Version Description
- [SUBSCRIBERS] Changed action buttons
- [GENERAL] Reoganization of CSS and removal of unused files
- [DASHBOARD] New window open for links and fix of invalid URLs
- [NEWSLETTERS] New action buttons
- [GENERAL] Minor fixes and optimizations
- [COMPOSER] Fixed rare size error on gif images
Download this release
Release Info
Developer | satollo |
Plugin | Newsletter |
Version | 7.0.8 |
Comparing to | |
See all releases |
Code changes from version 7.0.7 to 7.0.8
- admin-dark.css +34 -0
- admin.css +80 -1094
- admin.js +7 -1
- admin.min.css +0 -1
- admin.min.js +0 -5
- css/controls-dark.css +61 -0
- css/controls.css +146 -0
- css/dashboard.css +1 -106
- css/dashboard.min.css +0 -1
- css/dropdown.css +0 -14
- css/extensions.css +150 -0
- css/fields.css +1 -9
- css/fields.min.css +0 -1
- css/tabs.css +94 -0
- css/welcome.css +348 -0
- emails/edit.php +9 -8
- emails/index.php +13 -12
- emails/new.php +15 -0
- emails/subjects.php +0 -10
- emails/tnp-composer/_css/newsletter-builder-v2.css +0 -9
- emails/tnp-composer/_css/newsletter-builder-v2.min.css +0 -1
- emails/tnp-composer/_css/newsletter-builder.css +0 -9
- emails/tnp-composer/_scripts/newsletter-builder-v2.min.js +0 -26
- emails/tnp-composer/_scripts/newsletter-builder.js +0 -2
- emails/tnp-composer/_scripts/newsletter-builder.min.js +0 -18
- emails/tnp-composer/index-v2.php +21 -8
- includes/PHPMailerLoader.php +40 -40
- includes/composer.php +121 -142
- includes/controls.php +245 -143
- includes/helper.php +3 -0
- includes/mailer.php +547 -547
- includes/module.php +19 -5
- main/extensions.php +0 -46
- main/index.php +15 -11
- main/info.php +2 -2
- main/logs.php +57 -0
- main/main.php +2 -2
- main/status.php +0 -16
- main/welcome.php +3 -1
- plugin.php +20 -16
- readme.txt +10 -1
- style.min.css +0 -1
- subscription/profile.php +31 -31
- subscription/subscription.php +14 -15
- tnp-header.php +8 -2
- users/edit.php +1 -1
- users/import.php +3 -3
- users/index.php +12 -12
- vendor/select2/LICENSE +0 -18
- vendor/select2/LICENSE.md +21 -0
- vendor/select2/css/select2.min.css +1 -0
- vendor/select2/js/select2.min.js +2 -0
- vendor/select2/select2-spinner.gif +0 -0
- vendor/select2/select2.css +0 -692
- vendor/select2/select2.js +0 -3729
- vendor/select2/select2.min.js +0 -23
- vendor/select2/select2.png +0 -0
- vendor/select2/select2x2.png +0 -0
admin-dark.css
ADDED
@@ -0,0 +1,34 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
@import "css/controls-dark.css";
|
2 |
+
|
3 |
+
#tnp-body {
|
4 |
+
background-color: transparent;
|
5 |
+
}
|
6 |
+
|
7 |
+
/* Tabs */
|
8 |
+
#tnp-body #tabs p {
|
9 |
+
color: #999;
|
10 |
+
}
|
11 |
+
|
12 |
+
#tnp-body #tabs .ui-tabs-panel {
|
13 |
+
background-color: transparent;
|
14 |
+
padding-left: 0 !important;
|
15 |
+
}
|
16 |
+
|
17 |
+
#tnp-body #tabs .ui-widget-header .ui-state-default {
|
18 |
+
background-color: transparent;
|
19 |
+
}
|
20 |
+
|
21 |
+
#tnp-body #tabs .ui-widget-header .ui-state-default a {
|
22 |
+
color: #fff;
|
23 |
+
}
|
24 |
+
|
25 |
+
#tnp-body #tabs .ui-widget-header .ui-state-active a {
|
26 |
+
color: #fff;
|
27 |
+
background-color: #28313C;
|
28 |
+
}
|
29 |
+
|
30 |
+
#tnp-body #tabs h3,
|
31 |
+
#tnp-body #tabs h4 {
|
32 |
+
color: #fff;
|
33 |
+
}
|
34 |
+
|
admin.css
CHANGED
@@ -1,4 +1,7 @@
|
|
1 |
-
/*
|
|
|
|
|
|
|
2 |
|
3 |
#tnp-wrap * {
|
4 |
-webkit-box-sizing: border-box;
|
@@ -6,13 +9,6 @@
|
|
6 |
box-sizing: border-box;
|
7 |
}
|
8 |
|
9 |
-
/* Color picker patch */
|
10 |
-
#tnp-wrap .iris-picker, #tnp-wrap .iris-picker * {
|
11 |
-
-moz-box-sizing: content-box;
|
12 |
-
-webkit-box-sizing: content-box;
|
13 |
-
box-sizing: content-box;
|
14 |
-
}
|
15 |
-
|
16 |
#tnp-wrap *:before,
|
17 |
#tnp-wrap *:after {
|
18 |
-webkit-box-sizing: border-box;
|
@@ -20,10 +16,23 @@
|
|
20 |
box-sizing: border-box;
|
21 |
}
|
22 |
|
23 |
-
|
24 |
-
|
25 |
-
|
26 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27 |
|
28 |
.container {
|
29 |
width: 100%;
|
@@ -124,31 +133,6 @@
|
|
124 |
margin-top: 80px;
|
125 |
}
|
126 |
|
127 |
-
|
128 |
-
|
129 |
-
#tnp-wrap,
|
130 |
-
#tnp-header,
|
131 |
-
#tnp-body p,
|
132 |
-
#tnp-body td,
|
133 |
-
#tnp-body td p,
|
134 |
-
#tnp-body input,
|
135 |
-
#tnp-body select,
|
136 |
-
#tnp-body textarea {
|
137 |
-
font-family: soleil, sans-serif;
|
138 |
-
-webkit-font-smoothing: antialiased; /* Chrome, Safari */
|
139 |
-
-moz-osx-font-smoothing: grayscale; /* Firefox */
|
140 |
-
}
|
141 |
-
|
142 |
-
#tnp-body h1,
|
143 |
-
#tnp-body h2,
|
144 |
-
#tnp-body h3,
|
145 |
-
#tnp-body h4 {
|
146 |
-
font-family: soleil, sans-serif;
|
147 |
-
-webkit-font-smoothing: antialiased; /* Chrome, Safari */
|
148 |
-
-moz-osx-font-smoothing: grayscale; /* Firefox */
|
149 |
-
}
|
150 |
-
|
151 |
-
|
152 |
#tnp-promotion-bar {
|
153 |
background-color: #FF5F65;
|
154 |
color: ddd;
|
@@ -180,7 +164,6 @@
|
|
180 |
|
181 |
#tnp-header a {
|
182 |
text-decoration: none;
|
183 |
-
/*font-family: soleil,sans-serif;*/
|
184 |
color: white;
|
185 |
letter-spacing: 0.1em;
|
186 |
}
|
@@ -197,34 +180,15 @@
|
|
197 |
color: #000!important;
|
198 |
}
|
199 |
|
200 |
-
|
201 |
-
|
202 |
-
|
203 |
-
padding: 15px;
|
204 |
-
margin: 15px 0;
|
205 |
-
font-size: 1.2em;
|
206 |
-
line-height: 1.5em;
|
207 |
-
}
|
208 |
-
|
209 |
-
.tnp-warning {
|
210 |
-
border-left: 5px solid #ffb900;
|
211 |
-
background-color: #fff;
|
212 |
-
padding: 15px;
|
213 |
-
margin: 15px 0;
|
214 |
-
font-size: 1.2em;
|
215 |
-
line-height: 1.5em;
|
216 |
-
}
|
217 |
|
218 |
-
|
219 |
-
|
220 |
-
background-color: #
|
221 |
-
padding: 15px;
|
222 |
-
margin: 15px 0;
|
223 |
-
font-size: 1.2em;
|
224 |
-
line-height: 1.5em;
|
225 |
}
|
226 |
|
227 |
-
/* Default font colors for our dark background page body */
|
228 |
#tnp-body h1,
|
229 |
#tnp-body h2,
|
230 |
#tnp-body h3,
|
@@ -233,6 +197,13 @@
|
|
233 |
color: #fff;
|
234 |
}
|
235 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
236 |
#tnp-body ul {
|
237 |
list-style-type: circle;
|
238 |
list-style-position: inside;
|
@@ -259,14 +230,21 @@
|
|
259 |
#tnp-body .button:focus,
|
260 |
#tnp-body .button-primary,
|
261 |
#tnp-body .button-primary:visited,
|
262 |
-
#tnp-body .button-primary:hover
|
|
|
|
|
|
|
|
|
|
|
|
|
263 |
#tnp-body .button-secondary,
|
264 |
#tnp-body .button-secondary:visited,
|
265 |
#tnp-body .button-secondary:hover {
|
266 |
color: #fff;
|
267 |
-
background-color: #
|
268 |
text-shadow: none;
|
269 |
width: auto;
|
|
|
270 |
}
|
271 |
|
272 |
/* Icon in button media selector */
|
@@ -290,14 +268,6 @@
|
|
290 |
width: auto;
|
291 |
}
|
292 |
|
293 |
-
/* Form tables correction */
|
294 |
-
#tnp-body .form-table h1,
|
295 |
-
#tnp-body .form-table h2,
|
296 |
-
#tnp-body .form-table h4,
|
297 |
-
#tnp-body .form-table h3 {
|
298 |
-
color: #444;
|
299 |
-
}
|
300 |
-
|
301 |
#tnp-body tbody th,
|
302 |
#tnp-body td,
|
303 |
#tnp-body td p,
|
@@ -314,52 +284,6 @@
|
|
314 |
color: #27AE60; /* Green */
|
315 |
}
|
316 |
|
317 |
-
|
318 |
-
/* Tables of class form-table */
|
319 |
-
#tnp-body .form-table {
|
320 |
-
background-color: #fff;
|
321 |
-
border: 1px solid #ECF0F1;
|
322 |
-
margin-top: 2em;
|
323 |
-
border-spacing: 4px;
|
324 |
-
border-collapse: separate;
|
325 |
-
}
|
326 |
-
|
327 |
-
#tnp-body .form-table th {
|
328 |
-
text-align: right;
|
329 |
-
font-weight: bold;
|
330 |
-
max-width: 200px;
|
331 |
-
color: #000000;
|
332 |
-
background-color: #ECF0F1;
|
333 |
-
vertical-align: middle;
|
334 |
-
}
|
335 |
-
|
336 |
-
#tnp-body .form-table th small {
|
337 |
-
font-weight: normal;
|
338 |
-
}
|
339 |
-
|
340 |
-
#tnp-body .form-table textarea {
|
341 |
-
width: 100%;
|
342 |
-
}
|
343 |
-
|
344 |
-
/* Table inside a field form table to create a grid of options */
|
345 |
-
#tnp-body .form-table table {
|
346 |
-
border-collapse: collapse;
|
347 |
-
}
|
348 |
-
|
349 |
-
#tnp-body .form-table table td,
|
350 |
-
.form-table table th {
|
351 |
-
padding: 5px;
|
352 |
-
font-size: .9em;
|
353 |
-
font-weight: normal;
|
354 |
-
border: 1px solid #eee;
|
355 |
-
}
|
356 |
-
|
357 |
-
#tnp-body .form-table table thead th {
|
358 |
-
text-align: left;
|
359 |
-
font-weight: bold;
|
360 |
-
}
|
361 |
-
|
362 |
-
|
363 |
/*******************************************************************************
|
364 |
* Wide fat tables
|
365 |
*/
|
@@ -391,44 +315,7 @@
|
|
391 |
background-color: #f4faff;
|
392 |
}
|
393 |
|
394 |
-
#tnp-body .widefat.tnp-newsletters-list tbody tr {
|
395 |
-
height: 70px;
|
396 |
-
}
|
397 |
-
|
398 |
-
/* jQuery UI tabs corrections */
|
399 |
-
#tnp-body #tabs h3,
|
400 |
-
#tnp-body #tabs h4,
|
401 |
-
#tnp-body #tabs p,
|
402 |
-
#tnp-body #tabs li
|
403 |
-
{
|
404 |
-
color: #444;
|
405 |
-
}
|
406 |
-
|
407 |
-
/* Button correction */
|
408 |
-
#tnp-body #tabs .button,
|
409 |
-
#tnp-body #tabs .button:visited,
|
410 |
-
#tnp-body #tabs .button:hover,
|
411 |
-
#tnp-body #tabs .button-primary,
|
412 |
-
#tnp-body #tabs .button-primary:visited,
|
413 |
-
#tnp-body #tabs .button-primary:hover,
|
414 |
-
#tnp-body #tabs .button-secondary,
|
415 |
-
#tnp-body #tabs .button-secondary:visited,
|
416 |
-
#tnp-body #tabs .button-secondary:hover {
|
417 |
-
color: #fff;
|
418 |
-
width: auto;
|
419 |
-
}
|
420 |
-
|
421 |
-
#tnp-body td .tnp-tabs {
|
422 |
-
|
423 |
-
}
|
424 |
-
|
425 |
-
#tnp-body td .tnp-tabs .ui-widget-header {
|
426 |
-
background-color: #ddd;
|
427 |
-
}
|
428 |
|
429 |
-
#tnp-body td .tnp-tabs .ui-tabs-anchor {
|
430 |
-
color: #000;
|
431 |
-
}
|
432 |
|
433 |
table.clicks td {
|
434 |
border: 1px solid #666;
|
@@ -452,74 +339,9 @@ table.clicks {
|
|
452 |
background-color: #aaa;
|
453 |
}
|
454 |
|
455 |
-
.tnp-checkboxes label {
|
456 |
-
display: block;
|
457 |
-
float: left;
|
458 |
-
width: 220px;
|
459 |
-
border: 1px solid #ccc;
|
460 |
-
background-color: #f4f4f4;
|
461 |
-
margin-bottom: 5px;
|
462 |
-
padding: 5px;
|
463 |
-
white-space: nowrap;
|
464 |
-
margin-right: 5px;
|
465 |
-
}
|
466 |
-
|
467 |
.tnp-buttons {
|
468 |
/*background-color: #0073aa;*/
|
469 |
-
padding: 10px;
|
470 |
-
}
|
471 |
-
|
472 |
-
.newsletter-checkbox-group, .nl-checkbox-group {
|
473 |
-
float: left;
|
474 |
-
margin-right: 5px;
|
475 |
-
border: 1px solid #ccc;
|
476 |
-
background-color: #f4f4f4;
|
477 |
-
margin-bottom: 5px;
|
478 |
-
padding: 5px;
|
479 |
-
white-space: nowrap;
|
480 |
-
overflow: hidden;
|
481 |
-
}
|
482 |
-
|
483 |
-
/* Checkbox group */
|
484 |
-
.newsletter-checkboxes-item {
|
485 |
-
float: left;
|
486 |
-
margin-right: 5px;
|
487 |
-
border: 1px solid #ddd;
|
488 |
-
border-radius: 3px;
|
489 |
-
background-color: #f4f4f4;
|
490 |
-
width: 150px;
|
491 |
-
margin-bottom: 5px;
|
492 |
-
padding: 3px;
|
493 |
-
white-space: nowrap;
|
494 |
-
overflow: hidden;
|
495 |
-
}
|
496 |
-
|
497 |
-
.newsletter-checkboxes-item input {
|
498 |
-
vertical-align: text-bottom;
|
499 |
-
}
|
500 |
-
|
501 |
-
.newsletter-checkboxes-item label {
|
502 |
-
display: inline;
|
503 |
-
}
|
504 |
-
|
505 |
-
.newsletter-preferences-item {
|
506 |
-
float: left;
|
507 |
-
margin-right: 5px;
|
508 |
-
border: 1px solid #ccc;
|
509 |
-
background-color: #f4f4f4;
|
510 |
-
width: 250px;
|
511 |
-
margin-bottom: 5px;
|
512 |
-
padding: 5px;
|
513 |
-
white-space: nowrap;
|
514 |
-
overflow: hidden;
|
515 |
-
}
|
516 |
-
|
517 |
-
.newsletter-preferences-item label {
|
518 |
-
display: inline;
|
519 |
-
}
|
520 |
-
|
521 |
-
.form-table td .nl-checkbox-group label {
|
522 |
-
display: inline;
|
523 |
}
|
524 |
|
525 |
|
@@ -527,14 +349,6 @@ table.clicks {
|
|
527 |
|
528 |
|
529 |
|
530 |
-
|
531 |
-
/*
|
532 |
-
.form-table td label {
|
533 |
-
font-size: 10px;
|
534 |
-
display: block;
|
535 |
-
}
|
536 |
-
*/
|
537 |
-
|
538 |
.tnp-notice {
|
539 |
padding: 15px;
|
540 |
margin: 10px 0;
|
@@ -583,72 +397,11 @@ table.clicks {
|
|
583 |
cursor: pointer;
|
584 |
}
|
585 |
|
586 |
-
|
587 |
-
|
588 |
-
.newsletter-message {
|
589 |
-
background-color: #efe;
|
590 |
-
border-color: #393;
|
591 |
-
border-radius: 5px;
|
592 |
-
border-style: solid;
|
593 |
-
border-width: 3px;
|
594 |
-
padding: .6em;
|
595 |
-
margin-bottom: .6em;
|
596 |
-
}
|
597 |
-
|
598 |
-
.newsletter-error-span {
|
599 |
-
color: #f00;
|
600 |
-
font-weight: bold;
|
601 |
-
}
|
602 |
-
|
603 |
-
.newsletter-error {
|
604 |
-
background-color: #fee;
|
605 |
-
border-color: #933;
|
606 |
-
border-radius: 5px;
|
607 |
-
border-style: solid;
|
608 |
-
border-width: 2px;
|
609 |
-
padding: .6em;
|
610 |
-
margin-bottom: .6em;
|
611 |
-
}
|
612 |
-
|
613 |
-
.newsletter-error strong, .newsletter-message strong {
|
614 |
-
font-weight: bold;
|
615 |
-
}
|
616 |
-
|
617 |
-
#newsletter-warnings {
|
618 |
-
background-color: #FFEBE8;
|
619 |
-
border-color: #C00;
|
620 |
-
border-radius: 3px;
|
621 |
-
border-style: solid;
|
622 |
-
border-width: 1px;
|
623 |
-
padding: .6em;
|
624 |
-
margin-bottom: .6em;
|
625 |
-
}
|
626 |
-
|
627 |
-
.newsletter-buttons {
|
628 |
-
margin-top: 1em;
|
629 |
-
margin-bottom: 1em;
|
630 |
-
}
|
631 |
-
|
632 |
.tnp-paginator {
|
633 |
margin-top: 10px;
|
634 |
margin-bottom: 5px;
|
635 |
}
|
636 |
|
637 |
-
.newsletter-option-grid th {
|
638 |
-
text-align: right;
|
639 |
-
width: auto;
|
640 |
-
border: 0;
|
641 |
-
padding: 3px;
|
642 |
-
font-weight: normal;
|
643 |
-
vertical-align: top;
|
644 |
-
padding-right: 15px;
|
645 |
-
}
|
646 |
-
.newsletter-option-grid td {
|
647 |
-
border: 0;
|
648 |
-
padding: 3px;
|
649 |
-
vertical-align: top;
|
650 |
-
}
|
651 |
-
|
652 |
.newsletter-box {
|
653 |
border: 1px solid #ddd;
|
654 |
padding: 10px;
|
@@ -732,9 +485,7 @@ table.clicks {
|
|
732 |
|
733 |
/* CSS General Font Styles */
|
734 |
|
735 |
-
|
736 |
-
font-size: 12px !important;
|
737 |
-
}
|
738 |
|
739 |
|
740 |
/* CSS Themes Preview */
|
@@ -786,29 +537,7 @@ p.description {
|
|
786 |
}
|
787 |
|
788 |
|
789 |
-
/* Regole Generali*/
|
790 |
|
791 |
-
#tnp-body {
|
792 |
-
padding: 10px;
|
793 |
-
background-color: #28313C;
|
794 |
-
/*border-color: 10px solid #28313C;*/
|
795 |
-
}
|
796 |
-
|
797 |
-
.tnp-darkbg {
|
798 |
-
background-color: #34495E!important;
|
799 |
-
}
|
800 |
-
|
801 |
-
#tnp-body h3 {
|
802 |
-
margin-top: 25px;
|
803 |
-
clear: both;
|
804 |
-
/* display: inline-block; */
|
805 |
-
/* background-color: #34495E; */
|
806 |
-
/* color: #fff !important; */
|
807 |
-
margin-bottom: 10px;
|
808 |
-
/* width: 200px;*/
|
809 |
-
/* text-align: right; */
|
810 |
-
/* border-bottom: 2px solid #27AE60;*/
|
811 |
-
}
|
812 |
|
813 |
|
814 |
.tnp-body-lite {
|
@@ -840,6 +569,12 @@ p.description {
|
|
840 |
color: #565656;
|
841 |
}
|
842 |
|
|
|
|
|
|
|
|
|
|
|
|
|
843 |
#tnp-heading h2 {
|
844 |
color: #fff;
|
845 |
font-family: soleil, sans-serif;
|
@@ -1030,12 +765,6 @@ p.description {
|
|
1030 |
border-left: 3px solid #2ECC71;
|
1031 |
}
|
1032 |
|
1033 |
-
/* Wrapper Background */
|
1034 |
-
|
1035 |
-
#wpwrap {
|
1036 |
-
background-color: #222B36 !important;
|
1037 |
-
}
|
1038 |
-
|
1039 |
/* Global buttons styles */
|
1040 |
|
1041 |
#dashboard-widgets .button {
|
@@ -1059,15 +788,7 @@ p.description {
|
|
1059 |
width: auto;
|
1060 |
}
|
1061 |
|
1062 |
-
.wp-core-ui .button-secondary, .wp-core-ui .button
|
1063 |
-
background-color: #3498db;
|
1064 |
-
box-shadow: none;
|
1065 |
-
color: #fff;
|
1066 |
-
font-family: soleil,sans-serif;
|
1067 |
-
margin: 0px 2px;
|
1068 |
-
}
|
1069 |
-
|
1070 |
-
.wp-core-ui .button-secondary:hover, .wp-core-ui .button:hover, .wp-core-ui .button-primary:hover {
|
1071 |
background-color: #5DADE2;
|
1072 |
color: #fff;
|
1073 |
width: auto;
|
@@ -1288,730 +1009,42 @@ table.widefat {
|
|
1288 |
margin: 5px;
|
1289 |
}
|
1290 |
|
1291 |
-
/*******************************************************************************
|
1292 |
-
* Overrides some jQuery UI styles, specially for tabs and only inside the
|
1293 |
-
* #tnp-body div
|
1294 |
-
*/
|
1295 |
-
|
1296 |
-
#tnp-body .ui-widget {
|
1297 |
-
font-family: soleil, sans-serif;
|
1298 |
-
}
|
1299 |
-
|
1300 |
-
#tnp-body #tabs {
|
1301 |
-
background-color: transparent;
|
1302 |
-
border: 0!important;
|
1303 |
-
padding: 0;
|
1304 |
-
margin: 0;
|
1305 |
-
}
|
1306 |
|
1307 |
-
|
1308 |
-
background: #28313C;
|
1309 |
-
border: 0;
|
1310 |
-
}
|
1311 |
|
1312 |
-
|
1313 |
-
|
1314 |
-
|
|
|
|
|
|
|
|
|
1315 |
}
|
1316 |
|
1317 |
-
|
1318 |
-
|
1319 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
1320 |
}
|
1321 |
|
1322 |
-
|
1323 |
-
|
1324 |
}
|
1325 |
|
1326 |
-
|
1327 |
-
|
1328 |
-
|
1329 |
-
|
1330 |
-
|
1331 |
-
|
1332 |
-
|
1333 |
-
|
1334 |
-
|
1335 |
-
|
1336 |
-
#tnp-body #tabs .ui-tabs .ui-tabs-nav {
|
1337 |
-
margin: 0;
|
1338 |
-
padding: .2em .2em 0 0;
|
1339 |
-
background-color: #f2f2f2;
|
1340 |
-
}
|
1341 |
-
|
1342 |
-
#tnp-body #tabs .ui-tabs .ui-tabs-panel {
|
1343 |
-
padding: 1em 0;
|
1344 |
-
background-color: #f2f2f2;
|
1345 |
-
margin: 0;
|
1346 |
-
border: 0;
|
1347 |
-
}
|
1348 |
-
|
1349 |
-
#tnp-body .ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active {
|
1350 |
-
background: #fff !important;
|
1351 |
-
font-weight: normal;
|
1352 |
-
font-family: soleil, sans-serif;
|
1353 |
-
}
|
1354 |
-
|
1355 |
-
|
1356 |
-
#tnp-body .ui-widget-content {
|
1357 |
-
background: #fff;
|
1358 |
-
}
|
1359 |
-
|
1360 |
-
#tnp-body .ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default {
|
1361 |
-
border: none;
|
1362 |
-
background: #ECF0F1;
|
1363 |
-
font-family: soleil, sans-serif;
|
1364 |
-
}
|
1365 |
-
|
1366 |
-
|
1367 |
-
/*******************************************************************************
|
1368 |
-
* Extension Panel
|
1369 |
-
*/
|
1370 |
-
|
1371 |
-
.tnp-extension-premium-box, .tnp-extension-free-box, .tnp-integration-box {
|
1372 |
-
width: 300px;
|
1373 |
-
height: 220px;
|
1374 |
-
background-color: #222B36;
|
1375 |
-
text-align: center;
|
1376 |
-
margin: 20px;
|
1377 |
-
float: left;
|
1378 |
-
position: relative;
|
1379 |
-
}
|
1380 |
-
|
1381 |
-
.tnp-extension-premium-box:hover, .tnp-extension-free-box:hover, .tnp-integration-box:hover {
|
1382 |
-
background-color: #232C35;
|
1383 |
-
box-shadow: 1px 1px 15px #222B36;
|
1384 |
-
}
|
1385 |
-
|
1386 |
-
.tnp-extension-premium-box p, .tnp-extension-free-box p, .tnp-integration-box p {
|
1387 |
-
padding: 5px 10px;
|
1388 |
-
color: #72777c;
|
1389 |
-
font-size: 14px;
|
1390 |
-
margin-top: 0px;
|
1391 |
-
}
|
1392 |
-
|
1393 |
-
.tnp-extension-premium-box h3 {
|
1394 |
-
font-family: soleil, sans-serif;
|
1395 |
-
padding: 5px 8px !important;
|
1396 |
-
border-radius: 3px;
|
1397 |
-
display: inline-block;
|
1398 |
-
font-size: 16px;
|
1399 |
-
color: #fff;
|
1400 |
-
margin-bottom: 0px !important;
|
1401 |
-
margin-top: 25px !important;
|
1402 |
-
font-weight: 300;
|
1403 |
-
width: auto !important;
|
1404 |
-
border-bottom: none !important;
|
1405 |
-
}
|
1406 |
-
|
1407 |
-
.tnp-extension-free-box h3 {
|
1408 |
-
font-family: soleil, sans-serif;
|
1409 |
-
padding: 5px 8px !important;
|
1410 |
-
border-radius: 3px;
|
1411 |
-
display: inline-block;
|
1412 |
-
font-size: 16px;
|
1413 |
-
color: #fff;
|
1414 |
-
margin-bottom: 0px !important;
|
1415 |
-
margin-top: 25px !important;
|
1416 |
-
font-weight: 300;
|
1417 |
-
width: auto !important;
|
1418 |
-
border-bottom: none !important;
|
1419 |
-
}
|
1420 |
-
|
1421 |
-
.tnp-integration-box h3 {
|
1422 |
-
font-family: soleil, sans-serif;
|
1423 |
-
padding: 5px 8px !important;
|
1424 |
-
border-radius: 3px;
|
1425 |
-
display: inline-block;
|
1426 |
-
font-size: 16px;
|
1427 |
-
color: #fff;
|
1428 |
-
margin-bottom: 0px !important;
|
1429 |
-
margin-top: 25px !important;
|
1430 |
-
font-weight: 300;
|
1431 |
-
width: auto !important;
|
1432 |
-
border-bottom: none !important;
|
1433 |
-
}
|
1434 |
-
|
1435 |
-
.tnp-extension-premium-action {
|
1436 |
-
bottom: 0;
|
1437 |
-
position: absolute;
|
1438 |
-
width: 100%;
|
1439 |
-
padding: 12px;
|
1440 |
-
font-family: soleil, sans-serif;
|
1441 |
-
}
|
1442 |
-
|
1443 |
-
.tnp-extension-free-action {
|
1444 |
-
bottom: 0;
|
1445 |
-
position: absolute;
|
1446 |
-
width: 100%;
|
1447 |
-
padding: 12px;
|
1448 |
-
font-family: soleil, sans-serif;
|
1449 |
-
}
|
1450 |
-
|
1451 |
-
.tnp-integration-action {
|
1452 |
-
bottom: 0;
|
1453 |
-
position: absolute;
|
1454 |
-
width: 100%;
|
1455 |
-
padding: 12px;
|
1456 |
-
font-family: soleil, sans-serif;
|
1457 |
-
}
|
1458 |
-
|
1459 |
-
|
1460 |
-
.tnp-extension-premium-action span {
|
1461 |
-
color: #27AE60;
|
1462 |
-
}
|
1463 |
-
|
1464 |
-
.tnp-extension-free-action span {
|
1465 |
-
color: #27AE60;
|
1466 |
-
}
|
1467 |
-
|
1468 |
-
.tnp-integration-action span {
|
1469 |
-
color: #27AE60;
|
1470 |
-
}
|
1471 |
-
|
1472 |
-
.tnp-extension-activate {
|
1473 |
-
color: #1ABC9C;
|
1474 |
-
padding: 5px 8px;
|
1475 |
-
text-decoration: none;
|
1476 |
-
cursor: pointer;
|
1477 |
-
}
|
1478 |
-
|
1479 |
-
.tnp-extension-install {
|
1480 |
-
color: #2980B9;
|
1481 |
-
padding: 5px 8px;
|
1482 |
-
text-decoration: none;
|
1483 |
-
cursor: pointer;
|
1484 |
-
}
|
1485 |
-
|
1486 |
-
.tnp-extension-buy {
|
1487 |
-
color: #F1C40F;
|
1488 |
-
padding: 5px 8px;
|
1489 |
-
text-decoration: none;
|
1490 |
-
cursor: pointer;
|
1491 |
-
}
|
1492 |
-
|
1493 |
-
#tnp-body a.tnp-extension-details{
|
1494 |
-
color: #999999;
|
1495 |
-
padding: 5px 8px;
|
1496 |
-
text-decoration: none;
|
1497 |
-
cursor: pointer;
|
1498 |
-
}
|
1499 |
-
|
1500 |
-
.tnp-extension-free {
|
1501 |
-
color: #D35400;
|
1502 |
-
padding: 5px 8px;
|
1503 |
-
text-decoration: none;
|
1504 |
-
cursor: pointer;
|
1505 |
-
position: relative;
|
1506 |
-
}
|
1507 |
-
|
1508 |
-
img.tnp-extensions-free-badge {
|
1509 |
-
position: absolute;
|
1510 |
-
display: block;
|
1511 |
-
right: 0;
|
1512 |
-
top: 0;
|
1513 |
-
width: 70px;
|
1514 |
-
}
|
1515 |
-
|
1516 |
-
.tnp-extensions-image img {
|
1517 |
-
margin: 25px 0px -10px;
|
1518 |
-
}
|
1519 |
-
|
1520 |
-
/* Subscription modal for free extensions */
|
1521 |
-
#tnp-subscribe-overlay {
|
1522 |
-
height: 100vh;
|
1523 |
-
width: 100vw;
|
1524 |
-
z-index: 10000;
|
1525 |
-
display: none;
|
1526 |
-
background-image: url(images/modal-background.png);
|
1527 |
-
background-repeat: repeat;
|
1528 |
-
position: fixed;
|
1529 |
-
top: 0;
|
1530 |
-
left: -20px;
|
1531 |
-
}
|
1532 |
-
|
1533 |
-
#tnp-subscribe-modal {
|
1534 |
-
width: 600px;
|
1535 |
-
background-color: rgba(255,255,255,1);
|
1536 |
-
margin-right: auto;
|
1537 |
-
margin-left: auto;
|
1538 |
-
margin-top: 100px;
|
1539 |
-
-webkit-box-shadow: 0px 0px 20px 0px rgba(0,0,0,0.5);
|
1540 |
-
-moz-box-shadow: 0px 0px 20px 0px rgba(0,0,0,0.5);
|
1541 |
-
box-shadow: 0px 0px 20px 0px rgba(0,0,0,0.5);
|
1542 |
-
padding: 25px;
|
1543 |
-
background-color: #1D2B38;
|
1544 |
-
|
1545 |
-
text-align: center;
|
1546 |
-
}
|
1547 |
-
|
1548 |
-
#tnp-subscribe-modal img {
|
1549 |
-
width: 30%;
|
1550 |
-
}
|
1551 |
-
|
1552 |
-
#tnp-subscribe-title {
|
1553 |
-
font-size: 20px;
|
1554 |
-
margin-top: 30px;
|
1555 |
-
margin-bottom: 30px;
|
1556 |
-
line-height: 30px;
|
1557 |
-
color: white;
|
1558 |
-
font-weight: 200;
|
1559 |
-
}
|
1560 |
-
|
1561 |
-
#tnp-subscribe-email-wrapper {
|
1562 |
-
margin: 20px;
|
1563 |
-
}
|
1564 |
-
|
1565 |
-
#tnp-subscribe-email-wrapper input {
|
1566 |
-
border: none;
|
1567 |
-
background-color: #223242;
|
1568 |
-
color: white;
|
1569 |
-
}
|
1570 |
-
|
1571 |
-
#tnp-subscribe-email {
|
1572 |
-
font-size: 24px;
|
1573 |
-
box-sizing: border-box;
|
1574 |
-
width: 100%;
|
1575 |
-
padding: 10px;
|
1576 |
-
text-align: center;
|
1577 |
-
}
|
1578 |
-
|
1579 |
-
#tnp-subscribe-submit-wrapper {
|
1580 |
-
margin-bottom: 20px;
|
1581 |
-
}
|
1582 |
-
|
1583 |
-
#tnp-subscribe-submit {
|
1584 |
-
font-size: 24px;
|
1585 |
-
background-color: #219050;
|
1586 |
-
color: #fff;
|
1587 |
-
padding: 10px 35px;
|
1588 |
-
border: 0;
|
1589 |
-
font-size: 17px;
|
1590 |
-
letter-spacing: 2px;
|
1591 |
-
}
|
1592 |
-
|
1593 |
-
#tnp-subscribe-no-thanks {
|
1594 |
-
color: #666;
|
1595 |
-
margin-top: 20px;
|
1596 |
-
margin-bottom: 20px;
|
1597 |
-
}
|
1598 |
-
|
1599 |
-
|
1600 |
-
/* Theme options and theme preview styles */
|
1601 |
-
|
1602 |
-
#tnp-body div.tnp-emails-theme-options {
|
1603 |
-
background-color: #fff;
|
1604 |
-
padding: 10px;
|
1605 |
-
margin-top: 14px;
|
1606 |
-
}
|
1607 |
-
|
1608 |
-
.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default {
|
1609 |
-
border: none;
|
1610 |
-
background: #ECF0F1;
|
1611 |
-
font-family: soleil, sans-serif;
|
1612 |
-
}
|
1613 |
-
|
1614 |
-
|
1615 |
-
|
1616 |
-
/* --------------------------------
|
1617 |
-
|
1618 |
-
Tnp Welcome Slider
|
1619 |
-
|
1620 |
-
-------------------------------- */
|
1621 |
-
|
1622 |
-
.cd-slider-wrapper {
|
1623 |
-
position: relative;
|
1624 |
-
width: 100%;
|
1625 |
-
height: 90vh;
|
1626 |
-
/* hide horizontal scrollbar on IE11 */
|
1627 |
-
overflow: hidden;
|
1628 |
-
margin: 0 auto;
|
1629 |
-
}
|
1630 |
-
.cd-slider-wrapper .cd-slider, .cd-slider-wrapper .cd-slider > li {
|
1631 |
-
height: 100%;
|
1632 |
-
width: 100%;
|
1633 |
-
}
|
1634 |
-
|
1635 |
-
.tnp-logo-big {
|
1636 |
-
width: 300px;
|
1637 |
-
}
|
1638 |
-
|
1639 |
-
.tnp-row {
|
1640 |
-
display: table-row;
|
1641 |
-
}
|
1642 |
-
|
1643 |
-
.tnp-third {
|
1644 |
-
width: 33%;
|
1645 |
-
float: left;
|
1646 |
-
}
|
1647 |
-
|
1648 |
-
.tnp-welcome-confirm-button {
|
1649 |
-
color: #fff;
|
1650 |
-
padding: 10px 30px;
|
1651 |
-
background-color: #2ECC71;
|
1652 |
-
font-weight: 700;
|
1653 |
-
font-size: 15px;
|
1654 |
-
box-shadow: 0 20px 38px rgba(0, 0, 0, 0.16);
|
1655 |
-
text-decoration: none;
|
1656 |
-
display: inline-block;
|
1657 |
-
text-align: center;
|
1658 |
-
margin: 20px auto 0px;
|
1659 |
-
}
|
1660 |
-
|
1661 |
-
.tnp-welcome-confirm-button:hover {
|
1662 |
-
box-shadow: 0 0 38px rgba(0, 0, 0, 0.16);
|
1663 |
-
color: #fff;
|
1664 |
-
}
|
1665 |
-
|
1666 |
-
.tnp-welcome-confirm-button:visited {
|
1667 |
-
color: #fff;
|
1668 |
-
text-decoration: none;
|
1669 |
-
}
|
1670 |
-
|
1671 |
-
.tnp-welcome-link-button {
|
1672 |
-
color: #fff;
|
1673 |
-
padding: 10px 30px;
|
1674 |
-
background-color: #3498DB;
|
1675 |
-
font-weight: 700;
|
1676 |
-
font-size: 15px;
|
1677 |
-
box-shadow: 0 20px 38px rgba(0, 0, 0, 0.16);
|
1678 |
-
text-decoration: none;
|
1679 |
-
}
|
1680 |
-
|
1681 |
-
.tnp-welcome-link-button:hover {
|
1682 |
-
box-shadow: 0 0 38px rgba(0, 0, 0, 0.16);
|
1683 |
-
color: #fff;
|
1684 |
-
}
|
1685 |
-
|
1686 |
-
.tnp-welcome-link-button:visited {
|
1687 |
-
color: #fff;
|
1688 |
-
text-decoration: none;
|
1689 |
-
}
|
1690 |
-
|
1691 |
-
#tnp-welcome input[type="text"], #tnp-welcome input[type="email"] {
|
1692 |
-
max-width: 90%;
|
1693 |
-
}
|
1694 |
-
|
1695 |
-
.tnp-welcome-next {
|
1696 |
-
background-color: #2ECC71;
|
1697 |
-
padding: 10px 20px;
|
1698 |
-
color: white;
|
1699 |
-
text-decoration: none;
|
1700 |
-
font-weight: 600;
|
1701 |
-
font-size: 16px;
|
1702 |
-
margin: 0px 10px;
|
1703 |
-
box-shadow: 0 10px 30px rgba(0, 0, 0, 0.16);
|
1704 |
-
width: -moz-fit-content;
|
1705 |
-
width: -webkit-fit-content;
|
1706 |
-
width: fit-content;
|
1707 |
-
display: flex;
|
1708 |
-
align-items: center;
|
1709 |
-
}
|
1710 |
-
|
1711 |
-
.tnp-welcome-next:hover {
|
1712 |
-
box-shadow: 0 0 38px rgba(0, 0, 0, 0.16);
|
1713 |
-
color: #fff;
|
1714 |
-
}
|
1715 |
-
|
1716 |
-
.tnp-welcome-next:visited {
|
1717 |
-
color: #fff;
|
1718 |
-
text-decoration: none;
|
1719 |
-
}
|
1720 |
-
|
1721 |
-
.tnp-welcome-prev {
|
1722 |
-
background-color: #3498DB;
|
1723 |
-
padding: 10px 20px;
|
1724 |
-
color: white;
|
1725 |
-
text-decoration: none;
|
1726 |
-
font-weight: 600;
|
1727 |
-
font-size: 16px;
|
1728 |
-
margin: 0px 0px 0px 10px;
|
1729 |
-
box-shadow: 0 10px 30px rgba(0, 0, 0, 0.16);
|
1730 |
-
width: -moz-fit-content;
|
1731 |
-
width: -webkit-fit-content;
|
1732 |
-
width: fit-content;
|
1733 |
-
display: flex;
|
1734 |
-
align-items: center;
|
1735 |
-
}
|
1736 |
-
|
1737 |
-
.tnp-welcome-prev:hover {
|
1738 |
-
box-shadow: 0 0 38px rgba(0, 0, 0, 0.16);
|
1739 |
-
color: #fff;
|
1740 |
-
}
|
1741 |
-
|
1742 |
-
.tnp-welcome-prev:visited {
|
1743 |
-
color: #fff;
|
1744 |
-
text-decoration: none;
|
1745 |
-
}
|
1746 |
-
|
1747 |
-
.tnp-welcome-next svg {
|
1748 |
-
margin-left: 10px;
|
1749 |
-
}
|
1750 |
-
|
1751 |
-
.tnp-welcome-prev svg {
|
1752 |
-
margin-right: 10px;
|
1753 |
-
}
|
1754 |
-
|
1755 |
-
.cd-slider input {
|
1756 |
-
width: 250px;
|
1757 |
-
height: 40px;
|
1758 |
-
border: 1px solid #6c7280;
|
1759 |
-
background: #454a56;
|
1760 |
-
color: white;
|
1761 |
-
color: white;
|
1762 |
-
padding: 0px 10px;
|
1763 |
-
}
|
1764 |
-
|
1765 |
-
.cd-slider > li {
|
1766 |
-
position: absolute;
|
1767 |
-
top: 0;
|
1768 |
-
left: 0;
|
1769 |
-
opacity: 0;
|
1770 |
-
/* used to vertically center its content */
|
1771 |
-
display: table;
|
1772 |
-
background-position: center center;
|
1773 |
-
background-repeat: no-repeat;
|
1774 |
-
-webkit-font-smoothing: antialiased;
|
1775 |
-
-moz-osx-font-smoothing: grayscale;
|
1776 |
-
}
|
1777 |
-
.cd-slider > li.visible {
|
1778 |
-
/* selected slide */
|
1779 |
-
position: relative;
|
1780 |
-
z-index: 2;
|
1781 |
-
opacity: 1;
|
1782 |
-
}
|
1783 |
-
.cd-slider > li:first-of-type {
|
1784 |
-
background-color: #2B313A;
|
1785 |
-
}
|
1786 |
-
.cd-slider > li:nth-of-type(2) {
|
1787 |
-
background-color: #2B313A;
|
1788 |
-
}
|
1789 |
-
.cd-slider > li:nth-of-type(3) {
|
1790 |
-
background-color: #2B313A;
|
1791 |
-
}
|
1792 |
-
.cd-slider > li:nth-of-type(4) {
|
1793 |
-
background-color: #2B313A;
|
1794 |
-
}
|
1795 |
-
.cd-slider > li:first-of-type, .cd-slider > li:nth-of-type(2), .cd-slider > li:nth-of-type(3), .cd-slider > li:nth-of-type(4) {
|
1796 |
-
background-size: cover;
|
1797 |
-
}
|
1798 |
-
.cd-slider > li > div {
|
1799 |
-
/* vertically center the slider content */
|
1800 |
-
display: table-cell;
|
1801 |
-
vertical-align: middle;
|
1802 |
-
text-align: center;
|
1803 |
-
}
|
1804 |
-
.cd-slider > li h2, .cd-slider > li p {
|
1805 |
-
text-shadow: 0 1px 3px rgba(0, 0, 0, 0.1);
|
1806 |
-
line-height: 1.2;
|
1807 |
-
margin: 0 auto 14px;
|
1808 |
-
color: #ffffff;
|
1809 |
-
width: 90%;
|
1810 |
-
max-width: 320px;
|
1811 |
-
}
|
1812 |
-
.cd-slider > li h2 {
|
1813 |
-
font-size: 40px;
|
1814 |
-
}
|
1815 |
-
.cd-slider > li p {
|
1816 |
-
font-size: 18px;
|
1817 |
-
line-height: 26px;
|
1818 |
-
text-align: left;
|
1819 |
-
color: #B8C3C9;
|
1820 |
-
margin: 40px auto;
|
1821 |
-
}
|
1822 |
-
|
1823 |
-
.cd-slider > li .cd-btn {
|
1824 |
-
display: inline-block;
|
1825 |
-
padding: 1.2em 1.4em;
|
1826 |
-
margin-top: .8em;
|
1827 |
-
background-color: rgba(0, 0, 0, 0.6);
|
1828 |
-
border-radius: .25em;
|
1829 |
-
font-size: 1.3rem;
|
1830 |
-
font-weight: 700;
|
1831 |
-
letter-spacing: 1px;
|
1832 |
-
color: #ffffff;
|
1833 |
-
text-transform: uppercase;
|
1834 |
-
-webkit-transition: background-color 0.2s;
|
1835 |
-
-moz-transition: background-color 0.2s;
|
1836 |
-
transition: background-color 0.2s;
|
1837 |
-
}
|
1838 |
-
.no-touch .cd-slider > li .cd-btn:hover {
|
1839 |
-
background-color: rgba(0, 0, 0, 0.8);
|
1840 |
-
}
|
1841 |
-
@media only screen and (min-width: 768px) {
|
1842 |
-
.cd-slider > li h2, .cd-slider > li p {
|
1843 |
-
max-width: 520px;
|
1844 |
-
}
|
1845 |
-
.cd-slider > li h2 {
|
1846 |
-
font-size: 40px;
|
1847 |
-
}
|
1848 |
-
.cd-slider > li p {
|
1849 |
-
font-size: 18px;
|
1850 |
-
line-height: 26px;
|
1851 |
-
text-align: left;
|
1852 |
-
color: #B8C3C9;
|
1853 |
-
margin: 40px auto;
|
1854 |
-
|
1855 |
-
}
|
1856 |
-
}
|
1857 |
-
@media only screen and (min-width: 1170px) {
|
1858 |
-
.cd-slider > li h2, .cd-slider > li p {
|
1859 |
-
margin-bottom: 20px;
|
1860 |
-
}
|
1861 |
-
.cd-slider > li h2 {
|
1862 |
-
font-size: 40px;
|
1863 |
-
}
|
1864 |
-
.cd-slider > li p {
|
1865 |
-
font-size: 18px;
|
1866 |
-
line-height: 26px;
|
1867 |
-
text-align: center;
|
1868 |
-
color: #B8C3C9;
|
1869 |
-
margin: 30px auto;
|
1870 |
-
}
|
1871 |
-
}
|
1872 |
-
|
1873 |
-
/* --------------------------------
|
1874 |
-
|
1875 |
-
Tnp Welcome Slider Navigation
|
1876 |
-
|
1877 |
-
-------------------------------- */
|
1878 |
-
.cd-slider-navigation {
|
1879 |
-
position: relative;
|
1880 |
-
bottom: 110px;
|
1881 |
-
z-index: 3;
|
1882 |
-
display: flex;
|
1883 |
-
justify-content: center;
|
1884 |
-
}
|
1885 |
-
|
1886 |
-
/* svg cover layer */
|
1887 |
-
|
1888 |
-
.cd-svg-cover {
|
1889 |
-
position: absolute;
|
1890 |
-
z-index: 1;
|
1891 |
-
left: 0;
|
1892 |
-
top: 0;
|
1893 |
-
height: 100%;
|
1894 |
-
width: 100%;
|
1895 |
-
opacity: 0;
|
1896 |
-
}
|
1897 |
-
.cd-svg-cover path {
|
1898 |
-
fill: #ED6A6A;
|
1899 |
-
}
|
1900 |
-
.cd-svg-cover.is-animating {
|
1901 |
-
z-index: 4;
|
1902 |
-
opacity: 1;
|
1903 |
-
-webkit-transition: opacity 0.6s;
|
1904 |
-
-moz-transition: opacity 0.6s;
|
1905 |
-
transition: opacity 0.6s;
|
1906 |
-
}
|
1907 |
-
|
1908 |
-
/* Switch element style */
|
1909 |
-
|
1910 |
-
/* The switch - the box around the slider */
|
1911 |
-
.switch {
|
1912 |
-
position: relative;
|
1913 |
-
display: inline-block;
|
1914 |
-
width: 60px;
|
1915 |
-
height: 34px;
|
1916 |
-
}
|
1917 |
-
|
1918 |
-
/* Hide default HTML checkbox */
|
1919 |
-
.switch input {display:none;}
|
1920 |
-
|
1921 |
-
/* The slider */
|
1922 |
-
.slider {
|
1923 |
-
position: absolute;
|
1924 |
-
cursor: pointer;
|
1925 |
-
top: 0;
|
1926 |
-
left: 0;
|
1927 |
-
right: 0;
|
1928 |
-
bottom: 0;
|
1929 |
-
background-color: #ccc;
|
1930 |
-
-webkit-transition: .4s;
|
1931 |
-
transition: .4s;
|
1932 |
-
}
|
1933 |
-
|
1934 |
-
.slider:before {
|
1935 |
-
position: absolute;
|
1936 |
-
content: "";
|
1937 |
-
height: 26px;
|
1938 |
-
width: 26px;
|
1939 |
-
left: 4px;
|
1940 |
-
bottom: 4px;
|
1941 |
-
background-color: white;
|
1942 |
-
-webkit-transition: .4s;
|
1943 |
-
transition: .4s;
|
1944 |
-
}
|
1945 |
-
|
1946 |
-
input:checked + .slider {
|
1947 |
-
background-color: #2196F3;
|
1948 |
-
}
|
1949 |
-
|
1950 |
-
input:focus + .slider {
|
1951 |
-
box-shadow: 0 0 1px #2196F3;
|
1952 |
-
}
|
1953 |
-
|
1954 |
-
input:checked + .slider:before {
|
1955 |
-
-webkit-transform: translateX(26px);
|
1956 |
-
-ms-transform: translateX(26px);
|
1957 |
-
transform: translateX(26px);
|
1958 |
-
}
|
1959 |
-
|
1960 |
-
/* Rounded sliders */
|
1961 |
-
.slider.round {
|
1962 |
-
border-radius: 34px;
|
1963 |
-
}
|
1964 |
-
|
1965 |
-
.slider.round:before {
|
1966 |
-
border-radius: 50%;
|
1967 |
-
}
|
1968 |
-
|
1969 |
-
/* Cossa sea sta roba? ORDINE! */
|
1970 |
-
|
1971 |
-
#tnp-body div.tnp-emails-theme-options table.form-table {
|
1972 |
-
margin: 0;
|
1973 |
-
}
|
1974 |
-
|
1975 |
-
#tnp-body div.tnp-emails-theme-options h3 {
|
1976 |
-
color: #000;
|
1977 |
-
}
|
1978 |
-
|
1979 |
-
|
1980 |
-
/* Suggerimenti Oggetto + Inserimento Emoticons */
|
1981 |
-
|
1982 |
-
.tnp-emails-edit #options-subject {
|
1983 |
-
font-size: 16px;
|
1984 |
-
display: inline-block;
|
1985 |
-
margin: 20px 0px;
|
1986 |
-
width: auto;
|
1987 |
-
border-radius: 4px;
|
1988 |
-
padding: 5px 10px;
|
1989 |
-
}
|
1990 |
-
|
1991 |
-
.tnp-suggest-button {
|
1992 |
-
font-family: soleil, sans-serif;
|
1993 |
-
margin-left: 8px;
|
1994 |
-
border-radius: 3px;
|
1995 |
-
background-color: #2980B9;
|
1996 |
-
padding: 10px 15px 8px;
|
1997 |
-
font-size: 14px;
|
1998 |
-
color: #fff !important;
|
1999 |
-
text-decoration: none;
|
2000 |
-
}
|
2001 |
-
|
2002 |
-
.tnp-suggest-button:hover {
|
2003 |
-
background-color: #3f8dbf;
|
2004 |
-
}
|
2005 |
-
|
2006 |
-
.tnp-popup-overlay {
|
2007 |
-
display: none;
|
2008 |
-
position: fixed;
|
2009 |
-
top: 0;
|
2010 |
-
left: 0;
|
2011 |
-
width: 100%;
|
2012 |
-
height: 100%;
|
2013 |
-
background-color: rgba(0, 0, 0, .8);
|
2014 |
-
z-index: 10000;
|
2015 |
}
|
2016 |
|
2017 |
.tnp-popup {
|
@@ -2067,28 +1100,6 @@ input:checked + .slider:before {
|
|
2067 |
}
|
2068 |
|
2069 |
|
2070 |
-
#tnp-edit-emoji-list {
|
2071 |
-
font-size: 28px;
|
2072 |
-
}
|
2073 |
-
#tnp-edit-emoji-list a {
|
2074 |
-
display: inline-block;
|
2075 |
-
margin-right: 5px;
|
2076 |
-
margin-bottom: 5px;
|
2077 |
-
}
|
2078 |
-
|
2079 |
-
/* Stili per il campo testo oggetto delle email */
|
2080 |
-
|
2081 |
-
/*#options-subject {
|
2082 |
-
background: url(images/idea.svg) no-repeat white 99% 3px;
|
2083 |
-
background-size: 25px;
|
2084 |
-
}
|
2085 |
-
|
2086 |
-
#options-subject:hover {
|
2087 |
-
background: url(images/idea.svg) no-repeat red 99% 3px;
|
2088 |
-
background-size: 25px;
|
2089 |
-
}*/
|
2090 |
-
|
2091 |
-
|
2092 |
/* Stile selettore liste - Schermata di invio newsletter */
|
2093 |
|
2094 |
.tnp-list-conditions p {
|
@@ -2204,31 +1215,6 @@ iframe.tnp-editor-preview-desktop {
|
|
2204 |
color: #34495E;
|
2205 |
}
|
2206 |
|
2207 |
-
/*.tnp-nl-status-bar {
|
2208 |
-
height: 24px;
|
2209 |
-
width: auto;
|
2210 |
-
background-color: #fe5e64;
|
2211 |
-
margin: 10px 0px;
|
2212 |
-
border-radius: 15px;
|
2213 |
-
text-align: center;
|
2214 |
-
}
|
2215 |
-
|
2216 |
-
.tnp-nl-status-bar span {
|
2217 |
-
color: #fff;
|
2218 |
-
line-height: 24px;
|
2219 |
-
}*/
|
2220 |
-
/*
|
2221 |
-
#tnp-nl-status-toggle {
|
2222 |
-
width: 30px;
|
2223 |
-
height: 30px;
|
2224 |
-
background-color: #22272d;
|
2225 |
-
z-index: 999999;
|
2226 |
-
position: fixed;
|
2227 |
-
right: 390px;
|
2228 |
-
color: white;
|
2229 |
-
text-align: center;
|
2230 |
-
}*/
|
2231 |
-
|
2232 |
.tnp-status-header #options-subject {
|
2233 |
width: calc(100% - 150px);
|
2234 |
}
|
1 |
+
/* WordPress admin main wrapper */
|
2 |
+
#wpwrap {
|
3 |
+
background-color: #222B36 !important;
|
4 |
+
}
|
5 |
|
6 |
#tnp-wrap * {
|
7 |
-webkit-box-sizing: border-box;
|
9 |
box-sizing: border-box;
|
10 |
}
|
11 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
12 |
#tnp-wrap *:before,
|
13 |
#tnp-wrap *:after {
|
14 |
-webkit-box-sizing: border-box;
|
16 |
box-sizing: border-box;
|
17 |
}
|
18 |
|
19 |
+
#tnp-wrap,
|
20 |
+
#tnp-wrap td,
|
21 |
+
#tnp-wrap h1,
|
22 |
+
#tnp-wrap h2,
|
23 |
+
#tnp-wrap h3,
|
24 |
+
#tnp-wrap h4,
|
25 |
+
#tnp-wrap input,
|
26 |
+
#tnp-wrap select,
|
27 |
+
#tnp-wrap textarea,
|
28 |
+
#tnp-wrap button,
|
29 |
+
#tnp-wrap li,
|
30 |
+
#tnp-wrap a
|
31 |
+
{
|
32 |
+
font-family: soleil, sans-serif;
|
33 |
+
-webkit-font-smoothing: antialiased; /* Chrome, Safari */
|
34 |
+
-moz-osx-font-smoothing: grayscale; /* Firefox */
|
35 |
+
}
|
36 |
|
37 |
.container {
|
38 |
width: 100%;
|
133 |
margin-top: 80px;
|
134 |
}
|
135 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
136 |
#tnp-promotion-bar {
|
137 |
background-color: #FF5F65;
|
138 |
color: ddd;
|
164 |
|
165 |
#tnp-header a {
|
166 |
text-decoration: none;
|
|
|
167 |
color: white;
|
168 |
letter-spacing: 0.1em;
|
169 |
}
|
180 |
color: #000!important;
|
181 |
}
|
182 |
|
183 |
+
/******************************************************************************
|
184 |
+
* BODY
|
185 |
+
******************************************************************************/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
186 |
|
187 |
+
#tnp-body {
|
188 |
+
padding: 10px;
|
189 |
+
background-color: #28313C;
|
|
|
|
|
|
|
|
|
190 |
}
|
191 |
|
|
|
192 |
#tnp-body h1,
|
193 |
#tnp-body h2,
|
194 |
#tnp-body h3,
|
197 |
color: #fff;
|
198 |
}
|
199 |
|
200 |
+
#tnp-body h3 {
|
201 |
+
margin-top: 25px;
|
202 |
+
clear: both;
|
203 |
+
margin-bottom: 10px;
|
204 |
+
}
|
205 |
+
|
206 |
+
|
207 |
#tnp-body ul {
|
208 |
list-style-type: circle;
|
209 |
list-style-position: inside;
|
230 |
#tnp-body .button:focus,
|
231 |
#tnp-body .button-primary,
|
232 |
#tnp-body .button-primary:visited,
|
233 |
+
#tnp-body .button-primary:hover {
|
234 |
+
color: #fff;
|
235 |
+
text-shadow: none;
|
236 |
+
width: auto;
|
237 |
+
vertical-align: bottom;
|
238 |
+
}
|
239 |
+
|
240 |
#tnp-body .button-secondary,
|
241 |
#tnp-body .button-secondary:visited,
|
242 |
#tnp-body .button-secondary:hover {
|
243 |
color: #fff;
|
244 |
+
background-color: #999;
|
245 |
text-shadow: none;
|
246 |
width: auto;
|
247 |
+
vertical-align: bottom;
|
248 |
}
|
249 |
|
250 |
/* Icon in button media selector */
|
268 |
width: auto;
|
269 |
}
|
270 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
271 |
#tnp-body tbody th,
|
272 |
#tnp-body td,
|
273 |
#tnp-body td p,
|
284 |
color: #27AE60; /* Green */
|
285 |
}
|
286 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
287 |
/*******************************************************************************
|
288 |
* Wide fat tables
|
289 |
*/
|
315 |
background-color: #f4faff;
|
316 |
}
|
317 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
318 |
|
|
|
|
|
|
|
319 |
|
320 |
table.clicks td {
|
321 |
border: 1px solid #666;
|
339 |
background-color: #aaa;
|
340 |
}
|
341 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
342 |
.tnp-buttons {
|
343 |
/*background-color: #0073aa;*/
|
344 |
+
padding: 10px 0;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
345 |
}
|
346 |
|
347 |
|
349 |
|
350 |
|
351 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
352 |
.tnp-notice {
|
353 |
padding: 15px;
|
354 |
margin: 10px 0;
|
397 |
cursor: pointer;
|
398 |
}
|
399 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
400 |
.tnp-paginator {
|
401 |
margin-top: 10px;
|
402 |
margin-bottom: 5px;
|
403 |
}
|
404 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
405 |
.newsletter-box {
|
406 |
border: 1px solid #ddd;
|
407 |
padding: 10px;
|
485 |
|
486 |
/* CSS General Font Styles */
|
487 |
|
488 |
+
|
|
|
|
|
489 |
|
490 |
|
491 |
/* CSS Themes Preview */
|
537 |
}
|
538 |
|
539 |
|
|
|
540 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
541 |
|
542 |
|
543 |
.tnp-body-lite {
|
569 |
color: #565656;
|
570 |
}
|
571 |
|
572 |
+
#tnp-heading h1 {
|
573 |
+
color: #fff;
|
574 |
+
font-family: soleil, sans-serif;
|
575 |
+
font-weight: 900;
|
576 |
+
}
|
577 |
+
|
578 |
#tnp-heading h2 {
|
579 |
color: #fff;
|
580 |
font-family: soleil, sans-serif;
|
765 |
border-left: 3px solid #2ECC71;
|
766 |
}
|
767 |
|
|
|
|
|
|
|
|
|
|
|
|
|
768 |
/* Global buttons styles */
|
769 |
|
770 |
#dashboard-widgets .button {
|
788 |
width: auto;
|
789 |
}
|
790 |
|
791 |
+
.wp-core-ui .button-secondary:hover, .wp-core-ui .button-primary:hover {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
792 |
background-color: #5DADE2;
|
793 |
color: #fff;
|
794 |
width: auto;
|
1009 |
margin: 5px;
|
1010 |
}
|
1011 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1012 |
|
1013 |
+
/* Suggerimenti Oggetto + Inserimento Emoticons */
|
|
|
|
|
|
|
1014 |
|
1015 |
+
.tnp-emails-edit #options-subject {
|
1016 |
+
font-size: 16px;
|
1017 |
+
display: inline-block;
|
1018 |
+
margin: 20px 0px;
|
1019 |
+
width: auto;
|
1020 |
+
border-radius: 4px;
|
1021 |
+
padding: 5px 10px;
|
1022 |
}
|
1023 |
|
1024 |
+
.tnp-suggest-button {
|
1025 |
+
font-family: soleil, sans-serif;
|
1026 |
+
margin-left: 8px;
|
1027 |
+
border-radius: 3px;
|
1028 |
+
background-color: #2980B9;
|
1029 |
+
padding: 10px 15px 8px;
|
1030 |
+
font-size: 14px;
|
1031 |
+
color: #fff !important;
|
1032 |
+
text-decoration: none;
|
1033 |
}
|
1034 |
|
1035 |
+
.tnp-suggest-button:hover {
|
1036 |
+
background-color: #3f8dbf;
|
1037 |
}
|
1038 |
|
1039 |
+
.tnp-popup-overlay {
|
1040 |
+
display: none;
|
1041 |
+
position: fixed;
|
1042 |
+
top: 0;
|
1043 |
+
left: 0;
|
1044 |
+
width: 100%;
|
1045 |
+
height: 100%;
|
1046 |
+
background-color: rgba(0, 0, 0, .8);
|
1047 |
+
z-index: 10000;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1048 |
}
|
1049 |
|
1050 |
.tnp-popup {
|
1100 |
}
|
1101 |
|
1102 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1103 |
/* Stile selettore liste - Schermata di invio newsletter */
|
1104 |
|
1105 |
.tnp-list-conditions p {
|
1215 |
color: #34495E;
|
1216 |
}
|
1217 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1218 |
.tnp-status-header #options-subject {
|
1219 |
width: calc(100% - 150px);
|
1220 |
}
|
admin.js
CHANGED
@@ -142,7 +142,7 @@ window.onload = function () {
|
|
142 |
* https://seballot.github.io/spectrum/
|
143 |
*/
|
144 |
function tnp_controls_init() {
|
145 |
-
jQuery(".
|
146 |
type: 'color',
|
147 |
allowEmpty: true,
|
148 |
showAlpha: false,
|
@@ -183,3 +183,9 @@ function tnp_fields_media_mini_remove(name) {
|
|
183 |
$field.trigger("change");
|
184 |
document.getElementById(name + "_img").src = "";
|
185 |
}
|
|
|
|
|
|
|
|
|
|
|
|
142 |
* https://seballot.github.io/spectrum/
|
143 |
*/
|
144 |
function tnp_controls_init() {
|
145 |
+
jQuery(".tnpc-color").spectrum({
|
146 |
type: 'color',
|
147 |
allowEmpty: true,
|
148 |
showAlpha: false,
|
183 |
$field.trigger("change");
|
184 |
document.getElementById(name + "_img").src = "";
|
185 |
}
|
186 |
+
|
187 |
+
function tnp_lists_toggle(e) {
|
188 |
+
console.log(e);
|
189 |
+
jQuery('#' + e.id + '-notes > div').hide();
|
190 |
+
jQuery('#' + e.id + '-notes .list_' + e.value).show();
|
191 |
+
}
|
admin.min.css
DELETED
@@ -1 +0,0 @@
|
|
1 |
-
#tnp-wrap *{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}#tnp-wrap .iris-picker,#tnp-wrap .iris-picker *{-moz-box-sizing:content-box;-webkit-box-sizing:content-box;box-sizing:content-box}#tnp-wrap *:before,#tnp-wrap *:after{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.container{width:100%;padding-right:1rem;padding-left:1rem;margin-right:auto;margin-left:auto}@media(min-width:576px){.container{max-width:540px}}@media(min-width:768px){.container{max-width:720px}}@media(min-width:992px){.container{max-width:960px}}@media(min-width:1200px){.container{max-width:1140px}}.row:before,.row:after{display:table;content:" "}.row:after{clear:both}.col-xs-1,.col-sm-1,.col-md-1,.col-lg-1,.col-xs-2,.col-sm-2,.col-md-2,.col-lg-2,.col-xs-3,.col-sm-3,.col-md-3,.col-lg-3,.col-xs-4,.col-sm-4,.col-md-4,.col-lg-4,.col-xs-5,.col-sm-5,.col-md-5,.col-lg-5,.col-xs-6,.col-sm-6,.col-md-6,.col-lg-6,.col-xs-7,.col-sm-7,.col-md-7,.col-lg-7,.col-xs-8,.col-sm-8,.col-md-8,.col-lg-8,.col-xs-9,.col-sm-9,.col-md-9,.col-lg-9,.col-xs-10,.col-sm-10,.col-md-10,.col-lg-10,.col-xs-11,.col-sm-11,.col-md-11,.col-lg-11,.col-xs-12,.col-sm-12,.col-md-12,.col-lg-12{position:relative;min-height:1px;padding-right:15px;padding-left:15px}.col-xs-1,.col-xs-2,.col-xs-3,.col-xs-4,.col-xs-5,.col-xs-6,.col-xs-7,.col-xs-8,.col-xs-9,.col-xs-10,.col-xs-11,.col-xs-12{float:left}.col-md-1,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-md-10,.col-md-11,.col-md-12{float:left}.col-md-12{width:100%}.col-md-11{width:91.66666667%}.col-md-10{width:83.33333333%}.col-md-9{width:75%}.col-md-8{width:66.66666667%}.col-md-7{width:58.33333333%}.col-md-6{width:50%}.col-md-5{width:41.66666667%}.col-md-4{width:33.33333333%}.col-md-3{width:25%}.col-md-2{width:16.66666667%}.col-md-1{width:8.33333333%}@media all and (max-width:1100px){.col-md-12{width:100%}.col-md-11{width:100%}.col-md-10{width:100%}.col-md-9{width:100%}.col-md-8{width:100%}.col-md-7{width:100%}.col-md-6{width:100%}.col-md-5{width:100%}.col-md-4{width:100%}.col-md-3{width:100%}.col-md-2{width:100%}.col-md-1{width:100%}}.tnp-row-padded{width:90%;margin:0 auto;display:flex;justify-content:space-between}.tnp-col-3-boxed{width:30%;border:1px solid #3c414c;padding:0 0 30px 0;border-radius:10px}.tnp-margin-top{margin-top:80px}#tnp-wrap,#tnp-header,#tnp-body p,#tnp-body td,#tnp-body td p,#tnp-body input,#tnp-body select,#tnp-body textarea{font-family:soleil,sans-serif;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}#tnp-body h1,#tnp-body h2,#tnp-body h3,#tnp-body h4{font-family:soleil,sans-serif;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}#tnp-promotion-bar{background-color:#ff5f65;color:ddd;padding:10px 0;text-align:center;font-size:16px}#tnp-promotion-bar a{color:#fff;font-weight:normal;text-decoration:none}#tnp-header{text-align:left;font-size:12px;color:#fff;font-family:soleil,sans-serif}#tnp-header input{font-size:12px}#tnp-header a{text-decoration:none;color:white;letter-spacing:.1em}#tnp-header a:hover{color:#fff}.error a,.error a:hover{color:#000!important}.updated a,.updated a:hover{color:#000!important}.tnp-error{border-left:5px solid #d00;background-color:#fff;padding:15px;margin:15px 0;font-size:1.2em;line-height:1.5em}.tnp-warning{border-left:5px solid #ffb900;background-color:#fff;padding:15px;margin:15px 0;font-size:1.2em;line-height:1.5em}.tnp-message{border-left:5px solid #46b450;background-color:#fff;padding:15px;margin:15px 0;font-size:1.2em;line-height:1.5em}#tnp-body h1,#tnp-body h2,#tnp-body h3,#tnp-body h4,#tnp-body p,#tnp-body li{color:#fff}#tnp-body ul{list-style-type:circle;list-style-position:inside;margin-left:1em}#tnp-body a,#tnp-body a:active{color:#2980b9}#tnp-body a:hover{color:#3498db}#tnp-body .tnp-submit{margin-bottom:10px}#tnp-body .button,#tnp-body .button:visited,#tnp-body .button:hover,#tnp-body .button:active,#tnp-body .button:focus,#tnp-body .button-primary,#tnp-body .button-primary:visited,#tnp-body .button-primary:hover,#tnp-body .button-secondary,#tnp-body .button-secondary:visited,#tnp-body .button-secondary:hover{color:#fff;background-color:#3498db;text-shadow:none;width:auto}#tnp-body span.wp-media-buttons-icon:before{color:#fff}#tnp-body .tnp-button{color:#fff;background-color:#3498db;text-shadow:none}#tnp-body .button-primary.tnp-button-white,#tnp-body .tnp-button.tnp-button-white{color:#444!important;background-color:#fff!important;box-shadow:none!important;-webkit-box-shadow:none!important;width:auto}#tnp-body .form-table h1,#tnp-body .form-table h2,#tnp-body .form-table h4,#tnp-body .form-table h3{color:#444}#tnp-body tbody th,#tnp-body td,#tnp-body td p,#tnp-body td .button,#tnp-body td .button:visited,#tnp-body td .button:hover,#tnp-body td .button:active,#tnp-body td .button:focus{color:#444}#tnp-body td a,#tnp-body td a:visited{color:#27ae60}#tnp-body .form-table{background-color:#fff;border:1px solid #ecf0f1;margin-top:2em;border-spacing:4px;border-collapse:separate}#tnp-body .form-table th{text-align:right;font-weight:bold;max-width:200px;color:#000;background-color:#ecf0f1;vertical-align:middle}#tnp-body .form-table th small{font-weight:normal}#tnp-body .form-table textarea{width:100%}#tnp-body .form-table table{border-collapse:collapse}#tnp-body .form-table table td,.form-table table th{padding:5px;font-size:.9em;font-weight:normal;border:1px solid #eee}#tnp-body .form-table table thead th{text-align:left;font-weight:bold}#tnp-body .widefat{width:90%}#tnp-body .widefat th{text-align:left}#tnp-body .widefat thead{background-color:#3498db;font-family:soleil,sans-serif;color:#fff!important}#tnp-body .widefat thead tr th{color:#fff!important}#tnp-body .widefat td,.widefat th{vertical-align:middle}.tnp-newsletters-list tbody tr{height:70px}.widefat tr:nth-child(even){background-color:#f4faff}#tnp-body #tabs h1,#tnp-body #tabs h2,#tnp-body #tabs h3,#tnp-body #tabs h4,#tnp-body #tabs p,#tnp-body #tabs td,#tnp-body #tabs th,#tnp-body #tabs input,#tnp-body #tabs select,#tnp-body #tabs textarea,#tnp-body #tabs a{color:#444}#tnp-body #tabs .button,#tnp-body #tabs .button:visited,#tnp-body #tabs .button:hover,#tnp-body #tabs .button-primary,#tnp-body #tabs .button-primary:visited,#tnp-body #tabs .button-primary:hover,#tnp-body #tabs .button-secondary,#tnp-body #tabs .button-secondary:visited,#tnp-body #tabs .button-secondary:hover{color:#fff;width:auto}#tnp-body td .tnp-tabs .ui-widget-header{background-color:#ddd}#tnp-body td .tnp-tabs .ui-tabs-anchor{color:#000}table.clicks td{border:1px solid #666;padding:2px;font-size:10px}table.clicks{border-collapse:collapse}.grid{border-collapse:collapse}.grid td,.grid th{padding:10px;border:1px solid #ddd;margin:0}.grid th{background-color:#aaa}.tnp-checkboxes label{display:block;float:left;width:220px;border:1px solid #ccc;background-color:#f4f4f4;margin-bottom:5px;padding:5px;white-space:nowrap;margin-right:5px}.tnp-buttons{padding:10px}.newsletter-checkbox-group,.nl-checkbox-group{float:left;margin-right:5px;border:1px solid #ccc;background-color:#f4f4f4;margin-bottom:5px;padding:5px;white-space:nowrap;overflow:hidden}.newsletter-checkboxes-item{float:left;margin-right:5px;border:1px solid #ddd;border-radius:3px;background-color:#f4f4f4;width:150px;margin-bottom:5px;padding:3px;white-space:nowrap;overflow:hidden}.newsletter-checkboxes-item input{vertical-align:text-bottom}.newsletter-checkboxes-item label{display:inline}.newsletter-preferences-item{float:left;margin-right:5px;border:1px solid #ccc;background-color:#f4f4f4;width:250px;margin-bottom:5px;padding:5px;white-space:nowrap;overflow:hidden}.newsletter-preferences-item label{display:inline}.form-table td .nl-checkbox-group label{display:inline}.tnp-notice{padding:15px;margin:10px 0;padding-right:70px;position:relative;border:1px solid #eee;background-color:#fff;color:#444;font-size:13px;border-left:5px solid #27ae60}.tnp-notice a{color:#0073aa;text-decoration:none;font-weight:bold}.tnp-notice a.tnp-dismiss{display:block;position:absolute;right:10px;top:13px;font-size:25px;text-decoration:none;color:#666}.tnp-notice input[type=email]{margin:10px 5px 5px;width:250px;border:0;box-shadow:none;background-color:#ecf0f1;padding:8px}.tnp-notice input[type=submit]{border:0;box-shadow:none;background-color:#27ae60;padding:8px;font-family:soleil,sans-serif;font-size:13px;color:#fff;cursor:pointer}.newsletter-message{background-color:#efe;border-color:#393;border-radius:5px;border-style:solid;border-width:3px;padding:.6em;margin-bottom:.6em}.newsletter-error-span{color:#f00;font-weight:bold}.newsletter-error{background-color:#fee;border-color:#933;border-radius:5px;border-style:solid;border-width:2px;padding:.6em;margin-bottom:.6em}.newsletter-error strong,.newsletter-message strong{font-weight:bold}#newsletter-warnings{background-color:#ffebe8;border-color:#C00;border-radius:3px;border-style:solid;border-width:1px;padding:.6em;margin-bottom:.6em}.newsletter-buttons{margin-top:1em;margin-bottom:1em}.tnp-paginator{margin-top:10px;margin-bottom:5px}.newsletter-option-grid th{text-align:right;width:auto;border:0;padding:3px;font-weight:normal;vertical-align:top;padding-right:15px}.newsletter-option-grid td{border:0;padding:3px;vertical-align:top}.newsletter-box{border:1px solid #ddd;padding:10px;background-color:#fafafa;margin-bottom:15px}.newsletter-box h3{margin-top:0}.newsletter-textarea-preview{border:1px solid #ddd}.tnp-tab-notice{background-color:#fff;border:1px solid #eee;border-left:3px solid gray;padding:10px;margin:10px 0;color:#444}.tnp-tab-warning{background-color:#fff;border:1px solid #eee;border-left:3px solid orange;padding:10px;margin:10px 0;color:#444}.tnp-tab-success{background-color:#fff;border:1px solid #eee;border-left:3px solid green;padding:10px;margin:10px 0;color:#444}.tnp-tab-error{background-color:#fff;border:1px solid #eee;border-left:3px solid red;padding:10px;margin:10px 0;color:#444}.tnp-tip{margin-top:5px}.tip-button{padding:0 5px;color:#fd5f65;text-transform:uppercase;letter-spacing:.2em;font-size:10px;border:1px red solid}.tip-content{font-weight:500;font-size:11px;color:#999}p.description{font-size:12px!important}.tnp-theme-preview{display:inline-block;text-align:center}.tnp-theme-preview p{font-family:soleil;font-size:13px;letter-spacing:.2em;color:#fff}.tnp-theme-preview img:hover{box-shadow:3px 3px 8px 2px #293848}.tnp-theme-preview img{border-radius:10px;height:190px;width:auto}.tnp-theme-preview .tnp-theme-composer{height:250px;width:auto}.tnp-theme-preview .tnp-theme-html{width:auto}.tnp-header-logo{margin-left:10px}.wp-core-ui .button-primary{background-color:#2b2f3a;color:#fff;width:auto}#tnp-body{padding:10px;background-color:#28313c}.tnp-darkbg{background-color:#34495e!important}#tnp-body h3{margin-top:25px;clear:both;margin-bottom:10px}.tnp-body-lite{background-color:#f1f1f1!important}#tnp-heading{padding:10px;margin-bottom:10px;border-radius:5px}#tnp-heading a{color:#fff;border-bottom:1px solid #fff;text-decoration:none}#tnp-heading a:hover{color:#27ae60;border-bottom:1px solid #27ae60}#tnp-heading div p{color:#565656}#tnp-heading h2{color:#fff;font-family:soleil,sans-serif;letter-spacing:.1rem;font-size:1.1rem;line-height:1.8rem;text-transform:uppercase;vertical-align:middle;font-weight:700;padding:0;margin:0;margin-bottom:15px}#tnp-heading h3{color:#27ae60;font-family:soleil,sans-serif;letter-spacing:.1rem;font-size:.8rem;line-height:1.8rem;text-transform:uppercase;vertical-align:middle;font-weight:700;padding:0;margin:0}#tnp-heading p{margin:0;color:#ccc}#tnp-heading .notice p{margin:.5em 0;padding:2px}#tnp-heading .tnp-btn-h1{color:#fff;background-color:#3498db;border-radius:3px;padding:6px 11px;text-decoration:none;text-transform:capitalize;font-family:soleil,sans-serif;margin-left:10px;font-size:.75rem;font-weight:300;border:0}#tnp-heading .tnp-btn-h1:hover{color:#fff;background-color:#5dade2;-webkit-transition:background-color .25s linear;transition:background-color .25s linear;-webkit-font-smoothing:subpixel-antialiased;border:0;color:#fff}.metabox-holder{width:100%}.postbox{border:0}.postbox h3 a{float:right}#dashboard-widgets .postbox-container{width:33.333%}#tnp-body .postbox p{color:#000}#dashboard-widgets .postbox-container .postbox h3{font-family:soleil,sans-serif;letter-spacing:.05rem;background-color:#415b76;color:#fff;margin:0;padding:9px}#dashboard-widgets .postbox-container h3 a{color:white;text-decoration:none;margin-left:5px;padding:2px 8px;background-color:#26c281;border-radius:2px;font-weight:300;text-transform:capitalize;font-size:.8rem}#dashboard-widgets .postbox-container h3 a:hover{color:white;text-decoration:none;margin-left:5px;background-color:#2ecc71}.postbox-container i{margin-right:3px}#tnp-dash-newsletters tr td:last-of-type{width:80px;text-align:right}#tnp-dash-subscribers tr td:last-of-type{width:80px;text-align:right}#tnp-dash-subscribers tr td:first-of-type{width:250px;overflow:hidden}#tnp-dash-subscribers table{table-layout:fixed}#tnp-dash-documentation .inside div{margin-top:10px}#tnp-dash-documentation .inside a{text-decoration:none;color:#fff;display:block;font-family:soleil,sans-serif;padding:5px 10px}#tnp-footer{margin-top:10px;padding:20px 10px 10px 40px;background-color:#28313c;font-family:soleil,sans-serif}#tnp-footer div{width:33%;display:inline-block}#tnp-footer a{color:#fff;text-decoration:none}#tnp-footer a:hover{color:#bdc3c7}#tnp-footer input[type="submit"]{background-color:#2ecc71;border:0;padding:5px;color:#fff}#tnp-footer form{white-space:nowrap}#tnp-footer li{display:inline;margin-left:15px;padding:2px 5px;border-left:3px solid #2ecc71}#wpwrap{background-color:#222b36!important}#dashboard-widgets .button{border:0;background:0;box-shadow:none;color:#322c39}#dashboard-widgets .button:hover{background-color:#ecf0f1}.wp-core-ui .button-secondary,.wp-core-ui .button-primary{background-color:#3498db;border:0;box-shadow:none;color:#fff;font-family:soleil,sans-serif;margin:0 2px;width:auto}.wp-core-ui .button-secondary,.wp-core-ui .button,.wp-core-ui .button-primary{background-color:#3498db;box-shadow:none;color:#fff;font-family:soleil,sans-serif;margin:0 2px}.wp-core-ui .button-secondary:hover,.wp-core-ui .button:hover,.wp-core-ui .button-primary:hover{background-color:#5dade2;color:#fff;width:auto}span.wp-media-buttons-icon:before{color:#fff}.tnp-paginator [value="Go"]{background-color:#27ae60}.tnp-paginator [value="Go"]:hover{background-color:#2ecc71}.notice-dismiss{padding:3px}.tnp-paginator{color:#fff;font-family:soleil,sans-serif;margin:10px 0}.tnp-paginator .button-secondary{padding:5px;line-height:normal;height:auto;font-size:12px;height:25px;border:0;border-radius:3px;vertical-align:baseline}.tnp-paginator [value="Go"]{background-color:#27ae60!important}.tnp-paginator [value="Go"]:hover{background-color:#2ecc71!important}.tnp-paginator input{background-color:#2c3e50;border:0;border-radius:3px;color:#fff;padding:5px;line-height:normal;font-size:12px;height:25px}.tnp-subscribers-search{color:#fff;font-family:soleil,sans-serif;background-color:#2c3e50;padding:20px;border-radius:5px;margin-bottom:20px;display:inline-block}.tnp-subscribers-search select{margin-left:5px;padding:0;line-height:inherit}.tnp-video-container{position:relative;padding-bottom:56.25%;padding-top:30px;height:0;overflow:hidden}.tnp-video-container iframe,.tnp-video-container object,.tnp-video-container embed{position:absolute;top:0;left:0;width:100%;height:100%}.bg-white{background-color:#FFF}.orange{background-color:#f39c12}.blue{background-color:#2980b9}.purple{background-color:#8e44ad}.notice a{color:#27ae60!important;text-decoration:underline!important}.tnp-chart{border:1px solid #eee;width:100%}.tnp-db-table{width:auto;background-color:#fff}.tnp-db-table thead{border-bottom:1px solid #eee}.tnp-db-table th{font-weight:bold}.tnp-db-table td,.tnp-db-table th{padding:3px;font-family:monospace;border:0}.tnp-main-status h3,.tnp-main-status h4{color:#fff}#tnp-status-table .tnp-ok{font-weight:bold;color:white;font-size:14px;background-color:#27ae60;padding:2px 10px;border-radius:10px;display:inline-block;width:75px;text-align:center}#tnp-status-table .tnp-ko{font-weight:bold;color:white;font-size:14px;background-color:#e74c41;padding:2px 10px;border-radius:10px;display:inline-block;width:75px;text-align:center}#tnp-status-table .tnp-maybe{font-weight:bold;color:white;font-size:14px;background-color:#f1c40f;padding:2px 10px;border-radius:10px;display:inline-block;width:75px;text-align:center}.tnp-main-status .tnp-log-files li{padding-left:15px}.tnp-main-status .tnp-log-files li,.tnp-main-status .tnp-log-files li a{color:#fff}.tnp-main-status .tnp-log-files .tnp-log-size{font-style:italic}table.widefat{border:0;box-shadow:none}#tnp-status-table tbody tr:nth-child(2n+1){background-color:#ecf0f1;border-radius:2px;margin:5px}#tnp-parameters-table tbody tr:nth-child(2n+1){background-color:#ecf0f1;border-radius:2px;margin:5px}#tnp-body .ui-widget{font-family:soleil,sans-serif}#tnp-body #tabs{background-color:transparent;border:0!important;padding:0;margin:0}#tnp-body #tabs .ui-widget-header{background:#28313c;border:0}#tnp-body #tabs .ui-tabs-panel{padding:15px!important;background-color:#fff}#tnp-body #tabs a.ui-tabs-anchor,#tnp-body #tabs a.ui-tabs-anchor:visited{color:#444}#tnp-body .ui-tabs .ui-tabs-nav{padding:0}#tnp-body .ui-tabs .ui-tabs-nav li a{font-size:14px}#tnp-body #tabs .ui-tabs{border-color:#28313c;background-color:#28313c;border:0}#tnp-body #tabs .ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0 0;background-color:#f2f2f2}#tnp-body #tabs .ui-tabs .ui-tabs-panel{padding:1em 0;background-color:#f2f2f2;margin:0;border:0}#tnp-body .ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active{background:#fff!important;font-weight:normal;font-family:soleil,sans-serif}#tnp-body .ui-widget-content{background:#fff}#tnp-body .ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{border:0;background:#ecf0f1;font-family:soleil,sans-serif}.tnp-extension-premium-box,.tnp-extension-free-box,.tnp-integration-box{width:300px;height:220px;background-color:#222b36;text-align:center;margin:20px;float:left;position:relative}.tnp-extension-premium-box:hover,.tnp-extension-free-box:hover,.tnp-integration-box:hover{background-color:#232c35;box-shadow:1px 1px 15px #222b36}.tnp-extension-premium-box p,.tnp-extension-free-box p,.tnp-integration-box p{padding:5px 10px;color:#72777c;font-size:14px;margin-top:0}.tnp-extension-premium-box h3{font-family:soleil,sans-serif;padding:5px 8px!important;border-radius:3px;display:inline-block;font-size:16px;color:#fff;margin-bottom:0!important;margin-top:25px!important;font-weight:300;width:auto!important;border-bottom:none!important}.tnp-extension-free-box h3{font-family:soleil,sans-serif;padding:5px 8px!important;border-radius:3px;display:inline-block;font-size:16px;color:#fff;margin-bottom:0!important;margin-top:25px!important;font-weight:300;width:auto!important;border-bottom:none!important}.tnp-integration-box h3{font-family:soleil,sans-serif;padding:5px 8px!important;border-radius:3px;display:inline-block;font-size:16px;color:#fff;margin-bottom:0!important;margin-top:25px!important;font-weight:300;width:auto!important;border-bottom:none!important}.tnp-extension-premium-action{bottom:0;position:absolute;width:100%;padding:12px;font-family:soleil,sans-serif}.tnp-extension-free-action{bottom:0;position:absolute;width:100%;padding:12px;font-family:soleil,sans-serif}.tnp-integration-action{bottom:0;position:absolute;width:100%;padding:12px;font-family:soleil,sans-serif}.tnp-extension-premium-action span{color:#27ae60}.tnp-extension-free-action span{color:#27ae60}.tnp-integration-action span{color:#27ae60}.tnp-extension-activate{color:#1abc9c;padding:5px 8px;text-decoration:none;cursor:pointer}.tnp-extension-install{color:#2980b9;padding:5px 8px;text-decoration:none;cursor:pointer}.tnp-extension-buy{color:#f1c40f;padding:5px 8px;text-decoration:none;cursor:pointer}#tnp-body a.tnp-extension-details{color:#999;padding:5px 8px;text-decoration:none;cursor:pointer}.tnp-extension-free{color:#d35400;padding:5px 8px;text-decoration:none;cursor:pointer;position:relative}img.tnp-extensions-free-badge{position:absolute;display:block;right:0;top:0;width:70px}.tnp-extensions-image img{margin:25px 0 -10px}#tnp-subscribe-overlay{height:100vh;width:100vw;z-index:10000;display:none;background-image:url(images/modal-background.png);background-repeat:repeat;position:fixed;top:0;left:-20px}#tnp-subscribe-modal{width:600px;background-color:rgba(255,255,255,1);margin-right:auto;margin-left:auto;margin-top:100px;-webkit-box-shadow:0 0 20px 0 rgba(0,0,0,0.5);-moz-box-shadow:0 0 20px 0 rgba(0,0,0,0.5);box-shadow:0 0 20px 0 rgba(0,0,0,0.5);padding:25px;background-color:#1d2b38;text-align:center}#tnp-subscribe-modal img{width:30%}#tnp-subscribe-title{font-size:20px;margin-top:30px;margin-bottom:30px;line-height:30px;color:white;font-weight:200}#tnp-subscribe-email-wrapper{margin:20px}#tnp-subscribe-email-wrapper input{border:0;background-color:#223242;color:white}#tnp-subscribe-email{font-size:24px;box-sizing:border-box;width:100%;padding:10px;text-align:center}#tnp-subscribe-submit-wrapper{margin-bottom:20px}#tnp-subscribe-submit{font-size:24px;background-color:#219050;color:#fff;padding:10px 35px;border:0;font-size:17px;letter-spacing:2px}#tnp-subscribe-no-thanks{color:#666;margin-top:20px;margin-bottom:20px}#tnp-body div.tnp-emails-theme-options{background-color:#fff;padding:10px;margin-top:14px}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{border:0;background:#ecf0f1;font-family:soleil,sans-serif}.cd-slider-wrapper{position:relative;width:100%;height:90vh;overflow:hidden;margin:0 auto}.cd-slider-wrapper .cd-slider,.cd-slider-wrapper .cd-slider>li{height:100%;width:100%}.tnp-logo-big{width:300px}.tnp-row{display:table-row}.tnp-third{width:33%;float:left}.tnp-welcome-confirm-button{color:#fff;padding:10px 30px;background-color:#2ecc71;font-weight:700;font-size:15px;box-shadow:0 20px 38px rgba(0,0,0,0.16);text-decoration:none;display:inline-block;text-align:center;margin:20px auto 0}.tnp-welcome-confirm-button:hover{box-shadow:0 0 38px rgba(0,0,0,0.16);color:#fff}.tnp-welcome-confirm-button:visited{color:#fff;text-decoration:none}.tnp-welcome-link-button{color:#fff;padding:10px 30px;background-color:#3498db;font-weight:700;font-size:15px;box-shadow:0 20px 38px rgba(0,0,0,0.16);text-decoration:none}.tnp-welcome-link-button:hover{box-shadow:0 0 38px rgba(0,0,0,0.16);color:#fff}.tnp-welcome-link-button:visited{color:#fff;text-decoration:none}#tnp-welcome input[type="text"],#tnp-welcome input[type="email"]{max-width:90%}.tnp-welcome-next{background-color:#2ecc71;padding:10px 20px;color:white;text-decoration:none;font-weight:600;font-size:16px;margin:0 10px;box-shadow:0 10px 30px rgba(0,0,0,0.16);width:-moz-fit-content;width:-webkit-fit-content;width:fit-content;display:flex;align-items:center}.tnp-welcome-next:hover{box-shadow:0 0 38px rgba(0,0,0,0.16);color:#fff}.tnp-welcome-next:visited{color:#fff;text-decoration:none}.tnp-welcome-prev{background-color:#3498db;padding:10px 20px;color:white;text-decoration:none;font-weight:600;font-size:16px;margin:0 0 0 10px;box-shadow:0 10px 30px rgba(0,0,0,0.16);width:-moz-fit-content;width:-webkit-fit-content;width:fit-content;display:flex;align-items:center}.tnp-welcome-prev:hover{box-shadow:0 0 38px rgba(0,0,0,0.16);color:#fff}.tnp-welcome-prev:visited{color:#fff;text-decoration:none}.tnp-welcome-next svg{margin-left:10px}.tnp-welcome-prev svg{margin-right:10px}.cd-slider input{width:250px;height:40px;border:1px solid #6c7280;background:#454a56;color:white;color:white;padding:0 10px}.cd-slider>li{position:absolute;top:0;left:0;opacity:0;display:table;background-position:center center;background-repeat:no-repeat;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.cd-slider>li.visible{position:relative;z-index:2;opacity:1}.cd-slider>li:first-of-type{background-color:#2b313a}.cd-slider>li:nth-of-type(2){background-color:#2b313a}.cd-slider>li:nth-of-type(3){background-color:#2b313a}.cd-slider>li:nth-of-type(4){background-color:#2b313a}.cd-slider>li:first-of-type,.cd-slider>li:nth-of-type(2),.cd-slider>li:nth-of-type(3),.cd-slider>li:nth-of-type(4){background-size:cover}.cd-slider>li>div{display:table-cell;vertical-align:middle;text-align:center}.cd-slider>li h2,.cd-slider>li p{text-shadow:0 1px 3px rgba(0,0,0,0.1);line-height:1.2;margin:0 auto 14px;color:#fff;width:90%;max-width:320px}.cd-slider>li h2{font-size:40px}.cd-slider>li p{font-size:18px;line-height:26px;text-align:left;color:#b8c3c9;margin:40px auto}.cd-slider>li .cd-btn{display:inline-block;padding:1.2em 1.4em;margin-top:.8em;background-color:rgba(0,0,0,0.6);border-radius:.25em;font-size:1.3rem;font-weight:700;letter-spacing:1px;color:#fff;text-transform:uppercase;-webkit-transition:background-color .2s;-moz-transition:background-color .2s;transition:background-color .2s}.no-touch .cd-slider>li .cd-btn:hover{background-color:rgba(0,0,0,0.8)}@media only screen and (min-width:768px){.cd-slider>li h2,.cd-slider>li p{max-width:520px}.cd-slider>li h2{font-size:40px}.cd-slider>li p{font-size:18px;line-height:26px;text-align:left;color:#b8c3c9;margin:40px auto}}@media only screen and (min-width:1170px){.cd-slider>li h2,.cd-slider>li p{margin-bottom:20px}.cd-slider>li h2{font-size:40px}.cd-slider>li p{font-size:18px;line-height:26px;text-align:center;color:#b8c3c9;margin:30px auto}}.cd-slider-navigation{position:relative;bottom:110px;z-index:3;display:flex;justify-content:center}.cd-svg-cover{position:absolute;z-index:1;left:0;top:0;height:100%;width:100%;opacity:0}.cd-svg-cover path{fill:#ed6a6a}.cd-svg-cover.is-animating{z-index:4;opacity:1;-webkit-transition:opacity .6s;-moz-transition:opacity .6s;transition:opacity .6s}.switch{position:relative;display:inline-block;width:60px;height:34px}.switch input{display:none}.slider{position:absolute;cursor:pointer;top:0;left:0;right:0;bottom:0;background-color:#ccc;-webkit-transition:.4s;transition:.4s}.slider:before{position:absolute;content:"";height:26px;width:26px;left:4px;bottom:4px;background-color:white;-webkit-transition:.4s;transition:.4s}input:checked+.slider{background-color:#2196f3}input:focus+.slider{box-shadow:0 0 1px #2196f3}input:checked+.slider:before{-webkit-transform:translateX(26px);-ms-transform:translateX(26px);transform:translateX(26px)}.slider.round{border-radius:34px}.slider.round:before{border-radius:50%}#tnp-body div.tnp-emails-theme-options table.form-table{margin:0}#tnp-body div.tnp-emails-theme-options h3{color:#000}.tnp-emails-edit #options-subject{font-size:16px;display:inline-block;margin:20px 0;width:auto;border-radius:4px;padding:5px 10px}.tnp-suggest-button{font-family:soleil,sans-serif;margin-left:8px;border-radius:3px;background-color:#2980b9;padding:10px 15px 8px;font-size:14px;color:#fff!important;text-decoration:none}.tnp-suggest-button:hover{background-color:#3f8dbf}.tnp-popup-overlay{display:none;position:fixed;top:0;left:0;width:100%;height:100%;background-color:rgba(0,0,0,.8);z-index:10000}.tnp-popup{width:40vw;height:66vh;overflow:auto;margin:100px auto 0 auto;background-color:#181818;padding:20px;position:relative}.tnp-popup-close{display:block;position:absolute;top:5px;right:5px;background-color:#181818;color:#fff;font-size:40px;padding:10px;text-align:right;cursor:pointer}.tnp-subjects-header{font-size:16px;color:#fff;padding:0 70px 20px 20px;font-family:soleil,sans-serif;border-bottom:1px solid #282828}#tnp-edit-subjects-list{padding:0 70px 20px 20px}#tnp-edit-subjects-list a{padding:5px}#tnp-edit-subjects-list svg{margin:0 10px 0 0;vertical-align:middle}.tnp-subject-category{color:#565656;margin:25px 0 10px 0;font-size:12px;text-transform:uppercase;letter-spacing:.1em}#tnp-edit-emoji-list{font-size:28px}#tnp-edit-emoji-list a{display:inline-block;margin-right:5px;margin-bottom:5px}.tnp-list-conditions p{margin:0 10px}.tnp-lists .tnp-notes{margin:0;font-size:.9em}iframe.tnp-editor-preview-mobile{box-sizing:border-box;background-color:#fff;border:1px solid #bbb;box-shadow:1px 1px 10px #777;border-radius:10px;padding:5px;width:320px;height:500px;float:left}iframe.tnp-editor-preview-desktop{box-sizing:border-box;background-color:#fff;border:1px solid #bbb;border-radius:10px;box-shadow:1px 1px 10px #777;padding:15px;width:650px;margin-right:20px;height:500px;float:left}#tnp-license-control{border-left:5px solid #27ae60;display:inline-block;padding:15px 20px;margin-left:-10px;margin-top:15px;border-radius:2px;background-color:#fff}#tnp-license-control form{margin-bottom:10px;margin-top:10px}#tnp-license-control form input{padding-left:10px}#tnp-license-control a{border-bottom:0;color:#27ae60}#tnp-nl-status{width:100%;background:#fffafa;padding:15px 25px 15px 25px;border-left:10px solid #27ae60;border-radius:0 5px 5px 0}#tnp-nl-status p{font-size:17px}.tnp-nl-status-row{margin:10px 0}.tnp-nl-status-title{font-size:26px;line-height:32px;margin:5px 0 0 0;color:#3498db;font-weight:900;vertical-align:middle}.tnp-nl-status-title-value{font-size:13px;line-height:32px;margin:0 0 0 5px;color:#fff;background-color:#95a5a6;border-radius:4px;text-transform:uppercase;letter-spacing:1px;vertical-align:sub}.tnp-nl-status-schedule-targeting{font-size:15px;color:#34495e}.tnp-nl-status-schedule-value{font-size:15px;color:#34495e}.tnp-status-header #options-subject{width:calc(100% - 150px)}.tnp-one-third{width:40%;display:inline-block;vertical-align:top}.tnp-two-thirds{width:59%;display:inline-block;vertical-align:top}.tnp-progress{display:flex;height:1.5rem;overflow:hidden;font-size:.75rem;background-color:#c9cccf;border-radius:.25rem;margin:0;min-width:100px}.tnp-progress-bar{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;-ms-flex-pack:center;justify-content:center;color:#fff;text-align:center;white-space:nowrap;background-color:#007bff;transition:width .6s ease}.tnp-progress.sent .tnp-progress-bar{background-color:green}.tnp-progress-numbers{text-align:center;color:#666}.tnp-progress-date{color:#666;font-style:italic}span.tnp-email-status-new{background-color:#8e44ad;padding:2px 10px;border-radius:4px;color:#fff;white-space:nowrap}span.tnp-email-status-paused{background-color:#95a5a6;padding:2px 10px;border-radius:4px;color:#fff;white-space:nowrap}span.tnp-email-status-sending{background-color:#27ae60;padding:2px 10px;border-radius:4px;color:#fff;white-space:nowrap}span.tnp-email-status-scheduled{background-color:#e67e22;padding:2px 10px;border-radius:4px;color:#fff;white-space:nowrap}span.tnp-email-status-sent{background-color:#95a5a6;padding:2px 10px;border-radius:4px;color:#fff;white-space:nowrap}#tnp-schedule-button{background-color:#e67e22!important}#tnp-schedule-button:hover{background-color:#ec913f!important}.tnp-button-cancel{background-color:#e74c3c!important}.tnpc-preview{margin-top:10px}.tnpc-preview .fake-browser-ui iframe{width:700px}.tnpc-preview .fake-mobile-browser-ui iframe{width:320px}.fake-browser-ui{padding:30px 0 0;border-radius:3px;border-bottom:10px solid #ccc;background:#ddd;display:inline-block;position:relative;line-height:0;vertical-align:top;margin-left:20px}.fake-mobile-browser-ui{padding:30px 10px 37px;border-radius:10px;border-bottom:10px solid #ccc;background:#ddd;display:inline-block;position:relative;line-height:0;margin-left:30px}.fake-browser-ui .frame{display:block;height:25px;position:absolute;top:12px;left:8px}.fake-mobile-browser-ui .frame{display:block;height:25px;margin-top:10px}.fake-browser-ui span{height:12px;width:12px;border-radius:8px;background-color:#eee;border:1px solid #dadada;float:left;margin:0 0 0 4px}.fake-mobile-browser-ui span{height:50px;width:50px;border-radius:60px;background-color:#eee;border:2px solid #ccc;display:block;margin:auto}.fake-browser-ui .bt-1{background-color:#ed594a}.fake-browser-ui .bt-2{background-color:#fdd800}.fake-browser-ui .bt-3{background-color:#5ac05a}#tnp-promo{text-align:left;background-color:#222b36;margin:20px;border-radius:5px;padding:20px 40px}#tnp-promo .tnp-promo-how-to{width:50%;padding:5px 20px;margin-top:30px;margin-bottom:30px;border-left:2px solid #f1c40f}#tnp-promo .tnp-promo-how-to h3{color:#ecf0f1;margin:0;line-height:36px}#tnp-promo .tnp-promo-how-to p{color:#ecf0f1;margin:0;font-size:16px;line-height:26px}#tnp-promo .tnp-promo-buttons{margin:50px 0}#tnp-promo .tnp-promo-button{background:#27ae60;text-decoration:none;color:white;padding:15px 20px;font-size:15px;border-radius:2px}#tnp-promo .tnp-promo-button:hover{background:#2ecc71;color:white}#tnp-promo .tnp-promo-button i{margin-right:3px}#tnp-body td a.tnp-table-link,#tnp-body td a.tnp-table-link:visited{color:#444}#tnp-body td a.tnp-table-link:hover{color:#3498db}.text-left{text-align:left}.tab-min-height{min-height:500px}.tnp-control-all-languages-notice{padding:15px;border:1px dashed #999}.sp-dd{display:none}.sp-replacer{width:30px!important;height:30px!important}
|
|
admin.min.js
DELETED
@@ -1,5 +0,0 @@
|
|
1 |
-
jQuery.cookie=function(c,b,a){if("undefined"!=typeof b){a=a||{};null===b&&(b="",a.expires=-1);var d="";a.expires&&("number"==typeof a.expires||a.expires.toUTCString)&&("number"==typeof a.expires?(d=new Date,d.setTime(d.getTime()+864E5*a.expires)):d=a.expires,d="; expires="+d.toUTCString());var e=a.path?"; path="+a.path:"",f=a.domain?"; domain="+a.domain:"";a=a.secure?"; secure":"";document.cookie=[c,"=",encodeURIComponent(b),d,e,f,a].join("")}else{b=null;if(document.cookie&&""!=document.cookie)for(a=
|
2 |
-
document.cookie.split(";"),d=0;d<a.length;d++)if(e=jQuery.trim(a[d]),e.substring(0,c.length+1)==c+"="){b=decodeURIComponent(e.substring(c.length+1));break}return b}};function tnp_toggle_schedule(){jQuery("#tnp-schedule-button").toggle();jQuery("#tnp-schedule").toggle()}function tnp_select_toggle(c,b){1==c.value?jQuery("#options-"+b).show():jQuery("#options-"+b).hide()}
|
3 |
-
function tnp_date_onchange(c){var b=c.id.substring(0,c.id.lastIndexOf("_"));c=document.getElementById("options-"+b);let a=document.getElementById(b+"_year"),d=document.getElementById(b+"_month");b=document.getElementById(b+"_day");c.value=""===a.value||""===d.value||""===b.value?0:(new Date(a.value,d.value,b.value,12,0,0)).getTime()/1E3}
|
4 |
-
window.onload=function(){jQuery(".tnp-counter-animation").each(function(){var c=jQuery(this),b=null;(function(a){return!isNaN(Number(a))&&-1!==Number(a).toString().indexOf(".")})(c.text())?b={parsed:parseFloat(c.text()),rounded:function(a){return a.toFixed(1)}}:(b={parsed:parseInt(c.text()),rounded:function(a){return Math.ceil(a)}},c.hasClass("percentage")&&c.css("min-width","60px"));jQuery({counter:0}).animate({counter:b.parsed},{duration:1E3,easing:"swing",step:function(){c.text(b.rounded(this.counter))}})});
|
5 |
-
(function(){if(jQuery("#tnp-nl-status").length&&jQuery("#newsletter-form").length){var c=jQuery("#tnp-nl-status .tnp-nl-status-schedule-value");jQuery("#newsletter-form").change(function(b){1===jQuery(b.target).parents("#tabs-options").length&&c.text(tnp_translations.save_to_update_counter)})}})()};function tnp_controls_init(){jQuery(".tnpf-color").spectrum({type:"color",allowEmpty:!0,showAlpha:!1,showInput:!0,preferredFormat:"hex"})};
|
|
|
|
|
|
|
|
|
|
css/controls-dark.css
ADDED
@@ -0,0 +1,61 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
|
2 |
+
.tnpc-error, .tnpc-warning, .tnpc-message {
|
3 |
+
background-color: #28313C;
|
4 |
+
color: #fff;
|
5 |
+
}
|
6 |
+
|
7 |
+
#tnp-body table.form-table {
|
8 |
+
border: 1px solid #666;
|
9 |
+
border-radius: 3px;
|
10 |
+
margin-top: 0;
|
11 |
+
margin-bottom: 1em;
|
12 |
+
}
|
13 |
+
|
14 |
+
#tnp-body table.form-table th {
|
15 |
+
width: 150px;
|
16 |
+
}
|
17 |
+
|
18 |
+
#tnp-body table.form-table, #tnp-body table.form-table th {
|
19 |
+
background-color: transparent;
|
20 |
+
color: #fff;
|
21 |
+
}
|
22 |
+
|
23 |
+
#tnp-body table.form-table th, #tnp-body table.form-table td {
|
24 |
+
vertical-align: top;
|
25 |
+
}
|
26 |
+
|
27 |
+
#tnp-body table.form-table td {
|
28 |
+
color: #999;
|
29 |
+
}
|
30 |
+
|
31 |
+
#tnp-body table.form-table p.description {
|
32 |
+
color: #aaa;
|
33 |
+
}
|
34 |
+
|
35 |
+
#tnp-body table.widefat {
|
36 |
+
background-color: transparent !important;
|
37 |
+
}
|
38 |
+
|
39 |
+
#tnp-body table.widefat input[type="text"] {
|
40 |
+
background-color: #28313C;
|
41 |
+
color: #fff !important;
|
42 |
+
}
|
43 |
+
|
44 |
+
#tnp-body table.widefat thead {
|
45 |
+
background-color: #28313C;
|
46 |
+
color: #fff!important;
|
47 |
+
}
|
48 |
+
|
49 |
+
#tnp-body table.widefat td {
|
50 |
+
color: #999;
|
51 |
+
}
|
52 |
+
|
53 |
+
#tnp-body table.widefat tr:nth-child(even) {
|
54 |
+
background-color: #28313C;
|
55 |
+
}
|
56 |
+
|
57 |
+
/* Set of checkboxes */
|
58 |
+
.tnpc-checkboxes label {
|
59 |
+
border: 1px solid #666;
|
60 |
+
background-color: transparent;
|
61 |
+
}
|
css/controls.css
ADDED
@@ -0,0 +1,146 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/* Classes used by controls. Should be prefixed with "tnpc-" */
|
2 |
+
|
3 |
+
|
4 |
+
/* Top page messages */
|
5 |
+
.tnpc-error, .tnpc-warning, .tnpc-message,
|
6 |
+
.tnp-error, .tnp-warning, .tnp-message {
|
7 |
+
background-color: #fff;
|
8 |
+
padding: 15px;
|
9 |
+
margin: 15px 0;
|
10 |
+
font-size: 1.2em;
|
11 |
+
line-height: 1.5em;
|
12 |
+
margin-left: 10px;
|
13 |
+
}
|
14 |
+
|
15 |
+
.tnpc-error, .tnp-error {
|
16 |
+
border-left: 5px solid #dd0000;
|
17 |
+
}
|
18 |
+
|
19 |
+
.tnpc-warning, .tnp-warning {
|
20 |
+
border-left: 5px solid #ffb900;
|
21 |
+
}
|
22 |
+
|
23 |
+
.tnpc-message, .tnp-message {
|
24 |
+
border-left: 5px solid #46b450;
|
25 |
+
}
|
26 |
+
|
27 |
+
|
28 |
+
/* Structure */
|
29 |
+
|
30 |
+
/* Tables with controls */
|
31 |
+
#tnp-body .form-table {
|
32 |
+
background-color: #fff;
|
33 |
+
border: 1px solid #ECF0F1;
|
34 |
+
margin-top: 2em;
|
35 |
+
border-spacing: 4px;
|
36 |
+
border-collapse: separate;
|
37 |
+
}
|
38 |
+
|
39 |
+
#tnp-body .form-table h4,
|
40 |
+
#tnp-body .form-table h3 {
|
41 |
+
color: #444;
|
42 |
+
}
|
43 |
+
|
44 |
+
/* WP has different padding for TH and TD (why???) */
|
45 |
+
#tnp-body .form-table th, #tnp-body .form-table td {
|
46 |
+
padding: 15px;
|
47 |
+
}
|
48 |
+
|
49 |
+
#tnp-body .form-table th {
|
50 |
+
text-align: right;
|
51 |
+
font-weight: bold;
|
52 |
+
max-width: 200px;
|
53 |
+
color: #000000;
|
54 |
+
background-color: #ECF0F1;
|
55 |
+
vertical-align: middle;
|
56 |
+
}
|
57 |
+
|
58 |
+
#tnp-body .form-table th small {
|
59 |
+
font-weight: normal;
|
60 |
+
}
|
61 |
+
|
62 |
+
#tnp-body .form-table textarea {
|
63 |
+
width: 100%;
|
64 |
+
}
|
65 |
+
|
66 |
+
/* Subtables contained in a main form table TD */
|
67 |
+
#tnp-body .form-table td table {
|
68 |
+
border: 0;
|
69 |
+
border-collapse: collapse;
|
70 |
+
}
|
71 |
+
|
72 |
+
#tnp-body .form-table table thead th {
|
73 |
+
text-align: left;
|
74 |
+
font-weight: bold;
|
75 |
+
}
|
76 |
+
|
77 |
+
#tnp-body .form-table td table th {
|
78 |
+
background-color: transparent;
|
79 |
+
text-align: right;
|
80 |
+
width: auto;
|
81 |
+
border: 0;
|
82 |
+
padding: 3px;
|
83 |
+
font-weight: normal;
|
84 |
+
vertical-align: middle;
|
85 |
+
padding-right: 15px;
|
86 |
+
}
|
87 |
+
|
88 |
+
#tnp-body .form-table td table td {
|
89 |
+
background-color: transparent;
|
90 |
+
border: 0;
|
91 |
+
padding: 3px;
|
92 |
+
vertical-align: middle;
|
93 |
+
}
|
94 |
+
|
95 |
+
/* Fix for select 2 */
|
96 |
+
#tnp-body .form-table td ul {
|
97 |
+
margin-left: 0;
|
98 |
+
}
|
99 |
+
|
100 |
+
|
101 |
+
/* Set of checkboxes */
|
102 |
+
.tnpc-checkboxes label {
|
103 |
+
display: block;
|
104 |
+
float: left;
|
105 |
+
width: 250px;
|
106 |
+
border: 1px solid #ccc;
|
107 |
+
background-color: #f4f4f4;
|
108 |
+
margin-bottom: 5px;
|
109 |
+
padding: 5px;
|
110 |
+
white-space: nowrap;
|
111 |
+
margin-right: 5px;
|
112 |
+
overflow: hidden;
|
113 |
+
}
|
114 |
+
|
115 |
+
|
116 |
+
/* Hint text after a field */
|
117 |
+
.tnpc-hint, p.description {
|
118 |
+
margin-top: 15px;
|
119 |
+
clear: both;
|
120 |
+
font-size: 12px !important;
|
121 |
+
color: #666;
|
122 |
+
font-style: italic;
|
123 |
+
}
|
124 |
+
|
125 |
+
/* Color picker */
|
126 |
+
.tnpc-color {
|
127 |
+
width: 40px;
|
128 |
+
font-size: 12px;
|
129 |
+
}
|
130 |
+
|
131 |
+
/* Buttons */
|
132 |
+
.tnpc-button, .tnpc-button:visited, .tnpc-button:hover, .tnpc-button:active {
|
133 |
+
min-width: 3em;
|
134 |
+
text-align: center;
|
135 |
+
color: #fff!important;
|
136 |
+
width: auto;
|
137 |
+
}
|
138 |
+
|
139 |
+
/* Lists select with triggers */
|
140 |
+
.tnpc_lists_notes {
|
141 |
+
color: #999;
|
142 |
+
font-size: .9em;
|
143 |
+
padding: 0px 0 0 15px;
|
144 |
+
border-left: 3px solid #888;
|
145 |
+
margin-top: 10px;
|
146 |
+
}
|
css/dashboard.css
CHANGED
@@ -1,114 +1,9 @@
|
|
1 |
-
|
2 |
-
margin: 0 0 10px 0;
|
3 |
-
padding: 0;
|
4 |
-
}
|
5 |
-
|
6 |
-
#tnp-dashboard .row .tnp-widget {
|
7 |
-
min-height: 350px;
|
8 |
-
padding: 0;
|
9 |
-
text-align: center;
|
10 |
-
}
|
11 |
-
|
12 |
-
/* The widget title */
|
13 |
-
|
14 |
-
#tnp-dashboard h3 {
|
15 |
-
letter-spacing: 0.05rem;
|
16 |
-
background-color: #415b76;
|
17 |
-
color: #fff;
|
18 |
-
margin: 0;
|
19 |
-
padding: 9px;
|
20 |
-
}
|
21 |
-
|
22 |
-
|
23 |
-
#tnp-dashboard h3 a {
|
24 |
-
color: white;
|
25 |
-
text-decoration: none;
|
26 |
-
margin-left: 5px;
|
27 |
-
padding: 2px 8px;
|
28 |
-
background-color: #26C281;
|
29 |
-
border-radius: 2px;
|
30 |
-
font-weight: 300;
|
31 |
-
text-transform: capitalize;
|
32 |
-
font-size: 0.8rem;
|
33 |
-
float: right;
|
34 |
-
}
|
35 |
-
|
36 |
-
#tnp-dashboard h3 a:hover {
|
37 |
-
color: white;
|
38 |
-
text-decoration: none;
|
39 |
-
margin-left: 5px;
|
40 |
-
background-color: #2ECC71;
|
41 |
-
}
|
42 |
-
|
43 |
-
|
44 |
-
/* The widget inner content */
|
45 |
-
|
46 |
-
#tnp-dashboard .tnp-widget .tnp-inner {
|
47 |
-
padding: 15px;
|
48 |
-
}
|
49 |
-
|
50 |
-
|
51 |
-
/* One or more buttons in a row */
|
52 |
-
#tnp-dashboard .tnp-cta {
|
53 |
-
text-align: center;
|
54 |
-
margin-bottom: 15px;
|
55 |
-
}
|
56 |
-
|
57 |
-
#tnp-dashboard .tnp-cta a {
|
58 |
-
display: inline-block;
|
59 |
-
padding: 10px;
|
60 |
-
color: #fff;
|
61 |
-
background-color: green;
|
62 |
-
text-decoration: none;
|
63 |
-
}
|
64 |
-
|
65 |
-
#tnp-dashboard .tnp-cta a:hover {
|
66 |
-
color: #fff;
|
67 |
-
}
|
68 |
-
|
69 |
-
|
70 |
-
#tnp-dashboard .tnp-widget img {
|
71 |
-
max-width: 80%!important;
|
72 |
-
display: block;
|
73 |
-
margin: 0 auto;
|
74 |
-
}
|
75 |
-
|
76 |
-
#tnp-dashboard .tnp-widget table {
|
77 |
-
max-width: 100%;
|
78 |
-
width: 100%;
|
79 |
-
margin: 0;
|
80 |
-
box-sizing: border-box;
|
81 |
-
}
|
82 |
-
|
83 |
-
#tnp-dashboard .tnp-widget table td,
|
84 |
-
#tnp-dashboard .tnp-widget table th
|
85 |
-
{
|
86 |
-
text-align: left;
|
87 |
-
}
|
88 |
-
|
89 |
-
/* Bottoni usati all'interno delle tabelle, magari con la sola icona */
|
90 |
-
#tnp-dashboard .tnp-widget table .button-primary {
|
91 |
-
min-width: 40px;
|
92 |
-
text-align: center;
|
93 |
-
display: inline-block;
|
94 |
-
}
|
95 |
-
|
96 |
-
#tnp-dashboard .tnp-widget .tnp-canvas {
|
97 |
-
position: relative;
|
98 |
-
}
|
99 |
-
|
100 |
-
/* Tnp Dashboard with Flexbox - Redesign */
|
101 |
|
102 |
#wpfooter {
|
103 |
position: relative;
|
104 |
}
|
105 |
|
106 |
-
#tnp-heading h1 {
|
107 |
-
color: #fff;
|
108 |
-
font-family: soleil, sans-serif;
|
109 |
-
font-weight: 900;
|
110 |
-
}
|
111 |
-
|
112 |
.tnp-dashboard {
|
113 |
background-color: #f2f5f9;
|
114 |
color: #222222;
|
1 |
+
/* This is loaded inline in the main/index.php file */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2 |
|
3 |
#wpfooter {
|
4 |
position: relative;
|
5 |
}
|
6 |
|
|
|
|
|
|
|
|
|
|
|
|
|
7 |
.tnp-dashboard {
|
8 |
background-color: #f2f5f9;
|
9 |
color: #222222;
|
css/dashboard.min.css
DELETED
@@ -1 +0,0 @@
|
|
1 |
-
#tnp-body #tnp-dashboard .tnp-widget p{margin:0 0 10px 0;padding:0}#tnp-dashboard .row .tnp-widget{min-height:350px;padding:0;text-align:center}#tnp-dashboard h3{letter-spacing:.05rem;background-color:#415b76;color:#fff;margin:0;padding:9px}#tnp-dashboard h3 a{color:white;text-decoration:none;margin-left:5px;padding:2px 8px;background-color:#26c281;border-radius:2px;font-weight:300;text-transform:capitalize;font-size:.8rem;float:right}#tnp-dashboard h3 a:hover{color:white;text-decoration:none;margin-left:5px;background-color:#2ecc71}#tnp-dashboard .tnp-widget .tnp-inner{padding:15px}#tnp-dashboard .tnp-cta{text-align:center;margin-bottom:15px}#tnp-dashboard .tnp-cta a{display:inline-block;padding:10px;color:#fff;background-color:green;text-decoration:none}#tnp-dashboard .tnp-cta a:hover{color:#fff}#tnp-dashboard .tnp-widget img{max-width:80%!important;display:block;margin:0 auto}#tnp-dashboard .tnp-widget table{max-width:100%;width:100%;margin:0;box-sizing:border-box}#tnp-dashboard .tnp-widget table td,#tnp-dashboard .tnp-widget table th{text-align:left}#tnp-dashboard .tnp-widget table .button-primary{min-width:40px;text-align:center;display:inline-block}#tnp-dashboard .tnp-widget .tnp-canvas{position:relative}
|
|
css/dropdown.css
CHANGED
@@ -2,11 +2,6 @@
|
|
2 |
margin: 0; padding: 0; border: 0;
|
3 |
}
|
4 |
|
5 |
-
/* Removed by Stefano */
|
6 |
-
.tnp-drowpdown li {
|
7 |
-
/*min-width: 150px;*/
|
8 |
-
}
|
9 |
-
|
10 |
.tnp-drowpdown {
|
11 |
margin-top: 10px;
|
12 |
-webkit-transition-timing-function: ease;
|
@@ -65,8 +60,6 @@
|
|
65 |
background-color: #34495E;
|
66 |
/*border: 1px solid #34495E;*/
|
67 |
}
|
68 |
-
.tnp-drowpdown ul li:hover a {
|
69 |
-
}
|
70 |
|
71 |
.tnp-drowpdown ul li a {
|
72 |
display: block;
|
@@ -95,13 +88,10 @@
|
|
95 |
line-height: 1.6em;
|
96 |
}
|
97 |
|
98 |
-
|
99 |
.tnp-drowpdown ul ul li:nth-child(even) {
|
100 |
background-color: #3b3342;
|
101 |
}
|
102 |
|
103 |
-
|
104 |
-
|
105 |
.tnp-drowpdown ul ul li:hover {
|
106 |
background: inherit;
|
107 |
}
|
@@ -117,10 +107,6 @@
|
|
117 |
position: absolute; left: 100%; top:0;
|
118 |
}
|
119 |
|
120 |
-
.tnp-wrap ul li {
|
121 |
-
list-style-type: none;
|
122 |
-
}
|
123 |
-
|
124 |
.tnp-professional-extensions-button {
|
125 |
background-color: #27AE60;
|
126 |
border: 1px solid #27AE60 !important;
|
2 |
margin: 0; padding: 0; border: 0;
|
3 |
}
|
4 |
|
|
|
|
|
|
|
|
|
|
|
5 |
.tnp-drowpdown {
|
6 |
margin-top: 10px;
|
7 |
-webkit-transition-timing-function: ease;
|
60 |
background-color: #34495E;
|
61 |
/*border: 1px solid #34495E;*/
|
62 |
}
|
|
|
|
|
63 |
|
64 |
.tnp-drowpdown ul li a {
|
65 |
display: block;
|
88 |
line-height: 1.6em;
|
89 |
}
|
90 |
|
|
|
91 |
.tnp-drowpdown ul ul li:nth-child(even) {
|
92 |
background-color: #3b3342;
|
93 |
}
|
94 |
|
|
|
|
|
95 |
.tnp-drowpdown ul ul li:hover {
|
96 |
background: inherit;
|
97 |
}
|
107 |
position: absolute; left: 100%; top:0;
|
108 |
}
|
109 |
|
|
|
|
|
|
|
|
|
110 |
.tnp-professional-extensions-button {
|
111 |
background-color: #27AE60;
|
112 |
border: 1px solid #27AE60 !important;
|
css/extensions.css
ADDED
@@ -0,0 +1,150 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/* Used even by the addons manager addon */
|
2 |
+
|
3 |
+
.tnp-extension-premium-box, .tnp-extension-free-box, .tnp-integration-box {
|
4 |
+
width: 300px;
|
5 |
+
height: 220px;
|
6 |
+
background-color: #222B36;
|
7 |
+
text-align: center;
|
8 |
+
margin: 20px;
|
9 |
+
float: left;
|
10 |
+
position: relative;
|
11 |
+
}
|
12 |
+
|
13 |
+
.tnp-extension-premium-box:hover, .tnp-extension-free-box:hover, .tnp-integration-box:hover {
|
14 |
+
background-color: #232C35;
|
15 |
+
box-shadow: 1px 1px 15px #222B36;
|
16 |
+
}
|
17 |
+
|
18 |
+
.tnp-extension-premium-box p, .tnp-extension-free-box p, .tnp-integration-box p {
|
19 |
+
padding: 5px 10px;
|
20 |
+
color: #72777c;
|
21 |
+
font-size: 14px;
|
22 |
+
margin-top: 0px;
|
23 |
+
}
|
24 |
+
|
25 |
+
.tnp-extension-premium-box h3 {
|
26 |
+
font-family: soleil, sans-serif;
|
27 |
+
padding: 5px 8px !important;
|
28 |
+
border-radius: 3px;
|
29 |
+
display: inline-block;
|
30 |
+
font-size: 16px;
|
31 |
+
color: #fff;
|
32 |
+
margin-bottom: 0px !important;
|
33 |
+
margin-top: 25px !important;
|
34 |
+
font-weight: 300;
|
35 |
+
width: auto !important;
|
36 |
+
border-bottom: none !important;
|
37 |
+
}
|
38 |
+
|
39 |
+
.tnp-extension-free-box h3 {
|
40 |
+
font-family: soleil, sans-serif;
|
41 |
+
padding: 5px 8px !important;
|
42 |
+
border-radius: 3px;
|
43 |
+
display: inline-block;
|
44 |
+
font-size: 16px;
|
45 |
+
color: #fff;
|
46 |
+
margin-bottom: 0px !important;
|
47 |
+
margin-top: 25px !important;
|
48 |
+
font-weight: 300;
|
49 |
+
width: auto !important;
|
50 |
+
border-bottom: none !important;
|
51 |
+
}
|
52 |
+
|
53 |
+
.tnp-integration-box h3 {
|
54 |
+
font-family: soleil, sans-serif;
|
55 |
+
padding: 5px 8px !important;
|
56 |
+
border-radius: 3px;
|
57 |
+
display: inline-block;
|
58 |
+
font-size: 16px;
|
59 |
+
color: #fff;
|
60 |
+
margin-bottom: 0px !important;
|
61 |
+
margin-top: 25px !important;
|
62 |
+
font-weight: 300;
|
63 |
+
width: auto !important;
|
64 |
+
border-bottom: none !important;
|
65 |
+
}
|
66 |
+
|
67 |
+
.tnp-extension-premium-action {
|
68 |
+
bottom: 0;
|
69 |
+
position: absolute;
|
70 |
+
width: 100%;
|
71 |
+
padding: 12px;
|
72 |
+
font-family: soleil, sans-serif;
|
73 |
+
}
|
74 |
+
|
75 |
+
.tnp-extension-free-action {
|
76 |
+
bottom: 0;
|
77 |
+
position: absolute;
|
78 |
+
width: 100%;
|
79 |
+
padding: 12px;
|
80 |
+
font-family: soleil, sans-serif;
|
81 |
+
}
|
82 |
+
|
83 |
+
.tnp-integration-action {
|
84 |
+
bottom: 0;
|
85 |
+
position: absolute;
|
86 |
+
width: 100%;
|
87 |
+
padding: 12px;
|
88 |
+
font-family: soleil, sans-serif;
|
89 |
+
}
|
90 |
+
|
91 |
+
|
92 |
+
.tnp-extension-premium-action span {
|
93 |
+
color: #27AE60;
|
94 |
+
}
|
95 |
+
|
96 |
+
.tnp-extension-free-action span {
|
97 |
+
color: #27AE60;
|
98 |
+
}
|
99 |
+
|
100 |
+
.tnp-integration-action span {
|
101 |
+
color: #27AE60;
|
102 |
+
}
|
103 |
+
|
104 |
+
.tnp-extension-activate {
|
105 |
+
color: #1ABC9C;
|
106 |
+
padding: 5px 8px;
|
107 |
+
text-decoration: none;
|
108 |
+
cursor: pointer;
|
109 |
+
}
|
110 |
+
|
111 |
+
.tnp-extension-install {
|
112 |
+
color: #2980B9;
|
113 |
+
padding: 5px 8px;
|
114 |
+
text-decoration: none;
|
115 |
+
cursor: pointer;
|
116 |
+
}
|
117 |
+
|
118 |
+
.tnp-extension-buy {
|
119 |
+
color: #F1C40F;
|
120 |
+
padding: 5px 8px;
|
121 |
+
text-decoration: none;
|
122 |
+
cursor: pointer;
|
123 |
+
}
|
124 |
+
|
125 |
+
#tnp-body a.tnp-extension-details{
|
126 |
+
color: #999999;
|
127 |
+
padding: 5px 8px;
|
128 |
+
text-decoration: none;
|
129 |
+
cursor: pointer;
|
130 |
+
}
|
131 |
+
|
132 |
+
.tnp-extension-free {
|
133 |
+
color: #D35400;
|
134 |
+
padding: 5px 8px;
|
135 |
+
text-decoration: none;
|
136 |
+
cursor: pointer;
|
137 |
+
position: relative;
|
138 |
+
}
|
139 |
+
|
140 |
+
img.tnp-extensions-free-badge {
|
141 |
+
position: absolute;
|
142 |
+
display: block;
|
143 |
+
right: 0;
|
144 |
+
top: 0;
|
145 |
+
width: 70px;
|
146 |
+
}
|
147 |
+
|
148 |
+
.tnp-extensions-image img {
|
149 |
+
margin: 25px 0px -10px;
|
150 |
+
}
|
css/fields.css
CHANGED
@@ -1,7 +1,4 @@
|
|
1 |
-
|
2 |
-
/*.tnp-field {*/
|
3 |
-
/*border: 1px dashed #999;*/
|
4 |
-
/*}*/
|
5 |
|
6 |
/* STRUCTURE */
|
7 |
.tnp-field-row {
|
@@ -167,8 +164,3 @@ tnp-field.tnp-font {
|
|
167 |
font-weight: normal;
|
168 |
color: #999999;
|
169 |
}
|
170 |
-
|
171 |
-
.tnpf-color {
|
172 |
-
width: 40px;
|
173 |
-
font-size: 12px;
|
174 |
-
}
|
1 |
+
|
|
|
|
|
|
|
2 |
|
3 |
/* STRUCTURE */
|
4 |
.tnp-field-row {
|
164 |
font-weight: normal;
|
165 |
color: #999999;
|
166 |
}
|
|
|
|
|
|
|
|
|
|
css/fields.min.css
DELETED
@@ -1 +0,0 @@
|
|
1 |
-
.tnp-field-row{clear:both;margin-left:-10px;margin-right:-10px}.tnp-field-col-2{width:50%;box-sizing:border-box;padding:10px;float:left}.tnp-field-col-3{width:33%;box-sizing:border-box;padding:10px;float:left}.tnp-field-col-20{width:20%;box-sizing:border-box;padding:10px;float:left}.tnp-field-col-33{width:33%;box-sizing:border-box;padding:10px;float:left}.tnp-field-col-66{width:66%;box-sizing:border-box;padding:10px;float:left}.tnp-field-col-80{width:80%;box-sizing:border-box;padding:10px;float:left}.tnp-field.tnp-separator{border-top:1px solid #ddd;line-height:0}.tnp-field{display:block;width:100%;margin-bottom:10px}.tnp-field label.tnp-label,.tnp-field-row label.tnp-row-label{display:block;font-size:12px;font-weight:300;border-bottom:1px solid #fff;margin:25px 0 10px 0;font-family:soleil,sans-serif;font-weight:300;padding-bottom:5px;color:#868686}.tnp-field-row label.tnp-row-label{margin-left:10px}.tnp-field.tnp-checkbox label{display:inline}.tnp-field:not(.tnp-colorpicker) input{width:100%}.tnp-field input[type=number]{width:100px}.tnp-field.tnp-size input{width:60px;display:inline}.tnp-field .tnp-padding-fields{display:inline}.tnp-field .tnp-padding-fields input{width:40px;display:inline}.tnp-field select{width:auto!important;color:#34495e}.tnp-field input[type=url]{font-family:monospace}.tnp-field input[type=color]{width:40px;min-height:30px;vertical-align:middle}.tnp-field input[type=submit]{width:auto}.tnp-field input[type=checkbox]{width:auto}.tnp-field.tnpf-button .tnpf-font-family{font-size:13px}.tnp-field.tnpf-button .tnpf-font-size{font-size:13px}.tnp-field.tnpf-button .tnpf-font-weight{font-size:13px}.tnp-description{margin-top:7px;font-style:italic;font-weight:normal;color:#999}.tnpf-color{width:40px;font-size:12px}
|
|
css/tabs.css
ADDED
@@ -0,0 +1,94 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/* Since #tabs has a white background, all elements should be made dark */
|
2 |
+
|
3 |
+
#tnp-body #tabs h3,
|
4 |
+
#tnp-body #tabs h4,
|
5 |
+
#tnp-body #tabs p,
|
6 |
+
#tnp-body #tabs li,
|
7 |
+
#tnp-body #tabs input,
|
8 |
+
#tnp-body #tabs select,
|
9 |
+
#tnp-body #tabs textarea {
|
10 |
+
color: #444;
|
11 |
+
}
|
12 |
+
|
13 |
+
#tnp-body td .tnp-tabs {
|
14 |
+
|
15 |
+
}
|
16 |
+
|
17 |
+
#tnp-body td .tnp-tabs .ui-widget-header {
|
18 |
+
background-color: #ddd;
|
19 |
+
}
|
20 |
+
|
21 |
+
#tnp-body td .tnp-tabs .ui-tabs-anchor {
|
22 |
+
color: #000;
|
23 |
+
}
|
24 |
+
|
25 |
+
#tnp-body .ui-widget {
|
26 |
+
font-family: soleil, sans-serif;
|
27 |
+
}
|
28 |
+
|
29 |
+
#tnp-body #tabs {
|
30 |
+
background-color: transparent;
|
31 |
+
border: 0!important;
|
32 |
+
padding: 0;
|
33 |
+
margin: 0;
|
34 |
+
}
|
35 |
+
|
36 |
+
#tnp-body #tabs .ui-widget-header {
|
37 |
+
background: #28313C;
|
38 |
+
border: 0;
|
39 |
+
}
|
40 |
+
|
41 |
+
#tnp-body #tabs .ui-tabs-panel {
|
42 |
+
padding: 15px!important;
|
43 |
+
background-color: #fff;
|
44 |
+
}
|
45 |
+
|
46 |
+
#tnp-body #tabs a.ui-tabs-anchor,
|
47 |
+
#tnp-body #tabs a.ui-tabs-anchor:visited {
|
48 |
+
color: #444;
|
49 |
+
}
|
50 |
+
|
51 |
+
#tnp-body .ui-tabs .ui-tabs-nav {
|
52 |
+
padding: 0;
|
53 |
+
margin: 0;
|
54 |
+
}
|
55 |
+
|
56 |
+
#tnp-body .ui-tabs .ui-tabs-nav li a {
|
57 |
+
font-size: 14px;
|
58 |
+
}
|
59 |
+
|
60 |
+
#tnp-body #tabs .ui-tabs {
|
61 |
+
border-color: #28313C;
|
62 |
+
background-color: #28313C;
|
63 |
+
border: 0;
|
64 |
+
}
|
65 |
+
|
66 |
+
#tnp-body #tabs .ui-tabs .ui-tabs-nav {
|
67 |
+
margin: 0;
|
68 |
+
padding: .2em .2em 0 0;
|
69 |
+
background-color: #f2f2f2;
|
70 |
+
}
|
71 |
+
|
72 |
+
#tnp-body #tabs .ui-tabs .ui-tabs-panel {
|
73 |
+
padding: 1em 0;
|
74 |
+
background-color: #f2f2f2;
|
75 |
+
margin: 0;
|
76 |
+
border: 0;
|
77 |
+
}
|
78 |
+
|
79 |
+
#tnp-body .ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active {
|
80 |
+
background: #fff !important;
|
81 |
+
font-weight: normal;
|
82 |
+
font-family: soleil, sans-serif;
|
83 |
+
}
|
84 |
+
|
85 |
+
|
86 |
+
#tnp-body .ui-widget-content {
|
87 |
+
background: #fff;
|
88 |
+
}
|
89 |
+
|
90 |
+
#tnp-body .ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default {
|
91 |
+
border: none;
|
92 |
+
background: #ECF0F1;
|
93 |
+
font-family: soleil, sans-serif;
|
94 |
+
}
|
css/welcome.css
ADDED
@@ -0,0 +1,348 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/* This is loaded inline in the welcome.php page */
|
2 |
+
|
3 |
+
.cd-slider-wrapper {
|
4 |
+
position: relative;
|
5 |
+
width: 100%;
|
6 |
+
height: 90vh;
|
7 |
+
/* hide horizontal scrollbar on IE11 */
|
8 |
+
overflow: hidden;
|
9 |
+
margin: 0 auto;
|
10 |
+
}
|
11 |
+
.cd-slider-wrapper .cd-slider, .cd-slider-wrapper .cd-slider > li {
|
12 |
+
height: 100%;
|
13 |
+
width: 100%;
|
14 |
+
}
|
15 |
+
|
16 |
+
.tnp-logo-big {
|
17 |
+
width: 300px;
|
18 |
+
}
|
19 |
+
|
20 |
+
.tnp-row {
|
21 |
+
display: table-row;
|
22 |
+
}
|
23 |
+
|
24 |
+
.tnp-third {
|
25 |
+
width: 33%;
|
26 |
+
float: left;
|
27 |
+
}
|
28 |
+
|
29 |
+
.tnp-welcome-confirm-button {
|
30 |
+
color: #fff;
|
31 |
+
padding: 10px 30px;
|
32 |
+
background-color: #2ECC71;
|
33 |
+
font-weight: 700;
|
34 |
+
font-size: 15px;
|
35 |
+
box-shadow: 0 20px 38px rgba(0, 0, 0, 0.16);
|
36 |
+
text-decoration: none;
|
37 |
+
display: inline-block;
|
38 |
+
text-align: center;
|
39 |
+
margin: 20px auto 0px;
|
40 |
+
}
|
41 |
+
|
42 |
+
.tnp-welcome-confirm-button:hover {
|
43 |
+
box-shadow: 0 0 38px rgba(0, 0, 0, 0.16);
|
44 |
+
color: #fff;
|
45 |
+
}
|
46 |
+
|
47 |
+
.tnp-welcome-confirm-button:visited {
|
48 |
+
color: #fff;
|
49 |
+
text-decoration: none;
|
50 |
+
}
|
51 |
+
|
52 |
+
.tnp-welcome-link-button {
|
53 |
+
color: #fff;
|
54 |
+
padding: 10px 30px;
|
55 |
+
background-color: #3498DB;
|
56 |
+
font-weight: 700;
|
57 |
+
font-size: 15px;
|
58 |
+
box-shadow: 0 20px 38px rgba(0, 0, 0, 0.16);
|
59 |
+
text-decoration: none;
|
60 |
+
}
|
61 |
+
|
62 |
+
.tnp-welcome-link-button:hover {
|
63 |
+
box-shadow: 0 0 38px rgba(0, 0, 0, 0.16);
|
64 |
+
color: #fff;
|
65 |
+
}
|
66 |
+
|
67 |
+
.tnp-welcome-link-button:visited {
|
68 |
+
color: #fff;
|
69 |
+
text-decoration: none;
|
70 |
+
}
|
71 |
+
|
72 |
+
#tnp-welcome input[type="text"], #tnp-welcome input[type="email"] {
|
73 |
+
max-width: 90%;
|
74 |
+
}
|
75 |
+
|
76 |
+
.tnp-welcome-next {
|
77 |
+
background-color: #2ECC71;
|
78 |
+
padding: 10px 20px;
|
79 |
+
color: white;
|
80 |
+
text-decoration: none;
|
81 |
+
font-weight: 600;
|
82 |
+
font-size: 16px;
|
83 |
+
margin: 0px 10px;
|
84 |
+
box-shadow: 0 10px 30px rgba(0, 0, 0, 0.16);
|
85 |
+
width: -moz-fit-content;
|
86 |
+
width: -webkit-fit-content;
|
87 |
+
width: fit-content;
|
88 |
+
display: flex;
|
89 |
+
align-items: center;
|
90 |
+
}
|
91 |
+
|
92 |
+
.tnp-welcome-next:hover {
|
93 |
+
box-shadow: 0 0 38px rgba(0, 0, 0, 0.16);
|
94 |
+
color: #fff;
|
95 |
+
}
|
96 |
+
|
97 |
+
.tnp-welcome-next:visited {
|
98 |
+
color: #fff;
|
99 |
+
text-decoration: none;
|
100 |
+
}
|
101 |
+
|
102 |
+
.tnp-welcome-prev {
|
103 |
+
background-color: #3498DB;
|
104 |
+
padding: 10px 20px;
|
105 |
+
color: white;
|
106 |
+
text-decoration: none;
|
107 |
+
font-weight: 600;
|
108 |
+
font-size: 16px;
|
109 |
+
margin: 0px 0px 0px 10px;
|
110 |
+
box-shadow: 0 10px 30px rgba(0, 0, 0, 0.16);
|
111 |
+
width: -moz-fit-content;
|
112 |
+
width: -webkit-fit-content;
|
113 |
+
width: fit-content;
|
114 |
+
display: flex;
|
115 |
+
align-items: center;
|
116 |
+
}
|
117 |
+
|
118 |
+
.tnp-welcome-prev:hover {
|
119 |
+
box-shadow: 0 0 38px rgba(0, 0, 0, 0.16);
|
120 |
+
color: #fff;
|
121 |
+
}
|
122 |
+
|
123 |
+
.tnp-welcome-prev:visited {
|
124 |
+
color: #fff;
|
125 |
+
text-decoration: none;
|
126 |
+
}
|
127 |
+
|
128 |
+
.tnp-welcome-next svg {
|
129 |
+
margin-left: 10px;
|
130 |
+
}
|
131 |
+
|
132 |
+
.tnp-welcome-prev svg {
|
133 |
+
margin-right: 10px;
|
134 |
+
}
|
135 |
+
|
136 |
+
.cd-slider input {
|
137 |
+
width: 250px;
|
138 |
+
height: 40px;
|
139 |
+
border: 1px solid #6c7280;
|
140 |
+
background: #454a56;
|
141 |
+
color: white;
|
142 |
+
color: white;
|
143 |
+
padding: 0px 10px;
|
144 |
+
}
|
145 |
+
|
146 |
+
.cd-slider > li {
|
147 |
+
position: absolute;
|
148 |
+
top: 0;
|
149 |
+
left: 0;
|
150 |
+
opacity: 0;
|
151 |
+
/* used to vertically center its content */
|
152 |
+
display: table;
|
153 |
+
background-position: center center;
|
154 |
+
background-repeat: no-repeat;
|
155 |
+
-webkit-font-smoothing: antialiased;
|
156 |
+
-moz-osx-font-smoothing: grayscale;
|
157 |
+
}
|
158 |
+
.cd-slider > li.visible {
|
159 |
+
/* selected slide */
|
160 |
+
position: relative;
|
161 |
+
z-index: 2;
|
162 |
+
opacity: 1;
|
163 |
+
}
|
164 |
+
.cd-slider > li:first-of-type {
|
165 |
+
background-color: #2B313A;
|
166 |
+
}
|
167 |
+
.cd-slider > li:nth-of-type(2) {
|
168 |
+
background-color: #2B313A;
|
169 |
+
}
|
170 |
+
.cd-slider > li:nth-of-type(3) {
|
171 |
+
background-color: #2B313A;
|
172 |
+
}
|
173 |
+
.cd-slider > li:nth-of-type(4) {
|
174 |
+
background-color: #2B313A;
|
175 |
+
}
|
176 |
+
.cd-slider > li:first-of-type, .cd-slider > li:nth-of-type(2), .cd-slider > li:nth-of-type(3), .cd-slider > li:nth-of-type(4) {
|
177 |
+
background-size: cover;
|
178 |
+
}
|
179 |
+
.cd-slider > li > div {
|
180 |
+
/* vertically center the slider content */
|
181 |
+
display: table-cell;
|
182 |
+
vertical-align: middle;
|
183 |
+
text-align: center;
|
184 |
+
}
|
185 |
+
.cd-slider > li h2, .cd-slider > li p {
|
186 |
+
text-shadow: 0 1px 3px rgba(0, 0, 0, 0.1);
|
187 |
+
line-height: 1.2;
|
188 |
+
margin: 0 auto 14px;
|
189 |
+
color: #ffffff;
|
190 |
+
width: 90%;
|
191 |
+
max-width: 320px;
|
192 |
+
}
|
193 |
+
.cd-slider > li h2 {
|
194 |
+
font-size: 40px;
|
195 |
+
}
|
196 |
+
.cd-slider > li p {
|
197 |
+
font-size: 18px;
|
198 |
+
line-height: 26px;
|
199 |
+
text-align: left;
|
200 |
+
color: #B8C3C9;
|
201 |
+
margin: 40px auto;
|
202 |
+
}
|
203 |
+
|
204 |
+
.cd-slider > li .cd-btn {
|
205 |
+
display: inline-block;
|
206 |
+
padding: 1.2em 1.4em;
|
207 |
+
margin-top: .8em;
|
208 |
+
background-color: rgba(0, 0, 0, 0.6);
|
209 |
+
border-radius: .25em;
|
210 |
+
font-size: 1.3rem;
|
211 |
+
font-weight: 700;
|
212 |
+
letter-spacing: 1px;
|
213 |
+
color: #ffffff;
|
214 |
+
text-transform: uppercase;
|
215 |
+
-webkit-transition: background-color 0.2s;
|
216 |
+
-moz-transition: background-color 0.2s;
|
217 |
+
transition: background-color 0.2s;
|
218 |
+
}
|
219 |
+
.no-touch .cd-slider > li .cd-btn:hover {
|
220 |
+
background-color: rgba(0, 0, 0, 0.8);
|
221 |
+
}
|
222 |
+
@media only screen and (min-width: 768px) {
|
223 |
+
.cd-slider > li h2, .cd-slider > li p {
|
224 |
+
max-width: 520px;
|
225 |
+
}
|
226 |
+
.cd-slider > li h2 {
|
227 |
+
font-size: 40px;
|
228 |
+
}
|
229 |
+
.cd-slider > li p {
|
230 |
+
font-size: 18px;
|
231 |
+
line-height: 26px;
|
232 |
+
text-align: left;
|
233 |
+
color: #B8C3C9;
|
234 |
+
margin: 40px auto;
|
235 |
+
|
236 |
+
}
|
237 |
+
}
|
238 |
+
@media only screen and (min-width: 1170px) {
|
239 |
+
.cd-slider > li h2, .cd-slider > li p {
|
240 |
+
margin-bottom: 20px;
|
241 |
+
}
|
242 |
+
.cd-slider > li h2 {
|
243 |
+
font-size: 40px;
|
244 |
+
}
|
245 |
+
.cd-slider > li p {
|
246 |
+
font-size: 18px;
|
247 |
+
line-height: 26px;
|
248 |
+
text-align: center;
|
249 |
+
color: #B8C3C9;
|
250 |
+
margin: 30px auto;
|
251 |
+
}
|
252 |
+
}
|
253 |
+
|
254 |
+
/* --------------------------------
|
255 |
+
|
256 |
+
Tnp Welcome Slider Navigation
|
257 |
+
|
258 |
+
-------------------------------- */
|
259 |
+
.cd-slider-navigation {
|
260 |
+
position: relative;
|
261 |
+
bottom: 110px;
|
262 |
+
z-index: 3;
|
263 |
+
display: flex;
|
264 |
+
justify-content: center;
|
265 |
+
}
|
266 |
+
|
267 |
+
/* svg cover layer */
|
268 |
+
|
269 |
+
.cd-svg-cover {
|
270 |
+
position: absolute;
|
271 |
+
z-index: 1;
|
272 |
+
left: 0;
|
273 |
+
top: 0;
|
274 |
+
height: 100%;
|
275 |
+
width: 100%;
|
276 |
+
opacity: 0;
|
277 |
+
}
|
278 |
+
.cd-svg-cover path {
|
279 |
+
fill: #ED6A6A;
|
280 |
+
}
|
281 |
+
.cd-svg-cover.is-animating {
|
282 |
+
z-index: 4;
|
283 |
+
opacity: 1;
|
284 |
+
-webkit-transition: opacity 0.6s;
|
285 |
+
-moz-transition: opacity 0.6s;
|
286 |
+
transition: opacity 0.6s;
|
287 |
+
}
|
288 |
+
|
289 |
+
/* Switch element style */
|
290 |
+
|
291 |
+
/* The switch - the box around the slider */
|
292 |
+
.switch {
|
293 |
+
position: relative;
|
294 |
+
display: inline-block;
|
295 |
+
width: 60px;
|
296 |
+
height: 34px;
|
297 |
+
}
|
298 |
+
|
299 |
+
/* Hide default HTML checkbox */
|
300 |
+
.switch input {display:none;}
|
301 |
+
|
302 |
+
/* The slider */
|
303 |
+
.slider {
|
304 |
+
position: absolute;
|
305 |
+
cursor: pointer;
|
306 |
+
top: 0;
|
307 |
+
left: 0;
|
308 |
+
right: 0;
|
309 |
+
bottom: 0;
|
310 |
+
background-color: #ccc;
|
311 |
+
-webkit-transition: .4s;
|
312 |
+
transition: .4s;
|
313 |
+
}
|
314 |
+
|
315 |
+
.slider:before {
|
316 |
+
position: absolute;
|
317 |
+
content: "";
|
318 |
+
height: 26px;
|
319 |
+
width: 26px;
|
320 |
+
left: 4px;
|
321 |
+
bottom: 4px;
|
322 |
+
background-color: white;
|
323 |
+
-webkit-transition: .4s;
|
324 |
+
transition: .4s;
|
325 |
+
}
|
326 |
+
|
327 |
+
input:checked + .slider {
|
328 |
+
background-color: #2196F3;
|
329 |
+
}
|
330 |
+
|
331 |
+
input:focus + .slider {
|
332 |
+
box-shadow: 0 0 1px #2196F3;
|
333 |
+
}
|
334 |
+
|
335 |
+
input:checked + .slider:before {
|
336 |
+
-webkit-transform: translateX(26px);
|
337 |
+
-ms-transform: translateX(26px);
|
338 |
+
transform: translateX(26px);
|
339 |
+
}
|
340 |
+
|
341 |
+
/* Rounded sliders */
|
342 |
+
.slider.round {
|
343 |
+
border-radius: 34px;
|
344 |
+
}
|
345 |
+
|
346 |
+
.slider.round:before {
|
347 |
+
border-radius: 50%;
|
348 |
+
}
|
emails/edit.php
CHANGED
@@ -1,4 +1,5 @@
|
|
1 |
<?php
|
|
|
2 |
defined('ABSPATH') || exit;
|
3 |
|
4 |
/* @var $wpdb wpdb */
|
@@ -15,7 +16,7 @@ function tnp_prepare_controls($email, $controls) {
|
|
15 |
}
|
16 |
|
17 |
// Always required
|
18 |
-
$email = $
|
19 |
|
20 |
if (empty($email)) {
|
21 |
echo 'Wrong email identifier';
|
@@ -27,28 +28,28 @@ $email_id = $email['id'];
|
|
27 |
/* Satus changes which require a reload */
|
28 |
if ($controls->is_action('pause')) {
|
29 |
$wpdb->update(NEWSLETTER_EMAILS_TABLE, array('status' => 'paused'), array('id' => $email_id));
|
30 |
-
$email = $
|
31 |
tnp_prepare_controls($email, $controls);
|
32 |
}
|
33 |
|
34 |
if ($controls->is_action('continue')) {
|
35 |
$wpdb->update(NEWSLETTER_EMAILS_TABLE, array('status' => 'sending'), array('id' => $email_id));
|
36 |
-
$email = $
|
37 |
tnp_prepare_controls($email, $controls);
|
38 |
}
|
39 |
|
40 |
if ($controls->is_action('abort')) {
|
41 |
$wpdb->query("update " . NEWSLETTER_EMAILS_TABLE . " set last_id=0, sent=0, status='new' where id=" . $email_id);
|
42 |
-
$email = $
|
43 |
tnp_prepare_controls($email, $controls);
|
44 |
$controls->messages = __('Delivery definitively cancelled', 'newsletter');
|
45 |
}
|
46 |
|
47 |
if ($controls->is_action('change-private')) {
|
48 |
-
$data =
|
49 |
$data['private'] = $controls->data['private'] ? 1 : 0;
|
50 |
$data['id'] = $email['id'];
|
51 |
-
$email =
|
52 |
$controls->add_message_saved();
|
53 |
|
54 |
tnp_prepare_controls($email, $controls);
|
@@ -93,7 +94,7 @@ if (!$controls->is_action()) {
|
|
93 |
|
94 |
if ($controls->is_action('html')) {
|
95 |
|
96 |
-
$data =
|
97 |
$data['editor'] = NewsletterEmails::EDITOR_HTML;
|
98 |
$data['id'] = $email_id;
|
99 |
|
@@ -102,7 +103,7 @@ if ($controls->is_action('html')) {
|
|
102 |
unset($data['options']['composer']);
|
103 |
// End backward compatibility
|
104 |
|
105 |
-
$email =
|
106 |
$controls->messages = 'You can now edit the newsletter as pure HTML';
|
107 |
|
108 |
tnp_prepare_controls($email, $controls);
|
1 |
<?php
|
2 |
+
/* @var $this NewsletterEmails */
|
3 |
defined('ABSPATH') || exit;
|
4 |
|
5 |
/* @var $wpdb wpdb */
|
16 |
}
|
17 |
|
18 |
// Always required
|
19 |
+
$email = $this->get_email($_GET['id'], ARRAY_A);
|
20 |
|
21 |
if (empty($email)) {
|
22 |
echo 'Wrong email identifier';
|
28 |
/* Satus changes which require a reload */
|
29 |
if ($controls->is_action('pause')) {
|
30 |
$wpdb->update(NEWSLETTER_EMAILS_TABLE, array('status' => 'paused'), array('id' => $email_id));
|
31 |
+
$email = $this->get_email($_GET['id'], ARRAY_A);
|
32 |
tnp_prepare_controls($email, $controls);
|
33 |
}
|
34 |
|
35 |
if ($controls->is_action('continue')) {
|
36 |
$wpdb->update(NEWSLETTER_EMAILS_TABLE, array('status' => 'sending'), array('id' => $email_id));
|
37 |
+
$email = $this->get_email($_GET['id'], ARRAY_A);
|
38 |
tnp_prepare_controls($email, $controls);
|
39 |
}
|
40 |
|
41 |
if ($controls->is_action('abort')) {
|
42 |
$wpdb->query("update " . NEWSLETTER_EMAILS_TABLE . " set last_id=0, sent=0, status='new' where id=" . $email_id);
|
43 |
+
$email = $this->get_email($_GET['id'], ARRAY_A);
|
44 |
tnp_prepare_controls($email, $controls);
|
45 |
$controls->messages = __('Delivery definitively cancelled', 'newsletter');
|
46 |
}
|
47 |
|
48 |
if ($controls->is_action('change-private')) {
|
49 |
+
$data = [];
|
50 |
$data['private'] = $controls->data['private'] ? 1 : 0;
|
51 |
$data['id'] = $email['id'];
|
52 |
+
$email = $this->save_email($data, ARRAY_A);
|
53 |
$controls->add_message_saved();
|
54 |
|
55 |
tnp_prepare_controls($email, $controls);
|
94 |
|
95 |
if ($controls->is_action('html')) {
|
96 |
|
97 |
+
$data = [];
|
98 |
$data['editor'] = NewsletterEmails::EDITOR_HTML;
|
99 |
$data['id'] = $email_id;
|
100 |
|
103 |
unset($data['options']['composer']);
|
104 |
// End backward compatibility
|
105 |
|
106 |
+
$email = $this->save_email($data, ARRAY_A);
|
107 |
$controls->messages = 'You can now edit the newsletter as pure HTML';
|
108 |
|
109 |
tnp_prepare_controls($email, $controls);
|
emails/index.php
CHANGED
@@ -33,9 +33,8 @@ if ($controls->is_action('delete_selected')) {
|
|
33 |
$controls->messages .= $r . ' message(s) deleted';
|
34 |
}
|
35 |
|
36 |
-
$pagination_controller = new TNP_Pagination_Controller(
|
37 |
-
$emails
|
38 |
-
|
39 |
?>
|
40 |
|
41 |
<div class="wrap tnp-emails tnp-emails-index" id="tnp-wrap">
|
@@ -55,7 +54,7 @@ $emails = $pagination_controller->get_items();
|
|
55 |
|
56 |
<a href="<?php echo $this->get_admin_page_url('composer'); ?>" class="button-primary"><?php _e('New newsletter', 'newsletter') ?></a>
|
57 |
|
58 |
-
|
59 |
|
60 |
<?php $pagination_controller->display_paginator(); ?>
|
61 |
|
@@ -77,8 +76,7 @@ $emails = $pagination_controller->get_items();
|
|
77 |
</thead>
|
78 |
|
79 |
<tbody>
|
80 |
-
<?php
|
81 |
-
foreach ($emails as $email) { ?>
|
82 |
<tr>
|
83 |
<td><input type="checkbox" class="tnp-selector" name="ids[]" value="<?php echo $email->id; ?>"/></td>
|
84 |
<td><?php echo $email->id; ?></td>
|
@@ -94,19 +92,22 @@ $emails = $pagination_controller->get_items();
|
|
94 |
<?php $this->show_email_status_label($email) ?>
|
95 |
</td>
|
96 |
<td>
|
97 |
-
<?php $this->show_email_progress_bar($email, array('numbers'=>true)) ?>
|
98 |
</td>
|
99 |
<td><?php if ($email->status == 'sent' || $email->status == 'sending') echo $this->format_date($email->send_on); ?></td>
|
100 |
<td>
|
101 |
<?php echo $this->get_edit_button($email) ?>
|
102 |
</td>
|
103 |
|
104 |
-
<td>
|
105 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
106 |
</td>
|
107 |
-
<td><a class="button-primary" target="_blank" rel="noopener" href="<?php echo home_url('/')?>?na=view&id=<?php echo $email->id; ?>"><i class="fas fa-eye"></i> <?php _e('View', 'newsletter')?></a></td>
|
108 |
-
<td><?php $controls->button_copy($email->id); ?></td>
|
109 |
-
<td><?php $controls->button_delete($email->id); ?></td>
|
110 |
</tr>
|
111 |
<?php } ?>
|
112 |
</tbody>
|
33 |
$controls->messages .= $r . ' message(s) deleted';
|
34 |
}
|
35 |
|
36 |
+
$pagination_controller = new TNP_Pagination_Controller(NEWSLETTER_EMAILS_TABLE, 'id', ['type' => 'message']);
|
37 |
+
$emails = $pagination_controller->get_items();
|
|
|
38 |
?>
|
39 |
|
40 |
<div class="wrap tnp-emails tnp-emails-index" id="tnp-wrap">
|
54 |
|
55 |
<a href="<?php echo $this->get_admin_page_url('composer'); ?>" class="button-primary"><?php _e('New newsletter', 'newsletter') ?></a>
|
56 |
|
57 |
+
<?php $controls->button_confirm('delete_selected', __('Delete selected newsletters', 'newsletter')); ?>
|
58 |
|
59 |
<?php $pagination_controller->display_paginator(); ?>
|
60 |
|
76 |
</thead>
|
77 |
|
78 |
<tbody>
|
79 |
+
<?php foreach ($emails as $email) { ?>
|
|
|
80 |
<tr>
|
81 |
<td><input type="checkbox" class="tnp-selector" name="ids[]" value="<?php echo $email->id; ?>"/></td>
|
82 |
<td><?php echo $email->id; ?></td>
|
92 |
<?php $this->show_email_status_label($email) ?>
|
93 |
</td>
|
94 |
<td>
|
95 |
+
<?php $this->show_email_progress_bar($email, array('numbers' => true)) ?>
|
96 |
</td>
|
97 |
<td><?php if ($email->status == 'sent' || $email->status == 'sending') echo $this->format_date($email->send_on); ?></td>
|
98 |
<td>
|
99 |
<?php echo $this->get_edit_button($email) ?>
|
100 |
</td>
|
101 |
|
102 |
+
<td style="white-space: nowrap">
|
103 |
+
<?php $controls->button_icon_statistics(NewsletterStatistics::instance()->get_statistics_url($email->id)) ?>
|
104 |
+
<?php $controls->button_icon_view(home_url('/') . '?na=view&id=' . $email->id) ?>
|
105 |
+
</td>
|
106 |
+
|
107 |
+
<td style="white-space: nowrap">
|
108 |
+
<?php $controls->button_icon_copy($email->id); ?>
|
109 |
+
<?php $controls->button_icon_delete($email->id); ?>
|
110 |
</td>
|
|
|
|
|
|
|
111 |
</tr>
|
112 |
<?php } ?>
|
113 |
</tbody>
|
emails/new.php
CHANGED
@@ -109,6 +109,21 @@ if ($controls->is_action('create')) {
|
|
109 |
$controls->data['id'] = $theme_id;
|
110 |
}
|
111 |
?>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
112 |
|
113 |
<div class="wrap tnp-emails tnp-emails-new" id="tnp-wrap">
|
114 |
|
109 |
$controls->data['id'] = $theme_id;
|
110 |
}
|
111 |
?>
|
112 |
+
<style>
|
113 |
+
#tnp-body .tnp-emails-theme-options {
|
114 |
+
background-color: #fff;
|
115 |
+
padding: 10px;
|
116 |
+
margin-top: 14px;
|
117 |
+
}
|
118 |
+
|
119 |
+
#tnp-body .tnp-emails-theme-options table.form-table {
|
120 |
+
margin: 0;
|
121 |
+
}
|
122 |
+
|
123 |
+
#tnp-body .tnp-emails-theme-options h3 {
|
124 |
+
color: #000;
|
125 |
+
}
|
126 |
+
</style>
|
127 |
|
128 |
<div class="wrap tnp-emails tnp-emails-new" id="tnp-wrap">
|
129 |
|
emails/subjects.php
CHANGED
@@ -3,10 +3,6 @@
|
|
3 |
jQuery("#tnp-edit-subjects").show();
|
4 |
}
|
5 |
|
6 |
-
function tnp_emoji() {
|
7 |
-
jQuery("#tnp-edit-emoji").show();
|
8 |
-
}
|
9 |
-
|
10 |
jQuery(function () {
|
11 |
jQuery("#tnp-edit-subjects-list a").click(function (e) {
|
12 |
e.preventDefault();
|
@@ -15,12 +11,6 @@
|
|
15 |
jQuery("#tnp-edit-subjects").hide();
|
16 |
});
|
17 |
|
18 |
-
jQuery("#tnp-edit-emoji-list a").click(function (e) {
|
19 |
-
e.preventDefault();
|
20 |
-
document.getElementById("options-subject").value = this.title + document.getElementById("options-subject").value;
|
21 |
-
jQuery("#tnp-edit-emoji").hide();
|
22 |
-
});
|
23 |
-
|
24 |
jQuery(".tnp-popup-close").click(function () {
|
25 |
jQuery(this).parent().parent().hide();
|
26 |
|
3 |
jQuery("#tnp-edit-subjects").show();
|
4 |
}
|
5 |
|
|
|
|
|
|
|
|
|
6 |
jQuery(function () {
|
7 |
jQuery("#tnp-edit-subjects-list a").click(function (e) {
|
8 |
e.preventDefault();
|
11 |
jQuery("#tnp-edit-subjects").hide();
|
12 |
});
|
13 |
|
|
|
|
|
|
|
|
|
|
|
|
|
14 |
jQuery(".tnp-popup-close").click(function () {
|
15 |
jQuery(this).parent().parent().hide();
|
16 |
|
emails/tnp-composer/_css/newsletter-builder-v2.css
CHANGED
@@ -523,15 +523,6 @@ iframe#tnpc-mobile-preview {
|
|
523 |
color: #E74C3C;
|
524 |
}
|
525 |
|
526 |
-
.tnpc-edit-box-content-field .iris-square {
|
527 |
-
margin-right: 10px;
|
528 |
-
}
|
529 |
-
|
530 |
-
.tnpc-edit-box-content-field .iris-picker .iris-slider {
|
531 |
-
height: 100% !important;
|
532 |
-
}
|
533 |
-
|
534 |
-
|
535 |
|
536 |
/* Tnp Composer Preview */
|
537 |
|
523 |
color: #E74C3C;
|
524 |
}
|
525 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
526 |
|
527 |
/* Tnp Composer Preview */
|
528 |
|
emails/tnp-composer/_css/newsletter-builder-v2.min.css
DELETED
@@ -1 +0,0 @@
|
|
1 |
-
#wpbody-content{padding-bottom:15px}#newsletter-builder{height:calc(100vh - 120px);display:flex;flex-flow:row;position:relative;overflow:hidden;box-sizing:border-box}#newsletter-builder-area{display:flex;flex-flow:column;background-color:#fff;width:800px;box-sizing:border-box;border-radius:10px;overflow:hidden;float:left}#newsletter-builder-sidebar{display:flex;flex-flow:column;width:450px;background-color:#ecf0f1;margin-left:20px;overflow-y:scroll;position:relative}#tnpc-subject-wrap{border-bottom:1px solid #ccc;padding-bottom:20px;padding-top:20px;padding-left:20px}#tnpc-subject-wrap th{color:#999;font-size:14px;font-weight:normal!important;text-align:right;padding-right:10px;padding-bottom:10px;vertical-align:middle}#tnpc-subject-wrap td{color:#000;font-size:14px;font-weight:normal!important;text-align:left;padding-right:10px;padding-bottom:10px;vertical-align:middle}#tnpc-subject input[type=text]{width:550px;font-size:16px;margin-right:15px;border:1px solid #ddd}#tnpc-subject i{font-size:18px}.tnp-composer-heading{background-color:#0073aa;border-radius:0!important;position:fixed;bottom:0;right:0;left:56px;z-index:1000}.tnp-composer-heading h2{display:inline-block;margin-left:30px!important;text-transform:none!important;font-weight:400!important}.tnp-composer-heading a{display:inline-block;margin-left:30px}.tnp-composer-heading form{display:inline-block;margin-left:30px}.tnp-composer-heading img{width:50px;vertical-align:middle}#newsletter-builder-sidebar h4{color:#868686;font-family:Montserrat,sans-serif;font-weight:300;border-bottom:1px solid #fff;padding-bottom:10px}#newsletter-builder-sidebar .newsletter-sidebar-add-buttons img{width:150px;height:auto}.newsletter-sidebar-add-buttons{border-radius:4px;padding:5px;margin:5px}.tnp-body-lite{background-color:#fff!important}.newsletter-sidebar-buttons-content-tab{margin:1px;position:relative;display:inline-block}.newsletter-sidebar-buttons-content-tab:hover{cursor:move}.newsletter-sidebar-buttons-content-tab:hover img{opacity:.8}.newsletter-sidebar-buttons-content-tab:hover .newsletter-sidebar-buttons-content-tab-add{opacity:.5}.newsletter-sidebar-buttons-content-tab-add{height:100%;width:100%;background-color:rgba(70,70,70,1);position:absolute;left:0;top:0;-webkit-transition:all .5s;-moz-transition:all .5s;-o-transition:all .5s;transition:all .5s;z-index:2;opacity:0;text-align:center;line-height:inherit;color:white}.newsletter-sidebar-buttons-content-tab-add:hover{background-color:rgba(0,0,0,1)}#newsletter-builder-area-center-frame-content{min-height:50px;padding-bottom:75px;background-color:#ecf0f1;padding-top:30px;overflow-y:scroll}#newsletter-mobile-preview-area{margin-left:30px;box-sizing:border-box;margin-top:30px;text-align:center;border:1px solid #ddd;border-radius:10px;padding-left:10px;padding-right:10px;padding-top:10px}#newsletter-mobile-preview-area input{width:100px}iframe#tnpc-mobile-preview{height:550px;box-sizing:border-box;width:320px;border-radius:10px;margin-top:20px;margin-left:20px;background-color:#f6f8fd}.tnpc-row{-webkit-transition:box-shadow .5s;-moz-transition:box-shadow .5s;-o-transition:box-shadow .5s;transition:box-shadow .5s;position:relative}.tnpc-row:hover{cursor:move;-webkit-box-shadow:0 0 20px 0 rgba(0,0,0,0.2);-moz-box-shadow:0 0 20px 0 rgba(0,0,0,0.2);box-shadow:0 0 20px 0 rgba(0,0,0,0.2)}.tnpc-row.ui-sortable-helper{max-width:700px!important}.tnpc-row-delete,.tnpc-row-edit-block,.tnpc-row-clone{height:30px;width:30px;top:0;background-color:rgba(255,255,255,0.5);z-index:5;position:absolute;color:rgba(102,102,102,1);-webkit-transition:all .5s;-moz-transition:all .5s;-o-transition:all .5s;transition:all .5s;opacity:0;text-align:center;font-size:18px}.tnpc-row-delete i,.tnpc-row-edit-block i,.tnpc-row-clone i{line-height:30px}.tnpc-row-delete:hover{background-color:#e74c3c;cursor:pointer;color:rgba(255,255,255,1)}.tnpc-row:hover .tnpc-row-delete,.tnpc-row:hover .tnpc-row-edit-block,.tnpc-row:hover .tnpc-row-clone{opacity:1}.tnpc-row-delete{right:0;z-index:5}.tnpc-row-edit-block{right:60px}.tnpc-row-edit-block:hover{background-color:#e0e0e0;cursor:pointer;color:rgba(0,0,0,1)}.tnpc-row-clone{right:30px}.tnpc-row-clone:hover{background-color:#e0e0e0;cursor:pointer;color:rgba(0,0,0,1)}.tnpc-row-edit{position:relative}.tnpc-row-edit-hover{height:100%;width:100%;background-color:rgba(63,141,191,0.8);position:absolute;left:0;top:0;cursor:default;-webkit-transition:all .5s;-moz-transition:all .5s;-o-transition:all .5s;transition:all .5s}.tnpc-row-edit-hover i{position:absolute;height:30px;width:30px;line-height:30px;left:50%;top:50%;text-align:center;margin-top:-15px;margin-left:-15px;color:rgba(255,255,255,1);-webkit-transition:all .5s;-moz-transition:all .5s;-o-transition:all .5s;transition:all .5s;-webkit-border-radius:50%;-moz-border-radius:50%;border-radius:50%;font-size:16px}.tnpc-row-edit-hover i:hover{background-color:rgba(0,0,0,0.5);cursor:pointer}.tnpc-drop-here{padding:10px;text-align:center}.tnpc-edit{height:100vh;width:100vw;z-index:10;display:none;position:absolute;top:0;left:0}.tnpc-edit-box-title{width:100%;font-size:29px;color:#666;font-weight:300;margin-bottom:40px}.tnpc-edit-box-content{width:100%;margin-top:10px}.tnpc-edit-box-content-text{width:100%;font-size:15px;color:#666;font-weight:600;margin:15px 0 10px;text-transform:uppercase}.tnpc-edit-box-content-text span{font-size:11px;color:#95a5a6;background-color:#d3eadc;padding:2px 5px;text-transform:none;border-radius:5px}.tnpc-edit-box-content-field{width:100%}.tnpc-edit-box-content-field-input{height:33px;width:380px;border:none!important;outline:0;font-family:inherit;padding-right:10px;font-size:15px;-webkit-transition:all .5s;-moz-transition:all .5s;-o-transition:all .5s;transition:all .5s;color:rgba(102,102,102,1);margin-bottom:10px}.tnpc-edit-box-content-field-input:focus{-webkit-box-shadow:inset 0 0 10px 0 rgba(0,0,0,0.2);-moz-box-shadow:inset 0 0 10px 0 rgba(0,0,0,0.2);box-shadow:inset 0 0 10px 0 rgba(0,0,0,0.2)}.tnpc-edit-box-content-field-textarea{height:180px;width:380px;border:1px solid rgba(204,204,204,1);outline:0;font-family:inherit;font-size:15px;-webkit-transition:all .5s;-moz-transition:all .5s;-o-transition:all .5s;transition:all .5s;color:rgba(102,102,102,1);resize:none;padding:10px}.tnpc-edit-box-content-field-textarea:focus{-webkit-box-shadow:inset 0 0 10px 0 rgba(0,0,0,0.2);-moz-box-shadow:inset 0 0 10px 0 rgba(0,0,0,0.2);box-shadow:inset 0 0 10px 0 rgba(0,0,0,0.2)}.tnpc-edit-box-content-icons{height:388px;width:388px;border:1px solid rgba(204,204,204,1);margin-top:15px;overflow-y:scroll}.tnpc-edit-box-content-icons i{line-height:50px;background-color:rgba(225,225,225,1);height:50px;width:50px;margin-top:10px;margin-left:10px;text-align:center;-webkit-transition:all .5s;-moz-transition:all .5s;-o-transition:all .5s;transition:all .5s;font-size:28px;color:rgba(51,51,51,1)}.tnpc-edit-box-content-icons i:hover{cursor:pointer;background-color:rgba(153,153,153,1);-webkit-border-radius:50%;-moz-border-radius:50%;border-radius:50%;color:rgba(0,0,0,1)}.tnpc-edit-box-buttons{margin-top:10px;text-align:right;margin-right:10px}.tnpc-edit-box-buttons-save{height:35px;text-align:right;line-height:35px;color:#27ae60;font-weight:600;font-size:15px;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;-webkit-transition:background .5s;-moz-transition:background .5s;-o-transition:background .5s;transition:background .5s;cursor:pointer;display:inline-block}.tnpc-edit-box-buttons-save:hover{color:#2ecc71}.tnpc-edit-box-buttons-cancel{height:35px;text-align:right;line-height:35px;color:#666;font-weight:normal;font-size:15px;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;-webkit-transition:background .5s;-moz-transition:background .5s;-o-transition:background .5s;transition:background .5s;cursor:pointer;display:inline-block;margin-right:25px}.tnpc-edit-box-buttons-cancel:hover{color:#e74c3c}.tnpc-edit-box-content-field .iris-square{margin-right:10px}.tnpc-edit-box-content-field .iris-picker .iris-slider{height:100%!important}.tnpc-subject a{font-family:Source Sans Pro;font-weight:700;text-transform:uppercase;text-decoration:none;background-color:#3498db;color:white;padding:2px 10px;border-radius:10px;font-size:13px;letter-spacing:.1em}.tnpc-preview{margin-top:10px}.tnpc-preview .fake-browser-ui iframe{width:700px}.tnpc-preview .fake-mobile-browser-ui iframe{width:320px}.fake-browser-ui{padding:30px 0 0;border-radius:3px;border-bottom:10px solid #ccc;background:#ddd;display:inline-block;position:relative;line-height:0;vertical-align:top;margin-left:20px}.fake-mobile-browser-ui{padding:30px 10px 37px;border-radius:10px;border-bottom:10px solid #ccc;background:#ddd;display:inline-block;position:relative;line-height:0;margin-left:30px}.fake-browser-ui .frame{display:block;height:25px;position:absolute;top:12px;left:8px}.fake-mobile-browser-ui .frame{display:block;height:25px;margin-top:10px}.fake-browser-ui span{height:12px;width:12px;border-radius:8px;background-color:#eee;border:1px solid #dadada;float:left;margin:0 0 0 4px}.fake-mobile-browser-ui span{height:50px;width:50px;border-radius:60px;background-color:#eee;border:2px solid #ccc;display:block;margin:auto}.fake-browser-ui .bt-1{background-color:#ed594a}.fake-browser-ui .bt-2{background-color:#fdd800}.fake-browser-ui .bt-3{background-color:#5ac05a}#tnpc-html-editor{height:600px;border-top:20px solid #323232;border-radius:8px}.tnp-select2-option img{height:15px;margin-right:5px;vertical-align:middle;background-color:rgba(234,234,234,0.25);padding:10px;border-radius:5px}#tnpc-block-options{z-index:10;flex-flow:column;display:none;position:absolute;top:0;left:0;bottom:0;right:0;background-color:#ecf0f1;padding:0}#tnpc-block-options-buttons{padding:20px;text-align:right;background-color:#ecf0f1;height:70px;border-bottom:1px solid #fff}#tnpc-block-options-form{background-color:#fff;padding:15px;margin-top:0;overflow-y:scroll}#tnpc-block-options-form,#tnpc-block-options-form p{color:#444;background-color:#ecf0f1!important}#tnpc-block-options-form h3{color:#000}#tnpc-block-options-form table.form-table th{width:100%;vertical-align:top;float:left;font-weight:normal;text-transform:uppercase;font-size:13px;padding-top:10px;padding-bottom:5px;padding-left:0;padding-right:0}#tnpc-block-options-form table.form-table td{float:left;padding:0;margin:0;border:0;width:100%}#tnpc-block-options-form table.form-table{margin:0;border-collapse:separate!important;border-spacing:1px!important}#tnpc-block-options-form table.form-table table.tnp-button-colors{border:0;border-collapse:collapse}#tnpc-block-options-form table.form-table table.tnp-button-colors td{border:0;padding-top:0}.tnpc-tabs{background-color:#fff;font-family:Montserrat,sans-serif}.tnpc-tabs button{background-color:inherit;float:left;border:0;outline:0;cursor:pointer;padding:14px 16px;transition:.3s;color:#6a8ba0}.tnpc-tabs button:hover{background-color:#ddd}.tnpc-tabs button.active{background-color:#ecf0f1;color:#3498db}.tabcontent{display:none;padding:6px 12px;border-top:0}.tnpc-controls{text-align:right}.tnpc-logo{float:left}.tnpc-logo p{font-family:Montserrat,Sans-serif;color:#fff!important;font-size:16px;margin-left:20px!important;margin-top:5px!important}#tnpc-general-options select{box-shadow:none;border-radius:0;border:0;margin-right:5px}.tnpc-block-options-warning{background-color:#def9e9;padding:10px 15px}.tnpc-presets-title{padding:0 20px 25px;font-size:21px;margin-bottom:30px;color:#484848;border-bottom:3px solid white}.tnpc-preset{float:left;margin:15px;cursor:pointer;width:150px;height:263px;background:white;border-radius:8px;box-shadow:0 0 2px 0 #dee3e4;position:relative}.tnpc-preset:hover{box-shadow:0 0 8px 8px #dee3e4}.tnpc-preset-label{position:absolute;top:200px;left:50%;text-align:center;transform:translate(-50%,-50%);font-size:14px;width:80%}.tnpc-inline-editable{cursor:text}.tnpc-inline-editable{cursor:text;position:relative}.tnpc-inline-editable:hover{color:#EEE!important}.tnpc-inline-editable:hover:after{content:'';cursor:pointer;position:absolute;top:0;left:0;width:100%;height:100%;background-color:rgba(0,0,0,0.2);opacity:1;border-radius:2px}.tnpc-inline-editable:hover:before{content:'\f464';font-family:dashicons;position:absolute;top:0;bottom:0;left:0;right:0;margin:auto;width:32px;height:32px;font-size:32px;line-height:32px;color:#333}.tnpc-inline-editable-form{position:relative;margin-top:25px}.tnpc-inline-editable-form textarea,.tnpc-inline-editable-form input{width:95%;margin-left:20px}.two-columns .tnpc-inline-editable-form-actions{right:0}.tnpc-inline-editable-form input{padding:5px;font-size:25px;font-family:Helvetica,Arial,sans-serif;font-weight:normal;color:#333;line-height:normal}.tnpc-inline-editable-form-actions{position:absolute;top:-25px;right:5px;display:flex;align-items:center;flex-wrap:wrap}.tnpc-inline-editable-form-actions button{background:0;padding:0;border:0}.tnpc-inline-editable-form-actions span{display:block;font-size:25px;color:#333;cursor:pointer}.tnpc-inline-editable-form-actions span:first-child{margin-right:5px}
|
|
emails/tnp-composer/_css/newsletter-builder.css
CHANGED
@@ -456,15 +456,6 @@ iframe#tnpc-mobile-preview {
|
|
456 |
color: #E74C3C;
|
457 |
}
|
458 |
|
459 |
-
.tnpc-edit-box-content-field .iris-square {
|
460 |
-
margin-right: 10px;
|
461 |
-
}
|
462 |
-
|
463 |
-
.tnpc-edit-box-content-field .iris-picker .iris-slider {
|
464 |
-
height: 100% !important;
|
465 |
-
}
|
466 |
-
|
467 |
-
|
468 |
|
469 |
/* Tnp Composer Preview */
|
470 |
|
456 |
color: #E74C3C;
|
457 |
}
|
458 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
459 |
|
460 |
/* Tnp Composer Preview */
|
461 |
|
emails/tnp-composer/_scripts/newsletter-builder-v2.min.js
DELETED
@@ -1,26 +0,0 @@
|
|
1 |
-
jQuery.fn.add_delete=function(){this.append('<div class="tnpc-row-delete" title="Delete"><img src="'+TNP_PLUGIN_URL+'/emails/tnp-composer/_assets/delete.png" width="32"></div>');this.find(".tnpc-row-delete").perform_delete()};jQuery.fn.perform_delete=function(){this.click(function(){jQuery("#tnpc-block-options").hide();jQuery(this).parent().remove();tnpc_mobile_preview()})};
|
2 |
-
jQuery.fn.add_block_edit=function(){this.append('<div class="tnpc-row-edit-block" title="Edit"><img src="'+TNP_PLUGIN_URL+'/emails/tnp-composer/_assets/edit.png" width="32"></div>');this.find(".tnpc-row-edit-block").perform_block_edit()};jQuery.fn.add_block_clone=function(){this.append('<div class="tnpc-row-clone" title="Clone"><img src="'+TNP_PLUGIN_URL+'/emails/tnp-composer/_assets/copy.png" width="32"></div>');this.find(".tnpc-row-clone").perform_clone()};let start_options=null,container=null;
|
3 |
-
jQuery.fn.perform_block_edit=function(){jQuery(".tnpc-row-edit-block").click(function(a){a.preventDefault()});this.click(function(a){a.preventDefault();target=jQuery(this).parent().find(".edit-block");container=jQuery(this).closest("table");container.hasClass("tnpc-row-block")?(jQuery("#newsletter-builder-sidebar").css("overflow-y","hidden"),jQuery("#tnpc-block-options").css("display","flex"),(a=container.find(".tnpc-block-content").attr("data-json"))||(a=target.attr("data-options")),jQuery("#tnpc-block-options-form").load(ajaxurl,
|
4 |
-
{action:"tnpc_options",id:container.data("id"),context_type:tnp_context_type,options:a},function(){start_options=jQuery("#tnpc-block-options-form").serialize();tnp_controls_init();start_options=jQuery("#tnpc-block-options-form").serializeArray();tnpc_add_global_options(start_options)})):alert("This is deprecated block version and cannot be edited. Please replace it with a new one.")})};
|
5 |
-
jQuery.fn.perform_clone=function(){jQuery(".tnpc-row-clone").click(function(a){a.preventDefault()});this.click(function(a){a.preventDefault();jQuery("#tnpc-block-options").hide();a=jQuery(this).closest(".tnpc-row");let b=a.clone();b.find(".tnpc-row-delete").remove();b.find(".tnpc-row-edit-block").remove();b.find(".tnpc-row-clone").remove();b.add_delete();b.add_block_edit();b.add_block_clone();b.insertAfter(a);tnpc_mobile_preview()})};
|
6 |
-
jQuery(function(){function a(a){jQuery("#newsletter-builder-area-center-frame-content").css("background-color",a)}jQuery("body").addClass("folded");document.getElementById("defaultOpen").click();var b=jQuery('input[name="message"]').val();b||(b=jQuery('input[name="options[message]"]').val());b?(jQuery("#newsletter-builder-area-center-frame-content").html(b),start_composer()):tnpc_show_presets();jQuery("#options-title").val(jQuery('#tnpc-form input[name="options[subject]"]').val());a(document.getElementById("options-options_composer_background").value);
|
7 |
-
jQuery("#options-options_composer_background").on("change",function(b){a(b.target.value)})});
|
8 |
-
function start_composer(){jQuery("#newsletter-builder-area-center-frame-content").sortable({revert:!1,placeholder:"placeholder",forcePlaceholderSize:!0,opacity:.6,tolerance:"pointer",helper:function(a){return jQuery(document.getElementById("sortable-helper")).clone()},update:function(a,b){"draggable-helper"==b.item.attr("id")?(loading_row=jQuery('<div style="text-align: center; padding: 20px; background-color: #d4d5d6; color: #52BE7F;"><i class="fa fa-cog fa-2x fa-spin" /></div>'),b.item.before(loading_row),
|
9 |
-
b.item.remove(),a=[{name:"action",value:"tnpc_render"},{name:"b",value:b.item.data("id")},{name:"full",value:1},{name:"_wpnonce",value:tnp_nonce}],tnpc_add_global_options(a),console.log(a),jQuery.post(ajaxurl,a,function(a){new_row=jQuery(a);loading_row.before(new_row);loading_row.remove();new_row.add_delete();new_row.add_block_edit();new_row.add_block_clone();new_row.hasClass("tnpc-row-block")&&new_row.find(".tnpc-row-edit-block").click();tnpc_mobile_preview()}).fail(function(){alert("Block rendering failed.");
|
10 |
-
loading_row.remove()})):tnpc_mobile_preview()}});jQuery(".newsletter-sidebar-buttons-content-tab").draggable({connectToSortable:"#newsletter-builder-area-center-frame-content",helper:function(a){var b=jQuery(document.getElementById("draggable-helper")).clone();b.attr("data-id",a.currentTarget.dataset.id);b.html(a.currentTarget.dataset.name);return b},revert:!1,start:function(){jQuery(".tnpc-row").length||jQuery("#newsletter-builder-area-center-frame-content").append('<div class="tnpc-drop-here">Drag&Drop blocks here!</div>')},
|
11 |
-
stop:function(a,b){jQuery(".tnpc-drop-here").remove()}});jQuery("#tnpc-block-options-cancel").click(function(){jQuery(this).parent().parent().fadeOut(500);jQuery("#newsletter-builder-sidebar").css("overflow-y","auto");jQuery.post(ajaxurl,start_options,function(a){target.html(a);jQuery("#tnpc-block-options-form").html("")})});jQuery("#tnpc-block-options-save").click(function(a){a.preventDefault();jQuery("#newsletter-builder-sidebar").css("overflow-y","auto");"undefined"!==typeof templateEditor&&templateEditor.save();
|
12 |
-
window.tinymce&&window.tinymce.triggerSave();jQuery("#tnpc-block-options").fadeOut(500);a=jQuery("#tnpc-block-options-form").serializeArray();tnpc_add_global_options(a);jQuery.post(ajaxurl,a,function(a){target.html(a);tnpc_mobile_preview();jQuery("#tnpc-block-options-form").html("")})});jQuery("#tnpc-block-options-form").change(function(a){var b=jQuery("#tnpc-block-options-form").serializeArray();tnpc_add_global_options(b);jQuery.post(ajaxurl,b,function(b){target.html(b);"reload"===a.target.dataset.afterRendering&&
|
13 |
-
container.find(".tnpc-row-edit-block").click()}).fail(function(){alert("Block rendering failed")})});jQuery(".tnpc-row").add_delete();jQuery(".tnpc-row").add_block_edit();jQuery(".tnpc-row").add_block_clone();tnpc_mobile_preview()}
|
14 |
-
function tnpc_mobile_preview(){var a=document.getElementById("tnpc-mobile-preview").contentWindow.document;a.open();a.write("<!DOCTYPE html>\n<html>\n<head>\n");a.write("<link rel='stylesheet' href='"+TNP_HOME_URL+"?na=emails-composer-css&ver="+Math.random()+"' type='text/css'>");a.write("<style>.tnpc-row-delete, .tnpc-row-edit-block, .tnpc-row-clone { display: none; }</style>");a.write("<style>body::-webkit-scrollbar {width: 0px;background: transparent;}</style>");a.write("<style>body{scrollbar-width: none; -ms-overflow-style: none;}</style>");
|
15 |
-
a.write("</head>\n<body style='margin: 0; padding: 0;'><div style='width: 320px!important'>");a.write(jQuery("#newsletter-builder-area-center-frame-content").html());a.write("</div>\n</body>\n</html>");a.close()}
|
16 |
-
function tnpc_save(a){jQuery("#newsletter-preloaded-export").html(jQuery("#newsletter-builder-area-center-frame-content").html());jQuery("#newsletter-preloaded-export .tnpc-row-delete").remove();jQuery("#newsletter-preloaded-export .tnpc-row-edit-block").remove();jQuery("#newsletter-preloaded-export .tnpc-row-clone").remove();jQuery("#newsletter-preloaded-export .tnpc-row").removeClass("ui-draggable");jQuery("#newsletter-preloaded-export #sortable-helper").remove();a.elements["options[message]"].value=
|
17 |
-
jQuery("#newsletter-preloaded-export").html();document.getElementById("options-title")?a.elements["options[subject]"].value=jQuery("#options-title").val():a.elements["options[subject]"].value="";var b=document.getElementById("tnpc-global-styles-form");tnpc_copy_form(b,a);jQuery("#newsletter-preloaded-export").html(" ")}
|
18 |
-
function tnpc_copy_form(a,b){for(var c=0;c<a.elements.length;c++){var d=document.createElement("input");d.type="hidden";d.name=a.elements[c].name;d.value=a.elements[c].value;b.appendChild(d)}}function tnpc_test(){let a=document.getElementById("tnpc-form");tnpc_save(a);a.act.value="test";a.submit()}
|
19 |
-
function openTab(a,b){a.preventDefault();var c;var d=document.getElementsByClassName("tabcontent");for(c=0;c<d.length;c++)d[c].style.display="none";d=document.getElementsByClassName("tablinks");for(c=0;c<d.length;c++)d[c].className=d[c].className.replace(" active","");document.getElementById(b).style.display="block";a.currentTarget.className+=" active"}
|
20 |
-
function tnpc_show_presets(){jQuery(".tnpc-controls input").attr("disabled",!0);jQuery("#newsletter-builder-area-center-frame-content").load(ajaxurl,{action:"tnpc_presets"})}function tnpc_load_preset(a){jQuery("#newsletter-builder-area-center-frame-content").load(ajaxurl,{action:"tnpc_presets",id:a},function(){start_composer();jQuery(".tnpc-controls input").attr("disabled",!1)})}function tnpc_scratch(){jQuery("#newsletter-builder-area-center-frame-content").html(" ");start_composer()}
|
21 |
-
function tnpc_reload_options(a){a.preventDefault();a=jQuery("#tnpc-block-options-form").serializeArray();for(let b=0;b<a.length;b++)"action"===a[b].name&&(a[b].value="tnpc_options");jQuery("#tnpc-block-options-form").load(ajaxurl,a)}function tnpc_add_global_options(a){let b=jQuery("#tnpc-global-styles-form").serializeArray();for(let c=0;c<b.length;c++)b[c].name=b[c].name.replace("[options_","[").replace("options[","composer[").replace("composer_",""),a.push(b[c])}
|
22 |
-
jQuery(document).ready(function(){(function(){function a(){d.forEach(function(a){a.originalEl.show();a.newEl.off();a.newEl.remove()});d=[]}function b(a,b,c){var d="";switch(c){case "text":d="<textarea name='new_name' class='tnpc-inline-editable-textarea' rows='5'>"+a+"</textarea>";break;case "title":d="<textarea name='new_name' class='tnpc-inline-editable-textarea' rows='2'>"+a+"</textarea>"}var e="<td>"+("<form class='tnpc-inline-editable-form tnpc-inline-editable-form-"+c+b+"'>")+("<input type='hidden' name='id' value='"+
|
23 |
-
b+"'>")+("<input type='hidden' name='type' value='"+c+"'>");e+="<input type='hidden' name='old_value' value='"+a+"'>";e+="<div class='tnpc-inline-editable-container'>";e+=d;e+="<div class='tnpc-inline-editable-form-actions'>";e+="<button type='submit'><span class='dashicons dashicons-yes-alt' title='save'></span></button>";e=e+("<span class='dashicons dashicons-dismiss tnpc-dismiss-"+c+b+"' title='close'></span>")+"</div></div>";e+="</form>";return e+="</td>"}function c(a,b,c,d){var e=a.closest(".edit-block");
|
24 |
-
a=e.closest("table");var f=e.children(".tnpc-block-content");a.hasClass("tnpc-row-block")&&(b={action:"tnpc_render",b:a.data("id"),full:1,_wpnonce:tnp_nonce,options:{inline_edits:[{type:b,post_id:c,content:d}]},encoded_options:f.data("json")},tnpc_add_global_options(b),jQuery.post(ajaxurl,b,function(a){new_row=jQuery(a);e.before(new_row);e.remove();new_row.add_delete();new_row.add_block_edit();new_row.add_block_clone();new_row.hasClass("tnpc-row-block")&&new_row.find(".tnpc-row-edit-block").click();
|
25 |
-
tnpc_mobile_preview()}).fail(function(){alert("Block rendering failed.")}))}var d=[];return{init:function(){jQuery("#newsletter-builder-area-center-frame-content").on("click",".tnpc-inline-editable",function(g){g.preventDefault();a();var h=jQuery(this).hide(),f=jQuery(b(this.innerText.trim(),this.dataset.id,this.dataset.type)).insertAfter(this);d.push({originalEl:h,newEl:f});jQuery(".tnpc-inline-editable-form-"+this.dataset.type+this.dataset.id).on("submit",function(a){var b=jQuery(h);a.preventDefault();
|
26 |
-
a=f.find("form input[name=id]").val();var d=f.find("form input[name=type]").val(),g=f.find('form [name="new_name"]').val();c(b,d,a,g);f.remove();b.show()});jQuery(".tnpc-inline-editable-form-actions .tnpc-dismiss-"+this.dataset.type+this.dataset.id).on("click",function(b){a()})});jQuery("#newsletter-builder-area-center-frame-content").on("click",function(b){0<d.length&&!jQuery(b.target).hasClass("tnpc-inline-editable")&&0===jQuery(b.target).closest(".tnpc-inline-editable-container").length&&a()})}}})().init()});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
emails/tnp-composer/_scripts/newsletter-builder.js
CHANGED
@@ -45,8 +45,6 @@ jQuery.fn.perform_block_edit = function () {
|
|
45 |
jQuery("#tnpc-edit-block .bgcolor").val(target.css("background-color"));
|
46 |
jQuery("#tnpc-edit-block .font").val(target.css("font-family"));
|
47 |
|
48 |
-
//jQuery('.bgcolor').wpColorPicker().iris('color', target.css("background-color"));
|
49 |
-
|
50 |
// The row container which is a global variable and used later after the options save
|
51 |
container = jQuery(this).closest("table");
|
52 |
|
45 |
jQuery("#tnpc-edit-block .bgcolor").val(target.css("background-color"));
|
46 |
jQuery("#tnpc-edit-block .font").val(target.css("font-family"));
|
47 |
|
|
|
|
|
48 |
// The row container which is a global variable and used later after the options save
|
49 |
container = jQuery(this).closest("table");
|
50 |
|
emails/tnp-composer/_scripts/newsletter-builder.min.js
DELETED
@@ -1,18 +0,0 @@
|
|
1 |
-
jQuery.fn.add_delete=function(){this.append('<div class="tnpc-row-delete" title="Delete"><img src="'+TNP_PLUGIN_URL+'/emails/tnp-composer/_assets/delete.png" width="32"></div>');this.find(".tnpc-row-delete").perform_delete()};jQuery.fn.perform_delete=function(){this.click(function(){jQuery("#tnpc-block-options").hide();jQuery(this).parent().remove();tnpc_mobile_preview()})};
|
2 |
-
jQuery.fn.add_block_edit=function(){this.append('<div class="tnpc-row-edit-block" title="Edit"><img src="'+TNP_PLUGIN_URL+'/emails/tnp-composer/_assets/edit.png" width="32"></div>');this.find(".tnpc-row-edit-block").perform_block_edit()};jQuery.fn.add_block_clone=function(){this.append('<div class="tnpc-row-clone" title="Clone"><img src="'+TNP_PLUGIN_URL+'/emails/tnp-composer/_assets/copy.png" width="32"></div>');this.find(".tnpc-row-clone").perform_clone()};let start_options=null,container=null;
|
3 |
-
jQuery.fn.perform_block_edit=function(){jQuery(".tnpc-row-edit-block").click(function(a){a.preventDefault()});this.click(function(a){a.preventDefault();target=jQuery(this).parent().find(".edit-block");jQuery("#tnpc-edit-block .bgcolor").val(target.css("background-color"));jQuery("#tnpc-edit-block .font").val(target.css("font-family"));jQuery(".bgcolor").wpColorPicker().iris("color",target.css("background-color"));container=jQuery(this).closest("table");container.hasClass("tnpc-row-block")?(jQuery("#tnpc-block-options").fadeIn(500),
|
4 |
-
(a=container.find(".tnpc-block-content").attr("data-json"))||(a=target.attr("data-options")),jQuery("#tnpc-block-options-form").load(ajaxurl,{action:"tnpc_options",id:container.data("id"),context_type:tnp_context_type,options:a},function(){start_options=jQuery("#tnpc-block-options-form").serialize()})):alert("This is deprecated block version and cannot be edited. Please replace it with a new one.")})};
|
5 |
-
jQuery.fn.perform_clone=function(){jQuery(".tnpc-row-clone").click(function(a){a.preventDefault()});this.click(function(a){a.preventDefault();jQuery("#tnpc-block-options").hide();a=jQuery(this).closest(".tnpc-row");let b=a.clone();b.find(".tnpc-row-delete").remove();b.find(".tnpc-row-edit-block").remove();b.find(".tnpc-row-clone").remove();b.add_delete();b.add_block_edit();b.add_block_clone();b.insertAfter(a);tnpc_mobile_preview()})};
|
6 |
-
jQuery(function(){jQuery("body").addClass("folded");document.getElementById("defaultOpen").click();var a=jQuery('input[name="body"]').val();a||(a=jQuery('input[name="options[body]"]').val());a?(jQuery("#newsletter-builder-area-center-frame-content").html(a),start_composer()):tnpc_show_presets();jQuery("#options-title").val(jQuery('#tnpc-form input[name="options[subject]"]').val())});
|
7 |
-
function start_composer(){jQuery("#newsletter-builder-area-center-frame-content").sortable({revert:!1,placeholder:"placeholder",forcePlaceholderSize:!0,opacity:.6,tolerance:"pointer",helper:function(a){return jQuery(document.getElementById("sortable-helper")).clone()},update:function(a,b){"draggable-helper"==b.item.attr("id")?(loading_row=jQuery('<div style="text-align: center; padding: 20px; background-color: #d4d5d6; color: #52BE7F;"><i class="fa fa-cog fa-2x fa-spin" /></div>'),b.item.before(loading_row),
|
8 |
-
b.item.remove(),a={action:"tnpc_render",b:b.item.data("id"),full:1},jQuery.post(ajaxurl,a,function(a){new_row=jQuery(a);loading_row.before(new_row);loading_row.remove();new_row.add_delete();new_row.add_block_edit();new_row.add_block_clone();new_row.hasClass("tnpc-row-block")&&new_row.find(".tnpc-row-edit-block").click();tnpc_mobile_preview()}).fail(function(){alert("Block rendering failed.");loading_row.remove()})):tnpc_mobile_preview()}});jQuery(".newsletter-sidebar-buttons-content-tab").draggable({connectToSortable:"#newsletter-builder-area-center-frame-content",
|
9 |
-
helper:function(a){var b=jQuery(document.getElementById("draggable-helper")).clone();b.attr("data-id",a.currentTarget.dataset.id);b.html(a.currentTarget.dataset.name);return b},revert:!1,start:function(){jQuery(".tnpc-row").length||jQuery("#newsletter-builder-area-center-frame-content").append('<div class="tnpc-drop-here">Drag&Drop blocks here!</div>')},stop:function(a,b){jQuery(".tnpc-drop-here").remove()}});jQuery("#tnpc-block-options-cancel").click(function(){jQuery(this).parent().parent().fadeOut(500);
|
10 |
-
jQuery.post(ajaxurl,start_options,function(a){target.html(a);jQuery("#tnpc-block-options-form").html("")})});jQuery("#tnpc-block-options-save").click(function(a){a.preventDefault();"undefined"!==typeof templateEditor&&templateEditor.save();window.tinymce&&window.tinymce.triggerSave();jQuery("#tnpc-block-options").fadeOut(500);a=jQuery("#tnpc-block-options-form").serialize();jQuery.post(ajaxurl,a,function(a){target.html(a);tnpc_mobile_preview();jQuery("#tnpc-block-options-form").html("")})});jQuery("#tnpc-block-options-form").change(function(a){var b=
|
11 |
-
jQuery("#tnpc-block-options-form").serialize();jQuery.post(ajaxurl,b,function(b){target.html(b);"reload"===a.target.dataset.afterRendering&&container.find(".tnpc-row-edit-block").click()}).fail(function(){alert("Block rendering failed")})});jQuery(".tnpc-row").add_delete();jQuery(".tnpc-row").add_block_edit();jQuery(".tnpc-row").add_block_clone();tnpc_mobile_preview()}
|
12 |
-
function tnpc_mobile_preview(){var a=document.getElementById("tnpc-mobile-preview").contentWindow.document;a.open();a.write("<!DOCTYPE html>\n<html>\n<head>\n");a.write("<link rel='stylesheet' href='"+TNP_HOME_URL+"?na=emails-composer-css&ver="+Math.random()+"' type='text/css'>");a.write("<style type='text/css'>.tnpc-row-delete, .tnpc-row-edit-block, .tnpc-row-clone { display: none; }</style>");a.write("</head>\n<body style='margin: 0; padding: 0;'><div style='width: 320px!important'>");a.write(jQuery("#newsletter-builder-area-center-frame-content").html());
|
13 |
-
a.write("</div>\n</body>\n</html>");a.close()}
|
14 |
-
function tnpc_save(a){jQuery("#newsletter-preloaded-export").html(jQuery("#newsletter-builder-area-center-frame-content").html());jQuery("#newsletter-preloaded-export .tnpc-row-delete").remove();jQuery("#newsletter-preloaded-export .tnpc-row-edit-block").remove();jQuery("#newsletter-preloaded-export .tnpc-row-clone").remove();jQuery("#newsletter-preloaded-export .tnpc-row").removeClass("ui-draggable");let b=jQuery("#newsletter-preloaded-export").html();b=jQuery.trim(b);let c;c='<!DOCTYPE html>\n<html>\n<head>\n<title>{email_subject}</title>\n<meta charset="utf-8">\n<meta name="viewport" content="width=device-width, initial-scale=1">\n<meta http-equiv="X-UA-Compatible" content="IE=edge">\n'+
|
15 |
-
('<style type="text/css">'+jQuery.trim(a.elements["options[css]"].value)+"</style>")+'</head>\n<body style="margin: 0; padding: 0;">\n';c=c+b+"\n</body>\n</html>";a.elements["options[body]"].value=c;a.elements["options[subject]"].value=jQuery("#options-title").val();jQuery("#newsletter-preloaded-export").html(" ")}function tnpc_test(){let a=document.getElementById("tnpc-form");tnpc_save(a);a.act.value="test";a.submit()}
|
16 |
-
function openTab(a,b){a.preventDefault();var c;var d=document.getElementsByClassName("tabcontent");for(c=0;c<d.length;c++)d[c].style.display="none";d=document.getElementsByClassName("tablinks");for(c=0;c<d.length;c++)d[c].className=d[c].className.replace(" active","");document.getElementById(b).style.display="block";a.currentTarget.className+=" active"}
|
17 |
-
function tnpc_show_presets(){jQuery(".tnpc-controls input").attr("disabled",!0);jQuery("#newsletter-builder-area-center-frame-content").load(ajaxurl,{action:"tnpc_presets"})}function tnpc_load_preset(a){jQuery("#newsletter-builder-area-center-frame-content").load(ajaxurl,{action:"tnpc_presets",id:a},function(){start_composer();jQuery(".tnpc-controls input").attr("disabled",!1)})}function tnpc_scratch(){jQuery("#newsletter-builder-area-center-frame-content").html(" ");start_composer()}
|
18 |
-
function tnpc_reload_options(a){a.preventDefault();a=jQuery("#tnpc-block-options-form").serializeArray();for(let b=0;b<a.length;b++)"action"==a[b].name&&(a[b].value="tnpc_options");a.action="tnpc_options";a.id=container.data("id");jQuery("#tnpc-block-options-form").load(ajaxurl,a)};
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
emails/tnp-composer/index-v2.php
CHANGED
@@ -24,6 +24,9 @@ $blocks = array_merge(array_flip(array('header', 'content', 'footer')), $blocks)
|
|
24 |
$block_options = get_option('newsletter_main');
|
25 |
|
26 |
$fields = new NewsletterFields($controls);
|
|
|
|
|
|
|
27 |
?>
|
28 |
<script type="text/javascript">
|
29 |
// collapse wp menu
|
@@ -41,25 +44,35 @@ $fields = new NewsletterFields($controls);
|
|
41 |
#newsletter-builder-area-center-frame-content {
|
42 |
min-height: 300px!important;
|
43 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
44 |
</style>
|
45 |
|
46 |
<style>
|
47 |
<?php echo NewsletterEmails::instance()->get_composer_css(); ?>
|
48 |
</style>
|
49 |
-
<div id="newsletter-builder">
|
50 |
|
51 |
<div id="newsletter-builder-area" class="tnp-builder-column">
|
52 |
|
53 |
<?php if ($tnpc_show_subject) { ?>
|
54 |
-
|
55 |
<table role="presentation" style="width: 100%">
|
56 |
<tr>
|
57 |
-
<th>From</th>
|
58 |
-
<td
|
59 |
</tr>
|
60 |
<tr>
|
61 |
-
<th>Subject</th>
|
62 |
-
<td
|
63 |
<div id="tnpc-subject">
|
64 |
<?php $this->subject('title'); ?>
|
65 |
</div>
|
@@ -71,14 +84,14 @@ $fields = new NewsletterFields($controls);
|
|
71 |
</div>
|
72 |
<?php } ?>
|
73 |
|
74 |
-
<div id="newsletter-builder-area-center-frame-content">
|
75 |
|
76 |
<!-- Composer content -->
|
77 |
|
78 |
</div>
|
79 |
</div>
|
80 |
|
81 |
-
<div id="newsletter-builder-sidebar">
|
82 |
|
83 |
<div class="tnpc-tabs">
|
84 |
<button class="tablinks" onclick="openTab(event, 'tnpc-blocks')" data-tab-id='tnpc-blocks' id="defaultOpen"><?php _e('Blocks', 'newsletter') ?></button>
|
24 |
$block_options = get_option('newsletter_main');
|
25 |
|
26 |
$fields = new NewsletterFields($controls);
|
27 |
+
|
28 |
+
$dir = is_rtl()?'rtl':'ltr';
|
29 |
+
$rev_dir = is_rtl()?'ltr':'rlt';
|
30 |
?>
|
31 |
<script type="text/javascript">
|
32 |
// collapse wp menu
|
44 |
#newsletter-builder-area-center-frame-content {
|
45 |
min-height: 300px!important;
|
46 |
}
|
47 |
+
|
48 |
+
#tnpc-subject-wrap th[dir=rtl] {
|
49 |
+
text-align: left;
|
50 |
+
}
|
51 |
+
#tnpc-subject-wrap td[dir=rtl] {
|
52 |
+
text-align: right;
|
53 |
+
}
|
54 |
+
#tnpc-subject-wrap td[dir=rtl] #options-title {
|
55 |
+
margin-right: 0;
|
56 |
+
}
|
57 |
</style>
|
58 |
|
59 |
<style>
|
60 |
<?php echo NewsletterEmails::instance()->get_composer_css(); ?>
|
61 |
</style>
|
62 |
+
<div id="newsletter-builder" dir="ltr">
|
63 |
|
64 |
<div id="newsletter-builder-area" class="tnp-builder-column">
|
65 |
|
66 |
<?php if ($tnpc_show_subject) { ?>
|
67 |
+
<div id="tnpc-subject-wrap" dir="<?php echo $dir?>">
|
68 |
<table role="presentation" style="width: 100%">
|
69 |
<tr>
|
70 |
+
<th dir="<?php echo $dir?>">From</th>
|
71 |
+
<td dir="<?php echo $dir?>"><?php echo esc_html(Newsletter::instance()->options['sender_email']) ?></td>
|
72 |
</tr>
|
73 |
<tr>
|
74 |
+
<th dir="<?php echo $dir?>">Subject</th>
|
75 |
+
<td dir="<?php echo $dir?>">
|
76 |
<div id="tnpc-subject">
|
77 |
<?php $this->subject('title'); ?>
|
78 |
</div>
|
84 |
</div>
|
85 |
<?php } ?>
|
86 |
|
87 |
+
<div id="newsletter-builder-area-center-frame-content" dir="<?php echo $dir?>">
|
88 |
|
89 |
<!-- Composer content -->
|
90 |
|
91 |
</div>
|
92 |
</div>
|
93 |
|
94 |
+
<div id="newsletter-builder-sidebar" dir="<?php echo is_rtl()?'rtl':'ltr'?>">
|
95 |
|
96 |
<div class="tnpc-tabs">
|
97 |
<button class="tablinks" onclick="openTab(event, 'tnpc-blocks')" data-tab-id='tnpc-blocks' id="defaultOpen"><?php _e('Blocks', 'newsletter') ?></button>
|
includes/PHPMailerLoader.php
CHANGED
@@ -1,40 +1,40 @@
|
|
1 |
-
<?php
|
2 |
-
|
3 |
-
namespace TNP\Mailer;
|
4 |
-
|
5 |
-
class PHPMailerLoader {
|
6 |
-
|
7 |
-
/**
|
8 |
-
*
|
9 |
-
*/
|
10 |
-
public static function load() {
|
11 |
-
|
12 |
-
global $wp_version;
|
13 |
-
|
14 |
-
if ( class_exists( 'PHPMailer' ) ) {
|
15 |
-
return;
|
16 |
-
}
|
17 |
-
|
18 |
-
if ( version_compare( $wp_version, '5.4.9' ) > 0 ) {
|
19 |
-
require_once ABSPATH . WPINC . '/PHPMailer/PHPMailer.php';
|
20 |
-
require_once ABSPATH . WPINC . '/PHPMailer/SMTP.php';
|
21 |
-
require_once ABSPATH . WPINC . '/PHPMailer/Exception.php';
|
22 |
-
|
23 |
-
class_alias( \PHPMailer\PHPMailer\PHPMailer::class, 'PHPMailer' );
|
24 |
-
class_alias( \PHPMailer\PHPMailer\SMTP::class, 'SMTP' );
|
25 |
-
class_alias( \PHPMailer\PHPMailer\Exception::class, 'phpmailerException' );
|
26 |
-
} else {
|
27 |
-
require_once ABSPATH . WPINC . '/class-phpmailer.php';
|
28 |
-
require_once ABSPATH . WPINC . '/class-smtp.php';
|
29 |
-
}
|
30 |
-
|
31 |
-
}
|
32 |
-
|
33 |
-
public static function make_instance() {
|
34 |
-
self::load();
|
35 |
-
|
36 |
-
return new \PHPMailer(
|
37 |
-
}
|
38 |
-
|
39 |
-
|
40 |
-
}
|
1 |
+
<?php
|
2 |
+
|
3 |
+
namespace TNP\Mailer;
|
4 |
+
|
5 |
+
class PHPMailerLoader {
|
6 |
+
|
7 |
+
/**
|
8 |
+
*
|
9 |
+
*/
|
10 |
+
public static function load() {
|
11 |
+
|
12 |
+
global $wp_version;
|
13 |
+
|
14 |
+
if ( class_exists( 'PHPMailer' ) ) {
|
15 |
+
return;
|
16 |
+
}
|
17 |
+
|
18 |
+
if ( version_compare( $wp_version, '5.4.9' ) > 0 ) {
|
19 |
+
require_once ABSPATH . WPINC . '/PHPMailer/PHPMailer.php';
|
20 |
+
require_once ABSPATH . WPINC . '/PHPMailer/SMTP.php';
|
21 |
+
require_once ABSPATH . WPINC . '/PHPMailer/Exception.php';
|
22 |
+
|
23 |
+
class_alias( \PHPMailer\PHPMailer\PHPMailer::class, 'PHPMailer' );
|
24 |
+
class_alias( \PHPMailer\PHPMailer\SMTP::class, 'SMTP' );
|
25 |
+
class_alias( \PHPMailer\PHPMailer\Exception::class, 'phpmailerException' );
|
26 |
+
} else {
|
27 |
+
require_once ABSPATH . WPINC . '/class-phpmailer.php';
|
28 |
+
require_once ABSPATH . WPINC . '/class-smtp.php';
|
29 |
+
}
|
30 |
+
|
31 |
+
}
|
32 |
+
|
33 |
+
public static function make_instance($exceptions = false) {
|
34 |
+
self::load();
|
35 |
+
|
36 |
+
return new \PHPMailer( $exceptions );
|
37 |
+
}
|
38 |
+
|
39 |
+
|
40 |
+
}
|
includes/composer.php
CHANGED
@@ -229,8 +229,7 @@ class TNP_Composer {
|
|
229 |
$controls->data['message'] = TNP_Composer::unwrap_email($email->message);
|
230 |
$controls->data['subject'] = $email->subject;
|
231 |
|
232 |
-
|
233 |
-
|
234 |
}
|
235 |
|
236 |
/**
|
@@ -335,45 +334,45 @@ class TNP_Composer {
|
|
335 |
*/
|
336 |
static function image($media, $attr = []) {
|
337 |
|
338 |
-
|
339 |
-
|
340 |
-
|
341 |
-
|
342 |
-
|
343 |
-
|
344 |
-
|
345 |
-
|
346 |
-
|
347 |
-
|
348 |
-
|
349 |
-
|
350 |
-
|
351 |
-
|
352 |
-
|
353 |
-
|
354 |
-
|
355 |
-
|
356 |
-
|
357 |
-
|
358 |
-
|
359 |
-
|
360 |
-
|
361 |
-
|
362 |
|
363 |
$b = '';
|
364 |
-
|
365 |
-
|
366 |
-
|
367 |
-
|
368 |
-
|
369 |
-
|
370 |
-
|
371 |
-
|
372 |
-
|
373 |
-
|
374 |
-
|
375 |
-
|
376 |
-
|
377 |
|
378 |
if ($media->link) {
|
379 |
$b .= '</a>';
|
@@ -419,57 +418,55 @@ class TNP_Composer {
|
|
419 |
}
|
420 |
|
421 |
static function post_content($post) {
|
422 |
-
|
423 |
-
|
424 |
-
|
425 |
-
|
426 |
-
|
427 |
-
|
428 |
-
|
429 |
-
|
430 |
-
|
431 |
-
|
432 |
-
|
433 |
-
|
434 |
-
|
435 |
-
|
436 |
-
|
437 |
-
|
438 |
-
|
439 |
-
|
440 |
-
|
441 |
-
|
442 |
-
|
443 |
-
|
444 |
-
|
445 |
-
|
446 |
-
|
447 |
-
|
448 |
-
|
449 |
-
}
|
450 |
-
|
451 |
-
|
452 |
-
|
453 |
-
|
454 |
-
|
455 |
-
|
456 |
-
|
457 |
-
|
458 |
-
|
459 |
-
|
460 |
-
|
461 |
-
|
462 |
-
|
463 |
-
|
464 |
-
|
465 |
-
|
466 |
-
|
467 |
-
|
468 |
-
|
469 |
-
|
470 |
-
|
471 |
-
];
|
472 |
-
}
|
473 |
}
|
474 |
|
475 |
/**
|
@@ -582,18 +579,7 @@ class TNP_Composer_Grid_Row {
|
|
582 |
}
|
583 |
|
584 |
private function get_template() {
|
585 |
-
return "<table border='0'
|
586 |
-
cellpadding='0'
|
587 |
-
cellspacing='0'
|
588 |
-
width='100%'>
|
589 |
-
<tbody>
|
590 |
-
<tr>
|
591 |
-
<td>
|
592 |
-
TNP_ROW_CONTENT_PH
|
593 |
-
</td>
|
594 |
-
</tr>
|
595 |
-
</tbody>
|
596 |
-
</table>";
|
597 |
}
|
598 |
|
599 |
}
|
@@ -653,57 +639,50 @@ class TNP_Composer_Grid_Cell {
|
|
653 |
}
|
654 |
|
655 |
private function get_template() {
|
656 |
-
return "<table border='0'
|
657 |
-
|
658 |
-
|
659 |
-
|
660 |
-
|
661 |
-
|
662 |
-
|
663 |
-
|
664 |
-
|
665 |
-
<td border='0'
|
666 |
-
style='padding: 20px 10px 40px;'
|
667 |
-
align='TNP_ALIGN_PH'
|
668 |
-
valign='TNP_VALIGN_PH'
|
669 |
-
class='TNP_CLASS_PH'>
|
670 |
-
TNP_COLUMN_CONTENT_PH
|
671 |
-
</td>
|
672 |
-
</tr>
|
673 |
-
</tbody>
|
674 |
-
</table>";
|
675 |
}
|
676 |
|
677 |
}
|
678 |
|
679 |
class TNP_Composer_Component_Factory {
|
680 |
|
681 |
-
|
682 |
|
683 |
-
|
684 |
-
|
685 |
-
|
686 |
-
|
687 |
-
|
688 |
-
|
689 |
-
|
690 |
-
|
691 |
-
function heading() {
|
692 |
-
}
|
693 |
-
|
694 |
-
function paragraph() {
|
695 |
-
|
696 |
-
}
|
697 |
|
698 |
-
|
|
|
|
|
699 |
|
700 |
-
|
|
|
|
|
701 |
|
702 |
-
|
703 |
-
|
|
|
704 |
|
705 |
-
|
|
|
|
|
706 |
|
707 |
-
|
|
|
|
|
708 |
|
709 |
}
|
229 |
$controls->data['message'] = TNP_Composer::unwrap_email($email->message);
|
230 |
$controls->data['subject'] = $email->subject;
|
231 |
|
232 |
+
$controls->data = array_merge(TNP_Composer::get_global_style_defaults(), $controls->data);
|
|
|
233 |
}
|
234 |
|
235 |
/**
|
334 |
*/
|
335 |
static function image($media, $attr = []) {
|
336 |
|
337 |
+
$default_attrs = [
|
338 |
+
'style' => 'max-width: 100%; height: auto;',
|
339 |
+
'class' => null,
|
340 |
+
'link-style' => 'text-decoration: none;',
|
341 |
+
'link-class' => null,
|
342 |
+
];
|
343 |
+
|
344 |
+
$attr = array_merge($default_attrs, $attr);
|
345 |
+
|
346 |
+
//Class and style attribute are mutually exclusive.
|
347 |
+
//Class take priority to style because classes will transform to inline style inside block rendering operation
|
348 |
+
if (!empty($attr['class'])) {
|
349 |
+
$styling = ' inline-class="' . $attr['class'] . '" ';
|
350 |
+
} else {
|
351 |
+
$styling = ' style="' . $attr['style'] . '" ';
|
352 |
+
}
|
353 |
+
|
354 |
+
//Class and style attribute are mutually exclusive.
|
355 |
+
//Class take priority to style because classes will transform to inline style inside block rendering operation
|
356 |
+
if (!empty($attr['link-class'])) {
|
357 |
+
$link_styling = ' inline-class="' . $attr['link-class'] . '" ';
|
358 |
+
} else {
|
359 |
+
$link_styling = ' style="' . $attr['link-style'] . '" ';
|
360 |
+
}
|
361 |
|
362 |
$b = '';
|
363 |
+
if ($media->link) {
|
364 |
+
$b .= '<a href="' . $media->link . '" target="_blank" rel="noopener nofollow" ' . $link_styling . '>';
|
365 |
+
}
|
366 |
+
|
367 |
+
if ($media) {
|
368 |
+
$b .= '<img src="' . $media->url . '" width="' . $media->width . '"'
|
369 |
+
. ' height="auto"'
|
370 |
+
. ' alt="' . esc_attr($media->alt) . '"'
|
371 |
+
. ' border="0" '
|
372 |
+
. $styling
|
373 |
+
. ' class="responsive" '
|
374 |
+
. '>';
|
375 |
+
}
|
376 |
|
377 |
if ($media->link) {
|
378 |
$b .= '</a>';
|
418 |
}
|
419 |
|
420 |
static function post_content($post) {
|
421 |
+
$content = $post->post_content;
|
422 |
+
$content = wpautop($content);
|
423 |
+
if (true || $options['enable shortcodes']) {
|
424 |
+
remove_shortcode('gallery');
|
425 |
+
add_shortcode('gallery', 'tnp_gallery_shortcode');
|
426 |
+
$content = do_shortcode($content);
|
427 |
+
}
|
428 |
+
$content = str_replace('<p>', '<p class="paragraph">', $content);
|
429 |
+
|
430 |
+
$selected_images = array();
|
431 |
+
if (preg_match_all('/<img [^>]+>/', $content, $matches)) {
|
432 |
+
foreach ($matches[0] as $image) {
|
433 |
+
if (preg_match('/wp-image-([0-9]+)/i', $image, $class_id) && ( $attachment_id = absint($class_id[1]) )) {
|
434 |
+
$selected_images[$image] = $attachment_id;
|
435 |
+
}
|
436 |
+
}
|
437 |
+
}
|
438 |
+
|
439 |
+
foreach ($selected_images as $image => $attachment_id) {
|
440 |
+
$src = tnp_media_resize($attachment_id, array(600, 0));
|
441 |
+
if (is_wp_error($src)) {
|
442 |
+
continue;
|
443 |
+
}
|
444 |
+
$content = str_replace($image, '<img src="' . $src . '" width="600" style="max-width: 100%">', $content);
|
445 |
+
}
|
446 |
+
|
447 |
+
return $content;
|
448 |
+
}
|
449 |
+
|
450 |
+
static function get_global_style_defaults() {
|
451 |
+
return [
|
452 |
+
'options_composer_title_font_family' => 'Verdana, Geneva, sans-serif',
|
453 |
+
'options_composer_title_font_size' => 36,
|
454 |
+
'options_composer_title_font_weight' => 'bold',
|
455 |
+
'options_composer_title_font_color' => '#222222',
|
456 |
+
'options_composer_text_font_family' => 'Verdana, Geneva, sans-serif',
|
457 |
+
'options_composer_text_font_size' => 16,
|
458 |
+
'options_composer_text_font_weight' => 'normal',
|
459 |
+
'options_composer_text_font_color' => '#222222',
|
460 |
+
'options_composer_button_font_family' => 'Verdana, Geneva, sans-serif',
|
461 |
+
'options_composer_button_font_size' => 16,
|
462 |
+
'options_composer_button_font_weight' => 'bold',
|
463 |
+
'options_composer_button_font_color' => '#FFFFFF',
|
464 |
+
'options_composer_button_background_color' => '#256F9C',
|
465 |
+
'options_composer_background' => '#FFFFFF',
|
466 |
+
'options_composer_block_background' => '#FFFFFF',
|
467 |
+
];
|
468 |
+
}
|
469 |
+
|
|
|
|
|
470 |
}
|
471 |
|
472 |
/**
|
579 |
}
|
580 |
|
581 |
private function get_template() {
|
582 |
+
return "<table border='0' cellpadding='0' cellspacing='0' width='100%'><tbody><tr><td>TNP_ROW_CONTENT_PH</td></tr></tbody></table>";
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
583 |
}
|
584 |
|
585 |
}
|
639 |
}
|
640 |
|
641 |
private function get_template() {
|
642 |
+
return "<table border='0' cellpadding='0' cellspacing='0' width='TNP_WIDTH_PH' align='left' style='table-layout: fixed;' class='responsive'>
|
643 |
+
<tbody>
|
644 |
+
<tr>
|
645 |
+
<td border='0' style='padding: 20px 10px 40px;' align='TNP_ALIGN_PH' valign='TNP_VALIGN_PH' class='TNP_CLASS_PH'>
|
646 |
+
TNP_COLUMN_CONTENT_PH
|
647 |
+
</td>
|
648 |
+
</tr>
|
649 |
+
</tbody>
|
650 |
+
</table>";
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
651 |
}
|
652 |
|
653 |
}
|
654 |
|
655 |
class TNP_Composer_Component_Factory {
|
656 |
|
657 |
+
private $options;
|
658 |
|
659 |
+
/**
|
660 |
+
* TNP_Composer_Component_Factory constructor.
|
661 |
+
*
|
662 |
+
* @param Controller$controller
|
663 |
+
*/
|
664 |
+
public function __construct($controller) {
|
665 |
+
|
666 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
667 |
|
668 |
+
function heading() {
|
669 |
+
|
670 |
+
}
|
671 |
|
672 |
+
function paragraph() {
|
673 |
+
|
674 |
+
}
|
675 |
|
676 |
+
function link() {
|
677 |
+
|
678 |
+
}
|
679 |
|
680 |
+
function button() {
|
681 |
+
|
682 |
+
}
|
683 |
|
684 |
+
function image() {
|
685 |
+
|
686 |
+
}
|
687 |
|
688 |
}
|
includes/controls.php
CHANGED
@@ -310,6 +310,16 @@ class NewsletterControls {
|
|
310 |
}
|
311 |
}
|
312 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
313 |
function merge($options) {
|
314 |
if (!is_array($options))
|
315 |
return;
|
@@ -355,6 +365,18 @@ class NewsletterControls {
|
|
355 |
return $this->data[$name];
|
356 |
}
|
357 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
358 |
/**
|
359 |
* Show the errors and messages.
|
360 |
*/
|
@@ -367,19 +389,19 @@ class NewsletterControls {
|
|
367 |
$shown = true;
|
368 |
|
369 |
if (!empty($this->errors)) {
|
370 |
-
echo '<div class="
|
371 |
echo $this->errors;
|
372 |
echo '</div>';
|
373 |
}
|
374 |
if (!empty($this->warnings)) {
|
375 |
foreach ((array) $this->warnings as $warning) {
|
376 |
-
echo '<div class="
|
377 |
echo $warning;
|
378 |
echo '</div>';
|
379 |
}
|
380 |
}
|
381 |
if (!empty($this->messages)) {
|
382 |
-
echo '<div class="
|
383 |
echo $this->messages;
|
384 |
echo '</div>';
|
385 |
}
|
@@ -431,13 +453,13 @@ class NewsletterControls {
|
|
431 |
}
|
432 |
|
433 |
function switch_to_all_languages_notice() {
|
434 |
-
echo '<div class="
|
435 |
_e('Switch the administration side to "all languages" to set these options', 'newsletter');
|
436 |
echo '</div>';
|
437 |
}
|
438 |
|
439 |
function hint($text, $url = '') {
|
440 |
-
echo '<div class="
|
441 |
// Do not escape that, it can be formatted
|
442 |
echo $text;
|
443 |
if (!empty($url)) {
|
@@ -524,20 +546,19 @@ class NewsletterControls {
|
|
524 |
function checkboxes_group($name, $values_labels) {
|
525 |
$value_array = $this->get_value_array($name);
|
526 |
|
527 |
-
echo
|
528 |
foreach ($values_labels as $value => $label) {
|
529 |
-
echo "<div class='newsletter-checkboxes-item'>";
|
530 |
echo '<label><input type="checkbox" id="' . esc_attr($name) . '" name="options[' . esc_attr($name) . '][]" value="' . esc_attr($value) . '"';
|
531 |
if (array_search($value, $value_array) !== false) {
|
532 |
echo ' checked';
|
533 |
}
|
534 |
echo '>';
|
535 |
if ($label != '') {
|
536 |
-
echo esc_html($label);
|
537 |
}
|
538 |
-
echo "</label
|
539 |
}
|
540 |
-
echo "
|
541 |
}
|
542 |
|
543 |
/** Creates a checkbox group with all public post types.
|
@@ -639,17 +660,23 @@ class NewsletterControls {
|
|
639 |
echo '</select>';
|
640 |
}
|
641 |
|
642 |
-
function select($name, $options, $first = null) {
|
643 |
-
$
|
644 |
-
|
645 |
-
|
|
|
|
|
|
|
|
|
646 |
if (!empty($first)) {
|
647 |
echo '<option value="">' . esc_html($first) . '</option>';
|
648 |
}
|
|
|
649 |
foreach ($options as $key => $label) {
|
650 |
echo '<option value="' . esc_attr($key) . '"';
|
651 |
-
if ($value == $key)
|
652 |
echo ' selected';
|
|
|
653 |
echo '>' . esc_html($label) . '</option>';
|
654 |
}
|
655 |
echo '</select>';
|
@@ -753,7 +780,7 @@ class NewsletterControls {
|
|
753 |
}
|
754 |
|
755 |
function value($name) {
|
756 |
-
echo
|
757 |
}
|
758 |
|
759 |
function value_date($name, $show_remaining = true) {
|
@@ -770,8 +797,9 @@ class NewsletterControls {
|
|
770 |
$delta = $delta - $hours * 3600;
|
771 |
$minutes = floor($delta / 60);
|
772 |
|
773 |
-
if ($days > 0)
|
774 |
echo $days . ' days ';
|
|
|
775 |
echo $hours . ' hours ';
|
776 |
echo $minutes . ' minutes ';
|
777 |
}
|
@@ -790,7 +818,7 @@ class NewsletterControls {
|
|
790 |
function text($name, $size = 20, $placeholder = '') {
|
791 |
$value = $this->get_value($name);
|
792 |
$name = esc_attr($name);
|
793 |
-
echo '<input id="options-', $name, '" placeholder="' . esc_attr($placeholder) . '" name="options[', $name, ']" type="text" ';
|
794 |
if (!empty($size)) {
|
795 |
echo 'size="', esc_attr($size), '" ';
|
796 |
}
|
@@ -818,119 +846,162 @@ class NewsletterControls {
|
|
818 |
echo '<input name="options[', esc_attr($name), ']" id="options-', esc_attr($name), '" type="hidden" value="', esc_attr($value), '">';
|
819 |
}
|
820 |
|
821 |
-
|
822 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
823 |
if ($function != null) {
|
824 |
-
echo '<input ' . $id . ' class="button-
|
825 |
} else {
|
826 |
-
echo '<input ' . $id . ' class="button-
|
827 |
}
|
828 |
}
|
829 |
|
830 |
function action_link($action, $label, $function = null) {
|
831 |
if ($function != null) {
|
832 |
-
echo '<input class="button-link" type="button" value="' . esc_attr($label) . '" onclick="this.form.act.value=\'' . esc_attr($action) . '\';' . esc_html($function) . '"/>';
|
833 |
} else {
|
834 |
-
echo '<input class="button-link" type="submit" value="' . esc_attr($label) . '" onclick="this.form.act.value=\'' . esc_attr($action) . '\';return true;"/>';
|
835 |
}
|
836 |
}
|
837 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
838 |
/**
|
839 |
-
*
|
|
|
840 |
*/
|
841 |
-
function
|
842 |
-
$this->
|
843 |
}
|
844 |
|
845 |
-
function
|
846 |
-
|
847 |
-
echo esc_attr(esc_js(__('Proceed?', 'newsletter')));
|
848 |
-
echo '\')) return false;">';
|
849 |
-
echo '<i class="fas fa-reply"></i> ';
|
850 |
-
echo esc_html(__('Reset', 'newsletter'));
|
851 |
-
echo '</button>';
|
852 |
}
|
853 |
|
854 |
-
function
|
855 |
-
|
856 |
}
|
857 |
|
858 |
-
function
|
859 |
-
|
860 |
}
|
861 |
|
862 |
-
function
|
863 |
-
|
864 |
-
if (is_null($label)) {
|
865 |
-
echo ' ';
|
866 |
-
_e('Back', 'newsletter');
|
867 |
-
}
|
868 |
-
echo '</a>';
|
869 |
}
|
870 |
|
871 |
-
|
872 |
-
|
873 |
-
* @param type $data
|
874 |
-
*/
|
875 |
-
function button_copy($data = '', $label = null) {
|
876 |
-
echo '<button class="button-secondary" onclick="this.form.btn.value=\'' . esc_attr($data) . '\';this.form.act.value=\'copy\';if (!confirm(\'';
|
877 |
-
echo esc_attr(esc_js(__('Proceed with copy?', 'newsletter')));
|
878 |
-
echo '\')) return false;"';
|
879 |
-
if (empty($label)) {
|
880 |
-
echo 'title="', esc_attr(__('Duplicate', 'newsletter')), '"';
|
881 |
-
}
|
882 |
-
echo '>';
|
883 |
-
echo '<i class="fas fa-copy"></i>';
|
884 |
-
if (is_null($label)) {
|
885 |
-
echo ' ', esc_html(__('Duplicate', 'newsletter'));
|
886 |
-
} else {
|
887 |
-
if (!empty($label)) {
|
888 |
-
echo ' ', $label;
|
889 |
-
}
|
890 |
-
}
|
891 |
-
echo '</button>';
|
892 |
}
|
893 |
|
894 |
-
function
|
895 |
-
|
896 |
-
echo esc_attr(esc_js(__('Proceed with a test?', 'newsletter')));
|
897 |
-
echo '\')) return false;"';
|
898 |
-
if (empty($label)) {
|
899 |
-
echo 'title="', esc_attr(__('Run a test', 'newsletter')), '"';
|
900 |
-
}
|
901 |
-
echo '>';
|
902 |
-
echo '<i class="fas fa-vial"></i>';
|
903 |
-
if (is_null($label)) {
|
904 |
-
echo ' ', esc_html(__('Run a test', 'newsletter'));
|
905 |
-
} else {
|
906 |
-
if (!empty($label)) {
|
907 |
-
echo ' ', $label;
|
908 |
-
}
|
909 |
-
}
|
910 |
-
echo '</button>';
|
911 |
}
|
912 |
|
913 |
-
|
914 |
-
|
915 |
-
|
916 |
-
|
917 |
-
function
|
918 |
-
|
919 |
-
|
920 |
-
|
921 |
-
|
922 |
-
|
923 |
-
|
924 |
-
|
925 |
-
|
926 |
-
|
927 |
-
|
928 |
-
|
929 |
-
|
930 |
-
|
931 |
-
|
932 |
-
|
933 |
-
|
|
|
|
|
|
|
|
|
|
|
934 |
}
|
935 |
|
936 |
function button_primary($action, $label, $function = null) {
|
@@ -942,16 +1013,16 @@ class NewsletterControls {
|
|
942 |
}
|
943 |
|
944 |
function button_confirm($action, $label, $message = '', $data = '') {
|
945 |
-
|
946 |
-
$message = __('Are you sure?', 'newsletter');
|
947 |
-
}
|
948 |
-
|
949 |
-
echo '<input class="button-primary" type="button" value="' . esc_attr($label) . '" onclick="this.form.btn.value=\'' . esc_attr($data) . '\';this.form.act.value=\'' . esc_attr($action) . '\';if (confirm(\'' .
|
950 |
-
esc_attr(esc_js($message)) . '\')) this.form.submit()"/>';
|
951 |
}
|
952 |
|
953 |
-
|
954 |
-
|
|
|
|
|
|
|
|
|
|
|
955 |
}
|
956 |
|
957 |
function editor($name, $rows = 5, $cols = 75) {
|
@@ -961,6 +1032,15 @@ class NewsletterControls {
|
|
961 |
}
|
962 |
|
963 |
function wp_editor($name, $settings = array()) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
964 |
$value = $this->get_value($name);
|
965 |
wp_editor($value, $name, array_merge(array(
|
966 |
'tinymce' => array('content_css' => plugins_url('newsletter') . '/css/wp-editor.css?ver=' . filemtime(NEWSLETTER_DIR . '/css/wp-editor.css')),
|
@@ -1063,7 +1143,7 @@ class NewsletterControls {
|
|
1063 |
echo '<input type="radio" id="' . esc_attr($name) . '" name="options[' . esc_attr($name) . ']" value="' . esc_attr($value) . '"';
|
1064 |
$v = $this->get_value($name);
|
1065 |
if ($v == $value) {
|
1066 |
-
echo ' checked
|
1067 |
}
|
1068 |
echo '>';
|
1069 |
if ($label != '') {
|
@@ -1088,7 +1168,7 @@ class NewsletterControls {
|
|
1088 |
}
|
1089 |
|
1090 |
function checkboxes($name, $options) {
|
1091 |
-
echo '<div class="
|
1092 |
foreach ($options as $value => $label) {
|
1093 |
$this->checkbox_group($name, $value, $label);
|
1094 |
}
|
@@ -1099,21 +1179,18 @@ class NewsletterControls {
|
|
1099 |
function color($name, $default = '') {
|
1100 |
$value = esc_attr($this->get_value($name, $default));
|
1101 |
$name = esc_attr($name);
|
1102 |
-
echo '<input class="
|
1103 |
}
|
1104 |
|
1105 |
/** Creates a set of checkbox named $name_[category id] (so they are posted with distinct names).
|
1106 |
*/
|
1107 |
function categories($name = 'category') {
|
1108 |
$categories = get_categories();
|
1109 |
-
echo '<div class="
|
1110 |
foreach ($categories as $c) {
|
1111 |
-
echo '<div class="newsletter-checkboxes-item">';
|
1112 |
$this->checkbox($name . '_' . $c->cat_ID, esc_html($c->cat_name));
|
1113 |
-
echo '</div>';
|
1114 |
}
|
1115 |
echo '<div style="clear: both"></div>';
|
1116 |
-
echo '</div>';
|
1117 |
}
|
1118 |
|
1119 |
/**
|
@@ -1125,14 +1202,11 @@ class NewsletterControls {
|
|
1125 |
if ($show_mode) {
|
1126 |
$this->select($name . '_mode', array('include' => 'To be included', 'exclude' => 'To be excluded'));
|
1127 |
}
|
1128 |
-
echo '<div class="
|
1129 |
foreach ($categories as &$c) {
|
1130 |
-
echo '<div class="newsletter-checkboxes-item">';
|
1131 |
$this->checkbox_group($name, $c->cat_ID, esc_html($c->cat_name));
|
1132 |
-
echo '</div>';
|
1133 |
}
|
1134 |
echo '<div style="clear: both"></div>';
|
1135 |
-
echo '</div>';
|
1136 |
}
|
1137 |
|
1138 |
/**
|
@@ -1143,14 +1217,11 @@ class NewsletterControls {
|
|
1143 |
function preferences($name = 'preferences') {
|
1144 |
$lists = Newsletter::instance()->get_lists();
|
1145 |
|
1146 |
-
echo '<div class="
|
1147 |
-
|
1148 |
foreach ($lists as $list) {
|
1149 |
-
|
1150 |
-
echo '<div class="newsletter-preferences-item">';
|
1151 |
$this->checkbox2($name . '_' . $list->id, esc_html($list->name));
|
1152 |
-
echo '</div>';
|
1153 |
}
|
|
|
1154 |
}
|
1155 |
|
1156 |
function lists_checkboxes($name = 'lists') {
|
@@ -1215,6 +1286,36 @@ class NewsletterControls {
|
|
1215 |
$this->select($name, $lists);
|
1216 |
}
|
1217 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1218 |
function public_lists_select($name = 'list', $empty_label = null) {
|
1219 |
$lists = $this->get_public_list_options($empty_label);
|
1220 |
$this->select($name, $lists);
|
@@ -1513,6 +1614,7 @@ tnp_controls_init();
|
|
1513 |
echo '<script>';
|
1514 |
echo 'location.href="' . $url . '"';
|
1515 |
echo '</script>';
|
|
|
1516 |
}
|
1517 |
|
1518 |
/**
|
@@ -1531,13 +1633,13 @@ tnp_controls_init();
|
|
1531 |
* @param array $attrs
|
1532 |
*/
|
1533 |
function css_font($name = 'font', $attrs = array()) {
|
1534 |
-
|
1535 |
-
|
1536 |
-
|
1537 |
-
|
1538 |
-
|
1539 |
-
|
1540 |
-
|
1541 |
$attrs = array_merge($default, $attrs);
|
1542 |
$this->css_font_family($name . '_family', !empty($attrs['family_default']));
|
1543 |
if (!$attrs['hide_size']) {
|
@@ -1555,9 +1657,9 @@ tnp_controls_init();
|
|
1555 |
$value = $this->get_value($name);
|
1556 |
|
1557 |
echo '<select class="tnpf-font-size" id="options-', esc_attr($name), '" name="options[', esc_attr($name), ']">';
|
1558 |
-
|
1559 |
-
|
1560 |
-
|
1561 |
for ($i = 8; $i <= 50; $i++) {
|
1562 |
echo '<option value="' . $i . '"';
|
1563 |
if ($value == $i) {
|
@@ -1574,9 +1676,9 @@ tnp_controls_init();
|
|
1574 |
$fonts = array('normal' => 'Normal', 'bold' => 'Bold');
|
1575 |
|
1576 |
echo '<select class="tnpf-font-weight" id="options-' . esc_attr($name) . '" name="options[' . esc_attr($name) . ']">';
|
1577 |
-
|
1578 |
-
|
1579 |
-
|
1580 |
foreach ($fonts as $key => $font) {
|
1581 |
echo '<option value="', esc_attr($key), '"';
|
1582 |
if ($value == $key) {
|
@@ -1606,7 +1708,7 @@ tnp_controls_init();
|
|
1606 |
'Verdana, Geneva, sans-serif' => 'Verdana, Geneva']);
|
1607 |
|
1608 |
echo '<select class="tnpf-font-family" id="options-', esc_attr($name), '" name="options[', esc_attr($name), ']">';
|
1609 |
-
foreach ($fonts as $font
|
1610 |
echo '<option value="', esc_attr($font), '"';
|
1611 |
if ($value == $font) {
|
1612 |
echo ' selected';
|
@@ -1918,7 +2020,7 @@ tnp_controls_init();
|
|
1918 |
global $tnpc_show_subject;
|
1919 |
$tnpc_show_subject = $show_subject;
|
1920 |
|
1921 |
-
|
1922 |
|
1923 |
wp_enqueue_style('tnp-modal-style', plugins_url('newsletter') . '/emails/tnp-composer/_css/tnp-modal.css', array(), NEWSLETTER_VERSION);
|
1924 |
wp_enqueue_style('tnp-toast-style', plugins_url('newsletter') . '/emails/tnp-composer/_css/tnp-toast.css', array(), NEWSLETTER_VERSION);
|
310 |
}
|
311 |
}
|
312 |
|
313 |
+
function set_data($data) {
|
314 |
+
if (is_array($data)) {
|
315 |
+
$this->data = $data;
|
316 |
+
} else if (is_object($data)) {
|
317 |
+
$this->data = (array) $data;
|
318 |
+
} else {
|
319 |
+
$this->data = [];
|
320 |
+
}
|
321 |
+
}
|
322 |
+
|
323 |
function merge($options) {
|
324 |
if (!is_array($options))
|
325 |
return;
|
365 |
return $this->data[$name];
|
366 |
}
|
367 |
|
368 |
+
function show_error($text) {
|
369 |
+
echo '<div class="tnp-error">', $text, '</div>';
|
370 |
+
}
|
371 |
+
|
372 |
+
function show_warning($text) {
|
373 |
+
echo '<div class="tnp-warning">', $text, '</div>';
|
374 |
+
}
|
375 |
+
|
376 |
+
function show_message($text) {
|
377 |
+
echo '<div class="tnpc-message">', $text, '</div>';
|
378 |
+
}
|
379 |
+
|
380 |
/**
|
381 |
* Show the errors and messages.
|
382 |
*/
|
389 |
$shown = true;
|
390 |
|
391 |
if (!empty($this->errors)) {
|
392 |
+
echo '<div class="tnpc-error">';
|
393 |
echo $this->errors;
|
394 |
echo '</div>';
|
395 |
}
|
396 |
if (!empty($this->warnings)) {
|
397 |
foreach ((array) $this->warnings as $warning) {
|
398 |
+
echo '<div class="tnpc-warning">';
|
399 |
echo $warning;
|
400 |
echo '</div>';
|
401 |
}
|
402 |
}
|
403 |
if (!empty($this->messages)) {
|
404 |
+
echo '<div class="tnpc-message">';
|
405 |
echo $this->messages;
|
406 |
echo '</div>';
|
407 |
}
|
453 |
}
|
454 |
|
455 |
function switch_to_all_languages_notice() {
|
456 |
+
echo '<div class="tnpc-languages-notice">';
|
457 |
_e('Switch the administration side to "all languages" to set these options', 'newsletter');
|
458 |
echo '</div>';
|
459 |
}
|
460 |
|
461 |
function hint($text, $url = '') {
|
462 |
+
echo '<div class="tnpc-hint">';
|
463 |
// Do not escape that, it can be formatted
|
464 |
echo $text;
|
465 |
if (!empty($url)) {
|
546 |
function checkboxes_group($name, $values_labels) {
|
547 |
$value_array = $this->get_value_array($name);
|
548 |
|
549 |
+
echo '<div class="tnpc-checkboxes">';
|
550 |
foreach ($values_labels as $value => $label) {
|
|
|
551 |
echo '<label><input type="checkbox" id="' . esc_attr($name) . '" name="options[' . esc_attr($name) . '][]" value="' . esc_attr($value) . '"';
|
552 |
if (array_search($value, $value_array) !== false) {
|
553 |
echo ' checked';
|
554 |
}
|
555 |
echo '>';
|
556 |
if ($label != '') {
|
557 |
+
echo ' ' . esc_html($label);
|
558 |
}
|
559 |
+
echo "</label>";
|
560 |
}
|
561 |
+
echo "<div style='clear: both'></div>";
|
562 |
}
|
563 |
|
564 |
/** Creates a checkbox group with all public post types.
|
660 |
echo '</select>';
|
661 |
}
|
662 |
|
663 |
+
function select($name, $options, $first = null, $attrs = []) {
|
664 |
+
echo '<select id="options-' . esc_attr($name) . '" name="options[' . esc_attr($name) . ']"';
|
665 |
+
if ($attrs) {
|
666 |
+
foreach ($attrs as $key => $value) {
|
667 |
+
echo ' ', $key, '="' . esc_attr($value), '"';
|
668 |
+
}
|
669 |
+
}
|
670 |
+
echo '>';
|
671 |
if (!empty($first)) {
|
672 |
echo '<option value="">' . esc_html($first) . '</option>';
|
673 |
}
|
674 |
+
$value = $this->get_value($name);
|
675 |
foreach ($options as $key => $label) {
|
676 |
echo '<option value="' . esc_attr($key) . '"';
|
677 |
+
if ($value == $key) {
|
678 |
echo ' selected';
|
679 |
+
}
|
680 |
echo '>' . esc_html($label) . '</option>';
|
681 |
}
|
682 |
echo '</select>';
|
780 |
}
|
781 |
|
782 |
function value($name) {
|
783 |
+
echo esc_html($this->data[$name]);
|
784 |
}
|
785 |
|
786 |
function value_date($name, $show_remaining = true) {
|
797 |
$delta = $delta - $hours * 3600;
|
798 |
$minutes = floor($delta / 60);
|
799 |
|
800 |
+
if ($days > 0) {
|
801 |
echo $days . ' days ';
|
802 |
+
}
|
803 |
echo $hours . ' hours ';
|
804 |
echo $minutes . ' minutes ';
|
805 |
}
|
818 |
function text($name, $size = 20, $placeholder = '') {
|
819 |
$value = $this->get_value($name);
|
820 |
$name = esc_attr($name);
|
821 |
+
echo '<input id="options-', $name, '" placeholder="' . esc_attr($placeholder) . '" title="' . esc_attr($placeholder) . '" name="options[', $name, ']" type="text" ';
|
822 |
if (!empty($size)) {
|
823 |
echo 'size="', esc_attr($size), '" ';
|
824 |
}
|
846 |
echo '<input name="options[', esc_attr($name), ']" id="options-', esc_attr($name), '" type="hidden" value="', esc_attr($value), '">';
|
847 |
}
|
848 |
|
849 |
+
/**
|
850 |
+
* General button.
|
851 |
+
*
|
852 |
+
* @param type $action
|
853 |
+
* @param type $label
|
854 |
+
* @param type $attrs
|
855 |
+
*/
|
856 |
+
function btn($action, $label, $attrs = []) {
|
857 |
+
echo '<button class="button-primary tnpc-button"';
|
858 |
+
if (isset($attrs['id'])) {
|
859 |
+
echo ' id="', esc_attrs($attrs['id']), '"';
|
860 |
+
}
|
861 |
+
$onclick = "this.form.act.value='" . esc_attr(esc_js($action)) . "';";
|
862 |
+
if (!empty($attrs['data'])) {
|
863 |
+
$onclick .= "this.form.btn.value='" . esc_attr(esc_js($attrs['data'])) . "';";
|
864 |
+
}
|
865 |
+
if (!empty($attrs['confirm'])) {
|
866 |
+
if (is_string($attrs['confirm'])) {
|
867 |
+
$onclick .= "if (!confirm('" . esc_attr(esc_js($attrs['confirm'])) . "')) return false;";
|
868 |
+
} else {
|
869 |
+
$onclick .= "if (!confirm('" . esc_attr(esc_js(__('Proceed?', 'newsletter'))) . "')) return false;";
|
870 |
+
}
|
871 |
+
}
|
872 |
+
echo 'onclick="', $onclick, '"';
|
873 |
+
if (!empty($attrs['title'])) {
|
874 |
+
echo ' title="', esc_attr($attrs['title']), '"';
|
875 |
+
}
|
876 |
+
if (!empty($attrs['style'])) {
|
877 |
+
echo ' style="', esc_attr($attrs['style']), '"';
|
878 |
+
}
|
879 |
+
echo '>';
|
880 |
+
if (!empty($attrs['icon'])) {
|
881 |
+
echo '<i class="fas ', esc_attr($attrs['icon']), '"></i>';
|
882 |
+
if (!empty($label)) {
|
883 |
+
echo ' ', esc_html($label);
|
884 |
+
}
|
885 |
+
} else {
|
886 |
+
echo esc_html($label);
|
887 |
+
}
|
888 |
+
echo '</button>';
|
889 |
+
}
|
890 |
+
|
891 |
+
function btn_link($url, $label, $attrs = []) {
|
892 |
+
echo '<a href="', esc_attr($url), '" class="button-primary tnpc-button"';
|
893 |
+
if (!empty($attrs['style'])) {
|
894 |
+
echo ' style="', esc_attr($attrs['style']), '"';
|
895 |
+
}
|
896 |
+
if (!empty($attrs['title'])) {
|
897 |
+
echo ' title="', esc_attr($attrs['title']), '"';
|
898 |
+
}
|
899 |
+
if (!empty($attrs['target'])) {
|
900 |
+
echo ' target="', esc_attr($attrs['target']), '"';
|
901 |
+
}
|
902 |
+
echo '>';
|
903 |
+
if (!empty($attrs['icon'])) {
|
904 |
+
echo '<i class="fas ', esc_attr($attrs['icon']), '"></i>';
|
905 |
+
if (!empty($label)) {
|
906 |
+
echo ' ', esc_html($label);
|
907 |
+
}
|
908 |
+
} else {
|
909 |
+
echo esc_html($label);
|
910 |
+
}
|
911 |
+
echo '</a>';
|
912 |
+
}
|
913 |
+
|
914 |
+
function button($action, $label, $function = '', $id = '') {
|
915 |
+
$id = !empty($id) ? " id=\"$id\" " : '';
|
916 |
if ($function != null) {
|
917 |
+
echo '<input ' . $id . ' class="button-primary tnpc-button" type="button" value="' . esc_attr($label) . '" onclick="this.form.act.value=\'' . esc_attr($action) . '\';' . esc_html($function) . '"/>';
|
918 |
} else {
|
919 |
+
echo '<input ' . $id . ' class="button-primary tnpc-button" type="submit" value="' . esc_attr($label) . '" onclick="this.form.act.value=\'' . esc_attr($action) . '\';return true;"/>';
|
920 |
}
|
921 |
}
|
922 |
|
923 |
function action_link($action, $label, $function = null) {
|
924 |
if ($function != null) {
|
925 |
+
echo '<input class="button-link tnpc-button" type="button" value="' . esc_attr($label) . '" onclick="this.form.act.value=\'' . esc_attr($action) . '\';' . esc_html($function) . '"/>';
|
926 |
} else {
|
927 |
+
echo '<input class="button-link tnpc-button" type="submit" value="' . esc_attr($label) . '" onclick="this.form.act.value=\'' . esc_attr($action) . '\';return true;"/>';
|
928 |
}
|
929 |
}
|
930 |
|
931 |
+
function button_save() {
|
932 |
+
$this->btn('save', __('Save', 'newsletter'), ['icon' => 'fa-save']);
|
933 |
+
}
|
934 |
+
|
935 |
+
function button_reset() {
|
936 |
+
$this->btn('reset', __('Reset', 'newsletter'), ['icon' => 'fa-reply', 'confirm' => true]);
|
937 |
+
}
|
938 |
+
|
939 |
+
function button_copy($data = '') {
|
940 |
+
$this->btn('copy', __('Duplicate', 'newsletter'), ['data' => $data, 'icon' => 'fa-copy', 'confirm' => true]);
|
941 |
+
}
|
942 |
+
|
943 |
+
function button_icon_copy($data = '') {
|
944 |
+
$this->btn('copy', '', ['data' => $data, 'icon' => 'fa-copy', 'confirm' => true, 'title' => __('Duplicate', 'newsletter')]);
|
945 |
+
}
|
946 |
+
|
947 |
/**
|
948 |
+
* Creates a button with "delete" action.
|
949 |
+
* @param type $data
|
950 |
*/
|
951 |
+
function button_delete($data = '') {
|
952 |
+
$this->btn('delete', __('Delete', 'newsletter'), ['data' => $data, 'icon' => 'fa-times', 'confirm' => true, 'style' => 'background-color: darkred; color: #ffffff']);
|
953 |
}
|
954 |
|
955 |
+
function button_icon_delete($data = '') {
|
956 |
+
$this->btn('delete', '', ['data' => $data, 'icon' => 'fa-times', 'confirm' => true, 'title' => __('Delete', 'newsletter'), 'style' => 'background-color: darkred; color: #ffffff']);
|
|
|
|
|
|
|
|
|
|
|
957 |
}
|
958 |
|
959 |
+
function button_icon_configure($url) {
|
960 |
+
$this->btn_link($url, '', ['icon' => 'fa-cog', 'title' => __('Configure', 'newsletter')]);
|
961 |
}
|
962 |
|
963 |
+
function button_icon_subscribers($url) {
|
964 |
+
$this->btn_link($url, '', ['icon' => 'fa-users', 'title' => __('Subscribers', 'newsletter')]);
|
965 |
}
|
966 |
|
967 |
+
function button_statistics($url) {
|
968 |
+
$this->btn_link($url, __('Statistics', 'newsletter'), ['icon' => 'fa-chart-bar']);
|
|
|
|
|
|
|
|
|
|
|
969 |
}
|
970 |
|
971 |
+
function button_icon_statistics($url) {
|
972 |
+
$this->btn_link($url, '', ['icon' => 'fa-chart-bar', 'title' => __('Statistics', 'newsletter')]);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
973 |
}
|
974 |
|
975 |
+
function button_icon_view($url) {
|
976 |
+
$this->btn_link($url, '', ['icon' => 'fa-eye', 'title' => __('View', 'newsletter'), 'target' => '_blank']);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
977 |
}
|
978 |
|
979 |
+
function button_icon_newsletters($url) {
|
980 |
+
$this->btn_link($url, '', ['icon' => 'fa-file-alt', 'title' => __('Newsletters', 'newsletter')]);
|
981 |
+
}
|
982 |
+
|
983 |
+
function button_icon_design($url) {
|
984 |
+
$this->btn_link($url, '', ['icon' => 'fa-paint-brush', 'title' => __('Design', 'newsletter')]);
|
985 |
+
}
|
986 |
+
|
987 |
+
function button_icon_edit($url) {
|
988 |
+
$this->btn_link($url, '', ['icon' => 'fa-edit', 'title' => __('Edit', 'newsletter')]);
|
989 |
+
}
|
990 |
+
|
991 |
+
function button_icon_back($url) {
|
992 |
+
$this->btn_link($url, '', ['icon' => 'fa-chevron-left', 'title' => __('Back', 'newsletter')]);
|
993 |
+
}
|
994 |
+
|
995 |
+
function button_icon($action, $icon, $title = '', $data = '', $confirm = false) {
|
996 |
+
$this->btn($action, '', ['data' => $data, 'icon' => $icon, 'title' => $title, 'confirm' => $confirm]);
|
997 |
+
}
|
998 |
+
|
999 |
+
function button_back($url) {
|
1000 |
+
$this->btn_link($url, __('Back', 'newsletter'), ['icon' => 'fa-chevron-left']);
|
1001 |
+
}
|
1002 |
+
|
1003 |
+
function button_test($action = 'test') {
|
1004 |
+
$this->btn($action, __('Test', 'newsletter'), ['icon' => 'fa-vial']);
|
1005 |
}
|
1006 |
|
1007 |
function button_primary($action, $label, $function = null) {
|
1013 |
}
|
1014 |
|
1015 |
function button_confirm($action, $label, $message = '', $data = '') {
|
1016 |
+
$this->btn($action, $label, ['data' => $data, 'confirm' => $message]);
|
|
|
|
|
|
|
|
|
|
|
1017 |
}
|
1018 |
|
1019 |
+
/**
|
1020 |
+
* @deprecated
|
1021 |
+
* @param string $url
|
1022 |
+
* @param string $label Not escaped.
|
1023 |
+
*/
|
1024 |
+
function button_link($url, $label = '') {
|
1025 |
+
echo '<a href="', esc_attr($url), '" class="button-primary">', $label, '</a>';
|
1026 |
}
|
1027 |
|
1028 |
function editor($name, $rows = 5, $cols = 75) {
|
1032 |
}
|
1033 |
|
1034 |
function wp_editor($name, $settings = array()) {
|
1035 |
+
|
1036 |
+
add_filter('mce_buttons', function ($mce_buttons) {
|
1037 |
+
$mce_buttons[] = 'wp_add_media';
|
1038 |
+
//$mce_buttons[] = 'wp_code';
|
1039 |
+
return $mce_buttons;
|
1040 |
+
});
|
1041 |
+
|
1042 |
+
$settings = array_merge(['media_buttons' => false], $settings);
|
1043 |
+
|
1044 |
$value = $this->get_value($name);
|
1045 |
wp_editor($value, $name, array_merge(array(
|
1046 |
'tinymce' => array('content_css' => plugins_url('newsletter') . '/css/wp-editor.css?ver=' . filemtime(NEWSLETTER_DIR . '/css/wp-editor.css')),
|
1143 |
echo '<input type="radio" id="' . esc_attr($name) . '" name="options[' . esc_attr($name) . ']" value="' . esc_attr($value) . '"';
|
1144 |
$v = $this->get_value($name);
|
1145 |
if ($v == $value) {
|
1146 |
+
echo ' checked';
|
1147 |
}
|
1148 |
echo '>';
|
1149 |
if ($label != '') {
|
1168 |
}
|
1169 |
|
1170 |
function checkboxes($name, $options) {
|
1171 |
+
echo '<div class="tnpc-checkboxes">';
|
1172 |
foreach ($options as $value => $label) {
|
1173 |
$this->checkbox_group($name, $value, $label);
|
1174 |
}
|
1179 |
function color($name, $default = '') {
|
1180 |
$value = esc_attr($this->get_value($name, $default));
|
1181 |
$name = esc_attr($name);
|
1182 |
+
echo '<input class="tnpc-color" id="options-', $name, '" name="options[', $name, ']" type="text" value="', $value, '">';
|
1183 |
}
|
1184 |
|
1185 |
/** Creates a set of checkbox named $name_[category id] (so they are posted with distinct names).
|
1186 |
*/
|
1187 |
function categories($name = 'category') {
|
1188 |
$categories = get_categories();
|
1189 |
+
echo '<div class="tnpc-checkboxes">';
|
1190 |
foreach ($categories as $c) {
|
|
|
1191 |
$this->checkbox($name . '_' . $c->cat_ID, esc_html($c->cat_name));
|
|
|
1192 |
}
|
1193 |
echo '<div style="clear: both"></div>';
|
|
|
1194 |
}
|
1195 |
|
1196 |
/**
|
1202 |
if ($show_mode) {
|
1203 |
$this->select($name . '_mode', array('include' => 'To be included', 'exclude' => 'To be excluded'));
|
1204 |
}
|
1205 |
+
echo '<div class="tnpc-checkboxes">';
|
1206 |
foreach ($categories as &$c) {
|
|
|
1207 |
$this->checkbox_group($name, $c->cat_ID, esc_html($c->cat_name));
|
|
|
1208 |
}
|
1209 |
echo '<div style="clear: both"></div>';
|
|
|
1210 |
}
|
1211 |
|
1212 |
/**
|
1217 |
function preferences($name = 'preferences') {
|
1218 |
$lists = Newsletter::instance()->get_lists();
|
1219 |
|
1220 |
+
echo '<div class="tnpc-checkboxes">';
|
|
|
1221 |
foreach ($lists as $list) {
|
|
|
|
|
1222 |
$this->checkbox2($name . '_' . $list->id, esc_html($list->name));
|
|
|
1223 |
}
|
1224 |
+
echo '<div style="clear: both"></div>';
|
1225 |
}
|
1226 |
|
1227 |
function lists_checkboxes($name = 'lists') {
|
1286 |
$this->select($name, $lists);
|
1287 |
}
|
1288 |
|
1289 |
+
function lists_select_with_notes($name = 'list', $empty_label = null) {
|
1290 |
+
|
1291 |
+
$value = $this->get_value($name);
|
1292 |
+
|
1293 |
+
$lists = Newsletter::instance()->get_lists();
|
1294 |
+
$options = [];
|
1295 |
+
if ($empty_label) {
|
1296 |
+
$options[''] = $empty_label;
|
1297 |
+
}
|
1298 |
+
|
1299 |
+
foreach ($lists as $list) {
|
1300 |
+
$options['' . $list->id] = '(' . $list->id . ') ' . esc_html($list->name);
|
1301 |
+
}
|
1302 |
+
|
1303 |
+
$this->select($name, $options, null, ['onchange' => 'tnp_lists_toggle(this); return true;']);
|
1304 |
+
echo '<div id="options-', esc_attr($name), '-notes" class="tnpc_lists_notes">';
|
1305 |
+
foreach ($lists as $list) {
|
1306 |
+
$id = $list->id;
|
1307 |
+
$notes = apply_filters('newsletter_lists_notes', [], $id);
|
1308 |
+
|
1309 |
+
echo '<div class="list_', $id, '" style="display: ', ($value == $id ? 'block' : 'none'), '">';
|
1310 |
+
if ($list->forced) {
|
1311 |
+
echo 'Enforced on subscription<br>';
|
1312 |
+
}
|
1313 |
+
echo implode('<br>', $notes);
|
1314 |
+
echo '</div>';
|
1315 |
+
}
|
1316 |
+
echo '</div>';
|
1317 |
+
}
|
1318 |
+
|
1319 |
function public_lists_select($name = 'list', $empty_label = null) {
|
1320 |
$lists = $this->get_public_list_options($empty_label);
|
1321 |
$this->select($name, $lists);
|
1614 |
echo '<script>';
|
1615 |
echo 'location.href="' . $url . '"';
|
1616 |
echo '</script>';
|
1617 |
+
die();
|
1618 |
}
|
1619 |
|
1620 |
/**
|
1633 |
* @param array $attrs
|
1634 |
*/
|
1635 |
function css_font($name = 'font', $attrs = array()) {
|
1636 |
+
$default = [
|
1637 |
+
'color' => true,
|
1638 |
+
'weight' => true,
|
1639 |
+
'hide_size' => false,
|
1640 |
+
'hide_weight' => false,
|
1641 |
+
'hide_color' => false,
|
1642 |
+
];
|
1643 |
$attrs = array_merge($default, $attrs);
|
1644 |
$this->css_font_family($name . '_family', !empty($attrs['family_default']));
|
1645 |
if (!$attrs['hide_size']) {
|
1657 |
$value = $this->get_value($name);
|
1658 |
|
1659 |
echo '<select class="tnpf-font-size" id="options-', esc_attr($name), '" name="options[', esc_attr($name), ']">';
|
1660 |
+
if ($show_empty_option) {
|
1661 |
+
echo "<option value=''>-</option>";
|
1662 |
+
}
|
1663 |
for ($i = 8; $i <= 50; $i++) {
|
1664 |
echo '<option value="' . $i . '"';
|
1665 |
if ($value == $i) {
|
1676 |
$fonts = array('normal' => 'Normal', 'bold' => 'Bold');
|
1677 |
|
1678 |
echo '<select class="tnpf-font-weight" id="options-' . esc_attr($name) . '" name="options[' . esc_attr($name) . ']">';
|
1679 |
+
if ($show_empty_option) {
|
1680 |
+
echo "<option value=''>-</option>";
|
1681 |
+
}
|
1682 |
foreach ($fonts as $key => $font) {
|
1683 |
echo '<option value="', esc_attr($key), '"';
|
1684 |
if ($value == $key) {
|
1708 |
'Verdana, Geneva, sans-serif' => 'Verdana, Geneva']);
|
1709 |
|
1710 |
echo '<select class="tnpf-font-family" id="options-', esc_attr($name), '" name="options[', esc_attr($name), ']">';
|
1711 |
+
foreach ($fonts as $font => $label) {
|
1712 |
echo '<option value="', esc_attr($font), '"';
|
1713 |
if ($value == $font) {
|
1714 |
echo ' selected';
|
2020 |
global $tnpc_show_subject;
|
2021 |
$tnpc_show_subject = $show_subject;
|
2022 |
|
2023 |
+
echo "<link href='" . plugins_url('newsletter') . "/emails/tnp-composer/_css/newsletter-builder-v2.css?ver=" . NEWSLETTER_VERSION . "' rel='stylesheet' type='text/css'>";
|
2024 |
|
2025 |
wp_enqueue_style('tnp-modal-style', plugins_url('newsletter') . '/emails/tnp-composer/_css/tnp-modal.css', array(), NEWSLETTER_VERSION);
|
2026 |
wp_enqueue_style('tnp-toast-style', plugins_url('newsletter') . '/emails/tnp-composer/_css/tnp-toast.css', array(), NEWSLETTER_VERSION);
|
includes/helper.php
CHANGED
@@ -221,6 +221,9 @@ function tnp_resize($media_id, $size) {
|
|
221 |
|
222 |
if (substr($relative_file, -4) === '.gif') {
|
223 |
$editor = wp_get_image_editor($absolute_file);
|
|
|
|
|
|
|
224 |
$new_size = $editor->get_size();
|
225 |
$media = new TNP_Media();
|
226 |
$media->width = $new_size['width'];
|
221 |
|
222 |
if (substr($relative_file, -4) === '.gif') {
|
223 |
$editor = wp_get_image_editor($absolute_file);
|
224 |
+
if (is_wp_error($editor)) {
|
225 |
+
return _tnp_get_default_media($media_id, $size);
|
226 |
+
}
|
227 |
$new_size = $editor->get_size();
|
228 |
$media = new TNP_Media();
|
229 |
$media->width = $new_size['width'];
|
includes/mailer.php
CHANGED
@@ -1,547 +1,547 @@
|
|
1 |
-
<?php
|
2 |
-
|
3 |
-
use TNP\Mailer\PHPMailerLoader;
|
4 |
-
|
5 |
-
/**
|
6 |
-
*
|
7 |
-
*/
|
8 |
-
class NewsletterMailer {
|
9 |
-
|
10 |
-
const ERROR_GENERIC = '1';
|
11 |
-
const ERROR_FATAL = '2';
|
12 |
-
|
13 |
-
/* @var NewsletterLogger */
|
14 |
-
|
15 |
-
var $logger;
|
16 |
-
var $name;
|
17 |
-
var $options;
|
18 |
-
private $delta;
|
19 |
-
protected $batch_size = 1;
|
20 |
-
|
21 |
-
public function __construct($name, $options = array()) {
|
22 |
-
$this->name = $name;
|
23 |
-
$this->options = $options;
|
24 |
-
}
|
25 |
-
|
26 |
-
public function get_name() {
|
27 |
-
return $this->name;
|
28 |
-
}
|
29 |
-
|
30 |
-
public function get_description() {
|
31 |
-
return $this->name;
|
32 |
-
}
|
33 |
-
|
34 |
-
public function get_batch_size() {
|
35 |
-
return $this->batch_size;
|
36 |
-
}
|
37 |
-
|
38 |
-
function send_with_stats($message) {
|
39 |
-
$this->delta = microtime(true);
|
40 |
-
$r = $this->send($message);
|
41 |
-
$this->delta = microtime(true) - $this->delta;
|
42 |
-
return $r;
|
43 |
-
}
|
44 |
-
|
45 |
-
/**
|
46 |
-
*
|
47 |
-
* @param TNP_Mailer_Message $message
|
48 |
-
* @return bool|WP_Error
|
49 |
-
*/
|
50 |
-
public function send($message) {
|
51 |
-
$message->error = 'No mailing system available';
|
52 |
-
return new WP_Error(self::ERROR_FATAL, 'No mailing system available');
|
53 |
-
}
|
54 |
-
|
55 |
-
public function send_batch_with_stats($messages) {
|
56 |
-
$this->delta = microtime(true);
|
57 |
-
$r = $this->send_batch($messages);
|
58 |
-
$this->delta = microtime(true) - $this->delta;
|
59 |
-
return $r;
|
60 |
-
}
|
61 |
-
|
62 |
-
function get_capability() {
|
63 |
-
return (int) (3600 * $this->batch_size / $this->delta);
|
64 |
-
}
|
65 |
-
|
66 |
-
/**
|
67 |
-
*
|
68 |
-
* @param TNP_Mailer_Message[] $messages
|
69 |
-
* @return bool|WP_Error
|
70 |
-
*/
|
71 |
-
public function send_batch($messages) {
|
72 |
-
|
73 |
-
// We should not get there is the batch size is one, the caller should use "send()". We can get
|
74 |
-
// there if the array of messages counts to one, since could be the last of a series of chunks.
|
75 |
-
if ($this->batch_size == 1 || count($messages) == 1) {
|
76 |
-
$last_result = true;
|
77 |
-
foreach ($messages as $message) {
|
78 |
-
$r = $this->send($message);
|
79 |
-
if (is_wp_error($r)) {
|
80 |
-
$last_result = $r;
|
81 |
-
}
|
82 |
-
}
|
83 |
-
return $last_result;
|
84 |
-
}
|
85 |
-
|
86 |
-
// We should always get there
|
87 |
-
if (count($messages) <= $this->batch_size) {
|
88 |
-
return $this->send_chunk($messages);
|
89 |
-
}
|
90 |
-
|
91 |
-
// We should not get here, since it is not optimized
|
92 |
-
$chunks = array_chunk($message, $this->batch_size);
|
93 |
-
$last_result = true;
|
94 |
-
foreach ($chunks as $chunk) {
|
95 |
-
$r = $this->send_chunk($chunk);
|
96 |
-
if (is_wp_error($r)) {
|
97 |
-
$last_result = $r;
|
98 |
-
}
|
99 |
-
}
|
100 |
-
return $last_result;
|
101 |
-
}
|
102 |
-
|
103 |
-
protected function send_chunk($messages) {
|
104 |
-
$last_result = true;
|
105 |
-
foreach ($messages as $message) {
|
106 |
-
$r = $this->send($message);
|
107 |
-
if (is_wp_error($r)) {
|
108 |
-
$last_result = $r;
|
109 |
-
}
|
110 |
-
}
|
111 |
-
return $last_result;
|
112 |
-
}
|
113 |
-
|
114 |
-
/**
|
115 |
-
* @return NewsletterLogger
|
116 |
-
*/
|
117 |
-
function get_logger() {
|
118 |
-
if ($this->logger) {
|
119 |
-
return $this->logger;
|
120 |
-
}
|
121 |
-
$this->logger = new NewsletterLogger($this->name . '-mailer');
|
122 |
-
return $this->logger;
|
123 |
-
}
|
124 |
-
|
125 |
-
/**
|
126 |
-
*
|
127 |
-
* @param TNP_Mailer_Message $message
|
128 |
-
* @return bool|WP_Error
|
129 |
-
*/
|
130 |
-
public function enqueue(TNP_Mailer_Message $message) {
|
131 |
-
// Optimization when there is no queue
|
132 |
-
if ($this->queue_max == 0) {
|
133 |
-
$r = $this->send($message);
|
134 |
-
return $r;
|
135 |
-
}
|
136 |
-
|
137 |
-
$this->queue[] = $message;
|
138 |
-
if (count($this->queue) >= $this->queue_max) {
|
139 |
-
return $this->flush();
|
140 |
-
}
|
141 |
-
return true;
|
142 |
-
}
|
143 |
-
|
144 |
-
public function flush() {
|
145 |
-
$undelivered = array();
|
146 |
-
foreach ($this->queue as $message) {
|
147 |
-
$r = $this->deliver($message);
|
148 |
-
if (is_wp_error($r)) {
|
149 |
-
$message->error = $r;
|
150 |
-
$undelivered[] = $message;
|
151 |
-
}
|
152 |
-
}
|
153 |
-
|
154 |
-
$this->queue = array();
|
155 |
-
|
156 |
-
if ($undelivered) {
|
157 |
-
return new WP_Error(self::ERROR_GENERAL, 'Error while flushing messages', $undelivered);
|
158 |
-
}
|
159 |
-
|
160 |
-
return true;
|
161 |
-
}
|
162 |
-
|
163 |
-
/**
|
164 |
-
* Original mail function simulation for compatibility.
|
165 |
-
* @deprecated
|
166 |
-
*
|
167 |
-
* @param string $to
|
168 |
-
* @param string $subject
|
169 |
-
* @param array $message
|
170 |
-
* @param array $headers
|
171 |
-
* @param bool $enqueue
|
172 |
-
* @param type $from Actually ignored
|
173 |
-
* @return type
|
174 |
-
*/
|
175 |
-
public function mail($to, $subject, $message, $headers = null, $enqueue = false, $from = false) {
|
176 |
-
$mailer_message = new TNP_Mailer_Message();
|
177 |
-
$mailer_message->to = $to;
|
178 |
-
$mailer_message->subject = $subject;
|
179 |
-
$mailer_message->headers = $headers;
|
180 |
-
$mailer_message->body = $message['html'];
|
181 |
-
$mailer_message->body_text = $message['text'];
|
182 |
-
|
183 |
-
if ($enqueue) {
|
184 |
-
return !is_wp_error($this->enqueue($mailer_message));
|
185 |
-
}
|
186 |
-
return !is_wp_error($this->send($mailer_message));
|
187 |
-
}
|
188 |
-
|
189 |
-
function save_last_run($time) {
|
190 |
-
update_option($this->prefix . '_last_run', $time);
|
191 |
-
}
|
192 |
-
|
193 |
-
function get_last_run() {
|
194 |
-
return (int) get_option($this->prefix . '_last_run', 0);
|
195 |
-
}
|
196 |
-
|
197 |
-
}
|
198 |
-
|
199 |
-
/**
|
200 |
-
* @property string $to
|
201 |
-
* @property string $subject
|
202 |
-
* @property string $body
|
203 |
-
* @property array $headers
|
204 |
-
* @property string $from
|
205 |
-
* @property string $from_name
|
206 |
-
*/
|
207 |
-
class TNP_Mailer_Message {
|
208 |
-
|
209 |
-
var $to_name = '';
|
210 |
-
var $headers = array();
|
211 |
-
var $user_id = 0;
|
212 |
-
var $email_id = 0;
|
213 |
-
var $error = '';
|
214 |
-
var $subject = '';
|
215 |
-
var $body = '';
|
216 |
-
var $body_text = '';
|
217 |
-
|
218 |
-
}
|
219 |
-
|
220 |
-
/**
|
221 |
-
* Wrapper mailer for old addons registering the "mail" method (ultra deprecated).
|
222 |
-
*/
|
223 |
-
class NewsletterMailMethodWrapper extends NewsletterMailer {
|
224 |
-
|
225 |
-
var $mail_method;
|
226 |
-
|
227 |
-
/**
|
228 |
-
* The reference to the mail method.
|
229 |
-
*
|
230 |
-
* @param callback $callable Must be an array with object and method to call, no other callback formats allowed.
|
231 |
-
*/
|
232 |
-
function __construct($callable) {
|
233 |
-
parent::__construct(strtolower(get_class($callable[0])), array());
|
234 |
-
$this->mail_method = $callable;
|
235 |
-
}
|
236 |
-
|
237 |
-
function get_description() {
|
238 |
-
if ($this->mail_method != null) {
|
239 |
-
return 'Mail method of ' . get_class($this->mail_method[0]);
|
240 |
-
} else {
|
241 |
-
return 'Undetectable mailer class';
|
242 |
-
}
|
243 |
-
}
|
244 |
-
|
245 |
-
function send($message) {
|
246 |
-
if ($this->mail_method != null) {
|
247 |
-
$r = call_user_func($this->mail_method, $message->to, $message->subject, array('html' => $message->body, 'text' => $message->body_text), $message->headers);
|
248 |
-
if (!$r) {
|
249 |
-
$message->error = 'Unreported error';
|
250 |
-
return new WP_Error(self::ERROR_GENERIC, 'Unreported error');
|
251 |
-
}
|
252 |
-
} else {
|
253 |
-
$message->error = 'Mail method not available';
|
254 |
-
return new WP_Error(self::ERROR_FATAL, 'Mail method not available');
|
255 |
-
}
|
256 |
-
return true;
|
257 |
-
}
|
258 |
-
|
259 |
-
}
|
260 |
-
|
261 |
-
/**
|
262 |
-
* Wrapper Mailer for old addons registering the "mail" method (deprecated).
|
263 |
-
*/
|
264 |
-
class NewsletterOldMailerWrapper extends NewsletterMailer {
|
265 |
-
|
266 |
-
var $mailer;
|
267 |
-
|
268 |
-
/**
|
269 |
-
* Old mailer plugin (actually untyped object)
|
270 |
-
* @param object $mailer
|
271 |
-
*/
|
272 |
-
function __construct($mailer) {
|
273 |
-
$this->mailer = $mailer;
|
274 |
-
// We have not a name, build it from the class name... and of course, no options.
|
275 |
-
parent::__construct(strtolower(get_class($mailer)), array());
|
276 |
-
$this->description = 'Mailer wrapper for ' . get_class($mailer);
|
277 |
-
}
|
278 |
-
|
279 |
-
/**
|
280 |
-
* Only send() needs to be implemented all other method will use the defail base-class implementation
|
281 |
-
*
|
282 |
-
* @param TNP_Mailer_Message $message
|
283 |
-
* @return \WP_Error|boolean
|
284 |
-
*/
|
285 |
-
function send($message) {
|
286 |
-
// The old mailer manages itself the from field
|
287 |
-
$r = $this->mailer->mail($message->to, $message->subject, array('html' => $message->body, 'text' => $message->body_text), $message->headers);
|
288 |
-
if (!$r) {
|
289 |
-
if (isset($this->mailer->result)) {
|
290 |
-
$message->error = $this->mailer->result;
|
291 |
-
return new WP_Error(self::ERROR_GENERIC, $this->mailer->result);
|
292 |
-
} else {
|
293 |
-
$message->error = 'Unknown error';
|
294 |
-
return new WP_Error(self::ERROR_GENERIC, 'Unknown error');
|
295 |
-
}
|
296 |
-
}
|
297 |
-
return true;
|
298 |
-
}
|
299 |
-
|
300 |
-
}
|
301 |
-
|
302 |
-
/**
|
303 |
-
* Standard Mailer which uses the wp_mail() function of WP.
|
304 |
-
*/
|
305 |
-
class NewsletterDefaultMailer extends NewsletterMailer {
|
306 |
-
|
307 |
-
var $filter_active = false;
|
308 |
-
|
309 |
-
/**
|
310 |
-
* Static to be accessed in the hook: on some installation the object $this is not working, we're still trying to understand why
|
311 |
-
* @var TNP_Mailer_Message
|
312 |
-
*/
|
313 |
-
var $current_message = null;
|
314 |
-
|
315 |
-
function __construct() {
|
316 |
-
parent::__construct('default', Newsletter::instance()->get_options('smtp'));
|
317 |
-
}
|
318 |
-
|
319 |
-
function get_description() {
|
320 |
-
// TODO: check if overloaded
|
321 |
-
return 'wp_mail() WordPress function (could be extended by a SMTP plugin)';
|
322 |
-
}
|
323 |
-
|
324 |
-
function fix_mailer($mailer) {
|
325 |
-
// If there is not a current message, wp_mail() was not called by us
|
326 |
-
if (is_null($this->current_message)) {
|
327 |
-
return;
|
328 |
-
}
|
329 |
-
|
330 |
-
$newsletter = Newsletter::instance();
|
331 |
-
if (isset($this->current_message->encoding)) {
|
332 |
-
$mailer->Encoding = $this->current_message->encoding;
|
333 |
-
} else {
|
334 |
-
if (!empty($newsletter->options['content_transfer_encoding'])) {
|
335 |
-
$mailer->Encoding = $newsletter->options['content_transfer_encoding'];
|
336 |
-
} else {
|
337 |
-
$mailer->Encoding = 'base64';
|
338 |
-
}
|
339 |
-
}
|
340 |
-
|
341 |
-
/* @var $mailer PHPMailer */
|
342 |
-
$mailer->Sender = $newsletter->options['return_path'];
|
343 |
-
|
344 |
-
// If there is an HTML body AND a text body, add the text part.
|
345 |
-
if (!empty($this->current_message->body) && !empty($this->current_message->body_text)) {
|
346 |
-
$mailer->AltBody = $this->current_message->body_text;
|
347 |
-
}
|
348 |
-
}
|
349 |
-
|
350 |
-
function send($message) {
|
351 |
-
|
352 |
-
if (!$this->filter_active) {
|
353 |
-
add_action('phpmailer_init', array($this, 'fix_mailer'), 100);
|
354 |
-
$this->filter_active = true;
|
355 |
-
}
|
356 |
-
|
357 |
-
$newsletter = Newsletter::instance();
|
358 |
-
$wp_mail_headers = array();
|
359 |
-
// TODO: Manage the from address
|
360 |
-
$wp_mail_headers[] = 'From: "' . $newsletter->options['sender_name'] . '" <' . $newsletter->options['sender_email'] . '>';
|
361 |
-
|
362 |
-
if (!empty($newsletter->options['reply_to'])) {
|
363 |
-
$wp_mail_headers[] = 'Reply-To: ' . $newsletter->options['reply_to'];
|
364 |
-
}
|
365 |
-
|
366 |
-
// Manage from and from name
|
367 |
-
|
368 |
-
if (!empty($message->headers)) {
|
369 |
-
foreach ($message->headers as $key => $value) {
|
370 |
-
$wp_mail_headers[] = $key . ': ' . $value;
|
371 |
-
}
|
372 |
-
}
|
373 |
-
|
374 |
-
if (!empty($message->body)) {
|
375 |
-
$wp_mail_headers[] = 'Content-Type: text/html;charset=UTF-8';
|
376 |
-
$body = $message->body;
|
377 |
-
} else if (!empty($message->body_text)) {
|
378 |
-
$wp_mail_headers[] = 'Content-Type: text/plain;charset=UTF-8';
|
379 |
-
$body = $message->body_text;
|
380 |
-
} else {
|
381 |
-
$message->error = 'Empty body';
|
382 |
-
return new WP_Error(self::ERROR_GENERIC, 'Message format');
|
383 |
-
}
|
384 |
-
|
385 |
-
$this->current_message = $message;
|
386 |
-
$r = wp_mail($message->to, $message->subject, $body, $wp_mail_headers);
|
387 |
-
$this->current_message = null;
|
388 |
-
|
389 |
-
if (!$r) {
|
390 |
-
$last_error = error_get_last();
|
391 |
-
if (is_array($last_error)) {
|
392 |
-
$message->error = $last_error['message'];
|
393 |
-
if (stripos($message->error, 'Could not instantiate mail function') || stripos($message->error, 'Failed to connect to mailserver')) {
|
394 |
-
return new WP_Error(self::ERROR_FATAL, $last_error['message']);
|
395 |
-
} else {
|
396 |
-
return new WP_Error(self::ERROR_GENERIC, $last_error['message']);
|
397 |
-
}
|
398 |
-
} else {
|
399 |
-
$message->error = 'No error explanation reported';
|
400 |
-
return new WP_Error(self::ERROR_GENERIC, 'No error message reported');
|
401 |
-
}
|
402 |
-
}
|
403 |
-
return true;
|
404 |
-
}
|
405 |
-
|
406 |
-
}
|
407 |
-
|
408 |
-
/**
|
409 |
-
* Standard Mailer which uses the wp_mail() function of WP.
|
410 |
-
*/
|
411 |
-
class NewsletterDefaultSMTPMailer extends NewsletterMailer {
|
412 |
-
|
413 |
-
var $mailer = null;
|
414 |
-
|
415 |
-
function __construct($options) {
|
416 |
-
parent::__construct('internal-smtp', $options);
|
417 |
-
}
|
418 |
-
|
419 |
-
function get_description() {
|
420 |
-
return 'Internal SMTP';
|
421 |
-
}
|
422 |
-
|
423 |
-
/**
|
424 |
-
*
|
425 |
-
* @param TNP_Mailer_Message $message
|
426 |
-
* @return \WP_Error|boolean
|
427 |
-
*/
|
428 |
-
public function send($message) {
|
429 |
-
$logger = $this->get_logger();
|
430 |
-
$logger->debug('Start sending to ' . $message->to);
|
431 |
-
$mailer = $this->get_mailer();
|
432 |
-
|
433 |
-
if (!empty($message->body)) {
|
434 |
-
$mailer->IsHTML(true);
|
435 |
-
$mailer->Body = $message->body;
|
436 |
-
$mailer->AltBody = $message->body_text;
|
437 |
-
} else {
|
438 |
-
$mailer->IsHTML(false);
|
439 |
-
$mailer->Body = $message->body_text;
|
440 |
-
$mailer->AltBody = '';
|
441 |
-
}
|
442 |
-
|
443 |
-
$mailer->Subject = $message->subject;
|
444 |
-
|
445 |
-
$mailer->ClearCustomHeaders();
|
446 |
-
if (!empty($message->headers)) {
|
447 |
-
foreach ($message->headers as $key => $value) {
|
448 |
-
$mailer->AddCustomHeader($key . ': ' . $value);
|
449 |
-
}
|
450 |
-
}
|
451 |
-
|
452 |
-
if ($message->from) {
|
453 |
-
$logger->debug('Alternative from available');
|
454 |
-
$mailer->setFrom($message->from, $message->from_name);
|
455 |
-
} else {
|
456 |
-
$newsletter = Newsletter::instance();
|
457 |
-
$mailer->setFrom($newsletter->options['sender_email'], $newsletter->options['sender_name']);
|
458 |
-
}
|
459 |
-
|
460 |
-
$mailer->ClearAddresses();
|
461 |
-
$mailer->AddAddress($message->to);
|
462 |
-
$mailer->Send();
|
463 |
-
|
464 |
-
if ($mailer->IsError()) {
|
465 |
-
|
466 |
-
$logger->error($mailer->ErrorInfo);
|
467 |
-
// If the error is due to SMTP connection, the mailer cannot be reused since it does not clean up the connection
|
468 |
-
// on error.
|
469 |
-
//$this->mailer = null;
|
470 |
-
$message->error = $mailer->ErrorInfo;
|
471 |
-
return new WP_Error(self::ERROR_GENERIC, $mailer->ErrorInfo);
|
472 |
-
}
|
473 |
-
|
474 |
-
$logger->debug('Sent ' . $message->to);
|
475 |
-
//$logger->error('Time: ' . (microtime(true) - $start) . ' seconds');
|
476 |
-
return true;
|
477 |
-
}
|
478 |
-
|
479 |
-
/**
|
480 |
-
*
|
481 |
-
* @return PHPMailer
|
482 |
-
*/
|
483 |
-
function get_mailer() {
|
484 |
-
global $wp_version;
|
485 |
-
|
486 |
-
if ($this->mailer) {
|
487 |
-
return $this->mailer;
|
488 |
-
}
|
489 |
-
|
490 |
-
$logger = $this->get_logger();
|
491 |
-
$logger->debug('Setting up PHP mailer');
|
492 |
-
|
493 |
-
require_once 'PHPMailerLoader.php';
|
494 |
-
$this->mailer = PHPMailerLoader::make_instance();
|
495 |
-
|
496 |
-
$this->mailer->XMailer = ' '; // A space!
|
497 |
-
|
498 |
-
$this->mailer->IsSMTP();
|
499 |
-
$this->mailer->Host = $this->options['host'];
|
500 |
-
if (!empty($this->options['port'])) {
|
501 |
-
$this->mailer->Port = (int) $this->options['port'];
|
502 |
-
}
|
503 |
-
|
504 |
-
if (!empty($this->options['user'])) {
|
505 |
-
$this->mailer->SMTPAuth = true;
|
506 |
-
$this->mailer->Username = $this->options['user'];
|
507 |
-
$this->mailer->Password = $this->options['pass'];
|
508 |
-
}
|
509 |
-
|
510 |
-
$this->mailer->SMTPSecure = $this->options['secure'];
|
511 |
-
$this->mailer->SMTPAutoTLS = false;
|
512 |
-
|
513 |
-
if ($this->options['ssl_insecure'] == 1) {
|
514 |
-
$this->mailer->SMTPOptions = array(
|
515 |
-
'ssl' => array(
|
516 |
-
'verify_peer' => false,
|
517 |
-
'verify_peer_name' => false,
|
518 |
-
'allow_self_signed' => true
|
519 |
-
)
|
520 |
-
);
|
521 |
-
}
|
522 |
-
|
523 |
-
$newsletter = Newsletter::instance();
|
524 |
-
|
525 |
-
// if (!empty($newsletter->options['content_transfer_encoding'])) {
|
526 |
-
// $this->mailer->Encoding = $newsletter->options['content_transfer_encoding'];
|
527 |
-
// } else {
|
528 |
-
// $this->mailer->Encoding = 'base64';
|
529 |
-
// }
|
530 |
-
|
531 |
-
$this->mailer->CharSet = 'UTF-8';
|
532 |
-
$this->mailer->From = $newsletter->options['sender_email'];
|
533 |
-
|
534 |
-
if (!empty($newsletter->options['return_path'])) {
|
535 |
-
$this->mailer->Sender = $newsletter->options['return_path'];
|
536 |
-
}
|
537 |
-
if (!empty($newsletter->options['reply_to'])) {
|
538 |
-
$this->mailer->AddReplyTo($newsletter->options['reply_to']);
|
539 |
-
}
|
540 |
-
|
541 |
-
$this->mailer->FromName = $newsletter->options['sender_name'];
|
542 |
-
|
543 |
-
|
544 |
-
return $this->mailer;
|
545 |
-
}
|
546 |
-
|
547 |
-
}
|
1 |
+
<?php
|
2 |
+
|
3 |
+
use TNP\Mailer\PHPMailerLoader;
|
4 |
+
|
5 |
+
/**
|
6 |
+
*
|
7 |
+
*/
|
8 |
+
class NewsletterMailer {
|
9 |
+
|
10 |
+
const ERROR_GENERIC = '1';
|
11 |
+
const ERROR_FATAL = '2';
|
12 |
+
|
13 |
+
/* @var NewsletterLogger */
|
14 |
+
|
15 |
+
var $logger;
|
16 |
+
var $name;
|
17 |
+
var $options;
|
18 |
+
private $delta;
|
19 |
+
protected $batch_size = 1;
|
20 |
+
|
21 |
+
public function __construct($name, $options = array()) {
|
22 |
+
$this->name = $name;
|
23 |
+
$this->options = $options;
|
24 |
+
}
|
25 |
+
|
26 |
+
public function get_name() {
|
27 |
+
return $this->name;
|
28 |
+
}
|
29 |
+
|
30 |
+
public function get_description() {
|
31 |
+
return $this->name;
|
32 |
+
}
|
33 |
+
|
34 |
+
public function get_batch_size() {
|
35 |
+
return $this->batch_size;
|
36 |
+
}
|
37 |
+
|
38 |
+
function send_with_stats($message) {
|
39 |
+
$this->delta = microtime(true);
|
40 |
+
$r = $this->send($message);
|
41 |
+
$this->delta = microtime(true) - $this->delta;
|
42 |
+
return $r;
|
43 |
+
}
|
44 |
+
|
45 |
+
/**
|
46 |
+
*
|
47 |
+
* @param TNP_Mailer_Message $message
|
48 |
+
* @return bool|WP_Error
|
49 |
+
*/
|
50 |
+
public function send($message) {
|
51 |
+
$message->error = 'No mailing system available';
|
52 |
+
return new WP_Error(self::ERROR_FATAL, 'No mailing system available');
|
53 |
+
}
|
54 |
+
|
55 |
+
public function send_batch_with_stats($messages) {
|
56 |
+
$this->delta = microtime(true);
|
57 |
+
$r = $this->send_batch($messages);
|
58 |
+
$this->delta = microtime(true) - $this->delta;
|
59 |
+
return $r;
|
60 |
+
}
|
61 |
+
|
62 |
+
function get_capability() {
|
63 |
+
return (int) (3600 * $this->batch_size / $this->delta);
|
64 |
+
}
|
65 |
+
|
66 |
+
/**
|
67 |
+
*
|
68 |
+
* @param TNP_Mailer_Message[] $messages
|
69 |
+
* @return bool|WP_Error
|
70 |
+
*/
|
71 |
+
public function send_batch($messages) {
|
72 |
+
|
73 |
+
// We should not get there is the batch size is one, the caller should use "send()". We can get
|
74 |
+
// there if the array of messages counts to one, since could be the last of a series of chunks.
|
75 |
+
if ($this->batch_size == 1 || count($messages) == 1) {
|
76 |
+
$last_result = true;
|
77 |
+
foreach ($messages as $message) {
|
78 |
+
$r = $this->send($message);
|
79 |
+
if (is_wp_error($r)) {
|
80 |
+
$last_result = $r;
|
81 |
+
}
|
82 |
+
}
|
83 |
+
return $last_result;
|
84 |
+
}
|
85 |
+
|
86 |
+
// We should always get there
|
87 |
+
if (count($messages) <= $this->batch_size) {
|
88 |
+
return $this->send_chunk($messages);
|
89 |
+
}
|
90 |
+
|
91 |
+
// We should not get here, since it is not optimized
|
92 |
+
$chunks = array_chunk($message, $this->batch_size);
|
93 |
+
$last_result = true;
|
94 |
+
foreach ($chunks as $chunk) {
|
95 |
+
$r = $this->send_chunk($chunk);
|
96 |
+
if (is_wp_error($r)) {
|
97 |
+
$last_result = $r;
|
98 |
+
}
|
99 |
+
}
|
100 |
+
return $last_result;
|
101 |
+
}
|
102 |
+
|
103 |
+
protected function send_chunk($messages) {
|
104 |
+
$last_result = true;
|
105 |
+
foreach ($messages as $message) {
|
106 |
+
$r = $this->send($message);
|
107 |
+
if (is_wp_error($r)) {
|
108 |
+
$last_result = $r;
|
109 |
+
}
|
110 |
+
}
|
111 |
+
return $last_result;
|
112 |
+
}
|
113 |
+
|
114 |
+
/**
|
115 |
+
* @return NewsletterLogger
|
116 |
+
*/
|
117 |
+
function get_logger() {
|
118 |
+
if ($this->logger) {
|
119 |
+
return $this->logger;
|
120 |
+
}
|
121 |
+
$this->logger = new NewsletterLogger($this->name . '-mailer');
|
122 |
+
return $this->logger;
|
123 |
+
}
|
124 |
+
|
125 |
+
/**
|
126 |
+
*
|
127 |
+
* @param TNP_Mailer_Message $message
|
128 |
+
* @return bool|WP_Error
|
129 |
+
*/
|
130 |
+
public function enqueue(TNP_Mailer_Message $message) {
|
131 |
+
// Optimization when there is no queue
|
132 |
+
if ($this->queue_max == 0) {
|
133 |
+
$r = $this->send($message);
|
134 |
+
return $r;
|
135 |
+
}
|
136 |
+
|
137 |
+
$this->queue[] = $message;
|
138 |
+
if (count($this->queue) >= $this->queue_max) {
|
139 |
+
return $this->flush();
|
140 |
+
}
|
141 |
+
return true;
|
142 |
+
}
|
143 |
+
|
144 |
+
public function flush() {
|
145 |
+
$undelivered = array();
|
146 |
+
foreach ($this->queue as $message) {
|
147 |
+
$r = $this->deliver($message);
|
148 |
+
if (is_wp_error($r)) {
|
149 |
+
$message->error = $r;
|
150 |
+
$undelivered[] = $message;
|
151 |
+
}
|
152 |
+
}
|
153 |
+
|
154 |
+
$this->queue = array();
|
155 |
+
|
156 |
+
if ($undelivered) {
|
157 |
+
return new WP_Error(self::ERROR_GENERAL, 'Error while flushing messages', $undelivered);
|
158 |
+
}
|
159 |
+
|
160 |
+
return true;
|
161 |
+
}
|
162 |
+
|
163 |
+
/**
|
164 |
+
* Original mail function simulation for compatibility.
|
165 |
+
* @deprecated
|
166 |
+
*
|
167 |
+
* @param string $to
|
168 |
+
* @param string $subject
|
169 |
+
* @param array $message
|
170 |
+
* @param array $headers
|
171 |
+
* @param bool $enqueue
|
172 |
+
* @param type $from Actually ignored
|
173 |
+
* @return type
|
174 |
+
*/
|
175 |
+
public function mail($to, $subject, $message, $headers = null, $enqueue = false, $from = false) {
|
176 |
+
$mailer_message = new TNP_Mailer_Message();
|
177 |
+
$mailer_message->to = $to;
|
178 |
+
$mailer_message->subject = $subject;
|
179 |
+
$mailer_message->headers = $headers;
|
180 |
+
$mailer_message->body = $message['html'];
|
181 |
+
$mailer_message->body_text = $message['text'];
|
182 |
+
|
183 |
+
if ($enqueue) {
|
184 |
+
return !is_wp_error($this->enqueue($mailer_message));
|
185 |
+
}
|
186 |
+
return !is_wp_error($this->send($mailer_message));
|
187 |
+
}
|
188 |
+
|
189 |
+
function save_last_run($time) {
|
190 |
+
update_option($this->prefix . '_last_run', $time);
|
191 |
+
}
|
192 |
+
|
193 |
+
function get_last_run() {
|
194 |
+
return (int) get_option($this->prefix . '_last_run', 0);
|
195 |
+
}
|
196 |
+
|
197 |
+
}
|
198 |
+
|
199 |
+
/**
|
200 |
+
* @property string $to
|
201 |
+
* @property string $subject
|
202 |
+
* @property string $body
|
203 |
+
* @property array $headers
|
204 |
+
* @property string $from
|
205 |
+
* @property string $from_name
|
206 |
+
*/
|
207 |
+
class TNP_Mailer_Message {
|
208 |
+
|
209 |
+
var $to_name = '';
|
210 |
+
var $headers = array();
|
211 |
+
var $user_id = 0;
|
212 |
+
var $email_id = 0;
|
213 |
+
var $error = '';
|
214 |
+
var $subject = '';
|
215 |
+
var $body = '';
|
216 |
+
var $body_text = '';
|
217 |
+
|
218 |
+
}
|
219 |
+
|
220 |
+
/**
|
221 |
+
* Wrapper mailer for old addons registering the "mail" method (ultra deprecated).
|
222 |
+
*/
|
223 |
+
class NewsletterMailMethodWrapper extends NewsletterMailer {
|
224 |
+
|
225 |
+
var $mail_method;
|
226 |
+
|
227 |
+
/**
|
228 |
+
* The reference to the mail method.
|
229 |
+
*
|
230 |
+
* @param callback $callable Must be an array with object and method to call, no other callback formats allowed.
|
231 |
+
*/
|
232 |
+
function __construct($callable) {
|
233 |
+
parent::__construct(strtolower(get_class($callable[0])), array());
|
234 |
+
$this->mail_method = $callable;
|
235 |
+
}
|
236 |
+
|
237 |
+
function get_description() {
|
238 |
+
if ($this->mail_method != null) {
|
239 |
+
return 'Mail method of ' . get_class($this->mail_method[0]);
|
240 |
+
} else {
|
241 |
+
return 'Undetectable mailer class';
|
242 |
+
}
|
243 |
+
}
|
244 |
+
|
245 |
+
function send($message) {
|
246 |
+
if ($this->mail_method != null) {
|
247 |
+
$r = call_user_func($this->mail_method, $message->to, $message->subject, array('html' => $message->body, 'text' => $message->body_text), $message->headers);
|
248 |
+
if (!$r) {
|
249 |
+
$message->error = 'Unreported error';
|
250 |
+
return new WP_Error(self::ERROR_GENERIC, 'Unreported error');
|
251 |
+
}
|
252 |
+
} else {
|
253 |
+
$message->error = 'Mail method not available';
|
254 |
+
return new WP_Error(self::ERROR_FATAL, 'Mail method not available');
|
255 |
+
}
|
256 |
+
return true;
|
257 |
+
}
|
258 |
+
|
259 |
+
}
|
260 |
+
|
261 |
+
/**
|
262 |
+
* Wrapper Mailer for old addons registering the "mail" method (deprecated).
|
263 |
+
*/
|
264 |
+
class NewsletterOldMailerWrapper extends NewsletterMailer {
|
265 |
+
|
266 |
+
var $mailer;
|
267 |
+
|
268 |
+
/**
|
269 |
+
* Old mailer plugin (actually untyped object)
|
270 |
+
* @param object $mailer
|
271 |
+
*/
|
272 |
+
function __construct($mailer) {
|
273 |
+
$this->mailer = $mailer;
|
274 |
+
// We have not a name, build it from the class name... and of course, no options.
|
275 |
+
parent::__construct(strtolower(get_class($mailer)), array());
|
276 |
+
$this->description = 'Mailer wrapper for ' . get_class($mailer);
|
277 |
+
}
|
278 |
+
|
279 |
+
/**
|
280 |
+
* Only send() needs to be implemented all other method will use the defail base-class implementation
|
281 |
+
*
|
282 |
+
* @param TNP_Mailer_Message $message
|
283 |
+
* @return \WP_Error|boolean
|
284 |
+
*/
|
285 |
+
function send($message) {
|
286 |
+
// The old mailer manages itself the from field
|
287 |
+
$r = $this->mailer->mail($message->to, $message->subject, array('html' => $message->body, 'text' => $message->body_text), $message->headers);
|
288 |
+
if (!$r) {
|
289 |
+
if (isset($this->mailer->result)) {
|
290 |
+
$message->error = $this->mailer->result;
|
291 |
+
return new WP_Error(self::ERROR_GENERIC, $this->mailer->result);
|
292 |
+
} else {
|
293 |
+
$message->error = 'Unknown error';
|
294 |
+
return new WP_Error(self::ERROR_GENERIC, 'Unknown error');
|
295 |
+
}
|
296 |
+
}
|
297 |
+
return true;
|
298 |
+
}
|
299 |
+
|
300 |
+
}
|
301 |
+
|
302 |
+
/**
|
303 |
+
* Standard Mailer which uses the wp_mail() function of WP.
|
304 |
+
*/
|
305 |
+
class NewsletterDefaultMailer extends NewsletterMailer {
|
306 |
+
|
307 |
+
var $filter_active = false;
|
308 |
+
|
309 |
+
/**
|
310 |
+
* Static to be accessed in the hook: on some installation the object $this is not working, we're still trying to understand why
|
311 |
+
* @var TNP_Mailer_Message
|
312 |
+
*/
|
313 |
+
var $current_message = null;
|
314 |
+
|
315 |
+
function __construct() {
|
316 |
+
parent::__construct('default', Newsletter::instance()->get_options('smtp'));
|
317 |
+
}
|
318 |
+
|
319 |
+
function get_description() {
|
320 |
+
// TODO: check if overloaded
|
321 |
+
return 'wp_mail() WordPress function (could be extended by a SMTP plugin)';
|
322 |
+
}
|
323 |
+
|
324 |
+
function fix_mailer($mailer) {
|
325 |
+
// If there is not a current message, wp_mail() was not called by us
|
326 |
+
if (is_null($this->current_message)) {
|
327 |
+
return;
|
328 |
+
}
|
329 |
+
|
330 |
+
$newsletter = Newsletter::instance();
|
331 |
+
if (isset($this->current_message->encoding)) {
|
332 |
+
$mailer->Encoding = $this->current_message->encoding;
|
333 |
+
} else {
|
334 |
+
if (!empty($newsletter->options['content_transfer_encoding'])) {
|
335 |
+
$mailer->Encoding = $newsletter->options['content_transfer_encoding'];
|
336 |
+
} else {
|
337 |
+
$mailer->Encoding = 'base64';
|
338 |
+
}
|
339 |
+
}
|
340 |
+
|
341 |
+
/* @var $mailer PHPMailer */
|
342 |
+
$mailer->Sender = $newsletter->options['return_path'];
|
343 |
+
|
344 |
+
// If there is an HTML body AND a text body, add the text part.
|
345 |
+
if (!empty($this->current_message->body) && !empty($this->current_message->body_text)) {
|
346 |
+
$mailer->AltBody = $this->current_message->body_text;
|
347 |
+
}
|
348 |
+
}
|
349 |
+
|
350 |
+
function send($message) {
|
351 |
+
|
352 |
+
if (!$this->filter_active) {
|
353 |
+
add_action('phpmailer_init', array($this, 'fix_mailer'), 100);
|
354 |
+
$this->filter_active = true;
|
355 |
+
}
|
356 |
+
|
357 |
+
$newsletter = Newsletter::instance();
|
358 |
+
$wp_mail_headers = array();
|
359 |
+
// TODO: Manage the from address
|
360 |
+
$wp_mail_headers[] = 'From: "' . $newsletter->options['sender_name'] . '" <' . $newsletter->options['sender_email'] . '>';
|
361 |
+
|
362 |
+
if (!empty($newsletter->options['reply_to'])) {
|
363 |
+
$wp_mail_headers[] = 'Reply-To: ' . $newsletter->options['reply_to'];
|
364 |
+
}
|
365 |
+
|
366 |
+
// Manage from and from name
|
367 |
+
|
368 |
+
if (!empty($message->headers)) {
|
369 |
+
foreach ($message->headers as $key => $value) {
|
370 |
+
$wp_mail_headers[] = $key . ': ' . $value;
|
371 |
+
}
|
372 |
+
}
|
373 |
+
|
374 |
+
if (!empty($message->body)) {
|
375 |
+
$wp_mail_headers[] = 'Content-Type: text/html;charset=UTF-8';
|
376 |
+
$body = $message->body;
|
377 |
+
} else if (!empty($message->body_text)) {
|
378 |
+
$wp_mail_headers[] = 'Content-Type: text/plain;charset=UTF-8';
|
379 |
+
$body = $message->body_text;
|
380 |
+
} else {
|
381 |
+
$message->error = 'Empty body';
|
382 |
+
return new WP_Error(self::ERROR_GENERIC, 'Message format');
|
383 |
+
}
|
384 |
+
|
385 |
+
$this->current_message = $message;
|
386 |
+
$r = wp_mail($message->to, $message->subject, $body, $wp_mail_headers);
|
387 |
+
$this->current_message = null;
|
388 |
+
|
389 |
+
if (!$r) {
|
390 |
+
$last_error = error_get_last();
|
391 |
+
if (is_array($last_error)) {
|
392 |
+
$message->error = $last_error['message'];
|
393 |
+
if (stripos($message->error, 'Could not instantiate mail function') || stripos($message->error, 'Failed to connect to mailserver')) {
|
394 |
+
return new WP_Error(self::ERROR_FATAL, $last_error['message']);
|
395 |
+
} else {
|
396 |
+
return new WP_Error(self::ERROR_GENERIC, $last_error['message']);
|
397 |
+
}
|
398 |
+
} else {
|
399 |
+
$message->error = 'No error explanation reported';
|
400 |
+
return new WP_Error(self::ERROR_GENERIC, 'No error message reported');
|
401 |
+
}
|
402 |
+
}
|
403 |
+
return true;
|
404 |
+
}
|
405 |
+
|
406 |
+
}
|
407 |
+
|
408 |
+
/**
|
409 |
+
* Standard Mailer which uses the wp_mail() function of WP.
|
410 |
+
*/
|
411 |
+
class NewsletterDefaultSMTPMailer extends NewsletterMailer {
|
412 |
+
|
413 |
+
var $mailer = null;
|
414 |
+
|
415 |
+
function __construct($options) {
|
416 |
+
parent::__construct('internal-smtp', $options);
|
417 |
+
}
|
418 |
+
|
419 |
+
function get_description() {
|
420 |
+
return 'Internal SMTP';
|
421 |
+
}
|
422 |
+
|
423 |
+
/**
|
424 |
+
*
|
425 |
+
* @param TNP_Mailer_Message $message
|
426 |
+
* @return \WP_Error|boolean
|
427 |
+
*/
|
428 |
+
public function send($message) {
|
429 |
+
$logger = $this->get_logger();
|
430 |
+
$logger->debug('Start sending to ' . $message->to);
|
431 |
+
$mailer = $this->get_mailer();
|
432 |
+
|
433 |
+
if (!empty($message->body)) {
|
434 |
+
$mailer->IsHTML(true);
|
435 |
+
$mailer->Body = $message->body;
|
436 |
+
$mailer->AltBody = $message->body_text;
|
437 |
+
} else {
|
438 |
+
$mailer->IsHTML(false);
|
439 |
+
$mailer->Body = $message->body_text;
|
440 |
+
$mailer->AltBody = '';
|
441 |
+
}
|
442 |
+
|
443 |
+
$mailer->Subject = $message->subject;
|
444 |
+
|
445 |
+
$mailer->ClearCustomHeaders();
|
446 |
+
if (!empty($message->headers)) {
|
447 |
+
foreach ($message->headers as $key => $value) {
|
448 |
+
$mailer->AddCustomHeader($key . ': ' . $value);
|
449 |
+
}
|
450 |
+
}
|
451 |
+
|
452 |
+
if ($message->from) {
|
453 |
+
$logger->debug('Alternative from available');
|
454 |
+
$mailer->setFrom($message->from, $message->from_name);
|
455 |
+
} else {
|
456 |
+
$newsletter = Newsletter::instance();
|
457 |
+
$mailer->setFrom($newsletter->options['sender_email'], $newsletter->options['sender_name']);
|
458 |
+
}
|
459 |
+
|
460 |
+
$mailer->ClearAddresses();
|
461 |
+
$mailer->AddAddress($message->to);
|
462 |
+
$mailer->Send();
|
463 |
+
|
464 |
+
if ($mailer->IsError()) {
|
465 |
+
|
466 |
+
$logger->error($mailer->ErrorInfo);
|
467 |
+
// If the error is due to SMTP connection, the mailer cannot be reused since it does not clean up the connection
|
468 |
+
// on error.
|
469 |
+
//$this->mailer = null;
|
470 |
+
$message->error = $mailer->ErrorInfo;
|
471 |
+
return new WP_Error(self::ERROR_GENERIC, $mailer->ErrorInfo);
|
472 |
+
}
|
473 |
+
|
474 |
+
$logger->debug('Sent ' . $message->to);
|
475 |
+
//$logger->error('Time: ' . (microtime(true) - $start) . ' seconds');
|
476 |
+
return true;
|
477 |
+
}
|
478 |
+
|
479 |
+
/**
|
480 |
+
*
|
481 |
+
* @return PHPMailer
|
482 |
+
*/
|
483 |
+
function get_mailer() {
|
484 |
+
global $wp_version;
|
485 |
+
|
486 |
+
if ($this->mailer) {
|
487 |
+
return $this->mailer;
|
488 |
+
}
|
489 |
+
|
490 |
+
$logger = $this->get_logger();
|
491 |
+
$logger->debug('Setting up PHP mailer');
|
492 |
+
|
493 |
+
require_once 'PHPMailerLoader.php';
|
494 |
+
$this->mailer = PHPMailerLoader::make_instance();
|
495 |
+
|
496 |
+
$this->mailer->XMailer = ' '; // A space!
|
497 |
+
|
498 |
+
$this->mailer->IsSMTP();
|
499 |
+
$this->mailer->Host = $this->options['host'];
|
500 |
+
if (!empty($this->options['port'])) {
|
501 |
+
$this->mailer->Port = (int) $this->options['port'];
|
502 |
+
}
|
503 |
+
|
504 |
+
if (!empty($this->options['user'])) {
|
505 |
+
$this->mailer->SMTPAuth = true;
|
506 |
+
$this->mailer->Username = $this->options['user'];
|
507 |
+
$this->mailer->Password = $this->options['pass'];
|
508 |
+
}
|
509 |
+
|
510 |
+
$this->mailer->SMTPSecure = $this->options['secure'];
|
511 |
+
$this->mailer->SMTPAutoTLS = false;
|
512 |
+
|
513 |
+
if ($this->options['ssl_insecure'] == 1) {
|
514 |
+
$this->mailer->SMTPOptions = array(
|
515 |
+
'ssl' => array(
|
516 |
+
'verify_peer' => false,
|
517 |
+
'verify_peer_name' => false,
|
518 |
+
'allow_self_signed' => true
|
519 |
+
)
|
520 |
+
);
|
521 |
+
}
|
522 |
+
|
523 |
+
$newsletter = Newsletter::instance();
|
524 |
+
|
525 |
+
// if (!empty($newsletter->options['content_transfer_encoding'])) {
|
526 |
+
// $this->mailer->Encoding = $newsletter->options['content_transfer_encoding'];
|
527 |
+
// } else {
|
528 |
+
// $this->mailer->Encoding = 'base64';
|
529 |
+
// }
|
530 |
+
|
531 |
+
$this->mailer->CharSet = 'UTF-8';
|
532 |
+
$this->mailer->From = $newsletter->options['sender_email'];
|
533 |
+
|
534 |
+
if (!empty($newsletter->options['return_path'])) {
|
535 |
+
$this->mailer->Sender = $newsletter->options['return_path'];
|
536 |
+
}
|
537 |
+
if (!empty($newsletter->options['reply_to'])) {
|
538 |
+
$this->mailer->AddReplyTo($newsletter->options['reply_to']);
|
539 |
+
}
|
540 |
+
|
541 |
+
$this->mailer->FromName = $newsletter->options['sender_name'];
|
542 |
+
|
543 |
+
|
544 |
+
return $this->mailer;
|
545 |
+
}
|
546 |
+
|
547 |
+
}
|
includes/module.php
CHANGED
@@ -302,6 +302,18 @@ class TNP_User {
|
|
302 |
const STATUS_UNSUBSCRIBED = 'U';
|
303 |
const STATUS_BOUNCED = 'B';
|
304 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
305 |
}
|
306 |
|
307 |
/**
|
@@ -848,7 +860,7 @@ class NewsletterModule {
|
|
848 |
}
|
849 |
|
850 |
function admin_menu() {
|
851 |
-
|
852 |
}
|
853 |
|
854 |
function add_menu_page($page, $title, $capability = '') {
|
@@ -965,12 +977,14 @@ class NewsletterModule {
|
|
965 |
$email = $this->store->save(NEWSLETTER_EMAILS_TABLE, $email, $return_format);
|
966 |
if ($return_format == OBJECT) {
|
967 |
$email->options = maybe_unserialize($email->options);
|
968 |
-
if (!is_array($email->options))
|
969 |
-
$email->options =
|
|
|
970 |
} else if ($return_format == ARRAY_A) {
|
971 |
$email['options'] = maybe_unserialize($email['options']);
|
972 |
-
if (!is_array($email['options']))
|
973 |
-
$email['options'] =
|
|
|
974 |
}
|
975 |
return $email;
|
976 |
}
|
302 |
const STATUS_UNSUBSCRIBED = 'U';
|
303 |
const STATUS_BOUNCED = 'B';
|
304 |
|
305 |
+
public static function get_status_label($status) {
|
306 |
+
switch ($status) {
|
307 |
+
case self::STATUS_NOT_CONFIRMED: return __('NOT CONFIRMED', 'newsletter');
|
308 |
+
break;
|
309 |
+
case self::STATUS_CONFIRMED: return __('CONFIRMED', 'newsletter');
|
310 |
+
break;
|
311 |
+
case self::STATUS_UNSUBSCRIBED: return __('UNSUBSCRIBED', 'newsletter');
|
312 |
+
break;
|
313 |
+
case self::STATUS_BOUNCED: return __('BOUNCED', 'newsletter');
|
314 |
+
break;
|
315 |
+
}
|
316 |
+
}
|
317 |
}
|
318 |
|
319 |
/**
|
860 |
}
|
861 |
|
862 |
function admin_menu() {
|
863 |
+
|
864 |
}
|
865 |
|
866 |
function add_menu_page($page, $title, $capability = '') {
|
977 |
$email = $this->store->save(NEWSLETTER_EMAILS_TABLE, $email, $return_format);
|
978 |
if ($return_format == OBJECT) {
|
979 |
$email->options = maybe_unserialize($email->options);
|
980 |
+
if (!is_array($email->options)) {
|
981 |
+
$email->options = [];
|
982 |
+
}
|
983 |
} else if ($return_format == ARRAY_A) {
|
984 |
$email['options'] = maybe_unserialize($email['options']);
|
985 |
+
if (!is_array($email['options'])) {
|
986 |
+
$email['options'] = [];
|
987 |
+
}
|
988 |
}
|
989 |
return $email;
|
990 |
}
|
main/extensions.php
CHANGED
@@ -6,24 +6,6 @@ include_once NEWSLETTER_INCLUDES_DIR . '/controls.php';
|
|
6 |
$controls = new NewsletterControls();
|
7 |
$extensions = $this->getTnpExtensions();
|
8 |
|
9 |
-
$controls->data = get_option('newsletter_main');
|
10 |
-
|
11 |
-
if (isset($_POST['email']) && check_admin_referer('subscribe')) {
|
12 |
-
$body = array();
|
13 |
-
$body['ne'] = $_POST['email'];
|
14 |
-
$body['nr'] = 'extensions';
|
15 |
-
$body['nl'] = array('3', '4', '1');
|
16 |
-
$body['optin'] = 'single';
|
17 |
-
|
18 |
-
wp_remote_post('http://www.thenewsletterplugin.com/?na=ajaxsub', array('body' => $body));
|
19 |
-
|
20 |
-
update_option('newsletter_subscribed', time(), false);
|
21 |
-
|
22 |
-
$id = (int) $_POST['id'];
|
23 |
-
wp_redirect(wp_nonce_url(admin_url('admin.php'), 'save') . '&page=newsletter_main_extensions&act=install&id=' . $id);
|
24 |
-
die();
|
25 |
-
}
|
26 |
-
|
27 |
if ($controls->is_action('activate')) {
|
28 |
$result = activate_plugin('newsletter-extensions/extensions.php');
|
29 |
if (is_wp_error($result)) {
|
@@ -42,7 +24,6 @@ if ($controls->is_action('activate')) {
|
|
42 |
|
43 |
<?php include NEWSLETTER_DIR . '/tnp-header.php'; ?>
|
44 |
|
45 |
-
|
46 |
<div id="tnp-body">
|
47 |
<?php if (is_wp_error(validate_plugin('newsletter-extensions/extensions.php'))) { ?>
|
48 |
<div id="tnp-promo">
|
@@ -142,30 +123,3 @@ if ($controls->is_action('activate')) {
|
|
142 |
<?php include NEWSLETTER_DIR . '/tnp-footer.php'; ?>
|
143 |
|
144 |
</div>
|
145 |
-
|
146 |
-
<script>
|
147 |
-
function newsletter_subscribe(id) {
|
148 |
-
document.getElementById("tnp-extension-id").value = id;
|
149 |
-
jQuery("#tnp-subscribe-overlay").fadeIn(500);
|
150 |
-
}
|
151 |
-
</script>
|
152 |
-
|
153 |
-
<div id="tnp-subscribe-overlay">
|
154 |
-
<div id="tnp-subscribe-modal">
|
155 |
-
<div>
|
156 |
-
<img src="https://cdn.thenewsletterplugin.com/newsletters-img/tnp-logo-colore-text-white@2x.png">
|
157 |
-
</div>
|
158 |
-
<div id="tnp-subscribe-title">
|
159 |
-
Subscribe our newsletter to get this extension<br>
|
160 |
-
and be informed about updates and best practices.</div>
|
161 |
-
<form method="post" action="?page=newsletter_main_extensions&noheader=true">
|
162 |
-
<?php wp_nonce_field('subscribe'); ?>
|
163 |
-
<input type="hidden" value="id" name="id" id="tnp-extension-id">
|
164 |
-
<div id="tnp-subscribe-email-wrapper"><input type="email" id="tnp-subscribe-email" name="email" value="<?php echo esc_attr(get_option('admin_email')) ?>"></div>
|
165 |
-
<div id="tnp-subscribe-submit-wrapper"><input type="submit" id="tnp-subscribe-submit" value="<?php esc_attr_e('Subscribe', 'newsletter') ?>"></div>
|
166 |
-
</form>
|
167 |
-
<div class="tnp-subscribe-no-thanks">
|
168 |
-
<a href="javascript:void(jQuery('#tnp-subscribe-overlay').hide())">No thanks, I don't want to install the free extension</a>
|
169 |
-
</div>
|
170 |
-
</div>
|
171 |
-
</div>
|
6 |
$controls = new NewsletterControls();
|
7 |
$extensions = $this->getTnpExtensions();
|
8 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
9 |
if ($controls->is_action('activate')) {
|
10 |
$result = activate_plugin('newsletter-extensions/extensions.php');
|
11 |
if (is_wp_error($result)) {
|
24 |
|
25 |
<?php include NEWSLETTER_DIR . '/tnp-header.php'; ?>
|
26 |
|
|
|
27 |
<div id="tnp-body">
|
28 |
<?php if (is_wp_error(validate_plugin('newsletter-extensions/extensions.php'))) { ?>
|
29 |
<div id="tnp-promo">
|
123 |
<?php include NEWSLETTER_DIR . '/tnp-footer.php'; ?>
|
124 |
|
125 |
</div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
main/index.php
CHANGED
@@ -69,6 +69,10 @@ $labels = array_reverse($labels);
|
|
69 |
$lists = $this->get_lists();
|
70 |
?>
|
71 |
|
|
|
|
|
|
|
|
|
72 |
<div class="wrap" id="tnp-wrap">
|
73 |
|
74 |
<?php include NEWSLETTER_DIR . '/tnp-header.php'; ?>
|
@@ -231,55 +235,55 @@ $lists = $this->get_lists();
|
|
231 |
<div class="tnp-card">
|
232 |
<div class="tnp-card-title"><?php _e('Documentation', 'newsletter') ?></div>
|
233 |
<div class="break"></div>
|
234 |
-
<a href="https://www.thenewsletterplugin.com/documentation/installation/">
|
235 |
<div class="tnp-card-documentation-index">
|
236 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
237 |
Installation
|
238 |
</div>
|
239 |
</a>
|
240 |
-
<a href="https://www.thenewsletterplugin.com/documentation/subscription/">
|
241 |
<div class="tnp-card-documentation-index">
|
242 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
243 |
Subscription
|
244 |
</div>
|
245 |
</a>
|
246 |
-
<a href="https://www.thenewsletterplugin.com/category/tips">
|
247 |
<div class="tnp-card-documentation-index">
|
248 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
249 |
Tips & Tricks
|
250 |
</div>
|
251 |
</a>
|
252 |
-
<a href="https://www.thenewsletterplugin.com/documentation/subscribers-and-management/">
|
253 |
<div class="tnp-card-documentation-index">
|
254 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
255 |
Subscribers and management
|
256 |
</div>
|
257 |
</a>
|
258 |
-
<a href="https://www.thenewsletterplugin.com/documentation/newsletters/newsletters-module/">
|
259 |
<div class="tnp-card-documentation-index">
|
260 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
261 |
Creating Newsletters
|
262 |
</div>
|
263 |
</a>
|
264 |
-
<a href="https://www.thenewsletterplugin.com/documentation/addons/">
|
265 |
<div class="tnp-card-documentation-index">
|
266 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
267 |
Premium Addons
|
268 |
</div>
|
269 |
</a>
|
270 |
-
<a href="https://www.thenewsletterplugin.com/documentation/customization/">
|
271 |
<div class="tnp-card-documentation-index">
|
272 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
273 |
Customization
|
274 |
</div>
|
275 |
</a>
|
276 |
-
<a href="https://www.thenewsletterplugin.com/documentation/delivery-and-spam/">
|
277 |
<div class="tnp-card-documentation-index">
|
278 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
279 |
Delivery and spam
|
280 |
</div>
|
281 |
</a>
|
282 |
-
<a href="https://www.thenewsletterplugin.com/documentation/developers/">
|
283 |
<div class="tnp-card-documentation-index">
|
284 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
285 |
Developers & Advanced Topics
|
@@ -292,7 +296,7 @@ $lists = $this->get_lists();
|
|
292 |
<div class="tnp-card-title"><?php _e('Developers', 'newsletter') ?></div>
|
293 |
<div class="tnp-card-description">Extending Newsletter by yourself? There is something for you as well!</div>
|
294 |
<div class="tnp-card-button-container">
|
295 |
-
<a href="https://www.thenewsletterplugin.com/documentation/developers/">Developer's love 💛</a>
|
296 |
</div>
|
297 |
</div>
|
298 |
<div class="tnp-card">
|
@@ -302,7 +306,7 @@ $lists = $this->get_lists();
|
|
302 |
<iframe width="560" height="315" src="https://www.youtube.com/embed/zmVmW84Bw9A" frameborder="0" allow="accelerometer; autoplay; clipboard-write; encrypted-media; gyroscope; picture-in-picture" allowfullscreen></iframe>
|
303 |
</div>
|
304 |
<div class="tnp-card-button-container">
|
305 |
-
<a href="
|
306 |
</div>
|
307 |
</div>
|
308 |
</div>
|
69 |
$lists = $this->get_lists();
|
70 |
?>
|
71 |
|
72 |
+
<style>
|
73 |
+
<?php include NEWSLETTER_DIR . '/css/dashboard.css' ?>
|
74 |
+
</style>
|
75 |
+
|
76 |
<div class="wrap" id="tnp-wrap">
|
77 |
|
78 |
<?php include NEWSLETTER_DIR . '/tnp-header.php'; ?>
|
235 |
<div class="tnp-card">
|
236 |
<div class="tnp-card-title"><?php _e('Documentation', 'newsletter') ?></div>
|
237 |
<div class="break"></div>
|
238 |
+
<a href="https://www.thenewsletterplugin.com/documentation/installation/" target="_blank">
|
239 |
<div class="tnp-card-documentation-index">
|
240 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
241 |
Installation
|
242 |
</div>
|
243 |
</a>
|
244 |
+
<a href="https://www.thenewsletterplugin.com/documentation/subscription/" target="_blank">
|
245 |
<div class="tnp-card-documentation-index">
|
246 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
247 |
Subscription
|
248 |
</div>
|
249 |
</a>
|
250 |
+
<a href="https://www.thenewsletterplugin.com/category/tips" target="_blank">
|
251 |
<div class="tnp-card-documentation-index">
|
252 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
253 |
Tips & Tricks
|
254 |
</div>
|
255 |
</a>
|
256 |
+
<a href="https://www.thenewsletterplugin.com/documentation/subscribers-and-management/" target="_blank">
|
257 |
<div class="tnp-card-documentation-index">
|
258 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
259 |
Subscribers and management
|
260 |
</div>
|
261 |
</a>
|
262 |
+
<a href="https://www.thenewsletterplugin.com/documentation/newsletters/newsletters-module/" target="_blank">
|
263 |
<div class="tnp-card-documentation-index">
|
264 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
265 |
Creating Newsletters
|
266 |
</div>
|
267 |
</a>
|
268 |
+
<a href="https://www.thenewsletterplugin.com/documentation/addons/" target="_blank">
|
269 |
<div class="tnp-card-documentation-index">
|
270 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
271 |
Premium Addons
|
272 |
</div>
|
273 |
</a>
|
274 |
+
<a href="https://www.thenewsletterplugin.com/documentation/customization/" target="_blank">
|
275 |
<div class="tnp-card-documentation-index">
|
276 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
277 |
Customization
|
278 |
</div>
|
279 |
</a>
|
280 |
+
<a href="https://www.thenewsletterplugin.com/documentation/delivery-and-spam/" target="_blank">
|
281 |
<div class="tnp-card-documentation-index">
|
282 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
283 |
Delivery and spam
|
284 |
</div>
|
285 |
</a>
|
286 |
+
<a href="https://www.thenewsletterplugin.com/documentation/developers/" target="_blank">
|
287 |
<div class="tnp-card-documentation-index">
|
288 |
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48" width="20" height="20"><title>saved items</title><g class="nc-icon-wrapper" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" ><path d="M37,4h3a4,4,0,0,1,4,4V40a4,4,0,0,1-4,4H8a4,4,0,0,1-4-4V8A4,4,0,0,1,8,4h3" fill="none" stroke-miterlimit="10"/> <polygon points="32 24 24 18 16 24 16 4 32 4 32 24" fill="none" stroke-miterlimit="10" data-color="color-2"/></g></svg>
|
289 |
Developers & Advanced Topics
|
296 |
<div class="tnp-card-title"><?php _e('Developers', 'newsletter') ?></div>
|
297 |
<div class="tnp-card-description">Extending Newsletter by yourself? There is something for you as well!</div>
|
298 |
<div class="tnp-card-button-container">
|
299 |
+
<a href="https://www.thenewsletterplugin.com/documentation/developers/" target="_blank">Developer's love 💛</a>
|
300 |
</div>
|
301 |
</div>
|
302 |
<div class="tnp-card">
|
306 |
<iframe width="560" height="315" src="https://www.youtube.com/embed/zmVmW84Bw9A" frameborder="0" allow="accelerometer; autoplay; clipboard-write; encrypted-media; gyroscope; picture-in-picture" allowfullscreen></iframe>
|
307 |
</div>
|
308 |
<div class="tnp-card-button-container">
|
309 |
+
<a href="https://www.thenewsletterplugin.com/video-tutorials" target="_blank">See the videos</a>
|
310 |
</div>
|
311 |
</div>
|
312 |
</div>
|
main/info.php
CHANGED
@@ -170,9 +170,9 @@ if (!$controls->is_action()) {
|
|
170 |
</div>
|
171 |
</div>
|
172 |
|
173 |
-
<
|
174 |
<?php $controls->button_save(); ?>
|
175 |
-
</
|
176 |
|
177 |
</form>
|
178 |
</div>
|
170 |
</div>
|
171 |
</div>
|
172 |
|
173 |
+
<div class="tnp-buttons">
|
174 |
<?php $controls->button_save(); ?>
|
175 |
+
</div>
|
176 |
|
177 |
</form>
|
178 |
</div>
|
main/logs.php
ADDED
@@ -0,0 +1,57 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
/* @var $this Newsletter */
|
3 |
+
/* @var $wpdb wpdb */
|
4 |
+
|
5 |
+
defined('ABSPATH') || exit;
|
6 |
+
|
7 |
+
include_once NEWSLETTER_INCLUDES_DIR . '/controls.php';
|
8 |
+
$controls = new NewsletterControls();
|
9 |
+
|
10 |
+
if ($controls->is_action('delete_logs')) {
|
11 |
+
$files = glob(WP_CONTENT_DIR . '/logs/newsletter/*.txt');
|
12 |
+
foreach ($files as $file) {
|
13 |
+
if (is_file($file))
|
14 |
+
unlink($file);
|
15 |
+
}
|
16 |
+
$secret = NewsletterModule::get_token(8);
|
17 |
+
update_option('newsletter_logger_secret', $secret);
|
18 |
+
$controls->messages = 'Logs deleted';
|
19 |
+
}
|
20 |
+
|
21 |
+
?>
|
22 |
+
|
23 |
+
|
24 |
+
<div class="wrap tnp-main-status" id="tnp-wrap">
|
25 |
+
|
26 |
+
<?php include NEWSLETTER_DIR . '/tnp-header.php'; ?>
|
27 |
+
|
28 |
+
<div id="tnp-heading">
|
29 |
+
|
30 |
+
<h2><?php _e('Logs', 'newsletter') ?></h2>
|
31 |
+
|
32 |
+
</div>
|
33 |
+
|
34 |
+
<div id="tnp-body">
|
35 |
+
|
36 |
+
<form method="post" action="">
|
37 |
+
<?php $controls->init(); ?>
|
38 |
+
|
39 |
+
<ul class="tnp-log-files">
|
40 |
+
<?php
|
41 |
+
$files = glob(WP_CONTENT_DIR . '/logs/newsletter/*.txt'); // get all file names
|
42 |
+
foreach ($files as $file) { // iterate files
|
43 |
+
echo '<li><a href="' . WP_CONTENT_URL . '/logs/newsletter/' . basename($file) . '" target="_blank">' . basename($file) . '</a>';
|
44 |
+
echo ' <span class="tnp-log-size">(' . size_format(filesize($file)) . ')</span>';
|
45 |
+
echo '</li>';
|
46 |
+
}
|
47 |
+
?>
|
48 |
+
</ul>
|
49 |
+
|
50 |
+
<?php $controls->button('delete_logs', 'Delete all'); ?>
|
51 |
+
|
52 |
+
</form>
|
53 |
+
</div>
|
54 |
+
|
55 |
+
<?php include NEWSLETTER_DIR . '/tnp-footer.php'; ?>
|
56 |
+
|
57 |
+
</div>
|
main/main.php
CHANGED
@@ -364,9 +364,9 @@ if (!empty($return_path)) {
|
|
364 |
|
365 |
</div> <!-- tabs -->
|
366 |
|
367 |
-
<
|
368 |
<?php $controls->button_save(); ?>
|
369 |
-
</
|
370 |
|
371 |
</form>
|
372 |
|
364 |
|
365 |
</div> <!-- tabs -->
|
366 |
|
367 |
+
<div class="tnp-buttons">
|
368 |
<?php $controls->button_save(); ?>
|
369 |
+
</div>
|
370 |
|
371 |
</form>
|
372 |
|
main/status.php
CHANGED
@@ -1324,25 +1324,9 @@ function tnp_status_print_flag($condition) {
|
|
1324 |
</tbody>
|
1325 |
</table>
|
1326 |
|
1327 |
-
<h3>Log files</h3>
|
1328 |
-
|
1329 |
-
<ul class="tnp-log-files">
|
1330 |
-
<?php
|
1331 |
-
$files = glob(WP_CONTENT_DIR . '/logs/newsletter/*.txt'); // get all file names
|
1332 |
-
foreach ($files as $file) { // iterate files
|
1333 |
-
echo '<li><a href="' . WP_CONTENT_URL . '/logs/newsletter/' . basename($file) . '" target="_blank">' . basename($file) . '</a>';
|
1334 |
-
echo ' <span class="tnp-log-size">(' . size_format(filesize($file)) . ')</span>';
|
1335 |
-
echo '</li>';
|
1336 |
-
}
|
1337 |
-
?>
|
1338 |
-
</ul>
|
1339 |
-
|
1340 |
-
<?php $controls->button('delete_logs', 'Delete all'); ?>
|
1341 |
-
|
1342 |
|
1343 |
<?php if (isset($_GET['debug'])) { ?>
|
1344 |
|
1345 |
-
|
1346 |
<h3>Database Tables</h3>
|
1347 |
<h4><?php echo $wpdb->prefix ?>newsletter</h4>
|
1348 |
<?php
|
1324 |
</tbody>
|
1325 |
</table>
|
1326 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1327 |
|
1328 |
<?php if (isset($_GET['debug'])) { ?>
|
1329 |
|
|
|
1330 |
<h3>Database Tables</h3>
|
1331 |
<h4><?php echo $wpdb->prefix ?>newsletter</h4>
|
1332 |
<?php
|
main/welcome.php
CHANGED
@@ -99,7 +99,9 @@ if (empty($page_exists)) {
|
|
99 |
$logger->info('Dedicated page already exists');
|
100 |
}
|
101 |
?>
|
102 |
-
|
|
|
|
|
103 |
<script src="<?php echo plugins_url('newsletter') ?>/main/js/snap.svg-min.js"></script>
|
104 |
<script src="<?php echo plugins_url('newsletter') ?>/main/js/main.js"></script>
|
105 |
<script>
|
99 |
$logger->info('Dedicated page already exists');
|
100 |
}
|
101 |
?>
|
102 |
+
<style>
|
103 |
+
<?php include NEWSLETTER_DIR . '/css/welcome.css' ?>
|
104 |
+
</style>
|
105 |
<script src="<?php echo plugins_url('newsletter') ?>/main/js/snap.svg-min.js"></script>
|
106 |
<script src="<?php echo plugins_url('newsletter') ?>/main/js/main.js"></script>
|
107 |
<script>
|
plugin.php
CHANGED
@@ -4,7 +4,7 @@
|
|
4 |
Plugin Name: Newsletter
|
5 |
Plugin URI: https://www.thenewsletterplugin.com/plugins/newsletter
|
6 |
Description: Newsletter is a cool plugin to create your own subscriber list, to send newsletters, to build your business. <strong>Before update give a look to <a href="https://www.thenewsletterplugin.com/category/release">this page</a> to know what's changed.</strong>
|
7 |
-
Version: 7.0.
|
8 |
Author: Stefano Lissa & The Newsletter Team
|
9 |
Author URI: https://www.thenewsletterplugin.com
|
10 |
Disclaimer: Use at your own risk. No warranty expressed or implied is provided.
|
@@ -35,10 +35,13 @@ if (version_compare(phpversion(), '5.6', '<')) {
|
|
35 |
return;
|
36 |
}
|
37 |
|
38 |
-
define('NEWSLETTER_VERSION', '7.0.
|
39 |
|
40 |
global $newsletter, $wpdb;
|
41 |
|
|
|
|
|
|
|
42 |
if (!defined('NEWSLETTER_BETA'))
|
43 |
define('NEWSLETTER_BETA', false);
|
44 |
|
@@ -468,6 +471,7 @@ class Newsletter extends NewsletterModule {
|
|
468 |
$this->add_menu_page('main', __('Settings and More', 'newsletter'));
|
469 |
$this->add_admin_page('smtp', 'SMTP');
|
470 |
$this->add_admin_page('status', __('Status', 'newsletter'));
|
|
|
471 |
$this->add_admin_page('diagnostic', __('Diagnostic', 'newsletter'));
|
472 |
$this->add_admin_page('test', __('Test', 'newsletter'));
|
473 |
}
|
@@ -504,7 +508,7 @@ class Newsletter extends NewsletterModule {
|
|
504 |
|
505 |
function hook_wp_enqueue_scripts() {
|
506 |
if (empty($this->options['css_disabled']) && apply_filters('newsletter_enqueue_style', true)) {
|
507 |
-
wp_enqueue_style('newsletter', plugins_url('newsletter') . '/style.css',
|
508 |
if (!empty($this->options['css'])) {
|
509 |
wp_add_inline_style('newsletter', $this->options['css']);
|
510 |
}
|
@@ -519,22 +523,24 @@ class Newsletter extends NewsletterModule {
|
|
519 |
wp_enqueue_script('jquery-ui-draggable');
|
520 |
wp_enqueue_media();
|
521 |
|
|
|
|
|
|
|
522 |
wp_enqueue_style('tnp-admin-font', 'https://use.typekit.net/jlj2wjy.css');
|
523 |
wp_enqueue_style('tnp-admin-fontawesome', $newsletter_url . '/vendor/fa/css/all.min.css', [], NEWSLETTER_VERSION);
|
524 |
wp_enqueue_style('tnp-admin-jquery-ui', $newsletter_url . '/vendor/jquery-ui/jquery-ui.min.css', [], NEWSLETTER_VERSION);
|
|
|
525 |
wp_enqueue_style('tnp-admin-dropdown', $newsletter_url . '/css/dropdown.css', [], NEWSLETTER_VERSION);
|
526 |
-
wp_enqueue_style('tnp-admin-
|
|
|
527 |
wp_enqueue_style('tnp-admin-fields', $newsletter_url . '/css/fields.css', [], NEWSLETTER_VERSION);
|
528 |
wp_enqueue_style('tnp-admin-widgets', $newsletter_url . '/css/widgets.css', [], NEWSLETTER_VERSION);
|
529 |
-
wp_enqueue_style('tnp-admin', $newsletter_url . '/
|
530 |
-
|
531 |
-
|
532 |
-
|
533 |
-
|
534 |
-
|
535 |
-
'tnp-admin-fields',
|
536 |
-
'tnp-admin-widgets'
|
537 |
-
], NEWSLETTER_VERSION);
|
538 |
|
539 |
wp_enqueue_script('tnp-admin', $newsletter_url . '/admin.js', ['jquery'], NEWSLETTER_VERSION);
|
540 |
|
@@ -542,9 +548,7 @@ class Newsletter extends NewsletterModule {
|
|
542 |
'save_to_update_counter' => __('Save the newsletter to update the counter!', 'newsletter')
|
543 |
);
|
544 |
wp_localize_script('tnp-admin', 'tnp_translations', $translations_array);
|
545 |
-
|
546 |
-
wp_enqueue_style('tnp-select2', $newsletter_url . '/vendor/select2/select2.css', [], NEWSLETTER_VERSION);
|
547 |
-
wp_enqueue_script('tnp-select2', $newsletter_url . '/vendor/select2/select2.min.js', [], NEWSLETTER_VERSION);
|
548 |
wp_enqueue_script('tnp-jquery-vmap', $newsletter_url . '/vendor/jqvmap/jquery.vmap.min.js', ['jquery'], NEWSLETTER_VERSION);
|
549 |
wp_enqueue_script('tnp-jquery-vmap-world', $newsletter_url . '/vendor/jqvmap/jquery.vmap.world.js', ['tnp-jquery-vmap'], NEWSLETTER_VERSION);
|
550 |
wp_enqueue_style('tnp-jquery-vmap', $newsletter_url . '/vendor/jqvmap/jqvmap.min.css', [], NEWSLETTER_VERSION);
|
4 |
Plugin Name: Newsletter
|
5 |
Plugin URI: https://www.thenewsletterplugin.com/plugins/newsletter
|
6 |
Description: Newsletter is a cool plugin to create your own subscriber list, to send newsletters, to build your business. <strong>Before update give a look to <a href="https://www.thenewsletterplugin.com/category/release">this page</a> to know what's changed.</strong>
|
7 |
+
Version: 7.0.8
|
8 |
Author: Stefano Lissa & The Newsletter Team
|
9 |
Author URI: https://www.thenewsletterplugin.com
|
10 |
Disclaimer: Use at your own risk. No warranty expressed or implied is provided.
|
35 |
return;
|
36 |
}
|
37 |
|
38 |
+
define('NEWSLETTER_VERSION', '7.0.8');
|
39 |
|
40 |
global $newsletter, $wpdb;
|
41 |
|
42 |
+
if (!defined('NEWSLETTER_DARK'))
|
43 |
+
define('NEWSLETTER_DARK', false);
|
44 |
+
|
45 |
if (!defined('NEWSLETTER_BETA'))
|
46 |
define('NEWSLETTER_BETA', false);
|
47 |
|
471 |
$this->add_menu_page('main', __('Settings and More', 'newsletter'));
|
472 |
$this->add_admin_page('smtp', 'SMTP');
|
473 |
$this->add_admin_page('status', __('Status', 'newsletter'));
|
474 |
+
$this->add_admin_page('logs', __('Logs', 'newsletter'));
|
475 |
$this->add_admin_page('diagnostic', __('Diagnostic', 'newsletter'));
|
476 |
$this->add_admin_page('test', __('Test', 'newsletter'));
|
477 |
}
|
508 |
|
509 |
function hook_wp_enqueue_scripts() {
|
510 |
if (empty($this->options['css_disabled']) && apply_filters('newsletter_enqueue_style', true)) {
|
511 |
+
wp_enqueue_style('newsletter', plugins_url('newsletter') . '/style.css', [], NEWSLETTER_VERSION);
|
512 |
if (!empty($this->options['css'])) {
|
513 |
wp_add_inline_style('newsletter', $this->options['css']);
|
514 |
}
|
523 |
wp_enqueue_script('jquery-ui-draggable');
|
524 |
wp_enqueue_media();
|
525 |
|
526 |
+
wp_enqueue_style('tnp-select2', $newsletter_url . '/vendor/select2/css/select2.min.css', [], NEWSLETTER_VERSION);
|
527 |
+
wp_enqueue_script('tnp-select2', $newsletter_url . '/vendor/select2/js/select2.min.js', [], NEWSLETTER_VERSION);
|
528 |
+
|
529 |
wp_enqueue_style('tnp-admin-font', 'https://use.typekit.net/jlj2wjy.css');
|
530 |
wp_enqueue_style('tnp-admin-fontawesome', $newsletter_url . '/vendor/fa/css/all.min.css', [], NEWSLETTER_VERSION);
|
531 |
wp_enqueue_style('tnp-admin-jquery-ui', $newsletter_url . '/vendor/jquery-ui/jquery-ui.min.css', [], NEWSLETTER_VERSION);
|
532 |
+
wp_enqueue_style('tnp-admin', $newsletter_url . '/admin.css', [], NEWSLETTER_VERSION);
|
533 |
wp_enqueue_style('tnp-admin-dropdown', $newsletter_url . '/css/dropdown.css', [], NEWSLETTER_VERSION);
|
534 |
+
wp_enqueue_style('tnp-admin-tabs', $newsletter_url . '/css/tabs.css', [], NEWSLETTER_VERSION);
|
535 |
+
wp_enqueue_style('tnp-admin-controls', $newsletter_url . '/css/controls.css', [], NEWSLETTER_VERSION);
|
536 |
wp_enqueue_style('tnp-admin-fields', $newsletter_url . '/css/fields.css', [], NEWSLETTER_VERSION);
|
537 |
wp_enqueue_style('tnp-admin-widgets', $newsletter_url . '/css/widgets.css', [], NEWSLETTER_VERSION);
|
538 |
+
wp_enqueue_style('tnp-admin-extensions', $newsletter_url . '/css/extensions.css', [], NEWSLETTER_VERSION);
|
539 |
+
|
540 |
+
if (NEWSLETTER_DARK) {
|
541 |
+
wp_enqueue_style('tnp-admin-dark', $newsletter_url . '/admin-dark.css', ['tnp-admin'], NEWSLETTER_VERSION);
|
542 |
+
wp_enqueue_style('tnp-admin-controls-dark', $newsletter_url . '/css/controls-dark.css', ['tnp-admin-controls'], NEWSLETTER_VERSION);
|
543 |
+
}
|
|
|
|
|
|
|
544 |
|
545 |
wp_enqueue_script('tnp-admin', $newsletter_url . '/admin.js', ['jquery'], NEWSLETTER_VERSION);
|
546 |
|
548 |
'save_to_update_counter' => __('Save the newsletter to update the counter!', 'newsletter')
|
549 |
);
|
550 |
wp_localize_script('tnp-admin', 'tnp_translations', $translations_array);
|
551 |
+
|
|
|
|
|
552 |
wp_enqueue_script('tnp-jquery-vmap', $newsletter_url . '/vendor/jqvmap/jquery.vmap.min.js', ['jquery'], NEWSLETTER_VERSION);
|
553 |
wp_enqueue_script('tnp-jquery-vmap-world', $newsletter_url . '/vendor/jqvmap/jquery.vmap.world.js', ['tnp-jquery-vmap'], NEWSLETTER_VERSION);
|
554 |
wp_enqueue_style('tnp-jquery-vmap', $newsletter_url . '/vendor/jqvmap/jqvmap.min.css', [], NEWSLETTER_VERSION);
|
readme.txt
CHANGED
@@ -2,7 +2,7 @@
|
|
2 |
Tags: email, email marketing, newsletter, newsletter subscribers, welcome email, signup forms, contact, lead generation, popup, marketing automation
|
3 |
Requires at least: 3.4.0
|
4 |
Tested up to: 5.7
|
5 |
-
Stable tag: 7.0.
|
6 |
Requires PHP: 5.6
|
7 |
Contributors: satollo,webagile,michael-travan
|
8 |
License: GPLv2 or later
|
@@ -118,6 +118,15 @@ Thank you, The Newsletter Team
|
|
118 |
|
119 |
== Changelog ==
|
120 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
121 |
= 7.0.7 =
|
122 |
|
123 |
* [COMPOSER] Fixed a warning in some inline editable blocks
|
2 |
Tags: email, email marketing, newsletter, newsletter subscribers, welcome email, signup forms, contact, lead generation, popup, marketing automation
|
3 |
Requires at least: 3.4.0
|
4 |
Tested up to: 5.7
|
5 |
+
Stable tag: 7.0.8
|
6 |
Requires PHP: 5.6
|
7 |
Contributors: satollo,webagile,michael-travan
|
8 |
License: GPLv2 or later
|
118 |
|
119 |
== Changelog ==
|
120 |
|
121 |
+
= 7.0.8 =
|
122 |
+
|
123 |
+
* [SUBSCRIBERS] Changed action buttons
|
124 |
+
* [GENERAL] Reoganization of CSS and removal of unused files
|
125 |
+
* [DASHBOARD] New window open for links and fix of invalid URLs
|
126 |
+
* [NEWSLETTERS] New action buttons
|
127 |
+
* [GENERAL] Minor fixes and optimizations
|
128 |
+
* [COMPOSER] Fixed rare size error on gif images
|
129 |
+
|
130 |
= 7.0.7 =
|
131 |
|
132 |
* [COMPOSER] Fixed a warning in some inline editable blocks
|
style.min.css
DELETED
@@ -1 +0,0 @@
|
|
1 |
-
.tnp-subscription{display:block;margin:15px auto;max-width:500px;width:100%}.tnp-subscription div.tnp-field{margin-bottom:10px;border:0;padding:0}.tnp-subscription label{display:block;color:inherit;font-weight:700;line-height:normal;padding:5px;margin:0}.tnp-subscription input[type=text],.tnp-subscription input[type=email],.tnp-subscription input[type=submit],.tnp-subscription select{width:100%;height:50px;padding:10px;display:block;border:1px;border-color:#ddd;background-color:#f4f4f4;background-image:none;text-shadow:none;color:#444;font-size:14px;line-height:20px;margin:0;line-height:normal;box-sizing:border-box}.tnp-subscription input[type=checkbox],.tnp-widget input[type=radio]{max-width:20px;display:inline-block}.tnp-subscription select option{margin-right:10px}.tnp-subscription input.tnp-submit{background-color:#444;color:#fff;width:auto;height:auto;margin:0}@media all and (max-width:480px){.tnp-subscription input[type=submit]{width:100%}}.tnp-profile form .tnp-field{margin-bottom:10px;border:0;padding:0}.tnp-profile form .tnp-field label{display:block;color:#333}.tnp-profile form .tnp-field input[type=text],.tnp-profile form .tnp-field input[type=email],.tnp-profile form .tnp-field input[type=submit],.tnp-profile form .tnp-field textarea,.tnp-profile form .tnp-field select{padding:10px;display:block;border:1px;border-color:#ddd;background-color:#f4f4f4;background-image:none;text-shadow:none;color:#444;font-size:14px;margin:0;line-height:normal;box-sizing:border-box;border-radius:0;height:auto;float:none}.tnp-profile form input[type=checkbox],.tnp-profile input[type=radio]{max-width:20px;display:inline-block}.tnp-profile form .tnp-list-label{margin-left:15px}.tnp-profile form select option{margin-right:10px}.tnp-profile form .tnp-field input[type=submit]{background-color:#444;color:#fff;width:auto;height:auto;margin:0}@media all and (max-width:480px){.tnp-profile input[type=submit]{width:100%;margin:0}}.tnp-widget{width:100%;display:block;box-sizing:border-box}.tnp-widget .tnp-field{margin-bottom:10px;border:0;padding:0}.tnp-widget label{display:block;color:inherit;font-size:14px}.tnp-widget input[type=text],.tnp-widget input[type=email],.tnp-widget input[type=submit],.tnp-widget select{width:100%;padding:10px;display:block;border:1px solid #ddd;border-color:#ddd;background-color:#f4f4f4;background-image:none;text-shadow:none;color:#444;font-size:14px;line-height:normal;box-sizing:border-box;height:auto}.tnp-widget input[type=checkbox],.tnp-widget input[type=radio]{width:auto;display:inline-block}.tnp-widget select option{margin-right:10px}.tnp-widget input.tnp-submit{background-color:#444;background-image:none;text-shadow:none;color:#fff;margin:0}.tnp-field input[type="submit"]{position:inherit}.tnp-widget-minimal{width:100%}.tnp-widget-minimal form{margin:0;padding:0;border:0}.tnp-widget-minimal input.tnp-email{width:100%;box-sizing:border-box;padding:10px;display:inline-block;border:1px solid #ddd;background-color:#f4f4f4;color:#444;font-size:14px}.tnp-widget-minimal input.tnp-submit{width:100%;box-sizing:border-box;padding:10px;display:inline-block;border:1px;border-color:#ddd;background-color:#444;background-image:none;text-shadow:none;color:#fff;font-size:14px;line-height:normal;border-radius:0;height:auto;margin:0}.tnp-subscription-minimal{width:100%;box-sizing:border-box}.tnp-subscription-minimal form{margin:0;padding:0;border:0}.tnp-subscription-minimal input.tnp-email{width:70%;max-width:300px;box-sizing:border-box;padding:10px;display:inline-block;border:1px solid #ddd;background-color:#f4f4f4;color:#444;font-size:14px;line-height:20px;border-radius:0}.tnp-subscription-minimal .tnp-privacy-field{margin-top:10px}.tnp-subscription-minimal input.tnp-submit{width:29%;box-sizing:border-box;display:inline-block;padding:10px;border:1px;border-color:#ddd;background-color:#444;background-image:none;text-shadow:none;color:#fff;font-size:14px;line-height:20px;border-radius:0;margin:0}.tnp-comments{clear:both;margin-top:15px;margin-bottom:15px}.tnp-comments label{display:block}.tnp-comments input[type=checkbox]{display:inline-block;width:auto!important}.tnp-lock{clear:both;display:block;box-sizing:border-box;box-shadow:none;margin:20px;padding:15px;background-color:#fff;border:1px solid #ddd}.tnp-nl-checkout{margin-bottom:1em}
|
|
subscription/profile.php
CHANGED
@@ -67,7 +67,7 @@ $extra_type = array('text' => __('Text', 'newsletter'), 'select' => __('List', '
|
|
67 |
<tr>
|
68 |
<th>Email</th>
|
69 |
<td>
|
70 |
-
<table class="
|
71 |
<tr><th><?php _e('Field label', 'newsletter') ?></th><td><?php $controls->text('email', 50); ?></td></tr>
|
72 |
<tr><th><?php _e('Error message', 'newsletter') ?></th><td><?php $controls->text('email_error', 50); ?></td></tr>
|
73 |
</table>
|
@@ -76,11 +76,11 @@ $extra_type = array('text' => __('Text', 'newsletter'), 'select' => __('List', '
|
|
76 |
<tr>
|
77 |
<th><?php _e('First name', 'newsletter') ?></th>
|
78 |
<td>
|
79 |
-
<table class="
|
80 |
<tr><th><?php _e('Field label', 'newsletter') ?></th><td><?php $controls->text('name', 50); ?></td></tr>
|
81 |
<?php if ($is_all_languages) { ?>
|
82 |
-
|
83 |
-
|
84 |
<?php } ?>
|
85 |
</table>
|
86 |
<p class="description">
|
@@ -91,11 +91,11 @@ $extra_type = array('text' => __('Text', 'newsletter'), 'select' => __('List', '
|
|
91 |
<tr>
|
92 |
<th><?php _e('Last name', 'newsletter') ?></th>
|
93 |
<td>
|
94 |
-
<table class="
|
95 |
<tr><th><?php _e('Field label', 'newsletter') ?></th><td><?php $controls->text('surname', 50); ?></td></tr>
|
96 |
<?php if ($is_all_languages) { ?>
|
97 |
-
|
98 |
-
|
99 |
<?php } ?>
|
100 |
</table>
|
101 |
</td>
|
@@ -103,18 +103,18 @@ $extra_type = array('text' => __('Text', 'newsletter'), 'select' => __('List', '
|
|
103 |
<tr>
|
104 |
<th><?php _e('Gender', 'newsletter') ?></th>
|
105 |
<td>
|
106 |
-
<table class="
|
107 |
<tr><th><?php _e('Field label', 'newsletter') ?></th><td><?php $controls->text('sex', 50); ?></td></tr>
|
108 |
<?php if ($is_all_languages) { ?>
|
109 |
-
|
110 |
-
|
111 |
<?php } ?>
|
112 |
<tr>
|
113 |
<th><?php _e('Value labels', 'newsletter') ?></th>
|
114 |
<td>
|
115 |
-
<?php
|
116 |
-
<?php
|
117 |
-
<?php
|
118 |
</td>
|
119 |
</tr>
|
120 |
<tr>
|
@@ -146,9 +146,9 @@ $extra_type = array('text' => __('Text', 'newsletter'), 'select' => __('List', '
|
|
146 |
<tr>
|
147 |
<th><?php _e('Privacy checkbox/notice', 'newsletter') ?></th>
|
148 |
<td>
|
149 |
-
<table
|
150 |
<?php if ($is_all_languages) { ?>
|
151 |
-
|
152 |
<?php } ?>
|
153 |
<tr><th><?php _e('Label', 'newsletter') ?></th><td><?php $controls->text('privacy', 50); ?></td></tr>
|
154 |
<tr>
|
@@ -172,9 +172,9 @@ $extra_type = array('text' => __('Text', 'newsletter'), 'select' => __('List', '
|
|
172 |
</td>
|
173 |
</tr>
|
174 |
</table>
|
175 |
-
<
|
176 |
<?php _e('The privacy acceptance checkbox (required in many Europen countries) forces the subscriber to check it before proceeding. If an URL is specified the label becomes a link.', 'newsletter') ?>
|
177 |
-
</
|
178 |
</td>
|
179 |
</tr>
|
180 |
|
@@ -194,17 +194,17 @@ $extra_type = array('text' => __('Text', 'newsletter'), 'select' => __('List', '
|
|
194 |
|
195 |
<table class="widefat">
|
196 |
<thead>
|
197 |
-
|
198 |
-
|
199 |
-
|
200 |
-
|
201 |
-
|
202 |
<th><?php _e('When/Where', 'newsletter') ?></th>
|
203 |
<th><?php _e('Type', 'newsletter') ?></th>
|
204 |
<th><?php _e('Rule', 'newsletter') ?></th>
|
205 |
-
|
206 |
-
|
207 |
-
|
208 |
</thead>
|
209 |
<?php for ($i = 1; $i <= NEWSLETTER_PROFILE_MAX; $i++) { ?>
|
210 |
<tr>
|
@@ -212,13 +212,13 @@ $extra_type = array('text' => __('Text', 'newsletter'), 'select' => __('List', '
|
|
212 |
<td><?php $controls->text('profile_' . $i); ?></td>
|
213 |
<td><?php $controls->text('profile_' . $i . '_placeholder'); ?></td>
|
214 |
<?php if ($is_all_languages) { ?>
|
215 |
-
|
216 |
-
|
217 |
-
|
218 |
<?php } else { ?>
|
219 |
-
|
220 |
-
|
221 |
-
|
222 |
<?php } ?>
|
223 |
<td>
|
224 |
<?php $controls->textarea_fixed('profile_' . $i . '_options', '200px', '50px'); ?>
|
67 |
<tr>
|
68 |
<th>Email</th>
|
69 |
<td>
|
70 |
+
<table class="tnpc-grid">
|
71 |
<tr><th><?php _e('Field label', 'newsletter') ?></th><td><?php $controls->text('email', 50); ?></td></tr>
|
72 |
<tr><th><?php _e('Error message', 'newsletter') ?></th><td><?php $controls->text('email_error', 50); ?></td></tr>
|
73 |
</table>
|
76 |
<tr>
|
77 |
<th><?php _e('First name', 'newsletter') ?></th>
|
78 |
<td>
|
79 |
+
<table class="tnpc-grid">
|
80 |
<tr><th><?php _e('Field label', 'newsletter') ?></th><td><?php $controls->text('name', 50); ?></td></tr>
|
81 |
<?php if ($is_all_languages) { ?>
|
82 |
+
<tr><th><?php _e('When to show', 'newsletter') ?></th><td><?php $controls->select('name_status', $status); ?></td></tr>
|
83 |
+
<tr><th><?php _e('Rules', 'newsletter') ?></th><td><?php $controls->select('name_rules', $rules); ?></td></tr>
|
84 |
<?php } ?>
|
85 |
</table>
|
86 |
<p class="description">
|
91 |
<tr>
|
92 |
<th><?php _e('Last name', 'newsletter') ?></th>
|
93 |
<td>
|
94 |
+
<table class="tnpc-grid">
|
95 |
<tr><th><?php _e('Field label', 'newsletter') ?></th><td><?php $controls->text('surname', 50); ?></td></tr>
|
96 |
<?php if ($is_all_languages) { ?>
|
97 |
+
<tr><th><?php _e('When to show', 'newsletter') ?></th><td><?php $controls->select('surname_status', $status); ?></td></tr>
|
98 |
+
<tr><th><?php _e('Rules', 'newsletter') ?></th><td><?php $controls->select('surname_rules', $rules); ?></td></tr>
|
99 |
<?php } ?>
|
100 |
</table>
|
101 |
</td>
|
103 |
<tr>
|
104 |
<th><?php _e('Gender', 'newsletter') ?></th>
|
105 |
<td>
|
106 |
+
<table class="tnpc-grid">
|
107 |
<tr><th><?php _e('Field label', 'newsletter') ?></th><td><?php $controls->text('sex', 50); ?></td></tr>
|
108 |
<?php if ($is_all_languages) { ?>
|
109 |
+
<tr><th><?php _e('When to show', 'newsletter') ?></th><td><?php $controls->select('sex_status', $status); ?></td></tr>
|
110 |
+
<tr><th><?php _e('Rules', 'newsletter') ?></th><td><?php $controls->select('sex_rules', $rules); ?></td></tr>
|
111 |
<?php } ?>
|
112 |
<tr>
|
113 |
<th><?php _e('Value labels', 'newsletter') ?></th>
|
114 |
<td>
|
115 |
+
<?php $controls->text('sex_none', 20, __('not specified', 'newsletter')); ?>
|
116 |
+
<?php $controls->text('sex_female', 20, __('female', 'newsletter')); ?>
|
117 |
+
<?php $controls->text('sex_male', 20, __('male', 'newsletter')); ?>
|
118 |
</td>
|
119 |
</tr>
|
120 |
<tr>
|
146 |
<tr>
|
147 |
<th><?php _e('Privacy checkbox/notice', 'newsletter') ?></th>
|
148 |
<td>
|
149 |
+
<table>
|
150 |
<?php if ($is_all_languages) { ?>
|
151 |
+
<tr><th><?php _e('Enabled?', 'newsletter') ?></th><td><?php $controls->select('privacy_status', array(0 => __('No', 'newsletter'), 1 => __('Yes', 'newsletter'), 2 => __('Only the notice', 'newsletter'))); ?></td></tr>
|
152 |
<?php } ?>
|
153 |
<tr><th><?php _e('Label', 'newsletter') ?></th><td><?php $controls->text('privacy', 50); ?></td></tr>
|
154 |
<tr>
|
172 |
</td>
|
173 |
</tr>
|
174 |
</table>
|
175 |
+
<div class="tnpc-hint">
|
176 |
<?php _e('The privacy acceptance checkbox (required in many Europen countries) forces the subscriber to check it before proceeding. If an URL is specified the label becomes a link.', 'newsletter') ?>
|
177 |
+
</div>
|
178 |
</td>
|
179 |
</tr>
|
180 |
|
194 |
|
195 |
<table class="widefat">
|
196 |
<thead>
|
197 |
+
<tr>
|
198 |
+
<th><?php _e('Field', 'newsletter') ?></th>
|
199 |
+
<th><?php _e('Name/Label', 'newsletter') ?></th>
|
200 |
+
<th><?php _e('Placeholder', 'newsletter') ?></th>
|
201 |
+
|
202 |
<th><?php _e('When/Where', 'newsletter') ?></th>
|
203 |
<th><?php _e('Type', 'newsletter') ?></th>
|
204 |
<th><?php _e('Rule', 'newsletter') ?></th>
|
205 |
+
|
206 |
+
<th><?php _e('List values comma separated', 'newsletter') ?></th>
|
207 |
+
</tr>
|
208 |
</thead>
|
209 |
<?php for ($i = 1; $i <= NEWSLETTER_PROFILE_MAX; $i++) { ?>
|
210 |
<tr>
|
212 |
<td><?php $controls->text('profile_' . $i); ?></td>
|
213 |
<td><?php $controls->text('profile_' . $i . '_placeholder'); ?></td>
|
214 |
<?php if ($is_all_languages) { ?>
|
215 |
+
<td><?php $controls->select('profile_' . $i . '_status', $status); ?></td>
|
216 |
+
<td><?php $controls->select('profile_' . $i . '_type', $extra_type); ?></td>
|
217 |
+
<td><?php $controls->select('profile_' . $i . '_rules', $rules); ?></td>
|
218 |
<?php } else { ?>
|
219 |
+
<td><?php echo esc_html($status[$controls->get_value('profile_' . $i . '_status')]) ?></td>
|
220 |
+
<td><?php echo esc_html($extra_type[$controls->get_value('profile_' . $i . '_type')]) ?></td>
|
221 |
+
<td><?php echo esc_html($rules[$controls->get_value('profile_' . $i . '_rules')]) ?></td>
|
222 |
<?php } ?>
|
223 |
<td>
|
224 |
<?php $controls->textarea_fixed('profile_' . $i . '_options', '200px', '50px'); ?>
|
subscription/subscription.php
CHANGED
@@ -285,7 +285,7 @@ class NewsletterSubscription extends NewsletterModule {
|
|
285 |
}
|
286 |
|
287 |
function first_install() {
|
288 |
-
|
289 |
}
|
290 |
|
291 |
function admin_menu() {
|
@@ -464,9 +464,9 @@ class NewsletterSubscription extends NewsletterModule {
|
|
464 |
function get_default_subscription($language = null) {
|
465 |
$subscription = new TNP_Subscription();
|
466 |
|
467 |
-
|
468 |
|
469 |
-
$subscription->data->language = $language
|
470 |
$subscription->optin = $this->is_double_optin() ? 'double' : 'single';
|
471 |
$subscription->if_exists = empty($this->options['multiple']) ? TNP_Subscription::EXISTING_ERROR : TNP_Subscription::EXISTING_MERGE;
|
472 |
|
@@ -787,7 +787,6 @@ class NewsletterSubscription extends NewsletterModule {
|
|
787 |
continue;
|
788 |
}
|
789 |
$data->lists['' . $list_id] = 1;
|
790 |
-
|
791 |
}
|
792 |
} else {
|
793 |
$this->logger->debug('No lists received');
|
@@ -937,8 +936,7 @@ class NewsletterSubscription extends NewsletterModule {
|
|
937 |
$message['html'] = str_replace('{message}', $message['html'], $template);
|
938 |
$message['html'] = $this->replace($message['html'], $user);
|
939 |
$message['text'] = $this->replace($message['text'], $user);
|
940 |
-
}
|
941 |
-
else {
|
942 |
$message = str_replace('{message}', $message, $template);
|
943 |
$message = $this->replace($message, $user);
|
944 |
}
|
@@ -983,7 +981,7 @@ class NewsletterSubscription extends NewsletterModule {
|
|
983 |
} else {
|
984 |
$new_email = get_transient('newsletter_user_' . $user->id . '_email');
|
985 |
if ($new_email) {
|
986 |
-
$data = ['id'
|
987 |
$this->save_user($data);
|
988 |
delete_transient('newsletter_user_' . $user->id . '_email');
|
989 |
}
|
@@ -1032,7 +1030,7 @@ class NewsletterSubscription extends NewsletterModule {
|
|
1032 |
|
1033 |
$options = $this->get_options('', $language);
|
1034 |
$message = [];
|
1035 |
-
|
1036 |
$message['text'] = $this->get_text_message($type);
|
1037 |
if ($user->status == Newsletter::STATUS_NOT_CONFIRMED) {
|
1038 |
$message['html'] = $this->add_microdata($message['html']);
|
@@ -1127,7 +1125,7 @@ class NewsletterSubscription extends NewsletterModule {
|
|
1127 |
}
|
1128 |
|
1129 |
function get_form_javascript() {
|
1130 |
-
|
1131 |
}
|
1132 |
|
1133 |
/**
|
@@ -1191,7 +1189,8 @@ class NewsletterSubscription extends NewsletterModule {
|
|
1191 |
|
1192 |
foreach ($arr as $a) {
|
1193 |
$a = trim($a);
|
1194 |
-
if (empty($a))
|
|
|
1195 |
|
1196 |
$list = $this->get_list($a);
|
1197 |
if (!$list) {
|
@@ -1410,8 +1409,8 @@ class NewsletterSubscription extends NewsletterModule {
|
|
1410 |
if (isset($attrs['layout']) && $attrs['layout'] === 'dropdown') {
|
1411 |
|
1412 |
$buffer .= '<div class="tnp-field tnp-lists">';
|
1413 |
-
|
1414 |
-
|
1415 |
$buffer .= '<select class="tnp-lists" name="nl[]" required>';
|
1416 |
|
1417 |
if (!empty($attrs['first_option_label'])) {
|
@@ -1633,9 +1632,9 @@ class NewsletterSubscription extends NewsletterModule {
|
|
1633 |
if (empty($attrs['lists_field_empty_label'])) {
|
1634 |
$attrs['lists_field_empty_label'] = '';
|
1635 |
}
|
1636 |
-
|
1637 |
-
|
1638 |
-
|
1639 |
$buffer .= $this->shortcode_newsletter_field(['name' => 'lists', 'layout' => 'dropdown', 'first_option_label' => $attrs['lists_field_empty_label'], 'label' => $attrs['lists_field_label']]);
|
1640 |
} else {
|
1641 |
$buffer .= $this->shortcode_newsletter_field(['name' => 'lists']);
|
285 |
}
|
286 |
|
287 |
function first_install() {
|
288 |
+
|
289 |
}
|
290 |
|
291 |
function admin_menu() {
|
464 |
function get_default_subscription($language = null) {
|
465 |
$subscription = new TNP_Subscription();
|
466 |
|
467 |
+
$language = is_null($language) ? $this->get_current_language() : $language;
|
468 |
|
469 |
+
$subscription->data->language = $language;
|
470 |
$subscription->optin = $this->is_double_optin() ? 'double' : 'single';
|
471 |
$subscription->if_exists = empty($this->options['multiple']) ? TNP_Subscription::EXISTING_ERROR : TNP_Subscription::EXISTING_MERGE;
|
472 |
|
787 |
continue;
|
788 |
}
|
789 |
$data->lists['' . $list_id] = 1;
|
|
|
790 |
}
|
791 |
} else {
|
792 |
$this->logger->debug('No lists received');
|
936 |
$message['html'] = str_replace('{message}', $message['html'], $template);
|
937 |
$message['html'] = $this->replace($message['html'], $user);
|
938 |
$message['text'] = $this->replace($message['text'], $user);
|
939 |
+
} else {
|
|
|
940 |
$message = str_replace('{message}', $message, $template);
|
941 |
$message = $this->replace($message, $user);
|
942 |
}
|
981 |
} else {
|
982 |
$new_email = get_transient('newsletter_user_' . $user->id . '_email');
|
983 |
if ($new_email) {
|
984 |
+
$data = ['id' => $user->id, 'email' => $new_email];
|
985 |
$this->save_user($data);
|
986 |
delete_transient('newsletter_user_' . $user->id . '_email');
|
987 |
}
|
1030 |
|
1031 |
$options = $this->get_options('', $language);
|
1032 |
$message = [];
|
1033 |
+
$message['html'] = do_shortcode($options[$type . '_message']);
|
1034 |
$message['text'] = $this->get_text_message($type);
|
1035 |
if ($user->status == Newsletter::STATUS_NOT_CONFIRMED) {
|
1036 |
$message['html'] = $this->add_microdata($message['html']);
|
1125 |
}
|
1126 |
|
1127 |
function get_form_javascript() {
|
1128 |
+
|
1129 |
}
|
1130 |
|
1131 |
/**
|
1189 |
|
1190 |
foreach ($arr as $a) {
|
1191 |
$a = trim($a);
|
1192 |
+
if (empty($a))
|
1193 |
+
continue;
|
1194 |
|
1195 |
$list = $this->get_list($a);
|
1196 |
if (!$list) {
|
1409 |
if (isset($attrs['layout']) && $attrs['layout'] === 'dropdown') {
|
1410 |
|
1411 |
$buffer .= '<div class="tnp-field tnp-lists">';
|
1412 |
+
// There is not a default "label" for the block of lists, so it can only be specified in the shortcode attrs as "label"
|
1413 |
+
$buffer .= $this->_shortcode_label('lists', $attrs);
|
1414 |
$buffer .= '<select class="tnp-lists" name="nl[]" required>';
|
1415 |
|
1416 |
if (!empty($attrs['first_option_label'])) {
|
1632 |
if (empty($attrs['lists_field_empty_label'])) {
|
1633 |
$attrs['lists_field_empty_label'] = '';
|
1634 |
}
|
1635 |
+
if (empty($attrs['lists_field_label'])) {
|
1636 |
+
$attrs['lists_field_label'] = '';
|
1637 |
+
}
|
1638 |
$buffer .= $this->shortcode_newsletter_field(['name' => 'lists', 'layout' => 'dropdown', 'first_option_label' => $attrs['lists_field_empty_label'], 'label' => $attrs['lists_field_label']]);
|
1639 |
} else {
|
1640 |
$buffer .= $this->shortcode_newsletter_field(['name' => 'lists']);
|
tnp-header.php
CHANGED
@@ -159,6 +159,12 @@ $warning |= empty($status_options['mail']);
|
|
159 |
<i class="fas fa-exclamation-triangle" style="color: red;"></i>
|
160 |
<?php } ?>
|
161 |
</a>
|
|
|
|
|
|
|
|
|
|
|
|
|
162 |
</li>
|
163 |
<?php } ?>
|
164 |
|
@@ -259,9 +265,9 @@ $warning |= empty($status_options['mail']);
|
|
259 |
<?php if (!defined('NEWSLETTER_CRON_WARNINGS') || NEWSLETTER_CRON_WARNINGS) {
|
260 |
$x = wp_next_scheduled('newsletter');
|
261 |
if ($x === false) {
|
262 |
-
echo '<div class="
|
263 |
} else if (time() - $x > 900) {
|
264 |
-
echo '<div class="
|
265 |
} else {
|
266 |
// if (empty($this->options['disable_cron_notice'])) {
|
267 |
// $cron_data = get_option('newsletter_diagnostic_cron_data');
|
159 |
<i class="fas fa-exclamation-triangle" style="color: red;"></i>
|
160 |
<?php } ?>
|
161 |
</a>
|
162 |
+
<ul>
|
163 |
+
<li>
|
164 |
+
<a href="?page=newsletter_main_logs"><i class="fas fa-file"></i> <?php _e('Logs', 'newsletter') ?>
|
165 |
+
<small><?php _e('Plugin and addons logs', 'newsletter') ?></small></a>
|
166 |
+
</li>
|
167 |
+
</ul>
|
168 |
</li>
|
169 |
<?php } ?>
|
170 |
|
265 |
<?php if (!defined('NEWSLETTER_CRON_WARNINGS') || NEWSLETTER_CRON_WARNINGS) {
|
266 |
$x = wp_next_scheduled('newsletter');
|
267 |
if ($x === false) {
|
268 |
+
echo '<div class="tnpc-warning">The Newsletter delivery engine is off (it should never be off). Deactivate and reactivate the Newsletter plugin.</div>';
|
269 |
} else if (time() - $x > 900) {
|
270 |
+
echo '<div class="tnpc-warning">The WP scheduler doesn\'t seem to be running correctly for Newsletter. <a href="https://www.thenewsletterplugin.com/documentation/?p=6128" target="_blank"><strong>Read this page to solve the problem</strong></a>.</div>';
|
271 |
} else {
|
272 |
// if (empty($this->options['disable_cron_notice'])) {
|
273 |
// $cron_data = get_option('newsletter_diagnostic_cron_data');
|
users/edit.php
CHANGED
@@ -96,7 +96,7 @@ function percentValue($value, $total) {
|
|
96 |
|
97 |
<form method="post" action="">
|
98 |
<p>
|
99 |
-
<?php $controls->
|
100 |
<?php $controls->button_save(); ?>
|
101 |
</p>
|
102 |
<?php $controls->init(); ?>
|
96 |
|
97 |
<form method="post" action="">
|
98 |
<p>
|
99 |
+
<?php $controls->button_icon_back('?page=newsletter_users_index'); ?>
|
100 |
<?php $controls->button_save(); ?>
|
101 |
</p>
|
102 |
<?php $controls->init(); ?>
|
users/import.php
CHANGED
@@ -17,13 +17,13 @@ $controls = new NewsletterControls();
|
|
17 |
|
18 |
<div id="tnp-body" class="tnp-users tnp-users-import">
|
19 |
<p>
|
20 |
-
The import features have been consolidated in the <strong>free</strong> "
|
21 |
-
<a href="?page
|
22 |
</p>
|
23 |
<ul style="color: #fff; margin-left: 1em;">
|
24 |
<li>File upload or copy and paste of data</li>
|
25 |
<li>Background processing for long set of data</li>
|
26 |
-
<li>Quick
|
27 |
</ul>
|
28 |
|
29 |
<p>
|
17 |
|
18 |
<div id="tnp-body" class="tnp-users tnp-users-import">
|
19 |
<p>
|
20 |
+
The import features have been consolidated in the <strong>free</strong> "Advanced Import" addon you can find on
|
21 |
+
<a href="?page=<?php echo class_exists('NewsletterExtensions') ? 'newsletter_extensions_index' : 'newsletter_main_extensions' ?>">addons management panel</a>. Please install that addon to have:
|
22 |
</p>
|
23 |
<ul style="color: #fff; margin-left: 1em;">
|
24 |
<li>File upload or copy and paste of data</li>
|
25 |
<li>Background processing for long set of data</li>
|
26 |
+
<li>Quick bounced address import</li>
|
27 |
</ul>
|
28 |
|
29 |
<p>
|
users/index.php
CHANGED
@@ -36,7 +36,7 @@ if ($controls->is_action('resend_welcome')) {
|
|
36 |
$controls->messages = __('Welcome email sent.', 'newsletter');
|
37 |
}
|
38 |
|
39 |
-
if ($controls->is_action('
|
40 |
$this->delete_user($controls->button_data);
|
41 |
unset($controls->data['subscriber_id']);
|
42 |
}
|
@@ -169,7 +169,7 @@ $controls->data['search_page'] ++;
|
|
169 |
<table class="widefat">
|
170 |
<thead>
|
171 |
<tr>
|
172 |
-
<
|
173 |
<th>Id</th>
|
174 |
<th>Email</th>
|
175 |
<th><?php _e('Name', 'newsletter') ?></th>
|
@@ -178,14 +178,14 @@ $controls->data['search_page'] ++;
|
|
178 |
<th><?php _e('Lists', 'newsletter') ?></th>
|
179 |
<?php } ?>
|
180 |
<th> </th>
|
181 |
-
|
182 |
<th> </th>
|
183 |
</tr>
|
184 |
</thead>
|
185 |
<?php $i = 0; ?>
|
186 |
<?php foreach ($list as $s) { ?>
|
187 |
-
<tr
|
188 |
-
<
|
189 |
<td>
|
190 |
<?php echo $s->id; ?>
|
191 |
</td>
|
@@ -220,16 +220,16 @@ $controls->data['search_page'] ++;
|
|
220 |
<?php } ?>
|
221 |
|
222 |
<td>
|
223 |
-
|
224 |
</td>
|
225 |
-
|
226 |
-
|
227 |
-
|
228 |
-
|
229 |
<?php if ($s->status == "C") { ?>
|
230 |
-
<?php $controls->
|
231 |
<?php } else { ?>
|
232 |
-
<?php $controls->
|
233 |
<?php } ?>
|
234 |
</td>
|
235 |
|
36 |
$controls->messages = __('Welcome email sent.', 'newsletter');
|
37 |
}
|
38 |
|
39 |
+
if ($controls->is_action('delete')) {
|
40 |
$this->delete_user($controls->button_data);
|
41 |
unset($controls->data['subscriber_id']);
|
42 |
}
|
169 |
<table class="widefat">
|
170 |
<thead>
|
171 |
<tr>
|
172 |
+
<td class="check-column"><input type="checkbox" onchange="jQuery('input.tnp-selector').prop('checked', this.checked)"></th>
|
173 |
<th>Id</th>
|
174 |
<th>Email</th>
|
175 |
<th><?php _e('Name', 'newsletter') ?></th>
|
178 |
<th><?php _e('Lists', 'newsletter') ?></th>
|
179 |
<?php } ?>
|
180 |
<th> </th>
|
181 |
+
|
182 |
<th> </th>
|
183 |
</tr>
|
184 |
</thead>
|
185 |
<?php $i = 0; ?>
|
186 |
<?php foreach ($list as $s) { ?>
|
187 |
+
<tr>
|
188 |
+
<th scope="row" class="check-column" style="vertical-align: middle"><input class="tnp-selector" type="checkbox" name="ids[]" value="<?php echo $s->id; ?>"/></td>
|
189 |
<td>
|
190 |
<?php echo $s->id; ?>
|
191 |
</td>
|
220 |
<?php } ?>
|
221 |
|
222 |
<td>
|
223 |
+
<?php $controls->button_icon_edit($this->get_admin_page_url('edit') . '&id=' . $s->id)?>
|
224 |
</td>
|
225 |
+
|
226 |
+
<td style="white-space: nowrap">
|
227 |
+
<?php $controls->button_icon_delete($s->id); ?>
|
228 |
+
|
229 |
<?php if ($s->status == "C") { ?>
|
230 |
+
<?php $controls->button_icon('resend_welcome', 'fa-redo', __('Resend welcome', 'newsletter'), $s->id, true); ?>
|
231 |
<?php } else { ?>
|
232 |
+
<?php $controls->button_icon('resend', 'fa-redo', __('Resend activation', 'newsletter'), $s->id, true); ?>
|
233 |
<?php } ?>
|
234 |
</td>
|
235 |
|
vendor/select2/LICENSE
DELETED
@@ -1,18 +0,0 @@
|
|
1 |
-
Copyright 2014 Igor Vaynberg
|
2 |
-
|
3 |
-
Version: @@ver@@ Timestamp: @@timestamp@@
|
4 |
-
|
5 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
6 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
7 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
8 |
-
License or the GPL License.
|
9 |
-
|
10 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
11 |
-
|
12 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
13 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
14 |
-
|
15 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
16 |
-
or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
17 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
18 |
-
permissions and limitations under the Apache License and the GPL License.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/select2/LICENSE.md
ADDED
@@ -0,0 +1,21 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
The MIT License (MIT)
|
2 |
+
|
3 |
+
Copyright (c) 2012-2017 Kevin Brown, Igor Vaynberg, and Select2 contributors
|
4 |
+
|
5 |
+
Permission is hereby granted, free of charge, to any person obtaining a copy
|
6 |
+
of this software and associated documentation files (the "Software"), to deal
|
7 |
+
in the Software without restriction, including without limitation the rights
|
8 |
+
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
9 |
+
copies of the Software, and to permit persons to whom the Software is
|
10 |
+
furnished to do so, subject to the following conditions:
|
11 |
+
|
12 |
+
The above copyright notice and this permission notice shall be included in
|
13 |
+
all copies or substantial portions of the Software.
|
14 |
+
|
15 |
+
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
16 |
+
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
17 |
+
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
18 |
+
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
19 |
+
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
20 |
+
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
|
21 |
+
THE SOFTWARE.
|
vendor/select2/css/select2.min.css
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
.select2-container{box-sizing:border-box;display:inline-block;margin:0;position:relative;vertical-align:middle}.select2-container .select2-selection--single{box-sizing:border-box;cursor:pointer;display:block;height:28px;user-select:none;-webkit-user-select:none}.select2-container .select2-selection--single .select2-selection__rendered{display:block;padding-left:8px;padding-right:20px;overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.select2-container .select2-selection--single .select2-selection__clear{position:relative}.select2-container[dir="rtl"] .select2-selection--single .select2-selection__rendered{padding-right:8px;padding-left:20px}.select2-container .select2-selection--multiple{box-sizing:border-box;cursor:pointer;display:block;min-height:32px;user-select:none;-webkit-user-select:none}.select2-container .select2-selection--multiple .select2-selection__rendered{display:inline-block;overflow:hidden;padding-left:8px;text-overflow:ellipsis;white-space:nowrap}.select2-container .select2-search--inline{float:left}.select2-container .select2-search--inline .select2-search__field{box-sizing:border-box;border:none;font-size:100%;margin-top:5px;padding:0}.select2-container .select2-search--inline .select2-search__field::-webkit-search-cancel-button{-webkit-appearance:none}.select2-dropdown{background-color:white;border:1px solid #aaa;border-radius:4px;box-sizing:border-box;display:block;position:absolute;left:-100000px;width:100%;z-index:1051}.select2-results{display:block}.select2-results__options{list-style:none;margin:0;padding:0}.select2-results__option{padding:6px;user-select:none;-webkit-user-select:none}.select2-results__option[aria-selected]{cursor:pointer}.select2-container--open .select2-dropdown{left:0}.select2-container--open .select2-dropdown--above{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--open .select2-dropdown--below{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.select2-search--dropdown{display:block;padding:4px}.select2-search--dropdown .select2-search__field{padding:4px;width:100%;box-sizing:border-box}.select2-search--dropdown .select2-search__field::-webkit-search-cancel-button{-webkit-appearance:none}.select2-search--dropdown.select2-search--hide{display:none}.select2-close-mask{border:0;margin:0;padding:0;display:block;position:fixed;left:0;top:0;min-height:100%;min-width:100%;height:auto;width:auto;opacity:0;z-index:99;background-color:#fff;filter:alpha(opacity=0)}.select2-hidden-accessible{border:0 !important;clip:rect(0 0 0 0) !important;-webkit-clip-path:inset(50%) !important;clip-path:inset(50%) !important;height:1px !important;overflow:hidden !important;padding:0 !important;position:absolute !important;width:1px !important;white-space:nowrap !important}.select2-container--default .select2-selection--single{background-color:#fff;border:1px solid #aaa;border-radius:4px}.select2-container--default .select2-selection--single .select2-selection__rendered{color:#444;line-height:28px}.select2-container--default .select2-selection--single .select2-selection__clear{cursor:pointer;float:right;font-weight:bold}.select2-container--default .select2-selection--single .select2-selection__placeholder{color:#999}.select2-container--default .select2-selection--single .select2-selection__arrow{height:26px;position:absolute;top:1px;right:1px;width:20px}.select2-container--default .select2-selection--single .select2-selection__arrow b{border-color:#888 transparent transparent transparent;border-style:solid;border-width:5px 4px 0 4px;height:0;left:50%;margin-left:-4px;margin-top:-2px;position:absolute;top:50%;width:0}.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__clear{float:left}.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__arrow{left:1px;right:auto}.select2-container--default.select2-container--disabled .select2-selection--single{background-color:#eee;cursor:default}.select2-container--default.select2-container--disabled .select2-selection--single .select2-selection__clear{display:none}.select2-container--default.select2-container--open .select2-selection--single .select2-selection__arrow b{border-color:transparent transparent #888 transparent;border-width:0 4px 5px 4px}.select2-container--default .select2-selection--multiple{background-color:white;border:1px solid #aaa;border-radius:4px;cursor:text}.select2-container--default .select2-selection--multiple .select2-selection__rendered{box-sizing:border-box;list-style:none;margin:0;padding:0 5px;width:100%}.select2-container--default .select2-selection--multiple .select2-selection__rendered li{list-style:none}.select2-container--default .select2-selection--multiple .select2-selection__clear{cursor:pointer;float:right;font-weight:bold;margin-top:5px;margin-right:10px;padding:1px}.select2-container--default .select2-selection--multiple .select2-selection__choice{background-color:#e4e4e4;border:1px solid #aaa;border-radius:4px;cursor:default;float:left;margin-right:5px;margin-top:5px;padding:0 5px}.select2-container--default .select2-selection--multiple .select2-selection__choice__remove{color:#999;cursor:pointer;display:inline-block;font-weight:bold;margin-right:2px}.select2-container--default .select2-selection--multiple .select2-selection__choice__remove:hover{color:#333}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice,.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-search--inline{float:right}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice{margin-left:5px;margin-right:auto}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove{margin-left:2px;margin-right:auto}.select2-container--default.select2-container--focus .select2-selection--multiple{border:solid black 1px;outline:0}.select2-container--default.select2-container--disabled .select2-selection--multiple{background-color:#eee;cursor:default}.select2-container--default.select2-container--disabled .select2-selection__choice__remove{display:none}.select2-container--default.select2-container--open.select2-container--above .select2-selection--single,.select2-container--default.select2-container--open.select2-container--above .select2-selection--multiple{border-top-left-radius:0;border-top-right-radius:0}.select2-container--default.select2-container--open.select2-container--below .select2-selection--single,.select2-container--default.select2-container--open.select2-container--below .select2-selection--multiple{border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--default .select2-search--dropdown .select2-search__field{border:1px solid #aaa}.select2-container--default .select2-search--inline .select2-search__field{background:transparent;border:none;outline:0;box-shadow:none;-webkit-appearance:textfield}.select2-container--default .select2-results>.select2-results__options{max-height:200px;overflow-y:auto}.select2-container--default .select2-results__option[role=group]{padding:0}.select2-container--default .select2-results__option[aria-disabled=true]{color:#999}.select2-container--default .select2-results__option[aria-selected=true]{background-color:#ddd}.select2-container--default .select2-results__option .select2-results__option{padding-left:1em}.select2-container--default .select2-results__option .select2-results__option .select2-results__group{padding-left:0}.select2-container--default .select2-results__option .select2-results__option .select2-results__option{margin-left:-1em;padding-left:2em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-2em;padding-left:3em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-3em;padding-left:4em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-4em;padding-left:5em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-5em;padding-left:6em}.select2-container--default .select2-results__option--highlighted[aria-selected]{background-color:#5897fb;color:white}.select2-container--default .select2-results__group{cursor:default;display:block;padding:6px}.select2-container--classic .select2-selection--single{background-color:#f7f7f7;border:1px solid #aaa;border-radius:4px;outline:0;background-image:-webkit-linear-gradient(top, #fff 50%, #eee 100%);background-image:-o-linear-gradient(top, #fff 50%, #eee 100%);background-image:linear-gradient(to bottom, #fff 50%, #eee 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0)}.select2-container--classic .select2-selection--single:focus{border:1px solid #5897fb}.select2-container--classic .select2-selection--single .select2-selection__rendered{color:#444;line-height:28px}.select2-container--classic .select2-selection--single .select2-selection__clear{cursor:pointer;float:right;font-weight:bold;margin-right:10px}.select2-container--classic .select2-selection--single .select2-selection__placeholder{color:#999}.select2-container--classic .select2-selection--single .select2-selection__arrow{background-color:#ddd;border:none;border-left:1px solid #aaa;border-top-right-radius:4px;border-bottom-right-radius:4px;height:26px;position:absolute;top:1px;right:1px;width:20px;background-image:-webkit-linear-gradient(top, #eee 50%, #ccc 100%);background-image:-o-linear-gradient(top, #eee 50%, #ccc 100%);background-image:linear-gradient(to bottom, #eee 50%, #ccc 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFCCCCCC', GradientType=0)}.select2-container--classic .select2-selection--single .select2-selection__arrow b{border-color:#888 transparent transparent transparent;border-style:solid;border-width:5px 4px 0 4px;height:0;left:50%;margin-left:-4px;margin-top:-2px;position:absolute;top:50%;width:0}.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__clear{float:left}.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__arrow{border:none;border-right:1px solid #aaa;border-radius:0;border-top-left-radius:4px;border-bottom-left-radius:4px;left:1px;right:auto}.select2-container--classic.select2-container--open .select2-selection--single{border:1px solid #5897fb}.select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow{background:transparent;border:none}.select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow b{border-color:transparent transparent #888 transparent;border-width:0 4px 5px 4px}.select2-container--classic.select2-container--open.select2-container--above .select2-selection--single{border-top:none;border-top-left-radius:0;border-top-right-radius:0;background-image:-webkit-linear-gradient(top, #fff 0%, #eee 50%);background-image:-o-linear-gradient(top, #fff 0%, #eee 50%);background-image:linear-gradient(to bottom, #fff 0%, #eee 50%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0)}.select2-container--classic.select2-container--open.select2-container--below .select2-selection--single{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0;background-image:-webkit-linear-gradient(top, #eee 50%, #fff 100%);background-image:-o-linear-gradient(top, #eee 50%, #fff 100%);background-image:linear-gradient(to bottom, #eee 50%, #fff 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFFFFFFF', GradientType=0)}.select2-container--classic .select2-selection--multiple{background-color:white;border:1px solid #aaa;border-radius:4px;cursor:text;outline:0}.select2-container--classic .select2-selection--multiple:focus{border:1px solid #5897fb}.select2-container--classic .select2-selection--multiple .select2-selection__rendered{list-style:none;margin:0;padding:0 5px}.select2-container--classic .select2-selection--multiple .select2-selection__clear{display:none}.select2-container--classic .select2-selection--multiple .select2-selection__choice{background-color:#e4e4e4;border:1px solid #aaa;border-radius:4px;cursor:default;float:left;margin-right:5px;margin-top:5px;padding:0 5px}.select2-container--classic .select2-selection--multiple .select2-selection__choice__remove{color:#888;cursor:pointer;display:inline-block;font-weight:bold;margin-right:2px}.select2-container--classic .select2-selection--multiple .select2-selection__choice__remove:hover{color:#555}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice{float:right;margin-left:5px;margin-right:auto}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove{margin-left:2px;margin-right:auto}.select2-container--classic.select2-container--open .select2-selection--multiple{border:1px solid #5897fb}.select2-container--classic.select2-container--open.select2-container--above .select2-selection--multiple{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.select2-container--classic.select2-container--open.select2-container--below .select2-selection--multiple{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--classic .select2-search--dropdown .select2-search__field{border:1px solid #aaa;outline:0}.select2-container--classic .select2-search--inline .select2-search__field{outline:0;box-shadow:none}.select2-container--classic .select2-dropdown{background-color:#fff;border:1px solid transparent}.select2-container--classic .select2-dropdown--above{border-bottom:none}.select2-container--classic .select2-dropdown--below{border-top:none}.select2-container--classic .select2-results>.select2-results__options{max-height:200px;overflow-y:auto}.select2-container--classic .select2-results__option[role=group]{padding:0}.select2-container--classic .select2-results__option[aria-disabled=true]{color:grey}.select2-container--classic .select2-results__option--highlighted[aria-selected]{background-color:#3875d7;color:#fff}.select2-container--classic .select2-results__group{cursor:default;display:block;padding:6px}.select2-container--classic.select2-container--open .select2-dropdown{border-color:#5897fb}
|
vendor/select2/js/select2.min.js
ADDED
@@ -0,0 +1,2 @@
|
|
|
|
|
1 |
+
/*! Select2 4.0.13 | https://github.com/select2/select2/blob/master/LICENSE.md */
|
2 |
+
!function(n){"function"==typeof define&&define.amd?define(["jquery"],n):"object"==typeof module&&module.exports?module.exports=function(e,t){return void 0===t&&(t="undefined"!=typeof window?require("jquery"):require("jquery")(e)),n(t),t}:n(jQuery)}(function(u){var e=function(){if(u&&u.fn&&u.fn.select2&&u.fn.select2.amd)var e=u.fn.select2.amd;var t,n,r,h,o,s,f,g,m,v,y,_,i,a,b;function w(e,t){return i.call(e,t)}function l(e,t){var n,r,i,o,s,a,l,c,u,d,p,h=t&&t.split("/"),f=y.map,g=f&&f["*"]||{};if(e){for(s=(e=e.split("/")).length-1,y.nodeIdCompat&&b.test(e[s])&&(e[s]=e[s].replace(b,"")),"."===e[0].charAt(0)&&h&&(e=h.slice(0,h.length-1).concat(e)),u=0;u<e.length;u++)if("."===(p=e[u]))e.splice(u,1),u-=1;else if(".."===p){if(0===u||1===u&&".."===e[2]||".."===e[u-1])continue;0<u&&(e.splice(u-1,2),u-=2)}e=e.join("/")}if((h||g)&&f){for(u=(n=e.split("/")).length;0<u;u-=1){if(r=n.slice(0,u).join("/"),h)for(d=h.length;0<d;d-=1)if(i=(i=f[h.slice(0,d).join("/")])&&i[r]){o=i,a=u;break}if(o)break;!l&&g&&g[r]&&(l=g[r],c=u)}!o&&l&&(o=l,a=c),o&&(n.splice(0,a,o),e=n.join("/"))}return e}function A(t,n){return function(){var e=a.call(arguments,0);return"string"!=typeof e[0]&&1===e.length&&e.push(null),s.apply(h,e.concat([t,n]))}}function x(t){return function(e){m[t]=e}}function D(e){if(w(v,e)){var t=v[e];delete v[e],_[e]=!0,o.apply(h,t)}if(!w(m,e)&&!w(_,e))throw new Error("No "+e);return m[e]}function c(e){var t,n=e?e.indexOf("!"):-1;return-1<n&&(t=e.substring(0,n),e=e.substring(n+1,e.length)),[t,e]}function S(e){return e?c(e):[]}return e&&e.requirejs||(e?n=e:e={},m={},v={},y={},_={},i=Object.prototype.hasOwnProperty,a=[].slice,b=/\.js$/,f=function(e,t){var n,r=c(e),i=r[0],o=t[1];return e=r[1],i&&(n=D(i=l(i,o))),i?e=n&&n.normalize?n.normalize(e,function(t){return function(e){return l(e,t)}}(o)):l(e,o):(i=(r=c(e=l(e,o)))[0],e=r[1],i&&(n=D(i))),{f:i?i+"!"+e:e,n:e,pr:i,p:n}},g={require:function(e){return A(e)},exports:function(e){var t=m[e];return void 0!==t?t:m[e]={}},module:function(e){return{id:e,uri:"",exports:m[e],config:function(e){return function(){return y&&y.config&&y.config[e]||{}}}(e)}}},o=function(e,t,n,r){var i,o,s,a,l,c,u,d=[],p=typeof n;if(c=S(r=r||e),"undefined"==p||"function"==p){for(t=!t.length&&n.length?["require","exports","module"]:t,l=0;l<t.length;l+=1)if("require"===(o=(a=f(t[l],c)).f))d[l]=g.require(e);else if("exports"===o)d[l]=g.exports(e),u=!0;else if("module"===o)i=d[l]=g.module(e);else if(w(m,o)||w(v,o)||w(_,o))d[l]=D(o);else{if(!a.p)throw new Error(e+" missing "+o);a.p.load(a.n,A(r,!0),x(o),{}),d[l]=m[o]}s=n?n.apply(m[e],d):void 0,e&&(i&&i.exports!==h&&i.exports!==m[e]?m[e]=i.exports:s===h&&u||(m[e]=s))}else e&&(m[e]=n)},t=n=s=function(e,t,n,r,i){if("string"==typeof e)return g[e]?g[e](t):D(f(e,S(t)).f);if(!e.splice){if((y=e).deps&&s(y.deps,y.callback),!t)return;t.splice?(e=t,t=n,n=null):e=h}return t=t||function(){},"function"==typeof n&&(n=r,r=i),r?o(h,e,t,n):setTimeout(function(){o(h,e,t,n)},4),s},s.config=function(e){return s(e)},t._defined=m,(r=function(e,t,n){if("string"!=typeof e)throw new Error("See almond README: incorrect module build, no module name");t.splice||(n=t,t=[]),w(m,e)||w(v,e)||(v[e]=[e,t,n])}).amd={jQuery:!0},e.requirejs=t,e.require=n,e.define=r),e.define("almond",function(){}),e.define("jquery",[],function(){var e=u||$;return null==e&&console&&console.error&&console.error("Select2: An instance of jQuery or a jQuery-compatible library was not found. Make sure that you are including jQuery before Select2 on your web page."),e}),e.define("select2/utils",["jquery"],function(o){var i={};function u(e){var t=e.prototype,n=[];for(var r in t){"function"==typeof t[r]&&"constructor"!==r&&n.push(r)}return n}i.Extend=function(e,t){var n={}.hasOwnProperty;function r(){this.constructor=e}for(var i in t)n.call(t,i)&&(e[i]=t[i]);return r.prototype=t.prototype,e.prototype=new r,e.__super__=t.prototype,e},i.Decorate=function(r,i){var e=u(i),t=u(r);function o(){var e=Array.prototype.unshift,t=i.prototype.constructor.length,n=r.prototype.constructor;0<t&&(e.call(arguments,r.prototype.constructor),n=i.prototype.constructor),n.apply(this,arguments)}i.displayName=r.displayName,o.prototype=new function(){this.constructor=o};for(var n=0;n<t.length;n++){var s=t[n];o.prototype[s]=r.prototype[s]}function a(e){var t=function(){};e in o.prototype&&(t=o.prototype[e]);var n=i.prototype[e];return function(){return Array.prototype.unshift.call(arguments,t),n.apply(this,arguments)}}for(var l=0;l<e.length;l++){var c=e[l];o.prototype[c]=a(c)}return o};function e(){this.listeners={}}e.prototype.on=function(e,t){this.listeners=this.listeners||{},e in this.listeners?this.listeners[e].push(t):this.listeners[e]=[t]},e.prototype.trigger=function(e){var t=Array.prototype.slice,n=t.call(arguments,1);this.listeners=this.listeners||{},null==n&&(n=[]),0===n.length&&n.push({}),(n[0]._type=e)in this.listeners&&this.invoke(this.listeners[e],t.call(arguments,1)),"*"in this.listeners&&this.invoke(this.listeners["*"],arguments)},e.prototype.invoke=function(e,t){for(var n=0,r=e.length;n<r;n++)e[n].apply(this,t)},i.Observable=e,i.generateChars=function(e){for(var t="",n=0;n<e;n++){t+=Math.floor(36*Math.random()).toString(36)}return t},i.bind=function(e,t){return function(){e.apply(t,arguments)}},i._convertData=function(e){for(var t in e){var n=t.split("-"),r=e;if(1!==n.length){for(var i=0;i<n.length;i++){var o=n[i];(o=o.substring(0,1).toLowerCase()+o.substring(1))in r||(r[o]={}),i==n.length-1&&(r[o]=e[t]),r=r[o]}delete e[t]}}return e},i.hasScroll=function(e,t){var n=o(t),r=t.style.overflowX,i=t.style.overflowY;return(r!==i||"hidden"!==i&&"visible"!==i)&&("scroll"===r||"scroll"===i||(n.innerHeight()<t.scrollHeight||n.innerWidth()<t.scrollWidth))},i.escapeMarkup=function(e){var t={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return"string"!=typeof e?e:String(e).replace(/[&<>"'\/\\]/g,function(e){return t[e]})},i.appendMany=function(e,t){if("1.7"===o.fn.jquery.substr(0,3)){var n=o();o.map(t,function(e){n=n.add(e)}),t=n}e.append(t)},i.__cache={};var n=0;return i.GetUniqueElementId=function(e){var t=e.getAttribute("data-select2-id");return null==t&&(e.id?(t=e.id,e.setAttribute("data-select2-id",t)):(e.setAttribute("data-select2-id",++n),t=n.toString())),t},i.StoreData=function(e,t,n){var r=i.GetUniqueElementId(e);i.__cache[r]||(i.__cache[r]={}),i.__cache[r][t]=n},i.GetData=function(e,t){var n=i.GetUniqueElementId(e);return t?i.__cache[n]&&null!=i.__cache[n][t]?i.__cache[n][t]:o(e).data(t):i.__cache[n]},i.RemoveData=function(e){var t=i.GetUniqueElementId(e);null!=i.__cache[t]&&delete i.__cache[t],e.removeAttribute("data-select2-id")},i}),e.define("select2/results",["jquery","./utils"],function(h,f){function r(e,t,n){this.$element=e,this.data=n,this.options=t,r.__super__.constructor.call(this)}return f.Extend(r,f.Observable),r.prototype.render=function(){var e=h('<ul class="select2-results__options" role="listbox"></ul>');return this.options.get("multiple")&&e.attr("aria-multiselectable","true"),this.$results=e},r.prototype.clear=function(){this.$results.empty()},r.prototype.displayMessage=function(e){var t=this.options.get("escapeMarkup");this.clear(),this.hideLoading();var n=h('<li role="alert" aria-live="assertive" class="select2-results__option"></li>'),r=this.options.get("translations").get(e.message);n.append(t(r(e.args))),n[0].className+=" select2-results__message",this.$results.append(n)},r.prototype.hideMessages=function(){this.$results.find(".select2-results__message").remove()},r.prototype.append=function(e){this.hideLoading();var t=[];if(null!=e.results&&0!==e.results.length){e.results=this.sort(e.results);for(var n=0;n<e.results.length;n++){var r=e.results[n],i=this.option(r);t.push(i)}this.$results.append(t)}else 0===this.$results.children().length&&this.trigger("results:message",{message:"noResults"})},r.prototype.position=function(e,t){t.find(".select2-results").append(e)},r.prototype.sort=function(e){return this.options.get("sorter")(e)},r.prototype.highlightFirstItem=function(){var e=this.$results.find(".select2-results__option[aria-selected]"),t=e.filter("[aria-selected=true]");0<t.length?t.first().trigger("mouseenter"):e.first().trigger("mouseenter"),this.ensureHighlightVisible()},r.prototype.setClasses=function(){var t=this;this.data.current(function(e){var r=h.map(e,function(e){return e.id.toString()});t.$results.find(".select2-results__option[aria-selected]").each(function(){var e=h(this),t=f.GetData(this,"data"),n=""+t.id;null!=t.element&&t.element.selected||null==t.element&&-1<h.inArray(n,r)?e.attr("aria-selected","true"):e.attr("aria-selected","false")})})},r.prototype.showLoading=function(e){this.hideLoading();var t={disabled:!0,loading:!0,text:this.options.get("translations").get("searching")(e)},n=this.option(t);n.className+=" loading-results",this.$results.prepend(n)},r.prototype.hideLoading=function(){this.$results.find(".loading-results").remove()},r.prototype.option=function(e){var t=document.createElement("li");t.className="select2-results__option";var n={role:"option","aria-selected":"false"},r=window.Element.prototype.matches||window.Element.prototype.msMatchesSelector||window.Element.prototype.webkitMatchesSelector;for(var i in(null!=e.element&&r.call(e.element,":disabled")||null==e.element&&e.disabled)&&(delete n["aria-selected"],n["aria-disabled"]="true"),null==e.id&&delete n["aria-selected"],null!=e._resultId&&(t.id=e._resultId),e.title&&(t.title=e.title),e.children&&(n.role="group",n["aria-label"]=e.text,delete n["aria-selected"]),n){var o=n[i];t.setAttribute(i,o)}if(e.children){var s=h(t),a=document.createElement("strong");a.className="select2-results__group";h(a);this.template(e,a);for(var l=[],c=0;c<e.children.length;c++){var u=e.children[c],d=this.option(u);l.push(d)}var p=h("<ul></ul>",{class:"select2-results__options select2-results__options--nested"});p.append(l),s.append(a),s.append(p)}else this.template(e,t);return f.StoreData(t,"data",e),t},r.prototype.bind=function(t,e){var l=this,n=t.id+"-results";this.$results.attr("id",n),t.on("results:all",function(e){l.clear(),l.append(e.data),t.isOpen()&&(l.setClasses(),l.highlightFirstItem())}),t.on("results:append",function(e){l.append(e.data),t.isOpen()&&l.setClasses()}),t.on("query",function(e){l.hideMessages(),l.showLoading(e)}),t.on("select",function(){t.isOpen()&&(l.setClasses(),l.options.get("scrollAfterSelect")&&l.highlightFirstItem())}),t.on("unselect",function(){t.isOpen()&&(l.setClasses(),l.options.get("scrollAfterSelect")&&l.highlightFirstItem())}),t.on("open",function(){l.$results.attr("aria-expanded","true"),l.$results.attr("aria-hidden","false"),l.setClasses(),l.ensureHighlightVisible()}),t.on("close",function(){l.$results.attr("aria-expanded","false"),l.$results.attr("aria-hidden","true"),l.$results.removeAttr("aria-activedescendant")}),t.on("results:toggle",function(){var e=l.getHighlightedResults();0!==e.length&&e.trigger("mouseup")}),t.on("results:select",function(){var e=l.getHighlightedResults();if(0!==e.length){var t=f.GetData(e[0],"data");"true"==e.attr("aria-selected")?l.trigger("close",{}):l.trigger("select",{data:t})}}),t.on("results:previous",function(){var e=l.getHighlightedResults(),t=l.$results.find("[aria-selected]"),n=t.index(e);if(!(n<=0)){var r=n-1;0===e.length&&(r=0);var i=t.eq(r);i.trigger("mouseenter");var o=l.$results.offset().top,s=i.offset().top,a=l.$results.scrollTop()+(s-o);0===r?l.$results.scrollTop(0):s-o<0&&l.$results.scrollTop(a)}}),t.on("results:next",function(){var e=l.getHighlightedResults(),t=l.$results.find("[aria-selected]"),n=t.index(e)+1;if(!(n>=t.length)){var r=t.eq(n);r.trigger("mouseenter");var i=l.$results.offset().top+l.$results.outerHeight(!1),o=r.offset().top+r.outerHeight(!1),s=l.$results.scrollTop()+o-i;0===n?l.$results.scrollTop(0):i<o&&l.$results.scrollTop(s)}}),t.on("results:focus",function(e){e.element.addClass("select2-results__option--highlighted")}),t.on("results:message",function(e){l.displayMessage(e)}),h.fn.mousewheel&&this.$results.on("mousewheel",function(e){var t=l.$results.scrollTop(),n=l.$results.get(0).scrollHeight-t+e.deltaY,r=0<e.deltaY&&t-e.deltaY<=0,i=e.deltaY<0&&n<=l.$results.height();r?(l.$results.scrollTop(0),e.preventDefault(),e.stopPropagation()):i&&(l.$results.scrollTop(l.$results.get(0).scrollHeight-l.$results.height()),e.preventDefault(),e.stopPropagation())}),this.$results.on("mouseup",".select2-results__option[aria-selected]",function(e){var t=h(this),n=f.GetData(this,"data");"true"!==t.attr("aria-selected")?l.trigger("select",{originalEvent:e,data:n}):l.options.get("multiple")?l.trigger("unselect",{originalEvent:e,data:n}):l.trigger("close",{})}),this.$results.on("mouseenter",".select2-results__option[aria-selected]",function(e){var t=f.GetData(this,"data");l.getHighlightedResults().removeClass("select2-results__option--highlighted"),l.trigger("results:focus",{data:t,element:h(this)})})},r.prototype.getHighlightedResults=function(){return this.$results.find(".select2-results__option--highlighted")},r.prototype.destroy=function(){this.$results.remove()},r.prototype.ensureHighlightVisible=function(){var e=this.getHighlightedResults();if(0!==e.length){var t=this.$results.find("[aria-selected]").index(e),n=this.$results.offset().top,r=e.offset().top,i=this.$results.scrollTop()+(r-n),o=r-n;i-=2*e.outerHeight(!1),t<=2?this.$results.scrollTop(0):(o>this.$results.outerHeight()||o<0)&&this.$results.scrollTop(i)}},r.prototype.template=function(e,t){var n=this.options.get("templateResult"),r=this.options.get("escapeMarkup"),i=n(e,t);null==i?t.style.display="none":"string"==typeof i?t.innerHTML=r(i):h(t).append(i)},r}),e.define("select2/keys",[],function(){return{BACKSPACE:8,TAB:9,ENTER:13,SHIFT:16,CTRL:17,ALT:18,ESC:27,SPACE:32,PAGE_UP:33,PAGE_DOWN:34,END:35,HOME:36,LEFT:37,UP:38,RIGHT:39,DOWN:40,DELETE:46}}),e.define("select2/selection/base",["jquery","../utils","../keys"],function(n,r,i){function o(e,t){this.$element=e,this.options=t,o.__super__.constructor.call(this)}return r.Extend(o,r.Observable),o.prototype.render=function(){var e=n('<span class="select2-selection" role="combobox" aria-haspopup="true" aria-expanded="false"></span>');return this._tabindex=0,null!=r.GetData(this.$element[0],"old-tabindex")?this._tabindex=r.GetData(this.$element[0],"old-tabindex"):null!=this.$element.attr("tabindex")&&(this._tabindex=this.$element.attr("tabindex")),e.attr("title",this.$element.attr("title")),e.attr("tabindex",this._tabindex),e.attr("aria-disabled","false"),this.$selection=e},o.prototype.bind=function(e,t){var n=this,r=e.id+"-results";this.container=e,this.$selection.on("focus",function(e){n.trigger("focus",e)}),this.$selection.on("blur",function(e){n._handleBlur(e)}),this.$selection.on("keydown",function(e){n.trigger("keypress",e),e.which===i.SPACE&&e.preventDefault()}),e.on("results:focus",function(e){n.$selection.attr("aria-activedescendant",e.data._resultId)}),e.on("selection:update",function(e){n.update(e.data)}),e.on("open",function(){n.$selection.attr("aria-expanded","true"),n.$selection.attr("aria-owns",r),n._attachCloseHandler(e)}),e.on("close",function(){n.$selection.attr("aria-expanded","false"),n.$selection.removeAttr("aria-activedescendant"),n.$selection.removeAttr("aria-owns"),n.$selection.trigger("focus"),n._detachCloseHandler(e)}),e.on("enable",function(){n.$selection.attr("tabindex",n._tabindex),n.$selection.attr("aria-disabled","false")}),e.on("disable",function(){n.$selection.attr("tabindex","-1"),n.$selection.attr("aria-disabled","true")})},o.prototype._handleBlur=function(e){var t=this;window.setTimeout(function(){document.activeElement==t.$selection[0]||n.contains(t.$selection[0],document.activeElement)||t.trigger("blur",e)},1)},o.prototype._attachCloseHandler=function(e){n(document.body).on("mousedown.select2."+e.id,function(e){var t=n(e.target).closest(".select2");n(".select2.select2-container--open").each(function(){this!=t[0]&&r.GetData(this,"element").select2("close")})})},o.prototype._detachCloseHandler=function(e){n(document.body).off("mousedown.select2."+e.id)},o.prototype.position=function(e,t){t.find(".selection").append(e)},o.prototype.destroy=function(){this._detachCloseHandler(this.container)},o.prototype.update=function(e){throw new Error("The `update` method must be defined in child classes.")},o.prototype.isEnabled=function(){return!this.isDisabled()},o.prototype.isDisabled=function(){return this.options.get("disabled")},o}),e.define("select2/selection/single",["jquery","./base","../utils","../keys"],function(e,t,n,r){function i(){i.__super__.constructor.apply(this,arguments)}return n.Extend(i,t),i.prototype.render=function(){var e=i.__super__.render.call(this);return e.addClass("select2-selection--single"),e.html('<span class="select2-selection__rendered"></span><span class="select2-selection__arrow" role="presentation"><b role="presentation"></b></span>'),e},i.prototype.bind=function(t,e){var n=this;i.__super__.bind.apply(this,arguments);var r=t.id+"-container";this.$selection.find(".select2-selection__rendered").attr("id",r).attr("role","textbox").attr("aria-readonly","true"),this.$selection.attr("aria-labelledby",r),this.$selection.on("mousedown",function(e){1===e.which&&n.trigger("toggle",{originalEvent:e})}),this.$selection.on("focus",function(e){}),this.$selection.on("blur",function(e){}),t.on("focus",function(e){t.isOpen()||n.$selection.trigger("focus")})},i.prototype.clear=function(){var e=this.$selection.find(".select2-selection__rendered");e.empty(),e.removeAttr("title")},i.prototype.display=function(e,t){var n=this.options.get("templateSelection");return this.options.get("escapeMarkup")(n(e,t))},i.prototype.selectionContainer=function(){return e("<span></span>")},i.prototype.update=function(e){if(0!==e.length){var t=e[0],n=this.$selection.find(".select2-selection__rendered"),r=this.display(t,n);n.empty().append(r);var i=t.title||t.text;i?n.attr("title",i):n.removeAttr("title")}else this.clear()},i}),e.define("select2/selection/multiple",["jquery","./base","../utils"],function(i,e,l){function n(e,t){n.__super__.constructor.apply(this,arguments)}return l.Extend(n,e),n.prototype.render=function(){var e=n.__super__.render.call(this);return e.addClass("select2-selection--multiple"),e.html('<ul class="select2-selection__rendered"></ul>'),e},n.prototype.bind=function(e,t){var r=this;n.__super__.bind.apply(this,arguments),this.$selection.on("click",function(e){r.trigger("toggle",{originalEvent:e})}),this.$selection.on("click",".select2-selection__choice__remove",function(e){if(!r.isDisabled()){var t=i(this).parent(),n=l.GetData(t[0],"data");r.trigger("unselect",{originalEvent:e,data:n})}})},n.prototype.clear=function(){var e=this.$selection.find(".select2-selection__rendered");e.empty(),e.removeAttr("title")},n.prototype.display=function(e,t){var n=this.options.get("templateSelection");return this.options.get("escapeMarkup")(n(e,t))},n.prototype.selectionContainer=function(){return i('<li class="select2-selection__choice"><span class="select2-selection__choice__remove" role="presentation">×</span></li>')},n.prototype.update=function(e){if(this.clear(),0!==e.length){for(var t=[],n=0;n<e.length;n++){var r=e[n],i=this.selectionContainer(),o=this.display(r,i);i.append(o);var s=r.title||r.text;s&&i.attr("title",s),l.StoreData(i[0],"data",r),t.push(i)}var a=this.$selection.find(".select2-selection__rendered");l.appendMany(a,t)}},n}),e.define("select2/selection/placeholder",["../utils"],function(e){function t(e,t,n){this.placeholder=this.normalizePlaceholder(n.get("placeholder")),e.call(this,t,n)}return t.prototype.normalizePlaceholder=function(e,t){return"string"==typeof t&&(t={id:"",text:t}),t},t.prototype.createPlaceholder=function(e,t){var n=this.selectionContainer();return n.html(this.display(t)),n.addClass("select2-selection__placeholder").removeClass("select2-selection__choice"),n},t.prototype.update=function(e,t){var n=1==t.length&&t[0].id!=this.placeholder.id;if(1<t.length||n)return e.call(this,t);this.clear();var r=this.createPlaceholder(this.placeholder);this.$selection.find(".select2-selection__rendered").append(r)},t}),e.define("select2/selection/allowClear",["jquery","../keys","../utils"],function(i,r,a){function e(){}return e.prototype.bind=function(e,t,n){var r=this;e.call(this,t,n),null==this.placeholder&&this.options.get("debug")&&window.console&&console.error&&console.error("Select2: The `allowClear` option should be used in combination with the `placeholder` option."),this.$selection.on("mousedown",".select2-selection__clear",function(e){r._handleClear(e)}),t.on("keypress",function(e){r._handleKeyboardClear(e,t)})},e.prototype._handleClear=function(e,t){if(!this.isDisabled()){var n=this.$selection.find(".select2-selection__clear");if(0!==n.length){t.stopPropagation();var r=a.GetData(n[0],"data"),i=this.$element.val();this.$element.val(this.placeholder.id);var o={data:r};if(this.trigger("clear",o),o.prevented)this.$element.val(i);else{for(var s=0;s<r.length;s++)if(o={data:r[s]},this.trigger("unselect",o),o.prevented)return void this.$element.val(i);this.$element.trigger("input").trigger("change"),this.trigger("toggle",{})}}}},e.prototype._handleKeyboardClear=function(e,t,n){n.isOpen()||t.which!=r.DELETE&&t.which!=r.BACKSPACE||this._handleClear(t)},e.prototype.update=function(e,t){if(e.call(this,t),!(0<this.$selection.find(".select2-selection__placeholder").length||0===t.length)){var n=this.options.get("translations").get("removeAllItems"),r=i('<span class="select2-selection__clear" title="'+n()+'">×</span>');a.StoreData(r[0],"data",t),this.$selection.find(".select2-selection__rendered").prepend(r)}},e}),e.define("select2/selection/search",["jquery","../utils","../keys"],function(r,a,l){function e(e,t,n){e.call(this,t,n)}return e.prototype.render=function(e){var t=r('<li class="select2-search select2-search--inline"><input class="select2-search__field" type="search" tabindex="-1" autocomplete="off" autocorrect="off" autocapitalize="none" spellcheck="false" role="searchbox" aria-autocomplete="list" /></li>');this.$searchContainer=t,this.$search=t.find("input");var n=e.call(this);return this._transferTabIndex(),n},e.prototype.bind=function(e,t,n){var r=this,i=t.id+"-results";e.call(this,t,n),t.on("open",function(){r.$search.attr("aria-controls",i),r.$search.trigger("focus")}),t.on("close",function(){r.$search.val(""),r.$search.removeAttr("aria-controls"),r.$search.removeAttr("aria-activedescendant"),r.$search.trigger("focus")}),t.on("enable",function(){r.$search.prop("disabled",!1),r._transferTabIndex()}),t.on("disable",function(){r.$search.prop("disabled",!0)}),t.on("focus",function(e){r.$search.trigger("focus")}),t.on("results:focus",function(e){e.data._resultId?r.$search.attr("aria-activedescendant",e.data._resultId):r.$search.removeAttr("aria-activedescendant")}),this.$selection.on("focusin",".select2-search--inline",function(e){r.trigger("focus",e)}),this.$selection.on("focusout",".select2-search--inline",function(e){r._handleBlur(e)}),this.$selection.on("keydown",".select2-search--inline",function(e){if(e.stopPropagation(),r.trigger("keypress",e),r._keyUpPrevented=e.isDefaultPrevented(),e.which===l.BACKSPACE&&""===r.$search.val()){var t=r.$searchContainer.prev(".select2-selection__choice");if(0<t.length){var n=a.GetData(t[0],"data");r.searchRemoveChoice(n),e.preventDefault()}}}),this.$selection.on("click",".select2-search--inline",function(e){r.$search.val()&&e.stopPropagation()});var o=document.documentMode,s=o&&o<=11;this.$selection.on("input.searchcheck",".select2-search--inline",function(e){s?r.$selection.off("input.search input.searchcheck"):r.$selection.off("keyup.search")}),this.$selection.on("keyup.search input.search",".select2-search--inline",function(e){if(s&&"input"===e.type)r.$selection.off("input.search input.searchcheck");else{var t=e.which;t!=l.SHIFT&&t!=l.CTRL&&t!=l.ALT&&t!=l.TAB&&r.handleSearch(e)}})},e.prototype._transferTabIndex=function(e){this.$search.attr("tabindex",this.$selection.attr("tabindex")),this.$selection.attr("tabindex","-1")},e.prototype.createPlaceholder=function(e,t){this.$search.attr("placeholder",t.text)},e.prototype.update=function(e,t){var n=this.$search[0]==document.activeElement;this.$search.attr("placeholder",""),e.call(this,t),this.$selection.find(".select2-selection__rendered").append(this.$searchContainer),this.resizeSearch(),n&&this.$search.trigger("focus")},e.prototype.handleSearch=function(){if(this.resizeSearch(),!this._keyUpPrevented){var e=this.$search.val();this.trigger("query",{term:e})}this._keyUpPrevented=!1},e.prototype.searchRemoveChoice=function(e,t){this.trigger("unselect",{data:t}),this.$search.val(t.text),this.handleSearch()},e.prototype.resizeSearch=function(){this.$search.css("width","25px");var e="";""!==this.$search.attr("placeholder")?e=this.$selection.find(".select2-selection__rendered").width():e=.75*(this.$search.val().length+1)+"em";this.$search.css("width",e)},e}),e.define("select2/selection/eventRelay",["jquery"],function(s){function e(){}return e.prototype.bind=function(e,t,n){var r=this,i=["open","opening","close","closing","select","selecting","unselect","unselecting","clear","clearing"],o=["opening","closing","selecting","unselecting","clearing"];e.call(this,t,n),t.on("*",function(e,t){if(-1!==s.inArray(e,i)){t=t||{};var n=s.Event("select2:"+e,{params:t});r.$element.trigger(n),-1!==s.inArray(e,o)&&(t.prevented=n.isDefaultPrevented())}})},e}),e.define("select2/translation",["jquery","require"],function(t,n){function r(e){this.dict=e||{}}return r.prototype.all=function(){return this.dict},r.prototype.get=function(e){return this.dict[e]},r.prototype.extend=function(e){this.dict=t.extend({},e.all(),this.dict)},r._cache={},r.loadPath=function(e){if(!(e in r._cache)){var t=n(e);r._cache[e]=t}return new r(r._cache[e])},r}),e.define("select2/diacritics",[],function(){return{"Ⓐ":"A","A":"A","À":"A","Á":"A","Â":"A","Ầ":"A","Ấ":"A","Ẫ":"A","Ẩ":"A","Ã":"A","Ā":"A","Ă":"A","Ằ":"A","Ắ":"A","Ẵ":"A","Ẳ":"A","Ȧ":"A","Ǡ":"A","Ä":"A","Ǟ":"A","Ả":"A","Å":"A","Ǻ":"A","Ǎ":"A","Ȁ":"A","Ȃ":"A","Ạ":"A","Ậ":"A","Ặ":"A","Ḁ":"A","Ą":"A","Ⱥ":"A","Ɐ":"A","Ꜳ":"AA","Æ":"AE","Ǽ":"AE","Ǣ":"AE","Ꜵ":"AO","Ꜷ":"AU","Ꜹ":"AV","Ꜻ":"AV","Ꜽ":"AY","Ⓑ":"B","B":"B","Ḃ":"B","Ḅ":"B","Ḇ":"B","Ƀ":"B","Ƃ":"B","Ɓ":"B","Ⓒ":"C","C":"C","Ć":"C","Ĉ":"C","Ċ":"C","Č":"C","Ç":"C","Ḉ":"C","Ƈ":"C","Ȼ":"C","Ꜿ":"C","Ⓓ":"D","D":"D","Ḋ":"D","Ď":"D","Ḍ":"D","Ḑ":"D","Ḓ":"D","Ḏ":"D","Đ":"D","Ƌ":"D","Ɗ":"D","Ɖ":"D","Ꝺ":"D","DZ":"DZ","DŽ":"DZ","Dz":"Dz","Dž":"Dz","Ⓔ":"E","E":"E","È":"E","É":"E","Ê":"E","Ề":"E","Ế":"E","Ễ":"E","Ể":"E","Ẽ":"E","Ē":"E","Ḕ":"E","Ḗ":"E","Ĕ":"E","Ė":"E","Ë":"E","Ẻ":"E","Ě":"E","Ȅ":"E","Ȇ":"E","Ẹ":"E","Ệ":"E","Ȩ":"E","Ḝ":"E","Ę":"E","Ḙ":"E","Ḛ":"E","Ɛ":"E","Ǝ":"E","Ⓕ":"F","F":"F","Ḟ":"F","Ƒ":"F","Ꝼ":"F","Ⓖ":"G","G":"G","Ǵ":"G","Ĝ":"G","Ḡ":"G","Ğ":"G","Ġ":"G","Ǧ":"G","Ģ":"G","Ǥ":"G","Ɠ":"G","Ꞡ":"G","Ᵹ":"G","Ꝿ":"G","Ⓗ":"H","H":"H","Ĥ":"H","Ḣ":"H","Ḧ":"H","Ȟ":"H","Ḥ":"H","Ḩ":"H","Ḫ":"H","Ħ":"H","Ⱨ":"H","Ⱶ":"H","Ɥ":"H","Ⓘ":"I","I":"I","Ì":"I","Í":"I","Î":"I","Ĩ":"I","Ī":"I","Ĭ":"I","İ":"I","Ï":"I","Ḯ":"I","Ỉ":"I","Ǐ":"I","Ȉ":"I","Ȋ":"I","Ị":"I","Į":"I","Ḭ":"I","Ɨ":"I","Ⓙ":"J","J":"J","Ĵ":"J","Ɉ":"J","Ⓚ":"K","K":"K","Ḱ":"K","Ǩ":"K","Ḳ":"K","Ķ":"K","Ḵ":"K","Ƙ":"K","Ⱪ":"K","Ꝁ":"K","Ꝃ":"K","Ꝅ":"K","Ꞣ":"K","Ⓛ":"L","L":"L","Ŀ":"L","Ĺ":"L","Ľ":"L","Ḷ":"L","Ḹ":"L","Ļ":"L","Ḽ":"L","Ḻ":"L","Ł":"L","Ƚ":"L","Ɫ":"L","Ⱡ":"L","Ꝉ":"L","Ꝇ":"L","Ꞁ":"L","LJ":"LJ","Lj":"Lj","Ⓜ":"M","M":"M","Ḿ":"M","Ṁ":"M","Ṃ":"M","Ɱ":"M","Ɯ":"M","Ⓝ":"N","N":"N","Ǹ":"N","Ń":"N","Ñ":"N","Ṅ":"N","Ň":"N","Ṇ":"N","Ņ":"N","Ṋ":"N","Ṉ":"N","Ƞ":"N","Ɲ":"N","Ꞑ":"N","Ꞥ":"N","NJ":"NJ","Nj":"Nj","Ⓞ":"O","O":"O","Ò":"O","Ó":"O","Ô":"O","Ồ":"O","Ố":"O","Ỗ":"O","Ổ":"O","Õ":"O","Ṍ":"O","Ȭ":"O","Ṏ":"O","Ō":"O","Ṑ":"O","Ṓ":"O","Ŏ":"O","Ȯ":"O","Ȱ":"O","Ö":"O","Ȫ":"O","Ỏ":"O","Ő":"O","Ǒ":"O","Ȍ":"O","Ȏ":"O","Ơ":"O","Ờ":"O","Ớ":"O","Ỡ":"O","Ở":"O","Ợ":"O","Ọ":"O","Ộ":"O","Ǫ":"O","Ǭ":"O","Ø":"O","Ǿ":"O","Ɔ":"O","Ɵ":"O","Ꝋ":"O","Ꝍ":"O","Œ":"OE","Ƣ":"OI","Ꝏ":"OO","Ȣ":"OU","Ⓟ":"P","P":"P","Ṕ":"P","Ṗ":"P","Ƥ":"P","Ᵽ":"P","Ꝑ":"P","Ꝓ":"P","Ꝕ":"P","Ⓠ":"Q","Q":"Q","Ꝗ":"Q","Ꝙ":"Q","Ɋ":"Q","Ⓡ":"R","R":"R","Ŕ":"R","Ṙ":"R","Ř":"R","Ȑ":"R","Ȓ":"R","Ṛ":"R","Ṝ":"R","Ŗ":"R","Ṟ":"R","Ɍ":"R","Ɽ":"R","Ꝛ":"R","Ꞧ":"R","Ꞃ":"R","Ⓢ":"S","S":"S","ẞ":"S","Ś":"S","Ṥ":"S","Ŝ":"S","Ṡ":"S","Š":"S","Ṧ":"S","Ṣ":"S","Ṩ":"S","Ș":"S","Ş":"S","Ȿ":"S","Ꞩ":"S","Ꞅ":"S","Ⓣ":"T","T":"T","Ṫ":"T","Ť":"T","Ṭ":"T","Ț":"T","Ţ":"T","Ṱ":"T","Ṯ":"T","Ŧ":"T","Ƭ":"T","Ʈ":"T","Ⱦ":"T","Ꞇ":"T","Ꜩ":"TZ","Ⓤ":"U","U":"U","Ù":"U","Ú":"U","Û":"U","Ũ":"U","Ṹ":"U","Ū":"U","Ṻ":"U","Ŭ":"U","Ü":"U","Ǜ":"U","Ǘ":"U","Ǖ":"U","Ǚ":"U","Ủ":"U","Ů":"U","Ű":"U","Ǔ":"U","Ȕ":"U","Ȗ":"U","Ư":"U","Ừ":"U","Ứ":"U","Ữ":"U","Ử":"U","Ự":"U","Ụ":"U","Ṳ":"U","Ų":"U","Ṷ":"U","Ṵ":"U","Ʉ":"U","Ⓥ":"V","V":"V","Ṽ":"V","Ṿ":"V","Ʋ":"V","Ꝟ":"V","Ʌ":"V","Ꝡ":"VY","Ⓦ":"W","W":"W","Ẁ":"W","Ẃ":"W","Ŵ":"W","Ẇ":"W","Ẅ":"W","Ẉ":"W","Ⱳ":"W","Ⓧ":"X","X":"X","Ẋ":"X","Ẍ":"X","Ⓨ":"Y","Y":"Y","Ỳ":"Y","Ý":"Y","Ŷ":"Y","Ỹ":"Y","Ȳ":"Y","Ẏ":"Y","Ÿ":"Y","Ỷ":"Y","Ỵ":"Y","Ƴ":"Y","Ɏ":"Y","Ỿ":"Y","Ⓩ":"Z","Z":"Z","Ź":"Z","Ẑ":"Z","Ż":"Z","Ž":"Z","Ẓ":"Z","Ẕ":"Z","Ƶ":"Z","Ȥ":"Z","Ɀ":"Z","Ⱬ":"Z","Ꝣ":"Z","ⓐ":"a","a":"a","ẚ":"a","à":"a","á":"a","â":"a","ầ":"a","ấ":"a","ẫ":"a","ẩ":"a","ã":"a","ā":"a","ă":"a","ằ":"a","ắ":"a","ẵ":"a","ẳ":"a","ȧ":"a","ǡ":"a","ä":"a","ǟ":"a","ả":"a","å":"a","ǻ":"a","ǎ":"a","ȁ":"a","ȃ":"a","ạ":"a","ậ":"a","ặ":"a","ḁ":"a","ą":"a","ⱥ":"a","ɐ":"a","ꜳ":"aa","æ":"ae","ǽ":"ae","ǣ":"ae","ꜵ":"ao","ꜷ":"au","ꜹ":"av","ꜻ":"av","ꜽ":"ay","ⓑ":"b","b":"b","ḃ":"b","ḅ":"b","ḇ":"b","ƀ":"b","ƃ":"b","ɓ":"b","ⓒ":"c","c":"c","ć":"c","ĉ":"c","ċ":"c","č":"c","ç":"c","ḉ":"c","ƈ":"c","ȼ":"c","ꜿ":"c","ↄ":"c","ⓓ":"d","d":"d","ḋ":"d","ď":"d","ḍ":"d","ḑ":"d","ḓ":"d","ḏ":"d","đ":"d","ƌ":"d","ɖ":"d","ɗ":"d","ꝺ":"d","dz":"dz","dž":"dz","ⓔ":"e","e":"e","è":"e","é":"e","ê":"e","ề":"e","ế":"e","ễ":"e","ể":"e","ẽ":"e","ē":"e","ḕ":"e","ḗ":"e","ĕ":"e","ė":"e","ë":"e","ẻ":"e","ě":"e","ȅ":"e","ȇ":"e","ẹ":"e","ệ":"e","ȩ":"e","ḝ":"e","ę":"e","ḙ":"e","ḛ":"e","ɇ":"e","ɛ":"e","ǝ":"e","ⓕ":"f","f":"f","ḟ":"f","ƒ":"f","ꝼ":"f","ⓖ":"g","g":"g","ǵ":"g","ĝ":"g","ḡ":"g","ğ":"g","ġ":"g","ǧ":"g","ģ":"g","ǥ":"g","ɠ":"g","ꞡ":"g","ᵹ":"g","ꝿ":"g","ⓗ":"h","h":"h","ĥ":"h","ḣ":"h","ḧ":"h","ȟ":"h","ḥ":"h","ḩ":"h","ḫ":"h","ẖ":"h","ħ":"h","ⱨ":"h","ⱶ":"h","ɥ":"h","ƕ":"hv","ⓘ":"i","i":"i","ì":"i","í":"i","î":"i","ĩ":"i","ī":"i","ĭ":"i","ï":"i","ḯ":"i","ỉ":"i","ǐ":"i","ȉ":"i","ȋ":"i","ị":"i","į":"i","ḭ":"i","ɨ":"i","ı":"i","ⓙ":"j","j":"j","ĵ":"j","ǰ":"j","ɉ":"j","ⓚ":"k","k":"k","ḱ":"k","ǩ":"k","ḳ":"k","ķ":"k","ḵ":"k","ƙ":"k","ⱪ":"k","ꝁ":"k","ꝃ":"k","ꝅ":"k","ꞣ":"k","ⓛ":"l","l":"l","ŀ":"l","ĺ":"l","ľ":"l","ḷ":"l","ḹ":"l","ļ":"l","ḽ":"l","ḻ":"l","ſ":"l","ł":"l","ƚ":"l","ɫ":"l","ⱡ":"l","ꝉ":"l","ꞁ":"l","ꝇ":"l","lj":"lj","ⓜ":"m","m":"m","ḿ":"m","ṁ":"m","ṃ":"m","ɱ":"m","ɯ":"m","ⓝ":"n","n":"n","ǹ":"n","ń":"n","ñ":"n","ṅ":"n","ň":"n","ṇ":"n","ņ":"n","ṋ":"n","ṉ":"n","ƞ":"n","ɲ":"n","ʼn":"n","ꞑ":"n","ꞥ":"n","nj":"nj","ⓞ":"o","o":"o","ò":"o","ó":"o","ô":"o","ồ":"o","ố":"o","ỗ":"o","ổ":"o","õ":"o","ṍ":"o","ȭ":"o","ṏ":"o","ō":"o","ṑ":"o","ṓ":"o","ŏ":"o","ȯ":"o","ȱ":"o","ö":"o","ȫ":"o","ỏ":"o","ő":"o","ǒ":"o","ȍ":"o","ȏ":"o","ơ":"o","ờ":"o","ớ":"o","ỡ":"o","ở":"o","ợ":"o","ọ":"o","ộ":"o","ǫ":"o","ǭ":"o","ø":"o","ǿ":"o","ɔ":"o","ꝋ":"o","ꝍ":"o","ɵ":"o","œ":"oe","ƣ":"oi","ȣ":"ou","ꝏ":"oo","ⓟ":"p","p":"p","ṕ":"p","ṗ":"p","ƥ":"p","ᵽ":"p","ꝑ":"p","ꝓ":"p","ꝕ":"p","ⓠ":"q","q":"q","ɋ":"q","ꝗ":"q","ꝙ":"q","ⓡ":"r","r":"r","ŕ":"r","ṙ":"r","ř":"r","ȑ":"r","ȓ":"r","ṛ":"r","ṝ":"r","ŗ":"r","ṟ":"r","ɍ":"r","ɽ":"r","ꝛ":"r","ꞧ":"r","ꞃ":"r","ⓢ":"s","s":"s","ß":"s","ś":"s","ṥ":"s","ŝ":"s","ṡ":"s","š":"s","ṧ":"s","ṣ":"s","ṩ":"s","ș":"s","ş":"s","ȿ":"s","ꞩ":"s","ꞅ":"s","ẛ":"s","ⓣ":"t","t":"t","ṫ":"t","ẗ":"t","ť":"t","ṭ":"t","ț":"t","ţ":"t","ṱ":"t","ṯ":"t","ŧ":"t","ƭ":"t","ʈ":"t","ⱦ":"t","ꞇ":"t","ꜩ":"tz","ⓤ":"u","u":"u","ù":"u","ú":"u","û":"u","ũ":"u","ṹ":"u","ū":"u","ṻ":"u","ŭ":"u","ü":"u","ǜ":"u","ǘ":"u","ǖ":"u","ǚ":"u","ủ":"u","ů":"u","ű":"u","ǔ":"u","ȕ":"u","ȗ":"u","ư":"u","ừ":"u","ứ":"u","ữ":"u","ử":"u","ự":"u","ụ":"u","ṳ":"u","ų":"u","ṷ":"u","ṵ":"u","ʉ":"u","ⓥ":"v","v":"v","ṽ":"v","ṿ":"v","ʋ":"v","ꝟ":"v","ʌ":"v","ꝡ":"vy","ⓦ":"w","w":"w","ẁ":"w","ẃ":"w","ŵ":"w","ẇ":"w","ẅ":"w","ẘ":"w","ẉ":"w","ⱳ":"w","ⓧ":"x","x":"x","ẋ":"x","ẍ":"x","ⓨ":"y","y":"y","ỳ":"y","ý":"y","ŷ":"y","ỹ":"y","ȳ":"y","ẏ":"y","ÿ":"y","ỷ":"y","ẙ":"y","ỵ":"y","ƴ":"y","ɏ":"y","ỿ":"y","ⓩ":"z","z":"z","ź":"z","ẑ":"z","ż":"z","ž":"z","ẓ":"z","ẕ":"z","ƶ":"z","ȥ":"z","ɀ":"z","ⱬ":"z","ꝣ":"z","Ά":"Α","Έ":"Ε","Ή":"Η","Ί":"Ι","Ϊ":"Ι","Ό":"Ο","Ύ":"Υ","Ϋ":"Υ","Ώ":"Ω","ά":"α","έ":"ε","ή":"η","ί":"ι","ϊ":"ι","ΐ":"ι","ό":"ο","ύ":"υ","ϋ":"υ","ΰ":"υ","ώ":"ω","ς":"σ","’":"'"}}),e.define("select2/data/base",["../utils"],function(r){function n(e,t){n.__super__.constructor.call(this)}return r.Extend(n,r.Observable),n.prototype.current=function(e){throw new Error("The `current` method must be defined in child classes.")},n.prototype.query=function(e,t){throw new Error("The `query` method must be defined in child classes.")},n.prototype.bind=function(e,t){},n.prototype.destroy=function(){},n.prototype.generateResultId=function(e,t){var n=e.id+"-result-";return n+=r.generateChars(4),null!=t.id?n+="-"+t.id.toString():n+="-"+r.generateChars(4),n},n}),e.define("select2/data/select",["./base","../utils","jquery"],function(e,a,l){function n(e,t){this.$element=e,this.options=t,n.__super__.constructor.call(this)}return a.Extend(n,e),n.prototype.current=function(e){var n=[],r=this;this.$element.find(":selected").each(function(){var e=l(this),t=r.item(e);n.push(t)}),e(n)},n.prototype.select=function(i){var o=this;if(i.selected=!0,l(i.element).is("option"))return i.element.selected=!0,void this.$element.trigger("input").trigger("change");if(this.$element.prop("multiple"))this.current(function(e){var t=[];(i=[i]).push.apply(i,e);for(var n=0;n<i.length;n++){var r=i[n].id;-1===l.inArray(r,t)&&t.push(r)}o.$element.val(t),o.$element.trigger("input").trigger("change")});else{var e=i.id;this.$element.val(e),this.$element.trigger("input").trigger("change")}},n.prototype.unselect=function(i){var o=this;if(this.$element.prop("multiple")){if(i.selected=!1,l(i.element).is("option"))return i.element.selected=!1,void this.$element.trigger("input").trigger("change");this.current(function(e){for(var t=[],n=0;n<e.length;n++){var r=e[n].id;r!==i.id&&-1===l.inArray(r,t)&&t.push(r)}o.$element.val(t),o.$element.trigger("input").trigger("change")})}},n.prototype.bind=function(e,t){var n=this;(this.container=e).on("select",function(e){n.select(e.data)}),e.on("unselect",function(e){n.unselect(e.data)})},n.prototype.destroy=function(){this.$element.find("*").each(function(){a.RemoveData(this)})},n.prototype.query=function(r,e){var i=[],o=this;this.$element.children().each(function(){var e=l(this);if(e.is("option")||e.is("optgroup")){var t=o.item(e),n=o.matches(r,t);null!==n&&i.push(n)}}),e({results:i})},n.prototype.addOptions=function(e){a.appendMany(this.$element,e)},n.prototype.option=function(e){var t;e.children?(t=document.createElement("optgroup")).label=e.text:void 0!==(t=document.createElement("option")).textContent?t.textContent=e.text:t.innerText=e.text,void 0!==e.id&&(t.value=e.id),e.disabled&&(t.disabled=!0),e.selected&&(t.selected=!0),e.title&&(t.title=e.title);var n=l(t),r=this._normalizeItem(e);return r.element=t,a.StoreData(t,"data",r),n},n.prototype.item=function(e){var t={};if(null!=(t=a.GetData(e[0],"data")))return t;if(e.is("option"))t={id:e.val(),text:e.text(),disabled:e.prop("disabled"),selected:e.prop("selected"),title:e.prop("title")};else if(e.is("optgroup")){t={text:e.prop("label"),children:[],title:e.prop("title")};for(var n=e.children("option"),r=[],i=0;i<n.length;i++){var o=l(n[i]),s=this.item(o);r.push(s)}t.children=r}return(t=this._normalizeItem(t)).element=e[0],a.StoreData(e[0],"data",t),t},n.prototype._normalizeItem=function(e){e!==Object(e)&&(e={id:e,text:e});return null!=(e=l.extend({},{text:""},e)).id&&(e.id=e.id.toString()),null!=e.text&&(e.text=e.text.toString()),null==e._resultId&&e.id&&null!=this.container&&(e._resultId=this.generateResultId(this.container,e)),l.extend({},{selected:!1,disabled:!1},e)},n.prototype.matches=function(e,t){return this.options.get("matcher")(e,t)},n}),e.define("select2/data/array",["./select","../utils","jquery"],function(e,f,g){function r(e,t){this._dataToConvert=t.get("data")||[],r.__super__.constructor.call(this,e,t)}return f.Extend(r,e),r.prototype.bind=function(e,t){r.__super__.bind.call(this,e,t),this.addOptions(this.convertToOptions(this._dataToConvert))},r.prototype.select=function(n){var e=this.$element.find("option").filter(function(e,t){return t.value==n.id.toString()});0===e.length&&(e=this.option(n),this.addOptions(e)),r.__super__.select.call(this,n)},r.prototype.convertToOptions=function(e){var t=this,n=this.$element.find("option"),r=n.map(function(){return t.item(g(this)).id}).get(),i=[];function o(e){return function(){return g(this).val()==e.id}}for(var s=0;s<e.length;s++){var a=this._normalizeItem(e[s]);if(0<=g.inArray(a.id,r)){var l=n.filter(o(a)),c=this.item(l),u=g.extend(!0,{},a,c),d=this.option(u);l.replaceWith(d)}else{var p=this.option(a);if(a.children){var h=this.convertToOptions(a.children);f.appendMany(p,h)}i.push(p)}}return i},r}),e.define("select2/data/ajax",["./array","../utils","jquery"],function(e,t,o){function n(e,t){this.ajaxOptions=this._applyDefaults(t.get("ajax")),null!=this.ajaxOptions.processResults&&(this.processResults=this.ajaxOptions.processResults),n.__super__.constructor.call(this,e,t)}return t.Extend(n,e),n.prototype._applyDefaults=function(e){var t={data:function(e){return o.extend({},e,{q:e.term})},transport:function(e,t,n){var r=o.ajax(e);return r.then(t),r.fail(n),r}};return o.extend({},t,e,!0)},n.prototype.processResults=function(e){return e},n.prototype.query=function(n,r){var i=this;null!=this._request&&(o.isFunction(this._request.abort)&&this._request.abort(),this._request=null);var t=o.extend({type:"GET"},this.ajaxOptions);function e(){var e=t.transport(t,function(e){var t=i.processResults(e,n);i.options.get("debug")&&window.console&&console.error&&(t&&t.results&&o.isArray(t.results)||console.error("Select2: The AJAX results did not return an array in the `results` key of the response.")),r(t)},function(){"status"in e&&(0===e.status||"0"===e.status)||i.trigger("results:message",{message:"errorLoading"})});i._request=e}"function"==typeof t.url&&(t.url=t.url.call(this.$element,n)),"function"==typeof t.data&&(t.data=t.data.call(this.$element,n)),this.ajaxOptions.delay&&null!=n.term?(this._queryTimeout&&window.clearTimeout(this._queryTimeout),this._queryTimeout=window.setTimeout(e,this.ajaxOptions.delay)):e()},n}),e.define("select2/data/tags",["jquery"],function(u){function e(e,t,n){var r=n.get("tags"),i=n.get("createTag");void 0!==i&&(this.createTag=i);var o=n.get("insertTag");if(void 0!==o&&(this.insertTag=o),e.call(this,t,n),u.isArray(r))for(var s=0;s<r.length;s++){var a=r[s],l=this._normalizeItem(a),c=this.option(l);this.$element.append(c)}}return e.prototype.query=function(e,c,u){var d=this;this._removeOldTags(),null!=c.term&&null==c.page?e.call(this,c,function e(t,n){for(var r=t.results,i=0;i<r.length;i++){var o=r[i],s=null!=o.children&&!e({results:o.children},!0);if((o.text||"").toUpperCase()===(c.term||"").toUpperCase()||s)return!n&&(t.data=r,void u(t))}if(n)return!0;var a=d.createTag(c);if(null!=a){var l=d.option(a);l.attr("data-select2-tag",!0),d.addOptions([l]),d.insertTag(r,a)}t.results=r,u(t)}):e.call(this,c,u)},e.prototype.createTag=function(e,t){var n=u.trim(t.term);return""===n?null:{id:n,text:n}},e.prototype.insertTag=function(e,t,n){t.unshift(n)},e.prototype._removeOldTags=function(e){this.$element.find("option[data-select2-tag]").each(function(){this.selected||u(this).remove()})},e}),e.define("select2/data/tokenizer",["jquery"],function(d){function e(e,t,n){var r=n.get("tokenizer");void 0!==r&&(this.tokenizer=r),e.call(this,t,n)}return e.prototype.bind=function(e,t,n){e.call(this,t,n),this.$search=t.dropdown.$search||t.selection.$search||n.find(".select2-search__field")},e.prototype.query=function(e,t,n){var r=this;t.term=t.term||"";var i=this.tokenizer(t,this.options,function(e){var t=r._normalizeItem(e);if(!r.$element.find("option").filter(function(){return d(this).val()===t.id}).length){var n=r.option(t);n.attr("data-select2-tag",!0),r._removeOldTags(),r.addOptions([n])}!function(e){r.trigger("select",{data:e})}(t)});i.term!==t.term&&(this.$search.length&&(this.$search.val(i.term),this.$search.trigger("focus")),t.term=i.term),e.call(this,t,n)},e.prototype.tokenizer=function(e,t,n,r){for(var i=n.get("tokenSeparators")||[],o=t.term,s=0,a=this.createTag||function(e){return{id:e.term,text:e.term}};s<o.length;){var l=o[s];if(-1!==d.inArray(l,i)){var c=o.substr(0,s),u=a(d.extend({},t,{term:c}));null!=u?(r(u),o=o.substr(s+1)||"",s=0):s++}else s++}return{term:o}},e}),e.define("select2/data/minimumInputLength",[],function(){function e(e,t,n){this.minimumInputLength=n.get("minimumInputLength"),e.call(this,t,n)}return e.prototype.query=function(e,t,n){t.term=t.term||"",t.term.length<this.minimumInputLength?this.trigger("results:message",{message:"inputTooShort",args:{minimum:this.minimumInputLength,input:t.term,params:t}}):e.call(this,t,n)},e}),e.define("select2/data/maximumInputLength",[],function(){function e(e,t,n){this.maximumInputLength=n.get("maximumInputLength"),e.call(this,t,n)}return e.prototype.query=function(e,t,n){t.term=t.term||"",0<this.maximumInputLength&&t.term.length>this.maximumInputLength?this.trigger("results:message",{message:"inputTooLong",args:{maximum:this.maximumInputLength,input:t.term,params:t}}):e.call(this,t,n)},e}),e.define("select2/data/maximumSelectionLength",[],function(){function e(e,t,n){this.maximumSelectionLength=n.get("maximumSelectionLength"),e.call(this,t,n)}return e.prototype.bind=function(e,t,n){var r=this;e.call(this,t,n),t.on("select",function(){r._checkIfMaximumSelected()})},e.prototype.query=function(e,t,n){var r=this;this._checkIfMaximumSelected(function(){e.call(r,t,n)})},e.prototype._checkIfMaximumSelected=function(e,n){var r=this;this.current(function(e){var t=null!=e?e.length:0;0<r.maximumSelectionLength&&t>=r.maximumSelectionLength?r.trigger("results:message",{message:"maximumSelected",args:{maximum:r.maximumSelectionLength}}):n&&n()})},e}),e.define("select2/dropdown",["jquery","./utils"],function(t,e){function n(e,t){this.$element=e,this.options=t,n.__super__.constructor.call(this)}return e.Extend(n,e.Observable),n.prototype.render=function(){var e=t('<span class="select2-dropdown"><span class="select2-results"></span></span>');return e.attr("dir",this.options.get("dir")),this.$dropdown=e},n.prototype.bind=function(){},n.prototype.position=function(e,t){},n.prototype.destroy=function(){this.$dropdown.remove()},n}),e.define("select2/dropdown/search",["jquery","../utils"],function(o,e){function t(){}return t.prototype.render=function(e){var t=e.call(this),n=o('<span class="select2-search select2-search--dropdown"><input class="select2-search__field" type="search" tabindex="-1" autocomplete="off" autocorrect="off" autocapitalize="none" spellcheck="false" role="searchbox" aria-autocomplete="list" /></span>');return this.$searchContainer=n,this.$search=n.find("input"),t.prepend(n),t},t.prototype.bind=function(e,t,n){var r=this,i=t.id+"-results";e.call(this,t,n),this.$search.on("keydown",function(e){r.trigger("keypress",e),r._keyUpPrevented=e.isDefaultPrevented()}),this.$search.on("input",function(e){o(this).off("keyup")}),this.$search.on("keyup input",function(e){r.handleSearch(e)}),t.on("open",function(){r.$search.attr("tabindex",0),r.$search.attr("aria-controls",i),r.$search.trigger("focus"),window.setTimeout(function(){r.$search.trigger("focus")},0)}),t.on("close",function(){r.$search.attr("tabindex",-1),r.$search.removeAttr("aria-controls"),r.$search.removeAttr("aria-activedescendant"),r.$search.val(""),r.$search.trigger("blur")}),t.on("focus",function(){t.isOpen()||r.$search.trigger("focus")}),t.on("results:all",function(e){null!=e.query.term&&""!==e.query.term||(r.showSearch(e)?r.$searchContainer.removeClass("select2-search--hide"):r.$searchContainer.addClass("select2-search--hide"))}),t.on("results:focus",function(e){e.data._resultId?r.$search.attr("aria-activedescendant",e.data._resultId):r.$search.removeAttr("aria-activedescendant")})},t.prototype.handleSearch=function(e){if(!this._keyUpPrevented){var t=this.$search.val();this.trigger("query",{term:t})}this._keyUpPrevented=!1},t.prototype.showSearch=function(e,t){return!0},t}),e.define("select2/dropdown/hidePlaceholder",[],function(){function e(e,t,n,r){this.placeholder=this.normalizePlaceholder(n.get("placeholder")),e.call(this,t,n,r)}return e.prototype.append=function(e,t){t.results=this.removePlaceholder(t.results),e.call(this,t)},e.prototype.normalizePlaceholder=function(e,t){return"string"==typeof t&&(t={id:"",text:t}),t},e.prototype.removePlaceholder=function(e,t){for(var n=t.slice(0),r=t.length-1;0<=r;r--){var i=t[r];this.placeholder.id===i.id&&n.splice(r,1)}return n},e}),e.define("select2/dropdown/infiniteScroll",["jquery"],function(n){function e(e,t,n,r){this.lastParams={},e.call(this,t,n,r),this.$loadingMore=this.createLoadingMore(),this.loading=!1}return e.prototype.append=function(e,t){this.$loadingMore.remove(),this.loading=!1,e.call(this,t),this.showLoadingMore(t)&&(this.$results.append(this.$loadingMore),this.loadMoreIfNeeded())},e.prototype.bind=function(e,t,n){var r=this;e.call(this,t,n),t.on("query",function(e){r.lastParams=e,r.loading=!0}),t.on("query:append",function(e){r.lastParams=e,r.loading=!0}),this.$results.on("scroll",this.loadMoreIfNeeded.bind(this))},e.prototype.loadMoreIfNeeded=function(){var e=n.contains(document.documentElement,this.$loadingMore[0]);if(!this.loading&&e){var t=this.$results.offset().top+this.$results.outerHeight(!1);this.$loadingMore.offset().top+this.$loadingMore.outerHeight(!1)<=t+50&&this.loadMore()}},e.prototype.loadMore=function(){this.loading=!0;var e=n.extend({},{page:1},this.lastParams);e.page++,this.trigger("query:append",e)},e.prototype.showLoadingMore=function(e,t){return t.pagination&&t.pagination.more},e.prototype.createLoadingMore=function(){var e=n('<li class="select2-results__option select2-results__option--load-more"role="option" aria-disabled="true"></li>'),t=this.options.get("translations").get("loadingMore");return e.html(t(this.lastParams)),e},e}),e.define("select2/dropdown/attachBody",["jquery","../utils"],function(f,a){function e(e,t,n){this.$dropdownParent=f(n.get("dropdownParent")||document.body),e.call(this,t,n)}return e.prototype.bind=function(e,t,n){var r=this;e.call(this,t,n),t.on("open",function(){r._showDropdown(),r._attachPositioningHandler(t),r._bindContainerResultHandlers(t)}),t.on("close",function(){r._hideDropdown(),r._detachPositioningHandler(t)}),this.$dropdownContainer.on("mousedown",function(e){e.stopPropagation()})},e.prototype.destroy=function(e){e.call(this),this.$dropdownContainer.remove()},e.prototype.position=function(e,t,n){t.attr("class",n.attr("class")),t.removeClass("select2"),t.addClass("select2-container--open"),t.css({position:"absolute",top:-999999}),this.$container=n},e.prototype.render=function(e){var t=f("<span></span>"),n=e.call(this);return t.append(n),this.$dropdownContainer=t},e.prototype._hideDropdown=function(e){this.$dropdownContainer.detach()},e.prototype._bindContainerResultHandlers=function(e,t){if(!this._containerResultsHandlersBound){var n=this;t.on("results:all",function(){n._positionDropdown(),n._resizeDropdown()}),t.on("results:append",function(){n._positionDropdown(),n._resizeDropdown()}),t.on("results:message",function(){n._positionDropdown(),n._resizeDropdown()}),t.on("select",function(){n._positionDropdown(),n._resizeDropdown()}),t.on("unselect",function(){n._positionDropdown(),n._resizeDropdown()}),this._containerResultsHandlersBound=!0}},e.prototype._attachPositioningHandler=function(e,t){var n=this,r="scroll.select2."+t.id,i="resize.select2."+t.id,o="orientationchange.select2."+t.id,s=this.$container.parents().filter(a.hasScroll);s.each(function(){a.StoreData(this,"select2-scroll-position",{x:f(this).scrollLeft(),y:f(this).scrollTop()})}),s.on(r,function(e){var t=a.GetData(this,"select2-scroll-position");f(this).scrollTop(t.y)}),f(window).on(r+" "+i+" "+o,function(e){n._positionDropdown(),n._resizeDropdown()})},e.prototype._detachPositioningHandler=function(e,t){var n="scroll.select2."+t.id,r="resize.select2."+t.id,i="orientationchange.select2."+t.id;this.$container.parents().filter(a.hasScroll).off(n),f(window).off(n+" "+r+" "+i)},e.prototype._positionDropdown=function(){var e=f(window),t=this.$dropdown.hasClass("select2-dropdown--above"),n=this.$dropdown.hasClass("select2-dropdown--below"),r=null,i=this.$container.offset();i.bottom=i.top+this.$container.outerHeight(!1);var o={height:this.$container.outerHeight(!1)};o.top=i.top,o.bottom=i.top+o.height;var s=this.$dropdown.outerHeight(!1),a=e.scrollTop(),l=e.scrollTop()+e.height(),c=a<i.top-s,u=l>i.bottom+s,d={left:i.left,top:o.bottom},p=this.$dropdownParent;"static"===p.css("position")&&(p=p.offsetParent());var h={top:0,left:0};(f.contains(document.body,p[0])||p[0].isConnected)&&(h=p.offset()),d.top-=h.top,d.left-=h.left,t||n||(r="below"),u||!c||t?!c&&u&&t&&(r="below"):r="above",("above"==r||t&&"below"!==r)&&(d.top=o.top-h.top-s),null!=r&&(this.$dropdown.removeClass("select2-dropdown--below select2-dropdown--above").addClass("select2-dropdown--"+r),this.$container.removeClass("select2-container--below select2-container--above").addClass("select2-container--"+r)),this.$dropdownContainer.css(d)},e.prototype._resizeDropdown=function(){var e={width:this.$container.outerWidth(!1)+"px"};this.options.get("dropdownAutoWidth")&&(e.minWidth=e.width,e.position="relative",e.width="auto"),this.$dropdown.css(e)},e.prototype._showDropdown=function(e){this.$dropdownContainer.appendTo(this.$dropdownParent),this._positionDropdown(),this._resizeDropdown()},e}),e.define("select2/dropdown/minimumResultsForSearch",[],function(){function e(e,t,n,r){this.minimumResultsForSearch=n.get("minimumResultsForSearch"),this.minimumResultsForSearch<0&&(this.minimumResultsForSearch=1/0),e.call(this,t,n,r)}return e.prototype.showSearch=function(e,t){return!(function e(t){for(var n=0,r=0;r<t.length;r++){var i=t[r];i.children?n+=e(i.children):n++}return n}(t.data.results)<this.minimumResultsForSearch)&&e.call(this,t)},e}),e.define("select2/dropdown/selectOnClose",["../utils"],function(o){function e(){}return e.prototype.bind=function(e,t,n){var r=this;e.call(this,t,n),t.on("close",function(e){r._handleSelectOnClose(e)})},e.prototype._handleSelectOnClose=function(e,t){if(t&&null!=t.originalSelect2Event){var n=t.originalSelect2Event;if("select"===n._type||"unselect"===n._type)return}var r=this.getHighlightedResults();if(!(r.length<1)){var i=o.GetData(r[0],"data");null!=i.element&&i.element.selected||null==i.element&&i.selected||this.trigger("select",{data:i})}},e}),e.define("select2/dropdown/closeOnSelect",[],function(){function e(){}return e.prototype.bind=function(e,t,n){var r=this;e.call(this,t,n),t.on("select",function(e){r._selectTriggered(e)}),t.on("unselect",function(e){r._selectTriggered(e)})},e.prototype._selectTriggered=function(e,t){var n=t.originalEvent;n&&(n.ctrlKey||n.metaKey)||this.trigger("close",{originalEvent:n,originalSelect2Event:t})},e}),e.define("select2/i18n/en",[],function(){return{errorLoading:function(){return"The results could not be loaded."},inputTooLong:function(e){var t=e.input.length-e.maximum,n="Please delete "+t+" character";return 1!=t&&(n+="s"),n},inputTooShort:function(e){return"Please enter "+(e.minimum-e.input.length)+" or more characters"},loadingMore:function(){return"Loading more results…"},maximumSelected:function(e){var t="You can only select "+e.maximum+" item";return 1!=e.maximum&&(t+="s"),t},noResults:function(){return"No results found"},searching:function(){return"Searching…"},removeAllItems:function(){return"Remove all items"}}}),e.define("select2/defaults",["jquery","require","./results","./selection/single","./selection/multiple","./selection/placeholder","./selection/allowClear","./selection/search","./selection/eventRelay","./utils","./translation","./diacritics","./data/select","./data/array","./data/ajax","./data/tags","./data/tokenizer","./data/minimumInputLength","./data/maximumInputLength","./data/maximumSelectionLength","./dropdown","./dropdown/search","./dropdown/hidePlaceholder","./dropdown/infiniteScroll","./dropdown/attachBody","./dropdown/minimumResultsForSearch","./dropdown/selectOnClose","./dropdown/closeOnSelect","./i18n/en"],function(c,u,d,p,h,f,g,m,v,y,s,t,_,$,b,w,A,x,D,S,E,C,O,T,q,L,I,j,e){function n(){this.reset()}return n.prototype.apply=function(e){if(null==(e=c.extend(!0,{},this.defaults,e)).dataAdapter){if(null!=e.ajax?e.dataAdapter=b:null!=e.data?e.dataAdapter=$:e.dataAdapter=_,0<e.minimumInputLength&&(e.dataAdapter=y.Decorate(e.dataAdapter,x)),0<e.maximumInputLength&&(e.dataAdapter=y.Decorate(e.dataAdapter,D)),0<e.maximumSelectionLength&&(e.dataAdapter=y.Decorate(e.dataAdapter,S)),e.tags&&(e.dataAdapter=y.Decorate(e.dataAdapter,w)),null==e.tokenSeparators&&null==e.tokenizer||(e.dataAdapter=y.Decorate(e.dataAdapter,A)),null!=e.query){var t=u(e.amdBase+"compat/query");e.dataAdapter=y.Decorate(e.dataAdapter,t)}if(null!=e.initSelection){var n=u(e.amdBase+"compat/initSelection");e.dataAdapter=y.Decorate(e.dataAdapter,n)}}if(null==e.resultsAdapter&&(e.resultsAdapter=d,null!=e.ajax&&(e.resultsAdapter=y.Decorate(e.resultsAdapter,T)),null!=e.placeholder&&(e.resultsAdapter=y.Decorate(e.resultsAdapter,O)),e.selectOnClose&&(e.resultsAdapter=y.Decorate(e.resultsAdapter,I))),null==e.dropdownAdapter){if(e.multiple)e.dropdownAdapter=E;else{var r=y.Decorate(E,C);e.dropdownAdapter=r}if(0!==e.minimumResultsForSearch&&(e.dropdownAdapter=y.Decorate(e.dropdownAdapter,L)),e.closeOnSelect&&(e.dropdownAdapter=y.Decorate(e.dropdownAdapter,j)),null!=e.dropdownCssClass||null!=e.dropdownCss||null!=e.adaptDropdownCssClass){var i=u(e.amdBase+"compat/dropdownCss");e.dropdownAdapter=y.Decorate(e.dropdownAdapter,i)}e.dropdownAdapter=y.Decorate(e.dropdownAdapter,q)}if(null==e.selectionAdapter){if(e.multiple?e.selectionAdapter=h:e.selectionAdapter=p,null!=e.placeholder&&(e.selectionAdapter=y.Decorate(e.selectionAdapter,f)),e.allowClear&&(e.selectionAdapter=y.Decorate(e.selectionAdapter,g)),e.multiple&&(e.selectionAdapter=y.Decorate(e.selectionAdapter,m)),null!=e.containerCssClass||null!=e.containerCss||null!=e.adaptContainerCssClass){var o=u(e.amdBase+"compat/containerCss");e.selectionAdapter=y.Decorate(e.selectionAdapter,o)}e.selectionAdapter=y.Decorate(e.selectionAdapter,v)}e.language=this._resolveLanguage(e.language),e.language.push("en");for(var s=[],a=0;a<e.language.length;a++){var l=e.language[a];-1===s.indexOf(l)&&s.push(l)}return e.language=s,e.translations=this._processTranslations(e.language,e.debug),e},n.prototype.reset=function(){function a(e){return e.replace(/[^\u0000-\u007E]/g,function(e){return t[e]||e})}this.defaults={amdBase:"./",amdLanguageBase:"./i18n/",closeOnSelect:!0,debug:!1,dropdownAutoWidth:!1,escapeMarkup:y.escapeMarkup,language:{},matcher:function e(t,n){if(""===c.trim(t.term))return n;if(n.children&&0<n.children.length){for(var r=c.extend(!0,{},n),i=n.children.length-1;0<=i;i--)null==e(t,n.children[i])&&r.children.splice(i,1);return 0<r.children.length?r:e(t,r)}var o=a(n.text).toUpperCase(),s=a(t.term).toUpperCase();return-1<o.indexOf(s)?n:null},minimumInputLength:0,maximumInputLength:0,maximumSelectionLength:0,minimumResultsForSearch:0,selectOnClose:!1,scrollAfterSelect:!1,sorter:function(e){return e},templateResult:function(e){return e.text},templateSelection:function(e){return e.text},theme:"default",width:"resolve"}},n.prototype.applyFromElement=function(e,t){var n=e.language,r=this.defaults.language,i=t.prop("lang"),o=t.closest("[lang]").prop("lang"),s=Array.prototype.concat.call(this._resolveLanguage(i),this._resolveLanguage(n),this._resolveLanguage(r),this._resolveLanguage(o));return e.language=s,e},n.prototype._resolveLanguage=function(e){if(!e)return[];if(c.isEmptyObject(e))return[];if(c.isPlainObject(e))return[e];var t;t=c.isArray(e)?e:[e];for(var n=[],r=0;r<t.length;r++)if(n.push(t[r]),"string"==typeof t[r]&&0<t[r].indexOf("-")){var i=t[r].split("-")[0];n.push(i)}return n},n.prototype._processTranslations=function(e,t){for(var n=new s,r=0;r<e.length;r++){var i=new s,o=e[r];if("string"==typeof o)try{i=s.loadPath(o)}catch(e){try{o=this.defaults.amdLanguageBase+o,i=s.loadPath(o)}catch(e){t&&window.console&&console.warn&&console.warn('Select2: The language file for "'+o+'" could not be automatically loaded. A fallback will be used instead.')}}else i=c.isPlainObject(o)?new s(o):o;n.extend(i)}return n},n.prototype.set=function(e,t){var n={};n[c.camelCase(e)]=t;var r=y._convertData(n);c.extend(!0,this.defaults,r)},new n}),e.define("select2/options",["require","jquery","./defaults","./utils"],function(r,d,i,p){function e(e,t){if(this.options=e,null!=t&&this.fromElement(t),null!=t&&(this.options=i.applyFromElement(this.options,t)),this.options=i.apply(this.options),t&&t.is("input")){var n=r(this.get("amdBase")+"compat/inputData");this.options.dataAdapter=p.Decorate(this.options.dataAdapter,n)}}return e.prototype.fromElement=function(e){var t=["select2"];null==this.options.multiple&&(this.options.multiple=e.prop("multiple")),null==this.options.disabled&&(this.options.disabled=e.prop("disabled")),null==this.options.dir&&(e.prop("dir")?this.options.dir=e.prop("dir"):e.closest("[dir]").prop("dir")?this.options.dir=e.closest("[dir]").prop("dir"):this.options.dir="ltr"),e.prop("disabled",this.options.disabled),e.prop("multiple",this.options.multiple),p.GetData(e[0],"select2Tags")&&(this.options.debug&&window.console&&console.warn&&console.warn('Select2: The `data-select2-tags` attribute has been changed to use the `data-data` and `data-tags="true"` attributes and will be removed in future versions of Select2.'),p.StoreData(e[0],"data",p.GetData(e[0],"select2Tags")),p.StoreData(e[0],"tags",!0)),p.GetData(e[0],"ajaxUrl")&&(this.options.debug&&window.console&&console.warn&&console.warn("Select2: The `data-ajax-url` attribute has been changed to `data-ajax--url` and support for the old attribute will be removed in future versions of Select2."),e.attr("ajax--url",p.GetData(e[0],"ajaxUrl")),p.StoreData(e[0],"ajax-Url",p.GetData(e[0],"ajaxUrl")));var n={};function r(e,t){return t.toUpperCase()}for(var i=0;i<e[0].attributes.length;i++){var o=e[0].attributes[i].name,s="data-";if(o.substr(0,s.length)==s){var a=o.substring(s.length),l=p.GetData(e[0],a);n[a.replace(/-([a-z])/g,r)]=l}}d.fn.jquery&&"1."==d.fn.jquery.substr(0,2)&&e[0].dataset&&(n=d.extend(!0,{},e[0].dataset,n));var c=d.extend(!0,{},p.GetData(e[0]),n);for(var u in c=p._convertData(c))-1<d.inArray(u,t)||(d.isPlainObject(this.options[u])?d.extend(this.options[u],c[u]):this.options[u]=c[u]);return this},e.prototype.get=function(e){return this.options[e]},e.prototype.set=function(e,t){this.options[e]=t},e}),e.define("select2/core",["jquery","./options","./utils","./keys"],function(o,c,u,r){var d=function(e,t){null!=u.GetData(e[0],"select2")&&u.GetData(e[0],"select2").destroy(),this.$element=e,this.id=this._generateId(e),t=t||{},this.options=new c(t,e),d.__super__.constructor.call(this);var n=e.attr("tabindex")||0;u.StoreData(e[0],"old-tabindex",n),e.attr("tabindex","-1");var r=this.options.get("dataAdapter");this.dataAdapter=new r(e,this.options);var i=this.render();this._placeContainer(i);var o=this.options.get("selectionAdapter");this.selection=new o(e,this.options),this.$selection=this.selection.render(),this.selection.position(this.$selection,i);var s=this.options.get("dropdownAdapter");this.dropdown=new s(e,this.options),this.$dropdown=this.dropdown.render(),this.dropdown.position(this.$dropdown,i);var a=this.options.get("resultsAdapter");this.results=new a(e,this.options,this.dataAdapter),this.$results=this.results.render(),this.results.position(this.$results,this.$dropdown);var l=this;this._bindAdapters(),this._registerDomEvents(),this._registerDataEvents(),this._registerSelectionEvents(),this._registerDropdownEvents(),this._registerResultsEvents(),this._registerEvents(),this.dataAdapter.current(function(e){l.trigger("selection:update",{data:e})}),e.addClass("select2-hidden-accessible"),e.attr("aria-hidden","true"),this._syncAttributes(),u.StoreData(e[0],"select2",this),e.data("select2",this)};return u.Extend(d,u.Observable),d.prototype._generateId=function(e){return"select2-"+(null!=e.attr("id")?e.attr("id"):null!=e.attr("name")?e.attr("name")+"-"+u.generateChars(2):u.generateChars(4)).replace(/(:|\.|\[|\]|,)/g,"")},d.prototype._placeContainer=function(e){e.insertAfter(this.$element);var t=this._resolveWidth(this.$element,this.options.get("width"));null!=t&&e.css("width",t)},d.prototype._resolveWidth=function(e,t){var n=/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i;if("resolve"==t){var r=this._resolveWidth(e,"style");return null!=r?r:this._resolveWidth(e,"element")}if("element"==t){var i=e.outerWidth(!1);return i<=0?"auto":i+"px"}if("style"!=t)return"computedstyle"!=t?t:window.getComputedStyle(e[0]).width;var o=e.attr("style");if("string"!=typeof o)return null;for(var s=o.split(";"),a=0,l=s.length;a<l;a+=1){var c=s[a].replace(/\s/g,"").match(n);if(null!==c&&1<=c.length)return c[1]}return null},d.prototype._bindAdapters=function(){this.dataAdapter.bind(this,this.$container),this.selection.bind(this,this.$container),this.dropdown.bind(this,this.$container),this.results.bind(this,this.$container)},d.prototype._registerDomEvents=function(){var t=this;this.$element.on("change.select2",function(){t.dataAdapter.current(function(e){t.trigger("selection:update",{data:e})})}),this.$element.on("focus.select2",function(e){t.trigger("focus",e)}),this._syncA=u.bind(this._syncAttributes,this),this._syncS=u.bind(this._syncSubtree,this),this.$element[0].attachEvent&&this.$element[0].attachEvent("onpropertychange",this._syncA);var e=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver;null!=e?(this._observer=new e(function(e){t._syncA(),t._syncS(null,e)}),this._observer.observe(this.$element[0],{attributes:!0,childList:!0,subtree:!1})):this.$element[0].addEventListener&&(this.$element[0].addEventListener("DOMAttrModified",t._syncA,!1),this.$element[0].addEventListener("DOMNodeInserted",t._syncS,!1),this.$element[0].addEventListener("DOMNodeRemoved",t._syncS,!1))},d.prototype._registerDataEvents=function(){var n=this;this.dataAdapter.on("*",function(e,t){n.trigger(e,t)})},d.prototype._registerSelectionEvents=function(){var n=this,r=["toggle","focus"];this.selection.on("toggle",function(){n.toggleDropdown()}),this.selection.on("focus",function(e){n.focus(e)}),this.selection.on("*",function(e,t){-1===o.inArray(e,r)&&n.trigger(e,t)})},d.prototype._registerDropdownEvents=function(){var n=this;this.dropdown.on("*",function(e,t){n.trigger(e,t)})},d.prototype._registerResultsEvents=function(){var n=this;this.results.on("*",function(e,t){n.trigger(e,t)})},d.prototype._registerEvents=function(){var n=this;this.on("open",function(){n.$container.addClass("select2-container--open")}),this.on("close",function(){n.$container.removeClass("select2-container--open")}),this.on("enable",function(){n.$container.removeClass("select2-container--disabled")}),this.on("disable",function(){n.$container.addClass("select2-container--disabled")}),this.on("blur",function(){n.$container.removeClass("select2-container--focus")}),this.on("query",function(t){n.isOpen()||n.trigger("open",{}),this.dataAdapter.query(t,function(e){n.trigger("results:all",{data:e,query:t})})}),this.on("query:append",function(t){this.dataAdapter.query(t,function(e){n.trigger("results:append",{data:e,query:t})})}),this.on("keypress",function(e){var t=e.which;n.isOpen()?t===r.ESC||t===r.TAB||t===r.UP&&e.altKey?(n.close(e),e.preventDefault()):t===r.ENTER?(n.trigger("results:select",{}),e.preventDefault()):t===r.SPACE&&e.ctrlKey?(n.trigger("results:toggle",{}),e.preventDefault()):t===r.UP?(n.trigger("results:previous",{}),e.preventDefault()):t===r.DOWN&&(n.trigger("results:next",{}),e.preventDefault()):(t===r.ENTER||t===r.SPACE||t===r.DOWN&&e.altKey)&&(n.open(),e.preventDefault())})},d.prototype._syncAttributes=function(){this.options.set("disabled",this.$element.prop("disabled")),this.isDisabled()?(this.isOpen()&&this.close(),this.trigger("disable",{})):this.trigger("enable",{})},d.prototype._isChangeMutation=function(e,t){var n=!1,r=this;if(!e||!e.target||"OPTION"===e.target.nodeName||"OPTGROUP"===e.target.nodeName){if(t)if(t.addedNodes&&0<t.addedNodes.length)for(var i=0;i<t.addedNodes.length;i++){t.addedNodes[i].selected&&(n=!0)}else t.removedNodes&&0<t.removedNodes.length?n=!0:o.isArray(t)&&o.each(t,function(e,t){if(r._isChangeMutation(e,t))return!(n=!0)});else n=!0;return n}},d.prototype._syncSubtree=function(e,t){var n=this._isChangeMutation(e,t),r=this;n&&this.dataAdapter.current(function(e){r.trigger("selection:update",{data:e})})},d.prototype.trigger=function(e,t){var n=d.__super__.trigger,r={open:"opening",close:"closing",select:"selecting",unselect:"unselecting",clear:"clearing"};if(void 0===t&&(t={}),e in r){var i=r[e],o={prevented:!1,name:e,args:t};if(n.call(this,i,o),o.prevented)return void(t.prevented=!0)}n.call(this,e,t)},d.prototype.toggleDropdown=function(){this.isDisabled()||(this.isOpen()?this.close():this.open())},d.prototype.open=function(){this.isOpen()||this.isDisabled()||this.trigger("query",{})},d.prototype.close=function(e){this.isOpen()&&this.trigger("close",{originalEvent:e})},d.prototype.isEnabled=function(){return!this.isDisabled()},d.prototype.isDisabled=function(){return this.options.get("disabled")},d.prototype.isOpen=function(){return this.$container.hasClass("select2-container--open")},d.prototype.hasFocus=function(){return this.$container.hasClass("select2-container--focus")},d.prototype.focus=function(e){this.hasFocus()||(this.$container.addClass("select2-container--focus"),this.trigger("focus",{}))},d.prototype.enable=function(e){this.options.get("debug")&&window.console&&console.warn&&console.warn('Select2: The `select2("enable")` method has been deprecated and will be removed in later Select2 versions. Use $element.prop("disabled") instead.'),null!=e&&0!==e.length||(e=[!0]);var t=!e[0];this.$element.prop("disabled",t)},d.prototype.data=function(){this.options.get("debug")&&0<arguments.length&&window.console&&console.warn&&console.warn('Select2: Data can no longer be set using `select2("data")`. You should consider setting the value instead using `$element.val()`.');var t=[];return this.dataAdapter.current(function(e){t=e}),t},d.prototype.val=function(e){if(this.options.get("debug")&&window.console&&console.warn&&console.warn('Select2: The `select2("val")` method has been deprecated and will be removed in later Select2 versions. Use $element.val() instead.'),null==e||0===e.length)return this.$element.val();var t=e[0];o.isArray(t)&&(t=o.map(t,function(e){return e.toString()})),this.$element.val(t).trigger("input").trigger("change")},d.prototype.destroy=function(){this.$container.remove(),this.$element[0].detachEvent&&this.$element[0].detachEvent("onpropertychange",this._syncA),null!=this._observer?(this._observer.disconnect(),this._observer=null):this.$element[0].removeEventListener&&(this.$element[0].removeEventListener("DOMAttrModified",this._syncA,!1),this.$element[0].removeEventListener("DOMNodeInserted",this._syncS,!1),this.$element[0].removeEventListener("DOMNodeRemoved",this._syncS,!1)),this._syncA=null,this._syncS=null,this.$element.off(".select2"),this.$element.attr("tabindex",u.GetData(this.$element[0],"old-tabindex")),this.$element.removeClass("select2-hidden-accessible"),this.$element.attr("aria-hidden","false"),u.RemoveData(this.$element[0]),this.$element.removeData("select2"),this.dataAdapter.destroy(),this.selection.destroy(),this.dropdown.destroy(),this.results.destroy(),this.dataAdapter=null,this.selection=null,this.dropdown=null,this.results=null},d.prototype.render=function(){var e=o('<span class="select2 select2-container"><span class="selection"></span><span class="dropdown-wrapper" aria-hidden="true"></span></span>');return e.attr("dir",this.options.get("dir")),this.$container=e,this.$container.addClass("select2-container--"+this.options.get("theme")),u.StoreData(e[0],"element",this.$element),e},d}),e.define("jquery-mousewheel",["jquery"],function(e){return e}),e.define("jquery.select2",["jquery","jquery-mousewheel","./select2/core","./select2/defaults","./select2/utils"],function(i,e,o,t,s){if(null==i.fn.select2){var a=["open","close","destroy"];i.fn.select2=function(t){if("object"==typeof(t=t||{}))return this.each(function(){var e=i.extend(!0,{},t);new o(i(this),e)}),this;if("string"!=typeof t)throw new Error("Invalid arguments for Select2: "+t);var n,r=Array.prototype.slice.call(arguments,1);return this.each(function(){var e=s.GetData(this,"select2");null==e&&window.console&&console.error&&console.error("The select2('"+t+"') method was called on an element that is not using Select2."),n=e[t].apply(e,r)}),-1<i.inArray(t,a)?this:n}}return null==i.fn.select2.defaults&&(i.fn.select2.defaults=t),o}),{define:e.define,require:e.require}}(),t=e.require("jquery.select2");return u.fn.select2.amd=e,t});
|
vendor/select2/select2-spinner.gif
DELETED
Binary file
|
vendor/select2/select2.css
DELETED
@@ -1,692 +0,0 @@
|
|
1 |
-
/*
|
2 |
-
Version: 3.5.4 Timestamp: Sun Aug 30 13:30:32 EDT 2015
|
3 |
-
*/
|
4 |
-
.select2-container {
|
5 |
-
margin: 0;
|
6 |
-
position: relative;
|
7 |
-
display: inline-block;
|
8 |
-
vertical-align: middle;
|
9 |
-
}
|
10 |
-
|
11 |
-
.select2-container,
|
12 |
-
.select2-drop,
|
13 |
-
.select2-search,
|
14 |
-
.select2-search input {
|
15 |
-
/*
|
16 |
-
Force border-box so that % widths fit the parent
|
17 |
-
container without overlap because of margin/padding.
|
18 |
-
More Info : http://www.quirksmode.org/css/box.html
|
19 |
-
*/
|
20 |
-
-webkit-box-sizing: border-box; /* webkit */
|
21 |
-
-moz-box-sizing: border-box; /* firefox */
|
22 |
-
box-sizing: border-box; /* css3 */
|
23 |
-
}
|
24 |
-
|
25 |
-
.select2-container .select2-choice {
|
26 |
-
display: block;
|
27 |
-
height: 26px;
|
28 |
-
padding: 0 0 0 8px;
|
29 |
-
overflow: hidden;
|
30 |
-
position: relative;
|
31 |
-
|
32 |
-
border: 1px solid #aaa;
|
33 |
-
white-space: nowrap;
|
34 |
-
line-height: 26px;
|
35 |
-
color: #444;
|
36 |
-
text-decoration: none;
|
37 |
-
|
38 |
-
border-radius: 4px;
|
39 |
-
|
40 |
-
background-clip: padding-box;
|
41 |
-
|
42 |
-
-webkit-touch-callout: none;
|
43 |
-
-webkit-user-select: none;
|
44 |
-
-moz-user-select: none;
|
45 |
-
-ms-user-select: none;
|
46 |
-
user-select: none;
|
47 |
-
|
48 |
-
background-color: #fff;
|
49 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
50 |
-
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
51 |
-
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
52 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
53 |
-
background-image: linear-gradient(to top, #eee 0%, #fff 50%);
|
54 |
-
}
|
55 |
-
|
56 |
-
html[dir="rtl"] .select2-container .select2-choice {
|
57 |
-
padding: 0 8px 0 0;
|
58 |
-
}
|
59 |
-
|
60 |
-
.select2-container.select2-drop-above .select2-choice {
|
61 |
-
border-bottom-color: #aaa;
|
62 |
-
|
63 |
-
border-radius: 0 0 4px 4px;
|
64 |
-
|
65 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
|
66 |
-
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
67 |
-
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
68 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
69 |
-
background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
|
70 |
-
}
|
71 |
-
|
72 |
-
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
73 |
-
margin-right: 42px;
|
74 |
-
}
|
75 |
-
|
76 |
-
.select2-container .select2-choice > .select2-chosen {
|
77 |
-
margin-right: 26px;
|
78 |
-
display: block;
|
79 |
-
overflow: hidden;
|
80 |
-
|
81 |
-
white-space: nowrap;
|
82 |
-
|
83 |
-
text-overflow: ellipsis;
|
84 |
-
float: none;
|
85 |
-
width: auto;
|
86 |
-
}
|
87 |
-
|
88 |
-
html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
|
89 |
-
margin-left: 26px;
|
90 |
-
margin-right: 0;
|
91 |
-
}
|
92 |
-
|
93 |
-
.select2-container .select2-choice abbr {
|
94 |
-
display: none;
|
95 |
-
width: 12px;
|
96 |
-
height: 12px;
|
97 |
-
position: absolute;
|
98 |
-
right: 24px;
|
99 |
-
top: 8px;
|
100 |
-
|
101 |
-
font-size: 1px;
|
102 |
-
text-decoration: none;
|
103 |
-
|
104 |
-
border: 0;
|
105 |
-
background: url('select2.png') right top no-repeat;
|
106 |
-
cursor: pointer;
|
107 |
-
outline: 0;
|
108 |
-
}
|
109 |
-
|
110 |
-
.select2-container.select2-allowclear .select2-choice abbr {
|
111 |
-
display: inline-block;
|
112 |
-
}
|
113 |
-
|
114 |
-
.select2-container .select2-choice abbr:hover {
|
115 |
-
background-position: right -11px;
|
116 |
-
cursor: pointer;
|
117 |
-
}
|
118 |
-
|
119 |
-
.select2-drop-mask {
|
120 |
-
border: 0;
|
121 |
-
margin: 0;
|
122 |
-
padding: 0;
|
123 |
-
position: fixed;
|
124 |
-
left: 0;
|
125 |
-
top: 0;
|
126 |
-
min-height: 100%;
|
127 |
-
min-width: 100%;
|
128 |
-
height: auto;
|
129 |
-
width: auto;
|
130 |
-
opacity: 0;
|
131 |
-
z-index: 9998;
|
132 |
-
/* styles required for IE to work */
|
133 |
-
background-color: #fff;
|
134 |
-
filter: alpha(opacity=0);
|
135 |
-
}
|
136 |
-
|
137 |
-
.select2-drop {
|
138 |
-
width: 100%;
|
139 |
-
margin-top: -1px;
|
140 |
-
position: absolute;
|
141 |
-
z-index: 9999;
|
142 |
-
top: 100%;
|
143 |
-
|
144 |
-
background: #fff;
|
145 |
-
color: #000;
|
146 |
-
border: 1px solid #aaa;
|
147 |
-
border-top: 0;
|
148 |
-
|
149 |
-
border-radius: 0 0 4px 4px;
|
150 |
-
|
151 |
-
-webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
152 |
-
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
153 |
-
}
|
154 |
-
|
155 |
-
.select2-drop.select2-drop-above {
|
156 |
-
margin-top: 1px;
|
157 |
-
border-top: 1px solid #aaa;
|
158 |
-
border-bottom: 0;
|
159 |
-
|
160 |
-
border-radius: 4px 4px 0 0;
|
161 |
-
|
162 |
-
-webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
163 |
-
box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
164 |
-
}
|
165 |
-
|
166 |
-
.select2-drop-active {
|
167 |
-
border: 1px solid #5897fb;
|
168 |
-
border-top: none;
|
169 |
-
}
|
170 |
-
|
171 |
-
.select2-drop.select2-drop-above.select2-drop-active {
|
172 |
-
border-top: 1px solid #5897fb;
|
173 |
-
}
|
174 |
-
|
175 |
-
.select2-drop-auto-width {
|
176 |
-
border-top: 1px solid #aaa;
|
177 |
-
width: auto;
|
178 |
-
}
|
179 |
-
|
180 |
-
.select2-container .select2-choice .select2-arrow {
|
181 |
-
display: inline-block;
|
182 |
-
width: 18px;
|
183 |
-
height: 100%;
|
184 |
-
position: absolute;
|
185 |
-
right: 0;
|
186 |
-
top: 0;
|
187 |
-
|
188 |
-
border-left: 1px solid #aaa;
|
189 |
-
border-radius: 0 4px 4px 0;
|
190 |
-
|
191 |
-
background-clip: padding-box;
|
192 |
-
|
193 |
-
background: #ccc;
|
194 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
|
195 |
-
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
196 |
-
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
197 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
198 |
-
background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
|
199 |
-
}
|
200 |
-
|
201 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
|
202 |
-
left: 0;
|
203 |
-
right: auto;
|
204 |
-
|
205 |
-
border-left: none;
|
206 |
-
border-right: 1px solid #aaa;
|
207 |
-
border-radius: 4px 0 0 4px;
|
208 |
-
}
|
209 |
-
|
210 |
-
.select2-container .select2-choice .select2-arrow b {
|
211 |
-
display: block;
|
212 |
-
width: 100%;
|
213 |
-
height: 100%;
|
214 |
-
background: url('select2.png') no-repeat 0 1px;
|
215 |
-
}
|
216 |
-
|
217 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
|
218 |
-
background-position: 2px 1px;
|
219 |
-
}
|
220 |
-
|
221 |
-
.select2-search {
|
222 |
-
display: inline-block;
|
223 |
-
width: 100%;
|
224 |
-
min-height: 26px;
|
225 |
-
margin: 0;
|
226 |
-
padding: 4px 4px 0 4px;
|
227 |
-
|
228 |
-
position: relative;
|
229 |
-
z-index: 10000;
|
230 |
-
|
231 |
-
white-space: nowrap;
|
232 |
-
}
|
233 |
-
|
234 |
-
.select2-search input {
|
235 |
-
width: 100%;
|
236 |
-
height: auto !important;
|
237 |
-
min-height: 26px;
|
238 |
-
padding: 4px 20px 4px 5px;
|
239 |
-
margin: 0;
|
240 |
-
|
241 |
-
outline: 0;
|
242 |
-
font-family: sans-serif;
|
243 |
-
font-size: 1em;
|
244 |
-
|
245 |
-
border: 1px solid #aaa;
|
246 |
-
border-radius: 0;
|
247 |
-
|
248 |
-
-webkit-box-shadow: none;
|
249 |
-
box-shadow: none;
|
250 |
-
|
251 |
-
background: #fff url('select2.png') no-repeat 100% -22px;
|
252 |
-
background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
253 |
-
background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
254 |
-
background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
255 |
-
background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
256 |
-
}
|
257 |
-
|
258 |
-
html[dir="rtl"] .select2-search input {
|
259 |
-
padding: 4px 5px 4px 20px;
|
260 |
-
|
261 |
-
background: #fff url('select2.png') no-repeat -37px -22px;
|
262 |
-
background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
263 |
-
background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
264 |
-
background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
265 |
-
background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
266 |
-
}
|
267 |
-
|
268 |
-
.select2-search input.select2-active {
|
269 |
-
background: #fff url('select2-spinner.gif') no-repeat 100%;
|
270 |
-
background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
271 |
-
background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
272 |
-
background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
273 |
-
background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
274 |
-
}
|
275 |
-
|
276 |
-
.select2-container-active .select2-choice,
|
277 |
-
.select2-container-active .select2-choices {
|
278 |
-
border: 1px solid #5897fb;
|
279 |
-
outline: none;
|
280 |
-
|
281 |
-
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
282 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
283 |
-
}
|
284 |
-
|
285 |
-
.select2-dropdown-open .select2-choice {
|
286 |
-
border-bottom-color: transparent;
|
287 |
-
-webkit-box-shadow: 0 1px 0 #fff inset;
|
288 |
-
box-shadow: 0 1px 0 #fff inset;
|
289 |
-
|
290 |
-
border-bottom-left-radius: 0;
|
291 |
-
border-bottom-right-radius: 0;
|
292 |
-
|
293 |
-
background-color: #eee;
|
294 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
|
295 |
-
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
296 |
-
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
297 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
298 |
-
background-image: linear-gradient(to top, #fff 0%, #eee 50%);
|
299 |
-
}
|
300 |
-
|
301 |
-
.select2-dropdown-open.select2-drop-above .select2-choice,
|
302 |
-
.select2-dropdown-open.select2-drop-above .select2-choices {
|
303 |
-
border: 1px solid #5897fb;
|
304 |
-
border-top-color: transparent;
|
305 |
-
|
306 |
-
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
307 |
-
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
308 |
-
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
309 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
310 |
-
background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
|
311 |
-
}
|
312 |
-
|
313 |
-
.select2-dropdown-open .select2-choice .select2-arrow {
|
314 |
-
background: transparent;
|
315 |
-
border-left: none;
|
316 |
-
filter: none;
|
317 |
-
}
|
318 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
|
319 |
-
border-right: none;
|
320 |
-
}
|
321 |
-
|
322 |
-
.select2-dropdown-open .select2-choice .select2-arrow b {
|
323 |
-
background-position: -18px 1px;
|
324 |
-
}
|
325 |
-
|
326 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
|
327 |
-
background-position: -16px 1px;
|
328 |
-
}
|
329 |
-
|
330 |
-
.select2-hidden-accessible {
|
331 |
-
border: 0;
|
332 |
-
clip: rect(0 0 0 0);
|
333 |
-
height: 1px;
|
334 |
-
margin: -1px;
|
335 |
-
overflow: hidden;
|
336 |
-
padding: 0;
|
337 |
-
position: absolute;
|
338 |
-
width: 1px;
|
339 |
-
}
|
340 |
-
|
341 |
-
/* results */
|
342 |
-
.select2-results {
|
343 |
-
max-height: 200px;
|
344 |
-
padding: 0 0 0 4px;
|
345 |
-
margin: 4px 4px 4px 0;
|
346 |
-
position: relative;
|
347 |
-
overflow-x: hidden;
|
348 |
-
overflow-y: auto;
|
349 |
-
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
350 |
-
}
|
351 |
-
|
352 |
-
html[dir="rtl"] .select2-results {
|
353 |
-
padding: 0 4px 0 0;
|
354 |
-
margin: 4px 0 4px 4px;
|
355 |
-
}
|
356 |
-
|
357 |
-
.select2-results ul.select2-result-sub {
|
358 |
-
margin: 0;
|
359 |
-
padding-left: 0;
|
360 |
-
}
|
361 |
-
|
362 |
-
.select2-results li {
|
363 |
-
list-style: none;
|
364 |
-
display: list-item;
|
365 |
-
background-image: none;
|
366 |
-
}
|
367 |
-
|
368 |
-
.select2-results li.select2-result-with-children > .select2-result-label {
|
369 |
-
font-weight: bold;
|
370 |
-
}
|
371 |
-
|
372 |
-
.select2-results .select2-result-label {
|
373 |
-
padding: 3px 7px 4px;
|
374 |
-
margin: 0;
|
375 |
-
cursor: pointer;
|
376 |
-
|
377 |
-
min-height: 1em;
|
378 |
-
|
379 |
-
-webkit-touch-callout: none;
|
380 |
-
-webkit-user-select: none;
|
381 |
-
-moz-user-select: none;
|
382 |
-
-ms-user-select: none;
|
383 |
-
user-select: none;
|
384 |
-
}
|
385 |
-
|
386 |
-
.select2-results-dept-1 .select2-result-label { padding-left: 20px }
|
387 |
-
.select2-results-dept-2 .select2-result-label { padding-left: 40px }
|
388 |
-
.select2-results-dept-3 .select2-result-label { padding-left: 60px }
|
389 |
-
.select2-results-dept-4 .select2-result-label { padding-left: 80px }
|
390 |
-
.select2-results-dept-5 .select2-result-label { padding-left: 100px }
|
391 |
-
.select2-results-dept-6 .select2-result-label { padding-left: 110px }
|
392 |
-
.select2-results-dept-7 .select2-result-label { padding-left: 120px }
|
393 |
-
|
394 |
-
.select2-results .select2-highlighted {
|
395 |
-
background: #3875d7;
|
396 |
-
color: #fff;
|
397 |
-
}
|
398 |
-
|
399 |
-
.select2-results li em {
|
400 |
-
background: #feffde;
|
401 |
-
font-style: normal;
|
402 |
-
}
|
403 |
-
|
404 |
-
.select2-results .select2-highlighted em {
|
405 |
-
background: transparent;
|
406 |
-
}
|
407 |
-
|
408 |
-
.select2-results .select2-highlighted ul {
|
409 |
-
background: #fff;
|
410 |
-
color: #000;
|
411 |
-
}
|
412 |
-
|
413 |
-
.select2-results .select2-no-results,
|
414 |
-
.select2-results .select2-searching,
|
415 |
-
.select2-results .select2-ajax-error,
|
416 |
-
.select2-results .select2-selection-limit {
|
417 |
-
background: #f4f4f4;
|
418 |
-
display: list-item;
|
419 |
-
padding-left: 5px;
|
420 |
-
}
|
421 |
-
|
422 |
-
/*
|
423 |
-
disabled look for disabled choices in the results dropdown
|
424 |
-
*/
|
425 |
-
.select2-results .select2-disabled.select2-highlighted {
|
426 |
-
color: #666;
|
427 |
-
background: #f4f4f4;
|
428 |
-
display: list-item;
|
429 |
-
cursor: default;
|
430 |
-
}
|
431 |
-
.select2-results .select2-disabled {
|
432 |
-
background: #f4f4f4;
|
433 |
-
display: list-item;
|
434 |
-
cursor: default;
|
435 |
-
}
|
436 |
-
|
437 |
-
.select2-results .select2-selected {
|
438 |
-
display: none;
|
439 |
-
}
|
440 |
-
|
441 |
-
.select2-more-results.select2-active {
|
442 |
-
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
443 |
-
}
|
444 |
-
|
445 |
-
.select2-results .select2-ajax-error {
|
446 |
-
background: rgba(255, 50, 50, .2);
|
447 |
-
}
|
448 |
-
|
449 |
-
.select2-more-results {
|
450 |
-
background: #f4f4f4;
|
451 |
-
display: list-item;
|
452 |
-
}
|
453 |
-
|
454 |
-
/* disabled styles */
|
455 |
-
|
456 |
-
.select2-container.select2-container-disabled .select2-choice {
|
457 |
-
background-color: #f4f4f4;
|
458 |
-
background-image: none;
|
459 |
-
border: 1px solid #ddd;
|
460 |
-
cursor: default;
|
461 |
-
}
|
462 |
-
|
463 |
-
.select2-container.select2-container-disabled .select2-choice .select2-arrow {
|
464 |
-
background-color: #f4f4f4;
|
465 |
-
background-image: none;
|
466 |
-
border-left: 0;
|
467 |
-
}
|
468 |
-
|
469 |
-
.select2-container.select2-container-disabled .select2-choice abbr {
|
470 |
-
display: none;
|
471 |
-
}
|
472 |
-
|
473 |
-
|
474 |
-
/* multiselect */
|
475 |
-
|
476 |
-
.select2-container-multi .select2-choices {
|
477 |
-
height: auto !important;
|
478 |
-
height: 1%;
|
479 |
-
margin: 0;
|
480 |
-
padding: 0 5px 0 0;
|
481 |
-
position: relative;
|
482 |
-
|
483 |
-
border: 1px solid #aaa;
|
484 |
-
cursor: text;
|
485 |
-
overflow: hidden;
|
486 |
-
|
487 |
-
background-color: #fff;
|
488 |
-
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
|
489 |
-
background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
|
490 |
-
background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
|
491 |
-
background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
|
492 |
-
}
|
493 |
-
|
494 |
-
html[dir="rtl"] .select2-container-multi .select2-choices {
|
495 |
-
padding: 0 0 0 5px;
|
496 |
-
}
|
497 |
-
|
498 |
-
.select2-locked {
|
499 |
-
padding: 3px 5px 3px 5px !important;
|
500 |
-
}
|
501 |
-
|
502 |
-
.select2-container-multi .select2-choices {
|
503 |
-
min-height: 26px;
|
504 |
-
}
|
505 |
-
|
506 |
-
.select2-container-multi.select2-container-active .select2-choices {
|
507 |
-
border: 1px solid #5897fb;
|
508 |
-
outline: none;
|
509 |
-
|
510 |
-
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
511 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
512 |
-
}
|
513 |
-
.select2-container-multi .select2-choices li {
|
514 |
-
float: left;
|
515 |
-
list-style: none;
|
516 |
-
}
|
517 |
-
html[dir="rtl"] .select2-container-multi .select2-choices li
|
518 |
-
{
|
519 |
-
float: right;
|
520 |
-
}
|
521 |
-
.select2-container-multi .select2-choices .select2-search-field {
|
522 |
-
margin: 0;
|
523 |
-
padding: 0;
|
524 |
-
white-space: nowrap;
|
525 |
-
}
|
526 |
-
|
527 |
-
.select2-container-multi .select2-choices .select2-search-field input {
|
528 |
-
padding: 5px;
|
529 |
-
margin: 1px 0;
|
530 |
-
|
531 |
-
font-family: sans-serif;
|
532 |
-
font-size: 100%;
|
533 |
-
color: #666;
|
534 |
-
outline: 0;
|
535 |
-
border: 0;
|
536 |
-
-webkit-box-shadow: none;
|
537 |
-
box-shadow: none;
|
538 |
-
background: transparent !important;
|
539 |
-
}
|
540 |
-
|
541 |
-
.select2-container-multi .select2-choices .select2-search-field input.select2-active {
|
542 |
-
background: #fff url('select2-spinner.gif') no-repeat 100% !important;
|
543 |
-
}
|
544 |
-
|
545 |
-
.select2-default {
|
546 |
-
color: #999 !important;
|
547 |
-
}
|
548 |
-
|
549 |
-
.select2-container-multi .select2-choices .select2-search-choice {
|
550 |
-
padding: 3px 5px 3px 18px;
|
551 |
-
margin: 3px 0 3px 5px;
|
552 |
-
position: relative;
|
553 |
-
|
554 |
-
line-height: 13px;
|
555 |
-
color: #333;
|
556 |
-
cursor: default;
|
557 |
-
border: 1px solid #aaaaaa;
|
558 |
-
|
559 |
-
border-radius: 3px;
|
560 |
-
|
561 |
-
-webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
562 |
-
box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
563 |
-
|
564 |
-
background-clip: padding-box;
|
565 |
-
|
566 |
-
-webkit-touch-callout: none;
|
567 |
-
-webkit-user-select: none;
|
568 |
-
-moz-user-select: none;
|
569 |
-
-ms-user-select: none;
|
570 |
-
user-select: none;
|
571 |
-
|
572 |
-
background-color: #e4e4e4;
|
573 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
|
574 |
-
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
|
575 |
-
background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
576 |
-
background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
577 |
-
background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
578 |
-
}
|
579 |
-
html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
|
580 |
-
{
|
581 |
-
margin: 3px 5px 3px 0;
|
582 |
-
padding: 3px 18px 3px 5px;
|
583 |
-
}
|
584 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
585 |
-
cursor: default;
|
586 |
-
}
|
587 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus {
|
588 |
-
background: #d4d4d4;
|
589 |
-
}
|
590 |
-
|
591 |
-
.select2-search-choice-close {
|
592 |
-
display: block;
|
593 |
-
width: 12px;
|
594 |
-
height: 13px;
|
595 |
-
position: absolute;
|
596 |
-
right: 3px;
|
597 |
-
top: 4px;
|
598 |
-
|
599 |
-
font-size: 1px;
|
600 |
-
outline: none;
|
601 |
-
background: url('select2.png') right top no-repeat;
|
602 |
-
}
|
603 |
-
html[dir="rtl"] .select2-search-choice-close {
|
604 |
-
right: auto;
|
605 |
-
left: 3px;
|
606 |
-
}
|
607 |
-
|
608 |
-
.select2-container-multi .select2-search-choice-close {
|
609 |
-
left: 3px;
|
610 |
-
}
|
611 |
-
|
612 |
-
html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
|
613 |
-
left: auto;
|
614 |
-
right: 2px;
|
615 |
-
}
|
616 |
-
|
617 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
618 |
-
background-position: right -11px;
|
619 |
-
}
|
620 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
|
621 |
-
background-position: right -11px;
|
622 |
-
}
|
623 |
-
|
624 |
-
/* disabled styles */
|
625 |
-
.select2-container-multi.select2-container-disabled .select2-choices {
|
626 |
-
background-color: #f4f4f4;
|
627 |
-
background-image: none;
|
628 |
-
border: 1px solid #ddd;
|
629 |
-
cursor: default;
|
630 |
-
}
|
631 |
-
|
632 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
|
633 |
-
padding: 3px 5px 3px 5px;
|
634 |
-
border: 1px solid #ddd;
|
635 |
-
background-image: none;
|
636 |
-
background-color: #f4f4f4;
|
637 |
-
}
|
638 |
-
|
639 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
|
640 |
-
background: none;
|
641 |
-
}
|
642 |
-
/* end multiselect */
|
643 |
-
|
644 |
-
|
645 |
-
.select2-result-selectable .select2-match,
|
646 |
-
.select2-result-unselectable .select2-match {
|
647 |
-
text-decoration: underline;
|
648 |
-
}
|
649 |
-
|
650 |
-
.select2-offscreen, .select2-offscreen:focus {
|
651 |
-
clip: rect(0 0 0 0) !important;
|
652 |
-
width: 1px !important;
|
653 |
-
height: 1px !important;
|
654 |
-
border: 0 !important;
|
655 |
-
margin: 0 !important;
|
656 |
-
padding: 0 !important;
|
657 |
-
overflow: hidden !important;
|
658 |
-
position: absolute !important;
|
659 |
-
outline: 0 !important;
|
660 |
-
left: 0px !important;
|
661 |
-
top: 0px !important;
|
662 |
-
}
|
663 |
-
|
664 |
-
.select2-display-none {
|
665 |
-
display: none;
|
666 |
-
}
|
667 |
-
|
668 |
-
.select2-measure-scrollbar {
|
669 |
-
position: absolute;
|
670 |
-
top: -10000px;
|
671 |
-
left: -10000px;
|
672 |
-
width: 100px;
|
673 |
-
height: 100px;
|
674 |
-
overflow: scroll;
|
675 |
-
}
|
676 |
-
|
677 |
-
/* Retina-ize icons */
|
678 |
-
|
679 |
-
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
|
680 |
-
.select2-search input,
|
681 |
-
.select2-search-choice-close,
|
682 |
-
.select2-container .select2-choice abbr,
|
683 |
-
.select2-container .select2-choice .select2-arrow b {
|
684 |
-
background-image: url('select2x2.png') !important;
|
685 |
-
background-repeat: no-repeat !important;
|
686 |
-
background-size: 60px 40px !important;
|
687 |
-
}
|
688 |
-
|
689 |
-
.select2-search input {
|
690 |
-
background-position: 100% -21px !important;
|
691 |
-
}
|
692 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/select2/select2.js
DELETED
@@ -1,3729 +0,0 @@
|
|
1 |
-
/*
|
2 |
-
Copyright 2012 Igor Vaynberg
|
3 |
-
|
4 |
-
Version: 3.5.4 Timestamp: Sun Aug 30 13:30:32 EDT 2015
|
5 |
-
|
6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
9 |
-
License or the GPL License.
|
10 |
-
|
11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
12 |
-
|
13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
15 |
-
|
16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the
|
17 |
-
Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
|
18 |
-
CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
|
19 |
-
the specific language governing permissions and limitations under the Apache License and the GPL License.
|
20 |
-
*/
|
21 |
-
(function ($) {
|
22 |
-
if(typeof $.fn.each2 == "undefined") {
|
23 |
-
$.extend($.fn, {
|
24 |
-
/*
|
25 |
-
* 4-10 times faster .each replacement
|
26 |
-
* use it carefully, as it overrides jQuery context of element on each iteration
|
27 |
-
*/
|
28 |
-
each2 : function (c) {
|
29 |
-
var j = $([0]), i = -1, l = this.length;
|
30 |
-
while (
|
31 |
-
++i < l
|
32 |
-
&& (j.context = j[0] = this[i])
|
33 |
-
&& c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
|
34 |
-
);
|
35 |
-
return this;
|
36 |
-
}
|
37 |
-
});
|
38 |
-
}
|
39 |
-
})(jQuery);
|
40 |
-
|
41 |
-
(function ($, undefined) {
|
42 |
-
"use strict";
|
43 |
-
/*global document, window, jQuery, console */
|
44 |
-
|
45 |
-
if (window.Select2 !== undefined) {
|
46 |
-
return;
|
47 |
-
}
|
48 |
-
|
49 |
-
var AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
|
50 |
-
lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
|
51 |
-
|
52 |
-
KEY = {
|
53 |
-
TAB: 9,
|
54 |
-
ENTER: 13,
|
55 |
-
ESC: 27,
|
56 |
-
SPACE: 32,
|
57 |
-
LEFT: 37,
|
58 |
-
UP: 38,
|
59 |
-
RIGHT: 39,
|
60 |
-
DOWN: 40,
|
61 |
-
SHIFT: 16,
|
62 |
-
CTRL: 17,
|
63 |
-
ALT: 18,
|
64 |
-
PAGE_UP: 33,
|
65 |
-
PAGE_DOWN: 34,
|
66 |
-
HOME: 36,
|
67 |
-
END: 35,
|
68 |
-
BACKSPACE: 8,
|
69 |
-
DELETE: 46,
|
70 |
-
isArrow: function (k) {
|
71 |
-
k = k.which ? k.which : k;
|
72 |
-
switch (k) {
|
73 |
-
case KEY.LEFT:
|
74 |
-
case KEY.RIGHT:
|
75 |
-
case KEY.UP:
|
76 |
-
case KEY.DOWN:
|
77 |
-
return true;
|
78 |
-
}
|
79 |
-
return false;
|
80 |
-
},
|
81 |
-
isControl: function (e) {
|
82 |
-
var k = e.which;
|
83 |
-
switch (k) {
|
84 |
-
case KEY.SHIFT:
|
85 |
-
case KEY.CTRL:
|
86 |
-
case KEY.ALT:
|
87 |
-
return true;
|
88 |
-
}
|
89 |
-
|
90 |
-
if (e.metaKey) return true;
|
91 |
-
|
92 |
-
return false;
|
93 |
-
},
|
94 |
-
isFunctionKey: function (k) {
|
95 |
-
k = k.which ? k.which : k;
|
96 |
-
return k >= 112 && k <= 123;
|
97 |
-
}
|
98 |
-
},
|
99 |
-
MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
|
100 |
-
|
101 |
-
DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
|
102 |
-
|
103 |
-
$document = $(document);
|
104 |
-
|
105 |
-
nextUid=(function() { var counter=1; return function() { return counter++; }; }());
|
106 |
-
|
107 |
-
|
108 |
-
function reinsertElement(element) {
|
109 |
-
var placeholder = $(document.createTextNode(''));
|
110 |
-
|
111 |
-
element.before(placeholder);
|
112 |
-
placeholder.before(element);
|
113 |
-
placeholder.remove();
|
114 |
-
}
|
115 |
-
|
116 |
-
function stripDiacritics(str) {
|
117 |
-
// Used 'uni range + named function' from http://jsperf.com/diacritics/18
|
118 |
-
function match(a) {
|
119 |
-
return DIACRITICS[a] || a;
|
120 |
-
}
|
121 |
-
|
122 |
-
return str.replace(/[^\u0000-\u007E]/g, match);
|
123 |
-
}
|
124 |
-
|
125 |
-
function indexOf(value, array) {
|
126 |
-
var i = 0, l = array.length;
|
127 |
-
for (; i < l; i = i + 1) {
|
128 |
-
if (equal(value, array[i])) return i;
|
129 |
-
}
|
130 |
-
return -1;
|
131 |
-
}
|
132 |
-
|
133 |
-
function measureScrollbar () {
|
134 |
-
var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
|
135 |
-
$template.appendTo(document.body);
|
136 |
-
|
137 |
-
var dim = {
|
138 |
-
width: $template.width() - $template[0].clientWidth,
|
139 |
-
height: $template.height() - $template[0].clientHeight
|
140 |
-
};
|
141 |
-
$template.remove();
|
142 |
-
|
143 |
-
return dim;
|
144 |
-
}
|
145 |
-
|
146 |
-
/**
|
147 |
-
* Compares equality of a and b
|
148 |
-
* @param a
|
149 |
-
* @param b
|
150 |
-
*/
|
151 |
-
function equal(a, b) {
|
152 |
-
if (a === b) return true;
|
153 |
-
if (a === undefined || b === undefined) return false;
|
154 |
-
if (a === null || b === null) return false;
|
155 |
-
// Check whether 'a' or 'b' is a string (primitive or object).
|
156 |
-
// The concatenation of an empty string (+'') converts its argument to a string's primitive.
|
157 |
-
if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
|
158 |
-
if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
|
159 |
-
return false;
|
160 |
-
}
|
161 |
-
|
162 |
-
/**
|
163 |
-
* Splits the string into an array of values, transforming each value. An empty array is returned for nulls or empty
|
164 |
-
* strings
|
165 |
-
* @param string
|
166 |
-
* @param separator
|
167 |
-
*/
|
168 |
-
function splitVal(string, separator, transform) {
|
169 |
-
var val, i, l;
|
170 |
-
if (string === null || string.length < 1) return [];
|
171 |
-
val = string.split(separator);
|
172 |
-
for (i = 0, l = val.length; i < l; i = i + 1) val[i] = transform(val[i]);
|
173 |
-
return val;
|
174 |
-
}
|
175 |
-
|
176 |
-
function getSideBorderPadding(element) {
|
177 |
-
return element.outerWidth(false) - element.width();
|
178 |
-
}
|
179 |
-
|
180 |
-
function installKeyUpChangeEvent(element) {
|
181 |
-
var key="keyup-change-value";
|
182 |
-
element.on("keydown", function () {
|
183 |
-
if ($.data(element, key) === undefined) {
|
184 |
-
$.data(element, key, element.val());
|
185 |
-
}
|
186 |
-
});
|
187 |
-
element.on("keyup", function () {
|
188 |
-
var val= $.data(element, key);
|
189 |
-
if (val !== undefined && element.val() !== val) {
|
190 |
-
$.removeData(element, key);
|
191 |
-
element.trigger("keyup-change");
|
192 |
-
}
|
193 |
-
});
|
194 |
-
}
|
195 |
-
|
196 |
-
|
197 |
-
/**
|
198 |
-
* filters mouse events so an event is fired only if the mouse moved.
|
199 |
-
*
|
200 |
-
* filters out mouse events that occur when mouse is stationary but
|
201 |
-
* the elements under the pointer are scrolled.
|
202 |
-
*/
|
203 |
-
function installFilteredMouseMove(element) {
|
204 |
-
element.on("mousemove", function (e) {
|
205 |
-
var lastpos = lastMousePosition;
|
206 |
-
if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
|
207 |
-
$(e.target).trigger("mousemove-filtered", e);
|
208 |
-
}
|
209 |
-
});
|
210 |
-
}
|
211 |
-
|
212 |
-
/**
|
213 |
-
* Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
|
214 |
-
* within the last quietMillis milliseconds.
|
215 |
-
*
|
216 |
-
* @param quietMillis number of milliseconds to wait before invoking fn
|
217 |
-
* @param fn function to be debounced
|
218 |
-
* @param ctx object to be used as this reference within fn
|
219 |
-
* @return debounced version of fn
|
220 |
-
*/
|
221 |
-
function debounce(quietMillis, fn, ctx) {
|
222 |
-
ctx = ctx || undefined;
|
223 |
-
var timeout;
|
224 |
-
return function () {
|
225 |
-
var args = arguments;
|
226 |
-
window.clearTimeout(timeout);
|
227 |
-
timeout = window.setTimeout(function() {
|
228 |
-
fn.apply(ctx, args);
|
229 |
-
}, quietMillis);
|
230 |
-
};
|
231 |
-
}
|
232 |
-
|
233 |
-
function installDebouncedScroll(threshold, element) {
|
234 |
-
var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
|
235 |
-
element.on("scroll", function (e) {
|
236 |
-
if (indexOf(e.target, element.get()) >= 0) notify(e);
|
237 |
-
});
|
238 |
-
}
|
239 |
-
|
240 |
-
function focus($el) {
|
241 |
-
if ($el[0] === document.activeElement) return;
|
242 |
-
|
243 |
-
/* set the focus in a 0 timeout - that way the focus is set after the processing
|
244 |
-
of the current event has finished - which seems like the only reliable way
|
245 |
-
to set focus */
|
246 |
-
window.setTimeout(function() {
|
247 |
-
var el=$el[0], pos=$el.val().length, range;
|
248 |
-
|
249 |
-
$el.focus();
|
250 |
-
|
251 |
-
/* make sure el received focus so we do not error out when trying to manipulate the caret.
|
252 |
-
sometimes modals or others listeners may steal it after its set */
|
253 |
-
var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
|
254 |
-
if (isVisible && el === document.activeElement) {
|
255 |
-
|
256 |
-
/* after the focus is set move the caret to the end, necessary when we val()
|
257 |
-
just before setting focus */
|
258 |
-
if(el.setSelectionRange)
|
259 |
-
{
|
260 |
-
el.setSelectionRange(pos, pos);
|
261 |
-
}
|
262 |
-
else if (el.createTextRange) {
|
263 |
-
range = el.createTextRange();
|
264 |
-
range.collapse(false);
|
265 |
-
range.select();
|
266 |
-
}
|
267 |
-
}
|
268 |
-
}, 0);
|
269 |
-
}
|
270 |
-
|
271 |
-
function getCursorInfo(el) {
|
272 |
-
el = $(el)[0];
|
273 |
-
var offset = 0;
|
274 |
-
var length = 0;
|
275 |
-
if ('selectionStart' in el) {
|
276 |
-
offset = el.selectionStart;
|
277 |
-
length = el.selectionEnd - offset;
|
278 |
-
} else if ('selection' in document) {
|
279 |
-
el.focus();
|
280 |
-
var sel = document.selection.createRange();
|
281 |
-
length = document.selection.createRange().text.length;
|
282 |
-
sel.moveStart('character', -el.value.length);
|
283 |
-
offset = sel.text.length - length;
|
284 |
-
}
|
285 |
-
return { offset: offset, length: length };
|
286 |
-
}
|
287 |
-
|
288 |
-
function killEvent(event) {
|
289 |
-
event.preventDefault();
|
290 |
-
event.stopPropagation();
|
291 |
-
}
|
292 |
-
function killEventImmediately(event) {
|
293 |
-
event.preventDefault();
|
294 |
-
event.stopImmediatePropagation();
|
295 |
-
}
|
296 |
-
|
297 |
-
function measureTextWidth(e) {
|
298 |
-
if (!sizer){
|
299 |
-
var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
|
300 |
-
sizer = $(document.createElement("div")).css({
|
301 |
-
position: "absolute",
|
302 |
-
left: "-10000px",
|
303 |
-
top: "-10000px",
|
304 |
-
display: "none",
|
305 |
-
fontSize: style.fontSize,
|
306 |
-
fontFamily: style.fontFamily,
|
307 |
-
fontStyle: style.fontStyle,
|
308 |
-
fontWeight: style.fontWeight,
|
309 |
-
letterSpacing: style.letterSpacing,
|
310 |
-
textTransform: style.textTransform,
|
311 |
-
whiteSpace: "nowrap"
|
312 |
-
});
|
313 |
-
sizer.attr("class","select2-sizer");
|
314 |
-
$(document.body).append(sizer);
|
315 |
-
}
|
316 |
-
sizer.text(e.val());
|
317 |
-
return sizer.width();
|
318 |
-
}
|
319 |
-
|
320 |
-
function syncCssClasses(dest, src, adapter) {
|
321 |
-
var classes, replacements = [], adapted;
|
322 |
-
|
323 |
-
classes = $.trim(dest.attr("class"));
|
324 |
-
|
325 |
-
if (classes) {
|
326 |
-
classes = '' + classes; // for IE which returns object
|
327 |
-
|
328 |
-
$(classes.split(/\s+/)).each2(function() {
|
329 |
-
if (this.indexOf("select2-") === 0) {
|
330 |
-
replacements.push(this);
|
331 |
-
}
|
332 |
-
});
|
333 |
-
}
|
334 |
-
|
335 |
-
classes = $.trim(src.attr("class"));
|
336 |
-
|
337 |
-
if (classes) {
|
338 |
-
classes = '' + classes; // for IE which returns object
|
339 |
-
|
340 |
-
$(classes.split(/\s+/)).each2(function() {
|
341 |
-
if (this.indexOf("select2-") !== 0) {
|
342 |
-
adapted = adapter(this);
|
343 |
-
|
344 |
-
if (adapted) {
|
345 |
-
replacements.push(adapted);
|
346 |
-
}
|
347 |
-
}
|
348 |
-
});
|
349 |
-
}
|
350 |
-
|
351 |
-
dest.attr("class", replacements.join(" "));
|
352 |
-
}
|
353 |
-
|
354 |
-
|
355 |
-
function markMatch(text, term, markup, escapeMarkup) {
|
356 |
-
var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
|
357 |
-
tl=term.length;
|
358 |
-
|
359 |
-
if (match<0) {
|
360 |
-
markup.push(escapeMarkup(text));
|
361 |
-
return;
|
362 |
-
}
|
363 |
-
|
364 |
-
markup.push(escapeMarkup(text.substring(0, match)));
|
365 |
-
markup.push("<span class='select2-match'>");
|
366 |
-
markup.push(escapeMarkup(text.substring(match, match + tl)));
|
367 |
-
markup.push("</span>");
|
368 |
-
markup.push(escapeMarkup(text.substring(match + tl, text.length)));
|
369 |
-
}
|
370 |
-
|
371 |
-
function defaultEscapeMarkup(markup) {
|
372 |
-
var replace_map = {
|
373 |
-
'\\': '\',
|
374 |
-
'&': '&',
|
375 |
-
'<': '<',
|
376 |
-
'>': '>',
|
377 |
-
'"': '"',
|
378 |
-
"'": ''',
|
379 |
-
"/": '/'
|
380 |
-
};
|
381 |
-
|
382 |
-
return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
|
383 |
-
return replace_map[match];
|
384 |
-
});
|
385 |
-
}
|
386 |
-
|
387 |
-
/**
|
388 |
-
* Produces an ajax-based query function
|
389 |
-
*
|
390 |
-
* @param options object containing configuration parameters
|
391 |
-
* @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
|
392 |
-
* @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
|
393 |
-
* @param options.url url for the data
|
394 |
-
* @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
|
395 |
-
* @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
|
396 |
-
* @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
|
397 |
-
* @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
|
398 |
-
* The expected format is an object containing the following keys:
|
399 |
-
* results array of objects that will be used as choices
|
400 |
-
* more (optional) boolean indicating whether there are more results available
|
401 |
-
* Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
|
402 |
-
*/
|
403 |
-
function ajax(options) {
|
404 |
-
var timeout, // current scheduled but not yet executed request
|
405 |
-
handler = null,
|
406 |
-
quietMillis = options.quietMillis || 100,
|
407 |
-
ajaxUrl = options.url,
|
408 |
-
self = this;
|
409 |
-
|
410 |
-
return function (query) {
|
411 |
-
window.clearTimeout(timeout);
|
412 |
-
timeout = window.setTimeout(function () {
|
413 |
-
var data = options.data, // ajax data function
|
414 |
-
url = ajaxUrl, // ajax url string or function
|
415 |
-
transport = options.transport || $.fn.select2.ajaxDefaults.transport,
|
416 |
-
// deprecated - to be removed in 4.0 - use params instead
|
417 |
-
deprecated = {
|
418 |
-
type: options.type || 'GET', // set type of request (GET or POST)
|
419 |
-
cache: options.cache || false,
|
420 |
-
jsonpCallback: options.jsonpCallback||undefined,
|
421 |
-
dataType: options.dataType||"json"
|
422 |
-
},
|
423 |
-
params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
|
424 |
-
|
425 |
-
data = data ? data.call(self, query.term, query.page, query.context) : null;
|
426 |
-
url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
|
427 |
-
|
428 |
-
if (handler && typeof handler.abort === "function") { handler.abort(); }
|
429 |
-
|
430 |
-
if (options.params) {
|
431 |
-
if ($.isFunction(options.params)) {
|
432 |
-
$.extend(params, options.params.call(self));
|
433 |
-
} else {
|
434 |
-
$.extend(params, options.params);
|
435 |
-
}
|
436 |
-
}
|
437 |
-
|
438 |
-
$.extend(params, {
|
439 |
-
url: url,
|
440 |
-
dataType: options.dataType,
|
441 |
-
data: data,
|
442 |
-
success: function (data) {
|
443 |
-
// TODO - replace query.page with query so users have access to term, page, etc.
|
444 |
-
// added query as third paramter to keep backwards compatibility
|
445 |
-
var results = options.results(data, query.page, query);
|
446 |
-
query.callback(results);
|
447 |
-
},
|
448 |
-
error: function(jqXHR, textStatus, errorThrown){
|
449 |
-
var results = {
|
450 |
-
hasError: true,
|
451 |
-
jqXHR: jqXHR,
|
452 |
-
textStatus: textStatus,
|
453 |
-
errorThrown: errorThrown
|
454 |
-
};
|
455 |
-
|
456 |
-
query.callback(results);
|
457 |
-
}
|
458 |
-
});
|
459 |
-
handler = transport.call(self, params);
|
460 |
-
}, quietMillis);
|
461 |
-
};
|
462 |
-
}
|
463 |
-
|
464 |
-
/**
|
465 |
-
* Produces a query function that works with a local array
|
466 |
-
*
|
467 |
-
* @param options object containing configuration parameters. The options parameter can either be an array or an
|
468 |
-
* object.
|
469 |
-
*
|
470 |
-
* If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
|
471 |
-
*
|
472 |
-
* If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
|
473 |
-
* an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
|
474 |
-
* key can either be a String in which case it is expected that each element in the 'data' array has a key with the
|
475 |
-
* value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
|
476 |
-
* the text.
|
477 |
-
*/
|
478 |
-
function local(options) {
|
479 |
-
var data = options, // data elements
|
480 |
-
dataText,
|
481 |
-
tmp,
|
482 |
-
text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
|
483 |
-
|
484 |
-
if ($.isArray(data)) {
|
485 |
-
tmp = data;
|
486 |
-
data = { results: tmp };
|
487 |
-
}
|
488 |
-
|
489 |
-
if ($.isFunction(data) === false) {
|
490 |
-
tmp = data;
|
491 |
-
data = function() { return tmp; };
|
492 |
-
}
|
493 |
-
|
494 |
-
var dataItem = data();
|
495 |
-
if (dataItem.text) {
|
496 |
-
text = dataItem.text;
|
497 |
-
// if text is not a function we assume it to be a key name
|
498 |
-
if (!$.isFunction(text)) {
|
499 |
-
dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
|
500 |
-
text = function (item) { return item[dataText]; };
|
501 |
-
}
|
502 |
-
}
|
503 |
-
|
504 |
-
return function (query) {
|
505 |
-
var t = query.term, filtered = { results: [] }, process;
|
506 |
-
if (t === "") {
|
507 |
-
query.callback(data());
|
508 |
-
return;
|
509 |
-
}
|
510 |
-
|
511 |
-
process = function(datum, collection) {
|
512 |
-
var group, attr;
|
513 |
-
datum = datum[0];
|
514 |
-
if (datum.children) {
|
515 |
-
group = {};
|
516 |
-
for (attr in datum) {
|
517 |
-
if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
|
518 |
-
}
|
519 |
-
group.children=[];
|
520 |
-
$(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
|
521 |
-
if (group.children.length || query.matcher(t, text(group), datum)) {
|
522 |
-
collection.push(group);
|
523 |
-
}
|
524 |
-
} else {
|
525 |
-
if (query.matcher(t, text(datum), datum)) {
|
526 |
-
collection.push(datum);
|
527 |
-
}
|
528 |
-
}
|
529 |
-
};
|
530 |
-
|
531 |
-
$(data().results).each2(function(i, datum) { process(datum, filtered.results); });
|
532 |
-
query.callback(filtered);
|
533 |
-
};
|
534 |
-
}
|
535 |
-
|
536 |
-
// TODO javadoc
|
537 |
-
function tags(data) {
|
538 |
-
var isFunc = $.isFunction(data);
|
539 |
-
return function (query) {
|
540 |
-
var t = query.term, filtered = {results: []};
|
541 |
-
var result = isFunc ? data(query) : data;
|
542 |
-
if ($.isArray(result)) {
|
543 |
-
$(result).each(function () {
|
544 |
-
var isObject = this.text !== undefined,
|
545 |
-
text = isObject ? this.text : this;
|
546 |
-
if (t === "" || query.matcher(t, text)) {
|
547 |
-
filtered.results.push(isObject ? this : {id: this, text: this});
|
548 |
-
}
|
549 |
-
});
|
550 |
-
query.callback(filtered);
|
551 |
-
}
|
552 |
-
};
|
553 |
-
}
|
554 |
-
|
555 |
-
/**
|
556 |
-
* Checks if the formatter function should be used.
|
557 |
-
*
|
558 |
-
* Throws an error if it is not a function. Returns true if it should be used,
|
559 |
-
* false if no formatting should be performed.
|
560 |
-
*
|
561 |
-
* @param formatter
|
562 |
-
*/
|
563 |
-
function checkFormatter(formatter, formatterName) {
|
564 |
-
if ($.isFunction(formatter)) return true;
|
565 |
-
if (!formatter) return false;
|
566 |
-
if (typeof(formatter) === 'string') return true;
|
567 |
-
throw new Error(formatterName +" must be a string, function, or falsy value");
|
568 |
-
}
|
569 |
-
|
570 |
-
/**
|
571 |
-
* Returns a given value
|
572 |
-
* If given a function, returns its output
|
573 |
-
*
|
574 |
-
* @param val string|function
|
575 |
-
* @param context value of "this" to be passed to function
|
576 |
-
* @returns {*}
|
577 |
-
*/
|
578 |
-
function evaluate(val, context) {
|
579 |
-
if ($.isFunction(val)) {
|
580 |
-
var args = Array.prototype.slice.call(arguments, 2);
|
581 |
-
return val.apply(context, args);
|
582 |
-
}
|
583 |
-
return val;
|
584 |
-
}
|
585 |
-
|
586 |
-
function countResults(results) {
|
587 |
-
var count = 0;
|
588 |
-
$.each(results, function(i, item) {
|
589 |
-
if (item.children) {
|
590 |
-
count += countResults(item.children);
|
591 |
-
} else {
|
592 |
-
count++;
|
593 |
-
}
|
594 |
-
});
|
595 |
-
return count;
|
596 |
-
}
|
597 |
-
|
598 |
-
/**
|
599 |
-
* Default tokenizer. This function uses breaks the input on substring match of any string from the
|
600 |
-
* opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
|
601 |
-
* two options have to be defined in order for the tokenizer to work.
|
602 |
-
*
|
603 |
-
* @param input text user has typed so far or pasted into the search field
|
604 |
-
* @param selection currently selected choices
|
605 |
-
* @param selectCallback function(choice) callback tho add the choice to selection
|
606 |
-
* @param opts select2's opts
|
607 |
-
* @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
|
608 |
-
*/
|
609 |
-
function defaultTokenizer(input, selection, selectCallback, opts) {
|
610 |
-
var original = input, // store the original so we can compare and know if we need to tell the search to update its text
|
611 |
-
dupe = false, // check for whether a token we extracted represents a duplicate selected choice
|
612 |
-
token, // token
|
613 |
-
index, // position at which the separator was found
|
614 |
-
i, l, // looping variables
|
615 |
-
separator; // the matched separator
|
616 |
-
|
617 |
-
if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
|
618 |
-
|
619 |
-
while (true) {
|
620 |
-
index = -1;
|
621 |
-
|
622 |
-
for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
|
623 |
-
separator = opts.tokenSeparators[i];
|
624 |
-
index = input.indexOf(separator);
|
625 |
-
if (index >= 0) break;
|
626 |
-
}
|
627 |
-
|
628 |
-
if (index < 0) break; // did not find any token separator in the input string, bail
|
629 |
-
|
630 |
-
token = input.substring(0, index);
|
631 |
-
input = input.substring(index + separator.length);
|
632 |
-
|
633 |
-
if (token.length > 0) {
|
634 |
-
token = opts.createSearchChoice.call(this, token, selection);
|
635 |
-
if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
|
636 |
-
dupe = false;
|
637 |
-
for (i = 0, l = selection.length; i < l; i++) {
|
638 |
-
if (equal(opts.id(token), opts.id(selection[i]))) {
|
639 |
-
dupe = true; break;
|
640 |
-
}
|
641 |
-
}
|
642 |
-
|
643 |
-
if (!dupe) selectCallback(token);
|
644 |
-
}
|
645 |
-
}
|
646 |
-
}
|
647 |
-
|
648 |
-
if (original!==input) return input;
|
649 |
-
}
|
650 |
-
|
651 |
-
function cleanupJQueryElements() {
|
652 |
-
var self = this;
|
653 |
-
|
654 |
-
$.each(arguments, function (i, element) {
|
655 |
-
self[element].remove();
|
656 |
-
self[element] = null;
|
657 |
-
});
|
658 |
-
}
|
659 |
-
|
660 |
-
/**
|
661 |
-
* Creates a new class
|
662 |
-
*
|
663 |
-
* @param superClass
|
664 |
-
* @param methods
|
665 |
-
*/
|
666 |
-
function clazz(SuperClass, methods) {
|
667 |
-
var constructor = function () {};
|
668 |
-
constructor.prototype = new SuperClass;
|
669 |
-
constructor.prototype.constructor = constructor;
|
670 |
-
constructor.prototype.parent = SuperClass.prototype;
|
671 |
-
constructor.prototype = $.extend(constructor.prototype, methods);
|
672 |
-
return constructor;
|
673 |
-
}
|
674 |
-
|
675 |
-
AbstractSelect2 = clazz(Object, {
|
676 |
-
|
677 |
-
// abstract
|
678 |
-
bind: function (func) {
|
679 |
-
var self = this;
|
680 |
-
return function () {
|
681 |
-
func.apply(self, arguments);
|
682 |
-
};
|
683 |
-
},
|
684 |
-
|
685 |
-
// abstract
|
686 |
-
init: function (opts) {
|
687 |
-
var results, search, resultsSelector = ".select2-results";
|
688 |
-
|
689 |
-
// prepare options
|
690 |
-
this.opts = opts = this.prepareOpts(opts);
|
691 |
-
|
692 |
-
this.id=opts.id;
|
693 |
-
|
694 |
-
// destroy if called on an existing component
|
695 |
-
if (opts.element.data("select2") !== undefined &&
|
696 |
-
opts.element.data("select2") !== null) {
|
697 |
-
opts.element.data("select2").destroy();
|
698 |
-
}
|
699 |
-
|
700 |
-
this.container = this.createContainer();
|
701 |
-
|
702 |
-
this.liveRegion = $('.select2-hidden-accessible');
|
703 |
-
if (this.liveRegion.length == 0) {
|
704 |
-
this.liveRegion = $("<span>", {
|
705 |
-
role: "status",
|
706 |
-
"aria-live": "polite"
|
707 |
-
})
|
708 |
-
.addClass("select2-hidden-accessible")
|
709 |
-
.appendTo(document.body);
|
710 |
-
}
|
711 |
-
|
712 |
-
this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
|
713 |
-
this.containerEventName= this.containerId
|
714 |
-
.replace(/([.])/g, '_')
|
715 |
-
.replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
|
716 |
-
this.container.attr("id", this.containerId);
|
717 |
-
|
718 |
-
this.container.attr("title", opts.element.attr("title"));
|
719 |
-
|
720 |
-
this.body = $(document.body);
|
721 |
-
|
722 |
-
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
723 |
-
|
724 |
-
this.container.attr("style", opts.element.attr("style"));
|
725 |
-
this.container.css(evaluate(opts.containerCss, this.opts.element));
|
726 |
-
this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
|
727 |
-
|
728 |
-
this.elementTabIndex = this.opts.element.attr("tabindex");
|
729 |
-
|
730 |
-
// swap container for the element
|
731 |
-
this.opts.element
|
732 |
-
.data("select2", this)
|
733 |
-
.attr("tabindex", "-1")
|
734 |
-
.before(this.container)
|
735 |
-
.on("click.select2", killEvent); // do not leak click events
|
736 |
-
|
737 |
-
this.container.data("select2", this);
|
738 |
-
|
739 |
-
this.dropdown = this.container.find(".select2-drop");
|
740 |
-
|
741 |
-
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
742 |
-
|
743 |
-
this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
|
744 |
-
this.dropdown.data("select2", this);
|
745 |
-
this.dropdown.on("click", killEvent);
|
746 |
-
|
747 |
-
this.results = results = this.container.find(resultsSelector);
|
748 |
-
this.search = search = this.container.find("input.select2-input");
|
749 |
-
|
750 |
-
this.queryCount = 0;
|
751 |
-
this.resultsPage = 0;
|
752 |
-
this.context = null;
|
753 |
-
|
754 |
-
// initialize the container
|
755 |
-
this.initContainer();
|
756 |
-
|
757 |
-
this.container.on("click", killEvent);
|
758 |
-
|
759 |
-
installFilteredMouseMove(this.results);
|
760 |
-
|
761 |
-
this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
|
762 |
-
this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
|
763 |
-
this._touchEvent = true;
|
764 |
-
this.highlightUnderEvent(event);
|
765 |
-
}));
|
766 |
-
this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
|
767 |
-
this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
|
768 |
-
|
769 |
-
// Waiting for a click event on touch devices to select option and hide dropdown
|
770 |
-
// otherwise click will be triggered on an underlying element
|
771 |
-
this.dropdown.on('click', this.bind(function (event) {
|
772 |
-
if (this._touchEvent) {
|
773 |
-
this._touchEvent = false;
|
774 |
-
this.selectHighlighted();
|
775 |
-
}
|
776 |
-
}));
|
777 |
-
|
778 |
-
installDebouncedScroll(80, this.results);
|
779 |
-
this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
|
780 |
-
|
781 |
-
// do not propagate change event from the search field out of the component
|
782 |
-
$(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
783 |
-
$(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
784 |
-
|
785 |
-
// if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
|
786 |
-
if ($.fn.mousewheel) {
|
787 |
-
results.mousewheel(function (e, delta, deltaX, deltaY) {
|
788 |
-
var top = results.scrollTop();
|
789 |
-
if (deltaY > 0 && top - deltaY <= 0) {
|
790 |
-
results.scrollTop(0);
|
791 |
-
killEvent(e);
|
792 |
-
} else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
|
793 |
-
results.scrollTop(results.get(0).scrollHeight - results.height());
|
794 |
-
killEvent(e);
|
795 |
-
}
|
796 |
-
});
|
797 |
-
}
|
798 |
-
|
799 |
-
installKeyUpChangeEvent(search);
|
800 |
-
search.on("keyup-change input paste", this.bind(this.updateResults));
|
801 |
-
search.on("focus", function () { search.addClass("select2-focused"); });
|
802 |
-
search.on("blur", function () { search.removeClass("select2-focused");});
|
803 |
-
|
804 |
-
this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
|
805 |
-
if ($(e.target).closest(".select2-result-selectable").length > 0) {
|
806 |
-
this.highlightUnderEvent(e);
|
807 |
-
this.selectHighlighted(e);
|
808 |
-
}
|
809 |
-
}));
|
810 |
-
|
811 |
-
// trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
|
812 |
-
// for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
|
813 |
-
// dom it will trigger the popup close, which is not what we want
|
814 |
-
// focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
|
815 |
-
this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
|
816 |
-
|
817 |
-
this.lastSearchTerm = undefined;
|
818 |
-
|
819 |
-
if ($.isFunction(this.opts.initSelection)) {
|
820 |
-
// initialize selection based on the current value of the source element
|
821 |
-
this.initSelection();
|
822 |
-
|
823 |
-
// if the user has provided a function that can set selection based on the value of the source element
|
824 |
-
// we monitor the change event on the element and trigger it, allowing for two way synchronization
|
825 |
-
this.monitorSource();
|
826 |
-
}
|
827 |
-
|
828 |
-
if (opts.maximumInputLength !== null) {
|
829 |
-
this.search.attr("maxlength", opts.maximumInputLength);
|
830 |
-
}
|
831 |
-
|
832 |
-
var disabled = opts.element.prop("disabled");
|
833 |
-
if (disabled === undefined) disabled = false;
|
834 |
-
this.enable(!disabled);
|
835 |
-
|
836 |
-
var readonly = opts.element.prop("readonly");
|
837 |
-
if (readonly === undefined) readonly = false;
|
838 |
-
this.readonly(readonly);
|
839 |
-
|
840 |
-
// Calculate size of scrollbar
|
841 |
-
scrollBarDimensions = scrollBarDimensions || measureScrollbar();
|
842 |
-
|
843 |
-
this.autofocus = opts.element.prop("autofocus");
|
844 |
-
opts.element.prop("autofocus", false);
|
845 |
-
if (this.autofocus) this.focus();
|
846 |
-
|
847 |
-
this.search.attr("placeholder", opts.searchInputPlaceholder);
|
848 |
-
},
|
849 |
-
|
850 |
-
// abstract
|
851 |
-
destroy: function () {
|
852 |
-
var element=this.opts.element, select2 = element.data("select2"), self = this;
|
853 |
-
|
854 |
-
this.close();
|
855 |
-
|
856 |
-
if (element.length && element[0].detachEvent && self._sync) {
|
857 |
-
element.each(function () {
|
858 |
-
if (self._sync) {
|
859 |
-
this.detachEvent("onpropertychange", self._sync);
|
860 |
-
}
|
861 |
-
});
|
862 |
-
}
|
863 |
-
if (this.propertyObserver) {
|
864 |
-
this.propertyObserver.disconnect();
|
865 |
-
this.propertyObserver = null;
|
866 |
-
}
|
867 |
-
this._sync = null;
|
868 |
-
|
869 |
-
if (select2 !== undefined) {
|
870 |
-
select2.container.remove();
|
871 |
-
select2.liveRegion.remove();
|
872 |
-
select2.dropdown.remove();
|
873 |
-
element.removeData("select2")
|
874 |
-
.off(".select2");
|
875 |
-
if (!element.is("input[type='hidden']")) {
|
876 |
-
element
|
877 |
-
.show()
|
878 |
-
.prop("autofocus", this.autofocus || false);
|
879 |
-
if (this.elementTabIndex) {
|
880 |
-
element.attr({tabindex: this.elementTabIndex});
|
881 |
-
} else {
|
882 |
-
element.removeAttr("tabindex");
|
883 |
-
}
|
884 |
-
element.show();
|
885 |
-
} else {
|
886 |
-
element.css("display", "");
|
887 |
-
}
|
888 |
-
}
|
889 |
-
|
890 |
-
cleanupJQueryElements.call(this,
|
891 |
-
"container",
|
892 |
-
"liveRegion",
|
893 |
-
"dropdown",
|
894 |
-
"results",
|
895 |
-
"search"
|
896 |
-
);
|
897 |
-
},
|
898 |
-
|
899 |
-
// abstract
|
900 |
-
optionToData: function(element) {
|
901 |
-
if (element.is("option")) {
|
902 |
-
return {
|
903 |
-
id:element.prop("value"),
|
904 |
-
text:element.text(),
|
905 |
-
element: element.get(),
|
906 |
-
css: element.attr("class"),
|
907 |
-
disabled: element.prop("disabled"),
|
908 |
-
locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
|
909 |
-
};
|
910 |
-
} else if (element.is("optgroup")) {
|
911 |
-
return {
|
912 |
-
text:element.attr("label"),
|
913 |
-
children:[],
|
914 |
-
element: element.get(),
|
915 |
-
css: element.attr("class")
|
916 |
-
};
|
917 |
-
}
|
918 |
-
},
|
919 |
-
|
920 |
-
// abstract
|
921 |
-
prepareOpts: function (opts) {
|
922 |
-
var element, select, idKey, ajaxUrl, self = this;
|
923 |
-
|
924 |
-
element = opts.element;
|
925 |
-
|
926 |
-
if (element.get(0).tagName.toLowerCase() === "select") {
|
927 |
-
this.select = select = opts.element;
|
928 |
-
}
|
929 |
-
|
930 |
-
if (select) {
|
931 |
-
// these options are not allowed when attached to a select because they are picked up off the element itself
|
932 |
-
$.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
|
933 |
-
if (this in opts) {
|
934 |
-
throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
|
935 |
-
}
|
936 |
-
});
|
937 |
-
}
|
938 |
-
|
939 |
-
opts.debug = opts.debug || $.fn.select2.defaults.debug;
|
940 |
-
|
941 |
-
// Warnings for options renamed/removed in Select2 4.0.0
|
942 |
-
// Only when it's enabled through debug mode
|
943 |
-
if (opts.debug && console && console.warn) {
|
944 |
-
// id was removed
|
945 |
-
if (opts.id != null) {
|
946 |
-
console.warn(
|
947 |
-
'Select2: The `id` option has been removed in Select2 4.0.0, ' +
|
948 |
-
'consider renaming your `id` property or mapping the property before your data makes it to Select2. ' +
|
949 |
-
'You can read more at https://select2.github.io/announcements-4.0.html#changed-id'
|
950 |
-
);
|
951 |
-
}
|
952 |
-
|
953 |
-
// text was removed
|
954 |
-
if (opts.text != null) {
|
955 |
-
console.warn(
|
956 |
-
'Select2: The `text` option has been removed in Select2 4.0.0, ' +
|
957 |
-
'consider renaming your `text` property or mapping the property before your data makes it to Select2. ' +
|
958 |
-
'You can read more at https://select2.github.io/announcements-4.0.html#changed-id'
|
959 |
-
);
|
960 |
-
}
|
961 |
-
|
962 |
-
// sortResults was renamed to results
|
963 |
-
if (opts.sortResults != null) {
|
964 |
-
console.warn(
|
965 |
-
'Select2: the `sortResults` option has been renamed to `sorter` in Select2 4.0.0. '
|
966 |
-
);
|
967 |
-
}
|
968 |
-
|
969 |
-
// selectOnBlur was renamed to selectOnClose
|
970 |
-
if (opts.selectOnBlur != null) {
|
971 |
-
console.warn(
|
972 |
-
'Select2: The `selectOnBlur` option has been renamed to `selectOnClose` in Select2 4.0.0.'
|
973 |
-
);
|
974 |
-
}
|
975 |
-
|
976 |
-
// ajax.results was renamed to ajax.processResults
|
977 |
-
if (opts.ajax != null && opts.ajax.results != null) {
|
978 |
-
console.warn(
|
979 |
-
'Select2: The `ajax.results` option has been renamed to `ajax.processResults` in Select2 4.0.0.'
|
980 |
-
);
|
981 |
-
}
|
982 |
-
|
983 |
-
// format* options were renamed to language.*
|
984 |
-
if (opts.formatNoResults != null) {
|
985 |
-
console.warn(
|
986 |
-
'Select2: The `formatNoResults` option has been renamed to `language.noResults` in Select2 4.0.0.'
|
987 |
-
);
|
988 |
-
}
|
989 |
-
if (opts.formatSearching != null) {
|
990 |
-
console.warn(
|
991 |
-
'Select2: The `formatSearching` option has been renamed to `language.searching` in Select2 4.0.0.'
|
992 |
-
);
|
993 |
-
}
|
994 |
-
if (opts.formatInputTooShort != null) {
|
995 |
-
console.warn(
|
996 |
-
'Select2: The `formatInputTooShort` option has been renamed to `language.inputTooShort` in Select2 4.0.0.'
|
997 |
-
);
|
998 |
-
}
|
999 |
-
if (opts.formatInputTooLong != null) {
|
1000 |
-
console.warn(
|
1001 |
-
'Select2: The `formatInputTooLong` option has been renamed to `language.inputTooLong` in Select2 4.0.0.'
|
1002 |
-
);
|
1003 |
-
}
|
1004 |
-
if (opts.formatLoading != null) {
|
1005 |
-
console.warn(
|
1006 |
-
'Select2: The `formatLoading` option has been renamed to `language.loadingMore` in Select2 4.0.0.'
|
1007 |
-
);
|
1008 |
-
}
|
1009 |
-
if (opts.formatSelectionTooBig != null) {
|
1010 |
-
console.warn(
|
1011 |
-
'Select2: The `formatSelectionTooBig` option has been renamed to `language.maximumSelected` in Select2 4.0.0.'
|
1012 |
-
);
|
1013 |
-
}
|
1014 |
-
|
1015 |
-
if (opts.element.data('select2Tags')) {
|
1016 |
-
console.warn(
|
1017 |
-
'Select2: The `data-select2-tags` attribute has been renamed to `data-tags` in Select2 4.0.0.'
|
1018 |
-
);
|
1019 |
-
}
|
1020 |
-
}
|
1021 |
-
|
1022 |
-
// Aliasing options renamed in Select2 4.0.0
|
1023 |
-
|
1024 |
-
// data-select2-tags -> data-tags
|
1025 |
-
if (opts.element.data('tags') != null) {
|
1026 |
-
var elemTags = opts.element.data('tags');
|
1027 |
-
|
1028 |
-
// data-tags should actually be a boolean
|
1029 |
-
if (!$.isArray(elemTags)) {
|
1030 |
-
elemTags = [];
|
1031 |
-
}
|
1032 |
-
|
1033 |
-
opts.element.data('select2Tags', elemTags);
|
1034 |
-
}
|
1035 |
-
|
1036 |
-
// sortResults -> sorter
|
1037 |
-
if (opts.sorter != null) {
|
1038 |
-
opts.sortResults = opts.sorter;
|
1039 |
-
}
|
1040 |
-
|
1041 |
-
// selectOnBlur -> selectOnClose
|
1042 |
-
if (opts.selectOnClose != null) {
|
1043 |
-
opts.selectOnBlur = opts.selectOnClose;
|
1044 |
-
}
|
1045 |
-
|
1046 |
-
// ajax.results -> ajax.processResults
|
1047 |
-
if (opts.ajax != null) {
|
1048 |
-
if ($.isFunction(opts.ajax.processResults)) {
|
1049 |
-
opts.ajax.results = opts.ajax.processResults;
|
1050 |
-
}
|
1051 |
-
}
|
1052 |
-
|
1053 |
-
// Formatters/language options
|
1054 |
-
if (opts.language != null) {
|
1055 |
-
var lang = opts.language;
|
1056 |
-
|
1057 |
-
// formatNoMatches -> language.noMatches
|
1058 |
-
if ($.isFunction(lang.noMatches)) {
|
1059 |
-
opts.formatNoMatches = lang.noMatches;
|
1060 |
-
}
|
1061 |
-
|
1062 |
-
// formatSearching -> language.searching
|
1063 |
-
if ($.isFunction(lang.searching)) {
|
1064 |
-
opts.formatSearching = lang.searching;
|
1065 |
-
}
|
1066 |
-
|
1067 |
-
// formatInputTooShort -> language.inputTooShort
|
1068 |
-
if ($.isFunction(lang.inputTooShort)) {
|
1069 |
-
opts.formatInputTooShort = lang.inputTooShort;
|
1070 |
-
}
|
1071 |
-
|
1072 |
-
// formatInputTooLong -> language.inputTooLong
|
1073 |
-
if ($.isFunction(lang.inputTooLong)) {
|
1074 |
-
opts.formatInputTooLong = lang.inputTooLong;
|
1075 |
-
}
|
1076 |
-
|
1077 |
-
// formatLoading -> language.loadingMore
|
1078 |
-
if ($.isFunction(lang.loadingMore)) {
|
1079 |
-
opts.formatLoading = lang.loadingMore;
|
1080 |
-
}
|
1081 |
-
|
1082 |
-
// formatSelectionTooBig -> language.maximumSelected
|
1083 |
-
if ($.isFunction(lang.maximumSelected)) {
|
1084 |
-
opts.formatSelectionTooBig = lang.maximumSelected;
|
1085 |
-
}
|
1086 |
-
}
|
1087 |
-
|
1088 |
-
opts = $.extend({}, {
|
1089 |
-
populateResults: function(container, results, query) {
|
1090 |
-
var populate, id=this.opts.id, liveRegion=this.liveRegion;
|
1091 |
-
|
1092 |
-
populate=function(results, container, depth) {
|
1093 |
-
|
1094 |
-
var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
|
1095 |
-
|
1096 |
-
results = opts.sortResults(results, container, query);
|
1097 |
-
|
1098 |
-
// collect the created nodes for bulk append
|
1099 |
-
var nodes = [];
|
1100 |
-
for (i = 0, l = results.length; i < l; i = i + 1) {
|
1101 |
-
|
1102 |
-
result=results[i];
|
1103 |
-
|
1104 |
-
disabled = (result.disabled === true);
|
1105 |
-
selectable = (!disabled) && (id(result) !== undefined);
|
1106 |
-
|
1107 |
-
compound=result.children && result.children.length > 0;
|
1108 |
-
|
1109 |
-
node=$("<li></li>");
|
1110 |
-
node.addClass("select2-results-dept-"+depth);
|
1111 |
-
node.addClass("select2-result");
|
1112 |
-
node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
|
1113 |
-
if (disabled) { node.addClass("select2-disabled"); }
|
1114 |
-
if (compound) { node.addClass("select2-result-with-children"); }
|
1115 |
-
node.addClass(self.opts.formatResultCssClass(result));
|
1116 |
-
node.attr("role", "presentation");
|
1117 |
-
|
1118 |
-
label=$(document.createElement("div"));
|
1119 |
-
label.addClass("select2-result-label");
|
1120 |
-
label.attr("id", "select2-result-label-" + nextUid());
|
1121 |
-
label.attr("role", "option");
|
1122 |
-
|
1123 |
-
formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
|
1124 |
-
if (formatted!==undefined) {
|
1125 |
-
label.html(formatted);
|
1126 |
-
node.append(label);
|
1127 |
-
}
|
1128 |
-
|
1129 |
-
|
1130 |
-
if (compound) {
|
1131 |
-
innerContainer=$("<ul></ul>");
|
1132 |
-
innerContainer.addClass("select2-result-sub");
|
1133 |
-
populate(result.children, innerContainer, depth+1);
|
1134 |
-
node.append(innerContainer);
|
1135 |
-
}
|
1136 |
-
|
1137 |
-
node.data("select2-data", result);
|
1138 |
-
nodes.push(node[0]);
|
1139 |
-
}
|
1140 |
-
|
1141 |
-
// bulk append the created nodes
|
1142 |
-
container.append(nodes);
|
1143 |
-
liveRegion.text(opts.formatMatches(results.length));
|
1144 |
-
};
|
1145 |
-
|
1146 |
-
populate(results, container, 0);
|
1147 |
-
}
|
1148 |
-
}, $.fn.select2.defaults, opts);
|
1149 |
-
|
1150 |
-
if (typeof(opts.id) !== "function") {
|
1151 |
-
idKey = opts.id;
|
1152 |
-
opts.id = function (e) { return e[idKey]; };
|
1153 |
-
}
|
1154 |
-
|
1155 |
-
if ($.isArray(opts.element.data("select2Tags"))) {
|
1156 |
-
if ("tags" in opts) {
|
1157 |
-
throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
|
1158 |
-
}
|
1159 |
-
opts.tags=opts.element.data("select2Tags");
|
1160 |
-
}
|
1161 |
-
|
1162 |
-
if (select) {
|
1163 |
-
opts.query = this.bind(function (query) {
|
1164 |
-
var data = { results: [], more: false },
|
1165 |
-
term = query.term,
|
1166 |
-
children, placeholderOption, process;
|
1167 |
-
|
1168 |
-
process=function(element, collection) {
|
1169 |
-
var group;
|
1170 |
-
if (element.is("option")) {
|
1171 |
-
if (query.matcher(term, element.text(), element)) {
|
1172 |
-
collection.push(self.optionToData(element));
|
1173 |
-
}
|
1174 |
-
} else if (element.is("optgroup")) {
|
1175 |
-
group=self.optionToData(element);
|
1176 |
-
element.children().each2(function(i, elm) { process(elm, group.children); });
|
1177 |
-
if (group.children.length>0) {
|
1178 |
-
collection.push(group);
|
1179 |
-
}
|
1180 |
-
}
|
1181 |
-
};
|
1182 |
-
|
1183 |
-
children=element.children();
|
1184 |
-
|
1185 |
-
// ignore the placeholder option if there is one
|
1186 |
-
if (this.getPlaceholder() !== undefined && children.length > 0) {
|
1187 |
-
placeholderOption = this.getPlaceholderOption();
|
1188 |
-
if (placeholderOption) {
|
1189 |
-
children=children.not(placeholderOption);
|
1190 |
-
}
|
1191 |
-
}
|
1192 |
-
|
1193 |
-
children.each2(function(i, elm) { process(elm, data.results); });
|
1194 |
-
|
1195 |
-
query.callback(data);
|
1196 |
-
});
|
1197 |
-
// this is needed because inside val() we construct choices from options and their id is hardcoded
|
1198 |
-
opts.id=function(e) { return e.id; };
|
1199 |
-
} else {
|
1200 |
-
if (!("query" in opts)) {
|
1201 |
-
if ("ajax" in opts) {
|
1202 |
-
ajaxUrl = opts.element.data("ajax-url");
|
1203 |
-
if (ajaxUrl && ajaxUrl.length > 0) {
|
1204 |
-
opts.ajax.url = ajaxUrl;
|
1205 |
-
}
|
1206 |
-
opts.query = ajax.call(opts.element, opts.ajax);
|
1207 |
-
} else if ("data" in opts) {
|
1208 |
-
opts.query = local(opts.data);
|
1209 |
-
} else if ("tags" in opts) {
|
1210 |
-
opts.query = tags(opts.tags);
|
1211 |
-
if (opts.createSearchChoice === undefined) {
|
1212 |
-
opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
|
1213 |
-
}
|
1214 |
-
if (opts.initSelection === undefined) {
|
1215 |
-
opts.initSelection = function (element, callback) {
|
1216 |
-
var data = [];
|
1217 |
-
$(splitVal(element.val(), opts.separator, opts.transformVal)).each(function () {
|
1218 |
-
var obj = { id: this, text: this },
|
1219 |
-
tags = opts.tags;
|
1220 |
-
if ($.isFunction(tags)) tags=tags();
|
1221 |
-
$(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
|
1222 |
-
data.push(obj);
|
1223 |
-
});
|
1224 |
-
|
1225 |
-
callback(data);
|
1226 |
-
};
|
1227 |
-
}
|
1228 |
-
}
|
1229 |
-
}
|
1230 |
-
}
|
1231 |
-
if (typeof(opts.query) !== "function") {
|
1232 |
-
throw "query function not defined for Select2 " + opts.element.attr("id");
|
1233 |
-
}
|
1234 |
-
|
1235 |
-
if (opts.createSearchChoicePosition === 'top') {
|
1236 |
-
opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
|
1237 |
-
}
|
1238 |
-
else if (opts.createSearchChoicePosition === 'bottom') {
|
1239 |
-
opts.createSearchChoicePosition = function(list, item) { list.push(item); };
|
1240 |
-
}
|
1241 |
-
else if (typeof(opts.createSearchChoicePosition) !== "function") {
|
1242 |
-
throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
|
1243 |
-
}
|
1244 |
-
|
1245 |
-
return opts;
|
1246 |
-
},
|
1247 |
-
|
1248 |
-
/**
|
1249 |
-
* Monitor the original element for changes and update select2 accordingly
|
1250 |
-
*/
|
1251 |
-
// abstract
|
1252 |
-
monitorSource: function () {
|
1253 |
-
var el = this.opts.element, observer, self = this;
|
1254 |
-
|
1255 |
-
el.on("change.select2", this.bind(function (e) {
|
1256 |
-
if (this.opts.element.data("select2-change-triggered") !== true) {
|
1257 |
-
this.initSelection();
|
1258 |
-
}
|
1259 |
-
}));
|
1260 |
-
|
1261 |
-
this._sync = this.bind(function () {
|
1262 |
-
|
1263 |
-
// sync enabled state
|
1264 |
-
var disabled = el.prop("disabled");
|
1265 |
-
if (disabled === undefined) disabled = false;
|
1266 |
-
this.enable(!disabled);
|
1267 |
-
|
1268 |
-
var readonly = el.prop("readonly");
|
1269 |
-
if (readonly === undefined) readonly = false;
|
1270 |
-
this.readonly(readonly);
|
1271 |
-
|
1272 |
-
if (this.container) {
|
1273 |
-
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
1274 |
-
this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
|
1275 |
-
}
|
1276 |
-
|
1277 |
-
if (this.dropdown) {
|
1278 |
-
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
1279 |
-
this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
|
1280 |
-
}
|
1281 |
-
|
1282 |
-
});
|
1283 |
-
|
1284 |
-
// IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
|
1285 |
-
if (el.length && el[0].attachEvent) {
|
1286 |
-
el.each(function() {
|
1287 |
-
this.attachEvent("onpropertychange", self._sync);
|
1288 |
-
});
|
1289 |
-
}
|
1290 |
-
|
1291 |
-
// safari, chrome, firefox, IE11
|
1292 |
-
observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
|
1293 |
-
if (observer !== undefined) {
|
1294 |
-
if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
|
1295 |
-
this.propertyObserver = new observer(function (mutations) {
|
1296 |
-
$.each(mutations, self._sync);
|
1297 |
-
});
|
1298 |
-
this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
|
1299 |
-
}
|
1300 |
-
},
|
1301 |
-
|
1302 |
-
// abstract
|
1303 |
-
triggerSelect: function(data) {
|
1304 |
-
var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
|
1305 |
-
this.opts.element.trigger(evt);
|
1306 |
-
return !evt.isDefaultPrevented();
|
1307 |
-
},
|
1308 |
-
|
1309 |
-
/**
|
1310 |
-
* Triggers the change event on the source element
|
1311 |
-
*/
|
1312 |
-
// abstract
|
1313 |
-
triggerChange: function (details) {
|
1314 |
-
|
1315 |
-
details = details || {};
|
1316 |
-
details= $.extend({}, details, { type: "change", val: this.val() });
|
1317 |
-
// prevents recursive triggering
|
1318 |
-
this.opts.element.data("select2-change-triggered", true);
|
1319 |
-
this.opts.element.trigger(details);
|
1320 |
-
this.opts.element.data("select2-change-triggered", false);
|
1321 |
-
|
1322 |
-
// some validation frameworks ignore the change event and listen instead to keyup, click for selects
|
1323 |
-
// so here we trigger the click event manually
|
1324 |
-
this.opts.element.click();
|
1325 |
-
|
1326 |
-
// ValidationEngine ignores the change event and listens instead to blur
|
1327 |
-
// so here we trigger the blur event manually if so desired
|
1328 |
-
if (this.opts.blurOnChange)
|
1329 |
-
this.opts.element.blur();
|
1330 |
-
},
|
1331 |
-
|
1332 |
-
//abstract
|
1333 |
-
isInterfaceEnabled: function()
|
1334 |
-
{
|
1335 |
-
return this.enabledInterface === true;
|
1336 |
-
},
|
1337 |
-
|
1338 |
-
// abstract
|
1339 |
-
enableInterface: function() {
|
1340 |
-
var enabled = this._enabled && !this._readonly,
|
1341 |
-
disabled = !enabled;
|
1342 |
-
|
1343 |
-
if (enabled === this.enabledInterface) return false;
|
1344 |
-
|
1345 |
-
this.container.toggleClass("select2-container-disabled", disabled);
|
1346 |
-
this.close();
|
1347 |
-
this.enabledInterface = enabled;
|
1348 |
-
|
1349 |
-
return true;
|
1350 |
-
},
|
1351 |
-
|
1352 |
-
// abstract
|
1353 |
-
enable: function(enabled) {
|
1354 |
-
if (enabled === undefined) enabled = true;
|
1355 |
-
if (this._enabled === enabled) return;
|
1356 |
-
this._enabled = enabled;
|
1357 |
-
|
1358 |
-
this.opts.element.prop("disabled", !enabled);
|
1359 |
-
this.enableInterface();
|
1360 |
-
},
|
1361 |
-
|
1362 |
-
// abstract
|
1363 |
-
disable: function() {
|
1364 |
-
this.enable(false);
|
1365 |
-
},
|
1366 |
-
|
1367 |
-
// abstract
|
1368 |
-
readonly: function(enabled) {
|
1369 |
-
if (enabled === undefined) enabled = false;
|
1370 |
-
if (this._readonly === enabled) return;
|
1371 |
-
this._readonly = enabled;
|
1372 |
-
|
1373 |
-
this.opts.element.prop("readonly", enabled);
|
1374 |
-
this.enableInterface();
|
1375 |
-
},
|
1376 |
-
|
1377 |
-
// abstract
|
1378 |
-
opened: function () {
|
1379 |
-
return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
|
1380 |
-
},
|
1381 |
-
|
1382 |
-
// abstract
|
1383 |
-
positionDropdown: function() {
|
1384 |
-
var $dropdown = this.dropdown,
|
1385 |
-
container = this.container,
|
1386 |
-
offset = container.offset(),
|
1387 |
-
height = container.outerHeight(false),
|
1388 |
-
width = container.outerWidth(false),
|
1389 |
-
dropHeight = $dropdown.outerHeight(false),
|
1390 |
-
$window = $(window),
|
1391 |
-
windowWidth = $window.width(),
|
1392 |
-
windowHeight = $window.height(),
|
1393 |
-
viewPortRight = $window.scrollLeft() + windowWidth,
|
1394 |
-
viewportBottom = $window.scrollTop() + windowHeight,
|
1395 |
-
dropTop = offset.top + height,
|
1396 |
-
dropLeft = offset.left,
|
1397 |
-
enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
|
1398 |
-
enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
|
1399 |
-
dropWidth = $dropdown.outerWidth(false),
|
1400 |
-
enoughRoomOnRight = function() {
|
1401 |
-
return dropLeft + dropWidth <= viewPortRight;
|
1402 |
-
},
|
1403 |
-
enoughRoomOnLeft = function() {
|
1404 |
-
return offset.left + viewPortRight + container.outerWidth(false) > dropWidth;
|
1405 |
-
},
|
1406 |
-
aboveNow = $dropdown.hasClass("select2-drop-above"),
|
1407 |
-
bodyOffset,
|
1408 |
-
above,
|
1409 |
-
changeDirection,
|
1410 |
-
css,
|
1411 |
-
resultsListNode;
|
1412 |
-
|
1413 |
-
// always prefer the current above/below alignment, unless there is not enough room
|
1414 |
-
if (aboveNow) {
|
1415 |
-
above = true;
|
1416 |
-
if (!enoughRoomAbove && enoughRoomBelow) {
|
1417 |
-
changeDirection = true;
|
1418 |
-
above = false;
|
1419 |
-
}
|
1420 |
-
} else {
|
1421 |
-
above = false;
|
1422 |
-
if (!enoughRoomBelow && enoughRoomAbove) {
|
1423 |
-
changeDirection = true;
|
1424 |
-
above = true;
|
1425 |
-
}
|
1426 |
-
}
|
1427 |
-
|
1428 |
-
//if we are changing direction we need to get positions when dropdown is hidden;
|
1429 |
-
if (changeDirection) {
|
1430 |
-
$dropdown.hide();
|
1431 |
-
offset = this.container.offset();
|
1432 |
-
height = this.container.outerHeight(false);
|
1433 |
-
width = this.container.outerWidth(false);
|
1434 |
-
dropHeight = $dropdown.outerHeight(false);
|
1435 |
-
viewPortRight = $window.scrollLeft() + windowWidth;
|
1436 |
-
viewportBottom = $window.scrollTop() + windowHeight;
|
1437 |
-
dropTop = offset.top + height;
|
1438 |
-
dropLeft = offset.left;
|
1439 |
-
dropWidth = $dropdown.outerWidth(false);
|
1440 |
-
$dropdown.show();
|
1441 |
-
|
1442 |
-
// fix so the cursor does not move to the left within the search-textbox in IE
|
1443 |
-
this.focusSearch();
|
1444 |
-
}
|
1445 |
-
|
1446 |
-
if (this.opts.dropdownAutoWidth) {
|
1447 |
-
resultsListNode = $('.select2-results', $dropdown)[0];
|
1448 |
-
$dropdown.addClass('select2-drop-auto-width');
|
1449 |
-
$dropdown.css('width', '');
|
1450 |
-
// Add scrollbar width to dropdown if vertical scrollbar is present
|
1451 |
-
dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
|
1452 |
-
dropWidth > width ? width = dropWidth : dropWidth = width;
|
1453 |
-
dropHeight = $dropdown.outerHeight(false);
|
1454 |
-
}
|
1455 |
-
else {
|
1456 |
-
this.container.removeClass('select2-drop-auto-width');
|
1457 |
-
}
|
1458 |
-
|
1459 |
-
//console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
|
1460 |
-
//console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
|
1461 |
-
|
1462 |
-
// fix positioning when body has an offset and is not position: static
|
1463 |
-
if (this.body.css('position') !== 'static') {
|
1464 |
-
bodyOffset = this.body.offset();
|
1465 |
-
dropTop -= bodyOffset.top;
|
1466 |
-
dropLeft -= bodyOffset.left;
|
1467 |
-
}
|
1468 |
-
|
1469 |
-
if (!enoughRoomOnRight() && enoughRoomOnLeft()) {
|
1470 |
-
dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
|
1471 |
-
}
|
1472 |
-
|
1473 |
-
css = {
|
1474 |
-
left: dropLeft,
|
1475 |
-
width: width
|
1476 |
-
};
|
1477 |
-
|
1478 |
-
if (above) {
|
1479 |
-
this.container.addClass("select2-drop-above");
|
1480 |
-
$dropdown.addClass("select2-drop-above");
|
1481 |
-
dropHeight = $dropdown.outerHeight(false);
|
1482 |
-
css.top = offset.top - dropHeight;
|
1483 |
-
css.bottom = 'auto';
|
1484 |
-
}
|
1485 |
-
else {
|
1486 |
-
css.top = dropTop;
|
1487 |
-
css.bottom = 'auto';
|
1488 |
-
this.container.removeClass("select2-drop-above");
|
1489 |
-
$dropdown.removeClass("select2-drop-above");
|
1490 |
-
}
|
1491 |
-
css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
|
1492 |
-
|
1493 |
-
$dropdown.css(css);
|
1494 |
-
},
|
1495 |
-
|
1496 |
-
// abstract
|
1497 |
-
shouldOpen: function() {
|
1498 |
-
var event;
|
1499 |
-
|
1500 |
-
if (this.opened()) return false;
|
1501 |
-
|
1502 |
-
if (this._enabled === false || this._readonly === true) return false;
|
1503 |
-
|
1504 |
-
event = $.Event("select2-opening");
|
1505 |
-
this.opts.element.trigger(event);
|
1506 |
-
return !event.isDefaultPrevented();
|
1507 |
-
},
|
1508 |
-
|
1509 |
-
// abstract
|
1510 |
-
clearDropdownAlignmentPreference: function() {
|
1511 |
-
// clear the classes used to figure out the preference of where the dropdown should be opened
|
1512 |
-
this.container.removeClass("select2-drop-above");
|
1513 |
-
this.dropdown.removeClass("select2-drop-above");
|
1514 |
-
},
|
1515 |
-
|
1516 |
-
/**
|
1517 |
-
* Opens the dropdown
|
1518 |
-
*
|
1519 |
-
* @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
|
1520 |
-
* the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
|
1521 |
-
*/
|
1522 |
-
// abstract
|
1523 |
-
open: function () {
|
1524 |
-
|
1525 |
-
if (!this.shouldOpen()) return false;
|
1526 |
-
|
1527 |
-
this.opening();
|
1528 |
-
|
1529 |
-
// Only bind the document mousemove when the dropdown is visible
|
1530 |
-
$document.on("mousemove.select2Event", function (e) {
|
1531 |
-
lastMousePosition.x = e.pageX;
|
1532 |
-
lastMousePosition.y = e.pageY;
|
1533 |
-
});
|
1534 |
-
|
1535 |
-
return true;
|
1536 |
-
},
|
1537 |
-
|
1538 |
-
/**
|
1539 |
-
* Performs the opening of the dropdown
|
1540 |
-
*/
|
1541 |
-
// abstract
|
1542 |
-
opening: function() {
|
1543 |
-
var cid = this.containerEventName,
|
1544 |
-
scroll = "scroll." + cid,
|
1545 |
-
resize = "resize."+cid,
|
1546 |
-
orient = "orientationchange."+cid,
|
1547 |
-
mask;
|
1548 |
-
|
1549 |
-
this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
|
1550 |
-
|
1551 |
-
this.clearDropdownAlignmentPreference();
|
1552 |
-
|
1553 |
-
if(this.dropdown[0] !== this.body.children().last()[0]) {
|
1554 |
-
this.dropdown.detach().appendTo(this.body);
|
1555 |
-
}
|
1556 |
-
|
1557 |
-
// create the dropdown mask if doesn't already exist
|
1558 |
-
mask = $("#select2-drop-mask");
|
1559 |
-
if (mask.length === 0) {
|
1560 |
-
mask = $(document.createElement("div"));
|
1561 |
-
mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
|
1562 |
-
mask.hide();
|
1563 |
-
mask.appendTo(this.body);
|
1564 |
-
mask.on("mousedown touchstart click", function (e) {
|
1565 |
-
// Prevent IE from generating a click event on the body
|
1566 |
-
reinsertElement(mask);
|
1567 |
-
|
1568 |
-
var dropdown = $("#select2-drop"), self;
|
1569 |
-
if (dropdown.length > 0) {
|
1570 |
-
self=dropdown.data("select2");
|
1571 |
-
if (self.opts.selectOnBlur) {
|
1572 |
-
self.selectHighlighted({noFocus: true});
|
1573 |
-
}
|
1574 |
-
self.close();
|
1575 |
-
e.preventDefault();
|
1576 |
-
e.stopPropagation();
|
1577 |
-
}
|
1578 |
-
});
|
1579 |
-
}
|
1580 |
-
|
1581 |
-
// ensure the mask is always right before the dropdown
|
1582 |
-
if (this.dropdown.prev()[0] !== mask[0]) {
|
1583 |
-
this.dropdown.before(mask);
|
1584 |
-
}
|
1585 |
-
|
1586 |
-
// move the global id to the correct dropdown
|
1587 |
-
$("#select2-drop").removeAttr("id");
|
1588 |
-
this.dropdown.attr("id", "select2-drop");
|
1589 |
-
|
1590 |
-
// show the elements
|
1591 |
-
mask.show();
|
1592 |
-
|
1593 |
-
this.positionDropdown();
|
1594 |
-
this.dropdown.show();
|
1595 |
-
this.positionDropdown();
|
1596 |
-
|
1597 |
-
this.dropdown.addClass("select2-drop-active");
|
1598 |
-
|
1599 |
-
// attach listeners to events that can change the position of the container and thus require
|
1600 |
-
// the position of the dropdown to be updated as well so it does not come unglued from the container
|
1601 |
-
var that = this;
|
1602 |
-
this.container.parents().add(window).each(function () {
|
1603 |
-
$(this).on(resize+" "+scroll+" "+orient, function (e) {
|
1604 |
-
if (that.opened()) that.positionDropdown();
|
1605 |
-
});
|
1606 |
-
});
|
1607 |
-
|
1608 |
-
|
1609 |
-
},
|
1610 |
-
|
1611 |
-
// abstract
|
1612 |
-
close: function () {
|
1613 |
-
if (!this.opened()) return;
|
1614 |
-
|
1615 |
-
var cid = this.containerEventName,
|
1616 |
-
scroll = "scroll." + cid,
|
1617 |
-
resize = "resize."+cid,
|
1618 |
-
orient = "orientationchange."+cid;
|
1619 |
-
|
1620 |
-
// unbind event listeners
|
1621 |
-
this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
|
1622 |
-
|
1623 |
-
this.clearDropdownAlignmentPreference();
|
1624 |
-
|
1625 |
-
$("#select2-drop-mask").hide();
|
1626 |
-
this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
|
1627 |
-
this.dropdown.hide();
|
1628 |
-
this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
|
1629 |
-
this.results.empty();
|
1630 |
-
|
1631 |
-
// Now that the dropdown is closed, unbind the global document mousemove event
|
1632 |
-
$document.off("mousemove.select2Event");
|
1633 |
-
|
1634 |
-
this.clearSearch();
|
1635 |
-
this.search.removeClass("select2-active");
|
1636 |
-
|
1637 |
-
// Remove the aria active descendant for highlighted element
|
1638 |
-
this.search.removeAttr("aria-activedescendant");
|
1639 |
-
this.opts.element.trigger($.Event("select2-close"));
|
1640 |
-
},
|
1641 |
-
|
1642 |
-
/**
|
1643 |
-
* Opens control, sets input value, and updates results.
|
1644 |
-
*/
|
1645 |
-
// abstract
|
1646 |
-
externalSearch: function (term) {
|
1647 |
-
this.open();
|
1648 |
-
this.search.val(term);
|
1649 |
-
this.updateResults(false);
|
1650 |
-
},
|
1651 |
-
|
1652 |
-
// abstract
|
1653 |
-
clearSearch: function () {
|
1654 |
-
|
1655 |
-
},
|
1656 |
-
|
1657 |
-
/**
|
1658 |
-
* @return {Boolean} Whether or not search value was changed.
|
1659 |
-
* @private
|
1660 |
-
*/
|
1661 |
-
prefillNextSearchTerm: function () {
|
1662 |
-
// initializes search's value with nextSearchTerm (if defined by user)
|
1663 |
-
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
1664 |
-
if(this.search.val() !== "") {
|
1665 |
-
return false;
|
1666 |
-
}
|
1667 |
-
|
1668 |
-
var nextSearchTerm = this.opts.nextSearchTerm(this.data(), this.lastSearchTerm);
|
1669 |
-
if(nextSearchTerm !== undefined){
|
1670 |
-
this.search.val(nextSearchTerm);
|
1671 |
-
this.search.select();
|
1672 |
-
return true;
|
1673 |
-
}
|
1674 |
-
|
1675 |
-
return false;
|
1676 |
-
},
|
1677 |
-
|
1678 |
-
//abstract
|
1679 |
-
getMaximumSelectionSize: function() {
|
1680 |
-
return evaluate(this.opts.maximumSelectionSize, this.opts.element);
|
1681 |
-
},
|
1682 |
-
|
1683 |
-
// abstract
|
1684 |
-
ensureHighlightVisible: function () {
|
1685 |
-
var results = this.results, children, index, child, hb, rb, y, more, topOffset;
|
1686 |
-
|
1687 |
-
index = this.highlight();
|
1688 |
-
|
1689 |
-
if (index < 0) return;
|
1690 |
-
|
1691 |
-
if (index == 0) {
|
1692 |
-
|
1693 |
-
// if the first element is highlighted scroll all the way to the top,
|
1694 |
-
// that way any unselectable headers above it will also be scrolled
|
1695 |
-
// into view
|
1696 |
-
|
1697 |
-
results.scrollTop(0);
|
1698 |
-
return;
|
1699 |
-
}
|
1700 |
-
|
1701 |
-
children = this.findHighlightableChoices().find('.select2-result-label');
|
1702 |
-
|
1703 |
-
child = $(children[index]);
|
1704 |
-
|
1705 |
-
topOffset = (child.offset() || {}).top || 0;
|
1706 |
-
|
1707 |
-
hb = topOffset + child.outerHeight(true);
|
1708 |
-
|
1709 |
-
// if this is the last child lets also make sure select2-more-results is visible
|
1710 |
-
if (index === children.length - 1) {
|
1711 |
-
more = results.find("li.select2-more-results");
|
1712 |
-
if (more.length > 0) {
|
1713 |
-
hb = more.offset().top + more.outerHeight(true);
|
1714 |
-
}
|
1715 |
-
}
|
1716 |
-
|
1717 |
-
rb = results.offset().top + results.outerHeight(false);
|
1718 |
-
if (hb > rb) {
|
1719 |
-
results.scrollTop(results.scrollTop() + (hb - rb));
|
1720 |
-
}
|
1721 |
-
y = topOffset - results.offset().top;
|
1722 |
-
|
1723 |
-
// make sure the top of the element is visible
|
1724 |
-
if (y < 0 && child.css('display') != 'none' ) {
|
1725 |
-
results.scrollTop(results.scrollTop() + y); // y is negative
|
1726 |
-
}
|
1727 |
-
},
|
1728 |
-
|
1729 |
-
// abstract
|
1730 |
-
findHighlightableChoices: function() {
|
1731 |
-
return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
|
1732 |
-
},
|
1733 |
-
|
1734 |
-
// abstract
|
1735 |
-
moveHighlight: function (delta) {
|
1736 |
-
var choices = this.findHighlightableChoices(),
|
1737 |
-
index = this.highlight();
|
1738 |
-
|
1739 |
-
while (index > -1 && index < choices.length) {
|
1740 |
-
index += delta;
|
1741 |
-
var choice = $(choices[index]);
|
1742 |
-
if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
|
1743 |
-
this.highlight(index);
|
1744 |
-
break;
|
1745 |
-
}
|
1746 |
-
}
|
1747 |
-
},
|
1748 |
-
|
1749 |
-
// abstract
|
1750 |
-
highlight: function (index) {
|
1751 |
-
var choices = this.findHighlightableChoices(),
|
1752 |
-
choice,
|
1753 |
-
data;
|
1754 |
-
|
1755 |
-
if (arguments.length === 0) {
|
1756 |
-
return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
|
1757 |
-
}
|
1758 |
-
|
1759 |
-
if (index >= choices.length) index = choices.length - 1;
|
1760 |
-
if (index < 0) index = 0;
|
1761 |
-
|
1762 |
-
this.removeHighlight();
|
1763 |
-
|
1764 |
-
choice = $(choices[index]);
|
1765 |
-
choice.addClass("select2-highlighted");
|
1766 |
-
|
1767 |
-
// ensure assistive technology can determine the active choice
|
1768 |
-
this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
|
1769 |
-
|
1770 |
-
this.ensureHighlightVisible();
|
1771 |
-
|
1772 |
-
this.liveRegion.text(choice.text());
|
1773 |
-
|
1774 |
-
data = choice.data("select2-data");
|
1775 |
-
if (data) {
|
1776 |
-
this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
|
1777 |
-
}
|
1778 |
-
},
|
1779 |
-
|
1780 |
-
removeHighlight: function() {
|
1781 |
-
this.results.find(".select2-highlighted").removeClass("select2-highlighted");
|
1782 |
-
},
|
1783 |
-
|
1784 |
-
touchMoved: function() {
|
1785 |
-
this._touchMoved = true;
|
1786 |
-
},
|
1787 |
-
|
1788 |
-
clearTouchMoved: function() {
|
1789 |
-
this._touchMoved = false;
|
1790 |
-
},
|
1791 |
-
|
1792 |
-
// abstract
|
1793 |
-
countSelectableResults: function() {
|
1794 |
-
return this.findHighlightableChoices().length;
|
1795 |
-
},
|
1796 |
-
|
1797 |
-
// abstract
|
1798 |
-
highlightUnderEvent: function (event) {
|
1799 |
-
var el = $(event.target).closest(".select2-result-selectable");
|
1800 |
-
if (el.length > 0 && !el.is(".select2-highlighted")) {
|
1801 |
-
var choices = this.findHighlightableChoices();
|
1802 |
-
this.highlight(choices.index(el));
|
1803 |
-
} else if (el.length == 0) {
|
1804 |
-
// if we are over an unselectable item remove all highlights
|
1805 |
-
this.removeHighlight();
|
1806 |
-
}
|
1807 |
-
},
|
1808 |
-
|
1809 |
-
// abstract
|
1810 |
-
loadMoreIfNeeded: function () {
|
1811 |
-
var results = this.results,
|
1812 |
-
more = results.find("li.select2-more-results"),
|
1813 |
-
below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
|
1814 |
-
page = this.resultsPage + 1,
|
1815 |
-
self=this,
|
1816 |
-
term=this.search.val(),
|
1817 |
-
context=this.context;
|
1818 |
-
|
1819 |
-
if (more.length === 0) return;
|
1820 |
-
below = more.offset().top - results.offset().top - results.height();
|
1821 |
-
|
1822 |
-
if (below <= this.opts.loadMorePadding) {
|
1823 |
-
more.addClass("select2-active");
|
1824 |
-
this.opts.query({
|
1825 |
-
element: this.opts.element,
|
1826 |
-
term: term,
|
1827 |
-
page: page,
|
1828 |
-
context: context,
|
1829 |
-
matcher: this.opts.matcher,
|
1830 |
-
callback: this.bind(function (data) {
|
1831 |
-
|
1832 |
-
// ignore a response if the select2 has been closed before it was received
|
1833 |
-
if (!self.opened()) return;
|
1834 |
-
|
1835 |
-
|
1836 |
-
self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
|
1837 |
-
self.postprocessResults(data, false, false);
|
1838 |
-
|
1839 |
-
if (data.more===true) {
|
1840 |
-
more.detach().appendTo(results).html(self.opts.escapeMarkup(evaluate(self.opts.formatLoadMore, self.opts.element, page+1)));
|
1841 |
-
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
1842 |
-
} else {
|
1843 |
-
more.remove();
|
1844 |
-
}
|
1845 |
-
self.positionDropdown();
|
1846 |
-
self.resultsPage = page;
|
1847 |
-
self.context = data.context;
|
1848 |
-
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
1849 |
-
})});
|
1850 |
-
}
|
1851 |
-
},
|
1852 |
-
|
1853 |
-
/**
|
1854 |
-
* Default tokenizer function which does nothing
|
1855 |
-
*/
|
1856 |
-
tokenize: function() {
|
1857 |
-
|
1858 |
-
},
|
1859 |
-
|
1860 |
-
/**
|
1861 |
-
* @param initial whether or not this is the call to this method right after the dropdown has been opened
|
1862 |
-
*/
|
1863 |
-
// abstract
|
1864 |
-
updateResults: function (initial) {
|
1865 |
-
var search = this.search,
|
1866 |
-
results = this.results,
|
1867 |
-
opts = this.opts,
|
1868 |
-
data,
|
1869 |
-
self = this,
|
1870 |
-
input,
|
1871 |
-
term = search.val(),
|
1872 |
-
lastTerm = $.data(this.container, "select2-last-term"),
|
1873 |
-
// sequence number used to drop out-of-order responses
|
1874 |
-
queryNumber;
|
1875 |
-
|
1876 |
-
// prevent duplicate queries against the same term
|
1877 |
-
if (initial !== true && lastTerm && equal(term, lastTerm)) return;
|
1878 |
-
|
1879 |
-
$.data(this.container, "select2-last-term", term);
|
1880 |
-
|
1881 |
-
// if the search is currently hidden we do not alter the results
|
1882 |
-
if (initial !== true && (this.showSearchInput === false || !this.opened())) {
|
1883 |
-
return;
|
1884 |
-
}
|
1885 |
-
|
1886 |
-
function postRender() {
|
1887 |
-
search.removeClass("select2-active");
|
1888 |
-
self.positionDropdown();
|
1889 |
-
if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
|
1890 |
-
self.liveRegion.text(results.text());
|
1891 |
-
}
|
1892 |
-
else {
|
1893 |
-
self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable:not(".select2-selected")').length));
|
1894 |
-
}
|
1895 |
-
}
|
1896 |
-
|
1897 |
-
function render(html) {
|
1898 |
-
results.html(html);
|
1899 |
-
postRender();
|
1900 |
-
}
|
1901 |
-
|
1902 |
-
queryNumber = ++this.queryCount;
|
1903 |
-
|
1904 |
-
var maxSelSize = this.getMaximumSelectionSize();
|
1905 |
-
if (maxSelSize >=1) {
|
1906 |
-
data = this.data();
|
1907 |
-
if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
|
1908 |
-
render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
|
1909 |
-
return;
|
1910 |
-
}
|
1911 |
-
}
|
1912 |
-
|
1913 |
-
if (search.val().length < opts.minimumInputLength) {
|
1914 |
-
if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
|
1915 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
|
1916 |
-
} else {
|
1917 |
-
render("");
|
1918 |
-
}
|
1919 |
-
if (initial && this.showSearch) this.showSearch(true);
|
1920 |
-
return;
|
1921 |
-
}
|
1922 |
-
|
1923 |
-
if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
|
1924 |
-
if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
|
1925 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
|
1926 |
-
} else {
|
1927 |
-
render("");
|
1928 |
-
}
|
1929 |
-
return;
|
1930 |
-
}
|
1931 |
-
|
1932 |
-
if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
|
1933 |
-
render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
|
1934 |
-
}
|
1935 |
-
|
1936 |
-
search.addClass("select2-active");
|
1937 |
-
|
1938 |
-
this.removeHighlight();
|
1939 |
-
|
1940 |
-
// give the tokenizer a chance to pre-process the input
|
1941 |
-
input = this.tokenize();
|
1942 |
-
if (input != undefined && input != null) {
|
1943 |
-
search.val(input);
|
1944 |
-
}
|
1945 |
-
|
1946 |
-
this.resultsPage = 1;
|
1947 |
-
|
1948 |
-
opts.query({
|
1949 |
-
element: opts.element,
|
1950 |
-
term: search.val(),
|
1951 |
-
page: this.resultsPage,
|
1952 |
-
context: null,
|
1953 |
-
matcher: opts.matcher,
|
1954 |
-
callback: this.bind(function (data) {
|
1955 |
-
var def; // default choice
|
1956 |
-
|
1957 |
-
// ignore old responses
|
1958 |
-
if (queryNumber != this.queryCount) {
|
1959 |
-
return;
|
1960 |
-
}
|
1961 |
-
|
1962 |
-
// ignore a response if the select2 has been closed before it was received
|
1963 |
-
if (!this.opened()) {
|
1964 |
-
this.search.removeClass("select2-active");
|
1965 |
-
return;
|
1966 |
-
}
|
1967 |
-
|
1968 |
-
// handle ajax error
|
1969 |
-
if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
|
1970 |
-
render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
|
1971 |
-
return;
|
1972 |
-
}
|
1973 |
-
|
1974 |
-
// save context, if any
|
1975 |
-
this.context = (data.context===undefined) ? null : data.context;
|
1976 |
-
// create a default choice and prepend it to the list
|
1977 |
-
if (this.opts.createSearchChoice && search.val() !== "") {
|
1978 |
-
def = this.opts.createSearchChoice.call(self, search.val(), data.results);
|
1979 |
-
if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
|
1980 |
-
if ($(data.results).filter(
|
1981 |
-
function () {
|
1982 |
-
return equal(self.id(this), self.id(def));
|
1983 |
-
}).length === 0) {
|
1984 |
-
this.opts.createSearchChoicePosition(data.results, def);
|
1985 |
-
}
|
1986 |
-
}
|
1987 |
-
}
|
1988 |
-
|
1989 |
-
if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
|
1990 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
|
1991 |
-
if(this.showSearch){
|
1992 |
-
this.showSearch(search.val());
|
1993 |
-
}
|
1994 |
-
return;
|
1995 |
-
}
|
1996 |
-
|
1997 |
-
results.empty();
|
1998 |
-
self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
|
1999 |
-
|
2000 |
-
if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
|
2001 |
-
results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
|
2002 |
-
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
2003 |
-
}
|
2004 |
-
|
2005 |
-
this.postprocessResults(data, initial);
|
2006 |
-
|
2007 |
-
postRender();
|
2008 |
-
|
2009 |
-
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
2010 |
-
})});
|
2011 |
-
},
|
2012 |
-
|
2013 |
-
// abstract
|
2014 |
-
cancel: function () {
|
2015 |
-
this.close();
|
2016 |
-
},
|
2017 |
-
|
2018 |
-
// abstract
|
2019 |
-
blur: function () {
|
2020 |
-
// if selectOnBlur == true, select the currently highlighted option
|
2021 |
-
if (this.opts.selectOnBlur)
|
2022 |
-
this.selectHighlighted({noFocus: true});
|
2023 |
-
|
2024 |
-
this.close();
|
2025 |
-
this.container.removeClass("select2-container-active");
|
2026 |
-
// synonymous to .is(':focus'), which is available in jquery >= 1.6
|
2027 |
-
if (this.search[0] === document.activeElement) { this.search.blur(); }
|
2028 |
-
this.clearSearch();
|
2029 |
-
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
2030 |
-
},
|
2031 |
-
|
2032 |
-
// abstract
|
2033 |
-
focusSearch: function () {
|
2034 |
-
focus(this.search);
|
2035 |
-
},
|
2036 |
-
|
2037 |
-
// abstract
|
2038 |
-
selectHighlighted: function (options) {
|
2039 |
-
if (this._touchMoved) {
|
2040 |
-
this.clearTouchMoved();
|
2041 |
-
return;
|
2042 |
-
}
|
2043 |
-
var index=this.highlight(),
|
2044 |
-
highlighted=this.results.find(".select2-highlighted"),
|
2045 |
-
data = highlighted.closest('.select2-result').data("select2-data");
|
2046 |
-
|
2047 |
-
if (data) {
|
2048 |
-
this.highlight(index);
|
2049 |
-
this.onSelect(data, options);
|
2050 |
-
} else if (options && options.noFocus) {
|
2051 |
-
this.close();
|
2052 |
-
}
|
2053 |
-
},
|
2054 |
-
|
2055 |
-
// abstract
|
2056 |
-
getPlaceholder: function () {
|
2057 |
-
var placeholderOption;
|
2058 |
-
return this.opts.element.attr("placeholder") ||
|
2059 |
-
this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
|
2060 |
-
this.opts.element.data("placeholder") ||
|
2061 |
-
this.opts.placeholder ||
|
2062 |
-
((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
|
2063 |
-
},
|
2064 |
-
|
2065 |
-
// abstract
|
2066 |
-
getPlaceholderOption: function() {
|
2067 |
-
if (this.select) {
|
2068 |
-
var firstOption = this.select.children('option').first();
|
2069 |
-
if (this.opts.placeholderOption !== undefined ) {
|
2070 |
-
//Determine the placeholder option based on the specified placeholderOption setting
|
2071 |
-
return (this.opts.placeholderOption === "first" && firstOption) ||
|
2072 |
-
(typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
|
2073 |
-
} else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
|
2074 |
-
//No explicit placeholder option specified, use the first if it's blank
|
2075 |
-
return firstOption;
|
2076 |
-
}
|
2077 |
-
}
|
2078 |
-
},
|
2079 |
-
|
2080 |
-
/**
|
2081 |
-
* Get the desired width for the container element. This is
|
2082 |
-
* derived first from option `width` passed to select2, then
|
2083 |
-
* the inline 'style' on the original element, and finally
|
2084 |
-
* falls back to the jQuery calculated element width.
|
2085 |
-
*/
|
2086 |
-
// abstract
|
2087 |
-
initContainerWidth: function () {
|
2088 |
-
function resolveContainerWidth() {
|
2089 |
-
var style, attrs, matches, i, l, attr;
|
2090 |
-
|
2091 |
-
if (this.opts.width === "off") {
|
2092 |
-
return null;
|
2093 |
-
} else if (this.opts.width === "element"){
|
2094 |
-
return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
|
2095 |
-
} else if (this.opts.width === "copy" || this.opts.width === "resolve") {
|
2096 |
-
// check if there is inline style on the element that contains width
|
2097 |
-
style = this.opts.element.attr('style');
|
2098 |
-
if (typeof(style) === "string") {
|
2099 |
-
attrs = style.split(';');
|
2100 |
-
for (i = 0, l = attrs.length; i < l; i = i + 1) {
|
2101 |
-
attr = attrs[i].replace(/\s/g, '');
|
2102 |
-
matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
|
2103 |
-
if (matches !== null && matches.length >= 1)
|
2104 |
-
return matches[1];
|
2105 |
-
}
|
2106 |
-
}
|
2107 |
-
|
2108 |
-
if (this.opts.width === "resolve") {
|
2109 |
-
// next check if css('width') can resolve a width that is percent based, this is sometimes possible
|
2110 |
-
// when attached to input type=hidden or elements hidden via css
|
2111 |
-
style = this.opts.element.css('width');
|
2112 |
-
if (style.indexOf("%") > 0) return style;
|
2113 |
-
|
2114 |
-
// finally, fallback on the calculated width of the element
|
2115 |
-
return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
|
2116 |
-
}
|
2117 |
-
|
2118 |
-
return null;
|
2119 |
-
} else if ($.isFunction(this.opts.width)) {
|
2120 |
-
return this.opts.width();
|
2121 |
-
} else {
|
2122 |
-
return this.opts.width;
|
2123 |
-
}
|
2124 |
-
};
|
2125 |
-
|
2126 |
-
var width = resolveContainerWidth.call(this);
|
2127 |
-
if (width !== null) {
|
2128 |
-
this.container.css("width", width);
|
2129 |
-
}
|
2130 |
-
}
|
2131 |
-
});
|
2132 |
-
|
2133 |
-
SingleSelect2 = clazz(AbstractSelect2, {
|
2134 |
-
|
2135 |
-
// single
|
2136 |
-
|
2137 |
-
createContainer: function () {
|
2138 |
-
var container = $(document.createElement("div")).attr({
|
2139 |
-
"class": "select2-container"
|
2140 |
-
}).html([
|
2141 |
-
"<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
|
2142 |
-
" <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>",
|
2143 |
-
" <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
|
2144 |
-
"</a>",
|
2145 |
-
"<label for='' class='select2-offscreen'></label>",
|
2146 |
-
"<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
|
2147 |
-
"<div class='select2-drop select2-display-none'>",
|
2148 |
-
" <div class='select2-search'>",
|
2149 |
-
" <label for='' class='select2-offscreen'></label>",
|
2150 |
-
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
|
2151 |
-
" aria-autocomplete='list' />",
|
2152 |
-
" </div>",
|
2153 |
-
" <ul class='select2-results' role='listbox'>",
|
2154 |
-
" </ul>",
|
2155 |
-
"</div>"].join(""));
|
2156 |
-
return container;
|
2157 |
-
},
|
2158 |
-
|
2159 |
-
// single
|
2160 |
-
enableInterface: function() {
|
2161 |
-
if (this.parent.enableInterface.apply(this, arguments)) {
|
2162 |
-
this.focusser.prop("disabled", !this.isInterfaceEnabled());
|
2163 |
-
}
|
2164 |
-
},
|
2165 |
-
|
2166 |
-
// single
|
2167 |
-
opening: function () {
|
2168 |
-
var el, range, len;
|
2169 |
-
|
2170 |
-
if (this.opts.minimumResultsForSearch >= 0) {
|
2171 |
-
this.showSearch(true);
|
2172 |
-
}
|
2173 |
-
|
2174 |
-
this.parent.opening.apply(this, arguments);
|
2175 |
-
|
2176 |
-
if (this.showSearchInput !== false) {
|
2177 |
-
// IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
|
2178 |
-
// all other browsers handle this just fine
|
2179 |
-
|
2180 |
-
this.search.val(this.focusser.val());
|
2181 |
-
}
|
2182 |
-
if (this.opts.shouldFocusInput(this)) {
|
2183 |
-
this.search.focus();
|
2184 |
-
// move the cursor to the end after focussing, otherwise it will be at the beginning and
|
2185 |
-
// new text will appear *before* focusser.val()
|
2186 |
-
el = this.search.get(0);
|
2187 |
-
if (el.createTextRange) {
|
2188 |
-
range = el.createTextRange();
|
2189 |
-
range.collapse(false);
|
2190 |
-
range.select();
|
2191 |
-
} else if (el.setSelectionRange) {
|
2192 |
-
len = this.search.val().length;
|
2193 |
-
el.setSelectionRange(len, len);
|
2194 |
-
}
|
2195 |
-
}
|
2196 |
-
|
2197 |
-
this.prefillNextSearchTerm();
|
2198 |
-
|
2199 |
-
this.focusser.prop("disabled", true).val("");
|
2200 |
-
this.updateResults(true);
|
2201 |
-
this.opts.element.trigger($.Event("select2-open"));
|
2202 |
-
},
|
2203 |
-
|
2204 |
-
// single
|
2205 |
-
close: function () {
|
2206 |
-
if (!this.opened()) return;
|
2207 |
-
this.parent.close.apply(this, arguments);
|
2208 |
-
|
2209 |
-
this.focusser.prop("disabled", false);
|
2210 |
-
|
2211 |
-
if (this.opts.shouldFocusInput(this)) {
|
2212 |
-
this.focusser.focus();
|
2213 |
-
}
|
2214 |
-
},
|
2215 |
-
|
2216 |
-
// single
|
2217 |
-
focus: function () {
|
2218 |
-
if (this.opened()) {
|
2219 |
-
this.close();
|
2220 |
-
} else {
|
2221 |
-
this.focusser.prop("disabled", false);
|
2222 |
-
if (this.opts.shouldFocusInput(this)) {
|
2223 |
-
this.focusser.focus();
|
2224 |
-
}
|
2225 |
-
}
|
2226 |
-
},
|
2227 |
-
|
2228 |
-
// single
|
2229 |
-
isFocused: function () {
|
2230 |
-
return this.container.hasClass("select2-container-active");
|
2231 |
-
},
|
2232 |
-
|
2233 |
-
// single
|
2234 |
-
cancel: function () {
|
2235 |
-
this.parent.cancel.apply(this, arguments);
|
2236 |
-
this.focusser.prop("disabled", false);
|
2237 |
-
|
2238 |
-
if (this.opts.shouldFocusInput(this)) {
|
2239 |
-
this.focusser.focus();
|
2240 |
-
}
|
2241 |
-
},
|
2242 |
-
|
2243 |
-
// single
|
2244 |
-
destroy: function() {
|
2245 |
-
$("label[for='" + this.focusser.attr('id') + "']")
|
2246 |
-
.attr('for', this.opts.element.attr("id"));
|
2247 |
-
this.parent.destroy.apply(this, arguments);
|
2248 |
-
|
2249 |
-
cleanupJQueryElements.call(this,
|
2250 |
-
"selection",
|
2251 |
-
"focusser"
|
2252 |
-
);
|
2253 |
-
},
|
2254 |
-
|
2255 |
-
// single
|
2256 |
-
initContainer: function () {
|
2257 |
-
|
2258 |
-
var selection,
|
2259 |
-
container = this.container,
|
2260 |
-
dropdown = this.dropdown,
|
2261 |
-
idSuffix = nextUid(),
|
2262 |
-
elementLabel;
|
2263 |
-
|
2264 |
-
if (this.opts.minimumResultsForSearch < 0) {
|
2265 |
-
this.showSearch(false);
|
2266 |
-
} else {
|
2267 |
-
this.showSearch(true);
|
2268 |
-
}
|
2269 |
-
|
2270 |
-
this.selection = selection = container.find(".select2-choice");
|
2271 |
-
|
2272 |
-
this.focusser = container.find(".select2-focusser");
|
2273 |
-
|
2274 |
-
// add aria associations
|
2275 |
-
selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
|
2276 |
-
this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
|
2277 |
-
this.results.attr("id", "select2-results-"+idSuffix);
|
2278 |
-
this.search.attr("aria-owns", "select2-results-"+idSuffix);
|
2279 |
-
|
2280 |
-
// rewrite labels from original element to focusser
|
2281 |
-
this.focusser.attr("id", "s2id_autogen"+idSuffix);
|
2282 |
-
|
2283 |
-
elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
|
2284 |
-
this.opts.element.on('focus.select2', this.bind(function () { this.focus(); }));
|
2285 |
-
|
2286 |
-
this.focusser.prev()
|
2287 |
-
.text(elementLabel.text())
|
2288 |
-
.attr('for', this.focusser.attr('id'));
|
2289 |
-
|
2290 |
-
// Ensure the original element retains an accessible name
|
2291 |
-
var originalTitle = this.opts.element.attr("title");
|
2292 |
-
this.opts.element.attr("title", (originalTitle || elementLabel.text()));
|
2293 |
-
|
2294 |
-
this.focusser.attr("tabindex", this.elementTabIndex);
|
2295 |
-
|
2296 |
-
// write label for search field using the label from the focusser element
|
2297 |
-
this.search.attr("id", this.focusser.attr('id') + '_search');
|
2298 |
-
|
2299 |
-
this.search.prev()
|
2300 |
-
.text($("label[for='" + this.focusser.attr('id') + "']").text())
|
2301 |
-
.attr('for', this.search.attr('id'));
|
2302 |
-
|
2303 |
-
this.search.on("keydown", this.bind(function (e) {
|
2304 |
-
if (!this.isInterfaceEnabled()) return;
|
2305 |
-
|
2306 |
-
// filter 229 keyCodes (input method editor is processing key input)
|
2307 |
-
if (229 == e.keyCode) return;
|
2308 |
-
|
2309 |
-
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
2310 |
-
// prevent the page from scrolling
|
2311 |
-
killEvent(e);
|
2312 |
-
return;
|
2313 |
-
}
|
2314 |
-
|
2315 |
-
switch (e.which) {
|
2316 |
-
case KEY.UP:
|
2317 |
-
case KEY.DOWN:
|
2318 |
-
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
2319 |
-
killEvent(e);
|
2320 |
-
return;
|
2321 |
-
case KEY.ENTER:
|
2322 |
-
this.selectHighlighted();
|
2323 |
-
killEvent(e);
|
2324 |
-
return;
|
2325 |
-
case KEY.TAB:
|
2326 |
-
this.selectHighlighted({noFocus: true});
|
2327 |
-
return;
|
2328 |
-
case KEY.ESC:
|
2329 |
-
this.cancel(e);
|
2330 |
-
killEvent(e);
|
2331 |
-
return;
|
2332 |
-
}
|
2333 |
-
}));
|
2334 |
-
|
2335 |
-
this.search.on("blur", this.bind(function(e) {
|
2336 |
-
// a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
|
2337 |
-
// without this the search field loses focus which is annoying
|
2338 |
-
if (document.activeElement === this.body.get(0)) {
|
2339 |
-
window.setTimeout(this.bind(function() {
|
2340 |
-
if (this.opened() && this.results && this.results.length > 1) {
|
2341 |
-
this.search.focus();
|
2342 |
-
}
|
2343 |
-
}), 0);
|
2344 |
-
}
|
2345 |
-
}));
|
2346 |
-
|
2347 |
-
this.focusser.on("keydown", this.bind(function (e) {
|
2348 |
-
if (!this.isInterfaceEnabled()) return;
|
2349 |
-
|
2350 |
-
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
|
2351 |
-
return;
|
2352 |
-
}
|
2353 |
-
|
2354 |
-
if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
|
2355 |
-
killEvent(e);
|
2356 |
-
return;
|
2357 |
-
}
|
2358 |
-
|
2359 |
-
if (e.which == KEY.DOWN || e.which == KEY.UP
|
2360 |
-
|| (e.which == KEY.ENTER && this.opts.openOnEnter)) {
|
2361 |
-
|
2362 |
-
if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
|
2363 |
-
|
2364 |
-
this.open();
|
2365 |
-
killEvent(e);
|
2366 |
-
return;
|
2367 |
-
}
|
2368 |
-
|
2369 |
-
if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
|
2370 |
-
if (this.opts.allowClear) {
|
2371 |
-
this.clear();
|
2372 |
-
}
|
2373 |
-
killEvent(e);
|
2374 |
-
return;
|
2375 |
-
}
|
2376 |
-
}));
|
2377 |
-
|
2378 |
-
|
2379 |
-
installKeyUpChangeEvent(this.focusser);
|
2380 |
-
this.focusser.on("keyup-change input", this.bind(function(e) {
|
2381 |
-
if (this.opts.minimumResultsForSearch >= 0) {
|
2382 |
-
e.stopPropagation();
|
2383 |
-
if (this.opened()) return;
|
2384 |
-
this.open();
|
2385 |
-
}
|
2386 |
-
}));
|
2387 |
-
|
2388 |
-
selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
|
2389 |
-
if (!this.isInterfaceEnabled()) {
|
2390 |
-
return;
|
2391 |
-
}
|
2392 |
-
|
2393 |
-
this.clear();
|
2394 |
-
killEventImmediately(e);
|
2395 |
-
this.close();
|
2396 |
-
|
2397 |
-
if (this.selection) {
|
2398 |
-
this.selection.focus();
|
2399 |
-
}
|
2400 |
-
}));
|
2401 |
-
|
2402 |
-
selection.on("mousedown touchstart", this.bind(function (e) {
|
2403 |
-
// Prevent IE from generating a click event on the body
|
2404 |
-
reinsertElement(selection);
|
2405 |
-
|
2406 |
-
if (!this.container.hasClass("select2-container-active")) {
|
2407 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
2408 |
-
}
|
2409 |
-
|
2410 |
-
if (this.opened()) {
|
2411 |
-
this.close();
|
2412 |
-
} else if (this.isInterfaceEnabled()) {
|
2413 |
-
this.open();
|
2414 |
-
}
|
2415 |
-
|
2416 |
-
killEvent(e);
|
2417 |
-
}));
|
2418 |
-
|
2419 |
-
dropdown.on("mousedown touchstart", this.bind(function() {
|
2420 |
-
if (this.opts.shouldFocusInput(this)) {
|
2421 |
-
this.search.focus();
|
2422 |
-
}
|
2423 |
-
}));
|
2424 |
-
|
2425 |
-
selection.on("focus", this.bind(function(e) {
|
2426 |
-
killEvent(e);
|
2427 |
-
}));
|
2428 |
-
|
2429 |
-
this.focusser.on("focus", this.bind(function(){
|
2430 |
-
if (!this.container.hasClass("select2-container-active")) {
|
2431 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
2432 |
-
}
|
2433 |
-
this.container.addClass("select2-container-active");
|
2434 |
-
})).on("blur", this.bind(function() {
|
2435 |
-
if (!this.opened()) {
|
2436 |
-
this.container.removeClass("select2-container-active");
|
2437 |
-
this.opts.element.trigger($.Event("select2-blur"));
|
2438 |
-
}
|
2439 |
-
}));
|
2440 |
-
this.search.on("focus", this.bind(function(){
|
2441 |
-
if (!this.container.hasClass("select2-container-active")) {
|
2442 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
2443 |
-
}
|
2444 |
-
this.container.addClass("select2-container-active");
|
2445 |
-
}));
|
2446 |
-
|
2447 |
-
this.initContainerWidth();
|
2448 |
-
this.opts.element.hide();
|
2449 |
-
this.setPlaceholder();
|
2450 |
-
|
2451 |
-
},
|
2452 |
-
|
2453 |
-
// single
|
2454 |
-
clear: function(triggerChange) {
|
2455 |
-
var data=this.selection.data("select2-data");
|
2456 |
-
if (data) { // guard against queued quick consecutive clicks
|
2457 |
-
var evt = $.Event("select2-clearing");
|
2458 |
-
this.opts.element.trigger(evt);
|
2459 |
-
if (evt.isDefaultPrevented()) {
|
2460 |
-
return;
|
2461 |
-
}
|
2462 |
-
var placeholderOption = this.getPlaceholderOption();
|
2463 |
-
this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
|
2464 |
-
this.selection.find(".select2-chosen").empty();
|
2465 |
-
this.selection.removeData("select2-data");
|
2466 |
-
this.setPlaceholder();
|
2467 |
-
|
2468 |
-
if (triggerChange !== false){
|
2469 |
-
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
2470 |
-
this.triggerChange({removed:data});
|
2471 |
-
}
|
2472 |
-
}
|
2473 |
-
},
|
2474 |
-
|
2475 |
-
/**
|
2476 |
-
* Sets selection based on source element's value
|
2477 |
-
*/
|
2478 |
-
// single
|
2479 |
-
initSelection: function () {
|
2480 |
-
var selected;
|
2481 |
-
if (this.isPlaceholderOptionSelected()) {
|
2482 |
-
this.updateSelection(null);
|
2483 |
-
this.close();
|
2484 |
-
this.setPlaceholder();
|
2485 |
-
} else {
|
2486 |
-
var self = this;
|
2487 |
-
this.opts.initSelection.call(null, this.opts.element, function(selected){
|
2488 |
-
if (selected !== undefined && selected !== null) {
|
2489 |
-
self.updateSelection(selected);
|
2490 |
-
self.close();
|
2491 |
-
self.setPlaceholder();
|
2492 |
-
self.lastSearchTerm = self.search.val();
|
2493 |
-
}
|
2494 |
-
});
|
2495 |
-
}
|
2496 |
-
},
|
2497 |
-
|
2498 |
-
isPlaceholderOptionSelected: function() {
|
2499 |
-
var placeholderOption;
|
2500 |
-
if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
|
2501 |
-
return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
|
2502 |
-
|| (this.opts.element.val() === "")
|
2503 |
-
|| (this.opts.element.val() === undefined)
|
2504 |
-
|| (this.opts.element.val() === null);
|
2505 |
-
},
|
2506 |
-
|
2507 |
-
// single
|
2508 |
-
prepareOpts: function () {
|
2509 |
-
var opts = this.parent.prepareOpts.apply(this, arguments),
|
2510 |
-
self=this;
|
2511 |
-
|
2512 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
2513 |
-
// install the selection initializer
|
2514 |
-
opts.initSelection = function (element, callback) {
|
2515 |
-
var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
|
2516 |
-
// a single select box always has a value, no need to null check 'selected'
|
2517 |
-
callback(self.optionToData(selected));
|
2518 |
-
};
|
2519 |
-
} else if ("data" in opts) {
|
2520 |
-
// install default initSelection when applied to hidden input and data is local
|
2521 |
-
opts.initSelection = opts.initSelection || function (element, callback) {
|
2522 |
-
var id = element.val();
|
2523 |
-
//search in data by id, storing the actual matching item
|
2524 |
-
var match = null;
|
2525 |
-
opts.query({
|
2526 |
-
matcher: function(term, text, el){
|
2527 |
-
var is_match = equal(id, opts.id(el));
|
2528 |
-
if (is_match) {
|
2529 |
-
match = el;
|
2530 |
-
}
|
2531 |
-
return is_match;
|
2532 |
-
},
|
2533 |
-
callback: !$.isFunction(callback) ? $.noop : function() {
|
2534 |
-
callback(match);
|
2535 |
-
}
|
2536 |
-
});
|
2537 |
-
};
|
2538 |
-
}
|
2539 |
-
|
2540 |
-
return opts;
|
2541 |
-
},
|
2542 |
-
|
2543 |
-
// single
|
2544 |
-
getPlaceholder: function() {
|
2545 |
-
// if a placeholder is specified on a single select without a valid placeholder option ignore it
|
2546 |
-
if (this.select) {
|
2547 |
-
if (this.getPlaceholderOption() === undefined) {
|
2548 |
-
return undefined;
|
2549 |
-
}
|
2550 |
-
}
|
2551 |
-
|
2552 |
-
return this.parent.getPlaceholder.apply(this, arguments);
|
2553 |
-
},
|
2554 |
-
|
2555 |
-
// single
|
2556 |
-
setPlaceholder: function () {
|
2557 |
-
var placeholder = this.getPlaceholder();
|
2558 |
-
|
2559 |
-
if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
|
2560 |
-
|
2561 |
-
// check for a placeholder option if attached to a select
|
2562 |
-
if (this.select && this.getPlaceholderOption() === undefined) return;
|
2563 |
-
|
2564 |
-
this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
|
2565 |
-
|
2566 |
-
this.selection.addClass("select2-default");
|
2567 |
-
|
2568 |
-
this.container.removeClass("select2-allowclear");
|
2569 |
-
}
|
2570 |
-
},
|
2571 |
-
|
2572 |
-
// single
|
2573 |
-
postprocessResults: function (data, initial, noHighlightUpdate) {
|
2574 |
-
var selected = 0, self = this, showSearchInput = true;
|
2575 |
-
|
2576 |
-
// find the selected element in the result list
|
2577 |
-
|
2578 |
-
this.findHighlightableChoices().each2(function (i, elm) {
|
2579 |
-
if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
|
2580 |
-
selected = i;
|
2581 |
-
return false;
|
2582 |
-
}
|
2583 |
-
});
|
2584 |
-
|
2585 |
-
// and highlight it
|
2586 |
-
if (noHighlightUpdate !== false) {
|
2587 |
-
if (initial === true && selected >= 0) {
|
2588 |
-
this.highlight(selected);
|
2589 |
-
} else {
|
2590 |
-
this.highlight(0);
|
2591 |
-
}
|
2592 |
-
}
|
2593 |
-
|
2594 |
-
// hide the search box if this is the first we got the results and there are enough of them for search
|
2595 |
-
|
2596 |
-
if (initial === true) {
|
2597 |
-
var min = this.opts.minimumResultsForSearch;
|
2598 |
-
if (min >= 0) {
|
2599 |
-
this.showSearch(countResults(data.results) >= min);
|
2600 |
-
}
|
2601 |
-
}
|
2602 |
-
},
|
2603 |
-
|
2604 |
-
// single
|
2605 |
-
showSearch: function(showSearchInput) {
|
2606 |
-
if (this.showSearchInput === showSearchInput) return;
|
2607 |
-
|
2608 |
-
this.showSearchInput = showSearchInput;
|
2609 |
-
|
2610 |
-
this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
|
2611 |
-
this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
|
2612 |
-
//add "select2-with-searchbox" to the container if search box is shown
|
2613 |
-
$(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
|
2614 |
-
},
|
2615 |
-
|
2616 |
-
// single
|
2617 |
-
onSelect: function (data, options) {
|
2618 |
-
|
2619 |
-
if (!this.triggerSelect(data)) { return; }
|
2620 |
-
|
2621 |
-
var old = this.opts.element.val(),
|
2622 |
-
oldData = this.data();
|
2623 |
-
|
2624 |
-
this.opts.element.val(this.id(data));
|
2625 |
-
this.updateSelection(data);
|
2626 |
-
|
2627 |
-
this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
|
2628 |
-
|
2629 |
-
this.lastSearchTerm = this.search.val();
|
2630 |
-
this.close();
|
2631 |
-
|
2632 |
-
if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
|
2633 |
-
this.focusser.focus();
|
2634 |
-
}
|
2635 |
-
|
2636 |
-
if (!equal(old, this.id(data))) {
|
2637 |
-
this.triggerChange({ added: data, removed: oldData });
|
2638 |
-
}
|
2639 |
-
},
|
2640 |
-
|
2641 |
-
// single
|
2642 |
-
updateSelection: function (data) {
|
2643 |
-
|
2644 |
-
var container=this.selection.find(".select2-chosen"), formatted, cssClass;
|
2645 |
-
|
2646 |
-
this.selection.data("select2-data", data);
|
2647 |
-
|
2648 |
-
container.empty();
|
2649 |
-
if (data !== null) {
|
2650 |
-
formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
|
2651 |
-
}
|
2652 |
-
if (formatted !== undefined) {
|
2653 |
-
container.append(formatted);
|
2654 |
-
}
|
2655 |
-
cssClass=this.opts.formatSelectionCssClass(data, container);
|
2656 |
-
if (cssClass !== undefined) {
|
2657 |
-
container.addClass(cssClass);
|
2658 |
-
}
|
2659 |
-
|
2660 |
-
this.selection.removeClass("select2-default");
|
2661 |
-
|
2662 |
-
if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
|
2663 |
-
this.container.addClass("select2-allowclear");
|
2664 |
-
}
|
2665 |
-
},
|
2666 |
-
|
2667 |
-
// single
|
2668 |
-
val: function () {
|
2669 |
-
var val,
|
2670 |
-
triggerChange = false,
|
2671 |
-
data = null,
|
2672 |
-
self = this,
|
2673 |
-
oldData = this.data();
|
2674 |
-
|
2675 |
-
if (arguments.length === 0) {
|
2676 |
-
return this.opts.element.val();
|
2677 |
-
}
|
2678 |
-
|
2679 |
-
val = arguments[0];
|
2680 |
-
|
2681 |
-
if (arguments.length > 1) {
|
2682 |
-
triggerChange = arguments[1];
|
2683 |
-
|
2684 |
-
if (this.opts.debug && console && console.warn) {
|
2685 |
-
console.warn(
|
2686 |
-
'Select2: The second option to `select2("val")` is not supported in Select2 4.0.0. ' +
|
2687 |
-
'The `change` event will always be triggered in 4.0.0.'
|
2688 |
-
);
|
2689 |
-
}
|
2690 |
-
}
|
2691 |
-
|
2692 |
-
if (this.select) {
|
2693 |
-
if (this.opts.debug && console && console.warn) {
|
2694 |
-
console.warn(
|
2695 |
-
'Select2: Setting the value on a <select> using `select2("val")` is no longer supported in 4.0.0. ' +
|
2696 |
-
'You can use the `.val(newValue).trigger("change")` method provided by jQuery instead.'
|
2697 |
-
);
|
2698 |
-
}
|
2699 |
-
|
2700 |
-
this.select
|
2701 |
-
.val(val)
|
2702 |
-
.find("option").filter(function() { return this.selected }).each2(function (i, elm) {
|
2703 |
-
data = self.optionToData(elm);
|
2704 |
-
return false;
|
2705 |
-
});
|
2706 |
-
this.updateSelection(data);
|
2707 |
-
this.setPlaceholder();
|
2708 |
-
if (triggerChange) {
|
2709 |
-
this.triggerChange({added: data, removed:oldData});
|
2710 |
-
}
|
2711 |
-
} else {
|
2712 |
-
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
2713 |
-
if (!val && val !== 0) {
|
2714 |
-
this.clear(triggerChange);
|
2715 |
-
return;
|
2716 |
-
}
|
2717 |
-
if (this.opts.initSelection === undefined) {
|
2718 |
-
throw new Error("cannot call val() if initSelection() is not defined");
|
2719 |
-
}
|
2720 |
-
this.opts.element.val(val);
|
2721 |
-
this.opts.initSelection(this.opts.element, function(data){
|
2722 |
-
self.opts.element.val(!data ? "" : self.id(data));
|
2723 |
-
self.updateSelection(data);
|
2724 |
-
self.setPlaceholder();
|
2725 |
-
if (triggerChange) {
|
2726 |
-
self.triggerChange({added: data, removed:oldData});
|
2727 |
-
}
|
2728 |
-
});
|
2729 |
-
}
|
2730 |
-
},
|
2731 |
-
|
2732 |
-
// single
|
2733 |
-
clearSearch: function () {
|
2734 |
-
this.search.val("");
|
2735 |
-
this.focusser.val("");
|
2736 |
-
},
|
2737 |
-
|
2738 |
-
// single
|
2739 |
-
data: function(value) {
|
2740 |
-
var data,
|
2741 |
-
triggerChange = false;
|
2742 |
-
|
2743 |
-
if (arguments.length === 0) {
|
2744 |
-
data = this.selection.data("select2-data");
|
2745 |
-
if (data == undefined) data = null;
|
2746 |
-
return data;
|
2747 |
-
} else {
|
2748 |
-
if (this.opts.debug && console && console.warn) {
|
2749 |
-
console.warn(
|
2750 |
-
'Select2: The `select2("data")` method can no longer set selected values in 4.0.0, ' +
|
2751 |
-
'consider using the `.val()` method instead.'
|
2752 |
-
);
|
2753 |
-
}
|
2754 |
-
|
2755 |
-
if (arguments.length > 1) {
|
2756 |
-
triggerChange = arguments[1];
|
2757 |
-
}
|
2758 |
-
if (!value) {
|
2759 |
-
this.clear(triggerChange);
|
2760 |
-
} else {
|
2761 |
-
data = this.data();
|
2762 |
-
this.opts.element.val(!value ? "" : this.id(value));
|
2763 |
-
this.updateSelection(value);
|
2764 |
-
if (triggerChange) {
|
2765 |
-
this.triggerChange({added: value, removed:data});
|
2766 |
-
}
|
2767 |
-
}
|
2768 |
-
}
|
2769 |
-
}
|
2770 |
-
});
|
2771 |
-
|
2772 |
-
MultiSelect2 = clazz(AbstractSelect2, {
|
2773 |
-
|
2774 |
-
// multi
|
2775 |
-
createContainer: function () {
|
2776 |
-
var container = $(document.createElement("div")).attr({
|
2777 |
-
"class": "select2-container select2-container-multi"
|
2778 |
-
}).html([
|
2779 |
-
"<ul class='select2-choices'>",
|
2780 |
-
" <li class='select2-search-field'>",
|
2781 |
-
" <label for='' class='select2-offscreen'></label>",
|
2782 |
-
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
|
2783 |
-
" </li>",
|
2784 |
-
"</ul>",
|
2785 |
-
"<div class='select2-drop select2-drop-multi select2-display-none'>",
|
2786 |
-
" <ul class='select2-results'>",
|
2787 |
-
" </ul>",
|
2788 |
-
"</div>"].join(""));
|
2789 |
-
return container;
|
2790 |
-
},
|
2791 |
-
|
2792 |
-
// multi
|
2793 |
-
prepareOpts: function () {
|
2794 |
-
var opts = this.parent.prepareOpts.apply(this, arguments),
|
2795 |
-
self=this;
|
2796 |
-
|
2797 |
-
// TODO validate placeholder is a string if specified
|
2798 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
2799 |
-
// install the selection initializer
|
2800 |
-
opts.initSelection = function (element, callback) {
|
2801 |
-
|
2802 |
-
var data = [];
|
2803 |
-
|
2804 |
-
element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
|
2805 |
-
data.push(self.optionToData(elm));
|
2806 |
-
});
|
2807 |
-
callback(data);
|
2808 |
-
};
|
2809 |
-
} else if ("data" in opts) {
|
2810 |
-
// install default initSelection when applied to hidden input and data is local
|
2811 |
-
opts.initSelection = opts.initSelection || function (element, callback) {
|
2812 |
-
var ids = splitVal(element.val(), opts.separator, opts.transformVal);
|
2813 |
-
//search in data by array of ids, storing matching items in a list
|
2814 |
-
var matches = [];
|
2815 |
-
opts.query({
|
2816 |
-
matcher: function(term, text, el){
|
2817 |
-
var is_match = $.grep(ids, function(id) {
|
2818 |
-
return equal(id, opts.id(el));
|
2819 |
-
}).length;
|
2820 |
-
if (is_match) {
|
2821 |
-
matches.push(el);
|
2822 |
-
}
|
2823 |
-
return is_match;
|
2824 |
-
},
|
2825 |
-
callback: !$.isFunction(callback) ? $.noop : function() {
|
2826 |
-
// reorder matches based on the order they appear in the ids array because right now
|
2827 |
-
// they are in the order in which they appear in data array
|
2828 |
-
var ordered = [];
|
2829 |
-
for (var i = 0; i < ids.length; i++) {
|
2830 |
-
var id = ids[i];
|
2831 |
-
for (var j = 0; j < matches.length; j++) {
|
2832 |
-
var match = matches[j];
|
2833 |
-
if (equal(id, opts.id(match))) {
|
2834 |
-
ordered.push(match);
|
2835 |
-
matches.splice(j, 1);
|
2836 |
-
break;
|
2837 |
-
}
|
2838 |
-
}
|
2839 |
-
}
|
2840 |
-
callback(ordered);
|
2841 |
-
}
|
2842 |
-
});
|
2843 |
-
};
|
2844 |
-
}
|
2845 |
-
|
2846 |
-
return opts;
|
2847 |
-
},
|
2848 |
-
|
2849 |
-
// multi
|
2850 |
-
selectChoice: function (choice) {
|
2851 |
-
|
2852 |
-
var selected = this.container.find(".select2-search-choice-focus");
|
2853 |
-
if (selected.length && choice && choice[0] == selected[0]) {
|
2854 |
-
|
2855 |
-
} else {
|
2856 |
-
if (selected.length) {
|
2857 |
-
this.opts.element.trigger("choice-deselected", selected);
|
2858 |
-
}
|
2859 |
-
selected.removeClass("select2-search-choice-focus");
|
2860 |
-
if (choice && choice.length) {
|
2861 |
-
this.close();
|
2862 |
-
choice.addClass("select2-search-choice-focus");
|
2863 |
-
this.opts.element.trigger("choice-selected", choice);
|
2864 |
-
}
|
2865 |
-
}
|
2866 |
-
},
|
2867 |
-
|
2868 |
-
// multi
|
2869 |
-
destroy: function() {
|
2870 |
-
$("label[for='" + this.search.attr('id') + "']")
|
2871 |
-
.attr('for', this.opts.element.attr("id"));
|
2872 |
-
this.parent.destroy.apply(this, arguments);
|
2873 |
-
|
2874 |
-
cleanupJQueryElements.call(this,
|
2875 |
-
"searchContainer",
|
2876 |
-
"selection"
|
2877 |
-
);
|
2878 |
-
},
|
2879 |
-
|
2880 |
-
// multi
|
2881 |
-
initContainer: function () {
|
2882 |
-
|
2883 |
-
var selector = ".select2-choices", selection;
|
2884 |
-
|
2885 |
-
this.searchContainer = this.container.find(".select2-search-field");
|
2886 |
-
this.selection = selection = this.container.find(selector);
|
2887 |
-
|
2888 |
-
var _this = this;
|
2889 |
-
this.selection.on("click", ".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)", function (e) {
|
2890 |
-
_this.search[0].focus();
|
2891 |
-
_this.selectChoice($(this));
|
2892 |
-
});
|
2893 |
-
|
2894 |
-
// rewrite labels from original element to focusser
|
2895 |
-
this.search.attr("id", "s2id_autogen"+nextUid());
|
2896 |
-
|
2897 |
-
this.search.prev()
|
2898 |
-
.text($("label[for='" + this.opts.element.attr("id") + "']").text())
|
2899 |
-
.attr('for', this.search.attr('id'));
|
2900 |
-
this.opts.element.on('focus.select2', this.bind(function () { this.focus(); }));
|
2901 |
-
|
2902 |
-
this.search.on("input paste", this.bind(function() {
|
2903 |
-
if (this.search.attr('placeholder') && this.search.val().length == 0) return;
|
2904 |
-
if (!this.isInterfaceEnabled()) return;
|
2905 |
-
if (!this.opened()) {
|
2906 |
-
this.open();
|
2907 |
-
}
|
2908 |
-
}));
|
2909 |
-
|
2910 |
-
this.search.attr("tabindex", this.elementTabIndex);
|
2911 |
-
|
2912 |
-
this.keydowns = 0;
|
2913 |
-
this.search.on("keydown", this.bind(function (e) {
|
2914 |
-
if (!this.isInterfaceEnabled()) return;
|
2915 |
-
|
2916 |
-
++this.keydowns;
|
2917 |
-
var selected = selection.find(".select2-search-choice-focus");
|
2918 |
-
var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
|
2919 |
-
var next = selected.next(".select2-search-choice:not(.select2-locked)");
|
2920 |
-
var pos = getCursorInfo(this.search);
|
2921 |
-
|
2922 |
-
if (selected.length &&
|
2923 |
-
(e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
|
2924 |
-
var selectedChoice = selected;
|
2925 |
-
if (e.which == KEY.LEFT && prev.length) {
|
2926 |
-
selectedChoice = prev;
|
2927 |
-
}
|
2928 |
-
else if (e.which == KEY.RIGHT) {
|
2929 |
-
selectedChoice = next.length ? next : null;
|
2930 |
-
}
|
2931 |
-
else if (e.which === KEY.BACKSPACE) {
|
2932 |
-
if (this.unselect(selected.first())) {
|
2933 |
-
this.search.width(10);
|
2934 |
-
selectedChoice = prev.length ? prev : next;
|
2935 |
-
}
|
2936 |
-
} else if (e.which == KEY.DELETE) {
|
2937 |
-
if (this.unselect(selected.first())) {
|
2938 |
-
this.search.width(10);
|
2939 |
-
selectedChoice = next.length ? next : null;
|
2940 |
-
}
|
2941 |
-
} else if (e.which == KEY.ENTER) {
|
2942 |
-
selectedChoice = null;
|
2943 |
-
}
|
2944 |
-
|
2945 |
-
this.selectChoice(selectedChoice);
|
2946 |
-
killEvent(e);
|
2947 |
-
if (!selectedChoice || !selectedChoice.length) {
|
2948 |
-
this.open();
|
2949 |
-
}
|
2950 |
-
return;
|
2951 |
-
} else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
|
2952 |
-
|| e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
|
2953 |
-
|
2954 |
-
this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
|
2955 |
-
killEvent(e);
|
2956 |
-
return;
|
2957 |
-
} else {
|
2958 |
-
this.selectChoice(null);
|
2959 |
-
}
|
2960 |
-
|
2961 |
-
if (this.opened()) {
|
2962 |
-
switch (e.which) {
|
2963 |
-
case KEY.UP:
|
2964 |
-
case KEY.DOWN:
|
2965 |
-
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
2966 |
-
killEvent(e);
|
2967 |
-
return;
|
2968 |
-
case KEY.ENTER:
|
2969 |
-
this.selectHighlighted();
|
2970 |
-
killEvent(e);
|
2971 |
-
return;
|
2972 |
-
case KEY.TAB:
|
2973 |
-
this.selectHighlighted({noFocus:true});
|
2974 |
-
this.close();
|
2975 |
-
return;
|
2976 |
-
case KEY.ESC:
|
2977 |
-
this.cancel(e);
|
2978 |
-
killEvent(e);
|
2979 |
-
return;
|
2980 |
-
}
|
2981 |
-
}
|
2982 |
-
|
2983 |
-
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
|
2984 |
-
|| e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
|
2985 |
-
return;
|
2986 |
-
}
|
2987 |
-
|
2988 |
-
if (e.which === KEY.ENTER) {
|
2989 |
-
if (this.opts.openOnEnter === false) {
|
2990 |
-
return;
|
2991 |
-
} else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
|
2992 |
-
return;
|
2993 |
-
}
|
2994 |
-
}
|
2995 |
-
|
2996 |
-
this.open();
|
2997 |
-
|
2998 |
-
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
2999 |
-
// prevent the page from scrolling
|
3000 |
-
killEvent(e);
|
3001 |
-
}
|
3002 |
-
|
3003 |
-
if (e.which === KEY.ENTER) {
|
3004 |
-
// prevent form from being submitted
|
3005 |
-
killEvent(e);
|
3006 |
-
}
|
3007 |
-
|
3008 |
-
}));
|
3009 |
-
|
3010 |
-
this.search.on("keyup", this.bind(function (e) {
|
3011 |
-
this.keydowns = 0;
|
3012 |
-
this.resizeSearch();
|
3013 |
-
})
|
3014 |
-
);
|
3015 |
-
|
3016 |
-
this.search.on("blur", this.bind(function(e) {
|
3017 |
-
this.container.removeClass("select2-container-active");
|
3018 |
-
this.search.removeClass("select2-focused");
|
3019 |
-
this.selectChoice(null);
|
3020 |
-
if (!this.opened()) this.clearSearch();
|
3021 |
-
e.stopImmediatePropagation();
|
3022 |
-
this.opts.element.trigger($.Event("select2-blur"));
|
3023 |
-
}));
|
3024 |
-
|
3025 |
-
this.container.on("click", selector, this.bind(function (e) {
|
3026 |
-
if (!this.isInterfaceEnabled()) return;
|
3027 |
-
if ($(e.target).closest(".select2-search-choice").length > 0) {
|
3028 |
-
// clicked inside a select2 search choice, do not open
|
3029 |
-
return;
|
3030 |
-
}
|
3031 |
-
this.selectChoice(null);
|
3032 |
-
this.clearPlaceholder();
|
3033 |
-
if (!this.container.hasClass("select2-container-active")) {
|
3034 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
3035 |
-
}
|
3036 |
-
this.open();
|
3037 |
-
this.focusSearch();
|
3038 |
-
e.preventDefault();
|
3039 |
-
}));
|
3040 |
-
|
3041 |
-
this.container.on("focus", selector, this.bind(function () {
|
3042 |
-
if (!this.isInterfaceEnabled()) return;
|
3043 |
-
if (!this.container.hasClass("select2-container-active")) {
|
3044 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
3045 |
-
}
|
3046 |
-
this.container.addClass("select2-container-active");
|
3047 |
-
this.dropdown.addClass("select2-drop-active");
|
3048 |
-
this.clearPlaceholder();
|
3049 |
-
}));
|
3050 |
-
|
3051 |
-
this.initContainerWidth();
|
3052 |
-
this.opts.element.hide();
|
3053 |
-
|
3054 |
-
// set the placeholder if necessary
|
3055 |
-
this.clearSearch();
|
3056 |
-
},
|
3057 |
-
|
3058 |
-
// multi
|
3059 |
-
enableInterface: function() {
|
3060 |
-
if (this.parent.enableInterface.apply(this, arguments)) {
|
3061 |
-
this.search.prop("disabled", !this.isInterfaceEnabled());
|
3062 |
-
}
|
3063 |
-
},
|
3064 |
-
|
3065 |
-
// multi
|
3066 |
-
initSelection: function () {
|
3067 |
-
var data;
|
3068 |
-
if (this.opts.element.val() === "" && this.opts.element.text() === "") {
|
3069 |
-
this.updateSelection([]);
|
3070 |
-
this.close();
|
3071 |
-
// set the placeholder if necessary
|
3072 |
-
this.clearSearch();
|
3073 |
-
}
|
3074 |
-
if (this.select || this.opts.element.val() !== "") {
|
3075 |
-
var self = this;
|
3076 |
-
this.opts.initSelection.call(null, this.opts.element, function(data){
|
3077 |
-
if (data !== undefined && data !== null) {
|
3078 |
-
self.updateSelection(data);
|
3079 |
-
self.close();
|
3080 |
-
// set the placeholder if necessary
|
3081 |
-
self.clearSearch();
|
3082 |
-
}
|
3083 |
-
});
|
3084 |
-
}
|
3085 |
-
},
|
3086 |
-
|
3087 |
-
// multi
|
3088 |
-
clearSearch: function () {
|
3089 |
-
var placeholder = this.getPlaceholder(),
|
3090 |
-
maxWidth = this.getMaxSearchWidth();
|
3091 |
-
|
3092 |
-
if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
|
3093 |
-
this.search.val(placeholder).addClass("select2-default");
|
3094 |
-
// stretch the search box to full width of the container so as much of the placeholder is visible as possible
|
3095 |
-
// we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
|
3096 |
-
this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
|
3097 |
-
} else {
|
3098 |
-
this.search.val("").width(10);
|
3099 |
-
}
|
3100 |
-
},
|
3101 |
-
|
3102 |
-
// multi
|
3103 |
-
clearPlaceholder: function () {
|
3104 |
-
if (this.search.hasClass("select2-default")) {
|
3105 |
-
this.search.val("").removeClass("select2-default");
|
3106 |
-
}
|
3107 |
-
},
|
3108 |
-
|
3109 |
-
// multi
|
3110 |
-
opening: function () {
|
3111 |
-
this.clearPlaceholder(); // should be done before super so placeholder is not used to search
|
3112 |
-
this.resizeSearch();
|
3113 |
-
|
3114 |
-
this.parent.opening.apply(this, arguments);
|
3115 |
-
|
3116 |
-
this.focusSearch();
|
3117 |
-
|
3118 |
-
this.prefillNextSearchTerm();
|
3119 |
-
this.updateResults(true);
|
3120 |
-
|
3121 |
-
if (this.opts.shouldFocusInput(this)) {
|
3122 |
-
this.search.focus();
|
3123 |
-
}
|
3124 |
-
this.opts.element.trigger($.Event("select2-open"));
|
3125 |
-
},
|
3126 |
-
|
3127 |
-
// multi
|
3128 |
-
close: function () {
|
3129 |
-
if (!this.opened()) return;
|
3130 |
-
this.parent.close.apply(this, arguments);
|
3131 |
-
},
|
3132 |
-
|
3133 |
-
// multi
|
3134 |
-
focus: function () {
|
3135 |
-
this.close();
|
3136 |
-
this.search.focus();
|
3137 |
-
},
|
3138 |
-
|
3139 |
-
// multi
|
3140 |
-
isFocused: function () {
|
3141 |
-
return this.search.hasClass("select2-focused");
|
3142 |
-
},
|
3143 |
-
|
3144 |
-
// multi
|
3145 |
-
updateSelection: function (data) {
|
3146 |
-
var ids = {}, filtered = [], self = this;
|
3147 |
-
|
3148 |
-
// filter out duplicates
|
3149 |
-
$(data).each(function () {
|
3150 |
-
if (!(self.id(this) in ids)) {
|
3151 |
-
ids[self.id(this)] = 0;
|
3152 |
-
filtered.push(this);
|
3153 |
-
}
|
3154 |
-
});
|
3155 |
-
|
3156 |
-
this.selection.find(".select2-search-choice").remove();
|
3157 |
-
this.addSelectedChoice(filtered);
|
3158 |
-
self.postprocessResults();
|
3159 |
-
},
|
3160 |
-
|
3161 |
-
// multi
|
3162 |
-
tokenize: function() {
|
3163 |
-
var input = this.search.val();
|
3164 |
-
input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
|
3165 |
-
if (input != null && input != undefined) {
|
3166 |
-
this.search.val(input);
|
3167 |
-
if (input.length > 0) {
|
3168 |
-
this.open();
|
3169 |
-
}
|
3170 |
-
}
|
3171 |
-
|
3172 |
-
},
|
3173 |
-
|
3174 |
-
// multi
|
3175 |
-
onSelect: function (data, options) {
|
3176 |
-
|
3177 |
-
if (!this.triggerSelect(data) || data.text === "") { return; }
|
3178 |
-
|
3179 |
-
this.addSelectedChoice(data);
|
3180 |
-
|
3181 |
-
this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
|
3182 |
-
|
3183 |
-
// keep track of the search's value before it gets cleared
|
3184 |
-
this.lastSearchTerm = this.search.val();
|
3185 |
-
|
3186 |
-
this.clearSearch();
|
3187 |
-
this.updateResults();
|
3188 |
-
|
3189 |
-
if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
|
3190 |
-
|
3191 |
-
if (this.opts.closeOnSelect) {
|
3192 |
-
this.close();
|
3193 |
-
this.search.width(10);
|
3194 |
-
} else {
|
3195 |
-
if (this.countSelectableResults()>0) {
|
3196 |
-
this.search.width(10);
|
3197 |
-
this.resizeSearch();
|
3198 |
-
if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
|
3199 |
-
// if we reached max selection size repaint the results so choices
|
3200 |
-
// are replaced with the max selection reached message
|
3201 |
-
this.updateResults(true);
|
3202 |
-
} else {
|
3203 |
-
// initializes search's value with nextSearchTerm and update search result
|
3204 |
-
if (this.prefillNextSearchTerm()) {
|
3205 |
-
this.updateResults();
|
3206 |
-
}
|
3207 |
-
}
|
3208 |
-
this.positionDropdown();
|
3209 |
-
} else {
|
3210 |
-
// if nothing left to select close
|
3211 |
-
this.close();
|
3212 |
-
this.search.width(10);
|
3213 |
-
}
|
3214 |
-
}
|
3215 |
-
|
3216 |
-
// since its not possible to select an element that has already been
|
3217 |
-
// added we do not need to check if this is a new element before firing change
|
3218 |
-
this.triggerChange({ added: data });
|
3219 |
-
|
3220 |
-
if (!options || !options.noFocus)
|
3221 |
-
this.focusSearch();
|
3222 |
-
},
|
3223 |
-
|
3224 |
-
// multi
|
3225 |
-
cancel: function () {
|
3226 |
-
this.close();
|
3227 |
-
this.focusSearch();
|
3228 |
-
},
|
3229 |
-
|
3230 |
-
addSelectedChoice: function (data) {
|
3231 |
-
var val = this.getVal(), self = this;
|
3232 |
-
$(data).each(function () {
|
3233 |
-
val.push(self.createChoice(this));
|
3234 |
-
});
|
3235 |
-
this.setVal(val);
|
3236 |
-
},
|
3237 |
-
|
3238 |
-
createChoice: function (data) {
|
3239 |
-
var enableChoice = !data.locked,
|
3240 |
-
enabledItem = $(
|
3241 |
-
"<li class='select2-search-choice'>" +
|
3242 |
-
" <div></div>" +
|
3243 |
-
" <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
|
3244 |
-
"</li>"),
|
3245 |
-
disabledItem = $(
|
3246 |
-
"<li class='select2-search-choice select2-locked'>" +
|
3247 |
-
"<div></div>" +
|
3248 |
-
"</li>");
|
3249 |
-
var choice = enableChoice ? enabledItem : disabledItem,
|
3250 |
-
id = this.id(data),
|
3251 |
-
formatted,
|
3252 |
-
cssClass;
|
3253 |
-
|
3254 |
-
formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
|
3255 |
-
if (formatted != undefined) {
|
3256 |
-
choice.find("div").replaceWith($("<div></div>").html(formatted));
|
3257 |
-
}
|
3258 |
-
cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
|
3259 |
-
if (cssClass != undefined) {
|
3260 |
-
choice.addClass(cssClass);
|
3261 |
-
}
|
3262 |
-
|
3263 |
-
if(enableChoice){
|
3264 |
-
choice.find(".select2-search-choice-close")
|
3265 |
-
.on("mousedown", killEvent)
|
3266 |
-
.on("click dblclick", this.bind(function (e) {
|
3267 |
-
if (!this.isInterfaceEnabled()) return;
|
3268 |
-
|
3269 |
-
this.unselect($(e.target));
|
3270 |
-
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
3271 |
-
killEvent(e);
|
3272 |
-
this.close();
|
3273 |
-
this.focusSearch();
|
3274 |
-
})).on("focus", this.bind(function () {
|
3275 |
-
if (!this.isInterfaceEnabled()) return;
|
3276 |
-
this.container.addClass("select2-container-active");
|
3277 |
-
this.dropdown.addClass("select2-drop-active");
|
3278 |
-
}));
|
3279 |
-
}
|
3280 |
-
|
3281 |
-
choice.data("select2-data", data);
|
3282 |
-
choice.insertBefore(this.searchContainer);
|
3283 |
-
|
3284 |
-
return id;
|
3285 |
-
},
|
3286 |
-
|
3287 |
-
// multi
|
3288 |
-
unselect: function (selected) {
|
3289 |
-
var val = this.getVal(),
|
3290 |
-
data,
|
3291 |
-
index;
|
3292 |
-
selected = selected.closest(".select2-search-choice");
|
3293 |
-
|
3294 |
-
if (selected.length === 0) {
|
3295 |
-
throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
|
3296 |
-
}
|
3297 |
-
|
3298 |
-
data = selected.data("select2-data");
|
3299 |
-
|
3300 |
-
if (!data) {
|
3301 |
-
// prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
|
3302 |
-
// and invoked on an element already removed
|
3303 |
-
return;
|
3304 |
-
}
|
3305 |
-
|
3306 |
-
var evt = $.Event("select2-removing");
|
3307 |
-
evt.val = this.id(data);
|
3308 |
-
evt.choice = data;
|
3309 |
-
this.opts.element.trigger(evt);
|
3310 |
-
|
3311 |
-
if (evt.isDefaultPrevented()) {
|
3312 |
-
return false;
|
3313 |
-
}
|
3314 |
-
|
3315 |
-
while((index = indexOf(this.id(data), val)) >= 0) {
|
3316 |
-
val.splice(index, 1);
|
3317 |
-
this.setVal(val);
|
3318 |
-
if (this.select) this.postprocessResults();
|
3319 |
-
}
|
3320 |
-
|
3321 |
-
selected.remove();
|
3322 |
-
|
3323 |
-
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
3324 |
-
this.triggerChange({ removed: data });
|
3325 |
-
|
3326 |
-
return true;
|
3327 |
-
},
|
3328 |
-
|
3329 |
-
// multi
|
3330 |
-
postprocessResults: function (data, initial, noHighlightUpdate) {
|
3331 |
-
var val = this.getVal(),
|
3332 |
-
choices = this.results.find(".select2-result"),
|
3333 |
-
compound = this.results.find(".select2-result-with-children"),
|
3334 |
-
self = this;
|
3335 |
-
|
3336 |
-
choices.each2(function (i, choice) {
|
3337 |
-
var id = self.id(choice.data("select2-data"));
|
3338 |
-
if (indexOf(id, val) >= 0) {
|
3339 |
-
choice.addClass("select2-selected");
|
3340 |
-
// mark all children of the selected parent as selected
|
3341 |
-
choice.find(".select2-result-selectable").addClass("select2-selected");
|
3342 |
-
}
|
3343 |
-
});
|
3344 |
-
|
3345 |
-
compound.each2(function(i, choice) {
|
3346 |
-
// hide an optgroup if it doesn't have any selectable children
|
3347 |
-
if (!choice.is('.select2-result-selectable')
|
3348 |
-
&& choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
|
3349 |
-
choice.addClass("select2-selected");
|
3350 |
-
}
|
3351 |
-
});
|
3352 |
-
|
3353 |
-
if (this.highlight() == -1 && noHighlightUpdate !== false && this.opts.closeOnSelect === true){
|
3354 |
-
self.highlight(0);
|
3355 |
-
}
|
3356 |
-
|
3357 |
-
//If all results are chosen render formatNoMatches
|
3358 |
-
if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
|
3359 |
-
if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
|
3360 |
-
if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
|
3361 |
-
this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
|
3362 |
-
}
|
3363 |
-
}
|
3364 |
-
}
|
3365 |
-
|
3366 |
-
},
|
3367 |
-
|
3368 |
-
// multi
|
3369 |
-
getMaxSearchWidth: function() {
|
3370 |
-
return this.selection.width() - getSideBorderPadding(this.search);
|
3371 |
-
},
|
3372 |
-
|
3373 |
-
// multi
|
3374 |
-
resizeSearch: function () {
|
3375 |
-
var minimumWidth, left, maxWidth, containerLeft, searchWidth,
|
3376 |
-
sideBorderPadding = getSideBorderPadding(this.search);
|
3377 |
-
|
3378 |
-
minimumWidth = measureTextWidth(this.search) + 10;
|
3379 |
-
|
3380 |
-
left = this.search.offset().left;
|
3381 |
-
|
3382 |
-
maxWidth = this.selection.width();
|
3383 |
-
containerLeft = this.selection.offset().left;
|
3384 |
-
|
3385 |
-
searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
|
3386 |
-
|
3387 |
-
if (searchWidth < minimumWidth) {
|
3388 |
-
searchWidth = maxWidth - sideBorderPadding;
|
3389 |
-
}
|
3390 |
-
|
3391 |
-
if (searchWidth < 40) {
|
3392 |
-
searchWidth = maxWidth - sideBorderPadding;
|
3393 |
-
}
|
3394 |
-
|
3395 |
-
if (searchWidth <= 0) {
|
3396 |
-
searchWidth = minimumWidth;
|
3397 |
-
}
|
3398 |
-
|
3399 |
-
this.search.width(Math.floor(searchWidth));
|
3400 |
-
},
|
3401 |
-
|
3402 |
-
// multi
|
3403 |
-
getVal: function () {
|
3404 |
-
var val;
|
3405 |
-
if (this.select) {
|
3406 |
-
val = this.select.val();
|
3407 |
-
return val === null ? [] : val;
|
3408 |
-
} else {
|
3409 |
-
val = this.opts.element.val();
|
3410 |
-
return splitVal(val, this.opts.separator, this.opts.transformVal);
|
3411 |
-
}
|
3412 |
-
},
|
3413 |
-
|
3414 |
-
// multi
|
3415 |
-
setVal: function (val) {
|
3416 |
-
if (this.select) {
|
3417 |
-
this.select.val(val);
|
3418 |
-
} else {
|
3419 |
-
var unique = [], valMap = {};
|
3420 |
-
// filter out duplicates
|
3421 |
-
$(val).each(function () {
|
3422 |
-
if (!(this in valMap)) {
|
3423 |
-
unique.push(this);
|
3424 |
-
valMap[this] = 0;
|
3425 |
-
}
|
3426 |
-
});
|
3427 |
-
this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
|
3428 |
-
}
|
3429 |
-
},
|
3430 |
-
|
3431 |
-
// multi
|
3432 |
-
buildChangeDetails: function (old, current) {
|
3433 |
-
var current = current.slice(0),
|
3434 |
-
old = old.slice(0);
|
3435 |
-
|
3436 |
-
// remove intersection from each array
|
3437 |
-
for (var i = 0; i < current.length; i++) {
|
3438 |
-
for (var j = 0; j < old.length; j++) {
|
3439 |
-
if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
|
3440 |
-
current.splice(i, 1);
|
3441 |
-
i--;
|
3442 |
-
old.splice(j, 1);
|
3443 |
-
break;
|
3444 |
-
}
|
3445 |
-
}
|
3446 |
-
}
|
3447 |
-
|
3448 |
-
return {added: current, removed: old};
|
3449 |
-
},
|
3450 |
-
|
3451 |
-
|
3452 |
-
// multi
|
3453 |
-
val: function (val, triggerChange) {
|
3454 |
-
var oldData, self=this;
|
3455 |
-
|
3456 |
-
if (arguments.length === 0) {
|
3457 |
-
return this.getVal();
|
3458 |
-
}
|
3459 |
-
|
3460 |
-
oldData=this.data();
|
3461 |
-
if (!oldData.length) oldData=[];
|
3462 |
-
|
3463 |
-
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
3464 |
-
if (!val && val !== 0) {
|
3465 |
-
this.opts.element.val("");
|
3466 |
-
this.updateSelection([]);
|
3467 |
-
this.clearSearch();
|
3468 |
-
if (triggerChange) {
|
3469 |
-
this.triggerChange({added: this.data(), removed: oldData});
|
3470 |
-
}
|
3471 |
-
return;
|
3472 |
-
}
|
3473 |
-
|
3474 |
-
// val is a list of ids
|
3475 |
-
this.setVal(val);
|
3476 |
-
|
3477 |
-
if (this.select) {
|
3478 |
-
this.opts.initSelection(this.select, this.bind(this.updateSelection));
|
3479 |
-
if (triggerChange) {
|
3480 |
-
this.triggerChange(this.buildChangeDetails(oldData, this.data()));
|
3481 |
-
}
|
3482 |
-
} else {
|
3483 |
-
if (this.opts.initSelection === undefined) {
|
3484 |
-
throw new Error("val() cannot be called if initSelection() is not defined");
|
3485 |
-
}
|
3486 |
-
|
3487 |
-
this.opts.initSelection(this.opts.element, function(data){
|
3488 |
-
var ids=$.map(data, self.id);
|
3489 |
-
self.setVal(ids);
|
3490 |
-
self.updateSelection(data);
|
3491 |
-
self.clearSearch();
|
3492 |
-
if (triggerChange) {
|
3493 |
-
self.triggerChange(self.buildChangeDetails(oldData, self.data()));
|
3494 |
-
}
|
3495 |
-
});
|
3496 |
-
}
|
3497 |
-
this.clearSearch();
|
3498 |
-
},
|
3499 |
-
|
3500 |
-
// multi
|
3501 |
-
onSortStart: function() {
|
3502 |
-
if (this.select) {
|
3503 |
-
throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
|
3504 |
-
}
|
3505 |
-
|
3506 |
-
// collapse search field into 0 width so its container can be collapsed as well
|
3507 |
-
this.search.width(0);
|
3508 |
-
// hide the container
|
3509 |
-
this.searchContainer.hide();
|
3510 |
-
},
|
3511 |
-
|
3512 |
-
// multi
|
3513 |
-
onSortEnd:function() {
|
3514 |
-
|
3515 |
-
var val=[], self=this;
|
3516 |
-
|
3517 |
-
// show search and move it to the end of the list
|
3518 |
-
this.searchContainer.show();
|
3519 |
-
// make sure the search container is the last item in the list
|
3520 |
-
this.searchContainer.appendTo(this.searchContainer.parent());
|
3521 |
-
// since we collapsed the width in dragStarted, we resize it here
|
3522 |
-
this.resizeSearch();
|
3523 |
-
|
3524 |
-
// update selection
|
3525 |
-
this.selection.find(".select2-search-choice").each(function() {
|
3526 |
-
val.push(self.opts.id($(this).data("select2-data")));
|
3527 |
-
});
|
3528 |
-
this.setVal(val);
|
3529 |
-
this.triggerChange();
|
3530 |
-
},
|
3531 |
-
|
3532 |
-
// multi
|
3533 |
-
data: function(values, triggerChange) {
|
3534 |
-
var self=this, ids, old;
|
3535 |
-
if (arguments.length === 0) {
|
3536 |
-
return this.selection
|
3537 |
-
.children(".select2-search-choice")
|
3538 |
-
.map(function() { return $(this).data("select2-data"); })
|
3539 |
-
.get();
|
3540 |
-
} else {
|
3541 |
-
old = this.data();
|
3542 |
-
if (!values) { values = []; }
|
3543 |
-
ids = $.map(values, function(e) { return self.opts.id(e); });
|
3544 |
-
this.setVal(ids);
|
3545 |
-
this.updateSelection(values);
|
3546 |
-
this.clearSearch();
|
3547 |
-
if (triggerChange) {
|
3548 |
-
this.triggerChange(this.buildChangeDetails(old, this.data()));
|
3549 |
-
}
|
3550 |
-
}
|
3551 |
-
}
|
3552 |
-
});
|
3553 |
-
|
3554 |
-
$.fn.select2 = function () {
|
3555 |
-
|
3556 |
-
var args = Array.prototype.slice.call(arguments, 0),
|
3557 |
-
opts,
|
3558 |
-
select2,
|
3559 |
-
method, value, multiple,
|
3560 |
-
allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
|
3561 |
-
valueMethods = ["opened", "isFocused", "container", "dropdown"],
|
3562 |
-
propertyMethods = ["val", "data"],
|
3563 |
-
methodsMap = { search: "externalSearch" };
|
3564 |
-
|
3565 |
-
this.each(function () {
|
3566 |
-
if (args.length === 0 || typeof(args[0]) === "object") {
|
3567 |
-
opts = args.length === 0 ? {} : $.extend({}, args[0]);
|
3568 |
-
opts.element = $(this);
|
3569 |
-
|
3570 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
3571 |
-
multiple = opts.element.prop("multiple");
|
3572 |
-
} else {
|
3573 |
-
multiple = opts.multiple || false;
|
3574 |
-
if ("tags" in opts) {opts.multiple = multiple = true;}
|
3575 |
-
}
|
3576 |
-
|
3577 |
-
select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
|
3578 |
-
select2.init(opts);
|
3579 |
-
} else if (typeof(args[0]) === "string") {
|
3580 |
-
|
3581 |
-
if (indexOf(args[0], allowedMethods) < 0) {
|
3582 |
-
throw "Unknown method: " + args[0];
|
3583 |
-
}
|
3584 |
-
|
3585 |
-
value = undefined;
|
3586 |
-
select2 = $(this).data("select2");
|
3587 |
-
if (select2 === undefined) return;
|
3588 |
-
|
3589 |
-
method=args[0];
|
3590 |
-
|
3591 |
-
if (method === "container") {
|
3592 |
-
value = select2.container;
|
3593 |
-
} else if (method === "dropdown") {
|
3594 |
-
value = select2.dropdown;
|
3595 |
-
} else {
|
3596 |
-
if (methodsMap[method]) method = methodsMap[method];
|
3597 |
-
|
3598 |
-
value = select2[method].apply(select2, args.slice(1));
|
3599 |
-
}
|
3600 |
-
if (indexOf(args[0], valueMethods) >= 0
|
3601 |
-
|| (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
|
3602 |
-
return false; // abort the iteration, ready to return first matched value
|
3603 |
-
}
|
3604 |
-
} else {
|
3605 |
-
throw "Invalid arguments to select2 plugin: " + args;
|
3606 |
-
}
|
3607 |
-
});
|
3608 |
-
return (value === undefined) ? this : value;
|
3609 |
-
};
|
3610 |
-
|
3611 |
-
// plugin defaults, accessible to users
|
3612 |
-
$.fn.select2.defaults = {
|
3613 |
-
debug: false,
|
3614 |
-
width: "copy",
|
3615 |
-
loadMorePadding: 0,
|
3616 |
-
closeOnSelect: true,
|
3617 |
-
openOnEnter: true,
|
3618 |
-
containerCss: {},
|
3619 |
-
dropdownCss: {},
|
3620 |
-
containerCssClass: "",
|
3621 |
-
dropdownCssClass: "",
|
3622 |
-
formatResult: function(result, container, query, escapeMarkup) {
|
3623 |
-
var markup=[];
|
3624 |
-
markMatch(this.text(result), query.term, markup, escapeMarkup);
|
3625 |
-
return markup.join("");
|
3626 |
-
},
|
3627 |
-
transformVal: function(val) {
|
3628 |
-
return $.trim(val);
|
3629 |
-
},
|
3630 |
-
formatSelection: function (data, container, escapeMarkup) {
|
3631 |
-
return data ? escapeMarkup(this.text(data)) : undefined;
|
3632 |
-
},
|
3633 |
-
sortResults: function (results, container, query) {
|
3634 |
-
return results;
|
3635 |
-
},
|
3636 |
-
formatResultCssClass: function(data) {return data.css;},
|
3637 |
-
formatSelectionCssClass: function(data, container) {return undefined;},
|
3638 |
-
minimumResultsForSearch: 0,
|
3639 |
-
minimumInputLength: 0,
|
3640 |
-
maximumInputLength: null,
|
3641 |
-
maximumSelectionSize: 0,
|
3642 |
-
id: function (e) { return e == undefined ? null : e.id; },
|
3643 |
-
text: function (e) {
|
3644 |
-
if (e && this.data && this.data.text) {
|
3645 |
-
if ($.isFunction(this.data.text)) {
|
3646 |
-
return this.data.text(e);
|
3647 |
-
} else {
|
3648 |
-
return e[this.data.text];
|
3649 |
-
}
|
3650 |
-
} else {
|
3651 |
-
return e.text;
|
3652 |
-
}
|
3653 |
-
},
|
3654 |
-
matcher: function(term, text) {
|
3655 |
-
return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
|
3656 |
-
},
|
3657 |
-
separator: ",",
|
3658 |
-
tokenSeparators: [],
|
3659 |
-
tokenizer: defaultTokenizer,
|
3660 |
-
escapeMarkup: defaultEscapeMarkup,
|
3661 |
-
blurOnChange: false,
|
3662 |
-
selectOnBlur: false,
|
3663 |
-
adaptContainerCssClass: function(c) { return c; },
|
3664 |
-
adaptDropdownCssClass: function(c) { return null; },
|
3665 |
-
nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
|
3666 |
-
searchInputPlaceholder: '',
|
3667 |
-
createSearchChoicePosition: 'top',
|
3668 |
-
shouldFocusInput: function (instance) {
|
3669 |
-
// Attempt to detect touch devices
|
3670 |
-
var supportsTouchEvents = (('ontouchstart' in window) ||
|
3671 |
-
(navigator.msMaxTouchPoints > 0));
|
3672 |
-
|
3673 |
-
// Only devices which support touch events should be special cased
|
3674 |
-
if (!supportsTouchEvents) {
|
3675 |
-
return true;
|
3676 |
-
}
|
3677 |
-
|
3678 |
-
// Never focus the input if search is disabled
|
3679 |
-
if (instance.opts.minimumResultsForSearch < 0) {
|
3680 |
-
return false;
|
3681 |
-
}
|
3682 |
-
|
3683 |
-
return true;
|
3684 |
-
}
|
3685 |
-
};
|
3686 |
-
|
3687 |
-
$.fn.select2.locales = [];
|
3688 |
-
|
3689 |
-
$.fn.select2.locales['en'] = {
|
3690 |
-
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
3691 |
-
formatNoMatches: function () { return "No matches found"; },
|
3692 |
-
formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
|
3693 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
3694 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
3695 |
-
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
3696 |
-
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
3697 |
-
formatSearching: function () { return "Searching…"; }
|
3698 |
-
};
|
3699 |
-
|
3700 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
3701 |
-
|
3702 |
-
$.fn.select2.ajaxDefaults = {
|
3703 |
-
transport: $.ajax,
|
3704 |
-
params: {
|
3705 |
-
type: "GET",
|
3706 |
-
cache: false,
|
3707 |
-
dataType: "json"
|
3708 |
-
}
|
3709 |
-
};
|
3710 |
-
|
3711 |
-
// exports
|
3712 |
-
window.Select2 = {
|
3713 |
-
query: {
|
3714 |
-
ajax: ajax,
|
3715 |
-
local: local,
|
3716 |
-
tags: tags
|
3717 |
-
}, util: {
|
3718 |
-
debounce: debounce,
|
3719 |
-
markMatch: markMatch,
|
3720 |
-
escapeMarkup: defaultEscapeMarkup,
|
3721 |
-
stripDiacritics: stripDiacritics
|
3722 |
-
}, "class": {
|
3723 |
-
"abstract": AbstractSelect2,
|
3724 |
-
"single": SingleSelect2,
|
3725 |
-
"multi": MultiSelect2
|
3726 |
-
}
|
3727 |
-
};
|
3728 |
-
|
3729 |
-
}(jQuery));
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/select2/select2.min.js
DELETED
@@ -1,23 +0,0 @@
|
|
1 |
-
/*
|
2 |
-
Copyright 2014 Igor Vaynberg
|
3 |
-
|
4 |
-
Version: 3.5.4 Timestamp: Sun Aug 30 13:30:32 EDT 2015
|
5 |
-
|
6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
9 |
-
License or the GPL License.
|
10 |
-
|
11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
12 |
-
|
13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
15 |
-
|
16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
17 |
-
or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
18 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
19 |
-
permissions and limitations under the Apache License and the GPL License.
|
20 |
-
*/
|
21 |
-
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?void c.push(d(a)):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),void c.push(d(a.substring(e+f,a.length))))}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?void b.callback(c()):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),void b.callback(e))}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(a){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.lastSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.removeData("select2").off(".select2"),a.is("input[type='hidden']")?a.css("display",""):(a.show().prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show())),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c.debug=c.debug||a.fn.select2.defaults.debug,c.debug&&console&&console.warn&&(null!=c.id&&console.warn("Select2: The `id` option has been removed in Select2 4.0.0, consider renaming your `id` property or mapping the property before your data makes it to Select2. You can read more at https://select2.github.io/announcements-4.0.html#changed-id"),null!=c.text&&console.warn("Select2: The `text` option has been removed in Select2 4.0.0, consider renaming your `text` property or mapping the property before your data makes it to Select2. You can read more at https://select2.github.io/announcements-4.0.html#changed-id"),null!=c.sortResults&&console.warn("Select2: the `sortResults` option has been renamed to `sorter` in Select2 4.0.0. "),null!=c.selectOnBlur&&console.warn("Select2: The `selectOnBlur` option has been renamed to `selectOnClose` in Select2 4.0.0."),null!=c.ajax&&null!=c.ajax.results&&console.warn("Select2: The `ajax.results` option has been renamed to `ajax.processResults` in Select2 4.0.0."),null!=c.formatNoResults&&console.warn("Select2: The `formatNoResults` option has been renamed to `language.noResults` in Select2 4.0.0."),null!=c.formatSearching&&console.warn("Select2: The `formatSearching` option has been renamed to `language.searching` in Select2 4.0.0."),null!=c.formatInputTooShort&&console.warn("Select2: The `formatInputTooShort` option has been renamed to `language.inputTooShort` in Select2 4.0.0."),null!=c.formatInputTooLong&&console.warn("Select2: The `formatInputTooLong` option has been renamed to `language.inputTooLong` in Select2 4.0.0."),null!=c.formatLoading&&console.warn("Select2: The `formatLoading` option has been renamed to `language.loadingMore` in Select2 4.0.0."),null!=c.formatSelectionTooBig&&console.warn("Select2: The `formatSelectionTooBig` option has been renamed to `language.maximumSelected` in Select2 4.0.0."),c.element.data("select2Tags")&&console.warn("Select2: The `data-select2-tags` attribute has been renamed to `data-tags` in Select2 4.0.0.")),null!=c.element.data("tags")){var j=c.element.data("tags");a.isArray(j)||(j=[]),c.element.data("select2Tags",j)}if(null!=c.sorter&&(c.sortResults=c.sorter),null!=c.selectOnClose&&(c.selectOnBlur=c.selectOnClose),null!=c.ajax&&a.isFunction(c.ajax.processResults)&&(c.ajax.results=c.ajax.processResults),null!=c.language){var k=c.language;a.isFunction(k.noMatches)&&(c.formatNoMatches=k.noMatches),a.isFunction(k.searching)&&(c.formatSearching=k.searching),a.isFunction(k.inputTooShort)&&(c.formatInputTooShort=k.inputTooShort),a.isFunction(k.inputTooLong)&&(c.formatInputTooLong=k.inputTooLong),a.isFunction(k.loadingMore)&&(c.formatLoading=k.loadingMore),a.isFunction(k.maximumSelected)&&(c.formatSelectionTooBig=k.maximumSelected)}if(c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;(h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))})(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(a){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above"),g=b.outerHeight(!1),y.top=d.top-g,y.bottom="auto"):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),
|
22 |
-
this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(a){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.search.removeAttr("aria-activedescendant"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},prefillNextSearchTerm:function(){if(""!==this.search.val())return!1;var a=this.opts.nextSearchTerm(this.data(),this.lastSearchTerm);return a!==b?(this.search.val(a),this.search.select(),!0):!1},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return void b.scrollTop(0);c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),void(e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e})))},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return void n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>");if(d.val().length<f.minimumInputLength)return n(J(f.formatInputTooShort,"formatInputTooShort")?"<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>":""),void(c&&this.showSearch&&this.showSearch(!0));if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return void n(J(f.formatInputTooLong,"formatInputTooLong")?"<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>":"");f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return void this.search.removeClass("select2-active");if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return void n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>");if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void(this.showSearch&&this.showSearch(d.val()));e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return void this.clearTouchMoved();var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function b(){var b,c,d,e,f,g;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(b=this.opts.element.attr("style"),"string"==typeof b)for(c=b.split(";"),e=0,f=c.length;f>e;e+=1)if(g=c[e].replace(/\s/g,""),d=g.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==d&&d.length>=1)return d[1];return"resolve"===this.opts.width?(b=this.opts.element.css("width"),b.indexOf("%")>0?b:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var c=b.call(this);null!==c&&this.container.css("width",c)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var b,c,d;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),b=this.search.get(0),b.createTextRange?(c=b.createTextRange(),c.collapse(!1),c.select()):b.setSelectionRange&&(d=this.search.val().length,b.setSelectionRange(d,d))),this.prefillNextSearchTerm(),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.on("focus.select2",this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return void A(a);switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),void A(a);case k.ENTER:return this.selectHighlighted(),void A(a);case k.TAB:return void this.selectHighlighted({noFocus:!0});case k.ESC:return this.cancel(a),void A(a)}}})),this.search.on("blur",this.bind(function(a){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.results&&this.results.length>1&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return void A(a);if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),void A(a)}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),void A(a)):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.lastSearchTerm=c.search.val())})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.lastSearchTerm=this.search.val(),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1],this.opts.debug&&console&&console.warn&&console.warn('Select2: The second option to `select2("val")` is not supported in Select2 4.0.0. The `change` event will always be triggered in 4.0.0.')),this.select)this.opts.debug&&console&&console.warn&&console.warn('Select2: Setting the value on a <select> using `select2("val")` is no longer supported in 4.0.0. You can use the `.val(newValue).trigger("change")` method provided by jQuery instead.'),this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return void this.clear(c);if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(this.opts.debug&&console&&console.warn&&console.warn('Select2: The `select2("data")` method can no longer set selected values in 4.0.0, consider using the `.val()` method instead.'),arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(b){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.on("focus.select2",this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),void(g&&g.length||this.open())}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),void A(a);if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),void A(a);case k.ENTER:return this.selectHighlighted(),void A(a);case k.TAB:return this.selectHighlighted({noFocus:!0}),void this.close();case k.ESC:return this.cancel(a),void A(a)}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(a){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),this.prefillNextSearchTerm(),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c={},d=[],e=this;a(b).each(function(){e.id(this)in c||(c[e.id(this)]=0,d.push(this))}),this.selection.find(".select2-search-choice").remove(),this.addSelectedChoice(d),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,b){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.lastSearchTerm=this.search.val(),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.prefillNextSearchTerm()&&this.updateResults(),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),b&&b.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(b){var c=this.getVal(),d=this;a(b).each(function(){c.push(d.createChoice(this))}),this.setVal(c)},createChoice:function(c){var i,j,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c);return i=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),i!=b&&g.find("div").replaceWith(a("<div></div>").html(i)),j=this.opts.formatSelectionCssClass(c,g.find("div")),j!=b&&g.addClass(j),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),h},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){if(this.select)this.select.val(b);else{var c=[],d={};a(b).each(function(){this in d||(c.push(this),d[this]=0)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator))}},buildChangeDetails:function(a,b){
|
23 |
-
for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)if(r(this.opts.id(b[c]),this.opts.id(a[d]))){b.splice(c,1),c--,a.splice(d,1);break}return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),void(d&&this.triggerChange({added:this.data(),removed:e}));if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={debug:!1,width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a,b,c){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(a,c){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(a){return null},nextSearchTerm:function(a,c){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b&&a.opts.minimumResultsForSearch<0?!1:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(a,b,c){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(a){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/select2/select2.png
DELETED
Binary file
|
vendor/select2/select2x2.png
DELETED
Binary file
|