Gallery – Photo Gallery – Image Gallery

Version Description

Added notification for Modula 2.0
Added Compatibility with AO

Release Info

Developer	machothemes
Plugin	Gallery – Photo Gallery – Image Gallery
Version	1.3.3
Comparing to
See all releases

Code changes from version 1.3.2 to 1.3.3

Files changed (54) hide show

Modula.php +156 -5
README.txt +21 -1
admin/css/materialdesignicons.css +0 -0
admin/fancybox/jquery.fancybox.css +771 -0
admin/fancybox/jquery.fancybox.js +5629 -0
admin/fancybox/jquery.fancybox.min.css +1 -0
admin/fancybox/jquery.fancybox.min.js +13 -0
admin/font/material-design-icons/license.txt +0 -0
admin/font/material-design-icons/materialdesignicons-webfont.eot +0 -0
admin/font/material-design-icons/materialdesignicons-webfont.svg +0 -0
admin/font/material-design-icons/materialdesignicons-webfont.ttf +0 -0
admin/font/material-design-icons/materialdesignicons-webfont.woff +0 -0
admin/font/material-design-icons/materialdesignicons-webfont.woff2 +0 -0
admin/font/roboto/Roboto-Bold-webfont.eot +0 -0
admin/font/roboto/Roboto-Bold-webfont.svg +0 -0
admin/font/roboto/Roboto-Bold-webfont.ttf +0 -0
admin/font/roboto/Roboto-Bold-webfont.woff +0 -0
admin/font/roboto/Roboto-Light-webfont.eot +0 -0
admin/font/roboto/Roboto-Light-webfont.svg +0 -0
admin/font/roboto/Roboto-Light-webfont.ttf +0 -0
admin/font/roboto/Roboto-Light-webfont.woff +0 -0
admin/font/roboto/Roboto-Regular-webfont.eot +0 -0
admin/font/roboto/Roboto-Regular-webfont.svg +0 -0
admin/font/roboto/Roboto-Regular-webfont.ttf +0 -0
admin/font/roboto/Roboto-Regular-webfont.woff +0 -0
admin/images/captions-settings.jpg +0 -0
admin/images/creative-gallery-settings.jpg +0 -0
admin/images/custom-grid-settings.jpg +0 -0
admin/images/customizations-settings.jpg +0 -0
admin/images/drag-and-drop-upload.jpg +0 -0
admin/images/galleries-list.jpg +0 -0
admin/images/gallery-edit.jpg +0 -0
admin/images/helper-grid.jpg +0 -0
admin/images/hover-effects-settings.jpg +0 -0
admin/images/landscape-portrait.jpg +0 -0
admin/images/live-preview.jpg +0 -0
admin/images/loading-effects-settings.jpg +0 -0
admin/images/modula-v2-custom-grid.png +0 -0
admin/images/modula-v2-drag-and-drop-upload.png +0 -0
admin/images/modula-v2-familiar-dashboard.png +0 -0
admin/images/modula-v2-helper-grid.png +0 -0
admin/images/modula-v2-intuitive-settings.png +0 -0
admin/images/modula-v2-landscape-or-portrait.png +0 -0
admin/images/modula-v2-live-preview.png +0 -0
admin/images/modula.svg +48 -0
admin/images/social-settings.jpg +0 -0
admin/images/style-settings.jpg +0 -0
admin/modula-v2.php +99 -0
admin/welcome-screen/sections/modula-v2.php +11 -0
lib/class-modula-plugin-rollback.php +71 -0
lib/class-modula-review.php +177 -0
lib/class-modula-rollback.php +178 -0
lib/install-db.php +1 -3
scripts/rollback.js +11 -0

Modula.php CHANGED Viewed

@@ -5,13 +5,18 @@
              * Description: Modula is one of the best & most creative WordPress gallery plugins. Use it to create a great grid or
              * masonry image gallery.
              * Author: Macho Themes
-            -
             * Version: 1.3.2
              * Author URI: https://www.machothemes.com/
              */
             define( 'MODULA_PLUGIN_DIR_PATH', plugin_dir_path( __FILE__ ) );
             define( 'MODULA_PLUGIN_DIR_URL', plugin_dir_url( __FILE__ ) );
             function modula_lite_create_db_tables() {
             	include_once( WP_PLUGIN_DIR . '/modula-best-grid-gallery/lib/install-db.php' );
             	modula_lite_install_db();
@@ -23,7 +28,7 @@ if ( ! class_exists( "ModulaLite" ) ) {
             		private $loadedData;
             		private $fields = array();
-            -
            		private $version = "1.3.2";
             		private $defaultValues = array(
             			'width'            => 100,
@@ -109,6 +114,9 @@ if ( ! class_exists( "ModulaLite" ) ) {
             			add_filter( 'plugin_row_meta', array( $this, 'register_links' ), 10, 2 );
             			add_filter( 'admin_footer_text', array( $this, 'admin_footer' ), 1, 2 );
             			// Set fields
             			$this->fields[ __( 'General', 'modula-gallery' ) ] = array(
@@ -454,6 +462,17 @@ if ( ! class_exists( "ModulaLite" ) ) {
+            		}
             		//Define textdomain
             		public function create_textdomain() {
             			$plugin_dir = basename( dirname( __FILE__ ) );
@@ -875,6 +894,10 @@ if ( ! class_exists( "ModulaLite" ) ) {
             				$this,
             				'upgrade',
             			) );
             			add_action( 'load-' . $overview, array( $this, 'gallery_admin_init' ) );
@@ -897,6 +920,10 @@ if ( ! class_exists( "ModulaLite" ) ) {
             			include( "admin/add-gallery.php" );
+            		}
             		public function fix() {
             			global $wpdb;
             			include( "admin/fix.php" );
@@ -1252,8 +1279,9 @@ class ModulaLiteTools {
             			$metadata = wp_get_attachment_metadata( $img->imageId );
             			if ( $img->imageId > 0 ) {
-            -
            				$wpdata   = get_post( $img->imageId );
-            -
            				$baseurl  = str_replace( basename( $wpdata->guid ), "", $wpdata->guid );
             				$res_name = ModulaLiteTools::resize_image( $img->imageId, $size );
             				if ( ! ( array_key_exists( "image_meta", $metadata ) && array_key_exists( "resized_images", $metadata["image_meta"] ) && in_array( $size . "x" . $size, $metadata["image_meta"]["resized_images"] ) ) ) {
@@ -1278,4 +1306,127 @@ if ( class_exists( "ModulaLite" ) ) {
             	global $ob_ModulaLite;
             	$ob_ModulaLite = new ModulaLite();
+            }
-            -
            ?>


5	* Description: Modula is one of the best & most creative WordPress gallery plugins. Use it to create a great grid or
6	* masonry image gallery.
7	* Author: Macho Themes
8	+ * Version: 1.3.3
9	* Author URI: https://www.machothemes.com/
10	*/
11
12	define( 'MODULA_PLUGIN_DIR_PATH', plugin_dir_path( __FILE__ ) );
13	define( 'MODULA_PLUGIN_DIR_URL', plugin_dir_url( __FILE__ ) );
14
15	+ define( 'MODULA_VERSION', '1.3.3' );
16	+ define( 'MODULA_PLUGIN_BASE', plugin_basename( __FILE__ ) );
17	+ define( 'MODULA_PREVIOUS_PLUGIN_VERSION', '1.3.2' );
18	+ define( 'MODULA_FILE_', __FILE__ );
19	+
20	function modula_lite_create_db_tables() {
21	include_once( WP_PLUGIN_DIR . '/modula-best-grid-gallery/lib/install-db.php' );
22	modula_lite_install_db();

28	private $loadedData;
29	private $fields = array();
30
31	+ private $version = "1.3.3";
32
33	private $defaultValues = array(
34	'width' => 100,

114	add_filter( 'plugin_row_meta', array( $this, 'register_links' ), 10, 2 );
115	add_filter( 'admin_footer_text', array( $this, 'admin_footer' ), 1, 2 );
116
117	+ // Enqueue Fancybox for Modula 2.0 Page
118	+ add_action( 'admin_enqueue_scripts', array( $this, 'modula_beta_scripts' ) );
119	+
120
121	// Set fields
122	$this->fields[ __( 'General', 'modula-gallery' ) ] = array(

462
463	}
464
465	+ public function modula_beta_scripts( $hook ) {
466	+
467	+ if ( 'modula_page_modula-lite-gallery-v2' != $hook ) {
468	+ return;
469	+ }
470	+
471	+ wp_enqueue_script( 'modula-fancybox', plugins_url() . '/modula-best-grid-gallery/admin/fancybox/jquery.fancybox.min.js', array( 'jquery' ) );
472	+ wp_enqueue_style( 'modula-fancybox', plugins_url() . '/modula-best-grid-gallery/admin/fancybox/jquery.fancybox.min.css' );
473	+
474	+ }
475	+
476	//Define textdomain
477	public function create_textdomain() {
478	$plugin_dir = basename( dirname( __FILE__ ) );

894	$this,
895	'upgrade',
896	) );
897	+ $v2 = add_submenu_page( 'modula-lite-admin', __( 'Try Modula 2.0', 'modula-gallery' ), __( 'Try Modula 2.0', 'modula-gallery' ), 'edit_posts', 'modula-lite-gallery-v2', array(
898	+ $this,
899	+ 'new_modula',
900	+ ) );
901
902
903	add_action( 'load-' . $overview, array( $this, 'gallery_admin_init' ) );

920	include( "admin/add-gallery.php" );
921	}
922
923	+ public function new_modula() {
924	+ include( "admin/modula-v2.php" );
925	+ }
926	+
927	public function fix() {
928	global $wpdb;
929	include( "admin/fix.php" );

1279	$metadata = wp_get_attachment_metadata( $img->imageId );
1280
1281	if ( $img->imageId > 0 ) {
1282	+ $uploads = wp_get_upload_dir();
1283	+ $file = get_post_meta( $img->imageId, '_wp_attached_file', true );
1284	+ $baseurl = $uploads['baseurl'] . '/' . str_replace( basename( $file ), "", $file );
1285	$res_name = ModulaLiteTools::resize_image( $img->imageId, $size );
1286
1287	if ( ! ( array_key_exists( "image_meta", $metadata ) && array_key_exists( "resized_images", $metadata["image_meta"] ) && in_array( $size . "x" . $size, $metadata["image_meta"]["resized_images"] ) ) ) {

1306	global $ob_ModulaLite;
1307	$ob_ModulaLite = new ModulaLite();
1308	}
1309	+
1310	+ function modula_lite_check_for_review() {
1311	+
1312	+ if ( ! is_admin() ) {
1313	+ return;
1314	+ }
1315	+
1316	+ require_once MODULA_PLUGIN_DIR_PATH . 'lib/class-modula-review.php';
1317	+
1318	+ Modula_Review::get_instance( array(
1319	+ 'slug' => 'modula-best-grid-gallery',
1320	+ 'messages' => array(
1321	+ 'notice' => __( "Hey, I noticed you have created %s galleries - that's awesome! Could you please do me a BIG favor and give it a 5-star rating on WordPress? Just to help us spread the word and boost our motivation.<br><br><strong>~ Cristian Raiber</strong>,<br><strong>CEO Modula</strong>.", 'modula-gallery' ),
1322	+ 'rate' => __( 'Ok, you deserve it', 'modula-gallery' ),
1323	+ 'rated' => __( 'I already did', 'modula-gallery' ),
1324	+ 'no_rate' => __( 'No, not good enough', 'modula-gallery' ),
1325	+ ),
1326	+ ) );
1327	+
1328	+ }
1329	+ modula_lite_check_for_review();
1330	+
1331	+ // Add compatibility with AO
1332	+ add_filter('autoptimize_filter_js_exclude','modula_lite_override_jsexclude',90,1);
1333	+ function modula_lite_override_jsexclude( $exclude ) {
1334	+ if ( is_array( $exclude ) ) {
1335	+ $exclude[] = 'jquery.modula.js';
1336	+ }else{
1337	+ $exclude .= ", jquery.modula.js";
1338	+ }
1339	+ return $exclude;
1340	+ }
1341	+
1342	+ // Beta Testing.
1343	+ add_action( 'admin_notices', 'modula_beta_notices' );
1344	+ add_action( 'wp_ajax_modula_beta_testing', 'modula_beta_ajax' );
1345	+ add_action( 'admin_print_footer_scripts', 'modula_beta_ajax_script', 99 );
1346	+
1347	+ function modula_beta_notices() {
1348	+
1349	+ $options = get_option( 'modula-checks', array() );
1350	+
1351	+ if ( isset( $options['beta-testing'] ) ) {
1352	+ return;
1353	+ }
1354	+ ?>
1355	+ <style type="text/css">
1356	+ #modula-beta-testing-info {
1357	+ display: inline-block;
1358	+ margin-left: 15px;
1359	+ }
1360	+ </style>
1361	+ <div id="modula-beta-testing" class="notice notice-success is-dismissible">
1362	+ <h3>Try Modula 2.0 !!</h3>
1363	+ <p>We’ve been working on an awesome update to Modula over the last few months and can’t wait to release it to the public. But, before that can happen, we need the help of amazing users in the WordPress community (just like you) to improve Modula 2.0’s first beta.</p>
1364	+ <p class="actions">
1365	+ <a id="modula-beta-testing-dwn" href="https://machothemes.com/downloads/modula-2.0.0.zip" target="_blank" class="button button-primary modula-beta-testing-button"><?php echo __( 'Download Modula 2.0 Beta', 'modula-gallery' ); ?></a>
1366	+ <a id="modula-beta-testing-info" href="<?php echo admin_url( 'admin.php?page=modula-lite-gallery-v2' ) ?>" target="_blank" class="modula-beta-testing-button"><?php echo __( 'Find more', 'modula-gallery' ); ?></a>
1367	+ </p>
1368	+ </div>
1369	+ <?php
1370	+ }
1371	+
1372	+ function modula_beta_ajax() {
1373	+
1374	+ check_ajax_referer( 'modula-beta-testing', 'security' );
1375	+
1376	+ $options = get_option( 'modula-checks', array() );
1377	+ $options['beta-testing'] = 1;
1378	+
1379	+ update_option( 'modula-checks', $options );
1380	+
1381	+ wp_die( 'ok' );
1382	+
1383	+ }
1384	+
1385	+ function modula_beta_ajax_script() {
1386	+
1387	+ $ajax_nonce = wp_create_nonce( "modula-beta-testing" );
1388	+
1389	+ ?>
1390	+
1391	+ <script type="text/javascript">
1392	+ jQuery( document ).ready( function( $ ){
1393	+
1394	+ $( '.modula-beta-testing-button' ).click( function( evt ){
1395	+ var href = $(this).attr('href'),
1396	+ id = $(this).attr('id');
1397	+
1398	+ var data = {
1399	+ action: 'modula_beta_testing',
1400	+ security: '<?php echo $ajax_nonce; ?>',
1401	+ };
1402	+
1403	+ $.post( '<?php echo admin_url( 'admin-ajax.php' ) ?>', data, function( response ) {
1404	+ $( '#modula-beta-testing' ).slideUp( 'fast', function() {
1405	+ $( this ).remove();
1406	+ } );
1407	+ });
1408	+
1409	+ } );
1410	+
1411	+ });
1412	+ </script>
1413	+
1414	+ <?php
1415	+ }
1416	+
1417	+ /* RollBack functionality */
1418	+ require MODULA_PLUGIN_DIR_PATH . '/lib/class-modula-plugin-rollback.php';
1419	+ require MODULA_PLUGIN_DIR_PATH . '/lib/class-modula-rollback.php';
1420	+
1421	+ /**
1422	+ * Insert Rollback link for plugin in plugins page
1423	+ */
1424	+
1425	+ function modula_lite_rollback_link( $links ) {
1426	+
1427	+ $links['rollback'] = sprintf( '<a href="%s" class="modula-rollback-button">%s</a>', wp_nonce_url( admin_url( 'admin-post.php?action=modula_rollback' ), 'modula_rollback' ), __( 'Rollback version', 'modula-gallery' ) );
1428	+
1429	+ return $links;
1430	+ }
1431	+
1432	+ add_action( 'plugin_action_links_' . plugin_basename( __FILE__ ), 'modula_lite_rollback_link' );

README.txt CHANGED Viewed

	@@ -3,7 +3,7 @@ Contributors: machothemes, silkalns
3	Tags: best gallery plugin, image gallery, photo gallery, responsive gallery, wordpress gallery plugin, wordpress portfolio plugin, masonry gallery, fancy gallery, media gallery, mosaic gallery, polaroid gallery, portfolio gallery
4	Requires at least: 3.8
5	Tested up to: 4.9
6	- Stable tag: 1.3.2
7	License: GPLv3 or later
8	License URI: http://www.gnu.org/licenses/gpl-3.0.html
9
	@@ -13,6 +13,14 @@ Photo Gallery by Modula - an advanced solution for Photo Gallery users. Create b
13
14	Modula Image Gallery is a creative and original WordPress plugin perfect for creating custom, unique, and responsive image galleries. Modula is available in both a Lite/free version and a premium version and it is currently the easiest and fastest photo gallery plugin for WordPress. Directly from its dashboard you are able to build stunning galleries in a few seconds, unlike many other WordPress plugins.
15








16	= See a 60s video of Modula in action =
17
18	https://www.youtube.com/watch?v=tq8yUYxgtnA
	@@ -135,6 +143,14 @@ If you get blurry and pixellated images then you need to raise the "Minimum imag
135
136	The PRO license bundles 6 different lightboxes. However you can use any other lightbox you want also with the Lite license. If you have installed a lightbox plugin then you just need to select "Direct link to image" in the "Lightbox" settings.
137








138	= How can I get support? =
139
140	Free support is included only with a PRO license: [Buy Modula PRO](https://wp-modula.com/#buy "Buy Modula PRO")
	@@ -157,6 +173,10 @@ Free support is included only with a PRO license: [Buy Modula PRO](https://wp-mo
157
158	== Changelog ==
159




160	= 1.3.2 =
161	* Validated HTML markup
162


3	Tags: best gallery plugin, image gallery, photo gallery, responsive gallery, wordpress gallery plugin, wordpress portfolio plugin, masonry gallery, fancy gallery, media gallery, mosaic gallery, polaroid gallery, portfolio gallery
4	Requires at least: 3.8
5	Tested up to: 4.9
6	+ Stable tag: 1.3.3
7	License: GPLv3 or later
8	License URI: http://www.gnu.org/licenses/gpl-3.0.html
9

13
14	Modula Image Gallery is a creative and original WordPress plugin perfect for creating custom, unique, and responsive image galleries. Modula is available in both a Lite/free version and a premium version and it is currently the easiest and fastest photo gallery plugin for WordPress. Directly from its dashboard you are able to build stunning galleries in a few seconds, unlike many other WordPress plugins.
15
16	+ = Try Modula 2.0 Beta =
17	+
18	+ We’ve been working on an awesome update to Modula over the last few months and can’t wait to release it to the public. But, before that can happen, we need the help of amazing users in the WordPress community (just like you) to improve Modula 2.0’s first beta. You can download our new plugin from <a href="https://machothemes.com/downloads/modula-2.0.0.zip" target="_blank">here</a>.
19	+
20	+ Below is a video that showcases the new features of Modula 2.0.
21	+
22	+ https://www.youtube.com/watch?v=NxrTXQNExh4
23	+
24	= See a 60s video of Modula in action =
25
26	https://www.youtube.com/watch?v=tq8yUYxgtnA

143
144	The PRO license bundles 6 different lightboxes. However you can use any other lightbox you want also with the Lite license. If you have installed a lightbox plugin then you just need to select "Direct link to image" in the "Lightbox" settings.
145
146	+ = How can I change the lightbox's background? =
147	+
148	+ You can change the lightbox popup background color using the following code:
149	+
150	+ `body .lg-backdrop {
151	+ background-color: white;
152	+ }`
153	+
154	= How can I get support? =
155
156	Free support is included only with a PRO license: [Buy Modula PRO](https://wp-modula.com/#buy "Buy Modula PRO")

173
174	== Changelog ==
175
176	+ = 1.3.3 =
177	+ * Added notification for Modula 2.0
178	+ * Added Compatibility with AO
179	+
180	= 1.3.2 =
181	* Validated HTML markup
182

admin/css/materialdesignicons.css CHANGED Viewed

File without changes

admin/fancybox/jquery.fancybox.css ADDED Viewed

	@@ -0,0 +1,771 @@


1	+ body.compensate-for-scrollbar {
2	+ overflow: hidden; }
3	+
4	+ .fancybox-active {
5	+ height: auto; }
6	+
7	+ .fancybox-is-hidden {
8	+ left: -9999px;
9	+ margin: 0;
10	+ position: absolute !important;
11	+ top: -9999px;
12	+ visibility: hidden; }
13	+
14	+ .fancybox-container {
15	+ -webkit-backface-visibility: hidden;
16	+ height: 100%;
17	+ left: 0;
18	+ outline: none;
19	+ position: fixed;
20	+ -webkit-tap-highlight-color: transparent;
21	+ top: 0;
22	+ -ms-touch-action: manipulation;
23	+ touch-action: manipulation;
24	+ -webkit-transform: translateZ(0);
25	+ transform: translateZ(0);
26	+ width: 100%;
27	+ z-index: 99992; }
28	+
29	+ .fancybox-container * {
30	+ box-sizing: border-box; }
31	+
32	+ .fancybox-outer,
33	+ .fancybox-inner,
34	+ .fancybox-bg,
35	+ .fancybox-stage {
36	+ bottom: 0;
37	+ left: 0;
38	+ position: absolute;
39	+ right: 0;
40	+ top: 0; }
41	+
42	+ .fancybox-outer {
43	+ -webkit-overflow-scrolling: touch;
44	+ overflow-y: auto; }
45	+
46	+ .fancybox-bg {
47	+ background: #1e1e1e;
48	+ opacity: 0;
49	+ transition-duration: inherit;
50	+ transition-property: opacity;
51	+ transition-timing-function: cubic-bezier(0.47, 0, 0.74, 0.71); }
52	+
53	+ .fancybox-is-open .fancybox-bg {
54	+ opacity: .9;
55	+ transition-timing-function: cubic-bezier(0.22, 0.61, 0.36, 1); }
56	+
57	+ .fancybox-infobar,
58	+ .fancybox-toolbar,
59	+ .fancybox-caption,
60	+ .fancybox-navigation .fancybox-button {
61	+ direction: ltr;
62	+ opacity: 0;
63	+ position: absolute;
64	+ transition: opacity .25s ease, visibility 0s ease .25s;
65	+ visibility: hidden;
66	+ z-index: 99997; }
67	+
68	+ .fancybox-show-infobar .fancybox-infobar,
69	+ .fancybox-show-toolbar .fancybox-toolbar,
70	+ .fancybox-show-caption .fancybox-caption,
71	+ .fancybox-show-nav .fancybox-navigation .fancybox-button {
72	+ opacity: 1;
73	+ transition: opacity .25s ease 0s, visibility 0s ease 0s;
74	+ visibility: visible; }
75	+
76	+ .fancybox-infobar {
77	+ color: #ccc;
78	+ font-size: 13px;
79	+ -webkit-font-smoothing: subpixel-antialiased;
80	+ height: 44px;
81	+ left: 0;
82	+ line-height: 44px;
83	+ min-width: 44px;
84	+ mix-blend-mode: difference;
85	+ padding: 0 10px;
86	+ pointer-events: none;
87	+ top: 0;
88	+ -webkit-touch-callout: none;
89	+ -webkit-user-select: none;
90	+ -moz-user-select: none;
91	+ -ms-user-select: none;
92	+ user-select: none; }
93	+
94	+ .fancybox-toolbar {
95	+ right: 0;
96	+ top: 0; }
97	+
98	+ .fancybox-stage {
99	+ direction: ltr;
100	+ overflow: visible;
101	+ -webkit-transform: translateZ(0);
102	+ transform: translateZ(0);
103	+ z-index: 99994; }
104	+
105	+ .fancybox-is-open .fancybox-stage {
106	+ overflow: hidden; }
107	+
108	+ .fancybox-slide {
109	+ -webkit-backface-visibility: hidden;
110	+ /* Using without prefix would break IE11 */
111	+ display: none;
112	+ height: 100%;
113	+ left: 0;
114	+ outline: none;
115	+ overflow: auto;
116	+ -webkit-overflow-scrolling: touch;
117	+ padding: 44px;
118	+ position: absolute;
119	+ text-align: center;
120	+ top: 0;
121	+ transition-property: opacity, -webkit-transform;
122	+ transition-property: transform, opacity;
123	+ transition-property: transform, opacity, -webkit-transform;
124	+ white-space: normal;
125	+ width: 100%;
126	+ z-index: 99994; }
127	+
128	+ .fancybox-slide::before {
129	+ content: '';
130	+ display: inline-block;
131	+ font-size: 0;
132	+ height: 100%;
133	+ vertical-align: middle;
134	+ width: 0; }
135	+
136	+ .fancybox-is-sliding .fancybox-slide,
137	+ .fancybox-slide--previous,
138	+ .fancybox-slide--current,
139	+ .fancybox-slide--next {
140	+ display: block; }
141	+
142	+ .fancybox-slide--image {
143	+ overflow: hidden;
144	+ padding: 44px 0; }
145	+
146	+ .fancybox-slide--image::before {
147	+ display: none; }
148	+
149	+ .fancybox-slide--html {
150	+ padding: 6px; }
151	+
152	+ .fancybox-content {
153	+ background: #fff;
154	+ display: inline-block;
155	+ margin: 0;
156	+ max-width: 100%;
157	+ overflow: auto;
158	+ -webkit-overflow-scrolling: touch;
159	+ padding: 44px;
160	+ position: relative;
161	+ text-align: left;
162	+ vertical-align: middle; }
163	+
164	+ .fancybox-slide--image .fancybox-content {
165	+ -webkit-animation-timing-function: cubic-bezier(0.5, 0, 0.14, 1);
166	+ animation-timing-function: cubic-bezier(0.5, 0, 0.14, 1);
167	+ -webkit-backface-visibility: hidden;
168	+ background: transparent;
169	+ background-repeat: no-repeat;
170	+ background-size: 100% 100%;
171	+ left: 0;
172	+ max-width: none;
173	+ overflow: visible;
174	+ padding: 0;
175	+ position: absolute;
176	+ top: 0;
177	+ -webkit-transform-origin: top left;
178	+ -ms-transform-origin: top left;
179	+ transform-origin: top left;
180	+ transition-property: opacity, -webkit-transform;
181	+ transition-property: transform, opacity;
182	+ transition-property: transform, opacity, -webkit-transform;
183	+ -webkit-user-select: none;
184	+ -moz-user-select: none;
185	+ -ms-user-select: none;
186	+ user-select: none;
187	+ z-index: 99995; }
188	+
189	+ .fancybox-can-zoomOut .fancybox-content {
190	+ cursor: -webkit-zoom-out;
191	+ cursor: zoom-out; }
192	+
193	+ .fancybox-can-zoomIn .fancybox-content {
194	+ cursor: -webkit-zoom-in;
195	+ cursor: zoom-in; }
196	+
197	+ .fancybox-can-swipe .fancybox-content,
198	+ .fancybox-can-pan .fancybox-content {
199	+ cursor: -webkit-grab;
200	+ cursor: grab; }
201	+
202	+ .fancybox-is-grabbing .fancybox-content {
203	+ cursor: -webkit-grabbing;
204	+ cursor: grabbing; }
205	+
206	+ .fancybox-container [data-selectable='true'] {
207	+ cursor: text; }
208	+
209	+ .fancybox-image,
210	+ .fancybox-spaceball {
211	+ background: transparent;
212	+ border: 0;
213	+ height: 100%;
214	+ left: 0;
215	+ margin: 0;
216	+ max-height: none;
217	+ max-width: none;
218	+ padding: 0;
219	+ position: absolute;
220	+ top: 0;
221	+ -webkit-user-select: none;
222	+ -moz-user-select: none;
223	+ -ms-user-select: none;
224	+ user-select: none;
225	+ width: 100%; }
226	+
227	+ .fancybox-spaceball {
228	+ z-index: 1; }
229	+
230	+ .fancybox-slide--video .fancybox-content,
231	+ .fancybox-slide--map .fancybox-content,
232	+ .fancybox-slide--pdf .fancybox-content,
233	+ .fancybox-slide--iframe .fancybox-content {
234	+ height: 100%;
235	+ overflow: visible;
236	+ padding: 0;
237	+ width: 100%; }
238	+
239	+ .fancybox-slide--video .fancybox-content {
240	+ background: #000; }
241	+
242	+ .fancybox-slide--map .fancybox-content {
243	+ background: #e5e3df; }
244	+
245	+ .fancybox-slide--iframe .fancybox-content {
246	+ background: #fff; }
247	+
248	+ .fancybox-video,
249	+ .fancybox-iframe {
250	+ background: transparent;
251	+ border: 0;
252	+ display: block;
253	+ height: 100%;
254	+ margin: 0;
255	+ overflow: hidden;
256	+ padding: 0;
257	+ width: 100%; }
258	+
259	+ /* Fix iOS */
260	+ .fancybox-iframe {
261	+ left: 0;
262	+ position: absolute;
263	+ top: 0; }
264	+
265	+ .fancybox-error {
266	+ background: #fff;
267	+ cursor: default;
268	+ max-width: 400px;
269	+ padding: 40px;
270	+ width: 100%; }
271	+
272	+ .fancybox-error p {
273	+ color: #444;
274	+ font-size: 16px;
275	+ line-height: 20px;
276	+ margin: 0;
277	+ padding: 0; }
278	+
279	+ /* Buttons */
280	+ .fancybox-button {
281	+ background: rgba(30, 30, 30, 0.6);
282	+ border: 0;
283	+ border-radius: 0;
284	+ box-shadow: none;
285	+ cursor: pointer;
286	+ display: inline-block;
287	+ height: 44px;
288	+ margin: 0;
289	+ padding: 10px;
290	+ position: relative;
291	+ transition: color .2s;
292	+ vertical-align: top;
293	+ visibility: inherit;
294	+ width: 44px; }
295	+
296	+ .fancybox-button,
297	+ .fancybox-button:visited,
298	+ .fancybox-button:link {
299	+ color: #ccc; }
300	+
301	+ .fancybox-button:hover {
302	+ color: #fff; }
303	+
304	+ .fancybox-button:focus {
305	+ outline: none; }
306	+
307	+ .fancybox-button.fancybox-focus {
308	+ outline: 1px dotted; }
309	+
310	+ .fancybox-button[disabled],
311	+ .fancybox-button[disabled]:hover {
312	+ color: #888;
313	+ cursor: default;
314	+ outline: none; }
315	+
316	+ /* Fix IE11 */
317	+ .fancybox-button div {
318	+ height: 100%; }
319	+
320	+ .fancybox-button svg {
321	+ display: block;
322	+ height: 100%;
323	+ overflow: visible;
324	+ position: relative;
325	+ width: 100%; }
326	+
327	+ .fancybox-button svg path {
328	+ fill: currentColor;
329	+ stroke-width: 0; }
330	+
331	+ .fancybox-button--play svg:nth-child(2),
332	+ .fancybox-button--fsenter svg:nth-child(2) {
333	+ display: none; }
334	+
335	+ .fancybox-button--pause svg:nth-child(1),
336	+ .fancybox-button--fsexit svg:nth-child(1) {
337	+ display: none; }
338	+
339	+ .fancybox-progress {
340	+ background: #ff5268;
341	+ height: 2px;
342	+ left: 0;
343	+ position: absolute;
344	+ right: 0;
345	+ top: 0;
346	+ -webkit-transform: scaleX(0);
347	+ -ms-transform: scaleX(0);
348	+ transform: scaleX(0);
349	+ -webkit-transform-origin: 0;
350	+ -ms-transform-origin: 0;
351	+ transform-origin: 0;
352	+ transition-property: -webkit-transform;
353	+ transition-property: transform;
354	+ transition-property: transform, -webkit-transform;
355	+ transition-timing-function: linear;
356	+ z-index: 99998; }
357	+
358	+ /* Close button on the top right corner of html content */
359	+ .fancybox-close-small {
360	+ background: transparent;
361	+ border: 0;
362	+ border-radius: 0;
363	+ color: #ccc;
364	+ cursor: pointer;
365	+ opacity: .8;
366	+ padding: 8px;
367	+ position: absolute;
368	+ right: -12px;
369	+ top: -44px;
370	+ z-index: 401; }
371	+
372	+ .fancybox-close-small:hover {
373	+ color: #fff;
374	+ opacity: 1; }
375	+
376	+ .fancybox-slide--html .fancybox-close-small {
377	+ color: currentColor;
378	+ padding: 10px;
379	+ right: 0;
380	+ top: 0; }
381	+
382	+ .fancybox-slide--image.fancybox-is-scaling .fancybox-content {
383	+ overflow: hidden; }
384	+
385	+ .fancybox-is-scaling .fancybox-close-small,
386	+ .fancybox-is-zoomable.fancybox-can-pan .fancybox-close-small {
387	+ display: none; }
388	+
389	+ /* Navigation arrows */
390	+ .fancybox-navigation .fancybox-button {
391	+ background-clip: content-box;
392	+ height: 100px;
393	+ opacity: 0;
394	+ position: absolute;
395	+ top: calc(50% - 50px);
396	+ width: 70px; }
397	+
398	+ .fancybox-navigation .fancybox-button div {
399	+ padding: 7px; }
400	+
401	+ .fancybox-navigation .fancybox-button--arrow_left {
402	+ left: 0;
403	+ padding: 31px 26px 31px 6px; }
404	+
405	+ .fancybox-navigation .fancybox-button--arrow_right {
406	+ padding: 31px 6px 31px 26px;
407	+ right: 0; }
408	+
409	+ /* Caption */
410	+ .fancybox-caption {
411	+ bottom: 0;
412	+ color: #eee;
413	+ font-size: 14px;
414	+ font-weight: 400;
415	+ left: 0;
416	+ line-height: 1.5;
417	+ padding: 25px 44px 25px 44px;
418	+ right: 0;
419	+ text-align: center;
420	+ z-index: 99996; }
421	+
422	+ .fancybox-caption::before {
423	+ background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAEAAAD6CAQAAADKSeXYAAAAYklEQVQoz42RwQ3AMAgDjfcfup8WoRykfBAK5mQHKSz5rbXJPis1hjiV3CIqgG0hLZPkVkA4p4x5oR1bVeDrdCLrW2Q0D5bcwY3TGMHbdw3mPRuOtaspYP1w//G1OIcW148H0DMCqI/3mMMAAAAASUVORK5CYII=);
424	+ background-repeat: repeat-x;
425	+ background-size: contain;
426	+ bottom: 0;
427	+ content: '';
428	+ display: block;
429	+ left: 0;
430	+ pointer-events: none;
431	+ position: absolute;
432	+ right: 0;
433	+ top: -44px;
434	+ z-index: -1; }
435	+
436	+ .fancybox-caption a,
437	+ .fancybox-caption a:link,
438	+ .fancybox-caption a:visited {
439	+ color: #ccc;
440	+ text-decoration: none; }
441	+
442	+ .fancybox-caption a:hover {
443	+ color: #fff;
444	+ text-decoration: underline; }
445	+
446	+ /* Loading indicator */
447	+ .fancybox-loading {
448	+ -webkit-animation: fancybox-rotate 1s linear infinite;
449	+ animation: fancybox-rotate 1s linear infinite;
450	+ background: transparent;
451	+ border: 4px solid #888;
452	+ border-bottom-color: #fff;
453	+ border-radius: 50%;
454	+ height: 50px;
455	+ left: 50%;
456	+ margin: -25px 0 0 -25px;
457	+ opacity: .7;
458	+ padding: 0;
459	+ position: absolute;
460	+ top: 50%;
461	+ width: 50px;
462	+ z-index: 99999; }
463	+
464	+ @-webkit-keyframes fancybox-rotate {
465	+ 100% {
466	+ -webkit-transform: rotate(360deg);
467	+ transform: rotate(360deg); } }
468	+
469	+ @keyframes fancybox-rotate {
470	+ 100% {
471	+ -webkit-transform: rotate(360deg);
472	+ transform: rotate(360deg); } }
473	+
474	+ /* Transition effects */
475	+ .fancybox-animated {
476	+ transition-timing-function: cubic-bezier(0, 0, 0.25, 1); }
477	+
478	+ /* transitionEffect: slide */
479	+ .fancybox-fx-slide.fancybox-slide--previous {
480	+ opacity: 0;
481	+ -webkit-transform: translate3d(-100%, 0, 0);
482	+ transform: translate3d(-100%, 0, 0); }
483	+
484	+ .fancybox-fx-slide.fancybox-slide--next {
485	+ opacity: 0;
486	+ -webkit-transform: translate3d(100%, 0, 0);
487	+ transform: translate3d(100%, 0, 0); }
488	+
489	+ .fancybox-fx-slide.fancybox-slide--current {
490	+ opacity: 1;
491	+ -webkit-transform: translate3d(0, 0, 0);
492	+ transform: translate3d(0, 0, 0); }
493	+
494	+ /* transitionEffect: fade */
495	+ .fancybox-fx-fade.fancybox-slide--previous,
496	+ .fancybox-fx-fade.fancybox-slide--next {
497	+ opacity: 0;
498	+ transition-timing-function: cubic-bezier(0.19, 1, 0.22, 1); }
499	+
500	+ .fancybox-fx-fade.fancybox-slide--current {
501	+ opacity: 1; }
502	+
503	+ /* transitionEffect: zoom-in-out */
504	+ .fancybox-fx-zoom-in-out.fancybox-slide--previous {
505	+ opacity: 0;
506	+ -webkit-transform: scale3d(1.5, 1.5, 1.5);
507	+ transform: scale3d(1.5, 1.5, 1.5); }
508	+
509	+ .fancybox-fx-zoom-in-out.fancybox-slide--next {
510	+ opacity: 0;
511	+ -webkit-transform: scale3d(0.5, 0.5, 0.5);
512	+ transform: scale3d(0.5, 0.5, 0.5); }
513	+
514	+ .fancybox-fx-zoom-in-out.fancybox-slide--current {
515	+ opacity: 1;
516	+ -webkit-transform: scale3d(1, 1, 1);
517	+ transform: scale3d(1, 1, 1); }
518	+
519	+ /* transitionEffect: rotate */
520	+ .fancybox-fx-rotate.fancybox-slide--previous {
521	+ opacity: 0;
522	+ -webkit-transform: rotate(-360deg);
523	+ -ms-transform: rotate(-360deg);
524	+ transform: rotate(-360deg); }
525	+
526	+ .fancybox-fx-rotate.fancybox-slide--next {
527	+ opacity: 0;
528	+ -webkit-transform: rotate(360deg);
529	+ -ms-transform: rotate(360deg);
530	+ transform: rotate(360deg); }
531	+
532	+ .fancybox-fx-rotate.fancybox-slide--current {
533	+ opacity: 1;
534	+ -webkit-transform: rotate(0deg);
535	+ -ms-transform: rotate(0deg);
536	+ transform: rotate(0deg); }
537	+
538	+ /* transitionEffect: circular */
539	+ .fancybox-fx-circular.fancybox-slide--previous {
540	+ opacity: 0;
541	+ -webkit-transform: scale3d(0, 0, 0) translate3d(-100%, 0, 0);
542	+ transform: scale3d(0, 0, 0) translate3d(-100%, 0, 0); }
543	+
544	+ .fancybox-fx-circular.fancybox-slide--next {
545	+ opacity: 0;
546	+ -webkit-transform: scale3d(0, 0, 0) translate3d(100%, 0, 0);
547	+ transform: scale3d(0, 0, 0) translate3d(100%, 0, 0); }
548	+
549	+ .fancybox-fx-circular.fancybox-slide--current {
550	+ opacity: 1;
551	+ -webkit-transform: scale3d(1, 1, 1) translate3d(0, 0, 0);
552	+ transform: scale3d(1, 1, 1) translate3d(0, 0, 0); }
553	+
554	+ /* transitionEffect: tube */
555	+ .fancybox-fx-tube.fancybox-slide--previous {
556	+ -webkit-transform: translate3d(-100%, 0, 0) scale(0.1) skew(-10deg);
557	+ transform: translate3d(-100%, 0, 0) scale(0.1) skew(-10deg); }
558	+
559	+ .fancybox-fx-tube.fancybox-slide--next {
560	+ -webkit-transform: translate3d(100%, 0, 0) scale(0.1) skew(10deg);
561	+ transform: translate3d(100%, 0, 0) scale(0.1) skew(10deg); }
562	+
563	+ .fancybox-fx-tube.fancybox-slide--current {
564	+ -webkit-transform: translate3d(0, 0, 0) scale(1);
565	+ transform: translate3d(0, 0, 0) scale(1); }
566	+
567	+ /* Styling for Small-Screen Devices */
568	+ @media all and (max-height: 576px) {
569	+ .fancybox-caption {
570	+ padding: 12px; }
571	+ .fancybox-slide {
572	+ padding-left: 6px;
573	+ padding-right: 6px; }
574	+ .fancybox-slide--image {
575	+ padding: 6px 0; }
576	+ .fancybox-close-small {
577	+ right: -6px; }
578	+ .fancybox-slide--image .fancybox-close-small {
579	+ background: #4e4e4e;
580	+ color: #f2f4f6;
581	+ height: 36px;
582	+ opacity: 1;
583	+ padding: 6px;
584	+ right: 0;
585	+ top: 0;
586	+ width: 36px; } }
587	+
588	+ /* Share */
589	+ .fancybox-share {
590	+ background: #f4f4f4;
591	+ border-radius: 3px;
592	+ max-width: 90%;
593	+ padding: 30px;
594	+ text-align: center; }
595	+
596	+ .fancybox-share h1 {
597	+ color: #222;
598	+ font-size: 35px;
599	+ font-weight: 700;
600	+ margin: 0 0 20px 0; }
601	+
602	+ .fancybox-share p {
603	+ margin: 0;
604	+ padding: 0; }
605	+
606	+ .fancybox-share__button {
607	+ border: 0;
608	+ border-radius: 3px;
609	+ display: inline-block;
610	+ font-size: 14px;
611	+ font-weight: 700;
612	+ line-height: 40px;
613	+ margin: 0 5px 10px 5px;
614	+ min-width: 130px;
615	+ padding: 0 15px;
616	+ text-decoration: none;
617	+ transition: all .2s;
618	+ -webkit-user-select: none;
619	+ -moz-user-select: none;
620	+ -ms-user-select: none;
621	+ user-select: none;
622	+ white-space: nowrap; }
623	+
624	+ .fancybox-share__button:visited,
625	+ .fancybox-share__button:link {
626	+ color: #fff; }
627	+
628	+ .fancybox-share__button:hover {
629	+ text-decoration: none; }
630	+
631	+ .fancybox-share__button--fb {
632	+ background: #3b5998; }
633	+
634	+ .fancybox-share__button--fb:hover {
635	+ background: #344e86; }
636	+
637	+ .fancybox-share__button--pt {
638	+ background: #bd081d; }
639	+
640	+ .fancybox-share__button--pt:hover {
641	+ background: #aa0719; }
642	+
643	+ .fancybox-share__button--tw {
644	+ background: #1da1f2; }
645	+
646	+ .fancybox-share__button--tw:hover {
647	+ background: #0d95e8; }
648	+
649	+ .fancybox-share__button svg {
650	+ height: 25px;
651	+ margin-right: 7px;
652	+ position: relative;
653	+ top: -1px;
654	+ vertical-align: middle;
655	+ width: 25px; }
656	+
657	+ .fancybox-share__button svg path {
658	+ fill: #fff; }
659	+
660	+ .fancybox-share__input {
661	+ background: transparent;
662	+ border: 0;
663	+ border-bottom: 1px solid #d7d7d7;
664	+ border-radius: 0;
665	+ color: #5d5b5b;
666	+ font-size: 14px;
667	+ margin: 10px 0 0 0;
668	+ outline: none;
669	+ padding: 10px 15px;
670	+ width: 100%; }
671	+
672	+ /* Thumbs */
673	+ .fancybox-thumbs {
674	+ background: #ddd;
675	+ bottom: 0;
676	+ display: none;
677	+ margin: 0;
678	+ -webkit-overflow-scrolling: touch;
679	+ -ms-overflow-style: -ms-autohiding-scrollbar;
680	+ padding: 2px 2px 4px 2px;
681	+ position: absolute;
682	+ right: 0;
683	+ -webkit-tap-highlight-color: transparent;
684	+ top: 0;
685	+ width: 212px;
686	+ z-index: 99995; }
687	+
688	+ .fancybox-thumbs-x {
689	+ overflow-x: auto;
690	+ overflow-y: hidden; }
691	+
692	+ .fancybox-show-thumbs .fancybox-thumbs {
693	+ display: block; }
694	+
695	+ .fancybox-show-thumbs .fancybox-inner {
696	+ right: 212px; }
697	+
698	+ .fancybox-thumbs__list {
699	+ font-size: 0;
700	+ height: 100%;
701	+ list-style: none;
702	+ margin: 0;
703	+ overflow-x: hidden;
704	+ overflow-y: auto;
705	+ padding: 0;
706	+ position: absolute;
707	+ position: relative;
708	+ white-space: nowrap;
709	+ width: 100%; }
710	+
711	+ .fancybox-thumbs-x .fancybox-thumbs__list {
712	+ overflow: hidden; }
713	+
714	+ .fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar {
715	+ width: 7px; }
716	+
717	+ .fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar-track {
718	+ background: #fff;
719	+ border-radius: 10px;
720	+ box-shadow: inset 0 0 6px rgba(0, 0, 0, 0.3); }
721	+
722	+ .fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar-thumb {
723	+ background: #2a2a2a;
724	+ border-radius: 10px; }
725	+
726	+ .fancybox-thumbs__list a {
727	+ -webkit-backface-visibility: hidden;
728	+ backface-visibility: hidden;
729	+ background-color: rgba(0, 0, 0, 0.1);
730	+ background-position: center center;
731	+ background-repeat: no-repeat;
732	+ background-size: cover;
733	+ cursor: pointer;
734	+ float: left;
735	+ height: 75px;
736	+ margin: 2px;
737	+ max-height: calc(100% - 8px);
738	+ max-width: calc(50% - 4px);
739	+ outline: none;
740	+ overflow: hidden;
741	+ padding: 0;
742	+ position: relative;
743	+ -webkit-tap-highlight-color: transparent;
744	+ width: 100px; }
745	+
746	+ .fancybox-thumbs__list a::before {
747	+ border: 6px solid #ff5268;
748	+ bottom: 0;
749	+ content: '';
750	+ left: 0;
751	+ opacity: 0;
752	+ position: absolute;
753	+ right: 0;
754	+ top: 0;
755	+ transition: all 0.2s cubic-bezier(0.25, 0.46, 0.45, 0.94);
756	+ z-index: 99991; }
757	+
758	+ .fancybox-thumbs__list a:focus::before {
759	+ opacity: .5; }
760	+
761	+ .fancybox-thumbs__list a.fancybox-thumbs-active::before {
762	+ opacity: 1; }
763	+
764	+ /* Styling for Small-Screen Devices */
765	+ @media all and (max-width: 576px) {
766	+ .fancybox-thumbs {
767	+ width: 110px; }
768	+ .fancybox-show-thumbs .fancybox-inner {
769	+ right: 110px; }
770	+ .fancybox-thumbs__list a {
771	+ max-width: calc(100% - 10px); } }

admin/fancybox/jquery.fancybox.js ADDED Viewed

	@@ -0,0 +1,5629 @@


1	+ // ==================================================
2	+ // fancyBox v3.5.2
3	+ //
4	+ // Licensed GPLv3 for open source use
5	+ // or fancyBox Commercial License for commercial use
6	+ //
7	+ // http://fancyapps.com/fancybox/
8	+ // Copyright 2018 fancyApps
9	+ //
10	+ // ==================================================
11	+ (function(window, document, $, undefined) {
12	+ "use strict";
13	+
14	+ window.console = window.console \|\| {
15	+ info: function(stuff) {}
16	+ };
17	+
18	+ // If there's no jQuery, fancyBox can't work
19	+ // =========================================
20	+
21	+ if (!$) {
22	+ return;
23	+ }
24	+
25	+ // Check if fancyBox is already initialized
26	+ // ========================================
27	+
28	+ if ($.fn.fancybox) {
29	+ console.info("fancyBox already initialized");
30	+
31	+ return;
32	+ }
33	+
34	+ // Private default settings
35	+ // ========================
36	+
37	+ var defaults = {
38	+ // Close existing modals
39	+ // Set this to false if you do not need to stack multiple instances
40	+ closeExisting: false,
41	+
42	+ // Enable infinite gallery navigation
43	+ loop: false,
44	+
45	+ // Horizontal space between slides
46	+ gutter: 50,
47	+
48	+ // Enable keyboard navigation
49	+ keyboard: true,
50	+
51	+ // Should allow caption to overlap the content
52	+ preventCaptionOverlap: true,
53	+
54	+ // Should display navigation arrows at the screen edges
55	+ arrows: true,
56	+
57	+ // Should display counter at the top left corner
58	+ infobar: true,
59	+
60	+ // Should display close button (using `btnTpl.smallBtn` template) over the content
61	+ // Can be true, false, "auto"
62	+ // If "auto" - will be automatically enabled for "html", "inline" or "ajax" items
63	+ smallBtn: "auto",
64	+
65	+ // Should display toolbar (buttons at the top)
66	+ // Can be true, false, "auto"
67	+ // If "auto" - will be automatically hidden if "smallBtn" is enabled
68	+ toolbar: "auto",
69	+
70	+ // What buttons should appear in the top right corner.
71	+ // Buttons will be created using templates from `btnTpl` option
72	+ // and they will be placed into toolbar (class="fancybox-toolbar"` element)
73	+ buttons: [
74	+ "zoom",
75	+ //"share",
76	+ "slideShow",
77	+ //"fullScreen",
78	+ //"download",
79	+ "thumbs",
80	+ "close"
81	+ ],
82	+
83	+ // Detect "idle" time in seconds
84	+ idleTime: 3,
85	+
86	+ // Disable right-click and use simple image protection for images
87	+ protect: false,
88	+
89	+ // Shortcut to make content "modal" - disable keyboard navigtion, hide buttons, etc
90	+ modal: false,
91	+
92	+ image: {
93	+ // Wait for images to load before displaying
94	+ // true - wait for image to load and then display;
95	+ // false - display thumbnail and load the full-sized image over top,
96	+ // requires predefined image dimensions (`data-width` and `data-height` attributes)
97	+ preload: false
98	+ },
99	+
100	+ ajax: {
101	+ // Object containing settings for ajax request
102	+ settings: {
103	+ // This helps to indicate that request comes from the modal
104	+ // Feel free to change naming
105	+ data: {
106	+ fancybox: true
107	+ }
108	+ }
109	+ },
110	+
111	+ iframe: {
112	+ // Iframe template
113	+ tpl:
114	+ '<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" allowfullscreen allow="autoplay; fullscreen" src=""></iframe>',
115	+
116	+ // Preload iframe before displaying it
117	+ // This allows to calculate iframe content width and height
118	+ // (note: Due to "Same Origin Policy", you can't get cross domain data).
119	+ preload: true,
120	+
121	+ // Custom CSS styling for iframe wrapping element
122	+ // You can use this to set custom iframe dimensions
123	+ css: {},
124	+
125	+ // Iframe tag attributes
126	+ attr: {
127	+ scrolling: "auto"
128	+ }
129	+ },
130	+
131	+ // For HTML5 video only
132	+ video: {
133	+ tpl:
134	+ '<video class="fancybox-video" controls controlsList="nodownload" poster="{{poster}}">' +
135	+ '<source src="{{src}}" type="{{format}}" />' +
136	+ 'Sorry, your browser doesn\'t support embedded videos, <a href="{{src}}">download</a> and watch with your favorite video player!' +
137	+ "</video>",
138	+ format: "", // custom video format
139	+ autoStart: true
140	+ },
141	+
142	+ // Default content type if cannot be detected automatically
143	+ defaultType: "image",
144	+
145	+ // Open/close animation type
146	+ // Possible values:
147	+ // false - disable
148	+ // "zoom" - zoom images from/to thumbnail
149	+ // "fade"
150	+ // "zoom-in-out"
151	+ //
152	+ animationEffect: "zoom",
153	+
154	+ // Duration in ms for open/close animation
155	+ animationDuration: 366,
156	+
157	+ // Should image change opacity while zooming
158	+ // If opacity is "auto", then opacity will be changed if image and thumbnail have different aspect ratios
159	+ zoomOpacity: "auto",
160	+
161	+ // Transition effect between slides
162	+ //
163	+ // Possible values:
164	+ // false - disable
165	+ // "fade'
166	+ // "slide'
167	+ // "circular'
168	+ // "tube'
169	+ // "zoom-in-out'
170	+ // "rotate'
171	+ //
172	+ transitionEffect: "fade",
173	+
174	+ // Duration in ms for transition animation
175	+ transitionDuration: 366,
176	+
177	+ // Custom CSS class for slide element
178	+ slideClass: "",
179	+
180	+ // Custom CSS class for layout
181	+ baseClass: "",
182	+
183	+ // Base template for layout
184	+ baseTpl:
185	+ '<div class="fancybox-container" role="dialog" tabindex="-1">' +
186	+ '<div class="fancybox-bg"></div>' +
187	+ '<div class="fancybox-inner">' +
188	+ '<div class="fancybox-infobar"><span data-fancybox-index></span> / <span data-fancybox-count></span></div>' +
189	+ '<div class="fancybox-toolbar">{{buttons}}</div>' +
190	+ '<div class="fancybox-navigation">{{arrows}}</div>' +
191	+ '<div class="fancybox-stage"></div>' +
192	+ '<div class="fancybox-caption"></div>' +
193	+ "</div>" +
194	+ "</div>",
195	+
196	+ // Loading indicator template
197	+ spinnerTpl: '<div class="fancybox-loading"></div>',
198	+
199	+ // Error message template
200	+ errorTpl: '<div class="fancybox-error"><p>{{ERROR}}</p></div>',
201	+
202	+ btnTpl: {
203	+ download:
204	+ '<a download data-fancybox-download class="fancybox-button fancybox-button--download" title="{{DOWNLOAD}}" href="javascript:;">' +
205	+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.62 17.09V19H5.38v-1.91zm-2.97-6.96L17 11.45l-5 4.87-5-4.87 1.36-1.32 2.68 2.64V5h1.92v7.77z"/></svg>' +
206	+ "</a>",
207	+
208	+ zoom:
209	+ '<button data-fancybox-zoom class="fancybox-button fancybox-button--zoom" title="{{ZOOM}}">' +
210	+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.7 17.3l-3-3a5.9 5.9 0 0 0-.6-7.6 5.9 5.9 0 0 0-8.4 0 5.9 5.9 0 0 0 0 8.4 5.9 5.9 0 0 0 7.7.7l3 3a1 1 0 0 0 1.3 0c.4-.5.4-1 0-1.5zM8.1 13.8a4 4 0 0 1 0-5.7 4 4 0 0 1 5.7 0 4 4 0 0 1 0 5.7 4 4 0 0 1-5.7 0z"/></svg>' +
211	+ "</button>",
212	+
213	+ close:
214	+ '<button data-fancybox-close class="fancybox-button fancybox-button--close" title="{{CLOSE}}">' +
215	+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M12 10.6L6.6 5.2 5.2 6.6l5.4 5.4-5.4 5.4 1.4 1.4 5.4-5.4 5.4 5.4 1.4-1.4-5.4-5.4 5.4-5.4-1.4-1.4-5.4 5.4z"/></svg>' +
216	+ "</button>",
217	+
218	+ // Arrows
219	+ arrowLeft:
220	+ '<button data-fancybox-prev class="fancybox-button fancybox-button--arrow_left" title="{{PREV}}">' +
221	+ '<div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M11.28 15.7l-1.34 1.37L5 12l4.94-5.07 1.34 1.38-2.68 2.72H19v1.94H8.6z"/></svg></div>' +
222	+ "</button>",
223	+
224	+ arrowRight:
225	+ '<button data-fancybox-next class="fancybox-button fancybox-button--arrow_right" title="{{NEXT}}">' +
226	+ '<div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M15.4 12.97l-2.68 2.72 1.34 1.38L19 12l-4.94-5.07-1.34 1.38 2.68 2.72H5v1.94z"/></svg></div>' +
227	+ "</button>",
228	+
229	+ // This small close button will be appended to your html/inline/ajax content by default,
230	+ // if "smallBtn" option is not set to false
231	+ smallBtn:
232	+ '<button type="button" data-fancybox-close class="fancybox-button fancybox-close-small" title="{{CLOSE}}">' +
233	+ '<svg xmlns="http://www.w3.org/2000/svg" version="1" viewBox="0 0 24 24"><path d="M13 12l5-5-1-1-5 5-5-5-1 1 5 5-5 5 1 1 5-5 5 5 1-1z"/></svg>' +
234	+ "</button>"
235	+ },
236	+
237	+ // Container is injected into this element
238	+ parentEl: "body",
239	+
240	+ // Hide browser vertical scrollbars; use at your own risk
241	+ hideScrollbar: true,
242	+
243	+ // Focus handling
244	+ // ==============
245	+
246	+ // Try to focus on the first focusable element after opening
247	+ autoFocus: true,
248	+
249	+ // Put focus back to active element after closing
250	+ backFocus: true,
251	+
252	+ // Do not let user to focus on element outside modal content
253	+ trapFocus: true,
254	+
255	+ // Module specific options
256	+ // =======================
257	+
258	+ fullScreen: {
259	+ autoStart: false
260	+ },
261	+
262	+ // Set `touch: false` to disable panning/swiping
263	+ touch: {
264	+ vertical: true, // Allow to drag content vertically
265	+ momentum: true // Continue movement after releasing mouse/touch when panning
266	+ },
267	+
268	+ // Hash value when initializing manually,
269	+ // set `false` to disable hash change
270	+ hash: null,
271	+
272	+ // Customize or add new media types
273	+ // Example:
274	+ /*
275	+ media : {
276	+ youtube : {
277	+ params : {
278	+ autoplay : 0
279	+ }
280	+ }
281	+ }
282	+ */
283	+ media: {},
284	+
285	+ slideShow: {
286	+ autoStart: false,
287	+ speed: 3000
288	+ },
289	+
290	+ thumbs: {
291	+ autoStart: false, // Display thumbnails on opening
292	+ hideOnClose: true, // Hide thumbnail grid when closing animation starts
293	+ parentEl: ".fancybox-container", // Container is injected into this element
294	+ axis: "y" // Vertical (y) or horizontal (x) scrolling
295	+ },
296	+
297	+ // Use mousewheel to navigate gallery
298	+ // If 'auto' - enabled for images only
299	+ wheel: "auto",
300	+
301	+ // Callbacks
302	+ //==========
303	+
304	+ // See Documentation/API/Events for more information
305	+ // Example:
306	+ /*
307	+ afterShow: function( instance, current ) {
308	+ console.info( 'Clicked element:' );
309	+ console.info( current.opts.$orig );
310	+ }
311	+ */
312	+
313	+ onInit: $.noop, // When instance has been initialized
314	+
315	+ beforeLoad: $.noop, // Before the content of a slide is being loaded
316	+ afterLoad: $.noop, // When the content of a slide is done loading
317	+
318	+ beforeShow: $.noop, // Before open animation starts
319	+ afterShow: $.noop, // When content is done loading and animating
320	+
321	+ beforeClose: $.noop, // Before the instance attempts to close. Return false to cancel the close.
322	+ afterClose: $.noop, // After instance has been closed
323	+
324	+ onActivate: $.noop, // When instance is brought to front
325	+ onDeactivate: $.noop, // When other instance has been activated
326	+
327	+ // Interaction
328	+ // ===========
329	+
330	+ // Use options below to customize taken action when user clicks or double clicks on the fancyBox area,
331	+ // each option can be string or method that returns value.
332	+ //
333	+ // Possible values:
334	+ // "close" - close instance
335	+ // "next" - move to next gallery item
336	+ // "nextOrClose" - move to next gallery item or close if gallery has only one item
337	+ // "toggleControls" - show/hide controls
338	+ // "zoom" - zoom image (if loaded)
339	+ // false - do nothing
340	+
341	+ // Clicked on the content
342	+ clickContent: function(current, event) {
343	+ return current.type === "image" ? "zoom" : false;
344	+ },
345	+
346	+ // Clicked on the slide
347	+ clickSlide: "close",
348	+
349	+ // Clicked on the background (backdrop) element;
350	+ // if you have not changed the layout, then most likely you need to use `clickSlide` option
351	+ clickOutside: "close",
352	+
353	+ // Same as previous two, but for double click
354	+ dblclickContent: false,
355	+ dblclickSlide: false,
356	+ dblclickOutside: false,
357	+
358	+ // Custom options when mobile device is detected
359	+ // =============================================
360	+
361	+ mobile: {
362	+ preventCaptionOverlap: false,
363	+ idleTime: false,
364	+ clickContent: function(current, event) {
365	+ return current.type === "image" ? "toggleControls" : false;
366	+ },
367	+ clickSlide: function(current, event) {
368	+ return current.type === "image" ? "toggleControls" : "close";
369	+ },
370	+ dblclickContent: function(current, event) {
371	+ return current.type === "image" ? "zoom" : false;
372	+ },
373	+ dblclickSlide: function(current, event) {
374	+ return current.type === "image" ? "zoom" : false;
375	+ }
376	+ },
377	+
378	+ // Internationalization
379	+ // ====================
380	+
381	+ lang: "en",
382	+ i18n: {
383	+ en: {
384	+ CLOSE: "Close",
385	+ NEXT: "Next",
386	+ PREV: "Previous",
387	+ ERROR: "The requested content cannot be loaded. <br/> Please try again later.",
388	+ PLAY_START: "Start slideshow",
389	+ PLAY_STOP: "Pause slideshow",
390	+ FULL_SCREEN: "Full screen",
391	+ THUMBS: "Thumbnails",
392	+ DOWNLOAD: "Download",
393	+ SHARE: "Share",
394	+ ZOOM: "Zoom"
395	+ },
396	+ de: {
397	+ CLOSE: "Schliessen",
398	+ NEXT: "Weiter",
399	+ PREV: "Zurück",
400	+ ERROR: "Die angeforderten Daten konnten nicht geladen werden. <br/> Bitte versuchen Sie es später nochmal.",
401	+ PLAY_START: "Diaschau starten",
402	+ PLAY_STOP: "Diaschau beenden",
403	+ FULL_SCREEN: "Vollbild",
404	+ THUMBS: "Vorschaubilder",
405	+ DOWNLOAD: "Herunterladen",
406	+ SHARE: "Teilen",
407	+ ZOOM: "Maßstab"
408	+ }
409	+ }
410	+ };
411	+
412	+ // Few useful variables and methods
413	+ // ================================
414	+
415	+ var $W = $(window);
416	+ var $D = $(document);
417	+
418	+ var called = 0;
419	+
420	+ // Check if an object is a jQuery object and not a native JavaScript object
421	+ // ========================================================================
422	+ var isQuery = function(obj) {
423	+ return obj && obj.hasOwnProperty && obj instanceof $;
424	+ };
425	+
426	+ // Handle multiple browsers for "requestAnimationFrame" and "cancelAnimationFrame"
427	+ // ===============================================================================
428	+ var requestAFrame = (function() {
429	+ return (
430	+ window.requestAnimationFrame \|\|
431	+ window.webkitRequestAnimationFrame \|\|
432	+ window.mozRequestAnimationFrame \|\|
433	+ window.oRequestAnimationFrame \|\|
434	+ // if all else fails, use setTimeout
435	+ function(callback) {
436	+ return window.setTimeout(callback, 1000 / 60);
437	+ }
438	+ );
439	+ })();
440	+
441	+ var cancelAFrame = (function() {
442	+ return (
443	+ window.cancelAnimationFrame \|\|
444	+ window.webkitCancelAnimationFrame \|\|
445	+ window.mozCancelAnimationFrame \|\|
446	+ window.oCancelAnimationFrame \|\|
447	+ function(id) {
448	+ window.clearTimeout(id);
449	+ }
450	+ );
451	+ })();
452	+
453	+ // Detect the supported transition-end event property name
454	+ // =======================================================
455	+ var transitionEnd = (function() {
456	+ var el = document.createElement("fakeelement"),
457	+ t;
458	+
459	+ var transitions = {
460	+ transition: "transitionend",
461	+ OTransition: "oTransitionEnd",
462	+ MozTransition: "transitionend",
463	+ WebkitTransition: "webkitTransitionEnd"
464	+ };
465	+
466	+ for (t in transitions) {
467	+ if (el.style[t] !== undefined) {
468	+ return transitions[t];
469	+ }
470	+ }
471	+
472	+ return "transitionend";
473	+ })();
474	+
475	+ // Force redraw on an element.
476	+ // This helps in cases where the browser doesn't redraw an updated element properly
477	+ // ================================================================================
478	+ var forceRedraw = function($el) {
479	+ return $el && $el.length && $el[0].offsetHeight;
480	+ };
481	+
482	+ // Exclude array (`buttons`) options from deep merging
483	+ // ===================================================
484	+ var mergeOpts = function(opts1, opts2) {
485	+ var rez = $.extend(true, {}, opts1, opts2);
486	+
487	+ $.each(opts2, function(key, value) {
488	+ if ($.isArray(value)) {
489	+ rez[key] = value;
490	+ }
491	+ });
492	+
493	+ return rez;
494	+ };
495	+
496	+ // How much of an element is visible in viewport
497	+ // =============================================
498	+
499	+ var inViewport = function(elem) {
500	+ var elemCenter, rez;
501	+
502	+ if (!elem \|\| elem.ownerDocument !== document) {
503	+ return false;
504	+ }
505	+
506	+ $(".fancybox-container").css("pointer-events", "none");
507	+
508	+ elemCenter = {
509	+ x: elem.getBoundingClientRect().left + elem.offsetWidth / 2,
510	+ y: elem.getBoundingClientRect().top + elem.offsetHeight / 2
511	+ };
512	+
513	+ rez = document.elementFromPoint(elemCenter.x, elemCenter.y) === elem;
514	+
515	+ $(".fancybox-container").css("pointer-events", "");
516	+
517	+ return rez;
518	+ };
519	+
520	+ // Class definition
521	+ // ================
522	+
523	+ var FancyBox = function(content, opts, index) {
524	+ var self = this;
525	+
526	+ self.opts = mergeOpts({index: index}, $.fancybox.defaults);
527	+
528	+ if ($.isPlainObject(opts)) {
529	+ self.opts = mergeOpts(self.opts, opts);
530	+ }
531	+
532	+ if ($.fancybox.isMobile) {
533	+ self.opts = mergeOpts(self.opts, self.opts.mobile);
534	+ }
535	+
536	+ self.id = self.opts.id \|\| ++called;
537	+
538	+ self.currIndex = parseInt(self.opts.index, 10) \|\| 0;
539	+ self.prevIndex = null;
540	+
541	+ self.prevPos = null;
542	+ self.currPos = 0;
543	+
544	+ self.firstRun = true;
545	+
546	+ // All group items
547	+ self.group = [];
548	+
549	+ // Existing slides (for current, next and previous gallery items)
550	+ self.slides = {};
551	+
552	+ // Create group elements
553	+ self.addContent(content);
554	+
555	+ if (!self.group.length) {
556	+ return;
557	+ }
558	+
559	+ self.init();
560	+ };
561	+
562	+ $.extend(FancyBox.prototype, {
563	+ // Create DOM structure
564	+ // ====================
565	+
566	+ init: function() {
567	+ var self = this,
568	+ firstItem = self.group[self.currIndex],
569	+ firstItemOpts = firstItem.opts,
570	+ $container,
571	+ buttonStr;
572	+
573	+ if (firstItemOpts.closeExisting) {
574	+ $.fancybox.close(true);
575	+ }
576	+
577	+ // Hide scrollbars
578	+ // ===============
579	+
580	+ $("body").addClass("fancybox-active");
581	+
582	+ if (
583	+ !$.fancybox.getInstance() &&
584	+ firstItemOpts.hideScrollbar !== false &&
585	+ !$.fancybox.isMobile &&
586	+ document.body.scrollHeight > window.innerHeight
587	+ ) {
588	+ $("head").append(
589	+ '<style id="fancybox-style-noscroll" type="text/css">.compensate-for-scrollbar{margin-right:' +
590	+ (window.innerWidth - document.documentElement.clientWidth) +
591	+ "px;}</style>"
592	+ );
593	+
594	+ $("body").addClass("compensate-for-scrollbar");
595	+ }
596	+
597	+ // Build html markup and set references
598	+ // ====================================
599	+
600	+ // Build html code for buttons and insert into main template
601	+ buttonStr = "";
602	+
603	+ $.each(firstItemOpts.buttons, function(index, value) {
604	+ buttonStr += firstItemOpts.btnTpl[value] \|\| "";
605	+ });
606	+
607	+ // Create markup from base template, it will be initially hidden to
608	+ // avoid unnecessary work like painting while initializing is not complete
609	+ $container = $(
610	+ self.translate(
611	+ self,
612	+ firstItemOpts.baseTpl
613	+ .replace("{{buttons}}", buttonStr)
614	+ .replace("{{arrows}}", firstItemOpts.btnTpl.arrowLeft + firstItemOpts.btnTpl.arrowRight)
615	+ )
616	+ )
617	+ .attr("id", "fancybox-container-" + self.id)
618	+ .addClass(firstItemOpts.baseClass)
619	+ .data("FancyBox", self)
620	+ .appendTo(firstItemOpts.parentEl);
621	+
622	+ // Create object holding references to jQuery wrapped nodes
623	+ self.$refs = {
624	+ container: $container
625	+ };
626	+
627	+ ["bg", "inner", "infobar", "toolbar", "stage", "caption", "navigation"].forEach(function(item) {
628	+ self.$refs[item] = $container.find(".fancybox-" + item);
629	+ });
630	+
631	+ self.trigger("onInit");
632	+
633	+ // Enable events, deactive previous instances
634	+ self.activate();
635	+
636	+ // Build slides, load and reveal content
637	+ self.jumpTo(self.currIndex);
638	+ },
639	+
640	+ // Simple i18n support - replaces object keys found in template
641	+ // with corresponding values
642	+ // ============================================================
643	+
644	+ translate: function(obj, str) {
645	+ var arr = obj.opts.i18n[obj.opts.lang] \|\| obj.opts.i18n.en;
646	+
647	+ return str.replace(/\{\{(\w+)\}\}/g, function(match, n) {
648	+ var value = arr[n];
649	+
650	+ if (value === undefined) {
651	+ return match;
652	+ }
653	+
654	+ return value;
655	+ });
656	+ },
657	+
658	+ // Populate current group with fresh content
659	+ // Check if each object has valid type and content
660	+ // ===============================================
661	+
662	+ addContent: function(content) {
663	+ var self = this,
664	+ items = $.makeArray(content),
665	+ thumbs;
666	+
667	+ $.each(items, function(i, item) {
668	+ var obj = {},
669	+ opts = {},
670	+ $item,
671	+ type,
672	+ found,
673	+ src,
674	+ srcParts;
675	+
676	+ // Step 1 - Make sure we have an object
677	+ // ====================================
678	+
679	+ if ($.isPlainObject(item)) {
680	+ // We probably have manual usage here, something like
681	+ // $.fancybox.open( [ { src : "image.jpg", type : "image" } ] )
682	+
683	+ obj = item;
684	+ opts = item.opts \|\| item;
685	+ } else if ($.type(item) === "object" && $(item).length) {
686	+ // Here we probably have jQuery collection returned by some selector
687	+ $item = $(item);
688	+
689	+ // Support attributes like `data-options='{"touch" : false}'` and `data-touch='false'`
690	+ opts = $item.data() \|\| {};
691	+ opts = $.extend(true, {}, opts, opts.options);
692	+
693	+ // Here we store clicked element
694	+ opts.$orig = $item;
695	+
696	+ obj.src = self.opts.src \|\| opts.src \|\| $item.attr("href");
697	+
698	+ // Assume that simple syntax is used, for example:
699	+ // `$.fancybox.open( $("#test"), {} );`
700	+ if (!obj.type && !obj.src) {
701	+ obj.type = "inline";
702	+ obj.src = item;
703	+ }
704	+ } else {
705	+ // Assume we have a simple html code, for example:
706	+ // $.fancybox.open( '<div><h1>Hi!</h1></div>' );
707	+ obj = {
708	+ type: "html",
709	+ src: item + ""
710	+ };
711	+ }
712	+
713	+ // Each gallery object has full collection of options
714	+ obj.opts = $.extend(true, {}, self.opts, opts);
715	+
716	+ // Do not merge buttons array
717	+ if ($.isArray(opts.buttons)) {
718	+ obj.opts.buttons = opts.buttons;
719	+ }
720	+
721	+ if ($.fancybox.isMobile && obj.opts.mobile) {
722	+ obj.opts = mergeOpts(obj.opts, obj.opts.mobile);
723	+ }
724	+
725	+ // Step 2 - Make sure we have content type, if not - try to guess
726	+ // ==============================================================
727	+
728	+ type = obj.type \|\| obj.opts.type;
729	+ src = obj.src \|\| "";
730	+
731	+ if (!type && src) {
732	+ if ((found = src.match(/\.(mp4\|mov\|ogv\|webm)((\?\|#).*)?$/i))) {
733	+ type = "video";
734	+
735	+ if (!obj.opts.video.format) {
736	+ obj.opts.video.format = "video/" + (found[1] === "ogv" ? "ogg" : found[1]);
737	+ }
738	+ } else if (src.match(/(^data:image\/[a-z0-9+\/=],)\|(\.(jp(e\|g\|eg)\|gif\|png\|bmp\|webp\|svg\|ico)((\?\|#).)?$)/i)) {
739	+ type = "image";
740	+ } else if (src.match(/\.(pdf)((\?\|#).*)?$/i)) {
741	+ type = "iframe";
742	+ obj = $.extend(true, obj, {contentType: "pdf", opts: {iframe: {preload: false}}});
743	+ } else if (src.charAt(0) === "#") {
744	+ type = "inline";
745	+ }
746	+ }
747	+
748	+ if (type) {
749	+ obj.type = type;
750	+ } else {
751	+ self.trigger("objectNeedsType", obj);
752	+ }
753	+
754	+ if (!obj.contentType) {
755	+ obj.contentType = $.inArray(obj.type, ["html", "inline", "ajax"]) > -1 ? "html" : obj.type;
756	+ }
757	+
758	+ // Step 3 - Some adjustments
759	+ // =========================
760	+
761	+ obj.index = self.group.length;
762	+
763	+ if (obj.opts.smallBtn == "auto") {
764	+ obj.opts.smallBtn = $.inArray(obj.type, ["html", "inline", "ajax"]) > -1;
765	+ }
766	+
767	+ if (obj.opts.toolbar === "auto") {
768	+ obj.opts.toolbar = !obj.opts.smallBtn;
769	+ }
770	+
771	+ // Find thumbnail image, check if exists and if is in the viewport
772	+ obj.$thumb = obj.opts.$thumb \|\| null;
773	+
774	+ if (obj.opts.$trigger && obj.index === self.opts.index) {
775	+ obj.$thumb = obj.opts.$trigger.find("img:first");
776	+
777	+ if (obj.$thumb.length) {
778	+ obj.opts.$orig = obj.opts.$trigger;
779	+ }
780	+ }
781	+
782	+ if (!(obj.$thumb && obj.$thumb.length) && obj.opts.$orig) {
783	+ obj.$thumb = obj.opts.$orig.find("img:first");
784	+ }
785	+
786	+ if (obj.$thumb && !obj.$thumb.length) {
787	+ obj.$thumb = null;
788	+ }
789	+
790	+ obj.thumb = obj.opts.thumb \|\| (obj.$thumb ? obj.$thumb[0].src : null);
791	+
792	+ // "caption" is a "special" option, it can be used to customize caption per gallery item
793	+ if ($.type(obj.opts.caption) === "function") {
794	+ obj.opts.caption = obj.opts.caption.apply(item, [self, obj]);
795	+ }
796	+
797	+ if ($.type(self.opts.caption) === "function") {
798	+ obj.opts.caption = self.opts.caption.apply(item, [self, obj]);
799	+ }
800	+
801	+ // Make sure we have caption as a string or jQuery object
802	+ if (!(obj.opts.caption instanceof $)) {
803	+ obj.opts.caption = obj.opts.caption === undefined ? "" : obj.opts.caption + "";
804	+ }
805	+
806	+ // Check if url contains "filter" used to filter the content
807	+ // Example: "ajax.html #something"
808	+ if (obj.type === "ajax") {
809	+ srcParts = src.split(/\s+/, 2);
810	+
811	+ if (srcParts.length > 1) {
812	+ obj.src = srcParts.shift();
813	+
814	+ obj.opts.filter = srcParts.shift();
815	+ }
816	+ }
817	+
818	+ // Hide all buttons and disable interactivity for modal items
819	+ if (obj.opts.modal) {
820	+ obj.opts = $.extend(true, obj.opts, {
821	+ trapFocus: true,
822	+ // Remove buttons
823	+ infobar: 0,
824	+ toolbar: 0,
825	+
826	+ smallBtn: 0,
827	+
828	+ // Disable keyboard navigation
829	+ keyboard: 0,
830	+
831	+ // Disable some modules
832	+ slideShow: 0,
833	+ fullScreen: 0,
834	+ thumbs: 0,
835	+ touch: 0,
836	+
837	+ // Disable click event handlers
838	+ clickContent: false,
839	+ clickSlide: false,
840	+ clickOutside: false,
841	+ dblclickContent: false,
842	+ dblclickSlide: false,
843	+ dblclickOutside: false
844	+ });
845	+ }
846	+
847	+ // Step 4 - Add processed object to group
848	+ // ======================================
849	+
850	+ self.group.push(obj);
851	+ });
852	+
853	+ // Update controls if gallery is already opened
854	+ if (Object.keys(self.slides).length) {
855	+ self.updateControls();
856	+
857	+ // Update thumbnails, if needed
858	+ thumbs = self.Thumbs;
859	+
860	+ if (thumbs && thumbs.isActive) {
861	+ thumbs.create();
862	+
863	+ thumbs.focus();
864	+ }
865	+ }
866	+ },
867	+
868	+ // Attach an event handler functions for:
869	+ // - navigation buttons
870	+ // - browser scrolling, resizing;
871	+ // - focusing
872	+ // - keyboard
873	+ // - detecting inactivity
874	+ // ======================================
875	+
876	+ addEvents: function() {
877	+ var self = this;
878	+
879	+ self.removeEvents();
880	+
881	+ // Make navigation elements clickable
882	+ // ==================================
883	+
884	+ self.$refs.container
885	+ .on("click.fb-close", "[data-fancybox-close]", function(e) {
886	+ e.stopPropagation();
887	+ e.preventDefault();
888	+
889	+ self.close(e);
890	+ })
891	+ .on("touchstart.fb-prev click.fb-prev", "[data-fancybox-prev]", function(e) {
892	+ e.stopPropagation();
893	+ e.preventDefault();
894	+
895	+ self.previous();
896	+ })
897	+ .on("touchstart.fb-next click.fb-next", "[data-fancybox-next]", function(e) {
898	+ e.stopPropagation();
899	+ e.preventDefault();
900	+
901	+ self.next();
902	+ })
903	+ .on("click.fb", "[data-fancybox-zoom]", function(e) {
904	+ // Click handler for zoom button
905	+ self[self.isScaledDown() ? "scaleToActual" : "scaleToFit"]();
906	+ });
907	+
908	+ // Handle page scrolling and browser resizing
909	+ // ==========================================
910	+
911	+ $W.on("orientationchange.fb resize.fb", function(e) {
912	+ if (e && e.originalEvent && e.originalEvent.type === "resize") {
913	+ if (self.requestId) {
914	+ cancelAFrame(self.requestId);
915	+ }
916	+
917	+ self.requestId = requestAFrame(function() {
918	+ self.update(e);
919	+ });
920	+ } else {
921	+ if (self.current && self.current.type === "iframe") {
922	+ self.$refs.stage.hide();
923	+ }
924	+
925	+ setTimeout(function() {
926	+ self.$refs.stage.show();
927	+
928	+ self.update(e);
929	+ }, $.fancybox.isMobile ? 600 : 250);
930	+ }
931	+ });
932	+
933	+ $D.on("keydown.fb", function(e) {
934	+ var instance = $.fancybox ? $.fancybox.getInstance() : null,
935	+ current = instance.current,
936	+ keycode = e.keyCode \|\| e.which;
937	+
938	+ // Trap keyboard focus inside of the modal
939	+ // =======================================
940	+
941	+ if (keycode == 9) {
942	+ if (current.opts.trapFocus) {
943	+ self.focus(e);
944	+ }
945	+
946	+ return;
947	+ }
948	+
949	+ // Enable keyboard navigation
950	+ // ==========================
951	+
952	+ if (!current.opts.keyboard \|\| e.ctrlKey \|\| e.altKey \|\| e.shiftKey \|\| $(e.target).is("input") \|\| $(e.target).is("textarea")) {
953	+ return;
954	+ }
955	+
956	+ // Backspace and Esc keys
957	+ if (keycode === 8 \|\| keycode === 27) {
958	+ e.preventDefault();
959	+
960	+ self.close(e);
961	+
962	+ return;
963	+ }
964	+
965	+ // Left arrow and Up arrow
966	+ if (keycode === 37 \|\| keycode === 38) {
967	+ e.preventDefault();
968	+
969	+ self.previous();
970	+
971	+ return;
972	+ }
973	+
974	+ // Righ arrow and Down arrow
975	+ if (keycode === 39 \|\| keycode === 40) {
976	+ e.preventDefault();
977	+
978	+ self.next();
979	+
980	+ return;
981	+ }
982	+
983	+ self.trigger("afterKeydown", e, keycode);
984	+ });
985	+
986	+ // Hide controls after some inactivity period
987	+ if (self.group[self.currIndex].opts.idleTime) {
988	+ self.idleSecondsCounter = 0;
989	+
990	+ $D.on(
991	+ "mousemove.fb-idle mouseleave.fb-idle mousedown.fb-idle touchstart.fb-idle touchmove.fb-idle scroll.fb-idle keydown.fb-idle",
992	+ function(e) {
993	+ self.idleSecondsCounter = 0;
994	+
995	+ if (self.isIdle) {
996	+ self.showControls();
997	+ }
998	+
999	+ self.isIdle = false;
1000	+ }
1001	+ );
1002	+
1003	+ self.idleInterval = window.setInterval(function() {
1004	+ self.idleSecondsCounter++;
1005	+
1006	+ if (self.idleSecondsCounter >= self.group[self.currIndex].opts.idleTime && !self.isDragging) {
1007	+ self.isIdle = true;
1008	+ self.idleSecondsCounter = 0;
1009	+
1010	+ self.hideControls();
1011	+ }
1012	+ }, 1000);
1013	+ }
1014	+ },
1015	+
1016	+ // Remove events added by the core
1017	+ // ===============================
1018	+
1019	+ removeEvents: function() {
1020	+ var self = this;
1021	+
1022	+ $W.off("orientationchange.fb resize.fb");
1023	+ $D.off("keydown.fb .fb-idle");
1024	+
1025	+ this.$refs.container.off(".fb-close .fb-prev .fb-next");
1026	+
1027	+ if (self.idleInterval) {
1028	+ window.clearInterval(self.idleInterval);
1029	+
1030	+ self.idleInterval = null;
1031	+ }
1032	+ },
1033	+
1034	+ // Change to previous gallery item
1035	+ // ===============================
1036	+
1037	+ previous: function(duration) {
1038	+ return this.jumpTo(this.currPos - 1, duration);
1039	+ },
1040	+
1041	+ // Change to next gallery item
1042	+ // ===========================
1043	+
1044	+ next: function(duration) {
1045	+ return this.jumpTo(this.currPos + 1, duration);
1046	+ },
1047	+
1048	+ // Switch to selected gallery item
1049	+ // ===============================
1050	+
1051	+ jumpTo: function(pos, duration) {
1052	+ var self = this,
1053	+ groupLen = self.group.length,
1054	+ firstRun,
1055	+ isMoved,
1056	+ loop,
1057	+ current,
1058	+ previous,
1059	+ slidePos,
1060	+ stagePos,
1061	+ prop,
1062	+ diff;
1063	+
1064	+ if (self.isDragging \|\| self.isClosing \|\| (self.isAnimating && self.firstRun)) {
1065	+ return;
1066	+ }
1067	+
1068	+ // Should loop?
1069	+ pos = parseInt(pos, 10);
1070	+ loop = self.current ? self.current.opts.loop : self.opts.loop;
1071	+
1072	+ if (!loop && (pos < 0 \|\| pos >= groupLen)) {
1073	+ return false;
1074	+ }
1075	+
1076	+ // Check if opening for the first time; this helps to speed things up
1077	+ firstRun = self.firstRun = !Object.keys(self.slides).length;
1078	+
1079	+ // Create slides
1080	+ previous = self.current;
1081	+
1082	+ self.prevIndex = self.currIndex;
1083	+ self.prevPos = self.currPos;
1084	+
1085	+ current = self.createSlide(pos);
1086	+
1087	+ if (groupLen > 1) {
1088	+ if (loop \|\| current.index < groupLen - 1) {
1089	+ self.createSlide(pos + 1);
1090	+ }
1091	+
1092	+ if (loop \|\| current.index > 0) {
1093	+ self.createSlide(pos - 1);
1094	+ }
1095	+ }
1096	+
1097	+ self.current = current;
1098	+ self.currIndex = current.index;
1099	+ self.currPos = current.pos;
1100	+
1101	+ self.trigger("beforeShow", firstRun);
1102	+
1103	+ self.updateControls();
1104	+
1105	+ // Validate duration length
1106	+ current.forcedDuration = undefined;
1107	+
1108	+ if ($.isNumeric(duration)) {
1109	+ current.forcedDuration = duration;
1110	+ } else {
1111	+ duration = current.opts[firstRun ? "animationDuration" : "transitionDuration"];
1112	+ }
1113	+
1114	+ duration = parseInt(duration, 10);
1115	+
1116	+ // Check if user has swiped the slides or if still animating
1117	+ isMoved = self.isMoved(current);
1118	+
1119	+ // Make sure current slide is visible
1120	+ current.$slide.addClass("fancybox-slide--current");
1121	+
1122	+ // Fresh start - reveal container, current slide and start loading content
1123	+ if (firstRun) {
1124	+ if (current.opts.animationEffect && duration) {
1125	+ self.$refs.container.css("transition-duration", duration + "ms");
1126	+ }
1127	+
1128	+ self.$refs.container.addClass("fancybox-is-open").trigger("focus");
1129	+
1130	+ // Attempt to load content into slide
1131	+ // This will later call `afterLoad` -> `revealContent`
1132	+ self.loadSlide(current);
1133	+
1134	+ self.preload("image");
1135	+
1136	+ return;
1137	+ }
1138	+
1139	+ // Get actual slide/stage positions (before cleaning up)
1140	+ slidePos = $.fancybox.getTranslate(previous.$slide);
1141	+ stagePos = $.fancybox.getTranslate(self.$refs.stage);
1142	+
1143	+ // Clean up all slides
1144	+ $.each(self.slides, function(index, slide) {
1145	+ $.fancybox.stop(slide.$slide, true);
1146	+ });
1147	+
1148	+ if (previous.pos !== current.pos) {
1149	+ previous.isComplete = false;
1150	+ }
1151	+
1152	+ previous.$slide.removeClass("fancybox-slide--complete fancybox-slide--current");
1153	+
1154	+ // If slides are out of place, then animate them to correct position
1155	+ if (isMoved) {
1156	+ // Calculate horizontal swipe distance
1157	+ diff = slidePos.left - (previous.pos * slidePos.width + previous.pos * previous.opts.gutter);
1158	+
1159	+ $.each(self.slides, function(index, slide) {
1160	+ slide.$slide.removeClass("fancybox-animated").removeClass(function(index, className) {
1161	+ return (className.match(/(^\|\s)fancybox-fx-\S+/g) \|\| []).join(" ");
1162	+ });
1163	+
1164	+ // Make sure that each slide is in equal distance
1165	+ // This is mostly needed for freshly added slides, because they are not yet positioned
1166	+ var leftPos = slide.pos * slidePos.width + slide.pos * slide.opts.gutter;
1167	+
1168	+ $.fancybox.setTranslate(slide.$slide, {top: 0, left: leftPos - stagePos.left + diff});
1169	+
1170	+ if (slide.pos !== current.pos) {
1171	+ slide.$slide.addClass("fancybox-slide--" + (slide.pos > current.pos ? "next" : "previous"));
1172	+ }
1173	+
1174	+ // Redraw to make sure that transition will start
1175	+ forceRedraw(slide.$slide);
1176	+
1177	+ // Animate the slide
1178	+ $.fancybox.animate(
1179	+ slide.$slide,
1180	+ {
1181	+ top: 0,
1182	+ left: (slide.pos - current.pos) * slidePos.width + (slide.pos - current.pos) * slide.opts.gutter
1183	+ },
1184	+ duration,
1185	+ function() {
1186	+ slide.$slide
1187	+ .css({
1188	+ transform: "",
1189	+ opacity: ""
1190	+ })
1191	+ .removeClass("fancybox-slide--next fancybox-slide--previous");
1192	+
1193	+ if (slide.pos === self.currPos) {
1194	+ self.complete();
1195	+ }
1196	+ }
1197	+ );
1198	+ });
1199	+ } else if (duration && current.opts.transitionEffect) {
1200	+ // Set transition effect for previously active slide
1201	+ prop = "fancybox-animated fancybox-fx-" + current.opts.transitionEffect;
1202	+
1203	+ previous.$slide.addClass("fancybox-slide--" + (previous.pos > current.pos ? "next" : "previous"));
1204	+
1205	+ $.fancybox.animate(
1206	+ previous.$slide,
1207	+ prop,
1208	+ duration,
1209	+ function() {
1210	+ previous.$slide.removeClass(prop).removeClass("fancybox-slide--next fancybox-slide--previous");
1211	+ },
1212	+ false
1213	+ );
1214	+ }
1215	+
1216	+ if (current.isLoaded) {
1217	+ self.revealContent(current);
1218	+ } else {
1219	+ self.loadSlide(current);
1220	+ }
1221	+
1222	+ self.preload("image");
1223	+ },
1224	+
1225	+ // Create new "slide" element
1226	+ // These are gallery items that are actually added to DOM
1227	+ // =======================================================
1228	+
1229	+ createSlide: function(pos) {
1230	+ var self = this,
1231	+ $slide,
1232	+ index;
1233	+
1234	+ index = pos % self.group.length;
1235	+ index = index < 0 ? self.group.length + index : index;
1236	+
1237	+ if (!self.slides[pos] && self.group[index]) {
1238	+ $slide = $('<div class="fancybox-slide"></div>').appendTo(self.$refs.stage);
1239	+
1240	+ self.slides[pos] = $.extend(true, {}, self.group[index], {
1241	+ pos: pos,
1242	+ $slide: $slide,
1243	+ isLoaded: false
1244	+ });
1245	+
1246	+ self.updateSlide(self.slides[pos]);
1247	+ }
1248	+
1249	+ return self.slides[pos];
1250	+ },
1251	+
1252	+ // Scale image to the actual size of the image;
1253	+ // x and y values should be relative to the slide
1254	+ // ==============================================
1255	+
1256	+ scaleToActual: function(x, y, duration) {
1257	+ var self = this,
1258	+ current = self.current,
1259	+ $content = current.$content,
1260	+ canvasWidth = $.fancybox.getTranslate(current.$slide).width,
1261	+ canvasHeight = $.fancybox.getTranslate(current.$slide).height,
1262	+ newImgWidth = current.width,
1263	+ newImgHeight = current.height,
1264	+ imgPos,
1265	+ posX,
1266	+ posY,
1267	+ scaleX,
1268	+ scaleY;
1269	+
1270	+ if (self.isAnimating \|\| self.isMoved() \|\| !$content \|\| !(current.type == "image" && current.isLoaded && !current.hasError)) {
1271	+ return;
1272	+ }
1273	+
1274	+ self.isAnimating = true;
1275	+
1276	+ $.fancybox.stop($content);
1277	+
1278	+ x = x === undefined ? canvasWidth * 0.5 : x;
1279	+ y = y === undefined ? canvasHeight * 0.5 : y;
1280	+
1281	+ imgPos = $.fancybox.getTranslate($content);
1282	+
1283	+ imgPos.top -= $.fancybox.getTranslate(current.$slide).top;
1284	+ imgPos.left -= $.fancybox.getTranslate(current.$slide).left;
1285	+
1286	+ scaleX = newImgWidth / imgPos.width;
1287	+ scaleY = newImgHeight / imgPos.height;
1288	+
1289	+ // Get center position for original image
1290	+ posX = canvasWidth * 0.5 - newImgWidth * 0.5;
1291	+ posY = canvasHeight * 0.5 - newImgHeight * 0.5;
1292	+
1293	+ // Make sure image does not move away from edges
1294	+ if (newImgWidth > canvasWidth) {
1295	+ posX = imgPos.left * scaleX - (x * scaleX - x);
1296	+
1297	+ if (posX > 0) {
1298	+ posX = 0;
1299	+ }
1300	+
1301	+ if (posX < canvasWidth - newImgWidth) {
1302	+ posX = canvasWidth - newImgWidth;
1303	+ }
1304	+ }
1305	+
1306	+ if (newImgHeight > canvasHeight) {
1307	+ posY = imgPos.top * scaleY - (y * scaleY - y);
1308	+
1309	+ if (posY > 0) {
1310	+ posY = 0;
1311	+ }
1312	+
1313	+ if (posY < canvasHeight - newImgHeight) {
1314	+ posY = canvasHeight - newImgHeight;
1315	+ }
1316	+ }
1317	+
1318	+ self.updateCursor(newImgWidth, newImgHeight);
1319	+
1320	+ $.fancybox.animate(
1321	+ $content,
1322	+ {
1323	+ top: posY,
1324	+ left: posX,
1325	+ scaleX: scaleX,
1326	+ scaleY: scaleY
1327	+ },
1328	+ duration \|\| 330,
1329	+ function() {
1330	+ self.isAnimating = false;
1331	+ }
1332	+ );
1333	+
1334	+ // Stop slideshow
1335	+ if (self.SlideShow && self.SlideShow.isActive) {
1336	+ self.SlideShow.stop();
1337	+ }
1338	+ },
1339	+
1340	+ // Scale image to fit inside parent element
1341	+ // ========================================
1342	+
1343	+ scaleToFit: function(duration) {
1344	+ var self = this,
1345	+ current = self.current,
1346	+ $content = current.$content,
1347	+ end;
1348	+
1349	+ if (self.isAnimating \|\| self.isMoved() \|\| !$content \|\| !(current.type == "image" && current.isLoaded && !current.hasError)) {
1350	+ return;
1351	+ }
1352	+
1353	+ self.isAnimating = true;
1354	+
1355	+ $.fancybox.stop($content);
1356	+
1357	+ end = self.getFitPos(current);
1358	+
1359	+ self.updateCursor(end.width, end.height);
1360	+
1361	+ $.fancybox.animate(
1362	+ $content,
1363	+ {
1364	+ top: end.top,
1365	+ left: end.left,
1366	+ scaleX: end.width / $content.width(),
1367	+ scaleY: end.height / $content.height()
1368	+ },
1369	+ duration \|\| 330,
1370	+ function() {
1371	+ self.isAnimating = false;
1372	+ }
1373	+ );
1374	+ },
1375	+
1376	+ // Calculate image size to fit inside viewport
1377	+ // ===========================================
1378	+
1379	+ getFitPos: function(slide) {
1380	+ var self = this,
1381	+ $content = slide.$content,
1382	+ $slide = slide.$slide,
1383	+ width = slide.width \|\| slide.opts.width,
1384	+ height = slide.height \|\| slide.opts.height,
1385	+ maxWidth,
1386	+ maxHeight,
1387	+ minRatio,
1388	+ aspectRatio,
1389	+ rez = {};
1390	+
1391	+ if (!slide.isLoaded \|\| !$content \|\| !$content.length) {
1392	+ return false;
1393	+ }
1394	+
1395	+ maxWidth = $.fancybox.getTranslate(self.$refs.stage).width;
1396	+ maxHeight = $.fancybox.getTranslate(self.$refs.stage).height;
1397	+
1398	+ maxWidth -=
1399	+ parseFloat($slide.css("paddingLeft")) +
1400	+ parseFloat($slide.css("paddingRight")) +
1401	+ parseFloat($content.css("marginLeft")) +
1402	+ parseFloat($content.css("marginRight"));
1403	+
1404	+ maxHeight -=
1405	+ parseFloat($slide.css("paddingTop")) +
1406	+ parseFloat($slide.css("paddingBottom")) +
1407	+ parseFloat($content.css("marginTop")) +
1408	+ parseFloat($content.css("marginBottom"));
1409	+
1410	+ if (!width \|\| !height) {
1411	+ width = maxWidth;
1412	+ height = maxHeight;
1413	+ }
1414	+
1415	+ minRatio = Math.min(1, maxWidth / width, maxHeight / height);
1416	+
1417	+ width = minRatio * width;
1418	+ height = minRatio * height;
1419	+
1420	+ // Adjust width/height to precisely fit into container
1421	+ if (width > maxWidth - 0.5) {
1422	+ width = maxWidth;
1423	+ }
1424	+
1425	+ if (height > maxHeight - 0.5) {
1426	+ height = maxHeight;
1427	+ }
1428	+
1429	+ if (slide.type === "image") {
1430	+ rez.top = Math.floor((maxHeight - height) * 0.5) + parseFloat($slide.css("paddingTop"));
1431	+ rez.left = Math.floor((maxWidth - width) * 0.5) + parseFloat($slide.css("paddingLeft"));
1432	+ } else if (slide.contentType === "video") {
1433	+ // Force aspect ratio for the video
1434	+ // "I say the whole world must learn of our peaceful ways… by force!"
1435	+ aspectRatio = slide.opts.width && slide.opts.height ? width / height : slide.opts.ratio \|\| 16 / 9;
1436	+
1437	+ if (height > width / aspectRatio) {
1438	+ height = width / aspectRatio;
1439	+ } else if (width > height * aspectRatio) {
1440	+ width = height * aspectRatio;
1441	+ }
1442	+ }
1443	+
1444	+ rez.width = width;
1445	+ rez.height = height;
1446	+
1447	+ return rez;
1448	+ },
1449	+
1450	+ // Update content size and position for all slides
1451	+ // ==============================================
1452	+
1453	+ update: function(e) {
1454	+ var self = this;
1455	+
1456	+ $.each(self.slides, function(key, slide) {
1457	+ self.updateSlide(slide, e);
1458	+ });
1459	+ },
1460	+
1461	+ // Update slide content position and size
1462	+ // ======================================
1463	+
1464	+ updateSlide: function(slide, e) {
1465	+ var self = this,
1466	+ $content = slide && slide.$content,
1467	+ width = slide.width \|\| slide.opts.width,
1468	+ height = slide.height \|\| slide.opts.height,
1469	+ $slide = slide.$slide;
1470	+
1471	+ // First, prevent caption overlap, if needed
1472	+ self.adjustCaption(slide);
1473	+
1474	+ // Then resize content to fit inside the slide
1475	+ if ($content && (width \|\| height \|\| slide.contentType === "video") && !slide.hasError) {
1476	+ $.fancybox.stop($content);
1477	+
1478	+ $.fancybox.setTranslate($content, self.getFitPos(slide));
1479	+
1480	+ if (slide.pos === self.currPos) {
1481	+ self.isAnimating = false;
1482	+
1483	+ self.updateCursor();
1484	+ }
1485	+ }
1486	+
1487	+ // Then some adjustments
1488	+ self.adjustLayout(slide);
1489	+
1490	+ if ($slide.length) {
1491	+ $slide.trigger("refresh");
1492	+
1493	+ if (slide.pos === self.currPos) {
1494	+ self.$refs.toolbar
1495	+ .add(self.$refs.navigation.find(".fancybox-button--arrow_right"))
1496	+ .toggleClass("compensate-for-scrollbar", $slide.get(0).scrollHeight > $slide.get(0).clientHeight);
1497	+ }
1498	+ }
1499	+
1500	+ self.trigger("onUpdate", slide, e);
1501	+ },
1502	+
1503	+ // Horizontally center slide
1504	+ // =========================
1505	+
1506	+ centerSlide: function(duration) {
1507	+ var self = this,
1508	+ current = self.current,
1509	+ $slide = current.$slide;
1510	+
1511	+ if (self.isClosing \|\| !current) {
1512	+ return;
1513	+ }
1514	+
1515	+ $slide.siblings().css({
1516	+ transform: "",
1517	+ opacity: ""
1518	+ });
1519	+
1520	+ $slide
1521	+ .parent()
1522	+ .children()
1523	+ .removeClass("fancybox-slide--previous fancybox-slide--next");
1524	+
1525	+ $.fancybox.animate(
1526	+ $slide,
1527	+ {
1528	+ top: 0,
1529	+ left: 0,
1530	+ opacity: 1
1531	+ },
1532	+ duration === undefined ? 0 : duration,
1533	+ function() {
1534	+ // Clean up
1535	+ $slide.css({
1536	+ transform: "",
1537	+ opacity: ""
1538	+ });
1539	+
1540	+ if (!current.isComplete) {
1541	+ self.complete();
1542	+ }
1543	+ },
1544	+ false
1545	+ );
1546	+ },
1547	+
1548	+ // Check if current slide is moved (swiped)
1549	+ // ========================================
1550	+
1551	+ isMoved: function(slide) {
1552	+ var current = slide \|\| this.current,
1553	+ slidePos,
1554	+ stagePos;
1555	+
1556	+ if (!current) {
1557	+ return false;
1558	+ }
1559	+
1560	+ stagePos = $.fancybox.getTranslate(this.$refs.stage);
1561	+ slidePos = $.fancybox.getTranslate(current.$slide);
1562	+
1563	+ return (
1564	+ !current.$slide.hasClass("fancybox-animated") &&
1565	+ (Math.abs(slidePos.top - stagePos.top) > 0.5 \|\| Math.abs(slidePos.left - stagePos.left) > 0.5)
1566	+ );
1567	+ },
1568	+
1569	+ // Update cursor style depending if content can be zoomed
1570	+ // ======================================================
1571	+
1572	+ updateCursor: function(nextWidth, nextHeight) {
1573	+ var self = this,
1574	+ current = self.current,
1575	+ $container = self.$refs.container,
1576	+ canPan,
1577	+ isZoomable;
1578	+
1579	+ if (!current \|\| self.isClosing \|\| !self.Guestures) {
1580	+ return;
1581	+ }
1582	+
1583	+ $container.removeClass("fancybox-is-zoomable fancybox-can-zoomIn fancybox-can-zoomOut fancybox-can-swipe fancybox-can-pan");
1584	+
1585	+ canPan = self.canPan(nextWidth, nextHeight);
1586	+
1587	+ isZoomable = canPan ? true : self.isZoomable();
1588	+
1589	+ $container.toggleClass("fancybox-is-zoomable", isZoomable);
1590	+
1591	+ $("[data-fancybox-zoom]").prop("disabled", !isZoomable);
1592	+
1593	+ if (canPan) {
1594	+ $container.addClass("fancybox-can-pan");
1595	+ } else if (
1596	+ isZoomable &&
1597	+ (current.opts.clickContent === "zoom" \|\| ($.isFunction(current.opts.clickContent) && current.opts.clickContent(current) == "zoom"))
1598	+ ) {
1599	+ $container.addClass("fancybox-can-zoomIn");
1600	+ } else if (current.opts.touch && (current.opts.touch.vertical \|\| self.group.length > 1) && current.contentType !== "video") {
1601	+ $container.addClass("fancybox-can-swipe");
1602	+ }
1603	+ },
1604	+
1605	+ // Check if current slide is zoomable
1606	+ // ==================================
1607	+
1608	+ isZoomable: function() {
1609	+ var self = this,
1610	+ current = self.current,
1611	+ fitPos;
1612	+
1613	+ // Assume that slide is zoomable if:
1614	+ // - image is still loading
1615	+ // - actual size of the image is smaller than available area
1616	+ if (current && !self.isClosing && current.type === "image" && !current.hasError) {
1617	+ if (!current.isLoaded) {
1618	+ return true;
1619	+ }
1620	+
1621	+ fitPos = self.getFitPos(current);
1622	+
1623	+ if (fitPos && (current.width > fitPos.width \|\| current.height > fitPos.height)) {
1624	+ return true;
1625	+ }
1626	+ }
1627	+
1628	+ return false;
1629	+ },
1630	+
1631	+ // Check if current image dimensions are smaller than actual
1632	+ // =========================================================
1633	+
1634	+ isScaledDown: function(nextWidth, nextHeight) {
1635	+ var self = this,
1636	+ rez = false,
1637	+ current = self.current,
1638	+ $content = current.$content;
1639	+
1640	+ if (nextWidth !== undefined && nextHeight !== undefined) {
1641	+ rez = nextWidth < current.width && nextHeight < current.height;
1642	+ } else if ($content) {
1643	+ rez = $.fancybox.getTranslate($content);
1644	+ rez = rez.width < current.width && rez.height < current.height;
1645	+ }
1646	+
1647	+ return rez;
1648	+ },
1649	+
1650	+ // Check if image dimensions exceed parent element
1651	+ // ===============================================
1652	+
1653	+ canPan: function(nextWidth, nextHeight) {
1654	+ var self = this,
1655	+ current = self.current,
1656	+ pos = null,
1657	+ rez = false;
1658	+
1659	+ if (current.type === "image" && (current.isComplete \|\| (nextWidth && nextHeight)) && !current.hasError) {
1660	+ rez = self.getFitPos(current);
1661	+
1662	+ if (nextWidth !== undefined && nextHeight !== undefined) {
1663	+ pos = {width: nextWidth, height: nextHeight};
1664	+ } else if (current.isComplete) {
1665	+ pos = $.fancybox.getTranslate(current.$content);
1666	+ }
1667	+
1668	+ if (pos && rez) {
1669	+ rez = Math.abs(pos.width - rez.width) > 1.5 \|\| Math.abs(pos.height - rez.height) > 1.5;
1670	+ }
1671	+ }
1672	+
1673	+ return rez;
1674	+ },
1675	+
1676	+ // Load content into the slide
1677	+ // ===========================
1678	+
1679	+ loadSlide: function(slide) {
1680	+ var self = this,
1681	+ type,
1682	+ $slide,
1683	+ ajaxLoad;
1684	+
1685	+ if (slide.isLoading \|\| slide.isLoaded) {
1686	+ return;
1687	+ }
1688	+
1689	+ slide.isLoading = true;
1690	+
1691	+ if (self.trigger("beforeLoad", slide) === false) {
1692	+ slide.isLoading = false;
1693	+
1694	+ return false;
1695	+ }
1696	+
1697	+ type = slide.type;
1698	+ $slide = slide.$slide;
1699	+
1700	+ $slide
1701	+ .off("refresh")
1702	+ .trigger("onReset")
1703	+ .addClass(slide.opts.slideClass);
1704	+
1705	+ // Create content depending on the type
1706	+ switch (type) {
1707	+ case "image":
1708	+ self.setImage(slide);
1709	+
1710	+ break;
1711	+
1712	+ case "iframe":
1713	+ self.setIframe(slide);
1714	+
1715	+ break;
1716	+
1717	+ case "html":
1718	+ self.setContent(slide, slide.src \|\| slide.content);
1719	+
1720	+ break;
1721	+
1722	+ case "video":
1723	+ self.setContent(
1724	+ slide,
1725	+ slide.opts.video.tpl
1726	+ .replace(/\{\{src\}\}/gi, slide.src)
1727	+ .replace("{{format}}", slide.opts.videoFormat \|\| slide.opts.video.format \|\| "")
1728	+ .replace("{{poster}}", slide.thumb \|\| "")
1729	+ );
1730	+
1731	+ break;
1732	+
1733	+ case "inline":
1734	+ if ($(slide.src).length) {
1735	+ self.setContent(slide, $(slide.src));
1736	+ } else {
1737	+ self.setError(slide);
1738	+ }
1739	+
1740	+ break;
1741	+
1742	+ case "ajax":
1743	+ self.showLoading(slide);
1744	+
1745	+ ajaxLoad = $.ajax(
1746	+ $.extend({}, slide.opts.ajax.settings, {
1747	+ url: slide.src,
1748	+ success: function(data, textStatus) {
1749	+ if (textStatus === "success") {
1750	+ self.setContent(slide, data);
1751	+ }
1752	+ },
1753	+ error: function(jqXHR, textStatus) {
1754	+ if (jqXHR && textStatus !== "abort") {
1755	+ self.setError(slide);
1756	+ }
1757	+ }
1758	+ })
1759	+ );
1760	+
1761	+ $slide.one("onReset", function() {
1762	+ ajaxLoad.abort();
1763	+ });
1764	+
1765	+ break;
1766	+
1767	+ default:
1768	+ self.setError(slide);
1769	+
1770	+ break;
1771	+ }
1772	+
1773	+ return true;
1774	+ },
1775	+
1776	+ // Use thumbnail image, if possible
1777	+ // ================================
1778	+
1779	+ setImage: function(slide) {
1780	+ var self = this,
1781	+ ghost;
1782	+
1783	+ // Check if need to show loading icon
1784	+ setTimeout(function() {
1785	+ var $img = slide.$image;
1786	+
1787	+ if (!self.isClosing && slide.isLoading && (!$img \|\| !$img.length \|\| !$img[0].complete) && !slide.hasError) {
1788	+ self.showLoading(slide);
1789	+ }
1790	+ }, 50);
1791	+
1792	+ //Check if image has srcset
1793	+ self.checkSrcset(slide);
1794	+
1795	+ // This will be wrapper containing both ghost and actual image
1796	+ slide.$content = $('<div class="fancybox-content"></div>')
1797	+ .addClass("fancybox-is-hidden")
1798	+ .appendTo(slide.$slide.addClass("fancybox-slide--image"));
1799	+
1800	+ // If we have a thumbnail, we can display it while actual image is loading
1801	+ // Users will not stare at black screen and actual image will appear gradually
1802	+ if (slide.opts.preload !== false && slide.opts.width && slide.opts.height && slide.thumb) {
1803	+ slide.width = slide.opts.width;
1804	+ slide.height = slide.opts.height;
1805	+
1806	+ ghost = document.createElement("img");
1807	+
1808	+ ghost.onerror = function() {
1809	+ $(this).remove();
1810	+
1811	+ slide.$ghost = null;
1812	+ };
1813	+
1814	+ ghost.onload = function() {
1815	+ self.afterLoad(slide);
1816	+ };
1817	+
1818	+ slide.$ghost = $(ghost)
1819	+ .addClass("fancybox-image")
1820	+ .appendTo(slide.$content)
1821	+ .attr("src", slide.thumb);
1822	+ }
1823	+
1824	+ // Start loading actual image
1825	+ self.setBigImage(slide);
1826	+ },
1827	+
1828	+ // Check if image has srcset and get the source
1829	+ // ============================================
1830	+ checkSrcset: function(slide) {
1831	+ var srcset = slide.opts.srcset \|\| slide.opts.image.srcset,
1832	+ found,
1833	+ temp,
1834	+ pxRatio,
1835	+ windowWidth;
1836	+
1837	+ // If we have "srcset", then we need to find first matching "src" value.
1838	+ // This is necessary, because when you set an src attribute, the browser will preload the image
1839	+ // before any javascript or even CSS is applied.
1840	+ if (srcset) {
1841	+ pxRatio = window.devicePixelRatio \|\| 1;
1842	+ windowWidth = window.innerWidth * pxRatio;
1843	+
1844	+ temp = srcset.split(",").map(function(el) {
1845	+ var ret = {};
1846	+
1847	+ el.trim()
1848	+ .split(/\s+/)
1849	+ .forEach(function(el, i) {
1850	+ var value = parseInt(el.substring(0, el.length - 1), 10);
1851	+
1852	+ if (i === 0) {
1853	+ return (ret.url = el);
1854	+ }
1855	+
1856	+ if (value) {
1857	+ ret.value = value;
1858	+ ret.postfix = el[el.length - 1];
1859	+ }
1860	+ });
1861	+
1862	+ return ret;
1863	+ });
1864	+
1865	+ // Sort by value
1866	+ temp.sort(function(a, b) {
1867	+ return a.value - b.value;
1868	+ });
1869	+
1870	+ // Ok, now we have an array of all srcset values
1871	+ for (var j = 0; j < temp.length; j++) {
1872	+ var el = temp[j];
1873	+
1874	+ if ((el.postfix === "w" && el.value >= windowWidth) \|\| (el.postfix === "x" && el.value >= pxRatio)) {
1875	+ found = el;
1876	+ break;
1877	+ }
1878	+ }
1879	+
1880	+ // If not found, take the last one
1881	+ if (!found && temp.length) {
1882	+ found = temp[temp.length - 1];
1883	+ }
1884	+
1885	+ if (found) {
1886	+ slide.src = found.url;
1887	+
1888	+ // If we have default width/height values, we can calculate height for matching source
1889	+ if (slide.width && slide.height && found.postfix == "w") {
1890	+ slide.height = (slide.width / slide.height) * found.value;
1891	+ slide.width = found.value;
1892	+ }
1893	+
1894	+ slide.opts.srcset = srcset;
1895	+ }
1896	+ }
1897	+ },
1898	+
1899	+ // Create full-size image
1900	+ // ======================
1901	+
1902	+ setBigImage: function(slide) {
1903	+ var self = this,
1904	+ img = document.createElement("img"),
1905	+ $img = $(img);
1906	+
1907	+ slide.$image = $img
1908	+ .one("error", function() {
1909	+ self.setError(slide);
1910	+ })
1911	+ .one("load", function() {
1912	+ var sizes;
1913	+
1914	+ if (!slide.$ghost) {
1915	+ self.resolveImageSlideSize(slide, this.naturalWidth, this.naturalHeight);
1916	+
1917	+ self.afterLoad(slide);
1918	+ }
1919	+
1920	+ if (self.isClosing) {
1921	+ return;
1922	+ }
1923	+
1924	+ if (slide.opts.srcset) {
1925	+ sizes = slide.opts.sizes;
1926	+
1927	+ if (!sizes \|\| sizes === "auto") {
1928	+ sizes =
1929	+ (slide.width / slide.height > 1 && $W.width() / $W.height() > 1 ? "100" : Math.round((slide.width / slide.height) * 100)) +
1930	+ "vw";
1931	+ }
1932	+
1933	+ $img.attr("sizes", sizes).attr("srcset", slide.opts.srcset);
1934	+ }
1935	+
1936	+ // Hide temporary image after some delay
1937	+ if (slide.$ghost) {
1938	+ setTimeout(function() {
1939	+ if (slide.$ghost && !self.isClosing) {
1940	+ slide.$ghost.hide();
1941	+ }
1942	+ }, Math.min(300, Math.max(1000, slide.height / 1600)));
1943	+ }
1944	+
1945	+ self.hideLoading(slide);
1946	+ })
1947	+ .addClass("fancybox-image")
1948	+ .attr("src", slide.src)
1949	+ .appendTo(slide.$content);
1950	+
1951	+ if ((img.complete \|\| img.readyState == "complete") && $img.naturalWidth && $img.naturalHeight) {
1952	+ $img.trigger("load");
1953	+ } else if (img.error) {
1954	+ $img.trigger("error");
1955	+ }
1956	+ },
1957	+
1958	+ // Computes the slide size from image size and maxWidth/maxHeight
1959	+ // ==============================================================
1960	+
1961	+ resolveImageSlideSize: function(slide, imgWidth, imgHeight) {
1962	+ var maxWidth = parseInt(slide.opts.width, 10),
1963	+ maxHeight = parseInt(slide.opts.height, 10);
1964	+
1965	+ // Sets the default values from the image
1966	+ slide.width = imgWidth;
1967	+ slide.height = imgHeight;
1968	+
1969	+ if (maxWidth > 0) {
1970	+ slide.width = maxWidth;
1971	+ slide.height = Math.floor((maxWidth * imgHeight) / imgWidth);
1972	+ }
1973	+
1974	+ if (maxHeight > 0) {
1975	+ slide.width = Math.floor((maxHeight * imgWidth) / imgHeight);
1976	+ slide.height = maxHeight;
1977	+ }
1978	+ },
1979	+
1980	+ // Create iframe wrapper, iframe and bindings
1981	+ // ==========================================
1982	+
1983	+ setIframe: function(slide) {
1984	+ var self = this,
1985	+ opts = slide.opts.iframe,
1986	+ $slide = slide.$slide,
1987	+ $iframe;
1988	+
1989	+ // Fix responsive iframes on iOS (along with `position:absolute;` for iframe element)
1990	+ if ($.fancybox.isMobile) {
1991	+ opts.css.overflow = "scroll";
1992	+ }
1993	+
1994	+ slide.$content = $('<div class="fancybox-content' + (opts.preload ? " fancybox-is-hidden" : "") + '"></div>')
1995	+ .css(opts.css)
1996	+ .appendTo($slide);
1997	+
1998	+ $slide.addClass("fancybox-slide--" + slide.contentType);
1999	+
2000	+ slide.$iframe = $iframe = $(opts.tpl.replace(/\{rnd\}/g, new Date().getTime()))
2001	+ .attr(opts.attr)
2002	+ .appendTo(slide.$content);
2003	+
2004	+ if (opts.preload) {
2005	+ self.showLoading(slide);
2006	+
2007	+ // Unfortunately, it is not always possible to determine if iframe is successfully loaded
2008	+ // (due to browser security policy)
2009	+
2010	+ $iframe.on("load.fb error.fb", function(e) {
2011	+ this.isReady = 1;
2012	+
2013	+ slide.$slide.trigger("refresh");
2014	+
2015	+ self.afterLoad(slide);
2016	+ });
2017	+
2018	+ // Recalculate iframe content size
2019	+ // ===============================
2020	+
2021	+ $slide.on("refresh.fb", function() {
2022	+ var $content = slide.$content,
2023	+ frameWidth = opts.css.width,
2024	+ frameHeight = opts.css.height,
2025	+ $contents,
2026	+ $body;
2027	+
2028	+ if ($iframe[0].isReady !== 1) {
2029	+ return;
2030	+ }
2031	+
2032	+ try {
2033	+ $contents = $iframe.contents();
2034	+ $body = $contents.find("body");
2035	+ } catch (ignore) {}
2036	+
2037	+ // Calculate contnet dimensions if it is accessible
2038	+ if ($body && $body.length && $body.children().length) {
2039	+ // Avoid scrolling to top (if multiple instances)
2040	+ $slide.css("overflow", "visible");
2041	+
2042	+ $content.css({
2043	+ width: "100%",
2044	+ "max-width": "100%",
2045	+ height: "9999px"
2046	+ });
2047	+
2048	+ if (frameWidth === undefined) {
2049	+ frameWidth = Math.ceil(Math.max($body[0].clientWidth, $body.outerWidth(true)));
2050	+ }
2051	+
2052	+ $content.css("width", frameWidth ? frameWidth : "").css("max-width", "");
2053	+
2054	+ if (frameHeight === undefined) {
2055	+ frameHeight = Math.ceil(Math.max($body[0].clientHeight, $body.outerHeight(true)));
2056	+ }
2057	+
2058	+ $content.css("height", frameHeight ? frameHeight : "");
2059	+
2060	+ $slide.css("overflow", "auto");
2061	+ }
2062	+
2063	+ $content.removeClass("fancybox-is-hidden");
2064	+ });
2065	+ } else {
2066	+ self.afterLoad(slide);
2067	+ }
2068	+
2069	+ $iframe.attr("src", slide.src);
2070	+
2071	+ // Remove iframe if closing or changing gallery item
2072	+ $slide.one("onReset", function() {
2073	+ // This helps IE not to throw errors when closing
2074	+ try {
2075	+ $(this)
2076	+ .find("iframe")
2077	+ .hide()
2078	+ .unbind()
2079	+ .attr("src", "//about:blank");
2080	+ } catch (ignore) {}
2081	+
2082	+ $(this)
2083	+ .off("refresh.fb")
2084	+ .empty();
2085	+
2086	+ slide.isLoaded = false;
2087	+ slide.isRevealed = false;
2088	+ });
2089	+ },
2090	+
2091	+ // Wrap and append content to the slide
2092	+ // ======================================
2093	+
2094	+ setContent: function(slide, content) {
2095	+ var self = this;
2096	+
2097	+ if (self.isClosing) {
2098	+ return;
2099	+ }
2100	+
2101	+ self.hideLoading(slide);
2102	+
2103	+ if (slide.$content) {
2104	+ $.fancybox.stop(slide.$content);
2105	+ }
2106	+
2107	+ slide.$slide.empty();
2108	+
2109	+ // If content is a jQuery object, then it will be moved to the slide.
2110	+ // The placeholder is created so we will know where to put it back.
2111	+ if (isQuery(content) && content.parent().length) {
2112	+ // Make sure content is not already moved to fancyBox
2113	+ if (content.hasClass("fancybox-content") \|\| content.parent().hasClass("fancybox-content")) {
2114	+ content.parents(".fancybox-slide").trigger("onReset");
2115	+ }
2116	+
2117	+ // Create temporary element marking original place of the content
2118	+ slide.$placeholder = $("<div>")
2119	+ .hide()
2120	+ .insertAfter(content);
2121	+
2122	+ // Make sure content is visible
2123	+ content.css("display", "inline-block");
2124	+ } else if (!slide.hasError) {
2125	+ // If content is just a plain text, try to convert it to html
2126	+ if ($.type(content) === "string") {
2127	+ content = $("<div>")
2128	+ .append($.trim(content))
2129	+ .contents();
2130	+ }
2131	+
2132	+ // If "filter" option is provided, then filter content
2133	+ if (slide.opts.filter) {
2134	+ content = $("<div>")
2135	+ .html(content)
2136	+ .find(slide.opts.filter);
2137	+ }
2138	+ }
2139	+
2140	+ slide.$slide.one("onReset", function() {
2141	+ // Pause all html5 video/audio
2142	+ $(this)
2143	+ .find("video,audio")
2144	+ .trigger("pause");
2145	+
2146	+ // Put content back
2147	+ if (slide.$placeholder) {
2148	+ slide.$placeholder.after(content.removeClass("fancybox-content").hide()).remove();
2149	+
2150	+ slide.$placeholder = null;
2151	+ }
2152	+
2153	+ // Remove custom close button
2154	+ if (slide.$smallBtn) {
2155	+ slide.$smallBtn.remove();
2156	+
2157	+ slide.$smallBtn = null;
2158	+ }
2159	+
2160	+ // Remove content and mark slide as not loaded
2161	+ if (!slide.hasError) {
2162	+ $(this).empty();
2163	+
2164	+ slide.isLoaded = false;
2165	+ slide.isRevealed = false;
2166	+ }
2167	+ });
2168	+
2169	+ $(content).appendTo(slide.$slide);
2170	+
2171	+ if ($(content).is("video,audio")) {
2172	+ $(content).addClass("fancybox-video");
2173	+
2174	+ $(content).wrap("<div></div>");
2175	+
2176	+ slide.contentType = "video";
2177	+
2178	+ slide.opts.width = slide.opts.width \|\| $(content).attr("width");
2179	+ slide.opts.height = slide.opts.height \|\| $(content).attr("height");
2180	+ }
2181	+
2182	+ slide.$content = slide.$slide
2183	+ .children()
2184	+ .filter("div,form,main,video,audio,article,.fancybox-content")
2185	+ .first();
2186	+
2187	+ slide.$content.siblings().hide();
2188	+
2189	+ // Re-check if there is a valid content
2190	+ // (in some cases, ajax response can contain various elements or plain text)
2191	+ if (!slide.$content.length) {
2192	+ slide.$content = slide.$slide
2193	+ .wrapInner("<div></div>")
2194	+ .children()
2195	+ .first();
2196	+ }
2197	+
2198	+ slide.$content.addClass("fancybox-content");
2199	+
2200	+ slide.$slide.addClass("fancybox-slide--" + slide.contentType);
2201	+
2202	+ self.afterLoad(slide);
2203	+ },
2204	+
2205	+ // Display error message
2206	+ // =====================
2207	+
2208	+ setError: function(slide) {
2209	+ slide.hasError = true;
2210	+
2211	+ slide.$slide
2212	+ .trigger("onReset")
2213	+ .removeClass("fancybox-slide--" + slide.contentType)
2214	+ .addClass("fancybox-slide--error");
2215	+
2216	+ slide.contentType = "html";
2217	+
2218	+ this.setContent(slide, this.translate(slide, slide.opts.errorTpl));
2219	+
2220	+ if (slide.pos === this.currPos) {
2221	+ this.isAnimating = false;
2222	+ }
2223	+ },
2224	+
2225	+ // Show loading icon inside the slide
2226	+ // ==================================
2227	+
2228	+ showLoading: function(slide) {
2229	+ var self = this;
2230	+
2231	+ slide = slide \|\| self.current;
2232	+
2233	+ if (slide && !slide.$spinner) {
2234	+ slide.$spinner = $(self.translate(self, self.opts.spinnerTpl))
2235	+ .appendTo(slide.$slide)
2236	+ .hide()
2237	+ .fadeIn("fast");
2238	+ }
2239	+ },
2240	+
2241	+ // Remove loading icon from the slide
2242	+ // ==================================
2243	+
2244	+ hideLoading: function(slide) {
2245	+ var self = this;
2246	+
2247	+ slide = slide \|\| self.current;
2248	+
2249	+ if (slide && slide.$spinner) {
2250	+ slide.$spinner.stop().remove();
2251	+
2252	+ delete slide.$spinner;
2253	+ }
2254	+ },
2255	+
2256	+ // Adjustments after slide content has been loaded
2257	+ // ===============================================
2258	+
2259	+ afterLoad: function(slide) {
2260	+ var self = this;
2261	+
2262	+ if (self.isClosing) {
2263	+ return;
2264	+ }
2265	+
2266	+ slide.isLoading = false;
2267	+ slide.isLoaded = true;
2268	+
2269	+ self.trigger("afterLoad", slide);
2270	+
2271	+ self.hideLoading(slide);
2272	+
2273	+ // Add small close button
2274	+ if (slide.opts.smallBtn && (!slide.$smallBtn \|\| !slide.$smallBtn.length)) {
2275	+ slide.$smallBtn = $(self.translate(slide, slide.opts.btnTpl.smallBtn)).appendTo(slide.$content);
2276	+ }
2277	+
2278	+ // Disable right click
2279	+ if (slide.opts.protect && slide.$content && !slide.hasError) {
2280	+ slide.$content.on("contextmenu.fb", function(e) {
2281	+ if (e.button == 2) {
2282	+ e.preventDefault();
2283	+ }
2284	+
2285	+ return true;
2286	+ });
2287	+
2288	+ // Add fake element on top of the image
2289	+ // This makes a bit harder for user to select image
2290	+ if (slide.type === "image") {
2291	+ $('<div class="fancybox-spaceball"></div>').appendTo(slide.$content);
2292	+ }
2293	+ }
2294	+
2295	+ self.adjustCaption(slide);
2296	+
2297	+ self.adjustLayout(slide);
2298	+
2299	+ if (slide.pos === self.currPos) {
2300	+ self.updateCursor();
2301	+ }
2302	+
2303	+ self.revealContent(slide);
2304	+ },
2305	+
2306	+ // Prevent caption overlap,
2307	+ // fix css inconsistency across browsers
2308	+ // =====================================
2309	+
2310	+ adjustCaption: function(slide) {
2311	+ var self = this,
2312	+ current = slide \|\| self.current,
2313	+ caption = current.opts.caption,
2314	+ $caption = self.$refs.caption,
2315	+ captionH = false;
2316	+
2317	+ if (current.opts.preventCaptionOverlap && caption && caption.length) {
2318	+ if (current.pos !== self.currPos) {
2319	+ $caption = $caption
2320	+ .clone()
2321	+ .empty()
2322	+ .appendTo($caption.parent());
2323	+
2324	+ $caption.html(caption);
2325	+
2326	+ captionH = $caption.outerHeight(true);
2327	+
2328	+ $caption.empty().remove();
2329	+ } else if (self.$caption) {
2330	+ captionH = self.$caption.outerHeight(true);
2331	+ }
2332	+
2333	+ current.$slide.css("padding-bottom", captionH \|\| "");
2334	+ }
2335	+ },
2336	+
2337	+ // Simple hack to fix inconsistency across browsers, described here (affects Edge, too):
2338	+ // https://bugzilla.mozilla.org/show_bug.cgi?id=748518
2339	+ // ====================================================================================
2340	+
2341	+ adjustLayout: function(slide) {
2342	+ var self = this,
2343	+ current = slide \|\| self.current,
2344	+ scrollHeight,
2345	+ marginBottom,
2346	+ inlinePadding,
2347	+ actualPadding;
2348	+
2349	+ if (current.isLoaded && current.opts.disableLayoutFix !== true) {
2350	+ current.$content.css("margin-bottom", "");
2351	+
2352	+ // If we would always set margin-bottom for the content,
2353	+ // then it would potentially break vertical align
2354	+ if (current.$content.outerHeight() > current.$slide.height() + 0.5) {
2355	+ inlinePadding = current.$slide[0].style["padding-bottom"];
2356	+ actualPadding = current.$slide.css("padding-bottom");
2357	+
2358	+ if (parseFloat(actualPadding) > 0) {
2359	+ scrollHeight = current.$slide[0].scrollHeight;
2360	+
2361	+ current.$slide.css("padding-bottom", 0);
2362	+
2363	+ if (Math.abs(scrollHeight - current.$slide[0].scrollHeight) < 1) {
2364	+ marginBottom = actualPadding;
2365	+ }
2366	+
2367	+ current.$slide.css("padding-bottom", inlinePadding);
2368	+ }
2369	+ }
2370	+
2371	+ current.$content.css("margin-bottom", marginBottom);
2372	+ }
2373	+ },
2374	+
2375	+ // Make content visible
2376	+ // This method is called right after content has been loaded or
2377	+ // user navigates gallery and transition should start
2378	+ // ============================================================
2379	+
2380	+ revealContent: function(slide) {
2381	+ var self = this,
2382	+ $slide = slide.$slide,
2383	+ end = false,
2384	+ start = false,
2385	+ isMoved = self.isMoved(slide),
2386	+ isRevealed = slide.isRevealed,
2387	+ effect,
2388	+ effectClassName,
2389	+ duration,
2390	+ opacity;
2391	+
2392	+ slide.isRevealed = true;
2393	+
2394	+ effect = slide.opts[self.firstRun ? "animationEffect" : "transitionEffect"];
2395	+ duration = slide.opts[self.firstRun ? "animationDuration" : "transitionDuration"];
2396	+
2397	+ duration = parseInt(slide.forcedDuration === undefined ? duration : slide.forcedDuration, 10);
2398	+
2399	+ if (isMoved \|\| slide.pos !== self.currPos \|\| !duration) {
2400	+ effect = false;
2401	+ }
2402	+
2403	+ // Check if can zoom
2404	+ if (effect === "zoom") {
2405	+ if (slide.pos === self.currPos && duration && slide.type === "image" && !slide.hasError && (start = self.getThumbPos(slide))) {
2406	+ end = self.getFitPos(slide);
2407	+ } else {
2408	+ effect = "fade";
2409	+ }
2410	+ }
2411	+
2412	+ // Zoom animation
2413	+ // ==============
2414	+ if (effect === "zoom") {
2415	+ self.isAnimating = true;
2416	+
2417	+ end.scaleX = end.width / start.width;
2418	+ end.scaleY = end.height / start.height;
2419	+
2420	+ // Check if we need to animate opacity
2421	+ opacity = slide.opts.zoomOpacity;
2422	+
2423	+ if (opacity == "auto") {
2424	+ opacity = Math.abs(slide.width / slide.height - start.width / start.height) > 0.1;
2425	+ }
2426	+
2427	+ if (opacity) {
2428	+ start.opacity = 0.1;
2429	+ end.opacity = 1;
2430	+ }
2431	+
2432	+ // Draw image at start position
2433	+ $.fancybox.setTranslate(slide.$content.removeClass("fancybox-is-hidden"), start);
2434	+
2435	+ forceRedraw(slide.$content);
2436	+
2437	+ // Start animation
2438	+ $.fancybox.animate(slide.$content, end, duration, function() {
2439	+ self.isAnimating = false;
2440	+
2441	+ self.complete();
2442	+ });
2443	+
2444	+ return;
2445	+ }
2446	+
2447	+ self.updateSlide(slide);
2448	+
2449	+ // Simply show content if no effect
2450	+ // ================================
2451	+ if (!effect) {
2452	+ slide.$content.removeClass("fancybox-is-hidden");
2453	+
2454	+ if (!isRevealed && isMoved && slide.type === "image" && !slide.hasError) {
2455	+ slide.$content.hide().fadeIn("fast");
2456	+ }
2457	+
2458	+ if (slide.pos === self.currPos) {
2459	+ self.complete();
2460	+ }
2461	+
2462	+ return;
2463	+ }
2464	+
2465	+ // Prepare for CSS transiton
2466	+ // =========================
2467	+ $.fancybox.stop($slide);
2468	+
2469	+ //effectClassName = "fancybox-animated fancybox-slide--" + (slide.pos >= self.prevPos ? "next" : "previous") + " fancybox-fx-" + effect;
2470	+ effectClassName = "fancybox-slide--" + (slide.pos >= self.prevPos ? "next" : "previous") + " fancybox-animated fancybox-fx-" + effect;
2471	+
2472	+ $slide.addClass(effectClassName).removeClass("fancybox-slide--current"); //.addClass(effectClassName);
2473	+
2474	+ slide.$content.removeClass("fancybox-is-hidden");
2475	+
2476	+ // Force reflow
2477	+ forceRedraw($slide);
2478	+
2479	+ if (slide.type !== "image") {
2480	+ slide.$content.hide().show(0);
2481	+ }
2482	+
2483	+ $.fancybox.animate(
2484	+ $slide,
2485	+ "fancybox-slide--current",
2486	+ duration,
2487	+ function() {
2488	+ $slide.removeClass(effectClassName).css({
2489	+ transform: "",
2490	+ opacity: ""
2491	+ });
2492	+
2493	+ if (slide.pos === self.currPos) {
2494	+ self.complete();
2495	+ }
2496	+ },
2497	+ true
2498	+ );
2499	+ },
2500	+
2501	+ // Check if we can and have to zoom from thumbnail
2502	+ //================================================
2503	+
2504	+ getThumbPos: function(slide) {
2505	+ var rez = false,
2506	+ $thumb = slide.$thumb,
2507	+ thumbPos,
2508	+ btw,
2509	+ brw,
2510	+ bbw,
2511	+ blw;
2512	+
2513	+ if (!$thumb \|\| !inViewport($thumb[0])) {
2514	+ return false;
2515	+ }
2516	+
2517	+ thumbPos = $.fancybox.getTranslate($thumb);
2518	+
2519	+ btw = parseFloat($thumb.css("border-top-width") \|\| 0);
2520	+ brw = parseFloat($thumb.css("border-right-width") \|\| 0);
2521	+ bbw = parseFloat($thumb.css("border-bottom-width") \|\| 0);
2522	+ blw = parseFloat($thumb.css("border-left-width") \|\| 0);
2523	+
2524	+ rez = {
2525	+ top: thumbPos.top + btw,
2526	+ left: thumbPos.left + blw,
2527	+ width: thumbPos.width - brw - blw,
2528	+ height: thumbPos.height - btw - bbw,
2529	+ scaleX: 1,
2530	+ scaleY: 1
2531	+ };
2532	+
2533	+ return thumbPos.width > 0 && thumbPos.height > 0 ? rez : false;
2534	+ },
2535	+
2536	+ // Final adjustments after current gallery item is moved to position
2537	+ // and it`s content is loaded
2538	+ // ==================================================================
2539	+
2540	+ complete: function() {
2541	+ var self = this,
2542	+ current = self.current,
2543	+ slides = {},
2544	+ $el;
2545	+
2546	+ if (self.isMoved() \|\| !current.isLoaded) {
2547	+ return;
2548	+ }
2549	+
2550	+ if (!current.isComplete) {
2551	+ current.isComplete = true;
2552	+
2553	+ current.$slide.siblings().trigger("onReset");
2554	+
2555	+ self.preload("inline");
2556	+
2557	+ // Trigger any CSS transiton inside the slide
2558	+ forceRedraw(current.$slide);
2559	+
2560	+ current.$slide.addClass("fancybox-slide--complete");
2561	+
2562	+ // Remove unnecessary slides
2563	+ $.each(self.slides, function(key, slide) {
2564	+ if (slide.pos >= self.currPos - 1 && slide.pos <= self.currPos + 1) {
2565	+ slides[slide.pos] = slide;
2566	+ } else if (slide) {
2567	+ $.fancybox.stop(slide.$slide);
2568	+
2569	+ slide.$slide.off().remove();
2570	+ }
2571	+ });
2572	+
2573	+ self.slides = slides;
2574	+ }
2575	+
2576	+ self.isAnimating = false;
2577	+
2578	+ self.updateCursor();
2579	+
2580	+ self.trigger("afterShow");
2581	+
2582	+ // Autoplay first html5 video/audio
2583	+ if (!!current.opts.video.autoStart) {
2584	+ current.$slide
2585	+ .find("video,audio")
2586	+ .filter(":visible:first")
2587	+ .trigger("play")
2588	+ .one("ended", function() {
2589	+ if (this.webkitExitFullscreen) {
2590	+ this.webkitExitFullscreen();
2591	+ }
2592	+
2593	+ self.next();
2594	+ });
2595	+ }
2596	+
2597	+ // Try to focus on the first focusable element
2598	+ if (current.opts.autoFocus && current.contentType === "html") {
2599	+ // Look for the first input with autofocus attribute
2600	+ $el = current.$content.find("input[autofocus]:enabled:visible:first");
2601	+
2602	+ if ($el.length) {
2603	+ $el.trigger("focus");
2604	+ } else {
2605	+ self.focus(null, true);
2606	+ }
2607	+ }
2608	+
2609	+ // Avoid jumping
2610	+ current.$slide.scrollTop(0).scrollLeft(0);
2611	+ },
2612	+
2613	+ // Preload next and previous slides
2614	+ // ================================
2615	+
2616	+ preload: function(type) {
2617	+ var self = this,
2618	+ prev,
2619	+ next;
2620	+
2621	+ if (self.group.length < 2) {
2622	+ return;
2623	+ }
2624	+
2625	+ next = self.slides[self.currPos + 1];
2626	+ prev = self.slides[self.currPos - 1];
2627	+
2628	+ if (prev && prev.type === type) {
2629	+ self.loadSlide(prev);
2630	+ }
2631	+
2632	+ if (next && next.type === type) {
2633	+ self.loadSlide(next);
2634	+ }
2635	+ },
2636	+
2637	+ // Try to find and focus on the first focusable element
2638	+ // ====================================================
2639	+
2640	+ focus: function(e, firstRun) {
2641	+ var self = this,
2642	+ focusableStr = [
2643	+ "a[href]",
2644	+ "area[href]",
2645	+ 'input:not([disabled]):not([type="hidden"]):not([aria-hidden])',
2646	+ "select:not([disabled]):not([aria-hidden])",
2647	+ "textarea:not([disabled]):not([aria-hidden])",
2648	+ "button:not([disabled]):not([aria-hidden])",
2649	+ "iframe",
2650	+ "object",
2651	+ "embed",
2652	+ "[contenteditable]",
2653	+ '[tabindex]:not([tabindex^="-"])'
2654	+ ].join(","),
2655	+ focusableItems,
2656	+ focusedItemIndex;
2657	+
2658	+ if (self.isClosing) {
2659	+ return;
2660	+ }
2661	+
2662	+ if (e \|\| !self.current \|\| !self.current.isComplete) {
2663	+ // Focus on any element inside fancybox
2664	+ focusableItems = self.$refs.container.find("*:visible");
2665	+ } else {
2666	+ // Focus inside current slide
2667	+ focusableItems = self.current.$slide.find("*:visible" + (firstRun ? ":not(.fancybox-close-small)" : ""));
2668	+ }
2669	+
2670	+ focusableItems = focusableItems.filter(focusableStr).filter(function() {
2671	+ return $(this).css("visibility") !== "hidden" && !$(this).hasClass("disabled");
2672	+ });
2673	+
2674	+ if (focusableItems.length) {
2675	+ focusedItemIndex = focusableItems.index(document.activeElement);
2676	+
2677	+ if (e && e.shiftKey) {
2678	+ // Back tab
2679	+ if (focusedItemIndex < 0 \|\| focusedItemIndex == 0) {
2680	+ e.preventDefault();
2681	+
2682	+ focusableItems.eq(focusableItems.length - 1).trigger("focus");
2683	+ }
2684	+ } else {
2685	+ // Outside or Forward tab
2686	+ if (focusedItemIndex < 0 \|\| focusedItemIndex == focusableItems.length - 1) {
2687	+ if (e) {
2688	+ e.preventDefault();
2689	+ }
2690	+
2691	+ focusableItems.eq(0).trigger("focus");
2692	+ }
2693	+ }
2694	+ } else {
2695	+ self.$refs.container.trigger("focus");
2696	+ }
2697	+ },
2698	+
2699	+ // Activates current instance - brings container to the front and enables keyboard,
2700	+ // notifies other instances about deactivating
2701	+ // =================================================================================
2702	+
2703	+ activate: function() {
2704	+ var self = this;
2705	+
2706	+ // Deactivate all instances
2707	+ $(".fancybox-container").each(function() {
2708	+ var instance = $(this).data("FancyBox");
2709	+
2710	+ // Skip self and closing instances
2711	+ if (instance && instance.id !== self.id && !instance.isClosing) {
2712	+ instance.trigger("onDeactivate");
2713	+
2714	+ instance.removeEvents();
2715	+
2716	+ instance.isVisible = false;
2717	+ }
2718	+ });
2719	+
2720	+ self.isVisible = true;
2721	+
2722	+ if (self.current \|\| self.isIdle) {
2723	+ self.update();
2724	+
2725	+ self.updateControls();
2726	+ }
2727	+
2728	+ self.trigger("onActivate");
2729	+
2730	+ self.addEvents();
2731	+ },
2732	+
2733	+ // Start closing procedure
2734	+ // This will start "zoom-out" animation if needed and clean everything up afterwards
2735	+ // =================================================================================
2736	+
2737	+ close: function(e, d) {
2738	+ var self = this,
2739	+ current = self.current,
2740	+ effect,
2741	+ duration,
2742	+ $content,
2743	+ domRect,
2744	+ opacity,
2745	+ start,
2746	+ end;
2747	+
2748	+ var done = function() {
2749	+ self.cleanUp(e);
2750	+ };
2751	+
2752	+ if (self.isClosing) {
2753	+ return false;
2754	+ }
2755	+
2756	+ self.isClosing = true;
2757	+
2758	+ // If beforeClose callback prevents closing, make sure content is centered
2759	+ if (self.trigger("beforeClose", e) === false) {
2760	+ self.isClosing = false;
2761	+
2762	+ requestAFrame(function() {
2763	+ self.update();
2764	+ });
2765	+
2766	+ return false;
2767	+ }
2768	+
2769	+ // Remove all events
2770	+ // If there are multiple instances, they will be set again by "activate" method
2771	+ self.removeEvents();
2772	+
2773	+ $content = current.$content;
2774	+ effect = current.opts.animationEffect;
2775	+ duration = $.isNumeric(d) ? d : effect ? current.opts.animationDuration : 0;
2776	+
2777	+ current.$slide.removeClass("fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated");
2778	+
2779	+ if (e !== true) {
2780	+ $.fancybox.stop(current.$slide);
2781	+ } else {
2782	+ effect = false;
2783	+ }
2784	+
2785	+ // Remove other slides
2786	+ current.$slide
2787	+ .siblings()
2788	+ .trigger("onReset")
2789	+ .remove();
2790	+
2791	+ // Trigger animations
2792	+ if (duration) {
2793	+ self.$refs.container
2794	+ .removeClass("fancybox-is-open")
2795	+ .addClass("fancybox-is-closing")
2796	+ .css("transition-duration", duration + "ms");
2797	+ }
2798	+
2799	+ // Clean up
2800	+ self.hideLoading(current);
2801	+
2802	+ self.hideControls(true);
2803	+
2804	+ self.updateCursor();
2805	+
2806	+ // Check if possible to zoom-out
2807	+ if (
2808	+ effect === "zoom" &&
2809	+ !($content && duration && current.type === "image" && !self.isMoved() && !current.hasError && (end = self.getThumbPos(current)))
2810	+ ) {
2811	+ effect = "fade";
2812	+ }
2813	+
2814	+ if (effect === "zoom") {
2815	+ $.fancybox.stop($content);
2816	+
2817	+ domRect = $.fancybox.getTranslate($content);
2818	+
2819	+ start = {
2820	+ top: domRect.top,
2821	+ left: domRect.left,
2822	+ scaleX: domRect.width / end.width,
2823	+ scaleY: domRect.height / end.height,
2824	+ width: end.width,
2825	+ height: end.height
2826	+ };
2827	+
2828	+ // Check if we need to animate opacity
2829	+ opacity = current.opts.zoomOpacity;
2830	+
2831	+ if (opacity == "auto") {
2832	+ opacity = Math.abs(current.width / current.height - end.width / end.height) > 0.1;
2833	+ }
2834	+
2835	+ if (opacity) {
2836	+ end.opacity = 0;
2837	+ }
2838	+
2839	+ $.fancybox.setTranslate($content, start);
2840	+
2841	+ forceRedraw($content);
2842	+
2843	+ $.fancybox.animate($content, end, duration, done);
2844	+
2845	+ return true;
2846	+ }
2847	+
2848	+ if (effect && duration) {
2849	+ $.fancybox.animate(
2850	+ current.$slide.addClass("fancybox-slide--previous").removeClass("fancybox-slide--current"),
2851	+ "fancybox-animated fancybox-fx-" + effect,
2852	+ duration,
2853	+ done
2854	+ );
2855	+ } else {
2856	+ // If skip animation
2857	+ if (e === true) {
2858	+ setTimeout(done, duration);
2859	+ } else {
2860	+ done();
2861	+ }
2862	+ }
2863	+
2864	+ return true;
2865	+ },
2866	+
2867	+ // Final adjustments after removing the instance
2868	+ // =============================================
2869	+
2870	+ cleanUp: function(e) {
2871	+ var self = this,
2872	+ instance,
2873	+ $focus = self.current.opts.$orig,
2874	+ x,
2875	+ y;
2876	+
2877	+ self.current.$slide.trigger("onReset");
2878	+
2879	+ self.$refs.container.empty().remove();
2880	+
2881	+ self.trigger("afterClose", e);
2882	+
2883	+ // Place back focus
2884	+ if (!!self.current.opts.backFocus) {
2885	+ if (!$focus \|\| !$focus.length \|\| !$focus.is(":visible")) {
2886	+ $focus = self.$trigger;
2887	+ }
2888	+
2889	+ if ($focus && $focus.length) {
2890	+ x = window.scrollX;
2891	+ y = window.scrollY;
2892	+
2893	+ $focus.trigger("focus");
2894	+
2895	+ $("html, body")
2896	+ .scrollTop(y)
2897	+ .scrollLeft(x);
2898	+ }
2899	+ }
2900	+
2901	+ self.current = null;
2902	+
2903	+ // Check if there are other instances
2904	+ instance = $.fancybox.getInstance();
2905	+
2906	+ if (instance) {
2907	+ instance.activate();
2908	+ } else {
2909	+ $("body").removeClass("fancybox-active compensate-for-scrollbar");
2910	+
2911	+ $("#fancybox-style-noscroll").remove();
2912	+ }
2913	+ },
2914	+
2915	+ // Call callback and trigger an event
2916	+ // ==================================
2917	+
2918	+ trigger: function(name, slide) {
2919	+ var args = Array.prototype.slice.call(arguments, 1),
2920	+ self = this,
2921	+ obj = slide && slide.opts ? slide : self.current,
2922	+ rez;
2923	+
2924	+ if (obj) {
2925	+ args.unshift(obj);
2926	+ } else {
2927	+ obj = self;
2928	+ }
2929	+
2930	+ args.unshift(self);
2931	+
2932	+ if ($.isFunction(obj.opts[name])) {
2933	+ rez = obj.opts[name].apply(obj, args);
2934	+ }
2935	+
2936	+ if (rez === false) {
2937	+ return rez;
2938	+ }
2939	+
2940	+ if (name === "afterClose" \|\| !self.$refs) {
2941	+ $D.trigger(name + ".fb", args);
2942	+ } else {
2943	+ self.$refs.container.trigger(name + ".fb", args);
2944	+ }
2945	+ },
2946	+
2947	+ // Update infobar values, navigation button states and reveal caption
2948	+ // ==================================================================
2949	+
2950	+ updateControls: function() {
2951	+ var self = this,
2952	+ current = self.current,
2953	+ index = current.index,
2954	+ $container = self.$refs.container,
2955	+ $caption = self.$refs.caption,
2956	+ caption = current.opts.caption;
2957	+
2958	+ // Recalculate content dimensions
2959	+ current.$slide.trigger("refresh");
2960	+
2961	+ self.$caption = caption && caption.length ? $caption.html(caption) : null;
2962	+
2963	+ if (!self.hasHiddenControls && !self.isIdle) {
2964	+ self.showControls();
2965	+ }
2966	+
2967	+ // Update info and navigation elements
2968	+ $container.find("[data-fancybox-count]").html(self.group.length);
2969	+ $container.find("[data-fancybox-index]").html(index + 1);
2970	+
2971	+ $container.find("[data-fancybox-prev]").prop("disabled", !current.opts.loop && index <= 0);
2972	+ $container.find("[data-fancybox-next]").prop("disabled", !current.opts.loop && index >= self.group.length - 1);
2973	+
2974	+ if (current.type === "image") {
2975	+ // Re-enable buttons; update download button source
2976	+ $container
2977	+ .find("[data-fancybox-zoom]")
2978	+ .show()
2979	+ .end()
2980	+ .find("[data-fancybox-download]")
2981	+ .attr("href", current.opts.image.src \|\| current.src)
2982	+ .show();
2983	+ } else if (current.opts.toolbar) {
2984	+ $container.find("[data-fancybox-download],[data-fancybox-zoom]").hide();
2985	+ }
2986	+
2987	+ // Make sure focus is not on disabled button/element
2988	+ if ($(document.activeElement).is(":hidden,[disabled]")) {
2989	+ self.$refs.container.trigger("focus");
2990	+ }
2991	+ },
2992	+
2993	+ // Hide toolbar and caption
2994	+ // ========================
2995	+
2996	+ hideControls: function(andCaption) {
2997	+ var self = this,
2998	+ arr = ["infobar", "toolbar", "nav"];
2999	+
3000	+ if (andCaption \|\| !self.current.opts.preventCaptionOverlap) {
3001	+ arr.push("caption");
3002	+ }
3003	+
3004	+ this.$refs.container.removeClass(
3005	+ arr
3006	+ .map(function(i) {
3007	+ return "fancybox-show-" + i;
3008	+ })
3009	+ .join(" ")
3010	+ );
3011	+
3012	+ this.hasHiddenControls = true;
3013	+ },
3014	+
3015	+ showControls: function() {
3016	+ var self = this,
3017	+ opts = self.current ? self.current.opts : self.opts,
3018	+ $container = self.$refs.container;
3019	+
3020	+ self.hasHiddenControls = false;
3021	+ self.idleSecondsCounter = 0;
3022	+
3023	+ $container
3024	+ .toggleClass("fancybox-show-toolbar", !!(opts.toolbar && opts.buttons))
3025	+ .toggleClass("fancybox-show-infobar", !!(opts.infobar && self.group.length > 1))
3026	+ .toggleClass("fancybox-show-caption", !!self.$caption)
3027	+ .toggleClass("fancybox-show-nav", !!(opts.arrows && self.group.length > 1))
3028	+ .toggleClass("fancybox-is-modal", !!opts.modal);
3029	+ },
3030	+
3031	+ // Toggle toolbar and caption
3032	+ // ==========================
3033	+
3034	+ toggleControls: function() {
3035	+ if (this.hasHiddenControls) {
3036	+ this.showControls();
3037	+ } else {
3038	+ this.hideControls();
3039	+ }
3040	+ }
3041	+ });
3042	+
3043	+ $.fancybox = {
3044	+ version: "3.5.2",
3045	+ defaults: defaults,
3046	+
3047	+ // Get current instance and execute a command.
3048	+ //
3049	+ // Examples of usage:
3050	+ //
3051	+ // $instance = $.fancybox.getInstance();
3052	+ // $.fancybox.getInstance().jumpTo( 1 );
3053	+ // $.fancybox.getInstance( 'jumpTo', 1 );
3054	+ // $.fancybox.getInstance( function() {
3055	+ // console.info( this.currIndex );
3056	+ // });
3057	+ // ======================================================
3058	+
3059	+ getInstance: function(command) {
3060	+ var instance = $('.fancybox-container:not(".fancybox-is-closing"):last').data("FancyBox"),
3061	+ args = Array.prototype.slice.call(arguments, 1);
3062	+
3063	+ if (instance instanceof FancyBox) {
3064	+ if ($.type(command) === "string") {
3065	+ instance[command].apply(instance, args);
3066	+ } else if ($.type(command) === "function") {
3067	+ command.apply(instance, args);
3068	+ }
3069	+
3070	+ return instance;
3071	+ }
3072	+
3073	+ return false;
3074	+ },
3075	+
3076	+ // Create new instance
3077	+ // ===================
3078	+
3079	+ open: function(items, opts, index) {
3080	+ return new FancyBox(items, opts, index);
3081	+ },
3082	+
3083	+ // Close current or all instances
3084	+ // ==============================
3085	+
3086	+ close: function(all) {
3087	+ var instance = this.getInstance();
3088	+
3089	+ if (instance) {
3090	+ instance.close();
3091	+
3092	+ // Try to find and close next instance
3093	+ if (all === true) {
3094	+ this.close(all);
3095	+ }
3096	+ }
3097	+ },
3098	+
3099	+ // Close all instances and unbind all events
3100	+ // =========================================
3101	+
3102	+ destroy: function() {
3103	+ this.close(true);
3104	+
3105	+ $D.add("body").off("click.fb-start", "**");
3106	+ },
3107	+
3108	+ // Try to detect mobile devices
3109	+ // ============================
3110	+
3111	+ isMobile: /Android\|webOS\|iPhone\|iPad\|iPod\|BlackBerry\|IEMobile\|Opera Mini/i.test(navigator.userAgent),
3112	+
3113	+ // Detect if 'translate3d' support is available
3114	+ // ============================================
3115	+
3116	+ use3d: (function() {
3117	+ var div = document.createElement("div");
3118	+
3119	+ return (
3120	+ window.getComputedStyle &&
3121	+ window.getComputedStyle(div) &&
3122	+ window.getComputedStyle(div).getPropertyValue("transform") &&
3123	+ !(document.documentMode && document.documentMode < 11)
3124	+ );
3125	+ })(),
3126	+
3127	+ // Helper function to get current visual state of an element
3128	+ // returns array[ top, left, horizontal-scale, vertical-scale, opacity ]
3129	+ // =====================================================================
3130	+
3131	+ getTranslate: function($el) {
3132	+ var domRect;
3133	+
3134	+ if (!$el \|\| !$el.length) {
3135	+ return false;
3136	+ }
3137	+
3138	+ domRect = $el[0].getBoundingClientRect();
3139	+
3140	+ return {
3141	+ top: domRect.top \|\| 0,
3142	+ left: domRect.left \|\| 0,
3143	+ width: domRect.width,
3144	+ height: domRect.height,
3145	+ opacity: parseFloat($el.css("opacity"))
3146	+ };
3147	+ },
3148	+
3149	+ // Shortcut for setting "translate3d" properties for element
3150	+ // Can set be used to set opacity, too
3151	+ // ========================================================
3152	+
3153	+ setTranslate: function($el, props) {
3154	+ var str = "",
3155	+ css = {};
3156	+
3157	+ if (!$el \|\| !props) {
3158	+ return;
3159	+ }
3160	+
3161	+ if (props.left !== undefined \|\| props.top !== undefined) {
3162	+ str =
3163	+ (props.left === undefined ? $el.position().left : props.left) +
3164	+ "px, " +
3165	+ (props.top === undefined ? $el.position().top : props.top) +
3166	+ "px";
3167	+
3168	+ if (this.use3d) {
3169	+ str = "translate3d(" + str + ", 0px)";
3170	+ } else {
3171	+ str = "translate(" + str + ")";
3172	+ }
3173	+ }
3174	+
3175	+ if (props.scaleX !== undefined && props.scaleY !== undefined) {
3176	+ str += " scale(" + props.scaleX + ", " + props.scaleY + ")";
3177	+ } else if (props.scaleX !== undefined) {
3178	+ str += " scaleX(" + props.scaleX + ")";
3179	+ }
3180	+
3181	+ if (str.length) {
3182	+ css.transform = str;
3183	+ }
3184	+
3185	+ if (props.opacity !== undefined) {
3186	+ css.opacity = props.opacity;
3187	+ }
3188	+
3189	+ if (props.width !== undefined) {
3190	+ css.width = props.width;
3191	+ }
3192	+
3193	+ if (props.height !== undefined) {
3194	+ css.height = props.height;
3195	+ }
3196	+
3197	+ return $el.css(css);
3198	+ },
3199	+
3200	+ // Simple CSS transition handler
3201	+ // =============================
3202	+
3203	+ animate: function($el, to, duration, callback, leaveAnimationName) {
3204	+ var self = this,
3205	+ from;
3206	+
3207	+ if ($.isFunction(duration)) {
3208	+ callback = duration;
3209	+ duration = null;
3210	+ }
3211	+
3212	+ self.stop($el);
3213	+
3214	+ from = self.getTranslate($el);
3215	+
3216	+ $el.on(transitionEnd, function(e) {
3217	+ // Skip events from child elements and z-index change
3218	+ if (e && e.originalEvent && (!$el.is(e.originalEvent.target) \|\| e.originalEvent.propertyName == "z-index")) {
3219	+ return;
3220	+ }
3221	+
3222	+ self.stop($el);
3223	+
3224	+ if ($.isNumeric(duration)) {
3225	+ $el.css("transition-duration", "");
3226	+ }
3227	+
3228	+ if ($.isPlainObject(to)) {
3229	+ if (to.scaleX !== undefined && to.scaleY !== undefined) {
3230	+ self.setTranslate($el, {
3231	+ top: to.top,
3232	+ left: to.left,
3233	+ width: from.width * to.scaleX,
3234	+ height: from.height * to.scaleY,
3235	+ scaleX: 1,
3236	+ scaleY: 1
3237	+ });
3238	+ }
3239	+ } else if (leaveAnimationName !== true) {
3240	+ $el.removeClass(to);
3241	+ }
3242	+
3243	+ if ($.isFunction(callback)) {
3244	+ callback(e);
3245	+ }
3246	+ });
3247	+
3248	+ if ($.isNumeric(duration)) {
3249	+ $el.css("transition-duration", duration + "ms");
3250	+ }
3251	+
3252	+ // Start animation by changing CSS properties or class name
3253	+ if ($.isPlainObject(to)) {
3254	+ if (to.scaleX !== undefined && to.scaleY !== undefined) {
3255	+ delete to.width;
3256	+ delete to.height;
3257	+
3258	+ if ($el.parent().hasClass("fancybox-slide--image")) {
3259	+ $el.parent().addClass("fancybox-is-scaling");
3260	+ }
3261	+ }
3262	+
3263	+ $.fancybox.setTranslate($el, to);
3264	+ } else {
3265	+ $el.addClass(to);
3266	+ }
3267	+
3268	+ // Make sure that `transitionend` callback gets fired
3269	+ $el.data(
3270	+ "timer",
3271	+ setTimeout(function() {
3272	+ $el.trigger(transitionEnd);
3273	+ }, duration + 33)
3274	+ );
3275	+ },
3276	+
3277	+ stop: function($el, callCallback) {
3278	+ if ($el && $el.length) {
3279	+ clearTimeout($el.data("timer"));
3280	+
3281	+ if (callCallback) {
3282	+ $el.trigger(transitionEnd);
3283	+ }
3284	+
3285	+ $el.off(transitionEnd).css("transition-duration", "");
3286	+
3287	+ $el.parent().removeClass("fancybox-is-scaling");
3288	+ }
3289	+ }
3290	+ };
3291	+
3292	+ // Default click handler for "fancyboxed" links
3293	+ // ============================================
3294	+
3295	+ function _run(e, opts) {
3296	+ var items = [],
3297	+ index = 0,
3298	+ $target,
3299	+ value,
3300	+ instance;
3301	+
3302	+ // Avoid opening multiple times
3303	+ if (e && e.isDefaultPrevented()) {
3304	+ return;
3305	+ }
3306	+
3307	+ e.preventDefault();
3308	+
3309	+ opts = opts \|\| {};
3310	+
3311	+ if (e && e.data) {
3312	+ opts = mergeOpts(e.data.options, opts);
3313	+ }
3314	+
3315	+ $target = opts.$target \|\| $(e.currentTarget).trigger("blur");
3316	+ instance = $.fancybox.getInstance();
3317	+
3318	+ if (instance && instance.$trigger && instance.$trigger.is($target)) {
3319	+ return;
3320	+ }
3321	+
3322	+ if (opts.selector) {
3323	+ items = $(opts.selector);
3324	+ } else {
3325	+ // Get all related items and find index for clicked one
3326	+ value = $target.attr("data-fancybox") \|\| "";
3327	+
3328	+ if (value) {
3329	+ items = e.data ? e.data.items : [];
3330	+ items = items.length ? items.filter('[data-fancybox="' + value + '"]') : $('[data-fancybox="' + value + '"]');
3331	+ } else {
3332	+ items = [$target];
3333	+ }
3334	+ }
3335	+
3336	+ index = $(items).index($target);
3337	+
3338	+ // Sometimes current item can not be found
3339	+ if (index < 0) {
3340	+ index = 0;
3341	+ }
3342	+
3343	+ instance = $.fancybox.open(items, opts, index);
3344	+
3345	+ // Save last active element
3346	+ instance.$trigger = $target;
3347	+ }
3348	+
3349	+ // Create a jQuery plugin
3350	+ // ======================
3351	+
3352	+ $.fn.fancybox = function(options) {
3353	+ var selector;
3354	+
3355	+ options = options \|\| {};
3356	+ selector = options.selector \|\| false;
3357	+
3358	+ if (selector) {
3359	+ // Use body element instead of document so it executes first
3360	+ $("body")
3361	+ .off("click.fb-start", selector)
3362	+ .on("click.fb-start", selector, {options: options}, _run);
3363	+ } else {
3364	+ this.off("click.fb-start").on(
3365	+ "click.fb-start",
3366	+ {
3367	+ items: this,
3368	+ options: options
3369	+ },
3370	+ _run
3371	+ );
3372	+ }
3373	+
3374	+ return this;
3375	+ };
3376	+
3377	+ // Self initializing plugin for all elements having `data-fancybox` attribute
3378	+ // ==========================================================================
3379	+
3380	+ $D.on("click.fb-start", "[data-fancybox]", _run);
3381	+
3382	+ // Enable "trigger elements"
3383	+ // =========================
3384	+
3385	+ $D.on("click.fb-start", "[data-fancybox-trigger]", function(e) {
3386	+ $('[data-fancybox="' + $(this).attr("data-fancybox-trigger") + '"]')
3387	+ .eq($(this).attr("data-fancybox-index") \|\| 0)
3388	+ .trigger("click.fb-start", {
3389	+ $trigger: $(this)
3390	+ });
3391	+ });
3392	+
3393	+ // Track focus event for better accessibility styling
3394	+ // ==================================================
3395	+ (function() {
3396	+ var buttonStr = ".fancybox-button",
3397	+ focusStr = "fancybox-focus",
3398	+ $pressed = null;
3399	+
3400	+ $D.on("mousedown mouseup focus blur", buttonStr, function(e) {
3401	+ switch (e.type) {
3402	+ case "mousedown":
3403	+ $pressed = $(this);
3404	+ break;
3405	+ case "mouseup":
3406	+ $pressed = null;
3407	+ break;
3408	+ case "focusin":
3409	+ $(buttonStr).removeClass(focusStr);
3410	+
3411	+ if (!$(this).is($pressed) && !$(this).is("[disabled]")) {
3412	+ $(this).addClass(focusStr);
3413	+ }
3414	+ break;
3415	+ case "focusout":
3416	+ $(buttonStr).removeClass(focusStr);
3417	+ break;
3418	+ }
3419	+ });
3420	+ })();
3421	+ })(window, document, jQuery);
3422	+
3423	+ // ==========================================================================
3424	+ //
3425	+ // Media
3426	+ // Adds additional media type support
3427	+ //
3428	+ // ==========================================================================
3429	+ (function($) {
3430	+ "use strict";
3431	+
3432	+ // Object containing properties for each media type
3433	+ var defaults = {
3434	+ youtube: {
3435	+ matcher: /(youtube\.com\|youtu\.be\|youtube\-nocookie\.com)\/(watch\?(.&)?v=\|v\/\|u\/\|embed\/?)?(videoseries\?list=(.)\|[\w-]{11}\|\?listType=(.)&list=(.))(.*)/i,
3436	+ params: {
3437	+ autoplay: 1,
3438	+ autohide: 1,
3439	+ fs: 1,
3440	+ rel: 0,
3441	+ hd: 1,
3442	+ wmode: "transparent",
3443	+ enablejsapi: 1,
3444	+ html5: 1
3445	+ },
3446	+ paramPlace: 8,
3447	+ type: "iframe",
3448	+ url: "//www.youtube-nocookie.com/embed/$4",
3449	+ thumb: "//img.youtube.com/vi/$4/hqdefault.jpg"
3450	+ },
3451	+
3452	+ vimeo: {
3453	+ matcher: /^.+vimeo.com\/(.\/)?([\d]+)(.)?/,
3454	+ params: {
3455	+ autoplay: 1,
3456	+ hd: 1,
3457	+ show_title: 1,
3458	+ show_byline: 1,
3459	+ show_portrait: 0,
3460	+ fullscreen: 1
3461	+ },
3462	+ paramPlace: 3,
3463	+ type: "iframe",
3464	+ url: "//player.vimeo.com/video/$2"
3465	+ },
3466	+
3467	+ instagram: {
3468	+ matcher: /(instagr\.am\|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,
3469	+ type: "image",
3470	+ url: "//$1/p/$2/media/?size=l"
3471	+ },
3472	+
3473	+ // Examples:
3474	+ // http://maps.google.com/?ll=48.857995,2.294297&spn=0.007666,0.021136&t=m&z=16
3475	+ // https://www.google.com/maps/@37.7852006,-122.4146355,14.65z
3476	+ // https://www.google.com/maps/@52.2111123,2.9237542,6.61z?hl=en
3477	+ // https://www.google.com/maps/place/Googleplex/@37.4220041,-122.0833494,17z/data=!4m5!3m4!1s0x0:0x6c296c66619367e0!8m2!3d37.4219998!4d-122.0840572
3478	+ gmap_place: {
3479	+ matcher: /(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.)\/)?\@(.),(\d+.?\d+?)z))\|(\?ll=))(.*)?/i,
3480	+ type: "iframe",
3481	+ url: function(rez) {
3482	+ return (
3483	+ "//maps.google." +
3484	+ rez[2] +
3485	+ "/?ll=" +
3486	+ (rez[9] ? rez[9] + "&z=" + Math.floor(rez[10]) + (rez[12] ? rez[12].replace(/^\//, "&") : "") : rez[12] + "").replace(/\?/, "&") +
3487	+ "&output=" +
3488	+ (rez[12] && rez[12].indexOf("layer=c") > 0 ? "svembed" : "embed")
3489	+ );
3490	+ }
3491	+ },
3492	+
3493	+ // Examples:
3494	+ // https://www.google.com/maps/search/Empire+State+Building/
3495	+ // https://www.google.com/maps/search/?api=1&query=centurylink+field
3496	+ // https://www.google.com/maps/search/?api=1&query=47.5951518,-122.3316393
3497	+ gmap_search: {
3498	+ matcher: /(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(maps\/search\/)(.*)/i,
3499	+ type: "iframe",
3500	+ url: function(rez) {
3501	+ return "//maps.google." + rez[2] + "/maps?q=" + rez[5].replace("query=", "q=").replace("api=1", "") + "&output=embed";
3502	+ }
3503	+ }
3504	+ };
3505	+
3506	+ // Formats matching url to final form
3507	+ var format = function(url, rez, params) {
3508	+ if (!url) {
3509	+ return;
3510	+ }
3511	+
3512	+ params = params \|\| "";
3513	+
3514	+ if ($.type(params) === "object") {
3515	+ params = $.param(params, true);
3516	+ }
3517	+
3518	+ $.each(rez, function(key, value) {
3519	+ url = url.replace("$" + key, value \|\| "");
3520	+ });
3521	+
3522	+ if (params.length) {
3523	+ url += (url.indexOf("?") > 0 ? "&" : "?") + params;
3524	+ }
3525	+
3526	+ return url;
3527	+ };
3528	+
3529	+ $(document).on("objectNeedsType.fb", function(e, instance, item) {
3530	+ var url = item.src \|\| "",
3531	+ type = false,
3532	+ media,
3533	+ thumb,
3534	+ rez,
3535	+ params,
3536	+ urlParams,
3537	+ paramObj,
3538	+ provider;
3539	+
3540	+ media = $.extend(true, {}, defaults, item.opts.media);
3541	+
3542	+ // Look for any matching media type
3543	+ $.each(media, function(providerName, providerOpts) {
3544	+ rez = url.match(providerOpts.matcher);
3545	+
3546	+ if (!rez) {
3547	+ return;
3548	+ }
3549	+
3550	+ type = providerOpts.type;
3551	+ provider = providerName;
3552	+ paramObj = {};
3553	+
3554	+ if (providerOpts.paramPlace && rez[providerOpts.paramPlace]) {
3555	+ urlParams = rez[providerOpts.paramPlace];
3556	+
3557	+ if (urlParams[0] == "?") {
3558	+ urlParams = urlParams.substring(1);
3559	+ }
3560	+
3561	+ urlParams = urlParams.split("&");
3562	+
3563	+ for (var m = 0; m < urlParams.length; ++m) {
3564	+ var p = urlParams[m].split("=", 2);
3565	+
3566	+ if (p.length == 2) {
3567	+ paramObj[p[0]] = decodeURIComponent(p[1].replace(/\+/g, " "));
3568	+ }
3569	+ }
3570	+ }
3571	+
3572	+ params = $.extend(true, {}, providerOpts.params, item.opts[providerName], paramObj);
3573	+
3574	+ url =
3575	+ $.type(providerOpts.url) === "function" ? providerOpts.url.call(this, rez, params, item) : format(providerOpts.url, rez, params);
3576	+
3577	+ thumb =
3578	+ $.type(providerOpts.thumb) === "function" ? providerOpts.thumb.call(this, rez, params, item) : format(providerOpts.thumb, rez);
3579	+
3580	+ if (providerName === "youtube") {
3581	+ url = url.replace(/&t=((\d+)m)?(\d+)s/, function(match, p1, m, s) {
3582	+ return "&start=" + ((m ? parseInt(m, 10) * 60 : 0) + parseInt(s, 10));
3583	+ });
3584	+ } else if (providerName === "vimeo") {
3585	+ url = url.replace("&%23", "#");
3586	+ }
3587	+
3588	+ return false;
3589	+ });
3590	+
3591	+ // If it is found, then change content type and update the url
3592	+
3593	+ if (type) {
3594	+ if (!item.opts.thumb && !(item.opts.$thumb && item.opts.$thumb.length)) {
3595	+ item.opts.thumb = thumb;
3596	+ }
3597	+
3598	+ if (type === "iframe") {
3599	+ item.opts = $.extend(true, item.opts, {
3600	+ iframe: {
3601	+ preload: false,
3602	+ attr: {
3603	+ scrolling: "no"
3604	+ }
3605	+ }
3606	+ });
3607	+ }
3608	+
3609	+ $.extend(item, {
3610	+ type: type,
3611	+ src: url,
3612	+ origSrc: item.src,
3613	+ contentSource: provider,
3614	+ contentType: type === "image" ? "image" : provider == "gmap_place" \|\| provider == "gmap_search" ? "map" : "video"
3615	+ });
3616	+ } else if (url) {
3617	+ item.type = item.opts.defaultType;
3618	+ }
3619	+ });
3620	+
3621	+ // Load YouTube/Video API on request to detect when video finished playing
3622	+ var VideoAPILoader = {
3623	+ youtube: {
3624	+ src: "https://www.youtube.com/iframe_api",
3625	+ class: "YT",
3626	+ loading: false,
3627	+ loaded: false
3628	+ },
3629	+
3630	+ vimeo: {
3631	+ src: "https://player.vimeo.com/api/player.js",
3632	+ class: "Vimeo",
3633	+ loading: false,
3634	+ loaded: false
3635	+ },
3636	+
3637	+ load: function(vendor) {
3638	+ var _this = this,
3639	+ script;
3640	+
3641	+ if (this[vendor].loaded) {
3642	+ setTimeout(function() {
3643	+ _this.done(vendor);
3644	+ });
3645	+ return;
3646	+ }
3647	+
3648	+ if (this[vendor].loading) {
3649	+ return;
3650	+ }
3651	+
3652	+ this[vendor].loading = true;
3653	+
3654	+ script = document.createElement("script");
3655	+ script.type = "text/javascript";
3656	+ script.src = this[vendor].src;
3657	+
3658	+ if (vendor === "youtube") {
3659	+ window.onYouTubeIframeAPIReady = function() {
3660	+ _this[vendor].loaded = true;
3661	+ _this.done(vendor);
3662	+ };
3663	+ } else {
3664	+ script.onload = function() {
3665	+ _this[vendor].loaded = true;
3666	+ _this.done(vendor);
3667	+ };
3668	+ }
3669	+
3670	+ document.body.appendChild(script);
3671	+ },
3672	+ done: function(vendor) {
3673	+ var instance, $el, player;
3674	+
3675	+ if (vendor === "youtube") {
3676	+ delete window.onYouTubeIframeAPIReady;
3677	+ }
3678	+
3679	+ instance = $.fancybox.getInstance();
3680	+
3681	+ if (instance) {
3682	+ $el = instance.current.$content.find("iframe");
3683	+
3684	+ if (vendor === "youtube" && YT !== undefined && YT) {
3685	+ player = new YT.Player($el.attr("id"), {
3686	+ events: {
3687	+ onStateChange: function(e) {
3688	+ if (e.data == 0) {
3689	+ instance.next();
3690	+ }
3691	+ }
3692	+ }
3693	+ });
3694	+ } else if (vendor === "vimeo" && Vimeo !== undefined && Vimeo) {
3695	+ player = new Vimeo.Player($el);
3696	+
3697	+ player.on("ended", function() {
3698	+ instance.next();
3699	+ });
3700	+ }
3701	+ }
3702	+ }
3703	+ };
3704	+
3705	+ $(document).on({
3706	+ "afterShow.fb": function(e, instance, current) {
3707	+ if (instance.group.length > 1 && (current.contentSource === "youtube" \|\| current.contentSource === "vimeo")) {
3708	+ VideoAPILoader.load(current.contentSource);
3709	+ }
3710	+ }
3711	+ });
3712	+ })(jQuery);
3713	+
3714	+ // ==========================================================================
3715	+ //
3716	+ // Guestures
3717	+ // Adds touch guestures, handles click and tap events
3718	+ //
3719	+ // ==========================================================================
3720	+ (function(window, document, $) {
3721	+ "use strict";
3722	+
3723	+ var requestAFrame = (function() {
3724	+ return (
3725	+ window.requestAnimationFrame \|\|
3726	+ window.webkitRequestAnimationFrame \|\|
3727	+ window.mozRequestAnimationFrame \|\|
3728	+ window.oRequestAnimationFrame \|\|
3729	+ // if all else fails, use setTimeout
3730	+ function(callback) {
3731	+ return window.setTimeout(callback, 1000 / 60);
3732	+ }
3733	+ );
3734	+ })();
3735	+
3736	+ var cancelAFrame = (function() {
3737	+ return (
3738	+ window.cancelAnimationFrame \|\|
3739	+ window.webkitCancelAnimationFrame \|\|
3740	+ window.mozCancelAnimationFrame \|\|
3741	+ window.oCancelAnimationFrame \|\|
3742	+ function(id) {
3743	+ window.clearTimeout(id);
3744	+ }
3745	+ );
3746	+ })();
3747	+
3748	+ var getPointerXY = function(e) {
3749	+ var result = [];
3750	+
3751	+ e = e.originalEvent \|\| e \|\| window.e;
3752	+ e = e.touches && e.touches.length ? e.touches : e.changedTouches && e.changedTouches.length ? e.changedTouches : [e];
3753	+
3754	+ for (var key in e) {
3755	+ if (e[key].pageX) {
3756	+ result.push({
3757	+ x: e[key].pageX,
3758	+ y: e[key].pageY
3759	+ });
3760	+ } else if (e[key].clientX) {
3761	+ result.push({
3762	+ x: e[key].clientX,
3763	+ y: e[key].clientY
3764	+ });
3765	+ }
3766	+ }
3767	+
3768	+ return result;
3769	+ };
3770	+
3771	+ var distance = function(point2, point1, what) {
3772	+ if (!point1 \|\| !point2) {
3773	+ return 0;
3774	+ }
3775	+
3776	+ if (what === "x") {
3777	+ return point2.x - point1.x;
3778	+ } else if (what === "y") {
3779	+ return point2.y - point1.y;
3780	+ }
3781	+
3782	+ return Math.sqrt(Math.pow(point2.x - point1.x, 2) + Math.pow(point2.y - point1.y, 2));
3783	+ };
3784	+
3785	+ var isClickable = function($el) {
3786	+ if (
3787	+ $el.is('a,area,button,[role="button"],input,label,select,summary,textarea,video,audio,iframe') \|\|
3788	+ $.isFunction($el.get(0).onclick) \|\|
3789	+ $el.data("selectable")
3790	+ ) {
3791	+ return true;
3792	+ }
3793	+
3794	+ // Check for attributes like data-fancybox-next or data-fancybox-close
3795	+ for (var i = 0, atts = $el[0].attributes, n = atts.length; i < n; i++) {
3796	+ if (atts[i].nodeName.substr(0, 14) === "data-fancybox-") {
3797	+ return true;
3798	+ }
3799	+ }
3800	+
3801	+ return false;
3802	+ };
3803	+
3804	+ var hasScrollbars = function(el) {
3805	+ var overflowY = window.getComputedStyle(el)["overflow-y"],
3806	+ overflowX = window.getComputedStyle(el)["overflow-x"],
3807	+ vertical = (overflowY === "scroll" \|\| overflowY === "auto") && el.scrollHeight > el.clientHeight,
3808	+ horizontal = (overflowX === "scroll" \|\| overflowX === "auto") && el.scrollWidth > el.clientWidth;
3809	+
3810	+ return vertical \|\| horizontal;
3811	+ };
3812	+
3813	+ var isScrollable = function($el) {
3814	+ var rez = false;
3815	+
3816	+ while (true) {
3817	+ rez = hasScrollbars($el.get(0));
3818	+
3819	+ if (rez) {
3820	+ break;
3821	+ }
3822	+
3823	+ $el = $el.parent();
3824	+
3825	+ if (!$el.length \|\| $el.hasClass("fancybox-stage") \|\| $el.is("body")) {
3826	+ break;
3827	+ }
3828	+ }
3829	+
3830	+ return rez;
3831	+ };
3832	+
3833	+ var Guestures = function(instance) {
3834	+ var self = this;
3835	+
3836	+ self.instance = instance;
3837	+
3838	+ self.$bg = instance.$refs.bg;
3839	+ self.$stage = instance.$refs.stage;
3840	+ self.$container = instance.$refs.container;
3841	+
3842	+ self.destroy();
3843	+
3844	+ self.$container.on("touchstart.fb.touch mousedown.fb.touch", $.proxy(self, "ontouchstart"));
3845	+ };
3846	+
3847	+ Guestures.prototype.destroy = function() {
3848	+ var self = this;
3849	+
3850	+ self.$container.off(".fb.touch");
3851	+
3852	+ $(document).off(".fb.touch");
3853	+
3854	+ if (self.requestId) {
3855	+ cancelAFrame(self.requestId);
3856	+ self.requestId = null;
3857	+ }
3858	+
3859	+ if (self.tapped) {
3860	+ clearTimeout(self.tapped);
3861	+ self.tapped = null;
3862	+ }
3863	+ };
3864	+
3865	+ Guestures.prototype.ontouchstart = function(e) {
3866	+ var self = this,
3867	+ $target = $(e.target),
3868	+ instance = self.instance,
3869	+ current = instance.current,
3870	+ $slide = current.$slide,
3871	+ $content = current.$content,
3872	+ isTouchDevice = e.type == "touchstart";
3873	+
3874	+ // Do not respond to both (touch and mouse) events
3875	+ if (isTouchDevice) {
3876	+ self.$container.off("mousedown.fb.touch");
3877	+ }
3878	+
3879	+ // Ignore right click
3880	+ if (e.originalEvent && e.originalEvent.button == 2) {
3881	+ return;
3882	+ }
3883	+
3884	+ // Ignore taping on links, buttons, input elements
3885	+ if (!$slide.length \|\| !$target.length \|\| isClickable($target) \|\| isClickable($target.parent())) {
3886	+ return;
3887	+ }
3888	+ // Ignore clicks on the scrollbar
3889	+ if (!$target.is("img") && e.originalEvent.clientX > $target[0].clientWidth + $target.offset().left) {
3890	+ return;
3891	+ }
3892	+
3893	+ // Ignore clicks while zooming or closing
3894	+ if (!current \|\| instance.isAnimating \|\| current.$slide.hasClass("fancybox-animated")) {
3895	+ e.stopPropagation();
3896	+ e.preventDefault();
3897	+
3898	+ return;
3899	+ }
3900	+
3901	+ self.realPoints = self.startPoints = getPointerXY(e);
3902	+
3903	+ if (!self.startPoints.length) {
3904	+ return;
3905	+ }
3906	+
3907	+ // Allow other scripts to catch touch event if "touch" is set to false
3908	+ if (current.touch) {
3909	+ e.stopPropagation();
3910	+ }
3911	+
3912	+ self.startEvent = e;
3913	+
3914	+ self.canTap = true;
3915	+ self.$target = $target;
3916	+ self.$content = $content;
3917	+ self.opts = current.opts.touch;
3918	+
3919	+ self.isPanning = false;
3920	+ self.isSwiping = false;
3921	+ self.isZooming = false;
3922	+ self.isScrolling = false;
3923	+ self.canPan = instance.canPan();
3924	+
3925	+ self.startTime = new Date().getTime();
3926	+ self.distanceX = self.distanceY = self.distance = 0;
3927	+
3928	+ self.canvasWidth = Math.round($slide[0].clientWidth);
3929	+ self.canvasHeight = Math.round($slide[0].clientHeight);
3930	+
3931	+ self.contentLastPos = null;
3932	+ self.contentStartPos = $.fancybox.getTranslate(self.$content) \|\| {top: 0, left: 0};
3933	+ self.sliderStartPos = $.fancybox.getTranslate($slide);
3934	+
3935	+ // Since position will be absolute, but we need to make it relative to the stage
3936	+ self.stagePos = $.fancybox.getTranslate(instance.$refs.stage);
3937	+
3938	+ self.sliderStartPos.top -= self.stagePos.top;
3939	+ self.sliderStartPos.left -= self.stagePos.left;
3940	+
3941	+ self.contentStartPos.top -= self.stagePos.top;
3942	+ self.contentStartPos.left -= self.stagePos.left;
3943	+
3944	+ $(document)
3945	+ .off(".fb.touch")
3946	+ .on(isTouchDevice ? "touchend.fb.touch touchcancel.fb.touch" : "mouseup.fb.touch mouseleave.fb.touch", $.proxy(self, "ontouchend"))
3947	+ .on(isTouchDevice ? "touchmove.fb.touch" : "mousemove.fb.touch", $.proxy(self, "ontouchmove"));
3948	+
3949	+ if ($.fancybox.isMobile) {
3950	+ document.addEventListener("scroll", self.onscroll, true);
3951	+ }
3952	+
3953	+ // Skip if clicked outside the sliding area
3954	+ if (!(self.opts \|\| self.canPan) \|\| !($target.is(self.$stage) \|\| self.$stage.find($target).length)) {
3955	+ if ($target.is(".fancybox-image")) {
3956	+ e.preventDefault();
3957	+ }
3958	+
3959	+ if (!($.fancybox.isMobile && $target.hasClass("fancybox-caption"))) {
3960	+ return;
3961	+ }
3962	+ }
3963	+
3964	+ self.isScrollable = isScrollable($target) \|\| isScrollable($target.parent());
3965	+
3966	+ // Check if element is scrollable and try to prevent default behavior (scrolling)
3967	+ if (!($.fancybox.isMobile && self.isScrollable)) {
3968	+ e.preventDefault();
3969	+ }
3970	+
3971	+ // One finger or mouse click - swipe or pan an image
3972	+ if (self.startPoints.length === 1 \|\| current.hasError) {
3973	+ if (self.canPan) {
3974	+ $.fancybox.stop(self.$content);
3975	+
3976	+ self.isPanning = true;
3977	+ } else {
3978	+ self.isSwiping = true;
3979	+ }
3980	+
3981	+ self.$container.addClass("fancybox-is-grabbing");
3982	+ }
3983	+
3984	+ // Two fingers - zoom image
3985	+ if (self.startPoints.length === 2 && current.type === "image" && (current.isLoaded \|\| current.$ghost)) {
3986	+ self.canTap = false;
3987	+ self.isSwiping = false;
3988	+ self.isPanning = false;
3989	+
3990	+ self.isZooming = true;
3991	+
3992	+ $.fancybox.stop(self.$content);
3993	+
3994	+ self.centerPointStartX = (self.startPoints[0].x + self.startPoints[1].x) * 0.5 - $(window).scrollLeft();
3995	+ self.centerPointStartY = (self.startPoints[0].y + self.startPoints[1].y) * 0.5 - $(window).scrollTop();
3996	+
3997	+ self.percentageOfImageAtPinchPointX = (self.centerPointStartX - self.contentStartPos.left) / self.contentStartPos.width;
3998	+ self.percentageOfImageAtPinchPointY = (self.centerPointStartY - self.contentStartPos.top) / self.contentStartPos.height;
3999	+
4000	+ self.startDistanceBetweenFingers = distance(self.startPoints[0], self.startPoints[1]);
4001	+ }
4002	+ };
4003	+
4004	+ Guestures.prototype.onscroll = function(e) {
4005	+ var self = this;
4006	+
4007	+ self.isScrolling = true;
4008	+
4009	+ document.removeEventListener("scroll", self.onscroll, true);
4010	+ };
4011	+
4012	+ Guestures.prototype.ontouchmove = function(e) {
4013	+ var self = this;
4014	+
4015	+ // Make sure user has not released over iframe or disabled element
4016	+ if (e.originalEvent.buttons !== undefined && e.originalEvent.buttons === 0) {
4017	+ self.ontouchend(e);
4018	+ return;
4019	+ }
4020	+
4021	+ if (self.isScrolling) {
4022	+ self.canTap = false;
4023	+ return;
4024	+ }
4025	+
4026	+ self.newPoints = getPointerXY(e);
4027	+
4028	+ if (!(self.opts \|\| self.canPan) \|\| !self.newPoints.length \|\| !self.newPoints.length) {
4029	+ return;
4030	+ }
4031	+
4032	+ if (!(self.isSwiping && self.isSwiping === true)) {
4033	+ e.preventDefault();
4034	+ }
4035	+
4036	+ self.distanceX = distance(self.newPoints[0], self.startPoints[0], "x");
4037	+ self.distanceY = distance(self.newPoints[0], self.startPoints[0], "y");
4038	+
4039	+ self.distance = distance(self.newPoints[0], self.startPoints[0]);
4040	+
4041	+ // Skip false ontouchmove events (Chrome)
4042	+ if (self.distance > 0) {
4043	+ if (self.isSwiping) {
4044	+ self.onSwipe(e);
4045	+ } else if (self.isPanning) {
4046	+ self.onPan();
4047	+ } else if (self.isZooming) {
4048	+ self.onZoom();
4049	+ }
4050	+ }
4051	+ };
4052	+
4053	+ Guestures.prototype.onSwipe = function(e) {
4054	+ var self = this,
4055	+ instance = self.instance,
4056	+ swiping = self.isSwiping,
4057	+ left = self.sliderStartPos.left \|\| 0,
4058	+ angle;
4059	+
4060	+ // If direction is not yet determined
4061	+ if (swiping === true) {
4062	+ // We need at least 10px distance to correctly calculate an angle
4063	+ if (Math.abs(self.distance) > 10) {
4064	+ self.canTap = false;
4065	+
4066	+ if (instance.group.length < 2 && self.opts.vertical) {
4067	+ self.isSwiping = "y";
4068	+ } else if (instance.isDragging \|\| self.opts.vertical === false \|\| (self.opts.vertical === "auto" && $(window).width() > 800)) {
4069	+ self.isSwiping = "x";
4070	+ } else {
4071	+ angle = Math.abs((Math.atan2(self.distanceY, self.distanceX) * 180) / Math.PI);
4072	+
4073	+ self.isSwiping = angle > 45 && angle < 135 ? "y" : "x";
4074	+ }
4075	+
4076	+ if (self.isSwiping === "y" && $.fancybox.isMobile && self.isScrollable) {
4077	+ self.isScrolling = true;
4078	+
4079	+ return;
4080	+ }
4081	+
4082	+ instance.isDragging = self.isSwiping;
4083	+
4084	+ // Reset points to avoid jumping, because we dropped first swipes to calculate the angle
4085	+ self.startPoints = self.newPoints;
4086	+
4087	+ $.each(instance.slides, function(index, slide) {
4088	+ var slidePos, stagePos;
4089	+
4090	+ $.fancybox.stop(slide.$slide);
4091	+
4092	+ slidePos = $.fancybox.getTranslate(slide.$slide);
4093	+ stagePos = $.fancybox.getTranslate(instance.$refs.stage);
4094	+
4095	+ slide.$slide
4096	+ .css({
4097	+ transform: "",
4098	+ opacity: "",
4099	+ "transition-duration": ""
4100	+ })
4101	+ .removeClass("fancybox-animated")
4102	+ .removeClass(function(index, className) {
4103	+ return (className.match(/(^\|\s)fancybox-fx-\S+/g) \|\| []).join(" ");
4104	+ });
4105	+
4106	+ if (slide.pos === instance.current.pos) {
4107	+ self.sliderStartPos.top = slidePos.top - stagePos.top;
4108	+ self.sliderStartPos.left = slidePos.left - stagePos.left;
4109	+ }
4110	+
4111	+ $.fancybox.setTranslate(slide.$slide, {
4112	+ top: slidePos.top - stagePos.top,
4113	+ left: slidePos.left - stagePos.left
4114	+ });
4115	+ });
4116	+
4117	+ // Stop slideshow
4118	+ if (instance.SlideShow && instance.SlideShow.isActive) {
4119	+ instance.SlideShow.stop();
4120	+ }
4121	+ }
4122	+
4123	+ return;
4124	+ }
4125	+
4126	+ // Sticky edges
4127	+ if (swiping == "x") {
4128	+ if (
4129	+ self.distanceX > 0 &&
4130	+ (self.instance.group.length < 2 \|\| (self.instance.current.index === 0 && !self.instance.current.opts.loop))
4131	+ ) {
4132	+ left = left + Math.pow(self.distanceX, 0.8);
4133	+ } else if (
4134	+ self.distanceX < 0 &&
4135	+ (self.instance.group.length < 2 \|\|
4136	+ (self.instance.current.index === self.instance.group.length - 1 && !self.instance.current.opts.loop))
4137	+ ) {
4138	+ left = left - Math.pow(-self.distanceX, 0.8);
4139	+ } else {
4140	+ left = left + self.distanceX;
4141	+ }
4142	+ }
4143	+
4144	+ self.sliderLastPos = {
4145	+ top: swiping == "x" ? 0 : self.sliderStartPos.top + self.distanceY,
4146	+ left: left
4147	+ };
4148	+
4149	+ if (self.requestId) {
4150	+ cancelAFrame(self.requestId);
4151	+
4152	+ self.requestId = null;
4153	+ }
4154	+
4155	+ self.requestId = requestAFrame(function() {
4156	+ if (self.sliderLastPos) {
4157	+ $.each(self.instance.slides, function(index, slide) {
4158	+ var pos = slide.pos - self.instance.currPos;
4159	+
4160	+ $.fancybox.setTranslate(slide.$slide, {
4161	+ top: self.sliderLastPos.top,
4162	+ left: self.sliderLastPos.left + pos * self.canvasWidth + pos * slide.opts.gutter
4163	+ });
4164	+ });
4165	+
4166	+ self.$container.addClass("fancybox-is-sliding");
4167	+ }
4168	+ });
4169	+ };
4170	+
4171	+ Guestures.prototype.onPan = function() {
4172	+ var self = this;
4173	+
4174	+ // Prevent accidental movement (sometimes, when tapping casually, finger can move a bit)
4175	+ if (distance(self.newPoints[0], self.realPoints[0]) < ($.fancybox.isMobile ? 10 : 5)) {
4176	+ self.startPoints = self.newPoints;
4177	+ return;
4178	+ }
4179	+
4180	+ self.canTap = false;
4181	+
4182	+ self.contentLastPos = self.limitMovement();
4183	+
4184	+ if (self.requestId) {
4185	+ cancelAFrame(self.requestId);
4186	+ }
4187	+
4188	+ self.requestId = requestAFrame(function() {
4189	+ $.fancybox.setTranslate(self.$content, self.contentLastPos);
4190	+ });
4191	+ };
4192	+
4193	+ // Make panning sticky to the edges
4194	+ Guestures.prototype.limitMovement = function() {
4195	+ var self = this;
4196	+
4197	+ var canvasWidth = self.canvasWidth;
4198	+ var canvasHeight = self.canvasHeight;
4199	+
4200	+ var distanceX = self.distanceX;
4201	+ var distanceY = self.distanceY;
4202	+
4203	+ var contentStartPos = self.contentStartPos;
4204	+
4205	+ var currentOffsetX = contentStartPos.left;
4206	+ var currentOffsetY = contentStartPos.top;
4207	+
4208	+ var currentWidth = contentStartPos.width;
4209	+ var currentHeight = contentStartPos.height;
4210	+
4211	+ var minTranslateX, minTranslateY, maxTranslateX, maxTranslateY, newOffsetX, newOffsetY;
4212	+
4213	+ if (currentWidth > canvasWidth) {
4214	+ newOffsetX = currentOffsetX + distanceX;
4215	+ } else {
4216	+ newOffsetX = currentOffsetX;
4217	+ }
4218	+
4219	+ newOffsetY = currentOffsetY + distanceY;
4220	+
4221	+ // Slow down proportionally to traveled distance
4222	+ minTranslateX = Math.max(0, canvasWidth * 0.5 - currentWidth * 0.5);
4223	+ minTranslateY = Math.max(0, canvasHeight * 0.5 - currentHeight * 0.5);
4224	+
4225	+ maxTranslateX = Math.min(canvasWidth - currentWidth, canvasWidth * 0.5 - currentWidth * 0.5);
4226	+ maxTranslateY = Math.min(canvasHeight - currentHeight, canvasHeight * 0.5 - currentHeight * 0.5);
4227	+
4228	+ // ->
4229	+ if (distanceX > 0 && newOffsetX > minTranslateX) {
4230	+ newOffsetX = minTranslateX - 1 + Math.pow(-minTranslateX + currentOffsetX + distanceX, 0.8) \|\| 0;
4231	+ }
4232	+
4233	+ // <-
4234	+ if (distanceX < 0 && newOffsetX < maxTranslateX) {
4235	+ newOffsetX = maxTranslateX + 1 - Math.pow(maxTranslateX - currentOffsetX - distanceX, 0.8) \|\| 0;
4236	+ }
4237	+
4238	+ // \/
4239	+ if (distanceY > 0 && newOffsetY > minTranslateY) {
4240	+ newOffsetY = minTranslateY - 1 + Math.pow(-minTranslateY + currentOffsetY + distanceY, 0.8) \|\| 0;
4241	+ }
4242	+
4243	+ // /\
4244	+ if (distanceY < 0 && newOffsetY < maxTranslateY) {
4245	+ newOffsetY = maxTranslateY + 1 - Math.pow(maxTranslateY - currentOffsetY - distanceY, 0.8) \|\| 0;
4246	+ }
4247	+
4248	+ return {
4249	+ top: newOffsetY,
4250	+ left: newOffsetX
4251	+ };
4252	+ };
4253	+
4254	+ Guestures.prototype.limitPosition = function(newOffsetX, newOffsetY, newWidth, newHeight) {
4255	+ var self = this;
4256	+
4257	+ var canvasWidth = self.canvasWidth;
4258	+ var canvasHeight = self.canvasHeight;
4259	+
4260	+ if (newWidth > canvasWidth) {
4261	+ newOffsetX = newOffsetX > 0 ? 0 : newOffsetX;
4262	+ newOffsetX = newOffsetX < canvasWidth - newWidth ? canvasWidth - newWidth : newOffsetX;
4263	+ } else {
4264	+ // Center horizontally
4265	+ newOffsetX = Math.max(0, canvasWidth / 2 - newWidth / 2);
4266	+ }
4267	+
4268	+ if (newHeight > canvasHeight) {
4269	+ newOffsetY = newOffsetY > 0 ? 0 : newOffsetY;
4270	+ newOffsetY = newOffsetY < canvasHeight - newHeight ? canvasHeight - newHeight : newOffsetY;
4271	+ } else {
4272	+ // Center vertically
4273	+ newOffsetY = Math.max(0, canvasHeight / 2 - newHeight / 2);
4274	+ }
4275	+
4276	+ return {
4277	+ top: newOffsetY,
4278	+ left: newOffsetX
4279	+ };
4280	+ };
4281	+
4282	+ Guestures.prototype.onZoom = function() {
4283	+ var self = this;
4284	+
4285	+ // Calculate current distance between points to get pinch ratio and new width and height
4286	+ var contentStartPos = self.contentStartPos;
4287	+
4288	+ var currentWidth = contentStartPos.width;
4289	+ var currentHeight = contentStartPos.height;
4290	+
4291	+ var currentOffsetX = contentStartPos.left;
4292	+ var currentOffsetY = contentStartPos.top;
4293	+
4294	+ var endDistanceBetweenFingers = distance(self.newPoints[0], self.newPoints[1]);
4295	+
4296	+ var pinchRatio = endDistanceBetweenFingers / self.startDistanceBetweenFingers;
4297	+
4298	+ var newWidth = Math.floor(currentWidth * pinchRatio);
4299	+ var newHeight = Math.floor(currentHeight * pinchRatio);
4300	+
4301	+ // This is the translation due to pinch-zooming
4302	+ var translateFromZoomingX = (currentWidth - newWidth) * self.percentageOfImageAtPinchPointX;
4303	+ var translateFromZoomingY = (currentHeight - newHeight) * self.percentageOfImageAtPinchPointY;
4304	+
4305	+ // Point between the two touches
4306	+ var centerPointEndX = (self.newPoints[0].x + self.newPoints[1].x) / 2 - $(window).scrollLeft();
4307	+ var centerPointEndY = (self.newPoints[0].y + self.newPoints[1].y) / 2 - $(window).scrollTop();
4308	+
4309	+ // And this is the translation due to translation of the centerpoint
4310	+ // between the two fingers
4311	+ var translateFromTranslatingX = centerPointEndX - self.centerPointStartX;
4312	+ var translateFromTranslatingY = centerPointEndY - self.centerPointStartY;
4313	+
4314	+ // The new offset is the old/current one plus the total translation
4315	+ var newOffsetX = currentOffsetX + (translateFromZoomingX + translateFromTranslatingX);
4316	+ var newOffsetY = currentOffsetY + (translateFromZoomingY + translateFromTranslatingY);
4317	+
4318	+ var newPos = {
4319	+ top: newOffsetY,
4320	+ left: newOffsetX,
4321	+ scaleX: pinchRatio,
4322	+ scaleY: pinchRatio
4323	+ };
4324	+
4325	+ self.canTap = false;
4326	+
4327	+ self.newWidth = newWidth;
4328	+ self.newHeight = newHeight;
4329	+
4330	+ self.contentLastPos = newPos;
4331	+
4332	+ if (self.requestId) {
4333	+ cancelAFrame(self.requestId);
4334	+ }
4335	+
4336	+ self.requestId = requestAFrame(function() {
4337	+ $.fancybox.setTranslate(self.$content, self.contentLastPos);
4338	+ });
4339	+ };
4340	+
4341	+ Guestures.prototype.ontouchend = function(e) {
4342	+ var self = this;
4343	+
4344	+ var swiping = self.isSwiping;
4345	+ var panning = self.isPanning;
4346	+ var zooming = self.isZooming;
4347	+ var scrolling = self.isScrolling;
4348	+
4349	+ self.endPoints = getPointerXY(e);
4350	+ self.dMs = Math.max(new Date().getTime() - self.startTime, 1);
4351	+
4352	+ self.$container.removeClass("fancybox-is-grabbing");
4353	+
4354	+ $(document).off(".fb.touch");
4355	+
4356	+ document.removeEventListener("scroll", self.onscroll, true);
4357	+
4358	+ if (self.requestId) {
4359	+ cancelAFrame(self.requestId);
4360	+
4361	+ self.requestId = null;
4362	+ }
4363	+
4364	+ self.isSwiping = false;
4365	+ self.isPanning = false;
4366	+ self.isZooming = false;
4367	+ self.isScrolling = false;
4368	+
4369	+ self.instance.isDragging = false;
4370	+
4371	+ if (self.canTap) {
4372	+ return self.onTap(e);
4373	+ }
4374	+
4375	+ self.speed = 100;
4376	+
4377	+ // Speed in px/ms
4378	+ self.velocityX = (self.distanceX / self.dMs) * 0.5;
4379	+ self.velocityY = (self.distanceY / self.dMs) * 0.5;
4380	+
4381	+ if (panning) {
4382	+ self.endPanning();
4383	+ } else if (zooming) {
4384	+ self.endZooming();
4385	+ } else {
4386	+ self.endSwiping(swiping, scrolling);
4387	+ }
4388	+
4389	+ return;
4390	+ };
4391	+
4392	+ Guestures.prototype.endSwiping = function(swiping, scrolling) {
4393	+ var self = this,
4394	+ ret = false,
4395	+ len = self.instance.group.length,
4396	+ distanceX = Math.abs(self.distanceX),
4397	+ canAdvance = swiping == "x" && len > 1 && ((self.dMs > 130 && distanceX > 10) \|\| distanceX > 50),
4398	+ speedX = 300;
4399	+
4400	+ self.sliderLastPos = null;
4401	+
4402	+ // Close if swiped vertically / navigate if horizontally
4403	+ if (swiping == "y" && !scrolling && Math.abs(self.distanceY) > 50) {
4404	+ // Continue vertical movement
4405	+ $.fancybox.animate(
4406	+ self.instance.current.$slide,
4407	+ {
4408	+ top: self.sliderStartPos.top + self.distanceY + self.velocityY * 150,
4409	+ opacity: 0
4410	+ },
4411	+ 200
4412	+ );
4413	+ ret = self.instance.close(true, 250);
4414	+ } else if (canAdvance && self.distanceX > 0) {
4415	+ ret = self.instance.previous(speedX);
4416	+ } else if (canAdvance && self.distanceX < 0) {
4417	+ ret = self.instance.next(speedX);
4418	+ }
4419	+
4420	+ if (ret === false && (swiping == "x" \|\| swiping == "y")) {
4421	+ self.instance.centerSlide(200);
4422	+ }
4423	+
4424	+ self.$container.removeClass("fancybox-is-sliding");
4425	+ };
4426	+
4427	+ // Limit panning from edges
4428	+ // ========================
4429	+ Guestures.prototype.endPanning = function() {
4430	+ var self = this,
4431	+ newOffsetX,
4432	+ newOffsetY,
4433	+ newPos;
4434	+
4435	+ if (!self.contentLastPos) {
4436	+ return;
4437	+ }
4438	+
4439	+ if (self.opts.momentum === false \|\| self.dMs > 350) {
4440	+ newOffsetX = self.contentLastPos.left;
4441	+ newOffsetY = self.contentLastPos.top;
4442	+ } else {
4443	+ // Continue movement
4444	+ newOffsetX = self.contentLastPos.left + self.velocityX * 500;
4445	+ newOffsetY = self.contentLastPos.top + self.velocityY * 500;
4446	+ }
4447	+
4448	+ newPos = self.limitPosition(newOffsetX, newOffsetY, self.contentStartPos.width, self.contentStartPos.height);
4449	+
4450	+ newPos.width = self.contentStartPos.width;
4451	+ newPos.height = self.contentStartPos.height;
4452	+
4453	+ $.fancybox.animate(self.$content, newPos, 330);
4454	+ };
4455	+
4456	+ Guestures.prototype.endZooming = function() {
4457	+ var self = this;
4458	+
4459	+ var current = self.instance.current;
4460	+
4461	+ var newOffsetX, newOffsetY, newPos, reset;
4462	+
4463	+ var newWidth = self.newWidth;
4464	+ var newHeight = self.newHeight;
4465	+
4466	+ if (!self.contentLastPos) {
4467	+ return;
4468	+ }
4469	+
4470	+ newOffsetX = self.contentLastPos.left;
4471	+ newOffsetY = self.contentLastPos.top;
4472	+
4473	+ reset = {
4474	+ top: newOffsetY,
4475	+ left: newOffsetX,
4476	+ width: newWidth,
4477	+ height: newHeight,
4478	+ scaleX: 1,
4479	+ scaleY: 1
4480	+ };
4481	+
4482	+ // Reset scalex/scaleY values; this helps for perfomance and does not break animation
4483	+ $.fancybox.setTranslate(self.$content, reset);
4484	+
4485	+ if (newWidth < self.canvasWidth && newHeight < self.canvasHeight) {
4486	+ self.instance.scaleToFit(150);
4487	+ } else if (newWidth > current.width \|\| newHeight > current.height) {
4488	+ self.instance.scaleToActual(self.centerPointStartX, self.centerPointStartY, 150);
4489	+ } else {
4490	+ newPos = self.limitPosition(newOffsetX, newOffsetY, newWidth, newHeight);
4491	+
4492	+ $.fancybox.animate(self.$content, newPos, 150);
4493	+ }
4494	+ };
4495	+
4496	+ Guestures.prototype.onTap = function(e) {
4497	+ var self = this;
4498	+ var $target = $(e.target);
4499	+
4500	+ var instance = self.instance;
4501	+ var current = instance.current;
4502	+
4503	+ var endPoints = (e && getPointerXY(e)) \|\| self.startPoints;
4504	+
4505	+ var tapX = endPoints[0] ? endPoints[0].x - $(window).scrollLeft() - self.stagePos.left : 0;
4506	+ var tapY = endPoints[0] ? endPoints[0].y - $(window).scrollTop() - self.stagePos.top : 0;
4507	+
4508	+ var where;
4509	+
4510	+ var process = function(prefix) {
4511	+ var action = current.opts[prefix];
4512	+
4513	+ if ($.isFunction(action)) {
4514	+ action = action.apply(instance, [current, e]);
4515	+ }
4516	+
4517	+ if (!action) {
4518	+ return;
4519	+ }
4520	+
4521	+ switch (action) {
4522	+ case "close":
4523	+ instance.close(self.startEvent);
4524	+
4525	+ break;
4526	+
4527	+ case "toggleControls":
4528	+ instance.toggleControls();
4529	+
4530	+ break;
4531	+
4532	+ case "next":
4533	+ instance.next();
4534	+
4535	+ break;
4536	+
4537	+ case "nextOrClose":
4538	+ if (instance.group.length > 1) {
4539	+ instance.next();
4540	+ } else {
4541	+ instance.close(self.startEvent);
4542	+ }
4543	+
4544	+ break;
4545	+
4546	+ case "zoom":
4547	+ if (current.type == "image" && (current.isLoaded \|\| current.$ghost)) {
4548	+ if (instance.canPan()) {
4549	+ instance.scaleToFit();
4550	+ } else if (instance.isScaledDown()) {
4551	+ instance.scaleToActual(tapX, tapY);
4552	+ } else if (instance.group.length < 2) {
4553	+ instance.close(self.startEvent);
4554	+ }
4555	+ }
4556	+
4557	+ break;
4558	+ }
4559	+ };
4560	+
4561	+ // Ignore right click
4562	+ if (e.originalEvent && e.originalEvent.button == 2) {
4563	+ return;
4564	+ }
4565	+
4566	+ // Skip if clicked on the scrollbar
4567	+ if (!$target.is("img") && tapX > $target[0].clientWidth + $target.offset().left) {
4568	+ return;
4569	+ }
4570	+
4571	+ // Check where is clicked
4572	+ if ($target.is(".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container")) {
4573	+ where = "Outside";
4574	+ } else if ($target.is(".fancybox-slide")) {
4575	+ where = "Slide";
4576	+ } else if (
4577	+ instance.current.$content &&
4578	+ instance.current.$content
4579	+ .find($target)
4580	+ .addBack()
4581	+ .filter($target).length
4582	+ ) {
4583	+ where = "Content";
4584	+ } else {
4585	+ return;
4586	+ }
4587	+
4588	+ // Check if this is a double tap
4589	+ if (self.tapped) {
4590	+ // Stop previously created single tap
4591	+ clearTimeout(self.tapped);
4592	+ self.tapped = null;
4593	+
4594	+ // Skip if distance between taps is too big
4595	+ if (Math.abs(tapX - self.tapX) > 50 \|\| Math.abs(tapY - self.tapY) > 50) {
4596	+ return this;
4597	+ }
4598	+
4599	+ // OK, now we assume that this is a double-tap
4600	+ process("dblclick" + where);
4601	+ } else {
4602	+ // Single tap will be processed if user has not clicked second time within 300ms
4603	+ // or there is no need to wait for double-tap
4604	+ self.tapX = tapX;
4605	+ self.tapY = tapY;
4606	+
4607	+ if (current.opts["dblclick" + where] && current.opts["dblclick" + where] !== current.opts["click" + where]) {
4608	+ self.tapped = setTimeout(function() {
4609	+ self.tapped = null;
4610	+
4611	+ if (!instance.isAnimating) {
4612	+ process("click" + where);
4613	+ }
4614	+ }, 500);
4615	+ } else {
4616	+ process("click" + where);
4617	+ }
4618	+ }
4619	+
4620	+ return this;
4621	+ };
4622	+
4623	+ $(document)
4624	+ .on("onActivate.fb", function(e, instance) {
4625	+ if (instance && !instance.Guestures) {
4626	+ instance.Guestures = new Guestures(instance);
4627	+ }
4628	+ })
4629	+ .on("beforeClose.fb", function(e, instance) {
4630	+ if (instance && instance.Guestures) {
4631	+ instance.Guestures.destroy();
4632	+ }
4633	+ });
4634	+ })(window, document, jQuery);
4635	+
4636	+ // ==========================================================================
4637	+ //
4638	+ // SlideShow
4639	+ // Enables slideshow functionality
4640	+ //
4641	+ // Example of usage:
4642	+ // $.fancybox.getInstance().SlideShow.start()
4643	+ //
4644	+ // ==========================================================================
4645	+ (function(document, $) {
4646	+ "use strict";
4647	+
4648	+ $.extend(true, $.fancybox.defaults, {
4649	+ btnTpl: {
4650	+ slideShow:
4651	+ '<button data-fancybox-play class="fancybox-button fancybox-button--play" title="{{PLAY_START}}">' +
4652	+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M6.5 5.4v13.2l11-6.6z"/></svg>' +
4653	+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M8.33 5.75h2.2v12.5h-2.2V5.75zm5.15 0h2.2v12.5h-2.2V5.75z"/></svg>' +
4654	+ "</button>"
4655	+ },
4656	+ slideShow: {
4657	+ autoStart: false,
4658	+ speed: 3000,
4659	+ progress: true
4660	+ }
4661	+ });
4662	+
4663	+ var SlideShow = function(instance) {
4664	+ this.instance = instance;
4665	+ this.init();
4666	+ };
4667	+
4668	+ $.extend(SlideShow.prototype, {
4669	+ timer: null,
4670	+ isActive: false,
4671	+ $button: null,
4672	+
4673	+ init: function() {
4674	+ var self = this,
4675	+ instance = self.instance,
4676	+ opts = instance.group[instance.currIndex].opts.slideShow;
4677	+
4678	+ self.$button = instance.$refs.toolbar.find("[data-fancybox-play]").on("click", function() {
4679	+ self.toggle();
4680	+ });
4681	+
4682	+ if (instance.group.length < 2 \|\| !opts) {
4683	+ self.$button.hide();
4684	+ } else if (opts.progress) {
4685	+ self.$progress = $('<div class="fancybox-progress"></div>').appendTo(instance.$refs.inner);
4686	+ }
4687	+ },
4688	+
4689	+ set: function(force) {
4690	+ var self = this,
4691	+ instance = self.instance,
4692	+ current = instance.current;
4693	+
4694	+ // Check if reached last element
4695	+ if (current && (force === true \|\| current.opts.loop \|\| instance.currIndex < instance.group.length - 1)) {
4696	+ if (self.isActive && current.contentType !== "video") {
4697	+ if (self.$progress) {
4698	+ $.fancybox.animate(self.$progress.show(), {scaleX: 1}, current.opts.slideShow.speed);
4699	+ }
4700	+
4701	+ self.timer = setTimeout(function() {
4702	+ if (!instance.current.opts.loop && instance.current.index == instance.group.length - 1) {
4703	+ instance.jumpTo(0);
4704	+ } else {
4705	+ instance.next();
4706	+ }
4707	+ }, current.opts.slideShow.speed);
4708	+ }
4709	+ } else {
4710	+ self.stop();
4711	+ instance.idleSecondsCounter = 0;
4712	+ instance.showControls();
4713	+ }
4714	+ },
4715	+
4716	+ clear: function() {
4717	+ var self = this;
4718	+
4719	+ clearTimeout(self.timer);
4720	+
4721	+ self.timer = null;
4722	+
4723	+ if (self.$progress) {
4724	+ self.$progress.removeAttr("style").hide();
4725	+ }
4726	+ },
4727	+
4728	+ start: function() {
4729	+ var self = this,
4730	+ current = self.instance.current;
4731	+
4732	+ if (current) {
4733	+ self.$button
4734	+ .attr("title", (current.opts.i18n[current.opts.lang] \|\| current.opts.i18n.en).PLAY_STOP)
4735	+ .removeClass("fancybox-button--play")
4736	+ .addClass("fancybox-button--pause");
4737	+
4738	+ self.isActive = true;
4739	+
4740	+ if (current.isComplete) {
4741	+ self.set(true);
4742	+ }
4743	+
4744	+ self.instance.trigger("onSlideShowChange", true);
4745	+ }
4746	+ },
4747	+
4748	+ stop: function() {
4749	+ var self = this,
4750	+ current = self.instance.current;
4751	+
4752	+ self.clear();
4753	+
4754	+ self.$button
4755	+ .attr("title", (current.opts.i18n[current.opts.lang] \|\| current.opts.i18n.en).PLAY_START)
4756	+ .removeClass("fancybox-button--pause")
4757	+ .addClass("fancybox-button--play");
4758	+
4759	+ self.isActive = false;
4760	+
4761	+ self.instance.trigger("onSlideShowChange", false);
4762	+
4763	+ if (self.$progress) {
4764	+ self.$progress.removeAttr("style").hide();
4765	+ }
4766	+ },
4767	+
4768	+ toggle: function() {
4769	+ var self = this;
4770	+
4771	+ if (self.isActive) {
4772	+ self.stop();
4773	+ } else {
4774	+ self.start();
4775	+ }
4776	+ }
4777	+ });
4778	+
4779	+ $(document).on({
4780	+ "onInit.fb": function(e, instance) {
4781	+ if (instance && !instance.SlideShow) {
4782	+ instance.SlideShow = new SlideShow(instance);
4783	+ }
4784	+ },
4785	+
4786	+ "beforeShow.fb": function(e, instance, current, firstRun) {
4787	+ var SlideShow = instance && instance.SlideShow;
4788	+
4789	+ if (firstRun) {
4790	+ if (SlideShow && current.opts.slideShow.autoStart) {
4791	+ SlideShow.start();
4792	+ }
4793	+ } else if (SlideShow && SlideShow.isActive) {
4794	+ SlideShow.clear();
4795	+ }
4796	+ },
4797	+
4798	+ "afterShow.fb": function(e, instance, current) {
4799	+ var SlideShow = instance && instance.SlideShow;
4800	+
4801	+ if (SlideShow && SlideShow.isActive) {
4802	+ SlideShow.set();
4803	+ }
4804	+ },
4805	+
4806	+ "afterKeydown.fb": function(e, instance, current, keypress, keycode) {
4807	+ var SlideShow = instance && instance.SlideShow;
4808	+
4809	+ // "P" or Spacebar
4810	+ if (SlideShow && current.opts.slideShow && (keycode === 80 \|\| keycode === 32) && !$(document.activeElement).is("button,a,input")) {
4811	+ keypress.preventDefault();
4812	+
4813	+ SlideShow.toggle();
4814	+ }
4815	+ },
4816	+
4817	+ "beforeClose.fb onDeactivate.fb": function(e, instance) {
4818	+ var SlideShow = instance && instance.SlideShow;
4819	+
4820	+ if (SlideShow) {
4821	+ SlideShow.stop();
4822	+ }
4823	+ }
4824	+ });
4825	+
4826	+ // Page Visibility API to pause slideshow when window is not active
4827	+ $(document).on("visibilitychange", function() {
4828	+ var instance = $.fancybox.getInstance(),
4829	+ SlideShow = instance && instance.SlideShow;
4830	+
4831	+ if (SlideShow && SlideShow.isActive) {
4832	+ if (document.hidden) {
4833	+ SlideShow.clear();
4834	+ } else {
4835	+ SlideShow.set();
4836	+ }
4837	+ }
4838	+ });
4839	+ })(document, jQuery);
4840	+
4841	+ // ==========================================================================
4842	+ //
4843	+ // FullScreen
4844	+ // Adds fullscreen functionality
4845	+ //
4846	+ // ==========================================================================
4847	+ (function(document, $) {
4848	+ "use strict";
4849	+
4850	+ // Collection of methods supported by user browser
4851	+ var fn = (function() {
4852	+ var fnMap = [
4853	+ ["requestFullscreen", "exitFullscreen", "fullscreenElement", "fullscreenEnabled", "fullscreenchange", "fullscreenerror"],
4854	+ // new WebKit
4855	+ [
4856	+ "webkitRequestFullscreen",
4857	+ "webkitExitFullscreen",
4858	+ "webkitFullscreenElement",
4859	+ "webkitFullscreenEnabled",
4860	+ "webkitfullscreenchange",
4861	+ "webkitfullscreenerror"
4862	+ ],
4863	+ // old WebKit (Safari 5.1)
4864	+ [
4865	+ "webkitRequestFullScreen",
4866	+ "webkitCancelFullScreen",
4867	+ "webkitCurrentFullScreenElement",
4868	+ "webkitCancelFullScreen",
4869	+ "webkitfullscreenchange",
4870	+ "webkitfullscreenerror"
4871	+ ],
4872	+ [
4873	+ "mozRequestFullScreen",
4874	+ "mozCancelFullScreen",
4875	+ "mozFullScreenElement",
4876	+ "mozFullScreenEnabled",
4877	+ "mozfullscreenchange",
4878	+ "mozfullscreenerror"
4879	+ ],
4880	+ ["msRequestFullscreen", "msExitFullscreen", "msFullscreenElement", "msFullscreenEnabled", "MSFullscreenChange", "MSFullscreenError"]
4881	+ ];
4882	+
4883	+ var ret = {};
4884	+
4885	+ for (var i = 0; i < fnMap.length; i++) {
4886	+ var val = fnMap[i];
4887	+
4888	+ if (val && val[1] in document) {
4889	+ for (var j = 0; j < val.length; j++) {
4890	+ ret[fnMap[0][j]] = val[j];
4891	+ }
4892	+
4893	+ return ret;
4894	+ }
4895	+ }
4896	+
4897	+ return false;
4898	+ })();
4899	+
4900	+ if (fn) {
4901	+ var FullScreen = {
4902	+ request: function(elem) {
4903	+ elem = elem \|\| document.documentElement;
4904	+
4905	+ elem[fn.requestFullscreen](elem.ALLOW_KEYBOARD_INPUT);
4906	+ },
4907	+ exit: function() {
4908	+ document[fn.exitFullscreen]();
4909	+ },
4910	+ toggle: function(elem) {
4911	+ elem = elem \|\| document.documentElement;
4912	+
4913	+ if (this.isFullscreen()) {
4914	+ this.exit();
4915	+ } else {
4916	+ this.request(elem);
4917	+ }
4918	+ },
4919	+ isFullscreen: function() {
4920	+ return Boolean(document[fn.fullscreenElement]);
4921	+ },
4922	+ enabled: function() {
4923	+ return Boolean(document[fn.fullscreenEnabled]);
4924	+ }
4925	+ };
4926	+
4927	+ $.extend(true, $.fancybox.defaults, {
4928	+ btnTpl: {
4929	+ fullScreen:
4930	+ '<button data-fancybox-fullscreen class="fancybox-button fancybox-button--fsenter" title="{{FULL_SCREEN}}">' +
4931	+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M7 14H5v5h5v-2H7v-3zm-2-4h2V7h3V5H5v5zm12 7h-3v2h5v-5h-2v3zM14 5v2h3v3h2V5h-5z"/></svg>' +
4932	+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M5 16h3v3h2v-5H5zm3-8H5v2h5V5H8zm6 11h2v-3h3v-2h-5zm2-11V5h-2v5h5V8z"/></svg>' +
4933	+ "</button>"
4934	+ },
4935	+ fullScreen: {
4936	+ autoStart: false
4937	+ }
4938	+ });
4939	+
4940	+ $(document).on(fn.fullscreenchange, function() {
4941	+ var isFullscreen = FullScreen.isFullscreen(),
4942	+ instance = $.fancybox.getInstance();
4943	+
4944	+ if (instance) {
4945	+ // If image is zooming, then force to stop and reposition properly
4946	+ if (instance.current && instance.current.type === "image" && instance.isAnimating) {
4947	+ instance.current.$content.css("transition", "none");
4948	+
4949	+ instance.isAnimating = false;
4950	+
4951	+ instance.update(true, true, 0);
4952	+ }
4953	+
4954	+ instance.trigger("onFullscreenChange", isFullscreen);
4955	+
4956	+ instance.$refs.container.toggleClass("fancybox-is-fullscreen", isFullscreen);
4957	+
4958	+ instance.$refs.toolbar
4959	+ .find("[data-fancybox-fullscreen]")
4960	+ .toggleClass("fancybox-button--fsenter", !isFullscreen)
4961	+ .toggleClass("fancybox-button--fsexit", isFullscreen);
4962	+ }
4963	+ });
4964	+ }
4965	+
4966	+ $(document).on({
4967	+ "onInit.fb": function(e, instance) {
4968	+ var $container;
4969	+
4970	+ if (!fn) {
4971	+ instance.$refs.toolbar.find("[data-fancybox-fullscreen]").remove();
4972	+
4973	+ return;
4974	+ }
4975	+
4976	+ if (instance && instance.group[instance.currIndex].opts.fullScreen) {
4977	+ $container = instance.$refs.container;
4978	+
4979	+ $container.on("click.fb-fullscreen", "[data-fancybox-fullscreen]", function(e) {
4980	+ e.stopPropagation();
4981	+ e.preventDefault();
4982	+
4983	+ FullScreen.toggle();
4984	+ });
4985	+
4986	+ if (instance.opts.fullScreen && instance.opts.fullScreen.autoStart === true) {
4987	+ FullScreen.request();
4988	+ }
4989	+
4990	+ // Expose API
4991	+ instance.FullScreen = FullScreen;
4992	+ } else if (instance) {
4993	+ instance.$refs.toolbar.find("[data-fancybox-fullscreen]").hide();
4994	+ }
4995	+ },
4996	+
4997	+ "afterKeydown.fb": function(e, instance, current, keypress, keycode) {
4998	+ // "F"
4999	+ if (instance && instance.FullScreen && keycode === 70) {
5000	+ keypress.preventDefault();
5001	+
5002	+ instance.FullScreen.toggle();
5003	+ }
5004	+ },
5005	+
5006	+ "beforeClose.fb": function(e, instance) {
5007	+ if (instance && instance.FullScreen && instance.$refs.container.hasClass("fancybox-is-fullscreen")) {
5008	+ FullScreen.exit();
5009	+ }
5010	+ }
5011	+ });
5012	+ })(document, jQuery);
5013	+
5014	+ // ==========================================================================
5015	+ //
5016	+ // Thumbs
5017	+ // Displays thumbnails in a grid
5018	+ //
5019	+ // ==========================================================================
5020	+ (function(document, $) {
5021	+ "use strict";
5022	+
5023	+ var CLASS = "fancybox-thumbs",
5024	+ CLASS_ACTIVE = CLASS + "-active";
5025	+
5026	+ // Make sure there are default values
5027	+ $.fancybox.defaults = $.extend(
5028	+ true,
5029	+ {
5030	+ btnTpl: {
5031	+ thumbs:
5032	+ '<button data-fancybox-thumbs class="fancybox-button fancybox-button--thumbs" title="{{THUMBS}}">' +
5033	+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M14.59 14.59h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76H5.65V5.65z"/></svg>' +
5034	+ "</button>"
5035	+ },
5036	+ thumbs: {
5037	+ autoStart: false, // Display thumbnails on opening
5038	+ hideOnClose: true, // Hide thumbnail grid when closing animation starts
5039	+ parentEl: ".fancybox-container", // Container is injected into this element
5040	+ axis: "y" // Vertical (y) or horizontal (x) scrolling
5041	+ }
5042	+ },
5043	+ $.fancybox.defaults
5044	+ );
5045	+
5046	+ var FancyThumbs = function(instance) {
5047	+ this.init(instance);
5048	+ };
5049	+
5050	+ $.extend(FancyThumbs.prototype, {
5051	+ $button: null,
5052	+ $grid: null,
5053	+ $list: null,
5054	+ isVisible: false,
5055	+ isActive: false,
5056	+
5057	+ init: function(instance) {
5058	+ var self = this,
5059	+ group = instance.group,
5060	+ enabled = 0;
5061	+
5062	+ self.instance = instance;
5063	+ self.opts = group[instance.currIndex].opts.thumbs;
5064	+
5065	+ instance.Thumbs = self;
5066	+
5067	+ self.$button = instance.$refs.toolbar.find("[data-fancybox-thumbs]");
5068	+
5069	+ // Enable thumbs if at least two group items have thumbnails
5070	+ for (var i = 0, len = group.length; i < len; i++) {
5071	+ if (group[i].thumb) {
5072	+ enabled++;
5073	+ }
5074	+
5075	+ if (enabled > 1) {
5076	+ break;
5077	+ }
5078	+ }
5079	+
5080	+ if (enabled > 1 && !!self.opts) {
5081	+ self.$button.removeAttr("style").on("click", function() {
5082	+ self.toggle();
5083	+ });
5084	+
5085	+ self.isActive = true;
5086	+ } else {
5087	+ self.$button.hide();
5088	+ }
5089	+ },
5090	+
5091	+ create: function() {
5092	+ var self = this,
5093	+ instance = self.instance,
5094	+ parentEl = self.opts.parentEl,
5095	+ list = [],
5096	+ src;
5097	+
5098	+ if (!self.$grid) {
5099	+ // Create main element
5100	+ self.$grid = $('<div class="' + CLASS + " " + CLASS + "-" + self.opts.axis + '"></div>').appendTo(
5101	+ instance.$refs.container
5102	+ .find(parentEl)
5103	+ .addBack()
5104	+ .filter(parentEl)
5105	+ );
5106	+
5107	+ // Add "click" event that performs gallery navigation
5108	+ self.$grid.on("click", "a", function() {
5109	+ instance.jumpTo($(this).attr("data-index"));
5110	+ });
5111	+ }
5112	+
5113	+ // Build the list
5114	+ if (!self.$list) {
5115	+ self.$list = $('<div class="' + CLASS + '__list">').appendTo(self.$grid);
5116	+ }
5117	+
5118	+ $.each(instance.group, function(i, item) {
5119	+ src = item.thumb;
5120	+
5121	+ if (!src && item.type === "image") {
5122	+ src = item.src;
5123	+ }
5124	+
5125	+ list.push(
5126	+ '<a href="javascript:;" tabindex="0" data-index="' +
5127	+ i +
5128	+ '"' +
5129	+ (src && src.length ? ' style="background-image:url(' + src + ')"' : 'class="fancybox-thumbs-missing"') +
5130	+ "></a>"
5131	+ );
5132	+ });
5133	+
5134	+ self.$list[0].innerHTML = list.join("");
5135	+
5136	+ if (self.opts.axis === "x") {
5137	+ // Set fixed width for list element to enable horizontal scrolling
5138	+ self.$list.width(
5139	+ parseInt(self.$grid.css("padding-right"), 10) +
5140	+ instance.group.length *
5141	+ self.$list
5142	+ .children()
5143	+ .eq(0)
5144	+ .outerWidth(true)
5145	+ );
5146	+ }
5147	+ },
5148	+
5149	+ focus: function(duration) {
5150	+ var self = this,
5151	+ $list = self.$list,
5152	+ $grid = self.$grid,
5153	+ thumb,
5154	+ thumbPos;
5155	+
5156	+ if (!self.instance.current) {
5157	+ return;
5158	+ }
5159	+
5160	+ thumb = $list
5161	+ .children()
5162	+ .removeClass(CLASS_ACTIVE)
5163	+ .filter('[data-index="' + self.instance.current.index + '"]')
5164	+ .addClass(CLASS_ACTIVE);
5165	+
5166	+ thumbPos = thumb.position();
5167	+
5168	+ // Check if need to scroll to make current thumb visible
5169	+ if (self.opts.axis === "y" && (thumbPos.top < 0 \|\| thumbPos.top > $list.height() - thumb.outerHeight())) {
5170	+ $list.stop().animate(
5171	+ {
5172	+ scrollTop: $list.scrollTop() + thumbPos.top
5173	+ },
5174	+ duration
5175	+ );
5176	+ } else if (
5177	+ self.opts.axis === "x" &&
5178	+ (thumbPos.left < $grid.scrollLeft() \|\| thumbPos.left > $grid.scrollLeft() + ($grid.width() - thumb.outerWidth()))
5179	+ ) {
5180	+ $list
5181	+ .parent()
5182	+ .stop()
5183	+ .animate(
5184	+ {
5185	+ scrollLeft: thumbPos.left
5186	+ },
5187	+ duration
5188	+ );
5189	+ }
5190	+ },
5191	+
5192	+ update: function() {
5193	+ var that = this;
5194	+ that.instance.$refs.container.toggleClass("fancybox-show-thumbs", this.isVisible);
5195	+
5196	+ if (that.isVisible) {
5197	+ if (!that.$grid) {
5198	+ that.create();
5199	+ }
5200	+
5201	+ that.instance.trigger("onThumbsShow");
5202	+
5203	+ that.focus(0);
5204	+ } else if (that.$grid) {
5205	+ that.instance.trigger("onThumbsHide");
5206	+ }
5207	+
5208	+ // Update content position
5209	+ that.instance.update();
5210	+ },
5211	+
5212	+ hide: function() {
5213	+ this.isVisible = false;
5214	+ this.update();
5215	+ },
5216	+
5217	+ show: function() {
5218	+ this.isVisible = true;
5219	+ this.update();
5220	+ },
5221	+
5222	+ toggle: function() {
5223	+ this.isVisible = !this.isVisible;
5224	+ this.update();
5225	+ }
5226	+ });
5227	+
5228	+ $(document).on({
5229	+ "onInit.fb": function(e, instance) {
5230	+ var Thumbs;
5231	+
5232	+ if (instance && !instance.Thumbs) {
5233	+ Thumbs = new FancyThumbs(instance);
5234	+
5235	+ if (Thumbs.isActive && Thumbs.opts.autoStart === true) {
5236	+ Thumbs.show();
5237	+ }
5238	+ }
5239	+ },
5240	+
5241	+ "beforeShow.fb": function(e, instance, item, firstRun) {
5242	+ var Thumbs = instance && instance.Thumbs;
5243	+
5244	+ if (Thumbs && Thumbs.isVisible) {
5245	+ Thumbs.focus(firstRun ? 0 : 250);
5246	+ }
5247	+ },
5248	+
5249	+ "afterKeydown.fb": function(e, instance, current, keypress, keycode) {
5250	+ var Thumbs = instance && instance.Thumbs;
5251	+
5252	+ // "G"
5253	+ if (Thumbs && Thumbs.isActive && keycode === 71) {
5254	+ keypress.preventDefault();
5255	+
5256	+ Thumbs.toggle();
5257	+ }
5258	+ },
5259	+
5260	+ "beforeClose.fb": function(e, instance) {
5261	+ var Thumbs = instance && instance.Thumbs;
5262	+
5263	+ if (Thumbs && Thumbs.isVisible && Thumbs.opts.hideOnClose !== false) {
5264	+ Thumbs.$grid.hide();
5265	+ }
5266	+ }
5267	+ });
5268	+ })(document, jQuery);
5269	+
5270	+ //// ==========================================================================
5271	+ //
5272	+ // Share
5273	+ // Displays simple form for sharing current url
5274	+ //
5275	+ // ==========================================================================
5276	+ (function(document, $) {
5277	+ "use strict";
5278	+
5279	+ $.extend(true, $.fancybox.defaults, {
5280	+ btnTpl: {
5281	+ share:
5282	+ '<button data-fancybox-share class="fancybox-button fancybox-button--share" title="{{SHARE}}">' +
5283	+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M2.55 19c1.4-8.4 9.1-9.8 11.9-9.8V5l7 7-7 6.3v-3.5c-2.8 0-10.5 2.1-11.9 4.2z"/></svg>' +
5284	+ "</button>"
5285	+ },
5286	+ share: {
5287	+ url: function(instance, item) {
5288	+ return (
5289	+ (!instance.currentHash && !(item.type === "inline" \|\| item.type === "html") ? item.origSrc \|\| item.src : false) \|\| window.location
5290	+ );
5291	+ },
5292	+ tpl:
5293	+ '<div class="fancybox-share">' +
5294	+ "<h1>{{SHARE}}</h1>" +
5295	+ "<p>" +
5296	+ '<a class="fancybox-share__button fancybox-share__button--fb" href="https://www.facebook.com/sharer/sharer.php?u={{url}}">' +
5297	+ '<svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m287 456v-299c0-21 6-35 35-35h38v-63c-7-1-29-3-55-3-54 0-91 33-91 94v306m143-254h-205v72h196" /></svg>' +
5298	+ "<span>Facebook</span>" +
5299	+ "</a>" +
5300	+ '<a class="fancybox-share__button fancybox-share__button--tw" href="https://twitter.com/intent/tweet?url={{url}}&text={{descr}}">' +
5301	+ '<svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m456 133c-14 7-31 11-47 13 17-10 30-27 37-46-15 10-34 16-52 20-61-62-157-7-141 75-68-3-129-35-169-85-22 37-11 86 26 109-13 0-26-4-37-9 0 39 28 72 65 80-12 3-25 4-37 2 10 33 41 57 77 57-42 30-77 38-122 34 170 111 378-32 359-208 16-11 30-25 41-42z" /></svg>' +
5302	+ "<span>Twitter</span>" +
5303	+ "</a>" +
5304	+ '<a class="fancybox-share__button fancybox-share__button--pt" href="https://www.pinterest.com/pin/create/button/?url={{url}}&description={{descr}}&media={{media}}">' +
5305	+ '<svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m265 56c-109 0-164 78-164 144 0 39 15 74 47 87 5 2 10 0 12-5l4-19c2-6 1-8-3-13-9-11-15-25-15-45 0-58 43-110 113-110 62 0 96 38 96 88 0 67-30 122-73 122-24 0-42-19-36-44 6-29 20-60 20-81 0-19-10-35-31-35-25 0-44 26-44 60 0 21 7 36 7 36l-30 125c-8 37-1 83 0 87 0 3 4 4 5 2 2-3 32-39 42-75l16-64c8 16 31 29 56 29 74 0 124-67 124-157 0-69-58-132-146-132z" fill="#fff"/></svg>' +
5306	+ "<span>Pinterest</span>" +
5307	+ "</a>" +
5308	+ "</p>" +
5309	+ '<p><input class="fancybox-share__input" type="text" value="{{url_raw}}" onclick="select()" /></p>' +
5310	+ "</div>"
5311	+ }
5312	+ });
5313	+
5314	+ function escapeHtml(string) {
5315	+ var entityMap = {
5316	+ "&": "&",
5317	+ "<": "<",
5318	+ ">": ">",
5319	+ '"': """,
5320	+ "'": "'",
5321	+ "/": "/",
5322	+ "`": "`",
5323	+ "=": "="
5324	+ };
5325	+
5326	+ return String(string).replace(/[&<>"'`=\/]/g, function(s) {
5327	+ return entityMap[s];
5328	+ });
5329	+ }
5330	+
5331	+ $(document).on("click", "[data-fancybox-share]", function() {
5332	+ var instance = $.fancybox.getInstance(),
5333	+ current = instance.current \|\| null,
5334	+ url,
5335	+ tpl;
5336	+
5337	+ if (!current) {
5338	+ return;
5339	+ }
5340	+
5341	+ if ($.type(current.opts.share.url) === "function") {
5342	+ url = current.opts.share.url.apply(current, [instance, current]);
5343	+ }
5344	+
5345	+ tpl = current.opts.share.tpl
5346	+ .replace(/\{\{media\}\}/g, current.type === "image" ? encodeURIComponent(current.src) : "")
5347	+ .replace(/\{\{url\}\}/g, encodeURIComponent(url))
5348	+ .replace(/\{\{url_raw\}\}/g, escapeHtml(url))
5349	+ .replace(/\{\{descr\}\}/g, instance.$caption ? encodeURIComponent(instance.$caption.text()) : "");
5350	+
5351	+ $.fancybox.open({
5352	+ src: instance.translate(instance, tpl),
5353	+ type: "html",
5354	+ opts: {
5355	+ touch: false,
5356	+ animationEffect: false,
5357	+ afterLoad: function(shareInstance, shareCurrent) {
5358	+ // Close self if parent instance is closing
5359	+ instance.$refs.container.one("beforeClose.fb", function() {
5360	+ shareInstance.close(null, 0);
5361	+ });
5362	+
5363	+ // Opening links in a popup window
5364	+ shareCurrent.$content.find(".fancybox-share__button").click(function() {
5365	+ window.open(this.href, "Share", "width=550, height=450");
5366	+ return false;
5367	+ });
5368	+ },
5369	+ mobile: {
5370	+ autoFocus: false
5371	+ }
5372	+ }
5373	+ });
5374	+ });
5375	+ })(document, jQuery);
5376	+
5377	+ // ==========================================================================
5378	+ //
5379	+ // Hash
5380	+ // Enables linking to each modal
5381	+ //
5382	+ // ==========================================================================
5383	+ (function(window, document, $) {
5384	+ "use strict";
5385	+
5386	+ // Simple $.escapeSelector polyfill (for jQuery prior v3)
5387	+ if (!$.escapeSelector) {
5388	+ $.escapeSelector = function(sel) {
5389	+ var rcssescape = /([\0-\x1f\x7f]\|^-?\d)\|^-$\|[^\x80-\uFFFF\w-]/g;
5390	+ var fcssescape = function(ch, asCodePoint) {
5391	+ if (asCodePoint) {
5392	+ // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER
5393	+ if (ch === "\0") {
5394	+ return "\uFFFD";
5395	+ }
5396	+
5397	+ // Control characters and (dependent upon position) numbers get escaped as code points
5398	+ return ch.slice(0, -1) + "\\" + ch.charCodeAt(ch.length - 1).toString(16) + " ";
5399	+ }
5400	+
5401	+ // Other potentially-special ASCII characters get backslash-escaped
5402	+ return "\\" + ch;
5403	+ };
5404	+
5405	+ return (sel + "").replace(rcssescape, fcssescape);
5406	+ };
5407	+ }
5408	+
5409	+ // Get info about gallery name and current index from url
5410	+ function parseUrl() {
5411	+ var hash = window.location.hash.substr(1),
5412	+ rez = hash.split("-"),
5413	+ index = rez.length > 1 && /^\+?\d+$/.test(rez[rez.length - 1]) ? parseInt(rez.pop(-1), 10) \|\| 1 : 1,
5414	+ gallery = rez.join("-");
5415	+
5416	+ return {
5417	+ hash: hash,
5418	+ /* Index is starting from 1 */
5419	+ index: index < 1 ? 1 : index,
5420	+ gallery: gallery
5421	+ };
5422	+ }
5423	+
5424	+ // Trigger click evnt on links to open new fancyBox instance
5425	+ function triggerFromUrl(url) {
5426	+ if (url.gallery !== "") {
5427	+ // If we can find element matching 'data-fancybox' atribute,
5428	+ // then triggering click event should start fancyBox
5429	+ $("[data-fancybox='" + $.escapeSelector(url.gallery) + "']")
5430	+ .eq(url.index - 1)
5431	+ .focus()
5432	+ .trigger("click.fb-start");
5433	+ }
5434	+ }
5435	+
5436	+ // Get gallery name from current instance
5437	+ function getGalleryID(instance) {
5438	+ var opts, ret;
5439	+
5440	+ if (!instance) {
5441	+ return false;
5442	+ }
5443	+
5444	+ opts = instance.current ? instance.current.opts : instance.opts;
5445	+ ret = opts.hash \|\| (opts.$orig ? opts.$orig.data("fancybox") \|\| opts.$orig.data("fancybox-trigger") : "");
5446	+
5447	+ return ret === "" ? false : ret;
5448	+ }
5449	+
5450	+ // Start when DOM becomes ready
5451	+ $(function() {
5452	+ // Check if user has disabled this module
5453	+ if ($.fancybox.defaults.hash === false) {
5454	+ return;
5455	+ }
5456	+
5457	+ // Update hash when opening/closing fancyBox
5458	+ $(document).on({
5459	+ "onInit.fb": function(e, instance) {
5460	+ var url, gallery;
5461	+
5462	+ if (instance.group[instance.currIndex].opts.hash === false) {
5463	+ return;
5464	+ }
5465	+
5466	+ url = parseUrl();
5467	+ gallery = getGalleryID(instance);
5468	+
5469	+ // Make sure gallery start index matches index from hash
5470	+ if (gallery && url.gallery && gallery == url.gallery) {
5471	+ instance.currIndex = url.index - 1;
5472	+ }
5473	+ },
5474	+
5475	+ "beforeShow.fb": function(e, instance, current, firstRun) {
5476	+ var gallery;
5477	+
5478	+ if (!current \|\| current.opts.hash === false) {
5479	+ return;
5480	+ }
5481	+
5482	+ // Check if need to update window hash
5483	+ gallery = getGalleryID(instance);
5484	+
5485	+ if (!gallery) {
5486	+ return;
5487	+ }
5488	+
5489	+ // Variable containing last hash value set by fancyBox
5490	+ // It will be used to determine if fancyBox needs to close after hash change is detected
5491	+ instance.currentHash = gallery + (instance.group.length > 1 ? "-" + (current.index + 1) : "");
5492	+
5493	+ // If current hash is the same (this instance most likely is opened by hashchange), then do nothing
5494	+ if (window.location.hash === "#" + instance.currentHash) {
5495	+ return;
5496	+ }
5497	+
5498	+ if (firstRun && !instance.origHash) {
5499	+ instance.origHash = window.location.hash;
5500	+ }
5501	+
5502	+ if (instance.hashTimer) {
5503	+ clearTimeout(instance.hashTimer);
5504	+ }
5505	+
5506	+ // Update hash
5507	+ instance.hashTimer = setTimeout(function() {
5508	+ if ("replaceState" in window.history) {
5509	+ window.history[firstRun ? "pushState" : "replaceState"](
5510	+ {},
5511	+ document.title,
5512	+ window.location.pathname + window.location.search + "#" + instance.currentHash
5513	+ );
5514	+
5515	+ if (firstRun) {
5516	+ instance.hasCreatedHistory = true;
5517	+ }
5518	+ } else {
5519	+ window.location.hash = instance.currentHash;
5520	+ }
5521	+
5522	+ instance.hashTimer = null;
5523	+ }, 300);
5524	+ },
5525	+
5526	+ "beforeClose.fb": function(e, instance, current) {
5527	+ if (current.opts.hash === false) {
5528	+ return;
5529	+ }
5530	+
5531	+ clearTimeout(instance.hashTimer);
5532	+
5533	+ // Goto previous history entry
5534	+ if (instance.currentHash && instance.hasCreatedHistory) {
5535	+ window.history.back();
5536	+ } else if (instance.currentHash) {
5537	+ if ("replaceState" in window.history) {
5538	+ window.history.replaceState({}, document.title, window.location.pathname + window.location.search + (instance.origHash \|\| ""));
5539	+ } else {
5540	+ window.location.hash = instance.origHash;
5541	+ }
5542	+ }
5543	+
5544	+ instance.currentHash = null;
5545	+ }
5546	+ });
5547	+
5548	+ // Check if need to start/close after url has changed
5549	+ $(window).on("hashchange.fb", function() {
5550	+ var url = parseUrl(),
5551	+ fb = null;
5552	+
5553	+ // Find last fancyBox instance that has "hash"
5554	+ $.each(
5555	+ $(".fancybox-container")
5556	+ .get()
5557	+ .reverse(),
5558	+ function(index, value) {
5559	+ var tmp = $(value).data("FancyBox");
5560	+
5561	+ if (tmp && tmp.currentHash) {
5562	+ fb = tmp;
5563	+ return false;
5564	+ }
5565	+ }
5566	+ );
5567	+
5568	+ if (fb) {
5569	+ // Now, compare hash values
5570	+ if (fb.currentHash !== url.gallery + "-" + url.index && !(url.index === 1 && fb.currentHash == url.gallery)) {
5571	+ fb.currentHash = null;
5572	+
5573	+ fb.close();
5574	+ }
5575	+ } else if (url.gallery !== "") {
5576	+ triggerFromUrl(url);
5577	+ }
5578	+ });
5579	+
5580	+ // Check current hash and trigger click event on matching element to start fancyBox, if needed
5581	+ setTimeout(function() {
5582	+ if (!$.fancybox.getInstance()) {
5583	+ triggerFromUrl(parseUrl());
5584	+ }
5585	+ }, 50);
5586	+ });
5587	+ })(window, document, jQuery);
5588	+
5589	+ // ==========================================================================
5590	+ //
5591	+ // Wheel
5592	+ // Basic mouse weheel support for gallery navigation
5593	+ //
5594	+ // ==========================================================================
5595	+ (function(document, $) {
5596	+ "use strict";
5597	+
5598	+ var prevTime = new Date().getTime();
5599	+
5600	+ $(document).on({
5601	+ "onInit.fb": function(e, instance, current) {
5602	+ instance.$refs.stage.on("mousewheel DOMMouseScroll wheel MozMousePixelScroll", function(e) {
5603	+ var current = instance.current,
5604	+ currTime = new Date().getTime();
5605	+
5606	+ if (instance.group.length < 2 \|\| current.opts.wheel === false \|\| (current.opts.wheel === "auto" && current.type !== "image")) {
5607	+ return;
5608	+ }
5609	+
5610	+ e.preventDefault();
5611	+ e.stopPropagation();
5612	+
5613	+ if (current.$slide.hasClass("fancybox-animated")) {
5614	+ return;
5615	+ }
5616	+
5617	+ e = e.originalEvent \|\| e;
5618	+
5619	+ if (currTime - prevTime < 250) {
5620	+ return;
5621	+ }
5622	+
5623	+ prevTime = currTime;
5624	+
5625	+ instance[(-e.deltaY \|\| -e.deltaX \|\| e.wheelDelta \|\| -e.detail) < 0 ? "next" : "previous"]();
5626	+ });
5627	+ }
5628	+ });
5629	+ })(document, jQuery);

admin/fancybox/jquery.fancybox.min.css ADDED Viewed

	@@ -0,0 +1 @@

+ body.compensate-for-scrollbar{overflow:hidden}.fancybox-active{height:auto}.fancybox-is-hidden{left:-9999px;margin:0;position:absolute!important;top:-9999px;visibility:hidden}.fancybox-container{-webkit-backface-visibility:hidden;height:100%;left:0;outline:none;position:fixed;-webkit-tap-highlight-color:transparent;top:0;-ms-touch-action:manipulation;touch-action:manipulation;-webkit-transform:translateZ(0);transform:translateZ(0);width:100%;z-index:99992}.fancybox-container *{box-sizing:border-box}.fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-stage{bottom:0;left:0;position:absolute;right:0;top:0}.fancybox-outer{-webkit-overflow-scrolling:touch;overflow-y:auto}.fancybox-bg{background:#1e1e1e;opacity:0;transition-duration:inherit;transition-property:opacity;transition-timing-function:cubic-bezier(.47,0,.74,.71)}.fancybox-is-open .fancybox-bg{opacity:.9;transition-timing-function:cubic-bezier(.22,.61,.36,1)}.fancybox-caption,.fancybox-infobar,.fancybox-navigation .fancybox-button,.fancybox-toolbar{direction:ltr;opacity:0;position:absolute;transition:opacity .25s ease,visibility 0s ease .25s;visibility:hidden;z-index:99997}.fancybox-show-caption .fancybox-caption,.fancybox-show-infobar .fancybox-infobar,.fancybox-show-nav .fancybox-navigation .fancybox-button,.fancybox-show-toolbar .fancybox-toolbar{opacity:1;transition:opacity .25s ease 0s,visibility 0s ease 0s;visibility:visible}.fancybox-infobar{color:#ccc;font-size:13px;-webkit-font-smoothing:subpixel-antialiased;height:44px;left:0;line-height:44px;min-width:44px;mix-blend-mode:difference;padding:0 10px;pointer-events:none;top:0;-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.fancybox-toolbar{right:0;top:0}.fancybox-stage{direction:ltr;overflow:visible;-webkit-transform:translateZ(0);transform:translateZ(0);z-index:99994}.fancybox-is-open .fancybox-stage{overflow:hidden}.fancybox-slide{-webkit-backface-visibility:hidden;display:none;height:100%;left:0;outline:none;overflow:auto;-webkit-overflow-scrolling:touch;padding:44px;position:absolute;text-align:center;top:0;transition-property:opacity,-webkit-transform;transition-property:transform,opacity;transition-property:transform,opacity,-webkit-transform;white-space:normal;width:100%;z-index:99994}.fancybox-slide:before{content:"";display:inline-block;font-size:0;height:100%;vertical-align:middle;width:0}.fancybox-is-sliding .fancybox-slide,.fancybox-slide--current,.fancybox-slide--next,.fancybox-slide--previous{display:block}.fancybox-slide--image{overflow:hidden;padding:44px 0}.fancybox-slide--image:before{display:none}.fancybox-slide--html{padding:6px}.fancybox-content{background:#fff;display:inline-block;margin:0;max-width:100%;overflow:auto;-webkit-overflow-scrolling:touch;padding:44px;position:relative;text-align:left;vertical-align:middle}.fancybox-slide--image .fancybox-content{-webkit-animation-timing-function:cubic-bezier(.5,0,.14,1);animation-timing-function:cubic-bezier(.5,0,.14,1);-webkit-backface-visibility:hidden;background:transparent;background-repeat:no-repeat;background-size:100% 100%;left:0;max-width:none;overflow:visible;padding:0;position:absolute;top:0;-webkit-transform-origin:top left;transform-origin:top left;transition-property:opacity,-webkit-transform;transition-property:transform,opacity;transition-property:transform,opacity,-webkit-transform;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;z-index:99995}.fancybox-can-zoomOut .fancybox-content{cursor:zoom-out}.fancybox-can-zoomIn .fancybox-content{cursor:zoom-in}.fancybox-can-pan .fancybox-content,.fancybox-can-swipe .fancybox-content{cursor:-webkit-grab;cursor:grab}.fancybox-is-grabbing .fancybox-content{cursor:-webkit-grabbing;cursor:grabbing}.fancybox-container [data-selectable=true]{cursor:text}.fancybox-image,.fancybox-spaceball{background:transparent;border:0;height:100%;left:0;margin:0;max-height:none;max-width:none;padding:0;position:absolute;top:0;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;width:100%}.fancybox-spaceball{z-index:1}.fancybox-slide--iframe .fancybox-content,.fancybox-slide--map .fancybox-content,.fancybox-slide--pdf .fancybox-content,.fancybox-slide--video .fancybox-content{height:100%;overflow:visible;padding:0;width:100%}.fancybox-slide--video .fancybox-content{background:#000}.fancybox-slide--map .fancybox-content{background:#e5e3df}.fancybox-slide--iframe .fancybox-content{background:#fff}.fancybox-iframe,.fancybox-video{background:transparent;border:0;display:block;height:100%;margin:0;overflow:hidden;padding:0;width:100%}.fancybox-iframe{left:0;position:absolute;top:0}.fancybox-error{background:#fff;cursor:default;max-width:400px;padding:40px;width:100%}.fancybox-error p{color:#444;font-size:16px;line-height:20px;margin:0;padding:0}.fancybox-button{background:rgba(30,30,30,.6);border:0;border-radius:0;box-shadow:none;cursor:pointer;display:inline-block;height:44px;margin:0;padding:10px;position:relative;transition:color .2s;vertical-align:top;visibility:inherit;width:44px}.fancybox-button,.fancybox-button:link,.fancybox-button:visited{color:#ccc}.fancybox-button:hover{color:#fff}.fancybox-button:focus{outline:none}.fancybox-button.fancybox-focus{outline:1px dotted}.fancybox-button[disabled],.fancybox-button[disabled]:hover{color:#888;cursor:default;outline:none}.fancybox-button div{height:100%}.fancybox-button svg{display:block;height:100%;overflow:visible;position:relative;width:100%}.fancybox-button svg path{fill:currentColor;stroke-width:0}.fancybox-button--fsenter svg:nth-child(2),.fancybox-button--fsexit svg:nth-child(1),.fancybox-button--pause svg:nth-child(1),.fancybox-button--play svg:nth-child(2){display:none}.fancybox-progress{background:#ff5268;height:2px;left:0;position:absolute;right:0;top:0;-webkit-transform:scaleX(0);transform:scaleX(0);-webkit-transform-origin:0;transform-origin:0;transition-property:-webkit-transform;transition-property:transform;transition-property:transform,-webkit-transform;transition-timing-function:linear;z-index:99998}.fancybox-close-small{background:transparent;border:0;border-radius:0;color:#ccc;cursor:pointer;opacity:.8;padding:8px;position:absolute;right:-12px;top:-44px;z-index:401}.fancybox-close-small:hover{color:#fff;opacity:1}.fancybox-slide--html .fancybox-close-small{color:currentColor;padding:10px;right:0;top:0}.fancybox-slide--image.fancybox-is-scaling .fancybox-content{overflow:hidden}.fancybox-is-scaling .fancybox-close-small,.fancybox-is-zoomable.fancybox-can-pan .fancybox-close-small{display:none}.fancybox-navigation .fancybox-button{background-clip:content-box;height:100px;opacity:0;position:absolute;top:calc(50% - 50px);width:70px}.fancybox-navigation .fancybox-button div{padding:7px}.fancybox-navigation .fancybox-button--arrow_left{left:0;padding:31px 26px 31px 6px}.fancybox-navigation .fancybox-button--arrow_right{padding:31px 6px 31px 26px;right:0}.fancybox-caption{bottom:0;color:#eee;font-size:14px;font-weight:400;left:0;line-height:1.5;padding:25px 44px;right:0;text-align:center;z-index:99996}.fancybox-caption:before{background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAEAAAD6CAQAAADKSeXYAAAAYklEQVQoz42RwQ3AMAgDjfcfup8WoRykfBAK5mQHKSz5rbXJPis1hjiV3CIqgG0hLZPkVkA4p4x5oR1bVeDrdCLrW2Q0D5bcwY3TGMHbdw3mPRuOtaspYP1w//G1OIcW148H0DMCqI/3mMMAAAAASUVORK5CYII=);background-repeat:repeat-x;background-size:contain;bottom:0;content:"";display:block;left:0;pointer-events:none;position:absolute;right:0;top:-44px;z-index:-1}.fancybox-caption a,.fancybox-caption a:link,.fancybox-caption a:visited{color:#ccc;text-decoration:none}.fancybox-caption a:hover{color:#fff;text-decoration:underline}.fancybox-loading{-webkit-animation:a 1s linear infinite;animation:a 1s linear infinite;background:transparent;border:4px solid #888;border-bottom-color:#fff;border-radius:50%;height:50px;left:50%;margin:-25px 0 0 -25px;opacity:.7;padding:0;position:absolute;top:50%;width:50px;z-index:99999}@-webkit-keyframes a{to{-webkit-transform:rotate(1turn);transform:rotate(1turn)}}@keyframes a{to{-webkit-transform:rotate(1turn);transform:rotate(1turn)}}.fancybox-animated{transition-timing-function:cubic-bezier(0,0,.25,1)}.fancybox-fx-slide.fancybox-slide--previous{opacity:0;-webkit-transform:translate3d(-100%,0,0);transform:translate3d(-100%,0,0)}.fancybox-fx-slide.fancybox-slide--next{opacity:0;-webkit-transform:translate3d(100%,0,0);transform:translate3d(100%,0,0)}.fancybox-fx-slide.fancybox-slide--current{opacity:1;-webkit-transform:translateZ(0);transform:translateZ(0)}.fancybox-fx-fade.fancybox-slide--next,.fancybox-fx-fade.fancybox-slide--previous{opacity:0;transition-timing-function:cubic-bezier(.19,1,.22,1)}.fancybox-fx-fade.fancybox-slide--current{opacity:1}.fancybox-fx-zoom-in-out.fancybox-slide--previous{opacity:0;-webkit-transform:scale3d(1.5,1.5,1.5);transform:scale3d(1.5,1.5,1.5)}.fancybox-fx-zoom-in-out.fancybox-slide--next{opacity:0;-webkit-transform:scale3d(.5,.5,.5);transform:scale3d(.5,.5,.5)}.fancybox-fx-zoom-in-out.fancybox-slide--current{opacity:1;-webkit-transform:scaleX(1);transform:scaleX(1)}.fancybox-fx-rotate.fancybox-slide--previous{opacity:0;-webkit-transform:rotate(-1turn);transform:rotate(-1turn)}.fancybox-fx-rotate.fancybox-slide--next{opacity:0;-webkit-transform:rotate(1turn);transform:rotate(1turn)}.fancybox-fx-rotate.fancybox-slide--current{opacity:1;-webkit-transform:rotate(0deg);transform:rotate(0deg)}.fancybox-fx-circular.fancybox-slide--previous{opacity:0;-webkit-transform:scale3d(0,0,0) translate3d(-100%,0,0);transform:scale3d(0,0,0) translate3d(-100%,0,0)}.fancybox-fx-circular.fancybox-slide--next{opacity:0;-webkit-transform:scale3d(0,0,0) translate3d(100%,0,0);transform:scale3d(0,0,0) translate3d(100%,0,0)}.fancybox-fx-circular.fancybox-slide--current{opacity:1;-webkit-transform:scaleX(1) translateZ(0);transform:scaleX(1) translateZ(0)}.fancybox-fx-tube.fancybox-slide--previous{-webkit-transform:translate3d(-100%,0,0) scale(.1) skew(-10deg);transform:translate3d(-100%,0,0) scale(.1) skew(-10deg)}.fancybox-fx-tube.fancybox-slide--next{-webkit-transform:translate3d(100%,0,0) scale(.1) skew(10deg);transform:translate3d(100%,0,0) scale(.1) skew(10deg)}.fancybox-fx-tube.fancybox-slide--current{-webkit-transform:translateZ(0) scale(1);transform:translateZ(0) scale(1)}@media (max-height:576px){.fancybox-caption{padding:12px}.fancybox-slide{padding-left:6px;padding-right:6px}.fancybox-slide--image{padding:6px 0}.fancybox-close-small{right:-6px}.fancybox-slide--image .fancybox-close-small{background:#4e4e4e;color:#f2f4f6;height:36px;opacity:1;padding:6px;right:0;top:0;width:36px}}.fancybox-share{background:#f4f4f4;border-radius:3px;max-width:90%;padding:30px;text-align:center}.fancybox-share h1{color:#222;font-size:35px;font-weight:700;margin:0 0 20px}.fancybox-share p{margin:0;padding:0}.fancybox-share__button{border:0;border-radius:3px;display:inline-block;font-size:14px;font-weight:700;line-height:40px;margin:0 5px 10px;min-width:130px;padding:0 15px;text-decoration:none;transition:all .2s;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;white-space:nowrap}.fancybox-share__button:link,.fancybox-share__button:visited{color:#fff}.fancybox-share__button:hover{text-decoration:none}.fancybox-share__button--fb{background:#3b5998}.fancybox-share__button--fb:hover{background:#344e86}.fancybox-share__button--pt{background:#bd081d}.fancybox-share__button--pt:hover{background:#aa0719}.fancybox-share__button--tw{background:#1da1f2}.fancybox-share__button--tw:hover{background:#0d95e8}.fancybox-share__button svg{height:25px;margin-right:7px;position:relative;top:-1px;vertical-align:middle;width:25px}.fancybox-share__button svg path{fill:#fff}.fancybox-share__input{background:transparent;border:0;border-bottom:1px solid #d7d7d7;border-radius:0;color:#5d5b5b;font-size:14px;margin:10px 0 0;outline:none;padding:10px 15px;width:100%}.fancybox-thumbs{background:#ddd;bottom:0;display:none;margin:0;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar;padding:2px 2px 4px;position:absolute;right:0;-webkit-tap-highlight-color:transparent;top:0;width:212px;z-index:99995}.fancybox-thumbs-x{overflow-x:auto;overflow-y:hidden}.fancybox-show-thumbs .fancybox-thumbs{display:block}.fancybox-show-thumbs .fancybox-inner{right:212px}.fancybox-thumbs__list{font-size:0;height:100%;list-style:none;margin:0;overflow-x:hidden;overflow-y:auto;padding:0;position:absolute;position:relative;white-space:nowrap;width:100%}.fancybox-thumbs-x .fancybox-thumbs__list{overflow:hidden}.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar{width:7px}.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar-track{background:#fff;border-radius:10px;box-shadow:inset 0 0 6px rgba(0,0,0,.3)}.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar-thumb{background:#2a2a2a;border-radius:10px}.fancybox-thumbs__list a{-webkit-backface-visibility:hidden;backface-visibility:hidden;background-color:rgba(0,0,0,.1);background-position:50%;background-repeat:no-repeat;background-size:cover;cursor:pointer;float:left;height:75px;margin:2px;max-height:calc(100% - 8px);max-width:calc(50% - 4px);outline:none;overflow:hidden;padding:0;position:relative;-webkit-tap-highlight-color:transparent;width:100px}.fancybox-thumbs__list a:before{border:6px solid #ff5268;bottom:0;content:"";left:0;opacity:0;position:absolute;right:0;top:0;transition:all .2s cubic-bezier(.25,.46,.45,.94);z-index:99991}.fancybox-thumbs__list a:focus:before{opacity:.5}.fancybox-thumbs__list a.fancybox-thumbs-active:before{opacity:1}@media (max-width:576px){.fancybox-thumbs{width:110px}.fancybox-show-thumbs .fancybox-inner{right:110px}.fancybox-thumbs__list a{max-width:calc(100% - 10px)}}

admin/fancybox/jquery.fancybox.min.js ADDED Viewed

	@@ -0,0 +1,13 @@


1	+ // ==================================================
2	+ // fancyBox v3.5.2
3	+ //
4	+ // Licensed GPLv3 for open source use
5	+ // or fancyBox Commercial License for commercial use
6	+ //
7	+ // http://fancyapps.com/fancybox/
8	+ // Copyright 2018 fancyApps
9	+ //
10	+ // ==================================================
11	+ !function(t,e,n,o){"use strict";function a(t,e){var o,a,i,s=[],r=0;t&&t.isDefaultPrevented()\|\|(t.preventDefault(),e=e\|\|{},t&&t.data&&(e=h(t.data.options,e)),o=e.$target\|\|n(t.currentTarget).trigger("blur"),i=n.fancybox.getInstance(),i&&i.$trigger&&i.$trigger.is(o)\|\|(e.selector?s=n(e.selector):(a=o.attr("data-fancybox")\|\|"",a?(s=t.data?t.data.items:[],s=s.length?s.filter('[data-fancybox="'+a+'"]'):n('[data-fancybox="'+a+'"]')):s=[o]),r=n(s).index(o),r<0&&(r=0),i=n.fancybox.open(s,e,r),i.$trigger=o))}if(t.console=t.console\|\|{info:function(t){}},n){if(n.fn.fancybox)return void console.info("fancyBox already initialized");var i={closeExisting:!1,loop:!1,gutter:50,keyboard:!0,preventCaptionOverlap:!0,arrows:!0,infobar:!0,smallBtn:"auto",toolbar:"auto",buttons:["zoom","slideShow","thumbs","close"],idleTime:3,protect:!1,modal:!1,image:{preload:!1},ajax:{settings:{data:{fancybox:!0}}},iframe:{tpl:'<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" allowfullscreen allow="autoplay; fullscreen" src=""></iframe>',preload:!0,css:{},attr:{scrolling:"auto"}},video:{tpl:'<video class="fancybox-video" controls controlsList="nodownload" poster="{{poster}}"><source src="{{src}}" type="{{format}}" />Sorry, your browser doesn\'t support embedded videos, <a href="{{src}}">download</a> and watch with your favorite video player!</video>',format:"",autoStart:!0},defaultType:"image",animationEffect:"zoom",animationDuration:366,zoomOpacity:"auto",transitionEffect:"fade",transitionDuration:366,slideClass:"",baseClass:"",baseTpl:'<div class="fancybox-container" role="dialog" tabindex="-1"><div class="fancybox-bg"></div><div class="fancybox-inner"><div class="fancybox-infobar"><span data-fancybox-index></span> / <span data-fancybox-count></span></div><div class="fancybox-toolbar">{{buttons}}</div><div class="fancybox-navigation">{{arrows}}</div><div class="fancybox-stage"></div><div class="fancybox-caption"></div></div></div>',spinnerTpl:'<div class="fancybox-loading"></div>',errorTpl:'<div class="fancybox-error"><p>{{ERROR}}</p></div>',btnTpl:{download:'<a download data-fancybox-download class="fancybox-button fancybox-button--download" title="{{DOWNLOAD}}" href="javascript:;"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.62 17.09V19H5.38v-1.91zm-2.97-6.96L17 11.45l-5 4.87-5-4.87 1.36-1.32 2.68 2.64V5h1.92v7.77z"/></svg></a>',zoom:'<button data-fancybox-zoom class="fancybox-button fancybox-button--zoom" title="{{ZOOM}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.7 17.3l-3-3a5.9 5.9 0 0 0-.6-7.6 5.9 5.9 0 0 0-8.4 0 5.9 5.9 0 0 0 0 8.4 5.9 5.9 0 0 0 7.7.7l3 3a1 1 0 0 0 1.3 0c.4-.5.4-1 0-1.5zM8.1 13.8a4 4 0 0 1 0-5.7 4 4 0 0 1 5.7 0 4 4 0 0 1 0 5.7 4 4 0 0 1-5.7 0z"/></svg></button>',close:'<button data-fancybox-close class="fancybox-button fancybox-button--close" title="{{CLOSE}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M12 10.6L6.6 5.2 5.2 6.6l5.4 5.4-5.4 5.4 1.4 1.4 5.4-5.4 5.4 5.4 1.4-1.4-5.4-5.4 5.4-5.4-1.4-1.4-5.4 5.4z"/></svg></button>',arrowLeft:'<button data-fancybox-prev class="fancybox-button fancybox-button--arrow_left" title="{{PREV}}"><div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M11.28 15.7l-1.34 1.37L5 12l4.94-5.07 1.34 1.38-2.68 2.72H19v1.94H8.6z"/></svg></div></button>',arrowRight:'<button data-fancybox-next class="fancybox-button fancybox-button--arrow_right" title="{{NEXT}}"><div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M15.4 12.97l-2.68 2.72 1.34 1.38L19 12l-4.94-5.07-1.34 1.38 2.68 2.72H5v1.94z"/></svg></div></button>',smallBtn:'<button type="button" data-fancybox-close class="fancybox-button fancybox-close-small" title="{{CLOSE}}"><svg xmlns="http://www.w3.org/2000/svg" version="1" viewBox="0 0 24 24"><path d="M13 12l5-5-1-1-5 5-5-5-1 1 5 5-5 5 1 1 5-5 5 5 1-1z"/></svg></button>'},parentEl:"body",hideScrollbar:!0,autoFocus:!0,backFocus:!0,trapFocus:!0,fullScreen:{autoStart:!1},touch:{vertical:!0,momentum:!0},hash:null,media:{},slideShow:{autoStart:!1,speed:3e3},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"},wheel:"auto",onInit:n.noop,beforeLoad:n.noop,afterLoad:n.noop,beforeShow:n.noop,afterShow:n.noop,beforeClose:n.noop,afterClose:n.noop,onActivate:n.noop,onDeactivate:n.noop,clickContent:function(t,e){return"image"===t.type&&"zoom"},clickSlide:"close",clickOutside:"close",dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1,mobile:{preventCaptionOverlap:!1,idleTime:!1,clickContent:function(t,e){return"image"===t.type&&"toggleControls"},clickSlide:function(t,e){return"image"===t.type?"toggleControls":"close"},dblclickContent:function(t,e){return"image"===t.type&&"zoom"},dblclickSlide:function(t,e){return"image"===t.type&&"zoom"}},lang:"en",i18n:{en:{CLOSE:"Close",NEXT:"Next",PREV:"Previous",ERROR:"The requested content cannot be loaded. <br/> Please try again later.",PLAY_START:"Start slideshow",PLAY_STOP:"Pause slideshow",FULL_SCREEN:"Full screen",THUMBS:"Thumbnails",DOWNLOAD:"Download",SHARE:"Share",ZOOM:"Zoom"},de:{CLOSE:"Schliessen",NEXT:"Weiter",PREV:"Zurück",ERROR:"Die angeforderten Daten konnten nicht geladen werden. <br/> Bitte versuchen Sie es später nochmal.",PLAY_START:"Diaschau starten",PLAY_STOP:"Diaschau beenden",FULL_SCREEN:"Vollbild",THUMBS:"Vorschaubilder",DOWNLOAD:"Herunterladen",SHARE:"Teilen",ZOOM:"Maßstab"}}},s=n(t),r=n(e),c=0,l=function(t){return t&&t.hasOwnProperty&&t instanceof n},d=function(){return t.requestAnimationFrame\|\|t.webkitRequestAnimationFrame\|\|t.mozRequestAnimationFrame\|\|t.oRequestAnimationFrame\|\|function(e){return t.setTimeout(e,1e3/60)}}(),u=function(){return t.cancelAnimationFrame\|\|t.webkitCancelAnimationFrame\|\|t.mozCancelAnimationFrame\|\|t.oCancelAnimationFrame\|\|function(e){t.clearTimeout(e)}}(),f=function(){var t,n=e.createElement("fakeelement"),a={transition:"transitionend",OTransition:"oTransitionEnd",MozTransition:"transitionend",WebkitTransition:"webkitTransitionEnd"};for(t in a)if(n.style[t]!==o)return a[t];return"transitionend"}(),p=function(t){return t&&t.length&&t[0].offsetHeight},h=function(t,e){var o=n.extend(!0,{},t,e);return n.each(e,function(t,e){n.isArray(e)&&(o[t]=e)}),o},g=function(t){var o,a;return!(!t\|\|t.ownerDocument!==e)&&(n(".fancybox-container").css("pointer-events","none"),o={x:t.getBoundingClientRect().left+t.offsetWidth/2,y:t.getBoundingClientRect().top+t.offsetHeight/2},a=e.elementFromPoint(o.x,o.y)===t,n(".fancybox-container").css("pointer-events",""),a)},b=function(t,e,o){var a=this;a.opts=h({index:o},n.fancybox.defaults),n.isPlainObject(e)&&(a.opts=h(a.opts,e)),n.fancybox.isMobile&&(a.opts=h(a.opts,a.opts.mobile)),a.id=a.opts.id\|\|++c,a.currIndex=parseInt(a.opts.index,10)\|\|0,a.prevIndex=null,a.prevPos=null,a.currPos=0,a.firstRun=!0,a.group=[],a.slides={},a.addContent(t),a.group.length&&a.init()};n.extend(b.prototype,{init:function(){var o,a,i=this,s=i.group[i.currIndex],r=s.opts;r.closeExisting&&n.fancybox.close(!0),n("body").addClass("fancybox-active"),!n.fancybox.getInstance()&&r.hideScrollbar!==!1&&!n.fancybox.isMobile&&e.body.scrollHeight>t.innerHeight&&(n("head").append('<style id="fancybox-style-noscroll" type="text/css">.compensate-for-scrollbar{margin-right:'+(t.innerWidth-e.documentElement.clientWidth)+"px;}</style>"),n("body").addClass("compensate-for-scrollbar")),a="",n.each(r.buttons,function(t,e){a+=r.btnTpl[e]\|\|""}),o=n(i.translate(i,r.baseTpl.replace("{{buttons}}",a).replace("{{arrows}}",r.btnTpl.arrowLeft+r.btnTpl.arrowRight))).attr("id","fancybox-container-"+i.id).addClass(r.baseClass).data("FancyBox",i).appendTo(r.parentEl),i.$refs={container:o},["bg","inner","infobar","toolbar","stage","caption","navigation"].forEach(function(t){i.$refs[t]=o.find(".fancybox-"+t)}),i.trigger("onInit"),i.activate(),i.jumpTo(i.currIndex)},translate:function(t,e){var n=t.opts.i18n[t.opts.lang]\|\|t.opts.i18n.en;return e.replace(/\{\{(\w+)\}\}/g,function(t,e){var a=n[e];return a===o?t:a})},addContent:function(t){var e,a=this,i=n.makeArray(t);n.each(i,function(t,e){var i,s,r,c,l,d={},u={};n.isPlainObject(e)?(d=e,u=e.opts\|\|e):"object"===n.type(e)&&n(e).length?(i=n(e),u=i.data()\|\|{},u=n.extend(!0,{},u,u.options),u.$orig=i,d.src=a.opts.src\|\|u.src\|\|i.attr("href"),d.type\|\|d.src\|\|(d.type="inline",d.src=e)):d={type:"html",src:e+""},d.opts=n.extend(!0,{},a.opts,u),n.isArray(u.buttons)&&(d.opts.buttons=u.buttons),n.fancybox.isMobile&&d.opts.mobile&&(d.opts=h(d.opts,d.opts.mobile)),s=d.type\|\|d.opts.type,c=d.src\|\|"",!s&&c&&((r=c.match(/\.(mp4\|mov\|ogv\|webm)((\?\|#).)?$/i))?(s="video",d.opts.video.format\|\|(d.opts.video.format="video/"+("ogv"===r[1]?"ogg":r[1]))):c.match(/(^data:image\/[a-z0-9+\/=],)\|(\.(jp(e\|g\|eg)\|gif\|png\|bmp\|webp\|svg\|ico)((\?\|#).)?$)/i)?s="image":c.match(/\.(pdf)((\?\|#).)?$/i)?(s="iframe",d=n.extend(!0,d,{contentType:"pdf",opts:{iframe:{preload:!1}}})):"#"===c.charAt(0)&&(s="inline")),s?d.type=s:a.trigger("objectNeedsType",d),d.contentType\|\|(d.contentType=n.inArray(d.type,["html","inline","ajax"])>-1?"html":d.type),d.index=a.group.length,"auto"==d.opts.smallBtn&&(d.opts.smallBtn=n.inArray(d.type,["html","inline","ajax"])>-1),"auto"===d.opts.toolbar&&(d.opts.toolbar=!d.opts.smallBtn),d.$thumb=d.opts.$thumb\|\|null,d.opts.$trigger&&d.index===a.opts.index&&(d.$thumb=d.opts.$trigger.find("img:first"),d.$thumb.length&&(d.opts.$orig=d.opts.$trigger)),d.$thumb&&d.$thumb.length\|\|!d.opts.$orig\|\|(d.$thumb=d.opts.$orig.find("img:first")),d.$thumb&&!d.$thumb.length&&(d.$thumb=null),d.thumb=d.opts.thumb\|\|(d.$thumb?d.$thumb[0].src:null),"function"===n.type(d.opts.caption)&&(d.opts.caption=d.opts.caption.apply(e,[a,d])),"function"===n.type(a.opts.caption)&&(d.opts.caption=a.opts.caption.apply(e,[a,d])),d.opts.caption instanceof n\|\|(d.opts.caption=d.opts.caption===o?"":d.opts.caption+""),"ajax"===d.type&&(l=c.split(/\s+/,2),l.length>1&&(d.src=l.shift(),d.opts.filter=l.shift())),d.opts.modal&&(d.opts=n.extend(!0,d.opts,{trapFocus:!0,infobar:0,toolbar:0,smallBtn:0,keyboard:0,slideShow:0,fullScreen:0,thumbs:0,touch:0,clickContent:!1,clickSlide:!1,clickOutside:!1,dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1})),a.group.push(d)}),Object.keys(a.slides).length&&(a.updateControls(),e=a.Thumbs,e&&e.isActive&&(e.create(),e.focus()))},addEvents:function(){var e=this;e.removeEvents(),e.$refs.container.on("click.fb-close","[data-fancybox-close]",function(t){t.stopPropagation(),t.preventDefault(),e.close(t)}).on("touchstart.fb-prev click.fb-prev","[data-fancybox-prev]",function(t){t.stopPropagation(),t.preventDefault(),e.previous()}).on("touchstart.fb-next click.fb-next","[data-fancybox-next]",function(t){t.stopPropagation(),t.preventDefault(),e.next()}).on("click.fb","[data-fancybox-zoom]",function(t){e[e.isScaledDown()?"scaleToActual":"scaleToFit"]()}),s.on("orientationchange.fb resize.fb",function(t){t&&t.originalEvent&&"resize"===t.originalEvent.type?(e.requestId&&u(e.requestId),e.requestId=d(function(){e.update(t)})):(e.current&&"iframe"===e.current.type&&e.$refs.stage.hide(),setTimeout(function(){e.$refs.stage.show(),e.update(t)},n.fancybox.isMobile?600:250))}),r.on("keydown.fb",function(t){var o=n.fancybox?n.fancybox.getInstance():null,a=o.current,i=t.keyCode\|\|t.which;if(9==i)return void(a.opts.trapFocus&&e.focus(t));if(!(!a.opts.keyboard\|\|t.ctrlKey\|\|t.altKey\|\|t.shiftKey\|\|n(t.target).is("input")\|\|n(t.target).is("textarea")))return 8===i\|\|27===i?(t.preventDefault(),void e.close(t)):37===i\|\|38===i?(t.preventDefault(),void e.previous()):39===i\|\|40===i?(t.preventDefault(),void e.next()):void e.trigger("afterKeydown",t,i)}),e.group[e.currIndex].opts.idleTime&&(e.idleSecondsCounter=0,r.on("mousemove.fb-idle mouseleave.fb-idle mousedown.fb-idle touchstart.fb-idle touchmove.fb-idle scroll.fb-idle keydown.fb-idle",function(t){e.idleSecondsCounter=0,e.isIdle&&e.showControls(),e.isIdle=!1}),e.idleInterval=t.setInterval(function(){e.idleSecondsCounter++,e.idleSecondsCounter>=e.group[e.currIndex].opts.idleTime&&!e.isDragging&&(e.isIdle=!0,e.idleSecondsCounter=0,e.hideControls())},1e3))},removeEvents:function(){var e=this;s.off("orientationchange.fb resize.fb"),r.off("keydown.fb .fb-idle"),this.$refs.container.off(".fb-close .fb-prev .fb-next"),e.idleInterval&&(t.clearInterval(e.idleInterval),e.idleInterval=null)},previous:function(t){return this.jumpTo(this.currPos-1,t)},next:function(t){return this.jumpTo(this.currPos+1,t)},jumpTo:function(t,e){var a,i,s,r,c,l,d,u,f,h=this,g=h.group.length;if(!(h.isDragging\|\|h.isClosing\|\|h.isAnimating&&h.firstRun)){if(t=parseInt(t,10),s=h.current?h.current.opts.loop:h.opts.loop,!s&&(t<0\|\|t>=g))return!1;if(a=h.firstRun=!Object.keys(h.slides).length,c=h.current,h.prevIndex=h.currIndex,h.prevPos=h.currPos,r=h.createSlide(t),g>1&&((s\|\|r.index<g-1)&&h.createSlide(t+1),(s\|\|r.index>0)&&h.createSlide(t-1)),h.current=r,h.currIndex=r.index,h.currPos=r.pos,h.trigger("beforeShow",a),h.updateControls(),r.forcedDuration=o,n.isNumeric(e)?r.forcedDuration=e:e=r.opts[a?"animationDuration":"transitionDuration"],e=parseInt(e,10),i=h.isMoved(r),r.$slide.addClass("fancybox-slide--current"),a)return r.opts.animationEffect&&e&&h.$refs.container.css("transition-duration",e+"ms"),h.$refs.container.addClass("fancybox-is-open").trigger("focus"),h.loadSlide(r),void h.preload("image");l=n.fancybox.getTranslate(c.$slide),d=n.fancybox.getTranslate(h.$refs.stage),n.each(h.slides,function(t,e){n.fancybox.stop(e.$slide,!0)}),c.pos!==r.pos&&(c.isComplete=!1),c.$slide.removeClass("fancybox-slide--complete fancybox-slide--current"),i?(f=l.left-(c.posl.width+c.posc.opts.gutter),n.each(h.slides,function(t,o){o.$slide.removeClass("fancybox-animated").removeClass(function(t,e){return(e.match(/(^\|\s)fancybox-fx-\S+/g)\|\|[]).join(" ")});var a=o.posl.width+o.poso.opts.gutter;n.fancybox.setTranslate(o.$slide,{top:0,left:a-d.left+f}),o.pos!==r.pos&&o.$slide.addClass("fancybox-slide--"+(o.pos>r.pos?"next":"previous")),p(o.$slide),n.fancybox.animate(o.$slide,{top:0,left:(o.pos-r.pos)l.width+(o.pos-r.pos)o.opts.gutter},e,function(){o.$slide.css({transform:"",opacity:""}).removeClass("fancybox-slide--next fancybox-slide--previous"),o.pos===h.currPos&&h.complete()})})):e&&r.opts.transitionEffect&&(u="fancybox-animated fancybox-fx-"+r.opts.transitionEffect,c.$slide.addClass("fancybox-slide--"+(c.pos>r.pos?"next":"previous")),n.fancybox.animate(c.$slide,u,e,function(){c.$slide.removeClass(u).removeClass("fancybox-slide--next fancybox-slide--previous")},!1)),r.isLoaded?h.revealContent(r):h.loadSlide(r),h.preload("image")}},createSlide:function(t){var e,o,a=this;return o=t%a.group.length,o=o<0?a.group.length+o:o,!a.slides[t]&&a.group[o]&&(e=n('<div class="fancybox-slide"></div>').appendTo(a.$refs.stage),a.slides[t]=n.extend(!0,{},a.group[o],{pos:t,$slide:e,isLoaded:!1}),a.updateSlide(a.slides[t])),a.slides[t]},scaleToActual:function(t,e,a){var i,s,r,c,l,d=this,u=d.current,f=u.$content,p=n.fancybox.getTranslate(u.$slide).width,h=n.fancybox.getTranslate(u.$slide).height,g=u.width,b=u.height;d.isAnimating\|\|d.isMoved()\|\|!f\|\|"image"!=u.type\|\|!u.isLoaded\|\|u.hasError\|\|(d.isAnimating=!0,n.fancybox.stop(f),t=t===o?.5p:t,e=e===o?.5h:e,i=n.fancybox.getTranslate(f),i.top-=n.fancybox.getTranslate(u.$slide).top,i.left-=n.fancybox.getTranslate(u.$slide).left,c=g/i.width,l=b/i.height,s=.5p-.5g,r=.5h-.5b,g>p&&(s=i.leftc-(tc-t),s>0&&(s=0),s<p-g&&(s=p-g)),b>h&&(r=i.topl-(el-e),r>0&&(r=0),r<h-b&&(r=h-b)),d.updateCursor(g,b),n.fancybox.animate(f,{top:r,left:s,scaleX:c,scaleY:l},a\|\|330,function(){d.isAnimating=!1}),d.SlideShow&&d.SlideShow.isActive&&d.SlideShow.stop())},scaleToFit:function(t){var e,o=this,a=o.current,i=a.$content;o.isAnimating\|\|o.isMoved()\|\|!i\|\|"image"!=a.type\|\|!a.isLoaded\|\|a.hasError\|\|(o.isAnimating=!0,n.fancybox.stop(i),e=o.getFitPos(a),o.updateCursor(e.width,e.height),n.fancybox.animate(i,{top:e.top,left:e.left,scaleX:e.width/i.width(),scaleY:e.height/i.height()},t\|\|330,function(){o.isAnimating=!1}))},getFitPos:function(t){var e,o,a,i,s=this,r=t.$content,c=t.$slide,l=t.width\|\|t.opts.width,d=t.height\|\|t.opts.height,u={};return!!(t.isLoaded&&r&&r.length)&&(e=n.fancybox.getTranslate(s.$refs.stage).width,o=n.fancybox.getTranslate(s.$refs.stage).height,e-=parseFloat(c.css("paddingLeft"))+parseFloat(c.css("paddingRight"))+parseFloat(r.css("marginLeft"))+parseFloat(r.css("marginRight")),o-=parseFloat(c.css("paddingTop"))+parseFloat(c.css("paddingBottom"))+parseFloat(r.css("marginTop"))+parseFloat(r.css("marginBottom")),l&&d\|\|(l=e,d=o),a=Math.min(1,e/l,o/d),l=al,d=ad,l>e-.5&&(l=e),d>o-.5&&(d=o),"image"===t.type?(u.top=Math.floor(.5(o-d))+parseFloat(c.css("paddingTop")),u.left=Math.floor(.5(e-l))+parseFloat(c.css("paddingLeft"))):"video"===t.contentType&&(i=t.opts.width&&t.opts.height?l/d:t.opts.ratio\|\|16/9,d>l/i?d=l/i:l>di&&(l=di)),u.width=l,u.height=d,u)},update:function(t){var e=this;n.each(e.slides,function(n,o){e.updateSlide(o,t)})},updateSlide:function(t,e){var o=this,a=t&&t.$content,i=t.width\|\|t.opts.width,s=t.height\|\|t.opts.height,r=t.$slide;o.adjustCaption(t),a&&(i\|\|s\|\|"video"===t.contentType)&&!t.hasError&&(n.fancybox.stop(a),n.fancybox.setTranslate(a,o.getFitPos(t)),t.pos===o.currPos&&(o.isAnimating=!1,o.updateCursor())),o.adjustLayout(t),r.length&&(r.trigger("refresh"),t.pos===o.currPos&&o.$refs.toolbar.add(o.$refs.navigation.find(".fancybox-button--arrow_right")).toggleClass("compensate-for-scrollbar",r.get(0).scrollHeight>r.get(0).clientHeight)),o.trigger("onUpdate",t,e)},centerSlide:function(t){var e=this,a=e.current,i=a.$slide;!e.isClosing&&a&&(i.siblings().css({transform:"",opacity:""}),i.parent().children().removeClass("fancybox-slide--previous fancybox-slide--next"),n.fancybox.animate(i,{top:0,left:0,opacity:1},t===o?0:t,function(){i.css({transform:"",opacity:""}),a.isComplete\|\|e.complete()},!1))},isMoved:function(t){var e,o,a=t\|\|this.current;return!!a&&(o=n.fancybox.getTranslate(this.$refs.stage),e=n.fancybox.getTranslate(a.$slide),!a.$slide.hasClass("fancybox-animated")&&(Math.abs(e.top-o.top)>.5\|\|Math.abs(e.left-o.left)>.5))},updateCursor:function(t,e){var o,a,i=this,s=i.current,r=i.$refs.container;s&&!i.isClosing&&i.Guestures&&(r.removeClass("fancybox-is-zoomable fancybox-can-zoomIn fancybox-can-zoomOut fancybox-can-swipe fancybox-can-pan"),o=i.canPan(t,e),a=!!o\|\|i.isZoomable(),r.toggleClass("fancybox-is-zoomable",a),n("[data-fancybox-zoom]").prop("disabled",!a),o?r.addClass("fancybox-can-pan"):a&&("zoom"===s.opts.clickContent\|\|n.isFunction(s.opts.clickContent)&&"zoom"==s.opts.clickContent(s))?r.addClass("fancybox-can-zoomIn"):s.opts.touch&&(s.opts.touch.vertical\|\|i.group.length>1)&&"video"!==s.contentType&&r.addClass("fancybox-can-swipe"))},isZoomable:function(){var t,e=this,n=e.current;if(n&&!e.isClosing&&"image"===n.type&&!n.hasError){if(!n.isLoaded)return!0;if(t=e.getFitPos(n),t&&(n.width>t.width\|\|n.height>t.height))return!0}return!1},isScaledDown:function(t,e){var a=this,i=!1,s=a.current,r=s.$content;return t!==o&&e!==o?i=t<s.width&&e<s.height:r&&(i=n.fancybox.getTranslate(r),i=i.width<s.width&&i.height<s.height),i},canPan:function(t,e){var a=this,i=a.current,s=null,r=!1;return"image"===i.type&&(i.isComplete\|\|t&&e)&&!i.hasError&&(r=a.getFitPos(i),t!==o&&e!==o?s={width:t,height:e}:i.isComplete&&(s=n.fancybox.getTranslate(i.$content)),s&&r&&(r=Math.abs(s.width-r.width)>1.5\|\|Math.abs(s.height-r.height)>1.5)),r},loadSlide:function(t){var e,o,a,i=this;if(!t.isLoading&&!t.isLoaded){if(t.isLoading=!0,i.trigger("beforeLoad",t)===!1)return t.isLoading=!1,!1;switch(e=t.type,o=t.$slide,o.off("refresh").trigger("onReset").addClass(t.opts.slideClass),e){case"image":i.setImage(t);break;case"iframe":i.setIframe(t);break;case"html":i.setContent(t,t.src\|\|t.content);break;case"video":i.setContent(t,t.opts.video.tpl.replace(/\{\{src\}\}/gi,t.src).replace("{{format}}",t.opts.videoFormat\|\|t.opts.video.format\|\|"").replace("{{poster}}",t.thumb\|\|""));break;case"inline":n(t.src).length?i.setContent(t,n(t.src)):i.setError(t);break;case"ajax":i.showLoading(t),a=n.ajax(n.extend({},t.opts.ajax.settings,{url:t.src,success:function(e,n){"success"===n&&i.setContent(t,e)},error:function(e,n){e&&"abort"!==n&&i.setError(t)}})),o.one("onReset",function(){a.abort()});break;default:i.setError(t)}return!0}},setImage:function(t){var o,a=this;setTimeout(function(){var e=t.$image;a.isClosing\|\|!t.isLoading\|\|e&&e.length&&e[0].complete\|\|t.hasError\|\|a.showLoading(t)},50),a.checkSrcset(t),t.$content=n('<div class="fancybox-content"></div>').addClass("fancybox-is-hidden").appendTo(t.$slide.addClass("fancybox-slide--image")),t.opts.preload!==!1&&t.opts.width&&t.opts.height&&t.thumb&&(t.width=t.opts.width,t.height=t.opts.height,o=e.createElement("img"),o.onerror=function(){n(this).remove(),t.$ghost=null},o.onload=function(){a.afterLoad(t)},t.$ghost=n(o).addClass("fancybox-image").appendTo(t.$content).attr("src",t.thumb)),a.setBigImage(t)},checkSrcset:function(e){var n,o,a,i,s=e.opts.srcset\|\|e.opts.image.srcset;if(s){a=t.devicePixelRatio\|\|1,i=t.innerWidtha,o=s.split(",").map(function(t){var e={};return t.trim().split(/\s+/).forEach(function(t,n){var o=parseInt(t.substring(0,t.length-1),10);return 0===n?e.url=t:void(o&&(e.value=o,e.postfix=t[t.length-1]))}),e}),o.sort(function(t,e){return t.value-e.value});for(var r=0;r<o.length;r++){var c=o[r];if("w"===c.postfix&&c.value>=i\|\|"x"===c.postfix&&c.value>=a){n=c;break}}!n&&o.length&&(n=o[o.length-1]),n&&(e.src=n.url,e.width&&e.height&&"w"==n.postfix&&(e.height=e.width/e.heightn.value,e.width=n.value),e.opts.srcset=s)}},setBigImage:function(t){var o=this,a=e.createElement("img"),i=n(a);t.$image=i.one("error",function(){o.setError(t)}).one("load",function(){var e;t.$ghost\|\|(o.resolveImageSlideSize(t,this.naturalWidth,this.naturalHeight),o.afterLoad(t)),o.isClosing\|\|(t.opts.srcset&&(e=t.opts.sizes,e&&"auto"!==e\|\|(e=(t.width/t.height>1&&s.width()/s.height()>1?"100":Math.round(t.width/t.height100))+"vw"),i.attr("sizes",e).attr("srcset",t.opts.srcset)),t.$ghost&&setTimeout(function(){t.$ghost&&!o.isClosing&&t.$ghost.hide()},Math.min(300,Math.max(1e3,t.height/1600))),o.hideLoading(t))}).addClass("fancybox-image").attr("src",t.src).appendTo(t.$content),(a.complete\|\|"complete"==a.readyState)&&i.naturalWidth&&i.naturalHeight?i.trigger("load"):a.error&&i.trigger("error")},resolveImageSlideSize:function(t,e,n){var o=parseInt(t.opts.width,10),a=parseInt(t.opts.height,10);t.width=e,t.height=n,o>0&&(t.width=o,t.height=Math.floor(on/e)),a>0&&(t.width=Math.floor(ae/n),t.height=a)},setIframe:function(t){var e,a=this,i=t.opts.iframe,s=t.$slide;n.fancybox.isMobile&&(i.css.overflow="scroll"),t.$content=n('<div class="fancybox-content'+(i.preload?" fancybox-is-hidden":"")+'"></div>').css(i.css).appendTo(s),s.addClass("fancybox-slide--"+t.contentType),t.$iframe=e=n(i.tpl.replace(/\{rnd\}/g,(new Date).getTime())).attr(i.attr).appendTo(t.$content),i.preload?(a.showLoading(t),e.on("load.fb error.fb",function(e){this.isReady=1,t.$slide.trigger("refresh"),a.afterLoad(t)}),s.on("refresh.fb",function(){var n,a,r=t.$content,c=i.css.width,l=i.css.height;if(1===e[0].isReady){try{n=e.contents(),a=n.find("body")}catch(t){}a&&a.length&&a.children().length&&(s.css("overflow","visible"),r.css({width:"100%","max-width":"100%",height:"9999px"}),c===o&&(c=Math.ceil(Math.max(a[0].clientWidth,a.outerWidth(!0)))),r.css("width",c?c:"").css("max-width",""),l===o&&(l=Math.ceil(Math.max(a[0].clientHeight,a.outerHeight(!0)))),r.css("height",l?l:""),s.css("overflow","auto")),r.removeClass("fancybox-is-hidden")}})):a.afterLoad(t),e.attr("src",t.src),s.one("onReset",function(){try{n(this).find("iframe").hide().unbind().attr("src","//about:blank")}catch(t){}n(this).off("refresh.fb").empty(),t.isLoaded=!1,t.isRevealed=!1})},setContent:function(t,e){var o=this;o.isClosing\|\|(o.hideLoading(t),t.$content&&n.fancybox.stop(t.$content),t.$slide.empty(),l(e)&&e.parent().length?((e.hasClass("fancybox-content")\|\|e.parent().hasClass("fancybox-content"))&&e.parents(".fancybox-slide").trigger("onReset"),t.$placeholder=n("<div>").hide().insertAfter(e),e.css("display","inline-block")):t.hasError\|\|("string"===n.type(e)&&(e=n("<div>").append(n.trim(e)).contents()),t.opts.filter&&(e=n("<div>").html(e).find(t.opts.filter))),t.$slide.one("onReset",function(){n(this).find("video,audio").trigger("pause"),t.$placeholder&&(t.$placeholder.after(e.removeClass("fancybox-content").hide()).remove(),t.$placeholder=null),t.$smallBtn&&(t.$smallBtn.remove(),t.$smallBtn=null),t.hasError\|\|(n(this).empty(),t.isLoaded=!1,t.isRevealed=!1)}),n(e).appendTo(t.$slide),n(e).is("video,audio")&&(n(e).addClass("fancybox-video"),n(e).wrap("<div></div>"),t.contentType="video",t.opts.width=t.opts.width\|\|n(e).attr("width"),t.opts.height=t.opts.height\|\|n(e).attr("height")),t.$content=t.$slide.children().filter("div,form,main,video,audio,article,.fancybox-content").first(),t.$content.siblings().hide(),t.$content.length\|\|(t.$content=t.$slide.wrapInner("<div></div>").children().first()),t.$content.addClass("fancybox-content"),t.$slide.addClass("fancybox-slide--"+t.contentType),o.afterLoad(t))},setError:function(t){t.hasError=!0,t.$slide.trigger("onReset").removeClass("fancybox-slide--"+t.contentType).addClass("fancybox-slide--error"),t.contentType="html",this.setContent(t,this.translate(t,t.opts.errorTpl)),t.pos===this.currPos&&(this.isAnimating=!1)},showLoading:function(t){var e=this;t=t\|\|e.current,t&&!t.$spinner&&(t.$spinner=n(e.translate(e,e.opts.spinnerTpl)).appendTo(t.$slide).hide().fadeIn("fast"))},hideLoading:function(t){var e=this;t=t\|\|e.current,t&&t.$spinner&&(t.$spinner.stop().remove(),delete t.$spinner)},afterLoad:function(t){var e=this;e.isClosing\|\|(t.isLoading=!1,t.isLoaded=!0,e.trigger("afterLoad",t),e.hideLoading(t),!t.opts.smallBtn\|\|t.$smallBtn&&t.$smallBtn.length\|\|(t.$smallBtn=n(e.translate(t,t.opts.btnTpl.smallBtn)).appendTo(t.$content)),t.opts.protect&&t.$content&&!t.hasError&&(t.$content.on("contextmenu.fb",function(t){return 2==t.button&&t.preventDefault(),!0}),"image"===t.type&&n('<div class="fancybox-spaceball"></div>').appendTo(t.$content)),e.adjustCaption(t),e.adjustLayout(t),t.pos===e.currPos&&e.updateCursor(),e.revealContent(t))},adjustCaption:function(t){var e=this,n=t\|\|e.current,o=n.opts.caption,a=e.$refs.caption,i=!1;n.opts.preventCaptionOverlap&&o&&o.length&&(n.pos!==e.currPos?(a=a.clone().empty().appendTo(a.parent()),a.html(o),i=a.outerHeight(!0),a.empty().remove()):e.$caption&&(i=e.$caption.outerHeight(!0)),n.$slide.css("padding-bottom",i\|\|""))},adjustLayout:function(t){var e,n,o,a,i=this,s=t\|\|i.current;s.isLoaded&&s.opts.disableLayoutFix!==!0&&(s.$content.css("margin-bottom",""),s.$content.outerHeight()>s.$slide.height()+.5&&(o=s.$slide[0].style["padding-bottom"],a=s.$slide.css("padding-bottom"),parseFloat(a)>0&&(e=s.$slide[0].scrollHeight,s.$slide.css("padding-bottom",0),Math.abs(e-s.$slide[0].scrollHeight)<1&&(n=a),s.$slide.css("padding-bottom",o))),s.$content.css("margin-bottom",n))},revealContent:function(t){var e,a,i,s,r=this,c=t.$slide,l=!1,d=!1,u=r.isMoved(t),f=t.isRevealed;return t.isRevealed=!0,e=t.opts[r.firstRun?"animationEffect":"transitionEffect"],i=t.opts[r.firstRun?"animationDuration":"transitionDuration"],i=parseInt(t.forcedDuration===o?i:t.forcedDuration,10),!u&&t.pos===r.currPos&&i\|\|(e=!1),"zoom"===e&&(t.pos===r.currPos&&i&&"image"===t.type&&!t.hasError&&(d=r.getThumbPos(t))?l=r.getFitPos(t):e="fade"),"zoom"===e?(r.isAnimating=!0,l.scaleX=l.width/d.width,l.scaleY=l.height/d.height,s=t.opts.zoomOpacity,"auto"==s&&(s=Math.abs(t.width/t.height-d.width/d.height)>.1),s&&(d.opacity=.1,l.opacity=1),n.fancybox.setTranslate(t.$content.removeClass("fancybox-is-hidden"),d),p(t.$content),void n.fancybox.animate(t.$content,l,i,function(){r.isAnimating=!1,r.complete()})):(r.updateSlide(t),e?(n.fancybox.stop(c),a="fancybox-slide--"+(t.pos>=r.prevPos?"next":"previous")+" fancybox-animated fancybox-fx-"+e,c.addClass(a).removeClass("fancybox-slide--current"),t.$content.removeClass("fancybox-is-hidden"),p(c),"image"!==t.type&&t.$content.hide().show(0),void n.fancybox.animate(c,"fancybox-slide--current",i,function(){c.removeClass(a).css({transform:"",opacity:""}),t.pos===r.currPos&&r.complete()},!0)):(t.$content.removeClass("fancybox-is-hidden"),f\|\|!u\|\|"image"!==t.type\|\|t.hasError\|\|t.$content.hide().fadeIn("fast"),void(t.pos===r.currPos&&r.complete())))},getThumbPos:function(t){var e,o,a,i,s,r=!1,c=t.$thumb;return!(!c\|\|!g(c[0]))&&(e=n.fancybox.getTranslate(c),o=parseFloat(c.css("border-top-width")\|\|0),a=parseFloat(c.css("border-right-width")\|\|0),i=parseFloat(c.css("border-bottom-width")\|\|0),s=parseFloat(c.css("border-left-width")\|\|0),r={top:e.top+o,left:e.left+s,width:e.width-a-s,height:e.height-o-i,scaleX:1,scaleY:1},e.width>0&&e.height>0&&r)},complete:function(){var t,e=this,o=e.current,a={};!e.isMoved()&&o.isLoaded&&(o.isComplete\|\|(o.isComplete=!0,o.$slide.siblings().trigger("onReset"),e.preload("inline"),p(o.$slide),o.$slide.addClass("fancybox-slide--complete"),n.each(e.slides,function(t,o){o.pos>=e.currPos-1&&o.pos<=e.currPos+1?a[o.pos]=o:o&&(n.fancybox.stop(o.$slide),o.$slide.off().remove())}),e.slides=a),e.isAnimating=!1,e.updateCursor(),e.trigger("afterShow"),o.opts.video.autoStart&&o.$slide.find("video,audio").filter(":visible:first").trigger("play").one("ended",function(){this.webkitExitFullscreen&&this.webkitExitFullscreen(),e.next()}),o.opts.autoFocus&&"html"===o.contentType&&(t=o.$content.find("input[autofocus]:enabled:visible:first"),t.length?t.trigger("focus"):e.focus(null,!0)),o.$slide.scrollTop(0).scrollLeft(0))},preload:function(t){var e,n,o=this;o.group.length<2\|\|(n=o.slides[o.currPos+1],e=o.slides[o.currPos-1],e&&e.type===t&&o.loadSlide(e),n&&n.type===t&&o.loadSlide(n))},focus:function(t,o){var a,i,s=this,r=["a[href]","area[href]",'input:not([disabled]):not([type="hidden"]):not([aria-hidden])',"select:not([disabled]):not([aria-hidden])","textarea:not([disabled]):not([aria-hidden])","button:not([disabled]):not([aria-hidden])","iframe","object","embed","[contenteditable]",'[tabindex]:not([tabindex^="-"])'].join(",");s.isClosing\|\|(a=!t&&s.current&&s.current.isComplete?s.current.$slide.find(":visible"+(o?":not(.fancybox-close-small)":"")):s.$refs.container.find("*:visible"),a=a.filter(r).filter(function(){return"hidden"!==n(this).css("visibility")&&!n(this).hasClass("disabled")}),a.length?(i=a.index(e.activeElement),t&&t.shiftKey?(i<0\|\|0==i)&&(t.preventDefault(),a.eq(a.length-1).trigger("focus")):(i<0\|\|i==a.length-1)&&(t&&t.preventDefault(),a.eq(0).trigger("focus"))):s.$refs.container.trigger("focus"))},activate:function(){var t=this;n(".fancybox-container").each(function(){var e=n(this).data("FancyBox");e&&e.id!==t.id&&!e.isClosing&&(e.trigger("onDeactivate"),e.removeEvents(),e.isVisible=!1)}),t.isVisible=!0,(t.current\|\|t.isIdle)&&(t.update(),t.updateControls()),t.trigger("onActivate"),t.addEvents()},close:function(t,e){var o,a,i,s,r,c,l,u=this,f=u.current,h=function(){u.cleanUp(t)};return!u.isClosing&&(u.isClosing=!0,u.trigger("beforeClose",t)===!1?(u.isClosing=!1,d(function(){u.update()}),!1):(u.removeEvents(),i=f.$content,o=f.opts.animationEffect,a=n.isNumeric(e)?e:o?f.opts.animationDuration:0,f.$slide.removeClass("fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated"),t!==!0?n.fancybox.stop(f.$slide):o=!1,f.$slide.siblings().trigger("onReset").remove(),a&&u.$refs.container.removeClass("fancybox-is-open").addClass("fancybox-is-closing").css("transition-duration",a+"ms"),u.hideLoading(f),u.hideControls(!0),u.updateCursor(),"zoom"!==o\|\|i&&a&&"image"===f.type&&!u.isMoved()&&!f.hasError&&(l=u.getThumbPos(f))\|\|(o="fade"),"zoom"===o?(n.fancybox.stop(i),s=n.fancybox.getTranslate(i),c={top:s.top,left:s.left,scaleX:s.width/l.width,scaleY:s.height/l.height,width:l.width,height:l.height},r=f.opts.zoomOpacity,"auto"==r&&(r=Math.abs(f.width/f.height-l.width/l.height)>.1),r&&(l.opacity=0),n.fancybox.setTranslate(i,c),p(i),n.fancybox.animate(i,l,a,h),!0):(o&&a?n.fancybox.animate(f.$slide.addClass("fancybox-slide--previous").removeClass("fancybox-slide--current"),"fancybox-animated fancybox-fx-"+o,a,h):t===!0?setTimeout(h,a):h(),
12	+ !0)))},cleanUp:function(e){var o,a,i,s=this,r=s.current.opts.$orig;s.current.$slide.trigger("onReset"),s.$refs.container.empty().remove(),s.trigger("afterClose",e),s.current.opts.backFocus&&(r&&r.length&&r.is(":visible")\|\|(r=s.$trigger),r&&r.length&&(a=t.scrollX,i=t.scrollY,r.trigger("focus"),n("html, body").scrollTop(i).scrollLeft(a))),s.current=null,o=n.fancybox.getInstance(),o?o.activate():(n("body").removeClass("fancybox-active compensate-for-scrollbar"),n("#fancybox-style-noscroll").remove())},trigger:function(t,e){var o,a=Array.prototype.slice.call(arguments,1),i=this,s=e&&e.opts?e:i.current;return s?a.unshift(s):s=i,a.unshift(i),n.isFunction(s.opts[t])&&(o=s.opts[t].apply(s,a)),o===!1?o:void("afterClose"!==t&&i.$refs?i.$refs.container.trigger(t+".fb",a):r.trigger(t+".fb",a))},updateControls:function(){var t=this,o=t.current,a=o.index,i=t.$refs.container,s=t.$refs.caption,r=o.opts.caption;o.$slide.trigger("refresh"),t.$caption=r&&r.length?s.html(r):null,t.hasHiddenControls\|\|t.isIdle\|\|t.showControls(),i.find("[data-fancybox-count]").html(t.group.length),i.find("[data-fancybox-index]").html(a+1),i.find("[data-fancybox-prev]").prop("disabled",!o.opts.loop&&a<=0),i.find("[data-fancybox-next]").prop("disabled",!o.opts.loop&&a>=t.group.length-1),"image"===o.type?i.find("[data-fancybox-zoom]").show().end().find("[data-fancybox-download]").attr("href",o.opts.image.src\|\|o.src).show():o.opts.toolbar&&i.find("[data-fancybox-download],[data-fancybox-zoom]").hide(),n(e.activeElement).is(":hidden,[disabled]")&&t.$refs.container.trigger("focus")},hideControls:function(t){var e=this,n=["infobar","toolbar","nav"];!t&&e.current.opts.preventCaptionOverlap\|\|n.push("caption"),this.$refs.container.removeClass(n.map(function(t){return"fancybox-show-"+t}).join(" ")),this.hasHiddenControls=!0},showControls:function(){var t=this,e=t.current?t.current.opts:t.opts,n=t.$refs.container;t.hasHiddenControls=!1,t.idleSecondsCounter=0,n.toggleClass("fancybox-show-toolbar",!(!e.toolbar\|\|!e.buttons)).toggleClass("fancybox-show-infobar",!!(e.infobar&&t.group.length>1)).toggleClass("fancybox-show-caption",!!t.$caption).toggleClass("fancybox-show-nav",!!(e.arrows&&t.group.length>1)).toggleClass("fancybox-is-modal",!!e.modal)},toggleControls:function(){this.hasHiddenControls?this.showControls():this.hideControls()}}),n.fancybox={version:"3.5.2",defaults:i,getInstance:function(t){var e=n('.fancybox-container:not(".fancybox-is-closing"):last').data("FancyBox"),o=Array.prototype.slice.call(arguments,1);return e instanceof b&&("string"===n.type(t)?e[t].apply(e,o):"function"===n.type(t)&&t.apply(e,o),e)},open:function(t,e,n){return new b(t,e,n)},close:function(t){var e=this.getInstance();e&&(e.close(),t===!0&&this.close(t))},destroy:function(){this.close(!0),r.add("body").off("click.fb-start","*")},isMobile:/Android\|webOS\|iPhone\|iPad\|iPod\|BlackBerry\|IEMobile\|Opera Mini/i.test(navigator.userAgent),use3d:function(){var n=e.createElement("div");return t.getComputedStyle&&t.getComputedStyle(n)&&t.getComputedStyle(n).getPropertyValue("transform")&&!(e.documentMode&&e.documentMode<11)}(),getTranslate:function(t){var e;return!(!t\|\|!t.length)&&(e=t[0].getBoundingClientRect(),{top:e.top\|\|0,left:e.left\|\|0,width:e.width,height:e.height,opacity:parseFloat(t.css("opacity"))})},setTranslate:function(t,e){var n="",a={};if(t&&e)return e.left===o&&e.top===o\|\|(n=(e.left===o?t.position().left:e.left)+"px, "+(e.top===o?t.position().top:e.top)+"px",n=this.use3d?"translate3d("+n+", 0px)":"translate("+n+")"),e.scaleX!==o&&e.scaleY!==o?n+=" scale("+e.scaleX+", "+e.scaleY+")":e.scaleX!==o&&(n+=" scaleX("+e.scaleX+")"),n.length&&(a.transform=n),e.opacity!==o&&(a.opacity=e.opacity),e.width!==o&&(a.width=e.width),e.height!==o&&(a.height=e.height),t.css(a)},animate:function(t,e,a,i,s){var r,c=this;n.isFunction(a)&&(i=a,a=null),c.stop(t),r=c.getTranslate(t),t.on(f,function(l){(!l\|\|!l.originalEvent\|\|t.is(l.originalEvent.target)&&"z-index"!=l.originalEvent.propertyName)&&(c.stop(t),n.isNumeric(a)&&t.css("transition-duration",""),n.isPlainObject(e)?e.scaleX!==o&&e.scaleY!==o&&c.setTranslate(t,{top:e.top,left:e.left,width:r.widthe.scaleX,height:r.heighte.scaleY,scaleX:1,scaleY:1}):s!==!0&&t.removeClass(e),n.isFunction(i)&&i(l))}),n.isNumeric(a)&&t.css("transition-duration",a+"ms"),n.isPlainObject(e)?(e.scaleX!==o&&e.scaleY!==o&&(delete e.width,delete e.height,t.parent().hasClass("fancybox-slide--image")&&t.parent().addClass("fancybox-is-scaling")),n.fancybox.setTranslate(t,e)):t.addClass(e),t.data("timer",setTimeout(function(){t.trigger(f)},a+33))},stop:function(t,e){t&&t.length&&(clearTimeout(t.data("timer")),e&&t.trigger(f),t.off(f).css("transition-duration",""),t.parent().removeClass("fancybox-is-scaling"))}},n.fn.fancybox=function(t){var e;return t=t\|\|{},e=t.selector\|\|!1,e?n("body").off("click.fb-start",e).on("click.fb-start",e,{options:t},a):this.off("click.fb-start").on("click.fb-start",{items:this,options:t},a),this},r.on("click.fb-start","[data-fancybox]",a),r.on("click.fb-start","[data-fancybox-trigger]",function(t){n('[data-fancybox="'+n(this).attr("data-fancybox-trigger")+'"]').eq(n(this).attr("data-fancybox-index")\|\|0).trigger("click.fb-start",{$trigger:n(this)})}),function(){var t=".fancybox-button",e="fancybox-focus",o=null;r.on("mousedown mouseup focus blur",t,function(a){switch(a.type){case"mousedown":o=n(this);break;case"mouseup":o=null;break;case"focusin":n(t).removeClass(e),n(this).is(o)\|\|n(this).is("[disabled]")\|\|n(this).addClass(e);break;case"focusout":n(t).removeClass(e)}})}()}}(window,document,jQuery),function(t){"use strict";var e={youtube:{matcher:/(youtube\.com\|youtu\.be\|youtube\-nocookie\.com)\/(watch\?(.&)?v=\|v\/\|u\/\|embed\/?)?(videoseries\?list=(.)\|[\w-]{11}\|\?listType=(.)&list=(.))(.)/i,params:{autoplay:1,autohide:1,fs:1,rel:0,hd:1,wmode:"transparent",enablejsapi:1,html5:1},paramPlace:8,type:"iframe",url:"//www.youtube-nocookie.com/embed/$4",thumb:"//img.youtube.com/vi/$4/hqdefault.jpg"},vimeo:{matcher:/^.+vimeo.com\/(.\/)?([\d]+)(.)?/,params:{autoplay:1,hd:1,show_title:1,show_byline:1,show_portrait:0,fullscreen:1},paramPlace:3,type:"iframe",url:"//player.vimeo.com/video/$2"},instagram:{matcher:/(instagr\.am\|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,type:"image",url:"//$1/p/$2/media/?size=l"},gmap_place:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.)\/)?\@(.),(\d+.?\d+?)z))\|(\?ll=))(.)?/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/?ll="+(t[9]?t[9]+"&z="+Math.floor(t[10])+(t[12]?t[12].replace(/^\//,"&"):""):t[12]+"").replace(/\?/,"&")+"&output="+(t[12]&&t[12].indexOf("layer=c")>0?"svembed":"embed")}},gmap_search:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(maps\/search\/)(.)/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/maps?q="+t[5].replace("query=","q=").replace("api=1","")+"&output=embed"}}},n=function(e,n,o){if(e)return o=o\|\|"","object"===t.type(o)&&(o=t.param(o,!0)),t.each(n,function(t,n){e=e.replace("$"+t,n\|\|"")}),o.length&&(e+=(e.indexOf("?")>0?"&":"?")+o),e};t(document).on("objectNeedsType.fb",function(o,a,i){var s,r,c,l,d,u,f,p=i.src\|\|"",h=!1;s=t.extend(!0,{},e,i.opts.media),t.each(s,function(e,o){if(c=p.match(o.matcher)){if(h=o.type,f=e,u={},o.paramPlace&&c[o.paramPlace]){d=c[o.paramPlace],"?"==d[0]&&(d=d.substring(1)),d=d.split("&");for(var a=0;a<d.length;++a){var s=d[a].split("=",2);2==s.length&&(u[s[0]]=decodeURIComponent(s[1].replace(/\+/g," ")))}}return l=t.extend(!0,{},o.params,i.opts[e],u),p="function"===t.type(o.url)?o.url.call(this,c,l,i):n(o.url,c,l),r="function"===t.type(o.thumb)?o.thumb.call(this,c,l,i):n(o.thumb,c),"youtube"===e?p=p.replace(/&t=((\d+)m)?(\d+)s/,function(t,e,n,o){return"&start="+((n?60parseInt(n,10):0)+parseInt(o,10))}):"vimeo"===e&&(p=p.replace("&%23","#")),!1}}),h?(i.opts.thumb\|\|i.opts.$thumb&&i.opts.$thumb.length\|\|(i.opts.thumb=r),"iframe"===h&&(i.opts=t.extend(!0,i.opts,{iframe:{preload:!1,attr:{scrolling:"no"}}})),t.extend(i,{type:h,src:p,origSrc:i.src,contentSource:f,contentType:"image"===h?"image":"gmap_place"==f\|\|"gmap_search"==f?"map":"video"})):p&&(i.type=i.opts.defaultType)});var o={youtube:{src:"https://www.youtube.com/iframe_api",class:"YT",loading:!1,loaded:!1},vimeo:{src:"https://player.vimeo.com/api/player.js",class:"Vimeo",loading:!1,loaded:!1},load:function(t){var e,n=this;return this[t].loaded?void setTimeout(function(){n.done(t)}):void(this[t].loading\|\|(this[t].loading=!0,e=document.createElement("script"),e.type="text/javascript",e.src=this[t].src,"youtube"===t?window.onYouTubeIframeAPIReady=function(){n[t].loaded=!0,n.done(t)}:e.onload=function(){n[t].loaded=!0,n.done(t)},document.body.appendChild(e)))},done:function(e){var n,o,a;"youtube"===e&&delete window.onYouTubeIframeAPIReady,n=t.fancybox.getInstance(),n&&(o=n.current.$content.find("iframe"),"youtube"===e&&void 0!==YT&&YT?a=new YT.Player(o.attr("id"),{events:{onStateChange:function(t){0==t.data&&n.next()}}}):"vimeo"===e&&void 0!==Vimeo&&Vimeo&&(a=new Vimeo.Player(o),a.on("ended",function(){n.next()})))}};t(document).on({"afterShow.fb":function(t,e,n){e.group.length>1&&("youtube"===n.contentSource\|\|"vimeo"===n.contentSource)&&o.load(n.contentSource)}})}(jQuery),function(t,e,n){"use strict";var o=function(){return t.requestAnimationFrame\|\|t.webkitRequestAnimationFrame\|\|t.mozRequestAnimationFrame\|\|t.oRequestAnimationFrame\|\|function(e){return t.setTimeout(e,1e3/60)}}(),a=function(){return t.cancelAnimationFrame\|\|t.webkitCancelAnimationFrame\|\|t.mozCancelAnimationFrame\|\|t.oCancelAnimationFrame\|\|function(e){t.clearTimeout(e)}}(),i=function(e){var n=[];e=e.originalEvent\|\|e\|\|t.e,e=e.touches&&e.touches.length?e.touches:e.changedTouches&&e.changedTouches.length?e.changedTouches:[e];for(var o in e)e[o].pageX?n.push({x:e[o].pageX,y:e[o].pageY}):e[o].clientX&&n.push({x:e[o].clientX,y:e[o].clientY});return n},s=function(t,e,n){return e&&t?"x"===n?t.x-e.x:"y"===n?t.y-e.y:Math.sqrt(Math.pow(t.x-e.x,2)+Math.pow(t.y-e.y,2)):0},r=function(t){if(t.is('a,area,button,[role="button"],input,label,select,summary,textarea,video,audio,iframe')\|\|n.isFunction(t.get(0).onclick)\|\|t.data("selectable"))return!0;for(var e=0,o=t[0].attributes,a=o.length;e<a;e++)if("data-fancybox-"===o[e].nodeName.substr(0,14))return!0;return!1},c=function(e){var n=t.getComputedStyle(e)["overflow-y"],o=t.getComputedStyle(e)["overflow-x"],a=("scroll"===n\|\|"auto"===n)&&e.scrollHeight>e.clientHeight,i=("scroll"===o\|\|"auto"===o)&&e.scrollWidth>e.clientWidth;return a\|\|i},l=function(t){for(var e=!1;;){if(e=c(t.get(0)))break;if(t=t.parent(),!t.length\|\|t.hasClass("fancybox-stage")\|\|t.is("body"))break}return e},d=function(t){var e=this;e.instance=t,e.$bg=t.$refs.bg,e.$stage=t.$refs.stage,e.$container=t.$refs.container,e.destroy(),e.$container.on("touchstart.fb.touch mousedown.fb.touch",n.proxy(e,"ontouchstart"))};d.prototype.destroy=function(){var t=this;t.$container.off(".fb.touch"),n(e).off(".fb.touch"),t.requestId&&(a(t.requestId),t.requestId=null),t.tapped&&(clearTimeout(t.tapped),t.tapped=null)},d.prototype.ontouchstart=function(o){var a=this,c=n(o.target),d=a.instance,u=d.current,f=u.$slide,p=u.$content,h="touchstart"==o.type;if(h&&a.$container.off("mousedown.fb.touch"),(!o.originalEvent\|\|2!=o.originalEvent.button)&&f.length&&c.length&&!r(c)&&!r(c.parent())&&(c.is("img")\|\|!(o.originalEvent.clientX>c[0].clientWidth+c.offset().left))){if(!u\|\|d.isAnimating\|\|u.$slide.hasClass("fancybox-animated"))return o.stopPropagation(),void o.preventDefault();a.realPoints=a.startPoints=i(o),a.startPoints.length&&(u.touch&&o.stopPropagation(),a.startEvent=o,a.canTap=!0,a.$target=c,a.$content=p,a.opts=u.opts.touch,a.isPanning=!1,a.isSwiping=!1,a.isZooming=!1,a.isScrolling=!1,a.canPan=d.canPan(),a.startTime=(new Date).getTime(),a.distanceX=a.distanceY=a.distance=0,a.canvasWidth=Math.round(f[0].clientWidth),a.canvasHeight=Math.round(f[0].clientHeight),a.contentLastPos=null,a.contentStartPos=n.fancybox.getTranslate(a.$content)\|\|{top:0,left:0},a.sliderStartPos=n.fancybox.getTranslate(f),a.stagePos=n.fancybox.getTranslate(d.$refs.stage),a.sliderStartPos.top-=a.stagePos.top,a.sliderStartPos.left-=a.stagePos.left,a.contentStartPos.top-=a.stagePos.top,a.contentStartPos.left-=a.stagePos.left,n(e).off(".fb.touch").on(h?"touchend.fb.touch touchcancel.fb.touch":"mouseup.fb.touch mouseleave.fb.touch",n.proxy(a,"ontouchend")).on(h?"touchmove.fb.touch":"mousemove.fb.touch",n.proxy(a,"ontouchmove")),n.fancybox.isMobile&&e.addEventListener("scroll",a.onscroll,!0),((a.opts\|\|a.canPan)&&(c.is(a.$stage)\|\|a.$stage.find(c).length)\|\|(c.is(".fancybox-image")&&o.preventDefault(),n.fancybox.isMobile&&c.hasClass("fancybox-caption")))&&(a.isScrollable=l(c)\|\|l(c.parent()),n.fancybox.isMobile&&a.isScrollable\|\|o.preventDefault(),(1===a.startPoints.length\|\|u.hasError)&&(a.canPan?(n.fancybox.stop(a.$content),a.isPanning=!0):a.isSwiping=!0,a.$container.addClass("fancybox-is-grabbing")),2===a.startPoints.length&&"image"===u.type&&(u.isLoaded\|\|u.$ghost)&&(a.canTap=!1,a.isSwiping=!1,a.isPanning=!1,a.isZooming=!0,n.fancybox.stop(a.$content),a.centerPointStartX=.5(a.startPoints[0].x+a.startPoints[1].x)-n(t).scrollLeft(),a.centerPointStartY=.5(a.startPoints[0].y+a.startPoints[1].y)-n(t).scrollTop(),a.percentageOfImageAtPinchPointX=(a.centerPointStartX-a.contentStartPos.left)/a.contentStartPos.width,a.percentageOfImageAtPinchPointY=(a.centerPointStartY-a.contentStartPos.top)/a.contentStartPos.height,a.startDistanceBetweenFingers=s(a.startPoints[0],a.startPoints[1]))))}},d.prototype.onscroll=function(t){var n=this;n.isScrolling=!0,e.removeEventListener("scroll",n.onscroll,!0)},d.prototype.ontouchmove=function(t){var e=this;return void 0!==t.originalEvent.buttons&&0===t.originalEvent.buttons?void e.ontouchend(t):e.isScrolling?void(e.canTap=!1):(e.newPoints=i(t),void((e.opts\|\|e.canPan)&&e.newPoints.length&&e.newPoints.length&&(e.isSwiping&&e.isSwiping===!0\|\|t.preventDefault(),e.distanceX=s(e.newPoints[0],e.startPoints[0],"x"),e.distanceY=s(e.newPoints[0],e.startPoints[0],"y"),e.distance=s(e.newPoints[0],e.startPoints[0]),e.distance>0&&(e.isSwiping?e.onSwipe(t):e.isPanning?e.onPan():e.isZooming&&e.onZoom()))))},d.prototype.onSwipe=function(e){var i,s=this,r=s.instance,c=s.isSwiping,l=s.sliderStartPos.left\|\|0;if(c!==!0)"x"==c&&(s.distanceX>0&&(s.instance.group.length<2\|\|0===s.instance.current.index&&!s.instance.current.opts.loop)?l+=Math.pow(s.distanceX,.8):s.distanceX<0&&(s.instance.group.length<2\|\|s.instance.current.index===s.instance.group.length-1&&!s.instance.current.opts.loop)?l-=Math.pow(-s.distanceX,.8):l+=s.distanceX),s.sliderLastPos={top:"x"==c?0:s.sliderStartPos.top+s.distanceY,left:l},s.requestId&&(a(s.requestId),s.requestId=null),s.requestId=o(function(){s.sliderLastPos&&(n.each(s.instance.slides,function(t,e){var o=e.pos-s.instance.currPos;n.fancybox.setTranslate(e.$slide,{top:s.sliderLastPos.top,left:s.sliderLastPos.left+os.canvasWidth+oe.opts.gutter})}),s.$container.addClass("fancybox-is-sliding"))});else if(Math.abs(s.distance)>10){if(s.canTap=!1,r.group.length<2&&s.opts.vertical?s.isSwiping="y":r.isDragging\|\|s.opts.vertical===!1\|\|"auto"===s.opts.vertical&&n(t).width()>800?s.isSwiping="x":(i=Math.abs(180Math.atan2(s.distanceY,s.distanceX)/Math.PI),s.isSwiping=i>45&&i<135?"y":"x"),"y"===s.isSwiping&&n.fancybox.isMobile&&s.isScrollable)return void(s.isScrolling=!0);r.isDragging=s.isSwiping,s.startPoints=s.newPoints,n.each(r.slides,function(t,e){var o,a;n.fancybox.stop(e.$slide),o=n.fancybox.getTranslate(e.$slide),a=n.fancybox.getTranslate(r.$refs.stage),e.$slide.css({transform:"",opacity:"","transition-duration":""}).removeClass("fancybox-animated").removeClass(function(t,e){return(e.match(/(^\|\s)fancybox-fx-\S+/g)\|\|[]).join(" ")}),e.pos===r.current.pos&&(s.sliderStartPos.top=o.top-a.top,s.sliderStartPos.left=o.left-a.left),n.fancybox.setTranslate(e.$slide,{top:o.top-a.top,left:o.left-a.left})}),r.SlideShow&&r.SlideShow.isActive&&r.SlideShow.stop()}},d.prototype.onPan=function(){var t=this;return s(t.newPoints[0],t.realPoints[0])<(n.fancybox.isMobile?10:5)?void(t.startPoints=t.newPoints):(t.canTap=!1,t.contentLastPos=t.limitMovement(),t.requestId&&a(t.requestId),void(t.requestId=o(function(){n.fancybox.setTranslate(t.$content,t.contentLastPos)})))},d.prototype.limitMovement=function(){var t,e,n,o,a,i,s=this,r=s.canvasWidth,c=s.canvasHeight,l=s.distanceX,d=s.distanceY,u=s.contentStartPos,f=u.left,p=u.top,h=u.width,g=u.height;return a=h>r?f+l:f,i=p+d,t=Math.max(0,.5r-.5h),e=Math.max(0,.5c-.5g),n=Math.min(r-h,.5r-.5h),o=Math.min(c-g,.5c-.5g),l>0&&a>t&&(a=t-1+Math.pow(-t+f+l,.8)\|\|0),l<0&&a<n&&(a=n+1-Math.pow(n-f-l,.8)\|\|0),d>0&&i>e&&(i=e-1+Math.pow(-e+p+d,.8)\|\|0),d<0&&i<o&&(i=o+1-Math.pow(o-p-d,.8)\|\|0),{top:i,left:a}},d.prototype.limitPosition=function(t,e,n,o){var a=this,i=a.canvasWidth,s=a.canvasHeight;return n>i?(t=t>0?0:t,t=t<i-n?i-n:t):t=Math.max(0,i/2-n/2),o>s?(e=e>0?0:e,e=e<s-o?s-o:e):e=Math.max(0,s/2-o/2),{top:e,left:t}},d.prototype.onZoom=function(){var e=this,i=e.contentStartPos,r=i.width,c=i.height,l=i.left,d=i.top,u=s(e.newPoints[0],e.newPoints[1]),f=u/e.startDistanceBetweenFingers,p=Math.floor(rf),h=Math.floor(cf),g=(r-p)e.percentageOfImageAtPinchPointX,b=(c-h)e.percentageOfImageAtPinchPointY,m=(e.newPoints[0].x+e.newPoints[1].x)/2-n(t).scrollLeft(),v=(e.newPoints[0].y+e.newPoints[1].y)/2-n(t).scrollTop(),y=m-e.centerPointStartX,x=v-e.centerPointStartY,w=l+(g+y),$=d+(b+x),S={top:$,left:w,scaleX:f,scaleY:f};e.canTap=!1,e.newWidth=p,e.newHeight=h,e.contentLastPos=S,e.requestId&&a(e.requestId),e.requestId=o(function(){n.fancybox.setTranslate(e.$content,e.contentLastPos)})},d.prototype.ontouchend=function(t){var o=this,s=o.isSwiping,r=o.isPanning,c=o.isZooming,l=o.isScrolling;return o.endPoints=i(t),o.dMs=Math.max((new Date).getTime()-o.startTime,1),o.$container.removeClass("fancybox-is-grabbing"),n(e).off(".fb.touch"),e.removeEventListener("scroll",o.onscroll,!0),o.requestId&&(a(o.requestId),o.requestId=null),o.isSwiping=!1,o.isPanning=!1,o.isZooming=!1,o.isScrolling=!1,o.instance.isDragging=!1,o.canTap?o.onTap(t):(o.speed=100,o.velocityX=o.distanceX/o.dMs.5,o.velocityY=o.distanceY/o.dMs.5,void(r?o.endPanning():c?o.endZooming():o.endSwiping(s,l)))},d.prototype.endSwiping=function(t,e){var o=this,a=!1,i=o.instance.group.length,s=Math.abs(o.distanceX),r="x"==t&&i>1&&(o.dMs>130&&s>10\|\|s>50),c=300;o.sliderLastPos=null,"y"==t&&!e&&Math.abs(o.distanceY)>50?(n.fancybox.animate(o.instance.current.$slide,{top:o.sliderStartPos.top+o.distanceY+150o.velocityY,opacity:0},200),a=o.instance.close(!0,250)):r&&o.distanceX>0?a=o.instance.previous(c):r&&o.distanceX<0&&(a=o.instance.next(c)),a!==!1\|\|"x"!=t&&"y"!=t\|\|o.instance.centerSlide(200),o.$container.removeClass("fancybox-is-sliding")},d.prototype.endPanning=function(){var t,e,o,a=this;a.contentLastPos&&(a.opts.momentum===!1\|\|a.dMs>350?(t=a.contentLastPos.left,e=a.contentLastPos.top):(t=a.contentLastPos.left+500a.velocityX,e=a.contentLastPos.top+500a.velocityY),o=a.limitPosition(t,e,a.contentStartPos.width,a.contentStartPos.height),o.width=a.contentStartPos.width,o.height=a.contentStartPos.height,n.fancybox.animate(a.$content,o,330))},d.prototype.endZooming=function(){var t,e,o,a,i=this,s=i.instance.current,r=i.newWidth,c=i.newHeight;i.contentLastPos&&(t=i.contentLastPos.left,e=i.contentLastPos.top,a={top:e,left:t,width:r,height:c,scaleX:1,scaleY:1},n.fancybox.setTranslate(i.$content,a),r<i.canvasWidth&&c<i.canvasHeight?i.instance.scaleToFit(150):r>s.width\|\|c>s.height?i.instance.scaleToActual(i.centerPointStartX,i.centerPointStartY,150):(o=i.limitPosition(t,e,r,c),n.fancybox.animate(i.$content,o,150)))},d.prototype.onTap=function(e){var o,a=this,s=n(e.target),r=a.instance,c=r.current,l=e&&i(e)\|\|a.startPoints,d=l[0]?l[0].x-n(t).scrollLeft()-a.stagePos.left:0,u=l[0]?l[0].y-n(t).scrollTop()-a.stagePos.top:0,f=function(t){var o=c.opts[t];if(n.isFunction(o)&&(o=o.apply(r,[c,e])),o)switch(o){case"close":r.close(a.startEvent);break;case"toggleControls":r.toggleControls();break;case"next":r.next();break;case"nextOrClose":r.group.length>1?r.next():r.close(a.startEvent);break;case"zoom":"image"==c.type&&(c.isLoaded\|\|c.$ghost)&&(r.canPan()?r.scaleToFit():r.isScaledDown()?r.scaleToActual(d,u):r.group.length<2&&r.close(a.startEvent))}};if((!e.originalEvent\|\|2!=e.originalEvent.button)&&(s.is("img")\|\|!(d>s[0].clientWidth+s.offset().left))){if(s.is(".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container"))o="Outside";else if(s.is(".fancybox-slide"))o="Slide";else{if(!r.current.$content\|\|!r.current.$content.find(s).addBack().filter(s).length)return;o="Content"}if(a.tapped){if(clearTimeout(a.tapped),a.tapped=null,Math.abs(d-a.tapX)>50\|\|Math.abs(u-a.tapY)>50)return this;f("dblclick"+o)}else a.tapX=d,a.tapY=u,c.opts["dblclick"+o]&&c.opts["dblclick"+o]!==c.opts["click"+o]?a.tapped=setTimeout(function(){a.tapped=null,r.isAnimating\|\|f("click"+o)},500):f("click"+o);return this}},n(e).on("onActivate.fb",function(t,e){e&&!e.Guestures&&(e.Guestures=new d(e))}).on("beforeClose.fb",function(t,e){e&&e.Guestures&&e.Guestures.destroy()})}(window,document,jQuery),function(t,e){"use strict";e.extend(!0,e.fancybox.defaults,{btnTpl:{slideShow:'<button data-fancybox-play class="fancybox-button fancybox-button--play" title="{{PLAY_START}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M6.5 5.4v13.2l11-6.6z"/></svg><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M8.33 5.75h2.2v12.5h-2.2V5.75zm5.15 0h2.2v12.5h-2.2V5.75z"/></svg></button>'},slideShow:{autoStart:!1,speed:3e3,progress:!0}});var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{timer:null,isActive:!1,$button:null,init:function(){var t=this,n=t.instance,o=n.group[n.currIndex].opts.slideShow;t.$button=n.$refs.toolbar.find("[data-fancybox-play]").on("click",function(){t.toggle()}),n.group.length<2\|\|!o?t.$button.hide():o.progress&&(t.$progress=e('<div class="fancybox-progress"></div>').appendTo(n.$refs.inner))},set:function(t){var n=this,o=n.instance,a=o.current;a&&(t===!0\|\|a.opts.loop\|\|o.currIndex<o.group.length-1)?n.isActive&&"video"!==a.contentType&&(n.$progress&&e.fancybox.animate(n.$progress.show(),{scaleX:1},a.opts.slideShow.speed),n.timer=setTimeout(function(){o.current.opts.loop\|\|o.current.index!=o.group.length-1?o.next():o.jumpTo(0)},a.opts.slideShow.speed)):(n.stop(),o.idleSecondsCounter=0,o.showControls())},clear:function(){var t=this;clearTimeout(t.timer),t.timer=null,t.$progress&&t.$progress.removeAttr("style").hide()},start:function(){var t=this,e=t.instance.current;e&&(t.$button.attr("title",(e.opts.i18n[e.opts.lang]\|\|e.opts.i18n.en).PLAY_STOP).removeClass("fancybox-button--play").addClass("fancybox-button--pause"),t.isActive=!0,e.isComplete&&t.set(!0),t.instance.trigger("onSlideShowChange",!0))},stop:function(){var t=this,e=t.instance.current;t.clear(),t.$button.attr("title",(e.opts.i18n[e.opts.lang]\|\|e.opts.i18n.en).PLAY_START).removeClass("fancybox-button--pause").addClass("fancybox-button--play"),t.isActive=!1,t.instance.trigger("onSlideShowChange",!1),t.$progress&&t.$progress.removeAttr("style").hide()},toggle:function(){var t=this;t.isActive?t.stop():t.start()}}),e(t).on({"onInit.fb":function(t,e){e&&!e.SlideShow&&(e.SlideShow=new n(e))},"beforeShow.fb":function(t,e,n,o){var a=e&&e.SlideShow;o?a&&n.opts.slideShow.autoStart&&a.start():a&&a.isActive&&a.clear()},"afterShow.fb":function(t,e,n){var o=e&&e.SlideShow;o&&o.isActive&&o.set()},"afterKeydown.fb":function(n,o,a,i,s){var r=o&&o.SlideShow;!r\|\|!a.opts.slideShow\|\|80!==s&&32!==s\|\|e(t.activeElement).is("button,a,input")\|\|(i.preventDefault(),r.toggle())},"beforeClose.fb onDeactivate.fb":function(t,e){var n=e&&e.SlideShow;n&&n.stop()}}),e(t).on("visibilitychange",function(){var n=e.fancybox.getInstance(),o=n&&n.SlideShow;o&&o.isActive&&(t.hidden?o.clear():o.set())})}(document,jQuery),function(t,e){"use strict";var n=function(){for(var e=[["requestFullscreen","exitFullscreen","fullscreenElement","fullscreenEnabled","fullscreenchange","fullscreenerror"],["webkitRequestFullscreen","webkitExitFullscreen","webkitFullscreenElement","webkitFullscreenEnabled","webkitfullscreenchange","webkitfullscreenerror"],["webkitRequestFullScreen","webkitCancelFullScreen","webkitCurrentFullScreenElement","webkitCancelFullScreen","webkitfullscreenchange","webkitfullscreenerror"],["mozRequestFullScreen","mozCancelFullScreen","mozFullScreenElement","mozFullScreenEnabled","mozfullscreenchange","mozfullscreenerror"],["msRequestFullscreen","msExitFullscreen","msFullscreenElement","msFullscreenEnabled","MSFullscreenChange","MSFullscreenError"]],n={},o=0;o<e.length;o++){var a=e[o];if(a&&a[1]in t){for(var i=0;i<a.length;i++)n[e[0][i]]=a[i];return n}}return!1}();if(n){var o={request:function(e){e=e\|\|t.documentElement,e[n.requestFullscreen](e.ALLOW_KEYBOARD_INPUT)},exit:function(){t[n.exitFullscreen]()},toggle:function(e){e=e\|\|t.documentElement,this.isFullscreen()?this.exit():this.request(e)},isFullscreen:function(){return Boolean(t[n.fullscreenElement])},enabled:function(){return Boolean(t[n.fullscreenEnabled])}};e.extend(!0,e.fancybox.defaults,{btnTpl:{fullScreen:'<button data-fancybox-fullscreen class="fancybox-button fancybox-button--fsenter" title="{{FULL_SCREEN}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M7 14H5v5h5v-2H7v-3zm-2-4h2V7h3V5H5v5zm12 7h-3v2h5v-5h-2v3zM14 5v2h3v3h2V5h-5z"/></svg><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M5 16h3v3h2v-5H5zm3-8H5v2h5V5H8zm6 11h2v-3h3v-2h-5zm2-11V5h-2v5h5V8z"/></svg></button>'},fullScreen:{autoStart:!1}}),e(t).on(n.fullscreenchange,function(){var t=o.isFullscreen(),n=e.fancybox.getInstance();n&&(n.current&&"image"===n.current.type&&n.isAnimating&&(n.current.$content.css("transition","none"),n.isAnimating=!1,n.update(!0,!0,0)),n.trigger("onFullscreenChange",t),n.$refs.container.toggleClass("fancybox-is-fullscreen",t),n.$refs.toolbar.find("[data-fancybox-fullscreen]").toggleClass("fancybox-button--fsenter",!t).toggleClass("fancybox-button--fsexit",t))})}e(t).on({"onInit.fb":function(t,e){var a;return n?void(e&&e.group[e.currIndex].opts.fullScreen?(a=e.$refs.container,a.on("click.fb-fullscreen","[data-fancybox-fullscreen]",function(t){t.stopPropagation(),t.preventDefault(),o.toggle()}),e.opts.fullScreen&&e.opts.fullScreen.autoStart===!0&&o.request(),e.FullScreen=o):e&&e.$refs.toolbar.find("[data-fancybox-fullscreen]").hide()):void e.$refs.toolbar.find("[data-fancybox-fullscreen]").remove()},"afterKeydown.fb":function(t,e,n,o,a){e&&e.FullScreen&&70===a&&(o.preventDefault(),e.FullScreen.toggle())},"beforeClose.fb":function(t,e){e&&e.FullScreen&&e.$refs.container.hasClass("fancybox-is-fullscreen")&&o.exit()}})}(document,jQuery),function(t,e){"use strict";var n="fancybox-thumbs",o=n+"-active";e.fancybox.defaults=e.extend(!0,{btnTpl:{thumbs:'<button data-fancybox-thumbs class="fancybox-button fancybox-button--thumbs" title="{{THUMBS}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M14.59 14.59h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76H5.65V5.65z"/></svg></button>'},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"}},e.fancybox.defaults);var a=function(t){this.init(t)};e.extend(a.prototype,{$button:null,$grid:null,$list:null,isVisible:!1,isActive:!1,init:function(t){var e=this,n=t.group,o=0;e.instance=t,e.opts=n[t.currIndex].opts.thumbs,t.Thumbs=e,e.$button=t.$refs.toolbar.find("[data-fancybox-thumbs]");for(var a=0,i=n.length;a<i&&(n[a].thumb&&o++,!(o>1));a++);o>1&&e.opts?(e.$button.removeAttr("style").on("click",function(){e.toggle()}),e.isActive=!0):e.$button.hide()},create:function(){var t,o=this,a=o.instance,i=o.opts.parentEl,s=[];o.$grid\|\|(o.$grid=e('<div class="'+n+" "+n+"-"+o.opts.axis+'"></div>').appendTo(a.$refs.container.find(i).addBack().filter(i)),o.$grid.on("click","a",function(){a.jumpTo(e(this).attr("data-index"))})),o.$list\|\|(o.$list=e('<div class="'+n+'__list">').appendTo(o.$grid)),e.each(a.group,function(e,n){t=n.thumb,t\|\|"image"!==n.type\|\|(t=n.src),s.push('<a href="javascript:;" tabindex="0" data-index="'+e+'"'+(t&&t.length?' style="background-image:url('+t+')"':'class="fancybox-thumbs-missing"')+"></a>")}),o.$list[0].innerHTML=s.join(""),"x"===o.opts.axis&&o.$list.width(parseInt(o.$grid.css("padding-right"),10)+a.group.lengtho.$list.children().eq(0).outerWidth(!0))},focus:function(t){var e,n,a=this,i=a.$list,s=a.$grid;a.instance.current&&(e=i.children().removeClass(o).filter('[data-index="'+a.instance.current.index+'"]').addClass(o),n=e.position(),"y"===a.opts.axis&&(n.top<0\|\|n.top>i.height()-e.outerHeight())?i.stop().animate({scrollTop:i.scrollTop()+n.top},t):"x"===a.opts.axis&&(n.left<s.scrollLeft()\|\|n.left>s.scrollLeft()+(s.width()-e.outerWidth()))&&i.parent().stop().animate({scrollLeft:n.left},t))},update:function(){var t=this;t.instance.$refs.container.toggleClass("fancybox-show-thumbs",this.isVisible),t.isVisible?(t.$grid\|\|t.create(),t.instance.trigger("onThumbsShow"),t.focus(0)):t.$grid&&t.instance.trigger("onThumbsHide"),t.instance.update()},hide:function(){this.isVisible=!1,this.update()},show:function(){this.isVisible=!0,this.update()},toggle:function(){this.isVisible=!this.isVisible,this.update()}}),e(t).on({"onInit.fb":function(t,e){var n;e&&!e.Thumbs&&(n=new a(e),n.isActive&&n.opts.autoStart===!0&&n.show())},"beforeShow.fb":function(t,e,n,o){var a=e&&e.Thumbs;a&&a.isVisible&&a.focus(o?0:250)},"afterKeydown.fb":function(t,e,n,o,a){var i=e&&e.Thumbs;i&&i.isActive&&71===a&&(o.preventDefault(),i.toggle())},"beforeClose.fb":function(t,e){var n=e&&e.Thumbs;n&&n.isVisible&&n.opts.hideOnClose!==!1&&n.$grid.hide()}})}(document,jQuery),function(t,e){"use strict";function n(t){var e={"&":"&","<":"<",">":">",'"':""","'":"'","/":"/","`":"`","=":"="};return String(t).replace(/[&<>"'`=\/]/g,function(t){return e[t]})}e.extend(!0,e.fancybox.defaults,{btnTpl:{share:'<button data-fancybox-share class="fancybox-button fancybox-button--share" title="{{SHARE}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M2.55 19c1.4-8.4 9.1-9.8 11.9-9.8V5l7 7-7 6.3v-3.5c-2.8 0-10.5 2.1-11.9 4.2z"/></svg></button>'},share:{url:function(t,e){return!t.currentHash&&"inline"!==e.type&&"html"!==e.type&&(e.origSrc\|\|e.src)\|\|window.location},tpl:'<div class="fancybox-share"><h1>{{SHARE}}</h1><p><a class="fancybox-share__button fancybox-share__button--fb" href="https://www.facebook.com/sharer/sharer.php?u={{url}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m287 456v-299c0-21 6-35 35-35h38v-63c-7-1-29-3-55-3-54 0-91 33-91 94v306m143-254h-205v72h196" /></svg><span>Facebook</span></a><a class="fancybox-share__button fancybox-share__button--tw" href="https://twitter.com/intent/tweet?url={{url}}&text={{descr}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m456 133c-14 7-31 11-47 13 17-10 30-27 37-46-15 10-34 16-52 20-61-62-157-7-141 75-68-3-129-35-169-85-22 37-11 86 26 109-13 0-26-4-37-9 0 39 28 72 65 80-12 3-25 4-37 2 10 33 41 57 77 57-42 30-77 38-122 34 170 111 378-32 359-208 16-11 30-25 41-42z" /></svg><span>Twitter</span></a><a class="fancybox-share__button fancybox-share__button--pt" href="https://www.pinterest.com/pin/create/button/?url={{url}}&description={{descr}}&media={{media}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m265 56c-109 0-164 78-164 144 0 39 15 74 47 87 5 2 10 0 12-5l4-19c2-6 1-8-3-13-9-11-15-25-15-45 0-58 43-110 113-110 62 0 96 38 96 88 0 67-30 122-73 122-24 0-42-19-36-44 6-29 20-60 20-81 0-19-10-35-31-35-25 0-44 26-44 60 0 21 7 36 7 36l-30 125c-8 37-1 83 0 87 0 3 4 4 5 2 2-3 32-39 42-75l16-64c8 16 31 29 56 29 74 0 124-67 124-157 0-69-58-132-146-132z" fill="#fff"/></svg><span>Pinterest</span></a></p><p><input class="fancybox-share__input" type="text" value="{{url_raw}}" onclick="select()" /></p></div>'
13	+ }}),e(t).on("click","[data-fancybox-share]",function(){var t,o,a=e.fancybox.getInstance(),i=a.current\|\|null;i&&("function"===e.type(i.opts.share.url)&&(t=i.opts.share.url.apply(i,[a,i])),o=i.opts.share.tpl.replace(/\{\{media\}\}/g,"image"===i.type?encodeURIComponent(i.src):"").replace(/\{\{url\}\}/g,encodeURIComponent(t)).replace(/\{\{url_raw\}\}/g,n(t)).replace(/\{\{descr\}\}/g,a.$caption?encodeURIComponent(a.$caption.text()):""),e.fancybox.open({src:a.translate(a,o),type:"html",opts:{touch:!1,animationEffect:!1,afterLoad:function(t,e){a.$refs.container.one("beforeClose.fb",function(){t.close(null,0)}),e.$content.find(".fancybox-share__button").click(function(){return window.open(this.href,"Share","width=550, height=450"),!1})},mobile:{autoFocus:!1}}}))})}(document,jQuery),function(t,e,n){"use strict";function o(){var e=t.location.hash.substr(1),n=e.split("-"),o=n.length>1&&/^\+?\d+$/.test(n[n.length-1])?parseInt(n.pop(-1),10)\|\|1:1,a=n.join("-");return{hash:e,index:o<1?1:o,gallery:a}}function a(t){""!==t.gallery&&n("[data-fancybox='"+n.escapeSelector(t.gallery)+"']").eq(t.index-1).focus().trigger("click.fb-start")}function i(t){var e,n;return!!t&&(e=t.current?t.current.opts:t.opts,n=e.hash\|\|(e.$orig?e.$orig.data("fancybox")\|\|e.$orig.data("fancybox-trigger"):""),""!==n&&n)}n.escapeSelector\|\|(n.escapeSelector=function(t){var e=/([\0-\x1f\x7f]\|^-?\d)\|^-$\|[^\x80-\uFFFF\w-]/g,n=function(t,e){return e?"\0"===t?"�":t.slice(0,-1)+"\\"+t.charCodeAt(t.length-1).toString(16)+" ":"\\"+t};return(t+"").replace(e,n)}),n(function(){n.fancybox.defaults.hash!==!1&&(n(e).on({"onInit.fb":function(t,e){var n,a;e.group[e.currIndex].opts.hash!==!1&&(n=o(),a=i(e),a&&n.gallery&&a==n.gallery&&(e.currIndex=n.index-1))},"beforeShow.fb":function(n,o,a,s){var r;a&&a.opts.hash!==!1&&(r=i(o),r&&(o.currentHash=r+(o.group.length>1?"-"+(a.index+1):""),t.location.hash!=="#"+o.currentHash&&(s&&!o.origHash&&(o.origHash=t.location.hash),o.hashTimer&&clearTimeout(o.hashTimer),o.hashTimer=setTimeout(function(){"replaceState"in t.history?(t.history[s?"pushState":"replaceState"]({},e.title,t.location.pathname+t.location.search+"#"+o.currentHash),s&&(o.hasCreatedHistory=!0)):t.location.hash=o.currentHash,o.hashTimer=null},300))))},"beforeClose.fb":function(n,o,a){a.opts.hash!==!1&&(clearTimeout(o.hashTimer),o.currentHash&&o.hasCreatedHistory?t.history.back():o.currentHash&&("replaceState"in t.history?t.history.replaceState({},e.title,t.location.pathname+t.location.search+(o.origHash\|\|"")):t.location.hash=o.origHash),o.currentHash=null)}}),n(t).on("hashchange.fb",function(){var t=o(),e=null;n.each(n(".fancybox-container").get().reverse(),function(t,o){var a=n(o).data("FancyBox");if(a&&a.currentHash)return e=a,!1}),e?e.currentHash===t.gallery+"-"+t.index\|\|1===t.index&&e.currentHash==t.gallery\|\|(e.currentHash=null,e.close()):""!==t.gallery&&a(t)}),setTimeout(function(){n.fancybox.getInstance()\|\|a(o())},50))})}(window,document,jQuery),function(t,e){"use strict";var n=(new Date).getTime();e(t).on({"onInit.fb":function(t,e,o){e.$refs.stage.on("mousewheel DOMMouseScroll wheel MozMousePixelScroll",function(t){var o=e.current,a=(new Date).getTime();e.group.length<2\|\|o.opts.wheel===!1\|\|"auto"===o.opts.wheel&&"image"!==o.type\|\|(t.preventDefault(),t.stopPropagation(),o.$slide.hasClass("fancybox-animated")\|\|(t=t.originalEvent\|\|t,a-n<250\|\|(n=a,e[(-t.deltaY\|\|-t.deltaX\|\|t.wheelDelta\|\|-t.detail)<0?"next":"previous"]())))})}})}(document,jQuery);

admin/font/material-design-icons/license.txt CHANGED Viewed

File without changes

admin/font/material-design-icons/materialdesignicons-webfont.eot CHANGED Viewed

File without changes

admin/font/material-design-icons/materialdesignicons-webfont.svg CHANGED Viewed

File without changes

admin/font/material-design-icons/materialdesignicons-webfont.ttf CHANGED Viewed

File without changes

admin/font/material-design-icons/materialdesignicons-webfont.woff CHANGED Viewed

File without changes

admin/font/material-design-icons/materialdesignicons-webfont.woff2 CHANGED Viewed

File without changes

admin/font/roboto/Roboto-Bold-webfont.eot CHANGED Viewed

File without changes

admin/font/roboto/Roboto-Bold-webfont.svg CHANGED Viewed

File without changes

admin/font/roboto/Roboto-Bold-webfont.ttf CHANGED Viewed

File without changes

admin/font/roboto/Roboto-Bold-webfont.woff CHANGED Viewed

File without changes

admin/font/roboto/Roboto-Light-webfont.eot CHANGED Viewed

File without changes

admin/font/roboto/Roboto-Light-webfont.svg CHANGED Viewed

File without changes

admin/font/roboto/Roboto-Light-webfont.ttf CHANGED Viewed

File without changes

admin/font/roboto/Roboto-Light-webfont.woff CHANGED Viewed

File without changes

admin/font/roboto/Roboto-Regular-webfont.eot CHANGED Viewed

File without changes

admin/font/roboto/Roboto-Regular-webfont.svg CHANGED Viewed

File without changes

admin/font/roboto/Roboto-Regular-webfont.ttf CHANGED Viewed

File without changes

admin/font/roboto/Roboto-Regular-webfont.woff CHANGED Viewed

File without changes

admin/images/captions-settings.jpg ADDED Viewed

Binary file

admin/images/creative-gallery-settings.jpg ADDED Viewed

Binary file

admin/images/custom-grid-settings.jpg ADDED Viewed

Binary file

admin/images/customizations-settings.jpg ADDED Viewed

Binary file

admin/images/drag-and-drop-upload.jpg ADDED Viewed

Binary file

admin/images/galleries-list.jpg ADDED Viewed

Binary file

admin/images/gallery-edit.jpg ADDED Viewed

Binary file

admin/images/helper-grid.jpg ADDED Viewed

Binary file

admin/images/hover-effects-settings.jpg ADDED Viewed

Binary file

admin/images/landscape-portrait.jpg ADDED Viewed

Binary file

admin/images/live-preview.jpg ADDED Viewed

Binary file

admin/images/loading-effects-settings.jpg ADDED Viewed

Binary file

admin/images/modula-v2-custom-grid.png ADDED Viewed

Binary file

admin/images/modula-v2-drag-and-drop-upload.png ADDED Viewed

Binary file

admin/images/modula-v2-familiar-dashboard.png ADDED Viewed

Binary file

admin/images/modula-v2-helper-grid.png ADDED Viewed

Binary file

admin/images/modula-v2-intuitive-settings.png ADDED Viewed

Binary file

admin/images/modula-v2-landscape-or-portrait.png ADDED Viewed

Binary file

admin/images/modula-v2-live-preview.png ADDED Viewed

Binary file

admin/images/modula.svg ADDED Viewed

	@@ -0,0 +1,48 @@


1	+ <?xml version="1.0" encoding="utf-8"?>
2	+ <!-- Generator: Adobe Illustrator 23.0.1, SVG Export Plug-In . SVG Version: 6.00 Build 0) -->
3	+ <svg version="1.1" id="Layer_1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px"
4	+ viewBox="0 0 713.4 224.4" xml:space="preserve" fill="#fff">
5	+ <g>
6	+ <path d="M237,71c7,0,13.9,0,20.9,0c7.7,12.4,15.3,24.7,23.1,37.2c7.8-12.5,15.4-24.9,23.1-37.2c6.9,0,13.8,0,20.7,0
7	+ c0.2,0.8,0.3,86.6,0.1,88.2c-6.3,0-12.6,0-19,0c-0.2-2.4-0.1-4.8-0.1-7.2c0-2.4,0-4.7,0-7.1c0-2.4,0-4.8,0-7.2c0-2.4,0-4.7,0-7.1
8	+ c0-2.4,0-4.8,0-7.2c0-2.4,0-4.7,0-7.1c0-2.4,0-4.8,0-7.2c0-2.3,0-4.7,0-7c-0.1,0-0.2-0.1-0.3-0.1c-0.2,0.3-0.5,0.7-0.7,1
9	+ c-7.7,11.7-15.3,23.3-23,35c-1.1,1.7-1.1,1.7-2.2,0c-7.6-11.5-15.1-23-22.7-34.5c-0.2-0.4-0.5-0.7-0.9-1.3
10	+ c-0.1,0.6-0.1,0.9-0.1,1.2c0,2.7,0,5.4,0,8.1c0,15.3,0,30.7,0,46c0,0.5,0,1,0,1.5c-6.4,0-12.6,0-18.9,0C237,129.8,237,100.5,237,71
11	+ z"/>
12	+ <path d="M476.3,100.1c0-10.9,0-21.8,0-32.8c6.4,0,12.7,0,18.9,0c0.2,0.8,0.4,89.6,0.1,91.9c-6.3,0-12.6,0-19,0c0-3.1,0-6.1,0-9.4
13	+ c-0.4,0.5-0.6,0.7-0.8,0.9c-1.1,1.2-2.2,2.5-3.4,3.6c-3.8,3.6-8.3,5.7-13.6,6.2c-8.4,0.7-16-1.4-22.5-7c-4.3-3.7-7.2-8.3-9.1-13.6
14	+ c-2.1-5.6-2.6-11.3-2.3-17.2c0.3-5.2,1.4-10.2,3.7-14.9c1.6-3.2,3.5-6.2,6.1-8.8c5-5.1,11.1-7.8,18.1-8.4c3.3-0.3,6.6-0.1,9.8,0.6
15	+ c4.2,0.9,7.6,3.2,10.7,6c1.1,0.9,2,2,3,3C476.1,100.1,476.2,100.1,476.3,100.1z M476.6,125.5c0.1-4.2-0.9-8.1-3.2-11.6
16	+ c-3.6-5.7-10-8.3-16.5-6.9c-5.1,1.1-8.6,4.2-10.9,8.7c-1.3,2.5-1.9,5.1-2.1,7.9c-0.3,4.8,0.5,9.3,3.2,13.3c3.8,5.6,9.2,8,16,7
17	+ c4.9-0.8,8.4-3.6,10.9-7.9C475.8,132.8,476.7,129.3,476.6,125.5z"/>
18	+ <path d="M377,90.4c7.2,0,13.5,1.5,19.3,4.8c10,5.8,15.9,14.5,17.3,26c2.3,19.3-10.5,34.7-27.3,38.5c-10.2,2.3-20,1.1-29-4.4
19	+ c-9.3-5.7-14.8-14.2-16.2-25c-2.5-20,11-35.4,27.9-39C371.8,90.7,374.6,90.4,377,90.4z M394.9,125.7c0-0.4,0-0.9,0-1.3
20	+ c-0.5-10-8-16.9-16.3-17.5c-7.8-0.5-14.1,3.2-17,9.8c-1.6,3.6-2,7.4-1.7,11.3c0.9,8.8,8.4,16.9,18.9,16.2c5.8-0.4,10.3-3,13.4-8
21	+ C394.1,133,394.9,129.5,394.9,125.7z"/>
22	+ <path d="M668.5,120.7c0.1-2.3-0.1-4.4-0.9-6.4c-1-2.6-2.9-4.4-5.4-5.5c-2.1-0.9-4.3-1.3-6.5-1.4c-6.6-0.3-12.9,0.9-19.1,3.2
23	+ c-0.4,0.1-0.7,0.2-1.2,0.4c-1.6-4.9-3.2-9.7-4.8-14.5c0.4-0.2,0.7-0.4,1-0.5c4.6-1.9,9.4-3.5,14.3-4.2c7.2-1,14.3-1.3,21.5,0.4
24	+ c1.8,0.4,3.6,1,5.2,1.8c6.9,3.1,11.1,8.4,13,15.7c0.8,3,1.2,6.1,1.2,9.2c0,13.2,0,26.4,0,39.5c0,0.3,0,0.6-0.1,1
25	+ c-6.1,0-12.2,0-18.3,0c-0.1-2.3,0-4.5-0.1-6.9c-0.5,0.1-0.7,0.5-1,0.7c-3.3,3.1-7,5.5-11.4,6.5c-6.1,1.4-12.1,1.4-18-0.8
26	+ c-7.2-2.7-11.6-7.8-12.8-15.4c-0.7-4.7-0.3-9.3,1.9-13.6c2.4-4.7,6.2-7.6,11-9.5c4.2-1.6,8.6-2.2,13.1-2.3c5.5-0.1,10.8,0.6,16,2.3
27	+ C667.5,120.4,667.9,120.6,668.5,120.7z M668.7,132c-0.2-0.1-0.3-0.2-0.5-0.3c-4.7-2-9.5-2.6-14.5-2.1c-1.5,0.2-3.1,0.5-4.6,1.1
28	+ c-4.1,1.5-5.9,4.4-5.8,8.7c0.1,2.7,1.2,4.8,3.5,6.1c0.9,0.5,1.8,0.9,2.8,1.2c2,0.6,4.1,0.6,6.2,0.4c3-0.2,5.9-1.1,8.3-2.9
29	+ c2-1.4,3.4-3.3,4.1-5.6C669,136.5,668.8,134.3,668.7,132z"/>
30	+ <path d="M554.7,91.8c6.4,0,12.7,0,19.1,0c0,22.5,0,44.9,0,67.3c-0.9,0.2-17.7,0.3-19,0c0-3,0-6,0-9.3c-0.4,0.4-0.6,0.6-0.8,0.8
31	+ c-1.8,2.2-3.7,4.2-6,5.8c-3.7,2.6-7.8,4-12.4,4c-2.6,0-5.3-0.2-7.8-0.8c-6.6-1.8-11.1-6-13.7-12.3c-1.6-3.9-2-8-2-12.1
32	+ c0-14,0-28.1,0-42.1c0-0.4,0-0.8,0-1.3c6.4,0,12.7,0,19.1,0c0,0.5,0,1,0,1.4c0,11.8,0,23.7,0,35.5c0,2,0.1,4.1,0.6,6.1
33	+ c1.3,5.1,5,8.1,10.3,8.2c1.4,0,2.8,0,4.1-0.4c4.5-1.1,7.1-4.1,8-8.5c0.4-1.7,0.5-3.5,0.5-5.3c0-11.8,0-23.7,0-35.5
34	+ C554.7,92.9,554.7,92.4,554.7,91.8z"/>
35	+ <path d="M610.8,159.2c-6.3,0-12.6,0-19,0c0-30.6,0-61.2,0-91.8c0.8-0.3,17.1-0.3,19-0.1C610.8,97.9,610.8,128.5,610.8,159.2z"/>
36	+ <path d="M61.9,169.5c-14.3-4.3-28.6-8.5-43-12.8c14.3-21.4,28.6-42.8,42.8-64.1c0.1,0,0.1,0,0.2,0.1
37	+ C61.9,118.2,61.9,143.8,61.9,169.5z"/>
38	+ <path d="M144.7,134.3c-1-25.5-1.9-51-2.9-76.7c14.5,3.7,28.9,7.4,43.5,11.2c-13.5,22-26.9,43.8-40.3,65.7
39	+ C144.9,134.3,144.8,134.3,144.7,134.3z"/>
40	+ <path d="M185.3,160.9c-25.8-1.1-51.5-2.1-77.2-3.2c0-0.1,0-0.2-0.1-0.3c21.9-13.3,43.8-26.5,65.9-39.9
41	+ C177.7,132,181.5,146.4,185.3,160.9z"/>
42	+ <path d="M23.1,63c25.9,1.4,51.4,2.7,77,4c0.1,0.1,0.1,0.2,0.1,0.2c0,0,0,0.1,0,0.1c-0.4,0.2-0.7,0.5-1.1,0.7
43	+ c-21.6,12.8-43.3,25.5-65,38.4C30.3,92,26.7,77.6,23.1,63z"/>
44	+ <path d="M100.3,206c-12.2-22.7-24.4-45.3-36.6-67.9c1,0.2,66.5,35.1,68.1,36.2C121.3,184.8,110.9,195.3,100.3,206z"/>
45	+ <path d="M73.9,50.3c10.6-10.4,21.2-20.8,31.8-31.2c0.6,0.6,34.8,66.2,35.6,68.2c0,0-0.1,0.1-0.1,0.1c0,0-0.1,0-0.1,0
46	+ c-22.3-12.3-44.6-24.5-66.8-36.8C74.2,50.6,74.1,50.5,73.9,50.3z"/>
47	+ </g>
48	+ </svg>

admin/images/social-settings.jpg ADDED Viewed

Binary file

admin/images/style-settings.jpg ADDED Viewed

Binary file

admin/modula-v2.php ADDED Viewed

	@@ -0,0 +1,99 @@


1	+
2	+ <div class="wrap about-wrap modula-wrap">
3	+ <style type="text/css">
4	+ .center {
5	+ text-align: center;
6	+ }
7	+ a.modula-video {
8	+ text-decoration: none;
9	+ font-size: 20px;
10	+ margin-left: 20px;
11	+ line-height: 46px;
12	+ color: #23282d;
13	+ }
14	+ .modula-video span.dashicons.dashicons-video-alt3 {
15	+ line-height: 46px;
16	+ width: auto;
17	+ height: auto;
18	+ font-size: 26px;
19	+ vertical-align: middle;
20	+ }
21	+ </style>
22	+ <div class="feature-section one-col">
23	+ <div class="col">
24	+ <h2 style="font-size: 2.5em;"><?php echo __( 'Meet The New Modula', 'modula-gallery' ); ?></h2>
25	+ <p><?php echo __( 'We’ve been working on an awesome update to Modula over the last few months and can’t wait to release it to the public. But, before that can happen, we need the help of amazing users in the WordPress community (just like you) to improve Modula 2.0’s first beta.', 'modula-gallery' ); ?></p>
26	+ <div class="center">
27	+ <br>
28	+ <a href="https://machothemes.com/downloads/modula-2.0.0.zip" target="_blank" class="button button-primary button-hero"><?php echo __( 'Download Modula 2.0 Beta', 'modula-gallery' ); ?></a>
29	+ <a href="https://www.youtube.com/watch?v=NxrTXQNExh4" data-fancybox class="modula-video"><span class="dashicons dashicons-video-alt3"></span> See Video</a>
30	+ <br><br>
31	+ <p><?php echo __( 'Not convinced yet? Keep scrolling to take a look at what’s in store for Modula 2.0…', 'modula-gallery' ); ?></p>
32	+ </div>
33	+ </div>
34	+ </div>
35	+ <div class="inline-svg">
36	+ <picture>
37	+ <img src="<?php echo plugin_dir_url( __FILE__ ) ?>/images/modula-v2-custom-grid.png" alt="">
38	+ </picture>
39	+ </div>
40	+ <div class="feature-section">
41	+ <h2>Introducing <strong>Custom Grids</strong></h2>
42	+ </div>
43	+ <div class="three-col">
44	+ <div class="col">
45	+ <a href="<?php echo plugin_dir_url( __FILE__ ) ?>/images/landscape-portrait.jpg" data-caption="Take Full Control" data-fancybox="custom-grids"><img src="<?php echo plugin_dir_url( __FILE__ ) ?>/images/modula-v2-landscape-or-portrait.png" alt=""></a>
46	+ <h4>Take Full Control</h4>
47	+ <p>We’re proud to introduce custom grids to give you greater flexibility over how you display the images on your website. With Modula 2.0’s new custom grid functionality you have full control over the size of images on your website.</p>
48	+ </div>
49	+ <div class="col">
50	+ <a href="<?php echo plugin_dir_url( __FILE__ ) ?>/images/helper-grid.jpg" data-caption="Guidelines to Help you Make the Perfect Gallery" data-fancybox="custom-grids"><img src="<?php echo plugin_dir_url( __FILE__ ) ?>/images/modula-v2-helper-grid.png" alt=""></a>
51	+ <h4>Guidelines to Help you Make the Perfect Gallery</h4>
52	+ <p>As a guideline and to make it easier for you to create the perfect grid, we’ve included the helper grid which appears behind your images to indicate every potential layout you could design.</p>
53	+ </div>
54	+ <div class="col">
55	+ <a href="<?php echo plugin_dir_url( __FILE__ ) ?>/images/live-preview.jpg" data-caption="Preview your Gallery Without the Hassle" data-fancybox="custom-grids"><img src="<?php echo plugin_dir_url( __FILE__ ) ?>/images/modula-v2-live-preview.png" alt=""></a>
56	+ <h4>Preview your Gallery Without the Hassle</h4>
57	+ <p>And, of course, there’s no need to check the front-end every time you make a change, because you can easily preview the changes you make to your gallery in the WordPress admin area.</p>
58	+ </div>
59	+ </div>
60	+ <div class="center">
61	+ <br>
62	+ <a href="https://machothemes.com/downloads/modula-2.0.0.zip" target="_blank" class="button button-primary button-hero"><?php echo __( 'Download Modula 2.0 Beta', 'modula-gallery' ); ?></a>
63	+ <br><br>
64	+ </div>
65	+ <div class="feature-section">
66	+ <h2>Modula 2.0’s new (yet familiar) user interface</h2>
67	+ </div>
68	+ <div class="three-col">
69	+ <div class="col">
70	+ <a href="<?php echo plugin_dir_url( __FILE__ ) ?>/images/galleries-list.jpg" data-caption="Galleries List Screen" data-fancybox="modula-dashboard"><img src="<?php echo plugin_dir_url( __FILE__ ) ?>/images/modula-v2-familiar-dashboard.png" alt=""></a>
71	+ <a href="<?php echo plugin_dir_url( __FILE__ ) ?>/images/gallery-edit.jpg" data-caption="Gallery Edit Screen" data-fancybox="modula-dashboard"></a>
72	+ <h4>Modula 2.0 Blends in With WordPress</h4>
73	+ <p>In order to create a more intuitive user interface, we’ve blended our admin dashboard with that of WordPress together.</p>
74	+ </div>
75	+ <div class="col">
76	+ <a href="<?php echo plugin_dir_url( __FILE__ ) ?>/images/drag-and-drop-upload.jpg" data-caption="Drag and Drop to Upload" data-fancybox="modula-drag-and-drop"><img src="<?php echo plugin_dir_url( __FILE__ ) ?>/images/modula-v2-drag-and-drop-upload.png" alt=""></a>
77	+ <h4>Drag and Drop to Upload</h4>
78	+ <p>Easily drag images into the WordPress admin to add them directly to your gallery</p>
79	+ </div>
80	+ <div class="col">
81	+ <a href="<?php echo plugin_dir_url( __FILE__ ) ?>/images/custom-grid-settings.jpg" data-caption="Custom Grid Settings" data-fancybox="modula-settings"><img src="<?php echo plugin_dir_url( __FILE__ ) ?>/images/modula-v2-intuitive-settings.png" alt=""></a>
82	+ <a href="<?php echo plugin_dir_url( __FILE__ ) ?>/images/creative-gallery-settings.jpg" data-caption="Creative Gallery Settings" data-fancybox="modula-settings"></a>
83	+ <a href="<?php echo plugin_dir_url( __FILE__ ) ?>/images/captions-settings.jpg" data-caption="Captions Settings" data-fancybox="modula-settings"></a>
84	+ <a href="<?php echo plugin_dir_url( __FILE__ ) ?>/images/social-settings.jpg" data-caption="Social Settings" data-fancybox="modula-settings"></a>
85	+ <a href="<?php echo plugin_dir_url( __FILE__ ) ?>/images/loading-effects-settings.jpg" data-caption="Loading Effects Settings" data-fancybox="modula-settings"></a>
86	+ <a href="<?php echo plugin_dir_url( __FILE__ ) ?>/images/hover-effects-settings.jpg" data-caption="Hover Effects Settings" data-fancybox="modula-settings"></a>
87	+ <a href="<?php echo plugin_dir_url( __FILE__ ) ?>/images/style-settings.jpg" data-caption="Style Settings" data-fancybox="modula-settings"></a>
88	+ <a href="<?php echo plugin_dir_url( __FILE__ ) ?>/images/customizations-settings.jpg" data-caption="Customizations Settings" data-fancybox="modula-settings"></a>
89	+ <h4>Intuitive Settings</h4>
90	+ <p>Our settings panel has been redesigned to make everything you need easier to access quickly.</p>
91	+ </div>
92	+ </div>
93	+ <div class="center">
94	+ <br>
95	+ <a href="https://machothemes.com/downloads/modula-2.0.0.zip" target="_blank" class="button button-primary button-hero"><?php echo __( 'Download Modula 2.0 Beta', 'modula-gallery' ); ?></a>
96	+ <br><br>
97	+ </div>
98	+
99	+ </div> <!--/.about-wrap-->

admin/welcome-screen/sections/modula-v2.php ADDED Viewed

	@@ -0,0 +1,11 @@


1	+ <div class="feature-section one-col">
2	+ <div class="col">
3	+ <h2 style="font-size: 2.5em;"><?php echo __( 'New Admin Interface, Custom Grid!', 'modula-gallery' ); ?></h2>
4	+ <p class="lead-description"><?php echo __( 'Modula 2.0 bring new things like a new admin interface & a new type of gallery.', 'modula-gallery' ); ?></p>
5	+ <div class="center">
6	+ <a href="https://www.wp-modula.com/?utm_source=worg&utm_medium=about-page&utm_campaign=upsell" target="_blank" class="button button-primary button-hero"><span class="dashicons dashicons-cart"></span>
7	+ <?php echo __( 'Get Modula Pro', 'modula-gallery' ); ?>
8	+ </a>
9	+ </div>
10	+ </div>
11	+ </div>

lib/class-modula-plugin-rollback.php ADDED Viewed

	@@ -0,0 +1,71 @@


1	+ <?php
2	+
3	+ class Modula_Plugin_RollBack {
4	+
5	+ public function __construct() {
6	+
7	+ /**
8	+ * $_POST action hook
9	+ *
10	+ * @see: https://codex.wordpress.org/Plugin_API/Action_Reference/admin_post_(action)
11	+ *
12	+ */
13	+ add_action( 'admin_post_modula_rollback', array( $this, 'post_rollback' ) );
14	+
15	+ /**
16	+ * Hook responsible for loading our Rollback JS script
17	+ */
18	+ add_action( 'admin_enqueue_scripts', array( $this, 'rollback_scripts' ) );
19	+
20	+ }
21	+
22	+ /**
23	+ * FBFW version rollback.
24	+ *
25	+ * Rollback to previous {plugin} version.
26	+ *
27	+ * Fired by `admin_post_epfw_rollback` action.
28	+ *
29	+ * @since 1.5.0
30	+ * @access public
31	+ */
32	+ public function post_rollback() {
33	+
34	+ check_admin_referer( 'modula_rollback' );
35	+
36	+ $plugin_slug = basename( MODULA_FILE_, '.php' );
37	+
38	+ // check for const defines
39	+ if ( ! defined( 'MODULA_PREVIOUS_PLUGIN_VERSION' ) \|\| ! defined( 'MODULA_PLUGIN_BASE' ) ) {
40	+ wp_die(
41	+ new WP_Error( 'broke', esc_html__( 'Previous plugin version or plugin basename CONST aren\'t defined.', 'epfw' ) )
42	+ );
43	+ }
44	+
45	+ if ( class_exists( 'Modula_Rollback' ) ) {
46	+ $rollback = new Modula_Rollback(
47	+ array(
48	+ 'version' => MODULA_PREVIOUS_PLUGIN_VERSION,
49	+ 'plugin_name' => MODULA_PLUGIN_BASE,
50	+ 'plugin_slug' => $plugin_slug,
51	+ 'package_url' => sprintf( 'https://downloads.wordpress.org/plugin/%s.%s.zip', 'modula-best-grid-gallery', MODULA_PREVIOUS_PLUGIN_VERSION ),
52	+ )
53	+ );
54	+ $rollback->run();
55	+ }
56	+
57	+ wp_die(
58	+ '', __( 'Rollback to Previous Version', 'mfbfw' ), array(
59	+ 'response' => 200,
60	+ )
61	+ );
62	+ }
63	+
64	+ public function rollback_scripts() {
65	+ wp_enqueue_script('rollback-script', MODULA_PLUGIN_DIR_URL . 'scripts/rollback.js', MODULA_VERSION ); // Load Rollback script
66	+ wp_enqueue_script( 'rollback-script' );
67	+ }
68	+
69	+ }
70	+
71	+ new Modula_Plugin_RollBack();

lib/class-modula-review.php ADDED Viewed

	@@ -0,0 +1,177 @@


1	+ <?php
2	+
3	+ class Modula_Review {
4	+
5	+ private static $instance;
6	+ private $when = array( 5, 10, 15 );
7	+ private $value;
8	+ private $messages;
9	+ private $link = 'https://wordpress.org/support/plugin/%s/reviews/#new-post';
10	+ private $slug = '';
11	+ private $option_name = '';
12	+
13	+ function __construct( $args ) {
14	+
15	+ if ( isset( $args['slug'] ) ) {
16	+ $this->slug = $args['slug'];
17	+ }
18	+
19	+ $this->value = $this->value();
20	+
21	+ $this->messages = array(
22	+ 'notice' => __( "Hey, I noticed you have installed our plugin for %s day - that's awesome! Could you please do me a BIG favor and give it a 5-star rating on WordPress? Just to help us spread the word and boost our motivation.", 'modula-gallery' ),
23	+ 'rate' => __( 'Ok, you deserve it', 'modula-gallery' ),
24	+ 'rated' => __( 'I already did', 'modula-gallery' ),
25	+ 'no_rate' => __( 'No, not good enough', 'modula-gallery' ),
26	+ );
27	+
28	+ if ( isset( $args['messages'] ) ) {
29	+ $this->messages = wp_parse_args( $args['messages'], $this->messages );
30	+ }
31	+
32	+ $this->init();
33	+
34	+ }
35	+
36	+ public static function get_instance( $args ) {
37	+ if ( NULL === static::$instance ) {
38	+ static::$instance = new static( $args );
39	+ }
40	+
41	+ return static::$instance;
42	+ }
43	+
44	+ private function init() {
45	+ if ( ! is_admin() ) {
46	+ return;
47	+ }
48	+
49	+ add_action( 'wp_ajax_epsilon_review', array( $this, 'ajax' ) );
50	+
51	+ if ( $this->check() ) {
52	+ add_action( 'admin_notices', array( $this, 'five_star_wp_rate_notice' ) );
53	+ add_action( 'admin_enqueue_scripts', array( $this, 'enqueue' ) );
54	+ add_action( 'admin_print_footer_scripts', array( $this, 'ajax_script' ) );
55	+ }
56	+
57	+ }
58	+
59	+ private function check() {
60	+
61	+ $options = get_option( 'modula-checks' );
62	+ $option = isset( $options['givemereview'] ) ? $options['givemereview'] : '';
63	+
64	+ if ( 'already-rated' == $option ) {
65	+ return false;
66	+ }
67	+
68	+ if ( $this->value == $option ) {
69	+ return false;
70	+ }
71	+
72	+ if ( is_array( $this->when ) ) {
73	+ return in_array( $this->value, $this->when );
74	+ }
75	+
76	+ return ( $this->when == $this->value );
77	+
78	+ }
79	+
80	+ private function value() {
81	+
82	+ $value = get_transient( 'modula-galleries-review' );
83	+
84	+ if ( $value ) {
85	+ return $value;
86	+ }
87	+
88	+ global $wpdb;
89	+ $galleries = $wpdb->get_var( 'SELECT count(Id) FROM ' . $wpdb->ModulaGalleries );
90	+
91	+ set_transient( 'modula-galleries-review', $galleries, 6 * HOUR_IN_SECONDS );
92	+
93	+ return $galleries;
94	+
95	+ }
96	+
97	+ public function five_star_wp_rate_notice() {
98	+
99	+ $url = sprintf( $this->link, $this->slug );
100	+
101	+ ?>
102	+ <div id="<?php echo $this->slug ?>-epsilon-review-notice" class="notice notice-success is-dismissible">
103	+ <p><?php echo sprintf( wp_kses_post( $this->messages['notice'] ), $this->value ) ; ?></p>
104	+ <p class="actions">
105	+ <a id="epsilon-rate" href="<?php echo esc_url( $url ) ?>" class="button button-primary epsilon-review-button"><?php echo esc_html( $this->messages['rate'] ); ?></a>
106	+ <a id="epsilon-rated" href="#" class="button button-secondary epsilon-review-button"><?php echo esc_html( $this->messages['rated'] ); ?></a>
107	+ <a id="epsilon-no-rate" href="#" class="button button-secondary epsilon-review-button"><?php echo esc_html( $this->messages['no_rate'] ); ?></a>
108	+ </p>
109	+ </div>
110	+ <?php
111	+ }
112	+
113	+ public function ajax() {
114	+
115	+ check_ajax_referer( 'epsilon-review', 'security' );
116	+
117	+ $options = get_option( 'modula-checks', array() );
118	+
119	+ if ( isset( $_POST['epsilon-review'] ) ) {
120	+ $options['givemereview'] = 'already-rated';
121	+ }else{
122	+ $options['givemereview'] = $this->value;
123	+ }
124	+
125	+ update_option( 'modula-checks', $options );
126	+
127	+ wp_die( 'ok' );
128	+
129	+ }
130	+
131	+ public function enqueue() {
132	+ wp_enqueue_script( 'jquery' );
133	+ }
134	+
135	+ public function ajax_script() {
136	+
137	+ $ajax_nonce = wp_create_nonce( "epsilon-review" );
138	+
139	+ ?>
140	+
141	+ <script type="text/javascript">
142	+ jQuery( document ).ready( function( $ ){
143	+
144	+ $( '.epsilon-review-button' ).click( function( evt ){
145	+ var href = $(this).attr('href'),
146	+ id = $(this).attr('id');
147	+
148	+ evt.preventDefault();
149	+
150	+ var data = {
151	+ action: 'epsilon_review',
152	+ security: '<?php echo $ajax_nonce; ?>',
153	+ };
154	+
155	+ if ( 'epsilon-rated' === id ) {
156	+ data['epsilon-review'] = 1;
157	+ }
158	+
159	+ $.post( '<?php echo admin_url( 'admin-ajax.php' ) ?>', data, function( response ) {
160	+ $( '#<?php echo $this->slug ?>-epsilon-review-notice' ).slideUp( 'fast', function() {
161	+ $( this ).remove();
162	+ } );
163	+
164	+ if ( 'epsilon-rate' === id ) {
165	+ window.location.href = href;
166	+ }
167	+
168	+ });
169	+
170	+ } );
171	+
172	+ });
173	+ </script>
174	+
175	+ <?php
176	+ }
177	+ }

lib/class-modula-rollback.php ADDED Viewed

	@@ -0,0 +1,178 @@


1	+ <?php
2	+
3	+ if ( ! defined( 'ABSPATH' ) ) {
4	+ exit; // Exit if accessed directly.
5	+ }
6	+
7	+ /**
8	+ * Modula rollback class.
9	+ *
10	+ * EPFW rollback handler class is responsible for rolling back EPFW to
11	+ * previous version.
12	+ *
13	+ * @since 1.0.0
14	+ */
15	+ class Modula_Rollback {
16	+
17	+ /**
18	+ * Package URL.
19	+ *
20	+ * Holds the package URL.
21	+ *
22	+ * @since 1.0.0
23	+ * @access protected
24	+ *
25	+ * @var string Package URL.
26	+ */
27	+ protected $package_url;
28	+
29	+ /**
30	+ * Version.
31	+ *
32	+ * Holds the version.
33	+ *
34	+ * @since 1.0.0
35	+ * @access protected
36	+ *
37	+ * @var string Package URL.
38	+ */
39	+ protected $version;
40	+
41	+ /**
42	+ * Plugin name.
43	+ *
44	+ * Holds the plugin name.
45	+ *
46	+ * @since 1.0.0
47	+ * @access protected
48	+ *
49	+ * @var string Plugin name.
50	+ */
51	+ protected $plugin_name;
52	+
53	+ /**
54	+ * Plugin slug.
55	+ *
56	+ * Holds the plugin slug.
57	+ *
58	+ * @since 1.0.0
59	+ * @access protected
60	+ *
61	+ * @var string Plugin slug.
62	+ */
63	+ protected $plugin_slug;
64	+
65	+ /**
66	+ * Rollback constructor.
67	+ *
68	+ * Initializing EPFW rollback.
69	+ *
70	+ * @since 1.0.0
71	+ * @access public
72	+ *
73	+ * @param array $args Optional. Rollback arguments. Default is an empty array.
74	+ */
75	+ public function __construct( $args = array() ) {
76	+ foreach ( $args as $key => $value ) {
77	+ $this->{$key} = $value;
78	+ }
79	+ }
80	+
81	+ /**
82	+ * Print inline style.
83	+ *
84	+ * Add an inline CSS to the rollback page.
85	+ *
86	+ * @since 1.0.0
87	+ * @access private
88	+ */
89	+ private function print_inline_style() {
90	+ ?>
91	+ <style>
92	+ .wrap {
93	+ overflow: hidden;
94	+ }
95	+
96	+ h1 {
97	+ background: #9b0a46;
98	+ text-align: center;
99	+ color: #fff !important;
100	+ padding: 70px !important;
101	+ text-transform: uppercase;
102	+ letter-spacing: 1px;
103	+ }
104	+
105	+ h1 img {
106	+ max-width: 300px;
107	+ display: block;
108	+ margin: auto auto 50px;
109	+ }
110	+ </style>
111	+ <?php
112	+ }
113	+
114	+ /**
115	+ * Apply package.
116	+ *
117	+ * Change the plugin data when WordPress checks for updates. This method
118	+ * modifies package data to update the plugin from a specific URL containing
119	+ * the version package.
120	+ *
121	+ * @since 1.0.0
122	+ * @access protected
123	+ */
124	+ protected function apply_package() {
125	+ $update_plugins = get_site_transient( 'update_plugins' );
126	+ if ( ! is_object( $update_plugins ) ) {
127	+ $update_plugins = new \stdClass();
128	+ }
129	+
130	+ $plugin_info = new \stdClass();
131	+ $plugin_info->new_version = $this->version;
132	+ $plugin_info->slug = $this->plugin_slug;
133	+ $plugin_info->package = $this->package_url;
134	+
135	+ $update_plugins->response[ $this->plugin_name ] = $plugin_info;
136	+
137	+ set_site_transient( 'update_plugins', $update_plugins );
138	+ }
139	+
140	+ /**
141	+ * Upgrade.
142	+ *
143	+ * Run WordPress upgrade to rollback EPFW to previous version.
144	+ *
145	+ * @since 1.0.0
146	+ * @access protected
147	+ */
148	+ protected function upgrade() {
149	+ require_once( ABSPATH . 'wp-admin/includes/class-wp-upgrader.php' );
150	+
151	+ $logo_url = MODULA_PLUGIN_DIR_URL . 'admin/images/modula.svg';
152	+
153	+ $upgrader_args = array(
154	+ 'url' => 'update.php?action=upgrade-plugin&plugin=' . rawurlencode( $this->plugin_name ),
155	+ 'plugin' => $this->plugin_name,
156	+ 'nonce' => 'upgrade-plugin_' . $this->plugin_name,
157	+ 'title' => '<img src="' . $logo_url . '" alt="Modula">' . __( 'Rollback to Previous Version', 'epfw' ),
158	+ );
159	+
160	+ $this->print_inline_style();
161	+
162	+ $upgrader = new \Plugin_Upgrader( new \Plugin_Upgrader_Skin( $upgrader_args ) );
163	+ $upgrader->upgrade( $this->plugin_name );
164	+ }
165	+
166	+ /**
167	+ * Run.
168	+ *
169	+ * Rollback EPFW to previous versions.
170	+ *
171	+ * @since 1.0.0
172	+ * @access public
173	+ */
174	+ public function run() {
175	+ $this->apply_package();
176	+ $this->upgrade();
177	+ }
178	+ }

lib/install-db.php CHANGED Viewed

	@@ -1,9 +1,7 @@
1	-
2	<?php
3
4
5	- function modula_lite_install_db()
6	- {
7	global $wpdb;
8
9	$ModulaGalleries = $wpdb->ModulaGalleries;



1	<?php
2
3
4	+ function modula_lite_install_db() {

5	global $wpdb;
6
7	$ModulaGalleries = $wpdb->ModulaGalleries;

scripts/rollback.js ADDED Viewed

	@@ -0,0 +1,11 @@


1	+ jQuery(document).ready(function(){
2	+ //rollback function
3	+ jQuery('.modula-rollback-button').on('click', function (event) {
4	+ var checkD = confirm('Are you sure you want to reinstall previous version?');
5	+ if( checkD == true ){
6	+ return true;
7	+ } else {
8	+ return false;
9	+ }
10	+ });
11	+ });

Gallery – Photo Gallery – Image Gallery - Version 1.3.3

Version Description

Release Info

Code changes from version 1.3.2 to 1.3.3