Version Description
- 10.13.2020 =
- NEW: PHP 5.6 is the minimum supported PHP version
- NEW: WordPress 5.2 is the minimum support PHP version
- Fixed: Block disappearing in Block Editor
- Fixed: Gutenberg block and featured image features were broken on wordpress.com hosting
- Note: NextGEN Gallery will soon be licensed under GPLv3.
Download this release
Release Info
| Developer | photocrati |
| Plugin |  NextGEN Gallery – WordPress Gallery Plugin |
| Version | 3.3.20 |
| Comparing to | |
| See all releases | |
Code changes from version 3.3.17 to 3.3.20
- changelog.txt +7 -0
- composer.json +2 -3
- composer.lock +4 -63
- nggallery.php +5 -5
- products/photocrati_nextgen/modules/attach_to_post/static/attach_to_post.js +109 -88
- products/photocrati_nextgen/modules/attach_to_post/static/attach_to_post.min.js +1 -1
- products/photocrati_nextgen/modules/attach_to_post/static/display_tab.js +1 -0
- products/photocrati_nextgen/modules/attach_to_post/static/ngg_attach_to_post_tinymce_plugin.css +1 -1
- products/photocrati_nextgen/modules/attach_to_post/static/ngg_attach_to_post_tinymce_plugin.js +1 -1
- products/photocrati_nextgen/modules/attach_to_post/static/ngg_attach_to_post_tinymce_plugin.min.css +1 -1
- products/photocrati_nextgen/modules/attach_to_post/static/ngg_attach_to_post_tinymce_plugin.min.js +1 -1
- products/photocrati_nextgen/modules/i18n/lang/nggallery-da_DK.po +4 -4
- products/photocrati_nextgen/modules/i18n/lang/nggallery-sv_SE.po +4 -4
- products/photocrati_nextgen/modules/i18n/lang/nggallery.pot +2 -2
- products/photocrati_nextgen/modules/nextgen_admin/package.module.nextgen_admin.php +1 -1
- products/photocrati_nextgen/modules/nextgen_admin/templates/review_notice.php +1 -1
- products/photocrati_nextgen/modules/nextgen_block/module.nextgen_block.php +16 -5
- products/photocrati_nextgen/modules/nextgen_block/package.module.nextgen_block.php +9 -11
- products/photocrati_nextgen/modules/nextgen_block/static/build/block.min.js +14 -1
- products/photocrati_nextgen/modules/nextgen_block/static/build/block.min.js.map +1 -1
- products/photocrati_nextgen/modules/nextgen_block/static/build/post-thumbnail.min.js +14 -1
- products/photocrati_nextgen/modules/nextgen_block/static/build/post-thumbnail.min.js.map +1 -1
- products/photocrati_nextgen/modules/nextgen_block/static/editor.css +107 -81
- products/photocrati_nextgen/modules/nextgen_block/static/editor.min.css +1 -1
- products/photocrati_nextgen/modules/nextgen_block/static/src/block.jsx +16 -30
- products/photocrati_nextgen/modules/nextgen_block/static/src/block.min.js +0 -57
- products/photocrati_nextgen/modules/nextgen_block/static/src/components/ngg-post-thumbnail.jsx +79 -137
- products/photocrati_nextgen/modules/nextgen_block/static/src/components/ngg-post-thumbnail.min.js +0 -189
- products/photocrati_nextgen/modules/nextgen_block/static/src/edit.jsx +132 -59
- products/photocrati_nextgen/modules/nextgen_block/static/src/edit.min.js +0 -74
- products/photocrati_nextgen/modules/nextgen_block/static/src/post-thumbnail.jsx +15 -35
- products/photocrati_nextgen/modules/nextgen_block/static/src/post-thumbnail.min.js +0 -39
- readme.txt +16 -6
- vendor/bin/php-parse +0 -205
- vendor/composer/autoload_psr4.php +0 -1
- vendor/composer/autoload_static.php +0 -16
- vendor/composer/installed.json +2 -62
- vendor/nikic/php-parser/LICENSE +0 -31
- vendor/nikic/php-parser/README.md +0 -225
- vendor/nikic/php-parser/bin/php-parse +0 -205
- vendor/nikic/php-parser/composer.json +0 -41
- vendor/nikic/php-parser/grammar/README.md +0 -30
- vendor/nikic/php-parser/grammar/parser.template +0 -106
- vendor/nikic/php-parser/grammar/php5.y +0 -1026
- vendor/nikic/php-parser/grammar/php7.y +0 -1036
- vendor/nikic/php-parser/grammar/rebuildParsers.php +0 -261
- vendor/nikic/php-parser/grammar/tokens.template +0 -17
- vendor/nikic/php-parser/grammar/tokens.y +0 -114
- vendor/nikic/php-parser/lib/PhpParser/Builder.php +0 -13
- vendor/nikic/php-parser/lib/PhpParser/Builder/Class_.php +0 -122
- vendor/nikic/php-parser/lib/PhpParser/Builder/Declaration.php +0 -43
- vendor/nikic/php-parser/lib/PhpParser/Builder/FunctionLike.php +0 -74
- vendor/nikic/php-parser/lib/PhpParser/Builder/Function_.php +0 -50
- vendor/nikic/php-parser/lib/PhpParser/Builder/Interface_.php +0 -75
- vendor/nikic/php-parser/lib/PhpParser/Builder/Method.php +0 -129
- vendor/nikic/php-parser/lib/PhpParser/Builder/Namespace_.php +0 -45
- vendor/nikic/php-parser/lib/PhpParser/Builder/Param.php +0 -106
- vendor/nikic/php-parser/lib/PhpParser/Builder/Property.php +0 -132
- vendor/nikic/php-parser/lib/PhpParser/Builder/TraitUse.php +0 -64
- vendor/nikic/php-parser/lib/PhpParser/Builder/TraitUseAdaptation.php +0 -148
- vendor/nikic/php-parser/lib/PhpParser/Builder/Trait_.php +0 -60
- vendor/nikic/php-parser/lib/PhpParser/Builder/Use_.php +0 -49
- vendor/nikic/php-parser/lib/PhpParser/BuilderFactory.php +0 -348
- vendor/nikic/php-parser/lib/PhpParser/BuilderHelpers.php +0 -285
- vendor/nikic/php-parser/lib/PhpParser/Comment.php +0 -239
- vendor/nikic/php-parser/lib/PhpParser/Comment/Doc.php +0 -7
- vendor/nikic/php-parser/lib/PhpParser/ConstExprEvaluationException.php +0 -6
- vendor/nikic/php-parser/lib/PhpParser/ConstExprEvaluator.php +0 -226
- vendor/nikic/php-parser/lib/PhpParser/Error.php +0 -180
- vendor/nikic/php-parser/lib/PhpParser/ErrorHandler.php +0 -13
- vendor/nikic/php-parser/lib/PhpParser/ErrorHandler/Collecting.php +0 -46
- vendor/nikic/php-parser/lib/PhpParser/ErrorHandler/Throwing.php +0 -18
- vendor/nikic/php-parser/lib/PhpParser/Internal/DiffElem.php +0 -27
- vendor/nikic/php-parser/lib/PhpParser/Internal/Differ.php +0 -164
- vendor/nikic/php-parser/lib/PhpParser/Internal/PrintableNewAnonClassNode.php +0 -57
- vendor/nikic/php-parser/lib/PhpParser/Internal/TokenStream.php +0 -256
- vendor/nikic/php-parser/lib/PhpParser/JsonDecoder.php +0 -103
- vendor/nikic/php-parser/lib/PhpParser/Lexer.php +0 -422
- vendor/nikic/php-parser/lib/PhpParser/Lexer/Emulative.php +0 -250
- vendor/nikic/php-parser/lib/PhpParser/Lexer/TokenEmulator/CoaleseEqualTokenEmulator.php +0 -41
- vendor/nikic/php-parser/lib/PhpParser/Lexer/TokenEmulator/FnTokenEmulator.php +0 -53
- vendor/nikic/php-parser/lib/PhpParser/Lexer/TokenEmulator/NumericLiteralSeparatorEmulator.php +0 -99
- vendor/nikic/php-parser/lib/PhpParser/Lexer/TokenEmulator/TokenEmulatorInterface.php +0 -14
- vendor/nikic/php-parser/lib/PhpParser/NameContext.php +0 -285
- vendor/nikic/php-parser/lib/PhpParser/Node.php +0 -151
- vendor/nikic/php-parser/lib/PhpParser/Node/Arg.php +0 -38
- vendor/nikic/php-parser/lib/PhpParser/Node/Const_.php +0 -37
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr.php +0 -9
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ArrayDimFetch.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ArrayItem.php +0 -41
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Array_.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ArrowFunction.php +0 -71
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Assign.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/BitwiseAnd.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/BitwiseOr.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/BitwiseXor.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Coalesce.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Concat.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Div.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Minus.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Mod.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Mul.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Plus.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Pow.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/ShiftLeft.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/ShiftRight.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignRef.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp.php +0 -40
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/BitwiseAnd.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/BitwiseOr.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/BitwiseXor.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/BooleanAnd.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/BooleanOr.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Coalesce.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Concat.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Div.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Equal.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Greater.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/GreaterOrEqual.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Identical.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/LogicalAnd.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/LogicalOr.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/LogicalXor.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Minus.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Mod.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Mul.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/NotEqual.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/NotIdentical.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Plus.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Pow.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/ShiftLeft.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/ShiftRight.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Smaller.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/SmallerOrEqual.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Spaceship.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BitwiseNot.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BooleanNot.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast.php +0 -26
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast/Array_.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast/Bool_.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast/Double.php +0 -17
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast/Int_.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast/Object_.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast/String_.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast/Unset_.php +0 -12
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ClassConstFetch.php +0 -36
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Clone_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Closure.php +0 -71
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ClosureUse.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ConstFetch.php +0 -31
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Empty_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Error.php +0 -31
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ErrorSuppress.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Eval_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Exit_.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/FuncCall.php +0 -35
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Include_.php +0 -39
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Instanceof_.php +0 -35
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Isset_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/List_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/MethodCall.php +0 -40
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/New_.php +0 -35
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/PostDec.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/PostInc.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/PreDec.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/PreInc.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Print_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/PropertyFetch.php +0 -35
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ShellExec.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/StaticCall.php +0 -40
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/StaticPropertyFetch.php +0 -36
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Ternary.php +0 -38
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/UnaryMinus.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/UnaryPlus.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Variable.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/YieldFrom.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Yield_.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/FunctionLike.php +0 -36
- vendor/nikic/php-parser/lib/PhpParser/Node/Identifier.php +0 -75
- vendor/nikic/php-parser/lib/PhpParser/Node/Name.php +0 -242
- vendor/nikic/php-parser/lib/PhpParser/Node/Name/FullyQualified.php +0 -50
- vendor/nikic/php-parser/lib/PhpParser/Node/Name/Relative.php +0 -50
- vendor/nikic/php-parser/lib/PhpParser/Node/NullableType.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Param.php +0 -49
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar.php +0 -7
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/DNumber.php +0 -70
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/Encapsed.php +0 -31
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/EncapsedStringPart.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/LNumber.php +0 -73
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst.php +0 -28
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/Class_.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/Dir.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/File.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/Function_.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/Line.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/Method.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/Namespace_.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/Trait_.php +0 -16
- vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/String_.php +0 -141
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt.php +0 -9
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Break_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Case_.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Catch_.php +0 -41
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/ClassConst.php +0 -62
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/ClassLike.php +0 -107
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/ClassMethod.php +0 -151
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Class_.php +0 -105
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Const_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Continue_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/DeclareDeclare.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Declare_.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Do_.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Echo_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/ElseIf_.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Else_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Expression.php +0 -33
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Finally_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/For_.php +0 -43
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Foreach_.php +0 -47
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Function_.php +0 -69
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Global_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Goto_.php +0 -31
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/GroupUse.php +0 -39
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/HaltCompiler.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/If_.php +0 -43
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/InlineHTML.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Interface_.php +0 -35
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Label.php +0 -31
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Namespace_.php +0 -38
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Nop.php +0 -17
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Property.php +0 -79
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/PropertyProperty.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Return_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/StaticVar.php +0 -37
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Static_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Switch_.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Throw_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/TraitUse.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/TraitUseAdaptation.php +0 -13
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/TraitUseAdaptation/Alias.php +0 -38
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/TraitUseAdaptation/Precedence.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Trait_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/TryCatch.php +0 -38
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Unset_.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/UseUse.php +0 -52
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Use_.php +0 -47
- vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/While_.php +0 -34
- vendor/nikic/php-parser/lib/PhpParser/Node/UnionType.php +0 -30
- vendor/nikic/php-parser/lib/PhpParser/Node/VarLikeIdentifier.php +0 -17
- vendor/nikic/php-parser/lib/PhpParser/NodeAbstract.php +0 -178
- vendor/nikic/php-parser/lib/PhpParser/NodeDumper.php +0 -203
- vendor/nikic/php-parser/lib/PhpParser/NodeFinder.php +0 -81
- vendor/nikic/php-parser/lib/PhpParser/NodeTraverser.php +0 -291
- vendor/nikic/php-parser/lib/PhpParser/NodeTraverserInterface.php +0 -29
- vendor/nikic/php-parser/lib/PhpParser/NodeVisitor.php +0 -72
- vendor/nikic/php-parser/lib/PhpParser/NodeVisitor/CloningVisitor.php +0 -20
- vendor/nikic/php-parser/lib/PhpParser/NodeVisitor/FindingVisitor.php +0 -48
- vendor/nikic/php-parser/lib/PhpParser/NodeVisitor/FirstFindingVisitor.php +0 -50
- vendor/nikic/php-parser/lib/PhpParser/NodeVisitor/NameResolver.php +0 -228
- vendor/nikic/php-parser/lib/PhpParser/NodeVisitorAbstract.php +0 -25
- vendor/nikic/php-parser/lib/PhpParser/Parser.php +0 -18
- vendor/nikic/php-parser/lib/PhpParser/Parser/Multiple.php +0 -55
- vendor/nikic/php-parser/lib/PhpParser/Parser/Php5.php +0 -2640
- vendor/nikic/php-parser/lib/PhpParser/Parser/Php7.php +0 -796
changelog.txt
CHANGED
|
@@ -1,6 +1,13 @@
|
|
| 1 |
NextGEN Gallery
|
| 2 |
by Imagely
|
| 3 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 4 |
= V3.3.17 - 08.18.2020 =
|
| 5 |
* Fixed: Override Thumbnail Settings not configurable
|
| 6 |
* Fixed: Broken gallery displays in WP 5.5 with Classic Editor
|
| 1 |
NextGEN Gallery
|
| 2 |
by Imagely
|
| 3 |
|
| 4 |
+
= V3.3.20 - 10.13.2020 =
|
| 5 |
+
* NEW: PHP 5.6 is the minimum supported PHP version
|
| 6 |
+
* NEW: WordPress 5.2 is the minimum support PHP version
|
| 7 |
+
* Fixed: Block disappearing in Block Editor
|
| 8 |
+
* Fixed: Gutenberg block and featured image features were broken on wordpress.com hosting
|
| 9 |
+
* Note: NextGEN Gallery will soon be licensed under GPLv3.
|
| 10 |
+
|
| 11 |
= V3.3.17 - 08.18.2020 =
|
| 12 |
* Fixed: Override Thumbnail Settings not configurable
|
| 13 |
* Fixed: Broken gallery displays in WP 5.5 with Classic Editor
|
composer.json
CHANGED
|
@@ -1,7 +1,7 @@
|
|
| 1 |
{
|
| 2 |
"name": "imagely/nextgen-gallery",
|
| 3 |
-
"version": "3.3.
|
| 4 |
-
"description": "The most popular gallery plugin for WordPress and one of the most popular plugins of all time with over
|
| 5 |
"keywords": ["nextgen", "nextgen gallery", "gallery", "galleries", "image", "images", "image gallery", "photo", "photos", "photo gallery", "picture", "pictures", "picture gallery", "album", "albums", "photo albums", "image album", "media", "media gallery", "thumbnails", "thumbnail gallery", "thumbnail galleries", "slideshow", "slideshows", "slideshow gallery", "slideshow galleries", "fancybox", "lightbox", "responsive", "responsive gallery", "responsive galleries", "singlepic", "watermarks", "watermarking", "photography", "photographer"],
|
| 6 |
"homepage": "https://www.imagely.com/",
|
| 7 |
"license": "GPLv2",
|
|
@@ -15,6 +15,5 @@
|
|
| 15 |
"ezyang/htmlpurifier": "^4.13"
|
| 16 |
},
|
| 17 |
"require-dev": {
|
| 18 |
-
"nikic/php-parser": "^4.3"
|
| 19 |
}
|
| 20 |
}
|
| 1 |
{
|
| 2 |
"name": "imagely/nextgen-gallery",
|
| 3 |
+
"version": "3.3.18",
|
| 4 |
+
"description": "The most popular gallery plugin for WordPress and one of the most popular plugins of all time with over 30 million downloads.",
|
| 5 |
"keywords": ["nextgen", "nextgen gallery", "gallery", "galleries", "image", "images", "image gallery", "photo", "photos", "photo gallery", "picture", "pictures", "picture gallery", "album", "albums", "photo albums", "image album", "media", "media gallery", "thumbnails", "thumbnail gallery", "thumbnail galleries", "slideshow", "slideshows", "slideshow gallery", "slideshow galleries", "fancybox", "lightbox", "responsive", "responsive gallery", "responsive galleries", "singlepic", "watermarks", "watermarking", "photography", "photographer"],
|
| 6 |
"homepage": "https://www.imagely.com/",
|
| 7 |
"license": "GPLv2",
|
| 15 |
"ezyang/htmlpurifier": "^4.13"
|
| 16 |
},
|
| 17 |
"require-dev": {
|
|
|
|
| 18 |
}
|
| 19 |
}
|
composer.lock
CHANGED
|
@@ -4,7 +4,7 @@
|
|
| 4 |
"Read more about it at https://getcomposer.org/doc/01-basic-usage.md#installing-dependencies",
|
| 5 |
"This file is @generated automatically"
|
| 6 |
],
|
| 7 |
-
"content-hash": "
|
| 8 |
"packages": [
|
| 9 |
{
|
| 10 |
"name": "ezyang/htmlpurifier",
|
|
@@ -21,7 +21,7 @@
|
|
| 21 |
"shasum": "",
|
| 22 |
"mirrors": [
|
| 23 |
{
|
| 24 |
-
"url": "https://repo.packagist.com/imagely/dists/%package%/%version
|
| 25 |
"preferred": true
|
| 26 |
}
|
| 27 |
]
|
|
@@ -77,7 +77,7 @@
|
|
| 77 |
"shasum": "",
|
| 78 |
"mirrors": [
|
| 79 |
{
|
| 80 |
-
"url": "https://repo.packagist.com/imagely/dists/%package%/%version
|
| 81 |
"preferred": true
|
| 82 |
}
|
| 83 |
]
|
|
@@ -106,66 +106,7 @@
|
|
| 106 |
"time": "2020-06-11T20:23:55+00:00"
|
| 107 |
}
|
| 108 |
],
|
| 109 |
-
"packages-dev": [
|
| 110 |
-
{
|
| 111 |
-
"name": "nikic/php-parser",
|
| 112 |
-
"version": "v4.5.0",
|
| 113 |
-
"source": {
|
| 114 |
-
"type": "git",
|
| 115 |
-
"url": "https://github.com/nikic/PHP-Parser.git",
|
| 116 |
-
"reference": "53c2753d756f5adb586dca79c2ec0e2654dd9463"
|
| 117 |
-
},
|
| 118 |
-
"dist": {
|
| 119 |
-
"type": "zip",
|
| 120 |
-
"url": "https://api.github.com/repos/nikic/PHP-Parser/zipball/53c2753d756f5adb586dca79c2ec0e2654dd9463",
|
| 121 |
-
"reference": "53c2753d756f5adb586dca79c2ec0e2654dd9463",
|
| 122 |
-
"shasum": "",
|
| 123 |
-
"mirrors": [
|
| 124 |
-
{
|
| 125 |
-
"url": "https://repo.packagist.com/imagely/dists/%package%/%version%/%reference%.%type%",
|
| 126 |
-
"preferred": true
|
| 127 |
-
}
|
| 128 |
-
]
|
| 129 |
-
},
|
| 130 |
-
"require": {
|
| 131 |
-
"ext-tokenizer": "*",
|
| 132 |
-
"php": ">=7.0"
|
| 133 |
-
},
|
| 134 |
-
"require-dev": {
|
| 135 |
-
"ircmaxell/php-yacc": "0.0.5",
|
| 136 |
-
"phpunit/phpunit": "^6.5 || ^7.0 || ^8.0"
|
| 137 |
-
},
|
| 138 |
-
"bin": [
|
| 139 |
-
"bin/php-parse"
|
| 140 |
-
],
|
| 141 |
-
"type": "library",
|
| 142 |
-
"extra": {
|
| 143 |
-
"branch-alias": {
|
| 144 |
-
"dev-master": "4.3-dev"
|
| 145 |
-
}
|
| 146 |
-
},
|
| 147 |
-
"autoload": {
|
| 148 |
-
"psr-4": {
|
| 149 |
-
"PhpParser\\": "lib/PhpParser"
|
| 150 |
-
}
|
| 151 |
-
},
|
| 152 |
-
"notification-url": "https://repo.packagist.com/imagely/downloads/",
|
| 153 |
-
"license": [
|
| 154 |
-
"BSD-3-Clause"
|
| 155 |
-
],
|
| 156 |
-
"authors": [
|
| 157 |
-
{
|
| 158 |
-
"name": "Nikita Popov"
|
| 159 |
-
}
|
| 160 |
-
],
|
| 161 |
-
"description": "A PHP parser written in PHP",
|
| 162 |
-
"keywords": [
|
| 163 |
-
"parser",
|
| 164 |
-
"php"
|
| 165 |
-
],
|
| 166 |
-
"time": "2020-06-03T07:24:19+00:00"
|
| 167 |
-
}
|
| 168 |
-
],
|
| 169 |
"aliases": [],
|
| 170 |
"minimum-stability": "stable",
|
| 171 |
"stability-flags": [],
|
| 4 |
"Read more about it at https://getcomposer.org/doc/01-basic-usage.md#installing-dependencies",
|
| 5 |
"This file is @generated automatically"
|
| 6 |
],
|
| 7 |
+
"content-hash": "053b848d6bbaa7c266ec767c260588a8",
|
| 8 |
"packages": [
|
| 9 |
{
|
| 10 |
"name": "ezyang/htmlpurifier",
|
| 21 |
"shasum": "",
|
| 22 |
"mirrors": [
|
| 23 |
{
|
| 24 |
+
"url": "https://repo.packagist.com/imagely/dists/%package%/%version%/r%reference%.%type%",
|
| 25 |
"preferred": true
|
| 26 |
}
|
| 27 |
]
|
| 77 |
"shasum": "",
|
| 78 |
"mirrors": [
|
| 79 |
{
|
| 80 |
+
"url": "https://repo.packagist.com/imagely/dists/%package%/%version%/r%reference%.%type%",
|
| 81 |
"preferred": true
|
| 82 |
}
|
| 83 |
]
|
| 106 |
"time": "2020-06-11T20:23:55+00:00"
|
| 107 |
}
|
| 108 |
],
|
| 109 |
+
"packages-dev": [],
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 110 |
"aliases": [],
|
| 111 |
"minimum-stability": "stable",
|
| 112 |
"stability-flags": [],
|
nggallery.php
CHANGED
|
@@ -3,15 +3,15 @@ if(preg_match('#' . basename(__FILE__) . '#', $_SERVER['PHP_SELF'])) { die('You
|
|
| 3 |
|
| 4 |
/**
|
| 5 |
* Plugin Name: NextGEN Gallery
|
| 6 |
-
* Description: The most popular gallery plugin for WordPress and one of the most popular plugins of all time with over
|
| 7 |
-
* Version: 3.3.
|
| 8 |
* Author: Imagely
|
| 9 |
* Plugin URI: https://www.imagely.com/wordpress-gallery-plugin/nextgen-gallery/
|
| 10 |
* Author URI: https://www.imagely.com
|
| 11 |
* License: GPLv2
|
| 12 |
* Text Domain: nggallery
|
| 13 |
* Domain Path: /products/photocrati_nextgen/modules/i18n/lang
|
| 14 |
-
* Requires PHP: 5.
|
| 15 |
*/
|
| 16 |
|
| 17 |
if (!class_exists('E_Clean_Exit')) { class E_Clean_Exit extends RuntimeException {} }
|
|
@@ -680,7 +680,7 @@ class C_NextGEN_Bootstrap
|
|
| 680 |
define('NGG_PRODUCT_URL', path_join(str_replace("\\" , '/', NGG_PLUGIN_URL), 'products'));
|
| 681 |
define('NGG_MODULE_URL', path_join(str_replace("\\", '/', NGG_PRODUCT_URL), 'photocrati_nextgen/modules'));
|
| 682 |
define('NGG_PLUGIN_STARTED_AT', microtime());
|
| 683 |
-
define('NGG_PLUGIN_VERSION', '3.3.
|
| 684 |
|
| 685 |
define(
|
| 686 |
'NGG_SCRIPT_VERSION',
|
|
@@ -881,4 +881,4 @@ class C_NextGEN_Bootstrap
|
|
| 881 |
}
|
| 882 |
}
|
| 883 |
|
| 884 |
-
new C_NextGEN_Bootstrap();
|
| 3 |
|
| 4 |
/**
|
| 5 |
* Plugin Name: NextGEN Gallery
|
| 6 |
+
* Description: The most popular gallery plugin for WordPress and one of the most popular plugins of all time with over 30 million downloads.
|
| 7 |
+
* Version: 3.3.20
|
| 8 |
* Author: Imagely
|
| 9 |
* Plugin URI: https://www.imagely.com/wordpress-gallery-plugin/nextgen-gallery/
|
| 10 |
* Author URI: https://www.imagely.com
|
| 11 |
* License: GPLv2
|
| 12 |
* Text Domain: nggallery
|
| 13 |
* Domain Path: /products/photocrati_nextgen/modules/i18n/lang
|
| 14 |
+
* Requires PHP: 5.6
|
| 15 |
*/
|
| 16 |
|
| 17 |
if (!class_exists('E_Clean_Exit')) { class E_Clean_Exit extends RuntimeException {} }
|
| 680 |
define('NGG_PRODUCT_URL', path_join(str_replace("\\" , '/', NGG_PLUGIN_URL), 'products'));
|
| 681 |
define('NGG_MODULE_URL', path_join(str_replace("\\", '/', NGG_PRODUCT_URL), 'photocrati_nextgen/modules'));
|
| 682 |
define('NGG_PLUGIN_STARTED_AT', microtime());
|
| 683 |
+
define('NGG_PLUGIN_VERSION', '3.3.20');
|
| 684 |
|
| 685 |
define(
|
| 686 |
'NGG_SCRIPT_VERSION',
|
| 881 |
}
|
| 882 |
}
|
| 883 |
|
| 884 |
+
new C_NextGEN_Bootstrap();
|
products/photocrati_nextgen/modules/attach_to_post/static/attach_to_post.js
CHANGED
|
@@ -1,33 +1,24 @@
|
|
| 1 |
// Give this window an ID
|
| 2 |
this.id = 'ngg-attach_to_post';
|
| 3 |
|
| 4 |
-
// Provides a function to close the TinyMCE popup window
|
| 5 |
-
function close_attach_to_post_window() {
|
| 6 |
-
var src = jQuery(top.document).find("#TB_window iframe").attr('src');
|
| 7 |
-
if (src && src.match('attach_to_post')) {
|
| 8 |
-
top.tb_remove();
|
| 9 |
-
} else {
|
| 10 |
-
top.tinyMCE.activeEditor.windowManager.close(window);
|
| 11 |
-
}
|
| 12 |
-
}
|
| 13 |
-
|
| 14 |
// This function is only necessary on iOS because iframe's scrollable='yes' attribute
|
| 15 |
// is ignored there. To work around this we give each iframe a height matching its contents
|
| 16 |
// height and set overflow-y:scroll on the wrapping parent div.
|
| 17 |
function adjust_height_for_frame(parent_window, current_window, callback) {
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
|
|
|
| 25 |
|
| 26 |
// Adjust height of the frame
|
| 27 |
var $frame = jQuery(current_window.frameElement);
|
| 28 |
var new_height = $frame.contents().height()/3;
|
| 29 |
-
|
| 30 |
-
|
| 31 |
var current_height = $frame.height();
|
| 32 |
|
| 33 |
// because #wpbody may have zero height
|
|
@@ -35,35 +26,104 @@ function adjust_height_for_frame(parent_window, current_window, callback) {
|
|
| 35 |
new_height_body = $frame.contents().height();
|
| 36 |
}
|
| 37 |
|
| 38 |
-
|
| 39 |
-
|
| 40 |
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
|
| 46 |
-
|
| 47 |
-
|
| 48 |
-
|
| 49 |
-
|
| 50 |
|
| 51 |
if (callback !== undefined) {
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
|
| 55 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 56 |
}
|
| 57 |
|
| 58 |
// This overrides certain parts of shutter.js' positioning & sizing code
|
| 59 |
function ngg_get_measures_for_frame(frame) {
|
|
|
|
| 60 |
var $frame = jQuery(frame);
|
| 61 |
var frame_id = $frame.attr('id');
|
| 62 |
var measures = {};
|
| 63 |
|
| 64 |
if (frame_id && frame_id.indexOf('ngg-iframe-') === 0) {
|
| 65 |
var tab_id = frame_id.substr(11);
|
| 66 |
-
|
| 67 |
if (tab_id) {
|
| 68 |
var jDoc = jQuery(document);
|
| 69 |
|
|
@@ -84,7 +144,7 @@ function ngg_get_measures_for_frame(frame) {
|
|
| 84 |
}
|
| 85 |
}
|
| 86 |
}
|
| 87 |
-
|
| 88 |
return measures;
|
| 89 |
}
|
| 90 |
|
|
@@ -152,7 +212,7 @@ jQuery(function($) {
|
|
| 152 |
if (e.keyCode === 27) {
|
| 153 |
close_attach_to_post_window();
|
| 154 |
}
|
| 155 |
-
return;
|
| 156 |
});
|
| 157 |
|
| 158 |
// Fade in now that all GUI elements are intact
|
|
@@ -163,11 +223,7 @@ jQuery(function($) {
|
|
| 163 |
opacity: 1.0
|
| 164 |
});
|
| 165 |
|
| 166 |
-
|
| 167 |
-
|
| 168 |
-
/* Open and close IGW video tutorial */
|
| 169 |
-
jQuery(function($) {
|
| 170 |
-
|
| 171 |
$('#displayed_tab .ngg_igw_video_open').click( function(e) {
|
| 172 |
$('#displayed_tab .ngg_igw_video_inner').append('<iframe class="ngg_igw_video_iframe" width="1050" height="590" src="https://www.youtube.com/embed/mNEnY23i9DE?rel=0" frameborder="0" allowfullscreen></iframe>');
|
| 173 |
$('#displayed_tab .ngg_igw_video_inner').css("display", "block");
|
|
@@ -179,60 +235,25 @@ jQuery(function($) {
|
|
| 179 |
$('#displayed_tab .ngg_igw_video_inner').css("display", "none");
|
| 180 |
$('#displayed_tab .ngg_igw_video_open').css("display", "block");
|
| 181 |
});
|
| 182 |
-
|
| 183 |
-
});
|
| 184 |
-
|
| 185 |
-
/* Show Pro gallery promo only on Choose Display tab */
|
| 186 |
-
jQuery(function($) {
|
| 187 |
|
|
|
|
| 188 |
$('.ngg_page_content_menu a').click( function(e) {
|
| 189 |
-
|
| 190 |
var id = $(this).attr('data-id');
|
| 191 |
-
if (id == "choose_display") {
|
| 192 |
$("#displayed_tab .ngg_igw_video_open").css("display", "block");
|
| 193 |
}
|
| 194 |
-
else {
|
| 195 |
$("#displayed_tab .ngg_igw_video_open").css("display", "none");
|
| 196 |
$("#displayed_tab .ngg_igw_video_inner").css("display", "none");
|
| 197 |
}
|
| 198 |
-
|
| 199 |
});
|
| 200 |
|
| 201 |
-
|
| 202 |
-
|
| 203 |
-
|
| 204 |
-
|
| 205 |
-
|
| 206 |
-
|
| 207 |
-
function insert_into_editor(snippet, ref_or_id) {
|
| 208 |
-
if (is_visual_editor()) {
|
| 209 |
-
var editor = top.tinyMCE.activeEditor;
|
| 210 |
-
if (editor.selection.getNode().outerHTML.indexOf(ref_or_id) >= 0) {
|
| 211 |
-
jQuery(editor.selection.getNode()).attr('data-shortcode', snippet.substring(1, snippet.length-1));
|
| 212 |
-
} else {
|
| 213 |
-
editor.execCommand('mceInsertContent', false, snippet);
|
| 214 |
-
}
|
| 215 |
-
editor.selection.collapse(false);
|
| 216 |
-
|
| 217 |
-
} else {
|
| 218 |
-
myField = top.document.getElementById('content');
|
| 219 |
-
|
| 220 |
-
myValue = snippet;
|
| 221 |
-
|
| 222 |
-
//IE support
|
| 223 |
-
if (document.selection) {
|
| 224 |
-
myField.focus();
|
| 225 |
-
sel = document.selection.createRange();
|
| 226 |
-
sel.text = myValue;
|
| 227 |
-
} else if (myField.selectionStart || myField.selectionStart === '0') {
|
| 228 |
-
//MOZILLA and others
|
| 229 |
-
var startPos = myField.selectionStart;
|
| 230 |
-
var endPos = myField.selectionEnd;
|
| 231 |
-
myField.value = myField.value.substring(0, startPos)
|
| 232 |
-
+ myValue
|
| 233 |
-
+ myField.value.substring(endPos, myField.value.length);
|
| 234 |
-
} else {
|
| 235 |
-
myField.value += myValue;
|
| 236 |
-
}
|
| 237 |
}
|
| 238 |
-
|
|
|
| 1 |
// Give this window an ID
|
| 2 |
this.id = 'ngg-attach_to_post';
|
| 3 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 4 |
// This function is only necessary on iOS because iframe's scrollable='yes' attribute
|
| 5 |
// is ignored there. To work around this we give each iframe a height matching its contents
|
| 6 |
// height and set overflow-y:scroll on the wrapping parent div.
|
| 7 |
function adjust_height_for_frame(parent_window, current_window, callback) {
|
| 8 |
+
// TODO: ADD BLOCK CHECK AND DO NOTHING
|
| 9 |
+
if (!/crios|iP(hone|od|ad)/i.test(navigator.userAgent)) {
|
| 10 |
+
if (callback !== undefined) {
|
| 11 |
+
return callback(parent_window, current_window);
|
| 12 |
+
} else {
|
| 13 |
+
return true;
|
| 14 |
+
}
|
| 15 |
+
}
|
| 16 |
|
| 17 |
// Adjust height of the frame
|
| 18 |
var $frame = jQuery(current_window.frameElement);
|
| 19 |
var new_height = $frame.contents().height()/3;
|
| 20 |
+
var new_height_body = $frame.contents().find('#wpbody').height();
|
| 21 |
+
var parent_height = jQuery(parent_window.document).height();
|
| 22 |
var current_height = $frame.height();
|
| 23 |
|
| 24 |
// because #wpbody may have zero height
|
| 26 |
new_height_body = $frame.contents().height();
|
| 27 |
}
|
| 28 |
|
| 29 |
+
if (new_height < new_height_body) { new_height = new_height_body; }
|
| 30 |
+
if (new_height < parent_height) { new_height = parent_height; }
|
| 31 |
|
| 32 |
+
if (current_height < new_height) {
|
| 33 |
+
var frame_id = $frame.attr('id');
|
| 34 |
+
if (frame_id && frame_id.indexOf('ngg-iframe-') === 0) {
|
| 35 |
+
var tab_id = frame_id.substr(11);
|
| 36 |
+
if (tab_id) {
|
| 37 |
+
jQuery('#' + tab_id).height(new_height);
|
| 38 |
+
}
|
| 39 |
+
}
|
| 40 |
+
}
|
| 41 |
|
| 42 |
if (callback !== undefined) {
|
| 43 |
+
return callback(parent_window, current_window, new_height);
|
| 44 |
+
} else {
|
| 45 |
+
return true;
|
| 46 |
+
}
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
// Provides a function to close the TinyMCE popup window
|
| 50 |
+
function close_attach_to_post_window() {
|
| 51 |
+
// Block editor
|
| 52 |
+
if (is_block_editor()) {
|
| 53 |
+
const iframe = parent.document.getElementById(window.name);
|
| 54 |
+
const event = new Event('NGG_Close_Modal');
|
| 55 |
+
iframe.dispatchEvent(event);
|
| 56 |
+
|
| 57 |
+
// TinyMCE editor
|
| 58 |
+
} else {
|
| 59 |
+
const src = jQuery(top.document).find("#TB_window iframe").attr('src');
|
| 60 |
+
if (src && src.match('attach_to_post')) {
|
| 61 |
+
top.tb_remove();
|
| 62 |
+
} else {
|
| 63 |
+
top.tinyMCE.activeEditor.windowManager.close(window);
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
}
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
function insert_into_editor(snippet, ref_or_id) {
|
| 70 |
+
if (is_block_editor()) {
|
| 71 |
+
const iframe = parent.document.getElementById(window.name);
|
| 72 |
+
const event = new CustomEvent('NGG_Insert_Gallery', { detail: {
|
| 73 |
+
shortcode: snippet
|
| 74 |
+
}});
|
| 75 |
+
iframe.dispatchEvent(event);
|
| 76 |
+
}
|
| 77 |
+
else if (is_visual_editor()) {
|
| 78 |
+
var editor = top.tinyMCE.activeEditor;
|
| 79 |
+
if (editor.selection.getNode().outerHTML.indexOf(ref_or_id) >= 0) {
|
| 80 |
+
jQuery(editor.selection.getNode()).attr('data-shortcode', snippet.substring(1, snippet.length-1));
|
| 81 |
+
} else {
|
| 82 |
+
editor.execCommand('mceInsertContent', false, snippet);
|
| 83 |
+
}
|
| 84 |
+
editor.selection.collapse(false);
|
| 85 |
+
|
| 86 |
+
} else {
|
| 87 |
+
myField = top.document.getElementById('content');
|
| 88 |
+
|
| 89 |
+
myValue = snippet;
|
| 90 |
+
|
| 91 |
+
//IE support
|
| 92 |
+
if (document.selection) {
|
| 93 |
+
myField.focus();
|
| 94 |
+
sel = document.selection.createRange();
|
| 95 |
+
sel.text = myValue;
|
| 96 |
+
} else if (myField.selectionStart || myField.selectionStart === '0') {
|
| 97 |
+
//MOZILLA and others
|
| 98 |
+
var startPos = myField.selectionStart;
|
| 99 |
+
var endPos = myField.selectionEnd;
|
| 100 |
+
myField.value = myField.value.substring(0, startPos)
|
| 101 |
+
+ myValue
|
| 102 |
+
+ myField.value.substring(endPos, myField.value.length);
|
| 103 |
+
} else {
|
| 104 |
+
myField.value += myValue;
|
| 105 |
+
}
|
| 106 |
+
}
|
| 107 |
+
}
|
| 108 |
+
|
| 109 |
+
function is_visual_editor() {
|
| 110 |
+
return jQuery(top.document).find('.html-active:visible').length === 0;
|
| 111 |
+
}
|
| 112 |
+
|
| 113 |
+
function is_block_editor() {
|
| 114 |
+
return typeof window.name !== 'undefined' && window.name === 'add-ngg-gallery-block-iframe';
|
| 115 |
}
|
| 116 |
|
| 117 |
// This overrides certain parts of shutter.js' positioning & sizing code
|
| 118 |
function ngg_get_measures_for_frame(frame) {
|
| 119 |
+
// TODO: DETECT BLOCK EDITOR AND IMPLEMENTATION
|
| 120 |
var $frame = jQuery(frame);
|
| 121 |
var frame_id = $frame.attr('id');
|
| 122 |
var measures = {};
|
| 123 |
|
| 124 |
if (frame_id && frame_id.indexOf('ngg-iframe-') === 0) {
|
| 125 |
var tab_id = frame_id.substr(11);
|
| 126 |
+
|
| 127 |
if (tab_id) {
|
| 128 |
var jDoc = jQuery(document);
|
| 129 |
|
| 144 |
}
|
| 145 |
}
|
| 146 |
}
|
| 147 |
+
|
| 148 |
return measures;
|
| 149 |
}
|
| 150 |
|
| 212 |
if (e.keyCode === 27) {
|
| 213 |
close_attach_to_post_window();
|
| 214 |
}
|
| 215 |
+
return true;
|
| 216 |
});
|
| 217 |
|
| 218 |
// Fade in now that all GUI elements are intact
|
| 223 |
opacity: 1.0
|
| 224 |
});
|
| 225 |
|
| 226 |
+
/* Open and close IGW video tutorial */
|
|
|
|
|
|
|
|
|
|
|
|
|
| 227 |
$('#displayed_tab .ngg_igw_video_open').click( function(e) {
|
| 228 |
$('#displayed_tab .ngg_igw_video_inner').append('<iframe class="ngg_igw_video_iframe" width="1050" height="590" src="https://www.youtube.com/embed/mNEnY23i9DE?rel=0" frameborder="0" allowfullscreen></iframe>');
|
| 229 |
$('#displayed_tab .ngg_igw_video_inner').css("display", "block");
|
| 235 |
$('#displayed_tab .ngg_igw_video_inner').css("display", "none");
|
| 236 |
$('#displayed_tab .ngg_igw_video_open').css("display", "block");
|
| 237 |
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 238 |
|
| 239 |
+
/* Show Pro gallery promo only on Choose Display tab */
|
| 240 |
$('.ngg_page_content_menu a').click( function(e) {
|
| 241 |
+
|
| 242 |
var id = $(this).attr('data-id');
|
| 243 |
+
if (id == "choose_display") {
|
| 244 |
$("#displayed_tab .ngg_igw_video_open").css("display", "block");
|
| 245 |
}
|
| 246 |
+
else {
|
| 247 |
$("#displayed_tab .ngg_igw_video_open").css("display", "none");
|
| 248 |
$("#displayed_tab .ngg_igw_video_inner").css("display", "none");
|
| 249 |
}
|
|
|
|
| 250 |
});
|
| 251 |
|
| 252 |
+
// The Block plugin will wait for this event to trigger before removing its loading spinner
|
| 253 |
+
if (is_block_editor()) {
|
| 254 |
+
const iframe = parent.document.getElementById(window.name);
|
| 255 |
+
const event = new Event('NGG_Iframe_Ready');
|
| 256 |
+
iframe.dispatchEvent(event);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 257 |
}
|
| 258 |
+
|
| 259 |
+
});
|
products/photocrati_nextgen/modules/attach_to_post/static/attach_to_post.min.js
CHANGED
|
@@ -1 +1 @@
|
|
| 1 |
-
function
|
| 1 |
+
function adjust_height_for_frame(e,t,i){if(!/crios|iP(hone|od|ad)/i.test(navigator.userAgent))return void 0===i||i(e,t);var n=jQuery(t.frameElement),a=n.contents().height()/3,o=n.contents().find("#wpbody").height(),s=jQuery(e.document).height(),d=n.height();if(0===o&&(o=n.contents().height()),a<o&&(a=o),a<s&&(a=s),d<a){var c=n.attr("id");if(c&&0===c.indexOf("ngg-iframe-")){var r=c.substr(11);r&&jQuery("#"+r).height(a)}}return void 0===i||i(e,t,a)}function close_attach_to_post_window(){if(is_block_editor()){const e=parent.document.getElementById(window.name),t=new Event("NGG_Close_Modal");e.dispatchEvent(t)}else{const i=jQuery(top.document).find("#TB_window iframe").attr("src");i&&i.match("attach_to_post")?top.tb_remove():top.tinyMCE.activeEditor.windowManager.close(window)}}function insert_into_editor(e,t){if(is_block_editor()){const i=parent.document.getElementById(window.name),n=new CustomEvent("NGG_Insert_Gallery",{detail:{shortcode:e}});i.dispatchEvent(n)}else if(is_visual_editor()){var a=top.tinyMCE.activeEditor;a.selection.getNode().outerHTML.indexOf(t)>=0?jQuery(a.selection.getNode()).attr("data-shortcode",e.substring(1,e.length-1)):a.execCommand("mceInsertContent",!1,e),a.selection.collapse(!1)}else if(myField=top.document.getElementById("content"),myValue=e,document.selection)myField.focus(),sel=document.selection.createRange(),sel.text=myValue;else if(myField.selectionStart||"0"===myField.selectionStart){var o=myField.selectionStart,s=myField.selectionEnd;myField.value=myField.value.substring(0,o)+myValue+myField.value.substring(s,myField.value.length)}else myField.value+=myValue}function is_visual_editor(){return 0===jQuery(top.document).find(".html-active:visible").length}function is_block_editor(){return void 0!==window.name&&"add-ngg-gallery-block-iframe"===window.name}function ngg_get_measures_for_frame(e){var t=jQuery(e),i=t.attr("id"),n={};if(i&&0===i.indexOf("ngg-iframe-")){if(i.substr(11)){var a=jQuery(document);n.scrollTop=a.scrollTop()-40,window.parent?n.scrollHeight=jQuery(window.parent.document).find(".ngg_attach_to_post_window").height()-40:n.scrollHeight=a.height(),void 0!==window.console&&console.log(n)}}return n}this.id="ngg-attach_to_post",jQuery(function(e){if(/crios|iP(hone|od|ad)/i.test(navigator.userAgent)&&e("#attach_to_post_tabs").addClass("ngg_atp_ios_detected"),e("#attach_to_post_tabs").ngg_tabs({onShowTab:function(t){navigator.appVersion.match(/Chrome\/(69|7)/)&&("displayed_tab"!=t.attr("id")?e("#attach_to_post_tabs").addClass("chrome_70_hack_frames").removeClass("chrome_70_hack_noframes"):e("#attach_to_post_tabs").removeClass("chrome_70_hack_frames").addClass("chrome_70_hack_noframes"))}}),e(".ngg_page_content_menu a").on("click",function(){"preview_tab"===e(this).attr("data-id")&&e("#preview_area").trigger("opened")}),e(".accordion").accordion({clearStyle:!0,autoHeight:!1,heightStyle:"content"}),e(".ui-tabs-nav li:first-of-type a").addClass("active_tab"),e(".ui-tabs-nav a").click(function(t){e(".ui-tabs-nav a").removeClass("active_tab"),e(this).addClass("active_tab");var i=t.target?t.target:t.srcElement;if(e(i).parent().hasClass("ui-state-active")){var n=e(i.hash+" iframe");n.length>0&&n[0].contentDocument.location!=n.attr("src")&&(n[0].contentDocument.location=n.attr("src"))}}),e(this).keydown(function(e){return 27===e.keyCode&&close_attach_to_post_window(),!0}),e("body").css({position:"static",visibility:"visible"}).animate({opacity:1}),e("#displayed_tab .ngg_igw_video_open").click(function(t){e("#displayed_tab .ngg_igw_video_inner").append('<iframe class="ngg_igw_video_iframe" width="1050" height="590" src="https://www.youtube.com/embed/mNEnY23i9DE?rel=0" frameborder="0" allowfullscreen></iframe>'),e("#displayed_tab .ngg_igw_video_inner").css("display","block"),e("#displayed_tab .ngg_igw_video_open").css("display","none")}),e("#displayed_tab .ngg_igw_video_close").click(function(t){e("#displayed_tab .ngg_igw_video_iframe").remove(),e("#displayed_tab .ngg_igw_video_inner").css("display","none"),e("#displayed_tab .ngg_igw_video_open").css("display","block")}),e(".ngg_page_content_menu a").click(function(t){"choose_display"==e(this).attr("data-id")?e("#displayed_tab .ngg_igw_video_open").css("display","block"):(e("#displayed_tab .ngg_igw_video_open").css("display","none"),e("#displayed_tab .ngg_igw_video_inner").css("display","none"))}),is_block_editor()){const t=parent.document.getElementById(window.name),i=new Event("NGG_Iframe_Ready");t.dispatchEvent(i)}});
|
products/photocrati_nextgen/modules/attach_to_post/static/display_tab.js
CHANGED
|
@@ -334,6 +334,7 @@ jQuery(function($){
|
|
| 334 |
var obj = this.toJSON();
|
| 335 |
obj.display_type = display_type.get_shortcode_value();
|
| 336 |
|
|
|
|
| 337 |
// Convert the displayed gallery to a shortcode
|
| 338 |
var snippet = '[ngg';
|
| 339 |
var val = null;
|
| 334 |
var obj = this.toJSON();
|
| 335 |
obj.display_type = display_type.get_shortcode_value();
|
| 336 |
|
| 337 |
+
|
| 338 |
// Convert the displayed gallery to a shortcode
|
| 339 |
var snippet = '[ngg';
|
| 340 |
var val = null;
|
products/photocrati_nextgen/modules/attach_to_post/static/ngg_attach_to_post_tinymce_plugin.css
CHANGED
|
@@ -37,7 +37,7 @@
|
|
| 37 |
display: inline-block !important;
|
| 38 |
font-size: 13px;
|
| 39 |
font-weight: bold;
|
| 40 |
-
font-family: Lato, sans-serif !important
|
| 41 |
height: 36px !important;
|
| 42 |
line-height: 36px !important;
|
| 43 |
letter-spacing: 1.2px;
|
| 37 |
display: inline-block !important;
|
| 38 |
font-size: 13px;
|
| 39 |
font-weight: bold;
|
| 40 |
+
font-family: Lato, sans-serif !important;
|
| 41 |
height: 36px !important;
|
| 42 |
line-height: 36px !important;
|
| 43 |
letter-spacing: 1.2px;
|
products/photocrati_nextgen/modules/attach_to_post/static/ngg_attach_to_post_tinymce_plugin.js
CHANGED
|
@@ -72,7 +72,7 @@
|
|
| 72 |
});
|
| 73 |
|
| 74 |
// Support for IGW placeholder images. NGG <= 2.1.50
|
| 75 |
-
if (e.target.tagName
|
| 76 |
if (self.get_class_name(e.target).indexOf('ngg_displayed_gallery') >= 0) {
|
| 77 |
editor.dom.events.cancel(e);
|
| 78 |
var id = e.target.src.match(/\d+$/);
|
| 72 |
});
|
| 73 |
|
| 74 |
// Support for IGW placeholder images. NGG <= 2.1.50
|
| 75 |
+
if (e.target.tagName === 'IMG') {
|
| 76 |
if (self.get_class_name(e.target).indexOf('ngg_displayed_gallery') >= 0) {
|
| 77 |
editor.dom.events.cancel(e);
|
| 78 |
var id = e.target.src.match(/\d+$/);
|
products/photocrati_nextgen/modules/attach_to_post/static/ngg_attach_to_post_tinymce_plugin.min.css
CHANGED
|
@@ -1 +1 @@
|
|
| 1 |
-
.nggPlaceholder{background-color:#143650;box-sizing:border-box;border-top:5px solid #9fbb1a;border-radius:3px;box-shadow:0 0 4px 1px rgba(0,0,0,.05);color:#9fbb1a;font-family:sans-serif;font-size:20px;height:230px;margin:5px;outline:0!important;padding:20px 30px 50px;text-align:center;width:400px;max-width:98%}.nggPlaceholder h3{color:#fff;font-family:Lato,sans-serif;font-size:22px;margin:40px 0 8px 3px;text-transform:uppercase;font-weight:900;letter-spacing:1.5px}.nggPlaceholderButton{background:#9ebd00!important;border-radius:2px;border:none!important;box-shadow:none!important;color:#fff!important;display:inline-block!important;font-size:13px;font-weight:700;font-family:Lato,sans-serif!important
|
| 1 |
+
.nggPlaceholder{background-color:#143650;box-sizing:border-box;border-top:5px solid #9fbb1a;border-radius:3px;box-shadow:0 0 4px 1px rgba(0,0,0,.05);color:#9fbb1a;font-family:sans-serif;font-size:20px;height:230px;margin:5px;outline:0!important;padding:20px 30px 50px;text-align:center;width:400px;max-width:98%}.nggPlaceholder h3{color:#fff;font-family:Lato,sans-serif;font-size:22px;margin:40px 0 8px 3px;text-transform:uppercase;font-weight:900;letter-spacing:1.5px}.nggPlaceholderButton{background:#9ebd00!important;border-radius:2px;border:none!important;box-shadow:none!important;color:#fff!important;display:inline-block!important;font-size:13px;font-weight:700;font-family:Lato,sans-serif!important;height:36px!important;line-height:36px!important;letter-spacing:1.2px;margin:4px;padding:0;width:106px;text-align:center;text-transform:uppercase!important;text-shadow:none!important;cursor:pointer}.nggPlaceholderButtonRow{display:flex;justify-content:center;align-items:center}.nggPlaceholderButton:hover{background:#a5c31a!important}
|
products/photocrati_nextgen/modules/attach_to_post/static/ngg_attach_to_post_tinymce_plugin.min.js
CHANGED
|
@@ -1 +1 @@
|
|
| 1 |
-
!function(t,e){window.id="wordpress-post-page",tinyMCE.addI18n("en.ngg_attach_to_post",{title:"Attach NextGEN Gallery to Post"}),tinymce.create("tinymce.plugins.NextGEN_AttachToPost",{siteurl:t,getInfo:function(){return{longname:"NextGEN Gallery",author:"Imagely",authorurl:"https://www.imagely.com",infourl:"https://www.imagely.com/wordpress-gallery-plugin/nextgen-gallery/",version:"0.1"}},init:function(t,n){function o(t,n){for(;t.content.indexOf(n)>=0;){for(var o=t.content.indexOf(n),a=o+n.length,r=!1,i=null,c=!1,g=t.content.length;;){var l=t.content[a];if('"'==l||"'"==l&&"="==c)r&&i==l?(r=!1,i=null):(r=!0,i=l);else if("]"==l&&!r)break;if(c=l,a==g)break;a++}var s=t.content.substring(o,++a),d=s.substring(1,s.length-1);d=d.replace("[","["),d=d.replace("]","]");var h=_.template(e("#ngg-igw-placeholder").html());t.content=t.content.replace(s,h(e.extend(ngg_igw_i18n,{shortcode:d,ref:_.now()})))}}var a=this;t.windowManager.nggOldOpen=t.windowManager.open,t.windowManager.open=function(e,n){var o=t.windowManager.nggOldOpen(e,n);return o.on("close",a.wm_close_event),o},t.addCommand("ngg_attach_to_post",this.render_attach_to_post_interface,{editor:t,plugin:t.plugins.NextGEN_AttachToPost}),t.addButton("NextGEN_AttachToPost",{title:"ngg_attach_to_post.title",cmd:"ngg_attach_to_post",image:n+"/igw_button.png"}),t.on("SaveContent",function(t){e("body").hasClass("block-editor-page")&&(o(t,"[ngg_images "),o(t,"[ngg "))}),t.on("mouseup touchend",function(n){if(tinymce.extend(a,{editor:t,plugin:t.plugins.NextGEN_AttachToPost}),"IMG"
|
| 1 |
+
!function(t,e){window.id="wordpress-post-page",tinyMCE.addI18n("en.ngg_attach_to_post",{title:"Attach NextGEN Gallery to Post"}),tinymce.create("tinymce.plugins.NextGEN_AttachToPost",{siteurl:t,getInfo:function(){return{longname:"NextGEN Gallery",author:"Imagely",authorurl:"https://www.imagely.com",infourl:"https://www.imagely.com/wordpress-gallery-plugin/nextgen-gallery/",version:"0.1"}},init:function(t,n){function o(t,n){for(;t.content.indexOf(n)>=0;){for(var o=t.content.indexOf(n),a=o+n.length,r=!1,i=null,c=!1,g=t.content.length;;){var l=t.content[a];if('"'==l||"'"==l&&"="==c)r&&i==l?(r=!1,i=null):(r=!0,i=l);else if("]"==l&&!r)break;if(c=l,a==g)break;a++}var s=t.content.substring(o,++a),d=s.substring(1,s.length-1);d=d.replace("[","["),d=d.replace("]","]");var h=_.template(e("#ngg-igw-placeholder").html());t.content=t.content.replace(s,h(e.extend(ngg_igw_i18n,{shortcode:d,ref:_.now()})))}}var a=this;t.windowManager.nggOldOpen=t.windowManager.open,t.windowManager.open=function(e,n){var o=t.windowManager.nggOldOpen(e,n);return o.on("close",a.wm_close_event),o},t.addCommand("ngg_attach_to_post",this.render_attach_to_post_interface,{editor:t,plugin:t.plugins.NextGEN_AttachToPost}),t.addButton("NextGEN_AttachToPost",{title:"ngg_attach_to_post.title",cmd:"ngg_attach_to_post",image:n+"/igw_button.png"}),t.on("SaveContent",function(t){e("body").hasClass("block-editor-page")&&(o(t,"[ngg_images "),o(t,"[ngg "))}),t.on("mouseup touchend",function(n){if(tinymce.extend(a,{editor:t,plugin:t.plugins.NextGEN_AttachToPost}),"IMG"===n.target.tagName){if(a.get_class_name(n.target).indexOf("ngg_displayed_gallery")>=0){t.dom.events.cancel(n);var o=n.target.src.match(/\d+$/);o&&(o=o.pop()),a.render_attach_to_post_interface({key:"id",val:o})}}else{var r=e(n.target);if(r.hasClass("nggPlaceholderButton"))if(r.hasClass("nggIgwRemove")){var i=r.parents(".nggPlaceholder"),c=i[0].getAttribute("data-shortcode");t.fire("ngg-removed",{shortcode:c}),i.remove()}else window.igw_shortcode=e(n.target).parents(".nggPlaceholder")[0].getAttribute("data-shortcode"),a.render_attach_to_post_interface({key:"shortcode",val:Base64.encode(window.igw_shortcode),ref:e(n.target).parents(".nggPlaceholder").attr("id")})}}),t.on("BeforeSetContent",function(t){o(t,"[ngg_images "),o(t,"[ngg ")}),t.on("PostProcess",function(t){var n=e("<div/>").append(t.content);n.find(".nggPlaceholder").toArray().forEach(function(t){var n=e(t),o=n.data("shortcode");o="["+_.unescape(o)+"]",n.replaceWith(o)}),t.content=n[0].innerHTML})},get_class_name:function(t){var e=t.getAttribute("class")?t.getAttribute("class"):t.className;return e||""},wm_close_event:function(t){t&&t.target&&t.target._id&&"ngg_attach_to_post_dialog"==t.target._id&&(e("html,body").css("overflow","auto"),tinyMCE.activeEditor.selection.select(tinyMCE.activeEditor.dom.select("p")[0]),tinyMCE.activeEditor.selection.collapse(0))},render_attach_to_post_interface:function(t){var n=nextgen_gallery_attach_to_post_url;void 0!==t&&(n+="&"+t.key+"="+encodeURIComponent(t.val),void 0!==t.ref&&(n+="&ref="+encodeURIComponent(t.ref))),n+="&editor="+this.editor.id;for(var o=window;null!=o.parent&&o.parent!=o;)o=o.parent;o=e(o);var a=o.width(),r=o.height(),i=1600,c=1200,g=a-.05*a,l=r-.1*r;g<800&&(g=a-20),l<600&&(l=r-40),i>g&&(i=g),c>l&&(c=l),document.activeElement.blur(),Array.prototype.forEach.call(document.querySelectorAll("input, textarea"),function(t){t.blur()}),this.editor.windowManager.open({url:n,id:"ngg_attach_to_post_dialog",width:i,height:c,title:"NextGEN Gallery - Attach To Post"}),e("html,body").css("overflow","hidden"),e("#ngg_attach_to_post_dialog_ifr").css("overflow-y","auto"),e("#ngg_attach_to_post_dialog_ifr").css("overflow-x","hidden")}}),tinymce.PluginManager.add("NextGEN_AttachToPost",tinymce.plugins.NextGEN_AttachToPost)}(photocrati_ajax.wp_site_url,jQuery);
|
products/photocrati_nextgen/modules/i18n/lang/nggallery-da_DK.po
CHANGED
|
@@ -1555,14 +1555,14 @@ msgid ""
|
|
| 1555 |
"Hey <strong>%s</strong>, you've created %d NextGEN galleries! Awesome! Could "
|
| 1556 |
"I ask you to give us a 5-star rating really quickly on <a %s>WordPress."
|
| 1557 |
"org</a>? It helps other WordPress users and motivates us to keep improving. "
|
| 1558 |
-
"You can also just send us feedback <a %s>here</a>. Thanks! ~
|
| 1559 |
"(founder of Imagely/NextGEN Gallery"
|
| 1560 |
msgstr ""
|
| 1561 |
"Hej <strong>%s </ strong>, du har oprettet %d NextGEN gallerier! Fantastisk! "
|
| 1562 |
"Kan jeg bede dig om at give os en 5-stjernet vurdering meget hurtigt på <a "
|
| 1563 |
"%s> WordPress.org </a>? Det hjælper andre WordPress-brugere og motiverer os "
|
| 1564 |
"til fortsat at forbedre. Du kan også bare sende os feedback <a %s> her </a>. "
|
| 1565 |
-
"Tak! ~
|
| 1566 |
|
| 1567 |
#: products/photocrati_nextgen/modules/ngglegacy/admin/media-upload.php:238
|
| 1568 |
msgid "Hide"
|
|
@@ -3499,10 +3499,10 @@ msgstr "Galleriet ID =%s findes ikke."
|
|
| 3499 |
#. Description of the plugin
|
| 3500 |
msgid ""
|
| 3501 |
"The most popular gallery plugin for WordPress and one of the most popular "
|
| 3502 |
-
"plugins of all time with over
|
| 3503 |
msgstr ""
|
| 3504 |
"Den mest populære galleri plugin til WordPress og et af de mest populære "
|
| 3505 |
-
"plugins igennem tiden med over
|
| 3506 |
|
| 3507 |
#: products/photocrati_nextgen/modules/ngglegacy/admin/overview.php:290
|
| 3508 |
msgid "The most powerful gallery system ever built for WordPress. "
|
| 1555 |
"Hey <strong>%s</strong>, you've created %d NextGEN galleries! Awesome! Could "
|
| 1556 |
"I ask you to give us a 5-star rating really quickly on <a %s>WordPress."
|
| 1557 |
"org</a>? It helps other WordPress users and motivates us to keep improving. "
|
| 1558 |
+
"You can also just send us feedback <a %s>here</a>. Thanks! ~ Nathan Singh "
|
| 1559 |
"(founder of Imagely/NextGEN Gallery"
|
| 1560 |
msgstr ""
|
| 1561 |
"Hej <strong>%s </ strong>, du har oprettet %d NextGEN gallerier! Fantastisk! "
|
| 1562 |
"Kan jeg bede dig om at give os en 5-stjernet vurdering meget hurtigt på <a "
|
| 1563 |
"%s> WordPress.org </a>? Det hjælper andre WordPress-brugere og motiverer os "
|
| 1564 |
"til fortsat at forbedre. Du kan også bare sende os feedback <a %s> her </a>. "
|
| 1565 |
+
"Tak! ~ Nathan Singh (grundlægger af Imagely / NextGEN Gallery"
|
| 1566 |
|
| 1567 |
#: products/photocrati_nextgen/modules/ngglegacy/admin/media-upload.php:238
|
| 1568 |
msgid "Hide"
|
| 3499 |
#. Description of the plugin
|
| 3500 |
msgid ""
|
| 3501 |
"The most popular gallery plugin for WordPress and one of the most popular "
|
| 3502 |
+
"plugins of all time with over 30 million downloads."
|
| 3503 |
msgstr ""
|
| 3504 |
"Den mest populære galleri plugin til WordPress og et af de mest populære "
|
| 3505 |
+
"plugins igennem tiden med over 30 millioner downloads."
|
| 3506 |
|
| 3507 |
#: products/photocrati_nextgen/modules/ngglegacy/admin/overview.php:290
|
| 3508 |
msgid "The most powerful gallery system ever built for WordPress. "
|
products/photocrati_nextgen/modules/i18n/lang/nggallery-sv_SE.po
CHANGED
|
@@ -2431,8 +2431,8 @@ msgid "Server Settings"
|
|
| 2431 |
msgstr "Serverinställningar"
|
| 2432 |
|
| 2433 |
#: products/photocrati_nextgen/modules/ngglegacy/admin/overview.php:97
|
| 2434 |
-
msgid "NextGEN Gallery is one of the most popular WordPress plugins of all time with over
|
| 2435 |
-
msgstr "NextGEN Gallery är en av de mest populära WordPress-tilläggen genom tiderna med över
|
| 2436 |
|
| 2437 |
# Missed by NextGEN, translated string is displayed.
|
| 2438 |
#: products/photocrati_nextgen/modules/ngglegacy/admin/overview.php:97
|
|
@@ -3222,8 +3222,8 @@ msgid "https://www.imagely.com/wordpress-gallery-plugin/nextgen-gallery/"
|
|
| 3222 |
msgstr "https://www.imagely.com/wordpress-gallery-plugin/nextgen-gallery/"
|
| 3223 |
|
| 3224 |
#. Description of the plugin/theme
|
| 3225 |
-
msgid "The most popular gallery plugin for WordPress and one of the most popular plugins of all time with over
|
| 3226 |
-
msgstr "Det mest populära galleri-tillägget för WordPress och ett av de mest populära tillägg genom tiderna med över
|
| 3227 |
|
| 3228 |
#. Author of the plugin/theme
|
| 3229 |
msgid "Imagely"
|
| 2431 |
msgstr "Serverinställningar"
|
| 2432 |
|
| 2433 |
#: products/photocrati_nextgen/modules/ngglegacy/admin/overview.php:97
|
| 2434 |
+
msgid "NextGEN Gallery is one of the most popular WordPress plugins of all time with over 30 million downloads."
|
| 2435 |
+
msgstr "NextGEN Gallery är en av de mest populära WordPress-tilläggen genom tiderna med över 30 miljoner nedladdningar."
|
| 2436 |
|
| 2437 |
# Missed by NextGEN, translated string is displayed.
|
| 2438 |
#: products/photocrati_nextgen/modules/ngglegacy/admin/overview.php:97
|
| 3222 |
msgstr "https://www.imagely.com/wordpress-gallery-plugin/nextgen-gallery/"
|
| 3223 |
|
| 3224 |
#. Description of the plugin/theme
|
| 3225 |
+
msgid "The most popular gallery plugin for WordPress and one of the most popular plugins of all time with over 30 million downloads."
|
| 3226 |
+
msgstr "Det mest populära galleri-tillägget för WordPress och ett av de mest populära tillägg genom tiderna med över 30 miljoner nedladdningar."
|
| 3227 |
|
| 3228 |
#. Author of the plugin/theme
|
| 3229 |
msgid "Imagely"
|
products/photocrati_nextgen/modules/i18n/lang/nggallery.pot
CHANGED
|
@@ -30,7 +30,7 @@ msgid "https://www.imagely.com/wordpress-gallery-plugin/nextgen-gallery/"
|
|
| 30 |
msgstr ""
|
| 31 |
|
| 32 |
#. Description of the plugin
|
| 33 |
-
msgid "The most popular gallery plugin for WordPress and one of the most popular plugins of all time with over
|
| 34 |
msgstr ""
|
| 35 |
|
| 36 |
#. Author of the plugin
|
|
@@ -759,7 +759,7 @@ msgid "Save Options"
|
|
| 759 |
msgstr ""
|
| 760 |
|
| 761 |
#: products/photocrati_nextgen/modules/nextgen_admin/templates/review_notice.php:5
|
| 762 |
-
msgid "Hey <strong>%s</strong>, you've created %d NextGEN galleries! Awesome! Could I ask you to give us a 5-star rating really quickly on <a %s>WordPress.org</a>? It helps other WordPress users and motivates us to keep improving. You can also just send us feedback <a %s>here</a>. Thanks! ~
|
| 763 |
msgstr ""
|
| 764 |
|
| 765 |
#: products/photocrati_nextgen/modules/nextgen_admin/templates/review_notice.php:14
|
| 30 |
msgstr ""
|
| 31 |
|
| 32 |
#. Description of the plugin
|
| 33 |
+
msgid "The most popular gallery plugin for WordPress and one of the most popular plugins of all time with over 30 million downloads."
|
| 34 |
msgstr ""
|
| 35 |
|
| 36 |
#. Author of the plugin
|
| 759 |
msgstr ""
|
| 760 |
|
| 761 |
#: products/photocrati_nextgen/modules/nextgen_admin/templates/review_notice.php:5
|
| 762 |
+
msgid "Hey <strong>%s</strong>, you've created %d NextGEN galleries! Awesome! Could I ask you to give us a 5-star rating really quickly on <a %s>WordPress.org</a>? It helps other WordPress users and motivates us to keep improving. You can also just send us feedback <a %s>here</a>. Thanks! ~ Nathan Singh (founder of Imagely/NextGEN Gallery)"
|
| 763 |
msgstr ""
|
| 764 |
|
| 765 |
#: products/photocrati_nextgen/modules/nextgen_admin/templates/review_notice.php:14
|
products/photocrati_nextgen/modules/nextgen_admin/package.module.nextgen_admin.php
CHANGED
|
@@ -365,7 +365,7 @@ class C_Admin_Notification_Manager
|
|
| 365 |
// Does the handler want to render?
|
| 366 |
$has_method = method_exists($handler, 'is_renderable');
|
| 367 |
if ($has_method && $handler->is_renderable() || !$has_method) {
|
| 368 |
-
$show_dismiss_button = method_exists($handler, 'show_dismiss_button') ? $handler->show_dismiss_button() : method_exists($handler, 'is_dismissable') ? $handler->is_dismissable() : FALSE;
|
| 369 |
$template = method_exists($handler, 'get_mvc_template') ? $handler->get_mvc_template() : 'photocrati-nextgen_admin#admin_notice';
|
| 370 |
// The 'inline' class is necessary to prevent our notices from being moved in the DOM
|
| 371 |
// see https://core.trac.wordpress.org/ticket/34570 for reference
|
| 365 |
// Does the handler want to render?
|
| 366 |
$has_method = method_exists($handler, 'is_renderable');
|
| 367 |
if ($has_method && $handler->is_renderable() || !$has_method) {
|
| 368 |
+
$show_dismiss_button = method_exists($handler, 'show_dismiss_button') ? $handler->show_dismiss_button() : (method_exists($handler, 'is_dismissable') ? $handler->is_dismissable() : FALSE);
|
| 369 |
$template = method_exists($handler, 'get_mvc_template') ? $handler->get_mvc_template() : 'photocrati-nextgen_admin#admin_notice';
|
| 370 |
// The 'inline' class is necessary to prevent our notices from being moved in the DOM
|
| 371 |
// see https://core.trac.wordpress.org/ticket/34570 for reference
|
products/photocrati_nextgen/modules/nextgen_admin/templates/review_notice.php
CHANGED
|
@@ -2,7 +2,7 @@
|
|
| 2 |
<?php
|
| 3 |
$review_1_anchor = 'href="https://wordpress.org/support/plugin/nextgen-gallery/reviews/?rate=5#new-post" target="_blank"';
|
| 4 |
$user = get_userdata(get_current_user_id());
|
| 5 |
-
echo sprintf(__("Hey <strong>%s</strong>, you've created %d NextGEN galleries! Awesome! Could I ask you to give us a 5-star rating really quickly on <a %s>WordPress.org</a>? It helps other WordPress users and motivates us to keep improving. You can also just send us feedback <a %s>here</a>. Thanks! ~
|
| 6 |
$user->display_name,
|
| 7 |
$number,
|
| 8 |
$review_1_anchor,
|
| 2 |
<?php
|
| 3 |
$review_1_anchor = 'href="https://wordpress.org/support/plugin/nextgen-gallery/reviews/?rate=5#new-post" target="_blank"';
|
| 4 |
$user = get_userdata(get_current_user_id());
|
| 5 |
+
echo sprintf(__("Hey <strong>%s</strong>, you've created %d NextGEN galleries! Awesome! Could I ask you to give us a 5-star rating really quickly on <a %s>WordPress.org</a>? It helps other WordPress users and motivates us to keep improving. You can also just send us feedback <a %s>here</a>. Thanks! ~ Nathan Singh (founder of Imagely/NextGEN Gallery)", 'nggallery'),
|
| 6 |
$user->display_name,
|
| 7 |
$number,
|
| 8 |
$review_1_anchor,
|
products/photocrati_nextgen/modules/nextgen_block/module.nextgen_block.php
CHANGED
|
@@ -37,7 +37,7 @@ class M_NextGEN_Block extends C_Base_Module
|
|
| 37 |
|
| 38 |
function _register_hooks()
|
| 39 |
{
|
| 40 |
-
add_action(
|
| 41 |
C_Ngg_Post_Thumbnails::get_instance()->register_hooks();
|
| 42 |
}
|
| 43 |
|
|
@@ -48,25 +48,36 @@ class M_NextGEN_Block extends C_Base_Module
|
|
| 48 |
wp_enqueue_script(
|
| 49 |
'nextgen-block-js',
|
| 50 |
$router->get_static_url(NEXTGEN_BLOCK . '#build/block.min.js'),
|
| 51 |
-
|
| 52 |
NGG_SCRIPT_VERSION,
|
| 53 |
TRUE
|
| 54 |
);
|
| 55 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 56 |
wp_enqueue_style(
|
| 57 |
'nextgen-block-css',
|
| 58 |
$router->get_static_url(NEXTGEN_BLOCK . '#editor.css'),
|
| 59 |
-
|
| 60 |
NGG_SCRIPT_VERSION
|
| 61 |
);
|
| 62 |
}
|
| 63 |
|
| 64 |
function get_type_list()
|
| 65 |
{
|
| 66 |
-
return
|
| 67 |
'A_NextGen_Block_Ajax' => 'adapter.nextgen_block_ajax.php',
|
| 68 |
'C_Ngg_Post_Thumbnails' => 'post_thumbnails.php'
|
| 69 |
-
|
| 70 |
}
|
| 71 |
}
|
| 72 |
|
| 37 |
|
| 38 |
function _register_hooks()
|
| 39 |
{
|
| 40 |
+
add_action('enqueue_block_editor_assets', [$this, 'nextgen_block_editor_assets']);
|
| 41 |
C_Ngg_Post_Thumbnails::get_instance()->register_hooks();
|
| 42 |
}
|
| 43 |
|
| 48 |
wp_enqueue_script(
|
| 49 |
'nextgen-block-js',
|
| 50 |
$router->get_static_url(NEXTGEN_BLOCK . '#build/block.min.js'),
|
| 51 |
+
['wp-blocks', 'wp-i18n', 'wp-element', 'wp-compose'],
|
| 52 |
NGG_SCRIPT_VERSION,
|
| 53 |
TRUE
|
| 54 |
);
|
| 55 |
|
| 56 |
+
wp_localize_script(
|
| 57 |
+
'nextgen-block-js',
|
| 58 |
+
'add_ngg_gallery_block_i18n',
|
| 59 |
+
[
|
| 60 |
+
'edit' => __('Edit'),
|
| 61 |
+
'delete' => __('Delete'),
|
| 62 |
+
'create' => __('Add NextGEN Gallery', 'nggallery'),
|
| 63 |
+
'h3' => __('NextGEN Gallery', 'nggallery')
|
| 64 |
+
]
|
| 65 |
+
);
|
| 66 |
+
|
| 67 |
wp_enqueue_style(
|
| 68 |
'nextgen-block-css',
|
| 69 |
$router->get_static_url(NEXTGEN_BLOCK . '#editor.css'),
|
| 70 |
+
['wp-edit-blocks'],
|
| 71 |
NGG_SCRIPT_VERSION
|
| 72 |
);
|
| 73 |
}
|
| 74 |
|
| 75 |
function get_type_list()
|
| 76 |
{
|
| 77 |
+
return [
|
| 78 |
'A_NextGen_Block_Ajax' => 'adapter.nextgen_block_ajax.php',
|
| 79 |
'C_Ngg_Post_Thumbnails' => 'post_thumbnails.php'
|
| 80 |
+
];
|
| 81 |
}
|
| 82 |
}
|
| 83 |
|
products/photocrati_nextgen/modules/nextgen_block/package.module.nextgen_block.php
CHANGED
|
@@ -36,14 +36,12 @@ class C_Ngg_Post_Thumbnails
|
|
| 36 |
}
|
| 37 |
public function register_hooks()
|
| 38 |
{
|
| 39 |
-
add_action('admin_enqueue_scripts',
|
| 40 |
-
add_action('rest_insert_post',
|
| 41 |
-
add_action('rest_insert_page',
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
register_meta('post', 'ngg_post_thumbnail', array('type' => 'integer', 'single' => TRUE, 'show_in_rest' => TRUE));
|
| 46 |
-
register_meta('page', 'ngg_post_thumbnail', array('type' => 'integer', 'single' => TRUE, 'show_in_rest' => TRUE));
|
| 47 |
}
|
| 48 |
function register_adapters()
|
| 49 |
{
|
|
@@ -79,12 +77,12 @@ class C_Ngg_Post_Thumbnails
|
|
| 79 |
{
|
| 80 |
add_thickbox();
|
| 81 |
global $wp_scripts;
|
| 82 |
-
wp_enqueue_script('ngg-post-thumbnails', C_Router::get_instance()->get_static_url(NEXTGEN_BLOCK . '#build/post-thumbnail.min.js'),
|
| 83 |
-
wp_localize_script('ngg-post-thumbnails', 'ngg_featured_image',
|
| 84 |
if (preg_match("/media-upload\\.php/", $_SERVER['REQUEST_URI']) && $_GET['tab'] == 'nextgen') {
|
| 85 |
wp_add_inline_style('wp-admin', "#media-upload-header {display: none }");
|
| 86 |
if (isset($_GET['from']) && $_GET['from'] == 'block-editor') {
|
| 87 |
-
add_action('admin_enqueue_scripts',
|
| 88 |
}
|
| 89 |
}
|
| 90 |
}
|
| 36 |
}
|
| 37 |
public function register_hooks()
|
| 38 |
{
|
| 39 |
+
add_action('admin_enqueue_scripts', [$this, 'enqueue_post_thumbnails'], 1);
|
| 40 |
+
add_action('rest_insert_post', [$this, 'set_or_remove_ngg_post_thumbnail'], PHP_INT_MAX - 1, 2);
|
| 41 |
+
add_action('rest_insert_page', [$this, 'set_or_remove_ngg_post_thumbnail'], PHP_INT_MAX - 1, 2);
|
| 42 |
+
// Expose a field for posts/pages to set the ngg_post_thumbnail via REST API
|
| 43 |
+
register_meta('post', 'ngg_post_thumbnail', ['type' => 'integer', 'single' => TRUE, 'show_in_rest' => TRUE]);
|
| 44 |
+
register_meta('page', 'ngg_post_thumbnail', ['type' => 'integer', 'single' => TRUE, 'show_in_rest' => TRUE]);
|
|
|
|
|
|
|
| 45 |
}
|
| 46 |
function register_adapters()
|
| 47 |
{
|
| 77 |
{
|
| 78 |
add_thickbox();
|
| 79 |
global $wp_scripts;
|
| 80 |
+
wp_enqueue_script('ngg-post-thumbnails', C_Router::get_instance()->get_static_url(NEXTGEN_BLOCK . '#build/post-thumbnail.min.js'), ['lodash', 'wp-element', 'wp-data', 'wp-editor', 'wp-components', 'wp-i18n', 'photocrati_ajax'], NGG_PLUGIN_VERSION);
|
| 81 |
+
wp_localize_script('ngg-post-thumbnails', 'ngg_featured_image', ['modal_url' => admin_url("/media-upload.php?post_id=%post_id%&type=image&tab=nextgen&from=block-editor&TB_iframe=true")]);
|
| 82 |
if (preg_match("/media-upload\\.php/", $_SERVER['REQUEST_URI']) && $_GET['tab'] == 'nextgen') {
|
| 83 |
wp_add_inline_style('wp-admin', "#media-upload-header {display: none }");
|
| 84 |
if (isset($_GET['from']) && $_GET['from'] == 'block-editor') {
|
| 85 |
+
add_action('admin_enqueue_scripts', [$this, 'media_upload_footer']);
|
| 86 |
}
|
| 87 |
}
|
| 88 |
}
|
products/photocrati_nextgen/modules/nextgen_block/static/build/block.min.js
CHANGED
|
@@ -1,2 +1,15 @@
|
|
| 1 |
-
!function(e){var t={};function n(r){if(t[r])return t[r].exports;var o=t[r]={i:r,l:!1,exports:{}};return e[r].call(o.exports,o,o.exports,n),o.l=!0,o.exports}n.m=e,n.c=t,n.d=function(e,t,r){n.o(e,t)||Object.defineProperty(e,t,{enumerable:!0,get:r})},n.r=function(e){"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(e,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(e,"__esModule",{value:!0})},n.t=function(e,t){if(1&t&&(e=n(e)),8&t)return e;if(4&t&&"object"==typeof e&&e&&e.__esModule)return e;var r=Object.create(null);if(n.r(r),Object.defineProperty(r,"default",{enumerable:!0,value:e}),2&t&&"string"!=typeof e)for(var o in e)n.d(r,o,function(t){return e[t]}.bind(null,o));return r},n.n=function(e){var t=e&&e.__esModule?function(){return e.default}:function(){return e};return n.d(t,"a",t),t},n.o=function(e,t){return Object.prototype.hasOwnProperty.call(e,t)},n.p="",n(n.s=
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2 |
//# sourceMappingURL=block.min.js.map
|
| 1 |
+
!function(e){var t={};function n(r){if(t[r])return t[r].exports;var o=t[r]={i:r,l:!1,exports:{}};return e[r].call(o.exports,o,o.exports,n),o.l=!0,o.exports}n.m=e,n.c=t,n.d=function(e,t,r){n.o(e,t)||Object.defineProperty(e,t,{enumerable:!0,get:r})},n.r=function(e){"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(e,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(e,"__esModule",{value:!0})},n.t=function(e,t){if(1&t&&(e=n(e)),8&t)return e;if(4&t&&"object"==typeof e&&e&&e.__esModule)return e;var r=Object.create(null);if(n.r(r),Object.defineProperty(r,"default",{enumerable:!0,value:e}),2&t&&"string"!=typeof e)for(var o in e)n.d(r,o,function(t){return e[t]}.bind(null,o));return r},n.n=function(e){var t=e&&e.__esModule?function(){return e.default}:function(){return e};return n.d(t,"a",t),t},n.o=function(e,t){return Object.prototype.hasOwnProperty.call(e,t)},n.p="",n(n.s=3)}([function(e,t,n){"use strict";e.exports=n(1)},function(e,t,n){"use strict";
|
| 2 |
+
/** @license React v16.6.1
|
| 3 |
+
* react.production.min.js
|
| 4 |
+
*
|
| 5 |
+
* Copyright (c) Facebook, Inc. and its affiliates.
|
| 6 |
+
*
|
| 7 |
+
* This source code is licensed under the MIT license found in the
|
| 8 |
+
* LICENSE file in the root directory of this source tree.
|
| 9 |
+
*/function r(e){"@babel/helpers - typeof";return(r="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(e){return typeof e}:function(e){return e&&"function"==typeof Symbol&&e.constructor===Symbol&&e!==Symbol.prototype?"symbol":typeof e})(e)}var o=n(2),l="function"==typeof Symbol&&Symbol.for,a=l?Symbol.for("react.element"):60103,c=l?Symbol.for("react.portal"):60106,i=l?Symbol.for("react.fragment"):60107,u=l?Symbol.for("react.strict_mode"):60108,f=l?Symbol.for("react.profiler"):60114,s=l?Symbol.for("react.provider"):60109,p=l?Symbol.for("react.context"):60110,d=l?Symbol.for("react.concurrent_mode"):60111,y=l?Symbol.for("react.forward_ref"):60112,m=l?Symbol.for("react.suspense"):60113,b=l?Symbol.for("react.memo"):60115,g=l?Symbol.for("react.lazy"):60116,h="function"==typeof Symbol&&Symbol.iterator;function v(e){for(var t=arguments.length-1,n="https://reactjs.org/docs/error-decoder.html?invariant="+e,r=0;r<t;r++)n+="&args[]="+encodeURIComponent(arguments[r+1]);!function(e,t,n,r,o,l,a,c){if(!e){if(e=void 0,void 0===t)e=Error("Minified exception occurred; use the non-minified dev environment for the full error message and additional helpful warnings.");else{var i=[n,r,o,l,a,c],u=0;(e=Error(t.replace(/%s/g,function(){return i[u++]}))).name="Invariant Violation"}throw e.framesToPop=1,e}}(!1,"Minified React error #"+e+"; visit %s for the full message or use the non-minified dev environment for full errors and additional helpful warnings. ",n)}var C={isMounted:function(){return!1},enqueueForceUpdate:function(){},enqueueReplaceState:function(){},enqueueSetState:function(){}},_={};function k(e,t,n){this.props=e,this.context=t,this.refs=_,this.updater=n||C}function E(){}function S(e,t,n){this.props=e,this.context=t,this.refs=_,this.updater=n||C}k.prototype.isReactComponent={},k.prototype.setState=function(e,t){"object"!==r(e)&&"function"!=typeof e&&null!=e&&v("85"),this.updater.enqueueSetState(this,e,t,"setState")},k.prototype.forceUpdate=function(e){this.updater.enqueueForceUpdate(this,e,"forceUpdate")},E.prototype=k.prototype;var w=S.prototype=new E;w.constructor=S,o(w,k.prototype),w.isPureReactComponent=!0;var O={current:null,currentDispatcher:null},j=Object.prototype.hasOwnProperty,x={key:!0,ref:!0,__self:!0,__source:!0};function P(e,t,n){var r=void 0,o={},l=null,c=null;if(null!=t)for(r in void 0!==t.ref&&(c=t.ref),void 0!==t.key&&(l=""+t.key),t)j.call(t,r)&&!x.hasOwnProperty(r)&&(o[r]=t[r]);var i=arguments.length-2;if(1===i)o.children=n;else if(1<i){for(var u=Array(i),f=0;f<i;f++)u[f]=arguments[f+2];o.children=u}if(e&&e.defaultProps)for(r in i=e.defaultProps)void 0===o[r]&&(o[r]=i[r]);return{$$typeof:a,type:e,key:l,ref:c,props:o,_owner:O.current}}function R(e){return"object"===r(e)&&null!==e&&e.$$typeof===a}var G=/\/+/g,M=[];function I(e,t,n,r){if(M.length){var o=M.pop();return o.result=e,o.keyPrefix=t,o.func=n,o.context=r,o.count=0,o}return{result:e,keyPrefix:t,func:n,context:r,count:0}}function $(e){e.result=null,e.keyPrefix=null,e.func=null,e.context=null,e.count=0,10>M.length&&M.push(e)}function N(e,t,n){return null==e?0:function e(t,n,o,l){var i=r(t);"undefined"!==i&&"boolean"!==i||(t=null);var u=!1;if(null===t)u=!0;else switch(i){case"string":case"number":u=!0;break;case"object":switch(t.$$typeof){case a:case c:u=!0}}if(u)return o(l,t,""===n?"."+L(t,0):n),1;if(u=0,n=""===n?".":n+":",Array.isArray(t))for(var f=0;f<t.length;f++){var s=n+L(i=t[f],f);u+=e(i,s,o,l)}else if(s=null===t||"object"!==r(t)?null:"function"==typeof(s=h&&t[h]||t["@@iterator"])?s:null,"function"==typeof s)for(t=s.call(t),f=0;!(i=t.next()).done;)u+=e(i=i.value,s=n+L(i,f++),o,l);else"object"===i&&v("31","[object Object]"==(o=""+t)?"object with keys {"+Object.keys(t).join(", ")+"}":o,"");return u}(e,"",t,n)}function L(e,t){return"object"===r(e)&&null!==e&&null!=e.key?function(e){var t={"=":"=0",":":"=2"};return"$"+(""+e).replace(/[=:]/g,function(e){return t[e]})}(e.key):t.toString(36)}function A(e,t){e.func.call(e.context,t,e.count++)}function T(e,t,n){var r=e.result,o=e.keyPrefix;e=e.func.call(e.context,t,e.count++),Array.isArray(e)?W(e,r,n,function(e){return e}):null!=e&&(R(e)&&(e=function(e,t){return{$$typeof:a,type:e.type,key:t,ref:e.ref,props:e.props,_owner:e._owner}}(e,o+(!e.key||t&&t.key===e.key?"":(""+e.key).replace(G,"$&/")+"/")+n)),r.push(e))}function W(e,t,n,r,o){var l="";null!=n&&(l=(""+n).replace(G,"$&/")+"/"),N(e,T,t=I(t,l,r,o)),$(t)}var Z={Children:{map:function(e,t,n){if(null==e)return e;var r=[];return W(e,r,null,t,n),r},forEach:function(e,t,n){if(null==e)return e;N(e,A,t=I(null,null,t,n)),$(t)},count:function(e){return N(e,function(){return null},null)},toArray:function(e){var t=[];return W(e,t,null,function(e){return e}),t},only:function(e){return R(e)||v("143"),e}},createRef:function(){return{current:null}},Component:k,PureComponent:S,createContext:function(e,t){return void 0===t&&(t=null),(e={$$typeof:p,_calculateChangedBits:t,_currentValue:e,_currentValue2:e,_threadCount:0,Provider:null,Consumer:null}).Provider={$$typeof:s,_context:e},e.Consumer=e},forwardRef:function(e){return{$$typeof:y,render:e}},lazy:function(e){return{$$typeof:g,_ctor:e,_status:-1,_result:null}},memo:function(e,t){return{$$typeof:b,type:e,compare:void 0===t?null:t}},Fragment:i,StrictMode:u,Suspense:m,createElement:P,cloneElement:function(e,t,n){(null===e||void 0===e)&&v("267",e);var r=void 0,l=o({},e.props),c=e.key,i=e.ref,u=e._owner;if(null!=t){void 0!==t.ref&&(i=t.ref,u=O.current),void 0!==t.key&&(c=""+t.key);var f=void 0;for(r in e.type&&e.type.defaultProps&&(f=e.type.defaultProps),t)j.call(t,r)&&!x.hasOwnProperty(r)&&(l[r]=void 0===t[r]&&void 0!==f?f[r]:t[r])}if(1===(r=arguments.length-2))l.children=n;else if(1<r){f=Array(r);for(var s=0;s<r;s++)f[s]=arguments[s+2];l.children=f}return{$$typeof:a,type:e.type,key:c,ref:i,props:l,_owner:u}},createFactory:function(e){var t=P.bind(null,e);return t.type=e,t},isValidElement:R,version:"16.6.3",__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED:{ReactCurrentOwner:O,assign:o}};Z.unstable_ConcurrentMode=d,Z.unstable_Profiler=f;var U={default:Z},q=U&&Z||U;e.exports=q.default||q},function(e,t,n){"use strict";
|
| 10 |
+
/*
|
| 11 |
+
object-assign
|
| 12 |
+
(c) Sindre Sorhus
|
| 13 |
+
@license MIT
|
| 14 |
+
*/var r=Object.getOwnPropertySymbols,o=Object.prototype.hasOwnProperty,l=Object.prototype.propertyIsEnumerable;e.exports=function(){try{if(!Object.assign)return!1;var e=new String("abc");if(e[5]="de","5"===Object.getOwnPropertyNames(e)[0])return!1;for(var t={},n=0;n<10;n++)t["_"+String.fromCharCode(n)]=n;if("0123456789"!==Object.getOwnPropertyNames(t).map(function(e){return t[e]}).join(""))return!1;var r={};return"abcdefghijklmnopqrst".split("").forEach(function(e){r[e]=e}),"abcdefghijklmnopqrst"===Object.keys(Object.assign({},r)).join("")}catch(e){return!1}}()?Object.assign:function(e,t){for(var n,a,c=function(e){if(null===e||void 0===e)throw new TypeError("Object.assign cannot be called with null or undefined");return Object(e)}(e),i=1;i<arguments.length;i++){for(var u in n=Object(arguments[i]))o.call(n,u)&&(c[u]=n[u]);if(r){a=r(n);for(var f=0;f<a.length;f++)l.call(n,a[f])&&(c[a[f]]=n[a[f]])}}return c}},function(e,t,n){"use strict";n.r(t);var r=n(0),o=n.n(r);function l(e){"@babel/helpers - typeof";return(l="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(e){return typeof e}:function(e){return e&&"function"==typeof Symbol&&e.constructor===Symbol&&e!==Symbol.prototype?"symbol":typeof e})(e)}function a(e,t){if(!(e instanceof t))throw new TypeError("Cannot call a class as a function")}function c(e,t){for(var n=0;n<t.length;n++){var r=t[n];r.enumerable=r.enumerable||!1,r.configurable=!0,"value"in r&&(r.writable=!0),Object.defineProperty(e,r.key,r)}}function i(e,t,n){return t&&c(e.prototype,t),n&&c(e,n),e}function u(e,t){if("function"!=typeof t&&null!==t)throw new TypeError("Super expression must either be null or a function");e.prototype=Object.create(t&&t.prototype,{constructor:{value:e,writable:!0,configurable:!0}}),t&&f(e,t)}function f(e,t){return(f=Object.setPrototypeOf||function(e,t){return e.__proto__=t,e})(e,t)}function s(e){var t=function(){if("undefined"==typeof Reflect||!Reflect.construct)return!1;if(Reflect.construct.sham)return!1;if("function"==typeof Proxy)return!0;try{return Date.prototype.toString.call(Reflect.construct(Date,[],function(){})),!0}catch(e){return!1}}();return function(){var n,r=d(e);if(t){var o=d(this).constructor;n=Reflect.construct(r,arguments,o)}else n=r.apply(this,arguments);return function(e,t){if(t&&("object"===l(t)||"function"==typeof t))return t;return p(e)}(this,n)}}function p(e){if(void 0===e)throw new ReferenceError("this hasn't been initialised - super() hasn't been called");return e}function d(e){return(d=Object.setPrototypeOf?Object.getPrototypeOf:function(e){return e.__proto__||Object.getPrototypeOf(e)})(e)}var y=document.body,m=function(e){u(n,o.a.Component);var t=s(n);function n(e){var r;return a(this,n),(r=t.call(this,e)).closeModal=r.closeModal.bind(p(r)),r.background_layer=document.createElement("div"),r.background_layer.setAttribute("id","add-ngg-gallery-modal-background"),r}return i(n,[{key:"componentDidMount",value:function(){y.style.overflow="hidden",y.appendChild(this.background_layer);var e=this,t=document.getElementById("add-ngg-gallery-block-iframe");t.addEventListener("NGG_Iframe_Ready",function(){document.getElementById("add-ngg-gallery-modal-spinner").classList.add("add-ngg-gallery-modal-spinner-hidden")}),t.addEventListener("NGG_Insert_Gallery",function(t){e.props.onInsertGallery(t.detail.shortcode)}),t.addEventListener("NGG_Close_Modal",function(){e.props.onCloseModal()})}},{key:"componentWillUnmount",value:function(){y.style.overflow="auto",y.removeChild(this.background_layer)}},{key:"closeModal",value:function(){this.props.onCloseModal()}},{key:"render",value:function(){var e=nextgen_gallery_attach_to_post_url+"&origin=block";if(this.props.content){e+="&shortcode=";var t=this.props.content.replace(/\\"/g,'"');t=(t=(t=t.replace(/^\[ngg_images/,"")).replace(/^\[ngg/,"")).replace(/]$/,""),e+=Base64.encode(t)}return ReactDOM.createPortal(o.a.createElement("div",{id:"add-ngg-gallery-modal"},o.a.createElement("a",{href:"#",id:"add-ngg-gallery-modal-close",onClick:this.closeModal},o.a.createElement("span",{className:"dashicons dashicons-no"})),o.a.createElement("div",{id:"add-ngg-gallery-modal-spinner"},o.a.createElement("i",{className:"fa fa-spin fa-spinner"})),o.a.createElement("iframe",{src:e,tabIndex:"-1",name:"add-ngg-gallery-block-iframe",id:"add-ngg-gallery-block-iframe"})),y)}}]),n}(),b=function(e){u(n,o.a.Component);var t=s(n);function n(e){var r;return a(this,n),(r=t.call(this,e)).state={open:!1},r.openIGW=r.openIGW.bind(p(r)),r.closeIGW=r.closeIGW.bind(p(r)),r.removeGallery=r.removeGallery.bind(p(r)),r}return i(n,[{key:"hasGallery",value:function(){return this.props.content&&this.props.content.length>0}},{key:"removeGallery",value:function(){this.props.onInsertGallery("")}},{key:"closeIGW",value:function(){this.setState({open:!1})}},{key:"openIGW",value:function(){this.setState({open:!0})}},{key:"render",value:function(){return o.a.createElement("div",{className:"add-ngg-gallery-parent"},this.state.open?o.a.createElement(m,{content:this.props.content,onCloseModal:this.closeIGW,onInsertGallery:this.props.onInsertGallery}):"",this.hasGallery()?o.a.createElement("div",{className:"add-ngg-gallery-block"},o.a.createElement("h3",null,add_ngg_gallery_block_i18n.h3),o.a.createElement("button",{className:"add-ngg-gallery-button",onClick:this.openIGW},add_ngg_gallery_block_i18n.edit),o.a.createElement("button",{className:"add-ngg-gallery-button",onClick:this.removeGallery},add_ngg_gallery_block_i18n.delete)):o.a.createElement("div",{className:"add-ngg-gallery-block"},o.a.createElement("div",{className:"add-ngg-gallery-button",onClick:this.openIGW},add_ngg_gallery_block_i18n.create)))}}]),n}(),g={};g.nextgen=React.createElement("svg",{xmlns:"http://www.w3.org/2000/svg",version:"1.1",viewBox:"0 0 240 240",width:"240.0pt",height:"240.0pt"},React.createElement("path",{d:"M 0.00 0.00 L 240.00 0.00 L 240.00 240.00 L 0.00 240.00 L 0.00 0.00 Z",fill:"#ffffff"}),React.createElement("path",{d:"M 116.97 3.45 C 155.78 2.17 194.29 21.78 215.90 54.07 C 226.92 70.43 234.08 89.34 236.07 109.00 C 239.08 140.20 228.61 172.42 208.14 196.12 C 191.73 215.41 168.66 228.79 143.97 234.16 C 125.25 238.08 105.37 237.44 87.04 231.86 C 67.00 226.07 48.82 214.65 34.69 199.32 C 14.08 177.26 2.88 147.13 3.50 117.00 C 4.36 95.58 10.72 74.49 22.55 56.55 C 35.03 37.69 52.63 22.36 73.52 13.50 C 87.07 6.87 101.94 3.80 116.97 3.45 Z",fill:"#9fbb1a"}),React.createElement("path",{d:"M 69.17 61.47 C 70.78 61.56 72.37 61.91 73.97 62.05 C 80.30 62.27 86.66 62.04 93.00 62.14 C 96.81 62.23 100.65 61.35 104.18 62.75 C 108.45 64.30 111.62 68.44 111.67 73.03 C 111.78 81.35 111.66 89.68 111.72 98.00 C 111.65 101.03 111.87 104.65 110.30 107.35 C 108.22 110.91 104.17 113.41 100.02 113.40 C 90.68 113.43 81.33 113.42 71.99 113.40 C 65.66 113.41 59.85 108.54 59.66 102.04 C 59.55 92.36 59.70 82.67 59.58 72.99 C 59.41 67.44 63.60 62.15 69.17 61.47 Z",fill:"#ffffff"}),React.createElement("path",{d:"M 138.98 61.27 C 148.33 61.42 157.69 61.22 167.04 61.37 C 173.28 61.31 178.81 66.69 178.70 72.96 C 178.72 82.65 178.75 92.34 178.68 102.02 C 178.48 108.28 173.18 112.96 167.02 113.04 C 157.69 113.25 148.33 113.02 138.99 113.15 C 132.77 113.56 126.76 108.35 126.66 102.04 C 126.55 94.37 126.67 86.68 126.62 79.00 C 126.63 76.33 126.42 73.60 126.72 70.94 C 127.60 65.24 133.25 60.88 138.98 61.27 Z",fill:"#ffffff"}),React.createElement("path",{d:"M 70.97 72.97 C 80.41 72.70 89.87 72.92 99.31 72.86 C 99.39 82.36 99.34 91.87 99.34 101.38 C 89.85 101.36 80.36 101.42 70.87 101.35 C 70.90 91.90 70.70 82.42 70.97 72.97 Z",fill:"#9fbb1a"}),React.createElement("path",{d:"M 138.39 72.91 C 147.80 72.79 157.23 72.85 166.65 72.88 C 166.65 82.41 166.85 91.97 166.55 101.49 C 157.18 101.27 147.79 101.39 138.41 101.42 C 138.30 91.92 138.36 82.41 138.39 72.91 Z",fill:"#9fbb1a"}),React.createElement("path",{d:"M 69.96 128.72 C 77.95 128.35 86.00 128.68 94.00 128.66 C 97.84 128.75 101.40 128.12 104.93 129.93 C 109.12 131.86 111.63 136.43 111.39 141.00 C 111.31 150.34 111.48 159.70 111.31 169.04 C 111.25 175.45 105.33 180.72 99.01 180.44 C 90.00 180.43 81.00 180.42 71.99 180.44 C 67.16 180.64 62.37 177.99 60.28 173.57 C 59.04 171.04 59.32 167.76 59.27 165.00 C 59.38 156.70 59.15 148.39 59.37 140.10 C 59.59 134.25 64.10 129.27 69.96 128.72 Z",fill:"#ffffff"}),React.createElement("path",{d:"M 137.96 128.68 C 146.96 128.36 156.00 128.45 165.00 128.61 C 167.68 128.64 170.26 129.00 172.61 130.36 C 176.44 132.46 178.51 136.68 178.41 140.99 C 178.39 150.33 178.47 159.67 178.37 169.01 C 178.48 174.84 173.95 180.48 167.95 180.68 C 159.31 180.89 150.65 180.67 142.00 180.78 C 139.64 180.74 137.05 180.91 134.76 180.27 C 129.71 178.66 126.48 173.17 126.62 168.01 C 126.61 161.01 126.64 154.00 126.62 147.00 C 126.71 143.40 126.11 139.00 127.75 135.73 C 129.57 131.70 133.51 128.85 137.96 128.68 Z",fill:"#ffffff"}),React.createElement("path",{d:"M 70.98 140.01 C 80.41 139.71 89.87 139.94 99.31 139.89 C 99.40 149.41 99.33 158.93 99.35 168.45 C 89.85 168.43 80.36 168.47 70.86 168.42 C 70.91 158.96 70.69 149.47 70.98 140.01 Z",fill:"#9fbb1a"}),React.createElement("path",{d:"M 138.45 140.41 C 147.84 140.29 157.27 140.44 166.67 140.35 C 166.70 149.82 166.71 159.29 166.67 168.77 C 157.24 168.71 147.81 168.71 138.38 168.77 C 138.39 159.32 138.24 149.85 138.45 140.41 Z",fill:"#9fbb1a"}));var h=g,v=wp.i18n.__,C=wp.element.RawHTML;(0,wp.blocks.registerBlockType)("imagely/nextgen-gallery",{title:v("NextGEN Gallery"),description:v("A block for adding NextGEN Galleries."),icon:h.nextgen,category:"common",attributes:{content:{type:"string",source:"html"}},supports:{className:!1,customClassName:!1},edit:function(e){var t=e.attributes,n=e.setAttributes;return o.a.createElement(b,{content:t.content,onInsertGallery:function(e){n({content:e})}})},save:function(e){var t=e.attributes.content;return o.a.createElement(C,null,t)}})}]);
|
| 15 |
//# sourceMappingURL=block.min.js.map
|
products/photocrati_nextgen/modules/nextgen_block/static/build/block.min.js.map
CHANGED
|
@@ -1 +1 @@
|
|
| 1 |
-
{"version":3,"sources":["webpack:///webpack/bootstrap","webpack:///./build/nextgen-gallery/products/photocrati_nextgen/modules/nextgen_block/static/src/edit.min.js","webpack:///./build/nextgen-gallery/products/photocrati_nextgen/modules/nextgen_block/static/src/icons.min.js","webpack:///./build/nextgen-gallery/products/photocrati_nextgen/modules/nextgen_block/static/src/block.min.js"],"names":["installedModules","__webpack_require__","moduleId","exports","module","i","l","modules","call","m","c","d","name","getter","o","Object","defineProperty","enumerable","get","r","Symbol","toStringTag","value","t","mode","__esModule","ns","create","key","bind","n","object","property","prototype","hasOwnProperty","p","s","wp","i18n","__","createNggEditComponent","memoize","lodash","$","Freeform","_Freeform","NggEditor","props","_this","_classCallCheck","this","_possibleConstructorReturn","_getPrototypeOf","openIGW","_assertThisInitialized","updateContent","hasGallery","toggleAddGalleryBtn","_inherits","_createClass","attributes","content","length","_get","ref","addClass","siblings","hide","removeClass","show","setAttributes","editor","on","_ref","shortcode","execCommand","React","createElement","className","onClick","ngg_tinymce_plugin","button_label","icons","nextgen","xmlns","version","viewBox","width","height","fill","RawHTML","element","registerBlockType","blocks","withSelect","data","omit","memo","edit","select","getBlockType","withFreeform","editProps","NggEdit","jQuery","_extends","isSelected","title","desription","icon","category","type","source","supports","customClassName","save"],"mappings":"aACA,IAAAA,KAGA,SAAAC,EAAAC,GAGA,GAAAF,EAAAE,GACA,OAAAF,EAAAE,GAAAC,QAGA,IAAAC,EAAAJ,EAAAE,IACAG,EAAAH,EACAI,GAAA,EACAH,YAUA,OANAI,EAAAL,GAAAM,KAAAJ,EAAAD,QAAAC,IAAAD,QAAAF,GAGAG,EAAAE,GAAA,EAGAF,EAAAD,QAKAF,EAAAQ,EAAAF,EAGAN,EAAAS,EAAAV,EAGAC,EAAAU,EAAA,SAAAR,EAAAS,EAAAC,GACAZ,EAAAa,EAAAX,EAAAS,IACAG,OAAAC,eAAAb,EAAAS,GAA0CK,YAAA,EAAAC,IAAAL,KAK1CZ,EAAAkB,EAAA,SAAAhB,GACA,oBAAAiB,eAAAC,aACAN,OAAAC,eAAAb,EAAAiB,OAAAC,aAAwDC,MAAA,WAExDP,OAAAC,eAAAb,EAAA,cAAiDmB,OAAA,KAQjDrB,EAAAsB,EAAA,SAAAD,EAAAE,GAEA,GADA,EAAAA,IAAAF,EAAArB,EAAAqB,IACA,EAAAE,EAAA,OAAAF,EACA,KAAAE,GAAA,iBAAAF,QAAAG,WAAA,OAAAH,EACA,IAAAI,EAAAX,OAAAY,OAAA,MAGA,GAFA1B,EAAAkB,EAAAO,GACAX,OAAAC,eAAAU,EAAA,WAAyCT,YAAA,EAAAK,UACzC,EAAAE,GAAA,iBAAAF,EAAA,QAAAM,KAAAN,EAAArB,EAAAU,EAAAe,EAAAE,EAAA,SAAAA,GAAgH,OAAAN,EAAAM,IAAqBC,KAAA,KAAAD,IACrI,OAAAF,GAIAzB,EAAA6B,EAAA,SAAA1B,GACA,IAAAS,EAAAT,KAAAqB,WACA,WAA2B,OAAArB,EAAA,SAC3B,WAAiC,OAAAA,GAEjC,OADAH,EAAAU,EAAAE,EAAA,IAAAA,GACAA,GAIAZ,EAAAa,EAAA,SAAAiB,EAAAC,GAAsD,OAAAjB,OAAAkB,UAAAC,eAAA1B,KAAAuB,EAAAC,IAGtD/B,EAAAkC,EAAA,GAIAlC,IAAAmC,EAAA,mjCClFsBC,GAAGC,KAAjBC,OAIKC,GAAyBC,EAHhBC,OAAdD,SAGsC,SAACE,EAAGC,GAoE9C,OApE2D,SAAAC,GAEvD,SAAAC,EAAYC,GAAO,IAAAC,EAAA,mGAAAC,CAAAC,KAAAJ,IACfE,uEAAAG,CAAAD,KAAAE,EAAAN,GAAAtC,KAAA0C,KAAMH,KACDM,QAAqBL,EAAKK,QAAQxB,KAAbyB,IAAAN,KAC1BA,EAAKO,cAAqBP,EAAKO,cAAc1B,KAAnByB,IAAAN,KAC1BA,EAAKQ,WAAqBR,EAAKQ,WAAW3B,KAAhByB,IAAAN,KAC1BA,EAAKS,oBAAqBT,EAAKS,oBAAoB5B,KAAzByB,IAAAN,KALXA,EAFoC,yOAAAU,CAAAZ,EACnCF,iDADmCe,CAAAb,IAAAlB,IAAA,aAAAN,MAAA,WAWnD,OAAO4B,KAAKH,MAAMa,WAAWC,SAAWX,KAAKH,MAAMa,WAAWC,QAAQC,OAAS,KAX5BlC,IAAA,oBAAAN,MAAA,WAenDyC,EAAAX,EAAAN,EAAAb,WAAA,oBAAAiB,MAAA1C,KAAA0C,MACAP,EAAEO,KAAKc,KAAKC,SAAS,oBAAoBA,SAAS,wBAClDf,KAAKO,yBAjB8C7B,IAAA,qBAAAN,MAAA,WAsBnD4B,KAAKO,yBAtB8C7B,IAAA,sBAAAN,MAAA,WA2B/C4B,KAAKH,MAAMa,WAAWC,SACtBlB,EAAEO,KAAKc,KAAKC,SAAS,UACrBtB,EAAEO,KAAKc,KAAKE,SAAS,yBAAyBC,SAG9CxB,EAAEO,KAAKc,KAAKI,YAAY,UACxBzB,EAAEO,KAAKc,KAAKE,SAAS,yBAAyBG,WAjCCzC,IAAA,gBAAAN,MAAA,SAqCzCuC,GACVX,KAAKH,MAAMuB,eAAeT,eAtCyBjC,IAAA,UAAAN,MAAA,SAyC/CiD,GACJR,EAAAX,EAAAN,EAAAb,WAAA,UAAAiB,MAAA1C,KAAA0C,KAAcqB,GACd,IAAMhB,EAAoBL,KAAKK,cAAc1B,KAAKqB,MAIlDqB,EAAOC,GAAG,cAAe,kBAAMjB,EAAc,MAC7CgB,EAAOC,GAAG,eAAgB,SAAAC,GAAA,IAAEC,EAAFD,EAAEC,UAAF,OAAiBnB,EAAcmB,QAhDN9C,IAAA,UAAAN,MAAA,WAoDnD4B,KAAKqB,OAAOI,YAAY,yBApD2B/C,IAAA,SAAAN,MAAA,WAyDnD,OADayC,EAAAX,EAAAN,EAAAb,WAAA,SAAAiB,MAAA1C,KAAA0C,MAGT0B,MAAAC,cAAA,OAAKC,UAAU,wBACXF,MAAAC,cAAA,OAAKC,UAAU,kBAAkBC,QAAS7B,KAAKG,SAC1C2B,mBAAmB1C,KAAK2C,oBA7DcnC,EAAA,KCJzDoC,KAENA,EAAMC,QACNP,MAAAC,cAAA,OAAKO,MAAM,6BAA6BC,QAAQ,MAAMC,QAAQ,cAAcC,MAAM,UAAUC,OAAO,WACnGZ,MAAAC,cAAA,QAAMlE,EAAE,wEAAwE8E,KAAK,YACrFb,MAAAC,cAAA,QAAMlE,EAAE,uaAAua8E,KAAK,YACpbb,MAAAC,cAAA,QAAMlE,EAAE,8cAA8c8E,KAAK,YAC3db,MAAAC,cAAA,QAAMlE,EAAE,8YAA8Y8E,KAAK,YAC3Zb,MAAAC,cAAA,QAAMlE,EAAE,8KAA8K8E,KAAK,YAC3Lb,MAAAC,cAAA,QAAMlE,EAAE,2LAA2L8E,KAAK,YACxMb,MAAAC,cAAA,QAAMlE,EAAE,ubAAub8E,KAAK,YACpcb,MAAAC,cAAA,QAAMlE,EAAE,wfAAwf8E,KAAK,YACrgBb,MAAAC,cAAA,QAAMlE,EAAE,uLAAuL8E,KAAK,YACpMb,MAAAC,cAAA,QAAMlE,EAAE,oMAAoM8E,KAAK,aAGlMP,2NCZP3C,EAAwBF,GAAGC,KAA3BC,GACAmD,EAAqCrD,GAAGsD,QAAxCD,QACAE,EAAsCvD,GAAGwD,OAAzCD,kBACAE,EAAsCzD,GAAG0D,KAAzCD,WACAE,EAAsCtD,OAAtCsD,KACAC,EAAsCrB,MAAtCqB,KAUFC,EAPeJ,EAAW,SAACK,EAAQpD,GACrC,OACIH,SAAUuD,EAAO,eAAeC,aAAa,mBAKxCC,CAAaJ,EAAK,SAAAlD,GAC3B,IAAMuD,EAAaN,EAAKjD,GAAQ,aAC1BwD,EAAU/D,EAAuBgE,OAAQzD,EAAMH,SAASsD,MAC9D,OAAOtB,MAAAC,cAAC0B,EAADE,KAAaH,GAAWI,YAAY,QAI/Cd,EAAkB,2BAEde,MAAOpE,EAAG,mBAEVqE,WAAYrE,EAAG,yCAEfsE,KAAM3B,EAAMC,QAEZ2B,SAAU,SAEVlD,YACIC,SACIkD,KAAM,SACNC,OAAQ,SAIhBC,UACInC,WAAW,EACXoC,iBAAiB,GAGrBhB,OAEAiB,KAxByC,SAAA1C,GAwBlB,IACXZ,EADWY,EAAfb,WACIC,QACR,OAAOe,MAAAC,cAACa,EAAD,KAAW7B","file":"block.min.js","sourcesContent":[" \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId]) {\n \t\t\treturn installedModules[moduleId].exports;\n \t\t}\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\ti: moduleId,\n \t\t\tl: false,\n \t\t\texports: {}\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.l = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// define getter function for harmony exports\n \t__webpack_require__.d = function(exports, name, getter) {\n \t\tif(!__webpack_require__.o(exports, name)) {\n \t\t\tObject.defineProperty(exports, name, { enumerable: true, get: getter });\n \t\t}\n \t};\n\n \t// define __esModule on exports\n \t__webpack_require__.r = function(exports) {\n \t\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n \t\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n \t\t}\n \t\tObject.defineProperty(exports, '__esModule', { value: true });\n \t};\n\n \t// create a fake namespace object\n \t// mode & 1: value is a module id, require it\n \t// mode & 2: merge all properties of value into the ns\n \t// mode & 4: return value when already ns object\n \t// mode & 8|1: behave like require\n \t__webpack_require__.t = function(value, mode) {\n \t\tif(mode & 1) value = __webpack_require__(value);\n \t\tif(mode & 8) return value;\n \t\tif((mode & 4) && typeof value === 'object' && value && value.__esModule) return value;\n \t\tvar ns = Object.create(null);\n \t\t__webpack_require__.r(ns);\n \t\tObject.defineProperty(ns, 'default', { enumerable: true, value: value });\n \t\tif(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key));\n \t\treturn ns;\n \t};\n\n \t// getDefaultExport function for compatibility with non-harmony modules\n \t__webpack_require__.n = function(module) {\n \t\tvar getter = module && module.__esModule ?\n \t\t\tfunction getDefault() { return module['default']; } :\n \t\t\tfunction getModuleExports() { return module; };\n \t\t__webpack_require__.d(getter, 'a', getter);\n \t\treturn getter;\n \t};\n\n \t// Object.prototype.hasOwnProperty.call\n \t__webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(__webpack_require__.s = 0);\n","const { __ } = wp.i18n;\nconst { memoize } = lodash\n\n// Given jQuery and the Freeform block settings, creates the Ngg Editor Component\nexport const createNggEditComponent = memoize(($, Freeform) => {\n class NggEditor extends Freeform {\n constructor(props) {\n super(props)\n this.openIGW = this.openIGW.bind(this)\n this.updateContent = this.updateContent.bind(this)\n this.hasGallery = this.hasGallery.bind(this)\n this.toggleAddGalleryBtn= this.toggleAddGalleryBtn.bind(this)\n }\n\n hasGallery() {\n return this.props.attributes.content && this.props.attributes.content.length > 0\n }\n\n componentDidMount() {\n super.componentDidMount()\n $(this.ref).addClass('freeform-toolbar').addClass('ngg-freeform-toolbar')\n this.toggleAddGalleryBtn();\n\n }\n\n componentDidUpdate() {\n this.toggleAddGalleryBtn();\n }\n\n toggleAddGalleryBtn() {\n // Determine the UI state\n if (this.props.attributes.content) {\n $(this.ref).addClass('hidden');\n $(this.ref).siblings('.add-ngg-gallery-wrap').hide()\n }\n else {\n $(this.ref).removeClass('hidden');\n $(this.ref).siblings('.add-ngg-gallery-wrap').show()\n }\n }\n\n updateContent(content) {\n this.props.setAttributes({content}) \n }\n\n onSetup(editor){\n super.onSetup(editor);\n const updateContent = this.updateContent.bind(this)\n\n // When NGG is added or removed, we must set the classic \"content\" attribute, \n // which will re-render our component\n editor.on('ngg-removed', () => updateContent(\"\"))\n editor.on('ngg-inserted', ({shortcode}) => updateContent(shortcode))\n }\n\n openIGW() {\n this.editor.execCommand('ngg_attach_to_post')\n }\n\n render(){\n const classic = super.render()\n return [\n classic,\n <div className=\"add-ngg-gallery-wrap\">\n <div className=\"add-ngg-gallery\" onClick={this.openIGW}>\n {ngg_tinymce_plugin.i18n.button_label}\n </div>\n </div>\n ]\n }\n }\n\n return NggEditor\n})","const icons = {};\n\nicons.nextgen =\n<svg xmlns=\"http://www.w3.org/2000/svg\" version=\"1.1\" viewBox=\"0 0 240 240\" width=\"240.0pt\" height=\"240.0pt\">\n<path d=\"M 0.00 0.00 L 240.00 0.00 L 240.00 240.00 L 0.00 240.00 L 0.00 0.00 Z\" fill=\"#ffffff\" />\n<path d=\"M 116.97 3.45 C 155.78 2.17 194.29 21.78 215.90 54.07 C 226.92 70.43 234.08 89.34 236.07 109.00 C 239.08 140.20 228.61 172.42 208.14 196.12 C 191.73 215.41 168.66 228.79 143.97 234.16 C 125.25 238.08 105.37 237.44 87.04 231.86 C 67.00 226.07 48.82 214.65 34.69 199.32 C 14.08 177.26 2.88 147.13 3.50 117.00 C 4.36 95.58 10.72 74.49 22.55 56.55 C 35.03 37.69 52.63 22.36 73.52 13.50 C 87.07 6.87 101.94 3.80 116.97 3.45 Z\" fill=\"#9fbb1a\" />\n<path d=\"M 69.17 61.47 C 70.78 61.56 72.37 61.91 73.97 62.05 C 80.30 62.27 86.66 62.04 93.00 62.14 C 96.81 62.23 100.65 61.35 104.18 62.75 C 108.45 64.30 111.62 68.44 111.67 73.03 C 111.78 81.35 111.66 89.68 111.72 98.00 C 111.65 101.03 111.87 104.65 110.30 107.35 C 108.22 110.91 104.17 113.41 100.02 113.40 C 90.68 113.43 81.33 113.42 71.99 113.40 C 65.66 113.41 59.85 108.54 59.66 102.04 C 59.55 92.36 59.70 82.67 59.58 72.99 C 59.41 67.44 63.60 62.15 69.17 61.47 Z\" fill=\"#ffffff\" />\n<path d=\"M 138.98 61.27 C 148.33 61.42 157.69 61.22 167.04 61.37 C 173.28 61.31 178.81 66.69 178.70 72.96 C 178.72 82.65 178.75 92.34 178.68 102.02 C 178.48 108.28 173.18 112.96 167.02 113.04 C 157.69 113.25 148.33 113.02 138.99 113.15 C 132.77 113.56 126.76 108.35 126.66 102.04 C 126.55 94.37 126.67 86.68 126.62 79.00 C 126.63 76.33 126.42 73.60 126.72 70.94 C 127.60 65.24 133.25 60.88 138.98 61.27 Z\" fill=\"#ffffff\" />\n<path d=\"M 70.97 72.97 C 80.41 72.70 89.87 72.92 99.31 72.86 C 99.39 82.36 99.34 91.87 99.34 101.38 C 89.85 101.36 80.36 101.42 70.87 101.35 C 70.90 91.90 70.70 82.42 70.97 72.97 Z\" fill=\"#9fbb1a\" />\n<path d=\"M 138.39 72.91 C 147.80 72.79 157.23 72.85 166.65 72.88 C 166.65 82.41 166.85 91.97 166.55 101.49 C 157.18 101.27 147.79 101.39 138.41 101.42 C 138.30 91.92 138.36 82.41 138.39 72.91 Z\" fill=\"#9fbb1a\" />\n<path d=\"M 69.96 128.72 C 77.95 128.35 86.00 128.68 94.00 128.66 C 97.84 128.75 101.40 128.12 104.93 129.93 C 109.12 131.86 111.63 136.43 111.39 141.00 C 111.31 150.34 111.48 159.70 111.31 169.04 C 111.25 175.45 105.33 180.72 99.01 180.44 C 90.00 180.43 81.00 180.42 71.99 180.44 C 67.16 180.64 62.37 177.99 60.28 173.57 C 59.04 171.04 59.32 167.76 59.27 165.00 C 59.38 156.70 59.15 148.39 59.37 140.10 C 59.59 134.25 64.10 129.27 69.96 128.72 Z\" fill=\"#ffffff\" />\n<path d=\"M 137.96 128.68 C 146.96 128.36 156.00 128.45 165.00 128.61 C 167.68 128.64 170.26 129.00 172.61 130.36 C 176.44 132.46 178.51 136.68 178.41 140.99 C 178.39 150.33 178.47 159.67 178.37 169.01 C 178.48 174.84 173.95 180.48 167.95 180.68 C 159.31 180.89 150.65 180.67 142.00 180.78 C 139.64 180.74 137.05 180.91 134.76 180.27 C 129.71 178.66 126.48 173.17 126.62 168.01 C 126.61 161.01 126.64 154.00 126.62 147.00 C 126.71 143.40 126.11 139.00 127.75 135.73 C 129.57 131.70 133.51 128.85 137.96 128.68 Z\" fill=\"#ffffff\" />\n<path d=\"M 70.98 140.01 C 80.41 139.71 89.87 139.94 99.31 139.89 C 99.40 149.41 99.33 158.93 99.35 168.45 C 89.85 168.43 80.36 168.47 70.86 168.42 C 70.91 158.96 70.69 149.47 70.98 140.01 Z\" fill=\"#9fbb1a\" />\n<path d=\"M 138.45 140.41 C 147.84 140.29 157.27 140.44 166.67 140.35 C 166.70 149.82 166.71 159.29 166.67 168.77 C 157.24 168.71 147.81 168.71 138.38 168.77 C 138.39 159.32 138.24 149.85 138.45 140.41 Z\" fill=\"#9fbb1a\" />\n</svg>\n\nexport default icons;","// Dependencies\nimport { createNggEditComponent } from './edit.min'\nimport icons from './icons.min';\n\nconst { __ } \t\t\t\t\t = wp.i18n\nconst { RawHTML } \t = wp.element\nconst { registerBlockType } = wp.blocks\nconst { withSelect} = wp.data\nconst { omit } = lodash\nconst { memo } = React\n\n// Provides a higher order component that is aware when the freeform block becomes available\nconst withFreeform = withSelect((select, props) => {\n return {\n Freeform: select('core/blocks').getBlockType('core/freeform')\n }\n})\n\n// When the freeform block is available, we create our edit component for NGG and render it\nconst edit = withFreeform(memo(props => {\n const editProps = omit(props, ['Freeform'])\n const NggEdit = createNggEditComponent(jQuery, props.Freeform.edit)\n return <NggEdit {...editProps} isSelected={true}/>\n}))\n\n// Register our block\nregisterBlockType('imagely/nextgen-gallery', {\n\n title: __('NextGEN Gallery'),\n\n desription: __('A block for adding NextGEN Galleries.'),\n\n icon: icons.nextgen,\n\n category: 'common',\n\n attributes: {\n content: {\n type: 'string',\n source: 'html',\n },\n },\n\n supports: {\n className: false,\n customClassName: false,\n },\n\n edit,\n\n save( { attributes } ) {\n const { content } = attributes;\n return <RawHTML>{ content }</RawHTML>\n },\n});\n\n\n"],"sourceRoot":""}
|
| 1 |
+
{"version":3,"sources":["webpack:///webpack/bootstrap","webpack:///./node_modules/react/index.js","webpack:///./node_modules/react/cjs/react.production.min.js","webpack:///./node_modules/object-assign/index.js","webpack:///./build/nextgen-gallery/products/photocrati_nextgen/modules/nextgen_block/static/src/edit.jsx","webpack:///./build/nextgen-gallery/products/photocrati_nextgen/modules/nextgen_block/static/src/icons.min.js","webpack:///./build/nextgen-gallery/products/photocrati_nextgen/modules/nextgen_block/static/src/block.jsx"],"names":["installedModules","__webpack_require__","moduleId","exports","module","i","l","modules","call","m","c","d","name","getter","o","Object","defineProperty","enumerable","get","r","Symbol","toStringTag","value","t","mode","__esModule","ns","create","key","bind","n","object","property","prototype","hasOwnProperty","p","s","require","k","q","u","v","w","x","y","z","A","B","C","iterator","D","a","b","arguments","length","e","encodeURIComponent","g","h","f","Error","replace","framesToPop","aa","E","isMounted","enqueueForceUpdate","enqueueReplaceState","enqueueSetState","F","G","this","props","context","refs","updater","H","I","isReactComponent","setState","_typeof","forceUpdate","J","constructor","isPureReactComponent","K","current","currentDispatcher","L","M","ref","__self","__source","N","children","Array","defaultProps","$$typeof","type","_owner","O","P","Q","R","pop","result","keyPrefix","func","count","S","push","V","T","U","isArray","next","done","keys","join","=",":","escape","toString","ca","da","W","ba","X","Children","map","forEach","toArray","only","createRef","Component","PureComponent","createContext","_calculateChangedBits","_currentValue","_currentValue2","_threadCount","Provider","Consumer","_context","forwardRef","render","lazy","_ctor","_status","_result","memo","compare","Fragment","StrictMode","Suspense","createElement","cloneElement","createFactory","isValidElement","version","__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED","ReactCurrentOwner","assign","unstable_ConcurrentMode","unstable_Profiler","Y","default","Z","getOwnPropertySymbols","propIsEnumerable","propertyIsEnumerable","test1","String","getOwnPropertyNames","test2","fromCharCode","test3","split","letter","err","shouldUseNative","target","source","from","symbols","to","val","undefined","TypeError","toObject","body","document","NGGModal","React","_this","_classCallCheck","_super","closeModal","_assertThisInitialized","background_layer","setAttribute","style","overflow","appendChild","self","iframe","getElementById","addEventListener","classList","add","event","onInsertGallery","detail","shortcode","onCloseModal","removeChild","attach_to_post_url","nextgen_gallery_attach_to_post_url","content","Base64","encode","ReactDOM","createPortal","react_default","id","href","onClick","className","src","tabIndex","NGGEditor","_this2","_super2","state","open","openIGW","closeIGW","removeGallery","edit_NGGModal","hasGallery","add_ngg_gallery_block_i18n","h3","edit","icons","nextgen","xmlns","viewBox","width","height","fill","__","wp","i18n","RawHTML","element","registerBlockType","blocks","title","description","icon","category","attributes","supports","customClassName","_ref","setAttributes","edit_NGGEditor","save","_ref2"],"mappings":"aACA,IAAAA,KAGA,SAAAC,EAAAC,GAGA,GAAAF,EAAAE,GACA,OAAAF,EAAAE,GAAAC,QAGA,IAAAC,EAAAJ,EAAAE,IACAG,EAAAH,EACAI,GAAA,EACAH,YAUA,OANAI,EAAAL,GAAAM,KAAAJ,EAAAD,QAAAC,IAAAD,QAAAF,GAGAG,EAAAE,GAAA,EAGAF,EAAAD,QAKAF,EAAAQ,EAAAF,EAGAN,EAAAS,EAAAV,EAGAC,EAAAU,EAAA,SAAAR,EAAAS,EAAAC,GACAZ,EAAAa,EAAAX,EAAAS,IACAG,OAAAC,eAAAb,EAAAS,GAA0CK,YAAA,EAAAC,IAAAL,KAK1CZ,EAAAkB,EAAA,SAAAhB,GACA,oBAAAiB,eAAAC,aACAN,OAAAC,eAAAb,EAAAiB,OAAAC,aAAwDC,MAAA,WAExDP,OAAAC,eAAAb,EAAA,cAAiDmB,OAAA,KAQjDrB,EAAAsB,EAAA,SAAAD,EAAAE,GAEA,GADA,EAAAA,IAAAF,EAAArB,EAAAqB,IACA,EAAAE,EAAA,OAAAF,EACA,KAAAE,GAAA,iBAAAF,QAAAG,WAAA,OAAAH,EACA,IAAAI,EAAAX,OAAAY,OAAA,MAGA,GAFA1B,EAAAkB,EAAAO,GACAX,OAAAC,eAAAU,EAAA,WAAyCT,YAAA,EAAAK,UACzC,EAAAE,GAAA,iBAAAF,EAAA,QAAAM,KAAAN,EAAArB,EAAAU,EAAAe,EAAAE,EAAA,SAAAA,GAAgH,OAAAN,EAAAM,IAAqBC,KAAA,KAAAD,IACrI,OAAAF,GAIAzB,EAAA6B,EAAA,SAAA1B,GACA,IAAAS,EAAAT,KAAAqB,WACA,WAA2B,OAAArB,EAAA,SAC3B,WAAiC,OAAAA,GAEjC,OADAH,EAAAU,EAAAE,EAAA,IAAAA,GACAA,GAIAZ,EAAAa,EAAA,SAAAiB,EAAAC,GAAsD,OAAAjB,OAAAkB,UAAAC,eAAA1B,KAAAuB,EAAAC,IAGtD/B,EAAAkC,EAAA,GAIAlC,IAAAmC,EAAA,kCC/EEhC,EAAOD,QAAUkC,EAAQ;;;;;;;;kQCMd,IAAIC,EAAED,EAAQ,GAAiBP,EAAE,mBAAoBV,QAAQA,OAAM,IAAKe,EAAEL,EAAEV,OAAM,IAAK,iBAAiB,MAAMmB,EAAET,EAAEV,OAAM,IAAK,gBAAgB,MAAMD,EAAEW,EAAEV,OAAM,IAAK,kBAAkB,MAAMG,EAAEO,EAAEV,OAAM,IAAK,qBAAqB,MAAMoB,EAAEV,EAAEV,OAAM,IAAK,kBAAkB,MAAMqB,EAAEX,EAAEV,OAAM,IAAK,kBAAkB,MAAMsB,EAAEZ,EAAEV,OAAM,IAAK,iBAAiB,MAAMuB,EAAEb,EAAEV,OAAM,IAAK,yBAAyB,MAAMwB,EAAEd,EAAEV,OAAM,IAAK,qBAAqB,MAAMyB,EAAEf,EAAEV,OAAM,IAAK,kBAAkB,MAAM0B,EAAEhB,EAAEV,OAAM,IAAK,cACnf,MAAM2B,EAAEjB,EAAEV,OAAM,IAAK,cAAc,MAAM4B,EAAE,mBAAoB5B,QAAQA,OAAO6B,SAC9E,SAASC,EAAEC,GAAG,IAAI,IAAIC,EAAEC,UAAUC,OAAO,EAAEC,EAAE,yDAAyDJ,EAAEzC,EAAE,EAAEA,EAAE0C,EAAE1C,IAAI6C,GAAG,WAAWC,mBAAmBH,UAAU3C,EAAE,KAD1E,SAAYyC,EAAEC,EAAEG,EAAE7C,EAAEC,EAAE8C,EAAEC,EAAEC,GAAG,IAAIR,EAAE,CAAU,GAATA,OAAE,OAAU,IAASC,EAAED,EAAES,MAAM,qIAAqI,CAAC,IAAItD,GAAGiD,EAAE7C,EAAEC,EAAE8C,EAAEC,EAAEC,GAAGlD,EAAE,GAAE0C,EAAES,MAAMR,EAAES,QAAQ,MAAM,WAAW,OAAOvD,EAAEG,SAAUG,KAAK,sBAAsC,MAAhBuC,EAAEW,YAAY,EAAQX,GAC1PY,EAAG,EAAG,yBAAyBZ,EAAE,4HAA4HI,GAAG,IAAIS,GAAGC,UAAU,WAAW,OAAM,GAAIC,mBAAmB,aAAaC,oBAAoB,aAAaC,gBAAgB,cAAcC,KAC1c,SAASC,EAAEnB,EAAEC,EAAEG,GAAGgB,KAAKC,MAAMrB,EAAEoB,KAAKE,QAAQrB,EAAEmB,KAAKG,KAAKL,EAAEE,KAAKI,QAAQpB,GAAGS,EAAsR,SAASY,KAA6B,SAASC,EAAE1B,EAAEC,EAAEG,GAAGgB,KAAKC,MAAMrB,EAAEoB,KAAKE,QAAQrB,EAAEmB,KAAKG,KAAKL,EAAEE,KAAKI,QAAQpB,GAAGS,EAApYM,EAAErC,UAAU6C,oBAAoBR,EAAErC,UAAU8C,SAAS,SAAS5B,EAAEC,GAAG,WAAA4B,EAAkB7B,IAAG,mBAAoBA,GAAG,MAAMA,GAAED,EAAE,MAAaqB,KAAKI,QAAQP,gBAAgBG,KAAKpB,EAAEC,EAAE,aAAakB,EAAErC,UAAUgD,YAAY,SAAS9B,GAAGoB,KAAKI,QAAQT,mBAAmBK,KAAKpB,EAAE,gBAA8ByB,EAAE3C,UAAUqC,EAAErC,UAAsF,IAAIiD,EAAEL,EAAE5C,UAAU,IAAI2C,EACxeM,EAAEC,YAAYN,EAAEvC,EAAE4C,EAAEZ,EAAErC,WAAWiD,EAAEE,sBAAqB,EAAG,IAAIC,GAAGC,QAAQ,KAAKC,kBAAkB,MAAMC,EAAEzE,OAAOkB,UAAUC,eAAeuD,GAAG7D,KAAI,EAAG8D,KAAI,EAAGC,QAAO,EAAGC,UAAS,GAC7K,SAASC,EAAE1C,EAAEC,EAAEG,GAAG,IAAI7C,OAAE,EAAOC,KAAK8C,EAAE,KAAKC,EAAE,KAAK,GAAG,MAAMN,EAAE,IAAI1C,UAAK,IAAS0C,EAAEsC,MAAMhC,EAAEN,EAAEsC,UAAK,IAAStC,EAAExB,MAAM6B,EAAE,GAAGL,EAAExB,KAAKwB,EAAEoC,EAAEhF,KAAK4C,EAAE1C,KAAK+E,EAAEvD,eAAexB,KAAKC,EAAED,GAAG0C,EAAE1C,IAAI,IAAIiD,EAAEN,UAAUC,OAAO,EAAE,GAAG,IAAIK,EAAEhD,EAAEmF,SAASvC,OAAO,GAAG,EAAEI,EAAE,CAAC,IAAI,IAAIrD,EAAEyF,MAAMpC,GAAGlD,EAAE,EAAEA,EAAEkD,EAAElD,IAAIH,EAAEG,GAAG4C,UAAU5C,EAAE,GAAGE,EAAEmF,SAASxF,EAAE,GAAG6C,GAAGA,EAAE6C,aAAa,IAAItF,KAAKiD,EAAER,EAAE6C,kBAAe,IAASrF,EAAED,KAAKC,EAAED,GAAGiD,EAAEjD,IAAI,OAAOuF,SAAS9D,EAAE+D,KAAK/C,EAAEvB,IAAI6B,EAAEiC,IAAIhC,EAAEc,MAAM7D,EAAEwF,OAAOd,EAAEC,SAC9U,SAASc,EAAEjD,GAAG,MAAM,WAAA6B,EAAkB7B,IAAG,OAAOA,GAAGA,EAAE8C,WAAW9D,EAA0G,IAAIkE,EAAE,OAAOC,KAAK,SAASC,EAAEpD,EAAEC,EAAEG,EAAE7C,GAAG,GAAG4F,EAAEhD,OAAO,CAAC,IAAI3C,EAAE2F,EAAEE,MAA8D,OAAxD7F,EAAE8F,OAAOtD,EAAExC,EAAE+F,UAAUtD,EAAEzC,EAAEgG,KAAKpD,EAAE5C,EAAE8D,QAAQ/D,EAAEC,EAAEiG,MAAM,EAASjG,EAAE,OAAO8F,OAAOtD,EAAEuD,UAAUtD,EAAEuD,KAAKpD,EAAEkB,QAAQ/D,EAAEkG,MAAM,GAC7b,SAASC,EAAE1D,GAAGA,EAAEsD,OAAO,KAAKtD,EAAEuD,UAAU,KAAKvD,EAAEwD,KAAK,KAAKxD,EAAEsB,QAAQ,KAAKtB,EAAEyD,MAAM,EAAE,GAAGN,EAAEhD,QAAQgD,EAAEQ,KAAK3D,GAE+E,SAAS4D,EAAE5D,EAAEC,EAAEG,GAAG,OAAO,MAAMJ,EAAE,EADtN,SAAS6D,EAAE7D,EAAEC,EAAEG,EAAE7C,GAAG,IAAIC,EAACqE,EAAQ7B,GAAK,cAAcxC,GAAG,YAAYA,IAAEwC,EAAE,MAAK,IAAIM,GAAE,EAAG,GAAG,OAAON,EAAEM,GAAE,OAAQ,OAAO9C,GAAG,IAAK,SAAS,IAAK,SAAS8C,GAAE,EAAG,MAAM,IAAK,SAAS,OAAON,EAAE8C,UAAU,KAAK9D,EAAE,KAAKI,EAAEkB,GAAE,GAAI,GAAGA,EAAE,OAAOF,EAAE7C,EAAEyC,EAAE,KAAKC,EAAE,IAAI6D,EAAE9D,EAAE,GAAGC,GAAG,EAAyB,GAAvBK,EAAE,EAAEL,EAAE,KAAKA,EAAE,IAAIA,EAAE,IAAO2C,MAAMmB,QAAQ/D,GAAG,IAAI,IAAIO,EAAE,EAAEA,EAAEP,EAAEG,OAAOI,IAAI,CAAQ,IAAIC,EAAEP,EAAE6D,EAAftG,EAAEwC,EAAEO,GAAeA,GAAGD,GAAGuD,EAAErG,EAAEgD,EAAEJ,EAAE7C,QAAQ,GAAiCiD,EAA9B,OAAOR,GAAG,WAAA6B,EAAkB7B,GAAI,KAAmC,mBAA7BQ,EAAEX,GAAGG,EAAEH,IAAIG,EAAE,eAAsCQ,EAAE,KAAM,mBAAoBA,EAAE,IAAIR,EAAEQ,EAAEnD,KAAK2C,GAAGO,EACpf,IAAI/C,EAAEwC,EAAEgE,QAAQC,MAA6B3D,GAAGuD,EAA1BrG,EAAEA,EAAEW,MAAMqC,EAAEP,EAAE6D,EAAEtG,EAAE+C,KAAcH,EAAE7C,OAAO,WAAWC,GAAWuC,EAAE,KAAK,oBAAdK,EAAE,GAAGJ,GAA+B,qBAAqBpC,OAAOsG,KAAKlE,GAAGmE,KAAK,MAAM,IAAI/D,EAAE,IAAK,OAAOE,EAAqCuD,CAAE7D,EAAE,GAAGC,EAAEG,GAAG,SAAS0D,EAAE9D,EAAEC,GAAG,MAAM,WAAA4B,EAAkB7B,IAAG,OAAOA,GAAG,MAAMA,EAAEvB,IAHjI,SAAgBuB,GAAG,IAAIC,GAAGmE,IAAI,KAAKC,IAAI,MAAM,MAAM,KAAK,GAAGrE,GAAGU,QAAQ,QAAQ,SAASV,GAAG,OAAOC,EAAED,KAGkCsE,CAAOtE,EAAEvB,KAAKwB,EAAEsE,SAAS,IAAI,SAASC,EAAGxE,EAAEC,GAAGD,EAAEwD,KAAKnG,KAAK2C,EAAEsB,QAAQrB,EAAED,EAAEyD,SAC7W,SAASgB,EAAGzE,EAAEC,EAAEG,GAAG,IAAI7C,EAAEyC,EAAEsD,OAAO9F,EAAEwC,EAAEuD,UAAUvD,EAAEA,EAAEwD,KAAKnG,KAAK2C,EAAEsB,QAAQrB,EAAED,EAAEyD,SAASb,MAAMmB,QAAQ/D,GAAG0E,EAAE1E,EAAEzC,EAAE6C,EAAE,SAASJ,GAAG,OAAOA,IAAI,MAAMA,IAAIiD,EAAEjD,KAAKA,EAJtJ,SAAYA,EAAEC,GAAG,OAAO6C,SAAS9D,EAAE+D,KAAK/C,EAAE+C,KAAKtE,IAAIwB,EAAEsC,IAAIvC,EAAEuC,IAAIlB,MAAMrB,EAAEqB,MAAM2B,OAAOhD,EAAEgD,QAIkE2B,CAAG3E,EAAExC,IAAIwC,EAAEvB,KAAKwB,GAAGA,EAAExB,MAAMuB,EAAEvB,IAAI,IAAI,GAAGuB,EAAEvB,KAAKiC,QAAQwC,EAAE,OAAO,KAAK9C,IAAI7C,EAAEoG,KAAK3D,IAAI,SAAS0E,EAAE1E,EAAEC,EAAEG,EAAE7C,EAAEC,GAAG,IAAI8C,EAAE,GAAG,MAAMF,IAAIE,GAAG,GAAGF,GAAGM,QAAQwC,EAAE,OAAO,KAAkBU,EAAE5D,EAAEyE,EAAjBxE,EAAEmD,EAAEnD,EAAEK,EAAE/C,EAAEC,IAAakG,EAAEzD,GAC7U,IAAI2E,GAAGC,UAAUC,IAAI,SAAS9E,EAAEC,EAAEG,GAAG,GAAG,MAAMJ,EAAE,OAAOA,EAAE,IAAIzC,KAAqB,OAAhBmH,EAAE1E,EAAEzC,EAAE,KAAK0C,EAAEG,GAAU7C,GAAGwH,QAAQ,SAAS/E,EAAEC,EAAEG,GAAG,GAAG,MAAMJ,EAAE,OAAOA,EAAqB4D,EAAE5D,EAAEwE,EAAvBvE,EAAEmD,EAAE,KAAK,KAAKnD,EAAEG,IAAasD,EAAEzD,IAAIwD,MAAM,SAASzD,GAAG,OAAO4D,EAAE5D,EAAE,WAAW,OAAO,MAAM,OAAOgF,QAAQ,SAAShF,GAAG,IAAIC,KAAuC,OAAlCyE,EAAE1E,EAAEC,EAAE,KAAK,SAASD,GAAG,OAAOA,IAAWC,GAAGgF,KAAK,SAASjF,GAAwB,OAArBiD,EAAEjD,IAAUD,EAAE,OAAcC,IAAIkF,UAAU,WAAW,OAAO/C,QAAQ,OAAOgD,UAAUhE,EAAEiE,cAAc1D,EAAE2D,cAAc,SAASrF,EAAEC,GACjV,YADoV,IAASA,IAAIA,EAAE,OAAMD,GAAG8C,SAASvD,EAAE+F,sBAAsBrF,EAC7fsF,cAAcvF,EAAEwF,eAAexF,EAAEyF,aAAa,EAAEC,SAAS,KAAKC,SAAS,OAAQD,UAAU5C,SAASxD,EAAEsG,SAAS5F,GAAUA,EAAE2F,SAAS3F,GAAG6F,WAAW,SAAS7F,GAAG,OAAO8C,SAASrD,EAAEqG,OAAO9F,IAAI+F,KAAK,SAAS/F,GAAG,OAAO8C,SAASlD,EAAEoG,MAAMhG,EAAEiG,SAAS,EAAEC,QAAQ,OAAOC,KAAK,SAASnG,EAAEC,GAAG,OAAO6C,SAASnD,EAAEoD,KAAK/C,EAAEoG,aAAQ,IAASnG,EAAE,KAAKA,IAAIoG,SAASrI,EAAEsI,WAAWlI,EAAEmI,SAAS7G,EAAE8G,cAAc9D,EAAE+D,aAAa,SAASzG,EAAEC,EAAEG,IAAG,OAAOJ,QAAG,IAASA,IAAED,EAAE,MAAMC,GAAU,IAAIzC,OAAE,EAAOC,EAAE2B,KAAKa,EAAEqB,OAAOf,EAAEN,EAAEvB,IAAI8B,EAAEP,EAAEuC,IAAI/B,EAAER,EAAEgD,OAC9e,GAAG,MAAM/C,EAAE,MAAC,IAASA,EAAEsC,MAAMhC,EAAEN,EAAEsC,IAAI/B,EAAE0B,EAAEC,cAAS,IAASlC,EAAExB,MAAM6B,EAAE,GAAGL,EAAExB,KAAK,IAAItB,OAAE,EAA4D,IAAII,KAAzDyC,EAAE+C,MAAM/C,EAAE+C,KAAKF,eAAe1F,EAAE6C,EAAE+C,KAAKF,cAAuB5C,EAAEoC,EAAEhF,KAAK4C,EAAE1C,KAAK+E,EAAEvD,eAAexB,KAAKC,EAAED,QAAG,IAAS0C,EAAE1C,SAAI,IAASJ,EAAEA,EAAEI,GAAG0C,EAAE1C,IAAyB,GAAG,KAAxBA,EAAE2C,UAAUC,OAAO,GAAW3C,EAAEmF,SAASvC,OAAO,GAAG,EAAE7C,EAAE,CAACJ,EAAEyF,MAAMrF,GAAG,IAAI,IAAID,EAAE,EAAEA,EAAEC,EAAED,IAAIH,EAAEG,GAAG4C,UAAU5C,EAAE,GAAGE,EAAEmF,SAASxF,EAAE,OAAO2F,SAAS9D,EAAE+D,KAAK/C,EAAE+C,KAAKtE,IAAI6B,EAAEiC,IAAIhC,EAAEc,MAAM7D,EAAEwF,OAAOxC,IAAIkG,cAAc,SAAS1G,GAAG,IAAIC,EAAEyC,EAAEhE,KAAK,KAAKsB,GAAY,OAATC,EAAE8C,KAAK/C,EAASC,GAAG0G,eAAe1D,EAAE2D,QAAQ,SAC1fC,oDAAoDC,kBAAkB5E,EAAE6E,OAAO5H,IAAIyF,EAAEoC,wBAAwBxH,EAAEoF,EAAEqC,kBAAkB5H,EAAE,IAAI6H,GAAGC,QAAQvC,GAAGwC,EAAEF,GAAGtC,GAAGsC,EAAEjK,EAAOD,QAAQoK,EAAC,SAAUA;;;;;ECf3L,IAAIC,EAAwBzJ,OAAOyJ,sBAC/BtI,EAAiBnB,OAAOkB,UAAUC,eAClCuI,EAAmB1J,OAAOkB,UAAUyI,qBAsDxCtK,EAAOD,QA5CP,WACC,IACC,IAAKY,OAAOmJ,OACX,OAAO,EAMR,IAAIS,EAAQ,IAAIC,OAAO,OAEvB,GADAD,EAAM,GAAK,KACkC,MAAzC5J,OAAO8J,oBAAoBF,GAAO,GACrC,OAAO,EAKR,IADA,IAAIG,KACKzK,EAAI,EAAGA,EAAI,GAAIA,IACvByK,EAAM,IAAMF,OAAOG,aAAa1K,IAAMA,EAKvC,GAAwB,eAHXU,OAAO8J,oBAAoBC,GAAO7C,IAAI,SAAUnG,GAC5D,OAAOgJ,EAAMhJ,KAEHwF,KAAK,IACf,OAAO,EAIR,IAAI0D,KAIJ,MAHA,uBAAuBC,MAAM,IAAI/C,QAAQ,SAAUgD,GAClDF,EAAME,GAAUA,IAGf,yBADEnK,OAAOsG,KAAKtG,OAAOmJ,UAAWc,IAAQ1D,KAAK,IAM9C,MAAO6D,GAER,OAAO,GAIQC,GAAoBrK,OAAOmJ,OAAS,SAAUmB,EAAQC,GAKtE,IAJA,IAAIC,EAEAC,EADAC,EAtDL,SAAkBC,GACjB,GAAY,OAARA,QAAwBC,IAARD,EACnB,MAAM,IAAIE,UAAU,yDAGrB,OAAO7K,OAAO2K,GAiDLG,CAASR,GAGTjJ,EAAI,EAAGA,EAAIiB,UAAUC,OAAQlB,IAAK,CAG1C,IAAK,IAAIR,KAFT2J,EAAOxK,OAAOsC,UAAUjB,IAGnBF,EAAe1B,KAAK+K,EAAM3J,KAC7B6J,EAAG7J,GAAO2J,EAAK3J,IAIjB,GAAI4I,EAAuB,CAC1BgB,EAAUhB,EAAsBe,GAChC,IAAK,IAAIlL,EAAI,EAAGA,EAAImL,EAAQlI,OAAQjD,IAC/BoK,EAAiBjK,KAAK+K,EAAMC,EAAQnL,MACvCoL,EAAGD,EAAQnL,IAAMkL,EAAKC,EAAQnL,MAMlC,OAAOoL,oqDCtFR,IAAMK,EAAOC,SAASD,KAEhBE,kBAAiBC,IAAM3D,sBAEzB,SAAA0D,EAAYxH,GAAO,IAAA0H,EAAA,OAAAC,EAAA5H,KAAAyH,IACfE,EAAAE,EAAA5L,KAAA+D,KAAMC,IACD6H,WAAgBH,EAAKG,WAAWxK,KAAhByK,EAAAJ,IAErBA,EAAKK,iBAAmBR,SAASpC,cAAc,OAC/CuC,EAAKK,iBAAiBC,aAAa,KAAM,oCAL1BN,wDASfJ,EAAKW,MAAMC,SAAW,SACtBZ,EAAKa,YAAYpI,KAAKgI,kBAEtB,IAAMK,EAAOrI,KAEPsI,EAASd,SAASe,eAAe,gCAEvCD,EAAOE,iBAAiB,mBAAoB,WACxChB,SAASe,eAAe,iCAAiCE,UAAUC,IAAI,0CAG3EJ,EAAOE,iBAAiB,qBAAsB,SAASG,GACnDN,EAAKpI,MAAM2I,gBAAgBD,EAAME,OAAOC,aAI5CR,EAAOE,iBAAiB,kBAAmB,WACvCH,EAAKpI,MAAM8I,gEAKfxB,EAAKW,MAAMC,SAAW,OACtBZ,EAAKyB,YAAYhJ,KAAKgI,uDAItBhI,KAAKC,MAAM8I,gDAIX,IAAIE,EAAqBC,mCAAqC,gBAE9D,GAAIlJ,KAAKC,MAAMkJ,QAAS,CACpBF,GAAsB,cACtB,IAAIH,EAAY9I,KAAKC,MAAMkJ,QAAQ7J,QAAQ,OAAQ,KAGnDwJ,GADAA,GADAA,EAAYA,EAAUxJ,QAAQ,gBAAiB,KACzBA,QAAQ,SAAU,KAClBA,QAAQ,KAAM,IACpC2J,GAAsBG,OAAOC,OAAOP,GAKxC,OAAOQ,SAASC,aACZC,EAAA5K,EAAAwG,cAAA,OAAKqE,GAAG,yBACJD,EAAA5K,EAAAwG,cAAA,KAAGsE,KAAK,IACLD,GAAG,8BACHE,QAAS3J,KAAK8H,YACb0B,EAAA5K,EAAAwG,cAAA,QAAMwE,UAAU,4BAEpBJ,EAAA5K,EAAAwG,cAAA,OAAKqE,GAAG,iCACJD,EAAA5K,EAAAwG,cAAA,KAAGwE,UAAU,2BAEjBJ,EAAA5K,EAAAwG,cAAA,UAAQyE,IAAKZ,EACLa,SAAS,KACTzN,KAAK,+BACLoN,GAAG,kCAEflC,YAMSwC,kBAAkBrC,IAAM3D,sBAEzC,SAAAgG,EAAY9J,GAAO,IAAA+J,EAAA,OAAApC,EAAA5H,KAAA+J,IACfC,EAAAC,EAAAhO,KAAA+D,KAAMC,IAEDiK,OACDC,MAAM,GAGVH,EAAKI,QAAgBJ,EAAKI,QAAQ9M,KAAbyK,EAAAiC,IACrBA,EAAKK,SAAgBL,EAAKK,SAAS/M,KAAdyK,EAAAiC,IACrBA,EAAKM,cAAgBN,EAAKM,cAAchN,KAAnByK,EAAAiC,IATNA,iDAaf,OAAOhK,KAAKC,MAAMkJ,SAAWnJ,KAAKC,MAAMkJ,QAAQpK,OAAS,0CAIzDiB,KAAKC,MAAM2I,gBAAgB,uCAI3B5I,KAAKQ,UACD2J,MAAM,sCAKVnK,KAAKQ,UACD2J,MAAM,qCAKV,OACIX,EAAA5K,EAAAwG,cAAA,OAAKwE,UAAU,0BACV5J,KAAKkK,MAAMC,KACRX,EAAA5K,EAAAwG,cAACmF,GAASpB,QAASnJ,KAAKC,MAAMkJ,QACpBJ,aAAc/I,KAAKqK,SACnBzB,gBAAiB5I,KAAKC,MAAM2I,kBACpC,GAEL5I,KAAKwK,aACFhB,EAAA5K,EAAAwG,cAAA,OAAKwE,UAAU,yBACXJ,EAAA5K,EAAAwG,cAAA,UAAKqF,2BAA2BC,IAChClB,EAAA5K,EAAAwG,cAAA,UAAQwE,UAAU,yBACVD,QAAS3J,KAAKoK,SACjBK,2BAA2BE,MAEhCnB,EAAA5K,EAAAwG,cAAA,UAAQwE,UAAU,yBACVD,QAAS3J,KAAKsK,eACjBG,2BAA0B,SAInCjB,EAAA5K,EAAAwG,cAAA,OAAKwE,UAAU,yBACXJ,EAAA5K,EAAAwG,cAAA,OAAKwE,UAAU,yBACVD,QAAS3J,KAAKoK,SACdK,2BAA2BrN,mBC3IlDwN,KAENA,EAAMC,QACNnD,MAAAtC,cAAA,OAAK0F,MAAM,6BAA6BtF,QAAQ,MAAMuF,QAAQ,cAAcC,MAAM,UAAUC,OAAO,WACnGvD,MAAAtC,cAAA,QAAMhJ,EAAE,wEAAwE8O,KAAK,YACrFxD,MAAAtC,cAAA,QAAMhJ,EAAE,uaAAua8O,KAAK,YACpbxD,MAAAtC,cAAA,QAAMhJ,EAAE,8cAA8c8O,KAAK,YAC3dxD,MAAAtC,cAAA,QAAMhJ,EAAE,8YAA8Y8O,KAAK,YAC3ZxD,MAAAtC,cAAA,QAAMhJ,EAAE,8KAA8K8O,KAAK,YAC3LxD,MAAAtC,cAAA,QAAMhJ,EAAE,2LAA2L8O,KAAK,YACxMxD,MAAAtC,cAAA,QAAMhJ,EAAE,ubAAub8O,KAAK,YACpcxD,MAAAtC,cAAA,QAAMhJ,EAAE,wfAAwf8O,KAAK,YACrgBxD,MAAAtC,cAAA,QAAMhJ,EAAE,uLAAuL8O,KAAK,YACpMxD,MAAAtC,cAAA,QAAMhJ,EAAE,oMAAoM8O,KAAK,aAGlMN,QCZPO,EAAWC,GAAGC,KAAdF,GACAG,EAAqBF,GAAGG,QAAxBD,SAIRE,EAH8BJ,GAAGK,OAAzBD,mBAGU,2BAEdE,MAAOP,EAAG,mBAEVQ,YAAaR,EAAG,yCAEhBS,KAAMhB,EAAMC,QAEZgB,SAAU,SAEVC,YACI3C,SACIxH,KAAM,SACNoF,OAAQ,SAIhBgF,UACInC,WAAW,EACXoC,iBAAiB,GAGrBrB,KAtByC,SAAAsB,GAsBP,IAA5BH,EAA4BG,EAA5BH,WAAYI,EAAgBD,EAAhBC,cACd,OAAO1C,EAAA5K,EAAAwG,cAAC+G,GAAUhD,QAAS2C,EAAW3C,QACpBP,gBAAiB,SAACE,GACdoD,GAAe/C,QAASL,QAIlDsD,KA7ByC,SAAAC,GA6BpB,IACTlD,EADSkD,EAAdP,WACK3C,QACR,OAAOK,EAAA5K,EAAAwG,cAACkG,EAAD,KAAWnC","file":"block.min.js","sourcesContent":[" \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId]) {\n \t\t\treturn installedModules[moduleId].exports;\n \t\t}\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\ti: moduleId,\n \t\t\tl: false,\n \t\t\texports: {}\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.l = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// define getter function for harmony exports\n \t__webpack_require__.d = function(exports, name, getter) {\n \t\tif(!__webpack_require__.o(exports, name)) {\n \t\t\tObject.defineProperty(exports, name, { enumerable: true, get: getter });\n \t\t}\n \t};\n\n \t// define __esModule on exports\n \t__webpack_require__.r = function(exports) {\n \t\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n \t\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n \t\t}\n \t\tObject.defineProperty(exports, '__esModule', { value: true });\n \t};\n\n \t// create a fake namespace object\n \t// mode & 1: value is a module id, require it\n \t// mode & 2: merge all properties of value into the ns\n \t// mode & 4: return value when already ns object\n \t// mode & 8|1: behave like require\n \t__webpack_require__.t = function(value, mode) {\n \t\tif(mode & 1) value = __webpack_require__(value);\n \t\tif(mode & 8) return value;\n \t\tif((mode & 4) && typeof value === 'object' && value && value.__esModule) return value;\n \t\tvar ns = Object.create(null);\n \t\t__webpack_require__.r(ns);\n \t\tObject.defineProperty(ns, 'default', { enumerable: true, value: value });\n \t\tif(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key));\n \t\treturn ns;\n \t};\n\n \t// getDefaultExport function for compatibility with non-harmony modules\n \t__webpack_require__.n = function(module) {\n \t\tvar getter = module && module.__esModule ?\n \t\t\tfunction getDefault() { return module['default']; } :\n \t\t\tfunction getModuleExports() { return module; };\n \t\t__webpack_require__.d(getter, 'a', getter);\n \t\treturn getter;\n \t};\n\n \t// Object.prototype.hasOwnProperty.call\n \t__webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(__webpack_require__.s = 3);\n","'use strict';\n\nif (process.env.NODE_ENV === 'production') {\n module.exports = require('./cjs/react.production.min.js');\n} else {\n module.exports = require('./cjs/react.development.js');\n}\n","/** @license React v16.6.1\n * react.production.min.js\n *\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n */\n\n'use strict';var k=require(\"object-assign\"),n=\"function\"===typeof Symbol&&Symbol.for,p=n?Symbol.for(\"react.element\"):60103,q=n?Symbol.for(\"react.portal\"):60106,r=n?Symbol.for(\"react.fragment\"):60107,t=n?Symbol.for(\"react.strict_mode\"):60108,u=n?Symbol.for(\"react.profiler\"):60114,v=n?Symbol.for(\"react.provider\"):60109,w=n?Symbol.for(\"react.context\"):60110,x=n?Symbol.for(\"react.concurrent_mode\"):60111,y=n?Symbol.for(\"react.forward_ref\"):60112,z=n?Symbol.for(\"react.suspense\"):60113,A=n?Symbol.for(\"react.memo\"):\n60115,B=n?Symbol.for(\"react.lazy\"):60116,C=\"function\"===typeof Symbol&&Symbol.iterator;function aa(a,b,e,c,d,g,h,f){if(!a){a=void 0;if(void 0===b)a=Error(\"Minified exception occurred; use the non-minified dev environment for the full error message and additional helpful warnings.\");else{var l=[e,c,d,g,h,f],m=0;a=Error(b.replace(/%s/g,function(){return l[m++]}));a.name=\"Invariant Violation\"}a.framesToPop=1;throw a;}}\nfunction D(a){for(var b=arguments.length-1,e=\"https://reactjs.org/docs/error-decoder.html?invariant=\"+a,c=0;c<b;c++)e+=\"&args[]=\"+encodeURIComponent(arguments[c+1]);aa(!1,\"Minified React error #\"+a+\"; visit %s for the full message or use the non-minified dev environment for full errors and additional helpful warnings. \",e)}var E={isMounted:function(){return!1},enqueueForceUpdate:function(){},enqueueReplaceState:function(){},enqueueSetState:function(){}},F={};\nfunction G(a,b,e){this.props=a;this.context=b;this.refs=F;this.updater=e||E}G.prototype.isReactComponent={};G.prototype.setState=function(a,b){\"object\"!==typeof a&&\"function\"!==typeof a&&null!=a?D(\"85\"):void 0;this.updater.enqueueSetState(this,a,b,\"setState\")};G.prototype.forceUpdate=function(a){this.updater.enqueueForceUpdate(this,a,\"forceUpdate\")};function H(){}H.prototype=G.prototype;function I(a,b,e){this.props=a;this.context=b;this.refs=F;this.updater=e||E}var J=I.prototype=new H;\nJ.constructor=I;k(J,G.prototype);J.isPureReactComponent=!0;var K={current:null,currentDispatcher:null},L=Object.prototype.hasOwnProperty,M={key:!0,ref:!0,__self:!0,__source:!0};\nfunction N(a,b,e){var c=void 0,d={},g=null,h=null;if(null!=b)for(c in void 0!==b.ref&&(h=b.ref),void 0!==b.key&&(g=\"\"+b.key),b)L.call(b,c)&&!M.hasOwnProperty(c)&&(d[c]=b[c]);var f=arguments.length-2;if(1===f)d.children=e;else if(1<f){for(var l=Array(f),m=0;m<f;m++)l[m]=arguments[m+2];d.children=l}if(a&&a.defaultProps)for(c in f=a.defaultProps,f)void 0===d[c]&&(d[c]=f[c]);return{$$typeof:p,type:a,key:g,ref:h,props:d,_owner:K.current}}\nfunction ba(a,b){return{$$typeof:p,type:a.type,key:b,ref:a.ref,props:a.props,_owner:a._owner}}function O(a){return\"object\"===typeof a&&null!==a&&a.$$typeof===p}function escape(a){var b={\"=\":\"=0\",\":\":\"=2\"};return\"$\"+(\"\"+a).replace(/[=:]/g,function(a){return b[a]})}var P=/\\/+/g,Q=[];function R(a,b,e,c){if(Q.length){var d=Q.pop();d.result=a;d.keyPrefix=b;d.func=e;d.context=c;d.count=0;return d}return{result:a,keyPrefix:b,func:e,context:c,count:0}}\nfunction S(a){a.result=null;a.keyPrefix=null;a.func=null;a.context=null;a.count=0;10>Q.length&&Q.push(a)}\nfunction T(a,b,e,c){var d=typeof a;if(\"undefined\"===d||\"boolean\"===d)a=null;var g=!1;if(null===a)g=!0;else switch(d){case \"string\":case \"number\":g=!0;break;case \"object\":switch(a.$$typeof){case p:case q:g=!0}}if(g)return e(c,a,\"\"===b?\".\"+U(a,0):b),1;g=0;b=\"\"===b?\".\":b+\":\";if(Array.isArray(a))for(var h=0;h<a.length;h++){d=a[h];var f=b+U(d,h);g+=T(d,f,e,c)}else if(null===a||\"object\"!==typeof a?f=null:(f=C&&a[C]||a[\"@@iterator\"],f=\"function\"===typeof f?f:null),\"function\"===typeof f)for(a=f.call(a),h=\n0;!(d=a.next()).done;)d=d.value,f=b+U(d,h++),g+=T(d,f,e,c);else\"object\"===d&&(e=\"\"+a,D(\"31\",\"[object Object]\"===e?\"object with keys {\"+Object.keys(a).join(\", \")+\"}\":e,\"\"));return g}function V(a,b,e){return null==a?0:T(a,\"\",b,e)}function U(a,b){return\"object\"===typeof a&&null!==a&&null!=a.key?escape(a.key):b.toString(36)}function ca(a,b){a.func.call(a.context,b,a.count++)}\nfunction da(a,b,e){var c=a.result,d=a.keyPrefix;a=a.func.call(a.context,b,a.count++);Array.isArray(a)?W(a,c,e,function(a){return a}):null!=a&&(O(a)&&(a=ba(a,d+(!a.key||b&&b.key===a.key?\"\":(\"\"+a.key).replace(P,\"$&/\")+\"/\")+e)),c.push(a))}function W(a,b,e,c,d){var g=\"\";null!=e&&(g=(\"\"+e).replace(P,\"$&/\")+\"/\");b=R(b,g,c,d);V(a,da,b);S(b)}\nvar X={Children:{map:function(a,b,e){if(null==a)return a;var c=[];W(a,c,null,b,e);return c},forEach:function(a,b,e){if(null==a)return a;b=R(null,null,b,e);V(a,ca,b);S(b)},count:function(a){return V(a,function(){return null},null)},toArray:function(a){var b=[];W(a,b,null,function(a){return a});return b},only:function(a){O(a)?void 0:D(\"143\");return a}},createRef:function(){return{current:null}},Component:G,PureComponent:I,createContext:function(a,b){void 0===b&&(b=null);a={$$typeof:w,_calculateChangedBits:b,\n_currentValue:a,_currentValue2:a,_threadCount:0,Provider:null,Consumer:null};a.Provider={$$typeof:v,_context:a};return a.Consumer=a},forwardRef:function(a){return{$$typeof:y,render:a}},lazy:function(a){return{$$typeof:B,_ctor:a,_status:-1,_result:null}},memo:function(a,b){return{$$typeof:A,type:a,compare:void 0===b?null:b}},Fragment:r,StrictMode:t,Suspense:z,createElement:N,cloneElement:function(a,b,e){null===a||void 0===a?D(\"267\",a):void 0;var c=void 0,d=k({},a.props),g=a.key,h=a.ref,f=a._owner;\nif(null!=b){void 0!==b.ref&&(h=b.ref,f=K.current);void 0!==b.key&&(g=\"\"+b.key);var l=void 0;a.type&&a.type.defaultProps&&(l=a.type.defaultProps);for(c in b)L.call(b,c)&&!M.hasOwnProperty(c)&&(d[c]=void 0===b[c]&&void 0!==l?l[c]:b[c])}c=arguments.length-2;if(1===c)d.children=e;else if(1<c){l=Array(c);for(var m=0;m<c;m++)l[m]=arguments[m+2];d.children=l}return{$$typeof:p,type:a.type,key:g,ref:h,props:d,_owner:f}},createFactory:function(a){var b=N.bind(null,a);b.type=a;return b},isValidElement:O,version:\"16.6.3\",\n__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED:{ReactCurrentOwner:K,assign:k}};X.unstable_ConcurrentMode=x;X.unstable_Profiler=u;var Y={default:X},Z=Y&&X||Y;module.exports=Z.default||Z;\n","/*\nobject-assign\n(c) Sindre Sorhus\n@license MIT\n*/\n\n'use strict';\n/* eslint-disable no-unused-vars */\nvar getOwnPropertySymbols = Object.getOwnPropertySymbols;\nvar hasOwnProperty = Object.prototype.hasOwnProperty;\nvar propIsEnumerable = Object.prototype.propertyIsEnumerable;\n\nfunction toObject(val) {\n\tif (val === null || val === undefined) {\n\t\tthrow new TypeError('Object.assign cannot be called with null or undefined');\n\t}\n\n\treturn Object(val);\n}\n\nfunction shouldUseNative() {\n\ttry {\n\t\tif (!Object.assign) {\n\t\t\treturn false;\n\t\t}\n\n\t\t// Detect buggy property enumeration order in older V8 versions.\n\n\t\t// https://bugs.chromium.org/p/v8/issues/detail?id=4118\n\t\tvar test1 = new String('abc'); // eslint-disable-line no-new-wrappers\n\t\ttest1[5] = 'de';\n\t\tif (Object.getOwnPropertyNames(test1)[0] === '5') {\n\t\t\treturn false;\n\t\t}\n\n\t\t// https://bugs.chromium.org/p/v8/issues/detail?id=3056\n\t\tvar test2 = {};\n\t\tfor (var i = 0; i < 10; i++) {\n\t\t\ttest2['_' + String.fromCharCode(i)] = i;\n\t\t}\n\t\tvar order2 = Object.getOwnPropertyNames(test2).map(function (n) {\n\t\t\treturn test2[n];\n\t\t});\n\t\tif (order2.join('') !== '0123456789') {\n\t\t\treturn false;\n\t\t}\n\n\t\t// https://bugs.chromium.org/p/v8/issues/detail?id=3056\n\t\tvar test3 = {};\n\t\t'abcdefghijklmnopqrst'.split('').forEach(function (letter) {\n\t\t\ttest3[letter] = letter;\n\t\t});\n\t\tif (Object.keys(Object.assign({}, test3)).join('') !==\n\t\t\t\t'abcdefghijklmnopqrst') {\n\t\t\treturn false;\n\t\t}\n\n\t\treturn true;\n\t} catch (err) {\n\t\t// We don't expect any of the above to throw, but better to be safe.\n\t\treturn false;\n\t}\n}\n\nmodule.exports = shouldUseNative() ? Object.assign : function (target, source) {\n\tvar from;\n\tvar to = toObject(target);\n\tvar symbols;\n\n\tfor (var s = 1; s < arguments.length; s++) {\n\t\tfrom = Object(arguments[s]);\n\n\t\tfor (var key in from) {\n\t\t\tif (hasOwnProperty.call(from, key)) {\n\t\t\t\tto[key] = from[key];\n\t\t\t}\n\t\t}\n\n\t\tif (getOwnPropertySymbols) {\n\t\t\tsymbols = getOwnPropertySymbols(from);\n\t\t\tfor (var i = 0; i < symbols.length; i++) {\n\t\t\t\tif (propIsEnumerable.call(from, symbols[i])) {\n\t\t\t\t\tto[symbols[i]] = from[symbols[i]];\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\treturn to;\n};\n","import React from 'react';\n\nconst body = document.body;\n\nclass NGGModal extends React.Component {\n\n constructor(props) {\n super(props)\n this.closeModal = this.closeModal.bind(this);\n\n this.background_layer = document.createElement('div');\n this.background_layer.setAttribute('id', 'add-ngg-gallery-modal-background');\n }\n\n componentDidMount() {\n body.style.overflow = 'hidden';\n body.appendChild(this.background_layer);\n\n const self = this;\n\n const iframe = document.getElementById('add-ngg-gallery-block-iframe');\n\n iframe.addEventListener('NGG_Iframe_Ready', function() {\n document.getElementById(\"add-ngg-gallery-modal-spinner\").classList.add(\"add-ngg-gallery-modal-spinner-hidden\");\n });\n\n iframe.addEventListener('NGG_Insert_Gallery', function(event) {\n self.props.onInsertGallery(event.detail.shortcode);\n\n })\n\n iframe.addEventListener('NGG_Close_Modal', function() {\n self.props.onCloseModal();\n })\n }\n\n componentWillUnmount() {\n body.style.overflow = 'auto';\n body.removeChild(this.background_layer);\n }\n\n closeModal() {\n this.props.onCloseModal();\n }\n\n render() {\n let attach_to_post_url = nextgen_gallery_attach_to_post_url + '&origin=block';\n\n if (this.props.content) {\n attach_to_post_url += '&shortcode=';\n let shortcode = this.props.content.replace(/\\\\\"/g, '\"');\n shortcode = shortcode.replace(/^\\[ngg_images/, '');\n shortcode = shortcode.replace(/^\\[ngg/, '');\n shortcode = shortcode.replace(/]$/, '');\n attach_to_post_url += Base64.encode(shortcode);\n }\n\n // use createPortal to insert the modal div as a child of <body> to prevent the WP-Admin sidebar\n // menu from getting in the way and causing annoying z-index issues\n return ReactDOM.createPortal(\n <div id=\"add-ngg-gallery-modal\">\n <a href='#'\n id='add-ngg-gallery-modal-close'\n onClick={this.closeModal}>\n <span className=\"dashicons dashicons-no\"/>\n </a>\n <div id=\"add-ngg-gallery-modal-spinner\">\n <i className=\"fa fa-spin fa-spinner\"/>\n </div>\n <iframe src={attach_to_post_url}\n tabIndex=\"-1\"\n name=\"add-ngg-gallery-block-iframe\"\n id=\"add-ngg-gallery-block-iframe\"/>\n </div>,\n body\n );\n }\n\n}\n\nexport default class NGGEditor extends React.Component {\n\n constructor(props) {\n super(props)\n\n this.state = {\n open: false\n }\n\n this.openIGW = this.openIGW.bind(this);\n this.closeIGW = this.closeIGW.bind(this);\n this.removeGallery = this.removeGallery.bind(this);\n }\n\n hasGallery() {\n return this.props.content && this.props.content.length > 0\n }\n\n removeGallery() {\n this.props.onInsertGallery('');\n }\n\n closeIGW() {\n this.setState({\n open: false\n });\n }\n\n openIGW() {\n this.setState({\n open: true\n });\n }\n\n render() {\n return (\n <div className=\"add-ngg-gallery-parent\">\n {this.state.open ?\n <NGGModal content={this.props.content}\n onCloseModal={this.closeIGW}\n onInsertGallery={this.props.onInsertGallery}/>\n : ''\n }\n {this.hasGallery() ?\n <div className=\"add-ngg-gallery-block\">\n <h3>{add_ngg_gallery_block_i18n.h3}</h3>\n <button className=\"add-ngg-gallery-button\"\n onClick={this.openIGW}>\n {add_ngg_gallery_block_i18n.edit}\n </button>\n <button className=\"add-ngg-gallery-button\"\n onClick={this.removeGallery}>\n {add_ngg_gallery_block_i18n.delete}\n </button>\n </div>\n :\n <div className=\"add-ngg-gallery-block\">\n <div className=\"add-ngg-gallery-button\"\n onClick={this.openIGW}>\n {add_ngg_gallery_block_i18n.create}\n </div>\n </div>\n }\n </div>\n )\n }\n}","const icons = {};\n\nicons.nextgen =\n<svg xmlns=\"http://www.w3.org/2000/svg\" version=\"1.1\" viewBox=\"0 0 240 240\" width=\"240.0pt\" height=\"240.0pt\">\n<path d=\"M 0.00 0.00 L 240.00 0.00 L 240.00 240.00 L 0.00 240.00 L 0.00 0.00 Z\" fill=\"#ffffff\" />\n<path d=\"M 116.97 3.45 C 155.78 2.17 194.29 21.78 215.90 54.07 C 226.92 70.43 234.08 89.34 236.07 109.00 C 239.08 140.20 228.61 172.42 208.14 196.12 C 191.73 215.41 168.66 228.79 143.97 234.16 C 125.25 238.08 105.37 237.44 87.04 231.86 C 67.00 226.07 48.82 214.65 34.69 199.32 C 14.08 177.26 2.88 147.13 3.50 117.00 C 4.36 95.58 10.72 74.49 22.55 56.55 C 35.03 37.69 52.63 22.36 73.52 13.50 C 87.07 6.87 101.94 3.80 116.97 3.45 Z\" fill=\"#9fbb1a\" />\n<path d=\"M 69.17 61.47 C 70.78 61.56 72.37 61.91 73.97 62.05 C 80.30 62.27 86.66 62.04 93.00 62.14 C 96.81 62.23 100.65 61.35 104.18 62.75 C 108.45 64.30 111.62 68.44 111.67 73.03 C 111.78 81.35 111.66 89.68 111.72 98.00 C 111.65 101.03 111.87 104.65 110.30 107.35 C 108.22 110.91 104.17 113.41 100.02 113.40 C 90.68 113.43 81.33 113.42 71.99 113.40 C 65.66 113.41 59.85 108.54 59.66 102.04 C 59.55 92.36 59.70 82.67 59.58 72.99 C 59.41 67.44 63.60 62.15 69.17 61.47 Z\" fill=\"#ffffff\" />\n<path d=\"M 138.98 61.27 C 148.33 61.42 157.69 61.22 167.04 61.37 C 173.28 61.31 178.81 66.69 178.70 72.96 C 178.72 82.65 178.75 92.34 178.68 102.02 C 178.48 108.28 173.18 112.96 167.02 113.04 C 157.69 113.25 148.33 113.02 138.99 113.15 C 132.77 113.56 126.76 108.35 126.66 102.04 C 126.55 94.37 126.67 86.68 126.62 79.00 C 126.63 76.33 126.42 73.60 126.72 70.94 C 127.60 65.24 133.25 60.88 138.98 61.27 Z\" fill=\"#ffffff\" />\n<path d=\"M 70.97 72.97 C 80.41 72.70 89.87 72.92 99.31 72.86 C 99.39 82.36 99.34 91.87 99.34 101.38 C 89.85 101.36 80.36 101.42 70.87 101.35 C 70.90 91.90 70.70 82.42 70.97 72.97 Z\" fill=\"#9fbb1a\" />\n<path d=\"M 138.39 72.91 C 147.80 72.79 157.23 72.85 166.65 72.88 C 166.65 82.41 166.85 91.97 166.55 101.49 C 157.18 101.27 147.79 101.39 138.41 101.42 C 138.30 91.92 138.36 82.41 138.39 72.91 Z\" fill=\"#9fbb1a\" />\n<path d=\"M 69.96 128.72 C 77.95 128.35 86.00 128.68 94.00 128.66 C 97.84 128.75 101.40 128.12 104.93 129.93 C 109.12 131.86 111.63 136.43 111.39 141.00 C 111.31 150.34 111.48 159.70 111.31 169.04 C 111.25 175.45 105.33 180.72 99.01 180.44 C 90.00 180.43 81.00 180.42 71.99 180.44 C 67.16 180.64 62.37 177.99 60.28 173.57 C 59.04 171.04 59.32 167.76 59.27 165.00 C 59.38 156.70 59.15 148.39 59.37 140.10 C 59.59 134.25 64.10 129.27 69.96 128.72 Z\" fill=\"#ffffff\" />\n<path d=\"M 137.96 128.68 C 146.96 128.36 156.00 128.45 165.00 128.61 C 167.68 128.64 170.26 129.00 172.61 130.36 C 176.44 132.46 178.51 136.68 178.41 140.99 C 178.39 150.33 178.47 159.67 178.37 169.01 C 178.48 174.84 173.95 180.48 167.95 180.68 C 159.31 180.89 150.65 180.67 142.00 180.78 C 139.64 180.74 137.05 180.91 134.76 180.27 C 129.71 178.66 126.48 173.17 126.62 168.01 C 126.61 161.01 126.64 154.00 126.62 147.00 C 126.71 143.40 126.11 139.00 127.75 135.73 C 129.57 131.70 133.51 128.85 137.96 128.68 Z\" fill=\"#ffffff\" />\n<path d=\"M 70.98 140.01 C 80.41 139.71 89.87 139.94 99.31 139.89 C 99.40 149.41 99.33 158.93 99.35 168.45 C 89.85 168.43 80.36 168.47 70.86 168.42 C 70.91 158.96 70.69 149.47 70.98 140.01 Z\" fill=\"#9fbb1a\" />\n<path d=\"M 138.45 140.41 C 147.84 140.29 157.27 140.44 166.67 140.35 C 166.70 149.82 166.71 159.29 166.67 168.77 C 157.24 168.71 147.81 168.71 138.38 168.77 C 138.39 159.32 138.24 149.85 138.45 140.41 Z\" fill=\"#9fbb1a\" />\n</svg>\n\nexport default icons;","import NGGEditor from './edit.jsx'\nimport icons from './icons.min';\nimport React from 'react';\n\nconst { __ } \t\t\t\t= wp.i18n\nconst { RawHTML } \t = wp.element\nconst { registerBlockType } = wp.blocks\n\n// Register our block\nregisterBlockType('imagely/nextgen-gallery', {\n\n title: __('NextGEN Gallery'),\n\n description: __('A block for adding NextGEN Galleries.'),\n\n icon: icons.nextgen,\n\n category: 'common',\n\n attributes: {\n content: {\n type: 'string',\n source: 'html',\n },\n },\n\n supports: {\n className: false,\n customClassName: false,\n },\n\n edit({attributes, setAttributes}) {\n return <NGGEditor content={attributes.content}\n onInsertGallery={(shortcode) => {\n setAttributes({content: shortcode});\n }}/>\n },\n\n save({ attributes }) {\n const { content } = attributes;\n return <RawHTML>{ content }</RawHTML>\n }\n});"],"sourceRoot":""}
|
products/photocrati_nextgen/modules/nextgen_block/static/build/post-thumbnail.min.js
CHANGED
|
@@ -1,2 +1,15 @@
|
|
| 1 |
-
!function(t){var e={};function r(n){if(e[n])return e[n].exports;var o=e[n]={i:n,l:!1,exports:{}};return t[n].call(o.exports,o,o.exports,r),o.l=!0,o.exports}r.m=t,r.c=e,r.d=function(t,e,n){r.o(t,e)||Object.defineProperty(t,e,{enumerable:!0,get:n})},r.r=function(t){"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(t,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(t,"__esModule",{value:!0})},r.t=function(t,e){if(1&e&&(t=r(t)),8&e)return t;if(4&e&&"object"==typeof t&&t&&t.__esModule)return t;var n=Object.create(null);if(r.r(n),Object.defineProperty(n,"default",{enumerable:!0,value:t}),2&e&&"string"!=typeof t)for(var o in t)r.d(n,o,function(e){return t[e]}.bind(null,o));return n},r.n=function(t){var e=t&&t.__esModule?function(){return t.default}:function(){return t};return r.d(e,"a",e),e},r.o=function(t,e){return Object.prototype.hasOwnProperty.call(t,e)},r.p="",r(r.s=3)}([function(t,e,r){(function(t){function e(t){return(e="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&"function"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?"symbol":typeof t})(t)}var r=function(t){function e(){this.fetch=!1}return e.prototype=t,new e}("undefined"!=typeof self?self:this);(function(t){!function(t){if(!t.fetch){var e={searchParams:"URLSearchParams"in t,iterable:"Symbol"in t&&"iterator"in Symbol,blob:"FileReader"in t&&"Blob"in t&&function(){try{return new Blob,!0}catch(t){return!1}}(),formData:"FormData"in t,arrayBuffer:"ArrayBuffer"in t};if(e.arrayBuffer)var r=["[object Int8Array]","[object Uint8Array]","[object Uint8ClampedArray]","[object Int16Array]","[object Uint16Array]","[object Int32Array]","[object Uint32Array]","[object Float32Array]","[object Float64Array]"],n=function(t){return t&&DataView.prototype.isPrototypeOf(t)},o=ArrayBuffer.isView||function(t){return t&&r.indexOf(Object.prototype.toString.call(t))>-1};f.prototype.append=function(t,e){t=s(t),e=u(e);var r=this.map[t];this.map[t]=r?r+","+e:e},f.prototype.delete=function(t){delete this.map[s(t)]},f.prototype.get=function(t){return t=s(t),this.has(t)?this.map[t]:null},f.prototype.has=function(t){return this.map.hasOwnProperty(s(t))},f.prototype.set=function(t,e){this.map[s(t)]=u(e)},f.prototype.forEach=function(t,e){for(var r in this.map)this.map.hasOwnProperty(r)&&t.call(e,this.map[r],r,this)},f.prototype.keys=function(){var t=[];return this.forEach(function(e,r){t.push(r)}),c(t)},f.prototype.values=function(){var t=[];return this.forEach(function(e){t.push(e)}),c(t)},f.prototype.entries=function(){var t=[];return this.forEach(function(e,r){t.push([r,e])}),c(t)},e.iterable&&(f.prototype[Symbol.iterator]=f.prototype.entries);var i=["DELETE","GET","HEAD","OPTIONS","POST","PUT"];m.prototype.clone=function(){return new m(this,{body:this._bodyInit})},y.call(m.prototype),y.call(g.prototype),g.prototype.clone=function(){return new g(this._bodyInit,{status:this.status,statusText:this.statusText,headers:new f(this.headers),url:this.url})},g.error=function(){var t=new g(null,{status:0,statusText:""});return t.type="error",t};var a=[301,302,303,307,308];g.redirect=function(t,e){if(-1===a.indexOf(e))throw new RangeError("Invalid status code");return new g(null,{status:e,headers:{location:t}})},t.Headers=f,t.Request=m,t.Response=g,t.fetch=function(t,r){return new Promise(function(n,o){var i=new m(t,r),a=new XMLHttpRequest;a.onload=function(){var t={status:a.status,statusText:a.statusText,headers:function(t){var e=new f;return t.replace(/\r?\n[\t ]+/g," ").split(/\r?\n/).forEach(function(t){var r=t.split(":"),n=r.shift().trim();if(n){var o=r.join(":").trim();e.append(n,o)}}),e}(a.getAllResponseHeaders()||"")};t.url="responseURL"in a?a.responseURL:t.headers.get("X-Request-URL");var e="response"in a?a.response:a.responseText;n(new g(e,t))},a.onerror=function(){o(new TypeError("Network request failed"))},a.ontimeout=function(){o(new TypeError("Network request failed"))},a.open(i.method,i.url,!0),"include"===i.credentials?a.withCredentials=!0:"omit"===i.credentials&&(a.withCredentials=!1),"responseType"in a&&e.blob&&(a.responseType="blob"),i.headers.forEach(function(t,e){a.setRequestHeader(e,t)}),a.send(void 0===i._bodyInit?null:i._bodyInit)})},t.fetch.polyfill=!0}function s(t){if("string"!=typeof t&&(t=String(t)),/[^a-z0-9\-#$%&'*+.\^_`|~]/i.test(t))throw new TypeError("Invalid character in header field name");return t.toLowerCase()}function u(t){return"string"!=typeof t&&(t=String(t)),t}function c(t){var r={next:function(){var e=t.shift();return{done:void 0===e,value:e}}};return e.iterable&&(r[Symbol.iterator]=function(){return r}),r}function f(t){this.map={},t instanceof f?t.forEach(function(t,e){this.append(e,t)},this):Array.isArray(t)?t.forEach(function(t){this.append(t[0],t[1])},this):t&&Object.getOwnPropertyNames(t).forEach(function(e){this.append(e,t[e])},this)}function l(t){if(t.bodyUsed)return Promise.reject(new TypeError("Already read"));t.bodyUsed=!0}function p(t){return new Promise(function(e,r){t.onload=function(){e(t.result)},t.onerror=function(){r(t.error)}})}function d(t){var e=new FileReader,r=p(e);return e.readAsArrayBuffer(t),r}function h(t){if(t.slice)return t.slice(0);var e=new Uint8Array(t.byteLength);return e.set(new Uint8Array(t)),e.buffer}function y(){return this.bodyUsed=!1,this._initBody=function(t){if(this._bodyInit=t,t)if("string"==typeof t)this._bodyText=t;else if(e.blob&&Blob.prototype.isPrototypeOf(t))this._bodyBlob=t;else if(e.formData&&FormData.prototype.isPrototypeOf(t))this._bodyFormData=t;else if(e.searchParams&&URLSearchParams.prototype.isPrototypeOf(t))this._bodyText=t.toString();else if(e.arrayBuffer&&e.blob&&n(t))this._bodyArrayBuffer=h(t.buffer),this._bodyInit=new Blob([this._bodyArrayBuffer]);else{if(!e.arrayBuffer||!ArrayBuffer.prototype.isPrototypeOf(t)&&!o(t))throw new Error("unsupported BodyInit type");this._bodyArrayBuffer=h(t)}else this._bodyText="";this.headers.get("content-type")||("string"==typeof t?this.headers.set("content-type","text/plain;charset=UTF-8"):this._bodyBlob&&this._bodyBlob.type?this.headers.set("content-type",this._bodyBlob.type):e.searchParams&&URLSearchParams.prototype.isPrototypeOf(t)&&this.headers.set("content-type","application/x-www-form-urlencoded;charset=UTF-8"))},e.blob&&(this.blob=function(){var t=l(this);if(t)return t;if(this._bodyBlob)return Promise.resolve(this._bodyBlob);if(this._bodyArrayBuffer)return Promise.resolve(new Blob([this._bodyArrayBuffer]));if(this._bodyFormData)throw new Error("could not read FormData body as blob");return Promise.resolve(new Blob([this._bodyText]))},this.arrayBuffer=function(){return this._bodyArrayBuffer?l(this)||Promise.resolve(this._bodyArrayBuffer):this.blob().then(d)}),this.text=function(){var t=l(this);if(t)return t;if(this._bodyBlob)return function(t){var e=new FileReader,r=p(e);return e.readAsText(t),r}(this._bodyBlob);if(this._bodyArrayBuffer)return Promise.resolve(function(t){for(var e=new Uint8Array(t),r=new Array(e.length),n=0;n<e.length;n++)r[n]=String.fromCharCode(e[n]);return r.join("")}(this._bodyArrayBuffer));if(this._bodyFormData)throw new Error("could not read FormData body as text");return Promise.resolve(this._bodyText)},e.formData&&(this.formData=function(){return this.text().then(b)}),this.json=function(){return this.text().then(JSON.parse)},this}function m(t,e){var r=(e=e||{}).body;if(t instanceof m){if(t.bodyUsed)throw new TypeError("Already read");this.url=t.url,this.credentials=t.credentials,e.headers||(this.headers=new f(t.headers)),this.method=t.method,this.mode=t.mode,r||null==t._bodyInit||(r=t._bodyInit,t.bodyUsed=!0)}else this.url=String(t);if(this.credentials=e.credentials||this.credentials||"omit",!e.headers&&this.headers||(this.headers=new f(e.headers)),this.method=function(t){var e=t.toUpperCase();return i.indexOf(e)>-1?e:t}(e.method||this.method||"GET"),this.mode=e.mode||this.mode||null,this.referrer=null,("GET"===this.method||"HEAD"===this.method)&&r)throw new TypeError("Body not allowed for GET or HEAD requests");this._initBody(r)}function b(t){var e=new FormData;return t.trim().split("&").forEach(function(t){if(t){var r=t.split("="),n=r.shift().replace(/\+/g," "),o=r.join("=").replace(/\+/g," ");e.append(decodeURIComponent(n),decodeURIComponent(o))}}),e}function g(t,e){e||(e={}),this.type="default",this.status=void 0===e.status?200:e.status,this.ok=this.status>=200&&this.status<300,this.statusText="statusText"in e?e.statusText:"OK",this.headers=new f(e.headers),this.url=e.url||"",this._initBody(t)}}(void 0!==t?t:this)}).call(r,void 0);var n=r.fetch;n.Response=r.Response,n.Request=r.Request,n.Headers=r.Headers;"object"===e(t)&&t.exports&&(t.exports=n,t.exports.default=n)}).call(this,r(2)(t))},function(t,e){function r(t){return(r="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&"function"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?"symbol":typeof t})(t)}t.exports="object"==("undefined"==typeof self?"undefined":r(self))?self.FormData:window.FormData},function(t,e){t.exports=function(t){return t.webpackPolyfill||(t.deprecate=function(){},t.paths=[],t.children||(t.children=[]),Object.defineProperty(t,"loaded",{enumerable:!0,get:function(){return t.l}}),Object.defineProperty(t,"id",{enumerable:!0,get:function(){return t.i}}),t.webpackPolyfill=1),t}},function(t,e,r){"use strict";r.r(e);var n=r(0),o=r.n(n),i=r(1),a=r.n(i);function s(t){return(s="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&"function"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?"symbol":typeof t})(t)}function u(t){for(var e=1;e<arguments.length;e++){var r=null!=arguments[e]?arguments[e]:{},n=Object.keys(r);"function"==typeof Object.getOwnPropertySymbols&&(n=n.concat(Object.getOwnPropertySymbols(r).filter(function(t){return Object.getOwnPropertyDescriptor(r,t).enumerable}))),n.forEach(function(e){g(t,e,r[e])})}return t}function c(){return(c=Object.assign||function(t){for(var e=1;e<arguments.length;e++){var r=arguments[e];for(var n in r)Object.prototype.hasOwnProperty.call(r,n)&&(t[n]=r[n])}return t}).apply(this,arguments)}function f(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}function l(t,e){for(var r=0;r<e.length;r++){var n=e[r];n.enumerable=n.enumerable||!1,n.configurable=!0,"value"in n&&(n.writable=!0),Object.defineProperty(t,n.key,n)}}function p(t,e,r){return e&&l(t.prototype,e),r&&l(t,r),t}function d(t,e){return!e||"object"!==s(e)&&"function"!=typeof e?b(t):e}function h(t){return(h=Object.setPrototypeOf?Object.getPrototypeOf:function(t){return t.__proto__||Object.getPrototypeOf(t)})(t)}function y(t,e){if("function"!=typeof e&&null!==e)throw new TypeError("Super expression must either be null or a function");t.prototype=Object.create(e&&e.prototype,{constructor:{value:t,writable:!0,configurable:!0}}),e&&m(t,e)}function m(t,e){return(m=Object.setPrototypeOf||function(t,e){return t.__proto__=e,t})(t,e)}function b(t){if(void 0===t)throw new ReferenceError("this hasn't been initialised - super() hasn't been called");return t}function g(t,e,r){return e in t?Object.defineProperty(t,e,{value:r,enumerable:!0,configurable:!0,writable:!0}):t[e]=r,t}var w=wp.element,v=w.Fragment,_=w.Component,P=wp.data,O=P.withSelect,E=P.withDispatch,x=wp.compose.compose,T=wp.components.Button,S=wp.i18n.__,j=lodash.property,A=function(t){function e(){var t,r;f(this,e);for(var n=arguments.length,i=new Array(n),s=0;s<n;s++)i[s]=arguments[s];return g(b(b(r=d(this,(t=h(e)).call.apply(t,[this].concat(i))))),"state",{image_url:null,msg:S("Loading...")}),g(b(b(r)),"updateImageUrl",function(){r.getImageUrl(r.props.image_id).then(function(t){return r.setState({image_url:t})}).catch(function(t){return console.log(t)&&r.setState({msg:S("Could not load image")})})}),g(b(b(r)),"getImageUrl",function(t){var e=new a.a;return e.append("action","get_image"),e.append("image_id",t),o()(photocrati_ajax.url,{method:"POST",body:e,headers:{Accept:"application/json"}}).then(function(t){return t.json()}).then(j("image.image_url"))}),r}return y(e,_),p(e,[{key:"componentDidUpdate",value:function(t){this.props.image_id!=t.image_id&&this.updateImageUrl()}},{key:"componentDidMount",value:function(){this.updateImageUrl()}},{key:"render",value:function(){var t=this.state.msg,e=this.state.image_url?React.createElement("img",{src:this.state.image_url}):React.createElement("span",null,t);return React.createElement("div",{style:{paddingTop:"5px",paddingBottom:"5px"}},e)}}]),e}(),B=function(t){function e(){var t,r;f(this,e);for(var n=arguments.length,o=new Array(n),i=0;i<n;i++)o[i]=arguments[i];return g(b(b(r=d(this,(t=h(e)).call.apply(t,[this].concat(o))))),"handleOpenClick",function(t){var e=r.props.currentPostId;top.set_ngg_post_thumbnail=r.onUpdatePostThumbnail,tb_show("Set NextGEN Featured Image",ngg_featured_image.modal_url.replace(/%post_id%/,e))}),g(b(b(r)),"handleRemoveClick",function(t){r.props.onRemoveNggPostThumbnail()}),g(b(b(r)),"onUpdatePostThumbnail",function(t){tb_remove(),r.props.onSetNggPostThumbnail(parseInt(t))}),r}return y(e,_),p(e,[{key:"render",value:function(){var t=this.props,e=t.PostFeaturedImage,r=t.nggPostThumbnailId;return React.createElement(v,null,!r&&React.createElement(e,this.props),React.createElement(T,{style:{marginTop:"10px"},onClick:this.handleOpenClick,className:"editor-post-featured-image__toggle"},S("Set NextGEN Featured Image")),r>0&&React.createElement("div",null,React.createElement(A,{image_id:r}),React.createElement(T,{onClick:this.handleRemoveClick,className:"is-link is-destructive"},S("Remove featured image"))))}}]),e}(),R=O(function(t){var e=t("core/editor"),r=e.getCurrentPostId,n=e.getEditedPostAttribute,o=n("featured_media"),i=n("meta"),a=void 0!==i&&i.ngg_post_thumbnail?i.ngg_post_thumbnail:null;return{currentPostId:r(),featuredImageId:o,nggPostThumbnailId:a}}),I=E(function(t){var e=t("core/editor").editPost;return{onSetNggPostThumbnail:function(t){var r=wp.data.select("core/editor").getEditedPostAttribute("meta");void 0===r&&(r={}),r.ngg_post_thumbnail=t,e(u({},r,{meta:r}))},onRemoveNggPostThumbnail:function(){var t=wp.data.select("core/editor").getEditedPostAttribute("meta");t.ngg_post_thumbnail=0,t.featured_media=0,e(u({},t,{meta:t}))}}}),U=function(t){return x(R,I)(function(t){return function(e){return React.createElement(B,c({PostFeaturedImage:t},e))}}(t))},D=lodash.memoize,F={get:function(t,e){return"isProxy"==e||("PostFeaturedImage"==e?U(function(t){return D(function(e){return t[e]})}(t)(e)):t[e])}},k={get:function(t,e){return"editor"==e&&t[e]&&!t[e].isProxy&&(t[e]=new Proxy(t[e],F)),t[e]},set:function(t,e,r){return"editor"!=e||r.isProxy||(r=new Proxy(r,F)),t[e]=r,r}};window.wp.originalEditor=window.wp.editor,window.wp=new Proxy(wp,k)}]);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2 |
//# sourceMappingURL=post-thumbnail.min.js.map
|
| 1 |
+
!function(e){var t={};function r(n){if(t[n])return t[n].exports;var o=t[n]={i:n,l:!1,exports:{}};return e[n].call(o.exports,o,o.exports,r),o.l=!0,o.exports}r.m=e,r.c=t,r.d=function(e,t,n){r.o(e,t)||Object.defineProperty(e,t,{enumerable:!0,get:n})},r.r=function(e){"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(e,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(e,"__esModule",{value:!0})},r.t=function(e,t){if(1&t&&(e=r(e)),8&t)return e;if(4&t&&"object"==typeof e&&e&&e.__esModule)return e;var n=Object.create(null);if(r.r(n),Object.defineProperty(n,"default",{enumerable:!0,value:e}),2&t&&"string"!=typeof e)for(var o in e)r.d(n,o,function(t){return e[t]}.bind(null,o));return n},r.n=function(e){var t=e&&e.__esModule?function(){return e.default}:function(){return e};return r.d(t,"a",t),t},r.o=function(e,t){return Object.prototype.hasOwnProperty.call(e,t)},r.p="",r(r.s=6)}([function(e,t,r){"use strict";e.exports=r(3)},function(e,t){function r(e){"@babel/helpers - typeof";return(r="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(e){return typeof e}:function(e){return e&&"function"==typeof Symbol&&e.constructor===Symbol&&e!==Symbol.prototype?"symbol":typeof e})(e)}e.exports="object"==("undefined"==typeof self?"undefined":r(self))?self.FormData:window.FormData},function(e,t,r){(function(e){function t(e){"@babel/helpers - typeof";return(t="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(e){return typeof e}:function(e){return e&&"function"==typeof Symbol&&e.constructor===Symbol&&e!==Symbol.prototype?"symbol":typeof e})(e)}var r=function(e){function t(){this.fetch=!1}return t.prototype=e,new t}("undefined"!=typeof self?self:this);(function(e){!function(e){if(!e.fetch){var t={searchParams:"URLSearchParams"in e,iterable:"Symbol"in e&&"iterator"in Symbol,blob:"FileReader"in e&&"Blob"in e&&function(){try{return new Blob,!0}catch(e){return!1}}(),formData:"FormData"in e,arrayBuffer:"ArrayBuffer"in e};if(t.arrayBuffer)var r=["[object Int8Array]","[object Uint8Array]","[object Uint8ClampedArray]","[object Int16Array]","[object Uint16Array]","[object Int32Array]","[object Uint32Array]","[object Float32Array]","[object Float64Array]"],n=function(e){return e&&DataView.prototype.isPrototypeOf(e)},o=ArrayBuffer.isView||function(e){return e&&r.indexOf(Object.prototype.toString.call(e))>-1};f.prototype.append=function(e,t){e=u(e),t=s(t);var r=this.map[e];this.map[e]=r?r+","+t:t},f.prototype.delete=function(e){delete this.map[u(e)]},f.prototype.get=function(e){return e=u(e),this.has(e)?this.map[e]:null},f.prototype.has=function(e){return this.map.hasOwnProperty(u(e))},f.prototype.set=function(e,t){this.map[u(e)]=s(t)},f.prototype.forEach=function(e,t){for(var r in this.map)this.map.hasOwnProperty(r)&&e.call(t,this.map[r],r,this)},f.prototype.keys=function(){var e=[];return this.forEach(function(t,r){e.push(r)}),c(e)},f.prototype.values=function(){var e=[];return this.forEach(function(t){e.push(t)}),c(e)},f.prototype.entries=function(){var e=[];return this.forEach(function(t,r){e.push([r,t])}),c(e)},t.iterable&&(f.prototype[Symbol.iterator]=f.prototype.entries);var i=["DELETE","GET","HEAD","OPTIONS","POST","PUT"];b.prototype.clone=function(){return new b(this,{body:this._bodyInit})},h.call(b.prototype),h.call(v.prototype),v.prototype.clone=function(){return new v(this._bodyInit,{status:this.status,statusText:this.statusText,headers:new f(this.headers),url:this.url})},v.error=function(){var e=new v(null,{status:0,statusText:""});return e.type="error",e};var a=[301,302,303,307,308];v.redirect=function(e,t){if(-1===a.indexOf(t))throw new RangeError("Invalid status code");return new v(null,{status:t,headers:{location:e}})},e.Headers=f,e.Request=b,e.Response=v,e.fetch=function(e,r){return new Promise(function(n,o){var i=new b(e,r),a=new XMLHttpRequest;a.onload=function(){var e={status:a.status,statusText:a.statusText,headers:function(e){var t=new f;return e.replace(/\r?\n[\t ]+/g," ").split(/\r?\n/).forEach(function(e){var r=e.split(":"),n=r.shift().trim();if(n){var o=r.join(":").trim();t.append(n,o)}}),t}(a.getAllResponseHeaders()||"")};e.url="responseURL"in a?a.responseURL:e.headers.get("X-Request-URL");var t="response"in a?a.response:a.responseText;n(new v(t,e))},a.onerror=function(){o(new TypeError("Network request failed"))},a.ontimeout=function(){o(new TypeError("Network request failed"))},a.open(i.method,i.url,!0),"include"===i.credentials?a.withCredentials=!0:"omit"===i.credentials&&(a.withCredentials=!1),"responseType"in a&&t.blob&&(a.responseType="blob"),i.headers.forEach(function(e,t){a.setRequestHeader(t,e)}),a.send(void 0===i._bodyInit?null:i._bodyInit)})},e.fetch.polyfill=!0}function u(e){if("string"!=typeof e&&(e=String(e)),/[^a-z0-9\-#$%&'*+.\^_`|~]/i.test(e))throw new TypeError("Invalid character in header field name");return e.toLowerCase()}function s(e){return"string"!=typeof e&&(e=String(e)),e}function c(e){var r={next:function(){var t=e.shift();return{done:void 0===t,value:t}}};return t.iterable&&(r[Symbol.iterator]=function(){return r}),r}function f(e){this.map={},e instanceof f?e.forEach(function(e,t){this.append(t,e)},this):Array.isArray(e)?e.forEach(function(e){this.append(e[0],e[1])},this):e&&Object.getOwnPropertyNames(e).forEach(function(t){this.append(t,e[t])},this)}function l(e){if(e.bodyUsed)return Promise.reject(new TypeError("Already read"));e.bodyUsed=!0}function p(e){return new Promise(function(t,r){e.onload=function(){t(e.result)},e.onerror=function(){r(e.error)}})}function y(e){var t=new FileReader,r=p(t);return t.readAsArrayBuffer(e),r}function d(e){if(e.slice)return e.slice(0);var t=new Uint8Array(e.byteLength);return t.set(new Uint8Array(e)),t.buffer}function h(){return this.bodyUsed=!1,this._initBody=function(e){if(this._bodyInit=e,e)if("string"==typeof e)this._bodyText=e;else if(t.blob&&Blob.prototype.isPrototypeOf(e))this._bodyBlob=e;else if(t.formData&&FormData.prototype.isPrototypeOf(e))this._bodyFormData=e;else if(t.searchParams&&URLSearchParams.prototype.isPrototypeOf(e))this._bodyText=e.toString();else if(t.arrayBuffer&&t.blob&&n(e))this._bodyArrayBuffer=d(e.buffer),this._bodyInit=new Blob([this._bodyArrayBuffer]);else{if(!t.arrayBuffer||!ArrayBuffer.prototype.isPrototypeOf(e)&&!o(e))throw new Error("unsupported BodyInit type");this._bodyArrayBuffer=d(e)}else this._bodyText="";this.headers.get("content-type")||("string"==typeof e?this.headers.set("content-type","text/plain;charset=UTF-8"):this._bodyBlob&&this._bodyBlob.type?this.headers.set("content-type",this._bodyBlob.type):t.searchParams&&URLSearchParams.prototype.isPrototypeOf(e)&&this.headers.set("content-type","application/x-www-form-urlencoded;charset=UTF-8"))},t.blob&&(this.blob=function(){var e=l(this);if(e)return e;if(this._bodyBlob)return Promise.resolve(this._bodyBlob);if(this._bodyArrayBuffer)return Promise.resolve(new Blob([this._bodyArrayBuffer]));if(this._bodyFormData)throw new Error("could not read FormData body as blob");return Promise.resolve(new Blob([this._bodyText]))},this.arrayBuffer=function(){return this._bodyArrayBuffer?l(this)||Promise.resolve(this._bodyArrayBuffer):this.blob().then(y)}),this.text=function(){var e=l(this);if(e)return e;if(this._bodyBlob)return function(e){var t=new FileReader,r=p(t);return t.readAsText(e),r}(this._bodyBlob);if(this._bodyArrayBuffer)return Promise.resolve(function(e){for(var t=new Uint8Array(e),r=new Array(t.length),n=0;n<t.length;n++)r[n]=String.fromCharCode(t[n]);return r.join("")}(this._bodyArrayBuffer));if(this._bodyFormData)throw new Error("could not read FormData body as text");return Promise.resolve(this._bodyText)},t.formData&&(this.formData=function(){return this.text().then(m)}),this.json=function(){return this.text().then(JSON.parse)},this}function b(e,t){var r=(t=t||{}).body;if(e instanceof b){if(e.bodyUsed)throw new TypeError("Already read");this.url=e.url,this.credentials=e.credentials,t.headers||(this.headers=new f(e.headers)),this.method=e.method,this.mode=e.mode,r||null==e._bodyInit||(r=e._bodyInit,e.bodyUsed=!0)}else this.url=String(e);if(this.credentials=t.credentials||this.credentials||"omit",!t.headers&&this.headers||(this.headers=new f(t.headers)),this.method=function(e){var t=e.toUpperCase();return i.indexOf(t)>-1?t:e}(t.method||this.method||"GET"),this.mode=t.mode||this.mode||null,this.referrer=null,("GET"===this.method||"HEAD"===this.method)&&r)throw new TypeError("Body not allowed for GET or HEAD requests");this._initBody(r)}function m(e){var t=new FormData;return e.trim().split("&").forEach(function(e){if(e){var r=e.split("="),n=r.shift().replace(/\+/g," "),o=r.join("=").replace(/\+/g," ");t.append(decodeURIComponent(n),decodeURIComponent(o))}}),t}function v(e,t){t||(t={}),this.type="default",this.status=void 0===t.status?200:t.status,this.ok=this.status>=200&&this.status<300,this.statusText="statusText"in t?t.statusText:"OK",this.headers=new f(t.headers),this.url=t.url||"",this._initBody(e)}}(void 0!==e?e:this)}).call(r,void 0);var n=r.fetch;n.Response=r.Response,n.Request=r.Request,n.Headers=r.Headers;"object"===t(e)&&e.exports&&(e.exports=n,e.exports.default=n)}).call(this,r(5)(e))},function(e,t,r){"use strict";
|
| 2 |
+
/** @license React v16.6.1
|
| 3 |
+
* react.production.min.js
|
| 4 |
+
*
|
| 5 |
+
* Copyright (c) Facebook, Inc. and its affiliates.
|
| 6 |
+
*
|
| 7 |
+
* This source code is licensed under the MIT license found in the
|
| 8 |
+
* LICENSE file in the root directory of this source tree.
|
| 9 |
+
*/function n(e){"@babel/helpers - typeof";return(n="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(e){return typeof e}:function(e){return e&&"function"==typeof Symbol&&e.constructor===Symbol&&e!==Symbol.prototype?"symbol":typeof e})(e)}var o=r(4),i="function"==typeof Symbol&&Symbol.for,a=i?Symbol.for("react.element"):60103,u=i?Symbol.for("react.portal"):60106,s=i?Symbol.for("react.fragment"):60107,c=i?Symbol.for("react.strict_mode"):60108,f=i?Symbol.for("react.profiler"):60114,l=i?Symbol.for("react.provider"):60109,p=i?Symbol.for("react.context"):60110,y=i?Symbol.for("react.concurrent_mode"):60111,d=i?Symbol.for("react.forward_ref"):60112,h=i?Symbol.for("react.suspense"):60113,b=i?Symbol.for("react.memo"):60115,m=i?Symbol.for("react.lazy"):60116,v="function"==typeof Symbol&&Symbol.iterator;function g(e){for(var t=arguments.length-1,r="https://reactjs.org/docs/error-decoder.html?invariant="+e,n=0;n<t;n++)r+="&args[]="+encodeURIComponent(arguments[n+1]);!function(e,t,r,n,o,i,a,u){if(!e){if(e=void 0,void 0===t)e=Error("Minified exception occurred; use the non-minified dev environment for the full error message and additional helpful warnings.");else{var s=[r,n,o,i,a,u],c=0;(e=Error(t.replace(/%s/g,function(){return s[c++]}))).name="Invariant Violation"}throw e.framesToPop=1,e}}(!1,"Minified React error #"+e+"; visit %s for the full message or use the non-minified dev environment for full errors and additional helpful warnings. ",r)}var _={isMounted:function(){return!1},enqueueForceUpdate:function(){},enqueueReplaceState:function(){},enqueueSetState:function(){}},w={};function O(e,t,r){this.props=e,this.context=t,this.refs=w,this.updater=r||_}function S(){}function P(e,t,r){this.props=e,this.context=t,this.refs=w,this.updater=r||_}O.prototype.isReactComponent={},O.prototype.setState=function(e,t){"object"!==n(e)&&"function"!=typeof e&&null!=e&&g("85"),this.updater.enqueueSetState(this,e,t,"setState")},O.prototype.forceUpdate=function(e){this.updater.enqueueForceUpdate(this,e,"forceUpdate")},S.prototype=O.prototype;var j=P.prototype=new S;j.constructor=P,o(j,O.prototype),j.isPureReactComponent=!0;var E={current:null,currentDispatcher:null},x=Object.prototype.hasOwnProperty,A={key:!0,ref:!0,__self:!0,__source:!0};function T(e,t,r){var n=void 0,o={},i=null,u=null;if(null!=t)for(n in void 0!==t.ref&&(u=t.ref),void 0!==t.key&&(i=""+t.key),t)x.call(t,n)&&!A.hasOwnProperty(n)&&(o[n]=t[n]);var s=arguments.length-2;if(1===s)o.children=r;else if(1<s){for(var c=Array(s),f=0;f<s;f++)c[f]=arguments[f+2];o.children=c}if(e&&e.defaultProps)for(n in s=e.defaultProps)void 0===o[n]&&(o[n]=s[n]);return{$$typeof:a,type:e,key:i,ref:u,props:o,_owner:E.current}}function k(e){return"object"===n(e)&&null!==e&&e.$$typeof===a}var R=/\/+/g,B=[];function U(e,t,r,n){if(B.length){var o=B.pop();return o.result=e,o.keyPrefix=t,o.func=r,o.context=n,o.count=0,o}return{result:e,keyPrefix:t,func:r,context:n,count:0}}function C(e){e.result=null,e.keyPrefix=null,e.func=null,e.context=null,e.count=0,10>B.length&&B.push(e)}function I(e,t,r){return null==e?0:function e(t,r,o,i){var s=n(t);"undefined"!==s&&"boolean"!==s||(t=null);var c=!1;if(null===t)c=!0;else switch(s){case"string":case"number":c=!0;break;case"object":switch(t.$$typeof){case a:case u:c=!0}}if(c)return o(i,t,""===r?"."+D(t,0):r),1;if(c=0,r=""===r?".":r+":",Array.isArray(t))for(var f=0;f<t.length;f++){var l=r+D(s=t[f],f);c+=e(s,l,o,i)}else if(l=null===t||"object"!==n(t)?null:"function"==typeof(l=v&&t[v]||t["@@iterator"])?l:null,"function"==typeof l)for(t=l.call(t),f=0;!(s=t.next()).done;)c+=e(s=s.value,l=r+D(s,f++),o,i);else"object"===s&&g("31","[object Object]"==(o=""+t)?"object with keys {"+Object.keys(t).join(", ")+"}":o,"");return c}(e,"",t,r)}function D(e,t){return"object"===n(e)&&null!==e&&null!=e.key?function(e){var t={"=":"=0",":":"=2"};return"$"+(""+e).replace(/[=:]/g,function(e){return t[e]})}(e.key):t.toString(36)}function F(e,t){e.func.call(e.context,t,e.count++)}function $(e,t,r){var n=e.result,o=e.keyPrefix;e=e.func.call(e.context,t,e.count++),Array.isArray(e)?q(e,n,r,function(e){return e}):null!=e&&(k(e)&&(e=function(e,t){return{$$typeof:a,type:e.type,key:t,ref:e.ref,props:e.props,_owner:e._owner}}(e,o+(!e.key||t&&t.key===e.key?"":(""+e.key).replace(R,"$&/")+"/")+r)),n.push(e))}function q(e,t,r,n,o){var i="";null!=r&&(i=(""+r).replace(R,"$&/")+"/"),I(e,$,t=U(t,i,n,o)),C(t)}var N={Children:{map:function(e,t,r){if(null==e)return e;var n=[];return q(e,n,null,t,r),n},forEach:function(e,t,r){if(null==e)return e;I(e,F,t=U(null,null,t,r)),C(t)},count:function(e){return I(e,function(){return null},null)},toArray:function(e){var t=[];return q(e,t,null,function(e){return e}),t},only:function(e){return k(e)||g("143"),e}},createRef:function(){return{current:null}},Component:O,PureComponent:P,createContext:function(e,t){return void 0===t&&(t=null),(e={$$typeof:p,_calculateChangedBits:t,_currentValue:e,_currentValue2:e,_threadCount:0,Provider:null,Consumer:null}).Provider={$$typeof:l,_context:e},e.Consumer=e},forwardRef:function(e){return{$$typeof:d,render:e}},lazy:function(e){return{$$typeof:m,_ctor:e,_status:-1,_result:null}},memo:function(e,t){return{$$typeof:b,type:e,compare:void 0===t?null:t}},Fragment:s,StrictMode:c,Suspense:h,createElement:T,cloneElement:function(e,t,r){(null===e||void 0===e)&&g("267",e);var n=void 0,i=o({},e.props),u=e.key,s=e.ref,c=e._owner;if(null!=t){void 0!==t.ref&&(s=t.ref,c=E.current),void 0!==t.key&&(u=""+t.key);var f=void 0;for(n in e.type&&e.type.defaultProps&&(f=e.type.defaultProps),t)x.call(t,n)&&!A.hasOwnProperty(n)&&(i[n]=void 0===t[n]&&void 0!==f?f[n]:t[n])}if(1===(n=arguments.length-2))i.children=r;else if(1<n){f=Array(n);for(var l=0;l<n;l++)f[l]=arguments[l+2];i.children=f}return{$$typeof:a,type:e.type,key:u,ref:s,props:i,_owner:c}},createFactory:function(e){var t=T.bind(null,e);return t.type=e,t},isValidElement:k,version:"16.6.3",__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED:{ReactCurrentOwner:E,assign:o}};N.unstable_ConcurrentMode=y,N.unstable_Profiler=f;var L={default:N},M=L&&N||L;e.exports=M.default||M},function(e,t,r){"use strict";
|
| 10 |
+
/*
|
| 11 |
+
object-assign
|
| 12 |
+
(c) Sindre Sorhus
|
| 13 |
+
@license MIT
|
| 14 |
+
*/var n=Object.getOwnPropertySymbols,o=Object.prototype.hasOwnProperty,i=Object.prototype.propertyIsEnumerable;e.exports=function(){try{if(!Object.assign)return!1;var e=new String("abc");if(e[5]="de","5"===Object.getOwnPropertyNames(e)[0])return!1;for(var t={},r=0;r<10;r++)t["_"+String.fromCharCode(r)]=r;if("0123456789"!==Object.getOwnPropertyNames(t).map(function(e){return t[e]}).join(""))return!1;var n={};return"abcdefghijklmnopqrst".split("").forEach(function(e){n[e]=e}),"abcdefghijklmnopqrst"===Object.keys(Object.assign({},n)).join("")}catch(e){return!1}}()?Object.assign:function(e,t){for(var r,a,u=function(e){if(null===e||void 0===e)throw new TypeError("Object.assign cannot be called with null or undefined");return Object(e)}(e),s=1;s<arguments.length;s++){for(var c in r=Object(arguments[s]))o.call(r,c)&&(u[c]=r[c]);if(n){a=n(r);for(var f=0;f<a.length;f++)i.call(r,a[f])&&(u[a[f]]=r[a[f]])}}return u}},function(e,t){e.exports=function(e){return e.webpackPolyfill||(e.deprecate=function(){},e.paths=[],e.children||(e.children=[]),Object.defineProperty(e,"loaded",{enumerable:!0,get:function(){return e.l}}),Object.defineProperty(e,"id",{enumerable:!0,get:function(){return e.i}}),e.webpackPolyfill=1),e}},function(e,t,r){"use strict";r.r(t);var n=r(0),o=r.n(n),i=r(1),a=r.n(i),u=r(2),s=r.n(u);function c(e,t){var r=Object.keys(e);if(Object.getOwnPropertySymbols){var n=Object.getOwnPropertySymbols(e);t&&(n=n.filter(function(t){return Object.getOwnPropertyDescriptor(e,t).enumerable})),r.push.apply(r,n)}return r}function f(e){for(var t=1;t<arguments.length;t++){var r=null!=arguments[t]?arguments[t]:{};t%2?c(Object(r),!0).forEach(function(t){_(e,t,r[t])}):Object.getOwnPropertyDescriptors?Object.defineProperties(e,Object.getOwnPropertyDescriptors(r)):c(Object(r)).forEach(function(t){Object.defineProperty(e,t,Object.getOwnPropertyDescriptor(r,t))})}return e}function l(e){"@babel/helpers - typeof";return(l="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(e){return typeof e}:function(e){return e&&"function"==typeof Symbol&&e.constructor===Symbol&&e!==Symbol.prototype?"symbol":typeof e})(e)}function p(e,t){if(!(e instanceof t))throw new TypeError("Cannot call a class as a function")}function y(e,t){for(var r=0;r<t.length;r++){var n=t[r];n.enumerable=n.enumerable||!1,n.configurable=!0,"value"in n&&(n.writable=!0),Object.defineProperty(e,n.key,n)}}function d(e,t,r){return t&&y(e.prototype,t),r&&y(e,r),e}function h(e,t){if("function"!=typeof t&&null!==t)throw new TypeError("Super expression must either be null or a function");e.prototype=Object.create(t&&t.prototype,{constructor:{value:e,writable:!0,configurable:!0}}),t&&b(e,t)}function b(e,t){return(b=Object.setPrototypeOf||function(e,t){return e.__proto__=t,e})(e,t)}function m(e){var t=function(){if("undefined"==typeof Reflect||!Reflect.construct)return!1;if(Reflect.construct.sham)return!1;if("function"==typeof Proxy)return!0;try{return Date.prototype.toString.call(Reflect.construct(Date,[],function(){})),!0}catch(e){return!1}}();return function(){var r,n=g(e);if(t){var o=g(this).constructor;r=Reflect.construct(n,arguments,o)}else r=n.apply(this,arguments);return function(e,t){if(t&&("object"===l(t)||"function"==typeof t))return t;return v(e)}(this,r)}}function v(e){if(void 0===e)throw new ReferenceError("this hasn't been initialised - super() hasn't been called");return e}function g(e){return(g=Object.setPrototypeOf?Object.getPrototypeOf:function(e){return e.__proto__||Object.getPrototypeOf(e)})(e)}function _(e,t,r){return t in e?Object.defineProperty(e,t,{value:r,enumerable:!0,configurable:!0,writable:!0}):e[t]=r,e}var w=wp.data.dispatch,O=wp.components.Button,S=wp.element,P=S.Fragment,j=S.Component,E=wp.i18n.__,x=lodash.property,A=function(e){h(r,j);var t=m(r);function r(){var e;p(this,r);for(var n=arguments.length,o=new Array(n),i=0;i<n;i++)o[i]=arguments[i];return _(v(e=t.call.apply(t,[this].concat(o))),"state",{image_url:null,msg:E("Loading...")}),_(v(e),"updateImageUrl",function(){e.getImageUrl(e.props.image_id).then(function(t){return e.setState({image_url:t})}).catch(function(t){return console.log(t)&&e.setState({msg:E("Could not load image")})})}),_(v(e),"getImageUrl",function(e){var t=new a.a;return t.append("action","get_image"),t.append("image_id",e),s()(photocrati_ajax.url,{method:"POST",body:t,headers:{Accept:"application/json"}}).then(function(e){return e.json()}).then(x("image.image_url"))}),e}return d(r,[{key:"componentDidUpdate",value:function(e){this.props.image_id!==e.image_id&&this.updateImageUrl()}},{key:"componentDidMount",value:function(){this.updateImageUrl()}},{key:"render",value:function(){var e=this.state.msg,t=this.state.image_url?o.a.createElement("img",{src:this.state.image_url}):o.a.createElement("span",null,e);return o.a.createElement("div",{style:{paddingTop:"5px",paddingBottom:"5px"}},t)}}]),r}(),T=function(e){h(r,j);var t=m(r);function r(e){var n;return p(this,r),_(v(n=t.call(this,e)),"handleOpenClick",function(e){top.set_ngg_post_thumbnail=n.onUpdatePostThumbnail,tb_show("Set NextGEN Featured Image",ngg_featured_image.modal_url.replace(/%post_id%/,n.props.currentPostId))}),_(v(n),"handleRemoveClick",function(e){var t=f(f({},n.props.meta),{},{ngg_post_thumbnail:0,featured_media:0});n.setState({ngg_id:0}),w("core/editor").editPost({meta:t})}),_(v(n),"onUpdatePostThumbnail",function(e){tb_remove();var t=f(f({},n.props.meta),{},{ngg_post_thumbnail:parseInt(e)});n.setState({ngg_id:t.ngg_post_thumbnail}),w("core/editor").editPost({meta:t})}),n.state={ngg_id:e.meta.ngg_post_thumbnail,wp_ml_id:e.featuredImageId},n}return d(r,[{key:"render",value:function(){return o.a.createElement(P,null,o.a.createElement(O,{style:{marginTop:"10px"},onClick:this.handleOpenClick,className:"editor-post-featured-image__toggle"},E("Set NextGEN Featured Image")),this.state.ngg_id>0&&this.props.meta.ngg_post_thumbnail!==this.state.ngg_id?o.a.createElement(P,null,o.a.createElement(A,{image_id:this.state.ngg_id}),o.a.createElement(O,{onClick:this.handleRemoveClick,className:"is-link is-destructive"},E("Remove featured image"))):"")}}]),r}();function k(){return(k=Object.assign||function(e){for(var t=1;t<arguments.length;t++){var r=arguments[t];for(var n in r)Object.prototype.hasOwnProperty.call(r,n)&&(e[n]=r[n])}return e}).apply(this,arguments)}var R=wp.data.select,B=wp.element.Fragment;wp.hooks.addFilter("editor.PostFeaturedImage","imagely/featured-image-display",function(e){return function(t){var r=R("core/editor").getCurrentPostAttribute("meta");return o.a.createElement(B,null,o.a.createElement(e,t),o.a.createElement(T,k({},t,{meta:r})))}})}]);
|
| 15 |
//# sourceMappingURL=post-thumbnail.min.js.map
|
products/photocrati_nextgen/modules/nextgen_block/static/build/post-thumbnail.min.js.map
CHANGED
|
@@ -1 +1 @@
|
|
| 1 |
-
{"version":3,"sources":["webpack:///webpack/bootstrap","webpack:///./node_modules/cross-fetch/dist/browser-ponyfill.js","webpack:///./node_modules/form-data/lib/browser.js","webpack:///(webpack)/buildin/module.js","webpack:///./build/nextgen-gallery/products/photocrati_nextgen/modules/nextgen_block/static/src/components/ngg-post-thumbnail.min.js","webpack:///./build/nextgen-gallery/products/photocrati_nextgen/modules/nextgen_block/static/src/post-thumbnail.min.js"],"names":["installedModules","__webpack_require__","moduleId","exports","module","i","l","modules","call","m","c","d","name","getter","o","Object","defineProperty","enumerable","get","r","Symbol","toStringTag","value","t","mode","__esModule","ns","create","key","bind","n","object","property","prototype","hasOwnProperty","p","s","__root__","root","F","this","fetch","self","support","searchParams","iterable","blob","Blob","e","formData","arrayBuffer","viewClasses","isDataView","obj","DataView","isPrototypeOf","isArrayBufferView","ArrayBuffer","isView","indexOf","toString","Headers","append","normalizeName","normalizeValue","oldValue","map","has","set","forEach","callback","thisArg","keys","items","push","iteratorFor","values","entries","iterator","methods","Request","clone","body","_bodyInit","Body","Response","status","statusText","headers","url","error","response","type","redirectStatuses","redirect","RangeError","location","input","init","Promise","resolve","reject","request","xhr","XMLHttpRequest","onload","options","rawHeaders","replace","split","line","parts","shift","trim","join","parseHeaders","getAllResponseHeaders","responseURL","responseText","onerror","TypeError","ontimeout","open","method","credentials","withCredentials","responseType","setRequestHeader","send","polyfill","String","test","toLowerCase","next","done","undefined","Array","isArray","header","getOwnPropertyNames","consumed","bodyUsed","fileReaderReady","reader","result","readBlobAsArrayBuffer","FileReader","promise","readAsArrayBuffer","bufferClone","buf","slice","view","Uint8Array","byteLength","buffer","_initBody","_bodyText","_bodyBlob","FormData","_bodyFormData","URLSearchParams","_bodyArrayBuffer","Error","rejected","then","text","readAsText","readBlobAsText","chars","length","fromCharCode","readArrayBufferAsText","decode","json","JSON","parse","upcased","toUpperCase","normalizeMethod","referrer","form","bytes","decodeURIComponent","bodyInit","ok","_typeof","default","window","webpackPolyfill","deprecate","paths","children","wp","element","Fragment","Component","data","withSelect","withDispatch","compose","Button","components","__","i18n","lodash","NggThumbnail","_Component","_getPrototypeOf2","_this","_classCallCheck","_len","arguments","args","_key","_defineProperty","_assertThisInitialized","_possibleConstructorReturn","_getPrototypeOf","apply","concat","image_url","msg","getImageUrl","props","image_id","setState","catch","err","console","log","photocrati_ajax","Accept","res","_inherits","_createClass","prevProps","updateImageUrl","state","el","React","createElement","src","style","paddingTop","paddingBottom","PostThumbnail","currentPostId","_this2","top","set_ngg_post_thumbnail","onUpdatePostThumbnail","tb_show","ngg_featured_image","modal_url","onRemoveNggPostThumbnail","ngg_image_id","tb_remove","onSetNggPostThumbnail","parseInt","_this$props","PostFeaturedImage","nggPostThumbnailId","marginTop","onClick","handleOpenClick","className","ngg_post_thumbnail_min_NggThumbnail","handleRemoveClick","applyWithSelect","select","_select","getCurrentPostId","getEditedPostAttribute","featuredImageId","meta","ngg_post_thumbnail","applyWithDispatch","dispatch","editPost","_objectSpread","featured_media","ngg_post_thumbnail_min","_extends","nggPostThumbnail","memoize","wpEditorProxy","prop","NggPostThumbnail","getOriginalComponent","wpProxy","isProxy","Proxy","originalEditor","editor"],"mappings":"aACA,IAAAA,KAGA,SAAAC,EAAAC,GAGA,GAAAF,EAAAE,GACA,OAAAF,EAAAE,GAAAC,QAGA,IAAAC,EAAAJ,EAAAE,IACAG,EAAAH,EACAI,GAAA,EACAH,YAUA,OANAI,EAAAL,GAAAM,KAAAJ,EAAAD,QAAAC,IAAAD,QAAAF,GAGAG,EAAAE,GAAA,EAGAF,EAAAD,QAKAF,EAAAQ,EAAAF,EAGAN,EAAAS,EAAAV,EAGAC,EAAAU,EAAA,SAAAR,EAAAS,EAAAC,GACAZ,EAAAa,EAAAX,EAAAS,IACAG,OAAAC,eAAAb,EAAAS,GAA0CK,YAAA,EAAAC,IAAAL,KAK1CZ,EAAAkB,EAAA,SAAAhB,GACA,oBAAAiB,eAAAC,aACAN,OAAAC,eAAAb,EAAAiB,OAAAC,aAAwDC,MAAA,WAExDP,OAAAC,eAAAb,EAAA,cAAiDmB,OAAA,KAQjDrB,EAAAsB,EAAA,SAAAD,EAAAE,GAEA,GADA,EAAAA,IAAAF,EAAArB,EAAAqB,IACA,EAAAE,EAAA,OAAAF,EACA,KAAAE,GAAA,iBAAAF,QAAAG,WAAA,OAAAH,EACA,IAAAI,EAAAX,OAAAY,OAAA,MAGA,GAFA1B,EAAAkB,EAAAO,GACAX,OAAAC,eAAAU,EAAA,WAAyCT,YAAA,EAAAK,UACzC,EAAAE,GAAA,iBAAAF,EAAA,QAAAM,KAAAN,EAAArB,EAAAU,EAAAe,EAAAE,EAAA,SAAAA,GAAgH,OAAAN,EAAAM,IAAqBC,KAAA,KAAAD,IACrI,OAAAF,GAIAzB,EAAA6B,EAAA,SAAA1B,GACA,IAAAS,EAAAT,KAAAqB,WACA,WAA2B,OAAArB,EAAA,SAC3B,WAAiC,OAAAA,GAEjC,OADAH,EAAAU,EAAAE,EAAA,IAAAA,GACAA,GAIAZ,EAAAa,EAAA,SAAAiB,EAAAC,GAAsD,OAAAjB,OAAAkB,UAAAC,eAAA1B,KAAAuB,EAAAC,IAGtD/B,EAAAkC,EAAA,GAIAlC,IAAAmC,EAAA,uQClFA,IAAIC,EAAY,SAAUC,GAC1B,SAASC,IAAMC,KAAKC,OAAQ,EAE5B,OADAF,EAAEN,UAAYK,EACP,IAAIC,EAHK,CAIG,oBAATG,KAAuBA,KAAOF,OACxC,SAAUE,IAEV,SAAUA,GAER,IAAIA,EAAKD,MAAT,CAIA,IAAIE,GACFC,aAAc,oBAAqBF,EACnCG,SAAU,WAAYH,GAAQ,aAActB,OAC5C0B,KAAM,eAAgBJ,GAAQ,SAAUA,GAAS,WAC/C,IAEE,OADA,IAAIK,MACG,EACP,MAAMC,GACN,OAAO,GALsC,GAQjDC,SAAU,aAAcP,EACxBQ,YAAa,gBAAiBR,GAGhC,GAAIC,EAAQO,YACV,IAAIC,GACF,qBACA,sBACA,6BACA,sBACA,uBACA,sBACA,uBACA,wBACA,yBAGEC,EAAa,SAASC,GACxB,OAAOA,GAAOC,SAASrB,UAAUsB,cAAcF,IAG7CG,EAAoBC,YAAYC,QAAU,SAASL,GACrD,OAAOA,GAAOF,EAAYQ,QAAQ5C,OAAOkB,UAAU2B,SAASpD,KAAK6C,KAAS,GAyD9EQ,EAAQ5B,UAAU6B,OAAS,SAASlD,EAAMU,GACxCV,EAAOmD,EAAcnD,GACrBU,EAAQ0C,EAAe1C,GACvB,IAAI2C,EAAWzB,KAAK0B,IAAItD,GACxB4B,KAAK0B,IAAItD,GAAQqD,EAAWA,EAAS,IAAI3C,EAAQA,GAGnDuC,EAAQ5B,UAAR,OAA8B,SAASrB,UAC9B4B,KAAK0B,IAAIH,EAAcnD,KAGhCiD,EAAQ5B,UAAUf,IAAM,SAASN,GAE/B,OADAA,EAAOmD,EAAcnD,GACd4B,KAAK2B,IAAIvD,GAAQ4B,KAAK0B,IAAItD,GAAQ,MAG3CiD,EAAQ5B,UAAUkC,IAAM,SAASvD,GAC/B,OAAO4B,KAAK0B,IAAIhC,eAAe6B,EAAcnD,KAG/CiD,EAAQ5B,UAAUmC,IAAM,SAASxD,EAAMU,GACrCkB,KAAK0B,IAAIH,EAAcnD,IAASoD,EAAe1C,IAGjDuC,EAAQ5B,UAAUoC,QAAU,SAASC,EAAUC,GAC7C,IAAK,IAAI3D,KAAQ4B,KAAK0B,IAChB1B,KAAK0B,IAAIhC,eAAetB,IAC1B0D,EAAS9D,KAAK+D,EAAS/B,KAAK0B,IAAItD,GAAOA,EAAM4B,OAKnDqB,EAAQ5B,UAAUuC,KAAO,WACvB,IAAIC,KAEJ,OADAjC,KAAK6B,QAAQ,SAAS/C,EAAOV,GAAQ6D,EAAMC,KAAK9D,KACzC+D,EAAYF,IAGrBZ,EAAQ5B,UAAU2C,OAAS,WACzB,IAAIH,KAEJ,OADAjC,KAAK6B,QAAQ,SAAS/C,GAASmD,EAAMC,KAAKpD,KACnCqD,EAAYF,IAGrBZ,EAAQ5B,UAAU4C,QAAU,WAC1B,IAAIJ,KAEJ,OADAjC,KAAK6B,QAAQ,SAAS/C,EAAOV,GAAQ6D,EAAMC,MAAM9D,EAAMU,MAChDqD,EAAYF,IAGjB9B,EAAQE,WACVgB,EAAQ5B,UAAUb,OAAO0D,UAAYjB,EAAQ5B,UAAU4C,SAqJzD,IAAIE,GAAW,SAAU,MAAO,OAAQ,UAAW,OAAQ,OA4C3DC,EAAQ/C,UAAUgD,MAAQ,WACxB,OAAO,IAAID,EAAQxC,MAAQ0C,KAAM1C,KAAK2C,aAgCxCC,EAAK5E,KAAKwE,EAAQ/C,WAgBlBmD,EAAK5E,KAAK6E,EAASpD,WAEnBoD,EAASpD,UAAUgD,MAAQ,WACzB,OAAO,IAAII,EAAS7C,KAAK2C,WACvBG,OAAQ9C,KAAK8C,OACbC,WAAY/C,KAAK+C,WACjBC,QAAS,IAAI3B,EAAQrB,KAAKgD,SAC1BC,IAAKjD,KAAKiD,OAIdJ,EAASK,MAAQ,WACf,IAAIC,EAAW,IAAIN,EAAS,MAAOC,OAAQ,EAAGC,WAAY,KAE1D,OADAI,EAASC,KAAO,QACTD,GAGT,IAAIE,GAAoB,IAAK,IAAK,IAAK,IAAK,KAE5CR,EAASS,SAAW,SAASL,EAAKH,GAChC,IAA0C,IAAtCO,EAAiBlC,QAAQ2B,GAC3B,MAAM,IAAIS,WAAW,uBAGvB,OAAO,IAAIV,EAAS,MAAOC,OAAQA,EAAQE,SAAUQ,SAAUP,MAGjE/C,EAAKmB,QAAUA,EACfnB,EAAKsC,QAAUA,EACftC,EAAK2C,SAAWA,EAEhB3C,EAAKD,MAAQ,SAASwD,EAAOC,GAC3B,OAAO,IAAIC,QAAQ,SAASC,EAASC,GACnC,IAAIC,EAAU,IAAItB,EAAQiB,EAAOC,GAC7BK,EAAM,IAAIC,eAEdD,EAAIE,OAAS,WACX,IAAIC,GACFpB,OAAQiB,EAAIjB,OACZC,WAAYgB,EAAIhB,WAChBC,QAxER,SAAsBmB,GACpB,IAAInB,EAAU,IAAI3B,EAYlB,OAT0B8C,EAAWC,QAAQ,eAAgB,KACzCC,MAAM,SAASxC,QAAQ,SAASyC,GAClD,IAAIC,EAAQD,EAAKD,MAAM,KACnBjF,EAAMmF,EAAMC,QAAQC,OACxB,GAAIrF,EAAK,CACP,IAAIN,EAAQyF,EAAMG,KAAK,KAAKD,OAC5BzB,EAAQ1B,OAAOlC,EAAKN,MAGjBkE,EA2DQ2B,CAAaZ,EAAIa,yBAA2B,KAEvDV,EAAQjB,IAAM,gBAAiBc,EAAMA,EAAIc,YAAcX,EAAQlB,QAAQtE,IAAI,iBAC3E,IAAIgE,EAAO,aAAcqB,EAAMA,EAAIZ,SAAWY,EAAIe,aAClDlB,EAAQ,IAAIf,EAASH,EAAMwB,KAG7BH,EAAIgB,QAAU,WACZlB,EAAO,IAAImB,UAAU,4BAGvBjB,EAAIkB,UAAY,WACdpB,EAAO,IAAImB,UAAU,4BAGvBjB,EAAImB,KAAKpB,EAAQqB,OAAQrB,EAAQb,KAAK,GAEV,YAAxBa,EAAQsB,YACVrB,EAAIsB,iBAAkB,EACW,SAAxBvB,EAAQsB,cACjBrB,EAAIsB,iBAAkB,GAGpB,iBAAkBtB,GAAO5D,EAAQG,OACnCyD,EAAIuB,aAAe,QAGrBxB,EAAQd,QAAQnB,QAAQ,SAAS/C,EAAOV,GACtC2F,EAAIwB,iBAAiBnH,EAAMU,KAG7BiF,EAAIyB,UAAkC,IAAtB1B,EAAQnB,UAA4B,KAAOmB,EAAQnB,cAGvEzC,EAAKD,MAAMwF,UAAW,EApatB,SAASlE,EAAcnD,GAIrB,GAHoB,iBAATA,IACTA,EAAOsH,OAAOtH,IAEZ,6BAA6BuH,KAAKvH,GACpC,MAAM,IAAI4G,UAAU,0CAEtB,OAAO5G,EAAKwH,cAGd,SAASpE,EAAe1C,GAItB,MAHqB,iBAAVA,IACTA,EAAQ4G,OAAO5G,IAEVA,EAIT,SAASqD,EAAYF,GACnB,IAAIK,GACFuD,KAAM,WACJ,IAAI/G,EAAQmD,EAAMuC,QAClB,OAAQsB,UAAgBC,IAAVjH,EAAqBA,MAAOA,KAU9C,OANIqB,EAAQE,WACViC,EAAS1D,OAAO0D,UAAY,WAC1B,OAAOA,IAIJA,EAGT,SAASjB,EAAQ2B,GACfhD,KAAK0B,OAEDsB,aAAmB3B,EACrB2B,EAAQnB,QAAQ,SAAS/C,EAAOV,GAC9B4B,KAAKsB,OAAOlD,EAAMU,IACjBkB,MACMgG,MAAMC,QAAQjD,GACvBA,EAAQnB,QAAQ,SAASqE,GACvBlG,KAAKsB,OAAO4E,EAAO,GAAIA,EAAO,KAC7BlG,MACMgD,GACTzE,OAAO4H,oBAAoBnD,GAASnB,QAAQ,SAASzD,GACnD4B,KAAKsB,OAAOlD,EAAM4E,EAAQ5E,KACzB4B,MA0DP,SAASoG,EAAS1D,GAChB,GAAIA,EAAK2D,SACP,OAAO1C,QAAQE,OAAO,IAAImB,UAAU,iBAEtCtC,EAAK2D,UAAW,EAGlB,SAASC,EAAgBC,GACvB,OAAO,IAAI5C,QAAQ,SAASC,EAASC,GACnC0C,EAAOtC,OAAS,WACdL,EAAQ2C,EAAOC,SAEjBD,EAAOxB,QAAU,WACflB,EAAO0C,EAAOrD,UAKpB,SAASuD,EAAsBnG,GAC7B,IAAIiG,EAAS,IAAIG,WACbC,EAAUL,EAAgBC,GAE9B,OADAA,EAAOK,kBAAkBtG,GAClBqG,EAoBT,SAASE,EAAYC,GACnB,GAAIA,EAAIC,MACN,OAAOD,EAAIC,MAAM,GAEjB,IAAIC,EAAO,IAAIC,WAAWH,EAAII,YAE9B,OADAF,EAAKpF,IAAI,IAAIqF,WAAWH,IACjBE,EAAKG,OAIhB,SAASvE,IA0FP,OAzFA5C,KAAKqG,UAAW,EAEhBrG,KAAKoH,UAAY,SAAS1E,GAExB,GADA1C,KAAK2C,UAAYD,EACZA,EAEE,GAAoB,iBAATA,EAChB1C,KAAKqH,UAAY3E,OACZ,GAAIvC,EAAQG,MAAQC,KAAKd,UAAUsB,cAAc2B,GACtD1C,KAAKsH,UAAY5E,OACZ,GAAIvC,EAAQM,UAAY8G,SAAS9H,UAAUsB,cAAc2B,GAC9D1C,KAAKwH,cAAgB9E,OAChB,GAAIvC,EAAQC,cAAgBqH,gBAAgBhI,UAAUsB,cAAc2B,GACzE1C,KAAKqH,UAAY3E,EAAKtB,gBACjB,GAAIjB,EAAQO,aAAeP,EAAQG,MAAQM,EAAW8B,GAC3D1C,KAAK0H,iBAAmBb,EAAYnE,EAAKyE,QAEzCnH,KAAK2C,UAAY,IAAIpC,MAAMP,KAAK0H,uBAC3B,KAAIvH,EAAQO,cAAgBO,YAAYxB,UAAUsB,cAAc2B,KAAS1B,EAAkB0B,GAGhG,MAAM,IAAIiF,MAAM,6BAFhB3H,KAAK0H,iBAAmBb,EAAYnE,QAdpC1C,KAAKqH,UAAY,GAmBdrH,KAAKgD,QAAQtE,IAAI,kBACA,iBAATgE,EACT1C,KAAKgD,QAAQpB,IAAI,eAAgB,4BACxB5B,KAAKsH,WAAatH,KAAKsH,UAAUlE,KAC1CpD,KAAKgD,QAAQpB,IAAI,eAAgB5B,KAAKsH,UAAUlE,MACvCjD,EAAQC,cAAgBqH,gBAAgBhI,UAAUsB,cAAc2B,IACzE1C,KAAKgD,QAAQpB,IAAI,eAAgB,qDAKnCzB,EAAQG,OACVN,KAAKM,KAAO,WACV,IAAIsH,EAAWxB,EAASpG,MACxB,GAAI4H,EACF,OAAOA,EAGT,GAAI5H,KAAKsH,UACP,OAAO3D,QAAQC,QAAQ5D,KAAKsH,WACvB,GAAItH,KAAK0H,iBACd,OAAO/D,QAAQC,QAAQ,IAAIrD,MAAMP,KAAK0H,oBACjC,GAAI1H,KAAKwH,cACd,MAAM,IAAIG,MAAM,wCAEhB,OAAOhE,QAAQC,QAAQ,IAAIrD,MAAMP,KAAKqH,cAI1CrH,KAAKU,YAAc,WACjB,OAAIV,KAAK0H,iBACAtB,EAASpG,OAAS2D,QAAQC,QAAQ5D,KAAK0H,kBAEvC1H,KAAKM,OAAOuH,KAAKpB,KAK9BzG,KAAK8H,KAAO,WACV,IAAIF,EAAWxB,EAASpG,MACxB,GAAI4H,EACF,OAAOA,EAGT,GAAI5H,KAAKsH,UACP,OAjGN,SAAwBhH,GACtB,IAAIiG,EAAS,IAAIG,WACbC,EAAUL,EAAgBC,GAE9B,OADAA,EAAOwB,WAAWzH,GACXqG,EA6FIqB,CAAehI,KAAKsH,WACtB,GAAItH,KAAK0H,iBACd,OAAO/D,QAAQC,QA5FrB,SAA+BkD,GAI7B,IAHA,IAAIE,EAAO,IAAIC,WAAWH,GACtBmB,EAAQ,IAAIjC,MAAMgB,EAAKkB,QAElBrK,EAAI,EAAGA,EAAImJ,EAAKkB,OAAQrK,IAC/BoK,EAAMpK,GAAK6H,OAAOyC,aAAanB,EAAKnJ,IAEtC,OAAOoK,EAAMvD,KAAK,IAqFS0D,CAAsBpI,KAAK0H,mBAC7C,GAAI1H,KAAKwH,cACd,MAAM,IAAIG,MAAM,wCAEhB,OAAOhE,QAAQC,QAAQ5D,KAAKqH,YAI5BlH,EAAQM,WACVT,KAAKS,SAAW,WACd,OAAOT,KAAK8H,OAAOD,KAAKQ,KAI5BrI,KAAKsI,KAAO,WACV,OAAOtI,KAAK8H,OAAOD,KAAKU,KAAKC,QAGxBxI,KAWT,SAASwC,EAAQiB,EAAOS,GAEtB,IAAIxB,GADJwB,EAAUA,OACSxB,KAEnB,GAAIe,aAAiBjB,EAAS,CAC5B,GAAIiB,EAAM4C,SACR,MAAM,IAAIrB,UAAU,gBAEtBhF,KAAKiD,IAAMQ,EAAMR,IACjBjD,KAAKoF,YAAc3B,EAAM2B,YACpBlB,EAAQlB,UACXhD,KAAKgD,QAAU,IAAI3B,EAAQoC,EAAMT,UAEnChD,KAAKmF,OAAS1B,EAAM0B,OACpBnF,KAAKhB,KAAOyE,EAAMzE,KACb0D,GAA2B,MAAnBe,EAAMd,YACjBD,EAAOe,EAAMd,UACbc,EAAM4C,UAAW,QAGnBrG,KAAKiD,IAAMyC,OAAOjC,GAWpB,GARAzD,KAAKoF,YAAclB,EAAQkB,aAAepF,KAAKoF,aAAe,QAC1DlB,EAAQlB,SAAYhD,KAAKgD,UAC3BhD,KAAKgD,QAAU,IAAI3B,EAAQ6C,EAAQlB,UAErChD,KAAKmF,OAhCP,SAAyBA,GACvB,IAAIsD,EAAUtD,EAAOuD,cACrB,OAAQnG,EAAQpB,QAAQsH,IAAY,EAAKA,EAAUtD,EA8BrCwD,CAAgBzE,EAAQiB,QAAUnF,KAAKmF,QAAU,OAC/DnF,KAAKhB,KAAOkF,EAAQlF,MAAQgB,KAAKhB,MAAQ,KACzCgB,KAAK4I,SAAW,MAEK,QAAhB5I,KAAKmF,QAAoC,SAAhBnF,KAAKmF,SAAsBzC,EACvD,MAAM,IAAIsC,UAAU,6CAEtBhF,KAAKoH,UAAU1E,GAOjB,SAAS2F,EAAO3F,GACd,IAAImG,EAAO,IAAItB,SASf,OARA7E,EAAK+B,OAAOJ,MAAM,KAAKxC,QAAQ,SAASiH,GACtC,GAAIA,EAAO,CACT,IAAIzE,EAAQyE,EAAMzE,MAAM,KACpBjG,EAAOiG,EAAMG,QAAQJ,QAAQ,MAAO,KACpCtF,EAAQuF,EAAMK,KAAK,KAAKN,QAAQ,MAAO,KAC3CyE,EAAKvH,OAAOyH,mBAAmB3K,GAAO2K,mBAAmBjK,OAGtD+J,EAqBT,SAAShG,EAASmG,EAAU9E,GACrBA,IACHA,MAGFlE,KAAKoD,KAAO,UACZpD,KAAK8C,YAA4BiD,IAAnB7B,EAAQpB,OAAuB,IAAMoB,EAAQpB,OAC3D9C,KAAKiJ,GAAKjJ,KAAK8C,QAAU,KAAO9C,KAAK8C,OAAS,IAC9C9C,KAAK+C,WAAa,eAAgBmB,EAAUA,EAAQnB,WAAa,KACjE/C,KAAKgD,QAAU,IAAI3B,EAAQ6C,EAAQlB,SACnChD,KAAKiD,IAAMiB,EAAQjB,KAAO,GAC1BjD,KAAKoH,UAAU4B,IAlYnB,MAgdmB,IAAT9I,EAAuBA,EAAOF,QACrChC,KAAK6B,OAAU,GAClB,IAAII,EAAQJ,EAASI,MACNA,EAAM4C,SAAWhD,EAASgD,SAC3B5C,EAAMuC,QAAU3C,EAAS2C,QACzBvC,EAAMoB,QAAUxB,EAASwB,QACjB,WAAlB6H,EAAOtL,IAAuBA,EAAOD,UACzCC,EAAOD,QAAUsC,EAEjBrC,EAAOD,QAAQwL,QAAUlJ,4QC/dzBrC,EAAOD,QAAyB,WAAf,oBAAOuC,KAAP,YAAAgJ,EAAOhJ,OAAmBA,KAAKqH,SAAW6B,OAAO7B,wBCDlE3J,EAAOD,QAAU,SAASC,GAoBzB,OAnBKA,EAAOyL,kBACXzL,EAAO0L,UAAY,aACnB1L,EAAO2L,SAEF3L,EAAO4L,WAAU5L,EAAO4L,aAC7BjL,OAAOC,eAAeZ,EAAQ,UAC7Ba,YAAY,EACZC,IAAK,WACJ,OAAOd,EAAOE,KAGhBS,OAAOC,eAAeZ,EAAQ,MAC7Ba,YAAY,EACZC,IAAK,WACJ,OAAOd,EAAOC,KAGhBD,EAAOyL,gBAAkB,GAEnBzL,k4DCjB8B6L,GAAGC,QAAlCC,aAAUC,gBACqBH,GAAGI,KAAlCC,eAAYC,iBACZC,EAA+BP,GAAGO,QAAlCA,QACAC,EAAeR,GAAGS,WAAlBD,OACAE,EAAYV,GAAGW,KAAfD,GACA3K,EAAgB6K,OAAhB7K,SAKM8K,EAAb,SAAAC,GAAA,SAAAD,IAAA,IAAAE,EAAAC,EAAAC,EAAA1K,KAAAsK,GAAA,QAAAK,EAAAC,UAAA1C,OAAA2C,EAAA,IAAA7E,MAAA2E,GAAAG,EAAA,EAAAA,EAAAH,EAAAG,IAAAD,EAAAC,GAAAF,UAAAE,GAAA,OAAAC,EAAAC,IAAAP,EAAAQ,EAAAjL,MAAAwK,EAAAU,EAAAZ,IAAAtM,KAAAmN,MAAAX,GAAAxK,MAAAoL,OAAAP,OAAA,SAEEQ,UAAW,KACXC,IAAKnB,EAAG,gBAHVY,EAAAC,IAAAP,IAAA,iBAgBkB,WAChBA,EAAKc,YAAYd,EAAKe,MAAMC,UAC1B5D,KAAK,SAAAwD,GAAS,OAAIZ,EAAKiB,UAAUL,gBACjCM,MAAM,SAACC,GAAD,OAASC,QAAQC,IAAIF,IAAQnB,EAAKiB,UAAUJ,IAAKnB,EAAG,8BAnB9DY,EAAAC,IAAAP,IAAA,cAsBe,SAAAgB,GACb,IAAM5B,EAAO,IAAItC,IAKjB,OAHAsC,EAAKvI,OAAO,SAAU,aACtBuI,EAAKvI,OAAO,WAAYmK,GAEjBxL,IAAM8L,gBAAgB9I,KAAMkC,OAAQ,OAAQzC,KAAMmH,EAAM7G,SAAUgJ,OAAU,sBACjFnE,KAAK,SAAAoE,GAAG,OAAIA,EAAI3D,SAChBT,KAAKrI,EAAS,sBA9BlBiL,EAAA,OAAAyB,EAAA5B,EAAkCV,GAAlCuC,EAAA7B,IAAAlL,IAAA,qBAAAN,MAAA,SAMoBsN,GACdpM,KAAKwL,MAAMC,UAAYW,EAAUX,UACpCzL,KAAKqM,oBARRjN,IAAA,oBAAAN,MAAA,WAaEkB,KAAKqM,oBAbPjN,IAAA,SAAAN,MAAA,WAiCU,IACDwM,EAAStL,KAAKsM,MAAdhB,IAODiB,EAAKvM,KAAKsM,MAAMjB,UACnBmB,MAAAC,cAAA,OAAKC,IAAK1M,KAAKsM,MAAMjB,YACrBmB,MAAAC,cAAA,YAAOnB,GAEV,OACCkB,MAAAC,cAAA,OAAKE,OATLC,WAAY,MACZC,cAAe,QAQKN,OA9CvBjC,EAAA,GA6DMwC,wMAGa,SAAAtM,GAAK,IACfuM,EAAiBC,EAAKxB,MAAtBuB,cACPE,IAAIC,uBAAyBF,EAAKG,sBAClCC,QAAQ,6BAA8BC,mBAAmBC,UAAUlJ,QAAQ,YAAa2I,oCAIrE,SAAAvM,GACnBwM,EAAKxB,MAAM+B,+DAIY,SAAAC,GACvBC,YACAT,EAAKxB,MAAMkC,sBAAsBC,SAASH,mBAjBhB5D,uCAoBlB,IAAAgE,EACwC5N,KAAKwL,MAA9CqC,EADCD,EACDC,kBAAmBC,EADlBF,EACkBE,mBAG1B,OACCtB,MAAAC,cAAC9C,EAAD,MACImE,GAAsBtB,MAAAC,cAACoB,EAAsB7N,KAAKwL,OAErDgB,MAAAC,cAACxC,GAAO0C,OANWoB,UAAW,QAMFC,QAAShO,KAAKiO,gBAAiBC,UAAU,sCACnE/D,EAAG,+BAGJ2D,EAAqB,GACrBtB,MAAAC,cAAA,WACCD,MAAAC,cAAC0B,GAAa1C,SAAUqC,IACxBtB,MAAAC,cAACxC,GAAO+D,QAAShO,KAAKoO,kBAAmBF,UAAU,0BACjD/D,EAAG,qCA2BLkE,EAAkBvE,EAAY,SAAEwE,GAAY,IAAAC,EACID,EAAQ,eAArDE,EADyCD,EACzCC,iBAAkBC,EADuBF,EACvBE,uBACpBC,EAAkBD,EAAwB,kBAC1CE,EAAOF,EAAuB,QAC9BX,OAAsC,IAATa,GAAwBA,EAAKC,mBAAsBD,EAAKC,mBAAqB,KAEhH,OACC7B,cAAeyB,IACfE,kBACAZ,wBAWIe,EAAoB9E,EAAc,SAAE+E,GAAc,IAC/CC,EAAaD,EAAU,eAAvBC,SACR,OACCrB,sBADM,SACgBjC,GACrB,IAAIkD,EAAOlF,GAAGI,KAAKyE,OAAO,eAAeG,uBAAuB,aAC5C,IAATE,IACVA,MAEDA,EAAKC,mBAAqBnD,EAC1BsD,EAAQC,KACJL,GACHA,WAIFpB,yBAbM,WAcL,IAAMoB,EAAOlF,GAAGI,KAAKyE,OAAO,eAAeG,uBAAuB,QAClEE,EAAKC,mBAAqB,EAC1BD,EAAKM,eAAiB,EACtBF,EAAQC,KACJL,GACHA,cAOWO,EAAA,SAAArB,GAAiB,OAAI7D,EACnCqE,EACAQ,EAFmC7E,CA5DX,SAAA6D,GAAiB,OAAI,SAAArC,GAAK,OAClDgB,MAAAC,cAACK,EAADqC,GAAetB,kBAAmBA,GAAuBrC,KA8DxD4D,CAAiBvB,KC3LZwB,EAAmBhF,OAAnBgF,QASDC,GACF5Q,IADkB,SACdmC,EAAK0O,GACL,MAAY,WAARA,IACa,qBAARA,EACEC,EAVU,SAAA3O,GAAG,OAAIwO,EAAQ,SAAAE,GACxC,OAAO1O,EAAI0O,KASqBE,CAAqB5O,EAArB4O,CAA0BF,IAE/C1O,EAAI0O,MAGbG,GACFhR,IADY,SACRmC,EAAK0O,GAML,MALY,UAARA,GACI1O,EAAI0O,KAAU1O,EAAI0O,GAAMI,UACxB9O,EAAI0O,GAAQ,IAAIK,MAAM/O,EAAI0O,GAAOD,IAGlCzO,EAAI0O,IAGf3N,IAVY,SAURf,EAAK0O,EAAMzQ,GAKX,MAJY,UAARyQ,GAAqBzQ,EAAM6Q,UAC3B7Q,EAAQ,IAAI8Q,MAAM9Q,EAAOwQ,IAE7BzO,EAAI0O,GAAQzQ,EACLA,IAGfsK,OAAOK,GAAGoG,eAAiBzG,OAAOK,GAAGqG,OACrC1G,OAAOK,GAAK,IAAImG,MAAMnG,GAAIiG","file":"post-thumbnail.min.js","sourcesContent":[" \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId]) {\n \t\t\treturn installedModules[moduleId].exports;\n \t\t}\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\ti: moduleId,\n \t\t\tl: false,\n \t\t\texports: {}\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.l = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// define getter function for harmony exports\n \t__webpack_require__.d = function(exports, name, getter) {\n \t\tif(!__webpack_require__.o(exports, name)) {\n \t\t\tObject.defineProperty(exports, name, { enumerable: true, get: getter });\n \t\t}\n \t};\n\n \t// define __esModule on exports\n \t__webpack_require__.r = function(exports) {\n \t\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n \t\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n \t\t}\n \t\tObject.defineProperty(exports, '__esModule', { value: true });\n \t};\n\n \t// create a fake namespace object\n \t// mode & 1: value is a module id, require it\n \t// mode & 2: merge all properties of value into the ns\n \t// mode & 4: return value when already ns object\n \t// mode & 8|1: behave like require\n \t__webpack_require__.t = function(value, mode) {\n \t\tif(mode & 1) value = __webpack_require__(value);\n \t\tif(mode & 8) return value;\n \t\tif((mode & 4) && typeof value === 'object' && value && value.__esModule) return value;\n \t\tvar ns = Object.create(null);\n \t\t__webpack_require__.r(ns);\n \t\tObject.defineProperty(ns, 'default', { enumerable: true, value: value });\n \t\tif(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key));\n \t\treturn ns;\n \t};\n\n \t// getDefaultExport function for compatibility with non-harmony modules\n \t__webpack_require__.n = function(module) {\n \t\tvar getter = module && module.__esModule ?\n \t\t\tfunction getDefault() { return module['default']; } :\n \t\t\tfunction getModuleExports() { return module; };\n \t\t__webpack_require__.d(getter, 'a', getter);\n \t\treturn getter;\n \t};\n\n \t// Object.prototype.hasOwnProperty.call\n \t__webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(__webpack_require__.s = 3);\n","var __root__ = (function (root) {\nfunction F() { this.fetch = false; }\nF.prototype = root;\nreturn new F();\n})(typeof self !== 'undefined' ? self : this);\n(function(self) {\n\n(function(self) {\n\n if (self.fetch) {\n return\n }\n\n var support = {\n searchParams: 'URLSearchParams' in self,\n iterable: 'Symbol' in self && 'iterator' in Symbol,\n blob: 'FileReader' in self && 'Blob' in self && (function() {\n try {\n new Blob();\n return true\n } catch(e) {\n return false\n }\n })(),\n formData: 'FormData' in self,\n arrayBuffer: 'ArrayBuffer' in self\n };\n\n if (support.arrayBuffer) {\n var viewClasses = [\n '[object Int8Array]',\n '[object Uint8Array]',\n '[object Uint8ClampedArray]',\n '[object Int16Array]',\n '[object Uint16Array]',\n '[object Int32Array]',\n '[object Uint32Array]',\n '[object Float32Array]',\n '[object Float64Array]'\n ];\n\n var isDataView = function(obj) {\n return obj && DataView.prototype.isPrototypeOf(obj)\n };\n\n var isArrayBufferView = ArrayBuffer.isView || function(obj) {\n return obj && viewClasses.indexOf(Object.prototype.toString.call(obj)) > -1\n };\n }\n\n function normalizeName(name) {\n if (typeof name !== 'string') {\n name = String(name);\n }\n if (/[^a-z0-9\\-#$%&'*+.\\^_`|~]/i.test(name)) {\n throw new TypeError('Invalid character in header field name')\n }\n return name.toLowerCase()\n }\n\n function normalizeValue(value) {\n if (typeof value !== 'string') {\n value = String(value);\n }\n return value\n }\n\n // Build a destructive iterator for the value list\n function iteratorFor(items) {\n var iterator = {\n next: function() {\n var value = items.shift();\n return {done: value === undefined, value: value}\n }\n };\n\n if (support.iterable) {\n iterator[Symbol.iterator] = function() {\n return iterator\n };\n }\n\n return iterator\n }\n\n function Headers(headers) {\n this.map = {};\n\n if (headers instanceof Headers) {\n headers.forEach(function(value, name) {\n this.append(name, value);\n }, this);\n } else if (Array.isArray(headers)) {\n headers.forEach(function(header) {\n this.append(header[0], header[1]);\n }, this);\n } else if (headers) {\n Object.getOwnPropertyNames(headers).forEach(function(name) {\n this.append(name, headers[name]);\n }, this);\n }\n }\n\n Headers.prototype.append = function(name, value) {\n name = normalizeName(name);\n value = normalizeValue(value);\n var oldValue = this.map[name];\n this.map[name] = oldValue ? oldValue+','+value : value;\n };\n\n Headers.prototype['delete'] = function(name) {\n delete this.map[normalizeName(name)];\n };\n\n Headers.prototype.get = function(name) {\n name = normalizeName(name);\n return this.has(name) ? this.map[name] : null\n };\n\n Headers.prototype.has = function(name) {\n return this.map.hasOwnProperty(normalizeName(name))\n };\n\n Headers.prototype.set = function(name, value) {\n this.map[normalizeName(name)] = normalizeValue(value);\n };\n\n Headers.prototype.forEach = function(callback, thisArg) {\n for (var name in this.map) {\n if (this.map.hasOwnProperty(name)) {\n callback.call(thisArg, this.map[name], name, this);\n }\n }\n };\n\n Headers.prototype.keys = function() {\n var items = [];\n this.forEach(function(value, name) { items.push(name); });\n return iteratorFor(items)\n };\n\n Headers.prototype.values = function() {\n var items = [];\n this.forEach(function(value) { items.push(value); });\n return iteratorFor(items)\n };\n\n Headers.prototype.entries = function() {\n var items = [];\n this.forEach(function(value, name) { items.push([name, value]); });\n return iteratorFor(items)\n };\n\n if (support.iterable) {\n Headers.prototype[Symbol.iterator] = Headers.prototype.entries;\n }\n\n function consumed(body) {\n if (body.bodyUsed) {\n return Promise.reject(new TypeError('Already read'))\n }\n body.bodyUsed = true;\n }\n\n function fileReaderReady(reader) {\n return new Promise(function(resolve, reject) {\n reader.onload = function() {\n resolve(reader.result);\n };\n reader.onerror = function() {\n reject(reader.error);\n };\n })\n }\n\n function readBlobAsArrayBuffer(blob) {\n var reader = new FileReader();\n var promise = fileReaderReady(reader);\n reader.readAsArrayBuffer(blob);\n return promise\n }\n\n function readBlobAsText(blob) {\n var reader = new FileReader();\n var promise = fileReaderReady(reader);\n reader.readAsText(blob);\n return promise\n }\n\n function readArrayBufferAsText(buf) {\n var view = new Uint8Array(buf);\n var chars = new Array(view.length);\n\n for (var i = 0; i < view.length; i++) {\n chars[i] = String.fromCharCode(view[i]);\n }\n return chars.join('')\n }\n\n function bufferClone(buf) {\n if (buf.slice) {\n return buf.slice(0)\n } else {\n var view = new Uint8Array(buf.byteLength);\n view.set(new Uint8Array(buf));\n return view.buffer\n }\n }\n\n function Body() {\n this.bodyUsed = false;\n\n this._initBody = function(body) {\n this._bodyInit = body;\n if (!body) {\n this._bodyText = '';\n } else if (typeof body === 'string') {\n this._bodyText = body;\n } else if (support.blob && Blob.prototype.isPrototypeOf(body)) {\n this._bodyBlob = body;\n } else if (support.formData && FormData.prototype.isPrototypeOf(body)) {\n this._bodyFormData = body;\n } else if (support.searchParams && URLSearchParams.prototype.isPrototypeOf(body)) {\n this._bodyText = body.toString();\n } else if (support.arrayBuffer && support.blob && isDataView(body)) {\n this._bodyArrayBuffer = bufferClone(body.buffer);\n // IE 10-11 can't handle a DataView body.\n this._bodyInit = new Blob([this._bodyArrayBuffer]);\n } else if (support.arrayBuffer && (ArrayBuffer.prototype.isPrototypeOf(body) || isArrayBufferView(body))) {\n this._bodyArrayBuffer = bufferClone(body);\n } else {\n throw new Error('unsupported BodyInit type')\n }\n\n if (!this.headers.get('content-type')) {\n if (typeof body === 'string') {\n this.headers.set('content-type', 'text/plain;charset=UTF-8');\n } else if (this._bodyBlob && this._bodyBlob.type) {\n this.headers.set('content-type', this._bodyBlob.type);\n } else if (support.searchParams && URLSearchParams.prototype.isPrototypeOf(body)) {\n this.headers.set('content-type', 'application/x-www-form-urlencoded;charset=UTF-8');\n }\n }\n };\n\n if (support.blob) {\n this.blob = function() {\n var rejected = consumed(this);\n if (rejected) {\n return rejected\n }\n\n if (this._bodyBlob) {\n return Promise.resolve(this._bodyBlob)\n } else if (this._bodyArrayBuffer) {\n return Promise.resolve(new Blob([this._bodyArrayBuffer]))\n } else if (this._bodyFormData) {\n throw new Error('could not read FormData body as blob')\n } else {\n return Promise.resolve(new Blob([this._bodyText]))\n }\n };\n\n this.arrayBuffer = function() {\n if (this._bodyArrayBuffer) {\n return consumed(this) || Promise.resolve(this._bodyArrayBuffer)\n } else {\n return this.blob().then(readBlobAsArrayBuffer)\n }\n };\n }\n\n this.text = function() {\n var rejected = consumed(this);\n if (rejected) {\n return rejected\n }\n\n if (this._bodyBlob) {\n return readBlobAsText(this._bodyBlob)\n } else if (this._bodyArrayBuffer) {\n return Promise.resolve(readArrayBufferAsText(this._bodyArrayBuffer))\n } else if (this._bodyFormData) {\n throw new Error('could not read FormData body as text')\n } else {\n return Promise.resolve(this._bodyText)\n }\n };\n\n if (support.formData) {\n this.formData = function() {\n return this.text().then(decode)\n };\n }\n\n this.json = function() {\n return this.text().then(JSON.parse)\n };\n\n return this\n }\n\n // HTTP methods whose capitalization should be normalized\n var methods = ['DELETE', 'GET', 'HEAD', 'OPTIONS', 'POST', 'PUT'];\n\n function normalizeMethod(method) {\n var upcased = method.toUpperCase();\n return (methods.indexOf(upcased) > -1) ? upcased : method\n }\n\n function Request(input, options) {\n options = options || {};\n var body = options.body;\n\n if (input instanceof Request) {\n if (input.bodyUsed) {\n throw new TypeError('Already read')\n }\n this.url = input.url;\n this.credentials = input.credentials;\n if (!options.headers) {\n this.headers = new Headers(input.headers);\n }\n this.method = input.method;\n this.mode = input.mode;\n if (!body && input._bodyInit != null) {\n body = input._bodyInit;\n input.bodyUsed = true;\n }\n } else {\n this.url = String(input);\n }\n\n this.credentials = options.credentials || this.credentials || 'omit';\n if (options.headers || !this.headers) {\n this.headers = new Headers(options.headers);\n }\n this.method = normalizeMethod(options.method || this.method || 'GET');\n this.mode = options.mode || this.mode || null;\n this.referrer = null;\n\n if ((this.method === 'GET' || this.method === 'HEAD') && body) {\n throw new TypeError('Body not allowed for GET or HEAD requests')\n }\n this._initBody(body);\n }\n\n Request.prototype.clone = function() {\n return new Request(this, { body: this._bodyInit })\n };\n\n function decode(body) {\n var form = new FormData();\n body.trim().split('&').forEach(function(bytes) {\n if (bytes) {\n var split = bytes.split('=');\n var name = split.shift().replace(/\\+/g, ' ');\n var value = split.join('=').replace(/\\+/g, ' ');\n form.append(decodeURIComponent(name), decodeURIComponent(value));\n }\n });\n return form\n }\n\n function parseHeaders(rawHeaders) {\n var headers = new Headers();\n // Replace instances of \\r\\n and \\n followed by at least one space or horizontal tab with a space\n // https://tools.ietf.org/html/rfc7230#section-3.2\n var preProcessedHeaders = rawHeaders.replace(/\\r?\\n[\\t ]+/g, ' ');\n preProcessedHeaders.split(/\\r?\\n/).forEach(function(line) {\n var parts = line.split(':');\n var key = parts.shift().trim();\n if (key) {\n var value = parts.join(':').trim();\n headers.append(key, value);\n }\n });\n return headers\n }\n\n Body.call(Request.prototype);\n\n function Response(bodyInit, options) {\n if (!options) {\n options = {};\n }\n\n this.type = 'default';\n this.status = options.status === undefined ? 200 : options.status;\n this.ok = this.status >= 200 && this.status < 300;\n this.statusText = 'statusText' in options ? options.statusText : 'OK';\n this.headers = new Headers(options.headers);\n this.url = options.url || '';\n this._initBody(bodyInit);\n }\n\n Body.call(Response.prototype);\n\n Response.prototype.clone = function() {\n return new Response(this._bodyInit, {\n status: this.status,\n statusText: this.statusText,\n headers: new Headers(this.headers),\n url: this.url\n })\n };\n\n Response.error = function() {\n var response = new Response(null, {status: 0, statusText: ''});\n response.type = 'error';\n return response\n };\n\n var redirectStatuses = [301, 302, 303, 307, 308];\n\n Response.redirect = function(url, status) {\n if (redirectStatuses.indexOf(status) === -1) {\n throw new RangeError('Invalid status code')\n }\n\n return new Response(null, {status: status, headers: {location: url}})\n };\n\n self.Headers = Headers;\n self.Request = Request;\n self.Response = Response;\n\n self.fetch = function(input, init) {\n return new Promise(function(resolve, reject) {\n var request = new Request(input, init);\n var xhr = new XMLHttpRequest();\n\n xhr.onload = function() {\n var options = {\n status: xhr.status,\n statusText: xhr.statusText,\n headers: parseHeaders(xhr.getAllResponseHeaders() || '')\n };\n options.url = 'responseURL' in xhr ? xhr.responseURL : options.headers.get('X-Request-URL');\n var body = 'response' in xhr ? xhr.response : xhr.responseText;\n resolve(new Response(body, options));\n };\n\n xhr.onerror = function() {\n reject(new TypeError('Network request failed'));\n };\n\n xhr.ontimeout = function() {\n reject(new TypeError('Network request failed'));\n };\n\n xhr.open(request.method, request.url, true);\n\n if (request.credentials === 'include') {\n xhr.withCredentials = true;\n } else if (request.credentials === 'omit') {\n xhr.withCredentials = false;\n }\n\n if ('responseType' in xhr && support.blob) {\n xhr.responseType = 'blob';\n }\n\n request.headers.forEach(function(value, name) {\n xhr.setRequestHeader(name, value);\n });\n\n xhr.send(typeof request._bodyInit === 'undefined' ? null : request._bodyInit);\n })\n };\n self.fetch.polyfill = true;\n})(typeof self !== 'undefined' ? self : this);\n}).call(__root__, void(0));\nvar fetch = __root__.fetch;\nvar Response = fetch.Response = __root__.Response;\nvar Request = fetch.Request = __root__.Request;\nvar Headers = fetch.Headers = __root__.Headers;\nif (typeof module === 'object' && module.exports) {\nmodule.exports = fetch;\n// Needed for TypeScript consumers without esModuleInterop.\nmodule.exports.default = fetch;\n}\n","/* eslint-env browser */\nmodule.exports = typeof self == 'object' ? self.FormData : window.FormData;\n","module.exports = function(module) {\n\tif (!module.webpackPolyfill) {\n\t\tmodule.deprecate = function() {};\n\t\tmodule.paths = [];\n\t\t// module.parent = undefined by default\n\t\tif (!module.children) module.children = [];\n\t\tObject.defineProperty(module, \"loaded\", {\n\t\t\tenumerable: true,\n\t\t\tget: function() {\n\t\t\t\treturn module.l;\n\t\t\t}\n\t\t});\n\t\tObject.defineProperty(module, \"id\", {\n\t\t\tenumerable: true,\n\t\t\tget: function() {\n\t\t\t\treturn module.i;\n\t\t\t}\n\t\t});\n\t\tmodule.webpackPolyfill = 1;\n\t}\n\treturn module;\n};\n","import fetch from 'cross-fetch'\nimport FormData from 'form-data'\n\nconst {Fragment, Component} = wp.element\nconst {withSelect, withDispatch} = wp.data\nconst {compose} = wp.compose\nconst {Button}\t\t\t\t\t\t= wp.components\nconst {__}\t\t\t\t\t\t\t= wp.i18n\nconst {property}\t\t\t\t\t= lodash\n\n/**\n * Renders a NGG thumbnail\n */\nexport class NggThumbnail extends Component {\n\tstate = {\n\t\timage_url: null,\n\t\tmsg: __('Loading...')\n\t}\n\n\tcomponentDidUpdate(prevProps) {\n\t\tif (this.props.image_id != prevProps.image_id) {\n\t\t\tthis.updateImageUrl()\n\t\t}\n\t}\n\n\tcomponentDidMount() {\n\t\tthis.updateImageUrl()\n\t}\n\n\tupdateImageUrl = () => {\n\t\tthis.getImageUrl(this.props.image_id)\n\t\t\t.then(image_url => this.setState({image_url}))\n\t\t\t.catch((err) => console.log(err) && this.setState({msg: __(\"Could not load image\")}))\t\t\n\t}\n\n\tgetImageUrl = image_id => {\n\t\tconst data = new FormData()\n\n\t\tdata.append('action', 'get_image')\n\t\tdata.append('image_id', image_id)\t\n\n\t\treturn fetch(photocrati_ajax.url, {method: 'POST', body: data, headers: {'Accept': 'application/json'}})\n\t\t\t.then(res => res.json())\n\t\t\t.then(property('image.image_url'))\n\t}\n\n\trender() {\n\t\tconst {msg} \t\t= this.state\n\n\t\tconst style = {\n\t\t\tpaddingTop: '5px',\n\t\t\tpaddingBottom: '5px'\n\t\t}\n\n\t\tconst el = this.state.image_url\n\t\t\t? <img src={this.state.image_url}/>\n\t\t\t: <span>{msg}</span>\n\t\t\n\t\treturn (\n\t\t\t<div style={style}>{el}</div>\n\t\t)\n\t}\n}\n\n/**\n * Displays the NGG Post Thumbnail component, which is a wrapper\n * around the PostFeaturedImage component.\n * \n * This exponent expects the following props:\n * \n * @param PostFeaturedImage PostFeaturedImage\n * @param Function onUpdatePostThumbnail\n * @param Integer nggPostThumbnailId\n */\nclass PostThumbnail extends Component {\n\n\t// Open the modal window to select a Featured Image\n\thandleOpenClick = e => {\n\t\tconst {currentPostId} = this.props\n\t\ttop.set_ngg_post_thumbnail = this.onUpdatePostThumbnail\n\t\ttb_show(\"Set NextGEN Featured Image\", ngg_featured_image.modal_url.replace(/%post_id%/, currentPostId))\n\t}\n\n\t// Remove the post thumbnail\n\thandleRemoveClick = e => {\n\t\tthis.props.onRemoveNggPostThumbnail()\n\t}\n\n\t// Close the modal window and set the ngg_post_thumbnail post meta field\n\tonUpdatePostThumbnail = ngg_image_id => {\n\t\ttb_remove()\n\t\tthis.props.onSetNggPostThumbnail(parseInt(ngg_image_id))\n\t}\n\n\trender() {\n\t\tconst {PostFeaturedImage, nggPostThumbnailId} = this.props\n\t\tconst buttonStyle = {marginTop: '10px'}\n\n\t\treturn (\n\t\t\t<Fragment>\n\t\t\t\t{! nggPostThumbnailId && <PostFeaturedImage {...this.props}/>}\n\n\t\t\t\t<Button style={buttonStyle} onClick={this.handleOpenClick} className=\"editor-post-featured-image__toggle\">\n\t\t\t\t\t{__('Set NextGEN Featured Image')}\n\t\t\t\t</Button>\n\n\t\t\t\t{nggPostThumbnailId > 0 && \n\t\t\t\t\t<div>\n\t\t\t\t\t\t<NggThumbnail image_id={nggPostThumbnailId}/>\n\t\t\t\t\t\t<Button onClick={this.handleRemoveClick} className=\"is-link is-destructive\">\n\t\t\t\t\t\t\t{__('Remove featured image')}\n\t\t\t\t\t\t</Button>\n\t\t\t\t\t</div>\n\t\t\t\t}\n\t\t\t</Fragment>\n\t\t)\n\t\t\n\t}\n}\n\n/**\n * A higher-order component used to provide the PostFeaturedImage prop\n * to the PostThumbnail component\n * @param PostFeaturedImage PostFeaturedImage \n */\nconst nggPostThumbnail = PostFeaturedImage => props => (\n\t<PostThumbnail PostFeaturedImage={PostFeaturedImage} {...props}/>\n)\n\n/**\n * A higher-order component using the core/editor store which provides the following props\n * to the PostThumbnail component:\n * \n * @param integer currentPostId\t\t\tthe id of the current post\n * @param integer nggPostThumbnailId\tthe NGG image id used as a post thumbnail for the post/page\n * @param integer featuredImageId\t\tthe media library image id used as a post thumbnail for the post/page \t\n */\nconst applyWithSelect = withSelect( ( select ) => {\n\tconst { getCurrentPostId, getEditedPostAttribute } = select( 'core/editor' );\n\tconst featuredImageId = getEditedPostAttribute( 'featured_media' );\n\tconst meta = getEditedPostAttribute('meta')\n\tconst nggPostThumbnailId = (typeof meta !== 'undefined' && meta.ngg_post_thumbnail) ? meta.ngg_post_thumbnail : null;\n\n\treturn {\n\t\tcurrentPostId: getCurrentPostId(),\n\t\tfeaturedImageId,\n\t\tnggPostThumbnailId\n\t};\n} );\n\n\n/**\n * A higher-order component using the core/editor store which provides the following props\n * to the PostThumbnail component:\n * \n * @param function onSetPostThumbnail\n */\nconst applyWithDispatch = withDispatch( ( dispatch ) => {\n\tconst { editPost } = dispatch( 'core/editor' );\n\treturn {\n\t\tonSetNggPostThumbnail(image_id) {\n\t\t\tvar meta = wp.data.select('core/editor').getEditedPostAttribute('meta')\n\t\t\tif (typeof meta === 'undefined') {\n\t\t\t\tmeta = {}\n\t\t\t}\n\t\t\tmeta.ngg_post_thumbnail = image_id\n\t\t\teditPost({\n\t\t\t\t...meta,\n\t\t\t\tmeta\t\n\t\t\t})\n\t\t},\n\t\t\n\t\tonRemoveNggPostThumbnail() {\n\t\t\tconst meta = wp.data.select('core/editor').getEditedPostAttribute('meta')\n\t\t\tmeta.ngg_post_thumbnail = 0\n\t\t\tmeta.featured_media = 0\n\t\t\teditPost({\n\t\t\t\t...meta,\n\t\t\t\tmeta\n\t\t\t})\n\t\t},\n\t};\t\n} );\n\n/** Export a composed component **/\nexport default PostFeaturedImage => compose(\n\tapplyWithSelect,\n\tapplyWithDispatch\n)(nggPostThumbnail(PostFeaturedImage))\n","import NggPostThumbnail from './components/ngg-post-thumbnail.min'\nconst {memoize} = lodash\n\n// Gets the original component which we will wrap\nconst getOriginalComponent = obj => memoize(prop => {\n return obj[prop]\n})\n\n// Wrap wp && wp.editor in a Proxy. We can then override the wp.editor.PostFeaturedImage component\n// TODO: All of this logic should be encapsulated into a utility of some kind.\nconst wpEditorProxy = {\n get(obj, prop) {\n if (prop == 'isProxy') return true\n else if (prop == 'PostFeaturedImage') {\n return NggPostThumbnail(getOriginalComponent(obj)(prop))\n }\n return obj[prop]\n }\n }\nconst wpProxy = {\n get(obj, prop) {\n if (prop == 'editor') {\n if (obj[prop] && !obj[prop].isProxy) {\n obj[prop] = new Proxy(obj[prop], wpEditorProxy) \n }\n }\n return obj[prop]\n },\n\n set(obj, prop, value) {\n if (prop == 'editor' && !value.isProxy) {\n value = new Proxy(value, wpEditorProxy)\n }\n obj[prop] = value\n return value\n }\n}\nwindow.wp.originalEditor = window.wp.editor;\nwindow.wp = new Proxy(wp, wpProxy);\n"],"sourceRoot":""}
|
| 1 |
+
{"version":3,"sources":["webpack:///webpack/bootstrap","webpack:///./node_modules/react/index.js","webpack:///./node_modules/form-data/lib/browser.js","webpack:///./node_modules/cross-fetch/dist/browser-ponyfill.js","webpack:///./node_modules/react/cjs/react.production.min.js","webpack:///./node_modules/object-assign/index.js","webpack:///(webpack)/buildin/module.js","webpack:///./build/nextgen-gallery/products/photocrati_nextgen/modules/nextgen_block/static/src/components/ngg-post-thumbnail.jsx","webpack:///./build/nextgen-gallery/products/photocrati_nextgen/modules/nextgen_block/static/src/post-thumbnail.jsx"],"names":["installedModules","__webpack_require__","moduleId","exports","module","i","l","modules","call","m","c","d","name","getter","o","Object","defineProperty","enumerable","get","r","Symbol","toStringTag","value","t","mode","__esModule","ns","create","key","bind","n","object","property","prototype","hasOwnProperty","p","s","require","self","_typeof","FormData","window","__root__","root","F","this","fetch","support","searchParams","iterable","blob","Blob","e","formData","arrayBuffer","viewClasses","isDataView","obj","DataView","isPrototypeOf","isArrayBufferView","ArrayBuffer","isView","indexOf","toString","Headers","append","normalizeName","normalizeValue","oldValue","map","has","set","forEach","callback","thisArg","keys","items","push","iteratorFor","values","entries","iterator","methods","Request","clone","body","_bodyInit","Body","Response","status","statusText","headers","url","error","response","type","redirectStatuses","redirect","RangeError","location","input","init","Promise","resolve","reject","request","xhr","XMLHttpRequest","onload","options","rawHeaders","replace","split","line","parts","shift","trim","join","parseHeaders","getAllResponseHeaders","responseURL","responseText","onerror","TypeError","ontimeout","open","method","credentials","withCredentials","responseType","setRequestHeader","send","polyfill","String","test","toLowerCase","next","done","undefined","Array","isArray","header","getOwnPropertyNames","consumed","bodyUsed","fileReaderReady","reader","result","readBlobAsArrayBuffer","FileReader","promise","readAsArrayBuffer","bufferClone","buf","slice","view","Uint8Array","byteLength","buffer","_initBody","_bodyText","_bodyBlob","_bodyFormData","URLSearchParams","_bodyArrayBuffer","Error","rejected","then","text","readAsText","readBlobAsText","chars","length","fromCharCode","readArrayBufferAsText","decode","json","JSON","parse","upcased","toUpperCase","normalizeMethod","referrer","form","bytes","decodeURIComponent","bodyInit","ok","k","q","u","v","w","x","y","z","A","B","C","D","a","b","arguments","encodeURIComponent","g","h","f","framesToPop","aa","E","isMounted","enqueueForceUpdate","enqueueReplaceState","enqueueSetState","G","props","context","refs","updater","H","I","isReactComponent","setState","forceUpdate","J","constructor","isPureReactComponent","K","current","currentDispatcher","L","M","ref","__self","__source","N","children","defaultProps","$$typeof","_owner","O","P","Q","R","pop","keyPrefix","func","count","S","V","T","U","=",":","escape","ca","da","W","ba","X","Children","toArray","only","createRef","Component","PureComponent","createContext","_calculateChangedBits","_currentValue","_currentValue2","_threadCount","Provider","Consumer","_context","forwardRef","render","lazy","_ctor","_status","_result","memo","compare","Fragment","StrictMode","Suspense","createElement","cloneElement","createFactory","isValidElement","version","__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED","ReactCurrentOwner","assign","unstable_ConcurrentMode","unstable_Profiler","Y","default","Z","getOwnPropertySymbols","propIsEnumerable","propertyIsEnumerable","test1","test2","test3","letter","err","shouldUseNative","target","source","from","symbols","to","val","toObject","webpackPolyfill","deprecate","paths","dispatch","wp","data","Button","components","element","__","i18n","lodash","NGGFeaturedThumbnail","image_url","msg","_this","getImageUrl","image_id","console","log","photocrati_ajax","Accept","res","prevProps","updateImageUrl","state","el","react_default","src","style","paddingTop","paddingBottom","NGGFeaturedImage","_this2","_classCallCheck","_defineProperty","_assertThisInitialized","_super2","event","top","set_ngg_post_thumbnail","onUpdatePostThumbnail","tb_show","ngg_featured_image","modal_url","currentPostId","meta","_objectSpread","ngg_post_thumbnail","featured_media","ngg_id","editPost","ngg_image_id","tb_remove","parseInt","wp_ml_id","featuredImageId","marginTop","onClick","handleOpenClick","className","ngg_post_thumbnail_NGGFeaturedThumbnail","handleRemoveClick","select","hooks","addFilter","OriginalComponent","getCurrentPostAttribute","post_thumbnail_Fragment","ngg_post_thumbnail_NGGFeaturedImage","_extends"],"mappings":"aACA,IAAAA,KAGA,SAAAC,EAAAC,GAGA,GAAAF,EAAAE,GACA,OAAAF,EAAAE,GAAAC,QAGA,IAAAC,EAAAJ,EAAAE,IACAG,EAAAH,EACAI,GAAA,EACAH,YAUA,OANAI,EAAAL,GAAAM,KAAAJ,EAAAD,QAAAC,IAAAD,QAAAF,GAGAG,EAAAE,GAAA,EAGAF,EAAAD,QAKAF,EAAAQ,EAAAF,EAGAN,EAAAS,EAAAV,EAGAC,EAAAU,EAAA,SAAAR,EAAAS,EAAAC,GACAZ,EAAAa,EAAAX,EAAAS,IACAG,OAAAC,eAAAb,EAAAS,GAA0CK,YAAA,EAAAC,IAAAL,KAK1CZ,EAAAkB,EAAA,SAAAhB,GACA,oBAAAiB,eAAAC,aACAN,OAAAC,eAAAb,EAAAiB,OAAAC,aAAwDC,MAAA,WAExDP,OAAAC,eAAAb,EAAA,cAAiDmB,OAAA,KAQjDrB,EAAAsB,EAAA,SAAAD,EAAAE,GAEA,GADA,EAAAA,IAAAF,EAAArB,EAAAqB,IACA,EAAAE,EAAA,OAAAF,EACA,KAAAE,GAAA,iBAAAF,QAAAG,WAAA,OAAAH,EACA,IAAAI,EAAAX,OAAAY,OAAA,MAGA,GAFA1B,EAAAkB,EAAAO,GACAX,OAAAC,eAAAU,EAAA,WAAyCT,YAAA,EAAAK,UACzC,EAAAE,GAAA,iBAAAF,EAAA,QAAAM,KAAAN,EAAArB,EAAAU,EAAAe,EAAAE,EAAA,SAAAA,GAAgH,OAAAN,EAAAM,IAAqBC,KAAA,KAAAD,IACrI,OAAAF,GAIAzB,EAAA6B,EAAA,SAAA1B,GACA,IAAAS,EAAAT,KAAAqB,WACA,WAA2B,OAAArB,EAAA,SAC3B,WAAiC,OAAAA,GAEjC,OADAH,EAAAU,EAAAE,EAAA,IAAAA,GACAA,GAIAZ,EAAAa,EAAA,SAAAiB,EAAAC,GAAsD,OAAAjB,OAAAkB,UAAAC,eAAA1B,KAAAuB,EAAAC,IAGtD/B,EAAAkC,EAAA,GAIAlC,IAAAmC,EAAA,kCC/EEhC,EAAOD,QAAUkC,EAAQ,iRCF3BjC,EAAOD,QAAyB,WAAf,oBAAOmC,KAAP,YAAAC,EAAOD,OAAmBA,KAAKE,SAAWC,OAAOD,sSCDlE,IAAIE,EAAY,SAAUC,GAC1B,SAASC,IAAMC,KAAKC,OAAQ,EAE5B,OADAF,EAAEX,UAAYU,EACP,IAAIC,EAHK,CAIG,oBAATN,KAAuBA,KAAOO,OACxC,SAAUP,IAEV,SAAUA,GAER,IAAIA,EAAKQ,MAAT,CAIA,IAAIC,GACFC,aAAc,oBAAqBV,EACnCW,SAAU,WAAYX,GAAQ,aAAclB,OAC5C8B,KAAM,eAAgBZ,GAAQ,SAAUA,GAAS,WAC/C,IAEE,OADA,IAAIa,MACG,EACP,MAAMC,GACN,OAAO,GALsC,GAQjDC,SAAU,aAAcf,EACxBgB,YAAa,gBAAiBhB,GAGhC,GAAIS,EAAQO,YACV,IAAIC,GACF,qBACA,sBACA,6BACA,sBACA,uBACA,sBACA,uBACA,wBACA,yBAGEC,EAAa,SAASC,GACxB,OAAOA,GAAOC,SAASzB,UAAU0B,cAAcF,IAG7CG,EAAoBC,YAAYC,QAAU,SAASL,GACrD,OAAOA,GAAOF,EAAYQ,QAAQhD,OAAOkB,UAAU+B,SAASxD,KAAKiD,KAAS,GAyD9EQ,EAAQhC,UAAUiC,OAAS,SAAStD,EAAMU,GACxCV,EAAOuD,EAAcvD,GACrBU,EAAQ8C,EAAe9C,GACvB,IAAI+C,EAAWxB,KAAKyB,IAAI1D,GACxBiC,KAAKyB,IAAI1D,GAAQyD,EAAWA,EAAS,IAAI/C,EAAQA,GAGnD2C,EAAQhC,UAAR,OAA8B,SAASrB,UAC9BiC,KAAKyB,IAAIH,EAAcvD,KAGhCqD,EAAQhC,UAAUf,IAAM,SAASN,GAE/B,OADAA,EAAOuD,EAAcvD,GACdiC,KAAK0B,IAAI3D,GAAQiC,KAAKyB,IAAI1D,GAAQ,MAG3CqD,EAAQhC,UAAUsC,IAAM,SAAS3D,GAC/B,OAAOiC,KAAKyB,IAAIpC,eAAeiC,EAAcvD,KAG/CqD,EAAQhC,UAAUuC,IAAM,SAAS5D,EAAMU,GACrCuB,KAAKyB,IAAIH,EAAcvD,IAASwD,EAAe9C,IAGjD2C,EAAQhC,UAAUwC,QAAU,SAASC,EAAUC,GAC7C,IAAK,IAAI/D,KAAQiC,KAAKyB,IAChBzB,KAAKyB,IAAIpC,eAAetB,IAC1B8D,EAASlE,KAAKmE,EAAS9B,KAAKyB,IAAI1D,GAAOA,EAAMiC,OAKnDoB,EAAQhC,UAAU2C,KAAO,WACvB,IAAIC,KAEJ,OADAhC,KAAK4B,QAAQ,SAASnD,EAAOV,GAAQiE,EAAMC,KAAKlE,KACzCmE,EAAYF,IAGrBZ,EAAQhC,UAAU+C,OAAS,WACzB,IAAIH,KAEJ,OADAhC,KAAK4B,QAAQ,SAASnD,GAASuD,EAAMC,KAAKxD,KACnCyD,EAAYF,IAGrBZ,EAAQhC,UAAUgD,QAAU,WAC1B,IAAIJ,KAEJ,OADAhC,KAAK4B,QAAQ,SAASnD,EAAOV,GAAQiE,EAAMC,MAAMlE,EAAMU,MAChDyD,EAAYF,IAGjB9B,EAAQE,WACVgB,EAAQhC,UAAUb,OAAO8D,UAAYjB,EAAQhC,UAAUgD,SAqJzD,IAAIE,GAAW,SAAU,MAAO,OAAQ,UAAW,OAAQ,OA4C3DC,EAAQnD,UAAUoD,MAAQ,WACxB,OAAO,IAAID,EAAQvC,MAAQyC,KAAMzC,KAAK0C,aAgCxCC,EAAKhF,KAAK4E,EAAQnD,WAgBlBuD,EAAKhF,KAAKiF,EAASxD,WAEnBwD,EAASxD,UAAUoD,MAAQ,WACzB,OAAO,IAAII,EAAS5C,KAAK0C,WACvBG,OAAQ7C,KAAK6C,OACbC,WAAY9C,KAAK8C,WACjBC,QAAS,IAAI3B,EAAQpB,KAAK+C,SAC1BC,IAAKhD,KAAKgD,OAIdJ,EAASK,MAAQ,WACf,IAAIC,EAAW,IAAIN,EAAS,MAAOC,OAAQ,EAAGC,WAAY,KAE1D,OADAI,EAASC,KAAO,QACTD,GAGT,IAAIE,GAAoB,IAAK,IAAK,IAAK,IAAK,KAE5CR,EAASS,SAAW,SAASL,EAAKH,GAChC,IAA0C,IAAtCO,EAAiBlC,QAAQ2B,GAC3B,MAAM,IAAIS,WAAW,uBAGvB,OAAO,IAAIV,EAAS,MAAOC,OAAQA,EAAQE,SAAUQ,SAAUP,MAGjEvD,EAAK2B,QAAUA,EACf3B,EAAK8C,QAAUA,EACf9C,EAAKmD,SAAWA,EAEhBnD,EAAKQ,MAAQ,SAASuD,EAAOC,GAC3B,OAAO,IAAIC,QAAQ,SAASC,EAASC,GACnC,IAAIC,EAAU,IAAItB,EAAQiB,EAAOC,GAC7BK,EAAM,IAAIC,eAEdD,EAAIE,OAAS,WACX,IAAIC,GACFpB,OAAQiB,EAAIjB,OACZC,WAAYgB,EAAIhB,WAChBC,QAxER,SAAsBmB,GACpB,IAAInB,EAAU,IAAI3B,EAYlB,OAT0B8C,EAAWC,QAAQ,eAAgB,KACzCC,MAAM,SAASxC,QAAQ,SAASyC,GAClD,IAAIC,EAAQD,EAAKD,MAAM,KACnBrF,EAAMuF,EAAMC,QAAQC,OACxB,GAAIzF,EAAK,CACP,IAAIN,EAAQ6F,EAAMG,KAAK,KAAKD,OAC5BzB,EAAQ1B,OAAOtC,EAAKN,MAGjBsE,EA2DQ2B,CAAaZ,EAAIa,yBAA2B,KAEvDV,EAAQjB,IAAM,gBAAiBc,EAAMA,EAAIc,YAAcX,EAAQlB,QAAQ1E,IAAI,iBAC3E,IAAIoE,EAAO,aAAcqB,EAAMA,EAAIZ,SAAWY,EAAIe,aAClDlB,EAAQ,IAAIf,EAASH,EAAMwB,KAG7BH,EAAIgB,QAAU,WACZlB,EAAO,IAAImB,UAAU,4BAGvBjB,EAAIkB,UAAY,WACdpB,EAAO,IAAImB,UAAU,4BAGvBjB,EAAImB,KAAKpB,EAAQqB,OAAQrB,EAAQb,KAAK,GAEV,YAAxBa,EAAQsB,YACVrB,EAAIsB,iBAAkB,EACW,SAAxBvB,EAAQsB,cACjBrB,EAAIsB,iBAAkB,GAGpB,iBAAkBtB,GAAO5D,EAAQG,OACnCyD,EAAIuB,aAAe,QAGrBxB,EAAQd,QAAQnB,QAAQ,SAASnD,EAAOV,GACtC+F,EAAIwB,iBAAiBvH,EAAMU,KAG7BqF,EAAIyB,UAAkC,IAAtB1B,EAAQnB,UAA4B,KAAOmB,EAAQnB,cAGvEjD,EAAKQ,MAAMuF,UAAW,EApatB,SAASlE,EAAcvD,GAIrB,GAHoB,iBAATA,IACTA,EAAO0H,OAAO1H,IAEZ,6BAA6B2H,KAAK3H,GACpC,MAAM,IAAIgH,UAAU,0CAEtB,OAAOhH,EAAK4H,cAGd,SAASpE,EAAe9C,GAItB,MAHqB,iBAAVA,IACTA,EAAQgH,OAAOhH,IAEVA,EAIT,SAASyD,EAAYF,GACnB,IAAIK,GACFuD,KAAM,WACJ,IAAInH,EAAQuD,EAAMuC,QAClB,OAAQsB,UAAgBC,IAAVrH,EAAqBA,MAAOA,KAU9C,OANIyB,EAAQE,WACViC,EAAS9D,OAAO8D,UAAY,WAC1B,OAAOA,IAIJA,EAGT,SAASjB,EAAQ2B,GACf/C,KAAKyB,OAEDsB,aAAmB3B,EACrB2B,EAAQnB,QAAQ,SAASnD,EAAOV,GAC9BiC,KAAKqB,OAAOtD,EAAMU,IACjBuB,MACM+F,MAAMC,QAAQjD,GACvBA,EAAQnB,QAAQ,SAASqE,GACvBjG,KAAKqB,OAAO4E,EAAO,GAAIA,EAAO,KAC7BjG,MACM+C,GACT7E,OAAOgI,oBAAoBnD,GAASnB,QAAQ,SAAS7D,GACnDiC,KAAKqB,OAAOtD,EAAMgF,EAAQhF,KACzBiC,MA0DP,SAASmG,EAAS1D,GAChB,GAAIA,EAAK2D,SACP,OAAO1C,QAAQE,OAAO,IAAImB,UAAU,iBAEtCtC,EAAK2D,UAAW,EAGlB,SAASC,EAAgBC,GACvB,OAAO,IAAI5C,QAAQ,SAASC,EAASC,GACnC0C,EAAOtC,OAAS,WACdL,EAAQ2C,EAAOC,SAEjBD,EAAOxB,QAAU,WACflB,EAAO0C,EAAOrD,UAKpB,SAASuD,EAAsBnG,GAC7B,IAAIiG,EAAS,IAAIG,WACbC,EAAUL,EAAgBC,GAE9B,OADAA,EAAOK,kBAAkBtG,GAClBqG,EAoBT,SAASE,EAAYC,GACnB,GAAIA,EAAIC,MACN,OAAOD,EAAIC,MAAM,GAEjB,IAAIC,EAAO,IAAIC,WAAWH,EAAII,YAE9B,OADAF,EAAKpF,IAAI,IAAIqF,WAAWH,IACjBE,EAAKG,OAIhB,SAASvE,IA0FP,OAzFA3C,KAAKoG,UAAW,EAEhBpG,KAAKmH,UAAY,SAAS1E,GAExB,GADAzC,KAAK0C,UAAYD,EACZA,EAEE,GAAoB,iBAATA,EAChBzC,KAAKoH,UAAY3E,OACZ,GAAIvC,EAAQG,MAAQC,KAAKlB,UAAU0B,cAAc2B,GACtDzC,KAAKqH,UAAY5E,OACZ,GAAIvC,EAAQM,UAAYb,SAASP,UAAU0B,cAAc2B,GAC9DzC,KAAKsH,cAAgB7E,OAChB,GAAIvC,EAAQC,cAAgBoH,gBAAgBnI,UAAU0B,cAAc2B,GACzEzC,KAAKoH,UAAY3E,EAAKtB,gBACjB,GAAIjB,EAAQO,aAAeP,EAAQG,MAAQM,EAAW8B,GAC3DzC,KAAKwH,iBAAmBZ,EAAYnE,EAAKyE,QAEzClH,KAAK0C,UAAY,IAAIpC,MAAMN,KAAKwH,uBAC3B,KAAItH,EAAQO,cAAgBO,YAAY5B,UAAU0B,cAAc2B,KAAS1B,EAAkB0B,GAGhG,MAAM,IAAIgF,MAAM,6BAFhBzH,KAAKwH,iBAAmBZ,EAAYnE,QAdpCzC,KAAKoH,UAAY,GAmBdpH,KAAK+C,QAAQ1E,IAAI,kBACA,iBAAToE,EACTzC,KAAK+C,QAAQpB,IAAI,eAAgB,4BACxB3B,KAAKqH,WAAarH,KAAKqH,UAAUlE,KAC1CnD,KAAK+C,QAAQpB,IAAI,eAAgB3B,KAAKqH,UAAUlE,MACvCjD,EAAQC,cAAgBoH,gBAAgBnI,UAAU0B,cAAc2B,IACzEzC,KAAK+C,QAAQpB,IAAI,eAAgB,qDAKnCzB,EAAQG,OACVL,KAAKK,KAAO,WACV,IAAIqH,EAAWvB,EAASnG,MACxB,GAAI0H,EACF,OAAOA,EAGT,GAAI1H,KAAKqH,UACP,OAAO3D,QAAQC,QAAQ3D,KAAKqH,WACvB,GAAIrH,KAAKwH,iBACd,OAAO9D,QAAQC,QAAQ,IAAIrD,MAAMN,KAAKwH,oBACjC,GAAIxH,KAAKsH,cACd,MAAM,IAAIG,MAAM,wCAEhB,OAAO/D,QAAQC,QAAQ,IAAIrD,MAAMN,KAAKoH,cAI1CpH,KAAKS,YAAc,WACjB,OAAIT,KAAKwH,iBACArB,EAASnG,OAAS0D,QAAQC,QAAQ3D,KAAKwH,kBAEvCxH,KAAKK,OAAOsH,KAAKnB,KAK9BxG,KAAK4H,KAAO,WACV,IAAIF,EAAWvB,EAASnG,MACxB,GAAI0H,EACF,OAAOA,EAGT,GAAI1H,KAAKqH,UACP,OAjGN,SAAwBhH,GACtB,IAAIiG,EAAS,IAAIG,WACbC,EAAUL,EAAgBC,GAE9B,OADAA,EAAOuB,WAAWxH,GACXqG,EA6FIoB,CAAe9H,KAAKqH,WACtB,GAAIrH,KAAKwH,iBACd,OAAO9D,QAAQC,QA5FrB,SAA+BkD,GAI7B,IAHA,IAAIE,EAAO,IAAIC,WAAWH,GACtBkB,EAAQ,IAAIhC,MAAMgB,EAAKiB,QAElBxK,EAAI,EAAGA,EAAIuJ,EAAKiB,OAAQxK,IAC/BuK,EAAMvK,GAAKiI,OAAOwC,aAAalB,EAAKvJ,IAEtC,OAAOuK,EAAMtD,KAAK,IAqFSyD,CAAsBlI,KAAKwH,mBAC7C,GAAIxH,KAAKsH,cACd,MAAM,IAAIG,MAAM,wCAEhB,OAAO/D,QAAQC,QAAQ3D,KAAKoH,YAI5BlH,EAAQM,WACVR,KAAKQ,SAAW,WACd,OAAOR,KAAK4H,OAAOD,KAAKQ,KAI5BnI,KAAKoI,KAAO,WACV,OAAOpI,KAAK4H,OAAOD,KAAKU,KAAKC,QAGxBtI,KAWT,SAASuC,EAAQiB,EAAOS,GAEtB,IAAIxB,GADJwB,EAAUA,OACSxB,KAEnB,GAAIe,aAAiBjB,EAAS,CAC5B,GAAIiB,EAAM4C,SACR,MAAM,IAAIrB,UAAU,gBAEtB/E,KAAKgD,IAAMQ,EAAMR,IACjBhD,KAAKmF,YAAc3B,EAAM2B,YACpBlB,EAAQlB,UACX/C,KAAK+C,QAAU,IAAI3B,EAAQoC,EAAMT,UAEnC/C,KAAKkF,OAAS1B,EAAM0B,OACpBlF,KAAKrB,KAAO6E,EAAM7E,KACb8D,GAA2B,MAAnBe,EAAMd,YACjBD,EAAOe,EAAMd,UACbc,EAAM4C,UAAW,QAGnBpG,KAAKgD,IAAMyC,OAAOjC,GAWpB,GARAxD,KAAKmF,YAAclB,EAAQkB,aAAenF,KAAKmF,aAAe,QAC1DlB,EAAQlB,SAAY/C,KAAK+C,UAC3B/C,KAAK+C,QAAU,IAAI3B,EAAQ6C,EAAQlB,UAErC/C,KAAKkF,OAhCP,SAAyBA,GACvB,IAAIqD,EAAUrD,EAAOsD,cACrB,OAAQlG,EAAQpB,QAAQqH,IAAY,EAAKA,EAAUrD,EA8BrCuD,CAAgBxE,EAAQiB,QAAUlF,KAAKkF,QAAU,OAC/DlF,KAAKrB,KAAOsF,EAAQtF,MAAQqB,KAAKrB,MAAQ,KACzCqB,KAAK0I,SAAW,MAEK,QAAhB1I,KAAKkF,QAAoC,SAAhBlF,KAAKkF,SAAsBzC,EACvD,MAAM,IAAIsC,UAAU,6CAEtB/E,KAAKmH,UAAU1E,GAOjB,SAAS0F,EAAO1F,GACd,IAAIkG,EAAO,IAAIhJ,SASf,OARA8C,EAAK+B,OAAOJ,MAAM,KAAKxC,QAAQ,SAASgH,GACtC,GAAIA,EAAO,CACT,IAAIxE,EAAQwE,EAAMxE,MAAM,KACpBrG,EAAOqG,EAAMG,QAAQJ,QAAQ,MAAO,KACpC1F,EAAQ2F,EAAMK,KAAK,KAAKN,QAAQ,MAAO,KAC3CwE,EAAKtH,OAAOwH,mBAAmB9K,GAAO8K,mBAAmBpK,OAGtDkK,EAqBT,SAAS/F,EAASkG,EAAU7E,GACrBA,IACHA,MAGFjE,KAAKmD,KAAO,UACZnD,KAAK6C,YAA4BiD,IAAnB7B,EAAQpB,OAAuB,IAAMoB,EAAQpB,OAC3D7C,KAAK+I,GAAK/I,KAAK6C,QAAU,KAAO7C,KAAK6C,OAAS,IAC9C7C,KAAK8C,WAAa,eAAgBmB,EAAUA,EAAQnB,WAAa,KACjE9C,KAAK+C,QAAU,IAAI3B,EAAQ6C,EAAQlB,SACnC/C,KAAKgD,IAAMiB,EAAQjB,KAAO,GAC1BhD,KAAKmH,UAAU2B,IAlYnB,MAgdmB,IAATrJ,EAAuBA,EAAOO,QACrCrC,KAAKkC,OAAU,GAClB,IAAII,EAAQJ,EAASI,MACNA,EAAM2C,SAAW/C,EAAS+C,SAC3B3C,EAAMsC,QAAU1C,EAAS0C,QACzBtC,EAAMmB,QAAUvB,EAASuB,QACjB,WAAlB1B,EAAOnC,IAAuBA,EAAOD,UACzCC,EAAOD,QAAU2C,EAEjB1C,EAAOD,QAAP,QAAyB2C;;;;;;;;kQCvdZ,IAAI+I,EAAExJ,EAAQ,GAAiBP,EAAE,mBAAoBV,QAAQA,OAAM,IAAKe,EAAEL,EAAEV,OAAM,IAAK,iBAAiB,MAAM0K,EAAEhK,EAAEV,OAAM,IAAK,gBAAgB,MAAMD,EAAEW,EAAEV,OAAM,IAAK,kBAAkB,MAAMG,EAAEO,EAAEV,OAAM,IAAK,qBAAqB,MAAM2K,EAAEjK,EAAEV,OAAM,IAAK,kBAAkB,MAAM4K,EAAElK,EAAEV,OAAM,IAAK,kBAAkB,MAAM6K,EAAEnK,EAAEV,OAAM,IAAK,iBAAiB,MAAM8K,EAAEpK,EAAEV,OAAM,IAAK,yBAAyB,MAAM+K,EAAErK,EAAEV,OAAM,IAAK,qBAAqB,MAAMgL,EAAEtK,EAAEV,OAAM,IAAK,kBAAkB,MAAMiL,EAAEvK,EAAEV,OAAM,IAAK,cACnf,MAAMkL,EAAExK,EAAEV,OAAM,IAAK,cAAc,MAAMmL,EAAE,mBAAoBnL,QAAQA,OAAO8D,SAC9E,SAASsH,EAAEC,GAAG,IAAI,IAAIC,EAAEC,UAAU9B,OAAO,EAAEzH,EAAE,yDAAyDqJ,EAAE/L,EAAE,EAAEA,EAAEgM,EAAEhM,IAAI0C,GAAG,WAAWwJ,mBAAmBD,UAAUjM,EAAE,KAD1E,SAAY+L,EAAEC,EAAEtJ,EAAE1C,EAAEC,EAAEkM,EAAEC,EAAEC,GAAG,IAAIN,EAAE,CAAU,GAATA,OAAE,OAAU,IAASC,EAAED,EAAEnC,MAAM,qIAAqI,CAAC,IAAIhK,GAAG8C,EAAE1C,EAAEC,EAAEkM,EAAEC,EAAEC,GAAGtM,EAAE,GAAEgM,EAAEnC,MAAMoC,EAAE1F,QAAQ,MAAM,WAAW,OAAO1G,EAAEG,SAAUG,KAAK,sBAAsC,MAAhB6L,EAAEO,YAAY,EAAQP,GAC1PQ,EAAG,EAAG,yBAAyBR,EAAE,4HAA4HrJ,GAAG,IAAI8J,GAAGC,UAAU,WAAW,OAAM,GAAIC,mBAAmB,aAAaC,oBAAoB,aAAaC,gBAAgB,cAAc1K,KAC1c,SAAS2K,EAAEd,EAAEC,EAAEtJ,GAAGP,KAAK2K,MAAMf,EAAE5J,KAAK4K,QAAQf,EAAE7J,KAAK6K,KAAK9K,EAAEC,KAAK8K,QAAQvK,GAAG8J,EAAsR,SAASU,KAA6B,SAASC,EAAEpB,EAAEC,EAAEtJ,GAAGP,KAAK2K,MAAMf,EAAE5J,KAAK4K,QAAQf,EAAE7J,KAAK6K,KAAK9K,EAAEC,KAAK8K,QAAQvK,GAAG8J,EAApYK,EAAEtL,UAAU6L,oBAAoBP,EAAEtL,UAAU8L,SAAS,SAAStB,EAAEC,GAAG,WAAAnK,EAAkBkK,IAAG,mBAAoBA,GAAG,MAAMA,GAAED,EAAE,MAAa3J,KAAK8K,QAAQL,gBAAgBzK,KAAK4J,EAAEC,EAAE,aAAaa,EAAEtL,UAAU+L,YAAY,SAASvB,GAAG5J,KAAK8K,QAAQP,mBAAmBvK,KAAK4J,EAAE,gBAA8BmB,EAAE3L,UAAUsL,EAAEtL,UAAsF,IAAIgM,EAAEJ,EAAE5L,UAAU,IAAI2L,EACxeK,EAAEC,YAAYL,EAAEhC,EAAEoC,EAAEV,EAAEtL,WAAWgM,EAAEE,sBAAqB,EAAG,IAAIC,GAAGC,QAAQ,KAAKC,kBAAkB,MAAMC,EAAExN,OAAOkB,UAAUC,eAAesM,GAAG5M,KAAI,EAAG6M,KAAI,EAAGC,QAAO,EAAGC,UAAS,GAC7K,SAASC,EAAEnC,EAAEC,EAAEtJ,GAAG,IAAI1C,OAAE,EAAOC,KAAKkM,EAAE,KAAKC,EAAE,KAAK,GAAG,MAAMJ,EAAE,IAAIhM,UAAK,IAASgM,EAAE+B,MAAM3B,EAAEJ,EAAE+B,UAAK,IAAS/B,EAAE9K,MAAMiL,EAAE,GAAGH,EAAE9K,KAAK8K,EAAE6B,EAAE/N,KAAKkM,EAAEhM,KAAK8N,EAAEtM,eAAexB,KAAKC,EAAED,GAAGgM,EAAEhM,IAAI,IAAIqM,EAAEJ,UAAU9B,OAAO,EAAE,GAAG,IAAIkC,EAAEpM,EAAEkO,SAASzL,OAAO,GAAG,EAAE2J,EAAE,CAAC,IAAI,IAAIzM,EAAEsI,MAAMmE,GAAGtM,EAAE,EAAEA,EAAEsM,EAAEtM,IAAIH,EAAEG,GAAGkM,UAAUlM,EAAE,GAAGE,EAAEkO,SAASvO,EAAE,GAAGmM,GAAGA,EAAEqC,aAAa,IAAIpO,KAAKqM,EAAEN,EAAEqC,kBAAe,IAASnO,EAAED,KAAKC,EAAED,GAAGqM,EAAErM,IAAI,OAAOqO,SAAS5M,EAAE6D,KAAKyG,EAAE7K,IAAIiL,EAAE4B,IAAI3B,EAAEU,MAAM7M,EAAEqO,OAAOZ,EAAEC,SAC9U,SAASY,EAAExC,GAAG,MAAM,WAAAlK,EAAkBkK,IAAG,OAAOA,GAAGA,EAAEsC,WAAW5M,EAA0G,IAAI+M,EAAE,OAAOC,KAAK,SAASC,EAAE3C,EAAEC,EAAEtJ,EAAE1C,GAAG,GAAGyO,EAAEtE,OAAO,CAAC,IAAIlK,EAAEwO,EAAEE,MAA8D,OAAxD1O,EAAEyI,OAAOqD,EAAE9L,EAAE2O,UAAU5C,EAAE/L,EAAE4O,KAAKnM,EAAEzC,EAAE8M,QAAQ/M,EAAEC,EAAE6O,MAAM,EAAS7O,EAAE,OAAOyI,OAAOqD,EAAE6C,UAAU5C,EAAE6C,KAAKnM,EAAEqK,QAAQ/M,EAAE8O,MAAM,GAC7b,SAASC,EAAEhD,GAAGA,EAAErD,OAAO,KAAKqD,EAAE6C,UAAU,KAAK7C,EAAE8C,KAAK,KAAK9C,EAAEgB,QAAQ,KAAKhB,EAAE+C,MAAM,EAAE,GAAGL,EAAEtE,QAAQsE,EAAErK,KAAK2H,GAE+E,SAASiD,EAAEjD,EAAEC,EAAEtJ,GAAG,OAAO,MAAMqJ,EAAE,EADtN,SAASkD,EAAElD,EAAEC,EAAEtJ,EAAE1C,GAAG,IAAIC,EAAC4B,EAAQkK,GAAK,cAAc9L,GAAG,YAAYA,IAAE8L,EAAE,MAAK,IAAII,GAAE,EAAG,GAAG,OAAOJ,EAAEI,GAAE,OAAQ,OAAOlM,GAAG,IAAK,SAAS,IAAK,SAASkM,GAAE,EAAG,MAAM,IAAK,SAAS,OAAOJ,EAAEsC,UAAU,KAAK5M,EAAE,KAAK2J,EAAEe,GAAE,GAAI,GAAGA,EAAE,OAAOzJ,EAAE1C,EAAE+L,EAAE,KAAKC,EAAE,IAAIkD,EAAEnD,EAAE,GAAGC,GAAG,EAAyB,GAAvBG,EAAE,EAAEH,EAAE,KAAKA,EAAE,IAAIA,EAAE,IAAO9D,MAAMC,QAAQ4D,GAAG,IAAI,IAAIK,EAAE,EAAEA,EAAEL,EAAE5B,OAAOiC,IAAI,CAAQ,IAAIC,EAAEL,EAAEkD,EAAfjP,EAAE8L,EAAEK,GAAeA,GAAGD,GAAG8C,EAAEhP,EAAEoM,EAAE3J,EAAE1C,QAAQ,GAAiCqM,EAA9B,OAAON,GAAG,WAAAlK,EAAkBkK,GAAI,KAAmC,mBAA7BM,EAAER,GAAGE,EAAEF,IAAIE,EAAE,eAAsCM,EAAE,KAAM,mBAAoBA,EAAE,IAAIN,EAAEM,EAAEvM,KAAKiM,GAAGK,EACpf,IAAInM,EAAE8L,EAAEhE,QAAQC,MAA6BmE,GAAG8C,EAA1BhP,EAAEA,EAAEW,MAAMyL,EAAEL,EAAEkD,EAAEjP,EAAEmM,KAAc1J,EAAE1C,OAAO,WAAWC,GAAW6L,EAAE,KAAK,oBAAdpJ,EAAE,GAAGqJ,GAA+B,qBAAqB1L,OAAO6D,KAAK6H,GAAGnF,KAAK,MAAM,IAAIlE,EAAE,IAAK,OAAOyJ,EAAqC8C,CAAElD,EAAE,GAAGC,EAAEtJ,GAAG,SAASwM,EAAEnD,EAAEC,GAAG,MAAM,WAAAnK,EAAkBkK,IAAG,OAAOA,GAAG,MAAMA,EAAE7K,IAHjI,SAAgB6K,GAAG,IAAIC,GAAGmD,IAAI,KAAKC,IAAI,MAAM,MAAM,KAAK,GAAGrD,GAAGzF,QAAQ,QAAQ,SAASyF,GAAG,OAAOC,EAAED,KAGkCsD,CAAOtD,EAAE7K,KAAK8K,EAAE1I,SAAS,IAAI,SAASgM,EAAGvD,EAAEC,GAAGD,EAAE8C,KAAK/O,KAAKiM,EAAEgB,QAAQf,EAAED,EAAE+C,SAC7W,SAASS,EAAGxD,EAAEC,EAAEtJ,GAAG,IAAI1C,EAAE+L,EAAErD,OAAOzI,EAAE8L,EAAE6C,UAAU7C,EAAEA,EAAE8C,KAAK/O,KAAKiM,EAAEgB,QAAQf,EAAED,EAAE+C,SAAS5G,MAAMC,QAAQ4D,GAAGyD,EAAEzD,EAAE/L,EAAE0C,EAAE,SAASqJ,GAAG,OAAOA,IAAI,MAAMA,IAAIwC,EAAExC,KAAKA,EAJtJ,SAAYA,EAAEC,GAAG,OAAOqC,SAAS5M,EAAE6D,KAAKyG,EAAEzG,KAAKpE,IAAI8K,EAAE+B,IAAIhC,EAAEgC,IAAIjB,MAAMf,EAAEe,MAAMwB,OAAOvC,EAAEuC,QAIkEmB,CAAG1D,EAAE9L,IAAI8L,EAAE7K,KAAK8K,GAAGA,EAAE9K,MAAM6K,EAAE7K,IAAI,IAAI,GAAG6K,EAAE7K,KAAKoF,QAAQkI,EAAE,OAAO,KAAK9L,IAAI1C,EAAEoE,KAAK2H,IAAI,SAASyD,EAAEzD,EAAEC,EAAEtJ,EAAE1C,EAAEC,GAAG,IAAIkM,EAAE,GAAG,MAAMzJ,IAAIyJ,GAAG,GAAGzJ,GAAG4D,QAAQkI,EAAE,OAAO,KAAkBQ,EAAEjD,EAAEwD,EAAjBvD,EAAE0C,EAAE1C,EAAEG,EAAEnM,EAAEC,IAAa8O,EAAE/C,GAC7U,IAAI0D,GAAGC,UAAU/L,IAAI,SAASmI,EAAEC,EAAEtJ,GAAG,GAAG,MAAMqJ,EAAE,OAAOA,EAAE,IAAI/L,KAAqB,OAAhBwP,EAAEzD,EAAE/L,EAAE,KAAKgM,EAAEtJ,GAAU1C,GAAG+D,QAAQ,SAASgI,EAAEC,EAAEtJ,GAAG,GAAG,MAAMqJ,EAAE,OAAOA,EAAqBiD,EAAEjD,EAAEuD,EAAvBtD,EAAE0C,EAAE,KAAK,KAAK1C,EAAEtJ,IAAaqM,EAAE/C,IAAI8C,MAAM,SAAS/C,GAAG,OAAOiD,EAAEjD,EAAE,WAAW,OAAO,MAAM,OAAO6D,QAAQ,SAAS7D,GAAG,IAAIC,KAAuC,OAAlCwD,EAAEzD,EAAEC,EAAE,KAAK,SAASD,GAAG,OAAOA,IAAWC,GAAG6D,KAAK,SAAS9D,GAAwB,OAArBwC,EAAExC,IAAUD,EAAE,OAAcC,IAAI+D,UAAU,WAAW,OAAOnC,QAAQ,OAAOoC,UAAUlD,EAAEmD,cAAc7C,EAAE8C,cAAc,SAASlE,EAAEC,GACjV,YADoV,IAASA,IAAIA,EAAE,OAAMD,GAAGsC,SAAS9C,EAAE2E,sBAAsBlE,EAC7fmE,cAAcpE,EAAEqE,eAAerE,EAAEsE,aAAa,EAAEC,SAAS,KAAKC,SAAS,OAAQD,UAAUjC,SAAS/C,EAAEkF,SAASzE,GAAUA,EAAEwE,SAASxE,GAAG0E,WAAW,SAAS1E,GAAG,OAAOsC,SAAS5C,EAAEiF,OAAO3E,IAAI4E,KAAK,SAAS5E,GAAG,OAAOsC,SAASzC,EAAEgF,MAAM7E,EAAE8E,SAAS,EAAEC,QAAQ,OAAOC,KAAK,SAAShF,EAAEC,GAAG,OAAOqC,SAAS1C,EAAErG,KAAKyG,EAAEiF,aAAQ,IAAShF,EAAE,KAAKA,IAAIiF,SAASxQ,EAAEyQ,WAAWrQ,EAAEsQ,SAASzF,EAAE0F,cAAclD,EAAEmD,aAAa,SAAStF,EAAEC,EAAEtJ,IAAG,OAAOqJ,QAAG,IAASA,IAAED,EAAE,MAAMC,GAAU,IAAI/L,OAAE,EAAOC,EAAEkL,KAAKY,EAAEe,OAAOX,EAAEJ,EAAE7K,IAAIkL,EAAEL,EAAEgC,IAAI1B,EAAEN,EAAEuC,OAC9e,GAAG,MAAMtC,EAAE,MAAC,IAASA,EAAE+B,MAAM3B,EAAEJ,EAAE+B,IAAI1B,EAAEqB,EAAEC,cAAS,IAAS3B,EAAE9K,MAAMiL,EAAE,GAAGH,EAAE9K,KAAK,IAAItB,OAAE,EAA4D,IAAII,KAAzD+L,EAAEzG,MAAMyG,EAAEzG,KAAK8I,eAAexO,EAAEmM,EAAEzG,KAAK8I,cAAuBpC,EAAE6B,EAAE/N,KAAKkM,EAAEhM,KAAK8N,EAAEtM,eAAexB,KAAKC,EAAED,QAAG,IAASgM,EAAEhM,SAAI,IAASJ,EAAEA,EAAEI,GAAGgM,EAAEhM,IAAyB,GAAG,KAAxBA,EAAEiM,UAAU9B,OAAO,GAAWlK,EAAEkO,SAASzL,OAAO,GAAG,EAAE1C,EAAE,CAACJ,EAAEsI,MAAMlI,GAAG,IAAI,IAAID,EAAE,EAAEA,EAAEC,EAAED,IAAIH,EAAEG,GAAGkM,UAAUlM,EAAE,GAAGE,EAAEkO,SAASvO,EAAE,OAAOyO,SAAS5M,EAAE6D,KAAKyG,EAAEzG,KAAKpE,IAAIiL,EAAE4B,IAAI3B,EAAEU,MAAM7M,EAAEqO,OAAOjC,IAAIiF,cAAc,SAASvF,GAAG,IAAIC,EAAEkC,EAAE/M,KAAK,KAAK4K,GAAY,OAATC,EAAE1G,KAAKyG,EAASC,GAAGuF,eAAehD,EAAEiD,QAAQ,SAC1fC,oDAAoDC,kBAAkBhE,EAAEiE,OAAOxG,IAAIuE,EAAEkC,wBAAwBpG,EAAEkE,EAAEmC,kBAAkBxG,EAAE,IAAIyG,GAAGC,QAAQrC,GAAGsC,EAAEF,GAAGpC,GAAGoC,EAAEpS,EAAOD,QAAQuS,EAAC,SAAUA;;;;;ECf3L,IAAIC,EAAwB5R,OAAO4R,sBAC/BzQ,EAAiBnB,OAAOkB,UAAUC,eAClC0Q,EAAmB7R,OAAOkB,UAAU4Q,qBAsDxCzS,EAAOD,QA5CP,WACC,IACC,IAAKY,OAAOsR,OACX,OAAO,EAMR,IAAIS,EAAQ,IAAIxK,OAAO,OAEvB,GADAwK,EAAM,GAAK,KACkC,MAAzC/R,OAAOgI,oBAAoB+J,GAAO,GACrC,OAAO,EAKR,IADA,IAAIC,KACK1S,EAAI,EAAGA,EAAI,GAAIA,IACvB0S,EAAM,IAAMzK,OAAOwC,aAAazK,IAAMA,EAKvC,GAAwB,eAHXU,OAAOgI,oBAAoBgK,GAAOzO,IAAI,SAAUxC,GAC5D,OAAOiR,EAAMjR,KAEHwF,KAAK,IACf,OAAO,EAIR,IAAI0L,KAIJ,MAHA,uBAAuB/L,MAAM,IAAIxC,QAAQ,SAAUwO,GAClDD,EAAMC,GAAUA,IAGf,yBADElS,OAAO6D,KAAK7D,OAAOsR,UAAWW,IAAQ1L,KAAK,IAM9C,MAAO4L,GAER,OAAO,GAIQC,GAAoBpS,OAAOsR,OAAS,SAAUe,EAAQC,GAKtE,IAJA,IAAIC,EAEAC,EADAC,EAtDL,SAAkBC,GACjB,GAAY,OAARA,QAAwB9K,IAAR8K,EACnB,MAAM,IAAI7L,UAAU,yDAGrB,OAAO7G,OAAO0S,GAiDLC,CAASN,GAGThR,EAAI,EAAGA,EAAIuK,UAAU9B,OAAQzI,IAAK,CAG1C,IAAK,IAAIR,KAFT0R,EAAOvS,OAAO4L,UAAUvK,IAGnBF,EAAe1B,KAAK8S,EAAM1R,KAC7B4R,EAAG5R,GAAO0R,EAAK1R,IAIjB,GAAI+Q,EAAuB,CAC1BY,EAAUZ,EAAsBW,GAChC,IAAK,IAAIjT,EAAI,EAAGA,EAAIkT,EAAQ1I,OAAQxK,IAC/BuS,EAAiBpS,KAAK8S,EAAMC,EAAQlT,MACvCmT,EAAGD,EAAQlT,IAAMiT,EAAKC,EAAQlT,MAMlC,OAAOmT,kBCxFRpT,EAAOD,QAAU,SAASC,GAoBzB,OAnBKA,EAAOuT,kBACXvT,EAAOwT,UAAY,aACnBxT,EAAOyT,SAEFzT,EAAOyO,WAAUzO,EAAOyO,aAC7B9N,OAAOC,eAAeZ,EAAQ,UAC7Ba,YAAY,EACZC,IAAK,WACJ,OAAOd,EAAOE,KAGhBS,OAAOC,eAAeZ,EAAQ,MAC7Ba,YAAY,EACZC,IAAK,WACJ,OAAOd,EAAOC,KAGhBD,EAAOuT,gBAAkB,GAEnBvT,y3EChBD0T,EAAuBC,GAAGC,KAA1BF,SACAG,EAAuBF,GAAGG,WAA1BD,SACuBF,GAAGI,QAA1BxC,aAAUlB,cACV2D,EAAuBL,GAAGM,KAA1BD,GACApS,EAAuBsS,OAAvBtS,SAEDuS,kBAA6B9D,2KAEjC+D,UAAW,KACXC,IAAKL,EAAG,wCAaQ,WAChBM,EAAKC,YAAYD,EAAKlH,MAAMoH,UAC1BpK,KAAK,SAAAgK,GAAS,OAAIE,EAAK3G,UAAUyG,gBADnC,MAEQ,SAACtB,GAAD,OAAS2B,QAAQC,IAAI5B,IAAQwB,EAAK3G,UAAU0G,IAAKL,EAAG,mDAG/C,SAAAQ,GACb,IAAMZ,EAAO,IAAIxR,IAKjB,OAHAwR,EAAK9P,OAAO,SAAU,aACtB8P,EAAK9P,OAAO,WAAY0Q,GAEjB9R,IAAMiS,gBAAgBlP,KAE3BkC,OAAQ,OACRzC,KAAM0O,EACNpO,SACCoP,OAAU,sBAGXxK,KAAK,SAAAyK,GAAG,OAAIA,EAAIhK,SAChBT,KAAKxI,EAAS,6EA/BEkT,GACdrS,KAAK2K,MAAMoH,WAAaM,EAAUN,UACrC/R,KAAKsS,6DAKNtS,KAAKsS,kDA2BG,IACDV,EAAO5R,KAAKuS,MAAZX,IAODY,EAAKxS,KAAKuS,MAAMZ,UAAYc,EAAA7I,EAAAqF,cAAA,OAAKyD,IAAK1S,KAAKuS,MAAMZ,YAAec,EAAA7I,EAAAqF,cAAA,YAAO2C,GAE7E,OACCa,EAAA7I,EAAAqF,cAAA,OAAK0D,OAPLC,WAAY,MACZC,cAAe,QAMKL,YAKFM,kBAAyBlF,cAE7C,SAAAkF,EAAYnI,GAAO,IAAAoI,EAAA,OAAAC,EAAAhT,KAAA8S,GAAAG,EAAAC,EAClBH,EAAAI,EAAAxV,KAAAqC,KAAM2K,IADY,kBASD,SAAAyI,GACjBC,IAAIC,uBAAyBP,EAAKQ,sBAClCC,QACC,6BACAC,mBAAmBC,UAAUvP,QAAQ,YAAa4O,EAAKpI,MAAMgJ,kBAb5CV,EAAAC,EAAAH,GAAA,oBAiBC,SAAAK,GACnB,IAAMQ,EAAIC,OACNd,EAAKpI,MAAMiJ,UACdE,mBAAoB,EACpBC,eAAgB,IAEjBhB,EAAK7H,UACJ8I,OAAQ,IAET/C,EAAS,eAAegD,UAAUL,WA1BhBX,EAAAC,EAAAH,GAAA,wBA6BK,SAAAmB,GACvBC,YACA,IAAMP,EAAIC,OACNd,EAAKpI,MAAMiJ,UACdE,mBAAoBM,SAASF,KAE9BnB,EAAK7H,UACJ8I,OAAQJ,EAAKE,qBAEd7C,EAAS,eAAegD,UAAUL,WAnClCb,EAAKR,OACJyB,OAAQrJ,EAAMiJ,KAAKE,mBACnBO,SAAU1J,EAAM2J,iBALCvB,6CA0ClB,OACCN,EAAA7I,EAAAqF,cAACH,EAAD,KACC2D,EAAA7I,EAAAqF,cAACmC,GAAOuB,OAAQ4B,UAAW,QACzBC,QAASxU,KAAKyU,gBACdC,UAAU,sCACVnD,EAAG,+BAGJvR,KAAKuS,MAAMyB,OAAS,GAAKhU,KAAK2K,MAAMiJ,KAAKE,qBAAuB9T,KAAKuS,MAAMyB,OAC3EvB,EAAA7I,EAAAqF,cAACH,EAAD,KACC2D,EAAA7I,EAAAqF,cAAC0F,GAAqB5C,SAAU/R,KAAKuS,MAAMyB,SAC3CvB,EAAA7I,EAAAqF,cAACmC,GAAOoD,QAASxU,KAAK4U,kBACpBF,UAAU,0BACVnD,EAAG,2BAGJ,gOC3HAsD,EAAY3D,GAAGC,KAAf0D,OACA/F,EAAYoC,GAAGI,QAAfxC,SAcPoC,GAAG4D,MAAMC,UAAU,2BAA4B,iCAZ/C,SAAiCC,GAC7B,OAAO,SAACrK,GACJ,IAAMiJ,EAAOiB,EAAO,eAAeI,wBAAwB,QAC3D,OACIxC,EAAA7I,EAAAqF,cAACiG,EAAD,KACIzC,EAAA7I,EAAAqF,cAAC+F,EAAsBrK,GACvB8H,EAAA7I,EAAAqF,cAACkG,EAADC,KAAsBzK,GAAOiJ,KAAMA","file":"post-thumbnail.min.js","sourcesContent":[" \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId]) {\n \t\t\treturn installedModules[moduleId].exports;\n \t\t}\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\ti: moduleId,\n \t\t\tl: false,\n \t\t\texports: {}\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.l = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// define getter function for harmony exports\n \t__webpack_require__.d = function(exports, name, getter) {\n \t\tif(!__webpack_require__.o(exports, name)) {\n \t\t\tObject.defineProperty(exports, name, { enumerable: true, get: getter });\n \t\t}\n \t};\n\n \t// define __esModule on exports\n \t__webpack_require__.r = function(exports) {\n \t\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n \t\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n \t\t}\n \t\tObject.defineProperty(exports, '__esModule', { value: true });\n \t};\n\n \t// create a fake namespace object\n \t// mode & 1: value is a module id, require it\n \t// mode & 2: merge all properties of value into the ns\n \t// mode & 4: return value when already ns object\n \t// mode & 8|1: behave like require\n \t__webpack_require__.t = function(value, mode) {\n \t\tif(mode & 1) value = __webpack_require__(value);\n \t\tif(mode & 8) return value;\n \t\tif((mode & 4) && typeof value === 'object' && value && value.__esModule) return value;\n \t\tvar ns = Object.create(null);\n \t\t__webpack_require__.r(ns);\n \t\tObject.defineProperty(ns, 'default', { enumerable: true, value: value });\n \t\tif(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key));\n \t\treturn ns;\n \t};\n\n \t// getDefaultExport function for compatibility with non-harmony modules\n \t__webpack_require__.n = function(module) {\n \t\tvar getter = module && module.__esModule ?\n \t\t\tfunction getDefault() { return module['default']; } :\n \t\t\tfunction getModuleExports() { return module; };\n \t\t__webpack_require__.d(getter, 'a', getter);\n \t\treturn getter;\n \t};\n\n \t// Object.prototype.hasOwnProperty.call\n \t__webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(__webpack_require__.s = 6);\n","'use strict';\n\nif (process.env.NODE_ENV === 'production') {\n module.exports = require('./cjs/react.production.min.js');\n} else {\n module.exports = require('./cjs/react.development.js');\n}\n","/* eslint-env browser */\nmodule.exports = typeof self == 'object' ? self.FormData : window.FormData;\n","var __root__ = (function (root) {\nfunction F() { this.fetch = false; }\nF.prototype = root;\nreturn new F();\n})(typeof self !== 'undefined' ? self : this);\n(function(self) {\n\n(function(self) {\n\n if (self.fetch) {\n return\n }\n\n var support = {\n searchParams: 'URLSearchParams' in self,\n iterable: 'Symbol' in self && 'iterator' in Symbol,\n blob: 'FileReader' in self && 'Blob' in self && (function() {\n try {\n new Blob();\n return true\n } catch(e) {\n return false\n }\n })(),\n formData: 'FormData' in self,\n arrayBuffer: 'ArrayBuffer' in self\n };\n\n if (support.arrayBuffer) {\n var viewClasses = [\n '[object Int8Array]',\n '[object Uint8Array]',\n '[object Uint8ClampedArray]',\n '[object Int16Array]',\n '[object Uint16Array]',\n '[object Int32Array]',\n '[object Uint32Array]',\n '[object Float32Array]',\n '[object Float64Array]'\n ];\n\n var isDataView = function(obj) {\n return obj && DataView.prototype.isPrototypeOf(obj)\n };\n\n var isArrayBufferView = ArrayBuffer.isView || function(obj) {\n return obj && viewClasses.indexOf(Object.prototype.toString.call(obj)) > -1\n };\n }\n\n function normalizeName(name) {\n if (typeof name !== 'string') {\n name = String(name);\n }\n if (/[^a-z0-9\\-#$%&'*+.\\^_`|~]/i.test(name)) {\n throw new TypeError('Invalid character in header field name')\n }\n return name.toLowerCase()\n }\n\n function normalizeValue(value) {\n if (typeof value !== 'string') {\n value = String(value);\n }\n return value\n }\n\n // Build a destructive iterator for the value list\n function iteratorFor(items) {\n var iterator = {\n next: function() {\n var value = items.shift();\n return {done: value === undefined, value: value}\n }\n };\n\n if (support.iterable) {\n iterator[Symbol.iterator] = function() {\n return iterator\n };\n }\n\n return iterator\n }\n\n function Headers(headers) {\n this.map = {};\n\n if (headers instanceof Headers) {\n headers.forEach(function(value, name) {\n this.append(name, value);\n }, this);\n } else if (Array.isArray(headers)) {\n headers.forEach(function(header) {\n this.append(header[0], header[1]);\n }, this);\n } else if (headers) {\n Object.getOwnPropertyNames(headers).forEach(function(name) {\n this.append(name, headers[name]);\n }, this);\n }\n }\n\n Headers.prototype.append = function(name, value) {\n name = normalizeName(name);\n value = normalizeValue(value);\n var oldValue = this.map[name];\n this.map[name] = oldValue ? oldValue+','+value : value;\n };\n\n Headers.prototype['delete'] = function(name) {\n delete this.map[normalizeName(name)];\n };\n\n Headers.prototype.get = function(name) {\n name = normalizeName(name);\n return this.has(name) ? this.map[name] : null\n };\n\n Headers.prototype.has = function(name) {\n return this.map.hasOwnProperty(normalizeName(name))\n };\n\n Headers.prototype.set = function(name, value) {\n this.map[normalizeName(name)] = normalizeValue(value);\n };\n\n Headers.prototype.forEach = function(callback, thisArg) {\n for (var name in this.map) {\n if (this.map.hasOwnProperty(name)) {\n callback.call(thisArg, this.map[name], name, this);\n }\n }\n };\n\n Headers.prototype.keys = function() {\n var items = [];\n this.forEach(function(value, name) { items.push(name); });\n return iteratorFor(items)\n };\n\n Headers.prototype.values = function() {\n var items = [];\n this.forEach(function(value) { items.push(value); });\n return iteratorFor(items)\n };\n\n Headers.prototype.entries = function() {\n var items = [];\n this.forEach(function(value, name) { items.push([name, value]); });\n return iteratorFor(items)\n };\n\n if (support.iterable) {\n Headers.prototype[Symbol.iterator] = Headers.prototype.entries;\n }\n\n function consumed(body) {\n if (body.bodyUsed) {\n return Promise.reject(new TypeError('Already read'))\n }\n body.bodyUsed = true;\n }\n\n function fileReaderReady(reader) {\n return new Promise(function(resolve, reject) {\n reader.onload = function() {\n resolve(reader.result);\n };\n reader.onerror = function() {\n reject(reader.error);\n };\n })\n }\n\n function readBlobAsArrayBuffer(blob) {\n var reader = new FileReader();\n var promise = fileReaderReady(reader);\n reader.readAsArrayBuffer(blob);\n return promise\n }\n\n function readBlobAsText(blob) {\n var reader = new FileReader();\n var promise = fileReaderReady(reader);\n reader.readAsText(blob);\n return promise\n }\n\n function readArrayBufferAsText(buf) {\n var view = new Uint8Array(buf);\n var chars = new Array(view.length);\n\n for (var i = 0; i < view.length; i++) {\n chars[i] = String.fromCharCode(view[i]);\n }\n return chars.join('')\n }\n\n function bufferClone(buf) {\n if (buf.slice) {\n return buf.slice(0)\n } else {\n var view = new Uint8Array(buf.byteLength);\n view.set(new Uint8Array(buf));\n return view.buffer\n }\n }\n\n function Body() {\n this.bodyUsed = false;\n\n this._initBody = function(body) {\n this._bodyInit = body;\n if (!body) {\n this._bodyText = '';\n } else if (typeof body === 'string') {\n this._bodyText = body;\n } else if (support.blob && Blob.prototype.isPrototypeOf(body)) {\n this._bodyBlob = body;\n } else if (support.formData && FormData.prototype.isPrototypeOf(body)) {\n this._bodyFormData = body;\n } else if (support.searchParams && URLSearchParams.prototype.isPrototypeOf(body)) {\n this._bodyText = body.toString();\n } else if (support.arrayBuffer && support.blob && isDataView(body)) {\n this._bodyArrayBuffer = bufferClone(body.buffer);\n // IE 10-11 can't handle a DataView body.\n this._bodyInit = new Blob([this._bodyArrayBuffer]);\n } else if (support.arrayBuffer && (ArrayBuffer.prototype.isPrototypeOf(body) || isArrayBufferView(body))) {\n this._bodyArrayBuffer = bufferClone(body);\n } else {\n throw new Error('unsupported BodyInit type')\n }\n\n if (!this.headers.get('content-type')) {\n if (typeof body === 'string') {\n this.headers.set('content-type', 'text/plain;charset=UTF-8');\n } else if (this._bodyBlob && this._bodyBlob.type) {\n this.headers.set('content-type', this._bodyBlob.type);\n } else if (support.searchParams && URLSearchParams.prototype.isPrototypeOf(body)) {\n this.headers.set('content-type', 'application/x-www-form-urlencoded;charset=UTF-8');\n }\n }\n };\n\n if (support.blob) {\n this.blob = function() {\n var rejected = consumed(this);\n if (rejected) {\n return rejected\n }\n\n if (this._bodyBlob) {\n return Promise.resolve(this._bodyBlob)\n } else if (this._bodyArrayBuffer) {\n return Promise.resolve(new Blob([this._bodyArrayBuffer]))\n } else if (this._bodyFormData) {\n throw new Error('could not read FormData body as blob')\n } else {\n return Promise.resolve(new Blob([this._bodyText]))\n }\n };\n\n this.arrayBuffer = function() {\n if (this._bodyArrayBuffer) {\n return consumed(this) || Promise.resolve(this._bodyArrayBuffer)\n } else {\n return this.blob().then(readBlobAsArrayBuffer)\n }\n };\n }\n\n this.text = function() {\n var rejected = consumed(this);\n if (rejected) {\n return rejected\n }\n\n if (this._bodyBlob) {\n return readBlobAsText(this._bodyBlob)\n } else if (this._bodyArrayBuffer) {\n return Promise.resolve(readArrayBufferAsText(this._bodyArrayBuffer))\n } else if (this._bodyFormData) {\n throw new Error('could not read FormData body as text')\n } else {\n return Promise.resolve(this._bodyText)\n }\n };\n\n if (support.formData) {\n this.formData = function() {\n return this.text().then(decode)\n };\n }\n\n this.json = function() {\n return this.text().then(JSON.parse)\n };\n\n return this\n }\n\n // HTTP methods whose capitalization should be normalized\n var methods = ['DELETE', 'GET', 'HEAD', 'OPTIONS', 'POST', 'PUT'];\n\n function normalizeMethod(method) {\n var upcased = method.toUpperCase();\n return (methods.indexOf(upcased) > -1) ? upcased : method\n }\n\n function Request(input, options) {\n options = options || {};\n var body = options.body;\n\n if (input instanceof Request) {\n if (input.bodyUsed) {\n throw new TypeError('Already read')\n }\n this.url = input.url;\n this.credentials = input.credentials;\n if (!options.headers) {\n this.headers = new Headers(input.headers);\n }\n this.method = input.method;\n this.mode = input.mode;\n if (!body && input._bodyInit != null) {\n body = input._bodyInit;\n input.bodyUsed = true;\n }\n } else {\n this.url = String(input);\n }\n\n this.credentials = options.credentials || this.credentials || 'omit';\n if (options.headers || !this.headers) {\n this.headers = new Headers(options.headers);\n }\n this.method = normalizeMethod(options.method || this.method || 'GET');\n this.mode = options.mode || this.mode || null;\n this.referrer = null;\n\n if ((this.method === 'GET' || this.method === 'HEAD') && body) {\n throw new TypeError('Body not allowed for GET or HEAD requests')\n }\n this._initBody(body);\n }\n\n Request.prototype.clone = function() {\n return new Request(this, { body: this._bodyInit })\n };\n\n function decode(body) {\n var form = new FormData();\n body.trim().split('&').forEach(function(bytes) {\n if (bytes) {\n var split = bytes.split('=');\n var name = split.shift().replace(/\\+/g, ' ');\n var value = split.join('=').replace(/\\+/g, ' ');\n form.append(decodeURIComponent(name), decodeURIComponent(value));\n }\n });\n return form\n }\n\n function parseHeaders(rawHeaders) {\n var headers = new Headers();\n // Replace instances of \\r\\n and \\n followed by at least one space or horizontal tab with a space\n // https://tools.ietf.org/html/rfc7230#section-3.2\n var preProcessedHeaders = rawHeaders.replace(/\\r?\\n[\\t ]+/g, ' ');\n preProcessedHeaders.split(/\\r?\\n/).forEach(function(line) {\n var parts = line.split(':');\n var key = parts.shift().trim();\n if (key) {\n var value = parts.join(':').trim();\n headers.append(key, value);\n }\n });\n return headers\n }\n\n Body.call(Request.prototype);\n\n function Response(bodyInit, options) {\n if (!options) {\n options = {};\n }\n\n this.type = 'default';\n this.status = options.status === undefined ? 200 : options.status;\n this.ok = this.status >= 200 && this.status < 300;\n this.statusText = 'statusText' in options ? options.statusText : 'OK';\n this.headers = new Headers(options.headers);\n this.url = options.url || '';\n this._initBody(bodyInit);\n }\n\n Body.call(Response.prototype);\n\n Response.prototype.clone = function() {\n return new Response(this._bodyInit, {\n status: this.status,\n statusText: this.statusText,\n headers: new Headers(this.headers),\n url: this.url\n })\n };\n\n Response.error = function() {\n var response = new Response(null, {status: 0, statusText: ''});\n response.type = 'error';\n return response\n };\n\n var redirectStatuses = [301, 302, 303, 307, 308];\n\n Response.redirect = function(url, status) {\n if (redirectStatuses.indexOf(status) === -1) {\n throw new RangeError('Invalid status code')\n }\n\n return new Response(null, {status: status, headers: {location: url}})\n };\n\n self.Headers = Headers;\n self.Request = Request;\n self.Response = Response;\n\n self.fetch = function(input, init) {\n return new Promise(function(resolve, reject) {\n var request = new Request(input, init);\n var xhr = new XMLHttpRequest();\n\n xhr.onload = function() {\n var options = {\n status: xhr.status,\n statusText: xhr.statusText,\n headers: parseHeaders(xhr.getAllResponseHeaders() || '')\n };\n options.url = 'responseURL' in xhr ? xhr.responseURL : options.headers.get('X-Request-URL');\n var body = 'response' in xhr ? xhr.response : xhr.responseText;\n resolve(new Response(body, options));\n };\n\n xhr.onerror = function() {\n reject(new TypeError('Network request failed'));\n };\n\n xhr.ontimeout = function() {\n reject(new TypeError('Network request failed'));\n };\n\n xhr.open(request.method, request.url, true);\n\n if (request.credentials === 'include') {\n xhr.withCredentials = true;\n } else if (request.credentials === 'omit') {\n xhr.withCredentials = false;\n }\n\n if ('responseType' in xhr && support.blob) {\n xhr.responseType = 'blob';\n }\n\n request.headers.forEach(function(value, name) {\n xhr.setRequestHeader(name, value);\n });\n\n xhr.send(typeof request._bodyInit === 'undefined' ? null : request._bodyInit);\n })\n };\n self.fetch.polyfill = true;\n})(typeof self !== 'undefined' ? self : this);\n}).call(__root__, void(0));\nvar fetch = __root__.fetch;\nvar Response = fetch.Response = __root__.Response;\nvar Request = fetch.Request = __root__.Request;\nvar Headers = fetch.Headers = __root__.Headers;\nif (typeof module === 'object' && module.exports) {\nmodule.exports = fetch;\n// Needed for TypeScript consumers without esModuleInterop.\nmodule.exports.default = fetch;\n}\n","/** @license React v16.6.1\n * react.production.min.js\n *\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n */\n\n'use strict';var k=require(\"object-assign\"),n=\"function\"===typeof Symbol&&Symbol.for,p=n?Symbol.for(\"react.element\"):60103,q=n?Symbol.for(\"react.portal\"):60106,r=n?Symbol.for(\"react.fragment\"):60107,t=n?Symbol.for(\"react.strict_mode\"):60108,u=n?Symbol.for(\"react.profiler\"):60114,v=n?Symbol.for(\"react.provider\"):60109,w=n?Symbol.for(\"react.context\"):60110,x=n?Symbol.for(\"react.concurrent_mode\"):60111,y=n?Symbol.for(\"react.forward_ref\"):60112,z=n?Symbol.for(\"react.suspense\"):60113,A=n?Symbol.for(\"react.memo\"):\n60115,B=n?Symbol.for(\"react.lazy\"):60116,C=\"function\"===typeof Symbol&&Symbol.iterator;function aa(a,b,e,c,d,g,h,f){if(!a){a=void 0;if(void 0===b)a=Error(\"Minified exception occurred; use the non-minified dev environment for the full error message and additional helpful warnings.\");else{var l=[e,c,d,g,h,f],m=0;a=Error(b.replace(/%s/g,function(){return l[m++]}));a.name=\"Invariant Violation\"}a.framesToPop=1;throw a;}}\nfunction D(a){for(var b=arguments.length-1,e=\"https://reactjs.org/docs/error-decoder.html?invariant=\"+a,c=0;c<b;c++)e+=\"&args[]=\"+encodeURIComponent(arguments[c+1]);aa(!1,\"Minified React error #\"+a+\"; visit %s for the full message or use the non-minified dev environment for full errors and additional helpful warnings. \",e)}var E={isMounted:function(){return!1},enqueueForceUpdate:function(){},enqueueReplaceState:function(){},enqueueSetState:function(){}},F={};\nfunction G(a,b,e){this.props=a;this.context=b;this.refs=F;this.updater=e||E}G.prototype.isReactComponent={};G.prototype.setState=function(a,b){\"object\"!==typeof a&&\"function\"!==typeof a&&null!=a?D(\"85\"):void 0;this.updater.enqueueSetState(this,a,b,\"setState\")};G.prototype.forceUpdate=function(a){this.updater.enqueueForceUpdate(this,a,\"forceUpdate\")};function H(){}H.prototype=G.prototype;function I(a,b,e){this.props=a;this.context=b;this.refs=F;this.updater=e||E}var J=I.prototype=new H;\nJ.constructor=I;k(J,G.prototype);J.isPureReactComponent=!0;var K={current:null,currentDispatcher:null},L=Object.prototype.hasOwnProperty,M={key:!0,ref:!0,__self:!0,__source:!0};\nfunction N(a,b,e){var c=void 0,d={},g=null,h=null;if(null!=b)for(c in void 0!==b.ref&&(h=b.ref),void 0!==b.key&&(g=\"\"+b.key),b)L.call(b,c)&&!M.hasOwnProperty(c)&&(d[c]=b[c]);var f=arguments.length-2;if(1===f)d.children=e;else if(1<f){for(var l=Array(f),m=0;m<f;m++)l[m]=arguments[m+2];d.children=l}if(a&&a.defaultProps)for(c in f=a.defaultProps,f)void 0===d[c]&&(d[c]=f[c]);return{$$typeof:p,type:a,key:g,ref:h,props:d,_owner:K.current}}\nfunction ba(a,b){return{$$typeof:p,type:a.type,key:b,ref:a.ref,props:a.props,_owner:a._owner}}function O(a){return\"object\"===typeof a&&null!==a&&a.$$typeof===p}function escape(a){var b={\"=\":\"=0\",\":\":\"=2\"};return\"$\"+(\"\"+a).replace(/[=:]/g,function(a){return b[a]})}var P=/\\/+/g,Q=[];function R(a,b,e,c){if(Q.length){var d=Q.pop();d.result=a;d.keyPrefix=b;d.func=e;d.context=c;d.count=0;return d}return{result:a,keyPrefix:b,func:e,context:c,count:0}}\nfunction S(a){a.result=null;a.keyPrefix=null;a.func=null;a.context=null;a.count=0;10>Q.length&&Q.push(a)}\nfunction T(a,b,e,c){var d=typeof a;if(\"undefined\"===d||\"boolean\"===d)a=null;var g=!1;if(null===a)g=!0;else switch(d){case \"string\":case \"number\":g=!0;break;case \"object\":switch(a.$$typeof){case p:case q:g=!0}}if(g)return e(c,a,\"\"===b?\".\"+U(a,0):b),1;g=0;b=\"\"===b?\".\":b+\":\";if(Array.isArray(a))for(var h=0;h<a.length;h++){d=a[h];var f=b+U(d,h);g+=T(d,f,e,c)}else if(null===a||\"object\"!==typeof a?f=null:(f=C&&a[C]||a[\"@@iterator\"],f=\"function\"===typeof f?f:null),\"function\"===typeof f)for(a=f.call(a),h=\n0;!(d=a.next()).done;)d=d.value,f=b+U(d,h++),g+=T(d,f,e,c);else\"object\"===d&&(e=\"\"+a,D(\"31\",\"[object Object]\"===e?\"object with keys {\"+Object.keys(a).join(\", \")+\"}\":e,\"\"));return g}function V(a,b,e){return null==a?0:T(a,\"\",b,e)}function U(a,b){return\"object\"===typeof a&&null!==a&&null!=a.key?escape(a.key):b.toString(36)}function ca(a,b){a.func.call(a.context,b,a.count++)}\nfunction da(a,b,e){var c=a.result,d=a.keyPrefix;a=a.func.call(a.context,b,a.count++);Array.isArray(a)?W(a,c,e,function(a){return a}):null!=a&&(O(a)&&(a=ba(a,d+(!a.key||b&&b.key===a.key?\"\":(\"\"+a.key).replace(P,\"$&/\")+\"/\")+e)),c.push(a))}function W(a,b,e,c,d){var g=\"\";null!=e&&(g=(\"\"+e).replace(P,\"$&/\")+\"/\");b=R(b,g,c,d);V(a,da,b);S(b)}\nvar X={Children:{map:function(a,b,e){if(null==a)return a;var c=[];W(a,c,null,b,e);return c},forEach:function(a,b,e){if(null==a)return a;b=R(null,null,b,e);V(a,ca,b);S(b)},count:function(a){return V(a,function(){return null},null)},toArray:function(a){var b=[];W(a,b,null,function(a){return a});return b},only:function(a){O(a)?void 0:D(\"143\");return a}},createRef:function(){return{current:null}},Component:G,PureComponent:I,createContext:function(a,b){void 0===b&&(b=null);a={$$typeof:w,_calculateChangedBits:b,\n_currentValue:a,_currentValue2:a,_threadCount:0,Provider:null,Consumer:null};a.Provider={$$typeof:v,_context:a};return a.Consumer=a},forwardRef:function(a){return{$$typeof:y,render:a}},lazy:function(a){return{$$typeof:B,_ctor:a,_status:-1,_result:null}},memo:function(a,b){return{$$typeof:A,type:a,compare:void 0===b?null:b}},Fragment:r,StrictMode:t,Suspense:z,createElement:N,cloneElement:function(a,b,e){null===a||void 0===a?D(\"267\",a):void 0;var c=void 0,d=k({},a.props),g=a.key,h=a.ref,f=a._owner;\nif(null!=b){void 0!==b.ref&&(h=b.ref,f=K.current);void 0!==b.key&&(g=\"\"+b.key);var l=void 0;a.type&&a.type.defaultProps&&(l=a.type.defaultProps);for(c in b)L.call(b,c)&&!M.hasOwnProperty(c)&&(d[c]=void 0===b[c]&&void 0!==l?l[c]:b[c])}c=arguments.length-2;if(1===c)d.children=e;else if(1<c){l=Array(c);for(var m=0;m<c;m++)l[m]=arguments[m+2];d.children=l}return{$$typeof:p,type:a.type,key:g,ref:h,props:d,_owner:f}},createFactory:function(a){var b=N.bind(null,a);b.type=a;return b},isValidElement:O,version:\"16.6.3\",\n__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED:{ReactCurrentOwner:K,assign:k}};X.unstable_ConcurrentMode=x;X.unstable_Profiler=u;var Y={default:X},Z=Y&&X||Y;module.exports=Z.default||Z;\n","/*\nobject-assign\n(c) Sindre Sorhus\n@license MIT\n*/\n\n'use strict';\n/* eslint-disable no-unused-vars */\nvar getOwnPropertySymbols = Object.getOwnPropertySymbols;\nvar hasOwnProperty = Object.prototype.hasOwnProperty;\nvar propIsEnumerable = Object.prototype.propertyIsEnumerable;\n\nfunction toObject(val) {\n\tif (val === null || val === undefined) {\n\t\tthrow new TypeError('Object.assign cannot be called with null or undefined');\n\t}\n\n\treturn Object(val);\n}\n\nfunction shouldUseNative() {\n\ttry {\n\t\tif (!Object.assign) {\n\t\t\treturn false;\n\t\t}\n\n\t\t// Detect buggy property enumeration order in older V8 versions.\n\n\t\t// https://bugs.chromium.org/p/v8/issues/detail?id=4118\n\t\tvar test1 = new String('abc'); // eslint-disable-line no-new-wrappers\n\t\ttest1[5] = 'de';\n\t\tif (Object.getOwnPropertyNames(test1)[0] === '5') {\n\t\t\treturn false;\n\t\t}\n\n\t\t// https://bugs.chromium.org/p/v8/issues/detail?id=3056\n\t\tvar test2 = {};\n\t\tfor (var i = 0; i < 10; i++) {\n\t\t\ttest2['_' + String.fromCharCode(i)] = i;\n\t\t}\n\t\tvar order2 = Object.getOwnPropertyNames(test2).map(function (n) {\n\t\t\treturn test2[n];\n\t\t});\n\t\tif (order2.join('') !== '0123456789') {\n\t\t\treturn false;\n\t\t}\n\n\t\t// https://bugs.chromium.org/p/v8/issues/detail?id=3056\n\t\tvar test3 = {};\n\t\t'abcdefghijklmnopqrst'.split('').forEach(function (letter) {\n\t\t\ttest3[letter] = letter;\n\t\t});\n\t\tif (Object.keys(Object.assign({}, test3)).join('') !==\n\t\t\t\t'abcdefghijklmnopqrst') {\n\t\t\treturn false;\n\t\t}\n\n\t\treturn true;\n\t} catch (err) {\n\t\t// We don't expect any of the above to throw, but better to be safe.\n\t\treturn false;\n\t}\n}\n\nmodule.exports = shouldUseNative() ? Object.assign : function (target, source) {\n\tvar from;\n\tvar to = toObject(target);\n\tvar symbols;\n\n\tfor (var s = 1; s < arguments.length; s++) {\n\t\tfrom = Object(arguments[s]);\n\n\t\tfor (var key in from) {\n\t\t\tif (hasOwnProperty.call(from, key)) {\n\t\t\t\tto[key] = from[key];\n\t\t\t}\n\t\t}\n\n\t\tif (getOwnPropertySymbols) {\n\t\t\tsymbols = getOwnPropertySymbols(from);\n\t\t\tfor (var i = 0; i < symbols.length; i++) {\n\t\t\t\tif (propIsEnumerable.call(from, symbols[i])) {\n\t\t\t\t\tto[symbols[i]] = from[symbols[i]];\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\treturn to;\n};\n","module.exports = function(module) {\n\tif (!module.webpackPolyfill) {\n\t\tmodule.deprecate = function() {};\n\t\tmodule.paths = [];\n\t\t// module.parent = undefined by default\n\t\tif (!module.children) module.children = [];\n\t\tObject.defineProperty(module, \"loaded\", {\n\t\t\tenumerable: true,\n\t\t\tget: function() {\n\t\t\t\treturn module.l;\n\t\t\t}\n\t\t});\n\t\tObject.defineProperty(module, \"id\", {\n\t\t\tenumerable: true,\n\t\t\tget: function() {\n\t\t\t\treturn module.i;\n\t\t\t}\n\t\t});\n\t\tmodule.webpackPolyfill = 1;\n\t}\n\treturn module;\n};\n","import React from \"react\";\nimport FormData from \"form-data\";\nimport fetch from \"cross-fetch\";\n\nconst {dispatch} = wp.data;\nconst {Button} = wp.components\nconst {Fragment, Component} = wp.element\nconst {__} = wp.i18n\nconst {property} = lodash\n\nclass NGGFeaturedThumbnail extends Component {\n\tstate = {\n\t\timage_url: null,\n\t\tmsg: __('Loading...')\n\t}\n\n\tcomponentDidUpdate(prevProps) {\n\t\tif (this.props.image_id !== prevProps.image_id) {\n\t\t\tthis.updateImageUrl();\n\t\t}\n\t}\n\n\tcomponentDidMount() {\n\t\tthis.updateImageUrl();\n\t}\n\n\tupdateImageUrl = () => {\n\t\tthis.getImageUrl(this.props.image_id)\n\t\t\t.then(image_url => this.setState({image_url}))\n\t\t\t.catch((err) => console.log(err) && this.setState({msg: __(\"Could not load image\")}));\n\t}\n\n\tgetImageUrl = image_id => {\n\t\tconst data = new FormData();\n\n\t\tdata.append('action', 'get_image');\n\t\tdata.append('image_id', image_id);\n\n\t\treturn fetch(photocrati_ajax.url,\n\t\t\t{\n\t\t\t\tmethod: 'POST',\n\t\t\t\tbody: data,\n\t\t\t\theaders: {\n\t\t\t\t\t'Accept': 'application/json'\n\t\t\t\t}\n\t\t\t})\n\t\t\t.then(res => res.json())\n\t\t\t.then(property('image.image_url'));\n\t}\n\n\trender() {\n\t\tconst {msg} = this.state;\n\n\t\tconst style = {\n\t\t\tpaddingTop: '5px',\n\t\t\tpaddingBottom: '5px'\n\t\t};\n\n\t\tconst el = this.state.image_url ? <img src={this.state.image_url}/> : <span>{msg}</span>;\n\n\t\treturn (\n\t\t\t<div style={style}>{el}</div>\n\t\t);\n\t}\n}\n\nexport default class NGGFeaturedImage extends Component {\n\n\tconstructor(props) {\n\t\tsuper(props);\n\n\t\tthis.state = {\n\t\t\tngg_id: props.meta.ngg_post_thumbnail,\n\t\t\twp_ml_id: props.featuredImageId\n\t\t}\n\t}\n\n\thandleOpenClick = event => {\n\t\ttop.set_ngg_post_thumbnail = this.onUpdatePostThumbnail;\n\t\ttb_show(\n\t\t\t\"Set NextGEN Featured Image\",\n\t\t\tngg_featured_image.modal_url.replace(/%post_id%/, this.props.currentPostId)\n\t\t);\n\t}\n\n\thandleRemoveClick = event => {\n\t\tconst meta = {\n\t\t\t...this.props.meta,\n\t\t\tngg_post_thumbnail: 0,\n\t\t\tfeatured_media: 0\n\t\t};\n\t\tthis.setState({\n\t\t\tngg_id: 0\n\t\t});\n\t\tdispatch('core/editor').editPost({meta});\n\t}\n\n\tonUpdatePostThumbnail = ngg_image_id => {\n\t\ttb_remove()\n\t\tconst meta = {\n\t\t\t...this.props.meta,\n\t\t\tngg_post_thumbnail: parseInt(ngg_image_id)\n\t\t};\n\t\tthis.setState({\n\t\t\tngg_id: meta.ngg_post_thumbnail\n\t\t});\n\t\tdispatch('core/editor').editPost({meta});\n\t}\n\n\trender() {\n\t\treturn (\n\t\t\t<Fragment>\n\t\t\t\t<Button style={{marginTop: '10px'}}\n\t\t\t\t\t\tonClick={this.handleOpenClick}\n\t\t\t\t\t\tclassName=\"editor-post-featured-image__toggle\">\n\t\t\t\t\t{__('Set NextGEN Featured Image')}\n\t\t\t\t</Button>\n\n\t\t\t\t{this.state.ngg_id > 0 && this.props.meta.ngg_post_thumbnail !== this.state.ngg_id ?\n\t\t\t\t\t<Fragment>\n\t\t\t\t\t\t<NGGFeaturedThumbnail image_id={this.state.ngg_id}/>\n\t\t\t\t\t\t<Button onClick={this.handleRemoveClick}\n\t\t\t\t\t\t\t\tclassName=\"is-link is-destructive\">\n\t\t\t\t\t\t\t{__('Remove featured image')}\n\t\t\t\t\t\t</Button>\n\t\t\t\t\t</Fragment>\n\t\t\t\t\t: ''}\n\t\t\t</Fragment>\n\t\t);\n\t}\n}","import React from \"react\";\nimport NGGFeaturedImage from './components/ngg-post-thumbnail.jsx';\n\nconst {select} = wp.data;\nconst {Fragment} = wp.element\n\nfunction setFeaturedImageDisplay(OriginalComponent) {\n return (props) => {\n const meta = select('core/editor').getCurrentPostAttribute('meta');\n return (\n <Fragment>\n <OriginalComponent {...props}/>\n <NGGFeaturedImage {...props} meta={meta}/>\n </Fragment>\n );\n }\n}\n\nwp.hooks.addFilter('editor.PostFeaturedImage', 'imagely/featured-image-display', setFeaturedImageDisplay);"],"sourceRoot":""}
|
products/photocrati_nextgen/modules/nextgen_block/static/editor.css
CHANGED
|
@@ -6,73 +6,99 @@
|
|
| 6 |
|
| 7 |
/* Customize the overall block */
|
| 8 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 9 |
div[data-type="imagely/nextgen-gallery"].is-selected>.editor-block-list__block-edit:before,
|
| 10 |
div[data-type="imagely/nextgen-gallery"].is-hovered>.editor-block-list__block-edit:before {
|
| 11 |
outline: none !important;
|
| 12 |
}
|
| 13 |
|
| 14 |
div[data-type="imagely/nextgen-gallery"] .editor-block-list__breadcrumb {
|
| 15 |
-
display:none !important;
|
| 16 |
}
|
| 17 |
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
display: none !important;
|
| 21 |
}
|
| 22 |
|
| 23 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 24 |
|
| 25 |
-
|
| 26 |
-
|
| 27 |
-
|
| 28 |
-
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
z-index:
|
| 33 |
-
|
| 34 |
-
border: 1px solid #eee;
|
| 35 |
-
border-top: 4px solid #b8d330;
|
| 36 |
-
box-shadow: 0 0 4px 2px rgba(0,0,0,.03);
|
| 37 |
-
background: #fcfcfc;
|
| 38 |
}
|
| 39 |
|
| 40 |
-
|
| 41 |
-
|
| 42 |
-
letter-spacing: 1.2px;
|
| 43 |
-
line-height: 20px;
|
| 44 |
-
font-family: Lato,sans-serif;
|
| 45 |
-
font-weight: 900;
|
| 46 |
-
color: #fff;
|
| 47 |
-
background-color: black;
|
| 48 |
-
border: none;
|
| 49 |
-
box-shadow: none;
|
| 50 |
-
padding: 12px 24px;
|
| 51 |
-
margin: 0 auto;
|
| 52 |
-
text-transform: uppercase;
|
| 53 |
-
width: 260px;
|
| 54 |
-
text-align: center;
|
| 55 |
-
cursor: pointer;
|
| 56 |
}
|
| 57 |
|
| 58 |
-
|
| 59 |
-
|
|
|
|
| 60 |
}
|
| 61 |
|
| 62 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 63 |
|
| 64 |
-
|
| 65 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 66 |
}
|
| 67 |
|
| 68 |
-
|
| 69 |
-
left: 0 !important;
|
| 70 |
}
|
| 71 |
|
| 72 |
/* Customize the NextGEN Gallery placeholder */
|
| 73 |
|
| 74 |
-
div[data-type="imagely/nextgen-gallery"] .
|
| 75 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 76 |
border-radius: 2px;
|
| 77 |
box-shadow: 0 0 4px 2px rgba(0,0,0,.05);
|
| 78 |
box-sizing: border-box;
|
|
@@ -81,58 +107,58 @@ div[data-type="imagely/nextgen-gallery"] .nggPlaceholder {
|
|
| 81 |
font-family: sans-serif;
|
| 82 |
font-size: 20px;
|
| 83 |
outline: none !important;
|
| 84 |
-
position: relative;
|
| 85 |
-
text-align: center;
|
| 86 |
-
width: 100%;
|
| 87 |
-
z-index: 2;
|
| 88 |
min-height: 210px;
|
| 89 |
padding: 60px 60px 70px;
|
|
|
|
|
|
|
|
|
|
|
|
|
| 90 |
}
|
| 91 |
|
| 92 |
-
div[data-type="imagely/nextgen-gallery"] .
|
| 93 |
-
margin-top: 0;
|
| 94 |
-
z-index: 2;
|
| 95 |
-
display: block;
|
| 96 |
-
position: relative;
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
div[data-type="imagely/nextgen-gallery"] .wp-block-freeform.blocks-rich-text__tinymce > .nggPlaceholder {
|
| 100 |
-
margin-top: -135px;
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
div[data-type="imagely/nextgen-gallery"] .nggPlaceholder h3 {
|
| 104 |
color: black !important;
|
| 105 |
-
|
| 106 |
font-size: 21px;
|
| 107 |
-
font-family: Lato, sans-serif !important;
|
| 108 |
font-weight: 700 !important;
|
| 109 |
letter-spacing: 3px !important;
|
| 110 |
-
margin-bottom:
|
| 111 |
margin-top: 0;
|
|
|
|
|
|
|
|
|
|
| 112 |
}
|
| 113 |
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
|
| 118 |
-
box-shadow: none !important;
|
| 119 |
-
color: #fff !important;
|
| 120 |
-
display: inline-block !important;
|
| 121 |
-
font-size: 12px;
|
| 122 |
-
font-weight: bold;
|
| 123 |
-
font-family: Lato, sans-serif !important;
|
| 124 |
-
height: 36px !important;
|
| 125 |
-
line-height: 36px !important;
|
| 126 |
letter-spacing: 1.2px;
|
| 127 |
-
|
| 128 |
-
|
| 129 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 130 |
text-align: center;
|
| 131 |
-
text-transform: uppercase !important;
|
| 132 |
-
text-shadow: none !important;
|
| 133 |
cursor: pointer;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 134 |
}
|
| 135 |
|
| 136 |
-
div[data-type="imagely/nextgen-gallery"] .
|
| 137 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 138 |
}
|
| 6 |
|
| 7 |
/* Customize the overall block */
|
| 8 |
|
| 9 |
+
div[data-type="imagely/nextgen-gallery"] {
|
| 10 |
+
z-index: 30;
|
| 11 |
+
}
|
| 12 |
+
|
| 13 |
div[data-type="imagely/nextgen-gallery"].is-selected>.editor-block-list__block-edit:before,
|
| 14 |
div[data-type="imagely/nextgen-gallery"].is-hovered>.editor-block-list__block-edit:before {
|
| 15 |
outline: none !important;
|
| 16 |
}
|
| 17 |
|
| 18 |
div[data-type="imagely/nextgen-gallery"] .editor-block-list__breadcrumb {
|
| 19 |
+
display: none !important;
|
| 20 |
}
|
| 21 |
|
| 22 |
+
div[data-type="imagely/nextgen-gallery"]:focus::after {
|
| 23 |
+
box-shadow: none !important;
|
|
|
|
| 24 |
}
|
| 25 |
|
| 26 |
+
/* Popup modal when IGW is open */
|
| 27 |
+
#add-ngg-gallery-modal {
|
| 28 |
+
background: white;
|
| 29 |
+
position: fixed;
|
| 30 |
+
top: 50px;
|
| 31 |
+
bottom: 50px;
|
| 32 |
+
right: 35px;
|
| 33 |
+
left: 35px;
|
| 34 |
+
z-index: 999999;
|
| 35 |
+
}
|
| 36 |
|
| 37 |
+
#add-ngg-gallery-modal-background {
|
| 38 |
+
background: black;
|
| 39 |
+
position: fixed;
|
| 40 |
+
top: 0;
|
| 41 |
+
left: 0;
|
| 42 |
+
right: 0;
|
| 43 |
+
bottom: 0;
|
| 44 |
+
z-index: 99999;
|
| 45 |
+
opacity: 70%;
|
|
|
|
|
|
|
|
|
|
|
|
|
| 46 |
}
|
| 47 |
|
| 48 |
+
#add-ngg-gallery-modal p {
|
| 49 |
+
color: white;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 50 |
}
|
| 51 |
|
| 52 |
+
#add-ngg-gallery-modal iframe {
|
| 53 |
+
height: 100%;
|
| 54 |
+
width: 100%;
|
| 55 |
}
|
| 56 |
|
| 57 |
+
#add-ngg-gallery-modal-close {
|
| 58 |
+
position: absolute;
|
| 59 |
+
top: 10px;
|
| 60 |
+
right: 25px;
|
| 61 |
+
background-color: #9fbb1a;
|
| 62 |
+
border-radius: 50%;
|
| 63 |
+
color: white;
|
| 64 |
+
padding: 1px;
|
| 65 |
+
}
|
| 66 |
|
| 67 |
+
#add-ngg-gallery-modal-spinner {
|
| 68 |
+
position: absolute;
|
| 69 |
+
top: 0;
|
| 70 |
+
left: 0;
|
| 71 |
+
bottom: 0;
|
| 72 |
+
right: 0;
|
| 73 |
+
display: flex;
|
| 74 |
+
justify-content: center;
|
| 75 |
+
align-items: center;
|
| 76 |
+
z-index: 2;
|
| 77 |
+
background: white;
|
| 78 |
+
opacity: 1;
|
| 79 |
+
transition: visibility 0.5s linear 0.6s, opacity 0.4s linear, font-size 0.3s linear;
|
| 80 |
+
visibility: visible;
|
| 81 |
+
font-size: 15vh;
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
#add-ngg-gallery-modal-spinner.add-ngg-gallery-modal-spinner-hidden {
|
| 85 |
+
opacity: 0;
|
| 86 |
+
visibility: hidden;
|
| 87 |
+
transition-delay: 0s;
|
| 88 |
+
font-size: .5vh;
|
| 89 |
}
|
| 90 |
|
| 91 |
+
#add-ngg-gallery-modal-spinner i.fa.fa-spin {
|
|
|
|
| 92 |
}
|
| 93 |
|
| 94 |
/* Customize the NextGEN Gallery placeholder */
|
| 95 |
|
| 96 |
+
div[data-type="imagely/nextgen-gallery"] .add-ngg-gallery-parent {
|
| 97 |
+
outline: none !important;
|
| 98 |
+
}
|
| 99 |
+
|
| 100 |
+
div[data-type="imagely/nextgen-gallery"] .add-ngg-gallery-block {
|
| 101 |
+
background-color: #ffffff;
|
| 102 |
border-radius: 2px;
|
| 103 |
box-shadow: 0 0 4px 2px rgba(0,0,0,.05);
|
| 104 |
box-sizing: border-box;
|
| 107 |
font-family: sans-serif;
|
| 108 |
font-size: 20px;
|
| 109 |
outline: none !important;
|
|
|
|
|
|
|
|
|
|
|
|
|
| 110 |
min-height: 210px;
|
| 111 |
padding: 60px 60px 70px;
|
| 112 |
+
display: flex;
|
| 113 |
+
justify-content: center;
|
| 114 |
+
align-items: center;
|
| 115 |
+
flex-wrap: wrap;
|
| 116 |
}
|
| 117 |
|
| 118 |
+
div[data-type="imagely/nextgen-gallery"] .add-ngg-gallery-block h3 {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 119 |
color: black !important;
|
| 120 |
+
font-family: "Lato", sans-serif !important;
|
| 121 |
font-size: 21px;
|
|
|
|
| 122 |
font-weight: 700 !important;
|
| 123 |
letter-spacing: 3px !important;
|
| 124 |
+
margin-bottom: 15px;
|
| 125 |
margin-top: 0;
|
| 126 |
+
text-align: center;
|
| 127 |
+
text-transform: uppercase;
|
| 128 |
+
width: 100%;
|
| 129 |
}
|
| 130 |
|
| 131 |
+
/* Styling for Add NextGEN Gallery buttons */
|
| 132 |
+
|
| 133 |
+
div[data-type="imagely/nextgen-gallery"] .add-ngg-gallery-button {
|
| 134 |
+
font-size: 14px;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 135 |
letter-spacing: 1.2px;
|
| 136 |
+
line-height: 20px;
|
| 137 |
+
font-family: "Lato", sans-serif;
|
| 138 |
+
font-weight: 900;
|
| 139 |
+
color: #fff;
|
| 140 |
+
background-color: black;
|
| 141 |
+
border: none;
|
| 142 |
+
box-shadow: none;
|
| 143 |
+
padding: 12px 24px;
|
| 144 |
+
text-transform: uppercase;
|
| 145 |
text-align: center;
|
|
|
|
|
|
|
| 146 |
cursor: pointer;
|
| 147 |
+
flex: 1;
|
| 148 |
+
flex-grow: 0;
|
| 149 |
+
margin: 0 0 0 15px;
|
| 150 |
+
}
|
| 151 |
+
|
| 152 |
+
div[data-type="imagely/nextgen-gallery"] .add-ngg-gallery-button:only-of-type {
|
| 153 |
+
flex-grow: 1;
|
| 154 |
+
width: 300px;
|
| 155 |
+
max-width: 300px;
|
| 156 |
}
|
| 157 |
|
| 158 |
+
div[data-type="imagely/nextgen-gallery"] .add-ngg-gallery-button:first-of-type {
|
| 159 |
+
margin-left: 0;
|
| 160 |
+
}
|
| 161 |
+
|
| 162 |
+
div[data-type="imagely/nextgen-gallery"] .add-ngg-gallery-button:hover {
|
| 163 |
+
background: #383838;
|
| 164 |
}
|
products/photocrati_nextgen/modules/nextgen_block/static/editor.min.css
CHANGED
|
@@ -1 +1 @@
|
|
| 1 |
-
div[data-type="imagely/nextgen-gallery"].is-hovered>.editor-block-list__block-edit:before,div[data-type="imagely/nextgen-gallery"].is-selected>.editor-block-list__block-edit:before{outline:0!important}div[data-type="imagely/nextgen-gallery"] .editor-block-list__breadcrumb
|
| 1 |
+
div[data-type="imagely/nextgen-gallery"]{z-index:30}div[data-type="imagely/nextgen-gallery"].is-hovered>.editor-block-list__block-edit:before,div[data-type="imagely/nextgen-gallery"].is-selected>.editor-block-list__block-edit:before{outline:0!important}div[data-type="imagely/nextgen-gallery"] .editor-block-list__breadcrumb{display:none!important}div[data-type="imagely/nextgen-gallery"]:focus::after{box-shadow:none!important}#add-ngg-gallery-modal{background:#fff;position:fixed;top:50px;bottom:50px;right:35px;left:35px;z-index:999999}#add-ngg-gallery-modal-background{background:#000;position:fixed;top:0;left:0;right:0;bottom:0;z-index:99999;opacity:70%}#add-ngg-gallery-modal p{color:#fff}#add-ngg-gallery-modal iframe{height:100%;width:100%}#add-ngg-gallery-modal-close{position:absolute;top:10px;right:25px;background-color:#9fbb1a;border-radius:50%;color:#fff;padding:1px}#add-ngg-gallery-modal-spinner{position:absolute;top:0;left:0;bottom:0;right:0;display:flex;justify-content:center;align-items:center;z-index:2;background:#fff;opacity:1;transition:visibility .5s linear .6s,opacity .4s linear,font-size .3s linear;visibility:visible;font-size:15vh}#add-ngg-gallery-modal-spinner.add-ngg-gallery-modal-spinner-hidden{opacity:0;visibility:hidden;transition-delay:0s;font-size:.5vh}div[data-type="imagely/nextgen-gallery"] .add-ngg-gallery-parent{outline:0!important}div[data-type="imagely/nextgen-gallery"] .add-ngg-gallery-block{background-color:#fff;border-radius:2px;box-shadow:0 0 4px 2px rgba(0,0,0,.05);box-sizing:border-box;border-top:5px solid #b8d330;color:#fff;font-family:sans-serif;font-size:20px;outline:0!important;min-height:210px;padding:60px 60px 70px;display:flex;justify-content:center;align-items:center;flex-wrap:wrap}div[data-type="imagely/nextgen-gallery"] .add-ngg-gallery-block h3{color:#000!important;font-family:Lato,sans-serif!important;font-size:21px;font-weight:700!important;letter-spacing:3px!important;margin-bottom:15px;margin-top:0;text-align:center;text-transform:uppercase;width:100%}div[data-type="imagely/nextgen-gallery"] .add-ngg-gallery-button{font-size:14px;letter-spacing:1.2px;line-height:20px;font-family:Lato,sans-serif;font-weight:900;color:#fff;background-color:#000;border:none;box-shadow:none;padding:12px 24px;text-transform:uppercase;text-align:center;cursor:pointer;flex:1;flex-grow:0;margin:0 0 0 15px}div[data-type="imagely/nextgen-gallery"] .add-ngg-gallery-button:only-of-type{flex-grow:1;width:300px;max-width:300px}div[data-type="imagely/nextgen-gallery"] .add-ngg-gallery-button:first-of-type{margin-left:0}div[data-type="imagely/nextgen-gallery"] .add-ngg-gallery-button:hover{background:#383838}
|
products/photocrati_nextgen/modules/nextgen_block/static/src/block.jsx
CHANGED
|
@@ -1,34 +1,17 @@
|
|
| 1 |
-
|
| 2 |
-
import
|
| 3 |
-
import
|
| 4 |
-
|
| 5 |
-
const { __ } = wp.i18n
|
| 6 |
-
const { RawHTML } = wp.element
|
| 7 |
-
const { registerBlockType } = wp.blocks
|
| 8 |
-
const { withSelect} = wp.data
|
| 9 |
-
const { omit } = lodash
|
| 10 |
-
const { memo } = React
|
| 11 |
-
|
| 12 |
-
// Provides a higher order component that is aware when the freeform block becomes available
|
| 13 |
-
const withFreeform = withSelect((select, props) => {
|
| 14 |
-
return {
|
| 15 |
-
Freeform: select('core/blocks').getBlockType('core/freeform')
|
| 16 |
-
}
|
| 17 |
-
})
|
| 18 |
|
| 19 |
-
|
| 20 |
-
const
|
| 21 |
-
|
| 22 |
-
const NggEdit = createNggEditComponent(jQuery, props.Freeform.edit)
|
| 23 |
-
return <NggEdit {...editProps} isSelected={true}/>
|
| 24 |
-
}))
|
| 25 |
|
| 26 |
// Register our block
|
| 27 |
registerBlockType('imagely/nextgen-gallery', {
|
| 28 |
|
| 29 |
title: __('NextGEN Gallery'),
|
| 30 |
|
| 31 |
-
|
| 32 |
|
| 33 |
icon: icons.nextgen,
|
| 34 |
|
|
@@ -46,12 +29,15 @@ registerBlockType('imagely/nextgen-gallery', {
|
|
| 46 |
customClassName: false,
|
| 47 |
},
|
| 48 |
|
| 49 |
-
edit,
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 50 |
|
| 51 |
-
save(
|
| 52 |
const { content } = attributes;
|
| 53 |
return <RawHTML>{ content }</RawHTML>
|
| 54 |
-
}
|
| 55 |
-
});
|
| 56 |
-
|
| 57 |
-
|
| 1 |
+
import NGGEditor from './edit.jsx'
|
| 2 |
+
import icons from './icons.min';
|
| 3 |
+
import React from 'react';
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 4 |
|
| 5 |
+
const { __ } = wp.i18n
|
| 6 |
+
const { RawHTML } = wp.element
|
| 7 |
+
const { registerBlockType } = wp.blocks
|
|
|
|
|
|
|
|
|
|
| 8 |
|
| 9 |
// Register our block
|
| 10 |
registerBlockType('imagely/nextgen-gallery', {
|
| 11 |
|
| 12 |
title: __('NextGEN Gallery'),
|
| 13 |
|
| 14 |
+
description: __('A block for adding NextGEN Galleries.'),
|
| 15 |
|
| 16 |
icon: icons.nextgen,
|
| 17 |
|
| 29 |
customClassName: false,
|
| 30 |
},
|
| 31 |
|
| 32 |
+
edit({attributes, setAttributes}) {
|
| 33 |
+
return <NGGEditor content={attributes.content}
|
| 34 |
+
onInsertGallery={(shortcode) => {
|
| 35 |
+
setAttributes({content: shortcode});
|
| 36 |
+
}}/>
|
| 37 |
+
},
|
| 38 |
|
| 39 |
+
save({ attributes }) {
|
| 40 |
const { content } = attributes;
|
| 41 |
return <RawHTML>{ content }</RawHTML>
|
| 42 |
+
}
|
| 43 |
+
});
|
|
|
|
|
|
products/photocrati_nextgen/modules/nextgen_block/static/src/block.min.js
DELETED
|
@@ -1,57 +0,0 @@
|
|
| 1 |
-
// Dependencies
|
| 2 |
-
import { createNggEditComponent } from './edit.min'
|
| 3 |
-
import icons from './icons.min';
|
| 4 |
-
|
| 5 |
-
const { __ } = wp.i18n
|
| 6 |
-
const { RawHTML } = wp.element
|
| 7 |
-
const { registerBlockType } = wp.blocks
|
| 8 |
-
const { withSelect} = wp.data
|
| 9 |
-
const { omit } = lodash
|
| 10 |
-
const { memo } = React
|
| 11 |
-
|
| 12 |
-
// Provides a higher order component that is aware when the freeform block becomes available
|
| 13 |
-
const withFreeform = withSelect((select, props) => {
|
| 14 |
-
return {
|
| 15 |
-
Freeform: select('core/blocks').getBlockType('core/freeform')
|
| 16 |
-
}
|
| 17 |
-
})
|
| 18 |
-
|
| 19 |
-
// When the freeform block is available, we create our edit component for NGG and render it
|
| 20 |
-
const edit = withFreeform(memo(props => {
|
| 21 |
-
const editProps = omit(props, ['Freeform'])
|
| 22 |
-
const NggEdit = createNggEditComponent(jQuery, props.Freeform.edit)
|
| 23 |
-
return <NggEdit {...editProps} isSelected={true}/>
|
| 24 |
-
}))
|
| 25 |
-
|
| 26 |
-
// Register our block
|
| 27 |
-
registerBlockType('imagely/nextgen-gallery', {
|
| 28 |
-
|
| 29 |
-
title: __('NextGEN Gallery'),
|
| 30 |
-
|
| 31 |
-
desription: __('A block for adding NextGEN Galleries.'),
|
| 32 |
-
|
| 33 |
-
icon: icons.nextgen,
|
| 34 |
-
|
| 35 |
-
category: 'common',
|
| 36 |
-
|
| 37 |
-
attributes: {
|
| 38 |
-
content: {
|
| 39 |
-
type: 'string',
|
| 40 |
-
source: 'html',
|
| 41 |
-
},
|
| 42 |
-
},
|
| 43 |
-
|
| 44 |
-
supports: {
|
| 45 |
-
className: false,
|
| 46 |
-
customClassName: false,
|
| 47 |
-
},
|
| 48 |
-
|
| 49 |
-
edit,
|
| 50 |
-
|
| 51 |
-
save( { attributes } ) {
|
| 52 |
-
const { content } = attributes;
|
| 53 |
-
return <RawHTML>{ content }</RawHTML>
|
| 54 |
-
},
|
| 55 |
-
});
|
| 56 |
-
|
| 57 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
products/photocrati_nextgen/modules/nextgen_block/static/src/components/ngg-post-thumbnail.jsx
CHANGED
|
@@ -1,189 +1,131 @@
|
|
| 1 |
-
import
|
| 2 |
-
import FormData from
|
| 3 |
-
|
| 4 |
-
|
| 5 |
-
const {
|
| 6 |
-
const {
|
| 7 |
-
const {
|
| 8 |
-
const {__}
|
| 9 |
-
const {property}
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
* Renders a NGG thumbnail
|
| 13 |
-
*/
|
| 14 |
-
export class NggThumbnail extends Component {
|
| 15 |
state = {
|
| 16 |
image_url: null,
|
| 17 |
msg: __('Loading...')
|
| 18 |
}
|
| 19 |
|
| 20 |
componentDidUpdate(prevProps) {
|
| 21 |
-
if (this.props.image_id
|
| 22 |
-
this.updateImageUrl()
|
| 23 |
}
|
| 24 |
}
|
| 25 |
|
| 26 |
componentDidMount() {
|
| 27 |
-
this.updateImageUrl()
|
| 28 |
}
|
| 29 |
|
| 30 |
updateImageUrl = () => {
|
| 31 |
this.getImageUrl(this.props.image_id)
|
| 32 |
.then(image_url => this.setState({image_url}))
|
| 33 |
-
.catch((err) => console.log(err) && this.setState({msg: __("Could not load image")}))
|
| 34 |
}
|
| 35 |
|
| 36 |
getImageUrl = image_id => {
|
| 37 |
-
const data = new FormData()
|
| 38 |
|
| 39 |
-
data.append('action', 'get_image')
|
| 40 |
-
data.append('image_id', image_id)
|
| 41 |
|
| 42 |
-
return fetch(photocrati_ajax.url,
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 43 |
.then(res => res.json())
|
| 44 |
-
.then(property('image.image_url'))
|
| 45 |
}
|
| 46 |
|
| 47 |
render() {
|
| 48 |
-
const {msg}
|
| 49 |
|
| 50 |
const style = {
|
| 51 |
paddingTop: '5px',
|
| 52 |
paddingBottom: '5px'
|
| 53 |
-
}
|
|
|
|
|
|
|
| 54 |
|
| 55 |
-
const el = this.state.image_url
|
| 56 |
-
? <img src={this.state.image_url}/>
|
| 57 |
-
: <span>{msg}</span>
|
| 58 |
-
|
| 59 |
return (
|
| 60 |
<div style={style}>{el}</div>
|
| 61 |
-
)
|
| 62 |
}
|
| 63 |
}
|
| 64 |
|
| 65 |
-
|
| 66 |
-
|
| 67 |
-
|
| 68 |
-
|
| 69 |
-
|
| 70 |
-
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
|
| 74 |
-
|
| 75 |
-
|
| 76 |
-
|
| 77 |
-
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
|
| 81 |
-
|
| 82 |
}
|
| 83 |
|
| 84 |
-
|
| 85 |
-
|
| 86 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 87 |
}
|
| 88 |
|
| 89 |
-
// Close the modal window and set the ngg_post_thumbnail post meta field
|
| 90 |
onUpdatePostThumbnail = ngg_image_id => {
|
| 91 |
tb_remove()
|
| 92 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 93 |
}
|
| 94 |
|
| 95 |
render() {
|
| 96 |
-
const {PostFeaturedImage, nggPostThumbnailId} = this.props
|
| 97 |
-
const buttonStyle = {marginTop: '10px'}
|
| 98 |
-
|
| 99 |
return (
|
| 100 |
<Fragment>
|
| 101 |
-
|
| 102 |
-
|
| 103 |
-
|
| 104 |
{__('Set NextGEN Featured Image')}
|
| 105 |
</Button>
|
| 106 |
|
| 107 |
-
{
|
| 108 |
-
<
|
| 109 |
-
<
|
| 110 |
-
<Button onClick={this.handleRemoveClick}
|
|
|
|
| 111 |
{__('Remove featured image')}
|
| 112 |
</Button>
|
| 113 |
-
</
|
| 114 |
-
|
| 115 |
</Fragment>
|
| 116 |
-
)
|
| 117 |
-
|
| 118 |
}
|
| 119 |
-
}
|
| 120 |
-
|
| 121 |
-
/**
|
| 122 |
-
* A higher-order component used to provide the PostFeaturedImage prop
|
| 123 |
-
* to the PostThumbnail component
|
| 124 |
-
* @param PostFeaturedImage PostFeaturedImage
|
| 125 |
-
*/
|
| 126 |
-
const nggPostThumbnail = PostFeaturedImage => props => (
|
| 127 |
-
<PostThumbnail PostFeaturedImage={PostFeaturedImage} {...props}/>
|
| 128 |
-
)
|
| 129 |
-
|
| 130 |
-
/**
|
| 131 |
-
* A higher-order component using the core/editor store which provides the following props
|
| 132 |
-
* to the PostThumbnail component:
|
| 133 |
-
*
|
| 134 |
-
* @param integer currentPostId the id of the current post
|
| 135 |
-
* @param integer nggPostThumbnailId the NGG image id used as a post thumbnail for the post/page
|
| 136 |
-
* @param integer featuredImageId the media library image id used as a post thumbnail for the post/page
|
| 137 |
-
*/
|
| 138 |
-
const applyWithSelect = withSelect( ( select ) => {
|
| 139 |
-
const { getCurrentPostId, getEditedPostAttribute } = select( 'core/editor' );
|
| 140 |
-
const featuredImageId = getEditedPostAttribute( 'featured_media' );
|
| 141 |
-
const meta = getEditedPostAttribute('meta')
|
| 142 |
-
const nggPostThumbnailId = (typeof meta !== 'undefined' && meta.ngg_post_thumbnail) ? meta.ngg_post_thumbnail : null;
|
| 143 |
-
|
| 144 |
-
return {
|
| 145 |
-
currentPostId: getCurrentPostId(),
|
| 146 |
-
featuredImageId,
|
| 147 |
-
nggPostThumbnailId
|
| 148 |
-
};
|
| 149 |
-
} );
|
| 150 |
-
|
| 151 |
-
|
| 152 |
-
/**
|
| 153 |
-
* A higher-order component using the core/editor store which provides the following props
|
| 154 |
-
* to the PostThumbnail component:
|
| 155 |
-
*
|
| 156 |
-
* @param function onSetPostThumbnail
|
| 157 |
-
*/
|
| 158 |
-
const applyWithDispatch = withDispatch( ( dispatch ) => {
|
| 159 |
-
const { editPost } = dispatch( 'core/editor' );
|
| 160 |
-
return {
|
| 161 |
-
onSetNggPostThumbnail(image_id) {
|
| 162 |
-
var meta = wp.data.select('core/editor').getEditedPostAttribute('meta')
|
| 163 |
-
if (typeof meta === 'undefined') {
|
| 164 |
-
meta = {}
|
| 165 |
-
}
|
| 166 |
-
meta.ngg_post_thumbnail = image_id
|
| 167 |
-
editPost({
|
| 168 |
-
...meta,
|
| 169 |
-
meta
|
| 170 |
-
})
|
| 171 |
-
},
|
| 172 |
-
|
| 173 |
-
onRemoveNggPostThumbnail() {
|
| 174 |
-
const meta = wp.data.select('core/editor').getEditedPostAttribute('meta')
|
| 175 |
-
meta.ngg_post_thumbnail = 0
|
| 176 |
-
meta.featured_media = 0
|
| 177 |
-
editPost({
|
| 178 |
-
...meta,
|
| 179 |
-
meta
|
| 180 |
-
})
|
| 181 |
-
},
|
| 182 |
-
};
|
| 183 |
-
} );
|
| 184 |
-
|
| 185 |
-
/** Export a composed component **/
|
| 186 |
-
export default PostFeaturedImage => compose(
|
| 187 |
-
applyWithSelect,
|
| 188 |
-
applyWithDispatch
|
| 189 |
-
)(nggPostThumbnail(PostFeaturedImage))
|
| 1 |
+
import React from "react";
|
| 2 |
+
import FormData from "form-data";
|
| 3 |
+
import fetch from "cross-fetch";
|
| 4 |
+
|
| 5 |
+
const {dispatch} = wp.data;
|
| 6 |
+
const {Button} = wp.components
|
| 7 |
+
const {Fragment, Component} = wp.element
|
| 8 |
+
const {__} = wp.i18n
|
| 9 |
+
const {property} = lodash
|
| 10 |
+
|
| 11 |
+
class NGGFeaturedThumbnail extends Component {
|
|
|
|
|
|
|
|
|
|
| 12 |
state = {
|
| 13 |
image_url: null,
|
| 14 |
msg: __('Loading...')
|
| 15 |
}
|
| 16 |
|
| 17 |
componentDidUpdate(prevProps) {
|
| 18 |
+
if (this.props.image_id !== prevProps.image_id) {
|
| 19 |
+
this.updateImageUrl();
|
| 20 |
}
|
| 21 |
}
|
| 22 |
|
| 23 |
componentDidMount() {
|
| 24 |
+
this.updateImageUrl();
|
| 25 |
}
|
| 26 |
|
| 27 |
updateImageUrl = () => {
|
| 28 |
this.getImageUrl(this.props.image_id)
|
| 29 |
.then(image_url => this.setState({image_url}))
|
| 30 |
+
.catch((err) => console.log(err) && this.setState({msg: __("Could not load image")}));
|
| 31 |
}
|
| 32 |
|
| 33 |
getImageUrl = image_id => {
|
| 34 |
+
const data = new FormData();
|
| 35 |
|
| 36 |
+
data.append('action', 'get_image');
|
| 37 |
+
data.append('image_id', image_id);
|
| 38 |
|
| 39 |
+
return fetch(photocrati_ajax.url,
|
| 40 |
+
{
|
| 41 |
+
method: 'POST',
|
| 42 |
+
body: data,
|
| 43 |
+
headers: {
|
| 44 |
+
'Accept': 'application/json'
|
| 45 |
+
}
|
| 46 |
+
})
|
| 47 |
.then(res => res.json())
|
| 48 |
+
.then(property('image.image_url'));
|
| 49 |
}
|
| 50 |
|
| 51 |
render() {
|
| 52 |
+
const {msg} = this.state;
|
| 53 |
|
| 54 |
const style = {
|
| 55 |
paddingTop: '5px',
|
| 56 |
paddingBottom: '5px'
|
| 57 |
+
};
|
| 58 |
+
|
| 59 |
+
const el = this.state.image_url ? <img src={this.state.image_url}/> : <span>{msg}</span>;
|
| 60 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 61 |
return (
|
| 62 |
<div style={style}>{el}</div>
|
| 63 |
+
);
|
| 64 |
}
|
| 65 |
}
|
| 66 |
|
| 67 |
+
export default class NGGFeaturedImage extends Component {
|
| 68 |
+
|
| 69 |
+
constructor(props) {
|
| 70 |
+
super(props);
|
| 71 |
+
|
| 72 |
+
this.state = {
|
| 73 |
+
ngg_id: props.meta.ngg_post_thumbnail,
|
| 74 |
+
wp_ml_id: props.featuredImageId
|
| 75 |
+
}
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
handleOpenClick = event => {
|
| 79 |
+
top.set_ngg_post_thumbnail = this.onUpdatePostThumbnail;
|
| 80 |
+
tb_show(
|
| 81 |
+
"Set NextGEN Featured Image",
|
| 82 |
+
ngg_featured_image.modal_url.replace(/%post_id%/, this.props.currentPostId)
|
| 83 |
+
);
|
| 84 |
}
|
| 85 |
|
| 86 |
+
handleRemoveClick = event => {
|
| 87 |
+
const meta = {
|
| 88 |
+
...this.props.meta,
|
| 89 |
+
ngg_post_thumbnail: 0,
|
| 90 |
+
featured_media: 0
|
| 91 |
+
};
|
| 92 |
+
this.setState({
|
| 93 |
+
ngg_id: 0
|
| 94 |
+
});
|
| 95 |
+
dispatch('core/editor').editPost({meta});
|
| 96 |
}
|
| 97 |
|
|
|
|
| 98 |
onUpdatePostThumbnail = ngg_image_id => {
|
| 99 |
tb_remove()
|
| 100 |
+
const meta = {
|
| 101 |
+
...this.props.meta,
|
| 102 |
+
ngg_post_thumbnail: parseInt(ngg_image_id)
|
| 103 |
+
};
|
| 104 |
+
this.setState({
|
| 105 |
+
ngg_id: meta.ngg_post_thumbnail
|
| 106 |
+
});
|
| 107 |
+
dispatch('core/editor').editPost({meta});
|
| 108 |
}
|
| 109 |
|
| 110 |
render() {
|
|
|
|
|
|
|
|
|
|
| 111 |
return (
|
| 112 |
<Fragment>
|
| 113 |
+
<Button style={{marginTop: '10px'}}
|
| 114 |
+
onClick={this.handleOpenClick}
|
| 115 |
+
className="editor-post-featured-image__toggle">
|
| 116 |
{__('Set NextGEN Featured Image')}
|
| 117 |
</Button>
|
| 118 |
|
| 119 |
+
{this.state.ngg_id > 0 && this.props.meta.ngg_post_thumbnail !== this.state.ngg_id ?
|
| 120 |
+
<Fragment>
|
| 121 |
+
<NGGFeaturedThumbnail image_id={this.state.ngg_id}/>
|
| 122 |
+
<Button onClick={this.handleRemoveClick}
|
| 123 |
+
className="is-link is-destructive">
|
| 124 |
{__('Remove featured image')}
|
| 125 |
</Button>
|
| 126 |
+
</Fragment>
|
| 127 |
+
: ''}
|
| 128 |
</Fragment>
|
| 129 |
+
);
|
|
|
|
| 130 |
}
|
| 131 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
products/photocrati_nextgen/modules/nextgen_block/static/src/components/ngg-post-thumbnail.min.js
DELETED
|
@@ -1,189 +0,0 @@
|
|
| 1 |
-
import fetch from 'cross-fetch'
|
| 2 |
-
import FormData from 'form-data'
|
| 3 |
-
|
| 4 |
-
const {Fragment, Component} = wp.element
|
| 5 |
-
const {withSelect, withDispatch} = wp.data
|
| 6 |
-
const {compose} = wp.compose
|
| 7 |
-
const {Button} = wp.components
|
| 8 |
-
const {__} = wp.i18n
|
| 9 |
-
const {property} = lodash
|
| 10 |
-
|
| 11 |
-
/**
|
| 12 |
-
* Renders a NGG thumbnail
|
| 13 |
-
*/
|
| 14 |
-
export class NggThumbnail extends Component {
|
| 15 |
-
state = {
|
| 16 |
-
image_url: null,
|
| 17 |
-
msg: __('Loading...')
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
componentDidUpdate(prevProps) {
|
| 21 |
-
if (this.props.image_id != prevProps.image_id) {
|
| 22 |
-
this.updateImageUrl()
|
| 23 |
-
}
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
componentDidMount() {
|
| 27 |
-
this.updateImageUrl()
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
updateImageUrl = () => {
|
| 31 |
-
this.getImageUrl(this.props.image_id)
|
| 32 |
-
.then(image_url => this.setState({image_url}))
|
| 33 |
-
.catch((err) => console.log(err) && this.setState({msg: __("Could not load image")}))
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
getImageUrl = image_id => {
|
| 37 |
-
const data = new FormData()
|
| 38 |
-
|
| 39 |
-
data.append('action', 'get_image')
|
| 40 |
-
data.append('image_id', image_id)
|
| 41 |
-
|
| 42 |
-
return fetch(photocrati_ajax.url, {method: 'POST', body: data, headers: {'Accept': 'application/json'}})
|
| 43 |
-
.then(res => res.json())
|
| 44 |
-
.then(property('image.image_url'))
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
render() {
|
| 48 |
-
const {msg} = this.state
|
| 49 |
-
|
| 50 |
-
const style = {
|
| 51 |
-
paddingTop: '5px',
|
| 52 |
-
paddingBottom: '5px'
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
const el = this.state.image_url
|
| 56 |
-
? <img src={this.state.image_url}/>
|
| 57 |
-
: <span>{msg}</span>
|
| 58 |
-
|
| 59 |
-
return (
|
| 60 |
-
<div style={style}>{el}</div>
|
| 61 |
-
)
|
| 62 |
-
}
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
/**
|
| 66 |
-
* Displays the NGG Post Thumbnail component, which is a wrapper
|
| 67 |
-
* around the PostFeaturedImage component.
|
| 68 |
-
*
|
| 69 |
-
* This exponent expects the following props:
|
| 70 |
-
*
|
| 71 |
-
* @param PostFeaturedImage PostFeaturedImage
|
| 72 |
-
* @param Function onUpdatePostThumbnail
|
| 73 |
-
* @param Integer nggPostThumbnailId
|
| 74 |
-
*/
|
| 75 |
-
class PostThumbnail extends Component {
|
| 76 |
-
|
| 77 |
-
// Open the modal window to select a Featured Image
|
| 78 |
-
handleOpenClick = e => {
|
| 79 |
-
const {currentPostId} = this.props
|
| 80 |
-
top.set_ngg_post_thumbnail = this.onUpdatePostThumbnail
|
| 81 |
-
tb_show("Set NextGEN Featured Image", ngg_featured_image.modal_url.replace(/%post_id%/, currentPostId))
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
// Remove the post thumbnail
|
| 85 |
-
handleRemoveClick = e => {
|
| 86 |
-
this.props.onRemoveNggPostThumbnail()
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
// Close the modal window and set the ngg_post_thumbnail post meta field
|
| 90 |
-
onUpdatePostThumbnail = ngg_image_id => {
|
| 91 |
-
tb_remove()
|
| 92 |
-
this.props.onSetNggPostThumbnail(parseInt(ngg_image_id))
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
render() {
|
| 96 |
-
const {PostFeaturedImage, nggPostThumbnailId} = this.props
|
| 97 |
-
const buttonStyle = {marginTop: '10px'}
|
| 98 |
-
|
| 99 |
-
return (
|
| 100 |
-
<Fragment>
|
| 101 |
-
{! nggPostThumbnailId && <PostFeaturedImage {...this.props}/>}
|
| 102 |
-
|
| 103 |
-
<Button style={buttonStyle} onClick={this.handleOpenClick} className="editor-post-featured-image__toggle">
|
| 104 |
-
{__('Set NextGEN Featured Image')}
|
| 105 |
-
</Button>
|
| 106 |
-
|
| 107 |
-
{nggPostThumbnailId > 0 &&
|
| 108 |
-
<div>
|
| 109 |
-
<NggThumbnail image_id={nggPostThumbnailId}/>
|
| 110 |
-
<Button onClick={this.handleRemoveClick} className="is-link is-destructive">
|
| 111 |
-
{__('Remove featured image')}
|
| 112 |
-
</Button>
|
| 113 |
-
</div>
|
| 114 |
-
}
|
| 115 |
-
</Fragment>
|
| 116 |
-
)
|
| 117 |
-
|
| 118 |
-
}
|
| 119 |
-
}
|
| 120 |
-
|
| 121 |
-
/**
|
| 122 |
-
* A higher-order component used to provide the PostFeaturedImage prop
|
| 123 |
-
* to the PostThumbnail component
|
| 124 |
-
* @param PostFeaturedImage PostFeaturedImage
|
| 125 |
-
*/
|
| 126 |
-
const nggPostThumbnail = PostFeaturedImage => props => (
|
| 127 |
-
<PostThumbnail PostFeaturedImage={PostFeaturedImage} {...props}/>
|
| 128 |
-
)
|
| 129 |
-
|
| 130 |
-
/**
|
| 131 |
-
* A higher-order component using the core/editor store which provides the following props
|
| 132 |
-
* to the PostThumbnail component:
|
| 133 |
-
*
|
| 134 |
-
* @param integer currentPostId the id of the current post
|
| 135 |
-
* @param integer nggPostThumbnailId the NGG image id used as a post thumbnail for the post/page
|
| 136 |
-
* @param integer featuredImageId the media library image id used as a post thumbnail for the post/page
|
| 137 |
-
*/
|
| 138 |
-
const applyWithSelect = withSelect( ( select ) => {
|
| 139 |
-
const { getCurrentPostId, getEditedPostAttribute } = select( 'core/editor' );
|
| 140 |
-
const featuredImageId = getEditedPostAttribute( 'featured_media' );
|
| 141 |
-
const meta = getEditedPostAttribute('meta')
|
| 142 |
-
const nggPostThumbnailId = (typeof meta !== 'undefined' && meta.ngg_post_thumbnail) ? meta.ngg_post_thumbnail : null;
|
| 143 |
-
|
| 144 |
-
return {
|
| 145 |
-
currentPostId: getCurrentPostId(),
|
| 146 |
-
featuredImageId,
|
| 147 |
-
nggPostThumbnailId
|
| 148 |
-
};
|
| 149 |
-
} );
|
| 150 |
-
|
| 151 |
-
|
| 152 |
-
/**
|
| 153 |
-
* A higher-order component using the core/editor store which provides the following props
|
| 154 |
-
* to the PostThumbnail component:
|
| 155 |
-
*
|
| 156 |
-
* @param function onSetPostThumbnail
|
| 157 |
-
*/
|
| 158 |
-
const applyWithDispatch = withDispatch( ( dispatch ) => {
|
| 159 |
-
const { editPost } = dispatch( 'core/editor' );
|
| 160 |
-
return {
|
| 161 |
-
onSetNggPostThumbnail(image_id) {
|
| 162 |
-
var meta = wp.data.select('core/editor').getEditedPostAttribute('meta')
|
| 163 |
-
if (typeof meta === 'undefined') {
|
| 164 |
-
meta = {}
|
| 165 |
-
}
|
| 166 |
-
meta.ngg_post_thumbnail = image_id
|
| 167 |
-
editPost({
|
| 168 |
-
...meta,
|
| 169 |
-
meta
|
| 170 |
-
})
|
| 171 |
-
},
|
| 172 |
-
|
| 173 |
-
onRemoveNggPostThumbnail() {
|
| 174 |
-
const meta = wp.data.select('core/editor').getEditedPostAttribute('meta')
|
| 175 |
-
meta.ngg_post_thumbnail = 0
|
| 176 |
-
meta.featured_media = 0
|
| 177 |
-
editPost({
|
| 178 |
-
...meta,
|
| 179 |
-
meta
|
| 180 |
-
})
|
| 181 |
-
},
|
| 182 |
-
};
|
| 183 |
-
} );
|
| 184 |
-
|
| 185 |
-
/** Export a composed component **/
|
| 186 |
-
export default PostFeaturedImage => compose(
|
| 187 |
-
applyWithSelect,
|
| 188 |
-
applyWithDispatch
|
| 189 |
-
)(nggPostThumbnail(PostFeaturedImage))
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
products/photocrati_nextgen/modules/nextgen_block/static/src/edit.jsx
CHANGED
|
@@ -1,74 +1,147 @@
|
|
| 1 |
-
|
| 2 |
-
const { memoize } = lodash
|
| 3 |
-
|
| 4 |
-
// Given jQuery and the Freeform block settings, creates the Ngg Editor Component
|
| 5 |
-
export const createNggEditComponent = memoize(($, Freeform) => {
|
| 6 |
-
class NggEditor extends Freeform {
|
| 7 |
-
constructor(props) {
|
| 8 |
-
super(props)
|
| 9 |
-
this.openIGW = this.openIGW.bind(this)
|
| 10 |
-
this.updateContent = this.updateContent.bind(this)
|
| 11 |
-
this.hasGallery = this.hasGallery.bind(this)
|
| 12 |
-
this.toggleAddGalleryBtn= this.toggleAddGalleryBtn.bind(this)
|
| 13 |
-
}
|
| 14 |
|
| 15 |
-
|
| 16 |
-
return this.props.attributes.content && this.props.attributes.content.length > 0
|
| 17 |
-
}
|
| 18 |
|
| 19 |
-
|
| 20 |
-
super.componentDidMount()
|
| 21 |
-
$(this.ref).addClass('freeform-toolbar').addClass('ngg-freeform-toolbar')
|
| 22 |
-
this.toggleAddGalleryBtn();
|
| 23 |
|
| 24 |
-
|
|
|
|
|
|
|
| 25 |
|
| 26 |
-
|
| 27 |
-
|
| 28 |
-
|
| 29 |
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
|
| 33 |
-
$(this.ref).addClass('hidden');
|
| 34 |
-
$(this.ref).siblings('.add-ngg-gallery-wrap').hide()
|
| 35 |
-
}
|
| 36 |
-
else {
|
| 37 |
-
$(this.ref).removeClass('hidden');
|
| 38 |
-
$(this.ref).siblings('.add-ngg-gallery-wrap').show()
|
| 39 |
-
}
|
| 40 |
-
}
|
| 41 |
|
| 42 |
-
|
| 43 |
-
this.props.setAttributes({content})
|
| 44 |
-
}
|
| 45 |
|
| 46 |
-
|
| 47 |
-
super.onSetup(editor);
|
| 48 |
-
const updateContent = this.updateContent.bind(this)
|
| 49 |
|
| 50 |
-
|
| 51 |
-
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
|
|
|
|
| 55 |
|
| 56 |
-
|
| 57 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 58 |
}
|
| 59 |
|
| 60 |
-
|
| 61 |
-
|
| 62 |
-
|
| 63 |
-
|
| 64 |
-
<
|
| 65 |
-
|
| 66 |
-
|
| 67 |
-
|
|
|
|
|
|
|
|
|
|
| 68 |
</div>
|
| 69 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 70 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 71 |
}
|
| 72 |
|
| 73 |
-
|
| 74 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import React from 'react';
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2 |
|
| 3 |
+
const body = document.body;
|
|
|
|
|
|
|
| 4 |
|
| 5 |
+
class NGGModal extends React.Component {
|
|
|
|
|
|
|
|
|
|
| 6 |
|
| 7 |
+
constructor(props) {
|
| 8 |
+
super(props)
|
| 9 |
+
this.closeModal = this.closeModal.bind(this);
|
| 10 |
|
| 11 |
+
this.background_layer = document.createElement('div');
|
| 12 |
+
this.background_layer.setAttribute('id', 'add-ngg-gallery-modal-background');
|
| 13 |
+
}
|
| 14 |
|
| 15 |
+
componentDidMount() {
|
| 16 |
+
body.style.overflow = 'hidden';
|
| 17 |
+
body.appendChild(this.background_layer);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 18 |
|
| 19 |
+
const self = this;
|
|
|
|
|
|
|
| 20 |
|
| 21 |
+
const iframe = document.getElementById('add-ngg-gallery-block-iframe');
|
|
|
|
|
|
|
| 22 |
|
| 23 |
+
iframe.addEventListener('NGG_Iframe_Ready', function() {
|
| 24 |
+
document.getElementById("add-ngg-gallery-modal-spinner").classList.add("add-ngg-gallery-modal-spinner-hidden");
|
| 25 |
+
});
|
| 26 |
+
|
| 27 |
+
iframe.addEventListener('NGG_Insert_Gallery', function(event) {
|
| 28 |
+
self.props.onInsertGallery(event.detail.shortcode);
|
| 29 |
|
| 30 |
+
})
|
| 31 |
+
|
| 32 |
+
iframe.addEventListener('NGG_Close_Modal', function() {
|
| 33 |
+
self.props.onCloseModal();
|
| 34 |
+
})
|
| 35 |
+
}
|
| 36 |
+
|
| 37 |
+
componentWillUnmount() {
|
| 38 |
+
body.style.overflow = 'auto';
|
| 39 |
+
body.removeChild(this.background_layer);
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
closeModal() {
|
| 43 |
+
this.props.onCloseModal();
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
render() {
|
| 47 |
+
let attach_to_post_url = nextgen_gallery_attach_to_post_url + '&origin=block';
|
| 48 |
+
|
| 49 |
+
if (this.props.content) {
|
| 50 |
+
attach_to_post_url += '&shortcode=';
|
| 51 |
+
let shortcode = this.props.content.replace(/\\"/g, '"');
|
| 52 |
+
shortcode = shortcode.replace(/^\[ngg_images/, '');
|
| 53 |
+
shortcode = shortcode.replace(/^\[ngg/, '');
|
| 54 |
+
shortcode = shortcode.replace(/]$/, '');
|
| 55 |
+
attach_to_post_url += Base64.encode(shortcode);
|
| 56 |
}
|
| 57 |
|
| 58 |
+
// use createPortal to insert the modal div as a child of <body> to prevent the WP-Admin sidebar
|
| 59 |
+
// menu from getting in the way and causing annoying z-index issues
|
| 60 |
+
return ReactDOM.createPortal(
|
| 61 |
+
<div id="add-ngg-gallery-modal">
|
| 62 |
+
<a href='#'
|
| 63 |
+
id='add-ngg-gallery-modal-close'
|
| 64 |
+
onClick={this.closeModal}>
|
| 65 |
+
<span className="dashicons dashicons-no"/>
|
| 66 |
+
</a>
|
| 67 |
+
<div id="add-ngg-gallery-modal-spinner">
|
| 68 |
+
<i className="fa fa-spin fa-spinner"/>
|
| 69 |
</div>
|
| 70 |
+
<iframe src={attach_to_post_url}
|
| 71 |
+
tabIndex="-1"
|
| 72 |
+
name="add-ngg-gallery-block-iframe"
|
| 73 |
+
id="add-ngg-gallery-block-iframe"/>
|
| 74 |
+
</div>,
|
| 75 |
+
body
|
| 76 |
+
);
|
| 77 |
+
}
|
| 78 |
+
|
| 79 |
+
}
|
| 80 |
+
|
| 81 |
+
export default class NGGEditor extends React.Component {
|
| 82 |
+
|
| 83 |
+
constructor(props) {
|
| 84 |
+
super(props)
|
| 85 |
+
|
| 86 |
+
this.state = {
|
| 87 |
+
open: false
|
| 88 |
}
|
| 89 |
+
|
| 90 |
+
this.openIGW = this.openIGW.bind(this);
|
| 91 |
+
this.closeIGW = this.closeIGW.bind(this);
|
| 92 |
+
this.removeGallery = this.removeGallery.bind(this);
|
| 93 |
+
}
|
| 94 |
+
|
| 95 |
+
hasGallery() {
|
| 96 |
+
return this.props.content && this.props.content.length > 0
|
| 97 |
}
|
| 98 |
|
| 99 |
+
removeGallery() {
|
| 100 |
+
this.props.onInsertGallery('');
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
closeIGW() {
|
| 104 |
+
this.setState({
|
| 105 |
+
open: false
|
| 106 |
+
});
|
| 107 |
+
}
|
| 108 |
+
|
| 109 |
+
openIGW() {
|
| 110 |
+
this.setState({
|
| 111 |
+
open: true
|
| 112 |
+
});
|
| 113 |
+
}
|
| 114 |
+
|
| 115 |
+
render() {
|
| 116 |
+
return (
|
| 117 |
+
<div className="add-ngg-gallery-parent">
|
| 118 |
+
{this.state.open ?
|
| 119 |
+
<NGGModal content={this.props.content}
|
| 120 |
+
onCloseModal={this.closeIGW}
|
| 121 |
+
onInsertGallery={this.props.onInsertGallery}/>
|
| 122 |
+
: ''
|
| 123 |
+
}
|
| 124 |
+
{this.hasGallery() ?
|
| 125 |
+
<div className="add-ngg-gallery-block">
|
| 126 |
+
<h3>{add_ngg_gallery_block_i18n.h3}</h3>
|
| 127 |
+
<button className="add-ngg-gallery-button"
|
| 128 |
+
onClick={this.openIGW}>
|
| 129 |
+
{add_ngg_gallery_block_i18n.edit}
|
| 130 |
+
</button>
|
| 131 |
+
<button className="add-ngg-gallery-button"
|
| 132 |
+
onClick={this.removeGallery}>
|
| 133 |
+
{add_ngg_gallery_block_i18n.delete}
|
| 134 |
+
</button>
|
| 135 |
+
</div>
|
| 136 |
+
:
|
| 137 |
+
<div className="add-ngg-gallery-block">
|
| 138 |
+
<div className="add-ngg-gallery-button"
|
| 139 |
+
onClick={this.openIGW}>
|
| 140 |
+
{add_ngg_gallery_block_i18n.create}
|
| 141 |
+
</div>
|
| 142 |
+
</div>
|
| 143 |
+
}
|
| 144 |
+
</div>
|
| 145 |
+
)
|
| 146 |
+
}
|
| 147 |
+
}
|
products/photocrati_nextgen/modules/nextgen_block/static/src/edit.min.js
DELETED
|
@@ -1,74 +0,0 @@
|
|
| 1 |
-
const { __ } = wp.i18n;
|
| 2 |
-
const { memoize } = lodash
|
| 3 |
-
|
| 4 |
-
// Given jQuery and the Freeform block settings, creates the Ngg Editor Component
|
| 5 |
-
export const createNggEditComponent = memoize(($, Freeform) => {
|
| 6 |
-
class NggEditor extends Freeform {
|
| 7 |
-
constructor(props) {
|
| 8 |
-
super(props)
|
| 9 |
-
this.openIGW = this.openIGW.bind(this)
|
| 10 |
-
this.updateContent = this.updateContent.bind(this)
|
| 11 |
-
this.hasGallery = this.hasGallery.bind(this)
|
| 12 |
-
this.toggleAddGalleryBtn= this.toggleAddGalleryBtn.bind(this)
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
hasGallery() {
|
| 16 |
-
return this.props.attributes.content && this.props.attributes.content.length > 0
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
componentDidMount() {
|
| 20 |
-
super.componentDidMount()
|
| 21 |
-
$(this.ref).addClass('freeform-toolbar').addClass('ngg-freeform-toolbar')
|
| 22 |
-
this.toggleAddGalleryBtn();
|
| 23 |
-
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
componentDidUpdate() {
|
| 27 |
-
this.toggleAddGalleryBtn();
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
toggleAddGalleryBtn() {
|
| 31 |
-
// Determine the UI state
|
| 32 |
-
if (this.props.attributes.content) {
|
| 33 |
-
$(this.ref).addClass('hidden');
|
| 34 |
-
$(this.ref).siblings('.add-ngg-gallery-wrap').hide()
|
| 35 |
-
}
|
| 36 |
-
else {
|
| 37 |
-
$(this.ref).removeClass('hidden');
|
| 38 |
-
$(this.ref).siblings('.add-ngg-gallery-wrap').show()
|
| 39 |
-
}
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
updateContent(content) {
|
| 43 |
-
this.props.setAttributes({content})
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
onSetup(editor){
|
| 47 |
-
super.onSetup(editor);
|
| 48 |
-
const updateContent = this.updateContent.bind(this)
|
| 49 |
-
|
| 50 |
-
// When NGG is added or removed, we must set the classic "content" attribute,
|
| 51 |
-
// which will re-render our component
|
| 52 |
-
editor.on('ngg-removed', () => updateContent(""))
|
| 53 |
-
editor.on('ngg-inserted', ({shortcode}) => updateContent(shortcode))
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
openIGW() {
|
| 57 |
-
this.editor.execCommand('ngg_attach_to_post')
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
render(){
|
| 61 |
-
const classic = super.render()
|
| 62 |
-
return [
|
| 63 |
-
classic,
|
| 64 |
-
<div className="add-ngg-gallery-wrap">
|
| 65 |
-
<div className="add-ngg-gallery" onClick={this.openIGW}>
|
| 66 |
-
{ngg_tinymce_plugin.i18n.button_label}
|
| 67 |
-
</div>
|
| 68 |
-
</div>
|
| 69 |
-
]
|
| 70 |
-
}
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
return NggEditor
|
| 74 |
-
})
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
products/photocrati_nextgen/modules/nextgen_block/static/src/post-thumbnail.jsx
CHANGED
|
@@ -1,39 +1,19 @@
|
|
| 1 |
-
import
|
| 2 |
-
|
| 3 |
|
| 4 |
-
|
| 5 |
-
const
|
| 6 |
-
return obj[prop]
|
| 7 |
-
})
|
| 8 |
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
const
|
| 12 |
-
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
}
|
| 19 |
-
}
|
| 20 |
-
const wpProxy = {
|
| 21 |
-
get(obj, prop) {
|
| 22 |
-
if (prop == 'editor') {
|
| 23 |
-
if (obj[prop] && !obj[prop].isProxy) {
|
| 24 |
-
obj[prop] = new Proxy(obj[prop], wpEditorProxy)
|
| 25 |
-
}
|
| 26 |
-
}
|
| 27 |
-
return obj[prop]
|
| 28 |
-
},
|
| 29 |
-
|
| 30 |
-
set(obj, prop, value) {
|
| 31 |
-
if (prop == 'editor' && !value.isProxy) {
|
| 32 |
-
value = new Proxy(value, wpEditorProxy)
|
| 33 |
-
}
|
| 34 |
-
obj[prop] = value
|
| 35 |
-
return value
|
| 36 |
}
|
| 37 |
}
|
| 38 |
-
|
| 39 |
-
|
| 1 |
+
import React from "react";
|
| 2 |
+
import NGGFeaturedImage from './components/ngg-post-thumbnail.jsx';
|
| 3 |
|
| 4 |
+
const {select} = wp.data;
|
| 5 |
+
const {Fragment} = wp.element
|
|
|
|
|
|
|
| 6 |
|
| 7 |
+
function setFeaturedImageDisplay(OriginalComponent) {
|
| 8 |
+
return (props) => {
|
| 9 |
+
const meta = select('core/editor').getCurrentPostAttribute('meta');
|
| 10 |
+
return (
|
| 11 |
+
<Fragment>
|
| 12 |
+
<OriginalComponent {...props}/>
|
| 13 |
+
<NGGFeaturedImage {...props} meta={meta}/>
|
| 14 |
+
</Fragment>
|
| 15 |
+
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 16 |
}
|
| 17 |
}
|
| 18 |
+
|
| 19 |
+
wp.hooks.addFilter('editor.PostFeaturedImage', 'imagely/featured-image-display', setFeaturedImageDisplay);
|
products/photocrati_nextgen/modules/nextgen_block/static/src/post-thumbnail.min.js
DELETED
|
@@ -1,39 +0,0 @@
|
|
| 1 |
-
import NggPostThumbnail from './components/ngg-post-thumbnail.min'
|
| 2 |
-
const {memoize} = lodash
|
| 3 |
-
|
| 4 |
-
// Gets the original component which we will wrap
|
| 5 |
-
const getOriginalComponent = obj => memoize(prop => {
|
| 6 |
-
return obj[prop]
|
| 7 |
-
})
|
| 8 |
-
|
| 9 |
-
// Wrap wp && wp.editor in a Proxy. We can then override the wp.editor.PostFeaturedImage component
|
| 10 |
-
// TODO: All of this logic should be encapsulated into a utility of some kind.
|
| 11 |
-
const wpEditorProxy = {
|
| 12 |
-
get(obj, prop) {
|
| 13 |
-
if (prop == 'isProxy') return true
|
| 14 |
-
else if (prop == 'PostFeaturedImage') {
|
| 15 |
-
return NggPostThumbnail(getOriginalComponent(obj)(prop))
|
| 16 |
-
}
|
| 17 |
-
return obj[prop]
|
| 18 |
-
}
|
| 19 |
-
}
|
| 20 |
-
const wpProxy = {
|
| 21 |
-
get(obj, prop) {
|
| 22 |
-
if (prop == 'editor') {
|
| 23 |
-
if (obj[prop] && !obj[prop].isProxy) {
|
| 24 |
-
obj[prop] = new Proxy(obj[prop], wpEditorProxy)
|
| 25 |
-
}
|
| 26 |
-
}
|
| 27 |
-
return obj[prop]
|
| 28 |
-
},
|
| 29 |
-
|
| 30 |
-
set(obj, prop, value) {
|
| 31 |
-
if (prop == 'editor' && !value.isProxy) {
|
| 32 |
-
value = new Proxy(value, wpEditorProxy)
|
| 33 |
-
}
|
| 34 |
-
obj[prop] = value
|
| 35 |
-
return value
|
| 36 |
-
}
|
| 37 |
-
}
|
| 38 |
-
window.wp.originalEditor = window.wp.editor;
|
| 39 |
-
window.wp = new Proxy(wp, wpProxy);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
readme.txt
CHANGED
|
@@ -1,13 +1,13 @@
|
|
| 1 |
=== WordPress Gallery Plugin - NextGEN Gallery ===
|
| 2 |
Contributors: photocrati, imagely
|
| 3 |
Tags: wordpress gallery plugin, gallery, nextgen, nextgen gallery, photo gallery, image gallery, photography, slideshow, images, photo, photo album, watermark
|
| 4 |
-
Requires at least:
|
| 5 |
-
Stable tag: 3.3.
|
| 6 |
-
Tested up to: 5.5.
|
| 7 |
-
License:
|
| 8 |
-
Requires PHP: 5.
|
| 9 |
|
| 10 |
-
The most popular WordPress gallery plugin and one of the most popular plugins of all time with over
|
| 11 |
|
| 12 |
== Description ==
|
| 13 |
|
|
@@ -180,6 +180,16 @@ For more information, feel free to visit the official website for the NextGEN Ga
|
|
| 180 |
|
| 181 |
== Changelog ==
|
| 182 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 183 |
= V3.3.17 - 08.18.2020 =
|
| 184 |
* Fixed: Override Thumbnail Settings not configurable
|
| 185 |
* Fixed: Broken gallery displays in WP 5.5 with Classic Editor
|
| 1 |
=== WordPress Gallery Plugin - NextGEN Gallery ===
|
| 2 |
Contributors: photocrati, imagely
|
| 3 |
Tags: wordpress gallery plugin, gallery, nextgen, nextgen gallery, photo gallery, image gallery, photography, slideshow, images, photo, photo album, watermark
|
| 4 |
+
Requires at least: 5.2.0
|
| 5 |
+
Stable tag: 3.3.20
|
| 6 |
+
Tested up to: 5.5.1
|
| 7 |
+
License: GPLv3
|
| 8 |
+
Requires PHP: 5.6
|
| 9 |
|
| 10 |
+
The most popular WordPress gallery plugin and one of the most popular plugins of all time with over 30 million downloads.
|
| 11 |
|
| 12 |
== Description ==
|
| 13 |
|
| 180 |
|
| 181 |
== Changelog ==
|
| 182 |
|
| 183 |
+
= V3.3.20 - 10.13.2020 =
|
| 184 |
+
* NEW: PHP 5.6 is the minimum supported PHP version
|
| 185 |
+
* NEW: WordPress 5.2 is the minimum support PHP version
|
| 186 |
+
* Fixed: Block disappearing in Block Editor
|
| 187 |
+
* Fixed: Gutenberg block and featured image features were broken on wordpress.com hosting
|
| 188 |
+
* Note: NextGEN Gallery will soon be licensed under GPLv3.
|
| 189 |
+
|
| 190 |
+
= V3.3.17.1 - 09.03.2020 =
|
| 191 |
+
* Fixed: Gutenberg block and featured image features were broken on wordpress.com hosting
|
| 192 |
+
|
| 193 |
= V3.3.17 - 08.18.2020 =
|
| 194 |
* Fixed: Override Thumbnail Settings not configurable
|
| 195 |
* Fixed: Broken gallery displays in WP 5.5 with Classic Editor
|
vendor/bin/php-parse
DELETED
|
@@ -1,205 +0,0 @@
|
|
| 1 |
-
#!/usr/bin/env php
|
| 2 |
-
<?php
|
| 3 |
-
|
| 4 |
-
foreach ([__DIR__ . '/../../../autoload.php', __DIR__ . '/../vendor/autoload.php'] as $file) {
|
| 5 |
-
if (file_exists($file)) {
|
| 6 |
-
require $file;
|
| 7 |
-
break;
|
| 8 |
-
}
|
| 9 |
-
}
|
| 10 |
-
|
| 11 |
-
ini_set('xdebug.max_nesting_level', 3000);
|
| 12 |
-
|
| 13 |
-
// Disable XDebug var_dump() output truncation
|
| 14 |
-
ini_set('xdebug.var_display_max_children', -1);
|
| 15 |
-
ini_set('xdebug.var_display_max_data', -1);
|
| 16 |
-
ini_set('xdebug.var_display_max_depth', -1);
|
| 17 |
-
|
| 18 |
-
list($operations, $files, $attributes) = parseArgs($argv);
|
| 19 |
-
|
| 20 |
-
/* Dump nodes by default */
|
| 21 |
-
if (empty($operations)) {
|
| 22 |
-
$operations[] = 'dump';
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
if (empty($files)) {
|
| 26 |
-
showHelp("Must specify at least one file.");
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
$lexer = new PhpParser\Lexer\Emulative(['usedAttributes' => [
|
| 30 |
-
'startLine', 'endLine', 'startFilePos', 'endFilePos', 'comments'
|
| 31 |
-
]]);
|
| 32 |
-
$parser = (new PhpParser\ParserFactory)->create(
|
| 33 |
-
PhpParser\ParserFactory::PREFER_PHP7,
|
| 34 |
-
$lexer
|
| 35 |
-
);
|
| 36 |
-
$dumper = new PhpParser\NodeDumper([
|
| 37 |
-
'dumpComments' => true,
|
| 38 |
-
'dumpPositions' => $attributes['with-positions'],
|
| 39 |
-
]);
|
| 40 |
-
$prettyPrinter = new PhpParser\PrettyPrinter\Standard;
|
| 41 |
-
|
| 42 |
-
$traverser = new PhpParser\NodeTraverser();
|
| 43 |
-
$traverser->addVisitor(new PhpParser\NodeVisitor\NameResolver);
|
| 44 |
-
|
| 45 |
-
foreach ($files as $file) {
|
| 46 |
-
if (strpos($file, '<?php') === 0) {
|
| 47 |
-
$code = $file;
|
| 48 |
-
fwrite(STDERR, "====> Code $code\n");
|
| 49 |
-
} else {
|
| 50 |
-
if (!file_exists($file)) {
|
| 51 |
-
fwrite(STDERR, "File $file does not exist.\n");
|
| 52 |
-
exit(1);
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
$code = file_get_contents($file);
|
| 56 |
-
fwrite(STDERR, "====> File $file:\n");
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
if ($attributes['with-recovery']) {
|
| 60 |
-
$errorHandler = new PhpParser\ErrorHandler\Collecting;
|
| 61 |
-
$stmts = $parser->parse($code, $errorHandler);
|
| 62 |
-
foreach ($errorHandler->getErrors() as $error) {
|
| 63 |
-
$message = formatErrorMessage($error, $code, $attributes['with-column-info']);
|
| 64 |
-
fwrite(STDERR, $message . "\n");
|
| 65 |
-
}
|
| 66 |
-
if (null === $stmts) {
|
| 67 |
-
continue;
|
| 68 |
-
}
|
| 69 |
-
} else {
|
| 70 |
-
try {
|
| 71 |
-
$stmts = $parser->parse($code);
|
| 72 |
-
} catch (PhpParser\Error $error) {
|
| 73 |
-
$message = formatErrorMessage($error, $code, $attributes['with-column-info']);
|
| 74 |
-
fwrite(STDERR, $message . "\n");
|
| 75 |
-
exit(1);
|
| 76 |
-
}
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
foreach ($operations as $operation) {
|
| 80 |
-
if ('dump' === $operation) {
|
| 81 |
-
fwrite(STDERR, "==> Node dump:\n");
|
| 82 |
-
echo $dumper->dump($stmts, $code), "\n";
|
| 83 |
-
} elseif ('pretty-print' === $operation) {
|
| 84 |
-
fwrite(STDERR, "==> Pretty print:\n");
|
| 85 |
-
echo $prettyPrinter->prettyPrintFile($stmts), "\n";
|
| 86 |
-
} elseif ('json-dump' === $operation) {
|
| 87 |
-
fwrite(STDERR, "==> JSON dump:\n");
|
| 88 |
-
echo json_encode($stmts, JSON_PRETTY_PRINT), "\n";
|
| 89 |
-
} elseif ('var-dump' === $operation) {
|
| 90 |
-
fwrite(STDERR, "==> var_dump():\n");
|
| 91 |
-
var_dump($stmts);
|
| 92 |
-
} elseif ('resolve-names' === $operation) {
|
| 93 |
-
fwrite(STDERR, "==> Resolved names.\n");
|
| 94 |
-
$stmts = $traverser->traverse($stmts);
|
| 95 |
-
}
|
| 96 |
-
}
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
function formatErrorMessage(PhpParser\Error $e, $code, $withColumnInfo) {
|
| 100 |
-
if ($withColumnInfo && $e->hasColumnInfo()) {
|
| 101 |
-
return $e->getMessageWithColumnInfo($code);
|
| 102 |
-
} else {
|
| 103 |
-
return $e->getMessage();
|
| 104 |
-
}
|
| 105 |
-
}
|
| 106 |
-
|
| 107 |
-
function showHelp($error = '') {
|
| 108 |
-
if ($error) {
|
| 109 |
-
fwrite(STDERR, $error . "\n\n");
|
| 110 |
-
}
|
| 111 |
-
fwrite($error ? STDERR : STDOUT, <<<OUTPUT
|
| 112 |
-
Usage: php-parse [operations] file1.php [file2.php ...]
|
| 113 |
-
or: php-parse [operations] "<?php code"
|
| 114 |
-
Turn PHP source code into an abstract syntax tree.
|
| 115 |
-
|
| 116 |
-
Operations is a list of the following options (--dump by default):
|
| 117 |
-
|
| 118 |
-
-d, --dump Dump nodes using NodeDumper
|
| 119 |
-
-p, --pretty-print Pretty print file using PrettyPrinter\Standard
|
| 120 |
-
-j, --json-dump Print json_encode() result
|
| 121 |
-
--var-dump var_dump() nodes (for exact structure)
|
| 122 |
-
-N, --resolve-names Resolve names using NodeVisitor\NameResolver
|
| 123 |
-
-c, --with-column-info Show column-numbers for errors (if available)
|
| 124 |
-
-P, --with-positions Show positions in node dumps
|
| 125 |
-
-r, --with-recovery Use parsing with error recovery
|
| 126 |
-
-h, --help Display this page
|
| 127 |
-
|
| 128 |
-
Example:
|
| 129 |
-
php-parse -d -p -N -d file.php
|
| 130 |
-
|
| 131 |
-
Dumps nodes, pretty prints them, then resolves names and dumps them again.
|
| 132 |
-
|
| 133 |
-
|
| 134 |
-
OUTPUT
|
| 135 |
-
);
|
| 136 |
-
exit($error ? 1 : 0);
|
| 137 |
-
}
|
| 138 |
-
|
| 139 |
-
function parseArgs($args) {
|
| 140 |
-
$operations = [];
|
| 141 |
-
$files = [];
|
| 142 |
-
$attributes = [
|
| 143 |
-
'with-column-info' => false,
|
| 144 |
-
'with-positions' => false,
|
| 145 |
-
'with-recovery' => false,
|
| 146 |
-
];
|
| 147 |
-
|
| 148 |
-
array_shift($args);
|
| 149 |
-
$parseOptions = true;
|
| 150 |
-
foreach ($args as $arg) {
|
| 151 |
-
if (!$parseOptions) {
|
| 152 |
-
$files[] = $arg;
|
| 153 |
-
continue;
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
switch ($arg) {
|
| 157 |
-
case '--dump':
|
| 158 |
-
case '-d':
|
| 159 |
-
$operations[] = 'dump';
|
| 160 |
-
break;
|
| 161 |
-
case '--pretty-print':
|
| 162 |
-
case '-p':
|
| 163 |
-
$operations[] = 'pretty-print';
|
| 164 |
-
break;
|
| 165 |
-
case '--json-dump':
|
| 166 |
-
case '-j':
|
| 167 |
-
$operations[] = 'json-dump';
|
| 168 |
-
break;
|
| 169 |
-
case '--var-dump':
|
| 170 |
-
$operations[] = 'var-dump';
|
| 171 |
-
break;
|
| 172 |
-
case '--resolve-names':
|
| 173 |
-
case '-N';
|
| 174 |
-
$operations[] = 'resolve-names';
|
| 175 |
-
break;
|
| 176 |
-
case '--with-column-info':
|
| 177 |
-
case '-c';
|
| 178 |
-
$attributes['with-column-info'] = true;
|
| 179 |
-
break;
|
| 180 |
-
case '--with-positions':
|
| 181 |
-
case '-P':
|
| 182 |
-
$attributes['with-positions'] = true;
|
| 183 |
-
break;
|
| 184 |
-
case '--with-recovery':
|
| 185 |
-
case '-r':
|
| 186 |
-
$attributes['with-recovery'] = true;
|
| 187 |
-
break;
|
| 188 |
-
case '--help':
|
| 189 |
-
case '-h';
|
| 190 |
-
showHelp();
|
| 191 |
-
break;
|
| 192 |
-
case '--':
|
| 193 |
-
$parseOptions = false;
|
| 194 |
-
break;
|
| 195 |
-
default:
|
| 196 |
-
if ($arg[0] === '-') {
|
| 197 |
-
showHelp("Invalid operation $arg.");
|
| 198 |
-
} else {
|
| 199 |
-
$files[] = $arg;
|
| 200 |
-
}
|
| 201 |
-
}
|
| 202 |
-
}
|
| 203 |
-
|
| 204 |
-
return [$operations, $files, $attributes];
|
| 205 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/composer/autoload_psr4.php
CHANGED
|
@@ -6,5 +6,4 @@ $vendorDir = dirname(dirname(__FILE__));
|
|
| 6 |
$baseDir = dirname($vendorDir);
|
| 7 |
|
| 8 |
return array(
|
| 9 |
-
'PhpParser\\' => array($vendorDir . '/nikic/php-parser/lib/PhpParser'),
|
| 10 |
);
|
| 6 |
$baseDir = dirname($vendorDir);
|
| 7 |
|
| 8 |
return array(
|
|
|
|
| 9 |
);
|
vendor/composer/autoload_static.php
CHANGED
|
@@ -11,20 +11,6 @@ class ComposerStaticInitd944cb3ad10f834222db970b76dd976d
|
|
| 11 |
'a5dbe7df96665c0b6c16ae8d91231502' => __DIR__ . '/..' . '/imagely/pope-framework/lib/autoload.php',
|
| 12 |
);
|
| 13 |
|
| 14 |
-
public static $prefixLengthsPsr4 = array (
|
| 15 |
-
'P' =>
|
| 16 |
-
array (
|
| 17 |
-
'PhpParser\\' => 10,
|
| 18 |
-
),
|
| 19 |
-
);
|
| 20 |
-
|
| 21 |
-
public static $prefixDirsPsr4 = array (
|
| 22 |
-
'PhpParser\\' =>
|
| 23 |
-
array (
|
| 24 |
-
0 => __DIR__ . '/..' . '/nikic/php-parser/lib/PhpParser',
|
| 25 |
-
),
|
| 26 |
-
);
|
| 27 |
-
|
| 28 |
public static $prefixesPsr0 = array (
|
| 29 |
'H' =>
|
| 30 |
array (
|
|
@@ -38,8 +24,6 @@ class ComposerStaticInitd944cb3ad10f834222db970b76dd976d
|
|
| 38 |
public static function getInitializer(ClassLoader $loader)
|
| 39 |
{
|
| 40 |
return \Closure::bind(function () use ($loader) {
|
| 41 |
-
$loader->prefixLengthsPsr4 = ComposerStaticInitd944cb3ad10f834222db970b76dd976d::$prefixLengthsPsr4;
|
| 42 |
-
$loader->prefixDirsPsr4 = ComposerStaticInitd944cb3ad10f834222db970b76dd976d::$prefixDirsPsr4;
|
| 43 |
$loader->prefixesPsr0 = ComposerStaticInitd944cb3ad10f834222db970b76dd976d::$prefixesPsr0;
|
| 44 |
|
| 45 |
}, null, ClassLoader::class);
|
| 11 |
'a5dbe7df96665c0b6c16ae8d91231502' => __DIR__ . '/..' . '/imagely/pope-framework/lib/autoload.php',
|
| 12 |
);
|
| 13 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 14 |
public static $prefixesPsr0 = array (
|
| 15 |
'H' =>
|
| 16 |
array (
|
| 24 |
public static function getInitializer(ClassLoader $loader)
|
| 25 |
{
|
| 26 |
return \Closure::bind(function () use ($loader) {
|
|
|
|
|
|
|
| 27 |
$loader->prefixesPsr0 = ComposerStaticInitd944cb3ad10f834222db970b76dd976d::$prefixesPsr0;
|
| 28 |
|
| 29 |
}, null, ClassLoader::class);
|
vendor/composer/installed.json
CHANGED
|
@@ -15,7 +15,7 @@
|
|
| 15 |
"shasum": "",
|
| 16 |
"mirrors": [
|
| 17 |
{
|
| 18 |
-
"url": "https://repo.packagist.com/imagely/dists/%package%/%version
|
| 19 |
"preferred": true
|
| 20 |
}
|
| 21 |
]
|
|
@@ -73,7 +73,7 @@
|
|
| 73 |
"shasum": "",
|
| 74 |
"mirrors": [
|
| 75 |
{
|
| 76 |
-
"url": "https://repo.packagist.com/imagely/dists/%package%/%version
|
| 77 |
"preferred": true
|
| 78 |
}
|
| 79 |
]
|
|
@@ -101,65 +101,5 @@
|
|
| 101 |
"source": "https://github.com/imagely/pope-framework/tree/v0.16",
|
| 102 |
"issues": "https://github.com/imagely/pope-framework/issues"
|
| 103 |
}
|
| 104 |
-
},
|
| 105 |
-
{
|
| 106 |
-
"name": "nikic/php-parser",
|
| 107 |
-
"version": "v4.5.0",
|
| 108 |
-
"version_normalized": "4.5.0.0",
|
| 109 |
-
"source": {
|
| 110 |
-
"type": "git",
|
| 111 |
-
"url": "https://github.com/nikic/PHP-Parser.git",
|
| 112 |
-
"reference": "53c2753d756f5adb586dca79c2ec0e2654dd9463"
|
| 113 |
-
},
|
| 114 |
-
"dist": {
|
| 115 |
-
"type": "zip",
|
| 116 |
-
"url": "https://api.github.com/repos/nikic/PHP-Parser/zipball/53c2753d756f5adb586dca79c2ec0e2654dd9463",
|
| 117 |
-
"reference": "53c2753d756f5adb586dca79c2ec0e2654dd9463",
|
| 118 |
-
"shasum": "",
|
| 119 |
-
"mirrors": [
|
| 120 |
-
{
|
| 121 |
-
"url": "https://repo.packagist.com/imagely/dists/%package%/%version%/%reference%.%type%",
|
| 122 |
-
"preferred": true
|
| 123 |
-
}
|
| 124 |
-
]
|
| 125 |
-
},
|
| 126 |
-
"require": {
|
| 127 |
-
"ext-tokenizer": "*",
|
| 128 |
-
"php": ">=7.0"
|
| 129 |
-
},
|
| 130 |
-
"require-dev": {
|
| 131 |
-
"ircmaxell/php-yacc": "0.0.5",
|
| 132 |
-
"phpunit/phpunit": "^6.5 || ^7.0 || ^8.0"
|
| 133 |
-
},
|
| 134 |
-
"time": "2020-06-03T07:24:19+00:00",
|
| 135 |
-
"bin": [
|
| 136 |
-
"bin/php-parse"
|
| 137 |
-
],
|
| 138 |
-
"type": "library",
|
| 139 |
-
"extra": {
|
| 140 |
-
"branch-alias": {
|
| 141 |
-
"dev-master": "4.3-dev"
|
| 142 |
-
}
|
| 143 |
-
},
|
| 144 |
-
"installation-source": "dist",
|
| 145 |
-
"autoload": {
|
| 146 |
-
"psr-4": {
|
| 147 |
-
"PhpParser\\": "lib/PhpParser"
|
| 148 |
-
}
|
| 149 |
-
},
|
| 150 |
-
"notification-url": "https://repo.packagist.com/imagely/downloads/",
|
| 151 |
-
"license": [
|
| 152 |
-
"BSD-3-Clause"
|
| 153 |
-
],
|
| 154 |
-
"authors": [
|
| 155 |
-
{
|
| 156 |
-
"name": "Nikita Popov"
|
| 157 |
-
}
|
| 158 |
-
],
|
| 159 |
-
"description": "A PHP parser written in PHP",
|
| 160 |
-
"keywords": [
|
| 161 |
-
"parser",
|
| 162 |
-
"php"
|
| 163 |
-
]
|
| 164 |
}
|
| 165 |
]
|
| 15 |
"shasum": "",
|
| 16 |
"mirrors": [
|
| 17 |
{
|
| 18 |
+
"url": "https://repo.packagist.com/imagely/dists/%package%/%version%/r%reference%.%type%",
|
| 19 |
"preferred": true
|
| 20 |
}
|
| 21 |
]
|
| 73 |
"shasum": "",
|
| 74 |
"mirrors": [
|
| 75 |
{
|
| 76 |
+
"url": "https://repo.packagist.com/imagely/dists/%package%/%version%/r%reference%.%type%",
|
| 77 |
"preferred": true
|
| 78 |
}
|
| 79 |
]
|
| 101 |
"source": "https://github.com/imagely/pope-framework/tree/v0.16",
|
| 102 |
"issues": "https://github.com/imagely/pope-framework/issues"
|
| 103 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 104 |
}
|
| 105 |
]
|
vendor/nikic/php-parser/LICENSE
DELETED
|
@@ -1,31 +0,0 @@
|
|
| 1 |
-
Copyright (c) 2011-2018 by Nikita Popov.
|
| 2 |
-
|
| 3 |
-
Some rights reserved.
|
| 4 |
-
|
| 5 |
-
Redistribution and use in source and binary forms, with or without
|
| 6 |
-
modification, are permitted provided that the following conditions are
|
| 7 |
-
met:
|
| 8 |
-
|
| 9 |
-
* Redistributions of source code must retain the above copyright
|
| 10 |
-
notice, this list of conditions and the following disclaimer.
|
| 11 |
-
|
| 12 |
-
* Redistributions in binary form must reproduce the above
|
| 13 |
-
copyright notice, this list of conditions and the following
|
| 14 |
-
disclaimer in the documentation and/or other materials provided
|
| 15 |
-
with the distribution.
|
| 16 |
-
|
| 17 |
-
* The names of the contributors may not be used to endorse or
|
| 18 |
-
promote products derived from this software without specific
|
| 19 |
-
prior written permission.
|
| 20 |
-
|
| 21 |
-
THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
|
| 22 |
-
"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
|
| 23 |
-
LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
|
| 24 |
-
A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
|
| 25 |
-
OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
|
| 26 |
-
SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
|
| 27 |
-
LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
|
| 28 |
-
DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
|
| 29 |
-
THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
|
| 30 |
-
(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
|
| 31 |
-
OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/README.md
DELETED
|
@@ -1,225 +0,0 @@
|
|
| 1 |
-
PHP Parser
|
| 2 |
-
==========
|
| 3 |
-
|
| 4 |
-
[](https://travis-ci.org/nikic/PHP-Parser) [](https://coveralls.io/github/nikic/PHP-Parser?branch=master)
|
| 5 |
-
|
| 6 |
-
This is a PHP 5.2 to PHP 7.4 parser written in PHP. Its purpose is to simplify static code analysis and
|
| 7 |
-
manipulation.
|
| 8 |
-
|
| 9 |
-
[**Documentation for version 4.x**][doc_master] (stable; for running on PHP >= 7.0; for parsing PHP 5.2 to PHP 7.4).
|
| 10 |
-
|
| 11 |
-
[Documentation for version 3.x][doc_3_x] (unsupported; for running on PHP >= 5.5; for parsing PHP 5.2 to PHP 7.2).
|
| 12 |
-
|
| 13 |
-
Features
|
| 14 |
-
--------
|
| 15 |
-
|
| 16 |
-
The main features provided by this library are:
|
| 17 |
-
|
| 18 |
-
* Parsing PHP 5 and PHP 7 code into an abstract syntax tree (AST).
|
| 19 |
-
* Invalid code can be parsed into a partial AST.
|
| 20 |
-
* The AST contains accurate location information.
|
| 21 |
-
* Dumping the AST in human-readable form.
|
| 22 |
-
* Converting an AST back to PHP code.
|
| 23 |
-
* Experimental: Formatting can be preserved for partially changed ASTs.
|
| 24 |
-
* Infrastructure to traverse and modify ASTs.
|
| 25 |
-
* Resolution of namespaced names.
|
| 26 |
-
* Evaluation of constant expressions.
|
| 27 |
-
* Builders to simplify AST construction for code generation.
|
| 28 |
-
* Converting an AST into JSON and back.
|
| 29 |
-
|
| 30 |
-
Quick Start
|
| 31 |
-
-----------
|
| 32 |
-
|
| 33 |
-
Install the library using [composer](https://getcomposer.org):
|
| 34 |
-
|
| 35 |
-
php composer.phar require nikic/php-parser
|
| 36 |
-
|
| 37 |
-
Parse some PHP code into an AST and dump the result in human-readable form:
|
| 38 |
-
|
| 39 |
-
```php
|
| 40 |
-
<?php
|
| 41 |
-
use PhpParser\Error;
|
| 42 |
-
use PhpParser\NodeDumper;
|
| 43 |
-
use PhpParser\ParserFactory;
|
| 44 |
-
|
| 45 |
-
$code = <<<'CODE'
|
| 46 |
-
<?php
|
| 47 |
-
|
| 48 |
-
function test($foo)
|
| 49 |
-
{
|
| 50 |
-
var_dump($foo);
|
| 51 |
-
}
|
| 52 |
-
CODE;
|
| 53 |
-
|
| 54 |
-
$parser = (new ParserFactory)->create(ParserFactory::PREFER_PHP7);
|
| 55 |
-
try {
|
| 56 |
-
$ast = $parser->parse($code);
|
| 57 |
-
} catch (Error $error) {
|
| 58 |
-
echo "Parse error: {$error->getMessage()}\n";
|
| 59 |
-
return;
|
| 60 |
-
}
|
| 61 |
-
|
| 62 |
-
$dumper = new NodeDumper;
|
| 63 |
-
echo $dumper->dump($ast) . "\n";
|
| 64 |
-
```
|
| 65 |
-
|
| 66 |
-
This dumps an AST looking something like this:
|
| 67 |
-
|
| 68 |
-
```
|
| 69 |
-
array(
|
| 70 |
-
0: Stmt_Function(
|
| 71 |
-
byRef: false
|
| 72 |
-
name: Identifier(
|
| 73 |
-
name: test
|
| 74 |
-
)
|
| 75 |
-
params: array(
|
| 76 |
-
0: Param(
|
| 77 |
-
type: null
|
| 78 |
-
byRef: false
|
| 79 |
-
variadic: false
|
| 80 |
-
var: Expr_Variable(
|
| 81 |
-
name: foo
|
| 82 |
-
)
|
| 83 |
-
default: null
|
| 84 |
-
)
|
| 85 |
-
)
|
| 86 |
-
returnType: null
|
| 87 |
-
stmts: array(
|
| 88 |
-
0: Stmt_Expression(
|
| 89 |
-
expr: Expr_FuncCall(
|
| 90 |
-
name: Name(
|
| 91 |
-
parts: array(
|
| 92 |
-
0: var_dump
|
| 93 |
-
)
|
| 94 |
-
)
|
| 95 |
-
args: array(
|
| 96 |
-
0: Arg(
|
| 97 |
-
value: Expr_Variable(
|
| 98 |
-
name: foo
|
| 99 |
-
)
|
| 100 |
-
byRef: false
|
| 101 |
-
unpack: false
|
| 102 |
-
)
|
| 103 |
-
)
|
| 104 |
-
)
|
| 105 |
-
)
|
| 106 |
-
)
|
| 107 |
-
)
|
| 108 |
-
)
|
| 109 |
-
```
|
| 110 |
-
|
| 111 |
-
Let's traverse the AST and perform some kind of modification. For example, drop all function bodies:
|
| 112 |
-
|
| 113 |
-
```php
|
| 114 |
-
use PhpParser\Node;
|
| 115 |
-
use PhpParser\Node\Stmt\Function_;
|
| 116 |
-
use PhpParser\NodeTraverser;
|
| 117 |
-
use PhpParser\NodeVisitorAbstract;
|
| 118 |
-
|
| 119 |
-
$traverser = new NodeTraverser();
|
| 120 |
-
$traverser->addVisitor(new class extends NodeVisitorAbstract {
|
| 121 |
-
public function enterNode(Node $node) {
|
| 122 |
-
if ($node instanceof Function_) {
|
| 123 |
-
// Clean out the function body
|
| 124 |
-
$node->stmts = [];
|
| 125 |
-
}
|
| 126 |
-
}
|
| 127 |
-
});
|
| 128 |
-
|
| 129 |
-
$ast = $traverser->traverse($ast);
|
| 130 |
-
echo $dumper->dump($ast) . "\n";
|
| 131 |
-
```
|
| 132 |
-
|
| 133 |
-
This gives us an AST where the `Function_::$stmts` are empty:
|
| 134 |
-
|
| 135 |
-
```
|
| 136 |
-
array(
|
| 137 |
-
0: Stmt_Function(
|
| 138 |
-
byRef: false
|
| 139 |
-
name: Identifier(
|
| 140 |
-
name: test
|
| 141 |
-
)
|
| 142 |
-
params: array(
|
| 143 |
-
0: Param(
|
| 144 |
-
type: null
|
| 145 |
-
byRef: false
|
| 146 |
-
variadic: false
|
| 147 |
-
var: Expr_Variable(
|
| 148 |
-
name: foo
|
| 149 |
-
)
|
| 150 |
-
default: null
|
| 151 |
-
)
|
| 152 |
-
)
|
| 153 |
-
returnType: null
|
| 154 |
-
stmts: array(
|
| 155 |
-
)
|
| 156 |
-
)
|
| 157 |
-
)
|
| 158 |
-
```
|
| 159 |
-
|
| 160 |
-
Finally, we can convert the new AST back to PHP code:
|
| 161 |
-
|
| 162 |
-
```php
|
| 163 |
-
use PhpParser\PrettyPrinter;
|
| 164 |
-
|
| 165 |
-
$prettyPrinter = new PrettyPrinter\Standard;
|
| 166 |
-
echo $prettyPrinter->prettyPrintFile($ast);
|
| 167 |
-
```
|
| 168 |
-
|
| 169 |
-
This gives us our original code, minus the `var_dump()` call inside the function:
|
| 170 |
-
|
| 171 |
-
```php
|
| 172 |
-
<?php
|
| 173 |
-
|
| 174 |
-
function test($foo)
|
| 175 |
-
{
|
| 176 |
-
}
|
| 177 |
-
```
|
| 178 |
-
|
| 179 |
-
For a more comprehensive introduction, see the documentation.
|
| 180 |
-
|
| 181 |
-
Documentation
|
| 182 |
-
-------------
|
| 183 |
-
|
| 184 |
-
1. [Introduction](doc/0_Introduction.markdown)
|
| 185 |
-
2. [Usage of basic components](doc/2_Usage_of_basic_components.markdown)
|
| 186 |
-
|
| 187 |
-
Component documentation:
|
| 188 |
-
|
| 189 |
-
* [Walking the AST](doc/component/Walking_the_AST.markdown)
|
| 190 |
-
* Node visitors
|
| 191 |
-
* Modifying the AST from a visitor
|
| 192 |
-
* Short-circuiting traversals
|
| 193 |
-
* Interleaved visitors
|
| 194 |
-
* Simple node finding API
|
| 195 |
-
* Parent and sibling references
|
| 196 |
-
* [Name resolution](doc/component/Name_resolution.markdown)
|
| 197 |
-
* Name resolver options
|
| 198 |
-
* Name resolution context
|
| 199 |
-
* [Pretty printing](doc/component/Pretty_printing.markdown)
|
| 200 |
-
* Converting AST back to PHP code
|
| 201 |
-
* Customizing formatting
|
| 202 |
-
* Formatting-preserving code transformations
|
| 203 |
-
* [AST builders](doc/component/AST_builders.markdown)
|
| 204 |
-
* Fluent builders for AST nodes
|
| 205 |
-
* [Lexer](doc/component/Lexer.markdown)
|
| 206 |
-
* Lexer options
|
| 207 |
-
* Token and file positions for nodes
|
| 208 |
-
* Custom attributes
|
| 209 |
-
* [Error handling](doc/component/Error_handling.markdown)
|
| 210 |
-
* Column information for errors
|
| 211 |
-
* Error recovery (parsing of syntactically incorrect code)
|
| 212 |
-
* [Constant expression evaluation](doc/component/Constant_expression_evaluation.markdown)
|
| 213 |
-
* Evaluating constant/property/etc initializers
|
| 214 |
-
* Handling errors and unsupported expressions
|
| 215 |
-
* [JSON representation](doc/component/JSON_representation.markdown)
|
| 216 |
-
* JSON encoding and decoding of ASTs
|
| 217 |
-
* [Performance](doc/component/Performance.markdown)
|
| 218 |
-
* Disabling XDebug
|
| 219 |
-
* Reusing objects
|
| 220 |
-
* Garbage collection impact
|
| 221 |
-
* [Frequently asked questions](doc/component/FAQ.markdown)
|
| 222 |
-
* Parent and sibling references
|
| 223 |
-
|
| 224 |
-
[doc_3_x]: https://github.com/nikic/PHP-Parser/tree/3.x/doc
|
| 225 |
-
[doc_master]: https://github.com/nikic/PHP-Parser/tree/master/doc
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/bin/php-parse
DELETED
|
@@ -1,205 +0,0 @@
|
|
| 1 |
-
#!/usr/bin/env php
|
| 2 |
-
<?php
|
| 3 |
-
|
| 4 |
-
foreach ([__DIR__ . '/../../../autoload.php', __DIR__ . '/../vendor/autoload.php'] as $file) {
|
| 5 |
-
if (file_exists($file)) {
|
| 6 |
-
require $file;
|
| 7 |
-
break;
|
| 8 |
-
}
|
| 9 |
-
}
|
| 10 |
-
|
| 11 |
-
ini_set('xdebug.max_nesting_level', 3000);
|
| 12 |
-
|
| 13 |
-
// Disable XDebug var_dump() output truncation
|
| 14 |
-
ini_set('xdebug.var_display_max_children', -1);
|
| 15 |
-
ini_set('xdebug.var_display_max_data', -1);
|
| 16 |
-
ini_set('xdebug.var_display_max_depth', -1);
|
| 17 |
-
|
| 18 |
-
list($operations, $files, $attributes) = parseArgs($argv);
|
| 19 |
-
|
| 20 |
-
/* Dump nodes by default */
|
| 21 |
-
if (empty($operations)) {
|
| 22 |
-
$operations[] = 'dump';
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
if (empty($files)) {
|
| 26 |
-
showHelp("Must specify at least one file.");
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
$lexer = new PhpParser\Lexer\Emulative(['usedAttributes' => [
|
| 30 |
-
'startLine', 'endLine', 'startFilePos', 'endFilePos', 'comments'
|
| 31 |
-
]]);
|
| 32 |
-
$parser = (new PhpParser\ParserFactory)->create(
|
| 33 |
-
PhpParser\ParserFactory::PREFER_PHP7,
|
| 34 |
-
$lexer
|
| 35 |
-
);
|
| 36 |
-
$dumper = new PhpParser\NodeDumper([
|
| 37 |
-
'dumpComments' => true,
|
| 38 |
-
'dumpPositions' => $attributes['with-positions'],
|
| 39 |
-
]);
|
| 40 |
-
$prettyPrinter = new PhpParser\PrettyPrinter\Standard;
|
| 41 |
-
|
| 42 |
-
$traverser = new PhpParser\NodeTraverser();
|
| 43 |
-
$traverser->addVisitor(new PhpParser\NodeVisitor\NameResolver);
|
| 44 |
-
|
| 45 |
-
foreach ($files as $file) {
|
| 46 |
-
if (strpos($file, '<?php') === 0) {
|
| 47 |
-
$code = $file;
|
| 48 |
-
fwrite(STDERR, "====> Code $code\n");
|
| 49 |
-
} else {
|
| 50 |
-
if (!file_exists($file)) {
|
| 51 |
-
fwrite(STDERR, "File $file does not exist.\n");
|
| 52 |
-
exit(1);
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
$code = file_get_contents($file);
|
| 56 |
-
fwrite(STDERR, "====> File $file:\n");
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
if ($attributes['with-recovery']) {
|
| 60 |
-
$errorHandler = new PhpParser\ErrorHandler\Collecting;
|
| 61 |
-
$stmts = $parser->parse($code, $errorHandler);
|
| 62 |
-
foreach ($errorHandler->getErrors() as $error) {
|
| 63 |
-
$message = formatErrorMessage($error, $code, $attributes['with-column-info']);
|
| 64 |
-
fwrite(STDERR, $message . "\n");
|
| 65 |
-
}
|
| 66 |
-
if (null === $stmts) {
|
| 67 |
-
continue;
|
| 68 |
-
}
|
| 69 |
-
} else {
|
| 70 |
-
try {
|
| 71 |
-
$stmts = $parser->parse($code);
|
| 72 |
-
} catch (PhpParser\Error $error) {
|
| 73 |
-
$message = formatErrorMessage($error, $code, $attributes['with-column-info']);
|
| 74 |
-
fwrite(STDERR, $message . "\n");
|
| 75 |
-
exit(1);
|
| 76 |
-
}
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
foreach ($operations as $operation) {
|
| 80 |
-
if ('dump' === $operation) {
|
| 81 |
-
fwrite(STDERR, "==> Node dump:\n");
|
| 82 |
-
echo $dumper->dump($stmts, $code), "\n";
|
| 83 |
-
} elseif ('pretty-print' === $operation) {
|
| 84 |
-
fwrite(STDERR, "==> Pretty print:\n");
|
| 85 |
-
echo $prettyPrinter->prettyPrintFile($stmts), "\n";
|
| 86 |
-
} elseif ('json-dump' === $operation) {
|
| 87 |
-
fwrite(STDERR, "==> JSON dump:\n");
|
| 88 |
-
echo json_encode($stmts, JSON_PRETTY_PRINT), "\n";
|
| 89 |
-
} elseif ('var-dump' === $operation) {
|
| 90 |
-
fwrite(STDERR, "==> var_dump():\n");
|
| 91 |
-
var_dump($stmts);
|
| 92 |
-
} elseif ('resolve-names' === $operation) {
|
| 93 |
-
fwrite(STDERR, "==> Resolved names.\n");
|
| 94 |
-
$stmts = $traverser->traverse($stmts);
|
| 95 |
-
}
|
| 96 |
-
}
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
function formatErrorMessage(PhpParser\Error $e, $code, $withColumnInfo) {
|
| 100 |
-
if ($withColumnInfo && $e->hasColumnInfo()) {
|
| 101 |
-
return $e->getMessageWithColumnInfo($code);
|
| 102 |
-
} else {
|
| 103 |
-
return $e->getMessage();
|
| 104 |
-
}
|
| 105 |
-
}
|
| 106 |
-
|
| 107 |
-
function showHelp($error = '') {
|
| 108 |
-
if ($error) {
|
| 109 |
-
fwrite(STDERR, $error . "\n\n");
|
| 110 |
-
}
|
| 111 |
-
fwrite($error ? STDERR : STDOUT, <<<OUTPUT
|
| 112 |
-
Usage: php-parse [operations] file1.php [file2.php ...]
|
| 113 |
-
or: php-parse [operations] "<?php code"
|
| 114 |
-
Turn PHP source code into an abstract syntax tree.
|
| 115 |
-
|
| 116 |
-
Operations is a list of the following options (--dump by default):
|
| 117 |
-
|
| 118 |
-
-d, --dump Dump nodes using NodeDumper
|
| 119 |
-
-p, --pretty-print Pretty print file using PrettyPrinter\Standard
|
| 120 |
-
-j, --json-dump Print json_encode() result
|
| 121 |
-
--var-dump var_dump() nodes (for exact structure)
|
| 122 |
-
-N, --resolve-names Resolve names using NodeVisitor\NameResolver
|
| 123 |
-
-c, --with-column-info Show column-numbers for errors (if available)
|
| 124 |
-
-P, --with-positions Show positions in node dumps
|
| 125 |
-
-r, --with-recovery Use parsing with error recovery
|
| 126 |
-
-h, --help Display this page
|
| 127 |
-
|
| 128 |
-
Example:
|
| 129 |
-
php-parse -d -p -N -d file.php
|
| 130 |
-
|
| 131 |
-
Dumps nodes, pretty prints them, then resolves names and dumps them again.
|
| 132 |
-
|
| 133 |
-
|
| 134 |
-
OUTPUT
|
| 135 |
-
);
|
| 136 |
-
exit($error ? 1 : 0);
|
| 137 |
-
}
|
| 138 |
-
|
| 139 |
-
function parseArgs($args) {
|
| 140 |
-
$operations = [];
|
| 141 |
-
$files = [];
|
| 142 |
-
$attributes = [
|
| 143 |
-
'with-column-info' => false,
|
| 144 |
-
'with-positions' => false,
|
| 145 |
-
'with-recovery' => false,
|
| 146 |
-
];
|
| 147 |
-
|
| 148 |
-
array_shift($args);
|
| 149 |
-
$parseOptions = true;
|
| 150 |
-
foreach ($args as $arg) {
|
| 151 |
-
if (!$parseOptions) {
|
| 152 |
-
$files[] = $arg;
|
| 153 |
-
continue;
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
switch ($arg) {
|
| 157 |
-
case '--dump':
|
| 158 |
-
case '-d':
|
| 159 |
-
$operations[] = 'dump';
|
| 160 |
-
break;
|
| 161 |
-
case '--pretty-print':
|
| 162 |
-
case '-p':
|
| 163 |
-
$operations[] = 'pretty-print';
|
| 164 |
-
break;
|
| 165 |
-
case '--json-dump':
|
| 166 |
-
case '-j':
|
| 167 |
-
$operations[] = 'json-dump';
|
| 168 |
-
break;
|
| 169 |
-
case '--var-dump':
|
| 170 |
-
$operations[] = 'var-dump';
|
| 171 |
-
break;
|
| 172 |
-
case '--resolve-names':
|
| 173 |
-
case '-N';
|
| 174 |
-
$operations[] = 'resolve-names';
|
| 175 |
-
break;
|
| 176 |
-
case '--with-column-info':
|
| 177 |
-
case '-c';
|
| 178 |
-
$attributes['with-column-info'] = true;
|
| 179 |
-
break;
|
| 180 |
-
case '--with-positions':
|
| 181 |
-
case '-P':
|
| 182 |
-
$attributes['with-positions'] = true;
|
| 183 |
-
break;
|
| 184 |
-
case '--with-recovery':
|
| 185 |
-
case '-r':
|
| 186 |
-
$attributes['with-recovery'] = true;
|
| 187 |
-
break;
|
| 188 |
-
case '--help':
|
| 189 |
-
case '-h';
|
| 190 |
-
showHelp();
|
| 191 |
-
break;
|
| 192 |
-
case '--':
|
| 193 |
-
$parseOptions = false;
|
| 194 |
-
break;
|
| 195 |
-
default:
|
| 196 |
-
if ($arg[0] === '-') {
|
| 197 |
-
showHelp("Invalid operation $arg.");
|
| 198 |
-
} else {
|
| 199 |
-
$files[] = $arg;
|
| 200 |
-
}
|
| 201 |
-
}
|
| 202 |
-
}
|
| 203 |
-
|
| 204 |
-
return [$operations, $files, $attributes];
|
| 205 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/composer.json
DELETED
|
@@ -1,41 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"name": "nikic/php-parser",
|
| 3 |
-
"type": "library",
|
| 4 |
-
"description": "A PHP parser written in PHP",
|
| 5 |
-
"keywords": [
|
| 6 |
-
"php",
|
| 7 |
-
"parser"
|
| 8 |
-
],
|
| 9 |
-
"license": "BSD-3-Clause",
|
| 10 |
-
"authors": [
|
| 11 |
-
{
|
| 12 |
-
"name": "Nikita Popov"
|
| 13 |
-
}
|
| 14 |
-
],
|
| 15 |
-
"require": {
|
| 16 |
-
"php": ">=7.0",
|
| 17 |
-
"ext-tokenizer": "*"
|
| 18 |
-
},
|
| 19 |
-
"require-dev": {
|
| 20 |
-
"phpunit/phpunit": "^6.5 || ^7.0 || ^8.0",
|
| 21 |
-
"ircmaxell/php-yacc": "0.0.5"
|
| 22 |
-
},
|
| 23 |
-
"extra": {
|
| 24 |
-
"branch-alias": {
|
| 25 |
-
"dev-master": "4.3-dev"
|
| 26 |
-
}
|
| 27 |
-
},
|
| 28 |
-
"autoload": {
|
| 29 |
-
"psr-4": {
|
| 30 |
-
"PhpParser\\": "lib/PhpParser"
|
| 31 |
-
}
|
| 32 |
-
},
|
| 33 |
-
"autoload-dev": {
|
| 34 |
-
"psr-4": {
|
| 35 |
-
"PhpParser\\": "test/PhpParser/"
|
| 36 |
-
}
|
| 37 |
-
},
|
| 38 |
-
"bin": [
|
| 39 |
-
"bin/php-parse"
|
| 40 |
-
]
|
| 41 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/grammar/README.md
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
What do all those files mean?
|
| 2 |
-
=============================
|
| 3 |
-
|
| 4 |
-
* `php5.y`: PHP 5 grammar written in a pseudo language
|
| 5 |
-
* `php7.y`: PHP 7 grammar written in a pseudo language
|
| 6 |
-
* `tokens.y`: Tokens definition shared between PHP 5 and PHP 7 grammars
|
| 7 |
-
* `parser.template`: A `kmyacc` parser prototype file for PHP
|
| 8 |
-
* `tokens.template`: A `kmyacc` prototype file for the `Tokens` class
|
| 9 |
-
* `rebuildParsers.php`: Preprocesses the grammar and builds the parser using `kmyacc`
|
| 10 |
-
|
| 11 |
-
.phpy pseudo language
|
| 12 |
-
=====================
|
| 13 |
-
|
| 14 |
-
The `.y` file is a normal grammar in `kmyacc` (`yacc`) style, with some transformations
|
| 15 |
-
applied to it:
|
| 16 |
-
|
| 17 |
-
* Nodes are created using the syntax `Name[..., ...]`. This is transformed into
|
| 18 |
-
`new Name(..., ..., attributes())`
|
| 19 |
-
* Some function-like constructs are resolved (see `rebuildParsers.php` for a list)
|
| 20 |
-
|
| 21 |
-
Building the parser
|
| 22 |
-
===================
|
| 23 |
-
|
| 24 |
-
Run `php grammar/rebuildParsers.php` to rebuild the parsers. Additional options:
|
| 25 |
-
|
| 26 |
-
* The `KMYACC` environment variable can be used to specify an alternative `kmyacc` binary.
|
| 27 |
-
By default the `phpyacc` dev dependency will be used. To use the original `kmyacc`, you
|
| 28 |
-
need to compile [moriyoshi's fork](https://github.com/moriyoshi/kmyacc-forked).
|
| 29 |
-
* The `--debug` option enables emission of debug symbols and creates the `y.output` file.
|
| 30 |
-
* The `--keep-tmp-grammar` option preserves the preprocessed grammar file.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/grammar/parser.template
DELETED
|
@@ -1,106 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
$meta #
|
| 3 |
-
#semval($) $this->semValue
|
| 4 |
-
#semval($,%t) $this->semValue
|
| 5 |
-
#semval(%n) $stackPos-(%l-%n)
|
| 6 |
-
#semval(%n,%t) $stackPos-(%l-%n)
|
| 7 |
-
|
| 8 |
-
namespace PhpParser\Parser;
|
| 9 |
-
|
| 10 |
-
use PhpParser\Error;
|
| 11 |
-
use PhpParser\Node;
|
| 12 |
-
use PhpParser\Node\Expr;
|
| 13 |
-
use PhpParser\Node\Name;
|
| 14 |
-
use PhpParser\Node\Scalar;
|
| 15 |
-
use PhpParser\Node\Stmt;
|
| 16 |
-
#include;
|
| 17 |
-
|
| 18 |
-
/* This is an automatically GENERATED file, which should not be manually edited.
|
| 19 |
-
* Instead edit one of the following:
|
| 20 |
-
* * the grammar files grammar/php5.y or grammar/php7.y
|
| 21 |
-
* * the skeleton file grammar/parser.template
|
| 22 |
-
* * the preprocessing script grammar/rebuildParsers.php
|
| 23 |
-
*/
|
| 24 |
-
class #(-p) extends \PhpParser\ParserAbstract
|
| 25 |
-
{
|
| 26 |
-
protected $tokenToSymbolMapSize = #(YYMAXLEX);
|
| 27 |
-
protected $actionTableSize = #(YYLAST);
|
| 28 |
-
protected $gotoTableSize = #(YYGLAST);
|
| 29 |
-
|
| 30 |
-
protected $invalidSymbol = #(YYBADCH);
|
| 31 |
-
protected $errorSymbol = #(YYINTERRTOK);
|
| 32 |
-
protected $defaultAction = #(YYDEFAULT);
|
| 33 |
-
protected $unexpectedTokenRule = #(YYUNEXPECTED);
|
| 34 |
-
|
| 35 |
-
protected $YY2TBLSTATE = #(YY2TBLSTATE);
|
| 36 |
-
protected $numNonLeafStates = #(YYNLSTATES);
|
| 37 |
-
|
| 38 |
-
protected $symbolToName = array(
|
| 39 |
-
#listvar terminals
|
| 40 |
-
);
|
| 41 |
-
|
| 42 |
-
protected $tokenToSymbol = array(
|
| 43 |
-
#listvar yytranslate
|
| 44 |
-
);
|
| 45 |
-
|
| 46 |
-
protected $action = array(
|
| 47 |
-
#listvar yyaction
|
| 48 |
-
);
|
| 49 |
-
|
| 50 |
-
protected $actionCheck = array(
|
| 51 |
-
#listvar yycheck
|
| 52 |
-
);
|
| 53 |
-
|
| 54 |
-
protected $actionBase = array(
|
| 55 |
-
#listvar yybase
|
| 56 |
-
);
|
| 57 |
-
|
| 58 |
-
protected $actionDefault = array(
|
| 59 |
-
#listvar yydefault
|
| 60 |
-
);
|
| 61 |
-
|
| 62 |
-
protected $goto = array(
|
| 63 |
-
#listvar yygoto
|
| 64 |
-
);
|
| 65 |
-
|
| 66 |
-
protected $gotoCheck = array(
|
| 67 |
-
#listvar yygcheck
|
| 68 |
-
);
|
| 69 |
-
|
| 70 |
-
protected $gotoBase = array(
|
| 71 |
-
#listvar yygbase
|
| 72 |
-
);
|
| 73 |
-
|
| 74 |
-
protected $gotoDefault = array(
|
| 75 |
-
#listvar yygdefault
|
| 76 |
-
);
|
| 77 |
-
|
| 78 |
-
protected $ruleToNonTerminal = array(
|
| 79 |
-
#listvar yylhs
|
| 80 |
-
);
|
| 81 |
-
|
| 82 |
-
protected $ruleToLength = array(
|
| 83 |
-
#listvar yylen
|
| 84 |
-
);
|
| 85 |
-
#if -t
|
| 86 |
-
|
| 87 |
-
protected $productions = array(
|
| 88 |
-
#production-strings;
|
| 89 |
-
);
|
| 90 |
-
#endif
|
| 91 |
-
|
| 92 |
-
protected function initReduceCallbacks() {
|
| 93 |
-
$this->reduceCallbacks = [
|
| 94 |
-
#reduce
|
| 95 |
-
%n => function ($stackPos) {
|
| 96 |
-
%b
|
| 97 |
-
},
|
| 98 |
-
#noact
|
| 99 |
-
%n => function ($stackPos) {
|
| 100 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 101 |
-
},
|
| 102 |
-
#endreduce
|
| 103 |
-
];
|
| 104 |
-
}
|
| 105 |
-
}
|
| 106 |
-
#tailcode;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/grammar/php5.y
DELETED
|
@@ -1,1026 +0,0 @@
|
|
| 1 |
-
%pure_parser
|
| 2 |
-
%expect 6
|
| 3 |
-
|
| 4 |
-
%tokens
|
| 5 |
-
|
| 6 |
-
%%
|
| 7 |
-
|
| 8 |
-
start:
|
| 9 |
-
top_statement_list { $$ = $this->handleNamespaces($1); }
|
| 10 |
-
;
|
| 11 |
-
|
| 12 |
-
top_statement_list_ex:
|
| 13 |
-
top_statement_list_ex top_statement { pushNormalizing($1, $2); }
|
| 14 |
-
| /* empty */ { init(); }
|
| 15 |
-
;
|
| 16 |
-
|
| 17 |
-
top_statement_list:
|
| 18 |
-
top_statement_list_ex
|
| 19 |
-
{ makeZeroLengthNop($nop, $this->lookaheadStartAttributes);
|
| 20 |
-
if ($nop !== null) { $1[] = $nop; } $$ = $1; }
|
| 21 |
-
;
|
| 22 |
-
|
| 23 |
-
reserved_non_modifiers:
|
| 24 |
-
T_INCLUDE | T_INCLUDE_ONCE | T_EVAL | T_REQUIRE | T_REQUIRE_ONCE | T_LOGICAL_OR | T_LOGICAL_XOR | T_LOGICAL_AND
|
| 25 |
-
| T_INSTANCEOF | T_NEW | T_CLONE | T_EXIT | T_IF | T_ELSEIF | T_ELSE | T_ENDIF | T_ECHO | T_DO | T_WHILE
|
| 26 |
-
| T_ENDWHILE | T_FOR | T_ENDFOR | T_FOREACH | T_ENDFOREACH | T_DECLARE | T_ENDDECLARE | T_AS | T_TRY | T_CATCH
|
| 27 |
-
| T_FINALLY | T_THROW | T_USE | T_INSTEADOF | T_GLOBAL | T_VAR | T_UNSET | T_ISSET | T_EMPTY | T_CONTINUE | T_GOTO
|
| 28 |
-
| T_FUNCTION | T_CONST | T_RETURN | T_PRINT | T_YIELD | T_LIST | T_SWITCH | T_ENDSWITCH | T_CASE | T_DEFAULT
|
| 29 |
-
| T_BREAK | T_ARRAY | T_CALLABLE | T_EXTENDS | T_IMPLEMENTS | T_NAMESPACE | T_TRAIT | T_INTERFACE | T_CLASS
|
| 30 |
-
| T_CLASS_C | T_TRAIT_C | T_FUNC_C | T_METHOD_C | T_LINE | T_FILE | T_DIR | T_NS_C | T_HALT_COMPILER | T_FN
|
| 31 |
-
;
|
| 32 |
-
|
| 33 |
-
semi_reserved:
|
| 34 |
-
reserved_non_modifiers
|
| 35 |
-
| T_STATIC | T_ABSTRACT | T_FINAL | T_PRIVATE | T_PROTECTED | T_PUBLIC
|
| 36 |
-
;
|
| 37 |
-
|
| 38 |
-
identifier_ex:
|
| 39 |
-
T_STRING { $$ = Node\Identifier[$1]; }
|
| 40 |
-
| semi_reserved { $$ = Node\Identifier[$1]; }
|
| 41 |
-
;
|
| 42 |
-
|
| 43 |
-
identifier:
|
| 44 |
-
T_STRING { $$ = Node\Identifier[$1]; }
|
| 45 |
-
;
|
| 46 |
-
|
| 47 |
-
reserved_non_modifiers_identifier:
|
| 48 |
-
reserved_non_modifiers { $$ = Node\Identifier[$1]; }
|
| 49 |
-
;
|
| 50 |
-
|
| 51 |
-
namespace_name_parts:
|
| 52 |
-
T_STRING { init($1); }
|
| 53 |
-
| namespace_name_parts T_NS_SEPARATOR T_STRING { push($1, $3); }
|
| 54 |
-
;
|
| 55 |
-
|
| 56 |
-
namespace_name:
|
| 57 |
-
namespace_name_parts { $$ = Name[$1]; }
|
| 58 |
-
;
|
| 59 |
-
|
| 60 |
-
plain_variable:
|
| 61 |
-
T_VARIABLE { $$ = Expr\Variable[parseVar($1)]; }
|
| 62 |
-
;
|
| 63 |
-
|
| 64 |
-
top_statement:
|
| 65 |
-
statement { $$ = $1; }
|
| 66 |
-
| function_declaration_statement { $$ = $1; }
|
| 67 |
-
| class_declaration_statement { $$ = $1; }
|
| 68 |
-
| T_HALT_COMPILER
|
| 69 |
-
{ $$ = Stmt\HaltCompiler[$this->lexer->handleHaltCompiler()]; }
|
| 70 |
-
| T_NAMESPACE namespace_name ';'
|
| 71 |
-
{ $$ = Stmt\Namespace_[$2, null];
|
| 72 |
-
$$->setAttribute('kind', Stmt\Namespace_::KIND_SEMICOLON);
|
| 73 |
-
$this->checkNamespace($$); }
|
| 74 |
-
| T_NAMESPACE namespace_name '{' top_statement_list '}'
|
| 75 |
-
{ $$ = Stmt\Namespace_[$2, $4];
|
| 76 |
-
$$->setAttribute('kind', Stmt\Namespace_::KIND_BRACED);
|
| 77 |
-
$this->checkNamespace($$); }
|
| 78 |
-
| T_NAMESPACE '{' top_statement_list '}'
|
| 79 |
-
{ $$ = Stmt\Namespace_[null, $3];
|
| 80 |
-
$$->setAttribute('kind', Stmt\Namespace_::KIND_BRACED);
|
| 81 |
-
$this->checkNamespace($$); }
|
| 82 |
-
| T_USE use_declarations ';' { $$ = Stmt\Use_[$2, Stmt\Use_::TYPE_NORMAL]; }
|
| 83 |
-
| T_USE use_type use_declarations ';' { $$ = Stmt\Use_[$3, $2]; }
|
| 84 |
-
| group_use_declaration ';' { $$ = $1; }
|
| 85 |
-
| T_CONST constant_declaration_list ';' { $$ = Stmt\Const_[$2]; }
|
| 86 |
-
;
|
| 87 |
-
|
| 88 |
-
use_type:
|
| 89 |
-
T_FUNCTION { $$ = Stmt\Use_::TYPE_FUNCTION; }
|
| 90 |
-
| T_CONST { $$ = Stmt\Use_::TYPE_CONSTANT; }
|
| 91 |
-
;
|
| 92 |
-
|
| 93 |
-
/* Using namespace_name_parts here to avoid s/r conflict on T_NS_SEPARATOR */
|
| 94 |
-
group_use_declaration:
|
| 95 |
-
T_USE use_type namespace_name_parts T_NS_SEPARATOR '{' unprefixed_use_declarations '}'
|
| 96 |
-
{ $$ = Stmt\GroupUse[new Name($3, stackAttributes(#3)), $6, $2]; }
|
| 97 |
-
| T_USE use_type T_NS_SEPARATOR namespace_name_parts T_NS_SEPARATOR '{' unprefixed_use_declarations '}'
|
| 98 |
-
{ $$ = Stmt\GroupUse[new Name($4, stackAttributes(#4)), $7, $2]; }
|
| 99 |
-
| T_USE namespace_name_parts T_NS_SEPARATOR '{' inline_use_declarations '}'
|
| 100 |
-
{ $$ = Stmt\GroupUse[new Name($2, stackAttributes(#2)), $5, Stmt\Use_::TYPE_UNKNOWN]; }
|
| 101 |
-
| T_USE T_NS_SEPARATOR namespace_name_parts T_NS_SEPARATOR '{' inline_use_declarations '}'
|
| 102 |
-
{ $$ = Stmt\GroupUse[new Name($3, stackAttributes(#3)), $6, Stmt\Use_::TYPE_UNKNOWN]; }
|
| 103 |
-
;
|
| 104 |
-
|
| 105 |
-
unprefixed_use_declarations:
|
| 106 |
-
unprefixed_use_declarations ',' unprefixed_use_declaration
|
| 107 |
-
{ push($1, $3); }
|
| 108 |
-
| unprefixed_use_declaration { init($1); }
|
| 109 |
-
;
|
| 110 |
-
|
| 111 |
-
use_declarations:
|
| 112 |
-
use_declarations ',' use_declaration { push($1, $3); }
|
| 113 |
-
| use_declaration { init($1); }
|
| 114 |
-
;
|
| 115 |
-
|
| 116 |
-
inline_use_declarations:
|
| 117 |
-
inline_use_declarations ',' inline_use_declaration { push($1, $3); }
|
| 118 |
-
| inline_use_declaration { init($1); }
|
| 119 |
-
;
|
| 120 |
-
|
| 121 |
-
unprefixed_use_declaration:
|
| 122 |
-
namespace_name
|
| 123 |
-
{ $$ = Stmt\UseUse[$1, null, Stmt\Use_::TYPE_UNKNOWN]; $this->checkUseUse($$, #1); }
|
| 124 |
-
| namespace_name T_AS identifier
|
| 125 |
-
{ $$ = Stmt\UseUse[$1, $3, Stmt\Use_::TYPE_UNKNOWN]; $this->checkUseUse($$, #3); }
|
| 126 |
-
;
|
| 127 |
-
|
| 128 |
-
use_declaration:
|
| 129 |
-
unprefixed_use_declaration { $$ = $1; }
|
| 130 |
-
| T_NS_SEPARATOR unprefixed_use_declaration { $$ = $2; }
|
| 131 |
-
;
|
| 132 |
-
|
| 133 |
-
inline_use_declaration:
|
| 134 |
-
unprefixed_use_declaration { $$ = $1; $$->type = Stmt\Use_::TYPE_NORMAL; }
|
| 135 |
-
| use_type unprefixed_use_declaration { $$ = $2; $$->type = $1; }
|
| 136 |
-
;
|
| 137 |
-
|
| 138 |
-
constant_declaration_list:
|
| 139 |
-
constant_declaration_list ',' constant_declaration { push($1, $3); }
|
| 140 |
-
| constant_declaration { init($1); }
|
| 141 |
-
;
|
| 142 |
-
|
| 143 |
-
constant_declaration:
|
| 144 |
-
identifier '=' static_scalar { $$ = Node\Const_[$1, $3]; }
|
| 145 |
-
;
|
| 146 |
-
|
| 147 |
-
class_const_list:
|
| 148 |
-
class_const_list ',' class_const { push($1, $3); }
|
| 149 |
-
| class_const { init($1); }
|
| 150 |
-
;
|
| 151 |
-
|
| 152 |
-
class_const:
|
| 153 |
-
identifier_ex '=' static_scalar { $$ = Node\Const_[$1, $3]; }
|
| 154 |
-
;
|
| 155 |
-
|
| 156 |
-
inner_statement_list_ex:
|
| 157 |
-
inner_statement_list_ex inner_statement { pushNormalizing($1, $2); }
|
| 158 |
-
| /* empty */ { init(); }
|
| 159 |
-
;
|
| 160 |
-
|
| 161 |
-
inner_statement_list:
|
| 162 |
-
inner_statement_list_ex
|
| 163 |
-
{ makeZeroLengthNop($nop, $this->lookaheadStartAttributes);
|
| 164 |
-
if ($nop !== null) { $1[] = $nop; } $$ = $1; }
|
| 165 |
-
;
|
| 166 |
-
|
| 167 |
-
inner_statement:
|
| 168 |
-
statement { $$ = $1; }
|
| 169 |
-
| function_declaration_statement { $$ = $1; }
|
| 170 |
-
| class_declaration_statement { $$ = $1; }
|
| 171 |
-
| T_HALT_COMPILER
|
| 172 |
-
{ throw new Error('__HALT_COMPILER() can only be used from the outermost scope', attributes()); }
|
| 173 |
-
;
|
| 174 |
-
|
| 175 |
-
non_empty_statement:
|
| 176 |
-
'{' inner_statement_list '}'
|
| 177 |
-
{
|
| 178 |
-
if ($2) {
|
| 179 |
-
$$ = $2; prependLeadingComments($$);
|
| 180 |
-
} else {
|
| 181 |
-
makeNop($$, $this->startAttributeStack[#1], $this->endAttributes);
|
| 182 |
-
if (null === $$) { $$ = array(); }
|
| 183 |
-
}
|
| 184 |
-
}
|
| 185 |
-
| T_IF parentheses_expr statement elseif_list else_single
|
| 186 |
-
{ $$ = Stmt\If_[$2, ['stmts' => toArray($3), 'elseifs' => $4, 'else' => $5]]; }
|
| 187 |
-
| T_IF parentheses_expr ':' inner_statement_list new_elseif_list new_else_single T_ENDIF ';'
|
| 188 |
-
{ $$ = Stmt\If_[$2, ['stmts' => $4, 'elseifs' => $5, 'else' => $6]]; }
|
| 189 |
-
| T_WHILE parentheses_expr while_statement { $$ = Stmt\While_[$2, $3]; }
|
| 190 |
-
| T_DO statement T_WHILE parentheses_expr ';' { $$ = Stmt\Do_ [$4, toArray($2)]; }
|
| 191 |
-
| T_FOR '(' for_expr ';' for_expr ';' for_expr ')' for_statement
|
| 192 |
-
{ $$ = Stmt\For_[['init' => $3, 'cond' => $5, 'loop' => $7, 'stmts' => $9]]; }
|
| 193 |
-
| T_SWITCH parentheses_expr switch_case_list { $$ = Stmt\Switch_[$2, $3]; }
|
| 194 |
-
| T_BREAK ';' { $$ = Stmt\Break_[null]; }
|
| 195 |
-
| T_BREAK expr ';' { $$ = Stmt\Break_[$2]; }
|
| 196 |
-
| T_CONTINUE ';' { $$ = Stmt\Continue_[null]; }
|
| 197 |
-
| T_CONTINUE expr ';' { $$ = Stmt\Continue_[$2]; }
|
| 198 |
-
| T_RETURN ';' { $$ = Stmt\Return_[null]; }
|
| 199 |
-
| T_RETURN expr ';' { $$ = Stmt\Return_[$2]; }
|
| 200 |
-
| T_GLOBAL global_var_list ';' { $$ = Stmt\Global_[$2]; }
|
| 201 |
-
| T_STATIC static_var_list ';' { $$ = Stmt\Static_[$2]; }
|
| 202 |
-
| T_ECHO expr_list ';' { $$ = Stmt\Echo_[$2]; }
|
| 203 |
-
| T_INLINE_HTML { $$ = Stmt\InlineHTML[$1]; }
|
| 204 |
-
| yield_expr ';' { $$ = Stmt\Expression[$1]; }
|
| 205 |
-
| expr ';' { $$ = Stmt\Expression[$1]; }
|
| 206 |
-
| T_UNSET '(' variables_list ')' ';' { $$ = Stmt\Unset_[$3]; }
|
| 207 |
-
| T_FOREACH '(' expr T_AS foreach_variable ')' foreach_statement
|
| 208 |
-
{ $$ = Stmt\Foreach_[$3, $5[0], ['keyVar' => null, 'byRef' => $5[1], 'stmts' => $7]]; }
|
| 209 |
-
| T_FOREACH '(' expr T_AS variable T_DOUBLE_ARROW foreach_variable ')' foreach_statement
|
| 210 |
-
{ $$ = Stmt\Foreach_[$3, $7[0], ['keyVar' => $5, 'byRef' => $7[1], 'stmts' => $9]]; }
|
| 211 |
-
| T_DECLARE '(' declare_list ')' declare_statement { $$ = Stmt\Declare_[$3, $5]; }
|
| 212 |
-
| T_TRY '{' inner_statement_list '}' catches optional_finally
|
| 213 |
-
{ $$ = Stmt\TryCatch[$3, $5, $6]; $this->checkTryCatch($$); }
|
| 214 |
-
| T_THROW expr ';' { $$ = Stmt\Throw_[$2]; }
|
| 215 |
-
| T_GOTO identifier ';' { $$ = Stmt\Goto_[$2]; }
|
| 216 |
-
| identifier ':' { $$ = Stmt\Label[$1]; }
|
| 217 |
-
| expr error { $$ = Stmt\Expression[$1]; }
|
| 218 |
-
| error { $$ = array(); /* means: no statement */ }
|
| 219 |
-
;
|
| 220 |
-
|
| 221 |
-
statement:
|
| 222 |
-
non_empty_statement { $$ = $1; }
|
| 223 |
-
| ';'
|
| 224 |
-
{ makeNop($$, $this->startAttributeStack[#1], $this->endAttributes);
|
| 225 |
-
if ($$ === null) $$ = array(); /* means: no statement */ }
|
| 226 |
-
;
|
| 227 |
-
|
| 228 |
-
catches:
|
| 229 |
-
/* empty */ { init(); }
|
| 230 |
-
| catches catch { push($1, $2); }
|
| 231 |
-
;
|
| 232 |
-
|
| 233 |
-
catch:
|
| 234 |
-
T_CATCH '(' name plain_variable ')' '{' inner_statement_list '}'
|
| 235 |
-
{ $$ = Stmt\Catch_[array($3), $4, $7]; }
|
| 236 |
-
;
|
| 237 |
-
|
| 238 |
-
optional_finally:
|
| 239 |
-
/* empty */ { $$ = null; }
|
| 240 |
-
| T_FINALLY '{' inner_statement_list '}' { $$ = Stmt\Finally_[$3]; }
|
| 241 |
-
;
|
| 242 |
-
|
| 243 |
-
variables_list:
|
| 244 |
-
variable { init($1); }
|
| 245 |
-
| variables_list ',' variable { push($1, $3); }
|
| 246 |
-
;
|
| 247 |
-
|
| 248 |
-
optional_ref:
|
| 249 |
-
/* empty */ { $$ = false; }
|
| 250 |
-
| '&' { $$ = true; }
|
| 251 |
-
;
|
| 252 |
-
|
| 253 |
-
optional_ellipsis:
|
| 254 |
-
/* empty */ { $$ = false; }
|
| 255 |
-
| T_ELLIPSIS { $$ = true; }
|
| 256 |
-
;
|
| 257 |
-
|
| 258 |
-
function_declaration_statement:
|
| 259 |
-
T_FUNCTION optional_ref identifier '(' parameter_list ')' optional_return_type '{' inner_statement_list '}'
|
| 260 |
-
{ $$ = Stmt\Function_[$3, ['byRef' => $2, 'params' => $5, 'returnType' => $7, 'stmts' => $9]]; }
|
| 261 |
-
;
|
| 262 |
-
|
| 263 |
-
class_declaration_statement:
|
| 264 |
-
class_entry_type identifier extends_from implements_list '{' class_statement_list '}'
|
| 265 |
-
{ $$ = Stmt\Class_[$2, ['type' => $1, 'extends' => $3, 'implements' => $4, 'stmts' => $6]];
|
| 266 |
-
$this->checkClass($$, #2); }
|
| 267 |
-
| T_INTERFACE identifier interface_extends_list '{' class_statement_list '}'
|
| 268 |
-
{ $$ = Stmt\Interface_[$2, ['extends' => $3, 'stmts' => $5]];
|
| 269 |
-
$this->checkInterface($$, #2); }
|
| 270 |
-
| T_TRAIT identifier '{' class_statement_list '}'
|
| 271 |
-
{ $$ = Stmt\Trait_[$2, ['stmts' => $4]]; }
|
| 272 |
-
;
|
| 273 |
-
|
| 274 |
-
class_entry_type:
|
| 275 |
-
T_CLASS { $$ = 0; }
|
| 276 |
-
| T_ABSTRACT T_CLASS { $$ = Stmt\Class_::MODIFIER_ABSTRACT; }
|
| 277 |
-
| T_FINAL T_CLASS { $$ = Stmt\Class_::MODIFIER_FINAL; }
|
| 278 |
-
;
|
| 279 |
-
|
| 280 |
-
extends_from:
|
| 281 |
-
/* empty */ { $$ = null; }
|
| 282 |
-
| T_EXTENDS class_name { $$ = $2; }
|
| 283 |
-
;
|
| 284 |
-
|
| 285 |
-
interface_extends_list:
|
| 286 |
-
/* empty */ { $$ = array(); }
|
| 287 |
-
| T_EXTENDS class_name_list { $$ = $2; }
|
| 288 |
-
;
|
| 289 |
-
|
| 290 |
-
implements_list:
|
| 291 |
-
/* empty */ { $$ = array(); }
|
| 292 |
-
| T_IMPLEMENTS class_name_list { $$ = $2; }
|
| 293 |
-
;
|
| 294 |
-
|
| 295 |
-
class_name_list:
|
| 296 |
-
class_name { init($1); }
|
| 297 |
-
| class_name_list ',' class_name { push($1, $3); }
|
| 298 |
-
;
|
| 299 |
-
|
| 300 |
-
for_statement:
|
| 301 |
-
statement { $$ = toArray($1); }
|
| 302 |
-
| ':' inner_statement_list T_ENDFOR ';' { $$ = $2; }
|
| 303 |
-
;
|
| 304 |
-
|
| 305 |
-
foreach_statement:
|
| 306 |
-
statement { $$ = toArray($1); }
|
| 307 |
-
| ':' inner_statement_list T_ENDFOREACH ';' { $$ = $2; }
|
| 308 |
-
;
|
| 309 |
-
|
| 310 |
-
declare_statement:
|
| 311 |
-
non_empty_statement { $$ = toArray($1); }
|
| 312 |
-
| ';' { $$ = null; }
|
| 313 |
-
| ':' inner_statement_list T_ENDDECLARE ';' { $$ = $2; }
|
| 314 |
-
;
|
| 315 |
-
|
| 316 |
-
declare_list:
|
| 317 |
-
declare_list_element { init($1); }
|
| 318 |
-
| declare_list ',' declare_list_element { push($1, $3); }
|
| 319 |
-
;
|
| 320 |
-
|
| 321 |
-
declare_list_element:
|
| 322 |
-
identifier '=' static_scalar { $$ = Stmt\DeclareDeclare[$1, $3]; }
|
| 323 |
-
;
|
| 324 |
-
|
| 325 |
-
switch_case_list:
|
| 326 |
-
'{' case_list '}' { $$ = $2; }
|
| 327 |
-
| '{' ';' case_list '}' { $$ = $3; }
|
| 328 |
-
| ':' case_list T_ENDSWITCH ';' { $$ = $2; }
|
| 329 |
-
| ':' ';' case_list T_ENDSWITCH ';' { $$ = $3; }
|
| 330 |
-
;
|
| 331 |
-
|
| 332 |
-
case_list:
|
| 333 |
-
/* empty */ { init(); }
|
| 334 |
-
| case_list case { push($1, $2); }
|
| 335 |
-
;
|
| 336 |
-
|
| 337 |
-
case:
|
| 338 |
-
T_CASE expr case_separator inner_statement_list_ex { $$ = Stmt\Case_[$2, $4]; }
|
| 339 |
-
| T_DEFAULT case_separator inner_statement_list_ex { $$ = Stmt\Case_[null, $3]; }
|
| 340 |
-
;
|
| 341 |
-
|
| 342 |
-
case_separator:
|
| 343 |
-
':'
|
| 344 |
-
| ';'
|
| 345 |
-
;
|
| 346 |
-
|
| 347 |
-
while_statement:
|
| 348 |
-
statement { $$ = toArray($1); }
|
| 349 |
-
| ':' inner_statement_list T_ENDWHILE ';' { $$ = $2; }
|
| 350 |
-
;
|
| 351 |
-
|
| 352 |
-
elseif_list:
|
| 353 |
-
/* empty */ { init(); }
|
| 354 |
-
| elseif_list elseif { push($1, $2); }
|
| 355 |
-
;
|
| 356 |
-
|
| 357 |
-
elseif:
|
| 358 |
-
T_ELSEIF parentheses_expr statement { $$ = Stmt\ElseIf_[$2, toArray($3)]; }
|
| 359 |
-
;
|
| 360 |
-
|
| 361 |
-
new_elseif_list:
|
| 362 |
-
/* empty */ { init(); }
|
| 363 |
-
| new_elseif_list new_elseif { push($1, $2); }
|
| 364 |
-
;
|
| 365 |
-
|
| 366 |
-
new_elseif:
|
| 367 |
-
T_ELSEIF parentheses_expr ':' inner_statement_list { $$ = Stmt\ElseIf_[$2, $4]; }
|
| 368 |
-
;
|
| 369 |
-
|
| 370 |
-
else_single:
|
| 371 |
-
/* empty */ { $$ = null; }
|
| 372 |
-
| T_ELSE statement { $$ = Stmt\Else_[toArray($2)]; }
|
| 373 |
-
;
|
| 374 |
-
|
| 375 |
-
new_else_single:
|
| 376 |
-
/* empty */ { $$ = null; }
|
| 377 |
-
| T_ELSE ':' inner_statement_list { $$ = Stmt\Else_[$3]; }
|
| 378 |
-
;
|
| 379 |
-
|
| 380 |
-
foreach_variable:
|
| 381 |
-
variable { $$ = array($1, false); }
|
| 382 |
-
| '&' variable { $$ = array($2, true); }
|
| 383 |
-
| list_expr { $$ = array($1, false); }
|
| 384 |
-
;
|
| 385 |
-
|
| 386 |
-
parameter_list:
|
| 387 |
-
non_empty_parameter_list { $$ = $1; }
|
| 388 |
-
| /* empty */ { $$ = array(); }
|
| 389 |
-
;
|
| 390 |
-
|
| 391 |
-
non_empty_parameter_list:
|
| 392 |
-
parameter { init($1); }
|
| 393 |
-
| non_empty_parameter_list ',' parameter { push($1, $3); }
|
| 394 |
-
;
|
| 395 |
-
|
| 396 |
-
parameter:
|
| 397 |
-
optional_param_type optional_ref optional_ellipsis plain_variable
|
| 398 |
-
{ $$ = Node\Param[$4, null, $1, $2, $3]; $this->checkParam($$); }
|
| 399 |
-
| optional_param_type optional_ref optional_ellipsis plain_variable '=' static_scalar
|
| 400 |
-
{ $$ = Node\Param[$4, $6, $1, $2, $3]; $this->checkParam($$); }
|
| 401 |
-
;
|
| 402 |
-
|
| 403 |
-
type:
|
| 404 |
-
name { $$ = $1; }
|
| 405 |
-
| T_ARRAY { $$ = Node\Identifier['array']; }
|
| 406 |
-
| T_CALLABLE { $$ = Node\Identifier['callable']; }
|
| 407 |
-
;
|
| 408 |
-
|
| 409 |
-
optional_param_type:
|
| 410 |
-
/* empty */ { $$ = null; }
|
| 411 |
-
| type { $$ = $1; }
|
| 412 |
-
;
|
| 413 |
-
|
| 414 |
-
optional_return_type:
|
| 415 |
-
/* empty */ { $$ = null; }
|
| 416 |
-
| ':' type { $$ = $2; }
|
| 417 |
-
;
|
| 418 |
-
|
| 419 |
-
argument_list:
|
| 420 |
-
'(' ')' { $$ = array(); }
|
| 421 |
-
| '(' non_empty_argument_list ')' { $$ = $2; }
|
| 422 |
-
| '(' yield_expr ')' { $$ = array(Node\Arg[$2, false, false]); }
|
| 423 |
-
;
|
| 424 |
-
|
| 425 |
-
non_empty_argument_list:
|
| 426 |
-
argument { init($1); }
|
| 427 |
-
| non_empty_argument_list ',' argument { push($1, $3); }
|
| 428 |
-
;
|
| 429 |
-
|
| 430 |
-
argument:
|
| 431 |
-
expr { $$ = Node\Arg[$1, false, false]; }
|
| 432 |
-
| '&' variable { $$ = Node\Arg[$2, true, false]; }
|
| 433 |
-
| T_ELLIPSIS expr { $$ = Node\Arg[$2, false, true]; }
|
| 434 |
-
;
|
| 435 |
-
|
| 436 |
-
global_var_list:
|
| 437 |
-
global_var_list ',' global_var { push($1, $3); }
|
| 438 |
-
| global_var { init($1); }
|
| 439 |
-
;
|
| 440 |
-
|
| 441 |
-
global_var:
|
| 442 |
-
plain_variable { $$ = $1; }
|
| 443 |
-
| '$' variable { $$ = Expr\Variable[$2]; }
|
| 444 |
-
| '$' '{' expr '}' { $$ = Expr\Variable[$3]; }
|
| 445 |
-
;
|
| 446 |
-
|
| 447 |
-
static_var_list:
|
| 448 |
-
static_var_list ',' static_var { push($1, $3); }
|
| 449 |
-
| static_var { init($1); }
|
| 450 |
-
;
|
| 451 |
-
|
| 452 |
-
static_var:
|
| 453 |
-
plain_variable { $$ = Stmt\StaticVar[$1, null]; }
|
| 454 |
-
| plain_variable '=' static_scalar { $$ = Stmt\StaticVar[$1, $3]; }
|
| 455 |
-
;
|
| 456 |
-
|
| 457 |
-
class_statement_list_ex:
|
| 458 |
-
class_statement_list_ex class_statement { if ($2 !== null) { push($1, $2); } }
|
| 459 |
-
| /* empty */ { init(); }
|
| 460 |
-
;
|
| 461 |
-
|
| 462 |
-
class_statement_list:
|
| 463 |
-
class_statement_list_ex
|
| 464 |
-
{ makeZeroLengthNop($nop, $this->lookaheadStartAttributes);
|
| 465 |
-
if ($nop !== null) { $1[] = $nop; } $$ = $1; }
|
| 466 |
-
;
|
| 467 |
-
|
| 468 |
-
class_statement:
|
| 469 |
-
variable_modifiers property_declaration_list ';'
|
| 470 |
-
{ $$ = Stmt\Property[$1, $2]; $this->checkProperty($$, #1); }
|
| 471 |
-
| T_CONST class_const_list ';' { $$ = Stmt\ClassConst[$2, 0]; }
|
| 472 |
-
| method_modifiers T_FUNCTION optional_ref identifier_ex '(' parameter_list ')' optional_return_type method_body
|
| 473 |
-
{ $$ = Stmt\ClassMethod[$4, ['type' => $1, 'byRef' => $3, 'params' => $6, 'returnType' => $8, 'stmts' => $9]];
|
| 474 |
-
$this->checkClassMethod($$, #1); }
|
| 475 |
-
| T_USE class_name_list trait_adaptations { $$ = Stmt\TraitUse[$2, $3]; }
|
| 476 |
-
;
|
| 477 |
-
|
| 478 |
-
trait_adaptations:
|
| 479 |
-
';' { $$ = array(); }
|
| 480 |
-
| '{' trait_adaptation_list '}' { $$ = $2; }
|
| 481 |
-
;
|
| 482 |
-
|
| 483 |
-
trait_adaptation_list:
|
| 484 |
-
/* empty */ { init(); }
|
| 485 |
-
| trait_adaptation_list trait_adaptation { push($1, $2); }
|
| 486 |
-
;
|
| 487 |
-
|
| 488 |
-
trait_adaptation:
|
| 489 |
-
trait_method_reference_fully_qualified T_INSTEADOF class_name_list ';'
|
| 490 |
-
{ $$ = Stmt\TraitUseAdaptation\Precedence[$1[0], $1[1], $3]; }
|
| 491 |
-
| trait_method_reference T_AS member_modifier identifier_ex ';'
|
| 492 |
-
{ $$ = Stmt\TraitUseAdaptation\Alias[$1[0], $1[1], $3, $4]; }
|
| 493 |
-
| trait_method_reference T_AS member_modifier ';'
|
| 494 |
-
{ $$ = Stmt\TraitUseAdaptation\Alias[$1[0], $1[1], $3, null]; }
|
| 495 |
-
| trait_method_reference T_AS identifier ';'
|
| 496 |
-
{ $$ = Stmt\TraitUseAdaptation\Alias[$1[0], $1[1], null, $3]; }
|
| 497 |
-
| trait_method_reference T_AS reserved_non_modifiers_identifier ';'
|
| 498 |
-
{ $$ = Stmt\TraitUseAdaptation\Alias[$1[0], $1[1], null, $3]; }
|
| 499 |
-
;
|
| 500 |
-
|
| 501 |
-
trait_method_reference_fully_qualified:
|
| 502 |
-
name T_PAAMAYIM_NEKUDOTAYIM identifier_ex { $$ = array($1, $3); }
|
| 503 |
-
;
|
| 504 |
-
trait_method_reference:
|
| 505 |
-
trait_method_reference_fully_qualified { $$ = $1; }
|
| 506 |
-
| identifier_ex { $$ = array(null, $1); }
|
| 507 |
-
;
|
| 508 |
-
|
| 509 |
-
method_body:
|
| 510 |
-
';' /* abstract method */ { $$ = null; }
|
| 511 |
-
| '{' inner_statement_list '}' { $$ = $2; }
|
| 512 |
-
;
|
| 513 |
-
|
| 514 |
-
variable_modifiers:
|
| 515 |
-
non_empty_member_modifiers { $$ = $1; }
|
| 516 |
-
| T_VAR { $$ = 0; }
|
| 517 |
-
;
|
| 518 |
-
|
| 519 |
-
method_modifiers:
|
| 520 |
-
/* empty */ { $$ = 0; }
|
| 521 |
-
| non_empty_member_modifiers { $$ = $1; }
|
| 522 |
-
;
|
| 523 |
-
|
| 524 |
-
non_empty_member_modifiers:
|
| 525 |
-
member_modifier { $$ = $1; }
|
| 526 |
-
| non_empty_member_modifiers member_modifier { $this->checkModifier($1, $2, #2); $$ = $1 | $2; }
|
| 527 |
-
;
|
| 528 |
-
|
| 529 |
-
member_modifier:
|
| 530 |
-
T_PUBLIC { $$ = Stmt\Class_::MODIFIER_PUBLIC; }
|
| 531 |
-
| T_PROTECTED { $$ = Stmt\Class_::MODIFIER_PROTECTED; }
|
| 532 |
-
| T_PRIVATE { $$ = Stmt\Class_::MODIFIER_PRIVATE; }
|
| 533 |
-
| T_STATIC { $$ = Stmt\Class_::MODIFIER_STATIC; }
|
| 534 |
-
| T_ABSTRACT { $$ = Stmt\Class_::MODIFIER_ABSTRACT; }
|
| 535 |
-
| T_FINAL { $$ = Stmt\Class_::MODIFIER_FINAL; }
|
| 536 |
-
;
|
| 537 |
-
|
| 538 |
-
property_declaration_list:
|
| 539 |
-
property_declaration { init($1); }
|
| 540 |
-
| property_declaration_list ',' property_declaration { push($1, $3); }
|
| 541 |
-
;
|
| 542 |
-
|
| 543 |
-
property_decl_name:
|
| 544 |
-
T_VARIABLE { $$ = Node\VarLikeIdentifier[parseVar($1)]; }
|
| 545 |
-
;
|
| 546 |
-
|
| 547 |
-
property_declaration:
|
| 548 |
-
property_decl_name { $$ = Stmt\PropertyProperty[$1, null]; }
|
| 549 |
-
| property_decl_name '=' static_scalar { $$ = Stmt\PropertyProperty[$1, $3]; }
|
| 550 |
-
;
|
| 551 |
-
|
| 552 |
-
expr_list:
|
| 553 |
-
expr_list ',' expr { push($1, $3); }
|
| 554 |
-
| expr { init($1); }
|
| 555 |
-
;
|
| 556 |
-
|
| 557 |
-
for_expr:
|
| 558 |
-
/* empty */ { $$ = array(); }
|
| 559 |
-
| expr_list { $$ = $1; }
|
| 560 |
-
;
|
| 561 |
-
|
| 562 |
-
expr:
|
| 563 |
-
variable { $$ = $1; }
|
| 564 |
-
| list_expr '=' expr { $$ = Expr\Assign[$1, $3]; }
|
| 565 |
-
| variable '=' expr { $$ = Expr\Assign[$1, $3]; }
|
| 566 |
-
| variable '=' '&' variable { $$ = Expr\AssignRef[$1, $4]; }
|
| 567 |
-
| variable '=' '&' new_expr { $$ = Expr\AssignRef[$1, $4]; }
|
| 568 |
-
| new_expr { $$ = $1; }
|
| 569 |
-
| T_CLONE expr { $$ = Expr\Clone_[$2]; }
|
| 570 |
-
| variable T_PLUS_EQUAL expr { $$ = Expr\AssignOp\Plus [$1, $3]; }
|
| 571 |
-
| variable T_MINUS_EQUAL expr { $$ = Expr\AssignOp\Minus [$1, $3]; }
|
| 572 |
-
| variable T_MUL_EQUAL expr { $$ = Expr\AssignOp\Mul [$1, $3]; }
|
| 573 |
-
| variable T_DIV_EQUAL expr { $$ = Expr\AssignOp\Div [$1, $3]; }
|
| 574 |
-
| variable T_CONCAT_EQUAL expr { $$ = Expr\AssignOp\Concat [$1, $3]; }
|
| 575 |
-
| variable T_MOD_EQUAL expr { $$ = Expr\AssignOp\Mod [$1, $3]; }
|
| 576 |
-
| variable T_AND_EQUAL expr { $$ = Expr\AssignOp\BitwiseAnd[$1, $3]; }
|
| 577 |
-
| variable T_OR_EQUAL expr { $$ = Expr\AssignOp\BitwiseOr [$1, $3]; }
|
| 578 |
-
| variable T_XOR_EQUAL expr { $$ = Expr\AssignOp\BitwiseXor[$1, $3]; }
|
| 579 |
-
| variable T_SL_EQUAL expr { $$ = Expr\AssignOp\ShiftLeft [$1, $3]; }
|
| 580 |
-
| variable T_SR_EQUAL expr { $$ = Expr\AssignOp\ShiftRight[$1, $3]; }
|
| 581 |
-
| variable T_POW_EQUAL expr { $$ = Expr\AssignOp\Pow [$1, $3]; }
|
| 582 |
-
| variable T_COALESCE_EQUAL expr { $$ = Expr\AssignOp\Coalesce [$1, $3]; }
|
| 583 |
-
| variable T_INC { $$ = Expr\PostInc[$1]; }
|
| 584 |
-
| T_INC variable { $$ = Expr\PreInc [$2]; }
|
| 585 |
-
| variable T_DEC { $$ = Expr\PostDec[$1]; }
|
| 586 |
-
| T_DEC variable { $$ = Expr\PreDec [$2]; }
|
| 587 |
-
| expr T_BOOLEAN_OR expr { $$ = Expr\BinaryOp\BooleanOr [$1, $3]; }
|
| 588 |
-
| expr T_BOOLEAN_AND expr { $$ = Expr\BinaryOp\BooleanAnd[$1, $3]; }
|
| 589 |
-
| expr T_LOGICAL_OR expr { $$ = Expr\BinaryOp\LogicalOr [$1, $3]; }
|
| 590 |
-
| expr T_LOGICAL_AND expr { $$ = Expr\BinaryOp\LogicalAnd[$1, $3]; }
|
| 591 |
-
| expr T_LOGICAL_XOR expr { $$ = Expr\BinaryOp\LogicalXor[$1, $3]; }
|
| 592 |
-
| expr '|' expr { $$ = Expr\BinaryOp\BitwiseOr [$1, $3]; }
|
| 593 |
-
| expr '&' expr { $$ = Expr\BinaryOp\BitwiseAnd[$1, $3]; }
|
| 594 |
-
| expr '^' expr { $$ = Expr\BinaryOp\BitwiseXor[$1, $3]; }
|
| 595 |
-
| expr '.' expr { $$ = Expr\BinaryOp\Concat [$1, $3]; }
|
| 596 |
-
| expr '+' expr { $$ = Expr\BinaryOp\Plus [$1, $3]; }
|
| 597 |
-
| expr '-' expr { $$ = Expr\BinaryOp\Minus [$1, $3]; }
|
| 598 |
-
| expr '*' expr { $$ = Expr\BinaryOp\Mul [$1, $3]; }
|
| 599 |
-
| expr '/' expr { $$ = Expr\BinaryOp\Div [$1, $3]; }
|
| 600 |
-
| expr '%' expr { $$ = Expr\BinaryOp\Mod [$1, $3]; }
|
| 601 |
-
| expr T_SL expr { $$ = Expr\BinaryOp\ShiftLeft [$1, $3]; }
|
| 602 |
-
| expr T_SR expr { $$ = Expr\BinaryOp\ShiftRight[$1, $3]; }
|
| 603 |
-
| expr T_POW expr { $$ = Expr\BinaryOp\Pow [$1, $3]; }
|
| 604 |
-
| '+' expr %prec T_INC { $$ = Expr\UnaryPlus [$2]; }
|
| 605 |
-
| '-' expr %prec T_INC { $$ = Expr\UnaryMinus[$2]; }
|
| 606 |
-
| '!' expr { $$ = Expr\BooleanNot[$2]; }
|
| 607 |
-
| '~' expr { $$ = Expr\BitwiseNot[$2]; }
|
| 608 |
-
| expr T_IS_IDENTICAL expr { $$ = Expr\BinaryOp\Identical [$1, $3]; }
|
| 609 |
-
| expr T_IS_NOT_IDENTICAL expr { $$ = Expr\BinaryOp\NotIdentical [$1, $3]; }
|
| 610 |
-
| expr T_IS_EQUAL expr { $$ = Expr\BinaryOp\Equal [$1, $3]; }
|
| 611 |
-
| expr T_IS_NOT_EQUAL expr { $$ = Expr\BinaryOp\NotEqual [$1, $3]; }
|
| 612 |
-
| expr T_SPACESHIP expr { $$ = Expr\BinaryOp\Spaceship [$1, $3]; }
|
| 613 |
-
| expr '<' expr { $$ = Expr\BinaryOp\Smaller [$1, $3]; }
|
| 614 |
-
| expr T_IS_SMALLER_OR_EQUAL expr { $$ = Expr\BinaryOp\SmallerOrEqual[$1, $3]; }
|
| 615 |
-
| expr '>' expr { $$ = Expr\BinaryOp\Greater [$1, $3]; }
|
| 616 |
-
| expr T_IS_GREATER_OR_EQUAL expr { $$ = Expr\BinaryOp\GreaterOrEqual[$1, $3]; }
|
| 617 |
-
| expr T_INSTANCEOF class_name_reference { $$ = Expr\Instanceof_[$1, $3]; }
|
| 618 |
-
| parentheses_expr { $$ = $1; }
|
| 619 |
-
/* we need a separate '(' new_expr ')' rule to avoid problems caused by a s/r conflict */
|
| 620 |
-
| '(' new_expr ')' { $$ = $2; }
|
| 621 |
-
| expr '?' expr ':' expr { $$ = Expr\Ternary[$1, $3, $5]; }
|
| 622 |
-
| expr '?' ':' expr { $$ = Expr\Ternary[$1, null, $4]; }
|
| 623 |
-
| expr T_COALESCE expr { $$ = Expr\BinaryOp\Coalesce[$1, $3]; }
|
| 624 |
-
| T_ISSET '(' variables_list ')' { $$ = Expr\Isset_[$3]; }
|
| 625 |
-
| T_EMPTY '(' expr ')' { $$ = Expr\Empty_[$3]; }
|
| 626 |
-
| T_INCLUDE expr { $$ = Expr\Include_[$2, Expr\Include_::TYPE_INCLUDE]; }
|
| 627 |
-
| T_INCLUDE_ONCE expr { $$ = Expr\Include_[$2, Expr\Include_::TYPE_INCLUDE_ONCE]; }
|
| 628 |
-
| T_EVAL parentheses_expr { $$ = Expr\Eval_[$2]; }
|
| 629 |
-
| T_REQUIRE expr { $$ = Expr\Include_[$2, Expr\Include_::TYPE_REQUIRE]; }
|
| 630 |
-
| T_REQUIRE_ONCE expr { $$ = Expr\Include_[$2, Expr\Include_::TYPE_REQUIRE_ONCE]; }
|
| 631 |
-
| T_INT_CAST expr { $$ = Expr\Cast\Int_ [$2]; }
|
| 632 |
-
| T_DOUBLE_CAST expr
|
| 633 |
-
{ $attrs = attributes();
|
| 634 |
-
$attrs['kind'] = $this->getFloatCastKind($1);
|
| 635 |
-
$$ = new Expr\Cast\Double($2, $attrs); }
|
| 636 |
-
| T_STRING_CAST expr { $$ = Expr\Cast\String_ [$2]; }
|
| 637 |
-
| T_ARRAY_CAST expr { $$ = Expr\Cast\Array_ [$2]; }
|
| 638 |
-
| T_OBJECT_CAST expr { $$ = Expr\Cast\Object_ [$2]; }
|
| 639 |
-
| T_BOOL_CAST expr { $$ = Expr\Cast\Bool_ [$2]; }
|
| 640 |
-
| T_UNSET_CAST expr { $$ = Expr\Cast\Unset_ [$2]; }
|
| 641 |
-
| T_EXIT exit_expr
|
| 642 |
-
{ $attrs = attributes();
|
| 643 |
-
$attrs['kind'] = strtolower($1) === 'exit' ? Expr\Exit_::KIND_EXIT : Expr\Exit_::KIND_DIE;
|
| 644 |
-
$$ = new Expr\Exit_($2, $attrs); }
|
| 645 |
-
| '@' expr { $$ = Expr\ErrorSuppress[$2]; }
|
| 646 |
-
| scalar { $$ = $1; }
|
| 647 |
-
| array_expr { $$ = $1; }
|
| 648 |
-
| scalar_dereference { $$ = $1; }
|
| 649 |
-
| '`' backticks_expr '`' { $$ = Expr\ShellExec[$2]; }
|
| 650 |
-
| T_PRINT expr { $$ = Expr\Print_[$2]; }
|
| 651 |
-
| T_YIELD { $$ = Expr\Yield_[null, null]; }
|
| 652 |
-
| T_YIELD_FROM expr { $$ = Expr\YieldFrom[$2]; }
|
| 653 |
-
| T_FUNCTION optional_ref '(' parameter_list ')' lexical_vars optional_return_type
|
| 654 |
-
'{' inner_statement_list '}'
|
| 655 |
-
{ $$ = Expr\Closure[['static' => false, 'byRef' => $2, 'params' => $4, 'uses' => $6, 'returnType' => $7, 'stmts' => $9]]; }
|
| 656 |
-
| T_STATIC T_FUNCTION optional_ref '(' parameter_list ')' lexical_vars optional_return_type
|
| 657 |
-
'{' inner_statement_list '}'
|
| 658 |
-
{ $$ = Expr\Closure[['static' => true, 'byRef' => $3, 'params' => $5, 'uses' => $7, 'returnType' => $8, 'stmts' => $10]]; }
|
| 659 |
-
;
|
| 660 |
-
|
| 661 |
-
parentheses_expr:
|
| 662 |
-
'(' expr ')' { $$ = $2; }
|
| 663 |
-
| '(' yield_expr ')' { $$ = $2; }
|
| 664 |
-
;
|
| 665 |
-
|
| 666 |
-
yield_expr:
|
| 667 |
-
T_YIELD expr { $$ = Expr\Yield_[$2, null]; }
|
| 668 |
-
| T_YIELD expr T_DOUBLE_ARROW expr { $$ = Expr\Yield_[$4, $2]; }
|
| 669 |
-
;
|
| 670 |
-
|
| 671 |
-
array_expr:
|
| 672 |
-
T_ARRAY '(' array_pair_list ')'
|
| 673 |
-
{ $attrs = attributes(); $attrs['kind'] = Expr\Array_::KIND_LONG;
|
| 674 |
-
$$ = new Expr\Array_($3, $attrs); }
|
| 675 |
-
| '[' array_pair_list ']'
|
| 676 |
-
{ $attrs = attributes(); $attrs['kind'] = Expr\Array_::KIND_SHORT;
|
| 677 |
-
$$ = new Expr\Array_($2, $attrs); }
|
| 678 |
-
;
|
| 679 |
-
|
| 680 |
-
scalar_dereference:
|
| 681 |
-
array_expr '[' dim_offset ']' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 682 |
-
| T_CONSTANT_ENCAPSED_STRING '[' dim_offset ']'
|
| 683 |
-
{ $attrs = attributes(); $attrs['kind'] = strKind($1);
|
| 684 |
-
$$ = Expr\ArrayDimFetch[new Scalar\String_(Scalar\String_::parse($1), $attrs), $3]; }
|
| 685 |
-
| constant '[' dim_offset ']' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 686 |
-
| scalar_dereference '[' dim_offset ']' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 687 |
-
/* alternative array syntax missing intentionally */
|
| 688 |
-
;
|
| 689 |
-
|
| 690 |
-
anonymous_class:
|
| 691 |
-
T_CLASS ctor_arguments extends_from implements_list '{' class_statement_list '}'
|
| 692 |
-
{ $$ = array(Stmt\Class_[null, ['type' => 0, 'extends' => $3, 'implements' => $4, 'stmts' => $6]], $2);
|
| 693 |
-
$this->checkClass($$[0], -1); }
|
| 694 |
-
;
|
| 695 |
-
|
| 696 |
-
new_expr:
|
| 697 |
-
T_NEW class_name_reference ctor_arguments { $$ = Expr\New_[$2, $3]; }
|
| 698 |
-
| T_NEW anonymous_class
|
| 699 |
-
{ list($class, $ctorArgs) = $2; $$ = Expr\New_[$class, $ctorArgs]; }
|
| 700 |
-
;
|
| 701 |
-
|
| 702 |
-
lexical_vars:
|
| 703 |
-
/* empty */ { $$ = array(); }
|
| 704 |
-
| T_USE '(' lexical_var_list ')' { $$ = $3; }
|
| 705 |
-
;
|
| 706 |
-
|
| 707 |
-
lexical_var_list:
|
| 708 |
-
lexical_var { init($1); }
|
| 709 |
-
| lexical_var_list ',' lexical_var { push($1, $3); }
|
| 710 |
-
;
|
| 711 |
-
|
| 712 |
-
lexical_var:
|
| 713 |
-
optional_ref plain_variable { $$ = Expr\ClosureUse[$2, $1]; }
|
| 714 |
-
;
|
| 715 |
-
|
| 716 |
-
function_call:
|
| 717 |
-
name argument_list { $$ = Expr\FuncCall[$1, $2]; }
|
| 718 |
-
| class_name_or_var T_PAAMAYIM_NEKUDOTAYIM identifier_ex argument_list
|
| 719 |
-
{ $$ = Expr\StaticCall[$1, $3, $4]; }
|
| 720 |
-
| class_name_or_var T_PAAMAYIM_NEKUDOTAYIM '{' expr '}' argument_list
|
| 721 |
-
{ $$ = Expr\StaticCall[$1, $4, $6]; }
|
| 722 |
-
| static_property argument_list
|
| 723 |
-
{ $$ = $this->fixupPhp5StaticPropCall($1, $2, attributes()); }
|
| 724 |
-
| variable_without_objects argument_list
|
| 725 |
-
{ $$ = Expr\FuncCall[$1, $2]; }
|
| 726 |
-
| function_call '[' dim_offset ']' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 727 |
-
/* alternative array syntax missing intentionally */
|
| 728 |
-
;
|
| 729 |
-
|
| 730 |
-
class_name:
|
| 731 |
-
T_STATIC { $$ = Name[$1]; }
|
| 732 |
-
| name { $$ = $1; }
|
| 733 |
-
;
|
| 734 |
-
|
| 735 |
-
name:
|
| 736 |
-
namespace_name_parts { $$ = Name[$1]; }
|
| 737 |
-
| T_NS_SEPARATOR namespace_name_parts { $$ = Name\FullyQualified[$2]; }
|
| 738 |
-
| T_NAMESPACE T_NS_SEPARATOR namespace_name_parts { $$ = Name\Relative[$3]; }
|
| 739 |
-
;
|
| 740 |
-
|
| 741 |
-
class_name_reference:
|
| 742 |
-
class_name { $$ = $1; }
|
| 743 |
-
| dynamic_class_name_reference { $$ = $1; }
|
| 744 |
-
;
|
| 745 |
-
|
| 746 |
-
dynamic_class_name_reference:
|
| 747 |
-
object_access_for_dcnr { $$ = $1; }
|
| 748 |
-
| base_variable { $$ = $1; }
|
| 749 |
-
;
|
| 750 |
-
|
| 751 |
-
class_name_or_var:
|
| 752 |
-
class_name { $$ = $1; }
|
| 753 |
-
| reference_variable { $$ = $1; }
|
| 754 |
-
;
|
| 755 |
-
|
| 756 |
-
object_access_for_dcnr:
|
| 757 |
-
base_variable T_OBJECT_OPERATOR object_property
|
| 758 |
-
{ $$ = Expr\PropertyFetch[$1, $3]; }
|
| 759 |
-
| object_access_for_dcnr T_OBJECT_OPERATOR object_property
|
| 760 |
-
{ $$ = Expr\PropertyFetch[$1, $3]; }
|
| 761 |
-
| object_access_for_dcnr '[' dim_offset ']' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 762 |
-
| object_access_for_dcnr '{' expr '}' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 763 |
-
;
|
| 764 |
-
|
| 765 |
-
exit_expr:
|
| 766 |
-
/* empty */ { $$ = null; }
|
| 767 |
-
| '(' ')' { $$ = null; }
|
| 768 |
-
| parentheses_expr { $$ = $1; }
|
| 769 |
-
;
|
| 770 |
-
|
| 771 |
-
backticks_expr:
|
| 772 |
-
/* empty */ { $$ = array(); }
|
| 773 |
-
| T_ENCAPSED_AND_WHITESPACE
|
| 774 |
-
{ $$ = array(Scalar\EncapsedStringPart[Scalar\String_::parseEscapeSequences($1, '`', false)]); }
|
| 775 |
-
| encaps_list { parseEncapsed($1, '`', false); $$ = $1; }
|
| 776 |
-
;
|
| 777 |
-
|
| 778 |
-
ctor_arguments:
|
| 779 |
-
/* empty */ { $$ = array(); }
|
| 780 |
-
| argument_list { $$ = $1; }
|
| 781 |
-
;
|
| 782 |
-
|
| 783 |
-
common_scalar:
|
| 784 |
-
T_LNUMBER { $$ = $this->parseLNumber($1, attributes(), true); }
|
| 785 |
-
| T_DNUMBER { $$ = Scalar\DNumber[Scalar\DNumber::parse($1)]; }
|
| 786 |
-
| T_CONSTANT_ENCAPSED_STRING
|
| 787 |
-
{ $attrs = attributes(); $attrs['kind'] = strKind($1);
|
| 788 |
-
$$ = new Scalar\String_(Scalar\String_::parse($1, false), $attrs); }
|
| 789 |
-
| T_LINE { $$ = Scalar\MagicConst\Line[]; }
|
| 790 |
-
| T_FILE { $$ = Scalar\MagicConst\File[]; }
|
| 791 |
-
| T_DIR { $$ = Scalar\MagicConst\Dir[]; }
|
| 792 |
-
| T_CLASS_C { $$ = Scalar\MagicConst\Class_[]; }
|
| 793 |
-
| T_TRAIT_C { $$ = Scalar\MagicConst\Trait_[]; }
|
| 794 |
-
| T_METHOD_C { $$ = Scalar\MagicConst\Method[]; }
|
| 795 |
-
| T_FUNC_C { $$ = Scalar\MagicConst\Function_[]; }
|
| 796 |
-
| T_NS_C { $$ = Scalar\MagicConst\Namespace_[]; }
|
| 797 |
-
| T_START_HEREDOC T_ENCAPSED_AND_WHITESPACE T_END_HEREDOC
|
| 798 |
-
{ $$ = $this->parseDocString($1, $2, $3, attributes(), stackAttributes(#3), false); }
|
| 799 |
-
| T_START_HEREDOC T_END_HEREDOC
|
| 800 |
-
{ $$ = $this->parseDocString($1, '', $2, attributes(), stackAttributes(#2), false); }
|
| 801 |
-
;
|
| 802 |
-
|
| 803 |
-
static_scalar:
|
| 804 |
-
common_scalar { $$ = $1; }
|
| 805 |
-
| class_name T_PAAMAYIM_NEKUDOTAYIM identifier_ex { $$ = Expr\ClassConstFetch[$1, $3]; }
|
| 806 |
-
| name { $$ = Expr\ConstFetch[$1]; }
|
| 807 |
-
| T_ARRAY '(' static_array_pair_list ')' { $$ = Expr\Array_[$3]; }
|
| 808 |
-
| '[' static_array_pair_list ']' { $$ = Expr\Array_[$2]; }
|
| 809 |
-
| static_operation { $$ = $1; }
|
| 810 |
-
;
|
| 811 |
-
|
| 812 |
-
static_operation:
|
| 813 |
-
static_scalar T_BOOLEAN_OR static_scalar { $$ = Expr\BinaryOp\BooleanOr [$1, $3]; }
|
| 814 |
-
| static_scalar T_BOOLEAN_AND static_scalar { $$ = Expr\BinaryOp\BooleanAnd[$1, $3]; }
|
| 815 |
-
| static_scalar T_LOGICAL_OR static_scalar { $$ = Expr\BinaryOp\LogicalOr [$1, $3]; }
|
| 816 |
-
| static_scalar T_LOGICAL_AND static_scalar { $$ = Expr\BinaryOp\LogicalAnd[$1, $3]; }
|
| 817 |
-
| static_scalar T_LOGICAL_XOR static_scalar { $$ = Expr\BinaryOp\LogicalXor[$1, $3]; }
|
| 818 |
-
| static_scalar '|' static_scalar { $$ = Expr\BinaryOp\BitwiseOr [$1, $3]; }
|
| 819 |
-
| static_scalar '&' static_scalar { $$ = Expr\BinaryOp\BitwiseAnd[$1, $3]; }
|
| 820 |
-
| static_scalar '^' static_scalar { $$ = Expr\BinaryOp\BitwiseXor[$1, $3]; }
|
| 821 |
-
| static_scalar '.' static_scalar { $$ = Expr\BinaryOp\Concat [$1, $3]; }
|
| 822 |
-
| static_scalar '+' static_scalar { $$ = Expr\BinaryOp\Plus [$1, $3]; }
|
| 823 |
-
| static_scalar '-' static_scalar { $$ = Expr\BinaryOp\Minus [$1, $3]; }
|
| 824 |
-
| static_scalar '*' static_scalar { $$ = Expr\BinaryOp\Mul [$1, $3]; }
|
| 825 |
-
| static_scalar '/' static_scalar { $$ = Expr\BinaryOp\Div [$1, $3]; }
|
| 826 |
-
| static_scalar '%' static_scalar { $$ = Expr\BinaryOp\Mod [$1, $3]; }
|
| 827 |
-
| static_scalar T_SL static_scalar { $$ = Expr\BinaryOp\ShiftLeft [$1, $3]; }
|
| 828 |
-
| static_scalar T_SR static_scalar { $$ = Expr\BinaryOp\ShiftRight[$1, $3]; }
|
| 829 |
-
| static_scalar T_POW static_scalar { $$ = Expr\BinaryOp\Pow [$1, $3]; }
|
| 830 |
-
| '+' static_scalar %prec T_INC { $$ = Expr\UnaryPlus [$2]; }
|
| 831 |
-
| '-' static_scalar %prec T_INC { $$ = Expr\UnaryMinus[$2]; }
|
| 832 |
-
| '!' static_scalar { $$ = Expr\BooleanNot[$2]; }
|
| 833 |
-
| '~' static_scalar { $$ = Expr\BitwiseNot[$2]; }
|
| 834 |
-
| static_scalar T_IS_IDENTICAL static_scalar { $$ = Expr\BinaryOp\Identical [$1, $3]; }
|
| 835 |
-
| static_scalar T_IS_NOT_IDENTICAL static_scalar { $$ = Expr\BinaryOp\NotIdentical [$1, $3]; }
|
| 836 |
-
| static_scalar T_IS_EQUAL static_scalar { $$ = Expr\BinaryOp\Equal [$1, $3]; }
|
| 837 |
-
| static_scalar T_IS_NOT_EQUAL static_scalar { $$ = Expr\BinaryOp\NotEqual [$1, $3]; }
|
| 838 |
-
| static_scalar '<' static_scalar { $$ = Expr\BinaryOp\Smaller [$1, $3]; }
|
| 839 |
-
| static_scalar T_IS_SMALLER_OR_EQUAL static_scalar { $$ = Expr\BinaryOp\SmallerOrEqual[$1, $3]; }
|
| 840 |
-
| static_scalar '>' static_scalar { $$ = Expr\BinaryOp\Greater [$1, $3]; }
|
| 841 |
-
| static_scalar T_IS_GREATER_OR_EQUAL static_scalar { $$ = Expr\BinaryOp\GreaterOrEqual[$1, $3]; }
|
| 842 |
-
| static_scalar '?' static_scalar ':' static_scalar { $$ = Expr\Ternary[$1, $3, $5]; }
|
| 843 |
-
| static_scalar '?' ':' static_scalar { $$ = Expr\Ternary[$1, null, $4]; }
|
| 844 |
-
| static_scalar '[' static_scalar ']' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 845 |
-
| '(' static_scalar ')' { $$ = $2; }
|
| 846 |
-
;
|
| 847 |
-
|
| 848 |
-
constant:
|
| 849 |
-
name { $$ = Expr\ConstFetch[$1]; }
|
| 850 |
-
| class_name_or_var T_PAAMAYIM_NEKUDOTAYIM identifier_ex
|
| 851 |
-
{ $$ = Expr\ClassConstFetch[$1, $3]; }
|
| 852 |
-
;
|
| 853 |
-
|
| 854 |
-
scalar:
|
| 855 |
-
common_scalar { $$ = $1; }
|
| 856 |
-
| constant { $$ = $1; }
|
| 857 |
-
| '"' encaps_list '"'
|
| 858 |
-
{ $attrs = attributes(); $attrs['kind'] = Scalar\String_::KIND_DOUBLE_QUOTED;
|
| 859 |
-
parseEncapsed($2, '"', true); $$ = new Scalar\Encapsed($2, $attrs); }
|
| 860 |
-
| T_START_HEREDOC encaps_list T_END_HEREDOC
|
| 861 |
-
{ $$ = $this->parseDocString($1, $2, $3, attributes(), stackAttributes(#3), true); }
|
| 862 |
-
;
|
| 863 |
-
|
| 864 |
-
static_array_pair_list:
|
| 865 |
-
/* empty */ { $$ = array(); }
|
| 866 |
-
| non_empty_static_array_pair_list optional_comma { $$ = $1; }
|
| 867 |
-
;
|
| 868 |
-
|
| 869 |
-
optional_comma:
|
| 870 |
-
/* empty */
|
| 871 |
-
| ','
|
| 872 |
-
;
|
| 873 |
-
|
| 874 |
-
non_empty_static_array_pair_list:
|
| 875 |
-
non_empty_static_array_pair_list ',' static_array_pair { push($1, $3); }
|
| 876 |
-
| static_array_pair { init($1); }
|
| 877 |
-
;
|
| 878 |
-
|
| 879 |
-
static_array_pair:
|
| 880 |
-
static_scalar T_DOUBLE_ARROW static_scalar { $$ = Expr\ArrayItem[$3, $1, false]; }
|
| 881 |
-
| static_scalar { $$ = Expr\ArrayItem[$1, null, false]; }
|
| 882 |
-
;
|
| 883 |
-
|
| 884 |
-
variable:
|
| 885 |
-
object_access { $$ = $1; }
|
| 886 |
-
| base_variable { $$ = $1; }
|
| 887 |
-
| function_call { $$ = $1; }
|
| 888 |
-
| new_expr_array_deref { $$ = $1; }
|
| 889 |
-
;
|
| 890 |
-
|
| 891 |
-
new_expr_array_deref:
|
| 892 |
-
'(' new_expr ')' '[' dim_offset ']' { $$ = Expr\ArrayDimFetch[$2, $5]; }
|
| 893 |
-
| new_expr_array_deref '[' dim_offset ']' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 894 |
-
/* alternative array syntax missing intentionally */
|
| 895 |
-
;
|
| 896 |
-
|
| 897 |
-
object_access:
|
| 898 |
-
variable_or_new_expr T_OBJECT_OPERATOR object_property
|
| 899 |
-
{ $$ = Expr\PropertyFetch[$1, $3]; }
|
| 900 |
-
| variable_or_new_expr T_OBJECT_OPERATOR object_property argument_list
|
| 901 |
-
{ $$ = Expr\MethodCall[$1, $3, $4]; }
|
| 902 |
-
| object_access argument_list { $$ = Expr\FuncCall[$1, $2]; }
|
| 903 |
-
| object_access '[' dim_offset ']' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 904 |
-
| object_access '{' expr '}' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 905 |
-
;
|
| 906 |
-
|
| 907 |
-
variable_or_new_expr:
|
| 908 |
-
variable { $$ = $1; }
|
| 909 |
-
| '(' new_expr ')' { $$ = $2; }
|
| 910 |
-
;
|
| 911 |
-
|
| 912 |
-
variable_without_objects:
|
| 913 |
-
reference_variable { $$ = $1; }
|
| 914 |
-
| '$' variable_without_objects { $$ = Expr\Variable[$2]; }
|
| 915 |
-
;
|
| 916 |
-
|
| 917 |
-
base_variable:
|
| 918 |
-
variable_without_objects { $$ = $1; }
|
| 919 |
-
| static_property { $$ = $1; }
|
| 920 |
-
;
|
| 921 |
-
|
| 922 |
-
static_property:
|
| 923 |
-
class_name_or_var T_PAAMAYIM_NEKUDOTAYIM '$' reference_variable
|
| 924 |
-
{ $$ = Expr\StaticPropertyFetch[$1, $4]; }
|
| 925 |
-
| static_property_with_arrays { $$ = $1; }
|
| 926 |
-
;
|
| 927 |
-
|
| 928 |
-
static_property_simple_name:
|
| 929 |
-
T_VARIABLE
|
| 930 |
-
{ $var = parseVar($1); $$ = \is_string($var) ? Node\VarLikeIdentifier[$var] : $var; }
|
| 931 |
-
;
|
| 932 |
-
|
| 933 |
-
static_property_with_arrays:
|
| 934 |
-
class_name_or_var T_PAAMAYIM_NEKUDOTAYIM static_property_simple_name
|
| 935 |
-
{ $$ = Expr\StaticPropertyFetch[$1, $3]; }
|
| 936 |
-
| class_name_or_var T_PAAMAYIM_NEKUDOTAYIM '$' '{' expr '}'
|
| 937 |
-
{ $$ = Expr\StaticPropertyFetch[$1, $5]; }
|
| 938 |
-
| static_property_with_arrays '[' dim_offset ']' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 939 |
-
| static_property_with_arrays '{' expr '}' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 940 |
-
;
|
| 941 |
-
|
| 942 |
-
reference_variable:
|
| 943 |
-
reference_variable '[' dim_offset ']' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 944 |
-
| reference_variable '{' expr '}' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 945 |
-
| plain_variable { $$ = $1; }
|
| 946 |
-
| '$' '{' expr '}' { $$ = Expr\Variable[$3]; }
|
| 947 |
-
;
|
| 948 |
-
|
| 949 |
-
dim_offset:
|
| 950 |
-
/* empty */ { $$ = null; }
|
| 951 |
-
| expr { $$ = $1; }
|
| 952 |
-
;
|
| 953 |
-
|
| 954 |
-
object_property:
|
| 955 |
-
identifier { $$ = $1; }
|
| 956 |
-
| '{' expr '}' { $$ = $2; }
|
| 957 |
-
| variable_without_objects { $$ = $1; }
|
| 958 |
-
| error { $$ = Expr\Error[]; $this->errorState = 2; }
|
| 959 |
-
;
|
| 960 |
-
|
| 961 |
-
list_expr:
|
| 962 |
-
T_LIST '(' list_expr_elements ')' { $$ = Expr\List_[$3]; }
|
| 963 |
-
;
|
| 964 |
-
|
| 965 |
-
list_expr_elements:
|
| 966 |
-
list_expr_elements ',' list_expr_element { push($1, $3); }
|
| 967 |
-
| list_expr_element { init($1); }
|
| 968 |
-
;
|
| 969 |
-
|
| 970 |
-
list_expr_element:
|
| 971 |
-
variable { $$ = Expr\ArrayItem[$1, null, false]; }
|
| 972 |
-
| list_expr { $$ = Expr\ArrayItem[$1, null, false]; }
|
| 973 |
-
| /* empty */ { $$ = null; }
|
| 974 |
-
;
|
| 975 |
-
|
| 976 |
-
array_pair_list:
|
| 977 |
-
/* empty */ { $$ = array(); }
|
| 978 |
-
| non_empty_array_pair_list optional_comma { $$ = $1; }
|
| 979 |
-
;
|
| 980 |
-
|
| 981 |
-
non_empty_array_pair_list:
|
| 982 |
-
non_empty_array_pair_list ',' array_pair { push($1, $3); }
|
| 983 |
-
| array_pair { init($1); }
|
| 984 |
-
;
|
| 985 |
-
|
| 986 |
-
array_pair:
|
| 987 |
-
expr T_DOUBLE_ARROW expr { $$ = Expr\ArrayItem[$3, $1, false]; }
|
| 988 |
-
| expr { $$ = Expr\ArrayItem[$1, null, false]; }
|
| 989 |
-
| expr T_DOUBLE_ARROW '&' variable { $$ = Expr\ArrayItem[$4, $1, true]; }
|
| 990 |
-
| '&' variable { $$ = Expr\ArrayItem[$2, null, true]; }
|
| 991 |
-
| T_ELLIPSIS expr { $$ = Expr\ArrayItem[$2, null, false, attributes(), true]; }
|
| 992 |
-
;
|
| 993 |
-
|
| 994 |
-
encaps_list:
|
| 995 |
-
encaps_list encaps_var { push($1, $2); }
|
| 996 |
-
| encaps_list encaps_string_part { push($1, $2); }
|
| 997 |
-
| encaps_var { init($1); }
|
| 998 |
-
| encaps_string_part encaps_var { init($1, $2); }
|
| 999 |
-
;
|
| 1000 |
-
|
| 1001 |
-
encaps_string_part:
|
| 1002 |
-
T_ENCAPSED_AND_WHITESPACE { $$ = Scalar\EncapsedStringPart[$1]; }
|
| 1003 |
-
;
|
| 1004 |
-
|
| 1005 |
-
encaps_str_varname:
|
| 1006 |
-
T_STRING_VARNAME { $$ = Expr\Variable[$1]; }
|
| 1007 |
-
;
|
| 1008 |
-
|
| 1009 |
-
encaps_var:
|
| 1010 |
-
plain_variable { $$ = $1; }
|
| 1011 |
-
| plain_variable '[' encaps_var_offset ']' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 1012 |
-
| plain_variable T_OBJECT_OPERATOR identifier { $$ = Expr\PropertyFetch[$1, $3]; }
|
| 1013 |
-
| T_DOLLAR_OPEN_CURLY_BRACES expr '}' { $$ = Expr\Variable[$2]; }
|
| 1014 |
-
| T_DOLLAR_OPEN_CURLY_BRACES T_STRING_VARNAME '}' { $$ = Expr\Variable[$2]; }
|
| 1015 |
-
| T_DOLLAR_OPEN_CURLY_BRACES encaps_str_varname '[' expr ']' '}'
|
| 1016 |
-
{ $$ = Expr\ArrayDimFetch[$2, $4]; }
|
| 1017 |
-
| T_CURLY_OPEN variable '}' { $$ = $2; }
|
| 1018 |
-
;
|
| 1019 |
-
|
| 1020 |
-
encaps_var_offset:
|
| 1021 |
-
T_STRING { $$ = Scalar\String_[$1]; }
|
| 1022 |
-
| T_NUM_STRING { $$ = $this->parseNumString($1, attributes()); }
|
| 1023 |
-
| plain_variable { $$ = $1; }
|
| 1024 |
-
;
|
| 1025 |
-
|
| 1026 |
-
%%
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/grammar/php7.y
DELETED
|
@@ -1,1036 +0,0 @@
|
|
| 1 |
-
%pure_parser
|
| 2 |
-
%expect 2
|
| 3 |
-
|
| 4 |
-
%tokens
|
| 5 |
-
|
| 6 |
-
%%
|
| 7 |
-
|
| 8 |
-
start:
|
| 9 |
-
top_statement_list { $$ = $this->handleNamespaces($1); }
|
| 10 |
-
;
|
| 11 |
-
|
| 12 |
-
top_statement_list_ex:
|
| 13 |
-
top_statement_list_ex top_statement { pushNormalizing($1, $2); }
|
| 14 |
-
| /* empty */ { init(); }
|
| 15 |
-
;
|
| 16 |
-
|
| 17 |
-
top_statement_list:
|
| 18 |
-
top_statement_list_ex
|
| 19 |
-
{ makeZeroLengthNop($nop, $this->lookaheadStartAttributes);
|
| 20 |
-
if ($nop !== null) { $1[] = $nop; } $$ = $1; }
|
| 21 |
-
;
|
| 22 |
-
|
| 23 |
-
reserved_non_modifiers:
|
| 24 |
-
T_INCLUDE | T_INCLUDE_ONCE | T_EVAL | T_REQUIRE | T_REQUIRE_ONCE | T_LOGICAL_OR | T_LOGICAL_XOR | T_LOGICAL_AND
|
| 25 |
-
| T_INSTANCEOF | T_NEW | T_CLONE | T_EXIT | T_IF | T_ELSEIF | T_ELSE | T_ENDIF | T_ECHO | T_DO | T_WHILE
|
| 26 |
-
| T_ENDWHILE | T_FOR | T_ENDFOR | T_FOREACH | T_ENDFOREACH | T_DECLARE | T_ENDDECLARE | T_AS | T_TRY | T_CATCH
|
| 27 |
-
| T_FINALLY | T_THROW | T_USE | T_INSTEADOF | T_GLOBAL | T_VAR | T_UNSET | T_ISSET | T_EMPTY | T_CONTINUE | T_GOTO
|
| 28 |
-
| T_FUNCTION | T_CONST | T_RETURN | T_PRINT | T_YIELD | T_LIST | T_SWITCH | T_ENDSWITCH | T_CASE | T_DEFAULT
|
| 29 |
-
| T_BREAK | T_ARRAY | T_CALLABLE | T_EXTENDS | T_IMPLEMENTS | T_NAMESPACE | T_TRAIT | T_INTERFACE | T_CLASS
|
| 30 |
-
| T_CLASS_C | T_TRAIT_C | T_FUNC_C | T_METHOD_C | T_LINE | T_FILE | T_DIR | T_NS_C | T_HALT_COMPILER | T_FN
|
| 31 |
-
;
|
| 32 |
-
|
| 33 |
-
semi_reserved:
|
| 34 |
-
reserved_non_modifiers
|
| 35 |
-
| T_STATIC | T_ABSTRACT | T_FINAL | T_PRIVATE | T_PROTECTED | T_PUBLIC
|
| 36 |
-
;
|
| 37 |
-
|
| 38 |
-
identifier_ex:
|
| 39 |
-
T_STRING { $$ = Node\Identifier[$1]; }
|
| 40 |
-
| semi_reserved { $$ = Node\Identifier[$1]; }
|
| 41 |
-
;
|
| 42 |
-
|
| 43 |
-
identifier:
|
| 44 |
-
T_STRING { $$ = Node\Identifier[$1]; }
|
| 45 |
-
;
|
| 46 |
-
|
| 47 |
-
reserved_non_modifiers_identifier:
|
| 48 |
-
reserved_non_modifiers { $$ = Node\Identifier[$1]; }
|
| 49 |
-
;
|
| 50 |
-
|
| 51 |
-
namespace_name_parts:
|
| 52 |
-
T_STRING { init($1); }
|
| 53 |
-
| namespace_name_parts T_NS_SEPARATOR T_STRING { push($1, $3); }
|
| 54 |
-
;
|
| 55 |
-
|
| 56 |
-
namespace_name:
|
| 57 |
-
namespace_name_parts { $$ = Name[$1]; }
|
| 58 |
-
;
|
| 59 |
-
|
| 60 |
-
plain_variable:
|
| 61 |
-
T_VARIABLE { $$ = Expr\Variable[parseVar($1)]; }
|
| 62 |
-
;
|
| 63 |
-
|
| 64 |
-
semi:
|
| 65 |
-
';' { /* nothing */ }
|
| 66 |
-
| error { /* nothing */ }
|
| 67 |
-
;
|
| 68 |
-
|
| 69 |
-
no_comma:
|
| 70 |
-
/* empty */ { /* nothing */ }
|
| 71 |
-
| ',' { $this->emitError(new Error('A trailing comma is not allowed here', attributes())); }
|
| 72 |
-
;
|
| 73 |
-
|
| 74 |
-
optional_comma:
|
| 75 |
-
/* empty */
|
| 76 |
-
| ','
|
| 77 |
-
|
| 78 |
-
top_statement:
|
| 79 |
-
statement { $$ = $1; }
|
| 80 |
-
| function_declaration_statement { $$ = $1; }
|
| 81 |
-
| class_declaration_statement { $$ = $1; }
|
| 82 |
-
| T_HALT_COMPILER
|
| 83 |
-
{ $$ = Stmt\HaltCompiler[$this->lexer->handleHaltCompiler()]; }
|
| 84 |
-
| T_NAMESPACE namespace_name semi
|
| 85 |
-
{ $$ = Stmt\Namespace_[$2, null];
|
| 86 |
-
$$->setAttribute('kind', Stmt\Namespace_::KIND_SEMICOLON);
|
| 87 |
-
$this->checkNamespace($$); }
|
| 88 |
-
| T_NAMESPACE namespace_name '{' top_statement_list '}'
|
| 89 |
-
{ $$ = Stmt\Namespace_[$2, $4];
|
| 90 |
-
$$->setAttribute('kind', Stmt\Namespace_::KIND_BRACED);
|
| 91 |
-
$this->checkNamespace($$); }
|
| 92 |
-
| T_NAMESPACE '{' top_statement_list '}'
|
| 93 |
-
{ $$ = Stmt\Namespace_[null, $3];
|
| 94 |
-
$$->setAttribute('kind', Stmt\Namespace_::KIND_BRACED);
|
| 95 |
-
$this->checkNamespace($$); }
|
| 96 |
-
| T_USE use_declarations semi { $$ = Stmt\Use_[$2, Stmt\Use_::TYPE_NORMAL]; }
|
| 97 |
-
| T_USE use_type use_declarations semi { $$ = Stmt\Use_[$3, $2]; }
|
| 98 |
-
| group_use_declaration semi { $$ = $1; }
|
| 99 |
-
| T_CONST constant_declaration_list semi { $$ = Stmt\Const_[$2]; }
|
| 100 |
-
;
|
| 101 |
-
|
| 102 |
-
use_type:
|
| 103 |
-
T_FUNCTION { $$ = Stmt\Use_::TYPE_FUNCTION; }
|
| 104 |
-
| T_CONST { $$ = Stmt\Use_::TYPE_CONSTANT; }
|
| 105 |
-
;
|
| 106 |
-
|
| 107 |
-
/* Using namespace_name_parts here to avoid s/r conflict on T_NS_SEPARATOR */
|
| 108 |
-
group_use_declaration:
|
| 109 |
-
T_USE use_type namespace_name_parts T_NS_SEPARATOR '{' unprefixed_use_declarations '}'
|
| 110 |
-
{ $$ = Stmt\GroupUse[new Name($3, stackAttributes(#3)), $6, $2]; }
|
| 111 |
-
| T_USE use_type T_NS_SEPARATOR namespace_name_parts T_NS_SEPARATOR '{' unprefixed_use_declarations '}'
|
| 112 |
-
{ $$ = Stmt\GroupUse[new Name($4, stackAttributes(#4)), $7, $2]; }
|
| 113 |
-
| T_USE namespace_name_parts T_NS_SEPARATOR '{' inline_use_declarations '}'
|
| 114 |
-
{ $$ = Stmt\GroupUse[new Name($2, stackAttributes(#2)), $5, Stmt\Use_::TYPE_UNKNOWN]; }
|
| 115 |
-
| T_USE T_NS_SEPARATOR namespace_name_parts T_NS_SEPARATOR '{' inline_use_declarations '}'
|
| 116 |
-
{ $$ = Stmt\GroupUse[new Name($3, stackAttributes(#3)), $6, Stmt\Use_::TYPE_UNKNOWN]; }
|
| 117 |
-
;
|
| 118 |
-
|
| 119 |
-
unprefixed_use_declarations:
|
| 120 |
-
non_empty_unprefixed_use_declarations optional_comma { $$ = $1; }
|
| 121 |
-
;
|
| 122 |
-
|
| 123 |
-
non_empty_unprefixed_use_declarations:
|
| 124 |
-
non_empty_unprefixed_use_declarations ',' unprefixed_use_declaration
|
| 125 |
-
{ push($1, $3); }
|
| 126 |
-
| unprefixed_use_declaration { init($1); }
|
| 127 |
-
;
|
| 128 |
-
|
| 129 |
-
use_declarations:
|
| 130 |
-
non_empty_use_declarations no_comma { $$ = $1; }
|
| 131 |
-
;
|
| 132 |
-
|
| 133 |
-
non_empty_use_declarations:
|
| 134 |
-
non_empty_use_declarations ',' use_declaration { push($1, $3); }
|
| 135 |
-
| use_declaration { init($1); }
|
| 136 |
-
;
|
| 137 |
-
|
| 138 |
-
inline_use_declarations:
|
| 139 |
-
non_empty_inline_use_declarations optional_comma { $$ = $1; }
|
| 140 |
-
;
|
| 141 |
-
|
| 142 |
-
non_empty_inline_use_declarations:
|
| 143 |
-
non_empty_inline_use_declarations ',' inline_use_declaration
|
| 144 |
-
{ push($1, $3); }
|
| 145 |
-
| inline_use_declaration { init($1); }
|
| 146 |
-
;
|
| 147 |
-
|
| 148 |
-
unprefixed_use_declaration:
|
| 149 |
-
namespace_name
|
| 150 |
-
{ $$ = Stmt\UseUse[$1, null, Stmt\Use_::TYPE_UNKNOWN]; $this->checkUseUse($$, #1); }
|
| 151 |
-
| namespace_name T_AS identifier
|
| 152 |
-
{ $$ = Stmt\UseUse[$1, $3, Stmt\Use_::TYPE_UNKNOWN]; $this->checkUseUse($$, #3); }
|
| 153 |
-
;
|
| 154 |
-
|
| 155 |
-
use_declaration:
|
| 156 |
-
unprefixed_use_declaration { $$ = $1; }
|
| 157 |
-
| T_NS_SEPARATOR unprefixed_use_declaration { $$ = $2; }
|
| 158 |
-
;
|
| 159 |
-
|
| 160 |
-
inline_use_declaration:
|
| 161 |
-
unprefixed_use_declaration { $$ = $1; $$->type = Stmt\Use_::TYPE_NORMAL; }
|
| 162 |
-
| use_type unprefixed_use_declaration { $$ = $2; $$->type = $1; }
|
| 163 |
-
;
|
| 164 |
-
|
| 165 |
-
constant_declaration_list:
|
| 166 |
-
non_empty_constant_declaration_list no_comma { $$ = $1; }
|
| 167 |
-
;
|
| 168 |
-
|
| 169 |
-
non_empty_constant_declaration_list:
|
| 170 |
-
non_empty_constant_declaration_list ',' constant_declaration
|
| 171 |
-
{ push($1, $3); }
|
| 172 |
-
| constant_declaration { init($1); }
|
| 173 |
-
;
|
| 174 |
-
|
| 175 |
-
constant_declaration:
|
| 176 |
-
identifier '=' expr { $$ = Node\Const_[$1, $3]; }
|
| 177 |
-
;
|
| 178 |
-
|
| 179 |
-
class_const_list:
|
| 180 |
-
non_empty_class_const_list no_comma { $$ = $1; }
|
| 181 |
-
;
|
| 182 |
-
|
| 183 |
-
non_empty_class_const_list:
|
| 184 |
-
non_empty_class_const_list ',' class_const { push($1, $3); }
|
| 185 |
-
| class_const { init($1); }
|
| 186 |
-
;
|
| 187 |
-
|
| 188 |
-
class_const:
|
| 189 |
-
identifier_ex '=' expr { $$ = Node\Const_[$1, $3]; }
|
| 190 |
-
;
|
| 191 |
-
|
| 192 |
-
inner_statement_list_ex:
|
| 193 |
-
inner_statement_list_ex inner_statement { pushNormalizing($1, $2); }
|
| 194 |
-
| /* empty */ { init(); }
|
| 195 |
-
;
|
| 196 |
-
|
| 197 |
-
inner_statement_list:
|
| 198 |
-
inner_statement_list_ex
|
| 199 |
-
{ makeZeroLengthNop($nop, $this->lookaheadStartAttributes);
|
| 200 |
-
if ($nop !== null) { $1[] = $nop; } $$ = $1; }
|
| 201 |
-
;
|
| 202 |
-
|
| 203 |
-
inner_statement:
|
| 204 |
-
statement { $$ = $1; }
|
| 205 |
-
| function_declaration_statement { $$ = $1; }
|
| 206 |
-
| class_declaration_statement { $$ = $1; }
|
| 207 |
-
| T_HALT_COMPILER
|
| 208 |
-
{ throw new Error('__HALT_COMPILER() can only be used from the outermost scope', attributes()); }
|
| 209 |
-
;
|
| 210 |
-
|
| 211 |
-
non_empty_statement:
|
| 212 |
-
'{' inner_statement_list '}'
|
| 213 |
-
{
|
| 214 |
-
if ($2) {
|
| 215 |
-
$$ = $2; prependLeadingComments($$);
|
| 216 |
-
} else {
|
| 217 |
-
makeNop($$, $this->startAttributeStack[#1], $this->endAttributes);
|
| 218 |
-
if (null === $$) { $$ = array(); }
|
| 219 |
-
}
|
| 220 |
-
}
|
| 221 |
-
| T_IF '(' expr ')' statement elseif_list else_single
|
| 222 |
-
{ $$ = Stmt\If_[$3, ['stmts' => toArray($5), 'elseifs' => $6, 'else' => $7]]; }
|
| 223 |
-
| T_IF '(' expr ')' ':' inner_statement_list new_elseif_list new_else_single T_ENDIF ';'
|
| 224 |
-
{ $$ = Stmt\If_[$3, ['stmts' => $6, 'elseifs' => $7, 'else' => $8]]; }
|
| 225 |
-
| T_WHILE '(' expr ')' while_statement { $$ = Stmt\While_[$3, $5]; }
|
| 226 |
-
| T_DO statement T_WHILE '(' expr ')' ';' { $$ = Stmt\Do_ [$5, toArray($2)]; }
|
| 227 |
-
| T_FOR '(' for_expr ';' for_expr ';' for_expr ')' for_statement
|
| 228 |
-
{ $$ = Stmt\For_[['init' => $3, 'cond' => $5, 'loop' => $7, 'stmts' => $9]]; }
|
| 229 |
-
| T_SWITCH '(' expr ')' switch_case_list { $$ = Stmt\Switch_[$3, $5]; }
|
| 230 |
-
| T_BREAK optional_expr semi { $$ = Stmt\Break_[$2]; }
|
| 231 |
-
| T_CONTINUE optional_expr semi { $$ = Stmt\Continue_[$2]; }
|
| 232 |
-
| T_RETURN optional_expr semi { $$ = Stmt\Return_[$2]; }
|
| 233 |
-
| T_GLOBAL global_var_list semi { $$ = Stmt\Global_[$2]; }
|
| 234 |
-
| T_STATIC static_var_list semi { $$ = Stmt\Static_[$2]; }
|
| 235 |
-
| T_ECHO expr_list_forbid_comma semi { $$ = Stmt\Echo_[$2]; }
|
| 236 |
-
| T_INLINE_HTML { $$ = Stmt\InlineHTML[$1]; }
|
| 237 |
-
| expr semi { $$ = Stmt\Expression[$1]; }
|
| 238 |
-
| T_UNSET '(' variables_list ')' semi { $$ = Stmt\Unset_[$3]; }
|
| 239 |
-
| T_FOREACH '(' expr T_AS foreach_variable ')' foreach_statement
|
| 240 |
-
{ $$ = Stmt\Foreach_[$3, $5[0], ['keyVar' => null, 'byRef' => $5[1], 'stmts' => $7]]; }
|
| 241 |
-
| T_FOREACH '(' expr T_AS variable T_DOUBLE_ARROW foreach_variable ')' foreach_statement
|
| 242 |
-
{ $$ = Stmt\Foreach_[$3, $7[0], ['keyVar' => $5, 'byRef' => $7[1], 'stmts' => $9]]; }
|
| 243 |
-
| T_FOREACH '(' expr error ')' foreach_statement
|
| 244 |
-
{ $$ = Stmt\Foreach_[$3, new Expr\Error(stackAttributes(#4)), ['stmts' => $6]]; }
|
| 245 |
-
| T_DECLARE '(' declare_list ')' declare_statement { $$ = Stmt\Declare_[$3, $5]; }
|
| 246 |
-
| T_TRY '{' inner_statement_list '}' catches optional_finally
|
| 247 |
-
{ $$ = Stmt\TryCatch[$3, $5, $6]; $this->checkTryCatch($$); }
|
| 248 |
-
| T_THROW expr semi { $$ = Stmt\Throw_[$2]; }
|
| 249 |
-
| T_GOTO identifier semi { $$ = Stmt\Goto_[$2]; }
|
| 250 |
-
| identifier ':' { $$ = Stmt\Label[$1]; }
|
| 251 |
-
| error { $$ = array(); /* means: no statement */ }
|
| 252 |
-
;
|
| 253 |
-
|
| 254 |
-
statement:
|
| 255 |
-
non_empty_statement { $$ = $1; }
|
| 256 |
-
| ';'
|
| 257 |
-
{ makeNop($$, $this->startAttributeStack[#1], $this->endAttributes);
|
| 258 |
-
if ($$ === null) $$ = array(); /* means: no statement */ }
|
| 259 |
-
;
|
| 260 |
-
|
| 261 |
-
catches:
|
| 262 |
-
/* empty */ { init(); }
|
| 263 |
-
| catches catch { push($1, $2); }
|
| 264 |
-
;
|
| 265 |
-
|
| 266 |
-
name_union:
|
| 267 |
-
name { init($1); }
|
| 268 |
-
| name_union '|' name { push($1, $3); }
|
| 269 |
-
;
|
| 270 |
-
|
| 271 |
-
catch:
|
| 272 |
-
T_CATCH '(' name_union optional_plain_variable ')' '{' inner_statement_list '}'
|
| 273 |
-
{ $$ = Stmt\Catch_[$3, $4, $7]; }
|
| 274 |
-
;
|
| 275 |
-
|
| 276 |
-
optional_finally:
|
| 277 |
-
/* empty */ { $$ = null; }
|
| 278 |
-
| T_FINALLY '{' inner_statement_list '}' { $$ = Stmt\Finally_[$3]; }
|
| 279 |
-
;
|
| 280 |
-
|
| 281 |
-
variables_list:
|
| 282 |
-
non_empty_variables_list optional_comma { $$ = $1; }
|
| 283 |
-
;
|
| 284 |
-
|
| 285 |
-
non_empty_variables_list:
|
| 286 |
-
variable { init($1); }
|
| 287 |
-
| non_empty_variables_list ',' variable { push($1, $3); }
|
| 288 |
-
;
|
| 289 |
-
|
| 290 |
-
optional_ref:
|
| 291 |
-
/* empty */ { $$ = false; }
|
| 292 |
-
| '&' { $$ = true; }
|
| 293 |
-
;
|
| 294 |
-
|
| 295 |
-
optional_ellipsis:
|
| 296 |
-
/* empty */ { $$ = false; }
|
| 297 |
-
| T_ELLIPSIS { $$ = true; }
|
| 298 |
-
;
|
| 299 |
-
|
| 300 |
-
block_or_error:
|
| 301 |
-
'{' inner_statement_list '}' { $$ = $2; }
|
| 302 |
-
| error { $$ = []; }
|
| 303 |
-
;
|
| 304 |
-
|
| 305 |
-
function_declaration_statement:
|
| 306 |
-
T_FUNCTION optional_ref identifier '(' parameter_list ')' optional_return_type block_or_error
|
| 307 |
-
{ $$ = Stmt\Function_[$3, ['byRef' => $2, 'params' => $5, 'returnType' => $7, 'stmts' => $8]]; }
|
| 308 |
-
;
|
| 309 |
-
|
| 310 |
-
class_declaration_statement:
|
| 311 |
-
class_entry_type identifier extends_from implements_list '{' class_statement_list '}'
|
| 312 |
-
{ $$ = Stmt\Class_[$2, ['type' => $1, 'extends' => $3, 'implements' => $4, 'stmts' => $6]];
|
| 313 |
-
$this->checkClass($$, #2); }
|
| 314 |
-
| T_INTERFACE identifier interface_extends_list '{' class_statement_list '}'
|
| 315 |
-
{ $$ = Stmt\Interface_[$2, ['extends' => $3, 'stmts' => $5]];
|
| 316 |
-
$this->checkInterface($$, #2); }
|
| 317 |
-
| T_TRAIT identifier '{' class_statement_list '}'
|
| 318 |
-
{ $$ = Stmt\Trait_[$2, ['stmts' => $4]]; }
|
| 319 |
-
;
|
| 320 |
-
|
| 321 |
-
class_entry_type:
|
| 322 |
-
T_CLASS { $$ = 0; }
|
| 323 |
-
| T_ABSTRACT T_CLASS { $$ = Stmt\Class_::MODIFIER_ABSTRACT; }
|
| 324 |
-
| T_FINAL T_CLASS { $$ = Stmt\Class_::MODIFIER_FINAL; }
|
| 325 |
-
;
|
| 326 |
-
|
| 327 |
-
extends_from:
|
| 328 |
-
/* empty */ { $$ = null; }
|
| 329 |
-
| T_EXTENDS class_name { $$ = $2; }
|
| 330 |
-
;
|
| 331 |
-
|
| 332 |
-
interface_extends_list:
|
| 333 |
-
/* empty */ { $$ = array(); }
|
| 334 |
-
| T_EXTENDS class_name_list { $$ = $2; }
|
| 335 |
-
;
|
| 336 |
-
|
| 337 |
-
implements_list:
|
| 338 |
-
/* empty */ { $$ = array(); }
|
| 339 |
-
| T_IMPLEMENTS class_name_list { $$ = $2; }
|
| 340 |
-
;
|
| 341 |
-
|
| 342 |
-
class_name_list:
|
| 343 |
-
non_empty_class_name_list no_comma { $$ = $1; }
|
| 344 |
-
;
|
| 345 |
-
|
| 346 |
-
non_empty_class_name_list:
|
| 347 |
-
class_name { init($1); }
|
| 348 |
-
| non_empty_class_name_list ',' class_name { push($1, $3); }
|
| 349 |
-
;
|
| 350 |
-
|
| 351 |
-
for_statement:
|
| 352 |
-
statement { $$ = toArray($1); }
|
| 353 |
-
| ':' inner_statement_list T_ENDFOR ';' { $$ = $2; }
|
| 354 |
-
;
|
| 355 |
-
|
| 356 |
-
foreach_statement:
|
| 357 |
-
statement { $$ = toArray($1); }
|
| 358 |
-
| ':' inner_statement_list T_ENDFOREACH ';' { $$ = $2; }
|
| 359 |
-
;
|
| 360 |
-
|
| 361 |
-
declare_statement:
|
| 362 |
-
non_empty_statement { $$ = toArray($1); }
|
| 363 |
-
| ';' { $$ = null; }
|
| 364 |
-
| ':' inner_statement_list T_ENDDECLARE ';' { $$ = $2; }
|
| 365 |
-
;
|
| 366 |
-
|
| 367 |
-
declare_list:
|
| 368 |
-
non_empty_declare_list no_comma { $$ = $1; }
|
| 369 |
-
;
|
| 370 |
-
|
| 371 |
-
non_empty_declare_list:
|
| 372 |
-
declare_list_element { init($1); }
|
| 373 |
-
| non_empty_declare_list ',' declare_list_element { push($1, $3); }
|
| 374 |
-
;
|
| 375 |
-
|
| 376 |
-
declare_list_element:
|
| 377 |
-
identifier '=' expr { $$ = Stmt\DeclareDeclare[$1, $3]; }
|
| 378 |
-
;
|
| 379 |
-
|
| 380 |
-
switch_case_list:
|
| 381 |
-
'{' case_list '}' { $$ = $2; }
|
| 382 |
-
| '{' ';' case_list '}' { $$ = $3; }
|
| 383 |
-
| ':' case_list T_ENDSWITCH ';' { $$ = $2; }
|
| 384 |
-
| ':' ';' case_list T_ENDSWITCH ';' { $$ = $3; }
|
| 385 |
-
;
|
| 386 |
-
|
| 387 |
-
case_list:
|
| 388 |
-
/* empty */ { init(); }
|
| 389 |
-
| case_list case { push($1, $2); }
|
| 390 |
-
;
|
| 391 |
-
|
| 392 |
-
case:
|
| 393 |
-
T_CASE expr case_separator inner_statement_list_ex { $$ = Stmt\Case_[$2, $4]; }
|
| 394 |
-
| T_DEFAULT case_separator inner_statement_list_ex { $$ = Stmt\Case_[null, $3]; }
|
| 395 |
-
;
|
| 396 |
-
|
| 397 |
-
case_separator:
|
| 398 |
-
':'
|
| 399 |
-
| ';'
|
| 400 |
-
;
|
| 401 |
-
|
| 402 |
-
while_statement:
|
| 403 |
-
statement { $$ = toArray($1); }
|
| 404 |
-
| ':' inner_statement_list T_ENDWHILE ';' { $$ = $2; }
|
| 405 |
-
;
|
| 406 |
-
|
| 407 |
-
elseif_list:
|
| 408 |
-
/* empty */ { init(); }
|
| 409 |
-
| elseif_list elseif { push($1, $2); }
|
| 410 |
-
;
|
| 411 |
-
|
| 412 |
-
elseif:
|
| 413 |
-
T_ELSEIF '(' expr ')' statement { $$ = Stmt\ElseIf_[$3, toArray($5)]; }
|
| 414 |
-
;
|
| 415 |
-
|
| 416 |
-
new_elseif_list:
|
| 417 |
-
/* empty */ { init(); }
|
| 418 |
-
| new_elseif_list new_elseif { push($1, $2); }
|
| 419 |
-
;
|
| 420 |
-
|
| 421 |
-
new_elseif:
|
| 422 |
-
T_ELSEIF '(' expr ')' ':' inner_statement_list { $$ = Stmt\ElseIf_[$3, $6]; }
|
| 423 |
-
;
|
| 424 |
-
|
| 425 |
-
else_single:
|
| 426 |
-
/* empty */ { $$ = null; }
|
| 427 |
-
| T_ELSE statement { $$ = Stmt\Else_[toArray($2)]; }
|
| 428 |
-
;
|
| 429 |
-
|
| 430 |
-
new_else_single:
|
| 431 |
-
/* empty */ { $$ = null; }
|
| 432 |
-
| T_ELSE ':' inner_statement_list { $$ = Stmt\Else_[$3]; }
|
| 433 |
-
;
|
| 434 |
-
|
| 435 |
-
foreach_variable:
|
| 436 |
-
variable { $$ = array($1, false); }
|
| 437 |
-
| '&' variable { $$ = array($2, true); }
|
| 438 |
-
| list_expr { $$ = array($1, false); }
|
| 439 |
-
| array_short_syntax { $$ = array($1, false); }
|
| 440 |
-
;
|
| 441 |
-
|
| 442 |
-
parameter_list:
|
| 443 |
-
non_empty_parameter_list no_comma { $$ = $1; }
|
| 444 |
-
| /* empty */ { $$ = array(); }
|
| 445 |
-
;
|
| 446 |
-
|
| 447 |
-
non_empty_parameter_list:
|
| 448 |
-
parameter { init($1); }
|
| 449 |
-
| non_empty_parameter_list ',' parameter { push($1, $3); }
|
| 450 |
-
;
|
| 451 |
-
|
| 452 |
-
parameter:
|
| 453 |
-
optional_type optional_ref optional_ellipsis plain_variable
|
| 454 |
-
{ $$ = Node\Param[$4, null, $1, $2, $3]; $this->checkParam($$); }
|
| 455 |
-
| optional_type optional_ref optional_ellipsis plain_variable '=' expr
|
| 456 |
-
{ $$ = Node\Param[$4, $6, $1, $2, $3]; $this->checkParam($$); }
|
| 457 |
-
| optional_type optional_ref optional_ellipsis error
|
| 458 |
-
{ $$ = Node\Param[Expr\Error[], null, $1, $2, $3]; }
|
| 459 |
-
;
|
| 460 |
-
|
| 461 |
-
type_expr:
|
| 462 |
-
type { $$ = $1; }
|
| 463 |
-
| '?' type { $$ = Node\NullableType[$2]; }
|
| 464 |
-
| union_type { $$ = Node\UnionType[$1]; }
|
| 465 |
-
;
|
| 466 |
-
|
| 467 |
-
type:
|
| 468 |
-
name { $$ = $this->handleBuiltinTypes($1); }
|
| 469 |
-
| T_ARRAY { $$ = Node\Identifier['array']; }
|
| 470 |
-
| T_CALLABLE { $$ = Node\Identifier['callable']; }
|
| 471 |
-
;
|
| 472 |
-
|
| 473 |
-
union_type:
|
| 474 |
-
type '|' type { init($1, $3); }
|
| 475 |
-
| union_type '|' type { push($1, $3); }
|
| 476 |
-
;
|
| 477 |
-
|
| 478 |
-
optional_type:
|
| 479 |
-
/* empty */ { $$ = null; }
|
| 480 |
-
| type_expr { $$ = $1; }
|
| 481 |
-
;
|
| 482 |
-
|
| 483 |
-
optional_return_type:
|
| 484 |
-
/* empty */ { $$ = null; }
|
| 485 |
-
| ':' type_expr { $$ = $2; }
|
| 486 |
-
| ':' error { $$ = null; }
|
| 487 |
-
;
|
| 488 |
-
|
| 489 |
-
argument_list:
|
| 490 |
-
'(' ')' { $$ = array(); }
|
| 491 |
-
| '(' non_empty_argument_list optional_comma ')' { $$ = $2; }
|
| 492 |
-
;
|
| 493 |
-
|
| 494 |
-
non_empty_argument_list:
|
| 495 |
-
argument { init($1); }
|
| 496 |
-
| non_empty_argument_list ',' argument { push($1, $3); }
|
| 497 |
-
;
|
| 498 |
-
|
| 499 |
-
argument:
|
| 500 |
-
expr { $$ = Node\Arg[$1, false, false]; }
|
| 501 |
-
| '&' variable { $$ = Node\Arg[$2, true, false]; }
|
| 502 |
-
| T_ELLIPSIS expr { $$ = Node\Arg[$2, false, true]; }
|
| 503 |
-
;
|
| 504 |
-
|
| 505 |
-
global_var_list:
|
| 506 |
-
non_empty_global_var_list no_comma { $$ = $1; }
|
| 507 |
-
;
|
| 508 |
-
|
| 509 |
-
non_empty_global_var_list:
|
| 510 |
-
non_empty_global_var_list ',' global_var { push($1, $3); }
|
| 511 |
-
| global_var { init($1); }
|
| 512 |
-
;
|
| 513 |
-
|
| 514 |
-
global_var:
|
| 515 |
-
simple_variable { $$ = Expr\Variable[$1]; }
|
| 516 |
-
;
|
| 517 |
-
|
| 518 |
-
static_var_list:
|
| 519 |
-
non_empty_static_var_list no_comma { $$ = $1; }
|
| 520 |
-
;
|
| 521 |
-
|
| 522 |
-
non_empty_static_var_list:
|
| 523 |
-
non_empty_static_var_list ',' static_var { push($1, $3); }
|
| 524 |
-
| static_var { init($1); }
|
| 525 |
-
;
|
| 526 |
-
|
| 527 |
-
static_var:
|
| 528 |
-
plain_variable { $$ = Stmt\StaticVar[$1, null]; }
|
| 529 |
-
| plain_variable '=' expr { $$ = Stmt\StaticVar[$1, $3]; }
|
| 530 |
-
;
|
| 531 |
-
|
| 532 |
-
class_statement_list_ex:
|
| 533 |
-
class_statement_list_ex class_statement { if ($2 !== null) { push($1, $2); } }
|
| 534 |
-
| /* empty */ { init(); }
|
| 535 |
-
;
|
| 536 |
-
|
| 537 |
-
class_statement_list:
|
| 538 |
-
class_statement_list_ex
|
| 539 |
-
{ makeZeroLengthNop($nop, $this->lookaheadStartAttributes);
|
| 540 |
-
if ($nop !== null) { $1[] = $nop; } $$ = $1; }
|
| 541 |
-
;
|
| 542 |
-
|
| 543 |
-
class_statement:
|
| 544 |
-
variable_modifiers optional_type property_declaration_list ';'
|
| 545 |
-
{ $attrs = attributes();
|
| 546 |
-
$$ = new Stmt\Property($1, $3, $attrs, $2); $this->checkProperty($$, #1); }
|
| 547 |
-
| method_modifiers T_CONST class_const_list ';'
|
| 548 |
-
{ $$ = Stmt\ClassConst[$3, $1]; $this->checkClassConst($$, #1); }
|
| 549 |
-
| method_modifiers T_FUNCTION optional_ref identifier_ex '(' parameter_list ')' optional_return_type method_body
|
| 550 |
-
{ $$ = Stmt\ClassMethod[$4, ['type' => $1, 'byRef' => $3, 'params' => $6, 'returnType' => $8, 'stmts' => $9]];
|
| 551 |
-
$this->checkClassMethod($$, #1); }
|
| 552 |
-
| T_USE class_name_list trait_adaptations { $$ = Stmt\TraitUse[$2, $3]; }
|
| 553 |
-
| error { $$ = null; /* will be skipped */ }
|
| 554 |
-
;
|
| 555 |
-
|
| 556 |
-
trait_adaptations:
|
| 557 |
-
';' { $$ = array(); }
|
| 558 |
-
| '{' trait_adaptation_list '}' { $$ = $2; }
|
| 559 |
-
;
|
| 560 |
-
|
| 561 |
-
trait_adaptation_list:
|
| 562 |
-
/* empty */ { init(); }
|
| 563 |
-
| trait_adaptation_list trait_adaptation { push($1, $2); }
|
| 564 |
-
;
|
| 565 |
-
|
| 566 |
-
trait_adaptation:
|
| 567 |
-
trait_method_reference_fully_qualified T_INSTEADOF class_name_list ';'
|
| 568 |
-
{ $$ = Stmt\TraitUseAdaptation\Precedence[$1[0], $1[1], $3]; }
|
| 569 |
-
| trait_method_reference T_AS member_modifier identifier_ex ';'
|
| 570 |
-
{ $$ = Stmt\TraitUseAdaptation\Alias[$1[0], $1[1], $3, $4]; }
|
| 571 |
-
| trait_method_reference T_AS member_modifier ';'
|
| 572 |
-
{ $$ = Stmt\TraitUseAdaptation\Alias[$1[0], $1[1], $3, null]; }
|
| 573 |
-
| trait_method_reference T_AS identifier ';'
|
| 574 |
-
{ $$ = Stmt\TraitUseAdaptation\Alias[$1[0], $1[1], null, $3]; }
|
| 575 |
-
| trait_method_reference T_AS reserved_non_modifiers_identifier ';'
|
| 576 |
-
{ $$ = Stmt\TraitUseAdaptation\Alias[$1[0], $1[1], null, $3]; }
|
| 577 |
-
;
|
| 578 |
-
|
| 579 |
-
trait_method_reference_fully_qualified:
|
| 580 |
-
name T_PAAMAYIM_NEKUDOTAYIM identifier_ex { $$ = array($1, $3); }
|
| 581 |
-
;
|
| 582 |
-
trait_method_reference:
|
| 583 |
-
trait_method_reference_fully_qualified { $$ = $1; }
|
| 584 |
-
| identifier_ex { $$ = array(null, $1); }
|
| 585 |
-
;
|
| 586 |
-
|
| 587 |
-
method_body:
|
| 588 |
-
';' /* abstract method */ { $$ = null; }
|
| 589 |
-
| block_or_error { $$ = $1; }
|
| 590 |
-
;
|
| 591 |
-
|
| 592 |
-
variable_modifiers:
|
| 593 |
-
non_empty_member_modifiers { $$ = $1; }
|
| 594 |
-
| T_VAR { $$ = 0; }
|
| 595 |
-
;
|
| 596 |
-
|
| 597 |
-
method_modifiers:
|
| 598 |
-
/* empty */ { $$ = 0; }
|
| 599 |
-
| non_empty_member_modifiers { $$ = $1; }
|
| 600 |
-
;
|
| 601 |
-
|
| 602 |
-
non_empty_member_modifiers:
|
| 603 |
-
member_modifier { $$ = $1; }
|
| 604 |
-
| non_empty_member_modifiers member_modifier { $this->checkModifier($1, $2, #2); $$ = $1 | $2; }
|
| 605 |
-
;
|
| 606 |
-
|
| 607 |
-
member_modifier:
|
| 608 |
-
T_PUBLIC { $$ = Stmt\Class_::MODIFIER_PUBLIC; }
|
| 609 |
-
| T_PROTECTED { $$ = Stmt\Class_::MODIFIER_PROTECTED; }
|
| 610 |
-
| T_PRIVATE { $$ = Stmt\Class_::MODIFIER_PRIVATE; }
|
| 611 |
-
| T_STATIC { $$ = Stmt\Class_::MODIFIER_STATIC; }
|
| 612 |
-
| T_ABSTRACT { $$ = Stmt\Class_::MODIFIER_ABSTRACT; }
|
| 613 |
-
| T_FINAL { $$ = Stmt\Class_::MODIFIER_FINAL; }
|
| 614 |
-
;
|
| 615 |
-
|
| 616 |
-
property_declaration_list:
|
| 617 |
-
non_empty_property_declaration_list no_comma { $$ = $1; }
|
| 618 |
-
;
|
| 619 |
-
|
| 620 |
-
non_empty_property_declaration_list:
|
| 621 |
-
property_declaration { init($1); }
|
| 622 |
-
| non_empty_property_declaration_list ',' property_declaration
|
| 623 |
-
{ push($1, $3); }
|
| 624 |
-
;
|
| 625 |
-
|
| 626 |
-
property_decl_name:
|
| 627 |
-
T_VARIABLE { $$ = Node\VarLikeIdentifier[parseVar($1)]; }
|
| 628 |
-
;
|
| 629 |
-
|
| 630 |
-
property_declaration:
|
| 631 |
-
property_decl_name { $$ = Stmt\PropertyProperty[$1, null]; }
|
| 632 |
-
| property_decl_name '=' expr { $$ = Stmt\PropertyProperty[$1, $3]; }
|
| 633 |
-
;
|
| 634 |
-
|
| 635 |
-
expr_list_forbid_comma:
|
| 636 |
-
non_empty_expr_list no_comma { $$ = $1; }
|
| 637 |
-
;
|
| 638 |
-
|
| 639 |
-
expr_list_allow_comma:
|
| 640 |
-
non_empty_expr_list optional_comma { $$ = $1; }
|
| 641 |
-
;
|
| 642 |
-
|
| 643 |
-
non_empty_expr_list:
|
| 644 |
-
non_empty_expr_list ',' expr { push($1, $3); }
|
| 645 |
-
| expr { init($1); }
|
| 646 |
-
;
|
| 647 |
-
|
| 648 |
-
for_expr:
|
| 649 |
-
/* empty */ { $$ = array(); }
|
| 650 |
-
| expr_list_forbid_comma { $$ = $1; }
|
| 651 |
-
;
|
| 652 |
-
|
| 653 |
-
expr:
|
| 654 |
-
variable { $$ = $1; }
|
| 655 |
-
| list_expr '=' expr { $$ = Expr\Assign[$1, $3]; }
|
| 656 |
-
| array_short_syntax '=' expr { $$ = Expr\Assign[$1, $3]; }
|
| 657 |
-
| variable '=' expr { $$ = Expr\Assign[$1, $3]; }
|
| 658 |
-
| variable '=' '&' variable { $$ = Expr\AssignRef[$1, $4]; }
|
| 659 |
-
| new_expr { $$ = $1; }
|
| 660 |
-
| T_CLONE expr { $$ = Expr\Clone_[$2]; }
|
| 661 |
-
| variable T_PLUS_EQUAL expr { $$ = Expr\AssignOp\Plus [$1, $3]; }
|
| 662 |
-
| variable T_MINUS_EQUAL expr { $$ = Expr\AssignOp\Minus [$1, $3]; }
|
| 663 |
-
| variable T_MUL_EQUAL expr { $$ = Expr\AssignOp\Mul [$1, $3]; }
|
| 664 |
-
| variable T_DIV_EQUAL expr { $$ = Expr\AssignOp\Div [$1, $3]; }
|
| 665 |
-
| variable T_CONCAT_EQUAL expr { $$ = Expr\AssignOp\Concat [$1, $3]; }
|
| 666 |
-
| variable T_MOD_EQUAL expr { $$ = Expr\AssignOp\Mod [$1, $3]; }
|
| 667 |
-
| variable T_AND_EQUAL expr { $$ = Expr\AssignOp\BitwiseAnd[$1, $3]; }
|
| 668 |
-
| variable T_OR_EQUAL expr { $$ = Expr\AssignOp\BitwiseOr [$1, $3]; }
|
| 669 |
-
| variable T_XOR_EQUAL expr { $$ = Expr\AssignOp\BitwiseXor[$1, $3]; }
|
| 670 |
-
| variable T_SL_EQUAL expr { $$ = Expr\AssignOp\ShiftLeft [$1, $3]; }
|
| 671 |
-
| variable T_SR_EQUAL expr { $$ = Expr\AssignOp\ShiftRight[$1, $3]; }
|
| 672 |
-
| variable T_POW_EQUAL expr { $$ = Expr\AssignOp\Pow [$1, $3]; }
|
| 673 |
-
| variable T_COALESCE_EQUAL expr { $$ = Expr\AssignOp\Coalesce [$1, $3]; }
|
| 674 |
-
| variable T_INC { $$ = Expr\PostInc[$1]; }
|
| 675 |
-
| T_INC variable { $$ = Expr\PreInc [$2]; }
|
| 676 |
-
| variable T_DEC { $$ = Expr\PostDec[$1]; }
|
| 677 |
-
| T_DEC variable { $$ = Expr\PreDec [$2]; }
|
| 678 |
-
| expr T_BOOLEAN_OR expr { $$ = Expr\BinaryOp\BooleanOr [$1, $3]; }
|
| 679 |
-
| expr T_BOOLEAN_AND expr { $$ = Expr\BinaryOp\BooleanAnd[$1, $3]; }
|
| 680 |
-
| expr T_LOGICAL_OR expr { $$ = Expr\BinaryOp\LogicalOr [$1, $3]; }
|
| 681 |
-
| expr T_LOGICAL_AND expr { $$ = Expr\BinaryOp\LogicalAnd[$1, $3]; }
|
| 682 |
-
| expr T_LOGICAL_XOR expr { $$ = Expr\BinaryOp\LogicalXor[$1, $3]; }
|
| 683 |
-
| expr '|' expr { $$ = Expr\BinaryOp\BitwiseOr [$1, $3]; }
|
| 684 |
-
| expr '&' expr { $$ = Expr\BinaryOp\BitwiseAnd[$1, $3]; }
|
| 685 |
-
| expr '^' expr { $$ = Expr\BinaryOp\BitwiseXor[$1, $3]; }
|
| 686 |
-
| expr '.' expr { $$ = Expr\BinaryOp\Concat [$1, $3]; }
|
| 687 |
-
| expr '+' expr { $$ = Expr\BinaryOp\Plus [$1, $3]; }
|
| 688 |
-
| expr '-' expr { $$ = Expr\BinaryOp\Minus [$1, $3]; }
|
| 689 |
-
| expr '*' expr { $$ = Expr\BinaryOp\Mul [$1, $3]; }
|
| 690 |
-
| expr '/' expr { $$ = Expr\BinaryOp\Div [$1, $3]; }
|
| 691 |
-
| expr '%' expr { $$ = Expr\BinaryOp\Mod [$1, $3]; }
|
| 692 |
-
| expr T_SL expr { $$ = Expr\BinaryOp\ShiftLeft [$1, $3]; }
|
| 693 |
-
| expr T_SR expr { $$ = Expr\BinaryOp\ShiftRight[$1, $3]; }
|
| 694 |
-
| expr T_POW expr { $$ = Expr\BinaryOp\Pow [$1, $3]; }
|
| 695 |
-
| '+' expr %prec T_INC { $$ = Expr\UnaryPlus [$2]; }
|
| 696 |
-
| '-' expr %prec T_INC { $$ = Expr\UnaryMinus[$2]; }
|
| 697 |
-
| '!' expr { $$ = Expr\BooleanNot[$2]; }
|
| 698 |
-
| '~' expr { $$ = Expr\BitwiseNot[$2]; }
|
| 699 |
-
| expr T_IS_IDENTICAL expr { $$ = Expr\BinaryOp\Identical [$1, $3]; }
|
| 700 |
-
| expr T_IS_NOT_IDENTICAL expr { $$ = Expr\BinaryOp\NotIdentical [$1, $3]; }
|
| 701 |
-
| expr T_IS_EQUAL expr { $$ = Expr\BinaryOp\Equal [$1, $3]; }
|
| 702 |
-
| expr T_IS_NOT_EQUAL expr { $$ = Expr\BinaryOp\NotEqual [$1, $3]; }
|
| 703 |
-
| expr T_SPACESHIP expr { $$ = Expr\BinaryOp\Spaceship [$1, $3]; }
|
| 704 |
-
| expr '<' expr { $$ = Expr\BinaryOp\Smaller [$1, $3]; }
|
| 705 |
-
| expr T_IS_SMALLER_OR_EQUAL expr { $$ = Expr\BinaryOp\SmallerOrEqual[$1, $3]; }
|
| 706 |
-
| expr '>' expr { $$ = Expr\BinaryOp\Greater [$1, $3]; }
|
| 707 |
-
| expr T_IS_GREATER_OR_EQUAL expr { $$ = Expr\BinaryOp\GreaterOrEqual[$1, $3]; }
|
| 708 |
-
| expr T_INSTANCEOF class_name_reference { $$ = Expr\Instanceof_[$1, $3]; }
|
| 709 |
-
| '(' expr ')' { $$ = $2; }
|
| 710 |
-
| expr '?' expr ':' expr { $$ = Expr\Ternary[$1, $3, $5]; }
|
| 711 |
-
| expr '?' ':' expr { $$ = Expr\Ternary[$1, null, $4]; }
|
| 712 |
-
| expr T_COALESCE expr { $$ = Expr\BinaryOp\Coalesce[$1, $3]; }
|
| 713 |
-
| T_ISSET '(' expr_list_allow_comma ')' { $$ = Expr\Isset_[$3]; }
|
| 714 |
-
| T_EMPTY '(' expr ')' { $$ = Expr\Empty_[$3]; }
|
| 715 |
-
| T_INCLUDE expr { $$ = Expr\Include_[$2, Expr\Include_::TYPE_INCLUDE]; }
|
| 716 |
-
| T_INCLUDE_ONCE expr { $$ = Expr\Include_[$2, Expr\Include_::TYPE_INCLUDE_ONCE]; }
|
| 717 |
-
| T_EVAL '(' expr ')' { $$ = Expr\Eval_[$3]; }
|
| 718 |
-
| T_REQUIRE expr { $$ = Expr\Include_[$2, Expr\Include_::TYPE_REQUIRE]; }
|
| 719 |
-
| T_REQUIRE_ONCE expr { $$ = Expr\Include_[$2, Expr\Include_::TYPE_REQUIRE_ONCE]; }
|
| 720 |
-
| T_INT_CAST expr { $$ = Expr\Cast\Int_ [$2]; }
|
| 721 |
-
| T_DOUBLE_CAST expr
|
| 722 |
-
{ $attrs = attributes();
|
| 723 |
-
$attrs['kind'] = $this->getFloatCastKind($1);
|
| 724 |
-
$$ = new Expr\Cast\Double($2, $attrs); }
|
| 725 |
-
| T_STRING_CAST expr { $$ = Expr\Cast\String_ [$2]; }
|
| 726 |
-
| T_ARRAY_CAST expr { $$ = Expr\Cast\Array_ [$2]; }
|
| 727 |
-
| T_OBJECT_CAST expr { $$ = Expr\Cast\Object_ [$2]; }
|
| 728 |
-
| T_BOOL_CAST expr { $$ = Expr\Cast\Bool_ [$2]; }
|
| 729 |
-
| T_UNSET_CAST expr { $$ = Expr\Cast\Unset_ [$2]; }
|
| 730 |
-
| T_EXIT exit_expr
|
| 731 |
-
{ $attrs = attributes();
|
| 732 |
-
$attrs['kind'] = strtolower($1) === 'exit' ? Expr\Exit_::KIND_EXIT : Expr\Exit_::KIND_DIE;
|
| 733 |
-
$$ = new Expr\Exit_($2, $attrs); }
|
| 734 |
-
| '@' expr { $$ = Expr\ErrorSuppress[$2]; }
|
| 735 |
-
| scalar { $$ = $1; }
|
| 736 |
-
| '`' backticks_expr '`' { $$ = Expr\ShellExec[$2]; }
|
| 737 |
-
| T_PRINT expr { $$ = Expr\Print_[$2]; }
|
| 738 |
-
| T_YIELD { $$ = Expr\Yield_[null, null]; }
|
| 739 |
-
| T_YIELD expr { $$ = Expr\Yield_[$2, null]; }
|
| 740 |
-
| T_YIELD expr T_DOUBLE_ARROW expr { $$ = Expr\Yield_[$4, $2]; }
|
| 741 |
-
| T_YIELD_FROM expr { $$ = Expr\YieldFrom[$2]; }
|
| 742 |
-
|
| 743 |
-
| T_FN optional_ref '(' parameter_list ')' optional_return_type T_DOUBLE_ARROW expr
|
| 744 |
-
{ $$ = Expr\ArrowFunction[['static' => false, 'byRef' => $2, 'params' => $4, 'returnType' => $6, 'expr' => $8]]; }
|
| 745 |
-
| T_STATIC T_FN optional_ref '(' parameter_list ')' optional_return_type T_DOUBLE_ARROW expr
|
| 746 |
-
{ $$ = Expr\ArrowFunction[['static' => true, 'byRef' => $3, 'params' => $5, 'returnType' => $7, 'expr' => $9]]; }
|
| 747 |
-
|
| 748 |
-
| T_FUNCTION optional_ref '(' parameter_list ')' lexical_vars optional_return_type
|
| 749 |
-
block_or_error
|
| 750 |
-
{ $$ = Expr\Closure[['static' => false, 'byRef' => $2, 'params' => $4, 'uses' => $6, 'returnType' => $7, 'stmts' => $8]]; }
|
| 751 |
-
| T_STATIC T_FUNCTION optional_ref '(' parameter_list ')' lexical_vars optional_return_type
|
| 752 |
-
block_or_error
|
| 753 |
-
{ $$ = Expr\Closure[['static' => true, 'byRef' => $3, 'params' => $5, 'uses' => $7, 'returnType' => $8, 'stmts' => $9]]; }
|
| 754 |
-
;
|
| 755 |
-
|
| 756 |
-
anonymous_class:
|
| 757 |
-
T_CLASS ctor_arguments extends_from implements_list '{' class_statement_list '}'
|
| 758 |
-
{ $$ = array(Stmt\Class_[null, ['type' => 0, 'extends' => $3, 'implements' => $4, 'stmts' => $6]], $2);
|
| 759 |
-
$this->checkClass($$[0], -1); }
|
| 760 |
-
;
|
| 761 |
-
|
| 762 |
-
new_expr:
|
| 763 |
-
T_NEW class_name_reference ctor_arguments { $$ = Expr\New_[$2, $3]; }
|
| 764 |
-
| T_NEW anonymous_class
|
| 765 |
-
{ list($class, $ctorArgs) = $2; $$ = Expr\New_[$class, $ctorArgs]; }
|
| 766 |
-
;
|
| 767 |
-
|
| 768 |
-
lexical_vars:
|
| 769 |
-
/* empty */ { $$ = array(); }
|
| 770 |
-
| T_USE '(' lexical_var_list ')' { $$ = $3; }
|
| 771 |
-
;
|
| 772 |
-
|
| 773 |
-
lexical_var_list:
|
| 774 |
-
non_empty_lexical_var_list no_comma { $$ = $1; }
|
| 775 |
-
;
|
| 776 |
-
|
| 777 |
-
non_empty_lexical_var_list:
|
| 778 |
-
lexical_var { init($1); }
|
| 779 |
-
| non_empty_lexical_var_list ',' lexical_var { push($1, $3); }
|
| 780 |
-
;
|
| 781 |
-
|
| 782 |
-
lexical_var:
|
| 783 |
-
optional_ref plain_variable { $$ = Expr\ClosureUse[$2, $1]; }
|
| 784 |
-
;
|
| 785 |
-
|
| 786 |
-
function_call:
|
| 787 |
-
name argument_list { $$ = Expr\FuncCall[$1, $2]; }
|
| 788 |
-
| callable_expr argument_list { $$ = Expr\FuncCall[$1, $2]; }
|
| 789 |
-
| class_name_or_var T_PAAMAYIM_NEKUDOTAYIM member_name argument_list
|
| 790 |
-
{ $$ = Expr\StaticCall[$1, $3, $4]; }
|
| 791 |
-
;
|
| 792 |
-
|
| 793 |
-
class_name:
|
| 794 |
-
T_STATIC { $$ = Name[$1]; }
|
| 795 |
-
| name { $$ = $1; }
|
| 796 |
-
;
|
| 797 |
-
|
| 798 |
-
name:
|
| 799 |
-
namespace_name_parts { $$ = Name[$1]; }
|
| 800 |
-
| T_NS_SEPARATOR namespace_name_parts { $$ = Name\FullyQualified[$2]; }
|
| 801 |
-
| T_NAMESPACE T_NS_SEPARATOR namespace_name_parts { $$ = Name\Relative[$3]; }
|
| 802 |
-
;
|
| 803 |
-
|
| 804 |
-
class_name_reference:
|
| 805 |
-
class_name { $$ = $1; }
|
| 806 |
-
| new_variable { $$ = $1; }
|
| 807 |
-
| '(' expr ')' { $$ = $2; }
|
| 808 |
-
| error { $$ = Expr\Error[]; $this->errorState = 2; }
|
| 809 |
-
;
|
| 810 |
-
|
| 811 |
-
class_name_or_var:
|
| 812 |
-
class_name { $$ = $1; }
|
| 813 |
-
| fully_dereferencable { $$ = $1; }
|
| 814 |
-
;
|
| 815 |
-
|
| 816 |
-
exit_expr:
|
| 817 |
-
/* empty */ { $$ = null; }
|
| 818 |
-
| '(' optional_expr ')' { $$ = $2; }
|
| 819 |
-
;
|
| 820 |
-
|
| 821 |
-
backticks_expr:
|
| 822 |
-
/* empty */ { $$ = array(); }
|
| 823 |
-
| T_ENCAPSED_AND_WHITESPACE
|
| 824 |
-
{ $$ = array(Scalar\EncapsedStringPart[Scalar\String_::parseEscapeSequences($1, '`')]); }
|
| 825 |
-
| encaps_list { parseEncapsed($1, '`', true); $$ = $1; }
|
| 826 |
-
;
|
| 827 |
-
|
| 828 |
-
ctor_arguments:
|
| 829 |
-
/* empty */ { $$ = array(); }
|
| 830 |
-
| argument_list { $$ = $1; }
|
| 831 |
-
;
|
| 832 |
-
|
| 833 |
-
constant:
|
| 834 |
-
name { $$ = Expr\ConstFetch[$1]; }
|
| 835 |
-
| T_LINE { $$ = Scalar\MagicConst\Line[]; }
|
| 836 |
-
| T_FILE { $$ = Scalar\MagicConst\File[]; }
|
| 837 |
-
| T_DIR { $$ = Scalar\MagicConst\Dir[]; }
|
| 838 |
-
| T_CLASS_C { $$ = Scalar\MagicConst\Class_[]; }
|
| 839 |
-
| T_TRAIT_C { $$ = Scalar\MagicConst\Trait_[]; }
|
| 840 |
-
| T_METHOD_C { $$ = Scalar\MagicConst\Method[]; }
|
| 841 |
-
| T_FUNC_C { $$ = Scalar\MagicConst\Function_[]; }
|
| 842 |
-
| T_NS_C { $$ = Scalar\MagicConst\Namespace_[]; }
|
| 843 |
-
;
|
| 844 |
-
|
| 845 |
-
class_constant:
|
| 846 |
-
class_name_or_var T_PAAMAYIM_NEKUDOTAYIM identifier_ex
|
| 847 |
-
{ $$ = Expr\ClassConstFetch[$1, $3]; }
|
| 848 |
-
/* We interpret an isolated FOO:: as an unfinished class constant fetch. It could also be
|
| 849 |
-
an unfinished static property fetch or unfinished scoped call. */
|
| 850 |
-
| class_name_or_var T_PAAMAYIM_NEKUDOTAYIM error
|
| 851 |
-
{ $$ = Expr\ClassConstFetch[$1, new Expr\Error(stackAttributes(#3))]; $this->errorState = 2; }
|
| 852 |
-
;
|
| 853 |
-
|
| 854 |
-
array_short_syntax:
|
| 855 |
-
'[' array_pair_list ']'
|
| 856 |
-
{ $attrs = attributes(); $attrs['kind'] = Expr\Array_::KIND_SHORT;
|
| 857 |
-
$$ = new Expr\Array_($2, $attrs); }
|
| 858 |
-
;
|
| 859 |
-
|
| 860 |
-
dereferencable_scalar:
|
| 861 |
-
T_ARRAY '(' array_pair_list ')'
|
| 862 |
-
{ $attrs = attributes(); $attrs['kind'] = Expr\Array_::KIND_LONG;
|
| 863 |
-
$$ = new Expr\Array_($3, $attrs); }
|
| 864 |
-
| array_short_syntax { $$ = $1; }
|
| 865 |
-
| T_CONSTANT_ENCAPSED_STRING
|
| 866 |
-
{ $attrs = attributes(); $attrs['kind'] = strKind($1);
|
| 867 |
-
$$ = new Scalar\String_(Scalar\String_::parse($1), $attrs); }
|
| 868 |
-
| '"' encaps_list '"'
|
| 869 |
-
{ $attrs = attributes(); $attrs['kind'] = Scalar\String_::KIND_DOUBLE_QUOTED;
|
| 870 |
-
parseEncapsed($2, '"', true); $$ = new Scalar\Encapsed($2, $attrs); }
|
| 871 |
-
;
|
| 872 |
-
|
| 873 |
-
scalar:
|
| 874 |
-
T_LNUMBER { $$ = $this->parseLNumber($1, attributes()); }
|
| 875 |
-
| T_DNUMBER { $$ = Scalar\DNumber[Scalar\DNumber::parse($1)]; }
|
| 876 |
-
| dereferencable_scalar { $$ = $1; }
|
| 877 |
-
| constant { $$ = $1; }
|
| 878 |
-
| class_constant { $$ = $1; }
|
| 879 |
-
| T_START_HEREDOC T_ENCAPSED_AND_WHITESPACE T_END_HEREDOC
|
| 880 |
-
{ $$ = $this->parseDocString($1, $2, $3, attributes(), stackAttributes(#3), true); }
|
| 881 |
-
| T_START_HEREDOC T_END_HEREDOC
|
| 882 |
-
{ $$ = $this->parseDocString($1, '', $2, attributes(), stackAttributes(#2), true); }
|
| 883 |
-
| T_START_HEREDOC encaps_list T_END_HEREDOC
|
| 884 |
-
{ $$ = $this->parseDocString($1, $2, $3, attributes(), stackAttributes(#3), true); }
|
| 885 |
-
;
|
| 886 |
-
|
| 887 |
-
optional_expr:
|
| 888 |
-
/* empty */ { $$ = null; }
|
| 889 |
-
| expr { $$ = $1; }
|
| 890 |
-
;
|
| 891 |
-
|
| 892 |
-
fully_dereferencable:
|
| 893 |
-
variable { $$ = $1; }
|
| 894 |
-
| '(' expr ')' { $$ = $2; }
|
| 895 |
-
| dereferencable_scalar { $$ = $1; }
|
| 896 |
-
| class_constant { $$ = $1; }
|
| 897 |
-
;
|
| 898 |
-
|
| 899 |
-
array_object_dereferencable:
|
| 900 |
-
fully_dereferencable { $$ = $1; }
|
| 901 |
-
| constant { $$ = $1; }
|
| 902 |
-
;
|
| 903 |
-
|
| 904 |
-
callable_expr:
|
| 905 |
-
callable_variable { $$ = $1; }
|
| 906 |
-
| '(' expr ')' { $$ = $2; }
|
| 907 |
-
| dereferencable_scalar { $$ = $1; }
|
| 908 |
-
;
|
| 909 |
-
|
| 910 |
-
callable_variable:
|
| 911 |
-
simple_variable { $$ = Expr\Variable[$1]; }
|
| 912 |
-
| array_object_dereferencable '[' optional_expr ']' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 913 |
-
| array_object_dereferencable '{' expr '}' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 914 |
-
| function_call { $$ = $1; }
|
| 915 |
-
| array_object_dereferencable T_OBJECT_OPERATOR property_name argument_list
|
| 916 |
-
{ $$ = Expr\MethodCall[$1, $3, $4]; }
|
| 917 |
-
;
|
| 918 |
-
|
| 919 |
-
optional_plain_variable:
|
| 920 |
-
/* empty */ { $$ = null; }
|
| 921 |
-
| plain_variable { $$ = $1; }
|
| 922 |
-
;
|
| 923 |
-
|
| 924 |
-
variable:
|
| 925 |
-
callable_variable { $$ = $1; }
|
| 926 |
-
| static_member { $$ = $1; }
|
| 927 |
-
| array_object_dereferencable T_OBJECT_OPERATOR property_name
|
| 928 |
-
{ $$ = Expr\PropertyFetch[$1, $3]; }
|
| 929 |
-
;
|
| 930 |
-
|
| 931 |
-
simple_variable:
|
| 932 |
-
T_VARIABLE { $$ = parseVar($1); }
|
| 933 |
-
| '$' '{' expr '}' { $$ = $3; }
|
| 934 |
-
| '$' simple_variable { $$ = Expr\Variable[$2]; }
|
| 935 |
-
| '$' error { $$ = Expr\Error[]; $this->errorState = 2; }
|
| 936 |
-
;
|
| 937 |
-
|
| 938 |
-
static_member_prop_name:
|
| 939 |
-
simple_variable
|
| 940 |
-
{ $var = $1; $$ = \is_string($var) ? Node\VarLikeIdentifier[$var] : $var; }
|
| 941 |
-
;
|
| 942 |
-
|
| 943 |
-
static_member:
|
| 944 |
-
class_name_or_var T_PAAMAYIM_NEKUDOTAYIM static_member_prop_name
|
| 945 |
-
{ $$ = Expr\StaticPropertyFetch[$1, $3]; }
|
| 946 |
-
;
|
| 947 |
-
|
| 948 |
-
new_variable:
|
| 949 |
-
simple_variable { $$ = Expr\Variable[$1]; }
|
| 950 |
-
| new_variable '[' optional_expr ']' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 951 |
-
| new_variable '{' expr '}' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 952 |
-
| new_variable T_OBJECT_OPERATOR property_name { $$ = Expr\PropertyFetch[$1, $3]; }
|
| 953 |
-
| class_name T_PAAMAYIM_NEKUDOTAYIM static_member_prop_name
|
| 954 |
-
{ $$ = Expr\StaticPropertyFetch[$1, $3]; }
|
| 955 |
-
| new_variable T_PAAMAYIM_NEKUDOTAYIM static_member_prop_name
|
| 956 |
-
{ $$ = Expr\StaticPropertyFetch[$1, $3]; }
|
| 957 |
-
;
|
| 958 |
-
|
| 959 |
-
member_name:
|
| 960 |
-
identifier_ex { $$ = $1; }
|
| 961 |
-
| '{' expr '}' { $$ = $2; }
|
| 962 |
-
| simple_variable { $$ = Expr\Variable[$1]; }
|
| 963 |
-
;
|
| 964 |
-
|
| 965 |
-
property_name:
|
| 966 |
-
identifier { $$ = $1; }
|
| 967 |
-
| '{' expr '}' { $$ = $2; }
|
| 968 |
-
| simple_variable { $$ = Expr\Variable[$1]; }
|
| 969 |
-
| error { $$ = Expr\Error[]; $this->errorState = 2; }
|
| 970 |
-
;
|
| 971 |
-
|
| 972 |
-
list_expr:
|
| 973 |
-
T_LIST '(' inner_array_pair_list ')' { $$ = Expr\List_[$3]; }
|
| 974 |
-
;
|
| 975 |
-
|
| 976 |
-
array_pair_list:
|
| 977 |
-
inner_array_pair_list
|
| 978 |
-
{ $$ = $1; $end = count($$)-1; if ($$[$end] === null) array_pop($$); }
|
| 979 |
-
;
|
| 980 |
-
|
| 981 |
-
comma_or_error:
|
| 982 |
-
','
|
| 983 |
-
| error
|
| 984 |
-
{ /* do nothing -- prevent default action of $$=$1. See #551. */ }
|
| 985 |
-
;
|
| 986 |
-
|
| 987 |
-
inner_array_pair_list:
|
| 988 |
-
inner_array_pair_list comma_or_error array_pair { push($1, $3); }
|
| 989 |
-
| array_pair { init($1); }
|
| 990 |
-
;
|
| 991 |
-
|
| 992 |
-
array_pair:
|
| 993 |
-
expr { $$ = Expr\ArrayItem[$1, null, false]; }
|
| 994 |
-
| '&' variable { $$ = Expr\ArrayItem[$2, null, true]; }
|
| 995 |
-
| list_expr { $$ = Expr\ArrayItem[$1, null, false]; }
|
| 996 |
-
| expr T_DOUBLE_ARROW expr { $$ = Expr\ArrayItem[$3, $1, false]; }
|
| 997 |
-
| expr T_DOUBLE_ARROW '&' variable { $$ = Expr\ArrayItem[$4, $1, true]; }
|
| 998 |
-
| expr T_DOUBLE_ARROW list_expr { $$ = Expr\ArrayItem[$3, $1, false]; }
|
| 999 |
-
| T_ELLIPSIS expr { $$ = Expr\ArrayItem[$2, null, false, attributes(), true]; }
|
| 1000 |
-
| /* empty */ { $$ = null; }
|
| 1001 |
-
;
|
| 1002 |
-
|
| 1003 |
-
encaps_list:
|
| 1004 |
-
encaps_list encaps_var { push($1, $2); }
|
| 1005 |
-
| encaps_list encaps_string_part { push($1, $2); }
|
| 1006 |
-
| encaps_var { init($1); }
|
| 1007 |
-
| encaps_string_part encaps_var { init($1, $2); }
|
| 1008 |
-
;
|
| 1009 |
-
|
| 1010 |
-
encaps_string_part:
|
| 1011 |
-
T_ENCAPSED_AND_WHITESPACE { $$ = Scalar\EncapsedStringPart[$1]; }
|
| 1012 |
-
;
|
| 1013 |
-
|
| 1014 |
-
encaps_str_varname:
|
| 1015 |
-
T_STRING_VARNAME { $$ = Expr\Variable[$1]; }
|
| 1016 |
-
;
|
| 1017 |
-
|
| 1018 |
-
encaps_var:
|
| 1019 |
-
plain_variable { $$ = $1; }
|
| 1020 |
-
| plain_variable '[' encaps_var_offset ']' { $$ = Expr\ArrayDimFetch[$1, $3]; }
|
| 1021 |
-
| plain_variable T_OBJECT_OPERATOR identifier { $$ = Expr\PropertyFetch[$1, $3]; }
|
| 1022 |
-
| T_DOLLAR_OPEN_CURLY_BRACES expr '}' { $$ = Expr\Variable[$2]; }
|
| 1023 |
-
| T_DOLLAR_OPEN_CURLY_BRACES T_STRING_VARNAME '}' { $$ = Expr\Variable[$2]; }
|
| 1024 |
-
| T_DOLLAR_OPEN_CURLY_BRACES encaps_str_varname '[' expr ']' '}'
|
| 1025 |
-
{ $$ = Expr\ArrayDimFetch[$2, $4]; }
|
| 1026 |
-
| T_CURLY_OPEN variable '}' { $$ = $2; }
|
| 1027 |
-
;
|
| 1028 |
-
|
| 1029 |
-
encaps_var_offset:
|
| 1030 |
-
T_STRING { $$ = Scalar\String_[$1]; }
|
| 1031 |
-
| T_NUM_STRING { $$ = $this->parseNumString($1, attributes()); }
|
| 1032 |
-
| '-' T_NUM_STRING { $$ = $this->parseNumString('-' . $2, attributes()); }
|
| 1033 |
-
| plain_variable { $$ = $1; }
|
| 1034 |
-
;
|
| 1035 |
-
|
| 1036 |
-
%%
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/grammar/rebuildParsers.php
DELETED
|
@@ -1,261 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
$grammarFileToName = [
|
| 4 |
-
__DIR__ . '/php5.y' => 'Php5',
|
| 5 |
-
__DIR__ . '/php7.y' => 'Php7',
|
| 6 |
-
];
|
| 7 |
-
|
| 8 |
-
$tokensFile = __DIR__ . '/tokens.y';
|
| 9 |
-
$tokensTemplate = __DIR__ . '/tokens.template';
|
| 10 |
-
$skeletonFile = __DIR__ . '/parser.template';
|
| 11 |
-
$tmpGrammarFile = __DIR__ . '/tmp_parser.phpy';
|
| 12 |
-
$tmpResultFile = __DIR__ . '/tmp_parser.php';
|
| 13 |
-
$resultDir = __DIR__ . '/../lib/PhpParser/Parser';
|
| 14 |
-
$tokensResultsFile = $resultDir . '/Tokens.php';
|
| 15 |
-
|
| 16 |
-
$kmyacc = getenv('KMYACC');
|
| 17 |
-
if (!$kmyacc) {
|
| 18 |
-
// Use phpyacc from dev dependencies by default.
|
| 19 |
-
$kmyacc = PHP_BINARY . ' ' . __DIR__ . '/../vendor/bin/phpyacc';
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
$options = array_flip($argv);
|
| 23 |
-
$optionDebug = isset($options['--debug']);
|
| 24 |
-
$optionKeepTmpGrammar = isset($options['--keep-tmp-grammar']);
|
| 25 |
-
|
| 26 |
-
///////////////////////////////
|
| 27 |
-
/// Utility regex constants ///
|
| 28 |
-
///////////////////////////////
|
| 29 |
-
|
| 30 |
-
const LIB = '(?(DEFINE)
|
| 31 |
-
(?<singleQuotedString>\'[^\\\\\']*+(?:\\\\.[^\\\\\']*+)*+\')
|
| 32 |
-
(?<doubleQuotedString>"[^\\\\"]*+(?:\\\\.[^\\\\"]*+)*+")
|
| 33 |
-
(?<string>(?&singleQuotedString)|(?&doubleQuotedString))
|
| 34 |
-
(?<comment>/\*[^*]*+(?:\*(?!/)[^*]*+)*+\*/)
|
| 35 |
-
(?<code>\{[^\'"/{}]*+(?:(?:(?&string)|(?&comment)|(?&code)|/)[^\'"/{}]*+)*+})
|
| 36 |
-
)';
|
| 37 |
-
|
| 38 |
-
const PARAMS = '\[(?<params>[^[\]]*+(?:\[(?¶ms)\][^[\]]*+)*+)\]';
|
| 39 |
-
const ARGS = '\((?<args>[^()]*+(?:\((?&args)\)[^()]*+)*+)\)';
|
| 40 |
-
|
| 41 |
-
///////////////////
|
| 42 |
-
/// Main script ///
|
| 43 |
-
///////////////////
|
| 44 |
-
|
| 45 |
-
$tokens = file_get_contents($tokensFile);
|
| 46 |
-
|
| 47 |
-
foreach ($grammarFileToName as $grammarFile => $name) {
|
| 48 |
-
echo "Building temporary $name grammar file.\n";
|
| 49 |
-
|
| 50 |
-
$grammarCode = file_get_contents($grammarFile);
|
| 51 |
-
$grammarCode = str_replace('%tokens', $tokens, $grammarCode);
|
| 52 |
-
|
| 53 |
-
$grammarCode = resolveNodes($grammarCode);
|
| 54 |
-
$grammarCode = resolveMacros($grammarCode);
|
| 55 |
-
$grammarCode = resolveStackAccess($grammarCode);
|
| 56 |
-
|
| 57 |
-
file_put_contents($tmpGrammarFile, $grammarCode);
|
| 58 |
-
|
| 59 |
-
$additionalArgs = $optionDebug ? '-t -v' : '';
|
| 60 |
-
|
| 61 |
-
echo "Building $name parser.\n";
|
| 62 |
-
$output = execCmd("$kmyacc $additionalArgs -m $skeletonFile -p $name $tmpGrammarFile");
|
| 63 |
-
|
| 64 |
-
$resultCode = file_get_contents($tmpResultFile);
|
| 65 |
-
$resultCode = removeTrailingWhitespace($resultCode);
|
| 66 |
-
|
| 67 |
-
ensureDirExists($resultDir);
|
| 68 |
-
file_put_contents("$resultDir/$name.php", $resultCode);
|
| 69 |
-
unlink($tmpResultFile);
|
| 70 |
-
|
| 71 |
-
echo "Building token definition.\n";
|
| 72 |
-
$output = execCmd("$kmyacc -m $tokensTemplate $tmpGrammarFile");
|
| 73 |
-
rename($tmpResultFile, $tokensResultsFile);
|
| 74 |
-
|
| 75 |
-
if (!$optionKeepTmpGrammar) {
|
| 76 |
-
unlink($tmpGrammarFile);
|
| 77 |
-
}
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
///////////////////////////////
|
| 81 |
-
/// Preprocessing functions ///
|
| 82 |
-
///////////////////////////////
|
| 83 |
-
|
| 84 |
-
function resolveNodes($code) {
|
| 85 |
-
return preg_replace_callback(
|
| 86 |
-
'~\b(?<name>[A-Z][a-zA-Z_\\\\]++)\s*' . PARAMS . '~',
|
| 87 |
-
function($matches) {
|
| 88 |
-
// recurse
|
| 89 |
-
$matches['params'] = resolveNodes($matches['params']);
|
| 90 |
-
|
| 91 |
-
$params = magicSplit(
|
| 92 |
-
'(?:' . PARAMS . '|' . ARGS . ')(*SKIP)(*FAIL)|,',
|
| 93 |
-
$matches['params']
|
| 94 |
-
);
|
| 95 |
-
|
| 96 |
-
$paramCode = '';
|
| 97 |
-
foreach ($params as $param) {
|
| 98 |
-
$paramCode .= $param . ', ';
|
| 99 |
-
}
|
| 100 |
-
|
| 101 |
-
return 'new ' . $matches['name'] . '(' . $paramCode . 'attributes())';
|
| 102 |
-
},
|
| 103 |
-
$code
|
| 104 |
-
);
|
| 105 |
-
}
|
| 106 |
-
|
| 107 |
-
function resolveMacros($code) {
|
| 108 |
-
return preg_replace_callback(
|
| 109 |
-
'~\b(?<!::|->)(?!array\()(?<name>[a-z][A-Za-z]++)' . ARGS . '~',
|
| 110 |
-
function($matches) {
|
| 111 |
-
// recurse
|
| 112 |
-
$matches['args'] = resolveMacros($matches['args']);
|
| 113 |
-
|
| 114 |
-
$name = $matches['name'];
|
| 115 |
-
$args = magicSplit(
|
| 116 |
-
'(?:' . PARAMS . '|' . ARGS . ')(*SKIP)(*FAIL)|,',
|
| 117 |
-
$matches['args']
|
| 118 |
-
);
|
| 119 |
-
|
| 120 |
-
if ('attributes' == $name) {
|
| 121 |
-
assertArgs(0, $args, $name);
|
| 122 |
-
return '$this->startAttributeStack[#1] + $this->endAttributes';
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
if ('stackAttributes' == $name) {
|
| 126 |
-
assertArgs(1, $args, $name);
|
| 127 |
-
return '$this->startAttributeStack[' . $args[0] . ']'
|
| 128 |
-
. ' + $this->endAttributeStack[' . $args[0] . ']';
|
| 129 |
-
}
|
| 130 |
-
|
| 131 |
-
if ('init' == $name) {
|
| 132 |
-
return '$$ = array(' . implode(', ', $args) . ')';
|
| 133 |
-
}
|
| 134 |
-
|
| 135 |
-
if ('push' == $name) {
|
| 136 |
-
assertArgs(2, $args, $name);
|
| 137 |
-
|
| 138 |
-
return $args[0] . '[] = ' . $args[1] . '; $$ = ' . $args[0];
|
| 139 |
-
}
|
| 140 |
-
|
| 141 |
-
if ('pushNormalizing' == $name) {
|
| 142 |
-
assertArgs(2, $args, $name);
|
| 143 |
-
|
| 144 |
-
return 'if (is_array(' . $args[1] . ')) { $$ = array_merge(' . $args[0] . ', ' . $args[1] . '); }'
|
| 145 |
-
. ' else { ' . $args[0] . '[] = ' . $args[1] . '; $$ = ' . $args[0] . '; }';
|
| 146 |
-
}
|
| 147 |
-
|
| 148 |
-
if ('toArray' == $name) {
|
| 149 |
-
assertArgs(1, $args, $name);
|
| 150 |
-
|
| 151 |
-
return 'is_array(' . $args[0] . ') ? ' . $args[0] . ' : array(' . $args[0] . ')';
|
| 152 |
-
}
|
| 153 |
-
|
| 154 |
-
if ('parseVar' == $name) {
|
| 155 |
-
assertArgs(1, $args, $name);
|
| 156 |
-
|
| 157 |
-
return 'substr(' . $args[0] . ', 1)';
|
| 158 |
-
}
|
| 159 |
-
|
| 160 |
-
if ('parseEncapsed' == $name) {
|
| 161 |
-
assertArgs(3, $args, $name);
|
| 162 |
-
|
| 163 |
-
return 'foreach (' . $args[0] . ' as $s) { if ($s instanceof Node\Scalar\EncapsedStringPart) {'
|
| 164 |
-
. ' $s->value = Node\Scalar\String_::parseEscapeSequences($s->value, ' . $args[1] . ', ' . $args[2] . '); } }';
|
| 165 |
-
}
|
| 166 |
-
|
| 167 |
-
if ('makeNop' == $name) {
|
| 168 |
-
assertArgs(3, $args, $name);
|
| 169 |
-
|
| 170 |
-
return '$startAttributes = ' . $args[1] . ';'
|
| 171 |
-
. ' if (isset($startAttributes[\'comments\']))'
|
| 172 |
-
. ' { ' . $args[0] . ' = new Stmt\Nop($startAttributes + ' . $args[2] . '); }'
|
| 173 |
-
. ' else { ' . $args[0] . ' = null; }';
|
| 174 |
-
}
|
| 175 |
-
|
| 176 |
-
if ('makeZeroLengthNop' == $name) {
|
| 177 |
-
assertArgs(2, $args, $name);
|
| 178 |
-
|
| 179 |
-
return '$startAttributes = ' . $args[1] . ';'
|
| 180 |
-
. ' if (isset($startAttributes[\'comments\']))'
|
| 181 |
-
. ' { ' . $args[0] . ' = new Stmt\Nop($this->createCommentNopAttributes($startAttributes[\'comments\'])); }'
|
| 182 |
-
. ' else { ' . $args[0] . ' = null; }';
|
| 183 |
-
}
|
| 184 |
-
|
| 185 |
-
if ('strKind' == $name) {
|
| 186 |
-
assertArgs(1, $args, $name);
|
| 187 |
-
|
| 188 |
-
return '(' . $args[0] . '[0] === "\'" || (' . $args[0] . '[1] === "\'" && '
|
| 189 |
-
. '(' . $args[0] . '[0] === \'b\' || ' . $args[0] . '[0] === \'B\')) '
|
| 190 |
-
. '? Scalar\String_::KIND_SINGLE_QUOTED : Scalar\String_::KIND_DOUBLE_QUOTED)';
|
| 191 |
-
}
|
| 192 |
-
|
| 193 |
-
if ('prependLeadingComments' == $name) {
|
| 194 |
-
assertArgs(1, $args, $name);
|
| 195 |
-
|
| 196 |
-
return '$attrs = $this->startAttributeStack[#1]; $stmts = ' . $args[0] . '; '
|
| 197 |
-
. 'if (!empty($attrs[\'comments\'])) {'
|
| 198 |
-
. '$stmts[0]->setAttribute(\'comments\', '
|
| 199 |
-
. 'array_merge($attrs[\'comments\'], $stmts[0]->getAttribute(\'comments\', []))); }';
|
| 200 |
-
}
|
| 201 |
-
|
| 202 |
-
return $matches[0];
|
| 203 |
-
},
|
| 204 |
-
$code
|
| 205 |
-
);
|
| 206 |
-
}
|
| 207 |
-
|
| 208 |
-
function assertArgs($num, $args, $name) {
|
| 209 |
-
if ($num != count($args)) {
|
| 210 |
-
die('Wrong argument count for ' . $name . '().');
|
| 211 |
-
}
|
| 212 |
-
}
|
| 213 |
-
|
| 214 |
-
function resolveStackAccess($code) {
|
| 215 |
-
$code = preg_replace('/\$\d+/', '$this->semStack[$0]', $code);
|
| 216 |
-
$code = preg_replace('/#(\d+)/', '$$1', $code);
|
| 217 |
-
return $code;
|
| 218 |
-
}
|
| 219 |
-
|
| 220 |
-
function removeTrailingWhitespace($code) {
|
| 221 |
-
$lines = explode("\n", $code);
|
| 222 |
-
$lines = array_map('rtrim', $lines);
|
| 223 |
-
return implode("\n", $lines);
|
| 224 |
-
}
|
| 225 |
-
|
| 226 |
-
function ensureDirExists($dir) {
|
| 227 |
-
if (!is_dir($dir)) {
|
| 228 |
-
mkdir($dir, 0777, true);
|
| 229 |
-
}
|
| 230 |
-
}
|
| 231 |
-
|
| 232 |
-
function execCmd($cmd) {
|
| 233 |
-
$output = trim(shell_exec("$cmd 2>&1"));
|
| 234 |
-
if ($output !== "") {
|
| 235 |
-
echo "> " . $cmd . "\n";
|
| 236 |
-
echo $output;
|
| 237 |
-
}
|
| 238 |
-
return $output;
|
| 239 |
-
}
|
| 240 |
-
|
| 241 |
-
//////////////////////////////
|
| 242 |
-
/// Regex helper functions ///
|
| 243 |
-
//////////////////////////////
|
| 244 |
-
|
| 245 |
-
function regex($regex) {
|
| 246 |
-
return '~' . LIB . '(?:' . str_replace('~', '\~', $regex) . ')~';
|
| 247 |
-
}
|
| 248 |
-
|
| 249 |
-
function magicSplit($regex, $string) {
|
| 250 |
-
$pieces = preg_split(regex('(?:(?&string)|(?&comment)|(?&code))(*SKIP)(*FAIL)|' . $regex), $string);
|
| 251 |
-
|
| 252 |
-
foreach ($pieces as &$piece) {
|
| 253 |
-
$piece = trim($piece);
|
| 254 |
-
}
|
| 255 |
-
|
| 256 |
-
if ($pieces === ['']) {
|
| 257 |
-
return [];
|
| 258 |
-
}
|
| 259 |
-
|
| 260 |
-
return $pieces;
|
| 261 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/grammar/tokens.template
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
$meta #
|
| 3 |
-
#semval($) $this->semValue
|
| 4 |
-
#semval($,%t) $this->semValue
|
| 5 |
-
#semval(%n) $this->stackPos-(%l-%n)
|
| 6 |
-
#semval(%n,%t) $this->stackPos-(%l-%n)
|
| 7 |
-
|
| 8 |
-
namespace PhpParser\Parser;
|
| 9 |
-
#include;
|
| 10 |
-
|
| 11 |
-
/* GENERATED file based on grammar/tokens.y */
|
| 12 |
-
final class Tokens
|
| 13 |
-
{
|
| 14 |
-
#tokenval
|
| 15 |
-
const %s = %n;
|
| 16 |
-
#endtokenval
|
| 17 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/grammar/tokens.y
DELETED
|
@@ -1,114 +0,0 @@
|
|
| 1 |
-
/* We currently rely on the token ID mapping to be the same between PHP 5 and PHP 7 - so the same lexer can be used for
|
| 2 |
-
* both. This is enforced by sharing this token file. */
|
| 3 |
-
|
| 4 |
-
%left T_INCLUDE T_INCLUDE_ONCE T_EVAL T_REQUIRE T_REQUIRE_ONCE
|
| 5 |
-
%left ','
|
| 6 |
-
%left T_LOGICAL_OR
|
| 7 |
-
%left T_LOGICAL_XOR
|
| 8 |
-
%left T_LOGICAL_AND
|
| 9 |
-
%right T_PRINT
|
| 10 |
-
%right T_YIELD
|
| 11 |
-
%right T_DOUBLE_ARROW
|
| 12 |
-
%right T_YIELD_FROM
|
| 13 |
-
%left '=' T_PLUS_EQUAL T_MINUS_EQUAL T_MUL_EQUAL T_DIV_EQUAL T_CONCAT_EQUAL T_MOD_EQUAL T_AND_EQUAL T_OR_EQUAL T_XOR_EQUAL T_SL_EQUAL T_SR_EQUAL T_POW_EQUAL T_COALESCE_EQUAL
|
| 14 |
-
%left '?' ':'
|
| 15 |
-
%right T_COALESCE
|
| 16 |
-
%left T_BOOLEAN_OR
|
| 17 |
-
%left T_BOOLEAN_AND
|
| 18 |
-
%left '|'
|
| 19 |
-
%left '^'
|
| 20 |
-
%left '&'
|
| 21 |
-
%nonassoc T_IS_EQUAL T_IS_NOT_EQUAL T_IS_IDENTICAL T_IS_NOT_IDENTICAL T_SPACESHIP
|
| 22 |
-
%nonassoc '<' T_IS_SMALLER_OR_EQUAL '>' T_IS_GREATER_OR_EQUAL
|
| 23 |
-
%left T_SL T_SR
|
| 24 |
-
%left '+' '-' '.'
|
| 25 |
-
%left '*' '/' '%'
|
| 26 |
-
%right '!'
|
| 27 |
-
%nonassoc T_INSTANCEOF
|
| 28 |
-
%right '~' T_INC T_DEC T_INT_CAST T_DOUBLE_CAST T_STRING_CAST T_ARRAY_CAST T_OBJECT_CAST T_BOOL_CAST T_UNSET_CAST '@'
|
| 29 |
-
%right T_POW
|
| 30 |
-
%right '['
|
| 31 |
-
%nonassoc T_NEW T_CLONE
|
| 32 |
-
%token T_EXIT
|
| 33 |
-
%token T_IF
|
| 34 |
-
%left T_ELSEIF
|
| 35 |
-
%left T_ELSE
|
| 36 |
-
%left T_ENDIF
|
| 37 |
-
%token T_LNUMBER
|
| 38 |
-
%token T_DNUMBER
|
| 39 |
-
%token T_STRING
|
| 40 |
-
%token T_STRING_VARNAME
|
| 41 |
-
%token T_VARIABLE
|
| 42 |
-
%token T_NUM_STRING
|
| 43 |
-
%token T_INLINE_HTML
|
| 44 |
-
%token T_CHARACTER
|
| 45 |
-
%token T_BAD_CHARACTER
|
| 46 |
-
%token T_ENCAPSED_AND_WHITESPACE
|
| 47 |
-
%token T_CONSTANT_ENCAPSED_STRING
|
| 48 |
-
%token T_ECHO
|
| 49 |
-
%token T_DO
|
| 50 |
-
%token T_WHILE
|
| 51 |
-
%token T_ENDWHILE
|
| 52 |
-
%token T_FOR
|
| 53 |
-
%token T_ENDFOR
|
| 54 |
-
%token T_FOREACH
|
| 55 |
-
%token T_ENDFOREACH
|
| 56 |
-
%token T_DECLARE
|
| 57 |
-
%token T_ENDDECLARE
|
| 58 |
-
%token T_AS
|
| 59 |
-
%token T_SWITCH
|
| 60 |
-
%token T_ENDSWITCH
|
| 61 |
-
%token T_CASE
|
| 62 |
-
%token T_DEFAULT
|
| 63 |
-
%token T_BREAK
|
| 64 |
-
%token T_CONTINUE
|
| 65 |
-
%token T_GOTO
|
| 66 |
-
%token T_FUNCTION
|
| 67 |
-
%token T_FN
|
| 68 |
-
%token T_CONST
|
| 69 |
-
%token T_RETURN
|
| 70 |
-
%token T_TRY
|
| 71 |
-
%token T_CATCH
|
| 72 |
-
%token T_FINALLY
|
| 73 |
-
%token T_THROW
|
| 74 |
-
%token T_USE
|
| 75 |
-
%token T_INSTEADOF
|
| 76 |
-
%token T_GLOBAL
|
| 77 |
-
%right T_STATIC T_ABSTRACT T_FINAL T_PRIVATE T_PROTECTED T_PUBLIC
|
| 78 |
-
%token T_VAR
|
| 79 |
-
%token T_UNSET
|
| 80 |
-
%token T_ISSET
|
| 81 |
-
%token T_EMPTY
|
| 82 |
-
%token T_HALT_COMPILER
|
| 83 |
-
%token T_CLASS
|
| 84 |
-
%token T_TRAIT
|
| 85 |
-
%token T_INTERFACE
|
| 86 |
-
%token T_EXTENDS
|
| 87 |
-
%token T_IMPLEMENTS
|
| 88 |
-
%token T_OBJECT_OPERATOR
|
| 89 |
-
%token T_DOUBLE_ARROW
|
| 90 |
-
%token T_LIST
|
| 91 |
-
%token T_ARRAY
|
| 92 |
-
%token T_CALLABLE
|
| 93 |
-
%token T_CLASS_C
|
| 94 |
-
%token T_TRAIT_C
|
| 95 |
-
%token T_METHOD_C
|
| 96 |
-
%token T_FUNC_C
|
| 97 |
-
%token T_LINE
|
| 98 |
-
%token T_FILE
|
| 99 |
-
%token T_COMMENT
|
| 100 |
-
%token T_DOC_COMMENT
|
| 101 |
-
%token T_OPEN_TAG
|
| 102 |
-
%token T_OPEN_TAG_WITH_ECHO
|
| 103 |
-
%token T_CLOSE_TAG
|
| 104 |
-
%token T_WHITESPACE
|
| 105 |
-
%token T_START_HEREDOC
|
| 106 |
-
%token T_END_HEREDOC
|
| 107 |
-
%token T_DOLLAR_OPEN_CURLY_BRACES
|
| 108 |
-
%token T_CURLY_OPEN
|
| 109 |
-
%token T_PAAMAYIM_NEKUDOTAYIM
|
| 110 |
-
%token T_NAMESPACE
|
| 111 |
-
%token T_NS_C
|
| 112 |
-
%token T_DIR
|
| 113 |
-
%token T_NS_SEPARATOR
|
| 114 |
-
%token T_ELLIPSIS
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Builder.php
DELETED
|
@@ -1,13 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
interface Builder
|
| 6 |
-
{
|
| 7 |
-
/**
|
| 8 |
-
* Returns the built node.
|
| 9 |
-
*
|
| 10 |
-
* @return Node The built node
|
| 11 |
-
*/
|
| 12 |
-
public function getNode() : Node;
|
| 13 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Builder/Class_.php
DELETED
|
@@ -1,122 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Builder;
|
| 4 |
-
|
| 5 |
-
use PhpParser;
|
| 6 |
-
use PhpParser\BuilderHelpers;
|
| 7 |
-
use PhpParser\Node\Name;
|
| 8 |
-
use PhpParser\Node\Stmt;
|
| 9 |
-
|
| 10 |
-
class Class_ extends Declaration
|
| 11 |
-
{
|
| 12 |
-
protected $name;
|
| 13 |
-
|
| 14 |
-
protected $extends = null;
|
| 15 |
-
protected $implements = [];
|
| 16 |
-
protected $flags = 0;
|
| 17 |
-
|
| 18 |
-
protected $uses = [];
|
| 19 |
-
protected $constants = [];
|
| 20 |
-
protected $properties = [];
|
| 21 |
-
protected $methods = [];
|
| 22 |
-
|
| 23 |
-
/**
|
| 24 |
-
* Creates a class builder.
|
| 25 |
-
*
|
| 26 |
-
* @param string $name Name of the class
|
| 27 |
-
*/
|
| 28 |
-
public function __construct(string $name) {
|
| 29 |
-
$this->name = $name;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
/**
|
| 33 |
-
* Extends a class.
|
| 34 |
-
*
|
| 35 |
-
* @param Name|string $class Name of class to extend
|
| 36 |
-
*
|
| 37 |
-
* @return $this The builder instance (for fluid interface)
|
| 38 |
-
*/
|
| 39 |
-
public function extend($class) {
|
| 40 |
-
$this->extends = BuilderHelpers::normalizeName($class);
|
| 41 |
-
|
| 42 |
-
return $this;
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
/**
|
| 46 |
-
* Implements one or more interfaces.
|
| 47 |
-
*
|
| 48 |
-
* @param Name|string ...$interfaces Names of interfaces to implement
|
| 49 |
-
*
|
| 50 |
-
* @return $this The builder instance (for fluid interface)
|
| 51 |
-
*/
|
| 52 |
-
public function implement(...$interfaces) {
|
| 53 |
-
foreach ($interfaces as $interface) {
|
| 54 |
-
$this->implements[] = BuilderHelpers::normalizeName($interface);
|
| 55 |
-
}
|
| 56 |
-
|
| 57 |
-
return $this;
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
/**
|
| 61 |
-
* Makes the class abstract.
|
| 62 |
-
*
|
| 63 |
-
* @return $this The builder instance (for fluid interface)
|
| 64 |
-
*/
|
| 65 |
-
public function makeAbstract() {
|
| 66 |
-
$this->flags = BuilderHelpers::addModifier($this->flags, Stmt\Class_::MODIFIER_ABSTRACT);
|
| 67 |
-
|
| 68 |
-
return $this;
|
| 69 |
-
}
|
| 70 |
-
|
| 71 |
-
/**
|
| 72 |
-
* Makes the class final.
|
| 73 |
-
*
|
| 74 |
-
* @return $this The builder instance (for fluid interface)
|
| 75 |
-
*/
|
| 76 |
-
public function makeFinal() {
|
| 77 |
-
$this->flags = BuilderHelpers::addModifier($this->flags, Stmt\Class_::MODIFIER_FINAL);
|
| 78 |
-
|
| 79 |
-
return $this;
|
| 80 |
-
}
|
| 81 |
-
|
| 82 |
-
/**
|
| 83 |
-
* Adds a statement.
|
| 84 |
-
*
|
| 85 |
-
* @param Stmt|PhpParser\Builder $stmt The statement to add
|
| 86 |
-
*
|
| 87 |
-
* @return $this The builder instance (for fluid interface)
|
| 88 |
-
*/
|
| 89 |
-
public function addStmt($stmt) {
|
| 90 |
-
$stmt = BuilderHelpers::normalizeNode($stmt);
|
| 91 |
-
|
| 92 |
-
$targets = [
|
| 93 |
-
Stmt\TraitUse::class => &$this->uses,
|
| 94 |
-
Stmt\ClassConst::class => &$this->constants,
|
| 95 |
-
Stmt\Property::class => &$this->properties,
|
| 96 |
-
Stmt\ClassMethod::class => &$this->methods,
|
| 97 |
-
];
|
| 98 |
-
|
| 99 |
-
$class = \get_class($stmt);
|
| 100 |
-
if (!isset($targets[$class])) {
|
| 101 |
-
throw new \LogicException(sprintf('Unexpected node of type "%s"', $stmt->getType()));
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
-
$targets[$class][] = $stmt;
|
| 105 |
-
|
| 106 |
-
return $this;
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
/**
|
| 110 |
-
* Returns the built class node.
|
| 111 |
-
*
|
| 112 |
-
* @return Stmt\Class_ The built class node
|
| 113 |
-
*/
|
| 114 |
-
public function getNode() : PhpParser\Node {
|
| 115 |
-
return new Stmt\Class_($this->name, [
|
| 116 |
-
'flags' => $this->flags,
|
| 117 |
-
'extends' => $this->extends,
|
| 118 |
-
'implements' => $this->implements,
|
| 119 |
-
'stmts' => array_merge($this->uses, $this->constants, $this->properties, $this->methods),
|
| 120 |
-
], $this->attributes);
|
| 121 |
-
}
|
| 122 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Builder/Declaration.php
DELETED
|
@@ -1,43 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Builder;
|
| 4 |
-
|
| 5 |
-
use PhpParser;
|
| 6 |
-
use PhpParser\BuilderHelpers;
|
| 7 |
-
|
| 8 |
-
abstract class Declaration implements PhpParser\Builder
|
| 9 |
-
{
|
| 10 |
-
protected $attributes = [];
|
| 11 |
-
|
| 12 |
-
abstract public function addStmt($stmt);
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Adds multiple statements.
|
| 16 |
-
*
|
| 17 |
-
* @param array $stmts The statements to add
|
| 18 |
-
*
|
| 19 |
-
* @return $this The builder instance (for fluid interface)
|
| 20 |
-
*/
|
| 21 |
-
public function addStmts(array $stmts) {
|
| 22 |
-
foreach ($stmts as $stmt) {
|
| 23 |
-
$this->addStmt($stmt);
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
return $this;
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
/**
|
| 30 |
-
* Sets doc comment for the declaration.
|
| 31 |
-
*
|
| 32 |
-
* @param PhpParser\Comment\Doc|string $docComment Doc comment to set
|
| 33 |
-
*
|
| 34 |
-
* @return $this The builder instance (for fluid interface)
|
| 35 |
-
*/
|
| 36 |
-
public function setDocComment($docComment) {
|
| 37 |
-
$this->attributes['comments'] = [
|
| 38 |
-
BuilderHelpers::normalizeDocComment($docComment)
|
| 39 |
-
];
|
| 40 |
-
|
| 41 |
-
return $this;
|
| 42 |
-
}
|
| 43 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Builder/FunctionLike.php
DELETED
|
@@ -1,74 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Builder;
|
| 4 |
-
|
| 5 |
-
use PhpParser\BuilderHelpers;
|
| 6 |
-
use PhpParser\Node;
|
| 7 |
-
|
| 8 |
-
abstract class FunctionLike extends Declaration
|
| 9 |
-
{
|
| 10 |
-
protected $returnByRef = false;
|
| 11 |
-
protected $params = [];
|
| 12 |
-
|
| 13 |
-
/** @var string|Node\Name|Node\NullableType|null */
|
| 14 |
-
protected $returnType = null;
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* Make the function return by reference.
|
| 18 |
-
*
|
| 19 |
-
* @return $this The builder instance (for fluid interface)
|
| 20 |
-
*/
|
| 21 |
-
public function makeReturnByRef() {
|
| 22 |
-
$this->returnByRef = true;
|
| 23 |
-
|
| 24 |
-
return $this;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
/**
|
| 28 |
-
* Adds a parameter.
|
| 29 |
-
*
|
| 30 |
-
* @param Node\Param|Param $param The parameter to add
|
| 31 |
-
*
|
| 32 |
-
* @return $this The builder instance (for fluid interface)
|
| 33 |
-
*/
|
| 34 |
-
public function addParam($param) {
|
| 35 |
-
$param = BuilderHelpers::normalizeNode($param);
|
| 36 |
-
|
| 37 |
-
if (!$param instanceof Node\Param) {
|
| 38 |
-
throw new \LogicException(sprintf('Expected parameter node, got "%s"', $param->getType()));
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
$this->params[] = $param;
|
| 42 |
-
|
| 43 |
-
return $this;
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
/**
|
| 47 |
-
* Adds multiple parameters.
|
| 48 |
-
*
|
| 49 |
-
* @param array $params The parameters to add
|
| 50 |
-
*
|
| 51 |
-
* @return $this The builder instance (for fluid interface)
|
| 52 |
-
*/
|
| 53 |
-
public function addParams(array $params) {
|
| 54 |
-
foreach ($params as $param) {
|
| 55 |
-
$this->addParam($param);
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
return $this;
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
/**
|
| 62 |
-
* Sets the return type for PHP 7.
|
| 63 |
-
*
|
| 64 |
-
* @param string|Node\Name|Node\NullableType $type One of array, callable, string, int, float,
|
| 65 |
-
* bool, iterable, or a class/interface name.
|
| 66 |
-
*
|
| 67 |
-
* @return $this The builder instance (for fluid interface)
|
| 68 |
-
*/
|
| 69 |
-
public function setReturnType($type) {
|
| 70 |
-
$this->returnType = BuilderHelpers::normalizeType($type);
|
| 71 |
-
|
| 72 |
-
return $this;
|
| 73 |
-
}
|
| 74 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Builder/Function_.php
DELETED
|
@@ -1,50 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Builder;
|
| 4 |
-
|
| 5 |
-
use PhpParser;
|
| 6 |
-
use PhpParser\BuilderHelpers;
|
| 7 |
-
use PhpParser\Node;
|
| 8 |
-
use PhpParser\Node\Stmt;
|
| 9 |
-
|
| 10 |
-
class Function_ extends FunctionLike
|
| 11 |
-
{
|
| 12 |
-
protected $name;
|
| 13 |
-
protected $stmts = [];
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* Creates a function builder.
|
| 17 |
-
*
|
| 18 |
-
* @param string $name Name of the function
|
| 19 |
-
*/
|
| 20 |
-
public function __construct(string $name) {
|
| 21 |
-
$this->name = $name;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
/**
|
| 25 |
-
* Adds a statement.
|
| 26 |
-
*
|
| 27 |
-
* @param Node|PhpParser\Builder $stmt The statement to add
|
| 28 |
-
*
|
| 29 |
-
* @return $this The builder instance (for fluid interface)
|
| 30 |
-
*/
|
| 31 |
-
public function addStmt($stmt) {
|
| 32 |
-
$this->stmts[] = BuilderHelpers::normalizeStmt($stmt);
|
| 33 |
-
|
| 34 |
-
return $this;
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
/**
|
| 38 |
-
* Returns the built function node.
|
| 39 |
-
*
|
| 40 |
-
* @return Stmt\Function_ The built function node
|
| 41 |
-
*/
|
| 42 |
-
public function getNode() : Node {
|
| 43 |
-
return new Stmt\Function_($this->name, [
|
| 44 |
-
'byRef' => $this->returnByRef,
|
| 45 |
-
'params' => $this->params,
|
| 46 |
-
'returnType' => $this->returnType,
|
| 47 |
-
'stmts' => $this->stmts,
|
| 48 |
-
], $this->attributes);
|
| 49 |
-
}
|
| 50 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Builder/Interface_.php
DELETED
|
@@ -1,75 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Builder;
|
| 4 |
-
|
| 5 |
-
use PhpParser;
|
| 6 |
-
use PhpParser\BuilderHelpers;
|
| 7 |
-
use PhpParser\Node\Name;
|
| 8 |
-
use PhpParser\Node\Stmt;
|
| 9 |
-
|
| 10 |
-
class Interface_ extends Declaration
|
| 11 |
-
{
|
| 12 |
-
protected $name;
|
| 13 |
-
protected $extends = [];
|
| 14 |
-
protected $constants = [];
|
| 15 |
-
protected $methods = [];
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* Creates an interface builder.
|
| 19 |
-
*
|
| 20 |
-
* @param string $name Name of the interface
|
| 21 |
-
*/
|
| 22 |
-
public function __construct(string $name) {
|
| 23 |
-
$this->name = $name;
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
/**
|
| 27 |
-
* Extends one or more interfaces.
|
| 28 |
-
*
|
| 29 |
-
* @param Name|string ...$interfaces Names of interfaces to extend
|
| 30 |
-
*
|
| 31 |
-
* @return $this The builder instance (for fluid interface)
|
| 32 |
-
*/
|
| 33 |
-
public function extend(...$interfaces) {
|
| 34 |
-
foreach ($interfaces as $interface) {
|
| 35 |
-
$this->extends[] = BuilderHelpers::normalizeName($interface);
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
return $this;
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
/**
|
| 42 |
-
* Adds a statement.
|
| 43 |
-
*
|
| 44 |
-
* @param Stmt|PhpParser\Builder $stmt The statement to add
|
| 45 |
-
*
|
| 46 |
-
* @return $this The builder instance (for fluid interface)
|
| 47 |
-
*/
|
| 48 |
-
public function addStmt($stmt) {
|
| 49 |
-
$stmt = BuilderHelpers::normalizeNode($stmt);
|
| 50 |
-
|
| 51 |
-
if ($stmt instanceof Stmt\ClassConst) {
|
| 52 |
-
$this->constants[] = $stmt;
|
| 53 |
-
} elseif ($stmt instanceof Stmt\ClassMethod) {
|
| 54 |
-
// we erase all statements in the body of an interface method
|
| 55 |
-
$stmt->stmts = null;
|
| 56 |
-
$this->methods[] = $stmt;
|
| 57 |
-
} else {
|
| 58 |
-
throw new \LogicException(sprintf('Unexpected node of type "%s"', $stmt->getType()));
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
return $this;
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
/**
|
| 65 |
-
* Returns the built interface node.
|
| 66 |
-
*
|
| 67 |
-
* @return Stmt\Interface_ The built interface node
|
| 68 |
-
*/
|
| 69 |
-
public function getNode() : PhpParser\Node {
|
| 70 |
-
return new Stmt\Interface_($this->name, [
|
| 71 |
-
'extends' => $this->extends,
|
| 72 |
-
'stmts' => array_merge($this->constants, $this->methods),
|
| 73 |
-
], $this->attributes);
|
| 74 |
-
}
|
| 75 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Builder/Method.php
DELETED
|
@@ -1,129 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Builder;
|
| 4 |
-
|
| 5 |
-
use PhpParser;
|
| 6 |
-
use PhpParser\BuilderHelpers;
|
| 7 |
-
use PhpParser\Node;
|
| 8 |
-
use PhpParser\Node\Stmt;
|
| 9 |
-
|
| 10 |
-
class Method extends FunctionLike
|
| 11 |
-
{
|
| 12 |
-
protected $name;
|
| 13 |
-
protected $flags = 0;
|
| 14 |
-
|
| 15 |
-
/** @var array|null */
|
| 16 |
-
protected $stmts = [];
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* Creates a method builder.
|
| 20 |
-
*
|
| 21 |
-
* @param string $name Name of the method
|
| 22 |
-
*/
|
| 23 |
-
public function __construct(string $name) {
|
| 24 |
-
$this->name = $name;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
/**
|
| 28 |
-
* Makes the method public.
|
| 29 |
-
*
|
| 30 |
-
* @return $this The builder instance (for fluid interface)
|
| 31 |
-
*/
|
| 32 |
-
public function makePublic() {
|
| 33 |
-
$this->flags = BuilderHelpers::addModifier($this->flags, Stmt\Class_::MODIFIER_PUBLIC);
|
| 34 |
-
|
| 35 |
-
return $this;
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
/**
|
| 39 |
-
* Makes the method protected.
|
| 40 |
-
*
|
| 41 |
-
* @return $this The builder instance (for fluid interface)
|
| 42 |
-
*/
|
| 43 |
-
public function makeProtected() {
|
| 44 |
-
$this->flags = BuilderHelpers::addModifier($this->flags, Stmt\Class_::MODIFIER_PROTECTED);
|
| 45 |
-
|
| 46 |
-
return $this;
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
/**
|
| 50 |
-
* Makes the method private.
|
| 51 |
-
*
|
| 52 |
-
* @return $this The builder instance (for fluid interface)
|
| 53 |
-
*/
|
| 54 |
-
public function makePrivate() {
|
| 55 |
-
$this->flags = BuilderHelpers::addModifier($this->flags, Stmt\Class_::MODIFIER_PRIVATE);
|
| 56 |
-
|
| 57 |
-
return $this;
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
/**
|
| 61 |
-
* Makes the method static.
|
| 62 |
-
*
|
| 63 |
-
* @return $this The builder instance (for fluid interface)
|
| 64 |
-
*/
|
| 65 |
-
public function makeStatic() {
|
| 66 |
-
$this->flags = BuilderHelpers::addModifier($this->flags, Stmt\Class_::MODIFIER_STATIC);
|
| 67 |
-
|
| 68 |
-
return $this;
|
| 69 |
-
}
|
| 70 |
-
|
| 71 |
-
/**
|
| 72 |
-
* Makes the method abstract.
|
| 73 |
-
*
|
| 74 |
-
* @return $this The builder instance (for fluid interface)
|
| 75 |
-
*/
|
| 76 |
-
public function makeAbstract() {
|
| 77 |
-
if (!empty($this->stmts)) {
|
| 78 |
-
throw new \LogicException('Cannot make method with statements abstract');
|
| 79 |
-
}
|
| 80 |
-
|
| 81 |
-
$this->flags = BuilderHelpers::addModifier($this->flags, Stmt\Class_::MODIFIER_ABSTRACT);
|
| 82 |
-
$this->stmts = null; // abstract methods don't have statements
|
| 83 |
-
|
| 84 |
-
return $this;
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
/**
|
| 88 |
-
* Makes the method final.
|
| 89 |
-
*
|
| 90 |
-
* @return $this The builder instance (for fluid interface)
|
| 91 |
-
*/
|
| 92 |
-
public function makeFinal() {
|
| 93 |
-
$this->flags = BuilderHelpers::addModifier($this->flags, Stmt\Class_::MODIFIER_FINAL);
|
| 94 |
-
|
| 95 |
-
return $this;
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
/**
|
| 99 |
-
* Adds a statement.
|
| 100 |
-
*
|
| 101 |
-
* @param Node|PhpParser\Builder $stmt The statement to add
|
| 102 |
-
*
|
| 103 |
-
* @return $this The builder instance (for fluid interface)
|
| 104 |
-
*/
|
| 105 |
-
public function addStmt($stmt) {
|
| 106 |
-
if (null === $this->stmts) {
|
| 107 |
-
throw new \LogicException('Cannot add statements to an abstract method');
|
| 108 |
-
}
|
| 109 |
-
|
| 110 |
-
$this->stmts[] = BuilderHelpers::normalizeStmt($stmt);
|
| 111 |
-
|
| 112 |
-
return $this;
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
/**
|
| 116 |
-
* Returns the built method node.
|
| 117 |
-
*
|
| 118 |
-
* @return Stmt\ClassMethod The built method node
|
| 119 |
-
*/
|
| 120 |
-
public function getNode() : Node {
|
| 121 |
-
return new Stmt\ClassMethod($this->name, [
|
| 122 |
-
'flags' => $this->flags,
|
| 123 |
-
'byRef' => $this->returnByRef,
|
| 124 |
-
'params' => $this->params,
|
| 125 |
-
'returnType' => $this->returnType,
|
| 126 |
-
'stmts' => $this->stmts,
|
| 127 |
-
], $this->attributes);
|
| 128 |
-
}
|
| 129 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Builder/Namespace_.php
DELETED
|
@@ -1,45 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Builder;
|
| 4 |
-
|
| 5 |
-
use PhpParser;
|
| 6 |
-
use PhpParser\BuilderHelpers;
|
| 7 |
-
use PhpParser\Node;
|
| 8 |
-
use PhpParser\Node\Stmt;
|
| 9 |
-
|
| 10 |
-
class Namespace_ extends Declaration
|
| 11 |
-
{
|
| 12 |
-
private $name;
|
| 13 |
-
private $stmts = [];
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* Creates a namespace builder.
|
| 17 |
-
*
|
| 18 |
-
* @param Node\Name|string|null $name Name of the namespace
|
| 19 |
-
*/
|
| 20 |
-
public function __construct($name) {
|
| 21 |
-
$this->name = null !== $name ? BuilderHelpers::normalizeName($name) : null;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
/**
|
| 25 |
-
* Adds a statement.
|
| 26 |
-
*
|
| 27 |
-
* @param Node|PhpParser\Builder $stmt The statement to add
|
| 28 |
-
*
|
| 29 |
-
* @return $this The builder instance (for fluid interface)
|
| 30 |
-
*/
|
| 31 |
-
public function addStmt($stmt) {
|
| 32 |
-
$this->stmts[] = BuilderHelpers::normalizeStmt($stmt);
|
| 33 |
-
|
| 34 |
-
return $this;
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
/**
|
| 38 |
-
* Returns the built node.
|
| 39 |
-
*
|
| 40 |
-
* @return Node The built node
|
| 41 |
-
*/
|
| 42 |
-
public function getNode() : Node {
|
| 43 |
-
return new Stmt\Namespace_($this->name, $this->stmts, $this->attributes);
|
| 44 |
-
}
|
| 45 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Builder/Param.php
DELETED
|
@@ -1,106 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Builder;
|
| 4 |
-
|
| 5 |
-
use PhpParser;
|
| 6 |
-
use PhpParser\BuilderHelpers;
|
| 7 |
-
use PhpParser\Node;
|
| 8 |
-
|
| 9 |
-
class Param implements PhpParser\Builder
|
| 10 |
-
{
|
| 11 |
-
protected $name;
|
| 12 |
-
|
| 13 |
-
protected $default = null;
|
| 14 |
-
|
| 15 |
-
/** @var Node\Identifier|Node\Name|Node\NullableType|null */
|
| 16 |
-
protected $type = null;
|
| 17 |
-
|
| 18 |
-
protected $byRef = false;
|
| 19 |
-
|
| 20 |
-
protected $variadic = false;
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Creates a parameter builder.
|
| 24 |
-
*
|
| 25 |
-
* @param string $name Name of the parameter
|
| 26 |
-
*/
|
| 27 |
-
public function __construct(string $name) {
|
| 28 |
-
$this->name = $name;
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
/**
|
| 32 |
-
* Sets default value for the parameter.
|
| 33 |
-
*
|
| 34 |
-
* @param mixed $value Default value to use
|
| 35 |
-
*
|
| 36 |
-
* @return $this The builder instance (for fluid interface)
|
| 37 |
-
*/
|
| 38 |
-
public function setDefault($value) {
|
| 39 |
-
$this->default = BuilderHelpers::normalizeValue($value);
|
| 40 |
-
|
| 41 |
-
return $this;
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
/**
|
| 45 |
-
* Sets type for the parameter.
|
| 46 |
-
*
|
| 47 |
-
* @param string|Node\Name|Node\NullableType|Node\UnionType $type Parameter type
|
| 48 |
-
*
|
| 49 |
-
* @return $this The builder instance (for fluid interface)
|
| 50 |
-
*/
|
| 51 |
-
public function setType($type) {
|
| 52 |
-
$this->type = BuilderHelpers::normalizeType($type);
|
| 53 |
-
if ($this->type == 'void') {
|
| 54 |
-
throw new \LogicException('Parameter type cannot be void');
|
| 55 |
-
}
|
| 56 |
-
|
| 57 |
-
return $this;
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
/**
|
| 61 |
-
* Sets type for the parameter.
|
| 62 |
-
*
|
| 63 |
-
* @param string|Node\Name|Node\NullableType|Node\UnionType $type Parameter type
|
| 64 |
-
*
|
| 65 |
-
* @return $this The builder instance (for fluid interface)
|
| 66 |
-
*
|
| 67 |
-
* @deprecated Use setType() instead
|
| 68 |
-
*/
|
| 69 |
-
public function setTypeHint($type) {
|
| 70 |
-
return $this->setType($type);
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
/**
|
| 74 |
-
* Make the parameter accept the value by reference.
|
| 75 |
-
*
|
| 76 |
-
* @return $this The builder instance (for fluid interface)
|
| 77 |
-
*/
|
| 78 |
-
public function makeByRef() {
|
| 79 |
-
$this->byRef = true;
|
| 80 |
-
|
| 81 |
-
return $this;
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
/**
|
| 85 |
-
* Make the parameter variadic
|
| 86 |
-
*
|
| 87 |
-
* @return $this The builder instance (for fluid interface)
|
| 88 |
-
*/
|
| 89 |
-
public function makeVariadic() {
|
| 90 |
-
$this->variadic = true;
|
| 91 |
-
|
| 92 |
-
return $this;
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
/**
|
| 96 |
-
* Returns the built parameter node.
|
| 97 |
-
*
|
| 98 |
-
* @return Node\Param The built parameter node
|
| 99 |
-
*/
|
| 100 |
-
public function getNode() : Node {
|
| 101 |
-
return new Node\Param(
|
| 102 |
-
new Node\Expr\Variable($this->name),
|
| 103 |
-
$this->default, $this->type, $this->byRef, $this->variadic
|
| 104 |
-
);
|
| 105 |
-
}
|
| 106 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Builder/Property.php
DELETED
|
@@ -1,132 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Builder;
|
| 4 |
-
|
| 5 |
-
use PhpParser;
|
| 6 |
-
use PhpParser\BuilderHelpers;
|
| 7 |
-
use PhpParser\Node\Identifier;
|
| 8 |
-
use PhpParser\Node\Name;
|
| 9 |
-
use PhpParser\Node\NullableType;
|
| 10 |
-
use PhpParser\Node\Stmt;
|
| 11 |
-
|
| 12 |
-
class Property implements PhpParser\Builder
|
| 13 |
-
{
|
| 14 |
-
protected $name;
|
| 15 |
-
|
| 16 |
-
protected $flags = 0;
|
| 17 |
-
protected $default = null;
|
| 18 |
-
protected $attributes = [];
|
| 19 |
-
|
| 20 |
-
/** @var null|Identifier|Name|NullableType */
|
| 21 |
-
protected $type;
|
| 22 |
-
|
| 23 |
-
/**
|
| 24 |
-
* Creates a property builder.
|
| 25 |
-
*
|
| 26 |
-
* @param string $name Name of the property
|
| 27 |
-
*/
|
| 28 |
-
public function __construct(string $name) {
|
| 29 |
-
$this->name = $name;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
/**
|
| 33 |
-
* Makes the property public.
|
| 34 |
-
*
|
| 35 |
-
* @return $this The builder instance (for fluid interface)
|
| 36 |
-
*/
|
| 37 |
-
public function makePublic() {
|
| 38 |
-
$this->flags = BuilderHelpers::addModifier($this->flags, Stmt\Class_::MODIFIER_PUBLIC);
|
| 39 |
-
|
| 40 |
-
return $this;
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
/**
|
| 44 |
-
* Makes the property protected.
|
| 45 |
-
*
|
| 46 |
-
* @return $this The builder instance (for fluid interface)
|
| 47 |
-
*/
|
| 48 |
-
public function makeProtected() {
|
| 49 |
-
$this->flags = BuilderHelpers::addModifier($this->flags, Stmt\Class_::MODIFIER_PROTECTED);
|
| 50 |
-
|
| 51 |
-
return $this;
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
/**
|
| 55 |
-
* Makes the property private.
|
| 56 |
-
*
|
| 57 |
-
* @return $this The builder instance (for fluid interface)
|
| 58 |
-
*/
|
| 59 |
-
public function makePrivate() {
|
| 60 |
-
$this->flags = BuilderHelpers::addModifier($this->flags, Stmt\Class_::MODIFIER_PRIVATE);
|
| 61 |
-
|
| 62 |
-
return $this;
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
/**
|
| 66 |
-
* Makes the property static.
|
| 67 |
-
*
|
| 68 |
-
* @return $this The builder instance (for fluid interface)
|
| 69 |
-
*/
|
| 70 |
-
public function makeStatic() {
|
| 71 |
-
$this->flags = BuilderHelpers::addModifier($this->flags, Stmt\Class_::MODIFIER_STATIC);
|
| 72 |
-
|
| 73 |
-
return $this;
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
/**
|
| 77 |
-
* Sets default value for the property.
|
| 78 |
-
*
|
| 79 |
-
* @param mixed $value Default value to use
|
| 80 |
-
*
|
| 81 |
-
* @return $this The builder instance (for fluid interface)
|
| 82 |
-
*/
|
| 83 |
-
public function setDefault($value) {
|
| 84 |
-
$this->default = BuilderHelpers::normalizeValue($value);
|
| 85 |
-
|
| 86 |
-
return $this;
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
/**
|
| 90 |
-
* Sets doc comment for the property.
|
| 91 |
-
*
|
| 92 |
-
* @param PhpParser\Comment\Doc|string $docComment Doc comment to set
|
| 93 |
-
*
|
| 94 |
-
* @return $this The builder instance (for fluid interface)
|
| 95 |
-
*/
|
| 96 |
-
public function setDocComment($docComment) {
|
| 97 |
-
$this->attributes = [
|
| 98 |
-
'comments' => [BuilderHelpers::normalizeDocComment($docComment)]
|
| 99 |
-
];
|
| 100 |
-
|
| 101 |
-
return $this;
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
-
/**
|
| 105 |
-
* Sets the property type for PHP 7.4+.
|
| 106 |
-
*
|
| 107 |
-
* @param string|Name|NullableType|Identifier $type
|
| 108 |
-
*
|
| 109 |
-
* @return $this
|
| 110 |
-
*/
|
| 111 |
-
public function setType($type) {
|
| 112 |
-
$this->type = BuilderHelpers::normalizeType($type);
|
| 113 |
-
|
| 114 |
-
return $this;
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
/**
|
| 118 |
-
* Returns the built class node.
|
| 119 |
-
*
|
| 120 |
-
* @return Stmt\Property The built property node
|
| 121 |
-
*/
|
| 122 |
-
public function getNode() : PhpParser\Node {
|
| 123 |
-
return new Stmt\Property(
|
| 124 |
-
$this->flags !== 0 ? $this->flags : Stmt\Class_::MODIFIER_PUBLIC,
|
| 125 |
-
[
|
| 126 |
-
new Stmt\PropertyProperty($this->name, $this->default)
|
| 127 |
-
],
|
| 128 |
-
$this->attributes,
|
| 129 |
-
$this->type
|
| 130 |
-
);
|
| 131 |
-
}
|
| 132 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Builder/TraitUse.php
DELETED
|
@@ -1,64 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Builder;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Builder;
|
| 6 |
-
use PhpParser\BuilderHelpers;
|
| 7 |
-
use PhpParser\Node;
|
| 8 |
-
use PhpParser\Node\Stmt;
|
| 9 |
-
|
| 10 |
-
class TraitUse implements Builder
|
| 11 |
-
{
|
| 12 |
-
protected $traits = [];
|
| 13 |
-
protected $adaptations = [];
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* Creates a trait use builder.
|
| 17 |
-
*
|
| 18 |
-
* @param Node\Name|string ...$traits Names of used traits
|
| 19 |
-
*/
|
| 20 |
-
public function __construct(...$traits) {
|
| 21 |
-
foreach ($traits as $trait) {
|
| 22 |
-
$this->and($trait);
|
| 23 |
-
}
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
/**
|
| 27 |
-
* Adds used trait.
|
| 28 |
-
*
|
| 29 |
-
* @param Node\Name|string $trait Trait name
|
| 30 |
-
*
|
| 31 |
-
* @return $this The builder instance (for fluid interface)
|
| 32 |
-
*/
|
| 33 |
-
public function and($trait) {
|
| 34 |
-
$this->traits[] = BuilderHelpers::normalizeName($trait);
|
| 35 |
-
return $this;
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
/**
|
| 39 |
-
* Adds trait adaptation.
|
| 40 |
-
*
|
| 41 |
-
* @param Stmt\TraitUseAdaptation|Builder\TraitUseAdaptation $adaptation Trait adaptation
|
| 42 |
-
*
|
| 43 |
-
* @return $this The builder instance (for fluid interface)
|
| 44 |
-
*/
|
| 45 |
-
public function with($adaptation) {
|
| 46 |
-
$adaptation = BuilderHelpers::normalizeNode($adaptation);
|
| 47 |
-
|
| 48 |
-
if (!$adaptation instanceof Stmt\TraitUseAdaptation) {
|
| 49 |
-
throw new \LogicException('Adaptation must have type TraitUseAdaptation');
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
$this->adaptations[] = $adaptation;
|
| 53 |
-
return $this;
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
/**
|
| 57 |
-
* Returns the built node.
|
| 58 |
-
*
|
| 59 |
-
* @return Node The built node
|
| 60 |
-
*/
|
| 61 |
-
public function getNode() : Node {
|
| 62 |
-
return new Stmt\TraitUse($this->traits, $this->adaptations);
|
| 63 |
-
}
|
| 64 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Builder/TraitUseAdaptation.php
DELETED
|
@@ -1,148 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Builder;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Builder;
|
| 6 |
-
use PhpParser\BuilderHelpers;
|
| 7 |
-
use PhpParser\Node;
|
| 8 |
-
use PhpParser\Node\Stmt;
|
| 9 |
-
|
| 10 |
-
class TraitUseAdaptation implements Builder
|
| 11 |
-
{
|
| 12 |
-
const TYPE_UNDEFINED = 0;
|
| 13 |
-
const TYPE_ALIAS = 1;
|
| 14 |
-
const TYPE_PRECEDENCE = 2;
|
| 15 |
-
|
| 16 |
-
/** @var int Type of building adaptation */
|
| 17 |
-
protected $type;
|
| 18 |
-
|
| 19 |
-
protected $trait;
|
| 20 |
-
protected $method;
|
| 21 |
-
|
| 22 |
-
protected $modifier = null;
|
| 23 |
-
protected $alias = null;
|
| 24 |
-
|
| 25 |
-
protected $insteadof = [];
|
| 26 |
-
|
| 27 |
-
/**
|
| 28 |
-
* Creates a trait use adaptation builder.
|
| 29 |
-
*
|
| 30 |
-
* @param Node\Name|string|null $trait Name of adaptated trait
|
| 31 |
-
* @param Node\Identifier|string $method Name of adaptated method
|
| 32 |
-
*/
|
| 33 |
-
public function __construct($trait, $method) {
|
| 34 |
-
$this->type = self::TYPE_UNDEFINED;
|
| 35 |
-
|
| 36 |
-
$this->trait = is_null($trait)? null: BuilderHelpers::normalizeName($trait);
|
| 37 |
-
$this->method = BuilderHelpers::normalizeIdentifier($method);
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
/**
|
| 41 |
-
* Sets alias of method.
|
| 42 |
-
*
|
| 43 |
-
* @param Node\Identifier|string $alias Alias for adaptated method
|
| 44 |
-
*
|
| 45 |
-
* @return $this The builder instance (for fluid interface)
|
| 46 |
-
*/
|
| 47 |
-
public function as($alias) {
|
| 48 |
-
if ($this->type === self::TYPE_UNDEFINED) {
|
| 49 |
-
$this->type = self::TYPE_ALIAS;
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
if ($this->type !== self::TYPE_ALIAS) {
|
| 53 |
-
throw new \LogicException('Cannot set alias for not alias adaptation buider');
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
$this->alias = $alias;
|
| 57 |
-
return $this;
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
/**
|
| 61 |
-
* Sets adaptated method public.
|
| 62 |
-
*
|
| 63 |
-
* @return $this The builder instance (for fluid interface)
|
| 64 |
-
*/
|
| 65 |
-
public function makePublic() {
|
| 66 |
-
$this->setModifier(Stmt\Class_::MODIFIER_PUBLIC);
|
| 67 |
-
return $this;
|
| 68 |
-
}
|
| 69 |
-
|
| 70 |
-
/**
|
| 71 |
-
* Sets adaptated method protected.
|
| 72 |
-
*
|
| 73 |
-
* @return $this The builder instance (for fluid interface)
|
| 74 |
-
*/
|
| 75 |
-
public function makeProtected() {
|
| 76 |
-
$this->setModifier(Stmt\Class_::MODIFIER_PROTECTED);
|
| 77 |
-
return $this;
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
/**
|
| 81 |
-
* Sets adaptated method private.
|
| 82 |
-
*
|
| 83 |
-
* @return $this The builder instance (for fluid interface)
|
| 84 |
-
*/
|
| 85 |
-
public function makePrivate() {
|
| 86 |
-
$this->setModifier(Stmt\Class_::MODIFIER_PRIVATE);
|
| 87 |
-
return $this;
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
/**
|
| 91 |
-
* Adds overwritten traits.
|
| 92 |
-
*
|
| 93 |
-
* @param Node\Name|string ...$traits Traits for overwrite
|
| 94 |
-
*
|
| 95 |
-
* @return $this The builder instance (for fluid interface)
|
| 96 |
-
*/
|
| 97 |
-
public function insteadof(...$traits) {
|
| 98 |
-
if ($this->type === self::TYPE_UNDEFINED) {
|
| 99 |
-
if (is_null($this->trait)) {
|
| 100 |
-
throw new \LogicException('Precedence adaptation must have trait');
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
$this->type = self::TYPE_PRECEDENCE;
|
| 104 |
-
}
|
| 105 |
-
|
| 106 |
-
if ($this->type !== self::TYPE_PRECEDENCE) {
|
| 107 |
-
throw new \LogicException('Cannot add overwritten traits for not precedence adaptation buider');
|
| 108 |
-
}
|
| 109 |
-
|
| 110 |
-
foreach ($traits as $trait) {
|
| 111 |
-
$this->insteadof[] = BuilderHelpers::normalizeName($trait);
|
| 112 |
-
}
|
| 113 |
-
|
| 114 |
-
return $this;
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
protected function setModifier(int $modifier) {
|
| 118 |
-
if ($this->type === self::TYPE_UNDEFINED) {
|
| 119 |
-
$this->type = self::TYPE_ALIAS;
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
if ($this->type !== self::TYPE_ALIAS) {
|
| 123 |
-
throw new \LogicException('Cannot set access modifier for not alias adaptation buider');
|
| 124 |
-
}
|
| 125 |
-
|
| 126 |
-
if (is_null($this->modifier)) {
|
| 127 |
-
$this->modifier = $modifier;
|
| 128 |
-
} else {
|
| 129 |
-
throw new \LogicException('Multiple access type modifiers are not allowed');
|
| 130 |
-
}
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
/**
|
| 134 |
-
* Returns the built node.
|
| 135 |
-
*
|
| 136 |
-
* @return Node The built node
|
| 137 |
-
*/
|
| 138 |
-
public function getNode() : Node {
|
| 139 |
-
switch ($this->type) {
|
| 140 |
-
case self::TYPE_ALIAS:
|
| 141 |
-
return new Stmt\TraitUseAdaptation\Alias($this->trait, $this->method, $this->modifier, $this->alias);
|
| 142 |
-
case self::TYPE_PRECEDENCE:
|
| 143 |
-
return new Stmt\TraitUseAdaptation\Precedence($this->trait, $this->method, $this->insteadof);
|
| 144 |
-
default:
|
| 145 |
-
throw new \LogicException('Type of adaptation is not defined');
|
| 146 |
-
}
|
| 147 |
-
}
|
| 148 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Builder/Trait_.php
DELETED
|
@@ -1,60 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Builder;
|
| 4 |
-
|
| 5 |
-
use PhpParser;
|
| 6 |
-
use PhpParser\BuilderHelpers;
|
| 7 |
-
use PhpParser\Node\Stmt;
|
| 8 |
-
|
| 9 |
-
class Trait_ extends Declaration
|
| 10 |
-
{
|
| 11 |
-
protected $name;
|
| 12 |
-
protected $uses = [];
|
| 13 |
-
protected $properties = [];
|
| 14 |
-
protected $methods = [];
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* Creates an interface builder.
|
| 18 |
-
*
|
| 19 |
-
* @param string $name Name of the interface
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(string $name) {
|
| 22 |
-
$this->name = $name;
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
/**
|
| 26 |
-
* Adds a statement.
|
| 27 |
-
*
|
| 28 |
-
* @param Stmt|PhpParser\Builder $stmt The statement to add
|
| 29 |
-
*
|
| 30 |
-
* @return $this The builder instance (for fluid interface)
|
| 31 |
-
*/
|
| 32 |
-
public function addStmt($stmt) {
|
| 33 |
-
$stmt = BuilderHelpers::normalizeNode($stmt);
|
| 34 |
-
|
| 35 |
-
if ($stmt instanceof Stmt\Property) {
|
| 36 |
-
$this->properties[] = $stmt;
|
| 37 |
-
} elseif ($stmt instanceof Stmt\ClassMethod) {
|
| 38 |
-
$this->methods[] = $stmt;
|
| 39 |
-
} elseif ($stmt instanceof Stmt\TraitUse) {
|
| 40 |
-
$this->uses[] = $stmt;
|
| 41 |
-
} else {
|
| 42 |
-
throw new \LogicException(sprintf('Unexpected node of type "%s"', $stmt->getType()));
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
return $this;
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
/**
|
| 49 |
-
* Returns the built trait node.
|
| 50 |
-
*
|
| 51 |
-
* @return Stmt\Trait_ The built interface node
|
| 52 |
-
*/
|
| 53 |
-
public function getNode() : PhpParser\Node {
|
| 54 |
-
return new Stmt\Trait_(
|
| 55 |
-
$this->name, [
|
| 56 |
-
'stmts' => array_merge($this->uses, $this->properties, $this->methods)
|
| 57 |
-
], $this->attributes
|
| 58 |
-
);
|
| 59 |
-
}
|
| 60 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Builder/Use_.php
DELETED
|
@@ -1,49 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Builder;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Builder;
|
| 6 |
-
use PhpParser\BuilderHelpers;
|
| 7 |
-
use PhpParser\Node;
|
| 8 |
-
use PhpParser\Node\Stmt;
|
| 9 |
-
|
| 10 |
-
class Use_ implements Builder
|
| 11 |
-
{
|
| 12 |
-
protected $name;
|
| 13 |
-
protected $type;
|
| 14 |
-
protected $alias = null;
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* Creates a name use (alias) builder.
|
| 18 |
-
*
|
| 19 |
-
* @param Node\Name|string $name Name of the entity (namespace, class, function, constant) to alias
|
| 20 |
-
* @param int $type One of the Stmt\Use_::TYPE_* constants
|
| 21 |
-
*/
|
| 22 |
-
public function __construct($name, int $type) {
|
| 23 |
-
$this->name = BuilderHelpers::normalizeName($name);
|
| 24 |
-
$this->type = $type;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
/**
|
| 28 |
-
* Sets alias for used name.
|
| 29 |
-
*
|
| 30 |
-
* @param string $alias Alias to use (last component of full name by default)
|
| 31 |
-
*
|
| 32 |
-
* @return $this The builder instance (for fluid interface)
|
| 33 |
-
*/
|
| 34 |
-
public function as(string $alias) {
|
| 35 |
-
$this->alias = $alias;
|
| 36 |
-
return $this;
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
/**
|
| 40 |
-
* Returns the built node.
|
| 41 |
-
*
|
| 42 |
-
* @return Node The built node
|
| 43 |
-
*/
|
| 44 |
-
public function getNode() : Node {
|
| 45 |
-
return new Stmt\Use_([
|
| 46 |
-
new Stmt\UseUse($this->name, $this->alias)
|
| 47 |
-
], $this->type);
|
| 48 |
-
}
|
| 49 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/BuilderFactory.php
DELETED
|
@@ -1,348 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Arg;
|
| 6 |
-
use PhpParser\Node\Expr;
|
| 7 |
-
use PhpParser\Node\Expr\BinaryOp\Concat;
|
| 8 |
-
use PhpParser\Node\Identifier;
|
| 9 |
-
use PhpParser\Node\Name;
|
| 10 |
-
use PhpParser\Node\Scalar\String_;
|
| 11 |
-
use PhpParser\Node\Stmt\Use_;
|
| 12 |
-
|
| 13 |
-
class BuilderFactory
|
| 14 |
-
{
|
| 15 |
-
/**
|
| 16 |
-
* Creates a namespace builder.
|
| 17 |
-
*
|
| 18 |
-
* @param null|string|Node\Name $name Name of the namespace
|
| 19 |
-
*
|
| 20 |
-
* @return Builder\Namespace_ The created namespace builder
|
| 21 |
-
*/
|
| 22 |
-
public function namespace($name) : Builder\Namespace_ {
|
| 23 |
-
return new Builder\Namespace_($name);
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
/**
|
| 27 |
-
* Creates a class builder.
|
| 28 |
-
*
|
| 29 |
-
* @param string $name Name of the class
|
| 30 |
-
*
|
| 31 |
-
* @return Builder\Class_ The created class builder
|
| 32 |
-
*/
|
| 33 |
-
public function class(string $name) : Builder\Class_ {
|
| 34 |
-
return new Builder\Class_($name);
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
/**
|
| 38 |
-
* Creates an interface builder.
|
| 39 |
-
*
|
| 40 |
-
* @param string $name Name of the interface
|
| 41 |
-
*
|
| 42 |
-
* @return Builder\Interface_ The created interface builder
|
| 43 |
-
*/
|
| 44 |
-
public function interface(string $name) : Builder\Interface_ {
|
| 45 |
-
return new Builder\Interface_($name);
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
/**
|
| 49 |
-
* Creates a trait builder.
|
| 50 |
-
*
|
| 51 |
-
* @param string $name Name of the trait
|
| 52 |
-
*
|
| 53 |
-
* @return Builder\Trait_ The created trait builder
|
| 54 |
-
*/
|
| 55 |
-
public function trait(string $name) : Builder\Trait_ {
|
| 56 |
-
return new Builder\Trait_($name);
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
/**
|
| 60 |
-
* Creates a trait use builder.
|
| 61 |
-
*
|
| 62 |
-
* @param Node\Name|string ...$traits Trait names
|
| 63 |
-
*
|
| 64 |
-
* @return Builder\TraitUse The create trait use builder
|
| 65 |
-
*/
|
| 66 |
-
public function useTrait(...$traits) : Builder\TraitUse {
|
| 67 |
-
return new Builder\TraitUse(...$traits);
|
| 68 |
-
}
|
| 69 |
-
|
| 70 |
-
/**
|
| 71 |
-
* Creates a trait use adaptation builder.
|
| 72 |
-
*
|
| 73 |
-
* @param Node\Name|string|null $trait Trait name
|
| 74 |
-
* @param Node\Identifier|string $method Method name
|
| 75 |
-
*
|
| 76 |
-
* @return Builder\TraitUseAdaptation The create trait use adaptation builder
|
| 77 |
-
*/
|
| 78 |
-
public function traitUseAdaptation($trait, $method = null) : Builder\TraitUseAdaptation {
|
| 79 |
-
if ($method === null) {
|
| 80 |
-
$method = $trait;
|
| 81 |
-
$trait = null;
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
return new Builder\TraitUseAdaptation($trait, $method);
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
/**
|
| 88 |
-
* Creates a method builder.
|
| 89 |
-
*
|
| 90 |
-
* @param string $name Name of the method
|
| 91 |
-
*
|
| 92 |
-
* @return Builder\Method The created method builder
|
| 93 |
-
*/
|
| 94 |
-
public function method(string $name) : Builder\Method {
|
| 95 |
-
return new Builder\Method($name);
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
/**
|
| 99 |
-
* Creates a parameter builder.
|
| 100 |
-
*
|
| 101 |
-
* @param string $name Name of the parameter
|
| 102 |
-
*
|
| 103 |
-
* @return Builder\Param The created parameter builder
|
| 104 |
-
*/
|
| 105 |
-
public function param(string $name) : Builder\Param {
|
| 106 |
-
return new Builder\Param($name);
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
/**
|
| 110 |
-
* Creates a property builder.
|
| 111 |
-
*
|
| 112 |
-
* @param string $name Name of the property
|
| 113 |
-
*
|
| 114 |
-
* @return Builder\Property The created property builder
|
| 115 |
-
*/
|
| 116 |
-
public function property(string $name) : Builder\Property {
|
| 117 |
-
return new Builder\Property($name);
|
| 118 |
-
}
|
| 119 |
-
|
| 120 |
-
/**
|
| 121 |
-
* Creates a function builder.
|
| 122 |
-
*
|
| 123 |
-
* @param string $name Name of the function
|
| 124 |
-
*
|
| 125 |
-
* @return Builder\Function_ The created function builder
|
| 126 |
-
*/
|
| 127 |
-
public function function(string $name) : Builder\Function_ {
|
| 128 |
-
return new Builder\Function_($name);
|
| 129 |
-
}
|
| 130 |
-
|
| 131 |
-
/**
|
| 132 |
-
* Creates a namespace/class use builder.
|
| 133 |
-
*
|
| 134 |
-
* @param Node\Name|string $name Name of the entity (namespace or class) to alias
|
| 135 |
-
*
|
| 136 |
-
* @return Builder\Use_ The created use builder
|
| 137 |
-
*/
|
| 138 |
-
public function use($name) : Builder\Use_ {
|
| 139 |
-
return new Builder\Use_($name, Use_::TYPE_NORMAL);
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
/**
|
| 143 |
-
* Creates a function use builder.
|
| 144 |
-
*
|
| 145 |
-
* @param Node\Name|string $name Name of the function to alias
|
| 146 |
-
*
|
| 147 |
-
* @return Builder\Use_ The created use function builder
|
| 148 |
-
*/
|
| 149 |
-
public function useFunction($name) : Builder\Use_ {
|
| 150 |
-
return new Builder\Use_($name, Use_::TYPE_FUNCTION);
|
| 151 |
-
}
|
| 152 |
-
|
| 153 |
-
/**
|
| 154 |
-
* Creates a constant use builder.
|
| 155 |
-
*
|
| 156 |
-
* @param Node\Name|string $name Name of the const to alias
|
| 157 |
-
*
|
| 158 |
-
* @return Builder\Use_ The created use const builder
|
| 159 |
-
*/
|
| 160 |
-
public function useConst($name) : Builder\Use_ {
|
| 161 |
-
return new Builder\Use_($name, Use_::TYPE_CONSTANT);
|
| 162 |
-
}
|
| 163 |
-
|
| 164 |
-
/**
|
| 165 |
-
* Creates node a for a literal value.
|
| 166 |
-
*
|
| 167 |
-
* @param Expr|bool|null|int|float|string|array $value $value
|
| 168 |
-
*
|
| 169 |
-
* @return Expr
|
| 170 |
-
*/
|
| 171 |
-
public function val($value) : Expr {
|
| 172 |
-
return BuilderHelpers::normalizeValue($value);
|
| 173 |
-
}
|
| 174 |
-
|
| 175 |
-
/**
|
| 176 |
-
* Creates variable node.
|
| 177 |
-
*
|
| 178 |
-
* @param string|Expr $name Name
|
| 179 |
-
*
|
| 180 |
-
* @return Expr\Variable
|
| 181 |
-
*/
|
| 182 |
-
public function var($name) : Expr\Variable {
|
| 183 |
-
if (!\is_string($name) && !$name instanceof Expr) {
|
| 184 |
-
throw new \LogicException('Variable name must be string or Expr');
|
| 185 |
-
}
|
| 186 |
-
|
| 187 |
-
return new Expr\Variable($name);
|
| 188 |
-
}
|
| 189 |
-
|
| 190 |
-
/**
|
| 191 |
-
* Normalizes an argument list.
|
| 192 |
-
*
|
| 193 |
-
* Creates Arg nodes for all arguments and converts literal values to expressions.
|
| 194 |
-
*
|
| 195 |
-
* @param array $args List of arguments to normalize
|
| 196 |
-
*
|
| 197 |
-
* @return Arg[]
|
| 198 |
-
*/
|
| 199 |
-
public function args(array $args) : array {
|
| 200 |
-
$normalizedArgs = [];
|
| 201 |
-
foreach ($args as $arg) {
|
| 202 |
-
if ($arg instanceof Arg) {
|
| 203 |
-
$normalizedArgs[] = $arg;
|
| 204 |
-
} else {
|
| 205 |
-
$normalizedArgs[] = new Arg(BuilderHelpers::normalizeValue($arg));
|
| 206 |
-
}
|
| 207 |
-
}
|
| 208 |
-
return $normalizedArgs;
|
| 209 |
-
}
|
| 210 |
-
|
| 211 |
-
/**
|
| 212 |
-
* Creates a function call node.
|
| 213 |
-
*
|
| 214 |
-
* @param string|Name|Expr $name Function name
|
| 215 |
-
* @param array $args Function arguments
|
| 216 |
-
*
|
| 217 |
-
* @return Expr\FuncCall
|
| 218 |
-
*/
|
| 219 |
-
public function funcCall($name, array $args = []) : Expr\FuncCall {
|
| 220 |
-
return new Expr\FuncCall(
|
| 221 |
-
BuilderHelpers::normalizeNameOrExpr($name),
|
| 222 |
-
$this->args($args)
|
| 223 |
-
);
|
| 224 |
-
}
|
| 225 |
-
|
| 226 |
-
/**
|
| 227 |
-
* Creates a method call node.
|
| 228 |
-
*
|
| 229 |
-
* @param Expr $var Variable the method is called on
|
| 230 |
-
* @param string|Identifier|Expr $name Method name
|
| 231 |
-
* @param array $args Method arguments
|
| 232 |
-
*
|
| 233 |
-
* @return Expr\MethodCall
|
| 234 |
-
*/
|
| 235 |
-
public function methodCall(Expr $var, $name, array $args = []) : Expr\MethodCall {
|
| 236 |
-
return new Expr\MethodCall(
|
| 237 |
-
$var,
|
| 238 |
-
BuilderHelpers::normalizeIdentifierOrExpr($name),
|
| 239 |
-
$this->args($args)
|
| 240 |
-
);
|
| 241 |
-
}
|
| 242 |
-
|
| 243 |
-
/**
|
| 244 |
-
* Creates a static method call node.
|
| 245 |
-
*
|
| 246 |
-
* @param string|Name|Expr $class Class name
|
| 247 |
-
* @param string|Identifier|Expr $name Method name
|
| 248 |
-
* @param array $args Method arguments
|
| 249 |
-
*
|
| 250 |
-
* @return Expr\StaticCall
|
| 251 |
-
*/
|
| 252 |
-
public function staticCall($class, $name, array $args = []) : Expr\StaticCall {
|
| 253 |
-
return new Expr\StaticCall(
|
| 254 |
-
BuilderHelpers::normalizeNameOrExpr($class),
|
| 255 |
-
BuilderHelpers::normalizeIdentifierOrExpr($name),
|
| 256 |
-
$this->args($args)
|
| 257 |
-
);
|
| 258 |
-
}
|
| 259 |
-
|
| 260 |
-
/**
|
| 261 |
-
* Creates an object creation node.
|
| 262 |
-
*
|
| 263 |
-
* @param string|Name|Expr $class Class name
|
| 264 |
-
* @param array $args Constructor arguments
|
| 265 |
-
*
|
| 266 |
-
* @return Expr\New_
|
| 267 |
-
*/
|
| 268 |
-
public function new($class, array $args = []) : Expr\New_ {
|
| 269 |
-
return new Expr\New_(
|
| 270 |
-
BuilderHelpers::normalizeNameOrExpr($class),
|
| 271 |
-
$this->args($args)
|
| 272 |
-
);
|
| 273 |
-
}
|
| 274 |
-
|
| 275 |
-
/**
|
| 276 |
-
* Creates a constant fetch node.
|
| 277 |
-
*
|
| 278 |
-
* @param string|Name $name Constant name
|
| 279 |
-
*
|
| 280 |
-
* @return Expr\ConstFetch
|
| 281 |
-
*/
|
| 282 |
-
public function constFetch($name) : Expr\ConstFetch {
|
| 283 |
-
return new Expr\ConstFetch(BuilderHelpers::normalizeName($name));
|
| 284 |
-
}
|
| 285 |
-
|
| 286 |
-
/**
|
| 287 |
-
* Creates a property fetch node.
|
| 288 |
-
*
|
| 289 |
-
* @param Expr $var Variable holding object
|
| 290 |
-
* @param string|Identifier|Expr $name Property name
|
| 291 |
-
*
|
| 292 |
-
* @return Expr\PropertyFetch
|
| 293 |
-
*/
|
| 294 |
-
public function propertyFetch(Expr $var, $name) : Expr\PropertyFetch {
|
| 295 |
-
return new Expr\PropertyFetch($var, BuilderHelpers::normalizeIdentifierOrExpr($name));
|
| 296 |
-
}
|
| 297 |
-
|
| 298 |
-
/**
|
| 299 |
-
* Creates a class constant fetch node.
|
| 300 |
-
*
|
| 301 |
-
* @param string|Name|Expr $class Class name
|
| 302 |
-
* @param string|Identifier $name Constant name
|
| 303 |
-
*
|
| 304 |
-
* @return Expr\ClassConstFetch
|
| 305 |
-
*/
|
| 306 |
-
public function classConstFetch($class, $name): Expr\ClassConstFetch {
|
| 307 |
-
return new Expr\ClassConstFetch(
|
| 308 |
-
BuilderHelpers::normalizeNameOrExpr($class),
|
| 309 |
-
BuilderHelpers::normalizeIdentifier($name)
|
| 310 |
-
);
|
| 311 |
-
}
|
| 312 |
-
|
| 313 |
-
/**
|
| 314 |
-
* Creates nested Concat nodes from a list of expressions.
|
| 315 |
-
*
|
| 316 |
-
* @param Expr|string ...$exprs Expressions or literal strings
|
| 317 |
-
*
|
| 318 |
-
* @return Concat
|
| 319 |
-
*/
|
| 320 |
-
public function concat(...$exprs) : Concat {
|
| 321 |
-
$numExprs = count($exprs);
|
| 322 |
-
if ($numExprs < 2) {
|
| 323 |
-
throw new \LogicException('Expected at least two expressions');
|
| 324 |
-
}
|
| 325 |
-
|
| 326 |
-
$lastConcat = $this->normalizeStringExpr($exprs[0]);
|
| 327 |
-
for ($i = 1; $i < $numExprs; $i++) {
|
| 328 |
-
$lastConcat = new Concat($lastConcat, $this->normalizeStringExpr($exprs[$i]));
|
| 329 |
-
}
|
| 330 |
-
return $lastConcat;
|
| 331 |
-
}
|
| 332 |
-
|
| 333 |
-
/**
|
| 334 |
-
* @param string|Expr $expr
|
| 335 |
-
* @return Expr
|
| 336 |
-
*/
|
| 337 |
-
private function normalizeStringExpr($expr) : Expr {
|
| 338 |
-
if ($expr instanceof Expr) {
|
| 339 |
-
return $expr;
|
| 340 |
-
}
|
| 341 |
-
|
| 342 |
-
if (\is_string($expr)) {
|
| 343 |
-
return new String_($expr);
|
| 344 |
-
}
|
| 345 |
-
|
| 346 |
-
throw new \LogicException('Expected string or Expr');
|
| 347 |
-
}
|
| 348 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/BuilderHelpers.php
DELETED
|
@@ -1,285 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
use PhpParser\Node\Identifier;
|
| 7 |
-
use PhpParser\Node\Name;
|
| 8 |
-
use PhpParser\Node\NullableType;
|
| 9 |
-
use PhpParser\Node\Scalar;
|
| 10 |
-
use PhpParser\Node\Stmt;
|
| 11 |
-
use PhpParser\Node\UnionType;
|
| 12 |
-
|
| 13 |
-
/**
|
| 14 |
-
* This class defines helpers used in the implementation of builders. Don't use it directly.
|
| 15 |
-
*
|
| 16 |
-
* @internal
|
| 17 |
-
*/
|
| 18 |
-
final class BuilderHelpers
|
| 19 |
-
{
|
| 20 |
-
/**
|
| 21 |
-
* Normalizes a node: Converts builder objects to nodes.
|
| 22 |
-
*
|
| 23 |
-
* @param Node|Builder $node The node to normalize
|
| 24 |
-
*
|
| 25 |
-
* @return Node The normalized node
|
| 26 |
-
*/
|
| 27 |
-
public static function normalizeNode($node) : Node {
|
| 28 |
-
if ($node instanceof Builder) {
|
| 29 |
-
return $node->getNode();
|
| 30 |
-
} elseif ($node instanceof Node) {
|
| 31 |
-
return $node;
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
throw new \LogicException('Expected node or builder object');
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
/**
|
| 38 |
-
* Normalizes a node to a statement.
|
| 39 |
-
*
|
| 40 |
-
* Expressions are wrapped in a Stmt\Expression node.
|
| 41 |
-
*
|
| 42 |
-
* @param Node|Builder $node The node to normalize
|
| 43 |
-
*
|
| 44 |
-
* @return Stmt The normalized statement node
|
| 45 |
-
*/
|
| 46 |
-
public static function normalizeStmt($node) : Stmt {
|
| 47 |
-
$node = self::normalizeNode($node);
|
| 48 |
-
if ($node instanceof Stmt) {
|
| 49 |
-
return $node;
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
if ($node instanceof Expr) {
|
| 53 |
-
return new Stmt\Expression($node);
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
throw new \LogicException('Expected statement or expression node');
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
/**
|
| 60 |
-
* Normalizes strings to Identifier.
|
| 61 |
-
*
|
| 62 |
-
* @param string|Identifier $name The identifier to normalize
|
| 63 |
-
*
|
| 64 |
-
* @return Identifier The normalized identifier
|
| 65 |
-
*/
|
| 66 |
-
public static function normalizeIdentifier($name) : Identifier {
|
| 67 |
-
if ($name instanceof Identifier) {
|
| 68 |
-
return $name;
|
| 69 |
-
}
|
| 70 |
-
|
| 71 |
-
if (\is_string($name)) {
|
| 72 |
-
return new Identifier($name);
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
throw new \LogicException('Expected string or instance of Node\Identifier');
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
/**
|
| 79 |
-
* Normalizes strings to Identifier, also allowing expressions.
|
| 80 |
-
*
|
| 81 |
-
* @param string|Identifier|Expr $name The identifier to normalize
|
| 82 |
-
*
|
| 83 |
-
* @return Identifier|Expr The normalized identifier or expression
|
| 84 |
-
*/
|
| 85 |
-
public static function normalizeIdentifierOrExpr($name) {
|
| 86 |
-
if ($name instanceof Identifier || $name instanceof Expr) {
|
| 87 |
-
return $name;
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
if (\is_string($name)) {
|
| 91 |
-
return new Identifier($name);
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
throw new \LogicException('Expected string or instance of Node\Identifier or Node\Expr');
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
/**
|
| 98 |
-
* Normalizes a name: Converts string names to Name nodes.
|
| 99 |
-
*
|
| 100 |
-
* @param Name|string $name The name to normalize
|
| 101 |
-
*
|
| 102 |
-
* @return Name The normalized name
|
| 103 |
-
*/
|
| 104 |
-
public static function normalizeName($name) : Name {
|
| 105 |
-
return self::normalizeNameCommon($name, false);
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
/**
|
| 109 |
-
* Normalizes a name: Converts string names to Name nodes, while also allowing expressions.
|
| 110 |
-
*
|
| 111 |
-
* @param Expr|Name|string $name The name to normalize
|
| 112 |
-
*
|
| 113 |
-
* @return Name|Expr The normalized name or expression
|
| 114 |
-
*/
|
| 115 |
-
public static function normalizeNameOrExpr($name) {
|
| 116 |
-
return self::normalizeNameCommon($name, true);
|
| 117 |
-
}
|
| 118 |
-
|
| 119 |
-
/**
|
| 120 |
-
* Normalizes a name: Converts string names to Name nodes, optionally allowing expressions.
|
| 121 |
-
*
|
| 122 |
-
* @param Expr|Name|string $name The name to normalize
|
| 123 |
-
* @param bool $allowExpr Whether to also allow expressions
|
| 124 |
-
*
|
| 125 |
-
* @return Name|Expr The normalized name, or expression (if allowed)
|
| 126 |
-
*/
|
| 127 |
-
private static function normalizeNameCommon($name, bool $allowExpr) {
|
| 128 |
-
if ($name instanceof Name) {
|
| 129 |
-
return $name;
|
| 130 |
-
} elseif (is_string($name)) {
|
| 131 |
-
if (!$name) {
|
| 132 |
-
throw new \LogicException('Name cannot be empty');
|
| 133 |
-
}
|
| 134 |
-
|
| 135 |
-
if ($name[0] === '\\') {
|
| 136 |
-
return new Name\FullyQualified(substr($name, 1));
|
| 137 |
-
} elseif (0 === strpos($name, 'namespace\\')) {
|
| 138 |
-
return new Name\Relative(substr($name, strlen('namespace\\')));
|
| 139 |
-
} else {
|
| 140 |
-
return new Name($name);
|
| 141 |
-
}
|
| 142 |
-
}
|
| 143 |
-
|
| 144 |
-
if ($allowExpr) {
|
| 145 |
-
if ($name instanceof Expr) {
|
| 146 |
-
return $name;
|
| 147 |
-
}
|
| 148 |
-
throw new \LogicException(
|
| 149 |
-
'Name must be a string or an instance of Node\Name or Node\Expr'
|
| 150 |
-
);
|
| 151 |
-
} else {
|
| 152 |
-
throw new \LogicException('Name must be a string or an instance of Node\Name');
|
| 153 |
-
}
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
/**
|
| 157 |
-
* Normalizes a type: Converts plain-text type names into proper AST representation.
|
| 158 |
-
*
|
| 159 |
-
* In particular, builtin types become Identifiers, custom types become Names and nullables
|
| 160 |
-
* are wrapped in NullableType nodes.
|
| 161 |
-
*
|
| 162 |
-
* @param string|Name|Identifier|NullableType|UnionType $type The type to normalize
|
| 163 |
-
*
|
| 164 |
-
* @return Name|Identifier|NullableType|UnionType The normalized type
|
| 165 |
-
*/
|
| 166 |
-
public static function normalizeType($type) {
|
| 167 |
-
if (!is_string($type)) {
|
| 168 |
-
if (
|
| 169 |
-
!$type instanceof Name && !$type instanceof Identifier &&
|
| 170 |
-
!$type instanceof NullableType && !$type instanceof UnionType
|
| 171 |
-
) {
|
| 172 |
-
throw new \LogicException(
|
| 173 |
-
'Type must be a string, or an instance of Name, Identifier, NullableType or UnionType'
|
| 174 |
-
);
|
| 175 |
-
}
|
| 176 |
-
return $type;
|
| 177 |
-
}
|
| 178 |
-
|
| 179 |
-
$nullable = false;
|
| 180 |
-
if (strlen($type) > 0 && $type[0] === '?') {
|
| 181 |
-
$nullable = true;
|
| 182 |
-
$type = substr($type, 1);
|
| 183 |
-
}
|
| 184 |
-
|
| 185 |
-
$builtinTypes = [
|
| 186 |
-
'array', 'callable', 'string', 'int', 'float', 'bool', 'iterable', 'void', 'object', 'mixed'
|
| 187 |
-
];
|
| 188 |
-
|
| 189 |
-
$lowerType = strtolower($type);
|
| 190 |
-
if (in_array($lowerType, $builtinTypes)) {
|
| 191 |
-
$type = new Identifier($lowerType);
|
| 192 |
-
} else {
|
| 193 |
-
$type = self::normalizeName($type);
|
| 194 |
-
}
|
| 195 |
-
|
| 196 |
-
if ($nullable && (string) $type === 'void') {
|
| 197 |
-
throw new \LogicException('void type cannot be nullable');
|
| 198 |
-
}
|
| 199 |
-
|
| 200 |
-
if ($nullable && (string) $type === 'mixed') {
|
| 201 |
-
throw new \LogicException('mixed type cannot be nullable');
|
| 202 |
-
}
|
| 203 |
-
|
| 204 |
-
return $nullable ? new NullableType($type) : $type;
|
| 205 |
-
}
|
| 206 |
-
|
| 207 |
-
/**
|
| 208 |
-
* Normalizes a value: Converts nulls, booleans, integers,
|
| 209 |
-
* floats, strings and arrays into their respective nodes
|
| 210 |
-
*
|
| 211 |
-
* @param Node\Expr|bool|null|int|float|string|array $value The value to normalize
|
| 212 |
-
*
|
| 213 |
-
* @return Expr The normalized value
|
| 214 |
-
*/
|
| 215 |
-
public static function normalizeValue($value) : Expr {
|
| 216 |
-
if ($value instanceof Node\Expr) {
|
| 217 |
-
return $value;
|
| 218 |
-
} elseif (is_null($value)) {
|
| 219 |
-
return new Expr\ConstFetch(
|
| 220 |
-
new Name('null')
|
| 221 |
-
);
|
| 222 |
-
} elseif (is_bool($value)) {
|
| 223 |
-
return new Expr\ConstFetch(
|
| 224 |
-
new Name($value ? 'true' : 'false')
|
| 225 |
-
);
|
| 226 |
-
} elseif (is_int($value)) {
|
| 227 |
-
return new Scalar\LNumber($value);
|
| 228 |
-
} elseif (is_float($value)) {
|
| 229 |
-
return new Scalar\DNumber($value);
|
| 230 |
-
} elseif (is_string($value)) {
|
| 231 |
-
return new Scalar\String_($value);
|
| 232 |
-
} elseif (is_array($value)) {
|
| 233 |
-
$items = [];
|
| 234 |
-
$lastKey = -1;
|
| 235 |
-
foreach ($value as $itemKey => $itemValue) {
|
| 236 |
-
// for consecutive, numeric keys don't generate keys
|
| 237 |
-
if (null !== $lastKey && ++$lastKey === $itemKey) {
|
| 238 |
-
$items[] = new Expr\ArrayItem(
|
| 239 |
-
self::normalizeValue($itemValue)
|
| 240 |
-
);
|
| 241 |
-
} else {
|
| 242 |
-
$lastKey = null;
|
| 243 |
-
$items[] = new Expr\ArrayItem(
|
| 244 |
-
self::normalizeValue($itemValue),
|
| 245 |
-
self::normalizeValue($itemKey)
|
| 246 |
-
);
|
| 247 |
-
}
|
| 248 |
-
}
|
| 249 |
-
|
| 250 |
-
return new Expr\Array_($items);
|
| 251 |
-
} else {
|
| 252 |
-
throw new \LogicException('Invalid value');
|
| 253 |
-
}
|
| 254 |
-
}
|
| 255 |
-
|
| 256 |
-
/**
|
| 257 |
-
* Normalizes a doc comment: Converts plain strings to PhpParser\Comment\Doc.
|
| 258 |
-
*
|
| 259 |
-
* @param Comment\Doc|string $docComment The doc comment to normalize
|
| 260 |
-
*
|
| 261 |
-
* @return Comment\Doc The normalized doc comment
|
| 262 |
-
*/
|
| 263 |
-
public static function normalizeDocComment($docComment) : Comment\Doc {
|
| 264 |
-
if ($docComment instanceof Comment\Doc) {
|
| 265 |
-
return $docComment;
|
| 266 |
-
} elseif (is_string($docComment)) {
|
| 267 |
-
return new Comment\Doc($docComment);
|
| 268 |
-
} else {
|
| 269 |
-
throw new \LogicException('Doc comment must be a string or an instance of PhpParser\Comment\Doc');
|
| 270 |
-
}
|
| 271 |
-
}
|
| 272 |
-
|
| 273 |
-
/**
|
| 274 |
-
* Adds a modifier and returns new modifier bitmask.
|
| 275 |
-
*
|
| 276 |
-
* @param int $modifiers Existing modifiers
|
| 277 |
-
* @param int $modifier Modifier to set
|
| 278 |
-
*
|
| 279 |
-
* @return int New modifiers
|
| 280 |
-
*/
|
| 281 |
-
public static function addModifier(int $modifiers, int $modifier) : int {
|
| 282 |
-
Stmt\Class_::verifyModifier($modifiers, $modifier);
|
| 283 |
-
return $modifiers | $modifier;
|
| 284 |
-
}
|
| 285 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Comment.php
DELETED
|
@@ -1,239 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
class Comment implements \JsonSerializable
|
| 6 |
-
{
|
| 7 |
-
protected $text;
|
| 8 |
-
protected $startLine;
|
| 9 |
-
protected $startFilePos;
|
| 10 |
-
protected $startTokenPos;
|
| 11 |
-
protected $endLine;
|
| 12 |
-
protected $endFilePos;
|
| 13 |
-
protected $endTokenPos;
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* Constructs a comment node.
|
| 17 |
-
*
|
| 18 |
-
* @param string $text Comment text (including comment delimiters like /*)
|
| 19 |
-
* @param int $startLine Line number the comment started on
|
| 20 |
-
* @param int $startFilePos File offset the comment started on
|
| 21 |
-
* @param int $startTokenPos Token offset the comment started on
|
| 22 |
-
*/
|
| 23 |
-
public function __construct(
|
| 24 |
-
string $text,
|
| 25 |
-
int $startLine = -1, int $startFilePos = -1, int $startTokenPos = -1,
|
| 26 |
-
int $endLine = -1, int $endFilePos = -1, int $endTokenPos = -1
|
| 27 |
-
) {
|
| 28 |
-
$this->text = $text;
|
| 29 |
-
$this->startLine = $startLine;
|
| 30 |
-
$this->startFilePos = $startFilePos;
|
| 31 |
-
$this->startTokenPos = $startTokenPos;
|
| 32 |
-
$this->endLine = $endLine;
|
| 33 |
-
$this->endFilePos = $endFilePos;
|
| 34 |
-
$this->endTokenPos = $endTokenPos;
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
/**
|
| 38 |
-
* Gets the comment text.
|
| 39 |
-
*
|
| 40 |
-
* @return string The comment text (including comment delimiters like /*)
|
| 41 |
-
*/
|
| 42 |
-
public function getText() : string {
|
| 43 |
-
return $this->text;
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
/**
|
| 47 |
-
* Gets the line number the comment started on.
|
| 48 |
-
*
|
| 49 |
-
* @return int Line number (or -1 if not available)
|
| 50 |
-
*/
|
| 51 |
-
public function getStartLine() : int {
|
| 52 |
-
return $this->startLine;
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
/**
|
| 56 |
-
* Gets the file offset the comment started on.
|
| 57 |
-
*
|
| 58 |
-
* @return int File offset (or -1 if not available)
|
| 59 |
-
*/
|
| 60 |
-
public function getStartFilePos() : int {
|
| 61 |
-
return $this->startFilePos;
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
/**
|
| 65 |
-
* Gets the token offset the comment started on.
|
| 66 |
-
*
|
| 67 |
-
* @return int Token offset (or -1 if not available)
|
| 68 |
-
*/
|
| 69 |
-
public function getStartTokenPos() : int {
|
| 70 |
-
return $this->startTokenPos;
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
/**
|
| 74 |
-
* Gets the line number the comment ends on.
|
| 75 |
-
*
|
| 76 |
-
* @return int Line number (or -1 if not available)
|
| 77 |
-
*/
|
| 78 |
-
public function getEndLine() : int {
|
| 79 |
-
return $this->endLine;
|
| 80 |
-
}
|
| 81 |
-
|
| 82 |
-
/**
|
| 83 |
-
* Gets the file offset the comment ends on.
|
| 84 |
-
*
|
| 85 |
-
* @return int File offset (or -1 if not available)
|
| 86 |
-
*/
|
| 87 |
-
public function getEndFilePos() : int {
|
| 88 |
-
return $this->endFilePos;
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
/**
|
| 92 |
-
* Gets the token offset the comment ends on.
|
| 93 |
-
*
|
| 94 |
-
* @return int Token offset (or -1 if not available)
|
| 95 |
-
*/
|
| 96 |
-
public function getEndTokenPos() : int {
|
| 97 |
-
return $this->endTokenPos;
|
| 98 |
-
}
|
| 99 |
-
|
| 100 |
-
/**
|
| 101 |
-
* Gets the line number the comment started on.
|
| 102 |
-
*
|
| 103 |
-
* @deprecated Use getStartLine() instead
|
| 104 |
-
*
|
| 105 |
-
* @return int Line number
|
| 106 |
-
*/
|
| 107 |
-
public function getLine() : int {
|
| 108 |
-
return $this->startLine;
|
| 109 |
-
}
|
| 110 |
-
|
| 111 |
-
/**
|
| 112 |
-
* Gets the file offset the comment started on.
|
| 113 |
-
*
|
| 114 |
-
* @deprecated Use getStartFilePos() instead
|
| 115 |
-
*
|
| 116 |
-
* @return int File offset
|
| 117 |
-
*/
|
| 118 |
-
public function getFilePos() : int {
|
| 119 |
-
return $this->startFilePos;
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
/**
|
| 123 |
-
* Gets the token offset the comment started on.
|
| 124 |
-
*
|
| 125 |
-
* @deprecated Use getStartTokenPos() instead
|
| 126 |
-
*
|
| 127 |
-
* @return int Token offset
|
| 128 |
-
*/
|
| 129 |
-
public function getTokenPos() : int {
|
| 130 |
-
return $this->startTokenPos;
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
/**
|
| 134 |
-
* Gets the comment text.
|
| 135 |
-
*
|
| 136 |
-
* @return string The comment text (including comment delimiters like /*)
|
| 137 |
-
*/
|
| 138 |
-
public function __toString() : string {
|
| 139 |
-
return $this->text;
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
/**
|
| 143 |
-
* Gets the reformatted comment text.
|
| 144 |
-
*
|
| 145 |
-
* "Reformatted" here means that we try to clean up the whitespace at the
|
| 146 |
-
* starts of the lines. This is necessary because we receive the comments
|
| 147 |
-
* without trailing whitespace on the first line, but with trailing whitespace
|
| 148 |
-
* on all subsequent lines.
|
| 149 |
-
*
|
| 150 |
-
* @return mixed|string
|
| 151 |
-
*/
|
| 152 |
-
public function getReformattedText() {
|
| 153 |
-
$text = trim($this->text);
|
| 154 |
-
$newlinePos = strpos($text, "\n");
|
| 155 |
-
if (false === $newlinePos) {
|
| 156 |
-
// Single line comments don't need further processing
|
| 157 |
-
return $text;
|
| 158 |
-
} elseif (preg_match('((*BSR_ANYCRLF)(*ANYCRLF)^.*(?:\R\s+\*.*)+$)', $text)) {
|
| 159 |
-
// Multi line comment of the type
|
| 160 |
-
//
|
| 161 |
-
// /*
|
| 162 |
-
// * Some text.
|
| 163 |
-
// * Some more text.
|
| 164 |
-
// */
|
| 165 |
-
//
|
| 166 |
-
// is handled by replacing the whitespace sequences before the * by a single space
|
| 167 |
-
return preg_replace('(^\s+\*)m', ' *', $this->text);
|
| 168 |
-
} elseif (preg_match('(^/\*\*?\s*[\r\n])', $text) && preg_match('(\n(\s*)\*/$)', $text, $matches)) {
|
| 169 |
-
// Multi line comment of the type
|
| 170 |
-
//
|
| 171 |
-
// /*
|
| 172 |
-
// Some text.
|
| 173 |
-
// Some more text.
|
| 174 |
-
// */
|
| 175 |
-
//
|
| 176 |
-
// is handled by removing the whitespace sequence on the line before the closing
|
| 177 |
-
// */ on all lines. So if the last line is " */", then " " is removed at the
|
| 178 |
-
// start of all lines.
|
| 179 |
-
return preg_replace('(^' . preg_quote($matches[1]) . ')m', '', $text);
|
| 180 |
-
} elseif (preg_match('(^/\*\*?\s*(?!\s))', $text, $matches)) {
|
| 181 |
-
// Multi line comment of the type
|
| 182 |
-
//
|
| 183 |
-
// /* Some text.
|
| 184 |
-
// Some more text.
|
| 185 |
-
// Indented text.
|
| 186 |
-
// Even more text. */
|
| 187 |
-
//
|
| 188 |
-
// is handled by removing the difference between the shortest whitespace prefix on all
|
| 189 |
-
// lines and the length of the "/* " opening sequence.
|
| 190 |
-
$prefixLen = $this->getShortestWhitespacePrefixLen(substr($text, $newlinePos + 1));
|
| 191 |
-
$removeLen = $prefixLen - strlen($matches[0]);
|
| 192 |
-
return preg_replace('(^\s{' . $removeLen . '})m', '', $text);
|
| 193 |
-
}
|
| 194 |
-
|
| 195 |
-
// No idea how to format this comment, so simply return as is
|
| 196 |
-
return $text;
|
| 197 |
-
}
|
| 198 |
-
|
| 199 |
-
/**
|
| 200 |
-
* Get length of shortest whitespace prefix (at the start of a line).
|
| 201 |
-
*
|
| 202 |
-
* If there is a line with no prefix whitespace, 0 is a valid return value.
|
| 203 |
-
*
|
| 204 |
-
* @param string $str String to check
|
| 205 |
-
* @return int Length in characters. Tabs count as single characters.
|
| 206 |
-
*/
|
| 207 |
-
private function getShortestWhitespacePrefixLen(string $str) : int {
|
| 208 |
-
$lines = explode("\n", $str);
|
| 209 |
-
$shortestPrefixLen = \INF;
|
| 210 |
-
foreach ($lines as $line) {
|
| 211 |
-
preg_match('(^\s*)', $line, $matches);
|
| 212 |
-
$prefixLen = strlen($matches[0]);
|
| 213 |
-
if ($prefixLen < $shortestPrefixLen) {
|
| 214 |
-
$shortestPrefixLen = $prefixLen;
|
| 215 |
-
}
|
| 216 |
-
}
|
| 217 |
-
return $shortestPrefixLen;
|
| 218 |
-
}
|
| 219 |
-
|
| 220 |
-
/**
|
| 221 |
-
* @return array
|
| 222 |
-
* @psalm-return array{nodeType:string, text:mixed, line:mixed, filePos:mixed}
|
| 223 |
-
*/
|
| 224 |
-
public function jsonSerialize() : array {
|
| 225 |
-
// Technically not a node, but we make it look like one anyway
|
| 226 |
-
$type = $this instanceof Comment\Doc ? 'Comment_Doc' : 'Comment';
|
| 227 |
-
return [
|
| 228 |
-
'nodeType' => $type,
|
| 229 |
-
'text' => $this->text,
|
| 230 |
-
// TODO: Rename these to include "start".
|
| 231 |
-
'line' => $this->startLine,
|
| 232 |
-
'filePos' => $this->startFilePos,
|
| 233 |
-
'tokenPos' => $this->startTokenPos,
|
| 234 |
-
'endLine' => $this->endLine,
|
| 235 |
-
'endFilePos' => $this->endFilePos,
|
| 236 |
-
'endTokenPos' => $this->endTokenPos,
|
| 237 |
-
];
|
| 238 |
-
}
|
| 239 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Comment/Doc.php
DELETED
|
@@ -1,7 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Comment;
|
| 4 |
-
|
| 5 |
-
class Doc extends \PhpParser\Comment
|
| 6 |
-
{
|
| 7 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/ConstExprEvaluationException.php
DELETED
|
@@ -1,6 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
class ConstExprEvaluationException extends \Exception
|
| 6 |
-
{}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/ConstExprEvaluator.php
DELETED
|
@@ -1,226 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
use PhpParser\Node\Scalar;
|
| 7 |
-
|
| 8 |
-
/**
|
| 9 |
-
* Evaluates constant expressions.
|
| 10 |
-
*
|
| 11 |
-
* This evaluator is able to evaluate all constant expressions (as defined by PHP), which can be
|
| 12 |
-
* evaluated without further context. If a subexpression is not of this type, a user-provided
|
| 13 |
-
* fallback evaluator is invoked. To support all constant expressions that are also supported by
|
| 14 |
-
* PHP (and not already handled by this class), the fallback evaluator must be able to handle the
|
| 15 |
-
* following node types:
|
| 16 |
-
*
|
| 17 |
-
* * All Scalar\MagicConst\* nodes.
|
| 18 |
-
* * Expr\ConstFetch nodes. Only null/false/true are already handled by this class.
|
| 19 |
-
* * Expr\ClassConstFetch nodes.
|
| 20 |
-
*
|
| 21 |
-
* The fallback evaluator should throw ConstExprEvaluationException for nodes it cannot evaluate.
|
| 22 |
-
*
|
| 23 |
-
* The evaluation is dependent on runtime configuration in two respects: Firstly, floating
|
| 24 |
-
* point to string conversions are affected by the precision ini setting. Secondly, they are also
|
| 25 |
-
* affected by the LC_NUMERIC locale.
|
| 26 |
-
*/
|
| 27 |
-
class ConstExprEvaluator
|
| 28 |
-
{
|
| 29 |
-
private $fallbackEvaluator;
|
| 30 |
-
|
| 31 |
-
/**
|
| 32 |
-
* Create a constant expression evaluator.
|
| 33 |
-
*
|
| 34 |
-
* The provided fallback evaluator is invoked whenever a subexpression cannot be evaluated. See
|
| 35 |
-
* class doc comment for more information.
|
| 36 |
-
*
|
| 37 |
-
* @param callable|null $fallbackEvaluator To call if subexpression cannot be evaluated
|
| 38 |
-
*/
|
| 39 |
-
public function __construct(callable $fallbackEvaluator = null) {
|
| 40 |
-
$this->fallbackEvaluator = $fallbackEvaluator ?? function(Expr $expr) {
|
| 41 |
-
throw new ConstExprEvaluationException(
|
| 42 |
-
"Expression of type {$expr->getType()} cannot be evaluated"
|
| 43 |
-
);
|
| 44 |
-
};
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
/**
|
| 48 |
-
* Silently evaluates a constant expression into a PHP value.
|
| 49 |
-
*
|
| 50 |
-
* Thrown Errors, warnings or notices will be converted into a ConstExprEvaluationException.
|
| 51 |
-
* The original source of the exception is available through getPrevious().
|
| 52 |
-
*
|
| 53 |
-
* If some part of the expression cannot be evaluated, the fallback evaluator passed to the
|
| 54 |
-
* constructor will be invoked. By default, if no fallback is provided, an exception of type
|
| 55 |
-
* ConstExprEvaluationException is thrown.
|
| 56 |
-
*
|
| 57 |
-
* See class doc comment for caveats and limitations.
|
| 58 |
-
*
|
| 59 |
-
* @param Expr $expr Constant expression to evaluate
|
| 60 |
-
* @return mixed Result of evaluation
|
| 61 |
-
*
|
| 62 |
-
* @throws ConstExprEvaluationException if the expression cannot be evaluated or an error occurred
|
| 63 |
-
*/
|
| 64 |
-
public function evaluateSilently(Expr $expr) {
|
| 65 |
-
set_error_handler(function($num, $str, $file, $line) {
|
| 66 |
-
throw new \ErrorException($str, 0, $num, $file, $line);
|
| 67 |
-
});
|
| 68 |
-
|
| 69 |
-
try {
|
| 70 |
-
return $this->evaluate($expr);
|
| 71 |
-
} catch (\Throwable $e) {
|
| 72 |
-
if (!$e instanceof ConstExprEvaluationException) {
|
| 73 |
-
$e = new ConstExprEvaluationException(
|
| 74 |
-
"An error occurred during constant expression evaluation", 0, $e);
|
| 75 |
-
}
|
| 76 |
-
throw $e;
|
| 77 |
-
} finally {
|
| 78 |
-
restore_error_handler();
|
| 79 |
-
}
|
| 80 |
-
}
|
| 81 |
-
|
| 82 |
-
/**
|
| 83 |
-
* Directly evaluates a constant expression into a PHP value.
|
| 84 |
-
*
|
| 85 |
-
* May generate Error exceptions, warnings or notices. Use evaluateSilently() to convert these
|
| 86 |
-
* into a ConstExprEvaluationException.
|
| 87 |
-
*
|
| 88 |
-
* If some part of the expression cannot be evaluated, the fallback evaluator passed to the
|
| 89 |
-
* constructor will be invoked. By default, if no fallback is provided, an exception of type
|
| 90 |
-
* ConstExprEvaluationException is thrown.
|
| 91 |
-
*
|
| 92 |
-
* See class doc comment for caveats and limitations.
|
| 93 |
-
*
|
| 94 |
-
* @param Expr $expr Constant expression to evaluate
|
| 95 |
-
* @return mixed Result of evaluation
|
| 96 |
-
*
|
| 97 |
-
* @throws ConstExprEvaluationException if the expression cannot be evaluated
|
| 98 |
-
*/
|
| 99 |
-
public function evaluateDirectly(Expr $expr) {
|
| 100 |
-
return $this->evaluate($expr);
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
private function evaluate(Expr $expr) {
|
| 104 |
-
if ($expr instanceof Scalar\LNumber
|
| 105 |
-
|| $expr instanceof Scalar\DNumber
|
| 106 |
-
|| $expr instanceof Scalar\String_
|
| 107 |
-
) {
|
| 108 |
-
return $expr->value;
|
| 109 |
-
}
|
| 110 |
-
|
| 111 |
-
if ($expr instanceof Expr\Array_) {
|
| 112 |
-
return $this->evaluateArray($expr);
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
// Unary operators
|
| 116 |
-
if ($expr instanceof Expr\UnaryPlus) {
|
| 117 |
-
return +$this->evaluate($expr->expr);
|
| 118 |
-
}
|
| 119 |
-
if ($expr instanceof Expr\UnaryMinus) {
|
| 120 |
-
return -$this->evaluate($expr->expr);
|
| 121 |
-
}
|
| 122 |
-
if ($expr instanceof Expr\BooleanNot) {
|
| 123 |
-
return !$this->evaluate($expr->expr);
|
| 124 |
-
}
|
| 125 |
-
if ($expr instanceof Expr\BitwiseNot) {
|
| 126 |
-
return ~$this->evaluate($expr->expr);
|
| 127 |
-
}
|
| 128 |
-
|
| 129 |
-
if ($expr instanceof Expr\BinaryOp) {
|
| 130 |
-
return $this->evaluateBinaryOp($expr);
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
if ($expr instanceof Expr\Ternary) {
|
| 134 |
-
return $this->evaluateTernary($expr);
|
| 135 |
-
}
|
| 136 |
-
|
| 137 |
-
if ($expr instanceof Expr\ArrayDimFetch && null !== $expr->dim) {
|
| 138 |
-
return $this->evaluate($expr->var)[$this->evaluate($expr->dim)];
|
| 139 |
-
}
|
| 140 |
-
|
| 141 |
-
if ($expr instanceof Expr\ConstFetch) {
|
| 142 |
-
return $this->evaluateConstFetch($expr);
|
| 143 |
-
}
|
| 144 |
-
|
| 145 |
-
return ($this->fallbackEvaluator)($expr);
|
| 146 |
-
}
|
| 147 |
-
|
| 148 |
-
private function evaluateArray(Expr\Array_ $expr) {
|
| 149 |
-
$array = [];
|
| 150 |
-
foreach ($expr->items as $item) {
|
| 151 |
-
if (null !== $item->key) {
|
| 152 |
-
$array[$this->evaluate($item->key)] = $this->evaluate($item->value);
|
| 153 |
-
} else {
|
| 154 |
-
$array[] = $this->evaluate($item->value);
|
| 155 |
-
}
|
| 156 |
-
}
|
| 157 |
-
return $array;
|
| 158 |
-
}
|
| 159 |
-
|
| 160 |
-
private function evaluateTernary(Expr\Ternary $expr) {
|
| 161 |
-
if (null === $expr->if) {
|
| 162 |
-
return $this->evaluate($expr->cond) ?: $this->evaluate($expr->else);
|
| 163 |
-
}
|
| 164 |
-
|
| 165 |
-
return $this->evaluate($expr->cond)
|
| 166 |
-
? $this->evaluate($expr->if)
|
| 167 |
-
: $this->evaluate($expr->else);
|
| 168 |
-
}
|
| 169 |
-
|
| 170 |
-
private function evaluateBinaryOp(Expr\BinaryOp $expr) {
|
| 171 |
-
if ($expr instanceof Expr\BinaryOp\Coalesce
|
| 172 |
-
&& $expr->left instanceof Expr\ArrayDimFetch
|
| 173 |
-
) {
|
| 174 |
-
// This needs to be special cased to respect BP_VAR_IS fetch semantics
|
| 175 |
-
return $this->evaluate($expr->left->var)[$this->evaluate($expr->left->dim)]
|
| 176 |
-
?? $this->evaluate($expr->right);
|
| 177 |
-
}
|
| 178 |
-
|
| 179 |
-
// The evaluate() calls are repeated in each branch, because some of the operators are
|
| 180 |
-
// short-circuiting and evaluating the RHS in advance may be illegal in that case
|
| 181 |
-
$l = $expr->left;
|
| 182 |
-
$r = $expr->right;
|
| 183 |
-
switch ($expr->getOperatorSigil()) {
|
| 184 |
-
case '&': return $this->evaluate($l) & $this->evaluate($r);
|
| 185 |
-
case '|': return $this->evaluate($l) | $this->evaluate($r);
|
| 186 |
-
case '^': return $this->evaluate($l) ^ $this->evaluate($r);
|
| 187 |
-
case '&&': return $this->evaluate($l) && $this->evaluate($r);
|
| 188 |
-
case '||': return $this->evaluate($l) || $this->evaluate($r);
|
| 189 |
-
case '??': return $this->evaluate($l) ?? $this->evaluate($r);
|
| 190 |
-
case '.': return $this->evaluate($l) . $this->evaluate($r);
|
| 191 |
-
case '/': return $this->evaluate($l) / $this->evaluate($r);
|
| 192 |
-
case '==': return $this->evaluate($l) == $this->evaluate($r);
|
| 193 |
-
case '>': return $this->evaluate($l) > $this->evaluate($r);
|
| 194 |
-
case '>=': return $this->evaluate($l) >= $this->evaluate($r);
|
| 195 |
-
case '===': return $this->evaluate($l) === $this->evaluate($r);
|
| 196 |
-
case 'and': return $this->evaluate($l) and $this->evaluate($r);
|
| 197 |
-
case 'or': return $this->evaluate($l) or $this->evaluate($r);
|
| 198 |
-
case 'xor': return $this->evaluate($l) xor $this->evaluate($r);
|
| 199 |
-
case '-': return $this->evaluate($l) - $this->evaluate($r);
|
| 200 |
-
case '%': return $this->evaluate($l) % $this->evaluate($r);
|
| 201 |
-
case '*': return $this->evaluate($l) * $this->evaluate($r);
|
| 202 |
-
case '!=': return $this->evaluate($l) != $this->evaluate($r);
|
| 203 |
-
case '!==': return $this->evaluate($l) !== $this->evaluate($r);
|
| 204 |
-
case '+': return $this->evaluate($l) + $this->evaluate($r);
|
| 205 |
-
case '**': return $this->evaluate($l) ** $this->evaluate($r);
|
| 206 |
-
case '<<': return $this->evaluate($l) << $this->evaluate($r);
|
| 207 |
-
case '>>': return $this->evaluate($l) >> $this->evaluate($r);
|
| 208 |
-
case '<': return $this->evaluate($l) < $this->evaluate($r);
|
| 209 |
-
case '<=': return $this->evaluate($l) <= $this->evaluate($r);
|
| 210 |
-
case '<=>': return $this->evaluate($l) <=> $this->evaluate($r);
|
| 211 |
-
}
|
| 212 |
-
|
| 213 |
-
throw new \Exception('Should not happen');
|
| 214 |
-
}
|
| 215 |
-
|
| 216 |
-
private function evaluateConstFetch(Expr\ConstFetch $expr) {
|
| 217 |
-
$name = $expr->name->toLowerString();
|
| 218 |
-
switch ($name) {
|
| 219 |
-
case 'null': return null;
|
| 220 |
-
case 'false': return false;
|
| 221 |
-
case 'true': return true;
|
| 222 |
-
}
|
| 223 |
-
|
| 224 |
-
return ($this->fallbackEvaluator)($expr);
|
| 225 |
-
}
|
| 226 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Error.php
DELETED
|
@@ -1,180 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
class Error extends \RuntimeException
|
| 6 |
-
{
|
| 7 |
-
protected $rawMessage;
|
| 8 |
-
protected $attributes;
|
| 9 |
-
|
| 10 |
-
/**
|
| 11 |
-
* Creates an Exception signifying a parse error.
|
| 12 |
-
*
|
| 13 |
-
* @param string $message Error message
|
| 14 |
-
* @param array|int $attributes Attributes of node/token where error occurred
|
| 15 |
-
* (or start line of error -- deprecated)
|
| 16 |
-
*/
|
| 17 |
-
public function __construct(string $message, $attributes = []) {
|
| 18 |
-
$this->rawMessage = $message;
|
| 19 |
-
if (is_array($attributes)) {
|
| 20 |
-
$this->attributes = $attributes;
|
| 21 |
-
} else {
|
| 22 |
-
$this->attributes = ['startLine' => $attributes];
|
| 23 |
-
}
|
| 24 |
-
$this->updateMessage();
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
/**
|
| 28 |
-
* Gets the error message
|
| 29 |
-
*
|
| 30 |
-
* @return string Error message
|
| 31 |
-
*/
|
| 32 |
-
public function getRawMessage() : string {
|
| 33 |
-
return $this->rawMessage;
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* Gets the line the error starts in.
|
| 38 |
-
*
|
| 39 |
-
* @return int Error start line
|
| 40 |
-
*/
|
| 41 |
-
public function getStartLine() : int {
|
| 42 |
-
return $this->attributes['startLine'] ?? -1;
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
/**
|
| 46 |
-
* Gets the line the error ends in.
|
| 47 |
-
*
|
| 48 |
-
* @return int Error end line
|
| 49 |
-
*/
|
| 50 |
-
public function getEndLine() : int {
|
| 51 |
-
return $this->attributes['endLine'] ?? -1;
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
/**
|
| 55 |
-
* Gets the attributes of the node/token the error occurred at.
|
| 56 |
-
*
|
| 57 |
-
* @return array
|
| 58 |
-
*/
|
| 59 |
-
public function getAttributes() : array {
|
| 60 |
-
return $this->attributes;
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
/**
|
| 64 |
-
* Sets the attributes of the node/token the error occurred at.
|
| 65 |
-
*
|
| 66 |
-
* @param array $attributes
|
| 67 |
-
*/
|
| 68 |
-
public function setAttributes(array $attributes) {
|
| 69 |
-
$this->attributes = $attributes;
|
| 70 |
-
$this->updateMessage();
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
/**
|
| 74 |
-
* Sets the line of the PHP file the error occurred in.
|
| 75 |
-
*
|
| 76 |
-
* @param string $message Error message
|
| 77 |
-
*/
|
| 78 |
-
public function setRawMessage(string $message) {
|
| 79 |
-
$this->rawMessage = $message;
|
| 80 |
-
$this->updateMessage();
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
/**
|
| 84 |
-
* Sets the line the error starts in.
|
| 85 |
-
*
|
| 86 |
-
* @param int $line Error start line
|
| 87 |
-
*/
|
| 88 |
-
public function setStartLine(int $line) {
|
| 89 |
-
$this->attributes['startLine'] = $line;
|
| 90 |
-
$this->updateMessage();
|
| 91 |
-
}
|
| 92 |
-
|
| 93 |
-
/**
|
| 94 |
-
* Returns whether the error has start and end column information.
|
| 95 |
-
*
|
| 96 |
-
* For column information enable the startFilePos and endFilePos in the lexer options.
|
| 97 |
-
*
|
| 98 |
-
* @return bool
|
| 99 |
-
*/
|
| 100 |
-
public function hasColumnInfo() : bool {
|
| 101 |
-
return isset($this->attributes['startFilePos'], $this->attributes['endFilePos']);
|
| 102 |
-
}
|
| 103 |
-
|
| 104 |
-
/**
|
| 105 |
-
* Gets the start column (1-based) into the line where the error started.
|
| 106 |
-
*
|
| 107 |
-
* @param string $code Source code of the file
|
| 108 |
-
* @return int
|
| 109 |
-
*/
|
| 110 |
-
public function getStartColumn(string $code) : int {
|
| 111 |
-
if (!$this->hasColumnInfo()) {
|
| 112 |
-
throw new \RuntimeException('Error does not have column information');
|
| 113 |
-
}
|
| 114 |
-
|
| 115 |
-
return $this->toColumn($code, $this->attributes['startFilePos']);
|
| 116 |
-
}
|
| 117 |
-
|
| 118 |
-
/**
|
| 119 |
-
* Gets the end column (1-based) into the line where the error ended.
|
| 120 |
-
*
|
| 121 |
-
* @param string $code Source code of the file
|
| 122 |
-
* @return int
|
| 123 |
-
*/
|
| 124 |
-
public function getEndColumn(string $code) : int {
|
| 125 |
-
if (!$this->hasColumnInfo()) {
|
| 126 |
-
throw new \RuntimeException('Error does not have column information');
|
| 127 |
-
}
|
| 128 |
-
|
| 129 |
-
return $this->toColumn($code, $this->attributes['endFilePos']);
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
/**
|
| 133 |
-
* Formats message including line and column information.
|
| 134 |
-
*
|
| 135 |
-
* @param string $code Source code associated with the error, for calculation of the columns
|
| 136 |
-
*
|
| 137 |
-
* @return string Formatted message
|
| 138 |
-
*/
|
| 139 |
-
public function getMessageWithColumnInfo(string $code) : string {
|
| 140 |
-
return sprintf(
|
| 141 |
-
'%s from %d:%d to %d:%d', $this->getRawMessage(),
|
| 142 |
-
$this->getStartLine(), $this->getStartColumn($code),
|
| 143 |
-
$this->getEndLine(), $this->getEndColumn($code)
|
| 144 |
-
);
|
| 145 |
-
}
|
| 146 |
-
|
| 147 |
-
/**
|
| 148 |
-
* Converts a file offset into a column.
|
| 149 |
-
*
|
| 150 |
-
* @param string $code Source code that $pos indexes into
|
| 151 |
-
* @param int $pos 0-based position in $code
|
| 152 |
-
*
|
| 153 |
-
* @return int 1-based column (relative to start of line)
|
| 154 |
-
*/
|
| 155 |
-
private function toColumn(string $code, int $pos) : int {
|
| 156 |
-
if ($pos > strlen($code)) {
|
| 157 |
-
throw new \RuntimeException('Invalid position information');
|
| 158 |
-
}
|
| 159 |
-
|
| 160 |
-
$lineStartPos = strrpos($code, "\n", $pos - strlen($code));
|
| 161 |
-
if (false === $lineStartPos) {
|
| 162 |
-
$lineStartPos = -1;
|
| 163 |
-
}
|
| 164 |
-
|
| 165 |
-
return $pos - $lineStartPos;
|
| 166 |
-
}
|
| 167 |
-
|
| 168 |
-
/**
|
| 169 |
-
* Updates the exception message after a change to rawMessage or rawLine.
|
| 170 |
-
*/
|
| 171 |
-
protected function updateMessage() {
|
| 172 |
-
$this->message = $this->rawMessage;
|
| 173 |
-
|
| 174 |
-
if (-1 === $this->getStartLine()) {
|
| 175 |
-
$this->message .= ' on unknown line';
|
| 176 |
-
} else {
|
| 177 |
-
$this->message .= ' on line ' . $this->getStartLine();
|
| 178 |
-
}
|
| 179 |
-
}
|
| 180 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/ErrorHandler.php
DELETED
|
@@ -1,13 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
interface ErrorHandler
|
| 6 |
-
{
|
| 7 |
-
/**
|
| 8 |
-
* Handle an error generated during lexing, parsing or some other operation.
|
| 9 |
-
*
|
| 10 |
-
* @param Error $error The error that needs to be handled
|
| 11 |
-
*/
|
| 12 |
-
public function handleError(Error $error);
|
| 13 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/ErrorHandler/Collecting.php
DELETED
|
@@ -1,46 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\ErrorHandler;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Error;
|
| 6 |
-
use PhpParser\ErrorHandler;
|
| 7 |
-
|
| 8 |
-
/**
|
| 9 |
-
* Error handler that collects all errors into an array.
|
| 10 |
-
*
|
| 11 |
-
* This allows graceful handling of errors.
|
| 12 |
-
*/
|
| 13 |
-
class Collecting implements ErrorHandler
|
| 14 |
-
{
|
| 15 |
-
/** @var Error[] Collected errors */
|
| 16 |
-
private $errors = [];
|
| 17 |
-
|
| 18 |
-
public function handleError(Error $error) {
|
| 19 |
-
$this->errors[] = $error;
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Get collected errors.
|
| 24 |
-
*
|
| 25 |
-
* @return Error[]
|
| 26 |
-
*/
|
| 27 |
-
public function getErrors() : array {
|
| 28 |
-
return $this->errors;
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
/**
|
| 32 |
-
* Check whether there are any errors.
|
| 33 |
-
*
|
| 34 |
-
* @return bool
|
| 35 |
-
*/
|
| 36 |
-
public function hasErrors() : bool {
|
| 37 |
-
return !empty($this->errors);
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
/**
|
| 41 |
-
* Reset/clear collected errors.
|
| 42 |
-
*/
|
| 43 |
-
public function clearErrors() {
|
| 44 |
-
$this->errors = [];
|
| 45 |
-
}
|
| 46 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/ErrorHandler/Throwing.php
DELETED
|
@@ -1,18 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\ErrorHandler;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Error;
|
| 6 |
-
use PhpParser\ErrorHandler;
|
| 7 |
-
|
| 8 |
-
/**
|
| 9 |
-
* Error handler that handles all errors by throwing them.
|
| 10 |
-
*
|
| 11 |
-
* This is the default strategy used by all components.
|
| 12 |
-
*/
|
| 13 |
-
class Throwing implements ErrorHandler
|
| 14 |
-
{
|
| 15 |
-
public function handleError(Error $error) {
|
| 16 |
-
throw $error;
|
| 17 |
-
}
|
| 18 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Internal/DiffElem.php
DELETED
|
@@ -1,27 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Internal;
|
| 4 |
-
|
| 5 |
-
/**
|
| 6 |
-
* @internal
|
| 7 |
-
*/
|
| 8 |
-
class DiffElem
|
| 9 |
-
{
|
| 10 |
-
const TYPE_KEEP = 0;
|
| 11 |
-
const TYPE_REMOVE = 1;
|
| 12 |
-
const TYPE_ADD = 2;
|
| 13 |
-
const TYPE_REPLACE = 3;
|
| 14 |
-
|
| 15 |
-
/** @var int One of the TYPE_* constants */
|
| 16 |
-
public $type;
|
| 17 |
-
/** @var mixed Is null for add operations */
|
| 18 |
-
public $old;
|
| 19 |
-
/** @var mixed Is null for remove operations */
|
| 20 |
-
public $new;
|
| 21 |
-
|
| 22 |
-
public function __construct(int $type, $old, $new) {
|
| 23 |
-
$this->type = $type;
|
| 24 |
-
$this->old = $old;
|
| 25 |
-
$this->new = $new;
|
| 26 |
-
}
|
| 27 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Internal/Differ.php
DELETED
|
@@ -1,164 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Internal;
|
| 4 |
-
|
| 5 |
-
/**
|
| 6 |
-
* Implements the Myers diff algorithm.
|
| 7 |
-
*
|
| 8 |
-
* Myers, Eugene W. "An O (ND) difference algorithm and its variations."
|
| 9 |
-
* Algorithmica 1.1 (1986): 251-266.
|
| 10 |
-
*
|
| 11 |
-
* @internal
|
| 12 |
-
*/
|
| 13 |
-
class Differ
|
| 14 |
-
{
|
| 15 |
-
private $isEqual;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* Create differ over the given equality relation.
|
| 19 |
-
*
|
| 20 |
-
* @param callable $isEqual Equality relation with signature function($a, $b) : bool
|
| 21 |
-
*/
|
| 22 |
-
public function __construct(callable $isEqual) {
|
| 23 |
-
$this->isEqual = $isEqual;
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
/**
|
| 27 |
-
* Calculate diff (edit script) from $old to $new.
|
| 28 |
-
*
|
| 29 |
-
* @param array $old Original array
|
| 30 |
-
* @param array $new New array
|
| 31 |
-
*
|
| 32 |
-
* @return DiffElem[] Diff (edit script)
|
| 33 |
-
*/
|
| 34 |
-
public function diff(array $old, array $new) {
|
| 35 |
-
list($trace, $x, $y) = $this->calculateTrace($old, $new);
|
| 36 |
-
return $this->extractDiff($trace, $x, $y, $old, $new);
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
/**
|
| 40 |
-
* Calculate diff, including "replace" operations.
|
| 41 |
-
*
|
| 42 |
-
* If a sequence of remove operations is followed by the same number of add operations, these
|
| 43 |
-
* will be coalesced into replace operations.
|
| 44 |
-
*
|
| 45 |
-
* @param array $old Original array
|
| 46 |
-
* @param array $new New array
|
| 47 |
-
*
|
| 48 |
-
* @return DiffElem[] Diff (edit script), including replace operations
|
| 49 |
-
*/
|
| 50 |
-
public function diffWithReplacements(array $old, array $new) {
|
| 51 |
-
return $this->coalesceReplacements($this->diff($old, $new));
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
private function calculateTrace(array $a, array $b) {
|
| 55 |
-
$n = \count($a);
|
| 56 |
-
$m = \count($b);
|
| 57 |
-
$max = $n + $m;
|
| 58 |
-
$v = [1 => 0];
|
| 59 |
-
$trace = [];
|
| 60 |
-
for ($d = 0; $d <= $max; $d++) {
|
| 61 |
-
$trace[] = $v;
|
| 62 |
-
for ($k = -$d; $k <= $d; $k += 2) {
|
| 63 |
-
if ($k === -$d || ($k !== $d && $v[$k-1] < $v[$k+1])) {
|
| 64 |
-
$x = $v[$k+1];
|
| 65 |
-
} else {
|
| 66 |
-
$x = $v[$k-1] + 1;
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
$y = $x - $k;
|
| 70 |
-
while ($x < $n && $y < $m && ($this->isEqual)($a[$x], $b[$y])) {
|
| 71 |
-
$x++;
|
| 72 |
-
$y++;
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
$v[$k] = $x;
|
| 76 |
-
if ($x >= $n && $y >= $m) {
|
| 77 |
-
return [$trace, $x, $y];
|
| 78 |
-
}
|
| 79 |
-
}
|
| 80 |
-
}
|
| 81 |
-
throw new \Exception('Should not happen');
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
private function extractDiff(array $trace, int $x, int $y, array $a, array $b) {
|
| 85 |
-
$result = [];
|
| 86 |
-
for ($d = \count($trace) - 1; $d >= 0; $d--) {
|
| 87 |
-
$v = $trace[$d];
|
| 88 |
-
$k = $x - $y;
|
| 89 |
-
|
| 90 |
-
if ($k === -$d || ($k !== $d && $v[$k-1] < $v[$k+1])) {
|
| 91 |
-
$prevK = $k + 1;
|
| 92 |
-
} else {
|
| 93 |
-
$prevK = $k - 1;
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
$prevX = $v[$prevK];
|
| 97 |
-
$prevY = $prevX - $prevK;
|
| 98 |
-
|
| 99 |
-
while ($x > $prevX && $y > $prevY) {
|
| 100 |
-
$result[] = new DiffElem(DiffElem::TYPE_KEEP, $a[$x-1], $b[$y-1]);
|
| 101 |
-
$x--;
|
| 102 |
-
$y--;
|
| 103 |
-
}
|
| 104 |
-
|
| 105 |
-
if ($d === 0) {
|
| 106 |
-
break;
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
while ($x > $prevX) {
|
| 110 |
-
$result[] = new DiffElem(DiffElem::TYPE_REMOVE, $a[$x-1], null);
|
| 111 |
-
$x--;
|
| 112 |
-
}
|
| 113 |
-
|
| 114 |
-
while ($y > $prevY) {
|
| 115 |
-
$result[] = new DiffElem(DiffElem::TYPE_ADD, null, $b[$y-1]);
|
| 116 |
-
$y--;
|
| 117 |
-
}
|
| 118 |
-
}
|
| 119 |
-
return array_reverse($result);
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
/**
|
| 123 |
-
* Coalesce equal-length sequences of remove+add into a replace operation.
|
| 124 |
-
*
|
| 125 |
-
* @param DiffElem[] $diff
|
| 126 |
-
* @return DiffElem[]
|
| 127 |
-
*/
|
| 128 |
-
private function coalesceReplacements(array $diff) {
|
| 129 |
-
$newDiff = [];
|
| 130 |
-
$c = \count($diff);
|
| 131 |
-
for ($i = 0; $i < $c; $i++) {
|
| 132 |
-
$diffType = $diff[$i]->type;
|
| 133 |
-
if ($diffType !== DiffElem::TYPE_REMOVE) {
|
| 134 |
-
$newDiff[] = $diff[$i];
|
| 135 |
-
continue;
|
| 136 |
-
}
|
| 137 |
-
|
| 138 |
-
$j = $i;
|
| 139 |
-
while ($j < $c && $diff[$j]->type === DiffElem::TYPE_REMOVE) {
|
| 140 |
-
$j++;
|
| 141 |
-
}
|
| 142 |
-
|
| 143 |
-
$k = $j;
|
| 144 |
-
while ($k < $c && $diff[$k]->type === DiffElem::TYPE_ADD) {
|
| 145 |
-
$k++;
|
| 146 |
-
}
|
| 147 |
-
|
| 148 |
-
if ($j - $i === $k - $j) {
|
| 149 |
-
$len = $j - $i;
|
| 150 |
-
for ($n = 0; $n < $len; $n++) {
|
| 151 |
-
$newDiff[] = new DiffElem(
|
| 152 |
-
DiffElem::TYPE_REPLACE, $diff[$i + $n]->old, $diff[$j + $n]->new
|
| 153 |
-
);
|
| 154 |
-
}
|
| 155 |
-
} else {
|
| 156 |
-
for (; $i < $k; $i++) {
|
| 157 |
-
$newDiff[] = $diff[$i];
|
| 158 |
-
}
|
| 159 |
-
}
|
| 160 |
-
$i = $k - 1;
|
| 161 |
-
}
|
| 162 |
-
return $newDiff;
|
| 163 |
-
}
|
| 164 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Internal/PrintableNewAnonClassNode.php
DELETED
|
@@ -1,57 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Internal;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\Node\Expr;
|
| 7 |
-
|
| 8 |
-
/**
|
| 9 |
-
* This node is used internally by the format-preserving pretty printer to print anonymous classes.
|
| 10 |
-
*
|
| 11 |
-
* The normal anonymous class structure violates assumptions about the order of token offsets.
|
| 12 |
-
* Namely, the constructor arguments are part of the Expr\New_ node and follow the class node, even
|
| 13 |
-
* though they are actually interleaved with them. This special node type is used temporarily to
|
| 14 |
-
* restore a sane token offset order.
|
| 15 |
-
*
|
| 16 |
-
* @internal
|
| 17 |
-
*/
|
| 18 |
-
class PrintableNewAnonClassNode extends Expr
|
| 19 |
-
{
|
| 20 |
-
/** @var Node\Arg[] Arguments */
|
| 21 |
-
public $args;
|
| 22 |
-
/** @var null|Node\Name Name of extended class */
|
| 23 |
-
public $extends;
|
| 24 |
-
/** @var Node\Name[] Names of implemented interfaces */
|
| 25 |
-
public $implements;
|
| 26 |
-
/** @var Node\Stmt[] Statements */
|
| 27 |
-
public $stmts;
|
| 28 |
-
|
| 29 |
-
public function __construct(
|
| 30 |
-
array $args, Node\Name $extends = null, array $implements, array $stmts, array $attributes
|
| 31 |
-
) {
|
| 32 |
-
parent::__construct($attributes);
|
| 33 |
-
$this->args = $args;
|
| 34 |
-
$this->extends = $extends;
|
| 35 |
-
$this->implements = $implements;
|
| 36 |
-
$this->stmts = $stmts;
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
public static function fromNewNode(Expr\New_ $newNode) {
|
| 40 |
-
$class = $newNode->class;
|
| 41 |
-
assert($class instanceof Node\Stmt\Class_);
|
| 42 |
-
// We don't assert that $class->name is null here, to allow consumers to assign unique names
|
| 43 |
-
// to anonymous classes for their own purposes. We simplify ignore the name here.
|
| 44 |
-
return new self(
|
| 45 |
-
$newNode->args, $class->extends, $class->implements,
|
| 46 |
-
$class->stmts, $newNode->getAttributes()
|
| 47 |
-
);
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
public function getType() : string {
|
| 51 |
-
return 'Expr_PrintableNewAnonClass';
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
public function getSubNodeNames() : array {
|
| 55 |
-
return ['args', 'extends', 'implements', 'stmts'];
|
| 56 |
-
}
|
| 57 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Internal/TokenStream.php
DELETED
|
@@ -1,256 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Internal;
|
| 4 |
-
|
| 5 |
-
/**
|
| 6 |
-
* Provides operations on token streams, for use by pretty printer.
|
| 7 |
-
*
|
| 8 |
-
* @internal
|
| 9 |
-
*/
|
| 10 |
-
class TokenStream
|
| 11 |
-
{
|
| 12 |
-
/** @var array Tokens (in token_get_all format) */
|
| 13 |
-
private $tokens;
|
| 14 |
-
/** @var int[] Map from position to indentation */
|
| 15 |
-
private $indentMap;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* Create token stream instance.
|
| 19 |
-
*
|
| 20 |
-
* @param array $tokens Tokens in token_get_all() format
|
| 21 |
-
*/
|
| 22 |
-
public function __construct(array $tokens) {
|
| 23 |
-
$this->tokens = $tokens;
|
| 24 |
-
$this->indentMap = $this->calcIndentMap();
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
/**
|
| 28 |
-
* Whether the given position is immediately surrounded by parenthesis.
|
| 29 |
-
*
|
| 30 |
-
* @param int $startPos Start position
|
| 31 |
-
* @param int $endPos End position
|
| 32 |
-
*
|
| 33 |
-
* @return bool
|
| 34 |
-
*/
|
| 35 |
-
public function haveParens(int $startPos, int $endPos) : bool {
|
| 36 |
-
return $this->haveTokenImmediativelyBefore($startPos, '(')
|
| 37 |
-
&& $this->haveTokenImmediatelyAfter($endPos, ')');
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
/**
|
| 41 |
-
* Whether the given position is immediately surrounded by braces.
|
| 42 |
-
*
|
| 43 |
-
* @param int $startPos Start position
|
| 44 |
-
* @param int $endPos End position
|
| 45 |
-
*
|
| 46 |
-
* @return bool
|
| 47 |
-
*/
|
| 48 |
-
public function haveBraces(int $startPos, int $endPos) : bool {
|
| 49 |
-
return $this->haveTokenImmediativelyBefore($startPos, '{')
|
| 50 |
-
&& $this->haveTokenImmediatelyAfter($endPos, '}');
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
/**
|
| 54 |
-
* Check whether the position is directly preceded by a certain token type.
|
| 55 |
-
*
|
| 56 |
-
* During this check whitespace and comments are skipped.
|
| 57 |
-
*
|
| 58 |
-
* @param int $pos Position before which the token should occur
|
| 59 |
-
* @param int|string $expectedTokenType Token to check for
|
| 60 |
-
*
|
| 61 |
-
* @return bool Whether the expected token was found
|
| 62 |
-
*/
|
| 63 |
-
public function haveTokenImmediativelyBefore(int $pos, $expectedTokenType) : bool {
|
| 64 |
-
$tokens = $this->tokens;
|
| 65 |
-
$pos--;
|
| 66 |
-
for (; $pos >= 0; $pos--) {
|
| 67 |
-
$tokenType = $tokens[$pos][0];
|
| 68 |
-
if ($tokenType === $expectedTokenType) {
|
| 69 |
-
return true;
|
| 70 |
-
}
|
| 71 |
-
if ($tokenType !== \T_WHITESPACE
|
| 72 |
-
&& $tokenType !== \T_COMMENT && $tokenType !== \T_DOC_COMMENT) {
|
| 73 |
-
break;
|
| 74 |
-
}
|
| 75 |
-
}
|
| 76 |
-
return false;
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
/**
|
| 80 |
-
* Check whether the position is directly followed by a certain token type.
|
| 81 |
-
*
|
| 82 |
-
* During this check whitespace and comments are skipped.
|
| 83 |
-
*
|
| 84 |
-
* @param int $pos Position after which the token should occur
|
| 85 |
-
* @param int|string $expectedTokenType Token to check for
|
| 86 |
-
*
|
| 87 |
-
* @return bool Whether the expected token was found
|
| 88 |
-
*/
|
| 89 |
-
public function haveTokenImmediatelyAfter(int $pos, $expectedTokenType) : bool {
|
| 90 |
-
$tokens = $this->tokens;
|
| 91 |
-
$pos++;
|
| 92 |
-
for (; $pos < \count($tokens); $pos++) {
|
| 93 |
-
$tokenType = $tokens[$pos][0];
|
| 94 |
-
if ($tokenType === $expectedTokenType) {
|
| 95 |
-
return true;
|
| 96 |
-
}
|
| 97 |
-
if ($tokenType !== \T_WHITESPACE
|
| 98 |
-
&& $tokenType !== \T_COMMENT && $tokenType !== \T_DOC_COMMENT) {
|
| 99 |
-
break;
|
| 100 |
-
}
|
| 101 |
-
}
|
| 102 |
-
return false;
|
| 103 |
-
}
|
| 104 |
-
|
| 105 |
-
public function skipLeft(int $pos, $skipTokenType) {
|
| 106 |
-
$tokens = $this->tokens;
|
| 107 |
-
|
| 108 |
-
$pos = $this->skipLeftWhitespace($pos);
|
| 109 |
-
if ($skipTokenType === \T_WHITESPACE) {
|
| 110 |
-
return $pos;
|
| 111 |
-
}
|
| 112 |
-
|
| 113 |
-
if ($tokens[$pos][0] !== $skipTokenType) {
|
| 114 |
-
// Shouldn't happen. The skip token MUST be there
|
| 115 |
-
throw new \Exception('Encountered unexpected token');
|
| 116 |
-
}
|
| 117 |
-
$pos--;
|
| 118 |
-
|
| 119 |
-
return $this->skipLeftWhitespace($pos);
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
public function skipRight(int $pos, $skipTokenType) {
|
| 123 |
-
$tokens = $this->tokens;
|
| 124 |
-
|
| 125 |
-
$pos = $this->skipRightWhitespace($pos);
|
| 126 |
-
if ($skipTokenType === \T_WHITESPACE) {
|
| 127 |
-
return $pos;
|
| 128 |
-
}
|
| 129 |
-
|
| 130 |
-
if ($tokens[$pos][0] !== $skipTokenType) {
|
| 131 |
-
// Shouldn't happen. The skip token MUST be there
|
| 132 |
-
throw new \Exception('Encountered unexpected token');
|
| 133 |
-
}
|
| 134 |
-
$pos++;
|
| 135 |
-
|
| 136 |
-
return $this->skipRightWhitespace($pos);
|
| 137 |
-
}
|
| 138 |
-
|
| 139 |
-
/**
|
| 140 |
-
* Return first non-whitespace token position smaller or equal to passed position.
|
| 141 |
-
*
|
| 142 |
-
* @param int $pos Token position
|
| 143 |
-
* @return int Non-whitespace token position
|
| 144 |
-
*/
|
| 145 |
-
public function skipLeftWhitespace(int $pos) {
|
| 146 |
-
$tokens = $this->tokens;
|
| 147 |
-
for (; $pos >= 0; $pos--) {
|
| 148 |
-
$type = $tokens[$pos][0];
|
| 149 |
-
if ($type !== \T_WHITESPACE && $type !== \T_COMMENT && $type !== \T_DOC_COMMENT) {
|
| 150 |
-
break;
|
| 151 |
-
}
|
| 152 |
-
}
|
| 153 |
-
return $pos;
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
/**
|
| 157 |
-
* Return first non-whitespace position greater or equal to passed position.
|
| 158 |
-
*
|
| 159 |
-
* @param int $pos Token position
|
| 160 |
-
* @return int Non-whitespace token position
|
| 161 |
-
*/
|
| 162 |
-
public function skipRightWhitespace(int $pos) {
|
| 163 |
-
$tokens = $this->tokens;
|
| 164 |
-
for ($count = \count($tokens); $pos < $count; $pos++) {
|
| 165 |
-
$type = $tokens[$pos][0];
|
| 166 |
-
if ($type !== \T_WHITESPACE && $type !== \T_COMMENT && $type !== \T_DOC_COMMENT) {
|
| 167 |
-
break;
|
| 168 |
-
}
|
| 169 |
-
}
|
| 170 |
-
return $pos;
|
| 171 |
-
}
|
| 172 |
-
|
| 173 |
-
public function findRight($pos, $findTokenType) {
|
| 174 |
-
$tokens = $this->tokens;
|
| 175 |
-
for ($count = \count($tokens); $pos < $count; $pos++) {
|
| 176 |
-
$type = $tokens[$pos][0];
|
| 177 |
-
if ($type === $findTokenType) {
|
| 178 |
-
return $pos;
|
| 179 |
-
}
|
| 180 |
-
}
|
| 181 |
-
return -1;
|
| 182 |
-
}
|
| 183 |
-
|
| 184 |
-
/**
|
| 185 |
-
* Get indentation before token position.
|
| 186 |
-
*
|
| 187 |
-
* @param int $pos Token position
|
| 188 |
-
*
|
| 189 |
-
* @return int Indentation depth (in spaces)
|
| 190 |
-
*/
|
| 191 |
-
public function getIndentationBefore(int $pos) : int {
|
| 192 |
-
return $this->indentMap[$pos];
|
| 193 |
-
}
|
| 194 |
-
|
| 195 |
-
/**
|
| 196 |
-
* Get the code corresponding to a token offset range, optionally adjusted for indentation.
|
| 197 |
-
*
|
| 198 |
-
* @param int $from Token start position (inclusive)
|
| 199 |
-
* @param int $to Token end position (exclusive)
|
| 200 |
-
* @param int $indent By how much the code should be indented (can be negative as well)
|
| 201 |
-
*
|
| 202 |
-
* @return string Code corresponding to token range, adjusted for indentation
|
| 203 |
-
*/
|
| 204 |
-
public function getTokenCode(int $from, int $to, int $indent) : string {
|
| 205 |
-
$tokens = $this->tokens;
|
| 206 |
-
$result = '';
|
| 207 |
-
for ($pos = $from; $pos < $to; $pos++) {
|
| 208 |
-
$token = $tokens[$pos];
|
| 209 |
-
if (\is_array($token)) {
|
| 210 |
-
$type = $token[0];
|
| 211 |
-
$content = $token[1];
|
| 212 |
-
if ($type === \T_CONSTANT_ENCAPSED_STRING || $type === \T_ENCAPSED_AND_WHITESPACE) {
|
| 213 |
-
$result .= $content;
|
| 214 |
-
} else {
|
| 215 |
-
// TODO Handle non-space indentation
|
| 216 |
-
if ($indent < 0) {
|
| 217 |
-
$result .= str_replace("\n" . str_repeat(" ", -$indent), "\n", $content);
|
| 218 |
-
} elseif ($indent > 0) {
|
| 219 |
-
$result .= str_replace("\n", "\n" . str_repeat(" ", $indent), $content);
|
| 220 |
-
} else {
|
| 221 |
-
$result .= $content;
|
| 222 |
-
}
|
| 223 |
-
}
|
| 224 |
-
} else {
|
| 225 |
-
$result .= $token;
|
| 226 |
-
}
|
| 227 |
-
}
|
| 228 |
-
return $result;
|
| 229 |
-
}
|
| 230 |
-
|
| 231 |
-
/**
|
| 232 |
-
* Precalculate the indentation at every token position.
|
| 233 |
-
*
|
| 234 |
-
* @return int[] Token position to indentation map
|
| 235 |
-
*/
|
| 236 |
-
private function calcIndentMap() {
|
| 237 |
-
$indentMap = [];
|
| 238 |
-
$indent = 0;
|
| 239 |
-
foreach ($this->tokens as $token) {
|
| 240 |
-
$indentMap[] = $indent;
|
| 241 |
-
|
| 242 |
-
if ($token[0] === \T_WHITESPACE) {
|
| 243 |
-
$content = $token[1];
|
| 244 |
-
$newlinePos = \strrpos($content, "\n");
|
| 245 |
-
if (false !== $newlinePos) {
|
| 246 |
-
$indent = \strlen($content) - $newlinePos - 1;
|
| 247 |
-
}
|
| 248 |
-
}
|
| 249 |
-
}
|
| 250 |
-
|
| 251 |
-
// Add a sentinel for one past end of the file
|
| 252 |
-
$indentMap[] = $indent;
|
| 253 |
-
|
| 254 |
-
return $indentMap;
|
| 255 |
-
}
|
| 256 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/JsonDecoder.php
DELETED
|
@@ -1,103 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
class JsonDecoder
|
| 6 |
-
{
|
| 7 |
-
/** @var \ReflectionClass[] Node type to reflection class map */
|
| 8 |
-
private $reflectionClassCache;
|
| 9 |
-
|
| 10 |
-
public function decode(string $json) {
|
| 11 |
-
$value = json_decode($json, true);
|
| 12 |
-
if (json_last_error()) {
|
| 13 |
-
throw new \RuntimeException('JSON decoding error: ' . json_last_error_msg());
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
return $this->decodeRecursive($value);
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
private function decodeRecursive($value) {
|
| 20 |
-
if (\is_array($value)) {
|
| 21 |
-
if (isset($value['nodeType'])) {
|
| 22 |
-
if ($value['nodeType'] === 'Comment' || $value['nodeType'] === 'Comment_Doc') {
|
| 23 |
-
return $this->decodeComment($value);
|
| 24 |
-
}
|
| 25 |
-
return $this->decodeNode($value);
|
| 26 |
-
}
|
| 27 |
-
return $this->decodeArray($value);
|
| 28 |
-
}
|
| 29 |
-
return $value;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
private function decodeArray(array $array) : array {
|
| 33 |
-
$decodedArray = [];
|
| 34 |
-
foreach ($array as $key => $value) {
|
| 35 |
-
$decodedArray[$key] = $this->decodeRecursive($value);
|
| 36 |
-
}
|
| 37 |
-
return $decodedArray;
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
private function decodeNode(array $value) : Node {
|
| 41 |
-
$nodeType = $value['nodeType'];
|
| 42 |
-
if (!\is_string($nodeType)) {
|
| 43 |
-
throw new \RuntimeException('Node type must be a string');
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
$reflectionClass = $this->reflectionClassFromNodeType($nodeType);
|
| 47 |
-
/** @var Node $node */
|
| 48 |
-
$node = $reflectionClass->newInstanceWithoutConstructor();
|
| 49 |
-
|
| 50 |
-
if (isset($value['attributes'])) {
|
| 51 |
-
if (!\is_array($value['attributes'])) {
|
| 52 |
-
throw new \RuntimeException('Attributes must be an array');
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
$node->setAttributes($this->decodeArray($value['attributes']));
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
foreach ($value as $name => $subNode) {
|
| 59 |
-
if ($name === 'nodeType' || $name === 'attributes') {
|
| 60 |
-
continue;
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
$node->$name = $this->decodeRecursive($subNode);
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
return $node;
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
private function decodeComment(array $value) : Comment {
|
| 70 |
-
$className = $value['nodeType'] === 'Comment' ? Comment::class : Comment\Doc::class;
|
| 71 |
-
if (!isset($value['text'])) {
|
| 72 |
-
throw new \RuntimeException('Comment must have text');
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
return new $className(
|
| 76 |
-
$value['text'],
|
| 77 |
-
$value['line'] ?? -1, $value['filePos'] ?? -1, $value['tokenPos'] ?? -1,
|
| 78 |
-
$value['endLine'] ?? -1, $value['endFilePos'] ?? -1, $value['endTokenPos'] ?? -1
|
| 79 |
-
);
|
| 80 |
-
}
|
| 81 |
-
|
| 82 |
-
private function reflectionClassFromNodeType(string $nodeType) : \ReflectionClass {
|
| 83 |
-
if (!isset($this->reflectionClassCache[$nodeType])) {
|
| 84 |
-
$className = $this->classNameFromNodeType($nodeType);
|
| 85 |
-
$this->reflectionClassCache[$nodeType] = new \ReflectionClass($className);
|
| 86 |
-
}
|
| 87 |
-
return $this->reflectionClassCache[$nodeType];
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
private function classNameFromNodeType(string $nodeType) : string {
|
| 91 |
-
$className = 'PhpParser\\Node\\' . strtr($nodeType, '_', '\\');
|
| 92 |
-
if (class_exists($className)) {
|
| 93 |
-
return $className;
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
$className .= '_';
|
| 97 |
-
if (class_exists($className)) {
|
| 98 |
-
return $className;
|
| 99 |
-
}
|
| 100 |
-
|
| 101 |
-
throw new \RuntimeException("Unknown node type \"$nodeType\"");
|
| 102 |
-
}
|
| 103 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Lexer.php
DELETED
|
@@ -1,422 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Parser\Tokens;
|
| 6 |
-
|
| 7 |
-
class Lexer
|
| 8 |
-
{
|
| 9 |
-
protected $code;
|
| 10 |
-
protected $tokens;
|
| 11 |
-
protected $pos;
|
| 12 |
-
protected $line;
|
| 13 |
-
protected $filePos;
|
| 14 |
-
protected $prevCloseTagHasNewline;
|
| 15 |
-
|
| 16 |
-
protected $tokenMap;
|
| 17 |
-
protected $dropTokens;
|
| 18 |
-
|
| 19 |
-
private $attributeStartLineUsed;
|
| 20 |
-
private $attributeEndLineUsed;
|
| 21 |
-
private $attributeStartTokenPosUsed;
|
| 22 |
-
private $attributeEndTokenPosUsed;
|
| 23 |
-
private $attributeStartFilePosUsed;
|
| 24 |
-
private $attributeEndFilePosUsed;
|
| 25 |
-
private $attributeCommentsUsed;
|
| 26 |
-
|
| 27 |
-
/**
|
| 28 |
-
* Creates a Lexer.
|
| 29 |
-
*
|
| 30 |
-
* @param array $options Options array. Currently only the 'usedAttributes' option is supported,
|
| 31 |
-
* which is an array of attributes to add to the AST nodes. Possible
|
| 32 |
-
* attributes are: 'comments', 'startLine', 'endLine', 'startTokenPos',
|
| 33 |
-
* 'endTokenPos', 'startFilePos', 'endFilePos'. The option defaults to the
|
| 34 |
-
* first three. For more info see getNextToken() docs.
|
| 35 |
-
*/
|
| 36 |
-
public function __construct(array $options = []) {
|
| 37 |
-
// map from internal tokens to PhpParser tokens
|
| 38 |
-
$this->tokenMap = $this->createTokenMap();
|
| 39 |
-
|
| 40 |
-
// Compatibility define for PHP < 7.4
|
| 41 |
-
if (!defined('T_BAD_CHARACTER')) {
|
| 42 |
-
\define('T_BAD_CHARACTER', -1);
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
// map of tokens to drop while lexing (the map is only used for isset lookup,
|
| 46 |
-
// that's why the value is simply set to 1; the value is never actually used.)
|
| 47 |
-
$this->dropTokens = array_fill_keys(
|
| 48 |
-
[\T_WHITESPACE, \T_OPEN_TAG, \T_COMMENT, \T_DOC_COMMENT, \T_BAD_CHARACTER], 1
|
| 49 |
-
);
|
| 50 |
-
|
| 51 |
-
$defaultAttributes = ['comments', 'startLine', 'endLine'];
|
| 52 |
-
$usedAttributes = array_fill_keys($options['usedAttributes'] ?? $defaultAttributes, true);
|
| 53 |
-
|
| 54 |
-
// Create individual boolean properties to make these checks faster.
|
| 55 |
-
$this->attributeStartLineUsed = isset($usedAttributes['startLine']);
|
| 56 |
-
$this->attributeEndLineUsed = isset($usedAttributes['endLine']);
|
| 57 |
-
$this->attributeStartTokenPosUsed = isset($usedAttributes['startTokenPos']);
|
| 58 |
-
$this->attributeEndTokenPosUsed = isset($usedAttributes['endTokenPos']);
|
| 59 |
-
$this->attributeStartFilePosUsed = isset($usedAttributes['startFilePos']);
|
| 60 |
-
$this->attributeEndFilePosUsed = isset($usedAttributes['endFilePos']);
|
| 61 |
-
$this->attributeCommentsUsed = isset($usedAttributes['comments']);
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
/**
|
| 65 |
-
* Initializes the lexer for lexing the provided source code.
|
| 66 |
-
*
|
| 67 |
-
* This function does not throw if lexing errors occur. Instead, errors may be retrieved using
|
| 68 |
-
* the getErrors() method.
|
| 69 |
-
*
|
| 70 |
-
* @param string $code The source code to lex
|
| 71 |
-
* @param ErrorHandler|null $errorHandler Error handler to use for lexing errors. Defaults to
|
| 72 |
-
* ErrorHandler\Throwing
|
| 73 |
-
*/
|
| 74 |
-
public function startLexing(string $code, ErrorHandler $errorHandler = null) {
|
| 75 |
-
if (null === $errorHandler) {
|
| 76 |
-
$errorHandler = new ErrorHandler\Throwing();
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
$this->code = $code; // keep the code around for __halt_compiler() handling
|
| 80 |
-
$this->pos = -1;
|
| 81 |
-
$this->line = 1;
|
| 82 |
-
$this->filePos = 0;
|
| 83 |
-
|
| 84 |
-
// If inline HTML occurs without preceding code, treat it as if it had a leading newline.
|
| 85 |
-
// This ensures proper composability, because having a newline is the "safe" assumption.
|
| 86 |
-
$this->prevCloseTagHasNewline = true;
|
| 87 |
-
|
| 88 |
-
$scream = ini_set('xdebug.scream', '0');
|
| 89 |
-
|
| 90 |
-
error_clear_last();
|
| 91 |
-
$this->tokens = @token_get_all($code);
|
| 92 |
-
$this->handleErrors($errorHandler);
|
| 93 |
-
|
| 94 |
-
if (false !== $scream) {
|
| 95 |
-
ini_set('xdebug.scream', $scream);
|
| 96 |
-
}
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
private function handleInvalidCharacterRange($start, $end, $line, ErrorHandler $errorHandler) {
|
| 100 |
-
$tokens = [];
|
| 101 |
-
for ($i = $start; $i < $end; $i++) {
|
| 102 |
-
$chr = $this->code[$i];
|
| 103 |
-
if ($chr === "\0") {
|
| 104 |
-
// PHP cuts error message after null byte, so need special case
|
| 105 |
-
$errorMsg = 'Unexpected null byte';
|
| 106 |
-
} else {
|
| 107 |
-
$errorMsg = sprintf(
|
| 108 |
-
'Unexpected character "%s" (ASCII %d)', $chr, ord($chr)
|
| 109 |
-
);
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
$tokens[] = [\T_BAD_CHARACTER, $chr, $line];
|
| 113 |
-
$errorHandler->handleError(new Error($errorMsg, [
|
| 114 |
-
'startLine' => $line,
|
| 115 |
-
'endLine' => $line,
|
| 116 |
-
'startFilePos' => $i,
|
| 117 |
-
'endFilePos' => $i,
|
| 118 |
-
]));
|
| 119 |
-
}
|
| 120 |
-
return $tokens;
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
/**
|
| 124 |
-
* Check whether comment token is unterminated.
|
| 125 |
-
*
|
| 126 |
-
* @return bool
|
| 127 |
-
*/
|
| 128 |
-
private function isUnterminatedComment($token) : bool {
|
| 129 |
-
return ($token[0] === \T_COMMENT || $token[0] === \T_DOC_COMMENT)
|
| 130 |
-
&& substr($token[1], 0, 2) === '/*'
|
| 131 |
-
&& substr($token[1], -2) !== '*/';
|
| 132 |
-
}
|
| 133 |
-
|
| 134 |
-
/**
|
| 135 |
-
* Check whether an error *may* have occurred during tokenization.
|
| 136 |
-
*
|
| 137 |
-
* @return bool
|
| 138 |
-
*/
|
| 139 |
-
private function errorMayHaveOccurred() : bool {
|
| 140 |
-
if (defined('HHVM_VERSION')) {
|
| 141 |
-
// In HHVM token_get_all() does not throw warnings, so we need to conservatively
|
| 142 |
-
// assume that an error occurred
|
| 143 |
-
return true;
|
| 144 |
-
}
|
| 145 |
-
|
| 146 |
-
if (PHP_VERSION_ID >= 80000) {
|
| 147 |
-
// PHP 8 converts the "bad character" case into a parse error, rather than treating
|
| 148 |
-
// it as a lexing warning. To preserve previous behavior, we need to assume that an
|
| 149 |
-
// error occurred.
|
| 150 |
-
// TODO: We should handle this the same way as PHP 8: Only generate T_BAD_CHARACTER
|
| 151 |
-
// token here (for older PHP versions) and leave generationg of the actual parse error
|
| 152 |
-
// to the parser. This will also save the full token scan on PHP 8 here.
|
| 153 |
-
return true;
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
return null !== error_get_last();
|
| 157 |
-
}
|
| 158 |
-
|
| 159 |
-
protected function handleErrors(ErrorHandler $errorHandler) {
|
| 160 |
-
if (!$this->errorMayHaveOccurred()) {
|
| 161 |
-
return;
|
| 162 |
-
}
|
| 163 |
-
|
| 164 |
-
// PHP's error handling for token_get_all() is rather bad, so if we want detailed
|
| 165 |
-
// error information we need to compute it ourselves. Invalid character errors are
|
| 166 |
-
// detected by finding "gaps" in the token array. Unterminated comments are detected
|
| 167 |
-
// by checking if a trailing comment has a "*/" at the end.
|
| 168 |
-
|
| 169 |
-
$filePos = 0;
|
| 170 |
-
$line = 1;
|
| 171 |
-
$numTokens = \count($this->tokens);
|
| 172 |
-
for ($i = 0; $i < $numTokens; $i++) {
|
| 173 |
-
$token = $this->tokens[$i];
|
| 174 |
-
|
| 175 |
-
// Since PHP 7.4 invalid characters are represented by a T_BAD_CHARACTER token.
|
| 176 |
-
// In this case we only need to emit an error.
|
| 177 |
-
if ($token[0] === \T_BAD_CHARACTER) {
|
| 178 |
-
$this->handleInvalidCharacterRange($filePos, $filePos + 1, $line, $errorHandler);
|
| 179 |
-
}
|
| 180 |
-
|
| 181 |
-
$tokenValue = \is_string($token) ? $token : $token[1];
|
| 182 |
-
$tokenLen = \strlen($tokenValue);
|
| 183 |
-
|
| 184 |
-
if (substr($this->code, $filePos, $tokenLen) !== $tokenValue) {
|
| 185 |
-
// Something is missing, must be an invalid character
|
| 186 |
-
$nextFilePos = strpos($this->code, $tokenValue, $filePos);
|
| 187 |
-
$badCharTokens = $this->handleInvalidCharacterRange(
|
| 188 |
-
$filePos, $nextFilePos, $line, $errorHandler);
|
| 189 |
-
$filePos = (int) $nextFilePos;
|
| 190 |
-
|
| 191 |
-
array_splice($this->tokens, $i, 0, $badCharTokens);
|
| 192 |
-
$numTokens += \count($badCharTokens);
|
| 193 |
-
$i += \count($badCharTokens);
|
| 194 |
-
}
|
| 195 |
-
|
| 196 |
-
$filePos += $tokenLen;
|
| 197 |
-
$line += substr_count($tokenValue, "\n");
|
| 198 |
-
}
|
| 199 |
-
|
| 200 |
-
if ($filePos !== \strlen($this->code)) {
|
| 201 |
-
if (substr($this->code, $filePos, 2) === '/*') {
|
| 202 |
-
// Unlike PHP, HHVM will drop unterminated comments entirely
|
| 203 |
-
$comment = substr($this->code, $filePos);
|
| 204 |
-
$errorHandler->handleError(new Error('Unterminated comment', [
|
| 205 |
-
'startLine' => $line,
|
| 206 |
-
'endLine' => $line + substr_count($comment, "\n"),
|
| 207 |
-
'startFilePos' => $filePos,
|
| 208 |
-
'endFilePos' => $filePos + \strlen($comment),
|
| 209 |
-
]));
|
| 210 |
-
|
| 211 |
-
// Emulate the PHP behavior
|
| 212 |
-
$isDocComment = isset($comment[3]) && $comment[3] === '*';
|
| 213 |
-
$this->tokens[] = [$isDocComment ? \T_DOC_COMMENT : \T_COMMENT, $comment, $line];
|
| 214 |
-
} else {
|
| 215 |
-
// Invalid characters at the end of the input
|
| 216 |
-
$badCharTokens = $this->handleInvalidCharacterRange(
|
| 217 |
-
$filePos, \strlen($this->code), $line, $errorHandler);
|
| 218 |
-
$this->tokens = array_merge($this->tokens, $badCharTokens);
|
| 219 |
-
}
|
| 220 |
-
return;
|
| 221 |
-
}
|
| 222 |
-
|
| 223 |
-
if (count($this->tokens) > 0) {
|
| 224 |
-
// Check for unterminated comment
|
| 225 |
-
$lastToken = $this->tokens[count($this->tokens) - 1];
|
| 226 |
-
if ($this->isUnterminatedComment($lastToken)) {
|
| 227 |
-
$errorHandler->handleError(new Error('Unterminated comment', [
|
| 228 |
-
'startLine' => $line - substr_count($lastToken[1], "\n"),
|
| 229 |
-
'endLine' => $line,
|
| 230 |
-
'startFilePos' => $filePos - \strlen($lastToken[1]),
|
| 231 |
-
'endFilePos' => $filePos,
|
| 232 |
-
]));
|
| 233 |
-
}
|
| 234 |
-
}
|
| 235 |
-
}
|
| 236 |
-
|
| 237 |
-
/**
|
| 238 |
-
* Fetches the next token.
|
| 239 |
-
*
|
| 240 |
-
* The available attributes are determined by the 'usedAttributes' option, which can
|
| 241 |
-
* be specified in the constructor. The following attributes are supported:
|
| 242 |
-
*
|
| 243 |
-
* * 'comments' => Array of PhpParser\Comment or PhpParser\Comment\Doc instances,
|
| 244 |
-
* representing all comments that occurred between the previous
|
| 245 |
-
* non-discarded token and the current one.
|
| 246 |
-
* * 'startLine' => Line in which the node starts.
|
| 247 |
-
* * 'endLine' => Line in which the node ends.
|
| 248 |
-
* * 'startTokenPos' => Offset into the token array of the first token in the node.
|
| 249 |
-
* * 'endTokenPos' => Offset into the token array of the last token in the node.
|
| 250 |
-
* * 'startFilePos' => Offset into the code string of the first character that is part of the node.
|
| 251 |
-
* * 'endFilePos' => Offset into the code string of the last character that is part of the node.
|
| 252 |
-
*
|
| 253 |
-
* @param mixed $value Variable to store token content in
|
| 254 |
-
* @param mixed $startAttributes Variable to store start attributes in
|
| 255 |
-
* @param mixed $endAttributes Variable to store end attributes in
|
| 256 |
-
*
|
| 257 |
-
* @return int Token id
|
| 258 |
-
*/
|
| 259 |
-
public function getNextToken(&$value = null, &$startAttributes = null, &$endAttributes = null) : int {
|
| 260 |
-
$startAttributes = [];
|
| 261 |
-
$endAttributes = [];
|
| 262 |
-
|
| 263 |
-
while (1) {
|
| 264 |
-
if (isset($this->tokens[++$this->pos])) {
|
| 265 |
-
$token = $this->tokens[$this->pos];
|
| 266 |
-
} else {
|
| 267 |
-
// EOF token with ID 0
|
| 268 |
-
$token = "\0";
|
| 269 |
-
}
|
| 270 |
-
|
| 271 |
-
if ($this->attributeStartLineUsed) {
|
| 272 |
-
$startAttributes['startLine'] = $this->line;
|
| 273 |
-
}
|
| 274 |
-
if ($this->attributeStartTokenPosUsed) {
|
| 275 |
-
$startAttributes['startTokenPos'] = $this->pos;
|
| 276 |
-
}
|
| 277 |
-
if ($this->attributeStartFilePosUsed) {
|
| 278 |
-
$startAttributes['startFilePos'] = $this->filePos;
|
| 279 |
-
}
|
| 280 |
-
|
| 281 |
-
if (\is_string($token)) {
|
| 282 |
-
$value = $token;
|
| 283 |
-
if (isset($token[1])) {
|
| 284 |
-
// bug in token_get_all
|
| 285 |
-
$this->filePos += 2;
|
| 286 |
-
$id = ord('"');
|
| 287 |
-
} else {
|
| 288 |
-
$this->filePos += 1;
|
| 289 |
-
$id = ord($token);
|
| 290 |
-
}
|
| 291 |
-
} elseif (!isset($this->dropTokens[$token[0]])) {
|
| 292 |
-
$value = $token[1];
|
| 293 |
-
$id = $this->tokenMap[$token[0]];
|
| 294 |
-
if (\T_CLOSE_TAG === $token[0]) {
|
| 295 |
-
$this->prevCloseTagHasNewline = false !== strpos($token[1], "\n");
|
| 296 |
-
} elseif (\T_INLINE_HTML === $token[0]) {
|
| 297 |
-
$startAttributes['hasLeadingNewline'] = $this->prevCloseTagHasNewline;
|
| 298 |
-
}
|
| 299 |
-
|
| 300 |
-
$this->line += substr_count($value, "\n");
|
| 301 |
-
$this->filePos += \strlen($value);
|
| 302 |
-
} else {
|
| 303 |
-
$origLine = $this->line;
|
| 304 |
-
$origFilePos = $this->filePos;
|
| 305 |
-
$this->line += substr_count($token[1], "\n");
|
| 306 |
-
$this->filePos += \strlen($token[1]);
|
| 307 |
-
|
| 308 |
-
if (\T_COMMENT === $token[0] || \T_DOC_COMMENT === $token[0]) {
|
| 309 |
-
if ($this->attributeCommentsUsed) {
|
| 310 |
-
$comment = \T_DOC_COMMENT === $token[0]
|
| 311 |
-
? new Comment\Doc($token[1],
|
| 312 |
-
$origLine, $origFilePos, $this->pos,
|
| 313 |
-
$this->line, $this->filePos - 1, $this->pos)
|
| 314 |
-
: new Comment($token[1],
|
| 315 |
-
$origLine, $origFilePos, $this->pos,
|
| 316 |
-
$this->line, $this->filePos - 1, $this->pos);
|
| 317 |
-
$startAttributes['comments'][] = $comment;
|
| 318 |
-
}
|
| 319 |
-
}
|
| 320 |
-
continue;
|
| 321 |
-
}
|
| 322 |
-
|
| 323 |
-
if ($this->attributeEndLineUsed) {
|
| 324 |
-
$endAttributes['endLine'] = $this->line;
|
| 325 |
-
}
|
| 326 |
-
if ($this->attributeEndTokenPosUsed) {
|
| 327 |
-
$endAttributes['endTokenPos'] = $this->pos;
|
| 328 |
-
}
|
| 329 |
-
if ($this->attributeEndFilePosUsed) {
|
| 330 |
-
$endAttributes['endFilePos'] = $this->filePos - 1;
|
| 331 |
-
}
|
| 332 |
-
|
| 333 |
-
return $id;
|
| 334 |
-
}
|
| 335 |
-
|
| 336 |
-
throw new \RuntimeException('Reached end of lexer loop');
|
| 337 |
-
}
|
| 338 |
-
|
| 339 |
-
/**
|
| 340 |
-
* Returns the token array for current code.
|
| 341 |
-
*
|
| 342 |
-
* The token array is in the same format as provided by the
|
| 343 |
-
* token_get_all() function and does not discard tokens (i.e.
|
| 344 |
-
* whitespace and comments are included). The token position
|
| 345 |
-
* attributes are against this token array.
|
| 346 |
-
*
|
| 347 |
-
* @return array Array of tokens in token_get_all() format
|
| 348 |
-
*/
|
| 349 |
-
public function getTokens() : array {
|
| 350 |
-
return $this->tokens;
|
| 351 |
-
}
|
| 352 |
-
|
| 353 |
-
/**
|
| 354 |
-
* Handles __halt_compiler() by returning the text after it.
|
| 355 |
-
*
|
| 356 |
-
* @return string Remaining text
|
| 357 |
-
*/
|
| 358 |
-
public function handleHaltCompiler() : string {
|
| 359 |
-
// text after T_HALT_COMPILER, still including ();
|
| 360 |
-
$textAfter = substr($this->code, $this->filePos);
|
| 361 |
-
|
| 362 |
-
// ensure that it is followed by ();
|
| 363 |
-
// this simplifies the situation, by not allowing any comments
|
| 364 |
-
// in between of the tokens.
|
| 365 |
-
if (!preg_match('~^\s*\(\s*\)\s*(?:;|\?>\r?\n?)~', $textAfter, $matches)) {
|
| 366 |
-
throw new Error('__HALT_COMPILER must be followed by "();"');
|
| 367 |
-
}
|
| 368 |
-
|
| 369 |
-
// prevent the lexer from returning any further tokens
|
| 370 |
-
$this->pos = count($this->tokens);
|
| 371 |
-
|
| 372 |
-
// return with (); removed
|
| 373 |
-
return substr($textAfter, strlen($matches[0]));
|
| 374 |
-
}
|
| 375 |
-
|
| 376 |
-
/**
|
| 377 |
-
* Creates the token map.
|
| 378 |
-
*
|
| 379 |
-
* The token map maps the PHP internal token identifiers
|
| 380 |
-
* to the identifiers used by the Parser. Additionally it
|
| 381 |
-
* maps T_OPEN_TAG_WITH_ECHO to T_ECHO and T_CLOSE_TAG to ';'.
|
| 382 |
-
*
|
| 383 |
-
* @return array The token map
|
| 384 |
-
*/
|
| 385 |
-
protected function createTokenMap() : array {
|
| 386 |
-
$tokenMap = [];
|
| 387 |
-
|
| 388 |
-
// 256 is the minimum possible token number, as everything below
|
| 389 |
-
// it is an ASCII value
|
| 390 |
-
for ($i = 256; $i < 1000; ++$i) {
|
| 391 |
-
if (\T_DOUBLE_COLON === $i) {
|
| 392 |
-
// T_DOUBLE_COLON is equivalent to T_PAAMAYIM_NEKUDOTAYIM
|
| 393 |
-
$tokenMap[$i] = Tokens::T_PAAMAYIM_NEKUDOTAYIM;
|
| 394 |
-
} elseif(\T_OPEN_TAG_WITH_ECHO === $i) {
|
| 395 |
-
// T_OPEN_TAG_WITH_ECHO with dropped T_OPEN_TAG results in T_ECHO
|
| 396 |
-
$tokenMap[$i] = Tokens::T_ECHO;
|
| 397 |
-
} elseif(\T_CLOSE_TAG === $i) {
|
| 398 |
-
// T_CLOSE_TAG is equivalent to ';'
|
| 399 |
-
$tokenMap[$i] = ord(';');
|
| 400 |
-
} elseif ('UNKNOWN' !== $name = token_name($i)) {
|
| 401 |
-
if ('T_HASHBANG' === $name) {
|
| 402 |
-
// HHVM uses a special token for #! hashbang lines
|
| 403 |
-
$tokenMap[$i] = Tokens::T_INLINE_HTML;
|
| 404 |
-
} elseif (defined($name = Tokens::class . '::' . $name)) {
|
| 405 |
-
// Other tokens can be mapped directly
|
| 406 |
-
$tokenMap[$i] = constant($name);
|
| 407 |
-
}
|
| 408 |
-
}
|
| 409 |
-
}
|
| 410 |
-
|
| 411 |
-
// HHVM uses a special token for numbers that overflow to double
|
| 412 |
-
if (defined('T_ONUMBER')) {
|
| 413 |
-
$tokenMap[\T_ONUMBER] = Tokens::T_DNUMBER;
|
| 414 |
-
}
|
| 415 |
-
// HHVM also has a separate token for the __COMPILER_HALT_OFFSET__ constant
|
| 416 |
-
if (defined('T_COMPILER_HALT_OFFSET')) {
|
| 417 |
-
$tokenMap[\T_COMPILER_HALT_OFFSET] = Tokens::T_STRING;
|
| 418 |
-
}
|
| 419 |
-
|
| 420 |
-
return $tokenMap;
|
| 421 |
-
}
|
| 422 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Lexer/Emulative.php
DELETED
|
@@ -1,250 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Lexer;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Error;
|
| 6 |
-
use PhpParser\ErrorHandler;
|
| 7 |
-
use PhpParser\Lexer;
|
| 8 |
-
use PhpParser\Lexer\TokenEmulator\CoaleseEqualTokenEmulator;
|
| 9 |
-
use PhpParser\Lexer\TokenEmulator\FnTokenEmulator;
|
| 10 |
-
use PhpParser\Lexer\TokenEmulator\NumericLiteralSeparatorEmulator;
|
| 11 |
-
use PhpParser\Lexer\TokenEmulator\TokenEmulatorInterface;
|
| 12 |
-
use PhpParser\Parser\Tokens;
|
| 13 |
-
|
| 14 |
-
class Emulative extends Lexer
|
| 15 |
-
{
|
| 16 |
-
const PHP_7_3 = '7.3.0dev';
|
| 17 |
-
const PHP_7_4 = '7.4.0dev';
|
| 18 |
-
|
| 19 |
-
const T_COALESCE_EQUAL = 1007;
|
| 20 |
-
const T_FN = 1008;
|
| 21 |
-
|
| 22 |
-
const FLEXIBLE_DOC_STRING_REGEX = <<<'REGEX'
|
| 23 |
-
/<<<[ \t]*(['"]?)([a-zA-Z_\x80-\xff][a-zA-Z0-9_\x80-\xff]*)\1\r?\n
|
| 24 |
-
(?:.*\r?\n)*?
|
| 25 |
-
(?<indentation>\h*)\2(?![a-zA-Z0-9_\x80-\xff])(?<separator>(?:;?[\r\n])?)/x
|
| 26 |
-
REGEX;
|
| 27 |
-
|
| 28 |
-
/** @var mixed[] Patches used to reverse changes introduced in the code */
|
| 29 |
-
private $patches = [];
|
| 30 |
-
|
| 31 |
-
/** @var TokenEmulatorInterface[] */
|
| 32 |
-
private $tokenEmulators = [];
|
| 33 |
-
|
| 34 |
-
/**
|
| 35 |
-
* @param mixed[] $options
|
| 36 |
-
*/
|
| 37 |
-
public function __construct(array $options = [])
|
| 38 |
-
{
|
| 39 |
-
parent::__construct($options);
|
| 40 |
-
|
| 41 |
-
$this->tokenEmulators[] = new FnTokenEmulator();
|
| 42 |
-
$this->tokenEmulators[] = new CoaleseEqualTokenEmulator();
|
| 43 |
-
$this->tokenEmulators[] = new NumericLiteralSeparatorEmulator();
|
| 44 |
-
|
| 45 |
-
$this->tokenMap[self::T_COALESCE_EQUAL] = Tokens::T_COALESCE_EQUAL;
|
| 46 |
-
$this->tokenMap[self::T_FN] = Tokens::T_FN;
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
public function startLexing(string $code, ErrorHandler $errorHandler = null) {
|
| 50 |
-
$this->patches = [];
|
| 51 |
-
|
| 52 |
-
if ($this->isEmulationNeeded($code) === false) {
|
| 53 |
-
// Nothing to emulate, yay
|
| 54 |
-
parent::startLexing($code, $errorHandler);
|
| 55 |
-
return;
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
$collector = new ErrorHandler\Collecting();
|
| 59 |
-
|
| 60 |
-
// 1. emulation of heredoc and nowdoc new syntax
|
| 61 |
-
$preparedCode = $this->processHeredocNowdoc($code);
|
| 62 |
-
parent::startLexing($preparedCode, $collector);
|
| 63 |
-
$this->fixupTokens();
|
| 64 |
-
|
| 65 |
-
$errors = $collector->getErrors();
|
| 66 |
-
if (!empty($errors)) {
|
| 67 |
-
$this->fixupErrors($errors);
|
| 68 |
-
foreach ($errors as $error) {
|
| 69 |
-
$errorHandler->handleError($error);
|
| 70 |
-
}
|
| 71 |
-
}
|
| 72 |
-
|
| 73 |
-
// add token emulation
|
| 74 |
-
foreach ($this->tokenEmulators as $emulativeToken) {
|
| 75 |
-
if ($emulativeToken->isEmulationNeeded($code)) {
|
| 76 |
-
$this->tokens = $emulativeToken->emulate($code, $this->tokens);
|
| 77 |
-
}
|
| 78 |
-
}
|
| 79 |
-
}
|
| 80 |
-
|
| 81 |
-
private function isHeredocNowdocEmulationNeeded(string $code): bool
|
| 82 |
-
{
|
| 83 |
-
// skip version where this works without emulation
|
| 84 |
-
if (version_compare(\PHP_VERSION, self::PHP_7_3, '>=')) {
|
| 85 |
-
return false;
|
| 86 |
-
}
|
| 87 |
-
|
| 88 |
-
return strpos($code, '<<<') !== false;
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
private function processHeredocNowdoc(string $code): string
|
| 92 |
-
{
|
| 93 |
-
if ($this->isHeredocNowdocEmulationNeeded($code) === false) {
|
| 94 |
-
return $code;
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
if (!preg_match_all(self::FLEXIBLE_DOC_STRING_REGEX, $code, $matches, PREG_SET_ORDER|PREG_OFFSET_CAPTURE)) {
|
| 98 |
-
// No heredoc/nowdoc found
|
| 99 |
-
return $code;
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
// Keep track of how much we need to adjust string offsets due to the modifications we
|
| 103 |
-
// already made
|
| 104 |
-
$posDelta = 0;
|
| 105 |
-
foreach ($matches as $match) {
|
| 106 |
-
$indentation = $match['indentation'][0];
|
| 107 |
-
$indentationStart = $match['indentation'][1];
|
| 108 |
-
|
| 109 |
-
$separator = $match['separator'][0];
|
| 110 |
-
$separatorStart = $match['separator'][1];
|
| 111 |
-
|
| 112 |
-
if ($indentation === '' && $separator !== '') {
|
| 113 |
-
// Ordinary heredoc/nowdoc
|
| 114 |
-
continue;
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
if ($indentation !== '') {
|
| 118 |
-
// Remove indentation
|
| 119 |
-
$indentationLen = strlen($indentation);
|
| 120 |
-
$code = substr_replace($code, '', $indentationStart + $posDelta, $indentationLen);
|
| 121 |
-
$this->patches[] = [$indentationStart + $posDelta, 'add', $indentation];
|
| 122 |
-
$posDelta -= $indentationLen;
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
if ($separator === '') {
|
| 126 |
-
// Insert newline as separator
|
| 127 |
-
$code = substr_replace($code, "\n", $separatorStart + $posDelta, 0);
|
| 128 |
-
$this->patches[] = [$separatorStart + $posDelta, 'remove', "\n"];
|
| 129 |
-
$posDelta += 1;
|
| 130 |
-
}
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
return $code;
|
| 134 |
-
}
|
| 135 |
-
|
| 136 |
-
private function isEmulationNeeded(string $code): bool
|
| 137 |
-
{
|
| 138 |
-
foreach ($this->tokenEmulators as $emulativeToken) {
|
| 139 |
-
if ($emulativeToken->isEmulationNeeded($code)) {
|
| 140 |
-
return true;
|
| 141 |
-
}
|
| 142 |
-
}
|
| 143 |
-
|
| 144 |
-
return $this->isHeredocNowdocEmulationNeeded($code);
|
| 145 |
-
}
|
| 146 |
-
|
| 147 |
-
private function fixupTokens()
|
| 148 |
-
{
|
| 149 |
-
if (\count($this->patches) === 0) {
|
| 150 |
-
return;
|
| 151 |
-
}
|
| 152 |
-
|
| 153 |
-
// Load first patch
|
| 154 |
-
$patchIdx = 0;
|
| 155 |
-
|
| 156 |
-
list($patchPos, $patchType, $patchText) = $this->patches[$patchIdx];
|
| 157 |
-
|
| 158 |
-
// We use a manual loop over the tokens, because we modify the array on the fly
|
| 159 |
-
$pos = 0;
|
| 160 |
-
for ($i = 0, $c = \count($this->tokens); $i < $c; $i++) {
|
| 161 |
-
$token = $this->tokens[$i];
|
| 162 |
-
if (\is_string($token)) {
|
| 163 |
-
// We assume that patches don't apply to string tokens
|
| 164 |
-
$pos += \strlen($token);
|
| 165 |
-
continue;
|
| 166 |
-
}
|
| 167 |
-
|
| 168 |
-
$len = \strlen($token[1]);
|
| 169 |
-
$posDelta = 0;
|
| 170 |
-
while ($patchPos >= $pos && $patchPos < $pos + $len) {
|
| 171 |
-
$patchTextLen = \strlen($patchText);
|
| 172 |
-
if ($patchType === 'remove') {
|
| 173 |
-
if ($patchPos === $pos && $patchTextLen === $len) {
|
| 174 |
-
// Remove token entirely
|
| 175 |
-
array_splice($this->tokens, $i, 1, []);
|
| 176 |
-
$i--;
|
| 177 |
-
$c--;
|
| 178 |
-
} else {
|
| 179 |
-
// Remove from token string
|
| 180 |
-
$this->tokens[$i][1] = substr_replace(
|
| 181 |
-
$token[1], '', $patchPos - $pos + $posDelta, $patchTextLen
|
| 182 |
-
);
|
| 183 |
-
$posDelta -= $patchTextLen;
|
| 184 |
-
}
|
| 185 |
-
} elseif ($patchType === 'add') {
|
| 186 |
-
// Insert into the token string
|
| 187 |
-
$this->tokens[$i][1] = substr_replace(
|
| 188 |
-
$token[1], $patchText, $patchPos - $pos + $posDelta, 0
|
| 189 |
-
);
|
| 190 |
-
$posDelta += $patchTextLen;
|
| 191 |
-
} else {
|
| 192 |
-
assert(false);
|
| 193 |
-
}
|
| 194 |
-
|
| 195 |
-
// Fetch the next patch
|
| 196 |
-
$patchIdx++;
|
| 197 |
-
if ($patchIdx >= \count($this->patches)) {
|
| 198 |
-
// No more patches, we're done
|
| 199 |
-
return;
|
| 200 |
-
}
|
| 201 |
-
|
| 202 |
-
list($patchPos, $patchType, $patchText) = $this->patches[$patchIdx];
|
| 203 |
-
|
| 204 |
-
// Multiple patches may apply to the same token. Reload the current one to check
|
| 205 |
-
// If the new patch applies
|
| 206 |
-
$token = $this->tokens[$i];
|
| 207 |
-
}
|
| 208 |
-
|
| 209 |
-
$pos += $len;
|
| 210 |
-
}
|
| 211 |
-
|
| 212 |
-
// A patch did not apply
|
| 213 |
-
assert(false);
|
| 214 |
-
}
|
| 215 |
-
|
| 216 |
-
/**
|
| 217 |
-
* Fixup line and position information in errors.
|
| 218 |
-
*
|
| 219 |
-
* @param Error[] $errors
|
| 220 |
-
*/
|
| 221 |
-
private function fixupErrors(array $errors) {
|
| 222 |
-
foreach ($errors as $error) {
|
| 223 |
-
$attrs = $error->getAttributes();
|
| 224 |
-
|
| 225 |
-
$posDelta = 0;
|
| 226 |
-
$lineDelta = 0;
|
| 227 |
-
foreach ($this->patches as $patch) {
|
| 228 |
-
list($patchPos, $patchType, $patchText) = $patch;
|
| 229 |
-
if ($patchPos >= $attrs['startFilePos']) {
|
| 230 |
-
// No longer relevant
|
| 231 |
-
break;
|
| 232 |
-
}
|
| 233 |
-
|
| 234 |
-
if ($patchType === 'add') {
|
| 235 |
-
$posDelta += strlen($patchText);
|
| 236 |
-
$lineDelta += substr_count($patchText, "\n");
|
| 237 |
-
} else {
|
| 238 |
-
$posDelta -= strlen($patchText);
|
| 239 |
-
$lineDelta -= substr_count($patchText, "\n");
|
| 240 |
-
}
|
| 241 |
-
}
|
| 242 |
-
|
| 243 |
-
$attrs['startFilePos'] += $posDelta;
|
| 244 |
-
$attrs['endFilePos'] += $posDelta;
|
| 245 |
-
$attrs['startLine'] += $lineDelta;
|
| 246 |
-
$attrs['endLine'] += $lineDelta;
|
| 247 |
-
$error->setAttributes($attrs);
|
| 248 |
-
}
|
| 249 |
-
}
|
| 250 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Lexer/TokenEmulator/CoaleseEqualTokenEmulator.php
DELETED
|
@@ -1,41 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Lexer\TokenEmulator;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Lexer\Emulative;
|
| 6 |
-
|
| 7 |
-
final class CoaleseEqualTokenEmulator implements TokenEmulatorInterface
|
| 8 |
-
{
|
| 9 |
-
public function isEmulationNeeded(string $code) : bool
|
| 10 |
-
{
|
| 11 |
-
// skip version where this is supported
|
| 12 |
-
if (version_compare(\PHP_VERSION, Emulative::PHP_7_4, '>=')) {
|
| 13 |
-
return false;
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
return strpos($code, '??=') !== false;
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
public function emulate(string $code, array $tokens): array
|
| 20 |
-
{
|
| 21 |
-
// We need to manually iterate and manage a count because we'll change
|
| 22 |
-
// the tokens array on the way
|
| 23 |
-
$line = 1;
|
| 24 |
-
for ($i = 0, $c = count($tokens); $i < $c; ++$i) {
|
| 25 |
-
if (isset($tokens[$i + 1])) {
|
| 26 |
-
if ($tokens[$i][0] === T_COALESCE && $tokens[$i + 1] === '=') {
|
| 27 |
-
array_splice($tokens, $i, 2, [
|
| 28 |
-
[Emulative::T_COALESCE_EQUAL, '??=', $line]
|
| 29 |
-
]);
|
| 30 |
-
$c--;
|
| 31 |
-
continue;
|
| 32 |
-
}
|
| 33 |
-
}
|
| 34 |
-
if (\is_array($tokens[$i])) {
|
| 35 |
-
$line += substr_count($tokens[$i][1], "\n");
|
| 36 |
-
}
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
return $tokens;
|
| 40 |
-
}
|
| 41 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Lexer/TokenEmulator/FnTokenEmulator.php
DELETED
|
@@ -1,53 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Lexer\TokenEmulator;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Lexer\Emulative;
|
| 6 |
-
|
| 7 |
-
final class FnTokenEmulator implements TokenEmulatorInterface
|
| 8 |
-
{
|
| 9 |
-
public function isEmulationNeeded(string $code) : bool
|
| 10 |
-
{
|
| 11 |
-
// skip version where this is supported
|
| 12 |
-
if (version_compare(\PHP_VERSION, Emulative::PHP_7_4, '>=')) {
|
| 13 |
-
return false;
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
return strpos($code, 'fn') !== false;
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
public function emulate(string $code, array $tokens): array
|
| 20 |
-
{
|
| 21 |
-
// We need to manually iterate and manage a count because we'll change
|
| 22 |
-
// the tokens array on the way
|
| 23 |
-
foreach ($tokens as $i => $token) {
|
| 24 |
-
if ($token[0] === T_STRING && $token[1] === 'fn') {
|
| 25 |
-
$previousNonSpaceToken = $this->getPreviousNonSpaceToken($tokens, $i);
|
| 26 |
-
if ($previousNonSpaceToken !== null && $previousNonSpaceToken[0] === T_OBJECT_OPERATOR) {
|
| 27 |
-
continue;
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
$tokens[$i][0] = Emulative::T_FN;
|
| 31 |
-
}
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
return $tokens;
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
/**
|
| 38 |
-
* @param mixed[] $tokens
|
| 39 |
-
* @return mixed[]|null
|
| 40 |
-
*/
|
| 41 |
-
private function getPreviousNonSpaceToken(array $tokens, int $start)
|
| 42 |
-
{
|
| 43 |
-
for ($i = $start - 1; $i >= 0; --$i) {
|
| 44 |
-
if ($tokens[$i][0] === T_WHITESPACE) {
|
| 45 |
-
continue;
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
return $tokens[$i];
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
return null;
|
| 52 |
-
}
|
| 53 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Lexer/TokenEmulator/NumericLiteralSeparatorEmulator.php
DELETED
|
@@ -1,99 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Lexer\TokenEmulator;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Lexer\Emulative;
|
| 6 |
-
|
| 7 |
-
final class NumericLiteralSeparatorEmulator implements TokenEmulatorInterface
|
| 8 |
-
{
|
| 9 |
-
const BIN = '(?:0b[01]+(?:_[01]+)*)';
|
| 10 |
-
const HEX = '(?:0x[0-9a-f]+(?:_[0-9a-f]+)*)';
|
| 11 |
-
const DEC = '(?:[0-9]+(?:_[0-9]+)*)';
|
| 12 |
-
const SIMPLE_FLOAT = '(?:' . self::DEC . '\.' . self::DEC . '?|\.' . self::DEC . ')';
|
| 13 |
-
const EXP = '(?:e[+-]?' . self::DEC . ')';
|
| 14 |
-
const FLOAT = '(?:' . self::SIMPLE_FLOAT . self::EXP . '?|' . self::DEC . self::EXP . ')';
|
| 15 |
-
const NUMBER = '~' . self::FLOAT . '|' . self::BIN . '|' . self::HEX . '|' . self::DEC . '~iA';
|
| 16 |
-
|
| 17 |
-
public function isEmulationNeeded(string $code) : bool
|
| 18 |
-
{
|
| 19 |
-
// skip version where this is supported
|
| 20 |
-
if (version_compare(\PHP_VERSION, Emulative::PHP_7_4, '>=')) {
|
| 21 |
-
return false;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
return preg_match('~[0-9]_[0-9]~', $code)
|
| 25 |
-
|| preg_match('~0x[0-9a-f]+_[0-9a-f]~i', $code);
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function emulate(string $code, array $tokens): array
|
| 29 |
-
{
|
| 30 |
-
// We need to manually iterate and manage a count because we'll change
|
| 31 |
-
// the tokens array on the way
|
| 32 |
-
$codeOffset = 0;
|
| 33 |
-
for ($i = 0, $c = count($tokens); $i < $c; ++$i) {
|
| 34 |
-
$token = $tokens[$i];
|
| 35 |
-
$tokenLen = \strlen(\is_array($token) ? $token[1] : $token);
|
| 36 |
-
|
| 37 |
-
if ($token[0] !== T_LNUMBER && $token[0] !== T_DNUMBER) {
|
| 38 |
-
$codeOffset += $tokenLen;
|
| 39 |
-
continue;
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
$res = preg_match(self::NUMBER, $code, $matches, 0, $codeOffset);
|
| 43 |
-
assert($res, "No number at number token position");
|
| 44 |
-
|
| 45 |
-
$match = $matches[0];
|
| 46 |
-
$matchLen = \strlen($match);
|
| 47 |
-
if ($matchLen === $tokenLen) {
|
| 48 |
-
// Original token already holds the full number.
|
| 49 |
-
$codeOffset += $tokenLen;
|
| 50 |
-
continue;
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
$tokenKind = $this->resolveIntegerOrFloatToken($match);
|
| 54 |
-
$newTokens = [[$tokenKind, $match, $token[2]]];
|
| 55 |
-
|
| 56 |
-
$numTokens = 1;
|
| 57 |
-
$len = $tokenLen;
|
| 58 |
-
while ($matchLen > $len) {
|
| 59 |
-
$nextToken = $tokens[$i + $numTokens];
|
| 60 |
-
$nextTokenText = \is_array($nextToken) ? $nextToken[1] : $nextToken;
|
| 61 |
-
$nextTokenLen = \strlen($nextTokenText);
|
| 62 |
-
|
| 63 |
-
$numTokens++;
|
| 64 |
-
if ($matchLen < $len + $nextTokenLen) {
|
| 65 |
-
// Split trailing characters into a partial token.
|
| 66 |
-
assert(is_array($nextToken), "Partial token should be an array token");
|
| 67 |
-
$partialText = substr($nextTokenText, $matchLen - $len);
|
| 68 |
-
$newTokens[] = [$nextToken[0], $partialText, $nextToken[2]];
|
| 69 |
-
break;
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
$len += $nextTokenLen;
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
array_splice($tokens, $i, $numTokens, $newTokens);
|
| 76 |
-
$c -= $numTokens - \count($newTokens);
|
| 77 |
-
$codeOffset += $matchLen;
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
return $tokens;
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
private function resolveIntegerOrFloatToken(string $str): int
|
| 84 |
-
{
|
| 85 |
-
$str = str_replace('_', '', $str);
|
| 86 |
-
|
| 87 |
-
if (stripos($str, '0b') === 0) {
|
| 88 |
-
$num = bindec($str);
|
| 89 |
-
} elseif (stripos($str, '0x') === 0) {
|
| 90 |
-
$num = hexdec($str);
|
| 91 |
-
} elseif (stripos($str, '0') === 0 && ctype_digit($str)) {
|
| 92 |
-
$num = octdec($str);
|
| 93 |
-
} else {
|
| 94 |
-
$num = +$str;
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
return is_float($num) ? T_DNUMBER : T_LNUMBER;
|
| 98 |
-
}
|
| 99 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Lexer/TokenEmulator/TokenEmulatorInterface.php
DELETED
|
@@ -1,14 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Lexer\TokenEmulator;
|
| 4 |
-
|
| 5 |
-
/** @internal */
|
| 6 |
-
interface TokenEmulatorInterface
|
| 7 |
-
{
|
| 8 |
-
public function isEmulationNeeded(string $code): bool;
|
| 9 |
-
|
| 10 |
-
/**
|
| 11 |
-
* @return array Modified Tokens
|
| 12 |
-
*/
|
| 13 |
-
public function emulate(string $code, array $tokens): array;
|
| 14 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/NameContext.php
DELETED
|
@@ -1,285 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Name;
|
| 6 |
-
use PhpParser\Node\Name\FullyQualified;
|
| 7 |
-
use PhpParser\Node\Stmt;
|
| 8 |
-
|
| 9 |
-
class NameContext
|
| 10 |
-
{
|
| 11 |
-
/** @var null|Name Current namespace */
|
| 12 |
-
protected $namespace;
|
| 13 |
-
|
| 14 |
-
/** @var Name[][] Map of format [aliasType => [aliasName => originalName]] */
|
| 15 |
-
protected $aliases = [];
|
| 16 |
-
|
| 17 |
-
/** @var Name[][] Same as $aliases but preserving original case */
|
| 18 |
-
protected $origAliases = [];
|
| 19 |
-
|
| 20 |
-
/** @var ErrorHandler Error handler */
|
| 21 |
-
protected $errorHandler;
|
| 22 |
-
|
| 23 |
-
/**
|
| 24 |
-
* Create a name context.
|
| 25 |
-
*
|
| 26 |
-
* @param ErrorHandler $errorHandler Error handling used to report errors
|
| 27 |
-
*/
|
| 28 |
-
public function __construct(ErrorHandler $errorHandler) {
|
| 29 |
-
$this->errorHandler = $errorHandler;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
/**
|
| 33 |
-
* Start a new namespace.
|
| 34 |
-
*
|
| 35 |
-
* This also resets the alias table.
|
| 36 |
-
*
|
| 37 |
-
* @param Name|null $namespace Null is the global namespace
|
| 38 |
-
*/
|
| 39 |
-
public function startNamespace(Name $namespace = null) {
|
| 40 |
-
$this->namespace = $namespace;
|
| 41 |
-
$this->origAliases = $this->aliases = [
|
| 42 |
-
Stmt\Use_::TYPE_NORMAL => [],
|
| 43 |
-
Stmt\Use_::TYPE_FUNCTION => [],
|
| 44 |
-
Stmt\Use_::TYPE_CONSTANT => [],
|
| 45 |
-
];
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
/**
|
| 49 |
-
* Add an alias / import.
|
| 50 |
-
*
|
| 51 |
-
* @param Name $name Original name
|
| 52 |
-
* @param string $aliasName Aliased name
|
| 53 |
-
* @param int $type One of Stmt\Use_::TYPE_*
|
| 54 |
-
* @param array $errorAttrs Attributes to use to report an error
|
| 55 |
-
*/
|
| 56 |
-
public function addAlias(Name $name, string $aliasName, int $type, array $errorAttrs = []) {
|
| 57 |
-
// Constant names are case sensitive, everything else case insensitive
|
| 58 |
-
if ($type === Stmt\Use_::TYPE_CONSTANT) {
|
| 59 |
-
$aliasLookupName = $aliasName;
|
| 60 |
-
} else {
|
| 61 |
-
$aliasLookupName = strtolower($aliasName);
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
if (isset($this->aliases[$type][$aliasLookupName])) {
|
| 65 |
-
$typeStringMap = [
|
| 66 |
-
Stmt\Use_::TYPE_NORMAL => '',
|
| 67 |
-
Stmt\Use_::TYPE_FUNCTION => 'function ',
|
| 68 |
-
Stmt\Use_::TYPE_CONSTANT => 'const ',
|
| 69 |
-
];
|
| 70 |
-
|
| 71 |
-
$this->errorHandler->handleError(new Error(
|
| 72 |
-
sprintf(
|
| 73 |
-
'Cannot use %s%s as %s because the name is already in use',
|
| 74 |
-
$typeStringMap[$type], $name, $aliasName
|
| 75 |
-
),
|
| 76 |
-
$errorAttrs
|
| 77 |
-
));
|
| 78 |
-
return;
|
| 79 |
-
}
|
| 80 |
-
|
| 81 |
-
$this->aliases[$type][$aliasLookupName] = $name;
|
| 82 |
-
$this->origAliases[$type][$aliasName] = $name;
|
| 83 |
-
}
|
| 84 |
-
|
| 85 |
-
/**
|
| 86 |
-
* Get current namespace.
|
| 87 |
-
*
|
| 88 |
-
* @return null|Name Namespace (or null if global namespace)
|
| 89 |
-
*/
|
| 90 |
-
public function getNamespace() {
|
| 91 |
-
return $this->namespace;
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
/**
|
| 95 |
-
* Get resolved name.
|
| 96 |
-
*
|
| 97 |
-
* @param Name $name Name to resolve
|
| 98 |
-
* @param int $type One of Stmt\Use_::TYPE_{FUNCTION|CONSTANT}
|
| 99 |
-
*
|
| 100 |
-
* @return null|Name Resolved name, or null if static resolution is not possible
|
| 101 |
-
*/
|
| 102 |
-
public function getResolvedName(Name $name, int $type) {
|
| 103 |
-
// don't resolve special class names
|
| 104 |
-
if ($type === Stmt\Use_::TYPE_NORMAL && $name->isSpecialClassName()) {
|
| 105 |
-
if (!$name->isUnqualified()) {
|
| 106 |
-
$this->errorHandler->handleError(new Error(
|
| 107 |
-
sprintf("'\\%s' is an invalid class name", $name->toString()),
|
| 108 |
-
$name->getAttributes()
|
| 109 |
-
));
|
| 110 |
-
}
|
| 111 |
-
return $name;
|
| 112 |
-
}
|
| 113 |
-
|
| 114 |
-
// fully qualified names are already resolved
|
| 115 |
-
if ($name->isFullyQualified()) {
|
| 116 |
-
return $name;
|
| 117 |
-
}
|
| 118 |
-
|
| 119 |
-
// Try to resolve aliases
|
| 120 |
-
if (null !== $resolvedName = $this->resolveAlias($name, $type)) {
|
| 121 |
-
return $resolvedName;
|
| 122 |
-
}
|
| 123 |
-
|
| 124 |
-
if ($type !== Stmt\Use_::TYPE_NORMAL && $name->isUnqualified()) {
|
| 125 |
-
if (null === $this->namespace) {
|
| 126 |
-
// outside of a namespace unaliased unqualified is same as fully qualified
|
| 127 |
-
return new FullyQualified($name, $name->getAttributes());
|
| 128 |
-
}
|
| 129 |
-
|
| 130 |
-
// Cannot resolve statically
|
| 131 |
-
return null;
|
| 132 |
-
}
|
| 133 |
-
|
| 134 |
-
// if no alias exists prepend current namespace
|
| 135 |
-
return FullyQualified::concat($this->namespace, $name, $name->getAttributes());
|
| 136 |
-
}
|
| 137 |
-
|
| 138 |
-
/**
|
| 139 |
-
* Get resolved class name.
|
| 140 |
-
*
|
| 141 |
-
* @param Name $name Class ame to resolve
|
| 142 |
-
*
|
| 143 |
-
* @return Name Resolved name
|
| 144 |
-
*/
|
| 145 |
-
public function getResolvedClassName(Name $name) : Name {
|
| 146 |
-
return $this->getResolvedName($name, Stmt\Use_::TYPE_NORMAL);
|
| 147 |
-
}
|
| 148 |
-
|
| 149 |
-
/**
|
| 150 |
-
* Get possible ways of writing a fully qualified name (e.g., by making use of aliases).
|
| 151 |
-
*
|
| 152 |
-
* @param string $name Fully-qualified name (without leading namespace separator)
|
| 153 |
-
* @param int $type One of Stmt\Use_::TYPE_*
|
| 154 |
-
*
|
| 155 |
-
* @return Name[] Possible representations of the name
|
| 156 |
-
*/
|
| 157 |
-
public function getPossibleNames(string $name, int $type) : array {
|
| 158 |
-
$lcName = strtolower($name);
|
| 159 |
-
|
| 160 |
-
if ($type === Stmt\Use_::TYPE_NORMAL) {
|
| 161 |
-
// self, parent and static must always be unqualified
|
| 162 |
-
if ($lcName === "self" || $lcName === "parent" || $lcName === "static") {
|
| 163 |
-
return [new Name($name)];
|
| 164 |
-
}
|
| 165 |
-
}
|
| 166 |
-
|
| 167 |
-
// Collect possible ways to write this name, starting with the fully-qualified name
|
| 168 |
-
$possibleNames = [new FullyQualified($name)];
|
| 169 |
-
|
| 170 |
-
if (null !== $nsRelativeName = $this->getNamespaceRelativeName($name, $lcName, $type)) {
|
| 171 |
-
// Make sure there is no alias that makes the normally namespace-relative name
|
| 172 |
-
// into something else
|
| 173 |
-
if (null === $this->resolveAlias($nsRelativeName, $type)) {
|
| 174 |
-
$possibleNames[] = $nsRelativeName;
|
| 175 |
-
}
|
| 176 |
-
}
|
| 177 |
-
|
| 178 |
-
// Check for relevant namespace use statements
|
| 179 |
-
foreach ($this->origAliases[Stmt\Use_::TYPE_NORMAL] as $alias => $orig) {
|
| 180 |
-
$lcOrig = $orig->toLowerString();
|
| 181 |
-
if (0 === strpos($lcName, $lcOrig . '\\')) {
|
| 182 |
-
$possibleNames[] = new Name($alias . substr($name, strlen($lcOrig)));
|
| 183 |
-
}
|
| 184 |
-
}
|
| 185 |
-
|
| 186 |
-
// Check for relevant type-specific use statements
|
| 187 |
-
foreach ($this->origAliases[$type] as $alias => $orig) {
|
| 188 |
-
if ($type === Stmt\Use_::TYPE_CONSTANT) {
|
| 189 |
-
// Constants are are complicated-sensitive
|
| 190 |
-
$normalizedOrig = $this->normalizeConstName($orig->toString());
|
| 191 |
-
if ($normalizedOrig === $this->normalizeConstName($name)) {
|
| 192 |
-
$possibleNames[] = new Name($alias);
|
| 193 |
-
}
|
| 194 |
-
} else {
|
| 195 |
-
// Everything else is case-insensitive
|
| 196 |
-
if ($orig->toLowerString() === $lcName) {
|
| 197 |
-
$possibleNames[] = new Name($alias);
|
| 198 |
-
}
|
| 199 |
-
}
|
| 200 |
-
}
|
| 201 |
-
|
| 202 |
-
return $possibleNames;
|
| 203 |
-
}
|
| 204 |
-
|
| 205 |
-
/**
|
| 206 |
-
* Get shortest representation of this fully-qualified name.
|
| 207 |
-
*
|
| 208 |
-
* @param string $name Fully-qualified name (without leading namespace separator)
|
| 209 |
-
* @param int $type One of Stmt\Use_::TYPE_*
|
| 210 |
-
*
|
| 211 |
-
* @return Name Shortest representation
|
| 212 |
-
*/
|
| 213 |
-
public function getShortName(string $name, int $type) : Name {
|
| 214 |
-
$possibleNames = $this->getPossibleNames($name, $type);
|
| 215 |
-
|
| 216 |
-
// Find shortest name
|
| 217 |
-
$shortestName = null;
|
| 218 |
-
$shortestLength = \INF;
|
| 219 |
-
foreach ($possibleNames as $possibleName) {
|
| 220 |
-
$length = strlen($possibleName->toCodeString());
|
| 221 |
-
if ($length < $shortestLength) {
|
| 222 |
-
$shortestName = $possibleName;
|
| 223 |
-
$shortestLength = $length;
|
| 224 |
-
}
|
| 225 |
-
}
|
| 226 |
-
|
| 227 |
-
return $shortestName;
|
| 228 |
-
}
|
| 229 |
-
|
| 230 |
-
private function resolveAlias(Name $name, $type) {
|
| 231 |
-
$firstPart = $name->getFirst();
|
| 232 |
-
|
| 233 |
-
if ($name->isQualified()) {
|
| 234 |
-
// resolve aliases for qualified names, always against class alias table
|
| 235 |
-
$checkName = strtolower($firstPart);
|
| 236 |
-
if (isset($this->aliases[Stmt\Use_::TYPE_NORMAL][$checkName])) {
|
| 237 |
-
$alias = $this->aliases[Stmt\Use_::TYPE_NORMAL][$checkName];
|
| 238 |
-
return FullyQualified::concat($alias, $name->slice(1), $name->getAttributes());
|
| 239 |
-
}
|
| 240 |
-
} elseif ($name->isUnqualified()) {
|
| 241 |
-
// constant aliases are case-sensitive, function aliases case-insensitive
|
| 242 |
-
$checkName = $type === Stmt\Use_::TYPE_CONSTANT ? $firstPart : strtolower($firstPart);
|
| 243 |
-
if (isset($this->aliases[$type][$checkName])) {
|
| 244 |
-
// resolve unqualified aliases
|
| 245 |
-
return new FullyQualified($this->aliases[$type][$checkName], $name->getAttributes());
|
| 246 |
-
}
|
| 247 |
-
}
|
| 248 |
-
|
| 249 |
-
// No applicable aliases
|
| 250 |
-
return null;
|
| 251 |
-
}
|
| 252 |
-
|
| 253 |
-
private function getNamespaceRelativeName(string $name, string $lcName, int $type) {
|
| 254 |
-
if (null === $this->namespace) {
|
| 255 |
-
return new Name($name);
|
| 256 |
-
}
|
| 257 |
-
|
| 258 |
-
if ($type === Stmt\Use_::TYPE_CONSTANT) {
|
| 259 |
-
// The constants true/false/null always resolve to the global symbols, even inside a
|
| 260 |
-
// namespace, so they may be used without qualification
|
| 261 |
-
if ($lcName === "true" || $lcName === "false" || $lcName === "null") {
|
| 262 |
-
return new Name($name);
|
| 263 |
-
}
|
| 264 |
-
}
|
| 265 |
-
|
| 266 |
-
$namespacePrefix = strtolower($this->namespace . '\\');
|
| 267 |
-
if (0 === strpos($lcName, $namespacePrefix)) {
|
| 268 |
-
return new Name(substr($name, strlen($namespacePrefix)));
|
| 269 |
-
}
|
| 270 |
-
|
| 271 |
-
return null;
|
| 272 |
-
}
|
| 273 |
-
|
| 274 |
-
private function normalizeConstName(string $name) {
|
| 275 |
-
$nsSep = strrpos($name, '\\');
|
| 276 |
-
if (false === $nsSep) {
|
| 277 |
-
return $name;
|
| 278 |
-
}
|
| 279 |
-
|
| 280 |
-
// Constants have case-insensitive namespace and case-sensitive short-name
|
| 281 |
-
$ns = substr($name, 0, $nsSep);
|
| 282 |
-
$shortName = substr($name, $nsSep + 1);
|
| 283 |
-
return strtolower($ns) . '\\' . $shortName;
|
| 284 |
-
}
|
| 285 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node.php
DELETED
|
@@ -1,151 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
interface Node
|
| 6 |
-
{
|
| 7 |
-
/**
|
| 8 |
-
* Gets the type of the node.
|
| 9 |
-
*
|
| 10 |
-
* @return string Type of the node
|
| 11 |
-
*/
|
| 12 |
-
public function getType() : string;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Gets the names of the sub nodes.
|
| 16 |
-
*
|
| 17 |
-
* @return array Names of sub nodes
|
| 18 |
-
*/
|
| 19 |
-
public function getSubNodeNames() : array;
|
| 20 |
-
|
| 21 |
-
/**
|
| 22 |
-
* Gets line the node started in (alias of getStartLine).
|
| 23 |
-
*
|
| 24 |
-
* @return int Start line (or -1 if not available)
|
| 25 |
-
*/
|
| 26 |
-
public function getLine() : int;
|
| 27 |
-
|
| 28 |
-
/**
|
| 29 |
-
* Gets line the node started in.
|
| 30 |
-
*
|
| 31 |
-
* Requires the 'startLine' attribute to be enabled in the lexer (enabled by default).
|
| 32 |
-
*
|
| 33 |
-
* @return int Start line (or -1 if not available)
|
| 34 |
-
*/
|
| 35 |
-
public function getStartLine() : int;
|
| 36 |
-
|
| 37 |
-
/**
|
| 38 |
-
* Gets the line the node ended in.
|
| 39 |
-
*
|
| 40 |
-
* Requires the 'endLine' attribute to be enabled in the lexer (enabled by default).
|
| 41 |
-
*
|
| 42 |
-
* @return int End line (or -1 if not available)
|
| 43 |
-
*/
|
| 44 |
-
public function getEndLine() : int;
|
| 45 |
-
|
| 46 |
-
/**
|
| 47 |
-
* Gets the token offset of the first token that is part of this node.
|
| 48 |
-
*
|
| 49 |
-
* The offset is an index into the array returned by Lexer::getTokens().
|
| 50 |
-
*
|
| 51 |
-
* Requires the 'startTokenPos' attribute to be enabled in the lexer (DISABLED by default).
|
| 52 |
-
*
|
| 53 |
-
* @return int Token start position (or -1 if not available)
|
| 54 |
-
*/
|
| 55 |
-
public function getStartTokenPos() : int;
|
| 56 |
-
|
| 57 |
-
/**
|
| 58 |
-
* Gets the token offset of the last token that is part of this node.
|
| 59 |
-
*
|
| 60 |
-
* The offset is an index into the array returned by Lexer::getTokens().
|
| 61 |
-
*
|
| 62 |
-
* Requires the 'endTokenPos' attribute to be enabled in the lexer (DISABLED by default).
|
| 63 |
-
*
|
| 64 |
-
* @return int Token end position (or -1 if not available)
|
| 65 |
-
*/
|
| 66 |
-
public function getEndTokenPos() : int;
|
| 67 |
-
|
| 68 |
-
/**
|
| 69 |
-
* Gets the file offset of the first character that is part of this node.
|
| 70 |
-
*
|
| 71 |
-
* Requires the 'startFilePos' attribute to be enabled in the lexer (DISABLED by default).
|
| 72 |
-
*
|
| 73 |
-
* @return int File start position (or -1 if not available)
|
| 74 |
-
*/
|
| 75 |
-
public function getStartFilePos() : int;
|
| 76 |
-
|
| 77 |
-
/**
|
| 78 |
-
* Gets the file offset of the last character that is part of this node.
|
| 79 |
-
*
|
| 80 |
-
* Requires the 'endFilePos' attribute to be enabled in the lexer (DISABLED by default).
|
| 81 |
-
*
|
| 82 |
-
* @return int File end position (or -1 if not available)
|
| 83 |
-
*/
|
| 84 |
-
public function getEndFilePos() : int;
|
| 85 |
-
|
| 86 |
-
/**
|
| 87 |
-
* Gets all comments directly preceding this node.
|
| 88 |
-
*
|
| 89 |
-
* The comments are also available through the "comments" attribute.
|
| 90 |
-
*
|
| 91 |
-
* @return Comment[]
|
| 92 |
-
*/
|
| 93 |
-
public function getComments() : array;
|
| 94 |
-
|
| 95 |
-
/**
|
| 96 |
-
* Gets the doc comment of the node.
|
| 97 |
-
*
|
| 98 |
-
* @return null|Comment\Doc Doc comment object or null
|
| 99 |
-
*/
|
| 100 |
-
public function getDocComment();
|
| 101 |
-
|
| 102 |
-
/**
|
| 103 |
-
* Sets the doc comment of the node.
|
| 104 |
-
*
|
| 105 |
-
* This will either replace an existing doc comment or add it to the comments array.
|
| 106 |
-
*
|
| 107 |
-
* @param Comment\Doc $docComment Doc comment to set
|
| 108 |
-
*/
|
| 109 |
-
public function setDocComment(Comment\Doc $docComment);
|
| 110 |
-
|
| 111 |
-
/**
|
| 112 |
-
* Sets an attribute on a node.
|
| 113 |
-
*
|
| 114 |
-
* @param string $key
|
| 115 |
-
* @param mixed $value
|
| 116 |
-
*/
|
| 117 |
-
public function setAttribute(string $key, $value);
|
| 118 |
-
|
| 119 |
-
/**
|
| 120 |
-
* Returns whether an attribute exists.
|
| 121 |
-
*
|
| 122 |
-
* @param string $key
|
| 123 |
-
*
|
| 124 |
-
* @return bool
|
| 125 |
-
*/
|
| 126 |
-
public function hasAttribute(string $key) : bool;
|
| 127 |
-
|
| 128 |
-
/**
|
| 129 |
-
* Returns the value of an attribute.
|
| 130 |
-
*
|
| 131 |
-
* @param string $key
|
| 132 |
-
* @param mixed $default
|
| 133 |
-
*
|
| 134 |
-
* @return mixed
|
| 135 |
-
*/
|
| 136 |
-
public function getAttribute(string $key, $default = null);
|
| 137 |
-
|
| 138 |
-
/**
|
| 139 |
-
* Returns all the attributes of this node.
|
| 140 |
-
*
|
| 141 |
-
* @return array
|
| 142 |
-
*/
|
| 143 |
-
public function getAttributes() : array;
|
| 144 |
-
|
| 145 |
-
/**
|
| 146 |
-
* Replaces all the attributes of this node.
|
| 147 |
-
*
|
| 148 |
-
* @param array $attributes
|
| 149 |
-
*/
|
| 150 |
-
public function setAttributes(array $attributes);
|
| 151 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Arg.php
DELETED
|
@@ -1,38 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node;
|
| 4 |
-
|
| 5 |
-
use PhpParser\NodeAbstract;
|
| 6 |
-
|
| 7 |
-
class Arg extends NodeAbstract
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Value to pass */
|
| 10 |
-
public $value;
|
| 11 |
-
/** @var bool Whether to pass by ref */
|
| 12 |
-
public $byRef;
|
| 13 |
-
/** @var bool Whether to unpack the argument */
|
| 14 |
-
public $unpack;
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* Constructs a function call argument node.
|
| 18 |
-
*
|
| 19 |
-
* @param Expr $value Value to pass
|
| 20 |
-
* @param bool $byRef Whether to pass by ref
|
| 21 |
-
* @param bool $unpack Whether to unpack the argument
|
| 22 |
-
* @param array $attributes Additional attributes
|
| 23 |
-
*/
|
| 24 |
-
public function __construct(Expr $value, bool $byRef = false, bool $unpack = false, array $attributes = []) {
|
| 25 |
-
$this->attributes = $attributes;
|
| 26 |
-
$this->value = $value;
|
| 27 |
-
$this->byRef = $byRef;
|
| 28 |
-
$this->unpack = $unpack;
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getSubNodeNames() : array {
|
| 32 |
-
return ['value', 'byRef', 'unpack'];
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
public function getType() : string {
|
| 36 |
-
return 'Arg';
|
| 37 |
-
}
|
| 38 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Const_.php
DELETED
|
@@ -1,37 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node;
|
| 4 |
-
|
| 5 |
-
use PhpParser\NodeAbstract;
|
| 6 |
-
|
| 7 |
-
/**
|
| 8 |
-
* @property Name $namespacedName Namespaced name (for class constants, if using NameResolver)
|
| 9 |
-
*/
|
| 10 |
-
class Const_ extends NodeAbstract
|
| 11 |
-
{
|
| 12 |
-
/** @var Identifier Name */
|
| 13 |
-
public $name;
|
| 14 |
-
/** @var Expr Value */
|
| 15 |
-
public $value;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* Constructs a const node for use in class const and const statements.
|
| 19 |
-
*
|
| 20 |
-
* @param string|Identifier $name Name
|
| 21 |
-
* @param Expr $value Value
|
| 22 |
-
* @param array $attributes Additional attributes
|
| 23 |
-
*/
|
| 24 |
-
public function __construct($name, Expr $value, array $attributes = []) {
|
| 25 |
-
$this->attributes = $attributes;
|
| 26 |
-
$this->name = \is_string($name) ? new Identifier($name) : $name;
|
| 27 |
-
$this->value = $value;
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
public function getSubNodeNames() : array {
|
| 31 |
-
return ['name', 'value'];
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
public function getType() : string {
|
| 35 |
-
return 'Const';
|
| 36 |
-
}
|
| 37 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr.php
DELETED
|
@@ -1,9 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node;
|
| 4 |
-
|
| 5 |
-
use PhpParser\NodeAbstract;
|
| 6 |
-
|
| 7 |
-
abstract class Expr extends NodeAbstract
|
| 8 |
-
{
|
| 9 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ArrayDimFetch.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class ArrayDimFetch extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Variable */
|
| 10 |
-
public $var;
|
| 11 |
-
/** @var null|Expr Array index / dim */
|
| 12 |
-
public $dim;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs an array index fetch node.
|
| 16 |
-
*
|
| 17 |
-
* @param Expr $var Variable
|
| 18 |
-
* @param null|Expr $dim Array index / dim
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(Expr $var, Expr $dim = null, array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->var = $var;
|
| 24 |
-
$this->dim = $dim;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['var', 'dim'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Expr_ArrayDimFetch';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ArrayItem.php
DELETED
|
@@ -1,41 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class ArrayItem extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var null|Expr Key */
|
| 10 |
-
public $key;
|
| 11 |
-
/** @var Expr Value */
|
| 12 |
-
public $value;
|
| 13 |
-
/** @var bool Whether to assign by reference */
|
| 14 |
-
public $byRef;
|
| 15 |
-
/** @var bool Whether to unpack the argument */
|
| 16 |
-
public $unpack;
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* Constructs an array item node.
|
| 20 |
-
*
|
| 21 |
-
* @param Expr $value Value
|
| 22 |
-
* @param null|Expr $key Key
|
| 23 |
-
* @param bool $byRef Whether to assign by reference
|
| 24 |
-
* @param array $attributes Additional attributes
|
| 25 |
-
*/
|
| 26 |
-
public function __construct(Expr $value, Expr $key = null, bool $byRef = false, array $attributes = [], bool $unpack = false) {
|
| 27 |
-
$this->attributes = $attributes;
|
| 28 |
-
$this->key = $key;
|
| 29 |
-
$this->value = $value;
|
| 30 |
-
$this->byRef = $byRef;
|
| 31 |
-
$this->unpack = $unpack;
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
public function getSubNodeNames() : array {
|
| 35 |
-
return ['key', 'value', 'byRef', 'unpack'];
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
public function getType() : string {
|
| 39 |
-
return 'Expr_ArrayItem';
|
| 40 |
-
}
|
| 41 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Array_.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class Array_ extends Expr
|
| 8 |
-
{
|
| 9 |
-
// For use in "kind" attribute
|
| 10 |
-
const KIND_LONG = 1; // array() syntax
|
| 11 |
-
const KIND_SHORT = 2; // [] syntax
|
| 12 |
-
|
| 13 |
-
/** @var ArrayItem[] Items */
|
| 14 |
-
public $items;
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* Constructs an array node.
|
| 18 |
-
*
|
| 19 |
-
* @param ArrayItem[] $items Items of the array
|
| 20 |
-
* @param array $attributes Additional attributes
|
| 21 |
-
*/
|
| 22 |
-
public function __construct(array $items = [], array $attributes = []) {
|
| 23 |
-
$this->attributes = $attributes;
|
| 24 |
-
$this->items = $items;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['items'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Expr_Array';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ArrowFunction.php
DELETED
|
@@ -1,71 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\Node\Expr;
|
| 7 |
-
use PhpParser\Node\FunctionLike;
|
| 8 |
-
|
| 9 |
-
class ArrowFunction extends Expr implements FunctionLike
|
| 10 |
-
{
|
| 11 |
-
/** @var bool */
|
| 12 |
-
public $static;
|
| 13 |
-
|
| 14 |
-
/** @var bool */
|
| 15 |
-
public $byRef;
|
| 16 |
-
|
| 17 |
-
/** @var Node\Param[] */
|
| 18 |
-
public $params = [];
|
| 19 |
-
|
| 20 |
-
/** @var null|Node\Identifier|Node\Name|Node\NullableType|Node\UnionType */
|
| 21 |
-
public $returnType;
|
| 22 |
-
|
| 23 |
-
/** @var Expr */
|
| 24 |
-
public $expr;
|
| 25 |
-
|
| 26 |
-
/**
|
| 27 |
-
* @param array $subNodes Array of the following optional subnodes:
|
| 28 |
-
* 'static' => false : Whether the closure is static
|
| 29 |
-
* 'byRef' => false : Whether to return by reference
|
| 30 |
-
* 'params' => array() : Parameters
|
| 31 |
-
* 'returnType' => null : Return type
|
| 32 |
-
* 'expr' => Expr : Expression body
|
| 33 |
-
* @param array $attributes Additional attributes
|
| 34 |
-
*/
|
| 35 |
-
public function __construct(array $subNodes = [], array $attributes = []) {
|
| 36 |
-
$this->attributes = $attributes;
|
| 37 |
-
$this->static = $subNodes['static'] ?? false;
|
| 38 |
-
$this->byRef = $subNodes['byRef'] ?? false;
|
| 39 |
-
$this->params = $subNodes['params'] ?? [];
|
| 40 |
-
$returnType = $subNodes['returnType'] ?? null;
|
| 41 |
-
$this->returnType = \is_string($returnType) ? new Node\Identifier($returnType) : $returnType;
|
| 42 |
-
$this->expr = $subNodes['expr'] ?? null;
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
public function getSubNodeNames() : array {
|
| 46 |
-
return ['static', 'byRef', 'params', 'returnType', 'expr'];
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
public function returnsByRef() : bool {
|
| 50 |
-
return $this->byRef;
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
public function getParams() : array {
|
| 54 |
-
return $this->params;
|
| 55 |
-
}
|
| 56 |
-
|
| 57 |
-
public function getReturnType() {
|
| 58 |
-
return $this->returnType;
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
/**
|
| 62 |
-
* @return Node\Stmt\Return_[]
|
| 63 |
-
*/
|
| 64 |
-
public function getStmts() : array {
|
| 65 |
-
return [new Node\Stmt\Return_($this->expr)];
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
public function getType() : string {
|
| 69 |
-
return 'Expr_ArrowFunction';
|
| 70 |
-
}
|
| 71 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Assign.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class Assign extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Variable */
|
| 10 |
-
public $var;
|
| 11 |
-
/** @var Expr Expression */
|
| 12 |
-
public $expr;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs an assignment node.
|
| 16 |
-
*
|
| 17 |
-
* @param Expr $var Variable
|
| 18 |
-
* @param Expr $expr Expression
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(Expr $var, Expr $expr, array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->var = $var;
|
| 24 |
-
$this->expr = $expr;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['var', 'expr'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Expr_Assign';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
abstract class AssignOp extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Variable */
|
| 10 |
-
public $var;
|
| 11 |
-
/** @var Expr Expression */
|
| 12 |
-
public $expr;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs a compound assignment operation node.
|
| 16 |
-
*
|
| 17 |
-
* @param Expr $var Variable
|
| 18 |
-
* @param Expr $expr Expression
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(Expr $var, Expr $expr, array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->var = $var;
|
| 24 |
-
$this->expr = $expr;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['var', 'expr'];
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/BitwiseAnd.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\AssignOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\AssignOp;
|
| 6 |
-
|
| 7 |
-
class BitwiseAnd extends AssignOp
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_AssignOp_BitwiseAnd';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/BitwiseOr.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\AssignOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\AssignOp;
|
| 6 |
-
|
| 7 |
-
class BitwiseOr extends AssignOp
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_AssignOp_BitwiseOr';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/BitwiseXor.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\AssignOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\AssignOp;
|
| 6 |
-
|
| 7 |
-
class BitwiseXor extends AssignOp
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_AssignOp_BitwiseXor';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Coalesce.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\AssignOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\AssignOp;
|
| 6 |
-
|
| 7 |
-
class Coalesce extends AssignOp
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_AssignOp_Coalesce';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Concat.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\AssignOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\AssignOp;
|
| 6 |
-
|
| 7 |
-
class Concat extends AssignOp
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_AssignOp_Concat';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Div.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\AssignOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\AssignOp;
|
| 6 |
-
|
| 7 |
-
class Div extends AssignOp
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_AssignOp_Div';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Minus.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\AssignOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\AssignOp;
|
| 6 |
-
|
| 7 |
-
class Minus extends AssignOp
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_AssignOp_Minus';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Mod.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\AssignOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\AssignOp;
|
| 6 |
-
|
| 7 |
-
class Mod extends AssignOp
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_AssignOp_Mod';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Mul.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\AssignOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\AssignOp;
|
| 6 |
-
|
| 7 |
-
class Mul extends AssignOp
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_AssignOp_Mul';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Plus.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\AssignOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\AssignOp;
|
| 6 |
-
|
| 7 |
-
class Plus extends AssignOp
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_AssignOp_Plus';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/Pow.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\AssignOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\AssignOp;
|
| 6 |
-
|
| 7 |
-
class Pow extends AssignOp
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_AssignOp_Pow';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/ShiftLeft.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\AssignOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\AssignOp;
|
| 6 |
-
|
| 7 |
-
class ShiftLeft extends AssignOp
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_AssignOp_ShiftLeft';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignOp/ShiftRight.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\AssignOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\AssignOp;
|
| 6 |
-
|
| 7 |
-
class ShiftRight extends AssignOp
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_AssignOp_ShiftRight';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/AssignRef.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class AssignRef extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Variable reference is assigned to */
|
| 10 |
-
public $var;
|
| 11 |
-
/** @var Expr Variable which is referenced */
|
| 12 |
-
public $expr;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs an assignment node.
|
| 16 |
-
*
|
| 17 |
-
* @param Expr $var Variable
|
| 18 |
-
* @param Expr $expr Expression
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(Expr $var, Expr $expr, array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->var = $var;
|
| 24 |
-
$this->expr = $expr;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['var', 'expr'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Expr_AssignRef';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp.php
DELETED
|
@@ -1,40 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
abstract class BinaryOp extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr The left hand side expression */
|
| 10 |
-
public $left;
|
| 11 |
-
/** @var Expr The right hand side expression */
|
| 12 |
-
public $right;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs a binary operator node.
|
| 16 |
-
*
|
| 17 |
-
* @param Expr $left The left hand side expression
|
| 18 |
-
* @param Expr $right The right hand side expression
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(Expr $left, Expr $right, array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->left = $left;
|
| 24 |
-
$this->right = $right;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['left', 'right'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
/**
|
| 32 |
-
* Get the operator sigil for this binary operation.
|
| 33 |
-
*
|
| 34 |
-
* In the case there are multiple possible sigils for an operator, this method does not
|
| 35 |
-
* necessarily return the one used in the parsed code.
|
| 36 |
-
*
|
| 37 |
-
* @return string
|
| 38 |
-
*/
|
| 39 |
-
abstract public function getOperatorSigil() : string;
|
| 40 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/BitwiseAnd.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class BitwiseAnd extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '&';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_BitwiseAnd';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/BitwiseOr.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class BitwiseOr extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '|';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_BitwiseOr';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/BitwiseXor.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class BitwiseXor extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '^';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_BitwiseXor';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/BooleanAnd.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class BooleanAnd extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '&&';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_BooleanAnd';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/BooleanOr.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class BooleanOr extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '||';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_BooleanOr';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Coalesce.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class Coalesce extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '??';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_Coalesce';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Concat.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class Concat extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '.';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_Concat';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Div.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class Div extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '/';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_Div';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Equal.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class Equal extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '==';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_Equal';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Greater.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class Greater extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '>';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_Greater';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/GreaterOrEqual.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class GreaterOrEqual extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '>=';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_GreaterOrEqual';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Identical.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class Identical extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '===';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_Identical';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/LogicalAnd.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class LogicalAnd extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return 'and';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_LogicalAnd';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/LogicalOr.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class LogicalOr extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return 'or';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_LogicalOr';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/LogicalXor.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class LogicalXor extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return 'xor';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_LogicalXor';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Minus.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class Minus extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '-';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_Minus';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Mod.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class Mod extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '%';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_Mod';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Mul.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class Mul extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '*';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_Mul';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/NotEqual.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class NotEqual extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '!=';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_NotEqual';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/NotIdentical.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class NotIdentical extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '!==';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_NotIdentical';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Plus.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class Plus extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '+';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_Plus';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Pow.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class Pow extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '**';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_Pow';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/ShiftLeft.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class ShiftLeft extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '<<';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_ShiftLeft';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/ShiftRight.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class ShiftRight extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '>>';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_ShiftRight';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Smaller.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class Smaller extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '<';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_Smaller';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/SmallerOrEqual.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class SmallerOrEqual extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '<=';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_SmallerOrEqual';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BinaryOp/Spaceship.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\BinaryOp;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\BinaryOp;
|
| 6 |
-
|
| 7 |
-
class Spaceship extends BinaryOp
|
| 8 |
-
{
|
| 9 |
-
public function getOperatorSigil() : string {
|
| 10 |
-
return '<=>';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Expr_BinaryOp_Spaceship';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BitwiseNot.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class BitwiseNot extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Expression */
|
| 10 |
-
public $expr;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a bitwise not node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $expr Expression
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $expr, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->expr = $expr;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['expr'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_BitwiseNot';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/BooleanNot.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class BooleanNot extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Expression */
|
| 10 |
-
public $expr;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a boolean not node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $expr Expression
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $expr, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->expr = $expr;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['expr'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_BooleanNot';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast.php
DELETED
|
@@ -1,26 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
abstract class Cast extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Expression */
|
| 10 |
-
public $expr;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a cast node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $expr Expression
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $expr, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->expr = $expr;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['expr'];
|
| 25 |
-
}
|
| 26 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast/Array_.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\Cast;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\Cast;
|
| 6 |
-
|
| 7 |
-
class Array_ extends Cast
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_Cast_Array';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast/Bool_.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\Cast;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\Cast;
|
| 6 |
-
|
| 7 |
-
class Bool_ extends Cast
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_Cast_Bool';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast/Double.php
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\Cast;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\Cast;
|
| 6 |
-
|
| 7 |
-
class Double extends Cast
|
| 8 |
-
{
|
| 9 |
-
// For use in "kind" attribute
|
| 10 |
-
const KIND_DOUBLE = 1; // "double" syntax
|
| 11 |
-
const KIND_FLOAT = 2; // "float" syntax
|
| 12 |
-
const KIND_REAL = 3; // "real" syntax
|
| 13 |
-
|
| 14 |
-
public function getType() : string {
|
| 15 |
-
return 'Expr_Cast_Double';
|
| 16 |
-
}
|
| 17 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast/Int_.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\Cast;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\Cast;
|
| 6 |
-
|
| 7 |
-
class Int_ extends Cast
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_Cast_Int';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast/Object_.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\Cast;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\Cast;
|
| 6 |
-
|
| 7 |
-
class Object_ extends Cast
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_Cast_Object';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast/String_.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\Cast;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\Cast;
|
| 6 |
-
|
| 7 |
-
class String_ extends Cast
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_Cast_String';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Cast/Unset_.php
DELETED
|
@@ -1,12 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr\Cast;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\Cast;
|
| 6 |
-
|
| 7 |
-
class Unset_ extends Cast
|
| 8 |
-
{
|
| 9 |
-
public function getType() : string {
|
| 10 |
-
return 'Expr_Cast_Unset';
|
| 11 |
-
}
|
| 12 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ClassConstFetch.php
DELETED
|
@@ -1,36 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
use PhpParser\Node\Identifier;
|
| 7 |
-
use PhpParser\Node\Name;
|
| 8 |
-
|
| 9 |
-
class ClassConstFetch extends Expr
|
| 10 |
-
{
|
| 11 |
-
/** @var Name|Expr Class name */
|
| 12 |
-
public $class;
|
| 13 |
-
/** @var Identifier|Error Constant name */
|
| 14 |
-
public $name;
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* Constructs a class const fetch node.
|
| 18 |
-
*
|
| 19 |
-
* @param Name|Expr $class Class name
|
| 20 |
-
* @param string|Identifier|Error $name Constant name
|
| 21 |
-
* @param array $attributes Additional attributes
|
| 22 |
-
*/
|
| 23 |
-
public function __construct($class, $name, array $attributes = []) {
|
| 24 |
-
$this->attributes = $attributes;
|
| 25 |
-
$this->class = $class;
|
| 26 |
-
$this->name = \is_string($name) ? new Identifier($name) : $name;
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
public function getSubNodeNames() : array {
|
| 30 |
-
return ['class', 'name'];
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
public function getType() : string {
|
| 34 |
-
return 'Expr_ClassConstFetch';
|
| 35 |
-
}
|
| 36 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Clone_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class Clone_ extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Expression */
|
| 10 |
-
public $expr;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a clone node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $expr Expression
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $expr, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->expr = $expr;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['expr'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_Clone';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Closure.php
DELETED
|
@@ -1,71 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\Node\Expr;
|
| 7 |
-
use PhpParser\Node\FunctionLike;
|
| 8 |
-
|
| 9 |
-
class Closure extends Expr implements FunctionLike
|
| 10 |
-
{
|
| 11 |
-
/** @var bool Whether the closure is static */
|
| 12 |
-
public $static;
|
| 13 |
-
/** @var bool Whether to return by reference */
|
| 14 |
-
public $byRef;
|
| 15 |
-
/** @var Node\Param[] Parameters */
|
| 16 |
-
public $params;
|
| 17 |
-
/** @var ClosureUse[] use()s */
|
| 18 |
-
public $uses;
|
| 19 |
-
/** @var null|Node\Identifier|Node\Name|Node\NullableType|Node\UnionType Return type */
|
| 20 |
-
public $returnType;
|
| 21 |
-
/** @var Node\Stmt[] Statements */
|
| 22 |
-
public $stmts;
|
| 23 |
-
|
| 24 |
-
/**
|
| 25 |
-
* Constructs a lambda function node.
|
| 26 |
-
*
|
| 27 |
-
* @param array $subNodes Array of the following optional subnodes:
|
| 28 |
-
* 'static' => false : Whether the closure is static
|
| 29 |
-
* 'byRef' => false : Whether to return by reference
|
| 30 |
-
* 'params' => array(): Parameters
|
| 31 |
-
* 'uses' => array(): use()s
|
| 32 |
-
* 'returnType' => null : Return type
|
| 33 |
-
* 'stmts' => array(): Statements
|
| 34 |
-
* @param array $attributes Additional attributes
|
| 35 |
-
*/
|
| 36 |
-
public function __construct(array $subNodes = [], array $attributes = []) {
|
| 37 |
-
$this->attributes = $attributes;
|
| 38 |
-
$this->static = $subNodes['static'] ?? false;
|
| 39 |
-
$this->byRef = $subNodes['byRef'] ?? false;
|
| 40 |
-
$this->params = $subNodes['params'] ?? [];
|
| 41 |
-
$this->uses = $subNodes['uses'] ?? [];
|
| 42 |
-
$returnType = $subNodes['returnType'] ?? null;
|
| 43 |
-
$this->returnType = \is_string($returnType) ? new Node\Identifier($returnType) : $returnType;
|
| 44 |
-
$this->stmts = $subNodes['stmts'] ?? [];
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
public function getSubNodeNames() : array {
|
| 48 |
-
return ['static', 'byRef', 'params', 'uses', 'returnType', 'stmts'];
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
public function returnsByRef() : bool {
|
| 52 |
-
return $this->byRef;
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
public function getParams() : array {
|
| 56 |
-
return $this->params;
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
public function getReturnType() {
|
| 60 |
-
return $this->returnType;
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
/** @return Node\Stmt[] */
|
| 64 |
-
public function getStmts() : array {
|
| 65 |
-
return $this->stmts;
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
public function getType() : string {
|
| 69 |
-
return 'Expr_Closure';
|
| 70 |
-
}
|
| 71 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ClosureUse.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class ClosureUse extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr\Variable Variable to use */
|
| 10 |
-
public $var;
|
| 11 |
-
/** @var bool Whether to use by reference */
|
| 12 |
-
public $byRef;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs a closure use node.
|
| 16 |
-
*
|
| 17 |
-
* @param Expr\Variable $var Variable to use
|
| 18 |
-
* @param bool $byRef Whether to use by reference
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(Expr\Variable $var, bool $byRef = false, array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->var = $var;
|
| 24 |
-
$this->byRef = $byRef;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['var', 'byRef'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Expr_ClosureUse';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ConstFetch.php
DELETED
|
@@ -1,31 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
use PhpParser\Node\Name;
|
| 7 |
-
|
| 8 |
-
class ConstFetch extends Expr
|
| 9 |
-
{
|
| 10 |
-
/** @var Name Constant name */
|
| 11 |
-
public $name;
|
| 12 |
-
|
| 13 |
-
/**
|
| 14 |
-
* Constructs a const fetch node.
|
| 15 |
-
*
|
| 16 |
-
* @param Name $name Constant name
|
| 17 |
-
* @param array $attributes Additional attributes
|
| 18 |
-
*/
|
| 19 |
-
public function __construct(Name $name, array $attributes = []) {
|
| 20 |
-
$this->attributes = $attributes;
|
| 21 |
-
$this->name = $name;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
public function getSubNodeNames() : array {
|
| 25 |
-
return ['name'];
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function getType() : string {
|
| 29 |
-
return 'Expr_ConstFetch';
|
| 30 |
-
}
|
| 31 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Empty_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class Empty_ extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Expression */
|
| 10 |
-
public $expr;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs an empty() node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $expr Expression
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $expr, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->expr = $expr;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['expr'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_Empty';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Error.php
DELETED
|
@@ -1,31 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
/**
|
| 8 |
-
* Error node used during parsing with error recovery.
|
| 9 |
-
*
|
| 10 |
-
* An error node may be placed at a position where an expression is required, but an error occurred.
|
| 11 |
-
* Error nodes will not be present if the parser is run in throwOnError mode (the default).
|
| 12 |
-
*/
|
| 13 |
-
class Error extends Expr
|
| 14 |
-
{
|
| 15 |
-
/**
|
| 16 |
-
* Constructs an error node.
|
| 17 |
-
*
|
| 18 |
-
* @param array $attributes Additional attributes
|
| 19 |
-
*/
|
| 20 |
-
public function __construct(array $attributes = []) {
|
| 21 |
-
$this->attributes = $attributes;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
public function getSubNodeNames() : array {
|
| 25 |
-
return [];
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function getType() : string {
|
| 29 |
-
return 'Expr_Error';
|
| 30 |
-
}
|
| 31 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ErrorSuppress.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class ErrorSuppress extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Expression */
|
| 10 |
-
public $expr;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs an error suppress node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $expr Expression
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $expr, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->expr = $expr;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['expr'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_ErrorSuppress';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Eval_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class Eval_ extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Expression */
|
| 10 |
-
public $expr;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs an eval() node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $expr Expression
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $expr, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->expr = $expr;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['expr'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_Eval';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Exit_.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class Exit_ extends Expr
|
| 8 |
-
{
|
| 9 |
-
/* For use in "kind" attribute */
|
| 10 |
-
const KIND_EXIT = 1;
|
| 11 |
-
const KIND_DIE = 2;
|
| 12 |
-
|
| 13 |
-
/** @var null|Expr Expression */
|
| 14 |
-
public $expr;
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* Constructs an exit() node.
|
| 18 |
-
*
|
| 19 |
-
* @param null|Expr $expr Expression
|
| 20 |
-
* @param array $attributes Additional attributes
|
| 21 |
-
*/
|
| 22 |
-
public function __construct(Expr $expr = null, array $attributes = []) {
|
| 23 |
-
$this->attributes = $attributes;
|
| 24 |
-
$this->expr = $expr;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['expr'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Expr_Exit';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/FuncCall.php
DELETED
|
@@ -1,35 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\Node\Expr;
|
| 7 |
-
|
| 8 |
-
class FuncCall extends Expr
|
| 9 |
-
{
|
| 10 |
-
/** @var Node\Name|Expr Function name */
|
| 11 |
-
public $name;
|
| 12 |
-
/** @var Node\Arg[] Arguments */
|
| 13 |
-
public $args;
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* Constructs a function call node.
|
| 17 |
-
*
|
| 18 |
-
* @param Node\Name|Expr $name Function name
|
| 19 |
-
* @param Node\Arg[] $args Arguments
|
| 20 |
-
* @param array $attributes Additional attributes
|
| 21 |
-
*/
|
| 22 |
-
public function __construct($name, array $args = [], array $attributes = []) {
|
| 23 |
-
$this->attributes = $attributes;
|
| 24 |
-
$this->name = $name;
|
| 25 |
-
$this->args = $args;
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function getSubNodeNames() : array {
|
| 29 |
-
return ['name', 'args'];
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
public function getType() : string {
|
| 33 |
-
return 'Expr_FuncCall';
|
| 34 |
-
}
|
| 35 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Include_.php
DELETED
|
@@ -1,39 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class Include_ extends Expr
|
| 8 |
-
{
|
| 9 |
-
const TYPE_INCLUDE = 1;
|
| 10 |
-
const TYPE_INCLUDE_ONCE = 2;
|
| 11 |
-
const TYPE_REQUIRE = 3;
|
| 12 |
-
const TYPE_REQUIRE_ONCE = 4;
|
| 13 |
-
|
| 14 |
-
/** @var Expr Expression */
|
| 15 |
-
public $expr;
|
| 16 |
-
/** @var int Type of include */
|
| 17 |
-
public $type;
|
| 18 |
-
|
| 19 |
-
/**
|
| 20 |
-
* Constructs an include node.
|
| 21 |
-
*
|
| 22 |
-
* @param Expr $expr Expression
|
| 23 |
-
* @param int $type Type of include
|
| 24 |
-
* @param array $attributes Additional attributes
|
| 25 |
-
*/
|
| 26 |
-
public function __construct(Expr $expr, int $type, array $attributes = []) {
|
| 27 |
-
$this->attributes = $attributes;
|
| 28 |
-
$this->expr = $expr;
|
| 29 |
-
$this->type = $type;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
public function getSubNodeNames() : array {
|
| 33 |
-
return ['expr', 'type'];
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
public function getType() : string {
|
| 37 |
-
return 'Expr_Include';
|
| 38 |
-
}
|
| 39 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Instanceof_.php
DELETED
|
@@ -1,35 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
use PhpParser\Node\Name;
|
| 7 |
-
|
| 8 |
-
class Instanceof_ extends Expr
|
| 9 |
-
{
|
| 10 |
-
/** @var Expr Expression */
|
| 11 |
-
public $expr;
|
| 12 |
-
/** @var Name|Expr Class name */
|
| 13 |
-
public $class;
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* Constructs an instanceof check node.
|
| 17 |
-
*
|
| 18 |
-
* @param Expr $expr Expression
|
| 19 |
-
* @param Name|Expr $class Class name
|
| 20 |
-
* @param array $attributes Additional attributes
|
| 21 |
-
*/
|
| 22 |
-
public function __construct(Expr $expr, $class, array $attributes = []) {
|
| 23 |
-
$this->attributes = $attributes;
|
| 24 |
-
$this->expr = $expr;
|
| 25 |
-
$this->class = $class;
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function getSubNodeNames() : array {
|
| 29 |
-
return ['expr', 'class'];
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
public function getType() : string {
|
| 33 |
-
return 'Expr_Instanceof';
|
| 34 |
-
}
|
| 35 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Isset_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class Isset_ extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr[] Variables */
|
| 10 |
-
public $vars;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs an array node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr[] $vars Variables
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(array $vars, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->vars = $vars;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['vars'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_Isset';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/List_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class List_ extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var (ArrayItem|null)[] List of items to assign to */
|
| 10 |
-
public $items;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a list() destructuring node.
|
| 14 |
-
*
|
| 15 |
-
* @param (ArrayItem|null)[] $items List of items to assign to
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(array $items, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->items = $items;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['items'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_List';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/MethodCall.php
DELETED
|
@@ -1,40 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Arg;
|
| 6 |
-
use PhpParser\Node\Expr;
|
| 7 |
-
use PhpParser\Node\Identifier;
|
| 8 |
-
|
| 9 |
-
class MethodCall extends Expr
|
| 10 |
-
{
|
| 11 |
-
/** @var Expr Variable holding object */
|
| 12 |
-
public $var;
|
| 13 |
-
/** @var Identifier|Expr Method name */
|
| 14 |
-
public $name;
|
| 15 |
-
/** @var Arg[] Arguments */
|
| 16 |
-
public $args;
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* Constructs a function call node.
|
| 20 |
-
*
|
| 21 |
-
* @param Expr $var Variable holding object
|
| 22 |
-
* @param string|Identifier|Expr $name Method name
|
| 23 |
-
* @param Arg[] $args Arguments
|
| 24 |
-
* @param array $attributes Additional attributes
|
| 25 |
-
*/
|
| 26 |
-
public function __construct(Expr $var, $name, array $args = [], array $attributes = []) {
|
| 27 |
-
$this->attributes = $attributes;
|
| 28 |
-
$this->var = $var;
|
| 29 |
-
$this->name = \is_string($name) ? new Identifier($name) : $name;
|
| 30 |
-
$this->args = $args;
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
public function getSubNodeNames() : array {
|
| 34 |
-
return ['var', 'name', 'args'];
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
public function getType() : string {
|
| 38 |
-
return 'Expr_MethodCall';
|
| 39 |
-
}
|
| 40 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/New_.php
DELETED
|
@@ -1,35 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\Node\Expr;
|
| 7 |
-
|
| 8 |
-
class New_ extends Expr
|
| 9 |
-
{
|
| 10 |
-
/** @var Node\Name|Expr|Node\Stmt\Class_ Class name */
|
| 11 |
-
public $class;
|
| 12 |
-
/** @var Node\Arg[] Arguments */
|
| 13 |
-
public $args;
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* Constructs a function call node.
|
| 17 |
-
*
|
| 18 |
-
* @param Node\Name|Expr|Node\Stmt\Class_ $class Class name (or class node for anonymous classes)
|
| 19 |
-
* @param Node\Arg[] $args Arguments
|
| 20 |
-
* @param array $attributes Additional attributes
|
| 21 |
-
*/
|
| 22 |
-
public function __construct($class, array $args = [], array $attributes = []) {
|
| 23 |
-
$this->attributes = $attributes;
|
| 24 |
-
$this->class = $class;
|
| 25 |
-
$this->args = $args;
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function getSubNodeNames() : array {
|
| 29 |
-
return ['class', 'args'];
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
public function getType() : string {
|
| 33 |
-
return 'Expr_New';
|
| 34 |
-
}
|
| 35 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/PostDec.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class PostDec extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Variable */
|
| 10 |
-
public $var;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a post decrement node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $var Variable
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $var, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->var = $var;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['var'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_PostDec';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/PostInc.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class PostInc extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Variable */
|
| 10 |
-
public $var;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a post increment node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $var Variable
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $var, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->var = $var;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['var'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_PostInc';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/PreDec.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class PreDec extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Variable */
|
| 10 |
-
public $var;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a pre decrement node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $var Variable
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $var, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->var = $var;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['var'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_PreDec';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/PreInc.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class PreInc extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Variable */
|
| 10 |
-
public $var;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a pre increment node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $var Variable
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $var, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->var = $var;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['var'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_PreInc';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Print_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class Print_ extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Expression */
|
| 10 |
-
public $expr;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs an print() node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $expr Expression
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $expr, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->expr = $expr;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['expr'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_Print';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/PropertyFetch.php
DELETED
|
@@ -1,35 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
use PhpParser\Node\Identifier;
|
| 7 |
-
|
| 8 |
-
class PropertyFetch extends Expr
|
| 9 |
-
{
|
| 10 |
-
/** @var Expr Variable holding object */
|
| 11 |
-
public $var;
|
| 12 |
-
/** @var Identifier|Expr Property name */
|
| 13 |
-
public $name;
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* Constructs a function call node.
|
| 17 |
-
*
|
| 18 |
-
* @param Expr $var Variable holding object
|
| 19 |
-
* @param string|Identifier|Expr $name Property name
|
| 20 |
-
* @param array $attributes Additional attributes
|
| 21 |
-
*/
|
| 22 |
-
public function __construct(Expr $var, $name, array $attributes = []) {
|
| 23 |
-
$this->attributes = $attributes;
|
| 24 |
-
$this->var = $var;
|
| 25 |
-
$this->name = \is_string($name) ? new Identifier($name) : $name;
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function getSubNodeNames() : array {
|
| 29 |
-
return ['var', 'name'];
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
public function getType() : string {
|
| 33 |
-
return 'Expr_PropertyFetch';
|
| 34 |
-
}
|
| 35 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/ShellExec.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class ShellExec extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var array Encapsed string array */
|
| 10 |
-
public $parts;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a shell exec (backtick) node.
|
| 14 |
-
*
|
| 15 |
-
* @param array $parts Encapsed string array
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(array $parts, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->parts = $parts;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['parts'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_ShellExec';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/StaticCall.php
DELETED
|
@@ -1,40 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\Node\Expr;
|
| 7 |
-
use PhpParser\Node\Identifier;
|
| 8 |
-
|
| 9 |
-
class StaticCall extends Expr
|
| 10 |
-
{
|
| 11 |
-
/** @var Node\Name|Expr Class name */
|
| 12 |
-
public $class;
|
| 13 |
-
/** @var Identifier|Expr Method name */
|
| 14 |
-
public $name;
|
| 15 |
-
/** @var Node\Arg[] Arguments */
|
| 16 |
-
public $args;
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* Constructs a static method call node.
|
| 20 |
-
*
|
| 21 |
-
* @param Node\Name|Expr $class Class name
|
| 22 |
-
* @param string|Identifier|Expr $name Method name
|
| 23 |
-
* @param Node\Arg[] $args Arguments
|
| 24 |
-
* @param array $attributes Additional attributes
|
| 25 |
-
*/
|
| 26 |
-
public function __construct($class, $name, array $args = [], array $attributes = []) {
|
| 27 |
-
$this->attributes = $attributes;
|
| 28 |
-
$this->class = $class;
|
| 29 |
-
$this->name = \is_string($name) ? new Identifier($name) : $name;
|
| 30 |
-
$this->args = $args;
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
public function getSubNodeNames() : array {
|
| 34 |
-
return ['class', 'name', 'args'];
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
public function getType() : string {
|
| 38 |
-
return 'Expr_StaticCall';
|
| 39 |
-
}
|
| 40 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/StaticPropertyFetch.php
DELETED
|
@@ -1,36 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
use PhpParser\Node\Name;
|
| 7 |
-
use PhpParser\Node\VarLikeIdentifier;
|
| 8 |
-
|
| 9 |
-
class StaticPropertyFetch extends Expr
|
| 10 |
-
{
|
| 11 |
-
/** @var Name|Expr Class name */
|
| 12 |
-
public $class;
|
| 13 |
-
/** @var VarLikeIdentifier|Expr Property name */
|
| 14 |
-
public $name;
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* Constructs a static property fetch node.
|
| 18 |
-
*
|
| 19 |
-
* @param Name|Expr $class Class name
|
| 20 |
-
* @param string|VarLikeIdentifier|Expr $name Property name
|
| 21 |
-
* @param array $attributes Additional attributes
|
| 22 |
-
*/
|
| 23 |
-
public function __construct($class, $name, array $attributes = []) {
|
| 24 |
-
$this->attributes = $attributes;
|
| 25 |
-
$this->class = $class;
|
| 26 |
-
$this->name = \is_string($name) ? new VarLikeIdentifier($name) : $name;
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
public function getSubNodeNames() : array {
|
| 30 |
-
return ['class', 'name'];
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
public function getType() : string {
|
| 34 |
-
return 'Expr_StaticPropertyFetch';
|
| 35 |
-
}
|
| 36 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Ternary.php
DELETED
|
@@ -1,38 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class Ternary extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Condition */
|
| 10 |
-
public $cond;
|
| 11 |
-
/** @var null|Expr Expression for true */
|
| 12 |
-
public $if;
|
| 13 |
-
/** @var Expr Expression for false */
|
| 14 |
-
public $else;
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* Constructs a ternary operator node.
|
| 18 |
-
*
|
| 19 |
-
* @param Expr $cond Condition
|
| 20 |
-
* @param null|Expr $if Expression for true
|
| 21 |
-
* @param Expr $else Expression for false
|
| 22 |
-
* @param array $attributes Additional attributes
|
| 23 |
-
*/
|
| 24 |
-
public function __construct(Expr $cond, $if, Expr $else, array $attributes = []) {
|
| 25 |
-
$this->attributes = $attributes;
|
| 26 |
-
$this->cond = $cond;
|
| 27 |
-
$this->if = $if;
|
| 28 |
-
$this->else = $else;
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getSubNodeNames() : array {
|
| 32 |
-
return ['cond', 'if', 'else'];
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
public function getType() : string {
|
| 36 |
-
return 'Expr_Ternary';
|
| 37 |
-
}
|
| 38 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/UnaryMinus.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class UnaryMinus extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Expression */
|
| 10 |
-
public $expr;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a unary minus node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $expr Expression
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $expr, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->expr = $expr;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['expr'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_UnaryMinus';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/UnaryPlus.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class UnaryPlus extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Expression */
|
| 10 |
-
public $expr;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a unary plus node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $expr Expression
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $expr, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->expr = $expr;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['expr'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_UnaryPlus';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Variable.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class Variable extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var string|Expr Name */
|
| 10 |
-
public $name;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a variable node.
|
| 14 |
-
*
|
| 15 |
-
* @param string|Expr $name Name
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct($name, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->name = $name;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['name'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_Variable';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/YieldFrom.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class YieldFrom extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var Expr Expression to yield from */
|
| 10 |
-
public $expr;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs an "yield from" node.
|
| 14 |
-
*
|
| 15 |
-
* @param Expr $expr Expression
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Expr $expr, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->expr = $expr;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['expr'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Expr_YieldFrom';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Expr/Yield_.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Expr;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
|
| 7 |
-
class Yield_ extends Expr
|
| 8 |
-
{
|
| 9 |
-
/** @var null|Expr Key expression */
|
| 10 |
-
public $key;
|
| 11 |
-
/** @var null|Expr Value expression */
|
| 12 |
-
public $value;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs a yield expression node.
|
| 16 |
-
*
|
| 17 |
-
* @param null|Expr $value Value expression
|
| 18 |
-
* @param null|Expr $key Key expression
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(Expr $value = null, Expr $key = null, array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->key = $key;
|
| 24 |
-
$this->value = $value;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['key', 'value'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Expr_Yield';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/FunctionLike.php
DELETED
|
@@ -1,36 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
interface FunctionLike extends Node
|
| 8 |
-
{
|
| 9 |
-
/**
|
| 10 |
-
* Whether to return by reference
|
| 11 |
-
*
|
| 12 |
-
* @return bool
|
| 13 |
-
*/
|
| 14 |
-
public function returnsByRef() : bool;
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* List of parameters
|
| 18 |
-
*
|
| 19 |
-
* @return Node\Param[]
|
| 20 |
-
*/
|
| 21 |
-
public function getParams() : array;
|
| 22 |
-
|
| 23 |
-
/**
|
| 24 |
-
* Get the declared return type or null
|
| 25 |
-
*
|
| 26 |
-
* @return null|Identifier|Node\Name|Node\NullableType|Node\UnionType
|
| 27 |
-
*/
|
| 28 |
-
public function getReturnType();
|
| 29 |
-
|
| 30 |
-
/**
|
| 31 |
-
* The function body
|
| 32 |
-
*
|
| 33 |
-
* @return Node\Stmt[]|null
|
| 34 |
-
*/
|
| 35 |
-
public function getStmts();
|
| 36 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Identifier.php
DELETED
|
@@ -1,75 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node;
|
| 4 |
-
|
| 5 |
-
use PhpParser\NodeAbstract;
|
| 6 |
-
|
| 7 |
-
/**
|
| 8 |
-
* Represents a non-namespaced name. Namespaced names are represented using Name nodes.
|
| 9 |
-
*/
|
| 10 |
-
class Identifier extends NodeAbstract
|
| 11 |
-
{
|
| 12 |
-
/** @var string Identifier as string */
|
| 13 |
-
public $name;
|
| 14 |
-
|
| 15 |
-
private static $specialClassNames = [
|
| 16 |
-
'self' => true,
|
| 17 |
-
'parent' => true,
|
| 18 |
-
'static' => true,
|
| 19 |
-
];
|
| 20 |
-
|
| 21 |
-
/**
|
| 22 |
-
* Constructs an identifier node.
|
| 23 |
-
*
|
| 24 |
-
* @param string $name Identifier as string
|
| 25 |
-
* @param array $attributes Additional attributes
|
| 26 |
-
*/
|
| 27 |
-
public function __construct(string $name, array $attributes = []) {
|
| 28 |
-
$this->attributes = $attributes;
|
| 29 |
-
$this->name = $name;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
public function getSubNodeNames() : array {
|
| 33 |
-
return ['name'];
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* Get identifier as string.
|
| 38 |
-
*
|
| 39 |
-
* @return string Identifier as string.
|
| 40 |
-
*/
|
| 41 |
-
public function toString() : string {
|
| 42 |
-
return $this->name;
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
/**
|
| 46 |
-
* Get lowercased identifier as string.
|
| 47 |
-
*
|
| 48 |
-
* @return string Lowercased identifier as string
|
| 49 |
-
*/
|
| 50 |
-
public function toLowerString() : string {
|
| 51 |
-
return strtolower($this->name);
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
/**
|
| 55 |
-
* Checks whether the identifier is a special class name (self, parent or static).
|
| 56 |
-
*
|
| 57 |
-
* @return bool Whether identifier is a special class name
|
| 58 |
-
*/
|
| 59 |
-
public function isSpecialClassName() : bool {
|
| 60 |
-
return isset(self::$specialClassNames[strtolower($this->name)]);
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
/**
|
| 64 |
-
* Get identifier as string.
|
| 65 |
-
*
|
| 66 |
-
* @return string Identifier as string
|
| 67 |
-
*/
|
| 68 |
-
public function __toString() : string {
|
| 69 |
-
return $this->name;
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
public function getType() : string {
|
| 73 |
-
return 'Identifier';
|
| 74 |
-
}
|
| 75 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Name.php
DELETED
|
@@ -1,242 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node;
|
| 4 |
-
|
| 5 |
-
use PhpParser\NodeAbstract;
|
| 6 |
-
|
| 7 |
-
class Name extends NodeAbstract
|
| 8 |
-
{
|
| 9 |
-
/** @var string[] Parts of the name */
|
| 10 |
-
public $parts;
|
| 11 |
-
|
| 12 |
-
private static $specialClassNames = [
|
| 13 |
-
'self' => true,
|
| 14 |
-
'parent' => true,
|
| 15 |
-
'static' => true,
|
| 16 |
-
];
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* Constructs a name node.
|
| 20 |
-
*
|
| 21 |
-
* @param string|string[]|self $name Name as string, part array or Name instance (copy ctor)
|
| 22 |
-
* @param array $attributes Additional attributes
|
| 23 |
-
*/
|
| 24 |
-
public function __construct($name, array $attributes = []) {
|
| 25 |
-
$this->attributes = $attributes;
|
| 26 |
-
$this->parts = self::prepareName($name);
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
public function getSubNodeNames() : array {
|
| 30 |
-
return ['parts'];
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
/**
|
| 34 |
-
* Gets the first part of the name, i.e. everything before the first namespace separator.
|
| 35 |
-
*
|
| 36 |
-
* @return string First part of the name
|
| 37 |
-
*/
|
| 38 |
-
public function getFirst() : string {
|
| 39 |
-
return $this->parts[0];
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
/**
|
| 43 |
-
* Gets the last part of the name, i.e. everything after the last namespace separator.
|
| 44 |
-
*
|
| 45 |
-
* @return string Last part of the name
|
| 46 |
-
*/
|
| 47 |
-
public function getLast() : string {
|
| 48 |
-
return $this->parts[count($this->parts) - 1];
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
/**
|
| 52 |
-
* Checks whether the name is unqualified. (E.g. Name)
|
| 53 |
-
*
|
| 54 |
-
* @return bool Whether the name is unqualified
|
| 55 |
-
*/
|
| 56 |
-
public function isUnqualified() : bool {
|
| 57 |
-
return 1 === count($this->parts);
|
| 58 |
-
}
|
| 59 |
-
|
| 60 |
-
/**
|
| 61 |
-
* Checks whether the name is qualified. (E.g. Name\Name)
|
| 62 |
-
*
|
| 63 |
-
* @return bool Whether the name is qualified
|
| 64 |
-
*/
|
| 65 |
-
public function isQualified() : bool {
|
| 66 |
-
return 1 < count($this->parts);
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
/**
|
| 70 |
-
* Checks whether the name is fully qualified. (E.g. \Name)
|
| 71 |
-
*
|
| 72 |
-
* @return bool Whether the name is fully qualified
|
| 73 |
-
*/
|
| 74 |
-
public function isFullyQualified() : bool {
|
| 75 |
-
return false;
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
/**
|
| 79 |
-
* Checks whether the name is explicitly relative to the current namespace. (E.g. namespace\Name)
|
| 80 |
-
*
|
| 81 |
-
* @return bool Whether the name is relative
|
| 82 |
-
*/
|
| 83 |
-
public function isRelative() : bool {
|
| 84 |
-
return false;
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
/**
|
| 88 |
-
* Returns a string representation of the name itself, without taking taking the name type into
|
| 89 |
-
* account (e.g., not including a leading backslash for fully qualified names).
|
| 90 |
-
*
|
| 91 |
-
* @return string String representation
|
| 92 |
-
*/
|
| 93 |
-
public function toString() : string {
|
| 94 |
-
return implode('\\', $this->parts);
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
/**
|
| 98 |
-
* Returns a string representation of the name as it would occur in code (e.g., including
|
| 99 |
-
* leading backslash for fully qualified names.
|
| 100 |
-
*
|
| 101 |
-
* @return string String representation
|
| 102 |
-
*/
|
| 103 |
-
public function toCodeString() : string {
|
| 104 |
-
return $this->toString();
|
| 105 |
-
}
|
| 106 |
-
|
| 107 |
-
/**
|
| 108 |
-
* Returns lowercased string representation of the name, without taking the name type into
|
| 109 |
-
* account (e.g., no leading backslash for fully qualified names).
|
| 110 |
-
*
|
| 111 |
-
* @return string Lowercased string representation
|
| 112 |
-
*/
|
| 113 |
-
public function toLowerString() : string {
|
| 114 |
-
return strtolower(implode('\\', $this->parts));
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
/**
|
| 118 |
-
* Checks whether the identifier is a special class name (self, parent or static).
|
| 119 |
-
*
|
| 120 |
-
* @return bool Whether identifier is a special class name
|
| 121 |
-
*/
|
| 122 |
-
public function isSpecialClassName() : bool {
|
| 123 |
-
return count($this->parts) === 1
|
| 124 |
-
&& isset(self::$specialClassNames[strtolower($this->parts[0])]);
|
| 125 |
-
}
|
| 126 |
-
|
| 127 |
-
/**
|
| 128 |
-
* Returns a string representation of the name by imploding the namespace parts with the
|
| 129 |
-
* namespace separator.
|
| 130 |
-
*
|
| 131 |
-
* @return string String representation
|
| 132 |
-
*/
|
| 133 |
-
public function __toString() : string {
|
| 134 |
-
return implode('\\', $this->parts);
|
| 135 |
-
}
|
| 136 |
-
|
| 137 |
-
/**
|
| 138 |
-
* Gets a slice of a name (similar to array_slice).
|
| 139 |
-
*
|
| 140 |
-
* This method returns a new instance of the same type as the original and with the same
|
| 141 |
-
* attributes.
|
| 142 |
-
*
|
| 143 |
-
* If the slice is empty, null is returned. The null value will be correctly handled in
|
| 144 |
-
* concatenations using concat().
|
| 145 |
-
*
|
| 146 |
-
* Offset and length have the same meaning as in array_slice().
|
| 147 |
-
*
|
| 148 |
-
* @param int $offset Offset to start the slice at (may be negative)
|
| 149 |
-
* @param int|null $length Length of the slice (may be negative)
|
| 150 |
-
*
|
| 151 |
-
* @return static|null Sliced name
|
| 152 |
-
*/
|
| 153 |
-
public function slice(int $offset, int $length = null) {
|
| 154 |
-
$numParts = count($this->parts);
|
| 155 |
-
|
| 156 |
-
$realOffset = $offset < 0 ? $offset + $numParts : $offset;
|
| 157 |
-
if ($realOffset < 0 || $realOffset > $numParts) {
|
| 158 |
-
throw new \OutOfBoundsException(sprintf('Offset %d is out of bounds', $offset));
|
| 159 |
-
}
|
| 160 |
-
|
| 161 |
-
if (null === $length) {
|
| 162 |
-
$realLength = $numParts - $realOffset;
|
| 163 |
-
} else {
|
| 164 |
-
$realLength = $length < 0 ? $length + $numParts - $realOffset : $length;
|
| 165 |
-
if ($realLength < 0 || $realLength > $numParts) {
|
| 166 |
-
throw new \OutOfBoundsException(sprintf('Length %d is out of bounds', $length));
|
| 167 |
-
}
|
| 168 |
-
}
|
| 169 |
-
|
| 170 |
-
if ($realLength === 0) {
|
| 171 |
-
// Empty slice is represented as null
|
| 172 |
-
return null;
|
| 173 |
-
}
|
| 174 |
-
|
| 175 |
-
return new static(array_slice($this->parts, $realOffset, $realLength), $this->attributes);
|
| 176 |
-
}
|
| 177 |
-
|
| 178 |
-
/**
|
| 179 |
-
* Concatenate two names, yielding a new Name instance.
|
| 180 |
-
*
|
| 181 |
-
* The type of the generated instance depends on which class this method is called on, for
|
| 182 |
-
* example Name\FullyQualified::concat() will yield a Name\FullyQualified instance.
|
| 183 |
-
*
|
| 184 |
-
* If one of the arguments is null, a new instance of the other name will be returned. If both
|
| 185 |
-
* arguments are null, null will be returned. As such, writing
|
| 186 |
-
* Name::concat($namespace, $shortName)
|
| 187 |
-
* where $namespace is a Name node or null will work as expected.
|
| 188 |
-
*
|
| 189 |
-
* @param string|string[]|self|null $name1 The first name
|
| 190 |
-
* @param string|string[]|self|null $name2 The second name
|
| 191 |
-
* @param array $attributes Attributes to assign to concatenated name
|
| 192 |
-
*
|
| 193 |
-
* @return static|null Concatenated name
|
| 194 |
-
*/
|
| 195 |
-
public static function concat($name1, $name2, array $attributes = []) {
|
| 196 |
-
if (null === $name1 && null === $name2) {
|
| 197 |
-
return null;
|
| 198 |
-
} elseif (null === $name1) {
|
| 199 |
-
return new static(self::prepareName($name2), $attributes);
|
| 200 |
-
} elseif (null === $name2) {
|
| 201 |
-
return new static(self::prepareName($name1), $attributes);
|
| 202 |
-
} else {
|
| 203 |
-
return new static(
|
| 204 |
-
array_merge(self::prepareName($name1), self::prepareName($name2)), $attributes
|
| 205 |
-
);
|
| 206 |
-
}
|
| 207 |
-
}
|
| 208 |
-
|
| 209 |
-
/**
|
| 210 |
-
* Prepares a (string, array or Name node) name for use in name changing methods by converting
|
| 211 |
-
* it to an array.
|
| 212 |
-
*
|
| 213 |
-
* @param string|string[]|self $name Name to prepare
|
| 214 |
-
*
|
| 215 |
-
* @return string[] Prepared name
|
| 216 |
-
*/
|
| 217 |
-
private static function prepareName($name) : array {
|
| 218 |
-
if (\is_string($name)) {
|
| 219 |
-
if ('' === $name) {
|
| 220 |
-
throw new \InvalidArgumentException('Name cannot be empty');
|
| 221 |
-
}
|
| 222 |
-
|
| 223 |
-
return explode('\\', $name);
|
| 224 |
-
} elseif (\is_array($name)) {
|
| 225 |
-
if (empty($name)) {
|
| 226 |
-
throw new \InvalidArgumentException('Name cannot be empty');
|
| 227 |
-
}
|
| 228 |
-
|
| 229 |
-
return $name;
|
| 230 |
-
} elseif ($name instanceof self) {
|
| 231 |
-
return $name->parts;
|
| 232 |
-
}
|
| 233 |
-
|
| 234 |
-
throw new \InvalidArgumentException(
|
| 235 |
-
'Expected string, array of parts or Name instance'
|
| 236 |
-
);
|
| 237 |
-
}
|
| 238 |
-
|
| 239 |
-
public function getType() : string {
|
| 240 |
-
return 'Name';
|
| 241 |
-
}
|
| 242 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Name/FullyQualified.php
DELETED
|
@@ -1,50 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Name;
|
| 4 |
-
|
| 5 |
-
class FullyQualified extends \PhpParser\Node\Name
|
| 6 |
-
{
|
| 7 |
-
/**
|
| 8 |
-
* Checks whether the name is unqualified. (E.g. Name)
|
| 9 |
-
*
|
| 10 |
-
* @return bool Whether the name is unqualified
|
| 11 |
-
*/
|
| 12 |
-
public function isUnqualified() : bool {
|
| 13 |
-
return false;
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* Checks whether the name is qualified. (E.g. Name\Name)
|
| 18 |
-
*
|
| 19 |
-
* @return bool Whether the name is qualified
|
| 20 |
-
*/
|
| 21 |
-
public function isQualified() : bool {
|
| 22 |
-
return false;
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
/**
|
| 26 |
-
* Checks whether the name is fully qualified. (E.g. \Name)
|
| 27 |
-
*
|
| 28 |
-
* @return bool Whether the name is fully qualified
|
| 29 |
-
*/
|
| 30 |
-
public function isFullyQualified() : bool {
|
| 31 |
-
return true;
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
/**
|
| 35 |
-
* Checks whether the name is explicitly relative to the current namespace. (E.g. namespace\Name)
|
| 36 |
-
*
|
| 37 |
-
* @return bool Whether the name is relative
|
| 38 |
-
*/
|
| 39 |
-
public function isRelative() : bool {
|
| 40 |
-
return false;
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
public function toCodeString() : string {
|
| 44 |
-
return '\\' . $this->toString();
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
public function getType() : string {
|
| 48 |
-
return 'Name_FullyQualified';
|
| 49 |
-
}
|
| 50 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Name/Relative.php
DELETED
|
@@ -1,50 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Name;
|
| 4 |
-
|
| 5 |
-
class Relative extends \PhpParser\Node\Name
|
| 6 |
-
{
|
| 7 |
-
/**
|
| 8 |
-
* Checks whether the name is unqualified. (E.g. Name)
|
| 9 |
-
*
|
| 10 |
-
* @return bool Whether the name is unqualified
|
| 11 |
-
*/
|
| 12 |
-
public function isUnqualified() : bool {
|
| 13 |
-
return false;
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* Checks whether the name is qualified. (E.g. Name\Name)
|
| 18 |
-
*
|
| 19 |
-
* @return bool Whether the name is qualified
|
| 20 |
-
*/
|
| 21 |
-
public function isQualified() : bool {
|
| 22 |
-
return false;
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
/**
|
| 26 |
-
* Checks whether the name is fully qualified. (E.g. \Name)
|
| 27 |
-
*
|
| 28 |
-
* @return bool Whether the name is fully qualified
|
| 29 |
-
*/
|
| 30 |
-
public function isFullyQualified() : bool {
|
| 31 |
-
return false;
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
/**
|
| 35 |
-
* Checks whether the name is explicitly relative to the current namespace. (E.g. namespace\Name)
|
| 36 |
-
*
|
| 37 |
-
* @return bool Whether the name is relative
|
| 38 |
-
*/
|
| 39 |
-
public function isRelative() : bool {
|
| 40 |
-
return true;
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
public function toCodeString() : string {
|
| 44 |
-
return 'namespace\\' . $this->toString();
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
public function getType() : string {
|
| 48 |
-
return 'Name_Relative';
|
| 49 |
-
}
|
| 50 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/NullableType.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node;
|
| 4 |
-
|
| 5 |
-
use PhpParser\NodeAbstract;
|
| 6 |
-
|
| 7 |
-
class NullableType extends NodeAbstract
|
| 8 |
-
{
|
| 9 |
-
/** @var Identifier|Name Type */
|
| 10 |
-
public $type;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a nullable type (wrapping another type).
|
| 14 |
-
*
|
| 15 |
-
* @param string|Identifier|Name $type Type
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct($type, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->type = \is_string($type) ? new Identifier($type) : $type;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['type'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'NullableType';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Param.php
DELETED
|
@@ -1,49 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node;
|
| 4 |
-
|
| 5 |
-
use PhpParser\NodeAbstract;
|
| 6 |
-
|
| 7 |
-
class Param extends NodeAbstract
|
| 8 |
-
{
|
| 9 |
-
/** @var null|Identifier|Name|NullableType|UnionType Type declaration */
|
| 10 |
-
public $type;
|
| 11 |
-
/** @var bool Whether parameter is passed by reference */
|
| 12 |
-
public $byRef;
|
| 13 |
-
/** @var bool Whether this is a variadic argument */
|
| 14 |
-
public $variadic;
|
| 15 |
-
/** @var Expr\Variable|Expr\Error Parameter variable */
|
| 16 |
-
public $var;
|
| 17 |
-
/** @var null|Expr Default value */
|
| 18 |
-
public $default;
|
| 19 |
-
|
| 20 |
-
/**
|
| 21 |
-
* Constructs a parameter node.
|
| 22 |
-
*
|
| 23 |
-
* @param Expr\Variable|Expr\Error $var Parameter variable
|
| 24 |
-
* @param null|Expr $default Default value
|
| 25 |
-
* @param null|string|Identifier|Name|NullableType|UnionType $type Type declaration
|
| 26 |
-
* @param bool $byRef Whether is passed by reference
|
| 27 |
-
* @param bool $variadic Whether this is a variadic argument
|
| 28 |
-
* @param array $attributes Additional attributes
|
| 29 |
-
*/
|
| 30 |
-
public function __construct(
|
| 31 |
-
$var, Expr $default = null, $type = null,
|
| 32 |
-
bool $byRef = false, bool $variadic = false, array $attributes = []
|
| 33 |
-
) {
|
| 34 |
-
$this->attributes = $attributes;
|
| 35 |
-
$this->type = \is_string($type) ? new Identifier($type) : $type;
|
| 36 |
-
$this->byRef = $byRef;
|
| 37 |
-
$this->variadic = $variadic;
|
| 38 |
-
$this->var = $var;
|
| 39 |
-
$this->default = $default;
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
public function getSubNodeNames() : array {
|
| 43 |
-
return ['type', 'byRef', 'variadic', 'var', 'default'];
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
public function getType() : string {
|
| 47 |
-
return 'Param';
|
| 48 |
-
}
|
| 49 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar.php
DELETED
|
@@ -1,7 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node;
|
| 4 |
-
|
| 5 |
-
abstract class Scalar extends Expr
|
| 6 |
-
{
|
| 7 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/DNumber.php
DELETED
|
@@ -1,70 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Scalar;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Scalar;
|
| 6 |
-
|
| 7 |
-
class DNumber extends Scalar
|
| 8 |
-
{
|
| 9 |
-
/** @var float Number value */
|
| 10 |
-
public $value;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a float number scalar node.
|
| 14 |
-
*
|
| 15 |
-
* @param float $value Value of the number
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(float $value, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->value = $value;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['value'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
/**
|
| 28 |
-
* @internal
|
| 29 |
-
*
|
| 30 |
-
* Parses a DNUMBER token like PHP would.
|
| 31 |
-
*
|
| 32 |
-
* @param string $str A string number
|
| 33 |
-
*
|
| 34 |
-
* @return float The parsed number
|
| 35 |
-
*/
|
| 36 |
-
public static function parse(string $str) : float {
|
| 37 |
-
$str = str_replace('_', '', $str);
|
| 38 |
-
|
| 39 |
-
// if string contains any of .eE just cast it to float
|
| 40 |
-
if (false !== strpbrk($str, '.eE')) {
|
| 41 |
-
return (float) $str;
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
// otherwise it's an integer notation that overflowed into a float
|
| 45 |
-
// if it starts with 0 it's one of the special integer notations
|
| 46 |
-
if ('0' === $str[0]) {
|
| 47 |
-
// hex
|
| 48 |
-
if ('x' === $str[1] || 'X' === $str[1]) {
|
| 49 |
-
return hexdec($str);
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
// bin
|
| 53 |
-
if ('b' === $str[1] || 'B' === $str[1]) {
|
| 54 |
-
return bindec($str);
|
| 55 |
-
}
|
| 56 |
-
|
| 57 |
-
// oct
|
| 58 |
-
// substr($str, 0, strcspn($str, '89')) cuts the string at the first invalid digit (8 or 9)
|
| 59 |
-
// so that only the digits before that are used
|
| 60 |
-
return octdec(substr($str, 0, strcspn($str, '89')));
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
// dec
|
| 64 |
-
return (float) $str;
|
| 65 |
-
}
|
| 66 |
-
|
| 67 |
-
public function getType() : string {
|
| 68 |
-
return 'Scalar_DNumber';
|
| 69 |
-
}
|
| 70 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/Encapsed.php
DELETED
|
@@ -1,31 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Scalar;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr;
|
| 6 |
-
use PhpParser\Node\Scalar;
|
| 7 |
-
|
| 8 |
-
class Encapsed extends Scalar
|
| 9 |
-
{
|
| 10 |
-
/** @var Expr[] list of string parts */
|
| 11 |
-
public $parts;
|
| 12 |
-
|
| 13 |
-
/**
|
| 14 |
-
* Constructs an encapsed string node.
|
| 15 |
-
*
|
| 16 |
-
* @param Expr[] $parts Encaps list
|
| 17 |
-
* @param array $attributes Additional attributes
|
| 18 |
-
*/
|
| 19 |
-
public function __construct(array $parts, array $attributes = []) {
|
| 20 |
-
$this->attributes = $attributes;
|
| 21 |
-
$this->parts = $parts;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
public function getSubNodeNames() : array {
|
| 25 |
-
return ['parts'];
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function getType() : string {
|
| 29 |
-
return 'Scalar_Encapsed';
|
| 30 |
-
}
|
| 31 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/EncapsedStringPart.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Scalar;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Scalar;
|
| 6 |
-
|
| 7 |
-
class EncapsedStringPart extends Scalar
|
| 8 |
-
{
|
| 9 |
-
/** @var string String value */
|
| 10 |
-
public $value;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a node representing a string part of an encapsed string.
|
| 14 |
-
*
|
| 15 |
-
* @param string $value String value
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(string $value, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->value = $value;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['value'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Scalar_EncapsedStringPart';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/LNumber.php
DELETED
|
@@ -1,73 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Scalar;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Error;
|
| 6 |
-
use PhpParser\Node\Scalar;
|
| 7 |
-
|
| 8 |
-
class LNumber extends Scalar
|
| 9 |
-
{
|
| 10 |
-
/* For use in "kind" attribute */
|
| 11 |
-
const KIND_BIN = 2;
|
| 12 |
-
const KIND_OCT = 8;
|
| 13 |
-
const KIND_DEC = 10;
|
| 14 |
-
const KIND_HEX = 16;
|
| 15 |
-
|
| 16 |
-
/** @var int Number value */
|
| 17 |
-
public $value;
|
| 18 |
-
|
| 19 |
-
/**
|
| 20 |
-
* Constructs an integer number scalar node.
|
| 21 |
-
*
|
| 22 |
-
* @param int $value Value of the number
|
| 23 |
-
* @param array $attributes Additional attributes
|
| 24 |
-
*/
|
| 25 |
-
public function __construct(int $value, array $attributes = []) {
|
| 26 |
-
$this->attributes = $attributes;
|
| 27 |
-
$this->value = $value;
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
public function getSubNodeNames() : array {
|
| 31 |
-
return ['value'];
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
/**
|
| 35 |
-
* Constructs an LNumber node from a string number literal.
|
| 36 |
-
*
|
| 37 |
-
* @param string $str String number literal (decimal, octal, hex or binary)
|
| 38 |
-
* @param array $attributes Additional attributes
|
| 39 |
-
* @param bool $allowInvalidOctal Whether to allow invalid octal numbers (PHP 5)
|
| 40 |
-
*
|
| 41 |
-
* @return LNumber The constructed LNumber, including kind attribute
|
| 42 |
-
*/
|
| 43 |
-
public static function fromString(string $str, array $attributes = [], bool $allowInvalidOctal = false) : LNumber {
|
| 44 |
-
$str = str_replace('_', '', $str);
|
| 45 |
-
|
| 46 |
-
if ('0' !== $str[0] || '0' === $str) {
|
| 47 |
-
$attributes['kind'] = LNumber::KIND_DEC;
|
| 48 |
-
return new LNumber((int) $str, $attributes);
|
| 49 |
-
}
|
| 50 |
-
|
| 51 |
-
if ('x' === $str[1] || 'X' === $str[1]) {
|
| 52 |
-
$attributes['kind'] = LNumber::KIND_HEX;
|
| 53 |
-
return new LNumber(hexdec($str), $attributes);
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
if ('b' === $str[1] || 'B' === $str[1]) {
|
| 57 |
-
$attributes['kind'] = LNumber::KIND_BIN;
|
| 58 |
-
return new LNumber(bindec($str), $attributes);
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
if (!$allowInvalidOctal && strpbrk($str, '89')) {
|
| 62 |
-
throw new Error('Invalid numeric literal', $attributes);
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
// use intval instead of octdec to get proper cutting behavior with malformed numbers
|
| 66 |
-
$attributes['kind'] = LNumber::KIND_OCT;
|
| 67 |
-
return new LNumber(intval($str, 8), $attributes);
|
| 68 |
-
}
|
| 69 |
-
|
| 70 |
-
public function getType() : string {
|
| 71 |
-
return 'Scalar_LNumber';
|
| 72 |
-
}
|
| 73 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst.php
DELETED
|
@@ -1,28 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Scalar;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Scalar;
|
| 6 |
-
|
| 7 |
-
abstract class MagicConst extends Scalar
|
| 8 |
-
{
|
| 9 |
-
/**
|
| 10 |
-
* Constructs a magic constant node.
|
| 11 |
-
*
|
| 12 |
-
* @param array $attributes Additional attributes
|
| 13 |
-
*/
|
| 14 |
-
public function __construct(array $attributes = []) {
|
| 15 |
-
$this->attributes = $attributes;
|
| 16 |
-
}
|
| 17 |
-
|
| 18 |
-
public function getSubNodeNames() : array {
|
| 19 |
-
return [];
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
/**
|
| 23 |
-
* Get name of magic constant.
|
| 24 |
-
*
|
| 25 |
-
* @return string Name of magic constant
|
| 26 |
-
*/
|
| 27 |
-
abstract public function getName() : string;
|
| 28 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/Class_.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Scalar\MagicConst;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Scalar\MagicConst;
|
| 6 |
-
|
| 7 |
-
class Class_ extends MagicConst
|
| 8 |
-
{
|
| 9 |
-
public function getName() : string {
|
| 10 |
-
return '__CLASS__';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Scalar_MagicConst_Class';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/Dir.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Scalar\MagicConst;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Scalar\MagicConst;
|
| 6 |
-
|
| 7 |
-
class Dir extends MagicConst
|
| 8 |
-
{
|
| 9 |
-
public function getName() : string {
|
| 10 |
-
return '__DIR__';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Scalar_MagicConst_Dir';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/File.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Scalar\MagicConst;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Scalar\MagicConst;
|
| 6 |
-
|
| 7 |
-
class File extends MagicConst
|
| 8 |
-
{
|
| 9 |
-
public function getName() : string {
|
| 10 |
-
return '__FILE__';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Scalar_MagicConst_File';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/Function_.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Scalar\MagicConst;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Scalar\MagicConst;
|
| 6 |
-
|
| 7 |
-
class Function_ extends MagicConst
|
| 8 |
-
{
|
| 9 |
-
public function getName() : string {
|
| 10 |
-
return '__FUNCTION__';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Scalar_MagicConst_Function';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/Line.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Scalar\MagicConst;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Scalar\MagicConst;
|
| 6 |
-
|
| 7 |
-
class Line extends MagicConst
|
| 8 |
-
{
|
| 9 |
-
public function getName() : string {
|
| 10 |
-
return '__LINE__';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Scalar_MagicConst_Line';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/Method.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Scalar\MagicConst;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Scalar\MagicConst;
|
| 6 |
-
|
| 7 |
-
class Method extends MagicConst
|
| 8 |
-
{
|
| 9 |
-
public function getName() : string {
|
| 10 |
-
return '__METHOD__';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Scalar_MagicConst_Method';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/Namespace_.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Scalar\MagicConst;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Scalar\MagicConst;
|
| 6 |
-
|
| 7 |
-
class Namespace_ extends MagicConst
|
| 8 |
-
{
|
| 9 |
-
public function getName() : string {
|
| 10 |
-
return '__NAMESPACE__';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Scalar_MagicConst_Namespace';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/MagicConst/Trait_.php
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Scalar\MagicConst;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Scalar\MagicConst;
|
| 6 |
-
|
| 7 |
-
class Trait_ extends MagicConst
|
| 8 |
-
{
|
| 9 |
-
public function getName() : string {
|
| 10 |
-
return '__TRAIT__';
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
public function getType() : string {
|
| 14 |
-
return 'Scalar_MagicConst_Trait';
|
| 15 |
-
}
|
| 16 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Scalar/String_.php
DELETED
|
@@ -1,141 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Scalar;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Error;
|
| 6 |
-
use PhpParser\Node\Scalar;
|
| 7 |
-
|
| 8 |
-
class String_ extends Scalar
|
| 9 |
-
{
|
| 10 |
-
/* For use in "kind" attribute */
|
| 11 |
-
const KIND_SINGLE_QUOTED = 1;
|
| 12 |
-
const KIND_DOUBLE_QUOTED = 2;
|
| 13 |
-
const KIND_HEREDOC = 3;
|
| 14 |
-
const KIND_NOWDOC = 4;
|
| 15 |
-
|
| 16 |
-
/** @var string String value */
|
| 17 |
-
public $value;
|
| 18 |
-
|
| 19 |
-
protected static $replacements = [
|
| 20 |
-
'\\' => '\\',
|
| 21 |
-
'$' => '$',
|
| 22 |
-
'n' => "\n",
|
| 23 |
-
'r' => "\r",
|
| 24 |
-
't' => "\t",
|
| 25 |
-
'f' => "\f",
|
| 26 |
-
'v' => "\v",
|
| 27 |
-
'e' => "\x1B",
|
| 28 |
-
];
|
| 29 |
-
|
| 30 |
-
/**
|
| 31 |
-
* Constructs a string scalar node.
|
| 32 |
-
*
|
| 33 |
-
* @param string $value Value of the string
|
| 34 |
-
* @param array $attributes Additional attributes
|
| 35 |
-
*/
|
| 36 |
-
public function __construct(string $value, array $attributes = []) {
|
| 37 |
-
$this->attributes = $attributes;
|
| 38 |
-
$this->value = $value;
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
public function getSubNodeNames() : array {
|
| 42 |
-
return ['value'];
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
/**
|
| 46 |
-
* @internal
|
| 47 |
-
*
|
| 48 |
-
* Parses a string token.
|
| 49 |
-
*
|
| 50 |
-
* @param string $str String token content
|
| 51 |
-
* @param bool $parseUnicodeEscape Whether to parse PHP 7 \u escapes
|
| 52 |
-
*
|
| 53 |
-
* @return string The parsed string
|
| 54 |
-
*/
|
| 55 |
-
public static function parse(string $str, bool $parseUnicodeEscape = true) : string {
|
| 56 |
-
$bLength = 0;
|
| 57 |
-
if ('b' === $str[0] || 'B' === $str[0]) {
|
| 58 |
-
$bLength = 1;
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
if ('\'' === $str[$bLength]) {
|
| 62 |
-
return str_replace(
|
| 63 |
-
['\\\\', '\\\''],
|
| 64 |
-
['\\', '\''],
|
| 65 |
-
substr($str, $bLength + 1, -1)
|
| 66 |
-
);
|
| 67 |
-
} else {
|
| 68 |
-
return self::parseEscapeSequences(
|
| 69 |
-
substr($str, $bLength + 1, -1), '"', $parseUnicodeEscape
|
| 70 |
-
);
|
| 71 |
-
}
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
/**
|
| 75 |
-
* @internal
|
| 76 |
-
*
|
| 77 |
-
* Parses escape sequences in strings (all string types apart from single quoted).
|
| 78 |
-
*
|
| 79 |
-
* @param string $str String without quotes
|
| 80 |
-
* @param null|string $quote Quote type
|
| 81 |
-
* @param bool $parseUnicodeEscape Whether to parse PHP 7 \u escapes
|
| 82 |
-
*
|
| 83 |
-
* @return string String with escape sequences parsed
|
| 84 |
-
*/
|
| 85 |
-
public static function parseEscapeSequences(string $str, $quote, bool $parseUnicodeEscape = true) : string {
|
| 86 |
-
if (null !== $quote) {
|
| 87 |
-
$str = str_replace('\\' . $quote, $quote, $str);
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
$extra = '';
|
| 91 |
-
if ($parseUnicodeEscape) {
|
| 92 |
-
$extra = '|u\{([0-9a-fA-F]+)\}';
|
| 93 |
-
}
|
| 94 |
-
|
| 95 |
-
return preg_replace_callback(
|
| 96 |
-
'~\\\\([\\\\$nrtfve]|[xX][0-9a-fA-F]{1,2}|[0-7]{1,3}' . $extra . ')~',
|
| 97 |
-
function($matches) {
|
| 98 |
-
$str = $matches[1];
|
| 99 |
-
|
| 100 |
-
if (isset(self::$replacements[$str])) {
|
| 101 |
-
return self::$replacements[$str];
|
| 102 |
-
} elseif ('x' === $str[0] || 'X' === $str[0]) {
|
| 103 |
-
return chr(hexdec(substr($str, 1)));
|
| 104 |
-
} elseif ('u' === $str[0]) {
|
| 105 |
-
return self::codePointToUtf8(hexdec($matches[2]));
|
| 106 |
-
} else {
|
| 107 |
-
return chr(octdec($str));
|
| 108 |
-
}
|
| 109 |
-
},
|
| 110 |
-
$str
|
| 111 |
-
);
|
| 112 |
-
}
|
| 113 |
-
|
| 114 |
-
/**
|
| 115 |
-
* Converts a Unicode code point to its UTF-8 encoded representation.
|
| 116 |
-
*
|
| 117 |
-
* @param int $num Code point
|
| 118 |
-
*
|
| 119 |
-
* @return string UTF-8 representation of code point
|
| 120 |
-
*/
|
| 121 |
-
private static function codePointToUtf8(int $num) : string {
|
| 122 |
-
if ($num <= 0x7F) {
|
| 123 |
-
return chr($num);
|
| 124 |
-
}
|
| 125 |
-
if ($num <= 0x7FF) {
|
| 126 |
-
return chr(($num>>6) + 0xC0) . chr(($num&0x3F) + 0x80);
|
| 127 |
-
}
|
| 128 |
-
if ($num <= 0xFFFF) {
|
| 129 |
-
return chr(($num>>12) + 0xE0) . chr((($num>>6)&0x3F) + 0x80) . chr(($num&0x3F) + 0x80);
|
| 130 |
-
}
|
| 131 |
-
if ($num <= 0x1FFFFF) {
|
| 132 |
-
return chr(($num>>18) + 0xF0) . chr((($num>>12)&0x3F) + 0x80)
|
| 133 |
-
. chr((($num>>6)&0x3F) + 0x80) . chr(($num&0x3F) + 0x80);
|
| 134 |
-
}
|
| 135 |
-
throw new Error('Invalid UTF-8 codepoint escape sequence: Codepoint too large');
|
| 136 |
-
}
|
| 137 |
-
|
| 138 |
-
public function getType() : string {
|
| 139 |
-
return 'Scalar_String';
|
| 140 |
-
}
|
| 141 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt.php
DELETED
|
@@ -1,9 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node;
|
| 4 |
-
|
| 5 |
-
use PhpParser\NodeAbstract;
|
| 6 |
-
|
| 7 |
-
abstract class Stmt extends NodeAbstract
|
| 8 |
-
{
|
| 9 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Break_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Break_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var null|Node\Expr Number of loops to break */
|
| 10 |
-
public $num;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a break node.
|
| 14 |
-
*
|
| 15 |
-
* @param null|Node\Expr $num Number of loops to break
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Node\Expr $num = null, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->num = $num;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['num'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Stmt_Break';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Case_.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Case_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var null|Node\Expr Condition (null for default) */
|
| 10 |
-
public $cond;
|
| 11 |
-
/** @var Node\Stmt[] Statements */
|
| 12 |
-
public $stmts;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs a case node.
|
| 16 |
-
*
|
| 17 |
-
* @param null|Node\Expr $cond Condition (null for default)
|
| 18 |
-
* @param Node\Stmt[] $stmts Statements
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct($cond, array $stmts = [], array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->cond = $cond;
|
| 24 |
-
$this->stmts = $stmts;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['cond', 'stmts'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Stmt_Case';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Catch_.php
DELETED
|
@@ -1,41 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\Node\Expr;
|
| 7 |
-
|
| 8 |
-
class Catch_ extends Node\Stmt
|
| 9 |
-
{
|
| 10 |
-
/** @var Node\Name[] Types of exceptions to catch */
|
| 11 |
-
public $types;
|
| 12 |
-
/** @var Expr\Variable|null Variable for exception */
|
| 13 |
-
public $var;
|
| 14 |
-
/** @var Node\Stmt[] Statements */
|
| 15 |
-
public $stmts;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* Constructs a catch node.
|
| 19 |
-
*
|
| 20 |
-
* @param Node\Name[] $types Types of exceptions to catch
|
| 21 |
-
* @param Expr\Variable|null $var Variable for exception
|
| 22 |
-
* @param Node\Stmt[] $stmts Statements
|
| 23 |
-
* @param array $attributes Additional attributes
|
| 24 |
-
*/
|
| 25 |
-
public function __construct(
|
| 26 |
-
array $types, Expr\Variable $var = null, array $stmts = [], array $attributes = []
|
| 27 |
-
) {
|
| 28 |
-
$this->attributes = $attributes;
|
| 29 |
-
$this->types = $types;
|
| 30 |
-
$this->var = $var;
|
| 31 |
-
$this->stmts = $stmts;
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
public function getSubNodeNames() : array {
|
| 35 |
-
return ['types', 'var', 'stmts'];
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
public function getType() : string {
|
| 39 |
-
return 'Stmt_Catch';
|
| 40 |
-
}
|
| 41 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/ClassConst.php
DELETED
|
@@ -1,62 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class ClassConst extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var int Modifiers */
|
| 10 |
-
public $flags;
|
| 11 |
-
/** @var Node\Const_[] Constant declarations */
|
| 12 |
-
public $consts;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs a class const list node.
|
| 16 |
-
*
|
| 17 |
-
* @param Node\Const_[] $consts Constant declarations
|
| 18 |
-
* @param int $flags Modifiers
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(array $consts, int $flags = 0, array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->flags = $flags;
|
| 24 |
-
$this->consts = $consts;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['flags', 'consts'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
/**
|
| 32 |
-
* Whether constant is explicitly or implicitly public.
|
| 33 |
-
*
|
| 34 |
-
* @return bool
|
| 35 |
-
*/
|
| 36 |
-
public function isPublic() : bool {
|
| 37 |
-
return ($this->flags & Class_::MODIFIER_PUBLIC) !== 0
|
| 38 |
-
|| ($this->flags & Class_::VISIBILITY_MODIFIER_MASK) === 0;
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
/**
|
| 42 |
-
* Whether constant is protected.
|
| 43 |
-
*
|
| 44 |
-
* @return bool
|
| 45 |
-
*/
|
| 46 |
-
public function isProtected() : bool {
|
| 47 |
-
return (bool) ($this->flags & Class_::MODIFIER_PROTECTED);
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
/**
|
| 51 |
-
* Whether constant is private.
|
| 52 |
-
*
|
| 53 |
-
* @return bool
|
| 54 |
-
*/
|
| 55 |
-
public function isPrivate() : bool {
|
| 56 |
-
return (bool) ($this->flags & Class_::MODIFIER_PRIVATE);
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
public function getType() : string {
|
| 60 |
-
return 'Stmt_ClassConst';
|
| 61 |
-
}
|
| 62 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/ClassLike.php
DELETED
|
@@ -1,107 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
/**
|
| 8 |
-
* @property Node\Name $namespacedName Namespaced name (if using NameResolver)
|
| 9 |
-
*/
|
| 10 |
-
abstract class ClassLike extends Node\Stmt
|
| 11 |
-
{
|
| 12 |
-
/** @var Node\Identifier|null Name */
|
| 13 |
-
public $name;
|
| 14 |
-
/** @var Node\Stmt[] Statements */
|
| 15 |
-
public $stmts;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* @return TraitUse[]
|
| 19 |
-
*/
|
| 20 |
-
public function getTraitUses() : array {
|
| 21 |
-
$traitUses = [];
|
| 22 |
-
foreach ($this->stmts as $stmt) {
|
| 23 |
-
if ($stmt instanceof TraitUse) {
|
| 24 |
-
$traitUses[] = $stmt;
|
| 25 |
-
}
|
| 26 |
-
}
|
| 27 |
-
return $traitUses;
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
/**
|
| 31 |
-
* @return ClassConst[]
|
| 32 |
-
*/
|
| 33 |
-
public function getConstants() : array {
|
| 34 |
-
$constants = [];
|
| 35 |
-
foreach ($this->stmts as $stmt) {
|
| 36 |
-
if ($stmt instanceof ClassConst) {
|
| 37 |
-
$constants[] = $stmt;
|
| 38 |
-
}
|
| 39 |
-
}
|
| 40 |
-
return $constants;
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
/**
|
| 44 |
-
* @return Property[]
|
| 45 |
-
*/
|
| 46 |
-
public function getProperties() : array {
|
| 47 |
-
$properties = [];
|
| 48 |
-
foreach ($this->stmts as $stmt) {
|
| 49 |
-
if ($stmt instanceof Property) {
|
| 50 |
-
$properties[] = $stmt;
|
| 51 |
-
}
|
| 52 |
-
}
|
| 53 |
-
return $properties;
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
/**
|
| 57 |
-
* Gets property with the given name defined directly in this class/interface/trait.
|
| 58 |
-
*
|
| 59 |
-
* @param string $name Name of the property
|
| 60 |
-
*
|
| 61 |
-
* @return Property|null Property node or null if the property does not exist
|
| 62 |
-
*/
|
| 63 |
-
public function getProperty(string $name) {
|
| 64 |
-
foreach ($this->stmts as $stmt) {
|
| 65 |
-
if ($stmt instanceof Property) {
|
| 66 |
-
foreach ($stmt->props as $prop) {
|
| 67 |
-
if ($prop instanceof PropertyProperty && $name === $prop->name->toString()) {
|
| 68 |
-
return $stmt;
|
| 69 |
-
}
|
| 70 |
-
}
|
| 71 |
-
}
|
| 72 |
-
}
|
| 73 |
-
return null;
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
/**
|
| 77 |
-
* Gets all methods defined directly in this class/interface/trait
|
| 78 |
-
*
|
| 79 |
-
* @return ClassMethod[]
|
| 80 |
-
*/
|
| 81 |
-
public function getMethods() : array {
|
| 82 |
-
$methods = [];
|
| 83 |
-
foreach ($this->stmts as $stmt) {
|
| 84 |
-
if ($stmt instanceof ClassMethod) {
|
| 85 |
-
$methods[] = $stmt;
|
| 86 |
-
}
|
| 87 |
-
}
|
| 88 |
-
return $methods;
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
/**
|
| 92 |
-
* Gets method with the given name defined directly in this class/interface/trait.
|
| 93 |
-
*
|
| 94 |
-
* @param string $name Name of the method (compared case-insensitively)
|
| 95 |
-
*
|
| 96 |
-
* @return ClassMethod|null Method node or null if the method does not exist
|
| 97 |
-
*/
|
| 98 |
-
public function getMethod(string $name) {
|
| 99 |
-
$lowerName = strtolower($name);
|
| 100 |
-
foreach ($this->stmts as $stmt) {
|
| 101 |
-
if ($stmt instanceof ClassMethod && $lowerName === $stmt->name->toLowerString()) {
|
| 102 |
-
return $stmt;
|
| 103 |
-
}
|
| 104 |
-
}
|
| 105 |
-
return null;
|
| 106 |
-
}
|
| 107 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/ClassMethod.php
DELETED
|
@@ -1,151 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\Node\FunctionLike;
|
| 7 |
-
|
| 8 |
-
class ClassMethod extends Node\Stmt implements FunctionLike
|
| 9 |
-
{
|
| 10 |
-
/** @var int Flags */
|
| 11 |
-
public $flags;
|
| 12 |
-
/** @var bool Whether to return by reference */
|
| 13 |
-
public $byRef;
|
| 14 |
-
/** @var Node\Identifier Name */
|
| 15 |
-
public $name;
|
| 16 |
-
/** @var Node\Param[] Parameters */
|
| 17 |
-
public $params;
|
| 18 |
-
/** @var null|Node\Identifier|Node\Name|Node\NullableType|Node\UnionType Return type */
|
| 19 |
-
public $returnType;
|
| 20 |
-
/** @var Node\Stmt[]|null Statements */
|
| 21 |
-
public $stmts;
|
| 22 |
-
|
| 23 |
-
private static $magicNames = [
|
| 24 |
-
'__construct' => true,
|
| 25 |
-
'__destruct' => true,
|
| 26 |
-
'__call' => true,
|
| 27 |
-
'__callstatic' => true,
|
| 28 |
-
'__get' => true,
|
| 29 |
-
'__set' => true,
|
| 30 |
-
'__isset' => true,
|
| 31 |
-
'__unset' => true,
|
| 32 |
-
'__sleep' => true,
|
| 33 |
-
'__wakeup' => true,
|
| 34 |
-
'__tostring' => true,
|
| 35 |
-
'__set_state' => true,
|
| 36 |
-
'__clone' => true,
|
| 37 |
-
'__invoke' => true,
|
| 38 |
-
'__debuginfo' => true,
|
| 39 |
-
];
|
| 40 |
-
|
| 41 |
-
/**
|
| 42 |
-
* Constructs a class method node.
|
| 43 |
-
*
|
| 44 |
-
* @param string|Node\Identifier $name Name
|
| 45 |
-
* @param array $subNodes Array of the following optional subnodes:
|
| 46 |
-
* 'flags => MODIFIER_PUBLIC: Flags
|
| 47 |
-
* 'byRef' => false : Whether to return by reference
|
| 48 |
-
* 'params' => array() : Parameters
|
| 49 |
-
* 'returnType' => null : Return type
|
| 50 |
-
* 'stmts' => array() : Statements
|
| 51 |
-
* @param array $attributes Additional attributes
|
| 52 |
-
*/
|
| 53 |
-
public function __construct($name, array $subNodes = [], array $attributes = []) {
|
| 54 |
-
$this->attributes = $attributes;
|
| 55 |
-
$this->flags = $subNodes['flags'] ?? $subNodes['type'] ?? 0;
|
| 56 |
-
$this->byRef = $subNodes['byRef'] ?? false;
|
| 57 |
-
$this->name = \is_string($name) ? new Node\Identifier($name) : $name;
|
| 58 |
-
$this->params = $subNodes['params'] ?? [];
|
| 59 |
-
$returnType = $subNodes['returnType'] ?? null;
|
| 60 |
-
$this->returnType = \is_string($returnType) ? new Node\Identifier($returnType) : $returnType;
|
| 61 |
-
$this->stmts = array_key_exists('stmts', $subNodes) ? $subNodes['stmts'] : [];
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
public function getSubNodeNames() : array {
|
| 65 |
-
return ['flags', 'byRef', 'name', 'params', 'returnType', 'stmts'];
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
public function returnsByRef() : bool {
|
| 69 |
-
return $this->byRef;
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
public function getParams() : array {
|
| 73 |
-
return $this->params;
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
public function getReturnType() {
|
| 77 |
-
return $this->returnType;
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
public function getStmts() {
|
| 81 |
-
return $this->stmts;
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
/**
|
| 85 |
-
* Whether the method is explicitly or implicitly public.
|
| 86 |
-
*
|
| 87 |
-
* @return bool
|
| 88 |
-
*/
|
| 89 |
-
public function isPublic() : bool {
|
| 90 |
-
return ($this->flags & Class_::MODIFIER_PUBLIC) !== 0
|
| 91 |
-
|| ($this->flags & Class_::VISIBILITY_MODIFIER_MASK) === 0;
|
| 92 |
-
}
|
| 93 |
-
|
| 94 |
-
/**
|
| 95 |
-
* Whether the method is protected.
|
| 96 |
-
*
|
| 97 |
-
* @return bool
|
| 98 |
-
*/
|
| 99 |
-
public function isProtected() : bool {
|
| 100 |
-
return (bool) ($this->flags & Class_::MODIFIER_PROTECTED);
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
/**
|
| 104 |
-
* Whether the method is private.
|
| 105 |
-
*
|
| 106 |
-
* @return bool
|
| 107 |
-
*/
|
| 108 |
-
public function isPrivate() : bool {
|
| 109 |
-
return (bool) ($this->flags & Class_::MODIFIER_PRIVATE);
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
/**
|
| 113 |
-
* Whether the method is abstract.
|
| 114 |
-
*
|
| 115 |
-
* @return bool
|
| 116 |
-
*/
|
| 117 |
-
public function isAbstract() : bool {
|
| 118 |
-
return (bool) ($this->flags & Class_::MODIFIER_ABSTRACT);
|
| 119 |
-
}
|
| 120 |
-
|
| 121 |
-
/**
|
| 122 |
-
* Whether the method is final.
|
| 123 |
-
*
|
| 124 |
-
* @return bool
|
| 125 |
-
*/
|
| 126 |
-
public function isFinal() : bool {
|
| 127 |
-
return (bool) ($this->flags & Class_::MODIFIER_FINAL);
|
| 128 |
-
}
|
| 129 |
-
|
| 130 |
-
/**
|
| 131 |
-
* Whether the method is static.
|
| 132 |
-
*
|
| 133 |
-
* @return bool
|
| 134 |
-
*/
|
| 135 |
-
public function isStatic() : bool {
|
| 136 |
-
return (bool) ($this->flags & Class_::MODIFIER_STATIC);
|
| 137 |
-
}
|
| 138 |
-
|
| 139 |
-
/**
|
| 140 |
-
* Whether the method is magic.
|
| 141 |
-
*
|
| 142 |
-
* @return bool
|
| 143 |
-
*/
|
| 144 |
-
public function isMagic() : bool {
|
| 145 |
-
return isset(self::$magicNames[$this->name->toLowerString()]);
|
| 146 |
-
}
|
| 147 |
-
|
| 148 |
-
public function getType() : string {
|
| 149 |
-
return 'Stmt_ClassMethod';
|
| 150 |
-
}
|
| 151 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Class_.php
DELETED
|
@@ -1,105 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Error;
|
| 6 |
-
use PhpParser\Node;
|
| 7 |
-
|
| 8 |
-
class Class_ extends ClassLike
|
| 9 |
-
{
|
| 10 |
-
const MODIFIER_PUBLIC = 1;
|
| 11 |
-
const MODIFIER_PROTECTED = 2;
|
| 12 |
-
const MODIFIER_PRIVATE = 4;
|
| 13 |
-
const MODIFIER_STATIC = 8;
|
| 14 |
-
const MODIFIER_ABSTRACT = 16;
|
| 15 |
-
const MODIFIER_FINAL = 32;
|
| 16 |
-
|
| 17 |
-
const VISIBILITY_MODIFIER_MASK = 7; // 1 | 2 | 4
|
| 18 |
-
|
| 19 |
-
/** @var int Type */
|
| 20 |
-
public $flags;
|
| 21 |
-
/** @var null|Node\Name Name of extended class */
|
| 22 |
-
public $extends;
|
| 23 |
-
/** @var Node\Name[] Names of implemented interfaces */
|
| 24 |
-
public $implements;
|
| 25 |
-
|
| 26 |
-
/**
|
| 27 |
-
* Constructs a class node.
|
| 28 |
-
*
|
| 29 |
-
* @param string|Node\Identifier|null $name Name
|
| 30 |
-
* @param array $subNodes Array of the following optional subnodes:
|
| 31 |
-
* 'flags' => 0 : Flags
|
| 32 |
-
* 'extends' => null : Name of extended class
|
| 33 |
-
* 'implements' => array(): Names of implemented interfaces
|
| 34 |
-
* 'stmts' => array(): Statements
|
| 35 |
-
* @param array $attributes Additional attributes
|
| 36 |
-
*/
|
| 37 |
-
public function __construct($name, array $subNodes = [], array $attributes = []) {
|
| 38 |
-
$this->attributes = $attributes;
|
| 39 |
-
$this->flags = $subNodes['flags'] ?? $subNodes['type'] ?? 0;
|
| 40 |
-
$this->name = \is_string($name) ? new Node\Identifier($name) : $name;
|
| 41 |
-
$this->extends = $subNodes['extends'] ?? null;
|
| 42 |
-
$this->implements = $subNodes['implements'] ?? [];
|
| 43 |
-
$this->stmts = $subNodes['stmts'] ?? [];
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
public function getSubNodeNames() : array {
|
| 47 |
-
return ['flags', 'name', 'extends', 'implements', 'stmts'];
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
/**
|
| 51 |
-
* Whether the class is explicitly abstract.
|
| 52 |
-
*
|
| 53 |
-
* @return bool
|
| 54 |
-
*/
|
| 55 |
-
public function isAbstract() : bool {
|
| 56 |
-
return (bool) ($this->flags & self::MODIFIER_ABSTRACT);
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
/**
|
| 60 |
-
* Whether the class is final.
|
| 61 |
-
*
|
| 62 |
-
* @return bool
|
| 63 |
-
*/
|
| 64 |
-
public function isFinal() : bool {
|
| 65 |
-
return (bool) ($this->flags & self::MODIFIER_FINAL);
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
/**
|
| 69 |
-
* Whether the class is anonymous.
|
| 70 |
-
*
|
| 71 |
-
* @return bool
|
| 72 |
-
*/
|
| 73 |
-
public function isAnonymous() : bool {
|
| 74 |
-
return null === $this->name;
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
/**
|
| 78 |
-
* @internal
|
| 79 |
-
*/
|
| 80 |
-
public static function verifyModifier($a, $b) {
|
| 81 |
-
if ($a & self::VISIBILITY_MODIFIER_MASK && $b & self::VISIBILITY_MODIFIER_MASK) {
|
| 82 |
-
throw new Error('Multiple access type modifiers are not allowed');
|
| 83 |
-
}
|
| 84 |
-
|
| 85 |
-
if ($a & self::MODIFIER_ABSTRACT && $b & self::MODIFIER_ABSTRACT) {
|
| 86 |
-
throw new Error('Multiple abstract modifiers are not allowed');
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
if ($a & self::MODIFIER_STATIC && $b & self::MODIFIER_STATIC) {
|
| 90 |
-
throw new Error('Multiple static modifiers are not allowed');
|
| 91 |
-
}
|
| 92 |
-
|
| 93 |
-
if ($a & self::MODIFIER_FINAL && $b & self::MODIFIER_FINAL) {
|
| 94 |
-
throw new Error('Multiple final modifiers are not allowed');
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
if ($a & 48 && $b & 48) {
|
| 98 |
-
throw new Error('Cannot use the final modifier on an abstract class member');
|
| 99 |
-
}
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
public function getType() : string {
|
| 103 |
-
return 'Stmt_Class';
|
| 104 |
-
}
|
| 105 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Const_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Const_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Const_[] Constant declarations */
|
| 10 |
-
public $consts;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a const list node.
|
| 14 |
-
*
|
| 15 |
-
* @param Node\Const_[] $consts Constant declarations
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(array $consts, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->consts = $consts;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['consts'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Stmt_Const';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Continue_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Continue_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var null|Node\Expr Number of loops to continue */
|
| 10 |
-
public $num;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a continue node.
|
| 14 |
-
*
|
| 15 |
-
* @param null|Node\Expr $num Number of loops to continue
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Node\Expr $num = null, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->num = $num;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['num'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Stmt_Continue';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/DeclareDeclare.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class DeclareDeclare extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Identifier Key */
|
| 10 |
-
public $key;
|
| 11 |
-
/** @var Node\Expr Value */
|
| 12 |
-
public $value;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs a declare key=>value pair node.
|
| 16 |
-
*
|
| 17 |
-
* @param string|Node\Identifier $key Key
|
| 18 |
-
* @param Node\Expr $value Value
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct($key, Node\Expr $value, array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->key = \is_string($key) ? new Node\Identifier($key) : $key;
|
| 24 |
-
$this->value = $value;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['key', 'value'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Stmt_DeclareDeclare';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Declare_.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Declare_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var DeclareDeclare[] List of declares */
|
| 10 |
-
public $declares;
|
| 11 |
-
/** @var Node\Stmt[]|null Statements */
|
| 12 |
-
public $stmts;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs a declare node.
|
| 16 |
-
*
|
| 17 |
-
* @param DeclareDeclare[] $declares List of declares
|
| 18 |
-
* @param Node\Stmt[]|null $stmts Statements
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(array $declares, array $stmts = null, array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->declares = $declares;
|
| 24 |
-
$this->stmts = $stmts;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['declares', 'stmts'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Stmt_Declare';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Do_.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Do_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Stmt[] Statements */
|
| 10 |
-
public $stmts;
|
| 11 |
-
/** @var Node\Expr Condition */
|
| 12 |
-
public $cond;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs a do while node.
|
| 16 |
-
*
|
| 17 |
-
* @param Node\Expr $cond Condition
|
| 18 |
-
* @param Node\Stmt[] $stmts Statements
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(Node\Expr $cond, array $stmts = [], array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->cond = $cond;
|
| 24 |
-
$this->stmts = $stmts;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['stmts', 'cond'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Stmt_Do';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Echo_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Echo_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Expr[] Expressions */
|
| 10 |
-
public $exprs;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs an echo node.
|
| 14 |
-
*
|
| 15 |
-
* @param Node\Expr[] $exprs Expressions
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(array $exprs, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->exprs = $exprs;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['exprs'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Stmt_Echo';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/ElseIf_.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class ElseIf_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Expr Condition */
|
| 10 |
-
public $cond;
|
| 11 |
-
/** @var Node\Stmt[] Statements */
|
| 12 |
-
public $stmts;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs an elseif node.
|
| 16 |
-
*
|
| 17 |
-
* @param Node\Expr $cond Condition
|
| 18 |
-
* @param Node\Stmt[] $stmts Statements
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(Node\Expr $cond, array $stmts = [], array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->cond = $cond;
|
| 24 |
-
$this->stmts = $stmts;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['cond', 'stmts'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Stmt_ElseIf';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Else_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Else_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Stmt[] Statements */
|
| 10 |
-
public $stmts;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs an else node.
|
| 14 |
-
*
|
| 15 |
-
* @param Node\Stmt[] $stmts Statements
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(array $stmts = [], array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->stmts = $stmts;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['stmts'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Stmt_Else';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Expression.php
DELETED
|
@@ -1,33 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
/**
|
| 8 |
-
* Represents statements of type "expr;"
|
| 9 |
-
*/
|
| 10 |
-
class Expression extends Node\Stmt
|
| 11 |
-
{
|
| 12 |
-
/** @var Node\Expr Expression */
|
| 13 |
-
public $expr;
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* Constructs an expression statement.
|
| 17 |
-
*
|
| 18 |
-
* @param Node\Expr $expr Expression
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(Node\Expr $expr, array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->expr = $expr;
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
public function getSubNodeNames() : array {
|
| 27 |
-
return ['expr'];
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
public function getType() : string {
|
| 31 |
-
return 'Stmt_Expression';
|
| 32 |
-
}
|
| 33 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Finally_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Finally_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Stmt[] Statements */
|
| 10 |
-
public $stmts;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a finally node.
|
| 14 |
-
*
|
| 15 |
-
* @param Node\Stmt[] $stmts Statements
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(array $stmts = [], array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->stmts = $stmts;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['stmts'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Stmt_Finally';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/For_.php
DELETED
|
@@ -1,43 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class For_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Expr[] Init expressions */
|
| 10 |
-
public $init;
|
| 11 |
-
/** @var Node\Expr[] Loop conditions */
|
| 12 |
-
public $cond;
|
| 13 |
-
/** @var Node\Expr[] Loop expressions */
|
| 14 |
-
public $loop;
|
| 15 |
-
/** @var Node\Stmt[] Statements */
|
| 16 |
-
public $stmts;
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* Constructs a for loop node.
|
| 20 |
-
*
|
| 21 |
-
* @param array $subNodes Array of the following optional subnodes:
|
| 22 |
-
* 'init' => array(): Init expressions
|
| 23 |
-
* 'cond' => array(): Loop conditions
|
| 24 |
-
* 'loop' => array(): Loop expressions
|
| 25 |
-
* 'stmts' => array(): Statements
|
| 26 |
-
* @param array $attributes Additional attributes
|
| 27 |
-
*/
|
| 28 |
-
public function __construct(array $subNodes = [], array $attributes = []) {
|
| 29 |
-
$this->attributes = $attributes;
|
| 30 |
-
$this->init = $subNodes['init'] ?? [];
|
| 31 |
-
$this->cond = $subNodes['cond'] ?? [];
|
| 32 |
-
$this->loop = $subNodes['loop'] ?? [];
|
| 33 |
-
$this->stmts = $subNodes['stmts'] ?? [];
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
public function getSubNodeNames() : array {
|
| 37 |
-
return ['init', 'cond', 'loop', 'stmts'];
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
public function getType() : string {
|
| 41 |
-
return 'Stmt_For';
|
| 42 |
-
}
|
| 43 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Foreach_.php
DELETED
|
@@ -1,47 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Foreach_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Expr Expression to iterate */
|
| 10 |
-
public $expr;
|
| 11 |
-
/** @var null|Node\Expr Variable to assign key to */
|
| 12 |
-
public $keyVar;
|
| 13 |
-
/** @var bool Whether to assign value by reference */
|
| 14 |
-
public $byRef;
|
| 15 |
-
/** @var Node\Expr Variable to assign value to */
|
| 16 |
-
public $valueVar;
|
| 17 |
-
/** @var Node\Stmt[] Statements */
|
| 18 |
-
public $stmts;
|
| 19 |
-
|
| 20 |
-
/**
|
| 21 |
-
* Constructs a foreach node.
|
| 22 |
-
*
|
| 23 |
-
* @param Node\Expr $expr Expression to iterate
|
| 24 |
-
* @param Node\Expr $valueVar Variable to assign value to
|
| 25 |
-
* @param array $subNodes Array of the following optional subnodes:
|
| 26 |
-
* 'keyVar' => null : Variable to assign key to
|
| 27 |
-
* 'byRef' => false : Whether to assign value by reference
|
| 28 |
-
* 'stmts' => array(): Statements
|
| 29 |
-
* @param array $attributes Additional attributes
|
| 30 |
-
*/
|
| 31 |
-
public function __construct(Node\Expr $expr, Node\Expr $valueVar, array $subNodes = [], array $attributes = []) {
|
| 32 |
-
$this->attributes = $attributes;
|
| 33 |
-
$this->expr = $expr;
|
| 34 |
-
$this->keyVar = $subNodes['keyVar'] ?? null;
|
| 35 |
-
$this->byRef = $subNodes['byRef'] ?? false;
|
| 36 |
-
$this->valueVar = $valueVar;
|
| 37 |
-
$this->stmts = $subNodes['stmts'] ?? [];
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
public function getSubNodeNames() : array {
|
| 41 |
-
return ['expr', 'keyVar', 'byRef', 'valueVar', 'stmts'];
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
public function getType() : string {
|
| 45 |
-
return 'Stmt_Foreach';
|
| 46 |
-
}
|
| 47 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Function_.php
DELETED
|
@@ -1,69 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\Node\FunctionLike;
|
| 7 |
-
|
| 8 |
-
/**
|
| 9 |
-
* @property Node\Name $namespacedName Namespaced name (if using NameResolver)
|
| 10 |
-
*/
|
| 11 |
-
class Function_ extends Node\Stmt implements FunctionLike
|
| 12 |
-
{
|
| 13 |
-
/** @var bool Whether function returns by reference */
|
| 14 |
-
public $byRef;
|
| 15 |
-
/** @var Node\Identifier Name */
|
| 16 |
-
public $name;
|
| 17 |
-
/** @var Node\Param[] Parameters */
|
| 18 |
-
public $params;
|
| 19 |
-
/** @var null|Node\Identifier|Node\Name|Node\NullableType|Node\UnionType Return type */
|
| 20 |
-
public $returnType;
|
| 21 |
-
/** @var Node\Stmt[] Statements */
|
| 22 |
-
public $stmts;
|
| 23 |
-
|
| 24 |
-
/**
|
| 25 |
-
* Constructs a function node.
|
| 26 |
-
*
|
| 27 |
-
* @param string|Node\Identifier $name Name
|
| 28 |
-
* @param array $subNodes Array of the following optional subnodes:
|
| 29 |
-
* 'byRef' => false : Whether to return by reference
|
| 30 |
-
* 'params' => array(): Parameters
|
| 31 |
-
* 'returnType' => null : Return type
|
| 32 |
-
* 'stmts' => array(): Statements
|
| 33 |
-
* @param array $attributes Additional attributes
|
| 34 |
-
*/
|
| 35 |
-
public function __construct($name, array $subNodes = [], array $attributes = []) {
|
| 36 |
-
$this->attributes = $attributes;
|
| 37 |
-
$this->byRef = $subNodes['byRef'] ?? false;
|
| 38 |
-
$this->name = \is_string($name) ? new Node\Identifier($name) : $name;
|
| 39 |
-
$this->params = $subNodes['params'] ?? [];
|
| 40 |
-
$returnType = $subNodes['returnType'] ?? null;
|
| 41 |
-
$this->returnType = \is_string($returnType) ? new Node\Identifier($returnType) : $returnType;
|
| 42 |
-
$this->stmts = $subNodes['stmts'] ?? [];
|
| 43 |
-
}
|
| 44 |
-
|
| 45 |
-
public function getSubNodeNames() : array {
|
| 46 |
-
return ['byRef', 'name', 'params', 'returnType', 'stmts'];
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
public function returnsByRef() : bool {
|
| 50 |
-
return $this->byRef;
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
public function getParams() : array {
|
| 54 |
-
return $this->params;
|
| 55 |
-
}
|
| 56 |
-
|
| 57 |
-
public function getReturnType() {
|
| 58 |
-
return $this->returnType;
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
/** @return Node\Stmt[] */
|
| 62 |
-
public function getStmts() : array {
|
| 63 |
-
return $this->stmts;
|
| 64 |
-
}
|
| 65 |
-
|
| 66 |
-
public function getType() : string {
|
| 67 |
-
return 'Stmt_Function';
|
| 68 |
-
}
|
| 69 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Global_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Global_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Expr[] Variables */
|
| 10 |
-
public $vars;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a global variables list node.
|
| 14 |
-
*
|
| 15 |
-
* @param Node\Expr[] $vars Variables to unset
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(array $vars, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->vars = $vars;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['vars'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Stmt_Global';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Goto_.php
DELETED
|
@@ -1,31 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Identifier;
|
| 6 |
-
use PhpParser\Node\Stmt;
|
| 7 |
-
|
| 8 |
-
class Goto_ extends Stmt
|
| 9 |
-
{
|
| 10 |
-
/** @var Identifier Name of label to jump to */
|
| 11 |
-
public $name;
|
| 12 |
-
|
| 13 |
-
/**
|
| 14 |
-
* Constructs a goto node.
|
| 15 |
-
*
|
| 16 |
-
* @param string|Identifier $name Name of label to jump to
|
| 17 |
-
* @param array $attributes Additional attributes
|
| 18 |
-
*/
|
| 19 |
-
public function __construct($name, array $attributes = []) {
|
| 20 |
-
$this->attributes = $attributes;
|
| 21 |
-
$this->name = \is_string($name) ? new Identifier($name) : $name;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
public function getSubNodeNames() : array {
|
| 25 |
-
return ['name'];
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function getType() : string {
|
| 29 |
-
return 'Stmt_Goto';
|
| 30 |
-
}
|
| 31 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/GroupUse.php
DELETED
|
@@ -1,39 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Name;
|
| 6 |
-
use PhpParser\Node\Stmt;
|
| 7 |
-
|
| 8 |
-
class GroupUse extends Stmt
|
| 9 |
-
{
|
| 10 |
-
/** @var int Type of group use */
|
| 11 |
-
public $type;
|
| 12 |
-
/** @var Name Prefix for uses */
|
| 13 |
-
public $prefix;
|
| 14 |
-
/** @var UseUse[] Uses */
|
| 15 |
-
public $uses;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* Constructs a group use node.
|
| 19 |
-
*
|
| 20 |
-
* @param Name $prefix Prefix for uses
|
| 21 |
-
* @param UseUse[] $uses Uses
|
| 22 |
-
* @param int $type Type of group use
|
| 23 |
-
* @param array $attributes Additional attributes
|
| 24 |
-
*/
|
| 25 |
-
public function __construct(Name $prefix, array $uses, int $type = Use_::TYPE_NORMAL, array $attributes = []) {
|
| 26 |
-
$this->attributes = $attributes;
|
| 27 |
-
$this->type = $type;
|
| 28 |
-
$this->prefix = $prefix;
|
| 29 |
-
$this->uses = $uses;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
public function getSubNodeNames() : array {
|
| 33 |
-
return ['type', 'prefix', 'uses'];
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
public function getType() : string {
|
| 37 |
-
return 'Stmt_GroupUse';
|
| 38 |
-
}
|
| 39 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/HaltCompiler.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Stmt;
|
| 6 |
-
|
| 7 |
-
class HaltCompiler extends Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var string Remaining text after halt compiler statement. */
|
| 10 |
-
public $remaining;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a __halt_compiler node.
|
| 14 |
-
*
|
| 15 |
-
* @param string $remaining Remaining text after halt compiler statement.
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(string $remaining, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->remaining = $remaining;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['remaining'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Stmt_HaltCompiler';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/If_.php
DELETED
|
@@ -1,43 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class If_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Expr Condition expression */
|
| 10 |
-
public $cond;
|
| 11 |
-
/** @var Node\Stmt[] Statements */
|
| 12 |
-
public $stmts;
|
| 13 |
-
/** @var ElseIf_[] Elseif clauses */
|
| 14 |
-
public $elseifs;
|
| 15 |
-
/** @var null|Else_ Else clause */
|
| 16 |
-
public $else;
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* Constructs an if node.
|
| 20 |
-
*
|
| 21 |
-
* @param Node\Expr $cond Condition
|
| 22 |
-
* @param array $subNodes Array of the following optional subnodes:
|
| 23 |
-
* 'stmts' => array(): Statements
|
| 24 |
-
* 'elseifs' => array(): Elseif clauses
|
| 25 |
-
* 'else' => null : Else clause
|
| 26 |
-
* @param array $attributes Additional attributes
|
| 27 |
-
*/
|
| 28 |
-
public function __construct(Node\Expr $cond, array $subNodes = [], array $attributes = []) {
|
| 29 |
-
$this->attributes = $attributes;
|
| 30 |
-
$this->cond = $cond;
|
| 31 |
-
$this->stmts = $subNodes['stmts'] ?? [];
|
| 32 |
-
$this->elseifs = $subNodes['elseifs'] ?? [];
|
| 33 |
-
$this->else = $subNodes['else'] ?? null;
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
public function getSubNodeNames() : array {
|
| 37 |
-
return ['cond', 'stmts', 'elseifs', 'else'];
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
public function getType() : string {
|
| 41 |
-
return 'Stmt_If';
|
| 42 |
-
}
|
| 43 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/InlineHTML.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Stmt;
|
| 6 |
-
|
| 7 |
-
class InlineHTML extends Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var string String */
|
| 10 |
-
public $value;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs an inline HTML node.
|
| 14 |
-
*
|
| 15 |
-
* @param string $value String
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(string $value, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->value = $value;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['value'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Stmt_InlineHTML';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Interface_.php
DELETED
|
@@ -1,35 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Interface_ extends ClassLike
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Name[] Extended interfaces */
|
| 10 |
-
public $extends;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a class node.
|
| 14 |
-
*
|
| 15 |
-
* @param string|Node\Identifier $name Name
|
| 16 |
-
* @param array $subNodes Array of the following optional subnodes:
|
| 17 |
-
* 'extends' => array(): Name of extended interfaces
|
| 18 |
-
* 'stmts' => array(): Statements
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct($name, array $subNodes = [], array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->name = \is_string($name) ? new Node\Identifier($name) : $name;
|
| 24 |
-
$this->extends = $subNodes['extends'] ?? [];
|
| 25 |
-
$this->stmts = $subNodes['stmts'] ?? [];
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function getSubNodeNames() : array {
|
| 29 |
-
return ['name', 'extends', 'stmts'];
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
public function getType() : string {
|
| 33 |
-
return 'Stmt_Interface';
|
| 34 |
-
}
|
| 35 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Label.php
DELETED
|
@@ -1,31 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Identifier;
|
| 6 |
-
use PhpParser\Node\Stmt;
|
| 7 |
-
|
| 8 |
-
class Label extends Stmt
|
| 9 |
-
{
|
| 10 |
-
/** @var Identifier Name */
|
| 11 |
-
public $name;
|
| 12 |
-
|
| 13 |
-
/**
|
| 14 |
-
* Constructs a label node.
|
| 15 |
-
*
|
| 16 |
-
* @param string|Identifier $name Name
|
| 17 |
-
* @param array $attributes Additional attributes
|
| 18 |
-
*/
|
| 19 |
-
public function __construct($name, array $attributes = []) {
|
| 20 |
-
$this->attributes = $attributes;
|
| 21 |
-
$this->name = \is_string($name) ? new Identifier($name) : $name;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
public function getSubNodeNames() : array {
|
| 25 |
-
return ['name'];
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
public function getType() : string {
|
| 29 |
-
return 'Stmt_Label';
|
| 30 |
-
}
|
| 31 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Namespace_.php
DELETED
|
@@ -1,38 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Namespace_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/* For use in the "kind" attribute */
|
| 10 |
-
const KIND_SEMICOLON = 1;
|
| 11 |
-
const KIND_BRACED = 2;
|
| 12 |
-
|
| 13 |
-
/** @var null|Node\Name Name */
|
| 14 |
-
public $name;
|
| 15 |
-
/** @var Node\Stmt[] Statements */
|
| 16 |
-
public $stmts;
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* Constructs a namespace node.
|
| 20 |
-
*
|
| 21 |
-
* @param null|Node\Name $name Name
|
| 22 |
-
* @param null|Node\Stmt[] $stmts Statements
|
| 23 |
-
* @param array $attributes Additional attributes
|
| 24 |
-
*/
|
| 25 |
-
public function __construct(Node\Name $name = null, $stmts = [], array $attributes = []) {
|
| 26 |
-
$this->attributes = $attributes;
|
| 27 |
-
$this->name = $name;
|
| 28 |
-
$this->stmts = $stmts;
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getSubNodeNames() : array {
|
| 32 |
-
return ['name', 'stmts'];
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
public function getType() : string {
|
| 36 |
-
return 'Stmt_Namespace';
|
| 37 |
-
}
|
| 38 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Nop.php
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
/** Nop/empty statement (;). */
|
| 8 |
-
class Nop extends Node\Stmt
|
| 9 |
-
{
|
| 10 |
-
public function getSubNodeNames() : array {
|
| 11 |
-
return [];
|
| 12 |
-
}
|
| 13 |
-
|
| 14 |
-
public function getType() : string {
|
| 15 |
-
return 'Stmt_Nop';
|
| 16 |
-
}
|
| 17 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Property.php
DELETED
|
@@ -1,79 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\Node\Identifier;
|
| 7 |
-
use PhpParser\Node\Name;
|
| 8 |
-
use PhpParser\Node\NullableType;
|
| 9 |
-
use PhpParser\Node\UnionType;
|
| 10 |
-
|
| 11 |
-
class Property extends Node\Stmt
|
| 12 |
-
{
|
| 13 |
-
/** @var int Modifiers */
|
| 14 |
-
public $flags;
|
| 15 |
-
/** @var PropertyProperty[] Properties */
|
| 16 |
-
public $props;
|
| 17 |
-
/** @var null|Identifier|Name|NullableType|UnionType Type declaration */
|
| 18 |
-
public $type;
|
| 19 |
-
|
| 20 |
-
/**
|
| 21 |
-
* Constructs a class property list node.
|
| 22 |
-
*
|
| 23 |
-
* @param int $flags Modifiers
|
| 24 |
-
* @param PropertyProperty[] $props Properties
|
| 25 |
-
* @param array $attributes Additional attributes
|
| 26 |
-
* @param null|string|Identifier|Name|NullableType|UnionType $type Type declaration
|
| 27 |
-
*/
|
| 28 |
-
public function __construct(int $flags, array $props, array $attributes = [], $type = null) {
|
| 29 |
-
$this->attributes = $attributes;
|
| 30 |
-
$this->flags = $flags;
|
| 31 |
-
$this->props = $props;
|
| 32 |
-
$this->type = \is_string($type) ? new Identifier($type) : $type;
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
public function getSubNodeNames() : array {
|
| 36 |
-
return ['flags', 'type', 'props'];
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
/**
|
| 40 |
-
* Whether the property is explicitly or implicitly public.
|
| 41 |
-
*
|
| 42 |
-
* @return bool
|
| 43 |
-
*/
|
| 44 |
-
public function isPublic() : bool {
|
| 45 |
-
return ($this->flags & Class_::MODIFIER_PUBLIC) !== 0
|
| 46 |
-
|| ($this->flags & Class_::VISIBILITY_MODIFIER_MASK) === 0;
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
/**
|
| 50 |
-
* Whether the property is protected.
|
| 51 |
-
*
|
| 52 |
-
* @return bool
|
| 53 |
-
*/
|
| 54 |
-
public function isProtected() : bool {
|
| 55 |
-
return (bool) ($this->flags & Class_::MODIFIER_PROTECTED);
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
/**
|
| 59 |
-
* Whether the property is private.
|
| 60 |
-
*
|
| 61 |
-
* @return bool
|
| 62 |
-
*/
|
| 63 |
-
public function isPrivate() : bool {
|
| 64 |
-
return (bool) ($this->flags & Class_::MODIFIER_PRIVATE);
|
| 65 |
-
}
|
| 66 |
-
|
| 67 |
-
/**
|
| 68 |
-
* Whether the property is static.
|
| 69 |
-
*
|
| 70 |
-
* @return bool
|
| 71 |
-
*/
|
| 72 |
-
public function isStatic() : bool {
|
| 73 |
-
return (bool) ($this->flags & Class_::MODIFIER_STATIC);
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
public function getType() : string {
|
| 77 |
-
return 'Stmt_Property';
|
| 78 |
-
}
|
| 79 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/PropertyProperty.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class PropertyProperty extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\VarLikeIdentifier Name */
|
| 10 |
-
public $name;
|
| 11 |
-
/** @var null|Node\Expr Default */
|
| 12 |
-
public $default;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs a class property node.
|
| 16 |
-
*
|
| 17 |
-
* @param string|Node\VarLikeIdentifier $name Name
|
| 18 |
-
* @param null|Node\Expr $default Default value
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct($name, Node\Expr $default = null, array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->name = \is_string($name) ? new Node\VarLikeIdentifier($name) : $name;
|
| 24 |
-
$this->default = $default;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['name', 'default'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Stmt_PropertyProperty';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Return_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Return_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var null|Node\Expr Expression */
|
| 10 |
-
public $expr;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a return node.
|
| 14 |
-
*
|
| 15 |
-
* @param null|Node\Expr $expr Expression
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Node\Expr $expr = null, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->expr = $expr;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['expr'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Stmt_Return';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/StaticVar.php
DELETED
|
@@ -1,37 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\Node\Expr;
|
| 7 |
-
|
| 8 |
-
class StaticVar extends Node\Stmt
|
| 9 |
-
{
|
| 10 |
-
/** @var Expr\Variable Variable */
|
| 11 |
-
public $var;
|
| 12 |
-
/** @var null|Node\Expr Default value */
|
| 13 |
-
public $default;
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* Constructs a static variable node.
|
| 17 |
-
*
|
| 18 |
-
* @param Expr\Variable $var Name
|
| 19 |
-
* @param null|Node\Expr $default Default value
|
| 20 |
-
* @param array $attributes Additional attributes
|
| 21 |
-
*/
|
| 22 |
-
public function __construct(
|
| 23 |
-
Expr\Variable $var, Node\Expr $default = null, array $attributes = []
|
| 24 |
-
) {
|
| 25 |
-
$this->attributes = $attributes;
|
| 26 |
-
$this->var = $var;
|
| 27 |
-
$this->default = $default;
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
public function getSubNodeNames() : array {
|
| 31 |
-
return ['var', 'default'];
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
public function getType() : string {
|
| 35 |
-
return 'Stmt_StaticVar';
|
| 36 |
-
}
|
| 37 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Static_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Stmt;
|
| 6 |
-
|
| 7 |
-
class Static_ extends Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var StaticVar[] Variable definitions */
|
| 10 |
-
public $vars;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a static variables list node.
|
| 14 |
-
*
|
| 15 |
-
* @param StaticVar[] $vars Variable definitions
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(array $vars, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->vars = $vars;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['vars'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Stmt_Static';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Switch_.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Switch_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Expr Condition */
|
| 10 |
-
public $cond;
|
| 11 |
-
/** @var Case_[] Case list */
|
| 12 |
-
public $cases;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs a case node.
|
| 16 |
-
*
|
| 17 |
-
* @param Node\Expr $cond Condition
|
| 18 |
-
* @param Case_[] $cases Case list
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(Node\Expr $cond, array $cases, array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->cond = $cond;
|
| 24 |
-
$this->cases = $cases;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['cond', 'cases'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Stmt_Switch';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Throw_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Throw_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Expr Expression */
|
| 10 |
-
public $expr;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a throw node.
|
| 14 |
-
*
|
| 15 |
-
* @param Node\Expr $expr Expression
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(Node\Expr $expr, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->expr = $expr;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['expr'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Stmt_Throw';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/TraitUse.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class TraitUse extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Name[] Traits */
|
| 10 |
-
public $traits;
|
| 11 |
-
/** @var TraitUseAdaptation[] Adaptations */
|
| 12 |
-
public $adaptations;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs a trait use node.
|
| 16 |
-
*
|
| 17 |
-
* @param Node\Name[] $traits Traits
|
| 18 |
-
* @param TraitUseAdaptation[] $adaptations Adaptations
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(array $traits, array $adaptations = [], array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->traits = $traits;
|
| 24 |
-
$this->adaptations = $adaptations;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['traits', 'adaptations'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Stmt_TraitUse';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/TraitUseAdaptation.php
DELETED
|
@@ -1,13 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
abstract class TraitUseAdaptation extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Name|null Trait name */
|
| 10 |
-
public $trait;
|
| 11 |
-
/** @var Node\Identifier Method name */
|
| 12 |
-
public $method;
|
| 13 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/TraitUseAdaptation/Alias.php
DELETED
|
@@ -1,38 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt\TraitUseAdaptation;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Alias extends Node\Stmt\TraitUseAdaptation
|
| 8 |
-
{
|
| 9 |
-
/** @var null|int New modifier */
|
| 10 |
-
public $newModifier;
|
| 11 |
-
/** @var null|Node\Identifier New name */
|
| 12 |
-
public $newName;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs a trait use precedence adaptation node.
|
| 16 |
-
*
|
| 17 |
-
* @param null|Node\Name $trait Trait name
|
| 18 |
-
* @param string|Node\Identifier $method Method name
|
| 19 |
-
* @param null|int $newModifier New modifier
|
| 20 |
-
* @param null|string|Node\Identifier $newName New name
|
| 21 |
-
* @param array $attributes Additional attributes
|
| 22 |
-
*/
|
| 23 |
-
public function __construct($trait, $method, $newModifier, $newName, array $attributes = []) {
|
| 24 |
-
$this->attributes = $attributes;
|
| 25 |
-
$this->trait = $trait;
|
| 26 |
-
$this->method = \is_string($method) ? new Node\Identifier($method) : $method;
|
| 27 |
-
$this->newModifier = $newModifier;
|
| 28 |
-
$this->newName = \is_string($newName) ? new Node\Identifier($newName) : $newName;
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getSubNodeNames() : array {
|
| 32 |
-
return ['trait', 'method', 'newModifier', 'newName'];
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
public function getType() : string {
|
| 36 |
-
return 'Stmt_TraitUseAdaptation_Alias';
|
| 37 |
-
}
|
| 38 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/TraitUseAdaptation/Precedence.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt\TraitUseAdaptation;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Precedence extends Node\Stmt\TraitUseAdaptation
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Name[] Overwritten traits */
|
| 10 |
-
public $insteadof;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a trait use precedence adaptation node.
|
| 14 |
-
*
|
| 15 |
-
* @param Node\Name $trait Trait name
|
| 16 |
-
* @param string|Node\Identifier $method Method name
|
| 17 |
-
* @param Node\Name[] $insteadof Overwritten traits
|
| 18 |
-
* @param array $attributes Additional attributes
|
| 19 |
-
*/
|
| 20 |
-
public function __construct(Node\Name $trait, $method, array $insteadof, array $attributes = []) {
|
| 21 |
-
$this->attributes = $attributes;
|
| 22 |
-
$this->trait = $trait;
|
| 23 |
-
$this->method = \is_string($method) ? new Node\Identifier($method) : $method;
|
| 24 |
-
$this->insteadof = $insteadof;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['trait', 'method', 'insteadof'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Stmt_TraitUseAdaptation_Precedence';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Trait_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Trait_ extends ClassLike
|
| 8 |
-
{
|
| 9 |
-
/**
|
| 10 |
-
* Constructs a trait node.
|
| 11 |
-
*
|
| 12 |
-
* @param string|Node\Identifier $name Name
|
| 13 |
-
* @param array $subNodes Array of the following optional subnodes:
|
| 14 |
-
* 'stmts' => array(): Statements
|
| 15 |
-
* @param array $attributes Additional attributes
|
| 16 |
-
*/
|
| 17 |
-
public function __construct($name, array $subNodes = [], array $attributes = []) {
|
| 18 |
-
$this->attributes = $attributes;
|
| 19 |
-
$this->name = \is_string($name) ? new Node\Identifier($name) : $name;
|
| 20 |
-
$this->stmts = $subNodes['stmts'] ?? [];
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['name', 'stmts'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Stmt_Trait';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/TryCatch.php
DELETED
|
@@ -1,38 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class TryCatch extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Stmt[] Statements */
|
| 10 |
-
public $stmts;
|
| 11 |
-
/** @var Catch_[] Catches */
|
| 12 |
-
public $catches;
|
| 13 |
-
/** @var null|Finally_ Optional finally node */
|
| 14 |
-
public $finally;
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* Constructs a try catch node.
|
| 18 |
-
*
|
| 19 |
-
* @param Node\Stmt[] $stmts Statements
|
| 20 |
-
* @param Catch_[] $catches Catches
|
| 21 |
-
* @param null|Finally_ $finally Optional finally node
|
| 22 |
-
* @param array $attributes Additional attributes
|
| 23 |
-
*/
|
| 24 |
-
public function __construct(array $stmts, array $catches, Finally_ $finally = null, array $attributes = []) {
|
| 25 |
-
$this->attributes = $attributes;
|
| 26 |
-
$this->stmts = $stmts;
|
| 27 |
-
$this->catches = $catches;
|
| 28 |
-
$this->finally = $finally;
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getSubNodeNames() : array {
|
| 32 |
-
return ['stmts', 'catches', 'finally'];
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
public function getType() : string {
|
| 36 |
-
return 'Stmt_TryCatch';
|
| 37 |
-
}
|
| 38 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Unset_.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class Unset_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Expr[] Variables to unset */
|
| 10 |
-
public $vars;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs an unset node.
|
| 14 |
-
*
|
| 15 |
-
* @param Node\Expr[] $vars Variables to unset
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(array $vars, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->vars = $vars;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['vars'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'Stmt_Unset';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/UseUse.php
DELETED
|
@@ -1,52 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\Node\Identifier;
|
| 7 |
-
|
| 8 |
-
class UseUse extends Node\Stmt
|
| 9 |
-
{
|
| 10 |
-
/** @var int One of the Stmt\Use_::TYPE_* constants. Will only differ from TYPE_UNKNOWN for mixed group uses */
|
| 11 |
-
public $type;
|
| 12 |
-
/** @var Node\Name Namespace, class, function or constant to alias */
|
| 13 |
-
public $name;
|
| 14 |
-
/** @var Identifier|null Alias */
|
| 15 |
-
public $alias;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* Constructs an alias (use) node.
|
| 19 |
-
*
|
| 20 |
-
* @param Node\Name $name Namespace/Class to alias
|
| 21 |
-
* @param null|string|Identifier $alias Alias
|
| 22 |
-
* @param int $type Type of the use element (for mixed group use only)
|
| 23 |
-
* @param array $attributes Additional attributes
|
| 24 |
-
*/
|
| 25 |
-
public function __construct(Node\Name $name, $alias = null, int $type = Use_::TYPE_UNKNOWN, array $attributes = []) {
|
| 26 |
-
$this->attributes = $attributes;
|
| 27 |
-
$this->type = $type;
|
| 28 |
-
$this->name = $name;
|
| 29 |
-
$this->alias = \is_string($alias) ? new Identifier($alias) : $alias;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
public function getSubNodeNames() : array {
|
| 33 |
-
return ['type', 'name', 'alias'];
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* Get alias. If not explicitly given this is the last component of the used name.
|
| 38 |
-
*
|
| 39 |
-
* @return Identifier
|
| 40 |
-
*/
|
| 41 |
-
public function getAlias() : Identifier {
|
| 42 |
-
if (null !== $this->alias) {
|
| 43 |
-
return $this->alias;
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
return new Identifier($this->name->getLast());
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
public function getType() : string {
|
| 50 |
-
return 'Stmt_UseUse';
|
| 51 |
-
}
|
| 52 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/Use_.php
DELETED
|
@@ -1,47 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Stmt;
|
| 6 |
-
|
| 7 |
-
class Use_ extends Stmt
|
| 8 |
-
{
|
| 9 |
-
/**
|
| 10 |
-
* Unknown type. Both Stmt\Use_ / Stmt\GroupUse and Stmt\UseUse have a $type property, one of them will always be
|
| 11 |
-
* TYPE_UNKNOWN while the other has one of the three other possible types. For normal use statements the type on the
|
| 12 |
-
* Stmt\UseUse is unknown. It's only the other way around for mixed group use declarations.
|
| 13 |
-
*/
|
| 14 |
-
const TYPE_UNKNOWN = 0;
|
| 15 |
-
/** Class or namespace import */
|
| 16 |
-
const TYPE_NORMAL = 1;
|
| 17 |
-
/** Function import */
|
| 18 |
-
const TYPE_FUNCTION = 2;
|
| 19 |
-
/** Constant import */
|
| 20 |
-
const TYPE_CONSTANT = 3;
|
| 21 |
-
|
| 22 |
-
/** @var int Type of alias */
|
| 23 |
-
public $type;
|
| 24 |
-
/** @var UseUse[] Aliases */
|
| 25 |
-
public $uses;
|
| 26 |
-
|
| 27 |
-
/**
|
| 28 |
-
* Constructs an alias (use) list node.
|
| 29 |
-
*
|
| 30 |
-
* @param UseUse[] $uses Aliases
|
| 31 |
-
* @param int $type Type of alias
|
| 32 |
-
* @param array $attributes Additional attributes
|
| 33 |
-
*/
|
| 34 |
-
public function __construct(array $uses, int $type = self::TYPE_NORMAL, array $attributes = []) {
|
| 35 |
-
$this->attributes = $attributes;
|
| 36 |
-
$this->type = $type;
|
| 37 |
-
$this->uses = $uses;
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
public function getSubNodeNames() : array {
|
| 41 |
-
return ['type', 'uses'];
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
public function getType() : string {
|
| 45 |
-
return 'Stmt_Use';
|
| 46 |
-
}
|
| 47 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/Stmt/While_.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node\Stmt;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
|
| 7 |
-
class While_ extends Node\Stmt
|
| 8 |
-
{
|
| 9 |
-
/** @var Node\Expr Condition */
|
| 10 |
-
public $cond;
|
| 11 |
-
/** @var Node\Stmt[] Statements */
|
| 12 |
-
public $stmts;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Constructs a while node.
|
| 16 |
-
*
|
| 17 |
-
* @param Node\Expr $cond Condition
|
| 18 |
-
* @param Node\Stmt[] $stmts Statements
|
| 19 |
-
* @param array $attributes Additional attributes
|
| 20 |
-
*/
|
| 21 |
-
public function __construct(Node\Expr $cond, array $stmts = [], array $attributes = []) {
|
| 22 |
-
$this->attributes = $attributes;
|
| 23 |
-
$this->cond = $cond;
|
| 24 |
-
$this->stmts = $stmts;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getSubNodeNames() : array {
|
| 28 |
-
return ['cond', 'stmts'];
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
public function getType() : string {
|
| 32 |
-
return 'Stmt_While';
|
| 33 |
-
}
|
| 34 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/UnionType.php
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node;
|
| 4 |
-
|
| 5 |
-
use PhpParser\NodeAbstract;
|
| 6 |
-
|
| 7 |
-
class UnionType extends NodeAbstract
|
| 8 |
-
{
|
| 9 |
-
/** @var (Identifier|Name)[] Types */
|
| 10 |
-
public $types;
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Constructs a union type.
|
| 14 |
-
*
|
| 15 |
-
* @param (Identifier|Name)[] $types Types
|
| 16 |
-
* @param array $attributes Additional attributes
|
| 17 |
-
*/
|
| 18 |
-
public function __construct(array $types, array $attributes = []) {
|
| 19 |
-
$this->attributes = $attributes;
|
| 20 |
-
$this->types = $types;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
public function getSubNodeNames() : array {
|
| 24 |
-
return ['types'];
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function getType() : string {
|
| 28 |
-
return 'UnionType';
|
| 29 |
-
}
|
| 30 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Node/VarLikeIdentifier.php
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Node;
|
| 4 |
-
|
| 5 |
-
/**
|
| 6 |
-
* Represents a name that is written in source code with a leading dollar,
|
| 7 |
-
* but is not a proper variable. The leading dollar is not stored as part of the name.
|
| 8 |
-
*
|
| 9 |
-
* Examples: Names in property declarations are formatted as variables. Names in static property
|
| 10 |
-
* lookups are also formatted as variables.
|
| 11 |
-
*/
|
| 12 |
-
class VarLikeIdentifier extends Identifier
|
| 13 |
-
{
|
| 14 |
-
public function getType() : string {
|
| 15 |
-
return 'VarLikeIdentifier';
|
| 16 |
-
}
|
| 17 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/NodeAbstract.php
DELETED
|
@@ -1,178 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
abstract class NodeAbstract implements Node, \JsonSerializable
|
| 6 |
-
{
|
| 7 |
-
protected $attributes;
|
| 8 |
-
|
| 9 |
-
/**
|
| 10 |
-
* Creates a Node.
|
| 11 |
-
*
|
| 12 |
-
* @param array $attributes Array of attributes
|
| 13 |
-
*/
|
| 14 |
-
public function __construct(array $attributes = []) {
|
| 15 |
-
$this->attributes = $attributes;
|
| 16 |
-
}
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* Gets line the node started in (alias of getStartLine).
|
| 20 |
-
*
|
| 21 |
-
* @return int Start line (or -1 if not available)
|
| 22 |
-
*/
|
| 23 |
-
public function getLine() : int {
|
| 24 |
-
return $this->attributes['startLine'] ?? -1;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
/**
|
| 28 |
-
* Gets line the node started in.
|
| 29 |
-
*
|
| 30 |
-
* Requires the 'startLine' attribute to be enabled in the lexer (enabled by default).
|
| 31 |
-
*
|
| 32 |
-
* @return int Start line (or -1 if not available)
|
| 33 |
-
*/
|
| 34 |
-
public function getStartLine() : int {
|
| 35 |
-
return $this->attributes['startLine'] ?? -1;
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
/**
|
| 39 |
-
* Gets the line the node ended in.
|
| 40 |
-
*
|
| 41 |
-
* Requires the 'endLine' attribute to be enabled in the lexer (enabled by default).
|
| 42 |
-
*
|
| 43 |
-
* @return int End line (or -1 if not available)
|
| 44 |
-
*/
|
| 45 |
-
public function getEndLine() : int {
|
| 46 |
-
return $this->attributes['endLine'] ?? -1;
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
/**
|
| 50 |
-
* Gets the token offset of the first token that is part of this node.
|
| 51 |
-
*
|
| 52 |
-
* The offset is an index into the array returned by Lexer::getTokens().
|
| 53 |
-
*
|
| 54 |
-
* Requires the 'startTokenPos' attribute to be enabled in the lexer (DISABLED by default).
|
| 55 |
-
*
|
| 56 |
-
* @return int Token start position (or -1 if not available)
|
| 57 |
-
*/
|
| 58 |
-
public function getStartTokenPos() : int {
|
| 59 |
-
return $this->attributes['startTokenPos'] ?? -1;
|
| 60 |
-
}
|
| 61 |
-
|
| 62 |
-
/**
|
| 63 |
-
* Gets the token offset of the last token that is part of this node.
|
| 64 |
-
*
|
| 65 |
-
* The offset is an index into the array returned by Lexer::getTokens().
|
| 66 |
-
*
|
| 67 |
-
* Requires the 'endTokenPos' attribute to be enabled in the lexer (DISABLED by default).
|
| 68 |
-
*
|
| 69 |
-
* @return int Token end position (or -1 if not available)
|
| 70 |
-
*/
|
| 71 |
-
public function getEndTokenPos() : int {
|
| 72 |
-
return $this->attributes['endTokenPos'] ?? -1;
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
/**
|
| 76 |
-
* Gets the file offset of the first character that is part of this node.
|
| 77 |
-
*
|
| 78 |
-
* Requires the 'startFilePos' attribute to be enabled in the lexer (DISABLED by default).
|
| 79 |
-
*
|
| 80 |
-
* @return int File start position (or -1 if not available)
|
| 81 |
-
*/
|
| 82 |
-
public function getStartFilePos() : int {
|
| 83 |
-
return $this->attributes['startFilePos'] ?? -1;
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
/**
|
| 87 |
-
* Gets the file offset of the last character that is part of this node.
|
| 88 |
-
*
|
| 89 |
-
* Requires the 'endFilePos' attribute to be enabled in the lexer (DISABLED by default).
|
| 90 |
-
*
|
| 91 |
-
* @return int File end position (or -1 if not available)
|
| 92 |
-
*/
|
| 93 |
-
public function getEndFilePos() : int {
|
| 94 |
-
return $this->attributes['endFilePos'] ?? -1;
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
/**
|
| 98 |
-
* Gets all comments directly preceding this node.
|
| 99 |
-
*
|
| 100 |
-
* The comments are also available through the "comments" attribute.
|
| 101 |
-
*
|
| 102 |
-
* @return Comment[]
|
| 103 |
-
*/
|
| 104 |
-
public function getComments() : array {
|
| 105 |
-
return $this->attributes['comments'] ?? [];
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
/**
|
| 109 |
-
* Gets the doc comment of the node.
|
| 110 |
-
*
|
| 111 |
-
* @return null|Comment\Doc Doc comment object or null
|
| 112 |
-
*/
|
| 113 |
-
public function getDocComment() {
|
| 114 |
-
$comments = $this->getComments();
|
| 115 |
-
for ($i = count($comments) - 1; $i >= 0; $i--) {
|
| 116 |
-
$comment = $comments[$i];
|
| 117 |
-
if ($comment instanceof Comment\Doc) {
|
| 118 |
-
return $comment;
|
| 119 |
-
}
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
return null;
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
/**
|
| 126 |
-
* Sets the doc comment of the node.
|
| 127 |
-
*
|
| 128 |
-
* This will either replace an existing doc comment or add it to the comments array.
|
| 129 |
-
*
|
| 130 |
-
* @param Comment\Doc $docComment Doc comment to set
|
| 131 |
-
*/
|
| 132 |
-
public function setDocComment(Comment\Doc $docComment) {
|
| 133 |
-
$comments = $this->getComments();
|
| 134 |
-
for ($i = count($comments) - 1; $i >= 0; $i--) {
|
| 135 |
-
if ($comments[$i] instanceof Comment\Doc) {
|
| 136 |
-
// Replace existing doc comment.
|
| 137 |
-
$comments[$i] = $docComment;
|
| 138 |
-
$this->setAttribute('comments', $comments);
|
| 139 |
-
return;
|
| 140 |
-
}
|
| 141 |
-
}
|
| 142 |
-
|
| 143 |
-
// Append new doc comment.
|
| 144 |
-
$comments[] = $docComment;
|
| 145 |
-
$this->setAttribute('comments', $comments);
|
| 146 |
-
}
|
| 147 |
-
|
| 148 |
-
public function setAttribute(string $key, $value) {
|
| 149 |
-
$this->attributes[$key] = $value;
|
| 150 |
-
}
|
| 151 |
-
|
| 152 |
-
public function hasAttribute(string $key) : bool {
|
| 153 |
-
return array_key_exists($key, $this->attributes);
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
public function getAttribute(string $key, $default = null) {
|
| 157 |
-
if (array_key_exists($key, $this->attributes)) {
|
| 158 |
-
return $this->attributes[$key];
|
| 159 |
-
}
|
| 160 |
-
|
| 161 |
-
return $default;
|
| 162 |
-
}
|
| 163 |
-
|
| 164 |
-
public function getAttributes() : array {
|
| 165 |
-
return $this->attributes;
|
| 166 |
-
}
|
| 167 |
-
|
| 168 |
-
public function setAttributes(array $attributes) {
|
| 169 |
-
$this->attributes = $attributes;
|
| 170 |
-
}
|
| 171 |
-
|
| 172 |
-
/**
|
| 173 |
-
* @return array
|
| 174 |
-
*/
|
| 175 |
-
public function jsonSerialize() : array {
|
| 176 |
-
return ['nodeType' => $this->getType()] + get_object_vars($this);
|
| 177 |
-
}
|
| 178 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/NodeDumper.php
DELETED
|
@@ -1,203 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node\Expr\Include_;
|
| 6 |
-
use PhpParser\Node\Stmt\Class_;
|
| 7 |
-
use PhpParser\Node\Stmt\GroupUse;
|
| 8 |
-
use PhpParser\Node\Stmt\Use_;
|
| 9 |
-
use PhpParser\Node\Stmt\UseUse;
|
| 10 |
-
|
| 11 |
-
class NodeDumper
|
| 12 |
-
{
|
| 13 |
-
private $dumpComments;
|
| 14 |
-
private $dumpPositions;
|
| 15 |
-
private $code;
|
| 16 |
-
|
| 17 |
-
/**
|
| 18 |
-
* Constructs a NodeDumper.
|
| 19 |
-
*
|
| 20 |
-
* Supported options:
|
| 21 |
-
* * bool dumpComments: Whether comments should be dumped.
|
| 22 |
-
* * bool dumpPositions: Whether line/offset information should be dumped. To dump offset
|
| 23 |
-
* information, the code needs to be passed to dump().
|
| 24 |
-
*
|
| 25 |
-
* @param array $options Options (see description)
|
| 26 |
-
*/
|
| 27 |
-
public function __construct(array $options = []) {
|
| 28 |
-
$this->dumpComments = !empty($options['dumpComments']);
|
| 29 |
-
$this->dumpPositions = !empty($options['dumpPositions']);
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
/**
|
| 33 |
-
* Dumps a node or array.
|
| 34 |
-
*
|
| 35 |
-
* @param array|Node $node Node or array to dump
|
| 36 |
-
* @param string|null $code Code corresponding to dumped AST. This only needs to be passed if
|
| 37 |
-
* the dumpPositions option is enabled and the dumping of node offsets
|
| 38 |
-
* is desired.
|
| 39 |
-
*
|
| 40 |
-
* @return string Dumped value
|
| 41 |
-
*/
|
| 42 |
-
public function dump($node, string $code = null) : string {
|
| 43 |
-
$this->code = $code;
|
| 44 |
-
return $this->dumpRecursive($node);
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
protected function dumpRecursive($node) {
|
| 48 |
-
if ($node instanceof Node) {
|
| 49 |
-
$r = $node->getType();
|
| 50 |
-
if ($this->dumpPositions && null !== $p = $this->dumpPosition($node)) {
|
| 51 |
-
$r .= $p;
|
| 52 |
-
}
|
| 53 |
-
$r .= '(';
|
| 54 |
-
|
| 55 |
-
foreach ($node->getSubNodeNames() as $key) {
|
| 56 |
-
$r .= "\n " . $key . ': ';
|
| 57 |
-
|
| 58 |
-
$value = $node->$key;
|
| 59 |
-
if (null === $value) {
|
| 60 |
-
$r .= 'null';
|
| 61 |
-
} elseif (false === $value) {
|
| 62 |
-
$r .= 'false';
|
| 63 |
-
} elseif (true === $value) {
|
| 64 |
-
$r .= 'true';
|
| 65 |
-
} elseif (is_scalar($value)) {
|
| 66 |
-
if ('flags' === $key || 'newModifier' === $key) {
|
| 67 |
-
$r .= $this->dumpFlags($value);
|
| 68 |
-
} elseif ('type' === $key && $node instanceof Include_) {
|
| 69 |
-
$r .= $this->dumpIncludeType($value);
|
| 70 |
-
} elseif ('type' === $key
|
| 71 |
-
&& ($node instanceof Use_ || $node instanceof UseUse || $node instanceof GroupUse)) {
|
| 72 |
-
$r .= $this->dumpUseType($value);
|
| 73 |
-
} else {
|
| 74 |
-
$r .= $value;
|
| 75 |
-
}
|
| 76 |
-
} else {
|
| 77 |
-
$r .= str_replace("\n", "\n ", $this->dumpRecursive($value));
|
| 78 |
-
}
|
| 79 |
-
}
|
| 80 |
-
|
| 81 |
-
if ($this->dumpComments && $comments = $node->getComments()) {
|
| 82 |
-
$r .= "\n comments: " . str_replace("\n", "\n ", $this->dumpRecursive($comments));
|
| 83 |
-
}
|
| 84 |
-
} elseif (is_array($node)) {
|
| 85 |
-
$r = 'array(';
|
| 86 |
-
|
| 87 |
-
foreach ($node as $key => $value) {
|
| 88 |
-
$r .= "\n " . $key . ': ';
|
| 89 |
-
|
| 90 |
-
if (null === $value) {
|
| 91 |
-
$r .= 'null';
|
| 92 |
-
} elseif (false === $value) {
|
| 93 |
-
$r .= 'false';
|
| 94 |
-
} elseif (true === $value) {
|
| 95 |
-
$r .= 'true';
|
| 96 |
-
} elseif (is_scalar($value)) {
|
| 97 |
-
$r .= $value;
|
| 98 |
-
} else {
|
| 99 |
-
$r .= str_replace("\n", "\n ", $this->dumpRecursive($value));
|
| 100 |
-
}
|
| 101 |
-
}
|
| 102 |
-
} elseif ($node instanceof Comment) {
|
| 103 |
-
return $node->getReformattedText();
|
| 104 |
-
} else {
|
| 105 |
-
throw new \InvalidArgumentException('Can only dump nodes and arrays.');
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
return $r . "\n)";
|
| 109 |
-
}
|
| 110 |
-
|
| 111 |
-
protected function dumpFlags($flags) {
|
| 112 |
-
$strs = [];
|
| 113 |
-
if ($flags & Class_::MODIFIER_PUBLIC) {
|
| 114 |
-
$strs[] = 'MODIFIER_PUBLIC';
|
| 115 |
-
}
|
| 116 |
-
if ($flags & Class_::MODIFIER_PROTECTED) {
|
| 117 |
-
$strs[] = 'MODIFIER_PROTECTED';
|
| 118 |
-
}
|
| 119 |
-
if ($flags & Class_::MODIFIER_PRIVATE) {
|
| 120 |
-
$strs[] = 'MODIFIER_PRIVATE';
|
| 121 |
-
}
|
| 122 |
-
if ($flags & Class_::MODIFIER_ABSTRACT) {
|
| 123 |
-
$strs[] = 'MODIFIER_ABSTRACT';
|
| 124 |
-
}
|
| 125 |
-
if ($flags & Class_::MODIFIER_STATIC) {
|
| 126 |
-
$strs[] = 'MODIFIER_STATIC';
|
| 127 |
-
}
|
| 128 |
-
if ($flags & Class_::MODIFIER_FINAL) {
|
| 129 |
-
$strs[] = 'MODIFIER_FINAL';
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
if ($strs) {
|
| 133 |
-
return implode(' | ', $strs) . ' (' . $flags . ')';
|
| 134 |
-
} else {
|
| 135 |
-
return $flags;
|
| 136 |
-
}
|
| 137 |
-
}
|
| 138 |
-
|
| 139 |
-
protected function dumpIncludeType($type) {
|
| 140 |
-
$map = [
|
| 141 |
-
Include_::TYPE_INCLUDE => 'TYPE_INCLUDE',
|
| 142 |
-
Include_::TYPE_INCLUDE_ONCE => 'TYPE_INCLUDE_ONCE',
|
| 143 |
-
Include_::TYPE_REQUIRE => 'TYPE_REQUIRE',
|
| 144 |
-
Include_::TYPE_REQUIRE_ONCE => 'TYPE_REQUIRE_ONCE',
|
| 145 |
-
];
|
| 146 |
-
|
| 147 |
-
if (!isset($map[$type])) {
|
| 148 |
-
return $type;
|
| 149 |
-
}
|
| 150 |
-
return $map[$type] . ' (' . $type . ')';
|
| 151 |
-
}
|
| 152 |
-
|
| 153 |
-
protected function dumpUseType($type) {
|
| 154 |
-
$map = [
|
| 155 |
-
Use_::TYPE_UNKNOWN => 'TYPE_UNKNOWN',
|
| 156 |
-
Use_::TYPE_NORMAL => 'TYPE_NORMAL',
|
| 157 |
-
Use_::TYPE_FUNCTION => 'TYPE_FUNCTION',
|
| 158 |
-
Use_::TYPE_CONSTANT => 'TYPE_CONSTANT',
|
| 159 |
-
];
|
| 160 |
-
|
| 161 |
-
if (!isset($map[$type])) {
|
| 162 |
-
return $type;
|
| 163 |
-
}
|
| 164 |
-
return $map[$type] . ' (' . $type . ')';
|
| 165 |
-
}
|
| 166 |
-
|
| 167 |
-
/**
|
| 168 |
-
* Dump node position, if possible.
|
| 169 |
-
*
|
| 170 |
-
* @param Node $node Node for which to dump position
|
| 171 |
-
*
|
| 172 |
-
* @return string|null Dump of position, or null if position information not available
|
| 173 |
-
*/
|
| 174 |
-
protected function dumpPosition(Node $node) {
|
| 175 |
-
if (!$node->hasAttribute('startLine') || !$node->hasAttribute('endLine')) {
|
| 176 |
-
return null;
|
| 177 |
-
}
|
| 178 |
-
|
| 179 |
-
$start = $node->getStartLine();
|
| 180 |
-
$end = $node->getEndLine();
|
| 181 |
-
if ($node->hasAttribute('startFilePos') && $node->hasAttribute('endFilePos')
|
| 182 |
-
&& null !== $this->code
|
| 183 |
-
) {
|
| 184 |
-
$start .= ':' . $this->toColumn($this->code, $node->getStartFilePos());
|
| 185 |
-
$end .= ':' . $this->toColumn($this->code, $node->getEndFilePos());
|
| 186 |
-
}
|
| 187 |
-
return "[$start - $end]";
|
| 188 |
-
}
|
| 189 |
-
|
| 190 |
-
// Copied from Error class
|
| 191 |
-
private function toColumn($code, $pos) {
|
| 192 |
-
if ($pos > strlen($code)) {
|
| 193 |
-
throw new \RuntimeException('Invalid position information');
|
| 194 |
-
}
|
| 195 |
-
|
| 196 |
-
$lineStartPos = strrpos($code, "\n", $pos - strlen($code));
|
| 197 |
-
if (false === $lineStartPos) {
|
| 198 |
-
$lineStartPos = -1;
|
| 199 |
-
}
|
| 200 |
-
|
| 201 |
-
return $pos - $lineStartPos;
|
| 202 |
-
}
|
| 203 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/NodeFinder.php
DELETED
|
@@ -1,81 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
use PhpParser\NodeVisitor\FindingVisitor;
|
| 6 |
-
use PhpParser\NodeVisitor\FirstFindingVisitor;
|
| 7 |
-
|
| 8 |
-
class NodeFinder
|
| 9 |
-
{
|
| 10 |
-
/**
|
| 11 |
-
* Find all nodes satisfying a filter callback.
|
| 12 |
-
*
|
| 13 |
-
* @param Node|Node[] $nodes Single node or array of nodes to search in
|
| 14 |
-
* @param callable $filter Filter callback: function(Node $node) : bool
|
| 15 |
-
*
|
| 16 |
-
* @return Node[] Found nodes satisfying the filter callback
|
| 17 |
-
*/
|
| 18 |
-
public function find($nodes, callable $filter) : array {
|
| 19 |
-
if (!is_array($nodes)) {
|
| 20 |
-
$nodes = [$nodes];
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
$visitor = new FindingVisitor($filter);
|
| 24 |
-
|
| 25 |
-
$traverser = new NodeTraverser;
|
| 26 |
-
$traverser->addVisitor($visitor);
|
| 27 |
-
$traverser->traverse($nodes);
|
| 28 |
-
|
| 29 |
-
return $visitor->getFoundNodes();
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
/**
|
| 33 |
-
* Find all nodes that are instances of a certain class.
|
| 34 |
-
*
|
| 35 |
-
* @param Node|Node[] $nodes Single node or array of nodes to search in
|
| 36 |
-
* @param string $class Class name
|
| 37 |
-
*
|
| 38 |
-
* @return Node[] Found nodes (all instances of $class)
|
| 39 |
-
*/
|
| 40 |
-
public function findInstanceOf($nodes, string $class) : array {
|
| 41 |
-
return $this->find($nodes, function ($node) use ($class) {
|
| 42 |
-
return $node instanceof $class;
|
| 43 |
-
});
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
/**
|
| 47 |
-
* Find first node satisfying a filter callback.
|
| 48 |
-
*
|
| 49 |
-
* @param Node|Node[] $nodes Single node or array of nodes to search in
|
| 50 |
-
* @param callable $filter Filter callback: function(Node $node) : bool
|
| 51 |
-
*
|
| 52 |
-
* @return null|Node Found node (or null if none found)
|
| 53 |
-
*/
|
| 54 |
-
public function findFirst($nodes, callable $filter) {
|
| 55 |
-
if (!is_array($nodes)) {
|
| 56 |
-
$nodes = [$nodes];
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
$visitor = new FirstFindingVisitor($filter);
|
| 60 |
-
|
| 61 |
-
$traverser = new NodeTraverser;
|
| 62 |
-
$traverser->addVisitor($visitor);
|
| 63 |
-
$traverser->traverse($nodes);
|
| 64 |
-
|
| 65 |
-
return $visitor->getFoundNode();
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
/**
|
| 69 |
-
* Find first node that is an instance of a certain class.
|
| 70 |
-
*
|
| 71 |
-
* @param Node|Node[] $nodes Single node or array of nodes to search in
|
| 72 |
-
* @param string $class Class name
|
| 73 |
-
*
|
| 74 |
-
* @return null|Node Found node, which is an instance of $class (or null if none found)
|
| 75 |
-
*/
|
| 76 |
-
public function findFirstInstanceOf($nodes, string $class) {
|
| 77 |
-
return $this->findFirst($nodes, function ($node) use ($class) {
|
| 78 |
-
return $node instanceof $class;
|
| 79 |
-
});
|
| 80 |
-
}
|
| 81 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/NodeTraverser.php
DELETED
|
@@ -1,291 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
class NodeTraverser implements NodeTraverserInterface
|
| 6 |
-
{
|
| 7 |
-
/**
|
| 8 |
-
* If NodeVisitor::enterNode() returns DONT_TRAVERSE_CHILDREN, child nodes
|
| 9 |
-
* of the current node will not be traversed for any visitors.
|
| 10 |
-
*
|
| 11 |
-
* For subsequent visitors enterNode() will still be called on the current
|
| 12 |
-
* node and leaveNode() will also be invoked for the current node.
|
| 13 |
-
*/
|
| 14 |
-
const DONT_TRAVERSE_CHILDREN = 1;
|
| 15 |
-
|
| 16 |
-
/**
|
| 17 |
-
* If NodeVisitor::enterNode() or NodeVisitor::leaveNode() returns
|
| 18 |
-
* STOP_TRAVERSAL, traversal is aborted.
|
| 19 |
-
*
|
| 20 |
-
* The afterTraverse() method will still be invoked.
|
| 21 |
-
*/
|
| 22 |
-
const STOP_TRAVERSAL = 2;
|
| 23 |
-
|
| 24 |
-
/**
|
| 25 |
-
* If NodeVisitor::leaveNode() returns REMOVE_NODE for a node that occurs
|
| 26 |
-
* in an array, it will be removed from the array.
|
| 27 |
-
*
|
| 28 |
-
* For subsequent visitors leaveNode() will still be invoked for the
|
| 29 |
-
* removed node.
|
| 30 |
-
*/
|
| 31 |
-
const REMOVE_NODE = 3;
|
| 32 |
-
|
| 33 |
-
/**
|
| 34 |
-
* If NodeVisitor::enterNode() returns DONT_TRAVERSE_CURRENT_AND_CHILDREN, child nodes
|
| 35 |
-
* of the current node will not be traversed for any visitors.
|
| 36 |
-
*
|
| 37 |
-
* For subsequent visitors enterNode() will not be called as well.
|
| 38 |
-
* leaveNode() will be invoked for visitors that has enterNode() method invoked.
|
| 39 |
-
*/
|
| 40 |
-
const DONT_TRAVERSE_CURRENT_AND_CHILDREN = 4;
|
| 41 |
-
|
| 42 |
-
/** @var NodeVisitor[] Visitors */
|
| 43 |
-
protected $visitors = [];
|
| 44 |
-
|
| 45 |
-
/** @var bool Whether traversal should be stopped */
|
| 46 |
-
protected $stopTraversal;
|
| 47 |
-
|
| 48 |
-
public function __construct() {
|
| 49 |
-
// for BC
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
/**
|
| 53 |
-
* Adds a visitor.
|
| 54 |
-
*
|
| 55 |
-
* @param NodeVisitor $visitor Visitor to add
|
| 56 |
-
*/
|
| 57 |
-
public function addVisitor(NodeVisitor $visitor) {
|
| 58 |
-
$this->visitors[] = $visitor;
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
/**
|
| 62 |
-
* Removes an added visitor.
|
| 63 |
-
*
|
| 64 |
-
* @param NodeVisitor $visitor
|
| 65 |
-
*/
|
| 66 |
-
public function removeVisitor(NodeVisitor $visitor) {
|
| 67 |
-
foreach ($this->visitors as $index => $storedVisitor) {
|
| 68 |
-
if ($storedVisitor === $visitor) {
|
| 69 |
-
unset($this->visitors[$index]);
|
| 70 |
-
break;
|
| 71 |
-
}
|
| 72 |
-
}
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
/**
|
| 76 |
-
* Traverses an array of nodes using the registered visitors.
|
| 77 |
-
*
|
| 78 |
-
* @param Node[] $nodes Array of nodes
|
| 79 |
-
*
|
| 80 |
-
* @return Node[] Traversed array of nodes
|
| 81 |
-
*/
|
| 82 |
-
public function traverse(array $nodes) : array {
|
| 83 |
-
$this->stopTraversal = false;
|
| 84 |
-
|
| 85 |
-
foreach ($this->visitors as $visitor) {
|
| 86 |
-
if (null !== $return = $visitor->beforeTraverse($nodes)) {
|
| 87 |
-
$nodes = $return;
|
| 88 |
-
}
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
$nodes = $this->traverseArray($nodes);
|
| 92 |
-
|
| 93 |
-
foreach ($this->visitors as $visitor) {
|
| 94 |
-
if (null !== $return = $visitor->afterTraverse($nodes)) {
|
| 95 |
-
$nodes = $return;
|
| 96 |
-
}
|
| 97 |
-
}
|
| 98 |
-
|
| 99 |
-
return $nodes;
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
/**
|
| 103 |
-
* Recursively traverse a node.
|
| 104 |
-
*
|
| 105 |
-
* @param Node $node Node to traverse.
|
| 106 |
-
*
|
| 107 |
-
* @return Node Result of traversal (may be original node or new one)
|
| 108 |
-
*/
|
| 109 |
-
protected function traverseNode(Node $node) : Node {
|
| 110 |
-
foreach ($node->getSubNodeNames() as $name) {
|
| 111 |
-
$subNode =& $node->$name;
|
| 112 |
-
|
| 113 |
-
if (\is_array($subNode)) {
|
| 114 |
-
$subNode = $this->traverseArray($subNode);
|
| 115 |
-
if ($this->stopTraversal) {
|
| 116 |
-
break;
|
| 117 |
-
}
|
| 118 |
-
} elseif ($subNode instanceof Node) {
|
| 119 |
-
$traverseChildren = true;
|
| 120 |
-
$breakVisitorIndex = null;
|
| 121 |
-
|
| 122 |
-
foreach ($this->visitors as $visitorIndex => $visitor) {
|
| 123 |
-
$return = $visitor->enterNode($subNode);
|
| 124 |
-
if (null !== $return) {
|
| 125 |
-
if ($return instanceof Node) {
|
| 126 |
-
$this->ensureReplacementReasonable($subNode, $return);
|
| 127 |
-
$subNode = $return;
|
| 128 |
-
} elseif (self::DONT_TRAVERSE_CHILDREN === $return) {
|
| 129 |
-
$traverseChildren = false;
|
| 130 |
-
} elseif (self::DONT_TRAVERSE_CURRENT_AND_CHILDREN === $return) {
|
| 131 |
-
$traverseChildren = false;
|
| 132 |
-
$breakVisitorIndex = $visitorIndex;
|
| 133 |
-
break;
|
| 134 |
-
} elseif (self::STOP_TRAVERSAL === $return) {
|
| 135 |
-
$this->stopTraversal = true;
|
| 136 |
-
break 2;
|
| 137 |
-
} else {
|
| 138 |
-
throw new \LogicException(
|
| 139 |
-
'enterNode() returned invalid value of type ' . gettype($return)
|
| 140 |
-
);
|
| 141 |
-
}
|
| 142 |
-
}
|
| 143 |
-
}
|
| 144 |
-
|
| 145 |
-
if ($traverseChildren) {
|
| 146 |
-
$subNode = $this->traverseNode($subNode);
|
| 147 |
-
if ($this->stopTraversal) {
|
| 148 |
-
break;
|
| 149 |
-
}
|
| 150 |
-
}
|
| 151 |
-
|
| 152 |
-
foreach ($this->visitors as $visitorIndex => $visitor) {
|
| 153 |
-
$return = $visitor->leaveNode($subNode);
|
| 154 |
-
|
| 155 |
-
if (null !== $return) {
|
| 156 |
-
if ($return instanceof Node) {
|
| 157 |
-
$this->ensureReplacementReasonable($subNode, $return);
|
| 158 |
-
$subNode = $return;
|
| 159 |
-
} elseif (self::STOP_TRAVERSAL === $return) {
|
| 160 |
-
$this->stopTraversal = true;
|
| 161 |
-
break 2;
|
| 162 |
-
} elseif (\is_array($return)) {
|
| 163 |
-
throw new \LogicException(
|
| 164 |
-
'leaveNode() may only return an array ' .
|
| 165 |
-
'if the parent structure is an array'
|
| 166 |
-
);
|
| 167 |
-
} else {
|
| 168 |
-
throw new \LogicException(
|
| 169 |
-
'leaveNode() returned invalid value of type ' . gettype($return)
|
| 170 |
-
);
|
| 171 |
-
}
|
| 172 |
-
}
|
| 173 |
-
|
| 174 |
-
if ($breakVisitorIndex === $visitorIndex) {
|
| 175 |
-
break;
|
| 176 |
-
}
|
| 177 |
-
}
|
| 178 |
-
}
|
| 179 |
-
}
|
| 180 |
-
|
| 181 |
-
return $node;
|
| 182 |
-
}
|
| 183 |
-
|
| 184 |
-
/**
|
| 185 |
-
* Recursively traverse array (usually of nodes).
|
| 186 |
-
*
|
| 187 |
-
* @param array $nodes Array to traverse
|
| 188 |
-
*
|
| 189 |
-
* @return array Result of traversal (may be original array or changed one)
|
| 190 |
-
*/
|
| 191 |
-
protected function traverseArray(array $nodes) : array {
|
| 192 |
-
$doNodes = [];
|
| 193 |
-
|
| 194 |
-
foreach ($nodes as $i => &$node) {
|
| 195 |
-
if ($node instanceof Node) {
|
| 196 |
-
$traverseChildren = true;
|
| 197 |
-
$breakVisitorIndex = null;
|
| 198 |
-
|
| 199 |
-
foreach ($this->visitors as $visitorIndex => $visitor) {
|
| 200 |
-
$return = $visitor->enterNode($node);
|
| 201 |
-
if (null !== $return) {
|
| 202 |
-
if ($return instanceof Node) {
|
| 203 |
-
$this->ensureReplacementReasonable($node, $return);
|
| 204 |
-
$node = $return;
|
| 205 |
-
} elseif (self::DONT_TRAVERSE_CHILDREN === $return) {
|
| 206 |
-
$traverseChildren = false;
|
| 207 |
-
} elseif (self::DONT_TRAVERSE_CURRENT_AND_CHILDREN === $return) {
|
| 208 |
-
$traverseChildren = false;
|
| 209 |
-
$breakVisitorIndex = $visitorIndex;
|
| 210 |
-
break;
|
| 211 |
-
} elseif (self::STOP_TRAVERSAL === $return) {
|
| 212 |
-
$this->stopTraversal = true;
|
| 213 |
-
break 2;
|
| 214 |
-
} else {
|
| 215 |
-
throw new \LogicException(
|
| 216 |
-
'enterNode() returned invalid value of type ' . gettype($return)
|
| 217 |
-
);
|
| 218 |
-
}
|
| 219 |
-
}
|
| 220 |
-
}
|
| 221 |
-
|
| 222 |
-
if ($traverseChildren) {
|
| 223 |
-
$node = $this->traverseNode($node);
|
| 224 |
-
if ($this->stopTraversal) {
|
| 225 |
-
break;
|
| 226 |
-
}
|
| 227 |
-
}
|
| 228 |
-
|
| 229 |
-
foreach ($this->visitors as $visitorIndex => $visitor) {
|
| 230 |
-
$return = $visitor->leaveNode($node);
|
| 231 |
-
|
| 232 |
-
if (null !== $return) {
|
| 233 |
-
if ($return instanceof Node) {
|
| 234 |
-
$this->ensureReplacementReasonable($node, $return);
|
| 235 |
-
$node = $return;
|
| 236 |
-
} elseif (\is_array($return)) {
|
| 237 |
-
$doNodes[] = [$i, $return];
|
| 238 |
-
break;
|
| 239 |
-
} elseif (self::REMOVE_NODE === $return) {
|
| 240 |
-
$doNodes[] = [$i, []];
|
| 241 |
-
break;
|
| 242 |
-
} elseif (self::STOP_TRAVERSAL === $return) {
|
| 243 |
-
$this->stopTraversal = true;
|
| 244 |
-
break 2;
|
| 245 |
-
} elseif (false === $return) {
|
| 246 |
-
throw new \LogicException(
|
| 247 |
-
'bool(false) return from leaveNode() no longer supported. ' .
|
| 248 |
-
'Return NodeTraverser::REMOVE_NODE instead'
|
| 249 |
-
);
|
| 250 |
-
} else {
|
| 251 |
-
throw new \LogicException(
|
| 252 |
-
'leaveNode() returned invalid value of type ' . gettype($return)
|
| 253 |
-
);
|
| 254 |
-
}
|
| 255 |
-
}
|
| 256 |
-
|
| 257 |
-
if ($breakVisitorIndex === $visitorIndex) {
|
| 258 |
-
break;
|
| 259 |
-
}
|
| 260 |
-
}
|
| 261 |
-
} elseif (\is_array($node)) {
|
| 262 |
-
throw new \LogicException('Invalid node structure: Contains nested arrays');
|
| 263 |
-
}
|
| 264 |
-
}
|
| 265 |
-
|
| 266 |
-
if (!empty($doNodes)) {
|
| 267 |
-
while (list($i, $replace) = array_pop($doNodes)) {
|
| 268 |
-
array_splice($nodes, $i, 1, $replace);
|
| 269 |
-
}
|
| 270 |
-
}
|
| 271 |
-
|
| 272 |
-
return $nodes;
|
| 273 |
-
}
|
| 274 |
-
|
| 275 |
-
private function ensureReplacementReasonable($old, $new) {
|
| 276 |
-
if ($old instanceof Node\Stmt && $new instanceof Node\Expr) {
|
| 277 |
-
throw new \LogicException(
|
| 278 |
-
"Trying to replace statement ({$old->getType()}) " .
|
| 279 |
-
"with expression ({$new->getType()}). Are you missing a " .
|
| 280 |
-
"Stmt_Expression wrapper?"
|
| 281 |
-
);
|
| 282 |
-
}
|
| 283 |
-
|
| 284 |
-
if ($old instanceof Node\Expr && $new instanceof Node\Stmt) {
|
| 285 |
-
throw new \LogicException(
|
| 286 |
-
"Trying to replace expression ({$old->getType()}) " .
|
| 287 |
-
"with statement ({$new->getType()})"
|
| 288 |
-
);
|
| 289 |
-
}
|
| 290 |
-
}
|
| 291 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/NodeTraverserInterface.php
DELETED
|
@@ -1,29 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
interface NodeTraverserInterface
|
| 6 |
-
{
|
| 7 |
-
/**
|
| 8 |
-
* Adds a visitor.
|
| 9 |
-
*
|
| 10 |
-
* @param NodeVisitor $visitor Visitor to add
|
| 11 |
-
*/
|
| 12 |
-
public function addVisitor(NodeVisitor $visitor);
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Removes an added visitor.
|
| 16 |
-
*
|
| 17 |
-
* @param NodeVisitor $visitor
|
| 18 |
-
*/
|
| 19 |
-
public function removeVisitor(NodeVisitor $visitor);
|
| 20 |
-
|
| 21 |
-
/**
|
| 22 |
-
* Traverses an array of nodes using the registered visitors.
|
| 23 |
-
*
|
| 24 |
-
* @param Node[] $nodes Array of nodes
|
| 25 |
-
*
|
| 26 |
-
* @return Node[] Traversed array of nodes
|
| 27 |
-
*/
|
| 28 |
-
public function traverse(array $nodes) : array;
|
| 29 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/NodeVisitor.php
DELETED
|
@@ -1,72 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
interface NodeVisitor
|
| 6 |
-
{
|
| 7 |
-
/**
|
| 8 |
-
* Called once before traversal.
|
| 9 |
-
*
|
| 10 |
-
* Return value semantics:
|
| 11 |
-
* * null: $nodes stays as-is
|
| 12 |
-
* * otherwise: $nodes is set to the return value
|
| 13 |
-
*
|
| 14 |
-
* @param Node[] $nodes Array of nodes
|
| 15 |
-
*
|
| 16 |
-
* @return null|Node[] Array of nodes
|
| 17 |
-
*/
|
| 18 |
-
public function beforeTraverse(array $nodes);
|
| 19 |
-
|
| 20 |
-
/**
|
| 21 |
-
* Called when entering a node.
|
| 22 |
-
*
|
| 23 |
-
* Return value semantics:
|
| 24 |
-
* * null
|
| 25 |
-
* => $node stays as-is
|
| 26 |
-
* * NodeTraverser::DONT_TRAVERSE_CHILDREN
|
| 27 |
-
* => Children of $node are not traversed. $node stays as-is
|
| 28 |
-
* * NodeTraverser::STOP_TRAVERSAL
|
| 29 |
-
* => Traversal is aborted. $node stays as-is
|
| 30 |
-
* * otherwise
|
| 31 |
-
* => $node is set to the return value
|
| 32 |
-
*
|
| 33 |
-
* @param Node $node Node
|
| 34 |
-
*
|
| 35 |
-
* @return null|int|Node Replacement node (or special return value)
|
| 36 |
-
*/
|
| 37 |
-
public function enterNode(Node $node);
|
| 38 |
-
|
| 39 |
-
/**
|
| 40 |
-
* Called when leaving a node.
|
| 41 |
-
*
|
| 42 |
-
* Return value semantics:
|
| 43 |
-
* * null
|
| 44 |
-
* => $node stays as-is
|
| 45 |
-
* * NodeTraverser::REMOVE_NODE
|
| 46 |
-
* => $node is removed from the parent array
|
| 47 |
-
* * NodeTraverser::STOP_TRAVERSAL
|
| 48 |
-
* => Traversal is aborted. $node stays as-is
|
| 49 |
-
* * array (of Nodes)
|
| 50 |
-
* => The return value is merged into the parent array (at the position of the $node)
|
| 51 |
-
* * otherwise
|
| 52 |
-
* => $node is set to the return value
|
| 53 |
-
*
|
| 54 |
-
* @param Node $node Node
|
| 55 |
-
*
|
| 56 |
-
* @return null|int|Node|Node[] Replacement node (or special return value)
|
| 57 |
-
*/
|
| 58 |
-
public function leaveNode(Node $node);
|
| 59 |
-
|
| 60 |
-
/**
|
| 61 |
-
* Called once after traversal.
|
| 62 |
-
*
|
| 63 |
-
* Return value semantics:
|
| 64 |
-
* * null: $nodes stays as-is
|
| 65 |
-
* * otherwise: $nodes is set to the return value
|
| 66 |
-
*
|
| 67 |
-
* @param Node[] $nodes Array of nodes
|
| 68 |
-
*
|
| 69 |
-
* @return null|Node[] Array of nodes
|
| 70 |
-
*/
|
| 71 |
-
public function afterTraverse(array $nodes);
|
| 72 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/NodeVisitor/CloningVisitor.php
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\NodeVisitor;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\NodeVisitorAbstract;
|
| 7 |
-
|
| 8 |
-
/**
|
| 9 |
-
* Visitor cloning all nodes and linking to the original nodes using an attribute.
|
| 10 |
-
*
|
| 11 |
-
* This visitor is required to perform format-preserving pretty prints.
|
| 12 |
-
*/
|
| 13 |
-
class CloningVisitor extends NodeVisitorAbstract
|
| 14 |
-
{
|
| 15 |
-
public function enterNode(Node $origNode) {
|
| 16 |
-
$node = clone $origNode;
|
| 17 |
-
$node->setAttribute('origNode', $origNode);
|
| 18 |
-
return $node;
|
| 19 |
-
}
|
| 20 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/NodeVisitor/FindingVisitor.php
DELETED
|
@@ -1,48 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\NodeVisitor;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\NodeVisitorAbstract;
|
| 7 |
-
|
| 8 |
-
/**
|
| 9 |
-
* This visitor can be used to find and collect all nodes satisfying some criterion determined by
|
| 10 |
-
* a filter callback.
|
| 11 |
-
*/
|
| 12 |
-
class FindingVisitor extends NodeVisitorAbstract
|
| 13 |
-
{
|
| 14 |
-
/** @var callable Filter callback */
|
| 15 |
-
protected $filterCallback;
|
| 16 |
-
/** @var Node[] Found nodes */
|
| 17 |
-
protected $foundNodes;
|
| 18 |
-
|
| 19 |
-
public function __construct(callable $filterCallback) {
|
| 20 |
-
$this->filterCallback = $filterCallback;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
/**
|
| 24 |
-
* Get found nodes satisfying the filter callback.
|
| 25 |
-
*
|
| 26 |
-
* Nodes are returned in pre-order.
|
| 27 |
-
*
|
| 28 |
-
* @return Node[] Found nodes
|
| 29 |
-
*/
|
| 30 |
-
public function getFoundNodes() : array {
|
| 31 |
-
return $this->foundNodes;
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
public function beforeTraverse(array $nodes) {
|
| 35 |
-
$this->foundNodes = [];
|
| 36 |
-
|
| 37 |
-
return null;
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
public function enterNode(Node $node) {
|
| 41 |
-
$filterCallback = $this->filterCallback;
|
| 42 |
-
if ($filterCallback($node)) {
|
| 43 |
-
$this->foundNodes[] = $node;
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
return null;
|
| 47 |
-
}
|
| 48 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/NodeVisitor/FirstFindingVisitor.php
DELETED
|
@@ -1,50 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\NodeVisitor;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Node;
|
| 6 |
-
use PhpParser\NodeTraverser;
|
| 7 |
-
use PhpParser\NodeVisitorAbstract;
|
| 8 |
-
|
| 9 |
-
/**
|
| 10 |
-
* This visitor can be used to find the first node satisfying some criterion determined by
|
| 11 |
-
* a filter callback.
|
| 12 |
-
*/
|
| 13 |
-
class FirstFindingVisitor extends NodeVisitorAbstract
|
| 14 |
-
{
|
| 15 |
-
/** @var callable Filter callback */
|
| 16 |
-
protected $filterCallback;
|
| 17 |
-
/** @var null|Node Found node */
|
| 18 |
-
protected $foundNode;
|
| 19 |
-
|
| 20 |
-
public function __construct(callable $filterCallback) {
|
| 21 |
-
$this->filterCallback = $filterCallback;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
/**
|
| 25 |
-
* Get found node satisfying the filter callback.
|
| 26 |
-
*
|
| 27 |
-
* Returns null if no node satisfies the filter callback.
|
| 28 |
-
*
|
| 29 |
-
* @return null|Node Found node (or null if not found)
|
| 30 |
-
*/
|
| 31 |
-
public function getFoundNode() {
|
| 32 |
-
return $this->foundNode;
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
public function beforeTraverse(array $nodes) {
|
| 36 |
-
$this->foundNode = null;
|
| 37 |
-
|
| 38 |
-
return null;
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
public function enterNode(Node $node) {
|
| 42 |
-
$filterCallback = $this->filterCallback;
|
| 43 |
-
if ($filterCallback($node)) {
|
| 44 |
-
$this->foundNode = $node;
|
| 45 |
-
return NodeTraverser::STOP_TRAVERSAL;
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
return null;
|
| 49 |
-
}
|
| 50 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/NodeVisitor/NameResolver.php
DELETED
|
@@ -1,228 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\NodeVisitor;
|
| 4 |
-
|
| 5 |
-
use PhpParser\ErrorHandler;
|
| 6 |
-
use PhpParser\NameContext;
|
| 7 |
-
use PhpParser\Node;
|
| 8 |
-
use PhpParser\Node\Expr;
|
| 9 |
-
use PhpParser\Node\Name;
|
| 10 |
-
use PhpParser\Node\Name\FullyQualified;
|
| 11 |
-
use PhpParser\Node\Stmt;
|
| 12 |
-
use PhpParser\NodeVisitorAbstract;
|
| 13 |
-
|
| 14 |
-
class NameResolver extends NodeVisitorAbstract
|
| 15 |
-
{
|
| 16 |
-
/** @var NameContext Naming context */
|
| 17 |
-
protected $nameContext;
|
| 18 |
-
|
| 19 |
-
/** @var bool Whether to preserve original names */
|
| 20 |
-
protected $preserveOriginalNames;
|
| 21 |
-
|
| 22 |
-
/** @var bool Whether to replace resolved nodes in place, or to add resolvedNode attributes */
|
| 23 |
-
protected $replaceNodes;
|
| 24 |
-
|
| 25 |
-
/**
|
| 26 |
-
* Constructs a name resolution visitor.
|
| 27 |
-
*
|
| 28 |
-
* Options:
|
| 29 |
-
* * preserveOriginalNames (default false): An "originalName" attribute will be added to
|
| 30 |
-
* all name nodes that underwent resolution.
|
| 31 |
-
* * replaceNodes (default true): Resolved names are replaced in-place. Otherwise, a
|
| 32 |
-
* resolvedName attribute is added. (Names that cannot be statically resolved receive a
|
| 33 |
-
* namespacedName attribute, as usual.)
|
| 34 |
-
*
|
| 35 |
-
* @param ErrorHandler|null $errorHandler Error handler
|
| 36 |
-
* @param array $options Options
|
| 37 |
-
*/
|
| 38 |
-
public function __construct(ErrorHandler $errorHandler = null, array $options = []) {
|
| 39 |
-
$this->nameContext = new NameContext($errorHandler ?? new ErrorHandler\Throwing);
|
| 40 |
-
$this->preserveOriginalNames = $options['preserveOriginalNames'] ?? false;
|
| 41 |
-
$this->replaceNodes = $options['replaceNodes'] ?? true;
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
/**
|
| 45 |
-
* Get name resolution context.
|
| 46 |
-
*
|
| 47 |
-
* @return NameContext
|
| 48 |
-
*/
|
| 49 |
-
public function getNameContext() : NameContext {
|
| 50 |
-
return $this->nameContext;
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
public function beforeTraverse(array $nodes) {
|
| 54 |
-
$this->nameContext->startNamespace();
|
| 55 |
-
return null;
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
public function enterNode(Node $node) {
|
| 59 |
-
if ($node instanceof Stmt\Namespace_) {
|
| 60 |
-
$this->nameContext->startNamespace($node->name);
|
| 61 |
-
} elseif ($node instanceof Stmt\Use_) {
|
| 62 |
-
foreach ($node->uses as $use) {
|
| 63 |
-
$this->addAlias($use, $node->type, null);
|
| 64 |
-
}
|
| 65 |
-
} elseif ($node instanceof Stmt\GroupUse) {
|
| 66 |
-
foreach ($node->uses as $use) {
|
| 67 |
-
$this->addAlias($use, $node->type, $node->prefix);
|
| 68 |
-
}
|
| 69 |
-
} elseif ($node instanceof Stmt\Class_) {
|
| 70 |
-
if (null !== $node->extends) {
|
| 71 |
-
$node->extends = $this->resolveClassName($node->extends);
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
foreach ($node->implements as &$interface) {
|
| 75 |
-
$interface = $this->resolveClassName($interface);
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
if (null !== $node->name) {
|
| 79 |
-
$this->addNamespacedName($node);
|
| 80 |
-
}
|
| 81 |
-
} elseif ($node instanceof Stmt\Interface_) {
|
| 82 |
-
foreach ($node->extends as &$interface) {
|
| 83 |
-
$interface = $this->resolveClassName($interface);
|
| 84 |
-
}
|
| 85 |
-
|
| 86 |
-
$this->addNamespacedName($node);
|
| 87 |
-
} elseif ($node instanceof Stmt\Trait_) {
|
| 88 |
-
$this->addNamespacedName($node);
|
| 89 |
-
} elseif ($node instanceof Stmt\Function_) {
|
| 90 |
-
$this->addNamespacedName($node);
|
| 91 |
-
$this->resolveSignature($node);
|
| 92 |
-
} elseif ($node instanceof Stmt\ClassMethod
|
| 93 |
-
|| $node instanceof Expr\Closure
|
| 94 |
-
|| $node instanceof Expr\ArrowFunction
|
| 95 |
-
) {
|
| 96 |
-
$this->resolveSignature($node);
|
| 97 |
-
} elseif ($node instanceof Stmt\Property) {
|
| 98 |
-
if (null !== $node->type) {
|
| 99 |
-
$node->type = $this->resolveType($node->type);
|
| 100 |
-
}
|
| 101 |
-
} elseif ($node instanceof Stmt\Const_) {
|
| 102 |
-
foreach ($node->consts as $const) {
|
| 103 |
-
$this->addNamespacedName($const);
|
| 104 |
-
}
|
| 105 |
-
} elseif ($node instanceof Expr\StaticCall
|
| 106 |
-
|| $node instanceof Expr\StaticPropertyFetch
|
| 107 |
-
|| $node instanceof Expr\ClassConstFetch
|
| 108 |
-
|| $node instanceof Expr\New_
|
| 109 |
-
|| $node instanceof Expr\Instanceof_
|
| 110 |
-
) {
|
| 111 |
-
if ($node->class instanceof Name) {
|
| 112 |
-
$node->class = $this->resolveClassName($node->class);
|
| 113 |
-
}
|
| 114 |
-
} elseif ($node instanceof Stmt\Catch_) {
|
| 115 |
-
foreach ($node->types as &$type) {
|
| 116 |
-
$type = $this->resolveClassName($type);
|
| 117 |
-
}
|
| 118 |
-
} elseif ($node instanceof Expr\FuncCall) {
|
| 119 |
-
if ($node->name instanceof Name) {
|
| 120 |
-
$node->name = $this->resolveName($node->name, Stmt\Use_::TYPE_FUNCTION);
|
| 121 |
-
}
|
| 122 |
-
} elseif ($node instanceof Expr\ConstFetch) {
|
| 123 |
-
$node->name = $this->resolveName($node->name, Stmt\Use_::TYPE_CONSTANT);
|
| 124 |
-
} elseif ($node instanceof Stmt\TraitUse) {
|
| 125 |
-
foreach ($node->traits as &$trait) {
|
| 126 |
-
$trait = $this->resolveClassName($trait);
|
| 127 |
-
}
|
| 128 |
-
|
| 129 |
-
foreach ($node->adaptations as $adaptation) {
|
| 130 |
-
if (null !== $adaptation->trait) {
|
| 131 |
-
$adaptation->trait = $this->resolveClassName($adaptation->trait);
|
| 132 |
-
}
|
| 133 |
-
|
| 134 |
-
if ($adaptation instanceof Stmt\TraitUseAdaptation\Precedence) {
|
| 135 |
-
foreach ($adaptation->insteadof as &$insteadof) {
|
| 136 |
-
$insteadof = $this->resolveClassName($insteadof);
|
| 137 |
-
}
|
| 138 |
-
}
|
| 139 |
-
}
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
return null;
|
| 143 |
-
}
|
| 144 |
-
|
| 145 |
-
private function addAlias(Stmt\UseUse $use, $type, Name $prefix = null) {
|
| 146 |
-
// Add prefix for group uses
|
| 147 |
-
$name = $prefix ? Name::concat($prefix, $use->name) : $use->name;
|
| 148 |
-
// Type is determined either by individual element or whole use declaration
|
| 149 |
-
$type |= $use->type;
|
| 150 |
-
|
| 151 |
-
$this->nameContext->addAlias(
|
| 152 |
-
$name, (string) $use->getAlias(), $type, $use->getAttributes()
|
| 153 |
-
);
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
/** @param Stmt\Function_|Stmt\ClassMethod|Expr\Closure $node */
|
| 157 |
-
private function resolveSignature($node) {
|
| 158 |
-
foreach ($node->params as $param) {
|
| 159 |
-
$param->type = $this->resolveType($param->type);
|
| 160 |
-
}
|
| 161 |
-
$node->returnType = $this->resolveType($node->returnType);
|
| 162 |
-
}
|
| 163 |
-
|
| 164 |
-
private function resolveType($node) {
|
| 165 |
-
if ($node instanceof Name) {
|
| 166 |
-
return $this->resolveClassName($node);
|
| 167 |
-
}
|
| 168 |
-
if ($node instanceof Node\NullableType) {
|
| 169 |
-
$node->type = $this->resolveType($node->type);
|
| 170 |
-
return $node;
|
| 171 |
-
}
|
| 172 |
-
if ($node instanceof Node\UnionType) {
|
| 173 |
-
foreach ($node->types as &$type) {
|
| 174 |
-
$type = $this->resolveType($type);
|
| 175 |
-
}
|
| 176 |
-
return $node;
|
| 177 |
-
}
|
| 178 |
-
return $node;
|
| 179 |
-
}
|
| 180 |
-
|
| 181 |
-
/**
|
| 182 |
-
* Resolve name, according to name resolver options.
|
| 183 |
-
*
|
| 184 |
-
* @param Name $name Function or constant name to resolve
|
| 185 |
-
* @param int $type One of Stmt\Use_::TYPE_*
|
| 186 |
-
*
|
| 187 |
-
* @return Name Resolved name, or original name with attribute
|
| 188 |
-
*/
|
| 189 |
-
protected function resolveName(Name $name, int $type) : Name {
|
| 190 |
-
if (!$this->replaceNodes) {
|
| 191 |
-
$resolvedName = $this->nameContext->getResolvedName($name, $type);
|
| 192 |
-
if (null !== $resolvedName) {
|
| 193 |
-
$name->setAttribute('resolvedName', $resolvedName);
|
| 194 |
-
} else {
|
| 195 |
-
$name->setAttribute('namespacedName', FullyQualified::concat(
|
| 196 |
-
$this->nameContext->getNamespace(), $name, $name->getAttributes()));
|
| 197 |
-
}
|
| 198 |
-
return $name;
|
| 199 |
-
}
|
| 200 |
-
|
| 201 |
-
if ($this->preserveOriginalNames) {
|
| 202 |
-
// Save the original name
|
| 203 |
-
$originalName = $name;
|
| 204 |
-
$name = clone $originalName;
|
| 205 |
-
$name->setAttribute('originalName', $originalName);
|
| 206 |
-
}
|
| 207 |
-
|
| 208 |
-
$resolvedName = $this->nameContext->getResolvedName($name, $type);
|
| 209 |
-
if (null !== $resolvedName) {
|
| 210 |
-
return $resolvedName;
|
| 211 |
-
}
|
| 212 |
-
|
| 213 |
-
// unqualified names inside a namespace cannot be resolved at compile-time
|
| 214 |
-
// add the namespaced version of the name as an attribute
|
| 215 |
-
$name->setAttribute('namespacedName', FullyQualified::concat(
|
| 216 |
-
$this->nameContext->getNamespace(), $name, $name->getAttributes()));
|
| 217 |
-
return $name;
|
| 218 |
-
}
|
| 219 |
-
|
| 220 |
-
protected function resolveClassName(Name $name) {
|
| 221 |
-
return $this->resolveName($name, Stmt\Use_::TYPE_NORMAL);
|
| 222 |
-
}
|
| 223 |
-
|
| 224 |
-
protected function addNamespacedName(Node $node) {
|
| 225 |
-
$node->namespacedName = Name::concat(
|
| 226 |
-
$this->nameContext->getNamespace(), (string) $node->name);
|
| 227 |
-
}
|
| 228 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/NodeVisitorAbstract.php
DELETED
|
@@ -1,25 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
/**
|
| 6 |
-
* @codeCoverageIgnore
|
| 7 |
-
*/
|
| 8 |
-
class NodeVisitorAbstract implements NodeVisitor
|
| 9 |
-
{
|
| 10 |
-
public function beforeTraverse(array $nodes) {
|
| 11 |
-
return null;
|
| 12 |
-
}
|
| 13 |
-
|
| 14 |
-
public function enterNode(Node $node) {
|
| 15 |
-
return null;
|
| 16 |
-
}
|
| 17 |
-
|
| 18 |
-
public function leaveNode(Node $node) {
|
| 19 |
-
return null;
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
public function afterTraverse(array $nodes) {
|
| 23 |
-
return null;
|
| 24 |
-
}
|
| 25 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Parser.php
DELETED
|
@@ -1,18 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser;
|
| 4 |
-
|
| 5 |
-
interface Parser
|
| 6 |
-
{
|
| 7 |
-
/**
|
| 8 |
-
* Parses PHP code into a node tree.
|
| 9 |
-
*
|
| 10 |
-
* @param string $code The source code to parse
|
| 11 |
-
* @param ErrorHandler|null $errorHandler Error handler to use for lexer/parser errors, defaults
|
| 12 |
-
* to ErrorHandler\Throwing.
|
| 13 |
-
*
|
| 14 |
-
* @return Node\Stmt[]|null Array of statements (or null non-throwing error handler is used and
|
| 15 |
-
* the parser was unable to recover from an error).
|
| 16 |
-
*/
|
| 17 |
-
public function parse(string $code, ErrorHandler $errorHandler = null);
|
| 18 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Parser/Multiple.php
DELETED
|
@@ -1,55 +0,0 @@
|
|
| 1 |
-
<?php declare(strict_types=1);
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Parser;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Error;
|
| 6 |
-
use PhpParser\ErrorHandler;
|
| 7 |
-
use PhpParser\Parser;
|
| 8 |
-
|
| 9 |
-
class Multiple implements Parser
|
| 10 |
-
{
|
| 11 |
-
/** @var Parser[] List of parsers to try, in order of preference */
|
| 12 |
-
private $parsers;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Create a parser which will try multiple parsers in an order of preference.
|
| 16 |
-
*
|
| 17 |
-
* Parsers will be invoked in the order they're provided to the constructor. If one of the
|
| 18 |
-
* parsers runs without throwing, it's output is returned. Otherwise the exception that the
|
| 19 |
-
* first parser generated is thrown.
|
| 20 |
-
*
|
| 21 |
-
* @param Parser[] $parsers
|
| 22 |
-
*/
|
| 23 |
-
public function __construct(array $parsers) {
|
| 24 |
-
$this->parsers = $parsers;
|
| 25 |
-
}
|
| 26 |
-
|
| 27 |
-
public function parse(string $code, ErrorHandler $errorHandler = null) {
|
| 28 |
-
if (null === $errorHandler) {
|
| 29 |
-
$errorHandler = new ErrorHandler\Throwing;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
list($firstStmts, $firstError) = $this->tryParse($this->parsers[0], $errorHandler, $code);
|
| 33 |
-
if ($firstError === null) {
|
| 34 |
-
return $firstStmts;
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
for ($i = 1, $c = count($this->parsers); $i < $c; ++$i) {
|
| 38 |
-
list($stmts, $error) = $this->tryParse($this->parsers[$i], $errorHandler, $code);
|
| 39 |
-
if ($error === null) {
|
| 40 |
-
return $stmts;
|
| 41 |
-
}
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
throw $firstError;
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
private function tryParse(Parser $parser, ErrorHandler $errorHandler, $code) {
|
| 48 |
-
$stmts = null;
|
| 49 |
-
$error = null;
|
| 50 |
-
try {
|
| 51 |
-
$stmts = $parser->parse($code, $errorHandler);
|
| 52 |
-
} catch (Error $error) {}
|
| 53 |
-
return [$stmts, $error];
|
| 54 |
-
}
|
| 55 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Parser/Php5.php
DELETED
|
@@ -1,2640 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Parser;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Error;
|
| 6 |
-
use PhpParser\Node;
|
| 7 |
-
use PhpParser\Node\Expr;
|
| 8 |
-
use PhpParser\Node\Name;
|
| 9 |
-
use PhpParser\Node\Scalar;
|
| 10 |
-
use PhpParser\Node\Stmt;
|
| 11 |
-
|
| 12 |
-
/* This is an automatically GENERATED file, which should not be manually edited.
|
| 13 |
-
* Instead edit one of the following:
|
| 14 |
-
* * the grammar files grammar/php5.y or grammar/php7.y
|
| 15 |
-
* * the skeleton file grammar/parser.template
|
| 16 |
-
* * the preprocessing script grammar/rebuildParsers.php
|
| 17 |
-
*/
|
| 18 |
-
class Php5 extends \PhpParser\ParserAbstract
|
| 19 |
-
{
|
| 20 |
-
protected $tokenToSymbolMapSize = 394;
|
| 21 |
-
protected $actionTableSize = 1079;
|
| 22 |
-
protected $gotoTableSize = 650;
|
| 23 |
-
|
| 24 |
-
protected $invalidSymbol = 159;
|
| 25 |
-
protected $errorSymbol = 1;
|
| 26 |
-
protected $defaultAction = -32766;
|
| 27 |
-
protected $unexpectedTokenRule = 32767;
|
| 28 |
-
|
| 29 |
-
protected $YY2TBLSTATE = 407;
|
| 30 |
-
protected $numNonLeafStates = 676;
|
| 31 |
-
|
| 32 |
-
protected $symbolToName = array(
|
| 33 |
-
"EOF",
|
| 34 |
-
"error",
|
| 35 |
-
"T_INCLUDE",
|
| 36 |
-
"T_INCLUDE_ONCE",
|
| 37 |
-
"T_EVAL",
|
| 38 |
-
"T_REQUIRE",
|
| 39 |
-
"T_REQUIRE_ONCE",
|
| 40 |
-
"','",
|
| 41 |
-
"T_LOGICAL_OR",
|
| 42 |
-
"T_LOGICAL_XOR",
|
| 43 |
-
"T_LOGICAL_AND",
|
| 44 |
-
"T_PRINT",
|
| 45 |
-
"T_YIELD",
|
| 46 |
-
"T_DOUBLE_ARROW",
|
| 47 |
-
"T_YIELD_FROM",
|
| 48 |
-
"'='",
|
| 49 |
-
"T_PLUS_EQUAL",
|
| 50 |
-
"T_MINUS_EQUAL",
|
| 51 |
-
"T_MUL_EQUAL",
|
| 52 |
-
"T_DIV_EQUAL",
|
| 53 |
-
"T_CONCAT_EQUAL",
|
| 54 |
-
"T_MOD_EQUAL",
|
| 55 |
-
"T_AND_EQUAL",
|
| 56 |
-
"T_OR_EQUAL",
|
| 57 |
-
"T_XOR_EQUAL",
|
| 58 |
-
"T_SL_EQUAL",
|
| 59 |
-
"T_SR_EQUAL",
|
| 60 |
-
"T_POW_EQUAL",
|
| 61 |
-
"T_COALESCE_EQUAL",
|
| 62 |
-
"'?'",
|
| 63 |
-
"':'",
|
| 64 |
-
"T_COALESCE",
|
| 65 |
-
"T_BOOLEAN_OR",
|
| 66 |
-
"T_BOOLEAN_AND",
|
| 67 |
-
"'|'",
|
| 68 |
-
"'^'",
|
| 69 |
-
"'&'",
|
| 70 |
-
"T_IS_EQUAL",
|
| 71 |
-
"T_IS_NOT_EQUAL",
|
| 72 |
-
"T_IS_IDENTICAL",
|
| 73 |
-
"T_IS_NOT_IDENTICAL",
|
| 74 |
-
"T_SPACESHIP",
|
| 75 |
-
"'<'",
|
| 76 |
-
"T_IS_SMALLER_OR_EQUAL",
|
| 77 |
-
"'>'",
|
| 78 |
-
"T_IS_GREATER_OR_EQUAL",
|
| 79 |
-
"T_SL",
|
| 80 |
-
"T_SR",
|
| 81 |
-
"'+'",
|
| 82 |
-
"'-'",
|
| 83 |
-
"'.'",
|
| 84 |
-
"'*'",
|
| 85 |
-
"'/'",
|
| 86 |
-
"'%'",
|
| 87 |
-
"'!'",
|
| 88 |
-
"T_INSTANCEOF",
|
| 89 |
-
"'~'",
|
| 90 |
-
"T_INC",
|
| 91 |
-
"T_DEC",
|
| 92 |
-
"T_INT_CAST",
|
| 93 |
-
"T_DOUBLE_CAST",
|
| 94 |
-
"T_STRING_CAST",
|
| 95 |
-
"T_ARRAY_CAST",
|
| 96 |
-
"T_OBJECT_CAST",
|
| 97 |
-
"T_BOOL_CAST",
|
| 98 |
-
"T_UNSET_CAST",
|
| 99 |
-
"'@'",
|
| 100 |
-
"T_POW",
|
| 101 |
-
"'['",
|
| 102 |
-
"T_NEW",
|
| 103 |
-
"T_CLONE",
|
| 104 |
-
"T_EXIT",
|
| 105 |
-
"T_IF",
|
| 106 |
-
"T_ELSEIF",
|
| 107 |
-
"T_ELSE",
|
| 108 |
-
"T_ENDIF",
|
| 109 |
-
"T_LNUMBER",
|
| 110 |
-
"T_DNUMBER",
|
| 111 |
-
"T_STRING",
|
| 112 |
-
"T_STRING_VARNAME",
|
| 113 |
-
"T_VARIABLE",
|
| 114 |
-
"T_NUM_STRING",
|
| 115 |
-
"T_INLINE_HTML",
|
| 116 |
-
"T_ENCAPSED_AND_WHITESPACE",
|
| 117 |
-
"T_CONSTANT_ENCAPSED_STRING",
|
| 118 |
-
"T_ECHO",
|
| 119 |
-
"T_DO",
|
| 120 |
-
"T_WHILE",
|
| 121 |
-
"T_ENDWHILE",
|
| 122 |
-
"T_FOR",
|
| 123 |
-
"T_ENDFOR",
|
| 124 |
-
"T_FOREACH",
|
| 125 |
-
"T_ENDFOREACH",
|
| 126 |
-
"T_DECLARE",
|
| 127 |
-
"T_ENDDECLARE",
|
| 128 |
-
"T_AS",
|
| 129 |
-
"T_SWITCH",
|
| 130 |
-
"T_ENDSWITCH",
|
| 131 |
-
"T_CASE",
|
| 132 |
-
"T_DEFAULT",
|
| 133 |
-
"T_BREAK",
|
| 134 |
-
"T_CONTINUE",
|
| 135 |
-
"T_GOTO",
|
| 136 |
-
"T_FUNCTION",
|
| 137 |
-
"T_FN",
|
| 138 |
-
"T_CONST",
|
| 139 |
-
"T_RETURN",
|
| 140 |
-
"T_TRY",
|
| 141 |
-
"T_CATCH",
|
| 142 |
-
"T_FINALLY",
|
| 143 |
-
"T_THROW",
|
| 144 |
-
"T_USE",
|
| 145 |
-
"T_INSTEADOF",
|
| 146 |
-
"T_GLOBAL",
|
| 147 |
-
"T_STATIC",
|
| 148 |
-
"T_ABSTRACT",
|
| 149 |
-
"T_FINAL",
|
| 150 |
-
"T_PRIVATE",
|
| 151 |
-
"T_PROTECTED",
|
| 152 |
-
"T_PUBLIC",
|
| 153 |
-
"T_VAR",
|
| 154 |
-
"T_UNSET",
|
| 155 |
-
"T_ISSET",
|
| 156 |
-
"T_EMPTY",
|
| 157 |
-
"T_HALT_COMPILER",
|
| 158 |
-
"T_CLASS",
|
| 159 |
-
"T_TRAIT",
|
| 160 |
-
"T_INTERFACE",
|
| 161 |
-
"T_EXTENDS",
|
| 162 |
-
"T_IMPLEMENTS",
|
| 163 |
-
"T_OBJECT_OPERATOR",
|
| 164 |
-
"T_LIST",
|
| 165 |
-
"T_ARRAY",
|
| 166 |
-
"T_CALLABLE",
|
| 167 |
-
"T_CLASS_C",
|
| 168 |
-
"T_TRAIT_C",
|
| 169 |
-
"T_METHOD_C",
|
| 170 |
-
"T_FUNC_C",
|
| 171 |
-
"T_LINE",
|
| 172 |
-
"T_FILE",
|
| 173 |
-
"T_START_HEREDOC",
|
| 174 |
-
"T_END_HEREDOC",
|
| 175 |
-
"T_DOLLAR_OPEN_CURLY_BRACES",
|
| 176 |
-
"T_CURLY_OPEN",
|
| 177 |
-
"T_PAAMAYIM_NEKUDOTAYIM",
|
| 178 |
-
"T_NAMESPACE",
|
| 179 |
-
"T_NS_C",
|
| 180 |
-
"T_DIR",
|
| 181 |
-
"T_NS_SEPARATOR",
|
| 182 |
-
"T_ELLIPSIS",
|
| 183 |
-
"';'",
|
| 184 |
-
"'{'",
|
| 185 |
-
"'}'",
|
| 186 |
-
"'('",
|
| 187 |
-
"')'",
|
| 188 |
-
"'$'",
|
| 189 |
-
"'`'",
|
| 190 |
-
"']'",
|
| 191 |
-
"'\"'"
|
| 192 |
-
);
|
| 193 |
-
|
| 194 |
-
protected $tokenToSymbol = array(
|
| 195 |
-
0, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 196 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 197 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 198 |
-
159, 159, 159, 54, 158, 159, 155, 53, 36, 159,
|
| 199 |
-
153, 154, 51, 48, 7, 49, 50, 52, 159, 159,
|
| 200 |
-
159, 159, 159, 159, 159, 159, 159, 159, 30, 150,
|
| 201 |
-
42, 15, 44, 29, 66, 159, 159, 159, 159, 159,
|
| 202 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 203 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 204 |
-
159, 68, 159, 157, 35, 159, 156, 159, 159, 159,
|
| 205 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 206 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 207 |
-
159, 159, 159, 151, 34, 152, 56, 159, 159, 159,
|
| 208 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 209 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 210 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 211 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 212 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 213 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 214 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 215 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 216 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 217 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 218 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 219 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 220 |
-
159, 159, 159, 159, 159, 159, 1, 2, 3, 4,
|
| 221 |
-
5, 6, 8, 9, 10, 11, 12, 13, 14, 16,
|
| 222 |
-
17, 18, 19, 20, 21, 22, 23, 24, 25, 26,
|
| 223 |
-
27, 28, 31, 32, 33, 37, 38, 39, 40, 41,
|
| 224 |
-
43, 45, 46, 47, 55, 57, 58, 59, 60, 61,
|
| 225 |
-
62, 63, 64, 65, 67, 69, 70, 71, 72, 73,
|
| 226 |
-
74, 75, 76, 77, 78, 79, 80, 81, 82, 159,
|
| 227 |
-
159, 83, 84, 85, 86, 87, 88, 89, 90, 91,
|
| 228 |
-
92, 93, 94, 95, 96, 97, 98, 99, 100, 101,
|
| 229 |
-
102, 103, 104, 105, 106, 107, 108, 109, 110, 111,
|
| 230 |
-
112, 113, 114, 115, 116, 117, 118, 119, 120, 121,
|
| 231 |
-
122, 123, 124, 125, 126, 127, 128, 129, 130, 131,
|
| 232 |
-
132, 133, 134, 135, 136, 137, 138, 139, 159, 159,
|
| 233 |
-
159, 159, 159, 159, 140, 141, 142, 143, 144, 145,
|
| 234 |
-
146, 147, 148, 149
|
| 235 |
-
);
|
| 236 |
-
|
| 237 |
-
protected $action = array(
|
| 238 |
-
681, 682, 683, 684, 685, 283, 686, 687, 688, 724,
|
| 239 |
-
725, 222, 223, 224, 225, 226, 227, 228, 229, 230,
|
| 240 |
-
0, 231, 232, 233, 234, 235, 236, 237, 238, 239,
|
| 241 |
-
240, 241, 242,-32766,-32766,-32766,-32766,-32766,-32766,-32766,
|
| 242 |
-
-32766,-32767,-32767,-32767,-32767, 1052, 243, 244,-32766,-32766,
|
| 243 |
-
-32766,-32766,-32766, 689,-32766,-32766,-32766,-32766,-32766,-32766,
|
| 244 |
-
-32766,-32766,-32767,-32767,-32767,-32767,-32767, 690, 691, 692,
|
| 245 |
-
693, 694, 695, 696, 834, 27, 757, 959, 960, 961,
|
| 246 |
-
958, 957, 956, 697, 698, 699, 700, 701, 702, 703,
|
| 247 |
-
704, 705, 706, 707, 727, 728, 729, 730, 731, 719,
|
| 248 |
-
720, 721, 749, 722, 723, 708, 709, 710, 711, 712,
|
| 249 |
-
713, 714, 751, 752, 753, 754, 755, 756, 715, 716,
|
| 250 |
-
717, 718, 748, 739, 737, 738, 734, 735, 1188, 726,
|
| 251 |
-
732, 733, 740, 741, 743, 742, 744, 745, 54, 55,
|
| 252 |
-
426, 56, 57, 736, 747, 746, -220, 58, 59, 419,
|
| 253 |
-
60,-32766,-32766,-32766,-32766,-32766,-32766,-32766,-32766,-32766,
|
| 254 |
-
28,-32767,-32767,-32767,-32767,-32767,-32767,-32767,-32767, 97,
|
| 255 |
-
98, 99, 100, 101, 9, 906, 907,-32766, 1202, 761,
|
| 256 |
-
328, 764, 1188, 814, 61, 62, 52, 285, 500, 951,
|
| 257 |
-
63, 434, 64, 294, 295, 65, 66, 67, 68, 69,
|
| 258 |
-
70, 71, 72, 340, 25, 302, 73, 418,-32766,-32766,
|
| 259 |
-
-32766, 882, 1103, 1104, 761, 1080, 764,-32766,-32766,-32766,
|
| 260 |
-
475, -255, 298, 825, 835, 759, 219, 220, 221,-32766,
|
| 261 |
-
36,-32766,-32766,-32766,-32766,-32766,-32766, 125,-32766, 438,
|
| 262 |
-
-32766,-32766,-32766,-32766,-32766, 1052, 500, 206, 310, 434,
|
| 263 |
-
499, 423, 1052, 129, 439, 759, 336, 340, 483, 484,
|
| 264 |
-
10, 959, 960, 961, 958, 957, 956, 485, 486, 124,
|
| 265 |
-
1109, 1110, 1111, 1112, 1106, 1107, 313,-32766,-32766,-32766,
|
| 266 |
-
-32766, 500, 1113, 1108, 434, 219, 220, 221, 425, 41,
|
| 267 |
-
764, 336, 324, 1222, 325, 427, -126, -126, -126, -4,
|
| 268 |
-
835, 474,-32766,-32766,-32766, 823, 206, 913, 40, 21,
|
| 269 |
-
428, -126, 476, -126, 477, -126, 478, -126, 123, 429,
|
| 270 |
-
219, 220, 221, 31, 32, 430, 431, 354, 130, 33,
|
| 271 |
-
479, 883, 336, 74, 1203, 128, 352, 353, 480, 481,
|
| 272 |
-
912, 206, 247, 301, 482, 210, 1052, 806, 853, 432,
|
| 273 |
-
433, 312, 30, 297, 35, 106, 107, 108, 109, 110,
|
| 274 |
-
111, 112, 113, 114, 115, 116, 117, 118, 421, 1052,
|
| 275 |
-
296, 427, 1154, 837, 647, -126, 835, 474, 102, 103,
|
| 276 |
-
104, 823, 304, 816, 40, 21, 428, 332, 476, 632,
|
| 277 |
-
477, 422, 478, 298, 105, 429, 991, 993, 20, 31,
|
| 278 |
-
32, 430, 431, 933, 409, 33, 479, 220, 221, 74,
|
| 279 |
-
323,-32766, 352, 353, 480, 481,-32766,-32766,-32766, 424,
|
| 280 |
-
482, 1052, 448, 768, 853, 432, 433, 206,-32766,-32766,
|
| 281 |
-
-32766, 48, 906, 907, 1153, 1070, 339,-32766, 485,-32766,
|
| 282 |
-
-32766,-32766,-32766, 1231, 337, 500, 1232, 427, 434, 837,
|
| 283 |
-
647, -4, 835, 474, -224, 1052, 633, 823, 49, 434,
|
| 284 |
-
40, 21, 428, 937, 476, 776, 477, 777, 478, -504,
|
| 285 |
-
820, 429, -205, -205, -205, 31, 32, 430, 431,-32766,
|
| 286 |
-
-32766, 33, 479, 75,-32766, 74,-32766, 594, 352, 353,
|
| 287 |
-
480, 481,-32766,-32766,-32766, 119, 482, 526, 451, 806,
|
| 288 |
-
853, 432, 433, 240, 241, 242, 128,-32766,-32766,-32766,
|
| 289 |
-
411, 775, 51,-32766, 120,-32766,-32766,-32766, 500, 243,
|
| 290 |
-
244, 434, 552, 427, 417, 837, 647, -205,-32766, 474,
|
| 291 |
-
-32766,-32766, 1052, 823, 821, 351, 40, 21, 428, 1052,
|
| 292 |
-
476, 121, 477, 449, 478, 1115, 211, 429, -204, -204,
|
| 293 |
-
-204, 31, 32, 430, 431, 1115, 286, 33, 479, 818,
|
| 294 |
-
835, 74, 932, 299, 352, 353, 480, 481, 212, 219,
|
| 295 |
-
220, 221, 482, 335, 245, 806, 853, 432, 433,-32766,
|
| 296 |
-
-32766,-32766, 213, 79, 80, 81, 99, 100, 101, 650,
|
| 297 |
-
206, 237, 238, 239, 444, 122, 776, 649, 777, 300,
|
| 298 |
-
-32766, 837, 647, -204, 34, 248, 82, 83, 84, 85,
|
| 299 |
-
86, 87, 88, 89, 90, 91, 92, 93, 94, 95,
|
| 300 |
-
96, 97, 98, 99, 100, 101, 102, 103, 104, 1052,
|
| 301 |
-
304, 427, 221, 249, 835, 250, 78, 474, 206, 133,
|
| 302 |
-
336, 823, 105, 585, 40, 21, 428, 127, 476, -83,
|
| 303 |
-
477, 206, 478,-32766,-32766, 429, 219, 220, 221, 31,
|
| 304 |
-
32, 430, 316, 651, 658, 33, 479, 835, 661, 74,
|
| 305 |
-
243, 244, 352, 353, 458, 22, 833, 206, 463, 601,
|
| 306 |
-
482, 134, 362, 132, 608, 609, 769, 653,-32766, 948,
|
| 307 |
-
667, 936, 675, 846, 304, 105, 655, 43, 44, 45,
|
| 308 |
-
616, 761, 759, 46, 47, 427, 302, -274, 50, 837,
|
| 309 |
-
647, 474, 53, 131, 588, 823, 442, 468, 40, 21,
|
| 310 |
-
428, 762, 476, 606, 477,-32766, 478, 764, 447, 429,
|
| 311 |
-
964, 854, 532, 31, 32, 430, 855, 327, 427, 33,
|
| 312 |
-
479, 835, 641, 74, 474, 620, 352, 353, 823, -81,
|
| 313 |
-
628, 40, 21, 428, 482, 476, 11, 477, 450, 478,
|
| 314 |
-
282, 591, 429, 375, 605, 848, 31, 32, 430, 0,
|
| 315 |
-
659, 329, 33, 479, 835, 0, 74, 0, 0, 352,
|
| 316 |
-
353, 0, 0, 837, 647, -504, 0, 482, 326, 0,
|
| 317 |
-
331, 0, 0, 0, 0, 0, 0, 0, 309, 311,
|
| 318 |
-
-505, 0, 485, 664, 0, 0, 0, 0, 0, 0,
|
| 319 |
-
0, 0, 427, 1114, 1160, 0, 869, 647, 474, -413,
|
| 320 |
-
-405, 835, 823, 5, 6, 40, 21, 428, 12, 476,
|
| 321 |
-
14, 477, 361, 478, -414, 386, 429, 387, 24, 395,
|
| 322 |
-
31, 32, 430, 444, 534, 427, 33, 479, 412, 413,
|
| 323 |
-
74, 474, 38, 352, 353, 823, 39, 670, 40, 21,
|
| 324 |
-
428, 482, 476, 671, 477, 774, 478, 824, 832, 429,
|
| 325 |
-
811, 826, 885, 31, 32, 430, 876, 877, 809, 33,
|
| 326 |
-
479, 870, 867, 74, 865, 943, 352, 353, 944, 941,
|
| 327 |
-
837, 647, 427, 815, 482, 817, 819, 831, 474, 822,
|
| 328 |
-
940, 772, 823, 773, 942, 40, 21, 428, 78, 476,
|
| 329 |
-
648, 477, 652, 478, 654, 656, 429, 657, 246, 660,
|
| 330 |
-
31, 32, 430, 837, 647, 662, 33, 479, 663, 665,
|
| 331 |
-
74, 666, 126, 352, 353, 333, 214, 215, 334, 407,
|
| 332 |
-
408, 482, 216, 672, 217, 807, 1228, 1230, 771, 852,
|
| 333 |
-
770, 851, 1229, 850, 1066, 842, 208, 1054, 849, 1055,
|
| 334 |
-
840, 214, 215, 949, 1103, 1104, 874, 216,-32766, 217,
|
| 335 |
-
837, 647, 1105, 875, 462, 1227, 1196, 1194, 1179, 1192,
|
| 336 |
-
1094, 208, 924, 1200, 1190, 780, 781, 778, 779, 1103,
|
| 337 |
-
1104, 26, 29,-32766, 37, 42, 76, 1105, 77, 209,
|
| 338 |
-
284, 292, 293, 305, 306, 307, 308, 341, 410, 416,
|
| 339 |
-
-32766, 0, -221, -220, 16, 17, 18, 380, 459, 466,
|
| 340 |
-
573, 467, 1109, 1110, 1111, 1112, 1106, 1107, 385, 472,
|
| 341 |
-
567, 638, 1057, 1060, 1113, 1108, 914, 1119, 1056, 1032,
|
| 342 |
-
577, 218, 287,-32766, 1031, 573, 1096, 1109, 1110, 1111,
|
| 343 |
-
1112, 1106, 1107, 385, -423, 1050, 0, 1061, 1063, 1113,
|
| 344 |
-
1108, 1062, 1065, 1064, 1079, 1193, 218, 1178,-32766, 1174,
|
| 345 |
-
0, 1191, 1093, 1225, 1120, 1173, 612, 0, 1159
|
| 346 |
-
);
|
| 347 |
-
|
| 348 |
-
protected $actionCheck = array(
|
| 349 |
-
2, 3, 4, 5, 6, 13, 8, 9, 10, 11,
|
| 350 |
-
12, 32, 33, 34, 35, 36, 37, 38, 39, 40,
|
| 351 |
-
0, 42, 43, 44, 45, 46, 47, 48, 49, 50,
|
| 352 |
-
51, 52, 53, 8, 9, 10, 32, 33, 34, 35,
|
| 353 |
-
36, 37, 38, 39, 40, 12, 67, 68, 32, 33,
|
| 354 |
-
34, 35, 36, 55, 29, 8, 31, 32, 33, 34,
|
| 355 |
-
35, 36, 37, 38, 39, 40, 41, 69, 70, 71,
|
| 356 |
-
72, 73, 74, 75, 1, 7, 78, 114, 115, 116,
|
| 357 |
-
117, 118, 119, 85, 86, 87, 88, 89, 90, 91,
|
| 358 |
-
92, 93, 94, 95, 96, 97, 98, 99, 100, 101,
|
| 359 |
-
102, 103, 104, 105, 106, 107, 108, 109, 110, 111,
|
| 360 |
-
112, 113, 114, 115, 116, 117, 118, 119, 120, 121,
|
| 361 |
-
122, 123, 124, 125, 126, 127, 128, 129, 80, 131,
|
| 362 |
-
132, 133, 134, 135, 136, 137, 138, 139, 2, 3,
|
| 363 |
-
4, 5, 6, 145, 146, 147, 154, 11, 12, 125,
|
| 364 |
-
14, 32, 33, 34, 35, 36, 37, 38, 39, 40,
|
| 365 |
-
7, 42, 43, 44, 45, 42, 43, 44, 45, 46,
|
| 366 |
-
47, 48, 49, 50, 105, 132, 133, 153, 1, 78,
|
| 367 |
-
111, 80, 80, 150, 48, 49, 68, 7, 145, 120,
|
| 368 |
-
54, 148, 56, 57, 58, 59, 60, 61, 62, 63,
|
| 369 |
-
64, 65, 66, 155, 68, 69, 70, 71, 8, 9,
|
| 370 |
-
10, 30, 76, 77, 78, 114, 80, 8, 9, 10,
|
| 371 |
-
84, 152, 36, 150, 1, 78, 8, 9, 10, 29,
|
| 372 |
-
13, 31, 32, 33, 34, 35, 36, 7, 29, 103,
|
| 373 |
-
31, 32, 33, 34, 35, 12, 145, 29, 130, 148,
|
| 374 |
-
114, 7, 12, 151, 153, 78, 155, 155, 122, 123,
|
| 375 |
-
7, 114, 115, 116, 117, 118, 119, 131, 132, 151,
|
| 376 |
-
134, 135, 136, 137, 138, 139, 140, 32, 33, 34,
|
| 377 |
-
35, 145, 146, 147, 148, 8, 9, 10, 7, 153,
|
| 378 |
-
80, 155, 156, 83, 158, 72, 73, 74, 75, 0,
|
| 379 |
-
1, 78, 8, 9, 10, 82, 29, 154, 85, 86,
|
| 380 |
-
87, 88, 89, 90, 91, 92, 93, 94, 13, 96,
|
| 381 |
-
8, 9, 10, 100, 101, 102, 103, 7, 151, 106,
|
| 382 |
-
107, 150, 155, 110, 154, 149, 113, 114, 115, 116,
|
| 383 |
-
154, 29, 30, 36, 121, 7, 12, 124, 125, 126,
|
| 384 |
-
127, 7, 142, 143, 15, 16, 17, 18, 19, 20,
|
| 385 |
-
21, 22, 23, 24, 25, 26, 27, 28, 7, 12,
|
| 386 |
-
36, 72, 154, 150, 151, 152, 1, 78, 51, 52,
|
| 387 |
-
53, 82, 55, 150, 85, 86, 87, 7, 89, 78,
|
| 388 |
-
91, 7, 93, 36, 67, 96, 57, 58, 154, 100,
|
| 389 |
-
101, 102, 103, 150, 105, 106, 107, 9, 10, 110,
|
| 390 |
-
111, 80, 113, 114, 115, 116, 8, 9, 10, 7,
|
| 391 |
-
121, 12, 30, 124, 125, 126, 127, 29, 32, 33,
|
| 392 |
-
34, 68, 132, 133, 157, 154, 68, 29, 131, 31,
|
| 393 |
-
32, 33, 34, 78, 145, 145, 81, 72, 148, 150,
|
| 394 |
-
151, 152, 1, 78, 154, 12, 145, 82, 68, 148,
|
| 395 |
-
85, 86, 87, 152, 89, 103, 91, 105, 93, 130,
|
| 396 |
-
150, 96, 97, 98, 99, 100, 101, 102, 103, 8,
|
| 397 |
-
9, 106, 107, 149, 153, 110, 155, 83, 113, 114,
|
| 398 |
-
115, 116, 8, 9, 10, 15, 121, 83, 130, 124,
|
| 399 |
-
125, 126, 127, 51, 52, 53, 149, 8, 9, 10,
|
| 400 |
-
148, 150, 68, 29, 151, 31, 32, 33, 145, 67,
|
| 401 |
-
68, 148, 79, 72, 7, 150, 151, 152, 29, 78,
|
| 402 |
-
31, 32, 12, 82, 150, 7, 85, 86, 87, 12,
|
| 403 |
-
89, 151, 91, 151, 93, 141, 15, 96, 97, 98,
|
| 404 |
-
99, 100, 101, 102, 103, 141, 36, 106, 107, 150,
|
| 405 |
-
1, 110, 150, 36, 113, 114, 115, 116, 15, 8,
|
| 406 |
-
9, 10, 121, 7, 13, 124, 125, 126, 127, 8,
|
| 407 |
-
9, 10, 15, 8, 9, 10, 48, 49, 50, 30,
|
| 408 |
-
29, 48, 49, 50, 148, 151, 103, 151, 105, 7,
|
| 409 |
-
29, 150, 151, 152, 29, 15, 31, 32, 33, 34,
|
| 410 |
-
35, 36, 37, 38, 39, 40, 41, 42, 43, 44,
|
| 411 |
-
45, 46, 47, 48, 49, 50, 51, 52, 53, 12,
|
| 412 |
-
55, 72, 10, 15, 1, 15, 151, 78, 29, 151,
|
| 413 |
-
155, 82, 67, 155, 85, 86, 87, 30, 89, 30,
|
| 414 |
-
91, 29, 93, 32, 33, 96, 8, 9, 10, 100,
|
| 415 |
-
101, 102, 30, 30, 30, 106, 107, 1, 30, 110,
|
| 416 |
-
67, 68, 113, 114, 73, 74, 30, 29, 73, 74,
|
| 417 |
-
121, 98, 99, 30, 108, 109, 150, 151, 32, 150,
|
| 418 |
-
151, 150, 151, 36, 55, 67, 30, 68, 68, 68,
|
| 419 |
-
75, 78, 78, 68, 68, 72, 69, 80, 68, 150,
|
| 420 |
-
151, 78, 68, 68, 88, 82, 103, 103, 85, 86,
|
| 421 |
-
87, 78, 89, 111, 91, 83, 93, 80, 87, 96,
|
| 422 |
-
80, 125, 83, 100, 101, 102, 125, 129, 72, 106,
|
| 423 |
-
107, 1, 90, 110, 78, 94, 113, 114, 82, 95,
|
| 424 |
-
92, 85, 86, 87, 121, 89, 95, 91, 95, 93,
|
| 425 |
-
95, 97, 96, 148, 97, 149, 100, 101, 102, -1,
|
| 426 |
-
30, 112, 106, 107, 1, -1, 110, -1, -1, 113,
|
| 427 |
-
114, -1, -1, 150, 151, 130, -1, 121, 128, -1,
|
| 428 |
-
128, -1, -1, -1, -1, -1, -1, -1, 130, 130,
|
| 429 |
-
130, -1, 131, 30, -1, -1, -1, -1, -1, -1,
|
| 430 |
-
-1, -1, 72, 141, 141, -1, 150, 151, 78, 144,
|
| 431 |
-
144, 1, 82, 144, 144, 85, 86, 87, 144, 89,
|
| 432 |
-
144, 91, 144, 93, 144, 148, 96, 148, 153, 148,
|
| 433 |
-
100, 101, 102, 148, 148, 72, 106, 107, 148, 148,
|
| 434 |
-
110, 78, 150, 113, 114, 82, 150, 150, 85, 86,
|
| 435 |
-
87, 121, 89, 150, 91, 150, 93, 150, 150, 96,
|
| 436 |
-
150, 150, 150, 100, 101, 102, 150, 150, 150, 106,
|
| 437 |
-
107, 150, 150, 110, 150, 150, 113, 114, 150, 150,
|
| 438 |
-
150, 151, 72, 150, 121, 150, 150, 150, 78, 150,
|
| 439 |
-
150, 150, 82, 150, 150, 85, 86, 87, 151, 89,
|
| 440 |
-
151, 91, 151, 93, 151, 151, 96, 151, 30, 151,
|
| 441 |
-
100, 101, 102, 150, 151, 151, 106, 107, 151, 151,
|
| 442 |
-
110, 151, 151, 113, 114, 151, 48, 49, 151, 151,
|
| 443 |
-
151, 121, 54, 152, 56, 152, 152, 152, 152, 152,
|
| 444 |
-
152, 152, 152, 152, 152, 152, 68, 152, 152, 152,
|
| 445 |
-
152, 48, 49, 152, 76, 77, 152, 54, 80, 56,
|
| 446 |
-
150, 151, 84, 152, 152, 152, 152, 152, 152, 152,
|
| 447 |
-
152, 68, 152, 152, 152, 152, 152, 152, 152, 76,
|
| 448 |
-
77, 153, 153, 80, 153, 153, 153, 84, 153, 153,
|
| 449 |
-
153, 153, 153, 153, 153, 153, 153, 153, 153, 153,
|
| 450 |
-
153, -1, 154, 154, 154, 154, 154, 154, 154, 154,
|
| 451 |
-
132, 154, 134, 135, 136, 137, 138, 139, 140, 154,
|
| 452 |
-
154, 154, 154, 154, 146, 147, 154, 154, 154, 154,
|
| 453 |
-
154, 153, 155, 155, 154, 132, 154, 134, 135, 136,
|
| 454 |
-
137, 138, 139, 140, 156, 156, -1, 157, 157, 146,
|
| 455 |
-
147, 157, 157, 157, 157, 157, 153, 157, 155, 157,
|
| 456 |
-
-1, 157, 157, 157, 157, 157, 157, -1, 158
|
| 457 |
-
);
|
| 458 |
-
|
| 459 |
-
protected $actionBase = array(
|
| 460 |
-
0, 223, 299, 375, 451, 102, 102, 311, 754, -2,
|
| 461 |
-
-2, 147, -2, -2, -2, 633, 740, 773, 740, 559,
|
| 462 |
-
666, 820, 820, 820, 186, 334, 334, 334, 357, 892,
|
| 463 |
-
443, 33, 233, 409, 617, 520, 527, 240, 240, 240,
|
| 464 |
-
240, 136, 136, 240, 240, 240, 240, 240, 240, 240,
|
| 465 |
-
240, 240, 240, 240, 240, 240, 240, 240, 240, 240,
|
| 466 |
-
240, 240, 240, 240, 240, 240, 240, 240, 240, 240,
|
| 467 |
-
240, 240, 240, 240, 240, 240, 240, 240, 240, 240,
|
| 468 |
-
240, 240, 240, 240, 240, 240, 240, 240, 240, 240,
|
| 469 |
-
240, 240, 240, 240, 240, 240, 240, 240, 240, 240,
|
| 470 |
-
240, 240, 240, 240, 240, 240, 240, 240, 240, 240,
|
| 471 |
-
240, 240, 240, 240, 240, 240, 240, 240, 240, 240,
|
| 472 |
-
240, 240, 240, 240, 240, 240, 240, 240, 240, 240,
|
| 473 |
-
240, 240, 240, 240, 240, 181, 73, 305, 217, 743,
|
| 474 |
-
745, 746, 747, 884, 665, 885, 823, 824, 653, 825,
|
| 475 |
-
826, 827, 828, 830, 822, 831, 919, 832, 575, 575,
|
| 476 |
-
575, 575, 575, 575, 575, 575, 575, 575, 575, 575,
|
| 477 |
-
47, 561, 218, 312, 277, 471, 648, 648, 648, 648,
|
| 478 |
-
648, 648, 648, 294, 294, 294, 294, 294, 294, 294,
|
| 479 |
-
294, 294, 294, 294, 294, 294, 294, 294, 294, 294,
|
| 480 |
-
294, 398, 571, 571, 571, 622, 888, 609, 913, 913,
|
| 481 |
-
913, 913, 913, 913, 913, 913, 913, 913, 913, 913,
|
| 482 |
-
913, 913, 913, 913, 913, 913, 913, 913, 913, 913,
|
| 483 |
-
913, 913, 913, 913, 913, 913, 913, 913, 913, 913,
|
| 484 |
-
913, 913, 913, 913, 913, 913, 913, 913, 913, 913,
|
| 485 |
-
913, 499, -21, -21, 484, 656, 408, 621, 209, 396,
|
| 486 |
-
200, 25, 25, 25, 25, 25, 245, 16, 4, 4,
|
| 487 |
-
4, 4, 339, 123, 123, 123, 123, 119, 119, 119,
|
| 488 |
-
119, 69, 307, 307, 671, 671, 637, 781, 538, 538,
|
| 489 |
-
543, 543, 101, 101, 101, 101, 101, 101, 101, 101,
|
| 490 |
-
101, 101, 24, 627, 857, 300, 300, 300, 300, 177,
|
| 491 |
-
177, 177, 43, 414, 673, 920, 43, 327, 327, 327,
|
| 492 |
-
452, 452, 452, 362, 649, 210, 331, 331, 331, 331,
|
| 493 |
-
210, 331, 331, 493, 493, 493, 485, 446, 642, 365,
|
| 494 |
-
488, 373, 390, 664, 814, 667, 821, 541, 690, 118,
|
| 495 |
-
700, 701, 887, 613, 887, 601, 605, 576, 676, 392,
|
| 496 |
-
850, 48, 181, 539, 444, 639, 749, 361, 751, 320,
|
| 497 |
-
384, 368, 536, 363, 244, 784, 753, 886, 890, 180,
|
| 498 |
-
670, 639, 639, 639, 153, 404, 787, 788, 363, -8,
|
| 499 |
-
603, 603, 603, 603, 833, 789, 603, 603, 603, 603,
|
| 500 |
-
834, 835, 253, 412, 836, 281, 750, 623, 623, 624,
|
| 501 |
-
624, 623, 623, 623, 623, 650, 657, 623, 839, 685,
|
| 502 |
-
685, 624, 647, 624, 650, 657, 842, 842, 842, 842,
|
| 503 |
-
624, 657, 624, 624, 623, 624, 685, 685, 657, 637,
|
| 504 |
-
685, 68, 657, 660, 623, 662, 662, 842, 707, 713,
|
| 505 |
-
624, 624, 608, 685, 685, 685, 608, 657, 842, 612,
|
| 506 |
-
616, 338, 685, 842, 632, 647, 632, 612, 657, 632,
|
| 507 |
-
647, 647, 632, 20, 619, 629, 841, 843, 855, 759,
|
| 508 |
-
606, 611, 848, 849, 845, 847, 838, 646, 696, 715,
|
| 509 |
-
717, 480, 630, 631, 635, 636, 679, 640, 668, 613,
|
| 510 |
-
695, 628, 628, 628, 655, 680, 655, 628, 628, 628,
|
| 511 |
-
628, 628, 628, 628, 628, 900, 675, 688, 669, 641,
|
| 512 |
-
718, 531, 615, 663, 553, 761, 672, 696, 696, 793,
|
| 513 |
-
878, 863, 898, 899, 643, 850, 876, 655, 901, 702,
|
| 514 |
-
230, 567, 851, 791, 687, 689, 655, 852, 655, 763,
|
| 515 |
-
655, 879, 794, 645, 795, 696, 796, 628, 882, 904,
|
| 516 |
-
905, 906, 907, 908, 910, 912, 914, 644, 915, 720,
|
| 517 |
-
626, 864, 344, 846, 676, 684, 691, 721, 797, 380,
|
| 518 |
-
916, 798, 655, 655, 764, 757, 655, 766, 722, 706,
|
| 519 |
-
860, 726, 865, 917, 672, 867, 655, 614, 799, 918,
|
| 520 |
-
380, 634, 625, 858, 651, 727, 856, 883, 854, 768,
|
| 521 |
-
590, 618, 800, 801, 802, 638, 728, 861, 862, 859,
|
| 522 |
-
731, 774, 620, 777, 658, 803, 778, 853, 732, 805,
|
| 523 |
-
806, 877, 654, 695, 686, 659, 661, 652, 780, 807,
|
| 524 |
-
875, 734, 735, 738, 808, 739, 811, 0, 0, 0,
|
| 525 |
-
0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
| 526 |
-
0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
| 527 |
-
0, 0, 0, 0, 0, 0, 0, 136, 136, 136,
|
| 528 |
-
136, -2, -2, -2, -2, 0, 0, -2, 0, 0,
|
| 529 |
-
0, 136, 136, 136, 136, 136, 136, 136, 136, 136,
|
| 530 |
-
136, 136, 136, 136, 136, 136, 136, 136, 136, 136,
|
| 531 |
-
136, 136, 136, 136, 136, 136, 136, 0, 0, 136,
|
| 532 |
-
136, 136, 136, 136, 136, 136, 136, 136, 136, 136,
|
| 533 |
-
136, 136, 136, 136, 136, 136, 136, 136, 136, 136,
|
| 534 |
-
136, 136, 136, 136, 136, 136, 136, 136, 136, 136,
|
| 535 |
-
136, 136, 136, 136, 136, 136, 136, 136, 136, 136,
|
| 536 |
-
136, 136, 136, 136, 136, 136, 136, 136, 136, 136,
|
| 537 |
-
136, 136, 136, 136, 136, 136, 136, 136, 136, 136,
|
| 538 |
-
136, 136, 136, 136, 136, 136, 136, 136, 136, 136,
|
| 539 |
-
136, 136, 136, 136, 136, 136, 136, 136, 136, 136,
|
| 540 |
-
136, 136, 136, 136, 136, 136, 136, 136, 136, 136,
|
| 541 |
-
136, 575, 575, 575, 575, 575, 575, 575, 575, 575,
|
| 542 |
-
575, 575, 575, 575, 575, 575, 575, 575, 575, 575,
|
| 543 |
-
575, 575, 575, 575, 0, 0, 0, 0, 0, 0,
|
| 544 |
-
0, 0, 0, 0, 0, 0, 575, -21, -21, -21,
|
| 545 |
-
-21, 575, -21, -21, -21, -21, -21, -21, -21, 575,
|
| 546 |
-
575, 575, 575, 575, 575, 575, 575, 575, 575, 575,
|
| 547 |
-
575, 575, 575, 575, 575, 575, 575, -21, 575, 575,
|
| 548 |
-
575, -21, 101, -21, 101, 101, 101, 101, 101, 101,
|
| 549 |
-
101, 101, 101, 101, 101, 101, 101, 101, 101, 101,
|
| 550 |
-
101, 101, 101, 101, 101, 101, 101, 101, 101, 101,
|
| 551 |
-
101, 101, 101, 101, 101, 101, 101, 101, 101, 101,
|
| 552 |
-
101, 101, 101, 101, 101, 101, 101, 575, 0, 0,
|
| 553 |
-
575, -21, 575, -21, 575, -21, 575, 575, 575, 575,
|
| 554 |
-
575, 575, -21, -21, -21, -21, -21, -21, 0, 327,
|
| 555 |
-
327, 327, 327, -21, -21, -21, -21, -37, 101, 101,
|
| 556 |
-
101, 101, 101, 101, 327, 327, 452, 452, 0, 0,
|
| 557 |
-
0, 0, 0, 0, 0, 0, 0, 0, 101, -37,
|
| 558 |
-
101, 623, 623, 623, 623, 647, 647, 647, 623, 210,
|
| 559 |
-
210, 210, 623, 0, 0, 0, 0, 0, 0, 623,
|
| 560 |
-
210, 0, 101, 101, 101, 101, 0, 101, 101, 623,
|
| 561 |
-
623, 623, 647, 623, 210, 647, 647, 623, 685, 583,
|
| 562 |
-
583, 583, 583, 380, 363, 0, 623, 623, 647, 647,
|
| 563 |
-
647, 0, 0, 0, 685, 0, 624, 0, 0, 0,
|
| 564 |
-
0, 628, 230, 0, 528, 0, 0, 0, 0, 0,
|
| 565 |
-
0, 643, 528, 592, 592, 0, 644, 628, 628, 628,
|
| 566 |
-
0, 0, 643, 643, 0, 0, 0, 0, 0, 0,
|
| 567 |
-
566, 643, 0, 0, 0, 0, 566, 517, 0, 0,
|
| 568 |
-
517, 0, 380
|
| 569 |
-
);
|
| 570 |
-
|
| 571 |
-
protected $actionDefault = array(
|
| 572 |
-
3,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 573 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 574 |
-
32767,32767,32767,32767,32767, 533, 533, 488,32767,32767,
|
| 575 |
-
32767,32767,32767,32767,32767,32767,32767, 293, 293, 293,
|
| 576 |
-
32767,32767,32767, 521, 521, 521, 521, 521, 521, 521,
|
| 577 |
-
521, 521, 521, 521,32767,32767,32767,32767,32767, 376,
|
| 578 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 579 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 580 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 581 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 582 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 583 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 584 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 585 |
-
32767,32767,32767,32767,32767,32767,32767, 382, 538,32767,
|
| 586 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 587 |
-
32767,32767,32767,32767,32767,32767,32767,32767, 357, 358,
|
| 588 |
-
360, 361, 292, 541, 522, 241, 383, 537, 291, 243,
|
| 589 |
-
321, 492,32767,32767,32767, 323, 120, 252, 197, 491,
|
| 590 |
-
123, 290, 228, 375, 377, 322, 297, 302, 303, 304,
|
| 591 |
-
305, 306, 307, 308, 309, 310, 311, 312, 313, 314,
|
| 592 |
-
296, 448, 354, 353, 352, 450,32767, 449, 485, 485,
|
| 593 |
-
488,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 594 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 595 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 596 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 597 |
-
32767, 319, 476, 475, 320, 446, 324, 447, 326, 451,
|
| 598 |
-
325, 342, 343, 340, 341, 344, 453, 452, 469, 470,
|
| 599 |
-
467, 468, 295, 345, 346, 347, 348, 471, 472, 473,
|
| 600 |
-
474, 276,32767,32767, 532, 532,32767,32767, 333, 334,
|
| 601 |
-
460, 461,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 602 |
-
32767,32767,32767, 277,32767, 232, 232, 232, 232,32767,
|
| 603 |
-
32767,32767, 232,32767,32767,32767,32767, 328, 329, 327,
|
| 604 |
-
455, 456, 454,32767, 422,32767,32767,32767,32767,32767,
|
| 605 |
-
424,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 606 |
-
32767,32767, 493,32767,32767,32767,32767,32767, 506, 411,
|
| 607 |
-
32767,32767,32767, 404,32767, 216, 218, 165, 479,32767,
|
| 608 |
-
32767,32767,32767,32767, 511, 338,32767,32767,32767,32767,
|
| 609 |
-
32767, 548,32767, 506,32767,32767,32767,32767,32767,32767,
|
| 610 |
-
351, 330, 331, 332,32767,32767,32767,32767, 510, 504,
|
| 611 |
-
463, 464, 465, 466,32767,32767, 457, 458, 459, 462,
|
| 612 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 613 |
-
32767,32767,32767,32767,32767,32767, 169,32767, 419, 425,
|
| 614 |
-
425,32767,32767,32767,32767, 169,32767,32767,32767,32767,
|
| 615 |
-
32767, 169,32767,32767,32767,32767, 509, 508, 169,32767,
|
| 616 |
-
405, 487, 169, 182,32767, 180, 180,32767, 202, 202,
|
| 617 |
-
32767,32767, 184, 480, 499,32767, 184, 169,32767, 393,
|
| 618 |
-
171, 487,32767,32767, 234,32767, 234, 393, 169, 234,
|
| 619 |
-
32767,32767, 234,32767, 85, 429,32767,32767,32767,32767,
|
| 620 |
-
32767,32767,32767,32767,32767,32767,32767,32767, 406,32767,
|
| 621 |
-
32767,32767, 372, 373, 482, 495,32767, 496,32767, 404,
|
| 622 |
-
32767, 336, 337, 339, 316,32767, 318, 362, 363, 364,
|
| 623 |
-
365, 366, 367, 368, 370,32767, 409,32767, 412,32767,
|
| 624 |
-
32767,32767, 87, 112, 251,32767, 546, 87, 407,32767,
|
| 625 |
-
32767, 300, 546,32767,32767,32767,32767, 540,32767,32767,
|
| 626 |
-
294,32767,32767,32767, 87, 87, 247,32767, 167,32767,
|
| 627 |
-
530,32767, 547,32767, 504, 408,32767, 335,32767,32767,
|
| 628 |
-
32767,32767,32767,32767,32767,32767,32767, 505,32767,32767,
|
| 629 |
-
32767,32767, 223,32767, 442,32767, 87,32767,32767, 183,
|
| 630 |
-
32767,32767, 298, 242,32767,32767, 539,32767,32767,32767,
|
| 631 |
-
32767,32767,32767,32767,32767,32767, 168,32767,32767,32767,
|
| 632 |
-
185,32767,32767, 504,32767,32767,32767,32767,32767,32767,
|
| 633 |
-
32767, 289,32767,32767,32767,32767,32767,32767,32767, 504,
|
| 634 |
-
32767,32767, 227,32767,32767,32767,32767,32767,32767,32767,
|
| 635 |
-
32767,32767, 85, 60,32767, 270,32767,32767,32767,32767,
|
| 636 |
-
32767,32767,32767,32767,32767,32767,32767, 125, 125, 3,
|
| 637 |
-
125, 125, 254, 3, 254, 125, 254, 254, 125, 125,
|
| 638 |
-
125, 125, 125, 125, 125, 125, 125, 125, 210, 213,
|
| 639 |
-
202, 202, 162, 125, 125, 262
|
| 640 |
-
);
|
| 641 |
-
|
| 642 |
-
protected $goto = array(
|
| 643 |
-
165, 138, 138, 138, 165, 143, 146, 139, 140, 141,
|
| 644 |
-
148, 186, 167, 162, 162, 162, 162, 143, 143, 164,
|
| 645 |
-
164, 164, 164, 164, 164, 164, 164, 164, 164, 164,
|
| 646 |
-
158, 159, 160, 161, 183, 137, 184, 501, 502, 365,
|
| 647 |
-
503, 507, 508, 509, 510, 511, 512, 513, 514, 977,
|
| 648 |
-
142, 163, 144, 145, 147, 170, 175, 185, 202, 251,
|
| 649 |
-
254, 256, 258, 260, 261, 262, 263, 264, 265, 273,
|
| 650 |
-
274, 275, 276, 288, 289, 317, 318, 319, 381, 382,
|
| 651 |
-
383, 557, 187, 188, 189, 190, 191, 192, 193, 194,
|
| 652 |
-
195, 196, 197, 198, 199, 200, 149, 150, 151, 166,
|
| 653 |
-
152, 168, 153, 203, 169, 154, 155, 156, 204, 157,
|
| 654 |
-
135, 634, 575, 760, 575, 575, 575, 575, 575, 575,
|
| 655 |
-
575, 575, 575, 575, 575, 575, 575, 575, 575, 575,
|
| 656 |
-
575, 575, 575, 575, 575, 575, 575, 575, 575, 575,
|
| 657 |
-
575, 575, 575, 575, 575, 575, 575, 575, 575, 575,
|
| 658 |
-
575, 575, 575, 575, 575, 575, 575, 1116, 766, 1116,
|
| 659 |
-
1116, 1116, 1116, 1116, 1116, 1116, 1116, 1116, 1116, 1116,
|
| 660 |
-
1116, 1116, 1116, 1116, 1116, 1116, 1116, 1116, 1116, 1116,
|
| 661 |
-
1116, 1116, 1116, 1116, 1116, 1116, 1116, 1116, 1116, 1116,
|
| 662 |
-
1116, 1116, 1116, 1116, 1116, 1116, 1116, 1116, 1116, 1116,
|
| 663 |
-
1116, 1116, 505, 505, 505, 505, 505, 505, 516, 642,
|
| 664 |
-
516, 767, 505, 505, 505, 505, 505, 505, 505, 505,
|
| 665 |
-
505, 505, 517, 797, 517, 898, 898, 1207, 1207, 531,
|
| 666 |
-
589, 617, 862, 862, 862, 862, 173, 857, 863, 1092,
|
| 667 |
-
1091, 176, 177, 178, 390, 391, 392, 393, 172, 201,
|
| 668 |
-
205, 207, 255, 257, 259, 266, 267, 268, 269, 270,
|
| 669 |
-
271, 277, 278, 279, 280, 290, 291, 320, 321, 322,
|
| 670 |
-
396, 397, 398, 399, 174, 179, 252, 253, 180, 181,
|
| 671 |
-
182, 389, 619, 550, 550, 582, 546, 598, 765, 613,
|
| 672 |
-
614, 548, 548, 504, 506, 537, 554, 583, 586, 596,
|
| 673 |
-
603, 884, 866, 864, 866, 668, 828, 519, 893, 888,
|
| 674 |
-
574, 344, 574, 574, 574, 574, 574, 574, 574, 574,
|
| 675 |
-
574, 574, 574, 574, 574, 574, 574, 574, 574, 574,
|
| 676 |
-
574, 574, 574, 574, 574, 574, 574, 574, 574, 574,
|
| 677 |
-
574, 574, 574, 574, 574, 574, 574, 574, 574, 574,
|
| 678 |
-
574, 574, 574, 574, 574, 559, 560, 561, 562, 563,
|
| 679 |
-
564, 565, 566, 568, 599, 522, 558, 330, 315, 1219,
|
| 680 |
-
1219, 530, 592, 595, 640, 527, 527, 527, 868, 527,
|
| 681 |
-
600, 347, 406, 530, 530, 1219, 440, 440, 440, 440,
|
| 682 |
-
440, 440, 545, 527, 551, 954, 440, 440, 440, 440,
|
| 683 |
-
440, 440, 440, 440, 440, 440, 1081, 1211, 1081, 905,
|
| 684 |
-
905, 905, 905, 3, 4, 623, 905, 955, 626, 556,
|
| 685 |
-
905, 363, 1185, 581, 1185, 916, 371, 371, 371, 366,
|
| 686 |
-
1081, 1081, 1081, 1081, 790, 1081, 1081, 371, 371, 1184,
|
| 687 |
-
607, 1184, 1177, 371, 1165, 471, 1201, 1201, 1201, 527,
|
| 688 |
-
527, 371, 1233, 544, 576, 527, 527, 618, 1074, 527,
|
| 689 |
-
1204, 790, 790, 378, 1025, 922, 524, 922, 518, 902,
|
| 690 |
-
518, 911, 350, 1183, 975, 400, 528, 543, 786, 669,
|
| 691 |
-
570, 372, 376, 920, 604, 784, 555, 895, 624, 625,
|
| 692 |
-
891, 629, 630, 637, 639, 644, 646, 453, 455, 947,
|
| 693 |
-
645, 673, 1097, 404, 1117, 627, 945, 1199, 1199, 1199,
|
| 694 |
-
1035, 19, 15, 359, 1218, 1218, 1067, 872, 783, 783,
|
| 695 |
-
794, 963, 791, 791, 791, 793, 1072, 925, 782, 456,
|
| 696 |
-
1218, 569, 345, 346, 360, 524, 1077, 1078, 1221, 1162,
|
| 697 |
-
1074, 535, 23, 587, 469, 547, 0, 615, 373, 373,
|
| 698 |
-
373, 0, 0, 1075, 1176, 1075, 0, 0, 542, 0,
|
| 699 |
-
460, 0, 1076, 0, 0, 0, 0, 0, 0, 0,
|
| 700 |
-
0, 13, 0, 0, 0, 373, 0, 0, 622, 388,
|
| 701 |
-
0, 0, 0, 1073, 631, 0, 0, 0, 0, 0,
|
| 702 |
-
0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
| 703 |
-
0, 0, 0, 0, 0, 0, 0, 521, 541, 0,
|
| 704 |
-
0, 0, 0, 0, 0, 0, 0, 0, 0, 521,
|
| 705 |
-
0, 541, 0, 0, 0, 0, 0, 536, 520, 0,
|
| 706 |
-
525, 443, 0, 445, 0, 0, 0, 0, 0, 0,
|
| 707 |
-
0, 0, 0, 0, 0, 0, 0, 0, 789, 1226
|
| 708 |
-
);
|
| 709 |
-
|
| 710 |
-
protected $gotoCheck = array(
|
| 711 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 712 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 713 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 714 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 715 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 716 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 717 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 718 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 719 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 720 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 721 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 722 |
-
42, 56, 66, 5, 66, 66, 66, 66, 66, 66,
|
| 723 |
-
66, 66, 66, 66, 66, 66, 66, 66, 66, 66,
|
| 724 |
-
66, 66, 66, 66, 66, 66, 66, 66, 66, 66,
|
| 725 |
-
66, 66, 66, 66, 66, 66, 66, 66, 66, 66,
|
| 726 |
-
66, 66, 66, 66, 66, 66, 66, 124, 14, 124,
|
| 727 |
-
124, 124, 124, 124, 124, 124, 124, 124, 124, 124,
|
| 728 |
-
124, 124, 124, 124, 124, 124, 124, 124, 124, 124,
|
| 729 |
-
124, 124, 124, 124, 124, 124, 124, 124, 124, 124,
|
| 730 |
-
124, 124, 124, 124, 124, 124, 124, 124, 124, 124,
|
| 731 |
-
124, 124, 115, 115, 115, 115, 115, 115, 66, 8,
|
| 732 |
-
66, 15, 115, 115, 115, 115, 115, 115, 115, 115,
|
| 733 |
-
115, 115, 115, 28, 115, 74, 74, 74, 74, 99,
|
| 734 |
-
39, 39, 66, 66, 66, 66, 26, 66, 66, 122,
|
| 735 |
-
122, 26, 26, 26, 26, 26, 26, 26, 26, 26,
|
| 736 |
-
26, 26, 26, 26, 26, 26, 26, 26, 26, 26,
|
| 737 |
-
26, 26, 26, 26, 26, 26, 26, 26, 26, 26,
|
| 738 |
-
26, 26, 26, 26, 26, 26, 26, 26, 26, 26,
|
| 739 |
-
26, 50, 50, 50, 50, 50, 50, 64, 13, 64,
|
| 740 |
-
64, 50, 50, 50, 50, 50, 50, 50, 50, 50,
|
| 741 |
-
50, 13, 13, 13, 13, 13, 49, 13, 13, 13,
|
| 742 |
-
56, 69, 56, 56, 56, 56, 56, 56, 56, 56,
|
| 743 |
-
56, 56, 56, 56, 56, 56, 56, 56, 56, 56,
|
| 744 |
-
56, 56, 56, 56, 56, 56, 56, 56, 56, 56,
|
| 745 |
-
56, 56, 56, 56, 56, 56, 56, 56, 56, 56,
|
| 746 |
-
56, 56, 56, 56, 56, 108, 108, 108, 108, 108,
|
| 747 |
-
108, 108, 108, 108, 108, 10, 46, 123, 123, 140,
|
| 748 |
-
140, 46, 59, 59, 59, 10, 10, 10, 32, 10,
|
| 749 |
-
67, 67, 67, 46, 46, 140, 56, 56, 56, 56,
|
| 750 |
-
56, 56, 10, 10, 107, 95, 56, 56, 56, 56,
|
| 751 |
-
56, 56, 56, 56, 56, 56, 56, 138, 56, 56,
|
| 752 |
-
56, 56, 56, 29, 29, 60, 56, 95, 60, 2,
|
| 753 |
-
56, 60, 116, 2, 116, 81, 12, 12, 12, 45,
|
| 754 |
-
56, 56, 56, 56, 22, 56, 56, 12, 12, 117,
|
| 755 |
-
125, 117, 79, 12, 129, 56, 117, 117, 117, 10,
|
| 756 |
-
10, 12, 12, 10, 10, 10, 10, 48, 79, 10,
|
| 757 |
-
136, 22, 22, 47, 100, 12, 12, 12, 120, 76,
|
| 758 |
-
120, 78, 17, 117, 99, 21, 10, 31, 24, 31,
|
| 759 |
-
31, 11, 16, 82, 31, 23, 10, 31, 31, 31,
|
| 760 |
-
31, 31, 31, 31, 31, 31, 31, 7, 7, 7,
|
| 761 |
-
7, 71, 33, 20, 7, 7, 7, 8, 8, 8,
|
| 762 |
-
33, 33, 33, 33, 139, 139, 111, 68, 22, 22,
|
| 763 |
-
25, 97, 22, 22, 22, 22, 113, 83, 22, 62,
|
| 764 |
-
139, 33, 69, 69, 57, 12, 79, 79, 139, 128,
|
| 765 |
-
79, 57, 33, 63, 106, 57, -1, 33, 121, 121,
|
| 766 |
-
121, -1, -1, 79, 79, 79, -1, -1, 8, -1,
|
| 767 |
-
57, -1, 79, -1, -1, -1, -1, -1, -1, -1,
|
| 768 |
-
-1, 57, -1, -1, -1, 121, -1, -1, 12, 121,
|
| 769 |
-
-1, -1, -1, 12, 12, -1, -1, -1, -1, -1,
|
| 770 |
-
-1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
|
| 771 |
-
-1, -1, -1, -1, -1, -1, -1, 8, 8, -1,
|
| 772 |
-
-1, -1, -1, -1, -1, -1, -1, -1, -1, 8,
|
| 773 |
-
-1, 8, -1, -1, -1, -1, -1, 99, 8, -1,
|
| 774 |
-
8, 8, -1, 8, -1, -1, -1, -1, -1, -1,
|
| 775 |
-
-1, -1, -1, -1, -1, -1, -1, -1, 8, 8
|
| 776 |
-
);
|
| 777 |
-
|
| 778 |
-
protected $gotoBase = array(
|
| 779 |
-
0, 0, -230, 0, 0, 102, 0, 492, 198, 0,
|
| 780 |
-
42, 144, 113, 286, 156, 209, 132, 149, 0, 0,
|
| 781 |
-
95, 141, 111, 134, 143, 99, 30, 0, 213, -260,
|
| 782 |
-
0, -171, 358, 84, 0, 0, 0, 0, 0, 192,
|
| 783 |
-
0, 0, -24, 0, 0, 389, 342, 170, 174, 288,
|
| 784 |
-
-1, 0, 0, 0, 0, 0, 104, 103, 0, 66,
|
| 785 |
-
-51, 0, 83, 87, -367, 0, -94, 53, 94, -138,
|
| 786 |
-
0, 139, 0, 0, -57, 0, 157, 0, 155, 100,
|
| 787 |
-
0, 397, 129, 105, 0, 0, 0, 0, 0, 0,
|
| 788 |
-
0, 0, 0, 0, 0, 114, 0, 97, 0, 188,
|
| 789 |
-
160, 0, 0, 0, 0, 0, 77, 368, 311, 0,
|
| 790 |
-
0, 96, 0, 101, 0, -80, 120, 137, 0, 0,
|
| 791 |
-
166, 239, -71, 43, -49, 231, 0, 0, 78, 234,
|
| 792 |
-
0, 0, 0, 0, 0, 0, 175, 0, 380, 200,
|
| 793 |
-
55, 0, 0
|
| 794 |
-
);
|
| 795 |
-
|
| 796 |
-
protected $gotoDefault = array(
|
| 797 |
-
-32768, 473, 677, 2, 678, 750, 758, 610, 487, 643,
|
| 798 |
-
488, 523, 1195, 803, 804, 805, 368, 414, 489, 367,
|
| 799 |
-
401, 394, 792, 785, 787, 795, 171, 402, 798, 1,
|
| 800 |
-
800, 529, 836, 1026, 355, 808, 356, 602, 810, 539,
|
| 801 |
-
812, 813, 136, 369, 370, 540, 490, 377, 590, 827,
|
| 802 |
-
272, 374, 829, 357, 830, 839, 358, 470, 465, 571,
|
| 803 |
-
621, 435, 452, 584, 578, 549, 1089, 579, 871, 343,
|
| 804 |
-
879, 674, 887, 890, 491, 572, 901, 457, 909, 1102,
|
| 805 |
-
384, 915, 921, 926, 281, 929, 415, 403, 597, 934,
|
| 806 |
-
935, 7, 939, 635, 636, 8, 303, 962, 611, 976,
|
| 807 |
-
420, 1045, 1047, 492, 493, 533, 464, 515, 538, 494,
|
| 808 |
-
1068, 446, 405, 1071, 495, 496, 436, 437, 1086, 349,
|
| 809 |
-
1170, 348, 454, 314, 1157, 593, 1121, 461, 1210, 1166,
|
| 810 |
-
342, 497, 498, 364, 1189, 379, 1205, 441, 1212, 1220,
|
| 811 |
-
338, 553, 580
|
| 812 |
-
);
|
| 813 |
-
|
| 814 |
-
protected $ruleToNonTerminal = array(
|
| 815 |
-
0, 1, 3, 3, 2, 5, 5, 5, 5, 5,
|
| 816 |
-
5, 5, 5, 5, 5, 5, 5, 5, 5, 5,
|
| 817 |
-
5, 5, 5, 5, 5, 5, 5, 5, 5, 5,
|
| 818 |
-
5, 5, 5, 5, 5, 5, 5, 5, 5, 5,
|
| 819 |
-
5, 5, 5, 5, 5, 5, 5, 5, 5, 5,
|
| 820 |
-
5, 5, 5, 5, 5, 5, 5, 5, 5, 5,
|
| 821 |
-
5, 5, 5, 5, 5, 5, 5, 5, 5, 5,
|
| 822 |
-
5, 5, 5, 5, 6, 6, 6, 6, 6, 6,
|
| 823 |
-
6, 7, 7, 8, 9, 10, 10, 11, 12, 4,
|
| 824 |
-
4, 4, 4, 4, 4, 4, 4, 4, 4, 4,
|
| 825 |
-
17, 17, 18, 18, 18, 18, 20, 20, 16, 16,
|
| 826 |
-
21, 21, 22, 22, 23, 23, 24, 24, 19, 19,
|
| 827 |
-
25, 27, 27, 28, 29, 29, 31, 30, 30, 30,
|
| 828 |
-
30, 32, 32, 32, 32, 32, 32, 32, 32, 32,
|
| 829 |
-
32, 32, 32, 32, 32, 32, 32, 32, 32, 32,
|
| 830 |
-
32, 32, 32, 32, 32, 32, 32, 32, 32, 32,
|
| 831 |
-
13, 13, 53, 53, 55, 54, 54, 47, 47, 57,
|
| 832 |
-
57, 58, 58, 14, 15, 15, 15, 61, 61, 61,
|
| 833 |
-
62, 62, 65, 65, 63, 63, 67, 67, 40, 40,
|
| 834 |
-
49, 49, 52, 52, 52, 51, 51, 68, 41, 41,
|
| 835 |
-
41, 41, 69, 69, 70, 70, 71, 71, 38, 38,
|
| 836 |
-
34, 34, 72, 36, 36, 73, 35, 35, 37, 37,
|
| 837 |
-
48, 48, 48, 59, 59, 75, 75, 76, 76, 78,
|
| 838 |
-
78, 78, 77, 77, 60, 60, 79, 79, 79, 80,
|
| 839 |
-
80, 81, 81, 81, 43, 43, 82, 82, 82, 44,
|
| 840 |
-
44, 83, 83, 84, 84, 64, 85, 85, 85, 85,
|
| 841 |
-
90, 90, 91, 91, 92, 92, 92, 92, 92, 93,
|
| 842 |
-
94, 94, 89, 89, 86, 86, 88, 88, 96, 96,
|
| 843 |
-
95, 95, 95, 95, 95, 95, 87, 87, 98, 97,
|
| 844 |
-
97, 45, 45, 39, 39, 42, 42, 42, 42, 42,
|
| 845 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 846 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 847 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 848 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 849 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 850 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 851 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 852 |
-
42, 42, 42, 42, 42, 42, 42, 42, 42, 42,
|
| 853 |
-
33, 33, 46, 46, 103, 103, 104, 104, 104, 104,
|
| 854 |
-
110, 99, 99, 106, 106, 112, 112, 113, 114, 114,
|
| 855 |
-
114, 114, 114, 114, 66, 66, 56, 56, 56, 100,
|
| 856 |
-
100, 118, 118, 115, 115, 119, 119, 119, 119, 101,
|
| 857 |
-
101, 101, 105, 105, 105, 111, 111, 124, 124, 124,
|
| 858 |
-
124, 124, 124, 124, 124, 124, 124, 124, 124, 124,
|
| 859 |
-
26, 26, 26, 26, 26, 26, 126, 126, 126, 126,
|
| 860 |
-
126, 126, 126, 126, 126, 126, 126, 126, 126, 126,
|
| 861 |
-
126, 126, 126, 126, 126, 126, 126, 126, 126, 126,
|
| 862 |
-
126, 126, 126, 126, 126, 126, 126, 126, 126, 109,
|
| 863 |
-
109, 102, 102, 102, 102, 125, 125, 128, 128, 127,
|
| 864 |
-
127, 129, 129, 50, 50, 50, 50, 131, 131, 130,
|
| 865 |
-
130, 130, 130, 130, 132, 132, 117, 117, 120, 120,
|
| 866 |
-
116, 116, 134, 133, 133, 133, 133, 121, 121, 121,
|
| 867 |
-
121, 108, 108, 122, 122, 122, 122, 74, 135, 135,
|
| 868 |
-
136, 136, 136, 107, 107, 137, 137, 138, 138, 138,
|
| 869 |
-
138, 138, 123, 123, 123, 123, 140, 141, 139, 139,
|
| 870 |
-
139, 139, 139, 139, 139, 142, 142, 142
|
| 871 |
-
);
|
| 872 |
-
|
| 873 |
-
protected $ruleToLength = array(
|
| 874 |
-
1, 1, 2, 0, 1, 1, 1, 1, 1, 1,
|
| 875 |
-
1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
|
| 876 |
-
1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
|
| 877 |
-
1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
|
| 878 |
-
1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
|
| 879 |
-
1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
|
| 880 |
-
1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
|
| 881 |
-
1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
|
| 882 |
-
1, 1, 1, 1, 1, 1, 3, 1, 1, 1,
|
| 883 |
-
1, 1, 1, 3, 5, 4, 3, 4, 2, 3,
|
| 884 |
-
1, 1, 7, 8, 6, 7, 3, 1, 3, 1,
|
| 885 |
-
3, 1, 1, 3, 1, 2, 1, 2, 3, 1,
|
| 886 |
-
3, 3, 1, 3, 2, 0, 1, 1, 1, 1,
|
| 887 |
-
1, 3, 5, 8, 3, 5, 9, 3, 2, 3,
|
| 888 |
-
2, 3, 2, 3, 3, 3, 3, 1, 2, 2,
|
| 889 |
-
5, 7, 9, 5, 6, 3, 3, 2, 2, 1,
|
| 890 |
-
1, 1, 0, 2, 8, 0, 4, 1, 3, 0,
|
| 891 |
-
1, 0, 1, 10, 7, 6, 5, 1, 2, 2,
|
| 892 |
-
0, 2, 0, 2, 0, 2, 1, 3, 1, 4,
|
| 893 |
-
1, 4, 1, 1, 4, 1, 3, 3, 3, 4,
|
| 894 |
-
4, 5, 0, 2, 4, 3, 1, 1, 1, 4,
|
| 895 |
-
0, 2, 3, 0, 2, 4, 0, 2, 0, 3,
|
| 896 |
-
1, 2, 1, 1, 0, 1, 3, 4, 6, 1,
|
| 897 |
-
1, 1, 0, 1, 0, 2, 2, 3, 3, 1,
|
| 898 |
-
3, 1, 2, 2, 3, 1, 1, 2, 4, 3,
|
| 899 |
-
1, 1, 3, 2, 0, 1, 3, 3, 9, 3,
|
| 900 |
-
1, 3, 0, 2, 4, 5, 4, 4, 4, 3,
|
| 901 |
-
1, 1, 1, 3, 1, 1, 0, 1, 1, 2,
|
| 902 |
-
1, 1, 1, 1, 1, 1, 1, 3, 1, 1,
|
| 903 |
-
3, 3, 1, 0, 1, 1, 3, 3, 4, 4,
|
| 904 |
-
1, 2, 3, 3, 3, 3, 3, 3, 3, 3,
|
| 905 |
-
3, 3, 3, 3, 3, 2, 2, 2, 2, 3,
|
| 906 |
-
3, 3, 3, 3, 3, 3, 3, 3, 3, 3,
|
| 907 |
-
3, 3, 3, 3, 3, 3, 2, 2, 2, 2,
|
| 908 |
-
3, 3, 3, 3, 3, 3, 3, 3, 3, 3,
|
| 909 |
-
1, 3, 5, 4, 3, 4, 4, 2, 2, 2,
|
| 910 |
-
2, 2, 2, 2, 2, 2, 2, 2, 2, 2,
|
| 911 |
-
2, 1, 1, 1, 3, 2, 1, 2, 10, 11,
|
| 912 |
-
3, 3, 2, 4, 4, 3, 4, 4, 4, 4,
|
| 913 |
-
7, 3, 2, 0, 4, 1, 3, 2, 2, 4,
|
| 914 |
-
6, 2, 2, 4, 1, 1, 1, 2, 3, 1,
|
| 915 |
-
1, 1, 1, 1, 1, 3, 3, 4, 4, 0,
|
| 916 |
-
2, 1, 0, 1, 1, 0, 1, 1, 1, 1,
|
| 917 |
-
1, 1, 1, 1, 1, 1, 1, 1, 3, 2,
|
| 918 |
-
1, 3, 1, 4, 3, 1, 3, 3, 3, 3,
|
| 919 |
-
3, 3, 3, 3, 3, 3, 3, 3, 3, 3,
|
| 920 |
-
3, 3, 3, 2, 2, 2, 2, 3, 3, 3,
|
| 921 |
-
3, 3, 3, 3, 3, 5, 4, 4, 3, 1,
|
| 922 |
-
3, 1, 1, 3, 3, 0, 2, 0, 1, 3,
|
| 923 |
-
1, 3, 1, 1, 1, 1, 1, 6, 4, 3,
|
| 924 |
-
4, 2, 4, 4, 1, 3, 1, 2, 1, 1,
|
| 925 |
-
4, 1, 1, 3, 6, 4, 4, 4, 4, 1,
|
| 926 |
-
4, 0, 1, 1, 3, 1, 1, 4, 3, 1,
|
| 927 |
-
1, 1, 0, 0, 2, 3, 1, 3, 1, 4,
|
| 928 |
-
2, 2, 2, 2, 1, 2, 1, 1, 1, 4,
|
| 929 |
-
3, 3, 3, 6, 3, 1, 1, 1
|
| 930 |
-
);
|
| 931 |
-
|
| 932 |
-
protected function initReduceCallbacks() {
|
| 933 |
-
$this->reduceCallbacks = [
|
| 934 |
-
0 => function ($stackPos) {
|
| 935 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 936 |
-
},
|
| 937 |
-
1 => function ($stackPos) {
|
| 938 |
-
$this->semValue = $this->handleNamespaces($this->semStack[$stackPos-(1-1)]);
|
| 939 |
-
},
|
| 940 |
-
2 => function ($stackPos) {
|
| 941 |
-
if (is_array($this->semStack[$stackPos-(2-2)])) { $this->semValue = array_merge($this->semStack[$stackPos-(2-1)], $this->semStack[$stackPos-(2-2)]); } else { $this->semStack[$stackPos-(2-1)][] = $this->semStack[$stackPos-(2-2)]; $this->semValue = $this->semStack[$stackPos-(2-1)]; };
|
| 942 |
-
},
|
| 943 |
-
3 => function ($stackPos) {
|
| 944 |
-
$this->semValue = array();
|
| 945 |
-
},
|
| 946 |
-
4 => function ($stackPos) {
|
| 947 |
-
$startAttributes = $this->lookaheadStartAttributes; if (isset($startAttributes['comments'])) { $nop = new Stmt\Nop($this->createCommentNopAttributes($startAttributes['comments'])); } else { $nop = null; };
|
| 948 |
-
if ($nop !== null) { $this->semStack[$stackPos-(1-1)][] = $nop; } $this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 949 |
-
},
|
| 950 |
-
5 => function ($stackPos) {
|
| 951 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 952 |
-
},
|
| 953 |
-
6 => function ($stackPos) {
|
| 954 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 955 |
-
},
|
| 956 |
-
7 => function ($stackPos) {
|
| 957 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 958 |
-
},
|
| 959 |
-
8 => function ($stackPos) {
|
| 960 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 961 |
-
},
|
| 962 |
-
9 => function ($stackPos) {
|
| 963 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 964 |
-
},
|
| 965 |
-
10 => function ($stackPos) {
|
| 966 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 967 |
-
},
|
| 968 |
-
11 => function ($stackPos) {
|
| 969 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 970 |
-
},
|
| 971 |
-
12 => function ($stackPos) {
|
| 972 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 973 |
-
},
|
| 974 |
-
13 => function ($stackPos) {
|
| 975 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 976 |
-
},
|
| 977 |
-
14 => function ($stackPos) {
|
| 978 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 979 |
-
},
|
| 980 |
-
15 => function ($stackPos) {
|
| 981 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 982 |
-
},
|
| 983 |
-
16 => function ($stackPos) {
|
| 984 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 985 |
-
},
|
| 986 |
-
17 => function ($stackPos) {
|
| 987 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 988 |
-
},
|
| 989 |
-
18 => function ($stackPos) {
|
| 990 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 991 |
-
},
|
| 992 |
-
19 => function ($stackPos) {
|
| 993 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 994 |
-
},
|
| 995 |
-
20 => function ($stackPos) {
|
| 996 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 997 |
-
},
|
| 998 |
-
21 => function ($stackPos) {
|
| 999 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1000 |
-
},
|
| 1001 |
-
22 => function ($stackPos) {
|
| 1002 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1003 |
-
},
|
| 1004 |
-
23 => function ($stackPos) {
|
| 1005 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1006 |
-
},
|
| 1007 |
-
24 => function ($stackPos) {
|
| 1008 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1009 |
-
},
|
| 1010 |
-
25 => function ($stackPos) {
|
| 1011 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1012 |
-
},
|
| 1013 |
-
26 => function ($stackPos) {
|
| 1014 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1015 |
-
},
|
| 1016 |
-
27 => function ($stackPos) {
|
| 1017 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1018 |
-
},
|
| 1019 |
-
28 => function ($stackPos) {
|
| 1020 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1021 |
-
},
|
| 1022 |
-
29 => function ($stackPos) {
|
| 1023 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1024 |
-
},
|
| 1025 |
-
30 => function ($stackPos) {
|
| 1026 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1027 |
-
},
|
| 1028 |
-
31 => function ($stackPos) {
|
| 1029 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1030 |
-
},
|
| 1031 |
-
32 => function ($stackPos) {
|
| 1032 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1033 |
-
},
|
| 1034 |
-
33 => function ($stackPos) {
|
| 1035 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1036 |
-
},
|
| 1037 |
-
34 => function ($stackPos) {
|
| 1038 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1039 |
-
},
|
| 1040 |
-
35 => function ($stackPos) {
|
| 1041 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1042 |
-
},
|
| 1043 |
-
36 => function ($stackPos) {
|
| 1044 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1045 |
-
},
|
| 1046 |
-
37 => function ($stackPos) {
|
| 1047 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1048 |
-
},
|
| 1049 |
-
38 => function ($stackPos) {
|
| 1050 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1051 |
-
},
|
| 1052 |
-
39 => function ($stackPos) {
|
| 1053 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1054 |
-
},
|
| 1055 |
-
40 => function ($stackPos) {
|
| 1056 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1057 |
-
},
|
| 1058 |
-
41 => function ($stackPos) {
|
| 1059 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1060 |
-
},
|
| 1061 |
-
42 => function ($stackPos) {
|
| 1062 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1063 |
-
},
|
| 1064 |
-
43 => function ($stackPos) {
|
| 1065 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1066 |
-
},
|
| 1067 |
-
44 => function ($stackPos) {
|
| 1068 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1069 |
-
},
|
| 1070 |
-
45 => function ($stackPos) {
|
| 1071 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1072 |
-
},
|
| 1073 |
-
46 => function ($stackPos) {
|
| 1074 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1075 |
-
},
|
| 1076 |
-
47 => function ($stackPos) {
|
| 1077 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1078 |
-
},
|
| 1079 |
-
48 => function ($stackPos) {
|
| 1080 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1081 |
-
},
|
| 1082 |
-
49 => function ($stackPos) {
|
| 1083 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1084 |
-
},
|
| 1085 |
-
50 => function ($stackPos) {
|
| 1086 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1087 |
-
},
|
| 1088 |
-
51 => function ($stackPos) {
|
| 1089 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1090 |
-
},
|
| 1091 |
-
52 => function ($stackPos) {
|
| 1092 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1093 |
-
},
|
| 1094 |
-
53 => function ($stackPos) {
|
| 1095 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1096 |
-
},
|
| 1097 |
-
54 => function ($stackPos) {
|
| 1098 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1099 |
-
},
|
| 1100 |
-
55 => function ($stackPos) {
|
| 1101 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1102 |
-
},
|
| 1103 |
-
56 => function ($stackPos) {
|
| 1104 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1105 |
-
},
|
| 1106 |
-
57 => function ($stackPos) {
|
| 1107 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1108 |
-
},
|
| 1109 |
-
58 => function ($stackPos) {
|
| 1110 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1111 |
-
},
|
| 1112 |
-
59 => function ($stackPos) {
|
| 1113 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1114 |
-
},
|
| 1115 |
-
60 => function ($stackPos) {
|
| 1116 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1117 |
-
},
|
| 1118 |
-
61 => function ($stackPos) {
|
| 1119 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1120 |
-
},
|
| 1121 |
-
62 => function ($stackPos) {
|
| 1122 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1123 |
-
},
|
| 1124 |
-
63 => function ($stackPos) {
|
| 1125 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1126 |
-
},
|
| 1127 |
-
64 => function ($stackPos) {
|
| 1128 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1129 |
-
},
|
| 1130 |
-
65 => function ($stackPos) {
|
| 1131 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1132 |
-
},
|
| 1133 |
-
66 => function ($stackPos) {
|
| 1134 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1135 |
-
},
|
| 1136 |
-
67 => function ($stackPos) {
|
| 1137 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1138 |
-
},
|
| 1139 |
-
68 => function ($stackPos) {
|
| 1140 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1141 |
-
},
|
| 1142 |
-
69 => function ($stackPos) {
|
| 1143 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1144 |
-
},
|
| 1145 |
-
70 => function ($stackPos) {
|
| 1146 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1147 |
-
},
|
| 1148 |
-
71 => function ($stackPos) {
|
| 1149 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1150 |
-
},
|
| 1151 |
-
72 => function ($stackPos) {
|
| 1152 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1153 |
-
},
|
| 1154 |
-
73 => function ($stackPos) {
|
| 1155 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1156 |
-
},
|
| 1157 |
-
74 => function ($stackPos) {
|
| 1158 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1159 |
-
},
|
| 1160 |
-
75 => function ($stackPos) {
|
| 1161 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1162 |
-
},
|
| 1163 |
-
76 => function ($stackPos) {
|
| 1164 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1165 |
-
},
|
| 1166 |
-
77 => function ($stackPos) {
|
| 1167 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1168 |
-
},
|
| 1169 |
-
78 => function ($stackPos) {
|
| 1170 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1171 |
-
},
|
| 1172 |
-
79 => function ($stackPos) {
|
| 1173 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1174 |
-
},
|
| 1175 |
-
80 => function ($stackPos) {
|
| 1176 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1177 |
-
},
|
| 1178 |
-
81 => function ($stackPos) {
|
| 1179 |
-
$this->semValue = new Node\Identifier($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1180 |
-
},
|
| 1181 |
-
82 => function ($stackPos) {
|
| 1182 |
-
$this->semValue = new Node\Identifier($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1183 |
-
},
|
| 1184 |
-
83 => function ($stackPos) {
|
| 1185 |
-
$this->semValue = new Node\Identifier($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1186 |
-
},
|
| 1187 |
-
84 => function ($stackPos) {
|
| 1188 |
-
$this->semValue = new Node\Identifier($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1189 |
-
},
|
| 1190 |
-
85 => function ($stackPos) {
|
| 1191 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1192 |
-
},
|
| 1193 |
-
86 => function ($stackPos) {
|
| 1194 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1195 |
-
},
|
| 1196 |
-
87 => function ($stackPos) {
|
| 1197 |
-
$this->semValue = new Name($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1198 |
-
},
|
| 1199 |
-
88 => function ($stackPos) {
|
| 1200 |
-
$this->semValue = new Expr\Variable(substr($this->semStack[$stackPos-(1-1)], 1), $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1201 |
-
},
|
| 1202 |
-
89 => function ($stackPos) {
|
| 1203 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1204 |
-
},
|
| 1205 |
-
90 => function ($stackPos) {
|
| 1206 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1207 |
-
},
|
| 1208 |
-
91 => function ($stackPos) {
|
| 1209 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1210 |
-
},
|
| 1211 |
-
92 => function ($stackPos) {
|
| 1212 |
-
$this->semValue = new Stmt\HaltCompiler($this->lexer->handleHaltCompiler(), $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1213 |
-
},
|
| 1214 |
-
93 => function ($stackPos) {
|
| 1215 |
-
$this->semValue = new Stmt\Namespace_($this->semStack[$stackPos-(3-2)], null, $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1216 |
-
$this->semValue->setAttribute('kind', Stmt\Namespace_::KIND_SEMICOLON);
|
| 1217 |
-
$this->checkNamespace($this->semValue);
|
| 1218 |
-
},
|
| 1219 |
-
94 => function ($stackPos) {
|
| 1220 |
-
$this->semValue = new Stmt\Namespace_($this->semStack[$stackPos-(5-2)], $this->semStack[$stackPos-(5-4)], $this->startAttributeStack[$stackPos-(5-1)] + $this->endAttributes);
|
| 1221 |
-
$this->semValue->setAttribute('kind', Stmt\Namespace_::KIND_BRACED);
|
| 1222 |
-
$this->checkNamespace($this->semValue);
|
| 1223 |
-
},
|
| 1224 |
-
95 => function ($stackPos) {
|
| 1225 |
-
$this->semValue = new Stmt\Namespace_(null, $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 1226 |
-
$this->semValue->setAttribute('kind', Stmt\Namespace_::KIND_BRACED);
|
| 1227 |
-
$this->checkNamespace($this->semValue);
|
| 1228 |
-
},
|
| 1229 |
-
96 => function ($stackPos) {
|
| 1230 |
-
$this->semValue = new Stmt\Use_($this->semStack[$stackPos-(3-2)], Stmt\Use_::TYPE_NORMAL, $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1231 |
-
},
|
| 1232 |
-
97 => function ($stackPos) {
|
| 1233 |
-
$this->semValue = new Stmt\Use_($this->semStack[$stackPos-(4-3)], $this->semStack[$stackPos-(4-2)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 1234 |
-
},
|
| 1235 |
-
98 => function ($stackPos) {
|
| 1236 |
-
$this->semValue = $this->semStack[$stackPos-(2-1)];
|
| 1237 |
-
},
|
| 1238 |
-
99 => function ($stackPos) {
|
| 1239 |
-
$this->semValue = new Stmt\Const_($this->semStack[$stackPos-(3-2)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1240 |
-
},
|
| 1241 |
-
100 => function ($stackPos) {
|
| 1242 |
-
$this->semValue = Stmt\Use_::TYPE_FUNCTION;
|
| 1243 |
-
},
|
| 1244 |
-
101 => function ($stackPos) {
|
| 1245 |
-
$this->semValue = Stmt\Use_::TYPE_CONSTANT;
|
| 1246 |
-
},
|
| 1247 |
-
102 => function ($stackPos) {
|
| 1248 |
-
$this->semValue = new Stmt\GroupUse(new Name($this->semStack[$stackPos-(7-3)], $this->startAttributeStack[$stackPos-(7-3)] + $this->endAttributeStack[$stackPos-(7-3)]), $this->semStack[$stackPos-(7-6)], $this->semStack[$stackPos-(7-2)], $this->startAttributeStack[$stackPos-(7-1)] + $this->endAttributes);
|
| 1249 |
-
},
|
| 1250 |
-
103 => function ($stackPos) {
|
| 1251 |
-
$this->semValue = new Stmt\GroupUse(new Name($this->semStack[$stackPos-(8-4)], $this->startAttributeStack[$stackPos-(8-4)] + $this->endAttributeStack[$stackPos-(8-4)]), $this->semStack[$stackPos-(8-7)], $this->semStack[$stackPos-(8-2)], $this->startAttributeStack[$stackPos-(8-1)] + $this->endAttributes);
|
| 1252 |
-
},
|
| 1253 |
-
104 => function ($stackPos) {
|
| 1254 |
-
$this->semValue = new Stmt\GroupUse(new Name($this->semStack[$stackPos-(6-2)], $this->startAttributeStack[$stackPos-(6-2)] + $this->endAttributeStack[$stackPos-(6-2)]), $this->semStack[$stackPos-(6-5)], Stmt\Use_::TYPE_UNKNOWN, $this->startAttributeStack[$stackPos-(6-1)] + $this->endAttributes);
|
| 1255 |
-
},
|
| 1256 |
-
105 => function ($stackPos) {
|
| 1257 |
-
$this->semValue = new Stmt\GroupUse(new Name($this->semStack[$stackPos-(7-3)], $this->startAttributeStack[$stackPos-(7-3)] + $this->endAttributeStack[$stackPos-(7-3)]), $this->semStack[$stackPos-(7-6)], Stmt\Use_::TYPE_UNKNOWN, $this->startAttributeStack[$stackPos-(7-1)] + $this->endAttributes);
|
| 1258 |
-
},
|
| 1259 |
-
106 => function ($stackPos) {
|
| 1260 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1261 |
-
},
|
| 1262 |
-
107 => function ($stackPos) {
|
| 1263 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1264 |
-
},
|
| 1265 |
-
108 => function ($stackPos) {
|
| 1266 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1267 |
-
},
|
| 1268 |
-
109 => function ($stackPos) {
|
| 1269 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1270 |
-
},
|
| 1271 |
-
110 => function ($stackPos) {
|
| 1272 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1273 |
-
},
|
| 1274 |
-
111 => function ($stackPos) {
|
| 1275 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1276 |
-
},
|
| 1277 |
-
112 => function ($stackPos) {
|
| 1278 |
-
$this->semValue = new Stmt\UseUse($this->semStack[$stackPos-(1-1)], null, Stmt\Use_::TYPE_UNKNOWN, $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes); $this->checkUseUse($this->semValue, $stackPos-(1-1));
|
| 1279 |
-
},
|
| 1280 |
-
113 => function ($stackPos) {
|
| 1281 |
-
$this->semValue = new Stmt\UseUse($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], Stmt\Use_::TYPE_UNKNOWN, $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes); $this->checkUseUse($this->semValue, $stackPos-(3-3));
|
| 1282 |
-
},
|
| 1283 |
-
114 => function ($stackPos) {
|
| 1284 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1285 |
-
},
|
| 1286 |
-
115 => function ($stackPos) {
|
| 1287 |
-
$this->semValue = $this->semStack[$stackPos-(2-2)];
|
| 1288 |
-
},
|
| 1289 |
-
116 => function ($stackPos) {
|
| 1290 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)]; $this->semValue->type = Stmt\Use_::TYPE_NORMAL;
|
| 1291 |
-
},
|
| 1292 |
-
117 => function ($stackPos) {
|
| 1293 |
-
$this->semValue = $this->semStack[$stackPos-(2-2)]; $this->semValue->type = $this->semStack[$stackPos-(2-1)];
|
| 1294 |
-
},
|
| 1295 |
-
118 => function ($stackPos) {
|
| 1296 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1297 |
-
},
|
| 1298 |
-
119 => function ($stackPos) {
|
| 1299 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1300 |
-
},
|
| 1301 |
-
120 => function ($stackPos) {
|
| 1302 |
-
$this->semValue = new Node\Const_($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1303 |
-
},
|
| 1304 |
-
121 => function ($stackPos) {
|
| 1305 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1306 |
-
},
|
| 1307 |
-
122 => function ($stackPos) {
|
| 1308 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1309 |
-
},
|
| 1310 |
-
123 => function ($stackPos) {
|
| 1311 |
-
$this->semValue = new Node\Const_($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1312 |
-
},
|
| 1313 |
-
124 => function ($stackPos) {
|
| 1314 |
-
if (is_array($this->semStack[$stackPos-(2-2)])) { $this->semValue = array_merge($this->semStack[$stackPos-(2-1)], $this->semStack[$stackPos-(2-2)]); } else { $this->semStack[$stackPos-(2-1)][] = $this->semStack[$stackPos-(2-2)]; $this->semValue = $this->semStack[$stackPos-(2-1)]; };
|
| 1315 |
-
},
|
| 1316 |
-
125 => function ($stackPos) {
|
| 1317 |
-
$this->semValue = array();
|
| 1318 |
-
},
|
| 1319 |
-
126 => function ($stackPos) {
|
| 1320 |
-
$startAttributes = $this->lookaheadStartAttributes; if (isset($startAttributes['comments'])) { $nop = new Stmt\Nop($this->createCommentNopAttributes($startAttributes['comments'])); } else { $nop = null; };
|
| 1321 |
-
if ($nop !== null) { $this->semStack[$stackPos-(1-1)][] = $nop; } $this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1322 |
-
},
|
| 1323 |
-
127 => function ($stackPos) {
|
| 1324 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1325 |
-
},
|
| 1326 |
-
128 => function ($stackPos) {
|
| 1327 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1328 |
-
},
|
| 1329 |
-
129 => function ($stackPos) {
|
| 1330 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1331 |
-
},
|
| 1332 |
-
130 => function ($stackPos) {
|
| 1333 |
-
throw new Error('__HALT_COMPILER() can only be used from the outermost scope', $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1334 |
-
},
|
| 1335 |
-
131 => function ($stackPos) {
|
| 1336 |
-
|
| 1337 |
-
if ($this->semStack[$stackPos-(3-2)]) {
|
| 1338 |
-
$this->semValue = $this->semStack[$stackPos-(3-2)]; $attrs = $this->startAttributeStack[$stackPos-(3-1)]; $stmts = $this->semValue; if (!empty($attrs['comments'])) {$stmts[0]->setAttribute('comments', array_merge($attrs['comments'], $stmts[0]->getAttribute('comments', []))); };
|
| 1339 |
-
} else {
|
| 1340 |
-
$startAttributes = $this->startAttributeStack[$stackPos-(3-1)]; if (isset($startAttributes['comments'])) { $this->semValue = new Stmt\Nop($startAttributes + $this->endAttributes); } else { $this->semValue = null; };
|
| 1341 |
-
if (null === $this->semValue) { $this->semValue = array(); }
|
| 1342 |
-
}
|
| 1343 |
-
|
| 1344 |
-
},
|
| 1345 |
-
132 => function ($stackPos) {
|
| 1346 |
-
$this->semValue = new Stmt\If_($this->semStack[$stackPos-(5-2)], ['stmts' => is_array($this->semStack[$stackPos-(5-3)]) ? $this->semStack[$stackPos-(5-3)] : array($this->semStack[$stackPos-(5-3)]), 'elseifs' => $this->semStack[$stackPos-(5-4)], 'else' => $this->semStack[$stackPos-(5-5)]], $this->startAttributeStack[$stackPos-(5-1)] + $this->endAttributes);
|
| 1347 |
-
},
|
| 1348 |
-
133 => function ($stackPos) {
|
| 1349 |
-
$this->semValue = new Stmt\If_($this->semStack[$stackPos-(8-2)], ['stmts' => $this->semStack[$stackPos-(8-4)], 'elseifs' => $this->semStack[$stackPos-(8-5)], 'else' => $this->semStack[$stackPos-(8-6)]], $this->startAttributeStack[$stackPos-(8-1)] + $this->endAttributes);
|
| 1350 |
-
},
|
| 1351 |
-
134 => function ($stackPos) {
|
| 1352 |
-
$this->semValue = new Stmt\While_($this->semStack[$stackPos-(3-2)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1353 |
-
},
|
| 1354 |
-
135 => function ($stackPos) {
|
| 1355 |
-
$this->semValue = new Stmt\Do_($this->semStack[$stackPos-(5-4)], is_array($this->semStack[$stackPos-(5-2)]) ? $this->semStack[$stackPos-(5-2)] : array($this->semStack[$stackPos-(5-2)]), $this->startAttributeStack[$stackPos-(5-1)] + $this->endAttributes);
|
| 1356 |
-
},
|
| 1357 |
-
136 => function ($stackPos) {
|
| 1358 |
-
$this->semValue = new Stmt\For_(['init' => $this->semStack[$stackPos-(9-3)], 'cond' => $this->semStack[$stackPos-(9-5)], 'loop' => $this->semStack[$stackPos-(9-7)], 'stmts' => $this->semStack[$stackPos-(9-9)]], $this->startAttributeStack[$stackPos-(9-1)] + $this->endAttributes);
|
| 1359 |
-
},
|
| 1360 |
-
137 => function ($stackPos) {
|
| 1361 |
-
$this->semValue = new Stmt\Switch_($this->semStack[$stackPos-(3-2)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1362 |
-
},
|
| 1363 |
-
138 => function ($stackPos) {
|
| 1364 |
-
$this->semValue = new Stmt\Break_(null, $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1365 |
-
},
|
| 1366 |
-
139 => function ($stackPos) {
|
| 1367 |
-
$this->semValue = new Stmt\Break_($this->semStack[$stackPos-(3-2)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1368 |
-
},
|
| 1369 |
-
140 => function ($stackPos) {
|
| 1370 |
-
$this->semValue = new Stmt\Continue_(null, $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1371 |
-
},
|
| 1372 |
-
141 => function ($stackPos) {
|
| 1373 |
-
$this->semValue = new Stmt\Continue_($this->semStack[$stackPos-(3-2)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1374 |
-
},
|
| 1375 |
-
142 => function ($stackPos) {
|
| 1376 |
-
$this->semValue = new Stmt\Return_(null, $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1377 |
-
},
|
| 1378 |
-
143 => function ($stackPos) {
|
| 1379 |
-
$this->semValue = new Stmt\Return_($this->semStack[$stackPos-(3-2)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1380 |
-
},
|
| 1381 |
-
144 => function ($stackPos) {
|
| 1382 |
-
$this->semValue = new Stmt\Global_($this->semStack[$stackPos-(3-2)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1383 |
-
},
|
| 1384 |
-
145 => function ($stackPos) {
|
| 1385 |
-
$this->semValue = new Stmt\Static_($this->semStack[$stackPos-(3-2)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1386 |
-
},
|
| 1387 |
-
146 => function ($stackPos) {
|
| 1388 |
-
$this->semValue = new Stmt\Echo_($this->semStack[$stackPos-(3-2)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1389 |
-
},
|
| 1390 |
-
147 => function ($stackPos) {
|
| 1391 |
-
$this->semValue = new Stmt\InlineHTML($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1392 |
-
},
|
| 1393 |
-
148 => function ($stackPos) {
|
| 1394 |
-
$this->semValue = new Stmt\Expression($this->semStack[$stackPos-(2-1)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1395 |
-
},
|
| 1396 |
-
149 => function ($stackPos) {
|
| 1397 |
-
$this->semValue = new Stmt\Expression($this->semStack[$stackPos-(2-1)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1398 |
-
},
|
| 1399 |
-
150 => function ($stackPos) {
|
| 1400 |
-
$this->semValue = new Stmt\Unset_($this->semStack[$stackPos-(5-3)], $this->startAttributeStack[$stackPos-(5-1)] + $this->endAttributes);
|
| 1401 |
-
},
|
| 1402 |
-
151 => function ($stackPos) {
|
| 1403 |
-
$this->semValue = new Stmt\Foreach_($this->semStack[$stackPos-(7-3)], $this->semStack[$stackPos-(7-5)][0], ['keyVar' => null, 'byRef' => $this->semStack[$stackPos-(7-5)][1], 'stmts' => $this->semStack[$stackPos-(7-7)]], $this->startAttributeStack[$stackPos-(7-1)] + $this->endAttributes);
|
| 1404 |
-
},
|
| 1405 |
-
152 => function ($stackPos) {
|
| 1406 |
-
$this->semValue = new Stmt\Foreach_($this->semStack[$stackPos-(9-3)], $this->semStack[$stackPos-(9-7)][0], ['keyVar' => $this->semStack[$stackPos-(9-5)], 'byRef' => $this->semStack[$stackPos-(9-7)][1], 'stmts' => $this->semStack[$stackPos-(9-9)]], $this->startAttributeStack[$stackPos-(9-1)] + $this->endAttributes);
|
| 1407 |
-
},
|
| 1408 |
-
153 => function ($stackPos) {
|
| 1409 |
-
$this->semValue = new Stmt\Declare_($this->semStack[$stackPos-(5-3)], $this->semStack[$stackPos-(5-5)], $this->startAttributeStack[$stackPos-(5-1)] + $this->endAttributes);
|
| 1410 |
-
},
|
| 1411 |
-
154 => function ($stackPos) {
|
| 1412 |
-
$this->semValue = new Stmt\TryCatch($this->semStack[$stackPos-(6-3)], $this->semStack[$stackPos-(6-5)], $this->semStack[$stackPos-(6-6)], $this->startAttributeStack[$stackPos-(6-1)] + $this->endAttributes); $this->checkTryCatch($this->semValue);
|
| 1413 |
-
},
|
| 1414 |
-
155 => function ($stackPos) {
|
| 1415 |
-
$this->semValue = new Stmt\Throw_($this->semStack[$stackPos-(3-2)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1416 |
-
},
|
| 1417 |
-
156 => function ($stackPos) {
|
| 1418 |
-
$this->semValue = new Stmt\Goto_($this->semStack[$stackPos-(3-2)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1419 |
-
},
|
| 1420 |
-
157 => function ($stackPos) {
|
| 1421 |
-
$this->semValue = new Stmt\Label($this->semStack[$stackPos-(2-1)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1422 |
-
},
|
| 1423 |
-
158 => function ($stackPos) {
|
| 1424 |
-
$this->semValue = new Stmt\Expression($this->semStack[$stackPos-(2-1)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1425 |
-
},
|
| 1426 |
-
159 => function ($stackPos) {
|
| 1427 |
-
$this->semValue = array(); /* means: no statement */
|
| 1428 |
-
},
|
| 1429 |
-
160 => function ($stackPos) {
|
| 1430 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1431 |
-
},
|
| 1432 |
-
161 => function ($stackPos) {
|
| 1433 |
-
$startAttributes = $this->startAttributeStack[$stackPos-(1-1)]; if (isset($startAttributes['comments'])) { $this->semValue = new Stmt\Nop($startAttributes + $this->endAttributes); } else { $this->semValue = null; };
|
| 1434 |
-
if ($this->semValue === null) $this->semValue = array(); /* means: no statement */
|
| 1435 |
-
},
|
| 1436 |
-
162 => function ($stackPos) {
|
| 1437 |
-
$this->semValue = array();
|
| 1438 |
-
},
|
| 1439 |
-
163 => function ($stackPos) {
|
| 1440 |
-
$this->semStack[$stackPos-(2-1)][] = $this->semStack[$stackPos-(2-2)]; $this->semValue = $this->semStack[$stackPos-(2-1)];
|
| 1441 |
-
},
|
| 1442 |
-
164 => function ($stackPos) {
|
| 1443 |
-
$this->semValue = new Stmt\Catch_(array($this->semStack[$stackPos-(8-3)]), $this->semStack[$stackPos-(8-4)], $this->semStack[$stackPos-(8-7)], $this->startAttributeStack[$stackPos-(8-1)] + $this->endAttributes);
|
| 1444 |
-
},
|
| 1445 |
-
165 => function ($stackPos) {
|
| 1446 |
-
$this->semValue = null;
|
| 1447 |
-
},
|
| 1448 |
-
166 => function ($stackPos) {
|
| 1449 |
-
$this->semValue = new Stmt\Finally_($this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 1450 |
-
},
|
| 1451 |
-
167 => function ($stackPos) {
|
| 1452 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1453 |
-
},
|
| 1454 |
-
168 => function ($stackPos) {
|
| 1455 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1456 |
-
},
|
| 1457 |
-
169 => function ($stackPos) {
|
| 1458 |
-
$this->semValue = false;
|
| 1459 |
-
},
|
| 1460 |
-
170 => function ($stackPos) {
|
| 1461 |
-
$this->semValue = true;
|
| 1462 |
-
},
|
| 1463 |
-
171 => function ($stackPos) {
|
| 1464 |
-
$this->semValue = false;
|
| 1465 |
-
},
|
| 1466 |
-
172 => function ($stackPos) {
|
| 1467 |
-
$this->semValue = true;
|
| 1468 |
-
},
|
| 1469 |
-
173 => function ($stackPos) {
|
| 1470 |
-
$this->semValue = new Stmt\Function_($this->semStack[$stackPos-(10-3)], ['byRef' => $this->semStack[$stackPos-(10-2)], 'params' => $this->semStack[$stackPos-(10-5)], 'returnType' => $this->semStack[$stackPos-(10-7)], 'stmts' => $this->semStack[$stackPos-(10-9)]], $this->startAttributeStack[$stackPos-(10-1)] + $this->endAttributes);
|
| 1471 |
-
},
|
| 1472 |
-
174 => function ($stackPos) {
|
| 1473 |
-
$this->semValue = new Stmt\Class_($this->semStack[$stackPos-(7-2)], ['type' => $this->semStack[$stackPos-(7-1)], 'extends' => $this->semStack[$stackPos-(7-3)], 'implements' => $this->semStack[$stackPos-(7-4)], 'stmts' => $this->semStack[$stackPos-(7-6)]], $this->startAttributeStack[$stackPos-(7-1)] + $this->endAttributes);
|
| 1474 |
-
$this->checkClass($this->semValue, $stackPos-(7-2));
|
| 1475 |
-
},
|
| 1476 |
-
175 => function ($stackPos) {
|
| 1477 |
-
$this->semValue = new Stmt\Interface_($this->semStack[$stackPos-(6-2)], ['extends' => $this->semStack[$stackPos-(6-3)], 'stmts' => $this->semStack[$stackPos-(6-5)]], $this->startAttributeStack[$stackPos-(6-1)] + $this->endAttributes);
|
| 1478 |
-
$this->checkInterface($this->semValue, $stackPos-(6-2));
|
| 1479 |
-
},
|
| 1480 |
-
176 => function ($stackPos) {
|
| 1481 |
-
$this->semValue = new Stmt\Trait_($this->semStack[$stackPos-(5-2)], ['stmts' => $this->semStack[$stackPos-(5-4)]], $this->startAttributeStack[$stackPos-(5-1)] + $this->endAttributes);
|
| 1482 |
-
},
|
| 1483 |
-
177 => function ($stackPos) {
|
| 1484 |
-
$this->semValue = 0;
|
| 1485 |
-
},
|
| 1486 |
-
178 => function ($stackPos) {
|
| 1487 |
-
$this->semValue = Stmt\Class_::MODIFIER_ABSTRACT;
|
| 1488 |
-
},
|
| 1489 |
-
179 => function ($stackPos) {
|
| 1490 |
-
$this->semValue = Stmt\Class_::MODIFIER_FINAL;
|
| 1491 |
-
},
|
| 1492 |
-
180 => function ($stackPos) {
|
| 1493 |
-
$this->semValue = null;
|
| 1494 |
-
},
|
| 1495 |
-
181 => function ($stackPos) {
|
| 1496 |
-
$this->semValue = $this->semStack[$stackPos-(2-2)];
|
| 1497 |
-
},
|
| 1498 |
-
182 => function ($stackPos) {
|
| 1499 |
-
$this->semValue = array();
|
| 1500 |
-
},
|
| 1501 |
-
183 => function ($stackPos) {
|
| 1502 |
-
$this->semValue = $this->semStack[$stackPos-(2-2)];
|
| 1503 |
-
},
|
| 1504 |
-
184 => function ($stackPos) {
|
| 1505 |
-
$this->semValue = array();
|
| 1506 |
-
},
|
| 1507 |
-
185 => function ($stackPos) {
|
| 1508 |
-
$this->semValue = $this->semStack[$stackPos-(2-2)];
|
| 1509 |
-
},
|
| 1510 |
-
186 => function ($stackPos) {
|
| 1511 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1512 |
-
},
|
| 1513 |
-
187 => function ($stackPos) {
|
| 1514 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1515 |
-
},
|
| 1516 |
-
188 => function ($stackPos) {
|
| 1517 |
-
$this->semValue = is_array($this->semStack[$stackPos-(1-1)]) ? $this->semStack[$stackPos-(1-1)] : array($this->semStack[$stackPos-(1-1)]);
|
| 1518 |
-
},
|
| 1519 |
-
189 => function ($stackPos) {
|
| 1520 |
-
$this->semValue = $this->semStack[$stackPos-(4-2)];
|
| 1521 |
-
},
|
| 1522 |
-
190 => function ($stackPos) {
|
| 1523 |
-
$this->semValue = is_array($this->semStack[$stackPos-(1-1)]) ? $this->semStack[$stackPos-(1-1)] : array($this->semStack[$stackPos-(1-1)]);
|
| 1524 |
-
},
|
| 1525 |
-
191 => function ($stackPos) {
|
| 1526 |
-
$this->semValue = $this->semStack[$stackPos-(4-2)];
|
| 1527 |
-
},
|
| 1528 |
-
192 => function ($stackPos) {
|
| 1529 |
-
$this->semValue = is_array($this->semStack[$stackPos-(1-1)]) ? $this->semStack[$stackPos-(1-1)] : array($this->semStack[$stackPos-(1-1)]);
|
| 1530 |
-
},
|
| 1531 |
-
193 => function ($stackPos) {
|
| 1532 |
-
$this->semValue = null;
|
| 1533 |
-
},
|
| 1534 |
-
194 => function ($stackPos) {
|
| 1535 |
-
$this->semValue = $this->semStack[$stackPos-(4-2)];
|
| 1536 |
-
},
|
| 1537 |
-
195 => function ($stackPos) {
|
| 1538 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1539 |
-
},
|
| 1540 |
-
196 => function ($stackPos) {
|
| 1541 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1542 |
-
},
|
| 1543 |
-
197 => function ($stackPos) {
|
| 1544 |
-
$this->semValue = new Stmt\DeclareDeclare($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1545 |
-
},
|
| 1546 |
-
198 => function ($stackPos) {
|
| 1547 |
-
$this->semValue = $this->semStack[$stackPos-(3-2)];
|
| 1548 |
-
},
|
| 1549 |
-
199 => function ($stackPos) {
|
| 1550 |
-
$this->semValue = $this->semStack[$stackPos-(4-3)];
|
| 1551 |
-
},
|
| 1552 |
-
200 => function ($stackPos) {
|
| 1553 |
-
$this->semValue = $this->semStack[$stackPos-(4-2)];
|
| 1554 |
-
},
|
| 1555 |
-
201 => function ($stackPos) {
|
| 1556 |
-
$this->semValue = $this->semStack[$stackPos-(5-3)];
|
| 1557 |
-
},
|
| 1558 |
-
202 => function ($stackPos) {
|
| 1559 |
-
$this->semValue = array();
|
| 1560 |
-
},
|
| 1561 |
-
203 => function ($stackPos) {
|
| 1562 |
-
$this->semStack[$stackPos-(2-1)][] = $this->semStack[$stackPos-(2-2)]; $this->semValue = $this->semStack[$stackPos-(2-1)];
|
| 1563 |
-
},
|
| 1564 |
-
204 => function ($stackPos) {
|
| 1565 |
-
$this->semValue = new Stmt\Case_($this->semStack[$stackPos-(4-2)], $this->semStack[$stackPos-(4-4)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 1566 |
-
},
|
| 1567 |
-
205 => function ($stackPos) {
|
| 1568 |
-
$this->semValue = new Stmt\Case_(null, $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1569 |
-
},
|
| 1570 |
-
206 => function ($stackPos) {
|
| 1571 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1572 |
-
},
|
| 1573 |
-
207 => function ($stackPos) {
|
| 1574 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 1575 |
-
},
|
| 1576 |
-
208 => function ($stackPos) {
|
| 1577 |
-
$this->semValue = is_array($this->semStack[$stackPos-(1-1)]) ? $this->semStack[$stackPos-(1-1)] : array($this->semStack[$stackPos-(1-1)]);
|
| 1578 |
-
},
|
| 1579 |
-
209 => function ($stackPos) {
|
| 1580 |
-
$this->semValue = $this->semStack[$stackPos-(4-2)];
|
| 1581 |
-
},
|
| 1582 |
-
210 => function ($stackPos) {
|
| 1583 |
-
$this->semValue = array();
|
| 1584 |
-
},
|
| 1585 |
-
211 => function ($stackPos) {
|
| 1586 |
-
$this->semStack[$stackPos-(2-1)][] = $this->semStack[$stackPos-(2-2)]; $this->semValue = $this->semStack[$stackPos-(2-1)];
|
| 1587 |
-
},
|
| 1588 |
-
212 => function ($stackPos) {
|
| 1589 |
-
$this->semValue = new Stmt\ElseIf_($this->semStack[$stackPos-(3-2)], is_array($this->semStack[$stackPos-(3-3)]) ? $this->semStack[$stackPos-(3-3)] : array($this->semStack[$stackPos-(3-3)]), $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1590 |
-
},
|
| 1591 |
-
213 => function ($stackPos) {
|
| 1592 |
-
$this->semValue = array();
|
| 1593 |
-
},
|
| 1594 |
-
214 => function ($stackPos) {
|
| 1595 |
-
$this->semStack[$stackPos-(2-1)][] = $this->semStack[$stackPos-(2-2)]; $this->semValue = $this->semStack[$stackPos-(2-1)];
|
| 1596 |
-
},
|
| 1597 |
-
215 => function ($stackPos) {
|
| 1598 |
-
$this->semValue = new Stmt\ElseIf_($this->semStack[$stackPos-(4-2)], $this->semStack[$stackPos-(4-4)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 1599 |
-
},
|
| 1600 |
-
216 => function ($stackPos) {
|
| 1601 |
-
$this->semValue = null;
|
| 1602 |
-
},
|
| 1603 |
-
217 => function ($stackPos) {
|
| 1604 |
-
$this->semValue = new Stmt\Else_(is_array($this->semStack[$stackPos-(2-2)]) ? $this->semStack[$stackPos-(2-2)] : array($this->semStack[$stackPos-(2-2)]), $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1605 |
-
},
|
| 1606 |
-
218 => function ($stackPos) {
|
| 1607 |
-
$this->semValue = null;
|
| 1608 |
-
},
|
| 1609 |
-
219 => function ($stackPos) {
|
| 1610 |
-
$this->semValue = new Stmt\Else_($this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1611 |
-
},
|
| 1612 |
-
220 => function ($stackPos) {
|
| 1613 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)], false);
|
| 1614 |
-
},
|
| 1615 |
-
221 => function ($stackPos) {
|
| 1616 |
-
$this->semValue = array($this->semStack[$stackPos-(2-2)], true);
|
| 1617 |
-
},
|
| 1618 |
-
222 => function ($stackPos) {
|
| 1619 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)], false);
|
| 1620 |
-
},
|
| 1621 |
-
223 => function ($stackPos) {
|
| 1622 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1623 |
-
},
|
| 1624 |
-
224 => function ($stackPos) {
|
| 1625 |
-
$this->semValue = array();
|
| 1626 |
-
},
|
| 1627 |
-
225 => function ($stackPos) {
|
| 1628 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1629 |
-
},
|
| 1630 |
-
226 => function ($stackPos) {
|
| 1631 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1632 |
-
},
|
| 1633 |
-
227 => function ($stackPos) {
|
| 1634 |
-
$this->semValue = new Node\Param($this->semStack[$stackPos-(4-4)], null, $this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-2)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes); $this->checkParam($this->semValue);
|
| 1635 |
-
},
|
| 1636 |
-
228 => function ($stackPos) {
|
| 1637 |
-
$this->semValue = new Node\Param($this->semStack[$stackPos-(6-4)], $this->semStack[$stackPos-(6-6)], $this->semStack[$stackPos-(6-1)], $this->semStack[$stackPos-(6-2)], $this->semStack[$stackPos-(6-3)], $this->startAttributeStack[$stackPos-(6-1)] + $this->endAttributes); $this->checkParam($this->semValue);
|
| 1638 |
-
},
|
| 1639 |
-
229 => function ($stackPos) {
|
| 1640 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1641 |
-
},
|
| 1642 |
-
230 => function ($stackPos) {
|
| 1643 |
-
$this->semValue = new Node\Identifier('array', $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1644 |
-
},
|
| 1645 |
-
231 => function ($stackPos) {
|
| 1646 |
-
$this->semValue = new Node\Identifier('callable', $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1647 |
-
},
|
| 1648 |
-
232 => function ($stackPos) {
|
| 1649 |
-
$this->semValue = null;
|
| 1650 |
-
},
|
| 1651 |
-
233 => function ($stackPos) {
|
| 1652 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1653 |
-
},
|
| 1654 |
-
234 => function ($stackPos) {
|
| 1655 |
-
$this->semValue = null;
|
| 1656 |
-
},
|
| 1657 |
-
235 => function ($stackPos) {
|
| 1658 |
-
$this->semValue = $this->semStack[$stackPos-(2-2)];
|
| 1659 |
-
},
|
| 1660 |
-
236 => function ($stackPos) {
|
| 1661 |
-
$this->semValue = array();
|
| 1662 |
-
},
|
| 1663 |
-
237 => function ($stackPos) {
|
| 1664 |
-
$this->semValue = $this->semStack[$stackPos-(3-2)];
|
| 1665 |
-
},
|
| 1666 |
-
238 => function ($stackPos) {
|
| 1667 |
-
$this->semValue = array(new Node\Arg($this->semStack[$stackPos-(3-2)], false, false, $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes));
|
| 1668 |
-
},
|
| 1669 |
-
239 => function ($stackPos) {
|
| 1670 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1671 |
-
},
|
| 1672 |
-
240 => function ($stackPos) {
|
| 1673 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1674 |
-
},
|
| 1675 |
-
241 => function ($stackPos) {
|
| 1676 |
-
$this->semValue = new Node\Arg($this->semStack[$stackPos-(1-1)], false, false, $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1677 |
-
},
|
| 1678 |
-
242 => function ($stackPos) {
|
| 1679 |
-
$this->semValue = new Node\Arg($this->semStack[$stackPos-(2-2)], true, false, $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1680 |
-
},
|
| 1681 |
-
243 => function ($stackPos) {
|
| 1682 |
-
$this->semValue = new Node\Arg($this->semStack[$stackPos-(2-2)], false, true, $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1683 |
-
},
|
| 1684 |
-
244 => function ($stackPos) {
|
| 1685 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1686 |
-
},
|
| 1687 |
-
245 => function ($stackPos) {
|
| 1688 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1689 |
-
},
|
| 1690 |
-
246 => function ($stackPos) {
|
| 1691 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1692 |
-
},
|
| 1693 |
-
247 => function ($stackPos) {
|
| 1694 |
-
$this->semValue = new Expr\Variable($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1695 |
-
},
|
| 1696 |
-
248 => function ($stackPos) {
|
| 1697 |
-
$this->semValue = new Expr\Variable($this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 1698 |
-
},
|
| 1699 |
-
249 => function ($stackPos) {
|
| 1700 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1701 |
-
},
|
| 1702 |
-
250 => function ($stackPos) {
|
| 1703 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1704 |
-
},
|
| 1705 |
-
251 => function ($stackPos) {
|
| 1706 |
-
$this->semValue = new Stmt\StaticVar($this->semStack[$stackPos-(1-1)], null, $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1707 |
-
},
|
| 1708 |
-
252 => function ($stackPos) {
|
| 1709 |
-
$this->semValue = new Stmt\StaticVar($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1710 |
-
},
|
| 1711 |
-
253 => function ($stackPos) {
|
| 1712 |
-
if ($this->semStack[$stackPos-(2-2)] !== null) { $this->semStack[$stackPos-(2-1)][] = $this->semStack[$stackPos-(2-2)]; $this->semValue = $this->semStack[$stackPos-(2-1)]; }
|
| 1713 |
-
},
|
| 1714 |
-
254 => function ($stackPos) {
|
| 1715 |
-
$this->semValue = array();
|
| 1716 |
-
},
|
| 1717 |
-
255 => function ($stackPos) {
|
| 1718 |
-
$startAttributes = $this->lookaheadStartAttributes; if (isset($startAttributes['comments'])) { $nop = new Stmt\Nop($this->createCommentNopAttributes($startAttributes['comments'])); } else { $nop = null; };
|
| 1719 |
-
if ($nop !== null) { $this->semStack[$stackPos-(1-1)][] = $nop; } $this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1720 |
-
},
|
| 1721 |
-
256 => function ($stackPos) {
|
| 1722 |
-
$this->semValue = new Stmt\Property($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-2)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes); $this->checkProperty($this->semValue, $stackPos-(3-1));
|
| 1723 |
-
},
|
| 1724 |
-
257 => function ($stackPos) {
|
| 1725 |
-
$this->semValue = new Stmt\ClassConst($this->semStack[$stackPos-(3-2)], 0, $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1726 |
-
},
|
| 1727 |
-
258 => function ($stackPos) {
|
| 1728 |
-
$this->semValue = new Stmt\ClassMethod($this->semStack[$stackPos-(9-4)], ['type' => $this->semStack[$stackPos-(9-1)], 'byRef' => $this->semStack[$stackPos-(9-3)], 'params' => $this->semStack[$stackPos-(9-6)], 'returnType' => $this->semStack[$stackPos-(9-8)], 'stmts' => $this->semStack[$stackPos-(9-9)]], $this->startAttributeStack[$stackPos-(9-1)] + $this->endAttributes);
|
| 1729 |
-
$this->checkClassMethod($this->semValue, $stackPos-(9-1));
|
| 1730 |
-
},
|
| 1731 |
-
259 => function ($stackPos) {
|
| 1732 |
-
$this->semValue = new Stmt\TraitUse($this->semStack[$stackPos-(3-2)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1733 |
-
},
|
| 1734 |
-
260 => function ($stackPos) {
|
| 1735 |
-
$this->semValue = array();
|
| 1736 |
-
},
|
| 1737 |
-
261 => function ($stackPos) {
|
| 1738 |
-
$this->semValue = $this->semStack[$stackPos-(3-2)];
|
| 1739 |
-
},
|
| 1740 |
-
262 => function ($stackPos) {
|
| 1741 |
-
$this->semValue = array();
|
| 1742 |
-
},
|
| 1743 |
-
263 => function ($stackPos) {
|
| 1744 |
-
$this->semStack[$stackPos-(2-1)][] = $this->semStack[$stackPos-(2-2)]; $this->semValue = $this->semStack[$stackPos-(2-1)];
|
| 1745 |
-
},
|
| 1746 |
-
264 => function ($stackPos) {
|
| 1747 |
-
$this->semValue = new Stmt\TraitUseAdaptation\Precedence($this->semStack[$stackPos-(4-1)][0], $this->semStack[$stackPos-(4-1)][1], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 1748 |
-
},
|
| 1749 |
-
265 => function ($stackPos) {
|
| 1750 |
-
$this->semValue = new Stmt\TraitUseAdaptation\Alias($this->semStack[$stackPos-(5-1)][0], $this->semStack[$stackPos-(5-1)][1], $this->semStack[$stackPos-(5-3)], $this->semStack[$stackPos-(5-4)], $this->startAttributeStack[$stackPos-(5-1)] + $this->endAttributes);
|
| 1751 |
-
},
|
| 1752 |
-
266 => function ($stackPos) {
|
| 1753 |
-
$this->semValue = new Stmt\TraitUseAdaptation\Alias($this->semStack[$stackPos-(4-1)][0], $this->semStack[$stackPos-(4-1)][1], $this->semStack[$stackPos-(4-3)], null, $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 1754 |
-
},
|
| 1755 |
-
267 => function ($stackPos) {
|
| 1756 |
-
$this->semValue = new Stmt\TraitUseAdaptation\Alias($this->semStack[$stackPos-(4-1)][0], $this->semStack[$stackPos-(4-1)][1], null, $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 1757 |
-
},
|
| 1758 |
-
268 => function ($stackPos) {
|
| 1759 |
-
$this->semValue = new Stmt\TraitUseAdaptation\Alias($this->semStack[$stackPos-(4-1)][0], $this->semStack[$stackPos-(4-1)][1], null, $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 1760 |
-
},
|
| 1761 |
-
269 => function ($stackPos) {
|
| 1762 |
-
$this->semValue = array($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)]);
|
| 1763 |
-
},
|
| 1764 |
-
270 => function ($stackPos) {
|
| 1765 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1766 |
-
},
|
| 1767 |
-
271 => function ($stackPos) {
|
| 1768 |
-
$this->semValue = array(null, $this->semStack[$stackPos-(1-1)]);
|
| 1769 |
-
},
|
| 1770 |
-
272 => function ($stackPos) {
|
| 1771 |
-
$this->semValue = null;
|
| 1772 |
-
},
|
| 1773 |
-
273 => function ($stackPos) {
|
| 1774 |
-
$this->semValue = $this->semStack[$stackPos-(3-2)];
|
| 1775 |
-
},
|
| 1776 |
-
274 => function ($stackPos) {
|
| 1777 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1778 |
-
},
|
| 1779 |
-
275 => function ($stackPos) {
|
| 1780 |
-
$this->semValue = 0;
|
| 1781 |
-
},
|
| 1782 |
-
276 => function ($stackPos) {
|
| 1783 |
-
$this->semValue = 0;
|
| 1784 |
-
},
|
| 1785 |
-
277 => function ($stackPos) {
|
| 1786 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1787 |
-
},
|
| 1788 |
-
278 => function ($stackPos) {
|
| 1789 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1790 |
-
},
|
| 1791 |
-
279 => function ($stackPos) {
|
| 1792 |
-
$this->checkModifier($this->semStack[$stackPos-(2-1)], $this->semStack[$stackPos-(2-2)], $stackPos-(2-2)); $this->semValue = $this->semStack[$stackPos-(2-1)] | $this->semStack[$stackPos-(2-2)];
|
| 1793 |
-
},
|
| 1794 |
-
280 => function ($stackPos) {
|
| 1795 |
-
$this->semValue = Stmt\Class_::MODIFIER_PUBLIC;
|
| 1796 |
-
},
|
| 1797 |
-
281 => function ($stackPos) {
|
| 1798 |
-
$this->semValue = Stmt\Class_::MODIFIER_PROTECTED;
|
| 1799 |
-
},
|
| 1800 |
-
282 => function ($stackPos) {
|
| 1801 |
-
$this->semValue = Stmt\Class_::MODIFIER_PRIVATE;
|
| 1802 |
-
},
|
| 1803 |
-
283 => function ($stackPos) {
|
| 1804 |
-
$this->semValue = Stmt\Class_::MODIFIER_STATIC;
|
| 1805 |
-
},
|
| 1806 |
-
284 => function ($stackPos) {
|
| 1807 |
-
$this->semValue = Stmt\Class_::MODIFIER_ABSTRACT;
|
| 1808 |
-
},
|
| 1809 |
-
285 => function ($stackPos) {
|
| 1810 |
-
$this->semValue = Stmt\Class_::MODIFIER_FINAL;
|
| 1811 |
-
},
|
| 1812 |
-
286 => function ($stackPos) {
|
| 1813 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1814 |
-
},
|
| 1815 |
-
287 => function ($stackPos) {
|
| 1816 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1817 |
-
},
|
| 1818 |
-
288 => function ($stackPos) {
|
| 1819 |
-
$this->semValue = new Node\VarLikeIdentifier(substr($this->semStack[$stackPos-(1-1)], 1), $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1820 |
-
},
|
| 1821 |
-
289 => function ($stackPos) {
|
| 1822 |
-
$this->semValue = new Stmt\PropertyProperty($this->semStack[$stackPos-(1-1)], null, $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 1823 |
-
},
|
| 1824 |
-
290 => function ($stackPos) {
|
| 1825 |
-
$this->semValue = new Stmt\PropertyProperty($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1826 |
-
},
|
| 1827 |
-
291 => function ($stackPos) {
|
| 1828 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 1829 |
-
},
|
| 1830 |
-
292 => function ($stackPos) {
|
| 1831 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 1832 |
-
},
|
| 1833 |
-
293 => function ($stackPos) {
|
| 1834 |
-
$this->semValue = array();
|
| 1835 |
-
},
|
| 1836 |
-
294 => function ($stackPos) {
|
| 1837 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1838 |
-
},
|
| 1839 |
-
295 => function ($stackPos) {
|
| 1840 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1841 |
-
},
|
| 1842 |
-
296 => function ($stackPos) {
|
| 1843 |
-
$this->semValue = new Expr\Assign($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1844 |
-
},
|
| 1845 |
-
297 => function ($stackPos) {
|
| 1846 |
-
$this->semValue = new Expr\Assign($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1847 |
-
},
|
| 1848 |
-
298 => function ($stackPos) {
|
| 1849 |
-
$this->semValue = new Expr\AssignRef($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-4)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 1850 |
-
},
|
| 1851 |
-
299 => function ($stackPos) {
|
| 1852 |
-
$this->semValue = new Expr\AssignRef($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-4)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 1853 |
-
},
|
| 1854 |
-
300 => function ($stackPos) {
|
| 1855 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 1856 |
-
},
|
| 1857 |
-
301 => function ($stackPos) {
|
| 1858 |
-
$this->semValue = new Expr\Clone_($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1859 |
-
},
|
| 1860 |
-
302 => function ($stackPos) {
|
| 1861 |
-
$this->semValue = new Expr\AssignOp\Plus($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1862 |
-
},
|
| 1863 |
-
303 => function ($stackPos) {
|
| 1864 |
-
$this->semValue = new Expr\AssignOp\Minus($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1865 |
-
},
|
| 1866 |
-
304 => function ($stackPos) {
|
| 1867 |
-
$this->semValue = new Expr\AssignOp\Mul($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1868 |
-
},
|
| 1869 |
-
305 => function ($stackPos) {
|
| 1870 |
-
$this->semValue = new Expr\AssignOp\Div($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1871 |
-
},
|
| 1872 |
-
306 => function ($stackPos) {
|
| 1873 |
-
$this->semValue = new Expr\AssignOp\Concat($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1874 |
-
},
|
| 1875 |
-
307 => function ($stackPos) {
|
| 1876 |
-
$this->semValue = new Expr\AssignOp\Mod($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1877 |
-
},
|
| 1878 |
-
308 => function ($stackPos) {
|
| 1879 |
-
$this->semValue = new Expr\AssignOp\BitwiseAnd($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1880 |
-
},
|
| 1881 |
-
309 => function ($stackPos) {
|
| 1882 |
-
$this->semValue = new Expr\AssignOp\BitwiseOr($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1883 |
-
},
|
| 1884 |
-
310 => function ($stackPos) {
|
| 1885 |
-
$this->semValue = new Expr\AssignOp\BitwiseXor($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1886 |
-
},
|
| 1887 |
-
311 => function ($stackPos) {
|
| 1888 |
-
$this->semValue = new Expr\AssignOp\ShiftLeft($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1889 |
-
},
|
| 1890 |
-
312 => function ($stackPos) {
|
| 1891 |
-
$this->semValue = new Expr\AssignOp\ShiftRight($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1892 |
-
},
|
| 1893 |
-
313 => function ($stackPos) {
|
| 1894 |
-
$this->semValue = new Expr\AssignOp\Pow($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1895 |
-
},
|
| 1896 |
-
314 => function ($stackPos) {
|
| 1897 |
-
$this->semValue = new Expr\AssignOp\Coalesce($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1898 |
-
},
|
| 1899 |
-
315 => function ($stackPos) {
|
| 1900 |
-
$this->semValue = new Expr\PostInc($this->semStack[$stackPos-(2-1)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1901 |
-
},
|
| 1902 |
-
316 => function ($stackPos) {
|
| 1903 |
-
$this->semValue = new Expr\PreInc($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1904 |
-
},
|
| 1905 |
-
317 => function ($stackPos) {
|
| 1906 |
-
$this->semValue = new Expr\PostDec($this->semStack[$stackPos-(2-1)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1907 |
-
},
|
| 1908 |
-
318 => function ($stackPos) {
|
| 1909 |
-
$this->semValue = new Expr\PreDec($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1910 |
-
},
|
| 1911 |
-
319 => function ($stackPos) {
|
| 1912 |
-
$this->semValue = new Expr\BinaryOp\BooleanOr($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1913 |
-
},
|
| 1914 |
-
320 => function ($stackPos) {
|
| 1915 |
-
$this->semValue = new Expr\BinaryOp\BooleanAnd($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1916 |
-
},
|
| 1917 |
-
321 => function ($stackPos) {
|
| 1918 |
-
$this->semValue = new Expr\BinaryOp\LogicalOr($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1919 |
-
},
|
| 1920 |
-
322 => function ($stackPos) {
|
| 1921 |
-
$this->semValue = new Expr\BinaryOp\LogicalAnd($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1922 |
-
},
|
| 1923 |
-
323 => function ($stackPos) {
|
| 1924 |
-
$this->semValue = new Expr\BinaryOp\LogicalXor($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1925 |
-
},
|
| 1926 |
-
324 => function ($stackPos) {
|
| 1927 |
-
$this->semValue = new Expr\BinaryOp\BitwiseOr($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1928 |
-
},
|
| 1929 |
-
325 => function ($stackPos) {
|
| 1930 |
-
$this->semValue = new Expr\BinaryOp\BitwiseAnd($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1931 |
-
},
|
| 1932 |
-
326 => function ($stackPos) {
|
| 1933 |
-
$this->semValue = new Expr\BinaryOp\BitwiseXor($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1934 |
-
},
|
| 1935 |
-
327 => function ($stackPos) {
|
| 1936 |
-
$this->semValue = new Expr\BinaryOp\Concat($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1937 |
-
},
|
| 1938 |
-
328 => function ($stackPos) {
|
| 1939 |
-
$this->semValue = new Expr\BinaryOp\Plus($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1940 |
-
},
|
| 1941 |
-
329 => function ($stackPos) {
|
| 1942 |
-
$this->semValue = new Expr\BinaryOp\Minus($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1943 |
-
},
|
| 1944 |
-
330 => function ($stackPos) {
|
| 1945 |
-
$this->semValue = new Expr\BinaryOp\Mul($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1946 |
-
},
|
| 1947 |
-
331 => function ($stackPos) {
|
| 1948 |
-
$this->semValue = new Expr\BinaryOp\Div($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1949 |
-
},
|
| 1950 |
-
332 => function ($stackPos) {
|
| 1951 |
-
$this->semValue = new Expr\BinaryOp\Mod($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1952 |
-
},
|
| 1953 |
-
333 => function ($stackPos) {
|
| 1954 |
-
$this->semValue = new Expr\BinaryOp\ShiftLeft($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1955 |
-
},
|
| 1956 |
-
334 => function ($stackPos) {
|
| 1957 |
-
$this->semValue = new Expr\BinaryOp\ShiftRight($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1958 |
-
},
|
| 1959 |
-
335 => function ($stackPos) {
|
| 1960 |
-
$this->semValue = new Expr\BinaryOp\Pow($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1961 |
-
},
|
| 1962 |
-
336 => function ($stackPos) {
|
| 1963 |
-
$this->semValue = new Expr\UnaryPlus($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1964 |
-
},
|
| 1965 |
-
337 => function ($stackPos) {
|
| 1966 |
-
$this->semValue = new Expr\UnaryMinus($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1967 |
-
},
|
| 1968 |
-
338 => function ($stackPos) {
|
| 1969 |
-
$this->semValue = new Expr\BooleanNot($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1970 |
-
},
|
| 1971 |
-
339 => function ($stackPos) {
|
| 1972 |
-
$this->semValue = new Expr\BitwiseNot($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 1973 |
-
},
|
| 1974 |
-
340 => function ($stackPos) {
|
| 1975 |
-
$this->semValue = new Expr\BinaryOp\Identical($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1976 |
-
},
|
| 1977 |
-
341 => function ($stackPos) {
|
| 1978 |
-
$this->semValue = new Expr\BinaryOp\NotIdentical($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1979 |
-
},
|
| 1980 |
-
342 => function ($stackPos) {
|
| 1981 |
-
$this->semValue = new Expr\BinaryOp\Equal($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1982 |
-
},
|
| 1983 |
-
343 => function ($stackPos) {
|
| 1984 |
-
$this->semValue = new Expr\BinaryOp\NotEqual($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1985 |
-
},
|
| 1986 |
-
344 => function ($stackPos) {
|
| 1987 |
-
$this->semValue = new Expr\BinaryOp\Spaceship($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1988 |
-
},
|
| 1989 |
-
345 => function ($stackPos) {
|
| 1990 |
-
$this->semValue = new Expr\BinaryOp\Smaller($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1991 |
-
},
|
| 1992 |
-
346 => function ($stackPos) {
|
| 1993 |
-
$this->semValue = new Expr\BinaryOp\SmallerOrEqual($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1994 |
-
},
|
| 1995 |
-
347 => function ($stackPos) {
|
| 1996 |
-
$this->semValue = new Expr\BinaryOp\Greater($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 1997 |
-
},
|
| 1998 |
-
348 => function ($stackPos) {
|
| 1999 |
-
$this->semValue = new Expr\BinaryOp\GreaterOrEqual($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2000 |
-
},
|
| 2001 |
-
349 => function ($stackPos) {
|
| 2002 |
-
$this->semValue = new Expr\Instanceof_($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2003 |
-
},
|
| 2004 |
-
350 => function ($stackPos) {
|
| 2005 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2006 |
-
},
|
| 2007 |
-
351 => function ($stackPos) {
|
| 2008 |
-
$this->semValue = $this->semStack[$stackPos-(3-2)];
|
| 2009 |
-
},
|
| 2010 |
-
352 => function ($stackPos) {
|
| 2011 |
-
$this->semValue = new Expr\Ternary($this->semStack[$stackPos-(5-1)], $this->semStack[$stackPos-(5-3)], $this->semStack[$stackPos-(5-5)], $this->startAttributeStack[$stackPos-(5-1)] + $this->endAttributes);
|
| 2012 |
-
},
|
| 2013 |
-
353 => function ($stackPos) {
|
| 2014 |
-
$this->semValue = new Expr\Ternary($this->semStack[$stackPos-(4-1)], null, $this->semStack[$stackPos-(4-4)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2015 |
-
},
|
| 2016 |
-
354 => function ($stackPos) {
|
| 2017 |
-
$this->semValue = new Expr\BinaryOp\Coalesce($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2018 |
-
},
|
| 2019 |
-
355 => function ($stackPos) {
|
| 2020 |
-
$this->semValue = new Expr\Isset_($this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2021 |
-
},
|
| 2022 |
-
356 => function ($stackPos) {
|
| 2023 |
-
$this->semValue = new Expr\Empty_($this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2024 |
-
},
|
| 2025 |
-
357 => function ($stackPos) {
|
| 2026 |
-
$this->semValue = new Expr\Include_($this->semStack[$stackPos-(2-2)], Expr\Include_::TYPE_INCLUDE, $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2027 |
-
},
|
| 2028 |
-
358 => function ($stackPos) {
|
| 2029 |
-
$this->semValue = new Expr\Include_($this->semStack[$stackPos-(2-2)], Expr\Include_::TYPE_INCLUDE_ONCE, $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2030 |
-
},
|
| 2031 |
-
359 => function ($stackPos) {
|
| 2032 |
-
$this->semValue = new Expr\Eval_($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2033 |
-
},
|
| 2034 |
-
360 => function ($stackPos) {
|
| 2035 |
-
$this->semValue = new Expr\Include_($this->semStack[$stackPos-(2-2)], Expr\Include_::TYPE_REQUIRE, $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2036 |
-
},
|
| 2037 |
-
361 => function ($stackPos) {
|
| 2038 |
-
$this->semValue = new Expr\Include_($this->semStack[$stackPos-(2-2)], Expr\Include_::TYPE_REQUIRE_ONCE, $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2039 |
-
},
|
| 2040 |
-
362 => function ($stackPos) {
|
| 2041 |
-
$this->semValue = new Expr\Cast\Int_($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2042 |
-
},
|
| 2043 |
-
363 => function ($stackPos) {
|
| 2044 |
-
$attrs = $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes;
|
| 2045 |
-
$attrs['kind'] = $this->getFloatCastKind($this->semStack[$stackPos-(2-1)]);
|
| 2046 |
-
$this->semValue = new Expr\Cast\Double($this->semStack[$stackPos-(2-2)], $attrs);
|
| 2047 |
-
},
|
| 2048 |
-
364 => function ($stackPos) {
|
| 2049 |
-
$this->semValue = new Expr\Cast\String_($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2050 |
-
},
|
| 2051 |
-
365 => function ($stackPos) {
|
| 2052 |
-
$this->semValue = new Expr\Cast\Array_($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2053 |
-
},
|
| 2054 |
-
366 => function ($stackPos) {
|
| 2055 |
-
$this->semValue = new Expr\Cast\Object_($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2056 |
-
},
|
| 2057 |
-
367 => function ($stackPos) {
|
| 2058 |
-
$this->semValue = new Expr\Cast\Bool_($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2059 |
-
},
|
| 2060 |
-
368 => function ($stackPos) {
|
| 2061 |
-
$this->semValue = new Expr\Cast\Unset_($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2062 |
-
},
|
| 2063 |
-
369 => function ($stackPos) {
|
| 2064 |
-
$attrs = $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes;
|
| 2065 |
-
$attrs['kind'] = strtolower($this->semStack[$stackPos-(2-1)]) === 'exit' ? Expr\Exit_::KIND_EXIT : Expr\Exit_::KIND_DIE;
|
| 2066 |
-
$this->semValue = new Expr\Exit_($this->semStack[$stackPos-(2-2)], $attrs);
|
| 2067 |
-
},
|
| 2068 |
-
370 => function ($stackPos) {
|
| 2069 |
-
$this->semValue = new Expr\ErrorSuppress($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2070 |
-
},
|
| 2071 |
-
371 => function ($stackPos) {
|
| 2072 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2073 |
-
},
|
| 2074 |
-
372 => function ($stackPos) {
|
| 2075 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2076 |
-
},
|
| 2077 |
-
373 => function ($stackPos) {
|
| 2078 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2079 |
-
},
|
| 2080 |
-
374 => function ($stackPos) {
|
| 2081 |
-
$this->semValue = new Expr\ShellExec($this->semStack[$stackPos-(3-2)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2082 |
-
},
|
| 2083 |
-
375 => function ($stackPos) {
|
| 2084 |
-
$this->semValue = new Expr\Print_($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2085 |
-
},
|
| 2086 |
-
376 => function ($stackPos) {
|
| 2087 |
-
$this->semValue = new Expr\Yield_(null, null, $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2088 |
-
},
|
| 2089 |
-
377 => function ($stackPos) {
|
| 2090 |
-
$this->semValue = new Expr\YieldFrom($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2091 |
-
},
|
| 2092 |
-
378 => function ($stackPos) {
|
| 2093 |
-
$this->semValue = new Expr\Closure(['static' => false, 'byRef' => $this->semStack[$stackPos-(10-2)], 'params' => $this->semStack[$stackPos-(10-4)], 'uses' => $this->semStack[$stackPos-(10-6)], 'returnType' => $this->semStack[$stackPos-(10-7)], 'stmts' => $this->semStack[$stackPos-(10-9)]], $this->startAttributeStack[$stackPos-(10-1)] + $this->endAttributes);
|
| 2094 |
-
},
|
| 2095 |
-
379 => function ($stackPos) {
|
| 2096 |
-
$this->semValue = new Expr\Closure(['static' => true, 'byRef' => $this->semStack[$stackPos-(11-3)], 'params' => $this->semStack[$stackPos-(11-5)], 'uses' => $this->semStack[$stackPos-(11-7)], 'returnType' => $this->semStack[$stackPos-(11-8)], 'stmts' => $this->semStack[$stackPos-(11-10)]], $this->startAttributeStack[$stackPos-(11-1)] + $this->endAttributes);
|
| 2097 |
-
},
|
| 2098 |
-
380 => function ($stackPos) {
|
| 2099 |
-
$this->semValue = $this->semStack[$stackPos-(3-2)];
|
| 2100 |
-
},
|
| 2101 |
-
381 => function ($stackPos) {
|
| 2102 |
-
$this->semValue = $this->semStack[$stackPos-(3-2)];
|
| 2103 |
-
},
|
| 2104 |
-
382 => function ($stackPos) {
|
| 2105 |
-
$this->semValue = new Expr\Yield_($this->semStack[$stackPos-(2-2)], null, $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2106 |
-
},
|
| 2107 |
-
383 => function ($stackPos) {
|
| 2108 |
-
$this->semValue = new Expr\Yield_($this->semStack[$stackPos-(4-4)], $this->semStack[$stackPos-(4-2)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2109 |
-
},
|
| 2110 |
-
384 => function ($stackPos) {
|
| 2111 |
-
$attrs = $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes; $attrs['kind'] = Expr\Array_::KIND_LONG;
|
| 2112 |
-
$this->semValue = new Expr\Array_($this->semStack[$stackPos-(4-3)], $attrs);
|
| 2113 |
-
},
|
| 2114 |
-
385 => function ($stackPos) {
|
| 2115 |
-
$attrs = $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes; $attrs['kind'] = Expr\Array_::KIND_SHORT;
|
| 2116 |
-
$this->semValue = new Expr\Array_($this->semStack[$stackPos-(3-2)], $attrs);
|
| 2117 |
-
},
|
| 2118 |
-
386 => function ($stackPos) {
|
| 2119 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2120 |
-
},
|
| 2121 |
-
387 => function ($stackPos) {
|
| 2122 |
-
$attrs = $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes; $attrs['kind'] = ($this->semStack[$stackPos-(4-1)][0] === "'" || ($this->semStack[$stackPos-(4-1)][1] === "'" && ($this->semStack[$stackPos-(4-1)][0] === 'b' || $this->semStack[$stackPos-(4-1)][0] === 'B')) ? Scalar\String_::KIND_SINGLE_QUOTED : Scalar\String_::KIND_DOUBLE_QUOTED);
|
| 2123 |
-
$this->semValue = new Expr\ArrayDimFetch(new Scalar\String_(Scalar\String_::parse($this->semStack[$stackPos-(4-1)]), $attrs), $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2124 |
-
},
|
| 2125 |
-
388 => function ($stackPos) {
|
| 2126 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2127 |
-
},
|
| 2128 |
-
389 => function ($stackPos) {
|
| 2129 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2130 |
-
},
|
| 2131 |
-
390 => function ($stackPos) {
|
| 2132 |
-
$this->semValue = array(new Stmt\Class_(null, ['type' => 0, 'extends' => $this->semStack[$stackPos-(7-3)], 'implements' => $this->semStack[$stackPos-(7-4)], 'stmts' => $this->semStack[$stackPos-(7-6)]], $this->startAttributeStack[$stackPos-(7-1)] + $this->endAttributes), $this->semStack[$stackPos-(7-2)]);
|
| 2133 |
-
$this->checkClass($this->semValue[0], -1);
|
| 2134 |
-
},
|
| 2135 |
-
391 => function ($stackPos) {
|
| 2136 |
-
$this->semValue = new Expr\New_($this->semStack[$stackPos-(3-2)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2137 |
-
},
|
| 2138 |
-
392 => function ($stackPos) {
|
| 2139 |
-
list($class, $ctorArgs) = $this->semStack[$stackPos-(2-2)]; $this->semValue = new Expr\New_($class, $ctorArgs, $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2140 |
-
},
|
| 2141 |
-
393 => function ($stackPos) {
|
| 2142 |
-
$this->semValue = array();
|
| 2143 |
-
},
|
| 2144 |
-
394 => function ($stackPos) {
|
| 2145 |
-
$this->semValue = $this->semStack[$stackPos-(4-3)];
|
| 2146 |
-
},
|
| 2147 |
-
395 => function ($stackPos) {
|
| 2148 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 2149 |
-
},
|
| 2150 |
-
396 => function ($stackPos) {
|
| 2151 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 2152 |
-
},
|
| 2153 |
-
397 => function ($stackPos) {
|
| 2154 |
-
$this->semValue = new Expr\ClosureUse($this->semStack[$stackPos-(2-2)], $this->semStack[$stackPos-(2-1)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2155 |
-
},
|
| 2156 |
-
398 => function ($stackPos) {
|
| 2157 |
-
$this->semValue = new Expr\FuncCall($this->semStack[$stackPos-(2-1)], $this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2158 |
-
},
|
| 2159 |
-
399 => function ($stackPos) {
|
| 2160 |
-
$this->semValue = new Expr\StaticCall($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->semStack[$stackPos-(4-4)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2161 |
-
},
|
| 2162 |
-
400 => function ($stackPos) {
|
| 2163 |
-
$this->semValue = new Expr\StaticCall($this->semStack[$stackPos-(6-1)], $this->semStack[$stackPos-(6-4)], $this->semStack[$stackPos-(6-6)], $this->startAttributeStack[$stackPos-(6-1)] + $this->endAttributes);
|
| 2164 |
-
},
|
| 2165 |
-
401 => function ($stackPos) {
|
| 2166 |
-
$this->semValue = $this->fixupPhp5StaticPropCall($this->semStack[$stackPos-(2-1)], $this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2167 |
-
},
|
| 2168 |
-
402 => function ($stackPos) {
|
| 2169 |
-
$this->semValue = new Expr\FuncCall($this->semStack[$stackPos-(2-1)], $this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2170 |
-
},
|
| 2171 |
-
403 => function ($stackPos) {
|
| 2172 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2173 |
-
},
|
| 2174 |
-
404 => function ($stackPos) {
|
| 2175 |
-
$this->semValue = new Name($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2176 |
-
},
|
| 2177 |
-
405 => function ($stackPos) {
|
| 2178 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2179 |
-
},
|
| 2180 |
-
406 => function ($stackPos) {
|
| 2181 |
-
$this->semValue = new Name($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2182 |
-
},
|
| 2183 |
-
407 => function ($stackPos) {
|
| 2184 |
-
$this->semValue = new Name\FullyQualified($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2185 |
-
},
|
| 2186 |
-
408 => function ($stackPos) {
|
| 2187 |
-
$this->semValue = new Name\Relative($this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2188 |
-
},
|
| 2189 |
-
409 => function ($stackPos) {
|
| 2190 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2191 |
-
},
|
| 2192 |
-
410 => function ($stackPos) {
|
| 2193 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2194 |
-
},
|
| 2195 |
-
411 => function ($stackPos) {
|
| 2196 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2197 |
-
},
|
| 2198 |
-
412 => function ($stackPos) {
|
| 2199 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2200 |
-
},
|
| 2201 |
-
413 => function ($stackPos) {
|
| 2202 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2203 |
-
},
|
| 2204 |
-
414 => function ($stackPos) {
|
| 2205 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2206 |
-
},
|
| 2207 |
-
415 => function ($stackPos) {
|
| 2208 |
-
$this->semValue = new Expr\PropertyFetch($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2209 |
-
},
|
| 2210 |
-
416 => function ($stackPos) {
|
| 2211 |
-
$this->semValue = new Expr\PropertyFetch($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2212 |
-
},
|
| 2213 |
-
417 => function ($stackPos) {
|
| 2214 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2215 |
-
},
|
| 2216 |
-
418 => function ($stackPos) {
|
| 2217 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2218 |
-
},
|
| 2219 |
-
419 => function ($stackPos) {
|
| 2220 |
-
$this->semValue = null;
|
| 2221 |
-
},
|
| 2222 |
-
420 => function ($stackPos) {
|
| 2223 |
-
$this->semValue = null;
|
| 2224 |
-
},
|
| 2225 |
-
421 => function ($stackPos) {
|
| 2226 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2227 |
-
},
|
| 2228 |
-
422 => function ($stackPos) {
|
| 2229 |
-
$this->semValue = array();
|
| 2230 |
-
},
|
| 2231 |
-
423 => function ($stackPos) {
|
| 2232 |
-
$this->semValue = array(new Scalar\EncapsedStringPart(Scalar\String_::parseEscapeSequences($this->semStack[$stackPos-(1-1)], '`', false), $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes));
|
| 2233 |
-
},
|
| 2234 |
-
424 => function ($stackPos) {
|
| 2235 |
-
foreach ($this->semStack[$stackPos-(1-1)] as $s) { if ($s instanceof Node\Scalar\EncapsedStringPart) { $s->value = Node\Scalar\String_::parseEscapeSequences($s->value, '`', false); } }; $this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2236 |
-
},
|
| 2237 |
-
425 => function ($stackPos) {
|
| 2238 |
-
$this->semValue = array();
|
| 2239 |
-
},
|
| 2240 |
-
426 => function ($stackPos) {
|
| 2241 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2242 |
-
},
|
| 2243 |
-
427 => function ($stackPos) {
|
| 2244 |
-
$this->semValue = $this->parseLNumber($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes, true);
|
| 2245 |
-
},
|
| 2246 |
-
428 => function ($stackPos) {
|
| 2247 |
-
$this->semValue = new Scalar\DNumber(Scalar\DNumber::parse($this->semStack[$stackPos-(1-1)]), $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2248 |
-
},
|
| 2249 |
-
429 => function ($stackPos) {
|
| 2250 |
-
$attrs = $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes; $attrs['kind'] = ($this->semStack[$stackPos-(1-1)][0] === "'" || ($this->semStack[$stackPos-(1-1)][1] === "'" && ($this->semStack[$stackPos-(1-1)][0] === 'b' || $this->semStack[$stackPos-(1-1)][0] === 'B')) ? Scalar\String_::KIND_SINGLE_QUOTED : Scalar\String_::KIND_DOUBLE_QUOTED);
|
| 2251 |
-
$this->semValue = new Scalar\String_(Scalar\String_::parse($this->semStack[$stackPos-(1-1)], false), $attrs);
|
| 2252 |
-
},
|
| 2253 |
-
430 => function ($stackPos) {
|
| 2254 |
-
$this->semValue = new Scalar\MagicConst\Line($this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2255 |
-
},
|
| 2256 |
-
431 => function ($stackPos) {
|
| 2257 |
-
$this->semValue = new Scalar\MagicConst\File($this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2258 |
-
},
|
| 2259 |
-
432 => function ($stackPos) {
|
| 2260 |
-
$this->semValue = new Scalar\MagicConst\Dir($this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2261 |
-
},
|
| 2262 |
-
433 => function ($stackPos) {
|
| 2263 |
-
$this->semValue = new Scalar\MagicConst\Class_($this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2264 |
-
},
|
| 2265 |
-
434 => function ($stackPos) {
|
| 2266 |
-
$this->semValue = new Scalar\MagicConst\Trait_($this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2267 |
-
},
|
| 2268 |
-
435 => function ($stackPos) {
|
| 2269 |
-
$this->semValue = new Scalar\MagicConst\Method($this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2270 |
-
},
|
| 2271 |
-
436 => function ($stackPos) {
|
| 2272 |
-
$this->semValue = new Scalar\MagicConst\Function_($this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2273 |
-
},
|
| 2274 |
-
437 => function ($stackPos) {
|
| 2275 |
-
$this->semValue = new Scalar\MagicConst\Namespace_($this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2276 |
-
},
|
| 2277 |
-
438 => function ($stackPos) {
|
| 2278 |
-
$this->semValue = $this->parseDocString($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-2)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes, $this->startAttributeStack[$stackPos-(3-3)] + $this->endAttributeStack[$stackPos-(3-3)], false);
|
| 2279 |
-
},
|
| 2280 |
-
439 => function ($stackPos) {
|
| 2281 |
-
$this->semValue = $this->parseDocString($this->semStack[$stackPos-(2-1)], '', $this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes, $this->startAttributeStack[$stackPos-(2-2)] + $this->endAttributeStack[$stackPos-(2-2)], false);
|
| 2282 |
-
},
|
| 2283 |
-
440 => function ($stackPos) {
|
| 2284 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2285 |
-
},
|
| 2286 |
-
441 => function ($stackPos) {
|
| 2287 |
-
$this->semValue = new Expr\ClassConstFetch($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2288 |
-
},
|
| 2289 |
-
442 => function ($stackPos) {
|
| 2290 |
-
$this->semValue = new Expr\ConstFetch($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2291 |
-
},
|
| 2292 |
-
443 => function ($stackPos) {
|
| 2293 |
-
$this->semValue = new Expr\Array_($this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2294 |
-
},
|
| 2295 |
-
444 => function ($stackPos) {
|
| 2296 |
-
$this->semValue = new Expr\Array_($this->semStack[$stackPos-(3-2)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2297 |
-
},
|
| 2298 |
-
445 => function ($stackPos) {
|
| 2299 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2300 |
-
},
|
| 2301 |
-
446 => function ($stackPos) {
|
| 2302 |
-
$this->semValue = new Expr\BinaryOp\BooleanOr($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2303 |
-
},
|
| 2304 |
-
447 => function ($stackPos) {
|
| 2305 |
-
$this->semValue = new Expr\BinaryOp\BooleanAnd($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2306 |
-
},
|
| 2307 |
-
448 => function ($stackPos) {
|
| 2308 |
-
$this->semValue = new Expr\BinaryOp\LogicalOr($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2309 |
-
},
|
| 2310 |
-
449 => function ($stackPos) {
|
| 2311 |
-
$this->semValue = new Expr\BinaryOp\LogicalAnd($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2312 |
-
},
|
| 2313 |
-
450 => function ($stackPos) {
|
| 2314 |
-
$this->semValue = new Expr\BinaryOp\LogicalXor($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2315 |
-
},
|
| 2316 |
-
451 => function ($stackPos) {
|
| 2317 |
-
$this->semValue = new Expr\BinaryOp\BitwiseOr($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2318 |
-
},
|
| 2319 |
-
452 => function ($stackPos) {
|
| 2320 |
-
$this->semValue = new Expr\BinaryOp\BitwiseAnd($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2321 |
-
},
|
| 2322 |
-
453 => function ($stackPos) {
|
| 2323 |
-
$this->semValue = new Expr\BinaryOp\BitwiseXor($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2324 |
-
},
|
| 2325 |
-
454 => function ($stackPos) {
|
| 2326 |
-
$this->semValue = new Expr\BinaryOp\Concat($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2327 |
-
},
|
| 2328 |
-
455 => function ($stackPos) {
|
| 2329 |
-
$this->semValue = new Expr\BinaryOp\Plus($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2330 |
-
},
|
| 2331 |
-
456 => function ($stackPos) {
|
| 2332 |
-
$this->semValue = new Expr\BinaryOp\Minus($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2333 |
-
},
|
| 2334 |
-
457 => function ($stackPos) {
|
| 2335 |
-
$this->semValue = new Expr\BinaryOp\Mul($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2336 |
-
},
|
| 2337 |
-
458 => function ($stackPos) {
|
| 2338 |
-
$this->semValue = new Expr\BinaryOp\Div($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2339 |
-
},
|
| 2340 |
-
459 => function ($stackPos) {
|
| 2341 |
-
$this->semValue = new Expr\BinaryOp\Mod($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2342 |
-
},
|
| 2343 |
-
460 => function ($stackPos) {
|
| 2344 |
-
$this->semValue = new Expr\BinaryOp\ShiftLeft($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2345 |
-
},
|
| 2346 |
-
461 => function ($stackPos) {
|
| 2347 |
-
$this->semValue = new Expr\BinaryOp\ShiftRight($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2348 |
-
},
|
| 2349 |
-
462 => function ($stackPos) {
|
| 2350 |
-
$this->semValue = new Expr\BinaryOp\Pow($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2351 |
-
},
|
| 2352 |
-
463 => function ($stackPos) {
|
| 2353 |
-
$this->semValue = new Expr\UnaryPlus($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2354 |
-
},
|
| 2355 |
-
464 => function ($stackPos) {
|
| 2356 |
-
$this->semValue = new Expr\UnaryMinus($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2357 |
-
},
|
| 2358 |
-
465 => function ($stackPos) {
|
| 2359 |
-
$this->semValue = new Expr\BooleanNot($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2360 |
-
},
|
| 2361 |
-
466 => function ($stackPos) {
|
| 2362 |
-
$this->semValue = new Expr\BitwiseNot($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2363 |
-
},
|
| 2364 |
-
467 => function ($stackPos) {
|
| 2365 |
-
$this->semValue = new Expr\BinaryOp\Identical($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2366 |
-
},
|
| 2367 |
-
468 => function ($stackPos) {
|
| 2368 |
-
$this->semValue = new Expr\BinaryOp\NotIdentical($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2369 |
-
},
|
| 2370 |
-
469 => function ($stackPos) {
|
| 2371 |
-
$this->semValue = new Expr\BinaryOp\Equal($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2372 |
-
},
|
| 2373 |
-
470 => function ($stackPos) {
|
| 2374 |
-
$this->semValue = new Expr\BinaryOp\NotEqual($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2375 |
-
},
|
| 2376 |
-
471 => function ($stackPos) {
|
| 2377 |
-
$this->semValue = new Expr\BinaryOp\Smaller($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2378 |
-
},
|
| 2379 |
-
472 => function ($stackPos) {
|
| 2380 |
-
$this->semValue = new Expr\BinaryOp\SmallerOrEqual($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2381 |
-
},
|
| 2382 |
-
473 => function ($stackPos) {
|
| 2383 |
-
$this->semValue = new Expr\BinaryOp\Greater($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2384 |
-
},
|
| 2385 |
-
474 => function ($stackPos) {
|
| 2386 |
-
$this->semValue = new Expr\BinaryOp\GreaterOrEqual($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2387 |
-
},
|
| 2388 |
-
475 => function ($stackPos) {
|
| 2389 |
-
$this->semValue = new Expr\Ternary($this->semStack[$stackPos-(5-1)], $this->semStack[$stackPos-(5-3)], $this->semStack[$stackPos-(5-5)], $this->startAttributeStack[$stackPos-(5-1)] + $this->endAttributes);
|
| 2390 |
-
},
|
| 2391 |
-
476 => function ($stackPos) {
|
| 2392 |
-
$this->semValue = new Expr\Ternary($this->semStack[$stackPos-(4-1)], null, $this->semStack[$stackPos-(4-4)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2393 |
-
},
|
| 2394 |
-
477 => function ($stackPos) {
|
| 2395 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2396 |
-
},
|
| 2397 |
-
478 => function ($stackPos) {
|
| 2398 |
-
$this->semValue = $this->semStack[$stackPos-(3-2)];
|
| 2399 |
-
},
|
| 2400 |
-
479 => function ($stackPos) {
|
| 2401 |
-
$this->semValue = new Expr\ConstFetch($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2402 |
-
},
|
| 2403 |
-
480 => function ($stackPos) {
|
| 2404 |
-
$this->semValue = new Expr\ClassConstFetch($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2405 |
-
},
|
| 2406 |
-
481 => function ($stackPos) {
|
| 2407 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2408 |
-
},
|
| 2409 |
-
482 => function ($stackPos) {
|
| 2410 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2411 |
-
},
|
| 2412 |
-
483 => function ($stackPos) {
|
| 2413 |
-
$attrs = $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes; $attrs['kind'] = Scalar\String_::KIND_DOUBLE_QUOTED;
|
| 2414 |
-
foreach ($this->semStack[$stackPos-(3-2)] as $s) { if ($s instanceof Node\Scalar\EncapsedStringPart) { $s->value = Node\Scalar\String_::parseEscapeSequences($s->value, '"', true); } }; $this->semValue = new Scalar\Encapsed($this->semStack[$stackPos-(3-2)], $attrs);
|
| 2415 |
-
},
|
| 2416 |
-
484 => function ($stackPos) {
|
| 2417 |
-
$this->semValue = $this->parseDocString($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-2)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes, $this->startAttributeStack[$stackPos-(3-3)] + $this->endAttributeStack[$stackPos-(3-3)], true);
|
| 2418 |
-
},
|
| 2419 |
-
485 => function ($stackPos) {
|
| 2420 |
-
$this->semValue = array();
|
| 2421 |
-
},
|
| 2422 |
-
486 => function ($stackPos) {
|
| 2423 |
-
$this->semValue = $this->semStack[$stackPos-(2-1)];
|
| 2424 |
-
},
|
| 2425 |
-
487 => function ($stackPos) {
|
| 2426 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 2427 |
-
},
|
| 2428 |
-
488 => function ($stackPos) {
|
| 2429 |
-
$this->semValue = $this->semStack[$stackPos];
|
| 2430 |
-
},
|
| 2431 |
-
489 => function ($stackPos) {
|
| 2432 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 2433 |
-
},
|
| 2434 |
-
490 => function ($stackPos) {
|
| 2435 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 2436 |
-
},
|
| 2437 |
-
491 => function ($stackPos) {
|
| 2438 |
-
$this->semValue = new Expr\ArrayItem($this->semStack[$stackPos-(3-3)], $this->semStack[$stackPos-(3-1)], false, $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2439 |
-
},
|
| 2440 |
-
492 => function ($stackPos) {
|
| 2441 |
-
$this->semValue = new Expr\ArrayItem($this->semStack[$stackPos-(1-1)], null, false, $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2442 |
-
},
|
| 2443 |
-
493 => function ($stackPos) {
|
| 2444 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2445 |
-
},
|
| 2446 |
-
494 => function ($stackPos) {
|
| 2447 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2448 |
-
},
|
| 2449 |
-
495 => function ($stackPos) {
|
| 2450 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2451 |
-
},
|
| 2452 |
-
496 => function ($stackPos) {
|
| 2453 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2454 |
-
},
|
| 2455 |
-
497 => function ($stackPos) {
|
| 2456 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(6-2)], $this->semStack[$stackPos-(6-5)], $this->startAttributeStack[$stackPos-(6-1)] + $this->endAttributes);
|
| 2457 |
-
},
|
| 2458 |
-
498 => function ($stackPos) {
|
| 2459 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2460 |
-
},
|
| 2461 |
-
499 => function ($stackPos) {
|
| 2462 |
-
$this->semValue = new Expr\PropertyFetch($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2463 |
-
},
|
| 2464 |
-
500 => function ($stackPos) {
|
| 2465 |
-
$this->semValue = new Expr\MethodCall($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->semStack[$stackPos-(4-4)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2466 |
-
},
|
| 2467 |
-
501 => function ($stackPos) {
|
| 2468 |
-
$this->semValue = new Expr\FuncCall($this->semStack[$stackPos-(2-1)], $this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2469 |
-
},
|
| 2470 |
-
502 => function ($stackPos) {
|
| 2471 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2472 |
-
},
|
| 2473 |
-
503 => function ($stackPos) {
|
| 2474 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2475 |
-
},
|
| 2476 |
-
504 => function ($stackPos) {
|
| 2477 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2478 |
-
},
|
| 2479 |
-
505 => function ($stackPos) {
|
| 2480 |
-
$this->semValue = $this->semStack[$stackPos-(3-2)];
|
| 2481 |
-
},
|
| 2482 |
-
506 => function ($stackPos) {
|
| 2483 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2484 |
-
},
|
| 2485 |
-
507 => function ($stackPos) {
|
| 2486 |
-
$this->semValue = new Expr\Variable($this->semStack[$stackPos-(2-2)], $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2487 |
-
},
|
| 2488 |
-
508 => function ($stackPos) {
|
| 2489 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2490 |
-
},
|
| 2491 |
-
509 => function ($stackPos) {
|
| 2492 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2493 |
-
},
|
| 2494 |
-
510 => function ($stackPos) {
|
| 2495 |
-
$this->semValue = new Expr\StaticPropertyFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-4)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2496 |
-
},
|
| 2497 |
-
511 => function ($stackPos) {
|
| 2498 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2499 |
-
},
|
| 2500 |
-
512 => function ($stackPos) {
|
| 2501 |
-
$var = substr($this->semStack[$stackPos-(1-1)], 1); $this->semValue = \is_string($var) ? new Node\VarLikeIdentifier($var, $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes) : $var;
|
| 2502 |
-
},
|
| 2503 |
-
513 => function ($stackPos) {
|
| 2504 |
-
$this->semValue = new Expr\StaticPropertyFetch($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2505 |
-
},
|
| 2506 |
-
514 => function ($stackPos) {
|
| 2507 |
-
$this->semValue = new Expr\StaticPropertyFetch($this->semStack[$stackPos-(6-1)], $this->semStack[$stackPos-(6-5)], $this->startAttributeStack[$stackPos-(6-1)] + $this->endAttributes);
|
| 2508 |
-
},
|
| 2509 |
-
515 => function ($stackPos) {
|
| 2510 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2511 |
-
},
|
| 2512 |
-
516 => function ($stackPos) {
|
| 2513 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2514 |
-
},
|
| 2515 |
-
517 => function ($stackPos) {
|
| 2516 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2517 |
-
},
|
| 2518 |
-
518 => function ($stackPos) {
|
| 2519 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2520 |
-
},
|
| 2521 |
-
519 => function ($stackPos) {
|
| 2522 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2523 |
-
},
|
| 2524 |
-
520 => function ($stackPos) {
|
| 2525 |
-
$this->semValue = new Expr\Variable($this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2526 |
-
},
|
| 2527 |
-
521 => function ($stackPos) {
|
| 2528 |
-
$this->semValue = null;
|
| 2529 |
-
},
|
| 2530 |
-
522 => function ($stackPos) {
|
| 2531 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2532 |
-
},
|
| 2533 |
-
523 => function ($stackPos) {
|
| 2534 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2535 |
-
},
|
| 2536 |
-
524 => function ($stackPos) {
|
| 2537 |
-
$this->semValue = $this->semStack[$stackPos-(3-2)];
|
| 2538 |
-
},
|
| 2539 |
-
525 => function ($stackPos) {
|
| 2540 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2541 |
-
},
|
| 2542 |
-
526 => function ($stackPos) {
|
| 2543 |
-
$this->semValue = new Expr\Error($this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes); $this->errorState = 2;
|
| 2544 |
-
},
|
| 2545 |
-
527 => function ($stackPos) {
|
| 2546 |
-
$this->semValue = new Expr\List_($this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2547 |
-
},
|
| 2548 |
-
528 => function ($stackPos) {
|
| 2549 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 2550 |
-
},
|
| 2551 |
-
529 => function ($stackPos) {
|
| 2552 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 2553 |
-
},
|
| 2554 |
-
530 => function ($stackPos) {
|
| 2555 |
-
$this->semValue = new Expr\ArrayItem($this->semStack[$stackPos-(1-1)], null, false, $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2556 |
-
},
|
| 2557 |
-
531 => function ($stackPos) {
|
| 2558 |
-
$this->semValue = new Expr\ArrayItem($this->semStack[$stackPos-(1-1)], null, false, $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2559 |
-
},
|
| 2560 |
-
532 => function ($stackPos) {
|
| 2561 |
-
$this->semValue = null;
|
| 2562 |
-
},
|
| 2563 |
-
533 => function ($stackPos) {
|
| 2564 |
-
$this->semValue = array();
|
| 2565 |
-
},
|
| 2566 |
-
534 => function ($stackPos) {
|
| 2567 |
-
$this->semValue = $this->semStack[$stackPos-(2-1)];
|
| 2568 |
-
},
|
| 2569 |
-
535 => function ($stackPos) {
|
| 2570 |
-
$this->semStack[$stackPos-(3-1)][] = $this->semStack[$stackPos-(3-3)]; $this->semValue = $this->semStack[$stackPos-(3-1)];
|
| 2571 |
-
},
|
| 2572 |
-
536 => function ($stackPos) {
|
| 2573 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 2574 |
-
},
|
| 2575 |
-
537 => function ($stackPos) {
|
| 2576 |
-
$this->semValue = new Expr\ArrayItem($this->semStack[$stackPos-(3-3)], $this->semStack[$stackPos-(3-1)], false, $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2577 |
-
},
|
| 2578 |
-
538 => function ($stackPos) {
|
| 2579 |
-
$this->semValue = new Expr\ArrayItem($this->semStack[$stackPos-(1-1)], null, false, $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2580 |
-
},
|
| 2581 |
-
539 => function ($stackPos) {
|
| 2582 |
-
$this->semValue = new Expr\ArrayItem($this->semStack[$stackPos-(4-4)], $this->semStack[$stackPos-(4-1)], true, $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2583 |
-
},
|
| 2584 |
-
540 => function ($stackPos) {
|
| 2585 |
-
$this->semValue = new Expr\ArrayItem($this->semStack[$stackPos-(2-2)], null, true, $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2586 |
-
},
|
| 2587 |
-
541 => function ($stackPos) {
|
| 2588 |
-
$this->semValue = new Expr\ArrayItem($this->semStack[$stackPos-(2-2)], null, false, $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes, true, $this->startAttributeStack[$stackPos-(2-1)] + $this->endAttributes);
|
| 2589 |
-
},
|
| 2590 |
-
542 => function ($stackPos) {
|
| 2591 |
-
$this->semStack[$stackPos-(2-1)][] = $this->semStack[$stackPos-(2-2)]; $this->semValue = $this->semStack[$stackPos-(2-1)];
|
| 2592 |
-
},
|
| 2593 |
-
543 => function ($stackPos) {
|
| 2594 |
-
$this->semStack[$stackPos-(2-1)][] = $this->semStack[$stackPos-(2-2)]; $this->semValue = $this->semStack[$stackPos-(2-1)];
|
| 2595 |
-
},
|
| 2596 |
-
544 => function ($stackPos) {
|
| 2597 |
-
$this->semValue = array($this->semStack[$stackPos-(1-1)]);
|
| 2598 |
-
},
|
| 2599 |
-
545 => function ($stackPos) {
|
| 2600 |
-
$this->semValue = array($this->semStack[$stackPos-(2-1)], $this->semStack[$stackPos-(2-2)]);
|
| 2601 |
-
},
|
| 2602 |
-
546 => function ($stackPos) {
|
| 2603 |
-
$this->semValue = new Scalar\EncapsedStringPart($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2604 |
-
},
|
| 2605 |
-
547 => function ($stackPos) {
|
| 2606 |
-
$this->semValue = new Expr\Variable($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2607 |
-
},
|
| 2608 |
-
548 => function ($stackPos) {
|
| 2609 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2610 |
-
},
|
| 2611 |
-
549 => function ($stackPos) {
|
| 2612 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(4-1)], $this->semStack[$stackPos-(4-3)], $this->startAttributeStack[$stackPos-(4-1)] + $this->endAttributes);
|
| 2613 |
-
},
|
| 2614 |
-
550 => function ($stackPos) {
|
| 2615 |
-
$this->semValue = new Expr\PropertyFetch($this->semStack[$stackPos-(3-1)], $this->semStack[$stackPos-(3-3)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2616 |
-
},
|
| 2617 |
-
551 => function ($stackPos) {
|
| 2618 |
-
$this->semValue = new Expr\Variable($this->semStack[$stackPos-(3-2)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2619 |
-
},
|
| 2620 |
-
552 => function ($stackPos) {
|
| 2621 |
-
$this->semValue = new Expr\Variable($this->semStack[$stackPos-(3-2)], $this->startAttributeStack[$stackPos-(3-1)] + $this->endAttributes);
|
| 2622 |
-
},
|
| 2623 |
-
553 => function ($stackPos) {
|
| 2624 |
-
$this->semValue = new Expr\ArrayDimFetch($this->semStack[$stackPos-(6-2)], $this->semStack[$stackPos-(6-4)], $this->startAttributeStack[$stackPos-(6-1)] + $this->endAttributes);
|
| 2625 |
-
},
|
| 2626 |
-
554 => function ($stackPos) {
|
| 2627 |
-
$this->semValue = $this->semStack[$stackPos-(3-2)];
|
| 2628 |
-
},
|
| 2629 |
-
555 => function ($stackPos) {
|
| 2630 |
-
$this->semValue = new Scalar\String_($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2631 |
-
},
|
| 2632 |
-
556 => function ($stackPos) {
|
| 2633 |
-
$this->semValue = $this->parseNumString($this->semStack[$stackPos-(1-1)], $this->startAttributeStack[$stackPos-(1-1)] + $this->endAttributes);
|
| 2634 |
-
},
|
| 2635 |
-
557 => function ($stackPos) {
|
| 2636 |
-
$this->semValue = $this->semStack[$stackPos-(1-1)];
|
| 2637 |
-
},
|
| 2638 |
-
];
|
| 2639 |
-
}
|
| 2640 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
vendor/nikic/php-parser/lib/PhpParser/Parser/Php7.php
DELETED
|
@@ -1,2480 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
namespace PhpParser\Parser;
|
| 4 |
-
|
| 5 |
-
use PhpParser\Error;
|
| 6 |
-
use PhpParser\Node;
|
| 7 |
-
use PhpParser\Node\Expr;
|
| 8 |
-
use PhpParser\Node\Name;
|
| 9 |
-
use PhpParser\Node\Scalar;
|
| 10 |
-
use PhpParser\Node\Stmt;
|
| 11 |
-
|
| 12 |
-
/* This is an automatically GENERATED file, which should not be manually edited.
|
| 13 |
-
* Instead edit one of the following:
|
| 14 |
-
* * the grammar files grammar/php5.y or grammar/php7.y
|
| 15 |
-
* * the skeleton file grammar/parser.template
|
| 16 |
-
* * the preprocessing script grammar/rebuildParsers.php
|
| 17 |
-
*/
|
| 18 |
-
class Php7 extends \PhpParser\ParserAbstract
|
| 19 |
-
{
|
| 20 |
-
protected $tokenToSymbolMapSize = 394;
|
| 21 |
-
protected $actionTableSize = 939;
|
| 22 |
-
protected $gotoTableSize = 505;
|
| 23 |
-
|
| 24 |
-
protected $invalidSymbol = 159;
|
| 25 |
-
protected $errorSymbol = 1;
|
| 26 |
-
protected $defaultAction = -32766;
|
| 27 |
-
protected $unexpectedTokenRule = 32767;
|
| 28 |
-
|
| 29 |
-
protected $YY2TBLSTATE = 347;
|
| 30 |
-
protected $numNonLeafStates = 601;
|
| 31 |
-
|
| 32 |
-
protected $symbolToName = array(
|
| 33 |
-
"EOF",
|
| 34 |
-
"error",
|
| 35 |
-
"T_INCLUDE",
|
| 36 |
-
"T_INCLUDE_ONCE",
|
| 37 |
-
"T_EVAL",
|
| 38 |
-
"T_REQUIRE",
|
| 39 |
-
"T_REQUIRE_ONCE",
|
| 40 |
-
"','",
|
| 41 |
-
"T_LOGICAL_OR",
|
| 42 |
-
"T_LOGICAL_XOR",
|
| 43 |
-
"T_LOGICAL_AND",
|
| 44 |
-
"T_PRINT",
|
| 45 |
-
"T_YIELD",
|
| 46 |
-
"T_DOUBLE_ARROW",
|
| 47 |
-
"T_YIELD_FROM",
|
| 48 |
-
"'='",
|
| 49 |
-
"T_PLUS_EQUAL",
|
| 50 |
-
"T_MINUS_EQUAL",
|
| 51 |
-
"T_MUL_EQUAL",
|
| 52 |
-
"T_DIV_EQUAL",
|
| 53 |
-
"T_CONCAT_EQUAL",
|
| 54 |
-
"T_MOD_EQUAL",
|
| 55 |
-
"T_AND_EQUAL",
|
| 56 |
-
"T_OR_EQUAL",
|
| 57 |
-
"T_XOR_EQUAL",
|
| 58 |
-
"T_SL_EQUAL",
|
| 59 |
-
"T_SR_EQUAL",
|
| 60 |
-
"T_POW_EQUAL",
|
| 61 |
-
"T_COALESCE_EQUAL",
|
| 62 |
-
"'?'",
|
| 63 |
-
"':'",
|
| 64 |
-
"T_COALESCE",
|
| 65 |
-
"T_BOOLEAN_OR",
|
| 66 |
-
"T_BOOLEAN_AND",
|
| 67 |
-
"'|'",
|
| 68 |
-
"'^'",
|
| 69 |
-
"'&'",
|
| 70 |
-
"T_IS_EQUAL",
|
| 71 |
-
"T_IS_NOT_EQUAL",
|
| 72 |
-
"T_IS_IDENTICAL",
|
| 73 |
-
"T_IS_NOT_IDENTICAL",
|
| 74 |
-
"T_SPACESHIP",
|
| 75 |
-
"'<'",
|
| 76 |
-
"T_IS_SMALLER_OR_EQUAL",
|
| 77 |
-
"'>'",
|
| 78 |
-
"T_IS_GREATER_OR_EQUAL",
|
| 79 |
-
"T_SL",
|
| 80 |
-
"T_SR",
|
| 81 |
-
"'+'",
|
| 82 |
-
"'-'",
|
| 83 |
-
"'.'",
|
| 84 |
-
"'*'",
|
| 85 |
-
"'/'",
|
| 86 |
-
"'%'",
|
| 87 |
-
"'!'",
|
| 88 |
-
"T_INSTANCEOF",
|
| 89 |
-
"'~'",
|
| 90 |
-
"T_INC",
|
| 91 |
-
"T_DEC",
|
| 92 |
-
"T_INT_CAST",
|
| 93 |
-
"T_DOUBLE_CAST",
|
| 94 |
-
"T_STRING_CAST",
|
| 95 |
-
"T_ARRAY_CAST",
|
| 96 |
-
"T_OBJECT_CAST",
|
| 97 |
-
"T_BOOL_CAST",
|
| 98 |
-
"T_UNSET_CAST",
|
| 99 |
-
"'@'",
|
| 100 |
-
"T_POW",
|
| 101 |
-
"'['",
|
| 102 |
-
"T_NEW",
|
| 103 |
-
"T_CLONE",
|
| 104 |
-
"T_EXIT",
|
| 105 |
-
"T_IF",
|
| 106 |
-
"T_ELSEIF",
|
| 107 |
-
"T_ELSE",
|
| 108 |
-
"T_ENDIF",
|
| 109 |
-
"T_LNUMBER",
|
| 110 |
-
"T_DNUMBER",
|
| 111 |
-
"T_STRING",
|
| 112 |
-
"T_STRING_VARNAME",
|
| 113 |
-
"T_VARIABLE",
|
| 114 |
-
"T_NUM_STRING",
|
| 115 |
-
"T_INLINE_HTML",
|
| 116 |
-
"T_ENCAPSED_AND_WHITESPACE",
|
| 117 |
-
"T_CONSTANT_ENCAPSED_STRING",
|
| 118 |
-
"T_ECHO",
|
| 119 |
-
"T_DO",
|
| 120 |
-
"T_WHILE",
|
| 121 |
-
"T_ENDWHILE",
|
| 122 |
-
"T_FOR",
|
| 123 |
-
"T_ENDFOR",
|
| 124 |
-
"T_FOREACH",
|
| 125 |
-
"T_ENDFOREACH",
|
| 126 |
-
"T_DECLARE",
|
| 127 |
-
"T_ENDDECLARE",
|
| 128 |
-
"T_AS",
|
| 129 |
-
"T_SWITCH",
|
| 130 |
-
"T_ENDSWITCH",
|
| 131 |
-
"T_CASE",
|
| 132 |
-
"T_DEFAULT",
|
| 133 |
-
"T_BREAK",
|
| 134 |
-
"T_CONTINUE",
|
| 135 |
-
"T_GOTO",
|
| 136 |
-
"T_FUNCTION",
|
| 137 |
-
"T_FN",
|
| 138 |
-
"T_CONST",
|
| 139 |
-
"T_RETURN",
|
| 140 |
-
"T_TRY",
|
| 141 |
-
"T_CATCH",
|
| 142 |
-
"T_FINALLY",
|
| 143 |
-
"T_THROW",
|
| 144 |
-
"T_USE",
|
| 145 |
-
"T_INSTEADOF",
|
| 146 |
-
"T_GLOBAL",
|
| 147 |
-
"T_STATIC",
|
| 148 |
-
"T_ABSTRACT",
|
| 149 |
-
"T_FINAL",
|
| 150 |
-
"T_PRIVATE",
|
| 151 |
-
"T_PROTECTED",
|
| 152 |
-
"T_PUBLIC",
|
| 153 |
-
"T_VAR",
|
| 154 |
-
"T_UNSET",
|
| 155 |
-
"T_ISSET",
|
| 156 |
-
"T_EMPTY",
|
| 157 |
-
"T_HALT_COMPILER",
|
| 158 |
-
"T_CLASS",
|
| 159 |
-
"T_TRAIT",
|
| 160 |
-
"T_INTERFACE",
|
| 161 |
-
"T_EXTENDS",
|
| 162 |
-
"T_IMPLEMENTS",
|
| 163 |
-
"T_OBJECT_OPERATOR",
|
| 164 |
-
"T_LIST",
|
| 165 |
-
"T_ARRAY",
|
| 166 |
-
"T_CALLABLE",
|
| 167 |
-
"T_CLASS_C",
|
| 168 |
-
"T_TRAIT_C",
|
| 169 |
-
"T_METHOD_C",
|
| 170 |
-
"T_FUNC_C",
|
| 171 |
-
"T_LINE",
|
| 172 |
-
"T_FILE",
|
| 173 |
-
"T_START_HEREDOC",
|
| 174 |
-
"T_END_HEREDOC",
|
| 175 |
-
"T_DOLLAR_OPEN_CURLY_BRACES",
|
| 176 |
-
"T_CURLY_OPEN",
|
| 177 |
-
"T_PAAMAYIM_NEKUDOTAYIM",
|
| 178 |
-
"T_NAMESPACE",
|
| 179 |
-
"T_NS_C",
|
| 180 |
-
"T_DIR",
|
| 181 |
-
"T_NS_SEPARATOR",
|
| 182 |
-
"T_ELLIPSIS",
|
| 183 |
-
"';'",
|
| 184 |
-
"'{'",
|
| 185 |
-
"'}'",
|
| 186 |
-
"'('",
|
| 187 |
-
"')'",
|
| 188 |
-
"'`'",
|
| 189 |
-
"']'",
|
| 190 |
-
"'\"'",
|
| 191 |
-
"'$'"
|
| 192 |
-
);
|
| 193 |
-
|
| 194 |
-
protected $tokenToSymbol = array(
|
| 195 |
-
0, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 196 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 197 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 198 |
-
159, 159, 159, 54, 157, 159, 158, 53, 36, 159,
|
| 199 |
-
153, 154, 51, 48, 7, 49, 50, 52, 159, 159,
|
| 200 |
-
159, 159, 159, 159, 159, 159, 159, 159, 30, 150,
|
| 201 |
-
42, 15, 44, 29, 66, 159, 159, 159, 159, 159,
|
| 202 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 203 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 204 |
-
159, 68, 159, 156, 35, 159, 155, 159, 159, 159,
|
| 205 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 206 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 207 |
-
159, 159, 159, 151, 34, 152, 56, 159, 159, 159,
|
| 208 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 209 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 210 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 211 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 212 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 213 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 214 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 215 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 216 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 217 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 218 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 219 |
-
159, 159, 159, 159, 159, 159, 159, 159, 159, 159,
|
| 220 |
-
159, 159, 159, 159, 159, 159, 1, 2, 3, 4,
|
| 221 |
-
5, 6, 8, 9, 10, 11, 12, 13, 14, 16,
|
| 222 |
-
17, 18, 19, 20, 21, 22, 23, 24, 25, 26,
|
| 223 |
-
27, 28, 31, 32, 33, 37, 38, 39, 40, 41,
|
| 224 |
-
43, 45, 46, 47, 55, 57, 58, 59, 60, 61,
|
| 225 |
-
62, 63, 64, 65, 67, 69, 70, 71, 72, 73,
|
| 226 |
-
74, 75, 76, 77, 78, 79, 80, 81, 82, 159,
|
| 227 |
-
159, 83, 84, 85, 86, 87, 88, 89, 90, 91,
|
| 228 |
-
92, 93, 94, 95, 96, 97, 98, 99, 100, 101,
|
| 229 |
-
102, 103, 104, 105, 106, 107, 108, 109, 110, 111,
|
| 230 |
-
112, 113, 114, 115, 116, 117, 118, 119, 120, 121,
|
| 231 |
-
122, 123, 124, 125, 126, 127, 128, 129, 130, 131,
|
| 232 |
-
132, 133, 134, 135, 136, 137, 138, 139, 159, 159,
|
| 233 |
-
159, 159, 159, 159, 140, 141, 142, 143, 144, 145,
|
| 234 |
-
146, 147, 148, 149
|
| 235 |
-
);
|
| 236 |
-
|
| 237 |
-
protected $action = array(
|
| 238 |
-
606, 607, 608, 609, 610, 1085, 611, 612, 613, 649,
|
| 239 |
-
650,-32766,-32766,-32766,-32767,-32767,-32767,-32767, 94, 95,
|
| 240 |
-
96, 97, 98, 684,-32766,-32766,-32766, -219, -219, -219,
|
| 241 |
-
-32766,-32766,-32766, 368,-32766,-32766,-32766,-32766,-32766,-32766,
|
| 242 |
-
-32767,-32767,-32767,-32767,-32767, 428, 429, 906, 907, 908,
|
| 243 |
-
905, 904, 903, 614, 742, 790, 370, 371, 845, 906,
|
| 244 |
-
907, 908, 905, 904, 903, -263, 0, 615, 616, 617,
|
| 245 |
-
618, 619, 620, 621, 9, 400, 682, 96, 97, 98,
|
| 246 |
-
769, 28, -219, 622, 623, 624, 625, 626, 627, 628,
|
| 247 |
-
629, 630, 631, 632, 652, 653, 654, 655, 656, 644,
|
| 248 |
-
645, 646, 674, 647, 648, 633, 634, 635, 636, 637,
|
| 249 |
-
638, 639, 676, 677, 678, 679, 680, 681, 640, 641,
|
| 250 |
-
642, 643, 673, 664, 662, 663, 659, 660, 275, 651,
|
| 251 |
-
657, 658, 665, 666, 668, 667, 669, 670, 785, 76,
|
| 252 |
-
77, 78, -178, 661, 672, 671, 767, 44, 45, 419,
|
| 253 |
-
46, 47, 691, 257, 1047, 75, 48, 49, 1027, 50,
|
| 254 |
-
30, 257, 79, 80, 81, 82, 83, 84, 85, 86,
|
| 255 |
-
87, 88, 89, 90, 91, 92, 93, 94, 95, 96,
|
| 256 |
-
97, 98, 99, 100, 101, 1100, 239,-32766,-32766,-32766,
|
| 257 |
-
391, 257, 119, 51, 52, 1027, 401, 821, 102, 53,
|
| 258 |
-
121, 54, 218, 219, 55, 56, 57, 58, 59, 60,
|
| 259 |
-
61, 62, -263, 24, 238, 63, 366, 420,-32766,-32766,
|
| 260 |
-
-32766, 1053, 1054, 421, 707, 1082, 708, 756,-32766, 1051,
|
| 261 |
-
36, 20, 422, 1082, 423, 130, 424, 1082, 425,-32766,
|
| 262 |
-
225, 426, 581, -177, 249, 38, 39, 367, 375, 369,
|
| 263 |
-
582, 40, 427, 213, 274, 64, 850, 851, 303, 288,
|
| 264 |
-
534, 21, 684, 223, 850, 851, 430, 431, 432, 355,
|
| 265 |
-
384, 1019, 1082, 577, 1082, 583, 433, 434, -239, 1041,
|
| 266 |
-
1042, 1043, 1044, 1038, 1039, 252, -92,-32766, 588, -178,
|
| 267 |
-
442, 1045, 1040, 372, 850, 851, 575, 287, 65,-32766,
|
| 268 |
-
266, 690, 271, 276, 126, 686, 304, 882, 1019,-32766,
|
| 269 |
-
69, 276,-32766,-32766,-32766, 276,-32766, 822,-32766, 360,
|
| 270 |
-
-32766, -464, 220,-32766, -299, 307, -299,-32766,-32766,-32766,
|
| 271 |
-
-32766,-32766,-32766,-32766,-32766, 127, -463,-32766, 686,-32766,
|
| 272 |
-
-32766, 334,-32766,-32766,-32766, 465, 312, 69,-32766, 359,
|
| 273 |
-
276,-32766, 276,-32766,-32766,-32766,-32766,-32766,-32766, 586,
|
| 274 |
-
-465, 858, 769,-32766, 686,-32766,-32766,-32766,-32766, 362,
|
| 275 |
-
769,-32766,-32766,-32766, 223,-32766, 125,-32766,-32766,-32766,
|
| 276 |
-
560, 859,-32766, -464, 590,-32766,-32766,-32766,-32766, 257,
|
| 277 |
-
-177, -467,-32766,-32766, -234, 807,-32766, -464, -463,-32766,
|
| 278 |
-
334, 507, 363, 1059, -464, 442, -470,-32766, 372, -298,
|
| 279 |
-
-32766, -298, -463, 500, 549, 550, 686, 269, 364, -463,
|
| 280 |
-
-32766, -469, -465,-32766,-32766,-32766, 898,-32766, 365,-32766,
|
| 281 |
-
1128,-32766,-32766, 1129,-32766, 68, -465,-32766,-32766,-32766,
|
| 282 |
-
-32766, 133, 330, -465,-32766,-32766, 42, 561,-32766, 1104,
|
| 283 |
-
372,-32766, 334, -467, 884, 1103,-32766,-32766, -276,-32766,
|
| 284 |
-
380, 381, 686, 488, 134,-32766,-32766, 222, 137,-32766,
|
| 285 |
-
-32766,-32766, 116,-32766, -467,-32766, 32,-32766, -462, 769,
|
| 286 |
-
-32766, -501, 117, -501,-32766,-32766,-32766, 125, 122,-32766,
|
| 287 |
-
-32766,-32766, 850, 851,-32766, 123, 43,-32766, 334, 411,
|
| 288 |
-
224, 8, 129,-32766, 769,-32766, 136, 212, 255, 686,
|
| 289 |
-
99, 100, 101,-32766, 239, 138,-32766,-32766,-32766,-32766,
|
| 290 |
-
-32766, 707,-32766, 708,-32766, 689, 102,-32766, 1119, 118,
|
| 291 |
-
139,-32766,-32766,-32766, -83,-32766,-32766,-32766,-32766, 250,
|
| 292 |
-
-462,-32766, 686, 589,-32766, 334,-32766, 592, 124,-32766,
|
| 293 |
-
-32766,-32766,-32766,-32766, -462,-32766, 766,-32766, 256,-32766,
|
| 294 |
-
-32766, -462, 527, 528,-32766,-32766,-32766, 850, 851, 132,
|
| 295 |
-
-32766,-32766, 306, 781,-32766, 883, 598,-32766, 334, 120,
|
| 296 |
-
258, 259,-32766, 292, 239,-32766, 102, 29, 221, 131,
|
| 297 |
-
-32766, 557, 686, 1130,-32766, 474, 686, 569, 684, 540,
|
| 298 |
-
-32766, 687, 689,-32766,-32766,-32766, 525,-32766, 912,-32766,
|
| 299 |
-
469,-32766, 535, 270,-32766,-32766, 1019, 552,-32766,-32766,
|
| 300 |
-
-32766, 791, 792, 268,-32766,-32766, -81, 10,-32766, 226,
|
| 301 |
-
-32766,-32766, 334, 388, 267, 783, 686, 541, 553,-32766,
|
| 302 |
-
-32766, 337, -428,-32766,-32766,-32766, -237,-32766, 0,-32766,
|
| 303 |
-
576,-32766, 0, 34,-32766, 0, 0, 0,-32766,-32766,
|
| 304 |
-
-32766, 24, 273, -495,-32766,-32766, 0, 0,-32766,-32766,
|
| 305 |
-
0,-32766, 334, 1082, 1058, 0, 1060, 1051, 342,-32766,
|
| 306 |
-
31, 103, 104, 105, 106, 107, 108, 109, 110, 111,
|
| 307 |
-
112, 113, 114, 115, -419, 5, 24, -4, 12, 305,
|
| 308 |
-
343, 346, -235, 0, 384, 471, 0, 1019, 1082,-32766,
|
| 309 |
-
356, 357, 1051,-32766,-32766,-32766, 35, 596, 597, 747,
|
| 310 |
-
824, 808, 941, 943, 433, 434, 815, 1041, 1042, 1043,
|
| 311 |
-
1044, 1038, 1039, -462,-32766, 878,-32766,-32766, 879, 1045,
|
| 312 |
-
1040, 805, 1019, 578, 816, 745, 67,-32766,-32766,-32766,
|
| 313 |
-
271, 276, 803, 887, 890, 891, 888, 889, 769, 895,
|
| 314 |
-
434, 580, 1041, 1042, 1043, 1044, 1038, 1039,-32766, 584,
|
| 315 |
-
-32766,-32766,-32766,-32766, 1045, 1040, 585, -137, -137, -137,
|
| 316 |
-
587, 67, 591, 285, 286, 271, 276, 349, 350, 579,
|
| 317 |
-
-432, 593, -137, 743, -137, -462, -137, 1125, -137, 1127,
|
| 318 |
-
368, 702, 351, 789, 701, 711, 788, 368, 265, -462,
|
| 319 |
-
712, 709, 428, 429, 1126, 787, -462, -493, 1007, 428,
|
| 320 |
-
429, 699, 790, 370, 371, 710, 776, 784, 742, 790,
|
| 321 |
-
370, 371, -218, -218, -218, 774, 813, 814, 368, 1124,
|
| 322 |
-
1083, 1074, 290,-32766,-32766,-32766, 1090, 769, 1095, -4,
|
| 323 |
-
428, 429, 1098, -234, 769, -470, -137, 14, 1052, 742,
|
| 324 |
-
790, 370, 371, -469,-32766, -468,-32766,-32766,-32766,-32766,
|
| 325 |
-
-32766,-32766, 23, 25, 26, 33, 37, 41, 66, 70,
|
| 326 |
-
71, 72, 73, 74, 128, 769, 135, -218, 15, 140,
|
| 327 |
-
217, 243, 0, 244, 245, 246, 247, 248, 289, 352,
|
| 328 |
-
354, 0, 16, 17, 19, 327, 402, 404, 407, 409,
|
| 329 |
-
410, 417, 566, 1031, 980, 1049, 860, 1011, -92, 13,
|
| 330 |
-
18, 22, 261, 326, 497, 521, 568, 984, 1026, 981,
|
| 331 |
-
1101, 0, 997, 0, 1048, 1073, 1089, 1122, 531
|
| 332 |
-
);
|
| 333 |
-
|
| 334 |
-
protected $actionCheck = array(
|
| 335 |
-
2, 3, 4, 5, 6, 1, 8, 9, 10, 11,
|
| 336 |
-
12, 8, 9, 10, 42, 43, 44, 45, 46, 47,
|
| 337 |
-
48, 49, 50, 78, 8, 9, 10, 97, 98, 99,
|
| 338 |
-
8, 9, 29, 103, 31, 32, 33, 34, 35, 36,
|
| 339 |
-
37, 38, 39, 40, 41, 115, 116, 114, 115, 116,
|
| 340 |
-
117, 118, 119, 55, 124, 125, 126, 127, 1, 114,
|
| 341 |
-
115, 116, 117, 118, 119, 7, 0, 69, 70, 71,
|
| 342 |
-
72, 73, 74, 75, 7, 30, 78, 48, 49, 50,
|
| 343 |
-
150, 7, 152, 85, 86, 87, 88, 89, 90, 91,
|
| 344 |
-
92, 93, 94, 95, 96, 97, 98, 99, 100, 101,
|
| 345 |
-
102, 103, 104, 105, 106, 107, 108, 109, 110, 111,
|
| 346 |
-
112, 113, 114, 115, 116, 117, 118, 119, 120, 121,
|
| 347 |
-
122, 123, 124, 125, 126, 127, 128, 129, 68, 131,
|
| 348 |
-
132, 133, 134, 135, 136, 137, 138, 139, 1, 8,
|
| 349 |
-
9, 10, 7, 145, 146, 147, 1, 2, 3, 4,
|
| 350 |
-
5, 6, 1, 29, 1, 151, 11, 12, 1, 14,
|
| 351 |
-
29, 29, 31, 32, 33, 34, 35, 36, 37, 38,
|
| 352 |
-
39, 40, 41, 42, 43, 44, 45, 46, 47, 48,
|
| 353 |
-
49, 50, 51, 52, 53, 1, 55, 8, 9, 10,
|
| 354 |
-
130, 29, 13, 48, 49, 1, 151, 30, 67, 54,
|
| 355 |
-
7, 56, 57, 58, 59, 60, 61, 62, 63, 64,
|
| 356 |
-
65, 66, 154, 68, 69, 70, 71, 72, 8, 9,
|
| 357 |
-
10, 76, 77, 78, 103, 80, 105, 82, 1, 84,
|
| 358 |
-
85, 86, 87, 80, 89, 7, 91, 80, 93, 29,
|
| 359 |
-
7, 96, 30, 7, 7, 100, 101, 102, 103, 104,
|
| 360 |
-
30, 106, 107, 13, 7, 110, 132, 133, 113, 114,
|
| 361 |
-
73, 74, 78, 36, 132, 133, 121, 122, 123, 148,
|
| 362 |
-
148, 114, 80, 151, 80, 30, 131, 132, 154, 134,
|
| 363 |
-
135, 136, 137, 138, 139, 140, 154, 1, 151, 154,
|
| 364 |
-
145, 146, 147, 148, 132, 133, 151, 7, 153, 72,
|
| 365 |
-
155, 150, 157, 158, 151, 78, 7, 1, 114, 82,
|
| 366 |
-
153, 158, 85, 86, 87, 158, 89, 150, 91, 125,
|
| 367 |
-
93, 68, 36, 96, 103, 7, 105, 100, 101, 102,
|
| 368 |
-
8, 9, 10, 106, 107, 151, 68, 110, 78, 1,
|
| 369 |
-
113, 114, 8, 9, 10, 83, 7, 153, 121, 7,
|
| 370 |
-
158, 29, 158, 31, 32, 33, 34, 35, 72, 30,
|
| 371 |
-
68, 1, 150, 29, 78, 31, 32, 33, 82, 7,
|
| 372 |
-
150, 85, 86, 87, 36, 89, 149, 91, 151, 93,
|
| 373 |
-
78, 154, 96, 130, 30, 1, 100, 101, 102, 29,
|
| 374 |
-
154, 68, 106, 107, 154, 150, 110, 144, 130, 113,
|
| 375 |
-
114, 49, 7, 141, 151, 145, 153, 121, 148, 103,
|
| 376 |
-
72, 105, 144, 1, 73, 74, 78, 111, 7, 151,
|
| 377 |
-
82, 153, 130, 85, 86, 87, 120, 89, 7, 91,
|
| 378 |
-
78, 93, 1, 81, 96, 149, 144, 151, 100, 101,
|
| 379 |
-
102, 98, 99, 151, 106, 107, 68, 145, 110, 1,
|
| 380 |
-
148, 113, 114, 130, 152, 7, 72, 8, 152, 121,
|
| 381 |
-
103, 104, 78, 79, 13, 1, 82, 36, 13, 85,
|
| 382 |
-
86, 87, 15, 89, 151, 91, 13, 93, 68, 150,
|
| 383 |
-
96, 154, 15, 156, 100, 101, 102, 149, 15, 151,
|
| 384 |
-
106, 107, 132, 133, 110, 15, 68, 113, 114, 103,
|
| 385 |
-
36, 105, 15, 72, 150, 121, 15, 95, 130, 78,
|
| 386 |
-
51, 52, 53, 82, 55, 15, 85, 86, 87, 1,
|
| 387 |
-
89, 103, 91, 105, 93, 80, 67, 96, 83, 151,
|
| 388 |
-
15, 100, 101, 102, 30, 151, 72, 106, 107, 30,
|
| 389 |
-
130, 110, 78, 30, 113, 114, 82, 30, 30, 85,
|
| 390 |
-
86, 87, 121, 89, 144, 91, 30, 93, 130, 1,
|
| 391 |
-
96, 151, 108, 109, 100, 101, 102, 132, 133, 30,
|
| 392 |
-
106, 107, 144, 36, 110, 150, 151, 113, 114, 151,
|
| 393 |
-
34, 34, 151, 34, 55, 121, 67, 142, 143, 68,
|
| 394 |
-
72, 75, 78, 81, 83, 87, 78, 90, 78, 94,
|
| 395 |
-
82, 78, 80, 85, 86, 87, 111, 89, 80, 91,
|
| 396 |
-
83, 93, 88, 112, 96, 151, 114, 92, 100, 101,
|
| 397 |
-
102, 125, 125, 129, 106, 107, 95, 95, 110, 36,
|
| 398 |
-
72, 113, 114, 95, 128, 149, 78, 97, 97, 121,
|
| 399 |
-
82, 148, 144, 85, 86, 87, 154, 89, -1, 91,
|
| 400 |
-
151, 93, -1, 150, 96, -1, -1, -1, 100, 101,
|
| 401 |
-
102, 68, 128, 153, 106, 107, -1, -1, 110, 151,
|
| 402 |
-
-1, 113, 114, 80, 141, -1, 141, 84, 148, 121,
|
| 403 |
-
15, 16, 17, 18, 19, 20, 21, 22, 23, 24,
|
| 404 |
-
25, 26, 27, 28, 144, 144, 68, 0, 144, 144,
|
| 405 |
-
148, 148, 154, -1, 148, 148, -1, 114, 80, 151,
|
| 406 |
-
148, 148, 84, 8, 9, 10, 150, 150, 150, 150,
|
| 407 |
-
150, 150, 57, 58, 131, 132, 150, 134, 135, 136,
|
| 408 |
-
137, 138, 139, 68, 29, 150, 31, 32, 150, 146,
|
| 409 |
-
147, 150, 114, 151, 150, 150, 153, 8, 9, 10,
|
| 410 |
-
157, 158, 150, 150, 150, 150, 150, 150, 150, 150,
|
| 411 |
-
132, 151, 134, 135, 136, 137, 138, 139, 29, 151,
|
| 412 |
-
31, 32, 33, 34, 146, 147, 151, 73, 74, 75,
|
| 413 |
-
151, 153, 151, 151, 151, 157, 158, 151, 151, 151,
|
| 414 |
-
155, 152, 88, 152, 90, 130, 92, 152, 94, 152,
|
| 415 |
-
103, 152, 105, 152, 152, 152, 152, 103, 111, 144,
|
| 416 |
-
152, 152, 115, 116, 152, 152, 151, 153, 152, 115,
|
| 417 |
-
116, 124, 125, 126, 127, 152, 152, 152, 124, 125,
|
| 418 |
-
126, 127, 97, 98, 99, 152, 152, 152, 103, 152,
|
| 419 |
-
152, 152, 145, 8, 9, 10, 152, 150, 152, 152,
|
| 420 |
-
115, 116, 152, 154, 150, 153, 152, 154, 157, 124,
|
| 421 |
-
125, 126, 127, 153, 29, 153, 31, 32, 33, 34,
|
| 422 |
-
35, 36, 153, 153, 153, 153, 153, 153, 153, 153,
|
| 423 |
-
153, 153, 153, 153, 153, 150, 153, 152, 154, 153,
|
| 424 |
-
153, 153, -1, 153, 153, 153, 153, 153, 153, 153,
|
| 425 |
-
153, -1, 154, 154, 154, 154, 154, 154, 154, 154,
|
| 426 |
-
154, 154, 154, 154, 154, 154, 154, 154, 154, 154,
|
| 427 |
-
154, 154, 154, 154, 154, 154, 154, 154, 154, 154,
|
| 428 |
-
154, -1, 155, -1, 156, 156, 156, 156, 156
|
| 429 |
-
);
|
| 430 |
-
|
| 431 |
-
protected $actionBase = array(
|
| 432 |
-
0, 704, 697, -70, 735, 153, 302, 607, -2, -2,
|
| 433 |
-
-55, -2, -2, 220, 329, 329, 354, 329, 212, 245,
|
| 434 |
-
608, 608, 608, 227, 286, 286, 286, 286, 338, 384,
|
| 435 |
-
518, 431, 464, 558, 558, 558, 558, 558, 558, 558,
|
| 436 |
-
558, 558, 558, 558, 558, 558, 558, 558, 558, 558,
|
| 437 |
-
558, 558, 558, 558, 558, 558, 558, 558, 558, 558,
|
| 438 |
-
558, 558, 558, 558, 558, 558, 558, 558, 558, 558,
|
| 439 |
-
558, 558, 558, 558, 558, 558, 558, 558, 558, 558,
|
| 440 |
-
558, 558, 558, 558, 558, 558, 558, 558, 558, 558,
|
| 441 |
-
558, 558, 558, 558, 558, 558, 558, 558, 558, 558,
|
| 442 |
-
558, 558, 558, 558, 558, 558, 558, 558, 558, 558,
|
| 443 |
-
558, 558, 558, 558, 558, 558, 558, 558, 558, 558,
|
| 444 |
-
558, 558, 558, 558, 558, 558, 558, 558, 558, 558,
|
| 445 |
-
558, 558, 558, 558, 558, 558, 558, 558, 558, 558,
|
| 446 |
-
558, 151, 151, 167, 412, 463, 768, 773, 770, 774,
|
| 447 |
-
766, 765, 769, 775, 687, 688, 539, 689, 694, 696,
|
| 448 |
-
700, 771, 782, 767, 772, 131, 131, 131, 131, 131,
|
| 449 |
-
131, 131, 131, 131, 131, 131, 131, 131, 131, 131,
|
| 450 |
-
131, 131, 449, 179, 22, 16, 16, 16, 16, 16,
|
| 451 |
-
16, 16, 16, 16, 16, 16, 16, 16, 16, 16,
|
| 452 |
-
16, 16, 16, 16, 16, 16, 16, 210, 210, 210,
|
| 453 |
-
705, 334, 593, 593, 739, 665, 322, 628, 628, 628,
|
| 454 |
-
628, 628, 628, 628, 628, 628, 628, 835, 3, 3,
|
| 455 |
-
3, 3, 3, -28, -28, -28, -28, 306, 194, 157,
|
| 456 |
-
221, 29, 29, 124, 124, 124, 124, 124, 124, 132,
|
| 457 |
-
360, 162, 262, 535, 701, 184, 184, 435, 435, 435,
|
| 458 |
-
253, 268, 459, 459, 459, 121, 527, 502, 502, 502,
|
| 459 |
-
502, 445, 445, 502, 502, 352, 4, 327, 292, 410,
|
| 460 |
-
410, 428, 410, 410, 410, 418, 418, 418, 357, 260,
|
| 461 |
-
122, 511, 260, 609, 638, 776, 540, 684, 541, 685,
|
| 462 |
-
323, 378, 562, 192, 563, 192, 192, 192, 454, 187,
|
| 463 |
-
341, 549, 764, 151, 550, 151, 151, 151, 151, 738,
|
| 464 |
-
151, 151, 151, 151, 151, 151, 45, 151, 57, 425,
|
| 465 |
-
167, 137, 137, 137, 357, 529, 60, 632, 236, 529,
|
| 466 |
-
529, 529, 633, 636, 58, 240, 637, 135, 396, 514,
|
| 467 |
-
514, 520, 520, 528, 537, 514, 514, 514, 514, 514,
|
| 468 |
-
719, 719, 520, 522, 520, 528, 724, 520, 537, 537,
|
| 469 |
-
520, 520, 514, 520, 719, 537, 193, 362, 299, 318,
|
| 470 |
-
537, 537, 395, 506, 514, 534, 534, 411, 520, 233,
|
| 471 |
-
228, 520, 74, 494, 719, 719, 494, 237, 537, 247,
|
| 472 |
-
567, 568, 495, 486, 509, 290, 509, 509, 342, 495,
|
| 473 |
-
509, 537, 509, 421, 67, 522, 339, 509, 66, 725,
|
| 474 |
-
726, 504, 727, 722, 728, 746, 729, 499, 496, 497,
|
| 475 |
-
737, 723, 730, 721, 720, 526, 557, 457, 467, 551,
|
| 476 |
-
498, 712, 556, 519, 519, 519, 702, 519, 519, 519,
|
| 477 |
-
519, 519, 519, 519, 519, 457, 778, 555, 508, 740,
|
| 478 |
-
473, 493, 538, 480, 592, 533, 557, 557, 641, 635,
|
| 479 |
-
777, 523, 738, 759, 731, 503, 487, 750, 741, 639,
|
| 480 |
-
530, 552, 742, 743, 751, 760, 610, 761, 645, 521,
|
| 481 |
-
647, 557, 649, 519, 664, 510, 779, 710, 457, 780,
|
| 482 |
-
703, 752, 546, 547, 753, 553, 651, 512, 781, 652,
|
| 483 |
-
762, 618, 625, 566, 734, 492, 754, 653, 755, 756,
|
| 484 |
-
654, 569, 524, 548, 505, 747, 451, 745, 629, 658,
|
| 485 |
-
659, 662, 663, 666, 733, 570, 748, 525, 749, 699,
|
| 486 |
-
571, 576, 491, 673, 455, 585, 500, 515, 588, 736,
|
| 487 |
-
513, 516, 591, 594, 763, 674, 744, 595, 675, 758,
|
| 488 |
-
531, 556, 554, 501, 532, 507, 631, 757, 517, 602,
|
| 489 |
-
603, 604, 605, 683, 606, 0, 0, 0, 0, 0,
|
| 490 |
-
0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
| 491 |
-
0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
| 492 |
-
0, 0, 145, 145, 145, 145, -2, -2, -2, 0,
|
| 493 |
-
0, -2, 0, 0, 145, 145, 145, 145, 145, 145,
|
| 494 |
-
145, 145, 145, 145, 145, 145, 145, 145, 145, 145,
|
| 495 |
-
145, 145, 145, 145, 145, 145, 145, 145, 145, 145,
|
| 496 |
-
145, 145, 145, 145, 145, 145, 145, 145, 145, 145,
|
| 497 |
-
145, 145, 145, 145, 145, 145, 145, 145, 145, 145,
|
| 498 |
-
145, 145, 145, 145, 145, 145, 145, 145, 145, 145,
|
| 499 |
-
145, 145, 145, 145, 145, 145, 145, 145, 145, 145,
|
| 500 |
-
145, 145, 145, 145, 145, 145, 145, 145, 145, 145,
|
| 501 |
-
145, 145, 145, 145, 145, 145, 145, 145, 145, 145,
|
| 502 |
-
145, 145, 145, 145, 145, 145, 145, 145, 145, 145,
|
| 503 |
-
145, 145, 145, 145, 145, 145, 145, 145, 145, 145,
|
| 504 |
-
145, 145, 145, 145, 145, 145, 145, 145, 145, 145,
|
| 505 |
-
145, 145, 145, 145, 145, 145, 145, 145, 145, 145,
|
| 506 |
-
145, 145, 131, 131, 131, 131, 131, 131, 131, 131,
|
| 507 |
-
131, 131, 131, 131, 131, 131, 131, 131, 131, 131,
|
| 508 |
-
131, 131, 131, 131, 131, 131, 0, 0, 0, 0,
|
| 509 |
-
0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
| 510 |
-
0, 0, 0, 131, 131, 131, 131, 131, 131, 131,
|
| 511 |
-
131, 131, 131, 131, 131, 131, 131, 131, 131, 131,
|
| 512 |
-
131, 131, 131, 131, 131, 131, 131, 131, 131, 131,
|
| 513 |
-
131, 131, 131, 260, 260, 131, 0, 131, 260, 260,
|
| 514 |
-
260, 260, 260, 260, 260, 260, 260, 260, 131, 131,
|
| 515 |
-
131, 131, 131, 131, 459, 459, 459, 459, -67, 260,
|
| 516 |
-
260, -67, 459, 459, 260, 260, 260, 260, 260, 260,
|
| 517 |
-
260, 260, 260, 445, 445, 445, 192, 192, 260, 260,
|
| 518 |
-
260, 0, 0, 0, 0, 0, 514, 445, 260, 260,
|
| 519 |
-
260, 260, 0, 0, 260, 260, 522, 192, 448, 0,
|
| 520 |
-
0, 0, 0, 0, 0, 0, 514, 514, 514, 522,
|
| 521 |
-
0, 514, 445, 0, 137, 151, 448, 343, 343, 343,
|
| 522 |
-
343, 0, 0, 514, 0, 514, 0, 0, 0, 0,
|
| 523 |
-
0, 0, 522, 537, 0, 719, 0, 0, 0, 0,
|
| 524 |
-
520, 0, 0, 0, 0, 0, 0, 0, 0, 522,
|
| 525 |
-
0, 0, 0, 0, 0, 0, 519, 0, 523, 0,
|
| 526 |
-
519, 519, 519, 523, 523, 0, 0, 523
|
| 527 |
-
);
|
| 528 |
-
|
| 529 |
-
protected $actionDefault = array(
|
| 530 |
-
3,32767,32767,32767,32767,32767,32767,32767,32767, 92,
|
| 531 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 532 |
-
32767,32767,32767,32767, 513, 513, 513, 513, 94,32767,
|
| 533 |
-
32767,32767,32767, 318, 318, 318,32767,32767, 460, 460,
|
| 534 |
-
460, 460, 460, 460,32767,32767,32767,32767,32767, 398,
|
| 535 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 536 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 537 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 538 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 539 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 540 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 541 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 542 |
-
32767, 92,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 543 |
-
94,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 544 |
-
32767,32767,32767,32767,32767, 506,32767,32767,32767,32767,
|
| 545 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 546 |
-
32767,32767,32767,32767,32767, 381, 382, 384, 385, 317,
|
| 547 |
-
461, 512, 262, 509, 316, 130, 273, 264, 211, 243,
|
| 548 |
-
313, 134, 346, 399, 348, 397, 401, 347, 323, 327,
|
| 549 |
-
328, 329, 330, 331, 332, 333, 334, 335, 336, 337,
|
| 550 |
-
338, 339, 321, 322, 400, 402, 403, 378, 377, 376,
|
| 551 |
-
344, 345,32767,32767, 349, 320, 351,32767,32767,32767,
|
| 552 |
-
32767,32767,32767,32767,32767, 94,32767, 350, 367, 368,
|
| 553 |
-
365, 366, 369, 370, 371, 372, 373,32767,32767,32767,
|
| 554 |
-
296, 358, 359, 253, 253, 253, 253, 253, 253, 253,
|
| 555 |
-
32767, 253,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 556 |
-
454, 375, 353, 354, 352,32767, 431,32767,32767,32767,
|
| 557 |
-
32767,32767, 433,32767, 92,32767,32767,32767, 456, 341,
|
| 558 |
-
343, 424, 507, 324, 510,32767,32767, 94, 418,32767,
|
| 559 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 560 |
-
455,32767,32767,32767, 92,32767,32767, 92, 174, 230,
|
| 561 |
-
232, 476, 179,32767, 436,32767,32767,32767,32767,32767,
|
| 562 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 563 |
-
32767,32767,32767,32767, 418, 363, 520,32767, 462, 355,
|
| 564 |
-
356, 357,32767,32767, 462, 462,32767, 462,32767,32767,
|
| 565 |
-
32767,32767,32767,32767, 179,32767,32767,32767,32767, 94,
|
| 566 |
-
434, 434, 92, 92, 92, 92, 429,32767, 179, 179,
|
| 567 |
-
32767,32767,32767,32767,32767, 179, 91, 91, 91, 91,
|
| 568 |
-
179, 179, 91, 194,32767, 192, 192, 91,32767, 93,
|
| 569 |
-
93,32767, 93, 196,32767, 480, 196, 91, 179, 91,
|
| 570 |
-
216, 216, 409, 181, 255, 93, 255, 255, 93, 409,
|
| 571 |
-
255, 179, 255, 91, 91,32767, 91, 255,32767,32767,
|
| 572 |
-
32767, 85,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 573 |
-
32767,32767,32767,32767,32767,32767, 420,32767, 449,32767,
|
| 574 |
-
466, 478,32767, 361, 362, 364, 464, 386, 387, 388,
|
| 575 |
-
389, 390, 391, 392, 394, 508,32767, 423,32767,32767,
|
| 576 |
-
32767, 87, 121, 272,32767, 518, 87, 421,32767, 518,
|
| 577 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 578 |
-
87, 87,32767,32767,32767,32767,32767,32767, 519,32767,
|
| 579 |
-
462, 422,32767, 360, 445, 485,32767, 463, 511,32767,
|
| 580 |
-
32767,32767, 245, 247,32767, 87,32767,32767,32767,32767,
|
| 581 |
-
32767,32767,32767,32767,32767, 449,32767,32767,32767,32767,
|
| 582 |
-
32767,32767,32767, 462,32767,32767,32767,32767,32767,32767,
|
| 583 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767, 462,
|
| 584 |
-
32767,32767, 242,32767,32767,32767, 312,32767,32767,32767,
|
| 585 |
-
32767,32767,32767,32767,32767,32767,32767,32767,32767,32767,
|
| 586 |
-
85, 60,32767, 292,32767,32767,32767,32767,32767,32767,
|
| 587 |
-
32767,32767,32767,32767,32767, 136, 136, 3, 275, 3,
|
| 588 |
-
275, 136, 136, 136, 275, 275, 136, 136, 136, 136,
|
| 589 |
-
136, 136, 136, 169, 224, 227, 216, 216, 284, 136,
|
| 590 |
-
136
|
| 591 |
-
);
|
| 592 |
-
|
| 593 |
-
protected $goto = array(
|
| 594 |
-
172, 145, 145, 145, 145, 172, 154, 156, 188, 173,
|
| 595 |
-
169, 169, 169, 169, 169, 170, 170, 170, 170, 170,
|
| 596 |
-
170, 165, 166, 167, 168, 185, 183, 186, 443, 444,
|
| 597 |
-
335, 445, 447, 448, 449, 450, 451, 452, 453, 454,
|
| 598 |
-
927, 142, 146, 147, 148, 171, 149, 150, 151, 144,
|
| 599 |
-
152, 153, 155, 182, 184, 187, 207, 210, 211, 214,
|
| 600 |
-
216, 227, 228, 229, 230, 231, 232, 233, 234, 235,
|
| 601 |
-
236, 241, 242, 262, 263, 264, 339, 340, 341, 493,
|
| 602 |
-
189, 190, 191, 192, 193, 194, 195, 196, 197, 198,
|
| 603 |
-
199, 200, 201, 202, 203, 157, 204, 158, 174, 175,
|
| 604 |
-
176, 208, 177, 159, 160, 161, 178, 174, 162, 209,
|
| 605 |
-
143, 205, 163, 179, 206, 180, 181, 164, 562, 461,
|
| 606 |
-
571, 764, 345, 539, 1116, 1116, 697, 338, 279, 280,
|
| 607 |
-
282, 490, 283, 344, 284, 347, 523, 513, 536, 466,
|
| 608 |
-
466, 466, 495, 1116, 466, 455, 455, 455, 455, 847,
|
| 609 |
-
852, 853, 297, 498, 515, 515, 481, 698, 466, 1050,
|
| 610 |
-
1050, 1050, 1050, 1050, 1050, 1050, 1050, 1050, 1050, 1068,
|
| 611 |
-
1068, 798, 329, 570, 1068, 1068, 1068, 1068, 1068, 1068,
|
| 612 |
-
1068, 1068, 1068, 1068, 1066, 1066, 1005, 786, 1006, 1066,
|
| 613 |
-
1066, 1066, 1066, 1066, 1066, 1066, 1066, 1066, 1066, 494,
|
| 614 |
-
894, 574, 272, 466, 466, 556, 892, 254, 733, 480,
|
| 615 |
-
505, 466, 466, 466, 331, 332, 685, 759, 544, 760,
|
| 616 |
-
333, 487, 446, 446, 724, 293, 467, 446, 446, 446,
|
| 617 |
-
446, 446, 446, 446, 446, 446, 446, 479, 491, 492,
|
| 618 |
-
806, 509, 595, 522, 524, 1092, 1093, 537, 555, 558,
|
| 619 |
-
834, 565, 573, 830, 728, 716, 866, 901, 295, 870,
|
| 620 |
-
902, 724, 1105, 724, 809, 862, 696, 317, 321, 473,
|
| 621 |
-
496, 499, 1016, 700, 839, 315, 799, 823, 804, 804,
|
| 622 |
-
802, 804, 594, 390, 458, 832, 827, 538, 1115, 1115,
|
| 623 |
-
909, 732, 705, 1012, 755, 750, 751, 765, 975, 706,
|
| 624 |
-
752, 703, 753, 754, 704, 842, 758, 1115, 715, 715,
|
| 625 |
-
457, 457, 3, 4, 725, 725, 725, 727, 714, 504,
|
| 626 |
-
516, 518, 519, 567, 319, 459, 1118, 857, 302, 353,
|
| 627 |
-
529, 472, 1017, 837, 837, 1091, 482, 483, 720, 800,
|
| 628 |
-
800, 800, 800, 294, 325, 794, 801, 298, 299, 717,
|
| 629 |
-
1020, 1020, 1018, 1076, 403, 849, 849, 849, 849, 849,
|
| 630 |
-
849, 849, 849, 849, 1131, 1097, 1097, 11, 867, 849,
|
| 631 |
-
849, 849, 916, 599, 510, 1088, 1088, 463, 543, 1020,
|
| 632 |
-
1020, 1020, 1020, 1013, 520, 1020, 1020, 719, 532, 533,
|
| 633 |
-
713, 1008, 1099, 1099, 729, 811, 871, 396, 512, 911,
|
| 634 |
-
1078, 772, 412, 0, 773, 0, 0, 0, 0, 0,
|
| 635 |
-
0, 0, 0, 1084, 0, 0, 0, 542, 0, 0,
|
| 636 |
-
0, 0, 0, 0, 0, 0, 0, 0, 0, 478,
|
| 637 |
-
0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
|
| 638 |
-
869, 0, 1086, 1086, 869, 0, 0, 0, 0, 0,
|
| 639 |
-
0, 0, 463, 0, 0, 0, 0, 0, 0, 0,
|
| 640 |
-
0, 460, 476, 0, 0, 0, 0, 0, 0, 0,
|
| 641 |
-
0, 0, 460, 0, 476, 0, 0, 318, 0, 0,
|
| 642 |
-
464, 383, 0, 385, 0, 0, 0, 0, 0, 0,
|
| 643 |
-
0, 0, 0, 0, 0, 0, 0, 0, 723, 0,
|
| 644 |
-
0, 1123, 0, 0, 1015
|
| 645 |
-
);
|
| 646 |
-
|
| 647 |
-
protected $gotoCheck = array(
|
| 648 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 649 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 650 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 651 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 652 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 653 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 654 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 655 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 656 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 657 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 658 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 659 |
-
33, 33, 33, 33, 33, 33, 33, 33, 63, 10,
|
| 660 |
-
8, 13, 56, 56, 151, 151, 17, 56, 56, 56,
|
| 661 |
-
56, 56, 56, 56, 56, 56, 56, 46, 46, 10,
|
| 662 |
-
10, 10, 99, 151, 10, 86, 86, 86, 86, 92,
|
| 663 |
-
92, 92, 81, 86, 87, 87, 10, 18, 10, 87,
|
| 664 |
-
87, 87, 87, 87, 87, 87, 87, 87, 87, 138,
|
| 665 |
-
138, 77, 77, 77, 138, 138, 138, 138, 138, 138,
|
| 666 |
-
138, 138, 138, 138, 139, 139, 68, 68, 68, 139,
|
| 667 |
-
139, 139, 139, 139, 139, 139, 139, 139, 139, 7,
|
| 668 |
-
7, 7, 137, 10, 10, 7, 7, 137, 36, 10,
|
| 669 |
-
10, 10, 10, 10, 70, 70, 5, 55, 70, 55,
|
| 670 |
-
70, 140, 141, 141, 26, 70, 10, 141, 141, 141,
|
| 671 |
-
141, 141, 141, 141, 141, 141, 141, 39, 10, 2,
|
| 672 |
-
40, 2, 39, 39, 39, 146, 146, 39, 39, 39,
|
| 673 |
-
39, 39, 39, 39, 14, 14, 14, 113, 147, 14,
|
| 674 |
-
113, 26, 149, 26, 14, 96, 16, 49, 49, 49,
|
| 675 |
-
49, 49, 94, 13, 14, 52, 14, 16, 16, 16,
|
| 676 |
-
16, 16, 16, 118, 16, 16, 16, 54, 150, 150,
|
| 677 |
-
14, 14, 13, 14, 13, 13, 13, 13, 121, 13,
|
| 678 |
-
13, 13, 13, 13, 13, 89, 13, 150, 26, 26,
|
| 679 |
-
76, 76, 37, 37, 26, 26, 26, 26, 26, 69,
|
| 680 |
-
69, 69, 69, 69, 66, 66, 150, 91, 20, 90,
|
| 681 |
-
24, 66, 94, 86, 86, 144, 66, 66, 30, 76,
|
| 682 |
-
76, 76, 76, 11, 19, 76, 76, 81, 81, 28,
|
| 683 |
-
63, 63, 94, 94, 66, 63, 63, 63, 63, 63,
|
| 684 |
-
63, 63, 63, 63, 12, 8, 8, 66, 98, 63,
|
| 685 |
-
63, 63, 15, 83, 15, 99, 99, 12, 23, 63,
|
| 686 |
-
63, 63, 63, 130, 74, 63, 63, 15, 74, 74,
|
| 687 |
-
15, 127, 99, 99, 32, 80, 101, 72, 73, 116,
|
| 688 |
-
12, 63, 125, -1, 63, -1, -1, -1, -1, -1,
|
| 689 |
-
-1, -1, -1, 99, -1, -1, -1, 12, -1, -1,
|
| 690 |
-
-1, -1, -1, -1, -1, -1, -1, -1, -1, 8,
|
| 691 |
-
-1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
|
| 692 |
-
99, -1, 99, 99, 99, -1, -1, -1, -1, -1,
|
| 693 |
-
-1, -1, 12, -1, -1, -1, -1, -1, -1, -1,
|
| 694 |
-
-1, 8, 8, -1, -1, -1, -1, -1, -1, -1,
|
| 695 |
-
-1, -1, 8, -1, 8, -1, -1, 8, -1, -1,
|
| 696 |
-
8, 8, -1, 8, -1, -1, -1, -1, -1, -1,
|
| 697 |
-
-1, -1, -1, -1, -1, -1, -1, -1, 8, -1,
|
| 698 |
-
-1, 8, -1, -1, 12
|
| 699 |
-
);
|
| 700 |
-
|
| 701 |
-
protected $gotoBase = array(
|
| 702 |
-
0, 0, -338, 0, 0, 206, 0, 194, 110, 0,
|
| 703 |
-
-146, 53, 89, -21, -123, -18, 264, 124, 155, 42,
|
| 704 |
-
63, 0, 0, 28, 44, 0, -41, 0, 45, 0,
|
| 705 |
-
51, 0, 32, -23, 0, 0, 199, -287, 0, -339,
|
| 706 |
-
221, 0, 0, 0, 0, 0, 103, 0, 0, 228,
|
| 707 |
-
0, 0, 239, 0, 74, 202, -90, 0, 0, 0,
|
| 708 |
-
0, 0, 0, 112, 0, 0, -44, 0, -145, 75,
|
| 709 |
-
-192, 0, 11, 2, -196, 0, 72, -97, 0, 0,
|
| 710 |
-
31, -249, 0, 43, 0, 0, 121, -58, 0, 56,
|
| 711 |
-
78, 77, -108, 0, -42, 0, 237, 0, 61, 137,
|
| 712 |
-
0, 33, 0, 0, 0, 0, 0, 0, 0, 0,
|
| 713 |
-
0, 0, 0, 20, 0, 0, 34, 0, 246, 0,
|
| 714 |
-
0, 59, 0, 0, 0, -7, 0, 30, 0, 0,
|
| 715 |
-
29, 0, 0, 0, 0, 0, 0, -64, -43, -28,
|
| 716 |
-
196, 10, 0, 0, 79, 0, -60, 232, 0, 235,
|
| 717 |
-
35, -129, 0, 0
|
| 718 |
-
);
|
| 719 |
-
|
| 720 |
-
protected $gotoDefault = array(
|
| 721 |
-
-32768, 418, 602, 2, 603, 675, 683, 547, 435, 572,
|
| 722 |
-
436, 462, 336, 757, 915, 777, 739, 740, 741, 322,
|
| 723 |
-
358, 313, 320, 530, 517, 408, 726, 378, 718, 405,
|
| 724 |
-
721, 377, 730, 141, 548, 414, 734, 1, 736, 468,
|
| 725 |
-
768, 309, 744, 310, 551, 746, 475, 748, 749, 316,
|
| 726 |
-
323, 324, 920, 484, 514, 761, 215, 477, 762, 308,
|
| 727 |
-
763, 771, 311, 314, 559, 389, 415, 328, 896, 501,
|
| 728 |
-
526, 373, 393, 511, 506, 486, 1028, 796, 399, 387,
|
| 729 |
-
810, 296, 818, 600, 826, 829, 437, 438, 397, 841,
|
| 730 |
-
398, 855, 502, 503, 1036, 392, 861, 379, 868, 1072,
|
| 731 |
-
382, 872, 237, 875, 251, 545, 348, 880, 881, 6,
|
| 732 |
-
886, 563, 564, 7, 240, 413, 910, 546, 376, 485,
|
| 733 |
-
926, 361, 994, 996, 470, 406, 1009, 386, 554, 416,
|
| 734 |
-
1014, 1075, 374, 439, 394, 281, 440, 253, 300, 278,
|
| 735 |
-
456, 260, 301, 441, 395, 1080, 1087, 277, 27, 1106,
|
| 736 |
-
1117, 291, 489, 508
|
| 737 |
-
);
|
| 738 |
-
|
| 739 |
-
protected $ruleToNonTerminal = array(
|
| 740 |
-
0, 1, 3, 3, 2, 5, 5, 5, 5, 5,
|
| 741 |
-
5, 5, 5, 5, 5, 5, 5, 5, 5, 5,
|
| 742 |
-
5, 5, 5, 5, 5, 5, 5, 5, 5, 5,
|
| 743 |
-
5, 5, 5, 5, 5, 5, 5, 5, 5, 5,
|
| 744 |
-
5, 5, 5, 5, 5, 5, 5, 5, 5, 5,
|
| 745 |
-
5, 5, 5, 5, 5, 5, 5, 5, 5, 5,
|
| 746 |
-
5, 5, 5, 5, 5, 5, 5, 5, 5, 5,
|
| 747 |
-
5, 5, 5, 5, 6, 6, 6, 6, 6, 6,
|
| 748 |
-
6, 7, 7, 8, 9, 10, 10, 11, 12, 13,
|
| 749 |
-
13, 14, 14, 15, 15, 4, 4, 4, 4, 4,
|
| 750 |
-
4, 4, 4, 4, 4, 4, 20, 20, 21, 21,
|
| 751 |
-
21, 21, 23, 25, 25, 19, 27, 27, 24, 29,
|
| 752 |
-
29, 26, 26, 28, 28, 30, 30, 22, 31, 31,
|
| 753 |
-
32, 34, 35, 35, 36, 37, 37, 39, 38, 38,
|
| 754 |
-
38, 38, 40, 40, 40, 40, 40, 40, 40, 40,
|
| 755 |
-
40, 40, 40, 40, 40, 40, 40, 40, 40, 40,
|
| 756 |
-
40, 40, 40, 40, 40, 40, 40, 16, 16, 59,
|
| 757 |
-
59, 62, 62, 61, 60, 60, 53, 65, 65, 66,
|
| 758 |
-
66, 67, 67, 68, 68, 17, 18, 18, 18, 71,
|
| 759 |
-
71, 71, 72, 72, 75, 75, 73, 73, 77, 78,
|
| 760 |
-
78, 47, 47, 55, 55, 58, 58, 58, 57, 79,
|
| 761 |
-
79, 80, 48, 48, 48, 48, 81, 81, 82, 82,
|
| 762 |
-
83, 83, 45, 45, 41, 41, 84, 43, 43, 85,
|
| 763 |
-
42, 42, 44, 44, 54, 54, 54, 54, 69, 69,
|
| 764 |
-
88, 88, 89, 89, 89, 91, 91, 91, 92, 92,
|
| 765 |
-
92, 93, 93, 90, 90, 70, 70, 70, 94, 94,
|
| 766 |
-
95, 95, 96, 96, 96, 50, 97, 97, 98, 51,
|
| 767 |
-
100, 100, 101, 101, 102, 102, 74, 103, 103, 103,
|
| 768 |
-
103, 103, 108, 108, 109, 109, 110, 110, 110, 110,
|
| 769 |
-
110, 111, 112, 112, 107, 107, 104, 104, 106, 106,
|
| 770 |
-
114, 114, 113, 113, 113, 113, 113, 113, 105, 115,
|
| 771 |
-
115, 117, 116, 116, 52, 119, 118, 118, 46, 46,
|
| 772 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 773 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 774 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 775 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 776 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 777 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 778 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 779 |
-
33, 33, 33, 33, 33, 33, 33, 33, 33, 33,
|
| 780 |
-
33, 33, 33, 33, 33, 33, 126, 120, 120, 125,
|
| 781 |
-
125, 128, 129, 129, 130, 131, 131, 131, 76, 76,
|
| 782 |
-
63, 63, 63, 121, 121, 121, 121, 133, 133, 122,
|
| 783 |
-
122, 124, 124, 124, 127, 127, 138, 138, 138, 138,
|
| 784 |
-
138, 138, 138, 138, 138, 139, 139, 87, 141, 141,
|
| 785 |
-
141, 141, 123, 123, 123, 123, 123, 123, 123, 123,
|
| 786 |
-
49, 49, 136, 136, 136, 136, 142, 142, 132, 132,
|
| 787 |
-
132, 143, 143, 143, 143, 143, 64, 64, 56, 56,
|
| 788 |
-
56, 99, 99, 99, 99, 146, 145, 135, 135, 135,
|
| 789 |
-
135, 135, 135, 134, 134, 134, 144, 144, 144, 144,
|
| 790 |
-
86, 140, 148, 148, 147, 147, 149, 149, 149, 149,
|
| 791 |
-
149, 149, 149, 149, 137, 137, 137, 137, 151, 152,
|
| 792 |
-
150, 150, 150, 150, 150, 150, 150, 153, 153, 153,
|
| 793 |
-
153
|
| 794 |
-
);
|
| 795 |
-
|
| 796 |
-
protected $ruleT
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
