Version Description
- 11.12.2010 =
- NEW : Publish a new post direct from the gallery admin page
- NEW : Added filter hook 'ngg_get_image_metadata' to add more exif/iptc information
- NEW : Adding Autocomplete field to TinyMCE Popup and Album page
- NEW : More methods for XMLRPC interface
- Changed : New hooks for gallery table (THX to Alexander Schneider)
- Changed : Introduce jQuery dialog as new UI element
- Changed : Call TinyMCE window via admin-ajax
- Bugfix : Better support for SSL blogs
- Bugfix : Install/Upgrade failed when table prefix contain captial letters
- Bugfix : Fix validation issues in Media-RSS
- Bugifx : Empty tags in XMP Meta causes PHP error
- Bugifx : Rework load mechanism for slideshow
- Bugfix : Copy meta data when image is copied
- Bugfix : Icon Support for Ozh' Admin Drop Down Menu
- Bugfix : Use correct sort order in slideshow
Download this release
Release Info
Developer | alexrabe |
Plugin | NextGEN Gallery – WordPress Gallery Plugin |
Version | 1.7.0 |
Comparing to | |
See all releases |
Code changes from version 1.6.2 to 1.7.0
- admin/addgallery.php +11 -14
- admin/admin.php +53 -124
- admin/ajax.php +68 -1
- admin/album.php +36 -20
- admin/css/images/dropdown.png +0 -0
- admin/css/images/ui-anim_basic_16x16.gif +0 -0
- admin/css/images/ui-icons_222222_256x240.png +0 -0
- admin/css/images/ui-icons_cccccc_256x240.png +0 -0
- admin/css/images/ui-icons_ffffff_256x240.png +0 -0
- admin/css/jquery.ui.css +139 -0
- admin/css/menu.css +4 -2
- admin/css/nggadmin.css +13 -7
- admin/functions.php +58 -50
- admin/images/nextgen.png +0 -0
- admin/install.php +10 -6
- admin/js/jquery-ui-1.8.6.min.js +391 -0
- admin/js/jquery.ui.autocomplete.min.js +31 -0
- admin/js/ngg.ajax.js +1 -1
- admin/js/ngg.autocomplete.js +72 -0
- admin/js/ngg.progressbar.js +30 -18
- admin/js/swfupload.handler.js +7 -9
- admin/manage-galleries.php +117 -58
- admin/manage-images.php +87 -48
- admin/manage-sort.php +4 -1
- admin/manage.php +107 -68
- admin/media-upload.php +4 -6
- admin/overview.php +1 -1
- admin/publish.php +74 -0
- admin/roles.php +1 -1
- admin/rotate.php +1 -1
- admin/settings.php +61 -48
- admin/tinymce/editor_plugin.js +3 -4
- admin/tinymce/tinymce.php +1 -1
- admin/tinymce/window.php +35 -44
- admin/upgrade.php +132 -10
- admin/upload.php +7 -12
- admin/wpmu.php +38 -8
- changelog.txt +18 -1
- js/ngg.slideshow.js +25 -19
- js/ngg.slideshow.min.js +4 -3
- lang/nggallery-de_DE.mo +0 -0
- lang/nggallery-de_DE.po +915 -762
- lang/nggallery.pot +876 -744
- lib/gd.thumbnail.inc.php +5 -1
- lib/image.php +1 -0
- lib/imagemagick.inc.php +5 -1
- lib/media-rss.php +15 -5
- lib/meta.php +9 -6
- lib/ngg-db.php +339 -20
- lib/post-thumbnail.php +2 -2
- lib/xmlrpc.php +316 -17
- nggallery.php +7 -9
- nggfunctions.php +11 -8
- readme.txt +17 -0
- widgets/widgets.php +2 -2
- xml/json.php +100 -10
admin/addgallery.php
CHANGED
@@ -130,9 +130,6 @@ class nggAddGallery {
|
|
130 |
|
131 |
// link for the flash file
|
132 |
$swf_upload_link = NGGALLERY_URLPATH . 'admin/upload.php';
|
133 |
-
$swf_upload_link = wp_nonce_url($swf_upload_link, 'ngg_swfupload');
|
134 |
-
//flash doesn't seem to like encoded ampersands, so convert them back here
|
135 |
-
$swf_upload_link = str_replace('&', '&', $swf_upload_link);
|
136 |
|
137 |
// get list of tabs
|
138 |
$tabs = $this->tabs_order();
|
@@ -146,7 +143,7 @@ class nggAddGallery {
|
|
146 |
window.onload = function () {
|
147 |
ngg_swf_upload = new SWFUpload({
|
148 |
// Backend settings
|
149 |
-
upload_url : "<?php echo $swf_upload_link; ?>",
|
150 |
flash_url : "<?php echo NGGALLERY_URLPATH; ?>admin/js/swfupload.swf",
|
151 |
|
152 |
// Button Settings
|
@@ -172,7 +169,9 @@ class nggAddGallery {
|
|
172 |
upload_complete_handler : uploadComplete,
|
173 |
|
174 |
post_params : {
|
175 |
-
"auth_cookie" : "<?php echo $_COOKIE[AUTH_COOKIE]; ?>",
|
|
|
|
|
176 |
"galleryselect" : "0"
|
177 |
},
|
178 |
|
@@ -190,18 +189,15 @@ class nggAddGallery {
|
|
190 |
|
191 |
// on load change the upload to swfupload
|
192 |
initSWFUpload();
|
|
|
|
|
|
|
|
|
|
|
193 |
|
194 |
};
|
195 |
</script>
|
196 |
|
197 |
-
<div class="wrap" id="progressbar-wrap">
|
198 |
-
<div class="progressborder">
|
199 |
-
<div class="progressbar" id="progressbar">
|
200 |
-
<span>0%</span>
|
201 |
-
</div>
|
202 |
-
</div>
|
203 |
-
</div>
|
204 |
-
|
205 |
<?php } else { ?>
|
206 |
<!-- MultiFile script -->
|
207 |
<script type="text/javascript">
|
@@ -220,6 +216,7 @@ class nggAddGallery {
|
|
220 |
<script type="text/javascript">
|
221 |
/* <![CDATA[ */
|
222 |
jQuery(document).ready(function(){
|
|
|
223 |
jQuery('#slider').tabs({ fxFade: true, fxSpeed: 'fast' });
|
224 |
});
|
225 |
|
@@ -279,7 +276,7 @@ class nggAddGallery {
|
|
279 |
if ( wpmu_enable_function('wpmuZipUpload') && nggGallery::current_user_can( 'NextGEN Upload a zip' ) )
|
280 |
$tabs['zipupload'] = __('Upload a Zip-File', 'nggallery');
|
281 |
|
282 |
-
if (
|
283 |
$tabs['importfolder'] = __('Import image folder', 'nggallery');
|
284 |
|
285 |
$tabs = apply_filters('ngg_addgallery_tabs', $tabs);
|
130 |
|
131 |
// link for the flash file
|
132 |
$swf_upload_link = NGGALLERY_URLPATH . 'admin/upload.php';
|
|
|
|
|
|
|
133 |
|
134 |
// get list of tabs
|
135 |
$tabs = $this->tabs_order();
|
143 |
window.onload = function () {
|
144 |
ngg_swf_upload = new SWFUpload({
|
145 |
// Backend settings
|
146 |
+
upload_url : "<?php echo esc_attr( $swf_upload_link ); ?>",
|
147 |
flash_url : "<?php echo NGGALLERY_URLPATH; ?>admin/js/swfupload.swf",
|
148 |
|
149 |
// Button Settings
|
169 |
upload_complete_handler : uploadComplete,
|
170 |
|
171 |
post_params : {
|
172 |
+
"auth_cookie" : "<?php echo (is_ssl() ? $_COOKIE[SECURE_AUTH_COOKIE] : $_COOKIE[AUTH_COOKIE]); ?>",
|
173 |
+
"logged_in_cookie": "<?php echo $_COOKIE[LOGGED_IN_COOKIE]; ?>",
|
174 |
+
"_wpnonce" : "<?php echo wp_create_nonce('ngg_swfupload'); ?>",
|
175 |
"galleryselect" : "0"
|
176 |
},
|
177 |
|
189 |
|
190 |
// on load change the upload to swfupload
|
191 |
initSWFUpload();
|
192 |
+
|
193 |
+
nggAjaxOptions = {
|
194 |
+
header: "<?php _e('Upload images', 'nggallery') ;?>",
|
195 |
+
maxStep: 100
|
196 |
+
};
|
197 |
|
198 |
};
|
199 |
</script>
|
200 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
201 |
<?php } else { ?>
|
202 |
<!-- MultiFile script -->
|
203 |
<script type="text/javascript">
|
216 |
<script type="text/javascript">
|
217 |
/* <![CDATA[ */
|
218 |
jQuery(document).ready(function(){
|
219 |
+
jQuery('html,body').scrollTop(0);
|
220 |
jQuery('#slider').tabs({ fxFade: true, fxSpeed: 'fast' });
|
221 |
});
|
222 |
|
276 |
if ( wpmu_enable_function('wpmuZipUpload') && nggGallery::current_user_can( 'NextGEN Upload a zip' ) )
|
277 |
$tabs['zipupload'] = __('Upload a Zip-File', 'nggallery');
|
278 |
|
279 |
+
if ( wpmu_enable_function('wpmuImportFolder') && nggGallery::current_user_can( 'NextGEN Import image folder' ) )
|
280 |
$tabs['importfolder'] = __('Import image folder', 'nggallery');
|
281 |
|
282 |
$tabs = apply_filters('ngg_addgallery_tabs', $tabs);
|
admin/admin.php
CHANGED
@@ -13,8 +13,9 @@ class nggAdminPanel{
|
|
13 |
function nggAdminPanel() {
|
14 |
|
15 |
// Add the admin menu
|
16 |
-
add_action( 'admin_menu', array (&$this, 'add_menu') );
|
17 |
-
|
|
|
18 |
// Add the script and style files
|
19 |
add_action('admin_print_scripts', array(&$this, 'load_scripts') );
|
20 |
add_action('admin_print_styles', array(&$this, 'load_styles') );
|
@@ -39,9 +40,10 @@ class nggAdminPanel{
|
|
39 |
if ( wpmu_enable_function('wpmuRoles') || wpmu_site_admin() )
|
40 |
add_submenu_page( NGGFOLDER , __('Roles', 'nggallery'), __('Roles', 'nggallery'), 'activate_plugins', 'nggallery-roles', array (&$this, 'show_menu'));
|
41 |
add_submenu_page( NGGFOLDER , __('About this Gallery', 'nggallery'), __('About', 'nggallery'), 'NextGEN Gallery overview', 'nggallery-about', array (&$this, 'show_menu'));
|
42 |
-
//
|
43 |
if ( wpmu_site_admin() )
|
44 |
add_submenu_page( 'ms-admin.php' , __('NextGEN Gallery', 'nggallery'), __('NextGEN Gallery', 'nggallery'), 'activate_plugins', 'nggallery-wpmu', array (&$this, 'show_menu'));
|
|
|
45 |
if ( !is_multisite() || wpmu_site_admin() )
|
46 |
add_submenu_page( NGGFOLDER , __('Reset / Uninstall', 'nggallery'), __('Reset / Uninstall', 'nggallery'), 'activate_plugins', 'nggallery-setup', array (&$this, 'show_menu'));
|
47 |
|
@@ -49,16 +51,25 @@ class nggAdminPanel{
|
|
49 |
$this->register_columns();
|
50 |
}
|
51 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
52 |
// load the script for the defined page and load only this code
|
53 |
function show_menu() {
|
54 |
|
55 |
global $ngg;
|
56 |
-
|
57 |
-
// init PluginChecker
|
58 |
-
$nggCheck = new CheckPlugin();
|
59 |
-
$nggCheck->URL = NGGURL;
|
60 |
-
$nggCheck->version = NGGVERSION;
|
61 |
-
$nggCheck->name = 'ngg';
|
62 |
|
63 |
// check for upgrade and show upgrade screen
|
64 |
if( get_option( 'ngg_db_version' ) != NGG_DBVERSION ) {
|
@@ -68,12 +79,6 @@ class nggAdminPanel{
|
|
68 |
return;
|
69 |
}
|
70 |
|
71 |
-
// Show update message
|
72 |
-
if ( current_user_can('activate_plugins') )
|
73 |
-
if ( $nggCheck->startCheck() && (!is_multisite()) ) {
|
74 |
-
echo '<div class="plugin-update">' . __('A new version of NextGEN Gallery is available !', 'nggallery') . ' <a href="http://wordpress.org/extend/plugins/nextgen-gallery/download/" target="_blank">' . __('Download here', 'nggallery') . '</a></div>' ."\n";
|
75 |
-
}
|
76 |
-
|
77 |
// Set installation date
|
78 |
if( empty($ngg->options['installDate']) ) {
|
79 |
$ngg->options['installDate'] = time();
|
@@ -151,6 +156,7 @@ class nggAdminPanel{
|
|
151 |
include_once ( dirname (__FILE__) . '/about.php' ); // nggallery_admin_about
|
152 |
nggallery_admin_about();
|
153 |
break;
|
|
|
154 |
case "nggallery-wpmu" :
|
155 |
include_once ( dirname (__FILE__) . '/style.php' );
|
156 |
include_once ( dirname (__FILE__) . '/wpmu.php' ); // nggallery_wpmu_admin
|
@@ -170,7 +176,7 @@ class nggAdminPanel{
|
|
170 |
if( !isset($_GET['page']) )
|
171 |
return;
|
172 |
|
173 |
-
wp_register_script('ngg-ajax', NGGALLERY_URLPATH . 'admin/js/ngg.ajax.js', array('jquery'), '1.4.
|
174 |
wp_localize_script('ngg-ajax', 'nggAjaxSetup', array(
|
175 |
'url' => admin_url('admin-ajax.php'),
|
176 |
'action' => 'ngg_ajax_operation',
|
@@ -181,8 +187,13 @@ class nggAdminPanel{
|
|
181 |
'error' => __('Unexpected Error', 'nggallery'),
|
182 |
'failure' => __('A failure occurred', 'nggallery')
|
183 |
) );
|
184 |
-
wp_register_script('ngg-progressbar', NGGALLERY_URLPATH .'admin/js/ngg.progressbar.js', array('jquery'), '
|
185 |
wp_register_script('swfupload_f10', NGGALLERY_URLPATH .'admin/js/swfupload.js', array('jquery'), '2.2.0');
|
|
|
|
|
|
|
|
|
|
|
186 |
|
187 |
switch ($_GET['page']) {
|
188 |
case NGGFOLDER :
|
@@ -193,14 +204,14 @@ class nggAdminPanel{
|
|
193 |
wp_enqueue_script( 'postbox' );
|
194 |
wp_enqueue_script( 'ngg-ajax' );
|
195 |
wp_enqueue_script( 'ngg-progressbar' );
|
196 |
-
|
197 |
-
//TODO:Add Inline edit later
|
198 |
-
//wp_enqueue_script( 'ngg-inline-edit', NGGALLERY_URLPATH .'admin/js/ngg.inline-edit-images.js', array('jquery'), '1.0.0' );
|
199 |
add_thickbox();
|
200 |
break;
|
201 |
case "nggallery-manage-album" :
|
202 |
-
|
203 |
-
|
|
|
|
|
204 |
break;
|
205 |
case "nggallery-options" :
|
206 |
wp_enqueue_script( 'jquery-ui-tabs' );
|
@@ -209,9 +220,10 @@ class nggAdminPanel{
|
|
209 |
case "nggallery-add-gallery" :
|
210 |
wp_enqueue_script( 'jquery-ui-tabs' );
|
211 |
wp_enqueue_script( 'mutlifile', NGGALLERY_URLPATH .'admin/js/jquery.MultiFile.js', array('jquery'), '1.4.4' );
|
212 |
-
wp_enqueue_script( 'ngg-swfupload-handler', NGGALLERY_URLPATH .'admin/js/swfupload.handler.js', array('swfupload_f10'), '1.0.
|
213 |
wp_enqueue_script( 'ngg-ajax' );
|
214 |
wp_enqueue_script( 'ngg-progressbar' );
|
|
|
215 |
wp_enqueue_script( 'jqueryFileTree', NGGALLERY_URLPATH .'admin/js/jqueryFileTree/jqueryFileTree.js', array('jquery'), '1.0.1' );
|
216 |
break;
|
217 |
case "nggallery-style" :
|
@@ -223,31 +235,35 @@ class nggAdminPanel{
|
|
223 |
}
|
224 |
|
225 |
function load_styles() {
|
226 |
-
|
227 |
wp_enqueue_style( 'nggmenu', NGGALLERY_URLPATH .'admin/css/menu.css', array() );
|
228 |
-
|
229 |
-
|
|
|
|
|
230 |
if( !isset($_GET['page']) )
|
231 |
return;
|
232 |
|
233 |
switch ($_GET['page']) {
|
234 |
case NGGFOLDER :
|
235 |
-
wp_enqueue_style( 'thickbox');
|
236 |
case "nggallery-about" :
|
237 |
-
wp_enqueue_style( 'nggadmin'
|
238 |
wp_admin_css( 'css/dashboard' );
|
239 |
break;
|
240 |
case "nggallery-add-gallery" :
|
|
|
241 |
wp_enqueue_style( 'jqueryFileTree', NGGALLERY_URLPATH .'admin/js/jqueryFileTree/jqueryFileTree.css', false, '1.0.1', 'screen' );
|
242 |
case "nggallery-options" :
|
243 |
wp_enqueue_style( 'nggtabs', NGGALLERY_URLPATH .'admin/css/jquery.ui.tabs.css', false, '2.5.0', 'screen' );
|
244 |
-
wp_enqueue_style( '
|
|
|
245 |
case "nggallery-manage-gallery" :
|
246 |
case "nggallery-roles" :
|
247 |
case "nggallery-manage-album" :
|
248 |
-
|
249 |
-
wp_enqueue_style( 'nggadmin'
|
250 |
-
wp_enqueue_style( 'thickbox');
|
251 |
break;
|
252 |
case "nggallery-tags" :
|
253 |
wp_enqueue_style( 'nggtags', NGGALLERY_URLPATH .'admin/css/tags-admin.css', false, '2.6.1', 'screen' );
|
@@ -371,7 +387,11 @@ class nggAdminPanel{
|
|
371 |
function register_columns() {
|
372 |
include_once ( dirname (__FILE__) . '/manage-images.php' );
|
373 |
|
374 |
-
$this->register_column_headers('nggallery-manage-images',
|
|
|
|
|
|
|
|
|
375 |
}
|
376 |
|
377 |
/**
|
@@ -425,95 +445,4 @@ function wpmu_enable_function($value) {
|
|
425 |
return true;
|
426 |
}
|
427 |
|
428 |
-
/**
|
429 |
-
* WordPress PHP class to check for a new version.
|
430 |
-
* @author Alex Rabe
|
431 |
-
* @version 1.50
|
432 |
-
*
|
433 |
-
// Dashboard update notification example
|
434 |
-
function myPlugin_update_dashboard() {
|
435 |
-
$Check = new CheckPlugin();
|
436 |
-
$Check->URL = "YOUR URL";
|
437 |
-
$Check->version = "1.00";
|
438 |
-
$Check->name = "myPlugin";
|
439 |
-
if ($Check->startCheck()) {
|
440 |
-
echo '<h3>Update Information</h3>';
|
441 |
-
echo '<p>A new version is available</p>';
|
442 |
-
}
|
443 |
-
}
|
444 |
-
|
445 |
-
add_action('activity_box_end', 'myPlugin_update_dashboard', '0');
|
446 |
-
*
|
447 |
-
*/
|
448 |
-
if ( !class_exists( "CheckPlugin" ) ) {
|
449 |
-
class CheckPlugin {
|
450 |
-
/**
|
451 |
-
* URL with the version of the plugin
|
452 |
-
* @var string
|
453 |
-
*/
|
454 |
-
var $URL = 'myURL';
|
455 |
-
/**
|
456 |
-
* Version of thsi programm or plugin
|
457 |
-
* @var string
|
458 |
-
*/
|
459 |
-
var $version = '1.00';
|
460 |
-
/**
|
461 |
-
* Name of the plugin (will be used in the options table)
|
462 |
-
* @var string
|
463 |
-
*/
|
464 |
-
var $name = 'myPlugin';
|
465 |
-
/**
|
466 |
-
* Waiting period until the next check in seconds
|
467 |
-
* @var int
|
468 |
-
*/
|
469 |
-
var $period = 86400;
|
470 |
-
|
471 |
-
/**
|
472 |
-
* check for a new version, returns true if a version is avaiable
|
473 |
-
*/
|
474 |
-
function startCheck() {
|
475 |
-
|
476 |
-
// If we know that a update exists, don't check it again
|
477 |
-
if (get_option( $this->name . '_update_exists' ) == 'true' )
|
478 |
-
return true;
|
479 |
-
|
480 |
-
$check_intervall = get_option( $this->name . '_next_update' );
|
481 |
-
|
482 |
-
if ( ($check_intervall < time() ) or (empty($check_intervall)) ) {
|
483 |
-
|
484 |
-
// Do not bother the server to often
|
485 |
-
$check_intervall = time() + $this->period;
|
486 |
-
update_option( $this->name . '_next_update', $check_intervall );
|
487 |
-
|
488 |
-
if ( function_exists('wp_remote_request') ) {
|
489 |
-
|
490 |
-
$options = array();
|
491 |
-
$options['headers'] = array(
|
492 |
-
'User-Agent' => 'NextGEN Gallery Version Checker V' . NGGVERSION . '; (' . get_bloginfo('url') .')'
|
493 |
-
);
|
494 |
-
$response = wp_remote_request($this->URL, $options);
|
495 |
-
|
496 |
-
if ( is_wp_error( $response ) )
|
497 |
-
return false;
|
498 |
-
|
499 |
-
if ( 200 != $response['response']['code'] )
|
500 |
-
return false;
|
501 |
-
|
502 |
-
$server_version = unserialize($response['body']);
|
503 |
-
|
504 |
-
if (is_array($server_version)) {
|
505 |
-
if ( version_compare($server_version[$this->name], $this->version, '>') ) {
|
506 |
-
update_option( $this->name . '_update_exists', 'true' );
|
507 |
-
return true;
|
508 |
-
}
|
509 |
-
}
|
510 |
-
|
511 |
-
delete_option( $this->name . '_update_exists' );
|
512 |
-
return false;
|
513 |
-
}
|
514 |
-
}
|
515 |
-
}
|
516 |
-
}
|
517 |
-
}
|
518 |
-
|
519 |
?>
|
13 |
function nggAdminPanel() {
|
14 |
|
15 |
// Add the admin menu
|
16 |
+
add_action( 'admin_menu', array (&$this, 'add_menu') );
|
17 |
+
add_action( 'network_admin_menu', array (&$this, 'add_network_admin_menu') );
|
18 |
+
|
19 |
// Add the script and style files
|
20 |
add_action('admin_print_scripts', array(&$this, 'load_scripts') );
|
21 |
add_action('admin_print_styles', array(&$this, 'load_styles') );
|
40 |
if ( wpmu_enable_function('wpmuRoles') || wpmu_site_admin() )
|
41 |
add_submenu_page( NGGFOLDER , __('Roles', 'nggallery'), __('Roles', 'nggallery'), 'activate_plugins', 'nggallery-roles', array (&$this, 'show_menu'));
|
42 |
add_submenu_page( NGGFOLDER , __('About this Gallery', 'nggallery'), __('About', 'nggallery'), 'NextGEN Gallery overview', 'nggallery-about', array (&$this, 'show_menu'));
|
43 |
+
//TODO: Remove after WP 3.1 release, not longer needed
|
44 |
if ( wpmu_site_admin() )
|
45 |
add_submenu_page( 'ms-admin.php' , __('NextGEN Gallery', 'nggallery'), __('NextGEN Gallery', 'nggallery'), 'activate_plugins', 'nggallery-wpmu', array (&$this, 'show_menu'));
|
46 |
+
|
47 |
if ( !is_multisite() || wpmu_site_admin() )
|
48 |
add_submenu_page( NGGFOLDER , __('Reset / Uninstall', 'nggallery'), __('Reset / Uninstall', 'nggallery'), 'activate_plugins', 'nggallery-setup', array (&$this, 'show_menu'));
|
49 |
|
51 |
$this->register_columns();
|
52 |
}
|
53 |
|
54 |
+
// integrate the network menu
|
55 |
+
function add_network_admin_menu() {
|
56 |
+
|
57 |
+
add_menu_page( _n( 'Gallery', 'Galleries', 1, 'nggallery' ), _n( 'Gallery', 'Galleries', 1, 'nggallery' ), 'nggallery-wpmu', NGGFOLDER, array (&$this, 'show_network_settings'), 'div' );
|
58 |
+
add_submenu_page( NGGFOLDER , __('Network settings', 'nggallery'), __('Network settings', 'nggallery'), 'nggallery-wpmu', NGGFOLDER, array (&$this, 'show_network_settings'));
|
59 |
+
add_submenu_page( NGGFOLDER , __('Reset / Uninstall', 'nggallery'), __('Reset / Uninstall', 'nggallery'), 'activate_plugins', 'nggallery-setup', array (&$this, 'show_menu'));
|
60 |
+
}
|
61 |
+
|
62 |
+
// show the network page
|
63 |
+
function show_network_settings() {
|
64 |
+
include_once ( dirname (__FILE__) . '/style.php' );
|
65 |
+
include_once ( dirname (__FILE__) . '/wpmu.php' );
|
66 |
+
nggallery_wpmu_setup();
|
67 |
+
}
|
68 |
+
|
69 |
// load the script for the defined page and load only this code
|
70 |
function show_menu() {
|
71 |
|
72 |
global $ngg;
|
|
|
|
|
|
|
|
|
|
|
|
|
73 |
|
74 |
// check for upgrade and show upgrade screen
|
75 |
if( get_option( 'ngg_db_version' ) != NGG_DBVERSION ) {
|
79 |
return;
|
80 |
}
|
81 |
|
|
|
|
|
|
|
|
|
|
|
|
|
82 |
// Set installation date
|
83 |
if( empty($ngg->options['installDate']) ) {
|
84 |
$ngg->options['installDate'] = time();
|
156 |
include_once ( dirname (__FILE__) . '/about.php' ); // nggallery_admin_about
|
157 |
nggallery_admin_about();
|
158 |
break;
|
159 |
+
//TODO: Remove after WP 3.1 release, not longer needed
|
160 |
case "nggallery-wpmu" :
|
161 |
include_once ( dirname (__FILE__) . '/style.php' );
|
162 |
include_once ( dirname (__FILE__) . '/wpmu.php' ); // nggallery_wpmu_admin
|
176 |
if( !isset($_GET['page']) )
|
177 |
return;
|
178 |
|
179 |
+
wp_register_script('ngg-ajax', NGGALLERY_URLPATH . 'admin/js/ngg.ajax.js', array('jquery'), '1.4.1');
|
180 |
wp_localize_script('ngg-ajax', 'nggAjaxSetup', array(
|
181 |
'url' => admin_url('admin-ajax.php'),
|
182 |
'action' => 'ngg_ajax_operation',
|
187 |
'error' => __('Unexpected Error', 'nggallery'),
|
188 |
'failure' => __('A failure occurred', 'nggallery')
|
189 |
) );
|
190 |
+
wp_register_script('ngg-progressbar', NGGALLERY_URLPATH .'admin/js/ngg.progressbar.js', array('jquery'), '2.0.1');
|
191 |
wp_register_script('swfupload_f10', NGGALLERY_URLPATH .'admin/js/swfupload.js', array('jquery'), '2.2.0');
|
192 |
+
// Package included sortable, dialog, autocomplete, tabs
|
193 |
+
wp_register_script('jquery-ui', NGGALLERY_URLPATH .'admin/js/jquery-ui-1.8.6.min.js', array('jquery'), '1.8.6');
|
194 |
+
// Until release of 3.1 not used, due to script conflict
|
195 |
+
wp_register_script('jquery-ui-autocomplete', NGGALLERY_URLPATH .'admin/js/jquery.ui.autocomplete.min.js', array('jquery-ui-core'), '1.8.6');
|
196 |
+
wp_register_script('ngg-autocomplete', NGGALLERY_URLPATH .'admin/js/ngg.autocomplete.js', array('jquery-ui'), '1.0');
|
197 |
|
198 |
switch ($_GET['page']) {
|
199 |
case NGGFOLDER :
|
204 |
wp_enqueue_script( 'postbox' );
|
205 |
wp_enqueue_script( 'ngg-ajax' );
|
206 |
wp_enqueue_script( 'ngg-progressbar' );
|
207 |
+
wp_enqueue_script( 'jquery-ui-dialog' );
|
|
|
|
|
208 |
add_thickbox();
|
209 |
break;
|
210 |
case "nggallery-manage-album" :
|
211 |
+
// Until release of 3.1 comment out, due to script conflict
|
212 |
+
//wp_enqueue_script( 'jquery-ui-sortable' );
|
213 |
+
//wp_enqueue_script( 'jquery-ui-dialog' );
|
214 |
+
wp_enqueue_script( 'ngg-autocomplete' );
|
215 |
break;
|
216 |
case "nggallery-options" :
|
217 |
wp_enqueue_script( 'jquery-ui-tabs' );
|
220 |
case "nggallery-add-gallery" :
|
221 |
wp_enqueue_script( 'jquery-ui-tabs' );
|
222 |
wp_enqueue_script( 'mutlifile', NGGALLERY_URLPATH .'admin/js/jquery.MultiFile.js', array('jquery'), '1.4.4' );
|
223 |
+
wp_enqueue_script( 'ngg-swfupload-handler', NGGALLERY_URLPATH .'admin/js/swfupload.handler.js', array('swfupload_f10'), '1.0.3' );
|
224 |
wp_enqueue_script( 'ngg-ajax' );
|
225 |
wp_enqueue_script( 'ngg-progressbar' );
|
226 |
+
wp_enqueue_script( 'jquery-ui-dialog' );
|
227 |
wp_enqueue_script( 'jqueryFileTree', NGGALLERY_URLPATH .'admin/js/jqueryFileTree/jqueryFileTree.js', array('jquery'), '1.0.1' );
|
228 |
break;
|
229 |
case "nggallery-style" :
|
235 |
}
|
236 |
|
237 |
function load_styles() {
|
238 |
+
// load the icon for the navigation menu
|
239 |
wp_enqueue_style( 'nggmenu', NGGALLERY_URLPATH .'admin/css/menu.css', array() );
|
240 |
+
wp_register_style( 'nggadmin', NGGALLERY_URLPATH .'admin/css/nggadmin.css', false, '2.8.1', 'screen' );
|
241 |
+
wp_register_style( 'ngg-jqueryui', NGGALLERY_URLPATH .'admin/css/jquery.ui.css', false, '1.8.5', 'screen' );
|
242 |
+
|
243 |
+
// no need to go on if it's not a plugin page
|
244 |
if( !isset($_GET['page']) )
|
245 |
return;
|
246 |
|
247 |
switch ($_GET['page']) {
|
248 |
case NGGFOLDER :
|
249 |
+
wp_enqueue_style( 'thickbox' );
|
250 |
case "nggallery-about" :
|
251 |
+
wp_enqueue_style( 'nggadmin' );
|
252 |
wp_admin_css( 'css/dashboard' );
|
253 |
break;
|
254 |
case "nggallery-add-gallery" :
|
255 |
+
wp_enqueue_style( 'ngg-jqueryui' );
|
256 |
wp_enqueue_style( 'jqueryFileTree', NGGALLERY_URLPATH .'admin/js/jqueryFileTree/jqueryFileTree.css', false, '1.0.1', 'screen' );
|
257 |
case "nggallery-options" :
|
258 |
wp_enqueue_style( 'nggtabs', NGGALLERY_URLPATH .'admin/css/jquery.ui.tabs.css', false, '2.5.0', 'screen' );
|
259 |
+
wp_enqueue_style( 'nggadmin' );
|
260 |
+
break;
|
261 |
case "nggallery-manage-gallery" :
|
262 |
case "nggallery-roles" :
|
263 |
case "nggallery-manage-album" :
|
264 |
+
wp_enqueue_style( 'ngg-jqueryui' );
|
265 |
+
wp_enqueue_style( 'nggadmin' );
|
266 |
+
wp_enqueue_style( 'thickbox' );
|
267 |
break;
|
268 |
case "nggallery-tags" :
|
269 |
wp_enqueue_style( 'nggtags', NGGALLERY_URLPATH .'admin/css/tags-admin.css', false, '2.6.1', 'screen' );
|
387 |
function register_columns() {
|
388 |
include_once ( dirname (__FILE__) . '/manage-images.php' );
|
389 |
|
390 |
+
$this->register_column_headers('nggallery-manage-images', ngg_manage_image_columns() );
|
391 |
+
|
392 |
+
include_once ( dirname (__FILE__) . '/manage-galleries.php' );
|
393 |
+
|
394 |
+
$this->register_column_headers('nggallery-manage-galleries', ngg_manage_gallery_columns() );
|
395 |
}
|
396 |
|
397 |
/**
|
445 |
return true;
|
446 |
}
|
447 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
448 |
?>
|
admin/ajax.php
CHANGED
@@ -296,4 +296,71 @@ function ngg_ajax_file_browser() {
|
|
296 |
}
|
297 |
|
298 |
die();
|
299 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
296 |
}
|
297 |
|
298 |
die();
|
299 |
+
}
|
300 |
+
|
301 |
+
add_action('wp_ajax_ngg_tinymce', 'ngg_ajax_tinymce');
|
302 |
+
/**
|
303 |
+
* Call TinyMCE window content via admin-ajax
|
304 |
+
*
|
305 |
+
* @since 1.7.0
|
306 |
+
* @return html content
|
307 |
+
*/
|
308 |
+
function ngg_ajax_tinymce() {
|
309 |
+
|
310 |
+
// check for rights
|
311 |
+
if ( !current_user_can('edit_pages') && !current_user_can('edit_posts') )
|
312 |
+
die(__("You are not allowed to be here"));
|
313 |
+
|
314 |
+
include_once( dirname( dirname(__FILE__) ) . '/admin/tinymce/window.php');
|
315 |
+
|
316 |
+
die();
|
317 |
+
}
|
318 |
+
|
319 |
+
/**
|
320 |
+
* This rebuild the slugs for albums, galleries and images as ajax routine, max 50 elements per request
|
321 |
+
*
|
322 |
+
* @since 1.7.0
|
323 |
+
* @return string '1'
|
324 |
+
*/
|
325 |
+
function ngg_ajax_rebuild_unique_slugs() {
|
326 |
+
global $wpdb;
|
327 |
+
|
328 |
+
$action = $_POST['_action'];
|
329 |
+
$offset = (int) $_POST['offset'];
|
330 |
+
|
331 |
+
switch ($action) {
|
332 |
+
case 'images':
|
333 |
+
$images = $wpdb->get_results("SELECT * FROM $wpdb->nggpictures ORDER BY pid ASC LIMIT $offset, 50", OBJECT_K);
|
334 |
+
if ( is_array($images) ) {
|
335 |
+
foreach ($images as $image) {
|
336 |
+
//slug must be unique, we use the alttext for that
|
337 |
+
$image->slug = nggdb::get_unique_slug( sanitize_title( $image->alttext ), 'image' );
|
338 |
+
$wpdb->query( $wpdb->prepare( "UPDATE $wpdb->nggpictures SET image_slug= '%s' WHERE pid = '%d'" , $image->slug, $image->pid ) );
|
339 |
+
}
|
340 |
+
}
|
341 |
+
break;
|
342 |
+
case 'gallery':
|
343 |
+
$galleries = $wpdb->get_results("SELECT * FROM $wpdb->nggallery ORDER BY gid ASC LIMIT $offset, 50", OBJECT_K);
|
344 |
+
if ( is_array($galleries) ) {
|
345 |
+
foreach ($galleries as $gallery) {
|
346 |
+
//slug must be unique, we use the title for that
|
347 |
+
$gallery->slug = nggdb::get_unique_slug( sanitize_title( $gallery->title ), 'gallery' );
|
348 |
+
$wpdb->query( $wpdb->prepare( "UPDATE $wpdb->nggallery SET slug= '%s' WHERE gid = '%d'" , $gallery->slug, $gallery->gid ) );
|
349 |
+
}
|
350 |
+
}
|
351 |
+
break;
|
352 |
+
case 'album':
|
353 |
+
$albumlist = $wpdb->get_results("SELECT * FROM $wpdb->nggalbum ORDER BY id ASC LIMIT $offset, 50", OBJECT_K);
|
354 |
+
if ( is_array($albumlist) ) {
|
355 |
+
foreach ($albumlist as $album) {
|
356 |
+
//slug must be unique, we use the name for that
|
357 |
+
$album->slug = nggdb::get_unique_slug( sanitize_title( $album->name ), 'album' );
|
358 |
+
$wpdb->query( $wpdb->prepare( "UPDATE $wpdb->nggalbum SET slug= '%s' WHERE id = '%d'" , $album->slug, $album->id ) );
|
359 |
+
}
|
360 |
+
}
|
361 |
+
break;
|
362 |
+
}
|
363 |
+
|
364 |
+
die(1);
|
365 |
+
}
|
366 |
+
add_action( 'wp_ajax_ngg_rebuild_unique_slugs', 'ngg_ajax_rebuild_unique_slugs' );
|
admin/album.php
CHANGED
@@ -95,9 +95,8 @@ class nggManageAlbum {
|
|
95 |
if (!nggGallery::current_user_can( 'NextGEN Add/Delete album' ))
|
96 |
wp_die(__('Cheatin’ uh?'));
|
97 |
|
98 |
-
$
|
99 |
-
|
100 |
-
$this->currentID = (int) $wpdb->insert_id;
|
101 |
|
102 |
if ($result)
|
103 |
nggGallery::show_message(__('Update Successfully','nggallery'));
|
@@ -109,7 +108,7 @@ class nggManageAlbum {
|
|
109 |
|
110 |
// get variable galleryContainer
|
111 |
parse_str($_POST['sortorder']);
|
112 |
-
if (is_array($gid)){
|
113 |
$serial_sort = serialize($gid);
|
114 |
$wpdb->query("UPDATE $wpdb->nggalbum SET sortorder = '$serial_sort' WHERE id = $this->currentID ");
|
115 |
} else {
|
@@ -125,6 +124,9 @@ class nggManageAlbum {
|
|
125 |
wp_die(__('Cheatin’ uh?'));
|
126 |
|
127 |
$result = nggdb::delete_album( $this->currentID );
|
|
|
|
|
|
|
128 |
if ($result)
|
129 |
nggGallery::show_message(__('Album deleted','nggallery'));
|
130 |
}
|
@@ -132,19 +134,22 @@ class nggManageAlbum {
|
|
132 |
}
|
133 |
|
134 |
function update_album() {
|
135 |
-
global $wpdb;
|
136 |
|
137 |
check_admin_referer('ngg_thickbox_form');
|
138 |
|
139 |
if (!nggGallery::current_user_can( 'NextGEN Edit album settings' ))
|
140 |
wp_die(__('Cheatin’ uh?'));
|
141 |
|
142 |
-
$name =
|
143 |
-
$desc =
|
144 |
$prev = (int) $_POST['previewpic'];
|
145 |
$link = (int) $_POST['pageid'];
|
146 |
-
|
147 |
-
|
|
|
|
|
|
|
148 |
|
149 |
//hook for other plugin to update the fields
|
150 |
do_action('ngg_update_album', $this->currentID, $_POST);
|
@@ -167,7 +172,10 @@ class nggManageAlbum {
|
|
167 |
jQuery(document).ready(
|
168 |
function()
|
169 |
{
|
170 |
-
|
|
|
|
|
|
|
171 |
jQuery('#selectContainer').sortable( {
|
172 |
items: '.groupItem',
|
173 |
placeholder: 'sort_placeholder',
|
@@ -254,7 +262,13 @@ function ngg_serialize(s)
|
|
254 |
}
|
255 |
|
256 |
function showDialog() {
|
257 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
258 |
}
|
259 |
|
260 |
</script>
|
@@ -274,7 +288,7 @@ function showDialog() {
|
|
274 |
if( is_array($this->albums) ) {
|
275 |
foreach($this->albums as $album) {
|
276 |
$selected = ($this->currentID == $album->id) ? 'selected="selected" ' : '';
|
277 |
-
echo '<option value="' . $album->id . '" ' . $selected . '>' . $album->name . '</option>'."\n";
|
278 |
}
|
279 |
}
|
280 |
?>
|
@@ -407,15 +421,16 @@ function showDialog() {
|
|
407 |
<tr>
|
408 |
<th>
|
409 |
<?php _e('Select a preview image:', 'nggallery'); ?><br />
|
410 |
-
<select name="previewpic" style="width:95%" >
|
|
|
411 |
<option value="0"><?php _e('No picture', 'nggallery'); ?></option>
|
412 |
<?php
|
413 |
-
|
414 |
-
|
415 |
-
|
416 |
-
|
417 |
-
|
418 |
-
|
419 |
?>
|
420 |
</select>
|
421 |
</th>
|
@@ -439,7 +454,7 @@ function showDialog() {
|
|
439 |
<td class="submit">
|
440 |
<input type="submit" class="button-primary" name="update_album" value="<?php _e('OK', 'nggallery'); ?>" />
|
441 |
|
442 |
-
<input class="button-secondary" type="reset" value="<?php _e('Cancel', 'nggallery'); ?>"
|
443 |
</td>
|
444 |
</tr>
|
445 |
</table>
|
@@ -526,6 +541,7 @@ function showDialog() {
|
|
526 |
<p><strong>' . __('Name', 'nggallery') . ' : </strong>' . nggGallery::i18n( $obj['name'] ) . '</p>
|
527 |
<p><strong>' . __('Title', 'nggallery') . ' : </strong>' . nggGallery::i18n( $obj['title'] ) . '</p>
|
528 |
<p><strong>' . __('Page', 'nggallery'). ' : </strong>' . nggGallery::i18n( $obj['pagenname'] ) . '</p>
|
|
|
529 |
</div>
|
530 |
</div>
|
531 |
</div>';
|
95 |
if (!nggGallery::current_user_can( 'NextGEN Add/Delete album' ))
|
96 |
wp_die(__('Cheatin’ uh?'));
|
97 |
|
98 |
+
$result = nggdb::add_album( $_POST['newalbum'] );
|
99 |
+
$this->currentID = ($result) ? $result : 0 ;
|
|
|
100 |
|
101 |
if ($result)
|
102 |
nggGallery::show_message(__('Update Successfully','nggallery'));
|
108 |
|
109 |
// get variable galleryContainer
|
110 |
parse_str($_POST['sortorder']);
|
111 |
+
if ( is_array($gid) ){
|
112 |
$serial_sort = serialize($gid);
|
113 |
$wpdb->query("UPDATE $wpdb->nggalbum SET sortorder = '$serial_sort' WHERE id = $this->currentID ");
|
114 |
} else {
|
124 |
wp_die(__('Cheatin’ uh?'));
|
125 |
|
126 |
$result = nggdb::delete_album( $this->currentID );
|
127 |
+
|
128 |
+
$this->currentID = 0;
|
129 |
+
|
130 |
if ($result)
|
131 |
nggGallery::show_message(__('Album deleted','nggallery'));
|
132 |
}
|
134 |
}
|
135 |
|
136 |
function update_album() {
|
137 |
+
global $wpdb, $nggdb;
|
138 |
|
139 |
check_admin_referer('ngg_thickbox_form');
|
140 |
|
141 |
if (!nggGallery::current_user_can( 'NextGEN Edit album settings' ))
|
142 |
wp_die(__('Cheatin’ uh?'));
|
143 |
|
144 |
+
$name = $_POST['album_name'];
|
145 |
+
$desc = $_POST['album_desc'];
|
146 |
$prev = (int) $_POST['previewpic'];
|
147 |
$link = (int) $_POST['pageid'];
|
148 |
+
|
149 |
+
// slug must be unique, we use the title for that
|
150 |
+
$slug = nggdb::get_unique_slug( sanitize_title( $name ), 'album' );
|
151 |
+
|
152 |
+
$result = $wpdb->query( $wpdb->prepare( "UPDATE $wpdb->nggalbum SET slug= '%s', name= '%s', albumdesc= '%s', previewpic= %d, pageid= %d WHERE id = '%d'" , $slug, $name, $desc, $prev, $link, $this->currentID ) );
|
153 |
|
154 |
//hook for other plugin to update the fields
|
155 |
do_action('ngg_update_album', $this->currentID, $_POST);
|
172 |
jQuery(document).ready(
|
173 |
function()
|
174 |
{
|
175 |
+
jQuery("#previewpic").nggAutocomplete( {
|
176 |
+
type: 'image',domain: "<?php echo site_url(); ?>/"
|
177 |
+
});
|
178 |
+
|
179 |
jQuery('#selectContainer').sortable( {
|
180 |
items: '.groupItem',
|
181 |
placeholder: 'sort_placeholder',
|
262 |
}
|
263 |
|
264 |
function showDialog() {
|
265 |
+
jQuery( "#editalbum").dialog({
|
266 |
+
width: 640,
|
267 |
+
resizable : false,
|
268 |
+
modal: true,
|
269 |
+
title: '<?php _e('Edit Album', 'nggallery'); ?>'
|
270 |
+
});
|
271 |
+
jQuery('#editalbum .dialog-cancel').click(function() { jQuery( "#editalbum" ).dialog("close"); });
|
272 |
}
|
273 |
|
274 |
</script>
|
288 |
if( is_array($this->albums) ) {
|
289 |
foreach($this->albums as $album) {
|
290 |
$selected = ($this->currentID == $album->id) ? 'selected="selected" ' : '';
|
291 |
+
echo '<option value="' . $album->id . '" ' . $selected . '>' . $album->id . ' - ' . $album->name . '</option>'."\n";
|
292 |
}
|
293 |
}
|
294 |
?>
|
421 |
<tr>
|
422 |
<th>
|
423 |
<?php _e('Select a preview image:', 'nggallery'); ?><br />
|
424 |
+
<select id="previewpic" name="previewpic" style="width:95%" >
|
425 |
+
<?php if ($album->previewpic == 0) ?>
|
426 |
<option value="0"><?php _e('No picture', 'nggallery'); ?></option>
|
427 |
<?php
|
428 |
+
if ($album->previewpic == 0)
|
429 |
+
echo '<option value="0" selected="selected">' . __('No picture', 'nggallery') . '</option>';
|
430 |
+
else {
|
431 |
+
$picture = nggdb::find_image($album->previewpic);
|
432 |
+
echo '<option value="' . $picture->pid . '" selected="selected" >'. $picture->pid . ' - ' . ( empty($picture->alltext) ? $picture->filename : $picture->alltext ) .' </option>'."\n";
|
433 |
+
}
|
434 |
?>
|
435 |
</select>
|
436 |
</th>
|
454 |
<td class="submit">
|
455 |
<input type="submit" class="button-primary" name="update_album" value="<?php _e('OK', 'nggallery'); ?>" />
|
456 |
|
457 |
+
<input class="button-secondary dialog-cancel" type="reset" value="<?php _e('Cancel', 'nggallery'); ?>"/>
|
458 |
</td>
|
459 |
</tr>
|
460 |
</table>
|
541 |
<p><strong>' . __('Name', 'nggallery') . ' : </strong>' . nggGallery::i18n( $obj['name'] ) . '</p>
|
542 |
<p><strong>' . __('Title', 'nggallery') . ' : </strong>' . nggGallery::i18n( $obj['title'] ) . '</p>
|
543 |
<p><strong>' . __('Page', 'nggallery'). ' : </strong>' . nggGallery::i18n( $obj['pagenname'] ) . '</p>
|
544 |
+
' . apply_filters('ngg_display_album_item_content', '', $obj['id']) . '
|
545 |
</div>
|
546 |
</div>
|
547 |
</div>';
|
admin/css/images/dropdown.png
ADDED
Binary file
|
admin/css/images/ui-anim_basic_16x16.gif
ADDED
Binary file
|
admin/css/images/ui-icons_222222_256x240.png
ADDED
Binary file
|
admin/css/images/ui-icons_cccccc_256x240.png
ADDED
Binary file
|
admin/css/images/ui-icons_ffffff_256x240.png
ADDED
Binary file
|
admin/css/jquery.ui.css
ADDED
@@ -0,0 +1,139 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*
|
2 |
+
* jQuery UI CSS Framework @VERSION
|
3 |
+
*
|
4 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
5 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
6 |
+
* http://jquery.org/license
|
7 |
+
*
|
8 |
+
* http://docs.jquery.com/UI/Theming/API
|
9 |
+
*/
|
10 |
+
|
11 |
+
/* Layout helpers
|
12 |
+
----------------------------------*/
|
13 |
+
.ui-helper-hidden { display: none; }
|
14 |
+
.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
|
15 |
+
.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
|
16 |
+
.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
|
17 |
+
.ui-helper-clearfix { display: inline-block; }
|
18 |
+
/* required comment for clearfix to work in Opera \*/
|
19 |
+
* html .ui-helper-clearfix { height:1%; }
|
20 |
+
.ui-helper-clearfix { display:block; }
|
21 |
+
/* end clearfix */
|
22 |
+
.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
|
23 |
+
|
24 |
+
/* Interaction Cues
|
25 |
+
----------------------------------*/
|
26 |
+
.ui-state-disabled { cursor: default !important; }
|
27 |
+
|
28 |
+
/* Icons
|
29 |
+
----------------------------------*/
|
30 |
+
.ui-icon-triangle-1-s { background-position: -64px -16px; }
|
31 |
+
|
32 |
+
/* states and images */
|
33 |
+
.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
|
34 |
+
|
35 |
+
/* Misc visuals
|
36 |
+
----------------------------------*/
|
37 |
+
|
38 |
+
/* Overlays */
|
39 |
+
.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
|
40 |
+
|
41 |
+
/* jQuery UI CSS Framework @VERSION */
|
42 |
+
|
43 |
+
/* Component containers
|
44 |
+
----------------------------------*/
|
45 |
+
.ui-widget-content { background: #fcfdfd 50% bottom repeat-x; color: #222222; }
|
46 |
+
/* .ui-widget-content a { color: #222222; } */
|
47 |
+
.ui-widget-header { background: #222222 50% 50% repeat-x; color: #CFCFCF; }
|
48 |
+
.ui-widget-header a { color: #CFCFCF; }
|
49 |
+
|
50 |
+
/* Interaction states
|
51 |
+
----------------------------------*/
|
52 |
+
.ui-dialog-titlebar-close:hover { border: 1px solid #464646; background: #464646 50% 50% repeat-x; font-weight: normal; color: #ffffff; }
|
53 |
+
.ui-widget :active { outline: none; }
|
54 |
+
|
55 |
+
/* Icons
|
56 |
+
----------------------------------*/
|
57 |
+
|
58 |
+
/* states and images */
|
59 |
+
.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_cccccc_256x240.png); }
|
60 |
+
.ui-widget-content .ui-icon {background-image: url(images/ui-icons_cccccc_256x240.png); }
|
61 |
+
.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
|
62 |
+
.ui-state-default .ui-icon { background-image: url(images/ui-icons_cccccc_256x240.png); }
|
63 |
+
.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
|
64 |
+
.ui-state-active .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
|
65 |
+
|
66 |
+
/* positioning */
|
67 |
+
.ui-icon-close { background-position: -80px -128px; }
|
68 |
+
.ui-icon-closethick { background-position: -96px -128px; }
|
69 |
+
.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
|
70 |
+
.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
|
71 |
+
|
72 |
+
/* Misc visuals
|
73 |
+
----------------------------------*/
|
74 |
+
|
75 |
+
/* Corner radius */
|
76 |
+
.ui-corner-tl { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; border-top-left-radius: 5px; }
|
77 |
+
.ui-corner-tr { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; border-top-right-radius: 5px; }
|
78 |
+
.ui-corner-bl { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; border-bottom-left-radius: 5px; }
|
79 |
+
.ui-corner-br { -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; border-bottom-right-radius: 5px; }
|
80 |
+
.ui-corner-top { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; border-top-left-radius: 5px; -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; border-top-right-radius: 5px; }
|
81 |
+
.ui-corner-bottom { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; border-bottom-left-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; border-bottom-right-radius: 5px; }
|
82 |
+
.ui-corner-right { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; border-top-right-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; border-bottom-right-radius: 5px; }
|
83 |
+
.ui-corner-left { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; border-top-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; border-bottom-left-radius: 5px; }
|
84 |
+
.ui-corner-all { -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }
|
85 |
+
|
86 |
+
/* Overlays */
|
87 |
+
.ui-widget-overlay { background: #000000 50% 50% repeat-x; opacity: .75;filter:Alpha(Opacity=75); }
|
88 |
+
.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #000000 50% 50% repeat-x; opacity: .75;filter:Alpha(Opacity=75); -moz-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/*
|
89 |
+
|
90 |
+
/* jQuery UI Resizable */
|
91 |
+
.ui-resizable { position: relative;}
|
92 |
+
.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
|
93 |
+
.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
|
94 |
+
.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
|
95 |
+
.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
|
96 |
+
.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
|
97 |
+
.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
|
98 |
+
.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
|
99 |
+
.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
|
100 |
+
.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
|
101 |
+
.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
|
102 |
+
|
103 |
+
/* jQuery UI Dialog */
|
104 |
+
.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
|
105 |
+
.ui-dialog { -moz-box-shadow: rgba(0,0,0,1) 0 4px 30px; -webkit-box-shadow: rgba(0,0,0,1) 0 4px 30px; -khtml-box-shadow: rgba(0,0,0,1) 0 4px 30px; box-shadow: rgba(0,0,0,1) 0 4px 30px; }
|
106 |
+
.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; }
|
107 |
+
.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; }
|
108 |
+
.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
|
109 |
+
.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
|
110 |
+
.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
|
111 |
+
.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
|
112 |
+
.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
|
113 |
+
.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
|
114 |
+
.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
|
115 |
+
.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
|
116 |
+
.ui-draggable .ui-dialog-titlebar { cursor: move; }
|
117 |
+
|
118 |
+
/* jQuery UI Progressbar */
|
119 |
+
.ui-progressbar { height:2em; text-align: left; }
|
120 |
+
.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
|
121 |
+
|
122 |
+
/* jQuery UI Dialog loading spinner */
|
123 |
+
#spinner {display: none; width:100px; height: 100px; position: fixed; top: 50%; left: 50%; background:url(../../images/loader.gif) no-repeat center #fff; padding:10px; border:1px solid #666; margin-left: -50px; margin-top: -50px; z-index:2; overflow: auto; }
|
124 |
+
|
125 |
+
/* jQuery Autocomplete */
|
126 |
+
.ui-autocomplete { position: absolute; cursor: default; }
|
127 |
+
.ui-autocomplete-start { background: white url('images/dropdown.png') right center no-repeat; }
|
128 |
+
* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
|
129 |
+
.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; }
|
130 |
+
/* this limit the height of the result list*/
|
131 |
+
.ui-autocomplete { max-height: 90px; overflow-y: auto; }
|
132 |
+
* html .ui-autocomplete { height: 90px; }
|
133 |
+
.ui-autocomplete .ui-state-hover, .ui-autocomplete .ui-widget-content .ui-state-hover { background: #1e90ff; color: #FFFFFF !important; }
|
134 |
+
.ui-widget-content { border: 1px solid #dddddd; border-style:outset; background: #FFFFFF; }
|
135 |
+
.ui-autocomplete, .ui-autocomplete .ui-corner-all { -moz-border-radius: 0px; -webkit-border-radius: 0px; border-radius: 0px; }
|
136 |
+
.ui-menu { list-style:none; padding: 1px; margin: 0; display:block; float: left; }
|
137 |
+
.ui-menu .ui-menu { margin-top: -3px; }
|
138 |
+
.ui-menu .ui-menu-item { margin:0; padding:0; zoom:1; float:left; clear:left; width:100%; }
|
139 |
+
.ui-menu .ui-menu-item a { text-decoration:none; display:block; zoom:1; color: black;}
|
admin/css/menu.css
CHANGED
@@ -1,9 +1,11 @@
|
|
1 |
-
#adminmenu #toplevel_page_nextgen-gallery div.wp-menu-image
|
|
|
2 |
background: transparent url('../images/nextgen_16_grey.png') no-repeat scroll 6px 6px;
|
3 |
}
|
4 |
#adminmenu #toplevel_page_nextgen-gallery:hover div.wp-menu-image,
|
5 |
#adminmenu #toplevel_page_nextgen-gallery.wp-has-current-submenu div.wp-menu-image,
|
6 |
-
#adminmenu #toplevel_page_nextgen-gallery.current div.wp-menu-image
|
|
|
7 |
background: transparent url('../images/nextgen_16_color.png') no-repeat scroll 6px 6px;
|
8 |
}
|
9 |
|
1 |
+
#adminmenu #toplevel_page_nextgen-gallery div.wp-menu-image,
|
2 |
+
#oam_toplevel_page_nextgen-gallery div.wp-menu-image {
|
3 |
background: transparent url('../images/nextgen_16_grey.png') no-repeat scroll 6px 6px;
|
4 |
}
|
5 |
#adminmenu #toplevel_page_nextgen-gallery:hover div.wp-menu-image,
|
6 |
#adminmenu #toplevel_page_nextgen-gallery.wp-has-current-submenu div.wp-menu-image,
|
7 |
+
#adminmenu #toplevel_page_nextgen-gallery.current div.wp-menu-image,
|
8 |
+
#oam_toplevel_page_nextgen-gallery:hover div.wp-menu-image {
|
9 |
background: transparent url('../images/nextgen_16_color.png') no-repeat scroll 6px 6px;
|
10 |
}
|
11 |
|
admin/css/nggadmin.css
CHANGED
@@ -1,5 +1,5 @@
|
|
1 |
/*
|
2 |
-
** NextGEN Gallery Style for Wordpress
|
3 |
*/
|
4 |
|
5 |
/* SETTINGS FOR Overview Gallery */
|
@@ -167,32 +167,37 @@ p#ngg-inlinebutton {
|
|
167 |
/* SETTINGS FOR PROGRESS BAR */
|
168 |
|
169 |
div .progressborder {
|
170 |
-
border:
|
171 |
display: block;
|
172 |
-
height:
|
173 |
background-color: #464646;
|
174 |
width: 100%;
|
175 |
margin-top: 15px;
|
176 |
margin-bottom: 15px;
|
|
|
|
|
|
|
177 |
}
|
178 |
|
179 |
div .progressbar {
|
180 |
border: medium none ;
|
181 |
display: block;
|
182 |
-
height:
|
183 |
background-color: #D54E21;
|
184 |
width: 0%;
|
|
|
|
|
|
|
185 |
}
|
186 |
|
187 |
div .progressbar span {
|
188 |
display: inline;
|
189 |
-
position:
|
190 |
color: white;
|
191 |
font-weight: bold;
|
192 |
-
padding
|
193 |
}
|
194 |
|
195 |
-
|
196 |
.show_details
|
197 |
{
|
198 |
height: 16px;
|
@@ -339,6 +344,7 @@ div.widget-top {
|
|
339 |
font-size: 13px;
|
340 |
}
|
341 |
|
|
|
342 |
|
343 |
/* SETTINGS FOR SORT GALLERY */
|
344 |
|
1 |
/*
|
2 |
+
** NextGEN Gallery Style for Wordpress 3.0
|
3 |
*/
|
4 |
|
5 |
/* SETTINGS FOR Overview Gallery */
|
167 |
/* SETTINGS FOR PROGRESS BAR */
|
168 |
|
169 |
div .progressborder {
|
170 |
+
border:1px solid #DDDDDD;
|
171 |
display: block;
|
172 |
+
height: 30px;
|
173 |
background-color: #464646;
|
174 |
width: 100%;
|
175 |
margin-top: 15px;
|
176 |
margin-bottom: 15px;
|
177 |
+
-moz-border-radius: 5px;
|
178 |
+
-webkit-border-radius: 5px;
|
179 |
+
border-radius: 5px;
|
180 |
}
|
181 |
|
182 |
div .progressbar {
|
183 |
border: medium none ;
|
184 |
display: block;
|
185 |
+
height: 30px;
|
186 |
background-color: #D54E21;
|
187 |
width: 0%;
|
188 |
+
-moz-border-radius: 5px;
|
189 |
+
-webkit-border-radius: 5px;
|
190 |
+
border-radius: 5px;
|
191 |
}
|
192 |
|
193 |
div .progressbar span {
|
194 |
display: inline;
|
195 |
+
position: absolute;
|
196 |
color: white;
|
197 |
font-weight: bold;
|
198 |
+
padding: 5px 0 0 5px;
|
199 |
}
|
200 |
|
|
|
201 |
.show_details
|
202 |
{
|
203 |
height: 16px;
|
344 |
font-size: 13px;
|
345 |
}
|
346 |
|
347 |
+
.ui-autocomplete-start { background-position: 99% center; }
|
348 |
|
349 |
/* SETTINGS FOR SORT GALLERY */
|
350 |
|
admin/functions.php
CHANGED
@@ -16,27 +16,26 @@ class nggAdmin{
|
|
16 |
* create a new gallery & folder
|
17 |
*
|
18 |
* @class nggAdmin
|
19 |
-
* @param string $
|
20 |
* @param string $defaultpath
|
21 |
* @param bool $output if the function should show an error messsage or not
|
22 |
* @return
|
23 |
*/
|
24 |
-
function create_gallery($
|
25 |
|
26 |
-
global $
|
27 |
|
28 |
// get the current user ID
|
29 |
get_currentuserinfo();
|
30 |
|
31 |
//cleanup pathname
|
32 |
-
$
|
33 |
-
$
|
34 |
-
$nggpath = $defaultpath . $galleryname;
|
35 |
$nggRoot = WINABSPATH . $defaultpath;
|
36 |
$txt = '';
|
37 |
|
38 |
// No gallery name ?
|
39 |
-
if ( empty($
|
40 |
if ($output) nggGallery::show_error( __('No valid gallery name!', 'nggallery') );
|
41 |
return false;
|
42 |
}
|
@@ -59,17 +58,28 @@ class nggAdmin{
|
|
59 |
return false;
|
60 |
}
|
61 |
|
62 |
-
// 1.
|
63 |
-
if (
|
64 |
-
|
65 |
-
|
66 |
-
|
67 |
-
|
68 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
69 |
if ( !is_writeable(WINABSPATH . $nggpath ) )
|
70 |
$txt .= __('Directory', 'nggallery').' <strong>'.$nggpath.'</strong> '.__('is not writeable !', 'nggallery').'<br />';
|
71 |
|
72 |
-
//
|
73 |
if ( !is_dir(WINABSPATH . $nggpath . '/thumbs') ) {
|
74 |
if ( !wp_mkdir_p ( WINABSPATH . $nggpath . '/thumbs') )
|
75 |
$txt .= __('Unable to create directory ', 'nggallery').' <strong>' . $nggpath . '/thumbs !</strong>';
|
@@ -92,34 +102,26 @@ class nggAdmin{
|
|
92 |
if ($output) nggGallery::show_error($txt);
|
93 |
return false;
|
94 |
}
|
95 |
-
|
96 |
-
|
97 |
-
|
98 |
-
|
99 |
-
|
100 |
-
|
101 |
-
|
102 |
-
|
103 |
-
|
104 |
-
|
105 |
-
|
106 |
-
|
107 |
-
|
108 |
-
|
109 |
-
|
110 |
-
|
111 |
-
|
112 |
-
if ($
|
113 |
-
|
114 |
-
|
115 |
-
$message .= '<a href="' . admin_url() . 'admin.php?page=nggallery-manage-gallery&mode=edit&gid=' . $gallery_id . '" >';
|
116 |
-
$message .= __('Edit gallery','nggallery');
|
117 |
-
$message .= '</a>';
|
118 |
-
|
119 |
-
if ($output) nggGallery::show_message($message);
|
120 |
-
}
|
121 |
-
return true;
|
122 |
-
}
|
123 |
}
|
124 |
|
125 |
/**
|
@@ -710,6 +712,8 @@ class nggAdmin{
|
|
710 |
$meta['timestamp'] = $pdata->get_date_time();
|
711 |
// this contain other useful meta information
|
712 |
$meta['common'] = $pdata->get_common_meta();
|
|
|
|
|
713 |
|
714 |
return $meta;
|
715 |
|
@@ -851,7 +855,7 @@ class nggAdmin{
|
|
851 |
// check if file is a zip file
|
852 |
if ( !preg_match('/(zip|download|octet-stream)/i', $_FILES['zipfile']['type']) ) {
|
853 |
@unlink($temp_zipfile); // del temp file
|
854 |
-
nggGallery::show_error(__('Uploaded file was no or a faulty zip file ! The server
|
855 |
return false;
|
856 |
}
|
857 |
}
|
@@ -978,12 +982,12 @@ class nggAdmin{
|
|
978 |
|
979 |
// save temp file to gallery
|
980 |
if ( !@move_uploaded_file($temp_file, $dest_file) ){
|
981 |
-
nggGallery::show_error(__('Error, the file could not moved to : ','nggallery') . $dest_file);
|
982 |
nggAdmin::check_safemode( $gallery->abspath );
|
983 |
continue;
|
984 |
}
|
985 |
if ( !nggAdmin::chmod($dest_file) ) {
|
986 |
-
nggGallery::show_error(__('Error, the file permissions could not set','nggallery'));
|
987 |
continue;
|
988 |
}
|
989 |
|
@@ -1067,11 +1071,11 @@ class nggAdmin{
|
|
1067 |
// save temp file to gallery
|
1068 |
if ( !@move_uploaded_file($_FILES["Filedata"]['tmp_name'], $dest_file) ){
|
1069 |
nggAdmin::check_safemode(WINABSPATH.$gallerypath);
|
1070 |
-
return __('Error, the file could not moved to : ','nggallery').$dest_file;
|
1071 |
}
|
1072 |
|
1073 |
if ( !nggAdmin::chmod($dest_file) )
|
1074 |
-
return __('Error, the file permissions could not set','nggallery');
|
1075 |
|
1076 |
return '0';
|
1077 |
}
|
@@ -1230,6 +1234,8 @@ class nggAdmin{
|
|
1230 |
* @return void
|
1231 |
*/
|
1232 |
function copy_images($pic_ids, $dest_gid) {
|
|
|
|
|
1233 |
|
1234 |
$errors = $messages = '';
|
1235 |
|
@@ -1292,6 +1298,10 @@ class nggAdmin{
|
|
1292 |
|
1293 |
// Copy tags
|
1294 |
nggTags::copy_tags($image->pid, $new_pid);
|
|
|
|
|
|
|
|
|
1295 |
|
1296 |
if ( $tmp_prefix != '' ) {
|
1297 |
$messages .= sprintf(__('Image %1$s (%2$s) copied as image %3$s (%4$s) » The file already existed in the destination gallery.','nggallery'),
|
@@ -1353,8 +1363,6 @@ class nggAdmin{
|
|
1353 |
} );
|
1354 |
</script>
|
1355 |
|
1356 |
-
<div id="progressbar_container" class="wrap"></div>
|
1357 |
-
|
1358 |
<?php
|
1359 |
}
|
1360 |
|
16 |
* create a new gallery & folder
|
17 |
*
|
18 |
* @class nggAdmin
|
19 |
+
* @param string $name of the gallery
|
20 |
* @param string $defaultpath
|
21 |
* @param bool $output if the function should show an error messsage or not
|
22 |
* @return
|
23 |
*/
|
24 |
+
function create_gallery($title, $defaultpath, $output = true) {
|
25 |
|
26 |
+
global $user_ID;
|
27 |
|
28 |
// get the current user ID
|
29 |
get_currentuserinfo();
|
30 |
|
31 |
//cleanup pathname
|
32 |
+
$name = sanitize_file_name( sanitize_title($title) );
|
33 |
+
$name = apply_filters('ngg_gallery_name', $name);
|
|
|
34 |
$nggRoot = WINABSPATH . $defaultpath;
|
35 |
$txt = '';
|
36 |
|
37 |
// No gallery name ?
|
38 |
+
if ( empty($name) ) {
|
39 |
if ($output) nggGallery::show_error( __('No valid gallery name!', 'nggallery') );
|
40 |
return false;
|
41 |
}
|
58 |
return false;
|
59 |
}
|
60 |
|
61 |
+
// 1. Check for existing folder
|
62 |
+
if ( is_dir(WINABSPATH . $defaultpath . $name ) ) {
|
63 |
+
$suffix = 1;
|
64 |
+
do {
|
65 |
+
$alt_name = substr ($name, 0, 200 - ( strlen( $suffix ) + 1 ) ) . "_$suffix";
|
66 |
+
$dir_check = is_dir(WINABSPATH . $defaultpath . $alt_name );
|
67 |
+
$suffix++;
|
68 |
+
} while ( $dir_check );
|
69 |
+
$name = $alt_name;
|
70 |
+
}
|
71 |
+
// define relative path to gallery inside wp root folder
|
72 |
+
$nggpath = $defaultpath . $name;
|
73 |
+
|
74 |
+
// 2. Create new gallery folder
|
75 |
+
if ( !wp_mkdir_p (WINABSPATH . $nggpath) )
|
76 |
+
$txt = __('Unable to create directory ', 'nggallery').$nggpath.'!<br />';
|
77 |
+
|
78 |
+
// 3. Check folder permission
|
79 |
if ( !is_writeable(WINABSPATH . $nggpath ) )
|
80 |
$txt .= __('Directory', 'nggallery').' <strong>'.$nggpath.'</strong> '.__('is not writeable !', 'nggallery').'<br />';
|
81 |
|
82 |
+
// 4. Now create thumbnail folder inside
|
83 |
if ( !is_dir(WINABSPATH . $nggpath . '/thumbs') ) {
|
84 |
if ( !wp_mkdir_p ( WINABSPATH . $nggpath . '/thumbs') )
|
85 |
$txt .= __('Unable to create directory ', 'nggallery').' <strong>' . $nggpath . '/thumbs !</strong>';
|
102 |
if ($output) nggGallery::show_error($txt);
|
103 |
return false;
|
104 |
}
|
105 |
+
|
106 |
+
// now add the gallery to the database
|
107 |
+
$galleryID = nggdb::add_gallery($title, $nggpath, '', 0, 0, $user_ID );
|
108 |
+
// here you can inject a custom function
|
109 |
+
do_action('ngg_created_new_gallery', $galleryID);
|
110 |
+
|
111 |
+
// return only the id if defined
|
112 |
+
if ($output == false)
|
113 |
+
return $galleryID;
|
114 |
+
|
115 |
+
if ($galleryID != false) {
|
116 |
+
$message = __('Gallery ID %1$s successfully created. You can show this gallery in your post or page with the shortcode %2$s.<br/>','nggallery');
|
117 |
+
$message = sprintf($message, $galleryID, '<strong>[nggallery id=' . $galleryID . ']</strong>');
|
118 |
+
$message .= '<a href="' . admin_url() . 'admin.php?page=nggallery-manage-gallery&mode=edit&gid=' . $galleryID . '" >';
|
119 |
+
$message .= __('Edit gallery','nggallery');
|
120 |
+
$message .= '</a>';
|
121 |
+
|
122 |
+
if ($output) nggGallery::show_message($message);
|
123 |
+
}
|
124 |
+
return true;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
125 |
}
|
126 |
|
127 |
/**
|
712 |
$meta['timestamp'] = $pdata->get_date_time();
|
713 |
// this contain other useful meta information
|
714 |
$meta['common'] = $pdata->get_common_meta();
|
715 |
+
// hook for addon plugin to add more meta fields
|
716 |
+
$meta = apply_filters('ngg_get_image_metadata', $meta, $pdata);
|
717 |
|
718 |
return $meta;
|
719 |
|
855 |
// check if file is a zip file
|
856 |
if ( !preg_match('/(zip|download|octet-stream)/i', $_FILES['zipfile']['type']) ) {
|
857 |
@unlink($temp_zipfile); // del temp file
|
858 |
+
nggGallery::show_error(__('Uploaded file was no or a faulty zip file ! The server recognized : ','nggallery').$_FILES['zipfile']['type']);
|
859 |
return false;
|
860 |
}
|
861 |
}
|
982 |
|
983 |
// save temp file to gallery
|
984 |
if ( !@move_uploaded_file($temp_file, $dest_file) ){
|
985 |
+
nggGallery::show_error(__('Error, the file could not be moved to : ','nggallery') . $dest_file);
|
986 |
nggAdmin::check_safemode( $gallery->abspath );
|
987 |
continue;
|
988 |
}
|
989 |
if ( !nggAdmin::chmod($dest_file) ) {
|
990 |
+
nggGallery::show_error(__('Error, the file permissions could not be set','nggallery'));
|
991 |
continue;
|
992 |
}
|
993 |
|
1071 |
// save temp file to gallery
|
1072 |
if ( !@move_uploaded_file($_FILES["Filedata"]['tmp_name'], $dest_file) ){
|
1073 |
nggAdmin::check_safemode(WINABSPATH.$gallerypath);
|
1074 |
+
return __('Error, the file could not be moved to : ','nggallery').$dest_file;
|
1075 |
}
|
1076 |
|
1077 |
if ( !nggAdmin::chmod($dest_file) )
|
1078 |
+
return __('Error, the file permissions could not be set','nggallery');
|
1079 |
|
1080 |
return '0';
|
1081 |
}
|
1234 |
* @return void
|
1235 |
*/
|
1236 |
function copy_images($pic_ids, $dest_gid) {
|
1237 |
+
|
1238 |
+
require_once(NGGALLERY_ABSPATH . '/lib/meta.php');
|
1239 |
|
1240 |
$errors = $messages = '';
|
1241 |
|
1298 |
|
1299 |
// Copy tags
|
1300 |
nggTags::copy_tags($image->pid, $new_pid);
|
1301 |
+
|
1302 |
+
// Copy meta information
|
1303 |
+
$meta = new nggMeta($image->pid);
|
1304 |
+
nggdb::update_image_meta( $new_pid, $meta->image->meta_data);
|
1305 |
|
1306 |
if ( $tmp_prefix != '' ) {
|
1307 |
$messages .= sprintf(__('Image %1$s (%2$s) copied as image %3$s (%4$s) » The file already existed in the destination gallery.','nggallery'),
|
1363 |
} );
|
1364 |
</script>
|
1365 |
|
|
|
|
|
1366 |
<?php
|
1367 |
}
|
1368 |
|
admin/images/nextgen.png
ADDED
Binary file
|
admin/install.php
CHANGED
@@ -50,11 +50,13 @@ function nggallery_install () {
|
|
50 |
$nggpictures = $wpdb->prefix . 'ngg_pictures';
|
51 |
$nggallery = $wpdb->prefix . 'ngg_gallery';
|
52 |
$nggalbum = $wpdb->prefix . 'ngg_album';
|
53 |
-
|
54 |
-
|
|
|
55 |
|
56 |
$sql = "CREATE TABLE " . $nggpictures . " (
|
57 |
pid BIGINT(20) NOT NULL AUTO_INCREMENT ,
|
|
|
58 |
post_id BIGINT(20) DEFAULT '0' NOT NULL ,
|
59 |
galleryid BIGINT(20) DEFAULT '0' NOT NULL ,
|
60 |
filename VARCHAR(255) NOT NULL ,
|
@@ -71,11 +73,12 @@ function nggallery_install () {
|
|
71 |
dbDelta($sql);
|
72 |
}
|
73 |
|
74 |
-
if(
|
75 |
|
76 |
$sql = "CREATE TABLE " . $nggallery . " (
|
77 |
gid BIGINT(20) NOT NULL AUTO_INCREMENT ,
|
78 |
name VARCHAR(255) NOT NULL ,
|
|
|
79 |
path MEDIUMTEXT NULL ,
|
80 |
title MEDIUMTEXT NULL ,
|
81 |
galdesc MEDIUMTEXT NULL ,
|
@@ -87,12 +90,13 @@ function nggallery_install () {
|
|
87 |
|
88 |
dbDelta($sql);
|
89 |
}
|
90 |
-
|
91 |
-
if(
|
92 |
|
93 |
$sql = "CREATE TABLE " . $nggalbum . " (
|
94 |
id BIGINT(20) NOT NULL AUTO_INCREMENT ,
|
95 |
name VARCHAR(255) NOT NULL ,
|
|
|
96 |
previewpic BIGINT(20) DEFAULT '0' NOT NULL ,
|
97 |
albumdesc MEDIUMTEXT NULL ,
|
98 |
sortorder LONGTEXT NOT NULL,
|
@@ -104,7 +108,7 @@ function nggallery_install () {
|
|
104 |
}
|
105 |
|
106 |
// check one table again, to be sure
|
107 |
-
if(
|
108 |
update_option( "ngg_init_check", __('NextGEN Gallery : Tables could not created, please check your database settings',"nggallery") );
|
109 |
return;
|
110 |
}
|
50 |
$nggpictures = $wpdb->prefix . 'ngg_pictures';
|
51 |
$nggallery = $wpdb->prefix . 'ngg_gallery';
|
52 |
$nggalbum = $wpdb->prefix . 'ngg_album';
|
53 |
+
|
54 |
+
// could be case senstive : http://dev.mysql.com/doc/refman/5.1/en/identifier-case-sensitivity.html
|
55 |
+
if( !$wpdb->get_var( "SHOW TABLES LIKE '$nggpictures'" ) ) {
|
56 |
|
57 |
$sql = "CREATE TABLE " . $nggpictures . " (
|
58 |
pid BIGINT(20) NOT NULL AUTO_INCREMENT ,
|
59 |
+
image_slug VARCHAR(255) NOT NULL ,
|
60 |
post_id BIGINT(20) DEFAULT '0' NOT NULL ,
|
61 |
galleryid BIGINT(20) DEFAULT '0' NOT NULL ,
|
62 |
filename VARCHAR(255) NOT NULL ,
|
73 |
dbDelta($sql);
|
74 |
}
|
75 |
|
76 |
+
if( !$wpdb->get_var( "SHOW TABLES LIKE '$nggallery'" )) {
|
77 |
|
78 |
$sql = "CREATE TABLE " . $nggallery . " (
|
79 |
gid BIGINT(20) NOT NULL AUTO_INCREMENT ,
|
80 |
name VARCHAR(255) NOT NULL ,
|
81 |
+
slug VARCHAR(255) NOT NULL ,
|
82 |
path MEDIUMTEXT NULL ,
|
83 |
title MEDIUMTEXT NULL ,
|
84 |
galdesc MEDIUMTEXT NULL ,
|
90 |
|
91 |
dbDelta($sql);
|
92 |
}
|
93 |
+
|
94 |
+
if( !$wpdb->get_var( "SHOW TABLES LIKE '$nggalbum'" )) {
|
95 |
|
96 |
$sql = "CREATE TABLE " . $nggalbum . " (
|
97 |
id BIGINT(20) NOT NULL AUTO_INCREMENT ,
|
98 |
name VARCHAR(255) NOT NULL ,
|
99 |
+
slug VARCHAR(255) NOT NULL ,
|
100 |
previewpic BIGINT(20) DEFAULT '0' NOT NULL ,
|
101 |
albumdesc MEDIUMTEXT NULL ,
|
102 |
sortorder LONGTEXT NOT NULL,
|
108 |
}
|
109 |
|
110 |
// check one table again, to be sure
|
111 |
+
if( !$wpdb->get_var( "SHOW TABLES LIKE '$nggpictures'" ) ) {
|
112 |
update_option( "ngg_init_check", __('NextGEN Gallery : Tables could not created, please check your database settings',"nggallery") );
|
113 |
return;
|
114 |
}
|
admin/js/jquery-ui-1.8.6.min.js
ADDED
@@ -0,0 +1,391 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*!
|
2 |
+
* jQuery UI 1.8.6
|
3 |
+
*
|
4 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
5 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
6 |
+
* http://jquery.org/license
|
7 |
+
*
|
8 |
+
* http://docs.jquery.com/UI
|
9 |
+
*/
|
10 |
+
(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.6",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
|
11 |
+
NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,
|
12 |
+
"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");
|
13 |
+
if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f,
|
14 |
+
"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,
|
15 |
+
d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}});
|
16 |
+
c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&
|
17 |
+
b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery);
|
18 |
+
;/*!
|
19 |
+
* jQuery UI Widget 1.8.6
|
20 |
+
*
|
21 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
22 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
23 |
+
* http://jquery.org/license
|
24 |
+
*
|
25 |
+
* http://docs.jquery.com/UI/Widget
|
26 |
+
*/
|
27 |
+
(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,
|
28 |
+
a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h;
|
29 |
+
e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options,
|
30 |
+
this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},
|
31 |
+
widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},
|
32 |
+
enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
|
33 |
+
;/*!
|
34 |
+
* jQuery UI Mouse 1.8.6
|
35 |
+
*
|
36 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
37 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
38 |
+
* http://jquery.org/license
|
39 |
+
*
|
40 |
+
* http://docs.jquery.com/UI/Mouse
|
41 |
+
*
|
42 |
+
* Depends:
|
43 |
+
* jquery.ui.widget.js
|
44 |
+
*/
|
45 |
+
(function(c){c.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(b){return a._mouseDown(b)}).bind("click."+this.widgetName,function(b){if(a._preventClickEvent){a._preventClickEvent=false;b.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(a){a.originalEvent=a.originalEvent||{};if(!a.originalEvent.mouseHandled){this._mouseStarted&&
|
46 |
+
this._mouseUp(a);this._mouseDownEvent=a;var b=this,e=a.which==1,f=typeof this.options.cancel=="string"?c(a.target).parents().add(a.target).filter(this.options.cancel).length:false;if(!e||f||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){b.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();
|
47 |
+
return true}}this._mouseMoveDelegate=function(d){return b._mouseMove(d)};this._mouseUpDelegate=function(d){return b._mouseUp(d)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return a.originalEvent.mouseHandled=true}},_mouseMove:function(a){if(c.browser.msie&&!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&
|
48 |
+
this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;this._preventClickEvent=a.target==this._mouseDownEvent.target;this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-
|
49 |
+
a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
|
50 |
+
;/*
|
51 |
+
* jQuery UI Position 1.8.6
|
52 |
+
*
|
53 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
54 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
55 |
+
* http://jquery.org/license
|
56 |
+
*
|
57 |
+
* http://docs.jquery.com/UI/Position
|
58 |
+
*/
|
59 |
+
(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
|
60 |
+
left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
|
61 |
+
k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+parseInt(c.curCSS(this,"marginRight",true))||0,w=m+q+parseInt(c.curCSS(this,"marginBottom",true))||0,i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=m/2;
|
62 |
+
i.left=parseInt(i.left);i.top=parseInt(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=d>0?
|
63 |
+
b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
|
64 |
+
a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
|
65 |
+
g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
|
66 |
+
;/*
|
67 |
+
* jQuery UI Draggable 1.8.6
|
68 |
+
*
|
69 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
70 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
71 |
+
* http://jquery.org/license
|
72 |
+
*
|
73 |
+
* http://docs.jquery.com/UI/Draggables
|
74 |
+
*
|
75 |
+
* Depends:
|
76 |
+
* jquery.ui.core.js
|
77 |
+
* jquery.ui.mouse.js
|
78 |
+
* jquery.ui.widget.js
|
79 |
+
*/
|
80 |
+
(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
|
81 |
+
"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
|
82 |
+
this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-
|
83 |
+
this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();
|
84 |
+
d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||
|
85 |
+
this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if(!this.element[0]||!this.element[0].parentNode)return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,
|
86 |
+
b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
|
87 |
+
a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||
|
88 |
+
0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
|
89 |
+
this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-
|
90 |
+
(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment==
|
91 |
+
"parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&
|
92 |
+
a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),
|
93 |
+
10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
|
94 |
+
this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():
|
95 |
+
f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])e=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+
|
96 |
+
this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;e=this.originalPageX+
|
97 |
+
Math.round((e-this.originalPageX)/b.grid[0])*b.grid[0];e=this.containment?!(e-this.offset.click.left<this.containment[0]||e-this.offset.click.left>this.containment[2])?e:!(e-this.offset.click.left<this.containment[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-
|
98 |
+
this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=
|
99 |
+
this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.6"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var g=d.data(this,"sortable");
|
100 |
+
if(g&&!g.options.disabled){c.sortables.push({instance:g,shouldRevert:g.options.revert});g._refreshItems();g._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;
|
101 |
+
c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=
|
102 |
+
1;this.instance.currentItem=d(f).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;
|
103 |
+
this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=
|
104 |
+
this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","iframeFix",{start:function(){var a=
|
105 |
+
d(this).data("draggable").options;d(a.iframeFix===true?"iframe":a.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;
|
106 |
+
if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!=
|
107 |
+
"HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-
|
108 |
+
b.overflowOffset.left<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-
|
109 |
+
c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,
|
110 |
+
width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,g=b.offset.left,n=g+c.helperProportions.width,m=b.offset.top,o=m+c.helperProportions.height,h=c.snapElements.length-1;h>=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e<g&&g<k+e&&j-e<m&&m<l+e||i-e<g&&g<k+e&&j-e<o&&o<l+e||i-e<n&&n<k+e&&j-e<m&&m<l+e||i-e<n&&n<k+e&&j-e<o&&
|
111 |
+
o<l+e){if(f.snapMode!="inner"){var p=Math.abs(j-o)<=e,q=Math.abs(l-m)<=e,r=Math.abs(i-n)<=e,s=Math.abs(k-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k}).left-c.margins.left}var t=
|
112 |
+
p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(j-m)<=e;q=Math.abs(l-o)<=e;r=Math.abs(i-g)<=e;s=Math.abs(k-n)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[h].snapping&&
|
113 |
+
(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=p||q||r||s||t}else{c.snapElements[h].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),
|
114 |
+
10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery);
|
115 |
+
;/*
|
116 |
+
* jQuery UI Droppable 1.8.6
|
117 |
+
*
|
118 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
119 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
120 |
+
* http://jquery.org/license
|
121 |
+
*
|
122 |
+
* http://docs.jquery.com/UI/Droppables
|
123 |
+
*
|
124 |
+
* Depends:
|
125 |
+
* jquery.ui.core.js
|
126 |
+
* jquery.ui.widget.js
|
127 |
+
* jquery.ui.mouse.js
|
128 |
+
* jquery.ui.draggable.js
|
129 |
+
*/
|
130 |
+
(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this);
|
131 |
+
a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&
|
132 |
+
this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
|
133 |
+
this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=
|
134 |
+
d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
|
135 |
+
a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.6"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height;
|
136 |
+
switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>=
|
137 |
+
i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!=
|
138 |
+
"none";if(c[f].visible){c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight};e=="mousedown"&&c[f]._activate.call(c[f],b)}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem||
|
139 |
+
a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=
|
140 |
+
d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})}}})(jQuery);
|
141 |
+
;/*
|
142 |
+
* jQuery UI Resizable 1.8.6
|
143 |
+
*
|
144 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
145 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
146 |
+
* http://jquery.org/license
|
147 |
+
*
|
148 |
+
* http://docs.jquery.com/UI/Resizables
|
149 |
+
*
|
150 |
+
* Depends:
|
151 |
+
* jquery.ui.core.js
|
152 |
+
* jquery.ui.mouse.js
|
153 |
+
* jquery.ui.widget.js
|
154 |
+
*/
|
155 |
+
(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element,
|
156 |
+
_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
|
157 |
+
top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
|
158 |
+
this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
|
159 |
+
nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
|
160 |
+
String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
|
161 |
+
this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};
|
162 |
+
if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),
|
163 |
+
d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=
|
164 |
+
this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:
|
165 |
+
this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",
|
166 |
+
b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;
|
167 |
+
f={width:c.size.width-(f?0:c.sizeDiff.width),height:c.size.height-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",
|
168 |
+
b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=
|
169 |
+
a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=l(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=l(b.width)&&a.minWidth&&a.minWidth>b.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,
|
170 |
+
k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=[c.css("borderTopWidth"),
|
171 |
+
c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)||0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=
|
172 |
+
this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+
|
173 |
+
a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,
|
174 |
+
arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,
|
175 |
+
{version:"1.8.6"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,
|
176 |
+
function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=
|
177 |
+
(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=
|
178 |
+
false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-
|
179 |
+
a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",
|
180 |
+
b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top",
|
181 |
+
"Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,
|
182 |
+
f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=
|
183 |
+
a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+
|
184 |
+
a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&
|
185 |
+
e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",
|
186 |
+
height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=
|
187 |
+
d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
|
188 |
+
;/*
|
189 |
+
* jQuery UI Selectable 1.8.6
|
190 |
+
*
|
191 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
192 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
193 |
+
* http://jquery.org/license
|
194 |
+
*
|
195 |
+
* http://docs.jquery.com/UI/Selectables
|
196 |
+
*
|
197 |
+
* Depends:
|
198 |
+
* jquery.ui.core.js
|
199 |
+
* jquery.ui.mouse.js
|
200 |
+
* jquery.ui.widget.js
|
201 |
+
*/
|
202 |
+
(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),
|
203 |
+
selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
|
204 |
+
c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",
|
205 |
+
c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d=
|
206 |
+
this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting");
|
207 |
+
a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&&
|
208 |
+
!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d=
|
209 |
+
e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.6"})})(jQuery);
|
210 |
+
;/*
|
211 |
+
* jQuery UI Sortable 1.8.6
|
212 |
+
*
|
213 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
214 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
215 |
+
* http://jquery.org/license
|
216 |
+
*
|
217 |
+
* http://docs.jquery.com/UI/Sortables
|
218 |
+
*
|
219 |
+
* Depends:
|
220 |
+
* jquery.ui.core.js
|
221 |
+
* jquery.ui.mouse.js
|
222 |
+
* jquery.ui.widget.js
|
223 |
+
*/
|
224 |
+
(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable");
|
225 |
+
this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,
|
226 |
+
arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=
|
227 |
+
c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,
|
228 |
+
{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();
|
229 |
+
if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",
|
230 |
+
a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");
|
231 |
+
if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+
|
232 |
+
this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()-b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+
|
233 |
+
b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+
|
234 |
+
"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,
|
235 |
+
c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==
|
236 |
+
document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp();this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",
|
237 |
+
null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):
|
238 |
+
d(this.domPosition.parent).prepend(this.currentItem);return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||
|
239 |
+
"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+
|
240 |
+
this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection();var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?
|
241 |
+
2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)},_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},
|
242 |
+
_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=
|
243 |
+
this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=
|
244 |
+
this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element),this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");
|
245 |
+
if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&&this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=
|
246 |
+
0;b--){var c=this.items[b],e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=
|
247 |
+
this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},
|
248 |
+
update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=
|
249 |
+
null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));
|
250 |
+
this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,
|
251 |
+
null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||
|
252 |
+
d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a==
|
253 |
+
"string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition==
|
254 |
+
"absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition==
|
255 |
+
"relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},
|
256 |
+
_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-
|
257 |
+
this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),
|
258 |
+
10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?
|
259 |
+
this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=
|
260 |
+
this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])f=this.containment[0]+
|
261 |
+
this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?
|
262 |
+
g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():
|
263 |
+
e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==
|
264 |
+
f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",
|
265 |
+
f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove",f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",
|
266 |
+
g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=
|
267 |
+
0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
|
268 |
+
this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});
|
269 |
+
d.extend(d.ui.sortable,{version:"1.8.6"})})(jQuery);
|
270 |
+
;/*
|
271 |
+
* jQuery UI Autocomplete 1.8.6
|
272 |
+
*
|
273 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
274 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
275 |
+
* http://jquery.org/license
|
276 |
+
*
|
277 |
+
* http://docs.jquery.com/UI/Autocomplete
|
278 |
+
*
|
279 |
+
* Depends:
|
280 |
+
* jquery.ui.core.js
|
281 |
+
* jquery.ui.widget.js
|
282 |
+
* jquery.ui.position.js
|
283 |
+
*/
|
284 |
+
(function(e){e.widget("ui.autocomplete",{options:{appendTo:"body",delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},_create:function(){var a=this,b=this.element[0].ownerDocument,f;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){f=false;var d=e.ui.keyCode;switch(c.keyCode){case d.PAGE_UP:a._move("previousPage",
|
285 |
+
c);break;case d.PAGE_DOWN:a._move("nextPage",c);break;case d.UP:a._move("previous",c);c.preventDefault();break;case d.DOWN:a._move("next",c);c.preventDefault();break;case d.ENTER:case d.NUMPAD_ENTER:if(a.menu.active){f=true;c.preventDefault()}case d.TAB:if(!a.menu.active)return;a.menu.select(c);break;case d.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);
|
286 |
+
break}}}).bind("keypress.autocomplete",function(c){if(f){f=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};this.menu=e("<ul></ul>").addClass("ui-autocomplete").appendTo(e(this.options.appendTo||
|
287 |
+
"body",b)[0]).mousedown(function(c){var d=a.menu.element[0];e(c.target).closest(".ui-menu-item").length||setTimeout(function(){e(document).one("mousedown",function(g){g.target!==a.element[0]&&g.target!==d&&!e.ui.contains(d,g.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,d){d=d.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:d})&&/^key/.test(c.originalEvent.type)&&a.element.val(d.value)},selected:function(c,d){d=d.item.data("item.autocomplete");
|
288 |
+
var g=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=g;setTimeout(function(){a.previous=g},1)}false!==a._trigger("select",c,{item:d})&&a.element.val(d.value);a.term=a.element.val();a.close(c);a.selectedItem=d},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");e.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");
|
289 |
+
this.menu.element.remove();e.Widget.prototype.destroy.call(this)},_setOption:function(a,b){e.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(e(b||"body",this.element[0].ownerDocument)[0])},_initSource:function(){var a=this,b,f;if(e.isArray(this.options.source)){b=this.options.source;this.source=function(c,d){d(e.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){f=this.options.source;this.source=
|
290 |
+
function(c,d){a.xhr&&a.xhr.abort();a.xhr=e.getJSON(f,c,function(g,i,h){h===a.xhr&&d(g);a.xhr=null})}}else this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(a&&a.length){a=
|
291 |
+
this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this._trigger("close",a);this.menu.element.hide();this.menu.deactivate()}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return e.map(a,function(b){if(typeof b===
|
292 |
+
"string")return{label:b,value:b};return e.extend({label:b.label||b.value,value:b.value||b.label},b)})},_suggest:function(a){this._renderMenu(this.menu.element.empty().zIndex(this.element.zIndex()+1),a);this.menu.deactivate();this.menu.refresh();this.menu.element.show().position(e.extend({of:this.element},this.options.position));this._resizeMenu()},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var f=
|
293 |
+
this;e.each(b,function(c,d){f._renderItem(a,d)})},_renderItem:function(a,b){return e("<li></li>").data("item.autocomplete",b).append(e("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});e.extend(e.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,
|
294 |
+
"\\$&")},filter:function(a,b){var f=new RegExp(e.ui.autocomplete.escapeRegex(b),"i");return e.grep(a,function(c){return f.test(c.label||c.value||c)})}})})(jQuery);
|
295 |
+
(function(e){e.widget("ui.menu",{_create:function(){var a=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(b){if(e(b.target).closest(".ui-menu-item a").length){b.preventDefault();a.select(b)}});this.refresh()},refresh:function(){var a=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
|
296 |
+
-1).mouseenter(function(b){a.activate(b,e(this).parent())}).mouseleave(function(){a.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var f=b.offset().top-this.element.offset().top,c=this.element.attr("scrollTop"),d=this.element.height();if(f<0)this.element.attr("scrollTop",c+f);else f>=d&&this.element.attr("scrollTop",c+f-d+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",a,{item:b})},
|
297 |
+
deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(a,b,f){if(this.active){a=this.active[a+"All"](".ui-menu-item").eq(0);
|
298 |
+
a.length?this.activate(f,a):this.activate(f,this.element.children(b))}else this.activate(f,this.element.children(b))},nextPage:function(a){if(this.hasScroll())if(!this.active||this.last())this.activate(a,this.element.children(".ui-menu-item:first"));else{var b=this.active.offset().top,f=this.element.height(),c=this.element.children(".ui-menu-item").filter(function(){var d=e(this).offset().top-b-f+e(this).height();return d<10&&d>-10});c.length||(c=this.element.children(".ui-menu-item:last"));this.activate(a,
|
299 |
+
c)}else this.activate(a,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(a){if(this.hasScroll())if(!this.active||this.first())this.activate(a,this.element.children(".ui-menu-item:last"));else{var b=this.active.offset().top,f=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var c=e(this).offset().top-b+f-e(this).height();return c<10&&c>-10});result.length||(result=this.element.children(".ui-menu-item:first"));
|
300 |
+
this.activate(a,result)}else this.activate(a,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(a){this._trigger("selected",a,{item:this.active})}})})(jQuery);
|
301 |
+
;/*
|
302 |
+
* jQuery UI Dialog 1.8.6
|
303 |
+
*
|
304 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
305 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
306 |
+
* http://jquery.org/license
|
307 |
+
*
|
308 |
+
* http://docs.jquery.com/UI/Dialog
|
309 |
+
*
|
310 |
+
* Depends:
|
311 |
+
* jquery.ui.core.js
|
312 |
+
* jquery.ui.widget.js
|
313 |
+
* jquery.ui.button.js
|
314 |
+
* jquery.ui.draggable.js
|
315 |
+
* jquery.ui.mouse.js
|
316 |
+
* jquery.ui.position.js
|
317 |
+
* jquery.ui.resizable.js
|
318 |
+
*/
|
319 |
+
(function(c,j){var k={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},l={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",of:window,collision:"fit",using:function(a){var b=c(this).css(a).offset().top;
|
320 |
+
b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",
|
321 |
+
-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role",
|
322 |
+
"button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=
|
323 |
+
b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");a.uiDialog.remove();a.originalTitle&&
|
324 |
+
a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==b.uiDialog[0])d=Math.max(d,c(this).css("z-index"))});
|
325 |
+
c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);
|
326 |
+
d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();
|
327 |
+
a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;f=c('<button type="button"></button>').attr(h,true).unbind("click").click(function(){h.click.apply(b.element[0],
|
328 |
+
arguments)}).appendTo(g);c.fn.button&&f.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,
|
329 |
+
h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,originalSize:f.originalSize,position:f.position,size:f.size}}a=a===j?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";
|
330 |
+
d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",
|
331 |
+
g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,
|
332 |
+
a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(a);e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);if(g in k)e=true;if(g in l)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);
|
333 |
+
break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");
|
334 |
+
g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=this.options,b,d;this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,
|
335 |
+
height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.6",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});
|
336 |
+
c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&
|
337 |
+
d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){this.oldInstances.push(this.instances.splice(c.inArray(a,this.instances),1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");
|
338 |
+
a.remove();var b=0;c.each(this.instances,function(){b=Math.max(b,this.css("z-index"))});this.maxZ=b},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollWidth,
|
339 |
+
document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,function(){a=a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
|
340 |
+
;/*
|
341 |
+
* jQuery UI Tabs 1.8.6
|
342 |
+
*
|
343 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
344 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
345 |
+
* http://jquery.org/license
|
346 |
+
*
|
347 |
+
* http://docs.jquery.com/UI/Tabs
|
348 |
+
*
|
349 |
+
* Depends:
|
350 |
+
* jquery.ui.core.js
|
351 |
+
* jquery.ui.widget.js
|
352 |
+
*/
|
353 |
+
(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&&
|
354 |
+
e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=
|
355 |
+
d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]||
|
356 |
+
(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a._sanitizeSelector(i));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=d("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");
|
357 |
+
this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected=
|
358 |
+
this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");
|
359 |
+
if(c.selected>=0&&this.anchors.length){d(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],d(a._sanitizeSelector(a.anchors[c.selected].hash))))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"));
|
360 |
+
this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+
|
361 |
+
g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal",
|
362 |
+
function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")};
|
363 |
+
this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=d(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected=-1;c.cookie&&
|
364 |
+
a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier.";
|
365 |
+
d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e=
|
366 |
+
d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b,
|
367 |
+
e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=d("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]);
|
368 |
+
j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove();
|
369 |
+
if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null,
|
370 |
+
this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this},
|
371 |
+
load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){d(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c,"cache.tabs",
|
372 |
+
true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},url:function(b,
|
373 |
+
e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.6"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&&a.rotate(null)}:
|
374 |
+
function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery);
|
375 |
+
;/*
|
376 |
+
* jQuery UI Progressbar 1.8.6
|
377 |
+
*
|
378 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
379 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
380 |
+
* http://jquery.org/license
|
381 |
+
*
|
382 |
+
* http://docs.jquery.com/UI/Progressbar
|
383 |
+
*
|
384 |
+
* Depends:
|
385 |
+
* jquery.ui.core.js
|
386 |
+
* jquery.ui.widget.js
|
387 |
+
*/
|
388 |
+
(function(b,c){b.widget("ui.progressbar",{options:{value:0},min:0,max:100,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");
|
389 |
+
this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===c)return this._value();this._setOption("value",a);return this},_setOption:function(a,d){if(a==="value"){this.options.value=d;this._refreshValue();this._trigger("change");this._value()===this.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.max,Math.max(this.min,a))},_refreshValue:function(){var a=
|
390 |
+
this.value();this.valueDiv.toggleClass("ui-corner-right",a===this.max).width(a+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.6"})})(jQuery);
|
391 |
+
;
|
admin/js/jquery.ui.autocomplete.min.js
ADDED
@@ -0,0 +1,31 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*
|
2 |
+
* jQuery UI Autocomplete 1.8.6
|
3 |
+
*
|
4 |
+
* Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
|
5 |
+
* Dual licensed under the MIT or GPL Version 2 licenses.
|
6 |
+
* http://jquery.org/license
|
7 |
+
*
|
8 |
+
* http://docs.jquery.com/UI/Autocomplete
|
9 |
+
*
|
10 |
+
* Depends:
|
11 |
+
* jquery.ui.core.js
|
12 |
+
* jquery.ui.widget.js
|
13 |
+
* jquery.ui.position.js
|
14 |
+
*/
|
15 |
+
(function(e){e.widget("ui.autocomplete",{options:{appendTo:"body",delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},_create:function(){var a=this,b=this.element[0].ownerDocument,f;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){f=false;var d=e.ui.keyCode;switch(c.keyCode){case d.PAGE_UP:a._move("previousPage",
|
16 |
+
c);break;case d.PAGE_DOWN:a._move("nextPage",c);break;case d.UP:a._move("previous",c);c.preventDefault();break;case d.DOWN:a._move("next",c);c.preventDefault();break;case d.ENTER:case d.NUMPAD_ENTER:if(a.menu.active){f=true;c.preventDefault()}case d.TAB:if(!a.menu.active)return;a.menu.select(c);break;case d.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);
|
17 |
+
break}}}).bind("keypress.autocomplete",function(c){if(f){f=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};this.menu=e("<ul></ul>").addClass("ui-autocomplete").appendTo(e(this.options.appendTo||
|
18 |
+
"body",b)[0]).mousedown(function(c){var d=a.menu.element[0];e(c.target).closest(".ui-menu-item").length||setTimeout(function(){e(document).one("mousedown",function(g){g.target!==a.element[0]&&g.target!==d&&!e.ui.contains(d,g.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,d){d=d.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:d})&&/^key/.test(c.originalEvent.type)&&a.element.val(d.value)},selected:function(c,d){d=d.item.data("item.autocomplete");
|
19 |
+
var g=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=g;setTimeout(function(){a.previous=g},1)}false!==a._trigger("select",c,{item:d})&&a.element.val(d.value);a.term=a.element.val();a.close(c);a.selectedItem=d},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");e.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");
|
20 |
+
this.menu.element.remove();e.Widget.prototype.destroy.call(this)},_setOption:function(a,b){e.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(e(b||"body",this.element[0].ownerDocument)[0])},_initSource:function(){var a=this,b,f;if(e.isArray(this.options.source)){b=this.options.source;this.source=function(c,d){d(e.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){f=this.options.source;this.source=
|
21 |
+
function(c,d){a.xhr&&a.xhr.abort();a.xhr=e.getJSON(f,c,function(g,i,h){h===a.xhr&&d(g);a.xhr=null})}}else this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(a&&a.length){a=
|
22 |
+
this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this._trigger("close",a);this.menu.element.hide();this.menu.deactivate()}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return e.map(a,function(b){if(typeof b===
|
23 |
+
"string")return{label:b,value:b};return e.extend({label:b.label||b.value,value:b.value||b.label},b)})},_suggest:function(a){this._renderMenu(this.menu.element.empty().zIndex(this.element.zIndex()+1),a);this.menu.deactivate();this.menu.refresh();this.menu.element.show().position(e.extend({of:this.element},this.options.position));this._resizeMenu()},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var f=
|
24 |
+
this;e.each(b,function(c,d){f._renderItem(a,d)})},_renderItem:function(a,b){return e("<li></li>").data("item.autocomplete",b).append(e("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});e.extend(e.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,
|
25 |
+
"\\$&")},filter:function(a,b){var f=new RegExp(e.ui.autocomplete.escapeRegex(b),"i");return e.grep(a,function(c){return f.test(c.label||c.value||c)})}})})(jQuery);
|
26 |
+
(function(e){e.widget("ui.menu",{_create:function(){var a=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(b){if(e(b.target).closest(".ui-menu-item a").length){b.preventDefault();a.select(b)}});this.refresh()},refresh:function(){var a=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
|
27 |
+
-1).mouseenter(function(b){a.activate(b,e(this).parent())}).mouseleave(function(){a.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var f=b.offset().top-this.element.offset().top,c=this.element.attr("scrollTop"),d=this.element.height();if(f<0)this.element.attr("scrollTop",c+f);else f>=d&&this.element.attr("scrollTop",c+f-d+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",a,{item:b})},
|
28 |
+
deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(a,b,f){if(this.active){a=this.active[a+"All"](".ui-menu-item").eq(0);
|
29 |
+
a.length?this.activate(f,a):this.activate(f,this.element.children(b))}else this.activate(f,this.element.children(b))},nextPage:function(a){if(this.hasScroll())if(!this.active||this.last())this.activate(a,this.element.children(".ui-menu-item:first"));else{var b=this.active.offset().top,f=this.element.height(),c=this.element.children(".ui-menu-item").filter(function(){var d=e(this).offset().top-b-f+e(this).height();return d<10&&d>-10});c.length||(c=this.element.children(".ui-menu-item:last"));this.activate(a,
|
30 |
+
c)}else this.activate(a,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(a){if(this.hasScroll())if(!this.active||this.first())this.activate(a,this.element.children(".ui-menu-item:last"));else{var b=this.active.offset().top,f=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var c=e(this).offset().top-b+f-e(this).height();return c<10&&c>-10});result.length||(result=this.element.children(".ui-menu-item:first"));
|
31 |
+
this.activate(a,result)}else this.activate(a,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(a){this._trigger("selected",a,{item:this.active})}})})(jQuery);
|
admin/js/ngg.ajax.js
CHANGED
@@ -1,6 +1,6 @@
|
|
1 |
/*
|
2 |
* Ajax Plugin for NextGEN gallery
|
3 |
-
* Version: 1.4.
|
4 |
* Author : Alex Rabe
|
5 |
*/
|
6 |
(function($) {
|
1 |
/*
|
2 |
* Ajax Plugin for NextGEN gallery
|
3 |
+
* Version: 1.4.1
|
4 |
* Author : Alex Rabe
|
5 |
*/
|
6 |
(function($) {
|
admin/js/ngg.autocomplete.js
ADDED
@@ -0,0 +1,72 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*
|
2 |
+
* Implementation of jQuery UI Autocomplete
|
3 |
+
* see http://jqueryui.com/demos/autocomplete/
|
4 |
+
* Version: 1.0.0
|
5 |
+
* Author : Alex Rabe
|
6 |
+
*/
|
7 |
+
jQuery.fn.nggAutocomplete = function ( args ) {
|
8 |
+
|
9 |
+
var defaults = { type: 'image',
|
10 |
+
domain: '',
|
11 |
+
limit: 50 };
|
12 |
+
|
13 |
+
var s = jQuery.extend( {}, defaults, args);
|
14 |
+
|
15 |
+
var settings = { method: 'autocomplete',
|
16 |
+
type: s.type,
|
17 |
+
format: 'json',
|
18 |
+
callback: 'json',
|
19 |
+
limit: s.limit };
|
20 |
+
|
21 |
+
var obj = this.selector;
|
22 |
+
var id = jQuery(this).attr('id');
|
23 |
+
var cache = {}, lastXhr;
|
24 |
+
|
25 |
+
// get current value of drop down field
|
26 |
+
var c_text = jQuery(obj + ' :selected').text();
|
27 |
+
var c_val = jQuery(obj).val();
|
28 |
+
var c_width= jQuery(obj).css('width');
|
29 |
+
//hide first the drop down field
|
30 |
+
jQuery(obj).hide();
|
31 |
+
jQuery(obj).after('<input name="' + id + '_ac" type="text" id="' + id + '_ac"/>');
|
32 |
+
// Fill up current value & style
|
33 |
+
jQuery(obj + "_ac").val(c_text);
|
34 |
+
jQuery(obj + "_ac").css('width', c_width);
|
35 |
+
// Add the dropdown icon
|
36 |
+
jQuery(obj + "_ac").addClass('ui-autocomplete-start')
|
37 |
+
jQuery(obj + "_ac").autocomplete({
|
38 |
+
source: function( request, response ) {
|
39 |
+
var term = request.term;
|
40 |
+
if ( term in cache ) {
|
41 |
+
response( cache[ term ] );
|
42 |
+
return;
|
43 |
+
}
|
44 |
+
// adding more $_GET parameter
|
45 |
+
request = jQuery.extend( {}, settings, request);
|
46 |
+
lastXhr = jQuery.getJSON( s.domain, request, function( data, status, xhr ) {
|
47 |
+
// add term to cache
|
48 |
+
cache[ term ] = data;
|
49 |
+
if ( xhr === lastXhr )
|
50 |
+
response( data );
|
51 |
+
});
|
52 |
+
},
|
53 |
+
minLength: 0,
|
54 |
+
select: function( event, ui ) {
|
55 |
+
// adding this to the dropdown list
|
56 |
+
jQuery(obj).append( new Option(ui.item.label, ui.item.id) );
|
57 |
+
// now select it
|
58 |
+
jQuery(obj).val(ui.item.id);
|
59 |
+
jQuery(obj + "_ac").removeClass('ui-autocomplete-start');
|
60 |
+
}
|
61 |
+
});
|
62 |
+
|
63 |
+
jQuery(obj + "_ac").click(function() {
|
64 |
+
|
65 |
+
var search = jQuery(obj + "_ac").val();
|
66 |
+
// if the value is prefilled, we pass a empty string
|
67 |
+
if ( search == c_text)
|
68 |
+
search = '';
|
69 |
+
// pass empty string as value to search for, displaying all results
|
70 |
+
jQuery(obj + "_ac").autocomplete('search', search );
|
71 |
+
});
|
72 |
+
}
|
admin/js/ngg.progressbar.js
CHANGED
@@ -1,6 +1,6 @@
|
|
1 |
/*
|
2 |
* Progress bar Plugin for NextGEN gallery
|
3 |
-
* Version:
|
4 |
* Author : Alex Rabe
|
5 |
*/
|
6 |
(function($) {
|
@@ -16,14 +16,20 @@
|
|
16 |
init: function( s ) {
|
17 |
|
18 |
s = this.settings = $.extend( {}, this.settings, {}, s || {} );
|
19 |
-
|
20 |
-
div = $('#' + s.id + '_container');
|
21 |
width = Math.round( ( 100 / s.maxStep ) * 100 ) /100;
|
22 |
-
|
23 |
-
if (
|
24 |
-
|
25 |
-
|
26 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27 |
}
|
28 |
},
|
29 |
|
@@ -45,6 +51,8 @@
|
|
45 |
$("#" + s.id + "_note").append("<li>" + note + "<div class='show_details'><span>[more]</span><br />" + detail + "</div></li>");
|
46 |
else
|
47 |
$("#" + s.id + "_note").append("<li>" + note + "</li>");
|
|
|
|
|
48 |
},
|
49 |
|
50 |
increase: function( step ) {
|
@@ -61,19 +69,23 @@
|
|
61 |
$("#" + s.id + " span").html( '100%' );
|
62 |
// in the case we add a note , we should wait for a click
|
63 |
if (s.wait) {
|
64 |
-
|
65 |
-
$("#" + s.id).hide("slow");
|
66 |
-
}, 2000);
|
67 |
div.click(function () {
|
68 |
-
|
69 |
-
|
|
|
|
|
|
|
70 |
});
|
71 |
} else {
|
72 |
-
|
73 |
-
|
74 |
-
|
75 |
-
|
76 |
-
|
|
|
|
|
|
|
77 |
}
|
78 |
}
|
79 |
};
|
1 |
/*
|
2 |
* Progress bar Plugin for NextGEN gallery
|
3 |
+
* Version: 2.0.1
|
4 |
* Author : Alex Rabe
|
5 |
*/
|
6 |
(function($) {
|
16 |
init: function( s ) {
|
17 |
|
18 |
s = this.settings = $.extend( {}, this.settings, {}, s || {} );
|
19 |
+
div = $('#' + s.id + '_dialog');
|
|
|
20 |
width = Math.round( ( 100 / s.maxStep ) * 100 ) /100;
|
21 |
+
// add the initial progressbar
|
22 |
+
if ( $( "#" + s.id + "_dialog" ).length == 0) {
|
23 |
+
s.header = (s.header.length > 0) ? s.header : '' ;
|
24 |
+
$("body").append('<div id="' + s.id + '_dialog"><div id="' + s.id + '" class="progressborder"><div class="' + s.id + '"><span>0%</span></div></div></div>');
|
25 |
+
$('html,body').scrollTop(0); // works only in IE, FF
|
26 |
+
// we open the dialog
|
27 |
+
$( "#" + s.id + "_dialog" ).dialog({
|
28 |
+
width: 640,
|
29 |
+
resizable : true,
|
30 |
+
modal: true,
|
31 |
+
title: s.header
|
32 |
+
});
|
33 |
}
|
34 |
},
|
35 |
|
51 |
$("#" + s.id + "_note").append("<li>" + note + "<div class='show_details'><span>[more]</span><br />" + detail + "</div></li>");
|
52 |
else
|
53 |
$("#" + s.id + "_note").append("<li>" + note + "</li>");
|
54 |
+
// increase the height to show the note
|
55 |
+
div.dialog("option", "height", 220);
|
56 |
},
|
57 |
|
58 |
increase: function( step ) {
|
69 |
$("#" + s.id + " span").html( '100%' );
|
70 |
// in the case we add a note , we should wait for a click
|
71 |
if (s.wait) {
|
72 |
+
$("#" + s.id).delay(1000).hide("slow");
|
|
|
|
|
73 |
div.click(function () {
|
74 |
+
$("#" + s.id + "_dialog").dialog("destroy");
|
75 |
+
$("#" + s.id + "_dialog").remove();
|
76 |
+
// In the casee it's the manage page, force a submit
|
77 |
+
$('.nggform').prepend("<input type=\"hidden\" name=\"ajax_callback\" value=\"0\">");
|
78 |
+
$('.nggform').submit();
|
79 |
});
|
80 |
} else {
|
81 |
+
|
82 |
+
window.setTimeout(function() {
|
83 |
+
$("#" + s.id + "_dialog" ).delay(4000).dialog("destroy");
|
84 |
+
$("#" + s.id + "_dialog").remove();
|
85 |
+
// In the casee it's the manage page, force a submit
|
86 |
+
$('.nggform').prepend("<input type=\"hidden\" name=\"ajax_callback\" value=\"1\">");
|
87 |
+
$('.nggform').delay(4000).submit();
|
88 |
+
}, 1000);
|
89 |
}
|
90 |
}
|
91 |
};
|
admin/js/swfupload.handler.js
CHANGED
@@ -5,7 +5,7 @@
|
|
5 |
* Built on top of the swfupload library
|
6 |
* http://swfupload.org version 2.2.0
|
7 |
*
|
8 |
-
* version 1.0.
|
9 |
*/
|
10 |
|
11 |
// on load change the upload to swfupload
|
@@ -20,7 +20,6 @@ function initSWFUpload() {
|
|
20 |
.after("<input type='text' id='txtFileName' readonly='readonly' />")
|
21 |
.remove();
|
22 |
jQuery("#imagefiles").click( function() { fileBrowse(); } );
|
23 |
-
jQuery("#progressbar-wrap").hide();
|
24 |
});
|
25 |
}
|
26 |
|
@@ -45,7 +44,7 @@ function fileQueued(fileObj) {
|
|
45 |
function submitFiles() {
|
46 |
// check if a gallery is selected
|
47 |
if (jQuery('#galleryselect').val() > "0") {
|
48 |
-
|
49 |
// get old post_params
|
50 |
post_params = ngg_swf_upload.getSetting("post_params");
|
51 |
// update the selected gallery in the post_params
|
@@ -67,14 +66,14 @@ function removeFile(fileID) {
|
|
67 |
|
68 |
// called before the uploads start
|
69 |
function uploadStart(fileObj) {
|
70 |
-
|
71 |
return true;
|
72 |
}
|
73 |
|
74 |
// called during the upload progress
|
75 |
function uploadProgress(fileObj, bytesLoaded) {
|
76 |
var percent = Math.ceil((bytesLoaded / fileObj.size) * 100);
|
77 |
-
|
78 |
jQuery("#progressbar span").text(percent + "% - " + fileObj.name);
|
79 |
}
|
80 |
|
@@ -83,7 +82,7 @@ function uploadComplete(fileObj) {
|
|
83 |
jQuery("#" + fileObj.id).hide("slow");
|
84 |
jQuery("#" + fileObj.id).remove();
|
85 |
if ( ngg_swf_upload.getStats().files_queued == 0) {
|
86 |
-
|
87 |
jQuery("#uploadimage_form").submit();
|
88 |
}
|
89 |
}
|
@@ -92,7 +91,7 @@ function uploadComplete(fileObj) {
|
|
92 |
function uploadSuccess(fileObj, server_data) {
|
93 |
// Show any error message
|
94 |
if (server_data != 0){
|
95 |
-
|
96 |
}
|
97 |
// Upload the next file until queue is empty
|
98 |
if ( ngg_swf_upload.getStats().files_queued > 0) {
|
@@ -142,13 +141,12 @@ function uploadError(fileObj, error_code, message) {
|
|
142 |
error_name = "UNKNOWN";
|
143 |
break;
|
144 |
}
|
145 |
-
|
146 |
jQuery("#" + fileObj.id).hide("slow");
|
147 |
jQuery("#" + fileObj.id).remove();
|
148 |
if ( ngg_swf_upload.getStats().files_queued > 0) {
|
149 |
ngg_swf_upload.startUpload();
|
150 |
} else {
|
151 |
-
jQuery("#progressbar-wrap").hide()
|
152 |
jQuery('#uploadimage_form').prepend("<input type=\"hidden\" name=\"swf_callback\" value=\"" + error_name + "\">");
|
153 |
jQuery("#uploadimage_form").submit();
|
154 |
}
|
5 |
* Built on top of the swfupload library
|
6 |
* http://swfupload.org version 2.2.0
|
7 |
*
|
8 |
+
* version 1.0.3
|
9 |
*/
|
10 |
|
11 |
// on load change the upload to swfupload
|
20 |
.after("<input type='text' id='txtFileName' readonly='readonly' />")
|
21 |
.remove();
|
22 |
jQuery("#imagefiles").click( function() { fileBrowse(); } );
|
|
|
23 |
});
|
24 |
}
|
25 |
|
44 |
function submitFiles() {
|
45 |
// check if a gallery is selected
|
46 |
if (jQuery('#galleryselect').val() > "0") {
|
47 |
+
nggProgressBar.init(nggAjaxOptions);
|
48 |
// get old post_params
|
49 |
post_params = ngg_swf_upload.getSetting("post_params");
|
50 |
// update the selected gallery in the post_params
|
66 |
|
67 |
// called before the uploads start
|
68 |
function uploadStart(fileObj) {
|
69 |
+
nggProgressBar.init(nggAjaxOptions);
|
70 |
return true;
|
71 |
}
|
72 |
|
73 |
// called during the upload progress
|
74 |
function uploadProgress(fileObj, bytesLoaded) {
|
75 |
var percent = Math.ceil((bytesLoaded / fileObj.size) * 100);
|
76 |
+
nggProgressBar.increase( percent );
|
77 |
jQuery("#progressbar span").text(percent + "% - " + fileObj.name);
|
78 |
}
|
79 |
|
82 |
jQuery("#" + fileObj.id).hide("slow");
|
83 |
jQuery("#" + fileObj.id).remove();
|
84 |
if ( ngg_swf_upload.getStats().files_queued == 0) {
|
85 |
+
nggProgressBar.finished();
|
86 |
jQuery("#uploadimage_form").submit();
|
87 |
}
|
88 |
}
|
91 |
function uploadSuccess(fileObj, server_data) {
|
92 |
// Show any error message
|
93 |
if (server_data != 0){
|
94 |
+
nggProgressBar.addNote("<strong>ERROR</strong>: " + fileObj.name + " : " + server_data);
|
95 |
}
|
96 |
// Upload the next file until queue is empty
|
97 |
if ( ngg_swf_upload.getStats().files_queued > 0) {
|
141 |
error_name = "UNKNOWN";
|
142 |
break;
|
143 |
}
|
144 |
+
nggProgressBar.addNote("<strong>ERROR " + error_name + " </strong>: " + fileObj.name + " : " + message);
|
145 |
jQuery("#" + fileObj.id).hide("slow");
|
146 |
jQuery("#" + fileObj.id).remove();
|
147 |
if ( ngg_swf_upload.getStats().files_queued > 0) {
|
148 |
ngg_swf_upload.startUpload();
|
149 |
} else {
|
|
|
150 |
jQuery('#uploadimage_form').prepend("<input type=\"hidden\" name=\"swf_callback\" value=\"" + error_name + "\">");
|
151 |
jQuery("#uploadimage_form").submit();
|
152 |
}
|
admin/manage-galleries.php
CHANGED
@@ -67,11 +67,11 @@ function nggallery_manage_gallery_main() {
|
|
67 |
|
68 |
switch (actionId) {
|
69 |
case "resize_images":
|
70 |
-
|
71 |
return false;
|
72 |
break;
|
73 |
case "new_thumbnail":
|
74 |
-
showDialog('new_thumbnail',
|
75 |
return false;
|
76 |
break;
|
77 |
}
|
@@ -79,7 +79,7 @@ function nggallery_manage_gallery_main() {
|
|
79 |
return confirm('<?php echo sprintf(esc_js(__("You are about to start the bulk edit for %s galleries \n \n 'Cancel' to stop, 'OK' to proceed.",'nggallery')), "' + numchecked + '") ; ?>');
|
80 |
}
|
81 |
|
82 |
-
function showDialog( windowId,
|
83 |
var form = document.getElementById('editgalleries');
|
84 |
var elementlist = "";
|
85 |
for (i = 0, n = form.elements.length; i < n; i++) {
|
@@ -94,18 +94,30 @@ function nggallery_manage_gallery_main() {
|
|
94 |
}
|
95 |
jQuery("#" + windowId + "_bulkaction").val(jQuery("#bulkaction").val());
|
96 |
jQuery("#" + windowId + "_imagelist").val(elementlist);
|
97 |
-
|
98 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
99 |
}
|
100 |
|
101 |
function showAddGallery() {
|
102 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
103 |
}
|
104 |
//-->
|
105 |
</script>
|
106 |
<div class="wrap">
|
107 |
<?php screen_icon( 'nextgen-gallery' ); ?>
|
108 |
-
<h2><?php
|
109 |
<form class="search-form" action="" method="get">
|
110 |
<p class="search-box">
|
111 |
<label class="hidden" for="media-search-input"><?php _e( 'Search Images', 'nggallery' ); ?>:</label>
|
@@ -123,8 +135,9 @@ function nggallery_manage_gallery_main() {
|
|
123 |
<div class="alignleft actions">
|
124 |
<?php if ( function_exists('json_encode') ) : ?>
|
125 |
<select name="bulkaction" id="bulkaction">
|
126 |
-
<option value="no_action" ><?php _e("
|
127 |
-
<option value="
|
|
|
128 |
<option value="new_thumbnail" ><?php _e("Create new thumbnails",'nggallery'); ?></option>
|
129 |
<option value="resize_images" ><?php _e("Resize images",'nggallery'); ?></option>
|
130 |
<option value="import_meta" ><?php _e("Import metadata",'nggallery'); ?></option>
|
@@ -150,67 +163,95 @@ function nggallery_manage_gallery_main() {
|
|
150 |
<table class="widefat" cellspacing="0">
|
151 |
<thead>
|
152 |
<tr>
|
153 |
-
|
154 |
-
<input type="checkbox" onclick="checkAll(document.getElementById('editgalleries'));" name="checkall"/>
|
155 |
-
</th>
|
156 |
-
<th scope="col" ><?php _e('ID'); ?></th>
|
157 |
-
<th scope="col" ><?php _e('Title', 'nggallery'); ?></th>
|
158 |
-
<th scope="col" ><?php _e('Description', 'nggallery'); ?></th>
|
159 |
-
<th scope="col" ><?php _e('Author', 'nggallery'); ?></th>
|
160 |
-
<th scope="col" ><?php _e('Page ID', 'nggallery'); ?></th>
|
161 |
-
<th scope="col" ><?php _e('Quantity', 'nggallery'); ?></th>
|
162 |
-
<th scope="col" ><?php _e('Action'); ?></th>
|
163 |
</tr>
|
164 |
</thead>
|
165 |
<tfoot>
|
166 |
<tr>
|
167 |
-
|
168 |
-
<input type="checkbox" onclick="checkAll(document.getElementById('editgalleries'));" name="checkall"/>
|
169 |
-
</th>
|
170 |
-
<th scope="col" ><?php _e('ID'); ?></th>
|
171 |
-
<th scope="col" ><?php _e('Title', 'nggallery'); ?></th>
|
172 |
-
<th scope="col" ><?php _e('Description', 'nggallery'); ?></th>
|
173 |
-
<th scope="col" ><?php _e('Author', 'nggallery'); ?></th>
|
174 |
-
<th scope="col" ><?php _e('Page ID', 'nggallery'); ?></th>
|
175 |
-
<th scope="col" ><?php _e('Quantity', 'nggallery'); ?></th>
|
176 |
-
<th scope="col" ><?php _e('Action'); ?></th>
|
177 |
</tr>
|
178 |
</tfoot>
|
179 |
<tbody>
|
180 |
<?php
|
181 |
|
182 |
if($gallerylist) {
|
|
|
|
|
|
|
|
|
|
|
183 |
foreach($gallerylist as $gallery) {
|
184 |
-
$
|
185 |
$gid = $gallery->gid;
|
186 |
$name = (empty($gallery->title) ) ? $gallery->name : $gallery->title;
|
187 |
$author_user = get_userdata( (int) $gallery->author );
|
188 |
?>
|
189 |
-
<tr id="gallery-<?php echo $gid ?>" <?php echo $
|
190 |
-
|
191 |
-
|
192 |
-
|
193 |
-
|
194 |
-
|
195 |
-
|
196 |
-
|
197 |
-
|
198 |
-
|
199 |
-
|
200 |
-
|
201 |
-
|
202 |
-
|
203 |
-
|
204 |
-
|
205 |
-
|
206 |
-
|
207 |
-
|
208 |
-
|
209 |
-
|
210 |
-
|
211 |
-
|
212 |
-
|
213 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
214 |
</tr>
|
215 |
<?php
|
216 |
}
|
@@ -251,7 +292,7 @@ if($gallerylist) {
|
|
251 |
<td class="submit">
|
252 |
<input class="button-primary" type="submit" name="addgallery" value="<?php _e('OK','nggallery'); ?>" />
|
253 |
|
254 |
-
<input class="button-secondary" type="reset" value=" <?php _e('Cancel', 'nggallery'); ?> "
|
255 |
</td>
|
256 |
</tr>
|
257 |
</table>
|
@@ -280,7 +321,7 @@ if($gallerylist) {
|
|
280 |
<td colspan="2" class="submit">
|
281 |
<input class="button-primary" type="submit" name="TB_ResizeImages" value="<?php _e('OK', 'nggallery'); ?>" />
|
282 |
|
283 |
-
<input class="button-secondary" type="reset" value=" <?php _e('Cancel', 'nggallery'); ?> "
|
284 |
</td>
|
285 |
</tr>
|
286 |
</table>
|
@@ -310,7 +351,7 @@ if($gallerylist) {
|
|
310 |
<td colspan="2" class="submit">
|
311 |
<input class="button-primary" type="submit" name="TB_NewThumbnail" value="<?php _e('OK', 'nggallery');?>" />
|
312 |
|
313 |
-
<input class="button-secondary" type="reset" value=" <?php _e('Cancel', 'nggallery'); ?> "
|
314 |
</td>
|
315 |
</tr>
|
316 |
</table>
|
@@ -320,4 +361,22 @@ if($gallerylist) {
|
|
320 |
|
321 |
<?php
|
322 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
323 |
?>
|
67 |
|
68 |
switch (actionId) {
|
69 |
case "resize_images":
|
70 |
+
showDialog('resize_images', '<?php echo esc_js(__('Resize images','nggallery')); ?>');
|
71 |
return false;
|
72 |
break;
|
73 |
case "new_thumbnail":
|
74 |
+
showDialog('new_thumbnail', '<?php echo esc_js(__('Create new thumbnails','nggallery')); ?>');
|
75 |
return false;
|
76 |
break;
|
77 |
}
|
79 |
return confirm('<?php echo sprintf(esc_js(__("You are about to start the bulk edit for %s galleries \n \n 'Cancel' to stop, 'OK' to proceed.",'nggallery')), "' + numchecked + '") ; ?>');
|
80 |
}
|
81 |
|
82 |
+
function showDialog( windowId, title ) {
|
83 |
var form = document.getElementById('editgalleries');
|
84 |
var elementlist = "";
|
85 |
for (i = 0, n = form.elements.length; i < n; i++) {
|
94 |
}
|
95 |
jQuery("#" + windowId + "_bulkaction").val(jQuery("#bulkaction").val());
|
96 |
jQuery("#" + windowId + "_imagelist").val(elementlist);
|
97 |
+
// now show the dialog
|
98 |
+
jQuery( "#" + windowId ).dialog({
|
99 |
+
width: 640,
|
100 |
+
resizable : false,
|
101 |
+
modal: true,
|
102 |
+
title: title
|
103 |
+
});
|
104 |
+
jQuery("#" + windowId + ' .dialog-cancel').click(function() { jQuery( "#" + windowId ).dialog("close"); });
|
105 |
}
|
106 |
|
107 |
function showAddGallery() {
|
108 |
+
jQuery( "#addGallery").dialog({
|
109 |
+
width: 640,
|
110 |
+
resizable : false,
|
111 |
+
modal: true,
|
112 |
+
title: '<?php echo esc_js(__('Add new gallery','nggallery')); ?>'
|
113 |
+
});
|
114 |
+
jQuery("#addGallery .dialog-cancel").click(function() { jQuery( "#addGallery" ).dialog("close"); });
|
115 |
}
|
116 |
//-->
|
117 |
</script>
|
118 |
<div class="wrap">
|
119 |
<?php screen_icon( 'nextgen-gallery' ); ?>
|
120 |
+
<h2><?php echo _n( 'Gallery', 'Galleries', 2, 'nggallery'); ?></h2>
|
121 |
<form class="search-form" action="" method="get">
|
122 |
<p class="search-box">
|
123 |
<label class="hidden" for="media-search-input"><?php _e( 'Search Images', 'nggallery' ); ?>:</label>
|
135 |
<div class="alignleft actions">
|
136 |
<?php if ( function_exists('json_encode') ) : ?>
|
137 |
<select name="bulkaction" id="bulkaction">
|
138 |
+
<option value="no_action" ><?php _e("Bulk actions",'nggallery'); ?></option>
|
139 |
+
<option value="delete_gallery" ><?php _e("Delete",'nggallery'); ?></option>
|
140 |
+
<option value="set_watermark" ><?php _e("Set watermark",'nggallery'); ?></option>
|
141 |
<option value="new_thumbnail" ><?php _e("Create new thumbnails",'nggallery'); ?></option>
|
142 |
<option value="resize_images" ><?php _e("Resize images",'nggallery'); ?></option>
|
143 |
<option value="import_meta" ><?php _e("Import metadata",'nggallery'); ?></option>
|
163 |
<table class="widefat" cellspacing="0">
|
164 |
<thead>
|
165 |
<tr>
|
166 |
+
<?php print_column_headers('nggallery-manage-galleries'); ?>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
167 |
</tr>
|
168 |
</thead>
|
169 |
<tfoot>
|
170 |
<tr>
|
171 |
+
<?php print_column_headers('nggallery-manage-galleries', false); ?>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
172 |
</tr>
|
173 |
</tfoot>
|
174 |
<tbody>
|
175 |
<?php
|
176 |
|
177 |
if($gallerylist) {
|
178 |
+
//get the columns
|
179 |
+
$gallery_columns = ngg_manage_gallery_columns();
|
180 |
+
$hidden_columns = get_hidden_columns('nggallery-manage-images');
|
181 |
+
$num_columns = count($gallery_columns) - count($hidden_columns);
|
182 |
+
|
183 |
foreach($gallerylist as $gallery) {
|
184 |
+
$alternate = ( !isset($alternate) || $alternate == 'class="alternate"' ) ? '' : 'class="alternate"';
|
185 |
$gid = $gallery->gid;
|
186 |
$name = (empty($gallery->title) ) ? $gallery->name : $gallery->title;
|
187 |
$author_user = get_userdata( (int) $gallery->author );
|
188 |
?>
|
189 |
+
<tr id="gallery-<?php echo $gid ?>" <?php echo $alternate; ?> >
|
190 |
+
<?php
|
191 |
+
foreach($gallery_columns as $gallery_column_key => $column_display_name) {
|
192 |
+
$class = "class=\"$gallery_column_key column-$gallery_column_key\"";
|
193 |
+
|
194 |
+
$style = '';
|
195 |
+
if ( in_array($gallery_column_key, $hidden_columns) )
|
196 |
+
$style = ' style="display:none;"';
|
197 |
+
|
198 |
+
$attributes = "$class$style";
|
199 |
+
|
200 |
+
switch ($gallery_column_key) {
|
201 |
+
case 'cb' :
|
202 |
+
?>
|
203 |
+
<th scope="row" class="cb column-cb">
|
204 |
+
<?php if (nggAdmin::can_manage_this_gallery($gallery->author)) { ?>
|
205 |
+
<input name="doaction[]" type="checkbox" value="<?php echo $gid ?>" />
|
206 |
+
<?php } ?>
|
207 |
+
</th>
|
208 |
+
<?php
|
209 |
+
break;
|
210 |
+
case 'id' :
|
211 |
+
?>
|
212 |
+
<td <?php echo $attributes ?> scope="row"><?php echo $gid; ?></td>
|
213 |
+
<?php
|
214 |
+
break;
|
215 |
+
case 'title' :
|
216 |
+
?>
|
217 |
+
<td>
|
218 |
+
<?php if (nggAdmin::can_manage_this_gallery($gallery->author)) { ?>
|
219 |
+
<a href="<?php echo wp_nonce_url( $ngg->manage_page->base_page . '&mode=edit&gid=' . $gid, 'ngg_editgallery')?>" class='edit' title="<?php _e('Edit'); ?>" >
|
220 |
+
<?php echo nggGallery::i18n($name); ?>
|
221 |
+
</a>
|
222 |
+
<?php } else { ?>
|
223 |
+
<?php echo nggGallery::i18n($gallery->title); ?>
|
224 |
+
<?php } ?>
|
225 |
+
</td>
|
226 |
+
<?php
|
227 |
+
break;
|
228 |
+
case 'description' :
|
229 |
+
?>
|
230 |
+
<td <?php echo $attributes ?>><?php echo nggGallery::i18n($gallery->galdesc); ?> </td>
|
231 |
+
<?php
|
232 |
+
break;
|
233 |
+
case 'author' :
|
234 |
+
?>
|
235 |
+
<td <?php echo $attributes ?>><?php echo $author_user->display_name; ?></td>
|
236 |
+
<?php
|
237 |
+
break;
|
238 |
+
case 'page_id' :
|
239 |
+
?>
|
240 |
+
<td <?php echo $attributes ?>><?php echo $gallery->pageid; ?></td>
|
241 |
+
<?php
|
242 |
+
break;
|
243 |
+
case 'quantity' :
|
244 |
+
?>
|
245 |
+
<td <?php echo $attributes ?>><?php echo $gallery->counter; ?></td>
|
246 |
+
<?php
|
247 |
+
break;
|
248 |
+
default :
|
249 |
+
?>
|
250 |
+
<td <?php echo $attributes ?>><?php do_action('ngg_manage_gallery_custom_column', $gallery_column_key, $gid); ?></td>
|
251 |
+
<?php
|
252 |
+
break;
|
253 |
+
}
|
254 |
+
} ?>
|
255 |
</tr>
|
256 |
<?php
|
257 |
}
|
292 |
<td class="submit">
|
293 |
<input class="button-primary" type="submit" name="addgallery" value="<?php _e('OK','nggallery'); ?>" />
|
294 |
|
295 |
+
<input class="button-secondary dialog-cancel" type="reset" value=" <?php _e('Cancel', 'nggallery'); ?> " />
|
296 |
</td>
|
297 |
</tr>
|
298 |
</table>
|
321 |
<td colspan="2" class="submit">
|
322 |
<input class="button-primary" type="submit" name="TB_ResizeImages" value="<?php _e('OK', 'nggallery'); ?>" />
|
323 |
|
324 |
+
<input class="button-secondary dialog-cancel" type="reset" value=" <?php _e('Cancel', 'nggallery'); ?> " />
|
325 |
</td>
|
326 |
</tr>
|
327 |
</table>
|
351 |
<td colspan="2" class="submit">
|
352 |
<input class="button-primary" type="submit" name="TB_NewThumbnail" value="<?php _e('OK', 'nggallery');?>" />
|
353 |
|
354 |
+
<input class="button-secondary dialog-cancel" type="reset" value=" <?php _e('Cancel', 'nggallery'); ?> " />
|
355 |
</td>
|
356 |
</tr>
|
357 |
</table>
|
361 |
|
362 |
<?php
|
363 |
}
|
364 |
+
|
365 |
+
// define the columns to display, the syntax is 'internal name' => 'display name'
|
366 |
+
function ngg_manage_gallery_columns() {
|
367 |
+
|
368 |
+
$gallery_columns = array();
|
369 |
+
|
370 |
+
$gallery_columns['cb'] = '<input name="checkall" type="checkbox" onclick="checkAll(document.getElementById(\'editgalleries\'));" />';
|
371 |
+
$gallery_columns['id'] = __('ID');
|
372 |
+
$gallery_columns['title'] = _n( 'Gallery', 'Galleries', 1, 'nggallery');
|
373 |
+
$gallery_columns['description'] = __('Description', 'nggallery');
|
374 |
+
$gallery_columns['author'] = __('Author', 'nggallery');
|
375 |
+
$gallery_columns['page_id'] = __('Page ID', 'nggallery');
|
376 |
+
$gallery_columns['quantity'] = _n( 'Image', 'Images', 2, 'nggallery' );
|
377 |
+
|
378 |
+
$gallery_columns = apply_filters('ngg_manage_gallery_columns', $gallery_columns);
|
379 |
+
|
380 |
+
return $gallery_columns;
|
381 |
+
}
|
382 |
?>
|
admin/manage-images.php
CHANGED
@@ -67,25 +67,16 @@ function nggallery_picturelist() {
|
|
67 |
$gallerylist = $nggdb->find_all_galleries();
|
68 |
|
69 |
//get the columns
|
70 |
-
$
|
71 |
$hidden_columns = get_hidden_columns('nggallery-manage-images');
|
72 |
-
$num_columns = count($
|
73 |
|
74 |
$attr = (nggGallery::current_user_can( 'NextGEN Edit gallery options' )) ? '' : 'disabled="disabled"';
|
75 |
|
76 |
?>
|
77 |
-
<!--[if IE]>
|
78 |
-
<style type="text/css">
|
79 |
-
.custom_thumb {
|
80 |
-
display : none;
|
81 |
-
}
|
82 |
-
</style>
|
83 |
-
<![endif]-->
|
84 |
-
|
85 |
<script type="text/javascript">
|
86 |
<!--
|
87 |
-
|
88 |
-
function showDialog( windowId, height ) {
|
89 |
var form = document.getElementById('updategallery');
|
90 |
var elementlist = "";
|
91 |
for (i = 0, n = form.elements.length; i < n; i++) {
|
@@ -100,10 +91,49 @@ function showDialog( windowId, height ) {
|
|
100 |
}
|
101 |
jQuery("#" + windowId + "_bulkaction").val(jQuery("#bulkaction").val());
|
102 |
jQuery("#" + windowId + "_imagelist").val(elementlist);
|
103 |
-
|
104 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
105 |
}
|
106 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
107 |
function checkAll(form)
|
108 |
{
|
109 |
for (i = 0, n = form.elements.length; i < n; i++) {
|
@@ -145,22 +175,31 @@ function checkSelected() {
|
|
145 |
|
146 |
switch (actionId) {
|
147 |
case "copy_to":
|
|
|
|
|
|
|
148 |
case "move_to":
|
149 |
-
showDialog('selectgallery',
|
150 |
return false;
|
151 |
break;
|
152 |
case "add_tags":
|
|
|
|
|
|
|
153 |
case "delete_tags":
|
|
|
|
|
|
|
154 |
case "overwrite_tags":
|
155 |
-
showDialog('entertags',
|
156 |
return false;
|
157 |
break;
|
158 |
case "resize_images":
|
159 |
-
showDialog('resize_images',
|
160 |
return false;
|
161 |
break;
|
162 |
case "new_thumbnail":
|
163 |
-
showDialog('new_thumbnail',
|
164 |
return false;
|
165 |
break;
|
166 |
}
|
@@ -177,7 +216,6 @@ jQuery(document).ready( function() {
|
|
177 |
|
178 |
//-->
|
179 |
</script>
|
180 |
-
|
181 |
<div class="wrap">
|
182 |
<?php screen_icon( 'nextgen-gallery' ); ?>
|
183 |
<?php if ($is_search) :?>
|
@@ -234,6 +272,7 @@ jQuery(document).ready( function() {
|
|
234 |
<?php
|
235 |
if(is_array($picturelist)) {
|
236 |
foreach($picturelist as $picture) {
|
|
|
237 |
$selected = ($picture->pid == $gallery->previewpic) ? 'selected="selected" ' : '';
|
238 |
echo '<option value="'.$picture->pid.'" '.$selected.'>'.$picture->pid.' - '.$picture->filename.'</option>'."\n";
|
239 |
}
|
@@ -297,7 +336,7 @@ jQuery(document).ready( function() {
|
|
297 |
<?php endif; ?>
|
298 |
<div class="alignleft actions">
|
299 |
<select id="bulkaction" name="bulkaction">
|
300 |
-
<option value="no_action" ><?php _e("
|
301 |
<option value="set_watermark" ><?php _e("Set watermark",'nggallery'); ?></option>
|
302 |
<option value="new_thumbnail" ><?php _e("Create new thumbnails",'nggallery'); ?></option>
|
303 |
<option value="resize_images" ><?php _e("Resize images",'nggallery'); ?></option>
|
@@ -359,16 +398,16 @@ if($picturelist) {
|
|
359 |
?>
|
360 |
<tr id="picture-<?php echo $pid ?>" class="<?php echo $alternate ?> iedit" valign="top">
|
361 |
<?php
|
362 |
-
foreach($
|
363 |
-
$class = "class=\"$
|
364 |
|
365 |
$style = '';
|
366 |
-
if ( in_array($
|
367 |
$style = ' style="display:none;"';
|
368 |
|
369 |
$attributes = "$class$style";
|
370 |
|
371 |
-
switch ($
|
372 |
case 'cb' :
|
373 |
?>
|
374 |
<th <?php echo $attributes ?> scope="row"><input name="doaction[]" type="checkbox" value="<?php echo $pid ?>" /></th>
|
@@ -395,12 +434,12 @@ if($picturelist) {
|
|
395 |
<p>
|
396 |
<?php
|
397 |
$actions = array();
|
398 |
-
//TODO:Add a JS edit option
|
399 |
-
//$actions['edit'] = '<a class="editinline" href="#">' . __('Edit') . '</a>';
|
400 |
$actions['view'] = '<a class="thickbox" href="' . $picture->imageURL . '" title="' . esc_attr(sprintf(__('View "%s"'), $picture->filename)) . '">' . __('View', 'nggallery') . '</a>';
|
401 |
-
$actions['meta'] = '<a class="
|
402 |
-
$actions['custom_thumb'] = '<a class="
|
403 |
-
$actions['rotate']
|
|
|
|
|
404 |
if ( file_exists( $picture->imagePath . '_backup' ) )
|
405 |
$actions['recover'] = '<a class="confirmrecover" href="' .wp_nonce_url("admin.php?page=nggallery-manage-gallery&mode=recoverpic&gid=" . $act_gid . "&pid=" . $pid, 'ngg_recoverpicture'). '" title="' . __('Recover','nggallery') . '" onclick="javascript:check=confirm( \'' . esc_attr(sprintf(__('Recover "%s" ?' , 'nggallery'), $picture->filename)). '\');if(check==false) return false;">' . __('Recover', 'nggallery') . '</a>';
|
406 |
$actions['delete'] = '<a class="submitdelete" href="' . wp_nonce_url("admin.php?page=nggallery-manage-gallery&mode=delpic&gid=" . $act_gid . "&pid=" . $pid, 'ngg_delpicture'). '" class="delete column-delete" onclick="javascript:check=confirm( \'' . esc_attr(sprintf(__('Delete "%s" ?' , 'nggallery'), $picture->filename)). '\');if(check==false) return false;">' . __('Delete') . '</a>';
|
@@ -422,8 +461,8 @@ if($picturelist) {
|
|
422 |
if (is_array ($size = $picture->meta_data['thumbnail']) )
|
423 |
$thumbsize = 'width="' . $size['width'] . '" height="' . $size['height'] . '"';
|
424 |
?>
|
425 |
-
<td <?php echo $attributes ?>><a href="<?php echo $picture->imageURL
|
426 |
-
<img class="thumb" src="<?php echo $picture->thumbURL
|
427 |
</a>
|
428 |
</td>
|
429 |
<?php
|
@@ -450,7 +489,7 @@ if($picturelist) {
|
|
450 |
break;
|
451 |
default :
|
452 |
?>
|
453 |
-
<td <?php echo $attributes ?>><?php do_action('
|
454 |
<?php
|
455 |
break;
|
456 |
}
|
@@ -499,7 +538,7 @@ if ( $counter == 0 )
|
|
499 |
<td class="submit">
|
500 |
<input class="button-primary" type="submit" name="TB_EditTags" value="<?php _e("OK",'nggallery'); ?>" />
|
501 |
|
502 |
-
<input class="button-secondary" type="reset" value=" <?php _e("Cancel",'nggallery'); ?> "
|
503 |
</td>
|
504 |
</tr>
|
505 |
</table>
|
@@ -535,7 +574,7 @@ if ( $counter == 0 )
|
|
535 |
<td class="submit">
|
536 |
<input type="submit" class="button-primary" name="TB_SelectGallery" value="<?php _e("OK",'nggallery'); ?>" />
|
537 |
|
538 |
-
<input class="button-secondary" type="reset" value="<?php _e("Cancel",'nggallery'); ?>"
|
539 |
</td>
|
540 |
</tr>
|
541 |
</table>
|
@@ -564,7 +603,7 @@ if ( $counter == 0 )
|
|
564 |
<td colspan="2" class="submit">
|
565 |
<input class="button-primary" type="submit" name="TB_ResizeImages" value="<?php _e('OK', 'nggallery'); ?>" />
|
566 |
|
567 |
-
<input class="button-secondary" type="reset" value=" <?php _e('Cancel', 'nggallery'); ?> "
|
568 |
</td>
|
569 |
</tr>
|
570 |
</table>
|
@@ -579,7 +618,7 @@ if ( $counter == 0 )
|
|
579 |
<input type="hidden" id="new_thumbnail_imagelist" name="TB_imagelist" value="" />
|
580 |
<input type="hidden" id="new_thumbnail_bulkaction" name="TB_bulkaction" value="" />
|
581 |
<input type="hidden" name="page" value="manage-images" />
|
582 |
-
|
583 |
<tr valign="top">
|
584 |
<th align="left"><?php _e('Width x height (in pixel)','nggallery') ?></th>
|
585 |
<td><input type="text" size="5" maxlength="5" name="thumbwidth" value="<?php echo $ngg->options['thumbwidth']; ?>" /> x <input type="text" size="5" maxlength="5" name="thumbheight" value="<?php echo $ngg->options['thumbheight']; ?>" />
|
@@ -594,7 +633,7 @@ if ( $counter == 0 )
|
|
594 |
<td colspan="2" class="submit">
|
595 |
<input class="button-primary" type="submit" name="TB_NewThumbnail" value="<?php _e('OK', 'nggallery');?>" />
|
596 |
|
597 |
-
<input class="button-secondary" type="reset" value=" <?php _e('Cancel', 'nggallery'); ?> "
|
598 |
</td>
|
599 |
</tr>
|
600 |
</table>
|
@@ -611,24 +650,24 @@ if ( $counter == 0 )
|
|
611 |
}
|
612 |
|
613 |
// define the columns to display, the syntax is 'internal name' => 'display name'
|
614 |
-
function
|
615 |
|
616 |
-
$
|
617 |
|
618 |
-
$
|
619 |
-
$
|
620 |
-
$
|
621 |
|
622 |
-
$
|
623 |
|
624 |
-
$
|
625 |
-
$
|
626 |
|
627 |
-
$
|
628 |
|
629 |
-
$
|
630 |
|
631 |
-
return $
|
632 |
}
|
633 |
|
634 |
?>
|
67 |
$gallerylist = $nggdb->find_all_galleries();
|
68 |
|
69 |
//get the columns
|
70 |
+
$image_columns = ngg_manage_image_columns();
|
71 |
$hidden_columns = get_hidden_columns('nggallery-manage-images');
|
72 |
+
$num_columns = count($image_columns) - count($hidden_columns);
|
73 |
|
74 |
$attr = (nggGallery::current_user_can( 'NextGEN Edit gallery options' )) ? '' : 'disabled="disabled"';
|
75 |
|
76 |
?>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
77 |
<script type="text/javascript">
|
78 |
<!--
|
79 |
+
function showDialog( windowId, title ) {
|
|
|
80 |
var form = document.getElementById('updategallery');
|
81 |
var elementlist = "";
|
82 |
for (i = 0, n = form.elements.length; i < n; i++) {
|
91 |
}
|
92 |
jQuery("#" + windowId + "_bulkaction").val(jQuery("#bulkaction").val());
|
93 |
jQuery("#" + windowId + "_imagelist").val(elementlist);
|
94 |
+
// now show the dialog
|
95 |
+
jQuery( "#" + windowId ).dialog({
|
96 |
+
width: 640,
|
97 |
+
resizable : false,
|
98 |
+
modal: true,
|
99 |
+
title: title
|
100 |
+
});
|
101 |
+
jQuery("#" + windowId + ' .dialog-cancel').click(function() { jQuery( "#" + windowId ).dialog("close"); });
|
102 |
}
|
103 |
|
104 |
+
jQuery(function (){
|
105 |
+
// load a content via ajax
|
106 |
+
jQuery('a.ngg-dialog').click(function() {
|
107 |
+
if ( jQuery( "#spinner" ).length == 0)
|
108 |
+
jQuery("body").append('<div id="spinner"></div>');
|
109 |
+
var $this = jQuery(this);
|
110 |
+
var results = new RegExp('[\\?&]w=([^&#]*)').exec(this.href);
|
111 |
+
var width = ( results ) ? results[1] : 600;
|
112 |
+
var results = new RegExp('[\\?&]h=([^&#]*)').exec(this.href);
|
113 |
+
var height = ( results ) ? results[1] : 440;
|
114 |
+
jQuery('#spinner').fadeIn();
|
115 |
+
var dialog = jQuery('<div style="display:hidden"></div>').appendTo('body');
|
116 |
+
// load the remote content
|
117 |
+
dialog.load(
|
118 |
+
this.href,
|
119 |
+
{},
|
120 |
+
function () {
|
121 |
+
jQuery('#spinner').hide();
|
122 |
+
dialog.dialog({
|
123 |
+
title: ($this.attr('title')) ? $this.attr('title') : '',
|
124 |
+
width: width,
|
125 |
+
height: height,
|
126 |
+
modal: true,
|
127 |
+
resizable: false,
|
128 |
+
close: function() { dialog.remove(); }
|
129 |
+
}).width(width - 30).height(height - 30);
|
130 |
+
}
|
131 |
+
);
|
132 |
+
//prevent the browser to follow the link
|
133 |
+
return false;
|
134 |
+
});
|
135 |
+
});
|
136 |
+
|
137 |
function checkAll(form)
|
138 |
{
|
139 |
for (i = 0, n = form.elements.length; i < n; i++) {
|
175 |
|
176 |
switch (actionId) {
|
177 |
case "copy_to":
|
178 |
+
showDialog('selectgallery', '<?php echo esc_js(__('Copy image to...','nggallery')); ?>');
|
179 |
+
return false;
|
180 |
+
break;
|
181 |
case "move_to":
|
182 |
+
showDialog('selectgallery', '<?php echo esc_js(__('Move image to...','nggallery')); ?>');
|
183 |
return false;
|
184 |
break;
|
185 |
case "add_tags":
|
186 |
+
showDialog('entertags', '<?php echo esc_js(__('Add new tags','nggallery')); ?>');
|
187 |
+
return false;
|
188 |
+
break;
|
189 |
case "delete_tags":
|
190 |
+
showDialog('entertags', '<?php echo esc_js(__('Delete tags','nggallery')); ?>');
|
191 |
+
return false;
|
192 |
+
break;
|
193 |
case "overwrite_tags":
|
194 |
+
showDialog('entertags', '<?php echo esc_js(__('Overwrite','nggallery')); ?>');
|
195 |
return false;
|
196 |
break;
|
197 |
case "resize_images":
|
198 |
+
showDialog('resize_images', '<?php echo esc_js(__('Resize images','nggallery')); ?>');
|
199 |
return false;
|
200 |
break;
|
201 |
case "new_thumbnail":
|
202 |
+
showDialog('new_thumbnail', '<?php echo esc_js(__('Create new thumbnails','nggallery')); ?>');
|
203 |
return false;
|
204 |
break;
|
205 |
}
|
216 |
|
217 |
//-->
|
218 |
</script>
|
|
|
219 |
<div class="wrap">
|
220 |
<?php screen_icon( 'nextgen-gallery' ); ?>
|
221 |
<?php if ($is_search) :?>
|
272 |
<?php
|
273 |
if(is_array($picturelist)) {
|
274 |
foreach($picturelist as $picture) {
|
275 |
+
if ($picture->exclude) continue;
|
276 |
$selected = ($picture->pid == $gallery->previewpic) ? 'selected="selected" ' : '';
|
277 |
echo '<option value="'.$picture->pid.'" '.$selected.'>'.$picture->pid.' - '.$picture->filename.'</option>'."\n";
|
278 |
}
|
336 |
<?php endif; ?>
|
337 |
<div class="alignleft actions">
|
338 |
<select id="bulkaction" name="bulkaction">
|
339 |
+
<option value="no_action" ><?php _e("Bulk actions",'nggallery'); ?></option>
|
340 |
<option value="set_watermark" ><?php _e("Set watermark",'nggallery'); ?></option>
|
341 |
<option value="new_thumbnail" ><?php _e("Create new thumbnails",'nggallery'); ?></option>
|
342 |
<option value="resize_images" ><?php _e("Resize images",'nggallery'); ?></option>
|
398 |
?>
|
399 |
<tr id="picture-<?php echo $pid ?>" class="<?php echo $alternate ?> iedit" valign="top">
|
400 |
<?php
|
401 |
+
foreach($image_columns as $image_column_key => $column_display_name) {
|
402 |
+
$class = "class=\"$image_column_key column-$image_column_key\"";
|
403 |
|
404 |
$style = '';
|
405 |
+
if ( in_array($image_column_key, $hidden_columns) )
|
406 |
$style = ' style="display:none;"';
|
407 |
|
408 |
$attributes = "$class$style";
|
409 |
|
410 |
+
switch ($image_column_key) {
|
411 |
case 'cb' :
|
412 |
?>
|
413 |
<th <?php echo $attributes ?> scope="row"><input name="doaction[]" type="checkbox" value="<?php echo $pid ?>" /></th>
|
434 |
<p>
|
435 |
<?php
|
436 |
$actions = array();
|
|
|
|
|
437 |
$actions['view'] = '<a class="thickbox" href="' . $picture->imageURL . '" title="' . esc_attr(sprintf(__('View "%s"'), $picture->filename)) . '">' . __('View', 'nggallery') . '</a>';
|
438 |
+
$actions['meta'] = '<a class="ngg-dialog" href="' . NGGALLERY_URLPATH . 'admin/showmeta.php?id=' . $pid . '" title="' . __('Show Meta data','nggallery') . '">' . __('Meta', 'nggallery') . '</a>';
|
439 |
+
$actions['custom_thumb'] = '<a class="ngg-dialog" href="' . NGGALLERY_URLPATH . 'admin/edit-thumbnail.php?id=' . $pid . '" title="' . __('Customize thumbnail','nggallery') . '">' . __('Edit thumb', 'nggallery') . '</a>';
|
440 |
+
$actions['rotate'] = '<a class="ngg-dialog" href="' . NGGALLERY_URLPATH . 'admin/rotate.php?id=' . $pid . '" title="' . __('Rotate','nggallery') . '">' . __('Rotate', 'nggallery') . '</a>';
|
441 |
+
if ( current_user_can( 'publish_posts' ) )
|
442 |
+
$actions['publish'] = '<a class="ngg-dialog" href="' . NGGALLERY_URLPATH . 'admin/publish.php?id=' . $pid . '&h=230" title="' . __('Publish this image','nggallery') . '">' . __('Publish', 'nggallery') . '</a>';
|
443 |
if ( file_exists( $picture->imagePath . '_backup' ) )
|
444 |
$actions['recover'] = '<a class="confirmrecover" href="' .wp_nonce_url("admin.php?page=nggallery-manage-gallery&mode=recoverpic&gid=" . $act_gid . "&pid=" . $pid, 'ngg_recoverpicture'). '" title="' . __('Recover','nggallery') . '" onclick="javascript:check=confirm( \'' . esc_attr(sprintf(__('Recover "%s" ?' , 'nggallery'), $picture->filename)). '\');if(check==false) return false;">' . __('Recover', 'nggallery') . '</a>';
|
445 |
$actions['delete'] = '<a class="submitdelete" href="' . wp_nonce_url("admin.php?page=nggallery-manage-gallery&mode=delpic&gid=" . $act_gid . "&pid=" . $pid, 'ngg_delpicture'). '" class="delete column-delete" onclick="javascript:check=confirm( \'' . esc_attr(sprintf(__('Delete "%s" ?' , 'nggallery'), $picture->filename)). '\');if(check==false) return false;">' . __('Delete') . '</a>';
|
461 |
if (is_array ($size = $picture->meta_data['thumbnail']) )
|
462 |
$thumbsize = 'width="' . $size['width'] . '" height="' . $size['height'] . '"';
|
463 |
?>
|
464 |
+
<td <?php echo $attributes ?>><a href="<?php echo $picture->imageURL; if(strpos($picture->imageURL, '?')) { echo '&'; } else { echo '?'; } echo mt_rand(); ?>" class="thickbox" title="<?php echo $picture->filename ?>">
|
465 |
+
<img class="thumb" src="<?php echo $picture->thumbURL; if(strpos($picture->thumbURL, '?')) { echo '&'; } else { echo '?'; } echo mt_rand(); ?>" <?php echo $thumbsize ?> id="thumb<?php echo $pid ?>" />
|
466 |
</a>
|
467 |
</td>
|
468 |
<?php
|
489 |
break;
|
490 |
default :
|
491 |
?>
|
492 |
+
<td <?php echo $attributes ?>><?php do_action('ngg_manage_image_custom_column', $image_column_key, $pid); ?></td>
|
493 |
<?php
|
494 |
break;
|
495 |
}
|
538 |
<td class="submit">
|
539 |
<input class="button-primary" type="submit" name="TB_EditTags" value="<?php _e("OK",'nggallery'); ?>" />
|
540 |
|
541 |
+
<input class="button-secondary dialog-cancel" type="reset" value=" <?php _e("Cancel",'nggallery'); ?> " />
|
542 |
</td>
|
543 |
</tr>
|
544 |
</table>
|
574 |
<td class="submit">
|
575 |
<input type="submit" class="button-primary" name="TB_SelectGallery" value="<?php _e("OK",'nggallery'); ?>" />
|
576 |
|
577 |
+
<input class="button-secondary dialog-cancel" type="reset" value="<?php _e("Cancel",'nggallery'); ?>" />
|
578 |
</td>
|
579 |
</tr>
|
580 |
</table>
|
603 |
<td colspan="2" class="submit">
|
604 |
<input class="button-primary" type="submit" name="TB_ResizeImages" value="<?php _e('OK', 'nggallery'); ?>" />
|
605 |
|
606 |
+
<input class="button-secondary dialog-cancel" type="reset" value=" <?php _e('Cancel', 'nggallery'); ?> " />
|
607 |
</td>
|
608 |
</tr>
|
609 |
</table>
|
618 |
<input type="hidden" id="new_thumbnail_imagelist" name="TB_imagelist" value="" />
|
619 |
<input type="hidden" id="new_thumbnail_bulkaction" name="TB_bulkaction" value="" />
|
620 |
<input type="hidden" name="page" value="manage-images" />
|
621 |
+
<table width="100%" border="0" cellspacing="3" cellpadding="3" >
|
622 |
<tr valign="top">
|
623 |
<th align="left"><?php _e('Width x height (in pixel)','nggallery') ?></th>
|
624 |
<td><input type="text" size="5" maxlength="5" name="thumbwidth" value="<?php echo $ngg->options['thumbwidth']; ?>" /> x <input type="text" size="5" maxlength="5" name="thumbheight" value="<?php echo $ngg->options['thumbheight']; ?>" />
|
633 |
<td colspan="2" class="submit">
|
634 |
<input class="button-primary" type="submit" name="TB_NewThumbnail" value="<?php _e('OK', 'nggallery');?>" />
|
635 |
|
636 |
+
<input class="button-secondary dialog-cancel" type="reset" value=" <?php _e('Cancel', 'nggallery'); ?> " />
|
637 |
</td>
|
638 |
</tr>
|
639 |
</table>
|
650 |
}
|
651 |
|
652 |
// define the columns to display, the syntax is 'internal name' => 'display name'
|
653 |
+
function ngg_manage_image_columns() {
|
654 |
|
655 |
+
$image_columns = array();
|
656 |
|
657 |
+
$image_columns['cb'] = '<input name="checkall" type="checkbox" onclick="checkAll(document.getElementById(\'updategallery\'));" />';
|
658 |
+
$image_columns['id'] = __('ID');
|
659 |
+
$image_columns['thumbnail'] = __('Thumbnail', 'nggallery');
|
660 |
|
661 |
+
$image_columns['filename'] = __('Filename', 'nggallery');
|
662 |
|
663 |
+
$image_columns['alt_title_desc'] = __('Alt & Title Text', 'nggallery') . ' / ' . __('Description', 'nggallery');
|
664 |
+
$image_columns['tags'] = __('Tags (comma separated list)', 'nggallery');
|
665 |
|
666 |
+
$image_columns['exclude'] = __('exclude', 'nggallery');
|
667 |
|
668 |
+
$image_columns = apply_filters('ngg_manage_images_columns', $image_columns);
|
669 |
|
670 |
+
return $image_columns;
|
671 |
}
|
672 |
|
673 |
?>
|
admin/manage-sort.php
CHANGED
@@ -27,6 +27,9 @@ function nggallery_sortorder($galleryID = 0){
|
|
27 |
$wpdb->query("UPDATE $wpdb->nggpictures SET sortorder = '$sortindex' WHERE pid = $pic_id");
|
28 |
$sortindex++;
|
29 |
}
|
|
|
|
|
|
|
30 |
nggGallery::show_message(__('Sort order changed','nggallery'));
|
31 |
}
|
32 |
}
|
@@ -101,4 +104,4 @@ function nggallery_sortorder($galleryID = 0){
|
|
101 |
|
102 |
<?php
|
103 |
}
|
104 |
-
?>
|
27 |
$wpdb->query("UPDATE $wpdb->nggpictures SET sortorder = '$sortindex' WHERE pid = $pic_id");
|
28 |
$sortindex++;
|
29 |
}
|
30 |
+
|
31 |
+
do_action('ngg_gallery_sort', $galleryID);
|
32 |
+
|
33 |
nggGallery::show_message(__('Sort order changed','nggallery'));
|
34 |
}
|
35 |
}
|
104 |
|
105 |
<?php
|
106 |
}
|
107 |
+
?>
|
admin/manage.php
CHANGED
@@ -26,6 +26,9 @@ class nggManageGallery {
|
|
26 |
// Should be only called via a edit single gallery page
|
27 |
if ( isset($_POST['page']) && $_POST['page'] == 'manage-images' )
|
28 |
$this->post_processor_images();
|
|
|
|
|
|
|
29 |
//Look for other POST process
|
30 |
if ( !empty($_POST) || !empty($_GET) )
|
31 |
$this->processor();
|
@@ -55,39 +58,6 @@ class nggManageGallery {
|
|
55 |
|
56 |
global $wpdb, $ngg, $nggdb;
|
57 |
|
58 |
-
// Delete a gallery
|
59 |
-
if ($this->mode == 'delete') {
|
60 |
-
|
61 |
-
check_admin_referer('ngg_editgallery');
|
62 |
-
|
63 |
-
// get the path to the gallery
|
64 |
-
$gallerypath = $wpdb->get_var("SELECT path FROM $wpdb->nggallery WHERE gid = '$this->gid' ");
|
65 |
-
if ($gallerypath){
|
66 |
-
|
67 |
-
// delete pictures
|
68 |
-
//TODO:Remove also Tag reference, look here for ids instead filename
|
69 |
-
$imagelist = $wpdb->get_col("SELECT filename FROM $wpdb->nggpictures WHERE galleryid = '$this->gid' ");
|
70 |
-
if ($ngg->options['deleteImg']) {
|
71 |
-
if (is_array($imagelist)) {
|
72 |
-
foreach ($imagelist as $filename) {
|
73 |
-
@unlink(WINABSPATH . $gallerypath . '/thumbs/thumbs_' . $filename);
|
74 |
-
@unlink(WINABSPATH . $gallerypath .'/'. $filename);
|
75 |
-
}
|
76 |
-
}
|
77 |
-
// delete folder
|
78 |
-
@rmdir( WINABSPATH . $gallerypath . '/thumbs' );
|
79 |
-
@rmdir( WINABSPATH . $gallerypath );
|
80 |
-
}
|
81 |
-
}
|
82 |
-
|
83 |
-
$delete_galllery = nggdb::delete_gallery( $this->gid );
|
84 |
-
|
85 |
-
if($delete_galllery)
|
86 |
-
nggGallery::show_message( _n( 'Gallery', 'Galleries', 1, 'nggallery' ) . ' \''.$this->gid.'\' '.__('deleted successfully','nggallery'));
|
87 |
-
|
88 |
-
$this->mode = 'main'; // show mainpage
|
89 |
-
}
|
90 |
-
|
91 |
// Delete a picture
|
92 |
if ($this->mode == 'delpic') {
|
93 |
|
@@ -167,6 +137,37 @@ class nggManageGallery {
|
|
167 |
// A prefix 'gallery_' will first fetch all ids from the selected galleries
|
168 |
nggAdmin::do_ajax_operation( 'gallery_import_metadata' , $_POST['doaction'], __('Import metadata','nggallery') );
|
169 |
break;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
170 |
}
|
171 |
}
|
172 |
|
@@ -361,8 +362,11 @@ class nggManageGallery {
|
|
361 |
|
362 |
if ( nggGallery::current_user_can( 'NextGEN Edit gallery options' )) {
|
363 |
|
364 |
-
if ( nggGallery::current_user_can( 'NextGEN Edit gallery title' ))
|
365 |
-
|
|
|
|
|
|
|
366 |
if ( nggGallery::current_user_can( 'NextGEN Edit gallery path' ))
|
367 |
$wpdb->query( $wpdb->prepare ("UPDATE $wpdb->nggallery SET path= '%s' WHERE gid = %d", untrailingslashit ( str_replace('\\', '/', trim( stripslashes($_POST['path']) )) ), $this->gid ) );
|
368 |
if ( nggGallery::current_user_can( 'NextGEN Edit gallery description' ))
|
@@ -418,59 +422,94 @@ class nggManageGallery {
|
|
418 |
if ($gallery_pageid != 0) {
|
419 |
$result = $wpdb->query("UPDATE $wpdb->nggallery SET title= '$gallery_title', pageid = '$gallery_pageid' WHERE gid = '$this->gid'");
|
420 |
wp_cache_delete($this->gid, 'ngg_gallery');
|
421 |
-
nggGallery::show_message( __('New gallery page ID','nggallery'). ' ' . $
|
422 |
}
|
423 |
}
|
424 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
425 |
|
426 |
function update_pictures() {
|
427 |
-
global $wpdb;
|
428 |
|
429 |
//TODO:Error message when update failed
|
430 |
-
//TODO:Combine update in one query per image
|
431 |
|
432 |
-
$description = isset ( $_POST['description'] ) ? $_POST['description'] :
|
433 |
-
$alttext = isset ( $_POST['alttext'] ) ? $_POST['alttext'] :
|
434 |
$exclude = isset ( $_POST['exclude'] ) ? $_POST['exclude'] : false;
|
435 |
$taglist = isset ( $_POST['tags'] ) ? $_POST['tags'] : false;
|
436 |
$pictures = isset ( $_POST['pid'] ) ? $_POST['pid'] : false;
|
437 |
-
|
438 |
-
if ( is_array($description) ) {
|
439 |
-
foreach( $description as $key => $value ) {
|
440 |
-
$desc = $wpdb->escape($value);
|
441 |
-
$wpdb->query( "UPDATE $wpdb->nggpictures SET description = '$desc' WHERE pid = $key");
|
442 |
-
wp_cache_delete($key, 'ngg_image');
|
443 |
-
}
|
444 |
-
}
|
445 |
-
if ( is_array($alttext) ){
|
446 |
-
foreach( $alttext as $key => $value ) {
|
447 |
-
$alttext = $wpdb->escape($value);
|
448 |
-
$wpdb->query( "UPDATE $wpdb->nggpictures SET alttext = '$alttext' WHERE pid = $key");
|
449 |
-
wp_cache_delete($key, 'ngg_image');
|
450 |
-
}
|
451 |
-
}
|
452 |
|
453 |
if ( is_array($pictures) ){
|
454 |
foreach( $pictures as $pid ){
|
455 |
-
|
456 |
-
|
457 |
-
|
458 |
-
|
459 |
-
|
460 |
-
|
461 |
-
|
462 |
-
|
463 |
-
|
464 |
-
|
465 |
-
|
466 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
467 |
if ( is_array($taglist) ){
|
468 |
foreach($taglist as $key=>$value) {
|
469 |
$tags = explode(',', $value);
|
470 |
wp_set_object_terms($key, $tags, 'ngg_tag');
|
471 |
}
|
472 |
}
|
473 |
-
|
474 |
return;
|
475 |
}
|
476 |
|
26 |
// Should be only called via a edit single gallery page
|
27 |
if ( isset($_POST['page']) && $_POST['page'] == 'manage-images' )
|
28 |
$this->post_processor_images();
|
29 |
+
// Should be called via a publish dialog
|
30 |
+
if ( isset($_POST['page']) && $_POST['page'] == 'publish-post' )
|
31 |
+
$this->publish_post();
|
32 |
//Look for other POST process
|
33 |
if ( !empty($_POST) || !empty($_GET) )
|
34 |
$this->processor();
|
58 |
|
59 |
global $wpdb, $ngg, $nggdb;
|
60 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
61 |
// Delete a picture
|
62 |
if ($this->mode == 'delpic') {
|
63 |
|
137 |
// A prefix 'gallery_' will first fetch all ids from the selected galleries
|
138 |
nggAdmin::do_ajax_operation( 'gallery_import_metadata' , $_POST['doaction'], __('Import metadata','nggallery') );
|
139 |
break;
|
140 |
+
case 'delete_gallery':
|
141 |
+
// Delete gallery
|
142 |
+
if ( is_array($_POST['doaction']) ) {
|
143 |
+
$deleted = false;
|
144 |
+
foreach ( $_POST['doaction'] as $id ) {
|
145 |
+
// get the path to the gallery
|
146 |
+
$gallery = nggdb::find_gallery($id);
|
147 |
+
if ($gallery){
|
148 |
+
//TODO:Remove also Tag reference, look here for ids instead filename
|
149 |
+
$imagelist = $wpdb->get_col("SELECT filename FROM $wpdb->nggpictures WHERE galleryid = '$gallery->gid' ");
|
150 |
+
if ($ngg->options['deleteImg']) {
|
151 |
+
if (is_array($imagelist)) {
|
152 |
+
foreach ($imagelist as $filename) {
|
153 |
+
@unlink(WINABSPATH . $gallery->path . '/thumbs/thumbs_' . $filename);
|
154 |
+
@unlink(WINABSPATH . $gallery->path .'/'. $filename);
|
155 |
+
@unlink(WINABSPATH . $gallery->path .'/'. $filename . '_backup');
|
156 |
+
}
|
157 |
+
}
|
158 |
+
// delete folder
|
159 |
+
@rmdir( WINABSPATH . $gallery->path . '/thumbs' );
|
160 |
+
@rmdir( WINABSPATH . $gallery->path );
|
161 |
+
}
|
162 |
+
}
|
163 |
+
|
164 |
+
$deleted = nggdb::delete_gallery( $id );
|
165 |
+
}
|
166 |
+
|
167 |
+
if($deleted)
|
168 |
+
nggGallery::show_message(__('Gallery deleted successfully ', 'nggallery'));
|
169 |
+
}
|
170 |
+
break;
|
171 |
}
|
172 |
}
|
173 |
|
362 |
|
363 |
if ( nggGallery::current_user_can( 'NextGEN Edit gallery options' )) {
|
364 |
|
365 |
+
if ( nggGallery::current_user_can( 'NextGEN Edit gallery title' )) {
|
366 |
+
// don't forget to update the slug
|
367 |
+
$slug = nggdb::get_unique_slug( sanitize_title( $_POST['title'] ), 'gallery' );
|
368 |
+
$wpdb->query( $wpdb->prepare ("UPDATE $wpdb->nggallery SET title= '%s', slug= '%s' WHERE gid = %d", esc_attr($_POST['title']), $slug, $this->gid) );
|
369 |
+
}
|
370 |
if ( nggGallery::current_user_can( 'NextGEN Edit gallery path' ))
|
371 |
$wpdb->query( $wpdb->prepare ("UPDATE $wpdb->nggallery SET path= '%s' WHERE gid = %d", untrailingslashit ( str_replace('\\', '/', trim( stripslashes($_POST['path']) )) ), $this->gid ) );
|
372 |
if ( nggGallery::current_user_can( 'NextGEN Edit gallery description' ))
|
422 |
if ($gallery_pageid != 0) {
|
423 |
$result = $wpdb->query("UPDATE $wpdb->nggallery SET title= '$gallery_title', pageid = '$gallery_pageid' WHERE gid = '$this->gid'");
|
424 |
wp_cache_delete($this->gid, 'ngg_gallery');
|
425 |
+
nggGallery::show_message( __('New gallery page ID','nggallery'). ' ' . $gallery_pageid . ' -> <strong>' . $gallery_title . '</strong> ' .__('created','nggallery') );
|
426 |
}
|
427 |
}
|
428 |
}
|
429 |
+
|
430 |
+
/**
|
431 |
+
* Publish a new post with the shortcode from the selected image
|
432 |
+
*
|
433 |
+
* @since 1.7.0
|
434 |
+
* @return void
|
435 |
+
*/
|
436 |
+
function publish_post() {
|
437 |
+
|
438 |
+
check_admin_referer('publish-post');
|
439 |
+
|
440 |
+
// Create a WP page
|
441 |
+
global $user_ID, $ngg;
|
442 |
+
|
443 |
+
$ngg->options['publish_width'] = (int) $_POST['width'];
|
444 |
+
$ngg->options['publish_height'] = (int) $_POST['height'];
|
445 |
+
$ngg->options['publish_align'] = $_POST['align'];
|
446 |
+
$align = ( $ngg->options['publish_align'] == 'none') ? '' : 'float='.$ngg->options['publish_align'];
|
447 |
+
|
448 |
+
//save the new values for the next operation
|
449 |
+
update_option('ngg_options', $ngg->options);
|
450 |
+
|
451 |
+
$post['post_type'] = 'post';
|
452 |
+
$post['post_content'] = '[singlepic id=' . intval($_POST['pid']) . ' w=' . $ngg->options['publish_width'] . ' h=' . $ngg->options['publish_height'] . ' ' . $align . ']';
|
453 |
+
$post['post_author'] = $user_ID;
|
454 |
+
$post['post_status'] = isset ( $_POST['publish'] ) ? 'publish' : 'draft';
|
455 |
+
$post['post_title'] = $_POST['post_title'];
|
456 |
+
$post = apply_filters('ngg_add_new_post', $post, $_POST['pid']);
|
457 |
+
|
458 |
+
$post_id = wp_insert_post ($post);
|
459 |
+
|
460 |
+
if ($post_id != 0)
|
461 |
+
nggGallery::show_message( __('Published a new post','nggallery') );
|
462 |
+
|
463 |
+
}
|
464 |
|
465 |
function update_pictures() {
|
466 |
+
global $wpdb, $nggdb;
|
467 |
|
468 |
//TODO:Error message when update failed
|
|
|
469 |
|
470 |
+
$description = isset ( $_POST['description'] ) ? $_POST['description'] : array();
|
471 |
+
$alttext = isset ( $_POST['alttext'] ) ? $_POST['alttext'] : array();
|
472 |
$exclude = isset ( $_POST['exclude'] ) ? $_POST['exclude'] : false;
|
473 |
$taglist = isset ( $_POST['tags'] ) ? $_POST['tags'] : false;
|
474 |
$pictures = isset ( $_POST['pid'] ) ? $_POST['pid'] : false;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
475 |
|
476 |
if ( is_array($pictures) ){
|
477 |
foreach( $pictures as $pid ){
|
478 |
+
$image = $nggdb->find_image( $pid );
|
479 |
+
if ($image) {
|
480 |
+
// description field
|
481 |
+
$image->description = $description[$image->pid];
|
482 |
+
|
483 |
+
// only uptade this field if someone change the alttext
|
484 |
+
if ( $image->alttext != $alttext[$image->pid] ) {
|
485 |
+
$image->alttext = $alttext[$image->pid];
|
486 |
+
$image->image_slug = nggdb::get_unique_slug( sanitize_title( $image->alttext ), 'image' );
|
487 |
+
}
|
488 |
+
|
489 |
+
// set exclude flag
|
490 |
+
if ( is_array($exclude) )
|
491 |
+
$image->exclude = ( array_key_exists($image->pid, $exclude) )? 1 : 0;
|
492 |
+
else
|
493 |
+
$image->exclude = 0;
|
494 |
+
|
495 |
+
// update the database
|
496 |
+
$wpdb->query( $wpdb->prepare ("UPDATE $wpdb->nggpictures SET image_slug = '%s', alttext = '%s', description = '%s', exclude = %d WHERE pid = %d",
|
497 |
+
$image->image_slug, $image->alttext, $image->description, $image->exclude, $image->pid) );
|
498 |
+
// remove from cache
|
499 |
+
wp_cache_delete($image->pid, 'ngg_image');
|
500 |
+
}
|
501 |
+
|
502 |
+
}
|
503 |
+
}
|
504 |
+
|
505 |
+
//TODO: This produce 300-400 queries !
|
506 |
if ( is_array($taglist) ){
|
507 |
foreach($taglist as $key=>$value) {
|
508 |
$tags = explode(',', $value);
|
509 |
wp_set_object_terms($key, $tags, 'ngg_tag');
|
510 |
}
|
511 |
}
|
512 |
+
|
513 |
return;
|
514 |
}
|
515 |
|
admin/media-upload.php
CHANGED
@@ -70,12 +70,10 @@ function media_upload_nextgen_save_image() {
|
|
70 |
|
71 |
if ( !empty($_POST['image']) ) foreach ( $_POST['image'] as $image_id => $image ) {
|
72 |
|
73 |
-
|
74 |
-
|
75 |
-
|
76 |
-
|
77 |
-
$wpdb->query("UPDATE $wpdb->nggpictures SET alttext= '$alttext', description = '$description' WHERE pid = '$image_id'");
|
78 |
-
|
79 |
}
|
80 |
}
|
81 |
|
70 |
|
71 |
if ( !empty($_POST['image']) ) foreach ( $_POST['image'] as $image_id => $image ) {
|
72 |
|
73 |
+
// create a unique slug
|
74 |
+
$image_slug = nggdb::get_unique_slug( sanitize_title( $image['alttext'] ), 'image' );
|
75 |
+
$wpdb->query( $wpdb->prepare ("UPDATE $wpdb->nggpictures SET image_slug= '%s', alttext= '%s', description = '%s' WHERE pid = %d", $image_slug, $image['alttext'], $image['description'], $image_id));
|
76 |
+
wp_cache_delete($image_id, 'ngg_image');
|
|
|
|
|
77 |
}
|
78 |
}
|
79 |
|
admin/overview.php
CHANGED
@@ -118,7 +118,7 @@ function ngg_likeThisMetaBox() {
|
|
118 |
|
119 |
$url = 'http://alexrabe.de/wordpress-plugins/wordtube/translation-of-plugins/';
|
120 |
echo "<li style='padding-left: 38px; background:transparent url(" . NGGALLERY_URLPATH . "admin/images/icon-translate.png ) no-repeat scroll center left; background-position: 16px 50%; text-decoration: none;'><a href='{$url}'>";
|
121 |
-
_e("Help
|
122 |
echo "</a></li>";
|
123 |
|
124 |
echo '</ul>';
|
118 |
|
119 |
$url = 'http://alexrabe.de/wordpress-plugins/wordtube/translation-of-plugins/';
|
120 |
echo "<li style='padding-left: 38px; background:transparent url(" . NGGALLERY_URLPATH . "admin/images/icon-translate.png ) no-repeat scroll center left; background-position: 16px 50%; text-decoration: none;'><a href='{$url}'>";
|
121 |
+
_e("Help translating it.", 'nggallery');
|
122 |
echo "</a></li>";
|
123 |
|
124 |
echo '</ul>';
|
admin/publish.php
ADDED
@@ -0,0 +1,74 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
/**
|
3 |
+
|
4 |
+
Custom thumbnail for NGG
|
5 |
+
Author : Simone Fumagalli | simone@iliveinperego.com
|
6 |
+
More info and update : http://www.iliveinperego.com/rotate_for_ngg/
|
7 |
+
|
8 |
+
Credits:
|
9 |
+
NextGen Gallery : Alex Rabe | http://alexrabe.boelinger.com/wordpress-plugins/nextgen-gallery/
|
10 |
+
|
11 |
+
**/
|
12 |
+
|
13 |
+
require_once( dirname( dirname(__FILE__) ) . '/ngg-config.php');
|
14 |
+
require_once( NGGALLERY_ABSPATH . '/lib/image.php' );
|
15 |
+
|
16 |
+
if ( !is_user_logged_in() )
|
17 |
+
die(__('Cheatin’ uh?'));
|
18 |
+
|
19 |
+
if ( !current_user_can('NextGEN Manage gallery') )
|
20 |
+
die(__('Cheatin’ uh?'));
|
21 |
+
|
22 |
+
if ( !current_user_can( 'publish_posts' ) )
|
23 |
+
die(__('Cheatin’ uh?'));
|
24 |
+
|
25 |
+
global $wpdb;
|
26 |
+
|
27 |
+
$id = (int) $_GET['id'];
|
28 |
+
|
29 |
+
// let's get the image data
|
30 |
+
$picture = nggdb::find_image($id);
|
31 |
+
|
32 |
+
// use defaults the first time
|
33 |
+
$width = empty ($ngg->options['publish_width']) ? $ngg->options['thumbwidth'] : $ngg->options['publish_width'];
|
34 |
+
$height = empty ($ngg->options['publish_height']) ? $ngg->options['thumbheight'] : $ngg->options['publish_height'];
|
35 |
+
$align = empty ($ngg->options['publish_align']) ? 'none' : $ngg->options['publish_align'];
|
36 |
+
|
37 |
+
?>
|
38 |
+
|
39 |
+
<form id="form-publish-post" method="POST" accept-charset="utf-8">
|
40 |
+
<?php wp_nonce_field('publish-post') ?>
|
41 |
+
<input type="hidden" name="page" value="publish-post" />
|
42 |
+
<input type="hidden" name="pid" value="<?php echo $picture->pid; ?>" />
|
43 |
+
<table width="100%" border="0" cellspacing="3" cellpadding="3" >
|
44 |
+
<tr valign="top">
|
45 |
+
<th align="left"><?php _e('Post title','nggallery') ?></th>
|
46 |
+
<td><input type="text" size="70" name="post_title" value="<?php echo $picture->alttext; ?>" />
|
47 |
+
<br /><small><?php _e('Enter the post title ','nggallery') ?></small></td>
|
48 |
+
</tr>
|
49 |
+
<tr valign="top">
|
50 |
+
<th align="left"><?php _e('Width x height (in pixel)','nggallery') ?></th>
|
51 |
+
<td><input type="text" size="5" maxlength="5" name="width" value="<?php echo $width; ?>" /> x <input type="text" size="5" maxlength="5" name="height" value="<?php echo $height; ?>" />
|
52 |
+
<br /><small><?php _e('Size of the image','nggallery') ?></small></td>
|
53 |
+
</tr>
|
54 |
+
<tr valign="top">
|
55 |
+
<th align="left"><?php _e('Alignment','nggallery') ?></th>
|
56 |
+
<td><input type="radio" value="none" <?php checked('none', $align); ?> id="image-align-none" name="align"/>
|
57 |
+
<label class="align" for="image-align-none"><?php _e('None','nggallery'); ?></label>
|
58 |
+
<input type="radio" value="left" <?php checked('left', $align); ?> id="image-align-left" name="align"/>
|
59 |
+
<label class="align" for="image-align-left"><?php _e('Left','nggallery'); ?></label>
|
60 |
+
<input type="radio" value="center" <?php checked('center', $align); ?> id="image-align-center" name="align"/>
|
61 |
+
<label class="align" for="image-align-center"><?php _e('Center','nggallery'); ?></label>
|
62 |
+
<input type="radio" value="right" <?php checked('right', $align); ?> id="image-align-right" name="align"/>
|
63 |
+
<label class="align" for="image-align-right"><?php _e('Right','nggallery'); ?></label>
|
64 |
+
</td>
|
65 |
+
</tr>
|
66 |
+
<tr align="right">
|
67 |
+
<td colspan="2" class="submit">
|
68 |
+
<input class="button-primary" type="submit" name="publish" value="<?php _e('Publish', 'nggallery');?>" />
|
69 |
+
|
70 |
+
<input class="button-secondary" type="submit" name="draft" value=" <?php _e('Draft', 'nggallery'); ?> " />
|
71 |
+
</td>
|
72 |
+
</tr>
|
73 |
+
</table>
|
74 |
+
</form>
|
admin/roles.php
CHANGED
@@ -26,7 +26,7 @@ if ( isset($_POST['update_cap']) ) {
|
|
26 |
<div class="wrap">
|
27 |
<?php screen_icon( 'nextgen-gallery' ); ?>
|
28 |
<h2><?php _e('Roles / capabilities', 'nggallery') ;?></h2>
|
29 |
-
<p><?php _e('Select the lowest role which should be able to access the
|
30 |
<?php _e('For a more flexible user management you can use the', 'nggallery') ?> <a href="http://wordpress.org/extend/plugins/capsman/" target="_blank">Capability Manager</a>.</p>
|
31 |
<form name="addroles" id="addroles" method="POST" accept-charset="utf-8" >
|
32 |
<?php wp_nonce_field('ngg_addroles') ?>
|
26 |
<div class="wrap">
|
27 |
<?php screen_icon( 'nextgen-gallery' ); ?>
|
28 |
<h2><?php _e('Roles / capabilities', 'nggallery') ;?></h2>
|
29 |
+
<p><?php _e('Select the lowest role which should be able to access the following capabilities. NextGEN Gallery supports the standard roles from WordPress.', 'nggallery') ?> <br />
|
30 |
<?php _e('For a more flexible user management you can use the', 'nggallery') ?> <a href="http://wordpress.org/extend/plugins/capsman/" target="_blank">Capability Manager</a>.</p>
|
31 |
<form name="addroles" id="addroles" method="POST" accept-charset="utf-8" >
|
32 |
<?php wp_nonce_field('ngg_addroles') ?>
|
admin/rotate.php
CHANGED
@@ -36,7 +36,7 @@ $thumb->resize(350,350);
|
|
36 |
$resizedPreviewInfo = $thumb->newDimensions;
|
37 |
$thumb->destruct();
|
38 |
|
39 |
-
$preview_image =
|
40 |
|
41 |
?>
|
42 |
|
36 |
$resizedPreviewInfo = $thumb->newDimensions;
|
37 |
$thumb->destruct();
|
38 |
|
39 |
+
$preview_image = home_url() . '/' . 'index.php?callback=image&pid=' . $picture->pid . '&width=350&height=350';
|
40 |
|
41 |
?>
|
42 |
|
admin/settings.php
CHANGED
@@ -75,7 +75,8 @@ class nggOptions {
|
|
75 |
}
|
76 |
|
77 |
if ( isset($_POST['clearcache']) ) {
|
78 |
-
|
|
|
79 |
$path = WINABSPATH . $ngg->options['gallerypath'] . 'cache/';
|
80 |
|
81 |
if (is_dir($path))
|
@@ -90,6 +91,12 @@ class nggOptions {
|
|
90 |
|
91 |
nggGallery::show_message(__('Cache cleared','nggallery'));
|
92 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
93 |
|
94 |
do_action( 'ngg_update_options_page' );
|
95 |
|
@@ -108,6 +115,7 @@ class nggOptions {
|
|
108 |
?>
|
109 |
<script type="text/javascript">
|
110 |
jQuery(document).ready(function(){
|
|
|
111 |
jQuery("a.switch-expert").hide();
|
112 |
/*
|
113 |
jQuery(".expert").hide();
|
@@ -218,7 +226,7 @@ class nggOptions {
|
|
218 |
?>
|
219 |
<!-- General Options -->
|
220 |
<h2><?php _e('General Options','nggallery'); ?></h2>
|
221 |
-
<form name="generaloptions" method="post">
|
222 |
<?php wp_nonce_field('ngg_settings') ?>
|
223 |
<input type="hidden" name="page_options" value="gallerypath,deleteImg,useMediaRSS,usePicLens,usePermalinks,graphicLibrary,imageMagickDir,activateTags,appendType,maxImages" />
|
224 |
<table class="form-table ngg-options">
|
@@ -238,7 +246,12 @@ class nggOptions {
|
|
238 |
<?php _e('When you activate this option, you need to update your permalink structure one time.','nggallery'); ?></td>
|
239 |
</tr>
|
240 |
<tr class="expert">
|
241 |
-
<th valign="top"><?php _e('
|
|
|
|
|
|
|
|
|
|
|
242 |
<td><label><input name="graphicLibrary" type="radio" value="gd" <?php checked('gd', $ngg->options['graphicLibrary']); ?> /> <?php _e('GD Library', 'nggallery') ;?></label><br />
|
243 |
<label><input name="graphicLibrary" type="radio" value="im" <?php checked('im', $ngg->options['graphicLibrary']); ?> /> <?php _e('ImageMagick (Experimental). Path to the library :', 'nggallery') ;?>
|
244 |
<input <?php if (is_multisite()) echo 'readonly = "readonly"'; ?> type="text" size="35" name="imageMagickDir" value="<?php echo $ngg->options['imageMagickDir']; ?>" /></label>
|
@@ -258,19 +271,19 @@ class nggOptions {
|
|
258 |
<h3 class="expert"><?php _e('Tags / Categories','nggallery'); ?></h3>
|
259 |
<table class="expert form-table ngg-options">
|
260 |
<tr>
|
261 |
-
<th valign="top"><?php _e('Activate related images','nggallery');
|
262 |
<td><input name="activateTags" type="checkbox" value="1" <?php checked('1', $ngg->options['activateTags']); ?> />
|
263 |
<?php _e('This option will append related images to every post','nggallery'); ?>
|
264 |
</td>
|
265 |
</tr>
|
266 |
<tr>
|
267 |
-
<th valign="top"><?php _e('Match with','nggallery')
|
268 |
<td><label><input name="appendType" type="radio" value="category" <?php checked('category', $ngg->options['appendType']); ?> /> <?php _e('Categories', 'nggallery') ;?></label><br />
|
269 |
<label><input name="appendType" type="radio" value="tags" <?php checked('tags', $ngg->options['appendType']); ?> /> <?php _e('Tags', 'nggallery') ;?></label>
|
270 |
</td>
|
271 |
</tr>
|
272 |
<tr>
|
273 |
-
<th valign="top"><?php _e('Max. number of images','nggallery')
|
274 |
<td><input type="text" name="maxImages" value="<?php echo $ngg->options['maxImages']; ?>" size="3" maxlength="3" />
|
275 |
<span class="setting-description"><?php _e('0 will show all images','nggallery'); ?></span>
|
276 |
</td>
|
@@ -371,59 +384,59 @@ class nggOptions {
|
|
371 |
<input type="hidden" name="page_options" value="galNoPages,galImages,galColumns,galShowSlide,galTextSlide,galTextGallery,galShowOrder,galImgBrowser,galSort,galSortDir,galHiddenImg,galAjaxNav" />
|
372 |
<table class="form-table ngg-options">
|
373 |
<tr class="expert" >
|
374 |
-
<th valign="top"><?php _e('Deactivate gallery page link','nggallery')
|
375 |
<td><input name="galNoPages" type="checkbox" value="1" <?php checked('1', $ngg->options['galNoPages']); ?> />
|
376 |
<?php _e('The album will not link to a gallery subpage. The gallery is shown on the same page.','nggallery') ?>
|
377 |
</td>
|
378 |
</tr>
|
379 |
<tr>
|
380 |
-
<th valign="top"><?php _e('Number of images per page','nggallery')
|
381 |
<td><input type="text" name="galImages" value="<?php echo $ngg->options['galImages']; ?>" size="3" maxlength="3" />
|
382 |
<span class="setting-description"><?php _e('0 will disable pagination, all images on one page','nggallery') ?></span>
|
383 |
</td>
|
384 |
</tr>
|
385 |
<tr>
|
386 |
-
<th valign="top"><?php _e('Number of columns','nggallery')
|
387 |
<td><input type="text" name="galColumns" value="<?php echo $ngg->options['galColumns']; ?>" size="3" maxlength="3" />
|
388 |
<span class="setting-description"><?php _e('0 will display as much as possible based on the width of your theme. Setting normally only required for captions below the images','nggallery') ?></span>
|
389 |
</td>
|
390 |
</tr>
|
391 |
<tr>
|
392 |
-
<th valign="top"><?php _e('Integrate slideshow','nggallery')
|
393 |
<td><input name="galShowSlide" type="checkbox" value="1" <?php checked('1', $ngg->options['galShowSlide']); ?> />
|
394 |
<input type="text" name="galTextSlide" value="<?php echo $ngg->options['galTextSlide'] ?>" size="20" />
|
395 |
<input type="text" name="galTextGallery" value="<?php echo $ngg->options['galTextGallery'] ?>" size="20" />
|
396 |
</td>
|
397 |
</tr>
|
398 |
<tr class="expert" >
|
399 |
-
<th valign="top"><?php _e('Show first','nggallery')
|
400 |
<td><label><input name="galShowOrder" type="radio" value="gallery" <?php checked('gallery', $ngg->options['galShowOrder']); ?> /> <?php _e('Thumbnails', 'nggallery') ;?></label><br />
|
401 |
<label><input name="galShowOrder" type="radio" value="slide" <?php checked('slide', $ngg->options['galShowOrder']); ?> /> <?php _e('Slideshow', 'nggallery') ;?></label>
|
402 |
</td>
|
403 |
</tr>
|
404 |
<tr class="expert" >
|
405 |
-
<th valign="top"><?php _e('Show ImageBrowser','nggallery');
|
406 |
<td><input name="galImgBrowser" type="checkbox" value="1" <?php checked('1', $ngg->options['galImgBrowser']); ?> />
|
407 |
<?php _e('The gallery will open the ImageBrowser instead the effect.', 'nggallery'); ?>
|
408 |
</td>
|
409 |
</tr>
|
410 |
<tr class="expert" >
|
411 |
-
<th valign="top"><?php _e('Add hidden images','nggallery');
|
412 |
<td><input name="galHiddenImg" type="checkbox" value="1" <?php checked('1', $ngg->options['galHiddenImg']); ?> />
|
413 |
-
<?php _e('If pagination is used, this option will still show all images in the modal window (Thickbox, Lightbox etc.). Note : This
|
414 |
</td>
|
415 |
</tr>
|
416 |
<tr class="expert" >
|
417 |
-
<th valign="top"><?php _e('Enable AJAX pagination','nggallery');
|
418 |
<td><input name="galAjaxNav" type="checkbox" value="1" <?php checked('1', $ngg->options['galAjaxNav']); ?> />
|
419 |
-
<?php _e('Browse images without reload the page. Note :
|
420 |
</td>
|
421 |
</tr>
|
422 |
</table>
|
423 |
<h3 class="expert" ><?php _e('Sort options','nggallery') ?></h3>
|
424 |
<table class="expert form-table ngg-options">
|
425 |
<tr>
|
426 |
-
<th valign="top"><?php _e('Sort thumbnails','nggallery')
|
427 |
<td>
|
428 |
<label><input name="galSort" type="radio" value="sortorder" <?php checked('sortorder', $ngg->options['galSort']); ?> /> <?php _e('Custom order', 'nggallery') ;?></label><br />
|
429 |
<label><input name="galSort" type="radio" value="pid" <?php checked('pid', $ngg->options['galSort']); ?> /> <?php _e('Image ID', 'nggallery') ;?></label><br />
|
@@ -433,7 +446,7 @@ class nggOptions {
|
|
433 |
</td>
|
434 |
</tr>
|
435 |
<tr>
|
436 |
-
<th valign="top"><?php _e('Sort direction','nggallery')
|
437 |
<td><label><input name="galSortDir" type="radio" value="ASC" <?php checked('ASC', $ngg->options['galSortDir']); ?> /> <?php _e('Ascending', 'nggallery') ;?></label><br />
|
438 |
<label><input name="galSortDir" type="radio" value="DESC" <?php checked('DESC', $ngg->options['galSortDir']); ?> /> <?php _e('Descending', 'nggallery') ;?></label>
|
439 |
</td>
|
@@ -457,7 +470,7 @@ class nggOptions {
|
|
457 |
<?php _e('With the placeholder','nggallery'); ?><strong> %GALLERY_NAME% </strong> <?php _e('you can activate a navigation through the images (depend on the effect). Change the code line only , when you use a different thumbnail effect or you know what you do.','nggallery'); ?></p>
|
458 |
<table class="form-table ngg-options">
|
459 |
<tr valign="top">
|
460 |
-
<th><?php _e('JavaScript Thumbnail effect','nggallery')
|
461 |
<td>
|
462 |
<select size="1" id="thumbEffect" name="thumbEffect" onchange="insertcode(this.value)">
|
463 |
<option value="none" <?php selected('none', $ngg->options['thumbEffect']); ?> ><?php _e('None', 'nggallery') ;?></option>
|
@@ -470,7 +483,7 @@ class nggOptions {
|
|
470 |
</td>
|
471 |
</tr>
|
472 |
<tr class="expert" valign="top">
|
473 |
-
<th><?php _e('Link Code line','nggallery')
|
474 |
<td><textarea id="thumbCode" name="thumbCode" cols="50" rows="5"><?php echo htmlspecialchars(stripslashes($ngg->options['thumbCode'])); ?></textarea></td>
|
475 |
</tr>
|
476 |
</table>
|
@@ -487,7 +500,7 @@ class nggOptions {
|
|
487 |
|
488 |
// take the first image as sample
|
489 |
$imageID = $wpdb->get_var("SELECT MIN(pid) FROM $wpdb->nggpictures");
|
490 |
-
$imageURL = ($imageID) ? $imageURL = '<img src="'.
|
491 |
|
492 |
?>
|
493 |
<!-- Watermark settings -->
|
@@ -543,7 +556,7 @@ class nggOptions {
|
|
543 |
<h3><label><input type="radio" name="wmType" value="image" <?php checked('image', $ngg->options['wmType']); ?> /> <?php _e('Use image as watermark','nggallery') ?></label></h3>
|
544 |
<table class="wm-table form-table">
|
545 |
<tr>
|
546 |
-
<th><?php _e('URL to file','nggallery')
|
547 |
<td><input type="text" size="40" name="wmPath" value="<?php echo $ngg->options['wmPath']; ?>" /><br />
|
548 |
<?php if(!ini_get('allow_url_fopen')) _e('The accessing of URL files is disabled at your server (allow_url_fopen)','nggallery') ?> </td>
|
549 |
</tr>
|
@@ -551,7 +564,7 @@ class nggOptions {
|
|
551 |
<h3><label><input type="radio" name="wmType" value="text" <?php checked('text', $ngg->options['wmType']); ?> /> <?php _e('Use text as watermark','nggallery') ?></label></h3>
|
552 |
<table class="wm-table form-table">
|
553 |
<tr>
|
554 |
-
<th><?php _e('Font','nggallery')
|
555 |
<td><select name="wmFont" size="1"> <?php
|
556 |
$fontlist = ngg_get_TTFfont();
|
557 |
foreach ( $fontlist as $fontfile ) {
|
@@ -567,20 +580,20 @@ class nggOptions {
|
|
567 |
</td>
|
568 |
</tr>
|
569 |
<tr>
|
570 |
-
<th><?php _e('Size','nggallery')
|
571 |
<td><input type="text" name="wmSize" value="<?php echo $ngg->options['wmSize']; ?>" size="4" maxlength="2" /> px</td>
|
572 |
</tr>
|
573 |
<tr>
|
574 |
-
<th><?php _e('Color','nggallery')
|
575 |
<td><input class="picker" type="text" size="6" maxlength="6" id="wmColor" name="wmColor" onchange="setcolor('#previewText', this.value)" value="<?php echo $ngg->options['wmColor'] ?>" />
|
576 |
<input type="text" size="1" readonly="readonly" id="previewText" style="background-color: #<?php echo $ngg->options['wmColor']; ?>" /> <?php _e('(hex w/o #)','nggallery') ?></td>
|
577 |
</tr>
|
578 |
<tr>
|
579 |
-
<th valign="top"><?php _e('Text','nggallery')
|
580 |
<td><textarea name="wmText" cols="40" rows="4"><?php echo $ngg->options['wmText'] ?></textarea></td>
|
581 |
</tr>
|
582 |
<tr>
|
583 |
-
<th><?php _e('Opaque','nggallery')
|
584 |
<td><input type="text" name="wmOpaque" value="<?php echo $ngg->options['wmOpaque'] ?>" size="3" maxlength="3" /> % </td>
|
585 |
</tr>
|
586 |
</table>
|
@@ -601,16 +614,16 @@ class nggOptions {
|
|
601 |
<h2><?php _e('Slideshow','nggallery'); ?></h2>
|
602 |
<table class="form-table ngg-options">
|
603 |
<tr>
|
604 |
-
<th><?php _e('Default size (W x H)','nggallery')
|
605 |
<td><input type="text" size="3" maxlength="4" name="irWidth" value="<?php echo $ngg->options['irWidth']; ?>" /> x
|
606 |
<input type="text" size="3" maxlength="4" name="irHeight" value="<?php echo $ngg->options['irHeight']; ?>" /></td>
|
607 |
</tr>
|
608 |
<tr>
|
609 |
-
<th><?php _e('Duration time','nggallery')
|
610 |
<td><input type="text" size="3" maxlength="3" name="irRotatetime" value="<?php echo $ngg->options['irRotatetime'] ?>" /> <?php _e('sec.', 'nggallery') ;?></td>
|
611 |
</tr>
|
612 |
<tr>
|
613 |
-
<th><?php _e('Transition / Fade effect','nggallery')
|
614 |
<td>
|
615 |
<select size="1" name="slideFx">
|
616 |
<option value="fade" <?php selected('fade', $ngg->options['slideFx']); ?> ><?php _e('fade', 'nggallery') ;?></option>
|
@@ -640,41 +653,41 @@ class nggOptions {
|
|
640 |
<?php }?>
|
641 |
<table class="expert form-table ngg-options">
|
642 |
<tr>
|
643 |
-
<th><?php _e('Enable flash slideshow','nggallery')
|
644 |
<td><input name="enableIR" type="checkbox" value="1" <?php checked('1', $ngg->options['enableIR']); ?> />
|
645 |
-
<span class="setting-description"><?php _e('Integrate the flash based
|
646 |
</tr>
|
647 |
<tr>
|
648 |
-
<th><?php _e('Path to the Imagerotator (URL)','nggallery')
|
649 |
<td>
|
650 |
<input type="text" size="50" id="irURL" name="irURL" value="<?php echo $ngg->options['irURL']; ?>" />
|
651 |
<input type="submit" name="irDetect" class="button-secondary" value="<?php _e('Search now','nggallery') ;?> »"/>
|
652 |
-
<br /><span class="setting-description"><?php _e('Press the button to search
|
653 |
</td>
|
654 |
</tr>
|
655 |
<tr>
|
656 |
-
<th><?php _e('Shuffle mode','nggallery')
|
657 |
<td><input name="irShuffle" type="checkbox" value="1" <?php checked('1', $ngg->options['irShuffle']); ?> /></td>
|
658 |
</tr>
|
659 |
<tr class="expert">
|
660 |
-
<th><?php _e('Show next image on click','nggallery')
|
661 |
<td><input name="irLinkfromdisplay" type="checkbox" value="1" <?php checked('1', $ngg->options['irLinkfromdisplay']); ?> /></td>
|
662 |
</tr>
|
663 |
<tr class="expert">
|
664 |
-
<th><?php _e('Show navigation bar','nggallery')
|
665 |
<td><input name="irShownavigation" type="checkbox" value="1" <?php checked('1', $ngg->options['irShownavigation']); ?> /></td>
|
666 |
</tr>
|
667 |
<tr class="expert">
|
668 |
-
<th><?php _e('Show loading icon','nggallery')
|
669 |
<td><input name="irShowicons" type="checkbox" value="1" <?php checked('1', $ngg->options['irShowicons']); ?> /></td>
|
670 |
</tr>
|
671 |
<tr class="expert">
|
672 |
-
<th><?php _e('Use watermark logo','nggallery')
|
673 |
<td><input name="irWatermark" type="checkbox" value="1" <?php checked('1', $ngg->options['irWatermark']); ?> />
|
674 |
<span class="setting-description"><?php _e('You can change the logo at the watermark settings','nggallery') ?></span></td>
|
675 |
</tr>
|
676 |
<tr class="expert">
|
677 |
-
<th><?php _e('Stretch image','nggallery')
|
678 |
<td>
|
679 |
<select size="1" name="irOverstretch">
|
680 |
<option value="true" <?php selected('true', $ngg->options['irOverstretch']); ?> ><?php _e('true', 'nggallery') ;?></option>
|
@@ -685,7 +698,7 @@ class nggOptions {
|
|
685 |
</td>
|
686 |
</tr>
|
687 |
<tr>
|
688 |
-
<th><?php _e('Transition / Fade effect','nggallery')
|
689 |
<td>
|
690 |
<select size="1" name="irTransition">
|
691 |
<option value="fade" <?php selected('fade', $ngg->options['irTransition']); ?> ><?php _e('fade', 'nggallery') ;?></option>
|
@@ -702,35 +715,35 @@ class nggOptions {
|
|
702 |
</td>
|
703 |
</tr>
|
704 |
<tr class="expert">
|
705 |
-
<th><?php _e('Use slow zooming effect','nggallery')
|
706 |
<td><input name="irKenburns" type="checkbox" value="1" <?php checked('1', $ngg->options['irKenburns']); ?> /></td>
|
707 |
</tr>
|
708 |
<tr>
|
709 |
-
<th><?php _e('Background Color','nggallery')
|
710 |
<td><input class="picker" type="text" size="6" maxlength="6" id="irBackcolor" name="irBackcolor" onchange="setcolor('#previewBack', this.value)" value="<?php echo $ngg->options['irBackcolor'] ?>" />
|
711 |
<input type="text" size="1" readonly="readonly" id="previewBack" style="background-color: #<?php echo $ngg->options['irBackcolor'] ?>" /></td>
|
712 |
</tr>
|
713 |
<tr>
|
714 |
-
<th><?php _e('Texts / Buttons Color','nggallery')
|
715 |
<td><input class="picker" type="text" size="6" maxlength="6" id="irFrontcolor" name="irFrontcolor" onchange="setcolor('#previewFront', this.value)" value="<?php echo $ngg->options['irFrontcolor'] ?>" />
|
716 |
<input type="text" size="1" readonly="readonly" id="previewFront" style="background-color: #<?php echo $ngg->options['irFrontcolor'] ?>" /></td>
|
717 |
</tr>
|
718 |
<tr class="expert">
|
719 |
-
<th><?php _e('Rollover / Active Color','nggallery')
|
720 |
<td><input class="picker" type="text" size="6" maxlength="6" id="irLightcolor" name="irLightcolor" onchange="setcolor('#previewLight', this.value)" value="<?php echo $ngg->options['irLightcolor'] ?>" />
|
721 |
<input type="text" size="1" readonly="readonly" id="previewLight" style="background-color: #<?php echo $ngg->options['irLightcolor'] ?>" /></td>
|
722 |
</tr>
|
723 |
<tr class="expert">
|
724 |
-
<th><?php _e('Screen Color','nggallery')
|
725 |
<td><input class="picker" type="text" size="6" maxlength="6" id="irScreencolor" name="irScreencolor" onchange="setcolor('#previewScreen', this.value)" value="<?php echo $ngg->options['irScreencolor'] ?>" />
|
726 |
<input type="text" size="1" readonly="readonly" id="previewScreen" style="background-color: #<?php echo $ngg->options['irScreencolor'] ?>" /></td>
|
727 |
</tr>
|
728 |
<tr class="expert">
|
729 |
-
<th><?php _e('Background music (URL)','nggallery')
|
730 |
<td><input type="text" size="50" id="irAudio" name="irAudio" value="<?php echo $ngg->options['irAudio'] ?>" /></td>
|
731 |
</tr>
|
732 |
<tr class="expert">
|
733 |
-
<th ><?php _e('Try XHTML validation (with CDATA)','nggallery')
|
734 |
<td><input name="irXHTMLvalid" type="checkbox" value="1" <?php checked('1', $ngg->options['irXHTMLvalid']); ?> />
|
735 |
<span class="setting-description"><?php _e('Important : Could causes problem at some browser. Please recheck your page.','nggallery') ?></span></td>
|
736 |
</tr>
|
75 |
}
|
76 |
|
77 |
if ( isset($_POST['clearcache']) ) {
|
78 |
+
check_admin_referer('ngg_settings');
|
79 |
+
|
80 |
$path = WINABSPATH . $ngg->options['gallerypath'] . 'cache/';
|
81 |
|
82 |
if (is_dir($path))
|
91 |
|
92 |
nggGallery::show_message(__('Cache cleared','nggallery'));
|
93 |
}
|
94 |
+
|
95 |
+
if ( isset($_POST['createslugs']) ) {
|
96 |
+
check_admin_referer('ngg_settings');
|
97 |
+
include_once (dirname (__FILE__) . '/upgrade.php');
|
98 |
+
ngg_rebuild_unique_slugs::init();
|
99 |
+
}
|
100 |
|
101 |
do_action( 'ngg_update_options_page' );
|
102 |
|
115 |
?>
|
116 |
<script type="text/javascript">
|
117 |
jQuery(document).ready(function(){
|
118 |
+
jQuery('html,body').scrollTop(0);
|
119 |
jQuery("a.switch-expert").hide();
|
120 |
/*
|
121 |
jQuery(".expert").hide();
|
226 |
?>
|
227 |
<!-- General Options -->
|
228 |
<h2><?php _e('General Options','nggallery'); ?></h2>
|
229 |
+
<form name="generaloptions" method="post" action="<?php echo $this->filepath; ?>">
|
230 |
<?php wp_nonce_field('ngg_settings') ?>
|
231 |
<input type="hidden" name="page_options" value="gallerypath,deleteImg,useMediaRSS,usePicLens,usePermalinks,graphicLibrary,imageMagickDir,activateTags,appendType,maxImages" />
|
232 |
<table class="form-table ngg-options">
|
246 |
<?php _e('When you activate this option, you need to update your permalink structure one time.','nggallery'); ?></td>
|
247 |
</tr>
|
248 |
<tr class="expert">
|
249 |
+
<th valign="top"><?php _e('Create new URL friendly image slugs','nggallery'); ?></th>
|
250 |
+
<td><input type="submit" name="createslugs" class="button-secondary" value="<?php _e('Proceed now','nggallery') ;?> »"/>
|
251 |
+
<?php _e('Currently not used, prepare database for upcoming version','nggallery'); ?></td>
|
252 |
+
</tr>
|
253 |
+
<tr class="expert">
|
254 |
+
<th valign="top"><?php _e('Select graphic library','nggallery'); ?></th>
|
255 |
<td><label><input name="graphicLibrary" type="radio" value="gd" <?php checked('gd', $ngg->options['graphicLibrary']); ?> /> <?php _e('GD Library', 'nggallery') ;?></label><br />
|
256 |
<label><input name="graphicLibrary" type="radio" value="im" <?php checked('im', $ngg->options['graphicLibrary']); ?> /> <?php _e('ImageMagick (Experimental). Path to the library :', 'nggallery') ;?>
|
257 |
<input <?php if (is_multisite()) echo 'readonly = "readonly"'; ?> type="text" size="35" name="imageMagickDir" value="<?php echo $ngg->options['imageMagickDir']; ?>" /></label>
|
271 |
<h3 class="expert"><?php _e('Tags / Categories','nggallery'); ?></h3>
|
272 |
<table class="expert form-table ngg-options">
|
273 |
<tr>
|
274 |
+
<th valign="top"><?php _e('Activate related images','nggallery'); ?></th>
|
275 |
<td><input name="activateTags" type="checkbox" value="1" <?php checked('1', $ngg->options['activateTags']); ?> />
|
276 |
<?php _e('This option will append related images to every post','nggallery'); ?>
|
277 |
</td>
|
278 |
</tr>
|
279 |
<tr>
|
280 |
+
<th valign="top"><?php _e('Match with','nggallery'); ?></th>
|
281 |
<td><label><input name="appendType" type="radio" value="category" <?php checked('category', $ngg->options['appendType']); ?> /> <?php _e('Categories', 'nggallery') ;?></label><br />
|
282 |
<label><input name="appendType" type="radio" value="tags" <?php checked('tags', $ngg->options['appendType']); ?> /> <?php _e('Tags', 'nggallery') ;?></label>
|
283 |
</td>
|
284 |
</tr>
|
285 |
<tr>
|
286 |
+
<th valign="top"><?php _e('Max. number of images','nggallery'); ?></th>
|
287 |
<td><input type="text" name="maxImages" value="<?php echo $ngg->options['maxImages']; ?>" size="3" maxlength="3" />
|
288 |
<span class="setting-description"><?php _e('0 will show all images','nggallery'); ?></span>
|
289 |
</td>
|
384 |
<input type="hidden" name="page_options" value="galNoPages,galImages,galColumns,galShowSlide,galTextSlide,galTextGallery,galShowOrder,galImgBrowser,galSort,galSortDir,galHiddenImg,galAjaxNav" />
|
385 |
<table class="form-table ngg-options">
|
386 |
<tr class="expert" >
|
387 |
+
<th valign="top"><?php _e('Deactivate gallery page link','nggallery') ?></th>
|
388 |
<td><input name="galNoPages" type="checkbox" value="1" <?php checked('1', $ngg->options['galNoPages']); ?> />
|
389 |
<?php _e('The album will not link to a gallery subpage. The gallery is shown on the same page.','nggallery') ?>
|
390 |
</td>
|
391 |
</tr>
|
392 |
<tr>
|
393 |
+
<th valign="top"><?php _e('Number of images per page','nggallery') ?></th>
|
394 |
<td><input type="text" name="galImages" value="<?php echo $ngg->options['galImages']; ?>" size="3" maxlength="3" />
|
395 |
<span class="setting-description"><?php _e('0 will disable pagination, all images on one page','nggallery') ?></span>
|
396 |
</td>
|
397 |
</tr>
|
398 |
<tr>
|
399 |
+
<th valign="top"><?php _e('Number of columns','nggallery'); ?></th>
|
400 |
<td><input type="text" name="galColumns" value="<?php echo $ngg->options['galColumns']; ?>" size="3" maxlength="3" />
|
401 |
<span class="setting-description"><?php _e('0 will display as much as possible based on the width of your theme. Setting normally only required for captions below the images','nggallery') ?></span>
|
402 |
</td>
|
403 |
</tr>
|
404 |
<tr>
|
405 |
+
<th valign="top"><?php _e('Integrate slideshow','nggallery'); ?></th>
|
406 |
<td><input name="galShowSlide" type="checkbox" value="1" <?php checked('1', $ngg->options['galShowSlide']); ?> />
|
407 |
<input type="text" name="galTextSlide" value="<?php echo $ngg->options['galTextSlide'] ?>" size="20" />
|
408 |
<input type="text" name="galTextGallery" value="<?php echo $ngg->options['galTextGallery'] ?>" size="20" />
|
409 |
</td>
|
410 |
</tr>
|
411 |
<tr class="expert" >
|
412 |
+
<th valign="top"><?php _e('Show first','nggallery'); ?></th>
|
413 |
<td><label><input name="galShowOrder" type="radio" value="gallery" <?php checked('gallery', $ngg->options['galShowOrder']); ?> /> <?php _e('Thumbnails', 'nggallery') ;?></label><br />
|
414 |
<label><input name="galShowOrder" type="radio" value="slide" <?php checked('slide', $ngg->options['galShowOrder']); ?> /> <?php _e('Slideshow', 'nggallery') ;?></label>
|
415 |
</td>
|
416 |
</tr>
|
417 |
<tr class="expert" >
|
418 |
+
<th valign="top"><?php _e('Show ImageBrowser','nggallery'); ?></th>
|
419 |
<td><input name="galImgBrowser" type="checkbox" value="1" <?php checked('1', $ngg->options['galImgBrowser']); ?> />
|
420 |
<?php _e('The gallery will open the ImageBrowser instead the effect.', 'nggallery'); ?>
|
421 |
</td>
|
422 |
</tr>
|
423 |
<tr class="expert" >
|
424 |
+
<th valign="top"><?php _e('Add hidden images','nggallery'); ?></th>
|
425 |
<td><input name="galHiddenImg" type="checkbox" value="1" <?php checked('1', $ngg->options['galHiddenImg']); ?> />
|
426 |
+
<?php _e('If pagination is used, this option will still show all images in the modal window (Thickbox, Lightbox etc.). Note : This increases the page load','nggallery'); ?>
|
427 |
</td>
|
428 |
</tr>
|
429 |
<tr class="expert" >
|
430 |
+
<th valign="top"><?php _e('Enable AJAX pagination','nggallery'); ?></th>
|
431 |
<td><input name="galAjaxNav" type="checkbox" value="1" <?php checked('1', $ngg->options['galAjaxNav']); ?> />
|
432 |
+
<?php _e('Browse images without reload the page. Note : Works only in combination with Shutter effect','nggallery'); ?>
|
433 |
</td>
|
434 |
</tr>
|
435 |
</table>
|
436 |
<h3 class="expert" ><?php _e('Sort options','nggallery') ?></h3>
|
437 |
<table class="expert form-table ngg-options">
|
438 |
<tr>
|
439 |
+
<th valign="top"><?php _e('Sort thumbnails','nggallery') ?></th>
|
440 |
<td>
|
441 |
<label><input name="galSort" type="radio" value="sortorder" <?php checked('sortorder', $ngg->options['galSort']); ?> /> <?php _e('Custom order', 'nggallery') ;?></label><br />
|
442 |
<label><input name="galSort" type="radio" value="pid" <?php checked('pid', $ngg->options['galSort']); ?> /> <?php _e('Image ID', 'nggallery') ;?></label><br />
|
446 |
</td>
|
447 |
</tr>
|
448 |
<tr>
|
449 |
+
<th valign="top"><?php _e('Sort direction','nggallery') ?></th>
|
450 |
<td><label><input name="galSortDir" type="radio" value="ASC" <?php checked('ASC', $ngg->options['galSortDir']); ?> /> <?php _e('Ascending', 'nggallery') ;?></label><br />
|
451 |
<label><input name="galSortDir" type="radio" value="DESC" <?php checked('DESC', $ngg->options['galSortDir']); ?> /> <?php _e('Descending', 'nggallery') ;?></label>
|
452 |
</td>
|
470 |
<?php _e('With the placeholder','nggallery'); ?><strong> %GALLERY_NAME% </strong> <?php _e('you can activate a navigation through the images (depend on the effect). Change the code line only , when you use a different thumbnail effect or you know what you do.','nggallery'); ?></p>
|
471 |
<table class="form-table ngg-options">
|
472 |
<tr valign="top">
|
473 |
+
<th><?php _e('JavaScript Thumbnail effect','nggallery') ?></th>
|
474 |
<td>
|
475 |
<select size="1" id="thumbEffect" name="thumbEffect" onchange="insertcode(this.value)">
|
476 |
<option value="none" <?php selected('none', $ngg->options['thumbEffect']); ?> ><?php _e('None', 'nggallery') ;?></option>
|
483 |
</td>
|
484 |
</tr>
|
485 |
<tr class="expert" valign="top">
|
486 |
+
<th><?php _e('Link Code line','nggallery') ?></th>
|
487 |
<td><textarea id="thumbCode" name="thumbCode" cols="50" rows="5"><?php echo htmlspecialchars(stripslashes($ngg->options['thumbCode'])); ?></textarea></td>
|
488 |
</tr>
|
489 |
</table>
|
500 |
|
501 |
// take the first image as sample
|
502 |
$imageID = $wpdb->get_var("SELECT MIN(pid) FROM $wpdb->nggpictures");
|
503 |
+
$imageURL = ($imageID) ? $imageURL = '<img src="'. home_url() . '/' . 'index.php?callback=image&pid=' . intval ($imageID) . '&mode=watermark&width=300&height=250" />' : '';
|
504 |
|
505 |
?>
|
506 |
<!-- Watermark settings -->
|
556 |
<h3><label><input type="radio" name="wmType" value="image" <?php checked('image', $ngg->options['wmType']); ?> /> <?php _e('Use image as watermark','nggallery') ?></label></h3>
|
557 |
<table class="wm-table form-table">
|
558 |
<tr>
|
559 |
+
<th><?php _e('URL to file','nggallery') ?></th>
|
560 |
<td><input type="text" size="40" name="wmPath" value="<?php echo $ngg->options['wmPath']; ?>" /><br />
|
561 |
<?php if(!ini_get('allow_url_fopen')) _e('The accessing of URL files is disabled at your server (allow_url_fopen)','nggallery') ?> </td>
|
562 |
</tr>
|
564 |
<h3><label><input type="radio" name="wmType" value="text" <?php checked('text', $ngg->options['wmType']); ?> /> <?php _e('Use text as watermark','nggallery') ?></label></h3>
|
565 |
<table class="wm-table form-table">
|
566 |
<tr>
|
567 |
+
<th><?php _e('Font','nggallery') ?></th>
|
568 |
<td><select name="wmFont" size="1"> <?php
|
569 |
$fontlist = ngg_get_TTFfont();
|
570 |
foreach ( $fontlist as $fontfile ) {
|
580 |
</td>
|
581 |
</tr>
|
582 |
<tr>
|
583 |
+
<th><?php _e('Size','nggallery') ?></th>
|
584 |
<td><input type="text" name="wmSize" value="<?php echo $ngg->options['wmSize']; ?>" size="4" maxlength="2" /> px</td>
|
585 |
</tr>
|
586 |
<tr>
|
587 |
+
<th><?php _e('Color','nggallery') ?></th>
|
588 |
<td><input class="picker" type="text" size="6" maxlength="6" id="wmColor" name="wmColor" onchange="setcolor('#previewText', this.value)" value="<?php echo $ngg->options['wmColor'] ?>" />
|
589 |
<input type="text" size="1" readonly="readonly" id="previewText" style="background-color: #<?php echo $ngg->options['wmColor']; ?>" /> <?php _e('(hex w/o #)','nggallery') ?></td>
|
590 |
</tr>
|
591 |
<tr>
|
592 |
+
<th valign="top"><?php _e('Text','nggallery') ?></th>
|
593 |
<td><textarea name="wmText" cols="40" rows="4"><?php echo $ngg->options['wmText'] ?></textarea></td>
|
594 |
</tr>
|
595 |
<tr>
|
596 |
+
<th><?php _e('Opaque','nggallery') ?></th>
|
597 |
<td><input type="text" name="wmOpaque" value="<?php echo $ngg->options['wmOpaque'] ?>" size="3" maxlength="3" /> % </td>
|
598 |
</tr>
|
599 |
</table>
|
614 |
<h2><?php _e('Slideshow','nggallery'); ?></h2>
|
615 |
<table class="form-table ngg-options">
|
616 |
<tr>
|
617 |
+
<th><?php _e('Default size (W x H)','nggallery') ?></th>
|
618 |
<td><input type="text" size="3" maxlength="4" name="irWidth" value="<?php echo $ngg->options['irWidth']; ?>" /> x
|
619 |
<input type="text" size="3" maxlength="4" name="irHeight" value="<?php echo $ngg->options['irHeight']; ?>" /></td>
|
620 |
</tr>
|
621 |
<tr>
|
622 |
+
<th><?php _e('Duration time','nggallery') ?></th>
|
623 |
<td><input type="text" size="3" maxlength="3" name="irRotatetime" value="<?php echo $ngg->options['irRotatetime'] ?>" /> <?php _e('sec.', 'nggallery') ;?></td>
|
624 |
</tr>
|
625 |
<tr>
|
626 |
+
<th><?php _e('Transition / Fade effect','nggallery') ?></th>
|
627 |
<td>
|
628 |
<select size="1" name="slideFx">
|
629 |
<option value="fade" <?php selected('fade', $ngg->options['slideFx']); ?> ><?php _e('fade', 'nggallery') ;?></option>
|
653 |
<?php }?>
|
654 |
<table class="expert form-table ngg-options">
|
655 |
<tr>
|
656 |
+
<th><?php _e('Enable flash slideshow','nggallery') ?></th>
|
657 |
<td><input name="enableIR" type="checkbox" value="1" <?php checked('1', $ngg->options['enableIR']); ?> />
|
658 |
+
<span class="setting-description"><?php _e('Integrate the flash based slideshow for all flash supported devices','nggallery') ?></span></td>
|
659 |
</tr>
|
660 |
<tr>
|
661 |
+
<th><?php _e('Path to the Imagerotator (URL)','nggallery') ?></th>
|
662 |
<td>
|
663 |
<input type="text" size="50" id="irURL" name="irURL" value="<?php echo $ngg->options['irURL']; ?>" />
|
664 |
<input type="submit" name="irDetect" class="button-secondary" value="<?php _e('Search now','nggallery') ;?> »"/>
|
665 |
+
<br /><span class="setting-description"><?php _e('Press the button to search automatically for the imagerotator, if you uploaded it to wp-content/uploads or a subfolder','nggallery') ?></span>
|
666 |
</td>
|
667 |
</tr>
|
668 |
<tr>
|
669 |
+
<th><?php _e('Shuffle mode','nggallery') ?></th>
|
670 |
<td><input name="irShuffle" type="checkbox" value="1" <?php checked('1', $ngg->options['irShuffle']); ?> /></td>
|
671 |
</tr>
|
672 |
<tr class="expert">
|
673 |
+
<th><?php _e('Show next image on click','nggallery') ?></th>
|
674 |
<td><input name="irLinkfromdisplay" type="checkbox" value="1" <?php checked('1', $ngg->options['irLinkfromdisplay']); ?> /></td>
|
675 |
</tr>
|
676 |
<tr class="expert">
|
677 |
+
<th><?php _e('Show navigation bar','nggallery') ?></th>
|
678 |
<td><input name="irShownavigation" type="checkbox" value="1" <?php checked('1', $ngg->options['irShownavigation']); ?> /></td>
|
679 |
</tr>
|
680 |
<tr class="expert">
|
681 |
+
<th><?php _e('Show loading icon','nggallery') ?></th>
|
682 |
<td><input name="irShowicons" type="checkbox" value="1" <?php checked('1', $ngg->options['irShowicons']); ?> /></td>
|
683 |
</tr>
|
684 |
<tr class="expert">
|
685 |
+
<th><?php _e('Use watermark logo','nggallery') ?></th>
|
686 |
<td><input name="irWatermark" type="checkbox" value="1" <?php checked('1', $ngg->options['irWatermark']); ?> />
|
687 |
<span class="setting-description"><?php _e('You can change the logo at the watermark settings','nggallery') ?></span></td>
|
688 |
</tr>
|
689 |
<tr class="expert">
|
690 |
+
<th><?php _e('Stretch image','nggallery') ?></th>
|
691 |
<td>
|
692 |
<select size="1" name="irOverstretch">
|
693 |
<option value="true" <?php selected('true', $ngg->options['irOverstretch']); ?> ><?php _e('true', 'nggallery') ;?></option>
|
698 |
</td>
|
699 |
</tr>
|
700 |
<tr>
|
701 |
+
<th><?php _e('Transition / Fade effect','nggallery') ?></th>
|
702 |
<td>
|
703 |
<select size="1" name="irTransition">
|
704 |
<option value="fade" <?php selected('fade', $ngg->options['irTransition']); ?> ><?php _e('fade', 'nggallery') ;?></option>
|
715 |
</td>
|
716 |
</tr>
|
717 |
<tr class="expert">
|
718 |
+
<th><?php _e('Use slow zooming effect','nggallery') ?></th>
|
719 |
<td><input name="irKenburns" type="checkbox" value="1" <?php checked('1', $ngg->options['irKenburns']); ?> /></td>
|
720 |
</tr>
|
721 |
<tr>
|
722 |
+
<th><?php _e('Background Color','nggallery') ?></th>
|
723 |
<td><input class="picker" type="text" size="6" maxlength="6" id="irBackcolor" name="irBackcolor" onchange="setcolor('#previewBack', this.value)" value="<?php echo $ngg->options['irBackcolor'] ?>" />
|
724 |
<input type="text" size="1" readonly="readonly" id="previewBack" style="background-color: #<?php echo $ngg->options['irBackcolor'] ?>" /></td>
|
725 |
</tr>
|
726 |
<tr>
|
727 |
+
<th><?php _e('Texts / Buttons Color','nggallery') ?></th>
|
728 |
<td><input class="picker" type="text" size="6" maxlength="6" id="irFrontcolor" name="irFrontcolor" onchange="setcolor('#previewFront', this.value)" value="<?php echo $ngg->options['irFrontcolor'] ?>" />
|
729 |
<input type="text" size="1" readonly="readonly" id="previewFront" style="background-color: #<?php echo $ngg->options['irFrontcolor'] ?>" /></td>
|
730 |
</tr>
|
731 |
<tr class="expert">
|
732 |
+
<th><?php _e('Rollover / Active Color','nggallery') ?></th>
|
733 |
<td><input class="picker" type="text" size="6" maxlength="6" id="irLightcolor" name="irLightcolor" onchange="setcolor('#previewLight', this.value)" value="<?php echo $ngg->options['irLightcolor'] ?>" />
|
734 |
<input type="text" size="1" readonly="readonly" id="previewLight" style="background-color: #<?php echo $ngg->options['irLightcolor'] ?>" /></td>
|
735 |
</tr>
|
736 |
<tr class="expert">
|
737 |
+
<th><?php _e('Screen Color','nggallery') ?></th>
|
738 |
<td><input class="picker" type="text" size="6" maxlength="6" id="irScreencolor" name="irScreencolor" onchange="setcolor('#previewScreen', this.value)" value="<?php echo $ngg->options['irScreencolor'] ?>" />
|
739 |
<input type="text" size="1" readonly="readonly" id="previewScreen" style="background-color: #<?php echo $ngg->options['irScreencolor'] ?>" /></td>
|
740 |
</tr>
|
741 |
<tr class="expert">
|
742 |
+
<th><?php _e('Background music (URL)','nggallery') ?></th>
|
743 |
<td><input type="text" size="50" id="irAudio" name="irAudio" value="<?php echo $ngg->options['irAudio'] ?>" /></td>
|
744 |
</tr>
|
745 |
<tr class="expert">
|
746 |
+
<th ><?php _e('Try XHTML validation (with CDATA)','nggallery') ?></th>
|
747 |
<td><input name="irXHTMLvalid" type="checkbox" value="1" <?php checked('1', $ngg->options['irXHTMLvalid']); ?> />
|
748 |
<span class="setting-description"><?php _e('Important : Could causes problem at some browser. Please recheck your page.','nggallery') ?></span></td>
|
749 |
</tr>
|
admin/tinymce/editor_plugin.js
CHANGED
@@ -18,7 +18,8 @@
|
|
18 |
|
19 |
ed.addCommand('mceNextGEN', function() {
|
20 |
ed.windowManager.open({
|
21 |
-
|
|
|
22 |
width : 360 + ed.getLang('NextGEN.delta_width', 0),
|
23 |
height : 210 + ed.getLang('NextGEN.delta_height', 0),
|
24 |
inline : 1
|
@@ -73,6 +74,4 @@
|
|
73 |
|
74 |
// Register plugin
|
75 |
tinymce.PluginManager.add('NextGEN', tinymce.plugins.NextGEN);
|
76 |
-
})();
|
77 |
-
|
78 |
-
|
18 |
|
19 |
ed.addCommand('mceNextGEN', function() {
|
20 |
ed.windowManager.open({
|
21 |
+
// call content via admin-ajax, no need to know the full plugin path
|
22 |
+
file : ajaxurl + '?action=ngg_tinymce',
|
23 |
width : 360 + ed.getLang('NextGEN.delta_width', 0),
|
24 |
height : 210 + ed.getLang('NextGEN.delta_height', 0),
|
25 |
inline : 1
|
74 |
|
75 |
// Register plugin
|
76 |
tinymce.PluginManager.add('NextGEN', tinymce.plugins.NextGEN);
|
77 |
+
})();
|
|
|
|
admin/tinymce/tinymce.php
CHANGED
@@ -12,7 +12,7 @@ class add_nextgen_button {
|
|
12 |
|
13 |
var $pluginname = 'NextGEN';
|
14 |
var $path = '';
|
15 |
-
var $internalVersion =
|
16 |
|
17 |
/**
|
18 |
* add_nextgen_button::add_nextgen_button()
|
12 |
|
13 |
var $pluginname = 'NextGEN';
|
14 |
var $path = '';
|
15 |
+
var $internalVersion = 200;
|
16 |
|
17 |
/**
|
18 |
* add_nextgen_button::add_nextgen_button()
|
admin/tinymce/window.php
CHANGED
@@ -1,16 +1,12 @@
|
|
1 |
<?php
|
2 |
|
3 |
-
|
4 |
-
|
5 |
-
|
6 |
-
// check for rights
|
7 |
-
if ( !current_user_can('edit_pages') && !current_user_can('edit_posts') )
|
8 |
-
wp_die(__("You are not allowed to be here"));
|
9 |
-
|
10 |
global $wpdb, $nggdb;
|
11 |
|
|
|
12 |
?>
|
13 |
-
|
14 |
<html xmlns="http://www.w3.org/1999/xhtml">
|
15 |
<head>
|
16 |
<title>NextGEN Gallery</title>
|
@@ -18,9 +14,26 @@ global $wpdb, $nggdb;
|
|
18 |
<script language="javascript" type="text/javascript" src="<?php echo site_url(); ?>/wp-includes/js/tinymce/tiny_mce_popup.js"></script>
|
19 |
<script language="javascript" type="text/javascript" src="<?php echo site_url(); ?>/wp-includes/js/tinymce/utils/mctabs.js"></script>
|
20 |
<script language="javascript" type="text/javascript" src="<?php echo site_url(); ?>/wp-includes/js/tinymce/utils/form_utils.js"></script>
|
|
|
|
|
|
|
21 |
<script language="javascript" type="text/javascript" src="<?php echo NGGALLERY_URLPATH ?>admin/tinymce/tinymce.js"></script>
|
22 |
-
|
|
|
23 |
</head>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
24 |
<body id="link" onload="tinyMCEPopup.executeOnLoad('init();');document.body.style.display='';document.getElementById('gallerytag').focus();" style="display: none">
|
25 |
<!-- <form onsubmit="insertLink();return false;" action="#"> -->
|
26 |
<form name="NextGEN" action="#">
|
@@ -38,19 +51,11 @@ global $wpdb, $nggdb;
|
|
38 |
<br />
|
39 |
<table border="0" cellpadding="4" cellspacing="0">
|
40 |
<tr>
|
41 |
-
<td nowrap="nowrap"><label for="gallerytag"><?php _e("
|
42 |
<td><select id="gallerytag" name="gallerytag" style="width: 200px">
|
43 |
-
<option value="0"><?php _e("
|
44 |
-
|
45 |
-
|
46 |
-
if(is_array($gallerylist)) {
|
47 |
-
foreach($gallerylist as $gallery) {
|
48 |
-
$name = ( empty($gallery->title) ) ? $gallery->name : $gallery->title;
|
49 |
-
echo '<option value="' . $gallery->gid . '" >' . $gallery->gid . ' - ' . $name . '</option>' . "\n";
|
50 |
-
}
|
51 |
-
}
|
52 |
-
?>
|
53 |
-
</select></td>
|
54 |
</tr>
|
55 |
<tr>
|
56 |
<td nowrap="nowrap" valign="top"><label for="showtype"><?php _e("Show as", 'nggallery'); ?></label></td>
|
@@ -67,18 +72,11 @@ global $wpdb, $nggdb;
|
|
67 |
<br />
|
68 |
<table border="0" cellpadding="4" cellspacing="0">
|
69 |
<tr>
|
70 |
-
<td nowrap="nowrap"><label for="albumtag"><?php _e("
|
71 |
<td><select id="albumtag" name="albumtag" style="width: 200px">
|
72 |
-
|
73 |
-
|
74 |
-
|
75 |
-
if(is_array($albumlist)) {
|
76 |
-
foreach($albumlist as $album) {
|
77 |
-
echo '<option value="' . $album->id . '" >' . $album->id . ' - ' . $album->name . '</option>'."\n";
|
78 |
-
}
|
79 |
-
}
|
80 |
-
?>
|
81 |
-
</select></td>
|
82 |
</tr>
|
83 |
<tr>
|
84 |
<td nowrap="nowrap" valign="top"><label for="showtype"><?php _e("Show as", 'nggallery'); ?></label></td>
|
@@ -94,18 +92,11 @@ global $wpdb, $nggdb;
|
|
94 |
<br />
|
95 |
<table border="0" cellpadding="4" cellspacing="0">
|
96 |
<tr>
|
97 |
-
<td nowrap="nowrap"><label for="singlepictag"><?php _e("
|
98 |
<td><select id="singlepictag" name="singlepictag" style="width: 200px">
|
99 |
-
<option value="0"><?php _e("
|
100 |
-
|
101 |
-
|
102 |
-
if(is_array($picturelist)) {
|
103 |
-
foreach($picturelist as $picture) {
|
104 |
-
echo '<option value="' . $picture->pid . '" >'. $picture->pid . ' - ' . $picture->filename.'</option>'."\n";
|
105 |
-
}
|
106 |
-
}
|
107 |
-
?>
|
108 |
-
</select></td>
|
109 |
</tr>
|
110 |
<tr>
|
111 |
<td nowrap="nowrap"><?php _e("Width x Height", 'nggallery'); ?></td>
|
@@ -149,4 +140,4 @@ global $wpdb, $nggdb;
|
|
149 |
</div>
|
150 |
</form>
|
151 |
</body>
|
152 |
-
</html>
|
1 |
<?php
|
2 |
|
3 |
+
if ( !defined('ABSPATH') )
|
4 |
+
die('You are not allowed to call this page directly.');
|
5 |
+
|
|
|
|
|
|
|
|
|
6 |
global $wpdb, $nggdb;
|
7 |
|
8 |
+
@header('Content-Type: ' . get_option('html_type') . '; charset=' . get_option('blog_charset'));
|
9 |
?>
|
|
|
10 |
<html xmlns="http://www.w3.org/1999/xhtml">
|
11 |
<head>
|
12 |
<title>NextGEN Gallery</title>
|
14 |
<script language="javascript" type="text/javascript" src="<?php echo site_url(); ?>/wp-includes/js/tinymce/tiny_mce_popup.js"></script>
|
15 |
<script language="javascript" type="text/javascript" src="<?php echo site_url(); ?>/wp-includes/js/tinymce/utils/mctabs.js"></script>
|
16 |
<script language="javascript" type="text/javascript" src="<?php echo site_url(); ?>/wp-includes/js/tinymce/utils/form_utils.js"></script>
|
17 |
+
<script language="javascript" type="text/javascript" src="<?php echo site_url(); ?>/wp-includes/js/jquery/jquery.js"></script>
|
18 |
+
<script language="javascript" type="text/javascript" src="<?php echo NGGALLERY_URLPATH ?>admin/js/jquery-ui-1.8.6.min.js"></script>
|
19 |
+
<script language="javascript" type="text/javascript" src="<?php echo NGGALLERY_URLPATH ?>admin/js/ngg.autocomplete.js"></script>
|
20 |
<script language="javascript" type="text/javascript" src="<?php echo NGGALLERY_URLPATH ?>admin/tinymce/tinymce.js"></script>
|
21 |
+
<link rel="stylesheet" type="text/css" href="<?php echo NGGALLERY_URLPATH ?>admin/css/jquery.ui.css" media="all" />
|
22 |
+
<base target="_self" />
|
23 |
</head>
|
24 |
+
<script type="text/javascript">
|
25 |
+
jQuery(document).ready(function(){
|
26 |
+
jQuery("#gallerytag").nggAutocomplete( {
|
27 |
+
type: 'gallery',domain: "<?php echo site_url(); ?>/"
|
28 |
+
});
|
29 |
+
jQuery("#albumtag").nggAutocomplete( {
|
30 |
+
type: 'album',domain: "<?php echo site_url(); ?>/"
|
31 |
+
});
|
32 |
+
jQuery("#singlepictag").nggAutocomplete( {
|
33 |
+
type: 'image',domain: "<?php echo site_url(); ?>/"
|
34 |
+
});
|
35 |
+
});
|
36 |
+
</script>
|
37 |
<body id="link" onload="tinyMCEPopup.executeOnLoad('init();');document.body.style.display='';document.getElementById('gallerytag').focus();" style="display: none">
|
38 |
<!-- <form onsubmit="insertLink();return false;" action="#"> -->
|
39 |
<form name="NextGEN" action="#">
|
51 |
<br />
|
52 |
<table border="0" cellpadding="4" cellspacing="0">
|
53 |
<tr>
|
54 |
+
<td nowrap="nowrap"><label for="gallerytag"><?php _e("Gallery", 'nggallery'); ?></label></td>
|
55 |
<td><select id="gallerytag" name="gallerytag" style="width: 200px">
|
56 |
+
<option value="0" selected="selected"><?php _e("Select or enter gallery", 'nggallery'); ?></option>
|
57 |
+
</select>
|
58 |
+
</td>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
59 |
</tr>
|
60 |
<tr>
|
61 |
<td nowrap="nowrap" valign="top"><label for="showtype"><?php _e("Show as", 'nggallery'); ?></label></td>
|
72 |
<br />
|
73 |
<table border="0" cellpadding="4" cellspacing="0">
|
74 |
<tr>
|
75 |
+
<td nowrap="nowrap"><label for="albumtag"><?php _e("Album", 'nggallery'); ?></label></td>
|
76 |
<td><select id="albumtag" name="albumtag" style="width: 200px">
|
77 |
+
<option value="0" selected="selected"><?php _e("Select or enter album", 'nggallery'); ?></option>
|
78 |
+
</select>
|
79 |
+
</td>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
80 |
</tr>
|
81 |
<tr>
|
82 |
<td nowrap="nowrap" valign="top"><label for="showtype"><?php _e("Show as", 'nggallery'); ?></label></td>
|
92 |
<br />
|
93 |
<table border="0" cellpadding="4" cellspacing="0">
|
94 |
<tr>
|
95 |
+
<td nowrap="nowrap"><label for="singlepictag"><?php _e("Picture", 'nggallery'); ?></label></td>
|
96 |
<td><select id="singlepictag" name="singlepictag" style="width: 200px">
|
97 |
+
<option value="0" selected="selected"><?php _e("Select or enter picture", 'nggallery'); ?></option>
|
98 |
+
</select>
|
99 |
+
</td>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
100 |
</tr>
|
101 |
<tr>
|
102 |
<td nowrap="nowrap"><?php _e("Width x Height", 'nggallery'); ?></td>
|
140 |
</div>
|
141 |
</form>
|
142 |
</body>
|
143 |
+
</html>
|
admin/upgrade.php
CHANGED
@@ -1,7 +1,4 @@
|
|
1 |
<?php
|
2 |
-
|
3 |
-
if(preg_match('#' . basename(__FILE__) . '#', $_SERVER['PHP_SELF'])) { die('You are not allowed to call this page directly.'); }
|
4 |
-
|
5 |
/**
|
6 |
* ngg_upgrade() - update routine for older version
|
7 |
*
|
@@ -14,11 +11,13 @@ function ngg_upgrade() {
|
|
14 |
// get the current user ID
|
15 |
get_currentuserinfo();
|
16 |
|
17 |
-
// in multisite environment the pointer $wpdb->nggpictures
|
18 |
-
|
|
|
|
|
19 |
|
20 |
-
// Be sure that the tables exist
|
21 |
-
if( $wpdb->get_var("
|
22 |
|
23 |
echo __('Upgrade database structure...', 'nggallery');
|
24 |
$wpdb->show_errors();
|
@@ -95,6 +94,14 @@ function ngg_upgrade() {
|
|
95 |
// add link from album to a page
|
96 |
ngg_maybe_add_column( $wpdb->nggalbum, 'pageid', "BIGINT(20) DEFAULT '0' NOT NULL AFTER sortorder");
|
97 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
98 |
|
99 |
// update now the database
|
100 |
update_option( "ngg_db_version", NGG_DBVERSION );
|
@@ -161,6 +168,19 @@ function ngg_upgrade() {
|
|
161 |
echo __('Updated options.', 'nggallery');
|
162 |
}
|
163 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
164 |
return;
|
165 |
}
|
166 |
|
@@ -346,9 +366,111 @@ function nggallery_start_upgrade($filepath) {
|
|
346 |
<div class="wrap">
|
347 |
<h2><?php _e('Upgrade NextGEN Gallery', 'nggallery') ;?></h2>
|
348 |
<p><?php ngg_upgrade();?></p>
|
349 |
-
<p><?php _e('Upgrade finished...', 'nggallery') ;?></p>
|
350 |
-
<h3><a href="<?php echo $filepath;?>"><?php _e('Continue', 'nggallery'); ?>...</a></h3>
|
351 |
</div>
|
352 |
<?php
|
353 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
354 |
?>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
<?php
|
|
|
|
|
|
|
2 |
/**
|
3 |
* ngg_upgrade() - update routine for older version
|
4 |
*
|
11 |
// get the current user ID
|
12 |
get_currentuserinfo();
|
13 |
|
14 |
+
// in multisite environment the pointer $wpdb->nggpictures need to be set again
|
15 |
+
$wpdb->nggpictures = $wpdb->prefix . 'ngg_pictures';
|
16 |
+
$wpdb->nggallery = $wpdb->prefix . 'ngg_gallery';
|
17 |
+
$wpdb->nggalbum = $wpdb->prefix . 'ngg_album';
|
18 |
|
19 |
+
// Be sure that the tables exist, avoid case sensitive : http://dev.mysql.com/doc/refman/5.1/en/identifier-case-sensitivity.html
|
20 |
+
if( $wpdb->get_var( "SHOW TABLES LIKE '$wpdb->nggpictures'" ) ) {
|
21 |
|
22 |
echo __('Upgrade database structure...', 'nggallery');
|
23 |
$wpdb->show_errors();
|
94 |
// add link from album to a page
|
95 |
ngg_maybe_add_column( $wpdb->nggalbum, 'pageid', "BIGINT(20) DEFAULT '0' NOT NULL AFTER sortorder");
|
96 |
}
|
97 |
+
|
98 |
+
// v1.4.0 -> v1.7.0
|
99 |
+
if (version_compare($installed_ver, '1.7.0', '<')) {
|
100 |
+
// add slug fields
|
101 |
+
ngg_maybe_add_column( $wpdb->nggpictures, 'image_slug', "VARCHAR(255) NOT NULL AFTER pid");
|
102 |
+
ngg_maybe_add_column( $wpdb->nggalbum, 'slug', "VARCHAR(255) NOT NULL AFTER name");
|
103 |
+
ngg_maybe_add_column( $wpdb->nggallery, 'slug', "VARCHAR(255) NOT NULL AFTER name");
|
104 |
+
}
|
105 |
|
106 |
// update now the database
|
107 |
update_option( "ngg_db_version", NGG_DBVERSION );
|
168 |
echo __('Updated options.', 'nggallery');
|
169 |
}
|
170 |
|
171 |
+
if (version_compare($installed_ver, '1.7.0', '<')) {
|
172 |
+
// Network blogs need to call this manually
|
173 |
+
if ( !is_multisite() ) {
|
174 |
+
?>
|
175 |
+
<h2><?php _e('Create unique slug', 'nggallery') ;?></h2>
|
176 |
+
<p><?php _e('One of the upcomming features are a reworked permalinks structure.', 'nggallery') ;?>
|
177 |
+
<?php _e('Therefore it\'s needed to have a unique identifier for each image, gallery and album.', 'nggallery'); ?><br />
|
178 |
+
<?php _e('Depend on the amount of database entries this will take a while, don\'t reload this page.', 'nggallery') ;?></p>
|
179 |
+
<?php
|
180 |
+
ngg_rebuild_unique_slugs::init();
|
181 |
+
}
|
182 |
+
|
183 |
+
}
|
184 |
return;
|
185 |
}
|
186 |
|
366 |
<div class="wrap">
|
367 |
<h2><?php _e('Upgrade NextGEN Gallery', 'nggallery') ;?></h2>
|
368 |
<p><?php ngg_upgrade();?></p>
|
369 |
+
<p class="finished"><?php _e('Upgrade finished...', 'nggallery') ;?></p>
|
370 |
+
<h3><a class="finished" href="<?php echo $filepath;?>"><?php _e('Continue', 'nggallery'); ?>...</a></h3>
|
371 |
</div>
|
372 |
<?php
|
373 |
+
}
|
374 |
+
|
375 |
+
/**
|
376 |
+
* Rebuild slugs for albums, galleries and images via AJAX request
|
377 |
+
*
|
378 |
+
* @sine 1.7.0
|
379 |
+
* @access internal
|
380 |
+
*/
|
381 |
+
class ngg_rebuild_unique_slugs {
|
382 |
+
|
383 |
+
static function init() {
|
384 |
+
self::start_rebuild();
|
385 |
+
}
|
386 |
+
|
387 |
+
static function start_rebuild() {
|
388 |
+
global $wpdb;
|
389 |
+
|
390 |
+
$total = array();
|
391 |
+
// get the total number of images
|
392 |
+
$total['images'] = intval( $wpdb->get_var("SELECT COUNT(*) FROM $wpdb->nggpictures") );
|
393 |
+
$total['gallery'] = intval( $wpdb->get_var("SELECT COUNT(*) FROM $wpdb->nggallery") );
|
394 |
+
$total['album'] = intval( $wpdb->get_var("SELECT COUNT(*) FROM $wpdb->nggalbum") );
|
395 |
+
|
396 |
+
$messages = array(
|
397 |
+
'images' => __( 'Rebuild image structure : %s / %s images', 'nggallery' ),
|
398 |
+
'gallery' => __( 'Rebuild gallery structure : %s / %s galleries', 'nggallery' ),
|
399 |
+
'album' => __( 'Rebuild album structure : %s / %s albums', 'nggallery' ),
|
400 |
+
);
|
401 |
+
|
402 |
?>
|
403 |
+
<?php
|
404 |
+
|
405 |
+
foreach ( array_keys( $messages ) as $key ) {
|
406 |
+
|
407 |
+
$message = sprintf( $messages[ $key ] ,
|
408 |
+
"<span class='ngg-count-current'>0</span>",
|
409 |
+
"<span class='ngg-count-total'>" . $total[ $key ] . "</span>"
|
410 |
+
);
|
411 |
+
|
412 |
+
echo "<div class='$key updated'><p class='ngg'>$message</p></div>";
|
413 |
+
}
|
414 |
+
|
415 |
+
$ajax_url = add_query_arg( 'action', 'ngg_rebuild_unique_slugs', admin_url( 'admin-ajax.php' ) );
|
416 |
+
?>
|
417 |
+
<script type="text/javascript">
|
418 |
+
jQuery(document).ready(function($) {
|
419 |
+
var ajax_url = '<?php echo $ajax_url; ?>',
|
420 |
+
_action = 'images',
|
421 |
+
images = <?php echo $total['images']; ?>,
|
422 |
+
gallery = <?php echo $total['gallery']; ?>,
|
423 |
+
album = <?php echo $total['album']; ?>,
|
424 |
+
total = 0,
|
425 |
+
offset = 0,
|
426 |
+
count = 50;
|
427 |
+
|
428 |
+
var $display = $('.ngg-count-current');
|
429 |
+
$('.finished, .gallery, .album').hide();
|
430 |
+
total = images;
|
431 |
+
|
432 |
+
function call_again() {
|
433 |
+
if ( offset > total ) {
|
434 |
+
offset = 0;
|
435 |
+
// 1st run finished
|
436 |
+
if (_action == 'images') {
|
437 |
+
_action = 'gallery';
|
438 |
+
total = gallery;
|
439 |
+
$('.images, .gallery').toggle();
|
440 |
+
$display.html(offset);
|
441 |
+
call_again();
|
442 |
+
return;
|
443 |
+
}
|
444 |
+
// 2nd run finished
|
445 |
+
if (_action == 'gallery') {
|
446 |
+
_action = 'album';
|
447 |
+
total = album;
|
448 |
+
$('.gallery, .album').toggle();
|
449 |
+
$display.html(offset);
|
450 |
+
call_again();
|
451 |
+
return;
|
452 |
+
}
|
453 |
+
// 3rd run finished, exit now
|
454 |
+
if (_action == 'album') {
|
455 |
+
$('.ngg')
|
456 |
+
.html('<?php _e( 'Done.', 'nggallery' ); ?>')
|
457 |
+
.parent('div').hide();
|
458 |
+
$('.finished').show();
|
459 |
+
return;
|
460 |
+
}
|
461 |
+
}
|
462 |
+
|
463 |
+
$.post(ajax_url, {'_action': _action, 'offset': offset}, function(response) {
|
464 |
+
$display.html(offset);
|
465 |
+
|
466 |
+
offset += count;
|
467 |
+
call_again();
|
468 |
+
});
|
469 |
+
}
|
470 |
+
|
471 |
+
call_again();
|
472 |
+
});
|
473 |
+
</script>
|
474 |
+
<?php
|
475 |
+
}
|
476 |
+
}
|
admin/upload.php
CHANGED
@@ -6,22 +6,17 @@
|
|
6 |
* @subpackage Administration
|
7 |
*/
|
8 |
|
9 |
-
define('WP_ADMIN', true);
|
10 |
-
|
11 |
// look up for the path
|
12 |
require_once( dirname( dirname(__FILE__) ) . '/ngg-config.php');
|
13 |
|
14 |
// Flash often fails to send cookies with the POST or upload, so we need to pass it in GET or POST instead
|
15 |
-
if (
|
16 |
-
|
17 |
-
|
18 |
-
|
19 |
-
|
20 |
-
|
21 |
-
|
22 |
-
$_COOKIE[AUTH_COOKIE] = $_REQUEST['auth_cookie'];
|
23 |
-
}
|
24 |
-
|
25 |
// don't ask me why, sometimes needed, taken from wp core
|
26 |
unset($current_user);
|
27 |
|
6 |
* @subpackage Administration
|
7 |
*/
|
8 |
|
|
|
|
|
9 |
// look up for the path
|
10 |
require_once( dirname( dirname(__FILE__) ) . '/ngg-config.php');
|
11 |
|
12 |
// Flash often fails to send cookies with the POST or upload, so we need to pass it in GET or POST instead
|
13 |
+
if ( is_ssl() && empty($_COOKIE[SECURE_AUTH_COOKIE]) && !empty($_REQUEST['auth_cookie']) )
|
14 |
+
$_COOKIE[SECURE_AUTH_COOKIE] = $_REQUEST['auth_cookie'];
|
15 |
+
elseif ( empty($_COOKIE[AUTH_COOKIE]) && !empty($_REQUEST['auth_cookie']) )
|
16 |
+
$_COOKIE[AUTH_COOKIE] = $_REQUEST['auth_cookie'];
|
17 |
+
if ( empty($_COOKIE[LOGGED_IN_COOKIE]) && !empty($_REQUEST['logged_in_cookie']) )
|
18 |
+
$_COOKIE[LOGGED_IN_COOKIE] = $_REQUEST['logged_in_cookie'];
|
19 |
+
|
|
|
|
|
|
|
20 |
// don't ask me why, sometimes needed, taken from wp core
|
21 |
unset($current_user);
|
22 |
|
admin/wpmu.php
CHANGED
@@ -7,11 +7,10 @@ if(preg_match('#' . basename(__FILE__) . '#', $_SERVER['PHP_SELF'])) { die('You
|
|
7 |
if ( !is_super_admin() )
|
8 |
die('You are not allowed to call this page.');
|
9 |
|
|
|
|
|
10 |
// get the options
|
11 |
$ngg_options = get_site_option('ngg_options');
|
12 |
-
|
13 |
-
// same as $_SERVER['REQUEST_URI'], but should work under IIS 6.0
|
14 |
-
$filepath = site_url( 'wp-admin/ms-admin.php?page=' . $_GET['page'], 'admin' );
|
15 |
|
16 |
if ( isset($_POST['updateoption']) ) {
|
17 |
check_admin_referer('ngg_wpmu_settings');
|
@@ -27,25 +26,50 @@ if(preg_match('#' . basename(__FILE__) . '#', $_SERVER['PHP_SELF'])) { die('You
|
|
27 |
}
|
28 |
}
|
29 |
|
|
|
|
|
30 |
update_site_option('ngg_options', $ngg_options);
|
|
|
31 |
$messagetext = __('Update successfully','nggallery');
|
32 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
33 |
|
34 |
// message windows
|
35 |
-
if(!empty($messagetext)) { echo '<!-- Last Action --><div id="message" class="updated fade"><p>'.$messagetext.'</p></div>'; }
|
36 |
|
37 |
?>
|
38 |
|
39 |
<div class="wrap">
|
40 |
-
<h2><?php _e('
|
41 |
<form name="generaloptions" method="post">
|
42 |
<?php wp_nonce_field('ngg_wpmu_settings') ?>
|
43 |
-
<input type="hidden" name="page_options" value="gallerypath,wpmuQuotaCheck,wpmuZipUpload,wpmuStyle,wpmuRoles,wpmuCSSfile" />
|
44 |
<table class="form-table">
|
45 |
<tr valign="top">
|
46 |
<th align="left"><?php _e('Gallery path','nggallery') ?></th>
|
47 |
-
<td><input type="text" size="50" name="gallerypath" value="<?php echo $ngg_options['gallerypath']; ?>"
|
48 |
-
<?php _e('This is the default path for all blogs. With the placeholder %BLOG_ID% you can organize the folder structure better.
|
|
|
|
|
49 |
</tr>
|
50 |
<tr>
|
51 |
<th valign="top"><?php _e('Enable upload quota check','nggallery') ?>:</th>
|
@@ -59,6 +83,12 @@ if(preg_match('#' . basename(__FILE__) . '#', $_SERVER['PHP_SELF'])) { die('You
|
|
59 |
<?php _e('Allow users to upload zip folders.','nggallery') ?>
|
60 |
</td>
|
61 |
</tr>
|
|
|
|
|
|
|
|
|
|
|
|
|
62 |
<tr>
|
63 |
<th valign="top"><?php _e('Enable style selection','nggallery') ?>:</th>
|
64 |
<td><input name="wpmuStyle" type="checkbox" value="1" <?php checked('1', $ngg_options['wpmuStyle']); ?> />
|
7 |
if ( !is_super_admin() )
|
8 |
die('You are not allowed to call this page.');
|
9 |
|
10 |
+
$messagetext = '';
|
11 |
+
|
12 |
// get the options
|
13 |
$ngg_options = get_site_option('ngg_options');
|
|
|
|
|
|
|
14 |
|
15 |
if ( isset($_POST['updateoption']) ) {
|
16 |
check_admin_referer('ngg_wpmu_settings');
|
26 |
}
|
27 |
}
|
28 |
|
29 |
+
// the path should always end with a slash
|
30 |
+
$ngg_options['gallerypath'] = trailingslashit($ngg_options['gallerypath']);
|
31 |
update_site_option('ngg_options', $ngg_options);
|
32 |
+
|
33 |
$messagetext = __('Update successfully','nggallery');
|
34 |
}
|
35 |
+
|
36 |
+
// Show donation message only one time.
|
37 |
+
if (isset ( $_GET['hideSupportInfo']) ) {
|
38 |
+
$ngg_options['hideSupportInfo'] = true;
|
39 |
+
update_site_option('ngg_options', $ngg_options);
|
40 |
+
}
|
41 |
+
|
42 |
+
if( !isset ( $ngg_options['hideSupportInfo']) || $ngg_options['hideSupportInfo'] !== true ) {
|
43 |
+
?>
|
44 |
+
<div id="donator_message">
|
45 |
+
<p><?php echo str_replace('%s', 'http://alexrabe.de/donation', __('Thanks for using this plugin, NextGEN Gallery is initially developed for self hosted blogs. A multisite setup is possible, but cannot currently fully supported, as it can have several special condition ( i.e. Domain mapping).<br /> If you would like to support the further development, please consider a <strong><a href="%s">donation</a></strong>! If you still need some help, please post your questions <a href="http://wordpress.org/tags/nextgen-gallery?forum_id=10">here</a> .', 'nggallery')); ?>
|
46 |
+
<span>
|
47 |
+
<a href="<?php echo add_query_arg( array( 'hideSupportInfo' => 'true') ); ?>" >
|
48 |
+
<small><?php _e('OK, hide this message now !', 'nggallery'); ?></small>
|
49 |
+
</a>
|
50 |
+
<span>
|
51 |
+
</p>
|
52 |
+
</div>
|
53 |
+
<?php
|
54 |
+
}
|
55 |
|
56 |
// message windows
|
57 |
+
if( !empty($messagetext) ) { echo '<!-- Last Action --><div id="message" class="updated fade"><p>'.$messagetext.'</p></div>'; }
|
58 |
|
59 |
?>
|
60 |
|
61 |
<div class="wrap">
|
62 |
+
<h2><?php _e('Network Options','nggallery'); ?></h2>
|
63 |
<form name="generaloptions" method="post">
|
64 |
<?php wp_nonce_field('ngg_wpmu_settings') ?>
|
65 |
+
<input type="hidden" name="page_options" value="gallerypath,wpmuQuotaCheck,wpmuZipUpload,wpmuImportFolder,wpmuStyle,wpmuRoles,wpmuCSSfile" />
|
66 |
<table class="form-table">
|
67 |
<tr valign="top">
|
68 |
<th align="left"><?php _e('Gallery path','nggallery') ?></th>
|
69 |
+
<td><input type="text" size="50" name="gallerypath" value="<?php echo $ngg_options['gallerypath']; ?>" /><br />
|
70 |
+
<?php _e('This is the default path for all blogs. With the placeholder %BLOG_ID% you can organize the folder structure better.','nggallery') ?>
|
71 |
+
<?php echo str_replace('%s', '<code>wp-content/blogs.dir/%BLOG_ID%/files/</code>', __('The default setting should be %s', 'nggallery')); ?>
|
72 |
+
</td>
|
73 |
</tr>
|
74 |
<tr>
|
75 |
<th valign="top"><?php _e('Enable upload quota check','nggallery') ?>:</th>
|
83 |
<?php _e('Allow users to upload zip folders.','nggallery') ?>
|
84 |
</td>
|
85 |
</tr>
|
86 |
+
<tr>
|
87 |
+
<th valign="top"><?php _e('Enable import function','nggallery') ?>:</th>
|
88 |
+
<td><input name="wpmuImportFolder" type="checkbox" value="1" <?php checked('1', $ngg_options['wpmuImportFolder']); ?> />
|
89 |
+
<?php _e('Allow users to import images folders from the server.','nggallery') ?>
|
90 |
+
</td>
|
91 |
+
</tr>
|
92 |
<tr>
|
93 |
<th valign="top"><?php _e('Enable style selection','nggallery') ?>:</th>
|
94 |
<td><input name="wpmuStyle" type="checkbox" value="1" <?php checked('1', $ngg_options['wpmuStyle']); ?> />
|
changelog.txt
CHANGED
@@ -1,11 +1,28 @@
|
|
1 |
NextGEN Gallery
|
2 |
by Alex Rabe & NextGEN DEV Team
|
3 |
|
4 |
-
= V1.
|
5 |
* TODO : Adding Google Sitemaps for Images
|
6 |
* TODO : Facebook connector
|
7 |
* TODO : Switch to Plupload (http://www.plupload.com/)
|
8 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
9 |
= V1.6.2 - 19.09.2010 =
|
10 |
* NEW : Added constant NGG_SKIP_LOAD_SCRIPTS to avoid script load
|
11 |
* Bugfix : Load Tags library with core files
|
1 |
NextGEN Gallery
|
2 |
by Alex Rabe & NextGEN DEV Team
|
3 |
|
4 |
+
= V1.8.0 - sometimes =
|
5 |
* TODO : Adding Google Sitemaps for Images
|
6 |
* TODO : Facebook connector
|
7 |
* TODO : Switch to Plupload (http://www.plupload.com/)
|
8 |
|
9 |
+
= V1.7.0 - 11.12.2010 =
|
10 |
+
* NEW : Publish a new post direct from the gallery admin page
|
11 |
+
* NEW : Added filter hook 'ngg_get_image_metadata' to add more exif/iptc information
|
12 |
+
* NEW : Adding Autocomplete field to TinyMCE Popup and Album page
|
13 |
+
* NEW : More methods for XMLRPC interface
|
14 |
+
* Changed : New hooks for gallery table (THX to Alexander Schneider)
|
15 |
+
* Changed : Introduce jQuery dialog as new UI element
|
16 |
+
* Changed : Call TinyMCE window via admin-ajax
|
17 |
+
* Bugfix : Better support for SSL blogs
|
18 |
+
* Bugfix : Install/Upgrade failed when table prefix contain captial letters
|
19 |
+
* Bugfix : Fix validation issues in Media-RSS
|
20 |
+
* Bugifx : Empty tags in XMP Meta causes PHP error
|
21 |
+
* Bugifx : Rework load mechanism for slideshow
|
22 |
+
* Bugfix : Copy meta data when image is copied
|
23 |
+
* Bugfix : Icon Support for Ozh' Admin Drop Down Menu
|
24 |
+
* Bugfix : Use correct sort order in slideshow
|
25 |
+
|
26 |
= V1.6.2 - 19.09.2010 =
|
27 |
* NEW : Added constant NGG_SKIP_LOAD_SCRIPTS to avoid script load
|
28 |
* Bugfix : Load Tags library with core files
|
js/ngg.slideshow.js
CHANGED
@@ -1,3 +1,9 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
jQuery.fn.nggSlideshow = function ( args ) {
|
2 |
|
3 |
var defaults = { id: 1,
|
@@ -12,29 +18,31 @@ jQuery.fn.nggSlideshow = function ( args ) {
|
|
12 |
var obj = this.selector;
|
13 |
var stack = [];
|
14 |
var url = s.domain + 'index.php?callback=json&api_key=true&format=json&method=gallery&id=' + s.id;
|
15 |
-
|
16 |
-
|
|
|
17 |
if (r.stat == "ok"){
|
18 |
-
|
19 |
for (img in r.images) {
|
20 |
var photo = r.images[img];
|
21 |
//populate images into an array
|
22 |
stack.push( decodeURI( photo['imageURL'] ) );
|
23 |
}
|
24 |
-
|
25 |
// push the first three images out
|
26 |
-
var i = 1
|
|
|
27 |
while (stack.length && i <= 3) {
|
28 |
var img = new Image();
|
29 |
img.src = stack.shift();
|
30 |
-
|
31 |
-
|
32 |
-
|
33 |
-
|
34 |
-
if (counter == 3 || stack.length == 0 )
|
35 |
-
startSlideshow();
|
36 |
-
});
|
37 |
i++;
|
|
|
|
|
|
|
38 |
}
|
39 |
|
40 |
}
|
@@ -44,7 +52,6 @@ jQuery.fn.nggSlideshow = function ( args ) {
|
|
44 |
|
45 |
// hide the loader icon
|
46 |
jQuery( obj + '-loader' ).empty().remove();
|
47 |
-
|
48 |
// Start the slideshow
|
49 |
jQuery(obj + ' img:first').fadeIn(1000, function() {
|
50 |
// Start the cycle plugin
|
@@ -63,11 +70,10 @@ jQuery.fn.nggSlideshow = function ( args ) {
|
|
63 |
//Resize Image and keep ratio on client side, better move to server side later
|
64 |
function imageResize(img, maxWidth , maxHeight) {
|
65 |
|
66 |
-
//
|
67 |
-
|
68 |
-
|
69 |
-
|
70 |
-
|
71 |
// in some cases the image is not loaded, we can't resize them
|
72 |
if (img.height == 0 || img.width == 0)
|
73 |
return img;
|
@@ -83,7 +89,7 @@ jQuery.fn.nggSlideshow = function ( args ) {
|
|
83 |
'height': height,
|
84 |
'width': width
|
85 |
});
|
86 |
-
|
87 |
return img;
|
88 |
};
|
89 |
|
1 |
+
/*!
|
2 |
+
* NextGEN Slideshow based on jQuery Cycle Plugin
|
3 |
+
* Copyright (c) 2010 Alex Rabe
|
4 |
+
* Version: 1.0.3
|
5 |
+
* Requires: jQuery v1.2.6 or later
|
6 |
+
*/
|
7 |
jQuery.fn.nggSlideshow = function ( args ) {
|
8 |
|
9 |
var defaults = { id: 1,
|
18 |
var obj = this.selector;
|
19 |
var stack = [];
|
20 |
var url = s.domain + 'index.php?callback=json&api_key=true&format=json&method=gallery&id=' + s.id;
|
21 |
+
|
22 |
+
jQuery.getJSON(url, function(r){
|
23 |
+
|
24 |
if (r.stat == "ok"){
|
25 |
+
|
26 |
for (img in r.images) {
|
27 |
var photo = r.images[img];
|
28 |
//populate images into an array
|
29 |
stack.push( decodeURI( photo['imageURL'] ) );
|
30 |
}
|
31 |
+
|
32 |
// push the first three images out
|
33 |
+
var i = 1;
|
34 |
+
|
35 |
while (stack.length && i <= 3) {
|
36 |
var img = new Image();
|
37 |
img.src = stack.shift();
|
38 |
+
// Hide them first, Cycle plugin will show them
|
39 |
+
jQuery( img ).hide();
|
40 |
+
// Add the image now and resize after loaded
|
41 |
+
jQuery( obj ).append( imageResize(img, s.width , s.height) );
|
|
|
|
|
|
|
42 |
i++;
|
43 |
+
// start cycle after the third image
|
44 |
+
if (i == 3 || stack.length == 0 )
|
45 |
+
startSlideshow();
|
46 |
}
|
47 |
|
48 |
}
|
52 |
|
53 |
// hide the loader icon
|
54 |
jQuery( obj + '-loader' ).empty().remove();
|
|
|
55 |
// Start the slideshow
|
56 |
jQuery(obj + ' img:first').fadeIn(1000, function() {
|
57 |
// Start the cycle plugin
|
70 |
//Resize Image and keep ratio on client side, better move to server side later
|
71 |
function imageResize(img, maxWidth , maxHeight) {
|
72 |
|
73 |
+
// we need to wait until the image is loaded
|
74 |
+
if ( !img.complete )
|
75 |
+
jQuery( img ).bind('load', function() { imageResize(img, maxWidth , maxHeight) });
|
76 |
+
|
|
|
77 |
// in some cases the image is not loaded, we can't resize them
|
78 |
if (img.height == 0 || img.width == 0)
|
79 |
return img;
|
89 |
'height': height,
|
90 |
'width': width
|
91 |
});
|
92 |
+
|
93 |
return img;
|
94 |
};
|
95 |
|
js/ngg.slideshow.min.js
CHANGED
@@ -1,7 +1,8 @@
|
|
1 |
jQuery.fn.nggSlideshow=function(args){var defaults={id:1,width:320,height:240,fx:'fade',domain:'',timeout:5000};var s=jQuery.extend({},defaults,args);var obj=this.selector;var stack=[];var url=s.domain+'index.php?callback=json&api_key=true&format=json&method=gallery&id='+s.id;jQuery.getJSON(url,function(r){if(r.stat=="ok"){for(img in r.images){var photo=r.images[img];stack.push(decodeURI(photo['imageURL']));}
|
2 |
-
var i=1
|
3 |
-
startSlideshow();}
|
4 |
-
function imageResize(img,maxWidth,maxHeight){
|
|
|
5 |
return img;var height=(img.height<maxHeight)?img.height:maxHeight;var width=(img.width<maxWidth)?img.width:maxWidth;if(img.height>=img.width)
|
6 |
width=Math.floor(Math.ceil(img.width/img.height*maxHeight));else
|
7 |
height=Math.floor(Math.ceil(img.height/img.width*maxWidth));jQuery(img).css({'height':height,'width':width});return img;};function jCycle_onBefore(curr,next,opts){if(opts.addSlide)
|
1 |
jQuery.fn.nggSlideshow=function(args){var defaults={id:1,width:320,height:240,fx:'fade',domain:'',timeout:5000};var s=jQuery.extend({},defaults,args);var obj=this.selector;var stack=[];var url=s.domain+'index.php?callback=json&api_key=true&format=json&method=gallery&id='+s.id;jQuery.getJSON(url,function(r){if(r.stat=="ok"){for(img in r.images){var photo=r.images[img];stack.push(decodeURI(photo['imageURL']));}
|
2 |
+
var i=1;while(stack.length&&i<=3){var img=new Image();img.src=stack.shift();jQuery(img).hide();jQuery(obj).append(imageResize(img,s.width,s.height));i++;if(i==3||stack.length==0)
|
3 |
+
startSlideshow();}}});function startSlideshow(){jQuery(obj+'-loader').empty().remove();jQuery(obj+' img:first').fadeIn(1000,function(){jQuery(obj).cycle({fx:s.fx,containerResize:1,fit:1,timeout:s.timeout,next:obj,before:jCycle_onBefore});});}
|
4 |
+
function imageResize(img,maxWidth,maxHeight){if(!img.complete)
|
5 |
+
jQuery(img).bind('load',function(){imageResize(img,maxWidth,maxHeight)});if(img.height==0||img.width==0)
|
6 |
return img;var height=(img.height<maxHeight)?img.height:maxHeight;var width=(img.width<maxWidth)?img.width:maxWidth;if(img.height>=img.width)
|
7 |
width=Math.floor(Math.ceil(img.width/img.height*maxHeight));else
|
8 |
height=Math.floor(Math.ceil(img.height/img.width*maxWidth));jQuery(img).css({'height':height,'width':width});return img;};function jCycle_onBefore(curr,next,opts){if(opts.addSlide)
|
lang/nggallery-de_DE.mo
CHANGED
Binary file
|
lang/nggallery-de_DE.po
CHANGED
@@ -2,8 +2,8 @@ msgid ""
|
|
2 |
msgstr ""
|
3 |
"Project-Id-Version: NextGEN Gallery\n"
|
4 |
"Report-Msgid-Bugs-To: \n"
|
5 |
-
"POT-Creation-Date: 2010-
|
6 |
-
"PO-Revision-Date: 2010-
|
7 |
"Last-Translator: Alex Rabe\n"
|
8 |
"Language-Team: Alex Rabe\n"
|
9 |
"MIME-Version: 1.0\n"
|
@@ -18,86 +18,86 @@ msgstr ""
|
|
18 |
"X-Poedit-SearchPath-0: .\n"
|
19 |
"X-Poedit-SearchPath-1: ..\n"
|
20 |
|
21 |
-
#: ../nggallery.php:
|
22 |
msgid "<strong>Translation by : </strong><a target=\"_blank\" href=\"http://alexrabe.de/wordpress-plugins/nextgen-gallery/languages/\">See here</a>"
|
23 |
msgstr "<strong>Übersetzt von : </strong><a target=\"_blank\" href=\"http://alexrabe.de/wordpress-plugins/wordtube/translation-of-plugins/\">Alex Rabe</a>"
|
24 |
|
25 |
-
#: ../nggallery.php:
|
26 |
-
msgid "<strong>This translation is not yet updated for Version 1.
|
27 |
msgstr "Sollten jemand Rechtschreibfehler, Deppenapostrophe oder andere deutsche Ungereimtheiten finden, freue ich mich jederzeit über einen kurzen Hinweis</p>"
|
28 |
|
29 |
-
#: ../nggallery.php:
|
30 |
-
msgid "Sorry, NextGEN Gallery works only with a Memory Limit of 16 MB higher"
|
31 |
msgstr "Tut mir leid, aber NextGEN-Galerie benötigt minimum 16MB Speicher (Memory Limit) oder mehr"
|
32 |
|
33 |
-
#: ../nggallery.php:
|
34 |
msgid "Please update the database of NextGEN Gallery."
|
35 |
msgstr "Bitte aktualisiere die Datenbank von NextGEN Gallery."
|
36 |
|
37 |
-
#: ../nggallery.php:
|
38 |
msgid "Click here to proceed."
|
39 |
msgstr "Hier klicken um fortzufahren."
|
40 |
|
41 |
-
#: ../nggallery.php:
|
42 |
msgid "Picture tag"
|
43 |
msgstr "Bilder-Stichwort"
|
44 |
|
45 |
-
#: ../nggallery.php:
|
46 |
msgid "Picture tag: %2$l."
|
47 |
msgstr "Bilder-Stichwort: %2$l."
|
48 |
|
49 |
-
#: ../nggallery.php:
|
50 |
msgid "Separate picture tags with commas."
|
51 |
msgstr "Trenne Stichwörter mittels Komma"
|
52 |
|
53 |
-
#: ../nggallery.php:
|
54 |
msgid "L O A D I N G"
|
55 |
msgstr "B I T T E W A R T E N"
|
56 |
|
57 |
-
#: ../nggallery.php:
|
58 |
msgid "Click to Close"
|
59 |
msgstr "Klicken zum Schliessen "
|
60 |
|
61 |
-
#: ../nggallery.php:
|
62 |
msgid "loading"
|
63 |
msgstr "lade..."
|
64 |
|
65 |
-
#: ../nggallery.php:
|
66 |
-
#: ../nggfunctions.php:
|
67 |
-
#: ../admin/admin.php:
|
68 |
msgid "Overview"
|
69 |
msgstr "Übersicht"
|
70 |
|
71 |
-
#: ../nggallery.php:
|
72 |
msgid "Get help"
|
73 |
msgstr "Hilfe"
|
74 |
|
75 |
-
#: ../nggallery.php:
|
76 |
msgid "Contribute"
|
77 |
msgstr "Mithelfen"
|
78 |
|
79 |
-
#: ../nggallery.php:
|
80 |
msgid "Donate"
|
81 |
msgstr "Spenden"
|
82 |
|
83 |
#: ../nggfunctions.php:42
|
84 |
-
msgid "The <a href=\"http://www.macromedia.com/go/getflashplayer\">Flash Player</a> and <a href=\"http://www.mozilla.com/firefox/\">a browser with Javascript support</a> are needed
|
85 |
msgstr "Es wird der <a href=\"http://www.macromedia.com/go/getflashplayer\">Adobe Flash Player</a> benötigt und <a href=\"http://www.mozilla.com/firefox/\">im Browser muss Javascript</a> aktiviert sein."
|
86 |
|
87 |
-
#: ../nggfunctions.php:
|
88 |
-
#: ../nggfunctions.php:
|
89 |
msgid "[Gallery not found]"
|
90 |
msgstr "[Galerie nicht gefunden]"
|
91 |
|
92 |
-
#: ../nggfunctions.php:
|
93 |
msgid "[Album not found]"
|
94 |
msgstr "[Album nicht gefunden]"
|
95 |
|
96 |
-
#: ../nggfunctions.php:
|
97 |
msgid "[SinglePic not found]"
|
98 |
msgstr "[Bild nicht gefunden]"
|
99 |
|
100 |
-
#: ../nggfunctions.php:
|
101 |
msgid "Related images for"
|
102 |
msgstr "Verwandte Bilder von"
|
103 |
|
@@ -222,11 +222,11 @@ msgstr "und allen anderen Spendern..."
|
|
222 |
#: ../admin/addgallery.php:69
|
223 |
#: ../admin/addgallery.php:80
|
224 |
#: ../admin/album.php:96
|
225 |
-
#: ../admin/album.php:
|
226 |
-
#: ../admin/album.php:
|
227 |
#: ../admin/edit-thumbnail.php:19
|
228 |
#: ../admin/edit-thumbnail.php:22
|
229 |
-
#: ../admin/manage.php:
|
230 |
msgid "Cheatin’ uh?"
|
231 |
msgstr "Cheatin’ uh?"
|
232 |
|
@@ -239,479 +239,486 @@ msgid "Upload failed! "
|
|
239 |
msgstr "Upload fehlgeschlagen!"
|
240 |
|
241 |
#: ../admin/addgallery.php:90
|
242 |
-
#: ../admin/functions.php:
|
243 |
-
#: ../admin/functions.php:
|
244 |
msgid "No gallery selected !"
|
245 |
msgstr "Keine Galerie ausgewählt !"
|
246 |
|
247 |
-
#: ../admin/addgallery.php:
|
248 |
msgid "Image Files"
|
249 |
msgstr "Bilder"
|
250 |
|
251 |
-
#: ../admin/addgallery.php:
|
252 |
-
#: ../admin/addgallery.php:
|
253 |
msgid "remove"
|
254 |
msgstr "Entfernen"
|
255 |
|
256 |
-
#: ../admin/addgallery.php:
|
257 |
-
#: ../admin/addgallery.php:
|
258 |
msgid "Browse..."
|
259 |
msgstr "Durchsuche..."
|
260 |
|
261 |
-
#: ../admin/addgallery.php:
|
262 |
-
#: ../admin/addgallery.php:
|
|
|
263 |
msgid "Upload images"
|
264 |
msgstr "Bilder hochladen"
|
265 |
|
266 |
-
#: ../admin/addgallery.php:
|
267 |
-
#: ../admin/addgallery.php:
|
268 |
msgid "Upload Images"
|
269 |
msgstr "Bilder hochladen"
|
270 |
|
271 |
-
#: ../admin/addgallery.php:
|
272 |
-
#: ../admin/addgallery.php:
|
273 |
-
#: ../admin/manage-galleries.php:
|
|
|
274 |
msgid "Add new gallery"
|
275 |
msgstr "Neue Galerie erstellen"
|
276 |
|
277 |
-
#: ../admin/addgallery.php:
|
278 |
-
#: ../admin/addgallery.php:
|
279 |
msgid "Upload a Zip-File"
|
280 |
msgstr "Zip-Datei hochladen"
|
281 |
|
282 |
-
#: ../admin/addgallery.php:
|
283 |
-
#: ../admin/addgallery.php:
|
284 |
msgid "Import image folder"
|
285 |
msgstr "Bilder-Verzeichnis importieren"
|
286 |
|
287 |
-
#: ../admin/addgallery.php:
|
288 |
-
#: ../admin/manage-galleries.php:
|
289 |
msgid "New Gallery"
|
290 |
msgstr "Neue Galerie"
|
291 |
|
292 |
-
#: ../admin/addgallery.php:
|
293 |
-
#: ../admin/manage-galleries.php:
|
294 |
msgid "Create a new , empty gallery below the folder"
|
295 |
msgstr "Erstelle eine neue, leere Galerie unter dem Verzeichnis"
|
296 |
|
297 |
-
#: ../admin/addgallery.php:
|
298 |
-
#: ../admin/manage-galleries.php:
|
299 |
msgid "Allowed characters for file and folder names are"
|
300 |
msgstr "Erlaubte Zeichen für die Datei- und Verzeichnisnamen sind"
|
301 |
|
302 |
-
#: ../admin/addgallery.php:
|
303 |
msgid "Add gallery"
|
304 |
msgstr "Galerie hinzufügen"
|
305 |
|
306 |
-
#: ../admin/addgallery.php:
|
307 |
msgid "Select Zip-File"
|
308 |
msgstr "Wähle Zip-Datei"
|
309 |
|
310 |
-
#: ../admin/addgallery.php:
|
311 |
msgid "Upload a zip file with images"
|
312 |
msgstr "Lade eine Zip-Datei mit Bildern hoch"
|
313 |
|
314 |
-
#: ../admin/addgallery.php:
|
315 |
msgid "or enter a Zip-File URL"
|
316 |
msgstr "oder gib eine URL zur ZIP-Datei an"
|
317 |
|
318 |
-
#: ../admin/addgallery.php:
|
319 |
msgid "Import a zip file with images from a url"
|
320 |
msgstr "Lade eine Zip-Datei mit Bildern über ein URL hoch"
|
321 |
|
322 |
-
#: ../admin/addgallery.php:
|
323 |
-
#: ../admin/addgallery.php:
|
324 |
msgid "in to"
|
325 |
msgstr "in"
|
326 |
|
327 |
-
#: ../admin/addgallery.php:
|
328 |
msgid "a new gallery"
|
329 |
msgstr "eine neue Galerie"
|
330 |
|
331 |
-
#: ../admin/addgallery.php:
|
332 |
msgid "Note : The upload limit on your server is "
|
333 |
msgstr "Hinweis : Das Upload-Limit auf dem Server beträgt "
|
334 |
|
335 |
-
#: ../admin/addgallery.php:
|
336 |
msgid "Start upload"
|
337 |
msgstr "Upload starten"
|
338 |
|
339 |
-
#: ../admin/addgallery.php:
|
340 |
msgid "Import from Server path:"
|
341 |
msgstr "Importieren aus Server-Pfad:"
|
342 |
|
343 |
-
#: ../admin/addgallery.php:
|
344 |
msgid "Note : Change the default path in the gallery settings"
|
345 |
msgstr "Hinweis : Der Default-Pfad kann in den Einstellungen angepasst werden"
|
346 |
|
347 |
-
#: ../admin/addgallery.php:
|
348 |
msgid " Please note : For safe-mode = ON you need to add the subfolder thumbs manually"
|
349 |
msgstr "Achtung : Da der Safe-Mode (PHP.INI) eingeschaltet ist, mußt Du das Unterverzeichnis für die Vorschaubilder (\"thumbs\") manuell (per FTP) anlegen"
|
350 |
|
351 |
-
#: ../admin/addgallery.php:
|
352 |
msgid "Import folder"
|
353 |
msgstr "Verzeichnis importieren"
|
354 |
|
355 |
-
#: ../admin/addgallery.php:
|
356 |
msgid "Upload image"
|
357 |
msgstr "Bild hochladen"
|
358 |
|
359 |
-
#: ../admin/addgallery.php:
|
360 |
msgid "Choose gallery"
|
361 |
msgstr "Wähle Galerie"
|
362 |
|
363 |
-
#: ../admin/addgallery.php:
|
364 |
msgid "The batch upload requires Adobe Flash 10, disable it if you have problems"
|
365 |
msgstr "Das Batch-Upload benötigt Adbode Flash 10, wenn es Probleme gibt deaktiviere es besser."
|
366 |
|
367 |
-
#: ../admin/addgallery.php:
|
368 |
msgid "Disable flash upload"
|
369 |
msgstr "Deaktiviere Batch-Upload"
|
370 |
|
371 |
-
#: ../admin/addgallery.php:
|
372 |
msgid "Upload multiple files at once by ctrl/shift-selecting in dialog"
|
373 |
msgstr "Wähle im Dialog mit Ctrl/Shift mehrere Bilder gleichzeitig aus."
|
374 |
|
375 |
-
#: ../admin/addgallery.php:
|
376 |
msgid "Enable flash based upload"
|
377 |
msgstr "Aktiviere Flash Batch Upload"
|
378 |
|
379 |
-
#: ../admin/admin.php:
|
380 |
-
#: ../admin/admin.php:
|
381 |
-
#: ../admin/admin.php:
|
382 |
-
#: ../admin/
|
383 |
-
#: ../admin/functions.php:
|
384 |
-
#: ../admin/manage-
|
385 |
-
#: ../admin/manage.php:
|
|
|
386 |
msgid "Gallery"
|
387 |
msgid_plural "Galleries"
|
388 |
msgstr[0] "Galerie"
|
389 |
msgstr[1] "Galerien"
|
390 |
|
391 |
-
#: ../admin/admin.php:
|
392 |
msgid "Add Gallery / Images"
|
393 |
msgstr "Galerie / Bilder hinzufügen"
|
394 |
|
395 |
-
#: ../admin/admin.php:
|
396 |
msgid "Manage Gallery"
|
397 |
msgstr "Galerie verwalten"
|
398 |
|
399 |
-
#: ../admin/admin.php:
|
400 |
msgid "Album"
|
401 |
msgid_plural "Albums"
|
402 |
msgstr[0] "Album"
|
403 |
msgstr[1] "Alben"
|
404 |
|
405 |
-
#: ../admin/admin.php:
|
406 |
msgid "Tags"
|
407 |
msgstr "Stichwörter"
|
408 |
|
409 |
-
#: ../admin/admin.php:
|
410 |
msgid "Options"
|
411 |
msgstr "Optionen"
|
412 |
|
413 |
-
#: ../admin/admin.php:
|
414 |
msgid "Style"
|
415 |
msgstr "Style"
|
416 |
|
417 |
-
#: ../admin/admin.php:
|
418 |
msgid "Roles"
|
419 |
msgstr "Zugriff"
|
420 |
|
421 |
-
#: ../admin/admin.php:
|
422 |
msgid "About this Gallery"
|
423 |
msgstr "Über diese Galerie"
|
424 |
|
425 |
-
#: ../admin/admin.php:
|
426 |
msgid "About"
|
427 |
msgstr "Über"
|
428 |
|
429 |
-
#: ../admin/admin.php:
|
430 |
msgid "NextGEN Gallery"
|
431 |
msgstr "NextGEN Gallery"
|
432 |
|
433 |
-
#: ../admin/admin.php:
|
|
|
434 |
msgid "Reset / Uninstall"
|
435 |
msgstr "Rücksetzen"
|
436 |
|
437 |
-
#: ../admin/admin.php:
|
438 |
-
msgid "
|
439 |
-
msgstr "
|
440 |
|
441 |
-
#: ../admin/admin.php:
|
442 |
-
msgid "Download here"
|
443 |
-
msgstr "Hier downloaden"
|
444 |
-
|
445 |
-
#: ../admin/admin.php:93
|
446 |
#, php-format
|
447 |
msgid "Thanks for using this plugin, I hope you are satisfied ! If you would like to support the further development, please consider a <strong><a href=\"%s\">donation</a></strong>! If you still need some help, please post your questions <a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\">here</a> ."
|
448 |
msgstr "Vielen Dank, dass Du dieses Plugin nutzt. Ich hoffe, Du bist soweit zufrieden! Wenn Du die Weiterentwicklung unterstützen möchtest, würde ich mich über eine kleine <strong><a href=\"%s\">Spende</a></strong> freuen! Wenn Du Fragen oder Problem hast, schreib sie doch <a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\">hier</a> ins Forum."
|
449 |
|
450 |
-
#: ../admin/admin.php:
|
451 |
msgid "OK, hide this message now !"
|
452 |
msgstr "OK, danke für die Info !"
|
453 |
|
454 |
-
#: ../admin/admin.php:
|
455 |
msgid "You do not have the correct permission"
|
456 |
msgstr "Du hast keine Zugriffsrechte"
|
457 |
|
458 |
-
#: ../admin/admin.php:
|
459 |
msgid "Unexpected Error"
|
460 |
msgstr "Unerwarteter Fehler"
|
461 |
|
462 |
-
#: ../admin/admin.php:
|
463 |
msgid "A failure occurred"
|
464 |
msgstr "Ein Fehler ist aufgetreten"
|
465 |
|
466 |
-
#: ../admin/admin.php:
|
467 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Introduction</a>"
|
468 |
msgstr "<a href=\"http://www.curlyrob.de/curlyrob/?page_id=129\" target=\"_blank\">Einführung</a>"
|
469 |
|
470 |
-
#: ../admin/admin.php:
|
471 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Setup</a>"
|
472 |
msgstr "<a href=\"http://www.curlyrob.de/curlyrob/?page_id=129\" target=\"_blank\">Setup</a>"
|
473 |
|
474 |
-
#: ../admin/admin.php:
|
475 |
msgid "<a href=\"http://alexrabe.de/wordpress-plugins/nextgen-gallery/languages/\" target=\"_blank\">Translation by alex rabe</a>"
|
476 |
msgstr "<a href=\"http://alexrabe.de/wordpress-plugins/nextgen-gallery/languages/\" target=\"_blank\">Unterstütze bei der Übersetzung</a>"
|
477 |
|
478 |
-
#: ../admin/admin.php:
|
479 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Roles / Capabilities</a>"
|
480 |
msgstr "<a href=\"http://www.curlyrob.de/curlyrob/?page_id=129\" target=\"_blank\">Einführung</a>"
|
481 |
|
482 |
-
#: ../admin/admin.php:
|
483 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Styles</a>"
|
484 |
msgstr "<a href=\"http://www.curlyrob.de/curlyrob/?page_id=129\" target=\"_blank\">Einführung</a>"
|
485 |
|
486 |
-
#: ../admin/admin.php:
|
487 |
msgid "Templates"
|
488 |
msgstr "Vorlagen"
|
489 |
|
490 |
-
#: ../admin/admin.php:
|
491 |
-
#: ../admin/admin.php:
|
492 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Gallery management</a>"
|
493 |
msgstr "<a href=\"http://www.curlyrob.de/curlyrob/?page_id=129\" target=\"_blank\">Einführung</a>"
|
494 |
|
495 |
-
#: ../admin/admin.php:
|
496 |
msgid "Gallery example"
|
497 |
msgstr "Galerie Beispiel"
|
498 |
|
499 |
-
#: ../admin/admin.php:
|
500 |
-
#: ../admin/admin.php:
|
501 |
msgid "Gallery tags"
|
502 |
msgstr "Galerie Stichwörter"
|
503 |
|
504 |
-
#: ../admin/admin.php:
|
505 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Album management</a>"
|
506 |
msgstr "<a href=\"http://www.curlyrob.de/curlyrob/?page_id=129\" target=\"_blank\">Einführung</a>"
|
507 |
|
508 |
-
#: ../admin/admin.php:
|
509 |
msgid "Album example"
|
510 |
msgstr "Album Beispiel"
|
511 |
|
512 |
-
#: ../admin/admin.php:
|
513 |
-
#: ../admin/admin.php:
|
514 |
msgid "Album tags"
|
515 |
msgstr "Album Stichwörter"
|
516 |
|
517 |
-
#: ../admin/admin.php:
|
518 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Gallery tags</a>"
|
519 |
msgstr "<a href=\"http://www.curlyrob.de/curlyrob/?page_id=129\" target=\"_blank\">Einführung</a>"
|
520 |
|
521 |
-
#: ../admin/admin.php:
|
522 |
msgid "Related images"
|
523 |
msgstr "Verwandte Bilder"
|
524 |
|
525 |
-
#: ../admin/admin.php:
|
526 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-image-management/\" target=\"_blank\">Image management</a>"
|
527 |
msgstr "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-image-management/\" target=\"_blank\">Bilderverwaltung (englisch)</a>"
|
528 |
|
529 |
-
#: ../admin/admin.php:
|
530 |
msgid "Custom fields"
|
531 |
msgstr "Spezialfelder"
|
532 |
|
533 |
-
#: ../admin/admin.php:
|
534 |
msgid "Get help with NextGEN Gallery"
|
535 |
msgstr "Weitere Hilfe zu NextGEN Gallery"
|
536 |
|
537 |
-
#: ../admin/admin.php:
|
538 |
msgid "More Help & Info"
|
539 |
msgstr "Weitere Hilfe & Informationen"
|
540 |
|
541 |
-
#: ../admin/admin.php:
|
542 |
msgid "<a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\" target=\"_blank\">Support Forums</a>"
|
543 |
msgstr "<a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\" target=\"_blank\">Support Forum (englisch)</a>"
|
544 |
|
545 |
-
#: ../admin/admin.php:
|
546 |
msgid "FAQ"
|
547 |
msgstr "FAQ (englisch)"
|
548 |
|
549 |
-
#: ../admin/admin.php:
|
550 |
msgid "Feature request"
|
551 |
msgstr "Wünsch Dir was"
|
552 |
|
553 |
-
#: ../admin/admin.php:
|
554 |
msgid "Get your language pack"
|
555 |
msgstr "Lade Deine Sprachdatei"
|
556 |
|
557 |
-
#: ../admin/admin.php:
|
558 |
msgid "Contribute development"
|
559 |
msgstr "Entwicklung helfen"
|
560 |
|
561 |
-
#: ../admin/admin.php:
|
562 |
msgid "Download latest version"
|
563 |
msgstr "Aktuelle Version downloaden"
|
564 |
|
565 |
-
#: ../admin/
|
566 |
-
|
567 |
-
|
|
|
|
|
|
|
|
|
568 |
msgid "Update Successfully"
|
569 |
msgstr "Update erfolgreich"
|
570 |
|
571 |
-
#: ../admin/album.php:
|
572 |
msgid "Album deleted"
|
573 |
msgstr "Album gelöscht"
|
574 |
|
575 |
-
#: ../admin/album.php:
|
|
|
|
|
|
|
|
|
576 |
msgid "Manage Albums"
|
577 |
msgstr "Verwalte Alben"
|
578 |
|
579 |
-
#: ../admin/album.php:
|
580 |
-
#: ../admin/album.php:
|
581 |
msgid "Select album"
|
582 |
msgstr "Wähle Album"
|
583 |
|
584 |
-
#: ../admin/album.php:
|
585 |
msgid "No album selected"
|
586 |
msgstr "Kein Album ausgewählt"
|
587 |
|
588 |
-
#: ../admin/album.php:
|
589 |
#: ../admin/edit-thumbnail.php:157
|
590 |
msgid "Update"
|
591 |
msgstr "Aktualisiere"
|
592 |
|
593 |
-
#: ../admin/album.php:
|
594 |
msgid "Edit album"
|
595 |
msgstr "Album ändern"
|
596 |
|
597 |
-
#: ../admin/album.php:
|
598 |
-
#: ../admin/manage-galleries.php:
|
599 |
-
#: ../admin/manage-images.php:
|
600 |
msgid "Delete"
|
601 |
msgstr "Lösche"
|
602 |
|
603 |
-
#: ../admin/album.php:
|
604 |
msgid "Delete album ?"
|
605 |
msgstr "Album löschen ?"
|
606 |
|
607 |
-
#: ../admin/album.php:
|
608 |
msgid "Add new album"
|
609 |
msgstr "Album hinzufügen"
|
610 |
|
611 |
-
#: ../admin/album.php:
|
612 |
msgid "Add"
|
613 |
msgstr "Hinzufügen"
|
614 |
|
615 |
-
#: ../admin/album.php:
|
616 |
msgid "Show / hide used galleries"
|
617 |
msgstr "Zeige / Verstecke verwendete Galerien"
|
618 |
|
619 |
-
#: ../admin/album.php:
|
620 |
msgid "[Show all]"
|
621 |
msgstr "[Alle zeigen]"
|
622 |
|
623 |
-
#: ../admin/album.php:
|
624 |
msgid "Maximize the widget content"
|
625 |
msgstr "Maximiere die Widgets"
|
626 |
|
627 |
-
#: ../admin/album.php:
|
628 |
msgid "[Maximize]"
|
629 |
msgstr "[Vergrößern]"
|
630 |
|
631 |
-
#: ../admin/album.php:
|
632 |
msgid "Minimize the widget content"
|
633 |
msgstr "Minimiere die Widgets"
|
634 |
|
635 |
-
#: ../admin/album.php:
|
636 |
msgid "[Minimize]"
|
637 |
msgstr "[Verkleinern]"
|
638 |
|
639 |
-
#: ../admin/album.php:
|
640 |
msgid "After you create and select a album, you can drag and drop a gallery or another album into your new album below"
|
641 |
msgstr "Nachdem Du ein Album erstellt und ausgewählt hast, kannst Du per Drag & Drop eine Galerie oder ein anderes Album in das neue Album ziehen"
|
642 |
|
643 |
-
#: ../admin/album.php:
|
644 |
msgid "Select gallery"
|
645 |
msgstr "Wähle Galerie"
|
646 |
|
647 |
-
#: ../admin/album.php:
|
648 |
msgid "Album ID"
|
649 |
msgstr "Album ID"
|
650 |
|
651 |
-
#: ../admin/album.php:
|
652 |
msgid "No album selected!"
|
653 |
msgstr "Kein Album ausgewählt"
|
654 |
|
655 |
-
#: ../admin/album.php:
|
656 |
msgid "Album name:"
|
657 |
msgstr "Album Name :"
|
658 |
|
659 |
-
#: ../admin/album.php:
|
660 |
msgid "Album description:"
|
661 |
msgstr "Beschreibung:"
|
662 |
|
663 |
-
#: ../admin/album.php:
|
664 |
msgid "Select a preview image:"
|
665 |
msgstr "Wähle Vorschaubild:"
|
666 |
|
667 |
-
#: ../admin/album.php:
|
|
|
668 |
msgid "No picture"
|
669 |
msgstr "Kein Bild"
|
670 |
|
671 |
-
#: ../admin/album.php:
|
672 |
-
#: ../admin/manage-images.php:
|
673 |
msgid "Page Link to"
|
674 |
msgstr "Seite verlinkt zu"
|
675 |
|
676 |
-
#: ../admin/album.php:
|
677 |
-
#: ../admin/manage-images.php:
|
678 |
msgid "Not linked"
|
679 |
msgstr "Nicht verlinkt"
|
680 |
|
681 |
-
#: ../admin/album.php:
|
682 |
-
#: ../admin/manage-galleries.php:
|
683 |
-
#: ../admin/manage-galleries.php:
|
684 |
-
#: ../admin/manage-galleries.php:
|
685 |
-
#: ../admin/manage-images.php:
|
686 |
-
#: ../admin/manage-images.php:
|
687 |
-
#: ../admin/manage-images.php:
|
688 |
-
#: ../admin/manage-images.php:
|
689 |
msgid "OK"
|
690 |
msgstr "OK"
|
691 |
|
692 |
-
#: ../admin/album.php:
|
693 |
-
#: ../admin/manage-galleries.php:
|
694 |
-
#: ../admin/manage-galleries.php:
|
695 |
-
#: ../admin/manage-galleries.php:
|
696 |
-
#: ../admin/manage-images.php:
|
697 |
-
#: ../admin/manage-images.php:
|
698 |
-
#: ../admin/manage-images.php:
|
699 |
-
#: ../admin/manage-images.php:
|
700 |
msgid "Cancel"
|
701 |
msgstr "Abbrechen"
|
702 |
|
703 |
-
#: ../admin/album.php:
|
704 |
msgid "Name"
|
705 |
msgstr "Name"
|
706 |
|
707 |
-
#: ../admin/album.php:
|
708 |
-
#: ../admin/manage-
|
709 |
-
#: ../admin/manage-galleries.php:171
|
710 |
-
#: ../admin/manage-images.php:217
|
711 |
msgid "Title"
|
712 |
msgstr "Titel"
|
713 |
|
714 |
-
#: ../admin/album.php:
|
715 |
msgid "Page"
|
716 |
msgstr "Seite"
|
717 |
|
@@ -731,274 +738,272 @@ msgstr "Konnte Vorschaubild nicht erzeugen"
|
|
731 |
msgid "Select the area for the thumbnail from the picture on the left."
|
732 |
msgstr "Wähle den Ausschnitt für das Vorschaubild innerhalb des Bildes"
|
733 |
|
734 |
-
#: ../admin/functions.php:
|
735 |
msgid "No valid gallery name!"
|
736 |
msgstr "Kein gültiger Galerie-Name!"
|
737 |
|
738 |
-
#: ../admin/functions.php:
|
739 |
-
#: ../admin/functions.php:
|
740 |
-
#: ../admin/functions.php:
|
741 |
-
#: ../admin/functions.php:
|
742 |
-
#: ../admin/functions.php:
|
743 |
msgid "Directory"
|
744 |
msgstr "Verzeichnis"
|
745 |
|
746 |
-
#: ../admin/functions.php:
|
747 |
msgid "didn't exist. Please create first the main gallery folder "
|
748 |
msgstr "nicht gefunden. Bitte erstelle zuerst das Hauptverzeichnis."
|
749 |
|
750 |
-
#: ../admin/functions.php:
|
751 |
-
#: ../admin/functions.php:
|
752 |
msgid "Check this link, if you didn't know how to set the permission :"
|
753 |
msgstr "Dieser Link zeigt Dir, wie man Verzeichnisrechte ändert :"
|
754 |
|
755 |
-
#: ../admin/functions.php:
|
756 |
-
#: ../admin/functions.php:
|
757 |
msgid "is not writeable !"
|
758 |
msgstr "ist schreibgeschützt !"
|
759 |
|
760 |
-
#: ../admin/functions.php:
|
761 |
-
#: ../admin/functions.php:
|
762 |
-
#: ../admin/functions.php:
|
763 |
msgid "Unable to create directory "
|
764 |
msgstr "Kann Verzeichnis nicht erstellen "
|
765 |
|
766 |
-
#: ../admin/functions.php:
|
767 |
msgid "The server setting Safe-Mode is on !"
|
768 |
msgstr "Auf dem Server ist Safe-Mode aktiviert (PHP.INI)"
|
769 |
|
770 |
-
#: ../admin/functions.php:
|
771 |
msgid "If you have problems, please create directory"
|
772 |
msgstr "Wenn Probleme auftreten, erstelle bitte das Verzeichnis"
|
773 |
|
774 |
-
#: ../admin/functions.php:
|
775 |
msgid "and the thumbnails directory"
|
776 |
msgstr "und das Thumbnails-Verzeichnis"
|
777 |
|
778 |
-
#: ../admin/functions.php:
|
779 |
msgid "with permission 777 manually !"
|
780 |
msgstr "mit den Berechtigungen 777 manuell !"
|
781 |
|
782 |
-
#: ../admin/functions.php:
|
783 |
-
msgid "already exists"
|
784 |
-
msgstr "gibt es bereits"
|
785 |
-
|
786 |
-
#: ../admin/functions.php:113
|
787 |
#, php-format
|
788 |
-
msgid "Gallery %1$s successfully created
|
789 |
-
msgstr "Galerie %1$s erstellt..<br/>Du kannst diese Galerie jetzt mit dem Stichwort %2$s einbinden.<br/>"
|
790 |
|
791 |
-
#: ../admin/functions.php:
|
792 |
msgid "Edit gallery"
|
793 |
msgstr "Galerie ändern"
|
794 |
|
795 |
-
#: ../admin/functions.php:
|
796 |
msgid "doesn`t exist!"
|
797 |
msgstr "gibt es nicht !"
|
798 |
|
799 |
-
#: ../admin/functions.php:
|
800 |
msgid "contains no pictures"
|
801 |
msgstr "enthält keine Bilder"
|
802 |
|
803 |
-
#: ../admin/functions.php:
|
804 |
msgid "Database error. Could not add gallery!"
|
805 |
msgstr "Datenbank-Fehler. Kann Galerie nicht hinzufügen!"
|
806 |
|
807 |
-
#: ../admin/functions.php:
|
808 |
msgid "successfully created!"
|
809 |
msgstr "erfolgreich erstellt!"
|
810 |
|
811 |
-
#: ../admin/functions.php:
|
812 |
-
#: ../admin/functions.php:
|
813 |
-
#: ../admin/manage-galleries.php:
|
814 |
-
#: ../admin/manage-
|
815 |
-
#: ../admin/manage.php:
|
816 |
-
#: ../admin/manage.php:
|
|
|
|
|
817 |
msgid "Create new thumbnails"
|
818 |
msgstr "Neue Vorschaubilder erstellen"
|
819 |
|
820 |
-
#: ../admin/functions.php:
|
821 |
msgid " picture(s) successfully added"
|
822 |
msgstr " Bild(er) erfolgreich hinzugefügt"
|
823 |
|
824 |
-
#: ../admin/functions.php:
|
825 |
-
#: ../admin/functions.php:
|
826 |
-
#: ../admin/functions.php:
|
827 |
-
#: ../admin/functions.php:
|
828 |
-
#: ../admin/functions.php:
|
829 |
msgid "Object didn't contain correct data"
|
830 |
msgstr "Das Objekt enhält nicht die notwendigen Daten"
|
831 |
|
832 |
-
#: ../admin/functions.php:
|
833 |
msgid " is not writeable "
|
834 |
msgstr "ist schreibgeschützt !"
|
835 |
|
836 |
-
#: ../admin/functions.php:
|
837 |
-
#: ../admin/functions.php:
|
838 |
-
#: ../admin/functions.php:
|
839 |
-
#: ../admin/functions.php:
|
840 |
msgid " is not writeable"
|
841 |
msgstr "ist schreibgeschützt !"
|
842 |
|
843 |
-
#: ../admin/functions.php:
|
844 |
msgid "File do not exists"
|
845 |
msgstr "Datei existiert nicht"
|
846 |
|
847 |
-
#: ../admin/functions.php:
|
848 |
msgid "Couldn't restore original image"
|
849 |
msgstr "Konnte Originalbild nicht wiederherstellen"
|
850 |
|
851 |
-
#: ../admin/functions.php:
|
852 |
msgid "(Error : Couldn't not update data base)"
|
853 |
msgstr "(Fehler : Konnte Datenbank nicht updaten)"
|
854 |
|
855 |
-
#: ../admin/functions.php:
|
856 |
msgid "(Error : Couldn't not update meta data)"
|
857 |
msgstr "(Fehler : Konnte Metadaten nicht speichern)"
|
858 |
|
859 |
-
#: ../admin/functions.php:
|
860 |
msgid "(Error : Couldn't not find image)"
|
861 |
msgstr "(Fehler : Konnte das Bild nicht finden)"
|
862 |
|
863 |
-
#: ../admin/functions.php:
|
864 |
msgid "No valid URL path "
|
865 |
msgstr "Kein gültiger URL-Pfad"
|
866 |
|
867 |
-
#: ../admin/functions.php:
|
868 |
msgid "Import via cURL failed."
|
869 |
msgstr "Import via cURL abgebrochen"
|
870 |
|
871 |
-
#: ../admin/functions.php:
|
872 |
-
msgid "Uploaded file was no or a faulty zip file ! The server
|
873 |
msgstr "Die hochgeladene Datei war keine korrekte Zip-Datei. Servermeldung :"
|
874 |
|
875 |
-
#: ../admin/functions.php:
|
876 |
msgid "Could not get a valid foldername"
|
877 |
msgstr "Konnte keinen gültigen Verzeichnisnamen finden"
|
878 |
|
879 |
-
#: ../admin/functions.php:
|
880 |
#, php-format
|
881 |
msgid "Unable to create directory %s. Is its parent directory writable by the server?"
|
882 |
msgstr "Kann das Verzeichnis %s nicht erstellen. Ist das Hauptverzeichnis vielleicht schreibgeschützt ?"
|
883 |
|
884 |
-
#: ../admin/functions.php:
|
885 |
msgid "Zip-File successfully unpacked"
|
886 |
msgstr "Zip-Datei erfolgreich entpackt"
|
887 |
|
888 |
-
#: ../admin/functions.php:
|
889 |
-
#: ../admin/functions.php:
|
890 |
msgid "Failure in database, no gallery path set !"
|
891 |
msgstr "Datenbankfehler! Kein Galerie-Pfad gesetzt !"
|
892 |
|
893 |
-
#: ../admin/functions.php:
|
894 |
-
#: ../admin/functions.php:
|
895 |
msgid "is no valid image file!"
|
896 |
msgstr "ist keine zulässige Bilddatei !"
|
897 |
|
898 |
-
#: ../admin/functions.php:
|
899 |
-
#: ../admin/functions.php:
|
900 |
-
#: ../admin/functions.php:
|
901 |
#, php-format
|
902 |
msgid "Unable to write to directory %s. Is this directory writable by the server?"
|
903 |
msgstr "Kann das Verzeichnis %s nicht erstellen. Ist das Hauptverzeichnis vielleicht schreibgeschützt ?"
|
904 |
|
905 |
-
#: ../admin/functions.php:
|
906 |
-
#: ../admin/functions.php:
|
907 |
-
msgid "Error, the file could not moved to : "
|
908 |
msgstr "Fehler: Diese Datei kann nicht verschoben werden zu :"
|
909 |
|
910 |
-
#: ../admin/functions.php:
|
911 |
-
#: ../admin/functions.php:
|
912 |
-
msgid "Error, the file permissions could not set"
|
913 |
msgstr "Fehler: Die Berechtigungen für diese Datei können nicht gesetzt werden"
|
914 |
|
915 |
-
#: ../admin/functions.php:
|
916 |
msgid " Image(s) successfully added"
|
917 |
msgstr " Bild(er) erfolgreich hinzugefügt"
|
918 |
|
919 |
-
#: ../admin/functions.php:
|
920 |
msgid "Invalid upload. Error Code : "
|
921 |
msgstr "Ungültiger Upload. Fehler Code :"
|
922 |
|
923 |
-
#: ../admin/functions.php:
|
924 |
#, php-format
|
925 |
msgid "SAFE MODE Restriction in effect! You need to create the folder <strong>%s</strong> manually"
|
926 |
msgstr "SAFE MODE Einschränkungen ist aktiv. Du musst das Verzeichnis <strong>%s</strong> manuell anlegen."
|
927 |
|
928 |
-
#: ../admin/functions.php:
|
929 |
#, php-format
|
930 |
msgid "When safe_mode is on, PHP checks to see if the owner (%s) of the current script matches the owner (%s) of the file to be operated on by a file function or its directory"
|
931 |
msgstr "Wenn der Safe-Mode eingeschaltet ist, überprüft PHP, ob der Besitzer (%s) des Skript mit dem Besitzer (%s) der Datei/Verzeichnis übereinstimmt."
|
932 |
|
933 |
-
#: ../admin/functions.php:
|
934 |
-
#: ../admin/functions.php:
|
935 |
msgid "The destination gallery does not exist"
|
936 |
msgstr "Die ausgewählte Galerie existiert nicht"
|
937 |
|
938 |
-
#: ../admin/functions.php:
|
939 |
#, php-format
|
940 |
msgid "Failed to move image %1$s to %2$s"
|
941 |
msgstr "Konnte das Bild %1$s nicht nach %2$s verschieben"
|
942 |
|
943 |
-
#: ../admin/functions.php:
|
944 |
#, php-format
|
945 |
msgid "Moved %1$s picture(s) to gallery : %2$s ."
|
946 |
msgstr " %1$s Bild(er) in Galerie : %2$s verschoben."
|
947 |
|
948 |
-
#: ../admin/functions.php:
|
949 |
#, php-format
|
950 |
msgid "Failed to copy image %1$s to %2$s"
|
951 |
msgstr "Konnte das Bild %1$s nicht nach %2$s kopieren"
|
952 |
|
953 |
-
#: ../admin/functions.php:
|
954 |
#, php-format
|
955 |
msgid "Failed to copy database row for picture %s"
|
956 |
msgstr "Fehler bei der Datenbank-Operation für Bild %s"
|
957 |
|
958 |
-
#: ../admin/functions.php:
|
959 |
#, php-format
|
960 |
msgid "Image %1$s (%2$s) copied as image %3$s (%4$s) » The file already existed in the destination gallery."
|
961 |
msgstr "Bild %1$s (%2$s) als Bild %3$s (%4$s) kopiert » Die Datei existierte bereits."
|
962 |
|
963 |
-
#: ../admin/functions.php:
|
964 |
#, php-format
|
965 |
msgid "Image %1$s (%2$s) copied as image %3$s (%4$s)"
|
966 |
msgstr "Bild %1$s (%2$s) kopiert als Bild %3$s (%4$s)"
|
967 |
|
968 |
-
#: ../admin/functions.php:
|
969 |
#, php-format
|
970 |
msgid "Copied %1$s picture(s) to gallery: %2$s ."
|
971 |
msgstr "Kopiere %1$s Bild(er) in die Galerie : %2$s ."
|
972 |
|
973 |
-
#: ../admin/functions.php:
|
974 |
msgid "The uploaded file exceeds the upload_max_filesize directive in php.ini"
|
975 |
msgstr "Die Datei überschreitet die erlaubte Grösse (upload_max_filesize) in der php.ini"
|
976 |
|
977 |
-
#: ../admin/functions.php:
|
978 |
msgid "The uploaded file exceeds the MAX_FILE_SIZE directive that was specified in the HTML form"
|
979 |
msgstr "Die Datei ist zu gross"
|
980 |
|
981 |
-
#: ../admin/functions.php:
|
982 |
msgid "The uploaded file was only partially uploaded"
|
983 |
msgstr "Die Datei wurde nur teilweise hochgeladen"
|
984 |
|
985 |
-
#: ../admin/functions.php:
|
986 |
msgid "No file was uploaded"
|
987 |
msgstr "Keinen Datei wurde geladen"
|
988 |
|
989 |
-
#: ../admin/functions.php:
|
990 |
msgid "Missing a temporary folder"
|
991 |
msgstr "Konnte temporäres Verzeichnis nicht finden"
|
992 |
|
993 |
-
#: ../admin/functions.php:
|
994 |
msgid "Failed to write file to disk"
|
995 |
msgstr "Konnte Datei nicht speichern"
|
996 |
|
997 |
-
#: ../admin/functions.php:
|
998 |
msgid "File upload stopped by extension"
|
999 |
msgstr "Upload dieser Dateierweiterung nicht erlaubt"
|
1000 |
|
1001 |
-
#: ../admin/functions.php:
|
1002 |
msgid "Unknown upload error"
|
1003 |
msgstr "Unbekannter Uploadfehler"
|
1004 |
|
@@ -1006,15 +1011,15 @@ msgstr "Unbekannter Uploadfehler"
|
|
1006 |
msgid "Sorry, NextGEN Gallery works only with a role called administrator"
|
1007 |
msgstr "Tut mir leid, aber NextGEN Gallery benötigt zwingend die Rolle \"Administrator\""
|
1008 |
|
1009 |
-
#: ../admin/install.php:
|
1010 |
msgid "NextGEN Gallery : Tables could not created, please check your database settings"
|
1011 |
msgstr "NextGEN Gallery : Tabellen konnten nicht erstellt werden, überprüfe Deine Datenbank"
|
1012 |
|
1013 |
-
#: ../admin/install.php:
|
1014 |
msgid "[Show as slideshow]"
|
1015 |
msgstr "[Zeige als Diashow]"
|
1016 |
|
1017 |
-
#: ../admin/install.php:
|
1018 |
msgid "[Show picture list]"
|
1019 |
msgstr "[Zeige Bilder-Liste]"
|
1020 |
|
@@ -1029,10 +1034,19 @@ msgid "»"
|
|
1029 |
msgstr "»"
|
1030 |
|
1031 |
#: ../admin/manage-galleries.php:62
|
1032 |
-
#: ../admin/manage-images.php:
|
1033 |
msgid "No images selected"
|
1034 |
msgstr "Keine Bilder ausgewählt"
|
1035 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1036 |
#: ../admin/manage-galleries.php:79
|
1037 |
#, php-format
|
1038 |
msgid ""
|
@@ -1044,140 +1058,117 @@ msgstr ""
|
|
1044 |
" \n"
|
1045 |
" 'Abbrechen' um zu stoppen, 'OK' um die Bearbeitung durchzuführen."
|
1046 |
|
1047 |
-
#: ../admin/manage-galleries.php:
|
1048 |
-
|
1049 |
-
|
1050 |
-
|
1051 |
-
#: ../admin/manage-galleries.php:111
|
1052 |
-
#: ../admin/manage-galleries.php:114
|
1053 |
-
#: ../admin/manage-images.php:187
|
1054 |
-
#: ../admin/manage-images.php:190
|
1055 |
msgid "Search Images"
|
1056 |
msgstr "Suche Bilder"
|
1057 |
|
1058 |
-
#: ../admin/manage-galleries.php:
|
1059 |
-
#: ../admin/manage-images.php:
|
1060 |
-
msgid "
|
1061 |
-
msgstr "
|
1062 |
-
|
1063 |
-
#: ../admin/manage-galleries.php:
|
1064 |
-
#: ../admin/manage-images.php:
|
1065 |
-
#: ../admin/manage.php:
|
1066 |
-
#: ../admin/manage.php:
|
1067 |
msgid "Set watermark"
|
1068 |
msgstr "Wasserzeichen setzen"
|
1069 |
|
1070 |
-
#: ../admin/manage-galleries.php:
|
1071 |
-
#: ../admin/manage-images.php:
|
1072 |
-
#: ../admin/manage.php:
|
1073 |
-
#: ../admin/manage.php:
|
1074 |
-
msgid "Resize images"
|
1075 |
-
msgstr "Bilder verkleinern"
|
1076 |
-
|
1077 |
-
#: ../admin/manage-galleries.php:130
|
1078 |
-
#: ../admin/manage-images.php:306
|
1079 |
-
#: ../admin/manage.php:168
|
1080 |
-
#: ../admin/manage.php:261
|
1081 |
msgid "Import metadata"
|
1082 |
msgstr "Metadaten importieren"
|
1083 |
|
1084 |
-
#: ../admin/manage-galleries.php:
|
1085 |
-
#: ../admin/manage-images.php:
|
1086 |
-
#: ../admin/manage.php:
|
1087 |
-
#: ../admin/manage.php:
|
1088 |
msgid "Recover from backup"
|
1089 |
msgstr "Original wiederherstellen"
|
1090 |
|
1091 |
-
#: ../admin/manage-galleries.php:
|
1092 |
-
#: ../admin/manage-images.php:
|
1093 |
msgid "Apply"
|
1094 |
msgstr "Übernehmen"
|
1095 |
|
1096 |
-
#: ../admin/manage-galleries.php:
|
1097 |
-
#: ../admin/manage-galleries.php:
|
1098 |
-
#: ../admin/manage-images.php:
|
1099 |
-
#: ../admin/manage-images.php:
|
1100 |
#, php-format
|
1101 |
msgid "Displaying %s–%s of %s"
|
1102 |
msgstr "Zeige %s–%s von %s"
|
1103 |
|
1104 |
-
#: ../admin/manage-galleries.php:
|
1105 |
-
#: ../admin/manage-galleries.php:170
|
1106 |
-
#: ../admin/manage-images.php:619
|
1107 |
-
msgid "ID"
|
1108 |
-
msgstr "ID"
|
1109 |
-
|
1110 |
-
#: ../admin/manage-galleries.php:158
|
1111 |
-
#: ../admin/manage-galleries.php:172
|
1112 |
-
#: ../admin/manage-images.php:228
|
1113 |
-
#: ../admin/manage-images.php:624
|
1114 |
-
msgid "Description"
|
1115 |
-
msgstr "Beschreibung"
|
1116 |
-
|
1117 |
-
#: ../admin/manage-galleries.php:159
|
1118 |
-
#: ../admin/manage-galleries.php:173
|
1119 |
-
#: ../admin/manage-images.php:248
|
1120 |
-
msgid "Author"
|
1121 |
-
msgstr "Autor"
|
1122 |
-
|
1123 |
-
#: ../admin/manage-galleries.php:160
|
1124 |
-
#: ../admin/manage-galleries.php:174
|
1125 |
-
msgid "Page ID"
|
1126 |
-
msgstr "Seiten-ID"
|
1127 |
-
|
1128 |
-
#: ../admin/manage-galleries.php:161
|
1129 |
-
#: ../admin/manage-galleries.php:175
|
1130 |
-
msgid "Quantity"
|
1131 |
-
msgstr "Anzahl"
|
1132 |
-
|
1133 |
-
#: ../admin/manage-galleries.php:162
|
1134 |
-
#: ../admin/manage-galleries.php:176
|
1135 |
-
msgid "Action"
|
1136 |
-
msgstr "Aktion"
|
1137 |
-
|
1138 |
-
#: ../admin/manage-galleries.php:198
|
1139 |
msgid "Edit"
|
1140 |
msgstr "Bearbeiten"
|
1141 |
|
1142 |
-
#: ../admin/manage-galleries.php:
|
1143 |
-
|
1144 |
-
msgstr "Diese Galerie löschen ?"
|
1145 |
-
|
1146 |
-
#: ../admin/manage-galleries.php:218
|
1147 |
-
#: ../admin/manage-images.php:466
|
1148 |
msgid "No entries found"
|
1149 |
msgstr "Keine Einträge gefunden"
|
1150 |
|
1151 |
-
#: ../admin/manage-galleries.php:
|
1152 |
-
#: ../admin/manage-images.php:
|
1153 |
msgid "Resize Images to"
|
1154 |
msgstr "Verkleiner Bilder auf"
|
1155 |
|
1156 |
-
#: ../admin/manage-galleries.php:
|
1157 |
-
#: ../admin/manage-images.php:
|
1158 |
msgid "Width x height (in pixel). NextGEN Gallery will keep ratio size"
|
1159 |
msgstr "Breite x Höhe (in Pixel). Das Seitenverhältnis wird berücksichtigt."
|
1160 |
|
1161 |
-
#: ../admin/manage-galleries.php:
|
1162 |
-
#: ../admin/manage-images.php:
|
1163 |
msgid "Width x height (in pixel)"
|
1164 |
msgstr "Breite x Höhe (in Pixel)"
|
1165 |
|
1166 |
-
#: ../admin/manage-galleries.php:
|
1167 |
-
#: ../admin/manage-images.php:
|
1168 |
msgid "These values are maximum values "
|
1169 |
msgstr "Diese Angaben sind maximale Angaben."
|
1170 |
|
1171 |
-
#: ../admin/manage-galleries.php:
|
1172 |
-
#: ../admin/manage-images.php:
|
1173 |
msgid "Set fix dimension"
|
1174 |
msgstr "Setze feste Größe"
|
1175 |
|
1176 |
-
#: ../admin/manage-galleries.php:
|
1177 |
-
#: ../admin/manage-images.php:
|
1178 |
msgid "Ignore the aspect ratio, no portrait thumbnails"
|
1179 |
msgstr "Ignoriere Bildseitenverhältnis"
|
1180 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1181 |
#: ../admin/manage-images.php:32
|
1182 |
msgid "Gallery not found."
|
1183 |
msgstr "Galerie nicht gefunden"
|
@@ -1186,7 +1177,28 @@ msgstr "Galerie nicht gefunden"
|
|
1186 |
msgid "Sorry, you have no access here"
|
1187 |
msgstr "Sorry, Du hast nicht genügend Rechte"
|
1188 |
|
1189 |
-
#: ../admin/manage-images.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1190 |
#, php-format
|
1191 |
msgid ""
|
1192 |
"You are about to start the bulk edit for %s images \n"
|
@@ -1197,270 +1209,280 @@ msgstr ""
|
|
1197 |
" \n"
|
1198 |
" 'Abbrechen' um zu stoppen, 'OK' um die Bearbeitung durchzuführen."
|
1199 |
|
1200 |
-
#: ../admin/manage-images.php:
|
1201 |
#, php-format
|
1202 |
msgid "Search results for “%s”"
|
1203 |
msgstr "Suchergebinsse für “%s”"
|
1204 |
|
1205 |
-
#: ../admin/manage-images.php:
|
1206 |
msgid "Gallery settings"
|
1207 |
msgstr "Galerie Einstellungen"
|
1208 |
|
1209 |
-
#: ../admin/manage-images.php:
|
1210 |
msgid "Click here for more settings"
|
1211 |
msgstr "Hier klicken für weitere Einstellungen"
|
1212 |
|
1213 |
-
#: ../admin/manage-images.php:
|
1214 |
msgid "Preview image"
|
1215 |
msgstr "Vorschau-Bild"
|
1216 |
|
1217 |
-
#: ../admin/manage-images.php:
|
1218 |
msgid "No Picture"
|
1219 |
msgstr "Kein Bild"
|
1220 |
|
1221 |
-
#: ../admin/manage-images.php:
|
1222 |
msgid "Path"
|
1223 |
msgstr "Pfad"
|
1224 |
|
1225 |
-
#: ../admin/manage-images.php:
|
1226 |
msgid "Create new page"
|
1227 |
msgstr "Neue Seite erstellen"
|
1228 |
|
1229 |
-
#: ../admin/manage-images.php:
|
1230 |
msgid "Main page (No parent)"
|
1231 |
msgstr "Hauptseite (keine Unterseite)"
|
1232 |
|
1233 |
-
#: ../admin/manage-images.php:
|
1234 |
msgid "Add page"
|
1235 |
msgstr "Seite hinzufügen"
|
1236 |
|
1237 |
-
#: ../admin/manage-images.php:
|
1238 |
msgid "Scan Folder for new images"
|
1239 |
msgstr "Überprüfe Verzeichnis nach neuen Bildern"
|
1240 |
|
1241 |
-
#: ../admin/manage-images.php:
|
1242 |
-
#: ../admin/manage-images.php:
|
1243 |
-
#: ../admin/manage-images.php:
|
1244 |
msgid "Save Changes"
|
1245 |
msgstr "Änderungen speichern"
|
1246 |
|
1247 |
-
#: ../admin/manage-images.php:
|
1248 |
msgid "Delete images"
|
1249 |
msgstr "Bilder löschen"
|
1250 |
|
1251 |
-
#: ../admin/manage-images.php:
|
1252 |
msgid "Rotate images clockwise"
|
1253 |
msgstr "Rechts drehen"
|
1254 |
|
1255 |
-
#: ../admin/manage-images.php:
|
1256 |
msgid "Rotate images counter-clockwise"
|
1257 |
msgstr "Links drehen"
|
1258 |
|
1259 |
-
#: ../admin/manage-images.php:
|
1260 |
msgid "Copy to..."
|
1261 |
msgstr "Kopiere nach..."
|
1262 |
|
1263 |
-
#: ../admin/manage-images.php:
|
1264 |
msgid "Move to..."
|
1265 |
msgstr "Verschiebe nach..."
|
1266 |
|
1267 |
-
#: ../admin/manage-images.php:
|
1268 |
msgid "Add tags"
|
1269 |
msgstr "Stichwörter hinzufügen"
|
1270 |
|
1271 |
-
#: ../admin/manage-images.php:
|
1272 |
-
msgid "Delete tags"
|
1273 |
-
msgstr "Stichwörter löschen"
|
1274 |
-
|
1275 |
-
#: ../admin/manage-images.php:313
|
1276 |
msgid "Overwrite tags"
|
1277 |
msgstr "Stichwörter überschreiben"
|
1278 |
|
1279 |
-
#: ../admin/manage-images.php:
|
1280 |
msgid "Sort gallery"
|
1281 |
msgstr "Sortiere Bilder"
|
1282 |
|
1283 |
-
#: ../admin/manage-images.php:
|
1284 |
msgid "pixel"
|
1285 |
msgstr "pixel"
|
1286 |
|
1287 |
-
#: ../admin/manage-images.php:
|
1288 |
#, php-format
|
1289 |
msgid "View \"%s\""
|
1290 |
msgstr "Anzeigen \"%s\""
|
1291 |
|
1292 |
-
#: ../admin/manage-images.php:
|
1293 |
msgid "View"
|
1294 |
msgstr "Ansehen"
|
1295 |
|
1296 |
-
#: ../admin/manage-images.php:
|
1297 |
msgid "Show Meta data"
|
1298 |
msgstr "Zeige Metadaten"
|
1299 |
|
1300 |
-
#: ../admin/manage-images.php:
|
1301 |
msgid "Meta"
|
1302 |
msgstr "Meta"
|
1303 |
|
1304 |
-
#: ../admin/manage-images.php:
|
1305 |
msgid "Customize thumbnail"
|
1306 |
msgstr "Thumbnails anpassen"
|
1307 |
|
1308 |
-
#: ../admin/manage-images.php:
|
1309 |
msgid "Edit thumb"
|
1310 |
msgstr "Thumbnail ändern"
|
1311 |
|
1312 |
-
#: ../admin/manage-images.php:
|
1313 |
msgid "Rotate"
|
1314 |
msgstr "Drehen"
|
1315 |
|
1316 |
-
#: ../admin/manage-images.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1317 |
msgid "Recover"
|
1318 |
msgstr "Rücksetzen"
|
1319 |
|
1320 |
-
#: ../admin/manage-images.php:
|
1321 |
#, php-format
|
1322 |
msgid "Recover \"%s\" ?"
|
1323 |
msgstr " \"%s\" wiederherstellen ?"
|
1324 |
|
1325 |
-
#: ../admin/manage-images.php:
|
1326 |
#, php-format
|
1327 |
msgid "Delete \"%s\" ?"
|
1328 |
msgstr "Lösche \"%s\" ?"
|
1329 |
|
1330 |
-
#: ../admin/manage-images.php:
|
1331 |
msgid "Enter the tags"
|
1332 |
msgstr "Stichwörter angeben"
|
1333 |
|
1334 |
-
#: ../admin/manage-images.php:
|
1335 |
msgid "Select the destination gallery:"
|
1336 |
msgstr "Galerie auswählen:"
|
1337 |
|
1338 |
-
#: ../admin/manage-images.php:
|
1339 |
msgid "Thumbnail"
|
1340 |
msgstr "Thumbnail"
|
1341 |
|
1342 |
-
#: ../admin/manage-images.php:
|
1343 |
-
#: ../admin/manage-sort.php:
|
1344 |
msgid "Filename"
|
1345 |
msgstr "Dateiname"
|
1346 |
|
1347 |
-
#: ../admin/manage-images.php:
|
1348 |
msgid "Alt & Title Text"
|
1349 |
msgstr "Alt & Titel Text"
|
1350 |
|
1351 |
-
#: ../admin/manage-images.php:
|
1352 |
msgid "Tags (comma separated list)"
|
1353 |
msgstr "Stichwörter (Tags)"
|
1354 |
|
1355 |
-
#: ../admin/manage-images.php:
|
1356 |
msgid "exclude"
|
1357 |
msgstr "ausschließen"
|
1358 |
|
1359 |
-
#: ../admin/manage-sort.php:
|
1360 |
msgid "Sort order changed"
|
1361 |
msgstr "Reihenfolge aktualisiert"
|
1362 |
|
1363 |
-
#: ../admin/manage-sort.php:
|
1364 |
msgid "Sort Gallery"
|
1365 |
msgstr "Sortiere Bilder"
|
1366 |
|
1367 |
-
#: ../admin/manage-sort.php:
|
1368 |
msgid "Update Sort Order"
|
1369 |
msgstr "Sortierung speichern"
|
1370 |
|
1371 |
-
#: ../admin/manage-sort.php:
|
1372 |
msgid "Back to gallery"
|
1373 |
msgstr "Zurück zur Galerie"
|
1374 |
|
1375 |
-
#: ../admin/manage-sort.php:
|
1376 |
msgid "Presort"
|
1377 |
msgstr "Vorsortieren"
|
1378 |
|
1379 |
-
#: ../admin/manage-sort.php:
|
1380 |
msgid "Unsorted"
|
1381 |
msgstr "Unsortiert"
|
1382 |
|
1383 |
-
#: ../admin/manage-sort.php:
|
1384 |
msgid "Image ID"
|
1385 |
msgstr "Bilder ID"
|
1386 |
|
1387 |
-
#: ../admin/manage-sort.php:
|
1388 |
msgid "Alt/Title text"
|
1389 |
msgstr "Alt / Titel Text"
|
1390 |
|
1391 |
-
#: ../admin/manage-sort.php:
|
1392 |
msgid "Date/Time"
|
1393 |
msgstr "Datum/Zeit"
|
1394 |
|
1395 |
-
#: ../admin/manage-sort.php:
|
1396 |
msgid "Ascending"
|
1397 |
msgstr "Aufsteigend"
|
1398 |
|
1399 |
-
#: ../admin/manage-sort.php:
|
1400 |
msgid "Descending"
|
1401 |
msgstr "Absteigend"
|
1402 |
|
1403 |
-
#: ../admin/manage.php:
|
1404 |
-
#: ../admin/manage.php:107
|
1405 |
-
msgid "deleted successfully"
|
1406 |
-
msgstr "erfolgreich gelöscht"
|
1407 |
-
|
1408 |
-
#: ../admin/manage.php:107
|
1409 |
msgid "Picture"
|
1410 |
msgstr "Bild"
|
1411 |
|
1412 |
-
#: ../admin/manage.php:
|
1413 |
-
|
|
|
|
|
|
|
|
|
1414 |
msgid "Operation successful. Please clear your browser cache."
|
1415 |
msgstr "Thumbnails erfolgreich erstellt. Bitte Browser-Cache löschen."
|
1416 |
|
1417 |
-
#: ../admin/manage.php:
|
1418 |
-
|
|
|
|
|
|
|
|
|
1419 |
msgid "Rotate images"
|
1420 |
msgstr "Bild drehen"
|
1421 |
|
1422 |
-
#: ../admin/manage.php:
|
1423 |
msgid "Pictures deleted successfully "
|
1424 |
msgstr "Bilder erfolgreich gelöscht"
|
1425 |
|
1426 |
-
#: ../admin/manage.php:
|
1427 |
msgid "Tags changed"
|
1428 |
msgstr "Stichwörter geändert"
|
1429 |
|
1430 |
-
#: ../admin/manage.php:
|
1431 |
msgid "Update successful"
|
1432 |
msgstr "Aktualisierung erfolgreich"
|
1433 |
|
1434 |
-
#: ../admin/manage.php:
|
1435 |
msgid "New gallery page ID"
|
1436 |
msgstr "Neue Galerie Seiten ID"
|
1437 |
|
1438 |
-
#: ../admin/manage.php:
|
1439 |
msgid "created"
|
1440 |
msgstr "erstellt"
|
1441 |
|
1442 |
-
#: ../admin/
|
1443 |
-
|
|
|
|
|
|
|
1444 |
msgid "No gallery"
|
1445 |
msgstr "Keine Galerie"
|
1446 |
|
1447 |
-
#: ../admin/media-upload.php:
|
1448 |
msgid "Select »"
|
1449 |
msgstr "Wähle »"
|
1450 |
|
1451 |
-
#: ../admin/media-upload.php:
|
1452 |
msgid "Show"
|
1453 |
msgstr "Zeige"
|
1454 |
|
1455 |
-
#: ../admin/media-upload.php:
|
1456 |
msgid "Hide"
|
1457 |
msgstr "Verstecke"
|
1458 |
|
1459 |
-
#: ../admin/media-upload.php:
|
1460 |
msgid "Image ID:"
|
1461 |
msgstr "Bild ID:"
|
1462 |
|
1463 |
-
#: ../admin/media-upload.php:
|
1464 |
msgid "Save all changes"
|
1465 |
msgstr "Änderungen speichern"
|
1466 |
|
@@ -1514,7 +1536,7 @@ msgid "Send a gift to show your appreciation."
|
|
1514 |
msgstr "Schau doch einfach auf meinen Wunschzettel."
|
1515 |
|
1516 |
#: ../admin/overview.php:121
|
1517 |
-
msgid "Help
|
1518 |
msgstr "Hilf das Plugin zu übersetzen."
|
1519 |
|
1520 |
#: ../admin/overview.php:140
|
@@ -1556,12 +1578,6 @@ msgstr "Kein Titel"
|
|
1556 |
msgid "At a Glance"
|
1557 |
msgstr "Übersicht"
|
1558 |
|
1559 |
-
#: ../admin/overview.php:284
|
1560 |
-
msgid "Image"
|
1561 |
-
msgid_plural "Images"
|
1562 |
-
msgstr[0] "Bild"
|
1563 |
-
msgstr[1] "Bilder"
|
1564 |
-
|
1565 |
#: ../admin/overview.php:305
|
1566 |
msgid "Upload pictures"
|
1567 |
msgstr "Bilder hochladen"
|
@@ -1725,6 +1741,46 @@ msgstr "NextGEN Gallery enthält einige Funktionen, die nur unter PHP 5.2 verfü
|
|
1725 |
msgid "Install"
|
1726 |
msgstr "Installieren"
|
1727 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1728 |
#: ../admin/roles.php:22
|
1729 |
msgid "Updated capabilities"
|
1730 |
msgstr "Zugriffsrechte geändert"
|
@@ -1734,7 +1790,7 @@ msgid "Roles / capabilities"
|
|
1734 |
msgstr "Rollen / Zugriffsrechte"
|
1735 |
|
1736 |
#: ../admin/roles.php:29
|
1737 |
-
msgid "Select the lowest role which should be able to access the
|
1738 |
msgstr "Wähle die niedrigste Rolle aus, die Zugriff haben soll. NextGEN Gallery unterstützt nur die Standard-Wordpress-Rollen-Fähigkeiten von WordPress."
|
1739 |
|
1740 |
#: ../admin/roles.php:30
|
@@ -1765,10 +1821,6 @@ msgstr "Alle Galerien verwalten"
|
|
1765 |
msgid "Manage tags"
|
1766 |
msgstr "Verwalte Stichwörter"
|
1767 |
|
1768 |
-
#: ../admin/roles.php:59
|
1769 |
-
msgid "Edit Album"
|
1770 |
-
msgstr "Album erstellen"
|
1771 |
-
|
1772 |
#: ../admin/roles.php:63
|
1773 |
msgid "Change style"
|
1774 |
msgstr "Style anpassen"
|
@@ -1805,588 +1857,593 @@ msgstr "Vertikal spiegeln"
|
|
1805 |
msgid "Flip horizontally"
|
1806 |
msgstr "Horizontal spiegeln"
|
1807 |
|
1808 |
-
#: ../admin/settings.php:
|
1809 |
msgid "Cache cleared"
|
1810 |
msgstr "Cache löschen"
|
1811 |
|
1812 |
-
#: ../admin/settings.php:
|
1813 |
-
#: ../admin/settings.php:
|
1814 |
msgid "General Options"
|
1815 |
msgstr "Allg. Optionen"
|
1816 |
|
1817 |
-
#: ../admin/settings.php:
|
1818 |
-
#: ../admin/settings.php:
|
1819 |
msgid "Thumbnails"
|
1820 |
msgstr "Thumbnails"
|
1821 |
|
1822 |
-
#: ../admin/settings.php:
|
1823 |
msgid "Images"
|
1824 |
msgstr "Bilder"
|
1825 |
|
1826 |
-
#: ../admin/settings.php:
|
1827 |
-
#: ../admin/settings.php:
|
1828 |
msgid "Effects"
|
1829 |
msgstr "Effekte"
|
1830 |
|
1831 |
-
#: ../admin/settings.php:
|
1832 |
-
#: ../admin/settings.php:
|
1833 |
-
#: ../admin/tinymce/window.php:
|
1834 |
msgid "Watermark"
|
1835 |
msgstr "Wasserzeichen"
|
1836 |
|
1837 |
-
#: ../admin/settings.php:
|
1838 |
-
#: ../admin/settings.php:
|
1839 |
-
#: ../admin/settings.php:
|
1840 |
-
#: ../admin/tinymce/window.php:
|
1841 |
msgid "Slideshow"
|
1842 |
msgstr "Slideshow"
|
1843 |
|
1844 |
-
#: ../admin/settings.php:
|
1845 |
-
#: ../admin/wpmu.php:
|
1846 |
msgid "Gallery path"
|
1847 |
msgstr "Galerie-Pfad"
|
1848 |
|
1849 |
-
#: ../admin/settings.php:
|
1850 |
msgid "This is the default path for all galleries"
|
1851 |
msgstr "Dies ist der Standard-Pfad für alle Galerien"
|
1852 |
|
1853 |
-
#: ../admin/settings.php:
|
1854 |
msgid "Delete image files"
|
1855 |
msgstr "Lösche Bilddateien"
|
1856 |
|
1857 |
-
#: ../admin/settings.php:
|
1858 |
msgid "Delete files, when removing a gallery in the database"
|
1859 |
msgstr "Löscht auch die Dateien, falls die Galerie aus der Datenbank entfernt wird"
|
1860 |
|
1861 |
-
#: ../admin/settings.php:
|
1862 |
msgid "Activate permalinks"
|
1863 |
msgstr "Aktiviere Permalinks"
|
1864 |
|
1865 |
-
#: ../admin/settings.php:
|
1866 |
msgid "When you activate this option, you need to update your permalink structure one time."
|
1867 |
msgstr "Wenn Du diese Option aktivierst, muss Du einmal die Permalink Struktur aktualisieren."
|
1868 |
|
1869 |
-
#: ../admin/settings.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1870 |
msgid "Select graphic library"
|
1871 |
msgstr "Wähle Grafik-Bibliothek"
|
1872 |
|
1873 |
-
#: ../admin/settings.php:
|
1874 |
msgid "GD Library"
|
1875 |
msgstr "GD Bibliothek"
|
1876 |
|
1877 |
-
#: ../admin/settings.php:
|
1878 |
msgid "ImageMagick (Experimental). Path to the library :"
|
1879 |
msgstr "ImageMagick (Experimental). Pfad zur Bibliothek :"
|
1880 |
|
1881 |
-
#: ../admin/settings.php:
|
1882 |
msgid "Activate Media RSS feed"
|
1883 |
msgstr "Aktiviere Media-RSS-Feed"
|
1884 |
|
1885 |
-
#: ../admin/settings.php:
|
1886 |
msgid "A RSS feed will be added to you blog header. Useful for CoolIris/PicLens"
|
1887 |
msgstr "Ein Bilder-RSS Feed wird zum Blog hinzugefügt"
|
1888 |
|
1889 |
-
#: ../admin/settings.php:
|
1890 |
msgid "Activate PicLens/CoolIris support"
|
1891 |
msgstr "Aktiviere PicLens/CoolIris"
|
1892 |
|
1893 |
-
#: ../admin/settings.php:
|
1894 |
msgid "When you activate this option, some javascript is added to your site footer. Make sure that wp_footer is called in your theme."
|
1895 |
msgstr "Dieser Effekt fügt ein neues Javascript zu Deinem Theme hinzu. Beachte, dass wp_footer() in Deinen Vorlagen aufgerufen wird."
|
1896 |
|
1897 |
-
#: ../admin/settings.php:
|
1898 |
msgid "Tags / Categories"
|
1899 |
msgstr "Stichwörter / Kategorien"
|
1900 |
|
1901 |
-
#: ../admin/settings.php:
|
1902 |
msgid "Activate related images"
|
1903 |
msgstr "Verwandte Bilder anzeigen"
|
1904 |
|
1905 |
-
#: ../admin/settings.php:
|
1906 |
msgid "This option will append related images to every post"
|
1907 |
msgstr "Diese Option hängt verwandte Bilder an jeden Beitrag"
|
1908 |
|
1909 |
-
#: ../admin/settings.php:
|
1910 |
msgid "Match with"
|
1911 |
msgstr "Vergleiche mit"
|
1912 |
|
1913 |
-
#: ../admin/settings.php:
|
1914 |
msgid "Categories"
|
1915 |
msgstr "Kategorien"
|
1916 |
|
1917 |
-
#: ../admin/settings.php:
|
1918 |
msgid "Max. number of images"
|
1919 |
msgstr "Max. Anzahl der Bilder"
|
1920 |
|
1921 |
-
#: ../admin/settings.php:
|
1922 |
msgid "0 will show all images"
|
1923 |
msgstr "0 zeige alle verwandten Bilder"
|
1924 |
|
1925 |
-
#: ../admin/settings.php:
|
1926 |
-
#: ../admin/settings.php:
|
1927 |
-
#: ../admin/settings.php:
|
1928 |
-
#: ../admin/settings.php:
|
1929 |
-
#: ../admin/settings.php:
|
1930 |
-
#: ../admin/settings.php:
|
1931 |
msgid "More settings"
|
1932 |
msgstr "Mehr Einstellungen"
|
1933 |
|
1934 |
-
#: ../admin/settings.php:
|
1935 |
msgid "Thumbnail settings"
|
1936 |
msgstr "Thumbnail-Einstellungen"
|
1937 |
|
1938 |
-
#: ../admin/settings.php:
|
1939 |
msgid "Please note : If you change the settings, you need to recreate the thumbnails under -> Manage Gallery ."
|
1940 |
msgstr "Bitte beachten : Änderungen der Einstellungen werden erst übernommen, wenn Du neue Thumbnails unter -> \"Gallery verwalten\" erstellst"
|
1941 |
|
1942 |
-
#: ../admin/settings.php:
|
1943 |
msgid "Thumbnail quality"
|
1944 |
msgstr "Thumbnail Qualität"
|
1945 |
|
1946 |
-
#: ../admin/settings.php:
|
1947 |
msgid "Image settings"
|
1948 |
msgstr "Bild-Einstellungen"
|
1949 |
|
1950 |
-
#: ../admin/settings.php:
|
1951 |
msgid "Resize Images"
|
1952 |
msgstr "Bilder verkleinern"
|
1953 |
|
1954 |
-
#: ../admin/settings.php:
|
1955 |
msgid "Image quality"
|
1956 |
msgstr "Bild Qualität"
|
1957 |
|
1958 |
-
#: ../admin/settings.php:
|
1959 |
msgid "Backup original images"
|
1960 |
msgstr "Backup von Original-Bildern "
|
1961 |
|
1962 |
-
#: ../admin/settings.php:
|
1963 |
msgid "Creates a backup for inserted images"
|
1964 |
msgstr "Backup der Bilder anlegen"
|
1965 |
|
1966 |
-
#: ../admin/settings.php:
|
1967 |
msgid "Automatically resize"
|
1968 |
msgstr "Grösse automatisch anpassen"
|
1969 |
|
1970 |
-
#: ../admin/settings.php:
|
1971 |
msgid "Automatically resize images on upload."
|
1972 |
msgstr "Passt die Grösse automatisch beim Upload an"
|
1973 |
|
1974 |
-
#: ../admin/settings.php:
|
1975 |
msgid "Single picture"
|
1976 |
msgstr "Einzelbilder"
|
1977 |
|
1978 |
-
#: ../admin/settings.php:
|
1979 |
msgid "Cache single pictures"
|
1980 |
msgstr "Nutze Cache für Einzelbilder"
|
1981 |
|
1982 |
-
#: ../admin/settings.php:
|
1983 |
msgid "Creates a file for each singlepic settings. Reduce the CPU load"
|
1984 |
msgstr "Erstellt ein Cache-Bild für jedes Einzelbild (singlepic). Reduziert die CPU Belastung."
|
1985 |
|
1986 |
-
#: ../admin/settings.php:
|
1987 |
msgid "Clear cache folder"
|
1988 |
msgstr "Lösche Cache-Verzeichnis"
|
1989 |
|
1990 |
-
#: ../admin/settings.php:
|
1991 |
-
msgid "Proceed now"
|
1992 |
-
msgstr "Jetzt durchführen"
|
1993 |
-
|
1994 |
-
#: ../admin/settings.php:374
|
1995 |
msgid "Deactivate gallery page link"
|
1996 |
msgstr "Keine Seitenverzweigung"
|
1997 |
|
1998 |
-
#: ../admin/settings.php:
|
1999 |
msgid "The album will not link to a gallery subpage. The gallery is shown on the same page."
|
2000 |
msgstr "Ein Album benötigt dann keinen Link zur Seite. Die Galerie wird direkt angezeigt."
|
2001 |
|
2002 |
-
#: ../admin/settings.php:
|
2003 |
msgid "Number of images per page"
|
2004 |
msgstr "Anzahl der Bilder pro Seite"
|
2005 |
|
2006 |
-
#: ../admin/settings.php:
|
2007 |
msgid "0 will disable pagination, all images on one page"
|
2008 |
msgstr "0 schaltet Blätterfunktion ab ( = alle Bilder auf einer Seite )"
|
2009 |
|
2010 |
-
#: ../admin/settings.php:
|
2011 |
msgid "Number of columns"
|
2012 |
msgstr "Anzahl der Spalten"
|
2013 |
|
2014 |
-
#: ../admin/settings.php:
|
2015 |
msgid "0 will display as much as possible based on the width of your theme. Setting normally only required for captions below the images"
|
2016 |
msgstr "Mit \"0\" werden soviele Bilder wie möglich in einer Reihe dargestellt. Die Einstellung ist normalerweise nur für Beschriftungen unterhalb der Bilder sinnvoll."
|
2017 |
|
2018 |
-
#: ../admin/settings.php:
|
2019 |
msgid "Integrate slideshow"
|
2020 |
msgstr "Slideshow verwenden"
|
2021 |
|
2022 |
-
#: ../admin/settings.php:
|
2023 |
msgid "Show first"
|
2024 |
msgstr "Zeige als Erstes"
|
2025 |
|
2026 |
-
#: ../admin/settings.php:
|
2027 |
msgid "Show ImageBrowser"
|
2028 |
msgstr "Zeige Bilder-Browser"
|
2029 |
|
2030 |
-
#: ../admin/settings.php:
|
2031 |
msgid "The gallery will open the ImageBrowser instead the effect."
|
2032 |
msgstr "Es wird der Bilder-Browser angezeigt (Kein JavaScript Effekt)"
|
2033 |
|
2034 |
-
#: ../admin/settings.php:
|
2035 |
msgid "Add hidden images"
|
2036 |
msgstr "Versteckte Bilder hinzufügen"
|
2037 |
|
2038 |
-
#: ../admin/settings.php:
|
2039 |
-
msgid "If pagination is used, this option will still show all images in the modal window (Thickbox, Lightbox etc.). Note : This
|
2040 |
msgstr "Wenn Du die Blätterfunktion nutzt, dann kannst Du mit dieser Option alle Bilder im Modal-Fenster (Thickbox,Lightbox etc.) anzeigen. Berücksichtige, dass die Ladezeit der Seite erhöht wird."
|
2041 |
|
2042 |
-
#: ../admin/settings.php:
|
2043 |
msgid "Enable AJAX pagination"
|
2044 |
msgstr "Aktiviere AJAX-Navigation"
|
2045 |
|
2046 |
-
#: ../admin/settings.php:
|
2047 |
-
msgid "Browse images without reload the page. Note :
|
2048 |
msgstr "Ermöglicht das Blättern zwischen den Bildern ohne die Seite neu zu laden. Hinweis : Funktioniert nur mit dem Shutter-Effekt."
|
2049 |
|
2050 |
-
#: ../admin/settings.php:
|
2051 |
msgid "Sort options"
|
2052 |
msgstr "Sortierung"
|
2053 |
|
2054 |
-
#: ../admin/settings.php:
|
2055 |
msgid "Sort thumbnails"
|
2056 |
msgstr "Thumbnails sortieren"
|
2057 |
|
2058 |
-
#: ../admin/settings.php:
|
2059 |
msgid "Custom order"
|
2060 |
msgstr "Benutzerdefiniert"
|
2061 |
|
2062 |
-
#: ../admin/settings.php:
|
2063 |
msgid "File name"
|
2064 |
msgstr "Dateiname"
|
2065 |
|
2066 |
-
#: ../admin/settings.php:
|
2067 |
msgid "Alt / Title text"
|
2068 |
msgstr "Alt / Titel Text"
|
2069 |
|
2070 |
-
#: ../admin/settings.php:
|
2071 |
msgid "Date / Time"
|
2072 |
msgstr "Datum/Zeit"
|
2073 |
|
2074 |
-
#: ../admin/settings.php:
|
2075 |
msgid "Sort direction"
|
2076 |
msgstr "Sortierreihenfolge"
|
2077 |
|
2078 |
-
#: ../admin/settings.php:
|
2079 |
msgid "Here you can select the thumbnail effect, NextGEN Gallery will integrate the required HTML code in the images. Please note that only the Shutter and Thickbox effect will automatic added to your theme."
|
2080 |
msgstr "Hier kannst Du den Effekt für die Thumbnails auswählen. NextGEN Galerie wird den benötigten HTML-Code verwenden. Bitte beachte, dass nur Shutter und der Thickbox Effekt automatisch in Dein Theme von Wordpress integriert wird. Alle anderen Effekte mußt Du selbst in die header.php eintragen (JS)."
|
2081 |
|
2082 |
-
#: ../admin/settings.php:
|
2083 |
msgid "With the placeholder"
|
2084 |
msgstr "Mit Platzhalter"
|
2085 |
|
2086 |
-
#: ../admin/settings.php:
|
2087 |
msgid "you can activate a navigation through the images (depend on the effect). Change the code line only , when you use a different thumbnail effect or you know what you do."
|
2088 |
msgstr "Du kannst eine Navigation durch die Bilder aktivieren (hängt vom Effekt ab). Ändere nur die Codezeile, falls Du einen anderen Effekt für die Thumbnails verwendest oder einfach weißt, was Du tust."
|
2089 |
|
2090 |
-
#: ../admin/settings.php:
|
2091 |
msgid "JavaScript Thumbnail effect"
|
2092 |
msgstr "JavaScript Thumbnail Effekt"
|
2093 |
|
2094 |
-
#: ../admin/settings.php:
|
2095 |
-
msgid "None"
|
2096 |
-
msgstr "Keiner"
|
2097 |
-
|
2098 |
-
#: ../admin/settings.php:464
|
2099 |
msgid "Thickbox"
|
2100 |
msgstr "Thickbox"
|
2101 |
|
2102 |
-
#: ../admin/settings.php:
|
2103 |
msgid "Lightbox"
|
2104 |
msgstr "Lightbox"
|
2105 |
|
2106 |
-
#: ../admin/settings.php:
|
2107 |
msgid "Highslide"
|
2108 |
msgstr "Highslide"
|
2109 |
|
2110 |
-
#: ../admin/settings.php:
|
2111 |
msgid "Shutter"
|
2112 |
msgstr "Shutter"
|
2113 |
|
2114 |
-
#: ../admin/settings.php:
|
2115 |
msgid "Custom"
|
2116 |
msgstr "Eigener"
|
2117 |
|
2118 |
-
#: ../admin/settings.php:
|
2119 |
msgid "Link Code line"
|
2120 |
msgstr "Link-Code-Zeile"
|
2121 |
|
2122 |
-
#: ../admin/settings.php:
|
2123 |
msgid "Please note : You can only activate the watermark under -> Manage Gallery . This action cannot be undone."
|
2124 |
msgstr "Bitte beachten : Das Wasserzeichen kann nur unter der Galerieverwaltung gesetzt werden. "
|
2125 |
|
2126 |
-
#: ../admin/settings.php:
|
2127 |
msgid "Preview"
|
2128 |
msgstr "Vorschau"
|
2129 |
|
2130 |
-
#: ../admin/settings.php:
|
2131 |
-
#: ../admin/settings.php:
|
2132 |
msgid "Position"
|
2133 |
msgstr "Position"
|
2134 |
|
2135 |
-
#: ../admin/settings.php:
|
2136 |
msgid "Offset"
|
2137 |
msgstr "Abstand"
|
2138 |
|
2139 |
-
#: ../admin/settings.php:
|
2140 |
msgid "Use image as watermark"
|
2141 |
msgstr "Benutze das Bild als Wasserzeichen"
|
2142 |
|
2143 |
-
#: ../admin/settings.php:
|
2144 |
msgid "URL to file"
|
2145 |
msgstr "URL zur Datei"
|
2146 |
|
2147 |
-
#: ../admin/settings.php:
|
2148 |
msgid "The accessing of URL files is disabled at your server (allow_url_fopen)"
|
2149 |
msgstr "Der Dateizugriff von URLs ist auf diesem Server deaktiviert (allow_url_fopen)"
|
2150 |
|
2151 |
-
#: ../admin/settings.php:
|
2152 |
msgid "Use text as watermark"
|
2153 |
msgstr "Benutze Text als Wasserzeichen"
|
2154 |
|
2155 |
-
#: ../admin/settings.php:
|
2156 |
msgid "Font"
|
2157 |
msgstr "Schriftart"
|
2158 |
|
2159 |
-
#: ../admin/settings.php:
|
2160 |
msgid "This function will not work, cause you need the FreeType library"
|
2161 |
msgstr "Diese Funktion benötigt die FreeType-Bibliothek"
|
2162 |
|
2163 |
-
#: ../admin/settings.php:
|
2164 |
msgid "You can upload more fonts in the folder <strong>nggallery/fonts</strong>"
|
2165 |
msgstr "Du kannst mehr Schriftarten in das Verzeichniss <strong>nggallery/fonts</strong> hochladen."
|
2166 |
|
2167 |
-
#: ../admin/settings.php:
|
2168 |
msgid "Size"
|
2169 |
msgstr "Größe"
|
2170 |
|
2171 |
-
#: ../admin/settings.php:
|
2172 |
msgid "Color"
|
2173 |
msgstr "Farbe"
|
2174 |
|
2175 |
-
#: ../admin/settings.php:
|
2176 |
msgid "(hex w/o #)"
|
2177 |
msgstr "(hex w/o #)"
|
2178 |
|
2179 |
-
#: ../admin/settings.php:
|
2180 |
msgid "Text"
|
2181 |
msgstr "Text"
|
2182 |
|
2183 |
-
#: ../admin/settings.php:
|
2184 |
msgid "Opaque"
|
2185 |
msgstr "Transparenz"
|
2186 |
|
2187 |
-
#: ../admin/settings.php:
|
2188 |
msgid "Default size (W x H)"
|
2189 |
msgstr "Standard Größe (B x H)"
|
2190 |
|
2191 |
-
#: ../admin/settings.php:
|
2192 |
msgid "Duration time"
|
2193 |
msgstr "Dauer"
|
2194 |
|
2195 |
-
#: ../admin/settings.php:
|
2196 |
msgid "sec."
|
2197 |
msgstr "Sek."
|
2198 |
|
2199 |
-
#: ../admin/settings.php:
|
2200 |
-
#: ../admin/settings.php:
|
2201 |
msgid "Transition / Fade effect"
|
2202 |
msgstr "Fade Effekt"
|
2203 |
|
2204 |
-
#: ../admin/settings.php:
|
2205 |
-
#: ../admin/settings.php:
|
2206 |
msgid "fade"
|
2207 |
msgstr "Fade"
|
2208 |
|
2209 |
-
#: ../admin/settings.php:
|
2210 |
msgid "blindX"
|
2211 |
msgstr "blindX"
|
2212 |
|
2213 |
-
#: ../admin/settings.php:
|
2214 |
msgid "cover"
|
2215 |
msgstr "Blenden"
|
2216 |
|
2217 |
-
#: ../admin/settings.php:
|
2218 |
msgid "scrollUp"
|
2219 |
msgstr "ScrollUp"
|
2220 |
|
2221 |
-
#: ../admin/settings.php:
|
2222 |
msgid "scrollDown"
|
2223 |
msgstr "ScrollDown"
|
2224 |
|
2225 |
-
#: ../admin/settings.php:
|
2226 |
msgid "shuffle"
|
2227 |
msgstr "Shuffle"
|
2228 |
|
2229 |
-
#: ../admin/settings.php:
|
2230 |
msgid "toss"
|
2231 |
msgstr "Schüttel"
|
2232 |
|
2233 |
-
#: ../admin/settings.php:
|
2234 |
msgid "wipe"
|
2235 |
msgstr "wischen"
|
2236 |
|
2237 |
-
#: ../admin/settings.php:
|
2238 |
msgid "See here for more information about the effects :"
|
2239 |
msgstr "Hier bekommst du mehr Informationen über die Effekte :"
|
2240 |
|
2241 |
-
#: ../admin/settings.php:
|
2242 |
msgid "Settings for the JW Image Rotator"
|
2243 |
msgstr "JW-Image-Rotator Einstellungen"
|
2244 |
|
2245 |
-
#: ../admin/settings.php:
|
2246 |
msgid "The settings are only used in the JW Image Rotator Version"
|
2247 |
msgstr "Die Einstellungen werden im JW-Image-Rotator benutzt, in der Version"
|
2248 |
|
2249 |
-
#: ../admin/settings.php:
|
2250 |
msgid "See more information for the Flash Player on the web page"
|
2251 |
msgstr "Weitere Informationen auf der Flash-Player-Homepage"
|
2252 |
|
2253 |
-
#: ../admin/settings.php:
|
2254 |
msgid "The path to imagerotator.swf is not defined, the slideshow will not work."
|
2255 |
msgstr "Der Pfad zu imagerotator.swf ist nicht gesetzt, die Flash-Diaschau kann dann nicht angezeigt werden"
|
2256 |
|
2257 |
-
#: ../admin/settings.php:
|
2258 |
msgid "If you would like to use the JW Image Rotatator, please download the player <a href=\"http://www.longtailvideo.com/players/jw-image-rotator/\" target=\"_blank\" >here</a> and upload it to your Upload folder (Default is wp-content/uploads)."
|
2259 |
msgstr "Wenn Du den JW-Image-Rotator (Slideshow) nutzen möchtest, lade Dir die aktuelle Version <a href=\"http://www.longtailvideo.com/players/jw-image-rotator/\" target=\"_blank\" >hier</a> herunter und übertrage sie dann in Dein WordPress-Upload-Verzeichnis (normalerweise wp-content/uploads),"
|
2260 |
|
2261 |
-
#: ../admin/settings.php:
|
2262 |
msgid "Enable flash slideshow"
|
2263 |
msgstr "Aktiviere Flash Slideshow"
|
2264 |
|
2265 |
-
#: ../admin/settings.php:
|
2266 |
-
msgid "Integrate the flash based
|
2267 |
msgstr "Verwende die Flash Slideshow für alle Flash-unterstützte Geräte"
|
2268 |
|
2269 |
-
#: ../admin/settings.php:
|
2270 |
msgid "Path to the Imagerotator (URL)"
|
2271 |
msgstr "Pfad zum JW-Image-Rotator (URL)"
|
2272 |
|
2273 |
-
#: ../admin/settings.php:
|
2274 |
msgid "Search now"
|
2275 |
msgstr "Suche jetzt"
|
2276 |
|
2277 |
-
#: ../admin/settings.php:
|
2278 |
-
msgid "Press the button to search
|
2279 |
msgstr "Drücke 'Suche jetzt' um automatisch den Pfad zum Image-Rotator zu ermitteln, sofern Du den Player in wp-content/uploads oder ein Unterverzeichnis hochgeladen hast."
|
2280 |
|
2281 |
-
#: ../admin/settings.php:
|
2282 |
msgid "Shuffle mode"
|
2283 |
msgstr "Shuffle Modus"
|
2284 |
|
2285 |
-
#: ../admin/settings.php:
|
2286 |
msgid "Show next image on click"
|
2287 |
msgstr "Zeige nächstes Bild bei Klick"
|
2288 |
|
2289 |
-
#: ../admin/settings.php:
|
2290 |
msgid "Show navigation bar"
|
2291 |
msgstr "Zeige Navigations-Leiste"
|
2292 |
|
2293 |
-
#: ../admin/settings.php:
|
2294 |
msgid "Show loading icon"
|
2295 |
msgstr "Zeige Lade-Bildchen"
|
2296 |
|
2297 |
-
#: ../admin/settings.php:
|
2298 |
msgid "Use watermark logo"
|
2299 |
msgstr "Wasserzeichen anzeigen"
|
2300 |
|
2301 |
-
#: ../admin/settings.php:
|
2302 |
msgid "You can change the logo at the watermark settings"
|
2303 |
msgstr "Du kannst den Pfad in Einstellungen für das Wasserzeichen angeben"
|
2304 |
|
2305 |
-
#: ../admin/settings.php:
|
2306 |
msgid "Stretch image"
|
2307 |
msgstr "Bild dehnen"
|
2308 |
|
2309 |
-
#: ../admin/settings.php:
|
2310 |
msgid "true"
|
2311 |
msgstr "Ja"
|
2312 |
|
2313 |
-
#: ../admin/settings.php:
|
2314 |
msgid "false"
|
2315 |
msgstr "Nein"
|
2316 |
|
2317 |
-
#: ../admin/settings.php:
|
2318 |
msgid "fit"
|
2319 |
msgstr "Passend"
|
2320 |
|
2321 |
-
#: ../admin/settings.php:
|
2322 |
msgid "none"
|
2323 |
msgstr "keiner"
|
2324 |
|
2325 |
-
#: ../admin/settings.php:
|
2326 |
msgid "bgfade"
|
2327 |
msgstr "BGFade"
|
2328 |
|
2329 |
-
#: ../admin/settings.php:
|
2330 |
msgid "slowfade"
|
2331 |
msgstr "Slowfade"
|
2332 |
|
2333 |
-
#: ../admin/settings.php:
|
2334 |
msgid "circles"
|
2335 |
msgstr "Kreise"
|
2336 |
|
2337 |
-
#: ../admin/settings.php:
|
2338 |
msgid "bubbles"
|
2339 |
msgstr "Blasen"
|
2340 |
|
2341 |
-
#: ../admin/settings.php:
|
2342 |
msgid "blocks"
|
2343 |
msgstr "Blöcke"
|
2344 |
|
2345 |
-
#: ../admin/settings.php:
|
2346 |
msgid "fluids"
|
2347 |
msgstr "Fluids"
|
2348 |
|
2349 |
-
#: ../admin/settings.php:
|
2350 |
msgid "flash"
|
2351 |
msgstr "Flash"
|
2352 |
|
2353 |
-
#: ../admin/settings.php:
|
2354 |
msgid "lines"
|
2355 |
msgstr "Linien"
|
2356 |
|
2357 |
-
#: ../admin/settings.php:
|
2358 |
msgid "random"
|
2359 |
msgstr "Zufall"
|
2360 |
|
2361 |
-
#: ../admin/settings.php:
|
2362 |
msgid "Use slow zooming effect"
|
2363 |
msgstr "nutze Zoom-Effekt"
|
2364 |
|
2365 |
-
#: ../admin/settings.php:
|
2366 |
msgid "Background Color"
|
2367 |
msgstr "Hintergrund (BG) Farbe"
|
2368 |
|
2369 |
-
#: ../admin/settings.php:
|
2370 |
msgid "Texts / Buttons Color"
|
2371 |
msgstr "Text- / Button Farbe"
|
2372 |
|
2373 |
-
#: ../admin/settings.php:
|
2374 |
msgid "Rollover / Active Color"
|
2375 |
msgstr "Rollover / Aktiv (Link) Farbe"
|
2376 |
|
2377 |
-
#: ../admin/settings.php:
|
2378 |
msgid "Screen Color"
|
2379 |
msgstr "Seiten-Farbe"
|
2380 |
|
2381 |
-
#: ../admin/settings.php:
|
2382 |
msgid "Background music (URL)"
|
2383 |
msgstr "Hintergrundmusik (URL)"
|
2384 |
|
2385 |
-
#: ../admin/settings.php:
|
2386 |
msgid "Try XHTML validation (with CDATA)"
|
2387 |
msgstr "Integriere XHTML-Validierung (mittels CDATA)"
|
2388 |
|
2389 |
-
#: ../admin/settings.php:
|
2390 |
msgid "Important : Could causes problem at some browser. Please recheck your page."
|
2391 |
msgstr "Wichtig : Es könnten Probleme bei einigen Browser entstehen. Unbedingt Seite danach prüfen."
|
2392 |
|
@@ -2659,209 +2716,250 @@ msgstr "Stichwörter vergleichen :"
|
|
2659 |
msgid "Slug(s) to set:"
|
2660 |
msgstr "Schlagwörter setzen:"
|
2661 |
|
2662 |
-
#: ../admin/upgrade.php:
|
2663 |
msgid "Upgrade database structure..."
|
2664 |
msgstr "Aktualisiere die Datenbank-Struturen..."
|
2665 |
|
2666 |
-
#: ../admin/upgrade.php:
|
2667 |
-
#: ../admin/upgrade.php:115
|
2668 |
#: ../admin/upgrade.php:122
|
2669 |
-
#: ../admin/upgrade.php:
|
2670 |
-
#: ../admin/upgrade.php:
|
|
|
2671 |
msgid "finished"
|
2672 |
msgstr "beendet"
|
2673 |
|
2674 |
-
#: ../admin/upgrade.php:
|
2675 |
msgid "Update file structure..."
|
2676 |
msgstr "Aktualisiere Verzeichnisse..."
|
2677 |
|
2678 |
-
#: ../admin/upgrade.php:
|
2679 |
msgid "Import date and time information..."
|
2680 |
msgstr "Importiere Datum/Uhrzeit..."
|
2681 |
|
2682 |
-
#: ../admin/upgrade.php:
|
2683 |
msgid "Move imagerotator to new location..."
|
2684 |
msgstr "Verschiebe den Image-Rotator in ein neues Verzeichnis..."
|
2685 |
|
2686 |
-
#: ../admin/upgrade.php:
|
2687 |
msgid "Update settings..."
|
2688 |
msgstr "Einstellungen gespeichert..."
|
2689 |
|
2690 |
-
#: ../admin/upgrade.php:
|
2691 |
msgid "Updated widget structure. If you used NextGEN Widgets, you need to setup them again..."
|
2692 |
msgstr "Die Widgets wurden überarbeitet. Wenn Du NextGEN Widgets nutzt, musst du Sie nun neu einfügen..."
|
2693 |
|
2694 |
-
#: ../admin/upgrade.php:
|
2695 |
msgid "Updated options."
|
2696 |
msgstr "Einstellungen gespeichert."
|
2697 |
|
2698 |
-
#: ../admin/upgrade.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2699 |
msgid "Could not find NextGEN Gallery database tables, upgrade failed !"
|
2700 |
msgstr "Konnte die NextGEN Gallery Tabellen nicht finden, Upgrade fehlgeschlagen !"
|
2701 |
|
2702 |
-
#: ../admin/upgrade.php:
|
2703 |
msgid "Some folders/files could not renamed, please recheck the permission and rescan the folder in the manage gallery section."
|
2704 |
msgstr "Einige Verzeichnisse / Bilder konnten nicht umbenannt werden, bitte überprüfe die Zugriffsrechte und scanne dann das Verzeichnis neu ein."
|
2705 |
|
2706 |
-
#: ../admin/upgrade.php:
|
2707 |
msgid "Rename failed"
|
2708 |
msgstr "Konnte nicht umbenannt werden"
|
2709 |
|
2710 |
-
#: ../admin/upgrade.php:
|
2711 |
-
#: ../admin/upgrade.php:
|
2712 |
msgid "Upgrade NextGEN Gallery"
|
2713 |
msgstr "NextGEN-Gallery aktualisieren"
|
2714 |
|
2715 |
-
#: ../admin/upgrade.php:
|
2716 |
msgid "The script detect that you upgrade from a older version."
|
2717 |
msgstr "Es wurde eine ältere NextGEN-Datenbank erkannt."
|
2718 |
|
2719 |
-
#: ../admin/upgrade.php:
|
2720 |
msgid "Your database tables for NextGEN Gallery is out-of-date, and must be upgraded before you can continue."
|
2721 |
msgstr "Deine Datenbanktabellen für NextGEN-Gallery sind nicht auf dem aktuellen Stand, sie müssen jetzt aktualisiert werden."
|
2722 |
|
2723 |
-
#: ../admin/upgrade.php:
|
2724 |
msgid "If you would like to downgrade later, please make first a complete backup of your database and the images."
|
2725 |
msgstr "Wenn Du wieder auf eine ältere Version zurückgehen möchtest, solltest Du vorher die Datenbank sichern."
|
2726 |
|
2727 |
-
#: ../admin/upgrade.php:
|
2728 |
msgid "The upgrade process may take a while, so please be patient."
|
2729 |
msgstr "Der Upgrade-Prozess kann etwas dauern, bitte sei geduldig..."
|
2730 |
|
2731 |
-
#: ../admin/upgrade.php:
|
2732 |
msgid "Start upgrade now"
|
2733 |
msgstr "Aktualisierung starten"
|
2734 |
|
2735 |
-
#: ../admin/upgrade.php:
|
2736 |
msgid "Upgrade finished..."
|
2737 |
msgstr "Upgrade beendet..."
|
2738 |
|
2739 |
-
#: ../admin/upgrade.php:
|
2740 |
msgid "Continue"
|
2741 |
msgstr "Weiter"
|
2742 |
|
2743 |
-
#: ../admin/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2744 |
msgid "Update successfully"
|
2745 |
msgstr "Aktualisierung erfolgreich"
|
2746 |
|
2747 |
-
#: ../admin/wpmu.php:
|
2748 |
-
|
2749 |
-
|
|
|
2750 |
|
2751 |
-
#: ../admin/wpmu.php:
|
2752 |
-
msgid "
|
|
|
|
|
|
|
|
|
2753 |
msgstr "Dieses ist der Default-Pfad für alle Blogs. Mit dem Platzhalter %BLOG_ID% wird die Ordnerstruktur gesteuert. Der Pfad muss mit / enden."
|
2754 |
|
2755 |
-
#: ../admin/wpmu.php:
|
|
|
|
|
|
|
|
|
|
|
2756 |
msgid "Enable upload quota check"
|
2757 |
msgstr "Schalte die Uploadbegrenzung ein"
|
2758 |
|
2759 |
-
#: ../admin/wpmu.php:
|
2760 |
msgid "Should work if the gallery is bellow the blog.dir"
|
2761 |
msgstr "Sollte funktionieren, wenn die Galerien sich unterhalb blog.dir befinden"
|
2762 |
|
2763 |
-
#: ../admin/wpmu.php:
|
2764 |
msgid "Enable zip upload option"
|
2765 |
msgstr "Erlaube ZIP-Upload"
|
2766 |
|
2767 |
-
#: ../admin/wpmu.php:
|
2768 |
msgid "Allow users to upload zip folders."
|
2769 |
msgstr "Erlaubt die Nutzung des ZIP-Upload"
|
2770 |
|
2771 |
-
#: ../admin/wpmu.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2772 |
msgid "Enable style selection"
|
2773 |
msgstr "Freie CSS-Style-Auswahl"
|
2774 |
|
2775 |
-
#: ../admin/wpmu.php:
|
2776 |
msgid "Allow users to choose a style for the gallery."
|
2777 |
msgstr "Erlaube dem User, ein CSS für die Galerie zu wählen"
|
2778 |
|
2779 |
-
#: ../admin/wpmu.php:
|
2780 |
msgid "Enable roles/capabilities"
|
2781 |
msgstr "Rollen / Zugriffsrechte freischalten"
|
2782 |
|
2783 |
-
#: ../admin/wpmu.php:
|
2784 |
msgid "Allow users to change the roles for other blog authors."
|
2785 |
msgstr "Erlaube dem User die Anpassung der Zugangsberechtigung"
|
2786 |
|
2787 |
-
#: ../admin/wpmu.php:
|
2788 |
msgid "Default style"
|
2789 |
msgstr "Standard-CSS-Style"
|
2790 |
|
2791 |
-
#: ../admin/wpmu.php:
|
2792 |
msgid "Choose the default style for the galleries."
|
2793 |
msgstr "Wähle das Default-Stylesheet für die Galerien"
|
2794 |
|
2795 |
-
#: ../admin/tinymce/window.php:8
|
2796 |
-
msgid "You are not allowed to be here"
|
2797 |
-
msgstr "Keine Zugangsberechtigung"
|
2798 |
-
|
2799 |
#: ../admin/tinymce/window.php:56
|
2800 |
-
|
|
|
|
|
|
|
|
|
2801 |
msgid "Show as"
|
2802 |
msgstr "Zeige als"
|
2803 |
|
2804 |
-
#: ../admin/tinymce/window.php:
|
2805 |
msgid "Image list"
|
2806 |
msgstr "Bilder-Liste"
|
2807 |
|
2808 |
-
#: ../admin/tinymce/window.php:
|
2809 |
msgid "Imagebrowser"
|
2810 |
msgstr "Bilder-Browser"
|
2811 |
|
2812 |
-
#: ../admin/tinymce/window.php:
|
2813 |
-
msgid "
|
2814 |
-
msgstr "
|
2815 |
|
2816 |
-
#: ../admin/tinymce/window.php:
|
2817 |
msgid "Extended version"
|
2818 |
msgstr "Erweiterte Version"
|
2819 |
|
2820 |
-
#: ../admin/tinymce/window.php:
|
2821 |
msgid "Compact version"
|
2822 |
msgstr "Kompakte Version"
|
2823 |
|
2824 |
#: ../admin/tinymce/window.php:97
|
2825 |
-
msgid "Select picture"
|
2826 |
-
msgstr "Wähle Bild"
|
2827 |
|
2828 |
-
#: ../admin/tinymce/window.php:
|
2829 |
msgid "Width x Height"
|
2830 |
msgstr "Breite x Höhe"
|
2831 |
|
2832 |
-
#: ../admin/tinymce/window.php:
|
2833 |
msgid "Effect"
|
2834 |
msgstr "Effekt"
|
2835 |
|
2836 |
-
#: ../admin/tinymce/window.php:
|
2837 |
msgid "No effect"
|
2838 |
msgstr "Kein Effekt"
|
2839 |
|
2840 |
-
#: ../admin/tinymce/window.php:
|
2841 |
msgid "Web 2.0"
|
2842 |
msgstr "Web 2.0"
|
2843 |
|
2844 |
-
#: ../admin/tinymce/window.php:
|
2845 |
msgid "Float"
|
2846 |
msgstr "Float"
|
2847 |
|
2848 |
-
#: ../admin/tinymce/window.php:
|
2849 |
msgid "No float"
|
2850 |
msgstr "Kein Float"
|
2851 |
|
2852 |
-
#: ../admin/tinymce/window.php:
|
2853 |
-
msgid "Left"
|
2854 |
-
msgstr "Links"
|
2855 |
-
|
2856 |
-
#: ../admin/tinymce/window.php:130
|
2857 |
-
msgid "Center"
|
2858 |
-
msgstr "Zentrieren"
|
2859 |
-
|
2860 |
-
#: ../admin/tinymce/window.php:131
|
2861 |
-
msgid "Right"
|
2862 |
-
msgstr "Rechts"
|
2863 |
-
|
2864 |
-
#: ../admin/tinymce/window.php:147
|
2865 |
msgid "Insert"
|
2866 |
msgstr "Einfügen"
|
2867 |
|
@@ -2895,128 +2993,128 @@ msgstr "ausgelöst"
|
|
2895 |
msgid "Not fired"
|
2896 |
msgstr "Nicht ausgelöst"
|
2897 |
|
2898 |
-
#: ../lib/meta.php:
|
2899 |
msgid "Aperture"
|
2900 |
msgstr "Blende"
|
2901 |
|
2902 |
-
#: ../lib/meta.php:
|
2903 |
-
#: ../lib/meta.php:
|
2904 |
msgid "Credit"
|
2905 |
msgstr "Autor"
|
2906 |
|
2907 |
-
#: ../lib/meta.php:
|
2908 |
msgid "Camera"
|
2909 |
msgstr "Kamera"
|
2910 |
|
2911 |
-
#: ../lib/meta.php:
|
2912 |
msgid "Caption"
|
2913 |
msgstr "Beschreibung"
|
2914 |
|
2915 |
-
#: ../lib/meta.php:
|
2916 |
msgid "Copyright"
|
2917 |
msgstr "Rechte"
|
2918 |
|
2919 |
-
#: ../lib/meta.php:
|
2920 |
msgid "Focal length"
|
2921 |
msgstr "Brennweite"
|
2922 |
|
2923 |
-
#: ../lib/meta.php:
|
2924 |
msgid "ISO"
|
2925 |
msgstr "ISO"
|
2926 |
|
2927 |
-
#: ../lib/meta.php:
|
2928 |
msgid "Shutter speed"
|
2929 |
msgstr "Belichtungszeit"
|
2930 |
|
2931 |
-
#: ../lib/meta.php:
|
2932 |
msgid "Subject"
|
2933 |
msgstr "Betreff"
|
2934 |
|
2935 |
-
#: ../lib/meta.php:
|
2936 |
msgid "Make"
|
2937 |
msgstr "Hersteller"
|
2938 |
|
2939 |
-
#: ../lib/meta.php:
|
2940 |
msgid "Edit Status"
|
2941 |
msgstr "Ändere Status"
|
2942 |
|
2943 |
-
#: ../lib/meta.php:
|
2944 |
msgid "Category"
|
2945 |
msgstr "Kategorie"
|
2946 |
|
2947 |
-
#: ../lib/meta.php:
|
2948 |
msgid "Keywords"
|
2949 |
msgstr "Schlüsselwörter"
|
2950 |
|
2951 |
-
#: ../lib/meta.php:
|
2952 |
msgid "Date Created"
|
2953 |
msgstr "erstellt (Datum)"
|
2954 |
|
2955 |
-
#: ../lib/meta.php:
|
2956 |
msgid "Time Created"
|
2957 |
msgstr "erstellt (Zeit)"
|
2958 |
|
2959 |
-
#: ../lib/meta.php:
|
2960 |
msgid "Author Position"
|
2961 |
msgstr "Autor Position"
|
2962 |
|
2963 |
-
#: ../lib/meta.php:
|
2964 |
msgid "City"
|
2965 |
msgstr "Stadt"
|
2966 |
|
2967 |
-
#: ../lib/meta.php:
|
2968 |
msgid "Location"
|
2969 |
msgstr "Ort"
|
2970 |
|
2971 |
-
#: ../lib/meta.php:
|
2972 |
msgid "Province/State"
|
2973 |
msgstr "Staat / PLZ"
|
2974 |
|
2975 |
-
#: ../lib/meta.php:
|
2976 |
msgid "Country code"
|
2977 |
msgstr "Landescode"
|
2978 |
|
2979 |
-
#: ../lib/meta.php:
|
2980 |
msgid "Country"
|
2981 |
msgstr "Land"
|
2982 |
|
2983 |
-
#: ../lib/meta.php:
|
2984 |
msgid "Headline"
|
2985 |
msgstr "Kopfzeile"
|
2986 |
|
2987 |
-
#: ../lib/meta.php:
|
2988 |
msgid "Source"
|
2989 |
msgstr "Quelle"
|
2990 |
|
2991 |
-
#: ../lib/meta.php:
|
2992 |
msgid "Copyright Notice"
|
2993 |
msgstr "Copyright Hinweise / Credits"
|
2994 |
|
2995 |
-
#: ../lib/meta.php:
|
2996 |
msgid "Contact"
|
2997 |
msgstr "Kontakt"
|
2998 |
|
2999 |
-
#: ../lib/meta.php:
|
3000 |
msgid "Last modified"
|
3001 |
msgstr "Zuletzt geändert"
|
3002 |
|
3003 |
-
#: ../lib/meta.php:
|
3004 |
msgid "Program tool"
|
3005 |
msgstr "Programm"
|
3006 |
|
3007 |
-
#: ../lib/meta.php:
|
3008 |
msgid "Format"
|
3009 |
msgstr "Format"
|
3010 |
|
3011 |
-
#: ../lib/meta.php:
|
3012 |
msgid "Image Width"
|
3013 |
msgstr "Breite"
|
3014 |
|
3015 |
-
#: ../lib/meta.php:
|
3016 |
msgid "Image Height"
|
3017 |
msgstr "Höhe"
|
3018 |
|
3019 |
-
#: ../lib/meta.php:
|
3020 |
msgid "Flash"
|
3021 |
msgstr "Blitz"
|
3022 |
|
@@ -3024,8 +3122,8 @@ msgstr "Blitz"
|
|
3024 |
msgid "Sorry, you have used your space allocation. Please delete some files to upload more files."
|
3025 |
msgstr "Schade, Dein freier Speicher scheint aufgebraucht zu sein. Bitte lösche zuerst ein paar Bilder."
|
3026 |
|
3027 |
-
#: ../lib/ngg-db.php:
|
3028 |
-
#: ../lib/ngg-db.php:
|
3029 |
msgid "Album overview"
|
3030 |
msgstr "Album Übersicht"
|
3031 |
|
@@ -3101,56 +3199,90 @@ msgstr "Kein Stichwort geändert"
|
|
3101 |
msgid "%s slug(s) edited."
|
3102 |
msgstr "%s Stichwörter geändert"
|
3103 |
|
3104 |
-
#: ../lib/xmlrpc.php:
|
3105 |
#, php-format
|
3106 |
msgid "XML-RPC services are disabled on this blog. An admin user can enable them at %s"
|
3107 |
msgstr "XML-RPC Service ist ausgeschaltet. Der Administrator kann es hier %s einschalten"
|
3108 |
|
3109 |
-
#: ../lib/xmlrpc.php:
|
3110 |
msgid "Bad login/pass combination."
|
3111 |
msgstr "Username/Password falsch"
|
3112 |
|
3113 |
-
#: ../lib/xmlrpc.php:
|
3114 |
msgid "You are not allowed to upload files to this site."
|
3115 |
msgstr "Du hast keine Berechtigung, Bilder hochzuladen"
|
3116 |
|
3117 |
-
#: ../lib/xmlrpc.php:
|
3118 |
-
#: ../lib/xmlrpc.php:
|
3119 |
msgid "Could not find gallery "
|
3120 |
msgstr "Konnte Galerie nicht finden"
|
3121 |
|
3122 |
-
#: ../lib/xmlrpc.php:
|
3123 |
-
#: ../lib/xmlrpc.php:
|
3124 |
msgid "You are not allowed to upload files to this gallery."
|
3125 |
msgstr "Du hast keine Berechtigung, Bilder in diese Galerie zuladen"
|
3126 |
|
3127 |
-
#: ../lib/xmlrpc.php:
|
3128 |
msgid "This is no valid image file."
|
3129 |
msgstr "Das ist keine zulässige Bilddatei!"
|
3130 |
|
3131 |
-
#: ../lib/xmlrpc.php:
|
3132 |
msgid "Could not find image id "
|
3133 |
msgstr "Konnte die Bild-ID nicht finden"
|
3134 |
|
3135 |
-
#: ../lib/xmlrpc.php:
|
3136 |
#, php-format
|
3137 |
msgid "Failed to delete image %1$s "
|
3138 |
msgstr "Konnte das Bild %1$s nicht löschen"
|
3139 |
|
3140 |
-
#: ../lib/xmlrpc.php:
|
3141 |
#, php-format
|
3142 |
msgid "Could not write file %1$s (%2$s)"
|
3143 |
msgstr "Konnte die Datei %1$s (%2$s) nicht schreiben "
|
3144 |
|
3145 |
-
#: ../lib/xmlrpc.php:
|
3146 |
-
#: ../lib/xmlrpc.php:
|
3147 |
-
|
3148 |
-
|
|
|
3149 |
|
3150 |
-
#: ../lib/xmlrpc.php:
|
3151 |
msgid "Sorry, could not create the gallery"
|
3152 |
msgstr "Konnte die Galerie nicht anlegen"
|
3153 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3154 |
#: ../view/album-compact.php:32
|
3155 |
#: ../view/album-extend.php:30
|
3156 |
msgid "Photos"
|
@@ -3339,6 +3471,33 @@ msgstr "Album-ID %s existiert nicht"
|
|
3339 |
msgid "Invalid MediaRSS command"
|
3340 |
msgstr "Ungültiger Media-RSS-Befehl"
|
3341 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3342 |
#~ msgid "for the Fugue Iconset"
|
3343 |
#~ msgstr "für das Fugue-Iconset"
|
3344 |
|
@@ -3383,9 +3542,6 @@ msgstr "Ungültiger Media-RSS-Befehl"
|
|
3383 |
#~ msgid "Setup"
|
3384 |
#~ msgstr "Setup"
|
3385 |
|
3386 |
-
#~ msgid "Alignment"
|
3387 |
-
#~ msgstr "Ausrichtung"
|
3388 |
-
|
3389 |
#~ msgid "Full size"
|
3390 |
#~ msgstr "Volle Größe"
|
3391 |
|
@@ -3572,9 +3728,6 @@ msgstr "Ungültiger Media-RSS-Befehl"
|
|
3572 |
#~ msgid "Manage galleries and images"
|
3573 |
#~ msgstr "Verwalte Galerien und Bilder"
|
3574 |
|
3575 |
-
#~ msgid "Create and manage albums"
|
3576 |
-
#~ msgstr "Erstelle und verwalte Alben"
|
3577 |
-
|
3578 |
#~ msgid "URL"
|
3579 |
#~ msgstr "URL"
|
3580 |
|
2 |
msgstr ""
|
3 |
"Project-Id-Version: NextGEN Gallery\n"
|
4 |
"Report-Msgid-Bugs-To: \n"
|
5 |
+
"POT-Creation-Date: 2010-12-05 20:30+0100\n"
|
6 |
+
"PO-Revision-Date: 2010-12-05 20:30+0100\n"
|
7 |
"Last-Translator: Alex Rabe\n"
|
8 |
"Language-Team: Alex Rabe\n"
|
9 |
"MIME-Version: 1.0\n"
|
18 |
"X-Poedit-SearchPath-0: .\n"
|
19 |
"X-Poedit-SearchPath-1: ..\n"
|
20 |
|
21 |
+
#: ../nggallery.php:94
|
22 |
msgid "<strong>Translation by : </strong><a target=\"_blank\" href=\"http://alexrabe.de/wordpress-plugins/nextgen-gallery/languages/\">See here</a>"
|
23 |
msgstr "<strong>Übersetzt von : </strong><a target=\"_blank\" href=\"http://alexrabe.de/wordpress-plugins/wordtube/translation-of-plugins/\">Alex Rabe</a>"
|
24 |
|
25 |
+
#: ../nggallery.php:95
|
26 |
+
msgid "<strong>This translation is not yet updated for Version 1.7.0</strong>. If you would like to help with translation, download the current po from the plugin folder and read <a href=\"http://alexrabe.de/wordpress-plugins/wordtube/translation-of-plugins/\">here</a> how you can translate the plugin."
|
27 |
msgstr "Sollten jemand Rechtschreibfehler, Deppenapostrophe oder andere deutsche Ungereimtheiten finden, freue ich mich jederzeit über einen kurzen Hinweis</p>"
|
28 |
|
29 |
+
#: ../nggallery.php:194
|
30 |
+
msgid "Sorry, NextGEN Gallery works only with a Memory Limit of 16 MB or higher"
|
31 |
msgstr "Tut mir leid, aber NextGEN-Galerie benötigt minimum 16MB Speicher (Memory Limit) oder mehr"
|
32 |
|
33 |
+
#: ../nggallery.php:212
|
34 |
msgid "Please update the database of NextGEN Gallery."
|
35 |
msgstr "Bitte aktualisiere die Datenbank von NextGEN Gallery."
|
36 |
|
37 |
+
#: ../nggallery.php:212
|
38 |
msgid "Click here to proceed."
|
39 |
msgstr "Hier klicken um fortzufahren."
|
40 |
|
41 |
+
#: ../nggallery.php:235
|
42 |
msgid "Picture tag"
|
43 |
msgstr "Bilder-Stichwort"
|
44 |
|
45 |
+
#: ../nggallery.php:236
|
46 |
msgid "Picture tag: %2$l."
|
47 |
msgstr "Bilder-Stichwort: %2$l."
|
48 |
|
49 |
+
#: ../nggallery.php:237
|
50 |
msgid "Separate picture tags with commas."
|
51 |
msgstr "Trenne Stichwörter mittels Komma"
|
52 |
|
53 |
+
#: ../nggallery.php:336
|
54 |
msgid "L O A D I N G"
|
55 |
msgstr "B I T T E W A R T E N"
|
56 |
|
57 |
+
#: ../nggallery.php:337
|
58 |
msgid "Click to Close"
|
59 |
msgstr "Klicken zum Schliessen "
|
60 |
|
61 |
+
#: ../nggallery.php:358
|
62 |
msgid "loading"
|
63 |
msgstr "lade..."
|
64 |
|
65 |
+
#: ../nggallery.php:498
|
66 |
+
#: ../nggfunctions.php:919
|
67 |
+
#: ../admin/admin.php:32
|
68 |
msgid "Overview"
|
69 |
msgstr "Übersicht"
|
70 |
|
71 |
+
#: ../nggallery.php:499
|
72 |
msgid "Get help"
|
73 |
msgstr "Hilfe"
|
74 |
|
75 |
+
#: ../nggallery.php:500
|
76 |
msgid "Contribute"
|
77 |
msgstr "Mithelfen"
|
78 |
|
79 |
+
#: ../nggallery.php:501
|
80 |
msgid "Donate"
|
81 |
msgstr "Spenden"
|
82 |
|
83 |
#: ../nggfunctions.php:42
|
84 |
+
msgid "The <a href=\"http://www.macromedia.com/go/getflashplayer\">Flash Player</a> and <a href=\"http://www.mozilla.com/firefox/\">a browser with Javascript support</a> are needed."
|
85 |
msgstr "Es wird der <a href=\"http://www.macromedia.com/go/getflashplayer\">Adobe Flash Player</a> benötigt und <a href=\"http://www.mozilla.com/firefox/\">im Browser muss Javascript</a> aktiviert sein."
|
86 |
|
87 |
+
#: ../nggfunctions.php:164
|
88 |
+
#: ../nggfunctions.php:629
|
89 |
msgid "[Gallery not found]"
|
90 |
msgstr "[Galerie nicht gefunden]"
|
91 |
|
92 |
+
#: ../nggfunctions.php:436
|
93 |
msgid "[Album not found]"
|
94 |
msgstr "[Album nicht gefunden]"
|
95 |
|
96 |
+
#: ../nggfunctions.php:746
|
97 |
msgid "[SinglePic not found]"
|
98 |
msgstr "[Bild nicht gefunden]"
|
99 |
|
100 |
+
#: ../nggfunctions.php:884
|
101 |
msgid "Related images for"
|
102 |
msgstr "Verwandte Bilder von"
|
103 |
|
222 |
#: ../admin/addgallery.php:69
|
223 |
#: ../admin/addgallery.php:80
|
224 |
#: ../admin/album.php:96
|
225 |
+
#: ../admin/album.php:124
|
226 |
+
#: ../admin/album.php:142
|
227 |
#: ../admin/edit-thumbnail.php:19
|
228 |
#: ../admin/edit-thumbnail.php:22
|
229 |
+
#: ../admin/manage.php:179
|
230 |
msgid "Cheatin’ uh?"
|
231 |
msgstr "Cheatin’ uh?"
|
232 |
|
239 |
msgstr "Upload fehlgeschlagen!"
|
240 |
|
241 |
#: ../admin/addgallery.php:90
|
242 |
+
#: ../admin/functions.php:932
|
243 |
+
#: ../admin/functions.php:1032
|
244 |
msgid "No gallery selected !"
|
245 |
msgstr "Keine Galerie ausgewählt !"
|
246 |
|
247 |
+
#: ../admin/addgallery.php:159
|
248 |
msgid "Image Files"
|
249 |
msgstr "Bilder"
|
250 |
|
251 |
+
#: ../admin/addgallery.php:180
|
252 |
+
#: ../admin/addgallery.php:208
|
253 |
msgid "remove"
|
254 |
msgstr "Entfernen"
|
255 |
|
256 |
+
#: ../admin/addgallery.php:181
|
257 |
+
#: ../admin/addgallery.php:361
|
258 |
msgid "Browse..."
|
259 |
msgstr "Durchsuche..."
|
260 |
|
261 |
+
#: ../admin/addgallery.php:182
|
262 |
+
#: ../admin/addgallery.php:194
|
263 |
+
#: ../admin/addgallery.php:411
|
264 |
msgid "Upload images"
|
265 |
msgstr "Bilder hochladen"
|
266 |
|
267 |
+
#: ../admin/addgallery.php:271
|
268 |
+
#: ../admin/addgallery.php:377
|
269 |
msgid "Upload Images"
|
270 |
msgstr "Bilder hochladen"
|
271 |
|
272 |
+
#: ../admin/addgallery.php:274
|
273 |
+
#: ../admin/addgallery.php:291
|
274 |
+
#: ../admin/manage-galleries.php:112
|
275 |
+
#: ../admin/manage-galleries.php:149
|
276 |
msgid "Add new gallery"
|
277 |
msgstr "Neue Galerie erstellen"
|
278 |
|
279 |
+
#: ../admin/addgallery.php:277
|
280 |
+
#: ../admin/addgallery.php:313
|
281 |
msgid "Upload a Zip-File"
|
282 |
msgstr "Zip-Datei hochladen"
|
283 |
|
284 |
+
#: ../admin/addgallery.php:280
|
285 |
+
#: ../admin/addgallery.php:355
|
286 |
msgid "Import image folder"
|
287 |
msgstr "Bilder-Verzeichnis importieren"
|
288 |
|
289 |
+
#: ../admin/addgallery.php:296
|
290 |
+
#: ../admin/manage-galleries.php:284
|
291 |
msgid "New Gallery"
|
292 |
msgstr "Neue Galerie"
|
293 |
|
294 |
+
#: ../admin/addgallery.php:299
|
295 |
+
#: ../admin/manage-galleries.php:286
|
296 |
msgid "Create a new , empty gallery below the folder"
|
297 |
msgstr "Erstelle eine neue, leere Galerie unter dem Verzeichnis"
|
298 |
|
299 |
+
#: ../admin/addgallery.php:301
|
300 |
+
#: ../admin/manage-galleries.php:288
|
301 |
msgid "Allowed characters for file and folder names are"
|
302 |
msgstr "Erlaubte Zeichen für die Datei- und Verzeichnisnamen sind"
|
303 |
|
304 |
+
#: ../admin/addgallery.php:305
|
305 |
msgid "Add gallery"
|
306 |
msgstr "Galerie hinzufügen"
|
307 |
|
308 |
+
#: ../admin/addgallery.php:318
|
309 |
msgid "Select Zip-File"
|
310 |
msgstr "Wähle Zip-Datei"
|
311 |
|
312 |
+
#: ../admin/addgallery.php:320
|
313 |
msgid "Upload a zip file with images"
|
314 |
msgstr "Lade eine Zip-Datei mit Bildern hoch"
|
315 |
|
316 |
+
#: ../admin/addgallery.php:324
|
317 |
msgid "or enter a Zip-File URL"
|
318 |
msgstr "oder gib eine URL zur ZIP-Datei an"
|
319 |
|
320 |
+
#: ../admin/addgallery.php:326
|
321 |
msgid "Import a zip file with images from a url"
|
322 |
msgstr "Lade eine Zip-Datei mit Bildern über ein URL hoch"
|
323 |
|
324 |
+
#: ../admin/addgallery.php:330
|
325 |
+
#: ../admin/addgallery.php:386
|
326 |
msgid "in to"
|
327 |
msgstr "in"
|
328 |
|
329 |
+
#: ../admin/addgallery.php:332
|
330 |
msgid "a new gallery"
|
331 |
msgstr "eine neue Galerie"
|
332 |
|
333 |
+
#: ../admin/addgallery.php:343
|
334 |
msgid "Note : The upload limit on your server is "
|
335 |
msgstr "Hinweis : Das Upload-Limit auf dem Server beträgt "
|
336 |
|
337 |
+
#: ../admin/addgallery.php:347
|
338 |
msgid "Start upload"
|
339 |
msgstr "Upload starten"
|
340 |
|
341 |
+
#: ../admin/addgallery.php:360
|
342 |
msgid "Import from Server path:"
|
343 |
msgstr "Importieren aus Server-Pfad:"
|
344 |
|
345 |
+
#: ../admin/addgallery.php:363
|
346 |
msgid "Note : Change the default path in the gallery settings"
|
347 |
msgstr "Hinweis : Der Default-Pfad kann in den Einstellungen angepasst werden"
|
348 |
|
349 |
+
#: ../admin/addgallery.php:365
|
350 |
msgid " Please note : For safe-mode = ON you need to add the subfolder thumbs manually"
|
351 |
msgstr "Achtung : Da der Safe-Mode (PHP.INI) eingeschaltet ist, mußt Du das Unterverzeichnis für die Vorschaubilder (\"thumbs\") manuell (per FTP) anlegen"
|
352 |
|
353 |
+
#: ../admin/addgallery.php:368
|
354 |
msgid "Import folder"
|
355 |
msgstr "Verzeichnis importieren"
|
356 |
|
357 |
+
#: ../admin/addgallery.php:382
|
358 |
msgid "Upload image"
|
359 |
msgstr "Bild hochladen"
|
360 |
|
361 |
+
#: ../admin/addgallery.php:388
|
362 |
msgid "Choose gallery"
|
363 |
msgstr "Wähle Galerie"
|
364 |
|
365 |
+
#: ../admin/addgallery.php:407
|
366 |
msgid "The batch upload requires Adobe Flash 10, disable it if you have problems"
|
367 |
msgstr "Das Batch-Upload benötigt Adbode Flash 10, wenn es Probleme gibt deaktiviere es besser."
|
368 |
|
369 |
+
#: ../admin/addgallery.php:407
|
370 |
msgid "Disable flash upload"
|
371 |
msgstr "Deaktiviere Batch-Upload"
|
372 |
|
373 |
+
#: ../admin/addgallery.php:409
|
374 |
msgid "Upload multiple files at once by ctrl/shift-selecting in dialog"
|
375 |
msgstr "Wähle im Dialog mit Ctrl/Shift mehrere Bilder gleichzeitig aus."
|
376 |
|
377 |
+
#: ../admin/addgallery.php:409
|
378 |
msgid "Enable flash based upload"
|
379 |
msgstr "Aktiviere Flash Batch Upload"
|
380 |
|
381 |
+
#: ../admin/admin.php:31
|
382 |
+
#: ../admin/admin.php:57
|
383 |
+
#: ../admin/admin.php:283
|
384 |
+
#: ../admin/admin.php:351
|
385 |
+
#: ../admin/functions.php:178
|
386 |
+
#: ../admin/manage-galleries.php:120
|
387 |
+
#: ../admin/manage-galleries.php:372
|
388 |
+
#: ../admin/manage-images.php:239
|
389 |
msgid "Gallery"
|
390 |
msgid_plural "Galleries"
|
391 |
msgstr[0] "Galerie"
|
392 |
msgstr[1] "Galerien"
|
393 |
|
394 |
+
#: ../admin/admin.php:33
|
395 |
msgid "Add Gallery / Images"
|
396 |
msgstr "Galerie / Bilder hinzufügen"
|
397 |
|
398 |
+
#: ../admin/admin.php:34
|
399 |
msgid "Manage Gallery"
|
400 |
msgstr "Galerie verwalten"
|
401 |
|
402 |
+
#: ../admin/admin.php:35
|
403 |
msgid "Album"
|
404 |
msgid_plural "Albums"
|
405 |
msgstr[0] "Album"
|
406 |
msgstr[1] "Alben"
|
407 |
|
408 |
+
#: ../admin/admin.php:36
|
409 |
msgid "Tags"
|
410 |
msgstr "Stichwörter"
|
411 |
|
412 |
+
#: ../admin/admin.php:37
|
413 |
msgid "Options"
|
414 |
msgstr "Optionen"
|
415 |
|
416 |
+
#: ../admin/admin.php:39
|
417 |
msgid "Style"
|
418 |
msgstr "Style"
|
419 |
|
420 |
+
#: ../admin/admin.php:41
|
421 |
msgid "Roles"
|
422 |
msgstr "Zugriff"
|
423 |
|
424 |
+
#: ../admin/admin.php:42
|
425 |
msgid "About this Gallery"
|
426 |
msgstr "Über diese Galerie"
|
427 |
|
428 |
+
#: ../admin/admin.php:42
|
429 |
msgid "About"
|
430 |
msgstr "Über"
|
431 |
|
432 |
+
#: ../admin/admin.php:45
|
433 |
msgid "NextGEN Gallery"
|
434 |
msgstr "NextGEN Gallery"
|
435 |
|
436 |
+
#: ../admin/admin.php:48
|
437 |
+
#: ../admin/admin.php:59
|
438 |
msgid "Reset / Uninstall"
|
439 |
msgstr "Rücksetzen"
|
440 |
|
441 |
+
#: ../admin/admin.php:58
|
442 |
+
msgid "Network settings"
|
443 |
+
msgstr "Netzwerk Einstellungen"
|
444 |
|
445 |
+
#: ../admin/admin.php:98
|
|
|
|
|
|
|
|
|
446 |
#, php-format
|
447 |
msgid "Thanks for using this plugin, I hope you are satisfied ! If you would like to support the further development, please consider a <strong><a href=\"%s\">donation</a></strong>! If you still need some help, please post your questions <a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\">here</a> ."
|
448 |
msgstr "Vielen Dank, dass Du dieses Plugin nutzt. Ich hoffe, Du bist soweit zufrieden! Wenn Du die Weiterentwicklung unterstützen möchtest, würde ich mich über eine kleine <strong><a href=\"%s\">Spende</a></strong> freuen! Wenn Du Fragen oder Problem hast, schreib sie doch <a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\">hier</a> ins Forum."
|
449 |
|
450 |
+
#: ../admin/admin.php:101
|
451 |
msgid "OK, hide this message now !"
|
452 |
msgstr "OK, danke für die Info !"
|
453 |
|
454 |
+
#: ../admin/admin.php:186
|
455 |
msgid "You do not have the correct permission"
|
456 |
msgstr "Du hast keine Zugriffsrechte"
|
457 |
|
458 |
+
#: ../admin/admin.php:187
|
459 |
msgid "Unexpected Error"
|
460 |
msgstr "Unerwarteter Fehler"
|
461 |
|
462 |
+
#: ../admin/admin.php:188
|
463 |
msgid "A failure occurred"
|
464 |
msgstr "Ein Fehler ist aufgetreten"
|
465 |
|
466 |
+
#: ../admin/admin.php:287
|
467 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Introduction</a>"
|
468 |
msgstr "<a href=\"http://www.curlyrob.de/curlyrob/?page_id=129\" target=\"_blank\">Einführung</a>"
|
469 |
|
470 |
+
#: ../admin/admin.php:290
|
471 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Setup</a>"
|
472 |
msgstr "<a href=\"http://www.curlyrob.de/curlyrob/?page_id=129\" target=\"_blank\">Setup</a>"
|
473 |
|
474 |
+
#: ../admin/admin.php:293
|
475 |
msgid "<a href=\"http://alexrabe.de/wordpress-plugins/nextgen-gallery/languages/\" target=\"_blank\">Translation by alex rabe</a>"
|
476 |
msgstr "<a href=\"http://alexrabe.de/wordpress-plugins/nextgen-gallery/languages/\" target=\"_blank\">Unterstütze bei der Übersetzung</a>"
|
477 |
|
478 |
+
#: ../admin/admin.php:296
|
479 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Roles / Capabilities</a>"
|
480 |
msgstr "<a href=\"http://www.curlyrob.de/curlyrob/?page_id=129\" target=\"_blank\">Einführung</a>"
|
481 |
|
482 |
+
#: ../admin/admin.php:299
|
483 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Styles</a>"
|
484 |
msgstr "<a href=\"http://www.curlyrob.de/curlyrob/?page_id=129\" target=\"_blank\">Einführung</a>"
|
485 |
|
486 |
+
#: ../admin/admin.php:300
|
487 |
msgid "Templates"
|
488 |
msgstr "Vorlagen"
|
489 |
|
490 |
+
#: ../admin/admin.php:303
|
491 |
+
#: ../admin/admin.php:309
|
492 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Gallery management</a>"
|
493 |
msgstr "<a href=\"http://www.curlyrob.de/curlyrob/?page_id=129\" target=\"_blank\">Einführung</a>"
|
494 |
|
495 |
+
#: ../admin/admin.php:304
|
496 |
msgid "Gallery example"
|
497 |
msgstr "Galerie Beispiel"
|
498 |
|
499 |
+
#: ../admin/admin.php:310
|
500 |
+
#: ../admin/admin.php:320
|
501 |
msgid "Gallery tags"
|
502 |
msgstr "Galerie Stichwörter"
|
503 |
|
504 |
+
#: ../admin/admin.php:313
|
505 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Album management</a>"
|
506 |
msgstr "<a href=\"http://www.curlyrob.de/curlyrob/?page_id=129\" target=\"_blank\">Einführung</a>"
|
507 |
|
508 |
+
#: ../admin/admin.php:314
|
509 |
msgid "Album example"
|
510 |
msgstr "Album Beispiel"
|
511 |
|
512 |
+
#: ../admin/admin.php:315
|
513 |
+
#: ../admin/admin.php:321
|
514 |
msgid "Album tags"
|
515 |
msgstr "Album Stichwörter"
|
516 |
|
517 |
+
#: ../admin/admin.php:318
|
518 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Gallery tags</a>"
|
519 |
msgstr "<a href=\"http://www.curlyrob.de/curlyrob/?page_id=129\" target=\"_blank\">Einführung</a>"
|
520 |
|
521 |
+
#: ../admin/admin.php:319
|
522 |
msgid "Related images"
|
523 |
msgstr "Verwandte Bilder"
|
524 |
|
525 |
+
#: ../admin/admin.php:324
|
526 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-image-management/\" target=\"_blank\">Image management</a>"
|
527 |
msgstr "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-image-management/\" target=\"_blank\">Bilderverwaltung (englisch)</a>"
|
528 |
|
529 |
+
#: ../admin/admin.php:325
|
530 |
msgid "Custom fields"
|
531 |
msgstr "Spezialfelder"
|
532 |
|
533 |
+
#: ../admin/admin.php:330
|
534 |
msgid "Get help with NextGEN Gallery"
|
535 |
msgstr "Weitere Hilfe zu NextGEN Gallery"
|
536 |
|
537 |
+
#: ../admin/admin.php:334
|
538 |
msgid "More Help & Info"
|
539 |
msgstr "Weitere Hilfe & Informationen"
|
540 |
|
541 |
+
#: ../admin/admin.php:336
|
542 |
msgid "<a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\" target=\"_blank\">Support Forums</a>"
|
543 |
msgstr "<a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\" target=\"_blank\">Support Forum (englisch)</a>"
|
544 |
|
545 |
+
#: ../admin/admin.php:337
|
546 |
msgid "FAQ"
|
547 |
msgstr "FAQ (englisch)"
|
548 |
|
549 |
+
#: ../admin/admin.php:338
|
550 |
msgid "Feature request"
|
551 |
msgstr "Wünsch Dir was"
|
552 |
|
553 |
+
#: ../admin/admin.php:339
|
554 |
msgid "Get your language pack"
|
555 |
msgstr "Lade Deine Sprachdatei"
|
556 |
|
557 |
+
#: ../admin/admin.php:340
|
558 |
msgid "Contribute development"
|
559 |
msgstr "Entwicklung helfen"
|
560 |
|
561 |
+
#: ../admin/admin.php:341
|
562 |
msgid "Download latest version"
|
563 |
msgstr "Aktuelle Version downloaden"
|
564 |
|
565 |
+
#: ../admin/ajax.php:312
|
566 |
+
msgid "You are not allowed to be here"
|
567 |
+
msgstr "Keine Zugangsberechtigung"
|
568 |
+
|
569 |
+
#: ../admin/album.php:102
|
570 |
+
#: ../admin/album.php:117
|
571 |
+
#: ../admin/album.php:158
|
572 |
msgid "Update Successfully"
|
573 |
msgstr "Update erfolgreich"
|
574 |
|
575 |
+
#: ../admin/album.php:131
|
576 |
msgid "Album deleted"
|
577 |
msgstr "Album gelöscht"
|
578 |
|
579 |
+
#: ../admin/album.php:269
|
580 |
+
msgid "Edit Album"
|
581 |
+
msgstr "Album erstellen"
|
582 |
+
|
583 |
+
#: ../admin/album.php:278
|
584 |
msgid "Manage Albums"
|
585 |
msgstr "Verwalte Alben"
|
586 |
|
587 |
+
#: ../admin/album.php:284
|
588 |
+
#: ../admin/album.php:333
|
589 |
msgid "Select album"
|
590 |
msgstr "Wähle Album"
|
591 |
|
592 |
+
#: ../admin/album.php:286
|
593 |
msgid "No album selected"
|
594 |
msgstr "Kein Album ausgewählt"
|
595 |
|
596 |
+
#: ../admin/album.php:297
|
597 |
#: ../admin/edit-thumbnail.php:157
|
598 |
msgid "Update"
|
599 |
msgstr "Aktualisiere"
|
600 |
|
601 |
+
#: ../admin/album.php:299
|
602 |
msgid "Edit album"
|
603 |
msgstr "Album ändern"
|
604 |
|
605 |
+
#: ../admin/album.php:302
|
606 |
+
#: ../admin/manage-galleries.php:139
|
607 |
+
#: ../admin/manage-images.php:445
|
608 |
msgid "Delete"
|
609 |
msgstr "Lösche"
|
610 |
|
611 |
+
#: ../admin/album.php:302
|
612 |
msgid "Delete album ?"
|
613 |
msgstr "Album löschen ?"
|
614 |
|
615 |
+
#: ../admin/album.php:306
|
616 |
msgid "Add new album"
|
617 |
msgstr "Album hinzufügen"
|
618 |
|
619 |
+
#: ../admin/album.php:308
|
620 |
msgid "Add"
|
621 |
msgstr "Hinzufügen"
|
622 |
|
623 |
+
#: ../admin/album.php:319
|
624 |
msgid "Show / hide used galleries"
|
625 |
msgstr "Zeige / Verstecke verwendete Galerien"
|
626 |
|
627 |
+
#: ../admin/album.php:319
|
628 |
msgid "[Show all]"
|
629 |
msgstr "[Alle zeigen]"
|
630 |
|
631 |
+
#: ../admin/album.php:320
|
632 |
msgid "Maximize the widget content"
|
633 |
msgstr "Maximiere die Widgets"
|
634 |
|
635 |
+
#: ../admin/album.php:320
|
636 |
msgid "[Maximize]"
|
637 |
msgstr "[Vergrößern]"
|
638 |
|
639 |
+
#: ../admin/album.php:321
|
640 |
msgid "Minimize the widget content"
|
641 |
msgstr "Minimiere die Widgets"
|
642 |
|
643 |
+
#: ../admin/album.php:321
|
644 |
msgid "[Minimize]"
|
645 |
msgstr "[Verkleinern]"
|
646 |
|
647 |
+
#: ../admin/album.php:323
|
648 |
msgid "After you create and select a album, you can drag and drop a gallery or another album into your new album below"
|
649 |
msgstr "Nachdem Du ein Album erstellt und ausgewählt hast, kannst Du per Drag & Drop eine Galerie oder ein anderes Album in das neue Album ziehen"
|
650 |
|
651 |
+
#: ../admin/album.php:349
|
652 |
msgid "Select gallery"
|
653 |
msgstr "Wähle Galerie"
|
654 |
|
655 |
+
#: ../admin/album.php:378
|
656 |
msgid "Album ID"
|
657 |
msgstr "Album ID"
|
658 |
|
659 |
+
#: ../admin/album.php:391
|
660 |
msgid "No album selected!"
|
661 |
msgstr "Kein Album ausgewählt"
|
662 |
|
663 |
+
#: ../admin/album.php:411
|
664 |
msgid "Album name:"
|
665 |
msgstr "Album Name :"
|
666 |
|
667 |
+
#: ../admin/album.php:417
|
668 |
msgid "Album description:"
|
669 |
msgstr "Beschreibung:"
|
670 |
|
671 |
+
#: ../admin/album.php:423
|
672 |
msgid "Select a preview image:"
|
673 |
msgstr "Wähle Vorschaubild:"
|
674 |
|
675 |
+
#: ../admin/album.php:426
|
676 |
+
#: ../admin/album.php:429
|
677 |
msgid "No picture"
|
678 |
msgstr "Kein Bild"
|
679 |
|
680 |
+
#: ../admin/album.php:440
|
681 |
+
#: ../admin/manage-images.php:257
|
682 |
msgid "Page Link to"
|
683 |
msgstr "Seite verlinkt zu"
|
684 |
|
685 |
+
#: ../admin/album.php:442
|
686 |
+
#: ../admin/manage-images.php:260
|
687 |
msgid "Not linked"
|
688 |
msgstr "Nicht verlinkt"
|
689 |
|
690 |
+
#: ../admin/album.php:455
|
691 |
+
#: ../admin/manage-galleries.php:293
|
692 |
+
#: ../admin/manage-galleries.php:322
|
693 |
+
#: ../admin/manage-galleries.php:352
|
694 |
+
#: ../admin/manage-images.php:539
|
695 |
+
#: ../admin/manage-images.php:575
|
696 |
+
#: ../admin/manage-images.php:604
|
697 |
+
#: ../admin/manage-images.php:634
|
698 |
msgid "OK"
|
699 |
msgstr "OK"
|
700 |
|
701 |
+
#: ../admin/album.php:457
|
702 |
+
#: ../admin/manage-galleries.php:295
|
703 |
+
#: ../admin/manage-galleries.php:324
|
704 |
+
#: ../admin/manage-galleries.php:354
|
705 |
+
#: ../admin/manage-images.php:541
|
706 |
+
#: ../admin/manage-images.php:577
|
707 |
+
#: ../admin/manage-images.php:606
|
708 |
+
#: ../admin/manage-images.php:636
|
709 |
msgid "Cancel"
|
710 |
msgstr "Abbrechen"
|
711 |
|
712 |
+
#: ../admin/album.php:541
|
713 |
msgid "Name"
|
714 |
msgstr "Name"
|
715 |
|
716 |
+
#: ../admin/album.php:542
|
717 |
+
#: ../admin/manage-images.php:255
|
|
|
|
|
718 |
msgid "Title"
|
719 |
msgstr "Titel"
|
720 |
|
721 |
+
#: ../admin/album.php:543
|
722 |
msgid "Page"
|
723 |
msgstr "Seite"
|
724 |
|
738 |
msgid "Select the area for the thumbnail from the picture on the left."
|
739 |
msgstr "Wähle den Ausschnitt für das Vorschaubild innerhalb des Bildes"
|
740 |
|
741 |
+
#: ../admin/functions.php:39
|
742 |
msgid "No valid gallery name!"
|
743 |
msgstr "Kein gültiger Galerie-Name!"
|
744 |
|
745 |
+
#: ../admin/functions.php:46
|
746 |
+
#: ../admin/functions.php:55
|
747 |
+
#: ../admin/functions.php:80
|
748 |
+
#: ../admin/functions.php:149
|
749 |
+
#: ../admin/functions.php:157
|
750 |
msgid "Directory"
|
751 |
msgstr "Verzeichnis"
|
752 |
|
753 |
+
#: ../admin/functions.php:46
|
754 |
msgid "didn't exist. Please create first the main gallery folder "
|
755 |
msgstr "nicht gefunden. Bitte erstelle zuerst das Hauptverzeichnis."
|
756 |
|
757 |
+
#: ../admin/functions.php:47
|
758 |
+
#: ../admin/functions.php:56
|
759 |
msgid "Check this link, if you didn't know how to set the permission :"
|
760 |
msgstr "Dieser Link zeigt Dir, wie man Verzeichnisrechte ändert :"
|
761 |
|
762 |
+
#: ../admin/functions.php:55
|
763 |
+
#: ../admin/functions.php:80
|
764 |
msgid "is not writeable !"
|
765 |
msgstr "ist schreibgeschützt !"
|
766 |
|
767 |
+
#: ../admin/functions.php:76
|
768 |
+
#: ../admin/functions.php:85
|
769 |
+
#: ../admin/functions.php:891
|
770 |
msgid "Unable to create directory "
|
771 |
msgstr "Kann Verzeichnis nicht erstellen "
|
772 |
|
773 |
+
#: ../admin/functions.php:89
|
774 |
msgid "The server setting Safe-Mode is on !"
|
775 |
msgstr "Auf dem Server ist Safe-Mode aktiviert (PHP.INI)"
|
776 |
|
777 |
+
#: ../admin/functions.php:90
|
778 |
msgid "If you have problems, please create directory"
|
779 |
msgstr "Wenn Probleme auftreten, erstelle bitte das Verzeichnis"
|
780 |
|
781 |
+
#: ../admin/functions.php:91
|
782 |
msgid "and the thumbnails directory"
|
783 |
msgstr "und das Thumbnails-Verzeichnis"
|
784 |
|
785 |
+
#: ../admin/functions.php:91
|
786 |
msgid "with permission 777 manually !"
|
787 |
msgstr "mit den Berechtigungen 777 manuell !"
|
788 |
|
789 |
+
#: ../admin/functions.php:116
|
|
|
|
|
|
|
|
|
790 |
#, php-format
|
791 |
+
msgid "Gallery ID %1$s successfully created. You can show this gallery in your post or page with the shortcode %2$s.<br/>"
|
792 |
+
msgstr "Galerie ID %1$s erstellt..<br/>Du kannst diese Galerie jetzt mit dem Stichwort %2$s in einen Artikel einbinden.<br/>"
|
793 |
|
794 |
+
#: ../admin/functions.php:119
|
795 |
msgid "Edit gallery"
|
796 |
msgstr "Galerie ändern"
|
797 |
|
798 |
+
#: ../admin/functions.php:149
|
799 |
msgid "doesn`t exist!"
|
800 |
msgstr "gibt es nicht !"
|
801 |
|
802 |
+
#: ../admin/functions.php:157
|
803 |
msgid "contains no pictures"
|
804 |
msgstr "enthält keine Bilder"
|
805 |
|
806 |
+
#: ../admin/functions.php:175
|
807 |
msgid "Database error. Could not add gallery!"
|
808 |
msgstr "Datenbank-Fehler. Kann Galerie nicht hinzufügen!"
|
809 |
|
810 |
+
#: ../admin/functions.php:178
|
811 |
msgid "successfully created!"
|
812 |
msgstr "erfolgreich erstellt!"
|
813 |
|
814 |
+
#: ../admin/functions.php:207
|
815 |
+
#: ../admin/functions.php:1008
|
816 |
+
#: ../admin/manage-galleries.php:74
|
817 |
+
#: ../admin/manage-galleries.php:141
|
818 |
+
#: ../admin/manage-images.php:202
|
819 |
+
#: ../admin/manage-images.php:341
|
820 |
+
#: ../admin/manage.php:216
|
821 |
+
#: ../admin/manage.php:292
|
822 |
msgid "Create new thumbnails"
|
823 |
msgstr "Neue Vorschaubilder erstellen"
|
824 |
|
825 |
+
#: ../admin/functions.php:210
|
826 |
msgid " picture(s) successfully added"
|
827 |
msgstr " Bild(er) erfolgreich hinzugefügt"
|
828 |
|
829 |
+
#: ../admin/functions.php:260
|
830 |
+
#: ../admin/functions.php:340
|
831 |
+
#: ../admin/functions.php:395
|
832 |
+
#: ../admin/functions.php:492
|
833 |
+
#: ../admin/functions.php:546
|
834 |
msgid "Object didn't contain correct data"
|
835 |
msgstr "Das Objekt enhält nicht die notwendigen Daten"
|
836 |
|
837 |
+
#: ../admin/functions.php:268
|
838 |
msgid " is not writeable "
|
839 |
msgstr "ist schreibgeschützt !"
|
840 |
|
841 |
+
#: ../admin/functions.php:350
|
842 |
+
#: ../admin/functions.php:398
|
843 |
+
#: ../admin/functions.php:498
|
844 |
+
#: ../admin/functions.php:549
|
845 |
msgid " is not writeable"
|
846 |
msgstr "ist schreibgeschützt !"
|
847 |
|
848 |
+
#: ../admin/functions.php:552
|
849 |
msgid "File do not exists"
|
850 |
msgstr "Datei existiert nicht"
|
851 |
|
852 |
+
#: ../admin/functions.php:556
|
853 |
msgid "Couldn't restore original image"
|
854 |
msgstr "Konnte Originalbild nicht wiederherstellen"
|
855 |
|
856 |
+
#: ../admin/functions.php:671
|
857 |
msgid "(Error : Couldn't not update data base)"
|
858 |
msgstr "(Fehler : Konnte Datenbank nicht updaten)"
|
859 |
|
860 |
+
#: ../admin/functions.php:678
|
861 |
msgid "(Error : Couldn't not update meta data)"
|
862 |
msgstr "(Fehler : Konnte Metadaten nicht speichern)"
|
863 |
|
864 |
+
#: ../admin/functions.php:687
|
865 |
msgid "(Error : Couldn't not find image)"
|
866 |
msgstr "(Fehler : Konnte das Bild nicht finden)"
|
867 |
|
868 |
+
#: ../admin/functions.php:825
|
869 |
msgid "No valid URL path "
|
870 |
msgstr "Kein gültiger URL-Pfad"
|
871 |
|
872 |
+
#: ../admin/functions.php:841
|
873 |
msgid "Import via cURL failed."
|
874 |
msgstr "Import via cURL abgebrochen"
|
875 |
|
876 |
+
#: ../admin/functions.php:858
|
877 |
+
msgid "Uploaded file was no or a faulty zip file ! The server recognized : "
|
878 |
msgstr "Die hochgeladene Datei war keine korrekte Zip-Datei. Servermeldung :"
|
879 |
|
880 |
+
#: ../admin/functions.php:875
|
881 |
msgid "Could not get a valid foldername"
|
882 |
msgstr "Konnte keinen gültigen Verzeichnisnamen finden"
|
883 |
|
884 |
+
#: ../admin/functions.php:886
|
885 |
#, php-format
|
886 |
msgid "Unable to create directory %s. Is its parent directory writable by the server?"
|
887 |
msgstr "Kann das Verzeichnis %s nicht erstellen. Ist das Hauptverzeichnis vielleicht schreibgeschützt ?"
|
888 |
|
889 |
+
#: ../admin/functions.php:901
|
890 |
msgid "Zip-File successfully unpacked"
|
891 |
msgstr "Zip-Datei erfolgreich entpackt"
|
892 |
|
893 |
+
#: ../admin/functions.php:940
|
894 |
+
#: ../admin/functions.php:1057
|
895 |
msgid "Failure in database, no gallery path set !"
|
896 |
msgstr "Datenbankfehler! Kein Galerie-Pfad gesetzt !"
|
897 |
|
898 |
+
#: ../admin/functions.php:964
|
899 |
+
#: ../admin/functions.php:1051
|
900 |
msgid "is no valid image file!"
|
901 |
msgstr "ist keine zulässige Bilddatei !"
|
902 |
|
903 |
+
#: ../admin/functions.php:978
|
904 |
+
#: ../admin/functions.php:1177
|
905 |
+
#: ../admin/functions.php:1254
|
906 |
#, php-format
|
907 |
msgid "Unable to write to directory %s. Is this directory writable by the server?"
|
908 |
msgstr "Kann das Verzeichnis %s nicht erstellen. Ist das Hauptverzeichnis vielleicht schreibgeschützt ?"
|
909 |
|
910 |
+
#: ../admin/functions.php:985
|
911 |
+
#: ../admin/functions.php:1074
|
912 |
+
msgid "Error, the file could not be moved to : "
|
913 |
msgstr "Fehler: Diese Datei kann nicht verschoben werden zu :"
|
914 |
|
915 |
+
#: ../admin/functions.php:990
|
916 |
+
#: ../admin/functions.php:1078
|
917 |
+
msgid "Error, the file permissions could not be set"
|
918 |
msgstr "Fehler: Die Berechtigungen für diese Datei können nicht gesetzt werden"
|
919 |
|
920 |
+
#: ../admin/functions.php:1013
|
921 |
msgid " Image(s) successfully added"
|
922 |
msgstr " Bild(er) erfolgreich hinzugefügt"
|
923 |
|
924 |
+
#: ../admin/functions.php:1040
|
925 |
msgid "Invalid upload. Error Code : "
|
926 |
msgstr "Ungültiger Upload. Fehler Code :"
|
927 |
|
928 |
+
#: ../admin/functions.php:1117
|
929 |
#, php-format
|
930 |
msgid "SAFE MODE Restriction in effect! You need to create the folder <strong>%s</strong> manually"
|
931 |
msgstr "SAFE MODE Einschränkungen ist aktiv. Du musst das Verzeichnis <strong>%s</strong> manuell anlegen."
|
932 |
|
933 |
+
#: ../admin/functions.php:1118
|
934 |
#, php-format
|
935 |
msgid "When safe_mode is on, PHP checks to see if the owner (%s) of the current script matches the owner (%s) of the file to be operated on by a file function or its directory"
|
936 |
msgstr "Wenn der Safe-Mode eingeschaltet ist, überprüft PHP, ob der Besitzer (%s) des Skript mit dem Besitzer (%s) der Datei/Verzeichnis übereinstimmt."
|
937 |
|
938 |
+
#: ../admin/functions.php:1171
|
939 |
+
#: ../admin/functions.php:1248
|
940 |
msgid "The destination gallery does not exist"
|
941 |
msgstr "Die ausgewählte Galerie existiert nicht"
|
942 |
|
943 |
+
#: ../admin/functions.php:1202
|
944 |
#, php-format
|
945 |
msgid "Failed to move image %1$s to %2$s"
|
946 |
msgstr "Konnte das Bild %1$s nicht nach %2$s verschieben"
|
947 |
|
948 |
+
#: ../admin/functions.php:1222
|
949 |
#, php-format
|
950 |
msgid "Moved %1$s picture(s) to gallery : %2$s ."
|
951 |
msgstr " %1$s Bild(er) in Galerie : %2$s verschoben."
|
952 |
|
953 |
+
#: ../admin/functions.php:1281
|
954 |
#, php-format
|
955 |
msgid "Failed to copy image %1$s to %2$s"
|
956 |
msgstr "Konnte das Bild %1$s nicht nach %2$s kopieren"
|
957 |
|
958 |
+
#: ../admin/functions.php:1295
|
959 |
#, php-format
|
960 |
msgid "Failed to copy database row for picture %s"
|
961 |
msgstr "Fehler bei der Datenbank-Operation für Bild %s"
|
962 |
|
963 |
+
#: ../admin/functions.php:1307
|
964 |
#, php-format
|
965 |
msgid "Image %1$s (%2$s) copied as image %3$s (%4$s) » The file already existed in the destination gallery."
|
966 |
msgstr "Bild %1$s (%2$s) als Bild %3$s (%4$s) kopiert » Die Datei existierte bereits."
|
967 |
|
968 |
+
#: ../admin/functions.php:1310
|
969 |
#, php-format
|
970 |
msgid "Image %1$s (%2$s) copied as image %3$s (%4$s)"
|
971 |
msgstr "Bild %1$s (%2$s) kopiert als Bild %3$s (%4$s)"
|
972 |
|
973 |
+
#: ../admin/functions.php:1319
|
974 |
#, php-format
|
975 |
msgid "Copied %1$s picture(s) to gallery: %2$s ."
|
976 |
msgstr "Kopiere %1$s Bild(er) in die Galerie : %2$s ."
|
977 |
|
978 |
+
#: ../admin/functions.php:1427
|
979 |
msgid "The uploaded file exceeds the upload_max_filesize directive in php.ini"
|
980 |
msgstr "Die Datei überschreitet die erlaubte Grösse (upload_max_filesize) in der php.ini"
|
981 |
|
982 |
+
#: ../admin/functions.php:1430
|
983 |
msgid "The uploaded file exceeds the MAX_FILE_SIZE directive that was specified in the HTML form"
|
984 |
msgstr "Die Datei ist zu gross"
|
985 |
|
986 |
+
#: ../admin/functions.php:1433
|
987 |
msgid "The uploaded file was only partially uploaded"
|
988 |
msgstr "Die Datei wurde nur teilweise hochgeladen"
|
989 |
|
990 |
+
#: ../admin/functions.php:1436
|
991 |
msgid "No file was uploaded"
|
992 |
msgstr "Keinen Datei wurde geladen"
|
993 |
|
994 |
+
#: ../admin/functions.php:1439
|
995 |
msgid "Missing a temporary folder"
|
996 |
msgstr "Konnte temporäres Verzeichnis nicht finden"
|
997 |
|
998 |
+
#: ../admin/functions.php:1442
|
999 |
msgid "Failed to write file to disk"
|
1000 |
msgstr "Konnte Datei nicht speichern"
|
1001 |
|
1002 |
+
#: ../admin/functions.php:1445
|
1003 |
msgid "File upload stopped by extension"
|
1004 |
msgstr "Upload dieser Dateierweiterung nicht erlaubt"
|
1005 |
|
1006 |
+
#: ../admin/functions.php:1448
|
1007 |
msgid "Unknown upload error"
|
1008 |
msgstr "Unbekannter Uploadfehler"
|
1009 |
|
1011 |
msgid "Sorry, NextGEN Gallery works only with a role called administrator"
|
1012 |
msgstr "Tut mir leid, aber NextGEN Gallery benötigt zwingend die Rolle \"Administrator\""
|
1013 |
|
1014 |
+
#: ../admin/install.php:112
|
1015 |
msgid "NextGEN Gallery : Tables could not created, please check your database settings"
|
1016 |
msgstr "NextGEN Gallery : Tabellen konnten nicht erstellt werden, überprüfe Deine Datenbank"
|
1017 |
|
1018 |
+
#: ../admin/install.php:170
|
1019 |
msgid "[Show as slideshow]"
|
1020 |
msgstr "[Zeige als Diashow]"
|
1021 |
|
1022 |
+
#: ../admin/install.php:171
|
1023 |
msgid "[Show picture list]"
|
1024 |
msgstr "[Zeige Bilder-Liste]"
|
1025 |
|
1034 |
msgstr "»"
|
1035 |
|
1036 |
#: ../admin/manage-galleries.php:62
|
1037 |
+
#: ../admin/manage-images.php:170
|
1038 |
msgid "No images selected"
|
1039 |
msgstr "Keine Bilder ausgewählt"
|
1040 |
|
1041 |
+
#: ../admin/manage-galleries.php:70
|
1042 |
+
#: ../admin/manage-galleries.php:142
|
1043 |
+
#: ../admin/manage-images.php:198
|
1044 |
+
#: ../admin/manage-images.php:342
|
1045 |
+
#: ../admin/manage.php:200
|
1046 |
+
#: ../admin/manage.php:278
|
1047 |
+
msgid "Resize images"
|
1048 |
+
msgstr "Bilder verkleinern"
|
1049 |
+
|
1050 |
#: ../admin/manage-galleries.php:79
|
1051 |
#, php-format
|
1052 |
msgid ""
|
1058 |
" \n"
|
1059 |
" 'Abbrechen' um zu stoppen, 'OK' um die Bearbeitung durchzuführen."
|
1060 |
|
1061 |
+
#: ../admin/manage-galleries.php:123
|
1062 |
+
#: ../admin/manage-galleries.php:126
|
1063 |
+
#: ../admin/manage-images.php:225
|
1064 |
+
#: ../admin/manage-images.php:228
|
|
|
|
|
|
|
|
|
1065 |
msgid "Search Images"
|
1066 |
msgstr "Suche Bilder"
|
1067 |
|
1068 |
+
#: ../admin/manage-galleries.php:138
|
1069 |
+
#: ../admin/manage-images.php:339
|
1070 |
+
msgid "Bulk actions"
|
1071 |
+
msgstr "Aktion wählen"
|
1072 |
+
|
1073 |
+
#: ../admin/manage-galleries.php:140
|
1074 |
+
#: ../admin/manage-images.php:340
|
1075 |
+
#: ../admin/manage.php:133
|
1076 |
+
#: ../admin/manage.php:242
|
1077 |
msgid "Set watermark"
|
1078 |
msgstr "Wasserzeichen setzen"
|
1079 |
|
1080 |
+
#: ../admin/manage-galleries.php:143
|
1081 |
+
#: ../admin/manage-images.php:345
|
1082 |
+
#: ../admin/manage.php:138
|
1083 |
+
#: ../admin/manage.php:262
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1084 |
msgid "Import metadata"
|
1085 |
msgstr "Metadaten importieren"
|
1086 |
|
1087 |
+
#: ../admin/manage-galleries.php:144
|
1088 |
+
#: ../admin/manage-images.php:343
|
1089 |
+
#: ../admin/manage.php:128
|
1090 |
+
#: ../admin/manage.php:239
|
1091 |
msgid "Recover from backup"
|
1092 |
msgstr "Original wiederherstellen"
|
1093 |
|
1094 |
+
#: ../admin/manage-galleries.php:146
|
1095 |
+
#: ../admin/manage-images.php:354
|
1096 |
msgid "Apply"
|
1097 |
msgstr "Übernehmen"
|
1098 |
|
1099 |
+
#: ../admin/manage-galleries.php:154
|
1100 |
+
#: ../admin/manage-galleries.php:266
|
1101 |
+
#: ../admin/manage-images.php:330
|
1102 |
+
#: ../admin/manage-images.php:514
|
1103 |
#, php-format
|
1104 |
msgid "Displaying %s–%s of %s"
|
1105 |
msgstr "Zeige %s–%s von %s"
|
1106 |
|
1107 |
+
#: ../admin/manage-galleries.php:219
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1108 |
msgid "Edit"
|
1109 |
msgstr "Bearbeiten"
|
1110 |
|
1111 |
+
#: ../admin/manage-galleries.php:259
|
1112 |
+
#: ../admin/manage-images.php:505
|
|
|
|
|
|
|
|
|
1113 |
msgid "No entries found"
|
1114 |
msgstr "Keine Einträge gefunden"
|
1115 |
|
1116 |
+
#: ../admin/manage-galleries.php:313
|
1117 |
+
#: ../admin/manage-images.php:595
|
1118 |
msgid "Resize Images to"
|
1119 |
msgstr "Verkleiner Bilder auf"
|
1120 |
|
1121 |
+
#: ../admin/manage-galleries.php:317
|
1122 |
+
#: ../admin/manage-images.php:599
|
1123 |
msgid "Width x height (in pixel). NextGEN Gallery will keep ratio size"
|
1124 |
msgstr "Breite x Höhe (in Pixel). Das Seitenverhältnis wird berücksichtigt."
|
1125 |
|
1126 |
+
#: ../admin/manage-galleries.php:341
|
1127 |
+
#: ../admin/manage-images.php:623
|
1128 |
msgid "Width x height (in pixel)"
|
1129 |
msgstr "Breite x Höhe (in Pixel)"
|
1130 |
|
1131 |
+
#: ../admin/manage-galleries.php:343
|
1132 |
+
#: ../admin/manage-images.php:625
|
1133 |
msgid "These values are maximum values "
|
1134 |
msgstr "Diese Angaben sind maximale Angaben."
|
1135 |
|
1136 |
+
#: ../admin/manage-galleries.php:346
|
1137 |
+
#: ../admin/manage-images.php:628
|
1138 |
msgid "Set fix dimension"
|
1139 |
msgstr "Setze feste Größe"
|
1140 |
|
1141 |
+
#: ../admin/manage-galleries.php:348
|
1142 |
+
#: ../admin/manage-images.php:630
|
1143 |
msgid "Ignore the aspect ratio, no portrait thumbnails"
|
1144 |
msgstr "Ignoriere Bildseitenverhältnis"
|
1145 |
|
1146 |
+
#: ../admin/manage-galleries.php:371
|
1147 |
+
#: ../admin/manage-images.php:658
|
1148 |
+
msgid "ID"
|
1149 |
+
msgstr "ID"
|
1150 |
+
|
1151 |
+
#: ../admin/manage-galleries.php:373
|
1152 |
+
#: ../admin/manage-images.php:266
|
1153 |
+
#: ../admin/manage-images.php:663
|
1154 |
+
msgid "Description"
|
1155 |
+
msgstr "Beschreibung"
|
1156 |
+
|
1157 |
+
#: ../admin/manage-galleries.php:374
|
1158 |
+
#: ../admin/manage-images.php:287
|
1159 |
+
msgid "Author"
|
1160 |
+
msgstr "Autor"
|
1161 |
+
|
1162 |
+
#: ../admin/manage-galleries.php:375
|
1163 |
+
msgid "Page ID"
|
1164 |
+
msgstr "Seiten-ID"
|
1165 |
+
|
1166 |
+
#: ../admin/manage-galleries.php:376
|
1167 |
+
msgid "Image"
|
1168 |
+
msgid_plural "Images"
|
1169 |
+
msgstr[0] "Bild"
|
1170 |
+
msgstr[1] "Bilder"
|
1171 |
+
|
1172 |
#: ../admin/manage-images.php:32
|
1173 |
msgid "Gallery not found."
|
1174 |
msgstr "Galerie nicht gefunden"
|
1177 |
msgid "Sorry, you have no access here"
|
1178 |
msgstr "Sorry, Du hast nicht genügend Rechte"
|
1179 |
|
1180 |
+
#: ../admin/manage-images.php:178
|
1181 |
+
msgid "Copy image to..."
|
1182 |
+
msgstr "Kopiere nach..."
|
1183 |
+
|
1184 |
+
#: ../admin/manage-images.php:182
|
1185 |
+
msgid "Move image to..."
|
1186 |
+
msgstr "Verschiebe nach..."
|
1187 |
+
|
1188 |
+
#: ../admin/manage-images.php:186
|
1189 |
+
msgid "Add new tags"
|
1190 |
+
msgstr "Stichwörter hinzufügen"
|
1191 |
+
|
1192 |
+
#: ../admin/manage-images.php:190
|
1193 |
+
#: ../admin/manage-images.php:351
|
1194 |
+
msgid "Delete tags"
|
1195 |
+
msgstr "Stichwörter löschen"
|
1196 |
+
|
1197 |
+
#: ../admin/manage-images.php:194
|
1198 |
+
msgid "Overwrite"
|
1199 |
+
msgstr "Überschreiben"
|
1200 |
+
|
1201 |
+
#: ../admin/manage-images.php:207
|
1202 |
#, php-format
|
1203 |
msgid ""
|
1204 |
"You are about to start the bulk edit for %s images \n"
|
1209 |
" \n"
|
1210 |
" 'Abbrechen' um zu stoppen, 'OK' um die Bearbeitung durchzuführen."
|
1211 |
|
1212 |
+
#: ../admin/manage-images.php:222
|
1213 |
#, php-format
|
1214 |
msgid "Search results for “%s”"
|
1215 |
msgstr "Suchergebinsse für “%s”"
|
1216 |
|
1217 |
+
#: ../admin/manage-images.php:251
|
1218 |
msgid "Gallery settings"
|
1219 |
msgstr "Galerie Einstellungen"
|
1220 |
|
1221 |
+
#: ../admin/manage-images.php:251
|
1222 |
msgid "Click here for more settings"
|
1223 |
msgstr "Hier klicken für weitere Einstellungen"
|
1224 |
|
1225 |
+
#: ../admin/manage-images.php:268
|
1226 |
msgid "Preview image"
|
1227 |
msgstr "Vorschau-Bild"
|
1228 |
|
1229 |
+
#: ../admin/manage-images.php:271
|
1230 |
msgid "No Picture"
|
1231 |
msgstr "Kein Bild"
|
1232 |
|
1233 |
+
#: ../admin/manage-images.php:285
|
1234 |
msgid "Path"
|
1235 |
msgstr "Pfad"
|
1236 |
|
1237 |
+
#: ../admin/manage-images.php:302
|
1238 |
msgid "Create new page"
|
1239 |
msgstr "Neue Seite erstellen"
|
1240 |
|
1241 |
+
#: ../admin/manage-images.php:305
|
1242 |
msgid "Main page (No parent)"
|
1243 |
msgstr "Hauptseite (keine Unterseite)"
|
1244 |
|
1245 |
+
#: ../admin/manage-images.php:308
|
1246 |
msgid "Add page"
|
1247 |
msgstr "Seite hinzufügen"
|
1248 |
|
1249 |
+
#: ../admin/manage-images.php:317
|
1250 |
msgid "Scan Folder for new images"
|
1251 |
msgstr "Überprüfe Verzeichnis nach neuen Bildern"
|
1252 |
|
1253 |
+
#: ../admin/manage-images.php:318
|
1254 |
+
#: ../admin/manage-images.php:360
|
1255 |
+
#: ../admin/manage-images.php:512
|
1256 |
msgid "Save Changes"
|
1257 |
msgstr "Änderungen speichern"
|
1258 |
|
1259 |
+
#: ../admin/manage-images.php:344
|
1260 |
msgid "Delete images"
|
1261 |
msgstr "Bilder löschen"
|
1262 |
|
1263 |
+
#: ../admin/manage-images.php:346
|
1264 |
msgid "Rotate images clockwise"
|
1265 |
msgstr "Rechts drehen"
|
1266 |
|
1267 |
+
#: ../admin/manage-images.php:347
|
1268 |
msgid "Rotate images counter-clockwise"
|
1269 |
msgstr "Links drehen"
|
1270 |
|
1271 |
+
#: ../admin/manage-images.php:348
|
1272 |
msgid "Copy to..."
|
1273 |
msgstr "Kopiere nach..."
|
1274 |
|
1275 |
+
#: ../admin/manage-images.php:349
|
1276 |
msgid "Move to..."
|
1277 |
msgstr "Verschiebe nach..."
|
1278 |
|
1279 |
+
#: ../admin/manage-images.php:350
|
1280 |
msgid "Add tags"
|
1281 |
msgstr "Stichwörter hinzufügen"
|
1282 |
|
1283 |
+
#: ../admin/manage-images.php:352
|
|
|
|
|
|
|
|
|
1284 |
msgid "Overwrite tags"
|
1285 |
msgstr "Stichwörter überschreiben"
|
1286 |
|
1287 |
+
#: ../admin/manage-images.php:357
|
1288 |
msgid "Sort gallery"
|
1289 |
msgstr "Sortiere Bilder"
|
1290 |
|
1291 |
+
#: ../admin/manage-images.php:431
|
1292 |
msgid "pixel"
|
1293 |
msgstr "pixel"
|
1294 |
|
1295 |
+
#: ../admin/manage-images.php:437
|
1296 |
#, php-format
|
1297 |
msgid "View \"%s\""
|
1298 |
msgstr "Anzeigen \"%s\""
|
1299 |
|
1300 |
+
#: ../admin/manage-images.php:437
|
1301 |
msgid "View"
|
1302 |
msgstr "Ansehen"
|
1303 |
|
1304 |
+
#: ../admin/manage-images.php:438
|
1305 |
msgid "Show Meta data"
|
1306 |
msgstr "Zeige Metadaten"
|
1307 |
|
1308 |
+
#: ../admin/manage-images.php:438
|
1309 |
msgid "Meta"
|
1310 |
msgstr "Meta"
|
1311 |
|
1312 |
+
#: ../admin/manage-images.php:439
|
1313 |
msgid "Customize thumbnail"
|
1314 |
msgstr "Thumbnails anpassen"
|
1315 |
|
1316 |
+
#: ../admin/manage-images.php:439
|
1317 |
msgid "Edit thumb"
|
1318 |
msgstr "Thumbnail ändern"
|
1319 |
|
1320 |
+
#: ../admin/manage-images.php:440
|
1321 |
msgid "Rotate"
|
1322 |
msgstr "Drehen"
|
1323 |
|
1324 |
+
#: ../admin/manage-images.php:442
|
1325 |
+
msgid "Publish this image"
|
1326 |
+
msgstr "Bild veröffentlichen"
|
1327 |
+
|
1328 |
+
#: ../admin/manage-images.php:442
|
1329 |
+
msgid "Publish"
|
1330 |
+
msgstr "Veröffentlichen"
|
1331 |
+
|
1332 |
+
#: ../admin/manage-images.php:444
|
1333 |
msgid "Recover"
|
1334 |
msgstr "Rücksetzen"
|
1335 |
|
1336 |
+
#: ../admin/manage-images.php:444
|
1337 |
#, php-format
|
1338 |
msgid "Recover \"%s\" ?"
|
1339 |
msgstr " \"%s\" wiederherstellen ?"
|
1340 |
|
1341 |
+
#: ../admin/manage-images.php:445
|
1342 |
#, php-format
|
1343 |
msgid "Delete \"%s\" ?"
|
1344 |
msgstr "Lösche \"%s\" ?"
|
1345 |
|
1346 |
+
#: ../admin/manage-images.php:535
|
1347 |
msgid "Enter the tags"
|
1348 |
msgstr "Stichwörter angeben"
|
1349 |
|
1350 |
+
#: ../admin/manage-images.php:559
|
1351 |
msgid "Select the destination gallery:"
|
1352 |
msgstr "Galerie auswählen:"
|
1353 |
|
1354 |
+
#: ../admin/manage-images.php:659
|
1355 |
msgid "Thumbnail"
|
1356 |
msgstr "Thumbnail"
|
1357 |
|
1358 |
+
#: ../admin/manage-images.php:661
|
1359 |
+
#: ../admin/manage-sort.php:77
|
1360 |
msgid "Filename"
|
1361 |
msgstr "Dateiname"
|
1362 |
|
1363 |
+
#: ../admin/manage-images.php:663
|
1364 |
msgid "Alt & Title Text"
|
1365 |
msgstr "Alt & Titel Text"
|
1366 |
|
1367 |
+
#: ../admin/manage-images.php:664
|
1368 |
msgid "Tags (comma separated list)"
|
1369 |
msgstr "Stichwörter (Tags)"
|
1370 |
|
1371 |
+
#: ../admin/manage-images.php:666
|
1372 |
msgid "exclude"
|
1373 |
msgstr "ausschließen"
|
1374 |
|
1375 |
+
#: ../admin/manage-sort.php:33
|
1376 |
msgid "Sort order changed"
|
1377 |
msgstr "Reihenfolge aktualisiert"
|
1378 |
|
1379 |
+
#: ../admin/manage-sort.php:62
|
1380 |
msgid "Sort Gallery"
|
1381 |
msgstr "Sortiere Bilder"
|
1382 |
|
1383 |
+
#: ../admin/manage-sort.php:66
|
1384 |
msgid "Update Sort Order"
|
1385 |
msgstr "Sortierung speichern"
|
1386 |
|
1387 |
+
#: ../admin/manage-sort.php:69
|
1388 |
msgid "Back to gallery"
|
1389 |
msgstr "Zurück zur Galerie"
|
1390 |
|
1391 |
+
#: ../admin/manage-sort.php:74
|
1392 |
msgid "Presort"
|
1393 |
msgstr "Vorsortieren"
|
1394 |
|
1395 |
+
#: ../admin/manage-sort.php:75
|
1396 |
msgid "Unsorted"
|
1397 |
msgstr "Unsortiert"
|
1398 |
|
1399 |
+
#: ../admin/manage-sort.php:76
|
1400 |
msgid "Image ID"
|
1401 |
msgstr "Bilder ID"
|
1402 |
|
1403 |
+
#: ../admin/manage-sort.php:78
|
1404 |
msgid "Alt/Title text"
|
1405 |
msgstr "Alt / Titel Text"
|
1406 |
|
1407 |
+
#: ../admin/manage-sort.php:79
|
1408 |
msgid "Date/Time"
|
1409 |
msgstr "Datum/Zeit"
|
1410 |
|
1411 |
+
#: ../admin/manage-sort.php:80
|
1412 |
msgid "Ascending"
|
1413 |
msgstr "Aufsteigend"
|
1414 |
|
1415 |
+
#: ../admin/manage-sort.php:81
|
1416 |
msgid "Descending"
|
1417 |
msgstr "Absteigend"
|
1418 |
|
1419 |
+
#: ../admin/manage.php:77
|
|
|
|
|
|
|
|
|
|
|
1420 |
msgid "Picture"
|
1421 |
msgstr "Bild"
|
1422 |
|
1423 |
+
#: ../admin/manage.php:77
|
1424 |
+
msgid "deleted successfully"
|
1425 |
+
msgstr "erfolgreich gelöscht"
|
1426 |
+
|
1427 |
+
#: ../admin/manage.php:92
|
1428 |
+
#: ../admin/manage.php:101
|
1429 |
msgid "Operation successful. Please clear your browser cache."
|
1430 |
msgstr "Thumbnails erfolgreich erstellt. Bitte Browser-Cache löschen."
|
1431 |
|
1432 |
+
#: ../admin/manage.php:168
|
1433 |
+
msgid "Gallery deleted successfully "
|
1434 |
+
msgstr "Galerie gelöscht"
|
1435 |
+
|
1436 |
+
#: ../admin/manage.php:233
|
1437 |
+
#: ../admin/manage.php:236
|
1438 |
msgid "Rotate images"
|
1439 |
msgstr "Bild drehen"
|
1440 |
|
1441 |
+
#: ../admin/manage.php:258
|
1442 |
msgid "Pictures deleted successfully "
|
1443 |
msgstr "Bilder erfolgreich gelöscht"
|
1444 |
|
1445 |
+
#: ../admin/manage.php:354
|
1446 |
msgid "Tags changed"
|
1447 |
msgstr "Stichwörter geändert"
|
1448 |
|
1449 |
+
#: ../admin/manage.php:390
|
1450 |
msgid "Update successful"
|
1451 |
msgstr "Aktualisierung erfolgreich"
|
1452 |
|
1453 |
+
#: ../admin/manage.php:425
|
1454 |
msgid "New gallery page ID"
|
1455 |
msgstr "Neue Galerie Seiten ID"
|
1456 |
|
1457 |
+
#: ../admin/manage.php:425
|
1458 |
msgid "created"
|
1459 |
msgstr "erstellt"
|
1460 |
|
1461 |
+
#: ../admin/manage.php:461
|
1462 |
+
msgid "Published a new post"
|
1463 |
+
msgstr "Verföffentliche einen neuen Beitrag"
|
1464 |
+
|
1465 |
+
#: ../admin/media-upload.php:166
|
1466 |
msgid "No gallery"
|
1467 |
msgstr "Keine Galerie"
|
1468 |
|
1469 |
+
#: ../admin/media-upload.php:178
|
1470 |
msgid "Select »"
|
1471 |
msgstr "Wähle »"
|
1472 |
|
1473 |
+
#: ../admin/media-upload.php:209
|
1474 |
msgid "Show"
|
1475 |
msgstr "Zeige"
|
1476 |
|
1477 |
+
#: ../admin/media-upload.php:210
|
1478 |
msgid "Hide"
|
1479 |
msgstr "Verstecke"
|
1480 |
|
1481 |
+
#: ../admin/media-upload.php:215
|
1482 |
msgid "Image ID:"
|
1483 |
msgstr "Bild ID:"
|
1484 |
|
1485 |
+
#: ../admin/media-upload.php:274
|
1486 |
msgid "Save all changes"
|
1487 |
msgstr "Änderungen speichern"
|
1488 |
|
1536 |
msgstr "Schau doch einfach auf meinen Wunschzettel."
|
1537 |
|
1538 |
#: ../admin/overview.php:121
|
1539 |
+
msgid "Help translating it."
|
1540 |
msgstr "Hilf das Plugin zu übersetzen."
|
1541 |
|
1542 |
#: ../admin/overview.php:140
|
1578 |
msgid "At a Glance"
|
1579 |
msgstr "Übersicht"
|
1580 |
|
|
|
|
|
|
|
|
|
|
|
|
|
1581 |
#: ../admin/overview.php:305
|
1582 |
msgid "Upload pictures"
|
1583 |
msgstr "Bilder hochladen"
|
1741 |
msgid "Install"
|
1742 |
msgstr "Installieren"
|
1743 |
|
1744 |
+
#: ../admin/publish.php:45
|
1745 |
+
msgid "Post title"
|
1746 |
+
msgstr "Beitragstitel"
|
1747 |
+
|
1748 |
+
#: ../admin/publish.php:47
|
1749 |
+
msgid "Enter the post title "
|
1750 |
+
msgstr "Artikelüberschrift "
|
1751 |
+
|
1752 |
+
#: ../admin/publish.php:52
|
1753 |
+
msgid "Size of the image"
|
1754 |
+
msgstr "Größe des Bildes"
|
1755 |
+
|
1756 |
+
#: ../admin/publish.php:55
|
1757 |
+
msgid "Alignment"
|
1758 |
+
msgstr "Ausrichtung"
|
1759 |
+
|
1760 |
+
#: ../admin/publish.php:57
|
1761 |
+
#: ../admin/settings.php:476
|
1762 |
+
msgid "None"
|
1763 |
+
msgstr "Keiner"
|
1764 |
+
|
1765 |
+
#: ../admin/publish.php:59
|
1766 |
+
#: ../admin/tinymce/window.php:120
|
1767 |
+
msgid "Left"
|
1768 |
+
msgstr "Links"
|
1769 |
+
|
1770 |
+
#: ../admin/publish.php:61
|
1771 |
+
#: ../admin/tinymce/window.php:121
|
1772 |
+
msgid "Center"
|
1773 |
+
msgstr "Zentrieren"
|
1774 |
+
|
1775 |
+
#: ../admin/publish.php:63
|
1776 |
+
#: ../admin/tinymce/window.php:122
|
1777 |
+
msgid "Right"
|
1778 |
+
msgstr "Rechts"
|
1779 |
+
|
1780 |
+
#: ../admin/publish.php:70
|
1781 |
+
msgid "Draft"
|
1782 |
+
msgstr "Entwurf"
|
1783 |
+
|
1784 |
#: ../admin/roles.php:22
|
1785 |
msgid "Updated capabilities"
|
1786 |
msgstr "Zugriffsrechte geändert"
|
1790 |
msgstr "Rollen / Zugriffsrechte"
|
1791 |
|
1792 |
#: ../admin/roles.php:29
|
1793 |
+
msgid "Select the lowest role which should be able to access the following capabilities. NextGEN Gallery supports the standard roles from WordPress."
|
1794 |
msgstr "Wähle die niedrigste Rolle aus, die Zugriff haben soll. NextGEN Gallery unterstützt nur die Standard-Wordpress-Rollen-Fähigkeiten von WordPress."
|
1795 |
|
1796 |
#: ../admin/roles.php:30
|
1821 |
msgid "Manage tags"
|
1822 |
msgstr "Verwalte Stichwörter"
|
1823 |
|
|
|
|
|
|
|
|
|
1824 |
#: ../admin/roles.php:63
|
1825 |
msgid "Change style"
|
1826 |
msgstr "Style anpassen"
|
1857 |
msgid "Flip horizontally"
|
1858 |
msgstr "Horizontal spiegeln"
|
1859 |
|
1860 |
+
#: ../admin/settings.php:92
|
1861 |
msgid "Cache cleared"
|
1862 |
msgstr "Cache löschen"
|
1863 |
|
1864 |
+
#: ../admin/settings.php:209
|
1865 |
+
#: ../admin/settings.php:228
|
1866 |
msgid "General Options"
|
1867 |
msgstr "Allg. Optionen"
|
1868 |
|
1869 |
+
#: ../admin/settings.php:210
|
1870 |
+
#: ../admin/settings.php:413
|
1871 |
msgid "Thumbnails"
|
1872 |
msgstr "Thumbnails"
|
1873 |
|
1874 |
+
#: ../admin/settings.php:211
|
1875 |
msgid "Images"
|
1876 |
msgstr "Bilder"
|
1877 |
|
1878 |
+
#: ../admin/settings.php:213
|
1879 |
+
#: ../admin/settings.php:465
|
1880 |
msgid "Effects"
|
1881 |
msgstr "Effekte"
|
1882 |
|
1883 |
+
#: ../admin/settings.php:214
|
1884 |
+
#: ../admin/settings.php:507
|
1885 |
+
#: ../admin/tinymce/window.php:110
|
1886 |
msgid "Watermark"
|
1887 |
msgstr "Wasserzeichen"
|
1888 |
|
1889 |
+
#: ../admin/settings.php:215
|
1890 |
+
#: ../admin/settings.php:414
|
1891 |
+
#: ../admin/settings.php:614
|
1892 |
+
#: ../admin/tinymce/window.php:63
|
1893 |
msgid "Slideshow"
|
1894 |
msgstr "Slideshow"
|
1895 |
|
1896 |
+
#: ../admin/settings.php:234
|
1897 |
+
#: ../admin/wpmu.php:68
|
1898 |
msgid "Gallery path"
|
1899 |
msgstr "Galerie-Pfad"
|
1900 |
|
1901 |
+
#: ../admin/settings.php:236
|
1902 |
msgid "This is the default path for all galleries"
|
1903 |
msgstr "Dies ist der Standard-Pfad für alle Galerien"
|
1904 |
|
1905 |
+
#: ../admin/settings.php:239
|
1906 |
msgid "Delete image files"
|
1907 |
msgstr "Lösche Bilddateien"
|
1908 |
|
1909 |
+
#: ../admin/settings.php:241
|
1910 |
msgid "Delete files, when removing a gallery in the database"
|
1911 |
msgstr "Löscht auch die Dateien, falls die Galerie aus der Datenbank entfernt wird"
|
1912 |
|
1913 |
+
#: ../admin/settings.php:244
|
1914 |
msgid "Activate permalinks"
|
1915 |
msgstr "Aktiviere Permalinks"
|
1916 |
|
1917 |
+
#: ../admin/settings.php:246
|
1918 |
msgid "When you activate this option, you need to update your permalink structure one time."
|
1919 |
msgstr "Wenn Du diese Option aktivierst, muss Du einmal die Permalink Struktur aktualisieren."
|
1920 |
|
1921 |
+
#: ../admin/settings.php:249
|
1922 |
+
msgid "Create new URL friendly image slugs"
|
1923 |
+
msgstr "Erstelle neue URL lesbare Schlagwörter "
|
1924 |
+
|
1925 |
+
#: ../admin/settings.php:250
|
1926 |
+
#: ../admin/settings.php:367
|
1927 |
+
msgid "Proceed now"
|
1928 |
+
msgstr "Jetzt durchführen"
|
1929 |
+
|
1930 |
+
#: ../admin/settings.php:251
|
1931 |
+
msgid "Currently not used, prepare database for upcoming version"
|
1932 |
+
msgstr "Derzeit nicht genutzt, Vorbereitung für kommende Versionen"
|
1933 |
+
|
1934 |
+
#: ../admin/settings.php:254
|
1935 |
msgid "Select graphic library"
|
1936 |
msgstr "Wähle Grafik-Bibliothek"
|
1937 |
|
1938 |
+
#: ../admin/settings.php:255
|
1939 |
msgid "GD Library"
|
1940 |
msgstr "GD Bibliothek"
|
1941 |
|
1942 |
+
#: ../admin/settings.php:256
|
1943 |
msgid "ImageMagick (Experimental). Path to the library :"
|
1944 |
msgstr "ImageMagick (Experimental). Pfad zur Bibliothek :"
|
1945 |
|
1946 |
+
#: ../admin/settings.php:261
|
1947 |
msgid "Activate Media RSS feed"
|
1948 |
msgstr "Aktiviere Media-RSS-Feed"
|
1949 |
|
1950 |
+
#: ../admin/settings.php:263
|
1951 |
msgid "A RSS feed will be added to you blog header. Useful for CoolIris/PicLens"
|
1952 |
msgstr "Ein Bilder-RSS Feed wird zum Blog hinzugefügt"
|
1953 |
|
1954 |
+
#: ../admin/settings.php:266
|
1955 |
msgid "Activate PicLens/CoolIris support"
|
1956 |
msgstr "Aktiviere PicLens/CoolIris"
|
1957 |
|
1958 |
+
#: ../admin/settings.php:268
|
1959 |
msgid "When you activate this option, some javascript is added to your site footer. Make sure that wp_footer is called in your theme."
|
1960 |
msgstr "Dieser Effekt fügt ein neues Javascript zu Deinem Theme hinzu. Beachte, dass wp_footer() in Deinen Vorlagen aufgerufen wird."
|
1961 |
|
1962 |
+
#: ../admin/settings.php:271
|
1963 |
msgid "Tags / Categories"
|
1964 |
msgstr "Stichwörter / Kategorien"
|
1965 |
|
1966 |
+
#: ../admin/settings.php:274
|
1967 |
msgid "Activate related images"
|
1968 |
msgstr "Verwandte Bilder anzeigen"
|
1969 |
|
1970 |
+
#: ../admin/settings.php:276
|
1971 |
msgid "This option will append related images to every post"
|
1972 |
msgstr "Diese Option hängt verwandte Bilder an jeden Beitrag"
|
1973 |
|
1974 |
+
#: ../admin/settings.php:280
|
1975 |
msgid "Match with"
|
1976 |
msgstr "Vergleiche mit"
|
1977 |
|
1978 |
+
#: ../admin/settings.php:281
|
1979 |
msgid "Categories"
|
1980 |
msgstr "Kategorien"
|
1981 |
|
1982 |
+
#: ../admin/settings.php:286
|
1983 |
msgid "Max. number of images"
|
1984 |
msgstr "Max. Anzahl der Bilder"
|
1985 |
|
1986 |
+
#: ../admin/settings.php:288
|
1987 |
msgid "0 will show all images"
|
1988 |
msgstr "0 zeige alle verwandten Bilder"
|
1989 |
|
1990 |
+
#: ../admin/settings.php:292
|
1991 |
+
#: ../admin/settings.php:323
|
1992 |
+
#: ../admin/settings.php:370
|
1993 |
+
#: ../admin/settings.php:455
|
1994 |
+
#: ../admin/settings.php:490
|
1995 |
+
#: ../admin/settings.php:751
|
1996 |
msgid "More settings"
|
1997 |
msgstr "Mehr Einstellungen"
|
1998 |
|
1999 |
+
#: ../admin/settings.php:302
|
2000 |
msgid "Thumbnail settings"
|
2001 |
msgstr "Thumbnail-Einstellungen"
|
2002 |
|
2003 |
+
#: ../admin/settings.php:306
|
2004 |
msgid "Please note : If you change the settings, you need to recreate the thumbnails under -> Manage Gallery ."
|
2005 |
msgstr "Bitte beachten : Änderungen der Einstellungen werden erst übernommen, wenn Du neue Thumbnails unter -> \"Gallery verwalten\" erstellst"
|
2006 |
|
2007 |
+
#: ../admin/settings.php:319
|
2008 |
msgid "Thumbnail quality"
|
2009 |
msgstr "Thumbnail Qualität"
|
2010 |
|
2011 |
+
#: ../admin/settings.php:333
|
2012 |
msgid "Image settings"
|
2013 |
msgstr "Bild-Einstellungen"
|
2014 |
|
2015 |
+
#: ../admin/settings.php:339
|
2016 |
msgid "Resize Images"
|
2017 |
msgstr "Bilder verkleinern"
|
2018 |
|
2019 |
+
#: ../admin/settings.php:344
|
2020 |
msgid "Image quality"
|
2021 |
msgstr "Bild Qualität"
|
2022 |
|
2023 |
+
#: ../admin/settings.php:348
|
2024 |
msgid "Backup original images"
|
2025 |
msgstr "Backup von Original-Bildern "
|
2026 |
|
2027 |
+
#: ../admin/settings.php:350
|
2028 |
msgid "Creates a backup for inserted images"
|
2029 |
msgstr "Backup der Bilder anlegen"
|
2030 |
|
2031 |
+
#: ../admin/settings.php:353
|
2032 |
msgid "Automatically resize"
|
2033 |
msgstr "Grösse automatisch anpassen"
|
2034 |
|
2035 |
+
#: ../admin/settings.php:355
|
2036 |
msgid "Automatically resize images on upload."
|
2037 |
msgstr "Passt die Grösse automatisch beim Upload an"
|
2038 |
|
2039 |
+
#: ../admin/settings.php:358
|
2040 |
msgid "Single picture"
|
2041 |
msgstr "Einzelbilder"
|
2042 |
|
2043 |
+
#: ../admin/settings.php:361
|
2044 |
msgid "Cache single pictures"
|
2045 |
msgstr "Nutze Cache für Einzelbilder"
|
2046 |
|
2047 |
+
#: ../admin/settings.php:363
|
2048 |
msgid "Creates a file for each singlepic settings. Reduce the CPU load"
|
2049 |
msgstr "Erstellt ein Cache-Bild für jedes Einzelbild (singlepic). Reduziert die CPU Belastung."
|
2050 |
|
2051 |
+
#: ../admin/settings.php:366
|
2052 |
msgid "Clear cache folder"
|
2053 |
msgstr "Lösche Cache-Verzeichnis"
|
2054 |
|
2055 |
+
#: ../admin/settings.php:387
|
|
|
|
|
|
|
|
|
2056 |
msgid "Deactivate gallery page link"
|
2057 |
msgstr "Keine Seitenverzweigung"
|
2058 |
|
2059 |
+
#: ../admin/settings.php:389
|
2060 |
msgid "The album will not link to a gallery subpage. The gallery is shown on the same page."
|
2061 |
msgstr "Ein Album benötigt dann keinen Link zur Seite. Die Galerie wird direkt angezeigt."
|
2062 |
|
2063 |
+
#: ../admin/settings.php:393
|
2064 |
msgid "Number of images per page"
|
2065 |
msgstr "Anzahl der Bilder pro Seite"
|
2066 |
|
2067 |
+
#: ../admin/settings.php:395
|
2068 |
msgid "0 will disable pagination, all images on one page"
|
2069 |
msgstr "0 schaltet Blätterfunktion ab ( = alle Bilder auf einer Seite )"
|
2070 |
|
2071 |
+
#: ../admin/settings.php:399
|
2072 |
msgid "Number of columns"
|
2073 |
msgstr "Anzahl der Spalten"
|
2074 |
|
2075 |
+
#: ../admin/settings.php:401
|
2076 |
msgid "0 will display as much as possible based on the width of your theme. Setting normally only required for captions below the images"
|
2077 |
msgstr "Mit \"0\" werden soviele Bilder wie möglich in einer Reihe dargestellt. Die Einstellung ist normalerweise nur für Beschriftungen unterhalb der Bilder sinnvoll."
|
2078 |
|
2079 |
+
#: ../admin/settings.php:405
|
2080 |
msgid "Integrate slideshow"
|
2081 |
msgstr "Slideshow verwenden"
|
2082 |
|
2083 |
+
#: ../admin/settings.php:412
|
2084 |
msgid "Show first"
|
2085 |
msgstr "Zeige als Erstes"
|
2086 |
|
2087 |
+
#: ../admin/settings.php:418
|
2088 |
msgid "Show ImageBrowser"
|
2089 |
msgstr "Zeige Bilder-Browser"
|
2090 |
|
2091 |
+
#: ../admin/settings.php:420
|
2092 |
msgid "The gallery will open the ImageBrowser instead the effect."
|
2093 |
msgstr "Es wird der Bilder-Browser angezeigt (Kein JavaScript Effekt)"
|
2094 |
|
2095 |
+
#: ../admin/settings.php:424
|
2096 |
msgid "Add hidden images"
|
2097 |
msgstr "Versteckte Bilder hinzufügen"
|
2098 |
|
2099 |
+
#: ../admin/settings.php:426
|
2100 |
+
msgid "If pagination is used, this option will still show all images in the modal window (Thickbox, Lightbox etc.). Note : This increases the page load"
|
2101 |
msgstr "Wenn Du die Blätterfunktion nutzt, dann kannst Du mit dieser Option alle Bilder im Modal-Fenster (Thickbox,Lightbox etc.) anzeigen. Berücksichtige, dass die Ladezeit der Seite erhöht wird."
|
2102 |
|
2103 |
+
#: ../admin/settings.php:430
|
2104 |
msgid "Enable AJAX pagination"
|
2105 |
msgstr "Aktiviere AJAX-Navigation"
|
2106 |
|
2107 |
+
#: ../admin/settings.php:432
|
2108 |
+
msgid "Browse images without reload the page. Note : Works only in combination with Shutter effect"
|
2109 |
msgstr "Ermöglicht das Blättern zwischen den Bildern ohne die Seite neu zu laden. Hinweis : Funktioniert nur mit dem Shutter-Effekt."
|
2110 |
|
2111 |
+
#: ../admin/settings.php:436
|
2112 |
msgid "Sort options"
|
2113 |
msgstr "Sortierung"
|
2114 |
|
2115 |
+
#: ../admin/settings.php:439
|
2116 |
msgid "Sort thumbnails"
|
2117 |
msgstr "Thumbnails sortieren"
|
2118 |
|
2119 |
+
#: ../admin/settings.php:441
|
2120 |
msgid "Custom order"
|
2121 |
msgstr "Benutzerdefiniert"
|
2122 |
|
2123 |
+
#: ../admin/settings.php:443
|
2124 |
msgid "File name"
|
2125 |
msgstr "Dateiname"
|
2126 |
|
2127 |
+
#: ../admin/settings.php:444
|
2128 |
msgid "Alt / Title text"
|
2129 |
msgstr "Alt / Titel Text"
|
2130 |
|
2131 |
+
#: ../admin/settings.php:445
|
2132 |
msgid "Date / Time"
|
2133 |
msgstr "Datum/Zeit"
|
2134 |
|
2135 |
+
#: ../admin/settings.php:449
|
2136 |
msgid "Sort direction"
|
2137 |
msgstr "Sortierreihenfolge"
|
2138 |
|
2139 |
+
#: ../admin/settings.php:469
|
2140 |
msgid "Here you can select the thumbnail effect, NextGEN Gallery will integrate the required HTML code in the images. Please note that only the Shutter and Thickbox effect will automatic added to your theme."
|
2141 |
msgstr "Hier kannst Du den Effekt für die Thumbnails auswählen. NextGEN Galerie wird den benötigten HTML-Code verwenden. Bitte beachte, dass nur Shutter und der Thickbox Effekt automatisch in Dein Theme von Wordpress integriert wird. Alle anderen Effekte mußt Du selbst in die header.php eintragen (JS)."
|
2142 |
|
2143 |
+
#: ../admin/settings.php:470
|
2144 |
msgid "With the placeholder"
|
2145 |
msgstr "Mit Platzhalter"
|
2146 |
|
2147 |
+
#: ../admin/settings.php:470
|
2148 |
msgid "you can activate a navigation through the images (depend on the effect). Change the code line only , when you use a different thumbnail effect or you know what you do."
|
2149 |
msgstr "Du kannst eine Navigation durch die Bilder aktivieren (hängt vom Effekt ab). Ändere nur die Codezeile, falls Du einen anderen Effekt für die Thumbnails verwendest oder einfach weißt, was Du tust."
|
2150 |
|
2151 |
+
#: ../admin/settings.php:473
|
2152 |
msgid "JavaScript Thumbnail effect"
|
2153 |
msgstr "JavaScript Thumbnail Effekt"
|
2154 |
|
2155 |
+
#: ../admin/settings.php:477
|
|
|
|
|
|
|
|
|
2156 |
msgid "Thickbox"
|
2157 |
msgstr "Thickbox"
|
2158 |
|
2159 |
+
#: ../admin/settings.php:478
|
2160 |
msgid "Lightbox"
|
2161 |
msgstr "Lightbox"
|
2162 |
|
2163 |
+
#: ../admin/settings.php:479
|
2164 |
msgid "Highslide"
|
2165 |
msgstr "Highslide"
|
2166 |
|
2167 |
+
#: ../admin/settings.php:480
|
2168 |
msgid "Shutter"
|
2169 |
msgstr "Shutter"
|
2170 |
|
2171 |
+
#: ../admin/settings.php:481
|
2172 |
msgid "Custom"
|
2173 |
msgstr "Eigener"
|
2174 |
|
2175 |
+
#: ../admin/settings.php:486
|
2176 |
msgid "Link Code line"
|
2177 |
msgstr "Link-Code-Zeile"
|
2178 |
|
2179 |
+
#: ../admin/settings.php:508
|
2180 |
msgid "Please note : You can only activate the watermark under -> Manage Gallery . This action cannot be undone."
|
2181 |
msgstr "Bitte beachten : Das Wasserzeichen kann nur unter der Galerieverwaltung gesetzt werden. "
|
2182 |
|
2183 |
+
#: ../admin/settings.php:513
|
2184 |
msgid "Preview"
|
2185 |
msgstr "Vorschau"
|
2186 |
|
2187 |
+
#: ../admin/settings.php:515
|
2188 |
+
#: ../admin/settings.php:520
|
2189 |
msgid "Position"
|
2190 |
msgstr "Position"
|
2191 |
|
2192 |
+
#: ../admin/settings.php:540
|
2193 |
msgid "Offset"
|
2194 |
msgstr "Abstand"
|
2195 |
|
2196 |
+
#: ../admin/settings.php:556
|
2197 |
msgid "Use image as watermark"
|
2198 |
msgstr "Benutze das Bild als Wasserzeichen"
|
2199 |
|
2200 |
+
#: ../admin/settings.php:559
|
2201 |
msgid "URL to file"
|
2202 |
msgstr "URL zur Datei"
|
2203 |
|
2204 |
+
#: ../admin/settings.php:561
|
2205 |
msgid "The accessing of URL files is disabled at your server (allow_url_fopen)"
|
2206 |
msgstr "Der Dateizugriff von URLs ist auf diesem Server deaktiviert (allow_url_fopen)"
|
2207 |
|
2208 |
+
#: ../admin/settings.php:564
|
2209 |
msgid "Use text as watermark"
|
2210 |
msgstr "Benutze Text als Wasserzeichen"
|
2211 |
|
2212 |
+
#: ../admin/settings.php:567
|
2213 |
msgid "Font"
|
2214 |
msgstr "Schriftart"
|
2215 |
|
2216 |
+
#: ../admin/settings.php:576
|
2217 |
msgid "This function will not work, cause you need the FreeType library"
|
2218 |
msgstr "Diese Funktion benötigt die FreeType-Bibliothek"
|
2219 |
|
2220 |
+
#: ../admin/settings.php:578
|
2221 |
msgid "You can upload more fonts in the folder <strong>nggallery/fonts</strong>"
|
2222 |
msgstr "Du kannst mehr Schriftarten in das Verzeichniss <strong>nggallery/fonts</strong> hochladen."
|
2223 |
|
2224 |
+
#: ../admin/settings.php:583
|
2225 |
msgid "Size"
|
2226 |
msgstr "Größe"
|
2227 |
|
2228 |
+
#: ../admin/settings.php:587
|
2229 |
msgid "Color"
|
2230 |
msgstr "Farbe"
|
2231 |
|
2232 |
+
#: ../admin/settings.php:589
|
2233 |
msgid "(hex w/o #)"
|
2234 |
msgstr "(hex w/o #)"
|
2235 |
|
2236 |
+
#: ../admin/settings.php:592
|
2237 |
msgid "Text"
|
2238 |
msgstr "Text"
|
2239 |
|
2240 |
+
#: ../admin/settings.php:596
|
2241 |
msgid "Opaque"
|
2242 |
msgstr "Transparenz"
|
2243 |
|
2244 |
+
#: ../admin/settings.php:617
|
2245 |
msgid "Default size (W x H)"
|
2246 |
msgstr "Standard Größe (B x H)"
|
2247 |
|
2248 |
+
#: ../admin/settings.php:622
|
2249 |
msgid "Duration time"
|
2250 |
msgstr "Dauer"
|
2251 |
|
2252 |
+
#: ../admin/settings.php:623
|
2253 |
msgid "sec."
|
2254 |
msgstr "Sek."
|
2255 |
|
2256 |
+
#: ../admin/settings.php:626
|
2257 |
+
#: ../admin/settings.php:701
|
2258 |
msgid "Transition / Fade effect"
|
2259 |
msgstr "Fade Effekt"
|
2260 |
|
2261 |
+
#: ../admin/settings.php:629
|
2262 |
+
#: ../admin/settings.php:704
|
2263 |
msgid "fade"
|
2264 |
msgstr "Fade"
|
2265 |
|
2266 |
+
#: ../admin/settings.php:630
|
2267 |
msgid "blindX"
|
2268 |
msgstr "blindX"
|
2269 |
|
2270 |
+
#: ../admin/settings.php:631
|
2271 |
msgid "cover"
|
2272 |
msgstr "Blenden"
|
2273 |
|
2274 |
+
#: ../admin/settings.php:632
|
2275 |
msgid "scrollUp"
|
2276 |
msgstr "ScrollUp"
|
2277 |
|
2278 |
+
#: ../admin/settings.php:633
|
2279 |
msgid "scrollDown"
|
2280 |
msgstr "ScrollDown"
|
2281 |
|
2282 |
+
#: ../admin/settings.php:634
|
2283 |
msgid "shuffle"
|
2284 |
msgstr "Shuffle"
|
2285 |
|
2286 |
+
#: ../admin/settings.php:635
|
2287 |
msgid "toss"
|
2288 |
msgstr "Schüttel"
|
2289 |
|
2290 |
+
#: ../admin/settings.php:636
|
2291 |
msgid "wipe"
|
2292 |
msgstr "wischen"
|
2293 |
|
2294 |
+
#: ../admin/settings.php:638
|
2295 |
msgid "See here for more information about the effects :"
|
2296 |
msgstr "Hier bekommst du mehr Informationen über die Effekte :"
|
2297 |
|
2298 |
+
#: ../admin/settings.php:642
|
2299 |
msgid "Settings for the JW Image Rotator"
|
2300 |
msgstr "JW-Image-Rotator Einstellungen"
|
2301 |
|
2302 |
+
#: ../admin/settings.php:643
|
2303 |
msgid "The settings are only used in the JW Image Rotator Version"
|
2304 |
msgstr "Die Einstellungen werden im JW-Image-Rotator benutzt, in der Version"
|
2305 |
|
2306 |
+
#: ../admin/settings.php:644
|
2307 |
msgid "See more information for the Flash Player on the web page"
|
2308 |
msgstr "Weitere Informationen auf der Flash-Player-Homepage"
|
2309 |
|
2310 |
+
#: ../admin/settings.php:649
|
2311 |
msgid "The path to imagerotator.swf is not defined, the slideshow will not work."
|
2312 |
msgstr "Der Pfad zu imagerotator.swf ist nicht gesetzt, die Flash-Diaschau kann dann nicht angezeigt werden"
|
2313 |
|
2314 |
+
#: ../admin/settings.php:650
|
2315 |
msgid "If you would like to use the JW Image Rotatator, please download the player <a href=\"http://www.longtailvideo.com/players/jw-image-rotator/\" target=\"_blank\" >here</a> and upload it to your Upload folder (Default is wp-content/uploads)."
|
2316 |
msgstr "Wenn Du den JW-Image-Rotator (Slideshow) nutzen möchtest, lade Dir die aktuelle Version <a href=\"http://www.longtailvideo.com/players/jw-image-rotator/\" target=\"_blank\" >hier</a> herunter und übertrage sie dann in Dein WordPress-Upload-Verzeichnis (normalerweise wp-content/uploads),"
|
2317 |
|
2318 |
+
#: ../admin/settings.php:656
|
2319 |
msgid "Enable flash slideshow"
|
2320 |
msgstr "Aktiviere Flash Slideshow"
|
2321 |
|
2322 |
+
#: ../admin/settings.php:658
|
2323 |
+
msgid "Integrate the flash based slideshow for all flash supported devices"
|
2324 |
msgstr "Verwende die Flash Slideshow für alle Flash-unterstützte Geräte"
|
2325 |
|
2326 |
+
#: ../admin/settings.php:661
|
2327 |
msgid "Path to the Imagerotator (URL)"
|
2328 |
msgstr "Pfad zum JW-Image-Rotator (URL)"
|
2329 |
|
2330 |
+
#: ../admin/settings.php:664
|
2331 |
msgid "Search now"
|
2332 |
msgstr "Suche jetzt"
|
2333 |
|
2334 |
+
#: ../admin/settings.php:665
|
2335 |
+
msgid "Press the button to search automatically for the imagerotator, if you uploaded it to wp-content/uploads or a subfolder"
|
2336 |
msgstr "Drücke 'Suche jetzt' um automatisch den Pfad zum Image-Rotator zu ermitteln, sofern Du den Player in wp-content/uploads oder ein Unterverzeichnis hochgeladen hast."
|
2337 |
|
2338 |
+
#: ../admin/settings.php:669
|
2339 |
msgid "Shuffle mode"
|
2340 |
msgstr "Shuffle Modus"
|
2341 |
|
2342 |
+
#: ../admin/settings.php:673
|
2343 |
msgid "Show next image on click"
|
2344 |
msgstr "Zeige nächstes Bild bei Klick"
|
2345 |
|
2346 |
+
#: ../admin/settings.php:677
|
2347 |
msgid "Show navigation bar"
|
2348 |
msgstr "Zeige Navigations-Leiste"
|
2349 |
|
2350 |
+
#: ../admin/settings.php:681
|
2351 |
msgid "Show loading icon"
|
2352 |
msgstr "Zeige Lade-Bildchen"
|
2353 |
|
2354 |
+
#: ../admin/settings.php:685
|
2355 |
msgid "Use watermark logo"
|
2356 |
msgstr "Wasserzeichen anzeigen"
|
2357 |
|
2358 |
+
#: ../admin/settings.php:687
|
2359 |
msgid "You can change the logo at the watermark settings"
|
2360 |
msgstr "Du kannst den Pfad in Einstellungen für das Wasserzeichen angeben"
|
2361 |
|
2362 |
+
#: ../admin/settings.php:690
|
2363 |
msgid "Stretch image"
|
2364 |
msgstr "Bild dehnen"
|
2365 |
|
2366 |
+
#: ../admin/settings.php:693
|
2367 |
msgid "true"
|
2368 |
msgstr "Ja"
|
2369 |
|
2370 |
+
#: ../admin/settings.php:694
|
2371 |
msgid "false"
|
2372 |
msgstr "Nein"
|
2373 |
|
2374 |
+
#: ../admin/settings.php:695
|
2375 |
msgid "fit"
|
2376 |
msgstr "Passend"
|
2377 |
|
2378 |
+
#: ../admin/settings.php:696
|
2379 |
msgid "none"
|
2380 |
msgstr "keiner"
|
2381 |
|
2382 |
+
#: ../admin/settings.php:705
|
2383 |
msgid "bgfade"
|
2384 |
msgstr "BGFade"
|
2385 |
|
2386 |
+
#: ../admin/settings.php:706
|
2387 |
msgid "slowfade"
|
2388 |
msgstr "Slowfade"
|
2389 |
|
2390 |
+
#: ../admin/settings.php:707
|
2391 |
msgid "circles"
|
2392 |
msgstr "Kreise"
|
2393 |
|
2394 |
+
#: ../admin/settings.php:708
|
2395 |
msgid "bubbles"
|
2396 |
msgstr "Blasen"
|
2397 |
|
2398 |
+
#: ../admin/settings.php:709
|
2399 |
msgid "blocks"
|
2400 |
msgstr "Blöcke"
|
2401 |
|
2402 |
+
#: ../admin/settings.php:710
|
2403 |
msgid "fluids"
|
2404 |
msgstr "Fluids"
|
2405 |
|
2406 |
+
#: ../admin/settings.php:711
|
2407 |
msgid "flash"
|
2408 |
msgstr "Flash"
|
2409 |
|
2410 |
+
#: ../admin/settings.php:712
|
2411 |
msgid "lines"
|
2412 |
msgstr "Linien"
|
2413 |
|
2414 |
+
#: ../admin/settings.php:713
|
2415 |
msgid "random"
|
2416 |
msgstr "Zufall"
|
2417 |
|
2418 |
+
#: ../admin/settings.php:718
|
2419 |
msgid "Use slow zooming effect"
|
2420 |
msgstr "nutze Zoom-Effekt"
|
2421 |
|
2422 |
+
#: ../admin/settings.php:722
|
2423 |
msgid "Background Color"
|
2424 |
msgstr "Hintergrund (BG) Farbe"
|
2425 |
|
2426 |
+
#: ../admin/settings.php:727
|
2427 |
msgid "Texts / Buttons Color"
|
2428 |
msgstr "Text- / Button Farbe"
|
2429 |
|
2430 |
+
#: ../admin/settings.php:732
|
2431 |
msgid "Rollover / Active Color"
|
2432 |
msgstr "Rollover / Aktiv (Link) Farbe"
|
2433 |
|
2434 |
+
#: ../admin/settings.php:737
|
2435 |
msgid "Screen Color"
|
2436 |
msgstr "Seiten-Farbe"
|
2437 |
|
2438 |
+
#: ../admin/settings.php:742
|
2439 |
msgid "Background music (URL)"
|
2440 |
msgstr "Hintergrundmusik (URL)"
|
2441 |
|
2442 |
+
#: ../admin/settings.php:746
|
2443 |
msgid "Try XHTML validation (with CDATA)"
|
2444 |
msgstr "Integriere XHTML-Validierung (mittels CDATA)"
|
2445 |
|
2446 |
+
#: ../admin/settings.php:748
|
2447 |
msgid "Important : Could causes problem at some browser. Please recheck your page."
|
2448 |
msgstr "Wichtig : Es könnten Probleme bei einigen Browser entstehen. Unbedingt Seite danach prüfen."
|
2449 |
|
2716 |
msgid "Slug(s) to set:"
|
2717 |
msgstr "Schlagwörter setzen:"
|
2718 |
|
2719 |
+
#: ../admin/upgrade.php:22
|
2720 |
msgid "Upgrade database structure..."
|
2721 |
msgstr "Aktualisiere die Datenbank-Struturen..."
|
2722 |
|
2723 |
+
#: ../admin/upgrade.php:108
|
|
|
2724 |
#: ../admin/upgrade.php:122
|
2725 |
+
#: ../admin/upgrade.php:129
|
2726 |
+
#: ../admin/upgrade.php:140
|
2727 |
+
#: ../admin/upgrade.php:154
|
2728 |
msgid "finished"
|
2729 |
msgstr "beendet"
|
2730 |
|
2731 |
+
#: ../admin/upgrade.php:120
|
2732 |
msgid "Update file structure..."
|
2733 |
msgstr "Aktualisiere Verzeichnisse..."
|
2734 |
|
2735 |
+
#: ../admin/upgrade.php:127
|
2736 |
msgid "Import date and time information..."
|
2737 |
msgstr "Importiere Datum/Uhrzeit..."
|
2738 |
|
2739 |
+
#: ../admin/upgrade.php:135
|
2740 |
msgid "Move imagerotator to new location..."
|
2741 |
msgstr "Verschiebe den Image-Rotator in ein neues Verzeichnis..."
|
2742 |
|
2743 |
+
#: ../admin/upgrade.php:146
|
2744 |
msgid "Update settings..."
|
2745 |
msgstr "Einstellungen gespeichert..."
|
2746 |
|
2747 |
+
#: ../admin/upgrade.php:160
|
2748 |
msgid "Updated widget structure. If you used NextGEN Widgets, you need to setup them again..."
|
2749 |
msgstr "Die Widgets wurden überarbeitet. Wenn Du NextGEN Widgets nutzt, musst du Sie nun neu einfügen..."
|
2750 |
|
2751 |
+
#: ../admin/upgrade.php:168
|
2752 |
msgid "Updated options."
|
2753 |
msgstr "Einstellungen gespeichert."
|
2754 |
|
2755 |
+
#: ../admin/upgrade.php:175
|
2756 |
+
msgid "Create unique slug"
|
2757 |
+
msgstr "Permalinks erstellen"
|
2758 |
+
|
2759 |
+
#: ../admin/upgrade.php:176
|
2760 |
+
msgid "One of the upcomming features are a reworked permalinks structure."
|
2761 |
+
msgstr "Die Permalinkstruktur wird in einer kommenden Version überarbeitet."
|
2762 |
+
|
2763 |
+
#: ../admin/upgrade.php:177
|
2764 |
+
msgid "Therefore it's needed to have a unique identifier for each image, gallery and album."
|
2765 |
+
msgstr "Deshalb ist es notwendig ein eindeutiges Schlagwort für jedes Bild, Galerie und Album zu erzeugen."
|
2766 |
+
|
2767 |
+
#: ../admin/upgrade.php:178
|
2768 |
+
msgid "Depend on the amount of database entries this will take a while, don't reload this page."
|
2769 |
+
msgstr "Diese Operation kann je nach Anzahl der Bilder eine Weile daueren, bitte die Seite nicht neu laden."
|
2770 |
+
|
2771 |
+
#: ../admin/upgrade.php:187
|
2772 |
msgid "Could not find NextGEN Gallery database tables, upgrade failed !"
|
2773 |
msgstr "Konnte die NextGEN Gallery Tabellen nicht finden, Upgrade fehlgeschlagen !"
|
2774 |
|
2775 |
+
#: ../admin/upgrade.php:250
|
2776 |
msgid "Some folders/files could not renamed, please recheck the permission and rescan the folder in the manage gallery section."
|
2777 |
msgstr "Einige Verzeichnisse / Bilder konnten nicht umbenannt werden, bitte überprüfe die Zugriffsrechte und scanne dann das Verzeichnis neu ein."
|
2778 |
|
2779 |
+
#: ../admin/upgrade.php:252
|
2780 |
msgid "Rename failed"
|
2781 |
msgstr "Konnte nicht umbenannt werden"
|
2782 |
|
2783 |
+
#: ../admin/upgrade.php:348
|
2784 |
+
#: ../admin/upgrade.php:367
|
2785 |
msgid "Upgrade NextGEN Gallery"
|
2786 |
msgstr "NextGEN-Gallery aktualisieren"
|
2787 |
|
2788 |
+
#: ../admin/upgrade.php:349
|
2789 |
msgid "The script detect that you upgrade from a older version."
|
2790 |
msgstr "Es wurde eine ältere NextGEN-Datenbank erkannt."
|
2791 |
|
2792 |
+
#: ../admin/upgrade.php:350
|
2793 |
msgid "Your database tables for NextGEN Gallery is out-of-date, and must be upgraded before you can continue."
|
2794 |
msgstr "Deine Datenbanktabellen für NextGEN-Gallery sind nicht auf dem aktuellen Stand, sie müssen jetzt aktualisiert werden."
|
2795 |
|
2796 |
+
#: ../admin/upgrade.php:351
|
2797 |
msgid "If you would like to downgrade later, please make first a complete backup of your database and the images."
|
2798 |
msgstr "Wenn Du wieder auf eine ältere Version zurückgehen möchtest, solltest Du vorher die Datenbank sichern."
|
2799 |
|
2800 |
+
#: ../admin/upgrade.php:352
|
2801 |
msgid "The upgrade process may take a while, so please be patient."
|
2802 |
msgstr "Der Upgrade-Prozess kann etwas dauern, bitte sei geduldig..."
|
2803 |
|
2804 |
+
#: ../admin/upgrade.php:353
|
2805 |
msgid "Start upgrade now"
|
2806 |
msgstr "Aktualisierung starten"
|
2807 |
|
2808 |
+
#: ../admin/upgrade.php:369
|
2809 |
msgid "Upgrade finished..."
|
2810 |
msgstr "Upgrade beendet..."
|
2811 |
|
2812 |
+
#: ../admin/upgrade.php:370
|
2813 |
msgid "Continue"
|
2814 |
msgstr "Weiter"
|
2815 |
|
2816 |
+
#: ../admin/upgrade.php:397
|
2817 |
+
#, php-format
|
2818 |
+
msgid "Rebuild image structure : %s / %s images"
|
2819 |
+
msgstr "Erzeuge Permalinks für Bilder : %s / %s Bilder"
|
2820 |
+
|
2821 |
+
#: ../admin/upgrade.php:398
|
2822 |
+
#, php-format
|
2823 |
+
msgid "Rebuild gallery structure : %s / %s galleries"
|
2824 |
+
msgstr "Erzeuge Permalinks für Galerien : %s / %s Galerien"
|
2825 |
+
|
2826 |
+
#: ../admin/upgrade.php:399
|
2827 |
+
#, php-format
|
2828 |
+
msgid "Rebuild album structure : %s / %s albums"
|
2829 |
+
msgstr "Erzeuge Permalinks für Alben : %s / %s Alben"
|
2830 |
+
|
2831 |
+
#: ../admin/upgrade.php:456
|
2832 |
+
msgid "Done."
|
2833 |
+
msgstr "Fertig."
|
2834 |
+
|
2835 |
+
#: ../admin/wpmu.php:33
|
2836 |
msgid "Update successfully"
|
2837 |
msgstr "Aktualisierung erfolgreich"
|
2838 |
|
2839 |
+
#: ../admin/wpmu.php:45
|
2840 |
+
#, php-format
|
2841 |
+
msgid "Thanks for using this plugin, NextGEN Gallery is initially developed for self hosted blogs. A multisite setup is possible, but cannot currently fully supported, as it can have several special condition ( i.e. Domain mapping).<br /> If you would like to support the further development, please consider a <strong><a href=\"%s\">donation</a></strong>! If you still need some help, please post your questions <a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\">here</a> ."
|
2842 |
+
msgstr "Vielen Dank, dass Du dieses Plugin nutzt. NextGEN Gallery wurde für einfache Blogs entwickelt. Die Nutzung im Netzwerk (Multisite) ist möglich, aber wird nicht vollständig unterstützt (z.B. Domain Mapping).<br /> Wenn Du die Weiterentwicklung unterstützen möchtest, würde ich mich über eine kleine <strong><a href=\"%s\">Spende</a></strong> freuen! Wenn Du Fragen oder Problem hast, schreib sie doch <a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\">hier</a> ins Forum."
|
2843 |
|
2844 |
+
#: ../admin/wpmu.php:62
|
2845 |
+
msgid "Network Options"
|
2846 |
+
msgstr "Netzwerk Optionen"
|
2847 |
+
|
2848 |
+
#: ../admin/wpmu.php:70
|
2849 |
+
msgid "This is the default path for all blogs. With the placeholder %BLOG_ID% you can organize the folder structure better."
|
2850 |
msgstr "Dieses ist der Default-Pfad für alle Blogs. Mit dem Platzhalter %BLOG_ID% wird die Ordnerstruktur gesteuert. Der Pfad muss mit / enden."
|
2851 |
|
2852 |
+
#: ../admin/wpmu.php:71
|
2853 |
+
#, php-format
|
2854 |
+
msgid "The default setting should be %s"
|
2855 |
+
msgstr "Grundeinstellung ist %s"
|
2856 |
+
|
2857 |
+
#: ../admin/wpmu.php:75
|
2858 |
msgid "Enable upload quota check"
|
2859 |
msgstr "Schalte die Uploadbegrenzung ein"
|
2860 |
|
2861 |
+
#: ../admin/wpmu.php:77
|
2862 |
msgid "Should work if the gallery is bellow the blog.dir"
|
2863 |
msgstr "Sollte funktionieren, wenn die Galerien sich unterhalb blog.dir befinden"
|
2864 |
|
2865 |
+
#: ../admin/wpmu.php:81
|
2866 |
msgid "Enable zip upload option"
|
2867 |
msgstr "Erlaube ZIP-Upload"
|
2868 |
|
2869 |
+
#: ../admin/wpmu.php:83
|
2870 |
msgid "Allow users to upload zip folders."
|
2871 |
msgstr "Erlaubt die Nutzung des ZIP-Upload"
|
2872 |
|
2873 |
+
#: ../admin/wpmu.php:87
|
2874 |
+
msgid "Enable import function"
|
2875 |
+
msgstr "Erlaube Import Funktion"
|
2876 |
+
|
2877 |
+
#: ../admin/wpmu.php:89
|
2878 |
+
msgid "Allow users to import images folders from the server."
|
2879 |
+
msgstr "Erlaube dem User Bilder direkt aus den Server Verzeichnissen zu importieren."
|
2880 |
+
|
2881 |
+
#: ../admin/wpmu.php:93
|
2882 |
msgid "Enable style selection"
|
2883 |
msgstr "Freie CSS-Style-Auswahl"
|
2884 |
|
2885 |
+
#: ../admin/wpmu.php:95
|
2886 |
msgid "Allow users to choose a style for the gallery."
|
2887 |
msgstr "Erlaube dem User, ein CSS für die Galerie zu wählen"
|
2888 |
|
2889 |
+
#: ../admin/wpmu.php:99
|
2890 |
msgid "Enable roles/capabilities"
|
2891 |
msgstr "Rollen / Zugriffsrechte freischalten"
|
2892 |
|
2893 |
+
#: ../admin/wpmu.php:101
|
2894 |
msgid "Allow users to change the roles for other blog authors."
|
2895 |
msgstr "Erlaube dem User die Anpassung der Zugangsberechtigung"
|
2896 |
|
2897 |
+
#: ../admin/wpmu.php:105
|
2898 |
msgid "Default style"
|
2899 |
msgstr "Standard-CSS-Style"
|
2900 |
|
2901 |
+
#: ../admin/wpmu.php:122
|
2902 |
msgid "Choose the default style for the galleries."
|
2903 |
msgstr "Wähle das Default-Stylesheet für die Galerien"
|
2904 |
|
|
|
|
|
|
|
|
|
2905 |
#: ../admin/tinymce/window.php:56
|
2906 |
+
msgid "Select or enter gallery"
|
2907 |
+
msgstr "Wähle oder Suche Galerie"
|
2908 |
+
|
2909 |
+
#: ../admin/tinymce/window.php:61
|
2910 |
+
#: ../admin/tinymce/window.php:82
|
2911 |
msgid "Show as"
|
2912 |
msgstr "Zeige als"
|
2913 |
|
2914 |
+
#: ../admin/tinymce/window.php:62
|
2915 |
msgid "Image list"
|
2916 |
msgstr "Bilder-Liste"
|
2917 |
|
2918 |
+
#: ../admin/tinymce/window.php:64
|
2919 |
msgid "Imagebrowser"
|
2920 |
msgstr "Bilder-Browser"
|
2921 |
|
2922 |
+
#: ../admin/tinymce/window.php:77
|
2923 |
+
msgid "Select or enter album"
|
2924 |
+
msgstr "Wähle oder Suche Album"
|
2925 |
|
2926 |
+
#: ../admin/tinymce/window.php:83
|
2927 |
msgid "Extended version"
|
2928 |
msgstr "Erweiterte Version"
|
2929 |
|
2930 |
+
#: ../admin/tinymce/window.php:84
|
2931 |
msgid "Compact version"
|
2932 |
msgstr "Kompakte Version"
|
2933 |
|
2934 |
#: ../admin/tinymce/window.php:97
|
2935 |
+
msgid "Select or enter picture"
|
2936 |
+
msgstr "Wähle oder Suche Bild"
|
2937 |
|
2938 |
+
#: ../admin/tinymce/window.php:102
|
2939 |
msgid "Width x Height"
|
2940 |
msgstr "Breite x Höhe"
|
2941 |
|
2942 |
+
#: ../admin/tinymce/window.php:106
|
2943 |
msgid "Effect"
|
2944 |
msgstr "Effekt"
|
2945 |
|
2946 |
+
#: ../admin/tinymce/window.php:109
|
2947 |
msgid "No effect"
|
2948 |
msgstr "Kein Effekt"
|
2949 |
|
2950 |
+
#: ../admin/tinymce/window.php:111
|
2951 |
msgid "Web 2.0"
|
2952 |
msgstr "Web 2.0"
|
2953 |
|
2954 |
+
#: ../admin/tinymce/window.php:116
|
2955 |
msgid "Float"
|
2956 |
msgstr "Float"
|
2957 |
|
2958 |
+
#: ../admin/tinymce/window.php:119
|
2959 |
msgid "No float"
|
2960 |
msgstr "Kein Float"
|
2961 |
|
2962 |
+
#: ../admin/tinymce/window.php:138
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2963 |
msgid "Insert"
|
2964 |
msgstr "Einfügen"
|
2965 |
|
2993 |
msgid "Not fired"
|
2994 |
msgstr "Nicht ausgelöst"
|
2995 |
|
2996 |
+
#: ../lib/meta.php:426
|
2997 |
msgid "Aperture"
|
2998 |
msgstr "Blende"
|
2999 |
|
3000 |
+
#: ../lib/meta.php:427
|
3001 |
+
#: ../lib/meta.php:452
|
3002 |
msgid "Credit"
|
3003 |
msgstr "Autor"
|
3004 |
|
3005 |
+
#: ../lib/meta.php:428
|
3006 |
msgid "Camera"
|
3007 |
msgstr "Kamera"
|
3008 |
|
3009 |
+
#: ../lib/meta.php:429
|
3010 |
msgid "Caption"
|
3011 |
msgstr "Beschreibung"
|
3012 |
|
3013 |
+
#: ../lib/meta.php:431
|
3014 |
msgid "Copyright"
|
3015 |
msgstr "Rechte"
|
3016 |
|
3017 |
+
#: ../lib/meta.php:432
|
3018 |
msgid "Focal length"
|
3019 |
msgstr "Brennweite"
|
3020 |
|
3021 |
+
#: ../lib/meta.php:433
|
3022 |
msgid "ISO"
|
3023 |
msgstr "ISO"
|
3024 |
|
3025 |
+
#: ../lib/meta.php:434
|
3026 |
msgid "Shutter speed"
|
3027 |
msgstr "Belichtungszeit"
|
3028 |
|
3029 |
+
#: ../lib/meta.php:438
|
3030 |
msgid "Subject"
|
3031 |
msgstr "Betreff"
|
3032 |
|
3033 |
+
#: ../lib/meta.php:439
|
3034 |
msgid "Make"
|
3035 |
msgstr "Hersteller"
|
3036 |
|
3037 |
+
#: ../lib/meta.php:440
|
3038 |
msgid "Edit Status"
|
3039 |
msgstr "Ändere Status"
|
3040 |
|
3041 |
+
#: ../lib/meta.php:441
|
3042 |
msgid "Category"
|
3043 |
msgstr "Kategorie"
|
3044 |
|
3045 |
+
#: ../lib/meta.php:442
|
3046 |
msgid "Keywords"
|
3047 |
msgstr "Schlüsselwörter"
|
3048 |
|
3049 |
+
#: ../lib/meta.php:443
|
3050 |
msgid "Date Created"
|
3051 |
msgstr "erstellt (Datum)"
|
3052 |
|
3053 |
+
#: ../lib/meta.php:444
|
3054 |
msgid "Time Created"
|
3055 |
msgstr "erstellt (Zeit)"
|
3056 |
|
3057 |
+
#: ../lib/meta.php:445
|
3058 |
msgid "Author Position"
|
3059 |
msgstr "Autor Position"
|
3060 |
|
3061 |
+
#: ../lib/meta.php:446
|
3062 |
msgid "City"
|
3063 |
msgstr "Stadt"
|
3064 |
|
3065 |
+
#: ../lib/meta.php:447
|
3066 |
msgid "Location"
|
3067 |
msgstr "Ort"
|
3068 |
|
3069 |
+
#: ../lib/meta.php:448
|
3070 |
msgid "Province/State"
|
3071 |
msgstr "Staat / PLZ"
|
3072 |
|
3073 |
+
#: ../lib/meta.php:449
|
3074 |
msgid "Country code"
|
3075 |
msgstr "Landescode"
|
3076 |
|
3077 |
+
#: ../lib/meta.php:450
|
3078 |
msgid "Country"
|
3079 |
msgstr "Land"
|
3080 |
|
3081 |
+
#: ../lib/meta.php:451
|
3082 |
msgid "Headline"
|
3083 |
msgstr "Kopfzeile"
|
3084 |
|
3085 |
+
#: ../lib/meta.php:453
|
3086 |
msgid "Source"
|
3087 |
msgstr "Quelle"
|
3088 |
|
3089 |
+
#: ../lib/meta.php:454
|
3090 |
msgid "Copyright Notice"
|
3091 |
msgstr "Copyright Hinweise / Credits"
|
3092 |
|
3093 |
+
#: ../lib/meta.php:455
|
3094 |
msgid "Contact"
|
3095 |
msgstr "Kontakt"
|
3096 |
|
3097 |
+
#: ../lib/meta.php:456
|
3098 |
msgid "Last modified"
|
3099 |
msgstr "Zuletzt geändert"
|
3100 |
|
3101 |
+
#: ../lib/meta.php:457
|
3102 |
msgid "Program tool"
|
3103 |
msgstr "Programm"
|
3104 |
|
3105 |
+
#: ../lib/meta.php:458
|
3106 |
msgid "Format"
|
3107 |
msgstr "Format"
|
3108 |
|
3109 |
+
#: ../lib/meta.php:459
|
3110 |
msgid "Image Width"
|
3111 |
msgstr "Breite"
|
3112 |
|
3113 |
+
#: ../lib/meta.php:460
|
3114 |
msgid "Image Height"
|
3115 |
msgstr "Höhe"
|
3116 |
|
3117 |
+
#: ../lib/meta.php:461
|
3118 |
msgid "Flash"
|
3119 |
msgstr "Blitz"
|
3120 |
|
3122 |
msgid "Sorry, you have used your space allocation. Please delete some files to upload more files."
|
3123 |
msgstr "Schade, Dein freier Speicher scheint aufgebraucht zu sein. Bitte lösche zuerst ein paar Bilder."
|
3124 |
|
3125 |
+
#: ../lib/ngg-db.php:330
|
3126 |
+
#: ../lib/ngg-db.php:331
|
3127 |
msgid "Album overview"
|
3128 |
msgstr "Album Übersicht"
|
3129 |
|
3199 |
msgid "%s slug(s) edited."
|
3200 |
msgstr "%s Stichwörter geändert"
|
3201 |
|
3202 |
+
#: ../lib/xmlrpc.php:64
|
3203 |
#, php-format
|
3204 |
msgid "XML-RPC services are disabled on this blog. An admin user can enable them at %s"
|
3205 |
msgstr "XML-RPC Service ist ausgeschaltet. Der Administrator kann es hier %s einschalten"
|
3206 |
|
3207 |
+
#: ../lib/xmlrpc.php:71
|
3208 |
msgid "Bad login/pass combination."
|
3209 |
msgstr "Username/Password falsch"
|
3210 |
|
3211 |
+
#: ../lib/xmlrpc.php:127
|
3212 |
msgid "You are not allowed to upload files to this site."
|
3213 |
msgstr "Du hast keine Berechtigung, Bilder hochzuladen"
|
3214 |
|
3215 |
+
#: ../lib/xmlrpc.php:133
|
3216 |
+
#: ../lib/xmlrpc.php:580
|
3217 |
msgid "Could not find gallery "
|
3218 |
msgstr "Konnte Galerie nicht finden"
|
3219 |
|
3220 |
+
#: ../lib/xmlrpc.php:138
|
3221 |
+
#: ../lib/xmlrpc.php:585
|
3222 |
msgid "You are not allowed to upload files to this gallery."
|
3223 |
msgstr "Du hast keine Berechtigung, Bilder in diese Galerie zuladen"
|
3224 |
|
3225 |
+
#: ../lib/xmlrpc.php:150
|
3226 |
msgid "This is no valid image file."
|
3227 |
msgstr "Das ist keine zulässige Bilddatei!"
|
3228 |
|
3229 |
+
#: ../lib/xmlrpc.php:162
|
3230 |
msgid "Could not find image id "
|
3231 |
msgstr "Konnte die Bild-ID nicht finden"
|
3232 |
|
3233 |
+
#: ../lib/xmlrpc.php:169
|
3234 |
#, php-format
|
3235 |
msgid "Failed to delete image %1$s "
|
3236 |
msgstr "Konnte das Bild %1$s nicht löschen"
|
3237 |
|
3238 |
+
#: ../lib/xmlrpc.php:178
|
3239 |
#, php-format
|
3240 |
msgid "Could not write file %1$s (%2$s)"
|
3241 |
msgstr "Konnte die Datei %1$s (%2$s) nicht schreiben "
|
3242 |
|
3243 |
+
#: ../lib/xmlrpc.php:246
|
3244 |
+
#: ../lib/xmlrpc.php:476
|
3245 |
+
#: ../lib/xmlrpc.php:542
|
3246 |
+
msgid "Sorry, you must be able to manage galleries"
|
3247 |
+
msgstr "Sorry, Du hast nicht das Recht, diese Galerie zu bearbeiten"
|
3248 |
|
3249 |
+
#: ../lib/xmlrpc.php:252
|
3250 |
msgid "Sorry, could not create the gallery"
|
3251 |
msgstr "Konnte die Galerie nicht anlegen"
|
3252 |
|
3253 |
+
#: ../lib/xmlrpc.php:295
|
3254 |
+
#: ../lib/xmlrpc.php:473
|
3255 |
+
msgid "Invalid gallery ID"
|
3256 |
+
msgstr "Keine gültige Galerie ID"
|
3257 |
+
|
3258 |
+
#: ../lib/xmlrpc.php:298
|
3259 |
+
msgid "Sorry, you must be able to manage this gallery"
|
3260 |
+
msgstr "Sorry, Du hast nicht das Recht, diese Galerie zu bearbeiten"
|
3261 |
+
|
3262 |
+
#: ../lib/xmlrpc.php:304
|
3263 |
+
msgid "Sorry, could not update the gallery"
|
3264 |
+
msgstr "Konnte die Galerie nicht aktualisieren"
|
3265 |
+
|
3266 |
+
#: ../lib/xmlrpc.php:344
|
3267 |
+
#: ../lib/xmlrpc.php:396
|
3268 |
+
#: ../lib/xmlrpc.php:438
|
3269 |
+
#: ../lib/xmlrpc.php:509
|
3270 |
+
msgid "Sorry, you must be able to manage albums"
|
3271 |
+
msgstr "Sorry, Du hast nicht das Recht, dieses Album zu bearbeiten"
|
3272 |
+
|
3273 |
+
#: ../lib/xmlrpc.php:350
|
3274 |
+
msgid "Sorry, could not create the album"
|
3275 |
+
msgstr "Konnte das Album nicht anlegen"
|
3276 |
+
|
3277 |
+
#: ../lib/xmlrpc.php:393
|
3278 |
+
#: ../lib/xmlrpc.php:435
|
3279 |
+
msgid "Invalid album ID"
|
3280 |
+
msgstr "Ungültige Album ID"
|
3281 |
+
|
3282 |
+
#: ../lib/xmlrpc.php:402
|
3283 |
+
msgid "Sorry, could not update the album"
|
3284 |
+
msgstr "Konnte das Album nicht aktualisieren"
|
3285 |
+
|
3286 |
#: ../view/album-compact.php:32
|
3287 |
#: ../view/album-extend.php:30
|
3288 |
msgid "Photos"
|
3471 |
msgid "Invalid MediaRSS command"
|
3472 |
msgstr "Ungültiger Media-RSS-Befehl"
|
3473 |
|
3474 |
+
#~ msgid "A new version of NextGEN Gallery is available !"
|
3475 |
+
#~ msgstr "Eine neue Version von NextGEN Gallery ist jetzt verfügbar"
|
3476 |
+
|
3477 |
+
#~ msgid "Download here"
|
3478 |
+
#~ msgstr "Hier downloaden"
|
3479 |
+
|
3480 |
+
#~ msgid "already exists"
|
3481 |
+
#~ msgstr "gibt es bereits"
|
3482 |
+
|
3483 |
+
#~ msgid "Gallery Overview"
|
3484 |
+
#~ msgstr "Galerie Übersicht"
|
3485 |
+
|
3486 |
+
#~ msgid "Quantity"
|
3487 |
+
#~ msgstr "Anzahl"
|
3488 |
+
|
3489 |
+
#~ msgid "Action"
|
3490 |
+
#~ msgstr "Aktion"
|
3491 |
+
|
3492 |
+
#~ msgid "Delete this gallery ?"
|
3493 |
+
#~ msgstr "Diese Galerie löschen ?"
|
3494 |
+
|
3495 |
+
#~ msgid "General WordPress MU Settings"
|
3496 |
+
#~ msgstr "WordPress-MU-Einstellungen"
|
3497 |
+
|
3498 |
+
#~ msgid "No album"
|
3499 |
+
#~ msgstr "Kein Album"
|
3500 |
+
|
3501 |
#~ msgid "for the Fugue Iconset"
|
3502 |
#~ msgstr "für das Fugue-Iconset"
|
3503 |
|
3542 |
#~ msgid "Setup"
|
3543 |
#~ msgstr "Setup"
|
3544 |
|
|
|
|
|
|
|
3545 |
#~ msgid "Full size"
|
3546 |
#~ msgstr "Volle Größe"
|
3547 |
|
3728 |
#~ msgid "Manage galleries and images"
|
3729 |
#~ msgstr "Verwalte Galerien und Bilder"
|
3730 |
|
|
|
|
|
|
|
3731 |
#~ msgid "URL"
|
3732 |
#~ msgstr "URL"
|
3733 |
|
lang/nggallery.pot
CHANGED
@@ -2,8 +2,8 @@ msgid ""
|
|
2 |
msgstr ""
|
3 |
"Project-Id-Version: NextGEN Gallery\n"
|
4 |
"Report-Msgid-Bugs-To: \n"
|
5 |
-
"POT-Creation-Date: 2010-
|
6 |
-
"PO-Revision-Date: 2010-
|
7 |
"Last-Translator: Alex Rabe\n"
|
8 |
"Language-Team: Alex Rabe\n"
|
9 |
"MIME-Version: 1.0\n"
|
@@ -17,86 +17,86 @@ msgstr ""
|
|
17 |
"X-Poedit-SearchPath-0: .\n"
|
18 |
"X-Poedit-SearchPath-1: ..\n"
|
19 |
|
20 |
-
#: ../nggallery.php:
|
21 |
msgid "<strong>Translation by : </strong><a target=\"_blank\" href=\"http://alexrabe.de/wordpress-plugins/nextgen-gallery/languages/\">See here</a>"
|
22 |
msgstr ""
|
23 |
|
24 |
-
#: ../nggallery.php:
|
25 |
-
msgid "<strong>This translation is not yet updated for Version 1.
|
26 |
msgstr ""
|
27 |
|
28 |
-
#: ../nggallery.php:
|
29 |
-
msgid "Sorry, NextGEN Gallery works only with a Memory Limit of 16 MB higher"
|
30 |
msgstr ""
|
31 |
|
32 |
-
#: ../nggallery.php:
|
33 |
msgid "Please update the database of NextGEN Gallery."
|
34 |
msgstr ""
|
35 |
|
36 |
-
#: ../nggallery.php:
|
37 |
msgid "Click here to proceed."
|
38 |
msgstr ""
|
39 |
|
40 |
-
#: ../nggallery.php:
|
41 |
msgid "Picture tag"
|
42 |
msgstr ""
|
43 |
|
44 |
-
#: ../nggallery.php:
|
45 |
msgid "Picture tag: %2$l."
|
46 |
msgstr ""
|
47 |
|
48 |
-
#: ../nggallery.php:
|
49 |
msgid "Separate picture tags with commas."
|
50 |
msgstr ""
|
51 |
|
52 |
-
#: ../nggallery.php:
|
53 |
msgid "L O A D I N G"
|
54 |
msgstr ""
|
55 |
|
56 |
-
#: ../nggallery.php:
|
57 |
msgid "Click to Close"
|
58 |
msgstr ""
|
59 |
|
60 |
-
#: ../nggallery.php:
|
61 |
msgid "loading"
|
62 |
msgstr ""
|
63 |
|
64 |
-
#: ../nggallery.php:
|
65 |
-
#: ../nggfunctions.php:
|
66 |
-
#: ../admin/admin.php:
|
67 |
msgid "Overview"
|
68 |
msgstr ""
|
69 |
|
70 |
-
#: ../nggallery.php:
|
71 |
msgid "Get help"
|
72 |
msgstr ""
|
73 |
|
74 |
-
#: ../nggallery.php:
|
75 |
msgid "Contribute"
|
76 |
msgstr ""
|
77 |
|
78 |
-
#: ../nggallery.php:
|
79 |
msgid "Donate"
|
80 |
msgstr ""
|
81 |
|
82 |
#: ../nggfunctions.php:42
|
83 |
-
msgid "The <a href=\"http://www.macromedia.com/go/getflashplayer\">Flash Player</a> and <a href=\"http://www.mozilla.com/firefox/\">a browser with Javascript support</a> are needed
|
84 |
msgstr ""
|
85 |
|
86 |
-
#: ../nggfunctions.php:
|
87 |
-
#: ../nggfunctions.php:
|
88 |
msgid "[Gallery not found]"
|
89 |
msgstr ""
|
90 |
|
91 |
-
#: ../nggfunctions.php:
|
92 |
msgid "[Album not found]"
|
93 |
msgstr ""
|
94 |
|
95 |
-
#: ../nggfunctions.php:
|
96 |
msgid "[SinglePic not found]"
|
97 |
msgstr ""
|
98 |
|
99 |
-
#: ../nggfunctions.php:
|
100 |
msgid "Related images for"
|
101 |
msgstr ""
|
102 |
|
@@ -221,11 +221,11 @@ msgstr ""
|
|
221 |
#: ../admin/addgallery.php:69
|
222 |
#: ../admin/addgallery.php:80
|
223 |
#: ../admin/album.php:96
|
224 |
-
#: ../admin/album.php:
|
225 |
-
#: ../admin/album.php:
|
226 |
#: ../admin/edit-thumbnail.php:19
|
227 |
#: ../admin/edit-thumbnail.php:22
|
228 |
-
#: ../admin/manage.php:
|
229 |
msgid "Cheatin’ uh?"
|
230 |
msgstr ""
|
231 |
|
@@ -238,479 +238,486 @@ msgid "Upload failed! "
|
|
238 |
msgstr ""
|
239 |
|
240 |
#: ../admin/addgallery.php:90
|
241 |
-
#: ../admin/functions.php:
|
242 |
-
#: ../admin/functions.php:
|
243 |
msgid "No gallery selected !"
|
244 |
msgstr ""
|
245 |
|
246 |
-
#: ../admin/addgallery.php:
|
247 |
msgid "Image Files"
|
248 |
msgstr ""
|
249 |
|
250 |
-
#: ../admin/addgallery.php:
|
251 |
-
#: ../admin/addgallery.php:
|
252 |
msgid "remove"
|
253 |
msgstr ""
|
254 |
|
255 |
-
#: ../admin/addgallery.php:
|
256 |
-
#: ../admin/addgallery.php:
|
257 |
msgid "Browse..."
|
258 |
msgstr ""
|
259 |
|
260 |
-
#: ../admin/addgallery.php:
|
261 |
-
#: ../admin/addgallery.php:
|
|
|
262 |
msgid "Upload images"
|
263 |
msgstr ""
|
264 |
|
265 |
-
#: ../admin/addgallery.php:
|
266 |
-
#: ../admin/addgallery.php:
|
267 |
msgid "Upload Images"
|
268 |
msgstr ""
|
269 |
|
270 |
-
#: ../admin/addgallery.php:
|
271 |
-
#: ../admin/addgallery.php:
|
272 |
-
#: ../admin/manage-galleries.php:
|
|
|
273 |
msgid "Add new gallery"
|
274 |
msgstr ""
|
275 |
|
276 |
-
#: ../admin/addgallery.php:
|
277 |
-
#: ../admin/addgallery.php:
|
278 |
msgid "Upload a Zip-File"
|
279 |
msgstr ""
|
280 |
|
281 |
-
#: ../admin/addgallery.php:
|
282 |
-
#: ../admin/addgallery.php:
|
283 |
msgid "Import image folder"
|
284 |
msgstr ""
|
285 |
|
286 |
-
#: ../admin/addgallery.php:
|
287 |
-
#: ../admin/manage-galleries.php:
|
288 |
msgid "New Gallery"
|
289 |
msgstr ""
|
290 |
|
291 |
-
#: ../admin/addgallery.php:
|
292 |
-
#: ../admin/manage-galleries.php:
|
293 |
msgid "Create a new , empty gallery below the folder"
|
294 |
msgstr ""
|
295 |
|
296 |
-
#: ../admin/addgallery.php:
|
297 |
-
#: ../admin/manage-galleries.php:
|
298 |
msgid "Allowed characters for file and folder names are"
|
299 |
msgstr ""
|
300 |
|
301 |
-
#: ../admin/addgallery.php:
|
302 |
msgid "Add gallery"
|
303 |
msgstr ""
|
304 |
|
305 |
-
#: ../admin/addgallery.php:
|
306 |
msgid "Select Zip-File"
|
307 |
msgstr ""
|
308 |
|
309 |
-
#: ../admin/addgallery.php:
|
310 |
msgid "Upload a zip file with images"
|
311 |
msgstr ""
|
312 |
|
313 |
-
#: ../admin/addgallery.php:
|
314 |
msgid "or enter a Zip-File URL"
|
315 |
msgstr ""
|
316 |
|
317 |
-
#: ../admin/addgallery.php:
|
318 |
msgid "Import a zip file with images from a url"
|
319 |
msgstr ""
|
320 |
|
321 |
-
#: ../admin/addgallery.php:
|
322 |
-
#: ../admin/addgallery.php:
|
323 |
msgid "in to"
|
324 |
msgstr ""
|
325 |
|
326 |
-
#: ../admin/addgallery.php:
|
327 |
msgid "a new gallery"
|
328 |
msgstr ""
|
329 |
|
330 |
-
#: ../admin/addgallery.php:
|
331 |
msgid "Note : The upload limit on your server is "
|
332 |
msgstr ""
|
333 |
|
334 |
-
#: ../admin/addgallery.php:
|
335 |
msgid "Start upload"
|
336 |
msgstr ""
|
337 |
|
338 |
-
#: ../admin/addgallery.php:
|
339 |
msgid "Import from Server path:"
|
340 |
msgstr ""
|
341 |
|
342 |
-
#: ../admin/addgallery.php:
|
343 |
msgid "Note : Change the default path in the gallery settings"
|
344 |
msgstr ""
|
345 |
|
346 |
-
#: ../admin/addgallery.php:
|
347 |
msgid " Please note : For safe-mode = ON you need to add the subfolder thumbs manually"
|
348 |
msgstr ""
|
349 |
|
350 |
-
#: ../admin/addgallery.php:
|
351 |
msgid "Import folder"
|
352 |
msgstr ""
|
353 |
|
354 |
-
#: ../admin/addgallery.php:
|
355 |
msgid "Upload image"
|
356 |
msgstr ""
|
357 |
|
358 |
-
#: ../admin/addgallery.php:
|
359 |
msgid "Choose gallery"
|
360 |
msgstr ""
|
361 |
|
362 |
-
#: ../admin/addgallery.php:
|
363 |
msgid "The batch upload requires Adobe Flash 10, disable it if you have problems"
|
364 |
msgstr ""
|
365 |
|
366 |
-
#: ../admin/addgallery.php:
|
367 |
msgid "Disable flash upload"
|
368 |
msgstr ""
|
369 |
|
370 |
-
#: ../admin/addgallery.php:
|
371 |
msgid "Upload multiple files at once by ctrl/shift-selecting in dialog"
|
372 |
msgstr ""
|
373 |
|
374 |
-
#: ../admin/addgallery.php:
|
375 |
msgid "Enable flash based upload"
|
376 |
msgstr ""
|
377 |
|
378 |
-
#: ../admin/admin.php:
|
379 |
-
#: ../admin/admin.php:
|
380 |
-
#: ../admin/admin.php:
|
381 |
-
#: ../admin/
|
382 |
-
#: ../admin/functions.php:
|
383 |
-
#: ../admin/manage-
|
384 |
-
#: ../admin/manage.php:
|
|
|
385 |
msgid "Gallery"
|
386 |
msgid_plural "Galleries"
|
387 |
msgstr[0] ""
|
388 |
msgstr[1] ""
|
389 |
|
390 |
-
#: ../admin/admin.php:
|
391 |
msgid "Add Gallery / Images"
|
392 |
msgstr ""
|
393 |
|
394 |
-
#: ../admin/admin.php:
|
395 |
msgid "Manage Gallery"
|
396 |
msgstr ""
|
397 |
|
398 |
-
#: ../admin/admin.php:
|
399 |
msgid "Album"
|
400 |
msgid_plural "Albums"
|
401 |
msgstr[0] ""
|
402 |
msgstr[1] ""
|
403 |
|
404 |
-
#: ../admin/admin.php:
|
405 |
msgid "Tags"
|
406 |
msgstr ""
|
407 |
|
408 |
-
#: ../admin/admin.php:
|
409 |
msgid "Options"
|
410 |
msgstr ""
|
411 |
|
412 |
-
#: ../admin/admin.php:
|
413 |
msgid "Style"
|
414 |
msgstr ""
|
415 |
|
416 |
-
#: ../admin/admin.php:
|
417 |
msgid "Roles"
|
418 |
msgstr ""
|
419 |
|
420 |
-
#: ../admin/admin.php:
|
421 |
msgid "About this Gallery"
|
422 |
msgstr ""
|
423 |
|
424 |
-
#: ../admin/admin.php:
|
425 |
msgid "About"
|
426 |
msgstr ""
|
427 |
|
428 |
-
#: ../admin/admin.php:
|
429 |
msgid "NextGEN Gallery"
|
430 |
msgstr ""
|
431 |
|
432 |
-
#: ../admin/admin.php:
|
|
|
433 |
msgid "Reset / Uninstall"
|
434 |
msgstr ""
|
435 |
|
436 |
-
#: ../admin/admin.php:
|
437 |
-
msgid "
|
438 |
-
msgstr ""
|
439 |
-
|
440 |
-
#: ../admin/admin.php:74
|
441 |
-
msgid "Download here"
|
442 |
msgstr ""
|
443 |
|
444 |
-
#: ../admin/admin.php:
|
445 |
#, php-format
|
446 |
msgid "Thanks for using this plugin, I hope you are satisfied ! If you would like to support the further development, please consider a <strong><a href=\"%s\">donation</a></strong>! If you still need some help, please post your questions <a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\">here</a> ."
|
447 |
msgstr ""
|
448 |
|
449 |
-
#: ../admin/admin.php:
|
450 |
msgid "OK, hide this message now !"
|
451 |
msgstr ""
|
452 |
|
453 |
-
#: ../admin/admin.php:
|
454 |
msgid "You do not have the correct permission"
|
455 |
msgstr ""
|
456 |
|
457 |
-
#: ../admin/admin.php:
|
458 |
msgid "Unexpected Error"
|
459 |
msgstr ""
|
460 |
|
461 |
-
#: ../admin/admin.php:
|
462 |
msgid "A failure occurred"
|
463 |
msgstr ""
|
464 |
|
465 |
-
#: ../admin/admin.php:
|
466 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Introduction</a>"
|
467 |
msgstr ""
|
468 |
|
469 |
-
#: ../admin/admin.php:
|
470 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Setup</a>"
|
471 |
msgstr ""
|
472 |
|
473 |
-
#: ../admin/admin.php:
|
474 |
msgid "<a href=\"http://alexrabe.de/wordpress-plugins/nextgen-gallery/languages/\" target=\"_blank\">Translation by alex rabe</a>"
|
475 |
msgstr ""
|
476 |
|
477 |
-
#: ../admin/admin.php:
|
478 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Roles / Capabilities</a>"
|
479 |
msgstr ""
|
480 |
|
481 |
-
#: ../admin/admin.php:
|
482 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Styles</a>"
|
483 |
msgstr ""
|
484 |
|
485 |
-
#: ../admin/admin.php:
|
486 |
msgid "Templates"
|
487 |
msgstr ""
|
488 |
|
489 |
-
#: ../admin/admin.php:
|
490 |
-
#: ../admin/admin.php:
|
491 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Gallery management</a>"
|
492 |
msgstr ""
|
493 |
|
494 |
-
#: ../admin/admin.php:
|
495 |
msgid "Gallery example"
|
496 |
msgstr ""
|
497 |
|
498 |
-
#: ../admin/admin.php:
|
499 |
-
#: ../admin/admin.php:
|
500 |
msgid "Gallery tags"
|
501 |
msgstr ""
|
502 |
|
503 |
-
#: ../admin/admin.php:
|
504 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Album management</a>"
|
505 |
msgstr ""
|
506 |
|
507 |
-
#: ../admin/admin.php:
|
508 |
msgid "Album example"
|
509 |
msgstr ""
|
510 |
|
511 |
-
#: ../admin/admin.php:
|
512 |
-
#: ../admin/admin.php:
|
513 |
msgid "Album tags"
|
514 |
msgstr ""
|
515 |
|
516 |
-
#: ../admin/admin.php:
|
517 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Gallery tags</a>"
|
518 |
msgstr ""
|
519 |
|
520 |
-
#: ../admin/admin.php:
|
521 |
msgid "Related images"
|
522 |
msgstr ""
|
523 |
|
524 |
-
#: ../admin/admin.php:
|
525 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-image-management/\" target=\"_blank\">Image management</a>"
|
526 |
msgstr ""
|
527 |
|
528 |
-
#: ../admin/admin.php:
|
529 |
msgid "Custom fields"
|
530 |
msgstr ""
|
531 |
|
532 |
-
#: ../admin/admin.php:
|
533 |
msgid "Get help with NextGEN Gallery"
|
534 |
msgstr ""
|
535 |
|
536 |
-
#: ../admin/admin.php:
|
537 |
msgid "More Help & Info"
|
538 |
msgstr ""
|
539 |
|
540 |
-
#: ../admin/admin.php:
|
541 |
msgid "<a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\" target=\"_blank\">Support Forums</a>"
|
542 |
msgstr ""
|
543 |
|
544 |
-
#: ../admin/admin.php:
|
545 |
msgid "FAQ"
|
546 |
msgstr ""
|
547 |
|
548 |
-
#: ../admin/admin.php:
|
549 |
msgid "Feature request"
|
550 |
msgstr ""
|
551 |
|
552 |
-
#: ../admin/admin.php:
|
553 |
msgid "Get your language pack"
|
554 |
msgstr ""
|
555 |
|
556 |
-
#: ../admin/admin.php:
|
557 |
msgid "Contribute development"
|
558 |
msgstr ""
|
559 |
|
560 |
-
#: ../admin/admin.php:
|
561 |
msgid "Download latest version"
|
562 |
msgstr ""
|
563 |
|
564 |
-
#: ../admin/
|
565 |
-
|
566 |
-
|
|
|
|
|
|
|
|
|
567 |
msgid "Update Successfully"
|
568 |
msgstr ""
|
569 |
|
570 |
-
#: ../admin/album.php:
|
571 |
msgid "Album deleted"
|
572 |
msgstr ""
|
573 |
|
574 |
-
#: ../admin/album.php:
|
|
|
|
|
|
|
|
|
575 |
msgid "Manage Albums"
|
576 |
msgstr ""
|
577 |
|
578 |
-
#: ../admin/album.php:
|
579 |
-
#: ../admin/album.php:
|
580 |
msgid "Select album"
|
581 |
msgstr ""
|
582 |
|
583 |
-
#: ../admin/album.php:
|
584 |
msgid "No album selected"
|
585 |
msgstr ""
|
586 |
|
587 |
-
#: ../admin/album.php:
|
588 |
#: ../admin/edit-thumbnail.php:157
|
589 |
msgid "Update"
|
590 |
msgstr ""
|
591 |
|
592 |
-
#: ../admin/album.php:
|
593 |
msgid "Edit album"
|
594 |
msgstr ""
|
595 |
|
596 |
-
#: ../admin/album.php:
|
597 |
-
#: ../admin/manage-galleries.php:
|
598 |
-
#: ../admin/manage-images.php:
|
599 |
msgid "Delete"
|
600 |
msgstr ""
|
601 |
|
602 |
-
#: ../admin/album.php:
|
603 |
msgid "Delete album ?"
|
604 |
msgstr ""
|
605 |
|
606 |
-
#: ../admin/album.php:
|
607 |
msgid "Add new album"
|
608 |
msgstr ""
|
609 |
|
610 |
-
#: ../admin/album.php:
|
611 |
msgid "Add"
|
612 |
msgstr ""
|
613 |
|
614 |
-
#: ../admin/album.php:
|
615 |
msgid "Show / hide used galleries"
|
616 |
msgstr ""
|
617 |
|
618 |
-
#: ../admin/album.php:
|
619 |
msgid "[Show all]"
|
620 |
msgstr ""
|
621 |
|
622 |
-
#: ../admin/album.php:
|
623 |
msgid "Maximize the widget content"
|
624 |
msgstr ""
|
625 |
|
626 |
-
#: ../admin/album.php:
|
627 |
msgid "[Maximize]"
|
628 |
msgstr ""
|
629 |
|
630 |
-
#: ../admin/album.php:
|
631 |
msgid "Minimize the widget content"
|
632 |
msgstr ""
|
633 |
|
634 |
-
#: ../admin/album.php:
|
635 |
msgid "[Minimize]"
|
636 |
msgstr ""
|
637 |
|
638 |
-
#: ../admin/album.php:
|
639 |
msgid "After you create and select a album, you can drag and drop a gallery or another album into your new album below"
|
640 |
msgstr ""
|
641 |
|
642 |
-
#: ../admin/album.php:
|
643 |
msgid "Select gallery"
|
644 |
msgstr ""
|
645 |
|
646 |
-
#: ../admin/album.php:
|
647 |
msgid "Album ID"
|
648 |
msgstr ""
|
649 |
|
650 |
-
#: ../admin/album.php:
|
651 |
msgid "No album selected!"
|
652 |
msgstr ""
|
653 |
|
654 |
-
#: ../admin/album.php:
|
655 |
msgid "Album name:"
|
656 |
msgstr ""
|
657 |
|
658 |
-
#: ../admin/album.php:
|
659 |
msgid "Album description:"
|
660 |
msgstr ""
|
661 |
|
662 |
-
#: ../admin/album.php:
|
663 |
msgid "Select a preview image:"
|
664 |
msgstr ""
|
665 |
|
666 |
-
#: ../admin/album.php:
|
|
|
667 |
msgid "No picture"
|
668 |
msgstr ""
|
669 |
|
670 |
-
#: ../admin/album.php:
|
671 |
-
#: ../admin/manage-images.php:
|
672 |
msgid "Page Link to"
|
673 |
msgstr ""
|
674 |
|
675 |
-
#: ../admin/album.php:
|
676 |
-
#: ../admin/manage-images.php:
|
677 |
msgid "Not linked"
|
678 |
msgstr ""
|
679 |
|
680 |
-
#: ../admin/album.php:
|
681 |
-
#: ../admin/manage-galleries.php:
|
682 |
-
#: ../admin/manage-galleries.php:
|
683 |
-
#: ../admin/manage-galleries.php:
|
684 |
-
#: ../admin/manage-images.php:
|
685 |
-
#: ../admin/manage-images.php:
|
686 |
-
#: ../admin/manage-images.php:
|
687 |
-
#: ../admin/manage-images.php:
|
688 |
msgid "OK"
|
689 |
msgstr ""
|
690 |
|
691 |
-
#: ../admin/album.php:
|
692 |
-
#: ../admin/manage-galleries.php:
|
693 |
-
#: ../admin/manage-galleries.php:
|
694 |
-
#: ../admin/manage-galleries.php:
|
695 |
-
#: ../admin/manage-images.php:
|
696 |
-
#: ../admin/manage-images.php:
|
697 |
-
#: ../admin/manage-images.php:
|
698 |
-
#: ../admin/manage-images.php:
|
699 |
msgid "Cancel"
|
700 |
msgstr ""
|
701 |
|
702 |
-
#: ../admin/album.php:
|
703 |
msgid "Name"
|
704 |
msgstr ""
|
705 |
|
706 |
-
#: ../admin/album.php:
|
707 |
-
#: ../admin/manage-
|
708 |
-
#: ../admin/manage-galleries.php:171
|
709 |
-
#: ../admin/manage-images.php:217
|
710 |
msgid "Title"
|
711 |
msgstr ""
|
712 |
|
713 |
-
#: ../admin/album.php:
|
714 |
msgid "Page"
|
715 |
msgstr ""
|
716 |
|
@@ -730,274 +737,272 @@ msgstr ""
|
|
730 |
msgid "Select the area for the thumbnail from the picture on the left."
|
731 |
msgstr ""
|
732 |
|
733 |
-
#: ../admin/functions.php:
|
734 |
msgid "No valid gallery name!"
|
735 |
msgstr ""
|
736 |
|
737 |
-
#: ../admin/functions.php:
|
738 |
-
#: ../admin/functions.php:
|
739 |
-
#: ../admin/functions.php:
|
740 |
-
#: ../admin/functions.php:
|
741 |
-
#: ../admin/functions.php:
|
742 |
msgid "Directory"
|
743 |
msgstr ""
|
744 |
|
745 |
-
#: ../admin/functions.php:
|
746 |
msgid "didn't exist. Please create first the main gallery folder "
|
747 |
msgstr ""
|
748 |
|
749 |
-
#: ../admin/functions.php:
|
750 |
-
#: ../admin/functions.php:
|
751 |
msgid "Check this link, if you didn't know how to set the permission :"
|
752 |
msgstr ""
|
753 |
|
754 |
-
#: ../admin/functions.php:
|
755 |
-
#: ../admin/functions.php:
|
756 |
msgid "is not writeable !"
|
757 |
msgstr ""
|
758 |
|
759 |
-
#: ../admin/functions.php:
|
760 |
-
#: ../admin/functions.php:
|
761 |
-
#: ../admin/functions.php:
|
762 |
msgid "Unable to create directory "
|
763 |
msgstr ""
|
764 |
|
765 |
-
#: ../admin/functions.php:
|
766 |
msgid "The server setting Safe-Mode is on !"
|
767 |
msgstr ""
|
768 |
|
769 |
-
#: ../admin/functions.php:
|
770 |
msgid "If you have problems, please create directory"
|
771 |
msgstr ""
|
772 |
|
773 |
-
#: ../admin/functions.php:
|
774 |
msgid "and the thumbnails directory"
|
775 |
msgstr ""
|
776 |
|
777 |
-
#: ../admin/functions.php:
|
778 |
msgid "with permission 777 manually !"
|
779 |
msgstr ""
|
780 |
|
781 |
-
#: ../admin/functions.php:
|
782 |
-
msgid "already exists"
|
783 |
-
msgstr ""
|
784 |
-
|
785 |
-
#: ../admin/functions.php:113
|
786 |
#, php-format
|
787 |
-
msgid "Gallery %1$s successfully created
|
788 |
msgstr ""
|
789 |
|
790 |
-
#: ../admin/functions.php:
|
791 |
msgid "Edit gallery"
|
792 |
msgstr ""
|
793 |
|
794 |
-
#: ../admin/functions.php:
|
795 |
msgid "doesn`t exist!"
|
796 |
msgstr ""
|
797 |
|
798 |
-
#: ../admin/functions.php:
|
799 |
msgid "contains no pictures"
|
800 |
msgstr ""
|
801 |
|
802 |
-
#: ../admin/functions.php:
|
803 |
msgid "Database error. Could not add gallery!"
|
804 |
msgstr ""
|
805 |
|
806 |
-
#: ../admin/functions.php:
|
807 |
msgid "successfully created!"
|
808 |
msgstr ""
|
809 |
|
810 |
-
#: ../admin/functions.php:
|
811 |
-
#: ../admin/functions.php:
|
812 |
-
#: ../admin/manage-galleries.php:
|
813 |
-
#: ../admin/manage-
|
814 |
-
#: ../admin/manage.php:
|
815 |
-
#: ../admin/manage.php:
|
|
|
|
|
816 |
msgid "Create new thumbnails"
|
817 |
msgstr ""
|
818 |
|
819 |
-
#: ../admin/functions.php:
|
820 |
msgid " picture(s) successfully added"
|
821 |
msgstr ""
|
822 |
|
823 |
-
#: ../admin/functions.php:
|
824 |
-
#: ../admin/functions.php:
|
825 |
-
#: ../admin/functions.php:
|
826 |
-
#: ../admin/functions.php:
|
827 |
-
#: ../admin/functions.php:
|
828 |
msgid "Object didn't contain correct data"
|
829 |
msgstr ""
|
830 |
|
831 |
-
#: ../admin/functions.php:
|
832 |
msgid " is not writeable "
|
833 |
msgstr ""
|
834 |
|
835 |
-
#: ../admin/functions.php:
|
836 |
-
#: ../admin/functions.php:
|
837 |
-
#: ../admin/functions.php:
|
838 |
-
#: ../admin/functions.php:
|
839 |
msgid " is not writeable"
|
840 |
msgstr ""
|
841 |
|
842 |
-
#: ../admin/functions.php:
|
843 |
msgid "File do not exists"
|
844 |
msgstr ""
|
845 |
|
846 |
-
#: ../admin/functions.php:
|
847 |
msgid "Couldn't restore original image"
|
848 |
msgstr ""
|
849 |
|
850 |
-
#: ../admin/functions.php:
|
851 |
msgid "(Error : Couldn't not update data base)"
|
852 |
msgstr ""
|
853 |
|
854 |
-
#: ../admin/functions.php:
|
855 |
msgid "(Error : Couldn't not update meta data)"
|
856 |
msgstr ""
|
857 |
|
858 |
-
#: ../admin/functions.php:
|
859 |
msgid "(Error : Couldn't not find image)"
|
860 |
msgstr ""
|
861 |
|
862 |
-
#: ../admin/functions.php:
|
863 |
msgid "No valid URL path "
|
864 |
msgstr ""
|
865 |
|
866 |
-
#: ../admin/functions.php:
|
867 |
msgid "Import via cURL failed."
|
868 |
msgstr ""
|
869 |
|
870 |
-
#: ../admin/functions.php:
|
871 |
-
msgid "Uploaded file was no or a faulty zip file ! The server
|
872 |
msgstr ""
|
873 |
|
874 |
-
#: ../admin/functions.php:
|
875 |
msgid "Could not get a valid foldername"
|
876 |
msgstr ""
|
877 |
|
878 |
-
#: ../admin/functions.php:
|
879 |
#, php-format
|
880 |
msgid "Unable to create directory %s. Is its parent directory writable by the server?"
|
881 |
msgstr ""
|
882 |
|
883 |
-
#: ../admin/functions.php:
|
884 |
msgid "Zip-File successfully unpacked"
|
885 |
msgstr ""
|
886 |
|
887 |
-
#: ../admin/functions.php:
|
888 |
-
#: ../admin/functions.php:
|
889 |
msgid "Failure in database, no gallery path set !"
|
890 |
msgstr ""
|
891 |
|
892 |
-
#: ../admin/functions.php:
|
893 |
-
#: ../admin/functions.php:
|
894 |
msgid "is no valid image file!"
|
895 |
msgstr ""
|
896 |
|
897 |
-
#: ../admin/functions.php:
|
898 |
-
#: ../admin/functions.php:
|
899 |
-
#: ../admin/functions.php:
|
900 |
#, php-format
|
901 |
msgid "Unable to write to directory %s. Is this directory writable by the server?"
|
902 |
msgstr ""
|
903 |
|
904 |
-
#: ../admin/functions.php:
|
905 |
-
#: ../admin/functions.php:
|
906 |
-
msgid "Error, the file could not moved to : "
|
907 |
msgstr ""
|
908 |
|
909 |
-
#: ../admin/functions.php:
|
910 |
-
#: ../admin/functions.php:
|
911 |
-
msgid "Error, the file permissions could not set"
|
912 |
msgstr ""
|
913 |
|
914 |
-
#: ../admin/functions.php:
|
915 |
msgid " Image(s) successfully added"
|
916 |
msgstr ""
|
917 |
|
918 |
-
#: ../admin/functions.php:
|
919 |
msgid "Invalid upload. Error Code : "
|
920 |
msgstr ""
|
921 |
|
922 |
-
#: ../admin/functions.php:
|
923 |
#, php-format
|
924 |
msgid "SAFE MODE Restriction in effect! You need to create the folder <strong>%s</strong> manually"
|
925 |
msgstr ""
|
926 |
|
927 |
-
#: ../admin/functions.php:
|
928 |
#, php-format
|
929 |
msgid "When safe_mode is on, PHP checks to see if the owner (%s) of the current script matches the owner (%s) of the file to be operated on by a file function or its directory"
|
930 |
msgstr ""
|
931 |
|
932 |
-
#: ../admin/functions.php:
|
933 |
-
#: ../admin/functions.php:
|
934 |
msgid "The destination gallery does not exist"
|
935 |
msgstr ""
|
936 |
|
937 |
-
#: ../admin/functions.php:
|
938 |
#, php-format
|
939 |
msgid "Failed to move image %1$s to %2$s"
|
940 |
msgstr ""
|
941 |
|
942 |
-
#: ../admin/functions.php:
|
943 |
#, php-format
|
944 |
msgid "Moved %1$s picture(s) to gallery : %2$s ."
|
945 |
msgstr ""
|
946 |
|
947 |
-
#: ../admin/functions.php:
|
948 |
#, php-format
|
949 |
msgid "Failed to copy image %1$s to %2$s"
|
950 |
msgstr ""
|
951 |
|
952 |
-
#: ../admin/functions.php:
|
953 |
#, php-format
|
954 |
msgid "Failed to copy database row for picture %s"
|
955 |
msgstr ""
|
956 |
|
957 |
-
#: ../admin/functions.php:
|
958 |
#, php-format
|
959 |
msgid "Image %1$s (%2$s) copied as image %3$s (%4$s) » The file already existed in the destination gallery."
|
960 |
msgstr ""
|
961 |
|
962 |
-
#: ../admin/functions.php:
|
963 |
#, php-format
|
964 |
msgid "Image %1$s (%2$s) copied as image %3$s (%4$s)"
|
965 |
msgstr ""
|
966 |
|
967 |
-
#: ../admin/functions.php:
|
968 |
#, php-format
|
969 |
msgid "Copied %1$s picture(s) to gallery: %2$s ."
|
970 |
msgstr ""
|
971 |
|
972 |
-
#: ../admin/functions.php:
|
973 |
msgid "The uploaded file exceeds the upload_max_filesize directive in php.ini"
|
974 |
msgstr ""
|
975 |
|
976 |
-
#: ../admin/functions.php:
|
977 |
msgid "The uploaded file exceeds the MAX_FILE_SIZE directive that was specified in the HTML form"
|
978 |
msgstr ""
|
979 |
|
980 |
-
#: ../admin/functions.php:
|
981 |
msgid "The uploaded file was only partially uploaded"
|
982 |
msgstr ""
|
983 |
|
984 |
-
#: ../admin/functions.php:
|
985 |
msgid "No file was uploaded"
|
986 |
msgstr ""
|
987 |
|
988 |
-
#: ../admin/functions.php:
|
989 |
msgid "Missing a temporary folder"
|
990 |
msgstr ""
|
991 |
|
992 |
-
#: ../admin/functions.php:
|
993 |
msgid "Failed to write file to disk"
|
994 |
msgstr ""
|
995 |
|
996 |
-
#: ../admin/functions.php:
|
997 |
msgid "File upload stopped by extension"
|
998 |
msgstr ""
|
999 |
|
1000 |
-
#: ../admin/functions.php:
|
1001 |
msgid "Unknown upload error"
|
1002 |
msgstr ""
|
1003 |
|
@@ -1005,15 +1010,15 @@ msgstr ""
|
|
1005 |
msgid "Sorry, NextGEN Gallery works only with a role called administrator"
|
1006 |
msgstr ""
|
1007 |
|
1008 |
-
#: ../admin/install.php:
|
1009 |
msgid "NextGEN Gallery : Tables could not created, please check your database settings"
|
1010 |
msgstr ""
|
1011 |
|
1012 |
-
#: ../admin/install.php:
|
1013 |
msgid "[Show as slideshow]"
|
1014 |
msgstr ""
|
1015 |
|
1016 |
-
#: ../admin/install.php:
|
1017 |
msgid "[Show picture list]"
|
1018 |
msgstr ""
|
1019 |
|
@@ -1028,10 +1033,19 @@ msgid "»"
|
|
1028 |
msgstr ""
|
1029 |
|
1030 |
#: ../admin/manage-galleries.php:62
|
1031 |
-
#: ../admin/manage-images.php:
|
1032 |
msgid "No images selected"
|
1033 |
msgstr ""
|
1034 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1035 |
#: ../admin/manage-galleries.php:79
|
1036 |
#, php-format
|
1037 |
msgid ""
|
@@ -1040,149 +1054,147 @@ msgid ""
|
|
1040 |
" 'Cancel' to stop, 'OK' to proceed."
|
1041 |
msgstr ""
|
1042 |
|
1043 |
-
#: ../admin/manage-galleries.php:
|
1044 |
-
|
1045 |
-
|
1046 |
-
|
1047 |
-
#: ../admin/manage-galleries.php:111
|
1048 |
-
#: ../admin/manage-galleries.php:114
|
1049 |
-
#: ../admin/manage-images.php:187
|
1050 |
-
#: ../admin/manage-images.php:190
|
1051 |
msgid "Search Images"
|
1052 |
msgstr ""
|
1053 |
|
1054 |
-
#: ../admin/manage-galleries.php:
|
1055 |
-
#: ../admin/manage-images.php:
|
1056 |
-
msgid "
|
1057 |
msgstr ""
|
1058 |
|
1059 |
-
#: ../admin/manage-galleries.php:
|
1060 |
-
#: ../admin/manage-images.php:
|
1061 |
-
#: ../admin/manage.php:
|
1062 |
-
#: ../admin/manage.php:
|
1063 |
msgid "Set watermark"
|
1064 |
msgstr ""
|
1065 |
|
1066 |
-
#: ../admin/manage-galleries.php:
|
1067 |
-
#: ../admin/manage-images.php:
|
1068 |
-
#: ../admin/manage.php:
|
1069 |
-
#: ../admin/manage.php:
|
1070 |
-
msgid "Resize images"
|
1071 |
-
msgstr ""
|
1072 |
-
|
1073 |
-
#: ../admin/manage-galleries.php:130
|
1074 |
-
#: ../admin/manage-images.php:306
|
1075 |
-
#: ../admin/manage.php:168
|
1076 |
-
#: ../admin/manage.php:261
|
1077 |
msgid "Import metadata"
|
1078 |
msgstr ""
|
1079 |
|
1080 |
-
#: ../admin/manage-galleries.php:
|
1081 |
-
#: ../admin/manage-images.php:
|
1082 |
-
#: ../admin/manage.php:
|
1083 |
-
#: ../admin/manage.php:
|
1084 |
msgid "Recover from backup"
|
1085 |
msgstr ""
|
1086 |
|
1087 |
-
#: ../admin/manage-galleries.php:
|
1088 |
-
#: ../admin/manage-images.php:
|
1089 |
msgid "Apply"
|
1090 |
msgstr ""
|
1091 |
|
1092 |
-
#: ../admin/manage-galleries.php:
|
1093 |
-
#: ../admin/manage-galleries.php:
|
1094 |
-
#: ../admin/manage-images.php:
|
1095 |
-
#: ../admin/manage-images.php:
|
1096 |
#, php-format
|
1097 |
msgid "Displaying %s–%s of %s"
|
1098 |
msgstr ""
|
1099 |
|
1100 |
-
#: ../admin/manage-galleries.php:
|
1101 |
-
|
1102 |
-
#: ../admin/manage-images.php:619
|
1103 |
-
msgid "ID"
|
1104 |
msgstr ""
|
1105 |
|
1106 |
-
#: ../admin/manage-galleries.php:
|
1107 |
-
#: ../admin/manage-
|
1108 |
-
|
1109 |
-
#: ../admin/manage-images.php:624
|
1110 |
-
msgid "Description"
|
1111 |
msgstr ""
|
1112 |
|
1113 |
-
#: ../admin/manage-galleries.php:
|
1114 |
-
#: ../admin/manage-
|
1115 |
-
|
1116 |
-
msgid "Author"
|
1117 |
msgstr ""
|
1118 |
|
1119 |
-
#: ../admin/manage-galleries.php:
|
1120 |
-
#: ../admin/manage-
|
1121 |
-
msgid "
|
1122 |
msgstr ""
|
1123 |
|
1124 |
-
#: ../admin/manage-galleries.php:
|
1125 |
-
#: ../admin/manage-
|
1126 |
-
msgid "
|
1127 |
msgstr ""
|
1128 |
|
1129 |
-
#: ../admin/manage-galleries.php:
|
1130 |
-
#: ../admin/manage-
|
1131 |
-
msgid "
|
1132 |
msgstr ""
|
1133 |
|
1134 |
-
#: ../admin/manage-galleries.php:
|
1135 |
-
|
|
|
1136 |
msgstr ""
|
1137 |
|
1138 |
-
#: ../admin/manage-galleries.php:
|
1139 |
-
|
|
|
1140 |
msgstr ""
|
1141 |
|
1142 |
-
#: ../admin/manage-galleries.php:
|
1143 |
-
#: ../admin/manage-images.php:
|
1144 |
-
msgid "
|
1145 |
msgstr ""
|
1146 |
|
1147 |
-
#: ../admin/manage-galleries.php:
|
1148 |
-
#: ../admin/manage-images.php:
|
1149 |
-
|
|
|
1150 |
msgstr ""
|
1151 |
|
1152 |
-
#: ../admin/manage-galleries.php:
|
1153 |
-
#: ../admin/manage-images.php:
|
1154 |
-
msgid "
|
1155 |
msgstr ""
|
1156 |
|
1157 |
-
#: ../admin/manage-galleries.php:
|
1158 |
-
|
1159 |
-
msgid "Width x height (in pixel)"
|
1160 |
msgstr ""
|
1161 |
|
1162 |
-
#: ../admin/manage-galleries.php:
|
1163 |
-
|
1164 |
-
|
|
|
|
|
|
|
|
|
|
|
1165 |
msgstr ""
|
1166 |
|
1167 |
-
#: ../admin/manage-
|
1168 |
-
|
1169 |
-
msgid "Set fix dimension"
|
1170 |
msgstr ""
|
1171 |
|
1172 |
-
#: ../admin/manage-
|
1173 |
-
|
1174 |
-
msgid "Ignore the aspect ratio, no portrait thumbnails"
|
1175 |
msgstr ""
|
1176 |
|
1177 |
-
#: ../admin/manage-images.php:
|
1178 |
-
msgid "
|
1179 |
msgstr ""
|
1180 |
|
1181 |
-
#: ../admin/manage-images.php:
|
1182 |
-
msgid "
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1183 |
msgstr ""
|
1184 |
|
1185 |
-
#: ../admin/manage-images.php:
|
1186 |
#, php-format
|
1187 |
msgid ""
|
1188 |
"You are about to start the bulk edit for %s images \n"
|
@@ -1190,270 +1202,280 @@ msgid ""
|
|
1190 |
" 'Cancel' to stop, 'OK' to proceed."
|
1191 |
msgstr ""
|
1192 |
|
1193 |
-
#: ../admin/manage-images.php:
|
1194 |
#, php-format
|
1195 |
msgid "Search results for “%s”"
|
1196 |
msgstr ""
|
1197 |
|
1198 |
-
#: ../admin/manage-images.php:
|
1199 |
msgid "Gallery settings"
|
1200 |
msgstr ""
|
1201 |
|
1202 |
-
#: ../admin/manage-images.php:
|
1203 |
msgid "Click here for more settings"
|
1204 |
msgstr ""
|
1205 |
|
1206 |
-
#: ../admin/manage-images.php:
|
1207 |
msgid "Preview image"
|
1208 |
msgstr ""
|
1209 |
|
1210 |
-
#: ../admin/manage-images.php:
|
1211 |
msgid "No Picture"
|
1212 |
msgstr ""
|
1213 |
|
1214 |
-
#: ../admin/manage-images.php:
|
1215 |
msgid "Path"
|
1216 |
msgstr ""
|
1217 |
|
1218 |
-
#: ../admin/manage-images.php:
|
1219 |
msgid "Create new page"
|
1220 |
msgstr ""
|
1221 |
|
1222 |
-
#: ../admin/manage-images.php:
|
1223 |
msgid "Main page (No parent)"
|
1224 |
msgstr ""
|
1225 |
|
1226 |
-
#: ../admin/manage-images.php:
|
1227 |
msgid "Add page"
|
1228 |
msgstr ""
|
1229 |
|
1230 |
-
#: ../admin/manage-images.php:
|
1231 |
msgid "Scan Folder for new images"
|
1232 |
msgstr ""
|
1233 |
|
1234 |
-
#: ../admin/manage-images.php:
|
1235 |
-
#: ../admin/manage-images.php:
|
1236 |
-
#: ../admin/manage-images.php:
|
1237 |
msgid "Save Changes"
|
1238 |
msgstr ""
|
1239 |
|
1240 |
-
#: ../admin/manage-images.php:
|
1241 |
msgid "Delete images"
|
1242 |
msgstr ""
|
1243 |
|
1244 |
-
#: ../admin/manage-images.php:
|
1245 |
msgid "Rotate images clockwise"
|
1246 |
msgstr ""
|
1247 |
|
1248 |
-
#: ../admin/manage-images.php:
|
1249 |
msgid "Rotate images counter-clockwise"
|
1250 |
msgstr ""
|
1251 |
|
1252 |
-
#: ../admin/manage-images.php:
|
1253 |
msgid "Copy to..."
|
1254 |
msgstr ""
|
1255 |
|
1256 |
-
#: ../admin/manage-images.php:
|
1257 |
msgid "Move to..."
|
1258 |
msgstr ""
|
1259 |
|
1260 |
-
#: ../admin/manage-images.php:
|
1261 |
msgid "Add tags"
|
1262 |
msgstr ""
|
1263 |
|
1264 |
-
#: ../admin/manage-images.php:
|
1265 |
-
msgid "Delete tags"
|
1266 |
-
msgstr ""
|
1267 |
-
|
1268 |
-
#: ../admin/manage-images.php:313
|
1269 |
msgid "Overwrite tags"
|
1270 |
msgstr ""
|
1271 |
|
1272 |
-
#: ../admin/manage-images.php:
|
1273 |
msgid "Sort gallery"
|
1274 |
msgstr ""
|
1275 |
|
1276 |
-
#: ../admin/manage-images.php:
|
1277 |
msgid "pixel"
|
1278 |
msgstr ""
|
1279 |
|
1280 |
-
#: ../admin/manage-images.php:
|
1281 |
#, php-format
|
1282 |
msgid "View \"%s\""
|
1283 |
msgstr ""
|
1284 |
|
1285 |
-
#: ../admin/manage-images.php:
|
1286 |
msgid "View"
|
1287 |
msgstr ""
|
1288 |
|
1289 |
-
#: ../admin/manage-images.php:
|
1290 |
msgid "Show Meta data"
|
1291 |
msgstr ""
|
1292 |
|
1293 |
-
#: ../admin/manage-images.php:
|
1294 |
msgid "Meta"
|
1295 |
msgstr ""
|
1296 |
|
1297 |
-
#: ../admin/manage-images.php:
|
1298 |
msgid "Customize thumbnail"
|
1299 |
msgstr ""
|
1300 |
|
1301 |
-
#: ../admin/manage-images.php:
|
1302 |
msgid "Edit thumb"
|
1303 |
msgstr ""
|
1304 |
|
1305 |
-
#: ../admin/manage-images.php:
|
1306 |
msgid "Rotate"
|
1307 |
msgstr ""
|
1308 |
|
1309 |
-
#: ../admin/manage-images.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1310 |
msgid "Recover"
|
1311 |
msgstr ""
|
1312 |
|
1313 |
-
#: ../admin/manage-images.php:
|
1314 |
#, php-format
|
1315 |
msgid "Recover \"%s\" ?"
|
1316 |
msgstr ""
|
1317 |
|
1318 |
-
#: ../admin/manage-images.php:
|
1319 |
#, php-format
|
1320 |
msgid "Delete \"%s\" ?"
|
1321 |
msgstr ""
|
1322 |
|
1323 |
-
#: ../admin/manage-images.php:
|
1324 |
msgid "Enter the tags"
|
1325 |
msgstr ""
|
1326 |
|
1327 |
-
#: ../admin/manage-images.php:
|
1328 |
msgid "Select the destination gallery:"
|
1329 |
msgstr ""
|
1330 |
|
1331 |
-
#: ../admin/manage-images.php:
|
1332 |
msgid "Thumbnail"
|
1333 |
msgstr ""
|
1334 |
|
1335 |
-
#: ../admin/manage-images.php:
|
1336 |
-
#: ../admin/manage-sort.php:
|
1337 |
msgid "Filename"
|
1338 |
msgstr ""
|
1339 |
|
1340 |
-
#: ../admin/manage-images.php:
|
1341 |
msgid "Alt & Title Text"
|
1342 |
msgstr ""
|
1343 |
|
1344 |
-
#: ../admin/manage-images.php:
|
1345 |
msgid "Tags (comma separated list)"
|
1346 |
msgstr ""
|
1347 |
|
1348 |
-
#: ../admin/manage-images.php:
|
1349 |
msgid "exclude"
|
1350 |
msgstr ""
|
1351 |
|
1352 |
-
#: ../admin/manage-sort.php:
|
1353 |
msgid "Sort order changed"
|
1354 |
msgstr ""
|
1355 |
|
1356 |
-
#: ../admin/manage-sort.php:
|
1357 |
msgid "Sort Gallery"
|
1358 |
msgstr ""
|
1359 |
|
1360 |
-
#: ../admin/manage-sort.php:
|
1361 |
msgid "Update Sort Order"
|
1362 |
msgstr ""
|
1363 |
|
1364 |
-
#: ../admin/manage-sort.php:
|
1365 |
msgid "Back to gallery"
|
1366 |
msgstr ""
|
1367 |
|
1368 |
-
#: ../admin/manage-sort.php:
|
1369 |
msgid "Presort"
|
1370 |
msgstr ""
|
1371 |
|
1372 |
-
#: ../admin/manage-sort.php:
|
1373 |
msgid "Unsorted"
|
1374 |
msgstr ""
|
1375 |
|
1376 |
-
#: ../admin/manage-sort.php:
|
1377 |
msgid "Image ID"
|
1378 |
msgstr ""
|
1379 |
|
1380 |
-
#: ../admin/manage-sort.php:
|
1381 |
msgid "Alt/Title text"
|
1382 |
msgstr ""
|
1383 |
|
1384 |
-
#: ../admin/manage-sort.php:
|
1385 |
msgid "Date/Time"
|
1386 |
msgstr ""
|
1387 |
|
1388 |
-
#: ../admin/manage-sort.php:
|
1389 |
msgid "Ascending"
|
1390 |
msgstr ""
|
1391 |
|
1392 |
-
#: ../admin/manage-sort.php:
|
1393 |
msgid "Descending"
|
1394 |
msgstr ""
|
1395 |
|
1396 |
-
#: ../admin/manage.php:
|
1397 |
-
|
1398 |
-
msgid "deleted successfully"
|
1399 |
msgstr ""
|
1400 |
|
1401 |
-
#: ../admin/manage.php:
|
1402 |
-
msgid "
|
1403 |
msgstr ""
|
1404 |
|
1405 |
-
#: ../admin/manage.php:
|
1406 |
-
#: ../admin/manage.php:
|
1407 |
msgid "Operation successful. Please clear your browser cache."
|
1408 |
msgstr ""
|
1409 |
|
1410 |
-
#: ../admin/manage.php:
|
1411 |
-
|
|
|
|
|
|
|
|
|
1412 |
msgid "Rotate images"
|
1413 |
msgstr ""
|
1414 |
|
1415 |
-
#: ../admin/manage.php:
|
1416 |
msgid "Pictures deleted successfully "
|
1417 |
msgstr ""
|
1418 |
|
1419 |
-
#: ../admin/manage.php:
|
1420 |
msgid "Tags changed"
|
1421 |
msgstr ""
|
1422 |
|
1423 |
-
#: ../admin/manage.php:
|
1424 |
msgid "Update successful"
|
1425 |
msgstr ""
|
1426 |
|
1427 |
-
#: ../admin/manage.php:
|
1428 |
msgid "New gallery page ID"
|
1429 |
msgstr ""
|
1430 |
|
1431 |
-
#: ../admin/manage.php:
|
1432 |
msgid "created"
|
1433 |
msgstr ""
|
1434 |
|
1435 |
-
#: ../admin/
|
1436 |
-
|
|
|
|
|
|
|
1437 |
msgid "No gallery"
|
1438 |
msgstr ""
|
1439 |
|
1440 |
-
#: ../admin/media-upload.php:
|
1441 |
msgid "Select »"
|
1442 |
msgstr ""
|
1443 |
|
1444 |
-
#: ../admin/media-upload.php:
|
1445 |
msgid "Show"
|
1446 |
msgstr ""
|
1447 |
|
1448 |
-
#: ../admin/media-upload.php:
|
1449 |
msgid "Hide"
|
1450 |
msgstr ""
|
1451 |
|
1452 |
-
#: ../admin/media-upload.php:
|
1453 |
msgid "Image ID:"
|
1454 |
msgstr ""
|
1455 |
|
1456 |
-
#: ../admin/media-upload.php:
|
1457 |
msgid "Save all changes"
|
1458 |
msgstr ""
|
1459 |
|
@@ -1507,7 +1529,7 @@ msgid "Send a gift to show your appreciation."
|
|
1507 |
msgstr ""
|
1508 |
|
1509 |
#: ../admin/overview.php:121
|
1510 |
-
msgid "Help
|
1511 |
msgstr ""
|
1512 |
|
1513 |
#: ../admin/overview.php:140
|
@@ -1549,12 +1571,6 @@ msgstr ""
|
|
1549 |
msgid "At a Glance"
|
1550 |
msgstr ""
|
1551 |
|
1552 |
-
#: ../admin/overview.php:284
|
1553 |
-
msgid "Image"
|
1554 |
-
msgid_plural "Images"
|
1555 |
-
msgstr[0] ""
|
1556 |
-
msgstr[1] ""
|
1557 |
-
|
1558 |
#: ../admin/overview.php:305
|
1559 |
msgid "Upload pictures"
|
1560 |
msgstr ""
|
@@ -1718,6 +1734,46 @@ msgstr ""
|
|
1718 |
msgid "Install"
|
1719 |
msgstr ""
|
1720 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1721 |
#: ../admin/roles.php:22
|
1722 |
msgid "Updated capabilities"
|
1723 |
msgstr ""
|
@@ -1727,7 +1783,7 @@ msgid "Roles / capabilities"
|
|
1727 |
msgstr ""
|
1728 |
|
1729 |
#: ../admin/roles.php:29
|
1730 |
-
msgid "Select the lowest role which should be able to access the
|
1731 |
msgstr ""
|
1732 |
|
1733 |
#: ../admin/roles.php:30
|
@@ -1758,10 +1814,6 @@ msgstr ""
|
|
1758 |
msgid "Manage tags"
|
1759 |
msgstr ""
|
1760 |
|
1761 |
-
#: ../admin/roles.php:59
|
1762 |
-
msgid "Edit Album"
|
1763 |
-
msgstr ""
|
1764 |
-
|
1765 |
#: ../admin/roles.php:63
|
1766 |
msgid "Change style"
|
1767 |
msgstr ""
|
@@ -1798,588 +1850,593 @@ msgstr ""
|
|
1798 |
msgid "Flip horizontally"
|
1799 |
msgstr ""
|
1800 |
|
1801 |
-
#: ../admin/settings.php:
|
1802 |
msgid "Cache cleared"
|
1803 |
msgstr ""
|
1804 |
|
1805 |
-
#: ../admin/settings.php:
|
1806 |
-
#: ../admin/settings.php:
|
1807 |
msgid "General Options"
|
1808 |
msgstr ""
|
1809 |
|
1810 |
-
#: ../admin/settings.php:
|
1811 |
-
#: ../admin/settings.php:
|
1812 |
msgid "Thumbnails"
|
1813 |
msgstr ""
|
1814 |
|
1815 |
-
#: ../admin/settings.php:
|
1816 |
msgid "Images"
|
1817 |
msgstr ""
|
1818 |
|
1819 |
-
#: ../admin/settings.php:
|
1820 |
-
#: ../admin/settings.php:
|
1821 |
msgid "Effects"
|
1822 |
msgstr ""
|
1823 |
|
1824 |
-
#: ../admin/settings.php:
|
1825 |
-
#: ../admin/settings.php:
|
1826 |
-
#: ../admin/tinymce/window.php:
|
1827 |
msgid "Watermark"
|
1828 |
msgstr ""
|
1829 |
|
1830 |
-
#: ../admin/settings.php:
|
1831 |
-
#: ../admin/settings.php:
|
1832 |
-
#: ../admin/settings.php:
|
1833 |
-
#: ../admin/tinymce/window.php:
|
1834 |
msgid "Slideshow"
|
1835 |
msgstr ""
|
1836 |
|
1837 |
-
#: ../admin/settings.php:
|
1838 |
-
#: ../admin/wpmu.php:
|
1839 |
msgid "Gallery path"
|
1840 |
msgstr ""
|
1841 |
|
1842 |
-
#: ../admin/settings.php:
|
1843 |
msgid "This is the default path for all galleries"
|
1844 |
msgstr ""
|
1845 |
|
1846 |
-
#: ../admin/settings.php:
|
1847 |
msgid "Delete image files"
|
1848 |
msgstr ""
|
1849 |
|
1850 |
-
#: ../admin/settings.php:
|
1851 |
msgid "Delete files, when removing a gallery in the database"
|
1852 |
msgstr ""
|
1853 |
|
1854 |
-
#: ../admin/settings.php:
|
1855 |
msgid "Activate permalinks"
|
1856 |
msgstr ""
|
1857 |
|
1858 |
-
#: ../admin/settings.php:
|
1859 |
msgid "When you activate this option, you need to update your permalink structure one time."
|
1860 |
msgstr ""
|
1861 |
|
1862 |
-
#: ../admin/settings.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1863 |
msgid "Select graphic library"
|
1864 |
msgstr ""
|
1865 |
|
1866 |
-
#: ../admin/settings.php:
|
1867 |
msgid "GD Library"
|
1868 |
msgstr ""
|
1869 |
|
1870 |
-
#: ../admin/settings.php:
|
1871 |
msgid "ImageMagick (Experimental). Path to the library :"
|
1872 |
msgstr ""
|
1873 |
|
1874 |
-
#: ../admin/settings.php:
|
1875 |
msgid "Activate Media RSS feed"
|
1876 |
msgstr ""
|
1877 |
|
1878 |
-
#: ../admin/settings.php:
|
1879 |
msgid "A RSS feed will be added to you blog header. Useful for CoolIris/PicLens"
|
1880 |
msgstr ""
|
1881 |
|
1882 |
-
#: ../admin/settings.php:
|
1883 |
msgid "Activate PicLens/CoolIris support"
|
1884 |
msgstr ""
|
1885 |
|
1886 |
-
#: ../admin/settings.php:
|
1887 |
msgid "When you activate this option, some javascript is added to your site footer. Make sure that wp_footer is called in your theme."
|
1888 |
msgstr ""
|
1889 |
|
1890 |
-
#: ../admin/settings.php:
|
1891 |
msgid "Tags / Categories"
|
1892 |
msgstr ""
|
1893 |
|
1894 |
-
#: ../admin/settings.php:
|
1895 |
msgid "Activate related images"
|
1896 |
msgstr ""
|
1897 |
|
1898 |
-
#: ../admin/settings.php:
|
1899 |
msgid "This option will append related images to every post"
|
1900 |
msgstr ""
|
1901 |
|
1902 |
-
#: ../admin/settings.php:
|
1903 |
msgid "Match with"
|
1904 |
msgstr ""
|
1905 |
|
1906 |
-
#: ../admin/settings.php:
|
1907 |
msgid "Categories"
|
1908 |
msgstr ""
|
1909 |
|
1910 |
-
#: ../admin/settings.php:
|
1911 |
msgid "Max. number of images"
|
1912 |
msgstr ""
|
1913 |
|
1914 |
-
#: ../admin/settings.php:
|
1915 |
msgid "0 will show all images"
|
1916 |
msgstr ""
|
1917 |
|
1918 |
-
#: ../admin/settings.php:
|
1919 |
-
#: ../admin/settings.php:
|
1920 |
-
#: ../admin/settings.php:
|
1921 |
-
#: ../admin/settings.php:
|
1922 |
-
#: ../admin/settings.php:
|
1923 |
-
#: ../admin/settings.php:
|
1924 |
msgid "More settings"
|
1925 |
msgstr ""
|
1926 |
|
1927 |
-
#: ../admin/settings.php:
|
1928 |
msgid "Thumbnail settings"
|
1929 |
msgstr ""
|
1930 |
|
1931 |
-
#: ../admin/settings.php:
|
1932 |
msgid "Please note : If you change the settings, you need to recreate the thumbnails under -> Manage Gallery ."
|
1933 |
msgstr ""
|
1934 |
|
1935 |
-
#: ../admin/settings.php:
|
1936 |
msgid "Thumbnail quality"
|
1937 |
msgstr ""
|
1938 |
|
1939 |
-
#: ../admin/settings.php:
|
1940 |
msgid "Image settings"
|
1941 |
msgstr ""
|
1942 |
|
1943 |
-
#: ../admin/settings.php:
|
1944 |
msgid "Resize Images"
|
1945 |
msgstr ""
|
1946 |
|
1947 |
-
#: ../admin/settings.php:
|
1948 |
msgid "Image quality"
|
1949 |
msgstr ""
|
1950 |
|
1951 |
-
#: ../admin/settings.php:
|
1952 |
msgid "Backup original images"
|
1953 |
msgstr ""
|
1954 |
|
1955 |
-
#: ../admin/settings.php:
|
1956 |
msgid "Creates a backup for inserted images"
|
1957 |
msgstr ""
|
1958 |
|
1959 |
-
#: ../admin/settings.php:
|
1960 |
msgid "Automatically resize"
|
1961 |
msgstr ""
|
1962 |
|
1963 |
-
#: ../admin/settings.php:
|
1964 |
msgid "Automatically resize images on upload."
|
1965 |
msgstr ""
|
1966 |
|
1967 |
-
#: ../admin/settings.php:
|
1968 |
msgid "Single picture"
|
1969 |
msgstr ""
|
1970 |
|
1971 |
-
#: ../admin/settings.php:
|
1972 |
msgid "Cache single pictures"
|
1973 |
msgstr ""
|
1974 |
|
1975 |
-
#: ../admin/settings.php:
|
1976 |
msgid "Creates a file for each singlepic settings. Reduce the CPU load"
|
1977 |
msgstr ""
|
1978 |
|
1979 |
-
#: ../admin/settings.php:
|
1980 |
msgid "Clear cache folder"
|
1981 |
msgstr ""
|
1982 |
|
1983 |
-
#: ../admin/settings.php:
|
1984 |
-
msgid "Proceed now"
|
1985 |
-
msgstr ""
|
1986 |
-
|
1987 |
-
#: ../admin/settings.php:374
|
1988 |
msgid "Deactivate gallery page link"
|
1989 |
msgstr ""
|
1990 |
|
1991 |
-
#: ../admin/settings.php:
|
1992 |
msgid "The album will not link to a gallery subpage. The gallery is shown on the same page."
|
1993 |
msgstr ""
|
1994 |
|
1995 |
-
#: ../admin/settings.php:
|
1996 |
msgid "Number of images per page"
|
1997 |
msgstr ""
|
1998 |
|
1999 |
-
#: ../admin/settings.php:
|
2000 |
msgid "0 will disable pagination, all images on one page"
|
2001 |
msgstr ""
|
2002 |
|
2003 |
-
#: ../admin/settings.php:
|
2004 |
msgid "Number of columns"
|
2005 |
msgstr ""
|
2006 |
|
2007 |
-
#: ../admin/settings.php:
|
2008 |
msgid "0 will display as much as possible based on the width of your theme. Setting normally only required for captions below the images"
|
2009 |
msgstr ""
|
2010 |
|
2011 |
-
#: ../admin/settings.php:
|
2012 |
msgid "Integrate slideshow"
|
2013 |
msgstr ""
|
2014 |
|
2015 |
-
#: ../admin/settings.php:
|
2016 |
msgid "Show first"
|
2017 |
msgstr ""
|
2018 |
|
2019 |
-
#: ../admin/settings.php:
|
2020 |
msgid "Show ImageBrowser"
|
2021 |
msgstr ""
|
2022 |
|
2023 |
-
#: ../admin/settings.php:
|
2024 |
msgid "The gallery will open the ImageBrowser instead the effect."
|
2025 |
msgstr ""
|
2026 |
|
2027 |
-
#: ../admin/settings.php:
|
2028 |
msgid "Add hidden images"
|
2029 |
msgstr ""
|
2030 |
|
2031 |
-
#: ../admin/settings.php:
|
2032 |
-
msgid "If pagination is used, this option will still show all images in the modal window (Thickbox, Lightbox etc.). Note : This
|
2033 |
msgstr ""
|
2034 |
|
2035 |
-
#: ../admin/settings.php:
|
2036 |
msgid "Enable AJAX pagination"
|
2037 |
msgstr ""
|
2038 |
|
2039 |
-
#: ../admin/settings.php:
|
2040 |
-
msgid "Browse images without reload the page. Note :
|
2041 |
msgstr ""
|
2042 |
|
2043 |
-
#: ../admin/settings.php:
|
2044 |
msgid "Sort options"
|
2045 |
msgstr ""
|
2046 |
|
2047 |
-
#: ../admin/settings.php:
|
2048 |
msgid "Sort thumbnails"
|
2049 |
msgstr ""
|
2050 |
|
2051 |
-
#: ../admin/settings.php:
|
2052 |
msgid "Custom order"
|
2053 |
msgstr ""
|
2054 |
|
2055 |
-
#: ../admin/settings.php:
|
2056 |
msgid "File name"
|
2057 |
msgstr ""
|
2058 |
|
2059 |
-
#: ../admin/settings.php:
|
2060 |
msgid "Alt / Title text"
|
2061 |
msgstr ""
|
2062 |
|
2063 |
-
#: ../admin/settings.php:
|
2064 |
msgid "Date / Time"
|
2065 |
msgstr ""
|
2066 |
|
2067 |
-
#: ../admin/settings.php:
|
2068 |
msgid "Sort direction"
|
2069 |
msgstr ""
|
2070 |
|
2071 |
-
#: ../admin/settings.php:
|
2072 |
msgid "Here you can select the thumbnail effect, NextGEN Gallery will integrate the required HTML code in the images. Please note that only the Shutter and Thickbox effect will automatic added to your theme."
|
2073 |
msgstr ""
|
2074 |
|
2075 |
-
#: ../admin/settings.php:
|
2076 |
msgid "With the placeholder"
|
2077 |
msgstr ""
|
2078 |
|
2079 |
-
#: ../admin/settings.php:
|
2080 |
msgid "you can activate a navigation through the images (depend on the effect). Change the code line only , when you use a different thumbnail effect or you know what you do."
|
2081 |
msgstr ""
|
2082 |
|
2083 |
-
#: ../admin/settings.php:
|
2084 |
msgid "JavaScript Thumbnail effect"
|
2085 |
msgstr ""
|
2086 |
|
2087 |
-
#: ../admin/settings.php:
|
2088 |
-
msgid "None"
|
2089 |
-
msgstr ""
|
2090 |
-
|
2091 |
-
#: ../admin/settings.php:464
|
2092 |
msgid "Thickbox"
|
2093 |
msgstr ""
|
2094 |
|
2095 |
-
#: ../admin/settings.php:
|
2096 |
msgid "Lightbox"
|
2097 |
msgstr ""
|
2098 |
|
2099 |
-
#: ../admin/settings.php:
|
2100 |
msgid "Highslide"
|
2101 |
msgstr ""
|
2102 |
|
2103 |
-
#: ../admin/settings.php:
|
2104 |
msgid "Shutter"
|
2105 |
msgstr ""
|
2106 |
|
2107 |
-
#: ../admin/settings.php:
|
2108 |
msgid "Custom"
|
2109 |
msgstr ""
|
2110 |
|
2111 |
-
#: ../admin/settings.php:
|
2112 |
msgid "Link Code line"
|
2113 |
msgstr ""
|
2114 |
|
2115 |
-
#: ../admin/settings.php:
|
2116 |
msgid "Please note : You can only activate the watermark under -> Manage Gallery . This action cannot be undone."
|
2117 |
msgstr ""
|
2118 |
|
2119 |
-
#: ../admin/settings.php:
|
2120 |
msgid "Preview"
|
2121 |
msgstr ""
|
2122 |
|
2123 |
-
#: ../admin/settings.php:
|
2124 |
-
#: ../admin/settings.php:
|
2125 |
msgid "Position"
|
2126 |
msgstr ""
|
2127 |
|
2128 |
-
#: ../admin/settings.php:
|
2129 |
msgid "Offset"
|
2130 |
msgstr ""
|
2131 |
|
2132 |
-
#: ../admin/settings.php:
|
2133 |
msgid "Use image as watermark"
|
2134 |
msgstr ""
|
2135 |
|
2136 |
-
#: ../admin/settings.php:
|
2137 |
msgid "URL to file"
|
2138 |
msgstr ""
|
2139 |
|
2140 |
-
#: ../admin/settings.php:
|
2141 |
msgid "The accessing of URL files is disabled at your server (allow_url_fopen)"
|
2142 |
msgstr ""
|
2143 |
|
2144 |
-
#: ../admin/settings.php:
|
2145 |
msgid "Use text as watermark"
|
2146 |
msgstr ""
|
2147 |
|
2148 |
-
#: ../admin/settings.php:
|
2149 |
msgid "Font"
|
2150 |
msgstr ""
|
2151 |
|
2152 |
-
#: ../admin/settings.php:
|
2153 |
msgid "This function will not work, cause you need the FreeType library"
|
2154 |
msgstr ""
|
2155 |
|
2156 |
-
#: ../admin/settings.php:
|
2157 |
msgid "You can upload more fonts in the folder <strong>nggallery/fonts</strong>"
|
2158 |
msgstr ""
|
2159 |
|
2160 |
-
#: ../admin/settings.php:
|
2161 |
msgid "Size"
|
2162 |
msgstr ""
|
2163 |
|
2164 |
-
#: ../admin/settings.php:
|
2165 |
msgid "Color"
|
2166 |
msgstr ""
|
2167 |
|
2168 |
-
#: ../admin/settings.php:
|
2169 |
msgid "(hex w/o #)"
|
2170 |
msgstr ""
|
2171 |
|
2172 |
-
#: ../admin/settings.php:
|
2173 |
msgid "Text"
|
2174 |
msgstr ""
|
2175 |
|
2176 |
-
#: ../admin/settings.php:
|
2177 |
msgid "Opaque"
|
2178 |
msgstr ""
|
2179 |
|
2180 |
-
#: ../admin/settings.php:
|
2181 |
msgid "Default size (W x H)"
|
2182 |
msgstr ""
|
2183 |
|
2184 |
-
#: ../admin/settings.php:
|
2185 |
msgid "Duration time"
|
2186 |
msgstr ""
|
2187 |
|
2188 |
-
#: ../admin/settings.php:
|
2189 |
msgid "sec."
|
2190 |
msgstr ""
|
2191 |
|
2192 |
-
#: ../admin/settings.php:
|
2193 |
-
#: ../admin/settings.php:
|
2194 |
msgid "Transition / Fade effect"
|
2195 |
msgstr ""
|
2196 |
|
2197 |
-
#: ../admin/settings.php:
|
2198 |
-
#: ../admin/settings.php:
|
2199 |
msgid "fade"
|
2200 |
msgstr ""
|
2201 |
|
2202 |
-
#: ../admin/settings.php:
|
2203 |
msgid "blindX"
|
2204 |
msgstr ""
|
2205 |
|
2206 |
-
#: ../admin/settings.php:
|
2207 |
msgid "cover"
|
2208 |
msgstr ""
|
2209 |
|
2210 |
-
#: ../admin/settings.php:
|
2211 |
msgid "scrollUp"
|
2212 |
msgstr ""
|
2213 |
|
2214 |
-
#: ../admin/settings.php:
|
2215 |
msgid "scrollDown"
|
2216 |
msgstr ""
|
2217 |
|
2218 |
-
#: ../admin/settings.php:
|
2219 |
msgid "shuffle"
|
2220 |
msgstr ""
|
2221 |
|
2222 |
-
#: ../admin/settings.php:
|
2223 |
msgid "toss"
|
2224 |
msgstr ""
|
2225 |
|
2226 |
-
#: ../admin/settings.php:
|
2227 |
msgid "wipe"
|
2228 |
msgstr ""
|
2229 |
|
2230 |
-
#: ../admin/settings.php:
|
2231 |
msgid "See here for more information about the effects :"
|
2232 |
msgstr ""
|
2233 |
|
2234 |
-
#: ../admin/settings.php:
|
2235 |
msgid "Settings for the JW Image Rotator"
|
2236 |
msgstr ""
|
2237 |
|
2238 |
-
#: ../admin/settings.php:
|
2239 |
msgid "The settings are only used in the JW Image Rotator Version"
|
2240 |
msgstr ""
|
2241 |
|
2242 |
-
#: ../admin/settings.php:
|
2243 |
msgid "See more information for the Flash Player on the web page"
|
2244 |
msgstr ""
|
2245 |
|
2246 |
-
#: ../admin/settings.php:
|
2247 |
msgid "The path to imagerotator.swf is not defined, the slideshow will not work."
|
2248 |
msgstr ""
|
2249 |
|
2250 |
-
#: ../admin/settings.php:
|
2251 |
msgid "If you would like to use the JW Image Rotatator, please download the player <a href=\"http://www.longtailvideo.com/players/jw-image-rotator/\" target=\"_blank\" >here</a> and upload it to your Upload folder (Default is wp-content/uploads)."
|
2252 |
msgstr ""
|
2253 |
|
2254 |
-
#: ../admin/settings.php:
|
2255 |
msgid "Enable flash slideshow"
|
2256 |
msgstr ""
|
2257 |
|
2258 |
-
#: ../admin/settings.php:
|
2259 |
-
msgid "Integrate the flash based
|
2260 |
msgstr ""
|
2261 |
|
2262 |
-
#: ../admin/settings.php:
|
2263 |
msgid "Path to the Imagerotator (URL)"
|
2264 |
msgstr ""
|
2265 |
|
2266 |
-
#: ../admin/settings.php:
|
2267 |
msgid "Search now"
|
2268 |
msgstr ""
|
2269 |
|
2270 |
-
#: ../admin/settings.php:
|
2271 |
-
msgid "Press the button to search
|
2272 |
msgstr ""
|
2273 |
|
2274 |
-
#: ../admin/settings.php:
|
2275 |
msgid "Shuffle mode"
|
2276 |
msgstr ""
|
2277 |
|
2278 |
-
#: ../admin/settings.php:
|
2279 |
msgid "Show next image on click"
|
2280 |
msgstr ""
|
2281 |
|
2282 |
-
#: ../admin/settings.php:
|
2283 |
msgid "Show navigation bar"
|
2284 |
msgstr ""
|
2285 |
|
2286 |
-
#: ../admin/settings.php:
|
2287 |
msgid "Show loading icon"
|
2288 |
msgstr ""
|
2289 |
|
2290 |
-
#: ../admin/settings.php:
|
2291 |
msgid "Use watermark logo"
|
2292 |
msgstr ""
|
2293 |
|
2294 |
-
#: ../admin/settings.php:
|
2295 |
msgid "You can change the logo at the watermark settings"
|
2296 |
msgstr ""
|
2297 |
|
2298 |
-
#: ../admin/settings.php:
|
2299 |
msgid "Stretch image"
|
2300 |
msgstr ""
|
2301 |
|
2302 |
-
#: ../admin/settings.php:
|
2303 |
msgid "true"
|
2304 |
msgstr ""
|
2305 |
|
2306 |
-
#: ../admin/settings.php:
|
2307 |
msgid "false"
|
2308 |
msgstr ""
|
2309 |
|
2310 |
-
#: ../admin/settings.php:
|
2311 |
msgid "fit"
|
2312 |
msgstr ""
|
2313 |
|
2314 |
-
#: ../admin/settings.php:
|
2315 |
msgid "none"
|
2316 |
msgstr ""
|
2317 |
|
2318 |
-
#: ../admin/settings.php:
|
2319 |
msgid "bgfade"
|
2320 |
msgstr ""
|
2321 |
|
2322 |
-
#: ../admin/settings.php:
|
2323 |
msgid "slowfade"
|
2324 |
msgstr ""
|
2325 |
|
2326 |
-
#: ../admin/settings.php:
|
2327 |
msgid "circles"
|
2328 |
msgstr ""
|
2329 |
|
2330 |
-
#: ../admin/settings.php:
|
2331 |
msgid "bubbles"
|
2332 |
msgstr ""
|
2333 |
|
2334 |
-
#: ../admin/settings.php:
|
2335 |
msgid "blocks"
|
2336 |
msgstr ""
|
2337 |
|
2338 |
-
#: ../admin/settings.php:
|
2339 |
msgid "fluids"
|
2340 |
msgstr ""
|
2341 |
|
2342 |
-
#: ../admin/settings.php:
|
2343 |
msgid "flash"
|
2344 |
msgstr ""
|
2345 |
|
2346 |
-
#: ../admin/settings.php:
|
2347 |
msgid "lines"
|
2348 |
msgstr ""
|
2349 |
|
2350 |
-
#: ../admin/settings.php:
|
2351 |
msgid "random"
|
2352 |
msgstr ""
|
2353 |
|
2354 |
-
#: ../admin/settings.php:
|
2355 |
msgid "Use slow zooming effect"
|
2356 |
msgstr ""
|
2357 |
|
2358 |
-
#: ../admin/settings.php:
|
2359 |
msgid "Background Color"
|
2360 |
msgstr ""
|
2361 |
|
2362 |
-
#: ../admin/settings.php:
|
2363 |
msgid "Texts / Buttons Color"
|
2364 |
msgstr ""
|
2365 |
|
2366 |
-
#: ../admin/settings.php:
|
2367 |
msgid "Rollover / Active Color"
|
2368 |
msgstr ""
|
2369 |
|
2370 |
-
#: ../admin/settings.php:
|
2371 |
msgid "Screen Color"
|
2372 |
msgstr ""
|
2373 |
|
2374 |
-
#: ../admin/settings.php:
|
2375 |
msgid "Background music (URL)"
|
2376 |
msgstr ""
|
2377 |
|
2378 |
-
#: ../admin/settings.php:
|
2379 |
msgid "Try XHTML validation (with CDATA)"
|
2380 |
msgstr ""
|
2381 |
|
2382 |
-
#: ../admin/settings.php:
|
2383 |
msgid "Important : Could causes problem at some browser. Please recheck your page."
|
2384 |
msgstr ""
|
2385 |
|
@@ -2645,209 +2702,250 @@ msgstr ""
|
|
2645 |
msgid "Slug(s) to set:"
|
2646 |
msgstr ""
|
2647 |
|
2648 |
-
#: ../admin/upgrade.php:
|
2649 |
msgid "Upgrade database structure..."
|
2650 |
msgstr ""
|
2651 |
|
2652 |
-
#: ../admin/upgrade.php:
|
2653 |
-
#: ../admin/upgrade.php:115
|
2654 |
#: ../admin/upgrade.php:122
|
2655 |
-
#: ../admin/upgrade.php:
|
2656 |
-
#: ../admin/upgrade.php:
|
|
|
2657 |
msgid "finished"
|
2658 |
msgstr ""
|
2659 |
|
2660 |
-
#: ../admin/upgrade.php:
|
2661 |
msgid "Update file structure..."
|
2662 |
msgstr ""
|
2663 |
|
2664 |
-
#: ../admin/upgrade.php:
|
2665 |
msgid "Import date and time information..."
|
2666 |
msgstr ""
|
2667 |
|
2668 |
-
#: ../admin/upgrade.php:
|
2669 |
msgid "Move imagerotator to new location..."
|
2670 |
msgstr ""
|
2671 |
|
2672 |
-
#: ../admin/upgrade.php:
|
2673 |
msgid "Update settings..."
|
2674 |
msgstr ""
|
2675 |
|
2676 |
-
#: ../admin/upgrade.php:
|
2677 |
msgid "Updated widget structure. If you used NextGEN Widgets, you need to setup them again..."
|
2678 |
msgstr ""
|
2679 |
|
2680 |
-
#: ../admin/upgrade.php:
|
2681 |
msgid "Updated options."
|
2682 |
msgstr ""
|
2683 |
|
2684 |
-
#: ../admin/upgrade.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2685 |
msgid "Could not find NextGEN Gallery database tables, upgrade failed !"
|
2686 |
msgstr ""
|
2687 |
|
2688 |
-
#: ../admin/upgrade.php:
|
2689 |
msgid "Some folders/files could not renamed, please recheck the permission and rescan the folder in the manage gallery section."
|
2690 |
msgstr ""
|
2691 |
|
2692 |
-
#: ../admin/upgrade.php:
|
2693 |
msgid "Rename failed"
|
2694 |
msgstr ""
|
2695 |
|
2696 |
-
#: ../admin/upgrade.php:
|
2697 |
-
#: ../admin/upgrade.php:
|
2698 |
msgid "Upgrade NextGEN Gallery"
|
2699 |
msgstr ""
|
2700 |
|
2701 |
-
#: ../admin/upgrade.php:
|
2702 |
msgid "The script detect that you upgrade from a older version."
|
2703 |
msgstr ""
|
2704 |
|
2705 |
-
#: ../admin/upgrade.php:
|
2706 |
msgid "Your database tables for NextGEN Gallery is out-of-date, and must be upgraded before you can continue."
|
2707 |
msgstr ""
|
2708 |
|
2709 |
-
#: ../admin/upgrade.php:
|
2710 |
msgid "If you would like to downgrade later, please make first a complete backup of your database and the images."
|
2711 |
msgstr ""
|
2712 |
|
2713 |
-
#: ../admin/upgrade.php:
|
2714 |
msgid "The upgrade process may take a while, so please be patient."
|
2715 |
msgstr ""
|
2716 |
|
2717 |
-
#: ../admin/upgrade.php:
|
2718 |
msgid "Start upgrade now"
|
2719 |
msgstr ""
|
2720 |
|
2721 |
-
#: ../admin/upgrade.php:
|
2722 |
msgid "Upgrade finished..."
|
2723 |
msgstr ""
|
2724 |
|
2725 |
-
#: ../admin/upgrade.php:
|
2726 |
msgid "Continue"
|
2727 |
msgstr ""
|
2728 |
|
2729 |
-
#: ../admin/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2730 |
msgid "Update successfully"
|
2731 |
msgstr ""
|
2732 |
|
2733 |
-
#: ../admin/wpmu.php:
|
2734 |
-
|
|
|
|
|
|
|
|
|
|
|
2735 |
msgstr ""
|
2736 |
|
2737 |
-
#: ../admin/wpmu.php:
|
2738 |
-
msgid "This is the default path for all blogs. With the placeholder %BLOG_ID% you can organize the folder structure better.
|
|
|
|
|
|
|
|
|
|
|
2739 |
msgstr ""
|
2740 |
|
2741 |
-
#: ../admin/wpmu.php:
|
2742 |
msgid "Enable upload quota check"
|
2743 |
msgstr ""
|
2744 |
|
2745 |
-
#: ../admin/wpmu.php:
|
2746 |
msgid "Should work if the gallery is bellow the blog.dir"
|
2747 |
msgstr ""
|
2748 |
|
2749 |
-
#: ../admin/wpmu.php:
|
2750 |
msgid "Enable zip upload option"
|
2751 |
msgstr ""
|
2752 |
|
2753 |
-
#: ../admin/wpmu.php:
|
2754 |
msgid "Allow users to upload zip folders."
|
2755 |
msgstr ""
|
2756 |
|
2757 |
-
#: ../admin/wpmu.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2758 |
msgid "Enable style selection"
|
2759 |
msgstr ""
|
2760 |
|
2761 |
-
#: ../admin/wpmu.php:
|
2762 |
msgid "Allow users to choose a style for the gallery."
|
2763 |
msgstr ""
|
2764 |
|
2765 |
-
#: ../admin/wpmu.php:
|
2766 |
msgid "Enable roles/capabilities"
|
2767 |
msgstr ""
|
2768 |
|
2769 |
-
#: ../admin/wpmu.php:
|
2770 |
msgid "Allow users to change the roles for other blog authors."
|
2771 |
msgstr ""
|
2772 |
|
2773 |
-
#: ../admin/wpmu.php:
|
2774 |
msgid "Default style"
|
2775 |
msgstr ""
|
2776 |
|
2777 |
-
#: ../admin/wpmu.php:
|
2778 |
msgid "Choose the default style for the galleries."
|
2779 |
msgstr ""
|
2780 |
|
2781 |
-
#: ../admin/tinymce/window.php:
|
2782 |
-
msgid "
|
2783 |
msgstr ""
|
2784 |
|
2785 |
-
#: ../admin/tinymce/window.php:
|
2786 |
-
#: ../admin/tinymce/window.php:
|
2787 |
msgid "Show as"
|
2788 |
msgstr ""
|
2789 |
|
2790 |
-
#: ../admin/tinymce/window.php:
|
2791 |
msgid "Image list"
|
2792 |
msgstr ""
|
2793 |
|
2794 |
-
#: ../admin/tinymce/window.php:
|
2795 |
msgid "Imagebrowser"
|
2796 |
msgstr ""
|
2797 |
|
2798 |
-
#: ../admin/tinymce/window.php:
|
2799 |
-
msgid "
|
2800 |
msgstr ""
|
2801 |
|
2802 |
-
#: ../admin/tinymce/window.php:
|
2803 |
msgid "Extended version"
|
2804 |
msgstr ""
|
2805 |
|
2806 |
-
#: ../admin/tinymce/window.php:
|
2807 |
msgid "Compact version"
|
2808 |
msgstr ""
|
2809 |
|
2810 |
#: ../admin/tinymce/window.php:97
|
2811 |
-
msgid "Select picture"
|
2812 |
msgstr ""
|
2813 |
|
2814 |
-
#: ../admin/tinymce/window.php:
|
2815 |
msgid "Width x Height"
|
2816 |
msgstr ""
|
2817 |
|
2818 |
-
#: ../admin/tinymce/window.php:
|
2819 |
msgid "Effect"
|
2820 |
msgstr ""
|
2821 |
|
2822 |
-
#: ../admin/tinymce/window.php:
|
2823 |
msgid "No effect"
|
2824 |
msgstr ""
|
2825 |
|
2826 |
-
#: ../admin/tinymce/window.php:
|
2827 |
msgid "Web 2.0"
|
2828 |
msgstr ""
|
2829 |
|
2830 |
-
#: ../admin/tinymce/window.php:
|
2831 |
msgid "Float"
|
2832 |
msgstr ""
|
2833 |
|
2834 |
-
#: ../admin/tinymce/window.php:
|
2835 |
msgid "No float"
|
2836 |
msgstr ""
|
2837 |
|
2838 |
-
#: ../admin/tinymce/window.php:
|
2839 |
-
msgid "Left"
|
2840 |
-
msgstr ""
|
2841 |
-
|
2842 |
-
#: ../admin/tinymce/window.php:130
|
2843 |
-
msgid "Center"
|
2844 |
-
msgstr ""
|
2845 |
-
|
2846 |
-
#: ../admin/tinymce/window.php:131
|
2847 |
-
msgid "Right"
|
2848 |
-
msgstr ""
|
2849 |
-
|
2850 |
-
#: ../admin/tinymce/window.php:147
|
2851 |
msgid "Insert"
|
2852 |
msgstr ""
|
2853 |
|
@@ -2881,128 +2979,128 @@ msgstr ""
|
|
2881 |
msgid "Not fired"
|
2882 |
msgstr ""
|
2883 |
|
2884 |
-
#: ../lib/meta.php:
|
2885 |
msgid "Aperture"
|
2886 |
msgstr ""
|
2887 |
|
2888 |
-
#: ../lib/meta.php:
|
2889 |
-
#: ../lib/meta.php:
|
2890 |
msgid "Credit"
|
2891 |
msgstr ""
|
2892 |
|
2893 |
-
#: ../lib/meta.php:
|
2894 |
msgid "Camera"
|
2895 |
msgstr ""
|
2896 |
|
2897 |
-
#: ../lib/meta.php:
|
2898 |
msgid "Caption"
|
2899 |
msgstr ""
|
2900 |
|
2901 |
-
#: ../lib/meta.php:
|
2902 |
msgid "Copyright"
|
2903 |
msgstr ""
|
2904 |
|
2905 |
-
#: ../lib/meta.php:
|
2906 |
msgid "Focal length"
|
2907 |
msgstr ""
|
2908 |
|
2909 |
-
#: ../lib/meta.php:
|
2910 |
msgid "ISO"
|
2911 |
msgstr ""
|
2912 |
|
2913 |
-
#: ../lib/meta.php:
|
2914 |
msgid "Shutter speed"
|
2915 |
msgstr ""
|
2916 |
|
2917 |
-
#: ../lib/meta.php:
|
2918 |
msgid "Subject"
|
2919 |
msgstr ""
|
2920 |
|
2921 |
-
#: ../lib/meta.php:
|
2922 |
msgid "Make"
|
2923 |
msgstr ""
|
2924 |
|
2925 |
-
#: ../lib/meta.php:
|
2926 |
msgid "Edit Status"
|
2927 |
msgstr ""
|
2928 |
|
2929 |
-
#: ../lib/meta.php:
|
2930 |
msgid "Category"
|
2931 |
msgstr ""
|
2932 |
|
2933 |
-
#: ../lib/meta.php:
|
2934 |
msgid "Keywords"
|
2935 |
msgstr ""
|
2936 |
|
2937 |
-
#: ../lib/meta.php:
|
2938 |
msgid "Date Created"
|
2939 |
msgstr ""
|
2940 |
|
2941 |
-
#: ../lib/meta.php:
|
2942 |
msgid "Time Created"
|
2943 |
msgstr ""
|
2944 |
|
2945 |
-
#: ../lib/meta.php:
|
2946 |
msgid "Author Position"
|
2947 |
msgstr ""
|
2948 |
|
2949 |
-
#: ../lib/meta.php:
|
2950 |
msgid "City"
|
2951 |
msgstr ""
|
2952 |
|
2953 |
-
#: ../lib/meta.php:
|
2954 |
msgid "Location"
|
2955 |
msgstr ""
|
2956 |
|
2957 |
-
#: ../lib/meta.php:
|
2958 |
msgid "Province/State"
|
2959 |
msgstr ""
|
2960 |
|
2961 |
-
#: ../lib/meta.php:
|
2962 |
msgid "Country code"
|
2963 |
msgstr ""
|
2964 |
|
2965 |
-
#: ../lib/meta.php:
|
2966 |
msgid "Country"
|
2967 |
msgstr ""
|
2968 |
|
2969 |
-
#: ../lib/meta.php:
|
2970 |
msgid "Headline"
|
2971 |
msgstr ""
|
2972 |
|
2973 |
-
#: ../lib/meta.php:
|
2974 |
msgid "Source"
|
2975 |
msgstr ""
|
2976 |
|
2977 |
-
#: ../lib/meta.php:
|
2978 |
msgid "Copyright Notice"
|
2979 |
msgstr ""
|
2980 |
|
2981 |
-
#: ../lib/meta.php:
|
2982 |
msgid "Contact"
|
2983 |
msgstr ""
|
2984 |
|
2985 |
-
#: ../lib/meta.php:
|
2986 |
msgid "Last modified"
|
2987 |
msgstr ""
|
2988 |
|
2989 |
-
#: ../lib/meta.php:
|
2990 |
msgid "Program tool"
|
2991 |
msgstr ""
|
2992 |
|
2993 |
-
#: ../lib/meta.php:
|
2994 |
msgid "Format"
|
2995 |
msgstr ""
|
2996 |
|
2997 |
-
#: ../lib/meta.php:
|
2998 |
msgid "Image Width"
|
2999 |
msgstr ""
|
3000 |
|
3001 |
-
#: ../lib/meta.php:
|
3002 |
msgid "Image Height"
|
3003 |
msgstr ""
|
3004 |
|
3005 |
-
#: ../lib/meta.php:
|
3006 |
msgid "Flash"
|
3007 |
msgstr ""
|
3008 |
|
@@ -3010,8 +3108,8 @@ msgstr ""
|
|
3010 |
msgid "Sorry, you have used your space allocation. Please delete some files to upload more files."
|
3011 |
msgstr ""
|
3012 |
|
3013 |
-
#: ../lib/ngg-db.php:
|
3014 |
-
#: ../lib/ngg-db.php:
|
3015 |
msgid "Album overview"
|
3016 |
msgstr ""
|
3017 |
|
@@ -3087,56 +3185,90 @@ msgstr ""
|
|
3087 |
msgid "%s slug(s) edited."
|
3088 |
msgstr ""
|
3089 |
|
3090 |
-
#: ../lib/xmlrpc.php:
|
3091 |
#, php-format
|
3092 |
msgid "XML-RPC services are disabled on this blog. An admin user can enable them at %s"
|
3093 |
msgstr ""
|
3094 |
|
3095 |
-
#: ../lib/xmlrpc.php:
|
3096 |
msgid "Bad login/pass combination."
|
3097 |
msgstr ""
|
3098 |
|
3099 |
-
#: ../lib/xmlrpc.php:
|
3100 |
msgid "You are not allowed to upload files to this site."
|
3101 |
msgstr ""
|
3102 |
|
3103 |
-
#: ../lib/xmlrpc.php:
|
3104 |
-
#: ../lib/xmlrpc.php:
|
3105 |
msgid "Could not find gallery "
|
3106 |
msgstr ""
|
3107 |
|
3108 |
-
#: ../lib/xmlrpc.php:
|
3109 |
-
#: ../lib/xmlrpc.php:
|
3110 |
msgid "You are not allowed to upload files to this gallery."
|
3111 |
msgstr ""
|
3112 |
|
3113 |
-
#: ../lib/xmlrpc.php:
|
3114 |
msgid "This is no valid image file."
|
3115 |
msgstr ""
|
3116 |
|
3117 |
-
#: ../lib/xmlrpc.php:
|
3118 |
msgid "Could not find image id "
|
3119 |
msgstr ""
|
3120 |
|
3121 |
-
#: ../lib/xmlrpc.php:
|
3122 |
#, php-format
|
3123 |
msgid "Failed to delete image %1$s "
|
3124 |
msgstr ""
|
3125 |
|
3126 |
-
#: ../lib/xmlrpc.php:
|
3127 |
#, php-format
|
3128 |
msgid "Could not write file %1$s (%2$s)"
|
3129 |
msgstr ""
|
3130 |
|
3131 |
-
#: ../lib/xmlrpc.php:
|
3132 |
-
#: ../lib/xmlrpc.php:
|
3133 |
-
|
|
|
3134 |
msgstr ""
|
3135 |
|
3136 |
-
#: ../lib/xmlrpc.php:
|
3137 |
msgid "Sorry, could not create the gallery"
|
3138 |
msgstr ""
|
3139 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3140 |
#: ../view/album-compact.php:32
|
3141 |
#: ../view/album-extend.php:30
|
3142 |
msgid "Photos"
|
2 |
msgstr ""
|
3 |
"Project-Id-Version: NextGEN Gallery\n"
|
4 |
"Report-Msgid-Bugs-To: \n"
|
5 |
+
"POT-Creation-Date: 2010-12-05 20:30+0100\n"
|
6 |
+
"PO-Revision-Date: 2010-12-05 20:30+0100\n"
|
7 |
"Last-Translator: Alex Rabe\n"
|
8 |
"Language-Team: Alex Rabe\n"
|
9 |
"MIME-Version: 1.0\n"
|
17 |
"X-Poedit-SearchPath-0: .\n"
|
18 |
"X-Poedit-SearchPath-1: ..\n"
|
19 |
|
20 |
+
#: ../nggallery.php:94
|
21 |
msgid "<strong>Translation by : </strong><a target=\"_blank\" href=\"http://alexrabe.de/wordpress-plugins/nextgen-gallery/languages/\">See here</a>"
|
22 |
msgstr ""
|
23 |
|
24 |
+
#: ../nggallery.php:95
|
25 |
+
msgid "<strong>This translation is not yet updated for Version 1.7.0</strong>. If you would like to help with translation, download the current po from the plugin folder and read <a href=\"http://alexrabe.de/wordpress-plugins/wordtube/translation-of-plugins/\">here</a> how you can translate the plugin."
|
26 |
msgstr ""
|
27 |
|
28 |
+
#: ../nggallery.php:194
|
29 |
+
msgid "Sorry, NextGEN Gallery works only with a Memory Limit of 16 MB or higher"
|
30 |
msgstr ""
|
31 |
|
32 |
+
#: ../nggallery.php:212
|
33 |
msgid "Please update the database of NextGEN Gallery."
|
34 |
msgstr ""
|
35 |
|
36 |
+
#: ../nggallery.php:212
|
37 |
msgid "Click here to proceed."
|
38 |
msgstr ""
|
39 |
|
40 |
+
#: ../nggallery.php:235
|
41 |
msgid "Picture tag"
|
42 |
msgstr ""
|
43 |
|
44 |
+
#: ../nggallery.php:236
|
45 |
msgid "Picture tag: %2$l."
|
46 |
msgstr ""
|
47 |
|
48 |
+
#: ../nggallery.php:237
|
49 |
msgid "Separate picture tags with commas."
|
50 |
msgstr ""
|
51 |
|
52 |
+
#: ../nggallery.php:336
|
53 |
msgid "L O A D I N G"
|
54 |
msgstr ""
|
55 |
|
56 |
+
#: ../nggallery.php:337
|
57 |
msgid "Click to Close"
|
58 |
msgstr ""
|
59 |
|
60 |
+
#: ../nggallery.php:358
|
61 |
msgid "loading"
|
62 |
msgstr ""
|
63 |
|
64 |
+
#: ../nggallery.php:498
|
65 |
+
#: ../nggfunctions.php:919
|
66 |
+
#: ../admin/admin.php:32
|
67 |
msgid "Overview"
|
68 |
msgstr ""
|
69 |
|
70 |
+
#: ../nggallery.php:499
|
71 |
msgid "Get help"
|
72 |
msgstr ""
|
73 |
|
74 |
+
#: ../nggallery.php:500
|
75 |
msgid "Contribute"
|
76 |
msgstr ""
|
77 |
|
78 |
+
#: ../nggallery.php:501
|
79 |
msgid "Donate"
|
80 |
msgstr ""
|
81 |
|
82 |
#: ../nggfunctions.php:42
|
83 |
+
msgid "The <a href=\"http://www.macromedia.com/go/getflashplayer\">Flash Player</a> and <a href=\"http://www.mozilla.com/firefox/\">a browser with Javascript support</a> are needed."
|
84 |
msgstr ""
|
85 |
|
86 |
+
#: ../nggfunctions.php:164
|
87 |
+
#: ../nggfunctions.php:629
|
88 |
msgid "[Gallery not found]"
|
89 |
msgstr ""
|
90 |
|
91 |
+
#: ../nggfunctions.php:436
|
92 |
msgid "[Album not found]"
|
93 |
msgstr ""
|
94 |
|
95 |
+
#: ../nggfunctions.php:746
|
96 |
msgid "[SinglePic not found]"
|
97 |
msgstr ""
|
98 |
|
99 |
+
#: ../nggfunctions.php:884
|
100 |
msgid "Related images for"
|
101 |
msgstr ""
|
102 |
|
221 |
#: ../admin/addgallery.php:69
|
222 |
#: ../admin/addgallery.php:80
|
223 |
#: ../admin/album.php:96
|
224 |
+
#: ../admin/album.php:124
|
225 |
+
#: ../admin/album.php:142
|
226 |
#: ../admin/edit-thumbnail.php:19
|
227 |
#: ../admin/edit-thumbnail.php:22
|
228 |
+
#: ../admin/manage.php:179
|
229 |
msgid "Cheatin’ uh?"
|
230 |
msgstr ""
|
231 |
|
238 |
msgstr ""
|
239 |
|
240 |
#: ../admin/addgallery.php:90
|
241 |
+
#: ../admin/functions.php:932
|
242 |
+
#: ../admin/functions.php:1032
|
243 |
msgid "No gallery selected !"
|
244 |
msgstr ""
|
245 |
|
246 |
+
#: ../admin/addgallery.php:159
|
247 |
msgid "Image Files"
|
248 |
msgstr ""
|
249 |
|
250 |
+
#: ../admin/addgallery.php:180
|
251 |
+
#: ../admin/addgallery.php:208
|
252 |
msgid "remove"
|
253 |
msgstr ""
|
254 |
|
255 |
+
#: ../admin/addgallery.php:181
|
256 |
+
#: ../admin/addgallery.php:361
|
257 |
msgid "Browse..."
|
258 |
msgstr ""
|
259 |
|
260 |
+
#: ../admin/addgallery.php:182
|
261 |
+
#: ../admin/addgallery.php:194
|
262 |
+
#: ../admin/addgallery.php:411
|
263 |
msgid "Upload images"
|
264 |
msgstr ""
|
265 |
|
266 |
+
#: ../admin/addgallery.php:271
|
267 |
+
#: ../admin/addgallery.php:377
|
268 |
msgid "Upload Images"
|
269 |
msgstr ""
|
270 |
|
271 |
+
#: ../admin/addgallery.php:274
|
272 |
+
#: ../admin/addgallery.php:291
|
273 |
+
#: ../admin/manage-galleries.php:112
|
274 |
+
#: ../admin/manage-galleries.php:149
|
275 |
msgid "Add new gallery"
|
276 |
msgstr ""
|
277 |
|
278 |
+
#: ../admin/addgallery.php:277
|
279 |
+
#: ../admin/addgallery.php:313
|
280 |
msgid "Upload a Zip-File"
|
281 |
msgstr ""
|
282 |
|
283 |
+
#: ../admin/addgallery.php:280
|
284 |
+
#: ../admin/addgallery.php:355
|
285 |
msgid "Import image folder"
|
286 |
msgstr ""
|
287 |
|
288 |
+
#: ../admin/addgallery.php:296
|
289 |
+
#: ../admin/manage-galleries.php:284
|
290 |
msgid "New Gallery"
|
291 |
msgstr ""
|
292 |
|
293 |
+
#: ../admin/addgallery.php:299
|
294 |
+
#: ../admin/manage-galleries.php:286
|
295 |
msgid "Create a new , empty gallery below the folder"
|
296 |
msgstr ""
|
297 |
|
298 |
+
#: ../admin/addgallery.php:301
|
299 |
+
#: ../admin/manage-galleries.php:288
|
300 |
msgid "Allowed characters for file and folder names are"
|
301 |
msgstr ""
|
302 |
|
303 |
+
#: ../admin/addgallery.php:305
|
304 |
msgid "Add gallery"
|
305 |
msgstr ""
|
306 |
|
307 |
+
#: ../admin/addgallery.php:318
|
308 |
msgid "Select Zip-File"
|
309 |
msgstr ""
|
310 |
|
311 |
+
#: ../admin/addgallery.php:320
|
312 |
msgid "Upload a zip file with images"
|
313 |
msgstr ""
|
314 |
|
315 |
+
#: ../admin/addgallery.php:324
|
316 |
msgid "or enter a Zip-File URL"
|
317 |
msgstr ""
|
318 |
|
319 |
+
#: ../admin/addgallery.php:326
|
320 |
msgid "Import a zip file with images from a url"
|
321 |
msgstr ""
|
322 |
|
323 |
+
#: ../admin/addgallery.php:330
|
324 |
+
#: ../admin/addgallery.php:386
|
325 |
msgid "in to"
|
326 |
msgstr ""
|
327 |
|
328 |
+
#: ../admin/addgallery.php:332
|
329 |
msgid "a new gallery"
|
330 |
msgstr ""
|
331 |
|
332 |
+
#: ../admin/addgallery.php:343
|
333 |
msgid "Note : The upload limit on your server is "
|
334 |
msgstr ""
|
335 |
|
336 |
+
#: ../admin/addgallery.php:347
|
337 |
msgid "Start upload"
|
338 |
msgstr ""
|
339 |
|
340 |
+
#: ../admin/addgallery.php:360
|
341 |
msgid "Import from Server path:"
|
342 |
msgstr ""
|
343 |
|
344 |
+
#: ../admin/addgallery.php:363
|
345 |
msgid "Note : Change the default path in the gallery settings"
|
346 |
msgstr ""
|
347 |
|
348 |
+
#: ../admin/addgallery.php:365
|
349 |
msgid " Please note : For safe-mode = ON you need to add the subfolder thumbs manually"
|
350 |
msgstr ""
|
351 |
|
352 |
+
#: ../admin/addgallery.php:368
|
353 |
msgid "Import folder"
|
354 |
msgstr ""
|
355 |
|
356 |
+
#: ../admin/addgallery.php:382
|
357 |
msgid "Upload image"
|
358 |
msgstr ""
|
359 |
|
360 |
+
#: ../admin/addgallery.php:388
|
361 |
msgid "Choose gallery"
|
362 |
msgstr ""
|
363 |
|
364 |
+
#: ../admin/addgallery.php:407
|
365 |
msgid "The batch upload requires Adobe Flash 10, disable it if you have problems"
|
366 |
msgstr ""
|
367 |
|
368 |
+
#: ../admin/addgallery.php:407
|
369 |
msgid "Disable flash upload"
|
370 |
msgstr ""
|
371 |
|
372 |
+
#: ../admin/addgallery.php:409
|
373 |
msgid "Upload multiple files at once by ctrl/shift-selecting in dialog"
|
374 |
msgstr ""
|
375 |
|
376 |
+
#: ../admin/addgallery.php:409
|
377 |
msgid "Enable flash based upload"
|
378 |
msgstr ""
|
379 |
|
380 |
+
#: ../admin/admin.php:31
|
381 |
+
#: ../admin/admin.php:57
|
382 |
+
#: ../admin/admin.php:283
|
383 |
+
#: ../admin/admin.php:351
|
384 |
+
#: ../admin/functions.php:178
|
385 |
+
#: ../admin/manage-galleries.php:120
|
386 |
+
#: ../admin/manage-galleries.php:372
|
387 |
+
#: ../admin/manage-images.php:239
|
388 |
msgid "Gallery"
|
389 |
msgid_plural "Galleries"
|
390 |
msgstr[0] ""
|
391 |
msgstr[1] ""
|
392 |
|
393 |
+
#: ../admin/admin.php:33
|
394 |
msgid "Add Gallery / Images"
|
395 |
msgstr ""
|
396 |
|
397 |
+
#: ../admin/admin.php:34
|
398 |
msgid "Manage Gallery"
|
399 |
msgstr ""
|
400 |
|
401 |
+
#: ../admin/admin.php:35
|
402 |
msgid "Album"
|
403 |
msgid_plural "Albums"
|
404 |
msgstr[0] ""
|
405 |
msgstr[1] ""
|
406 |
|
407 |
+
#: ../admin/admin.php:36
|
408 |
msgid "Tags"
|
409 |
msgstr ""
|
410 |
|
411 |
+
#: ../admin/admin.php:37
|
412 |
msgid "Options"
|
413 |
msgstr ""
|
414 |
|
415 |
+
#: ../admin/admin.php:39
|
416 |
msgid "Style"
|
417 |
msgstr ""
|
418 |
|
419 |
+
#: ../admin/admin.php:41
|
420 |
msgid "Roles"
|
421 |
msgstr ""
|
422 |
|
423 |
+
#: ../admin/admin.php:42
|
424 |
msgid "About this Gallery"
|
425 |
msgstr ""
|
426 |
|
427 |
+
#: ../admin/admin.php:42
|
428 |
msgid "About"
|
429 |
msgstr ""
|
430 |
|
431 |
+
#: ../admin/admin.php:45
|
432 |
msgid "NextGEN Gallery"
|
433 |
msgstr ""
|
434 |
|
435 |
+
#: ../admin/admin.php:48
|
436 |
+
#: ../admin/admin.php:59
|
437 |
msgid "Reset / Uninstall"
|
438 |
msgstr ""
|
439 |
|
440 |
+
#: ../admin/admin.php:58
|
441 |
+
msgid "Network settings"
|
|
|
|
|
|
|
|
|
442 |
msgstr ""
|
443 |
|
444 |
+
#: ../admin/admin.php:98
|
445 |
#, php-format
|
446 |
msgid "Thanks for using this plugin, I hope you are satisfied ! If you would like to support the further development, please consider a <strong><a href=\"%s\">donation</a></strong>! If you still need some help, please post your questions <a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\">here</a> ."
|
447 |
msgstr ""
|
448 |
|
449 |
+
#: ../admin/admin.php:101
|
450 |
msgid "OK, hide this message now !"
|
451 |
msgstr ""
|
452 |
|
453 |
+
#: ../admin/admin.php:186
|
454 |
msgid "You do not have the correct permission"
|
455 |
msgstr ""
|
456 |
|
457 |
+
#: ../admin/admin.php:187
|
458 |
msgid "Unexpected Error"
|
459 |
msgstr ""
|
460 |
|
461 |
+
#: ../admin/admin.php:188
|
462 |
msgid "A failure occurred"
|
463 |
msgstr ""
|
464 |
|
465 |
+
#: ../admin/admin.php:287
|
466 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Introduction</a>"
|
467 |
msgstr ""
|
468 |
|
469 |
+
#: ../admin/admin.php:290
|
470 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Setup</a>"
|
471 |
msgstr ""
|
472 |
|
473 |
+
#: ../admin/admin.php:293
|
474 |
msgid "<a href=\"http://alexrabe.de/wordpress-plugins/nextgen-gallery/languages/\" target=\"_blank\">Translation by alex rabe</a>"
|
475 |
msgstr ""
|
476 |
|
477 |
+
#: ../admin/admin.php:296
|
478 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Roles / Capabilities</a>"
|
479 |
msgstr ""
|
480 |
|
481 |
+
#: ../admin/admin.php:299
|
482 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Styles</a>"
|
483 |
msgstr ""
|
484 |
|
485 |
+
#: ../admin/admin.php:300
|
486 |
msgid "Templates"
|
487 |
msgstr ""
|
488 |
|
489 |
+
#: ../admin/admin.php:303
|
490 |
+
#: ../admin/admin.php:309
|
491 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Gallery management</a>"
|
492 |
msgstr ""
|
493 |
|
494 |
+
#: ../admin/admin.php:304
|
495 |
msgid "Gallery example"
|
496 |
msgstr ""
|
497 |
|
498 |
+
#: ../admin/admin.php:310
|
499 |
+
#: ../admin/admin.php:320
|
500 |
msgid "Gallery tags"
|
501 |
msgstr ""
|
502 |
|
503 |
+
#: ../admin/admin.php:313
|
504 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Album management</a>"
|
505 |
msgstr ""
|
506 |
|
507 |
+
#: ../admin/admin.php:314
|
508 |
msgid "Album example"
|
509 |
msgstr ""
|
510 |
|
511 |
+
#: ../admin/admin.php:315
|
512 |
+
#: ../admin/admin.php:321
|
513 |
msgid "Album tags"
|
514 |
msgstr ""
|
515 |
|
516 |
+
#: ../admin/admin.php:318
|
517 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-introduction/\" target=\"_blank\">Gallery tags</a>"
|
518 |
msgstr ""
|
519 |
|
520 |
+
#: ../admin/admin.php:319
|
521 |
msgid "Related images"
|
522 |
msgstr ""
|
523 |
|
524 |
+
#: ../admin/admin.php:324
|
525 |
msgid "<a href=\"http://dpotter.net/Technical/2008/03/nextgen-gallery-review-image-management/\" target=\"_blank\">Image management</a>"
|
526 |
msgstr ""
|
527 |
|
528 |
+
#: ../admin/admin.php:325
|
529 |
msgid "Custom fields"
|
530 |
msgstr ""
|
531 |
|
532 |
+
#: ../admin/admin.php:330
|
533 |
msgid "Get help with NextGEN Gallery"
|
534 |
msgstr ""
|
535 |
|
536 |
+
#: ../admin/admin.php:334
|
537 |
msgid "More Help & Info"
|
538 |
msgstr ""
|
539 |
|
540 |
+
#: ../admin/admin.php:336
|
541 |
msgid "<a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\" target=\"_blank\">Support Forums</a>"
|
542 |
msgstr ""
|
543 |
|
544 |
+
#: ../admin/admin.php:337
|
545 |
msgid "FAQ"
|
546 |
msgstr ""
|
547 |
|
548 |
+
#: ../admin/admin.php:338
|
549 |
msgid "Feature request"
|
550 |
msgstr ""
|
551 |
|
552 |
+
#: ../admin/admin.php:339
|
553 |
msgid "Get your language pack"
|
554 |
msgstr ""
|
555 |
|
556 |
+
#: ../admin/admin.php:340
|
557 |
msgid "Contribute development"
|
558 |
msgstr ""
|
559 |
|
560 |
+
#: ../admin/admin.php:341
|
561 |
msgid "Download latest version"
|
562 |
msgstr ""
|
563 |
|
564 |
+
#: ../admin/ajax.php:312
|
565 |
+
msgid "You are not allowed to be here"
|
566 |
+
msgstr ""
|
567 |
+
|
568 |
+
#: ../admin/album.php:102
|
569 |
+
#: ../admin/album.php:117
|
570 |
+
#: ../admin/album.php:158
|
571 |
msgid "Update Successfully"
|
572 |
msgstr ""
|
573 |
|
574 |
+
#: ../admin/album.php:131
|
575 |
msgid "Album deleted"
|
576 |
msgstr ""
|
577 |
|
578 |
+
#: ../admin/album.php:269
|
579 |
+
msgid "Edit Album"
|
580 |
+
msgstr ""
|
581 |
+
|
582 |
+
#: ../admin/album.php:278
|
583 |
msgid "Manage Albums"
|
584 |
msgstr ""
|
585 |
|
586 |
+
#: ../admin/album.php:284
|
587 |
+
#: ../admin/album.php:333
|
588 |
msgid "Select album"
|
589 |
msgstr ""
|
590 |
|
591 |
+
#: ../admin/album.php:286
|
592 |
msgid "No album selected"
|
593 |
msgstr ""
|
594 |
|
595 |
+
#: ../admin/album.php:297
|
596 |
#: ../admin/edit-thumbnail.php:157
|
597 |
msgid "Update"
|
598 |
msgstr ""
|
599 |
|
600 |
+
#: ../admin/album.php:299
|
601 |
msgid "Edit album"
|
602 |
msgstr ""
|
603 |
|
604 |
+
#: ../admin/album.php:302
|
605 |
+
#: ../admin/manage-galleries.php:139
|
606 |
+
#: ../admin/manage-images.php:445
|
607 |
msgid "Delete"
|
608 |
msgstr ""
|
609 |
|
610 |
+
#: ../admin/album.php:302
|
611 |
msgid "Delete album ?"
|
612 |
msgstr ""
|
613 |
|
614 |
+
#: ../admin/album.php:306
|
615 |
msgid "Add new album"
|
616 |
msgstr ""
|
617 |
|
618 |
+
#: ../admin/album.php:308
|
619 |
msgid "Add"
|
620 |
msgstr ""
|
621 |
|
622 |
+
#: ../admin/album.php:319
|
623 |
msgid "Show / hide used galleries"
|
624 |
msgstr ""
|
625 |
|
626 |
+
#: ../admin/album.php:319
|
627 |
msgid "[Show all]"
|
628 |
msgstr ""
|
629 |
|
630 |
+
#: ../admin/album.php:320
|
631 |
msgid "Maximize the widget content"
|
632 |
msgstr ""
|
633 |
|
634 |
+
#: ../admin/album.php:320
|
635 |
msgid "[Maximize]"
|
636 |
msgstr ""
|
637 |
|
638 |
+
#: ../admin/album.php:321
|
639 |
msgid "Minimize the widget content"
|
640 |
msgstr ""
|
641 |
|
642 |
+
#: ../admin/album.php:321
|
643 |
msgid "[Minimize]"
|
644 |
msgstr ""
|
645 |
|
646 |
+
#: ../admin/album.php:323
|
647 |
msgid "After you create and select a album, you can drag and drop a gallery or another album into your new album below"
|
648 |
msgstr ""
|
649 |
|
650 |
+
#: ../admin/album.php:349
|
651 |
msgid "Select gallery"
|
652 |
msgstr ""
|
653 |
|
654 |
+
#: ../admin/album.php:378
|
655 |
msgid "Album ID"
|
656 |
msgstr ""
|
657 |
|
658 |
+
#: ../admin/album.php:391
|
659 |
msgid "No album selected!"
|
660 |
msgstr ""
|
661 |
|
662 |
+
#: ../admin/album.php:411
|
663 |
msgid "Album name:"
|
664 |
msgstr ""
|
665 |
|
666 |
+
#: ../admin/album.php:417
|
667 |
msgid "Album description:"
|
668 |
msgstr ""
|
669 |
|
670 |
+
#: ../admin/album.php:423
|
671 |
msgid "Select a preview image:"
|
672 |
msgstr ""
|
673 |
|
674 |
+
#: ../admin/album.php:426
|
675 |
+
#: ../admin/album.php:429
|
676 |
msgid "No picture"
|
677 |
msgstr ""
|
678 |
|
679 |
+
#: ../admin/album.php:440
|
680 |
+
#: ../admin/manage-images.php:257
|
681 |
msgid "Page Link to"
|
682 |
msgstr ""
|
683 |
|
684 |
+
#: ../admin/album.php:442
|
685 |
+
#: ../admin/manage-images.php:260
|
686 |
msgid "Not linked"
|
687 |
msgstr ""
|
688 |
|
689 |
+
#: ../admin/album.php:455
|
690 |
+
#: ../admin/manage-galleries.php:293
|
691 |
+
#: ../admin/manage-galleries.php:322
|
692 |
+
#: ../admin/manage-galleries.php:352
|
693 |
+
#: ../admin/manage-images.php:539
|
694 |
+
#: ../admin/manage-images.php:575
|
695 |
+
#: ../admin/manage-images.php:604
|
696 |
+
#: ../admin/manage-images.php:634
|
697 |
msgid "OK"
|
698 |
msgstr ""
|
699 |
|
700 |
+
#: ../admin/album.php:457
|
701 |
+
#: ../admin/manage-galleries.php:295
|
702 |
+
#: ../admin/manage-galleries.php:324
|
703 |
+
#: ../admin/manage-galleries.php:354
|
704 |
+
#: ../admin/manage-images.php:541
|
705 |
+
#: ../admin/manage-images.php:577
|
706 |
+
#: ../admin/manage-images.php:606
|
707 |
+
#: ../admin/manage-images.php:636
|
708 |
msgid "Cancel"
|
709 |
msgstr ""
|
710 |
|
711 |
+
#: ../admin/album.php:541
|
712 |
msgid "Name"
|
713 |
msgstr ""
|
714 |
|
715 |
+
#: ../admin/album.php:542
|
716 |
+
#: ../admin/manage-images.php:255
|
|
|
|
|
717 |
msgid "Title"
|
718 |
msgstr ""
|
719 |
|
720 |
+
#: ../admin/album.php:543
|
721 |
msgid "Page"
|
722 |
msgstr ""
|
723 |
|
737 |
msgid "Select the area for the thumbnail from the picture on the left."
|
738 |
msgstr ""
|
739 |
|
740 |
+
#: ../admin/functions.php:39
|
741 |
msgid "No valid gallery name!"
|
742 |
msgstr ""
|
743 |
|
744 |
+
#: ../admin/functions.php:46
|
745 |
+
#: ../admin/functions.php:55
|
746 |
+
#: ../admin/functions.php:80
|
747 |
+
#: ../admin/functions.php:149
|
748 |
+
#: ../admin/functions.php:157
|
749 |
msgid "Directory"
|
750 |
msgstr ""
|
751 |
|
752 |
+
#: ../admin/functions.php:46
|
753 |
msgid "didn't exist. Please create first the main gallery folder "
|
754 |
msgstr ""
|
755 |
|
756 |
+
#: ../admin/functions.php:47
|
757 |
+
#: ../admin/functions.php:56
|
758 |
msgid "Check this link, if you didn't know how to set the permission :"
|
759 |
msgstr ""
|
760 |
|
761 |
+
#: ../admin/functions.php:55
|
762 |
+
#: ../admin/functions.php:80
|
763 |
msgid "is not writeable !"
|
764 |
msgstr ""
|
765 |
|
766 |
+
#: ../admin/functions.php:76
|
767 |
+
#: ../admin/functions.php:85
|
768 |
+
#: ../admin/functions.php:891
|
769 |
msgid "Unable to create directory "
|
770 |
msgstr ""
|
771 |
|
772 |
+
#: ../admin/functions.php:89
|
773 |
msgid "The server setting Safe-Mode is on !"
|
774 |
msgstr ""
|
775 |
|
776 |
+
#: ../admin/functions.php:90
|
777 |
msgid "If you have problems, please create directory"
|
778 |
msgstr ""
|
779 |
|
780 |
+
#: ../admin/functions.php:91
|
781 |
msgid "and the thumbnails directory"
|
782 |
msgstr ""
|
783 |
|
784 |
+
#: ../admin/functions.php:91
|
785 |
msgid "with permission 777 manually !"
|
786 |
msgstr ""
|
787 |
|
788 |
+
#: ../admin/functions.php:116
|
|
|
|
|
|
|
|
|
789 |
#, php-format
|
790 |
+
msgid "Gallery ID %1$s successfully created. You can show this gallery in your post or page with the shortcode %2$s.<br/>"
|
791 |
msgstr ""
|
792 |
|
793 |
+
#: ../admin/functions.php:119
|
794 |
msgid "Edit gallery"
|
795 |
msgstr ""
|
796 |
|
797 |
+
#: ../admin/functions.php:149
|
798 |
msgid "doesn`t exist!"
|
799 |
msgstr ""
|
800 |
|
801 |
+
#: ../admin/functions.php:157
|
802 |
msgid "contains no pictures"
|
803 |
msgstr ""
|
804 |
|
805 |
+
#: ../admin/functions.php:175
|
806 |
msgid "Database error. Could not add gallery!"
|
807 |
msgstr ""
|
808 |
|
809 |
+
#: ../admin/functions.php:178
|
810 |
msgid "successfully created!"
|
811 |
msgstr ""
|
812 |
|
813 |
+
#: ../admin/functions.php:207
|
814 |
+
#: ../admin/functions.php:1008
|
815 |
+
#: ../admin/manage-galleries.php:74
|
816 |
+
#: ../admin/manage-galleries.php:141
|
817 |
+
#: ../admin/manage-images.php:202
|
818 |
+
#: ../admin/manage-images.php:341
|
819 |
+
#: ../admin/manage.php:216
|
820 |
+
#: ../admin/manage.php:292
|
821 |
msgid "Create new thumbnails"
|
822 |
msgstr ""
|
823 |
|
824 |
+
#: ../admin/functions.php:210
|
825 |
msgid " picture(s) successfully added"
|
826 |
msgstr ""
|
827 |
|
828 |
+
#: ../admin/functions.php:260
|
829 |
+
#: ../admin/functions.php:340
|
830 |
+
#: ../admin/functions.php:395
|
831 |
+
#: ../admin/functions.php:492
|
832 |
+
#: ../admin/functions.php:546
|
833 |
msgid "Object didn't contain correct data"
|
834 |
msgstr ""
|
835 |
|
836 |
+
#: ../admin/functions.php:268
|
837 |
msgid " is not writeable "
|
838 |
msgstr ""
|
839 |
|
840 |
+
#: ../admin/functions.php:350
|
841 |
+
#: ../admin/functions.php:398
|
842 |
+
#: ../admin/functions.php:498
|
843 |
+
#: ../admin/functions.php:549
|
844 |
msgid " is not writeable"
|
845 |
msgstr ""
|
846 |
|
847 |
+
#: ../admin/functions.php:552
|
848 |
msgid "File do not exists"
|
849 |
msgstr ""
|
850 |
|
851 |
+
#: ../admin/functions.php:556
|
852 |
msgid "Couldn't restore original image"
|
853 |
msgstr ""
|
854 |
|
855 |
+
#: ../admin/functions.php:671
|
856 |
msgid "(Error : Couldn't not update data base)"
|
857 |
msgstr ""
|
858 |
|
859 |
+
#: ../admin/functions.php:678
|
860 |
msgid "(Error : Couldn't not update meta data)"
|
861 |
msgstr ""
|
862 |
|
863 |
+
#: ../admin/functions.php:687
|
864 |
msgid "(Error : Couldn't not find image)"
|
865 |
msgstr ""
|
866 |
|
867 |
+
#: ../admin/functions.php:825
|
868 |
msgid "No valid URL path "
|
869 |
msgstr ""
|
870 |
|
871 |
+
#: ../admin/functions.php:841
|
872 |
msgid "Import via cURL failed."
|
873 |
msgstr ""
|
874 |
|
875 |
+
#: ../admin/functions.php:858
|
876 |
+
msgid "Uploaded file was no or a faulty zip file ! The server recognized : "
|
877 |
msgstr ""
|
878 |
|
879 |
+
#: ../admin/functions.php:875
|
880 |
msgid "Could not get a valid foldername"
|
881 |
msgstr ""
|
882 |
|
883 |
+
#: ../admin/functions.php:886
|
884 |
#, php-format
|
885 |
msgid "Unable to create directory %s. Is its parent directory writable by the server?"
|
886 |
msgstr ""
|
887 |
|
888 |
+
#: ../admin/functions.php:901
|
889 |
msgid "Zip-File successfully unpacked"
|
890 |
msgstr ""
|
891 |
|
892 |
+
#: ../admin/functions.php:940
|
893 |
+
#: ../admin/functions.php:1057
|
894 |
msgid "Failure in database, no gallery path set !"
|
895 |
msgstr ""
|
896 |
|
897 |
+
#: ../admin/functions.php:964
|
898 |
+
#: ../admin/functions.php:1051
|
899 |
msgid "is no valid image file!"
|
900 |
msgstr ""
|
901 |
|
902 |
+
#: ../admin/functions.php:978
|
903 |
+
#: ../admin/functions.php:1177
|
904 |
+
#: ../admin/functions.php:1254
|
905 |
#, php-format
|
906 |
msgid "Unable to write to directory %s. Is this directory writable by the server?"
|
907 |
msgstr ""
|
908 |
|
909 |
+
#: ../admin/functions.php:985
|
910 |
+
#: ../admin/functions.php:1074
|
911 |
+
msgid "Error, the file could not be moved to : "
|
912 |
msgstr ""
|
913 |
|
914 |
+
#: ../admin/functions.php:990
|
915 |
+
#: ../admin/functions.php:1078
|
916 |
+
msgid "Error, the file permissions could not be set"
|
917 |
msgstr ""
|
918 |
|
919 |
+
#: ../admin/functions.php:1013
|
920 |
msgid " Image(s) successfully added"
|
921 |
msgstr ""
|
922 |
|
923 |
+
#: ../admin/functions.php:1040
|
924 |
msgid "Invalid upload. Error Code : "
|
925 |
msgstr ""
|
926 |
|
927 |
+
#: ../admin/functions.php:1117
|
928 |
#, php-format
|
929 |
msgid "SAFE MODE Restriction in effect! You need to create the folder <strong>%s</strong> manually"
|
930 |
msgstr ""
|
931 |
|
932 |
+
#: ../admin/functions.php:1118
|
933 |
#, php-format
|
934 |
msgid "When safe_mode is on, PHP checks to see if the owner (%s) of the current script matches the owner (%s) of the file to be operated on by a file function or its directory"
|
935 |
msgstr ""
|
936 |
|
937 |
+
#: ../admin/functions.php:1171
|
938 |
+
#: ../admin/functions.php:1248
|
939 |
msgid "The destination gallery does not exist"
|
940 |
msgstr ""
|
941 |
|
942 |
+
#: ../admin/functions.php:1202
|
943 |
#, php-format
|
944 |
msgid "Failed to move image %1$s to %2$s"
|
945 |
msgstr ""
|
946 |
|
947 |
+
#: ../admin/functions.php:1222
|
948 |
#, php-format
|
949 |
msgid "Moved %1$s picture(s) to gallery : %2$s ."
|
950 |
msgstr ""
|
951 |
|
952 |
+
#: ../admin/functions.php:1281
|
953 |
#, php-format
|
954 |
msgid "Failed to copy image %1$s to %2$s"
|
955 |
msgstr ""
|
956 |
|
957 |
+
#: ../admin/functions.php:1295
|
958 |
#, php-format
|
959 |
msgid "Failed to copy database row for picture %s"
|
960 |
msgstr ""
|
961 |
|
962 |
+
#: ../admin/functions.php:1307
|
963 |
#, php-format
|
964 |
msgid "Image %1$s (%2$s) copied as image %3$s (%4$s) » The file already existed in the destination gallery."
|
965 |
msgstr ""
|
966 |
|
967 |
+
#: ../admin/functions.php:1310
|
968 |
#, php-format
|
969 |
msgid "Image %1$s (%2$s) copied as image %3$s (%4$s)"
|
970 |
msgstr ""
|
971 |
|
972 |
+
#: ../admin/functions.php:1319
|
973 |
#, php-format
|
974 |
msgid "Copied %1$s picture(s) to gallery: %2$s ."
|
975 |
msgstr ""
|
976 |
|
977 |
+
#: ../admin/functions.php:1427
|
978 |
msgid "The uploaded file exceeds the upload_max_filesize directive in php.ini"
|
979 |
msgstr ""
|
980 |
|
981 |
+
#: ../admin/functions.php:1430
|
982 |
msgid "The uploaded file exceeds the MAX_FILE_SIZE directive that was specified in the HTML form"
|
983 |
msgstr ""
|
984 |
|
985 |
+
#: ../admin/functions.php:1433
|
986 |
msgid "The uploaded file was only partially uploaded"
|
987 |
msgstr ""
|
988 |
|
989 |
+
#: ../admin/functions.php:1436
|
990 |
msgid "No file was uploaded"
|
991 |
msgstr ""
|
992 |
|
993 |
+
#: ../admin/functions.php:1439
|
994 |
msgid "Missing a temporary folder"
|
995 |
msgstr ""
|
996 |
|
997 |
+
#: ../admin/functions.php:1442
|
998 |
msgid "Failed to write file to disk"
|
999 |
msgstr ""
|
1000 |
|
1001 |
+
#: ../admin/functions.php:1445
|
1002 |
msgid "File upload stopped by extension"
|
1003 |
msgstr ""
|
1004 |
|
1005 |
+
#: ../admin/functions.php:1448
|
1006 |
msgid "Unknown upload error"
|
1007 |
msgstr ""
|
1008 |
|
1010 |
msgid "Sorry, NextGEN Gallery works only with a role called administrator"
|
1011 |
msgstr ""
|
1012 |
|
1013 |
+
#: ../admin/install.php:112
|
1014 |
msgid "NextGEN Gallery : Tables could not created, please check your database settings"
|
1015 |
msgstr ""
|
1016 |
|
1017 |
+
#: ../admin/install.php:170
|
1018 |
msgid "[Show as slideshow]"
|
1019 |
msgstr ""
|
1020 |
|
1021 |
+
#: ../admin/install.php:171
|
1022 |
msgid "[Show picture list]"
|
1023 |
msgstr ""
|
1024 |
|
1033 |
msgstr ""
|
1034 |
|
1035 |
#: ../admin/manage-galleries.php:62
|
1036 |
+
#: ../admin/manage-images.php:170
|
1037 |
msgid "No images selected"
|
1038 |
msgstr ""
|
1039 |
|
1040 |
+
#: ../admin/manage-galleries.php:70
|
1041 |
+
#: ../admin/manage-galleries.php:142
|
1042 |
+
#: ../admin/manage-images.php:198
|
1043 |
+
#: ../admin/manage-images.php:342
|
1044 |
+
#: ../admin/manage.php:200
|
1045 |
+
#: ../admin/manage.php:278
|
1046 |
+
msgid "Resize images"
|
1047 |
+
msgstr ""
|
1048 |
+
|
1049 |
#: ../admin/manage-galleries.php:79
|
1050 |
#, php-format
|
1051 |
msgid ""
|
1054 |
" 'Cancel' to stop, 'OK' to proceed."
|
1055 |
msgstr ""
|
1056 |
|
1057 |
+
#: ../admin/manage-galleries.php:123
|
1058 |
+
#: ../admin/manage-galleries.php:126
|
1059 |
+
#: ../admin/manage-images.php:225
|
1060 |
+
#: ../admin/manage-images.php:228
|
|
|
|
|
|
|
|
|
1061 |
msgid "Search Images"
|
1062 |
msgstr ""
|
1063 |
|
1064 |
+
#: ../admin/manage-galleries.php:138
|
1065 |
+
#: ../admin/manage-images.php:339
|
1066 |
+
msgid "Bulk actions"
|
1067 |
msgstr ""
|
1068 |
|
1069 |
+
#: ../admin/manage-galleries.php:140
|
1070 |
+
#: ../admin/manage-images.php:340
|
1071 |
+
#: ../admin/manage.php:133
|
1072 |
+
#: ../admin/manage.php:242
|
1073 |
msgid "Set watermark"
|
1074 |
msgstr ""
|
1075 |
|
1076 |
+
#: ../admin/manage-galleries.php:143
|
1077 |
+
#: ../admin/manage-images.php:345
|
1078 |
+
#: ../admin/manage.php:138
|
1079 |
+
#: ../admin/manage.php:262
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1080 |
msgid "Import metadata"
|
1081 |
msgstr ""
|
1082 |
|
1083 |
+
#: ../admin/manage-galleries.php:144
|
1084 |
+
#: ../admin/manage-images.php:343
|
1085 |
+
#: ../admin/manage.php:128
|
1086 |
+
#: ../admin/manage.php:239
|
1087 |
msgid "Recover from backup"
|
1088 |
msgstr ""
|
1089 |
|
1090 |
+
#: ../admin/manage-galleries.php:146
|
1091 |
+
#: ../admin/manage-images.php:354
|
1092 |
msgid "Apply"
|
1093 |
msgstr ""
|
1094 |
|
1095 |
+
#: ../admin/manage-galleries.php:154
|
1096 |
+
#: ../admin/manage-galleries.php:266
|
1097 |
+
#: ../admin/manage-images.php:330
|
1098 |
+
#: ../admin/manage-images.php:514
|
1099 |
#, php-format
|
1100 |
msgid "Displaying %s–%s of %s"
|
1101 |
msgstr ""
|
1102 |
|
1103 |
+
#: ../admin/manage-galleries.php:219
|
1104 |
+
msgid "Edit"
|
|
|
|
|
1105 |
msgstr ""
|
1106 |
|
1107 |
+
#: ../admin/manage-galleries.php:259
|
1108 |
+
#: ../admin/manage-images.php:505
|
1109 |
+
msgid "No entries found"
|
|
|
|
|
1110 |
msgstr ""
|
1111 |
|
1112 |
+
#: ../admin/manage-galleries.php:313
|
1113 |
+
#: ../admin/manage-images.php:595
|
1114 |
+
msgid "Resize Images to"
|
|
|
1115 |
msgstr ""
|
1116 |
|
1117 |
+
#: ../admin/manage-galleries.php:317
|
1118 |
+
#: ../admin/manage-images.php:599
|
1119 |
+
msgid "Width x height (in pixel). NextGEN Gallery will keep ratio size"
|
1120 |
msgstr ""
|
1121 |
|
1122 |
+
#: ../admin/manage-galleries.php:341
|
1123 |
+
#: ../admin/manage-images.php:623
|
1124 |
+
msgid "Width x height (in pixel)"
|
1125 |
msgstr ""
|
1126 |
|
1127 |
+
#: ../admin/manage-galleries.php:343
|
1128 |
+
#: ../admin/manage-images.php:625
|
1129 |
+
msgid "These values are maximum values "
|
1130 |
msgstr ""
|
1131 |
|
1132 |
+
#: ../admin/manage-galleries.php:346
|
1133 |
+
#: ../admin/manage-images.php:628
|
1134 |
+
msgid "Set fix dimension"
|
1135 |
msgstr ""
|
1136 |
|
1137 |
+
#: ../admin/manage-galleries.php:348
|
1138 |
+
#: ../admin/manage-images.php:630
|
1139 |
+
msgid "Ignore the aspect ratio, no portrait thumbnails"
|
1140 |
msgstr ""
|
1141 |
|
1142 |
+
#: ../admin/manage-galleries.php:371
|
1143 |
+
#: ../admin/manage-images.php:658
|
1144 |
+
msgid "ID"
|
1145 |
msgstr ""
|
1146 |
|
1147 |
+
#: ../admin/manage-galleries.php:373
|
1148 |
+
#: ../admin/manage-images.php:266
|
1149 |
+
#: ../admin/manage-images.php:663
|
1150 |
+
msgid "Description"
|
1151 |
msgstr ""
|
1152 |
|
1153 |
+
#: ../admin/manage-galleries.php:374
|
1154 |
+
#: ../admin/manage-images.php:287
|
1155 |
+
msgid "Author"
|
1156 |
msgstr ""
|
1157 |
|
1158 |
+
#: ../admin/manage-galleries.php:375
|
1159 |
+
msgid "Page ID"
|
|
|
1160 |
msgstr ""
|
1161 |
|
1162 |
+
#: ../admin/manage-galleries.php:376
|
1163 |
+
msgid "Image"
|
1164 |
+
msgid_plural "Images"
|
1165 |
+
msgstr[0] ""
|
1166 |
+
msgstr[1] ""
|
1167 |
+
|
1168 |
+
#: ../admin/manage-images.php:32
|
1169 |
+
msgid "Gallery not found."
|
1170 |
msgstr ""
|
1171 |
|
1172 |
+
#: ../admin/manage-images.php:38
|
1173 |
+
msgid "Sorry, you have no access here"
|
|
|
1174 |
msgstr ""
|
1175 |
|
1176 |
+
#: ../admin/manage-images.php:178
|
1177 |
+
msgid "Copy image to..."
|
|
|
1178 |
msgstr ""
|
1179 |
|
1180 |
+
#: ../admin/manage-images.php:182
|
1181 |
+
msgid "Move image to..."
|
1182 |
msgstr ""
|
1183 |
|
1184 |
+
#: ../admin/manage-images.php:186
|
1185 |
+
msgid "Add new tags"
|
1186 |
+
msgstr ""
|
1187 |
+
|
1188 |
+
#: ../admin/manage-images.php:190
|
1189 |
+
#: ../admin/manage-images.php:351
|
1190 |
+
msgid "Delete tags"
|
1191 |
+
msgstr ""
|
1192 |
+
|
1193 |
+
#: ../admin/manage-images.php:194
|
1194 |
+
msgid "Overwrite"
|
1195 |
msgstr ""
|
1196 |
|
1197 |
+
#: ../admin/manage-images.php:207
|
1198 |
#, php-format
|
1199 |
msgid ""
|
1200 |
"You are about to start the bulk edit for %s images \n"
|
1202 |
" 'Cancel' to stop, 'OK' to proceed."
|
1203 |
msgstr ""
|
1204 |
|
1205 |
+
#: ../admin/manage-images.php:222
|
1206 |
#, php-format
|
1207 |
msgid "Search results for “%s”"
|
1208 |
msgstr ""
|
1209 |
|
1210 |
+
#: ../admin/manage-images.php:251
|
1211 |
msgid "Gallery settings"
|
1212 |
msgstr ""
|
1213 |
|
1214 |
+
#: ../admin/manage-images.php:251
|
1215 |
msgid "Click here for more settings"
|
1216 |
msgstr ""
|
1217 |
|
1218 |
+
#: ../admin/manage-images.php:268
|
1219 |
msgid "Preview image"
|
1220 |
msgstr ""
|
1221 |
|
1222 |
+
#: ../admin/manage-images.php:271
|
1223 |
msgid "No Picture"
|
1224 |
msgstr ""
|
1225 |
|
1226 |
+
#: ../admin/manage-images.php:285
|
1227 |
msgid "Path"
|
1228 |
msgstr ""
|
1229 |
|
1230 |
+
#: ../admin/manage-images.php:302
|
1231 |
msgid "Create new page"
|
1232 |
msgstr ""
|
1233 |
|
1234 |
+
#: ../admin/manage-images.php:305
|
1235 |
msgid "Main page (No parent)"
|
1236 |
msgstr ""
|
1237 |
|
1238 |
+
#: ../admin/manage-images.php:308
|
1239 |
msgid "Add page"
|
1240 |
msgstr ""
|
1241 |
|
1242 |
+
#: ../admin/manage-images.php:317
|
1243 |
msgid "Scan Folder for new images"
|
1244 |
msgstr ""
|
1245 |
|
1246 |
+
#: ../admin/manage-images.php:318
|
1247 |
+
#: ../admin/manage-images.php:360
|
1248 |
+
#: ../admin/manage-images.php:512
|
1249 |
msgid "Save Changes"
|
1250 |
msgstr ""
|
1251 |
|
1252 |
+
#: ../admin/manage-images.php:344
|
1253 |
msgid "Delete images"
|
1254 |
msgstr ""
|
1255 |
|
1256 |
+
#: ../admin/manage-images.php:346
|
1257 |
msgid "Rotate images clockwise"
|
1258 |
msgstr ""
|
1259 |
|
1260 |
+
#: ../admin/manage-images.php:347
|
1261 |
msgid "Rotate images counter-clockwise"
|
1262 |
msgstr ""
|
1263 |
|
1264 |
+
#: ../admin/manage-images.php:348
|
1265 |
msgid "Copy to..."
|
1266 |
msgstr ""
|
1267 |
|
1268 |
+
#: ../admin/manage-images.php:349
|
1269 |
msgid "Move to..."
|
1270 |
msgstr ""
|
1271 |
|
1272 |
+
#: ../admin/manage-images.php:350
|
1273 |
msgid "Add tags"
|
1274 |
msgstr ""
|
1275 |
|
1276 |
+
#: ../admin/manage-images.php:352
|
|
|
|
|
|
|
|
|
1277 |
msgid "Overwrite tags"
|
1278 |
msgstr ""
|
1279 |
|
1280 |
+
#: ../admin/manage-images.php:357
|
1281 |
msgid "Sort gallery"
|
1282 |
msgstr ""
|
1283 |
|
1284 |
+
#: ../admin/manage-images.php:431
|
1285 |
msgid "pixel"
|
1286 |
msgstr ""
|
1287 |
|
1288 |
+
#: ../admin/manage-images.php:437
|
1289 |
#, php-format
|
1290 |
msgid "View \"%s\""
|
1291 |
msgstr ""
|
1292 |
|
1293 |
+
#: ../admin/manage-images.php:437
|
1294 |
msgid "View"
|
1295 |
msgstr ""
|
1296 |
|
1297 |
+
#: ../admin/manage-images.php:438
|
1298 |
msgid "Show Meta data"
|
1299 |
msgstr ""
|
1300 |
|
1301 |
+
#: ../admin/manage-images.php:438
|
1302 |
msgid "Meta"
|
1303 |
msgstr ""
|
1304 |
|
1305 |
+
#: ../admin/manage-images.php:439
|
1306 |
msgid "Customize thumbnail"
|
1307 |
msgstr ""
|
1308 |
|
1309 |
+
#: ../admin/manage-images.php:439
|
1310 |
msgid "Edit thumb"
|
1311 |
msgstr ""
|
1312 |
|
1313 |
+
#: ../admin/manage-images.php:440
|
1314 |
msgid "Rotate"
|
1315 |
msgstr ""
|
1316 |
|
1317 |
+
#: ../admin/manage-images.php:442
|
1318 |
+
msgid "Publish this image"
|
1319 |
+
msgstr ""
|
1320 |
+
|
1321 |
+
#: ../admin/manage-images.php:442
|
1322 |
+
msgid "Publish"
|
1323 |
+
msgstr ""
|
1324 |
+
|
1325 |
+
#: ../admin/manage-images.php:444
|
1326 |
msgid "Recover"
|
1327 |
msgstr ""
|
1328 |
|
1329 |
+
#: ../admin/manage-images.php:444
|
1330 |
#, php-format
|
1331 |
msgid "Recover \"%s\" ?"
|
1332 |
msgstr ""
|
1333 |
|
1334 |
+
#: ../admin/manage-images.php:445
|
1335 |
#, php-format
|
1336 |
msgid "Delete \"%s\" ?"
|
1337 |
msgstr ""
|
1338 |
|
1339 |
+
#: ../admin/manage-images.php:535
|
1340 |
msgid "Enter the tags"
|
1341 |
msgstr ""
|
1342 |
|
1343 |
+
#: ../admin/manage-images.php:559
|
1344 |
msgid "Select the destination gallery:"
|
1345 |
msgstr ""
|
1346 |
|
1347 |
+
#: ../admin/manage-images.php:659
|
1348 |
msgid "Thumbnail"
|
1349 |
msgstr ""
|
1350 |
|
1351 |
+
#: ../admin/manage-images.php:661
|
1352 |
+
#: ../admin/manage-sort.php:77
|
1353 |
msgid "Filename"
|
1354 |
msgstr ""
|
1355 |
|
1356 |
+
#: ../admin/manage-images.php:663
|
1357 |
msgid "Alt & Title Text"
|
1358 |
msgstr ""
|
1359 |
|
1360 |
+
#: ../admin/manage-images.php:664
|
1361 |
msgid "Tags (comma separated list)"
|
1362 |
msgstr ""
|
1363 |
|
1364 |
+
#: ../admin/manage-images.php:666
|
1365 |
msgid "exclude"
|
1366 |
msgstr ""
|
1367 |
|
1368 |
+
#: ../admin/manage-sort.php:33
|
1369 |
msgid "Sort order changed"
|
1370 |
msgstr ""
|
1371 |
|
1372 |
+
#: ../admin/manage-sort.php:62
|
1373 |
msgid "Sort Gallery"
|
1374 |
msgstr ""
|
1375 |
|
1376 |
+
#: ../admin/manage-sort.php:66
|
1377 |
msgid "Update Sort Order"
|
1378 |
msgstr ""
|
1379 |
|
1380 |
+
#: ../admin/manage-sort.php:69
|
1381 |
msgid "Back to gallery"
|
1382 |
msgstr ""
|
1383 |
|
1384 |
+
#: ../admin/manage-sort.php:74
|
1385 |
msgid "Presort"
|
1386 |
msgstr ""
|
1387 |
|
1388 |
+
#: ../admin/manage-sort.php:75
|
1389 |
msgid "Unsorted"
|
1390 |
msgstr ""
|
1391 |
|
1392 |
+
#: ../admin/manage-sort.php:76
|
1393 |
msgid "Image ID"
|
1394 |
msgstr ""
|
1395 |
|
1396 |
+
#: ../admin/manage-sort.php:78
|
1397 |
msgid "Alt/Title text"
|
1398 |
msgstr ""
|
1399 |
|
1400 |
+
#: ../admin/manage-sort.php:79
|
1401 |
msgid "Date/Time"
|
1402 |
msgstr ""
|
1403 |
|
1404 |
+
#: ../admin/manage-sort.php:80
|
1405 |
msgid "Ascending"
|
1406 |
msgstr ""
|
1407 |
|
1408 |
+
#: ../admin/manage-sort.php:81
|
1409 |
msgid "Descending"
|
1410 |
msgstr ""
|
1411 |
|
1412 |
+
#: ../admin/manage.php:77
|
1413 |
+
msgid "Picture"
|
|
|
1414 |
msgstr ""
|
1415 |
|
1416 |
+
#: ../admin/manage.php:77
|
1417 |
+
msgid "deleted successfully"
|
1418 |
msgstr ""
|
1419 |
|
1420 |
+
#: ../admin/manage.php:92
|
1421 |
+
#: ../admin/manage.php:101
|
1422 |
msgid "Operation successful. Please clear your browser cache."
|
1423 |
msgstr ""
|
1424 |
|
1425 |
+
#: ../admin/manage.php:168
|
1426 |
+
msgid "Gallery deleted successfully "
|
1427 |
+
msgstr ""
|
1428 |
+
|
1429 |
+
#: ../admin/manage.php:233
|
1430 |
+
#: ../admin/manage.php:236
|
1431 |
msgid "Rotate images"
|
1432 |
msgstr ""
|
1433 |
|
1434 |
+
#: ../admin/manage.php:258
|
1435 |
msgid "Pictures deleted successfully "
|
1436 |
msgstr ""
|
1437 |
|
1438 |
+
#: ../admin/manage.php:354
|
1439 |
msgid "Tags changed"
|
1440 |
msgstr ""
|
1441 |
|
1442 |
+
#: ../admin/manage.php:390
|
1443 |
msgid "Update successful"
|
1444 |
msgstr ""
|
1445 |
|
1446 |
+
#: ../admin/manage.php:425
|
1447 |
msgid "New gallery page ID"
|
1448 |
msgstr ""
|
1449 |
|
1450 |
+
#: ../admin/manage.php:425
|
1451 |
msgid "created"
|
1452 |
msgstr ""
|
1453 |
|
1454 |
+
#: ../admin/manage.php:461
|
1455 |
+
msgid "Published a new post"
|
1456 |
+
msgstr ""
|
1457 |
+
|
1458 |
+
#: ../admin/media-upload.php:166
|
1459 |
msgid "No gallery"
|
1460 |
msgstr ""
|
1461 |
|
1462 |
+
#: ../admin/media-upload.php:178
|
1463 |
msgid "Select »"
|
1464 |
msgstr ""
|
1465 |
|
1466 |
+
#: ../admin/media-upload.php:209
|
1467 |
msgid "Show"
|
1468 |
msgstr ""
|
1469 |
|
1470 |
+
#: ../admin/media-upload.php:210
|
1471 |
msgid "Hide"
|
1472 |
msgstr ""
|
1473 |
|
1474 |
+
#: ../admin/media-upload.php:215
|
1475 |
msgid "Image ID:"
|
1476 |
msgstr ""
|
1477 |
|
1478 |
+
#: ../admin/media-upload.php:274
|
1479 |
msgid "Save all changes"
|
1480 |
msgstr ""
|
1481 |
|
1529 |
msgstr ""
|
1530 |
|
1531 |
#: ../admin/overview.php:121
|
1532 |
+
msgid "Help translating it."
|
1533 |
msgstr ""
|
1534 |
|
1535 |
#: ../admin/overview.php:140
|
1571 |
msgid "At a Glance"
|
1572 |
msgstr ""
|
1573 |
|
|
|
|
|
|
|
|
|
|
|
|
|
1574 |
#: ../admin/overview.php:305
|
1575 |
msgid "Upload pictures"
|
1576 |
msgstr ""
|
1734 |
msgid "Install"
|
1735 |
msgstr ""
|
1736 |
|
1737 |
+
#: ../admin/publish.php:45
|
1738 |
+
msgid "Post title"
|
1739 |
+
msgstr ""
|
1740 |
+
|
1741 |
+
#: ../admin/publish.php:47
|
1742 |
+
msgid "Enter the post title "
|
1743 |
+
msgstr ""
|
1744 |
+
|
1745 |
+
#: ../admin/publish.php:52
|
1746 |
+
msgid "Size of the image"
|
1747 |
+
msgstr ""
|
1748 |
+
|
1749 |
+
#: ../admin/publish.php:55
|
1750 |
+
msgid "Alignment"
|
1751 |
+
msgstr ""
|
1752 |
+
|
1753 |
+
#: ../admin/publish.php:57
|
1754 |
+
#: ../admin/settings.php:476
|
1755 |
+
msgid "None"
|
1756 |
+
msgstr ""
|
1757 |
+
|
1758 |
+
#: ../admin/publish.php:59
|
1759 |
+
#: ../admin/tinymce/window.php:120
|
1760 |
+
msgid "Left"
|
1761 |
+
msgstr ""
|
1762 |
+
|
1763 |
+
#: ../admin/publish.php:61
|
1764 |
+
#: ../admin/tinymce/window.php:121
|
1765 |
+
msgid "Center"
|
1766 |
+
msgstr ""
|
1767 |
+
|
1768 |
+
#: ../admin/publish.php:63
|
1769 |
+
#: ../admin/tinymce/window.php:122
|
1770 |
+
msgid "Right"
|
1771 |
+
msgstr ""
|
1772 |
+
|
1773 |
+
#: ../admin/publish.php:70
|
1774 |
+
msgid "Draft"
|
1775 |
+
msgstr ""
|
1776 |
+
|
1777 |
#: ../admin/roles.php:22
|
1778 |
msgid "Updated capabilities"
|
1779 |
msgstr ""
|
1783 |
msgstr ""
|
1784 |
|
1785 |
#: ../admin/roles.php:29
|
1786 |
+
msgid "Select the lowest role which should be able to access the following capabilities. NextGEN Gallery supports the standard roles from WordPress."
|
1787 |
msgstr ""
|
1788 |
|
1789 |
#: ../admin/roles.php:30
|
1814 |
msgid "Manage tags"
|
1815 |
msgstr ""
|
1816 |
|
|
|
|
|
|
|
|
|
1817 |
#: ../admin/roles.php:63
|
1818 |
msgid "Change style"
|
1819 |
msgstr ""
|
1850 |
msgid "Flip horizontally"
|
1851 |
msgstr ""
|
1852 |
|
1853 |
+
#: ../admin/settings.php:92
|
1854 |
msgid "Cache cleared"
|
1855 |
msgstr ""
|
1856 |
|
1857 |
+
#: ../admin/settings.php:209
|
1858 |
+
#: ../admin/settings.php:228
|
1859 |
msgid "General Options"
|
1860 |
msgstr ""
|
1861 |
|
1862 |
+
#: ../admin/settings.php:210
|
1863 |
+
#: ../admin/settings.php:413
|
1864 |
msgid "Thumbnails"
|
1865 |
msgstr ""
|
1866 |
|
1867 |
+
#: ../admin/settings.php:211
|
1868 |
msgid "Images"
|
1869 |
msgstr ""
|
1870 |
|
1871 |
+
#: ../admin/settings.php:213
|
1872 |
+
#: ../admin/settings.php:465
|
1873 |
msgid "Effects"
|
1874 |
msgstr ""
|
1875 |
|
1876 |
+
#: ../admin/settings.php:214
|
1877 |
+
#: ../admin/settings.php:507
|
1878 |
+
#: ../admin/tinymce/window.php:110
|
1879 |
msgid "Watermark"
|
1880 |
msgstr ""
|
1881 |
|
1882 |
+
#: ../admin/settings.php:215
|
1883 |
+
#: ../admin/settings.php:414
|
1884 |
+
#: ../admin/settings.php:614
|
1885 |
+
#: ../admin/tinymce/window.php:63
|
1886 |
msgid "Slideshow"
|
1887 |
msgstr ""
|
1888 |
|
1889 |
+
#: ../admin/settings.php:234
|
1890 |
+
#: ../admin/wpmu.php:68
|
1891 |
msgid "Gallery path"
|
1892 |
msgstr ""
|
1893 |
|
1894 |
+
#: ../admin/settings.php:236
|
1895 |
msgid "This is the default path for all galleries"
|
1896 |
msgstr ""
|
1897 |
|
1898 |
+
#: ../admin/settings.php:239
|
1899 |
msgid "Delete image files"
|
1900 |
msgstr ""
|
1901 |
|
1902 |
+
#: ../admin/settings.php:241
|
1903 |
msgid "Delete files, when removing a gallery in the database"
|
1904 |
msgstr ""
|
1905 |
|
1906 |
+
#: ../admin/settings.php:244
|
1907 |
msgid "Activate permalinks"
|
1908 |
msgstr ""
|
1909 |
|
1910 |
+
#: ../admin/settings.php:246
|
1911 |
msgid "When you activate this option, you need to update your permalink structure one time."
|
1912 |
msgstr ""
|
1913 |
|
1914 |
+
#: ../admin/settings.php:249
|
1915 |
+
msgid "Create new URL friendly image slugs"
|
1916 |
+
msgstr ""
|
1917 |
+
|
1918 |
+
#: ../admin/settings.php:250
|
1919 |
+
#: ../admin/settings.php:367
|
1920 |
+
msgid "Proceed now"
|
1921 |
+
msgstr ""
|
1922 |
+
|
1923 |
+
#: ../admin/settings.php:251
|
1924 |
+
msgid "Currently not used, prepare database for upcoming version"
|
1925 |
+
msgstr ""
|
1926 |
+
|
1927 |
+
#: ../admin/settings.php:254
|
1928 |
msgid "Select graphic library"
|
1929 |
msgstr ""
|
1930 |
|
1931 |
+
#: ../admin/settings.php:255
|
1932 |
msgid "GD Library"
|
1933 |
msgstr ""
|
1934 |
|
1935 |
+
#: ../admin/settings.php:256
|
1936 |
msgid "ImageMagick (Experimental). Path to the library :"
|
1937 |
msgstr ""
|
1938 |
|
1939 |
+
#: ../admin/settings.php:261
|
1940 |
msgid "Activate Media RSS feed"
|
1941 |
msgstr ""
|
1942 |
|
1943 |
+
#: ../admin/settings.php:263
|
1944 |
msgid "A RSS feed will be added to you blog header. Useful for CoolIris/PicLens"
|
1945 |
msgstr ""
|
1946 |
|
1947 |
+
#: ../admin/settings.php:266
|
1948 |
msgid "Activate PicLens/CoolIris support"
|
1949 |
msgstr ""
|
1950 |
|
1951 |
+
#: ../admin/settings.php:268
|
1952 |
msgid "When you activate this option, some javascript is added to your site footer. Make sure that wp_footer is called in your theme."
|
1953 |
msgstr ""
|
1954 |
|
1955 |
+
#: ../admin/settings.php:271
|
1956 |
msgid "Tags / Categories"
|
1957 |
msgstr ""
|
1958 |
|
1959 |
+
#: ../admin/settings.php:274
|
1960 |
msgid "Activate related images"
|
1961 |
msgstr ""
|
1962 |
|
1963 |
+
#: ../admin/settings.php:276
|
1964 |
msgid "This option will append related images to every post"
|
1965 |
msgstr ""
|
1966 |
|
1967 |
+
#: ../admin/settings.php:280
|
1968 |
msgid "Match with"
|
1969 |
msgstr ""
|
1970 |
|
1971 |
+
#: ../admin/settings.php:281
|
1972 |
msgid "Categories"
|
1973 |
msgstr ""
|
1974 |
|
1975 |
+
#: ../admin/settings.php:286
|
1976 |
msgid "Max. number of images"
|
1977 |
msgstr ""
|
1978 |
|
1979 |
+
#: ../admin/settings.php:288
|
1980 |
msgid "0 will show all images"
|
1981 |
msgstr ""
|
1982 |
|
1983 |
+
#: ../admin/settings.php:292
|
1984 |
+
#: ../admin/settings.php:323
|
1985 |
+
#: ../admin/settings.php:370
|
1986 |
+
#: ../admin/settings.php:455
|
1987 |
+
#: ../admin/settings.php:490
|
1988 |
+
#: ../admin/settings.php:751
|
1989 |
msgid "More settings"
|
1990 |
msgstr ""
|
1991 |
|
1992 |
+
#: ../admin/settings.php:302
|
1993 |
msgid "Thumbnail settings"
|
1994 |
msgstr ""
|
1995 |
|
1996 |
+
#: ../admin/settings.php:306
|
1997 |
msgid "Please note : If you change the settings, you need to recreate the thumbnails under -> Manage Gallery ."
|
1998 |
msgstr ""
|
1999 |
|
2000 |
+
#: ../admin/settings.php:319
|
2001 |
msgid "Thumbnail quality"
|
2002 |
msgstr ""
|
2003 |
|
2004 |
+
#: ../admin/settings.php:333
|
2005 |
msgid "Image settings"
|
2006 |
msgstr ""
|
2007 |
|
2008 |
+
#: ../admin/settings.php:339
|
2009 |
msgid "Resize Images"
|
2010 |
msgstr ""
|
2011 |
|
2012 |
+
#: ../admin/settings.php:344
|
2013 |
msgid "Image quality"
|
2014 |
msgstr ""
|
2015 |
|
2016 |
+
#: ../admin/settings.php:348
|
2017 |
msgid "Backup original images"
|
2018 |
msgstr ""
|
2019 |
|
2020 |
+
#: ../admin/settings.php:350
|
2021 |
msgid "Creates a backup for inserted images"
|
2022 |
msgstr ""
|
2023 |
|
2024 |
+
#: ../admin/settings.php:353
|
2025 |
msgid "Automatically resize"
|
2026 |
msgstr ""
|
2027 |
|
2028 |
+
#: ../admin/settings.php:355
|
2029 |
msgid "Automatically resize images on upload."
|
2030 |
msgstr ""
|
2031 |
|
2032 |
+
#: ../admin/settings.php:358
|
2033 |
msgid "Single picture"
|
2034 |
msgstr ""
|
2035 |
|
2036 |
+
#: ../admin/settings.php:361
|
2037 |
msgid "Cache single pictures"
|
2038 |
msgstr ""
|
2039 |
|
2040 |
+
#: ../admin/settings.php:363
|
2041 |
msgid "Creates a file for each singlepic settings. Reduce the CPU load"
|
2042 |
msgstr ""
|
2043 |
|
2044 |
+
#: ../admin/settings.php:366
|
2045 |
msgid "Clear cache folder"
|
2046 |
msgstr ""
|
2047 |
|
2048 |
+
#: ../admin/settings.php:387
|
|
|
|
|
|
|
|
|
2049 |
msgid "Deactivate gallery page link"
|
2050 |
msgstr ""
|
2051 |
|
2052 |
+
#: ../admin/settings.php:389
|
2053 |
msgid "The album will not link to a gallery subpage. The gallery is shown on the same page."
|
2054 |
msgstr ""
|
2055 |
|
2056 |
+
#: ../admin/settings.php:393
|
2057 |
msgid "Number of images per page"
|
2058 |
msgstr ""
|
2059 |
|
2060 |
+
#: ../admin/settings.php:395
|
2061 |
msgid "0 will disable pagination, all images on one page"
|
2062 |
msgstr ""
|
2063 |
|
2064 |
+
#: ../admin/settings.php:399
|
2065 |
msgid "Number of columns"
|
2066 |
msgstr ""
|
2067 |
|
2068 |
+
#: ../admin/settings.php:401
|
2069 |
msgid "0 will display as much as possible based on the width of your theme. Setting normally only required for captions below the images"
|
2070 |
msgstr ""
|
2071 |
|
2072 |
+
#: ../admin/settings.php:405
|
2073 |
msgid "Integrate slideshow"
|
2074 |
msgstr ""
|
2075 |
|
2076 |
+
#: ../admin/settings.php:412
|
2077 |
msgid "Show first"
|
2078 |
msgstr ""
|
2079 |
|
2080 |
+
#: ../admin/settings.php:418
|
2081 |
msgid "Show ImageBrowser"
|
2082 |
msgstr ""
|
2083 |
|
2084 |
+
#: ../admin/settings.php:420
|
2085 |
msgid "The gallery will open the ImageBrowser instead the effect."
|
2086 |
msgstr ""
|
2087 |
|
2088 |
+
#: ../admin/settings.php:424
|
2089 |
msgid "Add hidden images"
|
2090 |
msgstr ""
|
2091 |
|
2092 |
+
#: ../admin/settings.php:426
|
2093 |
+
msgid "If pagination is used, this option will still show all images in the modal window (Thickbox, Lightbox etc.). Note : This increases the page load"
|
2094 |
msgstr ""
|
2095 |
|
2096 |
+
#: ../admin/settings.php:430
|
2097 |
msgid "Enable AJAX pagination"
|
2098 |
msgstr ""
|
2099 |
|
2100 |
+
#: ../admin/settings.php:432
|
2101 |
+
msgid "Browse images without reload the page. Note : Works only in combination with Shutter effect"
|
2102 |
msgstr ""
|
2103 |
|
2104 |
+
#: ../admin/settings.php:436
|
2105 |
msgid "Sort options"
|
2106 |
msgstr ""
|
2107 |
|
2108 |
+
#: ../admin/settings.php:439
|
2109 |
msgid "Sort thumbnails"
|
2110 |
msgstr ""
|
2111 |
|
2112 |
+
#: ../admin/settings.php:441
|
2113 |
msgid "Custom order"
|
2114 |
msgstr ""
|
2115 |
|
2116 |
+
#: ../admin/settings.php:443
|
2117 |
msgid "File name"
|
2118 |
msgstr ""
|
2119 |
|
2120 |
+
#: ../admin/settings.php:444
|
2121 |
msgid "Alt / Title text"
|
2122 |
msgstr ""
|
2123 |
|
2124 |
+
#: ../admin/settings.php:445
|
2125 |
msgid "Date / Time"
|
2126 |
msgstr ""
|
2127 |
|
2128 |
+
#: ../admin/settings.php:449
|
2129 |
msgid "Sort direction"
|
2130 |
msgstr ""
|
2131 |
|
2132 |
+
#: ../admin/settings.php:469
|
2133 |
msgid "Here you can select the thumbnail effect, NextGEN Gallery will integrate the required HTML code in the images. Please note that only the Shutter and Thickbox effect will automatic added to your theme."
|
2134 |
msgstr ""
|
2135 |
|
2136 |
+
#: ../admin/settings.php:470
|
2137 |
msgid "With the placeholder"
|
2138 |
msgstr ""
|
2139 |
|
2140 |
+
#: ../admin/settings.php:470
|
2141 |
msgid "you can activate a navigation through the images (depend on the effect). Change the code line only , when you use a different thumbnail effect or you know what you do."
|
2142 |
msgstr ""
|
2143 |
|
2144 |
+
#: ../admin/settings.php:473
|
2145 |
msgid "JavaScript Thumbnail effect"
|
2146 |
msgstr ""
|
2147 |
|
2148 |
+
#: ../admin/settings.php:477
|
|
|
|
|
|
|
|
|
2149 |
msgid "Thickbox"
|
2150 |
msgstr ""
|
2151 |
|
2152 |
+
#: ../admin/settings.php:478
|
2153 |
msgid "Lightbox"
|
2154 |
msgstr ""
|
2155 |
|
2156 |
+
#: ../admin/settings.php:479
|
2157 |
msgid "Highslide"
|
2158 |
msgstr ""
|
2159 |
|
2160 |
+
#: ../admin/settings.php:480
|
2161 |
msgid "Shutter"
|
2162 |
msgstr ""
|
2163 |
|
2164 |
+
#: ../admin/settings.php:481
|
2165 |
msgid "Custom"
|
2166 |
msgstr ""
|
2167 |
|
2168 |
+
#: ../admin/settings.php:486
|
2169 |
msgid "Link Code line"
|
2170 |
msgstr ""
|
2171 |
|
2172 |
+
#: ../admin/settings.php:508
|
2173 |
msgid "Please note : You can only activate the watermark under -> Manage Gallery . This action cannot be undone."
|
2174 |
msgstr ""
|
2175 |
|
2176 |
+
#: ../admin/settings.php:513
|
2177 |
msgid "Preview"
|
2178 |
msgstr ""
|
2179 |
|
2180 |
+
#: ../admin/settings.php:515
|
2181 |
+
#: ../admin/settings.php:520
|
2182 |
msgid "Position"
|
2183 |
msgstr ""
|
2184 |
|
2185 |
+
#: ../admin/settings.php:540
|
2186 |
msgid "Offset"
|
2187 |
msgstr ""
|
2188 |
|
2189 |
+
#: ../admin/settings.php:556
|
2190 |
msgid "Use image as watermark"
|
2191 |
msgstr ""
|
2192 |
|
2193 |
+
#: ../admin/settings.php:559
|
2194 |
msgid "URL to file"
|
2195 |
msgstr ""
|
2196 |
|
2197 |
+
#: ../admin/settings.php:561
|
2198 |
msgid "The accessing of URL files is disabled at your server (allow_url_fopen)"
|
2199 |
msgstr ""
|
2200 |
|
2201 |
+
#: ../admin/settings.php:564
|
2202 |
msgid "Use text as watermark"
|
2203 |
msgstr ""
|
2204 |
|
2205 |
+
#: ../admin/settings.php:567
|
2206 |
msgid "Font"
|
2207 |
msgstr ""
|
2208 |
|
2209 |
+
#: ../admin/settings.php:576
|
2210 |
msgid "This function will not work, cause you need the FreeType library"
|
2211 |
msgstr ""
|
2212 |
|
2213 |
+
#: ../admin/settings.php:578
|
2214 |
msgid "You can upload more fonts in the folder <strong>nggallery/fonts</strong>"
|
2215 |
msgstr ""
|
2216 |
|
2217 |
+
#: ../admin/settings.php:583
|
2218 |
msgid "Size"
|
2219 |
msgstr ""
|
2220 |
|
2221 |
+
#: ../admin/settings.php:587
|
2222 |
msgid "Color"
|
2223 |
msgstr ""
|
2224 |
|
2225 |
+
#: ../admin/settings.php:589
|
2226 |
msgid "(hex w/o #)"
|
2227 |
msgstr ""
|
2228 |
|
2229 |
+
#: ../admin/settings.php:592
|
2230 |
msgid "Text"
|
2231 |
msgstr ""
|
2232 |
|
2233 |
+
#: ../admin/settings.php:596
|
2234 |
msgid "Opaque"
|
2235 |
msgstr ""
|
2236 |
|
2237 |
+
#: ../admin/settings.php:617
|
2238 |
msgid "Default size (W x H)"
|
2239 |
msgstr ""
|
2240 |
|
2241 |
+
#: ../admin/settings.php:622
|
2242 |
msgid "Duration time"
|
2243 |
msgstr ""
|
2244 |
|
2245 |
+
#: ../admin/settings.php:623
|
2246 |
msgid "sec."
|
2247 |
msgstr ""
|
2248 |
|
2249 |
+
#: ../admin/settings.php:626
|
2250 |
+
#: ../admin/settings.php:701
|
2251 |
msgid "Transition / Fade effect"
|
2252 |
msgstr ""
|
2253 |
|
2254 |
+
#: ../admin/settings.php:629
|
2255 |
+
#: ../admin/settings.php:704
|
2256 |
msgid "fade"
|
2257 |
msgstr ""
|
2258 |
|
2259 |
+
#: ../admin/settings.php:630
|
2260 |
msgid "blindX"
|
2261 |
msgstr ""
|
2262 |
|
2263 |
+
#: ../admin/settings.php:631
|
2264 |
msgid "cover"
|
2265 |
msgstr ""
|
2266 |
|
2267 |
+
#: ../admin/settings.php:632
|
2268 |
msgid "scrollUp"
|
2269 |
msgstr ""
|
2270 |
|
2271 |
+
#: ../admin/settings.php:633
|
2272 |
msgid "scrollDown"
|
2273 |
msgstr ""
|
2274 |
|
2275 |
+
#: ../admin/settings.php:634
|
2276 |
msgid "shuffle"
|
2277 |
msgstr ""
|
2278 |
|
2279 |
+
#: ../admin/settings.php:635
|
2280 |
msgid "toss"
|
2281 |
msgstr ""
|
2282 |
|
2283 |
+
#: ../admin/settings.php:636
|
2284 |
msgid "wipe"
|
2285 |
msgstr ""
|
2286 |
|
2287 |
+
#: ../admin/settings.php:638
|
2288 |
msgid "See here for more information about the effects :"
|
2289 |
msgstr ""
|
2290 |
|
2291 |
+
#: ../admin/settings.php:642
|
2292 |
msgid "Settings for the JW Image Rotator"
|
2293 |
msgstr ""
|
2294 |
|
2295 |
+
#: ../admin/settings.php:643
|
2296 |
msgid "The settings are only used in the JW Image Rotator Version"
|
2297 |
msgstr ""
|
2298 |
|
2299 |
+
#: ../admin/settings.php:644
|
2300 |
msgid "See more information for the Flash Player on the web page"
|
2301 |
msgstr ""
|
2302 |
|
2303 |
+
#: ../admin/settings.php:649
|
2304 |
msgid "The path to imagerotator.swf is not defined, the slideshow will not work."
|
2305 |
msgstr ""
|
2306 |
|
2307 |
+
#: ../admin/settings.php:650
|
2308 |
msgid "If you would like to use the JW Image Rotatator, please download the player <a href=\"http://www.longtailvideo.com/players/jw-image-rotator/\" target=\"_blank\" >here</a> and upload it to your Upload folder (Default is wp-content/uploads)."
|
2309 |
msgstr ""
|
2310 |
|
2311 |
+
#: ../admin/settings.php:656
|
2312 |
msgid "Enable flash slideshow"
|
2313 |
msgstr ""
|
2314 |
|
2315 |
+
#: ../admin/settings.php:658
|
2316 |
+
msgid "Integrate the flash based slideshow for all flash supported devices"
|
2317 |
msgstr ""
|
2318 |
|
2319 |
+
#: ../admin/settings.php:661
|
2320 |
msgid "Path to the Imagerotator (URL)"
|
2321 |
msgstr ""
|
2322 |
|
2323 |
+
#: ../admin/settings.php:664
|
2324 |
msgid "Search now"
|
2325 |
msgstr ""
|
2326 |
|
2327 |
+
#: ../admin/settings.php:665
|
2328 |
+
msgid "Press the button to search automatically for the imagerotator, if you uploaded it to wp-content/uploads or a subfolder"
|
2329 |
msgstr ""
|
2330 |
|
2331 |
+
#: ../admin/settings.php:669
|
2332 |
msgid "Shuffle mode"
|
2333 |
msgstr ""
|
2334 |
|
2335 |
+
#: ../admin/settings.php:673
|
2336 |
msgid "Show next image on click"
|
2337 |
msgstr ""
|
2338 |
|
2339 |
+
#: ../admin/settings.php:677
|
2340 |
msgid "Show navigation bar"
|
2341 |
msgstr ""
|
2342 |
|
2343 |
+
#: ../admin/settings.php:681
|
2344 |
msgid "Show loading icon"
|
2345 |
msgstr ""
|
2346 |
|
2347 |
+
#: ../admin/settings.php:685
|
2348 |
msgid "Use watermark logo"
|
2349 |
msgstr ""
|
2350 |
|
2351 |
+
#: ../admin/settings.php:687
|
2352 |
msgid "You can change the logo at the watermark settings"
|
2353 |
msgstr ""
|
2354 |
|
2355 |
+
#: ../admin/settings.php:690
|
2356 |
msgid "Stretch image"
|
2357 |
msgstr ""
|
2358 |
|
2359 |
+
#: ../admin/settings.php:693
|
2360 |
msgid "true"
|
2361 |
msgstr ""
|
2362 |
|
2363 |
+
#: ../admin/settings.php:694
|
2364 |
msgid "false"
|
2365 |
msgstr ""
|
2366 |
|
2367 |
+
#: ../admin/settings.php:695
|
2368 |
msgid "fit"
|
2369 |
msgstr ""
|
2370 |
|
2371 |
+
#: ../admin/settings.php:696
|
2372 |
msgid "none"
|
2373 |
msgstr ""
|
2374 |
|
2375 |
+
#: ../admin/settings.php:705
|
2376 |
msgid "bgfade"
|
2377 |
msgstr ""
|
2378 |
|
2379 |
+
#: ../admin/settings.php:706
|
2380 |
msgid "slowfade"
|
2381 |
msgstr ""
|
2382 |
|
2383 |
+
#: ../admin/settings.php:707
|
2384 |
msgid "circles"
|
2385 |
msgstr ""
|
2386 |
|
2387 |
+
#: ../admin/settings.php:708
|
2388 |
msgid "bubbles"
|
2389 |
msgstr ""
|
2390 |
|
2391 |
+
#: ../admin/settings.php:709
|
2392 |
msgid "blocks"
|
2393 |
msgstr ""
|
2394 |
|
2395 |
+
#: ../admin/settings.php:710
|
2396 |
msgid "fluids"
|
2397 |
msgstr ""
|
2398 |
|
2399 |
+
#: ../admin/settings.php:711
|
2400 |
msgid "flash"
|
2401 |
msgstr ""
|
2402 |
|
2403 |
+
#: ../admin/settings.php:712
|
2404 |
msgid "lines"
|
2405 |
msgstr ""
|
2406 |
|
2407 |
+
#: ../admin/settings.php:713
|
2408 |
msgid "random"
|
2409 |
msgstr ""
|
2410 |
|
2411 |
+
#: ../admin/settings.php:718
|
2412 |
msgid "Use slow zooming effect"
|
2413 |
msgstr ""
|
2414 |
|
2415 |
+
#: ../admin/settings.php:722
|
2416 |
msgid "Background Color"
|
2417 |
msgstr ""
|
2418 |
|
2419 |
+
#: ../admin/settings.php:727
|
2420 |
msgid "Texts / Buttons Color"
|
2421 |
msgstr ""
|
2422 |
|
2423 |
+
#: ../admin/settings.php:732
|
2424 |
msgid "Rollover / Active Color"
|
2425 |
msgstr ""
|
2426 |
|
2427 |
+
#: ../admin/settings.php:737
|
2428 |
msgid "Screen Color"
|
2429 |
msgstr ""
|
2430 |
|
2431 |
+
#: ../admin/settings.php:742
|
2432 |
msgid "Background music (URL)"
|
2433 |
msgstr ""
|
2434 |
|
2435 |
+
#: ../admin/settings.php:746
|
2436 |
msgid "Try XHTML validation (with CDATA)"
|
2437 |
msgstr ""
|
2438 |
|
2439 |
+
#: ../admin/settings.php:748
|
2440 |
msgid "Important : Could causes problem at some browser. Please recheck your page."
|
2441 |
msgstr ""
|
2442 |
|
2702 |
msgid "Slug(s) to set:"
|
2703 |
msgstr ""
|
2704 |
|
2705 |
+
#: ../admin/upgrade.php:22
|
2706 |
msgid "Upgrade database structure..."
|
2707 |
msgstr ""
|
2708 |
|
2709 |
+
#: ../admin/upgrade.php:108
|
|
|
2710 |
#: ../admin/upgrade.php:122
|
2711 |
+
#: ../admin/upgrade.php:129
|
2712 |
+
#: ../admin/upgrade.php:140
|
2713 |
+
#: ../admin/upgrade.php:154
|
2714 |
msgid "finished"
|
2715 |
msgstr ""
|
2716 |
|
2717 |
+
#: ../admin/upgrade.php:120
|
2718 |
msgid "Update file structure..."
|
2719 |
msgstr ""
|
2720 |
|
2721 |
+
#: ../admin/upgrade.php:127
|
2722 |
msgid "Import date and time information..."
|
2723 |
msgstr ""
|
2724 |
|
2725 |
+
#: ../admin/upgrade.php:135
|
2726 |
msgid "Move imagerotator to new location..."
|
2727 |
msgstr ""
|
2728 |
|
2729 |
+
#: ../admin/upgrade.php:146
|
2730 |
msgid "Update settings..."
|
2731 |
msgstr ""
|
2732 |
|
2733 |
+
#: ../admin/upgrade.php:160
|
2734 |
msgid "Updated widget structure. If you used NextGEN Widgets, you need to setup them again..."
|
2735 |
msgstr ""
|
2736 |
|
2737 |
+
#: ../admin/upgrade.php:168
|
2738 |
msgid "Updated options."
|
2739 |
msgstr ""
|
2740 |
|
2741 |
+
#: ../admin/upgrade.php:175
|
2742 |
+
msgid "Create unique slug"
|
2743 |
+
msgstr ""
|
2744 |
+
|
2745 |
+
#: ../admin/upgrade.php:176
|
2746 |
+
msgid "One of the upcomming features are a reworked permalinks structure."
|
2747 |
+
msgstr ""
|
2748 |
+
|
2749 |
+
#: ../admin/upgrade.php:177
|
2750 |
+
msgid "Therefore it's needed to have a unique identifier for each image, gallery and album."
|
2751 |
+
msgstr ""
|
2752 |
+
|
2753 |
+
#: ../admin/upgrade.php:178
|
2754 |
+
msgid "Depend on the amount of database entries this will take a while, don't reload this page."
|
2755 |
+
msgstr ""
|
2756 |
+
|
2757 |
+
#: ../admin/upgrade.php:187
|
2758 |
msgid "Could not find NextGEN Gallery database tables, upgrade failed !"
|
2759 |
msgstr ""
|
2760 |
|
2761 |
+
#: ../admin/upgrade.php:250
|
2762 |
msgid "Some folders/files could not renamed, please recheck the permission and rescan the folder in the manage gallery section."
|
2763 |
msgstr ""
|
2764 |
|
2765 |
+
#: ../admin/upgrade.php:252
|
2766 |
msgid "Rename failed"
|
2767 |
msgstr ""
|
2768 |
|
2769 |
+
#: ../admin/upgrade.php:348
|
2770 |
+
#: ../admin/upgrade.php:367
|
2771 |
msgid "Upgrade NextGEN Gallery"
|
2772 |
msgstr ""
|
2773 |
|
2774 |
+
#: ../admin/upgrade.php:349
|
2775 |
msgid "The script detect that you upgrade from a older version."
|
2776 |
msgstr ""
|
2777 |
|
2778 |
+
#: ../admin/upgrade.php:350
|
2779 |
msgid "Your database tables for NextGEN Gallery is out-of-date, and must be upgraded before you can continue."
|
2780 |
msgstr ""
|
2781 |
|
2782 |
+
#: ../admin/upgrade.php:351
|
2783 |
msgid "If you would like to downgrade later, please make first a complete backup of your database and the images."
|
2784 |
msgstr ""
|
2785 |
|
2786 |
+
#: ../admin/upgrade.php:352
|
2787 |
msgid "The upgrade process may take a while, so please be patient."
|
2788 |
msgstr ""
|
2789 |
|
2790 |
+
#: ../admin/upgrade.php:353
|
2791 |
msgid "Start upgrade now"
|
2792 |
msgstr ""
|
2793 |
|
2794 |
+
#: ../admin/upgrade.php:369
|
2795 |
msgid "Upgrade finished..."
|
2796 |
msgstr ""
|
2797 |
|
2798 |
+
#: ../admin/upgrade.php:370
|
2799 |
msgid "Continue"
|
2800 |
msgstr ""
|
2801 |
|
2802 |
+
#: ../admin/upgrade.php:397
|
2803 |
+
#, php-format
|
2804 |
+
msgid "Rebuild image structure : %s / %s images"
|
2805 |
+
msgstr ""
|
2806 |
+
|
2807 |
+
#: ../admin/upgrade.php:398
|
2808 |
+
#, php-format
|
2809 |
+
msgid "Rebuild gallery structure : %s / %s galleries"
|
2810 |
+
msgstr ""
|
2811 |
+
|
2812 |
+
#: ../admin/upgrade.php:399
|
2813 |
+
#, php-format
|
2814 |
+
msgid "Rebuild album structure : %s / %s albums"
|
2815 |
+
msgstr ""
|
2816 |
+
|
2817 |
+
#: ../admin/upgrade.php:456
|
2818 |
+
msgid "Done."
|
2819 |
+
msgstr ""
|
2820 |
+
|
2821 |
+
#: ../admin/wpmu.php:33
|
2822 |
msgid "Update successfully"
|
2823 |
msgstr ""
|
2824 |
|
2825 |
+
#: ../admin/wpmu.php:45
|
2826 |
+
#, php-format
|
2827 |
+
msgid "Thanks for using this plugin, NextGEN Gallery is initially developed for self hosted blogs. A multisite setup is possible, but cannot currently fully supported, as it can have several special condition ( i.e. Domain mapping).<br /> If you would like to support the further development, please consider a <strong><a href=\"%s\">donation</a></strong>! If you still need some help, please post your questions <a href=\"http://wordpress.org/tags/nextgen-gallery?forum_id=10\">here</a> ."
|
2828 |
+
msgstr ""
|
2829 |
+
|
2830 |
+
#: ../admin/wpmu.php:62
|
2831 |
+
msgid "Network Options"
|
2832 |
msgstr ""
|
2833 |
|
2834 |
+
#: ../admin/wpmu.php:70
|
2835 |
+
msgid "This is the default path for all blogs. With the placeholder %BLOG_ID% you can organize the folder structure better."
|
2836 |
+
msgstr ""
|
2837 |
+
|
2838 |
+
#: ../admin/wpmu.php:71
|
2839 |
+
#, php-format
|
2840 |
+
msgid "The default setting should be %s"
|
2841 |
msgstr ""
|
2842 |
|
2843 |
+
#: ../admin/wpmu.php:75
|
2844 |
msgid "Enable upload quota check"
|
2845 |
msgstr ""
|
2846 |
|
2847 |
+
#: ../admin/wpmu.php:77
|
2848 |
msgid "Should work if the gallery is bellow the blog.dir"
|
2849 |
msgstr ""
|
2850 |
|
2851 |
+
#: ../admin/wpmu.php:81
|
2852 |
msgid "Enable zip upload option"
|
2853 |
msgstr ""
|
2854 |
|
2855 |
+
#: ../admin/wpmu.php:83
|
2856 |
msgid "Allow users to upload zip folders."
|
2857 |
msgstr ""
|
2858 |
|
2859 |
+
#: ../admin/wpmu.php:87
|
2860 |
+
msgid "Enable import function"
|
2861 |
+
msgstr ""
|
2862 |
+
|
2863 |
+
#: ../admin/wpmu.php:89
|
2864 |
+
msgid "Allow users to import images folders from the server."
|
2865 |
+
msgstr ""
|
2866 |
+
|
2867 |
+
#: ../admin/wpmu.php:93
|
2868 |
msgid "Enable style selection"
|
2869 |
msgstr ""
|
2870 |
|
2871 |
+
#: ../admin/wpmu.php:95
|
2872 |
msgid "Allow users to choose a style for the gallery."
|
2873 |
msgstr ""
|
2874 |
|
2875 |
+
#: ../admin/wpmu.php:99
|
2876 |
msgid "Enable roles/capabilities"
|
2877 |
msgstr ""
|
2878 |
|
2879 |
+
#: ../admin/wpmu.php:101
|
2880 |
msgid "Allow users to change the roles for other blog authors."
|
2881 |
msgstr ""
|
2882 |
|
2883 |
+
#: ../admin/wpmu.php:105
|
2884 |
msgid "Default style"
|
2885 |
msgstr ""
|
2886 |
|
2887 |
+
#: ../admin/wpmu.php:122
|
2888 |
msgid "Choose the default style for the galleries."
|
2889 |
msgstr ""
|
2890 |
|
2891 |
+
#: ../admin/tinymce/window.php:56
|
2892 |
+
msgid "Select or enter gallery"
|
2893 |
msgstr ""
|
2894 |
|
2895 |
+
#: ../admin/tinymce/window.php:61
|
2896 |
+
#: ../admin/tinymce/window.php:82
|
2897 |
msgid "Show as"
|
2898 |
msgstr ""
|
2899 |
|
2900 |
+
#: ../admin/tinymce/window.php:62
|
2901 |
msgid "Image list"
|
2902 |
msgstr ""
|
2903 |
|
2904 |
+
#: ../admin/tinymce/window.php:64
|
2905 |
msgid "Imagebrowser"
|
2906 |
msgstr ""
|
2907 |
|
2908 |
+
#: ../admin/tinymce/window.php:77
|
2909 |
+
msgid "Select or enter album"
|
2910 |
msgstr ""
|
2911 |
|
2912 |
+
#: ../admin/tinymce/window.php:83
|
2913 |
msgid "Extended version"
|
2914 |
msgstr ""
|
2915 |
|
2916 |
+
#: ../admin/tinymce/window.php:84
|
2917 |
msgid "Compact version"
|
2918 |
msgstr ""
|
2919 |
|
2920 |
#: ../admin/tinymce/window.php:97
|
2921 |
+
msgid "Select or enter picture"
|
2922 |
msgstr ""
|
2923 |
|
2924 |
+
#: ../admin/tinymce/window.php:102
|
2925 |
msgid "Width x Height"
|
2926 |
msgstr ""
|
2927 |
|
2928 |
+
#: ../admin/tinymce/window.php:106
|
2929 |
msgid "Effect"
|
2930 |
msgstr ""
|
2931 |
|
2932 |
+
#: ../admin/tinymce/window.php:109
|
2933 |
msgid "No effect"
|
2934 |
msgstr ""
|
2935 |
|
2936 |
+
#: ../admin/tinymce/window.php:111
|
2937 |
msgid "Web 2.0"
|
2938 |
msgstr ""
|
2939 |
|
2940 |
+
#: ../admin/tinymce/window.php:116
|
2941 |
msgid "Float"
|
2942 |
msgstr ""
|
2943 |
|
2944 |
+
#: ../admin/tinymce/window.php:119
|
2945 |
msgid "No float"
|
2946 |
msgstr ""
|
2947 |
|
2948 |
+
#: ../admin/tinymce/window.php:138
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2949 |
msgid "Insert"
|
2950 |
msgstr ""
|
2951 |
|
2979 |
msgid "Not fired"
|
2980 |
msgstr ""
|
2981 |
|
2982 |
+
#: ../lib/meta.php:426
|
2983 |
msgid "Aperture"
|
2984 |
msgstr ""
|
2985 |
|
2986 |
+
#: ../lib/meta.php:427
|
2987 |
+
#: ../lib/meta.php:452
|
2988 |
msgid "Credit"
|
2989 |
msgstr ""
|
2990 |
|
2991 |
+
#: ../lib/meta.php:428
|
2992 |
msgid "Camera"
|
2993 |
msgstr ""
|
2994 |
|
2995 |
+
#: ../lib/meta.php:429
|
2996 |
msgid "Caption"
|
2997 |
msgstr ""
|
2998 |
|
2999 |
+
#: ../lib/meta.php:431
|
3000 |
msgid "Copyright"
|
3001 |
msgstr ""
|
3002 |
|
3003 |
+
#: ../lib/meta.php:432
|
3004 |
msgid "Focal length"
|
3005 |
msgstr ""
|
3006 |
|
3007 |
+
#: ../lib/meta.php:433
|
3008 |
msgid "ISO"
|
3009 |
msgstr ""
|
3010 |
|
3011 |
+
#: ../lib/meta.php:434
|
3012 |
msgid "Shutter speed"
|
3013 |
msgstr ""
|
3014 |
|
3015 |
+
#: ../lib/meta.php:438
|
3016 |
msgid "Subject"
|
3017 |
msgstr ""
|
3018 |
|
3019 |
+
#: ../lib/meta.php:439
|
3020 |
msgid "Make"
|
3021 |
msgstr ""
|
3022 |
|
3023 |
+
#: ../lib/meta.php:440
|
3024 |
msgid "Edit Status"
|
3025 |
msgstr ""
|
3026 |
|
3027 |
+
#: ../lib/meta.php:441
|
3028 |
msgid "Category"
|
3029 |
msgstr ""
|
3030 |
|
3031 |
+
#: ../lib/meta.php:442
|
3032 |
msgid "Keywords"
|
3033 |
msgstr ""
|
3034 |
|
3035 |
+
#: ../lib/meta.php:443
|
3036 |
msgid "Date Created"
|
3037 |
msgstr ""
|
3038 |
|
3039 |
+
#: ../lib/meta.php:444
|
3040 |
msgid "Time Created"
|
3041 |
msgstr ""
|
3042 |
|
3043 |
+
#: ../lib/meta.php:445
|
3044 |
msgid "Author Position"
|
3045 |
msgstr ""
|
3046 |
|
3047 |
+
#: ../lib/meta.php:446
|
3048 |
msgid "City"
|
3049 |
msgstr ""
|
3050 |
|
3051 |
+
#: ../lib/meta.php:447
|
3052 |
msgid "Location"
|
3053 |
msgstr ""
|
3054 |
|
3055 |
+
#: ../lib/meta.php:448
|
3056 |
msgid "Province/State"
|
3057 |
msgstr ""
|
3058 |
|
3059 |
+
#: ../lib/meta.php:449
|
3060 |
msgid "Country code"
|
3061 |
msgstr ""
|
3062 |
|
3063 |
+
#: ../lib/meta.php:450
|
3064 |
msgid "Country"
|
3065 |
msgstr ""
|
3066 |
|
3067 |
+
#: ../lib/meta.php:451
|
3068 |
msgid "Headline"
|
3069 |
msgstr ""
|
3070 |
|
3071 |
+
#: ../lib/meta.php:453
|
3072 |
msgid "Source"
|
3073 |
msgstr ""
|
3074 |
|
3075 |
+
#: ../lib/meta.php:454
|
3076 |
msgid "Copyright Notice"
|
3077 |
msgstr ""
|
3078 |
|
3079 |
+
#: ../lib/meta.php:455
|
3080 |
msgid "Contact"
|
3081 |
msgstr ""
|
3082 |
|
3083 |
+
#: ../lib/meta.php:456
|
3084 |
msgid "Last modified"
|
3085 |
msgstr ""
|
3086 |
|
3087 |
+
#: ../lib/meta.php:457
|
3088 |
msgid "Program tool"
|
3089 |
msgstr ""
|
3090 |
|
3091 |
+
#: ../lib/meta.php:458
|
3092 |
msgid "Format"
|
3093 |
msgstr ""
|
3094 |
|
3095 |
+
#: ../lib/meta.php:459
|
3096 |
msgid "Image Width"
|
3097 |
msgstr ""
|
3098 |
|
3099 |
+
#: ../lib/meta.php:460
|
3100 |
msgid "Image Height"
|
3101 |
msgstr ""
|
3102 |
|
3103 |
+
#: ../lib/meta.php:461
|
3104 |
msgid "Flash"
|
3105 |
msgstr ""
|
3106 |
|
3108 |
msgid "Sorry, you have used your space allocation. Please delete some files to upload more files."
|
3109 |
msgstr ""
|
3110 |
|
3111 |
+
#: ../lib/ngg-db.php:330
|
3112 |
+
#: ../lib/ngg-db.php:331
|
3113 |
msgid "Album overview"
|
3114 |
msgstr ""
|
3115 |
|
3185 |
msgid "%s slug(s) edited."
|
3186 |
msgstr ""
|
3187 |
|
3188 |
+
#: ../lib/xmlrpc.php:64
|
3189 |
#, php-format
|
3190 |
msgid "XML-RPC services are disabled on this blog. An admin user can enable them at %s"
|
3191 |
msgstr ""
|
3192 |
|
3193 |
+
#: ../lib/xmlrpc.php:71
|
3194 |
msgid "Bad login/pass combination."
|
3195 |
msgstr ""
|
3196 |
|
3197 |
+
#: ../lib/xmlrpc.php:127
|
3198 |
msgid "You are not allowed to upload files to this site."
|
3199 |
msgstr ""
|
3200 |
|
3201 |
+
#: ../lib/xmlrpc.php:133
|
3202 |
+
#: ../lib/xmlrpc.php:580
|
3203 |
msgid "Could not find gallery "
|
3204 |
msgstr ""
|
3205 |
|
3206 |
+
#: ../lib/xmlrpc.php:138
|
3207 |
+
#: ../lib/xmlrpc.php:585
|
3208 |
msgid "You are not allowed to upload files to this gallery."
|
3209 |
msgstr ""
|
3210 |
|
3211 |
+
#: ../lib/xmlrpc.php:150
|
3212 |
msgid "This is no valid image file."
|
3213 |
msgstr ""
|
3214 |
|
3215 |
+
#: ../lib/xmlrpc.php:162
|
3216 |
msgid "Could not find image id "
|
3217 |
msgstr ""
|
3218 |
|
3219 |
+
#: ../lib/xmlrpc.php:169
|
3220 |
#, php-format
|
3221 |
msgid "Failed to delete image %1$s "
|
3222 |
msgstr ""
|
3223 |
|
3224 |
+
#: ../lib/xmlrpc.php:178
|
3225 |
#, php-format
|
3226 |
msgid "Could not write file %1$s (%2$s)"
|
3227 |
msgstr ""
|
3228 |
|
3229 |
+
#: ../lib/xmlrpc.php:246
|
3230 |
+
#: ../lib/xmlrpc.php:476
|
3231 |
+
#: ../lib/xmlrpc.php:542
|
3232 |
+
msgid "Sorry, you must be able to manage galleries"
|
3233 |
msgstr ""
|
3234 |
|
3235 |
+
#: ../lib/xmlrpc.php:252
|
3236 |
msgid "Sorry, could not create the gallery"
|
3237 |
msgstr ""
|
3238 |
|
3239 |
+
#: ../lib/xmlrpc.php:295
|
3240 |
+
#: ../lib/xmlrpc.php:473
|
3241 |
+
msgid "Invalid gallery ID"
|
3242 |
+
msgstr ""
|
3243 |
+
|
3244 |
+
#: ../lib/xmlrpc.php:298
|
3245 |
+
msgid "Sorry, you must be able to manage this gallery"
|
3246 |
+
msgstr ""
|
3247 |
+
|
3248 |
+
#: ../lib/xmlrpc.php:304
|
3249 |
+
msgid "Sorry, could not update the gallery"
|
3250 |
+
msgstr ""
|
3251 |
+
|
3252 |
+
#: ../lib/xmlrpc.php:344
|
3253 |
+
#: ../lib/xmlrpc.php:396
|
3254 |
+
#: ../lib/xmlrpc.php:438
|
3255 |
+
#: ../lib/xmlrpc.php:509
|
3256 |
+
msgid "Sorry, you must be able to manage albums"
|
3257 |
+
msgstr ""
|
3258 |
+
|
3259 |
+
#: ../lib/xmlrpc.php:350
|
3260 |
+
msgid "Sorry, could not create the album"
|
3261 |
+
msgstr ""
|
3262 |
+
|
3263 |
+
#: ../lib/xmlrpc.php:393
|
3264 |
+
#: ../lib/xmlrpc.php:435
|
3265 |
+
msgid "Invalid album ID"
|
3266 |
+
msgstr ""
|
3267 |
+
|
3268 |
+
#: ../lib/xmlrpc.php:402
|
3269 |
+
msgid "Sorry, could not update the album"
|
3270 |
+
msgstr ""
|
3271 |
+
|
3272 |
#: ../view/album-compact.php:32
|
3273 |
#: ../view/album-extend.php:30
|
3274 |
msgid "Photos"
|
lib/gd.thumbnail.inc.php
CHANGED
@@ -624,6 +624,10 @@ class ngg_Thumbnail {
|
|
624 |
$this->errmsg = 'Create Image failed. Check safe mode settings';
|
625 |
return false;
|
626 |
}
|
|
|
|
|
|
|
|
|
627 |
return true;
|
628 |
}
|
629 |
|
@@ -940,4 +944,4 @@ class ngg_Thumbnail {
|
|
940 |
return true;
|
941 |
}
|
942 |
}
|
943 |
-
?>
|
624 |
$this->errmsg = 'Create Image failed. Check safe mode settings';
|
625 |
return false;
|
626 |
}
|
627 |
+
|
628 |
+
if( function_exists('do_action') )
|
629 |
+
do_action('ngg_ajax_image_save', $name);
|
630 |
+
|
631 |
return true;
|
632 |
}
|
633 |
|
944 |
return true;
|
945 |
}
|
946 |
}
|
947 |
+
?>
|
lib/image.php
CHANGED
@@ -72,6 +72,7 @@ class nggImage{
|
|
72 |
$this->imageHTML = $this->get_href_link();
|
73 |
$this->thumbHTML = $this->get_href_thumb_link();
|
74 |
|
|
|
75 |
wp_cache_add($this->pid, $this, 'ngg_image');
|
76 |
|
77 |
// Get tags only if necessary
|
72 |
$this->imageHTML = $this->get_href_link();
|
73 |
$this->thumbHTML = $this->get_href_thumb_link();
|
74 |
|
75 |
+
do_action_ref_array('ngg_get_image', array(&$this));
|
76 |
wp_cache_add($this->pid, $this, 'ngg_image');
|
77 |
|
78 |
// Get tags only if necessary
|
lib/imagemagick.inc.php
CHANGED
@@ -564,6 +564,10 @@ var $imageMagickBefore;
|
|
564 |
//$this->errmsg = 'Create Image failed. Check safe mode settings';
|
565 |
return false;
|
566 |
}
|
|
|
|
|
|
|
|
|
567 |
return true;
|
568 |
}
|
569 |
|
@@ -591,4 +595,4 @@ var $imageMagickBefore;
|
|
591 |
}
|
592 |
}
|
593 |
}
|
594 |
-
?>
|
564 |
//$this->errmsg = 'Create Image failed. Check safe mode settings';
|
565 |
return false;
|
566 |
}
|
567 |
+
|
568 |
+
if( function_exists('do_action') )
|
569 |
+
do_action('ngg_ajax_image_save', $name);
|
570 |
+
|
571 |
return true;
|
572 |
}
|
573 |
|
595 |
}
|
596 |
}
|
597 |
}
|
598 |
+
?>
|
lib/media-rss.php
CHANGED
@@ -119,9 +119,9 @@ class nggMediaRss {
|
|
119 |
function get_mrss_root_node($title, $description, $link, $prev_link, $next_link, $images) {
|
120 |
|
121 |
if ($prev_link != '' || $next_link != '')
|
122 |
-
$out = "<rss version='2.0' xmlns:media='http://search.yahoo.com/mrss' xmlns:atom='http://www.w3.org/2005/Atom'>\n" ;
|
123 |
else
|
124 |
-
$out = "<rss version='2.0' xmlns:media='http://search.yahoo.com/mrss'>\n";
|
125 |
|
126 |
$out .= "\t<channel>\n";
|
127 |
|
@@ -129,7 +129,9 @@ class nggMediaRss {
|
|
129 |
$out .= nggMediaRss::get_title_mrss_node($title);
|
130 |
$out .= nggMediaRss::get_description_mrss_node($description);
|
131 |
$out .= nggMediaRss::get_link_mrss_node($link);
|
132 |
-
|
|
|
|
|
133 |
if ($prev_link!='') {
|
134 |
$out .= nggMediaRss::get_previous_link_mrss_node($prev_link);
|
135 |
}
|
@@ -151,7 +153,7 @@ class nggMediaRss {
|
|
151 |
* Get the XML <generator> node
|
152 |
*/
|
153 |
function get_generator_mrss_node($indent = "\t\t") {
|
154 |
-
return $indent . "<generator><![CDATA[NextGEN Gallery [http://
|
155 |
}
|
156 |
|
157 |
/**
|
@@ -174,6 +176,13 @@ class nggMediaRss {
|
|
174 |
function get_link_mrss_node($link, $indent = "\t\t") {
|
175 |
return $indent . "<link><![CDATA[" . htmlspecialchars($link) . "]]></link>\n";
|
176 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
177 |
|
178 |
/**
|
179 |
* Get the XML <atom:link previous> node
|
@@ -212,7 +221,8 @@ class nggMediaRss {
|
|
212 |
$out = $indent . "<item>\n";
|
213 |
$out .= $indent . "\t<title><![CDATA[" . nggGallery::i18n($title) . "]]></title>\n";
|
214 |
$out .= $indent . "\t<description><![CDATA[" . nggGallery::i18n($desc) . "]]></description>\n";
|
215 |
-
$out .= $indent . "\t<link><![CDATA[" . $image->get_permalink() . "]]></link>\n";
|
|
|
216 |
$out .= $indent . "\t<media:content url='" . esc_url($image->imageURL) . "' medium='image' />\n";
|
217 |
$out .= $indent . "\t<media:title><![CDATA[" . nggGallery::i18n($title) . "]]></media:title>\n";
|
218 |
$out .= $indent . "\t<media:description><![CDATA[" . nggGallery::i18n($desc) . "]]></media:description>\n";
|
119 |
function get_mrss_root_node($title, $description, $link, $prev_link, $next_link, $images) {
|
120 |
|
121 |
if ($prev_link != '' || $next_link != '')
|
122 |
+
$out = "<rss version='2.0' xmlns:media='http://search.yahoo.com/mrss/' xmlns:atom='http://www.w3.org/2005/Atom'>\n" ;
|
123 |
else
|
124 |
+
$out = "<rss version='2.0' xmlns:media='http://search.yahoo.com/mrss/'>\n";
|
125 |
|
126 |
$out .= "\t<channel>\n";
|
127 |
|
129 |
$out .= nggMediaRss::get_title_mrss_node($title);
|
130 |
$out .= nggMediaRss::get_description_mrss_node($description);
|
131 |
$out .= nggMediaRss::get_link_mrss_node($link);
|
132 |
+
|
133 |
+
if ($prev_link != '' || $next_link != '')
|
134 |
+
$out .= nggMediaRss::get_self_node(nggMediaRss::get_mrss_url());
|
135 |
if ($prev_link!='') {
|
136 |
$out .= nggMediaRss::get_previous_link_mrss_node($prev_link);
|
137 |
}
|
153 |
* Get the XML <generator> node
|
154 |
*/
|
155 |
function get_generator_mrss_node($indent = "\t\t") {
|
156 |
+
return $indent . "<generator><![CDATA[NextGEN Gallery [http://nextgen-gallery.com]]]></generator>\n";
|
157 |
}
|
158 |
|
159 |
/**
|
176 |
function get_link_mrss_node($link, $indent = "\t\t") {
|
177 |
return $indent . "<link><![CDATA[" . htmlspecialchars($link) . "]]></link>\n";
|
178 |
}
|
179 |
+
|
180 |
+
/**
|
181 |
+
* Get the XML <atom:link self> node
|
182 |
+
*/
|
183 |
+
function get_self_node($link, $indent = "\t\t") {
|
184 |
+
return $indent . "<atom:link rel='self' href='" . htmlspecialchars($link) . "' type='application/rss+xml' />\n";
|
185 |
+
}
|
186 |
|
187 |
/**
|
188 |
* Get the XML <atom:link previous> node
|
221 |
$out = $indent . "<item>\n";
|
222 |
$out .= $indent . "\t<title><![CDATA[" . nggGallery::i18n($title) . "]]></title>\n";
|
223 |
$out .= $indent . "\t<description><![CDATA[" . nggGallery::i18n($desc) . "]]></description>\n";
|
224 |
+
$out .= $indent . "\t<link><![CDATA[" . $image->get_permalink() . "]]></link>\n";
|
225 |
+
$out .= $indent . "\t<guid>image-id:" . $image->pid . "</guid>\n";
|
226 |
$out .= $indent . "\t<media:content url='" . esc_url($image->imageURL) . "' medium='image' />\n";
|
227 |
$out .= $indent . "\t<media:title><![CDATA[" . nggGallery::i18n($title) . "]]></media:title>\n";
|
228 |
$out .= $indent . "\t<media:description><![CDATA[" . nggGallery::i18n($desc) . "]]></media:description>\n";
|
lib/meta.php
CHANGED
@@ -323,20 +323,24 @@ class nggMeta{
|
|
323 |
if ($list_element == false)
|
324 |
array_pop($stack);
|
325 |
$list_element = true;
|
326 |
-
|
327 |
-
|
|
|
|
|
328 |
// in the case it's a list element we seralize it
|
329 |
$value = implode(",", $list_array);
|
330 |
$this->setArrayValue($xmlarray, $stack, $value);
|
331 |
} else {
|
332 |
array_push($stack, $val['tag']);
|
333 |
-
|
|
|
|
|
334 |
array_pop($stack);
|
335 |
}
|
336 |
}
|
337 |
|
338 |
} // foreach
|
339 |
-
|
340 |
// cut off the useless tags
|
341 |
$xmlarray = $xmlarray['x:xmpmeta']['rdf:RDF']['rdf:Description'];
|
342 |
|
@@ -381,8 +385,7 @@ class nggMeta{
|
|
381 |
function setArrayValue(&$array, $stack, $value) {
|
382 |
if ($stack) {
|
383 |
$key = array_shift($stack);
|
384 |
-
|
385 |
-
$this->setArrayValue($array[$key], $stack, $value);
|
386 |
return $array;
|
387 |
} else {
|
388 |
$array = $value;
|
323 |
if ($list_element == false)
|
324 |
array_pop($stack);
|
325 |
$list_element = true;
|
326 |
+
// do not parse empty tags
|
327 |
+
if ( empty($val['value']) ) continue;
|
328 |
+
// save it in our temp array
|
329 |
+
$list_array[] = $val['value'];
|
330 |
// in the case it's a list element we seralize it
|
331 |
$value = implode(",", $list_array);
|
332 |
$this->setArrayValue($xmlarray, $stack, $value);
|
333 |
} else {
|
334 |
array_push($stack, $val['tag']);
|
335 |
+
// do not parse empty tags
|
336 |
+
if ( !empty($val['value']) )
|
337 |
+
$this->setArrayValue($xmlarray, $stack, $val['value']);
|
338 |
array_pop($stack);
|
339 |
}
|
340 |
}
|
341 |
|
342 |
} // foreach
|
343 |
+
|
344 |
// cut off the useless tags
|
345 |
$xmlarray = $xmlarray['x:xmpmeta']['rdf:RDF']['rdf:Description'];
|
346 |
|
385 |
function setArrayValue(&$array, $stack, $value) {
|
386 |
if ($stack) {
|
387 |
$key = array_shift($stack);
|
388 |
+
$this->setArrayValue($array[$key], $stack, $value);
|
|
|
389 |
return $array;
|
390 |
} else {
|
391 |
$array = $value;
|
lib/ngg-db.php
CHANGED
@@ -4,7 +4,7 @@ if ( !class_exists('nggdb') ) :
|
|
4 |
* NextGEN Gallery Database Class
|
5 |
*
|
6 |
* @author Alex Rabe, Vincent Prat
|
7 |
-
* @copyright 2008-
|
8 |
* @since 1.0.0
|
9 |
*/
|
10 |
class nggdb {
|
@@ -79,18 +79,21 @@ class nggdb {
|
|
79 |
}
|
80 |
|
81 |
/**
|
82 |
-
* Get all the album
|
83 |
*
|
84 |
* @since 1.3.0
|
85 |
* @param string $order_by
|
86 |
* @param string $order_dir
|
|
|
|
|
87 |
* @return array $album
|
88 |
*/
|
89 |
-
function find_all_album( $order_by = 'id', $order_dir = 'ASC') {
|
90 |
global $wpdb;
|
91 |
|
92 |
$order_dir = ( $order_dir == 'DESC') ? 'DESC' : 'ASC';
|
93 |
-
$
|
|
|
94 |
|
95 |
if ( !$this->albums )
|
96 |
return array();
|
@@ -207,14 +210,16 @@ class nggdb {
|
|
207 |
* @param bool $exclude
|
208 |
* @param int $limit number of paged galleries, 0 shows all galleries
|
209 |
* @param int $start the start index for paged galleries
|
|
|
210 |
* @return An array containing the nggImage objects representing the images in the gallery.
|
211 |
*/
|
212 |
-
function get_gallery($id, $order_by = 'sortorder', $order_dir = 'ASC', $exclude = true, $limit = 0, $start = 0) {
|
213 |
|
214 |
global $wpdb;
|
215 |
|
216 |
// init the gallery as empty array
|
217 |
$gallery = array();
|
|
|
218 |
|
219 |
// Check for the exclude setting
|
220 |
$exclude_clause = ($exclude) ? ' AND tt.exclude<>1 ' : '';
|
@@ -243,8 +248,12 @@ class nggdb {
|
|
243 |
if ($result) {
|
244 |
|
245 |
// Now added all image data
|
246 |
-
foreach ($result as $key => $value)
|
|
|
|
|
|
|
247 |
$gallery[$key] = new nggImage( $value );
|
|
|
248 |
}
|
249 |
|
250 |
// Could not add to cache, the structure is different to find_gallery() cache_add, need rework
|
@@ -374,7 +383,7 @@ class nggdb {
|
|
374 |
}
|
375 |
|
376 |
/**
|
377 |
-
* nggdb::update_image() -
|
378 |
*
|
379 |
* @param int $pid id of the image
|
380 |
* @param (optional) string|int $galleryid
|
@@ -383,7 +392,7 @@ class nggdb {
|
|
383 |
* @param (optional) string $alttext
|
384 |
* @param (optional) int $exclude (0 or 1)
|
385 |
* @param (optional) int $sortorder
|
386 |
-
* @return bool result of
|
387 |
*/
|
388 |
function update_image($pid, $galleryid = false, $filename = false, $description = false, $alttext = false, $exclude = false, $sortorder = false) {
|
389 |
|
@@ -392,7 +401,11 @@ class nggdb {
|
|
392 |
$sql = array();
|
393 |
$pid = (int) $pid;
|
394 |
|
|
|
|
|
|
|
395 |
$update = array(
|
|
|
396 |
'galleryid' => $galleryid,
|
397 |
'filename' => $filename,
|
398 |
'description' => $description,
|
@@ -415,6 +428,101 @@ class nggdb {
|
|
415 |
|
416 |
return $result;
|
417 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
418 |
|
419 |
/**
|
420 |
* Get an image given its ID
|
@@ -492,22 +600,84 @@ class nggdb {
|
|
492 |
|
493 |
if ( is_array($meta_data) )
|
494 |
$meta_data = serialize($meta_data);
|
|
|
|
|
|
|
495 |
|
496 |
// Add the image
|
497 |
-
if ( false === $wpdb->query( $wpdb->prepare("INSERT INTO $wpdb->nggpictures (galleryid, filename, description, alttext, meta_data, post_id, imagedate, exclude, sortorder)
|
498 |
-
VALUES (%d, %s, %s, %s, %s, %d, %s, %d, %d)", $id, $filename, $description, $alttext, $meta_data, $post_id, $imagedate, $exclude, $sortorder ) ) ) {
|
499 |
return false;
|
500 |
}
|
501 |
|
502 |
$imageID = (int) $wpdb->insert_id;
|
503 |
|
504 |
// Remove from cache the galley, needs to be rebuild now
|
505 |
-
wp_cache_delete( $id, 'ngg_gallery');
|
506 |
-
|
507 |
-
|
508 |
return $imageID;
|
509 |
}
|
510 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
511 |
/**
|
512 |
* Delete an image entry from the database
|
513 |
* @param integer $id is the Image ID
|
@@ -530,9 +700,9 @@ class nggdb {
|
|
530 |
/**
|
531 |
* Get the last images registered in the database with a maximum number of $limit results
|
532 |
*
|
533 |
-
* @param integer $page
|
534 |
-
* @param integer $limit
|
535 |
-
* @param bool $
|
536 |
* @param int $galleryId Only look for images with this gallery id, or in all galleries if id is 0
|
537 |
* @param string $orderby is one of "id" (default, order by pid), "date" (order by exif date), sort (order by user sort order)
|
538 |
* @return
|
@@ -543,6 +713,9 @@ class nggdb {
|
|
543 |
// Check for the exclude setting
|
544 |
$exclude_clause = ($exclude) ? ' AND exclude<>1 ' : '';
|
545 |
|
|
|
|
|
|
|
546 |
$offset = (int) $page * $limit;
|
547 |
|
548 |
$galleryId = (int) $galleryId;
|
@@ -657,9 +830,10 @@ class nggdb {
|
|
657 |
*
|
658 |
* @since 1.3.0
|
659 |
* @param string $request
|
|
|
660 |
* @return Array Result of the request
|
661 |
*/
|
662 |
-
function search_for_images( $request ) {
|
663 |
global $wpdb;
|
664 |
|
665 |
// If a search pattern is specified, load the posts that match
|
@@ -687,10 +861,13 @@ class nggdb {
|
|
687 |
|
688 |
if ( !empty($search) )
|
689 |
$search = " AND ({$search}) ";
|
690 |
-
|
691 |
-
|
|
|
|
|
|
|
692 |
// build the final query
|
693 |
-
$query = "SELECT t.*, tt.* FROM $wpdb->nggallery AS t INNER JOIN $wpdb->nggpictures AS tt ON t.gid = tt.galleryid WHERE 1=1 $search ORDER BY tt.pid ASC ";
|
694 |
$result = $wpdb->get_results($query);
|
695 |
|
696 |
// Return the object from the query result
|
@@ -704,6 +881,102 @@ class nggdb {
|
|
704 |
return null;
|
705 |
}
|
706 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
707 |
/**
|
708 |
* search for a filename
|
709 |
*
|
@@ -766,6 +1039,52 @@ class nggdb {
|
|
766 |
return $result;
|
767 |
}
|
768 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
769 |
}
|
770 |
endif;
|
771 |
|
4 |
* NextGEN Gallery Database Class
|
5 |
*
|
6 |
* @author Alex Rabe, Vincent Prat
|
7 |
+
* @copyright 2008-2010
|
8 |
* @since 1.0.0
|
9 |
*/
|
10 |
class nggdb {
|
79 |
}
|
80 |
|
81 |
/**
|
82 |
+
* Get all the album and unserialize the content
|
83 |
*
|
84 |
* @since 1.3.0
|
85 |
* @param string $order_by
|
86 |
* @param string $order_dir
|
87 |
+
* @param int $limit number of albums, 0 shows all albums
|
88 |
+
* @param int $start the start index for paged albums
|
89 |
* @return array $album
|
90 |
*/
|
91 |
+
function find_all_album( $order_by = 'id', $order_dir = 'ASC', $limit = 0, $start = 0) {
|
92 |
global $wpdb;
|
93 |
|
94 |
$order_dir = ( $order_dir == 'DESC') ? 'DESC' : 'ASC';
|
95 |
+
$limit_by = ( $limit > 0 ) ? 'LIMIT ' . intval($start) . ',' . intval($limit) : '';
|
96 |
+
$this->albums = $wpdb->get_results("SELECT * FROM $wpdb->nggalbum ORDER BY {$order_by} {$order_dir} {$limit_by}" , OBJECT_K );
|
97 |
|
98 |
if ( !$this->albums )
|
99 |
return array();
|
210 |
* @param bool $exclude
|
211 |
* @param int $limit number of paged galleries, 0 shows all galleries
|
212 |
* @param int $start the start index for paged galleries
|
213 |
+
* @param bool $json remove the key for associative array in json request
|
214 |
* @return An array containing the nggImage objects representing the images in the gallery.
|
215 |
*/
|
216 |
+
function get_gallery($id, $order_by = 'sortorder', $order_dir = 'ASC', $exclude = true, $limit = 0, $start = 0, $json = false) {
|
217 |
|
218 |
global $wpdb;
|
219 |
|
220 |
// init the gallery as empty array
|
221 |
$gallery = array();
|
222 |
+
$i = 0;
|
223 |
|
224 |
// Check for the exclude setting
|
225 |
$exclude_clause = ($exclude) ? ' AND tt.exclude<>1 ' : '';
|
248 |
if ($result) {
|
249 |
|
250 |
// Now added all image data
|
251 |
+
foreach ($result as $key => $value) {
|
252 |
+
// due to a browser bug we need to remove the key for associative array for json request
|
253 |
+
// (see http://code.google.com/p/chromium/issues/detail?id=883)
|
254 |
+
if ($json) $key = $i++;
|
255 |
$gallery[$key] = new nggImage( $value );
|
256 |
+
}
|
257 |
}
|
258 |
|
259 |
// Could not add to cache, the structure is different to find_gallery() cache_add, need rework
|
383 |
}
|
384 |
|
385 |
/**
|
386 |
+
* nggdb::update_image() - Update an image in the database
|
387 |
*
|
388 |
* @param int $pid id of the image
|
389 |
* @param (optional) string|int $galleryid
|
392 |
* @param (optional) string $alttext
|
393 |
* @param (optional) int $exclude (0 or 1)
|
394 |
* @param (optional) int $sortorder
|
395 |
+
* @return bool result of update query
|
396 |
*/
|
397 |
function update_image($pid, $galleryid = false, $filename = false, $description = false, $alttext = false, $exclude = false, $sortorder = false) {
|
398 |
|
401 |
$sql = array();
|
402 |
$pid = (int) $pid;
|
403 |
|
404 |
+
// slug must be unique, we use the alttext for that
|
405 |
+
$slug = nggdb::get_unique_slug( sanitize_title( $alttext ), 'image' );
|
406 |
+
|
407 |
$update = array(
|
408 |
+
'image_slug' => $slug,
|
409 |
'galleryid' => $galleryid,
|
410 |
'filename' => $filename,
|
411 |
'description' => $description,
|
428 |
|
429 |
return $result;
|
430 |
}
|
431 |
+
|
432 |
+
/**
|
433 |
+
* nggdb::update_gallery() - Update an gallery in the database
|
434 |
+
*
|
435 |
+
* @since V1.7.0
|
436 |
+
* @param int $id id of the gallery
|
437 |
+
* @param (optional) string $title or name of the gallery
|
438 |
+
* @param (optional) string $path
|
439 |
+
* @param (optional) string $description
|
440 |
+
* @param (optional) int $pageid
|
441 |
+
* @param (optional) int $previewpic
|
442 |
+
* @param (optional) int $author
|
443 |
+
* @return bool result of update query
|
444 |
+
*/
|
445 |
+
function update_gallery($id, $name = false, $path = false, $title = false, $description = false, $pageid = false, $previewpic = false, $author = false) {
|
446 |
+
|
447 |
+
global $wpdb;
|
448 |
+
|
449 |
+
$sql = array();
|
450 |
+
$id = (int) $id;
|
451 |
+
|
452 |
+
// slug must be unique, we use the title for that
|
453 |
+
$slug = nggdb::get_unique_slug( sanitize_title( $title ), 'gallery' );
|
454 |
+
|
455 |
+
$update = array(
|
456 |
+
'name' => $name,
|
457 |
+
'slug' => $slug,
|
458 |
+
'path' => $path,
|
459 |
+
'title' => $title,
|
460 |
+
'galdesc' => $description,
|
461 |
+
'pageid' => $pageid,
|
462 |
+
'previewpic' => $previewpic,
|
463 |
+
'author' => $author);
|
464 |
+
|
465 |
+
// create the sql parameter "name = value"
|
466 |
+
foreach ($update as $key => $value)
|
467 |
+
if ($value)
|
468 |
+
$sql[] = $key . " = '" . $value . "'";
|
469 |
+
|
470 |
+
// create the final string
|
471 |
+
$sql = implode(', ', $sql);
|
472 |
+
|
473 |
+
if ( !empty($sql) && $id != 0)
|
474 |
+
$result = $wpdb->query( "UPDATE $wpdb->nggallery SET $sql WHERE gid = $id" );
|
475 |
+
|
476 |
+
wp_cache_delete($id, 'ngg_gallery');
|
477 |
+
|
478 |
+
return $result;
|
479 |
+
}
|
480 |
+
|
481 |
+
/**
|
482 |
+
* nggdb::update_album() - Update an album in the database
|
483 |
+
*
|
484 |
+
* @since V1.7.0
|
485 |
+
* @param int $ id id of the album
|
486 |
+
* @param (optional) string $title
|
487 |
+
* @param (optional) int $previewpic
|
488 |
+
* @param (optional) string $description
|
489 |
+
* @param (optional) serialized array $sortorder
|
490 |
+
* @param (optional) int $pageid
|
491 |
+
* @return bool result of update query
|
492 |
+
*/
|
493 |
+
function update_album($id, $name = false, $previewpic = false, $description = false, $sortorder = false, $pageid = false ) {
|
494 |
+
|
495 |
+
global $wpdb;
|
496 |
+
|
497 |
+
$sql = array();
|
498 |
+
$id = (int) $id;
|
499 |
+
|
500 |
+
// slug must be unique, we use the title for that
|
501 |
+
$slug = nggdb::get_unique_slug( sanitize_title( $name ), 'album' );
|
502 |
+
|
503 |
+
$update = array(
|
504 |
+
'name' => $name,
|
505 |
+
'slug' => $slug,
|
506 |
+
'previewpic' => $previewpic,
|
507 |
+
'albumdesc' => $description,
|
508 |
+
'sortorder' => $sortorder,
|
509 |
+
'pageid' => $pageid);
|
510 |
+
|
511 |
+
// create the sql parameter "name = value"
|
512 |
+
foreach ($update as $key => $value)
|
513 |
+
if ($value)
|
514 |
+
$sql[] = $key . " = '" . $value . "'";
|
515 |
+
|
516 |
+
// create the final string
|
517 |
+
$sql = implode(', ', $sql);
|
518 |
+
|
519 |
+
if ( !empty($sql) && $id != 0)
|
520 |
+
$result = $wpdb->query( "UPDATE $wpdb->nggalbum SET $sql WHERE id = $id" );
|
521 |
+
|
522 |
+
wp_cache_delete($id, 'ngg_album');
|
523 |
+
|
524 |
+
return $result;
|
525 |
+
}
|
526 |
|
527 |
/**
|
528 |
* Get an image given its ID
|
600 |
|
601 |
if ( is_array($meta_data) )
|
602 |
$meta_data = serialize($meta_data);
|
603 |
+
|
604 |
+
// slug must be unique, we use the alttext for that
|
605 |
+
$slug = nggdb::get_unique_slug( sanitize_title( $alttext ), 'image' );
|
606 |
|
607 |
// Add the image
|
608 |
+
if ( false === $wpdb->query( $wpdb->prepare("INSERT INTO $wpdb->nggpictures (slug, galleryid, filename, description, alttext, meta_data, post_id, imagedate, exclude, sortorder)
|
609 |
+
VALUES (%d, %d, %s, %s, %s, %s, %d, %s, %d, %d)", $slug, $id, $filename, $description, $alttext, $meta_data, $post_id, $imagedate, $exclude, $sortorder ) ) ) {
|
610 |
return false;
|
611 |
}
|
612 |
|
613 |
$imageID = (int) $wpdb->insert_id;
|
614 |
|
615 |
// Remove from cache the galley, needs to be rebuild now
|
616 |
+
wp_cache_delete( $id, 'ngg_gallery');
|
617 |
+
|
618 |
+
//and give me the new id
|
619 |
return $imageID;
|
620 |
}
|
621 |
|
622 |
+
/**
|
623 |
+
* Add an album to the database
|
624 |
+
*
|
625 |
+
* @since V1.7.0
|
626 |
+
* @param (optional) string $title
|
627 |
+
* @param (optional) int $previewpic
|
628 |
+
* @param (optional) string $description
|
629 |
+
* @param (optional) serialized array $sortorder
|
630 |
+
* @param (optional) int $pageid
|
631 |
+
* @return bool result of the ID of the inserted album
|
632 |
+
*/
|
633 |
+
function add_album( $name = false, $previewpic = 0, $description = '', $sortorder = 0, $pageid = 0 ) {
|
634 |
+
global $wpdb;
|
635 |
+
|
636 |
+
// name must be unique, we use the title for that
|
637 |
+
$slug = nggdb::get_unique_slug( sanitize_title( $name ), 'album' );
|
638 |
+
|
639 |
+
// Add the album
|
640 |
+
if ( false === $wpdb->query( $wpdb->prepare("INSERT INTO $wpdb->nggalbum (name, slug, previewpic, albumdesc, sortorder, pageid)
|
641 |
+
VALUES (%s, %s, %d, %s, %s, %d)", $name, $slug, $previewpic, $description, $sortorder, $pageid ) ) ) {
|
642 |
+
return false;
|
643 |
+
}
|
644 |
+
|
645 |
+
$albumID = (int) $wpdb->insert_id;
|
646 |
+
|
647 |
+
//and give me the new id
|
648 |
+
return $albumID;
|
649 |
+
}
|
650 |
+
|
651 |
+
/**
|
652 |
+
* Add an gallery to the database
|
653 |
+
*
|
654 |
+
* @since V1.7.0
|
655 |
+
* @param (optional) string $title or name of the gallery
|
656 |
+
* @param (optional) string $path
|
657 |
+
* @param (optional) string $description
|
658 |
+
* @param (optional) int $pageid
|
659 |
+
* @param (optional) int $previewpic
|
660 |
+
* @param (optional) int $author
|
661 |
+
* @return bool result of the ID of the inserted gallery
|
662 |
+
*/
|
663 |
+
function add_gallery( $title = '', $path = '', $description = '', $pageid = 0, $previewpic = 0, $author = 0 ) {
|
664 |
+
global $wpdb;
|
665 |
+
|
666 |
+
// slug must be unique, we use the title for that
|
667 |
+
$slug = nggdb::get_unique_slug( sanitize_title( $title ), 'gallery' );
|
668 |
+
|
669 |
+
// Note : The field 'name' is deprecated, it's currently kept only for compat reason with older shortcodes, we copy the slug into this field
|
670 |
+
if ( false === $wpdb->query( $wpdb->prepare("INSERT INTO $wpdb->nggallery (name, slug, path, title, galdesc, pageid, previewpic, author)
|
671 |
+
VALUES (%s, %s, %s, %s, %s, %d, %d, %d)", $slug, $slug, $path, $title, $description, $pageid, $previewpic, $author ) ) ) {
|
672 |
+
return false;
|
673 |
+
}
|
674 |
+
|
675 |
+
$galleryID = (int) $wpdb->insert_id;
|
676 |
+
|
677 |
+
//and give me the new id
|
678 |
+
return $galleryID;
|
679 |
+
}
|
680 |
+
|
681 |
/**
|
682 |
* Delete an image entry from the database
|
683 |
* @param integer $id is the Image ID
|
700 |
/**
|
701 |
* Get the last images registered in the database with a maximum number of $limit results
|
702 |
*
|
703 |
+
* @param integer $page start offset as page number (0,1,2,3,4...)
|
704 |
+
* @param integer $limit the number of result
|
705 |
+
* @param bool $exclude do not show exluded images
|
706 |
* @param int $galleryId Only look for images with this gallery id, or in all galleries if id is 0
|
707 |
* @param string $orderby is one of "id" (default, order by pid), "date" (order by exif date), sort (order by user sort order)
|
708 |
* @return
|
713 |
// Check for the exclude setting
|
714 |
$exclude_clause = ($exclude) ? ' AND exclude<>1 ' : '';
|
715 |
|
716 |
+
// a limit of 0 makes no sense
|
717 |
+
$limit = ($limit == 0) ? 30 : $limit;
|
718 |
+
// calculate the offset based on the pagr number
|
719 |
$offset = (int) $page * $limit;
|
720 |
|
721 |
$galleryId = (int) $galleryId;
|
830 |
*
|
831 |
* @since 1.3.0
|
832 |
* @param string $request
|
833 |
+
* @param int $limit number of results, 0 shows all results
|
834 |
* @return Array Result of the request
|
835 |
*/
|
836 |
+
function search_for_images( $request, $limit = 0 ) {
|
837 |
global $wpdb;
|
838 |
|
839 |
// If a search pattern is specified, load the posts that match
|
861 |
|
862 |
if ( !empty($search) )
|
863 |
$search = " AND ({$search}) ";
|
864 |
+
|
865 |
+
$limit = ( $limit > 0 ) ? 'LIMIT ' . intval($limit) : '';
|
866 |
+
} else
|
867 |
+
return false;
|
868 |
+
|
869 |
// build the final query
|
870 |
+
$query = "SELECT t.*, tt.* FROM $wpdb->nggallery AS t INNER JOIN $wpdb->nggpictures AS tt ON t.gid = tt.galleryid WHERE 1=1 $search ORDER BY tt.pid ASC $limit";
|
871 |
$result = $wpdb->get_results($query);
|
872 |
|
873 |
// Return the object from the query result
|
881 |
return null;
|
882 |
}
|
883 |
|
884 |
+
/**
|
885 |
+
* search for galleries and return the result
|
886 |
+
*
|
887 |
+
* @since 1.7.0
|
888 |
+
* @param string $request
|
889 |
+
* @param int $limit number of results, 0 shows all results
|
890 |
+
* @return Array Result of the request
|
891 |
+
*/
|
892 |
+
function search_for_galleries( $request, $limit = 0 ) {
|
893 |
+
global $wpdb;
|
894 |
+
|
895 |
+
// If a search pattern is specified, load the posts that match
|
896 |
+
if ( !empty($request) ) {
|
897 |
+
// added slashes screw with quote grouping when done early, so done later
|
898 |
+
$request = stripslashes($request);
|
899 |
+
|
900 |
+
// split the words it a array if seperated by a space or comma
|
901 |
+
preg_match_all('/".*?("|$)|((?<=[\\s",+])|^)[^\\s",+]+/', $request, $matches);
|
902 |
+
$search_terms = array_map(create_function('$a', 'return trim($a, "\\"\'\\n\\r ");'), $matches[0]);
|
903 |
+
|
904 |
+
$n = '%';
|
905 |
+
$searchand = '';
|
906 |
+
$search = '';
|
907 |
+
|
908 |
+
foreach( (array) $search_terms as $term) {
|
909 |
+
$term = addslashes_gpc($term);
|
910 |
+
$search .= "{$searchand}((title LIKE '{$n}{$term}{$n}') OR (name LIKE '{$n}{$term}{$n}') )";
|
911 |
+
$searchand = ' AND ';
|
912 |
+
}
|
913 |
+
|
914 |
+
$term = $wpdb->escape($request);
|
915 |
+
if (count($search_terms) > 1 && $search_terms[0] != $request )
|
916 |
+
$search .= " OR (title LIKE '{$n}{$term}{$n}') OR (name LIKE '{$n}{$term}{$n}')";
|
917 |
+
|
918 |
+
if ( !empty($search) )
|
919 |
+
$search = " AND ({$search}) ";
|
920 |
+
|
921 |
+
$limit = ( $limit > 0 ) ? 'LIMIT ' . intval($limit) : '';
|
922 |
+
} else
|
923 |
+
return false;
|
924 |
+
|
925 |
+
// build the final query
|
926 |
+
$query = "SELECT * FROM $wpdb->nggallery WHERE 1=1 $search ORDER BY title ASC $limit";
|
927 |
+
$result = $wpdb->get_results($query);
|
928 |
+
|
929 |
+
return $result;
|
930 |
+
}
|
931 |
+
|
932 |
+
/**
|
933 |
+
* search for albums and return the result
|
934 |
+
*
|
935 |
+
* @since 1.7.0
|
936 |
+
* @param string $request
|
937 |
+
* @param int $limit number of results, 0 shows all results
|
938 |
+
* @return Array Result of the request
|
939 |
+
*/
|
940 |
+
function search_for_albums( $request, $limit = 0 ) {
|
941 |
+
global $wpdb;
|
942 |
+
|
943 |
+
// If a search pattern is specified, load the posts that match
|
944 |
+
if ( !empty($request) ) {
|
945 |
+
// added slashes screw with quote grouping when done early, so done later
|
946 |
+
$request = stripslashes($request);
|
947 |
+
|
948 |
+
// split the words it a array if seperated by a space or comma
|
949 |
+
preg_match_all('/".*?("|$)|((?<=[\\s",+])|^)[^\\s",+]+/', $request, $matches);
|
950 |
+
$search_terms = array_map(create_function('$a', 'return trim($a, "\\"\'\\n\\r ");'), $matches[0]);
|
951 |
+
|
952 |
+
$n = '%';
|
953 |
+
$searchand = '';
|
954 |
+
$search = '';
|
955 |
+
|
956 |
+
foreach( (array) $search_terms as $term) {
|
957 |
+
$term = addslashes_gpc($term);
|
958 |
+
$search .= "{$searchand}(name LIKE '{$n}{$term}{$n}')";
|
959 |
+
$searchand = ' AND ';
|
960 |
+
}
|
961 |
+
|
962 |
+
$term = $wpdb->escape($request);
|
963 |
+
if (count($search_terms) > 1 && $search_terms[0] != $request )
|
964 |
+
$search .= " OR (name LIKE '{$n}{$term}{$n}')";
|
965 |
+
|
966 |
+
if ( !empty($search) )
|
967 |
+
$search = " AND ({$search}) ";
|
968 |
+
|
969 |
+
$limit = ( $limit > 0 ) ? 'LIMIT ' . intval($limit) : '';
|
970 |
+
} else
|
971 |
+
return false;
|
972 |
+
|
973 |
+
// build the final query
|
974 |
+
$query = "SELECT * FROM $wpdb->nggalbum WHERE 1=1 $search ORDER BY name ASC $limit";
|
975 |
+
$result = $wpdb->get_results($query);
|
976 |
+
|
977 |
+
return $result;
|
978 |
+
}
|
979 |
+
|
980 |
/**
|
981 |
* search for a filename
|
982 |
*
|
1039 |
return $result;
|
1040 |
}
|
1041 |
|
1042 |
+
/**
|
1043 |
+
* Computes a unique slug for the gallery,album or image, when given the desired slug.
|
1044 |
+
*
|
1045 |
+
* @since 1.7.0
|
1046 |
+
* @author taken from WP Core includes/post.php
|
1047 |
+
* @param string $slug the desired slug (post_name)
|
1048 |
+
* @param string $type ('image', 'album' or 'gallery')
|
1049 |
+
* @return string unique slug for the object, based on $slug (with a -1, -2, etc. suffix)
|
1050 |
+
*/
|
1051 |
+
function get_unique_slug( $slug, $type ) {
|
1052 |
+
|
1053 |
+
global $wpdb;
|
1054 |
+
|
1055 |
+
switch ($type) {
|
1056 |
+
case 'image':
|
1057 |
+
$check_sql = "SELECT image_slug FROM $wpdb->nggpictures WHERE image_slug = %s LIMIT 1";
|
1058 |
+
break;
|
1059 |
+
case 'album':
|
1060 |
+
$check_sql = "SELECT slug FROM $wpdb->nggalbum WHERE slug = %s LIMIT 1";
|
1061 |
+
break;
|
1062 |
+
case 'gallery':
|
1063 |
+
$check_sql = "SELECT slug FROM $wpdb->nggallery WHERE slug = %s LIMIT 1";
|
1064 |
+
break;
|
1065 |
+
default:
|
1066 |
+
return false;
|
1067 |
+
}
|
1068 |
+
|
1069 |
+
//if you didn't give us a nem we take the type
|
1070 |
+
$slug = empty($slug) ? $type: $slug;
|
1071 |
+
|
1072 |
+
// Slugs must be unique across all objects.
|
1073 |
+
$slug_check = $wpdb->get_var( $wpdb->prepare( $check_sql, $slug ) );
|
1074 |
+
|
1075 |
+
if ( $slug_check ) {
|
1076 |
+
$suffix = 2;
|
1077 |
+
do {
|
1078 |
+
$alt_name = substr ($slug, 0, 200 - ( strlen( $suffix ) + 1 ) ) . "-$suffix";
|
1079 |
+
$slug_check = $wpdb->get_var( $wpdb->prepare($check_sql, $alt_name ) );
|
1080 |
+
$suffix++;
|
1081 |
+
} while ( $slug_check );
|
1082 |
+
$slug = $alt_name;
|
1083 |
+
}
|
1084 |
+
|
1085 |
+
return $slug;
|
1086 |
+
}
|
1087 |
+
|
1088 |
}
|
1089 |
endif;
|
1090 |
|
lib/post-thumbnail.php
CHANGED
@@ -116,7 +116,7 @@ class nggPostThumbnail {
|
|
116 |
|
117 |
// if we didn't use a cached image then we take the on-the-fly mode
|
118 |
if ($img_src == false)
|
119 |
-
$img_src =
|
120 |
|
121 |
} else {
|
122 |
$img_src = $image->thumbURL;
|
@@ -195,7 +195,7 @@ class nggPostThumbnail {
|
|
195 |
|
196 |
// if we didn't use a cached image then we take the on-the-fly mode
|
197 |
if ( $img_src == false )
|
198 |
-
$img_src =
|
199 |
|
200 |
$thumbnail_html = '<img width="266" src="'. $img_src . '" alt="'.$image->alttext.'" title="'.$image->alttext.'" />';
|
201 |
|
116 |
|
117 |
// if we didn't use a cached image then we take the on-the-fly mode
|
118 |
if ($img_src == false)
|
119 |
+
$img_src = home_url() . '/' . 'index.php?callback=image&pid=' . $image->pid . '&width=' . $width . '&height=' . $height . '&mode=crop';
|
120 |
|
121 |
} else {
|
122 |
$img_src = $image->thumbURL;
|
195 |
|
196 |
// if we didn't use a cached image then we take the on-the-fly mode
|
197 |
if ( $img_src == false )
|
198 |
+
$img_src = home_url() . '/' . 'index.php?callback=image&pid=' . $image->pid . '&width=' . $width . '&height=' . $height . '&mode=crop';
|
199 |
|
200 |
$thumbnail_html = '<img width="266" src="'. $img_src . '" alt="'.$image->alttext.'" title="'.$image->alttext.'" />';
|
201 |
|
lib/xmlrpc.php
CHANGED
@@ -4,7 +4,7 @@
|
|
4 |
*
|
5 |
* @package NextGEN Gallery
|
6 |
* @author Alex Rabe
|
7 |
-
* @copyright 2009
|
8 |
*/
|
9 |
class nggXMLRPC{
|
10 |
|
@@ -20,11 +20,20 @@ class nggXMLRPC{
|
|
20 |
function add_methods($methods) {
|
21 |
|
22 |
$methods['ngg.installed'] = array(&$this, 'nggInstalled');
|
|
|
23 |
$methods['ngg.uploadImage'] = array(&$this, 'uploadImage');
|
24 |
-
$methods['ngg.getGalleries'] = array(&$this, 'getGalleries');
|
25 |
$methods['ngg.getImages'] = array(&$this, 'getImages');
|
|
|
|
|
26 |
$methods['ngg.newGallery'] = array(&$this, 'newGallery');
|
27 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
28 |
return $methods;
|
29 |
}
|
30 |
|
@@ -219,21 +228,22 @@ class nggXMLRPC{
|
|
219 |
*/
|
220 |
function newGallery($args) {
|
221 |
|
222 |
-
global $ngg
|
223 |
|
224 |
require_once ( dirname ( dirname( __FILE__ ) ). '/admin/functions.php' ); // admin functions
|
225 |
-
|
|
|
226 |
$blog_ID = (int) $args[0];
|
227 |
-
$username = $
|
228 |
-
$password = $
|
229 |
-
$name = $
|
230 |
$id = false;
|
231 |
|
232 |
if ( !$user = $this->login($username, $password) )
|
233 |
return $this->error;
|
234 |
|
235 |
if( !current_user_can( 'NextGEN Manage gallery' ) )
|
236 |
-
return new IXR_Error( 401, __( 'Sorry, you must be able to manage galleries
|
237 |
|
238 |
if ( !empty( $name ) )
|
239 |
$id = nggAdmin::create_gallery($name, $ngg->options['gallerypath'], false);
|
@@ -245,6 +255,265 @@ class nggXMLRPC{
|
|
245 |
|
246 |
}
|
247 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
248 |
/**
|
249 |
* Method "ngg.getGalleries"
|
250 |
* Return the list of all galleries
|
@@ -259,17 +528,18 @@ class nggXMLRPC{
|
|
259 |
*/
|
260 |
function getGalleries($args) {
|
261 |
|
262 |
-
global $nggdb
|
263 |
|
|
|
264 |
$blog_ID = (int) $args[0];
|
265 |
-
$username = $
|
266 |
-
$password = $
|
267 |
|
268 |
if ( !$user = $this->login($username, $password) )
|
269 |
return $this->error;
|
270 |
|
271 |
if( !current_user_can( 'NextGEN Manage gallery' ) )
|
272 |
-
return new IXR_Error( 401, __( 'Sorry, you must be able to manage galleries
|
273 |
|
274 |
$gallery_list = $nggdb->find_all_galleries('gid', 'asc', true, 0, 0, false);
|
275 |
|
@@ -292,13 +562,14 @@ class nggXMLRPC{
|
|
292 |
*/
|
293 |
function getImages($args) {
|
294 |
|
295 |
-
global $nggdb
|
296 |
|
297 |
require_once ( dirname ( dirname( __FILE__ ) ). '/admin/functions.php' ); // admin functions
|
298 |
-
|
|
|
299 |
$blog_ID = (int) $args[0];
|
300 |
-
$username = $
|
301 |
-
$password = $
|
302 |
$gid = (int) $args[3];
|
303 |
|
304 |
if ( !$user = $this->login($username, $password) )
|
@@ -322,6 +593,34 @@ class nggXMLRPC{
|
|
322 |
|
323 |
}
|
324 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
325 |
/**
|
326 |
* PHP5 style destructor and will run when database object is destroyed.
|
327 |
*
|
4 |
*
|
5 |
* @package NextGEN Gallery
|
6 |
* @author Alex Rabe
|
7 |
+
* @copyright 2009-2010
|
8 |
*/
|
9 |
class nggXMLRPC{
|
10 |
|
20 |
function add_methods($methods) {
|
21 |
|
22 |
$methods['ngg.installed'] = array(&$this, 'nggInstalled');
|
23 |
+
// Image methods
|
24 |
$methods['ngg.uploadImage'] = array(&$this, 'uploadImage');
|
|
|
25 |
$methods['ngg.getImages'] = array(&$this, 'getImages');
|
26 |
+
// Gallery methods
|
27 |
+
$methods['ngg.getGalleries'] = array(&$this, 'getGalleries');
|
28 |
$methods['ngg.newGallery'] = array(&$this, 'newGallery');
|
29 |
+
$methods['ngg.editGallery'] = array(&$this, 'editGallery');
|
30 |
+
$methods['ngg.deleteGallery'] = array(&$this, 'deleteGallery');
|
31 |
+
// Album methods
|
32 |
+
$methods['ngg.getAlbums'] = array(&$this, 'getAlbums');
|
33 |
+
$methods['ngg.newAlbum'] = array(&$this, 'newAlbum');
|
34 |
+
$methods['ngg.editAlbum'] = array(&$this, 'editAlbum');
|
35 |
+
$methods['ngg.deleteAlbum'] = array(&$this, 'deleteAlbum');
|
36 |
+
|
37 |
return $methods;
|
38 |
}
|
39 |
|
228 |
*/
|
229 |
function newGallery($args) {
|
230 |
|
231 |
+
global $ngg;
|
232 |
|
233 |
require_once ( dirname ( dirname( __FILE__ ) ). '/admin/functions.php' ); // admin functions
|
234 |
+
|
235 |
+
$this->escape($args);
|
236 |
$blog_ID = (int) $args[0];
|
237 |
+
$username = $args[1];
|
238 |
+
$password = $args[2];
|
239 |
+
$name = $args[3];
|
240 |
$id = false;
|
241 |
|
242 |
if ( !$user = $this->login($username, $password) )
|
243 |
return $this->error;
|
244 |
|
245 |
if( !current_user_can( 'NextGEN Manage gallery' ) )
|
246 |
+
return new IXR_Error( 401, __( 'Sorry, you must be able to manage galleries' ) );
|
247 |
|
248 |
if ( !empty( $name ) )
|
249 |
$id = nggAdmin::create_gallery($name, $ngg->options['gallerypath'], false);
|
255 |
|
256 |
}
|
257 |
|
258 |
+
/**
|
259 |
+
* Method "ngg.editGallery"
|
260 |
+
* Edit a existing gallery
|
261 |
+
*
|
262 |
+
* @since 1.7.0
|
263 |
+
*
|
264 |
+
* @param array $args Method parameters.
|
265 |
+
* - int blog_id
|
266 |
+
* - string username
|
267 |
+
* - string password
|
268 |
+
* - int gallery ID
|
269 |
+
* - string gallery name
|
270 |
+
* - string title
|
271 |
+
* - string description
|
272 |
+
* - int ID of the preview picture
|
273 |
+
* @return true if success
|
274 |
+
*/
|
275 |
+
function editGallery($args) {
|
276 |
+
|
277 |
+
global $ngg;
|
278 |
+
|
279 |
+
require_once ( dirname ( dirname( __FILE__ ) ). '/admin/functions.php' ); // admin functions
|
280 |
+
|
281 |
+
$this->escape($args);
|
282 |
+
$blog_ID = (int) $args[0];
|
283 |
+
$username = $args[1];
|
284 |
+
$password = $args[2];
|
285 |
+
$id = (int) $args[3];
|
286 |
+
$name = $args[4];
|
287 |
+
$title = $args[5];
|
288 |
+
$description= $args[6];
|
289 |
+
$previewpic = (int) $args[7];
|
290 |
+
|
291 |
+
if ( !$user = $this->login($username, $password) )
|
292 |
+
return $this->error;
|
293 |
+
|
294 |
+
if ( !$gallery = nggdb::find_gallery($id) )
|
295 |
+
return(new IXR_Error(404, __("Invalid gallery ID")));
|
296 |
+
|
297 |
+
if ( !current_user_can( 'NextGEN Manage gallery' ) && !nggAdmin::can_manage_this_gallery($gallery->author) )
|
298 |
+
return new IXR_Error( 401, __( 'Sorry, you must be able to manage this gallery' ) );
|
299 |
+
|
300 |
+
if ( !empty( $name ) )
|
301 |
+
$result = nggdb::update_gallery($id, $name, false, $title, $description, false, $previewpic);
|
302 |
+
|
303 |
+
if ( !$result )
|
304 |
+
return new IXR_Error(500, __('Sorry, could not update the gallery'));
|
305 |
+
|
306 |
+
return true;
|
307 |
+
|
308 |
+
}
|
309 |
+
|
310 |
+
/**
|
311 |
+
* Method "ngg.newAlbum"
|
312 |
+
* Create a new album
|
313 |
+
*
|
314 |
+
* @since 1.7
|
315 |
+
*
|
316 |
+
* @param array $args Method parameters.
|
317 |
+
* - int blog_id
|
318 |
+
* - string username
|
319 |
+
* - string password
|
320 |
+
* - string new album name
|
321 |
+
* - int id of preview image
|
322 |
+
* - string description
|
323 |
+
* - string serialized array of galleries
|
324 |
+
* @return int with new album ID
|
325 |
+
*/
|
326 |
+
function newAlbum($args) {
|
327 |
+
|
328 |
+
global $ngg;
|
329 |
+
|
330 |
+
$this->escape($args);
|
331 |
+
$blog_ID = (int) $args[0];
|
332 |
+
$username = $args[1];
|
333 |
+
$password = $args[2];
|
334 |
+
$name = $args[3];
|
335 |
+
$preview = (int) $args[4];
|
336 |
+
$description= $args[5];
|
337 |
+
$galleries = $args[6];
|
338 |
+
$id = false;
|
339 |
+
|
340 |
+
if ( !$user = $this->login($username, $password) )
|
341 |
+
return $this->error;
|
342 |
+
|
343 |
+
if( !current_user_can( 'NextGEN Edit album' ) || !nggGallery::current_user_can( 'NextGEN Add/Delete album' ) )
|
344 |
+
return new IXR_Error( 401, __( 'Sorry, you must be able to manage albums' ) );
|
345 |
+
|
346 |
+
if ( !empty( $name ) )
|
347 |
+
$id = $result = nggdb::add_album( $name, $preview, $description, $galleries );
|
348 |
+
|
349 |
+
if ( !$id )
|
350 |
+
return new IXR_Error(500, __('Sorry, could not create the album'));
|
351 |
+
|
352 |
+
return($id);
|
353 |
+
|
354 |
+
}
|
355 |
+
|
356 |
+
/**
|
357 |
+
* Method "ngg.editAlbum"
|
358 |
+
* Edit a existing Album
|
359 |
+
*
|
360 |
+
* @since 1.7.0
|
361 |
+
*
|
362 |
+
* @param array $args Method parameters.
|
363 |
+
* - int blog_id
|
364 |
+
* - string username
|
365 |
+
* - string password
|
366 |
+
* - int album ID
|
367 |
+
* - string album name
|
368 |
+
* - int id of preview image
|
369 |
+
* - string description
|
370 |
+
* - string serialized array of galleries
|
371 |
+
* @return true if success
|
372 |
+
*/
|
373 |
+
function editAlbum($args) {
|
374 |
+
|
375 |
+
global $ngg;
|
376 |
+
|
377 |
+
require_once ( dirname ( dirname( __FILE__ ) ). '/admin/functions.php' ); // admin functions
|
378 |
+
|
379 |
+
$this->escape($args);
|
380 |
+
$blog_ID = (int) $args[0];
|
381 |
+
$username = $args[1];
|
382 |
+
$password = $args[2];
|
383 |
+
$id = (int) $args[3];
|
384 |
+
$name = $args[4];
|
385 |
+
$preview = (int) $args[5];
|
386 |
+
$description= $args[6];
|
387 |
+
$galleries = $args[7];
|
388 |
+
|
389 |
+
if ( !$user = $this->login($username, $password) )
|
390 |
+
return $this->error;
|
391 |
+
|
392 |
+
if ( !$album = nggdb::find_album($id) )
|
393 |
+
return(new IXR_Error(404, __("Invalid album ID")));
|
394 |
+
|
395 |
+
if( !current_user_can( 'NextGEN Edit album' ) )
|
396 |
+
return new IXR_Error( 401, __( 'Sorry, you must be able to manage albums' ) );
|
397 |
+
|
398 |
+
if ( !empty( $name ) )
|
399 |
+
$result = nggdb::update_album($id, $name, $preview, $description, $description, $galleries);
|
400 |
+
|
401 |
+
if ( !$result )
|
402 |
+
return new IXR_Error(500, __('Sorry, could not update the album'));
|
403 |
+
|
404 |
+
return true;
|
405 |
+
|
406 |
+
}
|
407 |
+
|
408 |
+
/**
|
409 |
+
* Method "ngg.deleteAlbum"
|
410 |
+
* Delete a album from the database
|
411 |
+
*
|
412 |
+
* @since 1.7.0
|
413 |
+
*
|
414 |
+
* @param array $args Method parameters.
|
415 |
+
* - int blog_id
|
416 |
+
* - string username
|
417 |
+
* - string password
|
418 |
+
* - int album id
|
419 |
+
* @return true
|
420 |
+
*/
|
421 |
+
function deleteAlbum($args) {
|
422 |
+
|
423 |
+
global $nggdb;
|
424 |
+
|
425 |
+
$this->escape($args);
|
426 |
+
$blog_ID = (int) $args[0];
|
427 |
+
$username = $args[1];
|
428 |
+
$password = $args[2];
|
429 |
+
$id = (int) $args[3];
|
430 |
+
|
431 |
+
if ( !$user = $this->login($username, $password) )
|
432 |
+
return $this->error;
|
433 |
+
|
434 |
+
if ( !$album = nggdb::find_album($id) )
|
435 |
+
return(new IXR_Error(404, __("Invalid album ID")));
|
436 |
+
|
437 |
+
if( !current_user_can( 'NextGEN Edit album' ) && !nggGallery::current_user_can( 'NextGEN Add/Delete album' ) )
|
438 |
+
return new IXR_Error( 401, __( 'Sorry, you must be able to manage albums' ) );
|
439 |
+
|
440 |
+
$nggdb->delete_album($id);
|
441 |
+
|
442 |
+
return true;
|
443 |
+
|
444 |
+
}
|
445 |
+
|
446 |
+
/**
|
447 |
+
* Method "ngg.deleteGallery"
|
448 |
+
* Delete a gallery from the database, including all images
|
449 |
+
*
|
450 |
+
* @since 1.7.0
|
451 |
+
*
|
452 |
+
* @param array $args Method parameters.
|
453 |
+
* - int blog_id
|
454 |
+
* - string username
|
455 |
+
* - string password
|
456 |
+
* - int gallery_id
|
457 |
+
* @return true
|
458 |
+
*/
|
459 |
+
function deleteGallery($args) {
|
460 |
+
|
461 |
+
global $nggdb;
|
462 |
+
|
463 |
+
$this->escape($args);
|
464 |
+
$blog_ID = (int) $args[0];
|
465 |
+
$username = $args[1];
|
466 |
+
$password = $args[2];
|
467 |
+
$id = (int) $args[3];
|
468 |
+
|
469 |
+
if ( !$user = $this->login($username, $password) )
|
470 |
+
return $this->error;
|
471 |
+
|
472 |
+
if ( !$gallery = nggdb::find_gallery($id) )
|
473 |
+
return(new IXR_Error(404, __("Invalid gallery ID")));
|
474 |
+
|
475 |
+
if ( !current_user_can( 'NextGEN Manage gallery' ) && !nggAdmin::can_manage_this_gallery($gallery->author) )
|
476 |
+
return new IXR_Error( 401, __( 'Sorry, you must be able to manage galleries' ) );
|
477 |
+
|
478 |
+
$nggdb->delete_gallery($id);
|
479 |
+
|
480 |
+
return true;
|
481 |
+
|
482 |
+
}
|
483 |
+
|
484 |
+
/**
|
485 |
+
* Method "ngg.getAlbums"
|
486 |
+
* Return the list of all albums
|
487 |
+
*
|
488 |
+
* @since 1.7.0
|
489 |
+
*
|
490 |
+
* @param array $args Method parameters.
|
491 |
+
* - int blog_id
|
492 |
+
* - string username
|
493 |
+
* - string password
|
494 |
+
* @return array with all galleries
|
495 |
+
*/
|
496 |
+
function getAlbums($args) {
|
497 |
+
|
498 |
+
global $nggdb;
|
499 |
+
|
500 |
+
$this->escape($args);
|
501 |
+
$blog_ID = (int) $args[0];
|
502 |
+
$username = $args[1];
|
503 |
+
$password = $args[2];
|
504 |
+
|
505 |
+
if ( !$user = $this->login($username, $password) )
|
506 |
+
return $this->error;
|
507 |
+
|
508 |
+
if( !current_user_can( 'NextGEN Edit album' ) )
|
509 |
+
return new IXR_Error( 401, __( 'Sorry, you must be able to manage albums' ) );
|
510 |
+
|
511 |
+
$album_list = $nggdb->find_all_album('id', 'ASC', 0, 0 );
|
512 |
+
|
513 |
+
return($album_list);
|
514 |
+
|
515 |
+
}
|
516 |
+
|
517 |
/**
|
518 |
* Method "ngg.getGalleries"
|
519 |
* Return the list of all galleries
|
528 |
*/
|
529 |
function getGalleries($args) {
|
530 |
|
531 |
+
global $nggdb;
|
532 |
|
533 |
+
$this->escape($args);
|
534 |
$blog_ID = (int) $args[0];
|
535 |
+
$username = $args[1];
|
536 |
+
$password = $args[2];
|
537 |
|
538 |
if ( !$user = $this->login($username, $password) )
|
539 |
return $this->error;
|
540 |
|
541 |
if( !current_user_can( 'NextGEN Manage gallery' ) )
|
542 |
+
return new IXR_Error( 401, __( 'Sorry, you must be able to manage galleries' ) );
|
543 |
|
544 |
$gallery_list = $nggdb->find_all_galleries('gid', 'asc', true, 0, 0, false);
|
545 |
|
562 |
*/
|
563 |
function getImages($args) {
|
564 |
|
565 |
+
global $nggdb;
|
566 |
|
567 |
require_once ( dirname ( dirname( __FILE__ ) ). '/admin/functions.php' ); // admin functions
|
568 |
+
|
569 |
+
$this->escape($args);
|
570 |
$blog_ID = (int) $args[0];
|
571 |
+
$username = $args[1];
|
572 |
+
$password = $args[2];
|
573 |
$gid = (int) $args[3];
|
574 |
|
575 |
if ( !$user = $this->login($username, $password) )
|
593 |
|
594 |
}
|
595 |
|
596 |
+
/**
|
597 |
+
* Sanitize string or array of strings for database.
|
598 |
+
*
|
599 |
+
* @since 1.7.0
|
600 |
+
* @author WordPress Core
|
601 |
+
* @filesource inludes/class-wp-xmlrpc-server.php
|
602 |
+
*
|
603 |
+
* @param string|array $array Sanitize single string or array of strings.
|
604 |
+
* @return string|array Type matches $array and sanitized for the database.
|
605 |
+
*/
|
606 |
+
function escape(&$array) {
|
607 |
+
global $wpdb;
|
608 |
+
|
609 |
+
if (!is_array($array)) {
|
610 |
+
return($wpdb->escape($array));
|
611 |
+
} else {
|
612 |
+
foreach ( (array) $array as $k => $v ) {
|
613 |
+
if ( is_array($v) ) {
|
614 |
+
$this->escape($array[$k]);
|
615 |
+
} else if ( is_object($v) ) {
|
616 |
+
//skip
|
617 |
+
} else {
|
618 |
+
$array[$k] = $wpdb->escape($v);
|
619 |
+
}
|
620 |
+
}
|
621 |
+
}
|
622 |
+
}
|
623 |
+
|
624 |
/**
|
625 |
* PHP5 style destructor and will run when database object is destroyed.
|
626 |
*
|
nggallery.php
CHANGED
@@ -4,7 +4,7 @@ Plugin Name: NextGEN Gallery
|
|
4 |
Plugin URI: http://alexrabe.de/?page_id=80
|
5 |
Description: A NextGENeration Photo gallery for the Web 2.0.
|
6 |
Author: Alex Rabe
|
7 |
-
Version: 1.
|
8 |
|
9 |
Author URI: http://alexrabe.de/
|
10 |
|
@@ -34,10 +34,9 @@ if(preg_match('#' . basename(__FILE__) . '#', $_SERVER['PHP_SELF'])) { die('You
|
|
34 |
if (!class_exists('nggLoader')) {
|
35 |
class nggLoader {
|
36 |
|
37 |
-
var $version = '1.
|
38 |
-
var $dbversion = '1.
|
39 |
var $minium_WP = '3.0';
|
40 |
-
var $updateURL = 'http://nextgen.boelinger.com/version.php';
|
41 |
var $donators = 'http://nextgen.boelinger.com/donators.php';
|
42 |
var $options = '';
|
43 |
var $manage_page;
|
@@ -93,7 +92,7 @@ class nggLoader {
|
|
93 |
|
94 |
// All credits to the tranlator
|
95 |
$this->translator = '<p class="hint">'. __('<strong>Translation by : </strong><a target="_blank" href="http://alexrabe.de/wordpress-plugins/nextgen-gallery/languages/">See here</a>', 'nggallery') . '</p>';
|
96 |
-
$this->translator .= '<p class="hint">'. __('<strong>This translation is not yet updated for Version 1.
|
97 |
|
98 |
// Check for upgrade
|
99 |
$this->check_for_upgrade();
|
@@ -192,7 +191,7 @@ class nggLoader {
|
|
192 |
'admin_notices',
|
193 |
create_function(
|
194 |
'',
|
195 |
-
'echo \'<div id="message" class="error"><p><strong>' . __('Sorry, NextGEN Gallery works only with a Memory Limit of 16 MB higher', 'nggallery') . '</strong></p></div>\';'
|
196 |
)
|
197 |
);
|
198 |
return false;
|
@@ -249,7 +248,6 @@ class nggLoader {
|
|
249 |
define('NGGVERSION', $this->version);
|
250 |
// Minimum required database version
|
251 |
define('NGG_DBVERSION', $this->dbversion);
|
252 |
-
define('NGGURL', $this->updateURL);
|
253 |
|
254 |
// required for Windows & XAMPP
|
255 |
define('WINABSPATH', str_replace("\\", "/", ABSPATH) );
|
@@ -258,7 +256,7 @@ class nggLoader {
|
|
258 |
define('NGGFOLDER', plugin_basename( dirname(__FILE__)) );
|
259 |
|
260 |
define('NGGALLERY_ABSPATH', trailingslashit( str_replace("\\","/", WP_PLUGIN_DIR . '/' . plugin_basename( dirname(__FILE__) ) ) ) );
|
261 |
-
define('NGGALLERY_URLPATH', trailingslashit(
|
262 |
|
263 |
// look for imagerotator
|
264 |
define('NGGALLERY_IREXIST', !empty( $this->options['irURL'] ));
|
@@ -347,7 +345,7 @@ class nggLoader {
|
|
347 |
wp_enqueue_script('swfobject', NGGALLERY_URLPATH .'admin/js/swfobject.js', FALSE, '2.2');
|
348 |
else {
|
349 |
wp_register_script('jquery-cycle', NGGALLERY_URLPATH .'js/jquery.cycle.all.min.js', array('jquery'), '2.88');
|
350 |
-
wp_enqueue_script('ngg-slideshow', NGGALLERY_URLPATH .'js/ngg.slideshow.min.js', array('jquery-cycle'), '1.
|
351 |
|
352 |
}
|
353 |
|
4 |
Plugin URI: http://alexrabe.de/?page_id=80
|
5 |
Description: A NextGENeration Photo gallery for the Web 2.0.
|
6 |
Author: Alex Rabe
|
7 |
+
Version: 1.7.0
|
8 |
|
9 |
Author URI: http://alexrabe.de/
|
10 |
|
34 |
if (!class_exists('nggLoader')) {
|
35 |
class nggLoader {
|
36 |
|
37 |
+
var $version = '1.7.0';
|
38 |
+
var $dbversion = '1.7.0';
|
39 |
var $minium_WP = '3.0';
|
|
|
40 |
var $donators = 'http://nextgen.boelinger.com/donators.php';
|
41 |
var $options = '';
|
42 |
var $manage_page;
|
92 |
|
93 |
// All credits to the tranlator
|
94 |
$this->translator = '<p class="hint">'. __('<strong>Translation by : </strong><a target="_blank" href="http://alexrabe.de/wordpress-plugins/nextgen-gallery/languages/">See here</a>', 'nggallery') . '</p>';
|
95 |
+
$this->translator .= '<p class="hint">'. __('<strong>This translation is not yet updated for Version 1.7.0</strong>. If you would like to help with translation, download the current po from the plugin folder and read <a href="http://alexrabe.de/wordpress-plugins/wordtube/translation-of-plugins/">here</a> how you can translate the plugin.', 'nggallery') . '</p>';
|
96 |
|
97 |
// Check for upgrade
|
98 |
$this->check_for_upgrade();
|
191 |
'admin_notices',
|
192 |
create_function(
|
193 |
'',
|
194 |
+
'echo \'<div id="message" class="error"><p><strong>' . __('Sorry, NextGEN Gallery works only with a Memory Limit of 16 MB or higher', 'nggallery') . '</strong></p></div>\';'
|
195 |
)
|
196 |
);
|
197 |
return false;
|
248 |
define('NGGVERSION', $this->version);
|
249 |
// Minimum required database version
|
250 |
define('NGG_DBVERSION', $this->dbversion);
|
|
|
251 |
|
252 |
// required for Windows & XAMPP
|
253 |
define('WINABSPATH', str_replace("\\", "/", ABSPATH) );
|
256 |
define('NGGFOLDER', plugin_basename( dirname(__FILE__)) );
|
257 |
|
258 |
define('NGGALLERY_ABSPATH', trailingslashit( str_replace("\\","/", WP_PLUGIN_DIR . '/' . plugin_basename( dirname(__FILE__) ) ) ) );
|
259 |
+
define('NGGALLERY_URLPATH', trailingslashit( plugins_url( '', __FILE__ ) ) );
|
260 |
|
261 |
// look for imagerotator
|
262 |
define('NGGALLERY_IREXIST', !empty( $this->options['irURL'] ));
|
345 |
wp_enqueue_script('swfobject', NGGALLERY_URLPATH .'admin/js/swfobject.js', FALSE, '2.2');
|
346 |
else {
|
347 |
wp_register_script('jquery-cycle', NGGALLERY_URLPATH .'js/jquery.cycle.all.min.js', array('jquery'), '2.88');
|
348 |
+
wp_enqueue_script('ngg-slideshow', NGGALLERY_URLPATH .'js/ngg.slideshow.min.js', array('jquery-cycle'), '1.03');
|
349 |
|
350 |
}
|
351 |
|
nggfunctions.php
CHANGED
@@ -39,7 +39,7 @@ function nggShowSlideshow($galleryID, $width, $height) {
|
|
39 |
// init the flash output
|
40 |
$swfobject = new swfobject( $ngg_options['irURL'] , 'so' . $galleryID, $width, $height, '7.0.0', 'false');
|
41 |
|
42 |
-
$swfobject->message = '<p>'. __('The <a href="http://www.macromedia.com/go/getflashplayer">Flash Player</a> and <a href="http://www.mozilla.com/firefox/">a browser with Javascript support</a> are needed
|
43 |
$swfobject->add_params('wmode', 'opaque');
|
44 |
$swfobject->add_params('allowfullscreen', 'true');
|
45 |
$swfobject->add_params('bgcolor', $ngg_options['irScreencolor'], 'FFFFFF', 'string', '#');
|
@@ -47,7 +47,7 @@ function nggShowSlideshow($galleryID, $width, $height) {
|
|
47 |
$swfobject->add_attributes('name', 'so' . $galleryID);
|
48 |
|
49 |
// adding the flash parameter
|
50 |
-
$swfobject->add_flashvars( 'file', urlencode ( trailingslashit (
|
51 |
$swfobject->add_flashvars( 'shuffle', $ngg_options['irShuffle'], 'true', 'bool');
|
52 |
// option has oposite meaning : true should switch to next image
|
53 |
$swfobject->add_flashvars( 'linkfromdisplay', !$ngg_options['irLinkfromdisplay'], 'false', 'bool');
|
@@ -114,21 +114,24 @@ function nggShow_JS_Slideshow($galleryID, $width, $height, $class = 'ngg-slidesh
|
|
114 |
|
115 |
//filter to resize images for mobile browser
|
116 |
list($width, $height) = apply_filters('ngg_slideshow_size', array( $width, $height ) );
|
117 |
-
|
|
|
|
|
|
|
118 |
$out = '<div id="' . $anchor . '" class="' . $class . '" style="height:' . $height . 'px;width:' . $width . 'px;">';
|
119 |
$out .= "\n". '<div id="' . $anchor . '-loader" class="ngg-slideshow-loader" style="height:' . $height . 'px;width:' . $width . 'px;">';
|
120 |
-
$out .= "\n". '<img src="'. NGGALLERY_URLPATH . 'images/loader.gif
|
121 |
$out .= "\n". '</div>';
|
122 |
$out .= '</div>'."\n";
|
123 |
$out .= "\n".'<script type="text/javascript" defer="defer">';
|
124 |
-
$out .= "\n" . 'jQuery("#' . $anchor . '").nggSlideshow( {' .
|
125 |
'id: ' . $galleryID . ',' .
|
126 |
'fx:"' . $ngg_options['slideFx'] . '",' .
|
127 |
'width:' . $width . ',' .
|
128 |
'height:' . $height . ',' .
|
129 |
-
'domain: "' . trailingslashit (
|
130 |
'timeout:' . $ngg_options['irRotatetime'] * 1000 .
|
131 |
-
'});';
|
132 |
$out .= "\n".'</script>';
|
133 |
|
134 |
return $out;
|
@@ -774,7 +777,7 @@ function nggSinglePicture($imageID, $width = 250, $height = 250, $mode = '', $fl
|
|
774 |
|
775 |
// if we didn't use a cached image then we take the on-the-fly mode
|
776 |
if (!$picture->thumbnailURL)
|
777 |
-
$picture->thumbnailURL =
|
778 |
|
779 |
// add more variables for render output
|
780 |
$picture->imageURL = ( empty($link) ) ? $picture->imageURL : $link;
|
39 |
// init the flash output
|
40 |
$swfobject = new swfobject( $ngg_options['irURL'] , 'so' . $galleryID, $width, $height, '7.0.0', 'false');
|
41 |
|
42 |
+
$swfobject->message = '<p>'. __('The <a href="http://www.macromedia.com/go/getflashplayer">Flash Player</a> and <a href="http://www.mozilla.com/firefox/">a browser with Javascript support</a> are needed.', 'nggallery').'</p>';
|
43 |
$swfobject->add_params('wmode', 'opaque');
|
44 |
$swfobject->add_params('allowfullscreen', 'true');
|
45 |
$swfobject->add_params('bgcolor', $ngg_options['irScreencolor'], 'FFFFFF', 'string', '#');
|
47 |
$swfobject->add_attributes('name', 'so' . $galleryID);
|
48 |
|
49 |
// adding the flash parameter
|
50 |
+
$swfobject->add_flashvars( 'file', urlencode ( trailingslashit ( home_url() ) . 'index.php?callback=imagerotator&gid=' . $galleryID ) );
|
51 |
$swfobject->add_flashvars( 'shuffle', $ngg_options['irShuffle'], 'true', 'bool');
|
52 |
// option has oposite meaning : true should switch to next image
|
53 |
$swfobject->add_flashvars( 'linkfromdisplay', !$ngg_options['irLinkfromdisplay'], 'false', 'bool');
|
114 |
|
115 |
//filter to resize images for mobile browser
|
116 |
list($width, $height) = apply_filters('ngg_slideshow_size', array( $width, $height ) );
|
117 |
+
|
118 |
+
$width = (int) $width;
|
119 |
+
$height = (int) $height;
|
120 |
+
|
121 |
$out = '<div id="' . $anchor . '" class="' . $class . '" style="height:' . $height . 'px;width:' . $width . 'px;">';
|
122 |
$out .= "\n". '<div id="' . $anchor . '-loader" class="ngg-slideshow-loader" style="height:' . $height . 'px;width:' . $width . 'px;">';
|
123 |
+
$out .= "\n". '<img src="'. NGGALLERY_URLPATH . 'images/loader.gif" alt="" />';
|
124 |
$out .= "\n". '</div>';
|
125 |
$out .= '</div>'."\n";
|
126 |
$out .= "\n".'<script type="text/javascript" defer="defer">';
|
127 |
+
$out .= "\n" . 'jQuery(document).ready(function(){ ' . "\n" . 'jQuery("#' . $anchor . '").nggSlideshow( {' .
|
128 |
'id: ' . $galleryID . ',' .
|
129 |
'fx:"' . $ngg_options['slideFx'] . '",' .
|
130 |
'width:' . $width . ',' .
|
131 |
'height:' . $height . ',' .
|
132 |
+
'domain: "' . trailingslashit ( home_url() ) . '",' .
|
133 |
'timeout:' . $ngg_options['irRotatetime'] * 1000 .
|
134 |
+
'});' . "\n" . '});';
|
135 |
$out .= "\n".'</script>';
|
136 |
|
137 |
return $out;
|
777 |
|
778 |
// if we didn't use a cached image then we take the on-the-fly mode
|
779 |
if (!$picture->thumbnailURL)
|
780 |
+
$picture->thumbnailURL = home_url() . '/' . 'index.php?callback=image&pid=' . $imageID . '&width=' . $width . '&height=' . $height . '&mode=' . $mode;
|
781 |
|
782 |
// add more variables for render output
|
783 |
$picture->imageURL = ( empty($link) ) ? $picture->imageURL : $link;
|
readme.txt
CHANGED
@@ -134,6 +134,23 @@ To show the most recent added mages : **[recent max=x ]**
|
|
134 |
|
135 |
== Changelog ==
|
136 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
137 |
= V1.6.2 - 19.09.2010 =
|
138 |
* NEW : Added constant NGG_SKIP_LOAD_SCRIPTS to avoid script load
|
139 |
* Bugfix : Load Tags library with core files
|
134 |
|
135 |
== Changelog ==
|
136 |
|
137 |
+
= V1.7.0 - 11.12.2010 =
|
138 |
+
* NEW : Publish a new post direct from the gallery admin page
|
139 |
+
* NEW : Added filter hook 'ngg_get_image_metadata' to add more exif/iptc information
|
140 |
+
* NEW : Adding Autocomplete field to TinyMCE Popup and Album page
|
141 |
+
* NEW : More methods for XMLRPC interface
|
142 |
+
* Changed : New hooks for gallery table (THX to Alexander Schneider)
|
143 |
+
* Changed : Introduce jQuery dialog as new UI element
|
144 |
+
* Changed : Call TinyMCE window via admin-ajax
|
145 |
+
* Bugfix : Better support for SSL blogs
|
146 |
+
* Bugfix : Install/Upgrade failed when table prefix contain captial letters
|
147 |
+
* Bugfix : Fix validation issues in Media-RSS
|
148 |
+
* Bugifx : Empty tags in XMP Meta causes PHP error
|
149 |
+
* Bugifx : Rework load mechanism for slideshow
|
150 |
+
* Bugfix : Copy meta data when image is copied
|
151 |
+
* Bugfix : Icon Support for Ozh' Admin Drop Down Menu
|
152 |
+
* Bugfix : Use correct sort order in slideshow
|
153 |
+
|
154 |
= V1.6.2 - 19.09.2010 =
|
155 |
* NEW : Added constant NGG_SKIP_LOAD_SCRIPTS to avoid script load
|
156 |
* Bugfix : Load Tags library with core files
|
widgets/widgets.php
CHANGED
@@ -67,7 +67,7 @@ class nggSlideshowWidget extends WP_Widget {
|
|
67 |
$swfobject->add_attributes('styleclass', 'slideshow-widget');
|
68 |
|
69 |
// adding the flash parameter
|
70 |
-
$swfobject->add_flashvars( 'file', urlencode(
|
71 |
$swfobject->add_flashvars( 'shownavigation', 'false', 'true', 'bool');
|
72 |
$swfobject->add_flashvars( 'shuffle', $ngg_options['irShuffle'], 'true', 'bool');
|
73 |
$swfobject->add_flashvars( 'showicons', $ngg_options['irShowicons'], 'true', 'bool');
|
@@ -325,7 +325,7 @@ class nggWidget extends WP_Widget {
|
|
325 |
$instance['show'] = ( $instance['show'] == 'orginal' ) ? 'original' : $instance['show'];
|
326 |
|
327 |
if ( $instance['show'] == 'original' )
|
328 |
-
$out .= '<img src="' .
|
329 |
else
|
330 |
$out .= '<img src="'.$image->thumbURL.'" width="'.$instance['width'].'" height="'.$instance['height'].'" title="'.$alttext.'" alt="'.$alttext.'" />';
|
331 |
|
67 |
$swfobject->add_attributes('styleclass', 'slideshow-widget');
|
68 |
|
69 |
// adding the flash parameter
|
70 |
+
$swfobject->add_flashvars( 'file', urlencode( home_url() . '/' . 'index.php?callback=imagerotator&gid=' . $galleryID ) );
|
71 |
$swfobject->add_flashvars( 'shownavigation', 'false', 'true', 'bool');
|
72 |
$swfobject->add_flashvars( 'shuffle', $ngg_options['irShuffle'], 'true', 'bool');
|
73 |
$swfobject->add_flashvars( 'showicons', $ngg_options['irShowicons'], 'true', 'bool');
|
325 |
$instance['show'] = ( $instance['show'] == 'orginal' ) ? 'original' : $instance['show'];
|
326 |
|
327 |
if ( $instance['show'] == 'original' )
|
328 |
+
$out .= '<img src="' . home_url() . '/' . 'index.php?callback=image&pid='.$image->pid.'&width='.$instance['width'].'&height='.$instance['height']. '" title="'.$alttext.'" alt="'.$alttext.'" />';
|
329 |
else
|
330 |
$out .= '<img src="'.$image->thumbURL.'" width="'.$instance['width'].'" height="'.$instance['height'].'" title="'.$alttext.'" alt="'.$alttext.'" />';
|
331 |
|
xml/json.php
CHANGED
@@ -2,11 +2,10 @@
|
|
2 |
/**
|
3 |
* REST Application Programming Interface PHP class for the WordPress plugin NextGEN Gallery
|
4 |
* Should emulate some kind of Flickr JSON callback : ?callback=json&format=json&api_key=1234567890&method=search&term=myterm
|
5 |
-
|
6 |
*
|
|
|
7 |
* @author Alex Rabe
|
8 |
* @copyright Copyright 2010
|
9 |
-
* @since 1.5.0
|
10 |
* @require PHP 5.2.0 or higher
|
11 |
*
|
12 |
*/
|
@@ -22,11 +21,12 @@ class nggAPI {
|
|
22 |
*/
|
23 |
var $format = false; // $_GET['format'] : Return a XML oder JSON output
|
24 |
var $api_key = false; // $_GET['api_key'] : Protect the access via a random key (required if user is not logged into backend)
|
25 |
-
var $method = false; // $_GET['method'] : search | gallery | image |tag
|
26 |
var $term = false; // $_GET['term'] : The search term (required for method search | tag)
|
27 |
var $id = false; // $_GET['id'] : gallery or image id (required for method gallery | image)
|
28 |
-
var $limit = false; // $_GET['limit'] :
|
29 |
-
|
|
|
30 |
/**
|
31 |
* Contain the final output
|
32 |
*
|
@@ -61,16 +61,20 @@ class nggAPI {
|
|
61 |
$this->format = isset($_GET['format']) ? strtolower( $_GET['format'] ) : false;
|
62 |
$this->api_key = isset($_GET['api_key'])? $_GET['api_key'] : false;
|
63 |
$this->method = isset($_GET['method']) ? strtolower( $_GET['method'] ) : false;
|
64 |
-
$this->term = isset($_GET['term']) ?
|
65 |
$this->id = isset($_GET['id']) ? (int) $_GET['id'] : 0;
|
66 |
-
$this->limit = isset($_GET['limit']) ? (int) $_GET['limit'] : 0;
|
|
|
67 |
$this->result = array();
|
|
|
68 |
|
69 |
$this->start_process();
|
70 |
$this->render_output();
|
71 |
}
|
72 |
|
73 |
function start_process() {
|
|
|
|
|
74 |
|
75 |
if ( !$this->valid_access() )
|
76 |
return;
|
@@ -82,7 +86,7 @@ class nggAPI {
|
|
82 |
break;
|
83 |
case 'gallery' :
|
84 |
//search for some gallery
|
85 |
-
$this->result['images'] = ($this->id == 0) ? nggdb::find_last_images( 0 , 100 ) : nggdb::get_gallery( $this->id, '
|
86 |
break;
|
87 |
case 'image' :
|
88 |
//search for some image
|
@@ -96,6 +100,10 @@ class nggAPI {
|
|
96 |
//search for images based on tags
|
97 |
$this->result['images'] = nggdb::find_last_images( 0 , $this->limit );
|
98 |
break;
|
|
|
|
|
|
|
|
|
99 |
default :
|
100 |
$this->result = array ('stat' => 'fail', 'code' => '98', 'message' => 'Method not known.');
|
101 |
return false;
|
@@ -120,6 +128,88 @@ class nggAPI {
|
|
120 |
return false;
|
121 |
}
|
122 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
123 |
/**
|
124 |
* Iterates through a multidimensional array
|
125 |
*
|
@@ -155,12 +245,12 @@ class nggAPI {
|
|
155 |
function render_output() {
|
156 |
|
157 |
if ($this->format == 'json') {
|
158 |
-
header('Content-Type:
|
159 |
$this->output = json_encode($this->result);
|
160 |
} else {
|
161 |
header('Content-Type: text/xml; charset=' . get_option('blog_charset'), true);
|
162 |
$this->output = "<?xml version='1.0' encoding='UTF-8' standalone='yes'?>\n";
|
163 |
-
$this->output .= "<nextgen-gallery>" . create_xml_array( $this->result ) . "</nextgen-gallery>\n";
|
164 |
}
|
165 |
|
166 |
}
|
2 |
/**
|
3 |
* REST Application Programming Interface PHP class for the WordPress plugin NextGEN Gallery
|
4 |
* Should emulate some kind of Flickr JSON callback : ?callback=json&format=json&api_key=1234567890&method=search&term=myterm
|
|
|
5 |
*
|
6 |
+
* @version 1.1.0
|
7 |
* @author Alex Rabe
|
8 |
* @copyright Copyright 2010
|
|
|
9 |
* @require PHP 5.2.0 or higher
|
10 |
*
|
11 |
*/
|
21 |
*/
|
22 |
var $format = false; // $_GET['format'] : Return a XML oder JSON output
|
23 |
var $api_key = false; // $_GET['api_key'] : Protect the access via a random key (required if user is not logged into backend)
|
24 |
+
var $method = false; // $_GET['method'] : search | gallery | image | tag | autocomplete
|
25 |
var $term = false; // $_GET['term'] : The search term (required for method search | tag)
|
26 |
var $id = false; // $_GET['id'] : gallery or image id (required for method gallery | image)
|
27 |
+
var $limit = false; // $_GET['limit'] : maximum of images which we request
|
28 |
+
var $type = false; // $_GET['type'] : gallery | image | album (required for method autocomplete)
|
29 |
+
|
30 |
/**
|
31 |
* Contain the final output
|
32 |
*
|
61 |
$this->format = isset($_GET['format']) ? strtolower( $_GET['format'] ) : false;
|
62 |
$this->api_key = isset($_GET['api_key'])? $_GET['api_key'] : false;
|
63 |
$this->method = isset($_GET['method']) ? strtolower( $_GET['method'] ) : false;
|
64 |
+
$this->term = isset($_GET['term']) ? urldecode( $_GET['term'] ) : false;
|
65 |
$this->id = isset($_GET['id']) ? (int) $_GET['id'] : 0;
|
66 |
+
$this->limit = isset($_GET['limit']) ? (int) $_GET['limit'] : 0;
|
67 |
+
$this->type = isset($_GET['type']) ? strtolower( $_GET['type'] ) : false;
|
68 |
$this->result = array();
|
69 |
+
$this->list = false;
|
70 |
|
71 |
$this->start_process();
|
72 |
$this->render_output();
|
73 |
}
|
74 |
|
75 |
function start_process() {
|
76 |
+
|
77 |
+
global $ngg;
|
78 |
|
79 |
if ( !$this->valid_access() )
|
80 |
return;
|
86 |
break;
|
87 |
case 'gallery' :
|
88 |
//search for some gallery
|
89 |
+
$this->result['images'] = ($this->id == 0) ? nggdb::find_last_images( 0 , 100 ) : nggdb::get_gallery( $this->id, $ngg->options['galSort'], $ngg->options['galSortDir'], true, 0, 0, true );
|
90 |
break;
|
91 |
case 'image' :
|
92 |
//search for some image
|
100 |
//search for images based on tags
|
101 |
$this->result['images'] = nggdb::find_last_images( 0 , $this->limit );
|
102 |
break;
|
103 |
+
case 'autocomplete' :
|
104 |
+
//return images, galleries or albums for autocomplete drop down list
|
105 |
+
return $this->autocomplete();
|
106 |
+
break;
|
107 |
default :
|
108 |
$this->result = array ('stat' => 'fail', 'code' => '98', 'message' => 'Method not known.');
|
109 |
return false;
|
128 |
return false;
|
129 |
}
|
130 |
|
131 |
+
/**
|
132 |
+
* return search result for autocomplete request from backend
|
133 |
+
*
|
134 |
+
* @since 1.7.0
|
135 |
+
* @return void
|
136 |
+
*/
|
137 |
+
function autocomplete() {
|
138 |
+
global $nggdb;
|
139 |
+
|
140 |
+
switch ( $this->type ) {
|
141 |
+
case 'image' :
|
142 |
+
|
143 |
+
// return the last entries in case of an empty search string
|
144 |
+
if ( empty($this->term) )
|
145 |
+
$list = $nggdb->find_last_images(0, $this->limit, false);
|
146 |
+
else
|
147 |
+
$list = $nggdb->search_for_images($this->term, $this->limit);
|
148 |
+
|
149 |
+
if( is_array($list) ) {
|
150 |
+
foreach($list as $image) {
|
151 |
+
// reorder result to array-object
|
152 |
+
$obj = new stdClass();
|
153 |
+
$obj->id = $image->pid;
|
154 |
+
$name = ( empty($image->alttext) ? $image->filename : $image->alttext );
|
155 |
+
//TODO : need to rework save/load
|
156 |
+
$name = stripslashes( htmlspecialchars_decode($name, ENT_QUOTES));
|
157 |
+
$obj->label = $image->pid . ' - ' . $name;
|
158 |
+
$obj->value = $name;
|
159 |
+
$this->result[] = $obj;
|
160 |
+
}
|
161 |
+
}
|
162 |
+
|
163 |
+
return $this->result;
|
164 |
+
break;
|
165 |
+
case 'gallery' :
|
166 |
+
|
167 |
+
if ( empty($this->term) )
|
168 |
+
$list = $nggdb->find_all_galleries('gid', 'DESC', false, $this->limit );
|
169 |
+
else
|
170 |
+
$list = $nggdb->search_for_galleries($this->term, $this->limit);
|
171 |
+
|
172 |
+
if( is_array($list) ) {
|
173 |
+
foreach($list as $gallery) {
|
174 |
+
// reorder result to array-object
|
175 |
+
$obj = new stdClass();
|
176 |
+
$obj->id = $gallery->gid;
|
177 |
+
$name = ( empty($gallery->title) ) ? $gallery->name : $gallery->title;
|
178 |
+
$name = stripslashes( htmlspecialchars_decode($name, ENT_QUOTES));
|
179 |
+
$obj->label = $gallery->gid . ' - ' . $name;
|
180 |
+
$obj->value = $name;
|
181 |
+
$this->result[] = $obj;
|
182 |
+
}
|
183 |
+
}
|
184 |
+
return $this->result;
|
185 |
+
break;
|
186 |
+
case 'album' :
|
187 |
+
|
188 |
+
if ( empty($this->term) )
|
189 |
+
$list = $nggdb->find_all_album('id', 'DESC', $this->limit );
|
190 |
+
else
|
191 |
+
$list = $nggdb->search_for_albums($this->term, $this->limit);
|
192 |
+
|
193 |
+
if( is_array($list) ) {
|
194 |
+
foreach($list as $album) {
|
195 |
+
// reorder result to array-object
|
196 |
+
$obj = new stdClass();
|
197 |
+
$obj->id = $album->id;
|
198 |
+
$album->name = stripslashes( htmlspecialchars_decode($album->name, ENT_QUOTES));
|
199 |
+
$obj->label = $album->id . ' - ' . $album->name;
|
200 |
+
$obj->value = $album->name;
|
201 |
+
$this->result[] = $obj;
|
202 |
+
}
|
203 |
+
}
|
204 |
+
return $this->result;
|
205 |
+
break;
|
206 |
+
default :
|
207 |
+
$this->result = array ('stat' => 'fail', 'code' => '98', 'message' => 'Type not known.');
|
208 |
+
return false;
|
209 |
+
break;
|
210 |
+
}
|
211 |
+
}
|
212 |
+
|
213 |
/**
|
214 |
* Iterates through a multidimensional array
|
215 |
*
|
245 |
function render_output() {
|
246 |
|
247 |
if ($this->format == 'json') {
|
248 |
+
header('Content-Type: application/json; charset=' . get_option('blog_charset'), true);
|
249 |
$this->output = json_encode($this->result);
|
250 |
} else {
|
251 |
header('Content-Type: text/xml; charset=' . get_option('blog_charset'), true);
|
252 |
$this->output = "<?xml version='1.0' encoding='UTF-8' standalone='yes'?>\n";
|
253 |
+
$this->output .= "<nextgen-gallery>" . $this->create_xml_array( $this->result ) . "</nextgen-gallery>\n";
|
254 |
}
|
255 |
|
256 |
}
|