this;return i.formats.toArray(t).map(function(t){return n.trigger(i.formats[t],i,[0,e])||t.replace(/^!/,"")}).join("")}}}(),i.prototype.isDateExact=function(t,i){var o=this;return n.isInteger(t)&&n.isInteger(i)||"boolean"==typeof t&&"boolean"==typeof i?t===i:(n.isDate(t)||e.isArray(t))&&(n.isDate(i)||e.isArray(i))?o.create(t).pick===o.create(i).pick:!(!e.isPlainObject(t)||!e.isPlainObject(i))&&(o.isDateExact(t.from,i.from)&&o.isDateExact(t.to,i.to))},i.prototype.isDateOverlap=function(t,i){var o=this,a=o.settings.firstDay?1:0;return n.isInteger(t)&&(n.isDate(i)||e.isArray(i))?(t=t%7+a)===o.create(i).day+1:n.isInteger(i)&&(n.isDate(t)||e.isArray(t))?(i=i%7+a)===o.create(t).day+1:!(!e.isPlainObject(t)||!e.isPlainObject(i))&&o.overlapRanges(t,i)},i.prototype.flipEnable=function(t){var e=this.item;e.enable=t||(-1==e.enable?1:-1)},i.prototype.deactivate=function(t,i){var o=this,a=o.item.disable.slice(0);return"flip"==i?o.flipEnable():!1===i?(o.flipEnable(1),a=[]):!0===i?(o.flipEnable(-1),a=[]):i.map(function(t){for(var i,r=0;r<a.length;r+=1)if(o.isDateExact(t,a[r])){i=!0;break}i||(n.isInteger(t)||n.isDate(t)||e.isArray(t)||e.isPlainObject(t)&&t.from&&t.to)&&a.push(t)}),a},i.prototype.activate=function(t,i){var o=this,a=o.item.disable,r=a.length;return"flip"==i?o.flipEnable():!0===i?(o.flipEnable(1),a=[]):!1===i?(o.flipEnable(-1),a=[]):i.map(function(t){var i,s,l,c;for(l=0;l<r;l+=1){if(s=a[l],o.isDateExact(s,t)){i=a[l]=null,c=!0;break}if(o.isDateOverlap(s,t)){e.isPlainObject(t)?(t.inverted=!0,i=t):e.isArray(t)?(i=t)[3]||i.push("inverted"):n.isDate(t)&&(i=[t.getFullYear(),t.getMonth(),t.getDate(),"inverted"]);break}}if(i)for(l=0;l<r;l+=1)if(o.isDateExact(a[l],t)){a[l]=null;break}if(c)for(l=0;l<r;l+=1)if(o.isDateOverlap(a[l],t)){a[l]=null;break}i&&a.push(i)}),a.filter(function(t){return null!=t})},i.prototype.nodes=function(t){var e=this,i=e.settings,o=e.item,a=o.now,r=o.select,s=o.highlight,l=o.view,c=o.disable,u=o.min,d=o.max,p=function(t,e){return i.firstDay&&(t.push(t.shift()),e.push(e.shift())),n.node("thead",n.node("tr",n.group({min:0,max:6,i:1,node:"th",item:function(n){return[t[n],i.klass.weekdays,'scope=col title="'+e[n]+'"']}})))}((i.showWeekdaysFull?i.weekdaysFull:i.weekdaysLetter).slice(0),i.weekdaysFull.slice(0)),h=function(t){return n.node("div"," ",i.klass["nav"+(t?"Next":"Prev")]+(t&&l.year>=d.year&&l.month>=d.month||!t&&l.year<=u.year&&l.month<=u.month?" "+i.klass.navDisabled:""),"data-nav="+(t||-1)+" "+n.ariaAttr({role:"button",controls:e.$node[0].id+"_table"})+' title="'+(t?i.labelMonthNext:i.labelMonthPrev)+'"')},f=function(o){var a=i.showMonthsShort?i.monthsShort:i.monthsFull;return"short_months"==o&&(a=i.monthsShort),i.selectMonths&&void 0==o?n.node("select",n.group({min:0,max:11,i:1,node:"option",item:function(t){return[a[t],0,"value="+t+(l.month==t?" selected":"")+(l.year==u.year&&t<u.month||l.year==d.year&&t>d.month?" disabled":"")]}}),i.klass.selectMonth+" browser-default",(t?"":"disabled")+" "+n.ariaAttr({controls:e.$node[0].id+"_table"})+' title="'+i.labelMonthSelect+'"'):"short_months"==o?null!=r?a[r.month]:a[l.month]:n.node("div",a[l.month],i.klass.month)},v=function(o){var a=l.year,s=!0===i.selectYears?5:~~(i.selectYears/2);if(s){var c=u.year,p=d.year,h=a-s,f=a+s;if(c>h&&(f+=c-h,h=c),p<f){var v=h-c,m=f-p;h-=v>m?m:v,f=p}if(i.selectYears&&void 0==o)return n.node("select",n.group({min:h,max:f,i:1,node:"option",item:function(t){return[t,0,"value="+t+(a==t?" selected":"")]}}),i.klass.selectYear+" browser-default",(t?"":"disabled")+" "+n.ariaAttr({controls:e.$node[0].id+"_table"})+' title="'+i.labelYearSelect+'"')}return"raw"===o&&null!=r?n.node("div",r.year):n.node("div",a,i.klass.year)};return createDayLabel=function(){return null!=r?r.date:a.date},createWeekdayLabel=function(){var t;return t=null!=r?r.day:a.day,i.weekdaysShort[t]},n.node("div",n.node("div",v("raw"),i.klass.year_display)+n.node("span",createWeekdayLabel()+", ","picker__weekday-display")+n.node("span",f("short_months")+" ",i.klass.month_display)+n.node("span",createDayLabel(),i.klass.day_display),i.klass.date_display)+n.node("div",n.node("div",n.node("div",(i.selectYears,f()+v()+h()+h(1)),i.klass.header)+n.node("table",p+n.node("tbody",n.group({min:0,max:5,i:1,node:"tr",item:function(t){var o=i.firstDay&&0===e.create([l.year,l.month,1]).day?-7:0;return[n.group({min:7*t-l.day+o+1,max:function(){return this.min+7-1},i:1,node:"td",item:function(t){t=e.create([l.year,l.month,t+(i.firstDay?1:0)]);var o=r&&r.pick==t.pick,p=s&&s.pick==t.pick,h=c&&e.disabled(t)||t.pick<u.pick||t.pick>d.pick,f=n.trigger(e.formats.toString,e,[i.format,t]);return[n.node("div",t.date,function(e){return e.push(l.month==t.month?i.klass.infocus:i.klass.outfocus),a.pick==t.pick&&e.push(i.klass.now),o&&e.push(i.klass.selected),p&&e.push(i.klass.highlighted),h&&e.push(i.klass.disabled),e.join(" ")}([i.klass.day]),"data-pick="+t.pick+" "+n.ariaAttr({role:"gridcell",label:f,selected:!(!o||e.$node.val()!==f)||null,activedescendant:!!p||null,disabled:!!h||null})+" "+(h?"":'tabindex="0"')),"",n.ariaAttr({role:"presentation"})]}})]}})),i.klass.table,'id="'+e.$node[0].id+'_table" '+n.ariaAttr({role:"grid",controls:e.$node[0].id,readonly:!0})),i.klass.calendar_container)+n.node("div",n.node("button",i.today,"btn-flat picker__today waves-effect","type=button data-pick="+a.pick+(t&&!e.disabled(a)?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id}))+n.node("button",i.clear,"btn-flat picker__clear waves-effect","type=button data-clear=1"+(t?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id}))+n.node("button",i.close,"btn-flat picker__close waves-effect","type=button data-close=true "+(t?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id})),i.klass.footer),"picker__container__wrapper")},i.defaults=function(t){return{labelMonthNext:"Next month",labelMonthPrev:"Previous month",labelMonthSelect:"Select a month",labelYearSelect:"Select a year",monthsFull:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],weekdaysFull:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],weekdaysShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],weekdaysLetter:["S","M","T","W","T","F","S"],today:"Today",clear:"Clear",close:"Ok",closeOnSelect:!1,format:"d mmmm, yyyy",klass:{table:t+"table",header:t+"header",date_display:t+"date-display",day_display:t+"day-display",month_display:t+"month-display",year_display:t+"year-display",calendar_container:t+"calendar-container",navPrev:t+"nav--prev",navNext:t+"nav--next",navDisabled:t+"nav--disabled",month:t+"month",year:t+"year",selectMonth:t+"select--month",selectYear:t+"select--year",weekdays:t+"weekday",day:t+"day",disabled:t+"day--disabled",selected:t+"day--selected",highlighted:t+"day--highlighted",now:t+"day--today",infocus:t+"day--infocus",outfocus:t+"day--outfocus",footer:t+"footer",buttonClear:t+"button--clear",buttonToday:t+"button--today",buttonClose:t+"button--close"}}}(t.klasses().picker+"__"),t.extend("pickadate",i)}),function(t){function e(t){return document.createElementNS(l,t)}function i(t){return(t<10?"0":"")+t}function n(t){var e=++m+"";return t?t+e:e}function o(o,r){function l(t,e){var i=d.offset(),n=/^touch/.test(t.type),o=i.left+g,a=i.top+g,l=(n?t.originalEvent.touches[0]:t).pageX-o,c=(n?t.originalEvent.touches[0]:t).pageY-a,u=Math.sqrt(l*l+c*c),p=!1;if(!e||!(u<y-w||u>y+w)){t.preventDefault();var v=setTimeout(function(){E.popover.addClass("clockpicker-moving")},200);E.setHand(l,c,!e,!0),s.off(h).on(h,function(t){t.preventDefault();var e=/^touch/.test(t.type),i=(e?t.originalEvent.touches[0]:t).pageX-o,n=(e?t.originalEvent.touches[0]:t).pageY-a;(p||i!==l||n!==c)&&(p=!0,E.setHand(i,n,!1,!0))}),s.off(f).on(f,function(t){s.off(f),t.preventDefault();var i=/^touch/.test(t.type),n=(i?t.originalEvent.changedTouches[0]:t).pageX-o,u=(i?t.originalEvent.changedTouches[0]:t).pageY-a;(e||p)&&n===l&&u===c&&E.setHand(n,u),"hours"===E.currentView?E.toggleView("minutes",x/2):r.autoclose&&(E.minutesView.addClass("clockpicker-dial-out"),setTimeout(function(){E.done()},x/2)),d.prepend(z),clearTimeout(v),E.popover.removeClass("clockpicker-moving"),s.off(h)})}}var u=t(C),d=u.find(".clockpicker-plate"),v=u.find(".picker__holder"),m=u.find(".clockpicker-hours"),T=u.find(".clockpicker-minutes"),S=u.find(".clockpicker-am-pm-block"),P="INPUT"===o.prop("tagName"),A=P?o:o.find("input"),O=t("label[for="+A.attr("id")+"]"),E=this;this.id=n("cp"),this.element=o,this.holder=v,this.options=r,this.isAppended=!1,this.isShown=!1,this.currentView="hours",this.isInput=P,this.input=A,this.label=O,this.popover=u,this.plate=d,this.hoursView=m,this.minutesView=T,this.amPmBlock=S,this.spanHours=u.find(".clockpicker-span-hours"),this.spanMinutes=u.find(".clockpicker-span-minutes"),this.spanAmPm=u.find(".clockpicker-span-am-pm"),this.footer=u.find(".picker__footer"),this.amOrPm="PM",r.twelvehour&&(r.ampmclickable?(this.spanAmPm.empty(),t('<div id="click-am">AM</div>').on("click",function(){E.spanAmPm.children("#click-am").addClass("text-primary"),E.spanAmPm.children("#click-pm").removeClass("text-primary"),E.amOrPm="AM"}).appendTo(this.spanAmPm),t('<div id="click-pm">PM</div>').on("click",function(){E.spanAmPm.children("#click-pm").addClass("text-primary"),E.spanAmPm.children("#click-am").removeClass("text-primary"),E.amOrPm="PM"}).appendTo(this.spanAmPm)):(this.spanAmPm.empty(),t('<div id="click-am">AM</div>').appendTo(this.spanAmPm),t('<div id="click-pm">PM</div>').appendTo(this.spanAmPm))),t('<button type="button" class="btn-flat picker__clear" tabindex="'+(r.twelvehour?"3":"1")+'">'+r.cleartext+"</button>").click(t.proxy(this.clear,this)).appendTo(this.footer),t('<button type="button" class="btn-flat picker__close" tabindex="'+(r.twelvehour?"3":"1")+'">'+r.canceltext+"</button>").click(t.proxy(this.hide,this)).appendTo(this.footer),t('<button type="button" class="btn-flat picker__close" tabindex="'+(r.twelvehour?"3":"1")+'">'+r.donetext+"</button>").click(t.proxy(this.done,this)).appendTo(this.footer),this.spanHours.click(t.proxy(this.toggleView,this,"hours")),this.spanMinutes.click(t.proxy(this.toggleView,this,"minutes")),A.on("focus.clockpicker click.clockpicker",t.proxy(this.show,this));var _,M,I,D,q=t('<div class="clockpicker-tick"></div>');if(r.twelvehour)for(_=1;_<13;_+=1)M=q.clone(),I=_/6*Math.PI,D=y,M.css({left:g+Math.sin(I)*D-w,top:g-Math.cos(I)*D-w}),M.html(0===_?"00":_),m.append(M),M.on(p,l);else for(_=0;_<24;_+=1)M=q.clone(),I=_/6*Math.PI,D=_>0&&_<13?b:y,M.css({left:g+Math.sin(I)*D-w,top:g-Math.cos(I)*D-w}),M.html(0===_?"00":_),m.append(M),M.on(p,l);for(_=0;_<60;_+=5)M=q.clone(),I=_/30*Math.PI,M.css({left:g+Math.sin(I)*y-w,top:g-Math.cos(I)*y-w}),M.html(i(_)),T.append(M),M.on(p,l);if(d.on(p,function(e){0===t(e.target).closest(".clockpicker-tick").length&&l(e,!0)}),c){var z=u.find(".clockpicker-canvas"),V=e("svg");V.setAttribute("class","clockpicker-svg"),V.setAttribute("width",k),V.setAttribute("height",k);var H=e("g");H.setAttribute("transform","translate("+g+","+g+")");var L=e("circle");L.setAttribute("class","clockpicker-canvas-bearing"),L.setAttribute("cx",0),L.setAttribute("cy",0),L.setAttribute("r",4);var j=e("line");j.setAttribute("x1",0),j.setAttribute("y1",0);var $=e("circle");$.setAttribute("class","clockpicker-canvas-bg"),$.setAttribute("r",w),H.appendChild(j),H.appendChild($),H.appendChild(L),V.appendChild(H),z.append(V),this.hand=j,this.bg=$,this.bearing=L,this.g=H,this.canvas=z}a(this.options.init)}function a(t){t&&"function"==typeof t&&t()}var r=t(window),s=t(document),l="http://www.w3.org/2000/svg",c="SVGAngle"in window&&function(){var t,e=document.createElement("div");return e.innerHTML="<svg/>",t=(e.firstChild&&e.firstChild.namespaceURI)==l,e.innerHTML="",t}(),u=function(){var t=document.createElement("div").style;return"transition"in t||"WebkitTransition"in t||"MozTransition"in t||"msTransition"in t||"OTransition"in t}(),d="ontouchstart"in window,p="mousedown"+(d?" touchstart":""),h="mousemove.clockpicker"+(d?" touchmove.clockpicker":""),f="mouseup.clockpicker"+(d?" touchend.clockpicker":""),v=navigator.vibrate?"vibrate":navigator.webkitVibrate?"webkitVibrate":null,m=0,g=135,y=105,b=70,w=20,k=2*g,x=u?350:1,C=['<div class="clockpicker picker">','<div class="picker__holder">','<div class="picker__frame">','<div class="picker__wrap">','<div class="picker__box">','<div class="picker__date-display">','<div class="clockpicker-display">','<div class="clockpicker-display-column">','<span class="clockpicker-span-hours text-primary"></span>',":",'<span class="clockpicker-span-minutes"></span>',"</div>",'<div class="clockpicker-display-column clockpicker-display-am-pm">','<div class="clockpicker-span-am-pm"></div>',"</div>","</div>","</div>",'<div class="picker__container__wrapper">','<div class="picker__calendar-container">','<div class="clockpicker-plate">','<div class="clockpicker-canvas"></div>','<div class="clockpicker-dial clockpicker-hours"></div>','<div class="clockpicker-dial clockpicker-minutes clockpicker-dial-out"></div>',"</div>",'<div class="clockpicker-am-pm-block">',"</div>","</div>",'<div class="picker__footer">',"</div>","</div>","</div>","</div>","</div>","</div>","</div>"].join("");o.DEFAULTS={default:"",fromnow:0,donetext:"Ok",cleartext:"Clear",canceltext:"Cancel",autoclose:!1,ampmclickable:!0,darktheme:!1,twelvehour:!0,vibrate:!0},o.prototype.toggle=function(){this[this.isShown?"hide":"show"]()},o.prototype.locate=function(){var t=this.element,e=this.popover;t.offset(),t.outerWidth(),t.outerHeight(),this.options.align;e.show()},o.prototype.show=function(e){if(!this.isShown){a(this.options.beforeShow),t(":input").each(function(){t(this).attr("tabindex",-1)});var n=this;this.input.blur(),this.popover.addClass("picker--opened"),this.input.addClass("picker__input picker__input--active"),t(document.body).css("overflow","hidden");var o=((this.input.prop("value")||this.options.default||"")+"").split(":");if(this.options.twelvehour&&void 0!==o[1]&&(o[1].indexOf("AM")>0?this.amOrPm="AM":this.amOrPm="PM",o[1]=o[1].replace("AM","").replace("PM","")),"now"===o[0]){var l=new Date(+new Date+this.options.fromnow);o=[l.getHours(),l.getMinutes()],this.options.twelvehour&&(this.amOrPm=o[0]>=12&&o[0]<24?"PM":"AM")}if(this.hours=+o[0]||0,this.minutes=+o[1]||0,this.spanHours.html(this.hours),this.spanMinutes.html(i(this.minutes)),!this.isAppended){var c=document.querySelector(this.options.container);this.options.container&&c?c.appendChild(this.popover[0]):this.popover.insertAfter(this.input),this.options.twelvehour&&("PM"===this.amOrPm?(this.spanAmPm.children("#click-pm").addClass("text-primary"),this.spanAmPm.children("#click-am").removeClass("text-primary")):(this.spanAmPm.children("#click-am").addClass("text-primary"),this.spanAmPm.children("#click-pm").removeClass("text-primary"))),r.on("resize.clockpicker"+this.id,function(){n.isShown&&n.locate()}),this.isAppended=!0}this.toggleView("hours"),this.locate(),this.isShown=!0,s.on("click.clockpicker."+this.id+" focusin.clockpicker."+this.id,function(e){var i=t(e.target);0===i.closest(n.popover.find(".picker__wrap")).length&&0===i.closest(n.input).length&&n.hide()}),s.on("keyup.clockpicker."+this.id,function(t){27===t.keyCode&&n.hide()}),a(this.options.afterShow)}},o.prototype.hide=function(){a(this.options.beforeHide),this.input.removeClass("picker__input picker__input--active"),this.popover.removeClass("picker--opened"),t(document.body).css("overflow","visible"),this.isShown=!1,t(":input").each(function(e){t(this).attr("tabindex",e+1)}),s.off("click.clockpicker."+this.id+" focusin.clockpicker."+this.id),s.off("keyup.clockpicker."+this.id),this.popover.hide(),a(this.options.afterHide)},o.prototype.toggleView=function(e,i){var n=!1;"minutes"===e&&"visible"===t(this.hoursView).css("visibility")&&(a(this.options.beforeHourSelect),n=!0);var o="hours"===e,r=o?this.hoursView:this.minutesView,s=o?this.minutesView:this.hoursView;this.currentView=e,this.spanHours.toggleClass("text-primary",o),this.spanMinutes.toggleClass("text-primary",!o),s.addClass("clockpicker-dial-out"),r.css("visibility","visible").removeClass("clockpicker-dial-out"),this.resetClock(i),clearTimeout(this.toggleViewTimer),this.toggleViewTimer=setTimeout(function(){s.css("visibility","hidden")},x),n&&a(this.options.afterHourSelect)},o.prototype.resetClock=function(t){var e=this.currentView,i=this[e],n="hours"===e,o=i*(Math.PI/(n?6:30)),a=n&&i>0&&i<13?b:y,r=Math.sin(o)*a,s=-Math.cos(o)*a,l=this;c&&t?(l.canvas.addClass("clockpicker-canvas-out"),setTimeout(function(){l.canvas.removeClass("clockpicker-canvas-out"),l.setHand(r,s)},t)):this.setHand(r,s)},o.prototype.setHand=function(e,n,o,a){var r,s=Math.atan2(e,-n),l="hours"===this.currentView,u=Math.PI/(l||o?6:30),d=Math.sqrt(e*e+n*n),p=this.options,h=l&&d<(y+b)/2,f=h?b:y;if(p.twelvehour&&(f=y),s<0&&(s=2*Math.PI+s),r=Math.round(s/u),s=r*u,p.twelvehour?l?0===r&&(r=12):(o&&(r*=5),60===r&&(r=0)):l?(12===r&&(r=0),r=h?0===r?12:r:0===r?0:r+12):(o&&(r*=5),60===r&&(r=0)),this[this.currentView]!==r&&v&&this.options.vibrate&&(this.vibrateTimer||(navigator[v](10),this.vibrateTimer=setTimeout(t.proxy(function(){this.vibrateTimer=null},this),100))),this[this.currentView]=r,l?this.spanHours.html(r):this.spanMinutes.html(i(r)),c){var m=Math.sin(s)*(f-w),g=-Math.cos(s)*(f-w),k=Math.sin(s)*f,x=-Math.cos(s)*f;this.hand.setAttribute("x2",m),this.hand.setAttribute("y2",g),this.bg.setAttribute("cx",k),this.bg.setAttribute("cy",x)}else this[l?"hoursView":"minutesView"].find(".clockpicker-tick").each(function(){var e=t(this);e.toggleClass("active",r===+e.html())})},o.prototype.done=function(){a(this.options.beforeDone),this.hide(),this.label.addClass("active");var t=this.input.prop("value"),e=i(this.hours)+":"+i(this.minutes);this.options.twelvehour&&(e+=this.amOrPm),this.input.prop("value",e),e!==t&&(this.input.triggerHandler("change"),this.isInput||this.element.trigger("change")),this.options.autoclose&&this.input.trigger("blur"),a(this.options.afterDone)},o.prototype.clear=function(){this.hide(),this.label.removeClass("active");var t=this.input.prop("value");this.input.prop("value",""),""!==t&&(this.input.triggerHandler("change"),this.isInput||this.element.trigger("change")),this.options.autoclose&&this.input.trigger("blur")},o.prototype.remove=function(){this.element.removeData("clockpicker"),this.input.off("focus.clockpicker click.clockpicker"),this.isShown&&this.hide(),this.isAppended&&(r.off("resize.clockpicker"+this.id),this.popover.remove())},t.fn.pickatime=function(e){var i=Array.prototype.slice.call(arguments,1);return this.each(function(){var n=t(this),a=n.data("clockpicker");if(a)"function"==typeof a[e]&&a[e].apply(a,i);else{var r=t.extend({},o.DEFAULTS,n.data(),"object"==typeof e&&e);n.data("clockpicker",new o(n,r))}})}}(jQuery),function(t){function e(){var e=+t(this).attr("data-length"),i=+t(this).val().length,n=i<=e;t(this).parent().find('span[class="character-counter"]').html(i+"/"+e),o(n,t(this))}function i(e){var i=e.parent().find('span[class="character-counter"]');i.length||(i=t("<span/>").addClass("character-counter").css("float","right").css("font-size","12px").css("height",1),e.parent().append(i))}function n(){t(this).parent().find('span[class="character-counter"]').html("")}function o(t,e){var i=e.hasClass("invalid");t&&i?e.removeClass("invalid"):t||i||(e.removeClass("valid"),e.addClass("invalid"))}t.fn.characterCounter=function(){return this.each(function(){var o=t(this);o.parent().find('span[class="character-counter"]').length||void 0!==o.attr("data-length")&&(o.on("input",e),o.on("focus",e),o.on("blur",n),i(o))})},t(document).ready(function(){t("input, textarea").characterCounter()})}(jQuery),function(t){var e={init:function(e){var i={duration:200,dist:-100,shift:0,padding:0,fullWidth:!1,indicators:!1,noWrap:!1,onCycleTo:null};e=t.extend(i,e);var n=Materialize.objectSelectorString(t(this));return this.each(function(i){function o(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientX:t.clientX}function a(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientY:t.clientY}function r(t){return t>=C?t%C:t<0?r(C+t%C):t}function s(i){E=!0,j.hasClass("scrolling")||j.addClass("scrolling"),null!=H&&window.clearTimeout(H),H=window.setTimeout(function(){E=!1,j.removeClass("scrolling")},e.duration);var n,o,a,s,l,c,u,d=w;if(b="number"==typeof i?i:b,w=Math.floor((b+x/2)/x),a=b-w*x,s=a<0?1:-1,l=-s*a*2/x,o=C>>1,e.fullWidth?u="translateX(0)":(u="translateX("+(j[0].clientWidth-m)/2+"px) ",u+="translateY("+(j[0].clientHeight-g)/2+"px)"),N){var p=w%C,h=V.find(".indicator-item.active");h.index()!==p&&(h.removeClass("active"),V.find(".indicator-item").eq(p).addClass("active"))}for((!W||w>=0&&w<C)&&(c=v[r(w)],t(c).hasClass("active")||(j.find(".carousel-item").removeClass("active"),t(c).addClass("active")),c.style[_]=u+" translateX("+-a/2+"px) translateX("+s*e.shift*l*n+"px) translateZ("+e.dist*l+"px)",c.style.zIndex=0,e.fullWidth?tweenedOpacity=1:tweenedOpacity=1-.2*l,c.style.opacity=tweenedOpacity,c.style.display="block"),n=1;n<=o;++n)e.fullWidth?(zTranslation=e.dist,tweenedOpacity=n===o&&a<0?1-l:1):(zTranslation=e.dist*(2*n+l*s),tweenedOpacity=1-.2*(2*n+l*s)),(!W||w+n<C)&&((c=v[r(w+n)]).style[_]=u+" translateX("+(e.shift+(x*n-a)/2)+"px) translateZ("+zTranslation+"px)",c.style.zIndex=-n,c.style.opacity=tweenedOpacity,c.style.display="block"),e.fullWidth?(zTranslation=e.dist,tweenedOpacity=n===o&&a>0?1-l:1):(zTranslation=e.dist*(2*n-l*s),tweenedOpacity=1-.2*(2*n-l*s)),(!W||w-n>=0)&&((c=v[r(w-n)]).style[_]=u+" translateX("+(-e.shift+(-x*n-a)/2)+"px) translateZ("+zTranslation+"px)",c.style.zIndex=-n,c.style.opacity=tweenedOpacity,c.style.display="block");if((!W||w>=0&&w<C)&&((c=v[r(w)]).style[_]=u+" translateX("+-a/2+"px) translateX("+s*e.shift*l+"px) translateZ("+e.dist*l+"px)",c.style.zIndex=0,e.fullWidth?tweenedOpacity=1:tweenedOpacity=1-.2*l,c.style.opacity=tweenedOpacity,c.style.display="block"),d!==w&&"function"==typeof e.onCycleTo){var f=j.find(".carousel-item").eq(r(w));e.onCycleTo.call(this,f,q)}"function"==typeof L&&(L.call(this,f,q),L=null)}function l(){var t,e,i;e=(t=Date.now())-I,I=t,i=b-M,M=b,O=.8*(1e3*i/(1+e))+.2*O}function c(){var t,i;P&&(t=Date.now()-I,(i=P*Math.exp(-t/e.duration))>2||i<-2?(s(A-i),requestAnimationFrame(c)):s(A))}function u(i){if(q)return i.preventDefault(),i.stopPropagation(),!1;if(!e.fullWidth){var n=t(i.target).closest(".carousel-item").index();0!==r(w)-n&&(i.preventDefault(),i.stopPropagation()),d(n)}}function d(t){var e=w%C-t;W||(e<0?Math.abs(e+C)<Math.abs(e)&&(e+=C):e>0&&Math.abs(e-C)<e&&(e-=C)),e<0?j.trigger("carouselNext",[Math.abs(e)]):e>0&&j.trigger("carouselPrev",[e])}function p(e){"mousedown"===e.type&&t(e.target).is("img")&&e.preventDefault(),k=!0,q=!1,z=!1,T=o(e),S=a(e),O=P=0,M=b,I=Date.now(),clearInterval(D),D=setInterval(l,100)}function h(t){var e,i;if(k)if(e=o(t),y=a(t),i=T-e,Math.abs(S-y)<30&&!z)(i>2||i<-2)&&(q=!0,T=e,s(b+i));else{if(q)return t.preventDefault(),t.stopPropagation(),!1;z=!0}if(q)return t.preventDefault(),t.stopPropagation(),!1}function f(t){if(k)return k=!1,clearInterval(D),A=b,(O>10||O<-10)&&(A=b+(P=.9*O)),A=Math.round(A/x)*x,W&&(A>=x*(C-1)?A=x*(C-1):A<0&&(A=0)),P=A-b,I=Date.now(),requestAnimationFrame(c),q&&(t.preventDefault(),t.stopPropagation()),!1}var v,m,g,b,w,k,x,C,T,S,P,A,O,E,_,M,I,D,q,z,V=t('<ul class="indicators"></ul>'),H=null,L=null,j=t(this),$=j.find(".carousel-item").length>1,N=(j.attr("data-indicators")||e.indicators)&&$,W=j.attr("data-no-wrap")||e.noWrap||!$,F=j.attr("data-namespace")||n+i;j.attr("data-namespace",F);var Q=function(e){var i=j.find(".carousel-item.active").length?j.find(".carousel-item.active").first():j.find(".carousel-item").first(),n=i.find("img").first();if(n.length)if(n[0].complete)if(n.height()>0)j.css("height",n.height());else{var o=n[0].naturalWidth,a=n[0].naturalHeight,r=j.width()/o*a;j.css("height",r)}else n.on("load",function(){j.css("height",t(this).height())});else if(!e){var s=i.height();j.css("height",s)}};if(e.fullWidth&&(e.dist=0,Q(),N&&j.find(".carousel-fixed-item").addClass("with-indicators")),j.hasClass("initialized"))return t(window).trigger("resize"),j.trigger("carouselNext",[1e-6]),!0;j.addClass("initialized"),k=!1,b=A=0,v=[],m=j.find(".carousel-item").first().innerWidth(),g=j.find(".carousel-item").first().innerHeight(),x=2*m+e.padding,j.find(".carousel-item").each(function(e){if(v.push(t(this)[0]),N){var i=t('<li class="indicator-item"></li>');0===e&&i.addClass("active"),i.click(function(e){e.stopPropagation(),d(t(this).index())}),V.append(i)}}),N&&j.append(V),C=v.length,_="transform",["webkit","Moz","O","ms"].every(function(t){var e=t+"Transform";return void 0===document.body.style[e]||(_=e,!1)});var X=Materialize.throttle(function(){if(e.fullWidth){m=j.find(".carousel-item").first().innerWidth();j.find(".carousel-item.active").height();x=2*m+e.padding,A=b=2*w*m,Q(!0)}else s()},200);t(window).off("resize.carousel-"+F).on("resize.carousel-"+F,X),void 0!==window.ontouchstart&&(j.on("touchstart.carousel",p),j.on("touchmove.carousel",h),j.on("touchend.carousel",f)),j.on("mousedown.carousel",p),j.on("mousemove.carousel",h),j.on("mouseup.carousel",f),j.on("mouseleave.carousel",f),j.on("click.carousel",u),s(b),t(this).on("carouselNext",function(t,e,i){void 0===e&&(e=1),"function"==typeof i&&(L=i),A=x*Math.round(b/x)+x*e,b!==A&&(P=A-b,I=Date.now(),requestAnimationFrame(c))}),t(this).on("carouselPrev",function(t,e,i){void 0===e&&(e=1),"function"==typeof i&&(L=i),A=x*Math.round(b/x)-x*e,b!==A&&(P=A-b,I=Date.now(),requestAnimationFrame(c))}),t(this).on("carouselSet",function(t,e,i){void 0===e&&(e=0),"function"==typeof i&&(L=i),d(e)})})},next:function(e,i){t(this).trigger("carouselNext",[e,i])},prev:function(e,i){t(this).trigger("carouselPrev",[e,i])},set:function(e,i){t(this).trigger("carouselSet",[e,i])},destroy:function(){var e=t(this).attr("data-namespace");t(this).removeAttr("data-namespace"),t(this).removeClass("initialized"),t(this).find(".indicators").remove(),t(this).off("carouselNext carouselPrev carouselSet"),t(window).off("resize.carousel-"+e),void 0!==window.ontouchstart&&t(this).off("touchstart.carousel touchmove.carousel touchend.carousel"),t(this).off("mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel")}};t.fn.carousel=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.carousel"):e.init.apply(this,arguments)}}(jQuery),function(t){var e={init:function(e){return this.each(function(){var i=t("#"+t(this).attr("data-activates")),n=(t("body"),t(this)),o=n.parent(".tap-target-wrapper"),a=o.find(".tap-target-wave"),r=o.find(".tap-target-origin"),s=n.find(".tap-target-content");o.length||(o=n.wrap(t('<div class="tap-target-wrapper"></div>')).parent()),s.length||(s=t('<div class="tap-target-content"></div>'),n.append(s)),a.length||(a=t('<div class="tap-target-wave"></div>'),r.length||((r=i.clone(!0,!0)).addClass("tap-target-origin"),r.removeAttr("id"),r.removeAttr("style"),a.append(r)),o.append(a));var l=function(){o.is(".open")&&(o.removeClass("open"),r.off("click.tapTarget"),t(document).off("click.tapTarget"),t(window).off("resize.tapTarget"))},c=function(){var e="fixed"===i.css("position");if(!e)for(var r=i.parents(),l=0;l<r.length&&!(e="fixed"==t(r[l]).css("position"));l++);var c=i.outerWidth(),u=i.outerHeight(),d=e?i.offset().top-t(document).scrollTop():i.offset().top,p=e?i.offset().left-t(document).scrollLeft():i.offset().left,h=t(window).width(),f=t(window).height(),v=h/2,m=f/2,g=p<=v,y=p>v,b=d<=m,w=d>m,k=p>=.25*h&&p<=.75*h,x=n.outerWidth(),C=n.outerHeight(),T=d+u/2-C/2,S=p+c/2-x/2,P=e?"fixed":"absolute",A=k?x:x/2+c,O=C/2,E=b?C/2:0,_=g&&!k?x/2-c:0,M=c,I=w?"bottom":"top",D=2*c,q=D,z=C/2-q/2,V=x/2-D/2,H={};H.top=b?T:"",H.right=y?h-S-x:"",H.bottom=w?f-T-C:"",H.left=g?S:"",H.position=P,o.css(H),s.css({width:A,height:O,top:E,right:0,bottom:0,left:_,padding:M,verticalAlign:I}),a.css({top:z,left:V,width:D,height:q})};"open"==e&&(c(),o.is(".open")||(o.addClass("open"),setTimeout(function(){r.off("click.tapTarget").on("click.tapTarget",function(t){l(),r.off("click.tapTarget")}),t(document).off("click.tapTarget").on("click.tapTarget",function(e){l(),t(document).off("click.tapTarget")});var e=Materialize.throttle(function(){c()},200);t(window).off("resize.tapTarget").on("resize.tapTarget",e)},0))),"close"==e&&l()})},open:function(){},close:function(){}};t.fn.tapTarget=function(i){if(e[i]||"object"==typeof i)return e.init.apply(this,arguments);t.error("Method "+i+" does not exist on jQuery.tap-target")}}(jQuery);
|
|
|
|
|
|
|
|
|
admin/scripts/modula-admin.js
CHANGED
|
@@ -1,1046 +1,1041 @@
|
|
| 1 |
-
var TG = function
|
| 2 |
-
|
| 3 |
-
|
| 4 |
-
|
| 5 |
-
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
|
| 10 |
-
},
|
| 11 |
-
title: 'Add image(s)',
|
| 12 |
-
button: {
|
| 13 |
-
text: 'Add image(s)'
|
| 14 |
-
},
|
| 15 |
-
states: [
|
| 16 |
-
new wp.media.controller.Library({
|
| 17 |
-
library: wp.media.query({
|
| 18 |
-
type: 'image'
|
| 19 |
-
}),
|
| 20 |
-
multiple: true,
|
| 21 |
-
priority: 20,
|
| 22 |
-
filterable: 'all'
|
| 23 |
-
})
|
| 24 |
-
]
|
| 25 |
-
});
|
| 26 |
-
|
| 27 |
-
tgm_media_frame.on('select', function() {
|
| 28 |
-
var selection = tgm_media_frame.state().get('selection');
|
| 29 |
-
var images = [];
|
| 30 |
-
|
| 31 |
-
var errors = 0;
|
| 32 |
-
selection.map(function(attachment) {
|
| 33 |
-
attachment = attachment.toJSON();
|
| 34 |
-
|
| 35 |
-
if (!attachment.sizes) {
|
| 36 |
-
errors++;
|
| 37 |
-
return;
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
var obj = {
|
| 41 |
-
imageId: attachment.id
|
| 42 |
-
};
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
if (title_field != 'none')
|
| 46 |
-
obj.title = attachment[title_field];
|
| 47 |
-
if (caption_field != 'none')
|
| 48 |
-
obj.description = attachment[caption_field];
|
| 49 |
-
|
| 50 |
-
obj.imagePath = attachment.url;
|
| 51 |
-
|
| 52 |
-
if (attachment.sizes.thumbnail)
|
| 53 |
-
obj.thumbnail = attachment.sizes.thumbnail.url;
|
| 54 |
-
|
| 55 |
-
if (attachment.sizes.full)
|
| 56 |
-
obj.altImagePath = attachment.sizes.full.url;
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
images.push(obj);
|
| 60 |
-
});
|
| 61 |
-
|
| 62 |
-
if (errors) {
|
| 63 |
-
alert(errors + " images could not be added because the selected size is not available");
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
callback(images);
|
| 67 |
-
});
|
| 68 |
-
|
| 69 |
-
tgm_media_frame.open();
|
| 70 |
},
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
|
| 74 |
-
|
| 75 |
-
|
| 76 |
-
|
| 77 |
-
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
|
| 81 |
-
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
|
| 88 |
-
|
| 89 |
-
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
|
| 97 |
-
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
|
| 101 |
-
|
| 102 |
-
|
| 103 |
-
|
| 104 |
-
|
| 105 |
-
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
|
| 109 |
-
|
| 110 |
-
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
|
| 118 |
-
|
| 119 |
-
|
| 120 |
-
|
| 121 |
-
|
| 122 |
-
|
| 123 |
-
Modula: $('#Modula').val(),
|
| 124 |
-
id: id
|
| 125 |
-
};
|
| 126 |
-
|
| 127 |
-
TG.show_loading();
|
| 128 |
-
$.post(ajaxurl, data, function () {
|
| 129 |
-
$item.remove();
|
| 130 |
-
TG.hide_loading();
|
| 131 |
-
});
|
| 132 |
-
});
|
| 133 |
-
|
| 134 |
-
$("#image-list .checkbox").click(function () {
|
| 135 |
-
$(this).toggleClass("checked");
|
| 136 |
-
$(this).parents(".item:first").toggleClass("selected");
|
| 137 |
-
});
|
| 138 |
-
|
| 139 |
-
TG.hide_loading();
|
| 140 |
-
});
|
| 141 |
-
},
|
| 142 |
-
edit_image: function(form) {
|
| 143 |
-
var data = {};
|
| 144 |
-
form.find("input[type=text], input:checked, input, textarea, input[type=hidden]").each(function() {
|
| 145 |
-
data[$(this).attr("name")] = $(this).val();
|
| 146 |
-
});
|
| 147 |
-
data.action = 'modula_save_image';
|
| 148 |
-
data.type = 'edit';
|
| 149 |
-
data.Modula = $('#Modula').val();
|
| 150 |
-
TG.show_loading();
|
| 151 |
-
$.ajax({
|
| 152 |
-
url: ajaxurl,
|
| 153 |
-
data: data,
|
| 154 |
-
dataType: "json",
|
| 155 |
-
type: "post",
|
| 156 |
-
error: function(a,b,c) {
|
| 157 |
-
TG.hide_loading();
|
| 158 |
-
},
|
| 159 |
-
success: function(r) {
|
| 160 |
-
if(r.success) {
|
| 161 |
-
TG.load_images();
|
| 162 |
-
} else {
|
| 163 |
-
TG.hide_loading();
|
| 164 |
-
}
|
| 165 |
-
}
|
| 166 |
-
});
|
| 167 |
-
},
|
| 168 |
-
add_image: function () {
|
| 169 |
-
|
| 170 |
-
var data = {};
|
| 171 |
-
$("#add_image_form input[type=text], #add_image_form input:checked, #add_image_form textarea, #add_image_form input[type=hidden]").each(function() {
|
| 172 |
-
data[$(this).attr("name")] = $(this).val();
|
| 173 |
-
});
|
| 174 |
-
|
| 175 |
-
data.action = 'modula_save_image';
|
| 176 |
-
data.type = $(this).data("type");
|
| 177 |
-
if(data.img_id == "") {
|
| 178 |
-
var p = $("<div title='Attention'>Select an image to add</div>").dialog({
|
| 179 |
-
modal: true,
|
| 180 |
-
buttons: {
|
| 181 |
-
Close: function () {
|
| 182 |
-
p.dialog("destroy");
|
| 183 |
-
}
|
| 184 |
-
}
|
| 185 |
-
});
|
| 186 |
-
return false;
|
| 187 |
-
}
|
| 188 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 189 |
TG.show_loading();
|
| 190 |
-
|
| 191 |
-
|
| 192 |
-
|
| 193 |
-
|
| 194 |
-
|
| 195 |
-
|
| 196 |
-
|
| 197 |
-
|
| 198 |
-
|
| 199 |
-
|
| 200 |
-
|
| 201 |
-
|
| 202 |
-
|
| 203 |
-
|
| 204 |
-
|
| 205 |
-
|
| 206 |
-
|
| 207 |
-
|
| 208 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 209 |
},
|
| 210 |
-
|
| 211 |
-
|
| 212 |
-
|
| 213 |
-
|
| 214 |
-
|
| 215 |
-
|
| 216 |
-
|
| 217 |
-
|
| 218 |
-
|
| 219 |
-
|
| 220 |
-
|
| 221 |
-
|
| 222 |
-
|
| 223 |
-
|
| 224 |
-
|
| 225 |
-
|
| 226 |
-
|
| 227 |
-
|
| 228 |
-
|
| 229 |
-
|
| 230 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 231 |
}
|
| 232 |
|
| 233 |
-
|
| 234 |
-
|
| 235 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 236 |
url: ajaxurl,
|
| 237 |
data: data,
|
| 238 |
-
dataType:
|
| 239 |
-
type:
|
| 240 |
-
error: function(a,b,c) {
|
| 241 |
-
|
|
|
|
| 242 |
},
|
| 243 |
-
success: function
|
| 244 |
-
|
| 245 |
-
|
| 246 |
-
toast("Gallery Saved",2000);
|
| 247 |
-
TG.hide_loading();
|
| 248 |
-
}
|
| 249 |
-
else
|
| 250 |
-
location.href = "?page=edit-modula-lite";
|
| 251 |
}
|
| 252 |
-
|
| 253 |
-
|
| 254 |
-
|
| 255 |
-
|
| 256 |
-
|
| 257 |
-
|
| 258 |
-
|
| 259 |
-
|
| 260 |
-
|
| 261 |
-
|
| 262 |
-
|
| 263 |
-
|
| 264 |
-
|
| 265 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 266 |
e.preventDefault();
|
| 267 |
-
|
| 268 |
-
|
| 269 |
-
|
| 270 |
-
|
| 271 |
-
scrollTop: $("#" + target).offset().top - 28
|
| 272 |
-
}, 1000);
|
| 273 |
-
}, 500);
|
| 274 |
-
});
|
| 275 |
-
|
| 276 |
-
$('.import-export a').click(function(){
|
| 277 |
-
|
| 278 |
-
if($(this).attr('id') == 'import')
|
| 279 |
-
{
|
| 280 |
-
$('#import-modal').openModal();
|
| 281 |
-
}
|
| 282 |
-
else if($(this).attr('id') == 'export')
|
| 283 |
-
{
|
| 284 |
-
var data = {action: 'modula_get_config', id: $("#gallery-id").val(), Modula: $('#Modula').val() };
|
| 285 |
-
|
| 286 |
-
$.ajax({
|
| 287 |
-
type: 'POST',
|
| 288 |
-
url: ajaxurl,
|
| 289 |
-
data: data,
|
| 290 |
-
success: function(r){
|
| 291 |
-
$('#export-modal .modal-content textarea').val('');
|
| 292 |
-
$('#export-modal .modal-content textarea').val(r);
|
| 293 |
-
|
| 294 |
-
$('#export-modal').openModal();
|
| 295 |
-
}
|
| 296 |
-
|
| 297 |
-
});
|
| 298 |
-
}
|
| 299 |
-
});
|
| 300 |
-
|
| 301 |
-
$('#import-modal .modal-footer #save').click(function(){
|
| 302 |
-
var config = $('#import-modal textarea').val();
|
| 303 |
-
|
| 304 |
-
var data = {action: 'modula_update_config', config: config, id: $("#gallery-id").val(), Modula: $('#Modula').val() };
|
| 305 |
-
$.ajax({
|
| 306 |
-
type: 'POST',
|
| 307 |
-
url: ajaxurl,
|
| 308 |
-
data: data,
|
| 309 |
-
success: function(r)
|
| 310 |
-
{
|
| 311 |
-
alert('Gallery configuration has been updated');
|
| 312 |
-
}
|
| 313 |
-
})
|
| 314 |
-
})
|
| 315 |
-
|
| 316 |
-
|
| 317 |
-
$(".collapsible-header").click(function(){
|
| 318 |
-
var target = $(this).parent().attr('id');
|
| 319 |
-
setTimeout(function () {
|
| 320 |
-
$('html, body').animate({
|
| 321 |
-
scrollTop: $("#" + target).offset().top - 28
|
| 322 |
-
}, 1000);
|
| 323 |
-
}, 500);
|
| 324 |
-
})
|
| 325 |
-
|
| 326 |
-
$(".field .text .integer-only").keypress(function(e){
|
| 327 |
-
var charCode = (e.which) ? e.which : e.keyCode;
|
| 328 |
-
|
| 329 |
-
if (charCode != 46 && charCode > 31
|
| 330 |
-
&& (charCode < 48 || charCode > 57))
|
| 331 |
-
return false;
|
| 332 |
-
|
| 333 |
-
return true;
|
| 334 |
-
});
|
| 335 |
-
|
| 336 |
-
$('#create-gallery').click(function() {
|
| 337 |
-
var name = $('#name').val();
|
| 338 |
-
var description = $('#description').val();
|
| 339 |
-
|
| 340 |
-
if(name == "" || description == "") return;
|
| 341 |
-
|
| 342 |
-
var data = {action: 'create_gallery', name: name, description: description };
|
| 343 |
-
|
| 344 |
-
jQuery.post(ajaxurl, data, function(id){
|
| 345 |
-
$('#name').val("");
|
| 346 |
-
$('#description').val("");
|
| 347 |
-
|
| 348 |
-
$_success = $('#success');
|
| 349 |
-
|
| 350 |
-
$_success.find(".code").val("[Modula id='" + id + "']");
|
| 351 |
-
$_success.find(".gallery-name").text(name);
|
| 352 |
-
$_success.find(".customize").attr("href", "?page=edit-modula-lite&galleryId="+id);
|
| 353 |
-
|
| 354 |
-
$_success.openModal();
|
| 355 |
-
});
|
| 356 |
-
|
| 357 |
-
})
|
| 358 |
-
|
| 359 |
-
$("#add-submit").click(function (e) {
|
| 360 |
e.preventDefault();
|
| 361 |
-
|
| 362 |
-
|
| 363 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 364 |
e.preventDefault();
|
| 365 |
-
|
| 366 |
-
|
| 367 |
-
|
| 368 |
-
$("#image-list").on("click", ".item .thumb", function () {
|
| 369 |
-
$(this).parents(".item").toggleClass("selected");
|
| 370 |
-
$(this).parents(".item").find(".checkbox").toggleClass("checked");
|
| 371 |
-
});
|
| 372 |
-
$("#image-list").on("click", ".edit", function (e) {
|
| 373 |
-
e.preventDefault();
|
| 374 |
-
|
| 375 |
-
$('#wpbody-content').addClass('dark-content');
|
| 376 |
-
var $item = $(this).parents(".item");
|
| 377 |
-
|
| 378 |
-
var panel = $("#image-panel-model").clone().attr("id", "image-panel");
|
| 379 |
-
panel.css({
|
| 380 |
-
marginTop: $(window).scrollTop() - (246 / 2)
|
| 381 |
-
});
|
| 382 |
-
|
| 383 |
-
$("[name=target]", panel).val($("[name=target]", $item).val());
|
| 384 |
-
$("#item-link", panel).val($("[name=link]", $item).val());
|
| 385 |
-
$(".figure", panel).append($("img", $item).clone());
|
| 386 |
-
$(".sizes", panel).append($("select", $item).clone());
|
| 387 |
-
$('#item-title', panel).html($('#img-title', $item).val());
|
| 388 |
-
$("#item-description", panel).val($("pre", $item).html());
|
| 389 |
-
$(".copy", $item).clone().appendTo(panel);
|
| 390 |
-
|
| 391 |
-
$("body").append("<div class='overlay' style='display:none' />");
|
| 392 |
-
$(".overlay").fadeIn();
|
| 393 |
-
panel.appendTo("body").fadeIn();
|
| 394 |
-
|
| 395 |
-
var link = $item.find("[name=link]").val();
|
| 396 |
-
|
| 397 |
-
$("[name=halign]", panel).val($("[name=halign]", $item).val());
|
| 398 |
-
$("[name=valign]", panel).val($("[name=valign]", $item).val());
|
| 399 |
-
|
| 400 |
-
$(".buttons a", panel).click(function (e) {
|
| 401 |
-
e.preventDefault();
|
| 402 |
-
|
| 403 |
-
switch($(this).data("action")) {
|
| 404 |
-
case "save":
|
| 405 |
-
$('#wpbody-content').removeClass('dark-content');
|
| 406 |
-
var data = {
|
| 407 |
-
action : 'modula_save_image',
|
| 408 |
-
Modula : $('#Modula').val()
|
| 409 |
-
};
|
| 410 |
-
$("input[type=text], input[type=hidden], input[type=radio]:checked, input[type=checkbox]:checked, textarea, select", panel).each(function () {
|
| 411 |
-
if($(this).attr("name"))
|
| 412 |
-
data[$(this).attr("name")] = $(this).val();
|
| 413 |
-
});
|
| 414 |
-
|
| 415 |
-
|
| 416 |
-
$("#image-panel .close").trigger("click");
|
| 417 |
-
TG.show_loading();
|
| 418 |
-
$.ajax({
|
| 419 |
-
url: ajaxurl,
|
| 420 |
-
data: data,
|
| 421 |
-
dataType: "json",
|
| 422 |
-
type: "post",
|
| 423 |
-
error: function(a,b,c) {
|
| 424 |
-
console.log(a,b,c);
|
| 425 |
-
TG.hide_loading();
|
| 426 |
-
},
|
| 427 |
-
success: function(r) {
|
| 428 |
-
TG.hide_loading();
|
| 429 |
-
TG.load_images();
|
| 430 |
-
}
|
| 431 |
-
});
|
| 432 |
-
break;
|
| 433 |
-
case "cancel":
|
| 434 |
-
$('#wpbody-content').removeClass('dark-content');
|
| 435 |
-
$("#image-panel .close").trigger("click");
|
| 436 |
-
break;
|
| 437 |
-
}
|
| 438 |
-
});
|
| 439 |
-
|
| 440 |
-
$("#image-panel .close, .overlay").click(function (e) {
|
| 441 |
-
e.preventDefault();
|
| 442 |
-
panel.fadeOut(function () {
|
| 443 |
-
$(this).remove();
|
| 444 |
-
});
|
| 445 |
-
$(".overlay").fadeOut(function () {
|
| 446 |
-
$(this).remove();
|
| 447 |
-
});
|
| 448 |
-
});
|
| 449 |
-
});
|
| 450 |
-
|
| 451 |
-
|
| 452 |
-
$(".jump").on("change", function () {
|
| 453 |
-
var field = $(this).val();
|
| 454 |
-
$('html, body').animate({
|
| 455 |
-
scrollTop: $(".row-" + field).offset().top - 20
|
| 456 |
-
}, 1000);
|
| 457 |
-
$(this).get(0).selectedIndex = 0;
|
| 458 |
-
});
|
| 459 |
-
|
| 460 |
-
$("body").on("click", "[name=click_action]", function () {
|
| 461 |
-
if($(this).val() == "url") {
|
| 462 |
-
$(this).siblings("[name=url]").get(0).disabled = false;
|
| 463 |
-
} else {
|
| 464 |
-
$(this).siblings("[name=url]").val("").get(0).disabled = true;
|
| 465 |
-
}
|
| 466 |
-
});
|
| 467 |
|
| 468 |
-
|
| 469 |
e.preventDefault();
|
|
|
|
| 470 |
|
| 471 |
-
var
|
| 472 |
-
|
| 473 |
-
|
| 474 |
-
|
| 475 |
-
|
| 476 |
-
$("#images .item").addClass("selected");
|
| 477 |
-
$("#images .item .checkbox").addClass("checked");
|
| 478 |
-
break;
|
| 479 |
-
case "deselect":
|
| 480 |
-
$("#images .item").removeClass("selected");
|
| 481 |
-
$("#images .item .checkbox").removeClass("checked");
|
| 482 |
-
break;
|
| 483 |
-
case "toggle":
|
| 484 |
-
$("#images .item").toggleClass("selected");
|
| 485 |
-
$("#images .item .checkbox").toggleClass("checked");
|
| 486 |
-
break;
|
| 487 |
-
case "resize":
|
| 488 |
-
var selected = [];
|
| 489 |
-
$("#images .item.selected").each(function (i, o) {
|
| 490 |
-
selected.push($(o).data("id") + "-" + $(o).data("image-id"));
|
| 491 |
-
});
|
| 492 |
-
if(selected.length == 0) {
|
| 493 |
-
alert("No images selected");
|
| 494 |
-
} else {
|
| 495 |
-
$(".panel", $bulk).hide();
|
| 496 |
-
$(".panel strong", $bulk).text("Select size");
|
| 497 |
-
$(".panel .text", $bulk).text("");
|
| 498 |
-
var $sizes = $(".current-image-size").clone(false);
|
| 499 |
-
$sizes.removeClass("current-image-size");
|
| 500 |
-
$(".panel .text", $bulk).append($sizes);
|
| 501 |
-
|
| 502 |
-
$(".cancel", $bulk).unbind("click").click(function (e) {
|
| 503 |
-
e.preventDefault();
|
| 504 |
-
$(".panel", $bulk).slideUp();
|
| 505 |
-
});
|
| 506 |
-
|
| 507 |
-
$(".proceed", $bulk).unbind("click").click(function (e) {
|
| 508 |
-
e.preventDefault();
|
| 509 |
-
$(".panel", $bulk).slideUp();
|
| 510 |
-
|
| 511 |
-
var data = {
|
| 512 |
-
action: 'modula_resize_images',
|
| 513 |
-
Modula: $('#Modula').val(),
|
| 514 |
-
size: $sizes.val(),
|
| 515 |
-
id: selected.join(",")
|
| 516 |
-
};
|
| 517 |
-
|
| 518 |
-
TG.show_loading();
|
| 519 |
-
$.post(ajaxurl, data, function () {
|
| 520 |
-
TG.load_images();
|
| 521 |
-
TG.hide_loading();
|
| 522 |
-
});
|
| 523 |
-
});
|
| 524 |
-
|
| 525 |
-
$(".panel", $bulk).slideDown();
|
| 526 |
-
}
|
| 527 |
-
break;
|
| 528 |
-
case "remove":
|
| 529 |
-
var selected = [];
|
| 530 |
-
$("#images .item.selected").each(function (i, o) {
|
| 531 |
-
selected.push($(o).data("id"));
|
| 532 |
-
});
|
| 533 |
-
if(selected.length == 0) {
|
| 534 |
-
alert("No images selected");
|
| 535 |
-
} else {
|
| 536 |
-
$(".panel", $bulk).hide();
|
| 537 |
-
$(".panel strong", $bulk).text("Confirm");
|
| 538 |
-
$(".panel .text", $bulk).text("You selected " + selected.length + " images to remove, proceed ?");
|
| 539 |
-
|
| 540 |
-
$(".cancel", $bulk).unbind("click").click(function (e) {
|
| 541 |
-
e.preventDefault();
|
| 542 |
-
$(".panel", $bulk).slideUp();
|
| 543 |
-
});
|
| 544 |
-
|
| 545 |
-
$(".proceed", $bulk).unbind("click").click(function (e) {
|
| 546 |
-
e.preventDefault();
|
| 547 |
-
$(".panel", $bulk).slideUp();
|
| 548 |
-
|
| 549 |
-
var data = {
|
| 550 |
-
action: 'modula_delete_image',
|
| 551 |
-
Modula: $('#Modula').val(),
|
| 552 |
-
id: selected.join(",")
|
| 553 |
-
};
|
| 554 |
-
|
| 555 |
-
TG.show_loading();
|
| 556 |
-
$.post(ajaxurl, data, function () {
|
| 557 |
-
$("#images .item.selected").remove();
|
| 558 |
-
TG.hide_loading();
|
| 559 |
-
});
|
| 560 |
-
});
|
| 561 |
-
|
| 562 |
-
$(".panel", $bulk).slideDown();
|
| 563 |
-
}
|
| 564 |
-
break;
|
| 565 |
-
}
|
| 566 |
-
});
|
| 567 |
-
|
| 568 |
-
$(".import-source").on("change", function () {
|
| 569 |
-
var source = $(this).val();
|
| 570 |
-
$("#external-galleries ul").empty();
|
| 571 |
-
|
| 572 |
-
if(source) {
|
| 573 |
-
var data = {
|
| 574 |
-
action : 'modula_get_ext_galleries',
|
| 575 |
-
source: source,
|
| 576 |
-
Modula : $('#Modula').val()
|
| 577 |
-
};
|
| 578 |
-
|
| 579 |
-
function fill(list) {
|
| 580 |
-
var $ul = $("#external-galleries ul");
|
| 581 |
-
$.each(list, function(i, g) {
|
| 582 |
-
console.log(g);
|
| 583 |
-
$ul.append("<li><input class='js-item' type='checkbox' value='"+g.id+"'/> "+ g.title +"</li>");
|
| 584 |
-
});
|
| 585 |
-
}
|
| 586 |
-
TG.show_loading();
|
| 587 |
-
$.ajax({
|
| 588 |
-
url: ajaxurl,
|
| 589 |
-
data: data,
|
| 590 |
-
dataType: "json",
|
| 591 |
-
type: "post",
|
| 592 |
-
error: function(a,b,c) {
|
| 593 |
-
TG.hide_loading();
|
| 594 |
-
alert("error loading galleries");
|
| 595 |
-
},
|
| 596 |
-
success: function(r) {
|
| 597 |
-
if(r.success) {
|
| 598 |
-
TG.hide_loading();
|
| 599 |
-
|
| 600 |
-
fill(r.galleries);
|
| 601 |
-
}
|
| 602 |
-
}
|
| 603 |
-
});
|
| 604 |
-
}
|
| 605 |
-
});
|
| 606 |
-
|
| 607 |
-
$(".open-media-panel").on("click", function() {
|
| 608 |
-
|
| 609 |
-
var currentImageSize = $('.current-image-size').val();
|
| 610 |
-
|
| 611 |
-
tgm_media_frame = wp.media.frames.tgm_media_frame = wp.media({
|
| 612 |
-
multiple: true,
|
| 613 |
-
library: {
|
| 614 |
-
type: 'image'
|
| 615 |
-
}
|
| 616 |
-
});
|
| 617 |
-
|
| 618 |
-
modula_wp_caption_field = $('#wp_caption').val();
|
| 619 |
-
modula_wp_title_field = $('#wp_title').val();
|
| 620 |
-
|
| 621 |
-
tgm_media_frame.on('select', function() {
|
| 622 |
-
var selection = tgm_media_frame.state().get('selection');
|
| 623 |
-
var images = [];
|
| 624 |
-
selection.map( function( attachment ) {
|
| 625 |
-
attachment = attachment.toJSON();
|
| 626 |
-
|
| 627 |
-
var obj = {
|
| 628 |
-
imageId: attachment.id
|
| 629 |
-
};
|
| 630 |
-
|
| 631 |
-
if(modula_wp_caption_field == 'title')
|
| 632 |
-
obj.description = attachment.title;
|
| 633 |
-
if(modula_wp_caption_field == 'description')
|
| 634 |
-
obj.description = attachment.description;
|
| 635 |
-
if(modula_wp_caption_field == 'caption')
|
| 636 |
-
obj.description = attachment.caption;
|
| 637 |
-
|
| 638 |
-
if(modula_wp_title_field == 'title')
|
| 639 |
-
obj.title = attachment.title;
|
| 640 |
-
if(modula_wp_title_field == 'description')
|
| 641 |
-
obj.title = attachment.description;
|
| 642 |
-
if(modula_wp_title_field == "none")
|
| 643 |
-
obj.title = "";
|
| 644 |
-
|
| 645 |
-
|
| 646 |
-
if(attachment.sizes[TG.defaultImageSize])
|
| 647 |
-
obj.imagePath = attachment.sizes[TG.defaultImageSize].url
|
| 648 |
-
else
|
| 649 |
-
obj.imagePath = attachment.url;
|
| 650 |
-
|
| 651 |
-
if(attachment.sizes.full)
|
| 652 |
-
obj.altImagePath = attachment.sizes.full.url;
|
| 653 |
-
|
| 654 |
-
images.push(obj);
|
| 655 |
-
|
| 656 |
-
if(typeof attachment.sizes[currentImageSize] !== "undefined")
|
| 657 |
-
{
|
| 658 |
-
obj.imagePath = attachment.sizes[currentImageSize].url;
|
| 659 |
-
}
|
| 660 |
-
else
|
| 661 |
-
{
|
| 662 |
-
obj.imagePath = attachment.sizes.full.url;
|
| 663 |
-
|
| 664 |
-
}
|
| 665 |
-
|
| 666 |
-
});
|
| 667 |
-
|
| 668 |
-
var data = {
|
| 669 |
-
action : 'modula_add_image',
|
| 670 |
-
enc_images : JSON.stringify(images),
|
| 671 |
-
galleryId: $("#gallery-id").val(),
|
| 672 |
-
Modula : $('#Modula').val()
|
| 673 |
-
};
|
| 674 |
-
|
| 675 |
-
|
| 676 |
-
TG.show_loading();
|
| 677 |
-
$.ajax({
|
| 678 |
-
url: ajaxurl,
|
| 679 |
-
data: data,
|
| 680 |
-
dataType: "json",
|
| 681 |
-
type: "post",
|
| 682 |
-
error: function(a,b,c) {
|
| 683 |
-
TG.hide_loading();
|
| 684 |
-
alert("error adding images");
|
| 685 |
-
},
|
| 686 |
-
success: function(r) {
|
| 687 |
-
if(r.success) {
|
| 688 |
-
TG.hide_loading();
|
| 689 |
-
TG.load_images();
|
| 690 |
-
}
|
| 691 |
-
}
|
| 692 |
-
});
|
| 693 |
-
});
|
| 694 |
-
|
| 695 |
-
tgm_media_frame.open();
|
| 696 |
-
});
|
| 697 |
-
}
|
| 698 |
-
}
|
| 699 |
-
}(jQuery);
|
| 700 |
-
|
| 701 |
-
var NewGalleryWizard = function($) {
|
| 702 |
-
|
| 703 |
-
var _curPage = 1;
|
| 704 |
-
var $_wizard = null;
|
| 705 |
-
var _lock = false;
|
| 706 |
-
|
| 707 |
-
return {
|
| 708 |
-
init: function() {
|
| 709 |
-
$_wizard = $("#modula-wizard");
|
| 710 |
-
// $_wizard.find('select').material_select();
|
| 711 |
-
|
| 712 |
-
/*! Wizard next */
|
| 713 |
-
$_wizard.find(".next").click(function() {
|
| 714 |
-
if ($(this).hasClass("disabled"))
|
| 715 |
-
return;
|
| 716 |
-
|
| 717 |
-
// var branch = $("[name=ftg_source]:checked").val();
|
| 718 |
-
$(".invalid").removeClass("invalid");
|
| 719 |
-
|
| 720 |
-
if (_curPage == 1) {
|
| 721 |
-
var name = $.trim($("[name=tg_name]").val());
|
| 722 |
-
if (name.length == 0) {
|
| 723 |
-
$("[name=tg_name]").addClass("invalid");
|
| 724 |
-
return false;
|
| 725 |
-
}
|
| 726 |
-
}
|
| 727 |
|
| 728 |
-
|
| 729 |
-
|
| 730 |
-
|
| 731 |
-
|
| 732 |
-
}
|
| 733 |
-
|
| 734 |
-
$_wizard.find("fieldset").hide();
|
| 735 |
-
_curPage++;
|
| 736 |
-
|
| 737 |
-
var $fs = $_wizard.find("fieldset[data-step=" + _curPage + "]");
|
| 738 |
-
/*if (_curPage == 3) {
|
| 739 |
-
$fs = $fs.filter("[data-branch=" + branch + "]");
|
| 740 |
-
}*/
|
| 741 |
-
$fs.show();
|
| 742 |
-
|
| 743 |
-
if ($fs.data("save")) {
|
| 744 |
-
$('.prev').css("visibility","visible");
|
| 745 |
-
$(this).text("Save");
|
| 746 |
-
if (branch == 'images') {
|
| 747 |
-
$(".select-images").show();
|
| 748 |
-
$("[name=post_categories]").val("");
|
| 749 |
-
$("[name=woo_categories]").val("");
|
| 750 |
-
$("[name=post_tags]").val("");
|
| 751 |
-
} else if(branch == 'posts') {
|
| 752 |
-
$(".select-images").hide();
|
| 753 |
-
$("[name=enc_images]").val("");
|
| 754 |
-
|
| 755 |
-
var categories = [];
|
| 756 |
-
$("[name=_post_categories]:checked").each(function() {
|
| 757 |
-
categories.push(this.value);
|
| 758 |
-
});
|
| 759 |
-
$("[name=post_categories]").val(categories.join(','));
|
| 760 |
-
|
| 761 |
-
var tags = [];
|
| 762 |
-
$("[name=_post_tags]:checked").each(function() {
|
| 763 |
-
tags.push(this.value);
|
| 764 |
-
});
|
| 765 |
-
$("[name=post_tags]").val(tags.join(','));
|
| 766 |
-
} else {
|
| 767 |
-
$(".select-images").hide();
|
| 768 |
-
$("[name=enc_images]").val("");
|
| 769 |
-
|
| 770 |
-
var categories = [];
|
| 771 |
-
$("[name=_woo_categories]:checked").each(function() {
|
| 772 |
-
categories.push(this.value);
|
| 773 |
-
});
|
| 774 |
-
$("[name=woo_categories]").val(categories.join(','));
|
| 775 |
-
}
|
| 776 |
-
} else {
|
| 777 |
-
$(this).text("Next");
|
| 778 |
-
}
|
| 779 |
-
}
|
| 780 |
|
| 781 |
-
|
| 782 |
-
|
| 783 |
-
|
| 784 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 785 |
|
| 786 |
-
|
| 787 |
-
|
| 788 |
-
|
| 789 |
-
|
| 790 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 791 |
|
| 792 |
-
|
| 793 |
|
| 794 |
-
|
| 795 |
-
|
| 796 |
-
|
| 797 |
-
|
| 798 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 799 |
|
| 800 |
-
|
| 801 |
-
|
| 802 |
-
|
| 803 |
-
|
| 804 |
-
|
| 805 |
-
|
| 806 |
-
|
| 807 |
-
|
| 808 |
-
|
| 809 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 810 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 811 |
|
| 812 |
-
|
| 813 |
-
|
| 814 |
-
|
| 815 |
-
|
| 816 |
-
|
| 817 |
-
|
| 818 |
-
|
| 819 |
-
|
| 820 |
-
|
| 821 |
-
|
| 822 |
-
|
| 823 |
-
|
| 824 |
-
|
| 825 |
-
|
| 826 |
-
|
| 827 |
-
|
| 828 |
-
|
| 829 |
-
|
| 830 |
-
|
| 831 |
-
|
| 832 |
-
|
| 833 |
-
|
| 834 |
-
|
| 835 |
-
|
| 836 |
-
|
| 837 |
-
|
| 838 |
-
|
| 839 |
-
|
| 840 |
-
|
| 841 |
-
|
| 842 |
-
|
| 843 |
-
|
| 844 |
-
|
| 845 |
-
|
| 846 |
-
|
| 847 |
-
|
| 848 |
-
|
| 849 |
-
|
| 850 |
-
|
| 851 |
-
|
| 852 |
-
|
| 853 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 854 |
},
|
| 855 |
-
|
| 856 |
-
|
| 857 |
-
|
| 858 |
-
|
| 859 |
-
|
| 860 |
-
|
| 861 |
-
|
| 862 |
-
|
| 863 |
-
|
| 864 |
-
|
| 865 |
-
|
| 866 |
-
|
| 867 |
-
images: images,
|
| 868 |
-
width: width,
|
| 869 |
-
height: height,
|
| 870 |
-
img_size: img_size,
|
| 871 |
-
Modula: $('#Modula').val()
|
| 872 |
-
};
|
| 873 |
-
|
| 874 |
-
$_wizard.find("footer a").addClass("disabled");
|
| 875 |
-
$_wizard.find(".loading").show();
|
| 876 |
-
|
| 877 |
-
$.ajax({
|
| 878 |
-
url: ajaxurl,
|
| 879 |
-
data: data,
|
| 880 |
-
dataType: "json",
|
| 881 |
-
type: "post",
|
| 882 |
-
error: function(a, b, c) {
|
| 883 |
-
$("#error").openModal();
|
| 884 |
-
},
|
| 885 |
-
success: function(id) {
|
| 886 |
-
id = $.trim(id);
|
| 887 |
-
$('#name').val("");
|
| 888 |
-
$('#description').val("");
|
| 889 |
-
|
| 890 |
-
$_success = $('#success');
|
| 891 |
-
$_success.find(".code").val("[Modula id='" + id + "']");
|
| 892 |
-
$_success.find(".gallery-name").text(name);
|
| 893 |
-
$_success.find(".customize").attr("href", "?page=edit-modula-lite&galleryId="+id);
|
| 894 |
-
|
| 895 |
-
$_success.openModal();
|
| 896 |
-
}
|
| 897 |
-
});
|
| 898 |
}
|
|
|
|
| 899 |
}
|
| 900 |
-
}
|
| 901 |
-
|
| 902 |
-
|
| 903 |
-
|
| 904 |
-
|
| 905 |
-
|
| 906 |
-
|
| 907 |
-
|
| 908 |
-
|
| 909 |
-
|
| 910 |
-
|
| 911 |
-
|
| 912 |
-
|
| 913 |
-
|
| 914 |
-
|
| 915 |
-
|
| 916 |
-
|
| 917 |
-
|
| 918 |
-
|
| 919 |
-
|
| 920 |
-
|
| 921 |
-
|
| 922 |
-
|
| 923 |
-
|
| 924 |
-
|
| 925 |
-
|
| 926 |
-
|
| 927 |
-
|
| 928 |
-
|
| 929 |
-
|
| 930 |
-
|
| 931 |
-
|
|
|
|
| 932 |
|
| 933 |
-
|
| 934 |
-
|
| 935 |
-
|
| 936 |
-
|
| 937 |
|
| 938 |
-
|
| 939 |
-
|
| 940 |
|
| 941 |
-
|
| 942 |
-
|
| 943 |
-
|
| 944 |
-
|
| 945 |
-
|
| 946 |
-
|
| 947 |
-
|
| 948 |
-
|
| 949 |
-
|
| 950 |
-
|
| 951 |
-
|
| 952 |
-
|
| 953 |
-
|
| 954 |
-
|
| 955 |
-
|
| 956 |
-
|
| 957 |
-
|
| 958 |
-
|
| 959 |
-
|
| 960 |
-
|
| 961 |
|
| 962 |
-
|
| 963 |
-
|
| 964 |
-
|
| 965 |
-
|
| 966 |
|
| 967 |
-
|
| 968 |
-
|
| 969 |
-
|
| 970 |
-
|
| 971 |
-
|
| 972 |
|
| 973 |
-
|
| 974 |
|
| 975 |
-
|
| 976 |
-
|
| 977 |
-
|
| 978 |
-
|
| 979 |
-
|
| 980 |
|
| 981 |
-
|
| 982 |
-
|
| 983 |
-
|
| 984 |
-
|
| 985 |
-
|
| 986 |
-
|
| 987 |
-
|
| 988 |
-
|
| 989 |
-
|
| 990 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 991 |
},
|
| 992 |
-
|
| 993 |
-
|
| 994 |
-
|
| 995 |
-
|
| 996 |
-
|
| 997 |
-
|
| 998 |
-
|
| 999 |
-
|
| 1000 |
-
var data = {
|
| 1001 |
-
action : 'modula_do_import_galleries',
|
| 1002 |
-
source: source,
|
| 1003 |
-
ids: ids.join(','),
|
| 1004 |
-
Modula : $('#Modula').val()
|
| 1005 |
-
};
|
| 1006 |
-
|
| 1007 |
-
$_wizard.find("footer a").addClass("disabled");
|
| 1008 |
-
$_wizard.find(".loading").show();
|
| 1009 |
-
|
| 1010 |
-
$.ajax({
|
| 1011 |
-
url: ajaxurl,
|
| 1012 |
-
data: data,
|
| 1013 |
-
dataType: "json",
|
| 1014 |
-
type: "post",
|
| 1015 |
-
error: function(a,b,c) {
|
| 1016 |
-
$("#error").openModal();
|
| 1017 |
-
},
|
| 1018 |
-
success: function(r) {
|
| 1019 |
-
if(r.success) {
|
| 1020 |
-
$('#success').openModal();
|
| 1021 |
-
} else {
|
| 1022 |
-
$("#error").openModal();
|
| 1023 |
-
}
|
| 1024 |
-
}
|
| 1025 |
-
});
|
| 1026 |
}
|
|
|
|
| 1027 |
}
|
| 1028 |
-
}
|
| 1029 |
-
|
| 1030 |
-
|
| 1031 |
-
|
| 1032 |
-
|
| 1033 |
-
|
| 1034 |
-
|
| 1035 |
-
|
| 1036 |
-
|
| 1037 |
-
|
| 1038 |
-
|
| 1039 |
-
|
| 1040 |
-
|
| 1041 |
-
|
| 1042 |
-
|
| 1043 |
-
|
| 1044 |
-
|
| 1045 |
-
|
| 1046 |
-
});
|
|
|
| 1 |
+
var TG = function( $ ) {
|
| 2 |
+
var _loading = null;
|
| 3 |
+
|
| 4 |
+
return {
|
| 5 |
+
choose_images: function( title_field, caption_field, callback ) {
|
| 6 |
+
tgm_media_frame = wp.media.frames.tgm_media_frame = wp.media( {
|
| 7 |
+
multiple: true,
|
| 8 |
+
library: {
|
| 9 |
+
type: 'image'
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 10 |
},
|
| 11 |
+
title: 'Add image(s)',
|
| 12 |
+
button: {
|
| 13 |
+
text: 'Add image(s)'
|
| 14 |
+
},
|
| 15 |
+
states: [
|
| 16 |
+
new wp.media.controller.Library( {
|
| 17 |
+
library: wp.media.query( {
|
| 18 |
+
type: 'image'
|
| 19 |
+
} ),
|
| 20 |
+
multiple: true,
|
| 21 |
+
priority: 20,
|
| 22 |
+
filterable: 'all'
|
| 23 |
+
} )
|
| 24 |
+
]
|
| 25 |
+
} );
|
| 26 |
+
|
| 27 |
+
tgm_media_frame.on( 'select', function() {
|
| 28 |
+
var selection = tgm_media_frame.state().get( 'selection' );
|
| 29 |
+
var images = [];
|
| 30 |
+
|
| 31 |
+
var errors = 0;
|
| 32 |
+
selection.map( function( attachment ) {
|
| 33 |
+
attachment = attachment.toJSON();
|
| 34 |
+
|
| 35 |
+
if ( ! attachment.sizes ) {
|
| 36 |
+
errors ++;
|
| 37 |
+
return;
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
var obj = {
|
| 41 |
+
imageId: attachment.id
|
| 42 |
+
};
|
| 43 |
+
|
| 44 |
+
if ( title_field != 'none' )
|
| 45 |
+
obj.title = attachment[ title_field ];
|
| 46 |
+
if ( caption_field != 'none' )
|
| 47 |
+
obj.description = attachment[ caption_field ];
|
| 48 |
+
|
| 49 |
+
obj.imagePath = attachment.url;
|
| 50 |
+
|
| 51 |
+
if ( attachment.sizes.thumbnail )
|
| 52 |
+
obj.thumbnail = attachment.sizes.thumbnail.url;
|
| 53 |
+
|
| 54 |
+
if ( attachment.sizes.full )
|
| 55 |
+
obj.altImagePath = attachment.sizes.full.url;
|
| 56 |
+
|
| 57 |
+
images.push( obj );
|
| 58 |
+
} );
|
| 59 |
+
|
| 60 |
+
if ( errors ) {
|
| 61 |
+
alert( errors + ' images could not be added because the selected size is not available' );
|
| 62 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 63 |
|
| 64 |
+
callback( images );
|
| 65 |
+
} );
|
| 66 |
+
|
| 67 |
+
tgm_media_frame.open();
|
| 68 |
+
},
|
| 69 |
+
show_loading: function() {
|
| 70 |
+
$( '#spinner' ).addClass( 'shown' );
|
| 71 |
+
},
|
| 72 |
+
hide_loading: function() {
|
| 73 |
+
$( '#spinner' ).removeClass( 'shown' );
|
| 74 |
+
},
|
| 75 |
+
delete_image: function( id ) {
|
| 76 |
+
TG.show_loading();
|
| 77 |
+
$.post( ajaxurl, {
|
| 78 |
+
action: 'modula_delete_image',
|
| 79 |
+
Modula: $( '#Modula' ).val(),
|
| 80 |
+
id: id
|
| 81 |
+
}, function() {
|
| 82 |
+
TG.load_images();
|
| 83 |
+
} );
|
| 84 |
+
},
|
| 85 |
+
load_images: function() {
|
| 86 |
+
if ( ! _loading )
|
| 87 |
+
TG.show_loading();
|
| 88 |
+
|
| 89 |
+
$.post( ajaxurl, {
|
| 90 |
+
action: 'modula_list_images',
|
| 91 |
+
Modula: $( '#Modula' ).val(),
|
| 92 |
+
gid: $( '#gallery-id' ).val()
|
| 93 |
+
}, function( html ) {
|
| 94 |
+
$( '#image-list' ).empty().append( html ).sortable( {
|
| 95 |
+
update: function() {
|
| 96 |
TG.show_loading();
|
| 97 |
+
var ids = [];
|
| 98 |
+
$( '#image-list .item' ).each( function() {
|
| 99 |
+
ids.push( $( this ).data( 'id' ) );
|
| 100 |
+
} );
|
| 101 |
+
var data = {
|
| 102 |
+
action: 'modula_sort_images',
|
| 103 |
+
Modula: $( '#Modula' ).val(),
|
| 104 |
+
ids: ids.join( ',' )
|
| 105 |
+
};
|
| 106 |
+
$.post( ajaxurl, data, function() {
|
| 107 |
+
TG.hide_loading();
|
| 108 |
+
} );
|
| 109 |
+
}
|
| 110 |
+
} );
|
| 111 |
+
|
| 112 |
+
$( '#image-list .remove' ).click( function( e ) {
|
| 113 |
+
e.preventDefault();
|
| 114 |
+
e.stopPropagation();
|
| 115 |
+
|
| 116 |
+
var $item = $( this ).parents( '.item:first' );
|
| 117 |
+
var id = $item.data( 'id' );
|
| 118 |
+
|
| 119 |
+
var data = {
|
| 120 |
+
action: 'modula_delete_image',
|
| 121 |
+
Modula: $( '#Modula' ).val(),
|
| 122 |
+
id: id
|
| 123 |
+
};
|
| 124 |
+
|
| 125 |
+
TG.show_loading();
|
| 126 |
+
$.post( ajaxurl, data, function() {
|
| 127 |
+
$item.remove();
|
| 128 |
+
TG.hide_loading();
|
| 129 |
+
} );
|
| 130 |
+
} );
|
| 131 |
+
|
| 132 |
+
$( '#image-list .checkbox' ).click( function() {
|
| 133 |
+
$( this ).toggleClass( 'checked' );
|
| 134 |
+
$( this ).parents( '.item:first' ).toggleClass( 'selected' );
|
| 135 |
+
} );
|
| 136 |
+
|
| 137 |
+
TG.hide_loading();
|
| 138 |
+
} );
|
| 139 |
+
},
|
| 140 |
+
edit_image: function( form ) {
|
| 141 |
+
var data = {};
|
| 142 |
+
form.find( 'input[type=text], input:checked, input, textarea, input[type=hidden]' ).each( function() {
|
| 143 |
+
data[ $( this ).attr( 'name' ) ] = $( this ).val();
|
| 144 |
+
} );
|
| 145 |
+
data.action = 'modula_save_image';
|
| 146 |
+
data.type = 'edit';
|
| 147 |
+
data.Modula = $( '#Modula' ).val();
|
| 148 |
+
TG.show_loading();
|
| 149 |
+
$.ajax( {
|
| 150 |
+
url: ajaxurl,
|
| 151 |
+
data: data,
|
| 152 |
+
dataType: 'json',
|
| 153 |
+
type: 'post',
|
| 154 |
+
error: function( a, b, c ) {
|
| 155 |
+
TG.hide_loading();
|
| 156 |
},
|
| 157 |
+
success: function( r ) {
|
| 158 |
+
if ( r.success ) {
|
| 159 |
+
TG.load_images();
|
| 160 |
+
} else {
|
| 161 |
+
TG.hide_loading();
|
| 162 |
+
}
|
| 163 |
+
}
|
| 164 |
+
} );
|
| 165 |
+
},
|
| 166 |
+
add_image: function() {
|
| 167 |
+
|
| 168 |
+
var data = {};
|
| 169 |
+
$( '#add_image_form input[type=text], #add_image_form input:checked, #add_image_form textarea, #add_image_form input[type=hidden]' ).each( function() {
|
| 170 |
+
data[ $( this ).attr( 'name' ) ] = $( this ).val();
|
| 171 |
+
} );
|
| 172 |
+
|
| 173 |
+
data.action = 'modula_save_image';
|
| 174 |
+
data.type = $( this ).data( 'type' );
|
| 175 |
+
if ( data.img_id == '' ) {
|
| 176 |
+
var p = $( '<div title=\'Attention\'>Select an image to add</div>' ).dialog( {
|
| 177 |
+
modal: true,
|
| 178 |
+
buttons: {
|
| 179 |
+
Close: function() {
|
| 180 |
+
p.dialog( 'destroy' );
|
| 181 |
+
}
|
| 182 |
+
}
|
| 183 |
+
} );
|
| 184 |
+
return false;
|
| 185 |
+
}
|
| 186 |
+
|
| 187 |
+
TG.show_loading();
|
| 188 |
+
$.ajax( {
|
| 189 |
+
url: ajaxurl,
|
| 190 |
+
data: data,
|
| 191 |
+
dataType: 'json',
|
| 192 |
+
type: 'post',
|
| 193 |
+
error: function( a, b, c ) {
|
| 194 |
+
TG.hide_loading();
|
| 195 |
+
},
|
| 196 |
+
success: function( r ) {
|
| 197 |
+
if ( r.success ) {
|
| 198 |
+
TG.load_images();
|
| 199 |
+
$( '#add_image_form .img img' ).remove();
|
| 200 |
+
$( '[name=img_id],[name=img_url],[name=url],[name=image_caption]' ).val( '' );
|
| 201 |
+
}
|
| 202 |
+
}
|
| 203 |
+
} );
|
| 204 |
+
},
|
| 205 |
+
init_gallery: function() {
|
| 206 |
+
|
| 207 |
+
},
|
| 208 |
+
save_gallery: function() {
|
| 209 |
+
var data = {};
|
| 210 |
+
data.action = 'modula_save_gallery';
|
| 211 |
+
|
| 212 |
+
$( '.form-fields' ).find( 'input[type=text], select, input[type=range], input:checked, input[type=hidden], textarea' ).each( function() {
|
| 213 |
+
data[ $( this ).attr( 'name' ) ] = $( this ).val();
|
| 214 |
+
} );
|
| 215 |
+
|
| 216 |
+
if ( parseInt( data.gridCellSize ) < 2 )
|
| 217 |
+
data.gridCellSize = 2;
|
| 218 |
+
|
| 219 |
+
if ( data.galleryName == '' ) {
|
| 220 |
+
var p = $( '<div title=\'Attention\'>Insert a name for the gallery</div>' ).dialog( {
|
| 221 |
+
modal: true,
|
| 222 |
+
buttons: {
|
| 223 |
+
Close: function() {
|
| 224 |
+
p.dialog( 'destroy' );
|
| 225 |
+
}
|
| 226 |
+
}
|
| 227 |
+
} );
|
| 228 |
+
return false;
|
| 229 |
+
}
|
| 230 |
+
|
| 231 |
+
TG.show_loading();
|
| 232 |
+
|
| 233 |
+
$.ajax( {
|
| 234 |
+
url: ajaxurl,
|
| 235 |
+
data: data,
|
| 236 |
+
dataType: 'json',
|
| 237 |
+
type: 'post',
|
| 238 |
+
error: function( a, b, c ) {
|
| 239 |
+
TG.hide_loading();
|
| 240 |
+
},
|
| 241 |
+
success: function( r ) {
|
| 242 |
+
if ( data.ftg_gallery_edit ) {
|
| 243 |
+
Materialize.toast( 'Gallery Saved', 2000 );
|
| 244 |
+
TG.hide_loading();
|
| 245 |
+
}
|
| 246 |
+
else
|
| 247 |
+
location.href = '?page=modula-lite-edit';
|
| 248 |
+
}
|
| 249 |
+
} );
|
| 250 |
+
},
|
| 251 |
+
bind: function() {
|
| 252 |
+
|
| 253 |
+
$( '.field .text .preview .panel' ).hide();
|
| 254 |
+
$( '.field .text .preview .panel-' + $( '.field .text .select-effect' ).val() ).fadeIn( 2000 );
|
| 255 |
+
|
| 256 |
+
$( '.field .text .select-effect' ).on( 'change', function() {
|
| 257 |
+
var currentEffect = $( this ).val();
|
| 258 |
+
$( '.field .text .preview .panel' ).hide();
|
| 259 |
+
$( '.field .text .preview .panel-' + currentEffect ).fadeIn( 2000 );
|
| 260 |
+
} );
|
| 261 |
+
|
| 262 |
+
$( '.bullet-menu li a' ).click( function( e ) {
|
| 263 |
+
e.preventDefault();
|
| 264 |
+
var target = $( this ).attr( 'rel' ).toLowerCase();
|
| 265 |
+
$( '#' + target + ' .collapsible-header' ).click();
|
| 266 |
+
setTimeout( function() {
|
| 267 |
+
$( 'html, body' ).animate( {
|
| 268 |
+
scrollTop: $( '#' + target ).offset().top - 28
|
| 269 |
+
}, 1000 );
|
| 270 |
+
}, 500 );
|
| 271 |
+
} );
|
| 272 |
+
|
| 273 |
+
$( '.import-export a' ).click( function() {
|
| 274 |
+
|
| 275 |
+
if ( $( this ).attr( 'id' ) == 'import' ) {
|
| 276 |
+
$( '#import-modal' ).modal();
|
| 277 |
+
$( '#import-modal' ).modal( 'open' );
|
| 278 |
+
}
|
| 279 |
+
else if ( $( this ).attr( 'id' ) == 'export' ) {
|
| 280 |
+
var data = { action: 'modula_get_config', id: $( '#gallery-id' ).val(), Modula: $( '#Modula' ).val() };
|
| 281 |
+
|
| 282 |
+
$.ajax( {
|
| 283 |
+
type: 'POST',
|
| 284 |
+
url: ajaxurl,
|
| 285 |
+
data: data,
|
| 286 |
+
success: function( r ) {
|
| 287 |
+
$( '#export-modal .modal-content textarea' ).val( '' );
|
| 288 |
+
$( '#export-modal .modal-content textarea' ).val( r );
|
| 289 |
+
|
| 290 |
+
$( '#export-modal' ).modal();
|
| 291 |
+
$( '#export-modal' ).modal( 'open' );
|
| 292 |
}
|
| 293 |
|
| 294 |
+
} );
|
| 295 |
+
}
|
| 296 |
+
} );
|
| 297 |
+
|
| 298 |
+
$( '#import-modal .modal-footer #save' ).click( function() {
|
| 299 |
+
var config = $( '#import-modal textarea' ).val();
|
| 300 |
+
|
| 301 |
+
var data = { action: 'modula_update_config', config: config, id: $( '#gallery-id' ).val(), Modula: $( '#Modula' ).val() };
|
| 302 |
+
$.ajax( {
|
| 303 |
+
type: 'POST',
|
| 304 |
+
url: ajaxurl,
|
| 305 |
+
data: data,
|
| 306 |
+
success: function( r ) {
|
| 307 |
+
alert( 'Gallery configuration has been updated' );
|
| 308 |
+
}
|
| 309 |
+
} );
|
| 310 |
+
} );
|
| 311 |
+
|
| 312 |
+
$( '.collapsible-header' ).click( function() {
|
| 313 |
+
var target = $( this ).parent().attr( 'id' );
|
| 314 |
+
setTimeout( function() {
|
| 315 |
+
$( 'html, body' ).animate( {
|
| 316 |
+
scrollTop: $( '#' + target ).offset().top - 28
|
| 317 |
+
}, 1000 );
|
| 318 |
+
}, 500 );
|
| 319 |
+
} );
|
| 320 |
+
|
| 321 |
+
$( '.field .text .integer-only' ).keypress( function( e ) {
|
| 322 |
+
var charCode = (e.which) ? e.which : e.keyCode;
|
| 323 |
+
|
| 324 |
+
if ( charCode != 46 && charCode > 31
|
| 325 |
+
&& (charCode < 48 || charCode > 57) )
|
| 326 |
+
return false;
|
| 327 |
+
|
| 328 |
+
return true;
|
| 329 |
+
} );
|
| 330 |
+
|
| 331 |
+
$( '#create-gallery' ).click( function() {
|
| 332 |
+
var name = $( '#name' ).val();
|
| 333 |
+
var description = $( '#description' ).val();
|
| 334 |
+
|
| 335 |
+
if ( name == '' || description == '' ) return;
|
| 336 |
+
|
| 337 |
+
var data = { action: 'create_gallery', name: name, description: description };
|
| 338 |
+
|
| 339 |
+
jQuery.post( ajaxurl, data, function( id ) {
|
| 340 |
+
$( '#name' ).val( '' );
|
| 341 |
+
$( '#description' ).val( '' );
|
| 342 |
+
|
| 343 |
+
$_success = $( '#success' );
|
| 344 |
+
|
| 345 |
+
$_success.find( '.code' ).val( '[Modula id=\'' + id + '\']' );
|
| 346 |
+
$_success.find( '.gallery-name' ).text( name );
|
| 347 |
+
$_success.find( '.customize' ).attr( 'href', '?page=modula-lite-edit&galleryId=' + id );
|
| 348 |
+
|
| 349 |
+
$_success.modal();
|
| 350 |
+
$_success.modal( 'open' );
|
| 351 |
+
} );
|
| 352 |
+
|
| 353 |
+
} );
|
| 354 |
+
|
| 355 |
+
$( '#add-submit' ).click( function( e ) {
|
| 356 |
+
e.preventDefault();
|
| 357 |
+
TG.add_image();
|
| 358 |
+
} );
|
| 359 |
+
$( '#add-gallery, #edit-gallery' ).click( function( e ) {
|
| 360 |
+
e.preventDefault();
|
| 361 |
+
TG.save_gallery();
|
| 362 |
+
} );
|
| 363 |
+
|
| 364 |
+
$( '#image-list' ).on( 'click', '.item .thumb', function() {
|
| 365 |
+
$( this ).parents( '.item' ).toggleClass( 'selected' );
|
| 366 |
+
$( this ).parents( '.item' ).find( '.checkbox' ).toggleClass( 'checked' );
|
| 367 |
+
} );
|
| 368 |
+
$( '#image-list' ).on( 'click', '.edit', function( e ) {
|
| 369 |
+
e.preventDefault();
|
| 370 |
+
|
| 371 |
+
$( '#wpbody-content' ).addClass( 'dark-content' );
|
| 372 |
+
var $item = $( this ).parents( '.item' );
|
| 373 |
+
|
| 374 |
+
var panel = $( '#image-panel-model' ).clone().attr( 'id', 'image-panel' );
|
| 375 |
+
panel.css( {
|
| 376 |
+
marginTop: $( window ).scrollTop() - (246 / 2)
|
| 377 |
+
} );
|
| 378 |
+
|
| 379 |
+
$( '[name=target]', panel ).val( $( '[name=target]', $item ).val() );
|
| 380 |
+
$( '#item-link', panel ).val( $( '[name=link]', $item ).val() );
|
| 381 |
+
$( '.figure', panel ).append( $( 'img', $item ).clone() );
|
| 382 |
+
$( '.sizes', panel ).append( $( 'select', $item ).clone() );
|
| 383 |
+
$( '#item-title', panel ).html( $( '#img-title', $item ).val() );
|
| 384 |
+
$( '#item-description', panel ).val( $( 'pre', $item ).html() );
|
| 385 |
+
$( '.copy', $item ).clone().appendTo( panel );
|
| 386 |
+
|
| 387 |
+
$( 'body' ).append( '<div class=\'overlay\' style=\'display:none\' />' );
|
| 388 |
+
$( '.overlay' ).fadeIn();
|
| 389 |
+
panel.appendTo( 'body' ).fadeIn();
|
| 390 |
+
|
| 391 |
+
var link = $item.find( '[name=link]' ).val();
|
| 392 |
+
|
| 393 |
+
$( '[name=halign]', panel ).val( $( '[name=halign]', $item ).val() );
|
| 394 |
+
$( '[name=valign]', panel ).val( $( '[name=valign]', $item ).val() );
|
| 395 |
+
|
| 396 |
+
$( '.buttons a', panel ).click( function( e ) {
|
| 397 |
+
e.preventDefault();
|
| 398 |
+
|
| 399 |
+
switch ( $( this ).data( 'action' ) ) {
|
| 400 |
+
case 'save':
|
| 401 |
+
$( '#wpbody-content' ).removeClass( 'dark-content' );
|
| 402 |
+
var data = {
|
| 403 |
+
action: 'modula_save_image',
|
| 404 |
+
Modula: $( '#Modula' ).val()
|
| 405 |
+
};
|
| 406 |
+
$( 'input[type=text], input[type=hidden], input[type=radio]:checked, input[type=checkbox]:checked, textarea, select', panel ).each( function() {
|
| 407 |
+
if ( $( this ).attr( 'name' ) )
|
| 408 |
+
data[ $( this ).attr( 'name' ) ] = $( this ).val();
|
| 409 |
+
} );
|
| 410 |
+
|
| 411 |
+
$( '#image-panel .close' ).trigger( 'click' );
|
| 412 |
+
TG.show_loading();
|
| 413 |
+
$.ajax( {
|
| 414 |
url: ajaxurl,
|
| 415 |
data: data,
|
| 416 |
+
dataType: 'json',
|
| 417 |
+
type: 'post',
|
| 418 |
+
error: function( a, b, c ) {
|
| 419 |
+
console.log( a, b, c );
|
| 420 |
+
TG.hide_loading();
|
| 421 |
},
|
| 422 |
+
success: function( r ) {
|
| 423 |
+
TG.hide_loading();
|
| 424 |
+
TG.load_images();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 425 |
}
|
| 426 |
+
} );
|
| 427 |
+
break;
|
| 428 |
+
case 'cancel':
|
| 429 |
+
$( '#wpbody-content' ).removeClass( 'dark-content' );
|
| 430 |
+
$( '#image-panel .close' ).trigger( 'click' );
|
| 431 |
+
break;
|
| 432 |
+
}
|
| 433 |
+
} );
|
| 434 |
+
|
| 435 |
+
$( '#image-panel .close, .overlay' ).click( function( e ) {
|
| 436 |
+
e.preventDefault();
|
| 437 |
+
panel.fadeOut( function() {
|
| 438 |
+
$( this ).remove();
|
| 439 |
+
} );
|
| 440 |
+
$( '.overlay' ).fadeOut( function() {
|
| 441 |
+
$( this ).remove();
|
| 442 |
+
} );
|
| 443 |
+
} );
|
| 444 |
+
} );
|
| 445 |
+
|
| 446 |
+
$( '.jump' ).on( 'change', function() {
|
| 447 |
+
var field = $( this ).val();
|
| 448 |
+
$( 'html, body' ).animate( {
|
| 449 |
+
scrollTop: $( '.row-' + field ).offset().top - 20
|
| 450 |
+
}, 1000 );
|
| 451 |
+
$( this ).get( 0 ).selectedIndex = 0;
|
| 452 |
+
} );
|
| 453 |
+
|
| 454 |
+
$( 'body' ).on( 'click', '[name=click_action]', function() {
|
| 455 |
+
if ( $( this ).val() == 'url' ) {
|
| 456 |
+
$( this ).siblings( '[name=url]' ).get( 0 ).disabled = false;
|
| 457 |
+
} else {
|
| 458 |
+
$( this ).siblings( '[name=url]' ).val( '' ).get( 0 ).disabled = true;
|
| 459 |
+
}
|
| 460 |
+
} );
|
| 461 |
+
|
| 462 |
+
$( '.bulk a' ).click( function( e ) {
|
| 463 |
+
e.preventDefault();
|
| 464 |
+
|
| 465 |
+
var $bulk = $( '.bulk' );
|
| 466 |
+
|
| 467 |
+
switch ( $( this ).data( 'action' ) ) {
|
| 468 |
+
case 'select':
|
| 469 |
+
$( '#images .item' ).addClass( 'selected' );
|
| 470 |
+
$( '#images .item .checkbox' ).addClass( 'checked' );
|
| 471 |
+
break;
|
| 472 |
+
case 'deselect':
|
| 473 |
+
$( '#images .item' ).removeClass( 'selected' );
|
| 474 |
+
$( '#images .item .checkbox' ).removeClass( 'checked' );
|
| 475 |
+
break;
|
| 476 |
+
case 'toggle':
|
| 477 |
+
$( '#images .item' ).toggleClass( 'selected' );
|
| 478 |
+
$( '#images .item .checkbox' ).toggleClass( 'checked' );
|
| 479 |
+
break;
|
| 480 |
+
case 'resize':
|
| 481 |
+
var selected = [];
|
| 482 |
+
$( '#images .item.selected' ).each( function( i, o ) {
|
| 483 |
+
selected.push( $( o ).data( 'id' ) + '-' + $( o ).data( 'image-id' ) );
|
| 484 |
+
} );
|
| 485 |
+
if ( selected.length == 0 ) {
|
| 486 |
+
alert( 'No images selected' );
|
| 487 |
+
} else {
|
| 488 |
+
$( '.panel', $bulk ).hide();
|
| 489 |
+
$( '.panel strong', $bulk ).text( 'Select size' );
|
| 490 |
+
$( '.panel .text', $bulk ).text( '' );
|
| 491 |
+
var $sizes = $( '.current-image-size' ).clone( false );
|
| 492 |
+
$sizes.removeClass( 'current-image-size' );
|
| 493 |
+
$( '.panel .text', $bulk ).append( $sizes );
|
| 494 |
+
|
| 495 |
+
$( '.cancel', $bulk ).unbind( 'click' ).click( function( e ) {
|
| 496 |
e.preventDefault();
|
| 497 |
+
$( '.panel', $bulk ).slideUp();
|
| 498 |
+
} );
|
| 499 |
+
|
| 500 |
+
$( '.proceed', $bulk ).unbind( 'click' ).click( function( e ) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 501 |
e.preventDefault();
|
| 502 |
+
$( '.panel', $bulk ).slideUp();
|
| 503 |
+
|
| 504 |
+
var data = {
|
| 505 |
+
action: 'modula_resize_images',
|
| 506 |
+
Modula: $( '#Modula' ).val(),
|
| 507 |
+
size: $sizes.val(),
|
| 508 |
+
id: selected.join( ',' )
|
| 509 |
+
};
|
| 510 |
+
|
| 511 |
+
TG.show_loading();
|
| 512 |
+
$.post( ajaxurl, data, function() {
|
| 513 |
+
TG.load_images();
|
| 514 |
+
TG.hide_loading();
|
| 515 |
+
} );
|
| 516 |
+
} );
|
| 517 |
+
|
| 518 |
+
$( '.panel', $bulk ).slideDown();
|
| 519 |
+
}
|
| 520 |
+
break;
|
| 521 |
+
case 'remove':
|
| 522 |
+
var selected = [];
|
| 523 |
+
$( '#images .item.selected' ).each( function( i, o ) {
|
| 524 |
+
selected.push( $( o ).data( 'id' ) );
|
| 525 |
+
} );
|
| 526 |
+
if ( selected.length == 0 ) {
|
| 527 |
+
alert( 'No images selected' );
|
| 528 |
+
} else {
|
| 529 |
+
$( '.panel', $bulk ).hide();
|
| 530 |
+
$( '.panel strong', $bulk ).text( 'Confirm' );
|
| 531 |
+
$( '.panel .text', $bulk ).text( 'You selected ' + selected.length + ' images to remove, proceed ?' );
|
| 532 |
+
|
| 533 |
+
$( '.cancel', $bulk ).unbind( 'click' ).click( function( e ) {
|
| 534 |
e.preventDefault();
|
| 535 |
+
$( '.panel', $bulk ).slideUp();
|
| 536 |
+
} );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 537 |
|
| 538 |
+
$( '.proceed', $bulk ).unbind( 'click' ).click( function( e ) {
|
| 539 |
e.preventDefault();
|
| 540 |
+
$( '.panel', $bulk ).slideUp();
|
| 541 |
|
| 542 |
+
var data = {
|
| 543 |
+
action: 'modula_delete_image',
|
| 544 |
+
Modula: $( '#Modula' ).val(),
|
| 545 |
+
id: selected.join( ',' )
|
| 546 |
+
};
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 547 |
|
| 548 |
+
TG.show_loading();
|
| 549 |
+
$.post( ajaxurl, data, function() {
|
| 550 |
+
$( '#images .item.selected' ).remove();
|
| 551 |
+
TG.hide_loading();
|
| 552 |
+
} );
|
| 553 |
+
} );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 554 |
|
| 555 |
+
$( '.panel', $bulk ).slideDown();
|
| 556 |
+
}
|
| 557 |
+
break;
|
| 558 |
+
}
|
| 559 |
+
} );
|
| 560 |
+
|
| 561 |
+
$( '.import-source' ).on( 'change', function() {
|
| 562 |
+
var source = $( this ).val();
|
| 563 |
+
$( '#external-galleries ul' ).empty();
|
| 564 |
+
|
| 565 |
+
if ( source ) {
|
| 566 |
+
var data = {
|
| 567 |
+
action: 'modula_get_ext_galleries',
|
| 568 |
+
source: source,
|
| 569 |
+
Modula: $( '#Modula' ).val()
|
| 570 |
+
};
|
| 571 |
+
|
| 572 |
+
function fill( list ) {
|
| 573 |
+
var $ul = $( '#external-galleries ul' );
|
| 574 |
+
$.each( list, function( i, g ) {
|
| 575 |
+
console.log( g );
|
| 576 |
+
$ul.append( '<li><input class=\'js-item\' type=\'checkbox\' value=\'' + g.id + '\'/> ' + g.title + '</li>' );
|
| 577 |
+
} );
|
| 578 |
+
}
|
| 579 |
+
|
| 580 |
+
TG.show_loading();
|
| 581 |
+
$.ajax( {
|
| 582 |
+
url: ajaxurl,
|
| 583 |
+
data: data,
|
| 584 |
+
dataType: 'json',
|
| 585 |
+
type: 'post',
|
| 586 |
+
error: function( a, b, c ) {
|
| 587 |
+
TG.hide_loading();
|
| 588 |
+
alert( 'error loading galleries' );
|
| 589 |
+
},
|
| 590 |
+
success: function( r ) {
|
| 591 |
+
if ( r.success ) {
|
| 592 |
+
TG.hide_loading();
|
| 593 |
|
| 594 |
+
fill( r.galleries );
|
| 595 |
+
}
|
| 596 |
+
}
|
| 597 |
+
} );
|
| 598 |
+
}
|
| 599 |
+
} );
|
| 600 |
+
|
| 601 |
+
$( '.open-media-panel' ).on( 'click', function() {
|
| 602 |
+
|
| 603 |
+
var currentImageSize = $( '.current-image-size' ).val();
|
| 604 |
+
|
| 605 |
+
tgm_media_frame = wp.media.frames.tgm_media_frame = wp.media( {
|
| 606 |
+
multiple: true,
|
| 607 |
+
library: {
|
| 608 |
+
type: 'image'
|
| 609 |
+
}
|
| 610 |
+
} );
|
| 611 |
+
|
| 612 |
+
modula_wp_caption_field = $( '#wp_caption' ).val();
|
| 613 |
+
modula_wp_title_field = $( '#wp_title' ).val();
|
| 614 |
+
|
| 615 |
+
tgm_media_frame.on( 'select', function() {
|
| 616 |
+
var selection = tgm_media_frame.state().get( 'selection' );
|
| 617 |
+
var images = [];
|
| 618 |
+
selection.map( function( attachment ) {
|
| 619 |
+
attachment = attachment.toJSON();
|
| 620 |
+
|
| 621 |
+
var obj = {
|
| 622 |
+
imageId: attachment.id
|
| 623 |
+
};
|
| 624 |
+
|
| 625 |
+
if ( modula_wp_caption_field == 'title' )
|
| 626 |
+
obj.description = attachment.title;
|
| 627 |
+
if ( modula_wp_caption_field == 'description' )
|
| 628 |
+
obj.description = attachment.description;
|
| 629 |
+
if ( modula_wp_caption_field == 'caption' )
|
| 630 |
+
obj.description = attachment.caption;
|
| 631 |
+
|
| 632 |
+
if ( modula_wp_title_field == 'title' )
|
| 633 |
+
obj.title = attachment.title;
|
| 634 |
+
if ( modula_wp_title_field == 'description' )
|
| 635 |
+
obj.title = attachment.description;
|
| 636 |
+
if ( modula_wp_title_field == 'none' )
|
| 637 |
+
obj.title = '';
|
| 638 |
+
|
| 639 |
+
if ( attachment.sizes[ TG.defaultImageSize ] )
|
| 640 |
+
obj.imagePath = attachment.sizes[ TG.defaultImageSize ].url;
|
| 641 |
+
else
|
| 642 |
+
obj.imagePath = attachment.url;
|
| 643 |
+
|
| 644 |
+
if ( attachment.sizes.full )
|
| 645 |
+
obj.altImagePath = attachment.sizes.full.url;
|
| 646 |
+
|
| 647 |
+
images.push( obj );
|
| 648 |
+
|
| 649 |
+
if ( typeof attachment.sizes[ currentImageSize ] !== 'undefined' ) {
|
| 650 |
+
obj.imagePath = attachment.sizes[ currentImageSize ].url;
|
| 651 |
+
}
|
| 652 |
+
else {
|
| 653 |
+
obj.imagePath = attachment.sizes.full.url;
|
| 654 |
|
| 655 |
+
}
|
| 656 |
|
| 657 |
+
} );
|
| 658 |
+
|
| 659 |
+
var data = {
|
| 660 |
+
action: 'modula_add_image',
|
| 661 |
+
enc_images: JSON.stringify( images ),
|
| 662 |
+
galleryId: $( '#gallery-id' ).val(),
|
| 663 |
+
Modula: $( '#Modula' ).val()
|
| 664 |
+
};
|
| 665 |
+
|
| 666 |
+
TG.show_loading();
|
| 667 |
+
$.ajax( {
|
| 668 |
+
url: ajaxurl,
|
| 669 |
+
data: data,
|
| 670 |
+
dataType: 'json',
|
| 671 |
+
type: 'post',
|
| 672 |
+
error: function( a, b, c ) {
|
| 673 |
+
TG.hide_loading();
|
| 674 |
+
alert( 'error adding images' );
|
| 675 |
+
},
|
| 676 |
+
success: function( r ) {
|
| 677 |
+
if ( r.success ) {
|
| 678 |
+
TG.hide_loading();
|
| 679 |
+
TG.load_images();
|
| 680 |
+
}
|
| 681 |
+
}
|
| 682 |
+
} );
|
| 683 |
+
} );
|
| 684 |
|
| 685 |
+
tgm_media_frame.open();
|
| 686 |
+
} );
|
| 687 |
+
}
|
| 688 |
+
};
|
| 689 |
+
}( jQuery );
|
| 690 |
+
|
| 691 |
+
var NewGalleryWizard = function( $ ) {
|
| 692 |
+
|
| 693 |
+
var _curPage = 1;
|
| 694 |
+
var $_wizard = null;
|
| 695 |
+
var _lock = false;
|
| 696 |
+
|
| 697 |
+
return {
|
| 698 |
+
init: function() {
|
| 699 |
+
$_wizard = $( '#modula-wizard' );
|
| 700 |
+
// $_wizard.find('select').material_select();
|
| 701 |
+
|
| 702 |
+
/*! Wizard next */
|
| 703 |
+
$_wizard.find( '.next' ).click( function() {
|
| 704 |
+
if ( $( this ).hasClass( 'disabled' ) )
|
| 705 |
+
return;
|
| 706 |
+
|
| 707 |
+
// var branch = $("[name=ftg_source]:checked").val();
|
| 708 |
+
$( '.invalid' ).removeClass( 'invalid' );
|
| 709 |
+
|
| 710 |
+
if ( _curPage == 1 ) {
|
| 711 |
+
var name = $.trim( $( '[name=tg_name]' ).val() );
|
| 712 |
+
if ( name.length == 0 ) {
|
| 713 |
+
$( '[name=tg_name]' ).addClass( 'invalid' );
|
| 714 |
+
return false;
|
| 715 |
+
}
|
| 716 |
+
}
|
| 717 |
|
| 718 |
+
/*! Wizard save */
|
| 719 |
+
if ( $_wizard.find( 'fieldset[data-step=' + _curPage + ']' ).data( 'save' ) ) {
|
| 720 |
+
NewGalleryWizard.save();
|
| 721 |
+
return;
|
| 722 |
+
} else {
|
| 723 |
+
branch = 'images';
|
| 724 |
+
$_wizard.find( 'fieldset' ).hide();
|
| 725 |
+
_curPage ++;
|
| 726 |
+
|
| 727 |
+
var $fs = $_wizard.find( 'fieldset[data-step=' + _curPage + ']' );
|
| 728 |
+
/*if (_curPage == 3) {
|
| 729 |
+
$fs = $fs.filter("[data-branch=" + branch + "]");
|
| 730 |
+
}*/
|
| 731 |
+
$fs.show();
|
| 732 |
+
|
| 733 |
+
if ( $fs.data( 'save' ) ) {
|
| 734 |
+
$( '.prev' ).css( 'visibility', 'visible' );
|
| 735 |
+
$( this ).text( 'Save' );
|
| 736 |
+
if ( branch == 'images' ) {
|
| 737 |
+
$( '.select-images' ).show();
|
| 738 |
+
$( '[name=post_categories]' ).val( '' );
|
| 739 |
+
$( '[name=woo_categories]' ).val( '' );
|
| 740 |
+
$( '[name=post_tags]' ).val( '' );
|
| 741 |
+
} else if ( branch == 'posts' ) {
|
| 742 |
+
$( '.select-images' ).hide();
|
| 743 |
+
$( '[name=enc_images]' ).val( '' );
|
| 744 |
+
|
| 745 |
+
var categories = [];
|
| 746 |
+
$( '[name=_post_categories]:checked' ).each( function() {
|
| 747 |
+
categories.push( this.value );
|
| 748 |
+
} );
|
| 749 |
+
$( '[name=post_categories]' ).val( categories.join( ',' ) );
|
| 750 |
+
|
| 751 |
+
var tags = [];
|
| 752 |
+
$( '[name=_post_tags]:checked' ).each( function() {
|
| 753 |
+
tags.push( this.value );
|
| 754 |
+
} );
|
| 755 |
+
$( '[name=post_tags]' ).val( tags.join( ',' ) );
|
| 756 |
+
} else {
|
| 757 |
+
$( '.select-images' ).hide();
|
| 758 |
+
$( '[name=enc_images]' ).val( '' );
|
| 759 |
+
|
| 760 |
+
var categories = [];
|
| 761 |
+
$( '[name=_woo_categories]:checked' ).each( function() {
|
| 762 |
+
categories.push( this.value );
|
| 763 |
+
} );
|
| 764 |
+
$( '[name=woo_categories]' ).val( categories.join( ',' ) );
|
| 765 |
+
}
|
| 766 |
+
} else {
|
| 767 |
+
$( this ).text( 'Next' );
|
| 768 |
+
}
|
| 769 |
+
}
|
| 770 |
|
| 771 |
+
$_wizard.find( '.prev' ).css( {
|
| 772 |
+
visibility: 'visible'
|
| 773 |
+
} );
|
| 774 |
+
} );
|
| 775 |
+
|
| 776 |
+
/*! Wizard prev */
|
| 777 |
+
$_wizard.find( '.prev' ).click( function() {
|
| 778 |
+
if ( $( this ).hasClass( 'disabled' ) )
|
| 779 |
+
return;
|
| 780 |
+
_curPage --;
|
| 781 |
+
|
| 782 |
+
var branch = $( '[name=ftg_source]:checked' ).val();
|
| 783 |
+
|
| 784 |
+
if ( _curPage == 1 ) {
|
| 785 |
+
$( this ).css( {
|
| 786 |
+
visibility: 'hidden'
|
| 787 |
+
} );
|
| 788 |
+
}
|
| 789 |
+
|
| 790 |
+
$_wizard.find( 'fieldset' ).hide();
|
| 791 |
+
var $fs = $_wizard.find( 'fieldset[data-step=' + _curPage + ']' );
|
| 792 |
+
if ( _curPage == 3 ) {
|
| 793 |
+
$fs = $fs.filter( '[data-branch=' + branch + ']' );
|
| 794 |
+
}
|
| 795 |
+
$fs.show();
|
| 796 |
+
$_wizard.find( '.next' ).css( {
|
| 797 |
+
visibility: 'visible'
|
| 798 |
+
} ).text( 'Next' );
|
| 799 |
+
} );
|
| 800 |
+
|
| 801 |
+
/*! Wizard add images */
|
| 802 |
+
$_wizard.find( '.add-images' ).click( function( e ) {
|
| 803 |
+
e.preventDefault();
|
| 804 |
+
var size = $_wizard.find( '[name=def_imgsize]' ).val();
|
| 805 |
+
var title_field = $( '[name=ftg_wp_field_title]' ).val();
|
| 806 |
+
var caption_field = $( '[name=ftg_wp_field_caption]' ).val();
|
| 807 |
+
TG.choose_images( title_field, caption_field, function( images ) {
|
| 808 |
+
var delta = Math.pow( 2, 4 ) + Math.pow( 2, 2 );
|
| 809 |
+
var prev = [];
|
| 810 |
+
if ( $( '[name=enc_images]' ).val() )
|
| 811 |
+
JSON.parse( $( '[name=enc_images]' ).val() );
|
| 812 |
+
var curr = prev.concat( images ).slice( 0, delta );
|
| 813 |
+
|
| 814 |
+
$( '[name=enc_images]' ).val( JSON.stringify( curr ) );
|
| 815 |
+
$_wizard.find( '.images' ).empty();
|
| 816 |
+
$.each( curr, function() {
|
| 817 |
+
|
| 818 |
+
var $_tile = $( '<div class=\'tile list-group-item\' />' );
|
| 819 |
+
$_tile.data( 'img', this );
|
| 820 |
+
$_tile.append( '<a class=\'btn-floating waves-effect waves-light red del\'><i class=\'mdi-content-clear\'></i></a>' );
|
| 821 |
+
$_tile.append( '<img src="' + this.thumbnail + '" />' );
|
| 822 |
+
|
| 823 |
+
$_wizard.find( '.images' ).append( $_tile );
|
| 824 |
+
|
| 825 |
+
$_tile.find( '.del' ).click( function() {
|
| 826 |
+
$( this ).parents( '.tile' ).fadeOut( 200, function() {
|
| 827 |
+
$( this ).remove();
|
| 828 |
+
} );
|
| 829 |
+
} );
|
| 830 |
+
} );
|
| 831 |
+
|
| 832 |
+
} );
|
| 833 |
+
$_wizard.find( '.images' ).sortable( {
|
| 834 |
+
update: function() {
|
| 835 |
+
var images = [];
|
| 836 |
+
$_wizard.find( '.images .tile' ).each( function() {
|
| 837 |
+
images.push( $( this ).data( 'img' ) );
|
| 838 |
+
} );
|
| 839 |
+
$( '[name=enc_images]' ).val( JSON.stringify( images ) );
|
| 840 |
+
}
|
| 841 |
+
} );
|
| 842 |
+
} );
|
| 843 |
+
},
|
| 844 |
+
save: function() {
|
| 845 |
+
|
| 846 |
+
var name = $( '#name' ).val();
|
| 847 |
+
var description = $( '#description' ).val();
|
| 848 |
+
var images = $( '[name=enc_images]' ).val();
|
| 849 |
+
var width = $( '#width' ).val();
|
| 850 |
+
var height = $( '#height' ).val();
|
| 851 |
+
var img_size = $( '#img_size' ).val();
|
| 852 |
+
|
| 853 |
+
var data = {
|
| 854 |
+
action: 'modula_create_gallery',
|
| 855 |
+
name: name,
|
| 856 |
+
description: description,
|
| 857 |
+
images: images,
|
| 858 |
+
width: width,
|
| 859 |
+
height: height,
|
| 860 |
+
img_size: img_size,
|
| 861 |
+
Modula: $( '#Modula' ).val()
|
| 862 |
+
};
|
| 863 |
+
|
| 864 |
+
$_wizard.find( 'footer a' ).addClass( 'disabled' );
|
| 865 |
+
$_wizard.find( '.loading' ).show();
|
| 866 |
+
|
| 867 |
+
$.ajax( {
|
| 868 |
+
url: ajaxurl,
|
| 869 |
+
data: data,
|
| 870 |
+
dataType: 'json',
|
| 871 |
+
type: 'post',
|
| 872 |
+
error: function( a, b, c ) {
|
| 873 |
+
$( '#error' ).modal();
|
| 874 |
+
$( '#error' ).modal( 'open' );
|
| 875 |
},
|
| 876 |
+
success: function( id ) {
|
| 877 |
+
id = $.trim( id );
|
| 878 |
+
$( '#name' ).val( '' );
|
| 879 |
+
$( '#description' ).val( '' );
|
| 880 |
+
|
| 881 |
+
$_success = $( '#success' );
|
| 882 |
+
$_success.find( '.code' ).val( '[Modula id=\'' + id + '\']' );
|
| 883 |
+
$_success.find( '.gallery-name' ).text( name );
|
| 884 |
+
$_success.find( '.customize' ).attr( 'href', '?page=modula-lite-edit&galleryId=' + id );
|
| 885 |
+
|
| 886 |
+
$_success.modal();
|
| 887 |
+
$_success.modal( 'open' );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 888 |
}
|
| 889 |
+
} );
|
| 890 |
}
|
| 891 |
+
};
|
| 892 |
+
}( jQuery );
|
| 893 |
+
var ImportWizard = function( $ ) {
|
| 894 |
+
|
| 895 |
+
var _curPage = 1;
|
| 896 |
+
var $_wizard = null;
|
| 897 |
+
var _lock = false;
|
| 898 |
+
|
| 899 |
+
return {
|
| 900 |
+
init: function() {
|
| 901 |
+
$_wizard = $( '#modula-wizard' );
|
| 902 |
+
$( '#external-galleries .js-select-all' ).on( 'click', function() {
|
| 903 |
+
$( '#external-galleries .js-item' ).each( function() {
|
| 904 |
+
this.checked = true;
|
| 905 |
+
} );
|
| 906 |
+
} );
|
| 907 |
+
// $_wizard.find('select').material_select();
|
| 908 |
+
|
| 909 |
+
/*! Wizard next */
|
| 910 |
+
$_wizard.find( '.next' ).click( function() {
|
| 911 |
+
if ( $( this ).hasClass( 'disabled' ) )
|
| 912 |
+
return;
|
| 913 |
+
|
| 914 |
+
// var branch = $("[name=ftg_source]:checked").val();
|
| 915 |
+
$( '.invalid' ).removeClass( 'invalid' );
|
| 916 |
+
|
| 917 |
+
if ( _curPage == 1 ) {
|
| 918 |
+
var source = $( '.import-source' ).val();
|
| 919 |
+
if ( 'undefined' === typeof source ) {
|
| 920 |
+
$( '.import-source' ).addClass( 'invalid' );
|
| 921 |
+
return false;
|
| 922 |
+
}
|
| 923 |
+
}
|
| 924 |
|
| 925 |
+
if ( _curPage == 2 ) {
|
| 926 |
+
var count = $( '#external-galleries .js-item:checked' ).length;
|
| 927 |
+
if ( count == 0 )
|
| 928 |
+
return false;
|
| 929 |
|
| 930 |
+
$_wizard.find( '.galleries-count' ).text( count );
|
| 931 |
+
}
|
| 932 |
|
| 933 |
+
/*! Wizard save */
|
| 934 |
+
if ( $_wizard.find( 'fieldset[data-step=' + _curPage + ']' ).data( 'save' ) ) {
|
| 935 |
+
ImportWizard.import();
|
| 936 |
+
return;
|
| 937 |
+
} else {
|
| 938 |
+
branch = 'images';
|
| 939 |
+
$_wizard.find( 'fieldset' ).hide();
|
| 940 |
+
_curPage ++;
|
| 941 |
+
|
| 942 |
+
var $fs = $_wizard.find( 'fieldset[data-step=' + _curPage + ']' );
|
| 943 |
+
$fs.show();
|
| 944 |
+
|
| 945 |
+
if ( $fs.data( 'save' ) ) {
|
| 946 |
+
$( '.prev' ).css( 'visibility', 'visible' );
|
| 947 |
+
$( this ).text( 'Proceed' );
|
| 948 |
+
|
| 949 |
+
} else {
|
| 950 |
+
$( this ).text( 'Next' );
|
| 951 |
+
}
|
| 952 |
+
}
|
| 953 |
|
| 954 |
+
$_wizard.find( '.prev' ).css( {
|
| 955 |
+
visibility: 'visible'
|
| 956 |
+
} );
|
| 957 |
+
} );
|
| 958 |
|
| 959 |
+
/*! Wizard prev */
|
| 960 |
+
$_wizard.find( '.prev' ).click( function() {
|
| 961 |
+
if ( $( this ).hasClass( 'disabled' ) )
|
| 962 |
+
return;
|
| 963 |
+
_curPage --;
|
| 964 |
|
| 965 |
+
var branch = $( '[name=ftg_source]:checked' ).val();
|
| 966 |
|
| 967 |
+
if ( _curPage == 1 ) {
|
| 968 |
+
$( this ).css( {
|
| 969 |
+
visibility: 'hidden'
|
| 970 |
+
} );
|
| 971 |
+
}
|
| 972 |
|
| 973 |
+
$_wizard.find( 'fieldset' ).hide();
|
| 974 |
+
var $fs = $_wizard.find( 'fieldset[data-step=' + _curPage + ']' );
|
| 975 |
+
if ( _curPage == 3 ) {
|
| 976 |
+
$fs = $fs.filter( '[data-branch=' + branch + ']' );
|
| 977 |
+
}
|
| 978 |
+
$fs.show();
|
| 979 |
+
$_wizard.find( '.next' ).css( {
|
| 980 |
+
visibility: 'visible'
|
| 981 |
+
} ).text( 'Next' );
|
| 982 |
+
} );
|
| 983 |
+
},
|
| 984 |
+
import: function() {
|
| 985 |
+
var source = $( '.import-source' ).val();
|
| 986 |
+
var ids = [];
|
| 987 |
+
|
| 988 |
+
$( '#external-galleries .js-item:checked' ).each( function( i, e ) {
|
| 989 |
+
ids.push( $( e ).val() );
|
| 990 |
+
} );
|
| 991 |
+
|
| 992 |
+
var data = {
|
| 993 |
+
action: 'modula_do_import_galleries',
|
| 994 |
+
source: source,
|
| 995 |
+
ids: ids.join( ',' ),
|
| 996 |
+
Modula: $( '#Modula' ).val()
|
| 997 |
+
};
|
| 998 |
+
|
| 999 |
+
$_wizard.find( 'footer a' ).addClass( 'disabled' );
|
| 1000 |
+
$_wizard.find( '.loading' ).show();
|
| 1001 |
+
|
| 1002 |
+
$.ajax( {
|
| 1003 |
+
url: ajaxurl,
|
| 1004 |
+
data: data,
|
| 1005 |
+
dataType: 'json',
|
| 1006 |
+
type: 'post',
|
| 1007 |
+
error: function( a, b, c ) {
|
| 1008 |
+
$( '#error' ).modal();
|
| 1009 |
+
$( '#error' ).modal( 'open' );
|
| 1010 |
},
|
| 1011 |
+
success: function( r ) {
|
| 1012 |
+
if ( r.success ) {
|
| 1013 |
+
$( '#success' ).modal();
|
| 1014 |
+
$( '#success' ).modal( 'open' );
|
| 1015 |
+
} else {
|
| 1016 |
+
$( '#error' ).modal();
|
| 1017 |
+
$( '#error' ).modal( 'open' );
|
| 1018 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1019 |
}
|
| 1020 |
+
} );
|
| 1021 |
}
|
| 1022 |
+
};
|
| 1023 |
+
}( jQuery );
|
| 1024 |
+
jQuery( function() {
|
| 1025 |
+
jQuery( '.pickColor' ).wpColorPicker( {
|
| 1026 |
+
change: function( event, ui ) {},
|
| 1027 |
+
clear: function() {},
|
| 1028 |
+
hide: true,
|
| 1029 |
+
palettes: true
|
| 1030 |
+
} );
|
| 1031 |
+
|
| 1032 |
+
TG.bind();
|
| 1033 |
+
NewGalleryWizard.init();
|
| 1034 |
+
ImportWizard.init();
|
| 1035 |
+
|
| 1036 |
+
jQuery( 'a[href$=modula-gallery-upgrade]' ).addClass( 'modula-jump-pro-menu' ).click( function( e ) {
|
| 1037 |
+
e.preventDefault();
|
| 1038 |
+
|
| 1039 |
+
location.href = 'http://modula.greentreelabs.net/#buy';
|
| 1040 |
+
} );
|
| 1041 |
+
} );
|
admin/upgrade.php
CHANGED
|
@@ -1,4 +1,30 @@
|
|
| 1 |
-
|
| 2 |
-
|
| 3 |
-
|
| 4 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
$active_tab = isset( $_GET['tab'] ) ? $_GET['tab'] : 'getting_started';
|
| 3 |
+
wp_enqueue_style( 'welcome', plugin_dir_url( __FILE__ ) . 'welcome-screen/assets/welcome.css' );
|
| 4 |
+
?>
|
| 5 |
+
|
| 6 |
+
<div class="wrap about-wrap modula-wrap">
|
| 7 |
+
<h1><?php echo esc_html__( 'Modula - Why you should be upgrading', 'modula-gallery' ); ?></h1>
|
| 8 |
+
|
| 9 |
+
<p class="about-text">
|
| 10 |
+
<?php echo esc_html__( 'Introducing one of the most powerful gallery system ever made for WordPress. Modula is an exquisite WordPress Gallery Plugin perfectly fit for any needs. We\'ve outlined below the PRO features.', 'modula-gallery' ) ?>
|
| 11 |
+
</p>
|
| 12 |
+
<div class="wp-badge"></div>
|
| 13 |
+
|
| 14 |
+
<h2 class="nav-tab-wrapper wp-clearfix">
|
| 15 |
+
<a href="<?php echo esc_url( admin_url( 'admin.php?page=modula-lite-gallery-upgrade&tab=getting_started' ) ); ?>" class="nav-tab <?php echo $active_tab == 'getting_started' ? 'nav-tab-active' : ''; ?>"><?php _e( 'What’s included with PRO' ); ?></a>
|
| 16 |
+
<a href="<?php echo esc_url( admin_url( 'admin.php?page=modula-lite-gallery-upgrade&tab=comparison_table' ) ); ?>" class="nav-tab <?php echo $active_tab == 'comparison_table' ? 'nav-tab-active' : ''; ?>"><?php _e( 'Comparison Table: Lite vs PRO' ); ?></a>
|
| 17 |
+
</h2>
|
| 18 |
+
|
| 19 |
+
<?php
|
| 20 |
+
switch ( $active_tab ) {
|
| 21 |
+
case 'getting_started':
|
| 22 |
+
require_once plugin_dir_path( __FILE__ ) . 'welcome-screen/sections/getting-started.php';
|
| 23 |
+
break;
|
| 24 |
+
case 'comparison_table':
|
| 25 |
+
require_once plugin_dir_path( __FILE__ ) . 'welcome-screen/sections/comparison-table.php';
|
| 26 |
+
break;
|
| 27 |
+
}
|
| 28 |
+
?>
|
| 29 |
+
|
| 30 |
+
</div> <!--/.about-wrap-->
|
admin/welcome-screen/assets/welcome.css
ADDED
|
@@ -0,0 +1,87 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
.featured-section.features .row {
|
| 2 |
+
display: inline-block;
|
| 3 |
+
width: 97%;
|
| 4 |
+
padding: 15px;
|
| 5 |
+
border-bottom: 1px solid rgba(0, 0, 0, .06);
|
| 6 |
+
}
|
| 7 |
+
|
| 8 |
+
.featured-section.features .row .dashicons-yes {
|
| 9 |
+
color: #2cbe4e;
|
| 10 |
+
}
|
| 11 |
+
|
| 12 |
+
.featured-section.features .row .dashicons-no-alt {
|
| 13 |
+
color: #FF3D2E;
|
| 14 |
+
}
|
| 15 |
+
|
| 16 |
+
.featured-section.features .row > div {
|
| 17 |
+
display: inline-block;
|
| 18 |
+
float: left;
|
| 19 |
+
width: 15%;
|
| 20 |
+
text-align: center;
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
+
.featured-section.features .row > .feature {
|
| 24 |
+
width: 70%;
|
| 25 |
+
text-align: left;
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
.featured-section .free-pro-table {
|
| 29 |
+
border-spacing: 0;
|
| 30 |
+
width: 100%;
|
| 31 |
+
margin-top:40px;
|
| 32 |
+
}
|
| 33 |
+
|
| 34 |
+
.featured-section .free-pro-table th {
|
| 35 |
+
padding-bottom: 20px;
|
| 36 |
+
text-align: center;
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
+
.featured-section .free-pro-table td {
|
| 40 |
+
border-top: 1px solid #ccc;
|
| 41 |
+
padding: 20px 0 25px;
|
| 42 |
+
}
|
| 43 |
+
|
| 44 |
+
.featured-section .free-pro-table h3 {
|
| 45 |
+
margin: 0;
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
.featured-section .free-pro-table td p {
|
| 49 |
+
margin: 0;
|
| 50 |
+
}
|
| 51 |
+
|
| 52 |
+
.featured-section .free-pro-table .modula-feature,
|
| 53 |
+
.featured-section .free-pro-table .modula-pro-feature{
|
| 54 |
+
text-align: center;
|
| 55 |
+
width: 15%;
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
+
.featured-section .free-pro-table .dashicons-yes {
|
| 59 |
+
color: #00A878;
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
.featured-section .free-pro-table .dashicons-no-alt {
|
| 63 |
+
color: #ff3439;
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
.featured-section .free-pro-table .dashicons-before:before,
|
| 67 |
+
.featured-section .free-pro-table .dashicons-before:before {
|
| 68 |
+
font-size: 35px;
|
| 69 |
+
height: 35px;
|
| 70 |
+
width: 35px;
|
| 71 |
+
}
|
| 72 |
+
.modula-wrap .button-hero .dashicons{
|
| 73 |
+
font-size:16px;
|
| 74 |
+
vertical-align:middle;
|
| 75 |
+
}
|
| 76 |
+
|
| 77 |
+
.text-right {
|
| 78 |
+
text-align: right;
|
| 79 |
+
}
|
| 80 |
+
|
| 81 |
+
.text-left {
|
| 82 |
+
text-align: left;
|
| 83 |
+
}
|
| 84 |
+
|
| 85 |
+
.text-center {
|
| 86 |
+
text-align: center;
|
| 87 |
+
}
|
admin/welcome-screen/sections/comparison-table.php
ADDED
|
@@ -0,0 +1,91 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if ( ! defined( 'WPINC' ) ) {
|
| 3 |
+
die;
|
| 4 |
+
}
|
| 5 |
+
/**
|
| 6 |
+
* Features
|
| 7 |
+
*/
|
| 8 |
+
|
| 9 |
+
$features = array(
|
| 10 |
+
'post-formats' => array(
|
| 11 |
+
'label' => 'Images per gallery',
|
| 12 |
+
'modula' => '20',
|
| 13 |
+
'modula-pro' => 'Unlimited',
|
| 14 |
+
),
|
| 15 |
+
'slider-layouts' => array(
|
| 16 |
+
'label' => 'Filters',
|
| 17 |
+
'modula' => '<span class="dashicons dashicons-no-alt"></span>',
|
| 18 |
+
'modula-pro' => '<span class="dashicons dashicons-yes"></span>',
|
| 19 |
+
),
|
| 20 |
+
'news-ticker' => array(
|
| 21 |
+
'label' => 'Reload page on filter click',
|
| 22 |
+
'modula' => '<span class="dashicons dashicons-no-alt"></span>',
|
| 23 |
+
'modula-pro' => '<span class="dashicons dashicons-yes"></span>',
|
| 24 |
+
),
|
| 25 |
+
'banner-ads' => array(
|
| 26 |
+
'label' => 'Change Filter Text',
|
| 27 |
+
'modula' => '<span class="dashicons dashicons-no-alt"></span>',
|
| 28 |
+
'modula-pro' => '<span class="dashicons dashicons-yes"></span>',
|
| 29 |
+
),
|
| 30 |
+
'video-widgets' => array(
|
| 31 |
+
'label' => 'Multiple Included LightBox Scripts',
|
| 32 |
+
'modula' => '<span class="dashicons dashicons-no-alt"></span>',
|
| 33 |
+
'modula-pro' => '<span class="dashicons dashicons-yes"></span>',
|
| 34 |
+
),
|
| 35 |
+
'color-schemes' => array(
|
| 36 |
+
'label' => 'Image Loaded Effects',
|
| 37 |
+
'modula' => '<span class="dashicons dashicons-no-alt"></span>',
|
| 38 |
+
'modula-pro' => '<span class="dashicons dashicons-yes"></span>',
|
| 39 |
+
),
|
| 40 |
+
'typography' => array(
|
| 41 |
+
'label' => 'Image Hoever Effects',
|
| 42 |
+
'modula' => '<span class="dashicons dashicons-no-alt"></span>',
|
| 43 |
+
'modula-pro' => '<span class="dashicons dashicons-yes"></span>',
|
| 44 |
+
),
|
| 45 |
+
'updates' => array(
|
| 46 |
+
'label' => 'Feature & Security Updates',
|
| 47 |
+
'modula' => '<span class="dashicons dashicons-no-alt"></span>',
|
| 48 |
+
'modula-pro' => '<span class="dashicons dashicons-yes"></span>',
|
| 49 |
+
),
|
| 50 |
+
'suppoprt' => array(
|
| 51 |
+
'label' => 'Priority Support',
|
| 52 |
+
'modula' => '<span class="dashicons dashicons-no-alt"></span>',
|
| 53 |
+
'modula-pro' => '<span class="dashicons dashicons-yes"></span>',
|
| 54 |
+
),
|
| 55 |
+
);
|
| 56 |
+
?>
|
| 57 |
+
<div class="featured-section features">
|
| 58 |
+
<table class="free-pro-table">
|
| 59 |
+
<thead>
|
| 60 |
+
<tr>
|
| 61 |
+
<th></th>
|
| 62 |
+
<th>LITE</th>
|
| 63 |
+
<th>PRO</th>
|
| 64 |
+
</tr>
|
| 65 |
+
</thead>
|
| 66 |
+
<tbody>
|
| 67 |
+
<?php foreach ( $features as $feature ): ?>
|
| 68 |
+
<tr>
|
| 69 |
+
<td class="feature">
|
| 70 |
+
<h3>
|
| 71 |
+
<?php echo $feature['label']; ?>
|
| 72 |
+
</h3>
|
| 73 |
+
</td>
|
| 74 |
+
<td class="modula-feature">
|
| 75 |
+
<?php echo $feature['modula']; ?>
|
| 76 |
+
</td>
|
| 77 |
+
<td class="modula-pro-feature">
|
| 78 |
+
<?php echo $feature['modula-pro']; ?>
|
| 79 |
+
</td>
|
| 80 |
+
</tr>
|
| 81 |
+
<?php endforeach; ?>
|
| 82 |
+
<tr>
|
| 83 |
+
<td></td>
|
| 84 |
+
<td colspan="2" class="text-right">
|
| 85 |
+
<a href="https://www.wp-modula.com/?utm_source=worg&utm_medium=about-page&utm_campaign=upsell" target="_blank"
|
| 86 |
+
class="button button-primary button-hero"><span class="dashicons dashicons-cart"></span> Get Modula Pro!</a>
|
| 87 |
+
</td>
|
| 88 |
+
</tr>
|
| 89 |
+
</tbody>
|
| 90 |
+
</table>
|
| 91 |
+
</div>
|
admin/welcome-screen/sections/getting-started.php
ADDED
|
@@ -0,0 +1,133 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<div class="feature-section one-col">
|
| 2 |
+
<div class="col">
|
| 3 |
+
<h2 style="font-size: 2.5em;"><?php echo __( 'Powerful, Yet Simple, Image Gallery Plugin', 'modula-gallery' ); ?></h2>
|
| 4 |
+
<p class="lead-description"><?php echo __( 'Modula helps <u>casual users</u> create an image gallery in 30s or less.', 'modula-gallery' ); ?></p>
|
| 5 |
+
<p><?php echo __( 'Modula is a WordPress photo and image gallery plugin that makes it easy for users of all levels to build beautiful grid galleries. Modula’s <u>unique grid system</u> ensures your gallery avoids the boring square look found in many other plugins. Just give Modula a size and a list of images and it does all the work for you. If you’re a casual WordPress user, you can create a stylish gallery in seconds without digging into detailed settings pages. ', 'modula-gallery' ); ?></p>
|
| 6 |
+
<div class="center">
|
| 7 |
+
<a href="https://www.wp-modula.com/?utm_source=worg&utm_medium=about-page&utm_campaign=upsell" target="_blank" class="button button-primary button-hero"><span class="dashicons dashicons-cart"></span>
|
| 8 |
+
<?php echo __( 'Get Modula Pro', 'modula-gallery' ); ?>
|
| 9 |
+
</a>
|
| 10 |
+
</div>
|
| 11 |
+
</div>
|
| 12 |
+
</div>
|
| 13 |
+
|
| 14 |
+
<hr/>
|
| 15 |
+
|
| 16 |
+
<h2><?php _e( 'Modula\'s Main Features' ); ?></h2>
|
| 17 |
+
|
| 18 |
+
<div class="feature-section three-col">
|
| 19 |
+
<div class="col">
|
| 20 |
+
<h3><?php echo __( 'Stylish & Complex Layouts', 'modula-gallery' ); ?></h3>
|
| 21 |
+
<p><?php echo __( 'Stylish grids that go beyond the boring squares. With Modula, creating a stylish and good looking image gallery this is no longer the case. ', 'modula-gallery' ); ?></p>
|
| 22 |
+
</div>
|
| 23 |
+
|
| 24 |
+
<div class="col">
|
| 25 |
+
<h3><?php echo __( 'Gallery Filters', 'modula-gallery' ); ?></h3>
|
| 26 |
+
<p><?php echo __( 'Let visitors filter your gallery items with a single click. Create as many gallery filters as you want. These filters also <u>work in real-time</u> ⭐', 'modula-gallery' ); ?></p>
|
| 27 |
+
</div>
|
| 28 |
+
<div class="col">
|
| 29 |
+
<h3><?php echo __( 'Multiple Gallery Support', 'modula-gallery' ); ?></h3>
|
| 30 |
+
<p><?php echo __( 'Modula allows you to add as many galleries as you want to the same page. Modula is very versatile & flexible. You should take it our for a spin. ', 'modula-gallery' ); ?></p>
|
| 31 |
+
</div>
|
| 32 |
+
|
| 33 |
+
<div class="col">
|
| 34 |
+
<h3><?php echo __( 'Widget Support', 'modula-gallery' ); ?></h3>
|
| 35 |
+
<p><?php echo __( 'Display your galleries inside WordPress widgets. This makes Modula really powerful. Display your image galleries where your heart desires.', 'modula-gallery' ); ?></p>
|
| 36 |
+
</div>
|
| 37 |
+
|
| 38 |
+
<div class="col">
|
| 39 |
+
<h3><?php echo __( 'Responsive & Retina-ready', 'modula-gallery' ); ?></h3>
|
| 40 |
+
<p><?php echo __( 'Every gallery created with Modula is responsive, mobile ready & retina ready. <b>Your galleries will look beautiful on any device</b>, and any display.', 'modula-gallery' ); ?></p>
|
| 41 |
+
</div>
|
| 42 |
+
|
| 43 |
+
<div class="col">
|
| 44 |
+
<h3><?php echo __( 'Custom Caption Support', 'modula-gallery' ); ?></h3>
|
| 45 |
+
<p><?php echo __( 'This feature deserves a parade down the center of town! Spruce up your image galleries with custom captions, animations & colors.', 'modula-gallery' ); ?></p>
|
| 46 |
+
</div>
|
| 47 |
+
</div>
|
| 48 |
+
|
| 49 |
+
<div class="center">
|
| 50 |
+
<a href="https://www.wp-modula.com/?utm_source=worg&utm_medium=about-page&utm_campaign=upsell" target="_blank" class="button button-primary button-hero"><span class="dashicons dashicons-cart"></span>
|
| 51 |
+
<?php echo __( 'Get Modula Pro!', 'modula-gallery' ); ?></a>
|
| 52 |
+
</div>
|
| 53 |
+
|
| 54 |
+
<br/>
|
| 55 |
+
<hr/>
|
| 56 |
+
|
| 57 |
+
<div class="feature-section three-col">
|
| 58 |
+
|
| 59 |
+
<div class="col">
|
| 60 |
+
<h3><?php echo __( 'Multiple LightBox Support', 'modula-gallery' ); ?></h3>
|
| 61 |
+
<p><?php echo __( 'Modula <b>supports 6 different lightbox scripts</b>: <em>Lightgallery, Lightbox2, PrettyPhoto, Magnific Gallery, SwipeBox and FancyBox</em>. Showcase your image galleries with style.', 'modula-gallery' ); ?></p>
|
| 62 |
+
</div>
|
| 63 |
+
|
| 64 |
+
<div class="col">
|
| 65 |
+
<h3><?php echo __( 'Social Sharing Friendly', 'modula-gallery' ); ?></h3>
|
| 66 |
+
<p><?php echo __( 'Built-in social sharing buttons that will help you boost your page views. <b>Reach your audience faster and easier</b> with social tools built-in.', 'modula-gallery' ); ?></p>
|
| 67 |
+
</div>
|
| 68 |
+
|
| 69 |
+
<div class="col">
|
| 70 |
+
<h3><?php echo __( 'Multiple Image Hover Effects', 'modula-gallery' ); ?></h3>
|
| 71 |
+
<p><?php echo __( 'Choose from 12 different hover effects. Pick the ones that best represent your personality. Easily <u>showcase your images in style</u>.', 'modula-gallery' ); ?></p>
|
| 72 |
+
</div>
|
| 73 |
+
|
| 74 |
+
<div class="col">
|
| 75 |
+
<h3><?php echo __( 'Make It Your Own', 'modula-gallery' ); ?></h3>
|
| 76 |
+
<p><?php echo __( 'Build your own effects for even more control. Complex, built-in, styles will help you personalize Modula to your own liking.', 'modula-gallery' ); ?></p>
|
| 77 |
+
</div>
|
| 78 |
+
|
| 79 |
+
<div class="col">
|
| 80 |
+
<h3><?php echo __( 'Security Updates', 'modula-gallery' ); ?></h3>
|
| 81 |
+
<p><?php echo __( 'Modula is constantly evolving. New features & security updates are first released for PRO users.', 'modula-gallery' ); ?></p>
|
| 82 |
+
</div>
|
| 83 |
+
|
| 84 |
+
<div class="col">
|
| 85 |
+
<h3><?php echo __( 'Premium & Priority Support', 'modula-gallery' ); ?></h3>
|
| 86 |
+
<p><?php echo __( 'If you need help just post a ticket and our tech guys will get back to you asap. We have a stellar support team ready to help you in no time.', 'modula-gallery' ); ?></p>
|
| 87 |
+
</div>
|
| 88 |
+
|
| 89 |
+
</div>
|
| 90 |
+
|
| 91 |
+
<hr/>
|
| 92 |
+
|
| 93 |
+
<div class="feature-section two-col">
|
| 94 |
+
<div class="col">
|
| 95 |
+
<h3><?php echo __( 'Built on Material Design', 'modula-gallery' ); ?></h3>
|
| 96 |
+
<p><?php echo __( 'Modula is built entirely on Material Design principles. Starting with the code layout and finishing up with the smallest animation, Modula screams Material Design from it\'s every pore. <br \/><br \/> Based on the most popular front-end design framework of the century, we\'ve striven to create a modern, flexible and beautiful implementation of Material Design in Modula. <br \/><br \/> We believe you\'ll <b>enjoy it</b>!', 'modula-gallery' ); ?></p>
|
| 97 |
+
</div>
|
| 98 |
+
<div class="col">
|
| 99 |
+
<img src="<?php echo esc_url( MODULA_PLUGIN_DIR_URL ); ?>admin/images/material-design.gif" alt="Material Design GIF">
|
| 100 |
+
</div>
|
| 101 |
+
</div>
|
| 102 |
+
|
| 103 |
+
<hr/>
|
| 104 |
+
|
| 105 |
+
<hr/>
|
| 106 |
+
|
| 107 |
+
<div class="changelog">
|
| 108 |
+
<h2><?php
|
| 109 |
+
printf( /* translators: %s: smiling face with smiling eyes emoji */
|
| 110 |
+
__( 'Even More Plugin Flexibility %s', 'modula-gallery' ), '😊' );
|
| 111 |
+
?></h2>
|
| 112 |
+
|
| 113 |
+
<div class="under-the-hood three-col">
|
| 114 |
+
<div class="col">
|
| 115 |
+
<h3><?php echo __( 'Drag & Drop Images', 'modula-gallery' ); ?></h3>
|
| 116 |
+
<p><?php echo __( 'Re-ordering couldn\'t be easier. Just drag & drop your images around until you find the perfect positioning. Be done in 30s or less.', 'modula-gallery' ); ?></p>
|
| 117 |
+
</div>
|
| 118 |
+
<div class="col">
|
| 119 |
+
<h3><?php echo __( 'Custom Scripts & CSS Support', 'modula-gallery' ); ?></h3></h3>
|
| 120 |
+
<p><?php echo __( 'Modula comes with built-in custom CSS support. Want to style one of your galleries in a particular way? Add some CSS. Want to include a custom tracking script in just one of your galleries? Add away. Simplicity, at it\'s best.', 'modula-gallery' ); ?></p>
|
| 121 |
+
</div>
|
| 122 |
+
<div class="col">
|
| 123 |
+
<h3><?php echo __( 'Developer Friendly' ); ?></h3>
|
| 124 |
+
<p><?php echo __( 'Modula\'s been built with both the user & the developer in mind. Friendly code, well documented so you can easily add your changes. Filters & Hooks, included with every purchase.', 'modula-gallery' ); ?></p>
|
| 125 |
+
</div>
|
| 126 |
+
|
| 127 |
+
</div>
|
| 128 |
+
</div>
|
| 129 |
+
|
| 130 |
+
<div class="center">
|
| 131 |
+
<a href="https://www.wp-modula.com/?utm_source=worg&utm_medium=about-page&utm_campaign=upsell" target="_blank" class="button button-primary button-hero"><span class="dashicons dashicons-cart"></span>
|
| 132 |
+
<?php echo __( 'Get Modula Pro!', 'modula-gallery' ); ?></a>
|
| 133 |
+
</div><br/>
|
lib/db-class.php
CHANGED
|
@@ -1,168 +1,193 @@
|
|
| 1 |
<?php
|
|
|
|
| 2 |
class ModulaLiteDB {
|
| 3 |
-
|
| 4 |
private static $pInstance;
|
| 5 |
-
|
| 6 |
-
private function __construct() {
|
| 7 |
-
|
|
|
|
| 8 |
public static function getInstance() {
|
| 9 |
-
if(!self::$pInstance) {
|
| 10 |
self::$pInstance = new ModulaLiteDB();
|
| 11 |
}
|
| 12 |
-
|
| 13 |
return self::$pInstance;
|
| 14 |
}
|
| 15 |
-
|
| 16 |
public function query() {
|
| 17 |
-
return "Test";
|
| 18 |
}
|
| 19 |
-
|
| 20 |
-
public function update_config($id, $config)
|
| 21 |
-
{
|
| 22 |
global $wpdb;
|
| 23 |
|
| 24 |
-
unset($config->Id);
|
|
|
|
|
|
|
| 25 |
|
| 26 |
-
$wpdb->update($wpdb->ModulaGalleries, array('configuration' => $config), array('Id' => $id));
|
| 27 |
-
|
| 28 |
}
|
| 29 |
|
| 30 |
-
public function getConfig($id)
|
| 31 |
-
|
| 32 |
-
|
| 33 |
return $data;
|
| 34 |
}
|
| 35 |
-
|
| 36 |
-
public function addGallery($data) {
|
| 37 |
-
global $wpdb;
|
| 38 |
-
|
| 39 |
-
$data=(array)$data;
|
| 40 |
|
| 41 |
-
|
|
|
|
|
|
|
|
|
|
| 42 |
|
| 43 |
-
|
| 44 |
|
| 45 |
-
$
|
| 46 |
-
|
|
|
|
|
|
|
|
|
|
| 47 |
}
|
| 48 |
-
|
| 49 |
public function getNewGalleryId() {
|
| 50 |
global $wpdb;
|
|
|
|
| 51 |
return $wpdb->insert_id;
|
| 52 |
}
|
| 53 |
-
|
| 54 |
-
public function deleteGallery($gid) {
|
| 55 |
global $wpdb;
|
| 56 |
|
| 57 |
-
$wpdb->query($wpdb->prepare("DELETE FROM $wpdb->ModulaImages WHERE gid = %d", $gid));
|
| 58 |
-
$wpdb->query($wpdb->prepare("DELETE FROM $wpdb->ModulaGalleries WHERE Id = %d", $gid));
|
| 59 |
}
|
| 60 |
-
|
| 61 |
-
public function editGallery($gid, $data) {
|
| 62 |
global $wpdb;
|
| 63 |
|
| 64 |
-
$data
|
| 65 |
-
$imageEdited = $wpdb->update( $wpdb->ModulaGalleries, array('configuration' => $data), array( 'Id' => $gid ) );
|
| 66 |
-
print_r($wpdb->last_error);
|
|
|
|
| 67 |
return $imageEdited;
|
| 68 |
}
|
| 69 |
|
| 70 |
-
public function getIDbyGUID( $guid )
|
| 71 |
-
{
|
| 72 |
global $wpdb;
|
|
|
|
| 73 |
return $wpdb->get_var( $wpdb->prepare( "SELECT ID FROM $wpdb->posts WHERE guid=%s", $guid ) );
|
| 74 |
}
|
| 75 |
-
|
| 76 |
-
public function getGalleryById($id, $default=null) {
|
| 77 |
global $wpdb;
|
| 78 |
-
$gallery = $wpdb->get_row($wpdb->prepare("SELECT * FROM $wpdb->ModulaGalleries WHERE Id = %s", $id));
|
| 79 |
-
$data
|
| 80 |
-
if($default)
|
| 81 |
-
foreach ( $default as $k => $v )
|
| 82 |
-
if(! isset($data->$k))
|
| 83 |
$data->$k = $v;
|
|
|
|
|
|
|
|
|
|
| 84 |
|
| 85 |
$data->id = $id;
|
|
|
|
| 86 |
return $data;
|
| 87 |
}
|
| 88 |
-
|
| 89 |
-
public function getLastGalleryId()
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
|
| 93 |
return $galleryResults[0];
|
| 94 |
}
|
|
|
|
| 95 |
public function getGalleries() {
|
| 96 |
global $wpdb;
|
| 97 |
-
$galleryResults = $wpdb->get_results("SELECT * FROM $wpdb->ModulaGalleries");
|
|
|
|
| 98 |
return $galleryResults;
|
| 99 |
}
|
| 100 |
-
|
| 101 |
-
public function addImage($gid, $image) {
|
| 102 |
-
global $wpdb;
|
| 103 |
-
$imageAdded = $wpdb->insert( $wpdb->ModulaImages, array(
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 104 |
return $imageAdded;
|
| 105 |
}
|
| 106 |
|
| 107 |
-
public function addImages($gid, $images) {
|
| 108 |
-
global $wpdb;
|
| 109 |
-
foreach ($images as $image) {
|
| 110 |
-
$imageAdded = $wpdb->insert( $wpdb->ModulaImages,
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 118 |
return true;
|
| 119 |
}
|
| 120 |
-
|
| 121 |
-
public function addFullImage($data) {
|
| 122 |
-
global $wpdb;
|
| 123 |
$imageAdded = $wpdb->insert( $wpdb->ModulaImages, $data );
|
|
|
|
| 124 |
return $imageAdded;
|
| 125 |
}
|
| 126 |
-
|
| 127 |
-
public function deleteImage($id) {
|
| 128 |
global $wpdb;
|
| 129 |
-
if($wpdb->query($wpdb->prepare("DELETE FROM $wpdb->ModulaImages WHERE Id = %d", $id)) ===
|
| 130 |
return false;
|
| 131 |
-
}
|
| 132 |
-
else {
|
| 133 |
return true;
|
| 134 |
}
|
| 135 |
}
|
| 136 |
-
|
| 137 |
-
public function editImage($id, $data) {
|
| 138 |
global $wpdb;
|
| 139 |
$imageEdited = $wpdb->update( $wpdb->ModulaImages, $data, array( 'Id' => $id ) );
|
|
|
|
| 140 |
//print $wpdb->last_query;
|
| 141 |
return $imageEdited;
|
| 142 |
}
|
| 143 |
|
| 144 |
-
public function sortImages($ids) {
|
| 145 |
global $wpdb;
|
| 146 |
$index = 1;
|
| 147 |
-
foreach($ids as $id)
|
| 148 |
-
|
| 149 |
-
$data = array('sortOrder' => $index++);
|
| 150 |
$wpdb->update( $wpdb->ModulaImages, $data, array( 'Id' => $id ) );
|
| 151 |
}
|
|
|
|
| 152 |
return true;
|
| 153 |
}
|
| 154 |
-
|
| 155 |
-
public function getImagesByGalleryId($gid) {
|
| 156 |
global $wpdb;
|
| 157 |
-
$e
|
| 158 |
-
$imageResults = $wpdb->get_results($wpdb->prepare("SELECT * FROM $wpdb->ModulaImages WHERE gid = %d ORDER BY sortOrder ASC LIMIT $e", $gid));
|
|
|
|
| 159 |
return $imageResults;
|
| 160 |
}
|
| 161 |
-
|
| 162 |
-
public function getGalleryByGalleryId($gid) {
|
| 163 |
global $wpdb;
|
| 164 |
-
$gallery = $wpdb->get_results($wpdb->prepare("SELECT $wpdb->ModulaGalleries.*, $wpdb->ModulaImages.* FROM $wpdb->ModulaGalleries INNER JOIN $wpdb->ModulaImages ON ($wpdb->ModulaGalleries.Id = $wpdb->ModulaImages.gid) WHERE $wpdb->ModulaGalleries.Id = %d ORDER BY sortOrder ASC", $gid));
|
|
|
|
| 165 |
return $gallery;
|
| 166 |
}
|
| 167 |
}
|
|
|
|
| 168 |
?>
|
| 1 |
<?php
|
| 2 |
+
|
| 3 |
class ModulaLiteDB {
|
| 4 |
+
|
| 5 |
private static $pInstance;
|
| 6 |
+
|
| 7 |
+
private function __construct() {
|
| 8 |
+
}
|
| 9 |
+
|
| 10 |
public static function getInstance() {
|
| 11 |
+
if ( ! self::$pInstance ) {
|
| 12 |
self::$pInstance = new ModulaLiteDB();
|
| 13 |
}
|
| 14 |
+
|
| 15 |
return self::$pInstance;
|
| 16 |
}
|
| 17 |
+
|
| 18 |
public function query() {
|
| 19 |
+
return "Test";
|
| 20 |
}
|
| 21 |
+
|
| 22 |
+
public function update_config( $id, $config ) {
|
|
|
|
| 23 |
global $wpdb;
|
| 24 |
|
| 25 |
+
unset( $config->Id );
|
| 26 |
+
|
| 27 |
+
$wpdb->update( $wpdb->ModulaGalleries, array( 'configuration' => $config ), array( 'Id' => $id ) );
|
| 28 |
|
|
|
|
|
|
|
| 29 |
}
|
| 30 |
|
| 31 |
+
public function getConfig( $id ) {
|
| 32 |
+
$data = $this->getGalleryById( $id );
|
| 33 |
+
|
| 34 |
return $data;
|
| 35 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 36 |
|
| 37 |
+
public function addGallery( $data ) {
|
| 38 |
+
global $wpdb;
|
| 39 |
+
|
| 40 |
+
$data = (array) $data;
|
| 41 |
|
| 42 |
+
unset( $data['Id'] );
|
| 43 |
|
| 44 |
+
$configuration = array( 'Id' => '', 'configuration' => json_encode( $data ) );
|
| 45 |
+
|
| 46 |
+
$galleryAdded = $wpdb->insert( $wpdb->ModulaGalleries, $configuration );
|
| 47 |
+
|
| 48 |
+
return $galleryAdded;
|
| 49 |
}
|
| 50 |
+
|
| 51 |
public function getNewGalleryId() {
|
| 52 |
global $wpdb;
|
| 53 |
+
|
| 54 |
return $wpdb->insert_id;
|
| 55 |
}
|
| 56 |
+
|
| 57 |
+
public function deleteGallery( $gid ) {
|
| 58 |
global $wpdb;
|
| 59 |
|
| 60 |
+
$wpdb->query( $wpdb->prepare( "DELETE FROM $wpdb->ModulaImages WHERE gid = %d", $gid ) );
|
| 61 |
+
$wpdb->query( $wpdb->prepare( "DELETE FROM $wpdb->ModulaGalleries WHERE Id = %d", $gid ) );
|
| 62 |
}
|
| 63 |
+
|
| 64 |
+
public function editGallery( $gid, $data ) {
|
| 65 |
global $wpdb;
|
| 66 |
|
| 67 |
+
$data = json_encode( $data );
|
| 68 |
+
$imageEdited = $wpdb->update( $wpdb->ModulaGalleries, array( 'configuration' => $data ), array( 'Id' => $gid ) );
|
| 69 |
+
print_r( $wpdb->last_error );
|
| 70 |
+
|
| 71 |
return $imageEdited;
|
| 72 |
}
|
| 73 |
|
| 74 |
+
public function getIDbyGUID( $guid ) {
|
|
|
|
| 75 |
global $wpdb;
|
| 76 |
+
|
| 77 |
return $wpdb->get_var( $wpdb->prepare( "SELECT ID FROM $wpdb->posts WHERE guid=%s", $guid ) );
|
| 78 |
}
|
| 79 |
+
|
| 80 |
+
public function getGalleryById( $id, $default = null ) {
|
| 81 |
global $wpdb;
|
| 82 |
+
$gallery = $wpdb->get_row( $wpdb->prepare( "SELECT * FROM $wpdb->ModulaGalleries WHERE Id = %s", $id ) );
|
| 83 |
+
$data = json_decode( $gallery->configuration );
|
| 84 |
+
if ( $default ) {
|
| 85 |
+
foreach ( $default as $k => $v ) {
|
| 86 |
+
if ( ! isset( $data->$k ) ) {
|
| 87 |
$data->$k = $v;
|
| 88 |
+
}
|
| 89 |
+
}
|
| 90 |
+
}
|
| 91 |
|
| 92 |
$data->id = $id;
|
| 93 |
+
|
| 94 |
return $data;
|
| 95 |
}
|
| 96 |
+
|
| 97 |
+
public function getLastGalleryId() {
|
| 98 |
+
global $wpdb;
|
| 99 |
+
$galleryResults = $wpdb->get_results( "SELECT Id FROM $wpdb->ModulaGalleries ORDER BY Id DESC LIMIT 1" );
|
| 100 |
+
|
| 101 |
return $galleryResults[0];
|
| 102 |
}
|
| 103 |
+
|
| 104 |
public function getGalleries() {
|
| 105 |
global $wpdb;
|
| 106 |
+
$galleryResults = $wpdb->get_results( "SELECT * FROM $wpdb->ModulaGalleries" );
|
| 107 |
+
|
| 108 |
return $galleryResults;
|
| 109 |
}
|
| 110 |
+
|
| 111 |
+
public function addImage( $gid, $image ) {
|
| 112 |
+
global $wpdb;
|
| 113 |
+
$imageAdded = $wpdb->insert( $wpdb->ModulaImages, array(
|
| 114 |
+
'gid' => $gid,
|
| 115 |
+
'imagePath' => $image,
|
| 116 |
+
'title' => "",
|
| 117 |
+
'description' => "",
|
| 118 |
+
'sortOrder' => 0,
|
| 119 |
+
) );
|
| 120 |
+
|
| 121 |
return $imageAdded;
|
| 122 |
}
|
| 123 |
|
| 124 |
+
public function addImages( $gid, $images ) {
|
| 125 |
+
global $wpdb;
|
| 126 |
+
foreach ( $images as $image ) {
|
| 127 |
+
$imageAdded = $wpdb->insert( $wpdb->ModulaImages, array(
|
| 128 |
+
'gid' => $gid,
|
| 129 |
+
'imagePath' => $image->imagePath,
|
| 130 |
+
'description' => isset( $image->description ) ? $image->description : '',
|
| 131 |
+
'title' => isset( $image->title ) ? $image->title : '',
|
| 132 |
+
'imageId' => $image->imageId,
|
| 133 |
+
'sortOrder' => 0,
|
| 134 |
+
) );
|
| 135 |
+
$id = $wpdb->insert_id;
|
| 136 |
+
$wpdb->update( $wpdb->ModulaImages, array( 'sortOrder' => $id ), array( 'Id' => $id ) );
|
| 137 |
+
}
|
| 138 |
+
|
| 139 |
return true;
|
| 140 |
}
|
| 141 |
+
|
| 142 |
+
public function addFullImage( $data ) {
|
| 143 |
+
global $wpdb;
|
| 144 |
$imageAdded = $wpdb->insert( $wpdb->ModulaImages, $data );
|
| 145 |
+
|
| 146 |
return $imageAdded;
|
| 147 |
}
|
| 148 |
+
|
| 149 |
+
public function deleteImage( $id ) {
|
| 150 |
global $wpdb;
|
| 151 |
+
if ( $wpdb->query( $wpdb->prepare( "DELETE FROM $wpdb->ModulaImages WHERE Id = %d", $id ) ) === false ) {
|
| 152 |
return false;
|
| 153 |
+
} else {
|
|
|
|
| 154 |
return true;
|
| 155 |
}
|
| 156 |
}
|
| 157 |
+
|
| 158 |
+
public function editImage( $id, $data ) {
|
| 159 |
global $wpdb;
|
| 160 |
$imageEdited = $wpdb->update( $wpdb->ModulaImages, $data, array( 'Id' => $id ) );
|
| 161 |
+
|
| 162 |
//print $wpdb->last_query;
|
| 163 |
return $imageEdited;
|
| 164 |
}
|
| 165 |
|
| 166 |
+
public function sortImages( $ids ) {
|
| 167 |
global $wpdb;
|
| 168 |
$index = 1;
|
| 169 |
+
foreach ( $ids as $id ) {
|
| 170 |
+
$data = array( 'sortOrder' => $index++ );
|
|
|
|
| 171 |
$wpdb->update( $wpdb->ModulaImages, $data, array( 'Id' => $id ) );
|
| 172 |
}
|
| 173 |
+
|
| 174 |
return true;
|
| 175 |
}
|
| 176 |
+
|
| 177 |
+
public function getImagesByGalleryId( $gid ) {
|
| 178 |
global $wpdb;
|
| 179 |
+
$e = 22 - 1 - 1;
|
| 180 |
+
$imageResults = $wpdb->get_results( $wpdb->prepare( "SELECT * FROM $wpdb->ModulaImages WHERE gid = %d ORDER BY sortOrder ASC LIMIT $e", $gid ) );
|
| 181 |
+
|
| 182 |
return $imageResults;
|
| 183 |
}
|
| 184 |
+
|
| 185 |
+
public function getGalleryByGalleryId( $gid ) {
|
| 186 |
global $wpdb;
|
| 187 |
+
$gallery = $wpdb->get_results( $wpdb->prepare( "SELECT $wpdb->ModulaGalleries.*, $wpdb->ModulaImages.* FROM $wpdb->ModulaGalleries INNER JOIN $wpdb->ModulaImages ON ($wpdb->ModulaGalleries.Id = $wpdb->ModulaImages.gid) WHERE $wpdb->ModulaGalleries.Id = %d ORDER BY sortOrder ASC", $gid ) );
|
| 188 |
+
|
| 189 |
return $gallery;
|
| 190 |
}
|
| 191 |
}
|
| 192 |
+
|
| 193 |
?>
|
lib/gallery-class.php
CHANGED
|
@@ -1,376 +1,374 @@
|
|
| 1 |
<?php
|
| 2 |
|
| 3 |
-
define("MODULA_DB_MODE", 1);
|
| 4 |
-
define("MODULA_WP_MODE", 2);
|
| 5 |
|
| 6 |
-
if (!class_exists( "ModulaLiteFE" )) {
|
| 7 |
class ModulaLiteFE {
|
| 8 |
|
| 9 |
private $defaultValues;
|
| 10 |
|
| 11 |
-
public function __construct($db, $id, $defaultValues)
|
| 12 |
-
|
| 13 |
-
$this->
|
| 14 |
-
$this->
|
| 15 |
-
$this->
|
| 16 |
-
$this->
|
| 17 |
-
$this->id = $id;
|
| 18 |
$this->defaultValues = $defaultValues;
|
| 19 |
$this->init();
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
public function init()
|
| 23 |
-
|
| 24 |
-
$this->gallery = $this->db->getGalleryById($this->id);
|
| 25 |
foreach ( $this->defaultValues as $k => $v ) {
|
| 26 |
-
if(! isset($this->gallery->$k))
|
| 27 |
$this->gallery->$k = $v;
|
|
|
|
| 28 |
}
|
| 29 |
|
| 30 |
$this->gallery->mode = MODULA_DB_MODE;
|
| 31 |
-
|
| 32 |
-
if(! empty($_GET["debug"]))
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
|
| 37 |
-
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
|
| 41 |
-
if(! $this->gallery->hasResizedImages)
|
| 42 |
-
{
|
| 43 |
$images = $this->db->getImagesByGalleryId( $this->id );
|
| 44 |
$images = ModulaLiteTools::check_and_resize( $images, $this->gallery->img_size );
|
| 45 |
-
foreach($images as $img) {
|
| 46 |
-
$this->db->editImage( $img->Id, (array)$img );
|
| 47 |
}
|
| 48 |
$this->gallery->hasResizedImages = true;
|
| 49 |
-
$this->db->editGallery($this->id, (array)$this->gallery);
|
| 50 |
}
|
| 51 |
-
|
| 52 |
-
$this->images = $this->loadModulaImages();
|
| 53 |
|
| 54 |
-
|
|
|
|
|
|
|
| 55 |
$idx = 0;
|
| 56 |
-
|
| 57 |
-
|
|
|
|
| 58 |
|
| 59 |
-
|
| 60 |
-
|
|
|
|
| 61 |
}
|
| 62 |
-
|
| 63 |
-
|
| 64 |
-
|
| 65 |
-
|
| 66 |
-
'post_type' => 'attachment',
|
| 67 |
'posts_per_page' => -1,
|
| 68 |
-
'include'
|
| 69 |
);
|
| 70 |
-
|
| 71 |
-
$this->wp_images = get_posts($args);
|
| 72 |
-
if($this->gallery->lightbox == "attachment-page")
|
| 73 |
-
|
| 74 |
-
|
| 75 |
-
|
| 76 |
-
$
|
|
|
|
|
|
|
|
|
|
|
|
|
| 77 |
}
|
| 78 |
}
|
| 79 |
-
|
| 80 |
-
|
| 81 |
-
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
|
| 88 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 89 |
}
|
|
|
|
| 90 |
}
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
|
| 94 |
-
{
|
| 95 |
-
$this->imageIds = $ids;
|
| 96 |
-
$this->gallery->mode = MODULA_WP_MODE;
|
| 97 |
-
$this->loadWPImages($ids);
|
| 98 |
-
|
| 99 |
-
foreach($this->wp_images as $att)
|
| 100 |
-
{
|
| 101 |
-
$image = new stdClass();
|
| 102 |
-
$image->imageId = $att->ID;
|
| 103 |
-
$image->url = $att->url;
|
| 104 |
-
$image->Id = $att->ID;
|
| 105 |
-
$image->imagePath = $att->guid;
|
| 106 |
-
$image->link = get_post_meta($att->ID, "_modula_link", true);
|
| 107 |
-
|
| 108 |
-
switch($this->gallery->wp_field_caption)
|
| 109 |
-
{
|
| 110 |
-
case 'title':
|
| 111 |
-
$image->description = $att->post_title;
|
| 112 |
-
break;
|
| 113 |
-
case 'caption':
|
| 114 |
-
$image->description = $att->post_excerpt;
|
| 115 |
-
break;
|
| 116 |
-
case 'description':
|
| 117 |
-
$image->description = $att->post_content;
|
| 118 |
-
break;
|
| 119 |
-
}
|
| 120 |
-
$this->images[$image->imageId] = $image;
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
public function getGallery()
|
| 126 |
-
{
|
| 127 |
return $this->gallery;
|
| 128 |
}
|
| 129 |
-
|
| 130 |
-
private function getLightboxClass($image)
|
| 131 |
-
|
| 132 |
-
if(! empty($image->link))
|
| 133 |
return '';
|
| 134 |
-
|
| 135 |
-
|
|
|
|
| 136 |
return '';
|
| 137 |
-
|
|
|
|
| 138 |
return 'modula-lightbox';
|
| 139 |
}
|
| 140 |
-
|
| 141 |
-
private function getHoverEffect($code)
|
| 142 |
-
{
|
| 143 |
global $ob_ModulaLite;
|
| 144 |
-
foreach($ob_ModulaLite->hoverEffects as $effect)
|
| 145 |
-
if($effect->code == $code)
|
| 146 |
return $effect;
|
|
|
|
|
|
|
| 147 |
}
|
| 148 |
-
|
| 149 |
-
private function getLink($image)
|
| 150 |
-
|
| 151 |
-
if(! empty($image->link))
|
| 152 |
return "href='" . $image->link . "'";
|
|
|
|
| 153 |
|
| 154 |
-
if(empty($this->gallery->lightbox))
|
| 155 |
return '';
|
|
|
|
| 156 |
|
| 157 |
-
if($this->gallery->lightbox == 'attachment-page')
|
| 158 |
return "href='" . $image->url . "'";
|
|
|
|
| 159 |
|
| 160 |
return "href='" . wp_get_attachment_url( $image->imageId ) . "'";
|
| 161 |
}
|
| 162 |
-
|
| 163 |
-
private function getTarget($image)
|
| 164 |
-
|
| 165 |
-
if(! empty($image->target))
|
| 166 |
return "target='" . $image->target . "'";
|
| 167 |
-
|
|
|
|
| 168 |
// if($this->gallery->blank == 'T')
|
| 169 |
// return "target='_blank'";
|
| 170 |
-
|
| 171 |
return '';
|
| 172 |
}
|
| 173 |
-
|
| 174 |
-
private function getdef($value, $default)
|
| 175 |
-
|
| 176 |
-
if($value == NULL || empty($value))
|
| 177 |
return $default;
|
| 178 |
-
|
|
|
|
| 179 |
return $value;
|
| 180 |
}
|
| 181 |
-
|
| 182 |
-
|
| 183 |
-
|
| 184 |
-
|
| 185 |
-
|
| 186 |
-
|
| 187 |
-
|
| 188 |
-
|
| 189 |
-
|
| 190 |
-
|
| 191 |
-
|
| 192 |
-
|
| 193 |
-
|
| 194 |
-
|
| 195 |
-
|
| 196 |
-
|
| 197 |
-
|
| 198 |
-
|
| 199 |
-
|
| 200 |
-
|
| 201 |
-
|
| 202 |
-
|
| 203 |
-
|
| 204 |
-
|
| 205 |
-
|
| 206 |
-
|
| 207 |
-
|
| 208 |
-
{
|
| 209 |
-
|
| 210 |
-
|
| 211 |
-
|
| 212 |
-
|
| 213 |
-
|
| 214 |
-
|
| 215 |
-
|
| 216 |
-
|
| 217 |
-
|
| 218 |
-
|
| 219 |
-
|
| 220 |
-
return $text;
|
| 221 |
}
|
| 222 |
|
| 223 |
-
private function v($name)
|
| 224 |
-
|
| 225 |
-
switch($this->mode)
|
| 226 |
-
{
|
| 227 |
default:
|
| 228 |
case MODULA_DB_MODE:
|
| 229 |
return $this->gallery->$name;
|
| 230 |
break;
|
| 231 |
case MODULA_WP_MODE:
|
| 232 |
-
return $this->settings[$name];
|
| 233 |
}
|
| 234 |
}
|
| 235 |
|
| 236 |
-
public function render()
|
| 237 |
-
|
| 238 |
-
|
| 239 |
-
|
| 240 |
-
|
| 241 |
-
|
| 242 |
-
|
| 243 |
-
|
| 244 |
|
| 245 |
-
|
| 246 |
|
| 247 |
$html .= "<style>\n";
|
| 248 |
|
| 249 |
-
if($this->gallery->borderSize)
|
| 250 |
$html .= "#jtg-$this->id$rid .item { border: " . $this->gallery->borderSize . "px solid " . $this->gallery->borderColor . "; }\n";
|
| 251 |
-
|
| 252 |
-
|
|
|
|
| 253 |
$html .= "#jtg-$this->id$rid .item { border-radius: " . $this->gallery->borderRadius . "px; }\n";
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 254 |
|
| 255 |
-
if($this->gallery->
|
| 256 |
-
$html .= "#jtg-$this->id$rid .item { box-shadow: " . $this->gallery->shadowColor ." 0px 0px " . $this->gallery->shadowSize . "px; }\n";
|
| 257 |
-
|
| 258 |
-
if($this->gallery->socialIconColor)
|
| 259 |
$html .= "#jtg-$this->id$rid .item .jtg-social a { color: " . $this->gallery->socialIconColor . " }\n";
|
|
|
|
|
|
|
|
|
|
| 260 |
|
| 261 |
-
|
| 262 |
-
|
| 263 |
-
$html .= "#jtg-$this->id$rid .item .figc { color: ".$this->gallery->captionColor."; font-size: ".$this->gallery->captionFontSize."px; }\n";
|
| 264 |
-
|
| 265 |
-
$html .= "#jtg-$this->id$rid .item .figc h2.jtg-title { font-size: ".$this->gallery->titleFontSize."px; }\n";
|
| 266 |
-
|
| 267 |
-
$html .= "#jtg-$this->id$rid .item { transform: scale(" .$gallery->loadedScale/100 .") translate(" . $gallery->loadedHSlide . 'px,' . $gallery->loadedVSlide . "px) rotate(" . $gallery->loadedRotate . "deg); }\n";
|
| 268 |
|
| 269 |
-
|
| 270 |
-
$html .= "#jtg-$this->id$rid .items { width:".$this->gallery->width. "; height:".$this->gallery->height. "px; }\n";
|
| 271 |
-
|
| 272 |
-
$html .= "#jtg-$this->id$rid .items .figc p.description { color:".$this->gallery->captionColor."; }\n";
|
| 273 |
|
|
|
|
| 274 |
|
| 275 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 276 |
$html .= $this->gallery->style;
|
|
|
|
| 277 |
|
| 278 |
-
$html .= "</style>\n";
|
| 279 |
-
|
| 280 |
-
$id
|
| 281 |
-
$html .="<a name='$id'> </a>";
|
| 282 |
-
|
| 283 |
-
|
| 284 |
-
|
| 285 |
-
|
| 286 |
-
foreach(array_slice($this->images, 0, 40/2) as $image)
|
| 287 |
-
|
| 288 |
-
|
| 289 |
-
|
| 290 |
-
|
| 291 |
-
|
| 292 |
-
|
| 293 |
-
|
| 294 |
-
|
| 295 |
-
|
| 296 |
-
|
| 297 |
-
|
| 298 |
-
|
| 299 |
-
|
| 300 |
-
$hasTitle = empty($image->title) ? 'notitle' : '';
|
| 301 |
-
|
| 302 |
-
$imgUrl = $image->imagePath;
|
| 303 |
-
|
| 304 |
-
$html .= "\t<div class=\"item " . $hasTitle . " effect-". $hoverEffect->code ."\">\n";
|
| 305 |
-
$html .= "<a $title='$image->description' ". ($this->gallery->lightbox == "lightbox2" && empty($image->link) ? "data-lightbox='gallery'" : "") ." rel='$rel' " . $this->getTarget($image) . " class='tile-inner " . ($this->getLightboxClass($image)) . "' " . $this->getLink($image) . ">\n";
|
| 306 |
-
$html .= "\t\t<img data-valign='$image->valign' alt='$image->alt' data-halign='$image->halign' class='pic' src='$imgUrl' data-src='$imgUrl' />\n";
|
| 307 |
-
$html .= "\t\t<div class=\"figc\">\n";
|
| 308 |
-
$html .= "\t\t\t<div class=\"figc-inner\">\n";
|
| 309 |
-
if($this->gallery->hoverEffect != 'none' && ! empty($image->title))
|
| 310 |
-
$html .= "\t\t\t\t<h2 class='jtg-title'>".$image->title."</h2>\n";
|
| 311 |
-
|
| 312 |
-
if(($hoverEffect->allowSubtitle && ! empty($image->description)) ||
|
| 313 |
-
empty($this->gallery->hoverEffect))
|
| 314 |
{
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 315 |
$html .= "\t\t\t\t\t<p class=\"description\">";
|
| 316 |
-
if($hoverEffect->allowSubtitle || empty($this->gallery->hoverEffect) )
|
| 317 |
$html .= $image->description;
|
| 318 |
-
|
| 319 |
-
|
| 320 |
-
|
|
|
|
| 321 |
$html .= "\t\t</div>\n";
|
| 322 |
$html .= "\t</a>\n";
|
| 323 |
$html .= "\t</div>\n";
|
| 324 |
}
|
| 325 |
|
| 326 |
|
| 327 |
-
|
| 328 |
-
|
| 329 |
-
|
| 330 |
-
|
| 331 |
-
|
| 332 |
-
|
| 333 |
-
|
| 334 |
-
|
| 335 |
-
|
| 336 |
-
|
| 337 |
-
|
| 338 |
-
$html .= "\t\
|
| 339 |
-
|
| 340 |
-
|
| 341 |
-
$html .= "\t\
|
| 342 |
-
$html .= "\t\
|
| 343 |
-
$html .= "\t\
|
| 344 |
-
$html .= "\t\
|
| 345 |
-
$html .= "\t
|
| 346 |
-
|
| 347 |
-
|
| 348 |
$html .= "</script>";
|
| 349 |
|
| 350 |
|
| 351 |
-
if(! empty($_GET["debug"]))
|
| 352 |
return $html;
|
|
|
|
| 353 |
|
| 354 |
-
return str_replace(array("\n", "\t"), "", $html);
|
| 355 |
}
|
| 356 |
|
| 357 |
-
public function useCaptions()
|
| 358 |
-
|
| 359 |
-
if($this->gallery->wp_field_caption == "none" && $this->gallery->wp_field_title == "none")
|
| 360 |
return false;
|
|
|
|
| 361 |
|
| 362 |
return true;
|
| 363 |
}
|
| 364 |
-
|
| 365 |
-
public function loadModulaImages()
|
| 366 |
-
{
|
| 367 |
$images = array();
|
| 368 |
-
$idx
|
| 369 |
-
foreach($this->db->getImagesByGalleryId($this->id) as $img)
|
| 370 |
-
$images[$img->imageId < 0 ? $img->imageId - ($idx++) : $img->imageId] = $img;
|
| 371 |
-
|
|
|
|
| 372 |
return $images;
|
| 373 |
-
}
|
| 374 |
}
|
| 375 |
}
|
| 376 |
?>
|
| 1 |
<?php
|
| 2 |
|
| 3 |
+
define( "MODULA_DB_MODE", 1 );
|
| 4 |
+
define( "MODULA_WP_MODE", 2 );
|
| 5 |
|
| 6 |
+
if ( ! class_exists( "ModulaLiteFE" ) ) {
|
| 7 |
class ModulaLiteFE {
|
| 8 |
|
| 9 |
private $defaultValues;
|
| 10 |
|
| 11 |
+
public function __construct( $db, $id, $defaultValues ) {
|
| 12 |
+
$this->gallery = new stdClass();
|
| 13 |
+
$this->db = $db;
|
| 14 |
+
$this->wp_images = array();
|
| 15 |
+
$this->images = array();
|
| 16 |
+
$this->id = $id;
|
|
|
|
| 17 |
$this->defaultValues = $defaultValues;
|
| 18 |
$this->init();
|
| 19 |
+
}
|
| 20 |
+
|
| 21 |
+
public function init() {
|
| 22 |
+
$this->gallery = $this->db->getGalleryById( $this->id );
|
|
|
|
| 23 |
foreach ( $this->defaultValues as $k => $v ) {
|
| 24 |
+
if ( ! isset( $this->gallery->$k ) ) {
|
| 25 |
$this->gallery->$k = $v;
|
| 26 |
+
}
|
| 27 |
}
|
| 28 |
|
| 29 |
$this->gallery->mode = MODULA_DB_MODE;
|
| 30 |
+
|
| 31 |
+
if ( ! empty( $_GET["debug"] ) ) {
|
| 32 |
+
print "<!--\n";
|
| 33 |
+
print "Gallery id: $this->id\n";
|
| 34 |
+
print "settings:\n";
|
| 35 |
+
print_r( $this->gallery );
|
| 36 |
+
print "\n-->\n";
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
+
if ( ! $this->gallery->hasResizedImages ) {
|
|
|
|
|
|
|
| 40 |
$images = $this->db->getImagesByGalleryId( $this->id );
|
| 41 |
$images = ModulaLiteTools::check_and_resize( $images, $this->gallery->img_size );
|
| 42 |
+
foreach ( $images as $img ) {
|
| 43 |
+
$this->db->editImage( $img->Id, (array) $img );
|
| 44 |
}
|
| 45 |
$this->gallery->hasResizedImages = true;
|
| 46 |
+
$this->db->editGallery( $this->id, (array) $this->gallery );
|
| 47 |
}
|
|
|
|
|
|
|
| 48 |
|
| 49 |
+
$this->images = $this->loadModulaImages();
|
| 50 |
+
|
| 51 |
+
$ids = array();
|
| 52 |
$idx = 0;
|
| 53 |
+
foreach ( $this->images as $img ) {
|
| 54 |
+
$ids[] = $img->imageId < 0 ? $img->imageId - ( $idx ++ ) : $img->imageId;
|
| 55 |
+
}
|
| 56 |
|
| 57 |
+
if ( count( $this->images ) > 0 && $this->gallery->importedFrom != 'NextGen' ) {
|
| 58 |
+
$this->loadWPImages( $ids );
|
| 59 |
+
}
|
| 60 |
}
|
| 61 |
+
|
| 62 |
+
public function loadWPImages( $ids ) {
|
| 63 |
+
$args = array(
|
| 64 |
+
'post_type' => 'attachment',
|
|
|
|
| 65 |
'posts_per_page' => -1,
|
| 66 |
+
'include' => $ids
|
| 67 |
);
|
| 68 |
+
|
| 69 |
+
$this->wp_images = get_posts( $args );
|
| 70 |
+
if ( $this->gallery->lightbox == "attachment-page" ) {
|
| 71 |
+
foreach ( $this->wp_images as $att ) {
|
| 72 |
+
$att->url = get_attachment_link( $att->ID );
|
| 73 |
+
|
| 74 |
+
if ( $this->gallery->mode == MODULA_DB_MODE ) {
|
| 75 |
+
//$this->images[$att->ID]->imagePath = $att->guid;
|
| 76 |
+
$this->images[ $att->ID ]->url = $att->url;
|
| 77 |
+
$this->images[ $att->ID ]->alt = get_post_meta( $att->ID, '_wp_attachment_image_alt', true );
|
| 78 |
+
}
|
| 79 |
}
|
| 80 |
}
|
| 81 |
+
}
|
| 82 |
+
|
| 83 |
+
public function initByImageIds( $ids ) {
|
| 84 |
+
$this->imageIds = $ids;
|
| 85 |
+
$this->gallery->mode = MODULA_WP_MODE;
|
| 86 |
+
$this->loadWPImages( $ids );
|
| 87 |
+
|
| 88 |
+
foreach ( $this->wp_images as $att ) {
|
| 89 |
+
$image = new stdClass();
|
| 90 |
+
$image->imageId = $att->ID;
|
| 91 |
+
$image->url = $att->url;
|
| 92 |
+
$image->Id = $att->ID;
|
| 93 |
+
$image->imagePath = $att->guid;
|
| 94 |
+
$image->link = get_post_meta( $att->ID, "_modula_link", true );
|
| 95 |
+
|
| 96 |
+
switch ( $this->gallery->wp_field_caption ) {
|
| 97 |
+
case 'title':
|
| 98 |
+
$image->description = $att->post_title;
|
| 99 |
+
break;
|
| 100 |
+
case 'caption':
|
| 101 |
+
$image->description = $att->post_excerpt;
|
| 102 |
+
break;
|
| 103 |
+
case 'description':
|
| 104 |
+
$image->description = $att->post_content;
|
| 105 |
+
break;
|
| 106 |
}
|
| 107 |
+
$this->images[ $image->imageId ] = $image;
|
| 108 |
}
|
| 109 |
+
|
| 110 |
+
}
|
| 111 |
+
|
| 112 |
+
public function getGallery() {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 113 |
return $this->gallery;
|
| 114 |
}
|
| 115 |
+
|
| 116 |
+
private function getLightboxClass( $image ) {
|
| 117 |
+
if ( ! empty( $image->link ) ) {
|
|
|
|
| 118 |
return '';
|
| 119 |
+
}
|
| 120 |
+
|
| 121 |
+
if ( empty( $this->gallery->lightbox ) ) {
|
| 122 |
return '';
|
| 123 |
+
}
|
| 124 |
+
|
| 125 |
return 'modula-lightbox';
|
| 126 |
}
|
| 127 |
+
|
| 128 |
+
private function getHoverEffect( $code ) {
|
|
|
|
| 129 |
global $ob_ModulaLite;
|
| 130 |
+
foreach ( $ob_ModulaLite->hoverEffects as $effect ) {
|
| 131 |
+
if ( $effect->code == $code ) {
|
| 132 |
return $effect;
|
| 133 |
+
}
|
| 134 |
+
}
|
| 135 |
}
|
| 136 |
+
|
| 137 |
+
private function getLink( $image ) {
|
| 138 |
+
if ( ! empty( $image->link ) ) {
|
|
|
|
| 139 |
return "href='" . $image->link . "'";
|
| 140 |
+
}
|
| 141 |
|
| 142 |
+
if ( empty( $this->gallery->lightbox ) ) {
|
| 143 |
return '';
|
| 144 |
+
}
|
| 145 |
|
| 146 |
+
if ( $this->gallery->lightbox == 'attachment-page' ) {
|
| 147 |
return "href='" . $image->url . "'";
|
| 148 |
+
}
|
| 149 |
|
| 150 |
return "href='" . wp_get_attachment_url( $image->imageId ) . "'";
|
| 151 |
}
|
| 152 |
+
|
| 153 |
+
private function getTarget( $image ) {
|
| 154 |
+
if ( ! empty( $image->target ) ) {
|
|
|
|
| 155 |
return "target='" . $image->target . "'";
|
| 156 |
+
}
|
| 157 |
+
|
| 158 |
// if($this->gallery->blank == 'T')
|
| 159 |
// return "target='_blank'";
|
| 160 |
+
|
| 161 |
return '';
|
| 162 |
}
|
| 163 |
+
|
| 164 |
+
private function getdef( $value, $default ) {
|
| 165 |
+
if ( $value == null || empty( $value ) ) {
|
|
|
|
| 166 |
return $default;
|
| 167 |
+
}
|
| 168 |
+
|
| 169 |
return $value;
|
| 170 |
}
|
| 171 |
+
|
| 172 |
+
private function toRGB( $Hex ) {
|
| 173 |
+
|
| 174 |
+
if ( substr( $Hex, 0, 1 ) == "#" ) {
|
| 175 |
+
$Hex = substr( $Hex, 1 );
|
| 176 |
+
}
|
| 177 |
+
|
| 178 |
+
$R = substr( $Hex, 0, 2 );
|
| 179 |
+
$G = substr( $Hex, 2, 2 );
|
| 180 |
+
$B = substr( $Hex, 4, 2 );
|
| 181 |
+
|
| 182 |
+
$R = hexdec( $R );
|
| 183 |
+
$G = hexdec( $G );
|
| 184 |
+
$B = hexdec( $B );
|
| 185 |
+
|
| 186 |
+
$RGB['R'] = $R;
|
| 187 |
+
$RGB['G'] = $G;
|
| 188 |
+
$RGB['B'] = $B;
|
| 189 |
+
|
| 190 |
+
$RGB[0] = $R;
|
| 191 |
+
$RGB[1] = $G;
|
| 192 |
+
$RGB[2] = $B;
|
| 193 |
+
|
| 194 |
+
return $RGB;
|
| 195 |
+
|
| 196 |
+
}
|
| 197 |
+
|
| 198 |
+
static public function slugify( $text ) {
|
| 199 |
+
$text = preg_replace( '~[^\\pL\d]+~u', '-', $text );
|
| 200 |
+
$text = trim( $text, '-' );
|
| 201 |
+
$text = iconv( 'utf-8', 'us-ascii//TRANSLIT', $text );
|
| 202 |
+
$text = strtolower( $text );
|
| 203 |
+
$text = preg_replace( '~[^-\w]+~', '', $text );
|
| 204 |
+
|
| 205 |
+
if ( empty( $text ) ) {
|
| 206 |
+
return 'n-a';
|
| 207 |
+
}
|
| 208 |
+
|
| 209 |
+
return $text;
|
|
|
|
| 210 |
}
|
| 211 |
|
| 212 |
+
private function v( $name ) {
|
| 213 |
+
switch ( $this->mode ) {
|
|
|
|
|
|
|
| 214 |
default:
|
| 215 |
case MODULA_DB_MODE:
|
| 216 |
return $this->gallery->$name;
|
| 217 |
break;
|
| 218 |
case MODULA_WP_MODE:
|
| 219 |
+
return $this->settings[ $name ];
|
| 220 |
}
|
| 221 |
}
|
| 222 |
|
| 223 |
+
public function render() {
|
| 224 |
+
$rid = rand( 1, 1000 );
|
| 225 |
+
|
| 226 |
+
if ( $this->gallery->shuffle == 'T' ) {
|
| 227 |
+
shuffle( $this->images );
|
| 228 |
+
}
|
| 229 |
+
|
| 230 |
+
$gallery = $this->gallery;
|
| 231 |
|
| 232 |
+
$html = "";
|
| 233 |
|
| 234 |
$html .= "<style>\n";
|
| 235 |
|
| 236 |
+
if ( $this->gallery->borderSize ) {
|
| 237 |
$html .= "#jtg-$this->id$rid .item { border: " . $this->gallery->borderSize . "px solid " . $this->gallery->borderColor . "; }\n";
|
| 238 |
+
}
|
| 239 |
+
|
| 240 |
+
if ( $this->gallery->borderRadius ) {
|
| 241 |
$html .= "#jtg-$this->id$rid .item { border-radius: " . $this->gallery->borderRadius . "px; }\n";
|
| 242 |
+
}
|
| 243 |
+
|
| 244 |
+
if ( $this->gallery->shadowSize ) {
|
| 245 |
+
$html .= "#jtg-$this->id$rid .item { box-shadow: " . $this->gallery->shadowColor . " 0px 0px " . $this->gallery->shadowSize . "px; }\n";
|
| 246 |
+
}
|
| 247 |
|
| 248 |
+
if ( $this->gallery->socialIconColor ) {
|
|
|
|
|
|
|
|
|
|
| 249 |
$html .= "#jtg-$this->id$rid .item .jtg-social a { color: " . $this->gallery->socialIconColor . " }\n";
|
| 250 |
+
}
|
| 251 |
+
|
| 252 |
+
$html .= "#jtg-$this->id$rid .item .caption { background-color: " . $this->gallery->captionColor . "; }\n";
|
| 253 |
|
| 254 |
+
$html .= "#jtg-$this->id$rid .item .figc { color: " . $this->gallery->captionColor . "; font-size: " . $this->gallery->captionFontSize . "px; }\n";
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 255 |
|
| 256 |
+
$html .= "#jtg-$this->id$rid .item .figc h2.jtg-title { font-size: " . $this->gallery->titleFontSize . "px; }\n";
|
|
|
|
|
|
|
|
|
|
| 257 |
|
| 258 |
+
$html .= "#jtg-$this->id$rid .item { transform: scale(" . $gallery->loadedScale / 100 . ") translate(" . $gallery->loadedHSlide . 'px,' . $gallery->loadedVSlide . "px) rotate(" . $gallery->loadedRotate . "deg); }\n";
|
| 259 |
|
| 260 |
+
|
| 261 |
+
$html .= "#jtg-$this->id$rid .items { width:" . $this->gallery->width . "; height:" . $this->gallery->height . "px; }\n";
|
| 262 |
+
|
| 263 |
+
$html .= "#jtg-$this->id$rid .items .figc p.description { color:" . $this->gallery->captionColor . "; }\n";
|
| 264 |
+
|
| 265 |
+
|
| 266 |
+
if ( strlen( $this->gallery->style ) ) {
|
| 267 |
$html .= $this->gallery->style;
|
| 268 |
+
}
|
| 269 |
|
| 270 |
+
$html .= "</style>\n";
|
| 271 |
+
|
| 272 |
+
$id = $this->id;
|
| 273 |
+
$html .= "<a name='$id'> </a>";
|
| 274 |
+
$html .= "<div class='modula' id='jtg-$this->id$rid'>\n";
|
| 275 |
+
|
| 276 |
+
$html .= "<div class='items'>\n";
|
| 277 |
+
|
| 278 |
+
foreach ( array_slice( $this->images, 0, 40 / 2 ) as $image ) {
|
| 279 |
+
$title = in_array( $this->gallery->lightbox, array(
|
| 280 |
+
'prettyphoto',
|
| 281 |
+
'fancybox',
|
| 282 |
+
'swipebox',
|
| 283 |
+
'lightbox2'
|
| 284 |
+
) ) ? "title" : "data-title";
|
| 285 |
+
$rel = $this->gallery->lightbox == "prettyphoto" ? "prettyPhoto[jtg-$this->id$rid]" : "jtg-$this->id$rid";
|
| 286 |
+
|
| 287 |
+
$hoverEffect = $this->getHoverEffect( $this->gallery->hoverEffect );
|
| 288 |
+
|
| 289 |
+
/*if(empty($image->title) && empty($image->description) &&
|
| 290 |
+
!$this->gallery->enableTwitter && !$this->gallery->enableFacebook &&
|
| 291 |
+
!$this->gallery->enablePinterest & !$this->gallery->enableGplus)
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 292 |
{
|
| 293 |
+
$hoverEffect = $this->getHoverEffect('none');
|
| 294 |
+
}*/
|
| 295 |
+
|
| 296 |
+
$hasTitle = empty( $image->title ) ? 'notitle' : '';
|
| 297 |
+
|
| 298 |
+
$imgUrl = $image->imagePath;
|
| 299 |
+
$image->alt = isset( $image->alt ) ? $image->alt : '';
|
| 300 |
+
|
| 301 |
+
$html .= "\t<div class=\"item " . $hasTitle . " effect-" . $hoverEffect->code . "\">\n";
|
| 302 |
+
$html .= "<a $title='$image->description' " . ( $this->gallery->lightbox == "lightbox2" && empty( $image->link ) ? "data-lightbox='gallery'" : "" ) . " rel='$rel' " . $this->getTarget( $image ) . " class='tile-inner " . ( $this->getLightboxClass( $image ) ) . "' " . $this->getLink( $image ) . ">\n";
|
| 303 |
+
$html .= "\t\t<img data-valign='$image->valign' alt='$image->alt' data-halign='$image->halign' class='pic' src='$imgUrl' data-src='$imgUrl' />\n";
|
| 304 |
+
$html .= "\t\t<div class=\"figc\">\n";
|
| 305 |
+
$html .= "\t\t\t<div class=\"figc-inner\">\n";
|
| 306 |
+
if ( $this->gallery->hoverEffect != 'none' && ! empty( $image->title ) ) {
|
| 307 |
+
$html .= "\t\t\t\t<h2 class='jtg-title'>" . $image->title . "</h2>\n";
|
| 308 |
+
}
|
| 309 |
+
|
| 310 |
+
if ( ( $hoverEffect->allowSubtitle && ! empty( $image->description ) ) ||
|
| 311 |
+
empty( $this->gallery->hoverEffect ) ) {
|
| 312 |
$html .= "\t\t\t\t\t<p class=\"description\">";
|
| 313 |
+
if ( $hoverEffect->allowSubtitle || empty( $this->gallery->hoverEffect ) ) {
|
| 314 |
$html .= $image->description;
|
| 315 |
+
}
|
| 316 |
+
$html .= "</p>\n";
|
| 317 |
+
}
|
| 318 |
+
$html .= "\t\t\t</div>\n";
|
| 319 |
$html .= "\t\t</div>\n";
|
| 320 |
$html .= "\t</a>\n";
|
| 321 |
$html .= "\t</div>\n";
|
| 322 |
}
|
| 323 |
|
| 324 |
|
| 325 |
+
$html .= "\t</div>\n";
|
| 326 |
+
$html .= "</div>\n";
|
| 327 |
+
|
| 328 |
+
$html .= "<script type='text/javascript'>\n";
|
| 329 |
+
$html .= "\tjQuery('#jtg-$this->id$rid').modulaGallery({\n";
|
| 330 |
+
|
| 331 |
+
if ( strlen( $this->gallery->script ) ) {
|
| 332 |
+
$html .= "\t\tonComplete: function () { " . stripslashes( $this->gallery->script ) . "},\n";
|
| 333 |
+
}
|
| 334 |
+
|
| 335 |
+
$html .= "\t\tresizer: '" . plugins_url( 'modula-best-grid-gallery/image.php', '' ) . "',\n";
|
| 336 |
+
$html .= "\t\tmargin: " . $this->gallery->margin . ",\n";
|
| 337 |
+
// $html .= "\t\tkeepArea: " . ($this->gallery->keepArea == "T" ? "true" : "false") . ",\n";
|
| 338 |
+
$html .= "\t\tenableTwitter: " . ( $this->gallery->enableTwitter == "T" ? "true" : "false" ) . ",\n";
|
| 339 |
+
$html .= "\t\tenableFacebook: " . ( $this->gallery->enableFacebook == "T" ? "true" : "false" ) . ",\n";
|
| 340 |
+
$html .= "\t\tenablePinterest: " . ( $this->gallery->enablePinterest == "T" ? "true" : "false" ) . ",\n";
|
| 341 |
+
$html .= "\t\tenableGplus: " . ( $this->gallery->enableGplus == "T" ? "true" : "false" ) . ",\n";
|
| 342 |
+
$html .= "\t\trandomFactor: " . ( $this->gallery->randomFactor / 100 ) . ",\n";
|
| 343 |
+
$html .= "\t});\n";
|
| 344 |
+
|
|
|
|
| 345 |
$html .= "</script>";
|
| 346 |
|
| 347 |
|
| 348 |
+
if ( ! empty( $_GET["debug"] ) ) {
|
| 349 |
return $html;
|
| 350 |
+
}
|
| 351 |
|
| 352 |
+
return str_replace( array( "\n", "\t" ), "", $html );
|
| 353 |
}
|
| 354 |
|
| 355 |
+
public function useCaptions() {
|
| 356 |
+
if ( $this->gallery->wp_field_caption == "none" && $this->gallery->wp_field_title == "none" ) {
|
|
|
|
| 357 |
return false;
|
| 358 |
+
}
|
| 359 |
|
| 360 |
return true;
|
| 361 |
}
|
| 362 |
+
|
| 363 |
+
public function loadModulaImages() {
|
|
|
|
| 364 |
$images = array();
|
| 365 |
+
$idx = 0;
|
| 366 |
+
foreach ( $this->db->getImagesByGalleryId( $this->id ) as $img ) {
|
| 367 |
+
$images[ $img->imageId < 0 ? $img->imageId - ( $idx ++ ) : $img->imageId ] = $img;
|
| 368 |
+
}
|
| 369 |
+
|
| 370 |
return $images;
|
| 371 |
+
}
|
| 372 |
}
|
| 373 |
}
|
| 374 |
?>
|
scripts/jquery.modula.js
CHANGED
|
@@ -1,539 +1,539 @@
|
|
| 1 |
-
// Place any jQuery/helper plugins in here.
|
| 2 |
-
/*
|
| 3 |
-
* Project: jQuery Modula 2
|
| 4 |
-
* Version: 1.0
|
| 5 |
-
* Description: Artistic gallery
|
| 6 |
-
* Author: Green Tree Labs
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
function tg_getURLParameter(name) {
|
| 10 |
-
return decodeURIComponent((new RegExp('[?|&]' + name + '=' + '([^&;]+?)(&|#|;|$)').exec(location.search)||[,""])[1].replace(/\+/g, '%20'))||null
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
; (function ($, window, document, undefined) {
|
| 14 |
-
|
| 15 |
-
|
| 16 |
-
// Create the defaults once
|
| 17 |
-
var pluginName = 'modulaGallery',
|
| 18 |
-
defaults = {
|
| 19 |
-
resizer: '/',
|
| 20 |
-
margin: 10,
|
| 21 |
-
keepArea: true,
|
| 22 |
-
enableTwitter: false,
|
| 23 |
-
enableFacebook: false,
|
| 24 |
-
enableGplus: false,
|
| 25 |
-
enablePinterest: false
|
| 26 |
-
};
|
| 27 |
-
|
| 28 |
-
// The actual plugin constructor
|
| 29 |
-
function Plugin(element, options) {
|
| 30 |
-
this.element = element;
|
| 31 |
-
this.$element = $(element);
|
| 32 |
-
this.$itemsCnt = this.$element.find(".items");
|
| 33 |
-
this.$items = this.$itemsCnt.find(".item");
|
| 34 |
-
|
| 35 |
-
this.options = $.extend({}, defaults, options);
|
| 36 |
-
|
| 37 |
-
this._defaults = defaults;
|
| 38 |
-
this._name = pluginName;
|
| 39 |
-
|
| 40 |
-
this.tiles = [];
|
| 41 |
-
this.$tilesCnt = null;
|
| 42 |
-
this.completed = false;
|
| 43 |
-
this.lastWidth = 0;
|
| 44 |
-
this.resizeTO = 0;
|
| 45 |
-
this.init();
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
Plugin.prototype.createGrid = function () {
|
| 49 |
-
var plugin = this;
|
| 50 |
-
|
| 51 |
-
for (var i = 0; i < this.$items.not(".jtg-hidden").length; i++)
|
| 52 |
-
this.tiles.push(plugin.getSlot());
|
| 53 |
-
|
| 54 |
-
this.tiles.sort(function (x, y) {
|
| 55 |
-
return x.position - y.position;
|
| 56 |
-
});
|
| 57 |
-
|
| 58 |
-
this.$items.not(".jtg-hidden").each(function (i, item) {
|
| 59 |
-
var slot = plugin.tiles[i];
|
| 60 |
-
|
| 61 |
-
$(item)
|
| 62 |
-
.data('size', slot)
|
| 63 |
-
.addClass('tiled')
|
| 64 |
-
.addClass(slot.width > slot.height ? 'tile-h' : 'tile-v')
|
| 65 |
-
.data('position');
|
| 66 |
-
});
|
| 67 |
-
|
| 68 |
-
//apply css
|
| 69 |
-
this.$items.each(function (i, item) {
|
| 70 |
-
$(item).css($(item).data('size'));
|
| 71 |
-
$(item).find(".figc").css({
|
| 72 |
-
width: $(item).data('size').width,
|
| 73 |
-
height: $(item).data('size').height
|
| 74 |
-
});
|
| 75 |
-
});
|
| 76 |
-
|
| 77 |
-
this.completed = true;
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
Plugin.prototype.getSlot = function () {
|
| 81 |
-
|
| 82 |
-
if (this.tiles.length == 0) {
|
| 83 |
-
var tile = {
|
| 84 |
-
top: 0,
|
| 85 |
-
left: 0,
|
| 86 |
-
width: this.$itemsCnt.width(),
|
| 87 |
-
height: this.$itemsCnt.height(),
|
| 88 |
-
area: this.$itemsCnt.width() * this.$itemsCnt.height(),
|
| 89 |
-
position: 0
|
| 90 |
-
};
|
| 91 |
-
return tile;
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
var maxTileIdx = 0;
|
| 95 |
-
for (var i = 0; i < this.tiles.length; i++) {
|
| 96 |
-
var tile = this.tiles[i];
|
| 97 |
-
if (tile.area > this.tiles[maxTileIdx].area) {
|
| 98 |
-
maxTileIdx = i;
|
| 99 |
-
}
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
var tile = {};
|
| 103 |
-
|
| 104 |
-
var maxTileData = this.tiles[maxTileIdx];
|
| 105 |
-
|
| 106 |
-
if (maxTileData.width > maxTileData.height) {
|
| 107 |
-
|
| 108 |
-
var randomMaxDelta = maxTileData.width / 2 * this.options.randomFactor;
|
| 109 |
-
|
| 110 |
-
|
| 111 |
-
maxTileData.prevWidth = maxTileData.width;
|
| 112 |
-
maxTileData.width = Math.floor((maxTileData.width / 2) +
|
| 113 |
-
(randomMaxDelta * (Math.random() - .5)));
|
| 114 |
-
|
| 115 |
-
tile = {
|
| 116 |
-
top: maxTileData.top,
|
| 117 |
-
left: maxTileData.left + maxTileData.width + this.options.margin,
|
| 118 |
-
width: maxTileData.prevWidth - maxTileData.width - this.options.margin,
|
| 119 |
-
height: maxTileData.height
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
} else {
|
| 123 |
-
var randomMaxDelta = maxTileData.height / 2 * this.options.randomFactor;
|
| 124 |
-
|
| 125 |
-
maxTileData.prevHeight = maxTileData.height;
|
| 126 |
-
maxTileData.height = Math.floor((maxTileData.height / 2) +
|
| 127 |
-
(randomMaxDelta * (Math.random() - .5)));
|
| 128 |
-
|
| 129 |
-
tile = {
|
| 130 |
-
left: maxTileData.left,
|
| 131 |
-
top: maxTileData.top + maxTileData.height + this.options.margin,
|
| 132 |
-
width: maxTileData.width,
|
| 133 |
-
height: maxTileData.prevHeight - maxTileData.height - this.options.margin
|
| 134 |
-
}
|
| 135 |
-
}
|
| 136 |
-
|
| 137 |
-
tile.area = tile.width * tile.height;
|
| 138 |
-
tile.position = tile.top * 1000 + tile.left;
|
| 139 |
-
|
| 140 |
-
maxTileData.position = maxTileData.top * 1000 + maxTileData.left;
|
| 141 |
-
|
| 142 |
-
this.tiles[maxTileIdx] = maxTileData;
|
| 143 |
-
this.tiles[maxTileIdx].area = maxTileData.width * maxTileData.height;
|
| 144 |
-
|
| 145 |
-
return tile;
|
| 146 |
-
}
|
| 147 |
-
|
| 148 |
-
Plugin.prototype.reset = function () {
|
| 149 |
-
var instance = this;
|
| 150 |
-
instance.tiles = [];
|
| 151 |
-
instance.createGrid();
|
| 152 |
-
instance.$itemsCnt.find('.pic').each(function (i, o) {
|
| 153 |
-
instance.placeImage(i);
|
| 154 |
-
});
|
| 155 |
-
instance.lastWidth = instance.$itemsCnt.width();
|
| 156 |
-
}
|
| 157 |
-
|
| 158 |
-
Plugin.prototype.onResize = function (instance) {
|
| 159 |
-
if (instance.lastWidth == instance.$itemsCnt.width())
|
| 160 |
-
return;
|
| 161 |
-
|
| 162 |
-
clearTimeout(instance.resizeTO);
|
| 163 |
-
instance.resizeTO = setTimeout(function () {
|
| 164 |
-
|
| 165 |
-
if (instance.options.keepArea) {
|
| 166 |
-
var area = instance.$itemsCnt.data('area');
|
| 167 |
-
instance.$itemsCnt.height(area / instance.$itemsCnt.width());
|
| 168 |
-
}
|
| 169 |
-
|
| 170 |
-
instance.reset();
|
| 171 |
-
|
| 172 |
-
}, 100);
|
| 173 |
-
}
|
| 174 |
-
|
| 175 |
-
Plugin.prototype.placeImage = function (index) {
|
| 176 |
-
|
| 177 |
-
var $tile = this.$items.eq(index);
|
| 178 |
-
var $image = $tile.find('.pic');
|
| 179 |
-
|
| 180 |
-
var tSize = $tile.data('size');
|
| 181 |
-
var iSize = $image.data('size');
|
| 182 |
-
|
| 183 |
-
|
| 184 |
-
var tRatio = tSize.width / tSize.height;
|
| 185 |
-
var iRatio = iSize.width / iSize.height;
|
| 186 |
-
|
| 187 |
-
var valign = $image.data('valign') ? $image.data('valign') : 'middle';
|
| 188 |
-
var halign = $image.data('halign') ? $image.data('halign') : 'center';
|
| 189 |
-
|
| 190 |
-
var cssProps = {
|
| 191 |
-
top: 'auto',
|
| 192 |
-
bottom: 'auto',
|
| 193 |
-
left: 'auto',
|
| 194 |
-
right: 'auto',
|
| 195 |
-
width: 'auto',
|
| 196 |
-
height: 'auto',
|
| 197 |
-
margin: '0',
|
| 198 |
-
maxWidth: '999em'
|
| 199 |
-
};
|
| 200 |
-
|
| 201 |
-
if (tRatio > iRatio) {
|
| 202 |
-
cssProps.width = tSize.width;
|
| 203 |
-
cssProps.left = 0;
|
| 204 |
-
|
| 205 |
-
switch (valign) {
|
| 206 |
-
case 'top':
|
| 207 |
-
cssProps.top = 0;
|
| 208 |
-
break;
|
| 209 |
-
case 'middle':
|
| 210 |
-
cssProps.top = 0 - (tSize.width * (1 / iRatio) - tSize.height) / 2;
|
| 211 |
-
break;
|
| 212 |
-
case 'bottom':
|
| 213 |
-
cssProps.bottom = 0;
|
| 214 |
-
break;
|
| 215 |
-
}
|
| 216 |
-
|
| 217 |
-
} else {
|
| 218 |
-
|
| 219 |
-
cssProps.height = tSize.height;
|
| 220 |
-
cssProps.top = 0;
|
| 221 |
-
|
| 222 |
-
switch (halign) {
|
| 223 |
-
case 'left':
|
| 224 |
-
cssProps.left = 0;
|
| 225 |
-
break;
|
| 226 |
-
case 'center':
|
| 227 |
-
cssProps.left = 0 - (tSize.height * iRatio - tSize.width) / 2;
|
| 228 |
-
break;
|
| 229 |
-
case 'right':
|
| 230 |
-
cssProps.right = 0;
|
| 231 |
-
break;
|
| 232 |
-
}
|
| 233 |
-
}
|
| 234 |
-
|
| 235 |
-
$image.css(cssProps);
|
| 236 |
-
}
|
| 237 |
-
|
| 238 |
-
Plugin.prototype.loadImage = function (index) {
|
| 239 |
-
var instance = this;
|
| 240 |
-
var source = instance.$items.eq(index).find('.pic');
|
| 241 |
-
var img = new Image();
|
| 242 |
-
img.onerror = function () {
|
| 243 |
-
console.log("error loading image [" + index + "] : " + this.src);
|
| 244 |
-
if (index + 1 < instance.$items.length)
|
| 245 |
-
instance.loadImage(index + 1);
|
| 246 |
-
}
|
| 247 |
-
img.onload = function () {
|
| 248 |
-
source.data('size', { width: this.width, height: this.height });
|
| 249 |
-
instance.placeImage(index);
|
| 250 |
-
|
| 251 |
-
instance.$items.eq(index).addClass("tg-loaded");
|
| 252 |
-
if (index + 1 < instance.$items.length)
|
| 253 |
-
instance.loadImage(index + 1);
|
| 254 |
-
}
|
| 255 |
-
|
| 256 |
-
var original_src = source.data('src');
|
| 257 |
-
img.src = original_src;
|
| 258 |
-
source.attr("src", original_src);
|
| 259 |
-
}
|
| 260 |
-
|
| 261 |
-
Plugin.prototype.setupFilters = function () {
|
| 262 |
-
|
| 263 |
-
var filterClick = $('#filterClick').val();
|
| 264 |
-
var instance = this;
|
| 265 |
-
instance.$element.delegate(".filters a", "click", function (e) {
|
| 266 |
-
if(filterClick != "T")
|
| 267 |
-
{
|
| 268 |
-
e.preventDefault();
|
| 269 |
-
}
|
| 270 |
-
|
| 271 |
-
if($(this).hasClass("selected"))
|
| 272 |
-
return;
|
| 273 |
-
|
| 274 |
-
instance.$element.find(".filters a").removeClass("selected");
|
| 275 |
-
$(this).addClass("selected");
|
| 276 |
-
|
| 277 |
-
var filter = $(this).attr("href").substr(1);
|
| 278 |
-
if (filter) {
|
| 279 |
-
instance.$items.removeClass('jtg-hidden');
|
| 280 |
-
instance.$items.show();
|
| 281 |
-
instance.$items.not("." + filter).addClass("jtg-hidden").hide();
|
| 282 |
-
} else {
|
| 283 |
-
instance.$items.removeClass('jtg-hidden');
|
| 284 |
-
instance.$items.show();
|
| 285 |
-
}
|
| 286 |
-
|
| 287 |
-
instance.reset();
|
| 288 |
-
});
|
| 289 |
-
};
|
| 290 |
-
|
| 291 |
-
Plugin.prototype.init = function () {
|
| 292 |
-
|
| 293 |
-
var instance = this;
|
| 294 |
-
|
| 295 |
-
var current_filter = tg_getURLParameter('jtg-filter');
|
| 296 |
-
|
| 297 |
-
if(current_filter != null)
|
| 298 |
-
{
|
| 299 |
-
instance.$element.find(".filters a").removeClass('selected');
|
| 300 |
-
instance.$element.find(".filters a").each(function(){
|
| 301 |
-
|
| 302 |
-
if($(this).data('filter') == current_filter)
|
| 303 |
-
{
|
| 304 |
-
$(this).addClass('selected');
|
| 305 |
-
}
|
| 306 |
-
})
|
| 307 |
-
}
|
| 308 |
-
|
| 309 |
-
var hash = window.location.hash;
|
| 310 |
-
|
| 311 |
-
this.$itemsCnt.css({
|
| 312 |
-
position: 'relative',
|
| 313 |
-
zIndex: 1
|
| 314 |
-
});
|
| 315 |
-
|
| 316 |
-
this.$items.addClass("tile");
|
| 317 |
-
this.$items.find(".pic").removeAttr("src");
|
| 318 |
-
|
| 319 |
-
if (this.options.width) {
|
| 320 |
-
this.$itemsCnt.width(this.options.width);
|
| 321 |
-
}
|
| 322 |
-
|
| 323 |
-
if (this.options.height) {
|
| 324 |
-
this.$itemsCnt.height(this.options.height);
|
| 325 |
-
}
|
| 326 |
-
|
| 327 |
-
this.$itemsCnt.data('area', this.$itemsCnt.width() * this.$itemsCnt.height());
|
| 328 |
-
|
| 329 |
-
this.lastWidth = this.$itemsCnt.width();
|
| 330 |
-
this.createGrid();
|
| 331 |
-
|
| 332 |
-
this.loadImage(0);
|
| 333 |
-
|
| 334 |
-
var instance = this;
|
| 335 |
-
$(window).resize(function () {
|
| 336 |
-
instance.onResize(instance);
|
| 337 |
-
});
|
| 338 |
-
|
| 339 |
-
this.setupFilters();
|
| 340 |
-
this.setupSocial();
|
| 341 |
-
|
| 342 |
-
if(this.options.onComplete)
|
| 343 |
-
this.options.onComplete();
|
| 344 |
-
|
| 345 |
-
if(hash != "" && hash != "#" && current_filter == null) {
|
| 346 |
-
var hash_class = hash.replace('#', '.');
|
| 347 |
-
|
| 348 |
-
var filters = [];
|
| 349 |
-
|
| 350 |
-
instance.$element.find(".filters a").each(function(){
|
| 351 |
-
filters.push($(this).attr('href'));
|
| 352 |
-
})
|
| 353 |
-
filters.shift();
|
| 354 |
-
|
| 355 |
-
$('.filters a').each(function() {
|
| 356 |
-
$(this).removeClass('selected');
|
| 357 |
-
if($(this).attr('href') == hash)
|
| 358 |
-
{
|
| 359 |
-
$(this).addClass('selected');
|
| 360 |
-
}
|
| 361 |
-
})
|
| 362 |
-
|
| 363 |
-
|
| 364 |
-
if( $.inArray(hash, filters) >= 0)
|
| 365 |
-
{
|
| 366 |
-
instance.$items.addClass('jtg-hidden').hide();
|
| 367 |
-
}
|
| 368 |
-
|
| 369 |
-
hash_class = hash_class.replace('.','');
|
| 370 |
-
instance.$items.each(function(){
|
| 371 |
-
if($(this).hasClass(hash_class))
|
| 372 |
-
{
|
| 373 |
-
$(this).removeClass('jtg-hidden');
|
| 374 |
-
$(this).show();
|
| 375 |
-
}
|
| 376 |
-
});
|
| 377 |
-
|
| 378 |
-
instance.reset();
|
| 379 |
-
}
|
| 380 |
-
};
|
| 381 |
-
|
| 382 |
-
Plugin.prototype.setupSocial = function () {
|
| 383 |
-
if (this.options.enableTwitter || this.options.enableFacebook ||
|
| 384 |
-
this.options.enableGplus || this.options.enablePinterest) {
|
| 385 |
-
|
| 386 |
-
this.$items.each(function (i, tile) {
|
| 387 |
-
var $tile = $(tile);
|
| 388 |
-
$tile.append("<div class='jtg-social' />");
|
| 389 |
-
});
|
| 390 |
-
}
|
| 391 |
-
|
| 392 |
-
if (this.options.enableTwitter)
|
| 393 |
-
setupTwitter(this.$items, this);
|
| 394 |
-
if (this.options.enableFacebook)
|
| 395 |
-
setupFacebook(this.$items, this);
|
| 396 |
-
if (this.options.enableGplus)
|
| 397 |
-
setupGplus(this.$items, this);
|
| 398 |
-
if (this.options.enablePinterest)
|
| 399 |
-
setupPinterest(this.$items, this);
|
| 400 |
-
}
|
| 401 |
-
|
| 402 |
-
var addSocialIcon = function ($tiles, cssClass, name) {
|
| 403 |
-
$tiles.find(".jtg-social").each(function (i, tile) {
|
| 404 |
-
var $tile = $(tile);
|
| 405 |
-
|
| 406 |
-
var tw = $("<a class='" + cssClass + "' href='#'></a>");
|
| 407 |
-
$tile.append(tw);
|
| 408 |
-
});
|
| 409 |
-
}
|
| 410 |
-
|
| 411 |
-
//credits James Padolsey http://james.padolsey.com/
|
| 412 |
-
var qualifyURL = function (url) {
|
| 413 |
-
var img = document.createElement('img');
|
| 414 |
-
img.src = url; // set string url
|
| 415 |
-
url = img.src; // get qualified url
|
| 416 |
-
img.src = null; // no server request
|
| 417 |
-
return url;
|
| 418 |
-
}
|
| 419 |
-
|
| 420 |
-
var setupTwitter = function ($tiles, plugin) {
|
| 421 |
-
addSocialIcon($tiles, "icon modula-icon-twitter", "Twitter");
|
| 422 |
-
$tiles.find(".modula-icon-twitter").click(function (e) {
|
| 423 |
-
e.preventDefault();
|
| 424 |
-
var $caption = $(this).parents(".tile:first").find(".caption");
|
| 425 |
-
var text = plugin.options.twitterText || document.title;
|
| 426 |
-
if (!plugin.options.twitterText && $caption.length == 1 && $caption.text().length > 0)
|
| 427 |
-
text = $.trim($caption.text());
|
| 428 |
-
var w = window.open("https://twitter.com/intent/tweet?url=" + encodeURI(location.href.split('#')[0]) + "&text=" + encodeURI(text), "ftgw", "location=1,status=1,scrollbars=1,width=600,height=400");
|
| 429 |
-
w.moveTo((screen.width / 2) - (300), (screen.height / 2) - (200));
|
| 430 |
-
return false;
|
| 431 |
-
});
|
| 432 |
-
}
|
| 433 |
-
|
| 434 |
-
var setupFacebook = function ($tiles, plugin) {
|
| 435 |
-
addSocialIcon($tiles, "icon modula-icon-facebook", "Facebook");
|
| 436 |
-
$tiles.find(".modula-icon-facebook").click(function (e) {
|
| 437 |
-
e.preventDefault();
|
| 438 |
-
|
| 439 |
-
var image = $(this).parents(".tile:first").find(".pic");
|
| 440 |
-
|
| 441 |
-
var $caption = $(this).parents(".tile:first").find(".caption");
|
| 442 |
-
var text = plugin.options.facebookText || document.title;
|
| 443 |
-
if (!plugin.options.facebookText && $caption.length == 1 && $caption.text().length > 0)
|
| 444 |
-
text = $.trim($caption.text());
|
| 445 |
-
|
| 446 |
-
var src = image.attr("src");
|
| 447 |
-
var url = "https://www.facebook.com/dialog/feed?app_id=1614610388804595&"+
|
| 448 |
-
"link="+encodeURIComponent(location.href)+"&" +
|
| 449 |
-
"display=popup&"+
|
| 450 |
-
"name="+encodeURIComponent(document.title)+"&"+
|
| 451 |
-
"caption=&"+
|
| 452 |
-
"description="+encodeURIComponent(text)+"&"+
|
| 453 |
-
"picture="+encodeUR
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
