Version Description
- Fix - Gutenberg add / edit form fix
Download this release
Release Info
Developer | mailerlite |
Plugin | Official MailerLite Sign Up Forms |
Version | 1.4.8 |
Comparing to | |
See all releases |
Code changes from version 1.4.7 to 1.4.8
- assets/js/block.build.js +10480 -6645
assets/js/block.build.js
CHANGED
@@ -60,7 +60,7 @@
|
|
60 |
/******/ __webpack_require__.p = "";
|
61 |
/******/
|
62 |
/******/ // Load entry module and return exports
|
63 |
-
/******/ return __webpack_require__(__webpack_require__.s =
|
64 |
/******/ })
|
65 |
/************************************************************************/
|
66 |
/******/ ([
|
@@ -68,7 +68,7 @@
|
|
68 |
/***/ (function(module, exports, __webpack_require__) {
|
69 |
|
70 |
/* WEBPACK VAR INJECTION */(function(module) {var require;//! moment.js
|
71 |
-
//! version : 2.
|
72 |
//! authors : Tim Wood, Iskren Chernev, Moment.js contributors
|
73 |
//! license : MIT
|
74 |
//! momentjs.com
|
@@ -2158,7 +2158,7 @@
|
|
2158 |
try {
|
2159 |
oldLocale = globalLocale._abbr;
|
2160 |
aliasedRequire = require;
|
2161 |
-
__webpack_require__(
|
2162 |
getSetGlobalLocale(oldLocale);
|
2163 |
} catch (e) {
|
2164 |
// mark as not found to avoid repeating expensive file require call causing high CPU
|
@@ -2609,8 +2609,7 @@
|
|
2609 |
hooks.createFromInputFallback = deprecate(
|
2610 |
'value provided is not in a recognized RFC2822 or ISO format. moment construction falls back to js Date(), ' +
|
2611 |
'which is not reliable across all browsers and versions. Non RFC2822/ISO date formats are ' +
|
2612 |
-
'discouraged
|
2613 |
-
'http://momentjs.com/guides/#/warnings/js-date/ for more info.',
|
2614 |
function (config) {
|
2615 |
config._d = new Date(config._i + (config._useUTC ? ' UTC' : ''));
|
2616 |
}
|
@@ -3795,7 +3794,10 @@
|
|
3795 |
function calendar$1(time, formats) {
|
3796 |
// Support for single parameter, formats only overload to the calendar function
|
3797 |
if (arguments.length === 1) {
|
3798 |
-
if (
|
|
|
|
|
|
|
3799 |
time = arguments[0];
|
3800 |
formats = undefined;
|
3801 |
} else if (isCalendarSpec(arguments[0])) {
|
@@ -4473,7 +4475,7 @@
|
|
4473 |
eras = this.localeData().eras();
|
4474 |
for (i = 0, l = eras.length; i < l; ++i) {
|
4475 |
// truncate time
|
4476 |
-
val = this.startOf('day').valueOf();
|
4477 |
|
4478 |
if (eras[i].since <= val && val <= eras[i].until) {
|
4479 |
return eras[i].name;
|
@@ -4493,7 +4495,7 @@
|
|
4493 |
eras = this.localeData().eras();
|
4494 |
for (i = 0, l = eras.length; i < l; ++i) {
|
4495 |
// truncate time
|
4496 |
-
val = this.startOf('day').valueOf();
|
4497 |
|
4498 |
if (eras[i].since <= val && val <= eras[i].until) {
|
4499 |
return eras[i].narrow;
|
@@ -4513,7 +4515,7 @@
|
|
4513 |
eras = this.localeData().eras();
|
4514 |
for (i = 0, l = eras.length; i < l; ++i) {
|
4515 |
// truncate time
|
4516 |
-
val = this.startOf('day').valueOf();
|
4517 |
|
4518 |
if (eras[i].since <= val && val <= eras[i].until) {
|
4519 |
return eras[i].abbr;
|
@@ -4536,7 +4538,7 @@
|
|
4536 |
dir = eras[i].since <= eras[i].until ? +1 : -1;
|
4537 |
|
4538 |
// truncate time
|
4539 |
-
val = this.startOf('day').valueOf();
|
4540 |
|
4541 |
if (
|
4542 |
(eras[i].since <= val && val <= eras[i].until) ||
|
@@ -5687,7 +5689,7 @@
|
|
5687 |
|
5688 |
//! moment.js
|
5689 |
|
5690 |
-
hooks.version = '2.
|
5691 |
|
5692 |
setHookCallback(createLocal);
|
5693 |
|
@@ -5736,14 +5738,14 @@
|
|
5736 |
|
5737 |
})));
|
5738 |
|
5739 |
-
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(
|
5740 |
|
5741 |
/***/ }),
|
5742 |
/* 1 */
|
5743 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
5744 |
|
5745 |
"use strict";
|
5746 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__react__ = __webpack_require__(
|
5747 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_0__react__["a"]; });
|
5748 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_0__react__["b"]; });
|
5749 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_0__react__["c"]; });
|
@@ -5754,13 +5756,13 @@
|
|
5754 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "j", function() { return __WEBPACK_IMPORTED_MODULE_0__react__["i"]; });
|
5755 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "k", function() { return __WEBPACK_IMPORTED_MODULE_0__react__["j"]; });
|
5756 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "m", function() { return __WEBPACK_IMPORTED_MODULE_0__react__["k"]; });
|
5757 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__react_platform__ = __webpack_require__(
|
5758 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "i", function() { return __WEBPACK_IMPORTED_MODULE_1__react_platform__["a"]; });
|
5759 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils__ = __webpack_require__(
|
5760 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "l", function() { return __WEBPACK_IMPORTED_MODULE_2__utils__["a"]; });
|
5761 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__serialize__ = __webpack_require__(
|
5762 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "n", function() { return __WEBPACK_IMPORTED_MODULE_3__serialize__["a"]; });
|
5763 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__raw_html__ = __webpack_require__(
|
5764 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return __WEBPACK_IMPORTED_MODULE_4__raw_html__["a"]; });
|
5765 |
|
5766 |
|
@@ -5815,16 +5817,16 @@ function _createClass(Constructor, protoProps, staticProps) {
|
|
5815 |
|
5816 |
"use strict";
|
5817 |
/* harmony export (immutable) */ __webpack_exports__["a"] = _possibleConstructorReturn;
|
5818 |
-
/* harmony import */ var
|
5819 |
-
/* harmony import */ var
|
5820 |
|
5821 |
|
5822 |
function _possibleConstructorReturn(self, call) {
|
5823 |
-
if (call && (Object(
|
5824 |
return call;
|
5825 |
}
|
5826 |
|
5827 |
-
return Object(
|
5828 |
}
|
5829 |
|
5830 |
/***/ }),
|
@@ -5846,7 +5848,7 @@ function _getPrototypeOf(o) {
|
|
5846 |
|
5847 |
"use strict";
|
5848 |
/* harmony export (immutable) */ __webpack_exports__["a"] = _inherits;
|
5849 |
-
/* harmony import */ var
|
5850 |
|
5851 |
function _inherits(subClass, superClass) {
|
5852 |
if (typeof superClass !== "function" && superClass !== null) {
|
@@ -5860,7 +5862,7 @@ function _inherits(subClass, superClass) {
|
|
5860 |
configurable: true
|
5861 |
}
|
5862 |
});
|
5863 |
-
if (superClass) Object(
|
5864 |
}
|
5865 |
|
5866 |
/***/ }),
|
@@ -5889,33 +5891,33 @@ function _extends() {
|
|
5889 |
|
5890 |
/***/ }),
|
5891 |
/* 9 */
|
5892 |
-
/***/ (function(module,
|
5893 |
|
5894 |
"use strict";
|
5895 |
-
/*
|
5896 |
-
function _assertThisInitialized(self) {
|
5897 |
-
if (self === void 0) {
|
5898 |
-
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
5899 |
-
}
|
5900 |
|
5901 |
-
|
|
|
|
|
|
|
5902 |
}
|
5903 |
|
|
|
|
|
5904 |
/***/ }),
|
5905 |
/* 10 */
|
5906 |
-
/***/ (function(module,
|
5907 |
|
5908 |
"use strict";
|
5909 |
-
/*
|
|
|
|
|
|
|
|
|
5910 |
|
5911 |
-
|
5912 |
-
module.exports = __webpack_require__(429);
|
5913 |
-
} else {
|
5914 |
-
module.exports = __webpack_require__(430);
|
5915 |
}
|
5916 |
|
5917 |
-
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
5918 |
-
|
5919 |
/***/ }),
|
5920 |
/* 11 */
|
5921 |
/***/ (function(module, exports, __webpack_require__) {
|
@@ -5928,16 +5930,16 @@ if (process.env.NODE_ENV === 'production') {
|
|
5928 |
*/
|
5929 |
|
5930 |
if (process.env.NODE_ENV !== 'production') {
|
5931 |
-
var ReactIs = __webpack_require__(
|
5932 |
|
5933 |
// By explicitly using `prop-types` you are opting into new development behavior.
|
5934 |
// http://fb.me/prop-types-in-prod
|
5935 |
var throwOnDirectAccess = true;
|
5936 |
-
module.exports = __webpack_require__(
|
5937 |
} else {
|
5938 |
// By explicitly using `prop-types` you are opting into new production behavior.
|
5939 |
// http://fb.me/prop-types-in-prod
|
5940 |
-
module.exports = __webpack_require__(
|
5941 |
}
|
5942 |
|
5943 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
@@ -5948,11 +5950,11 @@ if (process.env.NODE_ENV !== 'production') {
|
|
5948 |
|
5949 |
"use strict";
|
5950 |
/* harmony export (immutable) */ __webpack_exports__["a"] = _objectWithoutProperties;
|
5951 |
-
/* harmony import */ var
|
5952 |
|
5953 |
function _objectWithoutProperties(source, excluded) {
|
5954 |
if (source == null) return {};
|
5955 |
-
var target = Object(
|
5956 |
var key, i;
|
5957 |
|
5958 |
if (Object.getOwnPropertySymbols) {
|
@@ -5971,6 +5973,27 @@ function _objectWithoutProperties(source, excluded) {
|
|
5971 |
|
5972 |
/***/ }),
|
5973 |
/* 13 */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
5974 |
/***/ (function(module, exports, __webpack_require__) {
|
5975 |
|
5976 |
var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;/*!
|
@@ -6028,35 +6051,14 @@ var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;/*!
|
|
6028 |
}());
|
6029 |
|
6030 |
|
6031 |
-
/***/ }),
|
6032 |
-
/* 14 */
|
6033 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
6034 |
-
|
6035 |
-
"use strict";
|
6036 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = _defineProperty;
|
6037 |
-
function _defineProperty(obj, key, value) {
|
6038 |
-
if (key in obj) {
|
6039 |
-
Object.defineProperty(obj, key, {
|
6040 |
-
value: value,
|
6041 |
-
enumerable: true,
|
6042 |
-
configurable: true,
|
6043 |
-
writable: true
|
6044 |
-
});
|
6045 |
-
} else {
|
6046 |
-
obj[key] = value;
|
6047 |
-
}
|
6048 |
-
|
6049 |
-
return obj;
|
6050 |
-
}
|
6051 |
-
|
6052 |
/***/ }),
|
6053 |
/* 15 */
|
6054 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
6055 |
|
6056 |
"use strict";
|
6057 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__create_interpolate_element__ = __webpack_require__(
|
6058 |
/* unused harmony reexport createInterpolateElement */
|
6059 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__react__ = __webpack_require__(
|
6060 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["a"]; });
|
6061 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["b"]; });
|
6062 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["d"]; });
|
@@ -6070,15 +6072,15 @@ function _defineProperty(obj, key, value) {
|
|
6070 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "k", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["l"]; });
|
6071 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "l", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["m"]; });
|
6072 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "m", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["n"]; });
|
6073 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__react_platform__ = __webpack_require__(
|
6074 |
/* unused harmony namespace reexport */
|
6075 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__utils__ = __webpack_require__(
|
6076 |
/* unused harmony namespace reexport */
|
6077 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__platform__ = __webpack_require__(
|
6078 |
/* unused harmony reexport Platform */
|
6079 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__serialize__ = __webpack_require__(
|
6080 |
/* unused harmony reexport renderToString */
|
6081 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__raw_html__ = __webpack_require__(
|
6082 |
/* unused harmony reexport RawHTML */
|
6083 |
|
6084 |
|
@@ -6101,7 +6103,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
6101 |
});
|
6102 |
exports["default"] = wrapValidator;
|
6103 |
|
6104 |
-
var _object = _interopRequireDefault(__webpack_require__(
|
6105 |
|
6106 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
6107 |
|
@@ -6169,36 +6171,46 @@ var MODIFIER_KEY_NAMES = exports.MODIFIER_KEY_NAMES = new Set(['Shift', 'Control
|
|
6169 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
6170 |
|
6171 |
"use strict";
|
6172 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_create_higher_order_component__ = __webpack_require__(
|
6173 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_0__utils_create_higher_order_component__["a"]; });
|
6174 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__higher_order_compose__ = __webpack_require__(
|
6175 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_1__higher_order_compose__["a"]; });
|
6176 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__higher_order_if_condition__ = __webpack_require__(
|
6177 |
/* unused harmony reexport ifCondition */
|
6178 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__higher_order_pure__ = __webpack_require__(
|
6179 |
/* unused harmony reexport pure */
|
6180 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__higher_order_with_global_events__ = __webpack_require__(
|
6181 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_4__higher_order_with_global_events__["a"]; });
|
6182 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__higher_order_with_instance_id__ = __webpack_require__(
|
6183 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return __WEBPACK_IMPORTED_MODULE_5__higher_order_with_instance_id__["a"]; });
|
6184 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__higher_order_with_safe_timeout__ = __webpack_require__(
|
6185 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "e", function() { return __WEBPACK_IMPORTED_MODULE_6__higher_order_with_safe_timeout__["a"]; });
|
6186 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__higher_order_with_state__ = __webpack_require__(
|
6187 |
/* unused harmony reexport withState */
|
6188 |
-
/* harmony import */ var
|
|
|
|
|
6189 |
/* unused harmony reexport __experimentalUseDragging */
|
6190 |
-
/* harmony import */ var
|
6191 |
/* unused harmony reexport useInstanceId */
|
6192 |
-
/* harmony import */ var
|
6193 |
/* unused harmony reexport useKeyboardShortcut */
|
6194 |
-
/* harmony import */ var
|
6195 |
/* unused harmony reexport useMediaQuery */
|
6196 |
-
/* harmony import */ var
|
|
|
|
|
6197 |
/* unused harmony reexport useReducedMotion */
|
6198 |
-
/* harmony import */ var
|
6199 |
/* unused harmony reexport useViewportMatch */
|
6200 |
-
/* harmony import */ var
|
6201 |
/* unused harmony reexport useResizeObserver */
|
|
|
|
|
|
|
|
|
|
|
|
|
6202 |
// Utils
|
6203 |
// Compose helper (aliased flowRight from Lodash)
|
6204 |
|
@@ -6218,6 +6230,11 @@ var MODIFIER_KEY_NAMES = exports.MODIFIER_KEY_NAMES = new Set(['Shift', 'Control
|
|
6218 |
|
6219 |
|
6220 |
|
|
|
|
|
|
|
|
|
|
|
6221 |
//# sourceMappingURL=index.js.map
|
6222 |
|
6223 |
/***/ }),
|
@@ -6263,7 +6280,7 @@ var ThrowTypeError = $gOPD
|
|
6263 |
}())
|
6264 |
: throwTypeError;
|
6265 |
|
6266 |
-
var hasSymbols = __webpack_require__(
|
6267 |
|
6268 |
var getProto = Object.getPrototypeOf || function (x) { return x.__proto__; }; // eslint-disable-line no-proto
|
6269 |
|
@@ -6389,7 +6406,7 @@ var INTRINSICS = {
|
|
6389 |
'%WeakSetPrototype%': typeof WeakSet === 'undefined' ? undefined : WeakSet.prototype
|
6390 |
};
|
6391 |
|
6392 |
-
var bind = __webpack_require__(
|
6393 |
var $replace = bind.call(Function.call, String.prototype.replace);
|
6394 |
|
6395 |
/* adapted from https://github.com/lodash/lodash/blob/4.17.15/dist/lodash.js#L6735-L6744 */
|
@@ -6435,7 +6452,14 @@ module.exports = function GetIntrinsic(name, allowMissing) {
|
|
6435 |
if (!allowMissing && !(parts[i] in value)) {
|
6436 |
throw new $TypeError('base intrinsic for ' + name + ' exists, but the property is not available.');
|
6437 |
}
|
6438 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
6439 |
} else {
|
6440 |
value = value[parts[i]];
|
6441 |
}
|
@@ -6637,20 +6661,38 @@ process.umask = function() { return 0; };
|
|
6637 |
|
6638 |
/***/ }),
|
6639 |
/* 21 */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
6640 |
/***/ (function(module, exports, __webpack_require__) {
|
6641 |
|
6642 |
-
/* WEBPACK VAR INJECTION */(function(process) {module.exports = process.env.NODE_ENV === 'production' ? __webpack_require__(
|
6643 |
|
6644 |
//# sourceMappingURL=index.js.map
|
6645 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
6646 |
|
6647 |
/***/ }),
|
6648 |
-
/*
|
6649 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
6650 |
|
6651 |
"use strict";
|
6652 |
/* harmony export (immutable) */ __webpack_exports__["a"] = _objectSpread;
|
6653 |
-
/* harmony import */ var
|
6654 |
|
6655 |
function _objectSpread(target) {
|
6656 |
for (var i = 1; i < arguments.length; i++) {
|
@@ -6664,7 +6706,7 @@ function _objectSpread(target) {
|
|
6664 |
}
|
6665 |
|
6666 |
ownKeys.forEach(function (key) {
|
6667 |
-
Object(
|
6668 |
});
|
6669 |
}
|
6670 |
|
@@ -6672,49 +6714,75 @@ function _objectSpread(target) {
|
|
6672 |
}
|
6673 |
|
6674 |
/***/ }),
|
6675 |
-
/*
|
6676 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
6677 |
|
6678 |
"use strict";
|
6679 |
-
/* harmony
|
6680 |
-
/* harmony
|
6681 |
-
/* harmony import */ var
|
6682 |
-
/* harmony
|
6683 |
-
/* harmony
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
6684 |
|
6685 |
|
6686 |
|
6687 |
|
6688 |
-
|
6689 |
-
|
6690 |
-
}
|
6691 |
|
6692 |
/***/ }),
|
6693 |
-
/*
|
6694 |
/***/ (function(module, exports, __webpack_require__) {
|
6695 |
|
6696 |
"use strict";
|
6697 |
|
6698 |
|
6699 |
-
var defineProperties = __webpack_require__(
|
|
|
6700 |
|
6701 |
-
var implementation = __webpack_require__(
|
6702 |
-
var getPolyfill = __webpack_require__(
|
6703 |
-
var shim = __webpack_require__(
|
6704 |
|
6705 |
-
var polyfill = getPolyfill();
|
|
|
|
|
|
|
|
|
6706 |
|
6707 |
-
defineProperties(
|
6708 |
getPolyfill: getPolyfill,
|
6709 |
implementation: implementation,
|
6710 |
shim: shim
|
6711 |
});
|
6712 |
|
6713 |
-
module.exports =
|
6714 |
|
6715 |
|
6716 |
/***/ }),
|
6717 |
-
/*
|
6718 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
6719 |
|
6720 |
"use strict";
|
@@ -6724,11 +6792,11 @@ module.exports = polyfill;
|
|
6724 |
/* harmony export (immutable) */ __webpack_exports__["b"] = _n;
|
6725 |
/* unused harmony export _nx */
|
6726 |
/* harmony export (immutable) */ __webpack_exports__["d"] = sprintf;
|
6727 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(
|
6728 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_tannin__ = __webpack_require__(
|
6729 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_memize__ = __webpack_require__(
|
6730 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_memize___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_memize__);
|
6731 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_sprintf_js__ = __webpack_require__(
|
6732 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_sprintf_js___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_sprintf_js__);
|
6733 |
|
6734 |
|
@@ -6906,13 +6974,31 @@ function sprintf(format) {
|
|
6906 |
//# sourceMappingURL=index.js.map
|
6907 |
|
6908 |
/***/ }),
|
6909 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
6910 |
/***/ (function(module, exports, __webpack_require__) {
|
6911 |
|
6912 |
"use strict";
|
6913 |
|
6914 |
|
6915 |
-
var keys = __webpack_require__(
|
6916 |
var hasSymbols = typeof Symbol === 'function' && typeof Symbol('foo') === 'symbol';
|
6917 |
|
6918 |
var toStr = Object.prototype.toString;
|
@@ -6971,7 +7057,7 @@ module.exports = defineProperties;
|
|
6971 |
|
6972 |
|
6973 |
/***/ }),
|
6974 |
-
/*
|
6975 |
/***/ (function(module, exports, __webpack_require__) {
|
6976 |
|
6977 |
"use strict";
|
@@ -7190,45 +7276,7 @@ var CalendarDayPhrases = exports.CalendarDayPhrases = {
|
|
7190 |
};
|
7191 |
|
7192 |
/***/ }),
|
7193 |
-
/*
|
7194 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
7195 |
-
|
7196 |
-
"use strict";
|
7197 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__create_interpolate_element__ = __webpack_require__(458);
|
7198 |
-
/* unused harmony reexport createInterpolateElement */
|
7199 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__react__ = __webpack_require__(97);
|
7200 |
-
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["a"]; });
|
7201 |
-
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["d"]; });
|
7202 |
-
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["e"]; });
|
7203 |
-
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "d", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["f"]; });
|
7204 |
-
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "e", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["g"]; });
|
7205 |
-
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "f", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["h"]; });
|
7206 |
-
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "g", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["i"]; });
|
7207 |
-
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "h", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["j"]; });
|
7208 |
-
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "i", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["k"]; });
|
7209 |
-
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "j", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["l"]; });
|
7210 |
-
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "k", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["m"]; });
|
7211 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__react_platform__ = __webpack_require__(462);
|
7212 |
-
/* unused harmony namespace reexport */
|
7213 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__utils__ = __webpack_require__(463);
|
7214 |
-
/* unused harmony namespace reexport */
|
7215 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__platform__ = __webpack_require__(464);
|
7216 |
-
/* unused harmony reexport Platform */
|
7217 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__serialize__ = __webpack_require__(465);
|
7218 |
-
/* unused harmony reexport renderToString */
|
7219 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__raw_html__ = __webpack_require__(147);
|
7220 |
-
/* unused harmony reexport RawHTML */
|
7221 |
-
|
7222 |
-
|
7223 |
-
|
7224 |
-
|
7225 |
-
|
7226 |
-
|
7227 |
-
|
7228 |
-
//# sourceMappingURL=index.js.map
|
7229 |
-
|
7230 |
-
/***/ }),
|
7231 |
-
/* 29 */
|
7232 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
7233 |
|
7234 |
"use strict";
|
@@ -7253,7 +7301,7 @@ var ZWNBSP = "\uFEFF";
|
|
7253 |
//# sourceMappingURL=special-characters.js.map
|
7254 |
|
7255 |
/***/ }),
|
7256 |
-
/*
|
7257 |
/***/ (function(module, exports, __webpack_require__) {
|
7258 |
|
7259 |
"use strict";
|
@@ -7264,7 +7312,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
7264 |
});
|
7265 |
exports['default'] = getPhrasePropTypes;
|
7266 |
|
7267 |
-
var _object = __webpack_require__(
|
7268 |
|
7269 |
var _object2 = _interopRequireDefault(_object);
|
7270 |
|
@@ -7283,7 +7331,7 @@ function getPhrasePropTypes(defaultPhrases) {
|
|
7283 |
}
|
7284 |
|
7285 |
/***/ }),
|
7286 |
-
/*
|
7287 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
7288 |
|
7289 |
"use strict";
|
@@ -7309,12 +7357,12 @@ function getPhrasePropTypes(defaultPhrases) {
|
|
7309 |
/* unused harmony export displayShortcut */
|
7310 |
/* unused harmony export shortcutAriaLabel */
|
7311 |
/* unused harmony export isKeyboardEvent */
|
7312 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
7313 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
7314 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash__ = __webpack_require__(2);
|
7315 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_lodash__);
|
7316 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_i18n__ = __webpack_require__(
|
7317 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__platform__ = __webpack_require__(
|
7318 |
|
7319 |
|
7320 |
|
@@ -7513,7 +7561,7 @@ var displayShortcutList = Object(__WEBPACK_IMPORTED_MODULE_2_lodash__["mapValues
|
|
7513 |
|
7514 |
var isApple = _isApple();
|
7515 |
|
7516 |
-
var replacementKeyMap = (_replacementKeyMap = {}, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(_replacementKeyMap, ALT, isApple ? '⌥' : 'Alt'), Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(_replacementKeyMap, CTRL, isApple ? '
|
7517 |
var modifierKeys = modifier(_isApple).reduce(function (accumulator, key) {
|
7518 |
var replacementKey = Object(__WEBPACK_IMPORTED_MODULE_2_lodash__["get"])(replacementKeyMap, key, key); // If on the Mac, adhere to platform convention and don't show plus between keys.
|
7519 |
|
@@ -7609,7 +7657,19 @@ var isKeyboardEvent = Object(__WEBPACK_IMPORTED_MODULE_2_lodash__["mapValues"])(
|
|
7609 |
//# sourceMappingURL=index.js.map
|
7610 |
|
7611 |
/***/ }),
|
7612 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7613 |
/***/ (function(module, exports, __webpack_require__) {
|
7614 |
|
7615 |
"use strict";
|
@@ -7626,11 +7686,11 @@ var _createClass = function () { function defineProperties(target, props) { for
|
|
7626 |
|
7627 |
exports.withStyles = withStyles;
|
7628 |
|
7629 |
-
var _object = __webpack_require__(
|
7630 |
|
7631 |
var _object2 = _interopRequireDefault(_object);
|
7632 |
|
7633 |
-
var _react = __webpack_require__(
|
7634 |
|
7635 |
var _react2 = _interopRequireDefault(_react);
|
7636 |
|
@@ -7638,17 +7698,17 @@ var _propTypes = __webpack_require__(11);
|
|
7638 |
|
7639 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
7640 |
|
7641 |
-
var _hoistNonReactStatics = __webpack_require__(
|
7642 |
|
7643 |
var _hoistNonReactStatics2 = _interopRequireDefault(_hoistNonReactStatics);
|
7644 |
|
7645 |
-
var _constants = __webpack_require__(
|
7646 |
|
7647 |
-
var _brcast = __webpack_require__(
|
7648 |
|
7649 |
var _brcast2 = _interopRequireDefault(_brcast);
|
7650 |
|
7651 |
-
var _ThemedStyleSheet = __webpack_require__(
|
7652 |
|
7653 |
var _ThemedStyleSheet2 = _interopRequireDefault(_ThemedStyleSheet);
|
7654 |
|
@@ -7875,32 +7935,33 @@ function withStyles(styleFn) {
|
|
7875 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
7876 |
|
7877 |
/***/ }),
|
7878 |
-
/*
|
7879 |
-
/***/ (function(module,
|
7880 |
|
7881 |
"use strict";
|
7882 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = _slicedToArray;
|
7883 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__arrayWithHoles__ = __webpack_require__(459);
|
7884 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__iterableToArrayLimit__ = __webpack_require__(460);
|
7885 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__unsupportedIterableToArray__ = __webpack_require__(145);
|
7886 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__nonIterableRest__ = __webpack_require__(461);
|
7887 |
|
7888 |
|
|
|
7889 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7890 |
|
7891 |
-
function _slicedToArray(arr, i) {
|
7892 |
-
return Object(__WEBPACK_IMPORTED_MODULE_0__arrayWithHoles__["a" /* default */])(arr) || Object(__WEBPACK_IMPORTED_MODULE_1__iterableToArrayLimit__["a" /* default */])(arr, i) || Object(__WEBPACK_IMPORTED_MODULE_2__unsupportedIterableToArray__["a" /* default */])(arr, i) || Object(__WEBPACK_IMPORTED_MODULE_3__nonIterableRest__["a" /* default */])();
|
7893 |
-
}
|
7894 |
|
7895 |
/***/ }),
|
7896 |
-
/*
|
7897 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
7898 |
|
7899 |
"use strict";
|
7900 |
/* unused harmony export Button */
|
7901 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(
|
7902 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
7903 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames__ = __webpack_require__(
|
7904 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_classnames__);
|
7905 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_element__ = __webpack_require__(1);
|
7906 |
|
@@ -7960,7 +8021,7 @@ function Button(props, ref) {
|
|
7960 |
//# sourceMappingURL=index.js.map
|
7961 |
|
7962 |
/***/ }),
|
7963 |
-
/*
|
7964 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
7965 |
|
7966 |
"use strict";
|
@@ -7972,13 +8033,13 @@ function Button(props, ref) {
|
|
7972 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
7973 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
7974 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(1);
|
7975 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_classnames__ = __webpack_require__(
|
7976 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_classnames__);
|
7977 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_lodash__ = __webpack_require__(2);
|
7978 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_9_lodash__);
|
7979 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__tooltip__ = __webpack_require__(
|
7980 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__button__ = __webpack_require__(
|
7981 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__dashicon__ = __webpack_require__(
|
7982 |
|
7983 |
|
7984 |
|
@@ -8065,7 +8126,19 @@ function (_Component) {
|
|
8065 |
//# sourceMappingURL=index.js.map
|
8066 |
|
8067 |
/***/ }),
|
8068 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
8069 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8070 |
|
8071 |
"use strict";
|
@@ -8087,31 +8160,12 @@ function _typeof(obj) {
|
|
8087 |
}
|
8088 |
|
8089 |
/***/ }),
|
8090 |
-
/*
|
8091 |
-
/***/ (function(module, exports, __webpack_require__) {
|
8092 |
-
|
8093 |
-
"use strict";
|
8094 |
-
|
8095 |
-
|
8096 |
-
var ES5Type = __webpack_require__(610);
|
8097 |
-
|
8098 |
-
// https://www.ecma-international.org/ecma-262/6.0/#sec-tostring
|
8099 |
-
|
8100 |
-
module.exports = function Type(x) {
|
8101 |
-
if (typeof x === 'symbol') {
|
8102 |
-
return 'Symbol';
|
8103 |
-
}
|
8104 |
-
return ES5Type(x);
|
8105 |
-
};
|
8106 |
-
|
8107 |
-
|
8108 |
-
/***/ }),
|
8109 |
-
/* 38 */
|
8110 |
/***/ (function(module, exports, __webpack_require__) {
|
8111 |
|
8112 |
var moment = __webpack_require__(0);
|
8113 |
-
var momentValidationWrapper = __webpack_require__(
|
8114 |
-
var core = __webpack_require__(
|
8115 |
|
8116 |
module.exports = {
|
8117 |
|
@@ -8152,45 +8206,46 @@ module.exports = {
|
|
8152 |
|
8153 |
|
8154 |
/***/ }),
|
8155 |
-
/*
|
8156 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8157 |
|
8158 |
"use strict";
|
8159 |
-
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "
|
8160 |
/* unused harmony export __experimentalResolveSelect */
|
8161 |
-
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "
|
8162 |
/* unused harmony export subscribe */
|
8163 |
/* unused harmony export registerGenericStore */
|
8164 |
-
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "
|
8165 |
/* unused harmony export use */
|
8166 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_turbo_combine_reducers__ = __webpack_require__(
|
8167 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_turbo_combine_reducers___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_turbo_combine_reducers__);
|
8168 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__default_registry__ = __webpack_require__(
|
8169 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__plugins__ = __webpack_require__(
|
8170 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__components_with_select__ = __webpack_require__(
|
8171 |
/* unused harmony reexport withSelect */
|
8172 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__components_with_dispatch__ = __webpack_require__(
|
8173 |
/* unused harmony reexport withDispatch */
|
8174 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__components_with_registry__ = __webpack_require__(
|
8175 |
/* unused harmony reexport withRegistry */
|
8176 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__components_registry_provider__ = __webpack_require__(
|
8177 |
/* unused harmony reexport RegistryProvider */
|
8178 |
/* unused harmony reexport RegistryConsumer */
|
8179 |
/* unused harmony reexport useRegistry */
|
8180 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__components_use_select__ = __webpack_require__(
|
8181 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "f", function() { return __WEBPACK_IMPORTED_MODULE_7__components_use_select__["a"]; });
|
8182 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__components_use_dispatch__ = __webpack_require__(
|
8183 |
-
/*
|
8184 |
-
/* harmony
|
8185 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__components_async_mode_provider__ = __webpack_require__(550);
|
8186 |
/* unused harmony reexport AsyncModeProvider */
|
8187 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__registry__ = __webpack_require__(
|
8188 |
/* unused harmony reexport createRegistry */
|
8189 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__factory__ = __webpack_require__(
|
8190 |
/* unused harmony reexport createRegistrySelector */
|
8191 |
/* unused harmony reexport createRegistryControl */
|
|
|
|
|
8192 |
/* unused harmony reexport plugins */
|
8193 |
-
/* harmony reexport (default from non-hamory) */ __webpack_require__.d(__webpack_exports__, "
|
8194 |
/**
|
8195 |
* External dependencies
|
8196 |
*/
|
@@ -8210,6 +8265,7 @@ module.exports = {
|
|
8210 |
|
8211 |
|
8212 |
|
|
|
8213 |
/**
|
8214 |
* Object of available plugins to use with a registry.
|
8215 |
*
|
@@ -8366,12 +8422,12 @@ var use = __WEBPACK_IMPORTED_MODULE_1__default_registry__["a" /* default */].use
|
|
8366 |
//# sourceMappingURL=index.js.map
|
8367 |
|
8368 |
/***/ }),
|
8369 |
-
/*
|
8370 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8371 |
|
8372 |
"use strict";
|
8373 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(1);
|
8374 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_classnames__ = __webpack_require__(
|
8375 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_classnames__);
|
8376 |
|
8377 |
|
@@ -8405,19 +8461,260 @@ function BaseControl(_ref) {
|
|
8405 |
//# sourceMappingURL=index.js.map
|
8406 |
|
8407 |
/***/ }),
|
8408 |
-
/*
|
8409 |
/***/ (function(module, exports, __webpack_require__) {
|
8410 |
|
8411 |
"use strict";
|
|
|
8412 |
|
|
|
|
|
8413 |
|
8414 |
-
|
|
|
|
|
|
|
|
|
8415 |
|
8416 |
-
|
|
|
8417 |
|
|
|
8418 |
|
8419 |
/***/ }),
|
8420 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
8421 |
/***/ (function(module, exports, __webpack_require__) {
|
8422 |
|
8423 |
"use strict";
|
@@ -8455,15 +8752,15 @@ if (process.env.NODE_ENV === 'production') {
|
|
8455 |
// DCE check should happen before ReactDOM bundle executes so that
|
8456 |
// DevTools can report bad minification during injection.
|
8457 |
checkDCE();
|
8458 |
-
module.exports = __webpack_require__(
|
8459 |
} else {
|
8460 |
-
module.exports = __webpack_require__(
|
8461 |
}
|
8462 |
|
8463 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
8464 |
|
8465 |
/***/ }),
|
8466 |
-
/*
|
8467 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8468 |
|
8469 |
"use strict";
|
@@ -8499,7 +8796,7 @@ function createHigherOrderComponent(mapComponentToEnhancedComponent, modifierNam
|
|
8499 |
//# sourceMappingURL=index.js.map
|
8500 |
|
8501 |
/***/ }),
|
8502 |
-
/*
|
8503 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8504 |
|
8505 |
"use strict";
|
@@ -8535,26 +8832,28 @@ function createHigherOrderComponent(mapComponentToEnhancedComponent, modifierNam
|
|
8535 |
//# sourceMappingURL=index.js.map
|
8536 |
|
8537 |
/***/ }),
|
8538 |
-
/*
|
8539 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8540 |
|
8541 |
"use strict";
|
8542 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getLineIndex;
|
8543 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__special_characters__ = __webpack_require__(
|
8544 |
/**
|
8545 |
* Internal dependencies
|
8546 |
*/
|
8547 |
|
|
|
|
|
8548 |
/**
|
8549 |
* Gets the currently selected line index, or the first line index if the
|
8550 |
* selection spans over multiple items.
|
8551 |
*
|
8552 |
-
* @param {
|
8553 |
-
* @param {boolean}
|
8554 |
-
*
|
8555 |
-
*
|
8556 |
*
|
8557 |
-
* @return {
|
8558 |
*/
|
8559 |
|
8560 |
function getLineIndex(_ref) {
|
@@ -8572,29 +8871,7 @@ function getLineIndex(_ref) {
|
|
8572 |
//# sourceMappingURL=get-line-index.js.map
|
8573 |
|
8574 |
/***/ }),
|
8575 |
-
/*
|
8576 |
-
/***/ (function(module, exports, __webpack_require__) {
|
8577 |
-
|
8578 |
-
"use strict";
|
8579 |
-
|
8580 |
-
|
8581 |
-
var GetIntrinsic = __webpack_require__(19);
|
8582 |
-
|
8583 |
-
var callBind = __webpack_require__(54);
|
8584 |
-
|
8585 |
-
var $indexOf = callBind(GetIntrinsic('String.prototype.indexOf'));
|
8586 |
-
|
8587 |
-
module.exports = function callBoundIntrinsic(name, allowMissing) {
|
8588 |
-
var intrinsic = GetIntrinsic(name, !!allowMissing);
|
8589 |
-
if (typeof intrinsic === 'function' && $indexOf(name, '.prototype.')) {
|
8590 |
-
return callBind(intrinsic);
|
8591 |
-
}
|
8592 |
-
return intrinsic;
|
8593 |
-
};
|
8594 |
-
|
8595 |
-
|
8596 |
-
/***/ }),
|
8597 |
-
/* 47 */
|
8598 |
/***/ (function(module, exports, __webpack_require__) {
|
8599 |
|
8600 |
"use strict";
|
@@ -8651,7 +8928,7 @@ function andValidator(validators) {
|
|
8651 |
//# sourceMappingURL=and.js.map
|
8652 |
|
8653 |
/***/ }),
|
8654 |
-
/*
|
8655 |
/***/ (function(module, exports, __webpack_require__) {
|
8656 |
|
8657 |
"use strict";
|
@@ -8672,151 +8949,151 @@ function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'd
|
|
8672 |
exports['default'] = _propTypes2['default'].oneOf(_constants.WEEKDAYS);
|
8673 |
|
8674 |
/***/ }),
|
8675 |
-
/*
|
8676 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8677 |
|
8678 |
"use strict";
|
8679 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__primitives__ = __webpack_require__(
|
8680 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "g", function() { return __WEBPACK_IMPORTED_MODULE_0__primitives__["c"]; });
|
8681 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__autocomplete__ = __webpack_require__(
|
8682 |
/* unused harmony reexport Autocomplete */
|
8683 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__base_control__ = __webpack_require__(
|
8684 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_2__base_control__["a"]; });
|
8685 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__button__ = __webpack_require__(
|
8686 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_3__button__["a"]; });
|
8687 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__button_group__ = __webpack_require__(
|
8688 |
/* unused harmony reexport ButtonGroup */
|
8689 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__checkbox_control__ = __webpack_require__(
|
8690 |
/* unused harmony reexport CheckboxControl */
|
8691 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__clipboard_button__ = __webpack_require__(
|
8692 |
/* unused harmony reexport ClipboardButton */
|
8693 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__color_indicator__ = __webpack_require__(
|
8694 |
/* unused harmony reexport ColorIndicator */
|
8695 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__color_palette__ = __webpack_require__(
|
8696 |
/* unused harmony reexport ColorPalette */
|
8697 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__color_picker__ = __webpack_require__(
|
8698 |
/* unused harmony reexport ColorPicker */
|
8699 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__dashicon__ = __webpack_require__(
|
8700 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_10__dashicon__["a"]; });
|
8701 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__date_time__ = __webpack_require__(
|
8702 |
/* unused harmony reexport DateTimePicker */
|
8703 |
/* unused harmony reexport DatePicker */
|
8704 |
/* unused harmony reexport TimePicker */
|
8705 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__disabled__ = __webpack_require__(
|
8706 |
/* unused harmony reexport Disabled */
|
8707 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__draggable__ = __webpack_require__(
|
8708 |
/* unused harmony reexport Draggable */
|
8709 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__drop_zone__ = __webpack_require__(
|
8710 |
/* unused harmony reexport DropZone */
|
8711 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__drop_zone_provider__ = __webpack_require__(
|
8712 |
/* unused harmony reexport DropZoneProvider */
|
8713 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__dropdown__ = __webpack_require__(
|
8714 |
/* unused harmony reexport Dropdown */
|
8715 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__dropdown_menu__ = __webpack_require__(
|
8716 |
/* unused harmony reexport DropdownMenu */
|
8717 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__external_link__ = __webpack_require__(
|
8718 |
/* unused harmony reexport ExternalLink */
|
8719 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__focusable_iframe__ = __webpack_require__(
|
8720 |
/* unused harmony reexport FocusableIframe */
|
8721 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__font_size_picker__ = __webpack_require__(
|
8722 |
/* unused harmony reexport FontSizePicker */
|
8723 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_21__form_file_upload__ = __webpack_require__(
|
8724 |
/* unused harmony reexport FormFileUpload */
|
8725 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_22__form_toggle__ = __webpack_require__(
|
8726 |
/* unused harmony reexport FormToggle */
|
8727 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_23__form_token_field__ = __webpack_require__(
|
8728 |
/* unused harmony reexport FormTokenField */
|
8729 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_24__icon__ = __webpack_require__(
|
8730 |
/* unused harmony reexport Icon */
|
8731 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_25__icon_button__ = __webpack_require__(
|
8732 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return __WEBPACK_IMPORTED_MODULE_25__icon_button__["a"]; });
|
8733 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_26__keyboard_shortcuts__ = __webpack_require__(
|
8734 |
/* unused harmony reexport KeyboardShortcuts */
|
8735 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_27__menu_group__ = __webpack_require__(
|
8736 |
/* unused harmony reexport MenuGroup */
|
8737 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_28__menu_item__ = __webpack_require__(
|
8738 |
/* unused harmony reexport MenuItem */
|
8739 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_29__menu_items_choice__ = __webpack_require__(
|
8740 |
/* unused harmony reexport MenuItemsChoice */
|
8741 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_30__modal__ = __webpack_require__(
|
8742 |
/* unused harmony reexport Modal */
|
8743 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_31__scroll_lock__ = __webpack_require__(
|
8744 |
/* unused harmony reexport ScrollLock */
|
8745 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_32__navigable_container__ = __webpack_require__(
|
8746 |
/* unused harmony reexport NavigableMenu */
|
8747 |
/* unused harmony reexport TabbableContainer */
|
8748 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_33__notice__ = __webpack_require__(
|
8749 |
/* unused harmony reexport Notice */
|
8750 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_34__notice_list__ = __webpack_require__(
|
8751 |
/* unused harmony reexport NoticeList */
|
8752 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_35__panel__ = __webpack_require__(
|
8753 |
/* unused harmony reexport Panel */
|
8754 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_36__panel_body__ = __webpack_require__(
|
8755 |
/* unused harmony reexport PanelBody */
|
8756 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_37__panel_header__ = __webpack_require__(
|
8757 |
/* unused harmony reexport PanelHeader */
|
8758 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_38__panel_row__ = __webpack_require__(
|
8759 |
/* unused harmony reexport PanelRow */
|
8760 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_39__placeholder__ = __webpack_require__(
|
8761 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "e", function() { return __WEBPACK_IMPORTED_MODULE_39__placeholder__["a"]; });
|
8762 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_40__popover__ = __webpack_require__(
|
8763 |
/* unused harmony reexport Popover */
|
8764 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_41__query_controls__ = __webpack_require__(
|
8765 |
/* unused harmony reexport QueryControls */
|
8766 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_42__radio_control__ = __webpack_require__(
|
8767 |
/* unused harmony reexport RadioControl */
|
8768 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_43__range_control__ = __webpack_require__(
|
8769 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "f", function() { return __WEBPACK_IMPORTED_MODULE_43__range_control__["a"]; });
|
8770 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_44__resizable_box__ = __webpack_require__(
|
8771 |
/* unused harmony reexport ResizableBox */
|
8772 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_45__responsive_wrapper__ = __webpack_require__(
|
8773 |
/* unused harmony reexport ResponsiveWrapper */
|
8774 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_46__sandbox__ = __webpack_require__(
|
8775 |
/* unused harmony reexport SandBox */
|
8776 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_47__select_control__ = __webpack_require__(
|
8777 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "h", function() { return __WEBPACK_IMPORTED_MODULE_47__select_control__["a"]; });
|
8778 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_48__spinner__ = __webpack_require__(
|
8779 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "i", function() { return __WEBPACK_IMPORTED_MODULE_48__spinner__["a"]; });
|
8780 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_49__server_side_render__ = __webpack_require__(
|
8781 |
/* unused harmony reexport ServerSideRender */
|
8782 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_50__tab_panel__ = __webpack_require__(
|
8783 |
/* unused harmony reexport TabPanel */
|
8784 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_51__text_control__ = __webpack_require__(
|
8785 |
/* unused harmony reexport TextControl */
|
8786 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_52__textarea_control__ = __webpack_require__(
|
8787 |
/* unused harmony reexport TextareaControl */
|
8788 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_53__toggle_control__ = __webpack_require__(
|
8789 |
/* unused harmony reexport ToggleControl */
|
8790 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_54__toolbar__ = __webpack_require__(
|
8791 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "j", function() { return __WEBPACK_IMPORTED_MODULE_54__toolbar__["a"]; });
|
8792 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_55__toolbar_button__ = __webpack_require__(
|
8793 |
/* unused harmony reexport ToolbarButton */
|
8794 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_56__tooltip__ = __webpack_require__(
|
8795 |
/* unused harmony reexport Tooltip */
|
8796 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_57__tree_select__ = __webpack_require__(
|
8797 |
/* unused harmony reexport TreeSelect */
|
8798 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_58__isolated_event_container__ = __webpack_require__(
|
8799 |
/* unused harmony reexport IsolatedEventContainer */
|
8800 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_59__slot_fill__ = __webpack_require__(
|
8801 |
/* unused harmony reexport createSlotFill */
|
8802 |
/* unused harmony reexport Slot */
|
8803 |
/* unused harmony reexport Fill */
|
8804 |
/* unused harmony reexport SlotFillProvider */
|
8805 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_60__higher_order_navigate_regions__ = __webpack_require__(
|
8806 |
/* unused harmony reexport navigateRegions */
|
8807 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_61__higher_order_with_constrained_tabbing__ = __webpack_require__(
|
8808 |
/* unused harmony reexport withConstrainedTabbing */
|
8809 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_62__higher_order_with_fallback_styles__ = __webpack_require__(
|
8810 |
/* unused harmony reexport withFallbackStyles */
|
8811 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_63__higher_order_with_filters__ = __webpack_require__(
|
8812 |
/* unused harmony reexport withFilters */
|
8813 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_64__higher_order_with_focus_outside__ = __webpack_require__(
|
8814 |
/* unused harmony reexport withFocusOutside */
|
8815 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_65__higher_order_with_focus_return__ = __webpack_require__(
|
8816 |
/* unused harmony reexport withFocusReturn */
|
8817 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_66__higher_order_with_notices__ = __webpack_require__(
|
8818 |
/* unused harmony reexport withNotices */
|
8819 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_67__higher_order_with_spoken_messages__ = __webpack_require__(
|
8820 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "k", function() { return __WEBPACK_IMPORTED_MODULE_67__higher_order_with_spoken_messages__["a"]; });
|
8821 |
// Components
|
8822 |
// eslint-disable-next-line camelcase
|
@@ -8892,13 +9169,13 @@ exports['default'] = _propTypes2['default'].oneOf(_constants.WEEKDAYS);
|
|
8892 |
//# sourceMappingURL=index.js.map
|
8893 |
|
8894 |
/***/ }),
|
8895 |
-
/*
|
8896 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8897 |
|
8898 |
"use strict";
|
8899 |
/* harmony export (immutable) */ __webpack_exports__["a"] = normaliseFormats;
|
8900 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
8901 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__is_format_equal__ = __webpack_require__(
|
8902 |
|
8903 |
|
8904 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
@@ -8909,13 +9186,15 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
8909 |
* Internal dependencies
|
8910 |
*/
|
8911 |
|
|
|
|
|
8912 |
/**
|
8913 |
* Normalises formats: ensures subsequent adjacent equal formats have the same
|
8914 |
* reference.
|
8915 |
*
|
8916 |
-
* @param {
|
8917 |
*
|
8918 |
-
* @return {
|
8919 |
*/
|
8920 |
|
8921 |
function normaliseFormats(value) {
|
@@ -8935,26 +9214,26 @@ function normaliseFormats(value) {
|
|
8935 |
newFormats[index] = newFormatsAtIndex;
|
8936 |
}
|
8937 |
});
|
8938 |
-
return _objectSpread({}, value, {
|
8939 |
formats: newFormats
|
8940 |
});
|
8941 |
}
|
8942 |
//# sourceMappingURL=normalise-formats.js.map
|
8943 |
|
8944 |
/***/ }),
|
8945 |
-
/*
|
8946 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8947 |
|
8948 |
"use strict";
|
8949 |
/* harmony export (immutable) */ __webpack_exports__["a"] = create;
|
8950 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
8951 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
8952 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_typeof__ = __webpack_require__(
|
8953 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_data__ = __webpack_require__(
|
8954 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__is_format_equal__ = __webpack_require__(
|
8955 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__create_element__ = __webpack_require__(
|
8956 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__concat__ = __webpack_require__(
|
8957 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__special_characters__ = __webpack_require__(
|
8958 |
|
8959 |
|
8960 |
|
@@ -8975,6 +9254,25 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
8975 |
|
8976 |
|
8977 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
8978 |
|
8979 |
function createEmptyValue() {
|
8980 |
return {
|
@@ -8998,7 +9296,7 @@ function toFormat(_ref) {
|
|
8998 |
var formatType;
|
8999 |
|
9000 |
if (attributes && attributes.class) {
|
9001 |
-
formatType = Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_data__["
|
9002 |
|
9003 |
if (formatType) {
|
9004 |
// Preserve any additional classes.
|
@@ -9011,7 +9309,7 @@ function toFormat(_ref) {
|
|
9011 |
}
|
9012 |
|
9013 |
if (!formatType) {
|
9014 |
-
formatType = Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_data__["
|
9015 |
}
|
9016 |
|
9017 |
if (!formatType) {
|
@@ -9089,10 +9387,11 @@ function toFormat(_ref) {
|
|
9089 |
* multiline.
|
9090 |
* @param {Array} [$1.multilineWrapperTags] Tags where lines can be found if
|
9091 |
* nesting is possible.
|
9092 |
-
* @param {
|
9093 |
* space characters.
|
|
|
9094 |
*
|
9095 |
-
* @return {
|
9096 |
*/
|
9097 |
|
9098 |
|
@@ -9197,7 +9496,7 @@ function accumulateSelection(accumulator, node, range, value) {
|
|
9197 |
* @param {Range} range The range to filter.
|
9198 |
* @param {Function} filter Function to use to filter the text.
|
9199 |
*
|
9200 |
-
* @return {
|
9201 |
*/
|
9202 |
|
9203 |
|
@@ -9251,17 +9550,19 @@ function removePadding(string) {
|
|
9251 |
/**
|
9252 |
* Creates a Rich Text value from a DOM element and range.
|
9253 |
*
|
9254 |
-
* @param {Object}
|
9255 |
-
* @param {
|
9256 |
-
* @param {
|
9257 |
-
* @param {
|
9258 |
* multiline.
|
9259 |
-
* @param {
|
9260 |
* nesting is possible.
|
9261 |
-
* @param {
|
9262 |
* space characters.
|
|
|
|
|
9263 |
*
|
9264 |
-
* @return {
|
9265 |
*/
|
9266 |
|
9267 |
|
@@ -9395,7 +9696,7 @@ function createFromElement(_ref3) {
|
|
9395 |
|
9396 |
|
9397 |
mergeFormats.newFormats = [format];
|
9398 |
-
Object(__WEBPACK_IMPORTED_MODULE_6__concat__["a" /* mergePair */])(accumulator, _objectSpread({}, value, {
|
9399 |
formats: Array.from(value.formats, mergeFormats)
|
9400 |
}));
|
9401 |
}
|
@@ -9413,19 +9714,20 @@ function createFromElement(_ref3) {
|
|
9413 |
* Creates a rich text value from a DOM element and range that should be
|
9414 |
* multiline.
|
9415 |
*
|
9416 |
-
* @param {Object}
|
9417 |
-
* @param {
|
9418 |
-
* @param {
|
9419 |
-
* @param {
|
9420 |
-
*
|
9421 |
-
* @param {
|
9422 |
-
*
|
9423 |
-
* @param {boolean}
|
9424 |
-
*
|
9425 |
-
* @param {
|
9426 |
-
*
|
|
|
9427 |
*
|
9428 |
-
* @return {
|
9429 |
*/
|
9430 |
|
9431 |
|
@@ -9480,11 +9782,11 @@ function createFromMultilineElement(_ref4) {
|
|
9480 |
/**
|
9481 |
* Gets the attributes of an element in object shape.
|
9482 |
*
|
9483 |
-
* @param {Object}
|
9484 |
-
* @param {Element}
|
9485 |
*
|
9486 |
-
* @return {
|
9487 |
-
*
|
9488 |
*/
|
9489 |
|
9490 |
|
@@ -9516,15 +9818,17 @@ function getAttributes(_ref5) {
|
|
9516 |
//# sourceMappingURL=create.js.map
|
9517 |
|
9518 |
/***/ }),
|
9519 |
-
/*
|
9520 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
9521 |
|
9522 |
"use strict";
|
9523 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return focus; });
|
9524 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__focusable__ = __webpack_require__(
|
9525 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__tabbable__ = __webpack_require__(
|
9526 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__dom__ = __webpack_require__(
|
9527 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_2__dom__["a"]; });
|
|
|
|
|
9528 |
/**
|
9529 |
* Internal dependencies
|
9530 |
*/
|
@@ -9540,10 +9844,11 @@ var focus = {
|
|
9540 |
tabbable: __WEBPACK_IMPORTED_MODULE_1__tabbable__
|
9541 |
};
|
9542 |
|
|
|
9543 |
//# sourceMappingURL=index.js.map
|
9544 |
|
9545 |
/***/ }),
|
9546 |
-
/*
|
9547 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
9548 |
|
9549 |
"use strict";
|
@@ -9554,7 +9859,7 @@ var focus = {
|
|
9554 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
9555 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
9556 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_element__ = __webpack_require__(1);
|
9557 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__primitives__ = __webpack_require__(
|
9558 |
|
9559 |
|
9560 |
|
@@ -10782,31 +11087,21 @@ function (_Component) {
|
|
10782 |
//# sourceMappingURL=index.js.map
|
10783 |
|
10784 |
/***/ }),
|
10785 |
-
/*
|
10786 |
/***/ (function(module, exports, __webpack_require__) {
|
10787 |
|
10788 |
"use strict";
|
10789 |
|
10790 |
|
10791 |
-
|
10792 |
-
|
10793 |
-
var GetIntrinsic = __webpack_require__(19);
|
10794 |
-
|
10795 |
-
var $Function = GetIntrinsic('%Function%');
|
10796 |
-
var $apply = $Function.apply;
|
10797 |
-
var $call = $Function.call;
|
10798 |
-
|
10799 |
-
module.exports = function callBind() {
|
10800 |
-
return bind.apply($call, arguments);
|
10801 |
-
};
|
10802 |
|
10803 |
-
module.exports
|
10804 |
-
return
|
10805 |
};
|
10806 |
|
10807 |
|
10808 |
/***/ }),
|
10809 |
-
/*
|
10810 |
/***/ (function(module, exports, __webpack_require__) {
|
10811 |
|
10812 |
"use strict";
|
@@ -10821,7 +11116,7 @@ module.exports.apply = function applyBind() {
|
|
10821 |
|
10822 |
|
10823 |
|
10824 |
-
var shallowEqual = __webpack_require__(
|
10825 |
|
10826 |
/**
|
10827 |
* Does a shallow comparison for props and state.
|
@@ -10839,7 +11134,7 @@ module.exports = shallowCompare;
|
|
10839 |
|
10840 |
|
10841 |
/***/ }),
|
10842 |
-
/*
|
10843 |
/***/ (function(module, exports, __webpack_require__) {
|
10844 |
|
10845 |
"use strict";
|
@@ -10864,7 +11159,7 @@ function isSameDay(a, b) {
|
|
10864 |
}
|
10865 |
|
10866 |
/***/ }),
|
10867 |
-
/*
|
10868 |
/***/ (function(module, exports, __webpack_require__) {
|
10869 |
|
10870 |
"use strict";
|
@@ -10891,7 +11186,7 @@ function toMomentObject(dateString, customFormat) {
|
|
10891 |
}
|
10892 |
|
10893 |
/***/ }),
|
10894 |
-
/*
|
10895 |
/***/ (function(module, exports, __webpack_require__) {
|
10896 |
|
10897 |
"use strict";
|
@@ -10912,7 +11207,7 @@ function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'd
|
|
10912 |
exports['default'] = _propTypes2['default'].oneOf([_constants.HORIZONTAL_ORIENTATION, _constants.VERTICAL_ORIENTATION, _constants.VERTICAL_SCROLLABLE]);
|
10913 |
|
10914 |
/***/ }),
|
10915 |
-
/*
|
10916 |
/***/ (function(module, exports) {
|
10917 |
|
10918 |
Object.defineProperty(exports, "__esModule", {
|
@@ -10925,7 +11220,7 @@ function isTouchDevice() {
|
|
10925 |
module.exports = exports['default'];
|
10926 |
|
10927 |
/***/ }),
|
10928 |
-
/*
|
10929 |
/***/ (function(module, exports, __webpack_require__) {
|
10930 |
|
10931 |
"use strict";
|
@@ -10946,7 +11241,7 @@ function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'd
|
|
10946 |
exports['default'] = _propTypes2['default'].oneOf([_constants.OPEN_DOWN, _constants.OPEN_UP]);
|
10947 |
|
10948 |
/***/ }),
|
10949 |
-
/*
|
10950 |
/***/ (function(module, exports, __webpack_require__) {
|
10951 |
|
10952 |
"use strict";
|
@@ -11043,7 +11338,181 @@ module.exports = shouldUseNative() ? Object.assign : function (target, source) {
|
|
11043 |
|
11044 |
|
11045 |
/***/ }),
|
11046 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
11047 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
11048 |
|
11049 |
"use strict";
|
@@ -11065,7 +11534,7 @@ module.exports = shouldUseNative() ? Object.assign : function (target, source) {
|
|
11065 |
/* unused harmony export didFilter */
|
11066 |
/* unused harmony export actions */
|
11067 |
/* unused harmony export filters */
|
11068 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__createHooks__ = __webpack_require__(
|
11069 |
/* unused harmony reexport createHooks */
|
11070 |
/**
|
11071 |
* Internal dependencies
|
@@ -11096,30 +11565,32 @@ var _createHooks = Object(__WEBPACK_IMPORTED_MODULE_0__createHooks__["a" /* defa
|
|
11096 |
//# sourceMappingURL=index.js.map
|
11097 |
|
11098 |
/***/ }),
|
11099 |
-
/*
|
11100 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
11101 |
|
11102 |
"use strict";
|
11103 |
/* harmony export (immutable) */ __webpack_exports__["a"] = insert;
|
11104 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__create__ = __webpack_require__(
|
11105 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__normalise_formats__ = __webpack_require__(
|
11106 |
/**
|
11107 |
* Internal dependencies
|
11108 |
*/
|
11109 |
|
11110 |
|
|
|
|
|
11111 |
/**
|
11112 |
* Insert a Rich Text value, an HTML string, or a plain text string, into a
|
11113 |
* Rich Text value at the given `startIndex`. Any content between `startIndex`
|
11114 |
* and `endIndex` will be removed. Indices are retrieved from the selection if
|
11115 |
* none are provided.
|
11116 |
*
|
11117 |
-
* @param {
|
11118 |
-
* @param {
|
11119 |
-
* @param {number}
|
11120 |
-
* @param {number}
|
11121 |
*
|
11122 |
-
* @return {
|
11123 |
*/
|
11124 |
|
11125 |
function insert(value, valueToInsert) {
|
@@ -11147,7 +11618,7 @@ function insert(value, valueToInsert) {
|
|
11147 |
//# sourceMappingURL=insert.js.map
|
11148 |
|
11149 |
/***/ }),
|
11150 |
-
/*
|
11151 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
11152 |
|
11153 |
"use strict";
|
@@ -11159,7 +11630,7 @@ function insert(value, valueToInsert) {
|
|
11159 |
/* harmony export (immutable) */ __webpack_exports__["c"] = calculateSaturationChange;
|
11160 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash__ = __webpack_require__(2);
|
11161 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_lodash__);
|
11162 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_tinycolor2__ = __webpack_require__(
|
11163 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_tinycolor2___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_tinycolor2__);
|
11164 |
/**
|
11165 |
* Parts of this source were derived and modified from react-color,
|
@@ -11398,7 +11869,7 @@ function calculateSaturationChange(e, props, container) {
|
|
11398 |
//# sourceMappingURL=utils.js.map
|
11399 |
|
11400 |
/***/ }),
|
11401 |
-
/*
|
11402 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
11403 |
|
11404 |
"use strict";
|
@@ -11407,11 +11878,11 @@ function calculateSaturationChange(e, props, container) {
|
|
11407 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
11408 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
11409 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
11410 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
11411 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_element__ = __webpack_require__(1);
|
11412 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_mousetrap__ = __webpack_require__(
|
11413 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_mousetrap___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_7_mousetrap__);
|
11414 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_mousetrap_plugins_global_bind_mousetrap_global_bind__ = __webpack_require__(
|
11415 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_mousetrap_plugins_global_bind_mousetrap_global_bind___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_mousetrap_plugins_global_bind_mousetrap_global_bind__);
|
11416 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_lodash__ = __webpack_require__(2);
|
11417 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_9_lodash__);
|
@@ -11508,36 +11979,44 @@ function (_Component) {
|
|
11508 |
//# sourceMappingURL=index.js.map
|
11509 |
|
11510 |
/***/ }),
|
11511 |
-
/*
|
11512 |
/***/ (function(module, exports, __webpack_require__) {
|
11513 |
|
11514 |
"use strict";
|
11515 |
|
11516 |
|
11517 |
-
|
11518 |
|
11519 |
-
|
11520 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
11521 |
};
|
11522 |
|
11523 |
|
11524 |
/***/ }),
|
11525 |
-
/*
|
11526 |
/***/ (function(module, exports, __webpack_require__) {
|
11527 |
|
11528 |
"use strict";
|
11529 |
/* WEBPACK VAR INJECTION */(function(process) {
|
11530 |
|
11531 |
if (process.env.NODE_ENV === 'production') {
|
11532 |
-
module.exports = __webpack_require__(
|
11533 |
} else {
|
11534 |
-
module.exports = __webpack_require__(
|
11535 |
}
|
11536 |
|
11537 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
11538 |
|
11539 |
/***/ }),
|
11540 |
-
/*
|
11541 |
/***/ (function(module, exports, __webpack_require__) {
|
11542 |
|
11543 |
"use strict";
|
@@ -11558,7 +12037,7 @@ function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'd
|
|
11558 |
exports['default'] = _propTypes2['default'].oneOf([_constants.ICON_BEFORE_POSITION, _constants.ICON_AFTER_POSITION]);
|
11559 |
|
11560 |
/***/ }),
|
11561 |
-
/*
|
11562 |
/***/ (function(module, exports, __webpack_require__) {
|
11563 |
|
11564 |
"use strict";
|
@@ -11579,7 +12058,7 @@ function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'd
|
|
11579 |
exports['default'] = _propTypes2['default'].oneOf([_constants.INFO_POSITION_TOP, _constants.INFO_POSITION_BOTTOM, _constants.INFO_POSITION_BEFORE, _constants.INFO_POSITION_AFTER]);
|
11580 |
|
11581 |
/***/ }),
|
11582 |
-
/*
|
11583 |
/***/ (function(module, exports, __webpack_require__) {
|
11584 |
|
11585 |
"use strict";
|
@@ -11594,7 +12073,7 @@ var _moment = __webpack_require__(0);
|
|
11594 |
|
11595 |
var _moment2 = _interopRequireDefault(_moment);
|
11596 |
|
11597 |
-
var _isBeforeDay = __webpack_require__(
|
11598 |
|
11599 |
var _isBeforeDay2 = _interopRequireDefault(_isBeforeDay);
|
11600 |
|
@@ -11606,7 +12085,7 @@ function isInclusivelyAfterDay(a, b) {
|
|
11606 |
}
|
11607 |
|
11608 |
/***/ }),
|
11609 |
-
/*
|
11610 |
/***/ (function(module, exports, __webpack_require__) {
|
11611 |
|
11612 |
"use strict";
|
@@ -11641,7 +12120,7 @@ function isBeforeDay(a, b) {
|
|
11641 |
}
|
11642 |
|
11643 |
/***/ }),
|
11644 |
-
/*
|
11645 |
/***/ (function(module, exports, __webpack_require__) {
|
11646 |
|
11647 |
"use strict";
|
@@ -11651,7 +12130,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
11651 |
value: true
|
11652 |
});
|
11653 |
|
11654 |
-
var _react = __webpack_require__(
|
11655 |
|
11656 |
var _react2 = _interopRequireDefault(_react);
|
11657 |
|
@@ -11678,13 +12157,13 @@ CloseButton.defaultProps = {
|
|
11678 |
exports['default'] = CloseButton;
|
11679 |
|
11680 |
/***/ }),
|
11681 |
-
/*
|
11682 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
11683 |
|
11684 |
"use strict";
|
11685 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__menu__ = __webpack_require__(
|
11686 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_0__menu__["a"]; });
|
11687 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__tabbable__ = __webpack_require__(
|
11688 |
/* unused harmony reexport TabbableContainer */
|
11689 |
/**
|
11690 |
* Internal Dependencies
|
@@ -11694,7 +12173,7 @@ exports['default'] = CloseButton;
|
|
11694 |
//# sourceMappingURL=index.js.map
|
11695 |
|
11696 |
/***/ }),
|
11697 |
-
/*
|
11698 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
11699 |
|
11700 |
"use strict";
|
@@ -11705,7 +12184,7 @@ exports['default'] = CloseButton;
|
|
11705 |
/* harmony export (immutable) */ __webpack_exports__["c"] = escapeHTML;
|
11706 |
/* harmony export (immutable) */ __webpack_exports__["b"] = escapeEditableHTML;
|
11707 |
/* harmony export (immutable) */ __webpack_exports__["d"] = isValidAttributeName;
|
11708 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__escape_greater__ = __webpack_require__(
|
11709 |
/**
|
11710 |
* Internal dependencies
|
11711 |
*/
|
@@ -11830,11 +12309,11 @@ function isValidAttributeName(name) {
|
|
11830 |
//# sourceMappingURL=index.js.map
|
11831 |
|
11832 |
/***/ }),
|
11833 |
-
/*
|
11834 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
11835 |
|
11836 |
"use strict";
|
11837 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__svg__ = __webpack_require__(
|
11838 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_0__svg__["a"]; });
|
11839 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_0__svg__["b"]; });
|
11840 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_0__svg__["c"]; });
|
@@ -11842,208 +12321,494 @@ function isValidAttributeName(name) {
|
|
11842 |
//# sourceMappingURL=index.js.map
|
11843 |
|
11844 |
/***/ }),
|
11845 |
-
/*
|
11846 |
/***/ (function(module, exports, __webpack_require__) {
|
11847 |
|
11848 |
-
|
11849 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
11850 |
*
|
11851 |
-
* @typedef
|
11852 |
*
|
11853 |
-
* @property {
|
|
|
11854 |
*/
|
11855 |
|
11856 |
/**
|
11857 |
-
*
|
11858 |
*
|
11859 |
-
* @typedef
|
11860 |
*
|
11861 |
-
* @property {
|
11862 |
-
* @property {
|
11863 |
-
* @property {
|
11864 |
-
*
|
11865 |
-
* @property {*} val Function result.
|
11866 |
*/
|
11867 |
|
11868 |
/**
|
11869 |
-
*
|
11870 |
-
*
|
11871 |
-
* @typedef MemizeMemoizedFunction
|
11872 |
*
|
11873 |
-
* @
|
11874 |
*/
|
11875 |
|
11876 |
/**
|
11877 |
-
*
|
11878 |
-
*
|
|
|
11879 |
*
|
11880 |
-
* @
|
|
|
|
|
|
|
|
|
11881 |
*
|
11882 |
-
* @
|
11883 |
-
* @param {MemizeOptions} [options] Options object.
|
11884 |
*
|
11885 |
-
* @
|
11886 |
*/
|
11887 |
-
function memize( fn, options ) {
|
11888 |
-
var size = 0;
|
11889 |
|
11890 |
-
|
11891 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
11892 |
|
11893 |
-
|
11894 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
11895 |
|
11896 |
-
|
11897 |
|
11898 |
-
|
11899 |
-
|
11900 |
-
|
11901 |
-
|
|
|
|
|
|
|
11902 |
|
11903 |
-
|
11904 |
-
|
11905 |
-
|
11906 |
-
|
11907 |
-
|
11908 |
-
|
|
|
|
|
|
|
|
|
11909 |
|
11910 |
-
|
11911 |
-
|
11912 |
-
|
11913 |
-
|
11914 |
-
|
|
|
|
|
11915 |
|
11916 |
-
|
11917 |
-
|
11918 |
-
|
11919 |
-
|
11920 |
-
|
11921 |
-
|
11922 |
-
|
11923 |
|
11924 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
11925 |
|
11926 |
-
|
11927 |
-
|
11928 |
-
|
11929 |
-
|
11930 |
-
|
11931 |
-
|
11932 |
-
}
|
11933 |
|
11934 |
-
|
11935 |
-
|
11936 |
-
|
11937 |
-
|
11938 |
-
|
11939 |
-
|
|
|
|
|
|
|
|
|
|
|
11940 |
|
11941 |
-
|
11942 |
-
|
11943 |
-
/** @type {MemizeCacheNode} */ ( head ).prev = node;
|
11944 |
-
head = node;
|
11945 |
-
}
|
11946 |
|
11947 |
-
|
11948 |
-
|
11949 |
-
|
|
|
|
|
|
|
|
|
|
|
11950 |
|
11951 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
11952 |
|
11953 |
-
|
11954 |
-
args = new Array( len );
|
11955 |
-
for ( i = 0; i < len; i++ ) {
|
11956 |
-
args[ i ] = arguments[ i ];
|
11957 |
}
|
11958 |
|
11959 |
-
|
11960 |
-
|
11961 |
|
11962 |
-
|
11963 |
-
|
11964 |
-
};
|
11965 |
|
11966 |
-
|
11967 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
11968 |
|
11969 |
-
|
11970 |
-
|
11971 |
-
|
11972 |
-
|
11973 |
-
|
11974 |
-
|
11975 |
-
|
11976 |
-
}
|
11977 |
-
|
11978 |
-
// Trim tail if we're reached max size and are pending cache insertion
|
11979 |
-
if ( size === /** @type {MemizeOptions} */ ( options ).maxSize ) {
|
11980 |
-
tail = /** @type {MemizeCacheNode} */ ( tail ).prev;
|
11981 |
-
/** @type {MemizeCacheNode} */ ( tail ).next = null;
|
11982 |
-
} else {
|
11983 |
-
size++;
|
11984 |
-
}
|
11985 |
|
11986 |
-
|
11987 |
|
11988 |
-
|
|
|
|
|
11989 |
}
|
11990 |
|
11991 |
-
|
11992 |
-
head = null;
|
11993 |
-
tail = null;
|
11994 |
-
size = 0;
|
11995 |
-
};
|
11996 |
|
11997 |
-
|
11998 |
-
|
11999 |
-
|
12000 |
-
|
12001 |
-
return [ head, tail, size ];
|
12002 |
-
};
|
12003 |
}
|
12004 |
|
12005 |
-
|
12006 |
-
|
12007 |
-
|
12008 |
-
// on the return value.
|
12009 |
-
|
12010 |
-
// @ts-ignore
|
12011 |
-
return memoized;
|
12012 |
-
}
|
12013 |
|
12014 |
-
|
|
|
|
|
|
|
12015 |
|
12016 |
-
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
12017 |
|
12018 |
/***/ }),
|
12019 |
-
/*
|
12020 |
/***/ (function(module, exports) {
|
12021 |
|
12022 |
-
var g;
|
12023 |
-
|
12024 |
-
// This works in non-strict mode
|
12025 |
-
g = (function() {
|
12026 |
-
return this;
|
12027 |
-
})();
|
12028 |
-
|
12029 |
-
try {
|
12030 |
-
// This works if eval is allowed (see CSP)
|
12031 |
-
g = g || Function("return this")() || (1,eval)("this");
|
12032 |
-
} catch(e) {
|
12033 |
-
// This works if the window reference is available
|
12034 |
-
if(typeof window === "object")
|
12035 |
-
g = window;
|
12036 |
-
}
|
12037 |
-
|
12038 |
-
// g can still be undefined, but nothing to do about it...
|
12039 |
-
// We return undefined, instead of nothing here, so it's
|
12040 |
-
// easier to handle this case. if(!global) { ...}
|
12041 |
-
|
12042 |
-
module.exports = g;
|
12043 |
|
12044 |
|
12045 |
/***/ }),
|
12046 |
-
/*
|
12047 |
/***/ (function(module, exports, __webpack_require__) {
|
12048 |
|
12049 |
"use strict";
|
@@ -12055,7 +12820,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
12055 |
|
12056 |
var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol ? "symbol" : typeof obj; };
|
12057 |
|
12058 |
-
var _keys = __webpack_require__(
|
12059 |
|
12060 |
var _keys2 = _interopRequireDefault(_keys);
|
12061 |
|
@@ -12107,69 +12872,13 @@ var is = {
|
|
12107 |
exports.default = is;
|
12108 |
|
12109 |
/***/ }),
|
12110 |
-
/*
|
12111 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
12112 |
-
|
12113 |
-
"use strict";
|
12114 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_create_higher_order_component__ = __webpack_require__(44);
|
12115 |
-
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_0__utils_create_higher_order_component__["a"]; });
|
12116 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__higher_order_compose__ = __webpack_require__(528);
|
12117 |
-
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_1__higher_order_compose__["a"]; });
|
12118 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__higher_order_if_condition__ = __webpack_require__(529);
|
12119 |
-
/* unused harmony reexport ifCondition */
|
12120 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__higher_order_pure__ = __webpack_require__(530);
|
12121 |
-
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_3__higher_order_pure__["a"]; });
|
12122 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__higher_order_with_global_events__ = __webpack_require__(533);
|
12123 |
-
/* unused harmony reexport withGlobalEvents */
|
12124 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__higher_order_with_instance_id__ = __webpack_require__(535);
|
12125 |
-
/* unused harmony reexport withInstanceId */
|
12126 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__higher_order_with_safe_timeout__ = __webpack_require__(536);
|
12127 |
-
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return __WEBPACK_IMPORTED_MODULE_6__higher_order_with_safe_timeout__["a"]; });
|
12128 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__higher_order_with_state__ = __webpack_require__(537);
|
12129 |
-
/* unused harmony reexport withState */
|
12130 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__hooks_use_dragging__ = __webpack_require__(538);
|
12131 |
-
/* unused harmony reexport __experimentalUseDragging */
|
12132 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__hooks_use_instance_id__ = __webpack_require__(157);
|
12133 |
-
/* unused harmony reexport useInstanceId */
|
12134 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__hooks_use_keyboard_shortcut__ = __webpack_require__(539);
|
12135 |
-
/* unused harmony reexport useKeyboardShortcut */
|
12136 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__hooks_use_media_query__ = __webpack_require__(106);
|
12137 |
-
/* unused harmony reexport useMediaQuery */
|
12138 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__hooks_use_reduced_motion__ = __webpack_require__(540);
|
12139 |
-
/* unused harmony reexport useReducedMotion */
|
12140 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__hooks_use_viewport_match__ = __webpack_require__(541);
|
12141 |
-
/* unused harmony reexport useViewportMatch */
|
12142 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__hooks_use_resize_observer__ = __webpack_require__(542);
|
12143 |
-
/* unused harmony reexport useResizeObserver */
|
12144 |
-
// Utils
|
12145 |
-
// Compose helper (aliased flowRight from Lodash)
|
12146 |
-
|
12147 |
-
// Higher-order components
|
12148 |
-
|
12149 |
-
|
12150 |
-
|
12151 |
-
|
12152 |
-
|
12153 |
-
|
12154 |
-
// Hooks
|
12155 |
-
|
12156 |
-
|
12157 |
-
|
12158 |
-
|
12159 |
-
|
12160 |
-
|
12161 |
-
|
12162 |
-
|
12163 |
-
//# sourceMappingURL=index.js.map
|
12164 |
-
|
12165 |
-
/***/ }),
|
12166 |
-
/* 80 */
|
12167 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
12168 |
|
12169 |
"use strict";
|
12170 |
/* harmony export (immutable) */ __webpack_exports__["a"] = useRegistry;
|
12171 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
12172 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__context__ = __webpack_require__(
|
12173 |
/**
|
12174 |
* WordPress dependencies
|
12175 |
*/
|
@@ -12225,7 +12934,7 @@ function useRegistry() {
|
|
12225 |
//# sourceMappingURL=use-registry.js.map
|
12226 |
|
12227 |
/***/ }),
|
12228 |
-
/*
|
12229 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
12230 |
|
12231 |
"use strict";
|
@@ -12236,22 +12945,22 @@ function useRegistry() {
|
|
12236 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
12237 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
12238 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
12239 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
12240 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__wordpress_element__ = __webpack_require__(1);
|
12241 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_classnames__ = __webpack_require__(
|
12242 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_9_classnames__);
|
12243 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__wordpress_is_shallow_equal__ = __webpack_require__(
|
12244 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__wordpress_is_shallow_equal___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_10__wordpress_is_shallow_equal__);
|
12245 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__wordpress_dom__ = __webpack_require__(
|
12246 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__wordpress_keycodes__ = __webpack_require__(
|
12247 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__utils__ = __webpack_require__(
|
12248 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__higher_order_with_focus_return__ = __webpack_require__(
|
12249 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__higher_order_with_constrained_tabbing__ = __webpack_require__(
|
12250 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__detect_outside__ = __webpack_require__(
|
12251 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__icon_button__ = __webpack_require__(
|
12252 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__scroll_lock__ = __webpack_require__(
|
12253 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__isolated_event_container__ = __webpack_require__(
|
12254 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__slot_fill__ = __webpack_require__(
|
12255 |
|
12256 |
|
12257 |
|
@@ -12640,7 +13349,7 @@ PopoverContainer.Slot = function () {
|
|
12640 |
//# sourceMappingURL=index.js.map
|
12641 |
|
12642 |
/***/ }),
|
12643 |
-
/*
|
12644 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
12645 |
|
12646 |
"use strict";
|
@@ -12649,10 +13358,10 @@ PopoverContainer.Slot = function () {
|
|
12649 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
12650 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
12651 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
12652 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
12653 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_element__ = __webpack_require__(1);
|
12654 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_deprecated__ = __webpack_require__(
|
12655 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__popover__ = __webpack_require__(
|
12656 |
|
12657 |
|
12658 |
|
@@ -12801,41 +13510,84 @@ function (_Component) {
|
|
12801 |
//# sourceMappingURL=index.js.map
|
12802 |
|
12803 |
/***/ }),
|
12804 |
-
/*
|
12805 |
-
/***/ (function(module, exports, __webpack_require__) {
|
12806 |
-
|
12807 |
-
"use strict";
|
12808 |
-
|
12809 |
-
|
12810 |
-
var implementation = __webpack_require__(607);
|
12811 |
-
|
12812 |
-
module.exports = Function.prototype.bind || implementation;
|
12813 |
-
|
12814 |
-
|
12815 |
-
/***/ }),
|
12816 |
-
/* 84 */
|
12817 |
/***/ (function(module, exports, __webpack_require__) {
|
12818 |
|
12819 |
"use strict";
|
12820 |
|
12821 |
|
12822 |
-
|
12823 |
-
|
12824 |
-
|
12825 |
-
|
12826 |
-
|
12827 |
-
|
12828 |
-
|
12829 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
12830 |
|
12831 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
12832 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
12833 |
|
12834 |
-
module.exports =
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
12835 |
|
12836 |
|
12837 |
/***/ }),
|
12838 |
-
/*
|
12839 |
/***/ (function(module, exports, __webpack_require__) {
|
12840 |
|
12841 |
"use strict";
|
@@ -12849,7 +13601,7 @@ var _propTypes = __webpack_require__(11);
|
|
12849 |
|
12850 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
12851 |
|
12852 |
-
var _airbnbPropTypes = __webpack_require__(
|
12853 |
|
12854 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
|
12855 |
|
@@ -12880,7 +13632,7 @@ exports['default'] = (0, _airbnbPropTypes.and)([_propTypes2['default'].instanceO
|
|
12880 |
}()], 'Modifiers (Set of Strings)');
|
12881 |
|
12882 |
/***/ }),
|
12883 |
-
/*
|
12884 |
/***/ (function(module, exports, __webpack_require__) {
|
12885 |
|
12886 |
"use strict";
|
@@ -12895,7 +13647,7 @@ var _moment = __webpack_require__(0);
|
|
12895 |
|
12896 |
var _moment2 = _interopRequireDefault(_moment);
|
12897 |
|
12898 |
-
var _toMomentObject = __webpack_require__(
|
12899 |
|
12900 |
var _toMomentObject2 = _interopRequireDefault(_toMomentObject);
|
12901 |
|
@@ -12911,7 +13663,7 @@ function toISODateString(date, currentFormat) {
|
|
12911 |
}
|
12912 |
|
12913 |
/***/ }),
|
12914 |
-
/*
|
12915 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
12916 |
|
12917 |
"use strict";
|
@@ -13126,7 +13878,7 @@ function addEventListener(target, eventName, listener, options) {
|
|
13126 |
|
13127 |
|
13128 |
/***/ }),
|
13129 |
-
/*
|
13130 |
/***/ (function(module, exports, __webpack_require__) {
|
13131 |
|
13132 |
"use strict";
|
@@ -13141,7 +13893,7 @@ var _moment = __webpack_require__(0);
|
|
13141 |
|
13142 |
var _moment2 = _interopRequireDefault(_moment);
|
13143 |
|
13144 |
-
var _toMomentObject = __webpack_require__(
|
13145 |
|
13146 |
var _toMomentObject2 = _interopRequireDefault(_toMomentObject);
|
13147 |
|
@@ -13157,7 +13909,7 @@ function toISOMonthString(date, currentFormat) {
|
|
13157 |
}
|
13158 |
|
13159 |
/***/ }),
|
13160 |
-
/*
|
13161 |
/***/ (function(module, exports, __webpack_require__) {
|
13162 |
|
13163 |
"use strict";
|
@@ -13178,7 +13930,7 @@ function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'd
|
|
13178 |
exports['default'] = _propTypes2['default'].oneOfType([_propTypes2['default'].bool, _propTypes2['default'].oneOf([_constants.START_DATE, _constants.END_DATE])]);
|
13179 |
|
13180 |
/***/ }),
|
13181 |
-
/*
|
13182 |
/***/ (function(module, exports, __webpack_require__) {
|
13183 |
|
13184 |
"use strict";
|
@@ -13193,11 +13945,11 @@ var _moment = __webpack_require__(0);
|
|
13193 |
|
13194 |
var _moment2 = _interopRequireDefault(_moment);
|
13195 |
|
13196 |
-
var _isBeforeDay = __webpack_require__(
|
13197 |
|
13198 |
var _isBeforeDay2 = _interopRequireDefault(_isBeforeDay);
|
13199 |
|
13200 |
-
var _isSameDay = __webpack_require__(
|
13201 |
|
13202 |
var _isSameDay2 = _interopRequireDefault(_isSameDay);
|
13203 |
|
@@ -13209,15 +13961,88 @@ function isAfterDay(a, b) {
|
|
13209 |
}
|
13210 |
|
13211 |
/***/ }),
|
13212 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
13213 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
13214 |
|
13215 |
"use strict";
|
13216 |
/* harmony export (immutable) */ __webpack_exports__["f"] = concatChildren;
|
13217 |
/* unused harmony export switchChildrenNodeName */
|
13218 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(
|
13219 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
13220 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_react__ = __webpack_require__(
|
13221 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_react__);
|
13222 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
13223 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
@@ -13370,7 +14195,7 @@ function switchChildrenNodeName(children, nodeName) {
|
|
13370 |
//# sourceMappingURL=react.js.map
|
13371 |
|
13372 |
/***/ }),
|
13373 |
-
/*
|
13374 |
/***/ (function(module, exports, __webpack_require__) {
|
13375 |
|
13376 |
"use strict";
|
@@ -13386,7 +14211,7 @@ function switchChildrenNodeName(children, nodeName) {
|
|
13386 |
var printWarning = function() {};
|
13387 |
|
13388 |
if (process.env.NODE_ENV !== 'production') {
|
13389 |
-
var ReactPropTypesSecret = __webpack_require__(
|
13390 |
var loggedTypeFailures = {};
|
13391 |
var has = Function.call.bind(Object.prototype.hasOwnProperty);
|
13392 |
|
@@ -13480,7 +14305,7 @@ module.exports = checkPropTypes;
|
|
13480 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
13481 |
|
13482 |
/***/ }),
|
13483 |
-
/*
|
13484 |
/***/ (function(module, exports, __webpack_require__) {
|
13485 |
|
13486 |
"use strict";
|
@@ -13499,549 +14324,89 @@ module.exports = ReactPropTypesSecret;
|
|
13499 |
|
13500 |
|
13501 |
/***/ }),
|
13502 |
-
/*
|
13503 |
-
/***/ (function(module,
|
13504 |
|
13505 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
13506 |
|
13507 |
-
!function() {
|
13508 |
-
'use strict'
|
13509 |
|
13510 |
-
var re = {
|
13511 |
-
not_string: /[^s]/,
|
13512 |
-
not_bool: /[^t]/,
|
13513 |
-
not_type: /[^T]/,
|
13514 |
-
not_primitive: /[^v]/,
|
13515 |
-
number: /[diefg]/,
|
13516 |
-
numeric_arg: /[bcdiefguxX]/,
|
13517 |
-
json: /[j]/,
|
13518 |
-
not_json: /[^j]/,
|
13519 |
-
text: /^[^\x25]+/,
|
13520 |
-
modulo: /^\x25{2}/,
|
13521 |
-
placeholder: /^\x25(?:([1-9]\d*)\$|\(([^)]+)\))?(\+)?(0|'[^$])?(-)?(\d+)?(?:\.(\d+))?([b-gijostTuvxX])/,
|
13522 |
-
key: /^([a-z_][a-z_\d]*)/i,
|
13523 |
-
key_access: /^\.([a-z_][a-z_\d]*)/i,
|
13524 |
-
index_access: /^\[(\d+)\]/,
|
13525 |
-
sign: /^[+-]/
|
13526 |
-
}
|
13527 |
|
13528 |
-
|
13529 |
-
// `arguments` is not an array, but should be fine for this call
|
13530 |
-
return sprintf_format(sprintf_parse(key), arguments)
|
13531 |
-
}
|
13532 |
|
13533 |
-
|
13534 |
-
return sprintf.apply(null, [fmt].concat(argv || []))
|
13535 |
-
}
|
13536 |
|
13537 |
-
|
13538 |
-
|
13539 |
-
|
13540 |
-
if (typeof parse_tree[i] === 'string') {
|
13541 |
-
output += parse_tree[i]
|
13542 |
-
}
|
13543 |
-
else if (typeof parse_tree[i] === 'object') {
|
13544 |
-
ph = parse_tree[i] // convenience purposes only
|
13545 |
-
if (ph.keys) { // keyword argument
|
13546 |
-
arg = argv[cursor]
|
13547 |
-
for (k = 0; k < ph.keys.length; k++) {
|
13548 |
-
if (arg == undefined) {
|
13549 |
-
throw new Error(sprintf('[sprintf] Cannot access property "%s" of undefined value "%s"', ph.keys[k], ph.keys[k-1]))
|
13550 |
-
}
|
13551 |
-
arg = arg[ph.keys[k]]
|
13552 |
-
}
|
13553 |
-
}
|
13554 |
-
else if (ph.param_no) { // positional argument (explicit)
|
13555 |
-
arg = argv[ph.param_no]
|
13556 |
-
}
|
13557 |
-
else { // positional argument (implicit)
|
13558 |
-
arg = argv[cursor++]
|
13559 |
-
}
|
13560 |
|
13561 |
-
if (re.not_type.test(ph.type) && re.not_primitive.test(ph.type) && arg instanceof Function) {
|
13562 |
-
arg = arg()
|
13563 |
-
}
|
13564 |
|
13565 |
-
|
13566 |
-
|
13567 |
-
|
|
|
|
|
13568 |
|
13569 |
-
|
13570 |
-
|
13571 |
-
|
|
|
|
|
13572 |
|
13573 |
-
|
13574 |
-
|
13575 |
-
|
13576 |
-
|
13577 |
-
|
13578 |
-
arg = String.fromCharCode(parseInt(arg, 10))
|
13579 |
-
break
|
13580 |
-
case 'd':
|
13581 |
-
case 'i':
|
13582 |
-
arg = parseInt(arg, 10)
|
13583 |
-
break
|
13584 |
-
case 'j':
|
13585 |
-
arg = JSON.stringify(arg, null, ph.width ? parseInt(ph.width) : 0)
|
13586 |
-
break
|
13587 |
-
case 'e':
|
13588 |
-
arg = ph.precision ? parseFloat(arg).toExponential(ph.precision) : parseFloat(arg).toExponential()
|
13589 |
-
break
|
13590 |
-
case 'f':
|
13591 |
-
arg = ph.precision ? parseFloat(arg).toFixed(ph.precision) : parseFloat(arg)
|
13592 |
-
break
|
13593 |
-
case 'g':
|
13594 |
-
arg = ph.precision ? String(Number(arg.toPrecision(ph.precision))) : parseFloat(arg)
|
13595 |
-
break
|
13596 |
-
case 'o':
|
13597 |
-
arg = (parseInt(arg, 10) >>> 0).toString(8)
|
13598 |
-
break
|
13599 |
-
case 's':
|
13600 |
-
arg = String(arg)
|
13601 |
-
arg = (ph.precision ? arg.substring(0, ph.precision) : arg)
|
13602 |
-
break
|
13603 |
-
case 't':
|
13604 |
-
arg = String(!!arg)
|
13605 |
-
arg = (ph.precision ? arg.substring(0, ph.precision) : arg)
|
13606 |
-
break
|
13607 |
-
case 'T':
|
13608 |
-
arg = Object.prototype.toString.call(arg).slice(8, -1).toLowerCase()
|
13609 |
-
arg = (ph.precision ? arg.substring(0, ph.precision) : arg)
|
13610 |
-
break
|
13611 |
-
case 'u':
|
13612 |
-
arg = parseInt(arg, 10) >>> 0
|
13613 |
-
break
|
13614 |
-
case 'v':
|
13615 |
-
arg = arg.valueOf()
|
13616 |
-
arg = (ph.precision ? arg.substring(0, ph.precision) : arg)
|
13617 |
-
break
|
13618 |
-
case 'x':
|
13619 |
-
arg = (parseInt(arg, 10) >>> 0).toString(16)
|
13620 |
-
break
|
13621 |
-
case 'X':
|
13622 |
-
arg = (parseInt(arg, 10) >>> 0).toString(16).toUpperCase()
|
13623 |
-
break
|
13624 |
-
}
|
13625 |
-
if (re.json.test(ph.type)) {
|
13626 |
-
output += arg
|
13627 |
-
}
|
13628 |
-
else {
|
13629 |
-
if (re.number.test(ph.type) && (!is_positive || ph.sign)) {
|
13630 |
-
sign = is_positive ? '+' : '-'
|
13631 |
-
arg = arg.toString().replace(re.sign, '')
|
13632 |
-
}
|
13633 |
-
else {
|
13634 |
-
sign = ''
|
13635 |
-
}
|
13636 |
-
pad_character = ph.pad_char ? ph.pad_char === '0' ? '0' : ph.pad_char.charAt(1) : ' '
|
13637 |
-
pad_length = ph.width - (sign + arg).length
|
13638 |
-
pad = ph.width ? (pad_length > 0 ? pad_character.repeat(pad_length) : '') : ''
|
13639 |
-
output += ph.align ? sign + arg + pad : (pad_character === '0' ? sign + pad + arg : pad + sign + arg)
|
13640 |
-
}
|
13641 |
-
}
|
13642 |
-
}
|
13643 |
-
return output
|
13644 |
-
}
|
13645 |
|
13646 |
-
|
|
|
|
|
13647 |
|
13648 |
-
function sprintf_parse(fmt) {
|
13649 |
-
if (sprintf_cache[fmt]) {
|
13650 |
-
return sprintf_cache[fmt]
|
13651 |
-
}
|
13652 |
|
13653 |
-
|
13654 |
-
|
13655 |
-
|
13656 |
-
|
13657 |
-
|
13658 |
-
|
13659 |
-
|
13660 |
-
|
13661 |
-
else if ((match = re.placeholder.exec(_fmt)) !== null) {
|
13662 |
-
if (match[2]) {
|
13663 |
-
arg_names |= 1
|
13664 |
-
var field_list = [], replacement_field = match[2], field_match = []
|
13665 |
-
if ((field_match = re.key.exec(replacement_field)) !== null) {
|
13666 |
-
field_list.push(field_match[1])
|
13667 |
-
while ((replacement_field = replacement_field.substring(field_match[0].length)) !== '') {
|
13668 |
-
if ((field_match = re.key_access.exec(replacement_field)) !== null) {
|
13669 |
-
field_list.push(field_match[1])
|
13670 |
-
}
|
13671 |
-
else if ((field_match = re.index_access.exec(replacement_field)) !== null) {
|
13672 |
-
field_list.push(field_match[1])
|
13673 |
-
}
|
13674 |
-
else {
|
13675 |
-
throw new SyntaxError('[sprintf] failed to parse named argument key')
|
13676 |
-
}
|
13677 |
-
}
|
13678 |
-
}
|
13679 |
-
else {
|
13680 |
-
throw new SyntaxError('[sprintf] failed to parse named argument key')
|
13681 |
-
}
|
13682 |
-
match[2] = field_list
|
13683 |
-
}
|
13684 |
-
else {
|
13685 |
-
arg_names |= 2
|
13686 |
-
}
|
13687 |
-
if (arg_names === 3) {
|
13688 |
-
throw new Error('[sprintf] mixing positional and named placeholders is not (yet) supported')
|
13689 |
-
}
|
13690 |
|
13691 |
-
parse_tree.push(
|
13692 |
-
{
|
13693 |
-
placeholder: match[0],
|
13694 |
-
param_no: match[1],
|
13695 |
-
keys: match[2],
|
13696 |
-
sign: match[3],
|
13697 |
-
pad_char: match[4],
|
13698 |
-
align: match[5],
|
13699 |
-
width: match[6],
|
13700 |
-
precision: match[7],
|
13701 |
-
type: match[8]
|
13702 |
-
}
|
13703 |
-
)
|
13704 |
-
}
|
13705 |
-
else {
|
13706 |
-
throw new SyntaxError('[sprintf] unexpected placeholder')
|
13707 |
-
}
|
13708 |
-
_fmt = _fmt.substring(match[0].length)
|
13709 |
-
}
|
13710 |
-
return sprintf_cache[fmt] = parse_tree
|
13711 |
-
}
|
13712 |
|
13713 |
-
|
13714 |
-
|
13715 |
-
|
13716 |
-
/* eslint-disable quote-props */
|
13717 |
-
if (true) {
|
13718 |
-
exports['sprintf'] = sprintf
|
13719 |
-
exports['vsprintf'] = vsprintf
|
13720 |
-
}
|
13721 |
-
if (typeof window !== 'undefined') {
|
13722 |
-
window['sprintf'] = sprintf
|
13723 |
-
window['vsprintf'] = vsprintf
|
13724 |
-
|
13725 |
-
if (true) {
|
13726 |
-
!(__WEBPACK_AMD_DEFINE_RESULT__ = (function() {
|
13727 |
-
return {
|
13728 |
-
'sprintf': sprintf,
|
13729 |
-
'vsprintf': vsprintf
|
13730 |
-
}
|
13731 |
-
}).call(exports, __webpack_require__, exports, module),
|
13732 |
-
__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__))
|
13733 |
-
}
|
13734 |
-
}
|
13735 |
-
/* eslint-enable quote-props */
|
13736 |
-
}(); // eslint-disable-line
|
13737 |
-
|
13738 |
-
|
13739 |
-
/***/ }),
|
13740 |
-
/* 96 */
|
13741 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
13742 |
-
|
13743 |
-
"use strict";
|
13744 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = Tannin;
|
13745 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__tannin_plural_forms__ = __webpack_require__(450);
|
13746 |
-
|
13747 |
-
|
13748 |
-
/**
|
13749 |
-
* Tannin constructor options.
|
13750 |
-
*
|
13751 |
-
* @typedef {Object} TanninOptions
|
13752 |
-
*
|
13753 |
-
* @property {string} [contextDelimiter] Joiner in string lookup with context.
|
13754 |
-
* @property {Function} [onMissingKey] Callback to invoke when key missing.
|
13755 |
-
*/
|
13756 |
-
|
13757 |
-
/**
|
13758 |
-
* Domain metadata.
|
13759 |
-
*
|
13760 |
-
* @typedef {Object} TanninDomainMetadata
|
13761 |
-
*
|
13762 |
-
* @property {string} [domain] Domain name.
|
13763 |
-
* @property {string} [lang] Language code.
|
13764 |
-
* @property {(string|Function)} [plural_forms] Plural forms expression or
|
13765 |
-
* function evaluator.
|
13766 |
-
*/
|
13767 |
-
|
13768 |
-
/**
|
13769 |
-
* Domain translation pair respectively representing the singular and plural
|
13770 |
-
* translation.
|
13771 |
-
*
|
13772 |
-
* @typedef {[string,string]} TanninTranslation
|
13773 |
-
*/
|
13774 |
-
|
13775 |
-
/**
|
13776 |
-
* Locale data domain. The key is used as reference for lookup, the value an
|
13777 |
-
* array of two string entries respectively representing the singular and plural
|
13778 |
-
* translation.
|
13779 |
-
*
|
13780 |
-
* @typedef {{[key:string]:TanninDomainMetadata|TanninTranslation,'':TanninDomainMetadata|TanninTranslation}} TanninLocaleDomain
|
13781 |
-
*/
|
13782 |
-
|
13783 |
-
/**
|
13784 |
-
* Jed-formatted locale data.
|
13785 |
-
*
|
13786 |
-
* @see http://messageformat.github.io/Jed/
|
13787 |
-
*
|
13788 |
-
* @typedef {{[domain:string]:TanninLocaleDomain}} TanninLocaleData
|
13789 |
-
*/
|
13790 |
-
|
13791 |
-
/**
|
13792 |
-
* Default Tannin constructor options.
|
13793 |
-
*
|
13794 |
-
* @type {TanninOptions}
|
13795 |
-
*/
|
13796 |
-
var DEFAULT_OPTIONS = {
|
13797 |
-
contextDelimiter: '\u0004',
|
13798 |
-
onMissingKey: null,
|
13799 |
-
};
|
13800 |
-
|
13801 |
-
/**
|
13802 |
-
* Given a specific locale data's config `plural_forms` value, returns the
|
13803 |
-
* expression.
|
13804 |
-
*
|
13805 |
-
* @example
|
13806 |
-
*
|
13807 |
-
* ```
|
13808 |
-
* getPluralExpression( 'nplurals=2; plural=(n != 1);' ) === '(n != 1)'
|
13809 |
-
* ```
|
13810 |
-
*
|
13811 |
-
* @param {string} pf Locale data plural forms.
|
13812 |
-
*
|
13813 |
-
* @return {string} Plural forms expression.
|
13814 |
-
*/
|
13815 |
-
function getPluralExpression( pf ) {
|
13816 |
-
var parts, i, part;
|
13817 |
-
|
13818 |
-
parts = pf.split( ';' );
|
13819 |
-
|
13820 |
-
for ( i = 0; i < parts.length; i++ ) {
|
13821 |
-
part = parts[ i ].trim();
|
13822 |
-
if ( part.indexOf( 'plural=' ) === 0 ) {
|
13823 |
-
return part.substr( 7 );
|
13824 |
-
}
|
13825 |
-
}
|
13826 |
-
}
|
13827 |
-
|
13828 |
-
/**
|
13829 |
-
* Tannin constructor.
|
13830 |
-
*
|
13831 |
-
* @class
|
13832 |
-
*
|
13833 |
-
* @param {TanninLocaleData} data Jed-formatted locale data.
|
13834 |
-
* @param {TanninOptions} [options] Tannin options.
|
13835 |
-
*/
|
13836 |
-
function Tannin( data, options ) {
|
13837 |
-
var key;
|
13838 |
-
|
13839 |
-
/**
|
13840 |
-
* Jed-formatted locale data.
|
13841 |
-
*
|
13842 |
-
* @name Tannin#data
|
13843 |
-
* @type {TanninLocaleData}
|
13844 |
-
*/
|
13845 |
-
this.data = data;
|
13846 |
-
|
13847 |
-
/**
|
13848 |
-
* Plural forms function cache, keyed by plural forms string.
|
13849 |
-
*
|
13850 |
-
* @name Tannin#pluralForms
|
13851 |
-
* @type {Object<string,Function>}
|
13852 |
-
*/
|
13853 |
-
this.pluralForms = {};
|
13854 |
-
|
13855 |
-
/**
|
13856 |
-
* Effective options for instance, including defaults.
|
13857 |
-
*
|
13858 |
-
* @name Tannin#options
|
13859 |
-
* @type {TanninOptions}
|
13860 |
-
*/
|
13861 |
-
this.options = {};
|
13862 |
-
|
13863 |
-
for ( key in DEFAULT_OPTIONS ) {
|
13864 |
-
this.options[ key ] = options !== undefined && key in options
|
13865 |
-
? options[ key ]
|
13866 |
-
: DEFAULT_OPTIONS[ key ];
|
13867 |
-
}
|
13868 |
-
}
|
13869 |
-
|
13870 |
-
/**
|
13871 |
-
* Returns the plural form index for the given domain and value.
|
13872 |
-
*
|
13873 |
-
* @param {string} domain Domain on which to calculate plural form.
|
13874 |
-
* @param {number} n Value for which plural form is to be calculated.
|
13875 |
-
*
|
13876 |
-
* @return {number} Plural form index.
|
13877 |
-
*/
|
13878 |
-
Tannin.prototype.getPluralForm = function( domain, n ) {
|
13879 |
-
var getPluralForm = this.pluralForms[ domain ],
|
13880 |
-
config, plural, pf;
|
13881 |
-
|
13882 |
-
if ( ! getPluralForm ) {
|
13883 |
-
config = this.data[ domain ][ '' ];
|
13884 |
-
|
13885 |
-
pf = (
|
13886 |
-
config[ 'Plural-Forms' ] ||
|
13887 |
-
config[ 'plural-forms' ] ||
|
13888 |
-
// Ignore reason: As known, there's no way to document the empty
|
13889 |
-
// string property on a key to guarantee this as metadata.
|
13890 |
-
// @ts-ignore
|
13891 |
-
config.plural_forms
|
13892 |
-
);
|
13893 |
-
|
13894 |
-
if ( typeof pf !== 'function' ) {
|
13895 |
-
plural = getPluralExpression(
|
13896 |
-
config[ 'Plural-Forms' ] ||
|
13897 |
-
config[ 'plural-forms' ] ||
|
13898 |
-
// Ignore reason: As known, there's no way to document the empty
|
13899 |
-
// string property on a key to guarantee this as metadata.
|
13900 |
-
// @ts-ignore
|
13901 |
-
config.plural_forms
|
13902 |
-
);
|
13903 |
-
|
13904 |
-
pf = Object(__WEBPACK_IMPORTED_MODULE_0__tannin_plural_forms__["a" /* default */])( plural );
|
13905 |
-
}
|
13906 |
-
|
13907 |
-
getPluralForm = this.pluralForms[ domain ] = pf;
|
13908 |
-
}
|
13909 |
-
|
13910 |
-
return getPluralForm( n );
|
13911 |
-
};
|
13912 |
-
|
13913 |
-
/**
|
13914 |
-
* Translate a string.
|
13915 |
-
*
|
13916 |
-
* @param {string} domain Translation domain.
|
13917 |
-
* @param {string|void} context Context distinguishing terms of the same name.
|
13918 |
-
* @param {string} singular Primary key for translation lookup.
|
13919 |
-
* @param {string=} plural Fallback value used for non-zero plural
|
13920 |
-
* form index.
|
13921 |
-
* @param {number=} n Value to use in calculating plural form.
|
13922 |
-
*
|
13923 |
-
* @return {string} Translated string.
|
13924 |
-
*/
|
13925 |
-
Tannin.prototype.dcnpgettext = function( domain, context, singular, plural, n ) {
|
13926 |
-
var index, key, entry;
|
13927 |
-
|
13928 |
-
if ( n === undefined ) {
|
13929 |
-
// Default to singular.
|
13930 |
-
index = 0;
|
13931 |
-
} else {
|
13932 |
-
// Find index by evaluating plural form for value.
|
13933 |
-
index = this.getPluralForm( domain, n );
|
13934 |
-
}
|
13935 |
-
|
13936 |
-
key = singular;
|
13937 |
-
|
13938 |
-
// If provided, context is prepended to key with delimiter.
|
13939 |
-
if ( context ) {
|
13940 |
-
key = context + this.options.contextDelimiter + singular;
|
13941 |
-
}
|
13942 |
-
|
13943 |
-
entry = this.data[ domain ][ key ];
|
13944 |
-
|
13945 |
-
// Verify not only that entry exists, but that the intended index is within
|
13946 |
-
// range and non-empty.
|
13947 |
-
if ( entry && entry[ index ] ) {
|
13948 |
-
return entry[ index ];
|
13949 |
-
}
|
13950 |
-
|
13951 |
-
if ( this.options.onMissingKey ) {
|
13952 |
-
this.options.onMissingKey( singular, domain );
|
13953 |
-
}
|
13954 |
-
|
13955 |
-
// If entry not found, fall back to singular vs. plural with zero index
|
13956 |
-
// representing the singular value.
|
13957 |
-
return index === 0 ? singular : plural;
|
13958 |
-
};
|
13959 |
-
|
13960 |
-
|
13961 |
-
/***/ }),
|
13962 |
-
/* 97 */
|
13963 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
13964 |
-
|
13965 |
-
"use strict";
|
13966 |
-
/* unused harmony export concatChildren */
|
13967 |
-
/* unused harmony export switchChildrenNodeName */
|
13968 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(14);
|
13969 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
13970 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_react__ = __webpack_require__(10);
|
13971 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_react__);
|
13972 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
13973 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
13974 |
-
/* unused harmony reexport Children */
|
13975 |
-
/* unused harmony reexport cloneElement */
|
13976 |
-
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "Component")) __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["Component"]; });
|
13977 |
-
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "createContext")) __webpack_require__.d(__webpack_exports__, "d", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["createContext"]; });
|
13978 |
-
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "createElement")) __webpack_require__.d(__webpack_exports__, "e", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["createElement"]; });
|
13979 |
-
/* unused harmony reexport createRef */
|
13980 |
-
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "forwardRef")) __webpack_require__.d(__webpack_exports__, "f", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["forwardRef"]; });
|
13981 |
-
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "Fragment")) __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["Fragment"]; });
|
13982 |
-
/* unused harmony reexport isValidElement */
|
13983 |
-
/* unused harmony reexport memo */
|
13984 |
-
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "StrictMode")) __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["StrictMode"]; });
|
13985 |
-
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useCallback")) __webpack_require__.d(__webpack_exports__, "g", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useCallback"]; });
|
13986 |
-
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useContext")) __webpack_require__.d(__webpack_exports__, "h", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useContext"]; });
|
13987 |
-
/* unused harmony reexport useDebugValue */
|
13988 |
-
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useEffect")) __webpack_require__.d(__webpack_exports__, "i", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useEffect"]; });
|
13989 |
-
/* unused harmony reexport useImperativeHandle */
|
13990 |
-
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useLayoutEffect")) __webpack_require__.d(__webpack_exports__, "j", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useLayoutEffect"]; });
|
13991 |
-
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useMemo")) __webpack_require__.d(__webpack_exports__, "k", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useMemo"]; });
|
13992 |
-
/* unused harmony reexport useReducer */
|
13993 |
-
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useRef")) __webpack_require__.d(__webpack_exports__, "l", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useRef"]; });
|
13994 |
-
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useState")) __webpack_require__.d(__webpack_exports__, "m", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useState"]; });
|
13995 |
-
/* unused harmony reexport lazy */
|
13996 |
-
/* unused harmony reexport Suspense */
|
13997 |
-
|
13998 |
-
|
13999 |
-
|
14000 |
-
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
14001 |
-
|
14002 |
-
function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }
|
14003 |
-
|
14004 |
-
/**
|
14005 |
-
* External dependencies
|
14006 |
-
*/
|
14007 |
-
|
14008 |
-
|
14009 |
-
/**
|
14010 |
-
* Object containing a React element.
|
14011 |
-
*
|
14012 |
-
* @typedef {import('react').ReactElement} WPElement
|
14013 |
-
*/
|
14014 |
-
|
14015 |
-
/**
|
14016 |
-
* Object containing a React component.
|
14017 |
-
*
|
14018 |
-
* @typedef {import('react').ComponentType} WPComponent
|
14019 |
-
*/
|
14020 |
-
|
14021 |
-
/**
|
14022 |
-
* Object containing a React synthetic event.
|
14023 |
-
*
|
14024 |
-
* @typedef {import('react').SyntheticEvent} WPSyntheticEvent
|
14025 |
-
*/
|
14026 |
-
|
14027 |
-
/**
|
14028 |
-
* Object that provides utilities for dealing with React children.
|
14029 |
-
*/
|
14030 |
-
|
14031 |
-
|
14032 |
-
/**
|
14033 |
-
* Creates a copy of an element with extended props.
|
14034 |
-
*
|
14035 |
-
* @param {WPElement} element Element
|
14036 |
-
* @param {?Object} props Props to apply to cloned element
|
14037 |
-
*
|
14038 |
-
* @return {WPElement} Cloned element.
|
14039 |
-
*/
|
14040 |
-
|
14041 |
-
|
14042 |
-
/**
|
14043 |
-
* A base class to create WordPress Components (Refs, state and lifecycle hooks)
|
14044 |
-
*/
|
14045 |
|
14046 |
|
14047 |
/**
|
@@ -14231,97 +14596,1075 @@ function switchChildrenNodeName(children, nodeName) {
|
|
14231 |
/* 98 */
|
14232 |
/***/ (function(module, exports, __webpack_require__) {
|
14233 |
|
14234 |
-
|
14235 |
-
|
14236 |
-
*
|
14237 |
-
*
|
14238 |
-
* Licensed
|
14239 |
-
* you may not use this file except in compliance with the License.
|
14240 |
-
* You may obtain a copy of the License at
|
14241 |
-
*
|
14242 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
14243 |
-
*
|
14244 |
-
* Unless required by applicable law or agreed to in writing, software
|
14245 |
-
* distributed under the License is distributed on an "AS IS" BASIS,
|
14246 |
-
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
14247 |
-
* See the License for the specific language governing permissions and
|
14248 |
-
* limitations under the License.
|
14249 |
-
*
|
14250 |
-
* Mousetrap is a simple keyboard shortcut library for Javascript with
|
14251 |
-
* no external dependencies
|
14252 |
-
*
|
14253 |
-
* @version 1.6.5
|
14254 |
-
* @url craig.is/killing/mice
|
14255 |
*/
|
14256 |
-
(function(
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
14257 |
|
14258 |
-
|
14259 |
-
|
14260 |
-
return;
|
14261 |
-
}
|
14262 |
|
14263 |
-
|
14264 |
-
|
14265 |
-
*
|
14266 |
-
* everything in this dictionary cannot use keypress events
|
14267 |
-
* so it has to be here to map to the correct keycodes for
|
14268 |
-
* keyup/keydown events
|
14269 |
-
*
|
14270 |
-
* @type {Object}
|
14271 |
-
*/
|
14272 |
-
var _MAP = {
|
14273 |
-
8: 'backspace',
|
14274 |
-
9: 'tab',
|
14275 |
-
13: 'enter',
|
14276 |
-
16: 'shift',
|
14277 |
-
17: 'ctrl',
|
14278 |
-
18: 'alt',
|
14279 |
-
20: 'capslock',
|
14280 |
-
27: 'esc',
|
14281 |
-
32: 'space',
|
14282 |
-
33: 'pageup',
|
14283 |
-
34: 'pagedown',
|
14284 |
-
35: 'end',
|
14285 |
-
36: 'home',
|
14286 |
-
37: 'left',
|
14287 |
-
38: 'up',
|
14288 |
-
39: 'right',
|
14289 |
-
40: 'down',
|
14290 |
-
45: 'ins',
|
14291 |
-
46: 'del',
|
14292 |
-
91: 'meta',
|
14293 |
-
93: 'meta',
|
14294 |
-
224: 'meta'
|
14295 |
-
};
|
14296 |
|
14297 |
-
|
14298 |
-
|
14299 |
-
|
14300 |
-
|
14301 |
-
* keyup or keydown event to one of these keys
|
14302 |
-
*
|
14303 |
-
* @type {Object}
|
14304 |
-
*/
|
14305 |
-
var _KEYCODE_MAP = {
|
14306 |
-
106: '*',
|
14307 |
-
107: '+',
|
14308 |
-
109: '-',
|
14309 |
-
110: '.',
|
14310 |
-
111 : '/',
|
14311 |
-
186: ';',
|
14312 |
-
187: '=',
|
14313 |
-
188: ',',
|
14314 |
-
189: '-',
|
14315 |
-
190: '.',
|
14316 |
-
191: '/',
|
14317 |
-
192: '`',
|
14318 |
-
219: '[',
|
14319 |
-
220: '\\',
|
14320 |
-
221: ']',
|
14321 |
-
222: '\''
|
14322 |
-
};
|
14323 |
|
14324 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
14325 |
* this is a mapping of keys that require shift on a US keypad
|
14326 |
* back to the non shift equivelents
|
14327 |
*
|
@@ -15293,7 +16636,7 @@ var __WEBPACK_AMD_DEFINE_RESULT__;/*global define:false */
|
|
15293 |
|
15294 |
|
15295 |
/***/ }),
|
15296 |
-
/*
|
15297 |
/***/ (function(module, exports) {
|
15298 |
|
15299 |
/**
|
@@ -15345,13 +16688,13 @@ var __WEBPACK_AMD_DEFINE_RESULT__;/*global define:false */
|
|
15345 |
|
15346 |
|
15347 |
/***/ }),
|
15348 |
-
/*
|
15349 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15350 |
|
15351 |
"use strict";
|
15352 |
/* harmony export (immutable) */ __webpack_exports__["a"] = useMediaQuery;
|
15353 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(
|
15354 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(
|
15355 |
|
15356 |
|
15357 |
/**
|
@@ -15366,7 +16709,7 @@ var __WEBPACK_AMD_DEFINE_RESULT__;/*global define:false */
|
|
15366 |
*/
|
15367 |
|
15368 |
function useMediaQuery(query) {
|
15369 |
-
var _useState = Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_element__["
|
15370 |
_useState2 = Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__["a" /* default */])(_useState, 2),
|
15371 |
match = _useState2[0],
|
15372 |
setMatch = _useState2[1];
|
@@ -15392,26 +16735,251 @@ function useMediaQuery(query) {
|
|
15392 |
//# sourceMappingURL=index.js.map
|
15393 |
|
15394 |
/***/ }),
|
15395 |
-
/*
|
15396 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15397 |
|
15398 |
"use strict";
|
15399 |
-
/* harmony
|
|
|
15400 |
/**
|
15401 |
* Internal dependencies
|
15402 |
*/
|
15403 |
|
15404 |
-
|
15405 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
15406 |
|
15407 |
/***/ }),
|
15408 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
15409 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15410 |
|
15411 |
"use strict";
|
15412 |
/* unused harmony export logged */
|
15413 |
/* harmony export (immutable) */ __webpack_exports__["a"] = deprecated;
|
15414 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_hooks__ = __webpack_require__(
|
15415 |
/**
|
15416 |
* WordPress dependencies
|
15417 |
*/
|
@@ -15489,7 +17057,7 @@ function deprecated(feature) {
|
|
15489 |
//# sourceMappingURL=index.js.map
|
15490 |
|
15491 |
/***/ }),
|
15492 |
-
/*
|
15493 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15494 |
|
15495 |
"use strict";
|
@@ -15528,15 +17096,15 @@ function validateHookName(hookName) {
|
|
15528 |
//# sourceMappingURL=validateHookName.js.map
|
15529 |
|
15530 |
/***/ }),
|
15531 |
-
/*
|
15532 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15533 |
|
15534 |
"use strict";
|
15535 |
/* unused harmony export concatChildren */
|
15536 |
/* unused harmony export switchChildrenNodeName */
|
15537 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
15538 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
15539 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_react__ = __webpack_require__(
|
15540 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_react__);
|
15541 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
15542 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
@@ -15797,57 +17365,83 @@ function switchChildrenNodeName(children, nodeName) {
|
|
15797 |
//# sourceMappingURL=react.js.map
|
15798 |
|
15799 |
/***/ }),
|
15800 |
-
/*
|
15801 |
-
/***/ (function(module,
|
15802 |
|
15803 |
"use strict";
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
15804 |
|
15805 |
|
15806 |
-
/**
|
15807 |
-
* Internal dependencies;
|
15808 |
-
*/
|
15809 |
-
var isShallowEqualObjects = __webpack_require__( 531 );
|
15810 |
-
var isShallowEqualArrays = __webpack_require__( 532 );
|
15811 |
|
15812 |
-
var isArray = Array.isArray;
|
15813 |
|
15814 |
-
/**
|
15815 |
-
* @typedef {Record<string, any>} ComparableObject
|
15816 |
-
*/
|
15817 |
|
15818 |
-
/**
|
15819 |
-
* Returns true if the two arrays or objects are shallow equal, or false
|
15820 |
-
* otherwise.
|
15821 |
-
*
|
15822 |
-
* @param {any[]|ComparableObject} a First object or array to compare.
|
15823 |
-
* @param {any[]|ComparableObject} b Second object or array to compare.
|
15824 |
-
*
|
15825 |
-
* @return {boolean} Whether the two values are shallow equal.
|
15826 |
-
*/
|
15827 |
-
function isShallowEqual( a, b ) {
|
15828 |
-
if ( a && b ) {
|
15829 |
-
if ( a.constructor === Object && b.constructor === Object ) {
|
15830 |
-
return isShallowEqualObjects( a, b );
|
15831 |
-
} else if ( isArray( a ) && isArray( b ) ) {
|
15832 |
-
return isShallowEqualArrays( a, b );
|
15833 |
-
}
|
15834 |
-
}
|
15835 |
|
15836 |
-
return a === b;
|
15837 |
-
}
|
15838 |
|
15839 |
-
module.exports = isShallowEqual;
|
15840 |
-
module.exports.isShallowEqualObjects = isShallowEqualObjects;
|
15841 |
-
module.exports.isShallowEqualArrays = isShallowEqualArrays;
|
15842 |
|
|
|
15843 |
|
15844 |
/***/ }),
|
15845 |
-
/*
|
15846 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15847 |
|
15848 |
"use strict";
|
15849 |
/* harmony export (immutable) */ __webpack_exports__["a"] = useMediaQuery;
|
15850 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(
|
15851 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(15);
|
15852 |
|
15853 |
|
@@ -15889,16 +17483,18 @@ function useMediaQuery(query) {
|
|
15889 |
//# sourceMappingURL=index.js.map
|
15890 |
|
15891 |
/***/ }),
|
15892 |
-
/*
|
15893 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15894 |
|
15895 |
"use strict";
|
15896 |
/* harmony export (immutable) */ __webpack_exports__["a"] = isFormatEqual;
|
|
|
|
|
15897 |
/**
|
15898 |
* Optimised equality check for format objects.
|
15899 |
*
|
15900 |
-
* @param {?
|
15901 |
-
* @param {?
|
15902 |
*
|
15903 |
* @return {boolean} True if formats are equal, false if not.
|
15904 |
*/
|
@@ -15951,7 +17547,7 @@ function isFormatEqual(format1, format2) {
|
|
15951 |
//# sourceMappingURL=is-format-equal.js.map
|
15952 |
|
15953 |
/***/ }),
|
15954 |
-
/*
|
15955 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15956 |
|
15957 |
"use strict";
|
@@ -15985,14 +17581,14 @@ function createElement(_ref, html) {
|
|
15985 |
//# sourceMappingURL=create-element.js.map
|
15986 |
|
15987 |
/***/ }),
|
15988 |
-
/*
|
15989 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15990 |
|
15991 |
"use strict";
|
15992 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getActiveFormat;
|
15993 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash__ = __webpack_require__(2);
|
15994 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_lodash__);
|
15995 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__get_active_formats__ = __webpack_require__(
|
15996 |
/**
|
15997 |
* External dependencies
|
15998 |
*/
|
@@ -16002,16 +17598,21 @@ function createElement(_ref, html) {
|
|
16002 |
*/
|
16003 |
|
16004 |
|
|
|
|
|
|
|
|
|
16005 |
/**
|
16006 |
* Gets the format object by type at the start of the selection. This can be
|
16007 |
* used to get e.g. the URL of a link format at the current selection, but also
|
16008 |
* to check if a format is active at the selection. Returns undefined if there
|
16009 |
* is no format at the selection.
|
16010 |
*
|
16011 |
-
* @param {
|
16012 |
-
* @param {string}
|
16013 |
*
|
16014 |
-
* @return {
|
|
|
16015 |
*/
|
16016 |
|
16017 |
function getActiveFormat(value, formatType) {
|
@@ -16022,19 +17623,23 @@ function getActiveFormat(value, formatType) {
|
|
16022 |
//# sourceMappingURL=get-active-format.js.map
|
16023 |
|
16024 |
/***/ }),
|
16025 |
-
/*
|
16026 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
16027 |
|
16028 |
"use strict";
|
16029 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getActiveFormats;
|
|
|
|
|
|
|
|
|
16030 |
/**
|
16031 |
* Gets the all format objects at the start of the selection.
|
16032 |
*
|
16033 |
-
* @param {
|
16034 |
-
* @param {Array}
|
16035 |
-
*
|
16036 |
*
|
16037 |
-
* @return {
|
16038 |
*/
|
16039 |
function getActiveFormats(_ref) {
|
16040 |
var formats = _ref.formats,
|
@@ -16070,18 +17675,20 @@ function getActiveFormats(_ref) {
|
|
16070 |
//# sourceMappingURL=get-active-formats.js.map
|
16071 |
|
16072 |
/***/ }),
|
16073 |
-
/*
|
16074 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
16075 |
|
16076 |
"use strict";
|
16077 |
/* harmony export (immutable) */ __webpack_exports__["a"] = isCollapsed;
|
|
|
|
|
16078 |
/**
|
16079 |
* Check if the selection of a Rich Text value is collapsed or not. Collapsed
|
16080 |
* means that no characters are selected, but there is a caret present. If there
|
16081 |
* is no selection, `undefined` will be returned. This is similar to
|
16082 |
* `window.getSelection().isCollapsed()`.
|
16083 |
*
|
16084 |
-
* @param {
|
16085 |
*
|
16086 |
* @return {boolean|undefined} True if the selection is collapsed, false if not,
|
16087 |
* undefined if there is no selection.
|
@@ -16099,15 +17706,15 @@ function isCollapsed(_ref) {
|
|
16099 |
//# sourceMappingURL=is-collapsed.js.map
|
16100 |
|
16101 |
/***/ }),
|
16102 |
-
/*
|
16103 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
16104 |
|
16105 |
"use strict";
|
16106 |
/* harmony export (immutable) */ __webpack_exports__["a"] = removeFormat;
|
16107 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
16108 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
16109 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
16110 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__normalise_formats__ = __webpack_require__(
|
16111 |
|
16112 |
|
16113 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
@@ -16123,17 +17730,19 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
16123 |
*/
|
16124 |
|
16125 |
|
|
|
|
|
16126 |
/**
|
16127 |
* Remove any format object from a Rich Text value by type from the given
|
16128 |
* `startIndex` to the given `endIndex`. Indices are retrieved from the
|
16129 |
* selection if none are provided.
|
16130 |
*
|
16131 |
-
* @param {
|
16132 |
-
* @param {string}
|
16133 |
-
* @param {number}
|
16134 |
-
* @param {number}
|
16135 |
*
|
16136 |
-
* @return {
|
16137 |
*/
|
16138 |
|
16139 |
function removeFormat(value, formatType) {
|
@@ -16170,7 +17779,7 @@ function removeFormat(value, formatType) {
|
|
16170 |
}
|
16171 |
}
|
16172 |
|
16173 |
-
return Object(__WEBPACK_IMPORTED_MODULE_2__normalise_formats__["a" /* normaliseFormats */])(_objectSpread({}, value, {
|
16174 |
formats: newFormats,
|
16175 |
activeFormats: Object(__WEBPACK_IMPORTED_MODULE_1_lodash__["reject"])(activeFormats, {
|
16176 |
type: formatType
|
@@ -16193,27 +17802,29 @@ function filterFormats(formats, index, formatType) {
|
|
16193 |
//# sourceMappingURL=remove-format.js.map
|
16194 |
|
16195 |
/***/ }),
|
16196 |
-
/*
|
16197 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
16198 |
|
16199 |
"use strict";
|
16200 |
/* harmony export (immutable) */ __webpack_exports__["a"] = remove;
|
16201 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__insert__ = __webpack_require__(
|
16202 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__create__ = __webpack_require__(
|
16203 |
/**
|
16204 |
* Internal dependencies
|
16205 |
*/
|
16206 |
|
16207 |
|
|
|
|
|
16208 |
/**
|
16209 |
* Remove content from a Rich Text value between the given `startIndex` and
|
16210 |
* `endIndex`. Indices are retrieved from the selection if none are provided.
|
16211 |
*
|
16212 |
-
* @param {
|
16213 |
-
* @param {number}
|
16214 |
-
* @param {number}
|
16215 |
*
|
16216 |
-
* @return {
|
16217 |
*/
|
16218 |
|
16219 |
function remove(value, startIndex, endIndex) {
|
@@ -16222,7 +17833,7 @@ function remove(value, startIndex, endIndex) {
|
|
16222 |
//# sourceMappingURL=remove.js.map
|
16223 |
|
16224 |
/***/ }),
|
16225 |
-
/*
|
16226 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
16227 |
|
16228 |
"use strict";
|
@@ -16316,7 +17927,7 @@ function remove(value, startIndex, endIndex) {
|
|
16316 |
//# sourceMappingURL=index.js.map
|
16317 |
|
16318 |
/***/ }),
|
16319 |
-
/*
|
16320 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
16321 |
|
16322 |
"use strict";
|
@@ -16325,11 +17936,11 @@ function remove(value, startIndex, endIndex) {
|
|
16325 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
16326 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
16327 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
16328 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
16329 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_element__ = __webpack_require__(1);
|
16330 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_compose__ = __webpack_require__(18);
|
16331 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__wordpress_keycodes__ = __webpack_require__(
|
16332 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__wordpress_dom__ = __webpack_require__(
|
16333 |
|
16334 |
|
16335 |
|
@@ -16417,7 +18028,7 @@ var withConstrainedTabbing = Object(__WEBPACK_IMPORTED_MODULE_7__wordpress_compo
|
|
16417 |
//# sourceMappingURL=index.js.map
|
16418 |
|
16419 |
/***/ }),
|
16420 |
-
/*
|
16421 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
16422 |
|
16423 |
"use strict";
|
@@ -16429,8 +18040,8 @@ var withConstrainedTabbing = Object(__WEBPACK_IMPORTED_MODULE_7__wordpress_compo
|
|
16429 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_element__ = __webpack_require__(1);
|
16430 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_lodash__ = __webpack_require__(2);
|
16431 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6_lodash__);
|
16432 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__popover__ = __webpack_require__(
|
16433 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__shortcut__ = __webpack_require__(
|
16434 |
|
16435 |
|
16436 |
|
@@ -16588,7 +18199,7 @@ function (_Component) {
|
|
16588 |
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(20)))
|
16589 |
|
16590 |
/***/ }),
|
16591 |
-
/*
|
16592 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
16593 |
|
16594 |
"use strict";
|
@@ -16599,7 +18210,7 @@ function (_Component) {
|
|
16599 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
16600 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
16601 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
16602 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
16603 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__wordpress_element__ = __webpack_require__(1);
|
16604 |
|
16605 |
|
@@ -16660,18 +18271,18 @@ function (_Component) {
|
|
16660 |
//# sourceMappingURL=index.js.map
|
16661 |
|
16662 |
/***/ }),
|
16663 |
-
/*
|
16664 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
16665 |
|
16666 |
"use strict";
|
16667 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Consumer; });
|
16668 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
16669 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
16670 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
16671 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
16672 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
16673 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
16674 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
16675 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(1);
|
16676 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
16677 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
@@ -16813,7 +18424,7 @@ function (_Component) {
|
|
16813 |
//# sourceMappingURL=context.js.map
|
16814 |
|
16815 |
/***/ }),
|
16816 |
-
/*
|
16817 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
16818 |
|
16819 |
"use strict";
|
@@ -16823,11 +18434,11 @@ function (_Component) {
|
|
16823 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
16824 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
16825 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
16826 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
16827 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(1);
|
16828 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
16829 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
16830 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__wordpress_a11y__ = __webpack_require__(
|
16831 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__wordpress_compose__ = __webpack_require__(18);
|
16832 |
|
16833 |
|
@@ -16903,7 +18514,48 @@ function (_Component) {
|
|
16903 |
//# sourceMappingURL=index.js.map
|
16904 |
|
16905 |
/***/ }),
|
16906 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
16907 |
/***/ (function(module, exports, __webpack_require__) {
|
16908 |
|
16909 |
"use strict";
|
@@ -16913,10 +18565,10 @@ var GetIntrinsic = __webpack_require__(19);
|
|
16913 |
|
16914 |
var $TypeError = GetIntrinsic('%TypeError%');
|
16915 |
|
16916 |
-
var inspect = __webpack_require__(
|
16917 |
|
16918 |
-
var IsPropertyKey = __webpack_require__(
|
16919 |
-
var Type = __webpack_require__(
|
16920 |
|
16921 |
/**
|
16922 |
* 7.3.1 Get (O, P) - https://ecma-international.org/ecma-262/6.0/#sec-get-o-p
|
@@ -16940,7 +18592,7 @@ module.exports = function Get(O, P) {
|
|
16940 |
|
16941 |
|
16942 |
/***/ }),
|
16943 |
-
/*
|
16944 |
/***/ (function(module, exports, __webpack_require__) {
|
16945 |
|
16946 |
"use strict";
|
@@ -16951,7 +18603,7 @@ var GetIntrinsic = __webpack_require__(19);
|
|
16951 |
var $Array = GetIntrinsic('%Array%');
|
16952 |
|
16953 |
// eslint-disable-next-line global-require
|
16954 |
-
var toStr = !$Array.isArray && __webpack_require__(
|
16955 |
|
16956 |
// https://www.ecma-international.org/ecma-262/6.0/#sec-isarray
|
16957 |
|
@@ -16961,38 +18613,74 @@ module.exports = $Array.isArray || function IsArray(argument) {
|
|
16961 |
|
16962 |
|
16963 |
/***/ }),
|
16964 |
-
/*
|
16965 |
/***/ (function(module, exports, __webpack_require__) {
|
16966 |
|
16967 |
"use strict";
|
16968 |
|
16969 |
|
16970 |
-
|
16971 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
16972 |
};
|
16973 |
|
16974 |
|
16975 |
/***/ }),
|
16976 |
-
/*
|
16977 |
/***/ (function(module, exports, __webpack_require__) {
|
16978 |
|
16979 |
"use strict";
|
16980 |
|
16981 |
|
16982 |
-
|
16983 |
-
|
16984 |
-
var ToInteger = __webpack_require__(202);
|
16985 |
-
|
16986 |
-
module.exports = function ToLength(argument) {
|
16987 |
-
var len = ToInteger(argument);
|
16988 |
-
if (len <= 0) { return 0; } // includes converting -0 to +0
|
16989 |
-
if (len > MAX_SAFE_INTEGER) { return MAX_SAFE_INTEGER; }
|
16990 |
-
return len;
|
16991 |
};
|
16992 |
|
16993 |
|
16994 |
/***/ }),
|
16995 |
-
/*
|
16996 |
/***/ (function(module, exports, __webpack_require__) {
|
16997 |
|
16998 |
"use strict";
|
@@ -17007,11 +18695,11 @@ var _extends = Object.assign || function (target) { for (var i = 1; i < argument
|
|
17007 |
|
17008 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
17009 |
|
17010 |
-
var _object = __webpack_require__(
|
17011 |
|
17012 |
var _object2 = _interopRequireDefault(_object);
|
17013 |
|
17014 |
-
var _react = __webpack_require__(
|
17015 |
|
17016 |
var _react2 = _interopRequireDefault(_react);
|
17017 |
|
@@ -17019,33 +18707,33 @@ var _propTypes = __webpack_require__(11);
|
|
17019 |
|
17020 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
17021 |
|
17022 |
-
var _reactAddonsShallowCompare = __webpack_require__(
|
17023 |
|
17024 |
var _reactAddonsShallowCompare2 = _interopRequireDefault(_reactAddonsShallowCompare);
|
17025 |
|
17026 |
-
var _reactMomentProptypes = __webpack_require__(
|
17027 |
|
17028 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
17029 |
|
17030 |
-
var _airbnbPropTypes = __webpack_require__(
|
17031 |
|
17032 |
-
var _reactWithStyles = __webpack_require__(
|
17033 |
|
17034 |
var _moment = __webpack_require__(0);
|
17035 |
|
17036 |
var _moment2 = _interopRequireDefault(_moment);
|
17037 |
|
17038 |
-
var _defaultPhrases = __webpack_require__(
|
17039 |
|
17040 |
-
var _getPhrasePropTypes = __webpack_require__(
|
17041 |
|
17042 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
17043 |
|
17044 |
-
var _getCalendarDaySettings = __webpack_require__(
|
17045 |
|
17046 |
var _getCalendarDaySettings2 = _interopRequireDefault(_getCalendarDaySettings);
|
17047 |
|
17048 |
-
var _ModifiersShape = __webpack_require__(
|
17049 |
|
17050 |
var _ModifiersShape2 = _interopRequireDefault(_ModifiersShape);
|
17051 |
|
@@ -17474,7 +19162,48 @@ exports['default'] = (0, _reactWithStyles.withStyles)(function (_ref2) {
|
|
17474 |
})(CalendarDay);
|
17475 |
|
17476 |
/***/ }),
|
17477 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
17478 |
/***/ (function(module, exports, __webpack_require__) {
|
17479 |
|
17480 |
"use strict";
|
@@ -17485,29 +19214,33 @@ Object.defineProperty(exports, "__esModule", {
|
|
17485 |
});
|
17486 |
exports["default"] = betweenValidator;
|
17487 |
|
17488 |
-
var _object = _interopRequireDefault(__webpack_require__(
|
17489 |
|
17490 |
-
var _shape = _interopRequireDefault(__webpack_require__(
|
17491 |
|
17492 |
-
var _valuesOf = _interopRequireDefault(__webpack_require__(
|
17493 |
|
17494 |
var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
17495 |
|
17496 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
17497 |
|
17498 |
-
function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }
|
17499 |
|
17500 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
17501 |
|
17502 |
-
function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }
|
17503 |
|
17504 |
function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }
|
17505 |
|
17506 |
-
function _slicedToArray(arr, i) { return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _nonIterableRest(); }
|
|
|
|
|
17507 |
|
17508 |
-
function
|
17509 |
|
17510 |
-
function
|
|
|
|
|
17511 |
|
17512 |
function _arrayWithHoles(arr) { if (Array.isArray(arr)) return arr; }
|
17513 |
|
@@ -17609,7 +19342,7 @@ function propsThunkify(opts) {
|
|
17609 |
var numberThunk = typeof value === 'number' ? function () {
|
17610 |
return value;
|
17611 |
} : value;
|
17612 |
-
return _objectSpread({}, acc, _defineProperty({}, key, numberThunk));
|
17613 |
}, {});
|
17614 |
}
|
17615 |
|
@@ -17620,7 +19353,7 @@ function invokeWithProps(optsThunks, props) {
|
|
17620 |
thunk = _ref8[1];
|
17621 |
|
17622 |
var value = thunk(props);
|
17623 |
-
return _objectSpread({}, acc, _defineProperty({}, key, value));
|
17624 |
}, {});
|
17625 |
}
|
17626 |
|
@@ -17726,7 +19459,239 @@ function betweenValidator(options) {
|
|
17726 |
//# sourceMappingURL=between.js.map
|
17727 |
|
17728 |
/***/ }),
|
17729 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
17730 |
/***/ (function(module, exports, __webpack_require__) {
|
17731 |
|
17732 |
"use strict";
|
@@ -17737,7 +19702,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
17737 |
});
|
17738 |
exports["default"] = shapeValidator;
|
17739 |
|
17740 |
-
var _isPlainObject = _interopRequireDefault(__webpack_require__(
|
17741 |
|
17742 |
var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
17743 |
|
@@ -17795,7 +19760,7 @@ function shapeValidator(shapeTypes) {
|
|
17795 |
//# sourceMappingURL=shape.js.map
|
17796 |
|
17797 |
/***/ }),
|
17798 |
-
/*
|
17799 |
/***/ (function(module, exports, __webpack_require__) {
|
17800 |
|
17801 |
"use strict";
|
@@ -17806,7 +19771,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
17806 |
});
|
17807 |
exports["default"] = void 0;
|
17808 |
|
17809 |
-
var _isPlainObject = _interopRequireDefault(__webpack_require__(
|
17810 |
|
17811 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
17812 |
|
@@ -17815,7 +19780,7 @@ exports["default"] = _default;
|
|
17815 |
//# sourceMappingURL=isPlainObject.js.map
|
17816 |
|
17817 |
/***/ }),
|
17818 |
-
/*
|
17819 |
/***/ (function(module, exports, __webpack_require__) {
|
17820 |
|
17821 |
"use strict";
|
@@ -17826,7 +19791,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
17826 |
});
|
17827 |
exports["default"] = renderableChildren;
|
17828 |
|
17829 |
-
var _react = _interopRequireDefault(__webpack_require__(
|
17830 |
|
17831 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
17832 |
|
@@ -17838,7 +19803,7 @@ function renderableChildren(childrenProp) {
|
|
17838 |
//# sourceMappingURL=renderableChildren.js.map
|
17839 |
|
17840 |
/***/ }),
|
17841 |
-
/*
|
17842 |
/***/ (function(module, exports, __webpack_require__) {
|
17843 |
|
17844 |
"use strict";
|
@@ -17849,9 +19814,9 @@ Object.defineProperty(exports, "__esModule", {
|
|
17849 |
});
|
17850 |
exports["default"] = getComponentName;
|
17851 |
|
17852 |
-
var _functionPrototype = _interopRequireDefault(__webpack_require__(
|
17853 |
|
17854 |
-
var _reactIs = __webpack_require__(
|
17855 |
|
17856 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
17857 |
|
@@ -17880,7 +19845,7 @@ function getComponentName(Component) {
|
|
17880 |
//# sourceMappingURL=getComponentName.js.map
|
17881 |
|
17882 |
/***/ }),
|
17883 |
-
/*
|
17884 |
/***/ (function(module, exports, __webpack_require__) {
|
17885 |
|
17886 |
"use strict";
|
@@ -17891,7 +19856,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
17891 |
});
|
17892 |
exports["default"] = void 0;
|
17893 |
|
17894 |
-
var _isInteger = _interopRequireDefault(__webpack_require__(
|
17895 |
|
17896 |
var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
17897 |
|
@@ -17931,7 +19896,7 @@ exports["default"] = _default;
|
|
17931 |
//# sourceMappingURL=integer.js.map
|
17932 |
|
17933 |
/***/ }),
|
17934 |
-
/*
|
17935 |
/***/ (function(module, exports, __webpack_require__) {
|
17936 |
|
17937 |
"use strict";
|
@@ -17942,9 +19907,9 @@ Object.defineProperty(exports, "__esModule", {
|
|
17942 |
});
|
17943 |
exports["default"] = withShape;
|
17944 |
|
17945 |
-
var _and = _interopRequireDefault(__webpack_require__(
|
17946 |
|
17947 |
-
var _shape = _interopRequireDefault(__webpack_require__(
|
17948 |
|
17949 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
17950 |
|
@@ -17959,25 +19924,25 @@ function withShape(type, shapeTypes) {
|
|
17959 |
//# sourceMappingURL=withShape.js.map
|
17960 |
|
17961 |
/***/ }),
|
17962 |
-
/*
|
17963 |
/***/ (function(module, exports, __webpack_require__) {
|
17964 |
|
17965 |
// eslint-disable-next-line import/no-unresolved
|
17966 |
-
module.exports = __webpack_require__(
|
17967 |
|
17968 |
|
17969 |
/***/ }),
|
17970 |
-
/*
|
17971 |
/***/ (function(module, exports, __webpack_require__) {
|
17972 |
|
17973 |
"use strict";
|
17974 |
|
17975 |
|
17976 |
-
var define = __webpack_require__(
|
17977 |
|
17978 |
-
var implementation = __webpack_require__(
|
17979 |
-
var getPolyfill = __webpack_require__(
|
17980 |
-
var shim = __webpack_require__(
|
17981 |
|
17982 |
var polyfill = getPolyfill();
|
17983 |
|
@@ -17991,7 +19956,239 @@ module.exports = polyfill;
|
|
17991 |
|
17992 |
|
17993 |
/***/ }),
|
17994 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
17995 |
/***/ (function(module, exports, __webpack_require__) {
|
17996 |
|
17997 |
"use strict";
|
@@ -18056,7 +20253,7 @@ function getInputHeight(_ref, small) {
|
|
18056 |
}
|
18057 |
|
18058 |
/***/ }),
|
18059 |
-
/*
|
18060 |
/***/ (function(module, exports) {
|
18061 |
|
18062 |
/**
|
@@ -18093,7 +20290,7 @@ module.exports = isObject;
|
|
18093 |
|
18094 |
|
18095 |
/***/ }),
|
18096 |
-
/*
|
18097 |
/***/ (function(module, exports, __webpack_require__) {
|
18098 |
|
18099 |
"use strict";
|
@@ -18108,7 +20305,7 @@ var _moment = __webpack_require__(0);
|
|
18108 |
|
18109 |
var _moment2 = _interopRequireDefault(_moment);
|
18110 |
|
18111 |
-
var _toMomentObject = __webpack_require__(
|
18112 |
|
18113 |
var _toMomentObject2 = _interopRequireDefault(_toMomentObject);
|
18114 |
|
@@ -18124,7 +20321,7 @@ function toLocalizedDateString(date, currentFormat) {
|
|
18124 |
}
|
18125 |
|
18126 |
/***/ }),
|
18127 |
-
/*
|
18128 |
/***/ (function(module, exports, __webpack_require__) {
|
18129 |
|
18130 |
"use strict";
|
@@ -18135,11 +20332,11 @@ Object.defineProperty(exports, "__esModule", {
|
|
18135 |
});
|
18136 |
exports['default'] = isDayVisible;
|
18137 |
|
18138 |
-
var _isBeforeDay = __webpack_require__(
|
18139 |
|
18140 |
var _isBeforeDay2 = _interopRequireDefault(_isBeforeDay);
|
18141 |
|
18142 |
-
var _isAfterDay = __webpack_require__(
|
18143 |
|
18144 |
var _isAfterDay2 = _interopRequireDefault(_isAfterDay);
|
18145 |
|
@@ -18156,7 +20353,7 @@ function isDayVisible(day, month, numberOfMonths, enableOutsideDays) {
|
|
18156 |
}
|
18157 |
|
18158 |
/***/ }),
|
18159 |
-
/*
|
18160 |
/***/ (function(module, exports, __webpack_require__) {
|
18161 |
|
18162 |
"use strict";
|
@@ -18171,11 +20368,11 @@ var _extends = Object.assign || function (target) { for (var i = 1; i < argument
|
|
18171 |
|
18172 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
18173 |
|
18174 |
-
var _object = __webpack_require__(
|
18175 |
|
18176 |
var _object2 = _interopRequireDefault(_object);
|
18177 |
|
18178 |
-
var _react = __webpack_require__(
|
18179 |
|
18180 |
var _react2 = _interopRequireDefault(_react);
|
18181 |
|
@@ -18183,81 +20380,81 @@ var _propTypes = __webpack_require__(11);
|
|
18183 |
|
18184 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
18185 |
|
18186 |
-
var _reactAddonsShallowCompare = __webpack_require__(
|
18187 |
|
18188 |
var _reactAddonsShallowCompare2 = _interopRequireDefault(_reactAddonsShallowCompare);
|
18189 |
|
18190 |
-
var _airbnbPropTypes = __webpack_require__(
|
18191 |
|
18192 |
-
var _reactWithStyles = __webpack_require__(
|
18193 |
|
18194 |
var _moment = __webpack_require__(0);
|
18195 |
|
18196 |
var _moment2 = _interopRequireDefault(_moment);
|
18197 |
|
18198 |
-
var _throttle = __webpack_require__(
|
18199 |
|
18200 |
var _throttle2 = _interopRequireDefault(_throttle);
|
18201 |
|
18202 |
-
var _isTouchDevice = __webpack_require__(
|
18203 |
|
18204 |
var _isTouchDevice2 = _interopRequireDefault(_isTouchDevice);
|
18205 |
|
18206 |
-
var _reactOutsideClickHandler = __webpack_require__(
|
18207 |
|
18208 |
var _reactOutsideClickHandler2 = _interopRequireDefault(_reactOutsideClickHandler);
|
18209 |
|
18210 |
-
var _defaultPhrases = __webpack_require__(
|
18211 |
|
18212 |
-
var _getPhrasePropTypes = __webpack_require__(
|
18213 |
|
18214 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
18215 |
|
18216 |
-
var _CalendarMonthGrid = __webpack_require__(
|
18217 |
|
18218 |
var _CalendarMonthGrid2 = _interopRequireDefault(_CalendarMonthGrid);
|
18219 |
|
18220 |
-
var _DayPickerNavigation = __webpack_require__(
|
18221 |
|
18222 |
var _DayPickerNavigation2 = _interopRequireDefault(_DayPickerNavigation);
|
18223 |
|
18224 |
-
var _DayPickerKeyboardShortcuts = __webpack_require__(
|
18225 |
|
18226 |
var _DayPickerKeyboardShortcuts2 = _interopRequireDefault(_DayPickerKeyboardShortcuts);
|
18227 |
|
18228 |
-
var _getNumberOfCalendarMonthWeeks = __webpack_require__(
|
18229 |
|
18230 |
var _getNumberOfCalendarMonthWeeks2 = _interopRequireDefault(_getNumberOfCalendarMonthWeeks);
|
18231 |
|
18232 |
-
var _getCalendarMonthWidth = __webpack_require__(
|
18233 |
|
18234 |
var _getCalendarMonthWidth2 = _interopRequireDefault(_getCalendarMonthWidth);
|
18235 |
|
18236 |
-
var _calculateDimension = __webpack_require__(
|
18237 |
|
18238 |
var _calculateDimension2 = _interopRequireDefault(_calculateDimension);
|
18239 |
|
18240 |
-
var _getActiveElement = __webpack_require__(
|
18241 |
|
18242 |
var _getActiveElement2 = _interopRequireDefault(_getActiveElement);
|
18243 |
|
18244 |
-
var _isDayVisible = __webpack_require__(
|
18245 |
|
18246 |
var _isDayVisible2 = _interopRequireDefault(_isDayVisible);
|
18247 |
|
18248 |
-
var _ModifiersShape = __webpack_require__(
|
18249 |
|
18250 |
var _ModifiersShape2 = _interopRequireDefault(_ModifiersShape);
|
18251 |
|
18252 |
-
var _ScrollableOrientationShape = __webpack_require__(
|
18253 |
|
18254 |
var _ScrollableOrientationShape2 = _interopRequireDefault(_ScrollableOrientationShape);
|
18255 |
|
18256 |
-
var _DayOfWeekShape = __webpack_require__(
|
18257 |
|
18258 |
var _DayOfWeekShape2 = _interopRequireDefault(_DayOfWeekShape);
|
18259 |
|
18260 |
-
var _CalendarInfoPositionShape = __webpack_require__(
|
18261 |
|
18262 |
var _CalendarInfoPositionShape2 = _interopRequireDefault(_CalendarInfoPositionShape);
|
18263 |
|
@@ -19738,85 +21935,15 @@ exports['default'] = (0, _reactWithStyles.withStyles)(function (_ref2) {
|
|
19738 |
})(DayPicker);
|
19739 |
|
19740 |
/***/ }),
|
19741 |
-
/*
|
19742 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
19743 |
-
|
19744 |
-
"use strict";
|
19745 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__is_url__ = __webpack_require__(769);
|
19746 |
-
/* unused harmony reexport isURL */
|
19747 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__is_email__ = __webpack_require__(415);
|
19748 |
-
/* unused harmony reexport isEmail */
|
19749 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__get_protocol__ = __webpack_require__(770);
|
19750 |
-
/* unused harmony reexport getProtocol */
|
19751 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__is_valid_protocol__ = __webpack_require__(771);
|
19752 |
-
/* unused harmony reexport isValidProtocol */
|
19753 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__get_authority__ = __webpack_require__(772);
|
19754 |
-
/* unused harmony reexport getAuthority */
|
19755 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__is_valid_authority__ = __webpack_require__(773);
|
19756 |
-
/* unused harmony reexport isValidAuthority */
|
19757 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__get_path__ = __webpack_require__(774);
|
19758 |
-
/* unused harmony reexport getPath */
|
19759 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__is_valid_path__ = __webpack_require__(775);
|
19760 |
-
/* unused harmony reexport isValidPath */
|
19761 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__get_query_string__ = __webpack_require__(776);
|
19762 |
-
/* unused harmony reexport getQueryString */
|
19763 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__is_valid_query_string__ = __webpack_require__(777);
|
19764 |
-
/* unused harmony reexport isValidQueryString */
|
19765 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__get_fragment__ = __webpack_require__(778);
|
19766 |
-
/* unused harmony reexport getFragment */
|
19767 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__is_valid_fragment__ = __webpack_require__(779);
|
19768 |
-
/* unused harmony reexport isValidFragment */
|
19769 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__add_query_args__ = __webpack_require__(780);
|
19770 |
-
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_12__add_query_args__["a"]; });
|
19771 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__get_query_arg__ = __webpack_require__(417);
|
19772 |
-
/* unused harmony reexport getQueryArg */
|
19773 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__has_query_arg__ = __webpack_require__(783);
|
19774 |
-
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_14__has_query_arg__["a"]; });
|
19775 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__remove_query_args__ = __webpack_require__(784);
|
19776 |
-
/* unused harmony reexport removeQueryArgs */
|
19777 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__prepend_http__ = __webpack_require__(785);
|
19778 |
-
/* unused harmony reexport prependHTTP */
|
19779 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__safe_decode_uri__ = __webpack_require__(786);
|
19780 |
-
/* unused harmony reexport safeDecodeURI */
|
19781 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__safe_decode_uri_component__ = __webpack_require__(787);
|
19782 |
-
/* unused harmony reexport safeDecodeURIComponent */
|
19783 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__filter_url_for_display__ = __webpack_require__(788);
|
19784 |
-
/* unused harmony reexport filterURLForDisplay */
|
19785 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__clean_for_slug__ = __webpack_require__(789);
|
19786 |
-
/* unused harmony reexport cleanForSlug */
|
19787 |
-
|
19788 |
-
|
19789 |
-
|
19790 |
-
|
19791 |
-
|
19792 |
-
|
19793 |
-
|
19794 |
-
|
19795 |
-
|
19796 |
-
|
19797 |
-
|
19798 |
-
|
19799 |
-
|
19800 |
-
|
19801 |
-
|
19802 |
-
|
19803 |
-
|
19804 |
-
|
19805 |
-
|
19806 |
-
|
19807 |
-
|
19808 |
-
//# sourceMappingURL=index.js.map
|
19809 |
-
|
19810 |
-
/***/ }),
|
19811 |
-
/* 140 */
|
19812 |
/***/ (function(module, exports, __webpack_require__) {
|
19813 |
|
19814 |
"use strict";
|
19815 |
|
19816 |
|
19817 |
-
var stringify = __webpack_require__(
|
19818 |
-
var parse = __webpack_require__(
|
19819 |
-
var formats = __webpack_require__(
|
19820 |
|
19821 |
module.exports = {
|
19822 |
formats: formats,
|
@@ -19826,7 +21953,7 @@ module.exports = {
|
|
19826 |
|
19827 |
|
19828 |
/***/ }),
|
19829 |
-
/*
|
19830 |
/***/ (function(module, exports, __webpack_require__) {
|
19831 |
|
19832 |
"use strict";
|
@@ -20081,29 +22208,29 @@ module.exports = {
|
|
20081 |
|
20082 |
|
20083 |
/***/ }),
|
20084 |
-
/*
|
20085 |
/***/ (function(module, exports, __webpack_require__) {
|
20086 |
|
20087 |
"use strict";
|
20088 |
/* WEBPACK VAR INJECTION */(function(process) {
|
20089 |
|
20090 |
if (process.env.NODE_ENV === 'production') {
|
20091 |
-
module.exports = __webpack_require__(
|
20092 |
} else {
|
20093 |
-
module.exports = __webpack_require__(
|
20094 |
}
|
20095 |
|
20096 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
20097 |
|
20098 |
/***/ }),
|
20099 |
-
/*
|
20100 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
20101 |
|
20102 |
"use strict";
|
20103 |
/* harmony export (immutable) */ __webpack_exports__["a"] = RawHTML;
|
20104 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(
|
20105 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
20106 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__react__ = __webpack_require__(
|
20107 |
|
20108 |
|
20109 |
|
@@ -20137,7 +22264,7 @@ function RawHTML(_ref) {
|
|
20137 |
//# sourceMappingURL=raw-html.js.map
|
20138 |
|
20139 |
/***/ }),
|
20140 |
-
/*
|
20141 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
20142 |
|
20143 |
"use strict";
|
@@ -20153,30 +22280,30 @@ function _arrayLikeToArray(arr, len) {
|
|
20153 |
}
|
20154 |
|
20155 |
/***/ }),
|
20156 |
-
/*
|
20157 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
20158 |
|
20159 |
"use strict";
|
20160 |
/* harmony export (immutable) */ __webpack_exports__["a"] = _unsupportedIterableToArray;
|
20161 |
-
/* harmony import */ var
|
20162 |
|
20163 |
function _unsupportedIterableToArray(o, minLen) {
|
20164 |
if (!o) return;
|
20165 |
-
if (typeof o === "string") return Object(
|
20166 |
var n = Object.prototype.toString.call(o).slice(8, -1);
|
20167 |
if (n === "Object" && o.constructor) n = o.constructor.name;
|
20168 |
if (n === "Map" || n === "Set") return Array.from(o);
|
20169 |
-
if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return Object(
|
20170 |
}
|
20171 |
|
20172 |
/***/ }),
|
20173 |
-
/*
|
20174 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
20175 |
|
20176 |
"use strict";
|
20177 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return createI18n; });
|
20178 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
20179 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_tannin__ = __webpack_require__(
|
20180 |
|
20181 |
|
20182 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
@@ -20248,10 +22375,10 @@ var createI18n = function createI18n(initialData, initialDomain) {
|
|
20248 |
|
20249 |
var setLocaleData = function setLocaleData(data) {
|
20250 |
var domain = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'default';
|
20251 |
-
tannin.data[domain] = _objectSpread({}, DEFAULT_LOCALE_DATA,
|
20252 |
// a plural forms expression).
|
20253 |
|
20254 |
-
tannin.data[domain][''] = _objectSpread({}, DEFAULT_LOCALE_DATA[''],
|
20255 |
};
|
20256 |
/**
|
20257 |
* Wrapper for Tannin's `dcnpgettext`. Populates default locale data if not
|
@@ -20385,12 +22512,12 @@ var createI18n = function createI18n(initialData, initialDomain) {
|
|
20385 |
//# sourceMappingURL=create-i18n.js.map
|
20386 |
|
20387 |
/***/ }),
|
20388 |
-
/*
|
20389 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
20390 |
|
20391 |
"use strict";
|
20392 |
/* harmony export (immutable) */ __webpack_exports__["a"] = RawHTML;
|
20393 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
20394 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
20395 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__react__ = __webpack_require__(97);
|
20396 |
|
@@ -20405,12 +22532,8 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
20405 |
*/
|
20406 |
// Disable reason: JSDoc linter doesn't seem to parse the union (`&`) correctly.
|
20407 |
|
20408 |
-
/* eslint-disable jsdoc/valid-types */
|
20409 |
-
|
20410 |
/** @typedef {{children: string} & import('react').ComponentPropsWithoutRef<'div'>} RawHTMLProps */
|
20411 |
|
20412 |
-
/* eslint-enable jsdoc/valid-types */
|
20413 |
-
|
20414 |
/**
|
20415 |
* Component used as equivalent of Fragment with unescaped HTML, in cases where
|
20416 |
* it is desirable to render dangerous HTML without needing a wrapper element.
|
@@ -20438,12 +22561,12 @@ function RawHTML(_ref) {
|
|
20438 |
//# sourceMappingURL=raw-html.js.map
|
20439 |
|
20440 |
/***/ }),
|
20441 |
-
/*
|
20442 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
20443 |
|
20444 |
"use strict";
|
20445 |
/* harmony export (immutable) */ __webpack_exports__["a"] = useInstanceId;
|
20446 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(
|
20447 |
/**
|
20448 |
* WordPress dependencies
|
20449 |
*/
|
@@ -20464,26 +22587,71 @@ function createId(object) {
|
|
20464 |
* Provides a unique instance ID.
|
20465 |
*
|
20466 |
* @param {Object} object Object reference to create an id for.
|
|
|
20467 |
*/
|
20468 |
|
20469 |
|
20470 |
-
function useInstanceId(object) {
|
20471 |
return Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_element__["i" /* useMemo */])(function () {
|
20472 |
-
|
|
|
20473 |
}, [object]);
|
20474 |
}
|
20475 |
//# sourceMappingURL=index.js.map
|
20476 |
|
20477 |
/***/ }),
|
20478 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20479 |
/***/ (function(module, exports, __webpack_require__) {
|
20480 |
|
20481 |
-
var e=__webpack_require__(
|
20482 |
//# sourceMappingURL=index.js.map
|
20483 |
|
20484 |
|
20485 |
/***/ }),
|
20486 |
-
/*
|
20487 |
/***/ (function(module, exports) {
|
20488 |
|
20489 |
function combineReducers( reducers ) {
|
@@ -20541,19 +22709,32 @@ module.exports = combineReducers;
|
|
20541 |
|
20542 |
|
20543 |
/***/ }),
|
20544 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20545 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
20546 |
|
20547 |
"use strict";
|
20548 |
/* harmony export (immutable) */ __webpack_exports__["a"] = createRegistry;
|
20549 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(
|
20550 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
20551 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash__ = __webpack_require__(2);
|
20552 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_lodash__);
|
20553 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_memize__ = __webpack_require__(
|
20554 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_memize___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_memize__);
|
20555 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__namespace_store__ = __webpack_require__(
|
20556 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__store__ = __webpack_require__(
|
20557 |
|
20558 |
|
20559 |
|
@@ -20802,7 +22983,7 @@ function createRegistry() {
|
|
20802 |
|
20803 |
|
20804 |
function use(plugin, options) {
|
20805 |
-
registry = _objectSpread({}, registry,
|
20806 |
return registry;
|
20807 |
}
|
20808 |
|
@@ -20824,7 +23005,7 @@ function createRegistry() {
|
|
20824 |
//# sourceMappingURL=registry.js.map
|
20825 |
|
20826 |
/***/ }),
|
20827 |
-
/*
|
20828 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
20829 |
|
20830 |
"use strict";
|
@@ -20866,7 +23047,321 @@ function _asyncToGenerator(fn) {
|
|
20866 |
}
|
20867 |
|
20868 |
/***/ }),
|
20869 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20870 |
/***/ (function(module, exports, __webpack_require__) {
|
20871 |
|
20872 |
"use strict";
|
@@ -20877,7 +23372,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
20877 |
});
|
20878 |
exports.createChannel = exports.subscribe = exports.cps = exports.apply = exports.call = exports.invoke = exports.delay = exports.race = exports.join = exports.fork = exports.error = exports.all = undefined;
|
20879 |
|
20880 |
-
var _keys = __webpack_require__(
|
20881 |
|
20882 |
var _keys2 = _interopRequireDefault(_keys);
|
20883 |
|
@@ -21006,7 +23501,7 @@ var createChannel = exports.createChannel = function createChannel(callback) {
|
|
21006 |
};
|
21007 |
|
21008 |
/***/ }),
|
21009 |
-
/*
|
21010 |
/***/ (function(module, exports, __webpack_require__) {
|
21011 |
|
21012 |
"use strict";
|
@@ -21029,7 +23524,264 @@ var keys = {
|
|
21029 |
exports.default = keys;
|
21030 |
|
21031 |
/***/ }),
|
21032 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
21033 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21034 |
|
21035 |
"use strict";
|
@@ -21061,14 +23813,14 @@ function validateNamespace(namespace) {
|
|
21061 |
//# sourceMappingURL=validateNamespace.js.map
|
21062 |
|
21063 |
/***/ }),
|
21064 |
-
/*
|
21065 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21066 |
|
21067 |
"use strict";
|
21068 |
/* harmony export (immutable) */ __webpack_exports__["a"] = RawHTML;
|
21069 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
21070 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
21071 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__react__ = __webpack_require__(
|
21072 |
|
21073 |
|
21074 |
|
@@ -21081,12 +23833,8 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
21081 |
*/
|
21082 |
// Disable reason: JSDoc linter doesn't seem to parse the union (`&`) correctly.
|
21083 |
|
21084 |
-
/* eslint-disable jsdoc/valid-types */
|
21085 |
-
|
21086 |
/** @typedef {{children: string} & import('react').ComponentPropsWithoutRef<'div'>} RawHTMLProps */
|
21087 |
|
21088 |
-
/* eslint-enable jsdoc/valid-types */
|
21089 |
-
|
21090 |
/**
|
21091 |
* Component used as equivalent of Fragment with unescaped HTML, in cases where
|
21092 |
* it is desirable to render dangerous HTML without needing a wrapper element.
|
@@ -21114,7 +23862,52 @@ function RawHTML(_ref) {
|
|
21114 |
//# sourceMappingURL=raw-html.js.map
|
21115 |
|
21116 |
/***/ }),
|
21117 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
21118 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21119 |
|
21120 |
"use strict";
|
@@ -21140,30 +23933,75 @@ function createId(object) {
|
|
21140 |
* Provides a unique instance ID.
|
21141 |
*
|
21142 |
* @param {Object} object Object reference to create an id for.
|
|
|
21143 |
*/
|
21144 |
|
21145 |
|
21146 |
-
function useInstanceId(object) {
|
21147 |
return Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_element__["j" /* useMemo */])(function () {
|
21148 |
-
|
|
|
21149 |
}, [object]);
|
21150 |
}
|
21151 |
//# sourceMappingURL=index.js.map
|
21152 |
|
21153 |
/***/ }),
|
21154 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
21155 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21156 |
|
21157 |
"use strict";
|
21158 |
/* harmony export (immutable) */ __webpack_exports__["a"] = useSelect;
|
21159 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(
|
21160 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_use_memo_one__ = __webpack_require__(
|
21161 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_priority_queue__ = __webpack_require__(
|
21162 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_element__ = __webpack_require__(15);
|
21163 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__wordpress_is_shallow_equal__ = __webpack_require__(
|
21164 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__wordpress_is_shallow_equal___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4__wordpress_is_shallow_equal__);
|
21165 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__registry_provider_use_registry__ = __webpack_require__(
|
21166 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__async_mode_provider_use_async_mode__ = __webpack_require__(
|
21167 |
|
21168 |
|
21169 |
/**
|
@@ -21343,14 +24181,14 @@ function useSelect(_mapSelect, deps) {
|
|
21343 |
//# sourceMappingURL=index.js.map
|
21344 |
|
21345 |
/***/ }),
|
21346 |
-
/*
|
21347 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21348 |
|
21349 |
"use strict";
|
21350 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Context; });
|
21351 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return RegistryConsumer; });
|
21352 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
21353 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__default_registry__ = __webpack_require__(
|
21354 |
/**
|
21355 |
* WordPress dependencies
|
21356 |
*/
|
@@ -21408,13 +24246,13 @@ var RegistryConsumer = Consumer;
|
|
21408 |
//# sourceMappingURL=context.js.map
|
21409 |
|
21410 |
/***/ }),
|
21411 |
-
/*
|
21412 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21413 |
|
21414 |
"use strict";
|
21415 |
/* harmony export (immutable) */ __webpack_exports__["a"] = useAsyncMode;
|
21416 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
21417 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__context__ = __webpack_require__(
|
21418 |
/**
|
21419 |
* WordPress dependencies
|
21420 |
*/
|
@@ -21430,7 +24268,7 @@ function useAsyncMode() {
|
|
21430 |
//# sourceMappingURL=use-async-mode.js.map
|
21431 |
|
21432 |
/***/ }),
|
21433 |
-
/*
|
21434 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21435 |
|
21436 |
"use strict";
|
@@ -21484,43 +24322,43 @@ var AsyncModeConsumer = Consumer;
|
|
21484 |
//# sourceMappingURL=context.js.map
|
21485 |
|
21486 |
/***/ }),
|
21487 |
-
/*
|
21488 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21489 |
|
21490 |
"use strict";
|
21491 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__use_dispatch__ = __webpack_require__(
|
21492 |
-
/*
|
21493 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__use_dispatch_with_map__ = __webpack_require__(
|
21494 |
-
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "
|
21495 |
|
21496 |
|
21497 |
//# sourceMappingURL=index.js.map
|
21498 |
|
21499 |
/***/ }),
|
21500 |
-
/*
|
21501 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21502 |
|
21503 |
"use strict";
|
21504 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__context__ = __webpack_require__(
|
21505 |
/* unused harmony reexport RegistryProvider */
|
21506 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_0__context__["b"]; });
|
21507 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__use_registry__ = __webpack_require__(
|
21508 |
/* unused harmony reexport useRegistry */
|
21509 |
|
21510 |
|
21511 |
//# sourceMappingURL=index.js.map
|
21512 |
|
21513 |
/***/ }),
|
21514 |
-
/*
|
21515 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21516 |
|
21517 |
"use strict";
|
21518 |
/* harmony export (immutable) */ __webpack_exports__["a"] = applyFormat;
|
21519 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
21520 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
21521 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash__ = __webpack_require__(2);
|
21522 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_lodash__);
|
21523 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__normalise_formats__ = __webpack_require__(
|
21524 |
|
21525 |
|
21526 |
|
@@ -21537,6 +24375,9 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
21537 |
*/
|
21538 |
|
21539 |
|
|
|
|
|
|
|
21540 |
|
21541 |
function replace(array, index, value) {
|
21542 |
array = array.slice();
|
@@ -21548,12 +24389,12 @@ function replace(array, index, value) {
|
|
21548 |
* given `endIndex`. Indices are retrieved from the selection if none are
|
21549 |
* provided.
|
21550 |
*
|
21551 |
-
* @param {
|
21552 |
-
* @param {
|
21553 |
-
* @param {number}
|
21554 |
-
* @param {number}
|
21555 |
*
|
21556 |
-
* @return {
|
21557 |
*/
|
21558 |
|
21559 |
|
@@ -21611,7 +24452,7 @@ function applyFormat(value, format) {
|
|
21611 |
}
|
21612 |
}
|
21613 |
|
21614 |
-
return Object(__WEBPACK_IMPORTED_MODULE_3__normalise_formats__["a" /* normaliseFormats */])(_objectSpread({}, value, {
|
21615 |
formats: newFormats,
|
21616 |
// Always revise active formats. This serves as a placeholder for new
|
21617 |
// inputs with the format so new input appears with the format applied,
|
@@ -21624,25 +24465,27 @@ function applyFormat(value, format) {
|
|
21624 |
//# sourceMappingURL=apply-format.js.map
|
21625 |
|
21626 |
/***/ }),
|
21627 |
-
/*
|
21628 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21629 |
|
21630 |
"use strict";
|
21631 |
/* harmony export (immutable) */ __webpack_exports__["a"] = mergePair;
|
21632 |
/* unused harmony export concat */
|
21633 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__normalise_formats__ = __webpack_require__(
|
21634 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__create__ = __webpack_require__(
|
21635 |
/**
|
21636 |
* Internal dependencies
|
21637 |
*/
|
21638 |
|
21639 |
|
|
|
|
|
21640 |
/**
|
21641 |
* Concats a pair of rich text values. Not that this mutates `a` and does NOT
|
21642 |
* normalise formats!
|
21643 |
*
|
21644 |
-
* @param
|
21645 |
-
* @param
|
21646 |
*
|
21647 |
* @return {Object} `a`, mutated.
|
21648 |
*/
|
@@ -21657,9 +24500,9 @@ function mergePair(a, b) {
|
|
21657 |
* Combine all Rich Text values into one. This is similar to
|
21658 |
* `String.prototype.concat`.
|
21659 |
*
|
21660 |
-
* @param {...
|
21661 |
*
|
21662 |
-
* @return {
|
21663 |
*/
|
21664 |
|
21665 |
function concat() {
|
@@ -21672,22 +24515,26 @@ function concat() {
|
|
21672 |
//# sourceMappingURL=concat.js.map
|
21673 |
|
21674 |
/***/ }),
|
21675 |
-
/*
|
21676 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21677 |
|
21678 |
"use strict";
|
21679 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getActiveObject;
|
21680 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__special_characters__ = __webpack_require__(
|
21681 |
/**
|
21682 |
* Internal dependencies
|
21683 |
*/
|
21684 |
|
|
|
|
|
|
|
|
|
21685 |
/**
|
21686 |
* Gets the active object, if there is any.
|
21687 |
*
|
21688 |
-
* @param {
|
21689 |
*
|
21690 |
-
* @return {
|
21691 |
*/
|
21692 |
|
21693 |
function getActiveObject(_ref) {
|
@@ -21705,16 +24552,18 @@ function getActiveObject(_ref) {
|
|
21705 |
//# sourceMappingURL=get-active-object.js.map
|
21706 |
|
21707 |
/***/ }),
|
21708 |
-
/*
|
21709 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21710 |
|
21711 |
"use strict";
|
21712 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getTextContent;
|
|
|
|
|
21713 |
/**
|
21714 |
* Get the textual content of a Rich Text value. This is similar to
|
21715 |
* `Element.textContent`.
|
21716 |
*
|
21717 |
-
* @param {
|
21718 |
*
|
21719 |
* @return {string} The text content.
|
21720 |
*/
|
@@ -21725,22 +24574,24 @@ function getTextContent(_ref) {
|
|
21725 |
//# sourceMappingURL=get-text-content.js.map
|
21726 |
|
21727 |
/***/ }),
|
21728 |
-
/*
|
21729 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21730 |
|
21731 |
"use strict";
|
21732 |
/* unused harmony export isEmpty */
|
21733 |
/* harmony export (immutable) */ __webpack_exports__["a"] = isEmptyLine;
|
21734 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__special_characters__ = __webpack_require__(
|
21735 |
/**
|
21736 |
* Internal dependencies
|
21737 |
*/
|
21738 |
|
|
|
|
|
21739 |
/**
|
21740 |
* Check if a Rich Text value is Empty, meaning it contains no text or any
|
21741 |
* objects (such as images).
|
21742 |
*
|
21743 |
-
* @param {
|
21744 |
*
|
21745 |
* @return {boolean} True if the value is empty, false if not.
|
21746 |
*/
|
@@ -21753,7 +24604,7 @@ function isEmpty(_ref) {
|
|
21753 |
* Check if the current collapsed selection is on an empty line in case of a
|
21754 |
* multiline value.
|
21755 |
*
|
21756 |
-
* @param {
|
21757 |
*
|
21758 |
* @return {boolean} True if the line is empty, false if not.
|
21759 |
*/
|
@@ -21784,24 +24635,26 @@ function isEmptyLine(_ref2) {
|
|
21784 |
//# sourceMappingURL=is-empty.js.map
|
21785 |
|
21786 |
/***/ }),
|
21787 |
-
/*
|
21788 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21789 |
|
21790 |
"use strict";
|
21791 |
/* harmony export (immutable) */ __webpack_exports__["a"] = replace;
|
21792 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_typeof__ = __webpack_require__(
|
21793 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__normalise_formats__ = __webpack_require__(
|
21794 |
|
21795 |
|
21796 |
/**
|
21797 |
* Internal dependencies
|
21798 |
*/
|
21799 |
|
|
|
|
|
21800 |
/**
|
21801 |
* Search a Rich Text value and replace the match(es) with `replacement`. This
|
21802 |
* is similar to `String.prototype.replace`.
|
21803 |
*
|
21804 |
-
* @param {
|
21805 |
* @param {RegExp|string} pattern A RegExp object or literal. Can also be
|
21806 |
* a string. It is treated as a verbatim
|
21807 |
* string and is not interpreted as a
|
@@ -21811,7 +24664,7 @@ function isEmptyLine(_ref2) {
|
|
21811 |
* the specified or the value returned by
|
21812 |
* the specified function.
|
21813 |
*
|
21814 |
-
* @return {
|
21815 |
*/
|
21816 |
|
21817 |
function replace(_ref, pattern, replacement) {
|
@@ -21867,15 +24720,15 @@ function replace(_ref, pattern, replacement) {
|
|
21867 |
//# sourceMappingURL=replace.js.map
|
21868 |
|
21869 |
/***/ }),
|
21870 |
-
/*
|
21871 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21872 |
|
21873 |
"use strict";
|
21874 |
/* harmony export (immutable) */ __webpack_exports__["a"] = removeLineSeparator;
|
21875 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
21876 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__special_characters__ = __webpack_require__(
|
21877 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__is_collapsed__ = __webpack_require__(
|
21878 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__remove__ = __webpack_require__(
|
21879 |
|
21880 |
|
21881 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
@@ -21888,14 +24741,20 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
21888 |
|
21889 |
|
21890 |
|
|
|
|
|
21891 |
/**
|
21892 |
-
* Removes a line separator character, if existing, from a Rich Text value at
|
21893 |
-
* indices. If no line separator exists on the indices it will
|
|
|
21894 |
*
|
21895 |
-
* @param {
|
21896 |
-
* @param {boolean}
|
|
|
21897 |
*
|
21898 |
-
* @return {
|
|
|
|
|
21899 |
*/
|
21900 |
|
21901 |
function removeLineSeparator(value) {
|
@@ -21925,7 +24784,7 @@ function removeLineSeparator(value) {
|
|
21925 |
if (collapsed && replacements[index] && replacements[index].length) {
|
21926 |
var newReplacements = replacements.slice();
|
21927 |
newReplacements[index] = replacements[index].slice(0, -1);
|
21928 |
-
newValue = _objectSpread({}, value, {
|
21929 |
replacements: newReplacements
|
21930 |
});
|
21931 |
} else {
|
@@ -21937,7 +24796,7 @@ function removeLineSeparator(value) {
|
|
21937 |
//# sourceMappingURL=remove-line-separator.js.map
|
21938 |
|
21939 |
/***/ }),
|
21940 |
-
/*
|
21941 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
21942 |
|
21943 |
"use strict";
|
@@ -21945,10 +24804,10 @@ function removeLineSeparator(value) {
|
|
21945 |
/* harmony export (immutable) */ __webpack_exports__["a"] = apply;
|
21946 |
/* unused harmony export applyValue */
|
21947 |
/* unused harmony export applySelection */
|
21948 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
21949 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
21950 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__to_tree__ = __webpack_require__(
|
21951 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__create_element__ = __webpack_require__(
|
21952 |
|
21953 |
|
21954 |
|
@@ -21961,6 +24820,8 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
21961 |
*/
|
21962 |
|
21963 |
|
|
|
|
|
21964 |
/**
|
21965 |
* Creates a path as an array of indices from the given root node to the given
|
21966 |
* node.
|
@@ -22071,7 +24932,7 @@ function toDom(_ref4) {
|
|
22071 |
var endPath = [];
|
22072 |
|
22073 |
if (prepareEditableTree) {
|
22074 |
-
value = _objectSpread({}, value, {
|
22075 |
formats: prepareEditableTree(value)
|
22076 |
});
|
22077 |
}
|
@@ -22124,11 +24985,13 @@ function toDom(_ref4) {
|
|
22124 |
* the `Element` tree contained by `current`. If a `multilineTag` is provided,
|
22125 |
* text separated by two new lines will be wrapped in an `Element` of that type.
|
22126 |
*
|
22127 |
-
* @param {Object}
|
22128 |
-
* @param {
|
22129 |
-
* @param {HTMLElement}
|
22130 |
-
* @param {string}
|
22131 |
-
* @param {
|
|
|
|
|
22132 |
*/
|
22133 |
|
22134 |
function apply(_ref5) {
|
@@ -22274,16 +25137,16 @@ function applySelection(_ref6, current) {
|
|
22274 |
//# sourceMappingURL=to-dom.js.map
|
22275 |
|
22276 |
/***/ }),
|
22277 |
-
/*
|
22278 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22279 |
|
22280 |
"use strict";
|
22281 |
/* harmony export (immutable) */ __webpack_exports__["a"] = toTree;
|
22282 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
22283 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
22284 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__get_active_formats__ = __webpack_require__(
|
22285 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__get_format_type__ = __webpack_require__(
|
22286 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__special_characters__ = __webpack_require__(
|
22287 |
|
22288 |
|
22289 |
|
@@ -22329,7 +25192,7 @@ function fromFormat(_ref) {
|
|
22329 |
|
22330 |
if (!formatType) {
|
22331 |
if (attributes) {
|
22332 |
-
elementAttributes = _objectSpread({}, attributes,
|
22333 |
}
|
22334 |
|
22335 |
return {
|
@@ -22339,7 +25202,7 @@ function fromFormat(_ref) {
|
|
22339 |
};
|
22340 |
}
|
22341 |
|
22342 |
-
elementAttributes = _objectSpread({}, unregisteredAttributes,
|
22343 |
|
22344 |
for (var name in attributes) {
|
22345 |
var key = formatType.attributes ? formatType.attributes[name] : false;
|
@@ -22522,7 +25385,7 @@ function toTree(_ref2) {
|
|
22522 |
}
|
22523 |
|
22524 |
if (character === __WEBPACK_IMPORTED_MODULE_4__special_characters__["b" /* OBJECT_REPLACEMENT_CHARACTER */]) {
|
22525 |
-
pointer = append(getParent(pointer), fromFormat(_objectSpread({}, replacements[i], {
|
22526 |
object: true
|
22527 |
}))); // Ensure pointer is text node.
|
22528 |
|
@@ -22583,13 +25446,13 @@ function toTree(_ref2) {
|
|
22583 |
//# sourceMappingURL=to-tree.js.map
|
22584 |
|
22585 |
/***/ }),
|
22586 |
-
/*
|
22587 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22588 |
|
22589 |
"use strict";
|
22590 |
/* harmony export (immutable) */ __webpack_exports__["a"] = toHTMLString;
|
22591 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_escape_html__ = __webpack_require__(
|
22592 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__to_tree__ = __webpack_require__(
|
22593 |
/**
|
22594 |
* WordPress dependencies
|
22595 |
*/
|
@@ -22599,15 +25462,17 @@ function toTree(_ref2) {
|
|
22599 |
*/
|
22600 |
|
22601 |
|
|
|
|
|
22602 |
/**
|
22603 |
* Create an HTML string from a Rich Text value. If a `multilineTag` is
|
22604 |
* provided, text separated by a line separator will be wrapped in it.
|
22605 |
*
|
22606 |
-
* @param {Object}
|
22607 |
-
* @param {
|
22608 |
-
* @param {string}
|
22609 |
-
* @param {
|
22610 |
-
*
|
22611 |
*
|
22612 |
* @return {string} HTML string.
|
22613 |
*/
|
@@ -22714,20 +25579,22 @@ function createChildrenHTML() {
|
|
22714 |
//# sourceMappingURL=to-html-string.js.map
|
22715 |
|
22716 |
/***/ }),
|
22717 |
-
/*
|
22718 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22719 |
|
22720 |
"use strict";
|
22721 |
/* harmony export (immutable) */ __webpack_exports__["a"] = canIndentListItems;
|
22722 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__get_line_index__ = __webpack_require__(
|
22723 |
/**
|
22724 |
* Internal dependencies
|
22725 |
*/
|
22726 |
|
|
|
|
|
22727 |
/**
|
22728 |
* Checks if the selected list item can be indented.
|
22729 |
*
|
22730 |
-
* @param {
|
22731 |
*
|
22732 |
* @return {boolean} Whether or not the selected list item can be indented.
|
22733 |
*/
|
@@ -22750,20 +25617,22 @@ function canIndentListItems(value) {
|
|
22750 |
//# sourceMappingURL=can-indent-list-items.js.map
|
22751 |
|
22752 |
/***/ }),
|
22753 |
-
/*
|
22754 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22755 |
|
22756 |
"use strict";
|
22757 |
/* harmony export (immutable) */ __webpack_exports__["a"] = canOutdentListItems;
|
22758 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__get_line_index__ = __webpack_require__(
|
22759 |
/**
|
22760 |
* Internal dependencies
|
22761 |
*/
|
22762 |
|
|
|
|
|
22763 |
/**
|
22764 |
* Checks if the selected list item can be outdented.
|
22765 |
*
|
22766 |
-
* @param {
|
22767 |
*
|
22768 |
* @return {boolean} Whether or not the selected list item can be outdented.
|
22769 |
*/
|
@@ -22777,15 +25646,15 @@ function canOutdentListItems(value) {
|
|
22777 |
//# sourceMappingURL=can-outdent-list-items.js.map
|
22778 |
|
22779 |
/***/ }),
|
22780 |
-
/*
|
22781 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22782 |
|
22783 |
"use strict";
|
22784 |
/* harmony export (immutable) */ __webpack_exports__["a"] = indentListItems;
|
22785 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
22786 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__special_characters__ = __webpack_require__(
|
22787 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__get_line_index__ = __webpack_require__(
|
22788 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__can_indent_list_items__ = __webpack_require__(
|
22789 |
|
22790 |
|
22791 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
@@ -22798,13 +25667,18 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
22798 |
|
22799 |
|
22800 |
|
|
|
|
|
|
|
|
|
22801 |
/**
|
22802 |
* Gets the line index of the first previous list item with higher indentation.
|
22803 |
*
|
22804 |
-
* @param {
|
22805 |
-
* @param {number}
|
|
|
22806 |
*
|
22807 |
-
* @return {
|
22808 |
*/
|
22809 |
|
22810 |
function getTargetLevelLineIndex(_ref, lineIndex) {
|
@@ -22831,10 +25705,10 @@ function getTargetLevelLineIndex(_ref, lineIndex) {
|
|
22831 |
/**
|
22832 |
* Indents any selected list items if possible.
|
22833 |
*
|
22834 |
-
* @param {
|
22835 |
-
* @param {
|
22836 |
*
|
22837 |
-
* @return {
|
22838 |
*/
|
22839 |
|
22840 |
|
@@ -22869,32 +25743,34 @@ function indentListItems(value, rootFormat) {
|
|
22869 |
}
|
22870 |
}
|
22871 |
|
22872 |
-
return _objectSpread({}, value, {
|
22873 |
replacements: newFormats
|
22874 |
});
|
22875 |
}
|
22876 |
//# sourceMappingURL=indent-list-items.js.map
|
22877 |
|
22878 |
/***/ }),
|
22879 |
-
/*
|
22880 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22881 |
|
22882 |
"use strict";
|
22883 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getParentLineIndex;
|
22884 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__special_characters__ = __webpack_require__(
|
22885 |
/**
|
22886 |
* Internal dependencies
|
22887 |
*/
|
22888 |
|
|
|
|
|
22889 |
/**
|
22890 |
* Gets the index of the first parent list. To get the parent list formats, we
|
22891 |
* go through every list item until we find one with exactly one format type
|
22892 |
* less.
|
22893 |
*
|
22894 |
-
* @param {
|
22895 |
-
* @param {number}
|
22896 |
*
|
22897 |
-
* @return {
|
22898 |
*/
|
22899 |
|
22900 |
function getParentLineIndex(_ref, lineIndex) {
|
@@ -22918,14 +25794,14 @@ function getParentLineIndex(_ref, lineIndex) {
|
|
22918 |
//# sourceMappingURL=get-parent-line-index.js.map
|
22919 |
|
22920 |
/***/ }),
|
22921 |
-
/*
|
22922 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22923 |
|
22924 |
"use strict";
|
22925 |
/* harmony export (immutable) */ __webpack_exports__["a"] = FormatEdit;
|
22926 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
22927 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__get_active_format__ = __webpack_require__(
|
22928 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__get_active_object__ = __webpack_require__(
|
22929 |
|
22930 |
|
22931 |
/**
|
@@ -22983,7 +25859,7 @@ function FormatEdit(_ref) {
|
|
22983 |
//# sourceMappingURL=format-edit.js.map
|
22984 |
|
22985 |
/***/ }),
|
22986 |
-
/*
|
22987 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22988 |
|
22989 |
"use strict";
|
@@ -23020,6 +25896,19 @@ var SELECTOR = ['[tabindex]', 'a[href]', 'button:not([disabled])', 'input:not([t
|
|
23020 |
function isVisible(element) {
|
23021 |
return element.offsetWidth > 0 || element.offsetHeight > 0 || element.getClientRects().length > 0;
|
23022 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
23023 |
/**
|
23024 |
* Returns true if the specified area element is a valid focusable element, or
|
23025 |
* false otherwise. Area is only focusable if within a map where a named map
|
@@ -23038,7 +25927,7 @@ function isValidFocusableArea(element) {
|
|
23038 |
return false;
|
23039 |
}
|
23040 |
|
23041 |
-
var img =
|
23042 |
return !!img && isVisible(img);
|
23043 |
}
|
23044 |
/**
|
@@ -23053,7 +25942,7 @@ function isValidFocusableArea(element) {
|
|
23053 |
function find(context) {
|
23054 |
var elements = context.querySelectorAll(SELECTOR);
|
23055 |
return Array.from(elements).filter(function (element) {
|
23056 |
-
if (!isVisible(element)) {
|
23057 |
return false;
|
23058 |
}
|
23059 |
|
@@ -23069,7 +25958,184 @@ function find(context) {
|
|
23069 |
//# sourceMappingURL=focusable.js.map
|
23070 |
|
23071 |
/***/ }),
|
23072 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
23073 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23074 |
|
23075 |
"use strict";
|
@@ -23079,7 +26145,7 @@ function find(context) {
|
|
23079 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
23080 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
23081 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
23082 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
23083 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(1);
|
23084 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
23085 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
@@ -23246,7 +26312,7 @@ function isFocusNormalizedButton(element) {
|
|
23246 |
//# sourceMappingURL=index.js.map
|
23247 |
|
23248 |
/***/ }),
|
23249 |
-
/*
|
23250 |
/***/ (function(module, exports, __webpack_require__) {
|
23251 |
|
23252 |
"use strict";
|
@@ -23255,8 +26321,8 @@ function isFocusNormalizedButton(element) {
|
|
23255 |
/**
|
23256 |
* Internal dependencies;
|
23257 |
*/
|
23258 |
-
var isShallowEqualObjects = __webpack_require__(
|
23259 |
-
var isShallowEqualArrays = __webpack_require__(
|
23260 |
|
23261 |
var isArray = Array.isArray;
|
23262 |
|
@@ -23291,7 +26357,7 @@ module.exports.isShallowEqualArrays = isShallowEqualArrays;
|
|
23291 |
|
23292 |
|
23293 |
/***/ }),
|
23294 |
-
/*
|
23295 |
/***/ (function(module, exports, __webpack_require__) {
|
23296 |
|
23297 |
"use strict";
|
@@ -23309,9 +26375,9 @@ function _possibleConstructorReturn(self, call) { if (!self) { throw new Referen
|
|
23309 |
|
23310 |
function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
|
23311 |
|
23312 |
-
var hoistNonReactStatic = __webpack_require__(
|
23313 |
-
var React = __webpack_require__(
|
23314 |
-
var ReactDOM = __webpack_require__(
|
23315 |
|
23316 |
module.exports = function enhanceWithClickOutside(WrappedComponent) {
|
23317 |
var componentName = WrappedComponent.displayName || WrappedComponent.name;
|
@@ -23374,7 +26440,7 @@ module.exports = function enhanceWithClickOutside(WrappedComponent) {
|
|
23374 |
};
|
23375 |
|
23376 |
/***/ }),
|
23377 |
-
/*
|
23378 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23379 |
|
23380 |
"use strict";
|
@@ -23418,7 +26484,7 @@ function Shortcut(_ref) {
|
|
23418 |
//# sourceMappingURL=index.js.map
|
23419 |
|
23420 |
/***/ }),
|
23421 |
-
/*
|
23422 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23423 |
|
23424 |
"use strict";
|
@@ -23572,16 +26638,16 @@ function createScrollLockComponent() {
|
|
23572 |
//# sourceMappingURL=index.js.map
|
23573 |
|
23574 |
/***/ }),
|
23575 |
-
/*
|
23576 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23577 |
|
23578 |
"use strict";
|
23579 |
/* unused harmony export createSlotFill */
|
23580 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
23581 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(1);
|
23582 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__slot__ = __webpack_require__(
|
23583 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__fill__ = __webpack_require__(
|
23584 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__context__ = __webpack_require__(
|
23585 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_2__slot__["a"]; });
|
23586 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_3__fill__["a"]; });
|
23587 |
/* unused harmony reexport Provider */
|
@@ -23622,16 +26688,17 @@ function createSlotFill(name) {
|
|
23622 |
//# sourceMappingURL=index.js.map
|
23623 |
|
23624 |
/***/ }),
|
23625 |
-
/*
|
23626 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23627 |
|
23628 |
"use strict";
|
23629 |
/* unused harmony export setup */
|
23630 |
/* harmony export (immutable) */ __webpack_exports__["a"] = speak;
|
23631 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_dom_ready__ = __webpack_require__(
|
23632 |
-
/* harmony import */ var
|
23633 |
-
/* harmony import */ var
|
23634 |
-
/* harmony import */ var
|
|
|
23635 |
/**
|
23636 |
* WordPress dependencies
|
23637 |
*/
|
@@ -23643,20 +26710,26 @@ function createSlotFill(name) {
|
|
23643 |
|
23644 |
|
23645 |
|
|
|
23646 |
/**
|
23647 |
* Create the live regions.
|
23648 |
*/
|
23649 |
|
23650 |
function setup() {
|
|
|
23651 |
var containerAssertive = document.getElementById('a11y-speak-assertive');
|
23652 |
var containerPolite = document.getElementById('a11y-speak-polite');
|
23653 |
|
|
|
|
|
|
|
|
|
23654 |
if (containerAssertive === null) {
|
23655 |
-
Object(
|
23656 |
}
|
23657 |
|
23658 |
if (containerPolite === null) {
|
23659 |
-
Object(
|
23660 |
}
|
23661 |
}
|
23662 |
/**
|
@@ -23684,9 +26757,13 @@ Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_dom_ready__["a" /* default */])(se
|
|
23684 |
*/
|
23685 |
|
23686 |
function speak(message, ariaLive) {
|
23687 |
-
|
23688 |
-
|
23689 |
-
|
|
|
|
|
|
|
|
|
23690 |
var containerAssertive = document.getElementById('a11y-speak-assertive');
|
23691 |
var containerPolite = document.getElementById('a11y-speak-polite');
|
23692 |
|
@@ -23695,11 +26772,235 @@ function speak(message, ariaLive) {
|
|
23695 |
} else if (containerPolite) {
|
23696 |
containerPolite.textContent = message;
|
23697 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
23698 |
}
|
23699 |
//# sourceMappingURL=index.js.map
|
23700 |
|
23701 |
/***/ }),
|
23702 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
23703 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23704 |
|
23705 |
"use strict";
|
@@ -23709,17 +27010,17 @@ function speak(message, ariaLive) {
|
|
23709 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
23710 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
23711 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
23712 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
23713 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_element__ = __webpack_require__(1);
|
23714 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_classnames__ = __webpack_require__(
|
23715 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_7_classnames__);
|
23716 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
23717 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
23718 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__alpha__ = __webpack_require__(
|
23719 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__hue__ = __webpack_require__(
|
23720 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__inputs__ = __webpack_require__(
|
23721 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__saturation__ = __webpack_require__(
|
23722 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__utils__ = __webpack_require__(
|
23723 |
|
23724 |
|
23725 |
|
@@ -23870,7 +27171,7 @@ function (_Component) {
|
|
23870 |
//# sourceMappingURL=index.js.map
|
23871 |
|
23872 |
/***/ }),
|
23873 |
-
/*
|
23874 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23875 |
|
23876 |
"use strict";
|
@@ -23878,7 +27179,7 @@ function (_Component) {
|
|
23878 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
23879 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(1);
|
23880 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_compose__ = __webpack_require__(18);
|
23881 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__base_control__ = __webpack_require__(
|
23882 |
|
23883 |
|
23884 |
|
@@ -23929,17 +27230,17 @@ function TextControl(_ref) {
|
|
23929 |
//# sourceMappingURL=index.js.map
|
23930 |
|
23931 |
/***/ }),
|
23932 |
-
/*
|
23933 |
/***/ (function(module, exports, __webpack_require__) {
|
23934 |
|
23935 |
"use strict";
|
23936 |
|
23937 |
|
23938 |
var slice = Array.prototype.slice;
|
23939 |
-
var isArgs = __webpack_require__(
|
23940 |
|
23941 |
var origKeys = Object.keys;
|
23942 |
-
var keysShim = origKeys ? function keys(o) { return origKeys(o); } : __webpack_require__(
|
23943 |
|
23944 |
var originalKeys = Object.keys;
|
23945 |
|
@@ -23968,7 +27269,7 @@ module.exports = keysShim;
|
|
23968 |
|
23969 |
|
23970 |
/***/ }),
|
23971 |
-
/*
|
23972 |
/***/ (function(module, exports, __webpack_require__) {
|
23973 |
|
23974 |
"use strict";
|
@@ -23992,28 +27293,7 @@ module.exports = function isArguments(value) {
|
|
23992 |
|
23993 |
|
23994 |
/***/ }),
|
23995 |
-
/*
|
23996 |
-
/***/ (function(module, exports, __webpack_require__) {
|
23997 |
-
|
23998 |
-
"use strict";
|
23999 |
-
/* WEBPACK VAR INJECTION */(function(global) {
|
24000 |
-
|
24001 |
-
var origSymbol = global.Symbol;
|
24002 |
-
var hasSymbolSham = __webpack_require__(192);
|
24003 |
-
|
24004 |
-
module.exports = function hasNativeSymbols() {
|
24005 |
-
if (typeof origSymbol !== 'function') { return false; }
|
24006 |
-
if (typeof Symbol !== 'function') { return false; }
|
24007 |
-
if (typeof origSymbol('foo') !== 'symbol') { return false; }
|
24008 |
-
if (typeof Symbol('bar') !== 'symbol') { return false; }
|
24009 |
-
|
24010 |
-
return hasSymbolSham();
|
24011 |
-
};
|
24012 |
-
|
24013 |
-
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(77)))
|
24014 |
-
|
24015 |
-
/***/ }),
|
24016 |
-
/* 192 */
|
24017 |
/***/ (function(module, exports, __webpack_require__) {
|
24018 |
|
24019 |
"use strict";
|
@@ -24062,18 +27342,18 @@ module.exports = function hasSymbols() {
|
|
24062 |
|
24063 |
|
24064 |
/***/ }),
|
24065 |
-
/*
|
24066 |
/***/ (function(module, exports, __webpack_require__) {
|
24067 |
|
24068 |
"use strict";
|
24069 |
|
24070 |
|
24071 |
-
var ArraySpeciesCreate = __webpack_require__(
|
24072 |
-
var FlattenIntoArray = __webpack_require__(
|
24073 |
-
var Get = __webpack_require__(
|
24074 |
-
var ToInteger = __webpack_require__(
|
24075 |
-
var ToLength = __webpack_require__(
|
24076 |
-
var ToObject = __webpack_require__(
|
24077 |
|
24078 |
module.exports = function flat() {
|
24079 |
var O = ToObject(this);
|
@@ -24082,533 +27362,363 @@ module.exports = function flat() {
|
|
24082 |
var depthNum = 1;
|
24083 |
if (arguments.length > 0 && typeof arguments[0] !== 'undefined') {
|
24084 |
depthNum = ToInteger(arguments[0]);
|
24085 |
-
}
|
24086 |
-
|
24087 |
-
var A = ArraySpeciesCreate(O, 0);
|
24088 |
-
FlattenIntoArray(A, O, sourceLen, 0, depthNum);
|
24089 |
-
return A;
|
24090 |
-
};
|
24091 |
-
|
24092 |
-
|
24093 |
-
/***/ }),
|
24094 |
-
/* 194 */
|
24095 |
-
/***/ (function(module, exports, __webpack_require__) {
|
24096 |
-
|
24097 |
-
var hasMap = typeof Map === 'function' && Map.prototype;
|
24098 |
-
var mapSizeDescriptor = Object.getOwnPropertyDescriptor && hasMap ? Object.getOwnPropertyDescriptor(Map.prototype, 'size') : null;
|
24099 |
-
var mapSize = hasMap && mapSizeDescriptor && typeof mapSizeDescriptor.get === 'function' ? mapSizeDescriptor.get : null;
|
24100 |
-
var mapForEach = hasMap && Map.prototype.forEach;
|
24101 |
-
var hasSet = typeof Set === 'function' && Set.prototype;
|
24102 |
-
var setSizeDescriptor = Object.getOwnPropertyDescriptor && hasSet ? Object.getOwnPropertyDescriptor(Set.prototype, 'size') : null;
|
24103 |
-
var setSize = hasSet && setSizeDescriptor && typeof setSizeDescriptor.get === 'function' ? setSizeDescriptor.get : null;
|
24104 |
-
var setForEach = hasSet && Set.prototype.forEach;
|
24105 |
-
var hasWeakMap = typeof WeakMap === 'function' && WeakMap.prototype;
|
24106 |
-
var weakMapHas = hasWeakMap ? WeakMap.prototype.has : null;
|
24107 |
-
var hasWeakSet = typeof WeakSet === 'function' && WeakSet.prototype;
|
24108 |
-
var weakSetHas = hasWeakSet ? WeakSet.prototype.has : null;
|
24109 |
-
var booleanValueOf = Boolean.prototype.valueOf;
|
24110 |
-
var objectToString = Object.prototype.toString;
|
24111 |
-
var match = String.prototype.match;
|
24112 |
-
var bigIntValueOf = typeof BigInt === 'function' ? BigInt.prototype.valueOf : null;
|
24113 |
-
|
24114 |
-
var inspectCustom = __webpack_require__(609).custom;
|
24115 |
-
var inspectSymbol = inspectCustom && isSymbol(inspectCustom) ? inspectCustom : null;
|
24116 |
-
|
24117 |
-
module.exports = function inspect_(obj, options, depth, seen) {
|
24118 |
-
var opts = options || {};
|
24119 |
-
|
24120 |
-
if (has(opts, 'quoteStyle') && (opts.quoteStyle !== 'single' && opts.quoteStyle !== 'double')) {
|
24121 |
-
throw new TypeError('option "quoteStyle" must be "single" or "double"');
|
24122 |
-
}
|
24123 |
-
|
24124 |
-
if (typeof obj === 'undefined') {
|
24125 |
-
return 'undefined';
|
24126 |
-
}
|
24127 |
-
if (obj === null) {
|
24128 |
-
return 'null';
|
24129 |
-
}
|
24130 |
-
if (typeof obj === 'boolean') {
|
24131 |
-
return obj ? 'true' : 'false';
|
24132 |
-
}
|
24133 |
-
|
24134 |
-
if (typeof obj === 'string') {
|
24135 |
-
return inspectString(obj, opts);
|
24136 |
-
}
|
24137 |
-
if (typeof obj === 'number') {
|
24138 |
-
if (obj === 0) {
|
24139 |
-
return Infinity / obj > 0 ? '0' : '-0';
|
24140 |
-
}
|
24141 |
-
return String(obj);
|
24142 |
-
}
|
24143 |
-
if (typeof obj === 'bigint') { // eslint-disable-line valid-typeof
|
24144 |
-
return String(obj) + 'n';
|
24145 |
-
}
|
24146 |
-
|
24147 |
-
var maxDepth = typeof opts.depth === 'undefined' ? 5 : opts.depth;
|
24148 |
-
if (typeof depth === 'undefined') { depth = 0; }
|
24149 |
-
if (depth >= maxDepth && maxDepth > 0 && typeof obj === 'object') {
|
24150 |
-
return '[Object]';
|
24151 |
-
}
|
24152 |
-
|
24153 |
-
if (typeof seen === 'undefined') {
|
24154 |
-
seen = [];
|
24155 |
-
} else if (indexOf(seen, obj) >= 0) {
|
24156 |
-
return '[Circular]';
|
24157 |
-
}
|
24158 |
-
|
24159 |
-
function inspect(value, from) {
|
24160 |
-
if (from) {
|
24161 |
-
seen = seen.slice();
|
24162 |
-
seen.push(from);
|
24163 |
-
}
|
24164 |
-
return inspect_(value, opts, depth + 1, seen);
|
24165 |
-
}
|
24166 |
-
|
24167 |
-
if (typeof obj === 'function') {
|
24168 |
-
var name = nameOf(obj);
|
24169 |
-
return '[Function' + (name ? ': ' + name : '') + ']';
|
24170 |
-
}
|
24171 |
-
if (isSymbol(obj)) {
|
24172 |
-
var symString = Symbol.prototype.toString.call(obj);
|
24173 |
-
return typeof obj === 'object' ? markBoxed(symString) : symString;
|
24174 |
-
}
|
24175 |
-
if (isElement(obj)) {
|
24176 |
-
var s = '<' + String(obj.nodeName).toLowerCase();
|
24177 |
-
var attrs = obj.attributes || [];
|
24178 |
-
for (var i = 0; i < attrs.length; i++) {
|
24179 |
-
s += ' ' + attrs[i].name + '=' + wrapQuotes(quote(attrs[i].value), 'double', opts);
|
24180 |
-
}
|
24181 |
-
s += '>';
|
24182 |
-
if (obj.childNodes && obj.childNodes.length) { s += '...'; }
|
24183 |
-
s += '</' + String(obj.nodeName).toLowerCase() + '>';
|
24184 |
-
return s;
|
24185 |
-
}
|
24186 |
-
if (isArray(obj)) {
|
24187 |
-
if (obj.length === 0) { return '[]'; }
|
24188 |
-
return '[ ' + arrObjKeys(obj, inspect).join(', ') + ' ]';
|
24189 |
-
}
|
24190 |
-
if (isError(obj)) {
|
24191 |
-
var parts = arrObjKeys(obj, inspect);
|
24192 |
-
if (parts.length === 0) { return '[' + String(obj) + ']'; }
|
24193 |
-
return '{ [' + String(obj) + '] ' + parts.join(', ') + ' }';
|
24194 |
-
}
|
24195 |
-
if (typeof obj === 'object') {
|
24196 |
-
if (inspectSymbol && typeof obj[inspectSymbol] === 'function') {
|
24197 |
-
return obj[inspectSymbol]();
|
24198 |
-
} else if (typeof obj.inspect === 'function') {
|
24199 |
-
return obj.inspect();
|
24200 |
-
}
|
24201 |
-
}
|
24202 |
-
if (isMap(obj)) {
|
24203 |
-
var mapParts = [];
|
24204 |
-
mapForEach.call(obj, function (value, key) {
|
24205 |
-
mapParts.push(inspect(key, obj) + ' => ' + inspect(value, obj));
|
24206 |
-
});
|
24207 |
-
return collectionOf('Map', mapSize.call(obj), mapParts);
|
24208 |
-
}
|
24209 |
-
if (isSet(obj)) {
|
24210 |
-
var setParts = [];
|
24211 |
-
setForEach.call(obj, function (value) {
|
24212 |
-
setParts.push(inspect(value, obj));
|
24213 |
-
});
|
24214 |
-
return collectionOf('Set', setSize.call(obj), setParts);
|
24215 |
-
}
|
24216 |
-
if (isWeakMap(obj)) {
|
24217 |
-
return weakCollectionOf('WeakMap');
|
24218 |
-
}
|
24219 |
-
if (isWeakSet(obj)) {
|
24220 |
-
return weakCollectionOf('WeakSet');
|
24221 |
-
}
|
24222 |
-
if (isNumber(obj)) {
|
24223 |
-
return markBoxed(inspect(Number(obj)));
|
24224 |
-
}
|
24225 |
-
if (isBigInt(obj)) {
|
24226 |
-
return markBoxed(inspect(bigIntValueOf.call(obj)));
|
24227 |
-
}
|
24228 |
-
if (isBoolean(obj)) {
|
24229 |
-
return markBoxed(booleanValueOf.call(obj));
|
24230 |
-
}
|
24231 |
-
if (isString(obj)) {
|
24232 |
-
return markBoxed(inspect(String(obj)));
|
24233 |
-
}
|
24234 |
-
if (!isDate(obj) && !isRegExp(obj)) {
|
24235 |
-
var xs = arrObjKeys(obj, inspect);
|
24236 |
-
if (xs.length === 0) { return '{}'; }
|
24237 |
-
return '{ ' + xs.join(', ') + ' }';
|
24238 |
-
}
|
24239 |
-
return String(obj);
|
24240 |
-
};
|
24241 |
-
|
24242 |
-
function wrapQuotes(s, defaultStyle, opts) {
|
24243 |
-
var quoteChar = (opts.quoteStyle || defaultStyle) === 'double' ? '"' : "'";
|
24244 |
-
return quoteChar + s + quoteChar;
|
24245 |
-
}
|
24246 |
-
|
24247 |
-
function quote(s) {
|
24248 |
-
return String(s).replace(/"/g, '"');
|
24249 |
-
}
|
24250 |
-
|
24251 |
-
function isArray(obj) { return toStr(obj) === '[object Array]'; }
|
24252 |
-
function isDate(obj) { return toStr(obj) === '[object Date]'; }
|
24253 |
-
function isRegExp(obj) { return toStr(obj) === '[object RegExp]'; }
|
24254 |
-
function isError(obj) { return toStr(obj) === '[object Error]'; }
|
24255 |
-
function isSymbol(obj) { return toStr(obj) === '[object Symbol]'; }
|
24256 |
-
function isString(obj) { return toStr(obj) === '[object String]'; }
|
24257 |
-
function isNumber(obj) { return toStr(obj) === '[object Number]'; }
|
24258 |
-
function isBigInt(obj) { return toStr(obj) === '[object BigInt]'; }
|
24259 |
-
function isBoolean(obj) { return toStr(obj) === '[object Boolean]'; }
|
24260 |
-
|
24261 |
-
var hasOwn = Object.prototype.hasOwnProperty || function (key) { return key in this; };
|
24262 |
-
function has(obj, key) {
|
24263 |
-
return hasOwn.call(obj, key);
|
24264 |
-
}
|
24265 |
-
|
24266 |
-
function toStr(obj) {
|
24267 |
-
return objectToString.call(obj);
|
24268 |
-
}
|
24269 |
|
24270 |
-
|
24271 |
-
|
24272 |
-
|
24273 |
-
|
24274 |
-
return null;
|
24275 |
-
}
|
24276 |
|
24277 |
-
function indexOf(xs, x) {
|
24278 |
-
if (xs.indexOf) { return xs.indexOf(x); }
|
24279 |
-
for (var i = 0, l = xs.length; i < l; i++) {
|
24280 |
-
if (xs[i] === x) { return i; }
|
24281 |
-
}
|
24282 |
-
return -1;
|
24283 |
-
}
|
24284 |
|
24285 |
-
|
24286 |
-
|
24287 |
-
|
24288 |
-
}
|
24289 |
-
try {
|
24290 |
-
mapSize.call(x);
|
24291 |
-
try {
|
24292 |
-
setSize.call(x);
|
24293 |
-
} catch (s) {
|
24294 |
-
return true;
|
24295 |
-
}
|
24296 |
-
return x instanceof Map; // core-js workaround, pre-v2.5.0
|
24297 |
-
} catch (e) {}
|
24298 |
-
return false;
|
24299 |
-
}
|
24300 |
|
24301 |
-
|
24302 |
-
if (!weakMapHas || !x || typeof x !== 'object') {
|
24303 |
-
return false;
|
24304 |
-
}
|
24305 |
-
try {
|
24306 |
-
weakMapHas.call(x, weakMapHas);
|
24307 |
-
try {
|
24308 |
-
weakSetHas.call(x, weakSetHas);
|
24309 |
-
} catch (s) {
|
24310 |
-
return true;
|
24311 |
-
}
|
24312 |
-
return x instanceof WeakMap; // core-js workaround, pre-v2.5.0
|
24313 |
-
} catch (e) {}
|
24314 |
-
return false;
|
24315 |
-
}
|
24316 |
|
24317 |
-
function isSet(x) {
|
24318 |
-
if (!setSize || !x || typeof x !== 'object') {
|
24319 |
-
return false;
|
24320 |
-
}
|
24321 |
-
try {
|
24322 |
-
setSize.call(x);
|
24323 |
-
try {
|
24324 |
-
mapSize.call(x);
|
24325 |
-
} catch (m) {
|
24326 |
-
return true;
|
24327 |
-
}
|
24328 |
-
return x instanceof Set; // core-js workaround, pre-v2.5.0
|
24329 |
-
} catch (e) {}
|
24330 |
-
return false;
|
24331 |
-
}
|
24332 |
|
24333 |
-
|
24334 |
-
if (!weakSetHas || !x || typeof x !== 'object') {
|
24335 |
-
return false;
|
24336 |
-
}
|
24337 |
-
try {
|
24338 |
-
weakSetHas.call(x, weakSetHas);
|
24339 |
-
try {
|
24340 |
-
weakMapHas.call(x, weakMapHas);
|
24341 |
-
} catch (s) {
|
24342 |
-
return true;
|
24343 |
-
}
|
24344 |
-
return x instanceof WeakSet; // core-js workaround, pre-v2.5.0
|
24345 |
-
} catch (e) {}
|
24346 |
-
return false;
|
24347 |
-
}
|
24348 |
|
24349 |
-
|
24350 |
-
if (!x || typeof x !== 'object') { return false; }
|
24351 |
-
if (typeof HTMLElement !== 'undefined' && x instanceof HTMLElement) {
|
24352 |
-
return true;
|
24353 |
-
}
|
24354 |
-
return typeof x.nodeName === 'string' && typeof x.getAttribute === 'function';
|
24355 |
-
}
|
24356 |
|
24357 |
-
|
24358 |
-
|
24359 |
-
|
24360 |
-
|
|
|
|
|
|
|
24361 |
}
|
24362 |
|
24363 |
-
|
24364 |
-
var n = c.charCodeAt(0);
|
24365 |
-
var x = {
|
24366 |
-
8: 'b', 9: 't', 10: 'n', 12: 'f', 13: 'r'
|
24367 |
-
}[n];
|
24368 |
-
if (x) { return '\\' + x; }
|
24369 |
-
return '\\x' + (n < 0x10 ? '0' : '') + n.toString(16);
|
24370 |
-
}
|
24371 |
|
24372 |
-
|
24373 |
-
return 'Object(' + str + ')';
|
24374 |
-
}
|
24375 |
|
24376 |
-
|
24377 |
-
|
24378 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
24379 |
|
24380 |
-
|
24381 |
-
|
24382 |
-
|
|
|
|
|
24383 |
|
24384 |
-
|
24385 |
-
|
24386 |
-
|
24387 |
-
|
24388 |
-
|
24389 |
-
|
24390 |
-
|
24391 |
-
|
24392 |
-
|
24393 |
-
for (var key in obj) { // eslint-disable-line no-restricted-syntax
|
24394 |
-
if (!has(obj, key)) { continue; } // eslint-disable-line no-restricted-syntax, no-continue
|
24395 |
-
if (isArr && String(Number(key)) === key && key < obj.length) { continue; } // eslint-disable-line no-restricted-syntax, no-continue
|
24396 |
-
if ((/[^\w$]/).test(key)) {
|
24397 |
-
xs.push(inspect(key, obj) + ': ' + inspect(obj[key], obj));
|
24398 |
-
} else {
|
24399 |
-
xs.push(key + ': ' + inspect(obj[key], obj));
|
24400 |
-
}
|
24401 |
-
}
|
24402 |
-
return xs;
|
24403 |
-
}
|
24404 |
|
24405 |
|
24406 |
/***/ }),
|
24407 |
-
/*
|
24408 |
/***/ (function(module, exports, __webpack_require__) {
|
24409 |
|
24410 |
"use strict";
|
24411 |
|
24412 |
|
24413 |
-
var
|
24414 |
|
24415 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
24416 |
|
24417 |
|
24418 |
/***/ }),
|
24419 |
-
/*
|
24420 |
/***/ (function(module, exports, __webpack_require__) {
|
24421 |
|
24422 |
"use strict";
|
24423 |
|
24424 |
|
24425 |
-
var
|
24426 |
|
24427 |
-
var
|
24428 |
-
var $Number = GetIntrinsic('%Number%');
|
24429 |
|
24430 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
24431 |
|
24432 |
|
24433 |
/***/ }),
|
24434 |
-
/*
|
24435 |
/***/ (function(module, exports, __webpack_require__) {
|
24436 |
|
24437 |
"use strict";
|
24438 |
|
24439 |
|
24440 |
-
var
|
24441 |
|
24442 |
-
|
24443 |
-
var isES6ClassFn = function isES6ClassFunction(value) {
|
24444 |
-
try {
|
24445 |
-
var fnStr = fnToStr.call(value);
|
24446 |
-
return constructorRegex.test(fnStr);
|
24447 |
-
} catch (e) {
|
24448 |
-
return false; // not a function
|
24449 |
-
}
|
24450 |
-
};
|
24451 |
|
24452 |
-
|
24453 |
-
|
24454 |
-
if (
|
24455 |
-
fnToStr.call(value);
|
24456 |
return true;
|
24457 |
-
} catch (e) {
|
24458 |
-
return false;
|
24459 |
}
|
24460 |
-
|
24461 |
-
var toStr = Object.prototype.toString;
|
24462 |
-
var fnClass = '[object Function]';
|
24463 |
-
var genClass = '[object GeneratorFunction]';
|
24464 |
-
var hasToStringTag = typeof Symbol === 'function' && typeof Symbol.toStringTag === 'symbol';
|
24465 |
-
|
24466 |
-
module.exports = function isCallable(value) {
|
24467 |
-
if (!value) { return false; }
|
24468 |
-
if (typeof value !== 'function' && typeof value !== 'object') { return false; }
|
24469 |
-
if (typeof value === 'function' && !value.prototype) { return true; }
|
24470 |
-
if (hasToStringTag) { return tryFunctionObject(value); }
|
24471 |
-
if (isES6ClassFn(value)) { return false; }
|
24472 |
-
var strClass = toStr.call(value);
|
24473 |
-
return strClass === fnClass || strClass === genClass;
|
24474 |
};
|
24475 |
|
24476 |
|
24477 |
/***/ }),
|
24478 |
-
/*
|
24479 |
/***/ (function(module, exports, __webpack_require__) {
|
24480 |
|
24481 |
"use strict";
|
24482 |
|
24483 |
|
|
|
|
|
24484 |
var GetIntrinsic = __webpack_require__(19);
|
24485 |
|
24486 |
var $TypeError = GetIntrinsic('%TypeError%');
|
24487 |
-
var $SyntaxError = GetIntrinsic('%SyntaxError%');
|
24488 |
|
24489 |
-
var
|
|
|
|
|
24490 |
|
24491 |
-
|
24492 |
-
// https://ecma-international.org/ecma-262/6.0/#sec-property-descriptor-specification-type
|
24493 |
-
'Property Descriptor': function isPropertyDescriptor(Type, Desc) {
|
24494 |
-
if (Type(Desc) !== 'Object') {
|
24495 |
-
return false;
|
24496 |
-
}
|
24497 |
-
var allowed = {
|
24498 |
-
'[[Configurable]]': true,
|
24499 |
-
'[[Enumerable]]': true,
|
24500 |
-
'[[Get]]': true,
|
24501 |
-
'[[Set]]': true,
|
24502 |
-
'[[Value]]': true,
|
24503 |
-
'[[Writable]]': true
|
24504 |
-
};
|
24505 |
|
24506 |
-
|
24507 |
-
|
24508 |
-
|
24509 |
-
|
24510 |
-
}
|
24511 |
|
24512 |
-
|
24513 |
-
|
24514 |
-
|
24515 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
24516 |
}
|
24517 |
-
|
24518 |
}
|
24519 |
-
|
24520 |
-
|
24521 |
-
|
24522 |
-
|
24523 |
-
|
24524 |
-
|
24525 |
}
|
24526 |
-
|
24527 |
-
|
|
|
24528 |
}
|
|
|
24529 |
};
|
24530 |
|
24531 |
|
24532 |
/***/ }),
|
24533 |
-
/*
|
24534 |
/***/ (function(module, exports, __webpack_require__) {
|
24535 |
|
24536 |
"use strict";
|
24537 |
|
24538 |
|
24539 |
-
|
24540 |
-
var regexExec = RegExp.prototype.exec;
|
24541 |
-
var gOPD = Object.getOwnPropertyDescriptor;
|
24542 |
|
24543 |
-
|
24544 |
-
try {
|
24545 |
-
var lastIndex = value.lastIndex;
|
24546 |
-
value.lastIndex = 0; // eslint-disable-line no-param-reassign
|
24547 |
|
24548 |
-
|
24549 |
-
|
24550 |
-
|
24551 |
-
|
24552 |
-
|
24553 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
24554 |
}
|
24555 |
-
}
|
|
|
24556 |
var toStr = Object.prototype.toString;
|
|
|
24557 |
var regexClass = '[object RegExp]';
|
24558 |
-
var hasToStringTag = typeof Symbol === 'function' && typeof Symbol.toStringTag === 'symbol';
|
24559 |
|
24560 |
-
module.exports =
|
24561 |
-
|
24562 |
-
|
24563 |
-
|
24564 |
-
|
24565 |
-
|
24566 |
-
}
|
24567 |
|
24568 |
-
|
24569 |
-
|
24570 |
-
|
24571 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
24572 |
}
|
|
|
|
|
|
|
|
|
|
|
24573 |
|
24574 |
-
|
24575 |
-
};
|
24576 |
|
24577 |
|
24578 |
/***/ }),
|
24579 |
-
/*
|
24580 |
/***/ (function(module, exports, __webpack_require__) {
|
24581 |
|
24582 |
"use strict";
|
24583 |
|
24584 |
|
24585 |
-
|
24586 |
-
|
24587 |
-
|
24588 |
|
24589 |
|
24590 |
/***/ }),
|
24591 |
-
/*
|
24592 |
/***/ (function(module, exports, __webpack_require__) {
|
24593 |
|
24594 |
"use strict";
|
24595 |
|
24596 |
|
24597 |
-
|
24598 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
24599 |
};
|
24600 |
|
24601 |
|
24602 |
/***/ }),
|
24603 |
-
/*
|
24604 |
/***/ (function(module, exports, __webpack_require__) {
|
24605 |
|
24606 |
"use strict";
|
24607 |
|
24608 |
|
24609 |
-
var ES5ToInteger = __webpack_require__(
|
24610 |
|
24611 |
-
var ToNumber = __webpack_require__(
|
24612 |
|
24613 |
// https://www.ecma-international.org/ecma-262/6.0/#sec-tointeger
|
24614 |
|
@@ -24619,14 +27729,96 @@ module.exports = function ToInteger(value) {
|
|
24619 |
|
24620 |
|
24621 |
/***/ }),
|
24622 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
24623 |
/***/ (function(module, exports, __webpack_require__) {
|
24624 |
|
24625 |
"use strict";
|
24626 |
|
24627 |
|
24628 |
var toStr = Object.prototype.toString;
|
24629 |
-
var hasSymbols = __webpack_require__(
|
24630 |
|
24631 |
if (hasSymbols) {
|
24632 |
var symToStr = Symbol.prototype.toString;
|
@@ -24661,34 +27853,13 @@ if (hasSymbols) {
|
|
24661 |
|
24662 |
|
24663 |
/***/ }),
|
24664 |
-
/*
|
24665 |
-
/***/ (function(module, exports, __webpack_require__) {
|
24666 |
-
|
24667 |
-
"use strict";
|
24668 |
-
|
24669 |
-
|
24670 |
-
var GetIntrinsic = __webpack_require__(19);
|
24671 |
-
|
24672 |
-
var $Object = GetIntrinsic('%Object%');
|
24673 |
-
|
24674 |
-
var RequireObjectCoercible = __webpack_require__(85);
|
24675 |
-
|
24676 |
-
// https://www.ecma-international.org/ecma-262/6.0/#sec-toobject
|
24677 |
-
|
24678 |
-
module.exports = function ToObject(value) {
|
24679 |
-
RequireObjectCoercible(value);
|
24680 |
-
return $Object(value);
|
24681 |
-
};
|
24682 |
-
|
24683 |
-
|
24684 |
-
/***/ }),
|
24685 |
-
/* 205 */
|
24686 |
/***/ (function(module, exports, __webpack_require__) {
|
24687 |
|
24688 |
"use strict";
|
24689 |
|
24690 |
|
24691 |
-
var implementation = __webpack_require__(
|
24692 |
|
24693 |
module.exports = function getPolyfill() {
|
24694 |
return Array.prototype.flat || implementation;
|
@@ -24696,7 +27867,7 @@ module.exports = function getPolyfill() {
|
|
24696 |
|
24697 |
|
24698 |
/***/ }),
|
24699 |
-
/*
|
24700 |
/***/ (function(module, exports, __webpack_require__) {
|
24701 |
|
24702 |
"use strict";
|
@@ -24807,7 +27978,7 @@ exports['default'] = {
|
|
24807 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
24808 |
|
24809 |
/***/ }),
|
24810 |
-
/*
|
24811 |
/***/ (function(module, exports, __webpack_require__) {
|
24812 |
|
24813 |
"use strict";
|
@@ -25013,7 +28184,7 @@ exports['default'] = {
|
|
25013 |
};
|
25014 |
|
25015 |
/***/ }),
|
25016 |
-
/*
|
25017 |
/***/ (function(module, exports, __webpack_require__) {
|
25018 |
|
25019 |
//! moment.js locale configuration
|
@@ -25100,7 +28271,7 @@ exports['default'] = {
|
|
25100 |
|
25101 |
|
25102 |
/***/ }),
|
25103 |
-
/*
|
25104 |
/***/ (function(module, exports, __webpack_require__) {
|
25105 |
|
25106 |
//! moment.js locale configuration
|
@@ -25118,16 +28289,16 @@ exports['default'] = {
|
|
25118 |
//! moment.js locale configuration
|
25119 |
|
25120 |
var symbolMap = {
|
25121 |
-
|
25122 |
-
|
25123 |
-
|
25124 |
-
|
25125 |
-
|
25126 |
-
|
25127 |
-
|
25128 |
-
|
25129 |
-
|
25130 |
-
|
25131 |
},
|
25132 |
numberMap = {
|
25133 |
'١': '1',
|
@@ -25305,7 +28476,7 @@ exports['default'] = {
|
|
25305 |
|
25306 |
|
25307 |
/***/ }),
|
25308 |
-
/*
|
25309 |
/***/ (function(module, exports, __webpack_require__) {
|
25310 |
|
25311 |
//! moment.js locale configuration
|
@@ -25477,7 +28648,7 @@ exports['default'] = {
|
|
25477 |
|
25478 |
|
25479 |
/***/ }),
|
25480 |
-
/*
|
25481 |
/***/ (function(module, exports, __webpack_require__) {
|
25482 |
|
25483 |
//! moment.js locale configuration
|
@@ -25536,276 +28707,276 @@ exports['default'] = {
|
|
25536 |
yy: '%d سنوات',
|
25537 |
},
|
25538 |
week: {
|
25539 |
-
dow: 0, // Sunday is the first day of the week.
|
25540 |
-
doy: 12, // The week that contains Jan 12th is the first week of the year.
|
25541 |
-
},
|
25542 |
-
});
|
25543 |
-
|
25544 |
-
return arKw;
|
25545 |
-
|
25546 |
-
})));
|
25547 |
-
|
25548 |
-
|
25549 |
-
/***/ }),
|
25550 |
-
/*
|
25551 |
-
/***/ (function(module, exports, __webpack_require__) {
|
25552 |
-
|
25553 |
-
//! moment.js locale configuration
|
25554 |
-
//! locale : Arabic (Lybia) [ar-ly]
|
25555 |
-
//! author : Ali Hmer: https://github.com/kikoanis
|
25556 |
-
|
25557 |
-
;(function (global, factory) {
|
25558 |
-
true ? factory(__webpack_require__(0)) :
|
25559 |
-
typeof define === 'function' && define.amd ? define(['../moment'], factory) :
|
25560 |
-
factory(global.moment)
|
25561 |
-
}(this, (function (moment) { 'use strict';
|
25562 |
-
|
25563 |
-
//! moment.js locale configuration
|
25564 |
-
|
25565 |
-
var symbolMap = {
|
25566 |
-
|
25567 |
-
|
25568 |
-
|
25569 |
-
|
25570 |
-
|
25571 |
-
|
25572 |
-
|
25573 |
-
|
25574 |
-
|
25575 |
-
|
25576 |
-
},
|
25577 |
-
pluralForm = function (n) {
|
25578 |
-
return n === 0
|
25579 |
-
? 0
|
25580 |
-
: n === 1
|
25581 |
-
? 1
|
25582 |
-
: n === 2
|
25583 |
-
? 2
|
25584 |
-
: n % 100 >= 3 && n % 100 <= 10
|
25585 |
-
? 3
|
25586 |
-
: n % 100 >= 11
|
25587 |
-
? 4
|
25588 |
-
: 5;
|
25589 |
-
},
|
25590 |
-
plurals = {
|
25591 |
-
s: [
|
25592 |
-
'أقل من ثانية',
|
25593 |
-
'ثانية واحدة',
|
25594 |
-
['ثانيتان', 'ثانيتين'],
|
25595 |
-
'%d ثوان',
|
25596 |
-
'%d ثانية',
|
25597 |
-
'%d ثانية',
|
25598 |
-
],
|
25599 |
-
m: [
|
25600 |
-
'أقل من دقيقة',
|
25601 |
-
'دقيقة واحدة',
|
25602 |
-
['دقيقتان', 'دقيقتين'],
|
25603 |
-
'%d دقائق',
|
25604 |
-
'%d دقيقة',
|
25605 |
-
'%d دقيقة',
|
25606 |
-
],
|
25607 |
-
h: [
|
25608 |
-
'أقل من ساعة',
|
25609 |
-
'ساعة واحدة',
|
25610 |
-
['ساعتان', 'ساعتين'],
|
25611 |
-
'%d ساعات',
|
25612 |
-
'%d ساعة',
|
25613 |
-
'%d ساعة',
|
25614 |
-
],
|
25615 |
-
d: [
|
25616 |
-
'أقل من يوم',
|
25617 |
-
'يوم واحد',
|
25618 |
-
['يومان', 'يومين'],
|
25619 |
-
'%d أيام',
|
25620 |
-
'%d يومًا',
|
25621 |
-
'%d يوم',
|
25622 |
-
],
|
25623 |
-
M: [
|
25624 |
-
'أقل من شهر',
|
25625 |
-
'شهر واحد',
|
25626 |
-
['شهران', 'شهرين'],
|
25627 |
-
'%d أشهر',
|
25628 |
-
'%d شهرا',
|
25629 |
-
'%d شهر',
|
25630 |
-
],
|
25631 |
-
y: [
|
25632 |
-
'أقل من عام',
|
25633 |
-
'عام واحد',
|
25634 |
-
['عامان', 'عامين'],
|
25635 |
-
'%d أعوام',
|
25636 |
-
'%d عامًا',
|
25637 |
-
'%d عام',
|
25638 |
-
],
|
25639 |
-
},
|
25640 |
-
pluralize = function (u) {
|
25641 |
-
return function (number, withoutSuffix, string, isFuture) {
|
25642 |
-
var f = pluralForm(number),
|
25643 |
-
str = plurals[u][pluralForm(number)];
|
25644 |
-
if (f === 2) {
|
25645 |
-
str = str[withoutSuffix ? 0 : 1];
|
25646 |
-
}
|
25647 |
-
return str.replace(/%d/i, number);
|
25648 |
-
};
|
25649 |
-
},
|
25650 |
-
months = [
|
25651 |
-
'يناير',
|
25652 |
-
'فبراير',
|
25653 |
-
'مارس',
|
25654 |
-
'أبريل',
|
25655 |
-
'مايو',
|
25656 |
-
'يونيو',
|
25657 |
-
'يوليو',
|
25658 |
-
'أغسطس',
|
25659 |
-
'سبتمبر',
|
25660 |
-
'أكتوبر',
|
25661 |
-
'نوفمبر',
|
25662 |
-
'ديسمبر',
|
25663 |
-
];
|
25664 |
-
|
25665 |
-
var arLy = moment.defineLocale('ar-ly', {
|
25666 |
-
months: months,
|
25667 |
-
monthsShort: months,
|
25668 |
-
weekdays: 'الأحد_الإثنين_الثلاثاء_الأربعاء_الخميس_الجمعة_السبت'.split('_'),
|
25669 |
-
weekdaysShort: 'أحد_إثنين_ثلاثاء_أربعاء_خميس_جمعة_سبت'.split('_'),
|
25670 |
-
weekdaysMin: 'ح_ن_ث_ر_خ_ج_س'.split('_'),
|
25671 |
-
weekdaysParseExact: true,
|
25672 |
-
longDateFormat: {
|
25673 |
-
LT: 'HH:mm',
|
25674 |
-
LTS: 'HH:mm:ss',
|
25675 |
-
L: 'D/\u200FM/\u200FYYYY',
|
25676 |
-
LL: 'D MMMM YYYY',
|
25677 |
-
LLL: 'D MMMM YYYY HH:mm',
|
25678 |
-
LLLL: 'dddd D MMMM YYYY HH:mm',
|
25679 |
-
},
|
25680 |
-
meridiemParse: /ص|م/,
|
25681 |
-
isPM: function (input) {
|
25682 |
-
return 'م' === input;
|
25683 |
-
},
|
25684 |
-
meridiem: function (hour, minute, isLower) {
|
25685 |
-
if (hour < 12) {
|
25686 |
-
return 'ص';
|
25687 |
-
} else {
|
25688 |
-
return 'م';
|
25689 |
-
}
|
25690 |
-
},
|
25691 |
-
calendar: {
|
25692 |
-
sameDay: '[اليوم عند الساعة] LT',
|
25693 |
-
nextDay: '[غدًا عند الساعة] LT',
|
25694 |
-
nextWeek: 'dddd [عند الساعة] LT',
|
25695 |
-
lastDay: '[أمس عند الساعة] LT',
|
25696 |
-
lastWeek: 'dddd [عند الساعة] LT',
|
25697 |
-
sameElse: 'L',
|
25698 |
-
},
|
25699 |
-
relativeTime: {
|
25700 |
-
future: 'بعد %s',
|
25701 |
-
past: 'منذ %s',
|
25702 |
-
s: pluralize('s'),
|
25703 |
-
ss: pluralize('s'),
|
25704 |
-
m: pluralize('m'),
|
25705 |
-
mm: pluralize('m'),
|
25706 |
-
h: pluralize('h'),
|
25707 |
-
hh: pluralize('h'),
|
25708 |
-
d: pluralize('d'),
|
25709 |
-
dd: pluralize('d'),
|
25710 |
-
M: pluralize('M'),
|
25711 |
-
MM: pluralize('M'),
|
25712 |
-
y: pluralize('y'),
|
25713 |
-
yy: pluralize('y'),
|
25714 |
-
},
|
25715 |
-
preparse: function (string) {
|
25716 |
-
return string.replace(/،/g, ',');
|
25717 |
-
},
|
25718 |
-
postformat: function (string) {
|
25719 |
-
return string
|
25720 |
-
.replace(/\d/g, function (match) {
|
25721 |
-
return symbolMap[match];
|
25722 |
-
})
|
25723 |
-
.replace(/,/g, '،');
|
25724 |
-
},
|
25725 |
-
week: {
|
25726 |
-
dow: 6, // Saturday is the first day of the week.
|
25727 |
-
doy: 12, // The week that contains Jan 12th is the first week of the year.
|
25728 |
-
},
|
25729 |
-
});
|
25730 |
-
|
25731 |
-
return arLy;
|
25732 |
-
|
25733 |
-
})));
|
25734 |
-
|
25735 |
-
|
25736 |
-
/***/ }),
|
25737 |
-
/* 213 */
|
25738 |
-
/***/ (function(module, exports, __webpack_require__) {
|
25739 |
-
|
25740 |
-
//! moment.js locale configuration
|
25741 |
-
//! locale : Arabic (Morocco) [ar-ma]
|
25742 |
-
//! author : ElFadili Yassine : https://github.com/ElFadiliY
|
25743 |
-
//! author : Abdel Said : https://github.com/abdelsaid
|
25744 |
-
|
25745 |
-
;(function (global, factory) {
|
25746 |
-
true ? factory(__webpack_require__(0)) :
|
25747 |
-
typeof define === 'function' && define.amd ? define(['../moment'], factory) :
|
25748 |
-
factory(global.moment)
|
25749 |
-
}(this, (function (moment) { 'use strict';
|
25750 |
-
|
25751 |
-
//! moment.js locale configuration
|
25752 |
-
|
25753 |
-
var arMa = moment.defineLocale('ar-ma', {
|
25754 |
-
months: 'يناير_فبراير_مارس_أبريل_ماي_يونيو_يوليوز_غشت_شتنبر_أكتوبر_نونبر_دجنبر'.split(
|
25755 |
-
'_'
|
25756 |
-
),
|
25757 |
-
monthsShort: 'يناير_فبراير_مارس_أبريل_ماي_يونيو_يوليوز_غشت_شتنبر_أكتوبر_نونبر_دجنبر'.split(
|
25758 |
-
'_'
|
25759 |
-
),
|
25760 |
-
weekdays: 'الأحد_الإثنين_الثلاثاء_الأربعاء_الخميس_الجمعة_السبت'.split('_'),
|
25761 |
-
weekdaysShort: 'احد_اثنين_ثلاثاء_اربعاء_خميس_جمعة_سبت'.split('_'),
|
25762 |
-
weekdaysMin: 'ح_ن_ث_ر_خ_ج_س'.split('_'),
|
25763 |
-
weekdaysParseExact: true,
|
25764 |
-
longDateFormat: {
|
25765 |
-
LT: 'HH:mm',
|
25766 |
-
LTS: 'HH:mm:ss',
|
25767 |
-
L: 'DD/MM/YYYY',
|
25768 |
-
LL: 'D MMMM YYYY',
|
25769 |
-
LLL: 'D MMMM YYYY HH:mm',
|
25770 |
-
LLLL: 'dddd D MMMM YYYY HH:mm',
|
25771 |
-
},
|
25772 |
-
calendar: {
|
25773 |
-
sameDay: '[اليوم على الساعة] LT',
|
25774 |
-
nextDay: '[غدا على الساعة] LT',
|
25775 |
-
nextWeek: 'dddd [على الساعة] LT',
|
25776 |
-
lastDay: '[أمس على الساعة] LT',
|
25777 |
-
lastWeek: 'dddd [على الساعة] LT',
|
25778 |
-
sameElse: 'L',
|
25779 |
-
},
|
25780 |
-
relativeTime: {
|
25781 |
-
future: 'في %s',
|
25782 |
-
past: 'منذ %s',
|
25783 |
-
s: 'ثوان',
|
25784 |
-
ss: '%d ثانية',
|
25785 |
-
m: 'دقيقة',
|
25786 |
-
mm: '%d دقائق',
|
25787 |
-
h: 'ساعة',
|
25788 |
-
hh: '%d ساعات',
|
25789 |
-
d: 'يوم',
|
25790 |
-
dd: '%d أيام',
|
25791 |
-
M: 'شهر',
|
25792 |
-
MM: '%d أشهر',
|
25793 |
-
y: 'سنة',
|
25794 |
-
yy: '%d سنوات',
|
25795 |
-
},
|
25796 |
-
week: {
|
25797 |
dow: 6, // Saturday is the first day of the week.
|
25798 |
doy: 12, // The week that contains Jan 12th is the first week of the year.
|
25799 |
},
|
25800 |
});
|
25801 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
25802 |
return arMa;
|
25803 |
|
25804 |
})));
|
25805 |
|
25806 |
|
25807 |
/***/ }),
|
25808 |
-
/*
|
25809 |
/***/ (function(module, exports, __webpack_require__) {
|
25810 |
|
25811 |
//! moment.js locale configuration
|
@@ -25821,16 +28992,16 @@ exports['default'] = {
|
|
25821 |
//! moment.js locale configuration
|
25822 |
|
25823 |
var symbolMap = {
|
25824 |
-
|
25825 |
-
|
25826 |
-
|
25827 |
-
|
25828 |
-
|
25829 |
-
|
25830 |
-
|
25831 |
-
|
25832 |
-
|
25833 |
-
|
25834 |
},
|
25835 |
numberMap = {
|
25836 |
'١': '1',
|
@@ -25925,7 +29096,7 @@ exports['default'] = {
|
|
25925 |
|
25926 |
|
25927 |
/***/ }),
|
25928 |
-
/*
|
25929 |
/***/ (function(module, exports, __webpack_require__) {
|
25930 |
|
25931 |
//! moment.js locale configuration
|
@@ -25995,7 +29166,7 @@ exports['default'] = {
|
|
25995 |
|
25996 |
|
25997 |
/***/ }),
|
25998 |
-
/*
|
25999 |
/***/ (function(module, exports, __webpack_require__) {
|
26000 |
|
26001 |
//! moment.js locale configuration
|
@@ -26061,7 +29232,7 @@ exports['default'] = {
|
|
26061 |
relativeTime: {
|
26062 |
future: '%s sonra',
|
26063 |
past: '%s əvvəl',
|
26064 |
-
s: '
|
26065 |
ss: '%d saniyə',
|
26066 |
m: 'bir dəqiqə',
|
26067 |
mm: '%d dəqiqə',
|
@@ -26112,7 +29283,7 @@ exports['default'] = {
|
|
26112 |
|
26113 |
|
26114 |
/***/ }),
|
26115 |
-
/*
|
26116 |
/***/ (function(module, exports, __webpack_require__) {
|
26117 |
|
26118 |
//! moment.js locale configuration
|
@@ -26269,7 +29440,7 @@ exports['default'] = {
|
|
26269 |
|
26270 |
|
26271 |
/***/ }),
|
26272 |
-
/*
|
26273 |
/***/ (function(module, exports, __webpack_require__) {
|
26274 |
|
26275 |
//! moment.js locale configuration
|
@@ -26333,6 +29504,8 @@ exports['default'] = {
|
|
26333 |
hh: '%d часа',
|
26334 |
d: 'ден',
|
26335 |
dd: '%d дена',
|
|
|
|
|
26336 |
M: 'месец',
|
26337 |
MM: '%d месеца',
|
26338 |
y: 'година',
|
@@ -26370,7 +29543,7 @@ exports['default'] = {
|
|
26370 |
|
26371 |
|
26372 |
/***/ }),
|
26373 |
-
/*
|
26374 |
/***/ (function(module, exports, __webpack_require__) {
|
26375 |
|
26376 |
//! moment.js locale configuration
|
@@ -26437,7 +29610,7 @@ exports['default'] = {
|
|
26437 |
|
26438 |
|
26439 |
/***/ }),
|
26440 |
-
/*
|
26441 |
/***/ (function(module, exports, __webpack_require__) {
|
26442 |
|
26443 |
//! moment.js locale configuration
|
@@ -26453,16 +29626,16 @@ exports['default'] = {
|
|
26453 |
//! moment.js locale configuration
|
26454 |
|
26455 |
var symbolMap = {
|
26456 |
-
|
26457 |
-
|
26458 |
-
|
26459 |
-
|
26460 |
-
|
26461 |
-
|
26462 |
-
|
26463 |
-
|
26464 |
-
|
26465 |
-
|
26466 |
},
|
26467 |
numberMap = {
|
26468 |
'১': '1',
|
@@ -26571,7 +29744,151 @@ exports['default'] = {
|
|
26571 |
|
26572 |
|
26573 |
/***/ }),
|
26574 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
26575 |
/***/ (function(module, exports, __webpack_require__) {
|
26576 |
|
26577 |
//! moment.js locale configuration
|
@@ -26587,16 +29904,16 @@ exports['default'] = {
|
|
26587 |
//! moment.js locale configuration
|
26588 |
|
26589 |
var symbolMap = {
|
26590 |
-
|
26591 |
-
|
26592 |
-
|
26593 |
-
|
26594 |
-
|
26595 |
-
|
26596 |
-
|
26597 |
-
|
26598 |
-
|
26599 |
-
|
26600 |
},
|
26601 |
numberMap = {
|
26602 |
'༡': '1',
|
@@ -26709,7 +30026,7 @@ exports['default'] = {
|
|
26709 |
|
26710 |
|
26711 |
/***/ }),
|
26712 |
-
/*
|
26713 |
/***/ (function(module, exports, __webpack_require__) {
|
26714 |
|
26715 |
//! moment.js locale configuration
|
@@ -26890,7 +30207,7 @@ exports['default'] = {
|
|
26890 |
|
26891 |
|
26892 |
/***/ }),
|
26893 |
-
/*
|
26894 |
/***/ (function(module, exports, __webpack_require__) {
|
26895 |
|
26896 |
//! moment.js locale configuration
|
@@ -27055,7 +30372,7 @@ exports['default'] = {
|
|
27055 |
|
27056 |
|
27057 |
/***/ }),
|
27058 |
-
/*
|
27059 |
/***/ (function(module, exports, __webpack_require__) {
|
27060 |
|
27061 |
//! moment.js locale configuration
|
@@ -27168,7 +30485,7 @@ exports['default'] = {
|
|
27168 |
|
27169 |
|
27170 |
/***/ }),
|
27171 |
-
/*
|
27172 |
/***/ (function(module, exports, __webpack_require__) {
|
27173 |
|
27174 |
//! moment.js locale configuration
|
@@ -27355,7 +30672,7 @@ exports['default'] = {
|
|
27355 |
|
27356 |
|
27357 |
/***/ }),
|
27358 |
-
/*
|
27359 |
/***/ (function(module, exports, __webpack_require__) {
|
27360 |
|
27361 |
//! moment.js locale configuration
|
@@ -27433,7 +30750,7 @@ exports['default'] = {
|
|
27433 |
|
27434 |
|
27435 |
/***/ }),
|
27436 |
-
/*
|
27437 |
/***/ (function(module, exports, __webpack_require__) {
|
27438 |
|
27439 |
//! moment.js locale configuration
|
@@ -27546,7 +30863,7 @@ exports['default'] = {
|
|
27546 |
|
27547 |
|
27548 |
/***/ }),
|
27549 |
-
/*
|
27550 |
/***/ (function(module, exports, __webpack_require__) {
|
27551 |
|
27552 |
//! moment.js locale configuration
|
@@ -27615,7 +30932,7 @@ exports['default'] = {
|
|
27615 |
|
27616 |
|
27617 |
/***/ }),
|
27618 |
-
/*
|
27619 |
/***/ (function(module, exports, __webpack_require__) {
|
27620 |
|
27621 |
//! moment.js locale configuration
|
@@ -27638,6 +30955,7 @@ exports['default'] = {
|
|
27638 |
h: ['eine Stunde', 'einer Stunde'],
|
27639 |
d: ['ein Tag', 'einem Tag'],
|
27640 |
dd: [number + ' Tage', number + ' Tagen'],
|
|
|
27641 |
M: ['ein Monat', 'einem Monat'],
|
27642 |
MM: [number + ' Monate', number + ' Monaten'],
|
27643 |
y: ['ein Jahr', 'einem Jahr'],
|
@@ -27687,6 +31005,8 @@ exports['default'] = {
|
|
27687 |
hh: '%d Stunden',
|
27688 |
d: processRelativeTime,
|
27689 |
dd: processRelativeTime,
|
|
|
|
|
27690 |
M: processRelativeTime,
|
27691 |
MM: processRelativeTime,
|
27692 |
y: processRelativeTime,
|
@@ -27706,7 +31026,7 @@ exports['default'] = {
|
|
27706 |
|
27707 |
|
27708 |
/***/ }),
|
27709 |
-
/*
|
27710 |
/***/ (function(module, exports, __webpack_require__) {
|
27711 |
|
27712 |
//! moment.js locale configuration
|
@@ -27730,6 +31050,7 @@ exports['default'] = {
|
|
27730 |
h: ['eine Stunde', 'einer Stunde'],
|
27731 |
d: ['ein Tag', 'einem Tag'],
|
27732 |
dd: [number + ' Tage', number + ' Tagen'],
|
|
|
27733 |
M: ['ein Monat', 'einem Monat'],
|
27734 |
MM: [number + ' Monate', number + ' Monaten'],
|
27735 |
y: ['ein Jahr', 'einem Jahr'],
|
@@ -27779,6 +31100,8 @@ exports['default'] = {
|
|
27779 |
hh: '%d Stunden',
|
27780 |
d: processRelativeTime,
|
27781 |
dd: processRelativeTime,
|
|
|
|
|
27782 |
M: processRelativeTime,
|
27783 |
MM: processRelativeTime,
|
27784 |
y: processRelativeTime,
|
@@ -27798,7 +31121,7 @@ exports['default'] = {
|
|
27798 |
|
27799 |
|
27800 |
/***/ }),
|
27801 |
-
/*
|
27802 |
/***/ (function(module, exports, __webpack_require__) {
|
27803 |
|
27804 |
//! moment.js locale configuration
|
@@ -27819,6 +31142,7 @@ exports['default'] = {
|
|
27819 |
h: ['eine Stunde', 'einer Stunde'],
|
27820 |
d: ['ein Tag', 'einem Tag'],
|
27821 |
dd: [number + ' Tage', number + ' Tagen'],
|
|
|
27822 |
M: ['ein Monat', 'einem Monat'],
|
27823 |
MM: [number + ' Monate', number + ' Monaten'],
|
27824 |
y: ['ein Jahr', 'einem Jahr'],
|
@@ -27868,6 +31192,8 @@ exports['default'] = {
|
|
27868 |
hh: '%d Stunden',
|
27869 |
d: processRelativeTime,
|
27870 |
dd: processRelativeTime,
|
|
|
|
|
27871 |
M: processRelativeTime,
|
27872 |
MM: processRelativeTime,
|
27873 |
y: processRelativeTime,
|
@@ -27887,7 +31213,7 @@ exports['default'] = {
|
|
27887 |
|
27888 |
|
27889 |
/***/ }),
|
27890 |
-
/*
|
27891 |
/***/ (function(module, exports, __webpack_require__) {
|
27892 |
|
27893 |
//! moment.js locale configuration
|
@@ -27993,7 +31319,7 @@ exports['default'] = {
|
|
27993 |
|
27994 |
|
27995 |
/***/ }),
|
27996 |
-
/*
|
27997 |
/***/ (function(module, exports, __webpack_require__) {
|
27998 |
|
27999 |
//! moment.js locale configuration
|
@@ -28113,7 +31439,7 @@ exports['default'] = {
|
|
28113 |
|
28114 |
|
28115 |
/***/ }),
|
28116 |
-
/*
|
28117 |
/***/ (function(module, exports, __webpack_require__) {
|
28118 |
|
28119 |
//! moment.js locale configuration
|
@@ -28197,7 +31523,7 @@ exports['default'] = {
|
|
28197 |
|
28198 |
|
28199 |
/***/ }),
|
28200 |
-
/*
|
28201 |
/***/ (function(module, exports, __webpack_require__) {
|
28202 |
|
28203 |
//! moment.js locale configuration
|
@@ -28277,7 +31603,7 @@ exports['default'] = {
|
|
28277 |
|
28278 |
|
28279 |
/***/ }),
|
28280 |
-
/*
|
28281 |
/***/ (function(module, exports, __webpack_require__) {
|
28282 |
|
28283 |
//! moment.js locale configuration
|
@@ -28361,7 +31687,7 @@ exports['default'] = {
|
|
28361 |
|
28362 |
|
28363 |
/***/ }),
|
28364 |
-
/*
|
28365 |
/***/ (function(module, exports, __webpack_require__) {
|
28366 |
|
28367 |
//! moment.js locale configuration
|
@@ -28445,7 +31771,7 @@ exports['default'] = {
|
|
28445 |
|
28446 |
|
28447 |
/***/ }),
|
28448 |
-
/*
|
28449 |
/***/ (function(module, exports, __webpack_require__) {
|
28450 |
|
28451 |
//! moment.js locale configuration
|
@@ -28525,7 +31851,7 @@ exports['default'] = {
|
|
28525 |
|
28526 |
|
28527 |
/***/ }),
|
28528 |
-
/*
|
28529 |
/***/ (function(module, exports, __webpack_require__) {
|
28530 |
|
28531 |
//! moment.js locale configuration
|
@@ -28609,7 +31935,7 @@ exports['default'] = {
|
|
28609 |
|
28610 |
|
28611 |
/***/ }),
|
28612 |
-
/*
|
28613 |
/***/ (function(module, exports, __webpack_require__) {
|
28614 |
|
28615 |
//! moment.js locale configuration
|
@@ -28693,7 +32019,7 @@ exports['default'] = {
|
|
28693 |
|
28694 |
|
28695 |
/***/ }),
|
28696 |
-
/*
|
28697 |
/***/ (function(module, exports, __webpack_require__) {
|
28698 |
|
28699 |
//! moment.js locale configuration
|
@@ -28777,7 +32103,7 @@ exports['default'] = {
|
|
28777 |
|
28778 |
|
28779 |
/***/ }),
|
28780 |
-
/*
|
28781 |
/***/ (function(module, exports, __webpack_require__) {
|
28782 |
|
28783 |
//! moment.js locale configuration
|
@@ -28861,7 +32187,7 @@ exports['default'] = {
|
|
28861 |
|
28862 |
|
28863 |
/***/ }),
|
28864 |
-
/*
|
28865 |
/***/ (function(module, exports, __webpack_require__) {
|
28866 |
|
28867 |
//! moment.js locale configuration
|
@@ -28961,6 +32287,8 @@ exports['default'] = {
|
|
28961 |
hh: '%d horas',
|
28962 |
d: 'un día',
|
28963 |
dd: '%d días',
|
|
|
|
|
28964 |
M: 'un mes',
|
28965 |
MM: '%d meses',
|
28966 |
y: 'un año',
|
@@ -28972,7 +32300,7 @@ exports['default'] = {
|
|
28972 |
dow: 1, // Monday is the first day of the week.
|
28973 |
doy: 4, // The week that contains Jan 4th is the first week of the year.
|
28974 |
},
|
28975 |
-
invalidDate: 'Fecha
|
28976 |
});
|
28977 |
|
28978 |
return es;
|
@@ -28981,7 +32309,7 @@ exports['default'] = {
|
|
28981 |
|
28982 |
|
28983 |
/***/ }),
|
28984 |
-
/*
|
28985 |
/***/ (function(module, exports, __webpack_require__) {
|
28986 |
|
28987 |
//! moment.js locale configuration
|
@@ -29080,6 +32408,8 @@ exports['default'] = {
|
|
29080 |
hh: '%d horas',
|
29081 |
d: 'un día',
|
29082 |
dd: '%d días',
|
|
|
|
|
29083 |
M: 'un mes',
|
29084 |
MM: '%d meses',
|
29085 |
y: 'un año',
|
@@ -29099,7 +32429,129 @@ exports['default'] = {
|
|
29099 |
|
29100 |
|
29101 |
/***/ }),
|
29102 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
29103 |
/***/ (function(module, exports, __webpack_require__) {
|
29104 |
|
29105 |
//! moment.js locale configuration
|
@@ -29200,6 +32652,8 @@ exports['default'] = {
|
|
29200 |
hh: '%d horas',
|
29201 |
d: 'un día',
|
29202 |
dd: '%d días',
|
|
|
|
|
29203 |
M: 'un mes',
|
29204 |
MM: '%d meses',
|
29205 |
y: 'un año',
|
@@ -29219,7 +32673,7 @@ exports['default'] = {
|
|
29219 |
|
29220 |
|
29221 |
/***/ }),
|
29222 |
-
/*
|
29223 |
/***/ (function(module, exports, __webpack_require__) {
|
29224 |
|
29225 |
//! moment.js locale configuration
|
@@ -29313,7 +32767,7 @@ exports['default'] = {
|
|
29313 |
|
29314 |
|
29315 |
/***/ }),
|
29316 |
-
/*
|
29317 |
/***/ (function(module, exports, __webpack_require__) {
|
29318 |
|
29319 |
//! moment.js locale configuration
|
@@ -29392,7 +32846,7 @@ exports['default'] = {
|
|
29392 |
|
29393 |
|
29394 |
/***/ }),
|
29395 |
-
/*
|
29396 |
/***/ (function(module, exports, __webpack_require__) {
|
29397 |
|
29398 |
//! moment.js locale configuration
|
@@ -29408,16 +32862,16 @@ exports['default'] = {
|
|
29408 |
//! moment.js locale configuration
|
29409 |
|
29410 |
var symbolMap = {
|
29411 |
-
|
29412 |
-
|
29413 |
-
|
29414 |
-
|
29415 |
-
|
29416 |
-
|
29417 |
-
|
29418 |
-
|
29419 |
-
|
29420 |
-
|
29421 |
},
|
29422 |
numberMap = {
|
29423 |
'۱': '1',
|
@@ -29518,7 +32972,7 @@ exports['default'] = {
|
|
29518 |
|
29519 |
|
29520 |
/***/ }),
|
29521 |
-
/*
|
29522 |
/***/ (function(module, exports, __webpack_require__) {
|
29523 |
|
29524 |
//! moment.js locale configuration
|
@@ -29554,7 +33008,8 @@ exports['default'] = {
|
|
29554 |
case 's':
|
29555 |
return isFuture ? 'muutaman sekunnin' : 'muutama sekunti';
|
29556 |
case 'ss':
|
29557 |
-
|
|
|
29558 |
case 'm':
|
29559 |
return isFuture ? 'minuutin' : 'minuutti';
|
29560 |
case 'mm':
|
@@ -29654,7 +33109,7 @@ exports['default'] = {
|
|
29654 |
|
29655 |
|
29656 |
/***/ }),
|
29657 |
-
/*
|
29658 |
/***/ (function(module, exports, __webpack_require__) {
|
29659 |
|
29660 |
//! moment.js locale configuration
|
@@ -29728,7 +33183,7 @@ exports['default'] = {
|
|
29728 |
|
29729 |
|
29730 |
/***/ }),
|
29731 |
-
/*
|
29732 |
/***/ (function(module, exports, __webpack_require__) {
|
29733 |
|
29734 |
//! moment.js locale configuration
|
@@ -29800,7 +33255,7 @@ exports['default'] = {
|
|
29800 |
|
29801 |
|
29802 |
/***/ }),
|
29803 |
-
/*
|
29804 |
/***/ (function(module, exports, __webpack_require__) {
|
29805 |
|
29806 |
//! moment.js locale configuration
|
@@ -29815,6 +33270,24 @@ exports['default'] = {
|
|
29815 |
|
29816 |
//! moment.js locale configuration
|
29817 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
29818 |
var fr = moment.defineLocale('fr', {
|
29819 |
months: 'janvier_février_mars_avril_mai_juin_juillet_août_septembre_octobre_novembre_décembre'.split(
|
29820 |
'_'
|
@@ -29822,7 +33295,13 @@ exports['default'] = {
|
|
29822 |
monthsShort: 'janv._févr._mars_avr._mai_juin_juil._août_sept._oct._nov._déc.'.split(
|
29823 |
'_'
|
29824 |
),
|
29825 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
29826 |
weekdays: 'dimanche_lundi_mardi_mercredi_jeudi_vendredi_samedi'.split('_'),
|
29827 |
weekdaysShort: 'dim._lun._mar._mer._jeu._ven._sam.'.split('_'),
|
29828 |
weekdaysMin: 'di_lu_ma_me_je_ve_sa'.split('_'),
|
@@ -29854,6 +33333,8 @@ exports['default'] = {
|
|
29854 |
hh: '%d heures',
|
29855 |
d: 'un jour',
|
29856 |
dd: '%d jours',
|
|
|
|
|
29857 |
M: 'un mois',
|
29858 |
MM: '%d mois',
|
29859 |
y: 'un an',
|
@@ -29894,7 +33375,7 @@ exports['default'] = {
|
|
29894 |
|
29895 |
|
29896 |
/***/ }),
|
29897 |
-
/*
|
29898 |
/***/ (function(module, exports, __webpack_require__) {
|
29899 |
|
29900 |
//! moment.js locale configuration
|
@@ -29979,7 +33460,7 @@ exports['default'] = {
|
|
29979 |
|
29980 |
|
29981 |
/***/ }),
|
29982 |
-
/*
|
29983 |
/***/ (function(module, exports, __webpack_require__) {
|
29984 |
|
29985 |
//! moment.js locale configuration
|
@@ -30068,7 +33549,7 @@ exports['default'] = {
|
|
30068 |
|
30069 |
|
30070 |
/***/ }),
|
30071 |
-
/*
|
30072 |
/***/ (function(module, exports, __webpack_require__) {
|
30073 |
|
30074 |
//! moment.js locale configuration
|
@@ -30161,7 +33642,7 @@ exports['default'] = {
|
|
30161 |
|
30162 |
|
30163 |
/***/ }),
|
30164 |
-
/*
|
30165 |
/***/ (function(module, exports, __webpack_require__) {
|
30166 |
|
30167 |
//! moment.js locale configuration
|
@@ -30272,7 +33753,7 @@ exports['default'] = {
|
|
30272 |
|
30273 |
|
30274 |
/***/ }),
|
30275 |
-
/*
|
30276 |
/***/ (function(module, exports, __webpack_require__) {
|
30277 |
|
30278 |
//! moment.js locale configuration
|
@@ -30383,7 +33864,7 @@ exports['default'] = {
|
|
30383 |
|
30384 |
|
30385 |
/***/ }),
|
30386 |
-
/*
|
30387 |
/***/ (function(module, exports, __webpack_require__) {
|
30388 |
|
30389 |
//! moment.js locale configuration
|
@@ -30473,7 +33954,7 @@ exports['default'] = {
|
|
30473 |
|
30474 |
|
30475 |
/***/ }),
|
30476 |
-
/*
|
30477 |
/***/ (function(module, exports, __webpack_require__) {
|
30478 |
|
30479 |
//! moment.js locale configuration
|
@@ -30574,8 +34055,8 @@ exports['default'] = {
|
|
30574 |
}
|
30575 |
},
|
30576 |
week: {
|
30577 |
-
dow:
|
30578 |
-
doy:
|
30579 |
},
|
30580 |
meridiemParse: /राती|सकाळीं|दनपारां|सांजे/,
|
30581 |
meridiemHour: function (hour, meridiem) {
|
@@ -30613,7 +34094,7 @@ exports['default'] = {
|
|
30613 |
|
30614 |
|
30615 |
/***/ }),
|
30616 |
-
/*
|
30617 |
/***/ (function(module, exports, __webpack_require__) {
|
30618 |
|
30619 |
//! moment.js locale configuration
|
@@ -30714,8 +34195,8 @@ exports['default'] = {
|
|
30714 |
}
|
30715 |
},
|
30716 |
week: {
|
30717 |
-
dow:
|
30718 |
-
doy:
|
30719 |
},
|
30720 |
meridiemParse: /rati|sokallim|donparam|sanje/,
|
30721 |
meridiemHour: function (hour, meridiem) {
|
@@ -30753,7 +34234,7 @@ exports['default'] = {
|
|
30753 |
|
30754 |
|
30755 |
/***/ }),
|
30756 |
-
/*
|
30757 |
/***/ (function(module, exports, __webpack_require__) {
|
30758 |
|
30759 |
//! moment.js locale configuration
|
@@ -30769,16 +34250,16 @@ exports['default'] = {
|
|
30769 |
//! moment.js locale configuration
|
30770 |
|
30771 |
var symbolMap = {
|
30772 |
-
|
30773 |
-
|
30774 |
-
|
30775 |
-
|
30776 |
-
|
30777 |
-
|
30778 |
-
|
30779 |
-
|
30780 |
-
|
30781 |
-
|
30782 |
},
|
30783 |
numberMap = {
|
30784 |
'૧': '1',
|
@@ -30824,7 +34305,7 @@ exports['default'] = {
|
|
30824 |
},
|
30825 |
relativeTime: {
|
30826 |
future: '%s મા',
|
30827 |
-
past: '%s
|
30828 |
s: 'અમુક પળો',
|
30829 |
ss: '%d સેકંડ',
|
30830 |
m: 'એક મિનિટ',
|
@@ -30890,7 +34371,7 @@ exports['default'] = {
|
|
30890 |
|
30891 |
|
30892 |
/***/ }),
|
30893 |
-
/*
|
30894 |
/***/ (function(module, exports, __webpack_require__) {
|
30895 |
|
30896 |
//! moment.js locale configuration
|
@@ -31000,7 +34481,7 @@ exports['default'] = {
|
|
31000 |
|
31001 |
|
31002 |
/***/ }),
|
31003 |
-
/*
|
31004 |
/***/ (function(module, exports, __webpack_require__) {
|
31005 |
|
31006 |
//! moment.js locale configuration
|
@@ -31016,16 +34497,16 @@ exports['default'] = {
|
|
31016 |
//! moment.js locale configuration
|
31017 |
|
31018 |
var symbolMap = {
|
31019 |
-
|
31020 |
-
|
31021 |
-
|
31022 |
-
|
31023 |
-
|
31024 |
-
|
31025 |
-
|
31026 |
-
|
31027 |
-
|
31028 |
-
|
31029 |
},
|
31030 |
numberMap = {
|
31031 |
'१': '1',
|
@@ -31038,16 +34519,48 @@ exports['default'] = {
|
|
31038 |
'८': '8',
|
31039 |
'९': '9',
|
31040 |
'०': '0',
|
31041 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
31042 |
|
31043 |
var hi = moment.defineLocale('hi', {
|
31044 |
-
months:
|
31045 |
-
'_'
|
31046 |
-
|
|
|
|
|
|
|
|
|
|
|
31047 |
monthsShort: 'जन._फ़र._मार्च_अप्रै._मई_जून_जुल._अग._सित._अक्टू._नव._दिस.'.split(
|
31048 |
'_'
|
31049 |
),
|
31050 |
-
monthsParseExact: true,
|
31051 |
weekdays: 'रविवार_सोमवार_मंगलवार_बुधवार_गुरूवार_शुक्रवार_शनिवार'.split('_'),
|
31052 |
weekdaysShort: 'रवि_सोम_मंगल_बुध_गुरू_शुक्र_शनि'.split('_'),
|
31053 |
weekdaysMin: 'र_सो_मं_बु_गु_शु_श'.split('_'),
|
@@ -31059,6 +34572,19 @@ exports['default'] = {
|
|
31059 |
LLL: 'D MMMM YYYY, A h:mm बजे',
|
31060 |
LLLL: 'dddd, D MMMM YYYY, A h:mm बजे',
|
31061 |
},
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
31062 |
calendar: {
|
31063 |
sameDay: '[आज] LT',
|
31064 |
nextDay: '[कल] LT',
|
@@ -31135,7 +34661,7 @@ exports['default'] = {
|
|
31135 |
|
31136 |
|
31137 |
/***/ }),
|
31138 |
-
/*
|
31139 |
/***/ (function(module, exports, __webpack_require__) {
|
31140 |
|
31141 |
//! moment.js locale configuration
|
@@ -31305,12 +34831,13 @@ exports['default'] = {
|
|
31305 |
|
31306 |
|
31307 |
/***/ }),
|
31308 |
-
/*
|
31309 |
/***/ (function(module, exports, __webpack_require__) {
|
31310 |
|
31311 |
//! moment.js locale configuration
|
31312 |
//! locale : Hungarian [hu]
|
31313 |
//! author : Adam Brunner : https://github.com/adambrunner
|
|
|
31314 |
|
31315 |
;(function (global, factory) {
|
31316 |
true ? factory(__webpack_require__(0)) :
|
@@ -31370,9 +34897,10 @@ exports['default'] = {
|
|
31370 |
months: 'január_február_március_április_május_június_július_augusztus_szeptember_október_november_december'.split(
|
31371 |
'_'
|
31372 |
),
|
31373 |
-
monthsShort: '
|
31374 |
'_'
|
31375 |
),
|
|
|
31376 |
weekdays: 'vasárnap_hétfő_kedd_szerda_csütörtök_péntek_szombat'.split('_'),
|
31377 |
weekdaysShort: 'vas_hét_kedd_sze_csüt_pén_szo'.split('_'),
|
31378 |
weekdaysMin: 'v_h_k_sze_cs_p_szo'.split('_'),
|
@@ -31437,7 +34965,7 @@ exports['default'] = {
|
|
31437 |
|
31438 |
|
31439 |
/***/ }),
|
31440 |
-
/*
|
31441 |
/***/ (function(module, exports, __webpack_require__) {
|
31442 |
|
31443 |
//! moment.js locale configuration
|
@@ -31545,7 +35073,7 @@ exports['default'] = {
|
|
31545 |
|
31546 |
|
31547 |
/***/ }),
|
31548 |
-
/*
|
31549 |
/***/ (function(module, exports, __webpack_require__) {
|
31550 |
|
31551 |
//! moment.js locale configuration
|
@@ -31637,7 +35165,7 @@ exports['default'] = {
|
|
31637 |
|
31638 |
|
31639 |
/***/ }),
|
31640 |
-
/*
|
31641 |
/***/ (function(module, exports, __webpack_require__) {
|
31642 |
|
31643 |
//! moment.js locale configuration
|
@@ -31792,7 +35320,7 @@ exports['default'] = {
|
|
31792 |
|
31793 |
|
31794 |
/***/ }),
|
31795 |
-
/*
|
31796 |
/***/ (function(module, exports, __webpack_require__) {
|
31797 |
|
31798 |
//! moment.js locale configuration
|
@@ -31883,9 +35411,7 @@ exports['default'] = {
|
|
31883 |
sameElse: 'L',
|
31884 |
},
|
31885 |
relativeTime: {
|
31886 |
-
future:
|
31887 |
-
return (/^[0-9].+$/.test(s) ? 'tra' : 'in') + ' ' + s;
|
31888 |
-
},
|
31889 |
past: '%s fa',
|
31890 |
s: 'alcuni secondi',
|
31891 |
ss: '%d secondi',
|
@@ -31895,6 +35421,8 @@ exports['default'] = {
|
|
31895 |
hh: '%d ore',
|
31896 |
d: 'un giorno',
|
31897 |
dd: '%d giorni',
|
|
|
|
|
31898 |
M: 'un mese',
|
31899 |
MM: '%d mesi',
|
31900 |
y: 'un anno',
|
@@ -31914,7 +35442,7 @@ exports['default'] = {
|
|
31914 |
|
31915 |
|
31916 |
/***/ }),
|
31917 |
-
/*
|
31918 |
/***/ (function(module, exports, __webpack_require__) {
|
31919 |
|
31920 |
//! moment.js locale configuration
|
@@ -31994,7 +35522,7 @@ exports['default'] = {
|
|
31994 |
|
31995 |
|
31996 |
/***/ }),
|
31997 |
-
/*
|
31998 |
/***/ (function(module, exports, __webpack_require__) {
|
31999 |
|
32000 |
//! moment.js locale configuration
|
@@ -32158,7 +35686,7 @@ exports['default'] = {
|
|
32158 |
|
32159 |
|
32160 |
/***/ }),
|
32161 |
-
/*
|
32162 |
/***/ (function(module, exports, __webpack_require__) {
|
32163 |
|
32164 |
//! moment.js locale configuration
|
@@ -32250,7 +35778,7 @@ exports['default'] = {
|
|
32250 |
|
32251 |
|
32252 |
/***/ }),
|
32253 |
-
/*
|
32254 |
/***/ (function(module, exports, __webpack_require__) {
|
32255 |
|
32256 |
//! moment.js locale configuration
|
@@ -32358,7 +35886,7 @@ exports['default'] = {
|
|
32358 |
|
32359 |
|
32360 |
/***/ }),
|
32361 |
-
/*
|
32362 |
/***/ (function(module, exports, __webpack_require__) {
|
32363 |
|
32364 |
//! moment.js locale configuration
|
@@ -32456,7 +35984,7 @@ exports['default'] = {
|
|
32456 |
|
32457 |
|
32458 |
/***/ }),
|
32459 |
-
/*
|
32460 |
/***/ (function(module, exports, __webpack_require__) {
|
32461 |
|
32462 |
//! moment.js locale configuration
|
@@ -32472,16 +36000,16 @@ exports['default'] = {
|
|
32472 |
//! moment.js locale configuration
|
32473 |
|
32474 |
var symbolMap = {
|
32475 |
-
|
32476 |
-
|
32477 |
-
|
32478 |
-
|
32479 |
-
|
32480 |
-
|
32481 |
-
|
32482 |
-
|
32483 |
-
|
32484 |
-
|
32485 |
},
|
32486 |
numberMap = {
|
32487 |
'១': '1',
|
@@ -32574,7 +36102,7 @@ exports['default'] = {
|
|
32574 |
|
32575 |
|
32576 |
/***/ }),
|
32577 |
-
/*
|
32578 |
/***/ (function(module, exports, __webpack_require__) {
|
32579 |
|
32580 |
//! moment.js locale configuration
|
@@ -32590,16 +36118,16 @@ exports['default'] = {
|
|
32590 |
//! moment.js locale configuration
|
32591 |
|
32592 |
var symbolMap = {
|
32593 |
-
|
32594 |
-
|
32595 |
-
|
32596 |
-
|
32597 |
-
|
32598 |
-
|
32599 |
-
|
32600 |
-
|
32601 |
-
|
32602 |
-
|
32603 |
},
|
32604 |
numberMap = {
|
32605 |
'೧': '1',
|
@@ -32713,7 +36241,7 @@ exports['default'] = {
|
|
32713 |
|
32714 |
|
32715 |
/***/ }),
|
32716 |
-
/*
|
32717 |
/***/ (function(module, exports, __webpack_require__) {
|
32718 |
|
32719 |
//! moment.js locale configuration
|
@@ -32804,7 +36332,7 @@ exports['default'] = {
|
|
32804 |
|
32805 |
|
32806 |
/***/ }),
|
32807 |
-
/*
|
32808 |
/***/ (function(module, exports, __webpack_require__) {
|
32809 |
|
32810 |
//! moment.js locale configuration
|
@@ -32820,16 +36348,16 @@ exports['default'] = {
|
|
32820 |
//! moment.js locale configuration
|
32821 |
|
32822 |
var symbolMap = {
|
32823 |
-
|
32824 |
-
|
32825 |
-
|
32826 |
-
|
32827 |
-
|
32828 |
-
|
32829 |
-
|
32830 |
-
|
32831 |
-
|
32832 |
-
|
32833 |
},
|
32834 |
numberMap = {
|
32835 |
'١': '1',
|
@@ -32938,7 +36466,7 @@ exports['default'] = {
|
|
32938 |
|
32939 |
|
32940 |
/***/ }),
|
32941 |
-
/*
|
32942 |
/***/ (function(module, exports, __webpack_require__) {
|
32943 |
|
32944 |
//! moment.js locale configuration
|
@@ -33038,7 +36566,7 @@ exports['default'] = {
|
|
33038 |
|
33039 |
|
33040 |
/***/ }),
|
33041 |
-
/*
|
33042 |
/***/ (function(module, exports, __webpack_require__) {
|
33043 |
|
33044 |
//! moment.js locale configuration
|
@@ -33189,7 +36717,7 @@ exports['default'] = {
|
|
33189 |
|
33190 |
|
33191 |
/***/ }),
|
33192 |
-
/*
|
33193 |
/***/ (function(module, exports, __webpack_require__) {
|
33194 |
|
33195 |
//! moment.js locale configuration
|
@@ -33270,7 +36798,7 @@ exports['default'] = {
|
|
33270 |
|
33271 |
|
33272 |
/***/ }),
|
33273 |
-
/*
|
33274 |
/***/ (function(module, exports, __webpack_require__) {
|
33275 |
|
33276 |
//! moment.js locale configuration
|
@@ -33409,7 +36937,7 @@ exports['default'] = {
|
|
33409 |
|
33410 |
|
33411 |
/***/ }),
|
33412 |
-
/*
|
33413 |
/***/ (function(module, exports, __webpack_require__) {
|
33414 |
|
33415 |
//! moment.js locale configuration
|
@@ -33518,7 +37046,7 @@ exports['default'] = {
|
|
33518 |
|
33519 |
|
33520 |
/***/ }),
|
33521 |
-
/*
|
33522 |
/***/ (function(module, exports, __webpack_require__) {
|
33523 |
|
33524 |
//! moment.js locale configuration
|
@@ -33652,7 +37180,7 @@ exports['default'] = {
|
|
33652 |
|
33653 |
|
33654 |
/***/ }),
|
33655 |
-
/*
|
33656 |
/***/ (function(module, exports, __webpack_require__) {
|
33657 |
|
33658 |
//! moment.js locale configuration
|
@@ -33727,7 +37255,7 @@ exports['default'] = {
|
|
33727 |
|
33728 |
|
33729 |
/***/ }),
|
33730 |
-
/*
|
33731 |
/***/ (function(module, exports, __webpack_require__) {
|
33732 |
|
33733 |
//! moment.js locale configuration
|
@@ -33829,7 +37357,7 @@ exports['default'] = {
|
|
33829 |
|
33830 |
|
33831 |
/***/ }),
|
33832 |
-
/*
|
33833 |
/***/ (function(module, exports, __webpack_require__) {
|
33834 |
|
33835 |
//! moment.js locale configuration
|
@@ -33925,7 +37453,7 @@ exports['default'] = {
|
|
33925 |
|
33926 |
|
33927 |
/***/ }),
|
33928 |
-
/*
|
33929 |
/***/ (function(module, exports, __webpack_require__) {
|
33930 |
|
33931 |
//! moment.js locale configuration
|
@@ -34040,7 +37568,7 @@ exports['default'] = {
|
|
34040 |
|
34041 |
|
34042 |
/***/ }),
|
34043 |
-
/*
|
34044 |
/***/ (function(module, exports, __webpack_require__) {
|
34045 |
|
34046 |
//! moment.js locale configuration
|
@@ -34057,16 +37585,16 @@ exports['default'] = {
|
|
34057 |
//! moment.js locale configuration
|
34058 |
|
34059 |
var symbolMap = {
|
34060 |
-
|
34061 |
-
|
34062 |
-
|
34063 |
-
|
34064 |
-
|
34065 |
-
|
34066 |
-
|
34067 |
-
|
34068 |
-
|
34069 |
-
|
34070 |
},
|
34071 |
numberMap = {
|
34072 |
'१': '1',
|
@@ -34258,7 +37786,7 @@ exports['default'] = {
|
|
34258 |
|
34259 |
|
34260 |
/***/ }),
|
34261 |
-
/*
|
34262 |
/***/ (function(module, exports, __webpack_require__) {
|
34263 |
|
34264 |
//! moment.js locale configuration
|
@@ -34349,7 +37877,7 @@ exports['default'] = {
|
|
34349 |
|
34350 |
|
34351 |
/***/ }),
|
34352 |
-
/*
|
34353 |
/***/ (function(module, exports, __webpack_require__) {
|
34354 |
|
34355 |
//! moment.js locale configuration
|
@@ -34441,7 +37969,7 @@ exports['default'] = {
|
|
34441 |
|
34442 |
|
34443 |
/***/ }),
|
34444 |
-
/*
|
34445 |
/***/ (function(module, exports, __webpack_require__) {
|
34446 |
|
34447 |
//! moment.js locale configuration
|
@@ -34512,7 +38040,7 @@ exports['default'] = {
|
|
34512 |
|
34513 |
|
34514 |
/***/ }),
|
34515 |
-
/*
|
34516 |
/***/ (function(module, exports, __webpack_require__) {
|
34517 |
|
34518 |
//! moment.js locale configuration
|
@@ -34530,16 +38058,16 @@ exports['default'] = {
|
|
34530 |
//! moment.js locale configuration
|
34531 |
|
34532 |
var symbolMap = {
|
34533 |
-
|
34534 |
-
|
34535 |
-
|
34536 |
-
|
34537 |
-
|
34538 |
-
|
34539 |
-
|
34540 |
-
|
34541 |
-
|
34542 |
-
|
34543 |
},
|
34544 |
numberMap = {
|
34545 |
'၁': '1',
|
@@ -34619,7 +38147,7 @@ exports['default'] = {
|
|
34619 |
|
34620 |
|
34621 |
/***/ }),
|
34622 |
-
/*
|
34623 |
/***/ (function(module, exports, __webpack_require__) {
|
34624 |
|
34625 |
//! moment.js locale configuration
|
@@ -34675,6 +38203,8 @@ exports['default'] = {
|
|
34675 |
hh: '%d timer',
|
34676 |
d: 'en dag',
|
34677 |
dd: '%d dager',
|
|
|
|
|
34678 |
M: 'en måned',
|
34679 |
MM: '%d måneder',
|
34680 |
y: 'ett år',
|
@@ -34694,7 +38224,7 @@ exports['default'] = {
|
|
34694 |
|
34695 |
|
34696 |
/***/ }),
|
34697 |
-
/*
|
34698 |
/***/ (function(module, exports, __webpack_require__) {
|
34699 |
|
34700 |
//! moment.js locale configuration
|
@@ -34710,16 +38240,16 @@ exports['default'] = {
|
|
34710 |
//! moment.js locale configuration
|
34711 |
|
34712 |
var symbolMap = {
|
34713 |
-
|
34714 |
-
|
34715 |
-
|
34716 |
-
|
34717 |
-
|
34718 |
-
|
34719 |
-
|
34720 |
-
|
34721 |
-
|
34722 |
-
|
34723 |
},
|
34724 |
numberMap = {
|
34725 |
'१': '1',
|
@@ -34830,7 +38360,7 @@ exports['default'] = {
|
|
34830 |
|
34831 |
|
34832 |
/***/ }),
|
34833 |
-
/*
|
34834 |
/***/ (function(module, exports, __webpack_require__) {
|
34835 |
|
34836 |
//! moment.js locale configuration
|
@@ -34924,6 +38454,8 @@ exports['default'] = {
|
|
34924 |
hh: '%d uur',
|
34925 |
d: 'één dag',
|
34926 |
dd: '%d dagen',
|
|
|
|
|
34927 |
M: 'één maand',
|
34928 |
MM: '%d maanden',
|
34929 |
y: 'één jaar',
|
@@ -34948,7 +38480,7 @@ exports['default'] = {
|
|
34948 |
|
34949 |
|
34950 |
/***/ }),
|
34951 |
-
/*
|
34952 |
/***/ (function(module, exports, __webpack_require__) {
|
34953 |
|
34954 |
//! moment.js locale configuration
|
@@ -35066,7 +38598,7 @@ exports['default'] = {
|
|
35066 |
|
35067 |
|
35068 |
/***/ }),
|
35069 |
-
/*
|
35070 |
/***/ (function(module, exports, __webpack_require__) {
|
35071 |
|
35072 |
//! moment.js locale configuration
|
@@ -35121,6 +38653,8 @@ exports['default'] = {
|
|
35121 |
hh: '%d timar',
|
35122 |
d: 'ein dag',
|
35123 |
dd: '%d dagar',
|
|
|
|
|
35124 |
M: 'ein månad',
|
35125 |
MM: '%d månader',
|
35126 |
y: 'eit år',
|
@@ -35140,7 +38674,7 @@ exports['default'] = {
|
|
35140 |
|
35141 |
|
35142 |
/***/ }),
|
35143 |
-
/*
|
35144 |
/***/ (function(module, exports, __webpack_require__) {
|
35145 |
|
35146 |
//! moment.js locale configuration
|
@@ -35239,7 +38773,7 @@ exports['default'] = {
|
|
35239 |
|
35240 |
|
35241 |
/***/ }),
|
35242 |
-
/*
|
35243 |
/***/ (function(module, exports, __webpack_require__) {
|
35244 |
|
35245 |
//! moment.js locale configuration
|
@@ -35255,16 +38789,16 @@ exports['default'] = {
|
|
35255 |
//! moment.js locale configuration
|
35256 |
|
35257 |
var symbolMap = {
|
35258 |
-
|
35259 |
-
|
35260 |
-
|
35261 |
-
|
35262 |
-
|
35263 |
-
|
35264 |
-
|
35265 |
-
|
35266 |
-
|
35267 |
-
|
35268 |
},
|
35269 |
numberMap = {
|
35270 |
'੧': '1',
|
@@ -35376,7 +38910,7 @@ exports['default'] = {
|
|
35376 |
|
35377 |
|
35378 |
/***/ }),
|
35379 |
-
/*
|
35380 |
/***/ (function(module, exports, __webpack_require__) {
|
35381 |
|
35382 |
//! moment.js locale configuration
|
@@ -35396,7 +38930,21 @@ exports['default'] = {
|
|
35396 |
),
|
35397 |
monthsSubjective = 'stycznia_lutego_marca_kwietnia_maja_czerwca_lipca_sierpnia_września_października_listopada_grudnia'.split(
|
35398 |
'_'
|
35399 |
-
)
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
35400 |
function plural(n) {
|
35401 |
return n % 10 < 5 && n % 10 > 1 && ~~(n / 10) % 10 !== 1;
|
35402 |
}
|
@@ -35413,6 +38961,8 @@ exports['default'] = {
|
|
35413 |
return withoutSuffix ? 'godzina' : 'godzinę';
|
35414 |
case 'hh':
|
35415 |
return result + (plural(number) ? 'godziny' : 'godzin');
|
|
|
|
|
35416 |
case 'MM':
|
35417 |
return result + (plural(number) ? 'miesiące' : 'miesięcy');
|
35418 |
case 'yy':
|
@@ -35424,17 +38974,6 @@ exports['default'] = {
|
|
35424 |
months: function (momentToFormat, format) {
|
35425 |
if (!momentToFormat) {
|
35426 |
return monthsNominative;
|
35427 |
-
} else if (format === '') {
|
35428 |
-
// Hack: if format empty we know this is used to generate
|
35429 |
-
// RegExp by moment. Give then back both valid forms of months
|
35430 |
-
// in RegExp ready format.
|
35431 |
-
return (
|
35432 |
-
'(' +
|
35433 |
-
monthsSubjective[momentToFormat.month()] +
|
35434 |
-
'|' +
|
35435 |
-
monthsNominative[momentToFormat.month()] +
|
35436 |
-
')'
|
35437 |
-
);
|
35438 |
} else if (/D MMMM/.test(format)) {
|
35439 |
return monthsSubjective[momentToFormat.month()];
|
35440 |
} else {
|
@@ -35442,6 +38981,9 @@ exports['default'] = {
|
|
35442 |
}
|
35443 |
},
|
35444 |
monthsShort: 'sty_lut_mar_kwi_maj_cze_lip_sie_wrz_paź_lis_gru'.split('_'),
|
|
|
|
|
|
|
35445 |
weekdays: 'niedziela_poniedziałek_wtorek_środa_czwartek_piątek_sobota'.split(
|
35446 |
'_'
|
35447 |
),
|
@@ -35502,6 +39044,8 @@ exports['default'] = {
|
|
35502 |
hh: translate,
|
35503 |
d: '1 dzień',
|
35504 |
dd: '%d dni',
|
|
|
|
|
35505 |
M: 'miesiąc',
|
35506 |
MM: translate,
|
35507 |
y: 'rok',
|
@@ -35521,7 +39065,7 @@ exports['default'] = {
|
|
35521 |
|
35522 |
|
35523 |
/***/ }),
|
35524 |
-
/*
|
35525 |
/***/ (function(module, exports, __webpack_require__) {
|
35526 |
|
35527 |
//! moment.js locale configuration
|
@@ -35578,6 +39122,8 @@ exports['default'] = {
|
|
35578 |
hh: '%d horas',
|
35579 |
d: 'um dia',
|
35580 |
dd: '%d dias',
|
|
|
|
|
35581 |
M: 'um mês',
|
35582 |
MM: '%d meses',
|
35583 |
y: 'um ano',
|
@@ -35597,7 +39143,7 @@ exports['default'] = {
|
|
35597 |
|
35598 |
|
35599 |
/***/ }),
|
35600 |
-
/*
|
35601 |
/***/ (function(module, exports, __webpack_require__) {
|
35602 |
|
35603 |
//! moment.js locale configuration
|
@@ -35661,6 +39207,7 @@ exports['default'] = {
|
|
35661 |
},
|
35662 |
dayOfMonthOrdinalParse: /\d{1,2}º/,
|
35663 |
ordinal: '%dº',
|
|
|
35664 |
});
|
35665 |
|
35666 |
return ptBr;
|
@@ -35669,7 +39216,7 @@ exports['default'] = {
|
|
35669 |
|
35670 |
|
35671 |
/***/ }),
|
35672 |
-
/*
|
35673 |
/***/ (function(module, exports, __webpack_require__) {
|
35674 |
|
35675 |
//! moment.js locale configuration
|
@@ -35692,6 +39239,7 @@ exports['default'] = {
|
|
35692 |
mm: 'minute',
|
35693 |
hh: 'ore',
|
35694 |
dd: 'zile',
|
|
|
35695 |
MM: 'luni',
|
35696 |
yy: 'ani',
|
35697 |
},
|
@@ -35740,6 +39288,8 @@ exports['default'] = {
|
|
35740 |
hh: relativeTimeWithPlural,
|
35741 |
d: 'o zi',
|
35742 |
dd: relativeTimeWithPlural,
|
|
|
|
|
35743 |
M: 'o lună',
|
35744 |
MM: relativeTimeWithPlural,
|
35745 |
y: 'un an',
|
@@ -35757,7 +39307,7 @@ exports['default'] = {
|
|
35757 |
|
35758 |
|
35759 |
/***/ }),
|
35760 |
-
/*
|
35761 |
/***/ (function(module, exports, __webpack_require__) {
|
35762 |
|
35763 |
//! moment.js locale configuration
|
@@ -35788,6 +39338,7 @@ exports['default'] = {
|
|
35788 |
mm: withoutSuffix ? 'минута_минуты_минут' : 'минуту_минуты_минут',
|
35789 |
hh: 'час_часа_часов',
|
35790 |
dd: 'день_дня_дней',
|
|
|
35791 |
MM: 'месяц_месяца_месяцев',
|
35792 |
yy: 'год_года_лет',
|
35793 |
};
|
@@ -35928,6 +39479,8 @@ exports['default'] = {
|
|
35928 |
hh: relativeTimeWithPlural,
|
35929 |
d: 'день',
|
35930 |
dd: relativeTimeWithPlural,
|
|
|
|
|
35931 |
M: 'месяц',
|
35932 |
MM: relativeTimeWithPlural,
|
35933 |
y: 'год',
|
@@ -35976,7 +39529,7 @@ exports['default'] = {
|
|
35976 |
|
35977 |
|
35978 |
/***/ }),
|
35979 |
-
/*
|
35980 |
/***/ (function(module, exports, __webpack_require__) {
|
35981 |
|
35982 |
//! moment.js locale configuration
|
@@ -36073,7 +39626,7 @@ exports['default'] = {
|
|
36073 |
|
36074 |
|
36075 |
/***/ }),
|
36076 |
-
/*
|
36077 |
/***/ (function(module, exports, __webpack_require__) {
|
36078 |
|
36079 |
//! moment.js locale configuration
|
@@ -36146,7 +39699,7 @@ exports['default'] = {
|
|
36146 |
|
36147 |
|
36148 |
/***/ }),
|
36149 |
-
/*
|
36150 |
/***/ (function(module, exports, __webpack_require__) {
|
36151 |
|
36152 |
//! moment.js locale configuration
|
@@ -36230,7 +39783,7 @@ exports['default'] = {
|
|
36230 |
|
36231 |
|
36232 |
/***/ }),
|
36233 |
-
/*
|
36234 |
/***/ (function(module, exports, __webpack_require__) {
|
36235 |
|
36236 |
//! moment.js locale configuration
|
@@ -36390,7 +39943,7 @@ exports['default'] = {
|
|
36390 |
|
36391 |
|
36392 |
/***/ }),
|
36393 |
-
/*
|
36394 |
/***/ (function(module, exports, __webpack_require__) {
|
36395 |
|
36396 |
//! moment.js locale configuration
|
@@ -36576,7 +40129,7 @@ exports['default'] = {
|
|
36576 |
|
36577 |
|
36578 |
/***/ }),
|
36579 |
-
/*
|
36580 |
/***/ (function(module, exports, __webpack_require__) {
|
36581 |
|
36582 |
//! moment.js locale configuration
|
@@ -36657,12 +40210,13 @@ exports['default'] = {
|
|
36657 |
|
36658 |
|
36659 |
/***/ }),
|
36660 |
-
/*
|
36661 |
/***/ (function(module, exports, __webpack_require__) {
|
36662 |
|
36663 |
//! moment.js locale configuration
|
36664 |
//! locale : Serbian [sr]
|
36665 |
//! author : Milan Janačković<milanjanackovic@gmail.com> : https://github.com/milan-j
|
|
|
36666 |
|
36667 |
;(function (global, factory) {
|
36668 |
true ? factory(__webpack_require__(0)) :
|
@@ -36722,10 +40276,10 @@ exports['default'] = {
|
|
36722 |
longDateFormat: {
|
36723 |
LT: 'H:mm',
|
36724 |
LTS: 'H:mm:ss',
|
36725 |
-
L: '
|
36726 |
-
LL: 'D. MMMM YYYY',
|
36727 |
-
LLL: 'D. MMMM YYYY H:mm',
|
36728 |
-
LLLL: 'dddd, D. MMMM YYYY H:mm',
|
36729 |
},
|
36730 |
calendar: {
|
36731 |
sameDay: '[danas u] LT',
|
@@ -36790,12 +40344,13 @@ exports['default'] = {
|
|
36790 |
|
36791 |
|
36792 |
/***/ }),
|
36793 |
-
/*
|
36794 |
/***/ (function(module, exports, __webpack_require__) {
|
36795 |
|
36796 |
//! moment.js locale configuration
|
36797 |
//! locale : Serbian Cyrillic [sr-cyrl]
|
36798 |
//! author : Milan Janačković<milanjanackovic@gmail.com> : https://github.com/milan-j
|
|
|
36799 |
|
36800 |
;(function (global, factory) {
|
36801 |
true ? factory(__webpack_require__(0)) :
|
@@ -36853,10 +40408,10 @@ exports['default'] = {
|
|
36853 |
longDateFormat: {
|
36854 |
LT: 'H:mm',
|
36855 |
LTS: 'H:mm:ss',
|
36856 |
-
L: '
|
36857 |
-
LL: 'D. MMMM YYYY',
|
36858 |
-
LLL: 'D. MMMM YYYY H:mm',
|
36859 |
-
LLLL: 'dddd, D. MMMM YYYY H:mm',
|
36860 |
},
|
36861 |
calendar: {
|
36862 |
sameDay: '[данас у] LT',
|
@@ -36911,7 +40466,7 @@ exports['default'] = {
|
|
36911 |
ordinal: '%d.',
|
36912 |
week: {
|
36913 |
dow: 1, // Monday is the first day of the week.
|
36914 |
-
doy: 7, // The week that contains Jan
|
36915 |
},
|
36916 |
});
|
36917 |
|
@@ -36921,7 +40476,7 @@ exports['default'] = {
|
|
36921 |
|
36922 |
|
36923 |
/***/ }),
|
36924 |
-
/*
|
36925 |
/***/ (function(module, exports, __webpack_require__) {
|
36926 |
|
36927 |
//! moment.js locale configuration
|
@@ -37020,7 +40575,7 @@ exports['default'] = {
|
|
37020 |
|
37021 |
|
37022 |
/***/ }),
|
37023 |
-
/*
|
37024 |
/***/ (function(module, exports, __webpack_require__) {
|
37025 |
|
37026 |
//! moment.js locale configuration
|
@@ -37104,7 +40659,7 @@ exports['default'] = {
|
|
37104 |
|
37105 |
|
37106 |
/***/ }),
|
37107 |
-
/*
|
37108 |
/***/ (function(module, exports, __webpack_require__) {
|
37109 |
|
37110 |
//! moment.js locale configuration
|
@@ -37131,7 +40686,7 @@ exports['default'] = {
|
|
37131 |
weekdaysMin: 'J2_J3_J4_J5_Al_Ij_J1'.split('_'),
|
37132 |
weekdaysParseExact: true,
|
37133 |
longDateFormat: {
|
37134 |
-
LT: '
|
37135 |
LTS: 'HH:mm:ss',
|
37136 |
L: 'DD.MM.YYYY',
|
37137 |
LL: 'D MMMM YYYY',
|
@@ -37174,7 +40729,7 @@ exports['default'] = {
|
|
37174 |
|
37175 |
|
37176 |
/***/ }),
|
37177 |
-
/*
|
37178 |
/***/ (function(module, exports, __webpack_require__) {
|
37179 |
|
37180 |
//! moment.js locale configuration
|
@@ -37190,16 +40745,16 @@ exports['default'] = {
|
|
37190 |
//! moment.js locale configuration
|
37191 |
|
37192 |
var symbolMap = {
|
37193 |
-
|
37194 |
-
|
37195 |
-
|
37196 |
-
|
37197 |
-
|
37198 |
-
|
37199 |
-
|
37200 |
-
|
37201 |
-
|
37202 |
-
|
37203 |
},
|
37204 |
numberMap = {
|
37205 |
'௧': '1',
|
@@ -37319,7 +40874,7 @@ exports['default'] = {
|
|
37319 |
|
37320 |
|
37321 |
/***/ }),
|
37322 |
-
/*
|
37323 |
/***/ (function(module, exports, __webpack_require__) {
|
37324 |
|
37325 |
//! moment.js locale configuration
|
@@ -37421,7 +40976,7 @@ exports['default'] = {
|
|
37421 |
|
37422 |
|
37423 |
/***/ }),
|
37424 |
-
/*
|
37425 |
/***/ (function(module, exports, __webpack_require__) {
|
37426 |
|
37427 |
//! moment.js locale configuration
|
@@ -37505,7 +41060,7 @@ exports['default'] = {
|
|
37505 |
|
37506 |
|
37507 |
/***/ }),
|
37508 |
-
/*
|
37509 |
/***/ (function(module, exports, __webpack_require__) {
|
37510 |
|
37511 |
//! moment.js locale configuration
|
@@ -37546,9 +41101,14 @@ exports['default'] = {
|
|
37546 |
};
|
37547 |
|
37548 |
var tg = moment.defineLocale('tg', {
|
37549 |
-
months:
|
37550 |
-
'_'
|
37551 |
-
|
|
|
|
|
|
|
|
|
|
|
37552 |
monthsShort: 'янв_фев_мар_апр_май_июн_июл_авг_сен_окт_ноя_дек'.split('_'),
|
37553 |
weekdays: 'якшанбе_душанбе_сешанбе_чоршанбе_панҷшанбе_ҷумъа_шанбе'.split(
|
37554 |
'_'
|
@@ -37558,14 +41118,14 @@ exports['default'] = {
|
|
37558 |
longDateFormat: {
|
37559 |
LT: 'HH:mm',
|
37560 |
LTS: 'HH:mm:ss',
|
37561 |
-
L: 'DD
|
37562 |
LL: 'D MMMM YYYY',
|
37563 |
LLL: 'D MMMM YYYY HH:mm',
|
37564 |
LLLL: 'dddd, D MMMM YYYY HH:mm',
|
37565 |
},
|
37566 |
calendar: {
|
37567 |
sameDay: '[Имрӯз соати] LT',
|
37568 |
-
nextDay: '[
|
37569 |
lastDay: '[Дирӯз соати] LT',
|
37570 |
nextWeek: 'dddd[и] [ҳафтаи оянда соати] LT',
|
37571 |
lastWeek: 'dddd[и] [ҳафтаи гузашта соати] LT',
|
@@ -37632,7 +41192,7 @@ exports['default'] = {
|
|
37632 |
|
37633 |
|
37634 |
/***/ }),
|
37635 |
-
/*
|
37636 |
/***/ (function(module, exports, __webpack_require__) {
|
37637 |
|
37638 |
//! moment.js locale configuration
|
@@ -37697,6 +41257,8 @@ exports['default'] = {
|
|
37697 |
hh: '%d ชั่วโมง',
|
37698 |
d: '1 วัน',
|
37699 |
dd: '%d วัน',
|
|
|
|
|
37700 |
M: '1 เดือน',
|
37701 |
MM: '%d เดือน',
|
37702 |
y: '1 ปี',
|
@@ -37710,7 +41272,114 @@ exports['default'] = {
|
|
37710 |
|
37711 |
|
37712 |
/***/ }),
|
37713 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
37714 |
/***/ (function(module, exports, __webpack_require__) {
|
37715 |
|
37716 |
//! moment.js locale configuration
|
@@ -37783,7 +41452,7 @@ exports['default'] = {
|
|
37783 |
|
37784 |
|
37785 |
/***/ }),
|
37786 |
-
/*
|
37787 |
/***/ (function(module, exports, __webpack_require__) {
|
37788 |
|
37789 |
//! moment.js locale configuration
|
@@ -37924,7 +41593,7 @@ exports['default'] = {
|
|
37924 |
|
37925 |
|
37926 |
/***/ }),
|
37927 |
-
/*
|
37928 |
/***/ (function(module, exports, __webpack_require__) {
|
37929 |
|
37930 |
//! moment.js locale configuration
|
@@ -38009,6 +41678,8 @@ exports['default'] = {
|
|
38009 |
hh: '%d saat',
|
38010 |
d: 'bir gün',
|
38011 |
dd: '%d gün',
|
|
|
|
|
38012 |
M: 'bir ay',
|
38013 |
MM: '%d ay',
|
38014 |
y: 'bir yıl',
|
@@ -38044,7 +41715,7 @@ exports['default'] = {
|
|
38044 |
|
38045 |
|
38046 |
/***/ }),
|
38047 |
-
/*
|
38048 |
/***/ (function(module, exports, __webpack_require__) {
|
38049 |
|
38050 |
//! moment.js locale configuration
|
@@ -38149,7 +41820,7 @@ exports['default'] = {
|
|
38149 |
|
38150 |
|
38151 |
/***/ }),
|
38152 |
-
/*
|
38153 |
/***/ (function(module, exports, __webpack_require__) {
|
38154 |
|
38155 |
//! moment.js locale configuration
|
@@ -38218,7 +41889,7 @@ exports['default'] = {
|
|
38218 |
|
38219 |
|
38220 |
/***/ }),
|
38221 |
-
/*
|
38222 |
/***/ (function(module, exports, __webpack_require__) {
|
38223 |
|
38224 |
//! moment.js locale configuration
|
@@ -38287,10 +41958,10 @@ exports['default'] = {
|
|
38287 |
|
38288 |
|
38289 |
/***/ }),
|
38290 |
-
/*
|
38291 |
/***/ (function(module, exports, __webpack_require__) {
|
38292 |
|
38293 |
-
//! moment.js
|
38294 |
//! locale : Uyghur (China) [ug-cn]
|
38295 |
//! author: boyaq : https://github.com/boyaq
|
38296 |
|
@@ -38300,7 +41971,7 @@ exports['default'] = {
|
|
38300 |
factory(global.moment)
|
38301 |
}(this, (function (moment) { 'use strict';
|
38302 |
|
38303 |
-
//! moment.js
|
38304 |
|
38305 |
var ugCn = moment.defineLocale('ug-cn', {
|
38306 |
months: 'يانۋار_فېۋرال_مارت_ئاپرېل_ماي_ئىيۇن_ئىيۇل_ئاۋغۇست_سېنتەبىر_ئۆكتەبىر_نويابىر_دېكابىر'.split(
|
@@ -38413,7 +42084,7 @@ exports['default'] = {
|
|
38413 |
|
38414 |
|
38415 |
/***/ }),
|
38416 |
-
/*
|
38417 |
/***/ (function(module, exports, __webpack_require__) {
|
38418 |
|
38419 |
//! moment.js locale configuration
|
@@ -38592,7 +42263,7 @@ exports['default'] = {
|
|
38592 |
|
38593 |
|
38594 |
/***/ }),
|
38595 |
-
/*
|
38596 |
/***/ (function(module, exports, __webpack_require__) {
|
38597 |
|
38598 |
//! moment.js locale configuration
|
@@ -38690,7 +42361,7 @@ exports['default'] = {
|
|
38690 |
|
38691 |
|
38692 |
/***/ }),
|
38693 |
-
/*
|
38694 |
/***/ (function(module, exports, __webpack_require__) {
|
38695 |
|
38696 |
//! moment.js locale configuration
|
@@ -38757,7 +42428,7 @@ exports['default'] = {
|
|
38757 |
|
38758 |
|
38759 |
/***/ }),
|
38760 |
-
/*
|
38761 |
/***/ (function(module, exports, __webpack_require__) {
|
38762 |
|
38763 |
//! moment.js locale configuration
|
@@ -38826,7 +42497,7 @@ exports['default'] = {
|
|
38826 |
|
38827 |
|
38828 |
/***/ }),
|
38829 |
-
/*
|
38830 |
/***/ (function(module, exports, __webpack_require__) {
|
38831 |
|
38832 |
//! moment.js locale configuration
|
@@ -38846,7 +42517,7 @@ exports['default'] = {
|
|
38846 |
months: 'tháng 1_tháng 2_tháng 3_tháng 4_tháng 5_tháng 6_tháng 7_tháng 8_tháng 9_tháng 10_tháng 11_tháng 12'.split(
|
38847 |
'_'
|
38848 |
),
|
38849 |
-
monthsShort: '
|
38850 |
'_'
|
38851 |
),
|
38852 |
monthsParseExact: true,
|
@@ -38898,6 +42569,8 @@ exports['default'] = {
|
|
38898 |
hh: '%d giờ',
|
38899 |
d: 'một ngày',
|
38900 |
dd: '%d ngày',
|
|
|
|
|
38901 |
M: 'một tháng',
|
38902 |
MM: '%d tháng',
|
38903 |
y: 'một năm',
|
@@ -38919,7 +42592,7 @@ exports['default'] = {
|
|
38919 |
|
38920 |
|
38921 |
/***/ }),
|
38922 |
-
/*
|
38923 |
/***/ (function(module, exports, __webpack_require__) {
|
38924 |
|
38925 |
//! moment.js locale configuration
|
@@ -39006,7 +42679,7 @@ exports['default'] = {
|
|
39006 |
|
39007 |
|
39008 |
/***/ }),
|
39009 |
-
/*
|
39010 |
/***/ (function(module, exports, __webpack_require__) {
|
39011 |
|
39012 |
//! moment.js locale configuration
|
@@ -39075,7 +42748,7 @@ exports['default'] = {
|
|
39075 |
|
39076 |
|
39077 |
/***/ }),
|
39078 |
-
/*
|
39079 |
/***/ (function(module, exports, __webpack_require__) {
|
39080 |
|
39081 |
//! moment.js locale configuration
|
@@ -39191,6 +42864,8 @@ exports['default'] = {
|
|
39191 |
hh: '%d 小时',
|
39192 |
d: '1 天',
|
39193 |
dd: '%d 天',
|
|
|
|
|
39194 |
M: '1 个月',
|
39195 |
MM: '%d 个月',
|
39196 |
y: '1 年',
|
@@ -39209,7 +42884,7 @@ exports['default'] = {
|
|
39209 |
|
39210 |
|
39211 |
/***/ }),
|
39212 |
-
/*
|
39213 |
/***/ (function(module, exports, __webpack_require__) {
|
39214 |
|
39215 |
//! moment.js locale configuration
|
@@ -39326,7 +43001,7 @@ exports['default'] = {
|
|
39326 |
|
39327 |
|
39328 |
/***/ }),
|
39329 |
-
/*
|
39330 |
/***/ (function(module, exports, __webpack_require__) {
|
39331 |
|
39332 |
//! moment.js locale configuration
|
@@ -39442,7 +43117,7 @@ exports['default'] = {
|
|
39442 |
|
39443 |
|
39444 |
/***/ }),
|
39445 |
-
/*
|
39446 |
/***/ (function(module, exports, __webpack_require__) {
|
39447 |
|
39448 |
//! moment.js locale configuration
|
@@ -39557,24 +43232,321 @@ exports['default'] = {
|
|
39557 |
|
39558 |
|
39559 |
/***/ }),
|
39560 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
39561 |
/***/ (function(module, exports, __webpack_require__) {
|
39562 |
|
39563 |
"use strict";
|
39564 |
|
39565 |
|
39566 |
// modified from https://github.com/es-shims/es6-shim
|
39567 |
-
var keys = __webpack_require__(
|
39568 |
-
var bind = __webpack_require__(83);
|
39569 |
var canBeObject = function (obj) {
|
39570 |
return typeof obj !== 'undefined' && obj !== null;
|
39571 |
};
|
39572 |
-
var hasSymbols = __webpack_require__(
|
|
|
39573 |
var toObject = Object;
|
39574 |
-
var push =
|
39575 |
-
var propIsEnumerable =
|
39576 |
var originalGetSymbols = hasSymbols ? Object.getOwnPropertySymbols : null;
|
39577 |
|
|
|
39578 |
module.exports = function assign(target, source1) {
|
39579 |
if (!canBeObject(target)) { throw new TypeError('target must be an object'); }
|
39580 |
var objTarget = toObject(target);
|
@@ -39587,15 +43559,15 @@ module.exports = function assign(target, source1) {
|
|
39587 |
syms = getSymbols(source);
|
39588 |
for (i = 0; i < syms.length; ++i) {
|
39589 |
key = syms[i];
|
39590 |
-
if (propIsEnumerable(source, key)) {
|
39591 |
-
push(props, key);
|
39592 |
}
|
39593 |
}
|
39594 |
}
|
39595 |
for (i = 0; i < props.length; ++i) {
|
39596 |
key = props[i];
|
39597 |
value = source[key];
|
39598 |
-
if (propIsEnumerable(source, key)) {
|
39599 |
objTarget[key] = value;
|
39600 |
}
|
39601 |
}
|
@@ -39605,20 +43577,22 @@ module.exports = function assign(target, source1) {
|
|
39605 |
|
39606 |
|
39607 |
/***/ }),
|
39608 |
-
/*
|
39609 |
/***/ (function(module, exports, __webpack_require__) {
|
39610 |
|
39611 |
"use strict";
|
39612 |
|
39613 |
|
39614 |
-
var implementation = __webpack_require__(
|
39615 |
|
39616 |
var lacksProperEnumerationOrder = function () {
|
39617 |
if (!Object.assign) {
|
39618 |
return false;
|
39619 |
}
|
39620 |
-
|
39621 |
-
|
|
|
|
|
39622 |
var str = 'abcdefghijklmnopqrst';
|
39623 |
var letters = str.split('');
|
39624 |
var map = {};
|
@@ -39637,8 +43611,10 @@ var assignHasPendingExceptions = function () {
|
|
39637 |
if (!Object.assign || !Object.preventExtensions) {
|
39638 |
return false;
|
39639 |
}
|
39640 |
-
|
39641 |
-
|
|
|
|
|
39642 |
var thrower = Object.preventExtensions({ 1: 2 });
|
39643 |
try {
|
39644 |
Object.assign(thrower, 'xy');
|
@@ -39663,7 +43639,7 @@ module.exports = function getPolyfill() {
|
|
39663 |
|
39664 |
|
39665 |
/***/ }),
|
39666 |
-
/*
|
39667 |
/***/ (function(module, exports) {
|
39668 |
|
39669 |
Object.defineProperty(exports, "__esModule", {
|
@@ -39680,15 +43656,56 @@ module.exports = exports['default'];
|
|
39680 |
//# sourceMappingURL=isPlainObject.js.map
|
39681 |
|
39682 |
/***/ }),
|
39683 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
39684 |
/***/ (function(module, exports, __webpack_require__) {
|
39685 |
|
39686 |
"use strict";
|
39687 |
|
39688 |
|
39689 |
-
var RequireObjectCoercible = __webpack_require__(
|
39690 |
-
var has = __webpack_require__(
|
39691 |
-
var callBound = __webpack_require__(
|
39692 |
var $isEnumerable = callBound('Object.prototype.propertyIsEnumerable');
|
39693 |
|
39694 |
module.exports = function entries(O) {
|
@@ -39704,13 +43721,13 @@ module.exports = function entries(O) {
|
|
39704 |
|
39705 |
|
39706 |
/***/ }),
|
39707 |
-
/*
|
39708 |
/***/ (function(module, exports, __webpack_require__) {
|
39709 |
|
39710 |
"use strict";
|
39711 |
|
39712 |
|
39713 |
-
var implementation = __webpack_require__(
|
39714 |
|
39715 |
module.exports = function getPolyfill() {
|
39716 |
return typeof Object.entries === 'function' ? Object.entries : implementation;
|
@@ -39718,7 +43735,7 @@ module.exports = function getPolyfill() {
|
|
39718 |
|
39719 |
|
39720 |
/***/ }),
|
39721 |
-
/*
|
39722 |
/***/ (function(module, exports, __webpack_require__) {
|
39723 |
|
39724 |
"use strict";
|
@@ -39729,7 +43746,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
39729 |
});
|
39730 |
exports["default"] = valuesOfValidator;
|
39731 |
|
39732 |
-
var _isPrimitive = _interopRequireDefault(__webpack_require__(
|
39733 |
|
39734 |
var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
39735 |
|
@@ -39779,7 +43796,7 @@ function valuesOfValidator(propType) {
|
|
39779 |
//# sourceMappingURL=valuesOf.js.map
|
39780 |
|
39781 |
/***/ }),
|
39782 |
-
/*
|
39783 |
/***/ (function(module, exports, __webpack_require__) {
|
39784 |
|
39785 |
"use strict";
|
@@ -39790,7 +43807,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
39790 |
});
|
39791 |
exports["default"] = isPrimitive;
|
39792 |
|
39793 |
-
function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }
|
39794 |
|
39795 |
function isPrimitive(x) {
|
39796 |
return !x || _typeof(x) !== 'object' && typeof x !== 'function';
|
@@ -39798,18 +43815,18 @@ function isPrimitive(x) {
|
|
39798 |
//# sourceMappingURL=isPrimitive.js.map
|
39799 |
|
39800 |
/***/ }),
|
39801 |
-
/*
|
39802 |
/***/ (function(module, exports, __webpack_require__) {
|
39803 |
|
39804 |
"use strict";
|
39805 |
|
39806 |
|
39807 |
-
var define = __webpack_require__(
|
39808 |
-
var RequireObjectCoercible = __webpack_require__(
|
39809 |
|
39810 |
-
var implementation = __webpack_require__(
|
39811 |
-
var getPolyfill = __webpack_require__(
|
39812 |
-
var shim = __webpack_require__(
|
39813 |
|
39814 |
var slice = Array.prototype.slice;
|
39815 |
|
@@ -39831,15 +43848,25 @@ module.exports = boundFindShim;
|
|
39831 |
|
39832 |
|
39833 |
/***/ }),
|
39834 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
39835 |
/***/ (function(module, exports, __webpack_require__) {
|
39836 |
|
39837 |
"use strict";
|
39838 |
|
39839 |
|
39840 |
-
var ToObject = __webpack_require__(
|
39841 |
-
var ToLength = __webpack_require__(
|
39842 |
-
var IsCallable = __webpack_require__(
|
39843 |
|
39844 |
module.exports = function find(predicate) {
|
39845 |
var list = ToObject(this);
|
@@ -39867,7 +43894,48 @@ module.exports = function find(predicate) {
|
|
39867 |
|
39868 |
|
39869 |
/***/ }),
|
39870 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
39871 |
/***/ (function(module, exports, __webpack_require__) {
|
39872 |
|
39873 |
"use strict";
|
@@ -39882,20 +43950,293 @@ module.exports = function getPolyfill() {
|
|
39882 |
}) !== 1;
|
39883 |
|
39884 |
// eslint-disable-next-line global-require
|
39885 |
-
return implemented ? Array.prototype.find : __webpack_require__(
|
39886 |
};
|
39887 |
|
39888 |
|
39889 |
/***/ }),
|
39890 |
-
/*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
39891 |
/***/ (function(module, exports, __webpack_require__) {
|
39892 |
|
39893 |
"use strict";
|
39894 |
|
39895 |
|
39896 |
-
|
39897 |
-
|
39898 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
39899 |
var $functionToString = callBound('Function.prototype.toString');
|
39900 |
var $stringMatch = callBound('String.prototype.match');
|
39901 |
|
@@ -39937,7 +44278,7 @@ module.exports = function getName() {
|
|
39937 |
|
39938 |
|
39939 |
/***/ }),
|
39940 |
-
/*
|
39941 |
/***/ (function(module, exports, __webpack_require__) {
|
39942 |
|
39943 |
"use strict";
|
@@ -39971,13 +44312,13 @@ module.exports = functionsHaveNames;
|
|
39971 |
|
39972 |
|
39973 |
/***/ }),
|
39974 |
-
/*
|
39975 |
/***/ (function(module, exports, __webpack_require__) {
|
39976 |
|
39977 |
"use strict";
|
39978 |
|
39979 |
|
39980 |
-
var implementation = __webpack_require__(
|
39981 |
|
39982 |
module.exports = function getPolyfill() {
|
39983 |
return implementation;
|
@@ -39985,7 +44326,7 @@ module.exports = function getPolyfill() {
|
|
39985 |
|
39986 |
|
39987 |
/***/ }),
|
39988 |
-
/*
|
39989 |
/***/ (function(module, exports, __webpack_require__) {
|
39990 |
|
39991 |
"use strict";
|
@@ -39998,17 +44339,17 @@ exports["default"] = sequenceOfValidator;
|
|
39998 |
|
39999 |
var _propTypes = __webpack_require__(11);
|
40000 |
|
40001 |
-
var _and = _interopRequireDefault(__webpack_require__(
|
40002 |
|
40003 |
-
var _between = _interopRequireDefault(__webpack_require__(
|
40004 |
|
40005 |
-
var _nonNegativeInteger = _interopRequireDefault(__webpack_require__(
|
40006 |
|
40007 |
-
var _object = _interopRequireDefault(__webpack_require__(
|
40008 |
|
40009 |
-
var _withShape = _interopRequireDefault(__webpack_require__(
|
40010 |
|
40011 |
-
var _typeOf = _interopRequireDefault(__webpack_require__(
|
40012 |
|
40013 |
var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
40014 |
|
@@ -40016,7 +44357,7 @@ function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "d
|
|
40016 |
|
40017 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
40018 |
|
40019 |
-
function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }
|
40020 |
|
40021 |
function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }
|
40022 |
|
@@ -40123,7 +44464,7 @@ function validateChunks(specifiers, props, propName, componentName) {
|
|
40123 |
var arrayOfValidator = (0, _propTypes.arrayOf)(validator).isRequired;
|
40124 |
var chunk = chunks.shift(); // extract the next chunk to test
|
40125 |
|
40126 |
-
var chunkError = arrayOfValidator.apply(void 0, [_objectSpread({}, props, _defineProperty({}, propName, chunk)), propName, componentName].concat(rest));
|
40127 |
|
40128 |
if (chunkError) {
|
40129 |
// this chunk is invalid
|
@@ -40216,7 +44557,7 @@ function sequenceOfValidator() {
|
|
40216 |
//# sourceMappingURL=sequenceOf.js.map
|
40217 |
|
40218 |
/***/ }),
|
40219 |
-
/*
|
40220 |
/***/ (function(module, exports, __webpack_require__) {
|
40221 |
|
40222 |
"use strict";
|
@@ -40227,11 +44568,11 @@ Object.defineProperty(exports, "__esModule", {
|
|
40227 |
});
|
40228 |
exports["default"] = void 0;
|
40229 |
|
40230 |
-
var _and = _interopRequireDefault(__webpack_require__(
|
40231 |
|
40232 |
-
var _integer = _interopRequireDefault(__webpack_require__(
|
40233 |
|
40234 |
-
var _nonNegativeNumber = _interopRequireDefault(__webpack_require__(
|
40235 |
|
40236 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
40237 |
|
@@ -40241,7 +44582,7 @@ exports["default"] = _default;
|
|
40241 |
//# sourceMappingURL=nonNegativeInteger.js.map
|
40242 |
|
40243 |
/***/ }),
|
40244 |
-
/*
|
40245 |
/***/ (function(module, exports, __webpack_require__) {
|
40246 |
|
40247 |
"use strict";
|
@@ -40264,7 +44605,7 @@ exports["default"] = _default;
|
|
40264 |
//# sourceMappingURL=isInteger.js.map
|
40265 |
|
40266 |
/***/ }),
|
40267 |
-
/*
|
40268 |
/***/ (function(module, exports, __webpack_require__) {
|
40269 |
|
40270 |
"use strict";
|
@@ -40275,7 +44616,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
40275 |
});
|
40276 |
exports["default"] = void 0;
|
40277 |
|
40278 |
-
var _objectIs = _interopRequireDefault(__webpack_require__(
|
40279 |
|
40280 |
var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
40281 |
|
@@ -40315,18 +44656,18 @@ exports["default"] = _default;
|
|
40315 |
//# sourceMappingURL=nonNegativeNumber.js.map
|
40316 |
|
40317 |
/***/ }),
|
40318 |
-
/*
|
40319 |
/***/ (function(module, exports, __webpack_require__) {
|
40320 |
|
40321 |
"use strict";
|
40322 |
|
40323 |
|
40324 |
-
var define = __webpack_require__(
|
40325 |
-
var callBind = __webpack_require__(
|
40326 |
|
40327 |
-
var implementation = __webpack_require__(
|
40328 |
-
var getPolyfill = __webpack_require__(
|
40329 |
-
var shim = __webpack_require__(
|
40330 |
|
40331 |
var polyfill = callBind(getPolyfill(), Object);
|
40332 |
|
@@ -40340,7 +44681,7 @@ module.exports = polyfill;
|
|
40340 |
|
40341 |
|
40342 |
/***/ }),
|
40343 |
-
/*
|
40344 |
/***/ (function(module, exports, __webpack_require__) {
|
40345 |
|
40346 |
"use strict";
|
@@ -40366,13 +44707,13 @@ module.exports = function is(a, b) {
|
|
40366 |
|
40367 |
|
40368 |
/***/ }),
|
40369 |
-
/*
|
40370 |
/***/ (function(module, exports, __webpack_require__) {
|
40371 |
|
40372 |
"use strict";
|
40373 |
|
40374 |
|
40375 |
-
var implementation = __webpack_require__(
|
40376 |
|
40377 |
module.exports = function getPolyfill() {
|
40378 |
return typeof Object.is === 'function' ? Object.is : implementation;
|
@@ -40380,7 +44721,7 @@ module.exports = function getPolyfill() {
|
|
40380 |
|
40381 |
|
40382 |
/***/ }),
|
40383 |
-
/*
|
40384 |
/***/ (function(module, exports, __webpack_require__) {
|
40385 |
|
40386 |
"use strict";
|
@@ -40391,9 +44732,9 @@ Object.defineProperty(exports, "__esModule", {
|
|
40391 |
});
|
40392 |
exports["default"] = void 0;
|
40393 |
|
40394 |
-
var _isPlainObject = _interopRequireDefault(__webpack_require__(
|
40395 |
|
40396 |
-
var _typeOf = _interopRequireDefault(__webpack_require__(
|
40397 |
|
40398 |
var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
40399 |
|
@@ -40447,7 +44788,7 @@ exports["default"] = _default;
|
|
40447 |
//# sourceMappingURL=object.js.map
|
40448 |
|
40449 |
/***/ }),
|
40450 |
-
/*
|
40451 |
/***/ (function(module, exports, __webpack_require__) {
|
40452 |
|
40453 |
"use strict";
|
@@ -40458,11 +44799,11 @@ Object.defineProperty(exports, "__esModule", {
|
|
40458 |
});
|
40459 |
exports["default"] = typeOf;
|
40460 |
|
40461 |
-
var _react = _interopRequireDefault(__webpack_require__(
|
40462 |
|
40463 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
40464 |
|
40465 |
-
function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }
|
40466 |
|
40467 |
function typeOf(child) {
|
40468 |
if (child === null) {
|
@@ -40477,7 +44818,7 @@ function typeOf(child) {
|
|
40477 |
return _typeof(child);
|
40478 |
}
|
40479 |
|
40480 |
-
if (_react["default"].isValidElement(child)) {
|
40481 |
return child.type;
|
40482 |
}
|
40483 |
|
@@ -40486,7 +44827,7 @@ function typeOf(child) {
|
|
40486 |
//# sourceMappingURL=typeOf.js.map
|
40487 |
|
40488 |
/***/ }),
|
40489 |
-
/*
|
40490 |
/***/ (function(module, exports, __webpack_require__) {
|
40491 |
|
40492 |
"use strict";
|
@@ -40503,13 +44844,17 @@ var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
|
40503 |
|
40504 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
40505 |
|
40506 |
-
function _toConsumableArray(arr) { return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _nonIterableSpread(); }
|
|
|
|
|
|
|
|
|
40507 |
|
40508 |
-
function
|
40509 |
|
40510 |
-
function
|
40511 |
|
40512 |
-
function
|
40513 |
|
40514 |
function oneOfTypeValidator(validators) {
|
40515 |
var validator = function oneOfType(props, propName, componentName) {
|
@@ -40576,7 +44921,7 @@ function or(validators) {
|
|
40576 |
//# sourceMappingURL=or.js.map
|
40577 |
|
40578 |
/***/ }),
|
40579 |
-
/*
|
40580 |
/***/ (function(module, exports, __webpack_require__) {
|
40581 |
|
40582 |
"use strict";
|
@@ -40591,7 +44936,7 @@ var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
|
40591 |
|
40592 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
40593 |
|
40594 |
-
function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }
|
40595 |
|
40596 |
function explicitNull(props, propName, componentName) {
|
40597 |
if (props[propName] == null) {
|
@@ -40617,7 +44962,7 @@ exports["default"] = _default;
|
|
40617 |
//# sourceMappingURL=explicitNull.js.map
|
40618 |
|
40619 |
/***/ }),
|
40620 |
-
/*
|
40621 |
/***/ (function(module, exports, __webpack_require__) {
|
40622 |
|
40623 |
"use strict";
|
@@ -40699,7 +45044,7 @@ exports["default"] = _default;
|
|
40699 |
//# sourceMappingURL=uniqueArray.js.map
|
40700 |
|
40701 |
/***/ }),
|
40702 |
-
/*
|
40703 |
/***/ (function(module, exports, __webpack_require__) {
|
40704 |
|
40705 |
"use strict";
|
@@ -40710,7 +45055,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
40710 |
});
|
40711 |
exports['default'] = getCalendarDaySettings;
|
40712 |
|
40713 |
-
var _getPhrase = __webpack_require__(
|
40714 |
|
40715 |
var _getPhrase2 = _interopRequireDefault(_getPhrase);
|
40716 |
|
@@ -40757,7 +45102,7 @@ function getCalendarDaySettings(day, ariaLabelFormat, daySize, modifiers, phrase
|
|
40757 |
}
|
40758 |
|
40759 |
/***/ }),
|
40760 |
-
/*
|
40761 |
/***/ (function(module, exports, __webpack_require__) {
|
40762 |
|
40763 |
"use strict";
|
@@ -40771,11 +45116,11 @@ var _extends = Object.assign || function (target) { for (var i = 1; i < argument
|
|
40771 |
|
40772 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
40773 |
|
40774 |
-
var _object = __webpack_require__(
|
40775 |
|
40776 |
var _object2 = _interopRequireDefault(_object);
|
40777 |
|
40778 |
-
var _react = __webpack_require__(
|
40779 |
|
40780 |
var _react2 = _interopRequireDefault(_react);
|
40781 |
|
@@ -40783,61 +45128,61 @@ var _propTypes = __webpack_require__(11);
|
|
40783 |
|
40784 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
40785 |
|
40786 |
-
var _reactAddonsShallowCompare = __webpack_require__(
|
40787 |
|
40788 |
var _reactAddonsShallowCompare2 = _interopRequireDefault(_reactAddonsShallowCompare);
|
40789 |
|
40790 |
-
var _reactMomentProptypes = __webpack_require__(
|
40791 |
|
40792 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
40793 |
|
40794 |
-
var _airbnbPropTypes = __webpack_require__(
|
40795 |
|
40796 |
-
var _reactWithStyles = __webpack_require__(
|
40797 |
|
40798 |
var _moment = __webpack_require__(0);
|
40799 |
|
40800 |
var _moment2 = _interopRequireDefault(_moment);
|
40801 |
|
40802 |
-
var _defaultPhrases = __webpack_require__(
|
40803 |
|
40804 |
-
var _getPhrasePropTypes = __webpack_require__(
|
40805 |
|
40806 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
40807 |
|
40808 |
-
var _CalendarWeek = __webpack_require__(
|
40809 |
|
40810 |
var _CalendarWeek2 = _interopRequireDefault(_CalendarWeek);
|
40811 |
|
40812 |
-
var _CalendarDay = __webpack_require__(
|
40813 |
|
40814 |
var _CalendarDay2 = _interopRequireDefault(_CalendarDay);
|
40815 |
|
40816 |
-
var _calculateDimension = __webpack_require__(
|
40817 |
|
40818 |
var _calculateDimension2 = _interopRequireDefault(_calculateDimension);
|
40819 |
|
40820 |
-
var _getCalendarMonthWeeks = __webpack_require__(
|
40821 |
|
40822 |
var _getCalendarMonthWeeks2 = _interopRequireDefault(_getCalendarMonthWeeks);
|
40823 |
|
40824 |
-
var _isSameDay = __webpack_require__(
|
40825 |
|
40826 |
var _isSameDay2 = _interopRequireDefault(_isSameDay);
|
40827 |
|
40828 |
-
var _toISODateString = __webpack_require__(
|
40829 |
|
40830 |
var _toISODateString2 = _interopRequireDefault(_toISODateString);
|
40831 |
|
40832 |
-
var _ModifiersShape = __webpack_require__(
|
40833 |
|
40834 |
var _ModifiersShape2 = _interopRequireDefault(_ModifiersShape);
|
40835 |
|
40836 |
-
var _ScrollableOrientationShape = __webpack_require__(
|
40837 |
|
40838 |
var _ScrollableOrientationShape2 = _interopRequireDefault(_ScrollableOrientationShape);
|
40839 |
|
40840 |
-
var _DayOfWeekShape = __webpack_require__(
|
40841 |
|
40842 |
var _DayOfWeekShape2 = _interopRequireDefault(_DayOfWeekShape);
|
40843 |
|
@@ -41162,7 +45507,7 @@ exports['default'] = (0, _reactWithStyles.withStyles)(function (_ref) {
|
|
41162 |
})(CalendarMonth);
|
41163 |
|
41164 |
/***/ }),
|
41165 |
-
/*
|
41166 |
/***/ (function(module, exports, __webpack_require__) {
|
41167 |
|
41168 |
"use strict";
|
@@ -41206,7 +45551,7 @@ function calculateDimension(el, axis) {
|
|
41206 |
}
|
41207 |
|
41208 |
/***/ }),
|
41209 |
-
/*
|
41210 |
/***/ (function(module, exports, __webpack_require__) {
|
41211 |
|
41212 |
"use strict";
|
@@ -41220,11 +45565,11 @@ var _extends = Object.assign || function (target) { for (var i = 1; i < argument
|
|
41220 |
|
41221 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
41222 |
|
41223 |
-
var _object = __webpack_require__(
|
41224 |
|
41225 |
var _object2 = _interopRequireDefault(_object);
|
41226 |
|
41227 |
-
var _react = __webpack_require__(
|
41228 |
|
41229 |
var _react2 = _interopRequireDefault(_react);
|
41230 |
|
@@ -41232,67 +45577,67 @@ var _propTypes = __webpack_require__(11);
|
|
41232 |
|
41233 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
41234 |
|
41235 |
-
var _reactAddonsShallowCompare = __webpack_require__(
|
41236 |
|
41237 |
var _reactAddonsShallowCompare2 = _interopRequireDefault(_reactAddonsShallowCompare);
|
41238 |
|
41239 |
-
var _reactMomentProptypes = __webpack_require__(
|
41240 |
|
41241 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
41242 |
|
41243 |
-
var _airbnbPropTypes = __webpack_require__(
|
41244 |
|
41245 |
-
var _reactWithStyles = __webpack_require__(
|
41246 |
|
41247 |
var _moment = __webpack_require__(0);
|
41248 |
|
41249 |
var _moment2 = _interopRequireDefault(_moment);
|
41250 |
|
41251 |
-
var _consolidatedEvents = __webpack_require__(
|
41252 |
|
41253 |
-
var _defaultPhrases = __webpack_require__(
|
41254 |
|
41255 |
-
var _getPhrasePropTypes = __webpack_require__(
|
41256 |
|
41257 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
41258 |
|
41259 |
-
var _CalendarMonth = __webpack_require__(
|
41260 |
|
41261 |
var _CalendarMonth2 = _interopRequireDefault(_CalendarMonth);
|
41262 |
|
41263 |
-
var _isTransitionEndSupported = __webpack_require__(
|
41264 |
|
41265 |
var _isTransitionEndSupported2 = _interopRequireDefault(_isTransitionEndSupported);
|
41266 |
|
41267 |
-
var _getTransformStyles = __webpack_require__(
|
41268 |
|
41269 |
var _getTransformStyles2 = _interopRequireDefault(_getTransformStyles);
|
41270 |
|
41271 |
-
var _getCalendarMonthWidth = __webpack_require__(
|
41272 |
|
41273 |
var _getCalendarMonthWidth2 = _interopRequireDefault(_getCalendarMonthWidth);
|
41274 |
|
41275 |
-
var _toISOMonthString = __webpack_require__(
|
41276 |
|
41277 |
var _toISOMonthString2 = _interopRequireDefault(_toISOMonthString);
|
41278 |
|
41279 |
-
var _isPrevMonth = __webpack_require__(
|
41280 |
|
41281 |
var _isPrevMonth2 = _interopRequireDefault(_isPrevMonth);
|
41282 |
|
41283 |
-
var _isNextMonth = __webpack_require__(
|
41284 |
|
41285 |
var _isNextMonth2 = _interopRequireDefault(_isNextMonth);
|
41286 |
|
41287 |
-
var _ModifiersShape = __webpack_require__(
|
41288 |
|
41289 |
var _ModifiersShape2 = _interopRequireDefault(_ModifiersShape);
|
41290 |
|
41291 |
-
var _ScrollableOrientationShape = __webpack_require__(
|
41292 |
|
41293 |
var _ScrollableOrientationShape2 = _interopRequireDefault(_ScrollableOrientationShape);
|
41294 |
|
41295 |
-
var _DayOfWeekShape = __webpack_require__(
|
41296 |
|
41297 |
var _DayOfWeekShape2 = _interopRequireDefault(_DayOfWeekShape);
|
41298 |
|
@@ -41772,7 +46117,7 @@ exports['default'] = (0, _reactWithStyles.withStyles)(function (_ref) {
|
|
41772 |
})(CalendarMonthGrid);
|
41773 |
|
41774 |
/***/ }),
|
41775 |
-
/*
|
41776 |
/***/ (function(module, exports, __webpack_require__) {
|
41777 |
|
41778 |
"use strict";
|
@@ -41787,7 +46132,7 @@ function getCalendarMonthWidth(daySize, calendarMonthPadding) {
|
|
41787 |
}
|
41788 |
|
41789 |
/***/ }),
|
41790 |
-
/*
|
41791 |
/***/ (function(module, exports, __webpack_require__) {
|
41792 |
|
41793 |
"use strict";
|
@@ -41812,13 +46157,13 @@ function isSameMonth(a, b) {
|
|
41812 |
}
|
41813 |
|
41814 |
/***/ }),
|
41815 |
-
/*
|
41816 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
41817 |
|
41818 |
"use strict";
|
41819 |
Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
41820 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__PortalCompat__ = __webpack_require__(
|
41821 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__PortalWithState__ = __webpack_require__(
|
41822 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "Portal", function() { return __WEBPACK_IMPORTED_MODULE_0__PortalCompat__["a"]; });
|
41823 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "PortalWithState", function() { return __WEBPACK_IMPORTED_MODULE_1__PortalWithState__["a"]; });
|
41824 |
|
@@ -41827,14 +46172,14 @@ Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
|
41827 |
|
41828 |
|
41829 |
/***/ }),
|
41830 |
-
/*
|
41831 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
41832 |
|
41833 |
"use strict";
|
41834 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom__ = __webpack_require__(
|
41835 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react_dom__);
|
41836 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Portal__ = __webpack_require__(
|
41837 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__LegacyPortal__ = __webpack_require__(
|
41838 |
|
41839 |
|
41840 |
|
@@ -41851,15 +46196,15 @@ if (__WEBPACK_IMPORTED_MODULE_0_react_dom___default.a.createPortal) {
|
|
41851 |
/* harmony default export */ __webpack_exports__["a"] = (Portal);
|
41852 |
|
41853 |
/***/ }),
|
41854 |
-
/*
|
41855 |
/***/ (function(module, exports, __webpack_require__) {
|
41856 |
|
41857 |
"use strict";
|
41858 |
|
41859 |
|
41860 |
-
var has = __webpack_require__(
|
41861 |
-
var RequireObjectCoercible = __webpack_require__(
|
41862 |
-
var callBound = __webpack_require__(
|
41863 |
|
41864 |
var $isEnumerable = callBound('Object.prototype.propertyIsEnumerable');
|
41865 |
|
@@ -41876,13 +46221,13 @@ module.exports = function values(O) {
|
|
41876 |
|
41877 |
|
41878 |
/***/ }),
|
41879 |
-
/*
|
41880 |
/***/ (function(module, exports, __webpack_require__) {
|
41881 |
|
41882 |
"use strict";
|
41883 |
|
41884 |
|
41885 |
-
var implementation = __webpack_require__(
|
41886 |
|
41887 |
module.exports = function getPolyfill() {
|
41888 |
return typeof Object.values === 'function' ? Object.values : implementation;
|
@@ -41890,7 +46235,7 @@ module.exports = function getPolyfill() {
|
|
41890 |
|
41891 |
|
41892 |
/***/ }),
|
41893 |
-
/*
|
41894 |
/***/ (function(module, exports, __webpack_require__) {
|
41895 |
|
41896 |
"use strict";
|
@@ -41919,13 +46264,13 @@ module.exports = function contains(other) {
|
|
41919 |
|
41920 |
|
41921 |
/***/ }),
|
41922 |
-
/*
|
41923 |
/***/ (function(module, exports, __webpack_require__) {
|
41924 |
|
41925 |
"use strict";
|
41926 |
|
41927 |
|
41928 |
-
var implementation = __webpack_require__(
|
41929 |
|
41930 |
module.exports = function getPolyfill() {
|
41931 |
if (typeof document !== 'undefined') {
|
@@ -41933,7 +46278,11 @@ module.exports = function getPolyfill() {
|
|
41933 |
return document.contains;
|
41934 |
}
|
41935 |
if (document.body && document.body.contains) {
|
41936 |
-
|
|
|
|
|
|
|
|
|
41937 |
}
|
41938 |
}
|
41939 |
return implementation;
|
@@ -41941,7 +46290,7 @@ module.exports = function getPolyfill() {
|
|
41941 |
|
41942 |
|
41943 |
/***/ }),
|
41944 |
-
/*
|
41945 |
/***/ (function(module, exports, __webpack_require__) {
|
41946 |
|
41947 |
"use strict";
|
@@ -41955,47 +46304,47 @@ var _propTypes = __webpack_require__(11);
|
|
41955 |
|
41956 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
41957 |
|
41958 |
-
var _reactMomentProptypes = __webpack_require__(
|
41959 |
|
41960 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
41961 |
|
41962 |
-
var _airbnbPropTypes = __webpack_require__(
|
41963 |
|
41964 |
-
var _defaultPhrases = __webpack_require__(
|
41965 |
|
41966 |
-
var _getPhrasePropTypes = __webpack_require__(
|
41967 |
|
41968 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
41969 |
|
41970 |
-
var _FocusedInputShape = __webpack_require__(
|
41971 |
|
41972 |
var _FocusedInputShape2 = _interopRequireDefault(_FocusedInputShape);
|
41973 |
|
41974 |
-
var _IconPositionShape = __webpack_require__(
|
41975 |
|
41976 |
var _IconPositionShape2 = _interopRequireDefault(_IconPositionShape);
|
41977 |
|
41978 |
-
var _OrientationShape = __webpack_require__(
|
41979 |
|
41980 |
var _OrientationShape2 = _interopRequireDefault(_OrientationShape);
|
41981 |
|
41982 |
-
var _DisabledShape = __webpack_require__(
|
41983 |
|
41984 |
var _DisabledShape2 = _interopRequireDefault(_DisabledShape);
|
41985 |
|
41986 |
-
var _AnchorDirectionShape = __webpack_require__(
|
41987 |
|
41988 |
var _AnchorDirectionShape2 = _interopRequireDefault(_AnchorDirectionShape);
|
41989 |
|
41990 |
-
var _OpenDirectionShape = __webpack_require__(
|
41991 |
|
41992 |
var _OpenDirectionShape2 = _interopRequireDefault(_OpenDirectionShape);
|
41993 |
|
41994 |
-
var _DayOfWeekShape = __webpack_require__(
|
41995 |
|
41996 |
var _DayOfWeekShape2 = _interopRequireDefault(_DayOfWeekShape);
|
41997 |
|
41998 |
-
var _CalendarInfoPositionShape = __webpack_require__(
|
41999 |
|
42000 |
var _CalendarInfoPositionShape2 = _interopRequireDefault(_CalendarInfoPositionShape);
|
42001 |
|
@@ -42082,7 +46431,7 @@ exports['default'] = {
|
|
42082 |
};
|
42083 |
|
42084 |
/***/ }),
|
42085 |
-
/*
|
42086 |
/***/ (function(module, exports, __webpack_require__) {
|
42087 |
|
42088 |
"use strict";
|
@@ -42103,7 +46452,7 @@ function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'd
|
|
42103 |
exports['default'] = _propTypes2['default'].oneOf([_constants.START_DATE, _constants.END_DATE]);
|
42104 |
|
42105 |
/***/ }),
|
42106 |
-
/*
|
42107 |
/***/ (function(module, exports, __webpack_require__) {
|
42108 |
|
42109 |
"use strict";
|
@@ -42124,7 +46473,7 @@ function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'd
|
|
42124 |
exports['default'] = _propTypes2['default'].oneOf([_constants.HORIZONTAL_ORIENTATION, _constants.VERTICAL_ORIENTATION]);
|
42125 |
|
42126 |
/***/ }),
|
42127 |
-
/*
|
42128 |
/***/ (function(module, exports, __webpack_require__) {
|
42129 |
|
42130 |
"use strict";
|
@@ -42145,7 +46494,7 @@ function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'd
|
|
42145 |
exports['default'] = _propTypes2['default'].oneOf([_constants.ANCHOR_LEFT, _constants.ANCHOR_RIGHT]);
|
42146 |
|
42147 |
/***/ }),
|
42148 |
-
/*
|
42149 |
/***/ (function(module, exports, __webpack_require__) {
|
42150 |
|
42151 |
"use strict";
|
@@ -42169,7 +46518,7 @@ function getResponsiveContainerStyles(anchorDirection, currentOffset, containerE
|
|
42169 |
}
|
42170 |
|
42171 |
/***/ }),
|
42172 |
-
/*
|
42173 |
/***/ (function(module, exports, __webpack_require__) {
|
42174 |
|
42175 |
"use strict";
|
@@ -42221,7 +46570,7 @@ function getDetachedContainerStyles(openDirection, anchorDirection, referenceEl)
|
|
42221 |
}
|
42222 |
|
42223 |
/***/ }),
|
42224 |
-
/*
|
42225 |
/***/ (function(module, exports, __webpack_require__) {
|
42226 |
|
42227 |
"use strict";
|
@@ -42310,7 +46659,7 @@ function disableScroll(node) {
|
|
42310 |
}
|
42311 |
|
42312 |
/***/ }),
|
42313 |
-
/*
|
42314 |
/***/ (function(module, exports, __webpack_require__) {
|
42315 |
|
42316 |
"use strict";
|
@@ -42322,7 +46671,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
42322 |
|
42323 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
42324 |
|
42325 |
-
var _react = __webpack_require__(
|
42326 |
|
42327 |
var _react2 = _interopRequireDefault(_react);
|
42328 |
|
@@ -42334,47 +46683,47 @@ var _moment = __webpack_require__(0);
|
|
42334 |
|
42335 |
var _moment2 = _interopRequireDefault(_moment);
|
42336 |
|
42337 |
-
var _reactMomentProptypes = __webpack_require__(
|
42338 |
|
42339 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
42340 |
|
42341 |
-
var _airbnbPropTypes = __webpack_require__(
|
42342 |
|
42343 |
-
var _OpenDirectionShape = __webpack_require__(
|
42344 |
|
42345 |
var _OpenDirectionShape2 = _interopRequireDefault(_OpenDirectionShape);
|
42346 |
|
42347 |
-
var _defaultPhrases = __webpack_require__(
|
42348 |
|
42349 |
-
var _getPhrasePropTypes = __webpack_require__(
|
42350 |
|
42351 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
42352 |
|
42353 |
-
var _DateRangePickerInput = __webpack_require__(
|
42354 |
|
42355 |
var _DateRangePickerInput2 = _interopRequireDefault(_DateRangePickerInput);
|
42356 |
|
42357 |
-
var _IconPositionShape = __webpack_require__(
|
42358 |
|
42359 |
var _IconPositionShape2 = _interopRequireDefault(_IconPositionShape);
|
42360 |
|
42361 |
-
var _DisabledShape = __webpack_require__(
|
42362 |
|
42363 |
var _DisabledShape2 = _interopRequireDefault(_DisabledShape);
|
42364 |
|
42365 |
-
var _toMomentObject = __webpack_require__(
|
42366 |
|
42367 |
var _toMomentObject2 = _interopRequireDefault(_toMomentObject);
|
42368 |
|
42369 |
-
var _toLocalizedDateString = __webpack_require__(
|
42370 |
|
42371 |
var _toLocalizedDateString2 = _interopRequireDefault(_toLocalizedDateString);
|
42372 |
|
42373 |
-
var _isInclusivelyAfterDay = __webpack_require__(
|
42374 |
|
42375 |
var _isInclusivelyAfterDay2 = _interopRequireDefault(_isInclusivelyAfterDay);
|
42376 |
|
42377 |
-
var _isBeforeDay = __webpack_require__(
|
42378 |
|
42379 |
var _isBeforeDay2 = _interopRequireDefault(_isBeforeDay);
|
42380 |
|
@@ -42795,7 +47144,7 @@ DateRangePickerInputController.propTypes = propTypes;
|
|
42795 |
DateRangePickerInputController.defaultProps = defaultProps;
|
42796 |
|
42797 |
/***/ }),
|
42798 |
-
/*
|
42799 |
/***/ (function(module, exports, __webpack_require__) {
|
42800 |
|
42801 |
"use strict";
|
@@ -42807,11 +47156,11 @@ Object.defineProperty(exports, "__esModule", {
|
|
42807 |
|
42808 |
var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; };
|
42809 |
|
42810 |
-
var _object = __webpack_require__(
|
42811 |
|
42812 |
var _object2 = _interopRequireDefault(_object);
|
42813 |
|
42814 |
-
var _react = __webpack_require__(
|
42815 |
|
42816 |
var _react2 = _interopRequireDefault(_react);
|
42817 |
|
@@ -42819,45 +47168,45 @@ var _propTypes = __webpack_require__(11);
|
|
42819 |
|
42820 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
42821 |
|
42822 |
-
var _airbnbPropTypes = __webpack_require__(
|
42823 |
|
42824 |
-
var _reactWithStyles = __webpack_require__(
|
42825 |
|
42826 |
-
var _defaultPhrases = __webpack_require__(
|
42827 |
|
42828 |
-
var _getPhrasePropTypes = __webpack_require__(
|
42829 |
|
42830 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
42831 |
|
42832 |
-
var _OpenDirectionShape = __webpack_require__(
|
42833 |
|
42834 |
var _OpenDirectionShape2 = _interopRequireDefault(_OpenDirectionShape);
|
42835 |
|
42836 |
-
var _DateInput = __webpack_require__(
|
42837 |
|
42838 |
var _DateInput2 = _interopRequireDefault(_DateInput);
|
42839 |
|
42840 |
-
var _IconPositionShape = __webpack_require__(
|
42841 |
|
42842 |
var _IconPositionShape2 = _interopRequireDefault(_IconPositionShape);
|
42843 |
|
42844 |
-
var _DisabledShape = __webpack_require__(
|
42845 |
|
42846 |
var _DisabledShape2 = _interopRequireDefault(_DisabledShape);
|
42847 |
|
42848 |
-
var _RightArrow = __webpack_require__(
|
42849 |
|
42850 |
var _RightArrow2 = _interopRequireDefault(_RightArrow);
|
42851 |
|
42852 |
-
var _LeftArrow = __webpack_require__(
|
42853 |
|
42854 |
var _LeftArrow2 = _interopRequireDefault(_LeftArrow);
|
42855 |
|
42856 |
-
var _CloseButton = __webpack_require__(
|
42857 |
|
42858 |
var _CloseButton2 = _interopRequireDefault(_CloseButton);
|
42859 |
|
42860 |
-
var _CalendarIcon = __webpack_require__(
|
42861 |
|
42862 |
var _CalendarIcon2 = _interopRequireDefault(_CalendarIcon);
|
42863 |
|
@@ -43251,7 +47600,7 @@ exports['default'] = (0, _reactWithStyles.withStyles)(function (_ref2) {
|
|
43251 |
})(DateRangePickerInput);
|
43252 |
|
43253 |
/***/ }),
|
43254 |
-
/*
|
43255 |
/***/ (function(module, exports, __webpack_require__) {
|
43256 |
|
43257 |
"use strict";
|
@@ -43265,11 +47614,11 @@ var _extends = Object.assign || function (target) { for (var i = 1; i < argument
|
|
43265 |
|
43266 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
43267 |
|
43268 |
-
var _object = __webpack_require__(
|
43269 |
|
43270 |
var _object2 = _interopRequireDefault(_object);
|
43271 |
|
43272 |
-
var _react = __webpack_require__(
|
43273 |
|
43274 |
var _react2 = _interopRequireDefault(_react);
|
43275 |
|
@@ -43277,23 +47626,23 @@ var _propTypes = __webpack_require__(11);
|
|
43277 |
|
43278 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
43279 |
|
43280 |
-
var _airbnbPropTypes = __webpack_require__(
|
43281 |
|
43282 |
-
var _reactWithStyles = __webpack_require__(
|
43283 |
|
43284 |
-
var _throttle = __webpack_require__(
|
43285 |
|
43286 |
var _throttle2 = _interopRequireDefault(_throttle);
|
43287 |
|
43288 |
-
var _isTouchDevice = __webpack_require__(
|
43289 |
|
43290 |
var _isTouchDevice2 = _interopRequireDefault(_isTouchDevice);
|
43291 |
|
43292 |
-
var _getInputHeight = __webpack_require__(
|
43293 |
|
43294 |
var _getInputHeight2 = _interopRequireDefault(_getInputHeight);
|
43295 |
|
43296 |
-
var _OpenDirectionShape = __webpack_require__(
|
43297 |
|
43298 |
var _OpenDirectionShape2 = _interopRequireDefault(_OpenDirectionShape);
|
43299 |
|
@@ -43731,11 +48080,11 @@ exports['default'] = (0, _reactWithStyles.withStyles)(function (_ref) {
|
|
43731 |
})(DateInput);
|
43732 |
|
43733 |
/***/ }),
|
43734 |
-
/*
|
43735 |
/***/ (function(module, exports, __webpack_require__) {
|
43736 |
|
43737 |
-
var debounce = __webpack_require__(
|
43738 |
-
isObject = __webpack_require__(
|
43739 |
|
43740 |
/** Error message constants. */
|
43741 |
var FUNC_ERROR_TEXT = 'Expected a function';
|
@@ -43806,10 +48155,10 @@ module.exports = throttle;
|
|
43806 |
|
43807 |
|
43808 |
/***/ }),
|
43809 |
-
/*
|
43810 |
/***/ (function(module, exports, __webpack_require__) {
|
43811 |
|
43812 |
-
var freeGlobal = __webpack_require__(
|
43813 |
|
43814 |
/** Detect free variable `self`. */
|
43815 |
var freeSelf = typeof self == 'object' && self && self.Object === Object && self;
|
@@ -43821,10 +48170,10 @@ module.exports = root;
|
|
43821 |
|
43822 |
|
43823 |
/***/ }),
|
43824 |
-
/*
|
43825 |
/***/ (function(module, exports, __webpack_require__) {
|
43826 |
|
43827 |
-
var root = __webpack_require__(
|
43828 |
|
43829 |
/** Built-in value references. */
|
43830 |
var Symbol = root.Symbol;
|
@@ -43833,7 +48182,7 @@ module.exports = Symbol;
|
|
43833 |
|
43834 |
|
43835 |
/***/ }),
|
43836 |
-
/*
|
43837 |
/***/ (function(module, exports, __webpack_require__) {
|
43838 |
|
43839 |
"use strict";
|
@@ -43843,7 +48192,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
43843 |
value: true
|
43844 |
});
|
43845 |
|
43846 |
-
var _react = __webpack_require__(
|
43847 |
|
43848 |
var _react2 = _interopRequireDefault(_react);
|
43849 |
|
@@ -43869,7 +48218,7 @@ RightArrow.defaultProps = {
|
|
43869 |
exports['default'] = RightArrow;
|
43870 |
|
43871 |
/***/ }),
|
43872 |
-
/*
|
43873 |
/***/ (function(module, exports, __webpack_require__) {
|
43874 |
|
43875 |
"use strict";
|
@@ -43879,7 +48228,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
43879 |
value: true
|
43880 |
});
|
43881 |
|
43882 |
-
var _react = __webpack_require__(
|
43883 |
|
43884 |
var _react2 = _interopRequireDefault(_react);
|
43885 |
|
@@ -43905,7 +48254,7 @@ LeftArrow.defaultProps = {
|
|
43905 |
exports['default'] = LeftArrow;
|
43906 |
|
43907 |
/***/ }),
|
43908 |
-
/*
|
43909 |
/***/ (function(module, exports, __webpack_require__) {
|
43910 |
|
43911 |
"use strict";
|
@@ -43915,7 +48264,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
43915 |
value: true
|
43916 |
});
|
43917 |
|
43918 |
-
var _react = __webpack_require__(
|
43919 |
|
43920 |
var _react2 = _interopRequireDefault(_react);
|
43921 |
|
@@ -43941,7 +48290,7 @@ CalendarIcon.defaultProps = {
|
|
43941 |
exports['default'] = CalendarIcon;
|
43942 |
|
43943 |
/***/ }),
|
43944 |
-
/*
|
43945 |
/***/ (function(module, exports, __webpack_require__) {
|
43946 |
|
43947 |
"use strict";
|
@@ -43955,11 +48304,11 @@ var _slicedToArray = function () { function sliceIterator(arr, i) { var _arr = [
|
|
43955 |
|
43956 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
43957 |
|
43958 |
-
var _object = __webpack_require__(
|
43959 |
|
43960 |
var _object2 = _interopRequireDefault(_object);
|
43961 |
|
43962 |
-
var _react = __webpack_require__(
|
43963 |
|
43964 |
var _react2 = _interopRequireDefault(_react);
|
43965 |
|
@@ -43967,93 +48316,93 @@ var _propTypes = __webpack_require__(11);
|
|
43967 |
|
43968 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
43969 |
|
43970 |
-
var _reactMomentProptypes = __webpack_require__(
|
43971 |
|
43972 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
43973 |
|
43974 |
-
var _airbnbPropTypes = __webpack_require__(
|
43975 |
|
43976 |
var _moment = __webpack_require__(0);
|
43977 |
|
43978 |
var _moment2 = _interopRequireDefault(_moment);
|
43979 |
|
43980 |
-
var _object3 = __webpack_require__(
|
43981 |
|
43982 |
var _object4 = _interopRequireDefault(_object3);
|
43983 |
|
43984 |
-
var _isTouchDevice = __webpack_require__(
|
43985 |
|
43986 |
var _isTouchDevice2 = _interopRequireDefault(_isTouchDevice);
|
43987 |
|
43988 |
-
var _defaultPhrases = __webpack_require__(
|
43989 |
|
43990 |
-
var _getPhrasePropTypes = __webpack_require__(
|
43991 |
|
43992 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
43993 |
|
43994 |
-
var _isInclusivelyAfterDay = __webpack_require__(
|
43995 |
|
43996 |
var _isInclusivelyAfterDay2 = _interopRequireDefault(_isInclusivelyAfterDay);
|
43997 |
|
43998 |
-
var _isNextDay = __webpack_require__(
|
43999 |
|
44000 |
var _isNextDay2 = _interopRequireDefault(_isNextDay);
|
44001 |
|
44002 |
-
var _isSameDay = __webpack_require__(
|
44003 |
|
44004 |
var _isSameDay2 = _interopRequireDefault(_isSameDay);
|
44005 |
|
44006 |
-
var _isAfterDay = __webpack_require__(
|
44007 |
|
44008 |
var _isAfterDay2 = _interopRequireDefault(_isAfterDay);
|
44009 |
|
44010 |
-
var _isBeforeDay = __webpack_require__(
|
44011 |
|
44012 |
var _isBeforeDay2 = _interopRequireDefault(_isBeforeDay);
|
44013 |
|
44014 |
-
var _getVisibleDays = __webpack_require__(
|
44015 |
|
44016 |
var _getVisibleDays2 = _interopRequireDefault(_getVisibleDays);
|
44017 |
|
44018 |
-
var _isDayVisible = __webpack_require__(
|
44019 |
|
44020 |
var _isDayVisible2 = _interopRequireDefault(_isDayVisible);
|
44021 |
|
44022 |
-
var _getSelectedDateOffset = __webpack_require__(
|
44023 |
|
44024 |
var _getSelectedDateOffset2 = _interopRequireDefault(_getSelectedDateOffset);
|
44025 |
|
44026 |
-
var _toISODateString = __webpack_require__(
|
44027 |
|
44028 |
var _toISODateString2 = _interopRequireDefault(_toISODateString);
|
44029 |
|
44030 |
-
var _toISOMonthString = __webpack_require__(
|
44031 |
|
44032 |
var _toISOMonthString2 = _interopRequireDefault(_toISOMonthString);
|
44033 |
|
44034 |
-
var _DisabledShape = __webpack_require__(
|
44035 |
|
44036 |
var _DisabledShape2 = _interopRequireDefault(_DisabledShape);
|
44037 |
|
44038 |
-
var _FocusedInputShape = __webpack_require__(
|
44039 |
|
44040 |
var _FocusedInputShape2 = _interopRequireDefault(_FocusedInputShape);
|
44041 |
|
44042 |
-
var _ScrollableOrientationShape = __webpack_require__(
|
44043 |
|
44044 |
var _ScrollableOrientationShape2 = _interopRequireDefault(_ScrollableOrientationShape);
|
44045 |
|
44046 |
-
var _DayOfWeekShape = __webpack_require__(
|
44047 |
|
44048 |
var _DayOfWeekShape2 = _interopRequireDefault(_DayOfWeekShape);
|
44049 |
|
44050 |
-
var _CalendarInfoPositionShape = __webpack_require__(
|
44051 |
|
44052 |
var _CalendarInfoPositionShape2 = _interopRequireDefault(_CalendarInfoPositionShape);
|
44053 |
|
44054 |
var _constants = __webpack_require__(17);
|
44055 |
|
44056 |
-
var _DayPicker = __webpack_require__(
|
44057 |
|
44058 |
var _DayPicker2 = _interopRequireDefault(_DayPicker);
|
44059 |
|
@@ -45452,7 +49801,7 @@ DayPickerRangeController.propTypes = propTypes;
|
|
45452 |
DayPickerRangeController.defaultProps = defaultProps;
|
45453 |
|
45454 |
/***/ }),
|
45455 |
-
/*
|
45456 |
/***/ (function(module, exports, __webpack_require__) {
|
45457 |
|
45458 |
"use strict";
|
@@ -45467,7 +49816,7 @@ var _moment = __webpack_require__(0);
|
|
45467 |
|
45468 |
var _moment2 = _interopRequireDefault(_moment);
|
45469 |
|
45470 |
-
var _isSameDay = __webpack_require__(
|
45471 |
|
45472 |
var _isSameDay2 = _interopRequireDefault(_isSameDay);
|
45473 |
|
@@ -45480,7 +49829,7 @@ function isNextDay(a, b) {
|
|
45480 |
}
|
45481 |
|
45482 |
/***/ }),
|
45483 |
-
/*
|
45484 |
/***/ (function(module, exports, __webpack_require__) {
|
45485 |
|
45486 |
"use strict";
|
@@ -45495,7 +49844,7 @@ var _moment = __webpack_require__(0);
|
|
45495 |
|
45496 |
var _moment2 = _interopRequireDefault(_moment);
|
45497 |
|
45498 |
-
var _toISOMonthString = __webpack_require__(
|
45499 |
|
45500 |
var _toISOMonthString2 = _interopRequireDefault(_toISOMonthString);
|
45501 |
|
@@ -45549,7 +49898,7 @@ function getVisibleDays(month, numberOfMonths, enableOutsideDays, withoutTransit
|
|
45549 |
}
|
45550 |
|
45551 |
/***/ }),
|
45552 |
-
/*
|
45553 |
/***/ (function(module, exports, __webpack_require__) {
|
45554 |
|
45555 |
"use strict";
|
@@ -45563,11 +49912,11 @@ var _slicedToArray = function () { function sliceIterator(arr, i) { var _arr = [
|
|
45563 |
|
45564 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
45565 |
|
45566 |
-
var _object = __webpack_require__(
|
45567 |
|
45568 |
var _object2 = _interopRequireDefault(_object);
|
45569 |
|
45570 |
-
var _react = __webpack_require__(
|
45571 |
|
45572 |
var _react2 = _interopRequireDefault(_react);
|
45573 |
|
@@ -45575,69 +49924,69 @@ var _propTypes = __webpack_require__(11);
|
|
45575 |
|
45576 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
45577 |
|
45578 |
-
var _reactMomentProptypes = __webpack_require__(
|
45579 |
|
45580 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
45581 |
|
45582 |
-
var _airbnbPropTypes = __webpack_require__(
|
45583 |
|
45584 |
var _moment = __webpack_require__(0);
|
45585 |
|
45586 |
var _moment2 = _interopRequireDefault(_moment);
|
45587 |
|
45588 |
-
var _object3 = __webpack_require__(
|
45589 |
|
45590 |
var _object4 = _interopRequireDefault(_object3);
|
45591 |
|
45592 |
-
var _isTouchDevice = __webpack_require__(
|
45593 |
|
45594 |
var _isTouchDevice2 = _interopRequireDefault(_isTouchDevice);
|
45595 |
|
45596 |
-
var _defaultPhrases = __webpack_require__(
|
45597 |
|
45598 |
-
var _getPhrasePropTypes = __webpack_require__(
|
45599 |
|
45600 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
45601 |
|
45602 |
-
var _isSameDay = __webpack_require__(
|
45603 |
|
45604 |
var _isSameDay2 = _interopRequireDefault(_isSameDay);
|
45605 |
|
45606 |
-
var _isAfterDay = __webpack_require__(
|
45607 |
|
45608 |
var _isAfterDay2 = _interopRequireDefault(_isAfterDay);
|
45609 |
|
45610 |
-
var _getVisibleDays = __webpack_require__(
|
45611 |
|
45612 |
var _getVisibleDays2 = _interopRequireDefault(_getVisibleDays);
|
45613 |
|
45614 |
-
var _isDayVisible = __webpack_require__(
|
45615 |
|
45616 |
var _isDayVisible2 = _interopRequireDefault(_isDayVisible);
|
45617 |
|
45618 |
-
var _toISODateString = __webpack_require__(
|
45619 |
|
45620 |
var _toISODateString2 = _interopRequireDefault(_toISODateString);
|
45621 |
|
45622 |
-
var _toISOMonthString = __webpack_require__(
|
45623 |
|
45624 |
var _toISOMonthString2 = _interopRequireDefault(_toISOMonthString);
|
45625 |
|
45626 |
-
var _ScrollableOrientationShape = __webpack_require__(
|
45627 |
|
45628 |
var _ScrollableOrientationShape2 = _interopRequireDefault(_ScrollableOrientationShape);
|
45629 |
|
45630 |
-
var _DayOfWeekShape = __webpack_require__(
|
45631 |
|
45632 |
var _DayOfWeekShape2 = _interopRequireDefault(_DayOfWeekShape);
|
45633 |
|
45634 |
-
var _CalendarInfoPositionShape = __webpack_require__(
|
45635 |
|
45636 |
var _CalendarInfoPositionShape2 = _interopRequireDefault(_CalendarInfoPositionShape);
|
45637 |
|
45638 |
var _constants = __webpack_require__(17);
|
45639 |
|
45640 |
-
var _DayPicker = __webpack_require__(
|
45641 |
|
45642 |
var _DayPicker2 = _interopRequireDefault(_DayPicker);
|
45643 |
|
@@ -46597,7 +50946,7 @@ DayPickerSingleDateController.propTypes = propTypes;
|
|
46597 |
DayPickerSingleDateController.defaultProps = defaultProps;
|
46598 |
|
46599 |
/***/ }),
|
46600 |
-
/*
|
46601 |
/***/ (function(module, exports, __webpack_require__) {
|
46602 |
|
46603 |
"use strict";
|
@@ -46611,39 +50960,39 @@ var _propTypes = __webpack_require__(11);
|
|
46611 |
|
46612 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
46613 |
|
46614 |
-
var _reactMomentProptypes = __webpack_require__(
|
46615 |
|
46616 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
46617 |
|
46618 |
-
var _airbnbPropTypes = __webpack_require__(
|
46619 |
|
46620 |
-
var _defaultPhrases = __webpack_require__(
|
46621 |
|
46622 |
-
var _getPhrasePropTypes = __webpack_require__(
|
46623 |
|
46624 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
46625 |
|
46626 |
-
var _IconPositionShape = __webpack_require__(
|
46627 |
|
46628 |
var _IconPositionShape2 = _interopRequireDefault(_IconPositionShape);
|
46629 |
|
46630 |
-
var _OrientationShape = __webpack_require__(
|
46631 |
|
46632 |
var _OrientationShape2 = _interopRequireDefault(_OrientationShape);
|
46633 |
|
46634 |
-
var _AnchorDirectionShape = __webpack_require__(
|
46635 |
|
46636 |
var _AnchorDirectionShape2 = _interopRequireDefault(_AnchorDirectionShape);
|
46637 |
|
46638 |
-
var _OpenDirectionShape = __webpack_require__(
|
46639 |
|
46640 |
var _OpenDirectionShape2 = _interopRequireDefault(_OpenDirectionShape);
|
46641 |
|
46642 |
-
var _DayOfWeekShape = __webpack_require__(
|
46643 |
|
46644 |
var _DayOfWeekShape2 = _interopRequireDefault(_DayOfWeekShape);
|
46645 |
|
46646 |
-
var _CalendarInfoPositionShape = __webpack_require__(
|
46647 |
|
46648 |
var _CalendarInfoPositionShape2 = _interopRequireDefault(_CalendarInfoPositionShape);
|
46649 |
|
@@ -46726,7 +51075,7 @@ exports['default'] = {
|
|
46726 |
};
|
46727 |
|
46728 |
/***/ }),
|
46729 |
-
/*
|
46730 |
/***/ (function(module, exports, __webpack_require__) {
|
46731 |
|
46732 |
"use strict";
|
@@ -46738,11 +51087,11 @@ Object.defineProperty(exports, "__esModule", {
|
|
46738 |
|
46739 |
var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; };
|
46740 |
|
46741 |
-
var _object = __webpack_require__(
|
46742 |
|
46743 |
var _object2 = _interopRequireDefault(_object);
|
46744 |
|
46745 |
-
var _react = __webpack_require__(
|
46746 |
|
46747 |
var _react2 = _interopRequireDefault(_react);
|
46748 |
|
@@ -46750,33 +51099,33 @@ var _propTypes = __webpack_require__(11);
|
|
46750 |
|
46751 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
46752 |
|
46753 |
-
var _airbnbPropTypes = __webpack_require__(
|
46754 |
|
46755 |
-
var _reactWithStyles = __webpack_require__(
|
46756 |
|
46757 |
-
var _defaultPhrases = __webpack_require__(
|
46758 |
|
46759 |
-
var _getPhrasePropTypes = __webpack_require__(
|
46760 |
|
46761 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
46762 |
|
46763 |
-
var _DateInput = __webpack_require__(
|
46764 |
|
46765 |
var _DateInput2 = _interopRequireDefault(_DateInput);
|
46766 |
|
46767 |
-
var _IconPositionShape = __webpack_require__(
|
46768 |
|
46769 |
var _IconPositionShape2 = _interopRequireDefault(_IconPositionShape);
|
46770 |
|
46771 |
-
var _CloseButton = __webpack_require__(
|
46772 |
|
46773 |
var _CloseButton2 = _interopRequireDefault(_CloseButton);
|
46774 |
|
46775 |
-
var _CalendarIcon = __webpack_require__(
|
46776 |
|
46777 |
var _CalendarIcon2 = _interopRequireDefault(_CalendarIcon);
|
46778 |
|
46779 |
-
var _OpenDirectionShape = __webpack_require__(
|
46780 |
|
46781 |
var _OpenDirectionShape2 = _interopRequireDefault(_OpenDirectionShape);
|
46782 |
|
@@ -47086,22 +51435,22 @@ exports['default'] = (0, _reactWithStyles.withStyles)(function (_ref2) {
|
|
47086 |
})(SingleDatePickerInput);
|
47087 |
|
47088 |
/***/ }),
|
47089 |
-
/*
|
47090 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
47091 |
|
47092 |
"use strict";
|
47093 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Consumer; });
|
47094 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
47095 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
47096 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
47097 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
47098 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
47099 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
47100 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
47101 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(1);
|
47102 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
47103 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
47104 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__wordpress_is_shallow_equal__ = __webpack_require__(
|
47105 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__wordpress_is_shallow_equal___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_9__wordpress_is_shallow_equal__);
|
47106 |
|
47107 |
|
@@ -47381,19 +51730,19 @@ function (_Component) {
|
|
47381 |
//# sourceMappingURL=provider.js.map
|
47382 |
|
47383 |
/***/ }),
|
47384 |
-
/*
|
47385 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
47386 |
|
47387 |
"use strict";
|
47388 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(1);
|
47389 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_classnames__ = __webpack_require__(
|
47390 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_classnames__);
|
47391 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash__ = __webpack_require__(2);
|
47392 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_lodash__);
|
47393 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_keycodes__ = __webpack_require__(
|
47394 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__icon_button__ = __webpack_require__(
|
47395 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__dropdown__ = __webpack_require__(
|
47396 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__navigable_container__ = __webpack_require__(
|
47397 |
|
47398 |
|
47399 |
/**
|
@@ -47497,7 +51846,7 @@ function DropdownMenu(_ref) {
|
|
47497 |
//# sourceMappingURL=index.js.map
|
47498 |
|
47499 |
/***/ }),
|
47500 |
-
/*
|
47501 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
47502 |
|
47503 |
"use strict";
|
@@ -47508,11 +51857,11 @@ function DropdownMenu(_ref) {
|
|
47508 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
47509 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
47510 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
47511 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
47512 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__wordpress_element__ = __webpack_require__(1);
|
47513 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_lodash__ = __webpack_require__(2);
|
47514 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_9_lodash__);
|
47515 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__wordpress_dom__ = __webpack_require__(
|
47516 |
|
47517 |
|
47518 |
|
@@ -47684,7 +52033,7 @@ forwardedNavigableContainer.displayName = 'NavigableContainer';
|
|
47684 |
//# sourceMappingURL=container.js.map
|
47685 |
|
47686 |
/***/ }),
|
47687 |
-
/*
|
47688 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
47689 |
|
47690 |
"use strict";
|
@@ -47694,7 +52043,7 @@ forwardedNavigableContainer.displayName = 'NavigableContainer';
|
|
47694 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
47695 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
47696 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
47697 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
47698 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(1);
|
47699 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
47700 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
@@ -47789,7 +52138,7 @@ function (_Component) {
|
|
47789 |
//# sourceMappingURL=index.js.map
|
47790 |
|
47791 |
/***/ }),
|
47792 |
-
/*
|
47793 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
47794 |
|
47795 |
"use strict";
|
@@ -47798,11 +52147,11 @@ function (_Component) {
|
|
47798 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(1);
|
47799 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
47800 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
47801 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_classnames__ = __webpack_require__(
|
47802 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_classnames__);
|
47803 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_i18n__ = __webpack_require__(
|
47804 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_compose__ = __webpack_require__(18);
|
47805 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7____ = __webpack_require__(
|
47806 |
|
47807 |
|
47808 |
|
@@ -47887,18 +52236,18 @@ function RangeControl(_ref) {
|
|
47887 |
//# sourceMappingURL=index.js.map
|
47888 |
|
47889 |
/***/ }),
|
47890 |
-
/*
|
47891 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
47892 |
|
47893 |
"use strict";
|
47894 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
47895 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
47896 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(1);
|
47897 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_classnames__ = __webpack_require__(
|
47898 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_classnames__);
|
47899 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash__ = __webpack_require__(2);
|
47900 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_lodash__);
|
47901 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__primitives__ = __webpack_require__(
|
47902 |
|
47903 |
|
47904 |
|
@@ -47963,13 +52312,13 @@ function FormToggle(_ref) {
|
|
47963 |
//# sourceMappingURL=index.js.map
|
47964 |
|
47965 |
/***/ }),
|
47966 |
-
/*
|
47967 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
47968 |
|
47969 |
"use strict";
|
47970 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(
|
47971 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(1);
|
47972 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2____ = __webpack_require__(
|
47973 |
|
47974 |
|
47975 |
/**
|
@@ -48033,22 +52382,22 @@ function Icon(_ref) {
|
|
48033 |
//# sourceMappingURL=index.js.map
|
48034 |
|
48035 |
/***/ }),
|
48036 |
-
/*
|
48037 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
48038 |
|
48039 |
"use strict";
|
48040 |
/* unused harmony export MenuItem */
|
48041 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(
|
48042 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
48043 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames__ = __webpack_require__(
|
48044 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_classnames__);
|
48045 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
48046 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
48047 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__wordpress_element__ = __webpack_require__(1);
|
48048 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_compose__ = __webpack_require__(18);
|
48049 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__button__ = __webpack_require__(
|
48050 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__shortcut__ = __webpack_require__(
|
48051 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__icon_button__ = __webpack_require__(
|
48052 |
|
48053 |
|
48054 |
|
@@ -48138,17 +52487,17 @@ function MenuItem(_ref) {
|
|
48138 |
//# sourceMappingURL=index.js.map
|
48139 |
|
48140 |
/***/ }),
|
48141 |
-
/*
|
48142 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
48143 |
|
48144 |
"use strict";
|
48145 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(1);
|
48146 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
48147 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
48148 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames__ = __webpack_require__(
|
48149 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_classnames__);
|
48150 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_i18n__ = __webpack_require__(
|
48151 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4____ = __webpack_require__(
|
48152 |
|
48153 |
|
48154 |
/**
|
@@ -48208,16 +52557,16 @@ function Notice(_ref) {
|
|
48208 |
//# sourceMappingURL=index.js.map
|
48209 |
|
48210 |
/***/ }),
|
48211 |
-
/*
|
48212 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
48213 |
|
48214 |
"use strict";
|
48215 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
48216 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
48217 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(1);
|
48218 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
48219 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
48220 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4____ = __webpack_require__(
|
48221 |
|
48222 |
|
48223 |
|
@@ -48270,7 +52619,7 @@ function NoticeList(_ref) {
|
|
48270 |
//# sourceMappingURL=list.js.map
|
48271 |
|
48272 |
/***/ }),
|
48273 |
-
/*
|
48274 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
48275 |
|
48276 |
"use strict";
|
@@ -48289,18 +52638,18 @@ function PanelHeader(_ref) {
|
|
48289 |
//# sourceMappingURL=header.js.map
|
48290 |
|
48291 |
/***/ }),
|
48292 |
-
/*
|
48293 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
48294 |
|
48295 |
"use strict";
|
48296 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
48297 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
48298 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(1);
|
48299 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_classnames__ = __webpack_require__(
|
48300 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_classnames__);
|
48301 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash__ = __webpack_require__(2);
|
48302 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_lodash__);
|
48303 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__dashicon__ = __webpack_require__(
|
48304 |
|
48305 |
|
48306 |
|
@@ -48349,18 +52698,18 @@ function Placeholder(_ref) {
|
|
48349 |
//# sourceMappingURL=index.js.map
|
48350 |
|
48351 |
/***/ }),
|
48352 |
-
/*
|
48353 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
48354 |
|
48355 |
"use strict";
|
48356 |
/* harmony export (immutable) */ __webpack_exports__["a"] = TreeSelect;
|
48357 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
48358 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
48359 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
48360 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_element__ = __webpack_require__(1);
|
48361 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash__ = __webpack_require__(2);
|
48362 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_lodash__);
|
48363 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5____ = __webpack_require__(
|
48364 |
|
48365 |
|
48366 |
|
@@ -48409,7 +52758,7 @@ function TreeSelect(_ref) {
|
|
48409 |
//# sourceMappingURL=index.js.map
|
48410 |
|
48411 |
/***/ }),
|
48412 |
-
/*
|
48413 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
48414 |
|
48415 |
"use strict";
|
@@ -48424,13 +52773,13 @@ function Spinner() {
|
|
48424 |
//# sourceMappingURL=index.js.map
|
48425 |
|
48426 |
/***/ }),
|
48427 |
-
/*
|
48428 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
48429 |
|
48430 |
"use strict";
|
48431 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return createI18n; });
|
48432 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
48433 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_tannin__ = __webpack_require__(
|
48434 |
|
48435 |
|
48436 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
@@ -48502,10 +52851,10 @@ var createI18n = function createI18n(initialData, initialDomain) {
|
|
48502 |
|
48503 |
var setLocaleData = function setLocaleData(data) {
|
48504 |
var domain = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'default';
|
48505 |
-
tannin.data[domain] = _objectSpread({}, DEFAULT_LOCALE_DATA,
|
48506 |
// a plural forms expression).
|
48507 |
|
48508 |
-
tannin.data[domain][''] = _objectSpread({}, DEFAULT_LOCALE_DATA[''],
|
48509 |
};
|
48510 |
/**
|
48511 |
* Wrapper for Tannin's `dcnpgettext`. Populates default locale data if not
|
@@ -48639,11 +52988,11 @@ var createI18n = function createI18n(initialData, initialDomain) {
|
|
48639 |
//# sourceMappingURL=create-i18n.js.map
|
48640 |
|
48641 |
/***/ }),
|
48642 |
-
/*
|
48643 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
48644 |
|
48645 |
"use strict";
|
48646 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(
|
48647 |
|
48648 |
|
48649 |
var namespaceAndEndpointMiddleware = function namespaceAndEndpointMiddleware(options, next) {
|
@@ -48672,7 +53021,7 @@ var namespaceAndEndpointMiddleware = function namespaceAndEndpointMiddleware(opt
|
|
48672 |
//# sourceMappingURL=namespace-endpoint.js.map
|
48673 |
|
48674 |
/***/ }),
|
48675 |
-
/*
|
48676 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
48677 |
|
48678 |
"use strict";
|
@@ -48697,7 +53046,7 @@ function isEmail(email) {
|
|
48697 |
//# sourceMappingURL=is-email.js.map
|
48698 |
|
48699 |
/***/ }),
|
48700 |
-
/*
|
48701 |
/***/ (function(module, exports, __webpack_require__) {
|
48702 |
|
48703 |
"use strict";
|
@@ -48706,7 +53055,7 @@ function isEmail(email) {
|
|
48706 |
var replace = String.prototype.replace;
|
48707 |
var percentTwenties = /%20/g;
|
48708 |
|
48709 |
-
var util = __webpack_require__(
|
48710 |
|
48711 |
var Format = {
|
48712 |
RFC1738: 'RFC1738',
|
@@ -48730,12 +53079,12 @@ module.exports = util.assign(
|
|
48730 |
|
48731 |
|
48732 |
/***/ }),
|
48733 |
-
/*
|
48734 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
48735 |
|
48736 |
"use strict";
|
48737 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getQueryArg;
|
48738 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_qs__ = __webpack_require__(
|
48739 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_qs___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_qs__);
|
48740 |
/**
|
48741 |
* External dependencies
|
@@ -48775,16 +53124,16 @@ function getQueryArg(url, arg) {
|
|
48775 |
//# sourceMappingURL=get-query-arg.js.map
|
48776 |
|
48777 |
/***/ }),
|
48778 |
-
/*
|
48779 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
48780 |
|
48781 |
"use strict";
|
48782 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
48783 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(1);
|
48784 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames__ = __webpack_require__(
|
48785 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_classnames__);
|
48786 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__icon_button__ = __webpack_require__(
|
48787 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__toolbar_button_container__ = __webpack_require__(
|
48788 |
|
48789 |
|
48790 |
|
@@ -48835,24 +53184,24 @@ function ToolbarButton(_ref) {
|
|
48835 |
//# sourceMappingURL=index.js.map
|
48836 |
|
48837 |
/***/ }),
|
48838 |
-
/*
|
48839 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
48840 |
|
48841 |
"use strict";
|
48842 |
Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
48843 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "default", function() { return MailerLiteFormBlock; });
|
48844 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_classCallCheck__ = __webpack_require__(
|
48845 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_classCallCheck__);
|
48846 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_createClass__ = __webpack_require__(
|
48847 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_createClass___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_createClass__);
|
48848 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_inherits__ = __webpack_require__(
|
48849 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_inherits___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_inherits__);
|
48850 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_possibleConstructorReturn__ = __webpack_require__(
|
48851 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_possibleConstructorReturn___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_possibleConstructorReturn__);
|
48852 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_getPrototypeOf__ = __webpack_require__(
|
48853 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_getPrototypeOf___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_getPrototypeOf__);
|
48854 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_element__ = __webpack_require__(1);
|
48855 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_components__ = __webpack_require__(
|
48856 |
|
48857 |
|
48858 |
|
@@ -48860,7 +53209,7 @@ Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
|
48860 |
|
48861 |
|
48862 |
|
48863 |
-
function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function () { var Super = __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_getPrototypeOf___default()(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_getPrototypeOf___default()(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_possibleConstructorReturn___default()(this, result); }; }
|
48864 |
|
48865 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
48866 |
|
@@ -48978,12 +53327,21 @@ var MailerLiteFormBlock = /*#__PURE__*/function (_Component) {
|
|
48978 |
}, {
|
48979 |
key: "renderEditWithForms",
|
48980 |
value: function renderEditWithForms() {
|
|
|
|
|
48981 |
var _this$state2 = this.state,
|
48982 |
forms = _this$state2.forms,
|
48983 |
selected_form = _this$state2.selected_form;
|
48984 |
var setAttributes = this.props.setAttributes;
|
48985 |
var form_id = this.props.attributes.form_id;
|
48986 |
-
return Object(__WEBPACK_IMPORTED_MODULE_5__wordpress_element__["h" /* createElement */])(__WEBPACK_IMPORTED_MODULE_5__wordpress_element__["c" /* Fragment */], null, Object(__WEBPACK_IMPORTED_MODULE_5__wordpress_element__["h" /* createElement */])("select",
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
48987 |
return Object(__WEBPACK_IMPORTED_MODULE_5__wordpress_element__["h" /* createElement */])("option", {
|
48988 |
key: form.value,
|
48989 |
value: form.value
|
@@ -48994,7 +53352,11 @@ var MailerLiteFormBlock = /*#__PURE__*/function (_Component) {
|
|
48994 |
marginLeft: 12
|
48995 |
},
|
48996 |
onClick: function onClick() {
|
48997 |
-
|
|
|
|
|
|
|
|
|
48998 |
form_id: selected_form,
|
48999 |
editMode: false
|
49000 |
});
|
@@ -49069,7 +53431,7 @@ registerBlockType('mailerlite/form-block', {
|
|
49069 |
});
|
49070 |
|
49071 |
/***/ }),
|
49072 |
-
/*
|
49073 |
/***/ (function(module, exports) {
|
49074 |
|
49075 |
function _classCallCheck(instance, Constructor) {
|
@@ -49081,7 +53443,7 @@ function _classCallCheck(instance, Constructor) {
|
|
49081 |
module.exports = _classCallCheck;
|
49082 |
|
49083 |
/***/ }),
|
49084 |
-
/*
|
49085 |
/***/ (function(module, exports) {
|
49086 |
|
49087 |
function _defineProperties(target, props) {
|
@@ -49103,10 +53465,10 @@ function _createClass(Constructor, protoProps, staticProps) {
|
|
49103 |
module.exports = _createClass;
|
49104 |
|
49105 |
/***/ }),
|
49106 |
-
/*
|
49107 |
/***/ (function(module, exports, __webpack_require__) {
|
49108 |
|
49109 |
-
var setPrototypeOf = __webpack_require__(
|
49110 |
|
49111 |
function _inherits(subClass, superClass) {
|
49112 |
if (typeof superClass !== "function" && superClass !== null) {
|
@@ -49126,7 +53488,7 @@ function _inherits(subClass, superClass) {
|
|
49126 |
module.exports = _inherits;
|
49127 |
|
49128 |
/***/ }),
|
49129 |
-
/*
|
49130 |
/***/ (function(module, exports) {
|
49131 |
|
49132 |
function _setPrototypeOf(o, p) {
|
@@ -49141,12 +53503,12 @@ function _setPrototypeOf(o, p) {
|
|
49141 |
module.exports = _setPrototypeOf;
|
49142 |
|
49143 |
/***/ }),
|
49144 |
-
/*
|
49145 |
/***/ (function(module, exports, __webpack_require__) {
|
49146 |
|
49147 |
-
var _typeof = __webpack_require__(
|
49148 |
|
49149 |
-
var assertThisInitialized = __webpack_require__(
|
49150 |
|
49151 |
function _possibleConstructorReturn(self, call) {
|
49152 |
if (call && (_typeof(call) === "object" || typeof call === "function")) {
|
@@ -49159,7 +53521,7 @@ function _possibleConstructorReturn(self, call) {
|
|
49159 |
module.exports = _possibleConstructorReturn;
|
49160 |
|
49161 |
/***/ }),
|
49162 |
-
/*
|
49163 |
/***/ (function(module, exports) {
|
49164 |
|
49165 |
function _typeof(obj) {
|
@@ -49181,7 +53543,7 @@ function _typeof(obj) {
|
|
49181 |
module.exports = _typeof;
|
49182 |
|
49183 |
/***/ }),
|
49184 |
-
/*
|
49185 |
/***/ (function(module, exports) {
|
49186 |
|
49187 |
function _assertThisInitialized(self) {
|
@@ -49195,7 +53557,7 @@ function _assertThisInitialized(self) {
|
|
49195 |
module.exports = _assertThisInitialized;
|
49196 |
|
49197 |
/***/ }),
|
49198 |
-
/*
|
49199 |
/***/ (function(module, exports) {
|
49200 |
|
49201 |
function _getPrototypeOf(o) {
|
@@ -49208,7 +53570,7 @@ function _getPrototypeOf(o) {
|
|
49208 |
module.exports = _getPrototypeOf;
|
49209 |
|
49210 |
/***/ }),
|
49211 |
-
/*
|
49212 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
49213 |
|
49214 |
"use strict";
|
@@ -49229,11 +53591,11 @@ function _objectWithoutPropertiesLoose(source, excluded) {
|
|
49229 |
}
|
49230 |
|
49231 |
/***/ }),
|
49232 |
-
/*
|
49233 |
/***/ (function(module, exports, __webpack_require__) {
|
49234 |
|
49235 |
"use strict";
|
49236 |
-
/** @license React v16.
|
49237 |
* react.production.min.js
|
49238 |
*
|
49239 |
* Copyright (c) Facebook, Inc. and its affiliates.
|
@@ -49242,7 +53604,7 @@ function _objectWithoutPropertiesLoose(source, excluded) {
|
|
49242 |
* LICENSE file in the root directory of this source tree.
|
49243 |
*/
|
49244 |
|
49245 |
-
var l=__webpack_require__(
|
49246 |
60116,B="function"===typeof Symbol&&Symbol.iterator;function C(a){for(var b="https://reactjs.org/docs/error-decoder.html?invariant="+a,c=1;c<arguments.length;c++)b+="&args[]="+encodeURIComponent(arguments[c]);return"Minified React error #"+a+"; visit "+b+" for the full message or use the non-minified dev environment for full errors and additional helpful warnings."}
|
49247 |
var D={isMounted:function(){return!1},enqueueForceUpdate:function(){},enqueueReplaceState:function(){},enqueueSetState:function(){}},E={};function F(a,b,c){this.props=a;this.context=b;this.refs=E;this.updater=c||D}F.prototype.isReactComponent={};F.prototype.setState=function(a,b){if("object"!==typeof a&&"function"!==typeof a&&null!=a)throw Error(C(85));this.updater.enqueueSetState(this,a,b,"setState")};F.prototype.forceUpdate=function(a){this.updater.enqueueForceUpdate(this,a,"forceUpdate")};
|
49248 |
function G(){}G.prototype=F.prototype;function H(a,b,c){this.props=a;this.context=b;this.refs=E;this.updater=c||D}var I=H.prototype=new G;I.constructor=H;l(I,F.prototype);I.isPureReactComponent=!0;var J={current:null},K=Object.prototype.hasOwnProperty,L={key:!0,ref:!0,__self:!0,__source:!0};
|
@@ -49257,15 +53619,15 @@ exports.Component=F;exports.Fragment=r;exports.Profiler=u;exports.PureComponent=
|
|
49257 |
exports.cloneElement=function(a,b,c){if(null===a||void 0===a)throw Error(C(267,a));var e=l({},a.props),d=a.key,g=a.ref,k=a._owner;if(null!=b){void 0!==b.ref&&(g=b.ref,k=J.current);void 0!==b.key&&(d=""+b.key);if(a.type&&a.type.defaultProps)var f=a.type.defaultProps;for(h in b)K.call(b,h)&&!L.hasOwnProperty(h)&&(e[h]=void 0===b[h]&&void 0!==f?f[h]:b[h])}var h=arguments.length-2;if(1===h)e.children=c;else if(1<h){f=Array(h);for(var m=0;m<h;m++)f[m]=arguments[m+2];e.children=f}return{$$typeof:p,type:a.type,
|
49258 |
key:d,ref:g,props:e,_owner:k}};exports.createContext=function(a,b){void 0===b&&(b=null);a={$$typeof:w,_calculateChangedBits:b,_currentValue:a,_currentValue2:a,_threadCount:0,Provider:null,Consumer:null};a.Provider={$$typeof:v,_context:a};return a.Consumer=a};exports.createElement=M;exports.createFactory=function(a){var b=M.bind(null,a);b.type=a;return b};exports.createRef=function(){return{current:null}};exports.forwardRef=function(a){return{$$typeof:x,render:a}};exports.isValidElement=O;
|
49259 |
exports.lazy=function(a){return{$$typeof:A,_ctor:a,_status:-1,_result:null}};exports.memo=function(a,b){return{$$typeof:z,type:a,compare:void 0===b?null:b}};exports.useCallback=function(a,b){return Z().useCallback(a,b)};exports.useContext=function(a,b){return Z().useContext(a,b)};exports.useDebugValue=function(){};exports.useEffect=function(a,b){return Z().useEffect(a,b)};exports.useImperativeHandle=function(a,b,c){return Z().useImperativeHandle(a,b,c)};
|
49260 |
-
exports.useLayoutEffect=function(a,b){return Z().useLayoutEffect(a,b)};exports.useMemo=function(a,b){return Z().useMemo(a,b)};exports.useReducer=function(a,b,c){return Z().useReducer(a,b,c)};exports.useRef=function(a){return Z().useRef(a)};exports.useState=function(a){return Z().useState(a)};exports.version="16.
|
49261 |
|
49262 |
|
49263 |
/***/ }),
|
49264 |
-
/*
|
49265 |
/***/ (function(module, exports, __webpack_require__) {
|
49266 |
|
49267 |
"use strict";
|
49268 |
-
/* WEBPACK VAR INJECTION */(function(process) {/** @license React v16.
|
49269 |
* react.development.js
|
49270 |
*
|
49271 |
* Copyright (c) Facebook, Inc. and its affiliates.
|
@@ -49282,10 +53644,10 @@ if (process.env.NODE_ENV !== "production") {
|
|
49282 |
(function() {
|
49283 |
'use strict';
|
49284 |
|
49285 |
-
var _assign = __webpack_require__(
|
49286 |
-
var checkPropTypes = __webpack_require__(
|
49287 |
|
49288 |
-
var ReactVersion = '16.
|
49289 |
|
49290 |
// The Symbol used to tag the ReactElement-like types. If there is no native Symbol
|
49291 |
// nor polyfill, then a plain number is used for performance.
|
@@ -51181,11 +55543,11 @@ exports.version = ReactVersion;
|
|
51181 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
51182 |
|
51183 |
/***/ }),
|
51184 |
-
/*
|
51185 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
51186 |
|
51187 |
"use strict";
|
51188 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom__ = __webpack_require__(
|
51189 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react_dom__);
|
51190 |
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_0_react_dom__, "createPortal")) __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_0_react_dom__["createPortal"]; });
|
51191 |
/* unused harmony reexport findDOMNode */
|
@@ -51231,11 +55593,11 @@ exports.version = ReactVersion;
|
|
51231 |
//# sourceMappingURL=react-platform.js.map
|
51232 |
|
51233 |
/***/ }),
|
51234 |
-
/*
|
51235 |
/***/ (function(module, exports, __webpack_require__) {
|
51236 |
|
51237 |
"use strict";
|
51238 |
-
/** @license React v16.
|
51239 |
* react-dom.production.min.js
|
51240 |
*
|
51241 |
* Copyright (c) Facebook, Inc. and its affiliates.
|
@@ -51247,7 +55609,7 @@ exports.version = ReactVersion;
|
|
51247 |
/*
|
51248 |
Modernizr 3.0.0pre (Custom Build) | MIT
|
51249 |
*/
|
51250 |
-
var aa=__webpack_require__(
|
51251 |
function ba(a,b,c,d,e,f,g,h,k){var l=Array.prototype.slice.call(arguments,3);try{b.apply(c,l)}catch(m){this.onError(m)}}var da=!1,ea=null,fa=!1,ha=null,ia={onError:function(a){da=!0;ea=a}};function ja(a,b,c,d,e,f,g,h,k){da=!1;ea=null;ba.apply(ia,arguments)}function ka(a,b,c,d,e,f,g,h,k){ja.apply(this,arguments);if(da){if(da){var l=ea;da=!1;ea=null}else throw Error(u(198));fa||(fa=!0,ha=l)}}var la=null,ma=null,na=null;
|
51252 |
function oa(a,b,c){var d=a.type||"unknown-event";a.currentTarget=na(c);ka(d,b,void 0,a);a.currentTarget=null}var pa=null,qa={};
|
51253 |
function ra(){if(pa)for(var a in qa){var b=qa[a],c=pa.indexOf(a);if(!(-1<c))throw Error(u(96,a));if(!sa[c]){if(!b.extractEvents)throw Error(u(97,a));sa[c]=b;c=b.eventTypes;for(var d in c){var e=void 0;var f=c[d],g=b,h=d;if(ta.hasOwnProperty(h))throw Error(u(99,h));ta[h]=f;var k=f.phasedRegistrationNames;if(k){for(e in k)k.hasOwnProperty(e)&&ua(k[e],g,h);e=!0}else f.registrationName?(ua(f.registrationName,g,h),e=!0):e=!1;if(!e)throw Error(u(98,d,a));}}}}
|
@@ -51522,15 +55884,15 @@ function ik(a,b,c,d,e){var f=c._reactRootContainer;if(f){var g=f._internalRoot;i
|
|
51522 |
wc=function(a){if(13===a.tag){var b=hg(Gg(),150,100);Ig(a,b);ek(a,b)}};xc=function(a){13===a.tag&&(Ig(a,3),ek(a,3))};yc=function(a){if(13===a.tag){var b=Gg();b=Hg(b,a,null);Ig(a,b);ek(a,b)}};
|
51523 |
za=function(a,b,c){switch(b){case "input":Cb(a,c);b=c.name;if("radio"===c.type&&null!=b){for(c=a;c.parentNode;)c=c.parentNode;c=c.querySelectorAll("input[name="+JSON.stringify(""+b)+'][type="radio"]');for(b=0;b<c.length;b++){var d=c[b];if(d!==a&&d.form===a.form){var e=Qd(d);if(!e)throw Error(u(90));yb(d);Cb(d,e)}}}break;case "textarea":Kb(a,c);break;case "select":b=c.value,null!=b&&Hb(a,!!c.multiple,b,!1)}};Fa=Mj;
|
51524 |
Ga=function(a,b,c,d,e){var f=W;W|=4;try{return cg(98,a.bind(null,b,c,d,e))}finally{W=f,W===V&&gg()}};Ha=function(){(W&(1|fj|gj))===V&&(Lj(),Dj())};Ia=function(a,b){var c=W;W|=2;try{return a(b)}finally{W=c,W===V&&gg()}};function kk(a,b){var c=2<arguments.length&&void 0!==arguments[2]?arguments[2]:null;if(!gk(b))throw Error(u(200));return jk(a,b,null,c)}var lk={Events:[Nc,Pd,Qd,xa,ta,Xd,function(a){jc(a,Wd)},Da,Ea,id,mc,Dj,{current:!1}]};
|
51525 |
-
(function(a){var b=a.findFiberByHostInstance;return Yj(n({},a,{overrideHookState:null,overrideProps:null,setSuspenseHandler:null,scheduleUpdate:null,currentDispatcherRef:Wa.ReactCurrentDispatcher,findHostInstanceByFiber:function(a){a=hc(a);return null===a?null:a.stateNode},findFiberByHostInstance:function(a){return b?b(a):null},findHostInstancesForRefresh:null,scheduleRefresh:null,scheduleRoot:null,setRefreshHandler:null,getCurrentFiber:null}))})({findFiberByHostInstance:tc,bundleType:0,version:"16.
|
51526 |
rendererPackageName:"react-dom"});exports.__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED=lk;exports.createPortal=kk;exports.findDOMNode=function(a){if(null==a)return null;if(1===a.nodeType)return a;var b=a._reactInternalFiber;if(void 0===b){if("function"===typeof a.render)throw Error(u(188));throw Error(u(268,Object.keys(a)));}a=hc(b);a=null===a?null:a.stateNode;return a};
|
51527 |
exports.flushSync=function(a,b){if((W&(fj|gj))!==V)throw Error(u(187));var c=W;W|=1;try{return cg(99,a.bind(null,b))}finally{W=c,gg()}};exports.hydrate=function(a,b,c){if(!gk(b))throw Error(u(200));return ik(null,a,b,!0,c)};exports.render=function(a,b,c){if(!gk(b))throw Error(u(200));return ik(null,a,b,!1,c)};
|
51528 |
exports.unmountComponentAtNode=function(a){if(!gk(a))throw Error(u(40));return a._reactRootContainer?(Nj(function(){ik(null,null,a,!1,function(){a._reactRootContainer=null;a[Od]=null})}),!0):!1};exports.unstable_batchedUpdates=Mj;exports.unstable_createPortal=function(a,b){return kk(a,b,2<arguments.length&&void 0!==arguments[2]?arguments[2]:null)};
|
51529 |
-
exports.unstable_renderSubtreeIntoContainer=function(a,b,c,d){if(!gk(c))throw Error(u(200));if(null==a||void 0===a._reactInternalFiber)throw Error(u(38));return ik(a,b,c,!1,d)};exports.version="16.
|
51530 |
|
51531 |
|
51532 |
/***/ }),
|
51533 |
-
/*
|
51534 |
/***/ (function(module, exports, __webpack_require__) {
|
51535 |
|
51536 |
"use strict";
|
@@ -51558,7 +55920,7 @@ exports.unstable_shouldYield=function(){var a=exports.unstable_now();V(a);var b=
|
|
51558 |
|
51559 |
|
51560 |
/***/ }),
|
51561 |
-
/*
|
51562 |
/***/ (function(module, exports, __webpack_require__) {
|
51563 |
|
51564 |
"use strict";
|
@@ -52424,11 +56786,11 @@ exports.unstable_wrapCallback = unstable_wrapCallback;
|
|
52424 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
52425 |
|
52426 |
/***/ }),
|
52427 |
-
/*
|
52428 |
/***/ (function(module, exports, __webpack_require__) {
|
52429 |
|
52430 |
"use strict";
|
52431 |
-
/* WEBPACK VAR INJECTION */(function(process) {/** @license React v16.
|
52432 |
* react-dom.development.js
|
52433 |
*
|
52434 |
* Copyright (c) Facebook, Inc. and its affiliates.
|
@@ -52445,11 +56807,11 @@ if (process.env.NODE_ENV !== "production") {
|
|
52445 |
(function() {
|
52446 |
'use strict';
|
52447 |
|
52448 |
-
var React = __webpack_require__(
|
52449 |
-
var _assign = __webpack_require__(
|
52450 |
-
var Scheduler = __webpack_require__(
|
52451 |
-
var checkPropTypes = __webpack_require__(
|
52452 |
-
var tracing = __webpack_require__(
|
52453 |
|
52454 |
var ReactSharedInternals = React.__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED; // Prevent newer renderers from RTE when used with older react package versions.
|
52455 |
// Current owner and dispatcher used to share the same ref,
|
@@ -76998,7 +81360,7 @@ function injectIntoDevTools(devToolsConfig) {
|
|
76998 |
// Enables DevTools to append owner stacks to error messages in DEV mode.
|
76999 |
getCurrentFiber: function () {
|
77000 |
return current;
|
77001 |
-
}
|
77002 |
}));
|
77003 |
}
|
77004 |
var IsSomeRendererActing$1 = ReactSharedInternals.IsSomeRendererActing;
|
@@ -77350,7 +81712,7 @@ implementation) {
|
|
77350 |
};
|
77351 |
}
|
77352 |
|
77353 |
-
var ReactVersion = '16.
|
77354 |
|
77355 |
setAttemptUserBlockingHydration(attemptUserBlockingHydration$1);
|
77356 |
setAttemptContinuousHydration(attemptContinuousHydration$1);
|
@@ -77444,22 +81806,22 @@ exports.version = ReactVersion;
|
|
77444 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
77445 |
|
77446 |
/***/ }),
|
77447 |
-
/*
|
77448 |
/***/ (function(module, exports, __webpack_require__) {
|
77449 |
|
77450 |
"use strict";
|
77451 |
/* WEBPACK VAR INJECTION */(function(process) {
|
77452 |
|
77453 |
if (process.env.NODE_ENV === 'production') {
|
77454 |
-
module.exports = __webpack_require__(
|
77455 |
} else {
|
77456 |
-
module.exports = __webpack_require__(
|
77457 |
}
|
77458 |
|
77459 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
77460 |
|
77461 |
/***/ }),
|
77462 |
-
/*
|
77463 |
/***/ (function(module, exports, __webpack_require__) {
|
77464 |
|
77465 |
"use strict";
|
@@ -77476,7 +81838,7 @@ var b=0;exports.__interactionsRef=null;exports.__subscriberRef=null;exports.unst
|
|
77476 |
|
77477 |
|
77478 |
/***/ }),
|
77479 |
-
/*
|
77480 |
/***/ (function(module, exports, __webpack_require__) {
|
77481 |
|
77482 |
"use strict";
|
@@ -77833,7 +82195,7 @@ exports.unstable_wrap = unstable_wrap;
|
|
77833 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
77834 |
|
77835 |
/***/ }),
|
77836 |
-
/*
|
77837 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
77838 |
|
77839 |
"use strict";
|
@@ -77865,7 +82227,7 @@ var isEmptyElement = function isEmptyElement(element) {
|
|
77865 |
//# sourceMappingURL=utils.js.map
|
77866 |
|
77867 |
/***/ }),
|
77868 |
-
/*
|
77869 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
77870 |
|
77871 |
"use strict";
|
@@ -77875,14 +82237,14 @@ var isEmptyElement = function isEmptyElement(element) {
|
|
77875 |
/* unused harmony export renderComponent */
|
77876 |
/* unused harmony export renderAttributes */
|
77877 |
/* unused harmony export renderStyle */
|
77878 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(
|
77879 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
77880 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_typeof__ = __webpack_require__(
|
77881 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
77882 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
77883 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__wordpress_escape_html__ = __webpack_require__(
|
77884 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__react__ = __webpack_require__(
|
77885 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__raw_html__ = __webpack_require__(
|
77886 |
|
77887 |
|
77888 |
|
@@ -78368,7 +82730,7 @@ function renderStyle(style) {
|
|
78368 |
//# sourceMappingURL=serialize.js.map
|
78369 |
|
78370 |
/***/ }),
|
78371 |
-
/*
|
78372 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
78373 |
|
78374 |
"use strict";
|
@@ -78391,7 +82753,7 @@ function __unstableEscapeGreaterThan(value) {
|
|
78391 |
//# sourceMappingURL=escape-greater.js.map
|
78392 |
|
78393 |
/***/ }),
|
78394 |
-
/*
|
78395 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
78396 |
|
78397 |
"use strict";
|
@@ -78401,7 +82763,7 @@ function __unstableEscapeGreaterThan(value) {
|
|
78401 |
/* unused harmony export Polygon */
|
78402 |
/* unused harmony export Rect */
|
78403 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return SVG; });
|
78404 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(
|
78405 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(1);
|
78406 |
|
78407 |
|
@@ -78438,34 +82800,34 @@ var SVG = function SVG(props) {
|
|
78438 |
//# sourceMappingURL=index.js.map
|
78439 |
|
78440 |
/***/ }),
|
78441 |
-
/*
|
78442 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
78443 |
|
78444 |
"use strict";
|
78445 |
/* unused harmony export Autocomplete */
|
78446 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(
|
78447 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
78448 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
78449 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
78450 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
78451 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
78452 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
78453 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
78454 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
78455 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__wordpress_element__ = __webpack_require__(1);
|
78456 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10_classnames__ = __webpack_require__(
|
78457 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_10_classnames__);
|
78458 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11_lodash__ = __webpack_require__(2);
|
78459 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_11_lodash__);
|
78460 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__wordpress_keycodes__ = __webpack_require__(
|
78461 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__wordpress_i18n__ = __webpack_require__(
|
78462 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__wordpress_compose__ = __webpack_require__(18);
|
78463 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__wordpress_rich_text__ = __webpack_require__(
|
78464 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__wordpress_dom__ = __webpack_require__(
|
78465 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__higher_order_with_focus_outside__ = __webpack_require__(
|
78466 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__button__ = __webpack_require__(
|
78467 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__popover__ = __webpack_require__(
|
78468 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__higher_order_with_spoken_messages__ = __webpack_require__(
|
78469 |
|
78470 |
|
78471 |
|
@@ -79070,7 +83432,7 @@ function (_Component) {
|
|
79070 |
//# sourceMappingURL=index.js.map
|
79071 |
|
79072 |
/***/ }),
|
79073 |
-
/*
|
79074 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79075 |
|
79076 |
"use strict";
|
@@ -79085,19 +83447,19 @@ function _setPrototypeOf(o, p) {
|
|
79085 |
}
|
79086 |
|
79087 |
/***/ }),
|
79088 |
-
/*
|
79089 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79090 |
|
79091 |
"use strict";
|
79092 |
/* harmony export (immutable) */ __webpack_exports__["a"] = _arrayWithoutHoles;
|
79093 |
-
/* harmony import */ var
|
79094 |
|
79095 |
function _arrayWithoutHoles(arr) {
|
79096 |
-
if (Array.isArray(arr)) return Object(
|
79097 |
}
|
79098 |
|
79099 |
/***/ }),
|
79100 |
-
/*
|
79101 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79102 |
|
79103 |
"use strict";
|
@@ -79107,7 +83469,7 @@ function _iterableToArray(iter) {
|
|
79107 |
}
|
79108 |
|
79109 |
/***/ }),
|
79110 |
-
/*
|
79111 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79112 |
|
79113 |
"use strict";
|
@@ -79117,15 +83479,15 @@ function _nonIterableSpread() {
|
|
79117 |
}
|
79118 |
|
79119 |
/***/ }),
|
79120 |
-
/*
|
79121 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79122 |
|
79123 |
"use strict";
|
79124 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__sprintf__ = __webpack_require__(
|
79125 |
/* unused harmony reexport sprintf */
|
79126 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__create_i18n__ = __webpack_require__(
|
79127 |
/* unused harmony namespace reexport */
|
79128 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__default_i18n__ = __webpack_require__(
|
79129 |
/* unused harmony reexport setLocaleData */
|
79130 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_2__default_i18n__["a"]; });
|
79131 |
/* unused harmony reexport _x */
|
@@ -79138,14 +83500,14 @@ function _nonIterableSpread() {
|
|
79138 |
//# sourceMappingURL=index.js.map
|
79139 |
|
79140 |
/***/ }),
|
79141 |
-
/*
|
79142 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79143 |
|
79144 |
"use strict";
|
79145 |
/* unused harmony export sprintf */
|
79146 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_memize__ = __webpack_require__(
|
79147 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_memize___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_memize__);
|
79148 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_sprintf_js__ = __webpack_require__(
|
79149 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_sprintf_js___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_sprintf_js__);
|
79150 |
/**
|
79151 |
* External dependencies
|
@@ -79189,12 +83551,12 @@ function sprintf(format) {
|
|
79189 |
//# sourceMappingURL=sprintf.js.map
|
79190 |
|
79191 |
/***/ }),
|
79192 |
-
/*
|
79193 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79194 |
|
79195 |
"use strict";
|
79196 |
/* harmony export (immutable) */ __webpack_exports__["a"] = pluralForms;
|
79197 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__tannin_compile__ = __webpack_require__(
|
79198 |
|
79199 |
|
79200 |
/**
|
@@ -79216,13 +83578,13 @@ function pluralForms( expression ) {
|
|
79216 |
|
79217 |
|
79218 |
/***/ }),
|
79219 |
-
/*
|
79220 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79221 |
|
79222 |
"use strict";
|
79223 |
/* harmony export (immutable) */ __webpack_exports__["a"] = compile;
|
79224 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__tannin_postfix__ = __webpack_require__(
|
79225 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__tannin_evaluate__ = __webpack_require__(
|
79226 |
|
79227 |
|
79228 |
|
@@ -79255,7 +83617,7 @@ function compile( expression ) {
|
|
79255 |
|
79256 |
|
79257 |
/***/ }),
|
79258 |
-
/*
|
79259 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79260 |
|
79261 |
"use strict";
|
@@ -79387,7 +83749,7 @@ function postfix( expression ) {
|
|
79387 |
|
79388 |
|
79389 |
/***/ }),
|
79390 |
-
/*
|
79391 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79392 |
|
79393 |
"use strict";
|
@@ -79505,7 +83867,7 @@ function evaluate( postfix, variables ) {
|
|
79505 |
|
79506 |
|
79507 |
/***/ }),
|
79508 |
-
/*
|
79509 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79510 |
|
79511 |
"use strict";
|
@@ -79515,7 +83877,7 @@ function evaluate( postfix, variables ) {
|
|
79515 |
/* unused harmony export _n */
|
79516 |
/* unused harmony export _nx */
|
79517 |
/* unused harmony export isRTL */
|
79518 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__create_i18n__ = __webpack_require__(
|
79519 |
/**
|
79520 |
* Internal dependencies
|
79521 |
*/
|
@@ -79614,7 +83976,7 @@ var isRTL = i18n.isRTL.bind(i18n);
|
|
79614 |
//# sourceMappingURL=default-i18n.js.map
|
79615 |
|
79616 |
/***/ }),
|
79617 |
-
/*
|
79618 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79619 |
|
79620 |
"use strict";
|
@@ -79642,7 +84004,7 @@ function isAppleOS() {
|
|
79642 |
//# sourceMappingURL=platform.js.map
|
79643 |
|
79644 |
/***/ }),
|
79645 |
-
/*
|
79646 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79647 |
|
79648 |
"use strict";
|
@@ -79665,12 +84027,12 @@ function isAppleOS() {
|
|
79665 |
//# sourceMappingURL=compose.js.map
|
79666 |
|
79667 |
/***/ }),
|
79668 |
-
/*
|
79669 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79670 |
|
79671 |
"use strict";
|
79672 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(
|
79673 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__utils_create_higher_order_component__ = __webpack_require__(
|
79674 |
|
79675 |
|
79676 |
/**
|
@@ -79702,14 +84064,14 @@ var ifCondition = function ifCondition(predicate) {
|
|
79702 |
//# sourceMappingURL=index.js.map
|
79703 |
|
79704 |
/***/ }),
|
79705 |
-
/*
|
79706 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
79707 |
|
79708 |
"use strict";
|
79709 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(
|
79710 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_typeof__ = __webpack_require__(
|
79711 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
79712 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_react__ = __webpack_require__(
|
79713 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_react__);
|
79714 |
|
79715 |
|
@@ -80062,7 +84424,7 @@ function closeOuterElement(endOffset) {
|
|
80062 |
//# sourceMappingURL=create-interpolate-element.js.map
|
80063 |
|
80064 |
/***/ }),
|
80065 |
-
/*
|
80066 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
80067 |
|
80068 |
"use strict";
|
@@ -80072,7 +84434,7 @@ function _arrayWithHoles(arr) {
|
|
80072 |
}
|
80073 |
|
80074 |
/***/ }),
|
80075 |
-
/*
|
80076 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
80077 |
|
80078 |
"use strict";
|
@@ -80105,7 +84467,7 @@ function _iterableToArrayLimit(arr, i) {
|
|
80105 |
}
|
80106 |
|
80107 |
/***/ }),
|
80108 |
-
/*
|
80109 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
80110 |
|
80111 |
"use strict";
|
@@ -80115,11 +84477,11 @@ function _nonIterableRest() {
|
|
80115 |
}
|
80116 |
|
80117 |
/***/ }),
|
80118 |
-
/*
|
80119 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
80120 |
|
80121 |
"use strict";
|
80122 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom__ = __webpack_require__(
|
80123 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react_dom__);
|
80124 |
/* unused harmony reexport createPortal */
|
80125 |
/* unused harmony reexport findDOMNode */
|
@@ -80165,7 +84527,7 @@ function _nonIterableRest() {
|
|
80165 |
//# sourceMappingURL=react-platform.js.map
|
80166 |
|
80167 |
/***/ }),
|
80168 |
-
/*
|
80169 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
80170 |
|
80171 |
"use strict";
|
@@ -80197,7 +84559,7 @@ var isEmptyElement = function isEmptyElement(element) {
|
|
80197 |
//# sourceMappingURL=utils.js.map
|
80198 |
|
80199 |
/***/ }),
|
80200 |
-
/*
|
80201 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
80202 |
|
80203 |
"use strict";
|
@@ -80239,7 +84601,7 @@ var Platform = {
|
|
80239 |
//# sourceMappingURL=platform.js.map
|
80240 |
|
80241 |
/***/ }),
|
80242 |
-
/*
|
80243 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
80244 |
|
80245 |
"use strict";
|
@@ -80249,14 +84611,14 @@ var Platform = {
|
|
80249 |
/* unused harmony export renderComponent */
|
80250 |
/* unused harmony export renderAttributes */
|
80251 |
/* unused harmony export renderStyle */
|
80252 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
80253 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
80254 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_typeof__ = __webpack_require__(
|
80255 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
80256 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
80257 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__wordpress_escape_html__ = __webpack_require__(
|
80258 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__react__ = __webpack_require__(97);
|
80259 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__raw_html__ = __webpack_require__(
|
80260 |
|
80261 |
|
80262 |
|
@@ -80540,7 +84902,7 @@ function renderElement(element, context) {
|
|
80540 |
var children = props.children,
|
80541 |
wrapperProps = Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__["a" /* default */])(props, ["children"]);
|
80542 |
|
80543 |
-
return renderNativeComponent(Object(__WEBPACK_IMPORTED_MODULE_3_lodash__["isEmpty"])(wrapperProps) ? null : 'div', _objectSpread({}, wrapperProps, {
|
80544 |
dangerouslySetInnerHTML: {
|
80545 |
__html: children
|
80546 |
}
|
@@ -80765,19 +85127,19 @@ function renderStyle(style) {
|
|
80765 |
//# sourceMappingURL=serialize.js.map
|
80766 |
|
80767 |
/***/ }),
|
80768 |
-
/*
|
80769 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
80770 |
|
80771 |
"use strict";
|
80772 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
80773 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
80774 |
-
/* harmony import */ var
|
80775 |
-
/* harmony import */ var
|
80776 |
-
/* harmony import */ var
|
80777 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_element__ = __webpack_require__(
|
80778 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_is_shallow_equal__ = __webpack_require__(
|
80779 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_is_shallow_equal___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6__wordpress_is_shallow_equal__);
|
80780 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__utils_create_higher_order_component__ = __webpack_require__(
|
80781 |
|
80782 |
|
80783 |
|
@@ -80785,7 +85147,7 @@ function renderStyle(style) {
|
|
80785 |
|
80786 |
|
80787 |
|
80788 |
-
function _createSuper(Derived) { return function () { var Super = Object(
|
80789 |
|
80790 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
80791 |
|
@@ -80814,7 +85176,7 @@ function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Re
|
|
80814 |
var pure = Object(__WEBPACK_IMPORTED_MODULE_7__utils_create_higher_order_component__["a" /* default */])(function (Wrapped) {
|
80815 |
if (Wrapped.prototype instanceof __WEBPACK_IMPORTED_MODULE_5__wordpress_element__["a" /* Component */]) {
|
80816 |
return /*#__PURE__*/function (_Wrapped) {
|
80817 |
-
Object(
|
80818 |
|
80819 |
var _super = _createSuper(_class);
|
80820 |
|
@@ -80836,7 +85198,7 @@ var pure = Object(__WEBPACK_IMPORTED_MODULE_7__utils_create_higher_order_compone
|
|
80836 |
}
|
80837 |
|
80838 |
return /*#__PURE__*/function (_Component) {
|
80839 |
-
Object(
|
80840 |
|
80841 |
var _super2 = _createSuper(_class2);
|
80842 |
|
@@ -80865,7 +85227,7 @@ var pure = Object(__WEBPACK_IMPORTED_MODULE_7__utils_create_higher_order_compone
|
|
80865 |
//# sourceMappingURL=index.js.map
|
80866 |
|
80867 |
/***/ }),
|
80868 |
-
/*
|
80869 |
/***/ (function(module, exports, __webpack_require__) {
|
80870 |
|
80871 |
"use strict";
|
@@ -80874,8 +85236,8 @@ var pure = Object(__WEBPACK_IMPORTED_MODULE_7__utils_create_higher_order_compone
|
|
80874 |
/**
|
80875 |
* Internal dependencies;
|
80876 |
*/
|
80877 |
-
var isShallowEqualObjects = __webpack_require__(
|
80878 |
-
var isShallowEqualArrays = __webpack_require__(
|
80879 |
|
80880 |
var isArray = Array.isArray;
|
80881 |
|
@@ -80910,7 +85272,7 @@ module.exports.isShallowEqualArrays = isShallowEqualArrays;
|
|
80910 |
|
80911 |
|
80912 |
/***/ }),
|
80913 |
-
/*
|
80914 |
/***/ (function(module, exports, __webpack_require__) {
|
80915 |
|
80916 |
"use strict";
|
@@ -80968,7 +85330,7 @@ module.exports = isShallowEqualObjects;
|
|
80968 |
|
80969 |
|
80970 |
/***/ }),
|
80971 |
-
/*
|
80972 |
/***/ (function(module, exports, __webpack_require__) {
|
80973 |
|
80974 |
"use strict";
|
@@ -81006,22 +85368,22 @@ module.exports = isShallowEqualArrays;
|
|
81006 |
|
81007 |
|
81008 |
/***/ }),
|
81009 |
-
/*
|
81010 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
81011 |
|
81012 |
"use strict";
|
81013 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
81014 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
81015 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
81016 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
81017 |
-
/* harmony import */ var
|
81018 |
-
/* harmony import */ var
|
81019 |
-
/* harmony import */ var
|
81020 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(
|
81021 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
81022 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
81023 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__ = __webpack_require__(
|
81024 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__listener__ = __webpack_require__(
|
81025 |
|
81026 |
|
81027 |
|
@@ -81031,7 +85393,7 @@ module.exports = isShallowEqualArrays;
|
|
81031 |
|
81032 |
|
81033 |
|
81034 |
-
function _createSuper(Derived) { return function () { var Super = Object(
|
81035 |
|
81036 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
81037 |
|
@@ -81078,7 +85440,7 @@ var listener = new __WEBPACK_IMPORTED_MODULE_10__listener__["a" /* default */]()
|
|
81078 |
function withGlobalEvents(eventTypesToHandlers) {
|
81079 |
return Object(__WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__["a" /* default */])(function (WrappedComponent) {
|
81080 |
var Wrapper = /*#__PURE__*/function (_Component) {
|
81081 |
-
Object(
|
81082 |
|
81083 |
var _super = _createSuper(Wrapper);
|
81084 |
|
@@ -81156,7 +85518,7 @@ function withGlobalEvents(eventTypesToHandlers) {
|
|
81156 |
//# sourceMappingURL=index.js.map
|
81157 |
|
81158 |
/***/ }),
|
81159 |
-
/*
|
81160 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
81161 |
|
81162 |
"use strict";
|
@@ -81223,14 +85585,14 @@ var Listener = /*#__PURE__*/function () {
|
|
81223 |
//# sourceMappingURL=listener.js.map
|
81224 |
|
81225 |
/***/ }),
|
81226 |
-
/*
|
81227 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
81228 |
|
81229 |
"use strict";
|
81230 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
81231 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(
|
81232 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_create_higher_order_component__ = __webpack_require__(
|
81233 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__hooks_use_instance_id__ = __webpack_require__(
|
81234 |
|
81235 |
|
81236 |
|
@@ -81259,21 +85621,21 @@ var Listener = /*#__PURE__*/function () {
|
|
81259 |
//# sourceMappingURL=index.js.map
|
81260 |
|
81261 |
/***/ }),
|
81262 |
-
/*
|
81263 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
81264 |
|
81265 |
"use strict";
|
81266 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
81267 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
81268 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
81269 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
81270 |
-
/* harmony import */ var
|
81271 |
-
/* harmony import */ var
|
81272 |
-
/* harmony import */ var
|
81273 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(
|
81274 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
81275 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
81276 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__ = __webpack_require__(
|
81277 |
|
81278 |
|
81279 |
|
@@ -81283,7 +85645,7 @@ var Listener = /*#__PURE__*/function () {
|
|
81283 |
|
81284 |
|
81285 |
|
81286 |
-
function _createSuper(Derived) { return function () { var Super = Object(
|
81287 |
|
81288 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
81289 |
|
@@ -81312,7 +85674,7 @@ function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Re
|
|
81312 |
|
81313 |
var withSafeTimeout = Object(__WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__["a" /* default */])(function (OriginalComponent) {
|
81314 |
return /*#__PURE__*/function (_Component) {
|
81315 |
-
Object(
|
81316 |
|
81317 |
var _super = _createSuper(WrappedComponent);
|
81318 |
|
@@ -81389,7 +85751,7 @@ var withSafeTimeout = Object(__WEBPACK_IMPORTED_MODULE_9__utils_create_higher_or
|
|
81389 |
//# sourceMappingURL=index.js.map
|
81390 |
|
81391 |
/***/ }),
|
81392 |
-
/*
|
81393 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
81394 |
|
81395 |
"use strict";
|
@@ -81397,12 +85759,12 @@ var withSafeTimeout = Object(__WEBPACK_IMPORTED_MODULE_9__utils_create_higher_or
|
|
81397 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
81398 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
81399 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
81400 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
81401 |
-
/* harmony import */ var
|
81402 |
-
/* harmony import */ var
|
81403 |
-
/* harmony import */ var
|
81404 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(
|
81405 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__utils_create_higher_order_component__ = __webpack_require__(
|
81406 |
|
81407 |
|
81408 |
|
@@ -81412,7 +85774,7 @@ var withSafeTimeout = Object(__WEBPACK_IMPORTED_MODULE_9__utils_create_higher_or
|
|
81412 |
|
81413 |
|
81414 |
|
81415 |
-
function _createSuper(Derived) { return function () { var Super = Object(
|
81416 |
|
81417 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
81418 |
|
@@ -81438,7 +85800,7 @@ function withState() {
|
|
81438 |
var initialState = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
|
81439 |
return Object(__WEBPACK_IMPORTED_MODULE_8__utils_create_higher_order_component__["a" /* default */])(function (OriginalComponent) {
|
81440 |
return /*#__PURE__*/function (_Component) {
|
81441 |
-
Object(
|
81442 |
|
81443 |
var _super = _createSuper(WrappedComponent);
|
81444 |
|
@@ -81469,13 +85831,92 @@ function withState() {
|
|
81469 |
//# sourceMappingURL=index.js.map
|
81470 |
|
81471 |
/***/ }),
|
81472 |
-
/*
|
81473 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
81474 |
|
81475 |
"use strict";
|
81476 |
/* unused harmony export default */
|
81477 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(
|
81478 |
-
/* harmony import */ var
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
81479 |
|
81480 |
|
81481 |
/**
|
@@ -81488,12 +85929,12 @@ function useDragging(_ref) {
|
|
81488 |
onDragMove = _ref.onDragMove,
|
81489 |
onDragEnd = _ref.onDragEnd;
|
81490 |
|
81491 |
-
var _useState = Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_element__["
|
81492 |
_useState2 = Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__["a" /* default */])(_useState, 2),
|
81493 |
isDragging = _useState2[0],
|
81494 |
setIsDragging = _useState2[1];
|
81495 |
|
81496 |
-
var eventsRef = Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_element__["
|
81497 |
onDragStart: onDragStart,
|
81498 |
onDragMove: onDragMove,
|
81499 |
onDragEnd: onDragEnd
|
@@ -81548,17 +85989,17 @@ function useDragging(_ref) {
|
|
81548 |
//# sourceMappingURL=index.js.map
|
81549 |
|
81550 |
/***/ }),
|
81551 |
-
/*
|
81552 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
81553 |
|
81554 |
"use strict";
|
81555 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_mousetrap__ = __webpack_require__(
|
81556 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_mousetrap___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_mousetrap__);
|
81557 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_mousetrap_plugins_global_bind_mousetrap_global_bind__ = __webpack_require__(
|
81558 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_mousetrap_plugins_global_bind_mousetrap_global_bind___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_mousetrap_plugins_global_bind_mousetrap_global_bind__);
|
81559 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash__ = __webpack_require__(2);
|
81560 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_lodash__);
|
81561 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_element__ = __webpack_require__(
|
81562 |
/**
|
81563 |
* External dependencies
|
81564 |
*/
|
@@ -81614,6 +86055,10 @@ function useKeyboardShortcut(shortcuts, callback) {
|
|
81614 |
isDisabled = _ref$isDisabled === void 0 ? false : _ref$isDisabled,
|
81615 |
target = _ref.target;
|
81616 |
|
|
|
|
|
|
|
|
|
81617 |
Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_element__["g" /* useEffect */])(function () {
|
81618 |
if (isDisabled) {
|
81619 |
return;
|
@@ -81636,23 +86081,25 @@ function useKeyboardShortcut(shortcuts, callback) {
|
|
81636 |
}
|
81637 |
|
81638 |
var bindFn = bindGlobal ? 'bindGlobal' : 'bind';
|
81639 |
-
mousetrap[bindFn](shortcut,
|
|
|
|
|
81640 |
});
|
81641 |
return function () {
|
81642 |
mousetrap.reset();
|
81643 |
};
|
81644 |
-
}, [shortcuts, bindGlobal, eventName,
|
81645 |
}
|
81646 |
|
81647 |
/* unused harmony default export */ var _unused_webpack_default_export = (useKeyboardShortcut);
|
81648 |
//# sourceMappingURL=index.js.map
|
81649 |
|
81650 |
/***/ }),
|
81651 |
-
/*
|
81652 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
81653 |
|
81654 |
"use strict";
|
81655 |
-
/* WEBPACK VAR INJECTION */(function(process) {/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__use_media_query__ = __webpack_require__(
|
81656 |
/**
|
81657 |
* Internal dependencies
|
81658 |
*/
|
@@ -81680,12 +86127,12 @@ var useReducedMotion = process.env.FORCE_REDUCED_MOTION || IS_IE ? function () {
|
|
81680 |
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(20)))
|
81681 |
|
81682 |
/***/ }),
|
81683 |
-
/*
|
81684 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
81685 |
|
81686 |
"use strict";
|
81687 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(
|
81688 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__use_media_query__ = __webpack_require__(
|
81689 |
/**
|
81690 |
* WordPress dependencies
|
81691 |
*/
|
@@ -81778,11 +86225,11 @@ useViewportMatch.__experimentalWidthProvider = ViewportMatchWidthContext.Provide
|
|
81778 |
//# sourceMappingURL=index.js.map
|
81779 |
|
81780 |
/***/ }),
|
81781 |
-
/*
|
81782 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
81783 |
|
81784 |
"use strict";
|
81785 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_resize_aware__ = __webpack_require__(
|
81786 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_resize_aware___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react_resize_aware__);
|
81787 |
/**
|
81788 |
* External dependencies
|
@@ -81815,79 +86262,312 @@ useViewportMatch.__experimentalWidthProvider = ViewportMatchWidthContext.Provide
|
|
81815 |
//# sourceMappingURL=index.js.map
|
81816 |
|
81817 |
/***/ }),
|
81818 |
-
/*
|
81819 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
81820 |
|
81821 |
"use strict";
|
81822 |
-
/* harmony import */ var
|
81823 |
-
/* harmony import */ var
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
81824 |
/* unused harmony reexport applyFormat */
|
81825 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__concat__ = __webpack_require__(
|
81826 |
/* unused harmony reexport concat */
|
81827 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__create__ = __webpack_require__(
|
81828 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_3__create__["a"]; });
|
81829 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__get_active_format__ = __webpack_require__(
|
81830 |
/* unused harmony reexport getActiveFormat */
|
81831 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__get_active_object__ = __webpack_require__(
|
81832 |
/* unused harmony reexport getActiveObject */
|
81833 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__get_text_content__ = __webpack_require__(
|
81834 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_6__get_text_content__["a"]; });
|
81835 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__is_list_root_selected__ = __webpack_require__(
|
81836 |
/* unused harmony reexport __unstableIsListRootSelected */
|
81837 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__is_active_list_type__ = __webpack_require__(
|
81838 |
/* unused harmony reexport __unstableIsActiveListType */
|
81839 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__is_collapsed__ = __webpack_require__(
|
81840 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return __WEBPACK_IMPORTED_MODULE_9__is_collapsed__["a"]; });
|
81841 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__is_empty__ = __webpack_require__(
|
81842 |
/* unused harmony reexport isEmpty */
|
81843 |
/* unused harmony reexport __unstableIsEmptyLine */
|
81844 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__join__ = __webpack_require__(
|
81845 |
/* unused harmony reexport join */
|
81846 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__register_format_type__ = __webpack_require__(
|
81847 |
/* unused harmony reexport registerFormatType */
|
81848 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__remove_format__ = __webpack_require__(
|
81849 |
/* unused harmony reexport removeFormat */
|
81850 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__remove__ = __webpack_require__(
|
81851 |
/* unused harmony reexport remove */
|
81852 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__replace__ = __webpack_require__(
|
81853 |
/* unused harmony reexport replace */
|
81854 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__insert__ = __webpack_require__(
|
81855 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_16__insert__["a"]; });
|
81856 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__insert_line_separator__ = __webpack_require__(
|
81857 |
/* unused harmony reexport __unstableInsertLineSeparator */
|
81858 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__remove_line_separator__ = __webpack_require__(
|
81859 |
/* unused harmony reexport __unstableRemoveLineSeparator */
|
81860 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__insert_object__ = __webpack_require__(
|
81861 |
/* unused harmony reexport insertObject */
|
81862 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__slice__ = __webpack_require__(
|
81863 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "e", function() { return __WEBPACK_IMPORTED_MODULE_20__slice__["a"]; });
|
81864 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_21__split__ = __webpack_require__(
|
81865 |
/* unused harmony reexport split */
|
81866 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_22__to_dom__ = __webpack_require__(
|
81867 |
/* unused harmony reexport __unstableToDom */
|
81868 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_23__to_html_string__ = __webpack_require__(
|
81869 |
/* unused harmony reexport toHTMLString */
|
81870 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_24__toggle_format__ = __webpack_require__(
|
81871 |
/* unused harmony reexport toggleFormat */
|
81872 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_25__special_characters__ = __webpack_require__(
|
81873 |
/* unused harmony reexport __UNSTABLE_LINE_SEPARATOR */
|
81874 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_26__unregister_format_type__ = __webpack_require__(
|
81875 |
/* unused harmony reexport unregisterFormatType */
|
81876 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_27__can_indent_list_items__ = __webpack_require__(
|
81877 |
/* unused harmony reexport __unstableCanIndentListItems */
|
81878 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_28__can_outdent_list_items__ = __webpack_require__(
|
81879 |
/* unused harmony reexport __unstableCanOutdentListItems */
|
81880 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_29__indent_list_items__ = __webpack_require__(
|
81881 |
/* unused harmony reexport __unstableIndentListItems */
|
81882 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_30__outdent_list_items__ = __webpack_require__(
|
81883 |
/* unused harmony reexport __unstableOutdentListItems */
|
81884 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_31__change_list_type__ = __webpack_require__(
|
81885 |
/* unused harmony reexport __unstableChangeListType */
|
81886 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_32__create_element__ = __webpack_require__(
|
81887 |
/* unused harmony reexport __unstableCreateElement */
|
81888 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_33__component__ = __webpack_require__(
|
81889 |
/* unused harmony reexport __experimentalRichText */
|
81890 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_34__component_format_edit__ = __webpack_require__(
|
81891 |
/* unused harmony reexport __unstableFormatEdit */
|
81892 |
/**
|
81893 |
* Internal dependencies
|
@@ -81930,14 +86610,14 @@ useViewportMatch.__experimentalWidthProvider = ViewportMatchWidthContext.Provide
|
|
81930 |
//# sourceMappingURL=index.js.map
|
81931 |
|
81932 |
/***/ }),
|
81933 |
-
/*
|
81934 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
81935 |
|
81936 |
"use strict";
|
81937 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_data__ = __webpack_require__(
|
81938 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__reducer__ = __webpack_require__(
|
81939 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__selectors__ = __webpack_require__(
|
81940 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__actions__ = __webpack_require__(
|
81941 |
/**
|
81942 |
* WordPress dependencies
|
81943 |
*/
|
@@ -81949,7 +86629,7 @@ useViewportMatch.__experimentalWidthProvider = ViewportMatchWidthContext.Provide
|
|
81949 |
|
81950 |
|
81951 |
|
81952 |
-
Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_data__["
|
81953 |
reducer: __WEBPACK_IMPORTED_MODULE_1__reducer__["a" /* default */],
|
81954 |
selectors: __WEBPACK_IMPORTED_MODULE_2__selectors__,
|
81955 |
actions: __WEBPACK_IMPORTED_MODULE_3__actions__
|
@@ -81957,26 +86637,29 @@ Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_data__["d" /* registerStore */])('
|
|
81957 |
//# sourceMappingURL=index.js.map
|
81958 |
|
81959 |
/***/ }),
|
81960 |
-
/*
|
81961 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
81962 |
|
81963 |
"use strict";
|
81964 |
/* harmony export (immutable) */ __webpack_exports__["a"] = createNamespace;
|
81965 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator__ = __webpack_require__(
|
81966 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator__);
|
81967 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_asyncToGenerator__ = __webpack_require__(
|
81968 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
81969 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_redux__ = __webpack_require__(
|
81970 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash__ = __webpack_require__(2);
|
81971 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_lodash__);
|
81972 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_turbo_combine_reducers__ = __webpack_require__(
|
81973 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_turbo_combine_reducers___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_5_turbo_combine_reducers__);
|
81974 |
-
/* harmony import */ var
|
81975 |
-
/* harmony import */ var
|
81976 |
-
/* harmony import */ var
|
81977 |
-
/* harmony import */ var
|
81978 |
-
/* harmony import */ var
|
81979 |
-
/* harmony import */ var
|
|
|
|
|
|
|
81980 |
|
81981 |
|
81982 |
|
@@ -81991,6 +86674,7 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
81991 |
|
81992 |
|
81993 |
|
|
|
81994 |
/**
|
81995 |
* WordPress dependencies
|
81996 |
*/
|
@@ -82005,6 +86689,33 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
82005 |
|
82006 |
|
82007 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
82008 |
/**
|
82009 |
* @typedef {WPDataRegistry} WPDataRegistry
|
82010 |
*/
|
@@ -82021,12 +86732,14 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
82021 |
* @return {Object} Store Object.
|
82022 |
*/
|
82023 |
|
|
|
82024 |
function createNamespace(key, options, registry) {
|
82025 |
var reducer = options.reducer;
|
82026 |
var store = createReduxStore(key, options, registry);
|
|
|
82027 |
var resolvers;
|
82028 |
-
var actions = mapActions(_objectSpread({},
|
82029 |
-
var selectors = mapSelectors(_objectSpread({}, Object(__WEBPACK_IMPORTED_MODULE_4_lodash__["mapValues"])(
|
82030 |
return function (state) {
|
82031 |
for (var _len = arguments.length, args = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
|
82032 |
args[_key - 1] = arguments[_key];
|
@@ -82034,7 +86747,7 @@ function createNamespace(key, options, registry) {
|
|
82034 |
|
82035 |
return selector.apply(void 0, [state.metadata].concat(args));
|
82036 |
};
|
82037 |
-
}),
|
82038 |
if (selector.isRegistrySelector) {
|
82039 |
selector.registry = registry;
|
82040 |
}
|
@@ -82049,7 +86762,7 @@ function createNamespace(key, options, registry) {
|
|
82049 |
})), store);
|
82050 |
|
82051 |
if (options.resolvers) {
|
82052 |
-
var result = mapResolvers(options.resolvers, selectors, store);
|
82053 |
resolvers = result.resolvers;
|
82054 |
selectors = result.selectors;
|
82055 |
}
|
@@ -82114,15 +86827,12 @@ function createNamespace(key, options, registry) {
|
|
82114 |
*/
|
82115 |
|
82116 |
function createReduxStore(key, options, registry) {
|
82117 |
-
var
|
82118 |
-
|
82119 |
-
if (options.controls) {
|
82120 |
-
var normalizedControls = Object(__WEBPACK_IMPORTED_MODULE_4_lodash__["mapValues"])(options.controls, function (control) {
|
82121 |
-
return control.isRegistryControl ? control(registry) : control;
|
82122 |
-
});
|
82123 |
-
middlewares.push(Object(__WEBPACK_IMPORTED_MODULE_6__wordpress_redux_routine__["a" /* default */])(normalizedControls));
|
82124 |
-
}
|
82125 |
|
|
|
|
|
|
|
|
|
82126 |
var enhancers = [__WEBPACK_IMPORTED_MODULE_3_redux__["a" /* applyMiddleware */].apply(void 0, middlewares)];
|
82127 |
|
82128 |
if (typeof window !== 'undefined' && window.__REDUX_DEVTOOLS_EXTENSION__) {
|
@@ -82135,7 +86845,7 @@ function createReduxStore(key, options, registry) {
|
|
82135 |
var reducer = options.reducer,
|
82136 |
initialState = options.initialState;
|
82137 |
var enhancedReducer = __WEBPACK_IMPORTED_MODULE_5_turbo_combine_reducers___default()({
|
82138 |
-
metadata:
|
82139 |
root: reducer
|
82140 |
});
|
82141 |
return Object(__WEBPACK_IMPORTED_MODULE_3_redux__["b" /* createStore */])(enhancedReducer, {
|
@@ -82149,7 +86859,6 @@ function createReduxStore(key, options, registry) {
|
|
82149 |
* public facing API. Selectors will get passed the
|
82150 |
* state as first argument.
|
82151 |
* @param {Object} store The store to which the selectors should be mapped.
|
82152 |
-
*
|
82153 |
* @return {Object} Selectors mapped to the provided store.
|
82154 |
*/
|
82155 |
|
@@ -82204,19 +86913,26 @@ function mapActions(actions, store) {
|
|
82204 |
* Resolvers are side effects invoked once per argument set of a given selector call,
|
82205 |
* used in ensuring that the data needs for the selector are satisfied.
|
82206 |
*
|
82207 |
-
* @param {Object} resolvers
|
82208 |
-
* @param {Object} selectors
|
82209 |
-
* @param {Object} store
|
82210 |
-
* @
|
82211 |
*/
|
82212 |
|
82213 |
|
82214 |
-
function mapResolvers(resolvers, selectors, store) {
|
|
|
|
|
|
|
82215 |
var mappedResolvers = Object(__WEBPACK_IMPORTED_MODULE_4_lodash__["mapValues"])(resolvers, function (resolver) {
|
82216 |
-
|
82217 |
-
|
82218 |
-
|
82219 |
-
|
|
|
|
|
|
|
|
|
82220 |
});
|
82221 |
});
|
82222 |
|
@@ -82238,46 +86954,61 @@ function mapResolvers(resolvers, selectors, store) {
|
|
82238 |
}
|
82239 |
|
82240 |
function _fulfillSelector() {
|
82241 |
-
_fulfillSelector = Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_asyncToGenerator__["a" /* default */])( /*#__PURE__*/__WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator___default.a.mark(function
|
82242 |
var state, _store$__unstableOrig, metadata;
|
82243 |
|
82244 |
-
return __WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator___default.a.wrap(function
|
82245 |
while (1) {
|
82246 |
-
switch (
|
82247 |
case 0:
|
82248 |
state = store.getState();
|
82249 |
|
82250 |
-
if (!(typeof resolver.isFulfilled === 'function' && resolver.isFulfilled.apply(resolver, [state].concat(args)))) {
|
82251 |
-
|
82252 |
break;
|
82253 |
}
|
82254 |
|
82255 |
-
return
|
82256 |
|
82257 |
case 3:
|
82258 |
_store$__unstableOrig = store.__unstableOriginalGetState(), metadata = _store$__unstableOrig.metadata;
|
82259 |
|
82260 |
-
if (!
|
82261 |
-
|
82262 |
break;
|
82263 |
}
|
82264 |
|
82265 |
-
return
|
82266 |
|
82267 |
case 6:
|
82268 |
-
|
82269 |
-
|
82270 |
-
|
82271 |
-
|
82272 |
-
|
82273 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
82274 |
|
82275 |
-
case
|
82276 |
case "end":
|
82277 |
-
return
|
82278 |
}
|
82279 |
}
|
82280 |
-
},
|
82281 |
}));
|
82282 |
return _fulfillSelector.apply(this, arguments);
|
82283 |
}
|
@@ -82310,62 +87041,62 @@ function fulfillResolver(_x, _x2, _x3) {
|
|
82310 |
}
|
82311 |
|
82312 |
function _fulfillResolver() {
|
82313 |
-
_fulfillResolver = Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_asyncToGenerator__["a" /* default */])( /*#__PURE__*/__WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator___default.a.mark(function
|
82314 |
var resolver,
|
82315 |
_len4,
|
82316 |
args,
|
82317 |
_key4,
|
82318 |
action,
|
82319 |
-
|
82320 |
|
82321 |
-
return __WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator___default.a.wrap(function
|
82322 |
while (1) {
|
82323 |
-
switch (
|
82324 |
case 0:
|
82325 |
resolver = Object(__WEBPACK_IMPORTED_MODULE_4_lodash__["get"])(resolvers, [selectorName]);
|
82326 |
|
82327 |
if (resolver) {
|
82328 |
-
|
82329 |
break;
|
82330 |
}
|
82331 |
|
82332 |
-
return
|
82333 |
|
82334 |
case 3:
|
82335 |
-
for (_len4 =
|
82336 |
-
args[_key4 - 3] =
|
82337 |
}
|
82338 |
|
82339 |
action = resolver.fulfill.apply(resolver, args);
|
82340 |
|
82341 |
if (!action) {
|
82342 |
-
|
82343 |
break;
|
82344 |
}
|
82345 |
|
82346 |
-
|
82347 |
return store.dispatch(action);
|
82348 |
|
82349 |
case 8:
|
82350 |
case "end":
|
82351 |
-
return
|
82352 |
}
|
82353 |
}
|
82354 |
-
},
|
82355 |
}));
|
82356 |
return _fulfillResolver.apply(this, arguments);
|
82357 |
}
|
82358 |
//# sourceMappingURL=index.js.map
|
82359 |
|
82360 |
/***/ }),
|
82361 |
-
/*
|
82362 |
/***/ (function(module, exports, __webpack_require__) {
|
82363 |
|
82364 |
-
module.exports = __webpack_require__(
|
82365 |
|
82366 |
|
82367 |
/***/ }),
|
82368 |
-
/*
|
82369 |
/***/ (function(module, exports, __webpack_require__) {
|
82370 |
|
82371 |
/**
|
@@ -82386,6 +87117,24 @@ var runtime = (function (exports) {
|
|
82386 |
var asyncIteratorSymbol = $Symbol.asyncIterator || "@@asyncIterator";
|
82387 |
var toStringTagSymbol = $Symbol.toStringTag || "@@toStringTag";
|
82388 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
82389 |
function wrap(innerFn, outerFn, self, tryLocsList) {
|
82390 |
// If outerFn provided and outerFn.prototype is a Generator, then outerFn.prototype instanceof Generator.
|
82391 |
var protoGenerator = outerFn && outerFn.prototype instanceof Generator ? outerFn : Generator;
|
@@ -82456,16 +87205,19 @@ var runtime = (function (exports) {
|
|
82456 |
Generator.prototype = Object.create(IteratorPrototype);
|
82457 |
GeneratorFunction.prototype = Gp.constructor = GeneratorFunctionPrototype;
|
82458 |
GeneratorFunctionPrototype.constructor = GeneratorFunction;
|
82459 |
-
|
82460 |
-
|
|
|
|
|
|
|
82461 |
|
82462 |
// Helper for defining the .next, .throw, and .return methods of the
|
82463 |
// Iterator interface in terms of a single ._invoke method.
|
82464 |
function defineIteratorMethods(prototype) {
|
82465 |
["next", "throw", "return"].forEach(function(method) {
|
82466 |
-
prototype
|
82467 |
return this._invoke(method, arg);
|
82468 |
-
};
|
82469 |
});
|
82470 |
}
|
82471 |
|
@@ -82484,9 +87236,7 @@ var runtime = (function (exports) {
|
|
82484 |
Object.setPrototypeOf(genFun, GeneratorFunctionPrototype);
|
82485 |
} else {
|
82486 |
genFun.__proto__ = GeneratorFunctionPrototype;
|
82487 |
-
|
82488 |
-
genFun[toStringTagSymbol] = "GeneratorFunction";
|
82489 |
-
}
|
82490 |
}
|
82491 |
genFun.prototype = Object.create(Gp);
|
82492 |
return genFun;
|
@@ -82756,7 +87506,7 @@ var runtime = (function (exports) {
|
|
82756 |
// unified ._invoke helper method.
|
82757 |
defineIteratorMethods(Gp);
|
82758 |
|
82759 |
-
Gp
|
82760 |
|
82761 |
// A Generator should always return itself as the iterator object when the
|
82762 |
// @@iterator function is called on it. Some browsers' implementations of the
|
@@ -83100,7 +87850,7 @@ try {
|
|
83100 |
|
83101 |
|
83102 |
/***/ }),
|
83103 |
-
/*
|
83104 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83105 |
|
83106 |
"use strict";
|
@@ -83110,7 +87860,7 @@ try {
|
|
83110 |
/* unused harmony export combineReducers */
|
83111 |
/* unused harmony export compose */
|
83112 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return createStore; });
|
83113 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_symbol_observable__ = __webpack_require__(
|
83114 |
|
83115 |
|
83116 |
/**
|
@@ -83778,11 +88528,11 @@ if (process.env.NODE_ENV !== 'production' && typeof isCrushed.name === 'string'
|
|
83778 |
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(20)))
|
83779 |
|
83780 |
/***/ }),
|
83781 |
-
/*
|
83782 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83783 |
|
83784 |
"use strict";
|
83785 |
-
/* WEBPACK VAR INJECTION */(function(global, module) {/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__ponyfill_js__ = __webpack_require__(
|
83786 |
/* global window */
|
83787 |
|
83788 |
|
@@ -83803,40 +88553,40 @@ if (typeof self !== 'undefined') {
|
|
83803 |
var result = Object(__WEBPACK_IMPORTED_MODULE_0__ponyfill_js__["a" /* default */])(root);
|
83804 |
/* harmony default export */ __webpack_exports__["a"] = (result);
|
83805 |
|
83806 |
-
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(
|
83807 |
|
83808 |
/***/ }),
|
83809 |
-
/*
|
83810 |
/***/ (function(module, exports) {
|
83811 |
|
83812 |
-
module.exports = function(originalModule) {
|
83813 |
-
if(!originalModule.webpackPolyfill) {
|
83814 |
-
var module = Object.create(originalModule);
|
83815 |
-
// module.parent = undefined by default
|
83816 |
-
if(!module.children) module.children = [];
|
83817 |
-
Object.defineProperty(module, "loaded", {
|
83818 |
-
enumerable: true,
|
83819 |
-
get: function() {
|
83820 |
-
return module.l;
|
83821 |
-
}
|
83822 |
-
});
|
83823 |
-
Object.defineProperty(module, "id", {
|
83824 |
-
enumerable: true,
|
83825 |
-
get: function() {
|
83826 |
-
return module.i;
|
83827 |
-
}
|
83828 |
-
});
|
83829 |
-
Object.defineProperty(module, "exports", {
|
83830 |
-
enumerable: true,
|
83831 |
-
});
|
83832 |
-
module.webpackPolyfill = 1;
|
83833 |
-
}
|
83834 |
-
return module;
|
83835 |
-
};
|
83836 |
|
83837 |
|
83838 |
/***/ }),
|
83839 |
-
/*
|
83840 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83841 |
|
83842 |
"use strict";
|
@@ -83861,13 +88611,13 @@ function symbolObservablePonyfill(root) {
|
|
83861 |
|
83862 |
|
83863 |
/***/ }),
|
83864 |
-
/*
|
83865 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83866 |
|
83867 |
"use strict";
|
83868 |
/* harmony export (immutable) */ __webpack_exports__["a"] = createMiddleware;
|
83869 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__is_generator__ = __webpack_require__(
|
83870 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__runtime__ = __webpack_require__(
|
83871 |
/**
|
83872 |
* Internal dependencies
|
83873 |
*/
|
@@ -83904,7 +88654,7 @@ function createMiddleware() {
|
|
83904 |
//# sourceMappingURL=index.js.map
|
83905 |
|
83906 |
/***/ }),
|
83907 |
-
/*
|
83908 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83909 |
|
83910 |
"use strict";
|
@@ -83926,18 +88676,18 @@ function isGenerator(object) {
|
|
83926 |
//# sourceMappingURL=is-generator.js.map
|
83927 |
|
83928 |
/***/ }),
|
83929 |
-
/*
|
83930 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83931 |
|
83932 |
"use strict";
|
83933 |
/* harmony export (immutable) */ __webpack_exports__["a"] = createRuntime;
|
83934 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_rungen__ = __webpack_require__(
|
83935 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_rungen___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_rungen__);
|
83936 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
83937 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
83938 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_is_promise__ = __webpack_require__(
|
83939 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_is_promise___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_is_promise__);
|
83940 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__is_action__ = __webpack_require__(
|
83941 |
/**
|
83942 |
* External dependencies
|
83943 |
*/
|
@@ -84007,7 +88757,7 @@ function createRuntime() {
|
|
84007 |
//# sourceMappingURL=runtime.js.map
|
84008 |
|
84009 |
/***/ }),
|
84010 |
-
/*
|
84011 |
/***/ (function(module, exports, __webpack_require__) {
|
84012 |
|
84013 |
"use strict";
|
@@ -84018,7 +88768,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
84018 |
});
|
84019 |
exports.wrapControls = exports.asyncControls = exports.create = undefined;
|
84020 |
|
84021 |
-
var _helpers = __webpack_require__(
|
84022 |
|
84023 |
Object.keys(_helpers).forEach(function (key) {
|
84024 |
if (key === "default") return;
|
@@ -84030,15 +88780,15 @@ Object.keys(_helpers).forEach(function (key) {
|
|
84030 |
});
|
84031 |
});
|
84032 |
|
84033 |
-
var _create = __webpack_require__(
|
84034 |
|
84035 |
var _create2 = _interopRequireDefault(_create);
|
84036 |
|
84037 |
-
var _async = __webpack_require__(
|
84038 |
|
84039 |
var _async2 = _interopRequireDefault(_async);
|
84040 |
|
84041 |
-
var _wrap = __webpack_require__(
|
84042 |
|
84043 |
var _wrap2 = _interopRequireDefault(_wrap);
|
84044 |
|
@@ -84049,7 +88799,7 @@ exports.asyncControls = _async2.default;
|
|
84049 |
exports.wrapControls = _wrap2.default;
|
84050 |
|
84051 |
/***/ }),
|
84052 |
-
/*
|
84053 |
/***/ (function(module, exports, __webpack_require__) {
|
84054 |
|
84055 |
"use strict";
|
@@ -84059,11 +88809,11 @@ Object.defineProperty(exports, "__esModule", {
|
|
84059 |
value: true
|
84060 |
});
|
84061 |
|
84062 |
-
var _builtin = __webpack_require__(
|
84063 |
|
84064 |
var _builtin2 = _interopRequireDefault(_builtin);
|
84065 |
|
84066 |
-
var _is = __webpack_require__(
|
84067 |
|
84068 |
var _is2 = _interopRequireDefault(_is);
|
84069 |
|
@@ -84134,7 +88884,7 @@ var create = function create() {
|
|
84134 |
exports.default = create;
|
84135 |
|
84136 |
/***/ }),
|
84137 |
-
/*
|
84138 |
/***/ (function(module, exports, __webpack_require__) {
|
84139 |
|
84140 |
"use strict";
|
@@ -84145,7 +88895,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
84145 |
});
|
84146 |
exports.iterator = exports.array = exports.object = exports.error = exports.any = undefined;
|
84147 |
|
84148 |
-
var _is = __webpack_require__(
|
84149 |
|
84150 |
var _is2 = _interopRequireDefault(_is);
|
84151 |
|
@@ -84234,7 +88984,7 @@ var iterator = exports.iterator = function iterator(value, next, rungen, yieldNe
|
|
84234 |
exports.default = [error, iterator, array, object, any];
|
84235 |
|
84236 |
/***/ }),
|
84237 |
-
/*
|
84238 |
/***/ (function(module, exports, __webpack_require__) {
|
84239 |
|
84240 |
"use strict";
|
@@ -84245,13 +88995,13 @@ Object.defineProperty(exports, "__esModule", {
|
|
84245 |
});
|
84246 |
exports.race = exports.join = exports.fork = exports.promise = undefined;
|
84247 |
|
84248 |
-
var _is = __webpack_require__(
|
84249 |
|
84250 |
var _is2 = _interopRequireDefault(_is);
|
84251 |
|
84252 |
-
var _helpers = __webpack_require__(
|
84253 |
|
84254 |
-
var _dispatcher = __webpack_require__(
|
84255 |
|
84256 |
var _dispatcher2 = _interopRequireDefault(_dispatcher);
|
84257 |
|
@@ -84355,7 +89105,7 @@ var subscribe = function subscribe(value, next) {
|
|
84355 |
exports.default = [promise, fork, join, race, subscribe];
|
84356 |
|
84357 |
/***/ }),
|
84358 |
-
/*
|
84359 |
/***/ (function(module, exports, __webpack_require__) {
|
84360 |
|
84361 |
"use strict";
|
@@ -84387,7 +89137,7 @@ var createDispatcher = function createDispatcher() {
|
|
84387 |
exports.default = createDispatcher;
|
84388 |
|
84389 |
/***/ }),
|
84390 |
-
/*
|
84391 |
/***/ (function(module, exports, __webpack_require__) {
|
84392 |
|
84393 |
"use strict";
|
@@ -84398,7 +89148,7 @@ Object.defineProperty(exports, "__esModule", {
|
|
84398 |
});
|
84399 |
exports.cps = exports.call = undefined;
|
84400 |
|
84401 |
-
var _is = __webpack_require__(
|
84402 |
|
84403 |
var _is2 = _interopRequireDefault(_is);
|
84404 |
|
@@ -84429,7 +89179,7 @@ var cps = exports.cps = function cps(value, next, rungen, yieldNext, raiseNext)
|
|
84429 |
exports.default = [call, cps];
|
84430 |
|
84431 |
/***/ }),
|
84432 |
-
/*
|
84433 |
/***/ (function(module, exports) {
|
84434 |
|
84435 |
module.exports = isPromise;
|
@@ -84441,7 +89191,7 @@ function isPromise(obj) {
|
|
84441 |
|
84442 |
|
84443 |
/***/ }),
|
84444 |
-
/*
|
84445 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
84446 |
|
84447 |
"use strict";
|
@@ -84480,11 +89230,11 @@ function isActionOfType(object, expectedType) {
|
|
84480 |
//# sourceMappingURL=is-action.js.map
|
84481 |
|
84482 |
/***/ }),
|
84483 |
-
/*
|
84484 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
84485 |
|
84486 |
"use strict";
|
84487 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_is_promise__ = __webpack_require__(
|
84488 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_is_promise___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_is_promise__);
|
84489 |
/**
|
84490 |
* External dependencies
|
@@ -84516,7 +89266,7 @@ var promiseMiddleware = function promiseMiddleware() {
|
|
84516 |
//# sourceMappingURL=promise-middleware.js.map
|
84517 |
|
84518 |
/***/ }),
|
84519 |
-
/*
|
84520 |
/***/ (function(module, exports) {
|
84521 |
|
84522 |
module.exports = isPromise;
|
@@ -84528,12 +89278,12 @@ function isPromise(obj) {
|
|
84528 |
|
84529 |
|
84530 |
/***/ }),
|
84531 |
-
/*
|
84532 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
84533 |
|
84534 |
"use strict";
|
84535 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
84536 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(
|
84537 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash__ = __webpack_require__(2);
|
84538 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_lodash__);
|
84539 |
|
@@ -84594,15 +89344,15 @@ var createResolversCacheMiddleware = function createResolversCacheMiddleware(reg
|
|
84594 |
//# sourceMappingURL=resolvers-cache-middleware.js.map
|
84595 |
|
84596 |
/***/ }),
|
84597 |
-
/*
|
84598 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
84599 |
|
84600 |
"use strict";
|
84601 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash__ = __webpack_require__(2);
|
84602 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_lodash__);
|
84603 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_equivalent_key_map__ = __webpack_require__(
|
84604 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_equivalent_key_map___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_equivalent_key_map__);
|
84605 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils__ = __webpack_require__(
|
84606 |
/**
|
84607 |
* External dependencies
|
84608 |
*/
|
@@ -84625,7 +89375,7 @@ var createResolversCacheMiddleware = function createResolversCacheMiddleware(reg
|
|
84625 |
* @return {Object} Next state.
|
84626 |
*/
|
84627 |
|
84628 |
-
var subKeysIsResolved = Object(
|
84629 |
var state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : new __WEBPACK_IMPORTED_MODULE_1_equivalent_key_map___default.a();
|
84630 |
var action = arguments.length > 1 ? arguments[1] : undefined;
|
84631 |
|
@@ -84686,326 +89436,12 @@ var isResolved = function isResolved() {
|
|
84686 |
//# sourceMappingURL=reducer.js.map
|
84687 |
|
84688 |
/***/ }),
|
84689 |
-
/*
|
84690 |
-
/***/ (function(module, exports, __webpack_require__) {
|
84691 |
-
|
84692 |
-
"use strict";
|
84693 |
-
|
84694 |
-
|
84695 |
-
function _typeof(obj) {
|
84696 |
-
if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
|
84697 |
-
_typeof = function (obj) {
|
84698 |
-
return typeof obj;
|
84699 |
-
};
|
84700 |
-
} else {
|
84701 |
-
_typeof = function (obj) {
|
84702 |
-
return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
|
84703 |
-
};
|
84704 |
-
}
|
84705 |
-
|
84706 |
-
return _typeof(obj);
|
84707 |
-
}
|
84708 |
-
|
84709 |
-
function _classCallCheck(instance, Constructor) {
|
84710 |
-
if (!(instance instanceof Constructor)) {
|
84711 |
-
throw new TypeError("Cannot call a class as a function");
|
84712 |
-
}
|
84713 |
-
}
|
84714 |
-
|
84715 |
-
function _defineProperties(target, props) {
|
84716 |
-
for (var i = 0; i < props.length; i++) {
|
84717 |
-
var descriptor = props[i];
|
84718 |
-
descriptor.enumerable = descriptor.enumerable || false;
|
84719 |
-
descriptor.configurable = true;
|
84720 |
-
if ("value" in descriptor) descriptor.writable = true;
|
84721 |
-
Object.defineProperty(target, descriptor.key, descriptor);
|
84722 |
-
}
|
84723 |
-
}
|
84724 |
-
|
84725 |
-
function _createClass(Constructor, protoProps, staticProps) {
|
84726 |
-
if (protoProps) _defineProperties(Constructor.prototype, protoProps);
|
84727 |
-
if (staticProps) _defineProperties(Constructor, staticProps);
|
84728 |
-
return Constructor;
|
84729 |
-
}
|
84730 |
-
|
84731 |
-
/**
|
84732 |
-
* Given an instance of EquivalentKeyMap, returns its internal value pair tuple
|
84733 |
-
* for a key, if one exists. The tuple members consist of the last reference
|
84734 |
-
* value for the key (used in efficient subsequent lookups) and the value
|
84735 |
-
* assigned for the key at the leaf node.
|
84736 |
-
*
|
84737 |
-
* @param {EquivalentKeyMap} instance EquivalentKeyMap instance.
|
84738 |
-
* @param {*} key The key for which to return value pair.
|
84739 |
-
*
|
84740 |
-
* @return {?Array} Value pair, if exists.
|
84741 |
-
*/
|
84742 |
-
function getValuePair(instance, key) {
|
84743 |
-
var _map = instance._map,
|
84744 |
-
_arrayTreeMap = instance._arrayTreeMap,
|
84745 |
-
_objectTreeMap = instance._objectTreeMap; // Map keeps a reference to the last object-like key used to set the
|
84746 |
-
// value, which can be used to shortcut immediately to the value.
|
84747 |
-
|
84748 |
-
if (_map.has(key)) {
|
84749 |
-
return _map.get(key);
|
84750 |
-
} // Sort keys to ensure stable retrieval from tree.
|
84751 |
-
|
84752 |
-
|
84753 |
-
var properties = Object.keys(key).sort(); // Tree by type to avoid conflicts on numeric object keys, empty value.
|
84754 |
-
|
84755 |
-
var map = Array.isArray(key) ? _arrayTreeMap : _objectTreeMap;
|
84756 |
-
|
84757 |
-
for (var i = 0; i < properties.length; i++) {
|
84758 |
-
var property = properties[i];
|
84759 |
-
map = map.get(property);
|
84760 |
-
|
84761 |
-
if (map === undefined) {
|
84762 |
-
return;
|
84763 |
-
}
|
84764 |
-
|
84765 |
-
var propertyValue = key[property];
|
84766 |
-
map = map.get(propertyValue);
|
84767 |
-
|
84768 |
-
if (map === undefined) {
|
84769 |
-
return;
|
84770 |
-
}
|
84771 |
-
}
|
84772 |
-
|
84773 |
-
var valuePair = map.get('_ekm_value');
|
84774 |
-
|
84775 |
-
if (!valuePair) {
|
84776 |
-
return;
|
84777 |
-
} // If reached, it implies that an object-like key was set with another
|
84778 |
-
// reference, so delete the reference and replace with the current.
|
84779 |
-
|
84780 |
-
|
84781 |
-
_map.delete(valuePair[0]);
|
84782 |
-
|
84783 |
-
valuePair[0] = key;
|
84784 |
-
map.set('_ekm_value', valuePair);
|
84785 |
-
|
84786 |
-
_map.set(key, valuePair);
|
84787 |
-
|
84788 |
-
return valuePair;
|
84789 |
-
}
|
84790 |
-
/**
|
84791 |
-
* Variant of a Map object which enables lookup by equivalent (deeply equal)
|
84792 |
-
* object and array keys.
|
84793 |
-
*/
|
84794 |
-
|
84795 |
-
|
84796 |
-
var EquivalentKeyMap =
|
84797 |
-
/*#__PURE__*/
|
84798 |
-
function () {
|
84799 |
-
/**
|
84800 |
-
* Constructs a new instance of EquivalentKeyMap.
|
84801 |
-
*
|
84802 |
-
* @param {Iterable.<*>} iterable Initial pair of key, value for map.
|
84803 |
-
*/
|
84804 |
-
function EquivalentKeyMap(iterable) {
|
84805 |
-
_classCallCheck(this, EquivalentKeyMap);
|
84806 |
-
|
84807 |
-
this.clear();
|
84808 |
-
|
84809 |
-
if (iterable instanceof EquivalentKeyMap) {
|
84810 |
-
// Map#forEach is only means of iterating with support for IE11.
|
84811 |
-
var iterablePairs = [];
|
84812 |
-
iterable.forEach(function (value, key) {
|
84813 |
-
iterablePairs.push([key, value]);
|
84814 |
-
});
|
84815 |
-
iterable = iterablePairs;
|
84816 |
-
}
|
84817 |
-
|
84818 |
-
if (iterable != null) {
|
84819 |
-
for (var i = 0; i < iterable.length; i++) {
|
84820 |
-
this.set(iterable[i][0], iterable[i][1]);
|
84821 |
-
}
|
84822 |
-
}
|
84823 |
-
}
|
84824 |
-
/**
|
84825 |
-
* Accessor property returning the number of elements.
|
84826 |
-
*
|
84827 |
-
* @return {number} Number of elements.
|
84828 |
-
*/
|
84829 |
-
|
84830 |
-
|
84831 |
-
_createClass(EquivalentKeyMap, [{
|
84832 |
-
key: "set",
|
84833 |
-
|
84834 |
-
/**
|
84835 |
-
* Add or update an element with a specified key and value.
|
84836 |
-
*
|
84837 |
-
* @param {*} key The key of the element to add.
|
84838 |
-
* @param {*} value The value of the element to add.
|
84839 |
-
*
|
84840 |
-
* @return {EquivalentKeyMap} Map instance.
|
84841 |
-
*/
|
84842 |
-
value: function set(key, value) {
|
84843 |
-
// Shortcut non-object-like to set on internal Map.
|
84844 |
-
if (key === null || _typeof(key) !== 'object') {
|
84845 |
-
this._map.set(key, value);
|
84846 |
-
|
84847 |
-
return this;
|
84848 |
-
} // Sort keys to ensure stable assignment into tree.
|
84849 |
-
|
84850 |
-
|
84851 |
-
var properties = Object.keys(key).sort();
|
84852 |
-
var valuePair = [key, value]; // Tree by type to avoid conflicts on numeric object keys, empty value.
|
84853 |
-
|
84854 |
-
var map = Array.isArray(key) ? this._arrayTreeMap : this._objectTreeMap;
|
84855 |
-
|
84856 |
-
for (var i = 0; i < properties.length; i++) {
|
84857 |
-
var property = properties[i];
|
84858 |
-
|
84859 |
-
if (!map.has(property)) {
|
84860 |
-
map.set(property, new EquivalentKeyMap());
|
84861 |
-
}
|
84862 |
-
|
84863 |
-
map = map.get(property);
|
84864 |
-
var propertyValue = key[property];
|
84865 |
-
|
84866 |
-
if (!map.has(propertyValue)) {
|
84867 |
-
map.set(propertyValue, new EquivalentKeyMap());
|
84868 |
-
}
|
84869 |
-
|
84870 |
-
map = map.get(propertyValue);
|
84871 |
-
} // If an _ekm_value exists, there was already an equivalent key. Before
|
84872 |
-
// overriding, ensure that the old key reference is removed from map to
|
84873 |
-
// avoid memory leak of accumulating equivalent keys. This is, in a
|
84874 |
-
// sense, a poor man's WeakMap, while still enabling iterability.
|
84875 |
-
|
84876 |
-
|
84877 |
-
var previousValuePair = map.get('_ekm_value');
|
84878 |
-
|
84879 |
-
if (previousValuePair) {
|
84880 |
-
this._map.delete(previousValuePair[0]);
|
84881 |
-
}
|
84882 |
-
|
84883 |
-
map.set('_ekm_value', valuePair);
|
84884 |
-
|
84885 |
-
this._map.set(key, valuePair);
|
84886 |
-
|
84887 |
-
return this;
|
84888 |
-
}
|
84889 |
-
/**
|
84890 |
-
* Returns a specified element.
|
84891 |
-
*
|
84892 |
-
* @param {*} key The key of the element to return.
|
84893 |
-
*
|
84894 |
-
* @return {?*} The element associated with the specified key or undefined
|
84895 |
-
* if the key can't be found.
|
84896 |
-
*/
|
84897 |
-
|
84898 |
-
}, {
|
84899 |
-
key: "get",
|
84900 |
-
value: function get(key) {
|
84901 |
-
// Shortcut non-object-like to get from internal Map.
|
84902 |
-
if (key === null || _typeof(key) !== 'object') {
|
84903 |
-
return this._map.get(key);
|
84904 |
-
}
|
84905 |
-
|
84906 |
-
var valuePair = getValuePair(this, key);
|
84907 |
-
|
84908 |
-
if (valuePair) {
|
84909 |
-
return valuePair[1];
|
84910 |
-
}
|
84911 |
-
}
|
84912 |
-
/**
|
84913 |
-
* Returns a boolean indicating whether an element with the specified key
|
84914 |
-
* exists or not.
|
84915 |
-
*
|
84916 |
-
* @param {*} key The key of the element to test for presence.
|
84917 |
-
*
|
84918 |
-
* @return {boolean} Whether an element with the specified key exists.
|
84919 |
-
*/
|
84920 |
-
|
84921 |
-
}, {
|
84922 |
-
key: "has",
|
84923 |
-
value: function has(key) {
|
84924 |
-
if (key === null || _typeof(key) !== 'object') {
|
84925 |
-
return this._map.has(key);
|
84926 |
-
} // Test on the _presence_ of the pair, not its value, as even undefined
|
84927 |
-
// can be a valid member value for a key.
|
84928 |
-
|
84929 |
-
|
84930 |
-
return getValuePair(this, key) !== undefined;
|
84931 |
-
}
|
84932 |
-
/**
|
84933 |
-
* Removes the specified element.
|
84934 |
-
*
|
84935 |
-
* @param {*} key The key of the element to remove.
|
84936 |
-
*
|
84937 |
-
* @return {boolean} Returns true if an element existed and has been
|
84938 |
-
* removed, or false if the element does not exist.
|
84939 |
-
*/
|
84940 |
-
|
84941 |
-
}, {
|
84942 |
-
key: "delete",
|
84943 |
-
value: function _delete(key) {
|
84944 |
-
if (!this.has(key)) {
|
84945 |
-
return false;
|
84946 |
-
} // This naive implementation will leave orphaned child trees. A better
|
84947 |
-
// implementation should traverse and remove orphans.
|
84948 |
-
|
84949 |
-
|
84950 |
-
this.set(key, undefined);
|
84951 |
-
return true;
|
84952 |
-
}
|
84953 |
-
/**
|
84954 |
-
* Executes a provided function once per each key/value pair, in insertion
|
84955 |
-
* order.
|
84956 |
-
*
|
84957 |
-
* @param {Function} callback Function to execute for each element.
|
84958 |
-
* @param {*} thisArg Value to use as `this` when executing
|
84959 |
-
* `callback`.
|
84960 |
-
*/
|
84961 |
-
|
84962 |
-
}, {
|
84963 |
-
key: "forEach",
|
84964 |
-
value: function forEach(callback) {
|
84965 |
-
var _this = this;
|
84966 |
-
|
84967 |
-
var thisArg = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this;
|
84968 |
-
|
84969 |
-
this._map.forEach(function (value, key) {
|
84970 |
-
// Unwrap value from object-like value pair.
|
84971 |
-
if (key !== null && _typeof(key) === 'object') {
|
84972 |
-
value = value[1];
|
84973 |
-
}
|
84974 |
-
|
84975 |
-
callback.call(thisArg, value, key, _this);
|
84976 |
-
});
|
84977 |
-
}
|
84978 |
-
/**
|
84979 |
-
* Removes all elements.
|
84980 |
-
*/
|
84981 |
-
|
84982 |
-
}, {
|
84983 |
-
key: "clear",
|
84984 |
-
value: function clear() {
|
84985 |
-
this._map = new Map();
|
84986 |
-
this._arrayTreeMap = new Map();
|
84987 |
-
this._objectTreeMap = new Map();
|
84988 |
-
}
|
84989 |
-
}, {
|
84990 |
-
key: "size",
|
84991 |
-
get: function get() {
|
84992 |
-
return this._map.size;
|
84993 |
-
}
|
84994 |
-
}]);
|
84995 |
-
|
84996 |
-
return EquivalentKeyMap;
|
84997 |
-
}();
|
84998 |
-
|
84999 |
-
module.exports = EquivalentKeyMap;
|
85000 |
-
|
85001 |
-
|
85002 |
-
/***/ }),
|
85003 |
-
/* 505 */
|
85004 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85005 |
|
85006 |
"use strict";
|
85007 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return onSubKey; });
|
85008 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
85009 |
|
85010 |
|
85011 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
@@ -85041,14 +89477,14 @@ var onSubKey = function onSubKey(actionProperty) {
|
|
85041 |
return state;
|
85042 |
}
|
85043 |
|
85044 |
-
return _objectSpread({}, state, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])({}, key, nextKeyState));
|
85045 |
};
|
85046 |
};
|
85047 |
};
|
85048 |
//# sourceMappingURL=utils.js.map
|
85049 |
|
85050 |
/***/ }),
|
85051 |
-
/*
|
85052 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85053 |
|
85054 |
"use strict";
|
@@ -85145,7 +89581,7 @@ function getCachedResolvers(state) {
|
|
85145 |
//# sourceMappingURL=selectors.js.map
|
85146 |
|
85147 |
/***/ }),
|
85148 |
-
/*
|
85149 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85150 |
|
85151 |
"use strict";
|
@@ -85235,11 +89671,11 @@ function invalidateResolutionForStoreSelector(selectorName) {
|
|
85235 |
//# sourceMappingURL=actions.js.map
|
85236 |
|
85237 |
/***/ }),
|
85238 |
-
/*
|
85239 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85240 |
|
85241 |
"use strict";
|
85242 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
85243 |
|
85244 |
|
85245 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
@@ -85274,12 +89710,12 @@ function createCoreDataStore(registry) {
|
|
85274 |
return {
|
85275 |
getSelectors: function getSelectors() {
|
85276 |
return ['getIsResolving', 'hasStartedResolution', 'hasFinishedResolution', 'isResolving', 'getCachedResolvers'].reduce(function (memo, selectorName) {
|
85277 |
-
return _objectSpread({}, memo, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])({}, selectorName, getCoreDataSelector(selectorName)));
|
85278 |
}, {});
|
85279 |
},
|
85280 |
getActions: function getActions() {
|
85281 |
return ['startResolution', 'finishResolution', 'invalidateResolution', 'invalidateResolutionForStore', 'invalidateResolutionForStoreSelector'].reduce(function (memo, actionName) {
|
85282 |
-
return _objectSpread({}, memo, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])({}, actionName, getCoreDataAction(actionName)));
|
85283 |
}, {});
|
85284 |
},
|
85285 |
subscribe: function subscribe() {
|
@@ -85296,24 +89732,24 @@ function createCoreDataStore(registry) {
|
|
85296 |
//# sourceMappingURL=index.js.map
|
85297 |
|
85298 |
/***/ }),
|
85299 |
-
/*
|
85300 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85301 |
|
85302 |
"use strict";
|
85303 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__controls__ = __webpack_require__(
|
85304 |
/* unused harmony reexport controls */
|
85305 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__persistence__ = __webpack_require__(
|
85306 |
/* unused harmony reexport persistence */
|
85307 |
|
85308 |
|
85309 |
//# sourceMappingURL=index.js.map
|
85310 |
|
85311 |
/***/ }),
|
85312 |
-
/*
|
85313 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85314 |
|
85315 |
"use strict";
|
85316 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_deprecated__ = __webpack_require__(
|
85317 |
/**
|
85318 |
* WordPress dependencies
|
85319 |
*/
|
@@ -85327,17 +89763,17 @@ function createCoreDataStore(registry) {
|
|
85327 |
//# sourceMappingURL=index.js.map
|
85328 |
|
85329 |
/***/ }),
|
85330 |
-
/*
|
85331 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85332 |
|
85333 |
"use strict";
|
85334 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__createAddHook__ = __webpack_require__(
|
85335 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__createRemoveHook__ = __webpack_require__(
|
85336 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__createHasHook__ = __webpack_require__(
|
85337 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__createRunHook__ = __webpack_require__(
|
85338 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__createCurrentHook__ = __webpack_require__(
|
85339 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__createDoingHook__ = __webpack_require__(
|
85340 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__createDidHook__ = __webpack_require__(
|
85341 |
/**
|
85342 |
* Internal dependencies
|
85343 |
*/
|
@@ -85385,13 +89821,13 @@ function createHooks() {
|
|
85385 |
//# sourceMappingURL=createHooks.js.map
|
85386 |
|
85387 |
/***/ }),
|
85388 |
-
/*
|
85389 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85390 |
|
85391 |
"use strict";
|
85392 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__validateNamespace_js__ = __webpack_require__(
|
85393 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__validateHookName_js__ = __webpack_require__(
|
85394 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2____ = __webpack_require__(
|
85395 |
/**
|
85396 |
* Internal dependencies
|
85397 |
*/
|
@@ -85491,13 +89927,13 @@ function createAddHook(hooks) {
|
|
85491 |
//# sourceMappingURL=createAddHook.js.map
|
85492 |
|
85493 |
/***/ }),
|
85494 |
-
/*
|
85495 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85496 |
|
85497 |
"use strict";
|
85498 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__validateNamespace_js__ = __webpack_require__(
|
85499 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__validateHookName_js__ = __webpack_require__(
|
85500 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2____ = __webpack_require__(
|
85501 |
/**
|
85502 |
* Internal dependencies
|
85503 |
*/
|
@@ -85584,7 +90020,7 @@ function createRemoveHook(hooks, removeAll) {
|
|
85584 |
//# sourceMappingURL=createRemoveHook.js.map
|
85585 |
|
85586 |
/***/ }),
|
85587 |
-
/*
|
85588 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85589 |
|
85590 |
"use strict";
|
@@ -85623,11 +90059,11 @@ function createHasHook(hooks) {
|
|
85623 |
//# sourceMappingURL=createHasHook.js.map
|
85624 |
|
85625 |
/***/ }),
|
85626 |
-
/*
|
85627 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85628 |
|
85629 |
"use strict";
|
85630 |
-
/* WEBPACK VAR INJECTION */(function(process) {/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
85631 |
|
85632 |
|
85633 |
/**
|
@@ -85707,7 +90143,7 @@ function createRunHook(hooks, returnFirstArg) {
|
|
85707 |
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(20)))
|
85708 |
|
85709 |
/***/ }),
|
85710 |
-
/*
|
85711 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85712 |
|
85713 |
"use strict";
|
@@ -85741,7 +90177,7 @@ function createCurrentHook(hooks) {
|
|
85741 |
//# sourceMappingURL=createCurrentHook.js.map
|
85742 |
|
85743 |
/***/ }),
|
85744 |
-
/*
|
85745 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85746 |
|
85747 |
"use strict";
|
@@ -85778,11 +90214,11 @@ function createDoingHook(hooks) {
|
|
85778 |
//# sourceMappingURL=createDoingHook.js.map
|
85779 |
|
85780 |
/***/ }),
|
85781 |
-
/*
|
85782 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85783 |
|
85784 |
"use strict";
|
85785 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__validateHookName_js__ = __webpack_require__(
|
85786 |
/**
|
85787 |
* Internal dependencies
|
85788 |
*/
|
@@ -85817,17 +90253,17 @@ function createDidHook(hooks) {
|
|
85817 |
//# sourceMappingURL=createDidHook.js.map
|
85818 |
|
85819 |
/***/ }),
|
85820 |
-
/*
|
85821 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85822 |
|
85823 |
"use strict";
|
85824 |
/* unused harmony export withLazySameState */
|
85825 |
/* unused harmony export createPersistenceInterface */
|
85826 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
85827 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
85828 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
85829 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__storage_default__ = __webpack_require__(
|
85830 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3____ = __webpack_require__(
|
85831 |
|
85832 |
|
85833 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
@@ -85942,7 +90378,7 @@ function createPersistenceInterface(options) {
|
|
85942 |
|
85943 |
|
85944 |
function setData(key, value) {
|
85945 |
-
data = _objectSpread({}, data, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])({}, key, value));
|
85946 |
storage.setItem(storageKey, JSON.stringify(data));
|
85947 |
}
|
85948 |
|
@@ -85960,7 +90396,7 @@ function createPersistenceInterface(options) {
|
|
85960 |
* @return {WPDataPlugin} Data plugin.
|
85961 |
*/
|
85962 |
|
85963 |
-
|
85964 |
var persistence = createPersistenceInterface(pluginOptions);
|
85965 |
/**
|
85966 |
* Creates an enhanced store dispatch function, triggering the state of the
|
@@ -85987,7 +90423,7 @@ var persistencePlugin = function persistencePlugin(registry, pluginOptions) {
|
|
85987 |
return action.nextState[key];
|
85988 |
}));
|
85989 |
}, {});
|
85990 |
-
getPersistedState = withLazySameState(Object(__WEBPACK_IMPORTED_MODULE_3____["
|
85991 |
} else {
|
85992 |
getPersistedState = function getPersistedState(state, action) {
|
85993 |
return action.nextState;
|
@@ -86019,7 +90455,7 @@ var persistencePlugin = function persistencePlugin(registry, pluginOptions) {
|
|
86019 |
var persistedState = persistence.get()[reducerKey];
|
86020 |
|
86021 |
if (persistedState !== undefined) {
|
86022 |
-
var initialState = options.reducer(
|
86023 |
type: '@@WP/PERSISTENCE_RESTORE'
|
86024 |
});
|
86025 |
|
@@ -86036,7 +90472,7 @@ var persistencePlugin = function persistencePlugin(registry, pluginOptions) {
|
|
86036 |
initialState = persistedState;
|
86037 |
}
|
86038 |
|
86039 |
-
options = _objectSpread({}, options, {
|
86040 |
initialState: initialState
|
86041 |
});
|
86042 |
}
|
@@ -86046,7 +90482,7 @@ var persistencePlugin = function persistencePlugin(registry, pluginOptions) {
|
|
86046 |
return store;
|
86047 |
}
|
86048 |
};
|
86049 |
-
}
|
86050 |
/**
|
86051 |
* Deprecated: Remove this function and the code in WordPress Core that calls
|
86052 |
* it once WordPress 5.4 is released.
|
@@ -86109,11 +90545,11 @@ persistencePlugin.__unstableMigrate = function (pluginOptions) {
|
|
86109 |
//# sourceMappingURL=index.js.map
|
86110 |
|
86111 |
/***/ }),
|
86112 |
-
/*
|
86113 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86114 |
|
86115 |
"use strict";
|
86116 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__object__ = __webpack_require__(
|
86117 |
/**
|
86118 |
* Internal dependencies
|
86119 |
*/
|
@@ -86135,7 +90571,7 @@ try {
|
|
86135 |
//# sourceMappingURL=default.js.map
|
86136 |
|
86137 |
/***/ }),
|
86138 |
-
/*
|
86139 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86140 |
|
86141 |
"use strict";
|
@@ -86163,14 +90599,14 @@ var storage = {
|
|
86163 |
//# sourceMappingURL=object.js.map
|
86164 |
|
86165 |
/***/ }),
|
86166 |
-
/*
|
86167 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86168 |
|
86169 |
"use strict";
|
86170 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
86171 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(15);
|
86172 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_compose__ = __webpack_require__(
|
86173 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__use_select__ = __webpack_require__(
|
86174 |
|
86175 |
|
86176 |
|
@@ -86224,8 +90660,8 @@ var storage = {
|
|
86224 |
*/
|
86225 |
|
86226 |
var withSelect = function withSelect(mapSelectToProps) {
|
86227 |
-
return Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_compose__["
|
86228 |
-
return Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_compose__["
|
86229 |
var mapSelect = function mapSelect(select, registry) {
|
86230 |
return mapSelectToProps(select, ownProps, registry);
|
86231 |
};
|
@@ -86240,14 +90676,14 @@ var withSelect = function withSelect(mapSelectToProps) {
|
|
86240 |
//# sourceMappingURL=index.js.map
|
86241 |
|
86242 |
/***/ }),
|
86243 |
-
/*
|
86244 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86245 |
|
86246 |
"use strict";
|
86247 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(
|
86248 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_typeof__ = __webpack_require__(
|
86249 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
86250 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_react__ = __webpack_require__(
|
86251 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_react__);
|
86252 |
|
86253 |
|
@@ -86600,11 +91036,11 @@ function closeOuterElement(endOffset) {
|
|
86600 |
//# sourceMappingURL=create-interpolate-element.js.map
|
86601 |
|
86602 |
/***/ }),
|
86603 |
-
/*
|
86604 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86605 |
|
86606 |
"use strict";
|
86607 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom__ = __webpack_require__(
|
86608 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react_dom__);
|
86609 |
/* unused harmony reexport createPortal */
|
86610 |
/* unused harmony reexport findDOMNode */
|
@@ -86650,7 +91086,7 @@ function closeOuterElement(endOffset) {
|
|
86650 |
//# sourceMappingURL=react-platform.js.map
|
86651 |
|
86652 |
/***/ }),
|
86653 |
-
/*
|
86654 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86655 |
|
86656 |
"use strict";
|
@@ -86682,7 +91118,7 @@ var isEmptyElement = function isEmptyElement(element) {
|
|
86682 |
//# sourceMappingURL=utils.js.map
|
86683 |
|
86684 |
/***/ }),
|
86685 |
-
/*
|
86686 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86687 |
|
86688 |
"use strict";
|
@@ -86724,7 +91160,7 @@ var Platform = {
|
|
86724 |
//# sourceMappingURL=platform.js.map
|
86725 |
|
86726 |
/***/ }),
|
86727 |
-
/*
|
86728 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86729 |
|
86730 |
"use strict";
|
@@ -86734,14 +91170,14 @@ var Platform = {
|
|
86734 |
/* unused harmony export renderComponent */
|
86735 |
/* unused harmony export renderAttributes */
|
86736 |
/* unused harmony export renderStyle */
|
86737 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
86738 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
86739 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_typeof__ = __webpack_require__(
|
86740 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
86741 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
86742 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__wordpress_escape_html__ = __webpack_require__(
|
86743 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__react__ = __webpack_require__(
|
86744 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__raw_html__ = __webpack_require__(
|
86745 |
|
86746 |
|
86747 |
|
@@ -87025,7 +91461,7 @@ function renderElement(element, context) {
|
|
87025 |
var children = props.children,
|
87026 |
wrapperProps = Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__["a" /* default */])(props, ["children"]);
|
87027 |
|
87028 |
-
return renderNativeComponent(Object(__WEBPACK_IMPORTED_MODULE_3_lodash__["isEmpty"])(wrapperProps) ? null : 'div', _objectSpread({}, wrapperProps, {
|
87029 |
dangerouslySetInnerHTML: {
|
87030 |
__html: children
|
87031 |
}
|
@@ -87250,7 +91686,7 @@ function renderStyle(style) {
|
|
87250 |
//# sourceMappingURL=serialize.js.map
|
87251 |
|
87252 |
/***/ }),
|
87253 |
-
/*
|
87254 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
87255 |
|
87256 |
"use strict";
|
@@ -87269,16 +91705,16 @@ function renderStyle(style) {
|
|
87269 |
* @return {Function} Returns the new composite function.
|
87270 |
*/
|
87271 |
|
87272 |
-
/* harmony default export */
|
87273 |
//# sourceMappingURL=compose.js.map
|
87274 |
|
87275 |
/***/ }),
|
87276 |
-
/*
|
87277 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
87278 |
|
87279 |
"use strict";
|
87280 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
87281 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__utils_create_higher_order_component__ = __webpack_require__(
|
87282 |
|
87283 |
|
87284 |
/**
|
@@ -87310,19 +91746,19 @@ var ifCondition = function ifCondition(predicate) {
|
|
87310 |
//# sourceMappingURL=index.js.map
|
87311 |
|
87312 |
/***/ }),
|
87313 |
-
/*
|
87314 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
87315 |
|
87316 |
"use strict";
|
87317 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
87318 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
87319 |
-
/* harmony import */ var
|
87320 |
-
/* harmony import */ var
|
87321 |
-
/* harmony import */ var
|
87322 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_element__ = __webpack_require__(15);
|
87323 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_is_shallow_equal__ = __webpack_require__(
|
87324 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_is_shallow_equal___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6__wordpress_is_shallow_equal__);
|
87325 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__utils_create_higher_order_component__ = __webpack_require__(
|
87326 |
|
87327 |
|
87328 |
|
@@ -87330,7 +91766,7 @@ var ifCondition = function ifCondition(predicate) {
|
|
87330 |
|
87331 |
|
87332 |
|
87333 |
-
function _createSuper(Derived) { return function () { var Super = Object(
|
87334 |
|
87335 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
87336 |
|
@@ -87359,7 +91795,7 @@ function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Re
|
|
87359 |
var pure = Object(__WEBPACK_IMPORTED_MODULE_7__utils_create_higher_order_component__["a" /* default */])(function (Wrapped) {
|
87360 |
if (Wrapped.prototype instanceof __WEBPACK_IMPORTED_MODULE_5__wordpress_element__["a" /* Component */]) {
|
87361 |
return /*#__PURE__*/function (_Wrapped) {
|
87362 |
-
Object(
|
87363 |
|
87364 |
var _super = _createSuper(_class);
|
87365 |
|
@@ -87381,7 +91817,7 @@ var pure = Object(__WEBPACK_IMPORTED_MODULE_7__utils_create_higher_order_compone
|
|
87381 |
}
|
87382 |
|
87383 |
return /*#__PURE__*/function (_Component) {
|
87384 |
-
Object(
|
87385 |
|
87386 |
var _super2 = _createSuper(_class2);
|
87387 |
|
@@ -87410,7 +91846,7 @@ var pure = Object(__WEBPACK_IMPORTED_MODULE_7__utils_create_higher_order_compone
|
|
87410 |
//# sourceMappingURL=index.js.map
|
87411 |
|
87412 |
/***/ }),
|
87413 |
-
/*
|
87414 |
/***/ (function(module, exports, __webpack_require__) {
|
87415 |
|
87416 |
"use strict";
|
@@ -87468,7 +91904,7 @@ module.exports = isShallowEqualObjects;
|
|
87468 |
|
87469 |
|
87470 |
/***/ }),
|
87471 |
-
/*
|
87472 |
/***/ (function(module, exports, __webpack_require__) {
|
87473 |
|
87474 |
"use strict";
|
@@ -87506,22 +91942,22 @@ module.exports = isShallowEqualArrays;
|
|
87506 |
|
87507 |
|
87508 |
/***/ }),
|
87509 |
-
/*
|
87510 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
87511 |
|
87512 |
"use strict";
|
87513 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
87514 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
87515 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
87516 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
87517 |
-
/* harmony import */ var
|
87518 |
-
/* harmony import */ var
|
87519 |
-
/* harmony import */ var
|
87520 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(15);
|
87521 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
87522 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
87523 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__ = __webpack_require__(
|
87524 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__listener__ = __webpack_require__(
|
87525 |
|
87526 |
|
87527 |
|
@@ -87531,7 +91967,7 @@ module.exports = isShallowEqualArrays;
|
|
87531 |
|
87532 |
|
87533 |
|
87534 |
-
function _createSuper(Derived) { return function () { var Super = Object(
|
87535 |
|
87536 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
87537 |
|
@@ -87578,7 +92014,7 @@ var listener = new __WEBPACK_IMPORTED_MODULE_10__listener__["a" /* default */]()
|
|
87578 |
function withGlobalEvents(eventTypesToHandlers) {
|
87579 |
return Object(__WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__["a" /* default */])(function (WrappedComponent) {
|
87580 |
var Wrapper = /*#__PURE__*/function (_Component) {
|
87581 |
-
Object(
|
87582 |
|
87583 |
var _super = _createSuper(Wrapper);
|
87584 |
|
@@ -87656,7 +92092,7 @@ function withGlobalEvents(eventTypesToHandlers) {
|
|
87656 |
//# sourceMappingURL=index.js.map
|
87657 |
|
87658 |
/***/ }),
|
87659 |
-
/*
|
87660 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
87661 |
|
87662 |
"use strict";
|
@@ -87723,14 +92159,14 @@ var Listener = /*#__PURE__*/function () {
|
|
87723 |
//# sourceMappingURL=listener.js.map
|
87724 |
|
87725 |
/***/ }),
|
87726 |
-
/*
|
87727 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
87728 |
|
87729 |
"use strict";
|
87730 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
87731 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(15);
|
87732 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_create_higher_order_component__ = __webpack_require__(
|
87733 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__hooks_use_instance_id__ = __webpack_require__(
|
87734 |
|
87735 |
|
87736 |
|
@@ -87759,21 +92195,21 @@ var Listener = /*#__PURE__*/function () {
|
|
87759 |
//# sourceMappingURL=index.js.map
|
87760 |
|
87761 |
/***/ }),
|
87762 |
-
/*
|
87763 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
87764 |
|
87765 |
"use strict";
|
87766 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
87767 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
87768 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
87769 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
87770 |
-
/* harmony import */ var
|
87771 |
-
/* harmony import */ var
|
87772 |
-
/* harmony import */ var
|
87773 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(15);
|
87774 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
87775 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
87776 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__ = __webpack_require__(
|
87777 |
|
87778 |
|
87779 |
|
@@ -87783,7 +92219,7 @@ var Listener = /*#__PURE__*/function () {
|
|
87783 |
|
87784 |
|
87785 |
|
87786 |
-
function _createSuper(Derived) { return function () { var Super = Object(
|
87787 |
|
87788 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
87789 |
|
@@ -87812,7 +92248,7 @@ function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Re
|
|
87812 |
|
87813 |
var withSafeTimeout = Object(__WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__["a" /* default */])(function (OriginalComponent) {
|
87814 |
return /*#__PURE__*/function (_Component) {
|
87815 |
-
Object(
|
87816 |
|
87817 |
var _super = _createSuper(WrappedComponent);
|
87818 |
|
@@ -87885,11 +92321,11 @@ var withSafeTimeout = Object(__WEBPACK_IMPORTED_MODULE_9__utils_create_higher_or
|
|
87885 |
return WrappedComponent;
|
87886 |
}(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["a" /* Component */]);
|
87887 |
}, 'withSafeTimeout');
|
87888 |
-
/* harmony default export */
|
87889 |
//# sourceMappingURL=index.js.map
|
87890 |
|
87891 |
/***/ }),
|
87892 |
-
/*
|
87893 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
87894 |
|
87895 |
"use strict";
|
@@ -87897,12 +92333,12 @@ var withSafeTimeout = Object(__WEBPACK_IMPORTED_MODULE_9__utils_create_higher_or
|
|
87897 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
87898 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
87899 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
87900 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(
|
87901 |
-
/* harmony import */ var
|
87902 |
-
/* harmony import */ var
|
87903 |
-
/* harmony import */ var
|
87904 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(15);
|
87905 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__utils_create_higher_order_component__ = __webpack_require__(
|
87906 |
|
87907 |
|
87908 |
|
@@ -87912,7 +92348,7 @@ var withSafeTimeout = Object(__WEBPACK_IMPORTED_MODULE_9__utils_create_higher_or
|
|
87912 |
|
87913 |
|
87914 |
|
87915 |
-
function _createSuper(Derived) { return function () { var Super = Object(
|
87916 |
|
87917 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
87918 |
|
@@ -87938,7 +92374,7 @@ function withState() {
|
|
87938 |
var initialState = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
|
87939 |
return Object(__WEBPACK_IMPORTED_MODULE_8__utils_create_higher_order_component__["a" /* default */])(function (OriginalComponent) {
|
87940 |
return /*#__PURE__*/function (_Component) {
|
87941 |
-
Object(
|
87942 |
|
87943 |
var _super = _createSuper(WrappedComponent);
|
87944 |
|
@@ -87969,12 +92405,91 @@ function withState() {
|
|
87969 |
//# sourceMappingURL=index.js.map
|
87970 |
|
87971 |
/***/ }),
|
87972 |
-
/*
|
87973 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
87974 |
|
87975 |
"use strict";
|
87976 |
/* unused harmony export default */
|
87977 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
87978 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(15);
|
87979 |
|
87980 |
|
@@ -88048,13 +92563,13 @@ function useDragging(_ref) {
|
|
88048 |
//# sourceMappingURL=index.js.map
|
88049 |
|
88050 |
/***/ }),
|
88051 |
-
/*
|
88052 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88053 |
|
88054 |
"use strict";
|
88055 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_mousetrap__ = __webpack_require__(
|
88056 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_mousetrap___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_mousetrap__);
|
88057 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_mousetrap_plugins_global_bind_mousetrap_global_bind__ = __webpack_require__(
|
88058 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_mousetrap_plugins_global_bind_mousetrap_global_bind___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_mousetrap_plugins_global_bind_mousetrap_global_bind__);
|
88059 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash__ = __webpack_require__(2);
|
88060 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_lodash__);
|
@@ -88114,6 +92629,10 @@ function useKeyboardShortcut(shortcuts, callback) {
|
|
88114 |
isDisabled = _ref$isDisabled === void 0 ? false : _ref$isDisabled,
|
88115 |
target = _ref.target;
|
88116 |
|
|
|
|
|
|
|
|
|
88117 |
Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_element__["h" /* useEffect */])(function () {
|
88118 |
if (isDisabled) {
|
88119 |
return;
|
@@ -88136,23 +92655,25 @@ function useKeyboardShortcut(shortcuts, callback) {
|
|
88136 |
}
|
88137 |
|
88138 |
var bindFn = bindGlobal ? 'bindGlobal' : 'bind';
|
88139 |
-
mousetrap[bindFn](shortcut,
|
|
|
|
|
88140 |
});
|
88141 |
return function () {
|
88142 |
mousetrap.reset();
|
88143 |
};
|
88144 |
-
}, [shortcuts, bindGlobal, eventName,
|
88145 |
}
|
88146 |
|
88147 |
/* unused harmony default export */ var _unused_webpack_default_export = (useKeyboardShortcut);
|
88148 |
//# sourceMappingURL=index.js.map
|
88149 |
|
88150 |
/***/ }),
|
88151 |
-
/*
|
88152 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88153 |
|
88154 |
"use strict";
|
88155 |
-
/* WEBPACK VAR INJECTION */(function(process) {/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__use_media_query__ = __webpack_require__(
|
88156 |
/**
|
88157 |
* Internal dependencies
|
88158 |
*/
|
@@ -88180,12 +92701,12 @@ var useReducedMotion = process.env.FORCE_REDUCED_MOTION || IS_IE ? function () {
|
|
88180 |
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(20)))
|
88181 |
|
88182 |
/***/ }),
|
88183 |
-
/*
|
88184 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88185 |
|
88186 |
"use strict";
|
88187 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
88188 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__use_media_query__ = __webpack_require__(
|
88189 |
/**
|
88190 |
* WordPress dependencies
|
88191 |
*/
|
@@ -88278,11 +92799,11 @@ useViewportMatch.__experimentalWidthProvider = ViewportMatchWidthContext.Provide
|
|
88278 |
//# sourceMappingURL=index.js.map
|
88279 |
|
88280 |
/***/ }),
|
88281 |
-
/*
|
88282 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88283 |
|
88284 |
"use strict";
|
88285 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_resize_aware__ = __webpack_require__(
|
88286 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_resize_aware___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react_resize_aware__);
|
88287 |
/**
|
88288 |
* External dependencies
|
@@ -88315,283 +92836,220 @@ useViewportMatch.__experimentalWidthProvider = ViewportMatchWidthContext.Provide
|
|
88315 |
//# sourceMappingURL=index.js.map
|
88316 |
|
88317 |
/***/ }),
|
88318 |
-
/*
|
88319 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88320 |
|
88321 |
"use strict";
|
88322 |
-
/*
|
88323 |
-
/*
|
88324 |
-
/*
|
88325 |
-
/* harmony
|
88326 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react__ = __webpack_require__(10);
|
88327 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react__);
|
88328 |
-
|
88329 |
-
|
88330 |
-
function areInputsEqual(newInputs, lastInputs) {
|
88331 |
-
if (newInputs.length !== lastInputs.length) {
|
88332 |
-
return false;
|
88333 |
-
}
|
88334 |
-
|
88335 |
-
for (var i = 0; i < newInputs.length; i++) {
|
88336 |
-
if (newInputs[i] !== lastInputs[i]) {
|
88337 |
-
return false;
|
88338 |
-
}
|
88339 |
-
}
|
88340 |
-
|
88341 |
-
return true;
|
88342 |
-
}
|
88343 |
-
|
88344 |
-
function useMemoOne(getResult, inputs) {
|
88345 |
-
var initial = Object(__WEBPACK_IMPORTED_MODULE_0_react__["useState"])(function () {
|
88346 |
-
return {
|
88347 |
-
inputs: inputs,
|
88348 |
-
result: getResult()
|
88349 |
-
};
|
88350 |
-
})[0];
|
88351 |
-
var committed = Object(__WEBPACK_IMPORTED_MODULE_0_react__["useRef"])(initial);
|
88352 |
-
var isInputMatch = Boolean(inputs && committed.current.inputs && areInputsEqual(inputs, committed.current.inputs));
|
88353 |
-
var cache = isInputMatch ? committed.current : {
|
88354 |
-
inputs: inputs,
|
88355 |
-
result: getResult()
|
88356 |
-
};
|
88357 |
-
Object(__WEBPACK_IMPORTED_MODULE_0_react__["useEffect"])(function () {
|
88358 |
-
committed.current = cache;
|
88359 |
-
}, [cache]);
|
88360 |
-
return cache.result;
|
88361 |
-
}
|
88362 |
-
function useCallbackOne(callback, inputs) {
|
88363 |
-
return useMemoOne(function () {
|
88364 |
-
return callback;
|
88365 |
-
}, inputs);
|
88366 |
-
}
|
88367 |
-
var useMemo = useMemoOne;
|
88368 |
-
var useCallback = useCallbackOne;
|
88369 |
-
|
88370 |
-
|
88371 |
|
88372 |
|
88373 |
-
/***/ }),
|
88374 |
-
/* 544 */
|
88375 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88376 |
|
88377 |
-
"use strict";
|
88378 |
-
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return createQueue; });
|
88379 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__request_idle_callback__ = __webpack_require__(545);
|
88380 |
/**
|
88381 |
-
*
|
88382 |
*/
|
88383 |
|
88384 |
-
/**
|
88385 |
-
* Enqueued callback to invoke once idle time permits.
|
88386 |
-
*
|
88387 |
-
* @typedef {()=>void} WPPriorityQueueCallback
|
88388 |
-
*/
|
88389 |
|
88390 |
/**
|
88391 |
-
*
|
88392 |
*
|
88393 |
-
* @
|
|
|
|
|
88394 |
*/
|
88395 |
|
88396 |
-
|
88397 |
-
|
88398 |
-
*
|
88399 |
-
* @typedef {(element:WPPriorityQueueContext,item:WPPriorityQueueCallback)=>void} WPPriorityQueueAdd
|
88400 |
-
*/
|
88401 |
|
88402 |
-
|
88403 |
-
|
88404 |
-
*
|
88405 |
-
* @typedef {(element:WPPriorityQueueContext)=>boolean} WPPriorityQueueFlush
|
88406 |
-
*/
|
88407 |
|
88408 |
-
|
88409 |
-
|
88410 |
-
|
88411 |
-
* @typedef {()=>void} WPPriorityQueueReset
|
88412 |
-
*/
|
88413 |
|
|
|
|
|
|
|
|
|
|
|
88414 |
/**
|
88415 |
-
*
|
88416 |
*
|
88417 |
-
* @
|
|
|
88418 |
*
|
88419 |
-
* @
|
88420 |
-
* @property {WPPriorityQueueFlush} flush Flush queue for context.
|
88421 |
-
* @property {WPPriorityQueueReset} reset Reset queue.
|
88422 |
*/
|
88423 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
88424 |
/**
|
88425 |
-
*
|
88426 |
-
*
|
88427 |
-
*
|
88428 |
-
* @example
|
88429 |
-
*```js
|
88430 |
-
* import { createQueue } from '@wordpress/priority-queue';
|
88431 |
-
*
|
88432 |
-
* const queue = createQueue();
|
88433 |
-
*
|
88434 |
-
* // Context objects.
|
88435 |
-
* const ctx1 = {};
|
88436 |
-
* const ctx2 = {};
|
88437 |
*
|
88438 |
-
*
|
88439 |
-
*
|
88440 |
-
* queue.add( ctx2, () => console.log( 'This won\'t be printed' ) );
|
88441 |
-
* queue.add( ctx2, () => console.log( 'This will be printed second' ) );
|
88442 |
-
*```
|
88443 |
-
*
|
88444 |
-
* @return {WPPriorityQueue} Queue object with `add`, `flush` and `reset` methods.
|
88445 |
*/
|
88446 |
|
88447 |
-
var createQueue = function createQueue() {
|
88448 |
-
/** @type {WPPriorityQueueContext[]} */
|
88449 |
-
var waitingList = [];
|
88450 |
-
/** @type {WeakMap<WPPriorityQueueContext,WPPriorityQueueCallback>} */
|
88451 |
|
88452 |
-
|
88453 |
-
var
|
88454 |
-
|
|
|
|
|
88455 |
|
88456 |
-
|
88457 |
-
|
88458 |
-
|
88459 |
-
|
88460 |
-
|
88461 |
-
|
|
|
|
|
88462 |
|
88463 |
-
|
|
|
|
|
|
|
|
|
88464 |
|
88465 |
-
|
88466 |
-
|
88467 |
-
|
88468 |
-
|
88469 |
-
|
|
|
88470 |
};
|
88471 |
|
88472 |
-
|
88473 |
-
|
88474 |
-
|
88475 |
-
|
88476 |
-
|
|
|
|
|
88477 |
|
88478 |
-
|
88479 |
-
|
88480 |
-
waitingList.shift();
|
88481 |
-
var callback =
|
88482 |
-
/** @type {WPPriorityQueueCallback} */
|
88483 |
-
elementsMap.get(nextElement);
|
88484 |
-
callback();
|
88485 |
-
elementsMap.delete(nextElement);
|
88486 |
-
} while (hasTimeRemaining());
|
88487 |
|
88488 |
-
|
88489 |
-
|
88490 |
-
|
88491 |
-
* Add a callback to the queue for a given context.
|
88492 |
-
*
|
88493 |
-
* @type {WPPriorityQueueAdd}
|
88494 |
-
*
|
88495 |
-
* @param {WPPriorityQueueContext} element Context object.
|
88496 |
-
* @param {WPPriorityQueueCallback} item Callback function.
|
88497 |
-
*/
|
88498 |
|
|
|
|
|
|
|
88499 |
|
88500 |
-
var add = function add(element, item) {
|
88501 |
-
if (!elementsMap.has(element)) {
|
88502 |
-
waitingList.push(element);
|
88503 |
-
}
|
88504 |
|
88505 |
-
|
|
|
|
|
88506 |
|
88507 |
-
|
88508 |
-
|
88509 |
-
|
88510 |
-
|
88511 |
-
|
88512 |
-
|
88513 |
-
|
88514 |
-
|
88515 |
-
|
88516 |
-
|
88517 |
-
|
88518 |
-
|
88519 |
-
|
88520 |
-
|
88521 |
-
|
|
|
|
|
|
|
88522 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
88523 |
|
88524 |
-
|
88525 |
-
|
88526 |
-
|
88527 |
}
|
|
|
|
|
88528 |
|
88529 |
-
|
88530 |
-
waitingList.splice(index, 1);
|
88531 |
-
var callback =
|
88532 |
-
/** @type {WPPriorityQueueCallback} */
|
88533 |
-
elementsMap.get(element);
|
88534 |
-
elementsMap.delete(element);
|
88535 |
-
callback();
|
88536 |
-
return true;
|
88537 |
-
};
|
88538 |
-
/**
|
88539 |
-
* Reset the queue without running the pending callbacks.
|
88540 |
-
*
|
88541 |
-
* @type {WPPriorityQueueReset}
|
88542 |
-
*/
|
88543 |
-
|
88544 |
-
|
88545 |
-
var reset = function reset() {
|
88546 |
-
waitingList = [];
|
88547 |
-
elementsMap = new WeakMap();
|
88548 |
-
isRunning = false;
|
88549 |
-
};
|
88550 |
-
|
88551 |
-
return {
|
88552 |
-
add: add,
|
88553 |
-
flush: flush,
|
88554 |
-
reset: reset
|
88555 |
-
};
|
88556 |
-
};
|
88557 |
//# sourceMappingURL=index.js.map
|
88558 |
|
88559 |
/***/ }),
|
88560 |
-
/*
|
88561 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88562 |
|
88563 |
"use strict";
|
88564 |
-
/* unused harmony export
|
|
|
|
|
|
|
|
|
88565 |
/**
|
88566 |
-
*
|
88567 |
*/
|
88568 |
|
|
|
88569 |
/**
|
88570 |
-
*
|
88571 |
*/
|
88572 |
-
|
88573 |
-
|
88574 |
-
|
88575 |
-
|
88576 |
-
|
88577 |
-
|
88578 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
88579 |
}
|
88580 |
|
88581 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
88582 |
}
|
88583 |
-
|
88584 |
-
//# sourceMappingURL=request-idle-callback.js.map
|
88585 |
|
88586 |
/***/ }),
|
88587 |
-
/*
|
88588 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88589 |
|
88590 |
"use strict";
|
88591 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
88592 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(15);
|
88593 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_compose__ = __webpack_require__(
|
88594 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__use_dispatch__ = __webpack_require__(
|
88595 |
|
88596 |
|
88597 |
|
@@ -88685,13 +93143,13 @@ function createRequestIdleCallback() {
|
|
88685 |
*/
|
88686 |
|
88687 |
var withDispatch = function withDispatch(mapDispatchToProps) {
|
88688 |
-
return Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_compose__["
|
88689 |
return function (ownProps) {
|
88690 |
var mapDispatch = function mapDispatch(dispatch, registry) {
|
88691 |
return mapDispatchToProps(dispatch, ownProps, registry);
|
88692 |
};
|
88693 |
|
88694 |
-
var dispatchProps = Object(__WEBPACK_IMPORTED_MODULE_3__use_dispatch__["
|
88695 |
return Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_element__["d" /* createElement */])(WrappedComponent, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__["a" /* default */])({}, ownProps, dispatchProps));
|
88696 |
};
|
88697 |
}, 'withDispatch');
|
@@ -88701,11 +93159,11 @@ var withDispatch = function withDispatch(mapDispatchToProps) {
|
|
88701 |
//# sourceMappingURL=index.js.map
|
88702 |
|
88703 |
/***/ }),
|
88704 |
-
/*
|
88705 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88706 |
|
88707 |
"use strict";
|
88708 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__registry_provider_use_registry__ = __webpack_require__(
|
88709 |
/**
|
88710 |
* Internal dependencies
|
88711 |
*/
|
@@ -88761,19 +93219,19 @@ var useDispatch = function useDispatch(storeName) {
|
|
88761 |
return storeName === void 0 ? dispatch : dispatch(storeName);
|
88762 |
};
|
88763 |
|
88764 |
-
/*
|
88765 |
//# sourceMappingURL=use-dispatch.js.map
|
88766 |
|
88767 |
/***/ }),
|
88768 |
-
/*
|
88769 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88770 |
|
88771 |
"use strict";
|
88772 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(
|
88773 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
88774 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
88775 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(15);
|
88776 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__registry_provider_use_registry__ = __webpack_require__(
|
88777 |
|
88778 |
|
88779 |
/**
|
@@ -88843,14 +93301,14 @@ var useDispatchWithMap = function useDispatchWithMap(dispatchMap, deps) {
|
|
88843 |
//# sourceMappingURL=use-dispatch-with-map.js.map
|
88844 |
|
88845 |
/***/ }),
|
88846 |
-
/*
|
88847 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88848 |
|
88849 |
"use strict";
|
88850 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
88851 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(15);
|
88852 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_compose__ = __webpack_require__(
|
88853 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__registry_provider__ = __webpack_require__(
|
88854 |
|
88855 |
|
88856 |
|
@@ -88872,7 +93330,7 @@ var useDispatchWithMap = function useDispatchWithMap(dispatchMap, deps) {
|
|
88872 |
* @return {WPComponent} Enhanced component.
|
88873 |
*/
|
88874 |
|
88875 |
-
var withRegistry = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_compose__["
|
88876 |
return function (props) {
|
88877 |
return Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_element__["d" /* createElement */])(__WEBPACK_IMPORTED_MODULE_3__registry_provider__["a" /* RegistryConsumer */], null, function (registry) {
|
88878 |
return Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_element__["d" /* createElement */])(OriginalComponent, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__["a" /* default */])({}, props, {
|
@@ -88885,13 +93343,13 @@ var withRegistry = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_compose__["b" /
|
|
88885 |
//# sourceMappingURL=index.js.map
|
88886 |
|
88887 |
/***/ }),
|
88888 |
-
/*
|
88889 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88890 |
|
88891 |
"use strict";
|
88892 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__use_async_mode__ = __webpack_require__(
|
88893 |
/* unused harmony reexport useAsyncMode */
|
88894 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__context__ = __webpack_require__(
|
88895 |
/* unused harmony reexport AsyncModeProvider */
|
88896 |
/* unused harmony reexport AsyncModeConsumer */
|
88897 |
|
@@ -88899,74 +93357,15 @@ var withRegistry = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_compose__["b" /
|
|
88899 |
//# sourceMappingURL=index.js.map
|
88900 |
|
88901 |
/***/ }),
|
88902 |
-
/*
|
88903 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88904 |
-
|
88905 |
-
"use strict";
|
88906 |
-
/* unused harmony export createRegistrySelector */
|
88907 |
-
/* unused harmony export createRegistryControl */
|
88908 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__default_registry__ = __webpack_require__(101);
|
88909 |
-
/**
|
88910 |
-
* Internal dependencies
|
88911 |
-
*/
|
88912 |
-
|
88913 |
-
/** @typedef {import('./registry').WPDataRegistry} WPDataRegistry */
|
88914 |
-
|
88915 |
-
/**
|
88916 |
-
* Mark a selector as a registry selector.
|
88917 |
-
*
|
88918 |
-
* @param {Function} registrySelector Function receiving a registry object and returning a state selector.
|
88919 |
-
*
|
88920 |
-
* @return {Function} marked registry selector.
|
88921 |
-
*/
|
88922 |
-
|
88923 |
-
function createRegistrySelector(registrySelector) {
|
88924 |
-
var selector = function selector() {
|
88925 |
-
return registrySelector(selector.registry.select).apply(void 0, arguments);
|
88926 |
-
};
|
88927 |
-
/**
|
88928 |
-
* Flag indicating to selector registration mapping that the selector should
|
88929 |
-
* be mapped as a registry selector.
|
88930 |
-
*
|
88931 |
-
* @type {boolean}
|
88932 |
-
*/
|
88933 |
-
|
88934 |
-
|
88935 |
-
selector.isRegistrySelector = true;
|
88936 |
-
/**
|
88937 |
-
* Registry on which to call `select`, stubbed for non-standard usage to
|
88938 |
-
* use the default registry.
|
88939 |
-
*
|
88940 |
-
* @type {WPDataRegistry}
|
88941 |
-
*/
|
88942 |
-
|
88943 |
-
selector.registry = __WEBPACK_IMPORTED_MODULE_0__default_registry__["a" /* default */];
|
88944 |
-
return selector;
|
88945 |
-
}
|
88946 |
-
/**
|
88947 |
-
* Mark a control as a registry control.
|
88948 |
-
*
|
88949 |
-
* @param {Function} registryControl Function receiving a registry object and returning a control.
|
88950 |
-
*
|
88951 |
-
* @return {Function} marked registry control.
|
88952 |
-
*/
|
88953 |
-
|
88954 |
-
function createRegistryControl(registryControl) {
|
88955 |
-
registryControl.isRegistryControl = true;
|
88956 |
-
return registryControl;
|
88957 |
-
}
|
88958 |
-
//# sourceMappingURL=factory.js.map
|
88959 |
-
|
88960 |
-
/***/ }),
|
88961 |
-
/* 552 */
|
88962 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88963 |
|
88964 |
"use strict";
|
88965 |
/* unused harmony export formatTypes */
|
88966 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
88967 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
88968 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
88969 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_data__ = __webpack_require__(
|
88970 |
|
88971 |
|
88972 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
@@ -88997,7 +93396,7 @@ function formatTypes() {
|
|
88997 |
|
88998 |
switch (action.type) {
|
88999 |
case 'ADD_FORMAT_TYPES':
|
89000 |
-
return _objectSpread({}, state,
|
89001 |
|
89002 |
case 'REMOVE_FORMAT_TYPES':
|
89003 |
return Object(__WEBPACK_IMPORTED_MODULE_1_lodash__["omit"])(state, action.names);
|
@@ -89005,13 +93404,13 @@ function formatTypes() {
|
|
89005 |
|
89006 |
return state;
|
89007 |
}
|
89008 |
-
/* harmony default export */ __webpack_exports__["a"] = (Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_data__["
|
89009 |
formatTypes: formatTypes
|
89010 |
}));
|
89011 |
//# sourceMappingURL=reducer.js.map
|
89012 |
|
89013 |
/***/ }),
|
89014 |
-
/*
|
89015 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89016 |
|
89017 |
"use strict";
|
@@ -89020,7 +93419,7 @@ Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
|
89020 |
/* harmony export (immutable) */ __webpack_exports__["getFormatType"] = getFormatType;
|
89021 |
/* harmony export (immutable) */ __webpack_exports__["getFormatTypeForBareElement"] = getFormatTypeForBareElement;
|
89022 |
/* harmony export (immutable) */ __webpack_exports__["getFormatTypeForClassName"] = getFormatTypeForClassName;
|
89023 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_rememo__ = __webpack_require__(
|
89024 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
89025 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
89026 |
/**
|
@@ -89093,7 +93492,7 @@ function getFormatTypeForClassName(state, elementClassName) {
|
|
89093 |
//# sourceMappingURL=selectors.js.map
|
89094 |
|
89095 |
/***/ }),
|
89096 |
-
/*
|
89097 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89098 |
|
89099 |
"use strict";
|
@@ -89374,7 +93773,7 @@ function isShallowEqual( a, b, fromIndex ) {
|
|
89374 |
|
89375 |
|
89376 |
/***/ }),
|
89377 |
-
/*
|
89378 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89379 |
|
89380 |
"use strict";
|
@@ -89419,20 +93818,22 @@ function removeFormatTypes(names) {
|
|
89419 |
//# sourceMappingURL=actions.js.map
|
89420 |
|
89421 |
/***/ }),
|
89422 |
-
/*
|
89423 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89424 |
|
89425 |
"use strict";
|
89426 |
/* unused harmony export isListRootSelected */
|
89427 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__get_line_index__ = __webpack_require__(
|
89428 |
/**
|
89429 |
* Internal dependencies
|
89430 |
*/
|
89431 |
|
|
|
|
|
89432 |
/**
|
89433 |
* Whether or not the root list is selected.
|
89434 |
*
|
89435 |
-
* @param {
|
89436 |
*
|
89437 |
* @return {boolean} True if the root list or nothing is selected, false if an
|
89438 |
* inner list is selected.
|
@@ -89448,23 +93849,25 @@ function isListRootSelected(value) {
|
|
89448 |
//# sourceMappingURL=is-list-root-selected.js.map
|
89449 |
|
89450 |
/***/ }),
|
89451 |
-
/*
|
89452 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89453 |
|
89454 |
"use strict";
|
89455 |
/* unused harmony export isActiveListType */
|
89456 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__get_line_index__ = __webpack_require__(
|
89457 |
/**
|
89458 |
* Internal dependencies
|
89459 |
*/
|
89460 |
|
|
|
|
|
89461 |
/**
|
89462 |
* Wether or not the selected list has the given tag name.
|
89463 |
*
|
89464 |
-
* @param {
|
89465 |
-
* @param {string}
|
89466 |
-
* @param {string}
|
89467 |
-
*
|
89468 |
*
|
89469 |
* @return {boolean} True if the current list type matches `type`, false if not.
|
89470 |
*/
|
@@ -89485,27 +93888,29 @@ function isActiveListType(value, type, rootType) {
|
|
89485 |
//# sourceMappingURL=is-active-list-type.js.map
|
89486 |
|
89487 |
/***/ }),
|
89488 |
-
/*
|
89489 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89490 |
|
89491 |
"use strict";
|
89492 |
/* unused harmony export join */
|
89493 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__create__ = __webpack_require__(
|
89494 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__normalise_formats__ = __webpack_require__(
|
89495 |
/**
|
89496 |
* Internal dependencies
|
89497 |
*/
|
89498 |
|
89499 |
|
|
|
|
|
89500 |
/**
|
89501 |
* Combine an array of Rich Text values into one, optionally separated by
|
89502 |
* `separator`, which can be a Rich Text value, HTML string, or plain text
|
89503 |
* string. This is similar to `Array.prototype.join`.
|
89504 |
*
|
89505 |
-
* @param {Array<
|
89506 |
-
* @param {string|
|
89507 |
*
|
89508 |
-
* @return {
|
89509 |
*/
|
89510 |
|
89511 |
function join(values) {
|
@@ -89531,13 +93936,13 @@ function join(values) {
|
|
89531 |
//# sourceMappingURL=join.js.map
|
89532 |
|
89533 |
/***/ }),
|
89534 |
-
/*
|
89535 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89536 |
|
89537 |
"use strict";
|
89538 |
/* unused harmony export registerFormatType */
|
89539 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
89540 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_data__ = __webpack_require__(
|
89541 |
|
89542 |
|
89543 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
@@ -89568,8 +93973,8 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
89568 |
* @param {string} name Format name.
|
89569 |
* @param {WPFormat} settings Format settings.
|
89570 |
*
|
89571 |
-
* @return {WPFormat|undefined} The format, if it has been successfully
|
89572 |
-
* otherwise `undefined`.
|
89573 |
*/
|
89574 |
|
89575 |
function registerFormatType(name, settings) {
|
@@ -89587,7 +93992,7 @@ function registerFormatType(name, settings) {
|
|
89587 |
return;
|
89588 |
}
|
89589 |
|
89590 |
-
if (Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_data__["
|
89591 |
window.console.error('Format "' + settings.name + '" is already registered.');
|
89592 |
return;
|
89593 |
}
|
@@ -89608,14 +94013,14 @@ function registerFormatType(name, settings) {
|
|
89608 |
}
|
89609 |
|
89610 |
if (settings.className === null) {
|
89611 |
-
var formatTypeForBareElement = Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_data__["
|
89612 |
|
89613 |
if (formatTypeForBareElement) {
|
89614 |
window.console.error("Format \"".concat(formatTypeForBareElement.name, "\" is already registered to handle bare tag name \"").concat(settings.tagName, "\"."));
|
89615 |
return;
|
89616 |
}
|
89617 |
} else {
|
89618 |
-
var formatTypeForClassName = Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_data__["
|
89619 |
|
89620 |
if (formatTypeForClassName) {
|
89621 |
window.console.error("Format \"".concat(formatTypeForClassName.name, "\" is already registered to handle class name \"").concat(settings.className, "\"."));
|
@@ -89638,36 +94043,38 @@ function registerFormatType(name, settings) {
|
|
89638 |
return;
|
89639 |
}
|
89640 |
|
89641 |
-
Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_data__["
|
89642 |
return settings;
|
89643 |
}
|
89644 |
//# sourceMappingURL=register-format-type.js.map
|
89645 |
|
89646 |
/***/ }),
|
89647 |
-
/*
|
89648 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89649 |
|
89650 |
"use strict";
|
89651 |
/* unused harmony export insertLineSeparator */
|
89652 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__get_text_content__ = __webpack_require__(
|
89653 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__insert__ = __webpack_require__(
|
89654 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__special_characters__ = __webpack_require__(
|
89655 |
/**
|
89656 |
* Internal dependencies
|
89657 |
*/
|
89658 |
|
89659 |
|
89660 |
|
|
|
|
|
89661 |
/**
|
89662 |
* Insert a line break character into a Rich Text value at the given
|
89663 |
* `startIndex`. Any content between `startIndex` and `endIndex` will be
|
89664 |
* removed. Indices are retrieved from the selection if none are provided.
|
89665 |
*
|
89666 |
-
* @param {
|
89667 |
-
* @param {number}
|
89668 |
-
* @param {number}
|
89669 |
*
|
89670 |
-
* @return {
|
89671 |
*/
|
89672 |
|
89673 |
function insertLineSeparator(value) {
|
@@ -89692,63 +94099,70 @@ function insertLineSeparator(value) {
|
|
89692 |
//# sourceMappingURL=insert-line-separator.js.map
|
89693 |
|
89694 |
/***/ }),
|
89695 |
-
/*
|
89696 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89697 |
|
89698 |
"use strict";
|
89699 |
/* unused harmony export insertObject */
|
89700 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__insert__ = __webpack_require__(
|
|
|
89701 |
/**
|
89702 |
* Internal dependencies
|
89703 |
*/
|
89704 |
|
89705 |
-
|
|
|
|
|
|
|
|
|
89706 |
/**
|
89707 |
* Insert a format as an object into a Rich Text value at the given
|
89708 |
* `startIndex`. Any content between `startIndex` and `endIndex` will be
|
89709 |
* removed. Indices are retrieved from the selection if none are provided.
|
89710 |
*
|
89711 |
-
* @param {
|
89712 |
-
* @param {
|
89713 |
-
* @param {number}
|
89714 |
-
* @param {number}
|
89715 |
*
|
89716 |
-
* @return {
|
89717 |
*/
|
89718 |
|
89719 |
function insertObject(value, formatToInsert, startIndex, endIndex) {
|
89720 |
var valueToInsert = {
|
89721 |
formats: [,],
|
89722 |
replacements: [formatToInsert],
|
89723 |
-
text: OBJECT_REPLACEMENT_CHARACTER
|
89724 |
};
|
89725 |
return Object(__WEBPACK_IMPORTED_MODULE_0__insert__["a" /* insert */])(value, valueToInsert, startIndex, endIndex);
|
89726 |
}
|
89727 |
//# sourceMappingURL=insert-object.js.map
|
89728 |
|
89729 |
/***/ }),
|
89730 |
-
/*
|
89731 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89732 |
|
89733 |
"use strict";
|
89734 |
/* harmony export (immutable) */ __webpack_exports__["a"] = slice;
|
89735 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
89736 |
|
89737 |
|
89738 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
89739 |
|
89740 |
function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }
|
89741 |
|
|
|
|
|
89742 |
/**
|
89743 |
* Slice a Rich Text value from `startIndex` to `endIndex`. Indices are
|
89744 |
* retrieved from the selection if none are provided. This is similar to
|
89745 |
* `String.prototype.slice`.
|
89746 |
*
|
89747 |
-
* @param {
|
89748 |
-
* @param {number}
|
89749 |
-
* @param {number}
|
89750 |
*
|
89751 |
-
* @return {
|
89752 |
*/
|
89753 |
function slice(value) {
|
89754 |
var startIndex = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : value.start;
|
@@ -89770,30 +94184,27 @@ function slice(value) {
|
|
89770 |
//# sourceMappingURL=slice.js.map
|
89771 |
|
89772 |
/***/ }),
|
89773 |
-
/*
|
89774 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89775 |
|
89776 |
"use strict";
|
89777 |
/* unused harmony export split */
|
89778 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__replace__ = __webpack_require__(
|
89779 |
/**
|
89780 |
* Internal dependencies
|
89781 |
*/
|
89782 |
|
|
|
|
|
89783 |
/**
|
89784 |
* Split a Rich Text value in two at the given `startIndex` and `endIndex`, or
|
89785 |
* split at the given separator. This is similar to `String.prototype.split`.
|
89786 |
* Indices are retrieved from the selection if none are provided.
|
89787 |
*
|
89788 |
-
* @param {
|
89789 |
-
* @param {Object[]} value.formats
|
89790 |
-
* @param {Object[]} value.replacements
|
89791 |
-
* @param {string} value.text
|
89792 |
-
* @param {number} value.start
|
89793 |
-
* @param {number} value.end
|
89794 |
* @param {number|string} [string] Start index, or string at which to split.
|
89795 |
*
|
89796 |
-
* @return {Array} An array of new values.
|
89797 |
*/
|
89798 |
|
89799 |
function split(_ref, string) {
|
@@ -89861,51 +94272,57 @@ function splitAtSelection(_ref2) {
|
|
89861 |
//# sourceMappingURL=split.js.map
|
89862 |
|
89863 |
/***/ }),
|
89864 |
-
/*
|
89865 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89866 |
|
89867 |
"use strict";
|
89868 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getFormatType;
|
89869 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_data__ = __webpack_require__(
|
89870 |
/**
|
89871 |
* WordPress dependencies
|
89872 |
*/
|
89873 |
|
|
|
|
|
89874 |
/**
|
89875 |
* Returns a registered format type.
|
89876 |
*
|
89877 |
* @param {string} name Format name.
|
89878 |
*
|
89879 |
-
* @return {
|
89880 |
*/
|
89881 |
|
89882 |
function getFormatType(name) {
|
89883 |
-
return Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_data__["
|
89884 |
}
|
89885 |
//# sourceMappingURL=get-format-type.js.map
|
89886 |
|
89887 |
/***/ }),
|
89888 |
-
/*
|
89889 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89890 |
|
89891 |
"use strict";
|
89892 |
/* unused harmony export toggleFormat */
|
89893 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__get_active_format__ = __webpack_require__(
|
89894 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__remove_format__ = __webpack_require__(
|
89895 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__apply_format__ = __webpack_require__(
|
89896 |
/**
|
89897 |
* Internal dependencies
|
89898 |
*/
|
89899 |
|
89900 |
|
89901 |
|
|
|
|
|
|
|
|
|
89902 |
/**
|
89903 |
* Toggles a format object to a Rich Text value at the current selection.
|
89904 |
*
|
89905 |
-
* @param {
|
89906 |
-
* @param {
|
89907 |
*
|
89908 |
-
* @return {
|
89909 |
*/
|
89910 |
|
89911 |
function toggleFormat(value, format) {
|
@@ -89918,52 +94335,53 @@ function toggleFormat(value, format) {
|
|
89918 |
//# sourceMappingURL=toggle-format.js.map
|
89919 |
|
89920 |
/***/ }),
|
89921 |
-
/*
|
89922 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89923 |
|
89924 |
"use strict";
|
89925 |
/* unused harmony export unregisterFormatType */
|
89926 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_data__ = __webpack_require__(
|
89927 |
/**
|
89928 |
* WordPress dependencies
|
89929 |
*/
|
89930 |
|
89931 |
-
/** @typedef {import('./register-format-type').
|
89932 |
|
89933 |
/**
|
89934 |
* Unregisters a format.
|
89935 |
*
|
89936 |
* @param {string} name Format name.
|
89937 |
*
|
89938 |
-
* @return {
|
89939 |
-
*
|
|
|
89940 |
*/
|
89941 |
|
89942 |
function unregisterFormatType(name) {
|
89943 |
-
var oldFormat = Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_data__["
|
89944 |
|
89945 |
if (!oldFormat) {
|
89946 |
window.console.error("Format ".concat(name, " is not registered."));
|
89947 |
return;
|
89948 |
}
|
89949 |
|
89950 |
-
Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_data__["
|
89951 |
return oldFormat;
|
89952 |
}
|
89953 |
//# sourceMappingURL=unregister-format-type.js.map
|
89954 |
|
89955 |
/***/ }),
|
89956 |
-
/*
|
89957 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89958 |
|
89959 |
"use strict";
|
89960 |
/* unused harmony export outdentListItems */
|
89961 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
89962 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__special_characters__ = __webpack_require__(
|
89963 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__get_line_index__ = __webpack_require__(
|
89964 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__get_parent_line_index__ = __webpack_require__(
|
89965 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__get_last_child_index__ = __webpack_require__(
|
89966 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__can_outdent_list_items__ = __webpack_require__(
|
89967 |
|
89968 |
|
89969 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
@@ -89978,12 +94396,14 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
89978 |
|
89979 |
|
89980 |
|
|
|
|
|
89981 |
/**
|
89982 |
* Outdents any selected list items if possible.
|
89983 |
*
|
89984 |
-
* @param {
|
89985 |
*
|
89986 |
-
* @return {
|
89987 |
*/
|
89988 |
|
89989 |
function outdentListItems(value) {
|
@@ -90019,30 +94439,32 @@ function outdentListItems(value) {
|
|
90019 |
}
|
90020 |
}
|
90021 |
|
90022 |
-
return _objectSpread({}, value, {
|
90023 |
replacements: newFormats
|
90024 |
});
|
90025 |
}
|
90026 |
//# sourceMappingURL=outdent-list-items.js.map
|
90027 |
|
90028 |
/***/ }),
|
90029 |
-
/*
|
90030 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
90031 |
|
90032 |
"use strict";
|
90033 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getLastChildIndex;
|
90034 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__special_characters__ = __webpack_require__(
|
90035 |
/**
|
90036 |
* Internal dependencies
|
90037 |
*/
|
90038 |
|
|
|
|
|
90039 |
/**
|
90040 |
* Gets the line index of the last child in the list.
|
90041 |
*
|
90042 |
-
* @param {
|
90043 |
-
* @param {number}
|
90044 |
*
|
90045 |
-
* @return {
|
90046 |
*/
|
90047 |
|
90048 |
function getLastChildIndex(_ref, lineIndex) {
|
@@ -90074,15 +94496,15 @@ function getLastChildIndex(_ref, lineIndex) {
|
|
90074 |
//# sourceMappingURL=get-last-child-index.js.map
|
90075 |
|
90076 |
/***/ }),
|
90077 |
-
/*
|
90078 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
90079 |
|
90080 |
"use strict";
|
90081 |
/* unused harmony export changeListType */
|
90082 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(
|
90083 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__special_characters__ = __webpack_require__(
|
90084 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__get_line_index__ = __webpack_require__(
|
90085 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__get_parent_line_index__ = __webpack_require__(
|
90086 |
|
90087 |
|
90088 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
@@ -90095,17 +94517,21 @@ function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { va
|
|
90095 |
|
90096 |
|
90097 |
|
|
|
|
|
|
|
|
|
90098 |
/**
|
90099 |
* Changes the list type of the selected indented list, if any. Looks at the
|
90100 |
* currently selected list item and takes the parent list, then changes the list
|
90101 |
* type of this list. When multiple lines are selected, the parent lists are
|
90102 |
* takes and changed.
|
90103 |
*
|
90104 |
-
* @param {
|
90105 |
-
* @param {
|
90106 |
-
*
|
90107 |
*
|
90108 |
-
* @return {
|
90109 |
*/
|
90110 |
|
90111 |
function changeListType(value, newFormat) {
|
@@ -90145,75 +94571,53 @@ function changeListType(value, newFormat) {
|
|
90145 |
return value;
|
90146 |
}
|
90147 |
|
90148 |
-
return _objectSpread({}, value, {
|
90149 |
replacements: newReplacements
|
90150 |
});
|
90151 |
}
|
90152 |
//# sourceMappingURL=change-list-type.js.map
|
90153 |
|
90154 |
/***/ }),
|
90155 |
-
/*
|
90156 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
90157 |
|
90158 |
"use strict";
|
90159 |
-
/* harmony import */ var
|
90160 |
-
/* harmony import */ var
|
90161 |
-
/* harmony import */ var
|
90162 |
-
/* harmony import */ var
|
90163 |
-
/* harmony import */ var
|
90164 |
-
/* harmony import */ var
|
90165 |
-
/* harmony import */ var
|
90166 |
-
/* harmony import */ var
|
90167 |
-
/* harmony import */ var
|
90168 |
-
/* harmony import */ var
|
90169 |
-
/* harmony import */ var
|
90170 |
-
/* harmony import */ var
|
90171 |
-
/* harmony import */ var
|
90172 |
-
/* harmony import */ var
|
90173 |
-
/* harmony import */ var
|
90174 |
-
/* harmony import */ var
|
90175 |
-
/* harmony import */ var
|
90176 |
-
/* harmony import */ var
|
90177 |
-
/* harmony import */ var
|
90178 |
-
/* harmony import */ var
|
90179 |
-
/* harmony import */ var
|
90180 |
-
/* harmony import */ var
|
90181 |
-
/* harmony import */ var
|
90182 |
-
/* harmony import */ var
|
90183 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_21__is_collapsed__ = __webpack_require__(111);
|
90184 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_22__special_characters__ = __webpack_require__(29);
|
90185 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_23__indent_list_items__ = __webpack_require__(176);
|
90186 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_24__get_active_formats__ = __webpack_require__(110);
|
90187 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_25__update_formats__ = __webpack_require__(571);
|
90188 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_26__remove_line_separator__ = __webpack_require__(170);
|
90189 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_27__is_empty__ = __webpack_require__(168);
|
90190 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_28__with_format_types__ = __webpack_require__(572);
|
90191 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_29__boundary_style__ = __webpack_require__(573);
|
90192 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_30__inline_warning__ = __webpack_require__(574);
|
90193 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_31__insert__ = __webpack_require__(63);
|
90194 |
-
|
90195 |
-
|
90196 |
-
|
90197 |
-
|
90198 |
-
|
90199 |
-
|
90200 |
|
90201 |
|
90202 |
|
90203 |
|
90204 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
90205 |
|
90206 |
-
function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(
|
90207 |
-
|
90208 |
-
function _createSuper(Derived) { return function () { var Super = Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(Derived), result; if (_isNativeReflectConstruct()) { var NewTarget = Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(__WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_possibleConstructorReturn__["a" /* default */])(this, result); }; }
|
90209 |
-
|
90210 |
-
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
90211 |
|
90212 |
/**
|
90213 |
* External dependencies
|
90214 |
*/
|
90215 |
|
90216 |
-
|
90217 |
/**
|
90218 |
* WordPress dependencies
|
90219 |
*/
|
@@ -90221,8 +94625,6 @@ function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Re
|
|
90221 |
|
90222 |
|
90223 |
|
90224 |
-
|
90225 |
-
|
90226 |
/**
|
90227 |
* Internal dependencies
|
90228 |
*/
|
@@ -90288,14 +94690,7 @@ var defaultStyle = {
|
|
90288 |
};
|
90289 |
var EMPTY_ACTIVE_FORMATS = [];
|
90290 |
|
90291 |
-
function createPrepareEditableTree(
|
90292 |
-
var fns = Object.keys(props).reduce(function (accumulator, key) {
|
90293 |
-
if (key.startsWith(prefix)) {
|
90294 |
-
accumulator.push(props[key]);
|
90295 |
-
}
|
90296 |
-
|
90297 |
-
return accumulator;
|
90298 |
-
}, []);
|
90299 |
return function (value) {
|
90300 |
return fns.reduce(function (accumulator, fn) {
|
90301 |
return fn(accumulator, value.text);
|
@@ -90327,1120 +94722,1010 @@ function fixPlaceholderSelection(defaultView) {
|
|
90327 |
|
90328 |
selection.collapseToStart();
|
90329 |
}
|
90330 |
-
/**
|
90331 |
-
* See export statement below.
|
90332 |
-
*/
|
90333 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
90334 |
|
90335 |
-
var RichText = /*#__PURE__*/function (_Component) {
|
90336 |
-
Object(__WEBPACK_IMPORTED_MODULE_7__babel_runtime_helpers_esm_inherits__["a" /* default */])(RichText, _Component);
|
90337 |
-
|
90338 |
-
var _super = _createSuper(RichText);
|
90339 |
-
|
90340 |
-
function RichText(_ref) {
|
90341 |
-
var _this;
|
90342 |
|
90343 |
-
|
90344 |
-
|
90345 |
-
|
90346 |
|
90347 |
-
|
|
|
|
|
90348 |
|
90349 |
-
|
90350 |
-
|
90351 |
-
|
90352 |
-
|
90353 |
-
|
90354 |
-
|
90355 |
-
|
90356 |
-
|
90357 |
-
|
90358 |
-
|
90359 |
-
_this.onPaste = _this.onPaste.bind(Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this));
|
90360 |
-
_this.onCreateUndoLevel = _this.onCreateUndoLevel.bind(Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this));
|
90361 |
-
_this.onInput = _this.onInput.bind(Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this));
|
90362 |
-
_this.onCompositionStart = _this.onCompositionStart.bind(Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this));
|
90363 |
-
_this.onCompositionEnd = _this.onCompositionEnd.bind(Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this));
|
90364 |
-
_this.onSelectionChange = _this.onSelectionChange.bind(Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this));
|
90365 |
-
_this.createRecord = _this.createRecord.bind(Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this));
|
90366 |
-
_this.applyRecord = _this.applyRecord.bind(Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this));
|
90367 |
-
_this.valueToFormat = _this.valueToFormat.bind(Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this));
|
90368 |
-
_this.onPointerDown = _this.onPointerDown.bind(Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this));
|
90369 |
-
_this.formatToValue = _this.formatToValue.bind(Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this));
|
90370 |
-
_this.Editable = _this.Editable.bind(Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this));
|
90371 |
-
|
90372 |
-
_this.onKeyDown = function (event) {
|
90373 |
-
if (event.defaultPrevented) {
|
90374 |
-
return;
|
90375 |
-
}
|
90376 |
|
90377 |
-
_this.handleDelete(event);
|
90378 |
|
90379 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
90380 |
|
90381 |
-
|
|
|
|
|
90382 |
|
90383 |
-
|
90384 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
90385 |
|
90386 |
-
_this.state = {};
|
90387 |
-
_this.lastHistoryValue = value; // Internal values are updated synchronously, unlike props and state.
|
90388 |
|
90389 |
-
|
90390 |
-
|
90391 |
-
|
90392 |
-
|
90393 |
-
|
|
|
|
|
|
|
90394 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
90395 |
|
90396 |
-
|
90397 |
-
|
90398 |
-
|
90399 |
-
|
90400 |
-
this.getWindow().cancelAnimationFrame(this.rafId);
|
90401 |
-
}
|
90402 |
-
}, {
|
90403 |
-
key: "componentDidMount",
|
90404 |
-
value: function componentDidMount() {
|
90405 |
-
this.applyRecord(this.record, {
|
90406 |
-
domOnly: true
|
90407 |
-
});
|
90408 |
-
}
|
90409 |
-
}, {
|
90410 |
-
key: "getDocument",
|
90411 |
-
value: function getDocument() {
|
90412 |
-
return this.props.forwardedRef.current.ownerDocument;
|
90413 |
-
}
|
90414 |
-
}, {
|
90415 |
-
key: "getWindow",
|
90416 |
-
value: function getWindow() {
|
90417 |
-
return this.getDocument().defaultView;
|
90418 |
-
}
|
90419 |
-
}, {
|
90420 |
-
key: "createRecord",
|
90421 |
-
value: function createRecord() {
|
90422 |
-
var _this$props = this.props,
|
90423 |
-
multilineTag = _this$props.__unstableMultilineTag,
|
90424 |
-
forwardedRef = _this$props.forwardedRef,
|
90425 |
-
preserveWhiteSpace = _this$props.preserveWhiteSpace;
|
90426 |
-
var selection = this.getWindow().getSelection();
|
90427 |
-
var range = selection.rangeCount > 0 ? selection.getRangeAt(0) : null;
|
90428 |
-
return Object(__WEBPACK_IMPORTED_MODULE_16__create__["a" /* create */])({
|
90429 |
-
element: forwardedRef.current,
|
90430 |
-
range: range,
|
90431 |
-
multilineTag: multilineTag,
|
90432 |
-
multilineWrapperTags: multilineTag === 'li' ? ['ul', 'ol'] : undefined,
|
90433 |
-
__unstableIsEditableTree: true,
|
90434 |
-
preserveWhiteSpace: preserveWhiteSpace
|
90435 |
-
});
|
90436 |
}
|
90437 |
-
}, {
|
90438 |
-
key: "applyRecord",
|
90439 |
-
value: function applyRecord(record) {
|
90440 |
-
var _ref2 = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {},
|
90441 |
-
domOnly = _ref2.domOnly;
|
90442 |
|
90443 |
-
|
90444 |
-
|
90445 |
-
|
90446 |
-
|
90447 |
-
value: record,
|
90448 |
-
current: forwardedRef.current,
|
90449 |
-
multilineTag: multilineTag,
|
90450 |
-
multilineWrapperTags: multilineTag === 'li' ? ['ul', 'ol'] : undefined,
|
90451 |
-
prepareEditableTree: createPrepareEditableTree(this.props, 'format_prepare_functions'),
|
90452 |
-
__unstableDomOnly: domOnly,
|
90453 |
-
placeholder: this.props.placeholder
|
90454 |
-
});
|
90455 |
}
|
90456 |
-
/**
|
90457 |
-
* Handles a paste event.
|
90458 |
-
*
|
90459 |
-
* Saves the pasted data as plain text in `pastedPlainText`.
|
90460 |
-
*
|
90461 |
-
* @param {ClipboardEvent} event The paste event.
|
90462 |
-
*/
|
90463 |
|
90464 |
-
|
90465 |
-
|
90466 |
-
|
90467 |
-
|
90468 |
-
|
90469 |
-
|
90470 |
-
isSelected = _this$props3.__unstableIsSelected,
|
90471 |
-
__unstableDisableFormats = _this$props3.__unstableDisableFormats;
|
90472 |
-
var _this$state$activeFor = this.state.activeFormats,
|
90473 |
-
activeFormats = _this$state$activeFor === void 0 ? [] : _this$state$activeFor;
|
90474 |
-
|
90475 |
-
if (!isSelected) {
|
90476 |
-
event.preventDefault();
|
90477 |
-
return;
|
90478 |
-
}
|
90479 |
|
90480 |
-
var clipboardData = event.clipboardData;
|
90481 |
-
var items = clipboardData.items,
|
90482 |
-
files = clipboardData.files; // In Edge these properties can be null instead of undefined, so a more
|
90483 |
-
// rigorous test is required over using default values.
|
90484 |
|
90485 |
-
|
90486 |
-
files = Object(__WEBPACK_IMPORTED_MODULE_10_lodash__["isNil"])(files) ? [] : files;
|
90487 |
-
var plainText = '';
|
90488 |
-
var html = ''; // IE11 only supports `Text` as an argument for `getData` and will
|
90489 |
-
// otherwise throw an invalid argument error, so we try the standard
|
90490 |
-
// arguments first, then fallback to `Text` if they fail.
|
90491 |
|
90492 |
-
|
90493 |
-
|
90494 |
-
|
90495 |
-
|
90496 |
-
|
90497 |
-
|
90498 |
-
} catch (error2) {
|
90499 |
-
// Some browsers like UC Browser paste plain text by default and
|
90500 |
-
// don't support clipboardData at all, so allow default
|
90501 |
-
// behaviour.
|
90502 |
-
return;
|
90503 |
-
}
|
90504 |
-
}
|
90505 |
|
90506 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
90507 |
|
90508 |
-
|
90509 |
-
|
|
|
90510 |
|
90511 |
-
|
90512 |
-
|
90513 |
-
|
90514 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
90515 |
|
90516 |
-
var record = this.record;
|
90517 |
-
var transformed = formatTypes.reduce(function (accumlator, _ref3) {
|
90518 |
-
var __unstablePasteRule = _ref3.__unstablePasteRule;
|
90519 |
|
90520 |
-
|
90521 |
-
|
90522 |
-
|
90523 |
-
|
90524 |
-
|
90525 |
-
|
90526 |
-
|
|
|
|
|
|
|
90527 |
|
90528 |
-
|
90529 |
-
|
|
|
|
|
|
|
|
|
90530 |
|
90531 |
-
|
90532 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
90533 |
return;
|
90534 |
}
|
|
|
90535 |
|
90536 |
-
|
90537 |
-
files = Array.from(files);
|
90538 |
-
Array.from(items).forEach(function (item) {
|
90539 |
-
if (!item.getAsFile) {
|
90540 |
-
return;
|
90541 |
-
}
|
90542 |
|
90543 |
-
|
|
|
90544 |
|
90545 |
-
|
90546 |
-
|
90547 |
-
|
|
|
90548 |
|
90549 |
-
|
90550 |
-
|
90551 |
-
size = file.size;
|
90552 |
|
90553 |
-
|
90554 |
-
|
90555 |
-
|
90556 |
-
size: size
|
90557 |
-
})) {
|
90558 |
-
files.push(file);
|
90559 |
-
}
|
90560 |
-
});
|
90561 |
-
onPaste({
|
90562 |
-
value: this.removeEditorOnlyFormats(record),
|
90563 |
-
onChange: this.onChange,
|
90564 |
html: html,
|
90565 |
-
plainText: plainText
|
90566 |
-
files: files,
|
90567 |
-
activeFormats: activeFormats
|
90568 |
});
|
90569 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
90570 |
}
|
90571 |
-
/**
|
90572 |
-
* Handles a focus event on the contenteditable field, calling the
|
90573 |
-
* `unstableOnFocus` prop callback if one is defined. The callback does not
|
90574 |
-
* receive any arguments.
|
90575 |
-
*
|
90576 |
-
* This is marked as a private API and the `unstableOnFocus` prop is not
|
90577 |
-
* documented, as the current requirements where it is used are subject to
|
90578 |
-
* future refactoring following `isSelected` handling.
|
90579 |
-
*
|
90580 |
-
* In contrast with `setFocusedElement`, this is only triggered in response
|
90581 |
-
* to focus within the contenteditable field, whereas `setFocusedElement`
|
90582 |
-
* is triggered on focus within any `RichText` descendent element.
|
90583 |
-
*
|
90584 |
-
* @see setFocusedElement
|
90585 |
-
*
|
90586 |
-
* @private
|
90587 |
-
*/
|
90588 |
|
90589 |
-
|
90590 |
-
|
90591 |
-
|
90592 |
-
|
90593 |
-
|
90594 |
-
|
90595 |
-
|
90596 |
-
|
90597 |
-
|
90598 |
-
if (!this.props.__unstableIsSelected) {
|
90599 |
-
// We know for certain that on focus, the old selection is invalid. It
|
90600 |
-
// will be recalculated on the next mouseup, keyup, or touchend event.
|
90601 |
-
var index = undefined;
|
90602 |
-
var activeFormats = EMPTY_ACTIVE_FORMATS;
|
90603 |
-
this.record = _objectSpread({}, this.record, {
|
90604 |
-
start: index,
|
90605 |
-
end: index,
|
90606 |
-
activeFormats: activeFormats
|
90607 |
-
});
|
90608 |
-
this.props.onSelectionChange(index, index);
|
90609 |
-
this.setState({
|
90610 |
-
activeFormats: activeFormats
|
90611 |
-
});
|
90612 |
-
} else {
|
90613 |
-
this.props.onSelectionChange(this.record.start, this.record.end);
|
90614 |
-
this.setState({
|
90615 |
-
activeFormats: Object(__WEBPACK_IMPORTED_MODULE_24__get_active_formats__["a" /* getActiveFormats */])(_objectSpread({}, this.record, {
|
90616 |
-
activeFormats: undefined
|
90617 |
-
}), EMPTY_ACTIVE_FORMATS)
|
90618 |
-
});
|
90619 |
-
} // Update selection as soon as possible, which is at the next animation
|
90620 |
-
// frame. The event listener for selection changes may be added too late
|
90621 |
-
// at this point, but this focus event is still too early to calculate
|
90622 |
-
// the selection.
|
90623 |
|
|
|
|
|
|
|
90624 |
|
90625 |
-
|
90626 |
-
|
|
|
90627 |
|
90628 |
-
|
90629 |
-
|
90630 |
-
|
90631 |
-
|
90632 |
-
|
90633 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
90634 |
}
|
90635 |
-
}
|
90636 |
-
|
90637 |
-
|
90638 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
90639 |
}
|
90640 |
-
/**
|
90641 |
-
* Handle input on the next selection change event.
|
90642 |
-
*
|
90643 |
-
* @param {WPSyntheticEvent} event Synthetic input event.
|
90644 |
-
*/
|
90645 |
|
90646 |
-
|
90647 |
-
|
90648 |
-
|
90649 |
-
|
90650 |
-
|
90651 |
-
// composed.
|
90652 |
-
// As of December 2019, Safari doesn't support nativeEvent.isComposing.
|
90653 |
-
if (this.isComposing) {
|
90654 |
-
return;
|
90655 |
-
}
|
90656 |
|
90657 |
-
|
|
|
|
|
90658 |
|
90659 |
-
|
90660 |
-
|
90661 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
90662 |
|
90663 |
-
|
90664 |
-
|
90665 |
-
} // The browser formatted something or tried to insert HTML.
|
90666 |
-
// Overwrite it. It will be handled later by the format library if
|
90667 |
-
// needed.
|
90668 |
|
|
|
|
|
|
|
|
|
|
|
90669 |
|
90670 |
-
if (
|
90671 |
-
|
|
|
90672 |
return;
|
90673 |
}
|
|
|
90674 |
|
90675 |
-
var value = this.createRecord();
|
90676 |
-
var _this$record = this.record,
|
90677 |
-
start = _this$record.start,
|
90678 |
-
_this$record$activeFo = _this$record.activeFormats,
|
90679 |
-
activeFormats = _this$record$activeFo === void 0 ? [] : _this$record$activeFo; // Update the formats between the last and new caret position.
|
90680 |
|
90681 |
-
|
90682 |
-
|
90683 |
-
|
90684 |
-
|
90685 |
-
|
90686 |
-
|
90687 |
-
|
90688 |
-
|
90689 |
-
|
90690 |
-
|
90691 |
-
|
90692 |
-
|
90693 |
-
|
90694 |
-
|
90695 |
-
|
90696 |
-
clearTimeout = _this$props4.clearTimeout; // Create an undo level when input stops for over a second.
|
90697 |
|
90698 |
-
clearTimeout(this.onInput.timeout);
|
90699 |
-
this.onInput.timeout = setTimeout(this.onCreateUndoLevel, 1000); // Only run input rules when inserting text.
|
90700 |
|
90701 |
-
|
90702 |
-
|
90703 |
-
|
|
|
90704 |
|
90705 |
-
|
90706 |
-
inputRule(change, this.valueToFormat);
|
90707 |
-
}
|
90708 |
|
90709 |
-
|
90710 |
-
|
|
|
90711 |
|
90712 |
-
|
90713 |
-
|
90714 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
90715 |
|
90716 |
-
return accumlator;
|
90717 |
-
}, change);
|
90718 |
|
90719 |
-
|
90720 |
-
|
90721 |
-
|
90722 |
-
|
90723 |
-
|
90724 |
-
|
90725 |
-
|
|
|
|
|
|
|
90726 |
}
|
90727 |
-
}, {
|
90728 |
-
key: "onCompositionStart",
|
90729 |
-
value: function onCompositionStart() {
|
90730 |
-
this.isComposing = true; // Do not update the selection when characters are being composed as
|
90731 |
-
// this rerenders the component and might distroy internal browser
|
90732 |
-
// editing state.
|
90733 |
|
90734 |
-
|
|
|
|
|
|
|
90735 |
}
|
90736 |
-
}, {
|
90737 |
-
key: "onCompositionEnd",
|
90738 |
-
value: function onCompositionEnd() {
|
90739 |
-
this.isComposing = false; // Ensure the value is up-to-date for browsers that don't emit a final
|
90740 |
-
// input event after composition.
|
90741 |
|
90742 |
-
|
90743 |
-
|
90744 |
-
|
90745 |
|
90746 |
-
|
|
|
90747 |
}
|
90748 |
-
/**
|
90749 |
-
* Syncs the selection to local state. A callback for the `selectionchange`
|
90750 |
-
* native events, `keyup`, `mouseup` and `touchend` synthetic events, and
|
90751 |
-
* animation frames after the `focus` event.
|
90752 |
-
*
|
90753 |
-
* @param {Event|WPSyntheticEvent|DOMHighResTimeStamp} event
|
90754 |
-
*/
|
90755 |
|
90756 |
-
|
90757 |
-
|
90758 |
-
|
90759 |
-
|
90760 |
-
|
90761 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
90762 |
|
90763 |
-
if (this.props.disabled) {
|
90764 |
-
return;
|
90765 |
-
} // In case of a keyboard event, ignore selection changes during
|
90766 |
-
// composition.
|
90767 |
|
|
|
|
|
|
|
|
|
|
|
|
|
90768 |
|
90769 |
-
|
90770 |
-
|
90771 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
90772 |
|
90773 |
-
|
90774 |
-
|
90775 |
-
end = _this$createRecord.end,
|
90776 |
-
text = _this$createRecord.text;
|
90777 |
|
90778 |
-
|
90779 |
-
|
|
|
|
|
|
|
90780 |
|
90781 |
-
|
90782 |
-
|
90783 |
return;
|
90784 |
}
|
90785 |
|
90786 |
-
if (
|
90787 |
-
// Sometimes the browser may set the selection on the placeholder
|
90788 |
-
// element, in which case the caret is not visible. We need to set
|
90789 |
-
// the caret before the placeholder if that's the case.
|
90790 |
-
if (value.text.length === 0 && start === 0) {
|
90791 |
-
fixPlaceholderSelection(this.getWindow());
|
90792 |
-
}
|
90793 |
-
|
90794 |
return;
|
90795 |
}
|
|
|
|
|
|
|
90796 |
|
90797 |
-
var _this$props5 = this.props,
|
90798 |
-
isCaretWithinFormattedText = _this$props5.__unstableIsCaretWithinFormattedText,
|
90799 |
-
onEnterFormattedText = _this$props5.__unstableOnEnterFormattedText,
|
90800 |
-
onExitFormattedText = _this$props5.__unstableOnExitFormattedText;
|
90801 |
-
|
90802 |
-
var newValue = _objectSpread({}, value, {
|
90803 |
-
start: start,
|
90804 |
-
end: end,
|
90805 |
-
// Allow `getActiveFormats` to get new `activeFormats`.
|
90806 |
-
activeFormats: undefined
|
90807 |
-
});
|
90808 |
|
90809 |
-
|
|
|
|
|
90810 |
|
90811 |
-
newValue.activeFormats = activeFormats;
|
90812 |
|
90813 |
-
|
90814 |
-
|
90815 |
-
|
90816 |
-
|
90817 |
-
|
90818 |
-
// otherwise the value will be wrong on render!
|
90819 |
|
|
|
|
|
|
|
|
|
90820 |
|
90821 |
-
this.record = newValue;
|
90822 |
-
this.applyRecord(newValue, {
|
90823 |
-
domOnly: true
|
90824 |
-
});
|
90825 |
-
this.props.onSelectionChange(start, end);
|
90826 |
-
this.setState({
|
90827 |
-
activeFormats: activeFormats
|
90828 |
-
});
|
90829 |
-
}
|
90830 |
-
/**
|
90831 |
-
* Sync the value to global state. The node tree and selection will also be
|
90832 |
-
* updated if differences are found.
|
90833 |
-
*
|
90834 |
-
* @param {Object} record The record to sync and apply.
|
90835 |
-
* @param {Object} $2 Named options.
|
90836 |
-
* @param {boolean} $2.withoutHistory If true, no undo level will be
|
90837 |
-
* created.
|
90838 |
-
*/
|
90839 |
|
90840 |
-
|
90841 |
-
|
90842 |
-
|
90843 |
-
|
90844 |
-
withoutHistory = _ref5.withoutHistory;
|
90845 |
-
|
90846 |
-
if (this.props.__unstableDisableFormats) {
|
90847 |
-
record.formats = Array(record.text.length);
|
90848 |
-
record.replacements = Array(record.text.length);
|
90849 |
-
}
|
90850 |
-
|
90851 |
-
this.applyRecord(record);
|
90852 |
-
var start = record.start,
|
90853 |
-
end = record.end,
|
90854 |
-
_record$activeFormats = record.activeFormats,
|
90855 |
-
activeFormats = _record$activeFormats === void 0 ? [] : _record$activeFormats;
|
90856 |
-
var changeHandlers = Object(__WEBPACK_IMPORTED_MODULE_10_lodash__["pickBy"])(this.props, function (v, key) {
|
90857 |
-
return key.startsWith('format_on_change_functions_');
|
90858 |
-
});
|
90859 |
-
Object.values(changeHandlers).forEach(function (changeHandler) {
|
90860 |
-
changeHandler(record.formats, record.text);
|
90861 |
-
});
|
90862 |
-
this.value = this.valueToFormat(record);
|
90863 |
-
this.record = record; // Selection must be updated first, so it is recorded in history when
|
90864 |
-
// the content change happens.
|
90865 |
|
90866 |
-
|
90867 |
-
|
90868 |
-
|
90869 |
-
|
90870 |
-
|
|
|
|
|
90871 |
|
90872 |
-
if (
|
90873 |
-
|
90874 |
}
|
90875 |
}
|
90876 |
-
}, {
|
90877 |
-
key: "onCreateUndoLevel",
|
90878 |
-
value: function onCreateUndoLevel() {
|
90879 |
-
// If the content is the same, no level needs to be created.
|
90880 |
-
if (this.lastHistoryValue === this.value) {
|
90881 |
-
return;
|
90882 |
-
}
|
90883 |
|
90884 |
-
|
|
|
|
|
|
|
|
|
|
|
90885 |
|
90886 |
-
|
|
|
|
|
|
|
90887 |
}
|
90888 |
-
/**
|
90889 |
-
* Handles delete on keydown:
|
90890 |
-
* - outdent list items,
|
90891 |
-
* - delete content if everything is selected,
|
90892 |
-
* - trigger the onDelete prop when selection is uncollapsed and at an edge.
|
90893 |
-
*
|
90894 |
-
* @param {WPSyntheticEvent} event A synthetic keyboard event.
|
90895 |
-
*/
|
90896 |
|
90897 |
-
|
90898 |
-
|
90899 |
-
value: function handleDelete(event) {
|
90900 |
-
var keyCode = event.keyCode;
|
90901 |
|
90902 |
-
|
90903 |
-
|
90904 |
-
|
|
|
|
|
90905 |
|
90906 |
-
|
90907 |
-
|
|
|
|
|
|
|
90908 |
|
90909 |
-
|
|
|
|
|
|
|
90910 |
|
90911 |
-
|
90912 |
-
|
|
|
|
|
|
|
90913 |
|
90914 |
-
|
90915 |
-
return;
|
90916 |
-
}
|
90917 |
|
90918 |
-
|
90919 |
-
|
90920 |
-
|
90921 |
-
|
90922 |
-
|
90923 |
-
var value = this.createRecord();
|
90924 |
-
var start = value.start,
|
90925 |
-
end = value.end,
|
90926 |
-
text = value.text;
|
90927 |
-
var isReverse = keyCode === __WEBPACK_IMPORTED_MODULE_11__wordpress_keycodes__["a" /* BACKSPACE */]; // Always handle full content deletion ourselves.
|
90928 |
|
90929 |
-
|
90930 |
-
|
90931 |
-
|
90932 |
-
|
90933 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
90934 |
|
90935 |
-
|
90936 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
90937 |
|
90938 |
-
|
90939 |
-
newValue = Object(__WEBPACK_IMPORTED_MODULE_26__remove_line_separator__["a" /* removeLineSeparator */])(value, !isReverse);
|
90940 |
-
} else {
|
90941 |
-
newValue = Object(__WEBPACK_IMPORTED_MODULE_26__remove_line_separator__["a" /* removeLineSeparator */])(value, isReverse);
|
90942 |
-
}
|
90943 |
|
90944 |
-
|
90945 |
-
|
90946 |
-
|
90947 |
-
return;
|
90948 |
-
}
|
90949 |
-
} // Only process delete if the key press occurs at an uncollapsed edge.
|
90950 |
|
|
|
|
|
|
|
|
|
|
|
90951 |
|
90952 |
-
if (!onDelete || !Object(__WEBPACK_IMPORTED_MODULE_21__is_collapsed__["a" /* isCollapsed */])(value) || activeFormats.length || isReverse && start !== 0 || !isReverse && end !== text.length) {
|
90953 |
-
return;
|
90954 |
-
}
|
90955 |
|
90956 |
-
|
90957 |
-
|
90958 |
-
|
90959 |
-
});
|
90960 |
-
event.preventDefault();
|
90961 |
}
|
90962 |
-
/**
|
90963 |
-
* Triggers the `onEnter` prop on keydown.
|
90964 |
-
*
|
90965 |
-
* @param {WPSyntheticEvent} event A synthetic keyboard event.
|
90966 |
-
*/
|
90967 |
|
90968 |
-
|
90969 |
-
|
90970 |
-
|
90971 |
-
|
90972 |
-
|
90973 |
-
}
|
90974 |
|
90975 |
-
|
90976 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
90977 |
|
90978 |
-
|
90979 |
-
|
90980 |
-
}
|
90981 |
|
90982 |
-
|
90983 |
-
|
90984 |
-
onChange: this.onChange,
|
90985 |
-
shiftKey: event.shiftKey
|
90986 |
-
});
|
90987 |
}
|
90988 |
-
/**
|
90989 |
-
* Indents list items on space keydown.
|
90990 |
-
*
|
90991 |
-
* @param {WPSyntheticEvent} event A synthetic keyboard event.
|
90992 |
-
*/
|
90993 |
|
90994 |
-
|
90995 |
-
|
90996 |
-
|
90997 |
-
var keyCode = event.keyCode,
|
90998 |
-
shiftKey = event.shiftKey,
|
90999 |
-
altKey = event.altKey,
|
91000 |
-
metaKey = event.metaKey,
|
91001 |
-
ctrlKey = event.ctrlKey;
|
91002 |
-
var _this$props7 = this.props,
|
91003 |
-
multilineRootTag = _this$props7.__unstableMultilineRootTag,
|
91004 |
-
multilineTag = _this$props7.__unstableMultilineTag;
|
91005 |
-
|
91006 |
-
if ( // Only override when no modifiers are pressed.
|
91007 |
-
shiftKey || altKey || metaKey || ctrlKey || keyCode !== __WEBPACK_IMPORTED_MODULE_11__wordpress_keycodes__["h" /* SPACE */] || multilineTag !== 'li') {
|
91008 |
-
return;
|
91009 |
-
}
|
91010 |
|
91011 |
-
|
|
|
91012 |
|
91013 |
-
if (
|
91014 |
-
|
91015 |
}
|
91016 |
|
91017 |
-
|
91018 |
-
|
91019 |
-
var characterBefore = text[start - 1]; // The caret must be at the start of a line.
|
91020 |
-
|
91021 |
-
if (characterBefore && characterBefore !== __WEBPACK_IMPORTED_MODULE_22__special_characters__["a" /* LINE_SEPARATOR */]) {
|
91022 |
-
return;
|
91023 |
-
}
|
91024 |
|
91025 |
-
|
91026 |
-
|
|
|
|
|
91027 |
}));
|
91028 |
-
|
91029 |
}
|
91030 |
-
|
91031 |
-
* Handles horizontal keyboard navigation when no modifiers are pressed. The
|
91032 |
-
* navigation is handled separately to move correctly around format
|
91033 |
-
* boundaries.
|
91034 |
-
*
|
91035 |
-
* @param {WPSyntheticEvent} event A synthetic keyboard event.
|
91036 |
-
*/
|
91037 |
-
|
91038 |
-
}, {
|
91039 |
-
key: "handleHorizontalNavigation",
|
91040 |
-
value: function handleHorizontalNavigation(event) {
|
91041 |
-
var keyCode = event.keyCode,
|
91042 |
-
shiftKey = event.shiftKey,
|
91043 |
-
altKey = event.altKey,
|
91044 |
-
metaKey = event.metaKey,
|
91045 |
-
ctrlKey = event.ctrlKey;
|
91046 |
-
|
91047 |
-
if ( // Only override left and right keys without modifiers pressed.
|
91048 |
-
shiftKey || altKey || metaKey || ctrlKey || keyCode !== __WEBPACK_IMPORTED_MODULE_11__wordpress_keycodes__["f" /* LEFT */] && keyCode !== __WEBPACK_IMPORTED_MODULE_11__wordpress_keycodes__["g" /* RIGHT */]) {
|
91049 |
-
return;
|
91050 |
-
}
|
91051 |
-
|
91052 |
-
var value = this.record;
|
91053 |
-
var text = value.text,
|
91054 |
-
formats = value.formats,
|
91055 |
-
start = value.start,
|
91056 |
-
end = value.end,
|
91057 |
-
_value$activeFormats = value.activeFormats,
|
91058 |
-
activeFormats = _value$activeFormats === void 0 ? [] : _value$activeFormats;
|
91059 |
-
var collapsed = Object(__WEBPACK_IMPORTED_MODULE_21__is_collapsed__["a" /* isCollapsed */])(value); // To do: ideally, we should look at visual position instead.
|
91060 |
|
91061 |
-
|
91062 |
-
|
|
|
|
|
91063 |
|
91064 |
-
|
91065 |
-
|
91066 |
-
// navigating backward.
|
91067 |
-
// If the selection is collapsed and at the very end, do nothing if
|
91068 |
-
// navigating forward.
|
91069 |
|
91070 |
-
|
91071 |
-
|
91072 |
-
|
91073 |
-
}
|
91074 |
|
91075 |
-
|
91076 |
-
|
91077 |
-
|
91078 |
-
} // If the selection is not collapsed, let the browser handle collapsing
|
91079 |
-
// the selection for now. Later we could expand this logic to set
|
91080 |
-
// boundary positions if needed.
|
91081 |
|
|
|
|
|
91082 |
|
91083 |
-
|
91084 |
-
|
91085 |
-
|
|
|
|
|
|
|
|
|
|
|
91086 |
|
|
|
|
|
|
|
|
|
91087 |
|
91088 |
-
|
91089 |
-
|
91090 |
-
|
91091 |
-
var newActiveFormatsLength = activeFormats.length;
|
91092 |
-
var source = formatsAfter;
|
91093 |
|
91094 |
-
|
91095 |
-
|
91096 |
-
|
91097 |
-
// different, the caret is at a format boundary.
|
91098 |
|
|
|
|
|
|
|
|
|
91099 |
|
91100 |
-
if (formatsBefore.length < formatsAfter.length) {
|
91101 |
-
if (!isReverse && activeFormats.length < formatsAfter.length) {
|
91102 |
-
newActiveFormatsLength++;
|
91103 |
-
}
|
91104 |
|
91105 |
-
|
91106 |
-
|
91107 |
-
|
91108 |
-
} else if (formatsBefore.length > formatsAfter.length) {
|
91109 |
-
if (!isReverse && activeFormats.length > formatsAfter.length) {
|
91110 |
-
newActiveFormatsLength--;
|
91111 |
-
}
|
91112 |
|
91113 |
-
|
91114 |
-
|
91115 |
-
|
91116 |
-
|
91117 |
|
91118 |
-
|
91119 |
-
|
91120 |
|
91121 |
-
|
91122 |
-
|
91123 |
-
|
|
|
91124 |
|
91125 |
-
|
91126 |
-
|
91127 |
-
|
91128 |
-
|
91129 |
-
|
91130 |
-
|
91131 |
}
|
91132 |
|
91133 |
-
|
91134 |
-
var newActiveFormats = isReverse ? formatsBefore : formatsAfter;
|
91135 |
-
|
91136 |
-
var newValue = _objectSpread({}, value, {
|
91137 |
-
start: newPos,
|
91138 |
-
end: newPos,
|
91139 |
-
activeFormats: newActiveFormats
|
91140 |
-
});
|
91141 |
-
|
91142 |
-
this.record = newValue;
|
91143 |
-
this.applyRecord(newValue);
|
91144 |
-
this.props.onSelectionChange(newPos, newPos);
|
91145 |
-
this.setState({
|
91146 |
-
activeFormats: newActiveFormats
|
91147 |
-
});
|
91148 |
}
|
91149 |
-
/**
|
91150 |
-
* Select object when they are clicked. The browser will not set any
|
91151 |
-
* selection when clicking e.g. an image.
|
91152 |
-
*
|
91153 |
-
* @param {WPSyntheticEvent} event Synthetic mousedown or touchstart event.
|
91154 |
-
*/
|
91155 |
|
91156 |
-
|
91157 |
-
|
91158 |
-
|
91159 |
-
|
|
|
|
|
91160 |
|
91161 |
-
|
91162 |
-
return;
|
91163 |
-
}
|
91164 |
|
91165 |
-
|
91166 |
-
|
91167 |
-
|
91168 |
-
|
91169 |
-
|
91170 |
-
|
91171 |
-
|
91172 |
-
|
91173 |
-
}
|
91174 |
-
}, {
|
91175 |
-
key: "componentDidUpdate",
|
91176 |
-
value: function componentDidUpdate(prevProps) {
|
91177 |
-
var _this$props8 = this.props,
|
91178 |
-
tagName = _this$props8.tagName,
|
91179 |
-
value = _this$props8.value,
|
91180 |
-
selectionStart = _this$props8.selectionStart,
|
91181 |
-
selectionEnd = _this$props8.selectionEnd,
|
91182 |
-
placeholder = _this$props8.placeholder,
|
91183 |
-
isSelected = _this$props8.__unstableIsSelected; // Check if tag name changed.
|
91184 |
|
91185 |
-
var shouldReapply = tagName !== prevProps.tagName; // Check if the content changed.
|
91186 |
|
91187 |
-
|
91188 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
91189 |
|
91190 |
-
shouldReapply = shouldReapply || isSelected && !prevProps.isSelected && selectionChanged;
|
91191 |
-
var prefix = 'format_prepare_props_';
|
91192 |
|
91193 |
-
|
91194 |
-
|
91195 |
-
|
91196 |
|
91197 |
-
|
91198 |
-
|
|
|
|
|
91199 |
|
91200 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
91201 |
|
91202 |
-
|
|
|
|
|
91203 |
|
91204 |
-
|
91205 |
-
|
91206 |
-
this.record = this.formatToValue(value);
|
91207 |
-
this.record.start = selectionStart;
|
91208 |
-
this.record.end = selectionEnd;
|
91209 |
-
this.applyRecord(this.record);
|
91210 |
-
} else if (selectionChanged) {
|
91211 |
-
this.record = _objectSpread({}, this.record, {
|
91212 |
-
start: selectionStart,
|
91213 |
-
end: selectionEnd
|
91214 |
-
});
|
91215 |
-
}
|
91216 |
}
|
91217 |
-
|
91218 |
-
|
91219 |
-
|
91220 |
-
|
91221 |
-
|
91222 |
-
|
|
|
91223 |
|
91224 |
-
}, {
|
91225 |
-
key: "formatToValue",
|
91226 |
-
value: function formatToValue(value) {
|
91227 |
-
var _this$props9 = this.props,
|
91228 |
-
format = _this$props9.format,
|
91229 |
-
multilineTag = _this$props9.__unstableMultilineTag,
|
91230 |
-
preserveWhiteSpace = _this$props9.preserveWhiteSpace,
|
91231 |
-
disableFormats = _this$props9.__unstableDisableFormats;
|
91232 |
-
|
91233 |
-
if (disableFormats) {
|
91234 |
-
return {
|
91235 |
-
text: value,
|
91236 |
-
formats: Array(value.length),
|
91237 |
-
replacements: Array(value.length)
|
91238 |
-
};
|
91239 |
-
}
|
91240 |
|
91241 |
-
|
91242 |
-
|
91243 |
-
}
|
91244 |
|
91245 |
-
|
91246 |
-
|
91247 |
-
html: value,
|
91248 |
-
multilineTag: multilineTag,
|
91249 |
-
multilineWrapperTags: multilineTag === 'li' ? ['ul', 'ol'] : undefined,
|
91250 |
-
preserveWhiteSpace: preserveWhiteSpace
|
91251 |
-
});
|
91252 |
-
value.formats = prepare(value);
|
91253 |
-
return value;
|
91254 |
}
|
91255 |
-
/**
|
91256 |
-
* Removes editor only formats from the value.
|
91257 |
-
*
|
91258 |
-
* Editor only formats are applied using `prepareEditableTree`, so we need to
|
91259 |
-
* remove them before converting the internal state
|
91260 |
-
*
|
91261 |
-
* @param {Object} value The internal rich-text value.
|
91262 |
-
* @return {Object} A new rich-text value.
|
91263 |
-
*/
|
91264 |
|
91265 |
-
|
91266 |
-
|
91267 |
-
|
91268 |
-
|
91269 |
-
|
91270 |
-
|
91271 |
-
|
91272 |
-
|
91273 |
-
|
91274 |
-
return value;
|
91275 |
-
}
|
91276 |
-
/**
|
91277 |
-
* Converts the internal value to the external data format.
|
91278 |
-
*
|
91279 |
-
* @param {Object} value The internal rich-text value.
|
91280 |
-
* @return {*} The external data format, data type depends on props.
|
91281 |
-
*/
|
91282 |
|
91283 |
-
|
91284 |
-
|
91285 |
-
|
91286 |
-
|
91287 |
-
|
91288 |
-
|
91289 |
-
|
91290 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
91291 |
|
91292 |
-
|
91293 |
-
|
91294 |
-
|
|
|
91295 |
|
91296 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
91297 |
|
91298 |
-
if (format !== 'string') {
|
91299 |
-
return;
|
91300 |
-
}
|
91301 |
|
91302 |
-
|
91303 |
-
|
91304 |
-
multilineTag: multilineTag,
|
91305 |
-
preserveWhiteSpace: preserveWhiteSpace
|
91306 |
-
});
|
91307 |
-
}
|
91308 |
-
}, {
|
91309 |
-
key: "Editable",
|
91310 |
-
value: function Editable(props) {
|
91311 |
-
var _this2 = this;
|
91312 |
|
91313 |
-
|
91314 |
-
|
91315 |
-
|
91316 |
-
style = _this$props11.style,
|
91317 |
-
className = _this$props11.className,
|
91318 |
-
placeholder = _this$props11.placeholder,
|
91319 |
-
forwardedRef = _this$props11.forwardedRef,
|
91320 |
-
disabled = _this$props11.disabled;
|
91321 |
-
var ariaProps = Object(__WEBPACK_IMPORTED_MODULE_10_lodash__["pickBy"])(this.props, function (value, key) {
|
91322 |
-
return Object(__WEBPACK_IMPORTED_MODULE_10_lodash__["startsWith"])(key, 'aria-');
|
91323 |
});
|
91324 |
-
|
91325 |
-
, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__["a" /* default */])({
|
91326 |
-
role: "textbox",
|
91327 |
-
"aria-multiline": true,
|
91328 |
-
"aria-label": placeholder
|
91329 |
-
}, props, ariaProps, {
|
91330 |
-
ref: forwardedRef,
|
91331 |
-
style: style ? _objectSpread({}, style, {
|
91332 |
-
whiteSpace: whiteSpace
|
91333 |
-
}) : defaultStyle,
|
91334 |
-
className: __WEBPACK_IMPORTED_MODULE_9_classnames___default()('rich-text', className),
|
91335 |
-
onPaste: this.onPaste,
|
91336 |
-
onInput: this.onInput,
|
91337 |
-
onCompositionStart: this.onCompositionStart,
|
91338 |
-
onCompositionEnd: this.onCompositionEnd,
|
91339 |
-
onKeyDown: props.onKeyDown ? function (event) {
|
91340 |
-
props.onKeyDown(event);
|
91341 |
-
|
91342 |
-
_this2.onKeyDown(event);
|
91343 |
-
} : this.onKeyDown,
|
91344 |
-
onFocus: this.onFocus,
|
91345 |
-
onBlur: this.onBlur,
|
91346 |
-
onMouseDown: this.onPointerDown,
|
91347 |
-
onTouchStart: this.onPointerDown // Selection updates must be done at these events as they
|
91348 |
-
// happen before the `selectionchange` event. In some cases,
|
91349 |
-
// the `selectionchange` event may not even fire, for
|
91350 |
-
// example when the window receives focus again on click.
|
91351 |
-
,
|
91352 |
-
onKeyUp: this.onSelectionChange,
|
91353 |
-
onMouseUp: this.onSelectionChange,
|
91354 |
-
onTouchEnd: this.onSelectionChange // Do not set the attribute if disabled.
|
91355 |
-
,
|
91356 |
-
contentEditable: disabled ? undefined : true,
|
91357 |
-
suppressContentEditableWarning: !disabled
|
91358 |
-
}));
|
91359 |
}
|
91360 |
-
}
|
91361 |
-
key: "render",
|
91362 |
-
value: function render() {
|
91363 |
-
var _this3 = this;
|
91364 |
|
91365 |
-
|
91366 |
-
|
91367 |
-
|
91368 |
-
allowedFormats = _this$props12.allowedFormats,
|
91369 |
-
withoutInteractiveFormatting = _this$props12.withoutInteractiveFormatting,
|
91370 |
-
formatTypes = _this$props12.formatTypes,
|
91371 |
-
forwardedRef = _this$props12.forwardedRef;
|
91372 |
-
var activeFormats = this.state.activeFormats;
|
91373 |
|
91374 |
-
|
91375 |
-
|
|
|
|
|
|
|
|
|
|
|
91376 |
|
91377 |
-
|
91378 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
91379 |
|
91380 |
-
|
91381 |
-
|
91382 |
-
|
91383 |
-
}
|
91384 |
-
|
91385 |
-
|
91386 |
-
|
91387 |
-
withoutInteractiveFormatting: withoutInteractiveFormatting,
|
91388 |
-
value: this.record,
|
91389 |
-
onChange: this.onChange,
|
91390 |
-
onFocus: onFocus,
|
91391 |
-
formatTypes: formatTypes
|
91392 |
-
}), children && children({
|
91393 |
-
isSelected: isSelected,
|
91394 |
-
value: this.record,
|
91395 |
-
onChange: this.onChange,
|
91396 |
-
onFocus: onFocus,
|
91397 |
-
Editable: this.Editable
|
91398 |
-
}), !children && Object(__WEBPACK_IMPORTED_MODULE_8__wordpress_element__["d" /* createElement */])(this.Editable, null));
|
91399 |
}
|
91400 |
-
}]);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
91401 |
|
91402 |
-
|
91403 |
-
|
|
|
|
|
91404 |
|
91405 |
-
|
91406 |
-
|
91407 |
-
|
91408 |
-
|
91409 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
91410 |
/**
|
91411 |
* Renders a rich content input, providing users with the option to format the
|
91412 |
* content.
|
91413 |
*/
|
91414 |
|
91415 |
-
|
91416 |
-
|
91417 |
-
forwardedRef: ref
|
91418 |
-
}));
|
91419 |
-
}));
|
91420 |
//# sourceMappingURL=index.js.map
|
91421 |
|
91422 |
/***/ }),
|
91423 |
-
/*
|
91424 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
91425 |
|
91426 |
"use strict";
|
91427 |
/* harmony export (immutable) */ __webpack_exports__["a"] = updateFormats;
|
91428 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__is_format_equal__ = __webpack_require__(
|
91429 |
/**
|
91430 |
* Internal dependencies
|
91431 |
*/
|
91432 |
|
|
|
|
|
91433 |
/**
|
91434 |
* Efficiently updates all the formats from `start` (including) until `end`
|
91435 |
* (excluding) with the active formats. Mutates `value`.
|
91436 |
*
|
91437 |
-
* @param {Object}
|
91438 |
-
* @param {
|
91439 |
-
* @param {number}
|
91440 |
-
* @param {number}
|
91441 |
-
* @param {Array}
|
91442 |
*
|
91443 |
-
* @return {
|
91444 |
*/
|
91445 |
|
91446 |
function updateFormats(_ref) {
|
@@ -91479,149 +95764,123 @@ function updateFormats(_ref) {
|
|
91479 |
//# sourceMappingURL=update-formats.js.map
|
91480 |
|
91481 |
/***/ }),
|
91482 |
-
/*
|
91483 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
91484 |
|
91485 |
"use strict";
|
91486 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] =
|
91487 |
-
/* harmony import */ var
|
91488 |
-
/* harmony import */ var
|
91489 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(15);
|
91490 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
91491 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
91492 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__wordpress_data__ = __webpack_require__(39);
|
91493 |
-
|
91494 |
-
|
91495 |
|
91496 |
|
91497 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
91498 |
|
91499 |
-
function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(
|
91500 |
-
|
91501 |
-
/**
|
91502 |
-
* External dependencies
|
91503 |
-
*/
|
91504 |
|
91505 |
/**
|
91506 |
* WordPress dependencies
|
91507 |
*/
|
91508 |
|
91509 |
|
91510 |
-
|
91511 |
-
|
91512 |
function formatTypesSelector(select) {
|
91513 |
return select('core/rich-text').getFormatTypes();
|
91514 |
}
|
91515 |
/**
|
91516 |
-
* This
|
91517 |
-
*
|
91518 |
-
*
|
91519 |
-
* @param {WPComponent} RichText The rich text component to add props for.
|
91520 |
*
|
91521 |
-
* @
|
|
|
|
|
91522 |
*/
|
91523 |
|
91524 |
|
91525 |
-
function
|
91526 |
-
|
91527 |
-
|
91528 |
-
|
91529 |
-
|
91530 |
-
|
91531 |
-
|
91532 |
-
|
91533 |
-
return acc;
|
91534 |
-
}
|
91535 |
-
|
91536 |
-
var selectPrefix = "format_prepare_props_(".concat(settings.name, ")_");
|
91537 |
-
return _objectSpread({}, acc, {}, Object(__WEBPACK_IMPORTED_MODULE_3_lodash__["mapKeys"])(settings.__experimentalGetPropsForEditableTreePreparation(select, {
|
91538 |
richTextIdentifier: identifier,
|
91539 |
blockClientId: clientId
|
91540 |
-
})
|
91541 |
-
|
91542 |
-
}));
|
91543 |
-
}, {});
|
91544 |
-
}, [formatTypes, clientId, identifier]);
|
91545 |
|
91546 |
-
|
91547 |
-
|
91548 |
-
|
91549 |
-
|
91550 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
91551 |
|
91552 |
-
|
91553 |
-
|
91554 |
-
|
91555 |
-
|
91556 |
-
|
91557 |
-
return dispatchPrefix + key;
|
91558 |
-
}));
|
91559 |
-
}, {});
|
91560 |
-
}, [formatTypes, clientId, identifier]);
|
91561 |
|
91562 |
-
|
91563 |
-
|
91564 |
-
|
91565 |
-
|
91566 |
-
|
|
|
|
|
91567 |
|
91568 |
-
|
|
|
91569 |
richTextIdentifier: identifier,
|
91570 |
blockClientId: clientId
|
91571 |
-
};
|
91572 |
-
|
91573 |
-
var combined = _objectSpread({}, selectProps, {}, dispatchProps);
|
91574 |
-
|
91575 |
-
var name = settings.name;
|
91576 |
-
var selectPrefix = "format_prepare_props_(".concat(name, ")_");
|
91577 |
-
var dispatchPrefix = "format_on_change_props_(".concat(name, ")_");
|
91578 |
-
var propsByPrefix = Object.keys(combined).reduce(function (accumulator, key) {
|
91579 |
-
if (key.startsWith(selectPrefix)) {
|
91580 |
-
accumulator[key.slice(selectPrefix.length)] = combined[key];
|
91581 |
-
}
|
91582 |
-
|
91583 |
-
if (key.startsWith(dispatchPrefix)) {
|
91584 |
-
accumulator[key.slice(dispatchPrefix.length)] = combined[key];
|
91585 |
-
}
|
91586 |
-
|
91587 |
-
return accumulator;
|
91588 |
-
}, {});
|
91589 |
-
|
91590 |
-
if (settings.__experimentalCreateOnChangeEditableValue) {
|
91591 |
-
var _objectSpread2;
|
91592 |
-
|
91593 |
-
return _objectSpread({}, acc, (_objectSpread2 = {}, Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(_objectSpread2, "format_value_functions_(".concat(name, ")"), settings.__experimentalCreatePrepareEditableTree(propsByPrefix, args)), Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(_objectSpread2, "format_on_change_functions_(".concat(name, ")"), settings.__experimentalCreateOnChangeEditableValue(propsByPrefix, args)), _objectSpread2));
|
91594 |
-
}
|
91595 |
|
91596 |
-
|
91597 |
-
|
91598 |
-
|
91599 |
-
|
91600 |
-
|
91601 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
91602 |
};
|
91603 |
}
|
91604 |
-
//# sourceMappingURL=
|
91605 |
|
91606 |
/***/ }),
|
91607 |
-
/*
|
91608 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
91609 |
|
91610 |
"use strict";
|
91611 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] =
|
91612 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
91613 |
/**
|
91614 |
* WordPress dependencies
|
91615 |
*/
|
91616 |
|
91617 |
-
|
91618 |
* Calculates and renders the format boundary style when the active formats
|
91619 |
* change.
|
91620 |
*/
|
91621 |
|
91622 |
-
function
|
91623 |
var activeFormats = _ref.activeFormats,
|
91624 |
-
|
91625 |
Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_element__["h" /* useEffect */])(function () {
|
91626 |
// There's no need to recalculate the boundary styles if no formats are
|
91627 |
// active, because no boundary styles will be visible.
|
@@ -91630,7 +95889,7 @@ function BoundaryStyle(_ref) {
|
|
91630 |
}
|
91631 |
|
91632 |
var boundarySelector = '*[data-rich-text-format-boundary]';
|
91633 |
-
var element =
|
91634 |
|
91635 |
if (!element) {
|
91636 |
return;
|
@@ -91656,26 +95915,25 @@ function BoundaryStyle(_ref) {
|
|
91656 |
globalStyle.innerHTML = style;
|
91657 |
}
|
91658 |
}, [activeFormats]);
|
91659 |
-
return null;
|
91660 |
}
|
91661 |
-
//# sourceMappingURL=boundary-style.js.map
|
91662 |
|
91663 |
/***/ }),
|
91664 |
-
/*
|
91665 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
91666 |
|
91667 |
"use strict";
|
91668 |
-
/* WEBPACK VAR INJECTION */(function(process) {/* harmony export (immutable) */ __webpack_exports__["a"] =
|
91669 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
91670 |
/**
|
91671 |
* WordPress dependencies
|
91672 |
*/
|
91673 |
|
91674 |
-
function
|
91675 |
-
var
|
91676 |
Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_element__["h" /* useEffect */])(function () {
|
91677 |
if (process.env.NODE_ENV === 'development') {
|
91678 |
-
var target =
|
91679 |
var defaultView = target.ownerDocument.defaultView;
|
91680 |
var computedStyle = defaultView.getComputedStyle(target);
|
91681 |
|
@@ -91685,13 +95943,12 @@ function InlineWarning(_ref) {
|
|
91685 |
}
|
91686 |
}
|
91687 |
}, []);
|
91688 |
-
return null;
|
91689 |
}
|
91690 |
-
//# sourceMappingURL=inline-warning.js.map
|
91691 |
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(20)))
|
91692 |
|
91693 |
/***/ }),
|
91694 |
-
/*
|
91695 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
91696 |
|
91697 |
"use strict";
|
@@ -91702,7 +95959,7 @@ Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
|
91702 |
/* harmony export (immutable) */ __webpack_exports__["findNext"] = findNext;
|
91703 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash__ = __webpack_require__(2);
|
91704 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_lodash__);
|
91705 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__focusable__ = __webpack_require__(
|
91706 |
/**
|
91707 |
* External dependencies
|
91708 |
*/
|
@@ -91859,9 +96116,8 @@ function find(context) {
|
|
91859 |
* to the active element.
|
91860 |
*/
|
91861 |
|
91862 |
-
function findPrevious() {
|
91863 |
-
var
|
91864 |
-
var focusables = Object(__WEBPACK_IMPORTED_MODULE_1__focusable__["find"])(document.body);
|
91865 |
var index = focusables.indexOf(element); // Remove all focusables after and including `element`.
|
91866 |
|
91867 |
focusables.length = index;
|
@@ -91874,9 +96130,8 @@ function findPrevious() {
|
|
91874 |
* to the active element.
|
91875 |
*/
|
91876 |
|
91877 |
-
function findNext() {
|
91878 |
-
var
|
91879 |
-
var focusables = Object(__WEBPACK_IMPORTED_MODULE_1__focusable__["find"])(document.body);
|
91880 |
var index = focusables.indexOf(element); // Remove all focusables before and inside `element`.
|
91881 |
|
91882 |
var remaining = focusables.slice(index + 1).filter(function (node) {
|
@@ -91887,7 +96142,7 @@ function findNext() {
|
|
91887 |
//# sourceMappingURL=tabbable.js.map
|
91888 |
|
91889 |
/***/ }),
|
91890 |
-
/*
|
91891 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
91892 |
|
91893 |
"use strict";
|
@@ -91899,6 +96154,8 @@ function findNext() {
|
|
91899 |
/* unused harmony export placeCaretAtVerticalEdge */
|
91900 |
/* unused harmony export isTextField */
|
91901 |
/* unused harmony export isNumberInput */
|
|
|
|
|
91902 |
/* unused harmony export documentHasSelection */
|
91903 |
/* unused harmony export isEntirelySelected */
|
91904 |
/* unused harmony export getScrollContainer */
|
@@ -91910,24 +96167,24 @@ function findNext() {
|
|
91910 |
/* unused harmony export replaceTag */
|
91911 |
/* unused harmony export wrap */
|
91912 |
/* unused harmony export __unstableStripHTML */
|
|
|
|
|
91913 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash__ = __webpack_require__(2);
|
91914 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_lodash__);
|
|
|
91915 |
/**
|
91916 |
* External dependencies
|
91917 |
*/
|
91918 |
|
91919 |
/**
|
91920 |
-
*
|
91921 |
*/
|
91922 |
|
91923 |
-
|
91924 |
-
|
91925 |
-
|
91926 |
-
|
91927 |
-
|
91928 |
-
ELEMENT_NODE = _window$Node.ELEMENT_NODE,
|
91929 |
-
DOCUMENT_POSITION_PRECEDING = _window$Node.DOCUMENT_POSITION_PRECEDING,
|
91930 |
-
DOCUMENT_POSITION_FOLLOWING = _window$Node.DOCUMENT_POSITION_FOLLOWING;
|
91931 |
/**
|
91932 |
* Returns true if the given selection object is in the forward direction, or
|
91933 |
* false otherwise.
|
@@ -91939,6 +96196,7 @@ var _window$Node = window.Node,
|
|
91939 |
* @return {boolean} Whether the selection is forward.
|
91940 |
*/
|
91941 |
|
|
|
91942 |
function isSelectionForward(selection) {
|
91943 |
var anchorNode = selection.anchorNode,
|
91944 |
focusNode = selection.focusNode,
|
@@ -91951,11 +96209,11 @@ function isSelectionForward(selection) {
|
|
91951 |
// Compare whether anchor node precedes focus node. If focus node (where
|
91952 |
// end of selection occurs) is after the anchor node, it is forward.
|
91953 |
|
91954 |
-
if (position & DOCUMENT_POSITION_PRECEDING) {
|
91955 |
return false;
|
91956 |
}
|
91957 |
|
91958 |
-
if (position & DOCUMENT_POSITION_FOLLOWING) {
|
91959 |
return true;
|
91960 |
}
|
91961 |
/* eslint-enable no-bitwise */
|
@@ -92000,7 +96258,9 @@ function isEdge(container, isReverse, onlyVertical) {
|
|
92000 |
return true;
|
92001 |
}
|
92002 |
|
92003 |
-
var
|
|
|
|
|
92004 |
|
92005 |
if (!selection.rangeCount) {
|
92006 |
return false;
|
@@ -92021,7 +96281,7 @@ function isEdge(container, isReverse, onlyVertical) {
|
|
92021 |
return false;
|
92022 |
}
|
92023 |
|
92024 |
-
var computedStyle =
|
92025 |
var lineHeight = parseInt(computedStyle.lineHeight, 10) || 0; // Only consider the multiline selection at the edge if the direction is
|
92026 |
// towards the edge.
|
92027 |
|
@@ -92057,7 +96317,7 @@ function isEdge(container, isReverse, onlyVertical) {
|
|
92057 |
|
92058 |
var x = isReverseDir ? containerRect.left + 1 : containerRect.right - 1;
|
92059 |
var y = isReverse ? containerRect.top + buffer : containerRect.bottom - buffer;
|
92060 |
-
var testRange = hiddenCaretRangeFromPoint(
|
92061 |
|
92062 |
if (!testRange) {
|
92063 |
return false;
|
@@ -92110,12 +96370,13 @@ function getRectangleFromRange(range) {
|
|
92110 |
}
|
92111 |
|
92112 |
var _range = range,
|
92113 |
-
startContainer = _range.startContainer;
|
|
|
92114 |
|
92115 |
if (startContainer.nodeName === 'BR') {
|
92116 |
var parentNode = startContainer.parentNode;
|
92117 |
var index = Array.from(parentNode.childNodes).indexOf(startContainer);
|
92118 |
-
range =
|
92119 |
range.setStart(parentNode, index);
|
92120 |
range.setEnd(parentNode, index);
|
92121 |
}
|
@@ -92127,7 +96388,7 @@ function getRectangleFromRange(range) {
|
|
92127 |
// See: https://stackoverflow.com/a/6847328/995445
|
92128 |
|
92129 |
if (!rect) {
|
92130 |
-
var padNode =
|
92131 |
|
92132 |
range = range.cloneRange();
|
92133 |
range.insertNode(padNode);
|
@@ -92140,11 +96401,13 @@ function getRectangleFromRange(range) {
|
|
92140 |
/**
|
92141 |
* Get the rectangle for the selection in a container.
|
92142 |
*
|
|
|
|
|
92143 |
* @return {?DOMRect} The rectangle.
|
92144 |
*/
|
92145 |
|
92146 |
-
function computeCaretRect() {
|
92147 |
-
var selection =
|
92148 |
var range = selection.rangeCount ? selection.getRangeAt(0) : null;
|
92149 |
|
92150 |
if (!range) {
|
@@ -92195,8 +96458,10 @@ function placeCaretAtHorizontalEdge(container, isReverse) {
|
|
92195 |
return;
|
92196 |
}
|
92197 |
|
92198 |
-
var
|
92199 |
-
var
|
|
|
|
|
92200 |
range.selectNodeContents(rangeTarget);
|
92201 |
range.collapse(!isReverse);
|
92202 |
selection.removeAllRanges();
|
@@ -92208,9 +96473,9 @@ function placeCaretAtHorizontalEdge(container, isReverse) {
|
|
92208 |
*
|
92209 |
* @see https://developer.mozilla.org/en-US/docs/Web/API/Document/caretRangeFromPoint
|
92210 |
*
|
92211 |
-
* @param {Document} doc
|
92212 |
-
* @param {number}
|
92213 |
-
* @param {number}
|
92214 |
*
|
92215 |
* @return {?Range} The best range for the given point.
|
92216 |
*/
|
@@ -92293,7 +96558,9 @@ function placeCaretAtVerticalEdge(container, isReverse, rect) {
|
|
92293 |
var editableRect = container.getBoundingClientRect();
|
92294 |
var x = rect.left;
|
92295 |
var y = isReverse ? editableRect.bottom - buffer : editableRect.top + buffer;
|
92296 |
-
var
|
|
|
|
|
92297 |
|
92298 |
if (!range || !container.contains(range.startContainer)) {
|
92299 |
if (mayUseScroll && (!range || !range.startContainer || !range.startContainer.contains(container))) {
|
@@ -92308,7 +96575,7 @@ function placeCaretAtVerticalEdge(container, isReverse, rect) {
|
|
92308 |
return;
|
92309 |
}
|
92310 |
|
92311 |
-
var selection =
|
92312 |
selection.removeAllRanges();
|
92313 |
selection.addRange(range);
|
92314 |
container.focus(); // Editable was already focussed, it goes back to old range...
|
@@ -92329,22 +96596,10 @@ function placeCaretAtVerticalEdge(container, isReverse, rect) {
|
|
92329 |
*/
|
92330 |
|
92331 |
function isTextField(element) {
|
92332 |
-
|
92333 |
-
|
92334 |
-
|
92335 |
-
|
92336 |
-
return nodeName === 'INPUT' && selectionStart !== null || nodeName === 'TEXTAREA' || contentEditable === 'true';
|
92337 |
-
} catch (error) {
|
92338 |
-
// Safari throws an exception when trying to get `selectionStart`
|
92339 |
-
// on non-text <input> elements (which, understandably, don't
|
92340 |
-
// have the text selection API). We catch this via a try/catch
|
92341 |
-
// block, as opposed to a more explicit check of the element's
|
92342 |
-
// input types, because of Safari's non-standard behavior. This
|
92343 |
-
// also means we don't have to worry about the list of input
|
92344 |
-
// types that support `selectionStart` changing as the HTML spec
|
92345 |
-
// evolves over time.
|
92346 |
-
return false;
|
92347 |
-
}
|
92348 |
}
|
92349 |
/**
|
92350 |
* Check whether the given element is an input field of type number
|
@@ -92362,24 +96617,82 @@ function isNumberInput(element) {
|
|
92362 |
return nodeName === 'INPUT' && type === 'number' && !!valueAsNumber;
|
92363 |
}
|
92364 |
/**
|
92365 |
-
* Check
|
92366 |
-
*
|
|
|
|
|
|
|
|
|
|
|
92367 |
*
|
92368 |
* @return {boolean} True if there is selection, false if not.
|
92369 |
*/
|
92370 |
|
92371 |
-
function
|
92372 |
-
|
92373 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
92374 |
}
|
92375 |
|
92376 |
-
|
92377 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
92378 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
92379 |
|
92380 |
-
|
92381 |
-
|
92382 |
-
return
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
92383 |
}
|
92384 |
/**
|
92385 |
* Check whether the contents of the element have been entirely selected.
|
@@ -92399,7 +96712,9 @@ function isEntirelySelected(element) {
|
|
92399 |
return true;
|
92400 |
}
|
92401 |
|
92402 |
-
var
|
|
|
|
|
92403 |
var range = selection.rangeCount ? selection.getRangeAt(0) : null;
|
92404 |
|
92405 |
if (!range) {
|
@@ -92416,7 +96731,7 @@ function isEntirelySelected(element) {
|
|
92416 |
}
|
92417 |
|
92418 |
var lastChild = element.lastChild;
|
92419 |
-
var lastChildContentLength = lastChild.nodeType === TEXT_NODE ? lastChild.data.length : lastChild.childNodes.length;
|
92420 |
return startContainer === element.firstChild && endContainer === element.lastChild && startOffset === 0 && endOffset === lastChildContentLength;
|
92421 |
}
|
92422 |
/**
|
@@ -92435,8 +96750,8 @@ function getScrollContainer(node) {
|
|
92435 |
|
92436 |
if (node.scrollHeight > node.clientHeight) {
|
92437 |
// ...except when overflow is defined to be hidden or visible
|
92438 |
-
var
|
92439 |
-
overflowY =
|
92440 |
|
92441 |
if (/(auto|scroll)/.test(overflowY)) {
|
92442 |
return node;
|
@@ -92464,7 +96779,7 @@ function getOffsetParent(node) {
|
|
92464 |
var closestElement;
|
92465 |
|
92466 |
while (closestElement = node.parentNode) {
|
92467 |
-
if (closestElement.nodeType === ELEMENT_NODE) {
|
92468 |
break;
|
92469 |
}
|
92470 |
}
|
@@ -92571,13 +96886,183 @@ function wrap(newNode, referenceNode) {
|
|
92571 |
*/
|
92572 |
|
92573 |
function __unstableStripHTML(html) {
|
92574 |
-
var document = new DOMParser().parseFromString(html, 'text/html');
|
92575 |
return document.body.textContent || '';
|
92576 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
92577 |
//# sourceMappingURL=dom.js.map
|
92578 |
|
92579 |
/***/ }),
|
92580 |
-
/*
|
92581 |
/***/ (function(module, exports, __webpack_require__) {
|
92582 |
|
92583 |
"use strict";
|
@@ -92635,7 +97120,7 @@ module.exports = isShallowEqualObjects;
|
|
92635 |
|
92636 |
|
92637 |
/***/ }),
|
92638 |
-
/*
|
92639 |
/***/ (function(module, exports, __webpack_require__) {
|
92640 |
|
92641 |
"use strict";
|
@@ -92673,15 +97158,15 @@ module.exports = isShallowEqualArrays;
|
|
92673 |
|
92674 |
|
92675 |
/***/ }),
|
92676 |
-
/*
|
92677 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
92678 |
|
92679 |
"use strict";
|
92680 |
/* unused harmony export computePopoverXAxisPosition */
|
92681 |
/* unused harmony export computePopoverYAxisPosition */
|
92682 |
/* harmony export (immutable) */ __webpack_exports__["a"] = computePopoverPosition;
|
92683 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(
|
92684 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(
|
92685 |
|
92686 |
|
92687 |
|
@@ -92846,7 +97331,7 @@ function computePopoverPosition(anchorRect, contentSize) {
|
|
92846 |
//# sourceMappingURL=utils.js.map
|
92847 |
|
92848 |
/***/ }),
|
92849 |
-
/*
|
92850 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
92851 |
|
92852 |
"use strict";
|
@@ -92855,7 +97340,7 @@ function computePopoverPosition(anchorRect, contentSize) {
|
|
92855 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
92856 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
92857 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
92858 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_react_click_outside__ = __webpack_require__(
|
92859 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_react_click_outside___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_5_react_click_outside__);
|
92860 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_element__ = __webpack_require__(1);
|
92861 |
|
@@ -92908,7 +97393,7 @@ function (_Component) {
|
|
92908 |
//# sourceMappingURL=detect-outside.js.map
|
92909 |
|
92910 |
/***/ }),
|
92911 |
-
/*
|
92912 |
/***/ (function(module, exports, __webpack_require__) {
|
92913 |
|
92914 |
"use strict";
|
@@ -92979,540 +97464,25 @@ function hoistNonReactStatics(targetComponent, sourceComponent, blacklist) {
|
|
92979 |
return targetComponent;
|
92980 |
}
|
92981 |
|
92982 |
-
module.exports = hoistNonReactStatics;
|
92983 |
-
|
92984 |
-
|
92985 |
-
/***/ }),
|
92986 |
-
/* 582 */
|
92987 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
92988 |
-
|
92989 |
-
"use strict";
|
92990 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
92991 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
92992 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
92993 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
92994 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
92995 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
92996 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(9);
|
92997 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(1);
|
92998 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
92999 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
93000 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__context__ = __webpack_require__(118);
|
93001 |
-
|
93002 |
-
|
93003 |
-
|
93004 |
-
|
93005 |
-
|
93006 |
-
|
93007 |
-
|
93008 |
-
|
93009 |
-
|
93010 |
-
/**
|
93011 |
-
* External dependencies
|
93012 |
-
*/
|
93013 |
-
|
93014 |
-
/**
|
93015 |
-
* WordPress dependencies
|
93016 |
-
*/
|
93017 |
-
|
93018 |
-
|
93019 |
-
/**
|
93020 |
-
* Internal dependencies
|
93021 |
-
*/
|
93022 |
-
|
93023 |
-
|
93024 |
-
|
93025 |
-
var SlotComponent =
|
93026 |
-
/*#__PURE__*/
|
93027 |
-
function (_Component) {
|
93028 |
-
Object(__WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__["a" /* default */])(SlotComponent, _Component);
|
93029 |
-
|
93030 |
-
function SlotComponent() {
|
93031 |
-
var _this;
|
93032 |
-
|
93033 |
-
Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__["a" /* default */])(this, SlotComponent);
|
93034 |
-
|
93035 |
-
_this = Object(__WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__["a" /* default */])(this, Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(SlotComponent).apply(this, arguments));
|
93036 |
-
_this.bindNode = _this.bindNode.bind(Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this)));
|
93037 |
-
return _this;
|
93038 |
-
}
|
93039 |
-
|
93040 |
-
Object(__WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__["a" /* default */])(SlotComponent, [{
|
93041 |
-
key: "componentDidMount",
|
93042 |
-
value: function componentDidMount() {
|
93043 |
-
var registerSlot = this.props.registerSlot;
|
93044 |
-
registerSlot(this.props.name, this);
|
93045 |
-
}
|
93046 |
-
}, {
|
93047 |
-
key: "componentWillUnmount",
|
93048 |
-
value: function componentWillUnmount() {
|
93049 |
-
var unregisterSlot = this.props.unregisterSlot;
|
93050 |
-
unregisterSlot(this.props.name, this);
|
93051 |
-
}
|
93052 |
-
}, {
|
93053 |
-
key: "componentDidUpdate",
|
93054 |
-
value: function componentDidUpdate(prevProps) {
|
93055 |
-
var _this$props = this.props,
|
93056 |
-
name = _this$props.name,
|
93057 |
-
unregisterSlot = _this$props.unregisterSlot,
|
93058 |
-
registerSlot = _this$props.registerSlot;
|
93059 |
-
|
93060 |
-
if (prevProps.name !== name) {
|
93061 |
-
unregisterSlot(prevProps.name);
|
93062 |
-
registerSlot(name, this);
|
93063 |
-
}
|
93064 |
-
}
|
93065 |
-
}, {
|
93066 |
-
key: "bindNode",
|
93067 |
-
value: function bindNode(node) {
|
93068 |
-
this.node = node;
|
93069 |
-
}
|
93070 |
-
}, {
|
93071 |
-
key: "render",
|
93072 |
-
value: function render() {
|
93073 |
-
var _this$props2 = this.props,
|
93074 |
-
children = _this$props2.children,
|
93075 |
-
name = _this$props2.name,
|
93076 |
-
_this$props2$bubblesV = _this$props2.bubblesVirtually,
|
93077 |
-
bubblesVirtually = _this$props2$bubblesV === void 0 ? false : _this$props2$bubblesV,
|
93078 |
-
_this$props2$fillProp = _this$props2.fillProps,
|
93079 |
-
fillProps = _this$props2$fillProp === void 0 ? {} : _this$props2$fillProp,
|
93080 |
-
getFills = _this$props2.getFills;
|
93081 |
-
|
93082 |
-
if (bubblesVirtually) {
|
93083 |
-
return Object(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["h" /* createElement */])("div", {
|
93084 |
-
ref: this.bindNode
|
93085 |
-
});
|
93086 |
-
}
|
93087 |
-
|
93088 |
-
var fills = Object(__WEBPACK_IMPORTED_MODULE_8_lodash__["map"])(getFills(name), function (fill) {
|
93089 |
-
var fillKey = fill.occurrence;
|
93090 |
-
var fillChildren = Object(__WEBPACK_IMPORTED_MODULE_8_lodash__["isFunction"])(fill.props.children) ? fill.props.children(fillProps) : fill.props.children;
|
93091 |
-
return __WEBPACK_IMPORTED_MODULE_7__wordpress_element__["a" /* Children */].map(fillChildren, function (child, childIndex) {
|
93092 |
-
if (!child || Object(__WEBPACK_IMPORTED_MODULE_8_lodash__["isString"])(child)) {
|
93093 |
-
return child;
|
93094 |
-
}
|
93095 |
-
|
93096 |
-
var childKey = "".concat(fillKey, "---").concat(child.key || childIndex);
|
93097 |
-
return Object(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["e" /* cloneElement */])(child, {
|
93098 |
-
key: childKey
|
93099 |
-
});
|
93100 |
-
});
|
93101 |
-
}).filter( // In some cases fills are rendered only when some conditions apply.
|
93102 |
-
// This ensures that we only use non-empty fills when rendering, i.e.,
|
93103 |
-
// it allows us to render wrappers only when the fills are actually present.
|
93104 |
-
Object(__WEBPACK_IMPORTED_MODULE_8_lodash__["negate"])(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["l" /* isEmptyElement */]));
|
93105 |
-
return Object(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["h" /* createElement */])(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["c" /* Fragment */], null, Object(__WEBPACK_IMPORTED_MODULE_8_lodash__["isFunction"])(children) ? children(fills) : fills);
|
93106 |
-
}
|
93107 |
-
}]);
|
93108 |
-
|
93109 |
-
return SlotComponent;
|
93110 |
-
}(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["b" /* Component */]);
|
93111 |
-
|
93112 |
-
var Slot = function Slot(props) {
|
93113 |
-
return Object(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["h" /* createElement */])(__WEBPACK_IMPORTED_MODULE_9__context__["a" /* Consumer */], null, function (_ref) {
|
93114 |
-
var registerSlot = _ref.registerSlot,
|
93115 |
-
unregisterSlot = _ref.unregisterSlot,
|
93116 |
-
getFills = _ref.getFills;
|
93117 |
-
return Object(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["h" /* createElement */])(SlotComponent, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__["a" /* default */])({}, props, {
|
93118 |
-
registerSlot: registerSlot,
|
93119 |
-
unregisterSlot: unregisterSlot,
|
93120 |
-
getFills: getFills
|
93121 |
-
}));
|
93122 |
-
});
|
93123 |
-
};
|
93124 |
-
|
93125 |
-
/* harmony default export */ __webpack_exports__["a"] = (Slot);
|
93126 |
-
//# sourceMappingURL=slot.js.map
|
93127 |
-
|
93128 |
-
/***/ }),
|
93129 |
-
/* 583 */
|
93130 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93131 |
-
|
93132 |
-
"use strict";
|
93133 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
93134 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
93135 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
93136 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
93137 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
93138 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
93139 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_element__ = __webpack_require__(1);
|
93140 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_lodash__ = __webpack_require__(2);
|
93141 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_7_lodash__);
|
93142 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__context__ = __webpack_require__(118);
|
93143 |
-
|
93144 |
-
|
93145 |
-
|
93146 |
-
|
93147 |
-
|
93148 |
-
|
93149 |
-
|
93150 |
-
|
93151 |
-
/**
|
93152 |
-
* External dependencies
|
93153 |
-
*/
|
93154 |
-
|
93155 |
-
/**
|
93156 |
-
* WordPress dependencies
|
93157 |
-
*/
|
93158 |
-
|
93159 |
-
|
93160 |
-
/**
|
93161 |
-
* Internal dependencies
|
93162 |
-
*/
|
93163 |
-
|
93164 |
-
|
93165 |
-
var occurrences = 0;
|
93166 |
-
|
93167 |
-
var FillComponent =
|
93168 |
-
/*#__PURE__*/
|
93169 |
-
function (_Component) {
|
93170 |
-
Object(__WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__["a" /* default */])(FillComponent, _Component);
|
93171 |
-
|
93172 |
-
function FillComponent() {
|
93173 |
-
var _this;
|
93174 |
-
|
93175 |
-
Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__["a" /* default */])(this, FillComponent);
|
93176 |
-
|
93177 |
-
_this = Object(__WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__["a" /* default */])(this, Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(FillComponent).apply(this, arguments));
|
93178 |
-
_this.occurrence = ++occurrences;
|
93179 |
-
return _this;
|
93180 |
-
}
|
93181 |
-
|
93182 |
-
Object(__WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__["a" /* default */])(FillComponent, [{
|
93183 |
-
key: "componentDidMount",
|
93184 |
-
value: function componentDidMount() {
|
93185 |
-
var registerFill = this.props.registerFill;
|
93186 |
-
registerFill(this.props.name, this);
|
93187 |
-
}
|
93188 |
-
}, {
|
93189 |
-
key: "componentWillUpdate",
|
93190 |
-
value: function componentWillUpdate() {
|
93191 |
-
if (!this.occurrence) {
|
93192 |
-
this.occurrence = ++occurrences;
|
93193 |
-
}
|
93194 |
-
|
93195 |
-
var getSlot = this.props.getSlot;
|
93196 |
-
var slot = getSlot(this.props.name);
|
93197 |
-
|
93198 |
-
if (slot && !slot.props.bubblesVirtually) {
|
93199 |
-
slot.forceUpdate();
|
93200 |
-
}
|
93201 |
-
}
|
93202 |
-
}, {
|
93203 |
-
key: "componentWillUnmount",
|
93204 |
-
value: function componentWillUnmount() {
|
93205 |
-
var unregisterFill = this.props.unregisterFill;
|
93206 |
-
unregisterFill(this.props.name, this);
|
93207 |
-
}
|
93208 |
-
}, {
|
93209 |
-
key: "componentDidUpdate",
|
93210 |
-
value: function componentDidUpdate(prevProps) {
|
93211 |
-
var _this$props = this.props,
|
93212 |
-
name = _this$props.name,
|
93213 |
-
unregisterFill = _this$props.unregisterFill,
|
93214 |
-
registerFill = _this$props.registerFill;
|
93215 |
-
|
93216 |
-
if (prevProps.name !== name) {
|
93217 |
-
unregisterFill(prevProps.name, this);
|
93218 |
-
registerFill(name, this);
|
93219 |
-
}
|
93220 |
-
}
|
93221 |
-
}, {
|
93222 |
-
key: "resetOccurrence",
|
93223 |
-
value: function resetOccurrence() {
|
93224 |
-
this.occurrence = null;
|
93225 |
-
}
|
93226 |
-
}, {
|
93227 |
-
key: "render",
|
93228 |
-
value: function render() {
|
93229 |
-
var _this$props2 = this.props,
|
93230 |
-
name = _this$props2.name,
|
93231 |
-
getSlot = _this$props2.getSlot;
|
93232 |
-
var children = this.props.children;
|
93233 |
-
var slot = getSlot(name);
|
93234 |
-
|
93235 |
-
if (!slot || !slot.props.bubblesVirtually) {
|
93236 |
-
return null;
|
93237 |
-
} // If a function is passed as a child, provide it with the fillProps.
|
93238 |
-
|
93239 |
-
|
93240 |
-
if (Object(__WEBPACK_IMPORTED_MODULE_7_lodash__["isFunction"])(children)) {
|
93241 |
-
children = children(slot.props.fillProps);
|
93242 |
-
}
|
93243 |
-
|
93244 |
-
return Object(__WEBPACK_IMPORTED_MODULE_6__wordpress_element__["i" /* createPortal */])(children, slot.node);
|
93245 |
-
}
|
93246 |
-
}]);
|
93247 |
-
|
93248 |
-
return FillComponent;
|
93249 |
-
}(__WEBPACK_IMPORTED_MODULE_6__wordpress_element__["b" /* Component */]);
|
93250 |
-
|
93251 |
-
var Fill = function Fill(props) {
|
93252 |
-
return Object(__WEBPACK_IMPORTED_MODULE_6__wordpress_element__["h" /* createElement */])(__WEBPACK_IMPORTED_MODULE_8__context__["a" /* Consumer */], null, function (_ref) {
|
93253 |
-
var getSlot = _ref.getSlot,
|
93254 |
-
registerFill = _ref.registerFill,
|
93255 |
-
unregisterFill = _ref.unregisterFill;
|
93256 |
-
return Object(__WEBPACK_IMPORTED_MODULE_6__wordpress_element__["h" /* createElement */])(FillComponent, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__["a" /* default */])({}, props, {
|
93257 |
-
getSlot: getSlot,
|
93258 |
-
registerFill: registerFill,
|
93259 |
-
unregisterFill: unregisterFill
|
93260 |
-
}));
|
93261 |
-
});
|
93262 |
-
};
|
93263 |
-
|
93264 |
-
/* harmony default export */ __webpack_exports__["a"] = (Fill);
|
93265 |
-
//# sourceMappingURL=fill.js.map
|
93266 |
-
|
93267 |
-
/***/ }),
|
93268 |
-
/* 584 */
|
93269 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93270 |
-
|
93271 |
-
"use strict";
|
93272 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = domReady;
|
93273 |
-
/**
|
93274 |
-
* @typedef {() => void} Callback
|
93275 |
-
*
|
93276 |
-
* TODO: Remove this typedef and inline `() => void` type.
|
93277 |
-
*
|
93278 |
-
* This typedef is used so that a descriptive type is provided in our
|
93279 |
-
* automatically generated documentation.
|
93280 |
-
*
|
93281 |
-
* An in-line type `() => void` would be preferable, but the generated
|
93282 |
-
* documentation is `null` in that case.
|
93283 |
-
*
|
93284 |
-
* @see https://github.com/WordPress/gutenberg/issues/18045
|
93285 |
-
*/
|
93286 |
-
|
93287 |
-
/**
|
93288 |
-
* Specify a function to execute when the DOM is fully loaded.
|
93289 |
-
*
|
93290 |
-
* @param {Callback} callback A function to execute after the DOM is ready.
|
93291 |
-
*
|
93292 |
-
* @example
|
93293 |
-
* ```js
|
93294 |
-
* import domReady from '@wordpress/dom-ready';
|
93295 |
-
*
|
93296 |
-
* domReady( function() {
|
93297 |
-
* //do something after DOM loads.
|
93298 |
-
* } );
|
93299 |
-
* ```
|
93300 |
-
*
|
93301 |
-
* @return {void}
|
93302 |
-
*/
|
93303 |
-
function domReady(callback) {
|
93304 |
-
if (document.readyState === 'complete' || // DOMContentLoaded + Images/Styles/etc loaded, so we call directly.
|
93305 |
-
document.readyState === 'interactive' // DOMContentLoaded fires at this point, so we call directly.
|
93306 |
-
) {
|
93307 |
-
return void callback();
|
93308 |
-
} // DOMContentLoaded has not fired yet, delay callback until then.
|
93309 |
-
|
93310 |
-
|
93311 |
-
document.addEventListener('DOMContentLoaded', callback);
|
93312 |
-
}
|
93313 |
-
//# sourceMappingURL=index.js.map
|
93314 |
-
|
93315 |
-
/***/ }),
|
93316 |
-
/* 585 */
|
93317 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93318 |
-
|
93319 |
-
"use strict";
|
93320 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = addContainer;
|
93321 |
-
/**
|
93322 |
-
* Build the live regions markup.
|
93323 |
-
*
|
93324 |
-
* @param {string} [ariaLive] Value for the 'aria-live' attribute; default: 'polite'.
|
93325 |
-
*
|
93326 |
-
* @return {HTMLDivElement} The ARIA live region HTML element.
|
93327 |
-
*/
|
93328 |
-
function addContainer() {
|
93329 |
-
var ariaLive = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 'polite';
|
93330 |
-
var container = document.createElement('div');
|
93331 |
-
container.id = "a11y-speak-".concat(ariaLive);
|
93332 |
-
container.className = 'a11y-speak-region';
|
93333 |
-
container.setAttribute('style', 'position: absolute;' + 'margin: -1px;' + 'padding: 0;' + 'height: 1px;' + 'width: 1px;' + 'overflow: hidden;' + 'clip: rect(1px, 1px, 1px, 1px);' + '-webkit-clip-path: inset(50%);' + 'clip-path: inset(50%);' + 'border: 0;' + 'word-wrap: normal !important;');
|
93334 |
-
container.setAttribute('aria-live', ariaLive);
|
93335 |
-
container.setAttribute('aria-relevant', 'additions text');
|
93336 |
-
container.setAttribute('aria-atomic', 'true');
|
93337 |
-
var _document = document,
|
93338 |
-
body = _document.body;
|
93339 |
-
|
93340 |
-
if (body) {
|
93341 |
-
body.appendChild(container);
|
93342 |
-
}
|
93343 |
-
|
93344 |
-
return container;
|
93345 |
-
}
|
93346 |
-
//# sourceMappingURL=add-container.js.map
|
93347 |
-
|
93348 |
-
/***/ }),
|
93349 |
-
/* 586 */
|
93350 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93351 |
-
|
93352 |
-
"use strict";
|
93353 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = clear;
|
93354 |
-
/**
|
93355 |
-
* Clear the a11y-speak-region elements.
|
93356 |
-
*/
|
93357 |
-
function clear() {
|
93358 |
-
var regions = document.getElementsByClassName('a11y-speak-region');
|
93359 |
-
|
93360 |
-
for (var i = 0; i < regions.length; i++) {
|
93361 |
-
regions[i].textContent = '';
|
93362 |
-
}
|
93363 |
-
}
|
93364 |
-
//# sourceMappingURL=clear.js.map
|
93365 |
-
|
93366 |
-
/***/ }),
|
93367 |
-
/* 587 */
|
93368 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93369 |
-
|
93370 |
-
"use strict";
|
93371 |
-
/* harmony export (immutable) */ __webpack_exports__["a"] = filterMessage;
|
93372 |
-
var previousMessage = '';
|
93373 |
-
/**
|
93374 |
-
* Filter the message to be announced to the screenreader.
|
93375 |
-
*
|
93376 |
-
* @param {string} message The message to be announced.
|
93377 |
-
*
|
93378 |
-
* @return {string} The filtered message.
|
93379 |
-
*/
|
93380 |
-
|
93381 |
-
function filterMessage(message) {
|
93382 |
-
/*
|
93383 |
-
* Strip HTML tags (if any) from the message string. Ideally, messages should
|
93384 |
-
* be simple strings, carefully crafted for specific use with A11ySpeak.
|
93385 |
-
* When re-using already existing strings this will ensure simple HTML to be
|
93386 |
-
* stripped out and replaced with a space. Browsers will collapse multiple
|
93387 |
-
* spaces natively.
|
93388 |
-
*/
|
93389 |
-
message = message.replace(/<[^<>]+>/g, ' ');
|
93390 |
-
|
93391 |
-
if (previousMessage === message) {
|
93392 |
-
message += "\xA0";
|
93393 |
-
}
|
93394 |
-
|
93395 |
-
previousMessage = message;
|
93396 |
-
return message;
|
93397 |
-
}
|
93398 |
-
//# sourceMappingURL=filter-message.js.map
|
93399 |
-
|
93400 |
-
/***/ }),
|
93401 |
-
/* 588 */
|
93402 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93403 |
-
|
93404 |
-
"use strict";
|
93405 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
93406 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
93407 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(1);
|
93408 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_classnames__ = __webpack_require__(13);
|
93409 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_classnames__);
|
93410 |
-
|
93411 |
-
|
93412 |
-
|
93413 |
-
|
93414 |
-
/**
|
93415 |
-
* External dependencies
|
93416 |
-
*/
|
93417 |
-
|
93418 |
-
|
93419 |
-
function ButtonGroup(_ref) {
|
93420 |
-
var className = _ref.className,
|
93421 |
-
props = Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__["a" /* default */])(_ref, ["className"]);
|
93422 |
-
|
93423 |
-
var classes = __WEBPACK_IMPORTED_MODULE_3_classnames___default()('components-button-group', className);
|
93424 |
-
return Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["h" /* createElement */])("div", Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__["a" /* default */])({}, props, {
|
93425 |
-
className: classes,
|
93426 |
-
role: "group"
|
93427 |
-
}));
|
93428 |
-
}
|
93429 |
-
|
93430 |
-
/* unused harmony default export */ var _unused_webpack_default_export = (ButtonGroup);
|
93431 |
-
//# sourceMappingURL=index.js.map
|
93432 |
-
|
93433 |
-
/***/ }),
|
93434 |
-
/* 589 */
|
93435 |
-
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93436 |
-
|
93437 |
-
"use strict";
|
93438 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
93439 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
93440 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(1);
|
93441 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_compose__ = __webpack_require__(18);
|
93442 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__base_control__ = __webpack_require__(40);
|
93443 |
-
|
93444 |
-
|
93445 |
-
|
93446 |
-
|
93447 |
-
/**
|
93448 |
-
* External dependencies
|
93449 |
-
*/
|
93450 |
-
|
93451 |
-
/**
|
93452 |
-
* Internal dependencies
|
93453 |
-
*/
|
93454 |
-
|
93455 |
-
|
93456 |
-
|
93457 |
-
function CheckboxControl(_ref) {
|
93458 |
-
var label = _ref.label,
|
93459 |
-
className = _ref.className,
|
93460 |
-
heading = _ref.heading,
|
93461 |
-
checked = _ref.checked,
|
93462 |
-
help = _ref.help,
|
93463 |
-
instanceId = _ref.instanceId,
|
93464 |
-
onChange = _ref.onChange,
|
93465 |
-
props = Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__["a" /* default */])(_ref, ["label", "className", "heading", "checked", "help", "instanceId", "onChange"]);
|
93466 |
-
|
93467 |
-
var id = "inspector-checkbox-control-".concat(instanceId);
|
93468 |
-
|
93469 |
-
var onChangeValue = function onChangeValue(event) {
|
93470 |
-
return onChange(event.target.checked);
|
93471 |
-
};
|
93472 |
-
|
93473 |
-
return Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["h" /* createElement */])(__WEBPACK_IMPORTED_MODULE_4__base_control__["a" /* default */], {
|
93474 |
-
label: heading,
|
93475 |
-
id: id,
|
93476 |
-
help: help,
|
93477 |
-
className: className
|
93478 |
-
}, Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["h" /* createElement */])("input", Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__["a" /* default */])({
|
93479 |
-
id: id,
|
93480 |
-
className: "components-checkbox-control__input",
|
93481 |
-
type: "checkbox",
|
93482 |
-
value: "1",
|
93483 |
-
onChange: onChangeValue,
|
93484 |
-
checked: checked,
|
93485 |
-
"aria-describedby": !!help ? id + '__help' : undefined
|
93486 |
-
}, props)), Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["h" /* createElement */])("label", {
|
93487 |
-
className: "components-checkbox-control__label",
|
93488 |
-
htmlFor: id
|
93489 |
-
}, label));
|
93490 |
-
}
|
93491 |
|
93492 |
-
/* unused harmony default export */ var _unused_webpack_default_export = (Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_compose__["d" /* withInstanceId */])(CheckboxControl));
|
93493 |
-
//# sourceMappingURL=index.js.map
|
93494 |
|
93495 |
/***/ }),
|
93496 |
-
/*
|
93497 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93498 |
|
93499 |
"use strict";
|
93500 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
93501 |
-
/* harmony import */ var
|
93502 |
-
/* harmony import */ var
|
93503 |
-
/* harmony import */ var
|
93504 |
-
/* harmony import */ var
|
93505 |
-
/* harmony import */ var
|
93506 |
-
/* harmony import */ var
|
93507 |
-
/* harmony import */ var
|
93508 |
-
/* harmony import */ var
|
93509 |
-
/* harmony import */ var
|
93510 |
-
/* harmony import */ var
|
93511 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10_classnames__ = __webpack_require__(13);
|
93512 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_10_classnames__);
|
93513 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__icon_button__ = __webpack_require__(35);
|
93514 |
-
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__button__ = __webpack_require__(34);
|
93515 |
-
|
93516 |
|
93517 |
|
93518 |
|
@@ -93526,7 +97496,6 @@ function CheckboxControl(_ref) {
|
|
93526 |
* External dependencies
|
93527 |
*/
|
93528 |
|
93529 |
-
|
93530 |
/**
|
93531 |
* WordPress dependencies
|
93532 |
*/
|
@@ -93538,1110 +97507,877 @@ function CheckboxControl(_ref) {
|
|
93538 |
|
93539 |
|
93540 |
|
93541 |
-
|
93542 |
-
var ClipboardButton =
|
93543 |
/*#__PURE__*/
|
93544 |
function (_Component) {
|
93545 |
-
Object(
|
93546 |
|
93547 |
-
function
|
93548 |
var _this;
|
93549 |
|
93550 |
-
Object(
|
93551 |
|
93552 |
-
_this = Object(
|
93553 |
-
_this.
|
93554 |
-
_this.onCopy = _this.onCopy.bind(Object(__WEBPACK_IMPORTED_MODULE_7__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(Object(__WEBPACK_IMPORTED_MODULE_7__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this)));
|
93555 |
-
_this.getText = _this.getText.bind(Object(__WEBPACK_IMPORTED_MODULE_7__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(Object(__WEBPACK_IMPORTED_MODULE_7__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this)));
|
93556 |
return _this;
|
93557 |
}
|
93558 |
|
93559 |
-
Object(
|
93560 |
key: "componentDidMount",
|
93561 |
value: function componentDidMount() {
|
93562 |
-
var
|
93563 |
-
|
93564 |
-
onCopy = this.onCopy;
|
93565 |
-
var button = container.firstChild;
|
93566 |
-
this.clipboard = new __WEBPACK_IMPORTED_MODULE_9_clipboard___default.a(button, {
|
93567 |
-
text: getText,
|
93568 |
-
container: container
|
93569 |
-
});
|
93570 |
-
this.clipboard.on('success', onCopy);
|
93571 |
}
|
93572 |
}, {
|
93573 |
key: "componentWillUnmount",
|
93574 |
value: function componentWillUnmount() {
|
93575 |
-
this.
|
93576 |
-
|
93577 |
-
clearTimeout(this.onCopyTimeout);
|
93578 |
-
}
|
93579 |
-
}, {
|
93580 |
-
key: "bindContainer",
|
93581 |
-
value: function bindContainer(container) {
|
93582 |
-
this.container = container;
|
93583 |
}
|
93584 |
}, {
|
93585 |
-
key: "
|
93586 |
-
value: function
|
93587 |
-
// Clearing selection will move focus back to the triggering button,
|
93588 |
-
// ensuring that it is not reset to the body, and further that it is
|
93589 |
-
// kept within the rendered node.
|
93590 |
-
args.clearSelection();
|
93591 |
var _this$props = this.props,
|
93592 |
-
|
93593 |
-
|
93594 |
-
|
93595 |
-
if (onCopy) {
|
93596 |
-
onCopy(); // For convenience and consistency, ClipboardButton offers to call
|
93597 |
-
// a secondary callback with delay. This is useful to reset
|
93598 |
-
// consumers' state, e.g. to revert a label from "Copied" to
|
93599 |
-
// "Copy".
|
93600 |
|
93601 |
-
|
93602 |
-
|
93603 |
-
|
93604 |
-
}
|
93605 |
}
|
93606 |
}
|
93607 |
}, {
|
93608 |
-
key: "
|
93609 |
-
value: function
|
93610 |
-
|
93611 |
-
|
93612 |
-
if ('function' === typeof text) {
|
93613 |
-
text = text();
|
93614 |
-
}
|
93615 |
-
|
93616 |
-
return text;
|
93617 |
}
|
93618 |
}, {
|
93619 |
key: "render",
|
93620 |
value: function render() {
|
93621 |
-
// Disable reason: Exclude from spread props passed to Button
|
93622 |
-
// eslint-disable-next-line no-unused-vars
|
93623 |
var _this$props2 = this.props,
|
93624 |
-
className = _this$props2.className,
|
93625 |
children = _this$props2.children,
|
93626 |
-
|
93627 |
-
|
93628 |
-
|
93629 |
-
|
|
|
|
|
93630 |
|
93631 |
-
|
93632 |
-
|
93633 |
-
|
93634 |
-
|
93635 |
-
|
93636 |
-
// mistakenly override the ClipboardButton, and copy a serialized string
|
93637 |
-
// of the current block instead.
|
93638 |
|
93639 |
-
var
|
93640 |
-
|
93641 |
-
|
|
|
|
|
|
|
|
|
93642 |
|
93643 |
-
|
93644 |
-
|
93645 |
-
|
93646 |
-
|
93647 |
-
|
93648 |
-
})
|
|
|
|
|
|
|
|
|
93649 |
}
|
93650 |
}]);
|
93651 |
|
93652 |
-
return
|
93653 |
-
}(
|
93654 |
|
93655 |
-
|
93656 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
93657 |
|
93658 |
-
|
93659 |
-
|
93660 |
-
/***/ (function(module, exports, __webpack_require__) {
|
93661 |
|
93662 |
-
|
93663 |
-
|
93664 |
-
|
93665 |
-
*
|
93666 |
-
* Licensed MIT © Zeno Rocha
|
93667 |
-
*/
|
93668 |
-
(function webpackUniversalModuleDefinition(root, factory) {
|
93669 |
-
if(true)
|
93670 |
-
module.exports = factory();
|
93671 |
-
else if(typeof define === 'function' && define.amd)
|
93672 |
-
define([], factory);
|
93673 |
-
else if(typeof exports === 'object')
|
93674 |
-
exports["ClipboardJS"] = factory();
|
93675 |
-
else
|
93676 |
-
root["ClipboardJS"] = factory();
|
93677 |
-
})(this, function() {
|
93678 |
-
return /******/ (function(modules) { // webpackBootstrap
|
93679 |
-
/******/ // The module cache
|
93680 |
-
/******/ var installedModules = {};
|
93681 |
-
/******/
|
93682 |
-
/******/ // The require function
|
93683 |
-
/******/ function __webpack_require__(moduleId) {
|
93684 |
-
/******/
|
93685 |
-
/******/ // Check if module is in cache
|
93686 |
-
/******/ if(installedModules[moduleId]) {
|
93687 |
-
/******/ return installedModules[moduleId].exports;
|
93688 |
-
/******/ }
|
93689 |
-
/******/ // Create a new module (and put it into the cache)
|
93690 |
-
/******/ var module = installedModules[moduleId] = {
|
93691 |
-
/******/ i: moduleId,
|
93692 |
-
/******/ l: false,
|
93693 |
-
/******/ exports: {}
|
93694 |
-
/******/ };
|
93695 |
-
/******/
|
93696 |
-
/******/ // Execute the module function
|
93697 |
-
/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
|
93698 |
-
/******/
|
93699 |
-
/******/ // Flag the module as loaded
|
93700 |
-
/******/ module.l = true;
|
93701 |
-
/******/
|
93702 |
-
/******/ // Return the exports of the module
|
93703 |
-
/******/ return module.exports;
|
93704 |
-
/******/ }
|
93705 |
-
/******/
|
93706 |
-
/******/
|
93707 |
-
/******/ // expose the modules object (__webpack_modules__)
|
93708 |
-
/******/ __webpack_require__.m = modules;
|
93709 |
-
/******/
|
93710 |
-
/******/ // expose the module cache
|
93711 |
-
/******/ __webpack_require__.c = installedModules;
|
93712 |
-
/******/
|
93713 |
-
/******/ // define getter function for harmony exports
|
93714 |
-
/******/ __webpack_require__.d = function(exports, name, getter) {
|
93715 |
-
/******/ if(!__webpack_require__.o(exports, name)) {
|
93716 |
-
/******/ Object.defineProperty(exports, name, { enumerable: true, get: getter });
|
93717 |
-
/******/ }
|
93718 |
-
/******/ };
|
93719 |
-
/******/
|
93720 |
-
/******/ // define __esModule on exports
|
93721 |
-
/******/ __webpack_require__.r = function(exports) {
|
93722 |
-
/******/ if(typeof Symbol !== 'undefined' && Symbol.toStringTag) {
|
93723 |
-
/******/ Object.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });
|
93724 |
-
/******/ }
|
93725 |
-
/******/ Object.defineProperty(exports, '__esModule', { value: true });
|
93726 |
-
/******/ };
|
93727 |
-
/******/
|
93728 |
-
/******/ // create a fake namespace object
|
93729 |
-
/******/ // mode & 1: value is a module id, require it
|
93730 |
-
/******/ // mode & 2: merge all properties of value into the ns
|
93731 |
-
/******/ // mode & 4: return value when already ns object
|
93732 |
-
/******/ // mode & 8|1: behave like require
|
93733 |
-
/******/ __webpack_require__.t = function(value, mode) {
|
93734 |
-
/******/ if(mode & 1) value = __webpack_require__(value);
|
93735 |
-
/******/ if(mode & 8) return value;
|
93736 |
-
/******/ if((mode & 4) && typeof value === 'object' && value && value.__esModule) return value;
|
93737 |
-
/******/ var ns = Object.create(null);
|
93738 |
-
/******/ __webpack_require__.r(ns);
|
93739 |
-
/******/ Object.defineProperty(ns, 'default', { enumerable: true, value: value });
|
93740 |
-
/******/ if(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key));
|
93741 |
-
/******/ return ns;
|
93742 |
-
/******/ };
|
93743 |
-
/******/
|
93744 |
-
/******/ // getDefaultExport function for compatibility with non-harmony modules
|
93745 |
-
/******/ __webpack_require__.n = function(module) {
|
93746 |
-
/******/ var getter = module && module.__esModule ?
|
93747 |
-
/******/ function getDefault() { return module['default']; } :
|
93748 |
-
/******/ function getModuleExports() { return module; };
|
93749 |
-
/******/ __webpack_require__.d(getter, 'a', getter);
|
93750 |
-
/******/ return getter;
|
93751 |
-
/******/ };
|
93752 |
-
/******/
|
93753 |
-
/******/ // Object.prototype.hasOwnProperty.call
|
93754 |
-
/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };
|
93755 |
-
/******/
|
93756 |
-
/******/ // __webpack_public_path__
|
93757 |
-
/******/ __webpack_require__.p = "";
|
93758 |
-
/******/
|
93759 |
-
/******/
|
93760 |
-
/******/ // Load entry module and return exports
|
93761 |
-
/******/ return __webpack_require__(__webpack_require__.s = 6);
|
93762 |
-
/******/ })
|
93763 |
-
/************************************************************************/
|
93764 |
-
/******/ ([
|
93765 |
-
/* 0 */
|
93766 |
-
/***/ (function(module, exports) {
|
93767 |
|
93768 |
-
|
93769 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
93770 |
|
93771 |
-
if (element.nodeName === 'SELECT') {
|
93772 |
-
element.focus();
|
93773 |
|
93774 |
-
selectedText = element.value;
|
93775 |
-
}
|
93776 |
-
else if (element.nodeName === 'INPUT' || element.nodeName === 'TEXTAREA') {
|
93777 |
-
var isReadOnly = element.hasAttribute('readonly');
|
93778 |
|
93779 |
-
if (!isReadOnly) {
|
93780 |
-
element.setAttribute('readonly', '');
|
93781 |
-
}
|
93782 |
|
93783 |
-
element.select();
|
93784 |
-
element.setSelectionRange(0, element.value.length);
|
93785 |
|
93786 |
-
if (!isReadOnly) {
|
93787 |
-
element.removeAttribute('readonly');
|
93788 |
-
}
|
93789 |
|
93790 |
-
selectedText = element.value;
|
93791 |
-
}
|
93792 |
-
else {
|
93793 |
-
if (element.hasAttribute('contenteditable')) {
|
93794 |
-
element.focus();
|
93795 |
-
}
|
93796 |
|
93797 |
-
var selection = window.getSelection();
|
93798 |
-
var range = document.createRange();
|
93799 |
|
93800 |
-
|
93801 |
-
|
93802 |
-
|
93803 |
|
93804 |
-
|
93805 |
-
|
|
|
93806 |
|
93807 |
-
return selectedText;
|
93808 |
-
}
|
93809 |
|
93810 |
-
|
|
|
|
|
93811 |
|
93812 |
|
93813 |
-
|
93814 |
-
/* 1 */
|
93815 |
-
/***/ (function(module, exports) {
|
93816 |
|
93817 |
-
|
93818 |
-
|
93819 |
-
|
93820 |
-
|
93821 |
|
93822 |
-
|
93823 |
-
|
93824 |
-
var e = this.e || (this.e = {});
|
93825 |
|
93826 |
-
(
|
93827 |
-
fn: callback,
|
93828 |
-
ctx: ctx
|
93829 |
-
});
|
93830 |
|
93831 |
-
|
93832 |
-
|
|
|
|
|
93833 |
|
93834 |
-
|
93835 |
-
|
93836 |
-
function
|
93837 |
-
|
93838 |
-
|
93839 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
93840 |
|
93841 |
-
|
93842 |
-
|
93843 |
-
},
|
93844 |
|
93845 |
-
|
93846 |
-
|
93847 |
-
|
93848 |
-
|
93849 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
93850 |
|
93851 |
-
|
93852 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
93853 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
93854 |
|
93855 |
-
|
93856 |
-
|
|
|
93857 |
|
93858 |
-
off: function (name, callback) {
|
93859 |
-
var e = this.e || (this.e = {});
|
93860 |
-
var evts = e[name];
|
93861 |
-
var liveEvents = [];
|
93862 |
|
93863 |
-
|
93864 |
-
|
93865 |
-
if (evts[i].fn !== callback && evts[i].fn._ !== callback)
|
93866 |
-
liveEvents.push(evts[i]);
|
93867 |
}
|
93868 |
-
}
|
93869 |
|
93870 |
-
|
93871 |
-
|
93872 |
-
|
93873 |
|
93874 |
-
|
93875 |
-
|
93876 |
-
: delete e[name];
|
93877 |
|
93878 |
-
|
93879 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
93880 |
};
|
93881 |
|
93882 |
-
|
93883 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
93884 |
|
93885 |
|
|
|
|
|
|
|
|
|
93886 |
/***/ }),
|
93887 |
-
/*
|
93888 |
-
/***/ (function(module,
|
93889 |
|
93890 |
-
|
93891 |
-
|
|
|
|
|
|
|
|
|
93892 |
|
93893 |
/**
|
93894 |
-
*
|
93895 |
-
* listener function based on its target type.
|
93896 |
*
|
93897 |
-
*
|
93898 |
-
*
|
93899 |
-
*
|
93900 |
-
* @return {
|
93901 |
*/
|
93902 |
-
function listen(target, type, callback) {
|
93903 |
-
if (!target && !type && !callback) {
|
93904 |
-
throw new Error('Missing required arguments');
|
93905 |
-
}
|
93906 |
|
93907 |
-
|
93908 |
-
|
93909 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
93910 |
|
93911 |
-
|
93912 |
-
|
93913 |
-
|
93914 |
|
93915 |
-
|
93916 |
-
return listenNode(target, type, callback);
|
93917 |
-
}
|
93918 |
-
else if (is.nodeList(target)) {
|
93919 |
-
return listenNodeList(target, type, callback);
|
93920 |
-
}
|
93921 |
-
else if (is.string(target)) {
|
93922 |
-
return listenSelector(target, type, callback);
|
93923 |
-
}
|
93924 |
-
else {
|
93925 |
-
throw new TypeError('First argument must be a String, HTMLElement, HTMLCollection, or NodeList');
|
93926 |
-
}
|
93927 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
93928 |
|
|
|
|
|
|
|
|
|
|
|
|
|
93929 |
/**
|
93930 |
-
*
|
93931 |
-
* and returns a remove listener function.
|
93932 |
-
*
|
93933 |
-
* @param {HTMLElement} node
|
93934 |
-
* @param {String} type
|
93935 |
-
* @param {Function} callback
|
93936 |
-
* @return {Object}
|
93937 |
*/
|
93938 |
-
function listenNode(node, type, callback) {
|
93939 |
-
node.addEventListener(type, callback);
|
93940 |
|
93941 |
-
return {
|
93942 |
-
destroy: function() {
|
93943 |
-
node.removeEventListener(type, callback);
|
93944 |
-
}
|
93945 |
-
}
|
93946 |
-
}
|
93947 |
|
93948 |
/**
|
93949 |
-
*
|
93950 |
-
*
|
|
|
93951 |
*
|
93952 |
-
* @param {
|
93953 |
-
* @param {String} type
|
93954 |
-
* @param {Function} callback
|
93955 |
-
* @return {Object}
|
93956 |
*/
|
93957 |
-
function listenNodeList(nodeList, type, callback) {
|
93958 |
-
Array.prototype.forEach.call(nodeList, function(node) {
|
93959 |
-
node.addEventListener(type, callback);
|
93960 |
-
});
|
93961 |
|
93962 |
-
|
93963 |
-
destroy: function() {
|
93964 |
-
Array.prototype.forEach.call(nodeList, function(node) {
|
93965 |
-
node.removeEventListener(type, callback);
|
93966 |
-
});
|
93967 |
-
}
|
93968 |
-
}
|
93969 |
-
}
|
93970 |
|
93971 |
/**
|
93972 |
-
*
|
93973 |
-
*
|
93974 |
*
|
93975 |
-
* @param {
|
93976 |
-
* @param {
|
93977 |
-
*
|
93978 |
-
* @
|
|
|
|
|
93979 |
*/
|
93980 |
-
function listenSelector(selector, type, callback) {
|
93981 |
-
return delegate(document.body, selector, type, callback);
|
93982 |
-
}
|
93983 |
|
93984 |
-
|
|
|
|
|
|
|
|
|
93985 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
93986 |
|
93987 |
/***/ }),
|
93988 |
-
/*
|
93989 |
-
/***/ (function(module,
|
93990 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
93991 |
/**
|
93992 |
-
*
|
93993 |
-
*
|
93994 |
-
* @param {Object} value
|
93995 |
-
* @return {Boolean}
|
93996 |
*/
|
93997 |
-
exports.node = function(value) {
|
93998 |
-
return value !== undefined
|
93999 |
-
&& value instanceof HTMLElement
|
94000 |
-
&& value.nodeType === 1;
|
94001 |
-
};
|
94002 |
|
94003 |
-
|
94004 |
-
|
94005 |
-
*
|
94006 |
-
*
|
94007 |
-
* @return {Boolean}
|
94008 |
*/
|
94009 |
-
exports.nodeList = function(value) {
|
94010 |
-
var type = Object.prototype.toString.call(value);
|
94011 |
-
|
94012 |
-
return value !== undefined
|
94013 |
-
&& (type === '[object NodeList]' || type === '[object HTMLCollection]')
|
94014 |
-
&& ('length' in value)
|
94015 |
-
&& (value.length === 0 || exports.node(value[0]));
|
94016 |
-
};
|
94017 |
|
94018 |
/**
|
94019 |
-
*
|
94020 |
-
*
|
94021 |
-
* @param {Object} value
|
94022 |
-
* @return {Boolean}
|
94023 |
*/
|
94024 |
-
exports.string = function(value) {
|
94025 |
-
return typeof value === 'string'
|
94026 |
-
|| value instanceof String;
|
94027 |
-
};
|
94028 |
|
94029 |
/**
|
94030 |
-
*
|
|
|
94031 |
*
|
94032 |
-
* @
|
94033 |
-
*
|
|
|
|
|
94034 |
*/
|
94035 |
-
exports.fn = function(value) {
|
94036 |
-
var type = Object.prototype.toString.call(value);
|
94037 |
-
|
94038 |
-
return type === '[object Function]';
|
94039 |
-
};
|
94040 |
-
|
94041 |
-
|
94042 |
-
/***/ }),
|
94043 |
-
/* 4 */
|
94044 |
-
/***/ (function(module, exports, __webpack_require__) {
|
94045 |
-
|
94046 |
-
var closest = __webpack_require__(5);
|
94047 |
|
|
|
94048 |
/**
|
94049 |
-
*
|
94050 |
*
|
94051 |
-
* @
|
94052 |
-
*
|
94053 |
-
* @param {
|
94054 |
-
* @param {
|
94055 |
-
*
|
94056 |
-
* @return {
|
94057 |
*/
|
94058 |
-
function _delegate(element, selector, type, callback, useCapture) {
|
94059 |
-
var listenerFn = listener.apply(this, arguments);
|
94060 |
-
|
94061 |
-
element.addEventListener(type, listenerFn, useCapture);
|
94062 |
-
|
94063 |
-
return {
|
94064 |
-
destroy: function() {
|
94065 |
-
element.removeEventListener(type, listenerFn, useCapture);
|
94066 |
-
}
|
94067 |
-
}
|
94068 |
-
}
|
94069 |
|
|
|
94070 |
/**
|
94071 |
-
*
|
94072 |
*
|
94073 |
-
* @
|
94074 |
-
*
|
94075 |
-
* @param {
|
94076 |
-
* @param {
|
94077 |
-
* @param {
|
94078 |
-
*
|
|
|
94079 |
*/
|
94080 |
-
function delegate(elements, selector, type, callback, useCapture) {
|
94081 |
-
// Handle the regular Element usage
|
94082 |
-
if (typeof elements.addEventListener === 'function') {
|
94083 |
-
return _delegate.apply(null, arguments);
|
94084 |
-
}
|
94085 |
-
|
94086 |
-
// Handle Element-less usage, it defaults to global delegation
|
94087 |
-
if (typeof type === 'function') {
|
94088 |
-
// Use `document` as the first parameter, then apply arguments
|
94089 |
-
// This is a short way to .unshift `arguments` without running into deoptimizations
|
94090 |
-
return _delegate.bind(null, document).apply(null, arguments);
|
94091 |
-
}
|
94092 |
-
|
94093 |
-
// Handle Selector-based usage
|
94094 |
-
if (typeof elements === 'string') {
|
94095 |
-
elements = document.querySelectorAll(elements);
|
94096 |
-
}
|
94097 |
-
|
94098 |
-
// Handle Array-like based usage
|
94099 |
-
return Array.prototype.map.call(elements, function (element) {
|
94100 |
-
return _delegate(element, selector, type, callback, useCapture);
|
94101 |
-
});
|
94102 |
-
}
|
94103 |
|
|
|
94104 |
/**
|
94105 |
-
*
|
|
|
94106 |
*
|
94107 |
-
* @
|
94108 |
-
*
|
94109 |
-
* @param {
|
94110 |
-
* @param {
|
94111 |
-
* @
|
|
|
|
|
|
|
|
|
94112 |
*/
|
94113 |
-
function listener(element, selector, type, callback) {
|
94114 |
-
return function(e) {
|
94115 |
-
e.delegateTarget = closest(e.target, selector);
|
94116 |
-
|
94117 |
-
if (e.delegateTarget) {
|
94118 |
-
callback.call(element, e);
|
94119 |
-
}
|
94120 |
-
}
|
94121 |
-
}
|
94122 |
-
|
94123 |
-
module.exports = delegate;
|
94124 |
-
|
94125 |
-
|
94126 |
-
/***/ }),
|
94127 |
-
/* 5 */
|
94128 |
-
/***/ (function(module, exports) {
|
94129 |
-
|
94130 |
-
var DOCUMENT_NODE_TYPE = 9;
|
94131 |
|
|
|
94132 |
/**
|
94133 |
-
*
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
94134 |
*/
|
94135 |
-
if (typeof Element !== 'undefined' && !Element.prototype.matches) {
|
94136 |
-
var proto = Element.prototype;
|
94137 |
-
|
94138 |
-
proto.matches = proto.matchesSelector ||
|
94139 |
-
proto.mozMatchesSelector ||
|
94140 |
-
proto.msMatchesSelector ||
|
94141 |
-
proto.oMatchesSelector ||
|
94142 |
-
proto.webkitMatchesSelector;
|
94143 |
-
}
|
94144 |
|
|
|
94145 |
/**
|
94146 |
-
*
|
94147 |
*
|
94148 |
-
*
|
94149 |
-
*
|
94150 |
-
*
|
|
|
|
|
|
|
94151 |
*/
|
94152 |
-
function closest (element, selector) {
|
94153 |
-
while (element && element.nodeType !== DOCUMENT_NODE_TYPE) {
|
94154 |
-
if (typeof element.matches === 'function' &&
|
94155 |
-
element.matches(selector)) {
|
94156 |
-
return element;
|
94157 |
-
}
|
94158 |
-
element = element.parentNode;
|
94159 |
-
}
|
94160 |
-
}
|
94161 |
-
|
94162 |
-
module.exports = closest;
|
94163 |
|
|
|
|
|
94164 |
|
94165 |
/***/ }),
|
94166 |
-
/*
|
94167 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
94168 |
|
94169 |
"use strict";
|
94170 |
-
|
94171 |
-
|
94172 |
-
// EXTERNAL MODULE: ./node_modules/select/src/select.js
|
94173 |
-
var src_select = __webpack_require__(0);
|
94174 |
-
var select_default = /*#__PURE__*/__webpack_require__.n(src_select);
|
94175 |
-
|
94176 |
-
// CONCATENATED MODULE: ./src/clipboard-action.js
|
94177 |
-
var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
|
94178 |
-
|
94179 |
-
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
94180 |
-
|
94181 |
-
function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
|
94182 |
-
|
94183 |
-
|
94184 |
-
|
94185 |
/**
|
94186 |
-
*
|
94187 |
-
*
|
|
|
|
|
|
|
94188 |
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
94189 |
|
94190 |
-
var clipboard_action_ClipboardAction = function () {
|
94191 |
-
/**
|
94192 |
-
* @param {Object} options
|
94193 |
-
*/
|
94194 |
-
function ClipboardAction(options) {
|
94195 |
-
_classCallCheck(this, ClipboardAction);
|
94196 |
-
|
94197 |
-
this.resolveOptions(options);
|
94198 |
-
this.initSelection();
|
94199 |
-
}
|
94200 |
-
|
94201 |
-
/**
|
94202 |
-
* Defines base properties passed from constructor.
|
94203 |
-
* @param {Object} options
|
94204 |
-
*/
|
94205 |
-
|
94206 |
-
|
94207 |
-
_createClass(ClipboardAction, [{
|
94208 |
-
key:
|
60 |
/******/ __webpack_require__.p = "";
|
61 |
/******/
|
62 |
/******/ // Load entry module and return exports
|
63 |
+
/******/ return __webpack_require__(__webpack_require__.s = 444);
|
64 |
/******/ })
|
65 |
/************************************************************************/
|
66 |
/******/ ([
|
68 |
/***/ (function(module, exports, __webpack_require__) {
|
69 |
|
70 |
/* WEBPACK VAR INJECTION */(function(module) {var require;//! moment.js
|
71 |
+
//! version : 2.29.1
|
72 |
//! authors : Tim Wood, Iskren Chernev, Moment.js contributors
|
73 |
//! license : MIT
|
74 |
//! momentjs.com
|
2158 |
try {
|
2159 |
oldLocale = globalLocale._abbr;
|
2160 |
aliasedRequire = require;
|
2161 |
+
__webpack_require__(679)("./" + name);
|
2162 |
getSetGlobalLocale(oldLocale);
|
2163 |
} catch (e) {
|
2164 |
// mark as not found to avoid repeating expensive file require call causing high CPU
|
2609 |
hooks.createFromInputFallback = deprecate(
|
2610 |
'value provided is not in a recognized RFC2822 or ISO format. moment construction falls back to js Date(), ' +
|
2611 |
'which is not reliable across all browsers and versions. Non RFC2822/ISO date formats are ' +
|
2612 |
+
'discouraged. Please refer to http://momentjs.com/guides/#/warnings/js-date/ for more info.',
|
|
|
2613 |
function (config) {
|
2614 |
config._d = new Date(config._i + (config._useUTC ? ' UTC' : ''));
|
2615 |
}
|
3794 |
function calendar$1(time, formats) {
|
3795 |
// Support for single parameter, formats only overload to the calendar function
|
3796 |
if (arguments.length === 1) {
|
3797 |
+
if (!arguments[0]) {
|
3798 |
+
time = undefined;
|
3799 |
+
formats = undefined;
|
3800 |
+
} else if (isMomentInput(arguments[0])) {
|
3801 |
time = arguments[0];
|
3802 |
formats = undefined;
|
3803 |
} else if (isCalendarSpec(arguments[0])) {
|
4475 |
eras = this.localeData().eras();
|
4476 |
for (i = 0, l = eras.length; i < l; ++i) {
|
4477 |
// truncate time
|
4478 |
+
val = this.clone().startOf('day').valueOf();
|
4479 |
|
4480 |
if (eras[i].since <= val && val <= eras[i].until) {
|
4481 |
return eras[i].name;
|
4495 |
eras = this.localeData().eras();
|
4496 |
for (i = 0, l = eras.length; i < l; ++i) {
|
4497 |
// truncate time
|
4498 |
+
val = this.clone().startOf('day').valueOf();
|
4499 |
|
4500 |
if (eras[i].since <= val && val <= eras[i].until) {
|
4501 |
return eras[i].narrow;
|
4515 |
eras = this.localeData().eras();
|
4516 |
for (i = 0, l = eras.length; i < l; ++i) {
|
4517 |
// truncate time
|
4518 |
+
val = this.clone().startOf('day').valueOf();
|
4519 |
|
4520 |
if (eras[i].since <= val && val <= eras[i].until) {
|
4521 |
return eras[i].abbr;
|
4538 |
dir = eras[i].since <= eras[i].until ? +1 : -1;
|
4539 |
|
4540 |
// truncate time
|
4541 |
+
val = this.clone().startOf('day').valueOf();
|
4542 |
|
4543 |
if (
|
4544 |
(eras[i].since <= val && val <= eras[i].until) ||
|
5689 |
|
5690 |
//! moment.js
|
5691 |
|
5692 |
+
hooks.version = '2.29.1';
|
5693 |
|
5694 |
setHookCallback(createLocal);
|
5695 |
|
5738 |
|
5739 |
})));
|
5740 |
|
5741 |
+
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(678)(module)))
|
5742 |
|
5743 |
/***/ }),
|
5744 |
/* 1 */
|
5745 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
5746 |
|
5747 |
"use strict";
|
5748 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__react__ = __webpack_require__(94);
|
5749 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_0__react__["a"]; });
|
5750 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_0__react__["b"]; });
|
5751 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_0__react__["c"]; });
|
5756 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "j", function() { return __WEBPACK_IMPORTED_MODULE_0__react__["i"]; });
|
5757 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "k", function() { return __WEBPACK_IMPORTED_MODULE_0__react__["j"]; });
|
5758 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "m", function() { return __WEBPACK_IMPORTED_MODULE_0__react__["k"]; });
|
5759 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__react_platform__ = __webpack_require__(456);
|
5760 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "i", function() { return __WEBPACK_IMPORTED_MODULE_1__react_platform__["a"]; });
|
5761 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils__ = __webpack_require__(464);
|
5762 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "l", function() { return __WEBPACK_IMPORTED_MODULE_2__utils__["a"]; });
|
5763 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__serialize__ = __webpack_require__(465);
|
5764 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "n", function() { return __WEBPACK_IMPORTED_MODULE_3__serialize__["a"]; });
|
5765 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__raw_html__ = __webpack_require__(148);
|
5766 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return __WEBPACK_IMPORTED_MODULE_4__raw_html__["a"]; });
|
5767 |
|
5768 |
|
5817 |
|
5818 |
"use strict";
|
5819 |
/* harmony export (immutable) */ __webpack_exports__["a"] = _possibleConstructorReturn;
|
5820 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_typeof__ = __webpack_require__(39);
|
5821 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
5822 |
|
5823 |
|
5824 |
function _possibleConstructorReturn(self, call) {
|
5825 |
+
if (call && (Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_typeof__["a" /* default */])(call) === "object" || typeof call === "function")) {
|
5826 |
return call;
|
5827 |
}
|
5828 |
|
5829 |
+
return Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(self);
|
5830 |
}
|
5831 |
|
5832 |
/***/ }),
|
5848 |
|
5849 |
"use strict";
|
5850 |
/* harmony export (immutable) */ __webpack_exports__["a"] = _inherits;
|
5851 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_setPrototypeOf__ = __webpack_require__(469);
|
5852 |
|
5853 |
function _inherits(subClass, superClass) {
|
5854 |
if (typeof superClass !== "function" && superClass !== null) {
|
5862 |
configurable: true
|
5863 |
}
|
5864 |
});
|
5865 |
+
if (superClass) Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_setPrototypeOf__["a" /* default */])(subClass, superClass);
|
5866 |
}
|
5867 |
|
5868 |
/***/ }),
|
5891 |
|
5892 |
/***/ }),
|
5893 |
/* 9 */
|
5894 |
+
/***/ (function(module, exports, __webpack_require__) {
|
5895 |
|
5896 |
"use strict";
|
5897 |
+
/* WEBPACK VAR INJECTION */(function(process) {
|
|
|
|
|
|
|
|
|
5898 |
|
5899 |
+
if (process.env.NODE_ENV === 'production') {
|
5900 |
+
module.exports = __webpack_require__(454);
|
5901 |
+
} else {
|
5902 |
+
module.exports = __webpack_require__(455);
|
5903 |
}
|
5904 |
|
5905 |
+
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
5906 |
+
|
5907 |
/***/ }),
|
5908 |
/* 10 */
|
5909 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
5910 |
|
5911 |
"use strict";
|
5912 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = _assertThisInitialized;
|
5913 |
+
function _assertThisInitialized(self) {
|
5914 |
+
if (self === void 0) {
|
5915 |
+
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
5916 |
+
}
|
5917 |
|
5918 |
+
return self;
|
|
|
|
|
|
|
5919 |
}
|
5920 |
|
|
|
|
|
5921 |
/***/ }),
|
5922 |
/* 11 */
|
5923 |
/***/ (function(module, exports, __webpack_require__) {
|
5930 |
*/
|
5931 |
|
5932 |
if (process.env.NODE_ENV !== 'production') {
|
5933 |
+
var ReactIs = __webpack_require__(70);
|
5934 |
|
5935 |
// By explicitly using `prop-types` you are opting into new development behavior.
|
5936 |
// http://fb.me/prop-types-in-prod
|
5937 |
var throwOnDirectAccess = true;
|
5938 |
+
module.exports = __webpack_require__(686)(ReactIs.isElement, throwOnDirectAccess);
|
5939 |
} else {
|
5940 |
// By explicitly using `prop-types` you are opting into new production behavior.
|
5941 |
// http://fb.me/prop-types-in-prod
|
5942 |
+
module.exports = __webpack_require__(687)();
|
5943 |
}
|
5944 |
|
5945 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
5950 |
|
5951 |
"use strict";
|
5952 |
/* harmony export (immutable) */ __webpack_exports__["a"] = _objectWithoutProperties;
|
5953 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectWithoutPropertiesLoose__ = __webpack_require__(453);
|
5954 |
|
5955 |
function _objectWithoutProperties(source, excluded) {
|
5956 |
if (source == null) return {};
|
5957 |
+
var target = Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectWithoutPropertiesLoose__["a" /* default */])(source, excluded);
|
5958 |
var key, i;
|
5959 |
|
5960 |
if (Object.getOwnPropertySymbols) {
|
5973 |
|
5974 |
/***/ }),
|
5975 |
/* 13 */
|
5976 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
5977 |
+
|
5978 |
+
"use strict";
|
5979 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = _defineProperty;
|
5980 |
+
function _defineProperty(obj, key, value) {
|
5981 |
+
if (key in obj) {
|
5982 |
+
Object.defineProperty(obj, key, {
|
5983 |
+
value: value,
|
5984 |
+
enumerable: true,
|
5985 |
+
configurable: true,
|
5986 |
+
writable: true
|
5987 |
+
});
|
5988 |
+
} else {
|
5989 |
+
obj[key] = value;
|
5990 |
+
}
|
5991 |
+
|
5992 |
+
return obj;
|
5993 |
+
}
|
5994 |
+
|
5995 |
+
/***/ }),
|
5996 |
+
/* 14 */
|
5997 |
/***/ (function(module, exports, __webpack_require__) {
|
5998 |
|
5999 |
var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;/*!
|
6051 |
}());
|
6052 |
|
6053 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
6054 |
/***/ }),
|
6055 |
/* 15 */
|
6056 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
6057 |
|
6058 |
"use strict";
|
6059 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__create_interpolate_element__ = __webpack_require__(552);
|
6060 |
/* unused harmony reexport createInterpolateElement */
|
6061 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__react__ = __webpack_require__(106);
|
6062 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["a"]; });
|
6063 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["b"]; });
|
6064 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["d"]; });
|
6072 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "k", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["l"]; });
|
6073 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "l", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["m"]; });
|
6074 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "m", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["n"]; });
|
6075 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__react_platform__ = __webpack_require__(553);
|
6076 |
/* unused harmony namespace reexport */
|
6077 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__utils__ = __webpack_require__(554);
|
6078 |
/* unused harmony namespace reexport */
|
6079 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__platform__ = __webpack_require__(555);
|
6080 |
/* unused harmony reexport Platform */
|
6081 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__serialize__ = __webpack_require__(556);
|
6082 |
/* unused harmony reexport renderToString */
|
6083 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__raw_html__ = __webpack_require__(166);
|
6084 |
/* unused harmony reexport RawHTML */
|
6085 |
|
6086 |
|
6103 |
});
|
6104 |
exports["default"] = wrapValidator;
|
6105 |
|
6106 |
+
var _object = _interopRequireDefault(__webpack_require__(25));
|
6107 |
|
6108 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
6109 |
|
6171 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
6172 |
|
6173 |
"use strict";
|
6174 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_create_higher_order_component__ = __webpack_require__(46);
|
6175 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_0__utils_create_higher_order_component__["a"]; });
|
6176 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__higher_order_compose__ = __webpack_require__(481);
|
6177 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_1__higher_order_compose__["a"]; });
|
6178 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__higher_order_if_condition__ = __webpack_require__(482);
|
6179 |
/* unused harmony reexport ifCondition */
|
6180 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__higher_order_pure__ = __webpack_require__(491);
|
6181 |
/* unused harmony reexport pure */
|
6182 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__higher_order_with_global_events__ = __webpack_require__(495);
|
6183 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_4__higher_order_with_global_events__["a"]; });
|
6184 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__higher_order_with_instance_id__ = __webpack_require__(497);
|
6185 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return __WEBPACK_IMPORTED_MODULE_5__higher_order_with_instance_id__["a"]; });
|
6186 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__higher_order_with_safe_timeout__ = __webpack_require__(498);
|
6187 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "e", function() { return __WEBPACK_IMPORTED_MODULE_6__higher_order_with_safe_timeout__["a"]; });
|
6188 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__higher_order_with_state__ = __webpack_require__(499);
|
6189 |
/* unused harmony reexport withState */
|
6190 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__hooks_use_copy_on_click__ = __webpack_require__(500);
|
6191 |
+
/* unused harmony reexport useCopyOnClick */
|
6192 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__hooks_use_dragging__ = __webpack_require__(501);
|
6193 |
/* unused harmony reexport __experimentalUseDragging */
|
6194 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__hooks_use_instance_id__ = __webpack_require__(153);
|
6195 |
/* unused harmony reexport useInstanceId */
|
6196 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__hooks_use_keyboard_shortcut__ = __webpack_require__(502);
|
6197 |
/* unused harmony reexport useKeyboardShortcut */
|
6198 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__hooks_use_media_query__ = __webpack_require__(101);
|
6199 |
/* unused harmony reexport useMediaQuery */
|
6200 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__hooks_use_previous__ = __webpack_require__(154);
|
6201 |
+
/* unused harmony reexport usePrevious */
|
6202 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__hooks_use_reduced_motion__ = __webpack_require__(503);
|
6203 |
/* unused harmony reexport useReducedMotion */
|
6204 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__hooks_use_viewport_match__ = __webpack_require__(504);
|
6205 |
/* unused harmony reexport useViewportMatch */
|
6206 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__hooks_use_resize_observer__ = __webpack_require__(505);
|
6207 |
/* unused harmony reexport useResizeObserver */
|
6208 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__hooks_use_async_list__ = __webpack_require__(506);
|
6209 |
+
/* unused harmony reexport useAsyncList */
|
6210 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__hooks_use_warn_on_change__ = __webpack_require__(508);
|
6211 |
+
/* unused harmony reexport useWarnOnChange */
|
6212 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__hooks_use_debounce__ = __webpack_require__(509);
|
6213 |
+
/* unused harmony reexport useDebounce */
|
6214 |
// Utils
|
6215 |
// Compose helper (aliased flowRight from Lodash)
|
6216 |
|
6230 |
|
6231 |
|
6232 |
|
6233 |
+
|
6234 |
+
|
6235 |
+
|
6236 |
+
|
6237 |
+
|
6238 |
//# sourceMappingURL=index.js.map
|
6239 |
|
6240 |
/***/ }),
|
6280 |
}())
|
6281 |
: throwTypeError;
|
6282 |
|
6283 |
+
var hasSymbols = __webpack_require__(43)();
|
6284 |
|
6285 |
var getProto = Object.getPrototypeOf || function (x) { return x.__proto__; }; // eslint-disable-line no-proto
|
6286 |
|
6406 |
'%WeakSetPrototype%': typeof WeakSet === 'undefined' ? undefined : WeakSet.prototype
|
6407 |
};
|
6408 |
|
6409 |
+
var bind = __webpack_require__(33);
|
6410 |
var $replace = bind.call(Function.call, String.prototype.replace);
|
6411 |
|
6412 |
/* adapted from https://github.com/lodash/lodash/blob/4.17.15/dist/lodash.js#L6735-L6744 */
|
6452 |
if (!allowMissing && !(parts[i] in value)) {
|
6453 |
throw new $TypeError('base intrinsic for ' + name + ' exists, but the property is not available.');
|
6454 |
}
|
6455 |
+
// By convention, when a data property is converted to an accessor
|
6456 |
+
// property to emulate a data property that does not suffer from
|
6457 |
+
// the override mistake, that accessor's getter is marked with
|
6458 |
+
// an `originalValue` property. Here, when we detect this, we
|
6459 |
+
// uphold the illusion by pretending to see that original data
|
6460 |
+
// property, i.e., returning the value rather than the getter
|
6461 |
+
// itself.
|
6462 |
+
value = desc && 'get' in desc && !('originalValue' in desc.get) ? desc.get : value[parts[i]];
|
6463 |
} else {
|
6464 |
value = value[parts[i]];
|
6465 |
}
|
6661 |
|
6662 |
/***/ }),
|
6663 |
/* 21 */
|
6664 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
6665 |
+
|
6666 |
+
"use strict";
|
6667 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = _toConsumableArray;
|
6668 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_arrayWithoutHoles__ = __webpack_require__(470);
|
6669 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_iterableToArray__ = __webpack_require__(471);
|
6670 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_unsupportedIterableToArray__ = __webpack_require__(150);
|
6671 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_nonIterableSpread__ = __webpack_require__(472);
|
6672 |
+
|
6673 |
+
|
6674 |
+
|
6675 |
+
|
6676 |
+
function _toConsumableArray(arr) {
|
6677 |
+
return Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_arrayWithoutHoles__["a" /* default */])(arr) || Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_iterableToArray__["a" /* default */])(arr) || Object(__WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_unsupportedIterableToArray__["a" /* default */])(arr) || Object(__WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_nonIterableSpread__["a" /* default */])();
|
6678 |
+
}
|
6679 |
+
|
6680 |
+
/***/ }),
|
6681 |
+
/* 22 */
|
6682 |
/***/ (function(module, exports, __webpack_require__) {
|
6683 |
|
6684 |
+
/* WEBPACK VAR INJECTION */(function(process) {module.exports = process.env.NODE_ENV === 'production' ? __webpack_require__(691) : __webpack_require__(692);
|
6685 |
|
6686 |
//# sourceMappingURL=index.js.map
|
6687 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
6688 |
|
6689 |
/***/ }),
|
6690 |
+
/* 23 */
|
6691 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
6692 |
|
6693 |
"use strict";
|
6694 |
/* harmony export (immutable) */ __webpack_exports__["a"] = _objectSpread;
|
6695 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
6696 |
|
6697 |
function _objectSpread(target) {
|
6698 |
for (var i = 1; i < arguments.length; i++) {
|
6706 |
}
|
6707 |
|
6708 |
ownKeys.forEach(function (key) {
|
6709 |
+
Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(target, key, source[key]);
|
6710 |
});
|
6711 |
}
|
6712 |
|
6714 |
}
|
6715 |
|
6716 |
/***/ }),
|
6717 |
+
/* 24 */
|
6718 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
6719 |
|
6720 |
"use strict";
|
6721 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__create_interpolate_element__ = __webpack_require__(483);
|
6722 |
+
/* unused harmony reexport createInterpolateElement */
|
6723 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__react__ = __webpack_require__(97);
|
6724 |
+
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["a"]; });
|
6725 |
+
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["d"]; });
|
6726 |
+
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["e"]; });
|
6727 |
+
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "d", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["f"]; });
|
6728 |
+
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "e", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["g"]; });
|
6729 |
+
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "f", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["h"]; });
|
6730 |
+
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "g", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["i"]; });
|
6731 |
+
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "h", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["j"]; });
|
6732 |
+
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "i", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["k"]; });
|
6733 |
+
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "j", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["l"]; });
|
6734 |
+
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "k", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["m"]; });
|
6735 |
+
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "l", function() { return __WEBPACK_IMPORTED_MODULE_1__react__["n"]; });
|
6736 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__react_platform__ = __webpack_require__(487);
|
6737 |
+
/* unused harmony namespace reexport */
|
6738 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__utils__ = __webpack_require__(488);
|
6739 |
+
/* unused harmony namespace reexport */
|
6740 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__platform__ = __webpack_require__(489);
|
6741 |
+
/* unused harmony reexport Platform */
|
6742 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__serialize__ = __webpack_require__(490);
|
6743 |
+
/* unused harmony reexport renderToString */
|
6744 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__raw_html__ = __webpack_require__(152);
|
6745 |
+
/* unused harmony reexport RawHTML */
|
6746 |
+
|
6747 |
+
|
6748 |
|
6749 |
|
6750 |
|
6751 |
|
6752 |
+
|
6753 |
+
//# sourceMappingURL=index.js.map
|
|
|
6754 |
|
6755 |
/***/ }),
|
6756 |
+
/* 25 */
|
6757 |
/***/ (function(module, exports, __webpack_require__) {
|
6758 |
|
6759 |
"use strict";
|
6760 |
|
6761 |
|
6762 |
+
var defineProperties = __webpack_require__(28);
|
6763 |
+
var callBind = __webpack_require__(128);
|
6764 |
|
6765 |
+
var implementation = __webpack_require__(360);
|
6766 |
+
var getPolyfill = __webpack_require__(361);
|
6767 |
+
var shim = __webpack_require__(683);
|
6768 |
|
6769 |
+
var polyfill = callBind.apply(getPolyfill());
|
6770 |
+
// eslint-disable-next-line no-unused-vars
|
6771 |
+
var bound = function assign(target, source1) {
|
6772 |
+
return polyfill(Object, arguments);
|
6773 |
+
};
|
6774 |
|
6775 |
+
defineProperties(bound, {
|
6776 |
getPolyfill: getPolyfill,
|
6777 |
implementation: implementation,
|
6778 |
shim: shim
|
6779 |
});
|
6780 |
|
6781 |
+
module.exports = bound;
|
6782 |
|
6783 |
|
6784 |
/***/ }),
|
6785 |
+
/* 26 */
|
6786 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
6787 |
|
6788 |
"use strict";
|
6792 |
/* harmony export (immutable) */ __webpack_exports__["b"] = _n;
|
6793 |
/* unused harmony export _nx */
|
6794 |
/* harmony export (immutable) */ __webpack_exports__["d"] = sprintf;
|
6795 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(23);
|
6796 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_tannin__ = __webpack_require__(80);
|
6797 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_memize__ = __webpack_require__(64);
|
6798 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_memize___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_memize__);
|
6799 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_sprintf_js__ = __webpack_require__(79);
|
6800 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_sprintf_js___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_sprintf_js__);
|
6801 |
|
6802 |
|
6974 |
//# sourceMappingURL=index.js.map
|
6975 |
|
6976 |
/***/ }),
|
6977 |
+
/* 27 */
|
6978 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
6979 |
+
|
6980 |
+
"use strict";
|
6981 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = _slicedToArray;
|
6982 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_arrayWithHoles__ = __webpack_require__(484);
|
6983 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_iterableToArrayLimit__ = __webpack_require__(485);
|
6984 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_unsupportedIterableToArray__ = __webpack_require__(150);
|
6985 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_nonIterableRest__ = __webpack_require__(486);
|
6986 |
+
|
6987 |
+
|
6988 |
+
|
6989 |
+
|
6990 |
+
function _slicedToArray(arr, i) {
|
6991 |
+
return Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_arrayWithHoles__["a" /* default */])(arr) || Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_iterableToArrayLimit__["a" /* default */])(arr, i) || Object(__WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_unsupportedIterableToArray__["a" /* default */])(arr, i) || Object(__WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_nonIterableRest__["a" /* default */])();
|
6992 |
+
}
|
6993 |
+
|
6994 |
+
/***/ }),
|
6995 |
+
/* 28 */
|
6996 |
/***/ (function(module, exports, __webpack_require__) {
|
6997 |
|
6998 |
"use strict";
|
6999 |
|
7000 |
|
7001 |
+
var keys = __webpack_require__(203);
|
7002 |
var hasSymbols = typeof Symbol === 'function' && typeof Symbol('foo') === 'symbol';
|
7003 |
|
7004 |
var toStr = Object.prototype.toString;
|
7057 |
|
7058 |
|
7059 |
/***/ }),
|
7060 |
+
/* 29 */
|
7061 |
/***/ (function(module, exports, __webpack_require__) {
|
7062 |
|
7063 |
"use strict";
|
7276 |
};
|
7277 |
|
7278 |
/***/ }),
|
7279 |
+
/* 30 */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
7280 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
7281 |
|
7282 |
"use strict";
|
7301 |
//# sourceMappingURL=special-characters.js.map
|
7302 |
|
7303 |
/***/ }),
|
7304 |
+
/* 31 */
|
7305 |
/***/ (function(module, exports, __webpack_require__) {
|
7306 |
|
7307 |
"use strict";
|
7312 |
});
|
7313 |
exports['default'] = getPhrasePropTypes;
|
7314 |
|
7315 |
+
var _object = __webpack_require__(25);
|
7316 |
|
7317 |
var _object2 = _interopRequireDefault(_object);
|
7318 |
|
7331 |
}
|
7332 |
|
7333 |
/***/ }),
|
7334 |
+
/* 32 */
|
7335 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
7336 |
|
7337 |
"use strict";
|
7357 |
/* unused harmony export displayShortcut */
|
7358 |
/* unused harmony export shortcutAriaLabel */
|
7359 |
/* unused harmony export isKeyboardEvent */
|
7360 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
7361 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
7362 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash__ = __webpack_require__(2);
|
7363 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_lodash__);
|
7364 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_i18n__ = __webpack_require__(473);
|
7365 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__platform__ = __webpack_require__(480);
|
7366 |
|
7367 |
|
7368 |
|
7561 |
|
7562 |
var isApple = _isApple();
|
7563 |
|
7564 |
+
var replacementKeyMap = (_replacementKeyMap = {}, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(_replacementKeyMap, ALT, isApple ? '⌥' : 'Alt'), Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(_replacementKeyMap, CTRL, isApple ? '⌃' : 'Ctrl'), Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(_replacementKeyMap, COMMAND, '⌘'), Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(_replacementKeyMap, SHIFT, isApple ? '⇧' : 'Shift'), _replacementKeyMap);
|
7565 |
var modifierKeys = modifier(_isApple).reduce(function (accumulator, key) {
|
7566 |
var replacementKey = Object(__WEBPACK_IMPORTED_MODULE_2_lodash__["get"])(replacementKeyMap, key, key); // If on the Mac, adhere to platform convention and don't show plus between keys.
|
7567 |
|
7657 |
//# sourceMappingURL=index.js.map
|
7658 |
|
7659 |
/***/ }),
|
7660 |
+
/* 33 */
|
7661 |
+
/***/ (function(module, exports, __webpack_require__) {
|
7662 |
+
|
7663 |
+
"use strict";
|
7664 |
+
|
7665 |
+
|
7666 |
+
var implementation = __webpack_require__(639);
|
7667 |
+
|
7668 |
+
module.exports = Function.prototype.bind || implementation;
|
7669 |
+
|
7670 |
+
|
7671 |
+
/***/ }),
|
7672 |
+
/* 34 */
|
7673 |
/***/ (function(module, exports, __webpack_require__) {
|
7674 |
|
7675 |
"use strict";
|
7686 |
|
7687 |
exports.withStyles = withStyles;
|
7688 |
|
7689 |
+
var _object = __webpack_require__(25);
|
7690 |
|
7691 |
var _object2 = _interopRequireDefault(_object);
|
7692 |
|
7693 |
+
var _react = __webpack_require__(9);
|
7694 |
|
7695 |
var _react2 = _interopRequireDefault(_react);
|
7696 |
|
7698 |
|
7699 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
7700 |
|
7701 |
+
var _hoistNonReactStatics = __webpack_require__(743);
|
7702 |
|
7703 |
var _hoistNonReactStatics2 = _interopRequireDefault(_hoistNonReactStatics);
|
7704 |
|
7705 |
+
var _constants = __webpack_require__(744);
|
7706 |
|
7707 |
+
var _brcast = __webpack_require__(745);
|
7708 |
|
7709 |
var _brcast2 = _interopRequireDefault(_brcast);
|
7710 |
|
7711 |
+
var _ThemedStyleSheet = __webpack_require__(222);
|
7712 |
|
7713 |
var _ThemedStyleSheet2 = _interopRequireDefault(_ThemedStyleSheet);
|
7714 |
|
7935 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
7936 |
|
7937 |
/***/ }),
|
7938 |
+
/* 35 */
|
7939 |
+
/***/ (function(module, exports, __webpack_require__) {
|
7940 |
|
7941 |
"use strict";
|
|
|
|
|
|
|
|
|
|
|
7942 |
|
7943 |
|
7944 |
+
var ES5Type = __webpack_require__(643);
|
7945 |
|
7946 |
+
// https://ecma-international.org/ecma-262/6.0/#sec-ecmascript-data-types-and-values
|
7947 |
+
|
7948 |
+
module.exports = function Type(x) {
|
7949 |
+
if (typeof x === 'symbol') {
|
7950 |
+
return 'Symbol';
|
7951 |
+
}
|
7952 |
+
return ES5Type(x);
|
7953 |
+
};
|
7954 |
|
|
|
|
|
|
|
7955 |
|
7956 |
/***/ }),
|
7957 |
+
/* 36 */
|
7958 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
7959 |
|
7960 |
"use strict";
|
7961 |
/* unused harmony export Button */
|
7962 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(23);
|
7963 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
7964 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames__ = __webpack_require__(14);
|
7965 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_classnames__);
|
7966 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_element__ = __webpack_require__(1);
|
7967 |
|
8021 |
//# sourceMappingURL=index.js.map
|
8022 |
|
8023 |
/***/ }),
|
8024 |
+
/* 37 */
|
8025 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8026 |
|
8027 |
"use strict";
|
8033 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
8034 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
8035 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(1);
|
8036 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_classnames__ = __webpack_require__(14);
|
8037 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_classnames__);
|
8038 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_lodash__ = __webpack_require__(2);
|
8039 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_9_lodash__);
|
8040 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__tooltip__ = __webpack_require__(118);
|
8041 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__button__ = __webpack_require__(36);
|
8042 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__dashicon__ = __webpack_require__(55);
|
8043 |
|
8044 |
|
8045 |
|
8126 |
//# sourceMappingURL=index.js.map
|
8127 |
|
8128 |
/***/ }),
|
8129 |
+
/* 38 */
|
8130 |
+
/***/ (function(module, exports, __webpack_require__) {
|
8131 |
+
|
8132 |
+
"use strict";
|
8133 |
+
|
8134 |
+
|
8135 |
+
var bind = __webpack_require__(33);
|
8136 |
+
|
8137 |
+
module.exports = bind.call(Function.call, Object.prototype.hasOwnProperty);
|
8138 |
+
|
8139 |
+
|
8140 |
+
/***/ }),
|
8141 |
+
/* 39 */
|
8142 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8143 |
|
8144 |
"use strict";
|
8160 |
}
|
8161 |
|
8162 |
/***/ }),
|
8163 |
+
/* 40 */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
8164 |
/***/ (function(module, exports, __webpack_require__) {
|
8165 |
|
8166 |
var moment = __webpack_require__(0);
|
8167 |
+
var momentValidationWrapper = __webpack_require__(689);
|
8168 |
+
var core = __webpack_require__(690);
|
8169 |
|
8170 |
module.exports = {
|
8171 |
|
8206 |
|
8207 |
|
8208 |
/***/ }),
|
8209 |
+
/* 41 */
|
8210 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8211 |
|
8212 |
"use strict";
|
8213 |
+
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return select; });
|
8214 |
/* unused harmony export __experimentalResolveSelect */
|
8215 |
+
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return dispatch; });
|
8216 |
/* unused harmony export subscribe */
|
8217 |
/* unused harmony export registerGenericStore */
|
8218 |
+
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return registerStore; });
|
8219 |
/* unused harmony export use */
|
8220 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_turbo_combine_reducers__ = __webpack_require__(156);
|
8221 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_turbo_combine_reducers___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_turbo_combine_reducers__);
|
8222 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__default_registry__ = __webpack_require__(157);
|
8223 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__plugins__ = __webpack_require__(538);
|
8224 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__components_with_select__ = __webpack_require__(551);
|
8225 |
/* unused harmony reexport withSelect */
|
8226 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__components_with_dispatch__ = __webpack_require__(576);
|
8227 |
/* unused harmony reexport withDispatch */
|
8228 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__components_with_registry__ = __webpack_require__(579);
|
8229 |
/* unused harmony reexport withRegistry */
|
8230 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__components_registry_provider__ = __webpack_require__(175);
|
8231 |
/* unused harmony reexport RegistryProvider */
|
8232 |
/* unused harmony reexport RegistryConsumer */
|
8233 |
/* unused harmony reexport useRegistry */
|
8234 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__components_use_select__ = __webpack_require__(170);
|
8235 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "f", function() { return __WEBPACK_IMPORTED_MODULE_7__components_use_select__["a"]; });
|
8236 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__components_use_dispatch__ = __webpack_require__(174);
|
8237 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "e", function() { return __WEBPACK_IMPORTED_MODULE_8__components_use_dispatch__["a"]; });
|
8238 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__components_async_mode_provider__ = __webpack_require__(580);
|
|
|
8239 |
/* unused harmony reexport AsyncModeProvider */
|
8240 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__registry__ = __webpack_require__(158);
|
8241 |
/* unused harmony reexport createRegistry */
|
8242 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__factory__ = __webpack_require__(164);
|
8243 |
/* unused harmony reexport createRegistrySelector */
|
8244 |
/* unused harmony reexport createRegistryControl */
|
8245 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__controls__ = __webpack_require__(163);
|
8246 |
+
/* unused harmony reexport controls */
|
8247 |
/* unused harmony reexport plugins */
|
8248 |
+
/* harmony reexport (default from non-hamory) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_0_turbo_combine_reducers___default.a; });
|
8249 |
/**
|
8250 |
* External dependencies
|
8251 |
*/
|
8265 |
|
8266 |
|
8267 |
|
8268 |
+
|
8269 |
/**
|
8270 |
* Object of available plugins to use with a registry.
|
8271 |
*
|
8422 |
//# sourceMappingURL=index.js.map
|
8423 |
|
8424 |
/***/ }),
|
8425 |
+
/* 42 */
|
8426 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8427 |
|
8428 |
"use strict";
|
8429 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(1);
|
8430 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_classnames__ = __webpack_require__(14);
|
8431 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_classnames__);
|
8432 |
|
8433 |
|
8461 |
//# sourceMappingURL=index.js.map
|
8462 |
|
8463 |
/***/ }),
|
8464 |
+
/* 43 */
|
8465 |
/***/ (function(module, exports, __webpack_require__) {
|
8466 |
|
8467 |
"use strict";
|
8468 |
+
/* WEBPACK VAR INJECTION */(function(global) {
|
8469 |
|
8470 |
+
var origSymbol = global.Symbol;
|
8471 |
+
var hasSymbolSham = __webpack_require__(205);
|
8472 |
|
8473 |
+
module.exports = function hasNativeSymbols() {
|
8474 |
+
if (typeof origSymbol !== 'function') { return false; }
|
8475 |
+
if (typeof Symbol !== 'function') { return false; }
|
8476 |
+
if (typeof origSymbol('foo') !== 'symbol') { return false; }
|
8477 |
+
if (typeof Symbol('bar') !== 'symbol') { return false; }
|
8478 |
|
8479 |
+
return hasSymbolSham();
|
8480 |
+
};
|
8481 |
|
8482 |
+
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(81)))
|
8483 |
|
8484 |
/***/ }),
|
8485 |
+
/* 44 */
|
8486 |
+
/***/ (function(module, exports, __webpack_require__) {
|
8487 |
+
|
8488 |
+
"use strict";
|
8489 |
+
|
8490 |
+
|
8491 |
+
/* globals
|
8492 |
+
Atomics,
|
8493 |
+
SharedArrayBuffer,
|
8494 |
+
*/
|
8495 |
+
|
8496 |
+
var undefined;
|
8497 |
+
|
8498 |
+
var $TypeError = TypeError;
|
8499 |
+
|
8500 |
+
var $gOPD = Object.getOwnPropertyDescriptor;
|
8501 |
+
if ($gOPD) {
|
8502 |
+
try {
|
8503 |
+
$gOPD({}, '');
|
8504 |
+
} catch (e) {
|
8505 |
+
$gOPD = null; // this is IE 8, which has a broken gOPD
|
8506 |
+
}
|
8507 |
+
}
|
8508 |
+
|
8509 |
+
var throwTypeError = function () { throw new $TypeError(); };
|
8510 |
+
var ThrowTypeError = $gOPD
|
8511 |
+
? (function () {
|
8512 |
+
try {
|
8513 |
+
// eslint-disable-next-line no-unused-expressions, no-caller, no-restricted-properties
|
8514 |
+
arguments.callee; // IE 8 does not throw here
|
8515 |
+
return throwTypeError;
|
8516 |
+
} catch (calleeThrows) {
|
8517 |
+
try {
|
8518 |
+
// IE 8 throws on Object.getOwnPropertyDescriptor(arguments, '')
|
8519 |
+
return $gOPD(arguments, 'callee').get;
|
8520 |
+
} catch (gOPDthrows) {
|
8521 |
+
return throwTypeError;
|
8522 |
+
}
|
8523 |
+
}
|
8524 |
+
}())
|
8525 |
+
: throwTypeError;
|
8526 |
+
|
8527 |
+
var hasSymbols = __webpack_require__(43)();
|
8528 |
+
|
8529 |
+
var getProto = Object.getPrototypeOf || function (x) { return x.__proto__; }; // eslint-disable-line no-proto
|
8530 |
+
|
8531 |
+
var generator; // = function * () {};
|
8532 |
+
var generatorFunction = generator ? getProto(generator) : undefined;
|
8533 |
+
var asyncFn; // async function() {};
|
8534 |
+
var asyncFunction = asyncFn ? asyncFn.constructor : undefined;
|
8535 |
+
var asyncGen; // async function * () {};
|
8536 |
+
var asyncGenFunction = asyncGen ? getProto(asyncGen) : undefined;
|
8537 |
+
var asyncGenIterator = asyncGen ? asyncGen() : undefined;
|
8538 |
+
|
8539 |
+
var TypedArray = typeof Uint8Array === 'undefined' ? undefined : getProto(Uint8Array);
|
8540 |
+
|
8541 |
+
var INTRINSICS = {
|
8542 |
+
'%Array%': Array,
|
8543 |
+
'%ArrayBuffer%': typeof ArrayBuffer === 'undefined' ? undefined : ArrayBuffer,
|
8544 |
+
'%ArrayBufferPrototype%': typeof ArrayBuffer === 'undefined' ? undefined : ArrayBuffer.prototype,
|
8545 |
+
'%ArrayIteratorPrototype%': hasSymbols ? getProto([][Symbol.iterator]()) : undefined,
|
8546 |
+
'%ArrayPrototype%': Array.prototype,
|
8547 |
+
'%ArrayProto_entries%': Array.prototype.entries,
|
8548 |
+
'%ArrayProto_forEach%': Array.prototype.forEach,
|
8549 |
+
'%ArrayProto_keys%': Array.prototype.keys,
|
8550 |
+
'%ArrayProto_values%': Array.prototype.values,
|
8551 |
+
'%AsyncFromSyncIteratorPrototype%': undefined,
|
8552 |
+
'%AsyncFunction%': asyncFunction,
|
8553 |
+
'%AsyncFunctionPrototype%': asyncFunction ? asyncFunction.prototype : undefined,
|
8554 |
+
'%AsyncGenerator%': asyncGen ? getProto(asyncGenIterator) : undefined,
|
8555 |
+
'%AsyncGeneratorFunction%': asyncGenFunction,
|
8556 |
+
'%AsyncGeneratorPrototype%': asyncGenFunction ? asyncGenFunction.prototype : undefined,
|
8557 |
+
'%AsyncIteratorPrototype%': asyncGenIterator && hasSymbols && Symbol.asyncIterator ? asyncGenIterator[Symbol.asyncIterator]() : undefined,
|
8558 |
+
'%Atomics%': typeof Atomics === 'undefined' ? undefined : Atomics,
|
8559 |
+
'%Boolean%': Boolean,
|
8560 |
+
'%BooleanPrototype%': Boolean.prototype,
|
8561 |
+
'%DataView%': typeof DataView === 'undefined' ? undefined : DataView,
|
8562 |
+
'%DataViewPrototype%': typeof DataView === 'undefined' ? undefined : DataView.prototype,
|
8563 |
+
'%Date%': Date,
|
8564 |
+
'%DatePrototype%': Date.prototype,
|
8565 |
+
'%decodeURI%': decodeURI,
|
8566 |
+
'%decodeURIComponent%': decodeURIComponent,
|
8567 |
+
'%encodeURI%': encodeURI,
|
8568 |
+
'%encodeURIComponent%': encodeURIComponent,
|
8569 |
+
'%Error%': Error,
|
8570 |
+
'%ErrorPrototype%': Error.prototype,
|
8571 |
+
'%eval%': eval, // eslint-disable-line no-eval
|
8572 |
+
'%EvalError%': EvalError,
|
8573 |
+
'%EvalErrorPrototype%': EvalError.prototype,
|
8574 |
+
'%Float32Array%': typeof Float32Array === 'undefined' ? undefined : Float32Array,
|
8575 |
+
'%Float32ArrayPrototype%': typeof Float32Array === 'undefined' ? undefined : Float32Array.prototype,
|
8576 |
+
'%Float64Array%': typeof Float64Array === 'undefined' ? undefined : Float64Array,
|
8577 |
+
'%Float64ArrayPrototype%': typeof Float64Array === 'undefined' ? undefined : Float64Array.prototype,
|
8578 |
+
'%Function%': Function,
|
8579 |
+
'%FunctionPrototype%': Function.prototype,
|
8580 |
+
'%Generator%': generator ? getProto(generator()) : undefined,
|
8581 |
+
'%GeneratorFunction%': generatorFunction,
|
8582 |
+
'%GeneratorPrototype%': generatorFunction ? generatorFunction.prototype : undefined,
|
8583 |
+
'%Int8Array%': typeof Int8Array === 'undefined' ? undefined : Int8Array,
|
8584 |
+
'%Int8ArrayPrototype%': typeof Int8Array === 'undefined' ? undefined : Int8Array.prototype,
|
8585 |
+
'%Int16Array%': typeof Int16Array === 'undefined' ? undefined : Int16Array,
|
8586 |
+
'%Int16ArrayPrototype%': typeof Int16Array === 'undefined' ? undefined : Int8Array.prototype,
|
8587 |
+
'%Int32Array%': typeof Int32Array === 'undefined' ? undefined : Int32Array,
|
8588 |
+
'%Int32ArrayPrototype%': typeof Int32Array === 'undefined' ? undefined : Int32Array.prototype,
|
8589 |
+
'%isFinite%': isFinite,
|
8590 |
+
'%isNaN%': isNaN,
|
8591 |
+
'%IteratorPrototype%': hasSymbols ? getProto(getProto([][Symbol.iterator]())) : undefined,
|
8592 |
+
'%JSON%': typeof JSON === 'object' ? JSON : undefined,
|
8593 |
+
'%JSONParse%': typeof JSON === 'object' ? JSON.parse : undefined,
|
8594 |
+
'%Map%': typeof Map === 'undefined' ? undefined : Map,
|
8595 |
+
'%MapIteratorPrototype%': typeof Map === 'undefined' || !hasSymbols ? undefined : getProto(new Map()[Symbol.iterator]()),
|
8596 |
+
'%MapPrototype%': typeof Map === 'undefined' ? undefined : Map.prototype,
|
8597 |
+
'%Math%': Math,
|
8598 |
+
'%Number%': Number,
|
8599 |
+
'%NumberPrototype%': Number.prototype,
|
8600 |
+
'%Object%': Object,
|
8601 |
+
'%ObjectPrototype%': Object.prototype,
|
8602 |
+
'%ObjProto_toString%': Object.prototype.toString,
|
8603 |
+
'%ObjProto_valueOf%': Object.prototype.valueOf,
|
8604 |
+
'%parseFloat%': parseFloat,
|
8605 |
+
'%parseInt%': parseInt,
|
8606 |
+
'%Promise%': typeof Promise === 'undefined' ? undefined : Promise,
|
8607 |
+
'%PromisePrototype%': typeof Promise === 'undefined' ? undefined : Promise.prototype,
|
8608 |
+
'%PromiseProto_then%': typeof Promise === 'undefined' ? undefined : Promise.prototype.then,
|
8609 |
+
'%Promise_all%': typeof Promise === 'undefined' ? undefined : Promise.all,
|
8610 |
+
'%Promise_reject%': typeof Promise === 'undefined' ? undefined : Promise.reject,
|
8611 |
+
'%Promise_resolve%': typeof Promise === 'undefined' ? undefined : Promise.resolve,
|
8612 |
+
'%Proxy%': typeof Proxy === 'undefined' ? undefined : Proxy,
|
8613 |
+
'%RangeError%': RangeError,
|
8614 |
+
'%RangeErrorPrototype%': RangeError.prototype,
|
8615 |
+
'%ReferenceError%': ReferenceError,
|
8616 |
+
'%ReferenceErrorPrototype%': ReferenceError.prototype,
|
8617 |
+
'%Reflect%': typeof Reflect === 'undefined' ? undefined : Reflect,
|
8618 |
+
'%RegExp%': RegExp,
|
8619 |
+
'%RegExpPrototype%': RegExp.prototype,
|
8620 |
+
'%Set%': typeof Set === 'undefined' ? undefined : Set,
|
8621 |
+
'%SetIteratorPrototype%': typeof Set === 'undefined' || !hasSymbols ? undefined : getProto(new Set()[Symbol.iterator]()),
|
8622 |
+
'%SetPrototype%': typeof Set === 'undefined' ? undefined : Set.prototype,
|
8623 |
+
'%SharedArrayBuffer%': typeof SharedArrayBuffer === 'undefined' ? undefined : SharedArrayBuffer,
|
8624 |
+
'%SharedArrayBufferPrototype%': typeof SharedArrayBuffer === 'undefined' ? undefined : SharedArrayBuffer.prototype,
|
8625 |
+
'%String%': String,
|
8626 |
+
'%StringIteratorPrototype%': hasSymbols ? getProto(''[Symbol.iterator]()) : undefined,
|
8627 |
+
'%StringPrototype%': String.prototype,
|
8628 |
+
'%Symbol%': hasSymbols ? Symbol : undefined,
|
8629 |
+
'%SymbolPrototype%': hasSymbols ? Symbol.prototype : undefined,
|
8630 |
+
'%SyntaxError%': SyntaxError,
|
8631 |
+
'%SyntaxErrorPrototype%': SyntaxError.prototype,
|
8632 |
+
'%ThrowTypeError%': ThrowTypeError,
|
8633 |
+
'%TypedArray%': TypedArray,
|
8634 |
+
'%TypedArrayPrototype%': TypedArray ? TypedArray.prototype : undefined,
|
8635 |
+
'%TypeError%': $TypeError,
|
8636 |
+
'%TypeErrorPrototype%': $TypeError.prototype,
|
8637 |
+
'%Uint8Array%': typeof Uint8Array === 'undefined' ? undefined : Uint8Array,
|
8638 |
+
'%Uint8ArrayPrototype%': typeof Uint8Array === 'undefined' ? undefined : Uint8Array.prototype,
|
8639 |
+
'%Uint8ClampedArray%': typeof Uint8ClampedArray === 'undefined' ? undefined : Uint8ClampedArray,
|
8640 |
+
'%Uint8ClampedArrayPrototype%': typeof Uint8ClampedArray === 'undefined' ? undefined : Uint8ClampedArray.prototype,
|
8641 |
+
'%Uint16Array%': typeof Uint16Array === 'undefined' ? undefined : Uint16Array,
|
8642 |
+
'%Uint16ArrayPrototype%': typeof Uint16Array === 'undefined' ? undefined : Uint16Array.prototype,
|
8643 |
+
'%Uint32Array%': typeof Uint32Array === 'undefined' ? undefined : Uint32Array,
|
8644 |
+
'%Uint32ArrayPrototype%': typeof Uint32Array === 'undefined' ? undefined : Uint32Array.prototype,
|
8645 |
+
'%URIError%': URIError,
|
8646 |
+
'%URIErrorPrototype%': URIError.prototype,
|
8647 |
+
'%WeakMap%': typeof WeakMap === 'undefined' ? undefined : WeakMap,
|
8648 |
+
'%WeakMapPrototype%': typeof WeakMap === 'undefined' ? undefined : WeakMap.prototype,
|
8649 |
+
'%WeakSet%': typeof WeakSet === 'undefined' ? undefined : WeakSet,
|
8650 |
+
'%WeakSetPrototype%': typeof WeakSet === 'undefined' ? undefined : WeakSet.prototype
|
8651 |
+
};
|
8652 |
+
|
8653 |
+
var bind = __webpack_require__(33);
|
8654 |
+
var $replace = bind.call(Function.call, String.prototype.replace);
|
8655 |
+
|
8656 |
+
/* adapted from https://github.com/lodash/lodash/blob/4.17.15/dist/lodash.js#L6735-L6744 */
|
8657 |
+
var rePropName = /[^%.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|%$))/g;
|
8658 |
+
var reEscapeChar = /\\(\\)?/g; /** Used to match backslashes in property paths. */
|
8659 |
+
var stringToPath = function stringToPath(string) {
|
8660 |
+
var result = [];
|
8661 |
+
$replace(string, rePropName, function (match, number, quote, subString) {
|
8662 |
+
result[result.length] = quote ? $replace(subString, reEscapeChar, '$1') : (number || match);
|
8663 |
+
});
|
8664 |
+
return result;
|
8665 |
+
};
|
8666 |
+
/* end adaptation */
|
8667 |
+
|
8668 |
+
var getBaseIntrinsic = function getBaseIntrinsic(name, allowMissing) {
|
8669 |
+
if (!(name in INTRINSICS)) {
|
8670 |
+
throw new SyntaxError('intrinsic ' + name + ' does not exist!');
|
8671 |
+
}
|
8672 |
+
|
8673 |
+
// istanbul ignore if // hopefully this is impossible to test :-)
|
8674 |
+
if (typeof INTRINSICS[name] === 'undefined' && !allowMissing) {
|
8675 |
+
throw new $TypeError('intrinsic ' + name + ' exists, but is not available. Please file an issue!');
|
8676 |
+
}
|
8677 |
+
|
8678 |
+
return INTRINSICS[name];
|
8679 |
+
};
|
8680 |
+
|
8681 |
+
module.exports = function GetIntrinsic(name, allowMissing) {
|
8682 |
+
if (typeof name !== 'string' || name.length === 0) {
|
8683 |
+
throw new TypeError('intrinsic name must be a non-empty string');
|
8684 |
+
}
|
8685 |
+
if (arguments.length > 1 && typeof allowMissing !== 'boolean') {
|
8686 |
+
throw new TypeError('"allowMissing" argument must be a boolean');
|
8687 |
+
}
|
8688 |
+
|
8689 |
+
var parts = stringToPath(name);
|
8690 |
+
|
8691 |
+
var value = getBaseIntrinsic('%' + (parts.length > 0 ? parts[0] : '') + '%', allowMissing);
|
8692 |
+
for (var i = 1; i < parts.length; i += 1) {
|
8693 |
+
if (value != null) {
|
8694 |
+
if ($gOPD && (i + 1) >= parts.length) {
|
8695 |
+
var desc = $gOPD(value, parts[i]);
|
8696 |
+
if (!allowMissing && !(parts[i] in value)) {
|
8697 |
+
throw new $TypeError('base intrinsic for ' + name + ' exists, but the property is not available.');
|
8698 |
+
}
|
8699 |
+
// By convention, when a data property is converted to an accessor
|
8700 |
+
// property to emulate a data property that does not suffer from
|
8701 |
+
// the override mistake, that accessor's getter is marked with
|
8702 |
+
// an `originalValue` property. Here, when we detect this, we
|
8703 |
+
// uphold the illusion by pretending to see that original data
|
8704 |
+
// property, i.e., returning the value rather than the getter
|
8705 |
+
// itself.
|
8706 |
+
value = desc && 'get' in desc && !('originalValue' in desc.get) ? desc.get : value[parts[i]];
|
8707 |
+
} else {
|
8708 |
+
value = value[parts[i]];
|
8709 |
+
}
|
8710 |
+
}
|
8711 |
+
}
|
8712 |
+
return value;
|
8713 |
+
};
|
8714 |
+
|
8715 |
+
|
8716 |
+
/***/ }),
|
8717 |
+
/* 45 */
|
8718 |
/***/ (function(module, exports, __webpack_require__) {
|
8719 |
|
8720 |
"use strict";
|
8752 |
// DCE check should happen before ReactDOM bundle executes so that
|
8753 |
// DevTools can report bad minification during injection.
|
8754 |
checkDCE();
|
8755 |
+
module.exports = __webpack_require__(457);
|
8756 |
} else {
|
8757 |
+
module.exports = __webpack_require__(460);
|
8758 |
}
|
8759 |
|
8760 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
8761 |
|
8762 |
/***/ }),
|
8763 |
+
/* 46 */
|
8764 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8765 |
|
8766 |
"use strict";
|
8796 |
//# sourceMappingURL=index.js.map
|
8797 |
|
8798 |
/***/ }),
|
8799 |
+
/* 47 */
|
8800 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8801 |
|
8802 |
"use strict";
|
8832 |
//# sourceMappingURL=index.js.map
|
8833 |
|
8834 |
/***/ }),
|
8835 |
+
/* 48 */
|
8836 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8837 |
|
8838 |
"use strict";
|
8839 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getLineIndex;
|
8840 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__special_characters__ = __webpack_require__(30);
|
8841 |
/**
|
8842 |
* Internal dependencies
|
8843 |
*/
|
8844 |
|
8845 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
8846 |
+
|
8847 |
/**
|
8848 |
* Gets the currently selected line index, or the first line index if the
|
8849 |
* selection spans over multiple items.
|
8850 |
*
|
8851 |
+
* @param {RichTextValue} value Value to get the line index from.
|
8852 |
+
* @param {boolean} startIndex Optional index that should be contained by
|
8853 |
+
* the line. Defaults to the selection start
|
8854 |
+
* of the value.
|
8855 |
*
|
8856 |
+
* @return {number|void} The line index. Undefined if not found.
|
8857 |
*/
|
8858 |
|
8859 |
function getLineIndex(_ref) {
|
8871 |
//# sourceMappingURL=get-line-index.js.map
|
8872 |
|
8873 |
/***/ }),
|
8874 |
+
/* 49 */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
8875 |
/***/ (function(module, exports, __webpack_require__) {
|
8876 |
|
8877 |
"use strict";
|
8928 |
//# sourceMappingURL=and.js.map
|
8929 |
|
8930 |
/***/ }),
|
8931 |
+
/* 50 */
|
8932 |
/***/ (function(module, exports, __webpack_require__) {
|
8933 |
|
8934 |
"use strict";
|
8949 |
exports['default'] = _propTypes2['default'].oneOf(_constants.WEEKDAYS);
|
8950 |
|
8951 |
/***/ }),
|
8952 |
+
/* 51 */
|
8953 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
8954 |
|
8955 |
"use strict";
|
8956 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__primitives__ = __webpack_require__(78);
|
8957 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "g", function() { return __WEBPACK_IMPORTED_MODULE_0__primitives__["c"]; });
|
8958 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__autocomplete__ = __webpack_require__(468);
|
8959 |
/* unused harmony reexport Autocomplete */
|
8960 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__base_control__ = __webpack_require__(42);
|
8961 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_2__base_control__["a"]; });
|
8962 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__button__ = __webpack_require__(36);
|
8963 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_3__button__["a"]; });
|
8964 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__button_group__ = __webpack_require__(621);
|
8965 |
/* unused harmony reexport ButtonGroup */
|
8966 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__checkbox_control__ = __webpack_require__(622);
|
8967 |
/* unused harmony reexport CheckboxControl */
|
8968 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__clipboard_button__ = __webpack_require__(623);
|
8969 |
/* unused harmony reexport ClipboardButton */
|
8970 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__color_indicator__ = __webpack_require__(624);
|
8971 |
/* unused harmony reexport ColorIndicator */
|
8972 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__color_palette__ = __webpack_require__(625);
|
8973 |
/* unused harmony reexport ColorPalette */
|
8974 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__color_picker__ = __webpack_require__(201);
|
8975 |
/* unused harmony reexport ColorPicker */
|
8976 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__dashicon__ = __webpack_require__(55);
|
8977 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_10__dashicon__["a"]; });
|
8978 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__date_time__ = __webpack_require__(631);
|
8979 |
/* unused harmony reexport DateTimePicker */
|
8980 |
/* unused harmony reexport DatePicker */
|
8981 |
/* unused harmony reexport TimePicker */
|
8982 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__disabled__ = __webpack_require__(787);
|
8983 |
/* unused harmony reexport Disabled */
|
8984 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__draggable__ = __webpack_require__(788);
|
8985 |
/* unused harmony reexport Draggable */
|
8986 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__drop_zone__ = __webpack_require__(789);
|
8987 |
/* unused harmony reexport DropZone */
|
8988 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__drop_zone_provider__ = __webpack_require__(424);
|
8989 |
/* unused harmony reexport DropZoneProvider */
|
8990 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__dropdown__ = __webpack_require__(85);
|
8991 |
/* unused harmony reexport Dropdown */
|
8992 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__dropdown_menu__ = __webpack_require__(425);
|
8993 |
/* unused harmony reexport DropdownMenu */
|
8994 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__external_link__ = __webpack_require__(792);
|
8995 |
/* unused harmony reexport ExternalLink */
|
8996 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__focusable_iframe__ = __webpack_require__(427);
|
8997 |
/* unused harmony reexport FocusableIframe */
|
8998 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__font_size_picker__ = __webpack_require__(793);
|
8999 |
/* unused harmony reexport FontSizePicker */
|
9000 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_21__form_file_upload__ = __webpack_require__(794);
|
9001 |
/* unused harmony reexport FormFileUpload */
|
9002 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_22__form_toggle__ = __webpack_require__(429);
|
9003 |
/* unused harmony reexport FormToggle */
|
9004 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_23__form_token_field__ = __webpack_require__(795);
|
9005 |
/* unused harmony reexport FormTokenField */
|
9006 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_24__icon__ = __webpack_require__(430);
|
9007 |
/* unused harmony reexport Icon */
|
9008 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_25__icon_button__ = __webpack_require__(37);
|
9009 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return __WEBPACK_IMPORTED_MODULE_25__icon_button__["a"]; });
|
9010 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_26__keyboard_shortcuts__ = __webpack_require__(68);
|
9011 |
/* unused harmony reexport KeyboardShortcuts */
|
9012 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_27__menu_group__ = __webpack_require__(802);
|
9013 |
/* unused harmony reexport MenuGroup */
|
9014 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_28__menu_item__ = __webpack_require__(431);
|
9015 |
/* unused harmony reexport MenuItem */
|
9016 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_29__menu_items_choice__ = __webpack_require__(803);
|
9017 |
/* unused harmony reexport MenuItemsChoice */
|
9018 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_30__modal__ = __webpack_require__(804);
|
9019 |
/* unused harmony reexport Modal */
|
9020 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_31__scroll_lock__ = __webpack_require__(197);
|
9021 |
/* unused harmony reexport ScrollLock */
|
9022 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_32__navigable_container__ = __webpack_require__(76);
|
9023 |
/* unused harmony reexport NavigableMenu */
|
9024 |
/* unused harmony reexport TabbableContainer */
|
9025 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_33__notice__ = __webpack_require__(432);
|
9026 |
/* unused harmony reexport Notice */
|
9027 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_34__notice_list__ = __webpack_require__(433);
|
9028 |
/* unused harmony reexport NoticeList */
|
9029 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_35__panel__ = __webpack_require__(808);
|
9030 |
/* unused harmony reexport Panel */
|
9031 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_36__panel_body__ = __webpack_require__(809);
|
9032 |
/* unused harmony reexport PanelBody */
|
9033 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_37__panel_header__ = __webpack_require__(434);
|
9034 |
/* unused harmony reexport PanelHeader */
|
9035 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_38__panel_row__ = __webpack_require__(810);
|
9036 |
/* unused harmony reexport PanelRow */
|
9037 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_39__placeholder__ = __webpack_require__(435);
|
9038 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "e", function() { return __WEBPACK_IMPORTED_MODULE_39__placeholder__["a"]; });
|
9039 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_40__popover__ = __webpack_require__(84);
|
9040 |
/* unused harmony reexport Popover */
|
9041 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_41__query_controls__ = __webpack_require__(811);
|
9042 |
/* unused harmony reexport QueryControls */
|
9043 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_42__radio_control__ = __webpack_require__(814);
|
9044 |
/* unused harmony reexport RadioControl */
|
9045 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_43__range_control__ = __webpack_require__(428);
|
9046 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "f", function() { return __WEBPACK_IMPORTED_MODULE_43__range_control__["a"]; });
|
9047 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_44__resizable_box__ = __webpack_require__(815);
|
9048 |
/* unused harmony reexport ResizableBox */
|
9049 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_45__responsive_wrapper__ = __webpack_require__(817);
|
9050 |
/* unused harmony reexport ResponsiveWrapper */
|
9051 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_46__sandbox__ = __webpack_require__(818);
|
9052 |
/* unused harmony reexport SandBox */
|
9053 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_47__select_control__ = __webpack_require__(819);
|
9054 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "h", function() { return __WEBPACK_IMPORTED_MODULE_47__select_control__["a"]; });
|
9055 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_48__spinner__ = __webpack_require__(437);
|
9056 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "i", function() { return __WEBPACK_IMPORTED_MODULE_48__spinner__["a"]; });
|
9057 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_49__server_side_render__ = __webpack_require__(820);
|
9058 |
/* unused harmony reexport ServerSideRender */
|
9059 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_50__tab_panel__ = __webpack_require__(853);
|
9060 |
/* unused harmony reexport TabPanel */
|
9061 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_51__text_control__ = __webpack_require__(202);
|
9062 |
/* unused harmony reexport TextControl */
|
9063 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_52__textarea_control__ = __webpack_require__(854);
|
9064 |
/* unused harmony reexport TextareaControl */
|
9065 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_53__toggle_control__ = __webpack_require__(855);
|
9066 |
/* unused harmony reexport ToggleControl */
|
9067 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_54__toolbar__ = __webpack_require__(856);
|
9068 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "j", function() { return __WEBPACK_IMPORTED_MODULE_54__toolbar__["a"]; });
|
9069 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_55__toolbar_button__ = __webpack_require__(443);
|
9070 |
/* unused harmony reexport ToolbarButton */
|
9071 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_56__tooltip__ = __webpack_require__(118);
|
9072 |
/* unused harmony reexport Tooltip */
|
9073 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_57__tree_select__ = __webpack_require__(436);
|
9074 |
/* unused harmony reexport TreeSelect */
|
9075 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_58__isolated_event_container__ = __webpack_require__(119);
|
9076 |
/* unused harmony reexport IsolatedEventContainer */
|
9077 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_59__slot_fill__ = __webpack_require__(198);
|
9078 |
/* unused harmony reexport createSlotFill */
|
9079 |
/* unused harmony reexport Slot */
|
9080 |
/* unused harmony reexport Fill */
|
9081 |
/* unused harmony reexport SlotFillProvider */
|
9082 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_60__higher_order_navigate_regions__ = __webpack_require__(859);
|
9083 |
/* unused harmony reexport navigateRegions */
|
9084 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_61__higher_order_with_constrained_tabbing__ = __webpack_require__(117);
|
9085 |
/* unused harmony reexport withConstrainedTabbing */
|
9086 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_62__higher_order_with_fallback_styles__ = __webpack_require__(860);
|
9087 |
/* unused harmony reexport withFallbackStyles */
|
9088 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_63__higher_order_with_filters__ = __webpack_require__(861);
|
9089 |
/* unused harmony reexport withFilters */
|
9090 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_64__higher_order_with_focus_outside__ = __webpack_require__(193);
|
9091 |
/* unused harmony reexport withFocusOutside */
|
9092 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_65__higher_order_with_focus_return__ = __webpack_require__(116);
|
9093 |
/* unused harmony reexport withFocusReturn */
|
9094 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_66__higher_order_with_notices__ = __webpack_require__(862);
|
9095 |
/* unused harmony reexport withNotices */
|
9096 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_67__higher_order_with_spoken_messages__ = __webpack_require__(121);
|
9097 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "k", function() { return __WEBPACK_IMPORTED_MODULE_67__higher_order_with_spoken_messages__["a"]; });
|
9098 |
// Components
|
9099 |
// eslint-disable-next-line camelcase
|
9169 |
//# sourceMappingURL=index.js.map
|
9170 |
|
9171 |
/***/ }),
|
9172 |
+
/* 52 */
|
9173 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
9174 |
|
9175 |
"use strict";
|
9176 |
/* harmony export (immutable) */ __webpack_exports__["a"] = normaliseFormats;
|
9177 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
9178 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__is_format_equal__ = __webpack_require__(109);
|
9179 |
|
9180 |
|
9181 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
9186 |
* Internal dependencies
|
9187 |
*/
|
9188 |
|
9189 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
9190 |
+
|
9191 |
/**
|
9192 |
* Normalises formats: ensures subsequent adjacent equal formats have the same
|
9193 |
* reference.
|
9194 |
*
|
9195 |
+
* @param {RichTextValue} value Value to normalise formats of.
|
9196 |
*
|
9197 |
+
* @return {RichTextValue} New value with normalised formats.
|
9198 |
*/
|
9199 |
|
9200 |
function normaliseFormats(value) {
|
9214 |
newFormats[index] = newFormatsAtIndex;
|
9215 |
}
|
9216 |
});
|
9217 |
+
return _objectSpread(_objectSpread({}, value), {}, {
|
9218 |
formats: newFormats
|
9219 |
});
|
9220 |
}
|
9221 |
//# sourceMappingURL=normalise-formats.js.map
|
9222 |
|
9223 |
/***/ }),
|
9224 |
+
/* 53 */
|
9225 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
9226 |
|
9227 |
"use strict";
|
9228 |
/* harmony export (immutable) */ __webpack_exports__["a"] = create;
|
9229 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
9230 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
9231 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_typeof__ = __webpack_require__(39);
|
9232 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_data__ = __webpack_require__(41);
|
9233 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__is_format_equal__ = __webpack_require__(109);
|
9234 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__create_element__ = __webpack_require__(110);
|
9235 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__concat__ = __webpack_require__(177);
|
9236 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__special_characters__ = __webpack_require__(30);
|
9237 |
|
9238 |
|
9239 |
|
9254 |
|
9255 |
|
9256 |
|
9257 |
+
/**
|
9258 |
+
* @typedef {Object} RichTextFormat
|
9259 |
+
*
|
9260 |
+
* @property {string} type Format type.
|
9261 |
+
*/
|
9262 |
+
|
9263 |
+
/**
|
9264 |
+
* @typedef {Array<RichTextFormat>} RichTextFormatList
|
9265 |
+
*/
|
9266 |
+
|
9267 |
+
/**
|
9268 |
+
* @typedef {Object} RichTextValue
|
9269 |
+
*
|
9270 |
+
* @property {string} text Text.
|
9271 |
+
* @property {Array<RichTextFormatList>} formats Formats.
|
9272 |
+
* @property {Array<RichTextFormat>} replacements Replacements.
|
9273 |
+
* @property {number|undefined} start Selection start.
|
9274 |
+
* @property {number|undefined} end Selection end.
|
9275 |
+
*/
|
9276 |
|
9277 |
function createEmptyValue() {
|
9278 |
return {
|
9296 |
var formatType;
|
9297 |
|
9298 |
if (attributes && attributes.class) {
|
9299 |
+
formatType = Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_data__["d" /* select */])('core/rich-text').getFormatTypeForClassName(attributes.class);
|
9300 |
|
9301 |
if (formatType) {
|
9302 |
// Preserve any additional classes.
|
9309 |
}
|
9310 |
|
9311 |
if (!formatType) {
|
9312 |
+
formatType = Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_data__["d" /* select */])('core/rich-text').getFormatTypeForBareElement(type);
|
9313 |
}
|
9314 |
|
9315 |
if (!formatType) {
|
9387 |
* multiline.
|
9388 |
* @param {Array} [$1.multilineWrapperTags] Tags where lines can be found if
|
9389 |
* nesting is possible.
|
9390 |
+
* @param {boolean} [$1.preserveWhiteSpace] Whether or not to collapse white
|
9391 |
* space characters.
|
9392 |
+
* @param {boolean} [$1.__unstableIsEditableTree]
|
9393 |
*
|
9394 |
+
* @return {RichTextValue} A rich text value.
|
9395 |
*/
|
9396 |
|
9397 |
|
9496 |
* @param {Range} range The range to filter.
|
9497 |
* @param {Function} filter Function to use to filter the text.
|
9498 |
*
|
9499 |
+
* @return {Object|void} Object containing range properties.
|
9500 |
*/
|
9501 |
|
9502 |
|
9550 |
/**
|
9551 |
* Creates a Rich Text value from a DOM element and range.
|
9552 |
*
|
9553 |
+
* @param {Object} $1 Named argements.
|
9554 |
+
* @param {Element} [$1.element] Element to create value from.
|
9555 |
+
* @param {Range} [$1.range] Range to create value from.
|
9556 |
+
* @param {string} [$1.multilineTag] Multiline tag if the structure is
|
9557 |
* multiline.
|
9558 |
+
* @param {Array} [$1.multilineWrapperTags] Tags where lines can be found if
|
9559 |
* nesting is possible.
|
9560 |
+
* @param {boolean} [$1.preserveWhiteSpace] Whether or not to collapse white
|
9561 |
* space characters.
|
9562 |
+
* @param {Array} [$1.currentWrapperTags]
|
9563 |
+
* @param {boolean} [$1.isEditableTree]
|
9564 |
*
|
9565 |
+
* @return {RichTextValue} A rich text value.
|
9566 |
*/
|
9567 |
|
9568 |
|
9696 |
|
9697 |
|
9698 |
mergeFormats.newFormats = [format];
|
9699 |
+
Object(__WEBPACK_IMPORTED_MODULE_6__concat__["a" /* mergePair */])(accumulator, _objectSpread(_objectSpread({}, value), {}, {
|
9700 |
formats: Array.from(value.formats, mergeFormats)
|
9701 |
}));
|
9702 |
}
|
9714 |
* Creates a rich text value from a DOM element and range that should be
|
9715 |
* multiline.
|
9716 |
*
|
9717 |
+
* @param {Object} $1 Named argements.
|
9718 |
+
* @param {Element} [$1.element] Element to create value from.
|
9719 |
+
* @param {Range} [$1.range] Range to create value from.
|
9720 |
+
* @param {string} [$1.multilineTag] Multiline tag if the structure is
|
9721 |
+
* multiline.
|
9722 |
+
* @param {Array} [$1.multilineWrapperTags] Tags where lines can be found if
|
9723 |
+
* nesting is possible.
|
9724 |
+
* @param {boolean} [$1.currentWrapperTags] Whether to prepend a line
|
9725 |
+
* separator.
|
9726 |
+
* @param {boolean} [$1.preserveWhiteSpace] Whether or not to collapse white
|
9727 |
+
* space characters.
|
9728 |
+
* @param {boolean} [$1.isEditableTree]
|
9729 |
*
|
9730 |
+
* @return {RichTextValue} A rich text value.
|
9731 |
*/
|
9732 |
|
9733 |
|
9782 |
/**
|
9783 |
* Gets the attributes of an element in object shape.
|
9784 |
*
|
9785 |
+
* @param {Object} $1 Named argements.
|
9786 |
+
* @param {Element} $1.element Element to get attributes from.
|
9787 |
*
|
9788 |
+
* @return {Object|void} Attribute object or `undefined` if the element has no
|
9789 |
+
* attributes.
|
9790 |
*/
|
9791 |
|
9792 |
|
9818 |
//# sourceMappingURL=create.js.map
|
9819 |
|
9820 |
/***/ }),
|
9821 |
+
/* 54 */
|
9822 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
9823 |
|
9824 |
"use strict";
|
9825 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return focus; });
|
9826 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__focusable__ = __webpack_require__(191);
|
9827 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__tabbable__ = __webpack_require__(604);
|
9828 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__dom__ = __webpack_require__(605);
|
9829 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_2__dom__["a"]; });
|
9830 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__phrasing_content__ = __webpack_require__(192);
|
9831 |
+
/* unused harmony namespace reexport */
|
9832 |
/**
|
9833 |
* Internal dependencies
|
9834 |
*/
|
9844 |
tabbable: __WEBPACK_IMPORTED_MODULE_1__tabbable__
|
9845 |
};
|
9846 |
|
9847 |
+
|
9848 |
//# sourceMappingURL=index.js.map
|
9849 |
|
9850 |
/***/ }),
|
9851 |
+
/* 55 */
|
9852 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
9853 |
|
9854 |
"use strict";
|
9859 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
9860 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
9861 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_element__ = __webpack_require__(1);
|
9862 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__primitives__ = __webpack_require__(78);
|
9863 |
|
9864 |
|
9865 |
|
11087 |
//# sourceMappingURL=index.js.map
|
11088 |
|
11089 |
/***/ }),
|
11090 |
+
/* 56 */
|
11091 |
/***/ (function(module, exports, __webpack_require__) {
|
11092 |
|
11093 |
"use strict";
|
11094 |
|
11095 |
|
11096 |
+
// https://www.ecma-international.org/ecma-262/6.0/#sec-ispropertykey
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
11097 |
|
11098 |
+
module.exports = function IsPropertyKey(argument) {
|
11099 |
+
return typeof argument === 'string' || typeof argument === 'symbol';
|
11100 |
};
|
11101 |
|
11102 |
|
11103 |
/***/ }),
|
11104 |
+
/* 57 */
|
11105 |
/***/ (function(module, exports, __webpack_require__) {
|
11106 |
|
11107 |
"use strict";
|
11116 |
|
11117 |
|
11118 |
|
11119 |
+
var shallowEqual = __webpack_require__(688);
|
11120 |
|
11121 |
/**
|
11122 |
* Does a shallow comparison for props and state.
|
11134 |
|
11135 |
|
11136 |
/***/ }),
|
11137 |
+
/* 58 */
|
11138 |
/***/ (function(module, exports, __webpack_require__) {
|
11139 |
|
11140 |
"use strict";
|
11159 |
}
|
11160 |
|
11161 |
/***/ }),
|
11162 |
+
/* 59 */
|
11163 |
/***/ (function(module, exports, __webpack_require__) {
|
11164 |
|
11165 |
"use strict";
|
11186 |
}
|
11187 |
|
11188 |
/***/ }),
|
11189 |
+
/* 60 */
|
11190 |
/***/ (function(module, exports, __webpack_require__) {
|
11191 |
|
11192 |
"use strict";
|
11207 |
exports['default'] = _propTypes2['default'].oneOf([_constants.HORIZONTAL_ORIENTATION, _constants.VERTICAL_ORIENTATION, _constants.VERTICAL_SCROLLABLE]);
|
11208 |
|
11209 |
/***/ }),
|
11210 |
+
/* 61 */
|
11211 |
/***/ (function(module, exports) {
|
11212 |
|
11213 |
Object.defineProperty(exports, "__esModule", {
|
11220 |
module.exports = exports['default'];
|
11221 |
|
11222 |
/***/ }),
|
11223 |
+
/* 62 */
|
11224 |
/***/ (function(module, exports, __webpack_require__) {
|
11225 |
|
11226 |
"use strict";
|
11241 |
exports['default'] = _propTypes2['default'].oneOf([_constants.OPEN_DOWN, _constants.OPEN_UP]);
|
11242 |
|
11243 |
/***/ }),
|
11244 |
+
/* 63 */
|
11245 |
/***/ (function(module, exports, __webpack_require__) {
|
11246 |
|
11247 |
"use strict";
|
11338 |
|
11339 |
|
11340 |
/***/ }),
|
11341 |
+
/* 64 */
|
11342 |
+
/***/ (function(module, exports, __webpack_require__) {
|
11343 |
+
|
11344 |
+
/* WEBPACK VAR INJECTION */(function(process) {/**
|
11345 |
+
* Memize options object.
|
11346 |
+
*
|
11347 |
+
* @typedef MemizeOptions
|
11348 |
+
*
|
11349 |
+
* @property {number} [maxSize] Maximum size of the cache.
|
11350 |
+
*/
|
11351 |
+
|
11352 |
+
/**
|
11353 |
+
* Internal cache entry.
|
11354 |
+
*
|
11355 |
+
* @typedef MemizeCacheNode
|
11356 |
+
*
|
11357 |
+
* @property {?MemizeCacheNode|undefined} [prev] Previous node.
|
11358 |
+
* @property {?MemizeCacheNode|undefined} [next] Next node.
|
11359 |
+
* @property {Array<*>} args Function arguments for cache
|
11360 |
+
* entry.
|
11361 |
+
* @property {*} val Function result.
|
11362 |
+
*/
|
11363 |
+
|
11364 |
+
/**
|
11365 |
+
* Properties of the enhanced function for controlling cache.
|
11366 |
+
*
|
11367 |
+
* @typedef MemizeMemoizedFunction
|
11368 |
+
*
|
11369 |
+
* @property {()=>void} clear Clear the cache.
|
11370 |
+
*/
|
11371 |
+
|
11372 |
+
/**
|
11373 |
+
* Accepts a function to be memoized, and returns a new memoized function, with
|
11374 |
+
* optional options.
|
11375 |
+
*
|
11376 |
+
* @template {Function} F
|
11377 |
+
*
|
11378 |
+
* @param {F} fn Function to memoize.
|
11379 |
+
* @param {MemizeOptions} [options] Options object.
|
11380 |
+
*
|
11381 |
+
* @return {F & MemizeMemoizedFunction} Memoized function.
|
11382 |
+
*/
|
11383 |
+
function memize( fn, options ) {
|
11384 |
+
var size = 0;
|
11385 |
+
|
11386 |
+
/** @type {?MemizeCacheNode|undefined} */
|
11387 |
+
var head;
|
11388 |
+
|
11389 |
+
/** @type {?MemizeCacheNode|undefined} */
|
11390 |
+
var tail;
|
11391 |
+
|
11392 |
+
options = options || {};
|
11393 |
+
|
11394 |
+
function memoized( /* ...args */ ) {
|
11395 |
+
var node = head,
|
11396 |
+
len = arguments.length,
|
11397 |
+
args, i;
|
11398 |
+
|
11399 |
+
searchCache: while ( node ) {
|
11400 |
+
// Perform a shallow equality test to confirm that whether the node
|
11401 |
+
// under test is a candidate for the arguments passed. Two arrays
|
11402 |
+
// are shallowly equal if their length matches and each entry is
|
11403 |
+
// strictly equal between the two sets. Avoid abstracting to a
|
11404 |
+
// function which could incur an arguments leaking deoptimization.
|
11405 |
+
|
11406 |
+
// Check whether node arguments match arguments length
|
11407 |
+
if ( node.args.length !== arguments.length ) {
|
11408 |
+
node = node.next;
|
11409 |
+
continue;
|
11410 |
+
}
|
11411 |
+
|
11412 |
+
// Check whether node arguments match arguments values
|
11413 |
+
for ( i = 0; i < len; i++ ) {
|
11414 |
+
if ( node.args[ i ] !== arguments[ i ] ) {
|
11415 |
+
node = node.next;
|
11416 |
+
continue searchCache;
|
11417 |
+
}
|
11418 |
+
}
|
11419 |
+
|
11420 |
+
// At this point we can assume we've found a match
|
11421 |
+
|
11422 |
+
// Surface matched node to head if not already
|
11423 |
+
if ( node !== head ) {
|
11424 |
+
// As tail, shift to previous. Must only shift if not also
|
11425 |
+
// head, since if both head and tail, there is no previous.
|
11426 |
+
if ( node === tail ) {
|
11427 |
+
tail = node.prev;
|
11428 |
+
}
|
11429 |
+
|
11430 |
+
// Adjust siblings to point to each other. If node was tail,
|
11431 |
+
// this also handles new tail's empty `next` assignment.
|
11432 |
+
/** @type {MemizeCacheNode} */ ( node.prev ).next = node.next;
|
11433 |
+
if ( node.next ) {
|
11434 |
+
node.next.prev = node.prev;
|
11435 |
+
}
|
11436 |
+
|
11437 |
+
node.next = head;
|
11438 |
+
node.prev = null;
|
11439 |
+
/** @type {MemizeCacheNode} */ ( head ).prev = node;
|
11440 |
+
head = node;
|
11441 |
+
}
|
11442 |
+
|
11443 |
+
// Return immediately
|
11444 |
+
return node.val;
|
11445 |
+
}
|
11446 |
+
|
11447 |
+
// No cached value found. Continue to insertion phase:
|
11448 |
+
|
11449 |
+
// Create a copy of arguments (avoid leaking deoptimization)
|
11450 |
+
args = new Array( len );
|
11451 |
+
for ( i = 0; i < len; i++ ) {
|
11452 |
+
args[ i ] = arguments[ i ];
|
11453 |
+
}
|
11454 |
+
|
11455 |
+
node = {
|
11456 |
+
args: args,
|
11457 |
+
|
11458 |
+
// Generate the result from original function
|
11459 |
+
val: fn.apply( null, args ),
|
11460 |
+
};
|
11461 |
+
|
11462 |
+
// Don't need to check whether node is already head, since it would
|
11463 |
+
// have been returned above already if it was
|
11464 |
+
|
11465 |
+
// Shift existing head down list
|
11466 |
+
if ( head ) {
|
11467 |
+
head.prev = node;
|
11468 |
+
node.next = head;
|
11469 |
+
} else {
|
11470 |
+
// If no head, follows that there's no tail (at initial or reset)
|
11471 |
+
tail = node;
|
11472 |
+
}
|
11473 |
+
|
11474 |
+
// Trim tail if we're reached max size and are pending cache insertion
|
11475 |
+
if ( size === /** @type {MemizeOptions} */ ( options ).maxSize ) {
|
11476 |
+
tail = /** @type {MemizeCacheNode} */ ( tail ).prev;
|
11477 |
+
/** @type {MemizeCacheNode} */ ( tail ).next = null;
|
11478 |
+
} else {
|
11479 |
+
size++;
|
11480 |
+
}
|
11481 |
+
|
11482 |
+
head = node;
|
11483 |
+
|
11484 |
+
return node.val;
|
11485 |
+
}
|
11486 |
+
|
11487 |
+
memoized.clear = function() {
|
11488 |
+
head = null;
|
11489 |
+
tail = null;
|
11490 |
+
size = 0;
|
11491 |
+
};
|
11492 |
+
|
11493 |
+
if ( process.env.NODE_ENV === 'test' ) {
|
11494 |
+
// Cache is not exposed in the public API, but used in tests to ensure
|
11495 |
+
// expected list progression
|
11496 |
+
memoized.getCache = function() {
|
11497 |
+
return [ head, tail, size ];
|
11498 |
+
};
|
11499 |
+
}
|
11500 |
+
|
11501 |
+
// Ignore reason: There's not a clear solution to create an intersection of
|
11502 |
+
// the function with additional properties, where the goal is to retain the
|
11503 |
+
// function signature of the incoming argument and add control properties
|
11504 |
+
// on the return value.
|
11505 |
+
|
11506 |
+
// @ts-ignore
|
11507 |
+
return memoized;
|
11508 |
+
}
|
11509 |
+
|
11510 |
+
module.exports = memize;
|
11511 |
+
|
11512 |
+
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
11513 |
+
|
11514 |
+
/***/ }),
|
11515 |
+
/* 65 */
|
11516 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
11517 |
|
11518 |
"use strict";
|
11534 |
/* unused harmony export didFilter */
|
11535 |
/* unused harmony export actions */
|
11536 |
/* unused harmony export filters */
|
11537 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__createHooks__ = __webpack_require__(540);
|
11538 |
/* unused harmony reexport createHooks */
|
11539 |
/**
|
11540 |
* Internal dependencies
|
11565 |
//# sourceMappingURL=index.js.map
|
11566 |
|
11567 |
/***/ }),
|
11568 |
+
/* 66 */
|
11569 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
11570 |
|
11571 |
"use strict";
|
11572 |
/* harmony export (immutable) */ __webpack_exports__["a"] = insert;
|
11573 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__create__ = __webpack_require__(53);
|
11574 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__normalise_formats__ = __webpack_require__(52);
|
11575 |
/**
|
11576 |
* Internal dependencies
|
11577 |
*/
|
11578 |
|
11579 |
|
11580 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
11581 |
+
|
11582 |
/**
|
11583 |
* Insert a Rich Text value, an HTML string, or a plain text string, into a
|
11584 |
* Rich Text value at the given `startIndex`. Any content between `startIndex`
|
11585 |
* and `endIndex` will be removed. Indices are retrieved from the selection if
|
11586 |
* none are provided.
|
11587 |
*
|
11588 |
+
* @param {RichTextValue} value Value to modify.
|
11589 |
+
* @param {RichTextValue|string} valueToInsert Value to insert.
|
11590 |
+
* @param {number} [startIndex] Start index.
|
11591 |
+
* @param {number} [endIndex] End index.
|
11592 |
*
|
11593 |
+
* @return {RichTextValue} A new value with the value inserted.
|
11594 |
*/
|
11595 |
|
11596 |
function insert(value, valueToInsert) {
|
11618 |
//# sourceMappingURL=insert.js.map
|
11619 |
|
11620 |
/***/ }),
|
11621 |
+
/* 67 */
|
11622 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
11623 |
|
11624 |
"use strict";
|
11630 |
/* harmony export (immutable) */ __webpack_exports__["c"] = calculateSaturationChange;
|
11631 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash__ = __webpack_require__(2);
|
11632 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_lodash__);
|
11633 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_tinycolor2__ = __webpack_require__(627);
|
11634 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_tinycolor2___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_tinycolor2__);
|
11635 |
/**
|
11636 |
* Parts of this source were derived and modified from react-color,
|
11869 |
//# sourceMappingURL=utils.js.map
|
11870 |
|
11871 |
/***/ }),
|
11872 |
+
/* 68 */
|
11873 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
11874 |
|
11875 |
"use strict";
|
11878 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
11879 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
11880 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
11881 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
11882 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_element__ = __webpack_require__(1);
|
11883 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_mousetrap__ = __webpack_require__(99);
|
11884 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_mousetrap___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_7_mousetrap__);
|
11885 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_mousetrap_plugins_global_bind_mousetrap_global_bind__ = __webpack_require__(100);
|
11886 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_mousetrap_plugins_global_bind_mousetrap_global_bind___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_mousetrap_plugins_global_bind_mousetrap_global_bind__);
|
11887 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_lodash__ = __webpack_require__(2);
|
11888 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_9_lodash__);
|
11979 |
//# sourceMappingURL=index.js.map
|
11980 |
|
11981 |
/***/ }),
|
11982 |
+
/* 69 */
|
11983 |
/***/ (function(module, exports, __webpack_require__) {
|
11984 |
|
11985 |
"use strict";
|
11986 |
|
11987 |
|
11988 |
+
var GetIntrinsic = __webpack_require__(19);
|
11989 |
|
11990 |
+
var callBind = __webpack_require__(122);
|
11991 |
+
|
11992 |
+
var $indexOf = callBind(GetIntrinsic('String.prototype.indexOf'));
|
11993 |
+
|
11994 |
+
module.exports = function callBoundIntrinsic(name, allowMissing) {
|
11995 |
+
var intrinsic = GetIntrinsic(name, !!allowMissing);
|
11996 |
+
if (typeof intrinsic === 'function' && $indexOf(name, '.prototype.')) {
|
11997 |
+
return callBind(intrinsic);
|
11998 |
+
}
|
11999 |
+
return intrinsic;
|
12000 |
};
|
12001 |
|
12002 |
|
12003 |
/***/ }),
|
12004 |
+
/* 70 */
|
12005 |
/***/ (function(module, exports, __webpack_require__) {
|
12006 |
|
12007 |
"use strict";
|
12008 |
/* WEBPACK VAR INJECTION */(function(process) {
|
12009 |
|
12010 |
if (process.env.NODE_ENV === 'production') {
|
12011 |
+
module.exports = __webpack_require__(684);
|
12012 |
} else {
|
12013 |
+
module.exports = __webpack_require__(685);
|
12014 |
}
|
12015 |
|
12016 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
12017 |
|
12018 |
/***/ }),
|
12019 |
+
/* 71 */
|
12020 |
/***/ (function(module, exports, __webpack_require__) {
|
12021 |
|
12022 |
"use strict";
|
12037 |
exports['default'] = _propTypes2['default'].oneOf([_constants.ICON_BEFORE_POSITION, _constants.ICON_AFTER_POSITION]);
|
12038 |
|
12039 |
/***/ }),
|
12040 |
+
/* 72 */
|
12041 |
/***/ (function(module, exports, __webpack_require__) {
|
12042 |
|
12043 |
"use strict";
|
12058 |
exports['default'] = _propTypes2['default'].oneOf([_constants.INFO_POSITION_TOP, _constants.INFO_POSITION_BOTTOM, _constants.INFO_POSITION_BEFORE, _constants.INFO_POSITION_AFTER]);
|
12059 |
|
12060 |
/***/ }),
|
12061 |
+
/* 73 */
|
12062 |
/***/ (function(module, exports, __webpack_require__) {
|
12063 |
|
12064 |
"use strict";
|
12073 |
|
12074 |
var _moment2 = _interopRequireDefault(_moment);
|
12075 |
|
12076 |
+
var _isBeforeDay = __webpack_require__(74);
|
12077 |
|
12078 |
var _isBeforeDay2 = _interopRequireDefault(_isBeforeDay);
|
12079 |
|
12085 |
}
|
12086 |
|
12087 |
/***/ }),
|
12088 |
+
/* 74 */
|
12089 |
/***/ (function(module, exports, __webpack_require__) {
|
12090 |
|
12091 |
"use strict";
|
12120 |
}
|
12121 |
|
12122 |
/***/ }),
|
12123 |
+
/* 75 */
|
12124 |
/***/ (function(module, exports, __webpack_require__) {
|
12125 |
|
12126 |
"use strict";
|
12130 |
value: true
|
12131 |
});
|
12132 |
|
12133 |
+
var _react = __webpack_require__(9);
|
12134 |
|
12135 |
var _react2 = _interopRequireDefault(_react);
|
12136 |
|
12157 |
exports['default'] = CloseButton;
|
12158 |
|
12159 |
/***/ }),
|
12160 |
+
/* 76 */
|
12161 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
12162 |
|
12163 |
"use strict";
|
12164 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__menu__ = __webpack_require__(790);
|
12165 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_0__menu__["a"]; });
|
12166 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__tabbable__ = __webpack_require__(791);
|
12167 |
/* unused harmony reexport TabbableContainer */
|
12168 |
/**
|
12169 |
* Internal Dependencies
|
12173 |
//# sourceMappingURL=index.js.map
|
12174 |
|
12175 |
/***/ }),
|
12176 |
+
/* 77 */
|
12177 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
12178 |
|
12179 |
"use strict";
|
12184 |
/* harmony export (immutable) */ __webpack_exports__["c"] = escapeHTML;
|
12185 |
/* harmony export (immutable) */ __webpack_exports__["b"] = escapeEditableHTML;
|
12186 |
/* harmony export (immutable) */ __webpack_exports__["d"] = isValidAttributeName;
|
12187 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__escape_greater__ = __webpack_require__(466);
|
12188 |
/**
|
12189 |
* Internal dependencies
|
12190 |
*/
|
12309 |
//# sourceMappingURL=index.js.map
|
12310 |
|
12311 |
/***/ }),
|
12312 |
+
/* 78 */
|
12313 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
12314 |
|
12315 |
"use strict";
|
12316 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__svg__ = __webpack_require__(467);
|
12317 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_0__svg__["a"]; });
|
12318 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_0__svg__["b"]; });
|
12319 |
/* harmony namespace reexport (by used) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_0__svg__["c"]; });
|
12321 |
//# sourceMappingURL=index.js.map
|
12322 |
|
12323 |
/***/ }),
|
12324 |
+
/* 79 */
|
12325 |
/***/ (function(module, exports, __webpack_require__) {
|
12326 |
|
12327 |
+
var __WEBPACK_AMD_DEFINE_RESULT__;/* global window, exports, define */
|
12328 |
+
|
12329 |
+
!function() {
|
12330 |
+
'use strict'
|
12331 |
+
|
12332 |
+
var re = {
|
12333 |
+
not_string: /[^s]/,
|
12334 |
+
not_bool: /[^t]/,
|
12335 |
+
not_type: /[^T]/,
|
12336 |
+
not_primitive: /[^v]/,
|
12337 |
+
number: /[diefg]/,
|
12338 |
+
numeric_arg: /[bcdiefguxX]/,
|
12339 |
+
json: /[j]/,
|
12340 |
+
not_json: /[^j]/,
|
12341 |
+
text: /^[^\x25]+/,
|
12342 |
+
modulo: /^\x25{2}/,
|
12343 |
+
placeholder: /^\x25(?:([1-9]\d*)\$|\(([^)]+)\))?(\+)?(0|'[^$])?(-)?(\d+)?(?:\.(\d+))?([b-gijostTuvxX])/,
|
12344 |
+
key: /^([a-z_][a-z_\d]*)/i,
|
12345 |
+
key_access: /^\.([a-z_][a-z_\d]*)/i,
|
12346 |
+
index_access: /^\[(\d+)\]/,
|
12347 |
+
sign: /^[+-]/
|
12348 |
+
}
|
12349 |
+
|
12350 |
+
function sprintf(key) {
|
12351 |
+
// `arguments` is not an array, but should be fine for this call
|
12352 |
+
return sprintf_format(sprintf_parse(key), arguments)
|
12353 |
+
}
|
12354 |
+
|
12355 |
+
function vsprintf(fmt, argv) {
|
12356 |
+
return sprintf.apply(null, [fmt].concat(argv || []))
|
12357 |
+
}
|
12358 |
+
|
12359 |
+
function sprintf_format(parse_tree, argv) {
|
12360 |
+
var cursor = 1, tree_length = parse_tree.length, arg, output = '', i, k, ph, pad, pad_character, pad_length, is_positive, sign
|
12361 |
+
for (i = 0; i < tree_length; i++) {
|
12362 |
+
if (typeof parse_tree[i] === 'string') {
|
12363 |
+
output += parse_tree[i]
|
12364 |
+
}
|
12365 |
+
else if (typeof parse_tree[i] === 'object') {
|
12366 |
+
ph = parse_tree[i] // convenience purposes only
|
12367 |
+
if (ph.keys) { // keyword argument
|
12368 |
+
arg = argv[cursor]
|
12369 |
+
for (k = 0; k < ph.keys.length; k++) {
|
12370 |
+
if (arg == undefined) {
|
12371 |
+
throw new Error(sprintf('[sprintf] Cannot access property "%s" of undefined value "%s"', ph.keys[k], ph.keys[k-1]))
|
12372 |
+
}
|
12373 |
+
arg = arg[ph.keys[k]]
|
12374 |
+
}
|
12375 |
+
}
|
12376 |
+
else if (ph.param_no) { // positional argument (explicit)
|
12377 |
+
arg = argv[ph.param_no]
|
12378 |
+
}
|
12379 |
+
else { // positional argument (implicit)
|
12380 |
+
arg = argv[cursor++]
|
12381 |
+
}
|
12382 |
+
|
12383 |
+
if (re.not_type.test(ph.type) && re.not_primitive.test(ph.type) && arg instanceof Function) {
|
12384 |
+
arg = arg()
|
12385 |
+
}
|
12386 |
+
|
12387 |
+
if (re.numeric_arg.test(ph.type) && (typeof arg !== 'number' && isNaN(arg))) {
|
12388 |
+
throw new TypeError(sprintf('[sprintf] expecting number but found %T', arg))
|
12389 |
+
}
|
12390 |
+
|
12391 |
+
if (re.number.test(ph.type)) {
|
12392 |
+
is_positive = arg >= 0
|
12393 |
+
}
|
12394 |
+
|
12395 |
+
switch (ph.type) {
|
12396 |
+
case 'b':
|
12397 |
+
arg = parseInt(arg, 10).toString(2)
|
12398 |
+
break
|
12399 |
+
case 'c':
|
12400 |
+
arg = String.fromCharCode(parseInt(arg, 10))
|
12401 |
+
break
|
12402 |
+
case 'd':
|
12403 |
+
case 'i':
|
12404 |
+
arg = parseInt(arg, 10)
|
12405 |
+
break
|
12406 |
+
case 'j':
|
12407 |
+
arg = JSON.stringify(arg, null, ph.width ? parseInt(ph.width) : 0)
|
12408 |
+
break
|
12409 |
+
case 'e':
|
12410 |
+
arg = ph.precision ? parseFloat(arg).toExponential(ph.precision) : parseFloat(arg).toExponential()
|
12411 |
+
break
|
12412 |
+
case 'f':
|
12413 |
+
arg = ph.precision ? parseFloat(arg).toFixed(ph.precision) : parseFloat(arg)
|
12414 |
+
break
|
12415 |
+
case 'g':
|
12416 |
+
arg = ph.precision ? String(Number(arg.toPrecision(ph.precision))) : parseFloat(arg)
|
12417 |
+
break
|
12418 |
+
case 'o':
|
12419 |
+
arg = (parseInt(arg, 10) >>> 0).toString(8)
|
12420 |
+
break
|
12421 |
+
case 's':
|
12422 |
+
arg = String(arg)
|
12423 |
+
arg = (ph.precision ? arg.substring(0, ph.precision) : arg)
|
12424 |
+
break
|
12425 |
+
case 't':
|
12426 |
+
arg = String(!!arg)
|
12427 |
+
arg = (ph.precision ? arg.substring(0, ph.precision) : arg)
|
12428 |
+
break
|
12429 |
+
case 'T':
|
12430 |
+
arg = Object.prototype.toString.call(arg).slice(8, -1).toLowerCase()
|
12431 |
+
arg = (ph.precision ? arg.substring(0, ph.precision) : arg)
|
12432 |
+
break
|
12433 |
+
case 'u':
|
12434 |
+
arg = parseInt(arg, 10) >>> 0
|
12435 |
+
break
|
12436 |
+
case 'v':
|
12437 |
+
arg = arg.valueOf()
|
12438 |
+
arg = (ph.precision ? arg.substring(0, ph.precision) : arg)
|
12439 |
+
break
|
12440 |
+
case 'x':
|
12441 |
+
arg = (parseInt(arg, 10) >>> 0).toString(16)
|
12442 |
+
break
|
12443 |
+
case 'X':
|
12444 |
+
arg = (parseInt(arg, 10) >>> 0).toString(16).toUpperCase()
|
12445 |
+
break
|
12446 |
+
}
|
12447 |
+
if (re.json.test(ph.type)) {
|
12448 |
+
output += arg
|
12449 |
+
}
|
12450 |
+
else {
|
12451 |
+
if (re.number.test(ph.type) && (!is_positive || ph.sign)) {
|
12452 |
+
sign = is_positive ? '+' : '-'
|
12453 |
+
arg = arg.toString().replace(re.sign, '')
|
12454 |
+
}
|
12455 |
+
else {
|
12456 |
+
sign = ''
|
12457 |
+
}
|
12458 |
+
pad_character = ph.pad_char ? ph.pad_char === '0' ? '0' : ph.pad_char.charAt(1) : ' '
|
12459 |
+
pad_length = ph.width - (sign + arg).length
|
12460 |
+
pad = ph.width ? (pad_length > 0 ? pad_character.repeat(pad_length) : '') : ''
|
12461 |
+
output += ph.align ? sign + arg + pad : (pad_character === '0' ? sign + pad + arg : pad + sign + arg)
|
12462 |
+
}
|
12463 |
+
}
|
12464 |
+
}
|
12465 |
+
return output
|
12466 |
+
}
|
12467 |
+
|
12468 |
+
var sprintf_cache = Object.create(null)
|
12469 |
+
|
12470 |
+
function sprintf_parse(fmt) {
|
12471 |
+
if (sprintf_cache[fmt]) {
|
12472 |
+
return sprintf_cache[fmt]
|
12473 |
+
}
|
12474 |
+
|
12475 |
+
var _fmt = fmt, match, parse_tree = [], arg_names = 0
|
12476 |
+
while (_fmt) {
|
12477 |
+
if ((match = re.text.exec(_fmt)) !== null) {
|
12478 |
+
parse_tree.push(match[0])
|
12479 |
+
}
|
12480 |
+
else if ((match = re.modulo.exec(_fmt)) !== null) {
|
12481 |
+
parse_tree.push('%')
|
12482 |
+
}
|
12483 |
+
else if ((match = re.placeholder.exec(_fmt)) !== null) {
|
12484 |
+
if (match[2]) {
|
12485 |
+
arg_names |= 1
|
12486 |
+
var field_list = [], replacement_field = match[2], field_match = []
|
12487 |
+
if ((field_match = re.key.exec(replacement_field)) !== null) {
|
12488 |
+
field_list.push(field_match[1])
|
12489 |
+
while ((replacement_field = replacement_field.substring(field_match[0].length)) !== '') {
|
12490 |
+
if ((field_match = re.key_access.exec(replacement_field)) !== null) {
|
12491 |
+
field_list.push(field_match[1])
|
12492 |
+
}
|
12493 |
+
else if ((field_match = re.index_access.exec(replacement_field)) !== null) {
|
12494 |
+
field_list.push(field_match[1])
|
12495 |
+
}
|
12496 |
+
else {
|
12497 |
+
throw new SyntaxError('[sprintf] failed to parse named argument key')
|
12498 |
+
}
|
12499 |
+
}
|
12500 |
+
}
|
12501 |
+
else {
|
12502 |
+
throw new SyntaxError('[sprintf] failed to parse named argument key')
|
12503 |
+
}
|
12504 |
+
match[2] = field_list
|
12505 |
+
}
|
12506 |
+
else {
|
12507 |
+
arg_names |= 2
|
12508 |
+
}
|
12509 |
+
if (arg_names === 3) {
|
12510 |
+
throw new Error('[sprintf] mixing positional and named placeholders is not (yet) supported')
|
12511 |
+
}
|
12512 |
+
|
12513 |
+
parse_tree.push(
|
12514 |
+
{
|
12515 |
+
placeholder: match[0],
|
12516 |
+
param_no: match[1],
|
12517 |
+
keys: match[2],
|
12518 |
+
sign: match[3],
|
12519 |
+
pad_char: match[4],
|
12520 |
+
align: match[5],
|
12521 |
+
width: match[6],
|
12522 |
+
precision: match[7],
|
12523 |
+
type: match[8]
|
12524 |
+
}
|
12525 |
+
)
|
12526 |
+
}
|
12527 |
+
else {
|
12528 |
+
throw new SyntaxError('[sprintf] unexpected placeholder')
|
12529 |
+
}
|
12530 |
+
_fmt = _fmt.substring(match[0].length)
|
12531 |
+
}
|
12532 |
+
return sprintf_cache[fmt] = parse_tree
|
12533 |
+
}
|
12534 |
+
|
12535 |
+
/**
|
12536 |
+
* export to either browser or node.js
|
12537 |
+
*/
|
12538 |
+
/* eslint-disable quote-props */
|
12539 |
+
if (true) {
|
12540 |
+
exports['sprintf'] = sprintf
|
12541 |
+
exports['vsprintf'] = vsprintf
|
12542 |
+
}
|
12543 |
+
if (typeof window !== 'undefined') {
|
12544 |
+
window['sprintf'] = sprintf
|
12545 |
+
window['vsprintf'] = vsprintf
|
12546 |
+
|
12547 |
+
if (true) {
|
12548 |
+
!(__WEBPACK_AMD_DEFINE_RESULT__ = (function() {
|
12549 |
+
return {
|
12550 |
+
'sprintf': sprintf,
|
12551 |
+
'vsprintf': vsprintf
|
12552 |
+
}
|
12553 |
+
}).call(exports, __webpack_require__, exports, module),
|
12554 |
+
__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__))
|
12555 |
+
}
|
12556 |
+
}
|
12557 |
+
/* eslint-enable quote-props */
|
12558 |
+
}(); // eslint-disable-line
|
12559 |
+
|
12560 |
+
|
12561 |
+
/***/ }),
|
12562 |
+
/* 80 */
|
12563 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
12564 |
+
|
12565 |
+
"use strict";
|
12566 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = Tannin;
|
12567 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__tannin_plural_forms__ = __webpack_require__(475);
|
12568 |
+
|
12569 |
+
|
12570 |
+
/**
|
12571 |
+
* Tannin constructor options.
|
12572 |
*
|
12573 |
+
* @typedef {Object} TanninOptions
|
12574 |
*
|
12575 |
+
* @property {string} [contextDelimiter] Joiner in string lookup with context.
|
12576 |
+
* @property {Function} [onMissingKey] Callback to invoke when key missing.
|
12577 |
*/
|
12578 |
|
12579 |
/**
|
12580 |
+
* Domain metadata.
|
12581 |
*
|
12582 |
+
* @typedef {Object} TanninDomainMetadata
|
12583 |
*
|
12584 |
+
* @property {string} [domain] Domain name.
|
12585 |
+
* @property {string} [lang] Language code.
|
12586 |
+
* @property {(string|Function)} [plural_forms] Plural forms expression or
|
12587 |
+
* function evaluator.
|
|
|
12588 |
*/
|
12589 |
|
12590 |
/**
|
12591 |
+
* Domain translation pair respectively representing the singular and plural
|
12592 |
+
* translation.
|
|
|
12593 |
*
|
12594 |
+
* @typedef {[string,string]} TanninTranslation
|
12595 |
*/
|
12596 |
|
12597 |
/**
|
12598 |
+
* Locale data domain. The key is used as reference for lookup, the value an
|
12599 |
+
* array of two string entries respectively representing the singular and plural
|
12600 |
+
* translation.
|
12601 |
*
|
12602 |
+
* @typedef {{[key:string]:TanninDomainMetadata|TanninTranslation,'':TanninDomainMetadata|TanninTranslation}} TanninLocaleDomain
|
12603 |
+
*/
|
12604 |
+
|
12605 |
+
/**
|
12606 |
+
* Jed-formatted locale data.
|
12607 |
*
|
12608 |
+
* @see http://messageformat.github.io/Jed/
|
|
|
12609 |
*
|
12610 |
+
* @typedef {{[domain:string]:TanninLocaleDomain}} TanninLocaleData
|
12611 |
*/
|
|
|
|
|
12612 |
|
12613 |
+
/**
|
12614 |
+
* Default Tannin constructor options.
|
12615 |
+
*
|
12616 |
+
* @type {TanninOptions}
|
12617 |
+
*/
|
12618 |
+
var DEFAULT_OPTIONS = {
|
12619 |
+
contextDelimiter: '\u0004',
|
12620 |
+
onMissingKey: null,
|
12621 |
+
};
|
12622 |
|
12623 |
+
/**
|
12624 |
+
* Given a specific locale data's config `plural_forms` value, returns the
|
12625 |
+
* expression.
|
12626 |
+
*
|
12627 |
+
* @example
|
12628 |
+
*
|
12629 |
+
* ```
|
12630 |
+
* getPluralExpression( 'nplurals=2; plural=(n != 1);' ) === '(n != 1)'
|
12631 |
+
* ```
|
12632 |
+
*
|
12633 |
+
* @param {string} pf Locale data plural forms.
|
12634 |
+
*
|
12635 |
+
* @return {string} Plural forms expression.
|
12636 |
+
*/
|
12637 |
+
function getPluralExpression( pf ) {
|
12638 |
+
var parts, i, part;
|
12639 |
|
12640 |
+
parts = pf.split( ';' );
|
12641 |
|
12642 |
+
for ( i = 0; i < parts.length; i++ ) {
|
12643 |
+
part = parts[ i ].trim();
|
12644 |
+
if ( part.indexOf( 'plural=' ) === 0 ) {
|
12645 |
+
return part.substr( 7 );
|
12646 |
+
}
|
12647 |
+
}
|
12648 |
+
}
|
12649 |
|
12650 |
+
/**
|
12651 |
+
* Tannin constructor.
|
12652 |
+
*
|
12653 |
+
* @class
|
12654 |
+
*
|
12655 |
+
* @param {TanninLocaleData} data Jed-formatted locale data.
|
12656 |
+
* @param {TanninOptions} [options] Tannin options.
|
12657 |
+
*/
|
12658 |
+
function Tannin( data, options ) {
|
12659 |
+
var key;
|
12660 |
|
12661 |
+
/**
|
12662 |
+
* Jed-formatted locale data.
|
12663 |
+
*
|
12664 |
+
* @name Tannin#data
|
12665 |
+
* @type {TanninLocaleData}
|
12666 |
+
*/
|
12667 |
+
this.data = data;
|
12668 |
|
12669 |
+
/**
|
12670 |
+
* Plural forms function cache, keyed by plural forms string.
|
12671 |
+
*
|
12672 |
+
* @name Tannin#pluralForms
|
12673 |
+
* @type {Object<string,Function>}
|
12674 |
+
*/
|
12675 |
+
this.pluralForms = {};
|
12676 |
|
12677 |
+
/**
|
12678 |
+
* Effective options for instance, including defaults.
|
12679 |
+
*
|
12680 |
+
* @name Tannin#options
|
12681 |
+
* @type {TanninOptions}
|
12682 |
+
*/
|
12683 |
+
this.options = {};
|
12684 |
|
12685 |
+
for ( key in DEFAULT_OPTIONS ) {
|
12686 |
+
this.options[ key ] = options !== undefined && key in options
|
12687 |
+
? options[ key ]
|
12688 |
+
: DEFAULT_OPTIONS[ key ];
|
12689 |
+
}
|
12690 |
+
}
|
|
|
12691 |
|
12692 |
+
/**
|
12693 |
+
* Returns the plural form index for the given domain and value.
|
12694 |
+
*
|
12695 |
+
* @param {string} domain Domain on which to calculate plural form.
|
12696 |
+
* @param {number} n Value for which plural form is to be calculated.
|
12697 |
+
*
|
12698 |
+
* @return {number} Plural form index.
|
12699 |
+
*/
|
12700 |
+
Tannin.prototype.getPluralForm = function( domain, n ) {
|
12701 |
+
var getPluralForm = this.pluralForms[ domain ],
|
12702 |
+
config, plural, pf;
|
12703 |
|
12704 |
+
if ( ! getPluralForm ) {
|
12705 |
+
config = this.data[ domain ][ '' ];
|
|
|
|
|
|
|
12706 |
|
12707 |
+
pf = (
|
12708 |
+
config[ 'Plural-Forms' ] ||
|
12709 |
+
config[ 'plural-forms' ] ||
|
12710 |
+
// Ignore reason: As known, there's no way to document the empty
|
12711 |
+
// string property on a key to guarantee this as metadata.
|
12712 |
+
// @ts-ignore
|
12713 |
+
config.plural_forms
|
12714 |
+
);
|
12715 |
|
12716 |
+
if ( typeof pf !== 'function' ) {
|
12717 |
+
plural = getPluralExpression(
|
12718 |
+
config[ 'Plural-Forms' ] ||
|
12719 |
+
config[ 'plural-forms' ] ||
|
12720 |
+
// Ignore reason: As known, there's no way to document the empty
|
12721 |
+
// string property on a key to guarantee this as metadata.
|
12722 |
+
// @ts-ignore
|
12723 |
+
config.plural_forms
|
12724 |
+
);
|
12725 |
|
12726 |
+
pf = Object(__WEBPACK_IMPORTED_MODULE_0__tannin_plural_forms__["a" /* default */])( plural );
|
|
|
|
|
|
|
12727 |
}
|
12728 |
|
12729 |
+
getPluralForm = this.pluralForms[ domain ] = pf;
|
12730 |
+
}
|
12731 |
|
12732 |
+
return getPluralForm( n );
|
12733 |
+
};
|
|
|
12734 |
|
12735 |
+
/**
|
12736 |
+
* Translate a string.
|
12737 |
+
*
|
12738 |
+
* @param {string} domain Translation domain.
|
12739 |
+
* @param {string|void} context Context distinguishing terms of the same name.
|
12740 |
+
* @param {string} singular Primary key for translation lookup.
|
12741 |
+
* @param {string=} plural Fallback value used for non-zero plural
|
12742 |
+
* form index.
|
12743 |
+
* @param {number=} n Value to use in calculating plural form.
|
12744 |
+
*
|
12745 |
+
* @return {string} Translated string.
|
12746 |
+
*/
|
12747 |
+
Tannin.prototype.dcnpgettext = function( domain, context, singular, plural, n ) {
|
12748 |
+
var index, key, entry;
|
12749 |
|
12750 |
+
if ( n === undefined ) {
|
12751 |
+
// Default to singular.
|
12752 |
+
index = 0;
|
12753 |
+
} else {
|
12754 |
+
// Find index by evaluating plural form for value.
|
12755 |
+
index = this.getPluralForm( domain, n );
|
12756 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
12757 |
|
12758 |
+
key = singular;
|
12759 |
|
12760 |
+
// If provided, context is prepended to key with delimiter.
|
12761 |
+
if ( context ) {
|
12762 |
+
key = context + this.options.contextDelimiter + singular;
|
12763 |
}
|
12764 |
|
12765 |
+
entry = this.data[ domain ][ key ];
|
|
|
|
|
|
|
|
|
12766 |
|
12767 |
+
// Verify not only that entry exists, but that the intended index is within
|
12768 |
+
// range and non-empty.
|
12769 |
+
if ( entry && entry[ index ] ) {
|
12770 |
+
return entry[ index ];
|
|
|
|
|
12771 |
}
|
12772 |
|
12773 |
+
if ( this.options.onMissingKey ) {
|
12774 |
+
this.options.onMissingKey( singular, domain );
|
12775 |
+
}
|
|
|
|
|
|
|
|
|
|
|
12776 |
|
12777 |
+
// If entry not found, fall back to singular vs. plural with zero index
|
12778 |
+
// representing the singular value.
|
12779 |
+
return index === 0 ? singular : plural;
|
12780 |
+
};
|
12781 |
|
|
|
12782 |
|
12783 |
/***/ }),
|
12784 |
+
/* 81 */
|
12785 |
/***/ (function(module, exports) {
|
12786 |
|
12787 |
+
var g;
|
12788 |
+
|
12789 |
+
// This works in non-strict mode
|
12790 |
+
g = (function() {
|
12791 |
+
return this;
|
12792 |
+
})();
|
12793 |
+
|
12794 |
+
try {
|
12795 |
+
// This works if eval is allowed (see CSP)
|
12796 |
+
g = g || Function("return this")() || (1,eval)("this");
|
12797 |
+
} catch(e) {
|
12798 |
+
// This works if the window reference is available
|
12799 |
+
if(typeof window === "object")
|
12800 |
+
g = window;
|
12801 |
+
}
|
12802 |
+
|
12803 |
+
// g can still be undefined, but nothing to do about it...
|
12804 |
+
// We return undefined, instead of nothing here, so it's
|
12805 |
+
// easier to handle this case. if(!global) { ...}
|
12806 |
+
|
12807 |
+
module.exports = g;
|
12808 |
|
12809 |
|
12810 |
/***/ }),
|
12811 |
+
/* 82 */
|
12812 |
/***/ (function(module, exports, __webpack_require__) {
|
12813 |
|
12814 |
"use strict";
|
12820 |
|
12821 |
var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol ? "symbol" : typeof obj; };
|
12822 |
|
12823 |
+
var _keys = __webpack_require__(162);
|
12824 |
|
12825 |
var _keys2 = _interopRequireDefault(_keys);
|
12826 |
|
12872 |
exports.default = is;
|
12873 |
|
12874 |
/***/ }),
|
12875 |
+
/* 83 */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
12876 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
12877 |
|
12878 |
"use strict";
|
12879 |
/* harmony export (immutable) */ __webpack_exports__["a"] = useRegistry;
|
12880 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
12881 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__context__ = __webpack_require__(171);
|
12882 |
/**
|
12883 |
* WordPress dependencies
|
12884 |
*/
|
12934 |
//# sourceMappingURL=use-registry.js.map
|
12935 |
|
12936 |
/***/ }),
|
12937 |
+
/* 84 */
|
12938 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
12939 |
|
12940 |
"use strict";
|
12945 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
12946 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
12947 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
12948 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
12949 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__wordpress_element__ = __webpack_require__(1);
|
12950 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_classnames__ = __webpack_require__(14);
|
12951 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_9_classnames__);
|
12952 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__wordpress_is_shallow_equal__ = __webpack_require__(194);
|
12953 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__wordpress_is_shallow_equal___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_10__wordpress_is_shallow_equal__);
|
12954 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__wordpress_dom__ = __webpack_require__(54);
|
12955 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__wordpress_keycodes__ = __webpack_require__(32);
|
12956 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__utils__ = __webpack_require__(608);
|
12957 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__higher_order_with_focus_return__ = __webpack_require__(116);
|
12958 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__higher_order_with_constrained_tabbing__ = __webpack_require__(117);
|
12959 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__detect_outside__ = __webpack_require__(609);
|
12960 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__icon_button__ = __webpack_require__(37);
|
12961 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__scroll_lock__ = __webpack_require__(197);
|
12962 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__isolated_event_container__ = __webpack_require__(119);
|
12963 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__slot_fill__ = __webpack_require__(198);
|
12964 |
|
12965 |
|
12966 |
|
13349 |
//# sourceMappingURL=index.js.map
|
13350 |
|
13351 |
/***/ }),
|
13352 |
+
/* 85 */
|
13353 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
13354 |
|
13355 |
"use strict";
|
13358 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
13359 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
13360 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
13361 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
13362 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_element__ = __webpack_require__(1);
|
13363 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_deprecated__ = __webpack_require__(104);
|
13364 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__popover__ = __webpack_require__(84);
|
13365 |
|
13366 |
|
13367 |
|
13510 |
//# sourceMappingURL=index.js.map
|
13511 |
|
13512 |
/***/ }),
|
13513 |
+
/* 86 */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
13514 |
/***/ (function(module, exports, __webpack_require__) {
|
13515 |
|
13516 |
"use strict";
|
13517 |
|
13518 |
|
13519 |
+
var fnToStr = Function.prototype.toString;
|
13520 |
+
var reflectApply = typeof Reflect === 'object' && Reflect !== null && Reflect.apply;
|
13521 |
+
var badArrayLike;
|
13522 |
+
var isCallableMarker;
|
13523 |
+
if (typeof reflectApply === 'function' && typeof Object.defineProperty === 'function') {
|
13524 |
+
try {
|
13525 |
+
badArrayLike = Object.defineProperty({}, 'length', {
|
13526 |
+
get: function () {
|
13527 |
+
throw isCallableMarker;
|
13528 |
+
}
|
13529 |
+
});
|
13530 |
+
isCallableMarker = {};
|
13531 |
+
// eslint-disable-next-line no-throw-literal
|
13532 |
+
reflectApply(function () { throw 42; }, null, badArrayLike);
|
13533 |
+
} catch (_) {
|
13534 |
+
if (_ !== isCallableMarker) {
|
13535 |
+
reflectApply = null;
|
13536 |
+
}
|
13537 |
+
}
|
13538 |
+
} else {
|
13539 |
+
reflectApply = null;
|
13540 |
+
}
|
13541 |
|
13542 |
+
var constructorRegex = /^\s*class\b/;
|
13543 |
+
var isES6ClassFn = function isES6ClassFunction(value) {
|
13544 |
+
try {
|
13545 |
+
var fnStr = fnToStr.call(value);
|
13546 |
+
return constructorRegex.test(fnStr);
|
13547 |
+
} catch (e) {
|
13548 |
+
return false; // not a function
|
13549 |
+
}
|
13550 |
+
};
|
13551 |
|
13552 |
+
var tryFunctionObject = function tryFunctionToStr(value) {
|
13553 |
+
try {
|
13554 |
+
if (isES6ClassFn(value)) { return false; }
|
13555 |
+
fnToStr.call(value);
|
13556 |
+
return true;
|
13557 |
+
} catch (e) {
|
13558 |
+
return false;
|
13559 |
+
}
|
13560 |
+
};
|
13561 |
+
var toStr = Object.prototype.toString;
|
13562 |
+
var fnClass = '[object Function]';
|
13563 |
+
var genClass = '[object GeneratorFunction]';
|
13564 |
+
var hasToStringTag = typeof Symbol === 'function' && typeof Symbol.toStringTag === 'symbol';
|
13565 |
|
13566 |
+
module.exports = reflectApply
|
13567 |
+
? function isCallable(value) {
|
13568 |
+
if (!value) { return false; }
|
13569 |
+
if (typeof value !== 'function' && typeof value !== 'object') { return false; }
|
13570 |
+
if (typeof value === 'function' && !value.prototype) { return true; }
|
13571 |
+
try {
|
13572 |
+
reflectApply(value, null, badArrayLike);
|
13573 |
+
} catch (e) {
|
13574 |
+
if (e !== isCallableMarker) { return false; }
|
13575 |
+
}
|
13576 |
+
return !isES6ClassFn(value);
|
13577 |
+
}
|
13578 |
+
: function isCallable(value) {
|
13579 |
+
if (!value) { return false; }
|
13580 |
+
if (typeof value !== 'function' && typeof value !== 'object') { return false; }
|
13581 |
+
if (typeof value === 'function' && !value.prototype) { return true; }
|
13582 |
+
if (hasToStringTag) { return tryFunctionObject(value); }
|
13583 |
+
if (isES6ClassFn(value)) { return false; }
|
13584 |
+
var strClass = toStr.call(value);
|
13585 |
+
return strClass === fnClass || strClass === genClass;
|
13586 |
+
};
|
13587 |
|
13588 |
|
13589 |
/***/ }),
|
13590 |
+
/* 87 */
|
13591 |
/***/ (function(module, exports, __webpack_require__) {
|
13592 |
|
13593 |
"use strict";
|
13601 |
|
13602 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
13603 |
|
13604 |
+
var _airbnbPropTypes = __webpack_require__(22);
|
13605 |
|
13606 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
|
13607 |
|
13632 |
}()], 'Modifiers (Set of Strings)');
|
13633 |
|
13634 |
/***/ }),
|
13635 |
+
/* 88 */
|
13636 |
/***/ (function(module, exports, __webpack_require__) {
|
13637 |
|
13638 |
"use strict";
|
13647 |
|
13648 |
var _moment2 = _interopRequireDefault(_moment);
|
13649 |
|
13650 |
+
var _toMomentObject = __webpack_require__(59);
|
13651 |
|
13652 |
var _toMomentObject2 = _interopRequireDefault(_toMomentObject);
|
13653 |
|
13663 |
}
|
13664 |
|
13665 |
/***/ }),
|
13666 |
+
/* 89 */
|
13667 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
13668 |
|
13669 |
"use strict";
|
13878 |
|
13879 |
|
13880 |
/***/ }),
|
13881 |
+
/* 90 */
|
13882 |
/***/ (function(module, exports, __webpack_require__) {
|
13883 |
|
13884 |
"use strict";
|
13893 |
|
13894 |
var _moment2 = _interopRequireDefault(_moment);
|
13895 |
|
13896 |
+
var _toMomentObject = __webpack_require__(59);
|
13897 |
|
13898 |
var _toMomentObject2 = _interopRequireDefault(_toMomentObject);
|
13899 |
|
13909 |
}
|
13910 |
|
13911 |
/***/ }),
|
13912 |
+
/* 91 */
|
13913 |
/***/ (function(module, exports, __webpack_require__) {
|
13914 |
|
13915 |
"use strict";
|
13930 |
exports['default'] = _propTypes2['default'].oneOfType([_propTypes2['default'].bool, _propTypes2['default'].oneOf([_constants.START_DATE, _constants.END_DATE])]);
|
13931 |
|
13932 |
/***/ }),
|
13933 |
+
/* 92 */
|
13934 |
/***/ (function(module, exports, __webpack_require__) {
|
13935 |
|
13936 |
"use strict";
|
13945 |
|
13946 |
var _moment2 = _interopRequireDefault(_moment);
|
13947 |
|
13948 |
+
var _isBeforeDay = __webpack_require__(74);
|
13949 |
|
13950 |
var _isBeforeDay2 = _interopRequireDefault(_isBeforeDay);
|
13951 |
|
13952 |
+
var _isSameDay = __webpack_require__(58);
|
13953 |
|
13954 |
var _isSameDay2 = _interopRequireDefault(_isSameDay);
|
13955 |
|
13961 |
}
|
13962 |
|
13963 |
/***/ }),
|
13964 |
+
/* 93 */
|
13965 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
13966 |
+
|
13967 |
+
"use strict";
|
13968 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__is_url__ = __webpack_require__(829);
|
13969 |
+
/* unused harmony reexport isURL */
|
13970 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__is_email__ = __webpack_require__(440);
|
13971 |
+
/* unused harmony reexport isEmail */
|
13972 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__get_protocol__ = __webpack_require__(830);
|
13973 |
+
/* unused harmony reexport getProtocol */
|
13974 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__is_valid_protocol__ = __webpack_require__(831);
|
13975 |
+
/* unused harmony reexport isValidProtocol */
|
13976 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__get_authority__ = __webpack_require__(832);
|
13977 |
+
/* unused harmony reexport getAuthority */
|
13978 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__is_valid_authority__ = __webpack_require__(833);
|
13979 |
+
/* unused harmony reexport isValidAuthority */
|
13980 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__get_path__ = __webpack_require__(834);
|
13981 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_6__get_path__["a"]; });
|
13982 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__is_valid_path__ = __webpack_require__(835);
|
13983 |
+
/* unused harmony reexport isValidPath */
|
13984 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__get_query_string__ = __webpack_require__(836);
|
13985 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_8__get_query_string__["a"]; });
|
13986 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__is_valid_query_string__ = __webpack_require__(837);
|
13987 |
+
/* unused harmony reexport isValidQueryString */
|
13988 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__get_path_and_query_string__ = __webpack_require__(838);
|
13989 |
+
/* unused harmony reexport getPathAndQueryString */
|
13990 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__get_fragment__ = __webpack_require__(839);
|
13991 |
+
/* unused harmony reexport getFragment */
|
13992 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__is_valid_fragment__ = __webpack_require__(840);
|
13993 |
+
/* unused harmony reexport isValidFragment */
|
13994 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__add_query_args__ = __webpack_require__(841);
|
13995 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_13__add_query_args__["a"]; });
|
13996 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__get_query_arg__ = __webpack_require__(442);
|
13997 |
+
/* unused harmony reexport getQueryArg */
|
13998 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__has_query_arg__ = __webpack_require__(844);
|
13999 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return __WEBPACK_IMPORTED_MODULE_15__has_query_arg__["a"]; });
|
14000 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__remove_query_args__ = __webpack_require__(845);
|
14001 |
+
/* unused harmony reexport removeQueryArgs */
|
14002 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__prepend_http__ = __webpack_require__(846);
|
14003 |
+
/* unused harmony reexport prependHTTP */
|
14004 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__safe_decode_uri__ = __webpack_require__(847);
|
14005 |
+
/* unused harmony reexport safeDecodeURI */
|
14006 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__safe_decode_uri_component__ = __webpack_require__(848);
|
14007 |
+
/* unused harmony reexport safeDecodeURIComponent */
|
14008 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__filter_url_for_display__ = __webpack_require__(849);
|
14009 |
+
/* unused harmony reexport filterURLForDisplay */
|
14010 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_21__clean_for_slug__ = __webpack_require__(850);
|
14011 |
+
/* unused harmony reexport cleanForSlug */
|
14012 |
+
|
14013 |
+
|
14014 |
+
|
14015 |
+
|
14016 |
+
|
14017 |
+
|
14018 |
+
|
14019 |
+
|
14020 |
+
|
14021 |
+
|
14022 |
+
|
14023 |
+
|
14024 |
+
|
14025 |
+
|
14026 |
+
|
14027 |
+
|
14028 |
+
|
14029 |
+
|
14030 |
+
|
14031 |
+
|
14032 |
+
|
14033 |
+
|
14034 |
+
//# sourceMappingURL=index.js.map
|
14035 |
+
|
14036 |
+
/***/ }),
|
14037 |
+
/* 94 */
|
14038 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
14039 |
|
14040 |
"use strict";
|
14041 |
/* harmony export (immutable) */ __webpack_exports__["f"] = concatChildren;
|
14042 |
/* unused harmony export switchChildrenNodeName */
|
14043 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(23);
|
14044 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
14045 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_react__ = __webpack_require__(9);
|
14046 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_react__);
|
14047 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
14048 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
14195 |
//# sourceMappingURL=react.js.map
|
14196 |
|
14197 |
/***/ }),
|
14198 |
+
/* 95 */
|
14199 |
/***/ (function(module, exports, __webpack_require__) {
|
14200 |
|
14201 |
"use strict";
|
14211 |
var printWarning = function() {};
|
14212 |
|
14213 |
if (process.env.NODE_ENV !== 'production') {
|
14214 |
+
var ReactPropTypesSecret = __webpack_require__(96);
|
14215 |
var loggedTypeFailures = {};
|
14216 |
var has = Function.call.bind(Object.prototype.hasOwnProperty);
|
14217 |
|
14305 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
14306 |
|
14307 |
/***/ }),
|
14308 |
+
/* 96 */
|
14309 |
/***/ (function(module, exports, __webpack_require__) {
|
14310 |
|
14311 |
"use strict";
|
14324 |
|
14325 |
|
14326 |
/***/ }),
|
14327 |
+
/* 97 */
|
14328 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
14329 |
|
14330 |
+
"use strict";
|
14331 |
+
/* unused harmony export concatChildren */
|
14332 |
+
/* unused harmony export switchChildrenNodeName */
|
14333 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
14334 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
14335 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_react__ = __webpack_require__(9);
|
14336 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_react__);
|
14337 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
14338 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
14339 |
+
/* unused harmony reexport Children */
|
14340 |
+
/* unused harmony reexport cloneElement */
|
14341 |
+
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "Component")) __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["Component"]; });
|
14342 |
+
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "createContext")) __webpack_require__.d(__webpack_exports__, "d", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["createContext"]; });
|
14343 |
+
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "createElement")) __webpack_require__.d(__webpack_exports__, "e", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["createElement"]; });
|
14344 |
+
/* unused harmony reexport createRef */
|
14345 |
+
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "forwardRef")) __webpack_require__.d(__webpack_exports__, "f", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["forwardRef"]; });
|
14346 |
+
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "Fragment")) __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["Fragment"]; });
|
14347 |
+
/* unused harmony reexport isValidElement */
|
14348 |
+
/* unused harmony reexport memo */
|
14349 |
+
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "StrictMode")) __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["StrictMode"]; });
|
14350 |
+
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useCallback")) __webpack_require__.d(__webpack_exports__, "g", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useCallback"]; });
|
14351 |
+
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useContext")) __webpack_require__.d(__webpack_exports__, "h", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useContext"]; });
|
14352 |
+
/* unused harmony reexport useDebugValue */
|
14353 |
+
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useEffect")) __webpack_require__.d(__webpack_exports__, "i", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useEffect"]; });
|
14354 |
+
/* unused harmony reexport useImperativeHandle */
|
14355 |
+
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useLayoutEffect")) __webpack_require__.d(__webpack_exports__, "j", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useLayoutEffect"]; });
|
14356 |
+
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useMemo")) __webpack_require__.d(__webpack_exports__, "k", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useMemo"]; });
|
14357 |
+
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useReducer")) __webpack_require__.d(__webpack_exports__, "l", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useReducer"]; });
|
14358 |
+
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useRef")) __webpack_require__.d(__webpack_exports__, "m", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useRef"]; });
|
14359 |
+
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_2_react__, "useState")) __webpack_require__.d(__webpack_exports__, "n", function() { return __WEBPACK_IMPORTED_MODULE_2_react__["useState"]; });
|
14360 |
+
/* unused harmony reexport lazy */
|
14361 |
+
/* unused harmony reexport Suspense */
|
14362 |
|
|
|
|
|
14363 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
14364 |
|
14365 |
+
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
|
|
|
|
|
|
14366 |
|
14367 |
+
function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }
|
|
|
|
|
14368 |
|
14369 |
+
/**
|
14370 |
+
* External dependencies
|
14371 |
+
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
14372 |
|
|
|
|
|
|
|
14373 |
|
14374 |
+
/**
|
14375 |
+
* Object containing a React element.
|
14376 |
+
*
|
14377 |
+
* @typedef {import('react').ReactElement} WPElement
|
14378 |
+
*/
|
14379 |
|
14380 |
+
/**
|
14381 |
+
* Object containing a React component.
|
14382 |
+
*
|
14383 |
+
* @typedef {import('react').ComponentType} WPComponent
|
14384 |
+
*/
|
14385 |
|
14386 |
+
/**
|
14387 |
+
* Object containing a React synthetic event.
|
14388 |
+
*
|
14389 |
+
* @typedef {import('react').SyntheticEvent} WPSyntheticEvent
|
14390 |
+
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
14391 |
|
14392 |
+
/**
|
14393 |
+
* Object that provides utilities for dealing with React children.
|
14394 |
+
*/
|
14395 |
|
|
|
|
|
|
|
|
|
14396 |
|
14397 |
+
/**
|
14398 |
+
* Creates a copy of an element with extended props.
|
14399 |
+
*
|
14400 |
+
* @param {WPElement} element Element
|
14401 |
+
* @param {?Object} props Props to apply to cloned element
|
14402 |
+
*
|
14403 |
+
* @return {WPElement} Cloned element.
|
14404 |
+
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
14405 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
14406 |
|
14407 |
+
/**
|
14408 |
+
* A base class to create WordPress Components (Refs, state and lifecycle hooks)
|
14409 |
+
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
14410 |
|
14411 |
|
14412 |
/**
|
14596 |
/* 98 */
|
14597 |
/***/ (function(module, exports, __webpack_require__) {
|
14598 |
|
14599 |
+
/*!
|
14600 |
+
* clipboard.js v2.0.6
|
14601 |
+
* https://clipboardjs.com/
|
14602 |
+
*
|
14603 |
+
* Licensed MIT © Zeno Rocha
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
14604 |
*/
|
14605 |
+
(function webpackUniversalModuleDefinition(root, factory) {
|
14606 |
+
if(true)
|
14607 |
+
module.exports = factory();
|
14608 |
+
else if(typeof define === 'function' && define.amd)
|
14609 |
+
define([], factory);
|
14610 |
+
else if(typeof exports === 'object')
|
14611 |
+
exports["ClipboardJS"] = factory();
|
14612 |
+
else
|
14613 |
+
root["ClipboardJS"] = factory();
|
14614 |
+
})(this, function() {
|
14615 |
+
return /******/ (function(modules) { // webpackBootstrap
|
14616 |
+
/******/ // The module cache
|
14617 |
+
/******/ var installedModules = {};
|
14618 |
+
/******/
|
14619 |
+
/******/ // The require function
|
14620 |
+
/******/ function __webpack_require__(moduleId) {
|
14621 |
+
/******/
|
14622 |
+
/******/ // Check if module is in cache
|
14623 |
+
/******/ if(installedModules[moduleId]) {
|
14624 |
+
/******/ return installedModules[moduleId].exports;
|
14625 |
+
/******/ }
|
14626 |
+
/******/ // Create a new module (and put it into the cache)
|
14627 |
+
/******/ var module = installedModules[moduleId] = {
|
14628 |
+
/******/ i: moduleId,
|
14629 |
+
/******/ l: false,
|
14630 |
+
/******/ exports: {}
|
14631 |
+
/******/ };
|
14632 |
+
/******/
|
14633 |
+
/******/ // Execute the module function
|
14634 |
+
/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
|
14635 |
+
/******/
|
14636 |
+
/******/ // Flag the module as loaded
|
14637 |
+
/******/ module.l = true;
|
14638 |
+
/******/
|
14639 |
+
/******/ // Return the exports of the module
|
14640 |
+
/******/ return module.exports;
|
14641 |
+
/******/ }
|
14642 |
+
/******/
|
14643 |
+
/******/
|
14644 |
+
/******/ // expose the modules object (__webpack_modules__)
|
14645 |
+
/******/ __webpack_require__.m = modules;
|
14646 |
+
/******/
|
14647 |
+
/******/ // expose the module cache
|
14648 |
+
/******/ __webpack_require__.c = installedModules;
|
14649 |
+
/******/
|
14650 |
+
/******/ // define getter function for harmony exports
|
14651 |
+
/******/ __webpack_require__.d = function(exports, name, getter) {
|
14652 |
+
/******/ if(!__webpack_require__.o(exports, name)) {
|
14653 |
+
/******/ Object.defineProperty(exports, name, { enumerable: true, get: getter });
|
14654 |
+
/******/ }
|
14655 |
+
/******/ };
|
14656 |
+
/******/
|
14657 |
+
/******/ // define __esModule on exports
|
14658 |
+
/******/ __webpack_require__.r = function(exports) {
|
14659 |
+
/******/ if(typeof Symbol !== 'undefined' && Symbol.toStringTag) {
|
14660 |
+
/******/ Object.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });
|
14661 |
+
/******/ }
|
14662 |
+
/******/ Object.defineProperty(exports, '__esModule', { value: true });
|
14663 |
+
/******/ };
|
14664 |
+
/******/
|
14665 |
+
/******/ // create a fake namespace object
|
14666 |
+
/******/ // mode & 1: value is a module id, require it
|
14667 |
+
/******/ // mode & 2: merge all properties of value into the ns
|
14668 |
+
/******/ // mode & 4: return value when already ns object
|
14669 |
+
/******/ // mode & 8|1: behave like require
|
14670 |
+
/******/ __webpack_require__.t = function(value, mode) {
|
14671 |
+
/******/ if(mode & 1) value = __webpack_require__(value);
|
14672 |
+
/******/ if(mode & 8) return value;
|
14673 |
+
/******/ if((mode & 4) && typeof value === 'object' && value && value.__esModule) return value;
|
14674 |
+
/******/ var ns = Object.create(null);
|
14675 |
+
/******/ __webpack_require__.r(ns);
|
14676 |
+
/******/ Object.defineProperty(ns, 'default', { enumerable: true, value: value });
|
14677 |
+
/******/ if(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key));
|
14678 |
+
/******/ return ns;
|
14679 |
+
/******/ };
|
14680 |
+
/******/
|
14681 |
+
/******/ // getDefaultExport function for compatibility with non-harmony modules
|
14682 |
+
/******/ __webpack_require__.n = function(module) {
|
14683 |
+
/******/ var getter = module && module.__esModule ?
|
14684 |
+
/******/ function getDefault() { return module['default']; } :
|
14685 |
+
/******/ function getModuleExports() { return module; };
|
14686 |
+
/******/ __webpack_require__.d(getter, 'a', getter);
|
14687 |
+
/******/ return getter;
|
14688 |
+
/******/ };
|
14689 |
+
/******/
|
14690 |
+
/******/ // Object.prototype.hasOwnProperty.call
|
14691 |
+
/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };
|
14692 |
+
/******/
|
14693 |
+
/******/ // __webpack_public_path__
|
14694 |
+
/******/ __webpack_require__.p = "";
|
14695 |
+
/******/
|
14696 |
+
/******/
|
14697 |
+
/******/ // Load entry module and return exports
|
14698 |
+
/******/ return __webpack_require__(__webpack_require__.s = 6);
|
14699 |
+
/******/ })
|
14700 |
+
/************************************************************************/
|
14701 |
+
/******/ ([
|
14702 |
+
/* 0 */
|
14703 |
+
/***/ (function(module, exports) {
|
14704 |
|
14705 |
+
function select(element) {
|
14706 |
+
var selectedText;
|
|
|
|
|
14707 |
|
14708 |
+
if (element.nodeName === 'SELECT') {
|
14709 |
+
element.focus();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
14710 |
|
14711 |
+
selectedText = element.value;
|
14712 |
+
}
|
14713 |
+
else if (element.nodeName === 'INPUT' || element.nodeName === 'TEXTAREA') {
|
14714 |
+
var isReadOnly = element.hasAttribute('readonly');
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
14715 |
|
14716 |
+
if (!isReadOnly) {
|
14717 |
+
element.setAttribute('readonly', '');
|
14718 |
+
}
|
14719 |
+
|
14720 |
+
element.select();
|
14721 |
+
element.setSelectionRange(0, element.value.length);
|
14722 |
+
|
14723 |
+
if (!isReadOnly) {
|
14724 |
+
element.removeAttribute('readonly');
|
14725 |
+
}
|
14726 |
+
|
14727 |
+
selectedText = element.value;
|
14728 |
+
}
|
14729 |
+
else {
|
14730 |
+
if (element.hasAttribute('contenteditable')) {
|
14731 |
+
element.focus();
|
14732 |
+
}
|
14733 |
+
|
14734 |
+
var selection = window.getSelection();
|
14735 |
+
var range = document.createRange();
|
14736 |
+
|
14737 |
+
range.selectNodeContents(element);
|
14738 |
+
selection.removeAllRanges();
|
14739 |
+
selection.addRange(range);
|
14740 |
+
|
14741 |
+
selectedText = selection.toString();
|
14742 |
+
}
|
14743 |
+
|
14744 |
+
return selectedText;
|
14745 |
+
}
|
14746 |
+
|
14747 |
+
module.exports = select;
|
14748 |
+
|
14749 |
+
|
14750 |
+
/***/ }),
|
14751 |
+
/* 1 */
|
14752 |
+
/***/ (function(module, exports) {
|
14753 |
+
|
14754 |
+
function E () {
|
14755 |
+
// Keep this empty so it's easier to inherit from
|
14756 |
+
// (via https://github.com/lipsmack from https://github.com/scottcorgan/tiny-emitter/issues/3)
|
14757 |
+
}
|
14758 |
+
|
14759 |
+
E.prototype = {
|
14760 |
+
on: function (name, callback, ctx) {
|
14761 |
+
var e = this.e || (this.e = {});
|
14762 |
+
|
14763 |
+
(e[name] || (e[name] = [])).push({
|
14764 |
+
fn: callback,
|
14765 |
+
ctx: ctx
|
14766 |
+
});
|
14767 |
+
|
14768 |
+
return this;
|
14769 |
+
},
|
14770 |
+
|
14771 |
+
once: function (name, callback, ctx) {
|
14772 |
+
var self = this;
|
14773 |
+
function listener () {
|
14774 |
+
self.off(name, listener);
|
14775 |
+
callback.apply(ctx, arguments);
|
14776 |
+
};
|
14777 |
+
|
14778 |
+
listener._ = callback
|
14779 |
+
return this.on(name, listener, ctx);
|
14780 |
+
},
|
14781 |
+
|
14782 |
+
emit: function (name) {
|
14783 |
+
var data = [].slice.call(arguments, 1);
|
14784 |
+
var evtArr = ((this.e || (this.e = {}))[name] || []).slice();
|
14785 |
+
var i = 0;
|
14786 |
+
var len = evtArr.length;
|
14787 |
+
|
14788 |
+
for (i; i < len; i++) {
|
14789 |
+
evtArr[i].fn.apply(evtArr[i].ctx, data);
|
14790 |
+
}
|
14791 |
+
|
14792 |
+
return this;
|
14793 |
+
},
|
14794 |
+
|
14795 |
+
off: function (name, callback) {
|
14796 |
+
var e = this.e || (this.e = {});
|
14797 |
+
var evts = e[name];
|
14798 |
+
var liveEvents = [];
|
14799 |
+
|
14800 |
+
if (evts && callback) {
|
14801 |
+
for (var i = 0, len = evts.length; i < len; i++) {
|
14802 |
+
if (evts[i].fn !== callback && evts[i].fn._ !== callback)
|
14803 |
+
liveEvents.push(evts[i]);
|
14804 |
+
}
|
14805 |
+
}
|
14806 |
+
|
14807 |
+
// Remove event from queue to prevent memory leak
|
14808 |
+
// Suggested by https://github.com/lazd
|
14809 |
+
// Ref: https://github.com/scottcorgan/tiny-emitter/commit/c6ebfaa9bc973b33d110a84a307742b7cf94c953#commitcomment-5024910
|
14810 |
+
|
14811 |
+
(liveEvents.length)
|
14812 |
+
? e[name] = liveEvents
|
14813 |
+
: delete e[name];
|
14814 |
+
|
14815 |
+
return this;
|
14816 |
+
}
|
14817 |
+
};
|
14818 |
+
|
14819 |
+
module.exports = E;
|
14820 |
+
module.exports.TinyEmitter = E;
|
14821 |
+
|
14822 |
+
|
14823 |
+
/***/ }),
|
14824 |
+
/* 2 */
|
14825 |
+
/***/ (function(module, exports, __webpack_require__) {
|
14826 |
+
|
14827 |
+
var is = __webpack_require__(3);
|
14828 |
+
var delegate = __webpack_require__(4);
|
14829 |
+
|
14830 |
+
/**
|
14831 |
+
* Validates all params and calls the right
|
14832 |
+
* listener function based on its target type.
|
14833 |
+
*
|
14834 |
+
* @param {String|HTMLElement|HTMLCollection|NodeList} target
|
14835 |
+
* @param {String} type
|
14836 |
+
* @param {Function} callback
|
14837 |
+
* @return {Object}
|
14838 |
+
*/
|
14839 |
+
function listen(target, type, callback) {
|
14840 |
+
if (!target && !type && !callback) {
|
14841 |
+
throw new Error('Missing required arguments');
|
14842 |
+
}
|
14843 |
+
|
14844 |
+
if (!is.string(type)) {
|
14845 |
+
throw new TypeError('Second argument must be a String');
|
14846 |
+
}
|
14847 |
+
|
14848 |
+
if (!is.fn(callback)) {
|
14849 |
+
throw new TypeError('Third argument must be a Function');
|
14850 |
+
}
|
14851 |
+
|
14852 |
+
if (is.node(target)) {
|
14853 |
+
return listenNode(target, type, callback);
|
14854 |
+
}
|
14855 |
+
else if (is.nodeList(target)) {
|
14856 |
+
return listenNodeList(target, type, callback);
|
14857 |
+
}
|
14858 |
+
else if (is.string(target)) {
|
14859 |
+
return listenSelector(target, type, callback);
|
14860 |
+
}
|
14861 |
+
else {
|
14862 |
+
throw new TypeError('First argument must be a String, HTMLElement, HTMLCollection, or NodeList');
|
14863 |
+
}
|
14864 |
+
}
|
14865 |
+
|
14866 |
+
/**
|
14867 |
+
* Adds an event listener to a HTML element
|
14868 |
+
* and returns a remove listener function.
|
14869 |
+
*
|
14870 |
+
* @param {HTMLElement} node
|
14871 |
+
* @param {String} type
|
14872 |
+
* @param {Function} callback
|
14873 |
+
* @return {Object}
|
14874 |
+
*/
|
14875 |
+
function listenNode(node, type, callback) {
|
14876 |
+
node.addEventListener(type, callback);
|
14877 |
+
|
14878 |
+
return {
|
14879 |
+
destroy: function() {
|
14880 |
+
node.removeEventListener(type, callback);
|
14881 |
+
}
|
14882 |
+
}
|
14883 |
+
}
|
14884 |
+
|
14885 |
+
/**
|
14886 |
+
* Add an event listener to a list of HTML elements
|
14887 |
+
* and returns a remove listener function.
|
14888 |
+
*
|
14889 |
+
* @param {NodeList|HTMLCollection} nodeList
|
14890 |
+
* @param {String} type
|
14891 |
+
* @param {Function} callback
|
14892 |
+
* @return {Object}
|
14893 |
+
*/
|
14894 |
+
function listenNodeList(nodeList, type, callback) {
|
14895 |
+
Array.prototype.forEach.call(nodeList, function(node) {
|
14896 |
+
node.addEventListener(type, callback);
|
14897 |
+
});
|
14898 |
+
|
14899 |
+
return {
|
14900 |
+
destroy: function() {
|
14901 |
+
Array.prototype.forEach.call(nodeList, function(node) {
|
14902 |
+
node.removeEventListener(type, callback);
|
14903 |
+
});
|
14904 |
+
}
|
14905 |
+
}
|
14906 |
+
}
|
14907 |
+
|
14908 |
+
/**
|
14909 |
+
* Add an event listener to a selector
|
14910 |
+
* and returns a remove listener function.
|
14911 |
+
*
|
14912 |
+
* @param {String} selector
|
14913 |
+
* @param {String} type
|
14914 |
+
* @param {Function} callback
|
14915 |
+
* @return {Object}
|
14916 |
+
*/
|
14917 |
+
function listenSelector(selector, type, callback) {
|
14918 |
+
return delegate(document.body, selector, type, callback);
|
14919 |
+
}
|
14920 |
+
|
14921 |
+
module.exports = listen;
|
14922 |
+
|
14923 |
+
|
14924 |
+
/***/ }),
|
14925 |
+
/* 3 */
|
14926 |
+
/***/ (function(module, exports) {
|
14927 |
+
|
14928 |
+
/**
|
14929 |
+
* Check if argument is a HTML element.
|
14930 |
+
*
|
14931 |
+
* @param {Object} value
|
14932 |
+
* @return {Boolean}
|
14933 |
+
*/
|
14934 |
+
exports.node = function(value) {
|
14935 |
+
return value !== undefined
|
14936 |
+
&& value instanceof HTMLElement
|
14937 |
+
&& value.nodeType === 1;
|
14938 |
+
};
|
14939 |
+
|
14940 |
+
/**
|
14941 |
+
* Check if argument is a list of HTML elements.
|
14942 |
+
*
|
14943 |
+
* @param {Object} value
|
14944 |
+
* @return {Boolean}
|
14945 |
+
*/
|
14946 |
+
exports.nodeList = function(value) {
|
14947 |
+
var type = Object.prototype.toString.call(value);
|
14948 |
+
|
14949 |
+
return value !== undefined
|
14950 |
+
&& (type === '[object NodeList]' || type === '[object HTMLCollection]')
|
14951 |
+
&& ('length' in value)
|
14952 |
+
&& (value.length === 0 || exports.node(value[0]));
|
14953 |
+
};
|
14954 |
+
|
14955 |
+
/**
|
14956 |
+
* Check if argument is a string.
|
14957 |
+
*
|
14958 |
+
* @param {Object} value
|
14959 |
+
* @return {Boolean}
|
14960 |
+
*/
|
14961 |
+
exports.string = function(value) {
|
14962 |
+
return typeof value === 'string'
|
14963 |
+
|| value instanceof String;
|
14964 |
+
};
|
14965 |
+
|
14966 |
+
/**
|
14967 |
+
* Check if argument is a function.
|
14968 |
+
*
|
14969 |
+
* @param {Object} value
|
14970 |
+
* @return {Boolean}
|
14971 |
+
*/
|
14972 |
+
exports.fn = function(value) {
|
14973 |
+
var type = Object.prototype.toString.call(value);
|
14974 |
+
|
14975 |
+
return type === '[object Function]';
|
14976 |
+
};
|
14977 |
+
|
14978 |
+
|
14979 |
+
/***/ }),
|
14980 |
+
/* 4 */
|
14981 |
+
/***/ (function(module, exports, __webpack_require__) {
|
14982 |
+
|
14983 |
+
var closest = __webpack_require__(5);
|
14984 |
+
|
14985 |
+
/**
|
14986 |
+
* Delegates event to a selector.
|
14987 |
+
*
|
14988 |
+
* @param {Element} element
|
14989 |
+
* @param {String} selector
|
14990 |
+
* @param {String} type
|
14991 |
+
* @param {Function} callback
|
14992 |
+
* @param {Boolean} useCapture
|
14993 |
+
* @return {Object}
|
14994 |
+
*/
|
14995 |
+
function _delegate(element, selector, type, callback, useCapture) {
|
14996 |
+
var listenerFn = listener.apply(this, arguments);
|
14997 |
+
|
14998 |
+
element.addEventListener(type, listenerFn, useCapture);
|
14999 |
+
|
15000 |
+
return {
|
15001 |
+
destroy: function() {
|
15002 |
+
element.removeEventListener(type, listenerFn, useCapture);
|
15003 |
+
}
|
15004 |
+
}
|
15005 |
+
}
|
15006 |
+
|
15007 |
+
/**
|
15008 |
+
* Delegates event to a selector.
|
15009 |
+
*
|
15010 |
+
* @param {Element|String|Array} [elements]
|
15011 |
+
* @param {String} selector
|
15012 |
+
* @param {String} type
|
15013 |
+
* @param {Function} callback
|
15014 |
+
* @param {Boolean} useCapture
|
15015 |
+
* @return {Object}
|
15016 |
+
*/
|
15017 |
+
function delegate(elements, selector, type, callback, useCapture) {
|
15018 |
+
// Handle the regular Element usage
|
15019 |
+
if (typeof elements.addEventListener === 'function') {
|
15020 |
+
return _delegate.apply(null, arguments);
|
15021 |
+
}
|
15022 |
+
|
15023 |
+
// Handle Element-less usage, it defaults to global delegation
|
15024 |
+
if (typeof type === 'function') {
|
15025 |
+
// Use `document` as the first parameter, then apply arguments
|
15026 |
+
// This is a short way to .unshift `arguments` without running into deoptimizations
|
15027 |
+
return _delegate.bind(null, document).apply(null, arguments);
|
15028 |
+
}
|
15029 |
+
|
15030 |
+
// Handle Selector-based usage
|
15031 |
+
if (typeof elements === 'string') {
|
15032 |
+
elements = document.querySelectorAll(elements);
|
15033 |
+
}
|
15034 |
+
|
15035 |
+
// Handle Array-like based usage
|
15036 |
+
return Array.prototype.map.call(elements, function (element) {
|
15037 |
+
return _delegate(element, selector, type, callback, useCapture);
|
15038 |
+
});
|
15039 |
+
}
|
15040 |
+
|
15041 |
+
/**
|
15042 |
+
* Finds closest match and invokes callback.
|
15043 |
+
*
|
15044 |
+
* @param {Element} element
|
15045 |
+
* @param {String} selector
|
15046 |
+
* @param {String} type
|
15047 |
+
* @param {Function} callback
|
15048 |
+
* @return {Function}
|
15049 |
+
*/
|
15050 |
+
function listener(element, selector, type, callback) {
|
15051 |
+
return function(e) {
|
15052 |
+
e.delegateTarget = closest(e.target, selector);
|
15053 |
+
|
15054 |
+
if (e.delegateTarget) {
|
15055 |
+
callback.call(element, e);
|
15056 |
+
}
|
15057 |
+
}
|
15058 |
+
}
|
15059 |
+
|
15060 |
+
module.exports = delegate;
|
15061 |
+
|
15062 |
+
|
15063 |
+
/***/ }),
|
15064 |
+
/* 5 */
|
15065 |
+
/***/ (function(module, exports) {
|
15066 |
+
|
15067 |
+
var DOCUMENT_NODE_TYPE = 9;
|
15068 |
+
|
15069 |
+
/**
|
15070 |
+
* A polyfill for Element.matches()
|
15071 |
+
*/
|
15072 |
+
if (typeof Element !== 'undefined' && !Element.prototype.matches) {
|
15073 |
+
var proto = Element.prototype;
|
15074 |
+
|
15075 |
+
proto.matches = proto.matchesSelector ||
|
15076 |
+
proto.mozMatchesSelector ||
|
15077 |
+
proto.msMatchesSelector ||
|
15078 |
+
proto.oMatchesSelector ||
|
15079 |
+
proto.webkitMatchesSelector;
|
15080 |
+
}
|
15081 |
+
|
15082 |
+
/**
|
15083 |
+
* Finds the closest parent that matches a selector.
|
15084 |
+
*
|
15085 |
+
* @param {Element} element
|
15086 |
+
* @param {String} selector
|
15087 |
+
* @return {Function}
|
15088 |
+
*/
|
15089 |
+
function closest (element, selector) {
|
15090 |
+
while (element && element.nodeType !== DOCUMENT_NODE_TYPE) {
|
15091 |
+
if (typeof element.matches === 'function' &&
|
15092 |
+
element.matches(selector)) {
|
15093 |
+
return element;
|
15094 |
+
}
|
15095 |
+
element = element.parentNode;
|
15096 |
+
}
|
15097 |
+
}
|
15098 |
+
|
15099 |
+
module.exports = closest;
|
15100 |
+
|
15101 |
+
|
15102 |
+
/***/ }),
|
15103 |
+
/* 6 */
|
15104 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
15105 |
+
|
15106 |
+
"use strict";
|
15107 |
+
__webpack_require__.r(__webpack_exports__);
|
15108 |
+
|
15109 |
+
// EXTERNAL MODULE: ./node_modules/select/src/select.js
|
15110 |
+
var src_select = __webpack_require__(0);
|
15111 |
+
var select_default = /*#__PURE__*/__webpack_require__.n(src_select);
|
15112 |
+
|
15113 |
+
// CONCATENATED MODULE: ./src/clipboard-action.js
|
15114 |
+
var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
|
15115 |
+
|
15116 |
+
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
15117 |
+
|
15118 |
+
function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
|
15119 |
+
|
15120 |
+
|
15121 |
+
|
15122 |
+
/**
|
15123 |
+
* Inner class which performs selection from either `text` or `target`
|
15124 |
+
* properties and then executes copy or cut operations.
|
15125 |
+
*/
|
15126 |
+
|
15127 |
+
var clipboard_action_ClipboardAction = function () {
|
15128 |
+
/**
|
15129 |
+
* @param {Object} options
|
15130 |
+
*/
|
15131 |
+
function ClipboardAction(options) {
|
15132 |
+
_classCallCheck(this, ClipboardAction);
|
15133 |
+
|
15134 |
+
this.resolveOptions(options);
|
15135 |
+
this.initSelection();
|
15136 |
+
}
|
15137 |
+
|
15138 |
+
/**
|
15139 |
+
* Defines base properties passed from constructor.
|
15140 |
+
* @param {Object} options
|
15141 |
+
*/
|
15142 |
+
|
15143 |
+
|
15144 |
+
_createClass(ClipboardAction, [{
|
15145 |
+
key: 'resolveOptions',
|
15146 |
+
value: function resolveOptions() {
|
15147 |
+
var options = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
|
15148 |
+
|
15149 |
+
this.action = options.action;
|
15150 |
+
this.container = options.container;
|
15151 |
+
this.emitter = options.emitter;
|
15152 |
+
this.target = options.target;
|
15153 |
+
this.text = options.text;
|
15154 |
+
this.trigger = options.trigger;
|
15155 |
+
|
15156 |
+
this.selectedText = '';
|
15157 |
+
}
|
15158 |
+
|
15159 |
+
/**
|
15160 |
+
* Decides which selection strategy is going to be applied based
|
15161 |
+
* on the existence of `text` and `target` properties.
|
15162 |
+
*/
|
15163 |
+
|
15164 |
+
}, {
|
15165 |
+
key: 'initSelection',
|
15166 |
+
value: function initSelection() {
|
15167 |
+
if (this.text) {
|
15168 |
+
this.selectFake();
|
15169 |
+
} else if (this.target) {
|
15170 |
+
this.selectTarget();
|
15171 |
+
}
|
15172 |
+
}
|
15173 |
+
|
15174 |
+
/**
|
15175 |
+
* Creates a fake textarea element, sets its value from `text` property,
|
15176 |
+
* and makes a selection on it.
|
15177 |
+
*/
|
15178 |
+
|
15179 |
+
}, {
|
15180 |
+
key: 'selectFake',
|
15181 |
+
value: function selectFake() {
|
15182 |
+
var _this = this;
|
15183 |
+
|
15184 |
+
var isRTL = document.documentElement.getAttribute('dir') == 'rtl';
|
15185 |
+
|
15186 |
+
this.removeFake();
|
15187 |
+
|
15188 |
+
this.fakeHandlerCallback = function () {
|
15189 |
+
return _this.removeFake();
|
15190 |
+
};
|
15191 |
+
this.fakeHandler = this.container.addEventListener('click', this.fakeHandlerCallback) || true;
|
15192 |
+
|
15193 |
+
this.fakeElem = document.createElement('textarea');
|
15194 |
+
// Prevent zooming on iOS
|
15195 |
+
this.fakeElem.style.fontSize = '12pt';
|
15196 |
+
// Reset box model
|
15197 |
+
this.fakeElem.style.border = '0';
|
15198 |
+
this.fakeElem.style.padding = '0';
|
15199 |
+
this.fakeElem.style.margin = '0';
|
15200 |
+
// Move element out of screen horizontally
|
15201 |
+
this.fakeElem.style.position = 'absolute';
|
15202 |
+
this.fakeElem.style[isRTL ? 'right' : 'left'] = '-9999px';
|
15203 |
+
// Move element to the same position vertically
|
15204 |
+
var yPosition = window.pageYOffset || document.documentElement.scrollTop;
|
15205 |
+
this.fakeElem.style.top = yPosition + 'px';
|
15206 |
+
|
15207 |
+
this.fakeElem.setAttribute('readonly', '');
|
15208 |
+
this.fakeElem.value = this.text;
|
15209 |
+
|
15210 |
+
this.container.appendChild(this.fakeElem);
|
15211 |
+
|
15212 |
+
this.selectedText = select_default()(this.fakeElem);
|
15213 |
+
this.copyText();
|
15214 |
+
}
|
15215 |
+
|
15216 |
+
/**
|
15217 |
+
* Only removes the fake element after another click event, that way
|
15218 |
+
* a user can hit `Ctrl+C` to copy because selection still exists.
|
15219 |
+
*/
|
15220 |
+
|
15221 |
+
}, {
|
15222 |
+
key: 'removeFake',
|
15223 |
+
value: function removeFake() {
|
15224 |
+
if (this.fakeHandler) {
|
15225 |
+
this.container.removeEventListener('click', this.fakeHandlerCallback);
|
15226 |
+
this.fakeHandler = null;
|
15227 |
+
this.fakeHandlerCallback = null;
|
15228 |
+
}
|
15229 |
+
|
15230 |
+
if (this.fakeElem) {
|
15231 |
+
this.container.removeChild(this.fakeElem);
|
15232 |
+
this.fakeElem = null;
|
15233 |
+
}
|
15234 |
+
}
|
15235 |
+
|
15236 |
+
/**
|
15237 |
+
* Selects the content from element passed on `target` property.
|
15238 |
+
*/
|
15239 |
+
|
15240 |
+
}, {
|
15241 |
+
key: 'selectTarget',
|
15242 |
+
value: function selectTarget() {
|
15243 |
+
this.selectedText = select_default()(this.target);
|
15244 |
+
this.copyText();
|
15245 |
+
}
|
15246 |
+
|
15247 |
+
/**
|
15248 |
+
* Executes the copy operation based on the current selection.
|
15249 |
+
*/
|
15250 |
+
|
15251 |
+
}, {
|
15252 |
+
key: 'copyText',
|
15253 |
+
value: function copyText() {
|
15254 |
+
var succeeded = void 0;
|
15255 |
+
|
15256 |
+
try {
|
15257 |
+
succeeded = document.execCommand(this.action);
|
15258 |
+
} catch (err) {
|
15259 |
+
succeeded = false;
|
15260 |
+
}
|
15261 |
+
|
15262 |
+
this.handleResult(succeeded);
|
15263 |
+
}
|
15264 |
+
|
15265 |
+
/**
|
15266 |
+
* Fires an event based on the copy operation result.
|
15267 |
+
* @param {Boolean} succeeded
|
15268 |
+
*/
|
15269 |
+
|
15270 |
+
}, {
|
15271 |
+
key: 'handleResult',
|
15272 |
+
value: function handleResult(succeeded) {
|
15273 |
+
this.emitter.emit(succeeded ? 'success' : 'error', {
|
15274 |
+
action: this.action,
|
15275 |
+
text: this.selectedText,
|
15276 |
+
trigger: this.trigger,
|
15277 |
+
clearSelection: this.clearSelection.bind(this)
|
15278 |
+
});
|
15279 |
+
}
|
15280 |
+
|
15281 |
+
/**
|
15282 |
+
* Moves focus away from `target` and back to the trigger, removes current selection.
|
15283 |
+
*/
|
15284 |
+
|
15285 |
+
}, {
|
15286 |
+
key: 'clearSelection',
|
15287 |
+
value: function clearSelection() {
|
15288 |
+
if (this.trigger) {
|
15289 |
+
this.trigger.focus();
|
15290 |
+
}
|
15291 |
+
document.activeElement.blur();
|
15292 |
+
window.getSelection().removeAllRanges();
|
15293 |
+
}
|
15294 |
+
|
15295 |
+
/**
|
15296 |
+
* Sets the `action` to be performed which can be either 'copy' or 'cut'.
|
15297 |
+
* @param {String} action
|
15298 |
+
*/
|
15299 |
+
|
15300 |
+
}, {
|
15301 |
+
key: 'destroy',
|
15302 |
+
|
15303 |
+
|
15304 |
+
/**
|
15305 |
+
* Destroy lifecycle.
|
15306 |
+
*/
|
15307 |
+
value: function destroy() {
|
15308 |
+
this.removeFake();
|
15309 |
+
}
|
15310 |
+
}, {
|
15311 |
+
key: 'action',
|
15312 |
+
set: function set() {
|
15313 |
+
var action = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 'copy';
|
15314 |
+
|
15315 |
+
this._action = action;
|
15316 |
+
|
15317 |
+
if (this._action !== 'copy' && this._action !== 'cut') {
|
15318 |
+
throw new Error('Invalid "action" value, use either "copy" or "cut"');
|
15319 |
+
}
|
15320 |
+
}
|
15321 |
+
|
15322 |
+
/**
|
15323 |
+
* Gets the `action` property.
|
15324 |
+
* @return {String}
|
15325 |
+
*/
|
15326 |
+
,
|
15327 |
+
get: function get() {
|
15328 |
+
return this._action;
|
15329 |
+
}
|
15330 |
+
|
15331 |
+
/**
|
15332 |
+
* Sets the `target` property using an element
|
15333 |
+
* that will be have its content copied.
|
15334 |
+
* @param {Element} target
|
15335 |
+
*/
|
15336 |
+
|
15337 |
+
}, {
|
15338 |
+
key: 'target',
|
15339 |
+
set: function set(target) {
|
15340 |
+
if (target !== undefined) {
|
15341 |
+
if (target && (typeof target === 'undefined' ? 'undefined' : _typeof(target)) === 'object' && target.nodeType === 1) {
|
15342 |
+
if (this.action === 'copy' && target.hasAttribute('disabled')) {
|
15343 |
+
throw new Error('Invalid "target" attribute. Please use "readonly" instead of "disabled" attribute');
|
15344 |
+
}
|
15345 |
+
|
15346 |
+
if (this.action === 'cut' && (target.hasAttribute('readonly') || target.hasAttribute('disabled'))) {
|
15347 |
+
throw new Error('Invalid "target" attribute. You can\'t cut text from elements with "readonly" or "disabled" attributes');
|
15348 |
+
}
|
15349 |
+
|
15350 |
+
this._target = target;
|
15351 |
+
} else {
|
15352 |
+
throw new Error('Invalid "target" value, use a valid Element');
|
15353 |
+
}
|
15354 |
+
}
|
15355 |
+
}
|
15356 |
+
|
15357 |
+
/**
|
15358 |
+
* Gets the `target` property.
|
15359 |
+
* @return {String|HTMLElement}
|
15360 |
+
*/
|
15361 |
+
,
|
15362 |
+
get: function get() {
|
15363 |
+
return this._target;
|
15364 |
+
}
|
15365 |
+
}]);
|
15366 |
+
|
15367 |
+
return ClipboardAction;
|
15368 |
+
}();
|
15369 |
+
|
15370 |
+
/* harmony default export */ var clipboard_action = (clipboard_action_ClipboardAction);
|
15371 |
+
// EXTERNAL MODULE: ./node_modules/tiny-emitter/index.js
|
15372 |
+
var tiny_emitter = __webpack_require__(1);
|
15373 |
+
var tiny_emitter_default = /*#__PURE__*/__webpack_require__.n(tiny_emitter);
|
15374 |
+
|
15375 |
+
// EXTERNAL MODULE: ./node_modules/good-listener/src/listen.js
|
15376 |
+
var listen = __webpack_require__(2);
|
15377 |
+
var listen_default = /*#__PURE__*/__webpack_require__.n(listen);
|
15378 |
+
|
15379 |
+
// CONCATENATED MODULE: ./src/clipboard.js
|
15380 |
+
var clipboard_typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
|
15381 |
+
|
15382 |
+
var clipboard_createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
15383 |
+
|
15384 |
+
function clipboard_classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
|
15385 |
+
|
15386 |
+
function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; }
|
15387 |
+
|
15388 |
+
function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
|
15389 |
+
|
15390 |
+
|
15391 |
+
|
15392 |
+
|
15393 |
+
|
15394 |
+
/**
|
15395 |
+
* Base class which takes one or more elements, adds event listeners to them,
|
15396 |
+
* and instantiates a new `ClipboardAction` on each click.
|
15397 |
+
*/
|
15398 |
+
|
15399 |
+
var clipboard_Clipboard = function (_Emitter) {
|
15400 |
+
_inherits(Clipboard, _Emitter);
|
15401 |
+
|
15402 |
+
/**
|
15403 |
+
* @param {String|HTMLElement|HTMLCollection|NodeList} trigger
|
15404 |
+
* @param {Object} options
|
15405 |
+
*/
|
15406 |
+
function Clipboard(trigger, options) {
|
15407 |
+
clipboard_classCallCheck(this, Clipboard);
|
15408 |
+
|
15409 |
+
var _this = _possibleConstructorReturn(this, (Clipboard.__proto__ || Object.getPrototypeOf(Clipboard)).call(this));
|
15410 |
+
|
15411 |
+
_this.resolveOptions(options);
|
15412 |
+
_this.listenClick(trigger);
|
15413 |
+
return _this;
|
15414 |
+
}
|
15415 |
+
|
15416 |
+
/**
|
15417 |
+
* Defines if attributes would be resolved using internal setter functions
|
15418 |
+
* or custom functions that were passed in the constructor.
|
15419 |
+
* @param {Object} options
|
15420 |
+
*/
|
15421 |
+
|
15422 |
+
|
15423 |
+
clipboard_createClass(Clipboard, [{
|
15424 |
+
key: 'resolveOptions',
|
15425 |
+
value: function resolveOptions() {
|
15426 |
+
var options = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
|
15427 |
+
|
15428 |
+
this.action = typeof options.action === 'function' ? options.action : this.defaultAction;
|
15429 |
+
this.target = typeof options.target === 'function' ? options.target : this.defaultTarget;
|
15430 |
+
this.text = typeof options.text === 'function' ? options.text : this.defaultText;
|
15431 |
+
this.container = clipboard_typeof(options.container) === 'object' ? options.container : document.body;
|
15432 |
+
}
|
15433 |
+
|
15434 |
+
/**
|
15435 |
+
* Adds a click event listener to the passed trigger.
|
15436 |
+
* @param {String|HTMLElement|HTMLCollection|NodeList} trigger
|
15437 |
+
*/
|
15438 |
+
|
15439 |
+
}, {
|
15440 |
+
key: 'listenClick',
|
15441 |
+
value: function listenClick(trigger) {
|
15442 |
+
var _this2 = this;
|
15443 |
+
|
15444 |
+
this.listener = listen_default()(trigger, 'click', function (e) {
|
15445 |
+
return _this2.onClick(e);
|
15446 |
+
});
|
15447 |
+
}
|
15448 |
+
|
15449 |
+
/**
|
15450 |
+
* Defines a new `ClipboardAction` on each click event.
|
15451 |
+
* @param {Event} e
|
15452 |
+
*/
|
15453 |
+
|
15454 |
+
}, {
|
15455 |
+
key: 'onClick',
|
15456 |
+
value: function onClick(e) {
|
15457 |
+
var trigger = e.delegateTarget || e.currentTarget;
|
15458 |
+
|
15459 |
+
if (this.clipboardAction) {
|
15460 |
+
this.clipboardAction = null;
|
15461 |
+
}
|
15462 |
+
|
15463 |
+
this.clipboardAction = new clipboard_action({
|
15464 |
+
action: this.action(trigger),
|
15465 |
+
target: this.target(trigger),
|
15466 |
+
text: this.text(trigger),
|
15467 |
+
container: this.container,
|
15468 |
+
trigger: trigger,
|
15469 |
+
emitter: this
|
15470 |
+
});
|
15471 |
+
}
|
15472 |
+
|
15473 |
+
/**
|
15474 |
+
* Default `action` lookup function.
|
15475 |
+
* @param {Element} trigger
|
15476 |
+
*/
|
15477 |
+
|
15478 |
+
}, {
|
15479 |
+
key: 'defaultAction',
|
15480 |
+
value: function defaultAction(trigger) {
|
15481 |
+
return getAttributeValue('action', trigger);
|
15482 |
+
}
|
15483 |
+
|
15484 |
+
/**
|
15485 |
+
* Default `target` lookup function.
|
15486 |
+
* @param {Element} trigger
|
15487 |
+
*/
|
15488 |
+
|
15489 |
+
}, {
|
15490 |
+
key: 'defaultTarget',
|
15491 |
+
value: function defaultTarget(trigger) {
|
15492 |
+
var selector = getAttributeValue('target', trigger);
|
15493 |
+
|
15494 |
+
if (selector) {
|
15495 |
+
return document.querySelector(selector);
|
15496 |
+
}
|
15497 |
+
}
|
15498 |
+
|
15499 |
+
/**
|
15500 |
+
* Returns the support of the given action, or all actions if no action is
|
15501 |
+
* given.
|
15502 |
+
* @param {String} [action]
|
15503 |
+
*/
|
15504 |
+
|
15505 |
+
}, {
|
15506 |
+
key: 'defaultText',
|
15507 |
+
|
15508 |
+
|
15509 |
+
/**
|
15510 |
+
* Default `text` lookup function.
|
15511 |
+
* @param {Element} trigger
|
15512 |
+
*/
|
15513 |
+
value: function defaultText(trigger) {
|
15514 |
+
return getAttributeValue('text', trigger);
|
15515 |
+
}
|
15516 |
+
|
15517 |
+
/**
|
15518 |
+
* Destroy lifecycle.
|
15519 |
+
*/
|
15520 |
+
|
15521 |
+
}, {
|
15522 |
+
key: 'destroy',
|
15523 |
+
value: function destroy() {
|
15524 |
+
this.listener.destroy();
|
15525 |
+
|
15526 |
+
if (this.clipboardAction) {
|
15527 |
+
this.clipboardAction.destroy();
|
15528 |
+
this.clipboardAction = null;
|
15529 |
+
}
|
15530 |
+
}
|
15531 |
+
}], [{
|
15532 |
+
key: 'isSupported',
|
15533 |
+
value: function isSupported() {
|
15534 |
+
var action = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : ['copy', 'cut'];
|
15535 |
+
|
15536 |
+
var actions = typeof action === 'string' ? [action] : action;
|
15537 |
+
var support = !!document.queryCommandSupported;
|
15538 |
+
|
15539 |
+
actions.forEach(function (action) {
|
15540 |
+
support = support && !!document.queryCommandSupported(action);
|
15541 |
+
});
|
15542 |
+
|
15543 |
+
return support;
|
15544 |
+
}
|
15545 |
+
}]);
|
15546 |
+
|
15547 |
+
return Clipboard;
|
15548 |
+
}(tiny_emitter_default.a);
|
15549 |
+
|
15550 |
+
/**
|
15551 |
+
* Helper function to retrieve attribute value.
|
15552 |
+
* @param {String} suffix
|
15553 |
+
* @param {Element} element
|
15554 |
+
*/
|
15555 |
+
|
15556 |
+
|
15557 |
+
function getAttributeValue(suffix, element) {
|
15558 |
+
var attribute = 'data-clipboard-' + suffix;
|
15559 |
+
|
15560 |
+
if (!element.hasAttribute(attribute)) {
|
15561 |
+
return;
|
15562 |
+
}
|
15563 |
+
|
15564 |
+
return element.getAttribute(attribute);
|
15565 |
+
}
|
15566 |
+
|
15567 |
+
/* harmony default export */ var clipboard = __webpack_exports__["default"] = (clipboard_Clipboard);
|
15568 |
+
|
15569 |
+
/***/ })
|
15570 |
+
/******/ ])["default"];
|
15571 |
+
});
|
15572 |
+
|
15573 |
+
/***/ }),
|
15574 |
+
/* 99 */
|
15575 |
+
/***/ (function(module, exports, __webpack_require__) {
|
15576 |
+
|
15577 |
+
var __WEBPACK_AMD_DEFINE_RESULT__;/*global define:false */
|
15578 |
+
/**
|
15579 |
+
* Copyright 2012-2017 Craig Campbell
|
15580 |
+
*
|
15581 |
+
* Licensed under the Apache License, Version 2.0 (the "License");
|
15582 |
+
* you may not use this file except in compliance with the License.
|
15583 |
+
* You may obtain a copy of the License at
|
15584 |
+
*
|
15585 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
15586 |
+
*
|
15587 |
+
* Unless required by applicable law or agreed to in writing, software
|
15588 |
+
* distributed under the License is distributed on an "AS IS" BASIS,
|
15589 |
+
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
15590 |
+
* See the License for the specific language governing permissions and
|
15591 |
+
* limitations under the License.
|
15592 |
+
*
|
15593 |
+
* Mousetrap is a simple keyboard shortcut library for Javascript with
|
15594 |
+
* no external dependencies
|
15595 |
+
*
|
15596 |
+
* @version 1.6.5
|
15597 |
+
* @url craig.is/killing/mice
|
15598 |
+
*/
|
15599 |
+
(function(window, document, undefined) {
|
15600 |
+
|
15601 |
+
// Check if mousetrap is used inside browser, if not, return
|
15602 |
+
if (!window) {
|
15603 |
+
return;
|
15604 |
+
}
|
15605 |
+
|
15606 |
+
/**
|
15607 |
+
* mapping of special keycodes to their corresponding keys
|
15608 |
+
*
|
15609 |
+
* everything in this dictionary cannot use keypress events
|
15610 |
+
* so it has to be here to map to the correct keycodes for
|
15611 |
+
* keyup/keydown events
|
15612 |
+
*
|
15613 |
+
* @type {Object}
|
15614 |
+
*/
|
15615 |
+
var _MAP = {
|
15616 |
+
8: 'backspace',
|
15617 |
+
9: 'tab',
|
15618 |
+
13: 'enter',
|
15619 |
+
16: 'shift',
|
15620 |
+
17: 'ctrl',
|
15621 |
+
18: 'alt',
|
15622 |
+
20: 'capslock',
|
15623 |
+
27: 'esc',
|
15624 |
+
32: 'space',
|
15625 |
+
33: 'pageup',
|
15626 |
+
34: 'pagedown',
|
15627 |
+
35: 'end',
|
15628 |
+
36: 'home',
|
15629 |
+
37: 'left',
|
15630 |
+
38: 'up',
|
15631 |
+
39: 'right',
|
15632 |
+
40: 'down',
|
15633 |
+
45: 'ins',
|
15634 |
+
46: 'del',
|
15635 |
+
91: 'meta',
|
15636 |
+
93: 'meta',
|
15637 |
+
224: 'meta'
|
15638 |
+
};
|
15639 |
+
|
15640 |
+
/**
|
15641 |
+
* mapping for special characters so they can support
|
15642 |
+
*
|
15643 |
+
* this dictionary is only used incase you want to bind a
|
15644 |
+
* keyup or keydown event to one of these keys
|
15645 |
+
*
|
15646 |
+
* @type {Object}
|
15647 |
+
*/
|
15648 |
+
var _KEYCODE_MAP = {
|
15649 |
+
106: '*',
|
15650 |
+
107: '+',
|
15651 |
+
109: '-',
|
15652 |
+
110: '.',
|
15653 |
+
111 : '/',
|
15654 |
+
186: ';',
|
15655 |
+
187: '=',
|
15656 |
+
188: ',',
|
15657 |
+
189: '-',
|
15658 |
+
190: '.',
|
15659 |
+
191: '/',
|
15660 |
+
192: '`',
|
15661 |
+
219: '[',
|
15662 |
+
220: '\\',
|
15663 |
+
221: ']',
|
15664 |
+
222: '\''
|
15665 |
+
};
|
15666 |
+
|
15667 |
+
/**
|
15668 |
* this is a mapping of keys that require shift on a US keypad
|
15669 |
* back to the non shift equivelents
|
15670 |
*
|
16636 |
|
16637 |
|
16638 |
/***/ }),
|
16639 |
+
/* 100 */
|
16640 |
/***/ (function(module, exports) {
|
16641 |
|
16642 |
/**
|
16688 |
|
16689 |
|
16690 |
/***/ }),
|
16691 |
+
/* 101 */
|
16692 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
16693 |
|
16694 |
"use strict";
|
16695 |
/* harmony export (immutable) */ __webpack_exports__["a"] = useMediaQuery;
|
16696 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
16697 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(24);
|
16698 |
|
16699 |
|
16700 |
/**
|
16709 |
*/
|
16710 |
|
16711 |
function useMediaQuery(query) {
|
16712 |
+
var _useState = Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_element__["l" /* useState */])(query && window.matchMedia(query).matches),
|
16713 |
_useState2 = Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__["a" /* default */])(_useState, 2),
|
16714 |
match = _useState2[0],
|
16715 |
setMatch = _useState2[1];
|
16735 |
//# sourceMappingURL=index.js.map
|
16736 |
|
16737 |
/***/ }),
|
16738 |
+
/* 102 */
|
16739 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
16740 |
|
16741 |
"use strict";
|
16742 |
+
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return createQueue; });
|
16743 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__request_idle_callback__ = __webpack_require__(507);
|
16744 |
/**
|
16745 |
* Internal dependencies
|
16746 |
*/
|
16747 |
|
16748 |
+
/**
|
16749 |
+
* Enqueued callback to invoke once idle time permits.
|
16750 |
+
*
|
16751 |
+
* @typedef {()=>void} WPPriorityQueueCallback
|
16752 |
+
*/
|
16753 |
+
|
16754 |
+
/**
|
16755 |
+
* An object used to associate callbacks in a particular context grouping.
|
16756 |
+
*
|
16757 |
+
* @typedef {{}} WPPriorityQueueContext
|
16758 |
+
*/
|
16759 |
+
|
16760 |
+
/**
|
16761 |
+
* Function to add callback to priority queue.
|
16762 |
+
*
|
16763 |
+
* @typedef {(element:WPPriorityQueueContext,item:WPPriorityQueueCallback)=>void} WPPriorityQueueAdd
|
16764 |
+
*/
|
16765 |
+
|
16766 |
+
/**
|
16767 |
+
* Function to flush callbacks from priority queue.
|
16768 |
+
*
|
16769 |
+
* @typedef {(element:WPPriorityQueueContext)=>boolean} WPPriorityQueueFlush
|
16770 |
+
*/
|
16771 |
+
|
16772 |
+
/**
|
16773 |
+
* Reset the queue.
|
16774 |
+
*
|
16775 |
+
* @typedef {()=>void} WPPriorityQueueReset
|
16776 |
+
*/
|
16777 |
+
|
16778 |
+
/**
|
16779 |
+
* Priority queue instance.
|
16780 |
+
*
|
16781 |
+
* @typedef {Object} WPPriorityQueue
|
16782 |
+
*
|
16783 |
+
* @property {WPPriorityQueueAdd} add Add callback to queue for context.
|
16784 |
+
* @property {WPPriorityQueueFlush} flush Flush queue for context.
|
16785 |
+
* @property {WPPriorityQueueReset} reset Reset queue.
|
16786 |
+
*/
|
16787 |
+
|
16788 |
+
/**
|
16789 |
+
* Creates a context-aware queue that only executes
|
16790 |
+
* the last task of a given context.
|
16791 |
+
*
|
16792 |
+
* @example
|
16793 |
+
*```js
|
16794 |
+
* import { createQueue } from '@wordpress/priority-queue';
|
16795 |
+
*
|
16796 |
+
* const queue = createQueue();
|
16797 |
+
*
|
16798 |
+
* // Context objects.
|
16799 |
+
* const ctx1 = {};
|
16800 |
+
* const ctx2 = {};
|
16801 |
+
*
|
16802 |
+
* // For a given context in the queue, only the last callback is executed.
|
16803 |
+
* queue.add( ctx1, () => console.log( 'This will be printed first' ) );
|
16804 |
+
* queue.add( ctx2, () => console.log( 'This won\'t be printed' ) );
|
16805 |
+
* queue.add( ctx2, () => console.log( 'This will be printed second' ) );
|
16806 |
+
*```
|
16807 |
+
*
|
16808 |
+
* @return {WPPriorityQueue} Queue object with `add`, `flush` and `reset` methods.
|
16809 |
+
*/
|
16810 |
+
|
16811 |
+
var createQueue = function createQueue() {
|
16812 |
+
/** @type {WPPriorityQueueContext[]} */
|
16813 |
+
var waitingList = [];
|
16814 |
+
/** @type {WeakMap<WPPriorityQueueContext,WPPriorityQueueCallback>} */
|
16815 |
+
|
16816 |
+
var elementsMap = new WeakMap();
|
16817 |
+
var isRunning = false;
|
16818 |
+
/**
|
16819 |
+
* Callback to process as much queue as time permits.
|
16820 |
+
*
|
16821 |
+
* @param {IdleDeadline|number} deadline Idle callback deadline object, or
|
16822 |
+
* animation frame timestamp.
|
16823 |
+
*/
|
16824 |
+
|
16825 |
+
var runWaitingList = function runWaitingList(deadline) {
|
16826 |
+
var hasTimeRemaining = typeof deadline === 'number' ? function () {
|
16827 |
+
return false;
|
16828 |
+
} : function () {
|
16829 |
+
return deadline.timeRemaining() > 0;
|
16830 |
+
};
|
16831 |
+
|
16832 |
+
do {
|
16833 |
+
if (waitingList.length === 0) {
|
16834 |
+
isRunning = false;
|
16835 |
+
return;
|
16836 |
+
}
|
16837 |
+
|
16838 |
+
var nextElement =
|
16839 |
+
/** @type {WPPriorityQueueContext} */
|
16840 |
+
waitingList.shift();
|
16841 |
+
var callback =
|
16842 |
+
/** @type {WPPriorityQueueCallback} */
|
16843 |
+
elementsMap.get(nextElement);
|
16844 |
+
callback();
|
16845 |
+
elementsMap.delete(nextElement);
|
16846 |
+
} while (hasTimeRemaining());
|
16847 |
+
|
16848 |
+
Object(__WEBPACK_IMPORTED_MODULE_0__request_idle_callback__["a" /* default */])(runWaitingList);
|
16849 |
+
};
|
16850 |
+
/**
|
16851 |
+
* Add a callback to the queue for a given context.
|
16852 |
+
*
|
16853 |
+
* @type {WPPriorityQueueAdd}
|
16854 |
+
*
|
16855 |
+
* @param {WPPriorityQueueContext} element Context object.
|
16856 |
+
* @param {WPPriorityQueueCallback} item Callback function.
|
16857 |
+
*/
|
16858 |
+
|
16859 |
+
|
16860 |
+
var add = function add(element, item) {
|
16861 |
+
if (!elementsMap.has(element)) {
|
16862 |
+
waitingList.push(element);
|
16863 |
+
}
|
16864 |
+
|
16865 |
+
elementsMap.set(element, item);
|
16866 |
+
|
16867 |
+
if (!isRunning) {
|
16868 |
+
isRunning = true;
|
16869 |
+
Object(__WEBPACK_IMPORTED_MODULE_0__request_idle_callback__["a" /* default */])(runWaitingList);
|
16870 |
+
}
|
16871 |
+
};
|
16872 |
+
/**
|
16873 |
+
* Flushes queue for a given context, returning true if the flush was
|
16874 |
+
* performed, or false if there is no queue for the given context.
|
16875 |
+
*
|
16876 |
+
* @type {WPPriorityQueueFlush}
|
16877 |
+
*
|
16878 |
+
* @param {WPPriorityQueueContext} element Context object.
|
16879 |
+
*
|
16880 |
+
* @return {boolean} Whether flush was performed.
|
16881 |
+
*/
|
16882 |
+
|
16883 |
+
|
16884 |
+
var flush = function flush(element) {
|
16885 |
+
if (!elementsMap.has(element)) {
|
16886 |
+
return false;
|
16887 |
+
}
|
16888 |
+
|
16889 |
+
var index = waitingList.indexOf(element);
|
16890 |
+
waitingList.splice(index, 1);
|
16891 |
+
var callback =
|
16892 |
+
/** @type {WPPriorityQueueCallback} */
|
16893 |
+
elementsMap.get(element);
|
16894 |
+
elementsMap.delete(element);
|
16895 |
+
callback();
|
16896 |
+
return true;
|
16897 |
+
};
|
16898 |
+
/**
|
16899 |
+
* Reset the queue without running the pending callbacks.
|
16900 |
+
*
|
16901 |
+
* @type {WPPriorityQueueReset}
|
16902 |
+
*/
|
16903 |
+
|
16904 |
+
|
16905 |
+
var reset = function reset() {
|
16906 |
+
waitingList = [];
|
16907 |
+
elementsMap = new WeakMap();
|
16908 |
+
isRunning = false;
|
16909 |
+
};
|
16910 |
+
|
16911 |
+
return {
|
16912 |
+
add: add,
|
16913 |
+
flush: flush,
|
16914 |
+
reset: reset
|
16915 |
+
};
|
16916 |
+
};
|
16917 |
+
//# sourceMappingURL=index.js.map
|
16918 |
|
16919 |
/***/ }),
|
16920 |
+
/* 103 */
|
16921 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
16922 |
+
|
16923 |
+
"use strict";
|
16924 |
+
/* unused harmony export useCallback */
|
16925 |
+
/* unused harmony export useCallbackOne */
|
16926 |
+
/* unused harmony export useMemo */
|
16927 |
+
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return useMemoOne; });
|
16928 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react__ = __webpack_require__(9);
|
16929 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react__);
|
16930 |
+
|
16931 |
+
|
16932 |
+
function areInputsEqual(newInputs, lastInputs) {
|
16933 |
+
if (newInputs.length !== lastInputs.length) {
|
16934 |
+
return false;
|
16935 |
+
}
|
16936 |
+
|
16937 |
+
for (var i = 0; i < newInputs.length; i++) {
|
16938 |
+
if (newInputs[i] !== lastInputs[i]) {
|
16939 |
+
return false;
|
16940 |
+
}
|
16941 |
+
}
|
16942 |
+
|
16943 |
+
return true;
|
16944 |
+
}
|
16945 |
+
|
16946 |
+
function useMemoOne(getResult, inputs) {
|
16947 |
+
var initial = Object(__WEBPACK_IMPORTED_MODULE_0_react__["useState"])(function () {
|
16948 |
+
return {
|
16949 |
+
inputs: inputs,
|
16950 |
+
result: getResult()
|
16951 |
+
};
|
16952 |
+
})[0];
|
16953 |
+
var committed = Object(__WEBPACK_IMPORTED_MODULE_0_react__["useRef"])(initial);
|
16954 |
+
var isInputMatch = Boolean(inputs && committed.current.inputs && areInputsEqual(inputs, committed.current.inputs));
|
16955 |
+
var cache = isInputMatch ? committed.current : {
|
16956 |
+
inputs: inputs,
|
16957 |
+
result: getResult()
|
16958 |
+
};
|
16959 |
+
Object(__WEBPACK_IMPORTED_MODULE_0_react__["useEffect"])(function () {
|
16960 |
+
committed.current = cache;
|
16961 |
+
}, [cache]);
|
16962 |
+
return cache.result;
|
16963 |
+
}
|
16964 |
+
function useCallbackOne(callback, inputs) {
|
16965 |
+
return useMemoOne(function () {
|
16966 |
+
return callback;
|
16967 |
+
}, inputs);
|
16968 |
+
}
|
16969 |
+
var useMemo = useMemoOne;
|
16970 |
+
var useCallback = useCallbackOne;
|
16971 |
+
|
16972 |
+
|
16973 |
+
|
16974 |
+
|
16975 |
+
/***/ }),
|
16976 |
+
/* 104 */
|
16977 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
16978 |
|
16979 |
"use strict";
|
16980 |
/* unused harmony export logged */
|
16981 |
/* harmony export (immutable) */ __webpack_exports__["a"] = deprecated;
|
16982 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_hooks__ = __webpack_require__(65);
|
16983 |
/**
|
16984 |
* WordPress dependencies
|
16985 |
*/
|
17057 |
//# sourceMappingURL=index.js.map
|
17058 |
|
17059 |
/***/ }),
|
17060 |
+
/* 105 */
|
17061 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17062 |
|
17063 |
"use strict";
|
17096 |
//# sourceMappingURL=validateHookName.js.map
|
17097 |
|
17098 |
/***/ }),
|
17099 |
+
/* 106 */
|
17100 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17101 |
|
17102 |
"use strict";
|
17103 |
/* unused harmony export concatChildren */
|
17104 |
/* unused harmony export switchChildrenNodeName */
|
17105 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
17106 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
17107 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_react__ = __webpack_require__(9);
|
17108 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_react__);
|
17109 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
17110 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
17365 |
//# sourceMappingURL=react.js.map
|
17366 |
|
17367 |
/***/ }),
|
17368 |
+
/* 107 */
|
17369 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17370 |
|
17371 |
"use strict";
|
17372 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__utils_create_higher_order_component__ = __webpack_require__(47);
|
17373 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_0__utils_create_higher_order_component__["a"]; });
|
17374 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__higher_order_compose__ = __webpack_require__(557);
|
17375 |
+
/* unused harmony reexport compose */
|
17376 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__higher_order_if_condition__ = __webpack_require__(558);
|
17377 |
+
/* unused harmony reexport ifCondition */
|
17378 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__higher_order_pure__ = __webpack_require__(559);
|
17379 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_3__higher_order_pure__["a"]; });
|
17380 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__higher_order_with_global_events__ = __webpack_require__(562);
|
17381 |
+
/* unused harmony reexport withGlobalEvents */
|
17382 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__higher_order_with_instance_id__ = __webpack_require__(564);
|
17383 |
+
/* unused harmony reexport withInstanceId */
|
17384 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__higher_order_with_safe_timeout__ = __webpack_require__(565);
|
17385 |
+
/* unused harmony reexport withSafeTimeout */
|
17386 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__higher_order_with_state__ = __webpack_require__(566);
|
17387 |
+
/* unused harmony reexport withState */
|
17388 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__hooks_use_copy_on_click__ = __webpack_require__(567);
|
17389 |
+
/* unused harmony reexport useCopyOnClick */
|
17390 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__hooks_use_dragging__ = __webpack_require__(568);
|
17391 |
+
/* unused harmony reexport __experimentalUseDragging */
|
17392 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__hooks_use_instance_id__ = __webpack_require__(168);
|
17393 |
+
/* unused harmony reexport useInstanceId */
|
17394 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__hooks_use_keyboard_shortcut__ = __webpack_require__(569);
|
17395 |
+
/* unused harmony reexport useKeyboardShortcut */
|
17396 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__hooks_use_media_query__ = __webpack_require__(108);
|
17397 |
+
/* unused harmony reexport useMediaQuery */
|
17398 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__hooks_use_previous__ = __webpack_require__(169);
|
17399 |
+
/* unused harmony reexport usePrevious */
|
17400 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__hooks_use_reduced_motion__ = __webpack_require__(570);
|
17401 |
+
/* unused harmony reexport useReducedMotion */
|
17402 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__hooks_use_viewport_match__ = __webpack_require__(571);
|
17403 |
+
/* unused harmony reexport useViewportMatch */
|
17404 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__hooks_use_resize_observer__ = __webpack_require__(572);
|
17405 |
+
/* unused harmony reexport useResizeObserver */
|
17406 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__hooks_use_async_list__ = __webpack_require__(573);
|
17407 |
+
/* unused harmony reexport useAsyncList */
|
17408 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__hooks_use_warn_on_change__ = __webpack_require__(574);
|
17409 |
+
/* unused harmony reexport useWarnOnChange */
|
17410 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__hooks_use_debounce__ = __webpack_require__(575);
|
17411 |
+
/* unused harmony reexport useDebounce */
|
17412 |
+
// Utils
|
17413 |
+
// Compose helper (aliased flowRight from Lodash)
|
17414 |
+
|
17415 |
+
// Higher-order components
|
17416 |
+
|
17417 |
+
|
17418 |
+
|
17419 |
+
|
17420 |
+
|
17421 |
+
|
17422 |
+
// Hooks
|
17423 |
+
|
17424 |
+
|
17425 |
+
|
17426 |
+
|
17427 |
+
|
17428 |
|
17429 |
|
|
|
|
|
|
|
|
|
|
|
17430 |
|
|
|
17431 |
|
|
|
|
|
|
|
17432 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
17433 |
|
|
|
|
|
17434 |
|
|
|
|
|
|
|
17435 |
|
17436 |
+
//# sourceMappingURL=index.js.map
|
17437 |
|
17438 |
/***/ }),
|
17439 |
+
/* 108 */
|
17440 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17441 |
|
17442 |
"use strict";
|
17443 |
/* harmony export (immutable) */ __webpack_exports__["a"] = useMediaQuery;
|
17444 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
17445 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(15);
|
17446 |
|
17447 |
|
17483 |
//# sourceMappingURL=index.js.map
|
17484 |
|
17485 |
/***/ }),
|
17486 |
+
/* 109 */
|
17487 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17488 |
|
17489 |
"use strict";
|
17490 |
/* harmony export (immutable) */ __webpack_exports__["a"] = isFormatEqual;
|
17491 |
+
/** @typedef {import('./create').RichTextFormat} RichTextFormat */
|
17492 |
+
|
17493 |
/**
|
17494 |
* Optimised equality check for format objects.
|
17495 |
*
|
17496 |
+
* @param {?RichTextFormat} format1 Format to compare.
|
17497 |
+
* @param {?RichTextFormat} format2 Format to compare.
|
17498 |
*
|
17499 |
* @return {boolean} True if formats are equal, false if not.
|
17500 |
*/
|
17547 |
//# sourceMappingURL=is-format-equal.js.map
|
17548 |
|
17549 |
/***/ }),
|
17550 |
+
/* 110 */
|
17551 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17552 |
|
17553 |
"use strict";
|
17581 |
//# sourceMappingURL=create-element.js.map
|
17582 |
|
17583 |
/***/ }),
|
17584 |
+
/* 111 */
|
17585 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17586 |
|
17587 |
"use strict";
|
17588 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getActiveFormat;
|
17589 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash__ = __webpack_require__(2);
|
17590 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_lodash__);
|
17591 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__get_active_formats__ = __webpack_require__(112);
|
17592 |
/**
|
17593 |
* External dependencies
|
17594 |
*/
|
17598 |
*/
|
17599 |
|
17600 |
|
17601 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
17602 |
+
|
17603 |
+
/** @typedef {import('./create').RichTextFormat} RichTextFormat */
|
17604 |
+
|
17605 |
/**
|
17606 |
* Gets the format object by type at the start of the selection. This can be
|
17607 |
* used to get e.g. the URL of a link format at the current selection, but also
|
17608 |
* to check if a format is active at the selection. Returns undefined if there
|
17609 |
* is no format at the selection.
|
17610 |
*
|
17611 |
+
* @param {RichTextValue} value Value to inspect.
|
17612 |
+
* @param {string} formatType Format type to look for.
|
17613 |
*
|
17614 |
+
* @return {RichTextFormat|undefined} Active format object of the specified
|
17615 |
+
* type, or undefined.
|
17616 |
*/
|
17617 |
|
17618 |
function getActiveFormat(value, formatType) {
|
17623 |
//# sourceMappingURL=get-active-format.js.map
|
17624 |
|
17625 |
/***/ }),
|
17626 |
+
/* 112 */
|
17627 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17628 |
|
17629 |
"use strict";
|
17630 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getActiveFormats;
|
17631 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
17632 |
+
|
17633 |
+
/** @typedef {import('./create').RichTextFormatList} RichTextFormatList */
|
17634 |
+
|
17635 |
/**
|
17636 |
* Gets the all format objects at the start of the selection.
|
17637 |
*
|
17638 |
+
* @param {RichTextValue} value Value to inspect.
|
17639 |
+
* @param {Array} EMPTY_ACTIVE_FORMATS Array to return if there are no
|
17640 |
+
* active formats.
|
17641 |
*
|
17642 |
+
* @return {RichTextFormatList} Active format objects.
|
17643 |
*/
|
17644 |
function getActiveFormats(_ref) {
|
17645 |
var formats = _ref.formats,
|
17675 |
//# sourceMappingURL=get-active-formats.js.map
|
17676 |
|
17677 |
/***/ }),
|
17678 |
+
/* 113 */
|
17679 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17680 |
|
17681 |
"use strict";
|
17682 |
/* harmony export (immutable) */ __webpack_exports__["a"] = isCollapsed;
|
17683 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
17684 |
+
|
17685 |
/**
|
17686 |
* Check if the selection of a Rich Text value is collapsed or not. Collapsed
|
17687 |
* means that no characters are selected, but there is a caret present. If there
|
17688 |
* is no selection, `undefined` will be returned. This is similar to
|
17689 |
* `window.getSelection().isCollapsed()`.
|
17690 |
*
|
17691 |
+
* @param {RichTextValue} value The rich text value to check.
|
17692 |
*
|
17693 |
* @return {boolean|undefined} True if the selection is collapsed, false if not,
|
17694 |
* undefined if there is no selection.
|
17706 |
//# sourceMappingURL=is-collapsed.js.map
|
17707 |
|
17708 |
/***/ }),
|
17709 |
+
/* 114 */
|
17710 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17711 |
|
17712 |
"use strict";
|
17713 |
/* harmony export (immutable) */ __webpack_exports__["a"] = removeFormat;
|
17714 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
17715 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
17716 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
17717 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__normalise_formats__ = __webpack_require__(52);
|
17718 |
|
17719 |
|
17720 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
17730 |
*/
|
17731 |
|
17732 |
|
17733 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
17734 |
+
|
17735 |
/**
|
17736 |
* Remove any format object from a Rich Text value by type from the given
|
17737 |
* `startIndex` to the given `endIndex`. Indices are retrieved from the
|
17738 |
* selection if none are provided.
|
17739 |
*
|
17740 |
+
* @param {RichTextValue} value Value to modify.
|
17741 |
+
* @param {string} formatType Format type to remove.
|
17742 |
+
* @param {number} [startIndex] Start index.
|
17743 |
+
* @param {number} [endIndex] End index.
|
17744 |
*
|
17745 |
+
* @return {RichTextValue} A new value with the format applied.
|
17746 |
*/
|
17747 |
|
17748 |
function removeFormat(value, formatType) {
|
17779 |
}
|
17780 |
}
|
17781 |
|
17782 |
+
return Object(__WEBPACK_IMPORTED_MODULE_2__normalise_formats__["a" /* normaliseFormats */])(_objectSpread(_objectSpread({}, value), {}, {
|
17783 |
formats: newFormats,
|
17784 |
activeFormats: Object(__WEBPACK_IMPORTED_MODULE_1_lodash__["reject"])(activeFormats, {
|
17785 |
type: formatType
|
17802 |
//# sourceMappingURL=remove-format.js.map
|
17803 |
|
17804 |
/***/ }),
|
17805 |
+
/* 115 */
|
17806 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17807 |
|
17808 |
"use strict";
|
17809 |
/* harmony export (immutable) */ __webpack_exports__["a"] = remove;
|
17810 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__insert__ = __webpack_require__(66);
|
17811 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__create__ = __webpack_require__(53);
|
17812 |
/**
|
17813 |
* Internal dependencies
|
17814 |
*/
|
17815 |
|
17816 |
|
17817 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
17818 |
+
|
17819 |
/**
|
17820 |
* Remove content from a Rich Text value between the given `startIndex` and
|
17821 |
* `endIndex`. Indices are retrieved from the selection if none are provided.
|
17822 |
*
|
17823 |
+
* @param {RichTextValue} value Value to modify.
|
17824 |
+
* @param {number} [startIndex] Start index.
|
17825 |
+
* @param {number} [endIndex] End index.
|
17826 |
*
|
17827 |
+
* @return {RichTextValue} A new value with the content removed.
|
17828 |
*/
|
17829 |
|
17830 |
function remove(value, startIndex, endIndex) {
|
17833 |
//# sourceMappingURL=remove.js.map
|
17834 |
|
17835 |
/***/ }),
|
17836 |
+
/* 116 */
|
17837 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17838 |
|
17839 |
"use strict";
|
17927 |
//# sourceMappingURL=index.js.map
|
17928 |
|
17929 |
/***/ }),
|
17930 |
+
/* 117 */
|
17931 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
17932 |
|
17933 |
"use strict";
|
17936 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
17937 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
17938 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
17939 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
17940 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_element__ = __webpack_require__(1);
|
17941 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_compose__ = __webpack_require__(18);
|
17942 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__wordpress_keycodes__ = __webpack_require__(32);
|
17943 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__wordpress_dom__ = __webpack_require__(54);
|
17944 |
|
17945 |
|
17946 |
|
18028 |
//# sourceMappingURL=index.js.map
|
18029 |
|
18030 |
/***/ }),
|
18031 |
+
/* 118 */
|
18032 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
18033 |
|
18034 |
"use strict";
|
18040 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_element__ = __webpack_require__(1);
|
18041 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_lodash__ = __webpack_require__(2);
|
18042 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6_lodash__);
|
18043 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__popover__ = __webpack_require__(84);
|
18044 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__shortcut__ = __webpack_require__(196);
|
18045 |
|
18046 |
|
18047 |
|
18199 |
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(20)))
|
18200 |
|
18201 |
/***/ }),
|
18202 |
+
/* 119 */
|
18203 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
18204 |
|
18205 |
"use strict";
|
18210 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
18211 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
18212 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
18213 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
18214 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__wordpress_element__ = __webpack_require__(1);
|
18215 |
|
18216 |
|
18271 |
//# sourceMappingURL=index.js.map
|
18272 |
|
18273 |
/***/ }),
|
18274 |
+
/* 120 */
|
18275 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
18276 |
|
18277 |
"use strict";
|
18278 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Consumer; });
|
18279 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
18280 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
18281 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
18282 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
18283 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
18284 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
18285 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
18286 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(1);
|
18287 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
18288 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
18424 |
//# sourceMappingURL=context.js.map
|
18425 |
|
18426 |
/***/ }),
|
18427 |
+
/* 121 */
|
18428 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
18429 |
|
18430 |
"use strict";
|
18434 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
18435 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
18436 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
18437 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
18438 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(1);
|
18439 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
18440 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
18441 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__wordpress_a11y__ = __webpack_require__(199);
|
18442 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__wordpress_compose__ = __webpack_require__(18);
|
18443 |
|
18444 |
|
18514 |
//# sourceMappingURL=index.js.map
|
18515 |
|
18516 |
/***/ }),
|
18517 |
+
/* 122 */
|
18518 |
+
/***/ (function(module, exports, __webpack_require__) {
|
18519 |
+
|
18520 |
+
"use strict";
|
18521 |
+
|
18522 |
+
|
18523 |
+
var bind = __webpack_require__(33);
|
18524 |
+
|
18525 |
+
var GetIntrinsic = __webpack_require__(19);
|
18526 |
+
|
18527 |
+
var $apply = GetIntrinsic('%Function.prototype.apply%');
|
18528 |
+
var $call = GetIntrinsic('%Function.prototype.call%');
|
18529 |
+
var $reflectApply = GetIntrinsic('%Reflect.apply%', true) || bind.call($call, $apply);
|
18530 |
+
|
18531 |
+
var $defineProperty = GetIntrinsic('%Object.defineProperty%', true);
|
18532 |
+
|
18533 |
+
if ($defineProperty) {
|
18534 |
+
try {
|
18535 |
+
$defineProperty({}, 'a', { value: 1 });
|
18536 |
+
} catch (e) {
|
18537 |
+
// IE 8 has a broken defineProperty
|
18538 |
+
$defineProperty = null;
|
18539 |
+
}
|
18540 |
+
}
|
18541 |
+
|
18542 |
+
module.exports = function callBind() {
|
18543 |
+
return $reflectApply(bind, $call, arguments);
|
18544 |
+
};
|
18545 |
+
|
18546 |
+
var applyBind = function applyBind() {
|
18547 |
+
return $reflectApply(bind, $apply, arguments);
|
18548 |
+
};
|
18549 |
+
|
18550 |
+
if ($defineProperty) {
|
18551 |
+
$defineProperty(module.exports, 'apply', { value: applyBind });
|
18552 |
+
} else {
|
18553 |
+
module.exports.apply = applyBind;
|
18554 |
+
}
|
18555 |
+
|
18556 |
+
|
18557 |
+
/***/ }),
|
18558 |
+
/* 123 */
|
18559 |
/***/ (function(module, exports, __webpack_require__) {
|
18560 |
|
18561 |
"use strict";
|
18565 |
|
18566 |
var $TypeError = GetIntrinsic('%TypeError%');
|
18567 |
|
18568 |
+
var inspect = __webpack_require__(641);
|
18569 |
|
18570 |
+
var IsPropertyKey = __webpack_require__(56);
|
18571 |
+
var Type = __webpack_require__(35);
|
18572 |
|
18573 |
/**
|
18574 |
* 7.3.1 Get (O, P) - https://ecma-international.org/ecma-262/6.0/#sec-get-o-p
|
18592 |
|
18593 |
|
18594 |
/***/ }),
|
18595 |
+
/* 124 */
|
18596 |
/***/ (function(module, exports, __webpack_require__) {
|
18597 |
|
18598 |
"use strict";
|
18603 |
var $Array = GetIntrinsic('%Array%');
|
18604 |
|
18605 |
// eslint-disable-next-line global-require
|
18606 |
+
var toStr = !$Array.isArray && __webpack_require__(69)('Object.prototype.toString');
|
18607 |
|
18608 |
// https://www.ecma-international.org/ecma-262/6.0/#sec-isarray
|
18609 |
|
18613 |
|
18614 |
|
18615 |
/***/ }),
|
18616 |
+
/* 125 */
|
18617 |
/***/ (function(module, exports, __webpack_require__) {
|
18618 |
|
18619 |
"use strict";
|
18620 |
|
18621 |
|
18622 |
+
var GetIntrinsic = __webpack_require__(19);
|
18623 |
+
|
18624 |
+
var $TypeError = GetIntrinsic('%TypeError%');
|
18625 |
+
var $SyntaxError = GetIntrinsic('%SyntaxError%');
|
18626 |
+
|
18627 |
+
var has = __webpack_require__(38);
|
18628 |
+
|
18629 |
+
var predicates = {
|
18630 |
+
// https://ecma-international.org/ecma-262/6.0/#sec-property-descriptor-specification-type
|
18631 |
+
'Property Descriptor': function isPropertyDescriptor(Type, Desc) {
|
18632 |
+
if (Type(Desc) !== 'Object') {
|
18633 |
+
return false;
|
18634 |
+
}
|
18635 |
+
var allowed = {
|
18636 |
+
'[[Configurable]]': true,
|
18637 |
+
'[[Enumerable]]': true,
|
18638 |
+
'[[Get]]': true,
|
18639 |
+
'[[Set]]': true,
|
18640 |
+
'[[Value]]': true,
|
18641 |
+
'[[Writable]]': true
|
18642 |
+
};
|
18643 |
+
|
18644 |
+
for (var key in Desc) { // eslint-disable-line
|
18645 |
+
if (has(Desc, key) && !allowed[key]) {
|
18646 |
+
return false;
|
18647 |
+
}
|
18648 |
+
}
|
18649 |
+
|
18650 |
+
var isData = has(Desc, '[[Value]]');
|
18651 |
+
var IsAccessor = has(Desc, '[[Get]]') || has(Desc, '[[Set]]');
|
18652 |
+
if (isData && IsAccessor) {
|
18653 |
+
throw new $TypeError('Property Descriptors may not be both accessor and data descriptors');
|
18654 |
+
}
|
18655 |
+
return true;
|
18656 |
+
}
|
18657 |
+
};
|
18658 |
+
|
18659 |
+
module.exports = function assertRecord(Type, recordType, argumentName, value) {
|
18660 |
+
var predicate = predicates[recordType];
|
18661 |
+
if (typeof predicate !== 'function') {
|
18662 |
+
throw new $SyntaxError('unknown record type: ' + recordType);
|
18663 |
+
}
|
18664 |
+
if (!predicate(Type, value)) {
|
18665 |
+
throw new $TypeError(argumentName + ' must be a ' + recordType);
|
18666 |
+
}
|
18667 |
};
|
18668 |
|
18669 |
|
18670 |
/***/ }),
|
18671 |
+
/* 126 */
|
18672 |
/***/ (function(module, exports, __webpack_require__) {
|
18673 |
|
18674 |
"use strict";
|
18675 |
|
18676 |
|
18677 |
+
module.exports = Number.isNaN || function isNaN(a) {
|
18678 |
+
return a !== a;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
18679 |
};
|
18680 |
|
18681 |
|
18682 |
/***/ }),
|
18683 |
+
/* 127 */
|
18684 |
/***/ (function(module, exports, __webpack_require__) {
|
18685 |
|
18686 |
"use strict";
|
18695 |
|
18696 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
18697 |
|
18698 |
+
var _object = __webpack_require__(25);
|
18699 |
|
18700 |
var _object2 = _interopRequireDefault(_object);
|
18701 |
|
18702 |
+
var _react = __webpack_require__(9);
|
18703 |
|
18704 |
var _react2 = _interopRequireDefault(_react);
|
18705 |
|
18707 |
|
18708 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
18709 |
|
18710 |
+
var _reactAddonsShallowCompare = __webpack_require__(57);
|
18711 |
|
18712 |
var _reactAddonsShallowCompare2 = _interopRequireDefault(_reactAddonsShallowCompare);
|
18713 |
|
18714 |
+
var _reactMomentProptypes = __webpack_require__(40);
|
18715 |
|
18716 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
18717 |
|
18718 |
+
var _airbnbPropTypes = __webpack_require__(22);
|
18719 |
|
18720 |
+
var _reactWithStyles = __webpack_require__(34);
|
18721 |
|
18722 |
var _moment = __webpack_require__(0);
|
18723 |
|
18724 |
var _moment2 = _interopRequireDefault(_moment);
|
18725 |
|
18726 |
+
var _defaultPhrases = __webpack_require__(29);
|
18727 |
|
18728 |
+
var _getPhrasePropTypes = __webpack_require__(31);
|
18729 |
|
18730 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
18731 |
|
18732 |
+
var _getCalendarDaySettings = __webpack_require__(390);
|
18733 |
|
18734 |
var _getCalendarDaySettings2 = _interopRequireDefault(_getCalendarDaySettings);
|
18735 |
|
18736 |
+
var _ModifiersShape = __webpack_require__(87);
|
18737 |
|
18738 |
var _ModifiersShape2 = _interopRequireDefault(_ModifiersShape);
|
18739 |
|
19162 |
})(CalendarDay);
|
19163 |
|
19164 |
/***/ }),
|
19165 |
+
/* 128 */
|
19166 |
+
/***/ (function(module, exports, __webpack_require__) {
|
19167 |
+
|
19168 |
+
"use strict";
|
19169 |
+
|
19170 |
+
|
19171 |
+
var bind = __webpack_require__(33);
|
19172 |
+
|
19173 |
+
var GetIntrinsic = __webpack_require__(359);
|
19174 |
+
|
19175 |
+
var $apply = GetIntrinsic('%Function.prototype.apply%');
|
19176 |
+
var $call = GetIntrinsic('%Function.prototype.call%');
|
19177 |
+
var $reflectApply = GetIntrinsic('%Reflect.apply%', true) || bind.call($call, $apply);
|
19178 |
+
|
19179 |
+
var $defineProperty = GetIntrinsic('%Object.defineProperty%', true);
|
19180 |
+
|
19181 |
+
if ($defineProperty) {
|
19182 |
+
try {
|
19183 |
+
$defineProperty({}, 'a', { value: 1 });
|
19184 |
+
} catch (e) {
|
19185 |
+
// IE 8 has a broken defineProperty
|
19186 |
+
$defineProperty = null;
|
19187 |
+
}
|
19188 |
+
}
|
19189 |
+
|
19190 |
+
module.exports = function callBind() {
|
19191 |
+
return $reflectApply(bind, $call, arguments);
|
19192 |
+
};
|
19193 |
+
|
19194 |
+
var applyBind = function applyBind() {
|
19195 |
+
return $reflectApply(bind, $apply, arguments);
|
19196 |
+
};
|
19197 |
+
|
19198 |
+
if ($defineProperty) {
|
19199 |
+
$defineProperty(module.exports, 'apply', { value: applyBind });
|
19200 |
+
} else {
|
19201 |
+
module.exports.apply = applyBind;
|
19202 |
+
}
|
19203 |
+
|
19204 |
+
|
19205 |
+
/***/ }),
|
19206 |
+
/* 129 */
|
19207 |
/***/ (function(module, exports, __webpack_require__) {
|
19208 |
|
19209 |
"use strict";
|
19214 |
});
|
19215 |
exports["default"] = betweenValidator;
|
19216 |
|
19217 |
+
var _object = _interopRequireDefault(__webpack_require__(694));
|
19218 |
|
19219 |
+
var _shape = _interopRequireDefault(__webpack_require__(131));
|
19220 |
|
19221 |
+
var _valuesOf = _interopRequireDefault(__webpack_require__(366));
|
19222 |
|
19223 |
var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
19224 |
|
19225 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
19226 |
|
19227 |
+
function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }
|
19228 |
|
19229 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
19230 |
|
19231 |
+
function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }
|
19232 |
|
19233 |
function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }
|
19234 |
|
19235 |
+
function _slicedToArray(arr, i) { return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _unsupportedIterableToArray(arr, i) || _nonIterableRest(); }
|
19236 |
+
|
19237 |
+
function _nonIterableRest() { throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); }
|
19238 |
|
19239 |
+
function _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === "string") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === "Object" && o.constructor) n = o.constructor.name; if (n === "Map" || n === "Set") return Array.from(o); if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }
|
19240 |
|
19241 |
+
function _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }
|
19242 |
+
|
19243 |
+
function _iterableToArrayLimit(arr, i) { if (typeof Symbol === "undefined" || !(Symbol.iterator in Object(arr))) return; var _arr = []; var _n = true; var _d = false; var _e = undefined; try { for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { _arr.push(_s.value); if (i && _arr.length === i) break; } } catch (err) { _d = true; _e = err; } finally { try { if (!_n && _i["return"] != null) _i["return"](); } finally { if (_d) throw _e; } } return _arr; }
|
19244 |
|
19245 |
function _arrayWithHoles(arr) { if (Array.isArray(arr)) return arr; }
|
19246 |
|
19342 |
var numberThunk = typeof value === 'number' ? function () {
|
19343 |
return value;
|
19344 |
} : value;
|
19345 |
+
return _objectSpread(_objectSpread({}, acc), {}, _defineProperty({}, key, numberThunk));
|
19346 |
}, {});
|
19347 |
}
|
19348 |
|
19353 |
thunk = _ref8[1];
|
19354 |
|
19355 |
var value = thunk(props);
|
19356 |
+
return _objectSpread(_objectSpread({}, acc), {}, _defineProperty({}, key, value));
|
19357 |
}, {});
|
19358 |
}
|
19359 |
|
19459 |
//# sourceMappingURL=between.js.map
|
19460 |
|
19461 |
/***/ }),
|
19462 |
+
/* 130 */
|
19463 |
+
/***/ (function(module, exports, __webpack_require__) {
|
19464 |
+
|
19465 |
+
"use strict";
|
19466 |
+
|
19467 |
+
|
19468 |
+
/* globals
|
19469 |
+
Atomics,
|
19470 |
+
SharedArrayBuffer,
|
19471 |
+
*/
|
19472 |
+
|
19473 |
+
var undefined;
|
19474 |
+
|
19475 |
+
var $TypeError = TypeError;
|
19476 |
+
|
19477 |
+
var $gOPD = Object.getOwnPropertyDescriptor;
|
19478 |
+
if ($gOPD) {
|
19479 |
+
try {
|
19480 |
+
$gOPD({}, '');
|
19481 |
+
} catch (e) {
|
19482 |
+
$gOPD = null; // this is IE 8, which has a broken gOPD
|
19483 |
+
}
|
19484 |
+
}
|
19485 |
+
|
19486 |
+
var throwTypeError = function () { throw new $TypeError(); };
|
19487 |
+
var ThrowTypeError = $gOPD
|
19488 |
+
? (function () {
|
19489 |
+
try {
|
19490 |
+
// eslint-disable-next-line no-unused-expressions, no-caller, no-restricted-properties
|
19491 |
+
arguments.callee; // IE 8 does not throw here
|
19492 |
+
return throwTypeError;
|
19493 |
+
} catch (calleeThrows) {
|
19494 |
+
try {
|
19495 |
+
// IE 8 throws on Object.getOwnPropertyDescriptor(arguments, '')
|
19496 |
+
return $gOPD(arguments, 'callee').get;
|
19497 |
+
} catch (gOPDthrows) {
|
19498 |
+
return throwTypeError;
|
19499 |
+
}
|
19500 |
+
}
|
19501 |
+
}())
|
19502 |
+
: throwTypeError;
|
19503 |
+
|
19504 |
+
var hasSymbols = __webpack_require__(43)();
|
19505 |
+
|
19506 |
+
var getProto = Object.getPrototypeOf || function (x) { return x.__proto__; }; // eslint-disable-line no-proto
|
19507 |
+
|
19508 |
+
var generator; // = function * () {};
|
19509 |
+
var generatorFunction = generator ? getProto(generator) : undefined;
|
19510 |
+
var asyncFn; // async function() {};
|
19511 |
+
var asyncFunction = asyncFn ? asyncFn.constructor : undefined;
|
19512 |
+
var asyncGen; // async function * () {};
|
19513 |
+
var asyncGenFunction = asyncGen ? getProto(asyncGen) : undefined;
|
19514 |
+
var asyncGenIterator = asyncGen ? asyncGen() : undefined;
|
19515 |
+
|
19516 |
+
var TypedArray = typeof Uint8Array === 'undefined' ? undefined : getProto(Uint8Array);
|
19517 |
+
|
19518 |
+
var INTRINSICS = {
|
19519 |
+
'%Array%': Array,
|
19520 |
+
'%ArrayBuffer%': typeof ArrayBuffer === 'undefined' ? undefined : ArrayBuffer,
|
19521 |
+
'%ArrayBufferPrototype%': typeof ArrayBuffer === 'undefined' ? undefined : ArrayBuffer.prototype,
|
19522 |
+
'%ArrayIteratorPrototype%': hasSymbols ? getProto([][Symbol.iterator]()) : undefined,
|
19523 |
+
'%ArrayPrototype%': Array.prototype,
|
19524 |
+
'%ArrayProto_entries%': Array.prototype.entries,
|
19525 |
+
'%ArrayProto_forEach%': Array.prototype.forEach,
|
19526 |
+
'%ArrayProto_keys%': Array.prototype.keys,
|
19527 |
+
'%ArrayProto_values%': Array.prototype.values,
|
19528 |
+
'%AsyncFromSyncIteratorPrototype%': undefined,
|
19529 |
+
'%AsyncFunction%': asyncFunction,
|
19530 |
+
'%AsyncFunctionPrototype%': asyncFunction ? asyncFunction.prototype : undefined,
|
19531 |
+
'%AsyncGenerator%': asyncGen ? getProto(asyncGenIterator) : undefined,
|
19532 |
+
'%AsyncGeneratorFunction%': asyncGenFunction,
|
19533 |
+
'%AsyncGeneratorPrototype%': asyncGenFunction ? asyncGenFunction.prototype : undefined,
|
19534 |
+
'%AsyncIteratorPrototype%': asyncGenIterator && hasSymbols && Symbol.asyncIterator ? asyncGenIterator[Symbol.asyncIterator]() : undefined,
|
19535 |
+
'%Atomics%': typeof Atomics === 'undefined' ? undefined : Atomics,
|
19536 |
+
'%Boolean%': Boolean,
|
19537 |
+
'%BooleanPrototype%': Boolean.prototype,
|
19538 |
+
'%DataView%': typeof DataView === 'undefined' ? undefined : DataView,
|
19539 |
+
'%DataViewPrototype%': typeof DataView === 'undefined' ? undefined : DataView.prototype,
|
19540 |
+
'%Date%': Date,
|
19541 |
+
'%DatePrototype%': Date.prototype,
|
19542 |
+
'%decodeURI%': decodeURI,
|
19543 |
+
'%decodeURIComponent%': decodeURIComponent,
|
19544 |
+
'%encodeURI%': encodeURI,
|
19545 |
+
'%encodeURIComponent%': encodeURIComponent,
|
19546 |
+
'%Error%': Error,
|
19547 |
+
'%ErrorPrototype%': Error.prototype,
|
19548 |
+
'%eval%': eval, // eslint-disable-line no-eval
|
19549 |
+
'%EvalError%': EvalError,
|
19550 |
+
'%EvalErrorPrototype%': EvalError.prototype,
|
19551 |
+
'%Float32Array%': typeof Float32Array === 'undefined' ? undefined : Float32Array,
|
19552 |
+
'%Float32ArrayPrototype%': typeof Float32Array === 'undefined' ? undefined : Float32Array.prototype,
|
19553 |
+
'%Float64Array%': typeof Float64Array === 'undefined' ? undefined : Float64Array,
|
19554 |
+
'%Float64ArrayPrototype%': typeof Float64Array === 'undefined' ? undefined : Float64Array.prototype,
|
19555 |
+
'%Function%': Function,
|
19556 |
+
'%FunctionPrototype%': Function.prototype,
|
19557 |
+
'%Generator%': generator ? getProto(generator()) : undefined,
|
19558 |
+
'%GeneratorFunction%': generatorFunction,
|
19559 |
+
'%GeneratorPrototype%': generatorFunction ? generatorFunction.prototype : undefined,
|
19560 |
+
'%Int8Array%': typeof Int8Array === 'undefined' ? undefined : Int8Array,
|
19561 |
+
'%Int8ArrayPrototype%': typeof Int8Array === 'undefined' ? undefined : Int8Array.prototype,
|
19562 |
+
'%Int16Array%': typeof Int16Array === 'undefined' ? undefined : Int16Array,
|
19563 |
+
'%Int16ArrayPrototype%': typeof Int16Array === 'undefined' ? undefined : Int8Array.prototype,
|
19564 |
+
'%Int32Array%': typeof Int32Array === 'undefined' ? undefined : Int32Array,
|
19565 |
+
'%Int32ArrayPrototype%': typeof Int32Array === 'undefined' ? undefined : Int32Array.prototype,
|
19566 |
+
'%isFinite%': isFinite,
|
19567 |
+
'%isNaN%': isNaN,
|
19568 |
+
'%IteratorPrototype%': hasSymbols ? getProto(getProto([][Symbol.iterator]())) : undefined,
|
19569 |
+
'%JSON%': typeof JSON === 'object' ? JSON : undefined,
|
19570 |
+
'%JSONParse%': typeof JSON === 'object' ? JSON.parse : undefined,
|
19571 |
+
'%Map%': typeof Map === 'undefined' ? undefined : Map,
|
19572 |
+
'%MapIteratorPrototype%': typeof Map === 'undefined' || !hasSymbols ? undefined : getProto(new Map()[Symbol.iterator]()),
|
19573 |
+
'%MapPrototype%': typeof Map === 'undefined' ? undefined : Map.prototype,
|
19574 |
+
'%Math%': Math,
|
19575 |
+
'%Number%': Number,
|
19576 |
+
'%NumberPrototype%': Number.prototype,
|
19577 |
+
'%Object%': Object,
|
19578 |
+
'%ObjectPrototype%': Object.prototype,
|
19579 |
+
'%ObjProto_toString%': Object.prototype.toString,
|
19580 |
+
'%ObjProto_valueOf%': Object.prototype.valueOf,
|
19581 |
+
'%parseFloat%': parseFloat,
|
19582 |
+
'%parseInt%': parseInt,
|
19583 |
+
'%Promise%': typeof Promise === 'undefined' ? undefined : Promise,
|
19584 |
+
'%PromisePrototype%': typeof Promise === 'undefined' ? undefined : Promise.prototype,
|
19585 |
+
'%PromiseProto_then%': typeof Promise === 'undefined' ? undefined : Promise.prototype.then,
|
19586 |
+
'%Promise_all%': typeof Promise === 'undefined' ? undefined : Promise.all,
|
19587 |
+
'%Promise_reject%': typeof Promise === 'undefined' ? undefined : Promise.reject,
|
19588 |
+
'%Promise_resolve%': typeof Promise === 'undefined' ? undefined : Promise.resolve,
|
19589 |
+
'%Proxy%': typeof Proxy === 'undefined' ? undefined : Proxy,
|
19590 |
+
'%RangeError%': RangeError,
|
19591 |
+
'%RangeErrorPrototype%': RangeError.prototype,
|
19592 |
+
'%ReferenceError%': ReferenceError,
|
19593 |
+
'%ReferenceErrorPrototype%': ReferenceError.prototype,
|
19594 |
+
'%Reflect%': typeof Reflect === 'undefined' ? undefined : Reflect,
|
19595 |
+
'%RegExp%': RegExp,
|
19596 |
+
'%RegExpPrototype%': RegExp.prototype,
|
19597 |
+
'%Set%': typeof Set === 'undefined' ? undefined : Set,
|
19598 |
+
'%SetIteratorPrototype%': typeof Set === 'undefined' || !hasSymbols ? undefined : getProto(new Set()[Symbol.iterator]()),
|
19599 |
+
'%SetPrototype%': typeof Set === 'undefined' ? undefined : Set.prototype,
|
19600 |
+
'%SharedArrayBuffer%': typeof SharedArrayBuffer === 'undefined' ? undefined : SharedArrayBuffer,
|
19601 |
+
'%SharedArrayBufferPrototype%': typeof SharedArrayBuffer === 'undefined' ? undefined : SharedArrayBuffer.prototype,
|
19602 |
+
'%String%': String,
|
19603 |
+
'%StringIteratorPrototype%': hasSymbols ? getProto(''[Symbol.iterator]()) : undefined,
|
19604 |
+
'%StringPrototype%': String.prototype,
|
19605 |
+
'%Symbol%': hasSymbols ? Symbol : undefined,
|
19606 |
+
'%SymbolPrototype%': hasSymbols ? Symbol.prototype : undefined,
|
19607 |
+
'%SyntaxError%': SyntaxError,
|
19608 |
+
'%SyntaxErrorPrototype%': SyntaxError.prototype,
|
19609 |
+
'%ThrowTypeError%': ThrowTypeError,
|
19610 |
+
'%TypedArray%': TypedArray,
|
19611 |
+
'%TypedArrayPrototype%': TypedArray ? TypedArray.prototype : undefined,
|
19612 |
+
'%TypeError%': $TypeError,
|
19613 |
+
'%TypeErrorPrototype%': $TypeError.prototype,
|
19614 |
+
'%Uint8Array%': typeof Uint8Array === 'undefined' ? undefined : Uint8Array,
|
19615 |
+
'%Uint8ArrayPrototype%': typeof Uint8Array === 'undefined' ? undefined : Uint8Array.prototype,
|
19616 |
+
'%Uint8ClampedArray%': typeof Uint8ClampedArray === 'undefined' ? undefined : Uint8ClampedArray,
|
19617 |
+
'%Uint8ClampedArrayPrototype%': typeof Uint8ClampedArray === 'undefined' ? undefined : Uint8ClampedArray.prototype,
|
19618 |
+
'%Uint16Array%': typeof Uint16Array === 'undefined' ? undefined : Uint16Array,
|
19619 |
+
'%Uint16ArrayPrototype%': typeof Uint16Array === 'undefined' ? undefined : Uint16Array.prototype,
|
19620 |
+
'%Uint32Array%': typeof Uint32Array === 'undefined' ? undefined : Uint32Array,
|
19621 |
+
'%Uint32ArrayPrototype%': typeof Uint32Array === 'undefined' ? undefined : Uint32Array.prototype,
|
19622 |
+
'%URIError%': URIError,
|
19623 |
+
'%URIErrorPrototype%': URIError.prototype,
|
19624 |
+
'%WeakMap%': typeof WeakMap === 'undefined' ? undefined : WeakMap,
|
19625 |
+
'%WeakMapPrototype%': typeof WeakMap === 'undefined' ? undefined : WeakMap.prototype,
|
19626 |
+
'%WeakSet%': typeof WeakSet === 'undefined' ? undefined : WeakSet,
|
19627 |
+
'%WeakSetPrototype%': typeof WeakSet === 'undefined' ? undefined : WeakSet.prototype
|
19628 |
+
};
|
19629 |
+
|
19630 |
+
var bind = __webpack_require__(33);
|
19631 |
+
var $replace = bind.call(Function.call, String.prototype.replace);
|
19632 |
+
|
19633 |
+
/* adapted from https://github.com/lodash/lodash/blob/4.17.15/dist/lodash.js#L6735-L6744 */
|
19634 |
+
var rePropName = /[^%.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|%$))/g;
|
19635 |
+
var reEscapeChar = /\\(\\)?/g; /** Used to match backslashes in property paths. */
|
19636 |
+
var stringToPath = function stringToPath(string) {
|
19637 |
+
var result = [];
|
19638 |
+
$replace(string, rePropName, function (match, number, quote, subString) {
|
19639 |
+
result[result.length] = quote ? $replace(subString, reEscapeChar, '$1') : (number || match);
|
19640 |
+
});
|
19641 |
+
return result;
|
19642 |
+
};
|
19643 |
+
/* end adaptation */
|
19644 |
+
|
19645 |
+
var getBaseIntrinsic = function getBaseIntrinsic(name, allowMissing) {
|
19646 |
+
if (!(name in INTRINSICS)) {
|
19647 |
+
throw new SyntaxError('intrinsic ' + name + ' does not exist!');
|
19648 |
+
}
|
19649 |
+
|
19650 |
+
// istanbul ignore if // hopefully this is impossible to test :-)
|
19651 |
+
if (typeof INTRINSICS[name] === 'undefined' && !allowMissing) {
|
19652 |
+
throw new $TypeError('intrinsic ' + name + ' exists, but is not available. Please file an issue!');
|
19653 |
+
}
|
19654 |
+
|
19655 |
+
return INTRINSICS[name];
|
19656 |
+
};
|
19657 |
+
|
19658 |
+
module.exports = function GetIntrinsic(name, allowMissing) {
|
19659 |
+
if (typeof name !== 'string' || name.length === 0) {
|
19660 |
+
throw new TypeError('intrinsic name must be a non-empty string');
|
19661 |
+
}
|
19662 |
+
if (arguments.length > 1 && typeof allowMissing !== 'boolean') {
|
19663 |
+
throw new TypeError('"allowMissing" argument must be a boolean');
|
19664 |
+
}
|
19665 |
+
|
19666 |
+
var parts = stringToPath(name);
|
19667 |
+
|
19668 |
+
var value = getBaseIntrinsic('%' + (parts.length > 0 ? parts[0] : '') + '%', allowMissing);
|
19669 |
+
for (var i = 1; i < parts.length; i += 1) {
|
19670 |
+
if (value != null) {
|
19671 |
+
if ($gOPD && (i + 1) >= parts.length) {
|
19672 |
+
var desc = $gOPD(value, parts[i]);
|
19673 |
+
if (!allowMissing && !(parts[i] in value)) {
|
19674 |
+
throw new $TypeError('base intrinsic for ' + name + ' exists, but the property is not available.');
|
19675 |
+
}
|
19676 |
+
// By convention, when a data property is converted to an accessor
|
19677 |
+
// property to emulate a data property that does not suffer from
|
19678 |
+
// the override mistake, that accessor's getter is marked with
|
19679 |
+
// an `originalValue` property. Here, when we detect this, we
|
19680 |
+
// uphold the illusion by pretending to see that original data
|
19681 |
+
// property, i.e., returning the value rather than the getter
|
19682 |
+
// itself.
|
19683 |
+
value = desc && 'get' in desc && !('originalValue' in desc.get) ? desc.get : value[parts[i]];
|
19684 |
+
} else {
|
19685 |
+
value = value[parts[i]];
|
19686 |
+
}
|
19687 |
+
}
|
19688 |
+
}
|
19689 |
+
return value;
|
19690 |
+
};
|
19691 |
+
|
19692 |
+
|
19693 |
+
/***/ }),
|
19694 |
+
/* 131 */
|
19695 |
/***/ (function(module, exports, __webpack_require__) {
|
19696 |
|
19697 |
"use strict";
|
19702 |
});
|
19703 |
exports["default"] = shapeValidator;
|
19704 |
|
19705 |
+
var _isPlainObject = _interopRequireDefault(__webpack_require__(132));
|
19706 |
|
19707 |
var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
19708 |
|
19760 |
//# sourceMappingURL=shape.js.map
|
19761 |
|
19762 |
/***/ }),
|
19763 |
+
/* 132 */
|
19764 |
/***/ (function(module, exports, __webpack_require__) {
|
19765 |
|
19766 |
"use strict";
|
19771 |
});
|
19772 |
exports["default"] = void 0;
|
19773 |
|
19774 |
+
var _isPlainObject = _interopRequireDefault(__webpack_require__(362));
|
19775 |
|
19776 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
19777 |
|
19780 |
//# sourceMappingURL=isPlainObject.js.map
|
19781 |
|
19782 |
/***/ }),
|
19783 |
+
/* 133 */
|
19784 |
/***/ (function(module, exports, __webpack_require__) {
|
19785 |
|
19786 |
"use strict";
|
19791 |
});
|
19792 |
exports["default"] = renderableChildren;
|
19793 |
|
19794 |
+
var _react = _interopRequireDefault(__webpack_require__(9));
|
19795 |
|
19796 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
19797 |
|
19803 |
//# sourceMappingURL=renderableChildren.js.map
|
19804 |
|
19805 |
/***/ }),
|
19806 |
+
/* 134 */
|
19807 |
/***/ (function(module, exports, __webpack_require__) {
|
19808 |
|
19809 |
"use strict";
|
19814 |
});
|
19815 |
exports["default"] = getComponentName;
|
19816 |
|
19817 |
+
var _functionPrototype = _interopRequireDefault(__webpack_require__(720));
|
19818 |
|
19819 |
+
var _reactIs = __webpack_require__(70);
|
19820 |
|
19821 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
19822 |
|
19845 |
//# sourceMappingURL=getComponentName.js.map
|
19846 |
|
19847 |
/***/ }),
|
19848 |
+
/* 135 */
|
19849 |
/***/ (function(module, exports, __webpack_require__) {
|
19850 |
|
19851 |
"use strict";
|
19856 |
});
|
19857 |
exports["default"] = void 0;
|
19858 |
|
19859 |
+
var _isInteger = _interopRequireDefault(__webpack_require__(380));
|
19860 |
|
19861 |
var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
19862 |
|
19896 |
//# sourceMappingURL=integer.js.map
|
19897 |
|
19898 |
/***/ }),
|
19899 |
+
/* 136 */
|
19900 |
/***/ (function(module, exports, __webpack_require__) {
|
19901 |
|
19902 |
"use strict";
|
19907 |
});
|
19908 |
exports["default"] = withShape;
|
19909 |
|
19910 |
+
var _and = _interopRequireDefault(__webpack_require__(49));
|
19911 |
|
19912 |
+
var _shape = _interopRequireDefault(__webpack_require__(131));
|
19913 |
|
19914 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
19915 |
|
19924 |
//# sourceMappingURL=withShape.js.map
|
19925 |
|
19926 |
/***/ }),
|
19927 |
+
/* 137 */
|
19928 |
/***/ (function(module, exports, __webpack_require__) {
|
19929 |
|
19930 |
// eslint-disable-next-line import/no-unresolved
|
19931 |
+
module.exports = __webpack_require__(759);
|
19932 |
|
19933 |
|
19934 |
/***/ }),
|
19935 |
+
/* 138 */
|
19936 |
/***/ (function(module, exports, __webpack_require__) {
|
19937 |
|
19938 |
"use strict";
|
19939 |
|
19940 |
|
19941 |
+
var define = __webpack_require__(28);
|
19942 |
|
19943 |
+
var implementation = __webpack_require__(398);
|
19944 |
+
var getPolyfill = __webpack_require__(399);
|
19945 |
+
var shim = __webpack_require__(764);
|
19946 |
|
19947 |
var polyfill = getPolyfill();
|
19948 |
|
19956 |
|
19957 |
|
19958 |
/***/ }),
|
19959 |
+
/* 139 */
|
19960 |
+
/***/ (function(module, exports, __webpack_require__) {
|
19961 |
+
|
19962 |
+
"use strict";
|
19963 |
+
|
19964 |
+
|
19965 |
+
/* globals
|
19966 |
+
Atomics,
|
19967 |
+
SharedArrayBuffer,
|
19968 |
+
*/
|
19969 |
+
|
19970 |
+
var undefined;
|
19971 |
+
|
19972 |
+
var $TypeError = TypeError;
|
19973 |
+
|
19974 |
+
var $gOPD = Object.getOwnPropertyDescriptor;
|
19975 |
+
if ($gOPD) {
|
19976 |
+
try {
|
19977 |
+
$gOPD({}, '');
|
19978 |
+
} catch (e) {
|
19979 |
+
$gOPD = null; // this is IE 8, which has a broken gOPD
|
19980 |
+
}
|
19981 |
+
}
|
19982 |
+
|
19983 |
+
var throwTypeError = function () { throw new $TypeError(); };
|
19984 |
+
var ThrowTypeError = $gOPD
|
19985 |
+
? (function () {
|
19986 |
+
try {
|
19987 |
+
// eslint-disable-next-line no-unused-expressions, no-caller, no-restricted-properties
|
19988 |
+
arguments.callee; // IE 8 does not throw here
|
19989 |
+
return throwTypeError;
|
19990 |
+
} catch (calleeThrows) {
|
19991 |
+
try {
|
19992 |
+
// IE 8 throws on Object.getOwnPropertyDescriptor(arguments, '')
|
19993 |
+
return $gOPD(arguments, 'callee').get;
|
19994 |
+
} catch (gOPDthrows) {
|
19995 |
+
return throwTypeError;
|
19996 |
+
}
|
19997 |
+
}
|
19998 |
+
}())
|
19999 |
+
: throwTypeError;
|
20000 |
+
|
20001 |
+
var hasSymbols = __webpack_require__(43)();
|
20002 |
+
|
20003 |
+
var getProto = Object.getPrototypeOf || function (x) { return x.__proto__; }; // eslint-disable-line no-proto
|
20004 |
+
|
20005 |
+
var generator; // = function * () {};
|
20006 |
+
var generatorFunction = generator ? getProto(generator) : undefined;
|
20007 |
+
var asyncFn; // async function() {};
|
20008 |
+
var asyncFunction = asyncFn ? asyncFn.constructor : undefined;
|
20009 |
+
var asyncGen; // async function * () {};
|
20010 |
+
var asyncGenFunction = asyncGen ? getProto(asyncGen) : undefined;
|
20011 |
+
var asyncGenIterator = asyncGen ? asyncGen() : undefined;
|
20012 |
+
|
20013 |
+
var TypedArray = typeof Uint8Array === 'undefined' ? undefined : getProto(Uint8Array);
|
20014 |
+
|
20015 |
+
var INTRINSICS = {
|
20016 |
+
'%Array%': Array,
|
20017 |
+
'%ArrayBuffer%': typeof ArrayBuffer === 'undefined' ? undefined : ArrayBuffer,
|
20018 |
+
'%ArrayBufferPrototype%': typeof ArrayBuffer === 'undefined' ? undefined : ArrayBuffer.prototype,
|
20019 |
+
'%ArrayIteratorPrototype%': hasSymbols ? getProto([][Symbol.iterator]()) : undefined,
|
20020 |
+
'%ArrayPrototype%': Array.prototype,
|
20021 |
+
'%ArrayProto_entries%': Array.prototype.entries,
|
20022 |
+
'%ArrayProto_forEach%': Array.prototype.forEach,
|
20023 |
+
'%ArrayProto_keys%': Array.prototype.keys,
|
20024 |
+
'%ArrayProto_values%': Array.prototype.values,
|
20025 |
+
'%AsyncFromSyncIteratorPrototype%': undefined,
|
20026 |
+
'%AsyncFunction%': asyncFunction,
|
20027 |
+
'%AsyncFunctionPrototype%': asyncFunction ? asyncFunction.prototype : undefined,
|
20028 |
+
'%AsyncGenerator%': asyncGen ? getProto(asyncGenIterator) : undefined,
|
20029 |
+
'%AsyncGeneratorFunction%': asyncGenFunction,
|
20030 |
+
'%AsyncGeneratorPrototype%': asyncGenFunction ? asyncGenFunction.prototype : undefined,
|
20031 |
+
'%AsyncIteratorPrototype%': asyncGenIterator && hasSymbols && Symbol.asyncIterator ? asyncGenIterator[Symbol.asyncIterator]() : undefined,
|
20032 |
+
'%Atomics%': typeof Atomics === 'undefined' ? undefined : Atomics,
|
20033 |
+
'%Boolean%': Boolean,
|
20034 |
+
'%BooleanPrototype%': Boolean.prototype,
|
20035 |
+
'%DataView%': typeof DataView === 'undefined' ? undefined : DataView,
|
20036 |
+
'%DataViewPrototype%': typeof DataView === 'undefined' ? undefined : DataView.prototype,
|
20037 |
+
'%Date%': Date,
|
20038 |
+
'%DatePrototype%': Date.prototype,
|
20039 |
+
'%decodeURI%': decodeURI,
|
20040 |
+
'%decodeURIComponent%': decodeURIComponent,
|
20041 |
+
'%encodeURI%': encodeURI,
|
20042 |
+
'%encodeURIComponent%': encodeURIComponent,
|
20043 |
+
'%Error%': Error,
|
20044 |
+
'%ErrorPrototype%': Error.prototype,
|
20045 |
+
'%eval%': eval, // eslint-disable-line no-eval
|
20046 |
+
'%EvalError%': EvalError,
|
20047 |
+
'%EvalErrorPrototype%': EvalError.prototype,
|
20048 |
+
'%Float32Array%': typeof Float32Array === 'undefined' ? undefined : Float32Array,
|
20049 |
+
'%Float32ArrayPrototype%': typeof Float32Array === 'undefined' ? undefined : Float32Array.prototype,
|
20050 |
+
'%Float64Array%': typeof Float64Array === 'undefined' ? undefined : Float64Array,
|
20051 |
+
'%Float64ArrayPrototype%': typeof Float64Array === 'undefined' ? undefined : Float64Array.prototype,
|
20052 |
+
'%Function%': Function,
|
20053 |
+
'%FunctionPrototype%': Function.prototype,
|
20054 |
+
'%Generator%': generator ? getProto(generator()) : undefined,
|
20055 |
+
'%GeneratorFunction%': generatorFunction,
|
20056 |
+
'%GeneratorPrototype%': generatorFunction ? generatorFunction.prototype : undefined,
|
20057 |
+
'%Int8Array%': typeof Int8Array === 'undefined' ? undefined : Int8Array,
|
20058 |
+
'%Int8ArrayPrototype%': typeof Int8Array === 'undefined' ? undefined : Int8Array.prototype,
|
20059 |
+
'%Int16Array%': typeof Int16Array === 'undefined' ? undefined : Int16Array,
|
20060 |
+
'%Int16ArrayPrototype%': typeof Int16Array === 'undefined' ? undefined : Int8Array.prototype,
|
20061 |
+
'%Int32Array%': typeof Int32Array === 'undefined' ? undefined : Int32Array,
|
20062 |
+
'%Int32ArrayPrototype%': typeof Int32Array === 'undefined' ? undefined : Int32Array.prototype,
|
20063 |
+
'%isFinite%': isFinite,
|
20064 |
+
'%isNaN%': isNaN,
|
20065 |
+
'%IteratorPrototype%': hasSymbols ? getProto(getProto([][Symbol.iterator]())) : undefined,
|
20066 |
+
'%JSON%': typeof JSON === 'object' ? JSON : undefined,
|
20067 |
+
'%JSONParse%': typeof JSON === 'object' ? JSON.parse : undefined,
|
20068 |
+
'%Map%': typeof Map === 'undefined' ? undefined : Map,
|
20069 |
+
'%MapIteratorPrototype%': typeof Map === 'undefined' || !hasSymbols ? undefined : getProto(new Map()[Symbol.iterator]()),
|
20070 |
+
'%MapPrototype%': typeof Map === 'undefined' ? undefined : Map.prototype,
|
20071 |
+
'%Math%': Math,
|
20072 |
+
'%Number%': Number,
|
20073 |
+
'%NumberPrototype%': Number.prototype,
|
20074 |
+
'%Object%': Object,
|
20075 |
+
'%ObjectPrototype%': Object.prototype,
|
20076 |
+
'%ObjProto_toString%': Object.prototype.toString,
|
20077 |
+
'%ObjProto_valueOf%': Object.prototype.valueOf,
|
20078 |
+
'%parseFloat%': parseFloat,
|
20079 |
+
'%parseInt%': parseInt,
|
20080 |
+
'%Promise%': typeof Promise === 'undefined' ? undefined : Promise,
|
20081 |
+
'%PromisePrototype%': typeof Promise === 'undefined' ? undefined : Promise.prototype,
|
20082 |
+
'%PromiseProto_then%': typeof Promise === 'undefined' ? undefined : Promise.prototype.then,
|
20083 |
+
'%Promise_all%': typeof Promise === 'undefined' ? undefined : Promise.all,
|
20084 |
+
'%Promise_reject%': typeof Promise === 'undefined' ? undefined : Promise.reject,
|
20085 |
+
'%Promise_resolve%': typeof Promise === 'undefined' ? undefined : Promise.resolve,
|
20086 |
+
'%Proxy%': typeof Proxy === 'undefined' ? undefined : Proxy,
|
20087 |
+
'%RangeError%': RangeError,
|
20088 |
+
'%RangeErrorPrototype%': RangeError.prototype,
|
20089 |
+
'%ReferenceError%': ReferenceError,
|
20090 |
+
'%ReferenceErrorPrototype%': ReferenceError.prototype,
|
20091 |
+
'%Reflect%': typeof Reflect === 'undefined' ? undefined : Reflect,
|
20092 |
+
'%RegExp%': RegExp,
|
20093 |
+
'%RegExpPrototype%': RegExp.prototype,
|
20094 |
+
'%Set%': typeof Set === 'undefined' ? undefined : Set,
|
20095 |
+
'%SetIteratorPrototype%': typeof Set === 'undefined' || !hasSymbols ? undefined : getProto(new Set()[Symbol.iterator]()),
|
20096 |
+
'%SetPrototype%': typeof Set === 'undefined' ? undefined : Set.prototype,
|
20097 |
+
'%SharedArrayBuffer%': typeof SharedArrayBuffer === 'undefined' ? undefined : SharedArrayBuffer,
|
20098 |
+
'%SharedArrayBufferPrototype%': typeof SharedArrayBuffer === 'undefined' ? undefined : SharedArrayBuffer.prototype,
|
20099 |
+
'%String%': String,
|
20100 |
+
'%StringIteratorPrototype%': hasSymbols ? getProto(''[Symbol.iterator]()) : undefined,
|
20101 |
+
'%StringPrototype%': String.prototype,
|
20102 |
+
'%Symbol%': hasSymbols ? Symbol : undefined,
|
20103 |
+
'%SymbolPrototype%': hasSymbols ? Symbol.prototype : undefined,
|
20104 |
+
'%SyntaxError%': SyntaxError,
|
20105 |
+
'%SyntaxErrorPrototype%': SyntaxError.prototype,
|
20106 |
+
'%ThrowTypeError%': ThrowTypeError,
|
20107 |
+
'%TypedArray%': TypedArray,
|
20108 |
+
'%TypedArrayPrototype%': TypedArray ? TypedArray.prototype : undefined,
|
20109 |
+
'%TypeError%': $TypeError,
|
20110 |
+
'%TypeErrorPrototype%': $TypeError.prototype,
|
20111 |
+
'%Uint8Array%': typeof Uint8Array === 'undefined' ? undefined : Uint8Array,
|
20112 |
+
'%Uint8ArrayPrototype%': typeof Uint8Array === 'undefined' ? undefined : Uint8Array.prototype,
|
20113 |
+
'%Uint8ClampedArray%': typeof Uint8ClampedArray === 'undefined' ? undefined : Uint8ClampedArray,
|
20114 |
+
'%Uint8ClampedArrayPrototype%': typeof Uint8ClampedArray === 'undefined' ? undefined : Uint8ClampedArray.prototype,
|
20115 |
+
'%Uint16Array%': typeof Uint16Array === 'undefined' ? undefined : Uint16Array,
|
20116 |
+
'%Uint16ArrayPrototype%': typeof Uint16Array === 'undefined' ? undefined : Uint16Array.prototype,
|
20117 |
+
'%Uint32Array%': typeof Uint32Array === 'undefined' ? undefined : Uint32Array,
|
20118 |
+
'%Uint32ArrayPrototype%': typeof Uint32Array === 'undefined' ? undefined : Uint32Array.prototype,
|
20119 |
+
'%URIError%': URIError,
|
20120 |
+
'%URIErrorPrototype%': URIError.prototype,
|
20121 |
+
'%WeakMap%': typeof WeakMap === 'undefined' ? undefined : WeakMap,
|
20122 |
+
'%WeakMapPrototype%': typeof WeakMap === 'undefined' ? undefined : WeakMap.prototype,
|
20123 |
+
'%WeakSet%': typeof WeakSet === 'undefined' ? undefined : WeakSet,
|
20124 |
+
'%WeakSetPrototype%': typeof WeakSet === 'undefined' ? undefined : WeakSet.prototype
|
20125 |
+
};
|
20126 |
+
|
20127 |
+
var bind = __webpack_require__(33);
|
20128 |
+
var $replace = bind.call(Function.call, String.prototype.replace);
|
20129 |
+
|
20130 |
+
/* adapted from https://github.com/lodash/lodash/blob/4.17.15/dist/lodash.js#L6735-L6744 */
|
20131 |
+
var rePropName = /[^%.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|%$))/g;
|
20132 |
+
var reEscapeChar = /\\(\\)?/g; /** Used to match backslashes in property paths. */
|
20133 |
+
var stringToPath = function stringToPath(string) {
|
20134 |
+
var result = [];
|
20135 |
+
$replace(string, rePropName, function (match, number, quote, subString) {
|
20136 |
+
result[result.length] = quote ? $replace(subString, reEscapeChar, '$1') : (number || match);
|
20137 |
+
});
|
20138 |
+
return result;
|
20139 |
+
};
|
20140 |
+
/* end adaptation */
|
20141 |
+
|
20142 |
+
var getBaseIntrinsic = function getBaseIntrinsic(name, allowMissing) {
|
20143 |
+
if (!(name in INTRINSICS)) {
|
20144 |
+
throw new SyntaxError('intrinsic ' + name + ' does not exist!');
|
20145 |
+
}
|
20146 |
+
|
20147 |
+
// istanbul ignore if // hopefully this is impossible to test :-)
|
20148 |
+
if (typeof INTRINSICS[name] === 'undefined' && !allowMissing) {
|
20149 |
+
throw new $TypeError('intrinsic ' + name + ' exists, but is not available. Please file an issue!');
|
20150 |
+
}
|
20151 |
+
|
20152 |
+
return INTRINSICS[name];
|
20153 |
+
};
|
20154 |
+
|
20155 |
+
module.exports = function GetIntrinsic(name, allowMissing) {
|
20156 |
+
if (typeof name !== 'string' || name.length === 0) {
|
20157 |
+
throw new TypeError('intrinsic name must be a non-empty string');
|
20158 |
+
}
|
20159 |
+
if (arguments.length > 1 && typeof allowMissing !== 'boolean') {
|
20160 |
+
throw new TypeError('"allowMissing" argument must be a boolean');
|
20161 |
+
}
|
20162 |
+
|
20163 |
+
var parts = stringToPath(name);
|
20164 |
+
|
20165 |
+
var value = getBaseIntrinsic('%' + (parts.length > 0 ? parts[0] : '') + '%', allowMissing);
|
20166 |
+
for (var i = 1; i < parts.length; i += 1) {
|
20167 |
+
if (value != null) {
|
20168 |
+
if ($gOPD && (i + 1) >= parts.length) {
|
20169 |
+
var desc = $gOPD(value, parts[i]);
|
20170 |
+
if (!allowMissing && !(parts[i] in value)) {
|
20171 |
+
throw new $TypeError('base intrinsic for ' + name + ' exists, but the property is not available.');
|
20172 |
+
}
|
20173 |
+
// By convention, when a data property is converted to an accessor
|
20174 |
+
// property to emulate a data property that does not suffer from
|
20175 |
+
// the override mistake, that accessor's getter is marked with
|
20176 |
+
// an `originalValue` property. Here, when we detect this, we
|
20177 |
+
// uphold the illusion by pretending to see that original data
|
20178 |
+
// property, i.e., returning the value rather than the getter
|
20179 |
+
// itself.
|
20180 |
+
value = desc && 'get' in desc && !('originalValue' in desc.get) ? desc.get : value[parts[i]];
|
20181 |
+
} else {
|
20182 |
+
value = value[parts[i]];
|
20183 |
+
}
|
20184 |
+
}
|
20185 |
+
}
|
20186 |
+
return value;
|
20187 |
+
};
|
20188 |
+
|
20189 |
+
|
20190 |
+
/***/ }),
|
20191 |
+
/* 140 */
|
20192 |
/***/ (function(module, exports, __webpack_require__) {
|
20193 |
|
20194 |
"use strict";
|
20253 |
}
|
20254 |
|
20255 |
/***/ }),
|
20256 |
+
/* 141 */
|
20257 |
/***/ (function(module, exports) {
|
20258 |
|
20259 |
/**
|
20290 |
|
20291 |
|
20292 |
/***/ }),
|
20293 |
+
/* 142 */
|
20294 |
/***/ (function(module, exports, __webpack_require__) {
|
20295 |
|
20296 |
"use strict";
|
20305 |
|
20306 |
var _moment2 = _interopRequireDefault(_moment);
|
20307 |
|
20308 |
+
var _toMomentObject = __webpack_require__(59);
|
20309 |
|
20310 |
var _toMomentObject2 = _interopRequireDefault(_toMomentObject);
|
20311 |
|
20321 |
}
|
20322 |
|
20323 |
/***/ }),
|
20324 |
+
/* 143 */
|
20325 |
/***/ (function(module, exports, __webpack_require__) {
|
20326 |
|
20327 |
"use strict";
|
20332 |
});
|
20333 |
exports['default'] = isDayVisible;
|
20334 |
|
20335 |
+
var _isBeforeDay = __webpack_require__(74);
|
20336 |
|
20337 |
var _isBeforeDay2 = _interopRequireDefault(_isBeforeDay);
|
20338 |
|
20339 |
+
var _isAfterDay = __webpack_require__(92);
|
20340 |
|
20341 |
var _isAfterDay2 = _interopRequireDefault(_isAfterDay);
|
20342 |
|
20353 |
}
|
20354 |
|
20355 |
/***/ }),
|
20356 |
+
/* 144 */
|
20357 |
/***/ (function(module, exports, __webpack_require__) {
|
20358 |
|
20359 |
"use strict";
|
20368 |
|
20369 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
20370 |
|
20371 |
+
var _object = __webpack_require__(25);
|
20372 |
|
20373 |
var _object2 = _interopRequireDefault(_object);
|
20374 |
|
20375 |
+
var _react = __webpack_require__(9);
|
20376 |
|
20377 |
var _react2 = _interopRequireDefault(_react);
|
20378 |
|
20380 |
|
20381 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
20382 |
|
20383 |
+
var _reactAddonsShallowCompare = __webpack_require__(57);
|
20384 |
|
20385 |
var _reactAddonsShallowCompare2 = _interopRequireDefault(_reactAddonsShallowCompare);
|
20386 |
|
20387 |
+
var _airbnbPropTypes = __webpack_require__(22);
|
20388 |
|
20389 |
+
var _reactWithStyles = __webpack_require__(34);
|
20390 |
|
20391 |
var _moment = __webpack_require__(0);
|
20392 |
|
20393 |
var _moment2 = _interopRequireDefault(_moment);
|
20394 |
|
20395 |
+
var _throttle = __webpack_require__(412);
|
20396 |
|
20397 |
var _throttle2 = _interopRequireDefault(_throttle);
|
20398 |
|
20399 |
+
var _isTouchDevice = __webpack_require__(61);
|
20400 |
|
20401 |
var _isTouchDevice2 = _interopRequireDefault(_isTouchDevice);
|
20402 |
|
20403 |
+
var _reactOutsideClickHandler = __webpack_require__(137);
|
20404 |
|
20405 |
var _reactOutsideClickHandler2 = _interopRequireDefault(_reactOutsideClickHandler);
|
20406 |
|
20407 |
+
var _defaultPhrases = __webpack_require__(29);
|
20408 |
|
20409 |
+
var _getPhrasePropTypes = __webpack_require__(31);
|
20410 |
|
20411 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
20412 |
|
20413 |
+
var _CalendarMonthGrid = __webpack_require__(393);
|
20414 |
|
20415 |
var _CalendarMonthGrid2 = _interopRequireDefault(_CalendarMonthGrid);
|
20416 |
|
20417 |
+
var _DayPickerNavigation = __webpack_require__(777);
|
20418 |
|
20419 |
var _DayPickerNavigation2 = _interopRequireDefault(_DayPickerNavigation);
|
20420 |
|
20421 |
+
var _DayPickerKeyboardShortcuts = __webpack_require__(780);
|
20422 |
|
20423 |
var _DayPickerKeyboardShortcuts2 = _interopRequireDefault(_DayPickerKeyboardShortcuts);
|
20424 |
|
20425 |
+
var _getNumberOfCalendarMonthWeeks = __webpack_require__(782);
|
20426 |
|
20427 |
var _getNumberOfCalendarMonthWeeks2 = _interopRequireDefault(_getNumberOfCalendarMonthWeeks);
|
20428 |
|
20429 |
+
var _getCalendarMonthWidth = __webpack_require__(394);
|
20430 |
|
20431 |
var _getCalendarMonthWidth2 = _interopRequireDefault(_getCalendarMonthWidth);
|
20432 |
|
20433 |
+
var _calculateDimension = __webpack_require__(392);
|
20434 |
|
20435 |
var _calculateDimension2 = _interopRequireDefault(_calculateDimension);
|
20436 |
|
20437 |
+
var _getActiveElement = __webpack_require__(783);
|
20438 |
|
20439 |
var _getActiveElement2 = _interopRequireDefault(_getActiveElement);
|
20440 |
|
20441 |
+
var _isDayVisible = __webpack_require__(143);
|
20442 |
|
20443 |
var _isDayVisible2 = _interopRequireDefault(_isDayVisible);
|
20444 |
|
20445 |
+
var _ModifiersShape = __webpack_require__(87);
|
20446 |
|
20447 |
var _ModifiersShape2 = _interopRequireDefault(_ModifiersShape);
|
20448 |
|
20449 |
+
var _ScrollableOrientationShape = __webpack_require__(60);
|
20450 |
|
20451 |
var _ScrollableOrientationShape2 = _interopRequireDefault(_ScrollableOrientationShape);
|
20452 |
|
20453 |
+
var _DayOfWeekShape = __webpack_require__(50);
|
20454 |
|
20455 |
var _DayOfWeekShape2 = _interopRequireDefault(_DayOfWeekShape);
|
20456 |
|
20457 |
+
var _CalendarInfoPositionShape = __webpack_require__(72);
|
20458 |
|
20459 |
var _CalendarInfoPositionShape2 = _interopRequireDefault(_CalendarInfoPositionShape);
|
20460 |
|
21935 |
})(DayPicker);
|
21936 |
|
21937 |
/***/ }),
|
21938 |
+
/* 145 */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
21939 |
/***/ (function(module, exports, __webpack_require__) {
|
21940 |
|
21941 |
"use strict";
|
21942 |
|
21943 |
|
21944 |
+
var stringify = __webpack_require__(842);
|
21945 |
+
var parse = __webpack_require__(843);
|
21946 |
+
var formats = __webpack_require__(441);
|
21947 |
|
21948 |
module.exports = {
|
21949 |
formats: formats,
|
21953 |
|
21954 |
|
21955 |
/***/ }),
|
21956 |
+
/* 146 */
|
21957 |
/***/ (function(module, exports, __webpack_require__) {
|
21958 |
|
21959 |
"use strict";
|
22208 |
|
22209 |
|
22210 |
/***/ }),
|
22211 |
+
/* 147 */
|
22212 |
/***/ (function(module, exports, __webpack_require__) {
|
22213 |
|
22214 |
"use strict";
|
22215 |
/* WEBPACK VAR INJECTION */(function(process) {
|
22216 |
|
22217 |
if (process.env.NODE_ENV === 'production') {
|
22218 |
+
module.exports = __webpack_require__(458);
|
22219 |
} else {
|
22220 |
+
module.exports = __webpack_require__(459);
|
22221 |
}
|
22222 |
|
22223 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
22224 |
|
22225 |
/***/ }),
|
22226 |
+
/* 148 */
|
22227 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22228 |
|
22229 |
"use strict";
|
22230 |
/* harmony export (immutable) */ __webpack_exports__["a"] = RawHTML;
|
22231 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(23);
|
22232 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
22233 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__react__ = __webpack_require__(94);
|
22234 |
|
22235 |
|
22236 |
|
22264 |
//# sourceMappingURL=raw-html.js.map
|
22265 |
|
22266 |
/***/ }),
|
22267 |
+
/* 149 */
|
22268 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22269 |
|
22270 |
"use strict";
|
22280 |
}
|
22281 |
|
22282 |
/***/ }),
|
22283 |
+
/* 150 */
|
22284 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22285 |
|
22286 |
"use strict";
|
22287 |
/* harmony export (immutable) */ __webpack_exports__["a"] = _unsupportedIterableToArray;
|
22288 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_arrayLikeToArray__ = __webpack_require__(149);
|
22289 |
|
22290 |
function _unsupportedIterableToArray(o, minLen) {
|
22291 |
if (!o) return;
|
22292 |
+
if (typeof o === "string") return Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_arrayLikeToArray__["a" /* default */])(o, minLen);
|
22293 |
var n = Object.prototype.toString.call(o).slice(8, -1);
|
22294 |
if (n === "Object" && o.constructor) n = o.constructor.name;
|
22295 |
if (n === "Map" || n === "Set") return Array.from(o);
|
22296 |
+
if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_arrayLikeToArray__["a" /* default */])(o, minLen);
|
22297 |
}
|
22298 |
|
22299 |
/***/ }),
|
22300 |
+
/* 151 */
|
22301 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22302 |
|
22303 |
"use strict";
|
22304 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return createI18n; });
|
22305 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
22306 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_tannin__ = __webpack_require__(80);
|
22307 |
|
22308 |
|
22309 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
22375 |
|
22376 |
var setLocaleData = function setLocaleData(data) {
|
22377 |
var domain = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'default';
|
22378 |
+
tannin.data[domain] = _objectSpread(_objectSpread(_objectSpread({}, DEFAULT_LOCALE_DATA), tannin.data[domain]), data); // Populate default domain configuration (supported locale date which omits
|
22379 |
// a plural forms expression).
|
22380 |
|
22381 |
+
tannin.data[domain][''] = _objectSpread(_objectSpread({}, DEFAULT_LOCALE_DATA['']), tannin.data[domain]['']);
|
22382 |
};
|
22383 |
/**
|
22384 |
* Wrapper for Tannin's `dcnpgettext`. Populates default locale data if not
|
22512 |
//# sourceMappingURL=create-i18n.js.map
|
22513 |
|
22514 |
/***/ }),
|
22515 |
+
/* 152 */
|
22516 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22517 |
|
22518 |
"use strict";
|
22519 |
/* harmony export (immutable) */ __webpack_exports__["a"] = RawHTML;
|
22520 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
22521 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
22522 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__react__ = __webpack_require__(97);
|
22523 |
|
22532 |
*/
|
22533 |
// Disable reason: JSDoc linter doesn't seem to parse the union (`&`) correctly.
|
22534 |
|
|
|
|
|
22535 |
/** @typedef {{children: string} & import('react').ComponentPropsWithoutRef<'div'>} RawHTMLProps */
|
22536 |
|
|
|
|
|
22537 |
/**
|
22538 |
* Component used as equivalent of Fragment with unescaped HTML, in cases where
|
22539 |
* it is desirable to render dangerous HTML without needing a wrapper element.
|
22561 |
//# sourceMappingURL=raw-html.js.map
|
22562 |
|
22563 |
/***/ }),
|
22564 |
+
/* 153 */
|
22565 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22566 |
|
22567 |
"use strict";
|
22568 |
/* harmony export (immutable) */ __webpack_exports__["a"] = useInstanceId;
|
22569 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(24);
|
22570 |
/**
|
22571 |
* WordPress dependencies
|
22572 |
*/
|
22587 |
* Provides a unique instance ID.
|
22588 |
*
|
22589 |
* @param {Object} object Object reference to create an id for.
|
22590 |
+
* @param {string} prefix Prefix for the unique id.
|
22591 |
*/
|
22592 |
|
22593 |
|
22594 |
+
function useInstanceId(object, prefix) {
|
22595 |
return Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_element__["i" /* useMemo */])(function () {
|
22596 |
+
var id = createId(object);
|
22597 |
+
return prefix ? "".concat(prefix, "-").concat(id) : id;
|
22598 |
}, [object]);
|
22599 |
}
|
22600 |
//# sourceMappingURL=index.js.map
|
22601 |
|
22602 |
/***/ }),
|
22603 |
+
/* 154 */
|
22604 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22605 |
+
|
22606 |
+
"use strict";
|
22607 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = usePrevious;
|
22608 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(24);
|
22609 |
+
/**
|
22610 |
+
* WordPress dependencies
|
22611 |
+
*/
|
22612 |
+
|
22613 |
+
/**
|
22614 |
+
* Use something's value from the previous render.
|
22615 |
+
* Based on https://usehooks.com/usePrevious/.
|
22616 |
+
*
|
22617 |
+
* @template T
|
22618 |
+
*
|
22619 |
+
* @param {T} value The value to track.
|
22620 |
+
*
|
22621 |
+
* @return {T|undefined} The value from the previous render.
|
22622 |
+
*/
|
22623 |
+
|
22624 |
+
function usePrevious(value) {
|
22625 |
+
// Disable reason: without an explicit type detail, the type of ref will be
|
22626 |
+
// inferred based on the initial useRef argument, which is undefined.
|
22627 |
+
// https://github.com/WordPress/gutenberg/pull/22597#issuecomment-633588366
|
22628 |
+
|
22629 |
+
/* eslint-disable jsdoc/no-undefined-types */
|
22630 |
+
var ref = Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_element__["k" /* useRef */])(
|
22631 |
+
/** @type {T|undefined} */
|
22632 |
+
undefined);
|
22633 |
+
/* eslint-enable jsdoc/no-undefined-types */
|
22634 |
+
// Store current value in ref.
|
22635 |
+
|
22636 |
+
Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_element__["g" /* useEffect */])(function () {
|
22637 |
+
ref.current = value;
|
22638 |
+
}, [value]); // Re-run when value changes.
|
22639 |
+
// Return previous value (happens before update in useEffect above).
|
22640 |
+
|
22641 |
+
return ref.current;
|
22642 |
+
}
|
22643 |
+
//# sourceMappingURL=index.js.map
|
22644 |
+
|
22645 |
+
/***/ }),
|
22646 |
+
/* 155 */
|
22647 |
/***/ (function(module, exports, __webpack_require__) {
|
22648 |
|
22649 |
+
var e=__webpack_require__(9),n={display:"block",opacity:0,position:"absolute",top:0,left:0,height:"100%",width:"100%",overflow:"hidden",pointerEvents:"none",zIndex:-1},t=function(t){var r=t.onResize,u=e.useRef();return function(n,t){var r=function(){return n.current&&n.current.contentDocument&&n.current.contentDocument.defaultView};function u(){t();var e=r();e&&e.addEventListener("resize",t)}e.useEffect((function(){return r()?u():n.current&&n.current.addEventListener&&n.current.addEventListener("load",u),function(){var e=r();e&&"function"==typeof e.removeEventListener&&e.removeEventListener("resize",t)}}),[])}(u,(function(){return r(u)})),e.createElement("iframe",{style:n,src:"about:blank",ref:u,"aria-hidden":!0,tabIndex:-1,frameBorder:0})},r=function(e){return{width:null!=e?e.offsetWidth:null,height:null!=e?e.offsetHeight:null}};module.exports=function(n){void 0===n&&(n=r);var u=e.useState(n(null)),o=u[0],i=u[1],c=e.useCallback((function(e){return i(n(e.current))}),[n]);return[e.useMemo((function(){return e.createElement(t,{onResize:c})}),[c]),o]};
|
22650 |
//# sourceMappingURL=index.js.map
|
22651 |
|
22652 |
|
22653 |
/***/ }),
|
22654 |
+
/* 156 */
|
22655 |
/***/ (function(module, exports) {
|
22656 |
|
22657 |
function combineReducers( reducers ) {
|
22709 |
|
22710 |
|
22711 |
/***/ }),
|
22712 |
+
/* 157 */
|
22713 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22714 |
+
|
22715 |
+
"use strict";
|
22716 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__registry__ = __webpack_require__(158);
|
22717 |
+
/**
|
22718 |
+
* Internal dependencies
|
22719 |
+
*/
|
22720 |
+
|
22721 |
+
/* harmony default export */ __webpack_exports__["a"] = (Object(__WEBPACK_IMPORTED_MODULE_0__registry__["a" /* createRegistry */])());
|
22722 |
+
//# sourceMappingURL=default-registry.js.map
|
22723 |
+
|
22724 |
+
/***/ }),
|
22725 |
+
/* 158 */
|
22726 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
22727 |
|
22728 |
"use strict";
|
22729 |
/* harmony export (immutable) */ __webpack_exports__["a"] = createRegistry;
|
22730 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
22731 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
22732 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash__ = __webpack_require__(2);
|
22733 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_lodash__);
|
22734 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_memize__ = __webpack_require__(64);
|
22735 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_memize___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_memize__);
|
22736 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__namespace_store__ = __webpack_require__(512);
|
22737 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__store__ = __webpack_require__(537);
|
22738 |
|
22739 |
|
22740 |
|
22983 |
|
22984 |
|
22985 |
function use(plugin, options) {
|
22986 |
+
registry = _objectSpread(_objectSpread({}, registry), plugin(registry, options));
|
22987 |
return registry;
|
22988 |
}
|
22989 |
|
23005 |
//# sourceMappingURL=registry.js.map
|
23006 |
|
23007 |
/***/ }),
|
23008 |
+
/* 159 */
|
23009 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23010 |
|
23011 |
"use strict";
|
23047 |
}
|
23048 |
|
23049 |
/***/ }),
|
23050 |
+
/* 160 */
|
23051 |
+
/***/ (function(module, exports, __webpack_require__) {
|
23052 |
+
|
23053 |
+
"use strict";
|
23054 |
+
|
23055 |
+
|
23056 |
+
function _typeof(obj) {
|
23057 |
+
if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
|
23058 |
+
_typeof = function (obj) {
|
23059 |
+
return typeof obj;
|
23060 |
+
};
|
23061 |
+
} else {
|
23062 |
+
_typeof = function (obj) {
|
23063 |
+
return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
|
23064 |
+
};
|
23065 |
+
}
|
23066 |
+
|
23067 |
+
return _typeof(obj);
|
23068 |
+
}
|
23069 |
+
|
23070 |
+
function _classCallCheck(instance, Constructor) {
|
23071 |
+
if (!(instance instanceof Constructor)) {
|
23072 |
+
throw new TypeError("Cannot call a class as a function");
|
23073 |
+
}
|
23074 |
+
}
|
23075 |
+
|
23076 |
+
function _defineProperties(target, props) {
|
23077 |
+
for (var i = 0; i < props.length; i++) {
|
23078 |
+
var descriptor = props[i];
|
23079 |
+
descriptor.enumerable = descriptor.enumerable || false;
|
23080 |
+
descriptor.configurable = true;
|
23081 |
+
if ("value" in descriptor) descriptor.writable = true;
|
23082 |
+
Object.defineProperty(target, descriptor.key, descriptor);
|
23083 |
+
}
|
23084 |
+
}
|
23085 |
+
|
23086 |
+
function _createClass(Constructor, protoProps, staticProps) {
|
23087 |
+
if (protoProps) _defineProperties(Constructor.prototype, protoProps);
|
23088 |
+
if (staticProps) _defineProperties(Constructor, staticProps);
|
23089 |
+
return Constructor;
|
23090 |
+
}
|
23091 |
+
|
23092 |
+
/**
|
23093 |
+
* Given an instance of EquivalentKeyMap, returns its internal value pair tuple
|
23094 |
+
* for a key, if one exists. The tuple members consist of the last reference
|
23095 |
+
* value for the key (used in efficient subsequent lookups) and the value
|
23096 |
+
* assigned for the key at the leaf node.
|
23097 |
+
*
|
23098 |
+
* @param {EquivalentKeyMap} instance EquivalentKeyMap instance.
|
23099 |
+
* @param {*} key The key for which to return value pair.
|
23100 |
+
*
|
23101 |
+
* @return {?Array} Value pair, if exists.
|
23102 |
+
*/
|
23103 |
+
function getValuePair(instance, key) {
|
23104 |
+
var _map = instance._map,
|
23105 |
+
_arrayTreeMap = instance._arrayTreeMap,
|
23106 |
+
_objectTreeMap = instance._objectTreeMap; // Map keeps a reference to the last object-like key used to set the
|
23107 |
+
// value, which can be used to shortcut immediately to the value.
|
23108 |
+
|
23109 |
+
if (_map.has(key)) {
|
23110 |
+
return _map.get(key);
|
23111 |
+
} // Sort keys to ensure stable retrieval from tree.
|
23112 |
+
|
23113 |
+
|
23114 |
+
var properties = Object.keys(key).sort(); // Tree by type to avoid conflicts on numeric object keys, empty value.
|
23115 |
+
|
23116 |
+
var map = Array.isArray(key) ? _arrayTreeMap : _objectTreeMap;
|
23117 |
+
|
23118 |
+
for (var i = 0; i < properties.length; i++) {
|
23119 |
+
var property = properties[i];
|
23120 |
+
map = map.get(property);
|
23121 |
+
|
23122 |
+
if (map === undefined) {
|
23123 |
+
return;
|
23124 |
+
}
|
23125 |
+
|
23126 |
+
var propertyValue = key[property];
|
23127 |
+
map = map.get(propertyValue);
|
23128 |
+
|
23129 |
+
if (map === undefined) {
|
23130 |
+
return;
|
23131 |
+
}
|
23132 |
+
}
|
23133 |
+
|
23134 |
+
var valuePair = map.get('_ekm_value');
|
23135 |
+
|
23136 |
+
if (!valuePair) {
|
23137 |
+
return;
|
23138 |
+
} // If reached, it implies that an object-like key was set with another
|
23139 |
+
// reference, so delete the reference and replace with the current.
|
23140 |
+
|
23141 |
+
|
23142 |
+
_map.delete(valuePair[0]);
|
23143 |
+
|
23144 |
+
valuePair[0] = key;
|
23145 |
+
map.set('_ekm_value', valuePair);
|
23146 |
+
|
23147 |
+
_map.set(key, valuePair);
|
23148 |
+
|
23149 |
+
return valuePair;
|
23150 |
+
}
|
23151 |
+
/**
|
23152 |
+
* Variant of a Map object which enables lookup by equivalent (deeply equal)
|
23153 |
+
* object and array keys.
|
23154 |
+
*/
|
23155 |
+
|
23156 |
+
|
23157 |
+
var EquivalentKeyMap =
|
23158 |
+
/*#__PURE__*/
|
23159 |
+
function () {
|
23160 |
+
/**
|
23161 |
+
* Constructs a new instance of EquivalentKeyMap.
|
23162 |
+
*
|
23163 |
+
* @param {Iterable.<*>} iterable Initial pair of key, value for map.
|
23164 |
+
*/
|
23165 |
+
function EquivalentKeyMap(iterable) {
|
23166 |
+
_classCallCheck(this, EquivalentKeyMap);
|
23167 |
+
|
23168 |
+
this.clear();
|
23169 |
+
|
23170 |
+
if (iterable instanceof EquivalentKeyMap) {
|
23171 |
+
// Map#forEach is only means of iterating with support for IE11.
|
23172 |
+
var iterablePairs = [];
|
23173 |
+
iterable.forEach(function (value, key) {
|
23174 |
+
iterablePairs.push([key, value]);
|
23175 |
+
});
|
23176 |
+
iterable = iterablePairs;
|
23177 |
+
}
|
23178 |
+
|
23179 |
+
if (iterable != null) {
|
23180 |
+
for (var i = 0; i < iterable.length; i++) {
|
23181 |
+
this.set(iterable[i][0], iterable[i][1]);
|
23182 |
+
}
|
23183 |
+
}
|
23184 |
+
}
|
23185 |
+
/**
|
23186 |
+
* Accessor property returning the number of elements.
|
23187 |
+
*
|
23188 |
+
* @return {number} Number of elements.
|
23189 |
+
*/
|
23190 |
+
|
23191 |
+
|
23192 |
+
_createClass(EquivalentKeyMap, [{
|
23193 |
+
key: "set",
|
23194 |
+
|
23195 |
+
/**
|
23196 |
+
* Add or update an element with a specified key and value.
|
23197 |
+
*
|
23198 |
+
* @param {*} key The key of the element to add.
|
23199 |
+
* @param {*} value The value of the element to add.
|
23200 |
+
*
|
23201 |
+
* @return {EquivalentKeyMap} Map instance.
|
23202 |
+
*/
|
23203 |
+
value: function set(key, value) {
|
23204 |
+
// Shortcut non-object-like to set on internal Map.
|
23205 |
+
if (key === null || _typeof(key) !== 'object') {
|
23206 |
+
this._map.set(key, value);
|
23207 |
+
|
23208 |
+
return this;
|
23209 |
+
} // Sort keys to ensure stable assignment into tree.
|
23210 |
+
|
23211 |
+
|
23212 |
+
var properties = Object.keys(key).sort();
|
23213 |
+
var valuePair = [key, value]; // Tree by type to avoid conflicts on numeric object keys, empty value.
|
23214 |
+
|
23215 |
+
var map = Array.isArray(key) ? this._arrayTreeMap : this._objectTreeMap;
|
23216 |
+
|
23217 |
+
for (var i = 0; i < properties.length; i++) {
|
23218 |
+
var property = properties[i];
|
23219 |
+
|
23220 |
+
if (!map.has(property)) {
|
23221 |
+
map.set(property, new EquivalentKeyMap());
|
23222 |
+
}
|
23223 |
+
|
23224 |
+
map = map.get(property);
|
23225 |
+
var propertyValue = key[property];
|
23226 |
+
|
23227 |
+
if (!map.has(propertyValue)) {
|
23228 |
+
map.set(propertyValue, new EquivalentKeyMap());
|
23229 |
+
}
|
23230 |
+
|
23231 |
+
map = map.get(propertyValue);
|
23232 |
+
} // If an _ekm_value exists, there was already an equivalent key. Before
|
23233 |
+
// overriding, ensure that the old key reference is removed from map to
|
23234 |
+
// avoid memory leak of accumulating equivalent keys. This is, in a
|
23235 |
+
// sense, a poor man's WeakMap, while still enabling iterability.
|
23236 |
+
|
23237 |
+
|
23238 |
+
var previousValuePair = map.get('_ekm_value');
|
23239 |
+
|
23240 |
+
if (previousValuePair) {
|
23241 |
+
this._map.delete(previousValuePair[0]);
|
23242 |
+
}
|
23243 |
+
|
23244 |
+
map.set('_ekm_value', valuePair);
|
23245 |
+
|
23246 |
+
this._map.set(key, valuePair);
|
23247 |
+
|
23248 |
+
return this;
|
23249 |
+
}
|
23250 |
+
/**
|
23251 |
+
* Returns a specified element.
|
23252 |
+
*
|
23253 |
+
* @param {*} key The key of the element to return.
|
23254 |
+
*
|
23255 |
+
* @return {?*} The element associated with the specified key or undefined
|
23256 |
+
* if the key can't be found.
|
23257 |
+
*/
|
23258 |
+
|
23259 |
+
}, {
|
23260 |
+
key: "get",
|
23261 |
+
value: function get(key) {
|
23262 |
+
// Shortcut non-object-like to get from internal Map.
|
23263 |
+
if (key === null || _typeof(key) !== 'object') {
|
23264 |
+
return this._map.get(key);
|
23265 |
+
}
|
23266 |
+
|
23267 |
+
var valuePair = getValuePair(this, key);
|
23268 |
+
|
23269 |
+
if (valuePair) {
|
23270 |
+
return valuePair[1];
|
23271 |
+
}
|
23272 |
+
}
|
23273 |
+
/**
|
23274 |
+
* Returns a boolean indicating whether an element with the specified key
|
23275 |
+
* exists or not.
|
23276 |
+
*
|
23277 |
+
* @param {*} key The key of the element to test for presence.
|
23278 |
+
*
|
23279 |
+
* @return {boolean} Whether an element with the specified key exists.
|
23280 |
+
*/
|
23281 |
+
|
23282 |
+
}, {
|
23283 |
+
key: "has",
|
23284 |
+
value: function has(key) {
|
23285 |
+
if (key === null || _typeof(key) !== 'object') {
|
23286 |
+
return this._map.has(key);
|
23287 |
+
} // Test on the _presence_ of the pair, not its value, as even undefined
|
23288 |
+
// can be a valid member value for a key.
|
23289 |
+
|
23290 |
+
|
23291 |
+
return getValuePair(this, key) !== undefined;
|
23292 |
+
}
|
23293 |
+
/**
|
23294 |
+
* Removes the specified element.
|
23295 |
+
*
|
23296 |
+
* @param {*} key The key of the element to remove.
|
23297 |
+
*
|
23298 |
+
* @return {boolean} Returns true if an element existed and has been
|
23299 |
+
* removed, or false if the element does not exist.
|
23300 |
+
*/
|
23301 |
+
|
23302 |
+
}, {
|
23303 |
+
key: "delete",
|
23304 |
+
value: function _delete(key) {
|
23305 |
+
if (!this.has(key)) {
|
23306 |
+
return false;
|
23307 |
+
} // This naive implementation will leave orphaned child trees. A better
|
23308 |
+
// implementation should traverse and remove orphans.
|
23309 |
+
|
23310 |
+
|
23311 |
+
this.set(key, undefined);
|
23312 |
+
return true;
|
23313 |
+
}
|
23314 |
+
/**
|
23315 |
+
* Executes a provided function once per each key/value pair, in insertion
|
23316 |
+
* order.
|
23317 |
+
*
|
23318 |
+
* @param {Function} callback Function to execute for each element.
|
23319 |
+
* @param {*} thisArg Value to use as `this` when executing
|
23320 |
+
* `callback`.
|
23321 |
+
*/
|
23322 |
+
|
23323 |
+
}, {
|
23324 |
+
key: "forEach",
|
23325 |
+
value: function forEach(callback) {
|
23326 |
+
var _this = this;
|
23327 |
+
|
23328 |
+
var thisArg = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this;
|
23329 |
+
|
23330 |
+
this._map.forEach(function (value, key) {
|
23331 |
+
// Unwrap value from object-like value pair.
|
23332 |
+
if (key !== null && _typeof(key) === 'object') {
|
23333 |
+
value = value[1];
|
23334 |
+
}
|
23335 |
+
|
23336 |
+
callback.call(thisArg, value, key, _this);
|
23337 |
+
});
|
23338 |
+
}
|
23339 |
+
/**
|
23340 |
+
* Removes all elements.
|
23341 |
+
*/
|
23342 |
+
|
23343 |
+
}, {
|
23344 |
+
key: "clear",
|
23345 |
+
value: function clear() {
|
23346 |
+
this._map = new Map();
|
23347 |
+
this._arrayTreeMap = new Map();
|
23348 |
+
this._objectTreeMap = new Map();
|
23349 |
+
}
|
23350 |
+
}, {
|
23351 |
+
key: "size",
|
23352 |
+
get: function get() {
|
23353 |
+
return this._map.size;
|
23354 |
+
}
|
23355 |
+
}]);
|
23356 |
+
|
23357 |
+
return EquivalentKeyMap;
|
23358 |
+
}();
|
23359 |
+
|
23360 |
+
module.exports = EquivalentKeyMap;
|
23361 |
+
|
23362 |
+
|
23363 |
+
/***/ }),
|
23364 |
+
/* 161 */
|
23365 |
/***/ (function(module, exports, __webpack_require__) {
|
23366 |
|
23367 |
"use strict";
|
23372 |
});
|
23373 |
exports.createChannel = exports.subscribe = exports.cps = exports.apply = exports.call = exports.invoke = exports.delay = exports.race = exports.join = exports.fork = exports.error = exports.all = undefined;
|
23374 |
|
23375 |
+
var _keys = __webpack_require__(162);
|
23376 |
|
23377 |
var _keys2 = _interopRequireDefault(_keys);
|
23378 |
|
23501 |
};
|
23502 |
|
23503 |
/***/ }),
|
23504 |
+
/* 162 */
|
23505 |
/***/ (function(module, exports, __webpack_require__) {
|
23506 |
|
23507 |
"use strict";
|
23524 |
exports.default = keys;
|
23525 |
|
23526 |
/***/ }),
|
23527 |
+
/* 163 */
|
23528 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23529 |
+
|
23530 |
+
"use strict";
|
23531 |
+
/* unused harmony export controls */
|
23532 |
+
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return builtinControls; });
|
23533 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
23534 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
23535 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__factory__ = __webpack_require__(164);
|
23536 |
+
|
23537 |
+
|
23538 |
+
|
23539 |
+
var _builtinControls;
|
23540 |
+
|
23541 |
+
/**
|
23542 |
+
* Internal dependencies
|
23543 |
+
*/
|
23544 |
+
|
23545 |
+
var SELECT = '@@data/SELECT';
|
23546 |
+
var RESOLVE_SELECT = '@@data/RESOLVE_SELECT';
|
23547 |
+
var DISPATCH = '@@data/DISPATCH';
|
23548 |
+
/**
|
23549 |
+
* Dispatches a control action for triggering a synchronous registry select.
|
23550 |
+
*
|
23551 |
+
* Note: This control synchronously returns the current selector value, triggering the
|
23552 |
+
* resolution, but not waiting for it.
|
23553 |
+
*
|
23554 |
+
* @param {string} storeKey The key for the store the selector belongs to.
|
23555 |
+
* @param {string} selectorName The name of the selector.
|
23556 |
+
* @param {Array} args Arguments for the selector.
|
23557 |
+
*
|
23558 |
+
* @example
|
23559 |
+
* ```js
|
23560 |
+
* import { controls } from '@wordpress/data';
|
23561 |
+
*
|
23562 |
+
* // Action generator using `select`.
|
23563 |
+
* export function* myAction() {
|
23564 |
+
* const isEditorSideBarOpened = yield controls.select( 'core/edit-post', 'isEditorSideBarOpened' );
|
23565 |
+
* // Do stuff with the result from the `select`.
|
23566 |
+
* }
|
23567 |
+
* ```
|
23568 |
+
*
|
23569 |
+
* @return {Object} The control descriptor.
|
23570 |
+
*/
|
23571 |
+
|
23572 |
+
function select(storeKey, selectorName) {
|
23573 |
+
for (var _len = arguments.length, args = new Array(_len > 2 ? _len - 2 : 0), _key = 2; _key < _len; _key++) {
|
23574 |
+
args[_key - 2] = arguments[_key];
|
23575 |
+
}
|
23576 |
+
|
23577 |
+
return {
|
23578 |
+
type: SELECT,
|
23579 |
+
storeKey: storeKey,
|
23580 |
+
selectorName: selectorName,
|
23581 |
+
args: args
|
23582 |
+
};
|
23583 |
+
}
|
23584 |
+
/**
|
23585 |
+
* Dispatches a control action for triggering and resolving a registry select.
|
23586 |
+
*
|
23587 |
+
* Note: when this control action is handled, it automatically considers
|
23588 |
+
* selectors that may have a resolver. In such case, it will return a `Promise` that resolves
|
23589 |
+
* after the selector finishes resolving, with the final result value.
|
23590 |
+
*
|
23591 |
+
* @param {string} storeKey The key for the store the selector belongs to
|
23592 |
+
* @param {string} selectorName The name of the selector
|
23593 |
+
* @param {Array} args Arguments for the selector.
|
23594 |
+
*
|
23595 |
+
* @example
|
23596 |
+
* ```js
|
23597 |
+
* import { controls } from '@wordpress/data';
|
23598 |
+
*
|
23599 |
+
* // Action generator using resolveSelect
|
23600 |
+
* export function* myAction() {
|
23601 |
+
* const isSidebarOpened = yield controls.resolveSelect( 'core/edit-post', 'isEditorSideBarOpened' );
|
23602 |
+
* // do stuff with the result from the select.
|
23603 |
+
* }
|
23604 |
+
* ```
|
23605 |
+
*
|
23606 |
+
* @return {Object} The control descriptor.
|
23607 |
+
*/
|
23608 |
+
|
23609 |
+
|
23610 |
+
function resolveSelect(storeKey, selectorName) {
|
23611 |
+
for (var _len2 = arguments.length, args = new Array(_len2 > 2 ? _len2 - 2 : 0), _key2 = 2; _key2 < _len2; _key2++) {
|
23612 |
+
args[_key2 - 2] = arguments[_key2];
|
23613 |
+
}
|
23614 |
+
|
23615 |
+
return {
|
23616 |
+
type: RESOLVE_SELECT,
|
23617 |
+
storeKey: storeKey,
|
23618 |
+
selectorName: selectorName,
|
23619 |
+
args: args
|
23620 |
+
};
|
23621 |
+
}
|
23622 |
+
/**
|
23623 |
+
* Dispatches a control action for triggering a registry dispatch.
|
23624 |
+
*
|
23625 |
+
* @param {string} storeKey The key for the store the action belongs to
|
23626 |
+
* @param {string} actionName The name of the action to dispatch
|
23627 |
+
* @param {Array} args Arguments for the dispatch action.
|
23628 |
+
*
|
23629 |
+
* @example
|
23630 |
+
* ```js
|
23631 |
+
* import { controls } from '@wordpress/data-controls';
|
23632 |
+
*
|
23633 |
+
* // Action generator using dispatch
|
23634 |
+
* export function* myAction() {
|
23635 |
+
* yield controls.dispatch( 'core/edit-post', 'togglePublishSidebar' );
|
23636 |
+
* // do some other things.
|
23637 |
+
* }
|
23638 |
+
* ```
|
23639 |
+
*
|
23640 |
+
* @return {Object} The control descriptor.
|
23641 |
+
*/
|
23642 |
+
|
23643 |
+
|
23644 |
+
function dispatch(storeKey, actionName) {
|
23645 |
+
for (var _len3 = arguments.length, args = new Array(_len3 > 2 ? _len3 - 2 : 0), _key3 = 2; _key3 < _len3; _key3++) {
|
23646 |
+
args[_key3 - 2] = arguments[_key3];
|
23647 |
+
}
|
23648 |
+
|
23649 |
+
return {
|
23650 |
+
type: DISPATCH,
|
23651 |
+
storeKey: storeKey,
|
23652 |
+
actionName: actionName,
|
23653 |
+
args: args
|
23654 |
+
};
|
23655 |
+
}
|
23656 |
+
|
23657 |
+
var controls = {
|
23658 |
+
select: select,
|
23659 |
+
resolveSelect: resolveSelect,
|
23660 |
+
dispatch: dispatch
|
23661 |
+
};
|
23662 |
+
var builtinControls = (_builtinControls = {}, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(_builtinControls, SELECT, Object(__WEBPACK_IMPORTED_MODULE_2__factory__["a" /* createRegistryControl */])(function (registry) {
|
23663 |
+
return function (_ref) {
|
23664 |
+
var _registry$select;
|
23665 |
+
|
23666 |
+
var storeKey = _ref.storeKey,
|
23667 |
+
selectorName = _ref.selectorName,
|
23668 |
+
args = _ref.args;
|
23669 |
+
return (_registry$select = registry.select(storeKey))[selectorName].apply(_registry$select, Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__["a" /* default */])(args));
|
23670 |
+
};
|
23671 |
+
})), Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(_builtinControls, RESOLVE_SELECT, Object(__WEBPACK_IMPORTED_MODULE_2__factory__["a" /* createRegistryControl */])(function (registry) {
|
23672 |
+
return function (_ref2) {
|
23673 |
+
var _registry$method;
|
23674 |
+
|
23675 |
+
var storeKey = _ref2.storeKey,
|
23676 |
+
selectorName = _ref2.selectorName,
|
23677 |
+
args = _ref2.args;
|
23678 |
+
var method = registry.select(storeKey)[selectorName].hasResolver ? '__experimentalResolveSelect' : 'select';
|
23679 |
+
return (_registry$method = registry[method](storeKey))[selectorName].apply(_registry$method, Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__["a" /* default */])(args));
|
23680 |
+
};
|
23681 |
+
})), Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(_builtinControls, DISPATCH, Object(__WEBPACK_IMPORTED_MODULE_2__factory__["a" /* createRegistryControl */])(function (registry) {
|
23682 |
+
return function (_ref3) {
|
23683 |
+
var _registry$dispatch;
|
23684 |
+
|
23685 |
+
var storeKey = _ref3.storeKey,
|
23686 |
+
actionName = _ref3.actionName,
|
23687 |
+
args = _ref3.args;
|
23688 |
+
return (_registry$dispatch = registry.dispatch(storeKey))[actionName].apply(_registry$dispatch, Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__["a" /* default */])(args));
|
23689 |
+
};
|
23690 |
+
})), _builtinControls);
|
23691 |
+
//# sourceMappingURL=controls.js.map
|
23692 |
+
|
23693 |
+
/***/ }),
|
23694 |
+
/* 164 */
|
23695 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23696 |
+
|
23697 |
+
"use strict";
|
23698 |
+
/* unused harmony export createRegistrySelector */
|
23699 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = createRegistryControl;
|
23700 |
+
/**
|
23701 |
+
* Creates a selector function that takes additional curried argument with the
|
23702 |
+
* registry `select` function. While a regular selector has signature
|
23703 |
+
* ```js
|
23704 |
+
* ( state, ...selectorArgs ) => ( result )
|
23705 |
+
* ```
|
23706 |
+
* that allows to select data from the store's `state`, a registry selector
|
23707 |
+
* has signature:
|
23708 |
+
* ```js
|
23709 |
+
* ( select ) => ( state, ...selectorArgs ) => ( result )
|
23710 |
+
* ```
|
23711 |
+
* that supports also selecting from other registered stores.
|
23712 |
+
*
|
23713 |
+
* @example
|
23714 |
+
* ```js
|
23715 |
+
* const getCurrentPostId = createRegistrySelector( ( select ) => ( state ) => {
|
23716 |
+
* return select( 'core/editor' ).getCurrentPostId();
|
23717 |
+
* } );
|
23718 |
+
*
|
23719 |
+
* const getPostEdits = createRegistrySelector( ( select ) => ( state ) => {
|
23720 |
+
* // calling another registry selector just like any other function
|
23721 |
+
* const postType = getCurrentPostType( state );
|
23722 |
+
* const postId = getCurrentPostId( state );
|
23723 |
+
* return select( 'core' ).getEntityRecordEdits( 'postType', postType, postId );
|
23724 |
+
* } );
|
23725 |
+
* ```
|
23726 |
+
*
|
23727 |
+
* Note how the `getCurrentPostId` selector can be called just like any other function,
|
23728 |
+
* (it works even inside a regular non-registry selector) and we don't need to pass the
|
23729 |
+
* registry as argument. The registry binding happens automatically when registering the selector
|
23730 |
+
* with a store.
|
23731 |
+
*
|
23732 |
+
* @param {Function} registrySelector Function receiving a registry `select`
|
23733 |
+
* function and returning a state selector.
|
23734 |
+
*
|
23735 |
+
* @return {Function} Registry selector that can be registered with a store.
|
23736 |
+
*/
|
23737 |
+
function createRegistrySelector(registrySelector) {
|
23738 |
+
// create a selector function that is bound to the registry referenced by `selector.registry`
|
23739 |
+
// and that has the same API as a regular selector. Binding it in such a way makes it
|
23740 |
+
// possible to call the selector directly from another selector.
|
23741 |
+
var selector = function selector() {
|
23742 |
+
return registrySelector(selector.registry.select).apply(void 0, arguments);
|
23743 |
+
};
|
23744 |
+
/**
|
23745 |
+
* Flag indicating that the selector is a registry selector that needs the correct registry
|
23746 |
+
* reference to be assigned to `selecto.registry` to make it work correctly.
|
23747 |
+
* be mapped as a registry selector.
|
23748 |
+
*
|
23749 |
+
* @type {boolean}
|
23750 |
+
*/
|
23751 |
+
|
23752 |
+
|
23753 |
+
selector.isRegistrySelector = true;
|
23754 |
+
return selector;
|
23755 |
+
}
|
23756 |
+
/**
|
23757 |
+
* Creates a control function that takes additional curried argument with the `registry` object.
|
23758 |
+
* While a regular control has signature
|
23759 |
+
* ```js
|
23760 |
+
* ( action ) => ( iteratorOrPromise )
|
23761 |
+
* ```
|
23762 |
+
* where the control works with the `action` that it's bound to, a registry control has signature:
|
23763 |
+
* ```js
|
23764 |
+
* ( registry ) => ( action ) => ( iteratorOrPromise )
|
23765 |
+
* ```
|
23766 |
+
* A registry control is typically used to select data or dispatch an action to a registered
|
23767 |
+
* store.
|
23768 |
+
*
|
23769 |
+
* When registering a control created with `createRegistryControl` with a store, the store
|
23770 |
+
* knows which calling convention to use when executing the control.
|
23771 |
+
*
|
23772 |
+
* @param {Function} registryControl Function receiving a registry object and returning a control.
|
23773 |
+
*
|
23774 |
+
* @return {Function} Registry control that can be registered with a store.
|
23775 |
+
*/
|
23776 |
+
|
23777 |
+
function createRegistryControl(registryControl) {
|
23778 |
+
registryControl.isRegistryControl = true;
|
23779 |
+
return registryControl;
|
23780 |
+
}
|
23781 |
+
//# sourceMappingURL=factory.js.map
|
23782 |
+
|
23783 |
+
/***/ }),
|
23784 |
+
/* 165 */
|
23785 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23786 |
|
23787 |
"use strict";
|
23813 |
//# sourceMappingURL=validateNamespace.js.map
|
23814 |
|
23815 |
/***/ }),
|
23816 |
+
/* 166 */
|
23817 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23818 |
|
23819 |
"use strict";
|
23820 |
/* harmony export (immutable) */ __webpack_exports__["a"] = RawHTML;
|
23821 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
23822 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
23823 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__react__ = __webpack_require__(106);
|
23824 |
|
23825 |
|
23826 |
|
23833 |
*/
|
23834 |
// Disable reason: JSDoc linter doesn't seem to parse the union (`&`) correctly.
|
23835 |
|
|
|
|
|
23836 |
/** @typedef {{children: string} & import('react').ComponentPropsWithoutRef<'div'>} RawHTMLProps */
|
23837 |
|
|
|
|
|
23838 |
/**
|
23839 |
* Component used as equivalent of Fragment with unescaped HTML, in cases where
|
23840 |
* it is desirable to render dangerous HTML without needing a wrapper element.
|
23862 |
//# sourceMappingURL=raw-html.js.map
|
23863 |
|
23864 |
/***/ }),
|
23865 |
+
/* 167 */
|
23866 |
+
/***/ (function(module, exports, __webpack_require__) {
|
23867 |
+
|
23868 |
+
"use strict";
|
23869 |
+
|
23870 |
+
|
23871 |
+
/**
|
23872 |
+
* Internal dependencies;
|
23873 |
+
*/
|
23874 |
+
var isShallowEqualObjects = __webpack_require__( 560 );
|
23875 |
+
var isShallowEqualArrays = __webpack_require__( 561 );
|
23876 |
+
|
23877 |
+
var isArray = Array.isArray;
|
23878 |
+
|
23879 |
+
/**
|
23880 |
+
* @typedef {Record<string, any>} ComparableObject
|
23881 |
+
*/
|
23882 |
+
|
23883 |
+
/**
|
23884 |
+
* Returns true if the two arrays or objects are shallow equal, or false
|
23885 |
+
* otherwise.
|
23886 |
+
*
|
23887 |
+
* @param {any[]|ComparableObject} a First object or array to compare.
|
23888 |
+
* @param {any[]|ComparableObject} b Second object or array to compare.
|
23889 |
+
*
|
23890 |
+
* @return {boolean} Whether the two values are shallow equal.
|
23891 |
+
*/
|
23892 |
+
function isShallowEqual( a, b ) {
|
23893 |
+
if ( a && b ) {
|
23894 |
+
if ( a.constructor === Object && b.constructor === Object ) {
|
23895 |
+
return isShallowEqualObjects( a, b );
|
23896 |
+
} else if ( isArray( a ) && isArray( b ) ) {
|
23897 |
+
return isShallowEqualArrays( a, b );
|
23898 |
+
}
|
23899 |
+
}
|
23900 |
+
|
23901 |
+
return a === b;
|
23902 |
+
}
|
23903 |
+
|
23904 |
+
module.exports = isShallowEqual;
|
23905 |
+
module.exports.isShallowEqualObjects = isShallowEqualObjects;
|
23906 |
+
module.exports.isShallowEqualArrays = isShallowEqualArrays;
|
23907 |
+
|
23908 |
+
|
23909 |
+
/***/ }),
|
23910 |
+
/* 168 */
|
23911 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23912 |
|
23913 |
"use strict";
|
23933 |
* Provides a unique instance ID.
|
23934 |
*
|
23935 |
* @param {Object} object Object reference to create an id for.
|
23936 |
+
* @param {string} prefix Prefix for the unique id.
|
23937 |
*/
|
23938 |
|
23939 |
|
23940 |
+
function useInstanceId(object, prefix) {
|
23941 |
return Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_element__["j" /* useMemo */])(function () {
|
23942 |
+
var id = createId(object);
|
23943 |
+
return prefix ? "".concat(prefix, "-").concat(id) : id;
|
23944 |
}, [object]);
|
23945 |
}
|
23946 |
//# sourceMappingURL=index.js.map
|
23947 |
|
23948 |
/***/ }),
|
23949 |
+
/* 169 */
|
23950 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23951 |
+
|
23952 |
+
"use strict";
|
23953 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = usePrevious;
|
23954 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
23955 |
+
/**
|
23956 |
+
* WordPress dependencies
|
23957 |
+
*/
|
23958 |
+
|
23959 |
+
/**
|
23960 |
+
* Use something's value from the previous render.
|
23961 |
+
* Based on https://usehooks.com/usePrevious/.
|
23962 |
+
*
|
23963 |
+
* @template T
|
23964 |
+
*
|
23965 |
+
* @param {T} value The value to track.
|
23966 |
+
*
|
23967 |
+
* @return {T|undefined} The value from the previous render.
|
23968 |
+
*/
|
23969 |
+
|
23970 |
+
function usePrevious(value) {
|
23971 |
+
// Disable reason: without an explicit type detail, the type of ref will be
|
23972 |
+
// inferred based on the initial useRef argument, which is undefined.
|
23973 |
+
// https://github.com/WordPress/gutenberg/pull/22597#issuecomment-633588366
|
23974 |
+
|
23975 |
+
/* eslint-disable jsdoc/no-undefined-types */
|
23976 |
+
var ref = Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_element__["l" /* useRef */])(
|
23977 |
+
/** @type {T|undefined} */
|
23978 |
+
undefined);
|
23979 |
+
/* eslint-enable jsdoc/no-undefined-types */
|
23980 |
+
// Store current value in ref.
|
23981 |
+
|
23982 |
+
Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_element__["h" /* useEffect */])(function () {
|
23983 |
+
ref.current = value;
|
23984 |
+
}, [value]); // Re-run when value changes.
|
23985 |
+
// Return previous value (happens before update in useEffect above).
|
23986 |
+
|
23987 |
+
return ref.current;
|
23988 |
+
}
|
23989 |
+
//# sourceMappingURL=index.js.map
|
23990 |
+
|
23991 |
+
/***/ }),
|
23992 |
+
/* 170 */
|
23993 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
23994 |
|
23995 |
"use strict";
|
23996 |
/* harmony export (immutable) */ __webpack_exports__["a"] = useSelect;
|
23997 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
23998 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_use_memo_one__ = __webpack_require__(103);
|
23999 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_priority_queue__ = __webpack_require__(102);
|
24000 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_element__ = __webpack_require__(15);
|
24001 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__wordpress_is_shallow_equal__ = __webpack_require__(167);
|
24002 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__wordpress_is_shallow_equal___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4__wordpress_is_shallow_equal__);
|
24003 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__registry_provider_use_registry__ = __webpack_require__(83);
|
24004 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__async_mode_provider_use_async_mode__ = __webpack_require__(172);
|
24005 |
|
24006 |
|
24007 |
/**
|
24181 |
//# sourceMappingURL=index.js.map
|
24182 |
|
24183 |
/***/ }),
|
24184 |
+
/* 171 */
|
24185 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
24186 |
|
24187 |
"use strict";
|
24188 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Context; });
|
24189 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return RegistryConsumer; });
|
24190 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
24191 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__default_registry__ = __webpack_require__(157);
|
24192 |
/**
|
24193 |
* WordPress dependencies
|
24194 |
*/
|
24246 |
//# sourceMappingURL=context.js.map
|
24247 |
|
24248 |
/***/ }),
|
24249 |
+
/* 172 */
|
24250 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
24251 |
|
24252 |
"use strict";
|
24253 |
/* harmony export (immutable) */ __webpack_exports__["a"] = useAsyncMode;
|
24254 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
24255 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__context__ = __webpack_require__(173);
|
24256 |
/**
|
24257 |
* WordPress dependencies
|
24258 |
*/
|
24268 |
//# sourceMappingURL=use-async-mode.js.map
|
24269 |
|
24270 |
/***/ }),
|
24271 |
+
/* 173 */
|
24272 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
24273 |
|
24274 |
"use strict";
|
24322 |
//# sourceMappingURL=context.js.map
|
24323 |
|
24324 |
/***/ }),
|
24325 |
+
/* 174 */
|
24326 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
24327 |
|
24328 |
"use strict";
|
24329 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__use_dispatch__ = __webpack_require__(577);
|
24330 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_0__use_dispatch__["a"]; });
|
24331 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__use_dispatch_with_map__ = __webpack_require__(578);
|
24332 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_1__use_dispatch_with_map__["a"]; });
|
24333 |
|
24334 |
|
24335 |
//# sourceMappingURL=index.js.map
|
24336 |
|
24337 |
/***/ }),
|
24338 |
+
/* 175 */
|
24339 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
24340 |
|
24341 |
"use strict";
|
24342 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__context__ = __webpack_require__(171);
|
24343 |
/* unused harmony reexport RegistryProvider */
|
24344 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_0__context__["b"]; });
|
24345 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__use_registry__ = __webpack_require__(83);
|
24346 |
/* unused harmony reexport useRegistry */
|
24347 |
|
24348 |
|
24349 |
//# sourceMappingURL=index.js.map
|
24350 |
|
24351 |
/***/ }),
|
24352 |
+
/* 176 */
|
24353 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
24354 |
|
24355 |
"use strict";
|
24356 |
/* harmony export (immutable) */ __webpack_exports__["a"] = applyFormat;
|
24357 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
24358 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
24359 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash__ = __webpack_require__(2);
|
24360 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_lodash__);
|
24361 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__normalise_formats__ = __webpack_require__(52);
|
24362 |
|
24363 |
|
24364 |
|
24375 |
*/
|
24376 |
|
24377 |
|
24378 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
24379 |
+
|
24380 |
+
/** @typedef {import('./create').RichTextFormat} RichTextFormat */
|
24381 |
|
24382 |
function replace(array, index, value) {
|
24383 |
array = array.slice();
|
24389 |
* given `endIndex`. Indices are retrieved from the selection if none are
|
24390 |
* provided.
|
24391 |
*
|
24392 |
+
* @param {RichTextValue} value Value to modify.
|
24393 |
+
* @param {RichTextFormat} format Format to apply.
|
24394 |
+
* @param {number} [startIndex] Start index.
|
24395 |
+
* @param {number} [endIndex] End index.
|
24396 |
*
|
24397 |
+
* @return {RichTextValue} A new value with the format applied.
|
24398 |
*/
|
24399 |
|
24400 |
|
24452 |
}
|
24453 |
}
|
24454 |
|
24455 |
+
return Object(__WEBPACK_IMPORTED_MODULE_3__normalise_formats__["a" /* normaliseFormats */])(_objectSpread(_objectSpread({}, value), {}, {
|
24456 |
formats: newFormats,
|
24457 |
// Always revise active formats. This serves as a placeholder for new
|
24458 |
// inputs with the format so new input appears with the format applied,
|
24465 |
//# sourceMappingURL=apply-format.js.map
|
24466 |
|
24467 |
/***/ }),
|
24468 |
+
/* 177 */
|
24469 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
24470 |
|
24471 |
"use strict";
|
24472 |
/* harmony export (immutable) */ __webpack_exports__["a"] = mergePair;
|
24473 |
/* unused harmony export concat */
|
24474 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__normalise_formats__ = __webpack_require__(52);
|
24475 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__create__ = __webpack_require__(53);
|
24476 |
/**
|
24477 |
* Internal dependencies
|
24478 |
*/
|
24479 |
|
24480 |
|
24481 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
24482 |
+
|
24483 |
/**
|
24484 |
* Concats a pair of rich text values. Not that this mutates `a` and does NOT
|
24485 |
* normalise formats!
|
24486 |
*
|
24487 |
+
* @param {Object} a Value to mutate.
|
24488 |
+
* @param {Object} b Value to add read from.
|
24489 |
*
|
24490 |
* @return {Object} `a`, mutated.
|
24491 |
*/
|
24500 |
* Combine all Rich Text values into one. This is similar to
|
24501 |
* `String.prototype.concat`.
|
24502 |
*
|
24503 |
+
* @param {...RichTextValue} values Objects to combine.
|
24504 |
*
|
24505 |
+
* @return {RichTextValue} A new value combining all given records.
|
24506 |
*/
|
24507 |
|
24508 |
function concat() {
|
24515 |
//# sourceMappingURL=concat.js.map
|
24516 |
|
24517 |
/***/ }),
|
24518 |
+
/* 178 */
|
24519 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
24520 |
|
24521 |
"use strict";
|
24522 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getActiveObject;
|
24523 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__special_characters__ = __webpack_require__(30);
|
24524 |
/**
|
24525 |
* Internal dependencies
|
24526 |
*/
|
24527 |
|
24528 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
24529 |
+
|
24530 |
+
/** @typedef {import('./create').RichTextFormat} RichTextFormat */
|
24531 |
+
|
24532 |
/**
|
24533 |
* Gets the active object, if there is any.
|
24534 |
*
|
24535 |
+
* @param {RichTextValue} value Value to inspect.
|
24536 |
*
|
24537 |
+
* @return {RichTextFormat|void} Active object, or undefined.
|
24538 |
*/
|
24539 |
|
24540 |
function getActiveObject(_ref) {
|
24552 |
//# sourceMappingURL=get-active-object.js.map
|
24553 |
|
24554 |
/***/ }),
|
24555 |
+
/* 179 */
|
24556 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
24557 |
|
24558 |
"use strict";
|
24559 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getTextContent;
|
24560 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
24561 |
+
|
24562 |
/**
|
24563 |
* Get the textual content of a Rich Text value. This is similar to
|
24564 |
* `Element.textContent`.
|
24565 |
*
|
24566 |
+
* @param {RichTextValue} value Value to use.
|
24567 |
*
|
24568 |
* @return {string} The text content.
|
24569 |
*/
|
24574 |
//# sourceMappingURL=get-text-content.js.map
|
24575 |
|
24576 |
/***/ }),
|
24577 |
+
/* 180 */
|
24578 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
24579 |
|
24580 |
"use strict";
|
24581 |
/* unused harmony export isEmpty */
|
24582 |
/* harmony export (immutable) */ __webpack_exports__["a"] = isEmptyLine;
|
24583 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__special_characters__ = __webpack_require__(30);
|
24584 |
/**
|
24585 |
* Internal dependencies
|
24586 |
*/
|
24587 |
|
24588 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
24589 |
+
|
24590 |
/**
|
24591 |
* Check if a Rich Text value is Empty, meaning it contains no text or any
|
24592 |
* objects (such as images).
|
24593 |
*
|
24594 |
+
* @param {RichTextValue} value Value to use.
|
24595 |
*
|
24596 |
* @return {boolean} True if the value is empty, false if not.
|
24597 |
*/
|
24604 |
* Check if the current collapsed selection is on an empty line in case of a
|
24605 |
* multiline value.
|
24606 |
*
|
24607 |
+
* @param {RichTextValue} value Value te check.
|
24608 |
*
|
24609 |
* @return {boolean} True if the line is empty, false if not.
|
24610 |
*/
|
24635 |
//# sourceMappingURL=is-empty.js.map
|
24636 |
|
24637 |
/***/ }),
|
24638 |
+
/* 181 */
|
24639 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
24640 |
|
24641 |
"use strict";
|
24642 |
/* harmony export (immutable) */ __webpack_exports__["a"] = replace;
|
24643 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_typeof__ = __webpack_require__(39);
|
24644 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__normalise_formats__ = __webpack_require__(52);
|
24645 |
|
24646 |
|
24647 |
/**
|
24648 |
* Internal dependencies
|
24649 |
*/
|
24650 |
|
24651 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
24652 |
+
|
24653 |
/**
|
24654 |
* Search a Rich Text value and replace the match(es) with `replacement`. This
|
24655 |
* is similar to `String.prototype.replace`.
|
24656 |
*
|
24657 |
+
* @param {RichTextValue} value The value to modify.
|
24658 |
* @param {RegExp|string} pattern A RegExp object or literal. Can also be
|
24659 |
* a string. It is treated as a verbatim
|
24660 |
* string and is not interpreted as a
|
24664 |
* the specified or the value returned by
|
24665 |
* the specified function.
|
24666 |
*
|
24667 |
+
* @return {RichTextValue} A new value with replacements applied.
|
24668 |
*/
|
24669 |
|
24670 |
function replace(_ref, pattern, replacement) {
|
24720 |
//# sourceMappingURL=replace.js.map
|
24721 |
|
24722 |
/***/ }),
|
24723 |
+
/* 182 */
|
24724 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
24725 |
|
24726 |
"use strict";
|
24727 |
/* harmony export (immutable) */ __webpack_exports__["a"] = removeLineSeparator;
|
24728 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
24729 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__special_characters__ = __webpack_require__(30);
|
24730 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__is_collapsed__ = __webpack_require__(113);
|
24731 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__remove__ = __webpack_require__(115);
|
24732 |
|
24733 |
|
24734 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
24741 |
|
24742 |
|
24743 |
|
24744 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
24745 |
+
|
24746 |
/**
|
24747 |
+
* Removes a line separator character, if existing, from a Rich Text value at
|
24748 |
+
* the current indices. If no line separator exists on the indices it will
|
24749 |
+
* return undefined.
|
24750 |
*
|
24751 |
+
* @param {RichTextValue} value Value to modify.
|
24752 |
+
* @param {boolean} backward Indicates if are removing from the start
|
24753 |
+
* index or the end index.
|
24754 |
*
|
24755 |
+
* @return {RichTextValue|undefined} A new value with the line separator
|
24756 |
+
* removed. Or undefined if no line separator
|
24757 |
+
* is found on the position.
|
24758 |
*/
|
24759 |
|
24760 |
function removeLineSeparator(value) {
|
24784 |
if (collapsed && replacements[index] && replacements[index].length) {
|
24785 |
var newReplacements = replacements.slice();
|
24786 |
newReplacements[index] = replacements[index].slice(0, -1);
|
24787 |
+
newValue = _objectSpread(_objectSpread({}, value), {}, {
|
24788 |
replacements: newReplacements
|
24789 |
});
|
24790 |
} else {
|
24796 |
//# sourceMappingURL=remove-line-separator.js.map
|
24797 |
|
24798 |
/***/ }),
|
24799 |
+
/* 183 */
|
24800 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
24801 |
|
24802 |
"use strict";
|
24804 |
/* harmony export (immutable) */ __webpack_exports__["a"] = apply;
|
24805 |
/* unused harmony export applyValue */
|
24806 |
/* unused harmony export applySelection */
|
24807 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
24808 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
24809 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__to_tree__ = __webpack_require__(184);
|
24810 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__create_element__ = __webpack_require__(110);
|
24811 |
|
24812 |
|
24813 |
|
24820 |
*/
|
24821 |
|
24822 |
|
24823 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
24824 |
+
|
24825 |
/**
|
24826 |
* Creates a path as an array of indices from the given root node to the given
|
24827 |
* node.
|
24932 |
var endPath = [];
|
24933 |
|
24934 |
if (prepareEditableTree) {
|
24935 |
+
value = _objectSpread(_objectSpread({}, value), {}, {
|
24936 |
formats: prepareEditableTree(value)
|
24937 |
});
|
24938 |
}
|
24985 |
* the `Element` tree contained by `current`. If a `multilineTag` is provided,
|
24986 |
* text separated by two new lines will be wrapped in an `Element` of that type.
|
24987 |
*
|
24988 |
+
* @param {Object} $1 Named arguments.
|
24989 |
+
* @param {RichTextValue} $1.value Value to apply.
|
24990 |
+
* @param {HTMLElement} $1.current The live root node to apply the element tree to.
|
24991 |
+
* @param {string} [$1.multilineTag] Multiline tag.
|
24992 |
+
* @param {Function} [$1.prepareEditableTree] Function to filter editorable formats.
|
24993 |
+
* @param {boolean} [$1.__unstableDomOnly] Only apply elements, no selection.
|
24994 |
+
* @param {string} [$1.placeholder] Placeholder text.
|
24995 |
*/
|
24996 |
|
24997 |
function apply(_ref5) {
|
25137 |
//# sourceMappingURL=to-dom.js.map
|
25138 |
|
25139 |
/***/ }),
|
25140 |
+
/* 184 */
|
25141 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
25142 |
|
25143 |
"use strict";
|
25144 |
/* harmony export (immutable) */ __webpack_exports__["a"] = toTree;
|
25145 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
25146 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
25147 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__get_active_formats__ = __webpack_require__(112);
|
25148 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__get_format_type__ = __webpack_require__(593);
|
25149 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__special_characters__ = __webpack_require__(30);
|
25150 |
|
25151 |
|
25152 |
|
25192 |
|
25193 |
if (!formatType) {
|
25194 |
if (attributes) {
|
25195 |
+
elementAttributes = _objectSpread(_objectSpread({}, attributes), elementAttributes);
|
25196 |
}
|
25197 |
|
25198 |
return {
|
25202 |
};
|
25203 |
}
|
25204 |
|
25205 |
+
elementAttributes = _objectSpread(_objectSpread({}, unregisteredAttributes), elementAttributes);
|
25206 |
|
25207 |
for (var name in attributes) {
|
25208 |
var key = formatType.attributes ? formatType.attributes[name] : false;
|
25385 |
}
|
25386 |
|
25387 |
if (character === __WEBPACK_IMPORTED_MODULE_4__special_characters__["b" /* OBJECT_REPLACEMENT_CHARACTER */]) {
|
25388 |
+
pointer = append(getParent(pointer), fromFormat(_objectSpread(_objectSpread({}, replacements[i]), {}, {
|
25389 |
object: true
|
25390 |
}))); // Ensure pointer is text node.
|
25391 |
|
25446 |
//# sourceMappingURL=to-tree.js.map
|
25447 |
|
25448 |
/***/ }),
|
25449 |
+
/* 185 */
|
25450 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
25451 |
|
25452 |
"use strict";
|
25453 |
/* harmony export (immutable) */ __webpack_exports__["a"] = toHTMLString;
|
25454 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_escape_html__ = __webpack_require__(77);
|
25455 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__to_tree__ = __webpack_require__(184);
|
25456 |
/**
|
25457 |
* WordPress dependencies
|
25458 |
*/
|
25462 |
*/
|
25463 |
|
25464 |
|
25465 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
25466 |
+
|
25467 |
/**
|
25468 |
* Create an HTML string from a Rich Text value. If a `multilineTag` is
|
25469 |
* provided, text separated by a line separator will be wrapped in it.
|
25470 |
*
|
25471 |
+
* @param {Object} $1 Named argements.
|
25472 |
+
* @param {RichTextValue} $1.value Rich text value.
|
25473 |
+
* @param {string} [$1.multilineTag] Multiline tag.
|
25474 |
+
* @param {boolean} [$1.preserveWhiteSpace] Whether or not to use newline
|
25475 |
+
* characters for line breaks.
|
25476 |
*
|
25477 |
* @return {string} HTML string.
|
25478 |
*/
|
25579 |
//# sourceMappingURL=to-html-string.js.map
|
25580 |
|
25581 |
/***/ }),
|
25582 |
+
/* 186 */
|
25583 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
25584 |
|
25585 |
"use strict";
|
25586 |
/* harmony export (immutable) */ __webpack_exports__["a"] = canIndentListItems;
|
25587 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__get_line_index__ = __webpack_require__(48);
|
25588 |
/**
|
25589 |
* Internal dependencies
|
25590 |
*/
|
25591 |
|
25592 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
25593 |
+
|
25594 |
/**
|
25595 |
* Checks if the selected list item can be indented.
|
25596 |
*
|
25597 |
+
* @param {RichTextValue} value Value to check.
|
25598 |
*
|
25599 |
* @return {boolean} Whether or not the selected list item can be indented.
|
25600 |
*/
|
25617 |
//# sourceMappingURL=can-indent-list-items.js.map
|
25618 |
|
25619 |
/***/ }),
|
25620 |
+
/* 187 */
|
25621 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
25622 |
|
25623 |
"use strict";
|
25624 |
/* harmony export (immutable) */ __webpack_exports__["a"] = canOutdentListItems;
|
25625 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__get_line_index__ = __webpack_require__(48);
|
25626 |
/**
|
25627 |
* Internal dependencies
|
25628 |
*/
|
25629 |
|
25630 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
25631 |
+
|
25632 |
/**
|
25633 |
* Checks if the selected list item can be outdented.
|
25634 |
*
|
25635 |
+
* @param {RichTextValue} value Value to check.
|
25636 |
*
|
25637 |
* @return {boolean} Whether or not the selected list item can be outdented.
|
25638 |
*/
|
25646 |
//# sourceMappingURL=can-outdent-list-items.js.map
|
25647 |
|
25648 |
/***/ }),
|
25649 |
+
/* 188 */
|
25650 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
25651 |
|
25652 |
"use strict";
|
25653 |
/* harmony export (immutable) */ __webpack_exports__["a"] = indentListItems;
|
25654 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
25655 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__special_characters__ = __webpack_require__(30);
|
25656 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__get_line_index__ = __webpack_require__(48);
|
25657 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__can_indent_list_items__ = __webpack_require__(186);
|
25658 |
|
25659 |
|
25660 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
25667 |
|
25668 |
|
25669 |
|
25670 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
25671 |
+
|
25672 |
+
/** @typedef {import('./create').RichTextFormat} RichTextFormat */
|
25673 |
+
|
25674 |
/**
|
25675 |
* Gets the line index of the first previous list item with higher indentation.
|
25676 |
*
|
25677 |
+
* @param {RichTextValue} value Value to search.
|
25678 |
+
* @param {number} lineIndex Line index of the list item to compare
|
25679 |
+
* with.
|
25680 |
*
|
25681 |
+
* @return {number|void} The line index.
|
25682 |
*/
|
25683 |
|
25684 |
function getTargetLevelLineIndex(_ref, lineIndex) {
|
25705 |
/**
|
25706 |
* Indents any selected list items if possible.
|
25707 |
*
|
25708 |
+
* @param {RichTextValue} value Value to change.
|
25709 |
+
* @param {RichTextFormat} rootFormat Root format.
|
25710 |
*
|
25711 |
+
* @return {RichTextValue} The changed value.
|
25712 |
*/
|
25713 |
|
25714 |
|
25743 |
}
|
25744 |
}
|
25745 |
|
25746 |
+
return _objectSpread(_objectSpread({}, value), {}, {
|
25747 |
replacements: newFormats
|
25748 |
});
|
25749 |
}
|
25750 |
//# sourceMappingURL=indent-list-items.js.map
|
25751 |
|
25752 |
/***/ }),
|
25753 |
+
/* 189 */
|
25754 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
25755 |
|
25756 |
"use strict";
|
25757 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getParentLineIndex;
|
25758 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__special_characters__ = __webpack_require__(30);
|
25759 |
/**
|
25760 |
* Internal dependencies
|
25761 |
*/
|
25762 |
|
25763 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
25764 |
+
|
25765 |
/**
|
25766 |
* Gets the index of the first parent list. To get the parent list formats, we
|
25767 |
* go through every list item until we find one with exactly one format type
|
25768 |
* less.
|
25769 |
*
|
25770 |
+
* @param {RichTextValue} value Value to search.
|
25771 |
+
* @param {number} lineIndex Line index of a child list item.
|
25772 |
*
|
25773 |
+
* @return {number|void} The parent list line index.
|
25774 |
*/
|
25775 |
|
25776 |
function getParentLineIndex(_ref, lineIndex) {
|
25794 |
//# sourceMappingURL=get-parent-line-index.js.map
|
25795 |
|
25796 |
/***/ }),
|
25797 |
+
/* 190 */
|
25798 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
25799 |
|
25800 |
"use strict";
|
25801 |
/* harmony export (immutable) */ __webpack_exports__["a"] = FormatEdit;
|
25802 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
25803 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__get_active_format__ = __webpack_require__(111);
|
25804 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__get_active_object__ = __webpack_require__(178);
|
25805 |
|
25806 |
|
25807 |
/**
|
25859 |
//# sourceMappingURL=format-edit.js.map
|
25860 |
|
25861 |
/***/ }),
|
25862 |
+
/* 191 */
|
25863 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
25864 |
|
25865 |
"use strict";
|
25896 |
function isVisible(element) {
|
25897 |
return element.offsetWidth > 0 || element.offsetHeight > 0 || element.getClientRects().length > 0;
|
25898 |
}
|
25899 |
+
/**
|
25900 |
+
* Returns true if the specified element should be skipped from focusable elements.
|
25901 |
+
* For now it rather specific for `iframes` and if tabindex attribute is set to -1.
|
25902 |
+
*
|
25903 |
+
* @param {Element} element DOM element to test.
|
25904 |
+
*
|
25905 |
+
* @return {boolean} Whether element should be skipped from focusable elements.
|
25906 |
+
*/
|
25907 |
+
|
25908 |
+
|
25909 |
+
function skipFocus(element) {
|
25910 |
+
return element.nodeName.toLowerCase() === 'iframe' && element.getAttribute('tabindex') === '-1';
|
25911 |
+
}
|
25912 |
/**
|
25913 |
* Returns true if the specified area element is a valid focusable element, or
|
25914 |
* false otherwise. Area is only focusable if within a map where a named map
|
25927 |
return false;
|
25928 |
}
|
25929 |
|
25930 |
+
var img = element.ownerDocument.querySelector('img[usemap="#' + map.name + '"]');
|
25931 |
return !!img && isVisible(img);
|
25932 |
}
|
25933 |
/**
|
25942 |
function find(context) {
|
25943 |
var elements = context.querySelectorAll(SELECTOR);
|
25944 |
return Array.from(elements).filter(function (element) {
|
25945 |
+
if (!isVisible(element) || skipFocus(element)) {
|
25946 |
return false;
|
25947 |
}
|
25948 |
|
25958 |
//# sourceMappingURL=focusable.js.map
|
25959 |
|
25960 |
/***/ }),
|
25961 |
+
/* 192 */
|
25962 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
25963 |
+
|
25964 |
+
"use strict";
|
25965 |
+
/* unused harmony export getPhrasingContentSchema */
|
25966 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = isPhrasingContent;
|
25967 |
+
/* unused harmony export isTextContent */
|
25968 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
25969 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
25970 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
25971 |
+
|
25972 |
+
|
25973 |
+
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
25974 |
+
|
25975 |
+
function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }
|
25976 |
+
|
25977 |
+
/**
|
25978 |
+
* External dependencies
|
25979 |
+
*/
|
25980 |
+
|
25981 |
+
/**
|
25982 |
+
* All phrasing content elements.
|
25983 |
+
*
|
25984 |
+
* @see https://www.w3.org/TR/2011/WD-html5-20110525/content-models.html#phrasing-content-0
|
25985 |
+
*/
|
25986 |
+
|
25987 |
+
/**
|
25988 |
+
* All text-level semantic elements.
|
25989 |
+
*
|
25990 |
+
* @see https://html.spec.whatwg.org/multipage/text-level-semantics.html
|
25991 |
+
*/
|
25992 |
+
|
25993 |
+
var textContentSchema = {
|
25994 |
+
strong: {},
|
25995 |
+
em: {},
|
25996 |
+
s: {},
|
25997 |
+
del: {},
|
25998 |
+
ins: {},
|
25999 |
+
a: {
|
26000 |
+
attributes: ['href', 'target', 'rel']
|
26001 |
+
},
|
26002 |
+
code: {},
|
26003 |
+
abbr: {
|
26004 |
+
attributes: ['title']
|
26005 |
+
},
|
26006 |
+
sub: {},
|
26007 |
+
sup: {},
|
26008 |
+
br: {},
|
26009 |
+
small: {},
|
26010 |
+
// To do: fix blockquote.
|
26011 |
+
// cite: {},
|
26012 |
+
q: {
|
26013 |
+
attributes: ['cite']
|
26014 |
+
},
|
26015 |
+
dfn: {
|
26016 |
+
attributes: ['title']
|
26017 |
+
},
|
26018 |
+
data: {
|
26019 |
+
attributes: ['value']
|
26020 |
+
},
|
26021 |
+
time: {
|
26022 |
+
attributes: ['datetime']
|
26023 |
+
},
|
26024 |
+
var: {},
|
26025 |
+
samp: {},
|
26026 |
+
kbd: {},
|
26027 |
+
i: {},
|
26028 |
+
b: {},
|
26029 |
+
u: {},
|
26030 |
+
mark: {},
|
26031 |
+
ruby: {},
|
26032 |
+
rt: {},
|
26033 |
+
rp: {},
|
26034 |
+
bdi: {
|
26035 |
+
attributes: ['dir']
|
26036 |
+
},
|
26037 |
+
bdo: {
|
26038 |
+
attributes: ['dir']
|
26039 |
+
},
|
26040 |
+
wbr: {},
|
26041 |
+
'#text': {}
|
26042 |
+
}; // Recursion is needed.
|
26043 |
+
// Possible: strong > em > strong.
|
26044 |
+
// Impossible: strong > strong.
|
26045 |
+
|
26046 |
+
Object(__WEBPACK_IMPORTED_MODULE_1_lodash__["without"])(Object.keys(textContentSchema), '#text', 'br').forEach(function (tag) {
|
26047 |
+
textContentSchema[tag].children = Object(__WEBPACK_IMPORTED_MODULE_1_lodash__["omit"])(textContentSchema, tag);
|
26048 |
+
});
|
26049 |
+
/**
|
26050 |
+
* Embedded content elements.
|
26051 |
+
*
|
26052 |
+
* @see https://www.w3.org/TR/2011/WD-html5-20110525/content-models.html#embedded-content-0
|
26053 |
+
*/
|
26054 |
+
|
26055 |
+
var embeddedContentSchema = {
|
26056 |
+
audio: {
|
26057 |
+
attributes: ['src', 'preload', 'autoplay', 'mediagroup', 'loop', 'muted']
|
26058 |
+
},
|
26059 |
+
canvas: {
|
26060 |
+
attributes: ['width', 'height']
|
26061 |
+
},
|
26062 |
+
embed: {
|
26063 |
+
attributes: ['src', 'type', 'width', 'height']
|
26064 |
+
},
|
26065 |
+
img: {
|
26066 |
+
attributes: ['alt', 'src', 'srcset', 'usemap', 'ismap', 'width', 'height']
|
26067 |
+
},
|
26068 |
+
object: {
|
26069 |
+
attributes: ['data', 'type', 'name', 'usemap', 'form', 'width', 'height']
|
26070 |
+
},
|
26071 |
+
video: {
|
26072 |
+
attributes: ['src', 'poster', 'preload', 'autoplay', 'mediagroup', 'loop', 'muted', 'controls', 'width', 'height']
|
26073 |
+
}
|
26074 |
+
};
|
26075 |
+
/**
|
26076 |
+
* Phrasing content elements.
|
26077 |
+
*
|
26078 |
+
* @see https://www.w3.org/TR/2011/WD-html5-20110525/content-models.html#phrasing-content-0
|
26079 |
+
*/
|
26080 |
+
|
26081 |
+
var phrasingContentSchema = _objectSpread(_objectSpread({}, textContentSchema), embeddedContentSchema);
|
26082 |
+
/**
|
26083 |
+
* Get schema of possible paths for phrasing content.
|
26084 |
+
*
|
26085 |
+
* @see https://developer.mozilla.org/en-US/docs/Web/Guide/HTML/Content_categories#Phrasing_content
|
26086 |
+
*
|
26087 |
+
* @param {string} context Set to "paste" to exclude invisible elements and
|
26088 |
+
* sensitive data.
|
26089 |
+
*
|
26090 |
+
* @return {Object} Schema.
|
26091 |
+
*/
|
26092 |
+
|
26093 |
+
|
26094 |
+
function getPhrasingContentSchema(context) {
|
26095 |
+
if (context !== 'paste') {
|
26096 |
+
return phrasingContentSchema;
|
26097 |
+
}
|
26098 |
+
|
26099 |
+
return Object(__WEBPACK_IMPORTED_MODULE_1_lodash__["omit"])(_objectSpread(_objectSpread({}, phrasingContentSchema), {}, {
|
26100 |
+
// We shouldn't paste potentially sensitive information which is not
|
26101 |
+
// visible to the user when pasted, so strip the attributes.
|
26102 |
+
ins: {
|
26103 |
+
children: phrasingContentSchema.ins.children
|
26104 |
+
},
|
26105 |
+
del: {
|
26106 |
+
children: phrasingContentSchema.del.children
|
26107 |
+
}
|
26108 |
+
}), ['u', // Used to mark misspelling. Shouldn't be pasted.
|
26109 |
+
'abbr', // Invisible.
|
26110 |
+
'data', // Invisible.
|
26111 |
+
'time', // Invisible.
|
26112 |
+
'wbr', // Invisible.
|
26113 |
+
'bdi', // Invisible.
|
26114 |
+
'bdo' // Invisible.
|
26115 |
+
]);
|
26116 |
+
}
|
26117 |
+
/**
|
26118 |
+
* Find out whether or not the given node is phrasing content.
|
26119 |
+
*
|
26120 |
+
* @see https://developer.mozilla.org/en-US/docs/Web/Guide/HTML/Content_categories#Phrasing_content
|
26121 |
+
*
|
26122 |
+
* @param {Element} node The node to test.
|
26123 |
+
*
|
26124 |
+
* @return {boolean} True if phrasing content, false if not.
|
26125 |
+
*/
|
26126 |
+
|
26127 |
+
function isPhrasingContent(node) {
|
26128 |
+
var tag = node.nodeName.toLowerCase();
|
26129 |
+
return getPhrasingContentSchema().hasOwnProperty(tag) || tag === 'span';
|
26130 |
+
}
|
26131 |
+
function isTextContent(node) {
|
26132 |
+
var tag = node.nodeName.toLowerCase();
|
26133 |
+
return textContentSchema.hasOwnProperty(tag) || tag === 'span';
|
26134 |
+
}
|
26135 |
+
//# sourceMappingURL=phrasing-content.js.map
|
26136 |
+
|
26137 |
+
/***/ }),
|
26138 |
+
/* 193 */
|
26139 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
26140 |
|
26141 |
"use strict";
|
26145 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
26146 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
26147 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
26148 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
26149 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(1);
|
26150 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
26151 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
26312 |
//# sourceMappingURL=index.js.map
|
26313 |
|
26314 |
/***/ }),
|
26315 |
+
/* 194 */
|
26316 |
/***/ (function(module, exports, __webpack_require__) {
|
26317 |
|
26318 |
"use strict";
|
26321 |
/**
|
26322 |
* Internal dependencies;
|
26323 |
*/
|
26324 |
+
var isShallowEqualObjects = __webpack_require__( 606 );
|
26325 |
+
var isShallowEqualArrays = __webpack_require__( 607 );
|
26326 |
|
26327 |
var isArray = Array.isArray;
|
26328 |
|
26357 |
|
26358 |
|
26359 |
/***/ }),
|
26360 |
+
/* 195 */
|
26361 |
/***/ (function(module, exports, __webpack_require__) {
|
26362 |
|
26363 |
"use strict";
|
26375 |
|
26376 |
function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
|
26377 |
|
26378 |
+
var hoistNonReactStatic = __webpack_require__(610);
|
26379 |
+
var React = __webpack_require__(9);
|
26380 |
+
var ReactDOM = __webpack_require__(45);
|
26381 |
|
26382 |
module.exports = function enhanceWithClickOutside(WrappedComponent) {
|
26383 |
var componentName = WrappedComponent.displayName || WrappedComponent.name;
|
26440 |
};
|
26441 |
|
26442 |
/***/ }),
|
26443 |
+
/* 196 */
|
26444 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
26445 |
|
26446 |
"use strict";
|
26484 |
//# sourceMappingURL=index.js.map
|
26485 |
|
26486 |
/***/ }),
|
26487 |
+
/* 197 */
|
26488 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
26489 |
|
26490 |
"use strict";
|
26638 |
//# sourceMappingURL=index.js.map
|
26639 |
|
26640 |
/***/ }),
|
26641 |
+
/* 198 */
|
26642 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
26643 |
|
26644 |
"use strict";
|
26645 |
/* unused harmony export createSlotFill */
|
26646 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
26647 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(1);
|
26648 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__slot__ = __webpack_require__(611);
|
26649 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__fill__ = __webpack_require__(612);
|
26650 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__context__ = __webpack_require__(120);
|
26651 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_2__slot__["a"]; });
|
26652 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_3__fill__["a"]; });
|
26653 |
/* unused harmony reexport Provider */
|
26688 |
//# sourceMappingURL=index.js.map
|
26689 |
|
26690 |
/***/ }),
|
26691 |
+
/* 199 */
|
26692 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
26693 |
|
26694 |
"use strict";
|
26695 |
/* unused harmony export setup */
|
26696 |
/* harmony export (immutable) */ __webpack_exports__["a"] = speak;
|
26697 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_dom_ready__ = __webpack_require__(613);
|
26698 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__add_intro_text__ = __webpack_require__(614);
|
26699 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__add_container__ = __webpack_require__(618);
|
26700 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__clear__ = __webpack_require__(619);
|
26701 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__filter_message__ = __webpack_require__(620);
|
26702 |
/**
|
26703 |
* WordPress dependencies
|
26704 |
*/
|
26710 |
|
26711 |
|
26712 |
|
26713 |
+
|
26714 |
/**
|
26715 |
* Create the live regions.
|
26716 |
*/
|
26717 |
|
26718 |
function setup() {
|
26719 |
+
var introText = document.getElementById('a11y-speak-intro-text');
|
26720 |
var containerAssertive = document.getElementById('a11y-speak-assertive');
|
26721 |
var containerPolite = document.getElementById('a11y-speak-polite');
|
26722 |
|
26723 |
+
if (introText === null) {
|
26724 |
+
Object(__WEBPACK_IMPORTED_MODULE_1__add_intro_text__["a" /* default */])();
|
26725 |
+
}
|
26726 |
+
|
26727 |
if (containerAssertive === null) {
|
26728 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__add_container__["a" /* default */])('assertive');
|
26729 |
}
|
26730 |
|
26731 |
if (containerPolite === null) {
|
26732 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__add_container__["a" /* default */])('polite');
|
26733 |
}
|
26734 |
}
|
26735 |
/**
|
26757 |
*/
|
26758 |
|
26759 |
function speak(message, ariaLive) {
|
26760 |
+
/*
|
26761 |
+
* Clear previous messages to allow repeated strings being read out and hide
|
26762 |
+
* the explanatory text from assistive technologies.
|
26763 |
+
*/
|
26764 |
+
Object(__WEBPACK_IMPORTED_MODULE_3__clear__["a" /* default */])();
|
26765 |
+
message = Object(__WEBPACK_IMPORTED_MODULE_4__filter_message__["a" /* default */])(message);
|
26766 |
+
var introText = document.getElementById('a11y-speak-intro-text');
|
26767 |
var containerAssertive = document.getElementById('a11y-speak-assertive');
|
26768 |
var containerPolite = document.getElementById('a11y-speak-polite');
|
26769 |
|
26772 |
} else if (containerPolite) {
|
26773 |
containerPolite.textContent = message;
|
26774 |
}
|
26775 |
+
/*
|
26776 |
+
* Make the explanatory text available to assistive technologies by removing
|
26777 |
+
* the 'hidden' HTML attribute.
|
26778 |
+
*/
|
26779 |
+
|
26780 |
+
|
26781 |
+
if (introText) {
|
26782 |
+
introText.removeAttribute('hidden');
|
26783 |
+
}
|
26784 |
}
|
26785 |
//# sourceMappingURL=index.js.map
|
26786 |
|
26787 |
/***/ }),
|
26788 |
+
/* 200 */
|
26789 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
26790 |
+
|
26791 |
+
"use strict";
|
26792 |
+
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return createI18n; });
|
26793 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
26794 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_tannin__ = __webpack_require__(80);
|
26795 |
+
|
26796 |
+
|
26797 |
+
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
26798 |
+
|
26799 |
+
function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }
|
26800 |
+
|
26801 |
+
/**
|
26802 |
+
* External dependencies
|
26803 |
+
*/
|
26804 |
+
|
26805 |
+
/**
|
26806 |
+
* @typedef {Record<string,any>} LocaleData
|
26807 |
+
*/
|
26808 |
+
|
26809 |
+
/**
|
26810 |
+
* Default locale data to use for Tannin domain when not otherwise provided.
|
26811 |
+
* Assumes an English plural forms expression.
|
26812 |
+
*
|
26813 |
+
* @type {LocaleData}
|
26814 |
+
*/
|
26815 |
+
|
26816 |
+
var DEFAULT_LOCALE_DATA = {
|
26817 |
+
'': {
|
26818 |
+
/** @param {number} n */
|
26819 |
+
plural_forms: function plural_forms(n) {
|
26820 |
+
return n === 1 ? 0 : 1;
|
26821 |
+
}
|
26822 |
+
}
|
26823 |
+
};
|
26824 |
+
/**
|
26825 |
+
* An i18n instance
|
26826 |
+
*
|
26827 |
+
* @typedef {Object} I18n
|
26828 |
+
* @property {Function} setLocaleData Merges locale data into the Tannin instance by domain. Accepts data in a
|
26829 |
+
* Jed-formatted JSON object shape.
|
26830 |
+
* @property {Function} __ Retrieve the translation of text.
|
26831 |
+
* @property {Function} _x Retrieve translated string with gettext context.
|
26832 |
+
* @property {Function} _n Translates and retrieves the singular or plural form based on the supplied
|
26833 |
+
* number.
|
26834 |
+
* @property {Function} _nx Translates and retrieves the singular or plural form based on the supplied
|
26835 |
+
* number, with gettext context.
|
26836 |
+
* @property {Function} isRTL Check if current locale is RTL.
|
26837 |
+
*/
|
26838 |
+
|
26839 |
+
/**
|
26840 |
+
* Create an i18n instance
|
26841 |
+
*
|
26842 |
+
* @param {LocaleData} [initialData] Locale data configuration.
|
26843 |
+
* @param {string} [initialDomain] Domain for which configuration applies.
|
26844 |
+
* @return {I18n} I18n instance
|
26845 |
+
*/
|
26846 |
+
|
26847 |
+
var createI18n = function createI18n(initialData, initialDomain) {
|
26848 |
+
/**
|
26849 |
+
* The underlying instance of Tannin to which exported functions interface.
|
26850 |
+
*
|
26851 |
+
* @type {Tannin}
|
26852 |
+
*/
|
26853 |
+
var tannin = new __WEBPACK_IMPORTED_MODULE_1_tannin__["a" /* default */]({});
|
26854 |
+
/**
|
26855 |
+
* Merges locale data into the Tannin instance by domain. Accepts data in a
|
26856 |
+
* Jed-formatted JSON object shape.
|
26857 |
+
*
|
26858 |
+
* @see http://messageformat.github.io/Jed/
|
26859 |
+
*
|
26860 |
+
* @param {LocaleData} [data] Locale data configuration.
|
26861 |
+
* @param {string} [domain] Domain for which configuration applies.
|
26862 |
+
*/
|
26863 |
+
|
26864 |
+
var setLocaleData = function setLocaleData(data) {
|
26865 |
+
var domain = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'default';
|
26866 |
+
tannin.data[domain] = _objectSpread(_objectSpread(_objectSpread({}, DEFAULT_LOCALE_DATA), tannin.data[domain]), data); // Populate default domain configuration (supported locale date which omits
|
26867 |
+
// a plural forms expression).
|
26868 |
+
|
26869 |
+
tannin.data[domain][''] = _objectSpread(_objectSpread({}, DEFAULT_LOCALE_DATA['']), tannin.data[domain]['']);
|
26870 |
+
};
|
26871 |
+
/**
|
26872 |
+
* Wrapper for Tannin's `dcnpgettext`. Populates default locale data if not
|
26873 |
+
* otherwise previously assigned.
|
26874 |
+
*
|
26875 |
+
* @param {string|undefined} domain Domain to retrieve the translated text.
|
26876 |
+
* @param {string|undefined} context Context information for the translators.
|
26877 |
+
* @param {string} single Text to translate if non-plural. Used as
|
26878 |
+
* fallback return value on a caught error.
|
26879 |
+
* @param {string} [plural] The text to be used if the number is
|
26880 |
+
* plural.
|
26881 |
+
* @param {number} [number] The number to compare against to use
|
26882 |
+
* either the singular or plural form.
|
26883 |
+
*
|
26884 |
+
* @return {string} The translated string.
|
26885 |
+
*/
|
26886 |
+
|
26887 |
+
|
26888 |
+
var dcnpgettext = function dcnpgettext() {
|
26889 |
+
var domain = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 'default';
|
26890 |
+
var context = arguments.length > 1 ? arguments[1] : undefined;
|
26891 |
+
var single = arguments.length > 2 ? arguments[2] : undefined;
|
26892 |
+
var plural = arguments.length > 3 ? arguments[3] : undefined;
|
26893 |
+
var number = arguments.length > 4 ? arguments[4] : undefined;
|
26894 |
+
|
26895 |
+
if (!tannin.data[domain]) {
|
26896 |
+
setLocaleData(undefined, domain);
|
26897 |
+
}
|
26898 |
+
|
26899 |
+
return tannin.dcnpgettext(domain, context, single, plural, number);
|
26900 |
+
};
|
26901 |
+
/**
|
26902 |
+
* Retrieve the translation of text.
|
26903 |
+
*
|
26904 |
+
* @see https://developer.wordpress.org/reference/functions/__/
|
26905 |
+
*
|
26906 |
+
* @param {string} text Text to translate.
|
26907 |
+
* @param {string} [domain] Domain to retrieve the translated text.
|
26908 |
+
*
|
26909 |
+
* @return {string} Translated text.
|
26910 |
+
*/
|
26911 |
+
|
26912 |
+
|
26913 |
+
var __ = function __(text, domain) {
|
26914 |
+
return dcnpgettext(domain, undefined, text);
|
26915 |
+
};
|
26916 |
+
/**
|
26917 |
+
* Retrieve translated string with gettext context.
|
26918 |
+
*
|
26919 |
+
* @see https://developer.wordpress.org/reference/functions/_x/
|
26920 |
+
*
|
26921 |
+
* @param {string} text Text to translate.
|
26922 |
+
* @param {string} context Context information for the translators.
|
26923 |
+
* @param {string} [domain] Domain to retrieve the translated text.
|
26924 |
+
*
|
26925 |
+
* @return {string} Translated context string without pipe.
|
26926 |
+
*/
|
26927 |
+
|
26928 |
+
|
26929 |
+
var _x = function _x(text, context, domain) {
|
26930 |
+
return dcnpgettext(domain, context, text);
|
26931 |
+
};
|
26932 |
+
/**
|
26933 |
+
* Translates and retrieves the singular or plural form based on the supplied
|
26934 |
+
* number.
|
26935 |
+
*
|
26936 |
+
* @see https://developer.wordpress.org/reference/functions/_n/
|
26937 |
+
*
|
26938 |
+
* @param {string} single The text to be used if the number is singular.
|
26939 |
+
* @param {string} plural The text to be used if the number is plural.
|
26940 |
+
* @param {number} number The number to compare against to use either the
|
26941 |
+
* singular or plural form.
|
26942 |
+
* @param {string} [domain] Domain to retrieve the translated text.
|
26943 |
+
*
|
26944 |
+
* @return {string} The translated singular or plural form.
|
26945 |
+
*/
|
26946 |
+
|
26947 |
+
|
26948 |
+
var _n = function _n(single, plural, number, domain) {
|
26949 |
+
return dcnpgettext(domain, undefined, single, plural, number);
|
26950 |
+
};
|
26951 |
+
/**
|
26952 |
+
* Translates and retrieves the singular or plural form based on the supplied
|
26953 |
+
* number, with gettext context.
|
26954 |
+
*
|
26955 |
+
* @see https://developer.wordpress.org/reference/functions/_nx/
|
26956 |
+
*
|
26957 |
+
* @param {string} single The text to be used if the number is singular.
|
26958 |
+
* @param {string} plural The text to be used if the number is plural.
|
26959 |
+
* @param {number} number The number to compare against to use either the
|
26960 |
+
* singular or plural form.
|
26961 |
+
* @param {string} context Context information for the translators.
|
26962 |
+
* @param {string} [domain] Domain to retrieve the translated text.
|
26963 |
+
*
|
26964 |
+
* @return {string} The translated singular or plural form.
|
26965 |
+
*/
|
26966 |
+
|
26967 |
+
|
26968 |
+
var _nx = function _nx(single, plural, number, context, domain) {
|
26969 |
+
return dcnpgettext(domain, context, single, plural, number);
|
26970 |
+
};
|
26971 |
+
/**
|
26972 |
+
* Check if current locale is RTL.
|
26973 |
+
*
|
26974 |
+
* **RTL (Right To Left)** is a locale property indicating that text is written from right to left.
|
26975 |
+
* For example, the `he` locale (for Hebrew) specifies right-to-left. Arabic (ar) is another common
|
26976 |
+
* language written RTL. The opposite of RTL, LTR (Left To Right) is used in other languages,
|
26977 |
+
* including English (`en`, `en-US`, `en-GB`, etc.), Spanish (`es`), and French (`fr`).
|
26978 |
+
*
|
26979 |
+
* @return {boolean} Whether locale is RTL.
|
26980 |
+
*/
|
26981 |
+
|
26982 |
+
|
26983 |
+
var isRTL = function isRTL() {
|
26984 |
+
return 'rtl' === _x('ltr', 'text direction');
|
26985 |
+
};
|
26986 |
+
|
26987 |
+
if (initialData) {
|
26988 |
+
setLocaleData(initialData, initialDomain);
|
26989 |
+
}
|
26990 |
+
|
26991 |
+
return {
|
26992 |
+
setLocaleData: setLocaleData,
|
26993 |
+
__: __,
|
26994 |
+
_x: _x,
|
26995 |
+
_n: _n,
|
26996 |
+
_nx: _nx,
|
26997 |
+
isRTL: isRTL
|
26998 |
+
};
|
26999 |
+
};
|
27000 |
+
//# sourceMappingURL=create-i18n.js.map
|
27001 |
+
|
27002 |
+
/***/ }),
|
27003 |
+
/* 201 */
|
27004 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
27005 |
|
27006 |
"use strict";
|
27010 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
27011 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
27012 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
27013 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
27014 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_element__ = __webpack_require__(1);
|
27015 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_classnames__ = __webpack_require__(14);
|
27016 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_7_classnames__);
|
27017 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
27018 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
27019 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__alpha__ = __webpack_require__(626);
|
27020 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__hue__ = __webpack_require__(628);
|
27021 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__inputs__ = __webpack_require__(629);
|
27022 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__saturation__ = __webpack_require__(630);
|
27023 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__utils__ = __webpack_require__(67);
|
27024 |
|
27025 |
|
27026 |
|
27171 |
//# sourceMappingURL=index.js.map
|
27172 |
|
27173 |
/***/ }),
|
27174 |
+
/* 202 */
|
27175 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
27176 |
|
27177 |
"use strict";
|
27179 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
27180 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(1);
|
27181 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_compose__ = __webpack_require__(18);
|
27182 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__base_control__ = __webpack_require__(42);
|
27183 |
|
27184 |
|
27185 |
|
27230 |
//# sourceMappingURL=index.js.map
|
27231 |
|
27232 |
/***/ }),
|
27233 |
+
/* 203 */
|
27234 |
/***/ (function(module, exports, __webpack_require__) {
|
27235 |
|
27236 |
"use strict";
|
27237 |
|
27238 |
|
27239 |
var slice = Array.prototype.slice;
|
27240 |
+
var isArgs = __webpack_require__(204);
|
27241 |
|
27242 |
var origKeys = Object.keys;
|
27243 |
+
var keysShim = origKeys ? function keys(o) { return origKeys(o); } : __webpack_require__(638);
|
27244 |
|
27245 |
var originalKeys = Object.keys;
|
27246 |
|
27269 |
|
27270 |
|
27271 |
/***/ }),
|
27272 |
+
/* 204 */
|
27273 |
/***/ (function(module, exports, __webpack_require__) {
|
27274 |
|
27275 |
"use strict";
|
27293 |
|
27294 |
|
27295 |
/***/ }),
|
27296 |
+
/* 205 */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27297 |
/***/ (function(module, exports, __webpack_require__) {
|
27298 |
|
27299 |
"use strict";
|
27342 |
|
27343 |
|
27344 |
/***/ }),
|
27345 |
+
/* 206 */
|
27346 |
/***/ (function(module, exports, __webpack_require__) {
|
27347 |
|
27348 |
"use strict";
|
27349 |
|
27350 |
|
27351 |
+
var ArraySpeciesCreate = __webpack_require__(640);
|
27352 |
+
var FlattenIntoArray = __webpack_require__(650);
|
27353 |
+
var Get = __webpack_require__(123);
|
27354 |
+
var ToInteger = __webpack_require__(218);
|
27355 |
+
var ToLength = __webpack_require__(217);
|
27356 |
+
var ToObject = __webpack_require__(668);
|
27357 |
|
27358 |
module.exports = function flat() {
|
27359 |
var O = ToObject(this);
|
27362 |
var depthNum = 1;
|
27363 |
if (arguments.length > 0 && typeof arguments[0] !== 'undefined') {
|
27364 |
depthNum = ToInteger(arguments[0]);
|
27365 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27366 |
|
27367 |
+
var A = ArraySpeciesCreate(O, 0);
|
27368 |
+
FlattenIntoArray(A, O, sourceLen, 0, depthNum);
|
27369 |
+
return A;
|
27370 |
+
};
|
|
|
|
|
27371 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27372 |
|
27373 |
+
/***/ }),
|
27374 |
+
/* 207 */
|
27375 |
+
/***/ (function(module, exports, __webpack_require__) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27376 |
|
27377 |
+
"use strict";
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27378 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27379 |
|
27380 |
+
var GetIntrinsic = __webpack_require__(19);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27381 |
|
27382 |
+
var $defineProperty = GetIntrinsic('%Object.defineProperty%', true);
|
|
|
|
|
|
|
|
|
|
|
|
|
27383 |
|
27384 |
+
if ($defineProperty) {
|
27385 |
+
try {
|
27386 |
+
$defineProperty({}, 'a', { value: 1 });
|
27387 |
+
} catch (e) {
|
27388 |
+
// IE 8 has a broken defineProperty
|
27389 |
+
$defineProperty = null;
|
27390 |
+
}
|
27391 |
}
|
27392 |
|
27393 |
+
var callBound = __webpack_require__(69);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27394 |
|
27395 |
+
var $isEnumerable = callBound('Object.prototype.propertyIsEnumerable');
|
|
|
|
|
27396 |
|
27397 |
+
// eslint-disable-next-line max-params
|
27398 |
+
module.exports = function DefineOwnProperty(IsDataDescriptor, SameValue, FromPropertyDescriptor, O, P, desc) {
|
27399 |
+
if (!$defineProperty) {
|
27400 |
+
if (!IsDataDescriptor(desc)) {
|
27401 |
+
// ES3 does not support getters/setters
|
27402 |
+
return false;
|
27403 |
+
}
|
27404 |
+
if (!desc['[[Configurable]]'] || !desc['[[Writable]]']) {
|
27405 |
+
return false;
|
27406 |
+
}
|
27407 |
|
27408 |
+
// fallback for ES3
|
27409 |
+
if (P in O && $isEnumerable(O, P) !== !!desc['[[Enumerable]]']) {
|
27410 |
+
// a non-enumerable existing property
|
27411 |
+
return false;
|
27412 |
+
}
|
27413 |
|
27414 |
+
// property does not exist at all, or exists but is enumerable
|
27415 |
+
var V = desc['[[Value]]'];
|
27416 |
+
// eslint-disable-next-line no-param-reassign
|
27417 |
+
O[P] = V; // will use [[Define]]
|
27418 |
+
return SameValue(O[P], V);
|
27419 |
+
}
|
27420 |
+
$defineProperty(O, P, FromPropertyDescriptor(desc));
|
27421 |
+
return true;
|
27422 |
+
};
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27423 |
|
27424 |
|
27425 |
/***/ }),
|
27426 |
+
/* 208 */
|
27427 |
/***/ (function(module, exports, __webpack_require__) {
|
27428 |
|
27429 |
"use strict";
|
27430 |
|
27431 |
|
27432 |
+
var assertRecord = __webpack_require__(125);
|
27433 |
|
27434 |
+
var Type = __webpack_require__(35);
|
27435 |
+
|
27436 |
+
// https://www.ecma-international.org/ecma-262/6.0/#sec-frompropertydescriptor
|
27437 |
+
|
27438 |
+
module.exports = function FromPropertyDescriptor(Desc) {
|
27439 |
+
if (typeof Desc === 'undefined') {
|
27440 |
+
return Desc;
|
27441 |
+
}
|
27442 |
+
|
27443 |
+
assertRecord(Type, 'Property Descriptor', 'Desc', Desc);
|
27444 |
+
|
27445 |
+
var obj = {};
|
27446 |
+
if ('[[Value]]' in Desc) {
|
27447 |
+
obj.value = Desc['[[Value]]'];
|
27448 |
+
}
|
27449 |
+
if ('[[Writable]]' in Desc) {
|
27450 |
+
obj.writable = Desc['[[Writable]]'];
|
27451 |
+
}
|
27452 |
+
if ('[[Get]]' in Desc) {
|
27453 |
+
obj.get = Desc['[[Get]]'];
|
27454 |
+
}
|
27455 |
+
if ('[[Set]]' in Desc) {
|
27456 |
+
obj.set = Desc['[[Set]]'];
|
27457 |
+
}
|
27458 |
+
if ('[[Enumerable]]' in Desc) {
|
27459 |
+
obj.enumerable = Desc['[[Enumerable]]'];
|
27460 |
+
}
|
27461 |
+
if ('[[Configurable]]' in Desc) {
|
27462 |
+
obj.configurable = Desc['[[Configurable]]'];
|
27463 |
+
}
|
27464 |
+
return obj;
|
27465 |
+
};
|
27466 |
|
27467 |
|
27468 |
/***/ }),
|
27469 |
+
/* 209 */
|
27470 |
/***/ (function(module, exports, __webpack_require__) {
|
27471 |
|
27472 |
"use strict";
|
27473 |
|
27474 |
|
27475 |
+
var has = __webpack_require__(38);
|
27476 |
|
27477 |
+
var assertRecord = __webpack_require__(125);
|
|
|
27478 |
|
27479 |
+
var Type = __webpack_require__(35);
|
27480 |
+
|
27481 |
+
// https://www.ecma-international.org/ecma-262/6.0/#sec-isdatadescriptor
|
27482 |
+
|
27483 |
+
module.exports = function IsDataDescriptor(Desc) {
|
27484 |
+
if (typeof Desc === 'undefined') {
|
27485 |
+
return false;
|
27486 |
+
}
|
27487 |
+
|
27488 |
+
assertRecord(Type, 'Property Descriptor', 'Desc', Desc);
|
27489 |
+
|
27490 |
+
if (!has(Desc, '[[Value]]') && !has(Desc, '[[Writable]]')) {
|
27491 |
+
return false;
|
27492 |
+
}
|
27493 |
+
|
27494 |
+
return true;
|
27495 |
+
};
|
27496 |
|
27497 |
|
27498 |
/***/ }),
|
27499 |
+
/* 210 */
|
27500 |
/***/ (function(module, exports, __webpack_require__) {
|
27501 |
|
27502 |
"use strict";
|
27503 |
|
27504 |
|
27505 |
+
var $isNaN = __webpack_require__(126);
|
27506 |
|
27507 |
+
// http://www.ecma-international.org/ecma-262/5.1/#sec-9.12
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27508 |
|
27509 |
+
module.exports = function SameValue(x, y) {
|
27510 |
+
if (x === y) { // 0 === -0, but they are not identical.
|
27511 |
+
if (x === 0) { return 1 / x === 1 / y; }
|
|
|
27512 |
return true;
|
|
|
|
|
27513 |
}
|
27514 |
+
return $isNaN(x) && $isNaN(y);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27515 |
};
|
27516 |
|
27517 |
|
27518 |
/***/ }),
|
27519 |
+
/* 211 */
|
27520 |
/***/ (function(module, exports, __webpack_require__) {
|
27521 |
|
27522 |
"use strict";
|
27523 |
|
27524 |
|
27525 |
+
var has = __webpack_require__(38);
|
27526 |
+
|
27527 |
var GetIntrinsic = __webpack_require__(19);
|
27528 |
|
27529 |
var $TypeError = GetIntrinsic('%TypeError%');
|
|
|
27530 |
|
27531 |
+
var Type = __webpack_require__(35);
|
27532 |
+
var ToBoolean = __webpack_require__(212);
|
27533 |
+
var IsCallable = __webpack_require__(648);
|
27534 |
|
27535 |
+
// https://ecma-international.org/ecma-262/5.1/#sec-8.10.5
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27536 |
|
27537 |
+
module.exports = function ToPropertyDescriptor(Obj) {
|
27538 |
+
if (Type(Obj) !== 'Object') {
|
27539 |
+
throw new $TypeError('ToPropertyDescriptor requires an object');
|
27540 |
+
}
|
|
|
27541 |
|
27542 |
+
var desc = {};
|
27543 |
+
if (has(Obj, 'enumerable')) {
|
27544 |
+
desc['[[Enumerable]]'] = ToBoolean(Obj.enumerable);
|
27545 |
+
}
|
27546 |
+
if (has(Obj, 'configurable')) {
|
27547 |
+
desc['[[Configurable]]'] = ToBoolean(Obj.configurable);
|
27548 |
+
}
|
27549 |
+
if (has(Obj, 'value')) {
|
27550 |
+
desc['[[Value]]'] = Obj.value;
|
27551 |
+
}
|
27552 |
+
if (has(Obj, 'writable')) {
|
27553 |
+
desc['[[Writable]]'] = ToBoolean(Obj.writable);
|
27554 |
+
}
|
27555 |
+
if (has(Obj, 'get')) {
|
27556 |
+
var getter = Obj.get;
|
27557 |
+
if (typeof getter !== 'undefined' && !IsCallable(getter)) {
|
27558 |
+
throw new $TypeError('getter must be a function');
|
27559 |
}
|
27560 |
+
desc['[[Get]]'] = getter;
|
27561 |
}
|
27562 |
+
if (has(Obj, 'set')) {
|
27563 |
+
var setter = Obj.set;
|
27564 |
+
if (typeof setter !== 'undefined' && !IsCallable(setter)) {
|
27565 |
+
throw new $TypeError('setter must be a function');
|
27566 |
+
}
|
27567 |
+
desc['[[Set]]'] = setter;
|
27568 |
}
|
27569 |
+
|
27570 |
+
if ((has(desc, '[[Get]]') || has(desc, '[[Set]]')) && (has(desc, '[[Value]]') || has(desc, '[[Writable]]'))) {
|
27571 |
+
throw new $TypeError('Invalid property descriptor. Cannot both specify accessors and a value or writable attribute');
|
27572 |
}
|
27573 |
+
return desc;
|
27574 |
};
|
27575 |
|
27576 |
|
27577 |
/***/ }),
|
27578 |
+
/* 212 */
|
27579 |
/***/ (function(module, exports, __webpack_require__) {
|
27580 |
|
27581 |
"use strict";
|
27582 |
|
27583 |
|
27584 |
+
// http://www.ecma-international.org/ecma-262/5.1/#sec-9.2
|
|
|
|
|
27585 |
|
27586 |
+
module.exports = function ToBoolean(value) { return !!value; };
|
|
|
|
|
|
|
27587 |
|
27588 |
+
|
27589 |
+
/***/ }),
|
27590 |
+
/* 213 */
|
27591 |
+
/***/ (function(module, exports, __webpack_require__) {
|
27592 |
+
|
27593 |
+
"use strict";
|
27594 |
+
|
27595 |
+
|
27596 |
+
var $isNaN = Number.isNaN || function (a) { return a !== a; };
|
27597 |
+
|
27598 |
+
module.exports = Number.isFinite || function (x) { return typeof x === 'number' && !$isNaN(x) && x !== Infinity && x !== -Infinity; };
|
27599 |
+
|
27600 |
+
|
27601 |
+
/***/ }),
|
27602 |
+
/* 214 */
|
27603 |
+
/***/ (function(module, exports, __webpack_require__) {
|
27604 |
+
|
27605 |
+
"use strict";
|
27606 |
+
|
27607 |
+
|
27608 |
+
var GetIntrinsic = __webpack_require__(19);
|
27609 |
+
|
27610 |
+
var $Math = GetIntrinsic('%Math%');
|
27611 |
+
var $Number = GetIntrinsic('%Number%');
|
27612 |
+
|
27613 |
+
module.exports = $Number.MAX_SAFE_INTEGER || $Math.pow(2, 53) - 1;
|
27614 |
+
|
27615 |
+
|
27616 |
+
/***/ }),
|
27617 |
+
/* 215 */
|
27618 |
+
/***/ (function(module, exports, __webpack_require__) {
|
27619 |
+
|
27620 |
+
"use strict";
|
27621 |
+
|
27622 |
+
|
27623 |
+
var hasSymbols = __webpack_require__(43)();
|
27624 |
+
var hasToStringTag = hasSymbols && typeof Symbol.toStringTag === 'symbol';
|
27625 |
+
var hasOwnProperty;
|
27626 |
+
var regexExec;
|
27627 |
+
var isRegexMarker;
|
27628 |
+
var badStringifier;
|
27629 |
+
|
27630 |
+
if (hasToStringTag) {
|
27631 |
+
hasOwnProperty = Function.call.bind(Object.prototype.hasOwnProperty);
|
27632 |
+
regexExec = Function.call.bind(RegExp.prototype.exec);
|
27633 |
+
isRegexMarker = {};
|
27634 |
+
|
27635 |
+
var throwRegexMarker = function () {
|
27636 |
+
throw isRegexMarker;
|
27637 |
+
};
|
27638 |
+
badStringifier = {
|
27639 |
+
toString: throwRegexMarker,
|
27640 |
+
valueOf: throwRegexMarker
|
27641 |
+
};
|
27642 |
+
|
27643 |
+
if (typeof Symbol.toPrimitive === 'symbol') {
|
27644 |
+
badStringifier[Symbol.toPrimitive] = throwRegexMarker;
|
27645 |
}
|
27646 |
+
}
|
27647 |
+
|
27648 |
var toStr = Object.prototype.toString;
|
27649 |
+
var gOPD = Object.getOwnPropertyDescriptor;
|
27650 |
var regexClass = '[object RegExp]';
|
|
|
27651 |
|
27652 |
+
module.exports = hasToStringTag
|
27653 |
+
// eslint-disable-next-line consistent-return
|
27654 |
+
? function isRegex(value) {
|
27655 |
+
if (!value || typeof value !== 'object') {
|
27656 |
+
return false;
|
27657 |
+
}
|
|
|
27658 |
|
27659 |
+
var descriptor = gOPD(value, 'lastIndex');
|
27660 |
+
var hasLastIndexDataProperty = descriptor && hasOwnProperty(descriptor, 'value');
|
27661 |
+
if (!hasLastIndexDataProperty) {
|
27662 |
+
return false;
|
27663 |
+
}
|
27664 |
+
|
27665 |
+
try {
|
27666 |
+
regexExec(value, badStringifier);
|
27667 |
+
} catch (e) {
|
27668 |
+
return e === isRegexMarker;
|
27669 |
+
}
|
27670 |
}
|
27671 |
+
: function isRegex(value) {
|
27672 |
+
// In older browsers, typeof regex incorrectly returns 'function'
|
27673 |
+
if (!value || (typeof value !== 'object' && typeof value !== 'function')) {
|
27674 |
+
return false;
|
27675 |
+
}
|
27676 |
|
27677 |
+
return toStr.call(value) === regexClass;
|
27678 |
+
};
|
27679 |
|
27680 |
|
27681 |
/***/ }),
|
27682 |
+
/* 216 */
|
27683 |
/***/ (function(module, exports, __webpack_require__) {
|
27684 |
|
27685 |
"use strict";
|
27686 |
|
27687 |
|
27688 |
+
module.exports = function isPrimitive(value) {
|
27689 |
+
return value === null || (typeof value !== 'function' && typeof value !== 'object');
|
27690 |
+
};
|
27691 |
|
27692 |
|
27693 |
/***/ }),
|
27694 |
+
/* 217 */
|
27695 |
/***/ (function(module, exports, __webpack_require__) {
|
27696 |
|
27697 |
"use strict";
|
27698 |
|
27699 |
|
27700 |
+
var MAX_SAFE_INTEGER = __webpack_require__(214);
|
27701 |
+
|
27702 |
+
var ToInteger = __webpack_require__(218);
|
27703 |
+
|
27704 |
+
module.exports = function ToLength(argument) {
|
27705 |
+
var len = ToInteger(argument);
|
27706 |
+
if (len <= 0) { return 0; } // includes converting -0 to +0
|
27707 |
+
if (len > MAX_SAFE_INTEGER) { return MAX_SAFE_INTEGER; }
|
27708 |
+
return len;
|
27709 |
};
|
27710 |
|
27711 |
|
27712 |
/***/ }),
|
27713 |
+
/* 218 */
|
27714 |
/***/ (function(module, exports, __webpack_require__) {
|
27715 |
|
27716 |
"use strict";
|
27717 |
|
27718 |
|
27719 |
+
var ES5ToInteger = __webpack_require__(659);
|
27720 |
|
27721 |
+
var ToNumber = __webpack_require__(662);
|
27722 |
|
27723 |
// https://www.ecma-international.org/ecma-262/6.0/#sec-tointeger
|
27724 |
|
27729 |
|
27730 |
|
27731 |
/***/ }),
|
27732 |
+
/* 219 */
|
27733 |
+
/***/ (function(module, exports, __webpack_require__) {
|
27734 |
+
|
27735 |
+
"use strict";
|
27736 |
+
|
27737 |
+
|
27738 |
+
var hasSymbols = typeof Symbol === 'function' && typeof Symbol.iterator === 'symbol';
|
27739 |
+
|
27740 |
+
var isPrimitive = __webpack_require__(665);
|
27741 |
+
var isCallable = __webpack_require__(86);
|
27742 |
+
var isDate = __webpack_require__(666);
|
27743 |
+
var isSymbol = __webpack_require__(220);
|
27744 |
+
|
27745 |
+
var ordinaryToPrimitive = function OrdinaryToPrimitive(O, hint) {
|
27746 |
+
if (typeof O === 'undefined' || O === null) {
|
27747 |
+
throw new TypeError('Cannot call method on ' + O);
|
27748 |
+
}
|
27749 |
+
if (typeof hint !== 'string' || (hint !== 'number' && hint !== 'string')) {
|
27750 |
+
throw new TypeError('hint must be "string" or "number"');
|
27751 |
+
}
|
27752 |
+
var methodNames = hint === 'string' ? ['toString', 'valueOf'] : ['valueOf', 'toString'];
|
27753 |
+
var method, result, i;
|
27754 |
+
for (i = 0; i < methodNames.length; ++i) {
|
27755 |
+
method = O[methodNames[i]];
|
27756 |
+
if (isCallable(method)) {
|
27757 |
+
result = method.call(O);
|
27758 |
+
if (isPrimitive(result)) {
|
27759 |
+
return result;
|
27760 |
+
}
|
27761 |
+
}
|
27762 |
+
}
|
27763 |
+
throw new TypeError('No default value');
|
27764 |
+
};
|
27765 |
+
|
27766 |
+
var GetMethod = function GetMethod(O, P) {
|
27767 |
+
var func = O[P];
|
27768 |
+
if (func !== null && typeof func !== 'undefined') {
|
27769 |
+
if (!isCallable(func)) {
|
27770 |
+
throw new TypeError(func + ' returned for property ' + P + ' of object ' + O + ' is not a function');
|
27771 |
+
}
|
27772 |
+
return func;
|
27773 |
+
}
|
27774 |
+
return void 0;
|
27775 |
+
};
|
27776 |
+
|
27777 |
+
// http://www.ecma-international.org/ecma-262/6.0/#sec-toprimitive
|
27778 |
+
module.exports = function ToPrimitive(input) {
|
27779 |
+
if (isPrimitive(input)) {
|
27780 |
+
return input;
|
27781 |
+
}
|
27782 |
+
var hint = 'default';
|
27783 |
+
if (arguments.length > 1) {
|
27784 |
+
if (arguments[1] === String) {
|
27785 |
+
hint = 'string';
|
27786 |
+
} else if (arguments[1] === Number) {
|
27787 |
+
hint = 'number';
|
27788 |
+
}
|
27789 |
+
}
|
27790 |
+
|
27791 |
+
var exoticToPrim;
|
27792 |
+
if (hasSymbols) {
|
27793 |
+
if (Symbol.toPrimitive) {
|
27794 |
+
exoticToPrim = GetMethod(input, Symbol.toPrimitive);
|
27795 |
+
} else if (isSymbol(input)) {
|
27796 |
+
exoticToPrim = Symbol.prototype.valueOf;
|
27797 |
+
}
|
27798 |
+
}
|
27799 |
+
if (typeof exoticToPrim !== 'undefined') {
|
27800 |
+
var result = exoticToPrim.call(input, hint);
|
27801 |
+
if (isPrimitive(result)) {
|
27802 |
+
return result;
|
27803 |
+
}
|
27804 |
+
throw new TypeError('unable to convert exotic object to primitive');
|
27805 |
+
}
|
27806 |
+
if (hint === 'default' && (isDate(input) || isSymbol(input))) {
|
27807 |
+
hint = 'string';
|
27808 |
+
}
|
27809 |
+
return ordinaryToPrimitive(input, hint === 'default' ? 'number' : hint);
|
27810 |
+
};
|
27811 |
+
|
27812 |
+
|
27813 |
+
/***/ }),
|
27814 |
+
/* 220 */
|
27815 |
/***/ (function(module, exports, __webpack_require__) {
|
27816 |
|
27817 |
"use strict";
|
27818 |
|
27819 |
|
27820 |
var toStr = Object.prototype.toString;
|
27821 |
+
var hasSymbols = __webpack_require__(43)();
|
27822 |
|
27823 |
if (hasSymbols) {
|
27824 |
var symToStr = Symbol.prototype.toString;
|
27853 |
|
27854 |
|
27855 |
/***/ }),
|
27856 |
+
/* 221 */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
27857 |
/***/ (function(module, exports, __webpack_require__) {
|
27858 |
|
27859 |
"use strict";
|
27860 |
|
27861 |
|
27862 |
+
var implementation = __webpack_require__(206);
|
27863 |
|
27864 |
module.exports = function getPolyfill() {
|
27865 |
return Array.prototype.flat || implementation;
|
27867 |
|
27868 |
|
27869 |
/***/ }),
|
27870 |
+
/* 222 */
|
27871 |
/***/ (function(module, exports, __webpack_require__) {
|
27872 |
|
27873 |
"use strict";
|
27978 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
27979 |
|
27980 |
/***/ }),
|
27981 |
+
/* 223 */
|
27982 |
/***/ (function(module, exports, __webpack_require__) {
|
27983 |
|
27984 |
"use strict";
|
28184 |
};
|
28185 |
|
28186 |
/***/ }),
|
28187 |
+
/* 224 */
|
28188 |
/***/ (function(module, exports, __webpack_require__) {
|
28189 |
|
28190 |
//! moment.js locale configuration
|
28271 |
|
28272 |
|
28273 |
/***/ }),
|
28274 |
+
/* 225 */
|
28275 |
/***/ (function(module, exports, __webpack_require__) {
|
28276 |
|
28277 |
//! moment.js locale configuration
|
28289 |
//! moment.js locale configuration
|
28290 |
|
28291 |
var symbolMap = {
|
28292 |
+
1: '١',
|
28293 |
+
2: '٢',
|
28294 |
+
3: '٣',
|
28295 |
+
4: '٤',
|
28296 |
+
5: '٥',
|
28297 |
+
6: '٦',
|
28298 |
+
7: '٧',
|
28299 |
+
8: '٨',
|
28300 |
+
9: '٩',
|
28301 |
+
0: '٠',
|
28302 |
},
|
28303 |
numberMap = {
|
28304 |
'١': '1',
|
28476 |
|
28477 |
|
28478 |
/***/ }),
|
28479 |
+
/* 226 */
|
28480 |
/***/ (function(module, exports, __webpack_require__) {
|
28481 |
|
28482 |
//! moment.js locale configuration
|
28648 |
|
28649 |
|
28650 |
/***/ }),
|
28651 |
+
/* 227 */
|
28652 |
/***/ (function(module, exports, __webpack_require__) {
|
28653 |
|
28654 |
//! moment.js locale configuration
|
28707 |
yy: '%d سنوات',
|
28708 |
},
|
28709 |
week: {
|
28710 |
+
dow: 0, // Sunday is the first day of the week.
|
28711 |
+
doy: 12, // The week that contains Jan 12th is the first week of the year.
|
28712 |
+
},
|
28713 |
+
});
|
28714 |
+
|
28715 |
+
return arKw;
|
28716 |
+
|
28717 |
+
})));
|
28718 |
+
|
28719 |
+
|
28720 |
+
/***/ }),
|
28721 |
+
/* 228 */
|
28722 |
+
/***/ (function(module, exports, __webpack_require__) {
|
28723 |
+
|
28724 |
+
//! moment.js locale configuration
|
28725 |
+
//! locale : Arabic (Lybia) [ar-ly]
|
28726 |
+
//! author : Ali Hmer: https://github.com/kikoanis
|
28727 |
+
|
28728 |
+
;(function (global, factory) {
|
28729 |
+
true ? factory(__webpack_require__(0)) :
|
28730 |
+
typeof define === 'function' && define.amd ? define(['../moment'], factory) :
|
28731 |
+
factory(global.moment)
|
28732 |
+
}(this, (function (moment) { 'use strict';
|
28733 |
+
|
28734 |
+
//! moment.js locale configuration
|
28735 |
+
|
28736 |
+
var symbolMap = {
|
28737 |
+
1: '1',
|
28738 |
+
2: '2',
|
28739 |
+
3: '3',
|
28740 |
+
4: '4',
|
28741 |
+
5: '5',
|
28742 |
+
6: '6',
|
28743 |
+
7: '7',
|
28744 |
+
8: '8',
|
28745 |
+
9: '9',
|
28746 |
+
0: '0',
|
28747 |
+
},
|
28748 |
+
pluralForm = function (n) {
|
28749 |
+
return n === 0
|
28750 |
+
? 0
|
28751 |
+
: n === 1
|
28752 |
+
? 1
|
28753 |
+
: n === 2
|
28754 |
+
? 2
|
28755 |
+
: n % 100 >= 3 && n % 100 <= 10
|
28756 |
+
? 3
|
28757 |
+
: n % 100 >= 11
|
28758 |
+
? 4
|
28759 |
+
: 5;
|
28760 |
+
},
|
28761 |
+
plurals = {
|
28762 |
+
s: [
|
28763 |
+
'أقل من ثانية',
|
28764 |
+
'ثانية واحدة',
|
28765 |
+
['ثانيتان', 'ثانيتين'],
|
28766 |
+
'%d ثوان',
|
28767 |
+
'%d ثانية',
|
28768 |
+
'%d ثانية',
|
28769 |
+
],
|
28770 |
+
m: [
|
28771 |
+
'أقل من دقيقة',
|
28772 |
+
'دقيقة واحدة',
|
28773 |
+
['دقيقتان', 'دقيقتين'],
|
28774 |
+
'%d دقائق',
|
28775 |
+
'%d دقيقة',
|
28776 |
+
'%d دقيقة',
|
28777 |
+
],
|
28778 |
+
h: [
|
28779 |
+
'أقل من ساعة',
|
28780 |
+
'ساعة واحدة',
|
28781 |
+
['ساعتان', 'ساعتين'],
|
28782 |
+
'%d ساعات',
|
28783 |
+
'%d ساعة',
|
28784 |
+
'%d ساعة',
|
28785 |
+
],
|
28786 |
+
d: [
|
28787 |
+
'أقل من يوم',
|
28788 |
+
'يوم واحد',
|
28789 |
+
['يومان', 'يومين'],
|
28790 |
+
'%d أيام',
|
28791 |
+
'%d يومًا',
|
28792 |
+
'%d يوم',
|
28793 |
+
],
|
28794 |
+
M: [
|
28795 |
+
'أقل من شهر',
|
28796 |
+
'شهر واحد',
|
28797 |
+
['شهران', 'شهرين'],
|
28798 |
+
'%d أشهر',
|
28799 |
+
'%d شهرا',
|
28800 |
+
'%d شهر',
|
28801 |
+
],
|
28802 |
+
y: [
|
28803 |
+
'أقل من عام',
|
28804 |
+
'عام واحد',
|
28805 |
+
['عامان', 'عامين'],
|
28806 |
+
'%d أعوام',
|
28807 |
+
'%d عامًا',
|
28808 |
+
'%d عام',
|
28809 |
+
],
|
28810 |
+
},
|
28811 |
+
pluralize = function (u) {
|
28812 |
+
return function (number, withoutSuffix, string, isFuture) {
|
28813 |
+
var f = pluralForm(number),
|
28814 |
+
str = plurals[u][pluralForm(number)];
|
28815 |
+
if (f === 2) {
|
28816 |
+
str = str[withoutSuffix ? 0 : 1];
|
28817 |
+
}
|
28818 |
+
return str.replace(/%d/i, number);
|
28819 |
+
};
|
28820 |
+
},
|
28821 |
+
months = [
|
28822 |
+
'يناير',
|
28823 |
+
'فبراير',
|
28824 |
+
'مارس',
|
28825 |
+
'أبريل',
|
28826 |
+
'مايو',
|
28827 |
+
'يونيو',
|
28828 |
+
'يوليو',
|
28829 |
+
'أغسطس',
|
28830 |
+
'سبتمبر',
|
28831 |
+
'أكتوبر',
|
28832 |
+
'نوفمبر',
|
28833 |
+
'ديسمبر',
|
28834 |
+
];
|
28835 |
+
|
28836 |
+
var arLy = moment.defineLocale('ar-ly', {
|
28837 |
+
months: months,
|
28838 |
+
monthsShort: months,
|
28839 |
+
weekdays: 'الأحد_الإثنين_الثلاثاء_الأربعاء_الخميس_الجمعة_السبت'.split('_'),
|
28840 |
+
weekdaysShort: 'أحد_إثنين_ثلاثاء_أربعاء_خميس_جمعة_سبت'.split('_'),
|
28841 |
+
weekdaysMin: 'ح_ن_ث_ر_خ_ج_س'.split('_'),
|
28842 |
+
weekdaysParseExact: true,
|
28843 |
+
longDateFormat: {
|
28844 |
+
LT: 'HH:mm',
|
28845 |
+
LTS: 'HH:mm:ss',
|
28846 |
+
L: 'D/\u200FM/\u200FYYYY',
|
28847 |
+
LL: 'D MMMM YYYY',
|
28848 |
+
LLL: 'D MMMM YYYY HH:mm',
|
28849 |
+
LLLL: 'dddd D MMMM YYYY HH:mm',
|
28850 |
+
},
|
28851 |
+
meridiemParse: /ص|م/,
|
28852 |
+
isPM: function (input) {
|
28853 |
+
return 'م' === input;
|
28854 |
+
},
|
28855 |
+
meridiem: function (hour, minute, isLower) {
|
28856 |
+
if (hour < 12) {
|
28857 |
+
return 'ص';
|
28858 |
+
} else {
|
28859 |
+
return 'م';
|
28860 |
+
}
|
28861 |
+
},
|
28862 |
+
calendar: {
|
28863 |
+
sameDay: '[اليوم عند الساعة] LT',
|
28864 |
+
nextDay: '[غدًا عند الساعة] LT',
|
28865 |
+
nextWeek: 'dddd [عند الساعة] LT',
|
28866 |
+
lastDay: '[أمس عند الساعة] LT',
|
28867 |
+
lastWeek: 'dddd [عند الساعة] LT',
|
28868 |
+
sameElse: 'L',
|
28869 |
+
},
|
28870 |
+
relativeTime: {
|
28871 |
+
future: 'بعد %s',
|
28872 |
+
past: 'منذ %s',
|
28873 |
+
s: pluralize('s'),
|
28874 |
+
ss: pluralize('s'),
|
28875 |
+
m: pluralize('m'),
|
28876 |
+
mm: pluralize('m'),
|
28877 |
+
h: pluralize('h'),
|
28878 |
+
hh: pluralize('h'),
|
28879 |
+
d: pluralize('d'),
|
28880 |
+
dd: pluralize('d'),
|
28881 |
+
M: pluralize('M'),
|
28882 |
+
MM: pluralize('M'),
|
28883 |
+
y: pluralize('y'),
|
28884 |
+
yy: pluralize('y'),
|
28885 |
+
},
|
28886 |
+
preparse: function (string) {
|
28887 |
+
return string.replace(/،/g, ',');
|
28888 |
+
},
|
28889 |
+
postformat: function (string) {
|
28890 |
+
return string
|
28891 |
+
.replace(/\d/g, function (match) {
|
28892 |
+
return symbolMap[match];
|
28893 |
+
})
|
28894 |
+
.replace(/,/g, '،');
|
28895 |
+
},
|
28896 |
+
week: {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
28897 |
dow: 6, // Saturday is the first day of the week.
|
28898 |
doy: 12, // The week that contains Jan 12th is the first week of the year.
|
28899 |
},
|
28900 |
});
|
28901 |
|
28902 |
+
return arLy;
|
28903 |
+
|
28904 |
+
})));
|
28905 |
+
|
28906 |
+
|
28907 |
+
/***/ }),
|
28908 |
+
/* 229 */
|
28909 |
+
/***/ (function(module, exports, __webpack_require__) {
|
28910 |
+
|
28911 |
+
//! moment.js locale configuration
|
28912 |
+
//! locale : Arabic (Morocco) [ar-ma]
|
28913 |
+
//! author : ElFadili Yassine : https://github.com/ElFadiliY
|
28914 |
+
//! author : Abdel Said : https://github.com/abdelsaid
|
28915 |
+
|
28916 |
+
;(function (global, factory) {
|
28917 |
+
true ? factory(__webpack_require__(0)) :
|
28918 |
+
typeof define === 'function' && define.amd ? define(['../moment'], factory) :
|
28919 |
+
factory(global.moment)
|
28920 |
+
}(this, (function (moment) { 'use strict';
|
28921 |
+
|
28922 |
+
//! moment.js locale configuration
|
28923 |
+
|
28924 |
+
var arMa = moment.defineLocale('ar-ma', {
|
28925 |
+
months: 'يناير_فبراير_مارس_أبريل_ماي_يونيو_يوليوز_غشت_شتنبر_أكتوبر_نونبر_دجنبر'.split(
|
28926 |
+
'_'
|
28927 |
+
),
|
28928 |
+
monthsShort: 'يناير_فبراير_مارس_أبريل_ماي_يونيو_يوليوز_غشت_شتنبر_أكتوبر_نونبر_دجنبر'.split(
|
28929 |
+
'_'
|
28930 |
+
),
|
28931 |
+
weekdays: 'الأحد_الإثنين_الثلاثاء_الأربعاء_الخميس_الجمعة_السبت'.split('_'),
|
28932 |
+
weekdaysShort: 'احد_اثنين_ثلاثاء_اربعاء_خميس_جمعة_سبت'.split('_'),
|
28933 |
+
weekdaysMin: 'ح_ن_ث_ر_خ_ج_س'.split('_'),
|
28934 |
+
weekdaysParseExact: true,
|
28935 |
+
longDateFormat: {
|
28936 |
+
LT: 'HH:mm',
|
28937 |
+
LTS: 'HH:mm:ss',
|
28938 |
+
L: 'DD/MM/YYYY',
|
28939 |
+
LL: 'D MMMM YYYY',
|
28940 |
+
LLL: 'D MMMM YYYY HH:mm',
|
28941 |
+
LLLL: 'dddd D MMMM YYYY HH:mm',
|
28942 |
+
},
|
28943 |
+
calendar: {
|
28944 |
+
sameDay: '[اليوم على الساعة] LT',
|
28945 |
+
nextDay: '[غدا على الساعة] LT',
|
28946 |
+
nextWeek: 'dddd [على الساعة] LT',
|
28947 |
+
lastDay: '[أمس على الساعة] LT',
|
28948 |
+
lastWeek: 'dddd [على الساعة] LT',
|
28949 |
+
sameElse: 'L',
|
28950 |
+
},
|
28951 |
+
relativeTime: {
|
28952 |
+
future: 'في %s',
|
28953 |
+
past: 'منذ %s',
|
28954 |
+
s: 'ثوان',
|
28955 |
+
ss: '%d ثانية',
|
28956 |
+
m: 'دقيقة',
|
28957 |
+
mm: '%d دقائق',
|
28958 |
+
h: 'ساعة',
|
28959 |
+
hh: '%d ساعات',
|
28960 |
+
d: 'يوم',
|
28961 |
+
dd: '%d أيام',
|
28962 |
+
M: 'شهر',
|
28963 |
+
MM: '%d أشهر',
|
28964 |
+
y: 'سنة',
|
28965 |
+
yy: '%d سنوات',
|
28966 |
+
},
|
28967 |
+
week: {
|
28968 |
+
dow: 1, // Monday is the first day of the week.
|
28969 |
+
doy: 4, // The week that contains Jan 4th is the first week of the year.
|
28970 |
+
},
|
28971 |
+
});
|
28972 |
+
|
28973 |
return arMa;
|
28974 |
|
28975 |
})));
|
28976 |
|
28977 |
|
28978 |
/***/ }),
|
28979 |
+
/* 230 */
|
28980 |
/***/ (function(module, exports, __webpack_require__) {
|
28981 |
|
28982 |
//! moment.js locale configuration
|
28992 |
//! moment.js locale configuration
|
28993 |
|
28994 |
var symbolMap = {
|
28995 |
+
1: '١',
|
28996 |
+
2: '٢',
|
28997 |
+
3: '٣',
|
28998 |
+
4: '٤',
|
28999 |
+
5: '٥',
|
29000 |
+
6: '٦',
|
29001 |
+
7: '٧',
|
29002 |
+
8: '٨',
|
29003 |
+
9: '٩',
|
29004 |
+
0: '٠',
|
29005 |
},
|
29006 |
numberMap = {
|
29007 |
'١': '1',
|
29096 |
|
29097 |
|
29098 |
/***/ }),
|
29099 |
+
/* 231 */
|
29100 |
/***/ (function(module, exports, __webpack_require__) {
|
29101 |
|
29102 |
//! moment.js locale configuration
|
29166 |
|
29167 |
|
29168 |
/***/ }),
|
29169 |
+
/* 232 */
|
29170 |
/***/ (function(module, exports, __webpack_require__) {
|
29171 |
|
29172 |
//! moment.js locale configuration
|
29232 |
relativeTime: {
|
29233 |
future: '%s sonra',
|
29234 |
past: '%s əvvəl',
|
29235 |
+
s: 'bir neçə saniyə',
|
29236 |
ss: '%d saniyə',
|
29237 |
m: 'bir dəqiqə',
|
29238 |
mm: '%d dəqiqə',
|
29283 |
|
29284 |
|
29285 |
/***/ }),
|
29286 |
+
/* 233 */
|
29287 |
/***/ (function(module, exports, __webpack_require__) {
|
29288 |
|
29289 |
//! moment.js locale configuration
|
29440 |
|
29441 |
|
29442 |
/***/ }),
|
29443 |
+
/* 234 */
|
29444 |
/***/ (function(module, exports, __webpack_require__) {
|
29445 |
|
29446 |
//! moment.js locale configuration
|
29504 |
hh: '%d часа',
|
29505 |
d: 'ден',
|
29506 |
dd: '%d дена',
|
29507 |
+
w: 'седмица',
|
29508 |
+
ww: '%d седмици',
|
29509 |
M: 'месец',
|
29510 |
MM: '%d месеца',
|
29511 |
y: 'година',
|
29543 |
|
29544 |
|
29545 |
/***/ }),
|
29546 |
+
/* 235 */
|
29547 |
/***/ (function(module, exports, __webpack_require__) {
|
29548 |
|
29549 |
//! moment.js locale configuration
|
29610 |
|
29611 |
|
29612 |
/***/ }),
|
29613 |
+
/* 236 */
|
29614 |
/***/ (function(module, exports, __webpack_require__) {
|
29615 |
|
29616 |
//! moment.js locale configuration
|
29626 |
//! moment.js locale configuration
|
29627 |
|
29628 |
var symbolMap = {
|
29629 |
+
1: '১',
|
29630 |
+
2: '২',
|
29631 |
+
3: '৩',
|
29632 |
+
4: '৪',
|
29633 |
+
5: '৫',
|
29634 |
+
6: '৬',
|
29635 |
+
7: '৭',
|
29636 |
+
8: '৮',
|
29637 |
+
9: '৯',
|
29638 |
+
0: '০',
|
29639 |
},
|
29640 |
numberMap = {
|
29641 |
'১': '1',
|
29744 |
|
29745 |
|
29746 |
/***/ }),
|
29747 |
+
/* 237 */
|
29748 |
+
/***/ (function(module, exports, __webpack_require__) {
|
29749 |
+
|
29750 |
+
//! moment.js locale configuration
|
29751 |
+
//! locale : Bengali (Bangladesh) [bn-bd]
|
29752 |
+
//! author : Asraf Hossain Patoary : https://github.com/ashwoolford
|
29753 |
+
|
29754 |
+
;(function (global, factory) {
|
29755 |
+
true ? factory(__webpack_require__(0)) :
|
29756 |
+
typeof define === 'function' && define.amd ? define(['../moment'], factory) :
|
29757 |
+
factory(global.moment)
|
29758 |
+
}(this, (function (moment) { 'use strict';
|
29759 |
+
|
29760 |
+
//! moment.js locale configuration
|
29761 |
+
|
29762 |
+
var symbolMap = {
|
29763 |
+
1: '১',
|
29764 |
+
2: '২',
|
29765 |
+
3: '৩',
|
29766 |
+
4: '৪',
|
29767 |
+
5: '৫',
|
29768 |
+
6: '৬',
|
29769 |
+
7: '৭',
|
29770 |
+
8: '৮',
|
29771 |
+
9: '৯',
|
29772 |
+
0: '০',
|
29773 |
+
},
|
29774 |
+
numberMap = {
|
29775 |
+
'১': '1',
|
29776 |
+
'২': '2',
|
29777 |
+
'৩': '3',
|
29778 |
+
'৪': '4',
|
29779 |
+
'৫': '5',
|
29780 |
+
'৬': '6',
|
29781 |
+
'৭': '7',
|
29782 |
+
'৮': '8',
|
29783 |
+
'৯': '9',
|
29784 |
+
'০': '0',
|
29785 |
+
};
|
29786 |
+
|
29787 |
+
var bnBd = moment.defineLocale('bn-bd', {
|
29788 |
+
months: 'জানুয়ারি_ফেব্রুয়ারি_মার্চ_এপ্রিল_মে_জুন_জুলাই_আগস্ট_সেপ্টেম্বর_অক্টোবর_নভেম্বর_ডিসেম্বর'.split(
|
29789 |
+
'_'
|
29790 |
+
),
|
29791 |
+
monthsShort: 'জানু_ফেব্রু_মার্চ_এপ্রিল_মে_জুন_জুলাই_আগস্ট_সেপ্ট_অক্টো_নভে_ডিসে'.split(
|
29792 |
+
'_'
|
29793 |
+
),
|
29794 |
+
weekdays: 'রবিবার_সোমবার_মঙ্গলবার_বুধবার_বৃহস্পতিবার_শুক্রবার_শনিবার'.split(
|
29795 |
+
'_'
|
29796 |
+
),
|
29797 |
+
weekdaysShort: 'রবি_সোম_মঙ্গল_বুধ_বৃহস্পতি_শুক্র_শনি'.split('_'),
|
29798 |
+
weekdaysMin: 'রবি_সোম_মঙ্গল_বুধ_বৃহ_শুক্র_শনি'.split('_'),
|
29799 |
+
longDateFormat: {
|
29800 |
+
LT: 'A h:mm সময়',
|
29801 |
+
LTS: 'A h:mm:ss সময়',
|
29802 |
+
L: 'DD/MM/YYYY',
|
29803 |
+
LL: 'D MMMM YYYY',
|
29804 |
+
LLL: 'D MMMM YYYY, A h:mm সময়',
|
29805 |
+
LLLL: 'dddd, D MMMM YYYY, A h:mm সময়',
|
29806 |
+
},
|
29807 |
+
calendar: {
|
29808 |
+
sameDay: '[আজ] LT',
|
29809 |
+
nextDay: '[আগামীকাল] LT',
|
29810 |
+
nextWeek: 'dddd, LT',
|
29811 |
+
lastDay: '[গতকাল] LT',
|
29812 |
+
lastWeek: '[গত] dddd, LT',
|
29813 |
+
sameElse: 'L',
|
29814 |
+
},
|
29815 |
+
relativeTime: {
|
29816 |
+
future: '%s পরে',
|
29817 |
+
past: '%s আগে',
|
29818 |
+
s: 'কয়েক সেকেন্ড',
|
29819 |
+
ss: '%d সেকেন্ড',
|
29820 |
+
m: 'এক মিনিট',
|
29821 |
+
mm: '%d মিনিট',
|
29822 |
+
h: 'এক ঘন্টা',
|
29823 |
+
hh: '%d ঘন্টা',
|
29824 |
+
d: 'এক দিন',
|
29825 |
+
dd: '%d দিন',
|
29826 |
+
M: 'এক মাস',
|
29827 |
+
MM: '%d মাস',
|
29828 |
+
y: 'এক বছর',
|
29829 |
+
yy: '%d বছর',
|
29830 |
+
},
|
29831 |
+
preparse: function (string) {
|
29832 |
+
return string.replace(/[১২৩৪৫৬৭৮৯০]/g, function (match) {
|
29833 |
+
return numberMap[match];
|
29834 |
+
});
|
29835 |
+
},
|
29836 |
+
postformat: function (string) {
|
29837 |
+
return string.replace(/\d/g, function (match) {
|
29838 |
+
return symbolMap[match];
|
29839 |
+
});
|
29840 |
+
},
|
29841 |
+
|
29842 |
+
meridiemParse: /রাত|ভোর|সকাল|দুপুর|বিকাল|সন্ধ্যা|রাত/,
|
29843 |
+
meridiemHour: function (hour, meridiem) {
|
29844 |
+
if (hour === 12) {
|
29845 |
+
hour = 0;
|
29846 |
+
}
|
29847 |
+
if (meridiem === 'রাত') {
|
29848 |
+
return hour < 4 ? hour : hour + 12;
|
29849 |
+
} else if (meridiem === 'ভোর') {
|
29850 |
+
return hour;
|
29851 |
+
} else if (meridiem === 'সকাল') {
|
29852 |
+
return hour;
|
29853 |
+
} else if (meridiem === 'দুপুর') {
|
29854 |
+
return hour >= 3 ? hour : hour + 12;
|
29855 |
+
} else if (meridiem === 'বিকাল') {
|
29856 |
+
return hour + 12;
|
29857 |
+
} else if (meridiem === 'সন্ধ্যা') {
|
29858 |
+
return hour + 12;
|
29859 |
+
}
|
29860 |
+
},
|
29861 |
+
|
29862 |
+
meridiem: function (hour, minute, isLower) {
|
29863 |
+
if (hour < 4) {
|
29864 |
+
return 'রাত';
|
29865 |
+
} else if (hour < 6) {
|
29866 |
+
return 'ভোর';
|
29867 |
+
} else if (hour < 12) {
|
29868 |
+
return 'সকাল';
|
29869 |
+
} else if (hour < 15) {
|
29870 |
+
return 'দুপুর';
|
29871 |
+
} else if (hour < 18) {
|
29872 |
+
return 'বিকাল';
|
29873 |
+
} else if (hour < 20) {
|
29874 |
+
return 'সন্ধ্যা';
|
29875 |
+
} else {
|
29876 |
+
return 'রাত';
|
29877 |
+
}
|
29878 |
+
},
|
29879 |
+
week: {
|
29880 |
+
dow: 0, // Sunday is the first day of the week.
|
29881 |
+
doy: 6, // The week that contains Jan 6th is the first week of the year.
|
29882 |
+
},
|
29883 |
+
});
|
29884 |
+
|
29885 |
+
return bnBd;
|
29886 |
+
|
29887 |
+
})));
|
29888 |
+
|
29889 |
+
|
29890 |
+
/***/ }),
|
29891 |
+
/* 238 */
|
29892 |
/***/ (function(module, exports, __webpack_require__) {
|
29893 |
|
29894 |
//! moment.js locale configuration
|
29904 |
//! moment.js locale configuration
|
29905 |
|
29906 |
var symbolMap = {
|
29907 |
+
1: '༡',
|
29908 |
+
2: '༢',
|
29909 |
+
3: '༣',
|
29910 |
+
4: '༤',
|
29911 |
+
5: '༥',
|
29912 |
+
6: '༦',
|
29913 |
+
7: '༧',
|
29914 |
+
8: '༨',
|
29915 |
+
9: '༩',
|
29916 |
+
0: '༠',
|
29917 |
},
|
29918 |
numberMap = {
|
29919 |
'༡': '1',
|
30026 |
|
30027 |
|
30028 |
/***/ }),
|
30029 |
+
/* 239 */
|
30030 |
/***/ (function(module, exports, __webpack_require__) {
|
30031 |
|
30032 |
//! moment.js locale configuration
|
30207 |
|
30208 |
|
30209 |
/***/ }),
|
30210 |
+
/* 240 */
|
30211 |
/***/ (function(module, exports, __webpack_require__) {
|
30212 |
|
30213 |
//! moment.js locale configuration
|
30372 |
|
30373 |
|
30374 |
/***/ }),
|
30375 |
+
/* 241 */
|
30376 |
/***/ (function(module, exports, __webpack_require__) {
|
30377 |
|
30378 |
//! moment.js locale configuration
|
30485 |
|
30486 |
|
30487 |
/***/ }),
|
30488 |
+
/* 242 */
|
30489 |
/***/ (function(module, exports, __webpack_require__) {
|
30490 |
|
30491 |
//! moment.js locale configuration
|
30672 |
|
30673 |
|
30674 |
/***/ }),
|
30675 |
+
/* 243 */
|
30676 |
/***/ (function(module, exports, __webpack_require__) {
|
30677 |
|
30678 |
//! moment.js locale configuration
|
30750 |
|
30751 |
|
30752 |
/***/ }),
|
30753 |
+
/* 244 */
|
30754 |
/***/ (function(module, exports, __webpack_require__) {
|
30755 |
|
30756 |
//! moment.js locale configuration
|
30863 |
|
30864 |
|
30865 |
/***/ }),
|
30866 |
+
/* 245 */
|
30867 |
/***/ (function(module, exports, __webpack_require__) {
|
30868 |
|
30869 |
//! moment.js locale configuration
|
30932 |
|
30933 |
|
30934 |
/***/ }),
|
30935 |
+
/* 246 */
|
30936 |
/***/ (function(module, exports, __webpack_require__) {
|
30937 |
|
30938 |
//! moment.js locale configuration
|
30955 |
h: ['eine Stunde', 'einer Stunde'],
|
30956 |
d: ['ein Tag', 'einem Tag'],
|
30957 |
dd: [number + ' Tage', number + ' Tagen'],
|
30958 |
+
w: ['eine Woche', 'einer Woche'],
|
30959 |
M: ['ein Monat', 'einem Monat'],
|
30960 |
MM: [number + ' Monate', number + ' Monaten'],
|
30961 |
y: ['ein Jahr', 'einem Jahr'],
|
31005 |
hh: '%d Stunden',
|
31006 |
d: processRelativeTime,
|
31007 |
dd: processRelativeTime,
|
31008 |
+
w: processRelativeTime,
|
31009 |
+
ww: '%d Wochen',
|
31010 |
M: processRelativeTime,
|
31011 |
MM: processRelativeTime,
|
31012 |
y: processRelativeTime,
|
31026 |
|
31027 |
|
31028 |
/***/ }),
|
31029 |
+
/* 247 */
|
31030 |
/***/ (function(module, exports, __webpack_require__) {
|
31031 |
|
31032 |
//! moment.js locale configuration
|
31050 |
h: ['eine Stunde', 'einer Stunde'],
|
31051 |
d: ['ein Tag', 'einem Tag'],
|
31052 |
dd: [number + ' Tage', number + ' Tagen'],
|
31053 |
+
w: ['eine Woche', 'einer Woche'],
|
31054 |
M: ['ein Monat', 'einem Monat'],
|
31055 |
MM: [number + ' Monate', number + ' Monaten'],
|
31056 |
y: ['ein Jahr', 'einem Jahr'],
|
31100 |
hh: '%d Stunden',
|
31101 |
d: processRelativeTime,
|
31102 |
dd: processRelativeTime,
|
31103 |
+
w: processRelativeTime,
|
31104 |
+
ww: '%d Wochen',
|
31105 |
M: processRelativeTime,
|
31106 |
MM: processRelativeTime,
|
31107 |
y: processRelativeTime,
|
31121 |
|
31122 |
|
31123 |
/***/ }),
|
31124 |
+
/* 248 */
|
31125 |
/***/ (function(module, exports, __webpack_require__) {
|
31126 |
|
31127 |
//! moment.js locale configuration
|
31142 |
h: ['eine Stunde', 'einer Stunde'],
|
31143 |
d: ['ein Tag', 'einem Tag'],
|
31144 |
dd: [number + ' Tage', number + ' Tagen'],
|
31145 |
+
w: ['eine Woche', 'einer Woche'],
|
31146 |
M: ['ein Monat', 'einem Monat'],
|
31147 |
MM: [number + ' Monate', number + ' Monaten'],
|
31148 |
y: ['ein Jahr', 'einem Jahr'],
|
31192 |
hh: '%d Stunden',
|
31193 |
d: processRelativeTime,
|
31194 |
dd: processRelativeTime,
|
31195 |
+
w: processRelativeTime,
|
31196 |
+
ww: '%d Wochen',
|
31197 |
M: processRelativeTime,
|
31198 |
MM: processRelativeTime,
|
31199 |
y: processRelativeTime,
|
31213 |
|
31214 |
|
31215 |
/***/ }),
|
31216 |
+
/* 249 */
|
31217 |
/***/ (function(module, exports, __webpack_require__) {
|
31218 |
|
31219 |
//! moment.js locale configuration
|
31319 |
|
31320 |
|
31321 |
/***/ }),
|
31322 |
+
/* 250 */
|
31323 |
/***/ (function(module, exports, __webpack_require__) {
|
31324 |
|
31325 |
//! moment.js locale configuration
|
31439 |
|
31440 |
|
31441 |
/***/ }),
|
31442 |
+
/* 251 */
|
31443 |
/***/ (function(module, exports, __webpack_require__) {
|
31444 |
|
31445 |
//! moment.js locale configuration
|
31523 |
|
31524 |
|
31525 |
/***/ }),
|
31526 |
+
/* 252 */
|
31527 |
/***/ (function(module, exports, __webpack_require__) {
|
31528 |
|
31529 |
//! moment.js locale configuration
|
31603 |
|
31604 |
|
31605 |
/***/ }),
|
31606 |
+
/* 253 */
|
31607 |
/***/ (function(module, exports, __webpack_require__) {
|
31608 |
|
31609 |
//! moment.js locale configuration
|
31687 |
|
31688 |
|
31689 |
/***/ }),
|
31690 |
+
/* 254 */
|
31691 |
/***/ (function(module, exports, __webpack_require__) {
|
31692 |
|
31693 |
//! moment.js locale configuration
|
31771 |
|
31772 |
|
31773 |
/***/ }),
|
31774 |
+
/* 255 */
|
31775 |
/***/ (function(module, exports, __webpack_require__) {
|
31776 |
|
31777 |
//! moment.js locale configuration
|
31851 |
|
31852 |
|
31853 |
/***/ }),
|
31854 |
+
/* 256 */
|
31855 |
/***/ (function(module, exports, __webpack_require__) {
|
31856 |
|
31857 |
//! moment.js locale configuration
|
31935 |
|
31936 |
|
31937 |
/***/ }),
|
31938 |
+
/* 257 */
|
31939 |
/***/ (function(module, exports, __webpack_require__) {
|
31940 |
|
31941 |
//! moment.js locale configuration
|
32019 |
|
32020 |
|
32021 |
/***/ }),
|
32022 |
+
/* 258 */
|
32023 |
/***/ (function(module, exports, __webpack_require__) {
|
32024 |
|
32025 |
//! moment.js locale configuration
|
32103 |
|
32104 |
|
32105 |
/***/ }),
|
32106 |
+
/* 259 */
|
32107 |
/***/ (function(module, exports, __webpack_require__) {
|
32108 |
|
32109 |
//! moment.js locale configuration
|
32187 |
|
32188 |
|
32189 |
/***/ }),
|
32190 |
+
/* 260 */
|
32191 |
/***/ (function(module, exports, __webpack_require__) {
|
32192 |
|
32193 |
//! moment.js locale configuration
|
32287 |
hh: '%d horas',
|
32288 |
d: 'un día',
|
32289 |
dd: '%d días',
|
32290 |
+
w: 'una semana',
|
32291 |
+
ww: '%d semanas',
|
32292 |
M: 'un mes',
|
32293 |
MM: '%d meses',
|
32294 |
y: 'un año',
|
32300 |
dow: 1, // Monday is the first day of the week.
|
32301 |
doy: 4, // The week that contains Jan 4th is the first week of the year.
|
32302 |
},
|
32303 |
+
invalidDate: 'Fecha inválida',
|
32304 |
});
|
32305 |
|
32306 |
return es;
|
32309 |
|
32310 |
|
32311 |
/***/ }),
|
32312 |
+
/* 261 */
|
32313 |
/***/ (function(module, exports, __webpack_require__) {
|
32314 |
|
32315 |
//! moment.js locale configuration
|
32408 |
hh: '%d horas',
|
32409 |
d: 'un día',
|
32410 |
dd: '%d días',
|
32411 |
+
w: 'una semana',
|
32412 |
+
ww: '%d semanas',
|
32413 |
M: 'un mes',
|
32414 |
MM: '%d meses',
|
32415 |
y: 'un año',
|
32429 |
|
32430 |
|
32431 |
/***/ }),
|
32432 |
+
/* 262 */
|
32433 |
+
/***/ (function(module, exports, __webpack_require__) {
|
32434 |
+
|
32435 |
+
//! moment.js locale configuration
|
32436 |
+
//! locale : Spanish (Mexico) [es-mx]
|
32437 |
+
//! author : JC Franco : https://github.com/jcfranco
|
32438 |
+
|
32439 |
+
;(function (global, factory) {
|
32440 |
+
true ? factory(__webpack_require__(0)) :
|
32441 |
+
typeof define === 'function' && define.amd ? define(['../moment'], factory) :
|
32442 |
+
factory(global.moment)
|
32443 |
+
}(this, (function (moment) { 'use strict';
|
32444 |
+
|
32445 |
+
//! moment.js locale configuration
|
32446 |
+
|
32447 |
+
var monthsShortDot = 'ene._feb._mar._abr._may._jun._jul._ago._sep._oct._nov._dic.'.split(
|
32448 |
+
'_'
|
32449 |
+
),
|
32450 |
+
monthsShort = 'ene_feb_mar_abr_may_jun_jul_ago_sep_oct_nov_dic'.split('_'),
|
32451 |
+
monthsParse = [
|
32452 |
+
/^ene/i,
|
32453 |
+
/^feb/i,
|
32454 |
+
/^mar/i,
|
32455 |
+
/^abr/i,
|
32456 |
+
/^may/i,
|
32457 |
+
/^jun/i,
|
32458 |
+
/^jul/i,
|
32459 |
+
/^ago/i,
|
32460 |
+
/^sep/i,
|
32461 |
+
/^oct/i,
|
32462 |
+
/^nov/i,
|
32463 |
+
/^dic/i,
|
32464 |
+
],
|
32465 |
+
monthsRegex = /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre|ene\.?|feb\.?|mar\.?|abr\.?|may\.?|jun\.?|jul\.?|ago\.?|sep\.?|oct\.?|nov\.?|dic\.?)/i;
|
32466 |
+
|
32467 |
+
var esMx = moment.defineLocale('es-mx', {
|
32468 |
+
months: 'enero_febrero_marzo_abril_mayo_junio_julio_agosto_septiembre_octubre_noviembre_diciembre'.split(
|
32469 |
+
'_'
|
32470 |
+
),
|
32471 |
+
monthsShort: function (m, format) {
|
32472 |
+
if (!m) {
|
32473 |
+
return monthsShortDot;
|
32474 |
+
} else if (/-MMM-/.test(format)) {
|
32475 |
+
return monthsShort[m.month()];
|
32476 |
+
} else {
|
32477 |
+
return monthsShortDot[m.month()];
|
32478 |
+
}
|
32479 |
+
},
|
32480 |
+
monthsRegex: monthsRegex,
|
32481 |
+
monthsShortRegex: monthsRegex,
|
32482 |
+
monthsStrictRegex: /^(enero|febrero|marzo|abril|mayo|junio|julio|agosto|septiembre|octubre|noviembre|diciembre)/i,
|
32483 |
+
monthsShortStrictRegex: /^(ene\.?|feb\.?|mar\.?|abr\.?|may\.?|jun\.?|jul\.?|ago\.?|sep\.?|oct\.?|nov\.?|dic\.?)/i,
|
32484 |
+
monthsParse: monthsParse,
|
32485 |
+
longMonthsParse: monthsParse,
|
32486 |
+
shortMonthsParse: monthsParse,
|
32487 |
+
weekdays: 'domingo_lunes_martes_miércoles_jueves_viernes_sábado'.split('_'),
|
32488 |
+
weekdaysShort: 'dom._lun._mar._mié._jue._vie._sáb.'.split('_'),
|
32489 |
+
weekdaysMin: 'do_lu_ma_mi_ju_vi_sá'.split('_'),
|
32490 |
+
weekdaysParseExact: true,
|
32491 |
+
longDateFormat: {
|
32492 |
+
LT: 'H:mm',
|
32493 |
+
LTS: 'H:mm:ss',
|
32494 |
+
L: 'DD/MM/YYYY',
|
32495 |
+
LL: 'D [de] MMMM [de] YYYY',
|
32496 |
+
LLL: 'D [de] MMMM [de] YYYY H:mm',
|
32497 |
+
LLLL: 'dddd, D [de] MMMM [de] YYYY H:mm',
|
32498 |
+
},
|
32499 |
+
calendar: {
|
32500 |
+
sameDay: function () {
|
32501 |
+
return '[hoy a la' + (this.hours() !== 1 ? 's' : '') + '] LT';
|
32502 |
+
},
|
32503 |
+
nextDay: function () {
|
32504 |
+
return '[mañana a la' + (this.hours() !== 1 ? 's' : '') + '] LT';
|
32505 |
+
},
|
32506 |
+
nextWeek: function () {
|
32507 |
+
return 'dddd [a la' + (this.hours() !== 1 ? 's' : '') + '] LT';
|
32508 |
+
},
|
32509 |
+
lastDay: function () {
|
32510 |
+
return '[ayer a la' + (this.hours() !== 1 ? 's' : '') + '] LT';
|
32511 |
+
},
|
32512 |
+
lastWeek: function () {
|
32513 |
+
return (
|
32514 |
+
'[el] dddd [pasado a la' +
|
32515 |
+
(this.hours() !== 1 ? 's' : '') +
|
32516 |
+
'] LT'
|
32517 |
+
);
|
32518 |
+
},
|
32519 |
+
sameElse: 'L',
|
32520 |
+
},
|
32521 |
+
relativeTime: {
|
32522 |
+
future: 'en %s',
|
32523 |
+
past: 'hace %s',
|
32524 |
+
s: 'unos segundos',
|
32525 |
+
ss: '%d segundos',
|
32526 |
+
m: 'un minuto',
|
32527 |
+
mm: '%d minutos',
|
32528 |
+
h: 'una hora',
|
32529 |
+
hh: '%d horas',
|
32530 |
+
d: 'un día',
|
32531 |
+
dd: '%d días',
|
32532 |
+
w: 'una semana',
|
32533 |
+
ww: '%d semanas',
|
32534 |
+
M: 'un mes',
|
32535 |
+
MM: '%d meses',
|
32536 |
+
y: 'un año',
|
32537 |
+
yy: '%d años',
|
32538 |
+
},
|
32539 |
+
dayOfMonthOrdinalParse: /\d{1,2}º/,
|
32540 |
+
ordinal: '%dº',
|
32541 |
+
week: {
|
32542 |
+
dow: 0, // Sunday is the first day of the week.
|
32543 |
+
doy: 4, // The week that contains Jan 4th is the first week of the year.
|
32544 |
+
},
|
32545 |
+
invalidDate: 'Fecha inválida',
|
32546 |
+
});
|
32547 |
+
|
32548 |
+
return esMx;
|
32549 |
+
|
32550 |
+
})));
|
32551 |
+
|
32552 |
+
|
32553 |
+
/***/ }),
|
32554 |
+
/* 263 */
|
32555 |
/***/ (function(module, exports, __webpack_require__) {
|
32556 |
|
32557 |
//! moment.js locale configuration
|
32652 |
hh: '%d horas',
|
32653 |
d: 'un día',
|
32654 |
dd: '%d días',
|
32655 |
+
w: 'una semana',
|
32656 |
+
ww: '%d semanas',
|
32657 |
M: 'un mes',
|
32658 |
MM: '%d meses',
|
32659 |
y: 'un año',
|
32673 |
|
32674 |
|
32675 |
/***/ }),
|
32676 |
+
/* 264 */
|
32677 |
/***/ (function(module, exports, __webpack_require__) {
|
32678 |
|
32679 |
//! moment.js locale configuration
|
32767 |
|
32768 |
|
32769 |
/***/ }),
|
32770 |
+
/* 265 */
|
32771 |
/***/ (function(module, exports, __webpack_require__) {
|
32772 |
|
32773 |
//! moment.js locale configuration
|
32846 |
|
32847 |
|
32848 |
/***/ }),
|
32849 |
+
/* 266 */
|
32850 |
/***/ (function(module, exports, __webpack_require__) {
|
32851 |
|
32852 |
//! moment.js locale configuration
|
32862 |
//! moment.js locale configuration
|
32863 |
|
32864 |
var symbolMap = {
|
32865 |
+
1: '۱',
|
32866 |
+
2: '۲',
|
32867 |
+
3: '۳',
|
32868 |
+
4: '۴',
|
32869 |
+
5: '۵',
|
32870 |
+
6: '۶',
|
32871 |
+
7: '۷',
|
32872 |
+
8: '۸',
|
32873 |
+
9: '۹',
|
32874 |
+
0: '۰',
|
32875 |
},
|
32876 |
numberMap = {
|
32877 |
'۱': '1',
|
32972 |
|
32973 |
|
32974 |
/***/ }),
|
32975 |
+
/* 267 */
|
32976 |
/***/ (function(module, exports, __webpack_require__) {
|
32977 |
|
32978 |
//! moment.js locale configuration
|
33008 |
case 's':
|
33009 |
return isFuture ? 'muutaman sekunnin' : 'muutama sekunti';
|
33010 |
case 'ss':
|
33011 |
+
result = isFuture ? 'sekunnin' : 'sekuntia';
|
33012 |
+
break;
|
33013 |
case 'm':
|
33014 |
return isFuture ? 'minuutin' : 'minuutti';
|
33015 |
case 'mm':
|
33109 |
|
33110 |
|
33111 |
/***/ }),
|
33112 |
+
/* 268 */
|
33113 |
/***/ (function(module, exports, __webpack_require__) {
|
33114 |
|
33115 |
//! moment.js locale configuration
|
33183 |
|
33184 |
|
33185 |
/***/ }),
|
33186 |
+
/* 269 */
|
33187 |
/***/ (function(module, exports, __webpack_require__) {
|
33188 |
|
33189 |
//! moment.js locale configuration
|
33255 |
|
33256 |
|
33257 |
/***/ }),
|
33258 |
+
/* 270 */
|
33259 |
/***/ (function(module, exports, __webpack_require__) {
|
33260 |
|
33261 |
//! moment.js locale configuration
|
33270 |
|
33271 |
//! moment.js locale configuration
|
33272 |
|
33273 |
+
var monthsStrictRegex = /^(janvier|février|mars|avril|mai|juin|juillet|août|septembre|octobre|novembre|décembre)/i,
|
33274 |
+
monthsShortStrictRegex = /(janv\.?|févr\.?|mars|avr\.?|mai|juin|juil\.?|août|sept\.?|oct\.?|nov\.?|déc\.?)/i,
|
33275 |
+
monthsRegex = /(janv\.?|févr\.?|mars|avr\.?|mai|juin|juil\.?|août|sept\.?|oct\.?|nov\.?|déc\.?|janvier|février|mars|avril|mai|juin|juillet|août|septembre|octobre|novembre|décembre)/i,
|
33276 |
+
monthsParse = [
|
33277 |
+
/^janv/i,
|
33278 |
+
/^févr/i,
|
33279 |
+
/^mars/i,
|
33280 |
+
/^avr/i,
|
33281 |
+
/^mai/i,
|
33282 |
+
/^juin/i,
|
33283 |
+
/^juil/i,
|
33284 |
+
/^août/i,
|
33285 |
+
/^sept/i,
|
33286 |
+
/^oct/i,
|
33287 |
+
/^nov/i,
|
33288 |
+
/^déc/i,
|
33289 |
+
];
|
33290 |
+
|
33291 |
var fr = moment.defineLocale('fr', {
|
33292 |
months: 'janvier_février_mars_avril_mai_juin_juillet_août_septembre_octobre_novembre_décembre'.split(
|
33293 |
'_'
|
33295 |
monthsShort: 'janv._févr._mars_avr._mai_juin_juil._août_sept._oct._nov._déc.'.split(
|
33296 |
'_'
|
33297 |
),
|
33298 |
+
monthsRegex: monthsRegex,
|
33299 |
+
monthsShortRegex: monthsRegex,
|
33300 |
+
monthsStrictRegex: monthsStrictRegex,
|
33301 |
+
monthsShortStrictRegex: monthsShortStrictRegex,
|
33302 |
+
monthsParse: monthsParse,
|
33303 |
+
longMonthsParse: monthsParse,
|
33304 |
+
shortMonthsParse: monthsParse,
|
33305 |
weekdays: 'dimanche_lundi_mardi_mercredi_jeudi_vendredi_samedi'.split('_'),
|
33306 |
weekdaysShort: 'dim._lun._mar._mer._jeu._ven._sam.'.split('_'),
|
33307 |
weekdaysMin: 'di_lu_ma_me_je_ve_sa'.split('_'),
|
33333 |
hh: '%d heures',
|
33334 |
d: 'un jour',
|
33335 |
dd: '%d jours',
|
33336 |
+
w: 'une semaine',
|
33337 |
+
ww: '%d semaines',
|
33338 |
M: 'un mois',
|
33339 |
MM: '%d mois',
|
33340 |
y: 'un an',
|
33375 |
|
33376 |
|
33377 |
/***/ }),
|
33378 |
+
/* 271 */
|
33379 |
/***/ (function(module, exports, __webpack_require__) {
|
33380 |
|
33381 |
//! moment.js locale configuration
|
33460 |
|
33461 |
|
33462 |
/***/ }),
|
33463 |
+
/* 272 */
|
33464 |
/***/ (function(module, exports, __webpack_require__) {
|
33465 |
|
33466 |
//! moment.js locale configuration
|
33549 |
|
33550 |
|
33551 |
/***/ }),
|
33552 |
+
/* 273 */
|
33553 |
/***/ (function(module, exports, __webpack_require__) {
|
33554 |
|
33555 |
//! moment.js locale configuration
|
33642 |
|
33643 |
|
33644 |
/***/ }),
|
33645 |
+
/* 274 */
|
33646 |
/***/ (function(module, exports, __webpack_require__) {
|
33647 |
|
33648 |
//! moment.js locale configuration
|
33753 |
|
33754 |
|
33755 |
/***/ }),
|
33756 |
+
/* 275 */
|
33757 |
/***/ (function(module, exports, __webpack_require__) {
|
33758 |
|
33759 |
//! moment.js locale configuration
|
33864 |
|
33865 |
|
33866 |
/***/ }),
|
33867 |
+
/* 276 */
|
33868 |
/***/ (function(module, exports, __webpack_require__) {
|
33869 |
|
33870 |
//! moment.js locale configuration
|
33954 |
|
33955 |
|
33956 |
/***/ }),
|
33957 |
+
/* 277 */
|
33958 |
/***/ (function(module, exports, __webpack_require__) {
|
33959 |
|
33960 |
//! moment.js locale configuration
|
34055 |
}
|
34056 |
},
|
34057 |
week: {
|
34058 |
+
dow: 0, // Sunday is the first day of the week
|
34059 |
+
doy: 3, // The week that contains Jan 4th is the first week of the year (7 + 0 - 4)
|
34060 |
},
|
34061 |
meridiemParse: /राती|सकाळीं|दनपारां|सांजे/,
|
34062 |
meridiemHour: function (hour, meridiem) {
|
34094 |
|
34095 |
|
34096 |
/***/ }),
|
34097 |
+
/* 278 */
|
34098 |
/***/ (function(module, exports, __webpack_require__) {
|
34099 |
|
34100 |
//! moment.js locale configuration
|
34195 |
}
|
34196 |
},
|
34197 |
week: {
|
34198 |
+
dow: 0, // Sunday is the first day of the week
|
34199 |
+
doy: 3, // The week that contains Jan 4th is the first week of the year (7 + 0 - 4)
|
34200 |
},
|
34201 |
meridiemParse: /rati|sokallim|donparam|sanje/,
|
34202 |
meridiemHour: function (hour, meridiem) {
|
34234 |
|
34235 |
|
34236 |
/***/ }),
|
34237 |
+
/* 279 */
|
34238 |
/***/ (function(module, exports, __webpack_require__) {
|
34239 |
|
34240 |
//! moment.js locale configuration
|
34250 |
//! moment.js locale configuration
|
34251 |
|
34252 |
var symbolMap = {
|
34253 |
+
1: '૧',
|
34254 |
+
2: '૨',
|
34255 |
+
3: '૩',
|
34256 |
+
4: '૪',
|
34257 |
+
5: '૫',
|
34258 |
+
6: '૬',
|
34259 |
+
7: '૭',
|
34260 |
+
8: '૮',
|
34261 |
+
9: '૯',
|
34262 |
+
0: '૦',
|
34263 |
},
|
34264 |
numberMap = {
|
34265 |
'૧': '1',
|
34305 |
},
|
34306 |
relativeTime: {
|
34307 |
future: '%s મા',
|
34308 |
+
past: '%s પહેલા',
|
34309 |
s: 'અમુક પળો',
|
34310 |
ss: '%d સેકંડ',
|
34311 |
m: 'એક મિનિટ',
|
34371 |
|
34372 |
|
34373 |
/***/ }),
|
34374 |
+
/* 280 */
|
34375 |
/***/ (function(module, exports, __webpack_require__) {
|
34376 |
|
34377 |
//! moment.js locale configuration
|
34481 |
|
34482 |
|
34483 |
/***/ }),
|
34484 |
+
/* 281 */
|
34485 |
/***/ (function(module, exports, __webpack_require__) {
|
34486 |
|
34487 |
//! moment.js locale configuration
|
34497 |
//! moment.js locale configuration
|
34498 |
|
34499 |
var symbolMap = {
|
34500 |
+
1: '१',
|
34501 |
+
2: '२',
|
34502 |
+
3: '३',
|
34503 |
+
4: '४',
|
34504 |
+
5: '५',
|
34505 |
+
6: '६',
|
34506 |
+
7: '७',
|
34507 |
+
8: '८',
|
34508 |
+
9: '९',
|
34509 |
+
0: '०',
|
34510 |
},
|
34511 |
numberMap = {
|
34512 |
'१': '1',
|
34519 |
'८': '8',
|
34520 |
'९': '9',
|
34521 |
'०': '0',
|
34522 |
+
},
|
34523 |
+
monthsParse = [
|
34524 |
+
/^जन/i,
|
34525 |
+
/^फ़र|फर/i,
|
34526 |
+
/^मार्च/i,
|
34527 |
+
/^अप्रै/i,
|
34528 |
+
/^मई/i,
|
34529 |
+
/^जून/i,
|
34530 |
+
/^जुल/i,
|
34531 |
+
/^अग/i,
|
34532 |
+
/^सितं|सित/i,
|
34533 |
+
/^अक्टू/i,
|
34534 |
+
/^नव|नवं/i,
|
34535 |
+
/^दिसं|दिस/i,
|
34536 |
+
],
|
34537 |
+
shortMonthsParse = [
|
34538 |
+
/^जन/i,
|
34539 |
+
/^फ़र/i,
|
34540 |
+
/^मार्च/i,
|
34541 |
+
/^अप्रै/i,
|
34542 |
+
/^मई/i,
|
34543 |
+
/^जून/i,
|
34544 |
+
/^जुल/i,
|
34545 |
+
/^अग/i,
|
34546 |
+
/^सित/i,
|
34547 |
+
/^अक्टू/i,
|
34548 |
+
/^नव/i,
|
34549 |
+
/^दिस/i,
|
34550 |
+
];
|
34551 |
|
34552 |
var hi = moment.defineLocale('hi', {
|
34553 |
+
months: {
|
34554 |
+
format: 'जनवरी_फ़रवरी_मार्च_अप्रैल_मई_जून_जुलाई_अगस्त_सितम्बर_अक्टूबर_नवम्बर_दिसम्बर'.split(
|
34555 |
+
'_'
|
34556 |
+
),
|
34557 |
+
standalone: 'जनवरी_फरवरी_मार्च_अप्रैल_मई_जून_जुलाई_अगस्त_सितंबर_अक्टूबर_नवंबर_दिसंबर'.split(
|
34558 |
+
'_'
|
34559 |
+
),
|
34560 |
+
},
|
34561 |
monthsShort: 'जन._फ़र._मार्च_अप्रै._मई_जून_जुल._अग._सित._अक्टू._नव._दिस.'.split(
|
34562 |
'_'
|
34563 |
),
|
|
|
34564 |
weekdays: 'रविवार_सोमवार_मंगलवार_बुधवार_गुरूवार_शुक्रवार_शनिवार'.split('_'),
|
34565 |
weekdaysShort: 'रवि_सोम_मंगल_बुध_गुरू_शुक्र_शनि'.split('_'),
|
34566 |
weekdaysMin: 'र_सो_मं_बु_गु_शु_श'.split('_'),
|
34572 |
LLL: 'D MMMM YYYY, A h:mm बजे',
|
34573 |
LLLL: 'dddd, D MMMM YYYY, A h:mm बजे',
|
34574 |
},
|
34575 |
+
|
34576 |
+
monthsParse: monthsParse,
|
34577 |
+
longMonthsParse: monthsParse,
|
34578 |
+
shortMonthsParse: shortMonthsParse,
|
34579 |
+
|
34580 |
+
monthsRegex: /^(जनवरी|जन\.?|फ़रवरी|फरवरी|फ़र\.?|मार्च?|अप्रैल|अप्रै\.?|मई?|जून?|जुलाई|जुल\.?|अगस्त|अग\.?|सितम्बर|सितंबर|सित\.?|अक्टूबर|अक्टू\.?|नवम्बर|नवंबर|नव\.?|दिसम्बर|दिसंबर|दिस\.?)/i,
|
34581 |
+
|
34582 |
+
monthsShortRegex: /^(जनवरी|जन\.?|फ़रवरी|फरवरी|फ़र\.?|मार्च?|अप्रैल|अप्रै\.?|मई?|जून?|जुलाई|जुल\.?|अगस्त|अग\.?|सितम्बर|सितंबर|सित\.?|अक्टूबर|अक्टू\.?|नवम्बर|नवंबर|नव\.?|दिसम्बर|दिसंबर|दिस\.?)/i,
|
34583 |
+
|
34584 |
+
monthsStrictRegex: /^(जनवरी?|फ़रवरी|फरवरी?|मार्च?|अप्रैल?|मई?|जून?|जुलाई?|अगस्त?|सितम्बर|सितंबर|सित?\.?|अक्टूबर|अक्टू\.?|नवम्बर|नवंबर?|दिसम्बर|दिसंबर?)/i,
|
34585 |
+
|
34586 |
+
monthsShortStrictRegex: /^(जन\.?|फ़र\.?|मार्च?|अप्रै\.?|मई?|जून?|जुल\.?|अग\.?|सित\.?|अक्टू\.?|नव\.?|दिस\.?)/i,
|
34587 |
+
|
34588 |
calendar: {
|
34589 |
sameDay: '[आज] LT',
|
34590 |
nextDay: '[कल] LT',
|
34661 |
|
34662 |
|
34663 |
/***/ }),
|
34664 |
+
/* 282 */
|
34665 |
/***/ (function(module, exports, __webpack_require__) {
|
34666 |
|
34667 |
//! moment.js locale configuration
|
34831 |
|
34832 |
|
34833 |
/***/ }),
|
34834 |
+
/* 283 */
|
34835 |
/***/ (function(module, exports, __webpack_require__) {
|
34836 |
|
34837 |
//! moment.js locale configuration
|
34838 |
//! locale : Hungarian [hu]
|
34839 |
//! author : Adam Brunner : https://github.com/adambrunner
|
34840 |
+
//! author : Peter Viszt : https://github.com/passatgt
|
34841 |
|
34842 |
;(function (global, factory) {
|
34843 |
true ? factory(__webpack_require__(0)) :
|
34897 |
months: 'január_február_március_április_május_június_július_augusztus_szeptember_október_november_december'.split(
|
34898 |
'_'
|
34899 |
),
|
34900 |
+
monthsShort: 'jan._feb._márc._ápr._máj._jún._júl._aug._szept._okt._nov._dec.'.split(
|
34901 |
'_'
|
34902 |
),
|
34903 |
+
monthsParseExact: true,
|
34904 |
weekdays: 'vasárnap_hétfő_kedd_szerda_csütörtök_péntek_szombat'.split('_'),
|
34905 |
weekdaysShort: 'vas_hét_kedd_sze_csüt_pén_szo'.split('_'),
|
34906 |
weekdaysMin: 'v_h_k_sze_cs_p_szo'.split('_'),
|
34965 |
|
34966 |
|
34967 |
/***/ }),
|
34968 |
+
/* 284 */
|
34969 |
/***/ (function(module, exports, __webpack_require__) {
|
34970 |
|
34971 |
//! moment.js locale configuration
|
35073 |
|
35074 |
|
35075 |
/***/ }),
|
35076 |
+
/* 285 */
|
35077 |
/***/ (function(module, exports, __webpack_require__) {
|
35078 |
|
35079 |
//! moment.js locale configuration
|
35165 |
|
35166 |
|
35167 |
/***/ }),
|
35168 |
+
/* 286 */
|
35169 |
/***/ (function(module, exports, __webpack_require__) {
|
35170 |
|
35171 |
//! moment.js locale configuration
|
35320 |
|
35321 |
|
35322 |
/***/ }),
|
35323 |
+
/* 287 */
|
35324 |
/***/ (function(module, exports, __webpack_require__) {
|
35325 |
|
35326 |
//! moment.js locale configuration
|
35411 |
sameElse: 'L',
|
35412 |
},
|
35413 |
relativeTime: {
|
35414 |
+
future: 'tra %s',
|
|
|
|
|
35415 |
past: '%s fa',
|
35416 |
s: 'alcuni secondi',
|
35417 |
ss: '%d secondi',
|
35421 |
hh: '%d ore',
|
35422 |
d: 'un giorno',
|
35423 |
dd: '%d giorni',
|
35424 |
+
w: 'una settimana',
|
35425 |
+
ww: '%d settimane',
|
35426 |
M: 'un mese',
|
35427 |
MM: '%d mesi',
|
35428 |
y: 'un anno',
|
35442 |
|
35443 |
|
35444 |
/***/ }),
|
35445 |
+
/* 288 */
|
35446 |
/***/ (function(module, exports, __webpack_require__) {
|
35447 |
|
35448 |
//! moment.js locale configuration
|
35522 |
|
35523 |
|
35524 |
/***/ }),
|
35525 |
+
/* 289 */
|
35526 |
/***/ (function(module, exports, __webpack_require__) {
|
35527 |
|
35528 |
//! moment.js locale configuration
|
35686 |
|
35687 |
|
35688 |
/***/ }),
|
35689 |
+
/* 290 */
|
35690 |
/***/ (function(module, exports, __webpack_require__) {
|
35691 |
|
35692 |
//! moment.js locale configuration
|
35778 |
|
35779 |
|
35780 |
/***/ }),
|
35781 |
+
/* 291 */
|
35782 |
/***/ (function(module, exports, __webpack_require__) {
|
35783 |
|
35784 |
//! moment.js locale configuration
|
35886 |
|
35887 |
|
35888 |
/***/ }),
|
35889 |
+
/* 292 */
|
35890 |
/***/ (function(module, exports, __webpack_require__) {
|
35891 |
|
35892 |
//! moment.js locale configuration
|
35984 |
|
35985 |
|
35986 |
/***/ }),
|
35987 |
+
/* 293 */
|
35988 |
/***/ (function(module, exports, __webpack_require__) {
|
35989 |
|
35990 |
//! moment.js locale configuration
|
36000 |
//! moment.js locale configuration
|
36001 |
|
36002 |
var symbolMap = {
|
36003 |
+
1: '១',
|
36004 |
+
2: '២',
|
36005 |
+
3: '៣',
|
36006 |
+
4: '៤',
|
36007 |
+
5: '៥',
|
36008 |
+
6: '៦',
|
36009 |
+
7: '៧',
|
36010 |
+
8: '៨',
|
36011 |
+
9: '៩',
|
36012 |
+
0: '០',
|
36013 |
},
|
36014 |
numberMap = {
|
36015 |
'១': '1',
|
36102 |
|
36103 |
|
36104 |
/***/ }),
|
36105 |
+
/* 294 */
|
36106 |
/***/ (function(module, exports, __webpack_require__) {
|
36107 |
|
36108 |
//! moment.js locale configuration
|
36118 |
//! moment.js locale configuration
|
36119 |
|
36120 |
var symbolMap = {
|
36121 |
+
1: '೧',
|
36122 |
+
2: '೨',
|
36123 |
+
3: '೩',
|
36124 |
+
4: '೪',
|
36125 |
+
5: '೫',
|
36126 |
+
6: '೬',
|
36127 |
+
7: '೭',
|
36128 |
+
8: '೮',
|
36129 |
+
9: '೯',
|
36130 |
+
0: '೦',
|
36131 |
},
|
36132 |
numberMap = {
|
36133 |
'೧': '1',
|
36241 |
|
36242 |
|
36243 |
/***/ }),
|
36244 |
+
/* 295 */
|
36245 |
/***/ (function(module, exports, __webpack_require__) {
|
36246 |
|
36247 |
//! moment.js locale configuration
|
36332 |
|
36333 |
|
36334 |
/***/ }),
|
36335 |
+
/* 296 */
|
36336 |
/***/ (function(module, exports, __webpack_require__) {
|
36337 |
|
36338 |
//! moment.js locale configuration
|
36348 |
//! moment.js locale configuration
|
36349 |
|
36350 |
var symbolMap = {
|
36351 |
+
1: '١',
|
36352 |
+
2: '٢',
|
36353 |
+
3: '٣',
|
36354 |
+
4: '٤',
|
36355 |
+
5: '٥',
|
36356 |
+
6: '٦',
|
36357 |
+
7: '٧',
|
36358 |
+
8: '٨',
|
36359 |
+
9: '٩',
|
36360 |
+
0: '٠',
|
36361 |
},
|
36362 |
numberMap = {
|
36363 |
'١': '1',
|
36466 |
|
36467 |
|
36468 |
/***/ }),
|
36469 |
+
/* 297 */
|
36470 |
/***/ (function(module, exports, __webpack_require__) {
|
36471 |
|
36472 |
//! moment.js locale configuration
|
36566 |
|
36567 |
|
36568 |
/***/ }),
|
36569 |
+
/* 298 */
|
36570 |
/***/ (function(module, exports, __webpack_require__) {
|
36571 |
|
36572 |
//! moment.js locale configuration
|
36717 |
|
36718 |
|
36719 |
/***/ }),
|
36720 |
+
/* 299 */
|
36721 |
/***/ (function(module, exports, __webpack_require__) {
|
36722 |
|
36723 |
//! moment.js locale configuration
|
36798 |
|
36799 |
|
36800 |
/***/ }),
|
36801 |
+
/* 300 */
|
36802 |
/***/ (function(module, exports, __webpack_require__) {
|
36803 |
|
36804 |
//! moment.js locale configuration
|
36937 |
|
36938 |
|
36939 |
/***/ }),
|
36940 |
+
/* 301 */
|
36941 |
/***/ (function(module, exports, __webpack_require__) {
|
36942 |
|
36943 |
//! moment.js locale configuration
|
37046 |
|
37047 |
|
37048 |
/***/ }),
|
37049 |
+
/* 302 */
|
37050 |
/***/ (function(module, exports, __webpack_require__) {
|
37051 |
|
37052 |
//! moment.js locale configuration
|
37180 |
|
37181 |
|
37182 |
/***/ }),
|
37183 |
+
/* 303 */
|
37184 |
/***/ (function(module, exports, __webpack_require__) {
|
37185 |
|
37186 |
//! moment.js locale configuration
|
37255 |
|
37256 |
|
37257 |
/***/ }),
|
37258 |
+
/* 304 */
|
37259 |
/***/ (function(module, exports, __webpack_require__) {
|
37260 |
|
37261 |
//! moment.js locale configuration
|
37357 |
|
37358 |
|
37359 |
/***/ }),
|
37360 |
+
/* 305 */
|
37361 |
/***/ (function(module, exports, __webpack_require__) {
|
37362 |
|
37363 |
//! moment.js locale configuration
|
37453 |
|
37454 |
|
37455 |
/***/ }),
|
37456 |
+
/* 306 */
|
37457 |
/***/ (function(module, exports, __webpack_require__) {
|
37458 |
|
37459 |
//! moment.js locale configuration
|
37568 |
|
37569 |
|
37570 |
/***/ }),
|
37571 |
+
/* 307 */
|
37572 |
/***/ (function(module, exports, __webpack_require__) {
|
37573 |
|
37574 |
//! moment.js locale configuration
|
37585 |
//! moment.js locale configuration
|
37586 |
|
37587 |
var symbolMap = {
|
37588 |
+
1: '१',
|
37589 |
+
2: '२',
|
37590 |
+
3: '३',
|
37591 |
+
4: '४',
|
37592 |
+
5: '५',
|
37593 |
+
6: '६',
|
37594 |
+
7: '७',
|
37595 |
+
8: '८',
|
37596 |
+
9: '९',
|
37597 |
+
0: '०',
|
37598 |
},
|
37599 |
numberMap = {
|
37600 |
'१': '1',
|
37786 |
|
37787 |
|
37788 |
/***/ }),
|
37789 |
+
/* 308 */
|
37790 |
/***/ (function(module, exports, __webpack_require__) {
|
37791 |
|
37792 |
//! moment.js locale configuration
|
37877 |
|
37878 |
|
37879 |
/***/ }),
|
37880 |
+
/* 309 */
|
37881 |
/***/ (function(module, exports, __webpack_require__) {
|
37882 |
|
37883 |
//! moment.js locale configuration
|
37969 |
|
37970 |
|
37971 |
/***/ }),
|
37972 |
+
/* 310 */
|
37973 |
/***/ (function(module, exports, __webpack_require__) {
|
37974 |
|
37975 |
//! moment.js locale configuration
|
38040 |
|
38041 |
|
38042 |
/***/ }),
|
38043 |
+
/* 311 */
|
38044 |
/***/ (function(module, exports, __webpack_require__) {
|
38045 |
|
38046 |
//! moment.js locale configuration
|
38058 |
//! moment.js locale configuration
|
38059 |
|
38060 |
var symbolMap = {
|
38061 |
+
1: '၁',
|
38062 |
+
2: '၂',
|
38063 |
+
3: '၃',
|
38064 |
+
4: '၄',
|
38065 |
+
5: '၅',
|
38066 |
+
6: '၆',
|
38067 |
+
7: '၇',
|
38068 |
+
8: '၈',
|
38069 |
+
9: '၉',
|
38070 |
+
0: '၀',
|
38071 |
},
|
38072 |
numberMap = {
|
38073 |
'၁': '1',
|
38147 |
|
38148 |
|
38149 |
/***/ }),
|
38150 |
+
/* 312 */
|
38151 |
/***/ (function(module, exports, __webpack_require__) {
|
38152 |
|
38153 |
//! moment.js locale configuration
|
38203 |
hh: '%d timer',
|
38204 |
d: 'en dag',
|
38205 |
dd: '%d dager',
|
38206 |
+
w: 'en uke',
|
38207 |
+
ww: '%d uker',
|
38208 |
M: 'en måned',
|
38209 |
MM: '%d måneder',
|
38210 |
y: 'ett år',
|
38224 |
|
38225 |
|
38226 |
/***/ }),
|
38227 |
+
/* 313 */
|
38228 |
/***/ (function(module, exports, __webpack_require__) {
|
38229 |
|
38230 |
//! moment.js locale configuration
|
38240 |
//! moment.js locale configuration
|
38241 |
|
38242 |
var symbolMap = {
|
38243 |
+
1: '१',
|
38244 |
+
2: '२',
|
38245 |
+
3: '३',
|
38246 |
+
4: '४',
|
38247 |
+
5: '५',
|
38248 |
+
6: '६',
|
38249 |
+
7: '७',
|
38250 |
+
8: '८',
|
38251 |
+
9: '९',
|
38252 |
+
0: '०',
|
38253 |
},
|
38254 |
numberMap = {
|
38255 |
'१': '1',
|
38360 |
|
38361 |
|
38362 |
/***/ }),
|
38363 |
+
/* 314 */
|
38364 |
/***/ (function(module, exports, __webpack_require__) {
|
38365 |
|
38366 |
//! moment.js locale configuration
|
38454 |
hh: '%d uur',
|
38455 |
d: 'één dag',
|
38456 |
dd: '%d dagen',
|
38457 |
+
w: 'één week',
|
38458 |
+
ww: '%d weken',
|
38459 |
M: 'één maand',
|
38460 |
MM: '%d maanden',
|
38461 |
y: 'één jaar',
|
38480 |
|
38481 |
|
38482 |
/***/ }),
|
38483 |
+
/* 315 */
|
38484 |
/***/ (function(module, exports, __webpack_require__) {
|
38485 |
|
38486 |
//! moment.js locale configuration
|
38598 |
|
38599 |
|
38600 |
/***/ }),
|
38601 |
+
/* 316 */
|
38602 |
/***/ (function(module, exports, __webpack_require__) {
|
38603 |
|
38604 |
//! moment.js locale configuration
|
38653 |
hh: '%d timar',
|
38654 |
d: 'ein dag',
|
38655 |
dd: '%d dagar',
|
38656 |
+
w: 'ei veke',
|
38657 |
+
ww: '%d veker',
|
38658 |
M: 'ein månad',
|
38659 |
MM: '%d månader',
|
38660 |
y: 'eit år',
|
38674 |
|
38675 |
|
38676 |
/***/ }),
|
38677 |
+
/* 317 */
|
38678 |
/***/ (function(module, exports, __webpack_require__) {
|
38679 |
|
38680 |
//! moment.js locale configuration
|
38773 |
|
38774 |
|
38775 |
/***/ }),
|
38776 |
+
/* 318 */
|
38777 |
/***/ (function(module, exports, __webpack_require__) {
|
38778 |
|
38779 |
//! moment.js locale configuration
|
38789 |
//! moment.js locale configuration
|
38790 |
|
38791 |
var symbolMap = {
|
38792 |
+
1: '੧',
|
38793 |
+
2: '੨',
|
38794 |
+
3: '੩',
|
38795 |
+
4: '੪',
|
38796 |
+
5: '੫',
|
38797 |
+
6: '੬',
|
38798 |
+
7: '੭',
|
38799 |
+
8: '੮',
|
38800 |
+
9: '੯',
|
38801 |
+
0: '੦',
|
38802 |
},
|
38803 |
numberMap = {
|
38804 |
'੧': '1',
|
38910 |
|
38911 |
|
38912 |
/***/ }),
|
38913 |
+
/* 319 */
|
38914 |
/***/ (function(module, exports, __webpack_require__) {
|
38915 |
|
38916 |
//! moment.js locale configuration
|
38930 |
),
|
38931 |
monthsSubjective = 'stycznia_lutego_marca_kwietnia_maja_czerwca_lipca_sierpnia_września_października_listopada_grudnia'.split(
|
38932 |
'_'
|
38933 |
+
),
|
38934 |
+
monthsParse = [
|
38935 |
+
/^sty/i,
|
38936 |
+
/^lut/i,
|
38937 |
+
/^mar/i,
|
38938 |
+
/^kwi/i,
|
38939 |
+
/^maj/i,
|
38940 |
+
/^cze/i,
|
38941 |
+
/^lip/i,
|
38942 |
+
/^sie/i,
|
38943 |
+
/^wrz/i,
|
38944 |
+
/^paź/i,
|
38945 |
+
/^lis/i,
|
38946 |
+
/^gru/i,
|
38947 |
+
];
|
38948 |
function plural(n) {
|
38949 |
return n % 10 < 5 && n % 10 > 1 && ~~(n / 10) % 10 !== 1;
|
38950 |
}
|
38961 |
return withoutSuffix ? 'godzina' : 'godzinę';
|
38962 |
case 'hh':
|
38963 |
return result + (plural(number) ? 'godziny' : 'godzin');
|
38964 |
+
case 'ww':
|
38965 |
+
return result + (plural(number) ? 'tygodnie' : 'tygodni');
|
38966 |
case 'MM':
|
38967 |
return result + (plural(number) ? 'miesiące' : 'miesięcy');
|
38968 |
case 'yy':
|
38974 |
months: function (momentToFormat, format) {
|
38975 |
if (!momentToFormat) {
|
38976 |
return monthsNominative;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
38977 |
} else if (/D MMMM/.test(format)) {
|
38978 |
return monthsSubjective[momentToFormat.month()];
|
38979 |
} else {
|
38981 |
}
|
38982 |
},
|
38983 |
monthsShort: 'sty_lut_mar_kwi_maj_cze_lip_sie_wrz_paź_lis_gru'.split('_'),
|
38984 |
+
monthsParse: monthsParse,
|
38985 |
+
longMonthsParse: monthsParse,
|
38986 |
+
shortMonthsParse: monthsParse,
|
38987 |
weekdays: 'niedziela_poniedziałek_wtorek_środa_czwartek_piątek_sobota'.split(
|
38988 |
'_'
|
38989 |
),
|
39044 |
hh: translate,
|
39045 |
d: '1 dzień',
|
39046 |
dd: '%d dni',
|
39047 |
+
w: 'tydzień',
|
39048 |
+
ww: translate,
|
39049 |
M: 'miesiąc',
|
39050 |
MM: translate,
|
39051 |
y: 'rok',
|
39065 |
|
39066 |
|
39067 |
/***/ }),
|
39068 |
+
/* 320 */
|
39069 |
/***/ (function(module, exports, __webpack_require__) {
|
39070 |
|
39071 |
//! moment.js locale configuration
|
39122 |
hh: '%d horas',
|
39123 |
d: 'um dia',
|
39124 |
dd: '%d dias',
|
39125 |
+
w: 'uma semana',
|
39126 |
+
ww: '%d semanas',
|
39127 |
M: 'um mês',
|
39128 |
MM: '%d meses',
|
39129 |
y: 'um ano',
|
39143 |
|
39144 |
|
39145 |
/***/ }),
|
39146 |
+
/* 321 */
|
39147 |
/***/ (function(module, exports, __webpack_require__) {
|
39148 |
|
39149 |
//! moment.js locale configuration
|
39207 |
},
|
39208 |
dayOfMonthOrdinalParse: /\d{1,2}º/,
|
39209 |
ordinal: '%dº',
|
39210 |
+
invalidDate: 'Data inválida',
|
39211 |
});
|
39212 |
|
39213 |
return ptBr;
|
39216 |
|
39217 |
|
39218 |
/***/ }),
|
39219 |
+
/* 322 */
|
39220 |
/***/ (function(module, exports, __webpack_require__) {
|
39221 |
|
39222 |
//! moment.js locale configuration
|
39239 |
mm: 'minute',
|
39240 |
hh: 'ore',
|
39241 |
dd: 'zile',
|
39242 |
+
ww: 'săptămâni',
|
39243 |
MM: 'luni',
|
39244 |
yy: 'ani',
|
39245 |
},
|
39288 |
hh: relativeTimeWithPlural,
|
39289 |
d: 'o zi',
|
39290 |
dd: relativeTimeWithPlural,
|
39291 |
+
w: 'o săptămână',
|
39292 |
+
ww: relativeTimeWithPlural,
|
39293 |
M: 'o lună',
|
39294 |
MM: relativeTimeWithPlural,
|
39295 |
y: 'un an',
|
39307 |
|
39308 |
|
39309 |
/***/ }),
|
39310 |
+
/* 323 */
|
39311 |
/***/ (function(module, exports, __webpack_require__) {
|
39312 |
|
39313 |
//! moment.js locale configuration
|
39338 |
mm: withoutSuffix ? 'минута_минуты_минут' : 'минуту_минуты_минут',
|
39339 |
hh: 'час_часа_часов',
|
39340 |
dd: 'день_дня_дней',
|
39341 |
+
ww: 'неделя_недели_недель',
|
39342 |
MM: 'месяц_месяца_месяцев',
|
39343 |
yy: 'год_года_лет',
|
39344 |
};
|
39479 |
hh: relativeTimeWithPlural,
|
39480 |
d: 'день',
|
39481 |
dd: relativeTimeWithPlural,
|
39482 |
+
w: 'неделя',
|
39483 |
+
ww: relativeTimeWithPlural,
|
39484 |
M: 'месяц',
|
39485 |
MM: relativeTimeWithPlural,
|
39486 |
y: 'год',
|
39529 |
|
39530 |
|
39531 |
/***/ }),
|
39532 |
+
/* 324 */
|
39533 |
/***/ (function(module, exports, __webpack_require__) {
|
39534 |
|
39535 |
//! moment.js locale configuration
|
39626 |
|
39627 |
|
39628 |
/***/ }),
|
39629 |
+
/* 325 */
|
39630 |
/***/ (function(module, exports, __webpack_require__) {
|
39631 |
|
39632 |
//! moment.js locale configuration
|
39699 |
|
39700 |
|
39701 |
/***/ }),
|
39702 |
+
/* 326 */
|
39703 |
/***/ (function(module, exports, __webpack_require__) {
|
39704 |
|
39705 |
//! moment.js locale configuration
|
39783 |
|
39784 |
|
39785 |
/***/ }),
|
39786 |
+
/* 327 */
|
39787 |
/***/ (function(module, exports, __webpack_require__) {
|
39788 |
|
39789 |
//! moment.js locale configuration
|
39943 |
|
39944 |
|
39945 |
/***/ }),
|
39946 |
+
/* 328 */
|
39947 |
/***/ (function(module, exports, __webpack_require__) {
|
39948 |
|
39949 |
//! moment.js locale configuration
|
40129 |
|
40130 |
|
40131 |
/***/ }),
|
40132 |
+
/* 329 */
|
40133 |
/***/ (function(module, exports, __webpack_require__) {
|
40134 |
|
40135 |
//! moment.js locale configuration
|
40210 |
|
40211 |
|
40212 |
/***/ }),
|
40213 |
+
/* 330 */
|
40214 |
/***/ (function(module, exports, __webpack_require__) {
|
40215 |
|
40216 |
//! moment.js locale configuration
|
40217 |
//! locale : Serbian [sr]
|
40218 |
//! author : Milan Janačković<milanjanackovic@gmail.com> : https://github.com/milan-j
|
40219 |
+
//! author : Stefan Crnjaković <stefan@hotmail.rs> : https://github.com/crnjakovic
|
40220 |
|
40221 |
;(function (global, factory) {
|
40222 |
true ? factory(__webpack_require__(0)) :
|
40276 |
longDateFormat: {
|
40277 |
LT: 'H:mm',
|
40278 |
LTS: 'H:mm:ss',
|
40279 |
+
L: 'D. M. YYYY.',
|
40280 |
+
LL: 'D. MMMM YYYY.',
|
40281 |
+
LLL: 'D. MMMM YYYY. H:mm',
|
40282 |
+
LLLL: 'dddd, D. MMMM YYYY. H:mm',
|
40283 |
},
|
40284 |
calendar: {
|
40285 |
sameDay: '[danas u] LT',
|
40344 |
|
40345 |
|
40346 |
/***/ }),
|
40347 |
+
/* 331 */
|
40348 |
/***/ (function(module, exports, __webpack_require__) {
|
40349 |
|
40350 |
//! moment.js locale configuration
|
40351 |
//! locale : Serbian Cyrillic [sr-cyrl]
|
40352 |
//! author : Milan Janačković<milanjanackovic@gmail.com> : https://github.com/milan-j
|
40353 |
+
//! author : Stefan Crnjaković <stefan@hotmail.rs> : https://github.com/crnjakovic
|
40354 |
|
40355 |
;(function (global, factory) {
|
40356 |
true ? factory(__webpack_require__(0)) :
|
40408 |
longDateFormat: {
|
40409 |
LT: 'H:mm',
|
40410 |
LTS: 'H:mm:ss',
|
40411 |
+
L: 'D. M. YYYY.',
|
40412 |
+
LL: 'D. MMMM YYYY.',
|
40413 |
+
LLL: 'D. MMMM YYYY. H:mm',
|
40414 |
+
LLLL: 'dddd, D. MMMM YYYY. H:mm',
|
40415 |
},
|
40416 |
calendar: {
|
40417 |
sameDay: '[данас у] LT',
|
40466 |
ordinal: '%d.',
|
40467 |
week: {
|
40468 |
dow: 1, // Monday is the first day of the week.
|
40469 |
+
doy: 7, // The week that contains Jan 1st is the first week of the year.
|
40470 |
},
|
40471 |
});
|
40472 |
|
40476 |
|
40477 |
|
40478 |
/***/ }),
|
40479 |
+
/* 332 */
|
40480 |
/***/ (function(module, exports, __webpack_require__) {
|
40481 |
|
40482 |
//! moment.js locale configuration
|
40575 |
|
40576 |
|
40577 |
/***/ }),
|
40578 |
+
/* 333 */
|
40579 |
/***/ (function(module, exports, __webpack_require__) {
|
40580 |
|
40581 |
//! moment.js locale configuration
|
40659 |
|
40660 |
|
40661 |
/***/ }),
|
40662 |
+
/* 334 */
|
40663 |
/***/ (function(module, exports, __webpack_require__) {
|
40664 |
|
40665 |
//! moment.js locale configuration
|
40686 |
weekdaysMin: 'J2_J3_J4_J5_Al_Ij_J1'.split('_'),
|
40687 |
weekdaysParseExact: true,
|
40688 |
longDateFormat: {
|
40689 |
+
LT: 'hh:mm A',
|
40690 |
LTS: 'HH:mm:ss',
|
40691 |
L: 'DD.MM.YYYY',
|
40692 |
LL: 'D MMMM YYYY',
|
40729 |
|
40730 |
|
40731 |
/***/ }),
|
40732 |
+
/* 335 */
|
40733 |
/***/ (function(module, exports, __webpack_require__) {
|
40734 |
|
40735 |
//! moment.js locale configuration
|
40745 |
//! moment.js locale configuration
|
40746 |
|
40747 |
var symbolMap = {
|
40748 |
+
1: '௧',
|
40749 |
+
2: '௨',
|
40750 |
+
3: '௩',
|
40751 |
+
4: '௪',
|
40752 |
+
5: '௫',
|
40753 |
+
6: '௬',
|
40754 |
+
7: '௭',
|
40755 |
+
8: '௮',
|
40756 |
+
9: '௯',
|
40757 |
+
0: '௦',
|
40758 |
},
|
40759 |
numberMap = {
|
40760 |
'௧': '1',
|
40874 |
|
40875 |
|
40876 |
/***/ }),
|
40877 |
+
/* 336 */
|
40878 |
/***/ (function(module, exports, __webpack_require__) {
|
40879 |
|
40880 |
//! moment.js locale configuration
|
40976 |
|
40977 |
|
40978 |
/***/ }),
|
40979 |
+
/* 337 */
|
40980 |
/***/ (function(module, exports, __webpack_require__) {
|
40981 |
|
40982 |
//! moment.js locale configuration
|
41060 |
|
41061 |
|
41062 |
/***/ }),
|
41063 |
+
/* 338 */
|
41064 |
/***/ (function(module, exports, __webpack_require__) {
|
41065 |
|
41066 |
//! moment.js locale configuration
|
41101 |
};
|
41102 |
|
41103 |
var tg = moment.defineLocale('tg', {
|
41104 |
+
months: {
|
41105 |
+
format: 'январи_феврали_марти_апрели_майи_июни_июли_августи_сентябри_октябри_ноябри_декабри'.split(
|
41106 |
+
'_'
|
41107 |
+
),
|
41108 |
+
standalone: 'январ_феврал_март_апрел_май_июн_июл_август_сентябр_октябр_ноябр_декабр'.split(
|
41109 |
+
'_'
|
41110 |
+
),
|
41111 |
+
},
|
41112 |
monthsShort: 'янв_фев_мар_апр_май_июн_июл_авг_сен_окт_ноя_дек'.split('_'),
|
41113 |
weekdays: 'якшанбе_душанбе_сешанбе_чоршанбе_панҷшанбе_ҷумъа_шанбе'.split(
|
41114 |
'_'
|
41118 |
longDateFormat: {
|
41119 |
LT: 'HH:mm',
|
41120 |
LTS: 'HH:mm:ss',
|
41121 |
+
L: 'DD.MM.YYYY',
|
41122 |
LL: 'D MMMM YYYY',
|
41123 |
LLL: 'D MMMM YYYY HH:mm',
|
41124 |
LLLL: 'dddd, D MMMM YYYY HH:mm',
|
41125 |
},
|
41126 |
calendar: {
|
41127 |
sameDay: '[Имрӯз соати] LT',
|
41128 |
+
nextDay: '[Фардо соати] LT',
|
41129 |
lastDay: '[Дирӯз соати] LT',
|
41130 |
nextWeek: 'dddd[и] [ҳафтаи оянда соати] LT',
|
41131 |
lastWeek: 'dddd[и] [ҳафтаи гузашта соати] LT',
|
41192 |
|
41193 |
|
41194 |
/***/ }),
|
41195 |
+
/* 339 */
|
41196 |
/***/ (function(module, exports, __webpack_require__) {
|
41197 |
|
41198 |
//! moment.js locale configuration
|
41257 |
hh: '%d ชั่วโมง',
|
41258 |
d: '1 วัน',
|
41259 |
dd: '%d วัน',
|
41260 |
+
w: '1 สัปดาห์',
|
41261 |
+
ww: '%d สัปดาห์',
|
41262 |
M: '1 เดือน',
|
41263 |
MM: '%d เดือน',
|
41264 |
y: '1 ปี',
|
41272 |
|
41273 |
|
41274 |
/***/ }),
|
41275 |
+
/* 340 */
|
41276 |
+
/***/ (function(module, exports, __webpack_require__) {
|
41277 |
+
|
41278 |
+
//! moment.js locale configuration
|
41279 |
+
//! locale : Turkmen [tk]
|
41280 |
+
//! author : Atamyrat Abdyrahmanov : https://github.com/atamyratabdy
|
41281 |
+
|
41282 |
+
;(function (global, factory) {
|
41283 |
+
true ? factory(__webpack_require__(0)) :
|
41284 |
+
typeof define === 'function' && define.amd ? define(['../moment'], factory) :
|
41285 |
+
factory(global.moment)
|
41286 |
+
}(this, (function (moment) { 'use strict';
|
41287 |
+
|
41288 |
+
//! moment.js locale configuration
|
41289 |
+
|
41290 |
+
var suffixes = {
|
41291 |
+
1: "'inji",
|
41292 |
+
5: "'inji",
|
41293 |
+
8: "'inji",
|
41294 |
+
70: "'inji",
|
41295 |
+
80: "'inji",
|
41296 |
+
2: "'nji",
|
41297 |
+
7: "'nji",
|
41298 |
+
20: "'nji",
|
41299 |
+
50: "'nji",
|
41300 |
+
3: "'ünji",
|
41301 |
+
4: "'ünji",
|
41302 |
+
100: "'ünji",
|
41303 |
+
6: "'njy",
|
41304 |
+
9: "'unjy",
|
41305 |
+
10: "'unjy",
|
41306 |
+
30: "'unjy",
|
41307 |
+
60: "'ynjy",
|
41308 |
+
90: "'ynjy",
|
41309 |
+
};
|
41310 |
+
|
41311 |
+
var tk = moment.defineLocale('tk', {
|
41312 |
+
months: 'Ýanwar_Fewral_Mart_Aprel_Maý_Iýun_Iýul_Awgust_Sentýabr_Oktýabr_Noýabr_Dekabr'.split(
|
41313 |
+
'_'
|
41314 |
+
),
|
41315 |
+
monthsShort: 'Ýan_Few_Mar_Apr_Maý_Iýn_Iýl_Awg_Sen_Okt_Noý_Dek'.split('_'),
|
41316 |
+
weekdays: 'Ýekşenbe_Duşenbe_Sişenbe_Çarşenbe_Penşenbe_Anna_Şenbe'.split(
|
41317 |
+
'_'
|
41318 |
+
),
|
41319 |
+
weekdaysShort: 'Ýek_Duş_Siş_Çar_Pen_Ann_Şen'.split('_'),
|
41320 |
+
weekdaysMin: 'Ýk_Dş_Sş_Çr_Pn_An_Şn'.split('_'),
|
41321 |
+
longDateFormat: {
|
41322 |
+
LT: 'HH:mm',
|
41323 |
+
LTS: 'HH:mm:ss',
|
41324 |
+
L: 'DD.MM.YYYY',
|
41325 |
+
LL: 'D MMMM YYYY',
|
41326 |
+
LLL: 'D MMMM YYYY HH:mm',
|
41327 |
+
LLLL: 'dddd, D MMMM YYYY HH:mm',
|
41328 |
+
},
|
41329 |
+
calendar: {
|
41330 |
+
sameDay: '[bugün sagat] LT',
|
41331 |
+
nextDay: '[ertir sagat] LT',
|
41332 |
+
nextWeek: '[indiki] dddd [sagat] LT',
|
41333 |
+
lastDay: '[düýn] LT',
|
41334 |
+
lastWeek: '[geçen] dddd [sagat] LT',
|
41335 |
+
sameElse: 'L',
|
41336 |
+
},
|
41337 |
+
relativeTime: {
|
41338 |
+
future: '%s soň',
|
41339 |
+
past: '%s öň',
|
41340 |
+
s: 'birnäçe sekunt',
|
41341 |
+
m: 'bir minut',
|
41342 |
+
mm: '%d minut',
|
41343 |
+
h: 'bir sagat',
|
41344 |
+
hh: '%d sagat',
|
41345 |
+
d: 'bir gün',
|
41346 |
+
dd: '%d gün',
|
41347 |
+
M: 'bir aý',
|
41348 |
+
MM: '%d aý',
|
41349 |
+
y: 'bir ýyl',
|
41350 |
+
yy: '%d ýyl',
|
41351 |
+
},
|
41352 |
+
ordinal: function (number, period) {
|
41353 |
+
switch (period) {
|
41354 |
+
case 'd':
|
41355 |
+
case 'D':
|
41356 |
+
case 'Do':
|
41357 |
+
case 'DD':
|
41358 |
+
return number;
|
41359 |
+
default:
|
41360 |
+
if (number === 0) {
|
41361 |
+
// special case for zero
|
41362 |
+
return number + "'unjy";
|
41363 |
+
}
|
41364 |
+
var a = number % 10,
|
41365 |
+
b = (number % 100) - a,
|
41366 |
+
c = number >= 100 ? 100 : null;
|
41367 |
+
return number + (suffixes[a] || suffixes[b] || suffixes[c]);
|
41368 |
+
}
|
41369 |
+
},
|
41370 |
+
week: {
|
41371 |
+
dow: 1, // Monday is the first day of the week.
|
41372 |
+
doy: 7, // The week that contains Jan 7th is the first week of the year.
|
41373 |
+
},
|
41374 |
+
});
|
41375 |
+
|
41376 |
+
return tk;
|
41377 |
+
|
41378 |
+
})));
|
41379 |
+
|
41380 |
+
|
41381 |
+
/***/ }),
|
41382 |
+
/* 341 */
|
41383 |
/***/ (function(module, exports, __webpack_require__) {
|
41384 |
|
41385 |
//! moment.js locale configuration
|
41452 |
|
41453 |
|
41454 |
/***/ }),
|
41455 |
+
/* 342 */
|
41456 |
/***/ (function(module, exports, __webpack_require__) {
|
41457 |
|
41458 |
//! moment.js locale configuration
|
41593 |
|
41594 |
|
41595 |
/***/ }),
|
41596 |
+
/* 343 */
|
41597 |
/***/ (function(module, exports, __webpack_require__) {
|
41598 |
|
41599 |
//! moment.js locale configuration
|
41678 |
hh: '%d saat',
|
41679 |
d: 'bir gün',
|
41680 |
dd: '%d gün',
|
41681 |
+
w: 'bir hafta',
|
41682 |
+
ww: '%d hafta',
|
41683 |
M: 'bir ay',
|
41684 |
MM: '%d ay',
|
41685 |
y: 'bir yıl',
|
41715 |
|
41716 |
|
41717 |
/***/ }),
|
41718 |
+
/* 344 */
|
41719 |
/***/ (function(module, exports, __webpack_require__) {
|
41720 |
|
41721 |
//! moment.js locale configuration
|
41820 |
|
41821 |
|
41822 |
/***/ }),
|
41823 |
+
/* 345 */
|
41824 |
/***/ (function(module, exports, __webpack_require__) {
|
41825 |
|
41826 |
//! moment.js locale configuration
|
41889 |
|
41890 |
|
41891 |
/***/ }),
|
41892 |
+
/* 346 */
|
41893 |
/***/ (function(module, exports, __webpack_require__) {
|
41894 |
|
41895 |
//! moment.js locale configuration
|
41958 |
|
41959 |
|
41960 |
/***/ }),
|
41961 |
+
/* 347 */
|
41962 |
/***/ (function(module, exports, __webpack_require__) {
|
41963 |
|
41964 |
+
//! moment.js locale configuration
|
41965 |
//! locale : Uyghur (China) [ug-cn]
|
41966 |
//! author: boyaq : https://github.com/boyaq
|
41967 |
|
41971 |
factory(global.moment)
|
41972 |
}(this, (function (moment) { 'use strict';
|
41973 |
|
41974 |
+
//! moment.js locale configuration
|
41975 |
|
41976 |
var ugCn = moment.defineLocale('ug-cn', {
|
41977 |
months: 'يانۋار_فېۋرال_مارت_ئاپرېل_ماي_ئىيۇن_ئىيۇل_ئاۋغۇست_سېنتەبىر_ئۆكتەبىر_نويابىر_دېكابىر'.split(
|
42084 |
|
42085 |
|
42086 |
/***/ }),
|
42087 |
+
/* 348 */
|
42088 |
/***/ (function(module, exports, __webpack_require__) {
|
42089 |
|
42090 |
//! moment.js locale configuration
|
42263 |
|
42264 |
|
42265 |
/***/ }),
|
42266 |
+
/* 349 */
|
42267 |
/***/ (function(module, exports, __webpack_require__) {
|
42268 |
|
42269 |
//! moment.js locale configuration
|
42361 |
|
42362 |
|
42363 |
/***/ }),
|
42364 |
+
/* 350 */
|
42365 |
/***/ (function(module, exports, __webpack_require__) {
|
42366 |
|
42367 |
//! moment.js locale configuration
|
42428 |
|
42429 |
|
42430 |
/***/ }),
|
42431 |
+
/* 351 */
|
42432 |
/***/ (function(module, exports, __webpack_require__) {
|
42433 |
|
42434 |
//! moment.js locale configuration
|
42497 |
|
42498 |
|
42499 |
/***/ }),
|
42500 |
+
/* 352 */
|
42501 |
/***/ (function(module, exports, __webpack_require__) {
|
42502 |
|
42503 |
//! moment.js locale configuration
|
42517 |
months: 'tháng 1_tháng 2_tháng 3_tháng 4_tháng 5_tháng 6_tháng 7_tháng 8_tháng 9_tháng 10_tháng 11_tháng 12'.split(
|
42518 |
'_'
|
42519 |
),
|
42520 |
+
monthsShort: 'Thg 01_Thg 02_Thg 03_Thg 04_Thg 05_Thg 06_Thg 07_Thg 08_Thg 09_Thg 10_Thg 11_Thg 12'.split(
|
42521 |
'_'
|
42522 |
),
|
42523 |
monthsParseExact: true,
|
42569 |
hh: '%d giờ',
|
42570 |
d: 'một ngày',
|
42571 |
dd: '%d ngày',
|
42572 |
+
w: 'một tuần',
|
42573 |
+
ww: '%d tuần',
|
42574 |
M: 'một tháng',
|
42575 |
MM: '%d tháng',
|
42576 |
y: 'một năm',
|
42592 |
|
42593 |
|
42594 |
/***/ }),
|
42595 |
+
/* 353 */
|
42596 |
/***/ (function(module, exports, __webpack_require__) {
|
42597 |
|
42598 |
//! moment.js locale configuration
|
42679 |
|
42680 |
|
42681 |
/***/ }),
|
42682 |
+
/* 354 */
|
42683 |
/***/ (function(module, exports, __webpack_require__) {
|
42684 |
|
42685 |
//! moment.js locale configuration
|
42748 |
|
42749 |
|
42750 |
/***/ }),
|
42751 |
+
/* 355 */
|
42752 |
/***/ (function(module, exports, __webpack_require__) {
|
42753 |
|
42754 |
//! moment.js locale configuration
|
42864 |
hh: '%d 小时',
|
42865 |
d: '1 天',
|
42866 |
dd: '%d 天',
|
42867 |
+
w: '1 周',
|
42868 |
+
ww: '%d 周',
|
42869 |
M: '1 个月',
|
42870 |
MM: '%d 个月',
|
42871 |
y: '1 年',
|
42884 |
|
42885 |
|
42886 |
/***/ }),
|
42887 |
+
/* 356 */
|
42888 |
/***/ (function(module, exports, __webpack_require__) {
|
42889 |
|
42890 |
//! moment.js locale configuration
|
43001 |
|
43002 |
|
43003 |
/***/ }),
|
43004 |
+
/* 357 */
|
43005 |
/***/ (function(module, exports, __webpack_require__) {
|
43006 |
|
43007 |
//! moment.js locale configuration
|
43117 |
|
43118 |
|
43119 |
/***/ }),
|
43120 |
+
/* 358 */
|
43121 |
/***/ (function(module, exports, __webpack_require__) {
|
43122 |
|
43123 |
//! moment.js locale configuration
|
43232 |
|
43233 |
|
43234 |
/***/ }),
|
43235 |
+
/* 359 */
|
43236 |
+
/***/ (function(module, exports, __webpack_require__) {
|
43237 |
+
|
43238 |
+
"use strict";
|
43239 |
+
|
43240 |
+
|
43241 |
+
/* globals
|
43242 |
+
AggregateError,
|
43243 |
+
Atomics,
|
43244 |
+
FinalizationRegistry,
|
43245 |
+
SharedArrayBuffer,
|
43246 |
+
WeakRef,
|
43247 |
+
*/
|
43248 |
+
|
43249 |
+
var undefined;
|
43250 |
+
|
43251 |
+
var $SyntaxError = SyntaxError;
|
43252 |
+
var $Function = Function;
|
43253 |
+
var $TypeError = TypeError;
|
43254 |
+
|
43255 |
+
// eslint-disable-next-line consistent-return
|
43256 |
+
var getEvalledConstructor = function (expressionSyntax) {
|
43257 |
+
try {
|
43258 |
+
// eslint-disable-next-line no-new-func
|
43259 |
+
return Function('"use strict"; return (' + expressionSyntax + ').constructor;')();
|
43260 |
+
} catch (e) {}
|
43261 |
+
};
|
43262 |
+
|
43263 |
+
var $gOPD = Object.getOwnPropertyDescriptor;
|
43264 |
+
if ($gOPD) {
|
43265 |
+
try {
|
43266 |
+
$gOPD({}, '');
|
43267 |
+
} catch (e) {
|
43268 |
+
$gOPD = null; // this is IE 8, which has a broken gOPD
|
43269 |
+
}
|
43270 |
+
}
|
43271 |
+
|
43272 |
+
var throwTypeError = function () { throw new $TypeError(); };
|
43273 |
+
var ThrowTypeError = $gOPD
|
43274 |
+
? (function () {
|
43275 |
+
try {
|
43276 |
+
// eslint-disable-next-line no-unused-expressions, no-caller, no-restricted-properties
|
43277 |
+
arguments.callee; // IE 8 does not throw here
|
43278 |
+
return throwTypeError;
|
43279 |
+
} catch (calleeThrows) {
|
43280 |
+
try {
|
43281 |
+
// IE 8 throws on Object.getOwnPropertyDescriptor(arguments, '')
|
43282 |
+
return $gOPD(arguments, 'callee').get;
|
43283 |
+
} catch (gOPDthrows) {
|
43284 |
+
return throwTypeError;
|
43285 |
+
}
|
43286 |
+
}
|
43287 |
+
}())
|
43288 |
+
: throwTypeError;
|
43289 |
+
|
43290 |
+
var hasSymbols = __webpack_require__(43)();
|
43291 |
+
|
43292 |
+
var getProto = Object.getPrototypeOf || function (x) { return x.__proto__; }; // eslint-disable-line no-proto
|
43293 |
+
|
43294 |
+
var asyncGenFunction = getEvalledConstructor('async function* () {}');
|
43295 |
+
var asyncGenFunctionPrototype = asyncGenFunction ? asyncGenFunction.prototype : undefined;
|
43296 |
+
var asyncGenPrototype = asyncGenFunctionPrototype ? asyncGenFunctionPrototype.prototype : undefined;
|
43297 |
+
|
43298 |
+
var TypedArray = typeof Uint8Array === 'undefined' ? undefined : getProto(Uint8Array);
|
43299 |
+
|
43300 |
+
var INTRINSICS = {
|
43301 |
+
'%AggregateError%': typeof AggregateError === 'undefined' ? undefined : AggregateError,
|
43302 |
+
'%Array%': Array,
|
43303 |
+
'%ArrayBuffer%': typeof ArrayBuffer === 'undefined' ? undefined : ArrayBuffer,
|
43304 |
+
'%ArrayIteratorPrototype%': hasSymbols ? getProto([][Symbol.iterator]()) : undefined,
|
43305 |
+
'%AsyncFromSyncIteratorPrototype%': undefined,
|
43306 |
+
'%AsyncFunction%': getEvalledConstructor('async function () {}'),
|
43307 |
+
'%AsyncGenerator%': asyncGenFunctionPrototype,
|
43308 |
+
'%AsyncGeneratorFunction%': asyncGenFunction,
|
43309 |
+
'%AsyncIteratorPrototype%': asyncGenPrototype ? getProto(asyncGenPrototype) : undefined,
|
43310 |
+
'%Atomics%': typeof Atomics === 'undefined' ? undefined : Atomics,
|
43311 |
+
'%BigInt%': typeof BigInt === 'undefined' ? undefined : BigInt,
|
43312 |
+
'%Boolean%': Boolean,
|
43313 |
+
'%DataView%': typeof DataView === 'undefined' ? undefined : DataView,
|
43314 |
+
'%Date%': Date,
|
43315 |
+
'%decodeURI%': decodeURI,
|
43316 |
+
'%decodeURIComponent%': decodeURIComponent,
|
43317 |
+
'%encodeURI%': encodeURI,
|
43318 |
+
'%encodeURIComponent%': encodeURIComponent,
|
43319 |
+
'%Error%': Error,
|
43320 |
+
'%eval%': eval, // eslint-disable-line no-eval
|
43321 |
+
'%EvalError%': EvalError,
|
43322 |
+
'%Float32Array%': typeof Float32Array === 'undefined' ? undefined : Float32Array,
|
43323 |
+
'%Float64Array%': typeof Float64Array === 'undefined' ? undefined : Float64Array,
|
43324 |
+
'%FinalizationRegistry%': typeof FinalizationRegistry === 'undefined' ? undefined : FinalizationRegistry,
|
43325 |
+
'%Function%': $Function,
|
43326 |
+
'%GeneratorFunction%': getEvalledConstructor('function* () {}'),
|
43327 |
+
'%Int8Array%': typeof Int8Array === 'undefined' ? undefined : Int8Array,
|
43328 |
+
'%Int16Array%': typeof Int16Array === 'undefined' ? undefined : Int16Array,
|
43329 |
+
'%Int32Array%': typeof Int32Array === 'undefined' ? undefined : Int32Array,
|
43330 |
+
'%isFinite%': isFinite,
|
43331 |
+
'%isNaN%': isNaN,
|
43332 |
+
'%IteratorPrototype%': hasSymbols ? getProto(getProto([][Symbol.iterator]())) : undefined,
|
43333 |
+
'%JSON%': typeof JSON === 'object' ? JSON : undefined,
|
43334 |
+
'%Map%': typeof Map === 'undefined' ? undefined : Map,
|
43335 |
+
'%MapIteratorPrototype%': typeof Map === 'undefined' || !hasSymbols ? undefined : getProto(new Map()[Symbol.iterator]()),
|
43336 |
+
'%Math%': Math,
|
43337 |
+
'%Number%': Number,
|
43338 |
+
'%Object%': Object,
|
43339 |
+
'%parseFloat%': parseFloat,
|
43340 |
+
'%parseInt%': parseInt,
|
43341 |
+
'%Promise%': typeof Promise === 'undefined' ? undefined : Promise,
|
43342 |
+
'%Proxy%': typeof Proxy === 'undefined' ? undefined : Proxy,
|
43343 |
+
'%RangeError%': RangeError,
|
43344 |
+
'%ReferenceError%': ReferenceError,
|
43345 |
+
'%Reflect%': typeof Reflect === 'undefined' ? undefined : Reflect,
|
43346 |
+
'%RegExp%': RegExp,
|
43347 |
+
'%Set%': typeof Set === 'undefined' ? undefined : Set,
|
43348 |
+
'%SetIteratorPrototype%': typeof Set === 'undefined' || !hasSymbols ? undefined : getProto(new Set()[Symbol.iterator]()),
|
43349 |
+
'%SharedArrayBuffer%': typeof SharedArrayBuffer === 'undefined' ? undefined : SharedArrayBuffer,
|
43350 |
+
'%String%': String,
|
43351 |
+
'%StringIteratorPrototype%': hasSymbols ? getProto(''[Symbol.iterator]()) : undefined,
|
43352 |
+
'%Symbol%': hasSymbols ? Symbol : undefined,
|
43353 |
+
'%SyntaxError%': $SyntaxError,
|
43354 |
+
'%ThrowTypeError%': ThrowTypeError,
|
43355 |
+
'%TypedArray%': TypedArray,
|
43356 |
+
'%TypeError%': $TypeError,
|
43357 |
+
'%Uint8Array%': typeof Uint8Array === 'undefined' ? undefined : Uint8Array,
|
43358 |
+
'%Uint8ClampedArray%': typeof Uint8ClampedArray === 'undefined' ? undefined : Uint8ClampedArray,
|
43359 |
+
'%Uint16Array%': typeof Uint16Array === 'undefined' ? undefined : Uint16Array,
|
43360 |
+
'%Uint32Array%': typeof Uint32Array === 'undefined' ? undefined : Uint32Array,
|
43361 |
+
'%URIError%': URIError,
|
43362 |
+
'%WeakMap%': typeof WeakMap === 'undefined' ? undefined : WeakMap,
|
43363 |
+
'%WeakRef%': typeof WeakRef === 'undefined' ? undefined : WeakRef,
|
43364 |
+
'%WeakSet%': typeof WeakSet === 'undefined' ? undefined : WeakSet
|
43365 |
+
};
|
43366 |
+
|
43367 |
+
var LEGACY_ALIASES = {
|
43368 |
+
'%ArrayBufferPrototype%': ['ArrayBuffer', 'prototype'],
|
43369 |
+
'%ArrayPrototype%': ['Array', 'prototype'],
|
43370 |
+
'%ArrayProto_entries%': ['Array', 'prototype', 'entries'],
|
43371 |
+
'%ArrayProto_forEach%': ['Array', 'prototype', 'forEach'],
|
43372 |
+
'%ArrayProto_keys%': ['Array', 'prototype', 'keys'],
|
43373 |
+
'%ArrayProto_values%': ['Array', 'prototype', 'values'],
|
43374 |
+
'%AsyncFunctionPrototype%': ['AsyncFunction', 'prototype'],
|
43375 |
+
'%AsyncGenerator%': ['AsyncGeneratorFunction', 'prototype'],
|
43376 |
+
'%AsyncGeneratorPrototype%': ['AsyncGeneratorFunction', 'prototype', 'prototype'],
|
43377 |
+
'%BooleanPrototype%': ['Boolean', 'prototype'],
|
43378 |
+
'%DataViewPrototype%': ['DataView', 'prototype'],
|
43379 |
+
'%DatePrototype%': ['Date', 'prototype'],
|
43380 |
+
'%ErrorPrototype%': ['Error', 'prototype'],
|
43381 |
+
'%EvalErrorPrototype%': ['EvalError', 'prototype'],
|
43382 |
+
'%Float32ArrayPrototype%': ['Float32Array', 'prototype'],
|
43383 |
+
'%Float64ArrayPrototype%': ['Float64Array', 'prototype'],
|
43384 |
+
'%FunctionPrototype%': ['Function', 'prototype'],
|
43385 |
+
'%Generator%': ['GeneratorFunction', 'prototype'],
|
43386 |
+
'%GeneratorPrototype%': ['GeneratorFunction', 'prototype', 'prototype'],
|
43387 |
+
'%Int8ArrayPrototype%': ['Int8Array', 'prototype'],
|
43388 |
+
'%Int16ArrayPrototype%': ['Int16Array', 'prototype'],
|
43389 |
+
'%Int32ArrayPrototype%': ['Int32Array', 'prototype'],
|
43390 |
+
'%JSONParse%': ['JSON', 'parse'],
|
43391 |
+
'%JSONStringify%': ['JSON', 'stringify'],
|
43392 |
+
'%MapPrototype%': ['Map', 'prototype'],
|
43393 |
+
'%NumberPrototype%': ['Number', 'prototype'],
|
43394 |
+
'%ObjectPrototype%': ['Object', 'prototype'],
|
43395 |
+
'%ObjProto_toString%': ['Object', 'prototype', 'toString'],
|
43396 |
+
'%ObjProto_valueOf%': ['Object', 'prototype', 'valueOf'],
|
43397 |
+
'%PromisePrototype%': ['Promise', 'prototype'],
|
43398 |
+
'%PromiseProto_then%': ['Promise', 'prototype', 'then'],
|
43399 |
+
'%Promise_all%': ['Promise', 'all'],
|
43400 |
+
'%Promise_reject%': ['Promise', 'reject'],
|
43401 |
+
'%Promise_resolve%': ['Promise', 'resolve'],
|
43402 |
+
'%RangeErrorPrototype%': ['RangeError', 'prototype'],
|
43403 |
+
'%ReferenceErrorPrototype%': ['ReferenceError', 'prototype'],
|
43404 |
+
'%RegExpPrototype%': ['RegExp', 'prototype'],
|
43405 |
+
'%SetPrototype%': ['Set', 'prototype'],
|
43406 |
+
'%SharedArrayBufferPrototype%': ['SharedArrayBuffer', 'prototype'],
|
43407 |
+
'%StringPrototype%': ['String', 'prototype'],
|
43408 |
+
'%SymbolPrototype%': ['Symbol', 'prototype'],
|
43409 |
+
'%SyntaxErrorPrototype%': ['SyntaxError', 'prototype'],
|
43410 |
+
'%TypedArrayPrototype%': ['TypedArray', 'prototype'],
|
43411 |
+
'%TypeErrorPrototype%': ['TypeError', 'prototype'],
|
43412 |
+
'%Uint8ArrayPrototype%': ['Uint8Array', 'prototype'],
|
43413 |
+
'%Uint8ClampedArrayPrototype%': ['Uint8ClampedArray', 'prototype'],
|
43414 |
+
'%Uint16ArrayPrototype%': ['Uint16Array', 'prototype'],
|
43415 |
+
'%Uint32ArrayPrototype%': ['Uint32Array', 'prototype'],
|
43416 |
+
'%URIErrorPrototype%': ['URIError', 'prototype'],
|
43417 |
+
'%WeakMapPrototype%': ['WeakMap', 'prototype'],
|
43418 |
+
'%WeakSetPrototype%': ['WeakSet', 'prototype']
|
43419 |
+
};
|
43420 |
+
|
43421 |
+
var bind = __webpack_require__(33);
|
43422 |
+
var hasOwn = __webpack_require__(38);
|
43423 |
+
var $concat = bind.call(Function.call, Array.prototype.concat);
|
43424 |
+
var $spliceApply = bind.call(Function.apply, Array.prototype.splice);
|
43425 |
+
var $replace = bind.call(Function.call, String.prototype.replace);
|
43426 |
+
|
43427 |
+
/* adapted from https://github.com/lodash/lodash/blob/4.17.15/dist/lodash.js#L6735-L6744 */
|
43428 |
+
var rePropName = /[^%.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|%$))/g;
|
43429 |
+
var reEscapeChar = /\\(\\)?/g; /** Used to match backslashes in property paths. */
|
43430 |
+
var stringToPath = function stringToPath(string) {
|
43431 |
+
var result = [];
|
43432 |
+
$replace(string, rePropName, function (match, number, quote, subString) {
|
43433 |
+
result[result.length] = quote ? $replace(subString, reEscapeChar, '$1') : number || match;
|
43434 |
+
});
|
43435 |
+
return result;
|
43436 |
+
};
|
43437 |
+
/* end adaptation */
|
43438 |
+
|
43439 |
+
var getBaseIntrinsic = function getBaseIntrinsic(name, allowMissing) {
|
43440 |
+
var intrinsicName = name;
|
43441 |
+
var alias;
|
43442 |
+
if (hasOwn(LEGACY_ALIASES, intrinsicName)) {
|
43443 |
+
alias = LEGACY_ALIASES[intrinsicName];
|
43444 |
+
intrinsicName = '%' + alias[0] + '%';
|
43445 |
+
}
|
43446 |
+
|
43447 |
+
if (hasOwn(INTRINSICS, intrinsicName)) {
|
43448 |
+
var value = INTRINSICS[intrinsicName];
|
43449 |
+
if (typeof value === 'undefined' && !allowMissing) {
|
43450 |
+
throw new $TypeError('intrinsic ' + name + ' exists, but is not available. Please file an issue!');
|
43451 |
+
}
|
43452 |
+
|
43453 |
+
return {
|
43454 |
+
alias: alias,
|
43455 |
+
name: intrinsicName,
|
43456 |
+
value: value
|
43457 |
+
};
|
43458 |
+
}
|
43459 |
+
|
43460 |
+
throw new $SyntaxError('intrinsic ' + name + ' does not exist!');
|
43461 |
+
};
|
43462 |
+
|
43463 |
+
module.exports = function GetIntrinsic(name, allowMissing) {
|
43464 |
+
if (typeof name !== 'string' || name.length === 0) {
|
43465 |
+
throw new $TypeError('intrinsic name must be a non-empty string');
|
43466 |
+
}
|
43467 |
+
if (arguments.length > 1 && typeof allowMissing !== 'boolean') {
|
43468 |
+
throw new $TypeError('"allowMissing" argument must be a boolean');
|
43469 |
+
}
|
43470 |
+
|
43471 |
+
var parts = stringToPath(name);
|
43472 |
+
var intrinsicBaseName = parts.length > 0 ? parts[0] : '';
|
43473 |
+
|
43474 |
+
var intrinsic = getBaseIntrinsic('%' + intrinsicBaseName + '%', allowMissing);
|
43475 |
+
var intrinsicRealName = intrinsic.name;
|
43476 |
+
var value = intrinsic.value;
|
43477 |
+
var skipFurtherCaching = false;
|
43478 |
+
|
43479 |
+
var alias = intrinsic.alias;
|
43480 |
+
if (alias) {
|
43481 |
+
intrinsicBaseName = alias[0];
|
43482 |
+
$spliceApply(parts, $concat([0, 1], alias));
|
43483 |
+
}
|
43484 |
+
|
43485 |
+
for (var i = 1, isOwn = true; i < parts.length; i += 1) {
|
43486 |
+
var part = parts[i];
|
43487 |
+
if (part === 'constructor' || !isOwn) {
|
43488 |
+
skipFurtherCaching = true;
|
43489 |
+
}
|
43490 |
+
|
43491 |
+
intrinsicBaseName += '.' + part;
|
43492 |
+
intrinsicRealName = '%' + intrinsicBaseName + '%';
|
43493 |
+
|
43494 |
+
if (hasOwn(INTRINSICS, intrinsicRealName)) {
|
43495 |
+
value = INTRINSICS[intrinsicRealName];
|
43496 |
+
} else if (value != null) {
|
43497 |
+
if ($gOPD && (i + 1) >= parts.length) {
|
43498 |
+
var desc = $gOPD(value, part);
|
43499 |
+
isOwn = !!desc;
|
43500 |
+
|
43501 |
+
if (!allowMissing && !(part in value)) {
|
43502 |
+
throw new $TypeError('base intrinsic for ' + name + ' exists, but the property is not available.');
|
43503 |
+
}
|
43504 |
+
// By convention, when a data property is converted to an accessor
|
43505 |
+
// property to emulate a data property that does not suffer from
|
43506 |
+
// the override mistake, that accessor's getter is marked with
|
43507 |
+
// an `originalValue` property. Here, when we detect this, we
|
43508 |
+
// uphold the illusion by pretending to see that original data
|
43509 |
+
// property, i.e., returning the value rather than the getter
|
43510 |
+
// itself.
|
43511 |
+
if (isOwn && 'get' in desc && !('originalValue' in desc.get)) {
|
43512 |
+
value = desc.get;
|
43513 |
+
} else {
|
43514 |
+
value = value[part];
|
43515 |
+
}
|
43516 |
+
} else {
|
43517 |
+
isOwn = hasOwn(value, part);
|
43518 |
+
value = value[part];
|
43519 |
+
}
|
43520 |
+
|
43521 |
+
if (isOwn && !skipFurtherCaching) {
|
43522 |
+
INTRINSICS[intrinsicRealName] = value;
|
43523 |
+
}
|
43524 |
+
}
|
43525 |
+
}
|
43526 |
+
return value;
|
43527 |
+
};
|
43528 |
+
|
43529 |
+
|
43530 |
+
/***/ }),
|
43531 |
+
/* 360 */
|
43532 |
/***/ (function(module, exports, __webpack_require__) {
|
43533 |
|
43534 |
"use strict";
|
43535 |
|
43536 |
|
43537 |
// modified from https://github.com/es-shims/es6-shim
|
43538 |
+
var keys = __webpack_require__(203);
|
|
|
43539 |
var canBeObject = function (obj) {
|
43540 |
return typeof obj !== 'undefined' && obj !== null;
|
43541 |
};
|
43542 |
+
var hasSymbols = __webpack_require__(205)();
|
43543 |
+
var callBound = __webpack_require__(682);
|
43544 |
var toObject = Object;
|
43545 |
+
var $push = callBound('Array.prototype.push');
|
43546 |
+
var $propIsEnumerable = callBound('Object.prototype.propertyIsEnumerable');
|
43547 |
var originalGetSymbols = hasSymbols ? Object.getOwnPropertySymbols : null;
|
43548 |
|
43549 |
+
// eslint-disable-next-line no-unused-vars
|
43550 |
module.exports = function assign(target, source1) {
|
43551 |
if (!canBeObject(target)) { throw new TypeError('target must be an object'); }
|
43552 |
var objTarget = toObject(target);
|
43559 |
syms = getSymbols(source);
|
43560 |
for (i = 0; i < syms.length; ++i) {
|
43561 |
key = syms[i];
|
43562 |
+
if ($propIsEnumerable(source, key)) {
|
43563 |
+
$push(props, key);
|
43564 |
}
|
43565 |
}
|
43566 |
}
|
43567 |
for (i = 0; i < props.length; ++i) {
|
43568 |
key = props[i];
|
43569 |
value = source[key];
|
43570 |
+
if ($propIsEnumerable(source, key)) {
|
43571 |
objTarget[key] = value;
|
43572 |
}
|
43573 |
}
|
43577 |
|
43578 |
|
43579 |
/***/ }),
|
43580 |
+
/* 361 */
|
43581 |
/***/ (function(module, exports, __webpack_require__) {
|
43582 |
|
43583 |
"use strict";
|
43584 |
|
43585 |
|
43586 |
+
var implementation = __webpack_require__(360);
|
43587 |
|
43588 |
var lacksProperEnumerationOrder = function () {
|
43589 |
if (!Object.assign) {
|
43590 |
return false;
|
43591 |
}
|
43592 |
+
/*
|
43593 |
+
* v8, specifically in node 4.x, has a bug with incorrect property enumeration order
|
43594 |
+
* note: this does not detect the bug unless there's 20 characters
|
43595 |
+
*/
|
43596 |
var str = 'abcdefghijklmnopqrst';
|
43597 |
var letters = str.split('');
|
43598 |
var map = {};
|
43611 |
if (!Object.assign || !Object.preventExtensions) {
|
43612 |
return false;
|
43613 |
}
|
43614 |
+
/*
|
43615 |
+
* Firefox 37 still has "pending exception" logic in its Object.assign implementation,
|
43616 |
+
* which is 72% slower than our shim, and Firefox 40's native implementation.
|
43617 |
+
*/
|
43618 |
var thrower = Object.preventExtensions({ 1: 2 });
|
43619 |
try {
|
43620 |
Object.assign(thrower, 'xy');
|
43639 |
|
43640 |
|
43641 |
/***/ }),
|
43642 |
+
/* 362 */
|
43643 |
/***/ (function(module, exports) {
|
43644 |
|
43645 |
Object.defineProperty(exports, "__esModule", {
|
43656 |
//# sourceMappingURL=isPlainObject.js.map
|
43657 |
|
43658 |
/***/ }),
|
43659 |
+
/* 363 */
|
43660 |
+
/***/ (function(module, exports, __webpack_require__) {
|
43661 |
+
|
43662 |
+
"use strict";
|
43663 |
+
|
43664 |
+
|
43665 |
+
var bind = __webpack_require__(33);
|
43666 |
+
|
43667 |
+
var GetIntrinsic = __webpack_require__(130);
|
43668 |
+
|
43669 |
+
var $apply = GetIntrinsic('%Function.prototype.apply%');
|
43670 |
+
var $call = GetIntrinsic('%Function.prototype.call%');
|
43671 |
+
var $reflectApply = GetIntrinsic('%Reflect.apply%', true) || bind.call($call, $apply);
|
43672 |
+
|
43673 |
+
var $defineProperty = GetIntrinsic('%Object.defineProperty%', true);
|
43674 |
+
|
43675 |
+
if ($defineProperty) {
|
43676 |
+
try {
|
43677 |
+
$defineProperty({}, 'a', { value: 1 });
|
43678 |
+
} catch (e) {
|
43679 |
+
// IE 8 has a broken defineProperty
|
43680 |
+
$defineProperty = null;
|
43681 |
+
}
|
43682 |
+
}
|
43683 |
+
|
43684 |
+
module.exports = function callBind() {
|
43685 |
+
return $reflectApply(bind, $call, arguments);
|
43686 |
+
};
|
43687 |
+
|
43688 |
+
var applyBind = function applyBind() {
|
43689 |
+
return $reflectApply(bind, $apply, arguments);
|
43690 |
+
};
|
43691 |
+
|
43692 |
+
if ($defineProperty) {
|
43693 |
+
$defineProperty(module.exports, 'apply', { value: applyBind });
|
43694 |
+
} else {
|
43695 |
+
module.exports.apply = applyBind;
|
43696 |
+
}
|
43697 |
+
|
43698 |
+
|
43699 |
+
/***/ }),
|
43700 |
+
/* 364 */
|
43701 |
/***/ (function(module, exports, __webpack_require__) {
|
43702 |
|
43703 |
"use strict";
|
43704 |
|
43705 |
|
43706 |
+
var RequireObjectCoercible = __webpack_require__(695);
|
43707 |
+
var has = __webpack_require__(38);
|
43708 |
+
var callBound = __webpack_require__(697);
|
43709 |
var $isEnumerable = callBound('Object.prototype.propertyIsEnumerable');
|
43710 |
|
43711 |
module.exports = function entries(O) {
|
43721 |
|
43722 |
|
43723 |
/***/ }),
|
43724 |
+
/* 365 */
|
43725 |
/***/ (function(module, exports, __webpack_require__) {
|
43726 |
|
43727 |
"use strict";
|
43728 |
|
43729 |
|
43730 |
+
var implementation = __webpack_require__(364);
|
43731 |
|
43732 |
module.exports = function getPolyfill() {
|
43733 |
return typeof Object.entries === 'function' ? Object.entries : implementation;
|
43735 |
|
43736 |
|
43737 |
/***/ }),
|
43738 |
+
/* 366 */
|
43739 |
/***/ (function(module, exports, __webpack_require__) {
|
43740 |
|
43741 |
"use strict";
|
43746 |
});
|
43747 |
exports["default"] = valuesOfValidator;
|
43748 |
|
43749 |
+
var _isPrimitive = _interopRequireDefault(__webpack_require__(367));
|
43750 |
|
43751 |
var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
43752 |
|
43796 |
//# sourceMappingURL=valuesOf.js.map
|
43797 |
|
43798 |
/***/ }),
|
43799 |
+
/* 367 */
|
43800 |
/***/ (function(module, exports, __webpack_require__) {
|
43801 |
|
43802 |
"use strict";
|
43807 |
});
|
43808 |
exports["default"] = isPrimitive;
|
43809 |
|
43810 |
+
function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }
|
43811 |
|
43812 |
function isPrimitive(x) {
|
43813 |
return !x || _typeof(x) !== 'object' && typeof x !== 'function';
|
43815 |
//# sourceMappingURL=isPrimitive.js.map
|
43816 |
|
43817 |
/***/ }),
|
43818 |
+
/* 368 */
|
43819 |
/***/ (function(module, exports, __webpack_require__) {
|
43820 |
|
43821 |
"use strict";
|
43822 |
|
43823 |
|
43824 |
+
var define = __webpack_require__(28);
|
43825 |
+
var RequireObjectCoercible = __webpack_require__(369);
|
43826 |
|
43827 |
+
var implementation = __webpack_require__(370);
|
43828 |
+
var getPolyfill = __webpack_require__(372);
|
43829 |
+
var shim = __webpack_require__(719);
|
43830 |
|
43831 |
var slice = Array.prototype.slice;
|
43832 |
|
43848 |
|
43849 |
|
43850 |
/***/ }),
|
43851 |
+
/* 369 */
|
43852 |
+
/***/ (function(module, exports, __webpack_require__) {
|
43853 |
+
|
43854 |
+
"use strict";
|
43855 |
+
|
43856 |
+
|
43857 |
+
module.exports = __webpack_require__(703);
|
43858 |
+
|
43859 |
+
|
43860 |
+
/***/ }),
|
43861 |
+
/* 370 */
|
43862 |
/***/ (function(module, exports, __webpack_require__) {
|
43863 |
|
43864 |
"use strict";
|
43865 |
|
43866 |
|
43867 |
+
var ToObject = __webpack_require__(704);
|
43868 |
+
var ToLength = __webpack_require__(705);
|
43869 |
+
var IsCallable = __webpack_require__(718);
|
43870 |
|
43871 |
module.exports = function find(predicate) {
|
43872 |
var list = ToObject(this);
|
43894 |
|
43895 |
|
43896 |
/***/ }),
|
43897 |
+
/* 371 */
|
43898 |
+
/***/ (function(module, exports, __webpack_require__) {
|
43899 |
+
|
43900 |
+
"use strict";
|
43901 |
+
|
43902 |
+
|
43903 |
+
var bind = __webpack_require__(33);
|
43904 |
+
|
43905 |
+
var GetIntrinsic = __webpack_require__(44);
|
43906 |
+
|
43907 |
+
var $apply = GetIntrinsic('%Function.prototype.apply%');
|
43908 |
+
var $call = GetIntrinsic('%Function.prototype.call%');
|
43909 |
+
var $reflectApply = GetIntrinsic('%Reflect.apply%', true) || bind.call($call, $apply);
|
43910 |
+
|
43911 |
+
var $defineProperty = GetIntrinsic('%Object.defineProperty%', true);
|
43912 |
+
|
43913 |
+
if ($defineProperty) {
|
43914 |
+
try {
|
43915 |
+
$defineProperty({}, 'a', { value: 1 });
|
43916 |
+
} catch (e) {
|
43917 |
+
// IE 8 has a broken defineProperty
|
43918 |
+
$defineProperty = null;
|
43919 |
+
}
|
43920 |
+
}
|
43921 |
+
|
43922 |
+
module.exports = function callBind() {
|
43923 |
+
return $reflectApply(bind, $call, arguments);
|
43924 |
+
};
|
43925 |
+
|
43926 |
+
var applyBind = function applyBind() {
|
43927 |
+
return $reflectApply(bind, $apply, arguments);
|
43928 |
+
};
|
43929 |
+
|
43930 |
+
if ($defineProperty) {
|
43931 |
+
$defineProperty(module.exports, 'apply', { value: applyBind });
|
43932 |
+
} else {
|
43933 |
+
module.exports.apply = applyBind;
|
43934 |
+
}
|
43935 |
+
|
43936 |
+
|
43937 |
+
/***/ }),
|
43938 |
+
/* 372 */
|
43939 |
/***/ (function(module, exports, __webpack_require__) {
|
43940 |
|
43941 |
"use strict";
|
43950 |
}) !== 1;
|
43951 |
|
43952 |
// eslint-disable-next-line global-require
|
43953 |
+
return implemented ? Array.prototype.find : __webpack_require__(370);
|
43954 |
};
|
43955 |
|
43956 |
|
43957 |
/***/ }),
|
43958 |
+
/* 373 */
|
43959 |
+
/***/ (function(module, exports, __webpack_require__) {
|
43960 |
+
|
43961 |
+
"use strict";
|
43962 |
+
|
43963 |
+
|
43964 |
+
var bind = __webpack_require__(33);
|
43965 |
+
|
43966 |
+
var GetIntrinsic = __webpack_require__(374);
|
43967 |
+
|
43968 |
+
var $apply = GetIntrinsic('%Function.prototype.apply%');
|
43969 |
+
var $call = GetIntrinsic('%Function.prototype.call%');
|
43970 |
+
var $reflectApply = GetIntrinsic('%Reflect.apply%', true) || bind.call($call, $apply);
|
43971 |
+
|
43972 |
+
var $defineProperty = GetIntrinsic('%Object.defineProperty%', true);
|
43973 |
+
|
43974 |
+
if ($defineProperty) {
|
43975 |
+
try {
|
43976 |
+
$defineProperty({}, 'a', { value: 1 });
|
43977 |
+
} catch (e) {
|
43978 |
+
// IE 8 has a broken defineProperty
|
43979 |
+
$defineProperty = null;
|
43980 |
+
}
|
43981 |
+
}
|
43982 |
+
|
43983 |
+
module.exports = function callBind() {
|
43984 |
+
return $reflectApply(bind, $call, arguments);
|
43985 |
+
};
|
43986 |
+
|
43987 |
+
var applyBind = function applyBind() {
|
43988 |
+
return $reflectApply(bind, $apply, arguments);
|
43989 |
+
};
|
43990 |
+
|
43991 |
+
if ($defineProperty) {
|
43992 |
+
$defineProperty(module.exports, 'apply', { value: applyBind });
|
43993 |
+
} else {
|
43994 |
+
module.exports.apply = applyBind;
|
43995 |
+
}
|
43996 |
+
|
43997 |
+
|
43998 |
+
/***/ }),
|
43999 |
+
/* 374 */
|
44000 |
/***/ (function(module, exports, __webpack_require__) {
|
44001 |
|
44002 |
"use strict";
|
44003 |
|
44004 |
|
44005 |
+
/* globals
|
44006 |
+
Atomics,
|
44007 |
+
SharedArrayBuffer,
|
44008 |
+
*/
|
44009 |
+
|
44010 |
+
var undefined;
|
44011 |
+
|
44012 |
+
var $TypeError = TypeError;
|
44013 |
+
|
44014 |
+
var $gOPD = Object.getOwnPropertyDescriptor;
|
44015 |
+
if ($gOPD) {
|
44016 |
+
try {
|
44017 |
+
$gOPD({}, '');
|
44018 |
+
} catch (e) {
|
44019 |
+
$gOPD = null; // this is IE 8, which has a broken gOPD
|
44020 |
+
}
|
44021 |
+
}
|
44022 |
+
|
44023 |
+
var throwTypeError = function () { throw new $TypeError(); };
|
44024 |
+
var ThrowTypeError = $gOPD
|
44025 |
+
? (function () {
|
44026 |
+
try {
|
44027 |
+
// eslint-disable-next-line no-unused-expressions, no-caller, no-restricted-properties
|
44028 |
+
arguments.callee; // IE 8 does not throw here
|
44029 |
+
return throwTypeError;
|
44030 |
+
} catch (calleeThrows) {
|
44031 |
+
try {
|
44032 |
+
// IE 8 throws on Object.getOwnPropertyDescriptor(arguments, '')
|
44033 |
+
return $gOPD(arguments, 'callee').get;
|
44034 |
+
} catch (gOPDthrows) {
|
44035 |
+
return throwTypeError;
|
44036 |
+
}
|
44037 |
+
}
|
44038 |
+
}())
|
44039 |
+
: throwTypeError;
|
44040 |
+
|
44041 |
+
var hasSymbols = __webpack_require__(43)();
|
44042 |
+
|
44043 |
+
var getProto = Object.getPrototypeOf || function (x) { return x.__proto__; }; // eslint-disable-line no-proto
|
44044 |
+
|
44045 |
+
var generator; // = function * () {};
|
44046 |
+
var generatorFunction = generator ? getProto(generator) : undefined;
|
44047 |
+
var asyncFn; // async function() {};
|
44048 |
+
var asyncFunction = asyncFn ? asyncFn.constructor : undefined;
|
44049 |
+
var asyncGen; // async function * () {};
|
44050 |
+
var asyncGenFunction = asyncGen ? getProto(asyncGen) : undefined;
|
44051 |
+
var asyncGenIterator = asyncGen ? asyncGen() : undefined;
|
44052 |
+
|
44053 |
+
var TypedArray = typeof Uint8Array === 'undefined' ? undefined : getProto(Uint8Array);
|
44054 |
+
|
44055 |
+
var INTRINSICS = {
|
44056 |
+
'%Array%': Array,
|
44057 |
+
'%ArrayBuffer%': typeof ArrayBuffer === 'undefined' ? undefined : ArrayBuffer,
|
44058 |
+
'%ArrayBufferPrototype%': typeof ArrayBuffer === 'undefined' ? undefined : ArrayBuffer.prototype,
|
44059 |
+
'%ArrayIteratorPrototype%': hasSymbols ? getProto([][Symbol.iterator]()) : undefined,
|
44060 |
+
'%ArrayPrototype%': Array.prototype,
|
44061 |
+
'%ArrayProto_entries%': Array.prototype.entries,
|
44062 |
+
'%ArrayProto_forEach%': Array.prototype.forEach,
|
44063 |
+
'%ArrayProto_keys%': Array.prototype.keys,
|
44064 |
+
'%ArrayProto_values%': Array.prototype.values,
|
44065 |
+
'%AsyncFromSyncIteratorPrototype%': undefined,
|
44066 |
+
'%AsyncFunction%': asyncFunction,
|
44067 |
+
'%AsyncFunctionPrototype%': asyncFunction ? asyncFunction.prototype : undefined,
|
44068 |
+
'%AsyncGenerator%': asyncGen ? getProto(asyncGenIterator) : undefined,
|
44069 |
+
'%AsyncGeneratorFunction%': asyncGenFunction,
|
44070 |
+
'%AsyncGeneratorPrototype%': asyncGenFunction ? asyncGenFunction.prototype : undefined,
|
44071 |
+
'%AsyncIteratorPrototype%': asyncGenIterator && hasSymbols && Symbol.asyncIterator ? asyncGenIterator[Symbol.asyncIterator]() : undefined,
|
44072 |
+
'%Atomics%': typeof Atomics === 'undefined' ? undefined : Atomics,
|
44073 |
+
'%Boolean%': Boolean,
|
44074 |
+
'%BooleanPrototype%': Boolean.prototype,
|
44075 |
+
'%DataView%': typeof DataView === 'undefined' ? undefined : DataView,
|
44076 |
+
'%DataViewPrototype%': typeof DataView === 'undefined' ? undefined : DataView.prototype,
|
44077 |
+
'%Date%': Date,
|
44078 |
+
'%DatePrototype%': Date.prototype,
|
44079 |
+
'%decodeURI%': decodeURI,
|
44080 |
+
'%decodeURIComponent%': decodeURIComponent,
|
44081 |
+
'%encodeURI%': encodeURI,
|
44082 |
+
'%encodeURIComponent%': encodeURIComponent,
|
44083 |
+
'%Error%': Error,
|
44084 |
+
'%ErrorPrototype%': Error.prototype,
|
44085 |
+
'%eval%': eval, // eslint-disable-line no-eval
|
44086 |
+
'%EvalError%': EvalError,
|
44087 |
+
'%EvalErrorPrototype%': EvalError.prototype,
|
44088 |
+
'%Float32Array%': typeof Float32Array === 'undefined' ? undefined : Float32Array,
|
44089 |
+
'%Float32ArrayPrototype%': typeof Float32Array === 'undefined' ? undefined : Float32Array.prototype,
|
44090 |
+
'%Float64Array%': typeof Float64Array === 'undefined' ? undefined : Float64Array,
|
44091 |
+
'%Float64ArrayPrototype%': typeof Float64Array === 'undefined' ? undefined : Float64Array.prototype,
|
44092 |
+
'%Function%': Function,
|
44093 |
+
'%FunctionPrototype%': Function.prototype,
|
44094 |
+
'%Generator%': generator ? getProto(generator()) : undefined,
|
44095 |
+
'%GeneratorFunction%': generatorFunction,
|
44096 |
+
'%GeneratorPrototype%': generatorFunction ? generatorFunction.prototype : undefined,
|
44097 |
+
'%Int8Array%': typeof Int8Array === 'undefined' ? undefined : Int8Array,
|
44098 |
+
'%Int8ArrayPrototype%': typeof Int8Array === 'undefined' ? undefined : Int8Array.prototype,
|
44099 |
+
'%Int16Array%': typeof Int16Array === 'undefined' ? undefined : Int16Array,
|
44100 |
+
'%Int16ArrayPrototype%': typeof Int16Array === 'undefined' ? undefined : Int8Array.prototype,
|
44101 |
+
'%Int32Array%': typeof Int32Array === 'undefined' ? undefined : Int32Array,
|
44102 |
+
'%Int32ArrayPrototype%': typeof Int32Array === 'undefined' ? undefined : Int32Array.prototype,
|
44103 |
+
'%isFinite%': isFinite,
|
44104 |
+
'%isNaN%': isNaN,
|
44105 |
+
'%IteratorPrototype%': hasSymbols ? getProto(getProto([][Symbol.iterator]())) : undefined,
|
44106 |
+
'%JSON%': typeof JSON === 'object' ? JSON : undefined,
|
44107 |
+
'%JSONParse%': typeof JSON === 'object' ? JSON.parse : undefined,
|
44108 |
+
'%Map%': typeof Map === 'undefined' ? undefined : Map,
|
44109 |
+
'%MapIteratorPrototype%': typeof Map === 'undefined' || !hasSymbols ? undefined : getProto(new Map()[Symbol.iterator]()),
|
44110 |
+
'%MapPrototype%': typeof Map === 'undefined' ? undefined : Map.prototype,
|
44111 |
+
'%Math%': Math,
|
44112 |
+
'%Number%': Number,
|
44113 |
+
'%NumberPrototype%': Number.prototype,
|
44114 |
+
'%Object%': Object,
|
44115 |
+
'%ObjectPrototype%': Object.prototype,
|
44116 |
+
'%ObjProto_toString%': Object.prototype.toString,
|
44117 |
+
'%ObjProto_valueOf%': Object.prototype.valueOf,
|
44118 |
+
'%parseFloat%': parseFloat,
|
44119 |
+
'%parseInt%': parseInt,
|
44120 |
+
'%Promise%': typeof Promise === 'undefined' ? undefined : Promise,
|
44121 |
+
'%PromisePrototype%': typeof Promise === 'undefined' ? undefined : Promise.prototype,
|
44122 |
+
'%PromiseProto_then%': typeof Promise === 'undefined' ? undefined : Promise.prototype.then,
|
44123 |
+
'%Promise_all%': typeof Promise === 'undefined' ? undefined : Promise.all,
|
44124 |
+
'%Promise_reject%': typeof Promise === 'undefined' ? undefined : Promise.reject,
|
44125 |
+
'%Promise_resolve%': typeof Promise === 'undefined' ? undefined : Promise.resolve,
|
44126 |
+
'%Proxy%': typeof Proxy === 'undefined' ? undefined : Proxy,
|
44127 |
+
'%RangeError%': RangeError,
|
44128 |
+
'%RangeErrorPrototype%': RangeError.prototype,
|
44129 |
+
'%ReferenceError%': ReferenceError,
|
44130 |
+
'%ReferenceErrorPrototype%': ReferenceError.prototype,
|
44131 |
+
'%Reflect%': typeof Reflect === 'undefined' ? undefined : Reflect,
|
44132 |
+
'%RegExp%': RegExp,
|
44133 |
+
'%RegExpPrototype%': RegExp.prototype,
|
44134 |
+
'%Set%': typeof Set === 'undefined' ? undefined : Set,
|
44135 |
+
'%SetIteratorPrototype%': typeof Set === 'undefined' || !hasSymbols ? undefined : getProto(new Set()[Symbol.iterator]()),
|
44136 |
+
'%SetPrototype%': typeof Set === 'undefined' ? undefined : Set.prototype,
|
44137 |
+
'%SharedArrayBuffer%': typeof SharedArrayBuffer === 'undefined' ? undefined : SharedArrayBuffer,
|
44138 |
+
'%SharedArrayBufferPrototype%': typeof SharedArrayBuffer === 'undefined' ? undefined : SharedArrayBuffer.prototype,
|
44139 |
+
'%String%': String,
|
44140 |
+
'%StringIteratorPrototype%': hasSymbols ? getProto(''[Symbol.iterator]()) : undefined,
|
44141 |
+
'%StringPrototype%': String.prototype,
|
44142 |
+
'%Symbol%': hasSymbols ? Symbol : undefined,
|
44143 |
+
'%SymbolPrototype%': hasSymbols ? Symbol.prototype : undefined,
|
44144 |
+
'%SyntaxError%': SyntaxError,
|
44145 |
+
'%SyntaxErrorPrototype%': SyntaxError.prototype,
|
44146 |
+
'%ThrowTypeError%': ThrowTypeError,
|
44147 |
+
'%TypedArray%': TypedArray,
|
44148 |
+
'%TypedArrayPrototype%': TypedArray ? TypedArray.prototype : undefined,
|
44149 |
+
'%TypeError%': $TypeError,
|
44150 |
+
'%TypeErrorPrototype%': $TypeError.prototype,
|
44151 |
+
'%Uint8Array%': typeof Uint8Array === 'undefined' ? undefined : Uint8Array,
|
44152 |
+
'%Uint8ArrayPrototype%': typeof Uint8Array === 'undefined' ? undefined : Uint8Array.prototype,
|
44153 |
+
'%Uint8ClampedArray%': typeof Uint8ClampedArray === 'undefined' ? undefined : Uint8ClampedArray,
|
44154 |
+
'%Uint8ClampedArrayPrototype%': typeof Uint8ClampedArray === 'undefined' ? undefined : Uint8ClampedArray.prototype,
|
44155 |
+
'%Uint16Array%': typeof Uint16Array === 'undefined' ? undefined : Uint16Array,
|
44156 |
+
'%Uint16ArrayPrototype%': typeof Uint16Array === 'undefined' ? undefined : Uint16Array.prototype,
|
44157 |
+
'%Uint32Array%': typeof Uint32Array === 'undefined' ? undefined : Uint32Array,
|
44158 |
+
'%Uint32ArrayPrototype%': typeof Uint32Array === 'undefined' ? undefined : Uint32Array.prototype,
|
44159 |
+
'%URIError%': URIError,
|
44160 |
+
'%URIErrorPrototype%': URIError.prototype,
|
44161 |
+
'%WeakMap%': typeof WeakMap === 'undefined' ? undefined : WeakMap,
|
44162 |
+
'%WeakMapPrototype%': typeof WeakMap === 'undefined' ? undefined : WeakMap.prototype,
|
44163 |
+
'%WeakSet%': typeof WeakSet === 'undefined' ? undefined : WeakSet,
|
44164 |
+
'%WeakSetPrototype%': typeof WeakSet === 'undefined' ? undefined : WeakSet.prototype
|
44165 |
+
};
|
44166 |
+
|
44167 |
+
var bind = __webpack_require__(33);
|
44168 |
+
var $replace = bind.call(Function.call, String.prototype.replace);
|
44169 |
+
|
44170 |
+
/* adapted from https://github.com/lodash/lodash/blob/4.17.15/dist/lodash.js#L6735-L6744 */
|
44171 |
+
var rePropName = /[^%.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|%$))/g;
|
44172 |
+
var reEscapeChar = /\\(\\)?/g; /** Used to match backslashes in property paths. */
|
44173 |
+
var stringToPath = function stringToPath(string) {
|
44174 |
+
var result = [];
|
44175 |
+
$replace(string, rePropName, function (match, number, quote, subString) {
|
44176 |
+
result[result.length] = quote ? $replace(subString, reEscapeChar, '$1') : (number || match);
|
44177 |
+
});
|
44178 |
+
return result;
|
44179 |
+
};
|
44180 |
+
/* end adaptation */
|
44181 |
+
|
44182 |
+
var getBaseIntrinsic = function getBaseIntrinsic(name, allowMissing) {
|
44183 |
+
if (!(name in INTRINSICS)) {
|
44184 |
+
throw new SyntaxError('intrinsic ' + name + ' does not exist!');
|
44185 |
+
}
|
44186 |
+
|
44187 |
+
// istanbul ignore if // hopefully this is impossible to test :-)
|
44188 |
+
if (typeof INTRINSICS[name] === 'undefined' && !allowMissing) {
|
44189 |
+
throw new $TypeError('intrinsic ' + name + ' exists, but is not available. Please file an issue!');
|
44190 |
+
}
|
44191 |
+
|
44192 |
+
return INTRINSICS[name];
|
44193 |
+
};
|
44194 |
+
|
44195 |
+
module.exports = function GetIntrinsic(name, allowMissing) {
|
44196 |
+
if (typeof name !== 'string' || name.length === 0) {
|
44197 |
+
throw new TypeError('intrinsic name must be a non-empty string');
|
44198 |
+
}
|
44199 |
+
if (arguments.length > 1 && typeof allowMissing !== 'boolean') {
|
44200 |
+
throw new TypeError('"allowMissing" argument must be a boolean');
|
44201 |
+
}
|
44202 |
+
|
44203 |
+
var parts = stringToPath(name);
|
44204 |
+
|
44205 |
+
var value = getBaseIntrinsic('%' + (parts.length > 0 ? parts[0] : '') + '%', allowMissing);
|
44206 |
+
for (var i = 1; i < parts.length; i += 1) {
|
44207 |
+
if (value != null) {
|
44208 |
+
if ($gOPD && (i + 1) >= parts.length) {
|
44209 |
+
var desc = $gOPD(value, parts[i]);
|
44210 |
+
if (!allowMissing && !(parts[i] in value)) {
|
44211 |
+
throw new $TypeError('base intrinsic for ' + name + ' exists, but the property is not available.');
|
44212 |
+
}
|
44213 |
+
// By convention, when a data property is converted to an accessor
|
44214 |
+
// property to emulate a data property that does not suffer from
|
44215 |
+
// the override mistake, that accessor's getter is marked with
|
44216 |
+
// an `originalValue` property. Here, when we detect this, we
|
44217 |
+
// uphold the illusion by pretending to see that original data
|
44218 |
+
// property, i.e., returning the value rather than the getter
|
44219 |
+
// itself.
|
44220 |
+
value = desc && 'get' in desc && !('originalValue' in desc.get) ? desc.get : value[parts[i]];
|
44221 |
+
} else {
|
44222 |
+
value = value[parts[i]];
|
44223 |
+
}
|
44224 |
+
}
|
44225 |
+
}
|
44226 |
+
return value;
|
44227 |
+
};
|
44228 |
+
|
44229 |
+
|
44230 |
+
/***/ }),
|
44231 |
+
/* 375 */
|
44232 |
+
/***/ (function(module, exports, __webpack_require__) {
|
44233 |
+
|
44234 |
+
"use strict";
|
44235 |
+
|
44236 |
+
|
44237 |
+
var IsCallable = __webpack_require__(721);
|
44238 |
+
var functionsHaveNames = __webpack_require__(376)();
|
44239 |
+
var callBound = __webpack_require__(722);
|
44240 |
var $functionToString = callBound('Function.prototype.toString');
|
44241 |
var $stringMatch = callBound('String.prototype.match');
|
44242 |
|
44278 |
|
44279 |
|
44280 |
/***/ }),
|
44281 |
+
/* 376 */
|
44282 |
/***/ (function(module, exports, __webpack_require__) {
|
44283 |
|
44284 |
"use strict";
|
44312 |
|
44313 |
|
44314 |
/***/ }),
|
44315 |
+
/* 377 */
|
44316 |
/***/ (function(module, exports, __webpack_require__) {
|
44317 |
|
44318 |
"use strict";
|
44319 |
|
44320 |
|
44321 |
+
var implementation = __webpack_require__(375);
|
44322 |
|
44323 |
module.exports = function getPolyfill() {
|
44324 |
return implementation;
|
44326 |
|
44327 |
|
44328 |
/***/ }),
|
44329 |
+
/* 378 */
|
44330 |
/***/ (function(module, exports, __webpack_require__) {
|
44331 |
|
44332 |
"use strict";
|
44339 |
|
44340 |
var _propTypes = __webpack_require__(11);
|
44341 |
|
44342 |
+
var _and = _interopRequireDefault(__webpack_require__(49));
|
44343 |
|
44344 |
+
var _between = _interopRequireDefault(__webpack_require__(129));
|
44345 |
|
44346 |
+
var _nonNegativeInteger = _interopRequireDefault(__webpack_require__(379));
|
44347 |
|
44348 |
+
var _object = _interopRequireDefault(__webpack_require__(385));
|
44349 |
|
44350 |
+
var _withShape = _interopRequireDefault(__webpack_require__(136));
|
44351 |
|
44352 |
+
var _typeOf = _interopRequireDefault(__webpack_require__(386));
|
44353 |
|
44354 |
var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
44355 |
|
44357 |
|
44358 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
44359 |
|
44360 |
+
function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }
|
44361 |
|
44362 |
function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }
|
44363 |
|
44464 |
var arrayOfValidator = (0, _propTypes.arrayOf)(validator).isRequired;
|
44465 |
var chunk = chunks.shift(); // extract the next chunk to test
|
44466 |
|
44467 |
+
var chunkError = arrayOfValidator.apply(void 0, [_objectSpread(_objectSpread({}, props), {}, _defineProperty({}, propName, chunk)), propName, componentName].concat(rest));
|
44468 |
|
44469 |
if (chunkError) {
|
44470 |
// this chunk is invalid
|
44557 |
//# sourceMappingURL=sequenceOf.js.map
|
44558 |
|
44559 |
/***/ }),
|
44560 |
+
/* 379 */
|
44561 |
/***/ (function(module, exports, __webpack_require__) {
|
44562 |
|
44563 |
"use strict";
|
44568 |
});
|
44569 |
exports["default"] = void 0;
|
44570 |
|
44571 |
+
var _and = _interopRequireDefault(__webpack_require__(49));
|
44572 |
|
44573 |
+
var _integer = _interopRequireDefault(__webpack_require__(135));
|
44574 |
|
44575 |
+
var _nonNegativeNumber = _interopRequireDefault(__webpack_require__(381));
|
44576 |
|
44577 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
44578 |
|
44582 |
//# sourceMappingURL=nonNegativeInteger.js.map
|
44583 |
|
44584 |
/***/ }),
|
44585 |
+
/* 380 */
|
44586 |
/***/ (function(module, exports, __webpack_require__) {
|
44587 |
|
44588 |
"use strict";
|
44605 |
//# sourceMappingURL=isInteger.js.map
|
44606 |
|
44607 |
/***/ }),
|
44608 |
+
/* 381 */
|
44609 |
/***/ (function(module, exports, __webpack_require__) {
|
44610 |
|
44611 |
"use strict";
|
44616 |
});
|
44617 |
exports["default"] = void 0;
|
44618 |
|
44619 |
+
var _objectIs = _interopRequireDefault(__webpack_require__(382));
|
44620 |
|
44621 |
var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
44622 |
|
44656 |
//# sourceMappingURL=nonNegativeNumber.js.map
|
44657 |
|
44658 |
/***/ }),
|
44659 |
+
/* 382 */
|
44660 |
/***/ (function(module, exports, __webpack_require__) {
|
44661 |
|
44662 |
"use strict";
|
44663 |
|
44664 |
|
44665 |
+
var define = __webpack_require__(28);
|
44666 |
+
var callBind = __webpack_require__(128);
|
44667 |
|
44668 |
+
var implementation = __webpack_require__(383);
|
44669 |
+
var getPolyfill = __webpack_require__(384);
|
44670 |
+
var shim = __webpack_require__(725);
|
44671 |
|
44672 |
var polyfill = callBind(getPolyfill(), Object);
|
44673 |
|
44681 |
|
44682 |
|
44683 |
/***/ }),
|
44684 |
+
/* 383 */
|
44685 |
/***/ (function(module, exports, __webpack_require__) {
|
44686 |
|
44687 |
"use strict";
|
44707 |
|
44708 |
|
44709 |
/***/ }),
|
44710 |
+
/* 384 */
|
44711 |
/***/ (function(module, exports, __webpack_require__) {
|
44712 |
|
44713 |
"use strict";
|
44714 |
|
44715 |
|
44716 |
+
var implementation = __webpack_require__(383);
|
44717 |
|
44718 |
module.exports = function getPolyfill() {
|
44719 |
return typeof Object.is === 'function' ? Object.is : implementation;
|
44721 |
|
44722 |
|
44723 |
/***/ }),
|
44724 |
+
/* 385 */
|
44725 |
/***/ (function(module, exports, __webpack_require__) {
|
44726 |
|
44727 |
"use strict";
|
44732 |
});
|
44733 |
exports["default"] = void 0;
|
44734 |
|
44735 |
+
var _isPlainObject = _interopRequireDefault(__webpack_require__(132));
|
44736 |
|
44737 |
+
var _typeOf = _interopRequireDefault(__webpack_require__(386));
|
44738 |
|
44739 |
var _wrapValidator = _interopRequireDefault(__webpack_require__(16));
|
44740 |
|
44788 |
//# sourceMappingURL=object.js.map
|
44789 |
|
44790 |
/***/ }),
|
44791 |
+
/* 386 */
|
44792 |
/***/ (function(module, exports, __webpack_require__) {
|
44793 |
|
44794 |
"use strict";
|
44799 |
});
|
44800 |
exports["default"] = typeOf;
|
44801 |
|
44802 |
+
var _react = _interopRequireDefault(__webpack_require__(9));
|
44803 |
|
44804 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
44805 |
|
44806 |
+
function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }
|
44807 |
|
44808 |
function typeOf(child) {
|
44809 |
if (child === null) {
|
44818 |
return _typeof(child);
|
44819 |
}
|
44820 |
|
44821 |
+
if ( /*#__PURE__*/_react["default"].isValidElement(child)) {
|
44822 |
return child.type;
|
44823 |
}
|
44824 |
|
44827 |
//# sourceMappingURL=typeOf.js.map
|
44828 |
|
44829 |
/***/ }),
|
44830 |
+
/* 387 */
|
44831 |
/***/ (function(module, exports, __webpack_require__) {
|
44832 |
|
44833 |
"use strict";
|
44844 |
|
44845 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
44846 |
|
44847 |
+
function _toConsumableArray(arr) { return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _unsupportedIterableToArray(arr) || _nonIterableSpread(); }
|
44848 |
+
|
44849 |
+
function _nonIterableSpread() { throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); }
|
44850 |
+
|
44851 |
+
function _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === "string") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === "Object" && o.constructor) n = o.constructor.name; if (n === "Map" || n === "Set") return Array.from(o); if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }
|
44852 |
|
44853 |
+
function _iterableToArray(iter) { if (typeof Symbol !== "undefined" && Symbol.iterator in Object(iter)) return Array.from(iter); }
|
44854 |
|
44855 |
+
function _arrayWithoutHoles(arr) { if (Array.isArray(arr)) return _arrayLikeToArray(arr); }
|
44856 |
|
44857 |
+
function _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; }
|
44858 |
|
44859 |
function oneOfTypeValidator(validators) {
|
44860 |
var validator = function oneOfType(props, propName, componentName) {
|
44921 |
//# sourceMappingURL=or.js.map
|
44922 |
|
44923 |
/***/ }),
|
44924 |
+
/* 388 */
|
44925 |
/***/ (function(module, exports, __webpack_require__) {
|
44926 |
|
44927 |
"use strict";
|
44936 |
|
44937 |
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { "default": obj }; }
|
44938 |
|
44939 |
+
function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }
|
44940 |
|
44941 |
function explicitNull(props, propName, componentName) {
|
44942 |
if (props[propName] == null) {
|
44962 |
//# sourceMappingURL=explicitNull.js.map
|
44963 |
|
44964 |
/***/ }),
|
44965 |
+
/* 389 */
|
44966 |
/***/ (function(module, exports, __webpack_require__) {
|
44967 |
|
44968 |
"use strict";
|
45044 |
//# sourceMappingURL=uniqueArray.js.map
|
45045 |
|
45046 |
/***/ }),
|
45047 |
+
/* 390 */
|
45048 |
/***/ (function(module, exports, __webpack_require__) {
|
45049 |
|
45050 |
"use strict";
|
45055 |
});
|
45056 |
exports['default'] = getCalendarDaySettings;
|
45057 |
|
45058 |
+
var _getPhrase = __webpack_require__(746);
|
45059 |
|
45060 |
var _getPhrase2 = _interopRequireDefault(_getPhrase);
|
45061 |
|
45102 |
}
|
45103 |
|
45104 |
/***/ }),
|
45105 |
+
/* 391 */
|
45106 |
/***/ (function(module, exports, __webpack_require__) {
|
45107 |
|
45108 |
"use strict";
|
45116 |
|
45117 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
45118 |
|
45119 |
+
var _object = __webpack_require__(25);
|
45120 |
|
45121 |
var _object2 = _interopRequireDefault(_object);
|
45122 |
|
45123 |
+
var _react = __webpack_require__(9);
|
45124 |
|
45125 |
var _react2 = _interopRequireDefault(_react);
|
45126 |
|
45128 |
|
45129 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
45130 |
|
45131 |
+
var _reactAddonsShallowCompare = __webpack_require__(57);
|
45132 |
|
45133 |
var _reactAddonsShallowCompare2 = _interopRequireDefault(_reactAddonsShallowCompare);
|
45134 |
|
45135 |
+
var _reactMomentProptypes = __webpack_require__(40);
|
45136 |
|
45137 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
45138 |
|
45139 |
+
var _airbnbPropTypes = __webpack_require__(22);
|
45140 |
|
45141 |
+
var _reactWithStyles = __webpack_require__(34);
|
45142 |
|
45143 |
var _moment = __webpack_require__(0);
|
45144 |
|
45145 |
var _moment2 = _interopRequireDefault(_moment);
|
45146 |
|
45147 |
+
var _defaultPhrases = __webpack_require__(29);
|
45148 |
|
45149 |
+
var _getPhrasePropTypes = __webpack_require__(31);
|
45150 |
|
45151 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
45152 |
|
45153 |
+
var _CalendarWeek = __webpack_require__(747);
|
45154 |
|
45155 |
var _CalendarWeek2 = _interopRequireDefault(_CalendarWeek);
|
45156 |
|
45157 |
+
var _CalendarDay = __webpack_require__(127);
|
45158 |
|
45159 |
var _CalendarDay2 = _interopRequireDefault(_CalendarDay);
|
45160 |
|
45161 |
+
var _calculateDimension = __webpack_require__(392);
|
45162 |
|
45163 |
var _calculateDimension2 = _interopRequireDefault(_calculateDimension);
|
45164 |
|
45165 |
+
var _getCalendarMonthWeeks = __webpack_require__(749);
|
45166 |
|
45167 |
var _getCalendarMonthWeeks2 = _interopRequireDefault(_getCalendarMonthWeeks);
|
45168 |
|
45169 |
+
var _isSameDay = __webpack_require__(58);
|
45170 |
|
45171 |
var _isSameDay2 = _interopRequireDefault(_isSameDay);
|
45172 |
|
45173 |
+
var _toISODateString = __webpack_require__(88);
|
45174 |
|
45175 |
var _toISODateString2 = _interopRequireDefault(_toISODateString);
|
45176 |
|
45177 |
+
var _ModifiersShape = __webpack_require__(87);
|
45178 |
|
45179 |
var _ModifiersShape2 = _interopRequireDefault(_ModifiersShape);
|
45180 |
|
45181 |
+
var _ScrollableOrientationShape = __webpack_require__(60);
|
45182 |
|
45183 |
var _ScrollableOrientationShape2 = _interopRequireDefault(_ScrollableOrientationShape);
|
45184 |
|
45185 |
+
var _DayOfWeekShape = __webpack_require__(50);
|
45186 |
|
45187 |
var _DayOfWeekShape2 = _interopRequireDefault(_DayOfWeekShape);
|
45188 |
|
45507 |
})(CalendarMonth);
|
45508 |
|
45509 |
/***/ }),
|
45510 |
+
/* 392 */
|
45511 |
/***/ (function(module, exports, __webpack_require__) {
|
45512 |
|
45513 |
"use strict";
|
45551 |
}
|
45552 |
|
45553 |
/***/ }),
|
45554 |
+
/* 393 */
|
45555 |
/***/ (function(module, exports, __webpack_require__) {
|
45556 |
|
45557 |
"use strict";
|
45565 |
|
45566 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
45567 |
|
45568 |
+
var _object = __webpack_require__(25);
|
45569 |
|
45570 |
var _object2 = _interopRequireDefault(_object);
|
45571 |
|
45572 |
+
var _react = __webpack_require__(9);
|
45573 |
|
45574 |
var _react2 = _interopRequireDefault(_react);
|
45575 |
|
45577 |
|
45578 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
45579 |
|
45580 |
+
var _reactAddonsShallowCompare = __webpack_require__(57);
|
45581 |
|
45582 |
var _reactAddonsShallowCompare2 = _interopRequireDefault(_reactAddonsShallowCompare);
|
45583 |
|
45584 |
+
var _reactMomentProptypes = __webpack_require__(40);
|
45585 |
|
45586 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
45587 |
|
45588 |
+
var _airbnbPropTypes = __webpack_require__(22);
|
45589 |
|
45590 |
+
var _reactWithStyles = __webpack_require__(34);
|
45591 |
|
45592 |
var _moment = __webpack_require__(0);
|
45593 |
|
45594 |
var _moment2 = _interopRequireDefault(_moment);
|
45595 |
|
45596 |
+
var _consolidatedEvents = __webpack_require__(89);
|
45597 |
|
45598 |
+
var _defaultPhrases = __webpack_require__(29);
|
45599 |
|
45600 |
+
var _getPhrasePropTypes = __webpack_require__(31);
|
45601 |
|
45602 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
45603 |
|
45604 |
+
var _CalendarMonth = __webpack_require__(391);
|
45605 |
|
45606 |
var _CalendarMonth2 = _interopRequireDefault(_CalendarMonth);
|
45607 |
|
45608 |
+
var _isTransitionEndSupported = __webpack_require__(750);
|
45609 |
|
45610 |
var _isTransitionEndSupported2 = _interopRequireDefault(_isTransitionEndSupported);
|
45611 |
|
45612 |
+
var _getTransformStyles = __webpack_require__(751);
|
45613 |
|
45614 |
var _getTransformStyles2 = _interopRequireDefault(_getTransformStyles);
|
45615 |
|
45616 |
+
var _getCalendarMonthWidth = __webpack_require__(394);
|
45617 |
|
45618 |
var _getCalendarMonthWidth2 = _interopRequireDefault(_getCalendarMonthWidth);
|
45619 |
|
45620 |
+
var _toISOMonthString = __webpack_require__(90);
|
45621 |
|
45622 |
var _toISOMonthString2 = _interopRequireDefault(_toISOMonthString);
|
45623 |
|
45624 |
+
var _isPrevMonth = __webpack_require__(752);
|
45625 |
|
45626 |
var _isPrevMonth2 = _interopRequireDefault(_isPrevMonth);
|
45627 |
|
45628 |
+
var _isNextMonth = __webpack_require__(753);
|
45629 |
|
45630 |
var _isNextMonth2 = _interopRequireDefault(_isNextMonth);
|
45631 |
|
45632 |
+
var _ModifiersShape = __webpack_require__(87);
|
45633 |
|
45634 |
var _ModifiersShape2 = _interopRequireDefault(_ModifiersShape);
|
45635 |
|
45636 |
+
var _ScrollableOrientationShape = __webpack_require__(60);
|
45637 |
|
45638 |
var _ScrollableOrientationShape2 = _interopRequireDefault(_ScrollableOrientationShape);
|
45639 |
|
45640 |
+
var _DayOfWeekShape = __webpack_require__(50);
|
45641 |
|
45642 |
var _DayOfWeekShape2 = _interopRequireDefault(_DayOfWeekShape);
|
45643 |
|
46117 |
})(CalendarMonthGrid);
|
46118 |
|
46119 |
/***/ }),
|
46120 |
+
/* 394 */
|
46121 |
/***/ (function(module, exports, __webpack_require__) {
|
46122 |
|
46123 |
"use strict";
|
46132 |
}
|
46133 |
|
46134 |
/***/ }),
|
46135 |
+
/* 395 */
|
46136 |
/***/ (function(module, exports, __webpack_require__) {
|
46137 |
|
46138 |
"use strict";
|
46157 |
}
|
46158 |
|
46159 |
/***/ }),
|
46160 |
+
/* 396 */
|
46161 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
46162 |
|
46163 |
"use strict";
|
46164 |
Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
46165 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__PortalCompat__ = __webpack_require__(397);
|
46166 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__PortalWithState__ = __webpack_require__(758);
|
46167 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "Portal", function() { return __WEBPACK_IMPORTED_MODULE_0__PortalCompat__["a"]; });
|
46168 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "PortalWithState", function() { return __WEBPACK_IMPORTED_MODULE_1__PortalWithState__["a"]; });
|
46169 |
|
46172 |
|
46173 |
|
46174 |
/***/ }),
|
46175 |
+
/* 397 */
|
46176 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
46177 |
|
46178 |
"use strict";
|
46179 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom__ = __webpack_require__(45);
|
46180 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react_dom__);
|
46181 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Portal__ = __webpack_require__(755);
|
46182 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__LegacyPortal__ = __webpack_require__(757);
|
46183 |
|
46184 |
|
46185 |
|
46196 |
/* harmony default export */ __webpack_exports__["a"] = (Portal);
|
46197 |
|
46198 |
/***/ }),
|
46199 |
+
/* 398 */
|
46200 |
/***/ (function(module, exports, __webpack_require__) {
|
46201 |
|
46202 |
"use strict";
|
46203 |
|
46204 |
|
46205 |
+
var has = __webpack_require__(38);
|
46206 |
+
var RequireObjectCoercible = __webpack_require__(760);
|
46207 |
+
var callBound = __webpack_require__(762);
|
46208 |
|
46209 |
var $isEnumerable = callBound('Object.prototype.propertyIsEnumerable');
|
46210 |
|
46221 |
|
46222 |
|
46223 |
/***/ }),
|
46224 |
+
/* 399 */
|
46225 |
/***/ (function(module, exports, __webpack_require__) {
|
46226 |
|
46227 |
"use strict";
|
46228 |
|
46229 |
|
46230 |
+
var implementation = __webpack_require__(398);
|
46231 |
|
46232 |
module.exports = function getPolyfill() {
|
46233 |
return typeof Object.values === 'function' ? Object.values : implementation;
|
46235 |
|
46236 |
|
46237 |
/***/ }),
|
46238 |
+
/* 400 */
|
46239 |
/***/ (function(module, exports, __webpack_require__) {
|
46240 |
|
46241 |
"use strict";
|
46264 |
|
46265 |
|
46266 |
/***/ }),
|
46267 |
+
/* 401 */
|
46268 |
/***/ (function(module, exports, __webpack_require__) {
|
46269 |
|
46270 |
"use strict";
|
46271 |
|
46272 |
|
46273 |
+
var implementation = __webpack_require__(400);
|
46274 |
|
46275 |
module.exports = function getPolyfill() {
|
46276 |
if (typeof document !== 'undefined') {
|
46278 |
return document.contains;
|
46279 |
}
|
46280 |
if (document.body && document.body.contains) {
|
46281 |
+
try {
|
46282 |
+
if (typeof document.body.contains.call(document, '') === 'boolean') {
|
46283 |
+
return document.body.contains;
|
46284 |
+
}
|
46285 |
+
} catch (e) { /**/ }
|
46286 |
}
|
46287 |
}
|
46288 |
return implementation;
|
46290 |
|
46291 |
|
46292 |
/***/ }),
|
46293 |
+
/* 402 */
|
46294 |
/***/ (function(module, exports, __webpack_require__) {
|
46295 |
|
46296 |
"use strict";
|
46304 |
|
46305 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
46306 |
|
46307 |
+
var _reactMomentProptypes = __webpack_require__(40);
|
46308 |
|
46309 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
46310 |
|
46311 |
+
var _airbnbPropTypes = __webpack_require__(22);
|
46312 |
|
46313 |
+
var _defaultPhrases = __webpack_require__(29);
|
46314 |
|
46315 |
+
var _getPhrasePropTypes = __webpack_require__(31);
|
46316 |
|
46317 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
46318 |
|
46319 |
+
var _FocusedInputShape = __webpack_require__(403);
|
46320 |
|
46321 |
var _FocusedInputShape2 = _interopRequireDefault(_FocusedInputShape);
|
46322 |
|
46323 |
+
var _IconPositionShape = __webpack_require__(71);
|
46324 |
|
46325 |
var _IconPositionShape2 = _interopRequireDefault(_IconPositionShape);
|
46326 |
|
46327 |
+
var _OrientationShape = __webpack_require__(404);
|
46328 |
|
46329 |
var _OrientationShape2 = _interopRequireDefault(_OrientationShape);
|
46330 |
|
46331 |
+
var _DisabledShape = __webpack_require__(91);
|
46332 |
|
46333 |
var _DisabledShape2 = _interopRequireDefault(_DisabledShape);
|
46334 |
|
46335 |
+
var _AnchorDirectionShape = __webpack_require__(405);
|
46336 |
|
46337 |
var _AnchorDirectionShape2 = _interopRequireDefault(_AnchorDirectionShape);
|
46338 |
|
46339 |
+
var _OpenDirectionShape = __webpack_require__(62);
|
46340 |
|
46341 |
var _OpenDirectionShape2 = _interopRequireDefault(_OpenDirectionShape);
|
46342 |
|
46343 |
+
var _DayOfWeekShape = __webpack_require__(50);
|
46344 |
|
46345 |
var _DayOfWeekShape2 = _interopRequireDefault(_DayOfWeekShape);
|
46346 |
|
46347 |
+
var _CalendarInfoPositionShape = __webpack_require__(72);
|
46348 |
|
46349 |
var _CalendarInfoPositionShape2 = _interopRequireDefault(_CalendarInfoPositionShape);
|
46350 |
|
46431 |
};
|
46432 |
|
46433 |
/***/ }),
|
46434 |
+
/* 403 */
|
46435 |
/***/ (function(module, exports, __webpack_require__) {
|
46436 |
|
46437 |
"use strict";
|
46452 |
exports['default'] = _propTypes2['default'].oneOf([_constants.START_DATE, _constants.END_DATE]);
|
46453 |
|
46454 |
/***/ }),
|
46455 |
+
/* 404 */
|
46456 |
/***/ (function(module, exports, __webpack_require__) {
|
46457 |
|
46458 |
"use strict";
|
46473 |
exports['default'] = _propTypes2['default'].oneOf([_constants.HORIZONTAL_ORIENTATION, _constants.VERTICAL_ORIENTATION]);
|
46474 |
|
46475 |
/***/ }),
|
46476 |
+
/* 405 */
|
46477 |
/***/ (function(module, exports, __webpack_require__) {
|
46478 |
|
46479 |
"use strict";
|
46494 |
exports['default'] = _propTypes2['default'].oneOf([_constants.ANCHOR_LEFT, _constants.ANCHOR_RIGHT]);
|
46495 |
|
46496 |
/***/ }),
|
46497 |
+
/* 406 */
|
46498 |
/***/ (function(module, exports, __webpack_require__) {
|
46499 |
|
46500 |
"use strict";
|
46518 |
}
|
46519 |
|
46520 |
/***/ }),
|
46521 |
+
/* 407 */
|
46522 |
/***/ (function(module, exports, __webpack_require__) {
|
46523 |
|
46524 |
"use strict";
|
46570 |
}
|
46571 |
|
46572 |
/***/ }),
|
46573 |
+
/* 408 */
|
46574 |
/***/ (function(module, exports, __webpack_require__) {
|
46575 |
|
46576 |
"use strict";
|
46659 |
}
|
46660 |
|
46661 |
/***/ }),
|
46662 |
+
/* 409 */
|
46663 |
/***/ (function(module, exports, __webpack_require__) {
|
46664 |
|
46665 |
"use strict";
|
46671 |
|
46672 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
46673 |
|
46674 |
+
var _react = __webpack_require__(9);
|
46675 |
|
46676 |
var _react2 = _interopRequireDefault(_react);
|
46677 |
|
46683 |
|
46684 |
var _moment2 = _interopRequireDefault(_moment);
|
46685 |
|
46686 |
+
var _reactMomentProptypes = __webpack_require__(40);
|
46687 |
|
46688 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
46689 |
|
46690 |
+
var _airbnbPropTypes = __webpack_require__(22);
|
46691 |
|
46692 |
+
var _OpenDirectionShape = __webpack_require__(62);
|
46693 |
|
46694 |
var _OpenDirectionShape2 = _interopRequireDefault(_OpenDirectionShape);
|
46695 |
|
46696 |
+
var _defaultPhrases = __webpack_require__(29);
|
46697 |
|
46698 |
+
var _getPhrasePropTypes = __webpack_require__(31);
|
46699 |
|
46700 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
46701 |
|
46702 |
+
var _DateRangePickerInput = __webpack_require__(410);
|
46703 |
|
46704 |
var _DateRangePickerInput2 = _interopRequireDefault(_DateRangePickerInput);
|
46705 |
|
46706 |
+
var _IconPositionShape = __webpack_require__(71);
|
46707 |
|
46708 |
var _IconPositionShape2 = _interopRequireDefault(_IconPositionShape);
|
46709 |
|
46710 |
+
var _DisabledShape = __webpack_require__(91);
|
46711 |
|
46712 |
var _DisabledShape2 = _interopRequireDefault(_DisabledShape);
|
46713 |
|
46714 |
+
var _toMomentObject = __webpack_require__(59);
|
46715 |
|
46716 |
var _toMomentObject2 = _interopRequireDefault(_toMomentObject);
|
46717 |
|
46718 |
+
var _toLocalizedDateString = __webpack_require__(142);
|
46719 |
|
46720 |
var _toLocalizedDateString2 = _interopRequireDefault(_toLocalizedDateString);
|
46721 |
|
46722 |
+
var _isInclusivelyAfterDay = __webpack_require__(73);
|
46723 |
|
46724 |
var _isInclusivelyAfterDay2 = _interopRequireDefault(_isInclusivelyAfterDay);
|
46725 |
|
46726 |
+
var _isBeforeDay = __webpack_require__(74);
|
46727 |
|
46728 |
var _isBeforeDay2 = _interopRequireDefault(_isBeforeDay);
|
46729 |
|
47144 |
DateRangePickerInputController.defaultProps = defaultProps;
|
47145 |
|
47146 |
/***/ }),
|
47147 |
+
/* 410 */
|
47148 |
/***/ (function(module, exports, __webpack_require__) {
|
47149 |
|
47150 |
"use strict";
|
47156 |
|
47157 |
var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; };
|
47158 |
|
47159 |
+
var _object = __webpack_require__(25);
|
47160 |
|
47161 |
var _object2 = _interopRequireDefault(_object);
|
47162 |
|
47163 |
+
var _react = __webpack_require__(9);
|
47164 |
|
47165 |
var _react2 = _interopRequireDefault(_react);
|
47166 |
|
47168 |
|
47169 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
47170 |
|
47171 |
+
var _airbnbPropTypes = __webpack_require__(22);
|
47172 |
|
47173 |
+
var _reactWithStyles = __webpack_require__(34);
|
47174 |
|
47175 |
+
var _defaultPhrases = __webpack_require__(29);
|
47176 |
|
47177 |
+
var _getPhrasePropTypes = __webpack_require__(31);
|
47178 |
|
47179 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
47180 |
|
47181 |
+
var _OpenDirectionShape = __webpack_require__(62);
|
47182 |
|
47183 |
var _OpenDirectionShape2 = _interopRequireDefault(_OpenDirectionShape);
|
47184 |
|
47185 |
+
var _DateInput = __webpack_require__(411);
|
47186 |
|
47187 |
var _DateInput2 = _interopRequireDefault(_DateInput);
|
47188 |
|
47189 |
+
var _IconPositionShape = __webpack_require__(71);
|
47190 |
|
47191 |
var _IconPositionShape2 = _interopRequireDefault(_IconPositionShape);
|
47192 |
|
47193 |
+
var _DisabledShape = __webpack_require__(91);
|
47194 |
|
47195 |
var _DisabledShape2 = _interopRequireDefault(_DisabledShape);
|
47196 |
|
47197 |
+
var _RightArrow = __webpack_require__(415);
|
47198 |
|
47199 |
var _RightArrow2 = _interopRequireDefault(_RightArrow);
|
47200 |
|
47201 |
+
var _LeftArrow = __webpack_require__(416);
|
47202 |
|
47203 |
var _LeftArrow2 = _interopRequireDefault(_LeftArrow);
|
47204 |
|
47205 |
+
var _CloseButton = __webpack_require__(75);
|
47206 |
|
47207 |
var _CloseButton2 = _interopRequireDefault(_CloseButton);
|
47208 |
|
47209 |
+
var _CalendarIcon = __webpack_require__(417);
|
47210 |
|
47211 |
var _CalendarIcon2 = _interopRequireDefault(_CalendarIcon);
|
47212 |
|
47600 |
})(DateRangePickerInput);
|
47601 |
|
47602 |
/***/ }),
|
47603 |
+
/* 411 */
|
47604 |
/***/ (function(module, exports, __webpack_require__) {
|
47605 |
|
47606 |
"use strict";
|
47614 |
|
47615 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
47616 |
|
47617 |
+
var _object = __webpack_require__(25);
|
47618 |
|
47619 |
var _object2 = _interopRequireDefault(_object);
|
47620 |
|
47621 |
+
var _react = __webpack_require__(9);
|
47622 |
|
47623 |
var _react2 = _interopRequireDefault(_react);
|
47624 |
|
47626 |
|
47627 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
47628 |
|
47629 |
+
var _airbnbPropTypes = __webpack_require__(22);
|
47630 |
|
47631 |
+
var _reactWithStyles = __webpack_require__(34);
|
47632 |
|
47633 |
+
var _throttle = __webpack_require__(412);
|
47634 |
|
47635 |
var _throttle2 = _interopRequireDefault(_throttle);
|
47636 |
|
47637 |
+
var _isTouchDevice = __webpack_require__(61);
|
47638 |
|
47639 |
var _isTouchDevice2 = _interopRequireDefault(_isTouchDevice);
|
47640 |
|
47641 |
+
var _getInputHeight = __webpack_require__(140);
|
47642 |
|
47643 |
var _getInputHeight2 = _interopRequireDefault(_getInputHeight);
|
47644 |
|
47645 |
+
var _OpenDirectionShape = __webpack_require__(62);
|
47646 |
|
47647 |
var _OpenDirectionShape2 = _interopRequireDefault(_OpenDirectionShape);
|
47648 |
|
48080 |
})(DateInput);
|
48081 |
|
48082 |
/***/ }),
|
48083 |
+
/* 412 */
|
48084 |
/***/ (function(module, exports, __webpack_require__) {
|
48085 |
|
48086 |
+
var debounce = __webpack_require__(767),
|
48087 |
+
isObject = __webpack_require__(141);
|
48088 |
|
48089 |
/** Error message constants. */
|
48090 |
var FUNC_ERROR_TEXT = 'Expected a function';
|
48155 |
|
48156 |
|
48157 |
/***/ }),
|
48158 |
+
/* 413 */
|
48159 |
/***/ (function(module, exports, __webpack_require__) {
|
48160 |
|
48161 |
+
var freeGlobal = __webpack_require__(769);
|
48162 |
|
48163 |
/** Detect free variable `self`. */
|
48164 |
var freeSelf = typeof self == 'object' && self && self.Object === Object && self;
|
48170 |
|
48171 |
|
48172 |
/***/ }),
|
48173 |
+
/* 414 */
|
48174 |
/***/ (function(module, exports, __webpack_require__) {
|
48175 |
|
48176 |
+
var root = __webpack_require__(413);
|
48177 |
|
48178 |
/** Built-in value references. */
|
48179 |
var Symbol = root.Symbol;
|
48182 |
|
48183 |
|
48184 |
/***/ }),
|
48185 |
+
/* 415 */
|
48186 |
/***/ (function(module, exports, __webpack_require__) {
|
48187 |
|
48188 |
"use strict";
|
48192 |
value: true
|
48193 |
});
|
48194 |
|
48195 |
+
var _react = __webpack_require__(9);
|
48196 |
|
48197 |
var _react2 = _interopRequireDefault(_react);
|
48198 |
|
48218 |
exports['default'] = RightArrow;
|
48219 |
|
48220 |
/***/ }),
|
48221 |
+
/* 416 */
|
48222 |
/***/ (function(module, exports, __webpack_require__) {
|
48223 |
|
48224 |
"use strict";
|
48228 |
value: true
|
48229 |
});
|
48230 |
|
48231 |
+
var _react = __webpack_require__(9);
|
48232 |
|
48233 |
var _react2 = _interopRequireDefault(_react);
|
48234 |
|
48254 |
exports['default'] = LeftArrow;
|
48255 |
|
48256 |
/***/ }),
|
48257 |
+
/* 417 */
|
48258 |
/***/ (function(module, exports, __webpack_require__) {
|
48259 |
|
48260 |
"use strict";
|
48264 |
value: true
|
48265 |
});
|
48266 |
|
48267 |
+
var _react = __webpack_require__(9);
|
48268 |
|
48269 |
var _react2 = _interopRequireDefault(_react);
|
48270 |
|
48290 |
exports['default'] = CalendarIcon;
|
48291 |
|
48292 |
/***/ }),
|
48293 |
+
/* 418 */
|
48294 |
/***/ (function(module, exports, __webpack_require__) {
|
48295 |
|
48296 |
"use strict";
|
48304 |
|
48305 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
48306 |
|
48307 |
+
var _object = __webpack_require__(25);
|
48308 |
|
48309 |
var _object2 = _interopRequireDefault(_object);
|
48310 |
|
48311 |
+
var _react = __webpack_require__(9);
|
48312 |
|
48313 |
var _react2 = _interopRequireDefault(_react);
|
48314 |
|
48316 |
|
48317 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
48318 |
|
48319 |
+
var _reactMomentProptypes = __webpack_require__(40);
|
48320 |
|
48321 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
48322 |
|
48323 |
+
var _airbnbPropTypes = __webpack_require__(22);
|
48324 |
|
48325 |
var _moment = __webpack_require__(0);
|
48326 |
|
48327 |
var _moment2 = _interopRequireDefault(_moment);
|
48328 |
|
48329 |
+
var _object3 = __webpack_require__(138);
|
48330 |
|
48331 |
var _object4 = _interopRequireDefault(_object3);
|
48332 |
|
48333 |
+
var _isTouchDevice = __webpack_require__(61);
|
48334 |
|
48335 |
var _isTouchDevice2 = _interopRequireDefault(_isTouchDevice);
|
48336 |
|
48337 |
+
var _defaultPhrases = __webpack_require__(29);
|
48338 |
|
48339 |
+
var _getPhrasePropTypes = __webpack_require__(31);
|
48340 |
|
48341 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
48342 |
|
48343 |
+
var _isInclusivelyAfterDay = __webpack_require__(73);
|
48344 |
|
48345 |
var _isInclusivelyAfterDay2 = _interopRequireDefault(_isInclusivelyAfterDay);
|
48346 |
|
48347 |
+
var _isNextDay = __webpack_require__(419);
|
48348 |
|
48349 |
var _isNextDay2 = _interopRequireDefault(_isNextDay);
|
48350 |
|
48351 |
+
var _isSameDay = __webpack_require__(58);
|
48352 |
|
48353 |
var _isSameDay2 = _interopRequireDefault(_isSameDay);
|
48354 |
|
48355 |
+
var _isAfterDay = __webpack_require__(92);
|
48356 |
|
48357 |
var _isAfterDay2 = _interopRequireDefault(_isAfterDay);
|
48358 |
|
48359 |
+
var _isBeforeDay = __webpack_require__(74);
|
48360 |
|
48361 |
var _isBeforeDay2 = _interopRequireDefault(_isBeforeDay);
|
48362 |
|
48363 |
+
var _getVisibleDays = __webpack_require__(420);
|
48364 |
|
48365 |
var _getVisibleDays2 = _interopRequireDefault(_getVisibleDays);
|
48366 |
|
48367 |
+
var _isDayVisible = __webpack_require__(143);
|
48368 |
|
48369 |
var _isDayVisible2 = _interopRequireDefault(_isDayVisible);
|
48370 |
|
48371 |
+
var _getSelectedDateOffset = __webpack_require__(776);
|
48372 |
|
48373 |
var _getSelectedDateOffset2 = _interopRequireDefault(_getSelectedDateOffset);
|
48374 |
|
48375 |
+
var _toISODateString = __webpack_require__(88);
|
48376 |
|
48377 |
var _toISODateString2 = _interopRequireDefault(_toISODateString);
|
48378 |
|
48379 |
+
var _toISOMonthString = __webpack_require__(90);
|
48380 |
|
48381 |
var _toISOMonthString2 = _interopRequireDefault(_toISOMonthString);
|
48382 |
|
48383 |
+
var _DisabledShape = __webpack_require__(91);
|
48384 |
|
48385 |
var _DisabledShape2 = _interopRequireDefault(_DisabledShape);
|
48386 |
|
48387 |
+
var _FocusedInputShape = __webpack_require__(403);
|
48388 |
|
48389 |
var _FocusedInputShape2 = _interopRequireDefault(_FocusedInputShape);
|
48390 |
|
48391 |
+
var _ScrollableOrientationShape = __webpack_require__(60);
|
48392 |
|
48393 |
var _ScrollableOrientationShape2 = _interopRequireDefault(_ScrollableOrientationShape);
|
48394 |
|
48395 |
+
var _DayOfWeekShape = __webpack_require__(50);
|
48396 |
|
48397 |
var _DayOfWeekShape2 = _interopRequireDefault(_DayOfWeekShape);
|
48398 |
|
48399 |
+
var _CalendarInfoPositionShape = __webpack_require__(72);
|
48400 |
|
48401 |
var _CalendarInfoPositionShape2 = _interopRequireDefault(_CalendarInfoPositionShape);
|
48402 |
|
48403 |
var _constants = __webpack_require__(17);
|
48404 |
|
48405 |
+
var _DayPicker = __webpack_require__(144);
|
48406 |
|
48407 |
var _DayPicker2 = _interopRequireDefault(_DayPicker);
|
48408 |
|
49801 |
DayPickerRangeController.defaultProps = defaultProps;
|
49802 |
|
49803 |
/***/ }),
|
49804 |
+
/* 419 */
|
49805 |
/***/ (function(module, exports, __webpack_require__) {
|
49806 |
|
49807 |
"use strict";
|
49816 |
|
49817 |
var _moment2 = _interopRequireDefault(_moment);
|
49818 |
|
49819 |
+
var _isSameDay = __webpack_require__(58);
|
49820 |
|
49821 |
var _isSameDay2 = _interopRequireDefault(_isSameDay);
|
49822 |
|
49829 |
}
|
49830 |
|
49831 |
/***/ }),
|
49832 |
+
/* 420 */
|
49833 |
/***/ (function(module, exports, __webpack_require__) {
|
49834 |
|
49835 |
"use strict";
|
49844 |
|
49845 |
var _moment2 = _interopRequireDefault(_moment);
|
49846 |
|
49847 |
+
var _toISOMonthString = __webpack_require__(90);
|
49848 |
|
49849 |
var _toISOMonthString2 = _interopRequireDefault(_toISOMonthString);
|
49850 |
|
49898 |
}
|
49899 |
|
49900 |
/***/ }),
|
49901 |
+
/* 421 */
|
49902 |
/***/ (function(module, exports, __webpack_require__) {
|
49903 |
|
49904 |
"use strict";
|
49912 |
|
49913 |
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
|
49914 |
|
49915 |
+
var _object = __webpack_require__(25);
|
49916 |
|
49917 |
var _object2 = _interopRequireDefault(_object);
|
49918 |
|
49919 |
+
var _react = __webpack_require__(9);
|
49920 |
|
49921 |
var _react2 = _interopRequireDefault(_react);
|
49922 |
|
49924 |
|
49925 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
49926 |
|
49927 |
+
var _reactMomentProptypes = __webpack_require__(40);
|
49928 |
|
49929 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
49930 |
|
49931 |
+
var _airbnbPropTypes = __webpack_require__(22);
|
49932 |
|
49933 |
var _moment = __webpack_require__(0);
|
49934 |
|
49935 |
var _moment2 = _interopRequireDefault(_moment);
|
49936 |
|
49937 |
+
var _object3 = __webpack_require__(138);
|
49938 |
|
49939 |
var _object4 = _interopRequireDefault(_object3);
|
49940 |
|
49941 |
+
var _isTouchDevice = __webpack_require__(61);
|
49942 |
|
49943 |
var _isTouchDevice2 = _interopRequireDefault(_isTouchDevice);
|
49944 |
|
49945 |
+
var _defaultPhrases = __webpack_require__(29);
|
49946 |
|
49947 |
+
var _getPhrasePropTypes = __webpack_require__(31);
|
49948 |
|
49949 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
49950 |
|
49951 |
+
var _isSameDay = __webpack_require__(58);
|
49952 |
|
49953 |
var _isSameDay2 = _interopRequireDefault(_isSameDay);
|
49954 |
|
49955 |
+
var _isAfterDay = __webpack_require__(92);
|
49956 |
|
49957 |
var _isAfterDay2 = _interopRequireDefault(_isAfterDay);
|
49958 |
|
49959 |
+
var _getVisibleDays = __webpack_require__(420);
|
49960 |
|
49961 |
var _getVisibleDays2 = _interopRequireDefault(_getVisibleDays);
|
49962 |
|
49963 |
+
var _isDayVisible = __webpack_require__(143);
|
49964 |
|
49965 |
var _isDayVisible2 = _interopRequireDefault(_isDayVisible);
|
49966 |
|
49967 |
+
var _toISODateString = __webpack_require__(88);
|
49968 |
|
49969 |
var _toISODateString2 = _interopRequireDefault(_toISODateString);
|
49970 |
|
49971 |
+
var _toISOMonthString = __webpack_require__(90);
|
49972 |
|
49973 |
var _toISOMonthString2 = _interopRequireDefault(_toISOMonthString);
|
49974 |
|
49975 |
+
var _ScrollableOrientationShape = __webpack_require__(60);
|
49976 |
|
49977 |
var _ScrollableOrientationShape2 = _interopRequireDefault(_ScrollableOrientationShape);
|
49978 |
|
49979 |
+
var _DayOfWeekShape = __webpack_require__(50);
|
49980 |
|
49981 |
var _DayOfWeekShape2 = _interopRequireDefault(_DayOfWeekShape);
|
49982 |
|
49983 |
+
var _CalendarInfoPositionShape = __webpack_require__(72);
|
49984 |
|
49985 |
var _CalendarInfoPositionShape2 = _interopRequireDefault(_CalendarInfoPositionShape);
|
49986 |
|
49987 |
var _constants = __webpack_require__(17);
|
49988 |
|
49989 |
+
var _DayPicker = __webpack_require__(144);
|
49990 |
|
49991 |
var _DayPicker2 = _interopRequireDefault(_DayPicker);
|
49992 |
|
50946 |
DayPickerSingleDateController.defaultProps = defaultProps;
|
50947 |
|
50948 |
/***/ }),
|
50949 |
+
/* 422 */
|
50950 |
/***/ (function(module, exports, __webpack_require__) {
|
50951 |
|
50952 |
"use strict";
|
50960 |
|
50961 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
50962 |
|
50963 |
+
var _reactMomentProptypes = __webpack_require__(40);
|
50964 |
|
50965 |
var _reactMomentProptypes2 = _interopRequireDefault(_reactMomentProptypes);
|
50966 |
|
50967 |
+
var _airbnbPropTypes = __webpack_require__(22);
|
50968 |
|
50969 |
+
var _defaultPhrases = __webpack_require__(29);
|
50970 |
|
50971 |
+
var _getPhrasePropTypes = __webpack_require__(31);
|
50972 |
|
50973 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
50974 |
|
50975 |
+
var _IconPositionShape = __webpack_require__(71);
|
50976 |
|
50977 |
var _IconPositionShape2 = _interopRequireDefault(_IconPositionShape);
|
50978 |
|
50979 |
+
var _OrientationShape = __webpack_require__(404);
|
50980 |
|
50981 |
var _OrientationShape2 = _interopRequireDefault(_OrientationShape);
|
50982 |
|
50983 |
+
var _AnchorDirectionShape = __webpack_require__(405);
|
50984 |
|
50985 |
var _AnchorDirectionShape2 = _interopRequireDefault(_AnchorDirectionShape);
|
50986 |
|
50987 |
+
var _OpenDirectionShape = __webpack_require__(62);
|
50988 |
|
50989 |
var _OpenDirectionShape2 = _interopRequireDefault(_OpenDirectionShape);
|
50990 |
|
50991 |
+
var _DayOfWeekShape = __webpack_require__(50);
|
50992 |
|
50993 |
var _DayOfWeekShape2 = _interopRequireDefault(_DayOfWeekShape);
|
50994 |
|
50995 |
+
var _CalendarInfoPositionShape = __webpack_require__(72);
|
50996 |
|
50997 |
var _CalendarInfoPositionShape2 = _interopRequireDefault(_CalendarInfoPositionShape);
|
50998 |
|
51075 |
};
|
51076 |
|
51077 |
/***/ }),
|
51078 |
+
/* 423 */
|
51079 |
/***/ (function(module, exports, __webpack_require__) {
|
51080 |
|
51081 |
"use strict";
|
51087 |
|
51088 |
var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; };
|
51089 |
|
51090 |
+
var _object = __webpack_require__(25);
|
51091 |
|
51092 |
var _object2 = _interopRequireDefault(_object);
|
51093 |
|
51094 |
+
var _react = __webpack_require__(9);
|
51095 |
|
51096 |
var _react2 = _interopRequireDefault(_react);
|
51097 |
|
51099 |
|
51100 |
var _propTypes2 = _interopRequireDefault(_propTypes);
|
51101 |
|
51102 |
+
var _airbnbPropTypes = __webpack_require__(22);
|
51103 |
|
51104 |
+
var _reactWithStyles = __webpack_require__(34);
|
51105 |
|
51106 |
+
var _defaultPhrases = __webpack_require__(29);
|
51107 |
|
51108 |
+
var _getPhrasePropTypes = __webpack_require__(31);
|
51109 |
|
51110 |
var _getPhrasePropTypes2 = _interopRequireDefault(_getPhrasePropTypes);
|
51111 |
|
51112 |
+
var _DateInput = __webpack_require__(411);
|
51113 |
|
51114 |
var _DateInput2 = _interopRequireDefault(_DateInput);
|
51115 |
|
51116 |
+
var _IconPositionShape = __webpack_require__(71);
|
51117 |
|
51118 |
var _IconPositionShape2 = _interopRequireDefault(_IconPositionShape);
|
51119 |
|
51120 |
+
var _CloseButton = __webpack_require__(75);
|
51121 |
|
51122 |
var _CloseButton2 = _interopRequireDefault(_CloseButton);
|
51123 |
|
51124 |
+
var _CalendarIcon = __webpack_require__(417);
|
51125 |
|
51126 |
var _CalendarIcon2 = _interopRequireDefault(_CalendarIcon);
|
51127 |
|
51128 |
+
var _OpenDirectionShape = __webpack_require__(62);
|
51129 |
|
51130 |
var _OpenDirectionShape2 = _interopRequireDefault(_OpenDirectionShape);
|
51131 |
|
51435 |
})(SingleDatePickerInput);
|
51436 |
|
51437 |
/***/ }),
|
51438 |
+
/* 424 */
|
51439 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
51440 |
|
51441 |
"use strict";
|
51442 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Consumer; });
|
51443 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
51444 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
51445 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
51446 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
51447 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
51448 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
51449 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
51450 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(1);
|
51451 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
51452 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
51453 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__wordpress_is_shallow_equal__ = __webpack_require__(194);
|
51454 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__wordpress_is_shallow_equal___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_9__wordpress_is_shallow_equal__);
|
51455 |
|
51456 |
|
51730 |
//# sourceMappingURL=provider.js.map
|
51731 |
|
51732 |
/***/ }),
|
51733 |
+
/* 425 */
|
51734 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
51735 |
|
51736 |
"use strict";
|
51737 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(1);
|
51738 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_classnames__ = __webpack_require__(14);
|
51739 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_classnames__);
|
51740 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash__ = __webpack_require__(2);
|
51741 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_lodash__);
|
51742 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_keycodes__ = __webpack_require__(32);
|
51743 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__icon_button__ = __webpack_require__(37);
|
51744 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__dropdown__ = __webpack_require__(85);
|
51745 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__navigable_container__ = __webpack_require__(76);
|
51746 |
|
51747 |
|
51748 |
/**
|
51846 |
//# sourceMappingURL=index.js.map
|
51847 |
|
51848 |
/***/ }),
|
51849 |
+
/* 426 */
|
51850 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
51851 |
|
51852 |
"use strict";
|
51857 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
51858 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
51859 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
51860 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
51861 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__wordpress_element__ = __webpack_require__(1);
|
51862 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_lodash__ = __webpack_require__(2);
|
51863 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_9_lodash__);
|
51864 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__wordpress_dom__ = __webpack_require__(54);
|
51865 |
|
51866 |
|
51867 |
|
52033 |
//# sourceMappingURL=container.js.map
|
52034 |
|
52035 |
/***/ }),
|
52036 |
+
/* 427 */
|
52037 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
52038 |
|
52039 |
"use strict";
|
52043 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
52044 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
52045 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
52046 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
52047 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(1);
|
52048 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
52049 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
52138 |
//# sourceMappingURL=index.js.map
|
52139 |
|
52140 |
/***/ }),
|
52141 |
+
/* 428 */
|
52142 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
52143 |
|
52144 |
"use strict";
|
52147 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(1);
|
52148 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
52149 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
52150 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_classnames__ = __webpack_require__(14);
|
52151 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_classnames__);
|
52152 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_i18n__ = __webpack_require__(26);
|
52153 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_compose__ = __webpack_require__(18);
|
52154 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7____ = __webpack_require__(51);
|
52155 |
|
52156 |
|
52157 |
|
52236 |
//# sourceMappingURL=index.js.map
|
52237 |
|
52238 |
/***/ }),
|
52239 |
+
/* 429 */
|
52240 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
52241 |
|
52242 |
"use strict";
|
52243 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
52244 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
52245 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(1);
|
52246 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_classnames__ = __webpack_require__(14);
|
52247 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_classnames__);
|
52248 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash__ = __webpack_require__(2);
|
52249 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_lodash__);
|
52250 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__primitives__ = __webpack_require__(78);
|
52251 |
|
52252 |
|
52253 |
|
52312 |
//# sourceMappingURL=index.js.map
|
52313 |
|
52314 |
/***/ }),
|
52315 |
+
/* 430 */
|
52316 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
52317 |
|
52318 |
"use strict";
|
52319 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(23);
|
52320 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(1);
|
52321 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2____ = __webpack_require__(51);
|
52322 |
|
52323 |
|
52324 |
/**
|
52382 |
//# sourceMappingURL=index.js.map
|
52383 |
|
52384 |
/***/ }),
|
52385 |
+
/* 431 */
|
52386 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
52387 |
|
52388 |
"use strict";
|
52389 |
/* unused harmony export MenuItem */
|
52390 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(23);
|
52391 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
52392 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames__ = __webpack_require__(14);
|
52393 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_classnames__);
|
52394 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
52395 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
52396 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__wordpress_element__ = __webpack_require__(1);
|
52397 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_compose__ = __webpack_require__(18);
|
52398 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__button__ = __webpack_require__(36);
|
52399 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__shortcut__ = __webpack_require__(196);
|
52400 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__icon_button__ = __webpack_require__(37);
|
52401 |
|
52402 |
|
52403 |
|
52487 |
//# sourceMappingURL=index.js.map
|
52488 |
|
52489 |
/***/ }),
|
52490 |
+
/* 432 */
|
52491 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
52492 |
|
52493 |
"use strict";
|
52494 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(1);
|
52495 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
52496 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
52497 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames__ = __webpack_require__(14);
|
52498 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_classnames__);
|
52499 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_i18n__ = __webpack_require__(26);
|
52500 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4____ = __webpack_require__(51);
|
52501 |
|
52502 |
|
52503 |
/**
|
52557 |
//# sourceMappingURL=index.js.map
|
52558 |
|
52559 |
/***/ }),
|
52560 |
+
/* 433 */
|
52561 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
52562 |
|
52563 |
"use strict";
|
52564 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
52565 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
52566 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(1);
|
52567 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
52568 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
52569 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4____ = __webpack_require__(432);
|
52570 |
|
52571 |
|
52572 |
|
52619 |
//# sourceMappingURL=list.js.map
|
52620 |
|
52621 |
/***/ }),
|
52622 |
+
/* 434 */
|
52623 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
52624 |
|
52625 |
"use strict";
|
52638 |
//# sourceMappingURL=header.js.map
|
52639 |
|
52640 |
/***/ }),
|
52641 |
+
/* 435 */
|
52642 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
52643 |
|
52644 |
"use strict";
|
52645 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
52646 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
52647 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(1);
|
52648 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_classnames__ = __webpack_require__(14);
|
52649 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_classnames__);
|
52650 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash__ = __webpack_require__(2);
|
52651 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_lodash__);
|
52652 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__dashicon__ = __webpack_require__(55);
|
52653 |
|
52654 |
|
52655 |
|
52698 |
//# sourceMappingURL=index.js.map
|
52699 |
|
52700 |
/***/ }),
|
52701 |
+
/* 436 */
|
52702 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
52703 |
|
52704 |
"use strict";
|
52705 |
/* harmony export (immutable) */ __webpack_exports__["a"] = TreeSelect;
|
52706 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
52707 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
52708 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
52709 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_element__ = __webpack_require__(1);
|
52710 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash__ = __webpack_require__(2);
|
52711 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_lodash__);
|
52712 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5____ = __webpack_require__(51);
|
52713 |
|
52714 |
|
52715 |
|
52758 |
//# sourceMappingURL=index.js.map
|
52759 |
|
52760 |
/***/ }),
|
52761 |
+
/* 437 */
|
52762 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
52763 |
|
52764 |
"use strict";
|
52773 |
//# sourceMappingURL=index.js.map
|
52774 |
|
52775 |
/***/ }),
|
52776 |
+
/* 438 */
|
52777 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
52778 |
|
52779 |
"use strict";
|
52780 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return createI18n; });
|
52781 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
52782 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_tannin__ = __webpack_require__(80);
|
52783 |
|
52784 |
|
52785 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
52851 |
|
52852 |
var setLocaleData = function setLocaleData(data) {
|
52853 |
var domain = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'default';
|
52854 |
+
tannin.data[domain] = _objectSpread(_objectSpread(_objectSpread({}, DEFAULT_LOCALE_DATA), tannin.data[domain]), data); // Populate default domain configuration (supported locale date which omits
|
52855 |
// a plural forms expression).
|
52856 |
|
52857 |
+
tannin.data[domain][''] = _objectSpread(_objectSpread({}, DEFAULT_LOCALE_DATA['']), tannin.data[domain]['']);
|
52858 |
};
|
52859 |
/**
|
52860 |
* Wrapper for Tannin's `dcnpgettext`. Populates default locale data if not
|
52988 |
//# sourceMappingURL=create-i18n.js.map
|
52989 |
|
52990 |
/***/ }),
|
52991 |
+
/* 439 */
|
52992 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
52993 |
|
52994 |
"use strict";
|
52995 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(23);
|
52996 |
|
52997 |
|
52998 |
var namespaceAndEndpointMiddleware = function namespaceAndEndpointMiddleware(options, next) {
|
53021 |
//# sourceMappingURL=namespace-endpoint.js.map
|
53022 |
|
53023 |
/***/ }),
|
53024 |
+
/* 440 */
|
53025 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
53026 |
|
53027 |
"use strict";
|
53046 |
//# sourceMappingURL=is-email.js.map
|
53047 |
|
53048 |
/***/ }),
|
53049 |
+
/* 441 */
|
53050 |
/***/ (function(module, exports, __webpack_require__) {
|
53051 |
|
53052 |
"use strict";
|
53055 |
var replace = String.prototype.replace;
|
53056 |
var percentTwenties = /%20/g;
|
53057 |
|
53058 |
+
var util = __webpack_require__(146);
|
53059 |
|
53060 |
var Format = {
|
53061 |
RFC1738: 'RFC1738',
|
53079 |
|
53080 |
|
53081 |
/***/ }),
|
53082 |
+
/* 442 */
|
53083 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
53084 |
|
53085 |
"use strict";
|
53086 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getQueryArg;
|
53087 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_qs__ = __webpack_require__(145);
|
53088 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_qs___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_qs__);
|
53089 |
/**
|
53090 |
* External dependencies
|
53124 |
//# sourceMappingURL=get-query-arg.js.map
|
53125 |
|
53126 |
/***/ }),
|
53127 |
+
/* 443 */
|
53128 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
53129 |
|
53130 |
"use strict";
|
53131 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
53132 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(1);
|
53133 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames__ = __webpack_require__(14);
|
53134 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_classnames__);
|
53135 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__icon_button__ = __webpack_require__(37);
|
53136 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__toolbar_button_container__ = __webpack_require__(857);
|
53137 |
|
53138 |
|
53139 |
|
53184 |
//# sourceMappingURL=index.js.map
|
53185 |
|
53186 |
/***/ }),
|
53187 |
+
/* 444 */
|
53188 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
53189 |
|
53190 |
"use strict";
|
53191 |
Object.defineProperty(__webpack_exports__, "__esModule", { value: true });
|
53192 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "default", function() { return MailerLiteFormBlock; });
|
53193 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_classCallCheck__ = __webpack_require__(445);
|
53194 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_classCallCheck___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_classCallCheck__);
|
53195 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_createClass__ = __webpack_require__(446);
|
53196 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_createClass___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_createClass__);
|
53197 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_inherits__ = __webpack_require__(447);
|
53198 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_inherits___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_inherits__);
|
53199 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_possibleConstructorReturn__ = __webpack_require__(449);
|
53200 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_possibleConstructorReturn___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_possibleConstructorReturn__);
|
53201 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_getPrototypeOf__ = __webpack_require__(452);
|
53202 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_getPrototypeOf___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_getPrototypeOf__);
|
53203 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_element__ = __webpack_require__(1);
|
53204 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_components__ = __webpack_require__(51);
|
53205 |
|
53206 |
|
53207 |
|
53209 |
|
53210 |
|
53211 |
|
53212 |
+
function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_getPrototypeOf___default()(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_getPrototypeOf___default()(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_possibleConstructorReturn___default()(this, result); }; }
|
53213 |
|
53214 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
53215 |
|
53327 |
}, {
|
53328 |
key: "renderEditWithForms",
|
53329 |
value: function renderEditWithForms() {
|
53330 |
+
var _this4 = this;
|
53331 |
+
|
53332 |
var _this$state2 = this.state,
|
53333 |
forms = _this$state2.forms,
|
53334 |
selected_form = _this$state2.selected_form;
|
53335 |
var setAttributes = this.props.setAttributes;
|
53336 |
var form_id = this.props.attributes.form_id;
|
53337 |
+
return Object(__WEBPACK_IMPORTED_MODULE_5__wordpress_element__["h" /* createElement */])(__WEBPACK_IMPORTED_MODULE_5__wordpress_element__["c" /* Fragment */], null, Object(__WEBPACK_IMPORTED_MODULE_5__wordpress_element__["h" /* createElement */])("select", {
|
53338 |
+
value: selected_form,
|
53339 |
+
onChange: function onChange(e) {
|
53340 |
+
return _this4.setState({
|
53341 |
+
selected_form: e.target.value
|
53342 |
+
});
|
53343 |
+
}
|
53344 |
+
}, forms.map(function (form) {
|
53345 |
return Object(__WEBPACK_IMPORTED_MODULE_5__wordpress_element__["h" /* createElement */])("option", {
|
53346 |
key: form.value,
|
53347 |
value: form.value
|
53352 |
marginLeft: 12
|
53353 |
},
|
53354 |
onClick: function onClick() {
|
53355 |
+
_this4.setState({
|
53356 |
+
preview_html: null
|
53357 |
+
});
|
53358 |
+
|
53359 |
+
setAttributes({
|
53360 |
form_id: selected_form,
|
53361 |
editMode: false
|
53362 |
});
|
53431 |
});
|
53432 |
|
53433 |
/***/ }),
|
53434 |
+
/* 445 */
|
53435 |
/***/ (function(module, exports) {
|
53436 |
|
53437 |
function _classCallCheck(instance, Constructor) {
|
53443 |
module.exports = _classCallCheck;
|
53444 |
|
53445 |
/***/ }),
|
53446 |
+
/* 446 */
|
53447 |
/***/ (function(module, exports) {
|
53448 |
|
53449 |
function _defineProperties(target, props) {
|
53465 |
module.exports = _createClass;
|
53466 |
|
53467 |
/***/ }),
|
53468 |
+
/* 447 */
|
53469 |
/***/ (function(module, exports, __webpack_require__) {
|
53470 |
|
53471 |
+
var setPrototypeOf = __webpack_require__(448);
|
53472 |
|
53473 |
function _inherits(subClass, superClass) {
|
53474 |
if (typeof superClass !== "function" && superClass !== null) {
|
53488 |
module.exports = _inherits;
|
53489 |
|
53490 |
/***/ }),
|
53491 |
+
/* 448 */
|
53492 |
/***/ (function(module, exports) {
|
53493 |
|
53494 |
function _setPrototypeOf(o, p) {
|
53503 |
module.exports = _setPrototypeOf;
|
53504 |
|
53505 |
/***/ }),
|
53506 |
+
/* 449 */
|
53507 |
/***/ (function(module, exports, __webpack_require__) {
|
53508 |
|
53509 |
+
var _typeof = __webpack_require__(450);
|
53510 |
|
53511 |
+
var assertThisInitialized = __webpack_require__(451);
|
53512 |
|
53513 |
function _possibleConstructorReturn(self, call) {
|
53514 |
if (call && (_typeof(call) === "object" || typeof call === "function")) {
|
53521 |
module.exports = _possibleConstructorReturn;
|
53522 |
|
53523 |
/***/ }),
|
53524 |
+
/* 450 */
|
53525 |
/***/ (function(module, exports) {
|
53526 |
|
53527 |
function _typeof(obj) {
|
53543 |
module.exports = _typeof;
|
53544 |
|
53545 |
/***/ }),
|
53546 |
+
/* 451 */
|
53547 |
/***/ (function(module, exports) {
|
53548 |
|
53549 |
function _assertThisInitialized(self) {
|
53557 |
module.exports = _assertThisInitialized;
|
53558 |
|
53559 |
/***/ }),
|
53560 |
+
/* 452 */
|
53561 |
/***/ (function(module, exports) {
|
53562 |
|
53563 |
function _getPrototypeOf(o) {
|
53570 |
module.exports = _getPrototypeOf;
|
53571 |
|
53572 |
/***/ }),
|
53573 |
+
/* 453 */
|
53574 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
53575 |
|
53576 |
"use strict";
|
53591 |
}
|
53592 |
|
53593 |
/***/ }),
|
53594 |
+
/* 454 */
|
53595 |
/***/ (function(module, exports, __webpack_require__) {
|
53596 |
|
53597 |
"use strict";
|
53598 |
+
/** @license React v16.14.0
|
53599 |
* react.production.min.js
|
53600 |
*
|
53601 |
* Copyright (c) Facebook, Inc. and its affiliates.
|
53604 |
* LICENSE file in the root directory of this source tree.
|
53605 |
*/
|
53606 |
|
53607 |
+
var l=__webpack_require__(63),n="function"===typeof Symbol&&Symbol.for,p=n?Symbol.for("react.element"):60103,q=n?Symbol.for("react.portal"):60106,r=n?Symbol.for("react.fragment"):60107,t=n?Symbol.for("react.strict_mode"):60108,u=n?Symbol.for("react.profiler"):60114,v=n?Symbol.for("react.provider"):60109,w=n?Symbol.for("react.context"):60110,x=n?Symbol.for("react.forward_ref"):60112,y=n?Symbol.for("react.suspense"):60113,z=n?Symbol.for("react.memo"):60115,A=n?Symbol.for("react.lazy"):
|
53608 |
60116,B="function"===typeof Symbol&&Symbol.iterator;function C(a){for(var b="https://reactjs.org/docs/error-decoder.html?invariant="+a,c=1;c<arguments.length;c++)b+="&args[]="+encodeURIComponent(arguments[c]);return"Minified React error #"+a+"; visit "+b+" for the full message or use the non-minified dev environment for full errors and additional helpful warnings."}
|
53609 |
var D={isMounted:function(){return!1},enqueueForceUpdate:function(){},enqueueReplaceState:function(){},enqueueSetState:function(){}},E={};function F(a,b,c){this.props=a;this.context=b;this.refs=E;this.updater=c||D}F.prototype.isReactComponent={};F.prototype.setState=function(a,b){if("object"!==typeof a&&"function"!==typeof a&&null!=a)throw Error(C(85));this.updater.enqueueSetState(this,a,b,"setState")};F.prototype.forceUpdate=function(a){this.updater.enqueueForceUpdate(this,a,"forceUpdate")};
|
53610 |
function G(){}G.prototype=F.prototype;function H(a,b,c){this.props=a;this.context=b;this.refs=E;this.updater=c||D}var I=H.prototype=new G;I.constructor=H;l(I,F.prototype);I.isPureReactComponent=!0;var J={current:null},K=Object.prototype.hasOwnProperty,L={key:!0,ref:!0,__self:!0,__source:!0};
|
53619 |
exports.cloneElement=function(a,b,c){if(null===a||void 0===a)throw Error(C(267,a));var e=l({},a.props),d=a.key,g=a.ref,k=a._owner;if(null!=b){void 0!==b.ref&&(g=b.ref,k=J.current);void 0!==b.key&&(d=""+b.key);if(a.type&&a.type.defaultProps)var f=a.type.defaultProps;for(h in b)K.call(b,h)&&!L.hasOwnProperty(h)&&(e[h]=void 0===b[h]&&void 0!==f?f[h]:b[h])}var h=arguments.length-2;if(1===h)e.children=c;else if(1<h){f=Array(h);for(var m=0;m<h;m++)f[m]=arguments[m+2];e.children=f}return{$$typeof:p,type:a.type,
|
53620 |
key:d,ref:g,props:e,_owner:k}};exports.createContext=function(a,b){void 0===b&&(b=null);a={$$typeof:w,_calculateChangedBits:b,_currentValue:a,_currentValue2:a,_threadCount:0,Provider:null,Consumer:null};a.Provider={$$typeof:v,_context:a};return a.Consumer=a};exports.createElement=M;exports.createFactory=function(a){var b=M.bind(null,a);b.type=a;return b};exports.createRef=function(){return{current:null}};exports.forwardRef=function(a){return{$$typeof:x,render:a}};exports.isValidElement=O;
|
53621 |
exports.lazy=function(a){return{$$typeof:A,_ctor:a,_status:-1,_result:null}};exports.memo=function(a,b){return{$$typeof:z,type:a,compare:void 0===b?null:b}};exports.useCallback=function(a,b){return Z().useCallback(a,b)};exports.useContext=function(a,b){return Z().useContext(a,b)};exports.useDebugValue=function(){};exports.useEffect=function(a,b){return Z().useEffect(a,b)};exports.useImperativeHandle=function(a,b,c){return Z().useImperativeHandle(a,b,c)};
|
53622 |
+
exports.useLayoutEffect=function(a,b){return Z().useLayoutEffect(a,b)};exports.useMemo=function(a,b){return Z().useMemo(a,b)};exports.useReducer=function(a,b,c){return Z().useReducer(a,b,c)};exports.useRef=function(a){return Z().useRef(a)};exports.useState=function(a){return Z().useState(a)};exports.version="16.14.0";
|
53623 |
|
53624 |
|
53625 |
/***/ }),
|
53626 |
+
/* 455 */
|
53627 |
/***/ (function(module, exports, __webpack_require__) {
|
53628 |
|
53629 |
"use strict";
|
53630 |
+
/* WEBPACK VAR INJECTION */(function(process) {/** @license React v16.14.0
|
53631 |
* react.development.js
|
53632 |
*
|
53633 |
* Copyright (c) Facebook, Inc. and its affiliates.
|
53644 |
(function() {
|
53645 |
'use strict';
|
53646 |
|
53647 |
+
var _assign = __webpack_require__(63);
|
53648 |
+
var checkPropTypes = __webpack_require__(95);
|
53649 |
|
53650 |
+
var ReactVersion = '16.14.0';
|
53651 |
|
53652 |
// The Symbol used to tag the ReactElement-like types. If there is no native Symbol
|
53653 |
// nor polyfill, then a plain number is used for performance.
|
55543 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
55544 |
|
55545 |
/***/ }),
|
55546 |
+
/* 456 */
|
55547 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
55548 |
|
55549 |
"use strict";
|
55550 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom__ = __webpack_require__(45);
|
55551 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react_dom__);
|
55552 |
/* harmony reexport (binding) */ if(__webpack_require__.o(__WEBPACK_IMPORTED_MODULE_0_react_dom__, "createPortal")) __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_0_react_dom__["createPortal"]; });
|
55553 |
/* unused harmony reexport findDOMNode */
|
55593 |
//# sourceMappingURL=react-platform.js.map
|
55594 |
|
55595 |
/***/ }),
|
55596 |
+
/* 457 */
|
55597 |
/***/ (function(module, exports, __webpack_require__) {
|
55598 |
|
55599 |
"use strict";
|
55600 |
+
/** @license React v16.14.0
|
55601 |
* react-dom.production.min.js
|
55602 |
*
|
55603 |
* Copyright (c) Facebook, Inc. and its affiliates.
|
55609 |
/*
|
55610 |
Modernizr 3.0.0pre (Custom Build) | MIT
|
55611 |
*/
|
55612 |
+
var aa=__webpack_require__(9),n=__webpack_require__(63),r=__webpack_require__(147);function u(a){for(var b="https://reactjs.org/docs/error-decoder.html?invariant="+a,c=1;c<arguments.length;c++)b+="&args[]="+encodeURIComponent(arguments[c]);return"Minified React error #"+a+"; visit "+b+" for the full message or use the non-minified dev environment for full errors and additional helpful warnings."}if(!aa)throw Error(u(227));
|
55613 |
function ba(a,b,c,d,e,f,g,h,k){var l=Array.prototype.slice.call(arguments,3);try{b.apply(c,l)}catch(m){this.onError(m)}}var da=!1,ea=null,fa=!1,ha=null,ia={onError:function(a){da=!0;ea=a}};function ja(a,b,c,d,e,f,g,h,k){da=!1;ea=null;ba.apply(ia,arguments)}function ka(a,b,c,d,e,f,g,h,k){ja.apply(this,arguments);if(da){if(da){var l=ea;da=!1;ea=null}else throw Error(u(198));fa||(fa=!0,ha=l)}}var la=null,ma=null,na=null;
|
55614 |
function oa(a,b,c){var d=a.type||"unknown-event";a.currentTarget=na(c);ka(d,b,void 0,a);a.currentTarget=null}var pa=null,qa={};
|
55615 |
function ra(){if(pa)for(var a in qa){var b=qa[a],c=pa.indexOf(a);if(!(-1<c))throw Error(u(96,a));if(!sa[c]){if(!b.extractEvents)throw Error(u(97,a));sa[c]=b;c=b.eventTypes;for(var d in c){var e=void 0;var f=c[d],g=b,h=d;if(ta.hasOwnProperty(h))throw Error(u(99,h));ta[h]=f;var k=f.phasedRegistrationNames;if(k){for(e in k)k.hasOwnProperty(e)&&ua(k[e],g,h);e=!0}else f.registrationName?(ua(f.registrationName,g,h),e=!0):e=!1;if(!e)throw Error(u(98,d,a));}}}}
|
55884 |
wc=function(a){if(13===a.tag){var b=hg(Gg(),150,100);Ig(a,b);ek(a,b)}};xc=function(a){13===a.tag&&(Ig(a,3),ek(a,3))};yc=function(a){if(13===a.tag){var b=Gg();b=Hg(b,a,null);Ig(a,b);ek(a,b)}};
|
55885 |
za=function(a,b,c){switch(b){case "input":Cb(a,c);b=c.name;if("radio"===c.type&&null!=b){for(c=a;c.parentNode;)c=c.parentNode;c=c.querySelectorAll("input[name="+JSON.stringify(""+b)+'][type="radio"]');for(b=0;b<c.length;b++){var d=c[b];if(d!==a&&d.form===a.form){var e=Qd(d);if(!e)throw Error(u(90));yb(d);Cb(d,e)}}}break;case "textarea":Kb(a,c);break;case "select":b=c.value,null!=b&&Hb(a,!!c.multiple,b,!1)}};Fa=Mj;
|
55886 |
Ga=function(a,b,c,d,e){var f=W;W|=4;try{return cg(98,a.bind(null,b,c,d,e))}finally{W=f,W===V&&gg()}};Ha=function(){(W&(1|fj|gj))===V&&(Lj(),Dj())};Ia=function(a,b){var c=W;W|=2;try{return a(b)}finally{W=c,W===V&&gg()}};function kk(a,b){var c=2<arguments.length&&void 0!==arguments[2]?arguments[2]:null;if(!gk(b))throw Error(u(200));return jk(a,b,null,c)}var lk={Events:[Nc,Pd,Qd,xa,ta,Xd,function(a){jc(a,Wd)},Da,Ea,id,mc,Dj,{current:!1}]};
|
55887 |
+
(function(a){var b=a.findFiberByHostInstance;return Yj(n({},a,{overrideHookState:null,overrideProps:null,setSuspenseHandler:null,scheduleUpdate:null,currentDispatcherRef:Wa.ReactCurrentDispatcher,findHostInstanceByFiber:function(a){a=hc(a);return null===a?null:a.stateNode},findFiberByHostInstance:function(a){return b?b(a):null},findHostInstancesForRefresh:null,scheduleRefresh:null,scheduleRoot:null,setRefreshHandler:null,getCurrentFiber:null}))})({findFiberByHostInstance:tc,bundleType:0,version:"16.14.0",
|
55888 |
rendererPackageName:"react-dom"});exports.__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED=lk;exports.createPortal=kk;exports.findDOMNode=function(a){if(null==a)return null;if(1===a.nodeType)return a;var b=a._reactInternalFiber;if(void 0===b){if("function"===typeof a.render)throw Error(u(188));throw Error(u(268,Object.keys(a)));}a=hc(b);a=null===a?null:a.stateNode;return a};
|
55889 |
exports.flushSync=function(a,b){if((W&(fj|gj))!==V)throw Error(u(187));var c=W;W|=1;try{return cg(99,a.bind(null,b))}finally{W=c,gg()}};exports.hydrate=function(a,b,c){if(!gk(b))throw Error(u(200));return ik(null,a,b,!0,c)};exports.render=function(a,b,c){if(!gk(b))throw Error(u(200));return ik(null,a,b,!1,c)};
|
55890 |
exports.unmountComponentAtNode=function(a){if(!gk(a))throw Error(u(40));return a._reactRootContainer?(Nj(function(){ik(null,null,a,!1,function(){a._reactRootContainer=null;a[Od]=null})}),!0):!1};exports.unstable_batchedUpdates=Mj;exports.unstable_createPortal=function(a,b){return kk(a,b,2<arguments.length&&void 0!==arguments[2]?arguments[2]:null)};
|
55891 |
+
exports.unstable_renderSubtreeIntoContainer=function(a,b,c,d){if(!gk(c))throw Error(u(200));if(null==a||void 0===a._reactInternalFiber)throw Error(u(38));return ik(a,b,c,!1,d)};exports.version="16.14.0";
|
55892 |
|
55893 |
|
55894 |
/***/ }),
|
55895 |
+
/* 458 */
|
55896 |
/***/ (function(module, exports, __webpack_require__) {
|
55897 |
|
55898 |
"use strict";
|
55920 |
|
55921 |
|
55922 |
/***/ }),
|
55923 |
+
/* 459 */
|
55924 |
/***/ (function(module, exports, __webpack_require__) {
|
55925 |
|
55926 |
"use strict";
|
56786 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
56787 |
|
56788 |
/***/ }),
|
56789 |
+
/* 460 */
|
56790 |
/***/ (function(module, exports, __webpack_require__) {
|
56791 |
|
56792 |
"use strict";
|
56793 |
+
/* WEBPACK VAR INJECTION */(function(process) {/** @license React v16.14.0
|
56794 |
* react-dom.development.js
|
56795 |
*
|
56796 |
* Copyright (c) Facebook, Inc. and its affiliates.
|
56807 |
(function() {
|
56808 |
'use strict';
|
56809 |
|
56810 |
+
var React = __webpack_require__(9);
|
56811 |
+
var _assign = __webpack_require__(63);
|
56812 |
+
var Scheduler = __webpack_require__(147);
|
56813 |
+
var checkPropTypes = __webpack_require__(95);
|
56814 |
+
var tracing = __webpack_require__(461);
|
56815 |
|
56816 |
var ReactSharedInternals = React.__SECRET_INTERNALS_DO_NOT_USE_OR_YOU_WILL_BE_FIRED; // Prevent newer renderers from RTE when used with older react package versions.
|
56817 |
// Current owner and dispatcher used to share the same ref,
|
81360 |
// Enables DevTools to append owner stacks to error messages in DEV mode.
|
81361 |
getCurrentFiber: function () {
|
81362 |
return current;
|
81363 |
+
}
|
81364 |
}));
|
81365 |
}
|
81366 |
var IsSomeRendererActing$1 = ReactSharedInternals.IsSomeRendererActing;
|
81712 |
};
|
81713 |
}
|
81714 |
|
81715 |
+
var ReactVersion = '16.14.0';
|
81716 |
|
81717 |
setAttemptUserBlockingHydration(attemptUserBlockingHydration$1);
|
81718 |
setAttemptContinuousHydration(attemptContinuousHydration$1);
|
81806 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
81807 |
|
81808 |
/***/ }),
|
81809 |
+
/* 461 */
|
81810 |
/***/ (function(module, exports, __webpack_require__) {
|
81811 |
|
81812 |
"use strict";
|
81813 |
/* WEBPACK VAR INJECTION */(function(process) {
|
81814 |
|
81815 |
if (process.env.NODE_ENV === 'production') {
|
81816 |
+
module.exports = __webpack_require__(462);
|
81817 |
} else {
|
81818 |
+
module.exports = __webpack_require__(463);
|
81819 |
}
|
81820 |
|
81821 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
81822 |
|
81823 |
/***/ }),
|
81824 |
+
/* 462 */
|
81825 |
/***/ (function(module, exports, __webpack_require__) {
|
81826 |
|
81827 |
"use strict";
|
81838 |
|
81839 |
|
81840 |
/***/ }),
|
81841 |
+
/* 463 */
|
81842 |
/***/ (function(module, exports, __webpack_require__) {
|
81843 |
|
81844 |
"use strict";
|
82195 |
/* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(20)))
|
82196 |
|
82197 |
/***/ }),
|
82198 |
+
/* 464 */
|
82199 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
82200 |
|
82201 |
"use strict";
|
82227 |
//# sourceMappingURL=utils.js.map
|
82228 |
|
82229 |
/***/ }),
|
82230 |
+
/* 465 */
|
82231 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
82232 |
|
82233 |
"use strict";
|
82237 |
/* unused harmony export renderComponent */
|
82238 |
/* unused harmony export renderAttributes */
|
82239 |
/* unused harmony export renderStyle */
|
82240 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(23);
|
82241 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
82242 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_typeof__ = __webpack_require__(39);
|
82243 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
82244 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
82245 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__wordpress_escape_html__ = __webpack_require__(77);
|
82246 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__react__ = __webpack_require__(94);
|
82247 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__raw_html__ = __webpack_require__(148);
|
82248 |
|
82249 |
|
82250 |
|
82730 |
//# sourceMappingURL=serialize.js.map
|
82731 |
|
82732 |
/***/ }),
|
82733 |
+
/* 466 */
|
82734 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
82735 |
|
82736 |
"use strict";
|
82753 |
//# sourceMappingURL=escape-greater.js.map
|
82754 |
|
82755 |
/***/ }),
|
82756 |
+
/* 467 */
|
82757 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
82758 |
|
82759 |
"use strict";
|
82763 |
/* unused harmony export Polygon */
|
82764 |
/* unused harmony export Rect */
|
82765 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return SVG; });
|
82766 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(23);
|
82767 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(1);
|
82768 |
|
82769 |
|
82800 |
//# sourceMappingURL=index.js.map
|
82801 |
|
82802 |
/***/ }),
|
82803 |
+
/* 468 */
|
82804 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
82805 |
|
82806 |
"use strict";
|
82807 |
/* unused harmony export Autocomplete */
|
82808 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(23);
|
82809 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
82810 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
82811 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
82812 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
82813 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
82814 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
82815 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
82816 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
82817 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__wordpress_element__ = __webpack_require__(1);
|
82818 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10_classnames__ = __webpack_require__(14);
|
82819 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10_classnames___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_10_classnames__);
|
82820 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11_lodash__ = __webpack_require__(2);
|
82821 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_11_lodash__);
|
82822 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__wordpress_keycodes__ = __webpack_require__(32);
|
82823 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__wordpress_i18n__ = __webpack_require__(26);
|
82824 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__wordpress_compose__ = __webpack_require__(18);
|
82825 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__wordpress_rich_text__ = __webpack_require__(510);
|
82826 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__wordpress_dom__ = __webpack_require__(54);
|
82827 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__higher_order_with_focus_outside__ = __webpack_require__(193);
|
82828 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__button__ = __webpack_require__(36);
|
82829 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__popover__ = __webpack_require__(84);
|
82830 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__higher_order_with_spoken_messages__ = __webpack_require__(121);
|
82831 |
|
82832 |
|
82833 |
|
83432 |
//# sourceMappingURL=index.js.map
|
83433 |
|
83434 |
/***/ }),
|
83435 |
+
/* 469 */
|
83436 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83437 |
|
83438 |
"use strict";
|
83447 |
}
|
83448 |
|
83449 |
/***/ }),
|
83450 |
+
/* 470 */
|
83451 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83452 |
|
83453 |
"use strict";
|
83454 |
/* harmony export (immutable) */ __webpack_exports__["a"] = _arrayWithoutHoles;
|
83455 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_arrayLikeToArray__ = __webpack_require__(149);
|
83456 |
|
83457 |
function _arrayWithoutHoles(arr) {
|
83458 |
+
if (Array.isArray(arr)) return Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_arrayLikeToArray__["a" /* default */])(arr);
|
83459 |
}
|
83460 |
|
83461 |
/***/ }),
|
83462 |
+
/* 471 */
|
83463 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83464 |
|
83465 |
"use strict";
|
83469 |
}
|
83470 |
|
83471 |
/***/ }),
|
83472 |
+
/* 472 */
|
83473 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83474 |
|
83475 |
"use strict";
|
83479 |
}
|
83480 |
|
83481 |
/***/ }),
|
83482 |
+
/* 473 */
|
83483 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83484 |
|
83485 |
"use strict";
|
83486 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__sprintf__ = __webpack_require__(474);
|
83487 |
/* unused harmony reexport sprintf */
|
83488 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__create_i18n__ = __webpack_require__(151);
|
83489 |
/* unused harmony namespace reexport */
|
83490 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__default_i18n__ = __webpack_require__(479);
|
83491 |
/* unused harmony reexport setLocaleData */
|
83492 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_2__default_i18n__["a"]; });
|
83493 |
/* unused harmony reexport _x */
|
83500 |
//# sourceMappingURL=index.js.map
|
83501 |
|
83502 |
/***/ }),
|
83503 |
+
/* 474 */
|
83504 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83505 |
|
83506 |
"use strict";
|
83507 |
/* unused harmony export sprintf */
|
83508 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_memize__ = __webpack_require__(64);
|
83509 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_memize___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_memize__);
|
83510 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_sprintf_js__ = __webpack_require__(79);
|
83511 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_sprintf_js___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_sprintf_js__);
|
83512 |
/**
|
83513 |
* External dependencies
|
83551 |
//# sourceMappingURL=sprintf.js.map
|
83552 |
|
83553 |
/***/ }),
|
83554 |
+
/* 475 */
|
83555 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83556 |
|
83557 |
"use strict";
|
83558 |
/* harmony export (immutable) */ __webpack_exports__["a"] = pluralForms;
|
83559 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__tannin_compile__ = __webpack_require__(476);
|
83560 |
|
83561 |
|
83562 |
/**
|
83578 |
|
83579 |
|
83580 |
/***/ }),
|
83581 |
+
/* 476 */
|
83582 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83583 |
|
83584 |
"use strict";
|
83585 |
/* harmony export (immutable) */ __webpack_exports__["a"] = compile;
|
83586 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__tannin_postfix__ = __webpack_require__(477);
|
83587 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__tannin_evaluate__ = __webpack_require__(478);
|
83588 |
|
83589 |
|
83590 |
|
83617 |
|
83618 |
|
83619 |
/***/ }),
|
83620 |
+
/* 477 */
|
83621 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83622 |
|
83623 |
"use strict";
|
83749 |
|
83750 |
|
83751 |
/***/ }),
|
83752 |
+
/* 478 */
|
83753 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83754 |
|
83755 |
"use strict";
|
83867 |
|
83868 |
|
83869 |
/***/ }),
|
83870 |
+
/* 479 */
|
83871 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83872 |
|
83873 |
"use strict";
|
83877 |
/* unused harmony export _n */
|
83878 |
/* unused harmony export _nx */
|
83879 |
/* unused harmony export isRTL */
|
83880 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__create_i18n__ = __webpack_require__(151);
|
83881 |
/**
|
83882 |
* Internal dependencies
|
83883 |
*/
|
83976 |
//# sourceMappingURL=default-i18n.js.map
|
83977 |
|
83978 |
/***/ }),
|
83979 |
+
/* 480 */
|
83980 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
83981 |
|
83982 |
"use strict";
|
84004 |
//# sourceMappingURL=platform.js.map
|
84005 |
|
84006 |
/***/ }),
|
84007 |
+
/* 481 */
|
84008 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
84009 |
|
84010 |
"use strict";
|
84027 |
//# sourceMappingURL=compose.js.map
|
84028 |
|
84029 |
/***/ }),
|
84030 |
+
/* 482 */
|
84031 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
84032 |
|
84033 |
"use strict";
|
84034 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(24);
|
84035 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__utils_create_higher_order_component__ = __webpack_require__(46);
|
84036 |
|
84037 |
|
84038 |
/**
|
84064 |
//# sourceMappingURL=index.js.map
|
84065 |
|
84066 |
/***/ }),
|
84067 |
+
/* 483 */
|
84068 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
84069 |
|
84070 |
"use strict";
|
84071 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
84072 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_typeof__ = __webpack_require__(39);
|
84073 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
84074 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_react__ = __webpack_require__(9);
|
84075 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_react__);
|
84076 |
|
84077 |
|
84424 |
//# sourceMappingURL=create-interpolate-element.js.map
|
84425 |
|
84426 |
/***/ }),
|
84427 |
+
/* 484 */
|
84428 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
84429 |
|
84430 |
"use strict";
|
84434 |
}
|
84435 |
|
84436 |
/***/ }),
|
84437 |
+
/* 485 */
|
84438 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
84439 |
|
84440 |
"use strict";
|
84467 |
}
|
84468 |
|
84469 |
/***/ }),
|
84470 |
+
/* 486 */
|
84471 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
84472 |
|
84473 |
"use strict";
|
84477 |
}
|
84478 |
|
84479 |
/***/ }),
|
84480 |
+
/* 487 */
|
84481 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
84482 |
|
84483 |
"use strict";
|
84484 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom__ = __webpack_require__(45);
|
84485 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react_dom__);
|
84486 |
/* unused harmony reexport createPortal */
|
84487 |
/* unused harmony reexport findDOMNode */
|
84527 |
//# sourceMappingURL=react-platform.js.map
|
84528 |
|
84529 |
/***/ }),
|
84530 |
+
/* 488 */
|
84531 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
84532 |
|
84533 |
"use strict";
|
84559 |
//# sourceMappingURL=utils.js.map
|
84560 |
|
84561 |
/***/ }),
|
84562 |
+
/* 489 */
|
84563 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
84564 |
|
84565 |
"use strict";
|
84601 |
//# sourceMappingURL=platform.js.map
|
84602 |
|
84603 |
/***/ }),
|
84604 |
+
/* 490 */
|
84605 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
84606 |
|
84607 |
"use strict";
|
84611 |
/* unused harmony export renderComponent */
|
84612 |
/* unused harmony export renderAttributes */
|
84613 |
/* unused harmony export renderStyle */
|
84614 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
84615 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
84616 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_typeof__ = __webpack_require__(39);
|
84617 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
84618 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
84619 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__wordpress_escape_html__ = __webpack_require__(77);
|
84620 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__react__ = __webpack_require__(97);
|
84621 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__raw_html__ = __webpack_require__(152);
|
84622 |
|
84623 |
|
84624 |
|
84902 |
var children = props.children,
|
84903 |
wrapperProps = Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__["a" /* default */])(props, ["children"]);
|
84904 |
|
84905 |
+
return renderNativeComponent(Object(__WEBPACK_IMPORTED_MODULE_3_lodash__["isEmpty"])(wrapperProps) ? null : 'div', _objectSpread(_objectSpread({}, wrapperProps), {}, {
|
84906 |
dangerouslySetInnerHTML: {
|
84907 |
__html: children
|
84908 |
}
|
85127 |
//# sourceMappingURL=serialize.js.map
|
85128 |
|
85129 |
/***/ }),
|
85130 |
+
/* 491 */
|
85131 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85132 |
|
85133 |
"use strict";
|
85134 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
85135 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
85136 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
85137 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
85138 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
85139 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_element__ = __webpack_require__(24);
|
85140 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_is_shallow_equal__ = __webpack_require__(492);
|
85141 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_is_shallow_equal___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6__wordpress_is_shallow_equal__);
|
85142 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__utils_create_higher_order_component__ = __webpack_require__(46);
|
85143 |
|
85144 |
|
85145 |
|
85147 |
|
85148 |
|
85149 |
|
85150 |
+
function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(__WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__["a" /* default */])(this, result); }; }
|
85151 |
|
85152 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
85153 |
|
85176 |
var pure = Object(__WEBPACK_IMPORTED_MODULE_7__utils_create_higher_order_component__["a" /* default */])(function (Wrapped) {
|
85177 |
if (Wrapped.prototype instanceof __WEBPACK_IMPORTED_MODULE_5__wordpress_element__["a" /* Component */]) {
|
85178 |
return /*#__PURE__*/function (_Wrapped) {
|
85179 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_inherits__["a" /* default */])(_class, _Wrapped);
|
85180 |
|
85181 |
var _super = _createSuper(_class);
|
85182 |
|
85198 |
}
|
85199 |
|
85200 |
return /*#__PURE__*/function (_Component) {
|
85201 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_inherits__["a" /* default */])(_class2, _Component);
|
85202 |
|
85203 |
var _super2 = _createSuper(_class2);
|
85204 |
|
85227 |
//# sourceMappingURL=index.js.map
|
85228 |
|
85229 |
/***/ }),
|
85230 |
+
/* 492 */
|
85231 |
/***/ (function(module, exports, __webpack_require__) {
|
85232 |
|
85233 |
"use strict";
|
85236 |
/**
|
85237 |
* Internal dependencies;
|
85238 |
*/
|
85239 |
+
var isShallowEqualObjects = __webpack_require__( 493 );
|
85240 |
+
var isShallowEqualArrays = __webpack_require__( 494 );
|
85241 |
|
85242 |
var isArray = Array.isArray;
|
85243 |
|
85272 |
|
85273 |
|
85274 |
/***/ }),
|
85275 |
+
/* 493 */
|
85276 |
/***/ (function(module, exports, __webpack_require__) {
|
85277 |
|
85278 |
"use strict";
|
85330 |
|
85331 |
|
85332 |
/***/ }),
|
85333 |
+
/* 494 */
|
85334 |
/***/ (function(module, exports, __webpack_require__) {
|
85335 |
|
85336 |
"use strict";
|
85368 |
|
85369 |
|
85370 |
/***/ }),
|
85371 |
+
/* 495 */
|
85372 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85373 |
|
85374 |
"use strict";
|
85375 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
85376 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
85377 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
85378 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
85379 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
85380 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
85381 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
85382 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(24);
|
85383 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
85384 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
85385 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__ = __webpack_require__(46);
|
85386 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__listener__ = __webpack_require__(496);
|
85387 |
|
85388 |
|
85389 |
|
85393 |
|
85394 |
|
85395 |
|
85396 |
+
function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(__WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_possibleConstructorReturn__["a" /* default */])(this, result); }; }
|
85397 |
|
85398 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
85399 |
|
85440 |
function withGlobalEvents(eventTypesToHandlers) {
|
85441 |
return Object(__WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__["a" /* default */])(function (WrappedComponent) {
|
85442 |
var Wrapper = /*#__PURE__*/function (_Component) {
|
85443 |
+
Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__["a" /* default */])(Wrapper, _Component);
|
85444 |
|
85445 |
var _super = _createSuper(Wrapper);
|
85446 |
|
85518 |
//# sourceMappingURL=index.js.map
|
85519 |
|
85520 |
/***/ }),
|
85521 |
+
/* 496 */
|
85522 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85523 |
|
85524 |
"use strict";
|
85585 |
//# sourceMappingURL=listener.js.map
|
85586 |
|
85587 |
/***/ }),
|
85588 |
+
/* 497 */
|
85589 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85590 |
|
85591 |
"use strict";
|
85592 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
85593 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(24);
|
85594 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_create_higher_order_component__ = __webpack_require__(46);
|
85595 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__hooks_use_instance_id__ = __webpack_require__(153);
|
85596 |
|
85597 |
|
85598 |
|
85621 |
//# sourceMappingURL=index.js.map
|
85622 |
|
85623 |
/***/ }),
|
85624 |
+
/* 498 */
|
85625 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85626 |
|
85627 |
"use strict";
|
85628 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
85629 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
85630 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
85631 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
85632 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
85633 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
85634 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
85635 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(24);
|
85636 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
85637 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
85638 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__ = __webpack_require__(46);
|
85639 |
|
85640 |
|
85641 |
|
85645 |
|
85646 |
|
85647 |
|
85648 |
+
function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(__WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_possibleConstructorReturn__["a" /* default */])(this, result); }; }
|
85649 |
|
85650 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
85651 |
|
85674 |
|
85675 |
var withSafeTimeout = Object(__WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__["a" /* default */])(function (OriginalComponent) {
|
85676 |
return /*#__PURE__*/function (_Component) {
|
85677 |
+
Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__["a" /* default */])(WrappedComponent, _Component);
|
85678 |
|
85679 |
var _super = _createSuper(WrappedComponent);
|
85680 |
|
85751 |
//# sourceMappingURL=index.js.map
|
85752 |
|
85753 |
/***/ }),
|
85754 |
+
/* 499 */
|
85755 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85756 |
|
85757 |
"use strict";
|
85759 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
85760 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
85761 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
85762 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
85763 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
85764 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
85765 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
85766 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(24);
|
85767 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__utils_create_higher_order_component__ = __webpack_require__(46);
|
85768 |
|
85769 |
|
85770 |
|
85774 |
|
85775 |
|
85776 |
|
85777 |
+
function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(__WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_possibleConstructorReturn__["a" /* default */])(this, result); }; }
|
85778 |
|
85779 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
85780 |
|
85800 |
var initialState = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
|
85801 |
return Object(__WEBPACK_IMPORTED_MODULE_8__utils_create_higher_order_component__["a" /* default */])(function (OriginalComponent) {
|
85802 |
return /*#__PURE__*/function (_Component) {
|
85803 |
+
Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__["a" /* default */])(WrappedComponent, _Component);
|
85804 |
|
85805 |
var _super = _createSuper(WrappedComponent);
|
85806 |
|
85831 |
//# sourceMappingURL=index.js.map
|
85832 |
|
85833 |
/***/ }),
|
85834 |
+
/* 500 */
|
85835 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85836 |
|
85837 |
"use strict";
|
85838 |
/* unused harmony export default */
|
85839 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
85840 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_clipboard__ = __webpack_require__(98);
|
85841 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_clipboard___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_clipboard__);
|
85842 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(24);
|
85843 |
+
|
85844 |
+
|
85845 |
+
/**
|
85846 |
+
* External dependencies
|
85847 |
+
*/
|
85848 |
+
|
85849 |
+
/**
|
85850 |
+
* WordPress dependencies
|
85851 |
+
*/
|
85852 |
+
|
85853 |
+
|
85854 |
+
/**
|
85855 |
+
* Copies the text to the clipboard when the element is clicked.
|
85856 |
+
*
|
85857 |
+
* @param {Object} ref Reference with the element.
|
85858 |
+
* @param {string|Function} text The text to copy.
|
85859 |
+
* @param {number} timeout Optional timeout to reset the returned
|
85860 |
+
* state. 4 seconds by default.
|
85861 |
+
*
|
85862 |
+
* @return {boolean} Whether or not the text has been copied. Resets after the
|
85863 |
+
* timeout.
|
85864 |
+
*/
|
85865 |
+
|
85866 |
+
function useCopyOnClick(ref, _text) {
|
85867 |
+
var timeout = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 4000;
|
85868 |
+
var clipboard = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["k" /* useRef */])();
|
85869 |
+
|
85870 |
+
var _useState = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["l" /* useState */])(false),
|
85871 |
+
_useState2 = Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__["a" /* default */])(_useState, 2),
|
85872 |
+
hasCopied = _useState2[0],
|
85873 |
+
setHasCopied = _useState2[1];
|
85874 |
+
|
85875 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["g" /* useEffect */])(function () {
|
85876 |
+
var timeoutId; // Clipboard listens to click events.
|
85877 |
+
|
85878 |
+
clipboard.current = new __WEBPACK_IMPORTED_MODULE_1_clipboard___default.a(ref.current, {
|
85879 |
+
text: function text() {
|
85880 |
+
return typeof _text === 'function' ? _text() : _text;
|
85881 |
+
}
|
85882 |
+
});
|
85883 |
+
clipboard.current.on('success', function (_ref) {
|
85884 |
+
var clearSelection = _ref.clearSelection,
|
85885 |
+
trigger = _ref.trigger;
|
85886 |
+
// Clearing selection will move focus back to the triggering button,
|
85887 |
+
// ensuring that it is not reset to the body, and further that it is
|
85888 |
+
// kept within the rendered node.
|
85889 |
+
clearSelection(); // Handle ClipboardJS focus bug, see https://github.com/zenorocha/clipboard.js/issues/680
|
85890 |
+
|
85891 |
+
if (trigger) {
|
85892 |
+
trigger.focus();
|
85893 |
+
}
|
85894 |
+
|
85895 |
+
if (timeout) {
|
85896 |
+
setHasCopied(true);
|
85897 |
+
clearTimeout(timeoutId);
|
85898 |
+
timeoutId = setTimeout(function () {
|
85899 |
+
return setHasCopied(false);
|
85900 |
+
}, timeout);
|
85901 |
+
}
|
85902 |
+
});
|
85903 |
+
return function () {
|
85904 |
+
clipboard.current.destroy();
|
85905 |
+
clearTimeout(timeoutId);
|
85906 |
+
};
|
85907 |
+
}, [_text, timeout, setHasCopied]);
|
85908 |
+
return hasCopied;
|
85909 |
+
}
|
85910 |
+
//# sourceMappingURL=index.js.map
|
85911 |
+
|
85912 |
+
/***/ }),
|
85913 |
+
/* 501 */
|
85914 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85915 |
+
|
85916 |
+
"use strict";
|
85917 |
+
/* unused harmony export default */
|
85918 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
85919 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(24);
|
85920 |
|
85921 |
|
85922 |
/**
|
85929 |
onDragMove = _ref.onDragMove,
|
85930 |
onDragEnd = _ref.onDragEnd;
|
85931 |
|
85932 |
+
var _useState = Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_element__["l" /* useState */])(false),
|
85933 |
_useState2 = Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__["a" /* default */])(_useState, 2),
|
85934 |
isDragging = _useState2[0],
|
85935 |
setIsDragging = _useState2[1];
|
85936 |
|
85937 |
+
var eventsRef = Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_element__["k" /* useRef */])({
|
85938 |
onDragStart: onDragStart,
|
85939 |
onDragMove: onDragMove,
|
85940 |
onDragEnd: onDragEnd
|
85989 |
//# sourceMappingURL=index.js.map
|
85990 |
|
85991 |
/***/ }),
|
85992 |
+
/* 502 */
|
85993 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
85994 |
|
85995 |
"use strict";
|
85996 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_mousetrap__ = __webpack_require__(99);
|
85997 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_mousetrap___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_mousetrap__);
|
85998 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_mousetrap_plugins_global_bind_mousetrap_global_bind__ = __webpack_require__(100);
|
85999 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_mousetrap_plugins_global_bind_mousetrap_global_bind___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_mousetrap_plugins_global_bind_mousetrap_global_bind__);
|
86000 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash__ = __webpack_require__(2);
|
86001 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_lodash__);
|
86002 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_element__ = __webpack_require__(24);
|
86003 |
/**
|
86004 |
* External dependencies
|
86005 |
*/
|
86055 |
isDisabled = _ref$isDisabled === void 0 ? false : _ref$isDisabled,
|
86056 |
target = _ref.target;
|
86057 |
|
86058 |
+
var currentCallback = Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_element__["k" /* useRef */])(callback);
|
86059 |
+
Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_element__["g" /* useEffect */])(function () {
|
86060 |
+
currentCallback.current = callback;
|
86061 |
+
}, [callback]);
|
86062 |
Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_element__["g" /* useEffect */])(function () {
|
86063 |
if (isDisabled) {
|
86064 |
return;
|
86081 |
}
|
86082 |
|
86083 |
var bindFn = bindGlobal ? 'bindGlobal' : 'bind';
|
86084 |
+
mousetrap[bindFn](shortcut, function () {
|
86085 |
+
return currentCallback.current.apply(currentCallback, arguments);
|
86086 |
+
}, eventName);
|
86087 |
});
|
86088 |
return function () {
|
86089 |
mousetrap.reset();
|
86090 |
};
|
86091 |
+
}, [shortcuts, bindGlobal, eventName, target, isDisabled]);
|
86092 |
}
|
86093 |
|
86094 |
/* unused harmony default export */ var _unused_webpack_default_export = (useKeyboardShortcut);
|
86095 |
//# sourceMappingURL=index.js.map
|
86096 |
|
86097 |
/***/ }),
|
86098 |
+
/* 503 */
|
86099 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86100 |
|
86101 |
"use strict";
|
86102 |
+
/* WEBPACK VAR INJECTION */(function(process) {/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__use_media_query__ = __webpack_require__(101);
|
86103 |
/**
|
86104 |
* Internal dependencies
|
86105 |
*/
|
86127 |
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(20)))
|
86128 |
|
86129 |
/***/ }),
|
86130 |
+
/* 504 */
|
86131 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86132 |
|
86133 |
"use strict";
|
86134 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(24);
|
86135 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__use_media_query__ = __webpack_require__(101);
|
86136 |
/**
|
86137 |
* WordPress dependencies
|
86138 |
*/
|
86225 |
//# sourceMappingURL=index.js.map
|
86226 |
|
86227 |
/***/ }),
|
86228 |
+
/* 505 */
|
86229 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86230 |
|
86231 |
"use strict";
|
86232 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_resize_aware__ = __webpack_require__(155);
|
86233 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_resize_aware___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react_resize_aware__);
|
86234 |
/**
|
86235 |
* External dependencies
|
86262 |
//# sourceMappingURL=index.js.map
|
86263 |
|
86264 |
/***/ }),
|
86265 |
+
/* 506 */
|
86266 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86267 |
|
86268 |
"use strict";
|
86269 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
86270 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
86271 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(24);
|
86272 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_priority_queue__ = __webpack_require__(102);
|
86273 |
+
|
86274 |
+
|
86275 |
+
|
86276 |
+
/**
|
86277 |
+
* WordPress dependencies
|
86278 |
+
*/
|
86279 |
+
|
86280 |
+
|
86281 |
+
/**
|
86282 |
+
* Returns the first items from list that are present on state.
|
86283 |
+
*
|
86284 |
+
* @param {Array} list New array.
|
86285 |
+
* @param {Array} state Current state.
|
86286 |
+
* @return {Array} First items present iin state.
|
86287 |
+
*/
|
86288 |
+
|
86289 |
+
function getFirstItemsPresentInState(list, state) {
|
86290 |
+
var firstItems = [];
|
86291 |
+
|
86292 |
+
for (var i = 0; i < list.length; i++) {
|
86293 |
+
var item = list[i];
|
86294 |
+
|
86295 |
+
if (!state.includes(item)) {
|
86296 |
+
break;
|
86297 |
+
}
|
86298 |
+
|
86299 |
+
firstItems.push(item);
|
86300 |
+
}
|
86301 |
+
|
86302 |
+
return firstItems;
|
86303 |
+
}
|
86304 |
+
/**
|
86305 |
+
* Reducer keeping track of a list of appended items.
|
86306 |
+
*
|
86307 |
+
* @param {Array} state Current state
|
86308 |
+
* @param {Object} action Action
|
86309 |
+
*
|
86310 |
+
* @return {Array} update state.
|
86311 |
+
*/
|
86312 |
+
|
86313 |
+
|
86314 |
+
function listReducer(state, action) {
|
86315 |
+
if (action.type === 'reset') {
|
86316 |
+
return action.list;
|
86317 |
+
}
|
86318 |
+
|
86319 |
+
if (action.type === 'append') {
|
86320 |
+
return [].concat(Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__["a" /* default */])(state), [action.item]);
|
86321 |
+
}
|
86322 |
+
|
86323 |
+
return state;
|
86324 |
+
}
|
86325 |
+
/**
|
86326 |
+
* React hook returns an array which items get asynchronously appended from a source array.
|
86327 |
+
* This behavior is useful if we want to render a list of items asynchronously for performance reasons.
|
86328 |
+
*
|
86329 |
+
* @param {Array} list Source array.
|
86330 |
+
* @return {Array} Async array.
|
86331 |
+
*/
|
86332 |
+
|
86333 |
+
|
86334 |
+
function useAsyncList(list) {
|
86335 |
+
var _useReducer = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["j" /* useReducer */])(listReducer, []),
|
86336 |
+
_useReducer2 = Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__["a" /* default */])(_useReducer, 2),
|
86337 |
+
current = _useReducer2[0],
|
86338 |
+
dispatch = _useReducer2[1];
|
86339 |
+
|
86340 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["g" /* useEffect */])(function () {
|
86341 |
+
// On reset, we keep the first items that were previously rendered.
|
86342 |
+
var firstItems = getFirstItemsPresentInState(list, current);
|
86343 |
+
dispatch({
|
86344 |
+
type: 'reset',
|
86345 |
+
list: firstItems
|
86346 |
+
});
|
86347 |
+
var asyncQueue = Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_priority_queue__["a" /* createQueue */])();
|
86348 |
+
|
86349 |
+
var append = function append(index) {
|
86350 |
+
return function () {
|
86351 |
+
if (list.length <= index) {
|
86352 |
+
return;
|
86353 |
+
}
|
86354 |
+
|
86355 |
+
dispatch({
|
86356 |
+
type: 'append',
|
86357 |
+
item: list[index]
|
86358 |
+
});
|
86359 |
+
asyncQueue.add({}, append(index + 1));
|
86360 |
+
};
|
86361 |
+
};
|
86362 |
+
|
86363 |
+
asyncQueue.add({}, append(firstItems.length));
|
86364 |
+
return function () {
|
86365 |
+
return asyncQueue.reset();
|
86366 |
+
};
|
86367 |
+
}, [list]);
|
86368 |
+
return current;
|
86369 |
+
}
|
86370 |
+
|
86371 |
+
/* unused harmony default export */ var _unused_webpack_default_export = (useAsyncList);
|
86372 |
+
//# sourceMappingURL=index.js.map
|
86373 |
+
|
86374 |
+
/***/ }),
|
86375 |
+
/* 507 */
|
86376 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86377 |
+
|
86378 |
+
"use strict";
|
86379 |
+
/* unused harmony export createRequestIdleCallback */
|
86380 |
+
/**
|
86381 |
+
* @typedef {( timeOrDeadline: IdleDeadline | number ) => void} Callback
|
86382 |
+
*/
|
86383 |
+
|
86384 |
+
/**
|
86385 |
+
* @return {(callback: Callback) => void} RequestIdleCallback
|
86386 |
+
*/
|
86387 |
+
function createRequestIdleCallback() {
|
86388 |
+
if (typeof window === 'undefined') {
|
86389 |
+
return function (callback) {
|
86390 |
+
setTimeout(function () {
|
86391 |
+
return callback(Date.now());
|
86392 |
+
}, 0);
|
86393 |
+
};
|
86394 |
+
}
|
86395 |
+
|
86396 |
+
return window.requestIdleCallback || window.requestAnimationFrame;
|
86397 |
+
}
|
86398 |
+
/* harmony default export */ __webpack_exports__["a"] = (createRequestIdleCallback());
|
86399 |
+
//# sourceMappingURL=request-idle-callback.js.map
|
86400 |
+
|
86401 |
+
/***/ }),
|
86402 |
+
/* 508 */
|
86403 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86404 |
+
|
86405 |
+
"use strict";
|
86406 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
86407 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__use_previous__ = __webpack_require__(154);
|
86408 |
+
|
86409 |
+
|
86410 |
+
/**
|
86411 |
+
* Internal dependencies
|
86412 |
+
*/
|
86413 |
+
|
86414 |
+
/**
|
86415 |
+
* Hook that performs a shallow comparison between the preview value of an object
|
86416 |
+
* and the new one, if there's a difference, it prints it to the console.
|
86417 |
+
* this is useful in performance related work, to check why a component re-renders.
|
86418 |
+
*
|
86419 |
+
* @example
|
86420 |
+
*
|
86421 |
+
* ```jsx
|
86422 |
+
* function MyComponent(props) {
|
86423 |
+
* useWarnOnChange(props);
|
86424 |
+
*
|
86425 |
+
* return "Something";
|
86426 |
+
* }
|
86427 |
+
* ```
|
86428 |
+
*
|
86429 |
+
* @param {Object} object Object which changes to compare.
|
86430 |
+
* @param {string} prefix Just a prefix to show when console logging.
|
86431 |
+
*/
|
86432 |
+
|
86433 |
+
function useWarnOnChange(object) {
|
86434 |
+
var prefix = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'Change detection';
|
86435 |
+
var previousValues = Object(__WEBPACK_IMPORTED_MODULE_1__use_previous__["a" /* default */])(object);
|
86436 |
+
Object.entries(previousValues !== null && previousValues !== void 0 ? previousValues : []).forEach(function (_ref) {
|
86437 |
+
var _ref2 = Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__["a" /* default */])(_ref, 2),
|
86438 |
+
key = _ref2[0],
|
86439 |
+
value = _ref2[1];
|
86440 |
+
|
86441 |
+
if (value !== object[key]) {
|
86442 |
+
// eslint-disable-next-line no-console
|
86443 |
+
console.warn("".concat(prefix, ": ").concat(key, " key changed:"), value, object[key]);
|
86444 |
+
}
|
86445 |
+
});
|
86446 |
+
}
|
86447 |
+
|
86448 |
+
/* unused harmony default export */ var _unused_webpack_default_export = (useWarnOnChange);
|
86449 |
+
//# sourceMappingURL=index.js.map
|
86450 |
+
|
86451 |
+
/***/ }),
|
86452 |
+
/* 509 */
|
86453 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86454 |
+
|
86455 |
+
"use strict";
|
86456 |
+
/* unused harmony export default */
|
86457 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash__ = __webpack_require__(2);
|
86458 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_lodash__);
|
86459 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_use_memo_one__ = __webpack_require__(103);
|
86460 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(24);
|
86461 |
+
/**
|
86462 |
+
* External dependencies
|
86463 |
+
*/
|
86464 |
+
|
86465 |
+
|
86466 |
+
/**
|
86467 |
+
* WordPress dependencies
|
86468 |
+
*/
|
86469 |
+
|
86470 |
+
|
86471 |
+
/**
|
86472 |
+
* Debounces a function with Lodash's `debounce`. A new debounced function will
|
86473 |
+
* be returned and any scheduled calls cancelled if any of the arguments change,
|
86474 |
+
* including the function to debounce, so please wrap functions created on
|
86475 |
+
* render in components in `useCallback`.
|
86476 |
+
*
|
86477 |
+
* @param {...any} args Arguments passed to Lodash's `debounce`.
|
86478 |
+
*/
|
86479 |
+
|
86480 |
+
function useDebounce() {
|
86481 |
+
for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
|
86482 |
+
args[_key] = arguments[_key];
|
86483 |
+
}
|
86484 |
+
|
86485 |
+
var debounced = Object(__WEBPACK_IMPORTED_MODULE_1_use_memo_one__["a" /* useMemoOne */])(function () {
|
86486 |
+
return __WEBPACK_IMPORTED_MODULE_0_lodash__["debounce"].apply(void 0, args);
|
86487 |
+
}, args);
|
86488 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["g" /* useEffect */])(function () {
|
86489 |
+
return function () {
|
86490 |
+
return debounced.cancel();
|
86491 |
+
};
|
86492 |
+
}, [debounced]);
|
86493 |
+
return debounced;
|
86494 |
+
}
|
86495 |
+
//# sourceMappingURL=index.js.map
|
86496 |
+
|
86497 |
+
/***/ }),
|
86498 |
+
/* 510 */
|
86499 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86500 |
+
|
86501 |
+
"use strict";
|
86502 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__store__ = __webpack_require__(511);
|
86503 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__apply_format__ = __webpack_require__(176);
|
86504 |
/* unused harmony reexport applyFormat */
|
86505 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__concat__ = __webpack_require__(177);
|
86506 |
/* unused harmony reexport concat */
|
86507 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__create__ = __webpack_require__(53);
|
86508 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_3__create__["a"]; });
|
86509 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__get_active_format__ = __webpack_require__(111);
|
86510 |
/* unused harmony reexport getActiveFormat */
|
86511 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__get_active_object__ = __webpack_require__(178);
|
86512 |
/* unused harmony reexport getActiveObject */
|
86513 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__get_text_content__ = __webpack_require__(179);
|
86514 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return __WEBPACK_IMPORTED_MODULE_6__get_text_content__["a"]; });
|
86515 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__is_list_root_selected__ = __webpack_require__(585);
|
86516 |
/* unused harmony reexport __unstableIsListRootSelected */
|
86517 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__is_active_list_type__ = __webpack_require__(586);
|
86518 |
/* unused harmony reexport __unstableIsActiveListType */
|
86519 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__is_collapsed__ = __webpack_require__(113);
|
86520 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return __WEBPACK_IMPORTED_MODULE_9__is_collapsed__["a"]; });
|
86521 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__is_empty__ = __webpack_require__(180);
|
86522 |
/* unused harmony reexport isEmpty */
|
86523 |
/* unused harmony reexport __unstableIsEmptyLine */
|
86524 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__join__ = __webpack_require__(587);
|
86525 |
/* unused harmony reexport join */
|
86526 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__register_format_type__ = __webpack_require__(588);
|
86527 |
/* unused harmony reexport registerFormatType */
|
86528 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__remove_format__ = __webpack_require__(114);
|
86529 |
/* unused harmony reexport removeFormat */
|
86530 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__remove__ = __webpack_require__(115);
|
86531 |
/* unused harmony reexport remove */
|
86532 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__replace__ = __webpack_require__(181);
|
86533 |
/* unused harmony reexport replace */
|
86534 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__insert__ = __webpack_require__(66);
|
86535 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return __WEBPACK_IMPORTED_MODULE_16__insert__["a"]; });
|
86536 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__insert_line_separator__ = __webpack_require__(589);
|
86537 |
/* unused harmony reexport __unstableInsertLineSeparator */
|
86538 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__remove_line_separator__ = __webpack_require__(182);
|
86539 |
/* unused harmony reexport __unstableRemoveLineSeparator */
|
86540 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__insert_object__ = __webpack_require__(590);
|
86541 |
/* unused harmony reexport insertObject */
|
86542 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__slice__ = __webpack_require__(591);
|
86543 |
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "e", function() { return __WEBPACK_IMPORTED_MODULE_20__slice__["a"]; });
|
86544 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_21__split__ = __webpack_require__(592);
|
86545 |
/* unused harmony reexport split */
|
86546 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_22__to_dom__ = __webpack_require__(183);
|
86547 |
/* unused harmony reexport __unstableToDom */
|
86548 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_23__to_html_string__ = __webpack_require__(185);
|
86549 |
/* unused harmony reexport toHTMLString */
|
86550 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_24__toggle_format__ = __webpack_require__(594);
|
86551 |
/* unused harmony reexport toggleFormat */
|
86552 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_25__special_characters__ = __webpack_require__(30);
|
86553 |
/* unused harmony reexport __UNSTABLE_LINE_SEPARATOR */
|
86554 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_26__unregister_format_type__ = __webpack_require__(595);
|
86555 |
/* unused harmony reexport unregisterFormatType */
|
86556 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_27__can_indent_list_items__ = __webpack_require__(186);
|
86557 |
/* unused harmony reexport __unstableCanIndentListItems */
|
86558 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_28__can_outdent_list_items__ = __webpack_require__(187);
|
86559 |
/* unused harmony reexport __unstableCanOutdentListItems */
|
86560 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_29__indent_list_items__ = __webpack_require__(188);
|
86561 |
/* unused harmony reexport __unstableIndentListItems */
|
86562 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_30__outdent_list_items__ = __webpack_require__(596);
|
86563 |
/* unused harmony reexport __unstableOutdentListItems */
|
86564 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_31__change_list_type__ = __webpack_require__(598);
|
86565 |
/* unused harmony reexport __unstableChangeListType */
|
86566 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_32__create_element__ = __webpack_require__(110);
|
86567 |
/* unused harmony reexport __unstableCreateElement */
|
86568 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_33__component__ = __webpack_require__(599);
|
86569 |
/* unused harmony reexport __experimentalRichText */
|
86570 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_34__component_format_edit__ = __webpack_require__(190);
|
86571 |
/* unused harmony reexport __unstableFormatEdit */
|
86572 |
/**
|
86573 |
* Internal dependencies
|
86610 |
//# sourceMappingURL=index.js.map
|
86611 |
|
86612 |
/***/ }),
|
86613 |
+
/* 511 */
|
86614 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86615 |
|
86616 |
"use strict";
|
86617 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_data__ = __webpack_require__(41);
|
86618 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__reducer__ = __webpack_require__(581);
|
86619 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__selectors__ = __webpack_require__(582);
|
86620 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__actions__ = __webpack_require__(584);
|
86621 |
/**
|
86622 |
* WordPress dependencies
|
86623 |
*/
|
86629 |
|
86630 |
|
86631 |
|
86632 |
+
Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_data__["c" /* registerStore */])('core/rich-text', {
|
86633 |
reducer: __WEBPACK_IMPORTED_MODULE_1__reducer__["a" /* default */],
|
86634 |
selectors: __WEBPACK_IMPORTED_MODULE_2__selectors__,
|
86635 |
actions: __WEBPACK_IMPORTED_MODULE_3__actions__
|
86637 |
//# sourceMappingURL=index.js.map
|
86638 |
|
86639 |
/***/ }),
|
86640 |
+
/* 512 */
|
86641 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
86642 |
|
86643 |
"use strict";
|
86644 |
/* harmony export (immutable) */ __webpack_exports__["a"] = createNamespace;
|
86645 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator__ = __webpack_require__(513);
|
86646 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator__);
|
86647 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_asyncToGenerator__ = __webpack_require__(159);
|
86648 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
86649 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_redux__ = __webpack_require__(515);
|
86650 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash__ = __webpack_require__(2);
|
86651 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_4_lodash__);
|
86652 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_turbo_combine_reducers__ = __webpack_require__(156);
|
86653 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_turbo_combine_reducers___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_5_turbo_combine_reducers__);
|
86654 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_equivalent_key_map__ = __webpack_require__(160);
|
86655 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6_equivalent_key_map___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6_equivalent_key_map__);
|
86656 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_redux_routine__ = __webpack_require__(519);
|
86657 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__controls__ = __webpack_require__(163);
|
86658 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__promise_middleware__ = __webpack_require__(530);
|
86659 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__resolvers_cache_middleware__ = __webpack_require__(532);
|
86660 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__metadata_reducer__ = __webpack_require__(533);
|
86661 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__metadata_selectors__ = __webpack_require__(535);
|
86662 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__metadata_actions__ = __webpack_require__(536);
|
86663 |
|
86664 |
|
86665 |
|
86674 |
|
86675 |
|
86676 |
|
86677 |
+
|
86678 |
/**
|
86679 |
* WordPress dependencies
|
86680 |
*/
|
86689 |
|
86690 |
|
86691 |
|
86692 |
+
|
86693 |
+
/**
|
86694 |
+
* Create a cache to track whether resolvers started running or not.
|
86695 |
+
*
|
86696 |
+
* @return {Object} Resolvers Cache.
|
86697 |
+
*/
|
86698 |
+
|
86699 |
+
function createResolversCache() {
|
86700 |
+
var cache = {};
|
86701 |
+
return {
|
86702 |
+
isRunning: function isRunning(selectorName, args) {
|
86703 |
+
return cache[selectorName] && cache[selectorName].get(args);
|
86704 |
+
},
|
86705 |
+
clear: function clear(selectorName, args) {
|
86706 |
+
if (cache[selectorName]) {
|
86707 |
+
cache[selectorName].delete(args);
|
86708 |
+
}
|
86709 |
+
},
|
86710 |
+
markAsRunning: function markAsRunning(selectorName, args) {
|
86711 |
+
if (!cache[selectorName]) {
|
86712 |
+
cache[selectorName] = new __WEBPACK_IMPORTED_MODULE_6_equivalent_key_map___default.a();
|
86713 |
+
}
|
86714 |
+
|
86715 |
+
cache[selectorName].set(args, true);
|
86716 |
+
}
|
86717 |
+
};
|
86718 |
+
}
|
86719 |
/**
|
86720 |
* @typedef {WPDataRegistry} WPDataRegistry
|
86721 |
*/
|
86732 |
* @return {Object} Store Object.
|
86733 |
*/
|
86734 |
|
86735 |
+
|
86736 |
function createNamespace(key, options, registry) {
|
86737 |
var reducer = options.reducer;
|
86738 |
var store = createReduxStore(key, options, registry);
|
86739 |
+
var resolversCache = createResolversCache();
|
86740 |
var resolvers;
|
86741 |
+
var actions = mapActions(_objectSpread(_objectSpread({}, __WEBPACK_IMPORTED_MODULE_13__metadata_actions__), options.actions), store);
|
86742 |
+
var selectors = mapSelectors(_objectSpread(_objectSpread({}, Object(__WEBPACK_IMPORTED_MODULE_4_lodash__["mapValues"])(__WEBPACK_IMPORTED_MODULE_12__metadata_selectors__, function (selector) {
|
86743 |
return function (state) {
|
86744 |
for (var _len = arguments.length, args = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
|
86745 |
args[_key - 1] = arguments[_key];
|
86747 |
|
86748 |
return selector.apply(void 0, [state.metadata].concat(args));
|
86749 |
};
|
86750 |
+
})), Object(__WEBPACK_IMPORTED_MODULE_4_lodash__["mapValues"])(options.selectors, function (selector) {
|
86751 |
if (selector.isRegistrySelector) {
|
86752 |
selector.registry = registry;
|
86753 |
}
|
86762 |
})), store);
|
86763 |
|
86764 |
if (options.resolvers) {
|
86765 |
+
var result = mapResolvers(options.resolvers, selectors, store, resolversCache);
|
86766 |
resolvers = result.resolvers;
|
86767 |
selectors = result.selectors;
|
86768 |
}
|
86827 |
*/
|
86828 |
|
86829 |
function createReduxStore(key, options, registry) {
|
86830 |
+
var controls = _objectSpread(_objectSpread({}, options.controls), __WEBPACK_IMPORTED_MODULE_8__controls__["a" /* builtinControls */]);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
86831 |
|
86832 |
+
var normalizedControls = Object(__WEBPACK_IMPORTED_MODULE_4_lodash__["mapValues"])(controls, function (control) {
|
86833 |
+
return control.isRegistryControl ? control(registry) : control;
|
86834 |
+
});
|
86835 |
+
var middlewares = [Object(__WEBPACK_IMPORTED_MODULE_10__resolvers_cache_middleware__["a" /* default */])(registry, key), __WEBPACK_IMPORTED_MODULE_9__promise_middleware__["a" /* default */], Object(__WEBPACK_IMPORTED_MODULE_7__wordpress_redux_routine__["a" /* default */])(normalizedControls)];
|
86836 |
var enhancers = [__WEBPACK_IMPORTED_MODULE_3_redux__["a" /* applyMiddleware */].apply(void 0, middlewares)];
|
86837 |
|
86838 |
if (typeof window !== 'undefined' && window.__REDUX_DEVTOOLS_EXTENSION__) {
|
86845 |
var reducer = options.reducer,
|
86846 |
initialState = options.initialState;
|
86847 |
var enhancedReducer = __WEBPACK_IMPORTED_MODULE_5_turbo_combine_reducers___default()({
|
86848 |
+
metadata: __WEBPACK_IMPORTED_MODULE_11__metadata_reducer__["a" /* default */],
|
86849 |
root: reducer
|
86850 |
});
|
86851 |
return Object(__WEBPACK_IMPORTED_MODULE_3_redux__["b" /* createStore */])(enhancedReducer, {
|
86859 |
* public facing API. Selectors will get passed the
|
86860 |
* state as first argument.
|
86861 |
* @param {Object} store The store to which the selectors should be mapped.
|
|
|
86862 |
* @return {Object} Selectors mapped to the provided store.
|
86863 |
*/
|
86864 |
|
86913 |
* Resolvers are side effects invoked once per argument set of a given selector call,
|
86914 |
* used in ensuring that the data needs for the selector are satisfied.
|
86915 |
*
|
86916 |
+
* @param {Object} resolvers Resolvers to register.
|
86917 |
+
* @param {Object} selectors The current selectors to be modified.
|
86918 |
+
* @param {Object} store The redux store to which the resolvers should be mapped.
|
86919 |
+
* @param {Object} resolversCache Resolvers Cache.
|
86920 |
*/
|
86921 |
|
86922 |
|
86923 |
+
function mapResolvers(resolvers, selectors, store, resolversCache) {
|
86924 |
+
// The `resolver` can be either a function that does the resolution, or, in more advanced
|
86925 |
+
// cases, an object with a `fullfill` method and other optional methods like `isFulfilled`.
|
86926 |
+
// Here we normalize the `resolver` function to an object with `fulfill` method.
|
86927 |
var mappedResolvers = Object(__WEBPACK_IMPORTED_MODULE_4_lodash__["mapValues"])(resolvers, function (resolver) {
|
86928 |
+
if (resolver.fulfill) {
|
86929 |
+
return resolver;
|
86930 |
+
}
|
86931 |
+
|
86932 |
+
return _objectSpread(_objectSpread({}, resolver), {}, {
|
86933 |
+
// copy the enumerable properties of the resolver function
|
86934 |
+
fulfill: resolver // add the fulfill method
|
86935 |
+
|
86936 |
});
|
86937 |
});
|
86938 |
|
86954 |
}
|
86955 |
|
86956 |
function _fulfillSelector() {
|
86957 |
+
_fulfillSelector = Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_asyncToGenerator__["a" /* default */])( /*#__PURE__*/__WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator___default.a.mark(function _callee2() {
|
86958 |
var state, _store$__unstableOrig, metadata;
|
86959 |
|
86960 |
+
return __WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator___default.a.wrap(function _callee2$(_context2) {
|
86961 |
while (1) {
|
86962 |
+
switch (_context2.prev = _context2.next) {
|
86963 |
case 0:
|
86964 |
state = store.getState();
|
86965 |
|
86966 |
+
if (!(resolversCache.isRunning(selectorName, args) || typeof resolver.isFulfilled === 'function' && resolver.isFulfilled.apply(resolver, [state].concat(args)))) {
|
86967 |
+
_context2.next = 3;
|
86968 |
break;
|
86969 |
}
|
86970 |
|
86971 |
+
return _context2.abrupt("return");
|
86972 |
|
86973 |
case 3:
|
86974 |
_store$__unstableOrig = store.__unstableOriginalGetState(), metadata = _store$__unstableOrig.metadata;
|
86975 |
|
86976 |
+
if (!__WEBPACK_IMPORTED_MODULE_12__metadata_selectors__["hasStartedResolution"](metadata, selectorName, args)) {
|
86977 |
+
_context2.next = 6;
|
86978 |
break;
|
86979 |
}
|
86980 |
|
86981 |
+
return _context2.abrupt("return");
|
86982 |
|
86983 |
case 6:
|
86984 |
+
resolversCache.markAsRunning(selectorName, args);
|
86985 |
+
setTimeout( /*#__PURE__*/Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_asyncToGenerator__["a" /* default */])( /*#__PURE__*/__WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator___default.a.mark(function _callee() {
|
86986 |
+
return __WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator___default.a.wrap(function _callee$(_context) {
|
86987 |
+
while (1) {
|
86988 |
+
switch (_context.prev = _context.next) {
|
86989 |
+
case 0:
|
86990 |
+
resolversCache.clear(selectorName, args);
|
86991 |
+
store.dispatch(__WEBPACK_IMPORTED_MODULE_13__metadata_actions__["startResolution"](selectorName, args));
|
86992 |
+
_context.next = 4;
|
86993 |
+
return fulfillResolver.apply(void 0, [store, mappedResolvers, selectorName].concat(args));
|
86994 |
+
|
86995 |
+
case 4:
|
86996 |
+
store.dispatch(__WEBPACK_IMPORTED_MODULE_13__metadata_actions__["finishResolution"](selectorName, args));
|
86997 |
+
|
86998 |
+
case 5:
|
86999 |
+
case "end":
|
87000 |
+
return _context.stop();
|
87001 |
+
}
|
87002 |
+
}
|
87003 |
+
}, _callee);
|
87004 |
+
})));
|
87005 |
|
87006 |
+
case 8:
|
87007 |
case "end":
|
87008 |
+
return _context2.stop();
|
87009 |
}
|
87010 |
}
|
87011 |
+
}, _callee2);
|
87012 |
}));
|
87013 |
return _fulfillSelector.apply(this, arguments);
|
87014 |
}
|
87041 |
}
|
87042 |
|
87043 |
function _fulfillResolver() {
|
87044 |
+
_fulfillResolver = Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_asyncToGenerator__["a" /* default */])( /*#__PURE__*/__WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator___default.a.mark(function _callee3(store, resolvers, selectorName) {
|
87045 |
var resolver,
|
87046 |
_len4,
|
87047 |
args,
|
87048 |
_key4,
|
87049 |
action,
|
87050 |
+
_args3 = arguments;
|
87051 |
|
87052 |
+
return __WEBPACK_IMPORTED_MODULE_0__babel_runtime_regenerator___default.a.wrap(function _callee3$(_context3) {
|
87053 |
while (1) {
|
87054 |
+
switch (_context3.prev = _context3.next) {
|
87055 |
case 0:
|
87056 |
resolver = Object(__WEBPACK_IMPORTED_MODULE_4_lodash__["get"])(resolvers, [selectorName]);
|
87057 |
|
87058 |
if (resolver) {
|
87059 |
+
_context3.next = 3;
|
87060 |
break;
|
87061 |
}
|
87062 |
|
87063 |
+
return _context3.abrupt("return");
|
87064 |
|
87065 |
case 3:
|
87066 |
+
for (_len4 = _args3.length, args = new Array(_len4 > 3 ? _len4 - 3 : 0), _key4 = 3; _key4 < _len4; _key4++) {
|
87067 |
+
args[_key4 - 3] = _args3[_key4];
|
87068 |
}
|
87069 |
|
87070 |
action = resolver.fulfill.apply(resolver, args);
|
87071 |
|
87072 |
if (!action) {
|
87073 |
+
_context3.next = 8;
|
87074 |
break;
|
87075 |
}
|
87076 |
|
87077 |
+
_context3.next = 8;
|
87078 |
return store.dispatch(action);
|
87079 |
|
87080 |
case 8:
|
87081 |
case "end":
|
87082 |
+
return _context3.stop();
|
87083 |
}
|
87084 |
}
|
87085 |
+
}, _callee3);
|
87086 |
}));
|
87087 |
return _fulfillResolver.apply(this, arguments);
|
87088 |
}
|
87089 |
//# sourceMappingURL=index.js.map
|
87090 |
|
87091 |
/***/ }),
|
87092 |
+
/* 513 */
|
87093 |
/***/ (function(module, exports, __webpack_require__) {
|
87094 |
|
87095 |
+
module.exports = __webpack_require__(514);
|
87096 |
|
87097 |
|
87098 |
/***/ }),
|
87099 |
+
/* 514 */
|
87100 |
/***/ (function(module, exports, __webpack_require__) {
|
87101 |
|
87102 |
/**
|
87117 |
var asyncIteratorSymbol = $Symbol.asyncIterator || "@@asyncIterator";
|
87118 |
var toStringTagSymbol = $Symbol.toStringTag || "@@toStringTag";
|
87119 |
|
87120 |
+
function define(obj, key, value) {
|
87121 |
+
Object.defineProperty(obj, key, {
|
87122 |
+
value: value,
|
87123 |
+
enumerable: true,
|
87124 |
+
configurable: true,
|
87125 |
+
writable: true
|
87126 |
+
});
|
87127 |
+
return obj[key];
|
87128 |
+
}
|
87129 |
+
try {
|
87130 |
+
// IE 8 has a broken Object.defineProperty that only works on DOM objects.
|
87131 |
+
define({}, "");
|
87132 |
+
} catch (err) {
|
87133 |
+
define = function(obj, key, value) {
|
87134 |
+
return obj[key] = value;
|
87135 |
+
};
|
87136 |
+
}
|
87137 |
+
|
87138 |
function wrap(innerFn, outerFn, self, tryLocsList) {
|
87139 |
// If outerFn provided and outerFn.prototype is a Generator, then outerFn.prototype instanceof Generator.
|
87140 |
var protoGenerator = outerFn && outerFn.prototype instanceof Generator ? outerFn : Generator;
|
87205 |
Generator.prototype = Object.create(IteratorPrototype);
|
87206 |
GeneratorFunction.prototype = Gp.constructor = GeneratorFunctionPrototype;
|
87207 |
GeneratorFunctionPrototype.constructor = GeneratorFunction;
|
87208 |
+
GeneratorFunction.displayName = define(
|
87209 |
+
GeneratorFunctionPrototype,
|
87210 |
+
toStringTagSymbol,
|
87211 |
+
"GeneratorFunction"
|
87212 |
+
);
|
87213 |
|
87214 |
// Helper for defining the .next, .throw, and .return methods of the
|
87215 |
// Iterator interface in terms of a single ._invoke method.
|
87216 |
function defineIteratorMethods(prototype) {
|
87217 |
["next", "throw", "return"].forEach(function(method) {
|
87218 |
+
define(prototype, method, function(arg) {
|
87219 |
return this._invoke(method, arg);
|
87220 |
+
});
|
87221 |
});
|
87222 |
}
|
87223 |
|
87236 |
Object.setPrototypeOf(genFun, GeneratorFunctionPrototype);
|
87237 |
} else {
|
87238 |
genFun.__proto__ = GeneratorFunctionPrototype;
|
87239 |
+
define(genFun, toStringTagSymbol, "GeneratorFunction");
|
|
|
|
|
87240 |
}
|
87241 |
genFun.prototype = Object.create(Gp);
|
87242 |
return genFun;
|
87506 |
// unified ._invoke helper method.
|
87507 |
defineIteratorMethods(Gp);
|
87508 |
|
87509 |
+
define(Gp, toStringTagSymbol, "Generator");
|
87510 |
|
87511 |
// A Generator should always return itself as the iterator object when the
|
87512 |
// @@iterator function is called on it. Some browsers' implementations of the
|
87850 |
|
87851 |
|
87852 |
/***/ }),
|
87853 |
+
/* 515 */
|
87854 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
87855 |
|
87856 |
"use strict";
|
87860 |
/* unused harmony export combineReducers */
|
87861 |
/* unused harmony export compose */
|
87862 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return createStore; });
|
87863 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_symbol_observable__ = __webpack_require__(516);
|
87864 |
|
87865 |
|
87866 |
/**
|
88528 |
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(20)))
|
88529 |
|
88530 |
/***/ }),
|
88531 |
+
/* 516 */
|
88532 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88533 |
|
88534 |
"use strict";
|
88535 |
+
/* WEBPACK VAR INJECTION */(function(global, module) {/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__ponyfill_js__ = __webpack_require__(518);
|
88536 |
/* global window */
|
88537 |
|
88538 |
|
88553 |
var result = Object(__WEBPACK_IMPORTED_MODULE_0__ponyfill_js__["a" /* default */])(root);
|
88554 |
/* harmony default export */ __webpack_exports__["a"] = (result);
|
88555 |
|
88556 |
+
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(81), __webpack_require__(517)(module)))
|
88557 |
|
88558 |
/***/ }),
|
88559 |
+
/* 517 */
|
88560 |
/***/ (function(module, exports) {
|
88561 |
|
88562 |
+
module.exports = function(originalModule) {
|
88563 |
+
if(!originalModule.webpackPolyfill) {
|
88564 |
+
var module = Object.create(originalModule);
|
88565 |
+
// module.parent = undefined by default
|
88566 |
+
if(!module.children) module.children = [];
|
88567 |
+
Object.defineProperty(module, "loaded", {
|
88568 |
+
enumerable: true,
|
88569 |
+
get: function() {
|
88570 |
+
return module.l;
|
88571 |
+
}
|
88572 |
+
});
|
88573 |
+
Object.defineProperty(module, "id", {
|
88574 |
+
enumerable: true,
|
88575 |
+
get: function() {
|
88576 |
+
return module.i;
|
88577 |
+
}
|
88578 |
+
});
|
88579 |
+
Object.defineProperty(module, "exports", {
|
88580 |
+
enumerable: true,
|
88581 |
+
});
|
88582 |
+
module.webpackPolyfill = 1;
|
88583 |
+
}
|
88584 |
+
return module;
|
88585 |
+
};
|
88586 |
|
88587 |
|
88588 |
/***/ }),
|
88589 |
+
/* 518 */
|
88590 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88591 |
|
88592 |
"use strict";
|
88611 |
|
88612 |
|
88613 |
/***/ }),
|
88614 |
+
/* 519 */
|
88615 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88616 |
|
88617 |
"use strict";
|
88618 |
/* harmony export (immutable) */ __webpack_exports__["a"] = createMiddleware;
|
88619 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__is_generator__ = __webpack_require__(520);
|
88620 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__runtime__ = __webpack_require__(521);
|
88621 |
/**
|
88622 |
* Internal dependencies
|
88623 |
*/
|
88654 |
//# sourceMappingURL=index.js.map
|
88655 |
|
88656 |
/***/ }),
|
88657 |
+
/* 520 */
|
88658 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88659 |
|
88660 |
"use strict";
|
88676 |
//# sourceMappingURL=is-generator.js.map
|
88677 |
|
88678 |
/***/ }),
|
88679 |
+
/* 521 */
|
88680 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
88681 |
|
88682 |
"use strict";
|
88683 |
/* harmony export (immutable) */ __webpack_exports__["a"] = createRuntime;
|
88684 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_rungen__ = __webpack_require__(522);
|
88685 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_rungen___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_rungen__);
|
88686 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
88687 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
88688 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_is_promise__ = __webpack_require__(528);
|
88689 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_is_promise___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_is_promise__);
|
88690 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__is_action__ = __webpack_require__(529);
|
88691 |
/**
|
88692 |
* External dependencies
|
88693 |
*/
|
88757 |
//# sourceMappingURL=runtime.js.map
|
88758 |
|
88759 |
/***/ }),
|
88760 |
+
/* 522 */
|
88761 |
/***/ (function(module, exports, __webpack_require__) {
|
88762 |
|
88763 |
"use strict";
|
88768 |
});
|
88769 |
exports.wrapControls = exports.asyncControls = exports.create = undefined;
|
88770 |
|
88771 |
+
var _helpers = __webpack_require__(161);
|
88772 |
|
88773 |
Object.keys(_helpers).forEach(function (key) {
|
88774 |
if (key === "default") return;
|
88780 |
});
|
88781 |
});
|
88782 |
|
88783 |
+
var _create = __webpack_require__(523);
|
88784 |
|
88785 |
var _create2 = _interopRequireDefault(_create);
|
88786 |
|
88787 |
+
var _async = __webpack_require__(525);
|
88788 |
|
88789 |
var _async2 = _interopRequireDefault(_async);
|
88790 |
|
88791 |
+
var _wrap = __webpack_require__(527);
|
88792 |
|
88793 |
var _wrap2 = _interopRequireDefault(_wrap);
|
88794 |
|
88799 |
exports.wrapControls = _wrap2.default;
|
88800 |
|
88801 |
/***/ }),
|
88802 |
+
/* 523 */
|
88803 |
/***/ (function(module, exports, __webpack_require__) {
|
88804 |
|
88805 |
"use strict";
|
88809 |
value: true
|
88810 |
});
|
88811 |
|
88812 |
+
var _builtin = __webpack_require__(524);
|
88813 |
|
88814 |
var _builtin2 = _interopRequireDefault(_builtin);
|
88815 |
|
88816 |
+
var _is = __webpack_require__(82);
|
88817 |
|
88818 |
var _is2 = _interopRequireDefault(_is);
|
88819 |
|
88884 |
exports.default = create;
|
88885 |
|
88886 |
/***/ }),
|
88887 |
+
/* 524 */
|
88888 |
/***/ (function(module, exports, __webpack_require__) {
|
88889 |
|
88890 |
"use strict";
|
88895 |
});
|
88896 |
exports.iterator = exports.array = exports.object = exports.error = exports.any = undefined;
|
88897 |
|
88898 |
+
var _is = __webpack_require__(82);
|
88899 |
|
88900 |
var _is2 = _interopRequireDefault(_is);
|
88901 |
|
88984 |
exports.default = [error, iterator, array, object, any];
|
88985 |
|
88986 |
/***/ }),
|
88987 |
+
/* 525 */
|
88988 |
/***/ (function(module, exports, __webpack_require__) {
|
88989 |
|
88990 |
"use strict";
|
88995 |
});
|
88996 |
exports.race = exports.join = exports.fork = exports.promise = undefined;
|
88997 |
|
88998 |
+
var _is = __webpack_require__(82);
|
88999 |
|
89000 |
var _is2 = _interopRequireDefault(_is);
|
89001 |
|
89002 |
+
var _helpers = __webpack_require__(161);
|
89003 |
|
89004 |
+
var _dispatcher = __webpack_require__(526);
|
89005 |
|
89006 |
var _dispatcher2 = _interopRequireDefault(_dispatcher);
|
89007 |
|
89105 |
exports.default = [promise, fork, join, race, subscribe];
|
89106 |
|
89107 |
/***/ }),
|
89108 |
+
/* 526 */
|
89109 |
/***/ (function(module, exports, __webpack_require__) {
|
89110 |
|
89111 |
"use strict";
|
89137 |
exports.default = createDispatcher;
|
89138 |
|
89139 |
/***/ }),
|
89140 |
+
/* 527 */
|
89141 |
/***/ (function(module, exports, __webpack_require__) {
|
89142 |
|
89143 |
"use strict";
|
89148 |
});
|
89149 |
exports.cps = exports.call = undefined;
|
89150 |
|
89151 |
+
var _is = __webpack_require__(82);
|
89152 |
|
89153 |
var _is2 = _interopRequireDefault(_is);
|
89154 |
|
89179 |
exports.default = [call, cps];
|
89180 |
|
89181 |
/***/ }),
|
89182 |
+
/* 528 */
|
89183 |
/***/ (function(module, exports) {
|
89184 |
|
89185 |
module.exports = isPromise;
|
89191 |
|
89192 |
|
89193 |
/***/ }),
|
89194 |
+
/* 529 */
|
89195 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89196 |
|
89197 |
"use strict";
|
89230 |
//# sourceMappingURL=is-action.js.map
|
89231 |
|
89232 |
/***/ }),
|
89233 |
+
/* 530 */
|
89234 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89235 |
|
89236 |
"use strict";
|
89237 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_is_promise__ = __webpack_require__(531);
|
89238 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_is_promise___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_is_promise__);
|
89239 |
/**
|
89240 |
* External dependencies
|
89266 |
//# sourceMappingURL=promise-middleware.js.map
|
89267 |
|
89268 |
/***/ }),
|
89269 |
+
/* 531 */
|
89270 |
/***/ (function(module, exports) {
|
89271 |
|
89272 |
module.exports = isPromise;
|
89278 |
|
89279 |
|
89280 |
/***/ }),
|
89281 |
+
/* 532 */
|
89282 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89283 |
|
89284 |
"use strict";
|
89285 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
89286 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
89287 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash__ = __webpack_require__(2);
|
89288 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_lodash__);
|
89289 |
|
89344 |
//# sourceMappingURL=resolvers-cache-middleware.js.map
|
89345 |
|
89346 |
/***/ }),
|
89347 |
+
/* 533 */
|
89348 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89349 |
|
89350 |
"use strict";
|
89351 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash__ = __webpack_require__(2);
|
89352 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_lodash__);
|
89353 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_equivalent_key_map__ = __webpack_require__(160);
|
89354 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_equivalent_key_map___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_equivalent_key_map__);
|
89355 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils__ = __webpack_require__(534);
|
89356 |
/**
|
89357 |
* External dependencies
|
89358 |
*/
|
89375 |
* @return {Object} Next state.
|
89376 |
*/
|
89377 |
|
89378 |
+
var subKeysIsResolved = Object(__WEBPACK_IMPORTED_MODULE_2__utils__["a" /* onSubKey */])('selectorName')(function () {
|
89379 |
var state = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : new __WEBPACK_IMPORTED_MODULE_1_equivalent_key_map___default.a();
|
89380 |
var action = arguments.length > 1 ? arguments[1] : undefined;
|
89381 |
|
89436 |
//# sourceMappingURL=reducer.js.map
|
89437 |
|
89438 |
/***/ }),
|
89439 |
+
/* 534 */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
89440 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89441 |
|
89442 |
"use strict";
|
89443 |
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return onSubKey; });
|
89444 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
89445 |
|
89446 |
|
89447 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
89477 |
return state;
|
89478 |
}
|
89479 |
|
89480 |
+
return _objectSpread(_objectSpread({}, state), {}, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])({}, key, nextKeyState));
|
89481 |
};
|
89482 |
};
|
89483 |
};
|
89484 |
//# sourceMappingURL=utils.js.map
|
89485 |
|
89486 |
/***/ }),
|
89487 |
+
/* 535 */
|
89488 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89489 |
|
89490 |
"use strict";
|
89581 |
//# sourceMappingURL=selectors.js.map
|
89582 |
|
89583 |
/***/ }),
|
89584 |
+
/* 536 */
|
89585 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89586 |
|
89587 |
"use strict";
|
89671 |
//# sourceMappingURL=actions.js.map
|
89672 |
|
89673 |
/***/ }),
|
89674 |
+
/* 537 */
|
89675 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89676 |
|
89677 |
"use strict";
|
89678 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
89679 |
|
89680 |
|
89681 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
89710 |
return {
|
89711 |
getSelectors: function getSelectors() {
|
89712 |
return ['getIsResolving', 'hasStartedResolution', 'hasFinishedResolution', 'isResolving', 'getCachedResolvers'].reduce(function (memo, selectorName) {
|
89713 |
+
return _objectSpread(_objectSpread({}, memo), {}, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])({}, selectorName, getCoreDataSelector(selectorName)));
|
89714 |
}, {});
|
89715 |
},
|
89716 |
getActions: function getActions() {
|
89717 |
return ['startResolution', 'finishResolution', 'invalidateResolution', 'invalidateResolutionForStore', 'invalidateResolutionForStoreSelector'].reduce(function (memo, actionName) {
|
89718 |
+
return _objectSpread(_objectSpread({}, memo), {}, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])({}, actionName, getCoreDataAction(actionName)));
|
89719 |
}, {});
|
89720 |
},
|
89721 |
subscribe: function subscribe() {
|
89732 |
//# sourceMappingURL=index.js.map
|
89733 |
|
89734 |
/***/ }),
|
89735 |
+
/* 538 */
|
89736 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89737 |
|
89738 |
"use strict";
|
89739 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__controls__ = __webpack_require__(539);
|
89740 |
/* unused harmony reexport controls */
|
89741 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__persistence__ = __webpack_require__(548);
|
89742 |
/* unused harmony reexport persistence */
|
89743 |
|
89744 |
|
89745 |
//# sourceMappingURL=index.js.map
|
89746 |
|
89747 |
/***/ }),
|
89748 |
+
/* 539 */
|
89749 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89750 |
|
89751 |
"use strict";
|
89752 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_deprecated__ = __webpack_require__(104);
|
89753 |
/**
|
89754 |
* WordPress dependencies
|
89755 |
*/
|
89763 |
//# sourceMappingURL=index.js.map
|
89764 |
|
89765 |
/***/ }),
|
89766 |
+
/* 540 */
|
89767 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89768 |
|
89769 |
"use strict";
|
89770 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__createAddHook__ = __webpack_require__(541);
|
89771 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__createRemoveHook__ = __webpack_require__(542);
|
89772 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__createHasHook__ = __webpack_require__(543);
|
89773 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__createRunHook__ = __webpack_require__(544);
|
89774 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__createCurrentHook__ = __webpack_require__(545);
|
89775 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__createDoingHook__ = __webpack_require__(546);
|
89776 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__createDidHook__ = __webpack_require__(547);
|
89777 |
/**
|
89778 |
* Internal dependencies
|
89779 |
*/
|
89821 |
//# sourceMappingURL=createHooks.js.map
|
89822 |
|
89823 |
/***/ }),
|
89824 |
+
/* 541 */
|
89825 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89826 |
|
89827 |
"use strict";
|
89828 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__validateNamespace_js__ = __webpack_require__(165);
|
89829 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__validateHookName_js__ = __webpack_require__(105);
|
89830 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2____ = __webpack_require__(65);
|
89831 |
/**
|
89832 |
* Internal dependencies
|
89833 |
*/
|
89927 |
//# sourceMappingURL=createAddHook.js.map
|
89928 |
|
89929 |
/***/ }),
|
89930 |
+
/* 542 */
|
89931 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
89932 |
|
89933 |
"use strict";
|
89934 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__validateNamespace_js__ = __webpack_require__(165);
|
89935 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__validateHookName_js__ = __webpack_require__(105);
|
89936 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2____ = __webpack_require__(65);
|
89937 |
/**
|
89938 |
* Internal dependencies
|
89939 |
*/
|
90020 |
//# sourceMappingURL=createRemoveHook.js.map
|
90021 |
|
90022 |
/***/ }),
|
90023 |
+
/* 543 */
|
90024 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
90025 |
|
90026 |
"use strict";
|
90059 |
//# sourceMappingURL=createHasHook.js.map
|
90060 |
|
90061 |
/***/ }),
|
90062 |
+
/* 544 */
|
90063 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
90064 |
|
90065 |
"use strict";
|
90066 |
+
/* WEBPACK VAR INJECTION */(function(process) {/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
90067 |
|
90068 |
|
90069 |
/**
|
90143 |
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(20)))
|
90144 |
|
90145 |
/***/ }),
|
90146 |
+
/* 545 */
|
90147 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
90148 |
|
90149 |
"use strict";
|
90177 |
//# sourceMappingURL=createCurrentHook.js.map
|
90178 |
|
90179 |
/***/ }),
|
90180 |
+
/* 546 */
|
90181 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
90182 |
|
90183 |
"use strict";
|
90214 |
//# sourceMappingURL=createDoingHook.js.map
|
90215 |
|
90216 |
/***/ }),
|
90217 |
+
/* 547 */
|
90218 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
90219 |
|
90220 |
"use strict";
|
90221 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__validateHookName_js__ = __webpack_require__(105);
|
90222 |
/**
|
90223 |
* Internal dependencies
|
90224 |
*/
|
90253 |
//# sourceMappingURL=createDidHook.js.map
|
90254 |
|
90255 |
/***/ }),
|
90256 |
+
/* 548 */
|
90257 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
90258 |
|
90259 |
"use strict";
|
90260 |
/* unused harmony export withLazySameState */
|
90261 |
/* unused harmony export createPersistenceInterface */
|
90262 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
90263 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
90264 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
90265 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__storage_default__ = __webpack_require__(549);
|
90266 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3____ = __webpack_require__(41);
|
90267 |
|
90268 |
|
90269 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
90378 |
|
90379 |
|
90380 |
function setData(key, value) {
|
90381 |
+
data = _objectSpread(_objectSpread({}, data), {}, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])({}, key, value));
|
90382 |
storage.setItem(storageKey, JSON.stringify(data));
|
90383 |
}
|
90384 |
|
90396 |
* @return {WPDataPlugin} Data plugin.
|
90397 |
*/
|
90398 |
|
90399 |
+
function persistencePlugin(registry, pluginOptions) {
|
90400 |
var persistence = createPersistenceInterface(pluginOptions);
|
90401 |
/**
|
90402 |
* Creates an enhanced store dispatch function, triggering the state of the
|
90423 |
return action.nextState[key];
|
90424 |
}));
|
90425 |
}, {});
|
90426 |
+
getPersistedState = withLazySameState(Object(__WEBPACK_IMPORTED_MODULE_3____["a" /* combineReducers */])(reducers));
|
90427 |
} else {
|
90428 |
getPersistedState = function getPersistedState(state, action) {
|
90429 |
return action.nextState;
|
90455 |
var persistedState = persistence.get()[reducerKey];
|
90456 |
|
90457 |
if (persistedState !== undefined) {
|
90458 |
+
var initialState = options.reducer(options.initialState, {
|
90459 |
type: '@@WP/PERSISTENCE_RESTORE'
|
90460 |
});
|
90461 |
|
90472 |
initialState = persistedState;
|
90473 |
}
|
90474 |
|
90475 |
+
options = _objectSpread(_objectSpread({}, options), {}, {
|
90476 |
initialState: initialState
|
90477 |
});
|
90478 |
}
|
90482 |
return store;
|
90483 |
}
|
90484 |
};
|
90485 |
+
}
|
90486 |
/**
|
90487 |
* Deprecated: Remove this function and the code in WordPress Core that calls
|
90488 |
* it once WordPress 5.4 is released.
|
90545 |
//# sourceMappingURL=index.js.map
|
90546 |
|
90547 |
/***/ }),
|
90548 |
+
/* 549 */
|
90549 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
90550 |
|
90551 |
"use strict";
|
90552 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__object__ = __webpack_require__(550);
|
90553 |
/**
|
90554 |
* Internal dependencies
|
90555 |
*/
|
90571 |
//# sourceMappingURL=default.js.map
|
90572 |
|
90573 |
/***/ }),
|
90574 |
+
/* 550 */
|
90575 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
90576 |
|
90577 |
"use strict";
|
90599 |
//# sourceMappingURL=object.js.map
|
90600 |
|
90601 |
/***/ }),
|
90602 |
+
/* 551 */
|
90603 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
90604 |
|
90605 |
"use strict";
|
90606 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
90607 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(15);
|
90608 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_compose__ = __webpack_require__(107);
|
90609 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__use_select__ = __webpack_require__(170);
|
90610 |
|
90611 |
|
90612 |
|
90660 |
*/
|
90661 |
|
90662 |
var withSelect = function withSelect(mapSelectToProps) {
|
90663 |
+
return Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_compose__["a" /* createHigherOrderComponent */])(function (WrappedComponent) {
|
90664 |
+
return Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_compose__["b" /* pure */])(function (ownProps) {
|
90665 |
var mapSelect = function mapSelect(select, registry) {
|
90666 |
return mapSelectToProps(select, ownProps, registry);
|
90667 |
};
|
90676 |
//# sourceMappingURL=index.js.map
|
90677 |
|
90678 |
/***/ }),
|
90679 |
+
/* 552 */
|
90680 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
90681 |
|
90682 |
"use strict";
|
90683 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
90684 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_typeof__ = __webpack_require__(39);
|
90685 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
90686 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_react__ = __webpack_require__(9);
|
90687 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_react__);
|
90688 |
|
90689 |
|
91036 |
//# sourceMappingURL=create-interpolate-element.js.map
|
91037 |
|
91038 |
/***/ }),
|
91039 |
+
/* 553 */
|
91040 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
91041 |
|
91042 |
"use strict";
|
91043 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom__ = __webpack_require__(45);
|
91044 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_dom___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react_dom__);
|
91045 |
/* unused harmony reexport createPortal */
|
91046 |
/* unused harmony reexport findDOMNode */
|
91086 |
//# sourceMappingURL=react-platform.js.map
|
91087 |
|
91088 |
/***/ }),
|
91089 |
+
/* 554 */
|
91090 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
91091 |
|
91092 |
"use strict";
|
91118 |
//# sourceMappingURL=utils.js.map
|
91119 |
|
91120 |
/***/ }),
|
91121 |
+
/* 555 */
|
91122 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
91123 |
|
91124 |
"use strict";
|
91160 |
//# sourceMappingURL=platform.js.map
|
91161 |
|
91162 |
/***/ }),
|
91163 |
+
/* 556 */
|
91164 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
91165 |
|
91166 |
"use strict";
|
91170 |
/* unused harmony export renderComponent */
|
91171 |
/* unused harmony export renderAttributes */
|
91172 |
/* unused harmony export renderStyle */
|
91173 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
91174 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__ = __webpack_require__(12);
|
91175 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_typeof__ = __webpack_require__(39);
|
91176 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
91177 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
91178 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__wordpress_escape_html__ = __webpack_require__(77);
|
91179 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__react__ = __webpack_require__(106);
|
91180 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__raw_html__ = __webpack_require__(166);
|
91181 |
|
91182 |
|
91183 |
|
91461 |
var children = props.children,
|
91462 |
wrapperProps = Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_objectWithoutProperties__["a" /* default */])(props, ["children"]);
|
91463 |
|
91464 |
+
return renderNativeComponent(Object(__WEBPACK_IMPORTED_MODULE_3_lodash__["isEmpty"])(wrapperProps) ? null : 'div', _objectSpread(_objectSpread({}, wrapperProps), {}, {
|
91465 |
dangerouslySetInnerHTML: {
|
91466 |
__html: children
|
91467 |
}
|
91686 |
//# sourceMappingURL=serialize.js.map
|
91687 |
|
91688 |
/***/ }),
|
91689 |
+
/* 557 */
|
91690 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
91691 |
|
91692 |
"use strict";
|
91705 |
* @return {Function} Returns the new composite function.
|
91706 |
*/
|
91707 |
|
91708 |
+
/* unused harmony default export */ var _unused_webpack_default_export = (__WEBPACK_IMPORTED_MODULE_0_lodash__["flowRight"]);
|
91709 |
//# sourceMappingURL=compose.js.map
|
91710 |
|
91711 |
/***/ }),
|
91712 |
+
/* 558 */
|
91713 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
91714 |
|
91715 |
"use strict";
|
91716 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
91717 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__utils_create_higher_order_component__ = __webpack_require__(47);
|
91718 |
|
91719 |
|
91720 |
/**
|
91746 |
//# sourceMappingURL=index.js.map
|
91747 |
|
91748 |
/***/ }),
|
91749 |
+
/* 559 */
|
91750 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
91751 |
|
91752 |
"use strict";
|
91753 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
91754 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
91755 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
91756 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
91757 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
91758 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_element__ = __webpack_require__(15);
|
91759 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_is_shallow_equal__ = __webpack_require__(167);
|
91760 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_is_shallow_equal___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_6__wordpress_is_shallow_equal__);
|
91761 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__utils_create_higher_order_component__ = __webpack_require__(47);
|
91762 |
|
91763 |
|
91764 |
|
91766 |
|
91767 |
|
91768 |
|
91769 |
+
function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(__WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__["a" /* default */])(this, result); }; }
|
91770 |
|
91771 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
91772 |
|
91795 |
var pure = Object(__WEBPACK_IMPORTED_MODULE_7__utils_create_higher_order_component__["a" /* default */])(function (Wrapped) {
|
91796 |
if (Wrapped.prototype instanceof __WEBPACK_IMPORTED_MODULE_5__wordpress_element__["a" /* Component */]) {
|
91797 |
return /*#__PURE__*/function (_Wrapped) {
|
91798 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_inherits__["a" /* default */])(_class, _Wrapped);
|
91799 |
|
91800 |
var _super = _createSuper(_class);
|
91801 |
|
91817 |
}
|
91818 |
|
91819 |
return /*#__PURE__*/function (_Component) {
|
91820 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_inherits__["a" /* default */])(_class2, _Component);
|
91821 |
|
91822 |
var _super2 = _createSuper(_class2);
|
91823 |
|
91846 |
//# sourceMappingURL=index.js.map
|
91847 |
|
91848 |
/***/ }),
|
91849 |
+
/* 560 */
|
91850 |
/***/ (function(module, exports, __webpack_require__) {
|
91851 |
|
91852 |
"use strict";
|
91904 |
|
91905 |
|
91906 |
/***/ }),
|
91907 |
+
/* 561 */
|
91908 |
/***/ (function(module, exports, __webpack_require__) {
|
91909 |
|
91910 |
"use strict";
|
91942 |
|
91943 |
|
91944 |
/***/ }),
|
91945 |
+
/* 562 */
|
91946 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
91947 |
|
91948 |
"use strict";
|
91949 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
91950 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
91951 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
91952 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
91953 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
91954 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
91955 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
91956 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(15);
|
91957 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
91958 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
91959 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__ = __webpack_require__(47);
|
91960 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__listener__ = __webpack_require__(563);
|
91961 |
|
91962 |
|
91963 |
|
91967 |
|
91968 |
|
91969 |
|
91970 |
+
function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(__WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_possibleConstructorReturn__["a" /* default */])(this, result); }; }
|
91971 |
|
91972 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
91973 |
|
92014 |
function withGlobalEvents(eventTypesToHandlers) {
|
92015 |
return Object(__WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__["a" /* default */])(function (WrappedComponent) {
|
92016 |
var Wrapper = /*#__PURE__*/function (_Component) {
|
92017 |
+
Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__["a" /* default */])(Wrapper, _Component);
|
92018 |
|
92019 |
var _super = _createSuper(Wrapper);
|
92020 |
|
92092 |
//# sourceMappingURL=index.js.map
|
92093 |
|
92094 |
/***/ }),
|
92095 |
+
/* 563 */
|
92096 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
92097 |
|
92098 |
"use strict";
|
92159 |
//# sourceMappingURL=listener.js.map
|
92160 |
|
92161 |
/***/ }),
|
92162 |
+
/* 564 */
|
92163 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
92164 |
|
92165 |
"use strict";
|
92166 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
92167 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(15);
|
92168 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__utils_create_higher_order_component__ = __webpack_require__(47);
|
92169 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__hooks_use_instance_id__ = __webpack_require__(168);
|
92170 |
|
92171 |
|
92172 |
|
92195 |
//# sourceMappingURL=index.js.map
|
92196 |
|
92197 |
/***/ }),
|
92198 |
+
/* 565 */
|
92199 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
92200 |
|
92201 |
"use strict";
|
92202 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
92203 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
92204 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
92205 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
92206 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
92207 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
92208 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
92209 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(15);
|
92210 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
92211 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
92212 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__ = __webpack_require__(47);
|
92213 |
|
92214 |
|
92215 |
|
92219 |
|
92220 |
|
92221 |
|
92222 |
+
function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(__WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_possibleConstructorReturn__["a" /* default */])(this, result); }; }
|
92223 |
|
92224 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
92225 |
|
92248 |
|
92249 |
var withSafeTimeout = Object(__WEBPACK_IMPORTED_MODULE_9__utils_create_higher_order_component__["a" /* default */])(function (OriginalComponent) {
|
92250 |
return /*#__PURE__*/function (_Component) {
|
92251 |
+
Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__["a" /* default */])(WrappedComponent, _Component);
|
92252 |
|
92253 |
var _super = _createSuper(WrappedComponent);
|
92254 |
|
92321 |
return WrappedComponent;
|
92322 |
}(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["a" /* Component */]);
|
92323 |
}, 'withSafeTimeout');
|
92324 |
+
/* unused harmony default export */ var _unused_webpack_default_export = (withSafeTimeout);
|
92325 |
//# sourceMappingURL=index.js.map
|
92326 |
|
92327 |
/***/ }),
|
92328 |
+
/* 566 */
|
92329 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
92330 |
|
92331 |
"use strict";
|
92333 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
92334 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
92335 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
92336 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
92337 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
92338 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
92339 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
92340 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(15);
|
92341 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__utils_create_higher_order_component__ = __webpack_require__(47);
|
92342 |
|
92343 |
|
92344 |
|
92348 |
|
92349 |
|
92350 |
|
92351 |
+
function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(__WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_possibleConstructorReturn__["a" /* default */])(this, result); }; }
|
92352 |
|
92353 |
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } }
|
92354 |
|
92374 |
var initialState = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
|
92375 |
return Object(__WEBPACK_IMPORTED_MODULE_8__utils_create_higher_order_component__["a" /* default */])(function (OriginalComponent) {
|
92376 |
return /*#__PURE__*/function (_Component) {
|
92377 |
+
Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__["a" /* default */])(WrappedComponent, _Component);
|
92378 |
|
92379 |
var _super = _createSuper(WrappedComponent);
|
92380 |
|
92405 |
//# sourceMappingURL=index.js.map
|
92406 |
|
92407 |
/***/ }),
|
92408 |
+
/* 567 */
|
92409 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
92410 |
|
92411 |
"use strict";
|
92412 |
/* unused harmony export default */
|
92413 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
92414 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_clipboard__ = __webpack_require__(98);
|
92415 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_clipboard___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_clipboard__);
|
92416 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(15);
|
92417 |
+
|
92418 |
+
|
92419 |
+
/**
|
92420 |
+
* External dependencies
|
92421 |
+
*/
|
92422 |
+
|
92423 |
+
/**
|
92424 |
+
* WordPress dependencies
|
92425 |
+
*/
|
92426 |
+
|
92427 |
+
|
92428 |
+
/**
|
92429 |
+
* Copies the text to the clipboard when the element is clicked.
|
92430 |
+
*
|
92431 |
+
* @param {Object} ref Reference with the element.
|
92432 |
+
* @param {string|Function} text The text to copy.
|
92433 |
+
* @param {number} timeout Optional timeout to reset the returned
|
92434 |
+
* state. 4 seconds by default.
|
92435 |
+
*
|
92436 |
+
* @return {boolean} Whether or not the text has been copied. Resets after the
|
92437 |
+
* timeout.
|
92438 |
+
*/
|
92439 |
+
|
92440 |
+
function useCopyOnClick(ref, _text) {
|
92441 |
+
var timeout = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 4000;
|
92442 |
+
var clipboard = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["l" /* useRef */])();
|
92443 |
+
|
92444 |
+
var _useState = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["m" /* useState */])(false),
|
92445 |
+
_useState2 = Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__["a" /* default */])(_useState, 2),
|
92446 |
+
hasCopied = _useState2[0],
|
92447 |
+
setHasCopied = _useState2[1];
|
92448 |
+
|
92449 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["h" /* useEffect */])(function () {
|
92450 |
+
var timeoutId; // Clipboard listens to click events.
|
92451 |
+
|
92452 |
+
clipboard.current = new __WEBPACK_IMPORTED_MODULE_1_clipboard___default.a(ref.current, {
|
92453 |
+
text: function text() {
|
92454 |
+
return typeof _text === 'function' ? _text() : _text;
|
92455 |
+
}
|
92456 |
+
});
|
92457 |
+
clipboard.current.on('success', function (_ref) {
|
92458 |
+
var clearSelection = _ref.clearSelection,
|
92459 |
+
trigger = _ref.trigger;
|
92460 |
+
// Clearing selection will move focus back to the triggering button,
|
92461 |
+
// ensuring that it is not reset to the body, and further that it is
|
92462 |
+
// kept within the rendered node.
|
92463 |
+
clearSelection(); // Handle ClipboardJS focus bug, see https://github.com/zenorocha/clipboard.js/issues/680
|
92464 |
+
|
92465 |
+
if (trigger) {
|
92466 |
+
trigger.focus();
|
92467 |
+
}
|
92468 |
+
|
92469 |
+
if (timeout) {
|
92470 |
+
setHasCopied(true);
|
92471 |
+
clearTimeout(timeoutId);
|
92472 |
+
timeoutId = setTimeout(function () {
|
92473 |
+
return setHasCopied(false);
|
92474 |
+
}, timeout);
|
92475 |
+
}
|
92476 |
+
});
|
92477 |
+
return function () {
|
92478 |
+
clipboard.current.destroy();
|
92479 |
+
clearTimeout(timeoutId);
|
92480 |
+
};
|
92481 |
+
}, [_text, timeout, setHasCopied]);
|
92482 |
+
return hasCopied;
|
92483 |
+
}
|
92484 |
+
//# sourceMappingURL=index.js.map
|
92485 |
+
|
92486 |
+
/***/ }),
|
92487 |
+
/* 568 */
|
92488 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
92489 |
+
|
92490 |
+
"use strict";
|
92491 |
+
/* unused harmony export default */
|
92492 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
92493 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(15);
|
92494 |
|
92495 |
|
92563 |
//# sourceMappingURL=index.js.map
|
92564 |
|
92565 |
/***/ }),
|
92566 |
+
/* 569 */
|
92567 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
92568 |
|
92569 |
"use strict";
|
92570 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_mousetrap__ = __webpack_require__(99);
|
92571 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_mousetrap___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_mousetrap__);
|
92572 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_mousetrap_plugins_global_bind_mousetrap_global_bind__ = __webpack_require__(100);
|
92573 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_mousetrap_plugins_global_bind_mousetrap_global_bind___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_mousetrap_plugins_global_bind_mousetrap_global_bind__);
|
92574 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash__ = __webpack_require__(2);
|
92575 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_2_lodash__);
|
92629 |
isDisabled = _ref$isDisabled === void 0 ? false : _ref$isDisabled,
|
92630 |
target = _ref.target;
|
92631 |
|
92632 |
+
var currentCallback = Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_element__["l" /* useRef */])(callback);
|
92633 |
+
Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_element__["h" /* useEffect */])(function () {
|
92634 |
+
currentCallback.current = callback;
|
92635 |
+
}, [callback]);
|
92636 |
Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_element__["h" /* useEffect */])(function () {
|
92637 |
if (isDisabled) {
|
92638 |
return;
|
92655 |
}
|
92656 |
|
92657 |
var bindFn = bindGlobal ? 'bindGlobal' : 'bind';
|
92658 |
+
mousetrap[bindFn](shortcut, function () {
|
92659 |
+
return currentCallback.current.apply(currentCallback, arguments);
|
92660 |
+
}, eventName);
|
92661 |
});
|
92662 |
return function () {
|
92663 |
mousetrap.reset();
|
92664 |
};
|
92665 |
+
}, [shortcuts, bindGlobal, eventName, target, isDisabled]);
|
92666 |
}
|
92667 |
|
92668 |
/* unused harmony default export */ var _unused_webpack_default_export = (useKeyboardShortcut);
|
92669 |
//# sourceMappingURL=index.js.map
|
92670 |
|
92671 |
/***/ }),
|
92672 |
+
/* 570 */
|
92673 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
92674 |
|
92675 |
"use strict";
|
92676 |
+
/* WEBPACK VAR INJECTION */(function(process) {/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__use_media_query__ = __webpack_require__(108);
|
92677 |
/**
|
92678 |
* Internal dependencies
|
92679 |
*/
|
92701 |
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(20)))
|
92702 |
|
92703 |
/***/ }),
|
92704 |
+
/* 571 */
|
92705 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
92706 |
|
92707 |
"use strict";
|
92708 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
92709 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__use_media_query__ = __webpack_require__(108);
|
92710 |
/**
|
92711 |
* WordPress dependencies
|
92712 |
*/
|
92799 |
//# sourceMappingURL=index.js.map
|
92800 |
|
92801 |
/***/ }),
|
92802 |
+
/* 572 */
|
92803 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
92804 |
|
92805 |
"use strict";
|
92806 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_resize_aware__ = __webpack_require__(155);
|
92807 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_react_resize_aware___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react_resize_aware__);
|
92808 |
/**
|
92809 |
* External dependencies
|
92836 |
//# sourceMappingURL=index.js.map
|
92837 |
|
92838 |
/***/ }),
|
92839 |
+
/* 573 */
|
92840 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
92841 |
|
92842 |
"use strict";
|
92843 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
92844 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
92845 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(15);
|
92846 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__wordpress_priority_queue__ = __webpack_require__(102);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
92847 |
|
92848 |
|
|
|
|
|
|
|
92849 |
|
|
|
|
|
|
|
92850 |
/**
|
92851 |
+
* WordPress dependencies
|
92852 |
*/
|
92853 |
|
|
|
|
|
|
|
|
|
|
|
92854 |
|
92855 |
/**
|
92856 |
+
* Returns the first items from list that are present on state.
|
92857 |
*
|
92858 |
+
* @param {Array} list New array.
|
92859 |
+
* @param {Array} state Current state.
|
92860 |
+
* @return {Array} First items present iin state.
|
92861 |
*/
|
92862 |
|
92863 |
+
function getFirstItemsPresentInState(list, state) {
|
92864 |
+
var firstItems = [];
|
|
|
|
|
|
|
92865 |
|
92866 |
+
for (var i = 0; i < list.length; i++) {
|
92867 |
+
var item = list[i];
|
|
|
|
|
|
|
92868 |
|
92869 |
+
if (!state.includes(item)) {
|
92870 |
+
break;
|
92871 |
+
}
|
|
|
|
|
92872 |
|
92873 |
+
firstItems.push(item);
|
92874 |
+
}
|
92875 |
+
|
92876 |
+
return firstItems;
|
92877 |
+
}
|
92878 |
/**
|
92879 |
+
* Reducer keeping track of a list of appended items.
|
92880 |
*
|
92881 |
+
* @param {Array} state Current state
|
92882 |
+
* @param {Object} action Action
|
92883 |
*
|
92884 |
+
* @return {Array} update state.
|
|
|
|
|
92885 |
*/
|
92886 |
|
92887 |
+
|
92888 |
+
function listReducer(state, action) {
|
92889 |
+
if (action.type === 'reset') {
|
92890 |
+
return action.list;
|
92891 |
+
}
|
92892 |
+
|
92893 |
+
if (action.type === 'append') {
|
92894 |
+
return [].concat(Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_toConsumableArray__["a" /* default */])(state), [action.item]);
|
92895 |
+
}
|
92896 |
+
|
92897 |
+
return state;
|
92898 |
+
}
|
92899 |
/**
|
92900 |
+
* React hook returns an array which items get asynchronously appended from a source array.
|
92901 |
+
* This behavior is useful if we want to render a list of items asynchronously for performance reasons.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
92902 |
*
|
92903 |
+
* @param {Array} list Source array.
|
92904 |
+
* @return {Array} Async array.
|
|
|
|
|
|
|
|
|
|
|
92905 |
*/
|
92906 |
|
|
|
|
|
|
|
|
|
92907 |
|
92908 |
+
function useAsyncList(list) {
|
92909 |
+
var _useReducer = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["k" /* useReducer */])(listReducer, []),
|
92910 |
+
_useReducer2 = Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__["a" /* default */])(_useReducer, 2),
|
92911 |
+
current = _useReducer2[0],
|
92912 |
+
dispatch = _useReducer2[1];
|
92913 |
|
92914 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["h" /* useEffect */])(function () {
|
92915 |
+
// On reset, we keep the first items that were previously rendered.
|
92916 |
+
var firstItems = getFirstItemsPresentInState(list, current);
|
92917 |
+
dispatch({
|
92918 |
+
type: 'reset',
|
92919 |
+
list: firstItems
|
92920 |
+
});
|
92921 |
+
var asyncQueue = Object(__WEBPACK_IMPORTED_MODULE_3__wordpress_priority_queue__["a" /* createQueue */])();
|
92922 |
|
92923 |
+
var append = function append(index) {
|
92924 |
+
return function () {
|
92925 |
+
if (list.length <= index) {
|
92926 |
+
return;
|
92927 |
+
}
|
92928 |
|
92929 |
+
dispatch({
|
92930 |
+
type: 'append',
|
92931 |
+
item: list[index]
|
92932 |
+
});
|
92933 |
+
asyncQueue.add({}, append(index + 1));
|
92934 |
+
};
|
92935 |
};
|
92936 |
|
92937 |
+
asyncQueue.add({}, append(firstItems.length));
|
92938 |
+
return function () {
|
92939 |
+
return asyncQueue.reset();
|
92940 |
+
};
|
92941 |
+
}, [list]);
|
92942 |
+
return current;
|
92943 |
+
}
|
92944 |
|
92945 |
+
/* unused harmony default export */ var _unused_webpack_default_export = (useAsyncList);
|
92946 |
+
//# sourceMappingURL=index.js.map
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
92947 |
|
92948 |
+
/***/ }),
|
92949 |
+
/* 574 */
|
92950 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
92951 |
|
92952 |
+
"use strict";
|
92953 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
92954 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__use_previous__ = __webpack_require__(169);
|
92955 |
|
|
|
|
|
|
|
|
|
92956 |
|
92957 |
+
/**
|
92958 |
+
* Internal dependencies
|
92959 |
+
*/
|
92960 |
|
92961 |
+
/**
|
92962 |
+
* Hook that performs a shallow comparison between the preview value of an object
|
92963 |
+
* and the new one, if there's a difference, it prints it to the console.
|
92964 |
+
* this is useful in performance related work, to check why a component re-renders.
|
92965 |
+
*
|
92966 |
+
* @example
|
92967 |
+
*
|
92968 |
+
* ```jsx
|
92969 |
+
* function MyComponent(props) {
|
92970 |
+
* useWarnOnChange(props);
|
92971 |
+
*
|
92972 |
+
* return "Something";
|
92973 |
+
* }
|
92974 |
+
* ```
|
92975 |
+
*
|
92976 |
+
* @param {Object} object Object which changes to compare.
|
92977 |
+
* @param {string} prefix Just a prefix to show when console logging.
|
92978 |
+
*/
|
92979 |
|
92980 |
+
function useWarnOnChange(object) {
|
92981 |
+
var prefix = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'Change detection';
|
92982 |
+
var previousValues = Object(__WEBPACK_IMPORTED_MODULE_1__use_previous__["a" /* default */])(object);
|
92983 |
+
Object.entries(previousValues !== null && previousValues !== void 0 ? previousValues : []).forEach(function (_ref) {
|
92984 |
+
var _ref2 = Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_slicedToArray__["a" /* default */])(_ref, 2),
|
92985 |
+
key = _ref2[0],
|
92986 |
+
value = _ref2[1];
|
92987 |
|
92988 |
+
if (value !== object[key]) {
|
92989 |
+
// eslint-disable-next-line no-console
|
92990 |
+
console.warn("".concat(prefix, ": ").concat(key, " key changed:"), value, object[key]);
|
92991 |
}
|
92992 |
+
});
|
92993 |
+
}
|
92994 |
|
92995 |
+
/* unused harmony default export */ var _unused_webpack_default_export = (useWarnOnChange);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
92996 |
//# sourceMappingURL=index.js.map
|
92997 |
|
92998 |
/***/ }),
|
92999 |
+
/* 575 */
|
93000 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93001 |
|
93002 |
"use strict";
|
93003 |
+
/* unused harmony export default */
|
93004 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash__ = __webpack_require__(2);
|
93005 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_lodash__);
|
93006 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_use_memo_one__ = __webpack_require__(103);
|
93007 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(15);
|
93008 |
/**
|
93009 |
+
* External dependencies
|
93010 |
*/
|
93011 |
|
93012 |
+
|
93013 |
/**
|
93014 |
+
* WordPress dependencies
|
93015 |
*/
|
93016 |
+
|
93017 |
+
|
93018 |
+
/**
|
93019 |
+
* Debounces a function with Lodash's `debounce`. A new debounced function will
|
93020 |
+
* be returned and any scheduled calls cancelled if any of the arguments change,
|
93021 |
+
* including the function to debounce, so please wrap functions created on
|
93022 |
+
* render in components in `useCallback`.
|
93023 |
+
*
|
93024 |
+
* @param {...any} args Arguments passed to Lodash's `debounce`.
|
93025 |
+
*/
|
93026 |
+
|
93027 |
+
function useDebounce() {
|
93028 |
+
for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
|
93029 |
+
args[_key] = arguments[_key];
|
93030 |
}
|
93031 |
|
93032 |
+
var debounced = Object(__WEBPACK_IMPORTED_MODULE_1_use_memo_one__["a" /* useMemoOne */])(function () {
|
93033 |
+
return __WEBPACK_IMPORTED_MODULE_0_lodash__["debounce"].apply(void 0, args);
|
93034 |
+
}, args);
|
93035 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["h" /* useEffect */])(function () {
|
93036 |
+
return function () {
|
93037 |
+
return debounced.cancel();
|
93038 |
+
};
|
93039 |
+
}, [debounced]);
|
93040 |
+
return debounced;
|
93041 |
}
|
93042 |
+
//# sourceMappingURL=index.js.map
|
|
|
93043 |
|
93044 |
/***/ }),
|
93045 |
+
/* 576 */
|
93046 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93047 |
|
93048 |
"use strict";
|
93049 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
93050 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(15);
|
93051 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_compose__ = __webpack_require__(107);
|
93052 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__use_dispatch__ = __webpack_require__(174);
|
93053 |
|
93054 |
|
93055 |
|
93143 |
*/
|
93144 |
|
93145 |
var withDispatch = function withDispatch(mapDispatchToProps) {
|
93146 |
+
return Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_compose__["a" /* createHigherOrderComponent */])(function (WrappedComponent) {
|
93147 |
return function (ownProps) {
|
93148 |
var mapDispatch = function mapDispatch(dispatch, registry) {
|
93149 |
return mapDispatchToProps(dispatch, ownProps, registry);
|
93150 |
};
|
93151 |
|
93152 |
+
var dispatchProps = Object(__WEBPACK_IMPORTED_MODULE_3__use_dispatch__["b" /* useDispatchWithMap */])(mapDispatch, []);
|
93153 |
return Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_element__["d" /* createElement */])(WrappedComponent, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__["a" /* default */])({}, ownProps, dispatchProps));
|
93154 |
};
|
93155 |
}, 'withDispatch');
|
93159 |
//# sourceMappingURL=index.js.map
|
93160 |
|
93161 |
/***/ }),
|
93162 |
+
/* 577 */
|
93163 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93164 |
|
93165 |
"use strict";
|
93166 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__registry_provider_use_registry__ = __webpack_require__(83);
|
93167 |
/**
|
93168 |
* Internal dependencies
|
93169 |
*/
|
93219 |
return storeName === void 0 ? dispatch : dispatch(storeName);
|
93220 |
};
|
93221 |
|
93222 |
+
/* harmony default export */ __webpack_exports__["a"] = (useDispatch);
|
93223 |
//# sourceMappingURL=use-dispatch.js.map
|
93224 |
|
93225 |
/***/ }),
|
93226 |
+
/* 578 */
|
93227 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93228 |
|
93229 |
"use strict";
|
93230 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_toConsumableArray__ = __webpack_require__(21);
|
93231 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
93232 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
93233 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(15);
|
93234 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__registry_provider_use_registry__ = __webpack_require__(83);
|
93235 |
|
93236 |
|
93237 |
/**
|
93301 |
//# sourceMappingURL=use-dispatch-with-map.js.map
|
93302 |
|
93303 |
/***/ }),
|
93304 |
+
/* 579 */
|
93305 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93306 |
|
93307 |
"use strict";
|
93308 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
93309 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_element__ = __webpack_require__(15);
|
93310 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_compose__ = __webpack_require__(107);
|
93311 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__registry_provider__ = __webpack_require__(175);
|
93312 |
|
93313 |
|
93314 |
|
93330 |
* @return {WPComponent} Enhanced component.
|
93331 |
*/
|
93332 |
|
93333 |
+
var withRegistry = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_compose__["a" /* createHigherOrderComponent */])(function (OriginalComponent) {
|
93334 |
return function (props) {
|
93335 |
return Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_element__["d" /* createElement */])(__WEBPACK_IMPORTED_MODULE_3__registry_provider__["a" /* RegistryConsumer */], null, function (registry) {
|
93336 |
return Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_element__["d" /* createElement */])(OriginalComponent, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__["a" /* default */])({}, props, {
|
93343 |
//# sourceMappingURL=index.js.map
|
93344 |
|
93345 |
/***/ }),
|
93346 |
+
/* 580 */
|
93347 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93348 |
|
93349 |
"use strict";
|
93350 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__use_async_mode__ = __webpack_require__(172);
|
93351 |
/* unused harmony reexport useAsyncMode */
|
93352 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__context__ = __webpack_require__(173);
|
93353 |
/* unused harmony reexport AsyncModeProvider */
|
93354 |
/* unused harmony reexport AsyncModeConsumer */
|
93355 |
|
93357 |
//# sourceMappingURL=index.js.map
|
93358 |
|
93359 |
/***/ }),
|
93360 |
+
/* 581 */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
93361 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93362 |
|
93363 |
"use strict";
|
93364 |
/* unused harmony export formatTypes */
|
93365 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
93366 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
93367 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
93368 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_data__ = __webpack_require__(41);
|
93369 |
|
93370 |
|
93371 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
93396 |
|
93397 |
switch (action.type) {
|
93398 |
case 'ADD_FORMAT_TYPES':
|
93399 |
+
return _objectSpread(_objectSpread({}, state), Object(__WEBPACK_IMPORTED_MODULE_1_lodash__["keyBy"])(action.formatTypes, 'name'));
|
93400 |
|
93401 |
case 'REMOVE_FORMAT_TYPES':
|
93402 |
return Object(__WEBPACK_IMPORTED_MODULE_1_lodash__["omit"])(state, action.names);
|
93404 |
|
93405 |
return state;
|
93406 |
}
|
93407 |
+
/* harmony default export */ __webpack_exports__["a"] = (Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_data__["a" /* combineReducers */])({
|
93408 |
formatTypes: formatTypes
|
93409 |
}));
|
93410 |
//# sourceMappingURL=reducer.js.map
|
93411 |
|
93412 |
/***/ }),
|
93413 |
+
/* 582 */
|
93414 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93415 |
|
93416 |
"use strict";
|
93419 |
/* harmony export (immutable) */ __webpack_exports__["getFormatType"] = getFormatType;
|
93420 |
/* harmony export (immutable) */ __webpack_exports__["getFormatTypeForBareElement"] = getFormatTypeForBareElement;
|
93421 |
/* harmony export (immutable) */ __webpack_exports__["getFormatTypeForClassName"] = getFormatTypeForClassName;
|
93422 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_rememo__ = __webpack_require__(583);
|
93423 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash__ = __webpack_require__(2);
|
93424 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_lodash__);
|
93425 |
/**
|
93492 |
//# sourceMappingURL=selectors.js.map
|
93493 |
|
93494 |
/***/ }),
|
93495 |
+
/* 583 */
|
93496 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93497 |
|
93498 |
"use strict";
|
93773 |
|
93774 |
|
93775 |
/***/ }),
|
93776 |
+
/* 584 */
|
93777 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93778 |
|
93779 |
"use strict";
|
93818 |
//# sourceMappingURL=actions.js.map
|
93819 |
|
93820 |
/***/ }),
|
93821 |
+
/* 585 */
|
93822 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93823 |
|
93824 |
"use strict";
|
93825 |
/* unused harmony export isListRootSelected */
|
93826 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__get_line_index__ = __webpack_require__(48);
|
93827 |
/**
|
93828 |
* Internal dependencies
|
93829 |
*/
|
93830 |
|
93831 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
93832 |
+
|
93833 |
/**
|
93834 |
* Whether or not the root list is selected.
|
93835 |
*
|
93836 |
+
* @param {RichTextValue} value The value to check.
|
93837 |
*
|
93838 |
* @return {boolean} True if the root list or nothing is selected, false if an
|
93839 |
* inner list is selected.
|
93849 |
//# sourceMappingURL=is-list-root-selected.js.map
|
93850 |
|
93851 |
/***/ }),
|
93852 |
+
/* 586 */
|
93853 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93854 |
|
93855 |
"use strict";
|
93856 |
/* unused harmony export isActiveListType */
|
93857 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__get_line_index__ = __webpack_require__(48);
|
93858 |
/**
|
93859 |
* Internal dependencies
|
93860 |
*/
|
93861 |
|
93862 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
93863 |
+
|
93864 |
/**
|
93865 |
* Wether or not the selected list has the given tag name.
|
93866 |
*
|
93867 |
+
* @param {RichTextValue} value The value to check.
|
93868 |
+
* @param {string} type The tag name the list should have.
|
93869 |
+
* @param {string} rootType The current root tag name, to compare with in
|
93870 |
+
* case nothing is selected.
|
93871 |
*
|
93872 |
* @return {boolean} True if the current list type matches `type`, false if not.
|
93873 |
*/
|
93888 |
//# sourceMappingURL=is-active-list-type.js.map
|
93889 |
|
93890 |
/***/ }),
|
93891 |
+
/* 587 */
|
93892 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93893 |
|
93894 |
"use strict";
|
93895 |
/* unused harmony export join */
|
93896 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__create__ = __webpack_require__(53);
|
93897 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__normalise_formats__ = __webpack_require__(52);
|
93898 |
/**
|
93899 |
* Internal dependencies
|
93900 |
*/
|
93901 |
|
93902 |
|
93903 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
93904 |
+
|
93905 |
/**
|
93906 |
* Combine an array of Rich Text values into one, optionally separated by
|
93907 |
* `separator`, which can be a Rich Text value, HTML string, or plain text
|
93908 |
* string. This is similar to `Array.prototype.join`.
|
93909 |
*
|
93910 |
+
* @param {Array<RichTextValue>} values An array of values to join.
|
93911 |
+
* @param {string|RichTextValue} [separator] Separator string or value.
|
93912 |
*
|
93913 |
+
* @return {RichTextValue} A new combined value.
|
93914 |
*/
|
93915 |
|
93916 |
function join(values) {
|
93936 |
//# sourceMappingURL=join.js.map
|
93937 |
|
93938 |
/***/ }),
|
93939 |
+
/* 588 */
|
93940 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
93941 |
|
93942 |
"use strict";
|
93943 |
/* unused harmony export registerFormatType */
|
93944 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
93945 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_data__ = __webpack_require__(41);
|
93946 |
|
93947 |
|
93948 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
93973 |
* @param {string} name Format name.
|
93974 |
* @param {WPFormat} settings Format settings.
|
93975 |
*
|
93976 |
+
* @return {WPFormat|undefined} The format, if it has been successfully
|
93977 |
+
* registered; otherwise `undefined`.
|
93978 |
*/
|
93979 |
|
93980 |
function registerFormatType(name, settings) {
|
93992 |
return;
|
93993 |
}
|
93994 |
|
93995 |
+
if (Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_data__["d" /* select */])('core/rich-text').getFormatType(settings.name)) {
|
93996 |
window.console.error('Format "' + settings.name + '" is already registered.');
|
93997 |
return;
|
93998 |
}
|
94013 |
}
|
94014 |
|
94015 |
if (settings.className === null) {
|
94016 |
+
var formatTypeForBareElement = Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_data__["d" /* select */])('core/rich-text').getFormatTypeForBareElement(settings.tagName);
|
94017 |
|
94018 |
if (formatTypeForBareElement) {
|
94019 |
window.console.error("Format \"".concat(formatTypeForBareElement.name, "\" is already registered to handle bare tag name \"").concat(settings.tagName, "\"."));
|
94020 |
return;
|
94021 |
}
|
94022 |
} else {
|
94023 |
+
var formatTypeForClassName = Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_data__["d" /* select */])('core/rich-text').getFormatTypeForClassName(settings.className);
|
94024 |
|
94025 |
if (formatTypeForClassName) {
|
94026 |
window.console.error("Format \"".concat(formatTypeForClassName.name, "\" is already registered to handle class name \"").concat(settings.className, "\"."));
|
94043 |
return;
|
94044 |
}
|
94045 |
|
94046 |
+
Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_data__["b" /* dispatch */])('core/rich-text').addFormatTypes(settings);
|
94047 |
return settings;
|
94048 |
}
|
94049 |
//# sourceMappingURL=register-format-type.js.map
|
94050 |
|
94051 |
/***/ }),
|
94052 |
+
/* 589 */
|
94053 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
94054 |
|
94055 |
"use strict";
|
94056 |
/* unused harmony export insertLineSeparator */
|
94057 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__get_text_content__ = __webpack_require__(179);
|
94058 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__insert__ = __webpack_require__(66);
|
94059 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__special_characters__ = __webpack_require__(30);
|
94060 |
/**
|
94061 |
* Internal dependencies
|
94062 |
*/
|
94063 |
|
94064 |
|
94065 |
|
94066 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
94067 |
+
|
94068 |
/**
|
94069 |
* Insert a line break character into a Rich Text value at the given
|
94070 |
* `startIndex`. Any content between `startIndex` and `endIndex` will be
|
94071 |
* removed. Indices are retrieved from the selection if none are provided.
|
94072 |
*
|
94073 |
+
* @param {RichTextValue} value Value to modify.
|
94074 |
+
* @param {number} [startIndex] Start index.
|
94075 |
+
* @param {number} [endIndex] End index.
|
94076 |
*
|
94077 |
+
* @return {RichTextValue} A new value with the value inserted.
|
94078 |
*/
|
94079 |
|
94080 |
function insertLineSeparator(value) {
|
94099 |
//# sourceMappingURL=insert-line-separator.js.map
|
94100 |
|
94101 |
/***/ }),
|
94102 |
+
/* 590 */
|
94103 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
94104 |
|
94105 |
"use strict";
|
94106 |
/* unused harmony export insertObject */
|
94107 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__insert__ = __webpack_require__(66);
|
94108 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__special_characters__ = __webpack_require__(30);
|
94109 |
/**
|
94110 |
* Internal dependencies
|
94111 |
*/
|
94112 |
|
94113 |
+
|
94114 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
94115 |
+
|
94116 |
+
/** @typedef {import('./create').RichTextFormat} RichTextFormat */
|
94117 |
+
|
94118 |
/**
|
94119 |
* Insert a format as an object into a Rich Text value at the given
|
94120 |
* `startIndex`. Any content between `startIndex` and `endIndex` will be
|
94121 |
* removed. Indices are retrieved from the selection if none are provided.
|
94122 |
*
|
94123 |
+
* @param {RichTextValue} value Value to modify.
|
94124 |
+
* @param {RichTextFormat} formatToInsert Format to insert as object.
|
94125 |
+
* @param {number} [startIndex] Start index.
|
94126 |
+
* @param {number} [endIndex] End index.
|
94127 |
*
|
94128 |
+
* @return {RichTextValue} A new value with the object inserted.
|
94129 |
*/
|
94130 |
|
94131 |
function insertObject(value, formatToInsert, startIndex, endIndex) {
|
94132 |
var valueToInsert = {
|
94133 |
formats: [,],
|
94134 |
replacements: [formatToInsert],
|
94135 |
+
text: __WEBPACK_IMPORTED_MODULE_1__special_characters__["b" /* OBJECT_REPLACEMENT_CHARACTER */]
|
94136 |
};
|
94137 |
return Object(__WEBPACK_IMPORTED_MODULE_0__insert__["a" /* insert */])(value, valueToInsert, startIndex, endIndex);
|
94138 |
}
|
94139 |
//# sourceMappingURL=insert-object.js.map
|
94140 |
|
94141 |
/***/ }),
|
94142 |
+
/* 591 */
|
94143 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
94144 |
|
94145 |
"use strict";
|
94146 |
/* harmony export (immutable) */ __webpack_exports__["a"] = slice;
|
94147 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
94148 |
|
94149 |
|
94150 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
94151 |
|
94152 |
function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }
|
94153 |
|
94154 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
94155 |
+
|
94156 |
/**
|
94157 |
* Slice a Rich Text value from `startIndex` to `endIndex`. Indices are
|
94158 |
* retrieved from the selection if none are provided. This is similar to
|
94159 |
* `String.prototype.slice`.
|
94160 |
*
|
94161 |
+
* @param {RichTextValue} value Value to modify.
|
94162 |
+
* @param {number} [startIndex] Start index.
|
94163 |
+
* @param {number} [endIndex] End index.
|
94164 |
*
|
94165 |
+
* @return {RichTextValue} A new extracted value.
|
94166 |
*/
|
94167 |
function slice(value) {
|
94168 |
var startIndex = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : value.start;
|
94184 |
//# sourceMappingURL=slice.js.map
|
94185 |
|
94186 |
/***/ }),
|
94187 |
+
/* 592 */
|
94188 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
94189 |
|
94190 |
"use strict";
|
94191 |
/* unused harmony export split */
|
94192 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__replace__ = __webpack_require__(181);
|
94193 |
/**
|
94194 |
* Internal dependencies
|
94195 |
*/
|
94196 |
|
94197 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
94198 |
+
|
94199 |
/**
|
94200 |
* Split a Rich Text value in two at the given `startIndex` and `endIndex`, or
|
94201 |
* split at the given separator. This is similar to `String.prototype.split`.
|
94202 |
* Indices are retrieved from the selection if none are provided.
|
94203 |
*
|
94204 |
+
* @param {RichTextValue} value
|
|
|
|
|
|
|
|
|
|
|
94205 |
* @param {number|string} [string] Start index, or string at which to split.
|
94206 |
*
|
94207 |
+
* @return {Array<RichTextValue>} An array of new values.
|
94208 |
*/
|
94209 |
|
94210 |
function split(_ref, string) {
|
94272 |
//# sourceMappingURL=split.js.map
|
94273 |
|
94274 |
/***/ }),
|
94275 |
+
/* 593 */
|
94276 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
94277 |
|
94278 |
"use strict";
|
94279 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getFormatType;
|
94280 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_data__ = __webpack_require__(41);
|
94281 |
/**
|
94282 |
* WordPress dependencies
|
94283 |
*/
|
94284 |
|
94285 |
+
/** @typedef {import('./register-format-type').RichTextFormatType} RichTextFormatType */
|
94286 |
+
|
94287 |
/**
|
94288 |
* Returns a registered format type.
|
94289 |
*
|
94290 |
* @param {string} name Format name.
|
94291 |
*
|
94292 |
+
* @return {RichTextFormatType|undefined} Format type.
|
94293 |
*/
|
94294 |
|
94295 |
function getFormatType(name) {
|
94296 |
+
return Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_data__["d" /* select */])('core/rich-text').getFormatType(name);
|
94297 |
}
|
94298 |
//# sourceMappingURL=get-format-type.js.map
|
94299 |
|
94300 |
/***/ }),
|
94301 |
+
/* 594 */
|
94302 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
94303 |
|
94304 |
"use strict";
|
94305 |
/* unused harmony export toggleFormat */
|
94306 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__get_active_format__ = __webpack_require__(111);
|
94307 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__remove_format__ = __webpack_require__(114);
|
94308 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__apply_format__ = __webpack_require__(176);
|
94309 |
/**
|
94310 |
* Internal dependencies
|
94311 |
*/
|
94312 |
|
94313 |
|
94314 |
|
94315 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
94316 |
+
|
94317 |
+
/** @typedef {import('./create').RichTextFormat} RichTextFormat */
|
94318 |
+
|
94319 |
/**
|
94320 |
* Toggles a format object to a Rich Text value at the current selection.
|
94321 |
*
|
94322 |
+
* @param {RichTextValue} value Value to modify.
|
94323 |
+
* @param {RichTextFormat} format Format to apply or remove.
|
94324 |
*
|
94325 |
+
* @return {RichTextValue} A new value with the format applied or removed.
|
94326 |
*/
|
94327 |
|
94328 |
function toggleFormat(value, format) {
|
94335 |
//# sourceMappingURL=toggle-format.js.map
|
94336 |
|
94337 |
/***/ }),
|
94338 |
+
/* 595 */
|
94339 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
94340 |
|
94341 |
"use strict";
|
94342 |
/* unused harmony export unregisterFormatType */
|
94343 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_data__ = __webpack_require__(41);
|
94344 |
/**
|
94345 |
* WordPress dependencies
|
94346 |
*/
|
94347 |
|
94348 |
+
/** @typedef {import('./register-format-type').RichTextFormatType} RichTextFormatType */
|
94349 |
|
94350 |
/**
|
94351 |
* Unregisters a format.
|
94352 |
*
|
94353 |
* @param {string} name Format name.
|
94354 |
*
|
94355 |
+
* @return {RichTextFormatType|undefined} The previous format value, if it has
|
94356 |
+
* been successfully unregistered;
|
94357 |
+
* otherwise `undefined`.
|
94358 |
*/
|
94359 |
|
94360 |
function unregisterFormatType(name) {
|
94361 |
+
var oldFormat = Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_data__["d" /* select */])('core/rich-text').getFormatType(name);
|
94362 |
|
94363 |
if (!oldFormat) {
|
94364 |
window.console.error("Format ".concat(name, " is not registered."));
|
94365 |
return;
|
94366 |
}
|
94367 |
|
94368 |
+
Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_data__["b" /* dispatch */])('core/rich-text').removeFormatTypes(name);
|
94369 |
return oldFormat;
|
94370 |
}
|
94371 |
//# sourceMappingURL=unregister-format-type.js.map
|
94372 |
|
94373 |
/***/ }),
|
94374 |
+
/* 596 */
|
94375 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
94376 |
|
94377 |
"use strict";
|
94378 |
/* unused harmony export outdentListItems */
|
94379 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
94380 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__special_characters__ = __webpack_require__(30);
|
94381 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__get_line_index__ = __webpack_require__(48);
|
94382 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__get_parent_line_index__ = __webpack_require__(189);
|
94383 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__get_last_child_index__ = __webpack_require__(597);
|
94384 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__can_outdent_list_items__ = __webpack_require__(187);
|
94385 |
|
94386 |
|
94387 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
94396 |
|
94397 |
|
94398 |
|
94399 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
94400 |
+
|
94401 |
/**
|
94402 |
* Outdents any selected list items if possible.
|
94403 |
*
|
94404 |
+
* @param {RichTextValue} value Value to change.
|
94405 |
*
|
94406 |
+
* @return {RichTextValue} The changed value.
|
94407 |
*/
|
94408 |
|
94409 |
function outdentListItems(value) {
|
94439 |
}
|
94440 |
}
|
94441 |
|
94442 |
+
return _objectSpread(_objectSpread({}, value), {}, {
|
94443 |
replacements: newFormats
|
94444 |
});
|
94445 |
}
|
94446 |
//# sourceMappingURL=outdent-list-items.js.map
|
94447 |
|
94448 |
/***/ }),
|
94449 |
+
/* 597 */
|
94450 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
94451 |
|
94452 |
"use strict";
|
94453 |
/* harmony export (immutable) */ __webpack_exports__["a"] = getLastChildIndex;
|
94454 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__special_characters__ = __webpack_require__(30);
|
94455 |
/**
|
94456 |
* Internal dependencies
|
94457 |
*/
|
94458 |
|
94459 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
94460 |
+
|
94461 |
/**
|
94462 |
* Gets the line index of the last child in the list.
|
94463 |
*
|
94464 |
+
* @param {RichTextValue} value Value to search.
|
94465 |
+
* @param {number} lineIndex Line index of a list item in the list.
|
94466 |
*
|
94467 |
+
* @return {number} The index of the last child.
|
94468 |
*/
|
94469 |
|
94470 |
function getLastChildIndex(_ref, lineIndex) {
|
94496 |
//# sourceMappingURL=get-last-child-index.js.map
|
94497 |
|
94498 |
/***/ }),
|
94499 |
+
/* 598 */
|
94500 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
94501 |
|
94502 |
"use strict";
|
94503 |
/* unused harmony export changeListType */
|
94504 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
94505 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__special_characters__ = __webpack_require__(30);
|
94506 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__get_line_index__ = __webpack_require__(48);
|
94507 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__get_parent_line_index__ = __webpack_require__(189);
|
94508 |
|
94509 |
|
94510 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
94517 |
|
94518 |
|
94519 |
|
94520 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
94521 |
+
|
94522 |
+
/** @typedef {import('./create').RichTextFormat} RichTextFormat */
|
94523 |
+
|
94524 |
/**
|
94525 |
* Changes the list type of the selected indented list, if any. Looks at the
|
94526 |
* currently selected list item and takes the parent list, then changes the list
|
94527 |
* type of this list. When multiple lines are selected, the parent lists are
|
94528 |
* takes and changed.
|
94529 |
*
|
94530 |
+
* @param {RichTextValue} value Value to change.
|
94531 |
+
* @param {RichTextFormat} newFormat The new list format object. Choose between
|
94532 |
+
* `{ type: 'ol' }` and `{ type: 'ul' }`.
|
94533 |
*
|
94534 |
+
* @return {RichTextValue} The changed value.
|
94535 |
*/
|
94536 |
|
94537 |
function changeListType(value, newFormat) {
|
94571 |
return value;
|
94572 |
}
|
94573 |
|
94574 |
+
return _objectSpread(_objectSpread({}, value), {}, {
|
94575 |
replacements: newReplacements
|
94576 |
});
|
94577 |
}
|
94578 |
//# sourceMappingURL=change-list-type.js.map
|
94579 |
|
94580 |
/***/ }),
|
94581 |
+
/* 599 */
|
94582 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
94583 |
|
94584 |
"use strict";
|
94585 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
94586 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
94587 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__wordpress_element__ = __webpack_require__(15);
|
94588 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash__ = __webpack_require__(2);
|
94589 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_lodash__);
|
94590 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__wordpress_keycodes__ = __webpack_require__(32);
|
94591 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__wordpress_deprecated__ = __webpack_require__(104);
|
94592 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__format_edit__ = __webpack_require__(190);
|
94593 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__create__ = __webpack_require__(53);
|
94594 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__to_dom__ = __webpack_require__(183);
|
94595 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__to_html_string__ = __webpack_require__(185);
|
94596 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_10__remove__ = __webpack_require__(115);
|
94597 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_11__remove_format__ = __webpack_require__(114);
|
94598 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_12__is_collapsed__ = __webpack_require__(113);
|
94599 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_13__special_characters__ = __webpack_require__(30);
|
94600 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_14__indent_list_items__ = __webpack_require__(188);
|
94601 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_15__get_active_formats__ = __webpack_require__(112);
|
94602 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_16__update_formats__ = __webpack_require__(600);
|
94603 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_17__remove_line_separator__ = __webpack_require__(182);
|
94604 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_18__is_empty__ = __webpack_require__(180);
|
94605 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_19__use_format_types__ = __webpack_require__(601);
|
94606 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_20__use_boundary_style__ = __webpack_require__(602);
|
94607 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_21__use_inline_warning__ = __webpack_require__(603);
|
94608 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_22__insert__ = __webpack_require__(66);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
94609 |
|
94610 |
|
94611 |
|
94612 |
|
94613 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
94614 |
|
94615 |
+
function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }
|
|
|
|
|
|
|
|
|
94616 |
|
94617 |
/**
|
94618 |
* External dependencies
|
94619 |
*/
|
94620 |
|
|
|
94621 |
/**
|
94622 |
* WordPress dependencies
|
94623 |
*/
|
94625 |
|
94626 |
|
94627 |
|
|
|
|
|
94628 |
/**
|
94629 |
* Internal dependencies
|
94630 |
*/
|
94690 |
};
|
94691 |
var EMPTY_ACTIVE_FORMATS = [];
|
94692 |
|
94693 |
+
function createPrepareEditableTree(fns) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
94694 |
return function (value) {
|
94695 |
return fns.reduce(function (accumulator, fn) {
|
94696 |
return fn(accumulator, value.text);
|
94722 |
|
94723 |
selection.collapseToStart();
|
94724 |
}
|
|
|
|
|
|
|
94725 |
|
94726 |
+
function RichText(_ref, ref) {
|
94727 |
+
var _ref$tagName = _ref.tagName,
|
94728 |
+
TagName = _ref$tagName === void 0 ? 'div' : _ref$tagName,
|
94729 |
+
_ref$value = _ref.value,
|
94730 |
+
value = _ref$value === void 0 ? '' : _ref$value,
|
94731 |
+
selectionStart = _ref.selectionStart,
|
94732 |
+
selectionEnd = _ref.selectionEnd,
|
94733 |
+
children = _ref.children,
|
94734 |
+
allowedFormats = _ref.allowedFormats,
|
94735 |
+
withoutInteractiveFormatting = _ref.withoutInteractiveFormatting,
|
94736 |
+
placeholder = _ref.placeholder,
|
94737 |
+
disabled = _ref.disabled,
|
94738 |
+
preserveWhiteSpace = _ref.preserveWhiteSpace,
|
94739 |
+
onPaste = _ref.onPaste,
|
94740 |
+
_ref$format = _ref.format,
|
94741 |
+
format = _ref$format === void 0 ? 'string' : _ref$format,
|
94742 |
+
onDelete = _ref.onDelete,
|
94743 |
+
onEnter = _ref.onEnter,
|
94744 |
+
onSelectionChange = _ref.onSelectionChange,
|
94745 |
+
onChange = _ref.onChange,
|
94746 |
+
onFocus = _ref.unstableOnFocus,
|
94747 |
+
setFocusedElement = _ref.setFocusedElement,
|
94748 |
+
instanceId = _ref.instanceId,
|
94749 |
+
clientId = _ref.clientId,
|
94750 |
+
identifier = _ref.identifier,
|
94751 |
+
multilineTag = _ref.__unstableMultilineTag,
|
94752 |
+
multilineRootTag = _ref.__unstableMultilineRootTag,
|
94753 |
+
disableFormats = _ref.__unstableDisableFormats,
|
94754 |
+
didAutomaticChange = _ref.__unstableDidAutomaticChange,
|
94755 |
+
inputRule = _ref.__unstableInputRule,
|
94756 |
+
markAutomaticChange = _ref.__unstableMarkAutomaticChange,
|
94757 |
+
allowPrefixTransformations = _ref.__unstableAllowPrefixTransformations,
|
94758 |
+
undo = _ref.__unstableUndo,
|
94759 |
+
isCaretWithinFormattedText = _ref.__unstableIsCaretWithinFormattedText,
|
94760 |
+
onEnterFormattedText = _ref.__unstableOnEnterFormattedText,
|
94761 |
+
onExitFormattedText = _ref.__unstableOnExitFormattedText,
|
94762 |
+
onCreateUndoLevel = _ref.__unstableOnCreateUndoLevel,
|
94763 |
+
isSelected = _ref.__unstableIsSelected;
|
94764 |
+
|
94765 |
+
var _useState = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["m" /* useState */])(),
|
94766 |
+
_useState2 = Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_slicedToArray__["a" /* default */])(_useState, 2),
|
94767 |
+
_useState2$ = _useState2[0],
|
94768 |
+
activeFormats = _useState2$ === void 0 ? [] : _useState2$,
|
94769 |
+
setActiveFormats = _useState2[1];
|
94770 |
+
|
94771 |
+
var _useFormatTypes = Object(__WEBPACK_IMPORTED_MODULE_19__use_format_types__["a" /* useFormatTypes */])({
|
94772 |
+
clientId: clientId,
|
94773 |
+
identifier: identifier
|
94774 |
+
}),
|
94775 |
+
formatTypes = _useFormatTypes.formatTypes,
|
94776 |
+
prepareHandlers = _useFormatTypes.prepareHandlers,
|
94777 |
+
valueHandlers = _useFormatTypes.valueHandlers,
|
94778 |
+
changeHandlers = _useFormatTypes.changeHandlers,
|
94779 |
+
dependencies = _useFormatTypes.dependencies; // For backward compatibility, fall back to tagName if it's a string.
|
94780 |
+
// tagName can now be a component for light blocks.
|
94781 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
94782 |
|
94783 |
+
if (!multilineRootTag && typeof TagName === 'string') {
|
94784 |
+
multilineRootTag = TagName;
|
94785 |
+
}
|
94786 |
|
94787 |
+
function getDoc() {
|
94788 |
+
return ref.current.ownerDocument;
|
94789 |
+
}
|
94790 |
|
94791 |
+
function getWin() {
|
94792 |
+
return getDoc().defaultView;
|
94793 |
+
}
|
94794 |
+
/**
|
94795 |
+
* Converts the outside data structure to our internal representation.
|
94796 |
+
*
|
94797 |
+
* @param {*} string The outside value, data type depends on props.
|
94798 |
+
*
|
94799 |
+
* @return {Object} An internal rich-text value.
|
94800 |
+
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
94801 |
|
|
|
94802 |
|
94803 |
+
function formatToValue(string) {
|
94804 |
+
if (disableFormats) {
|
94805 |
+
return {
|
94806 |
+
text: string,
|
94807 |
+
formats: Array(string.length),
|
94808 |
+
replacements: Array(string.length)
|
94809 |
+
};
|
94810 |
+
}
|
94811 |
|
94812 |
+
if (format !== 'string') {
|
94813 |
+
return string;
|
94814 |
+
}
|
94815 |
|
94816 |
+
var prepare = createPrepareEditableTree(valueHandlers);
|
94817 |
+
var result = Object(__WEBPACK_IMPORTED_MODULE_7__create__["a" /* create */])({
|
94818 |
+
html: string,
|
94819 |
+
multilineTag: multilineTag,
|
94820 |
+
multilineWrapperTags: multilineTag === 'li' ? ['ul', 'ol'] : undefined,
|
94821 |
+
preserveWhiteSpace: preserveWhiteSpace
|
94822 |
+
});
|
94823 |
+
result.formats = prepare(result);
|
94824 |
+
return result;
|
94825 |
+
}
|
94826 |
+
/**
|
94827 |
+
* Removes editor only formats from the value.
|
94828 |
+
*
|
94829 |
+
* Editor only formats are applied using `prepareEditableTree`, so we need to
|
94830 |
+
* remove them before converting the internal state
|
94831 |
+
*
|
94832 |
+
* @param {Object} val The internal rich-text value.
|
94833 |
+
*
|
94834 |
+
* @return {Object} A new rich-text value.
|
94835 |
+
*/
|
94836 |
|
|
|
|
|
94837 |
|
94838 |
+
function removeEditorOnlyFormats(val) {
|
94839 |
+
formatTypes.forEach(function (formatType) {
|
94840 |
+
// Remove formats created by prepareEditableTree, because they are editor only.
|
94841 |
+
if (formatType.__experimentalCreatePrepareEditableTree) {
|
94842 |
+
val = Object(__WEBPACK_IMPORTED_MODULE_11__remove_format__["a" /* removeFormat */])(val, formatType.name, 0, val.text.length);
|
94843 |
+
}
|
94844 |
+
});
|
94845 |
+
return val;
|
94846 |
}
|
94847 |
+
/**
|
94848 |
+
* Converts the internal value to the external data format.
|
94849 |
+
*
|
94850 |
+
* @param {Object} val The internal rich-text value.
|
94851 |
+
*
|
94852 |
+
* @return {*} The external data format, data type depends on props.
|
94853 |
+
*/
|
94854 |
|
94855 |
+
|
94856 |
+
function valueToFormat(val) {
|
94857 |
+
if (disableFormats) {
|
94858 |
+
return val.text;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
94859 |
}
|
|
|
|
|
|
|
|
|
|
|
94860 |
|
94861 |
+
val = removeEditorOnlyFormats(val);
|
94862 |
+
|
94863 |
+
if (format !== 'string') {
|
94864 |
+
return;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
94865 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
94866 |
|
94867 |
+
return Object(__WEBPACK_IMPORTED_MODULE_9__to_html_string__["a" /* toHTMLString */])({
|
94868 |
+
value: val,
|
94869 |
+
multilineTag: multilineTag,
|
94870 |
+
preserveWhiteSpace: preserveWhiteSpace
|
94871 |
+
});
|
94872 |
+
} // Internal values are updated synchronously, unlike props and state.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
94873 |
|
|
|
|
|
|
|
|
|
94874 |
|
94875 |
+
var _value = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["l" /* useRef */])(value);
|
|
|
|
|
|
|
|
|
|
|
94876 |
|
94877 |
+
var record = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["l" /* useRef */])(Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["j" /* useMemo */])(function () {
|
94878 |
+
var initialRecord = formatToValue(value);
|
94879 |
+
initialRecord.start = selectionStart;
|
94880 |
+
initialRecord.end = selectionEnd;
|
94881 |
+
return initialRecord;
|
94882 |
+
}, []));
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
94883 |
|
94884 |
+
function createRecord() {
|
94885 |
+
var selection = getWin().getSelection();
|
94886 |
+
var range = selection.rangeCount > 0 ? selection.getRangeAt(0) : null;
|
94887 |
+
return Object(__WEBPACK_IMPORTED_MODULE_7__create__["a" /* create */])({
|
94888 |
+
element: ref.current,
|
94889 |
+
range: range,
|
94890 |
+
multilineTag: multilineTag,
|
94891 |
+
multilineWrapperTags: multilineTag === 'li' ? ['ul', 'ol'] : undefined,
|
94892 |
+
__unstableIsEditableTree: true,
|
94893 |
+
preserveWhiteSpace: preserveWhiteSpace
|
94894 |
+
});
|
94895 |
+
}
|
94896 |
|
94897 |
+
function applyRecord(newRecord) {
|
94898 |
+
var _ref2 = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {},
|
94899 |
+
domOnly = _ref2.domOnly;
|
94900 |
|
94901 |
+
Object(__WEBPACK_IMPORTED_MODULE_8__to_dom__["a" /* apply */])({
|
94902 |
+
value: newRecord,
|
94903 |
+
current: ref.current,
|
94904 |
+
multilineTag: multilineTag,
|
94905 |
+
multilineWrapperTags: multilineTag === 'li' ? ['ul', 'ol'] : undefined,
|
94906 |
+
prepareEditableTree: createPrepareEditableTree(prepareHandlers),
|
94907 |
+
__unstableDomOnly: domOnly,
|
94908 |
+
placeholder: placeholder
|
94909 |
+
});
|
94910 |
+
}
|
94911 |
+
/**
|
94912 |
+
* Handles a paste event.
|
94913 |
+
*
|
94914 |
+
* Saves the pasted data as plain text in `pastedPlainText`.
|
94915 |
+
*
|
94916 |
+
* @param {ClipboardEvent} event The paste event.
|
94917 |
+
*/
|
94918 |
|
|
|
|
|
|
|
94919 |
|
94920 |
+
function handlePaste(event) {
|
94921 |
+
if (!isSelected) {
|
94922 |
+
event.preventDefault();
|
94923 |
+
return;
|
94924 |
+
}
|
94925 |
+
|
94926 |
+
var clipboardData = event.clipboardData;
|
94927 |
+
var items = clipboardData.items,
|
94928 |
+
files = clipboardData.files; // In Edge these properties can be null instead of undefined, so a more
|
94929 |
+
// rigorous test is required over using default values.
|
94930 |
|
94931 |
+
items = Object(__WEBPACK_IMPORTED_MODULE_3_lodash__["isNil"])(items) ? [] : items;
|
94932 |
+
files = Object(__WEBPACK_IMPORTED_MODULE_3_lodash__["isNil"])(files) ? [] : files;
|
94933 |
+
var plainText = '';
|
94934 |
+
var html = ''; // IE11 only supports `Text` as an argument for `getData` and will
|
94935 |
+
// otherwise throw an invalid argument error, so we try the standard
|
94936 |
+
// arguments first, then fallback to `Text` if they fail.
|
94937 |
|
94938 |
+
try {
|
94939 |
+
plainText = clipboardData.getData('text/plain');
|
94940 |
+
html = clipboardData.getData('text/html');
|
94941 |
+
} catch (error1) {
|
94942 |
+
try {
|
94943 |
+
html = clipboardData.getData('Text');
|
94944 |
+
} catch (error2) {
|
94945 |
+
// Some browsers like UC Browser paste plain text by default and
|
94946 |
+
// don't support clipboardData at all, so allow default
|
94947 |
+
// behaviour.
|
94948 |
return;
|
94949 |
}
|
94950 |
+
}
|
94951 |
|
94952 |
+
event.preventDefault(); // Allows us to ask for this information when we get a report.
|
|
|
|
|
|
|
|
|
|
|
94953 |
|
94954 |
+
window.console.log('Received HTML:\n\n', html);
|
94955 |
+
window.console.log('Received plain text:\n\n', plainText);
|
94956 |
|
94957 |
+
if (disableFormats) {
|
94958 |
+
handleChange(Object(__WEBPACK_IMPORTED_MODULE_22__insert__["a" /* insert */])(record.current, plainText));
|
94959 |
+
return;
|
94960 |
+
}
|
94961 |
|
94962 |
+
var transformed = formatTypes.reduce(function (accumlator, _ref3) {
|
94963 |
+
var __unstablePasteRule = _ref3.__unstablePasteRule;
|
|
|
94964 |
|
94965 |
+
// Only allow one transform.
|
94966 |
+
if (__unstablePasteRule && accumlator === record.current) {
|
94967 |
+
accumlator = __unstablePasteRule(record.current, {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
94968 |
html: html,
|
94969 |
+
plainText: plainText
|
|
|
|
|
94970 |
});
|
94971 |
}
|
94972 |
+
|
94973 |
+
return accumlator;
|
94974 |
+
}, record.current);
|
94975 |
+
|
94976 |
+
if (transformed !== record.current) {
|
94977 |
+
handleChange(transformed);
|
94978 |
+
return;
|
94979 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
94980 |
|
94981 |
+
if (onPaste) {
|
94982 |
+
files = Array.from(files);
|
94983 |
+
Array.from(items).forEach(function (item) {
|
94984 |
+
if (!item.getAsFile) {
|
94985 |
+
return;
|
94986 |
+
}
|
94987 |
+
|
94988 |
+
var file = item.getAsFile();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
94989 |
|
94990 |
+
if (!file) {
|
94991 |
+
return;
|
94992 |
+
}
|
94993 |
|
94994 |
+
var name = file.name,
|
94995 |
+
type = file.type,
|
94996 |
+
size = file.size;
|
94997 |
|
94998 |
+
if (!Object(__WEBPACK_IMPORTED_MODULE_3_lodash__["find"])(files, {
|
94999 |
+
name: name,
|
95000 |
+
type: type,
|
95001 |
+
size: size
|
95002 |
+
})) {
|
95003 |
+
files.push(file);
|
95004 |
+
}
|
95005 |
+
});
|
95006 |
+
onPaste({
|
95007 |
+
value: removeEditorOnlyFormats(record.current),
|
95008 |
+
onChange: handleChange,
|
95009 |
+
html: html,
|
95010 |
+
plainText: plainText,
|
95011 |
+
files: files,
|
95012 |
+
activeFormats: activeFormats
|
95013 |
+
});
|
95014 |
}
|
95015 |
+
}
|
95016 |
+
/**
|
95017 |
+
* Handles delete on keydown:
|
95018 |
+
* - outdent list items,
|
95019 |
+
* - delete content if everything is selected,
|
95020 |
+
* - trigger the onDelete prop when selection is uncollapsed and at an edge.
|
95021 |
+
*
|
95022 |
+
* @param {WPSyntheticEvent} event A synthetic keyboard event.
|
95023 |
+
*/
|
95024 |
+
|
95025 |
+
|
95026 |
+
function handleDelete(event) {
|
95027 |
+
var keyCode = event.keyCode;
|
95028 |
+
|
95029 |
+
if (keyCode !== __WEBPACK_IMPORTED_MODULE_4__wordpress_keycodes__["b" /* DELETE */] && keyCode !== __WEBPACK_IMPORTED_MODULE_4__wordpress_keycodes__["a" /* BACKSPACE */] && keyCode !== __WEBPACK_IMPORTED_MODULE_4__wordpress_keycodes__["e" /* ESCAPE */]) {
|
95030 |
+
return;
|
95031 |
}
|
|
|
|
|
|
|
|
|
|
|
95032 |
|
95033 |
+
if (didAutomaticChange) {
|
95034 |
+
event.preventDefault();
|
95035 |
+
undo();
|
95036 |
+
return;
|
95037 |
+
}
|
|
|
|
|
|
|
|
|
|
|
95038 |
|
95039 |
+
if (keyCode === __WEBPACK_IMPORTED_MODULE_4__wordpress_keycodes__["e" /* ESCAPE */]) {
|
95040 |
+
return;
|
95041 |
+
}
|
95042 |
|
95043 |
+
var currentValue = createRecord();
|
95044 |
+
var start = currentValue.start,
|
95045 |
+
end = currentValue.end,
|
95046 |
+
text = currentValue.text;
|
95047 |
+
var isReverse = keyCode === __WEBPACK_IMPORTED_MODULE_4__wordpress_keycodes__["a" /* BACKSPACE */]; // Always handle full content deletion ourselves.
|
95048 |
+
|
95049 |
+
if (start === 0 && end !== 0 && end === text.length) {
|
95050 |
+
handleChange(Object(__WEBPACK_IMPORTED_MODULE_10__remove__["a" /* remove */])(currentValue));
|
95051 |
+
event.preventDefault();
|
95052 |
+
return;
|
95053 |
+
}
|
95054 |
|
95055 |
+
if (multilineTag) {
|
95056 |
+
var newValue; // Check to see if we should remove the first item if empty.
|
|
|
|
|
|
|
95057 |
|
95058 |
+
if (isReverse && currentValue.start === 0 && currentValue.end === 0 && Object(__WEBPACK_IMPORTED_MODULE_18__is_empty__["a" /* isEmptyLine */])(currentValue)) {
|
95059 |
+
newValue = Object(__WEBPACK_IMPORTED_MODULE_17__remove_line_separator__["a" /* removeLineSeparator */])(currentValue, !isReverse);
|
95060 |
+
} else {
|
95061 |
+
newValue = Object(__WEBPACK_IMPORTED_MODULE_17__remove_line_separator__["a" /* removeLineSeparator */])(currentValue, isReverse);
|
95062 |
+
}
|
95063 |
|
95064 |
+
if (newValue) {
|
95065 |
+
handleChange(newValue);
|
95066 |
+
event.preventDefault();
|
95067 |
return;
|
95068 |
}
|
95069 |
+
} // Only process delete if the key press occurs at an uncollapsed edge.
|
95070 |
|
|
|
|
|
|
|
|
|
|
|
95071 |
|
95072 |
+
if (!onDelete || !Object(__WEBPACK_IMPORTED_MODULE_12__is_collapsed__["a" /* isCollapsed */])(currentValue) || activeFormats.length || isReverse && start !== 0 || !isReverse && end !== text.length) {
|
95073 |
+
return;
|
95074 |
+
}
|
95075 |
+
|
95076 |
+
onDelete({
|
95077 |
+
isReverse: isReverse,
|
95078 |
+
value: currentValue
|
95079 |
+
});
|
95080 |
+
event.preventDefault();
|
95081 |
+
}
|
95082 |
+
/**
|
95083 |
+
* Triggers the `onEnter` prop on keydown.
|
95084 |
+
*
|
95085 |
+
* @param {WPSyntheticEvent} event A synthetic keyboard event.
|
95086 |
+
*/
|
|
|
95087 |
|
|
|
|
|
95088 |
|
95089 |
+
function handleEnter(event) {
|
95090 |
+
if (event.keyCode !== __WEBPACK_IMPORTED_MODULE_4__wordpress_keycodes__["d" /* ENTER */]) {
|
95091 |
+
return;
|
95092 |
+
}
|
95093 |
|
95094 |
+
event.preventDefault();
|
|
|
|
|
95095 |
|
95096 |
+
if (!onEnter) {
|
95097 |
+
return;
|
95098 |
+
}
|
95099 |
|
95100 |
+
onEnter({
|
95101 |
+
value: removeEditorOnlyFormats(createRecord()),
|
95102 |
+
onChange: handleChange,
|
95103 |
+
shiftKey: event.shiftKey
|
95104 |
+
});
|
95105 |
+
}
|
95106 |
+
/**
|
95107 |
+
* Indents list items on space keydown.
|
95108 |
+
*
|
95109 |
+
* @param {WPSyntheticEvent} event A synthetic keyboard event.
|
95110 |
+
*/
|
95111 |
|
|
|
|
|
95112 |
|
95113 |
+
function handleSpace(event) {
|
95114 |
+
var keyCode = event.keyCode,
|
95115 |
+
shiftKey = event.shiftKey,
|
95116 |
+
altKey = event.altKey,
|
95117 |
+
metaKey = event.metaKey,
|
95118 |
+
ctrlKey = event.ctrlKey;
|
95119 |
+
|
95120 |
+
if ( // Only override when no modifiers are pressed.
|
95121 |
+
shiftKey || altKey || metaKey || ctrlKey || keyCode !== __WEBPACK_IMPORTED_MODULE_4__wordpress_keycodes__["h" /* SPACE */] || multilineTag !== 'li') {
|
95122 |
+
return;
|
95123 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
95124 |
|
95125 |
+
var currentValue = createRecord();
|
95126 |
+
|
95127 |
+
if (!Object(__WEBPACK_IMPORTED_MODULE_12__is_collapsed__["a" /* isCollapsed */])(currentValue)) {
|
95128 |
+
return;
|
95129 |
}
|
|
|
|
|
|
|
|
|
|
|
95130 |
|
95131 |
+
var text = currentValue.text,
|
95132 |
+
start = currentValue.start;
|
95133 |
+
var characterBefore = text[start - 1]; // The caret must be at the start of a line.
|
95134 |
|
95135 |
+
if (characterBefore && characterBefore !== __WEBPACK_IMPORTED_MODULE_13__special_characters__["a" /* LINE_SEPARATOR */]) {
|
95136 |
+
return;
|
95137 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95138 |
|
95139 |
+
handleChange(Object(__WEBPACK_IMPORTED_MODULE_14__indent_list_items__["a" /* indentListItems */])(currentValue, {
|
95140 |
+
type: multilineRootTag
|
95141 |
+
}));
|
95142 |
+
event.preventDefault();
|
95143 |
+
}
|
95144 |
+
/**
|
95145 |
+
* Handles horizontal keyboard navigation when no modifiers are pressed. The
|
95146 |
+
* navigation is handled separately to move correctly around format
|
95147 |
+
* boundaries.
|
95148 |
+
*
|
95149 |
+
* @param {WPSyntheticEvent} event A synthetic keyboard event.
|
95150 |
+
*/
|
95151 |
|
|
|
|
|
|
|
|
|
95152 |
|
95153 |
+
function handleHorizontalNavigation(event) {
|
95154 |
+
var keyCode = event.keyCode,
|
95155 |
+
shiftKey = event.shiftKey,
|
95156 |
+
altKey = event.altKey,
|
95157 |
+
metaKey = event.metaKey,
|
95158 |
+
ctrlKey = event.ctrlKey;
|
95159 |
|
95160 |
+
if ( // Only override left and right keys without modifiers pressed.
|
95161 |
+
shiftKey || altKey || metaKey || ctrlKey || keyCode !== __WEBPACK_IMPORTED_MODULE_4__wordpress_keycodes__["f" /* LEFT */] && keyCode !== __WEBPACK_IMPORTED_MODULE_4__wordpress_keycodes__["g" /* RIGHT */]) {
|
95162 |
+
return;
|
95163 |
+
}
|
95164 |
+
|
95165 |
+
var _record$current = record.current,
|
95166 |
+
text = _record$current.text,
|
95167 |
+
formats = _record$current.formats,
|
95168 |
+
start = _record$current.start,
|
95169 |
+
end = _record$current.end,
|
95170 |
+
_record$current$activ = _record$current.activeFormats,
|
95171 |
+
currentActiveFormats = _record$current$activ === void 0 ? [] : _record$current$activ;
|
95172 |
+
var collapsed = Object(__WEBPACK_IMPORTED_MODULE_12__is_collapsed__["a" /* isCollapsed */])(record.current); // To do: ideally, we should look at visual position instead.
|
95173 |
|
95174 |
+
var _getWin$getComputedSt = getWin().getComputedStyle(ref.current),
|
95175 |
+
direction = _getWin$getComputedSt.direction;
|
|
|
|
|
95176 |
|
95177 |
+
var reverseKey = direction === 'rtl' ? __WEBPACK_IMPORTED_MODULE_4__wordpress_keycodes__["g" /* RIGHT */] : __WEBPACK_IMPORTED_MODULE_4__wordpress_keycodes__["f" /* LEFT */];
|
95178 |
+
var isReverse = event.keyCode === reverseKey; // If the selection is collapsed and at the very start, do nothing if
|
95179 |
+
// navigating backward.
|
95180 |
+
// If the selection is collapsed and at the very end, do nothing if
|
95181 |
+
// navigating forward.
|
95182 |
|
95183 |
+
if (collapsed && currentActiveFormats.length === 0) {
|
95184 |
+
if (start === 0 && isReverse) {
|
95185 |
return;
|
95186 |
}
|
95187 |
|
95188 |
+
if (end === text.length && !isReverse) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95189 |
return;
|
95190 |
}
|
95191 |
+
} // If the selection is not collapsed, let the browser handle collapsing
|
95192 |
+
// the selection for now. Later we could expand this logic to set
|
95193 |
+
// boundary positions if needed.
|
95194 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95195 |
|
95196 |
+
if (!collapsed) {
|
95197 |
+
return;
|
95198 |
+
} // In all other cases, prevent default behaviour.
|
95199 |
|
|
|
95200 |
|
95201 |
+
event.preventDefault();
|
95202 |
+
var formatsBefore = formats[start - 1] || EMPTY_ACTIVE_FORMATS;
|
95203 |
+
var formatsAfter = formats[start] || EMPTY_ACTIVE_FORMATS;
|
95204 |
+
var newActiveFormatsLength = currentActiveFormats.length;
|
95205 |
+
var source = formatsAfter;
|
|
|
95206 |
|
95207 |
+
if (formatsBefore.length > formatsAfter.length) {
|
95208 |
+
source = formatsBefore;
|
95209 |
+
} // If the amount of formats before the caret and after the caret is
|
95210 |
+
// different, the caret is at a format boundary.
|
95211 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95212 |
|
95213 |
+
if (formatsBefore.length < formatsAfter.length) {
|
95214 |
+
if (!isReverse && currentActiveFormats.length < formatsAfter.length) {
|
95215 |
+
newActiveFormatsLength++;
|
95216 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95217 |
|
95218 |
+
if (isReverse && currentActiveFormats.length > formatsBefore.length) {
|
95219 |
+
newActiveFormatsLength--;
|
95220 |
+
}
|
95221 |
+
} else if (formatsBefore.length > formatsAfter.length) {
|
95222 |
+
if (!isReverse && currentActiveFormats.length > formatsAfter.length) {
|
95223 |
+
newActiveFormatsLength--;
|
95224 |
+
}
|
95225 |
|
95226 |
+
if (isReverse && currentActiveFormats.length < formatsBefore.length) {
|
95227 |
+
newActiveFormatsLength++;
|
95228 |
}
|
95229 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95230 |
|
95231 |
+
if (newActiveFormatsLength !== currentActiveFormats.length) {
|
95232 |
+
var _newActiveFormats = source.slice(0, newActiveFormatsLength);
|
95233 |
+
|
95234 |
+
var _newValue = _objectSpread(_objectSpread({}, record.current), {}, {
|
95235 |
+
activeFormats: _newActiveFormats
|
95236 |
+
});
|
95237 |
|
95238 |
+
record.current = _newValue;
|
95239 |
+
applyRecord(_newValue);
|
95240 |
+
setActiveFormats(_newActiveFormats);
|
95241 |
+
return;
|
95242 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95243 |
|
95244 |
+
var newPos = start + (isReverse ? -1 : 1);
|
95245 |
+
var newActiveFormats = isReverse ? formatsBefore : formatsAfter;
|
|
|
|
|
95246 |
|
95247 |
+
var newValue = _objectSpread(_objectSpread({}, record.current), {}, {
|
95248 |
+
start: newPos,
|
95249 |
+
end: newPos,
|
95250 |
+
activeFormats: newActiveFormats
|
95251 |
+
});
|
95252 |
|
95253 |
+
record.current = newValue;
|
95254 |
+
applyRecord(newValue);
|
95255 |
+
onSelectionChange(newPos, newPos);
|
95256 |
+
setActiveFormats(newActiveFormats);
|
95257 |
+
}
|
95258 |
|
95259 |
+
function handleKeyDown(event) {
|
95260 |
+
if (event.defaultPrevented) {
|
95261 |
+
return;
|
95262 |
+
}
|
95263 |
|
95264 |
+
handleDelete(event);
|
95265 |
+
handleEnter(event);
|
95266 |
+
handleSpace(event);
|
95267 |
+
handleHorizontalNavigation(event);
|
95268 |
+
}
|
95269 |
|
95270 |
+
var lastHistoryValue = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["l" /* useRef */])(value);
|
|
|
|
|
95271 |
|
95272 |
+
function createUndoLevel() {
|
95273 |
+
// If the content is the same, no level needs to be created.
|
95274 |
+
if (lastHistoryValue.current === _value.current) {
|
95275 |
+
return;
|
95276 |
+
}
|
|
|
|
|
|
|
|
|
|
|
95277 |
|
95278 |
+
onCreateUndoLevel();
|
95279 |
+
lastHistoryValue.current = _value.current;
|
95280 |
+
}
|
95281 |
+
|
95282 |
+
var isComposing = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["l" /* useRef */])(false);
|
95283 |
+
var timeout = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["l" /* useRef */])();
|
95284 |
+
/**
|
95285 |
+
* Handle input on the next selection change event.
|
95286 |
+
*
|
95287 |
+
* @param {WPSyntheticEvent} event Synthetic input event.
|
95288 |
+
*/
|
95289 |
|
95290 |
+
function handleInput(event) {
|
95291 |
+
// Do not trigger a change if characters are being composed. Browsers
|
95292 |
+
// will usually emit a final `input` event when the characters are
|
95293 |
+
// composed.
|
95294 |
+
// As of December 2019, Safari doesn't support nativeEvent.isComposing.
|
95295 |
+
if (isComposing.current) {
|
95296 |
+
return;
|
95297 |
+
}
|
95298 |
|
95299 |
+
var inputType;
|
|
|
|
|
|
|
|
|
95300 |
|
95301 |
+
if (event) {
|
95302 |
+
inputType = event.inputType;
|
95303 |
+
}
|
|
|
|
|
|
|
95304 |
|
95305 |
+
if (!inputType && event && event.nativeEvent) {
|
95306 |
+
inputType = event.nativeEvent.inputType;
|
95307 |
+
} // The browser formatted something or tried to insert HTML.
|
95308 |
+
// Overwrite it. It will be handled later by the format library if
|
95309 |
+
// needed.
|
95310 |
|
|
|
|
|
|
|
95311 |
|
95312 |
+
if (inputType && (inputType.indexOf('format') === 0 || INSERTION_INPUT_TYPES_TO_IGNORE.has(inputType))) {
|
95313 |
+
applyRecord(record.current);
|
95314 |
+
return;
|
|
|
|
|
95315 |
}
|
|
|
|
|
|
|
|
|
|
|
95316 |
|
95317 |
+
var currentValue = createRecord();
|
95318 |
+
var _record$current2 = record.current,
|
95319 |
+
start = _record$current2.start,
|
95320 |
+
_record$current2$acti = _record$current2.activeFormats,
|
95321 |
+
oldActiveFormats = _record$current2$acti === void 0 ? [] : _record$current2$acti; // Update the formats between the last and new caret position.
|
|
|
95322 |
|
95323 |
+
var change = Object(__WEBPACK_IMPORTED_MODULE_16__update_formats__["a" /* updateFormats */])({
|
95324 |
+
value: currentValue,
|
95325 |
+
start: start,
|
95326 |
+
end: currentValue.start,
|
95327 |
+
formats: oldActiveFormats
|
95328 |
+
});
|
95329 |
+
handleChange(change, {
|
95330 |
+
withoutHistory: true
|
95331 |
+
}); // Create an undo level when input stops for over a second.
|
95332 |
|
95333 |
+
getWin().clearTimeout(timeout.current);
|
95334 |
+
timeout.current = getWin().setTimeout(createUndoLevel, 1000); // Only run input rules when inserting text.
|
|
|
95335 |
|
95336 |
+
if (inputType !== 'insertText') {
|
95337 |
+
return;
|
|
|
|
|
|
|
95338 |
}
|
|
|
|
|
|
|
|
|
|
|
95339 |
|
95340 |
+
if (allowPrefixTransformations && inputRule) {
|
95341 |
+
inputRule(change, valueToFormat);
|
95342 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95343 |
|
95344 |
+
var transformed = formatTypes.reduce(function (accumlator, _ref4) {
|
95345 |
+
var __unstableInputRule = _ref4.__unstableInputRule;
|
95346 |
|
95347 |
+
if (__unstableInputRule) {
|
95348 |
+
accumlator = __unstableInputRule(accumlator);
|
95349 |
}
|
95350 |
|
95351 |
+
return accumlator;
|
95352 |
+
}, change);
|
|
|
|
|
|
|
|
|
|
|
95353 |
|
95354 |
+
if (transformed !== change) {
|
95355 |
+
createUndoLevel();
|
95356 |
+
handleChange(_objectSpread(_objectSpread({}, transformed), {}, {
|
95357 |
+
activeFormats: oldActiveFormats
|
95358 |
}));
|
95359 |
+
markAutomaticChange();
|
95360 |
}
|
95361 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95362 |
|
95363 |
+
function handleCompositionStart() {
|
95364 |
+
isComposing.current = true; // Do not update the selection when characters are being composed as
|
95365 |
+
// this rerenders the component and might distroy internal browser
|
95366 |
+
// editing state.
|
95367 |
|
95368 |
+
getDoc().removeEventListener('selectionchange', handleSelectionChange);
|
95369 |
+
}
|
|
|
|
|
|
|
95370 |
|
95371 |
+
function handleCompositionEnd() {
|
95372 |
+
isComposing.current = false; // Ensure the value is up-to-date for browsers that don't emit a final
|
95373 |
+
// input event after composition.
|
|
|
95374 |
|
95375 |
+
handleInput({
|
95376 |
+
inputType: 'insertText'
|
95377 |
+
}); // Tracking selection changes can be resumed.
|
|
|
|
|
|
|
95378 |
|
95379 |
+
getDoc().addEventListener('selectionchange', handleSelectionChange);
|
95380 |
+
}
|
95381 |
|
95382 |
+
var didMount = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["l" /* useRef */])(false);
|
95383 |
+
/**
|
95384 |
+
* Syncs the selection to local state. A callback for the `selectionchange`
|
95385 |
+
* native events, `keyup`, `mouseup` and `touchend` synthetic events, and
|
95386 |
+
* animation frames after the `focus` event.
|
95387 |
+
*
|
95388 |
+
* @param {Event|WPSyntheticEvent|DOMHighResTimeStamp} event
|
95389 |
+
*/
|
95390 |
|
95391 |
+
function handleSelectionChange(event) {
|
95392 |
+
if (!ref.current) {
|
95393 |
+
return;
|
95394 |
+
}
|
95395 |
|
95396 |
+
if (ref.current.ownerDocument.activeElement !== ref.current) {
|
95397 |
+
return;
|
95398 |
+
}
|
|
|
|
|
95399 |
|
95400 |
+
if (event.type !== 'selectionchange' && !isSelected) {
|
95401 |
+
return;
|
95402 |
+
}
|
|
|
95403 |
|
95404 |
+
if (disabled) {
|
95405 |
+
return;
|
95406 |
+
} // In case of a keyboard event, ignore selection changes during
|
95407 |
+
// composition.
|
95408 |
|
|
|
|
|
|
|
|
|
95409 |
|
95410 |
+
if (isComposing.current) {
|
95411 |
+
return;
|
95412 |
+
}
|
|
|
|
|
|
|
|
|
95413 |
|
95414 |
+
var _createRecord = createRecord(),
|
95415 |
+
start = _createRecord.start,
|
95416 |
+
end = _createRecord.end,
|
95417 |
+
text = _createRecord.text;
|
95418 |
|
95419 |
+
var oldRecord = record.current; // Fallback mechanism for IE11, which doesn't support the input event.
|
95420 |
+
// Any input results in a selection change.
|
95421 |
|
95422 |
+
if (text !== oldRecord.text) {
|
95423 |
+
handleInput();
|
95424 |
+
return;
|
95425 |
+
}
|
95426 |
|
95427 |
+
if (start === oldRecord.start && end === oldRecord.end) {
|
95428 |
+
// Sometimes the browser may set the selection on the placeholder
|
95429 |
+
// element, in which case the caret is not visible. We need to set
|
95430 |
+
// the caret before the placeholder if that's the case.
|
95431 |
+
if (oldRecord.text.length === 0 && start === 0) {
|
95432 |
+
fixPlaceholderSelection(getWin());
|
95433 |
}
|
95434 |
|
95435 |
+
return;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95436 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
95437 |
|
95438 |
+
var newValue = _objectSpread(_objectSpread({}, oldRecord), {}, {
|
95439 |
+
start: start,
|
95440 |
+
end: end,
|
95441 |
+
// Allow `getActiveFormats` to get new `activeFormats`.
|
95442 |
+
activeFormats: undefined
|
95443 |
+
});
|
95444 |
|
95445 |
+
var newActiveFormats = Object(__WEBPACK_IMPORTED_MODULE_15__get_active_formats__["a" /* getActiveFormats */])(newValue, EMPTY_ACTIVE_FORMATS); // Update the value with the new active formats.
|
|
|
|
|
95446 |
|
95447 |
+
newValue.activeFormats = newActiveFormats;
|
95448 |
+
|
95449 |
+
if (!isCaretWithinFormattedText && newActiveFormats.length) {
|
95450 |
+
onEnterFormattedText();
|
95451 |
+
} else if (isCaretWithinFormattedText && !newActiveFormats.length) {
|
95452 |
+
onExitFormattedText();
|
95453 |
+
} // It is important that the internal value is updated first,
|
95454 |
+
// otherwise the value will be wrong on render!
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95455 |
|
|
|
95456 |
|
95457 |
+
record.current = newValue;
|
95458 |
+
applyRecord(newValue, {
|
95459 |
+
domOnly: true
|
95460 |
+
});
|
95461 |
+
onSelectionChange(start, end);
|
95462 |
+
setActiveFormats(newActiveFormats);
|
95463 |
+
}
|
95464 |
+
/**
|
95465 |
+
* Sync the value to global state. The node tree and selection will also be
|
95466 |
+
* updated if differences are found.
|
95467 |
+
*
|
95468 |
+
* @param {Object} newRecord The record to sync and apply.
|
95469 |
+
* @param {Object} $2 Named options.
|
95470 |
+
* @param {boolean} $2.withoutHistory If true, no undo level will be
|
95471 |
+
* created.
|
95472 |
+
*/
|
95473 |
|
|
|
|
|
95474 |
|
95475 |
+
function handleChange(newRecord) {
|
95476 |
+
var _ref5 = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {},
|
95477 |
+
withoutHistory = _ref5.withoutHistory;
|
95478 |
|
95479 |
+
if (disableFormats) {
|
95480 |
+
newRecord.formats = Array(newRecord.text.length);
|
95481 |
+
newRecord.replacements = Array(newRecord.text.length);
|
95482 |
+
}
|
95483 |
|
95484 |
+
applyRecord(newRecord);
|
95485 |
+
var start = newRecord.start,
|
95486 |
+
end = newRecord.end,
|
95487 |
+
_newRecord$activeForm = newRecord.activeFormats,
|
95488 |
+
newActiveFormats = _newRecord$activeForm === void 0 ? [] : _newRecord$activeForm;
|
95489 |
+
Object.values(changeHandlers).forEach(function (changeHandler) {
|
95490 |
+
changeHandler(newRecord.formats, newRecord.text);
|
95491 |
+
});
|
95492 |
+
_value.current = valueToFormat(newRecord);
|
95493 |
+
record.current = newRecord; // Selection must be updated first, so it is recorded in history when
|
95494 |
+
// the content change happens.
|
95495 |
|
95496 |
+
onSelectionChange(start, end);
|
95497 |
+
onChange(_value.current);
|
95498 |
+
setActiveFormats(newActiveFormats);
|
95499 |
|
95500 |
+
if (!withoutHistory) {
|
95501 |
+
createUndoLevel();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95502 |
}
|
95503 |
+
}
|
95504 |
+
/**
|
95505 |
+
* Select object when they are clicked. The browser will not set any
|
95506 |
+
* selection when clicking e.g. an image.
|
95507 |
+
*
|
95508 |
+
* @param {WPSyntheticEvent} event Synthetic mousedown or touchstart event.
|
95509 |
+
*/
|
95510 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95511 |
|
95512 |
+
function handlePointerDown(event) {
|
95513 |
+
var target = event.target; // If the child element has no text content, it must be an object.
|
|
|
95514 |
|
95515 |
+
if (target === ref.current || target.textContent) {
|
95516 |
+
return;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95517 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95518 |
|
95519 |
+
var parentNode = target.parentNode;
|
95520 |
+
var index = Array.from(parentNode.childNodes).indexOf(target);
|
95521 |
+
var range = getDoc().createRange();
|
95522 |
+
var selection = getWin().getSelection();
|
95523 |
+
range.setStart(target.parentNode, index);
|
95524 |
+
range.setEnd(target.parentNode, index + 1);
|
95525 |
+
selection.removeAllRanges();
|
95526 |
+
selection.addRange(range);
|
95527 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95528 |
|
95529 |
+
var rafId = Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["l" /* useRef */])();
|
95530 |
+
/**
|
95531 |
+
* Handles a focus event on the contenteditable field, calling the
|
95532 |
+
* `unstableOnFocus` prop callback if one is defined. The callback does not
|
95533 |
+
* receive any arguments.
|
95534 |
+
*
|
95535 |
+
* This is marked as a private API and the `unstableOnFocus` prop is not
|
95536 |
+
* documented, as the current requirements where it is used are subject to
|
95537 |
+
* future refactoring following `isSelected` handling.
|
95538 |
+
*
|
95539 |
+
* In contrast with `setFocusedElement`, this is only triggered in response
|
95540 |
+
* to focus within the contenteditable field, whereas `setFocusedElement`
|
95541 |
+
* is triggered on focus within any `RichText` descendent element.
|
95542 |
+
*
|
95543 |
+
* @see setFocusedElement
|
95544 |
+
*
|
95545 |
+
* @private
|
95546 |
+
*/
|
95547 |
|
95548 |
+
function handleFocus() {
|
95549 |
+
if (onFocus) {
|
95550 |
+
onFocus();
|
95551 |
+
}
|
95552 |
|
95553 |
+
if (!isSelected) {
|
95554 |
+
// We know for certain that on focus, the old selection is invalid.
|
95555 |
+
// It will be recalculated on the next mouseup, keyup, or touchend
|
95556 |
+
// event.
|
95557 |
+
var index = undefined;
|
95558 |
+
record.current = _objectSpread(_objectSpread({}, record.current), {}, {
|
95559 |
+
start: index,
|
95560 |
+
end: index,
|
95561 |
+
activeFormats: EMPTY_ACTIVE_FORMATS
|
95562 |
+
});
|
95563 |
+
onSelectionChange(index, index);
|
95564 |
+
setActiveFormats(EMPTY_ACTIVE_FORMATS);
|
95565 |
+
} else {
|
95566 |
+
onSelectionChange(record.current.start, record.current.end);
|
95567 |
+
setActiveFormats(Object(__WEBPACK_IMPORTED_MODULE_15__get_active_formats__["a" /* getActiveFormats */])(_objectSpread(_objectSpread({}, record.current), {}, {
|
95568 |
+
activeFormats: undefined
|
95569 |
+
}), EMPTY_ACTIVE_FORMATS));
|
95570 |
+
} // Update selection as soon as possible, which is at the next animation
|
95571 |
+
// frame. The event listener for selection changes may be added too late
|
95572 |
+
// at this point, but this focus event is still too early to calculate
|
95573 |
+
// the selection.
|
95574 |
|
|
|
|
|
|
|
95575 |
|
95576 |
+
rafId.current = getWin().requestAnimationFrame(handleSelectionChange);
|
95577 |
+
getDoc().addEventListener('selectionchange', handleSelectionChange);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95578 |
|
95579 |
+
if (setFocusedElement) {
|
95580 |
+
Object(__WEBPACK_IMPORTED_MODULE_5__wordpress_deprecated__["a" /* default */])('wp.blockEditor.RichText setFocusedElement prop', {
|
95581 |
+
alternative: 'selection state from the block editor store.'
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95582 |
});
|
95583 |
+
setFocusedElement(instanceId);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95584 |
}
|
95585 |
+
}
|
|
|
|
|
|
|
95586 |
|
95587 |
+
function handleBlur() {
|
95588 |
+
getDoc().removeEventListener('selectionchange', handleSelectionChange);
|
95589 |
+
}
|
|
|
|
|
|
|
|
|
|
|
95590 |
|
95591 |
+
function applyFromProps() {
|
95592 |
+
_value.current = value;
|
95593 |
+
record.current = formatToValue(value);
|
95594 |
+
record.current.start = selectionStart;
|
95595 |
+
record.current.end = selectionEnd;
|
95596 |
+
applyRecord(record.current);
|
95597 |
+
}
|
95598 |
|
95599 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["h" /* useEffect */])(function () {
|
95600 |
+
if (didMount.current) {
|
95601 |
+
applyFromProps();
|
95602 |
+
}
|
95603 |
+
}, [TagName, placeholder]);
|
95604 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["h" /* useEffect */])(function () {
|
95605 |
+
if (didMount.current && value !== _value.current) {
|
95606 |
+
applyFromProps();
|
95607 |
+
}
|
95608 |
+
}, [value]);
|
95609 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["h" /* useEffect */])(function () {
|
95610 |
+
if (!didMount.current) {
|
95611 |
+
return;
|
95612 |
+
}
|
95613 |
|
95614 |
+
if (isSelected && (selectionStart !== record.current.start || selectionEnd !== record.current.end)) {
|
95615 |
+
applyFromProps();
|
95616 |
+
} else {
|
95617 |
+
record.current = _objectSpread(_objectSpread({}, record.current), {}, {
|
95618 |
+
start: selectionStart,
|
95619 |
+
end: selectionEnd
|
95620 |
+
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95621 |
}
|
95622 |
+
}, [selectionStart, selectionEnd, isSelected]);
|
95623 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["h" /* useEffect */])(function () {
|
95624 |
+
if (didMount.current) {
|
95625 |
+
applyFromProps();
|
95626 |
+
}
|
95627 |
+
}, dependencies);
|
95628 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["i" /* useLayoutEffect */])(function () {
|
95629 |
+
applyRecord(record.current, {
|
95630 |
+
domOnly: true
|
95631 |
+
});
|
95632 |
+
didMount.current = true;
|
95633 |
+
return function () {
|
95634 |
+
getDoc().removeEventListener('selectionchange', handleSelectionChange);
|
95635 |
+
getWin().cancelAnimationFrame(rafId.current);
|
95636 |
+
getWin().clearTimeout(timeout.current);
|
95637 |
+
};
|
95638 |
+
}, []);
|
95639 |
|
95640 |
+
function focus() {
|
95641 |
+
ref.current.focus();
|
95642 |
+
applyRecord(record.current);
|
95643 |
+
}
|
95644 |
|
95645 |
+
var editableProps = {
|
95646 |
+
// Overridable props.
|
95647 |
+
role: 'textbox',
|
95648 |
+
'aria-multiline': true,
|
95649 |
+
'aria-label': placeholder,
|
95650 |
+
ref: ref,
|
95651 |
+
style: defaultStyle,
|
95652 |
+
className: 'rich-text',
|
95653 |
+
onPaste: handlePaste,
|
95654 |
+
onInput: handleInput,
|
95655 |
+
onCompositionStart: handleCompositionStart,
|
95656 |
+
onCompositionEnd: handleCompositionEnd,
|
95657 |
+
onKeyDown: handleKeyDown,
|
95658 |
+
onFocus: handleFocus,
|
95659 |
+
onBlur: handleBlur,
|
95660 |
+
onMouseDown: handlePointerDown,
|
95661 |
+
onTouchStart: handlePointerDown,
|
95662 |
+
// Selection updates must be done at these events as they
|
95663 |
+
// happen before the `selectionchange` event. In some cases,
|
95664 |
+
// the `selectionchange` event may not even fire, for
|
95665 |
+
// example when the window receives focus again on click.
|
95666 |
+
onKeyUp: handleSelectionChange,
|
95667 |
+
onMouseUp: handleSelectionChange,
|
95668 |
+
onTouchEnd: handleSelectionChange,
|
95669 |
+
// Do not set the attribute if disabled.
|
95670 |
+
contentEditable: disabled ? undefined : true,
|
95671 |
+
suppressContentEditableWarning: !disabled
|
95672 |
+
};
|
95673 |
+
Object(__WEBPACK_IMPORTED_MODULE_20__use_boundary_style__["a" /* useBoundaryStyle */])({
|
95674 |
+
ref: ref,
|
95675 |
+
activeFormats: activeFormats
|
95676 |
+
});
|
95677 |
+
Object(__WEBPACK_IMPORTED_MODULE_21__use_inline_warning__["a" /* useInlineWarning */])({
|
95678 |
+
ref: ref
|
95679 |
+
});
|
95680 |
+
return Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["d" /* createElement */])(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["b" /* Fragment */], null, isSelected && Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["d" /* createElement */])(__WEBPACK_IMPORTED_MODULE_6__format_edit__["a" /* default */], {
|
95681 |
+
allowedFormats: allowedFormats,
|
95682 |
+
withoutInteractiveFormatting: withoutInteractiveFormatting,
|
95683 |
+
value: record.current,
|
95684 |
+
onChange: handleChange,
|
95685 |
+
onFocus: focus,
|
95686 |
+
formatTypes: formatTypes
|
95687 |
+
}), children && children({
|
95688 |
+
isSelected: isSelected,
|
95689 |
+
value: record.current,
|
95690 |
+
onChange: handleChange,
|
95691 |
+
onFocus: focus,
|
95692 |
+
editableProps: editableProps,
|
95693 |
+
editableTagName: TagName
|
95694 |
+
}), !children && Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["d" /* createElement */])(TagName, editableProps));
|
95695 |
+
}
|
95696 |
/**
|
95697 |
* Renders a rich content input, providing users with the option to format the
|
95698 |
* content.
|
95699 |
*/
|
95700 |
|
95701 |
+
|
95702 |
+
/* unused harmony default export */ var _unused_webpack_default_export = (Object(__WEBPACK_IMPORTED_MODULE_2__wordpress_element__["e" /* forwardRef */])(RichText));
|
|
|
|
|
|
|
95703 |
//# sourceMappingURL=index.js.map
|
95704 |
|
95705 |
/***/ }),
|
95706 |
+
/* 600 */
|
95707 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
95708 |
|
95709 |
"use strict";
|
95710 |
/* harmony export (immutable) */ __webpack_exports__["a"] = updateFormats;
|
95711 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__is_format_equal__ = __webpack_require__(109);
|
95712 |
/**
|
95713 |
* Internal dependencies
|
95714 |
*/
|
95715 |
|
95716 |
+
/** @typedef {import('./create').RichTextValue} RichTextValue */
|
95717 |
+
|
95718 |
/**
|
95719 |
* Efficiently updates all the formats from `start` (including) until `end`
|
95720 |
* (excluding) with the active formats. Mutates `value`.
|
95721 |
*
|
95722 |
+
* @param {Object} $1 Named paramentes.
|
95723 |
+
* @param {RichTextValue} $1.value Value te update.
|
95724 |
+
* @param {number} $1.start Index to update from.
|
95725 |
+
* @param {number} $1.end Index to update until.
|
95726 |
+
* @param {Array} $1.formats Replacement formats.
|
95727 |
*
|
95728 |
+
* @return {RichTextValue} Mutated value.
|
95729 |
*/
|
95730 |
|
95731 |
function updateFormats(_ref) {
|
95764 |
//# sourceMappingURL=update-formats.js.map
|
95765 |
|
95766 |
/***/ }),
|
95767 |
+
/* 601 */
|
95768 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
95769 |
|
95770 |
"use strict";
|
95771 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = useFormatTypes;
|
95772 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__ = __webpack_require__(13);
|
95773 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__wordpress_data__ = __webpack_require__(41);
|
|
|
|
|
|
|
|
|
|
|
|
|
95774 |
|
95775 |
|
95776 |
function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }
|
95777 |
|
95778 |
+
function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_defineProperty__["a" /* default */])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }
|
|
|
|
|
|
|
|
|
95779 |
|
95780 |
/**
|
95781 |
* WordPress dependencies
|
95782 |
*/
|
95783 |
|
95784 |
|
|
|
|
|
95785 |
function formatTypesSelector(select) {
|
95786 |
return select('core/rich-text').getFormatTypes();
|
95787 |
}
|
95788 |
/**
|
95789 |
+
* This hook provides RichText with the `formatTypes` and its derived props from
|
95790 |
+
* experimental format type settings.
|
|
|
|
|
95791 |
*
|
95792 |
+
* @param {Object} $0 Options
|
95793 |
+
* @param {string} $0.clientId Block client ID.
|
95794 |
+
* @param {string} $0.identifier Block attribute.
|
95795 |
*/
|
95796 |
|
95797 |
|
95798 |
+
function useFormatTypes(_ref) {
|
95799 |
+
var clientId = _ref.clientId,
|
95800 |
+
identifier = _ref.identifier;
|
95801 |
+
var formatTypes = Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_data__["f" /* useSelect */])(formatTypesSelector, []);
|
95802 |
+
var keyedSelected = Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_data__["f" /* useSelect */])(function (select) {
|
95803 |
+
return formatTypes.reduce(function (accumulator, type) {
|
95804 |
+
if (type.__experimentalGetPropsForEditableTreePreparation) {
|
95805 |
+
accumulator[type.name] = type.__experimentalGetPropsForEditableTreePreparation(select, {
|
|
|
|
|
|
|
|
|
|
|
95806 |
richTextIdentifier: identifier,
|
95807 |
blockClientId: clientId
|
95808 |
+
});
|
95809 |
+
}
|
|
|
|
|
|
|
95810 |
|
95811 |
+
return accumulator;
|
95812 |
+
}, {});
|
95813 |
+
}, [formatTypes, clientId, identifier]);
|
95814 |
+
var dispatch = Object(__WEBPACK_IMPORTED_MODULE_1__wordpress_data__["e" /* useDispatch */])();
|
95815 |
+
var prepareHandlers = [];
|
95816 |
+
var valueHandlers = [];
|
95817 |
+
var changeHandlers = [];
|
95818 |
+
var dependencies = [];
|
95819 |
+
formatTypes.forEach(function (type) {
|
95820 |
+
if (type.__experimentalCreatePrepareEditableTree) {
|
95821 |
+
var selected = keyedSelected[type.name];
|
95822 |
+
|
95823 |
+
var handler = type.__experimentalCreatePrepareEditableTree(selected, {
|
95824 |
+
richTextIdentifier: identifier,
|
95825 |
+
blockClientId: clientId
|
95826 |
+
});
|
95827 |
|
95828 |
+
if (type.__experimentalCreateOnChangeEditableValue) {
|
95829 |
+
valueHandlers.push(handler);
|
95830 |
+
} else {
|
95831 |
+
prepareHandlers.push(handler);
|
95832 |
+
}
|
|
|
|
|
|
|
|
|
95833 |
|
95834 |
+
for (var key in selected) {
|
95835 |
+
dependencies.push(selected[key]);
|
95836 |
+
}
|
95837 |
+
}
|
95838 |
+
|
95839 |
+
if (type.__experimentalCreateOnChangeEditableValue) {
|
95840 |
+
var dispatchers = {};
|
95841 |
|
95842 |
+
if (type.__experimentalGetPropsForEditableTreeChangeHandler) {
|
95843 |
+
dispatchers = type.__experimentalGetPropsForEditableTreeChangeHandler(dispatch, {
|
95844 |
richTextIdentifier: identifier,
|
95845 |
blockClientId: clientId
|
95846 |
+
});
|
95847 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
95848 |
|
95849 |
+
changeHandlers.push(type.__experimentalCreateOnChangeEditableValue(_objectSpread(_objectSpread({}, keyedSelected[type.name] || {}), dispatchers), {
|
95850 |
+
richTextIdentifier: identifier,
|
95851 |
+
blockClientId: clientId
|
95852 |
+
}));
|
95853 |
+
}
|
95854 |
+
});
|
95855 |
+
return {
|
95856 |
+
formatTypes: formatTypes,
|
95857 |
+
prepareHandlers: prepareHandlers,
|
95858 |
+
valueHandlers: valueHandlers,
|
95859 |
+
changeHandlers: changeHandlers,
|
95860 |
+
dependencies: dependencies
|
95861 |
};
|
95862 |
}
|
95863 |
+
//# sourceMappingURL=use-format-types.js.map
|
95864 |
|
95865 |
/***/ }),
|
95866 |
+
/* 602 */
|
95867 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
95868 |
|
95869 |
"use strict";
|
95870 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = useBoundaryStyle;
|
95871 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
95872 |
/**
|
95873 |
* WordPress dependencies
|
95874 |
*/
|
95875 |
|
95876 |
+
/*
|
95877 |
* Calculates and renders the format boundary style when the active formats
|
95878 |
* change.
|
95879 |
*/
|
95880 |
|
95881 |
+
function useBoundaryStyle(_ref) {
|
95882 |
var activeFormats = _ref.activeFormats,
|
95883 |
+
ref = _ref.ref;
|
95884 |
Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_element__["h" /* useEffect */])(function () {
|
95885 |
// There's no need to recalculate the boundary styles if no formats are
|
95886 |
// active, because no boundary styles will be visible.
|
95889 |
}
|
95890 |
|
95891 |
var boundarySelector = '*[data-rich-text-format-boundary]';
|
95892 |
+
var element = ref.current.querySelector(boundarySelector);
|
95893 |
|
95894 |
if (!element) {
|
95895 |
return;
|
95915 |
globalStyle.innerHTML = style;
|
95916 |
}
|
95917 |
}, [activeFormats]);
|
|
|
95918 |
}
|
95919 |
+
//# sourceMappingURL=use-boundary-style.js.map
|
95920 |
|
95921 |
/***/ }),
|
95922 |
+
/* 603 */
|
95923 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
95924 |
|
95925 |
"use strict";
|
95926 |
+
/* WEBPACK VAR INJECTION */(function(process) {/* harmony export (immutable) */ __webpack_exports__["a"] = useInlineWarning;
|
95927 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_element__ = __webpack_require__(15);
|
95928 |
/**
|
95929 |
* WordPress dependencies
|
95930 |
*/
|
95931 |
|
95932 |
+
function useInlineWarning(_ref) {
|
95933 |
+
var ref = _ref.ref;
|
95934 |
Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_element__["h" /* useEffect */])(function () {
|
95935 |
if (process.env.NODE_ENV === 'development') {
|
95936 |
+
var target = ref.current;
|
95937 |
var defaultView = target.ownerDocument.defaultView;
|
95938 |
var computedStyle = defaultView.getComputedStyle(target);
|
95939 |
|
95943 |
}
|
95944 |
}
|
95945 |
}, []);
|
|
|
95946 |
}
|
95947 |
+
//# sourceMappingURL=use-inline-warning.js.map
|
95948 |
/* WEBPACK VAR INJECTION */}.call(__webpack_exports__, __webpack_require__(20)))
|
95949 |
|
95950 |
/***/ }),
|
95951 |
+
/* 604 */
|
95952 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
95953 |
|
95954 |
"use strict";
|
95959 |
/* harmony export (immutable) */ __webpack_exports__["findNext"] = findNext;
|
95960 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash__ = __webpack_require__(2);
|
95961 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_lodash__);
|
95962 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__focusable__ = __webpack_require__(191);
|
95963 |
/**
|
95964 |
* External dependencies
|
95965 |
*/
|
96116 |
* to the active element.
|
96117 |
*/
|
96118 |
|
96119 |
+
function findPrevious(element) {
|
96120 |
+
var focusables = Object(__WEBPACK_IMPORTED_MODULE_1__focusable__["find"])(element.ownerDocument.body);
|
|
|
96121 |
var index = focusables.indexOf(element); // Remove all focusables after and including `element`.
|
96122 |
|
96123 |
focusables.length = index;
|
96130 |
* to the active element.
|
96131 |
*/
|
96132 |
|
96133 |
+
function findNext(element) {
|
96134 |
+
var focusables = Object(__WEBPACK_IMPORTED_MODULE_1__focusable__["find"])(element.ownerDocument.body);
|
|
|
96135 |
var index = focusables.indexOf(element); // Remove all focusables before and inside `element`.
|
96136 |
|
96137 |
var remaining = focusables.slice(index + 1).filter(function (node) {
|
96142 |
//# sourceMappingURL=tabbable.js.map
|
96143 |
|
96144 |
/***/ }),
|
96145 |
+
/* 605 */
|
96146 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
96147 |
|
96148 |
"use strict";
|
96154 |
/* unused harmony export placeCaretAtVerticalEdge */
|
96155 |
/* unused harmony export isTextField */
|
96156 |
/* unused harmony export isNumberInput */
|
96157 |
+
/* unused harmony export documentHasTextSelection */
|
96158 |
+
/* unused harmony export documentHasUncollapsedSelection */
|
96159 |
/* unused harmony export documentHasSelection */
|
96160 |
/* unused harmony export isEntirelySelected */
|
96161 |
/* unused harmony export getScrollContainer */
|
96167 |
/* unused harmony export replaceTag */
|
96168 |
/* unused harmony export wrap */
|
96169 |
/* unused harmony export __unstableStripHTML */
|
96170 |
+
/* unused harmony export isEmpty */
|
96171 |
+
/* unused harmony export removeInvalidHTML */
|
96172 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash__ = __webpack_require__(2);
|
96173 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_lodash__);
|
96174 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__phrasing_content__ = __webpack_require__(192);
|
96175 |
/**
|
96176 |
* External dependencies
|
96177 |
*/
|
96178 |
|
96179 |
/**
|
96180 |
+
* Internal dependencies
|
96181 |
*/
|
96182 |
|
96183 |
+
|
96184 |
+
|
96185 |
+
function getComputedStyle(node) {
|
96186 |
+
return node.ownerDocument.defaultView.getComputedStyle(node);
|
96187 |
+
}
|
|
|
|
|
|
|
96188 |
/**
|
96189 |
* Returns true if the given selection object is in the forward direction, or
|
96190 |
* false otherwise.
|
96196 |
* @return {boolean} Whether the selection is forward.
|
96197 |
*/
|
96198 |
|
96199 |
+
|
96200 |
function isSelectionForward(selection) {
|
96201 |
var anchorNode = selection.anchorNode,
|
96202 |
focusNode = selection.focusNode,
|
96209 |
// Compare whether anchor node precedes focus node. If focus node (where
|
96210 |
// end of selection occurs) is after the anchor node, it is forward.
|
96211 |
|
96212 |
+
if (position & anchorNode.DOCUMENT_POSITION_PRECEDING) {
|
96213 |
return false;
|
96214 |
}
|
96215 |
|
96216 |
+
if (position & anchorNode.DOCUMENT_POSITION_FOLLOWING) {
|
96217 |
return true;
|
96218 |
}
|
96219 |
/* eslint-enable no-bitwise */
|
96258 |
return true;
|
96259 |
}
|
96260 |
|
96261 |
+
var ownerDocument = container.ownerDocument;
|
96262 |
+
var defaultView = ownerDocument.defaultView;
|
96263 |
+
var selection = defaultView.getSelection();
|
96264 |
|
96265 |
if (!selection.rangeCount) {
|
96266 |
return false;
|
96281 |
return false;
|
96282 |
}
|
96283 |
|
96284 |
+
var computedStyle = getComputedStyle(container);
|
96285 |
var lineHeight = parseInt(computedStyle.lineHeight, 10) || 0; // Only consider the multiline selection at the edge if the direction is
|
96286 |
// towards the edge.
|
96287 |
|
96317 |
|
96318 |
var x = isReverseDir ? containerRect.left + 1 : containerRect.right - 1;
|
96319 |
var y = isReverse ? containerRect.top + buffer : containerRect.bottom - buffer;
|
96320 |
+
var testRange = hiddenCaretRangeFromPoint(ownerDocument, x, y, container);
|
96321 |
|
96322 |
if (!testRange) {
|
96323 |
return false;
|
96370 |
}
|
96371 |
|
96372 |
var _range = range,
|
96373 |
+
startContainer = _range.startContainer;
|
96374 |
+
var ownerDocument = startContainer.ownerDocument; // Correct invalid "BR" ranges. The cannot contain any children.
|
96375 |
|
96376 |
if (startContainer.nodeName === 'BR') {
|
96377 |
var parentNode = startContainer.parentNode;
|
96378 |
var index = Array.from(parentNode.childNodes).indexOf(startContainer);
|
96379 |
+
range = ownerDocument.createRange();
|
96380 |
range.setStart(parentNode, index);
|
96381 |
range.setEnd(parentNode, index);
|
96382 |
}
|
96388 |
// See: https://stackoverflow.com/a/6847328/995445
|
96389 |
|
96390 |
if (!rect) {
|
96391 |
+
var padNode = ownerDocument.createTextNode("\u200B"); // Do not modify the live range.
|
96392 |
|
96393 |
range = range.cloneRange();
|
96394 |
range.insertNode(padNode);
|
96401 |
/**
|
96402 |
* Get the rectangle for the selection in a container.
|
96403 |
*
|
96404 |
+
* @param {Window} win The window of the selection.
|
96405 |
+
*
|
96406 |
* @return {?DOMRect} The rectangle.
|
96407 |
*/
|
96408 |
|
96409 |
+
function computeCaretRect(win) {
|
96410 |
+
var selection = win.getSelection();
|
96411 |
var range = selection.rangeCount ? selection.getRangeAt(0) : null;
|
96412 |
|
96413 |
if (!range) {
|
96458 |
return;
|
96459 |
}
|
96460 |
|
96461 |
+
var ownerDocument = container.ownerDocument;
|
96462 |
+
var defaultView = ownerDocument.defaultView;
|
96463 |
+
var selection = defaultView.getSelection();
|
96464 |
+
var range = ownerDocument.createRange();
|
96465 |
range.selectNodeContents(rangeTarget);
|
96466 |
range.collapse(!isReverse);
|
96467 |
selection.removeAllRanges();
|
96473 |
*
|
96474 |
* @see https://developer.mozilla.org/en-US/docs/Web/API/Document/caretRangeFromPoint
|
96475 |
*
|
96476 |
+
* @param {Document} doc The document of the range.
|
96477 |
+
* @param {number} x Horizontal position within the current viewport.
|
96478 |
+
* @param {number} y Vertical position within the current viewport.
|
96479 |
*
|
96480 |
* @return {?Range} The best range for the given point.
|
96481 |
*/
|
96558 |
var editableRect = container.getBoundingClientRect();
|
96559 |
var x = rect.left;
|
96560 |
var y = isReverse ? editableRect.bottom - buffer : editableRect.top + buffer;
|
96561 |
+
var ownerDocument = container.ownerDocument;
|
96562 |
+
var defaultView = ownerDocument.defaultView;
|
96563 |
+
var range = hiddenCaretRangeFromPoint(ownerDocument, x, y, container);
|
96564 |
|
96565 |
if (!range || !container.contains(range.startContainer)) {
|
96566 |
if (mayUseScroll && (!range || !range.startContainer || !range.startContainer.contains(container))) {
|
96575 |
return;
|
96576 |
}
|
96577 |
|
96578 |
+
var selection = defaultView.getSelection();
|
96579 |
selection.removeAllRanges();
|
96580 |
selection.addRange(range);
|
96581 |
container.focus(); // Editable was already focussed, it goes back to old range...
|
96596 |
*/
|
96597 |
|
96598 |
function isTextField(element) {
|
96599 |
+
var nodeName = element.nodeName,
|
96600 |
+
contentEditable = element.contentEditable;
|
96601 |
+
var nonTextInputs = ['button', 'checkbox', 'hidden', 'file', 'radio', 'image', 'range', 'reset', 'submit', 'number'];
|
96602 |
+
return nodeName === 'INPUT' && !nonTextInputs.includes(element.type) || nodeName === 'TEXTAREA' || contentEditable === 'true';
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
96603 |
}
|
96604 |
/**
|
96605 |
* Check whether the given element is an input field of type number
|
96617 |
return nodeName === 'INPUT' && type === 'number' && !!valueAsNumber;
|
96618 |
}
|
96619 |
/**
|
96620 |
+
* Check whether the current document has selected text. This applies to ranges
|
96621 |
+
* of text in the document, and not selection inside <input> and <textarea>
|
96622 |
+
* elements.
|
96623 |
+
*
|
96624 |
+
* See: https://developer.mozilla.org/en-US/docs/Web/API/Window/getSelection#Related_objects.
|
96625 |
+
*
|
96626 |
+
* @param {Document} doc The document to check.
|
96627 |
*
|
96628 |
* @return {boolean} True if there is selection, false if not.
|
96629 |
*/
|
96630 |
|
96631 |
+
function documentHasTextSelection(doc) {
|
96632 |
+
var selection = doc.defaultView.getSelection();
|
96633 |
+
var range = selection.rangeCount ? selection.getRangeAt(0) : null;
|
96634 |
+
return range && !range.collapsed;
|
96635 |
+
}
|
96636 |
+
/**
|
96637 |
+
* Check whether the given element, assumed an input field or textarea,
|
96638 |
+
* contains a (uncollapsed) selection of text.
|
96639 |
+
*
|
96640 |
+
* Note: this is perhaps an abuse of the term "selection", since these elements
|
96641 |
+
* manage selection differently and aren't covered by Selection#collapsed.
|
96642 |
+
*
|
96643 |
+
* See: https://developer.mozilla.org/en-US/docs/Web/API/Window/getSelection#Related_objects.
|
96644 |
+
*
|
96645 |
+
* @param {HTMLElement} element The HTML element.
|
96646 |
+
*
|
96647 |
+
* @return {boolean} Whether the input/textareaa element has some "selection".
|
96648 |
+
*/
|
96649 |
+
|
96650 |
+
function inputFieldHasUncollapsedSelection(element) {
|
96651 |
+
if (!isTextField(element) && !isNumberInput(element)) {
|
96652 |
+
return false;
|
96653 |
}
|
96654 |
|
96655 |
+
try {
|
96656 |
+
var selectionStart = element.selectionStart,
|
96657 |
+
selectionEnd = element.selectionEnd;
|
96658 |
+
return selectionStart !== null && selectionStart !== selectionEnd;
|
96659 |
+
} catch (error) {
|
96660 |
+
// Safari throws an exception when trying to get `selectionStart`
|
96661 |
+
// on non-text <input> elements (which, understandably, don't
|
96662 |
+
// have the text selection API). We catch this via a try/catch
|
96663 |
+
// block, as opposed to a more explicit check of the element's
|
96664 |
+
// input types, because of Safari's non-standard behavior. This
|
96665 |
+
// also means we don't have to worry about the list of input
|
96666 |
+
// types that support `selectionStart` changing as the HTML spec
|
96667 |
+
// evolves over time.
|
96668 |
+
return false;
|
96669 |
}
|
96670 |
+
}
|
96671 |
+
/**
|
96672 |
+
* Check whether the current document has any sort of selection. This includes
|
96673 |
+
* ranges of text across elements and any selection inside <input> and
|
96674 |
+
* <textarea> elements.
|
96675 |
+
*
|
96676 |
+
* @param {Document} doc The document to check.
|
96677 |
+
*
|
96678 |
+
* @return {boolean} Whether there is any sort of "selection" in the document.
|
96679 |
+
*/
|
96680 |
|
96681 |
+
|
96682 |
+
function documentHasUncollapsedSelection(doc) {
|
96683 |
+
return documentHasTextSelection(doc) || inputFieldHasUncollapsedSelection(doc.activeElement);
|
96684 |
+
}
|
96685 |
+
/**
|
96686 |
+
* Check whether the current document has a selection. This checks for both
|
96687 |
+
* focus in an input field and general text selection.
|
96688 |
+
*
|
96689 |
+
* @param {Document} doc The document to check.
|
96690 |
+
*
|
96691 |
+
* @return {boolean} True if there is selection, false if not.
|
96692 |
+
*/
|
96693 |
+
|
96694 |
+
function documentHasSelection(doc) {
|
96695 |
+
return isTextField(doc.activeElement) || isNumberInput(doc.activeElement) || documentHasTextSelection(doc);
|
96696 |
}
|
96697 |
/**
|
96698 |
* Check whether the contents of the element have been entirely selected.
|
96712 |
return true;
|
96713 |
}
|
96714 |
|
96715 |
+
var ownerDocument = element.ownerDocument;
|
96716 |
+
var defaultView = ownerDocument.defaultView;
|
96717 |
+
var selection = defaultView.getSelection();
|
96718 |
var range = selection.rangeCount ? selection.getRangeAt(0) : null;
|
96719 |
|
96720 |
if (!range) {
|
96731 |
}
|
96732 |
|
96733 |
var lastChild = element.lastChild;
|
96734 |
+
var lastChildContentLength = lastChild.nodeType === lastChild.TEXT_NODE ? lastChild.data.length : lastChild.childNodes.length;
|
96735 |
return startContainer === element.firstChild && endContainer === element.lastChild && startOffset === 0 && endOffset === lastChildContentLength;
|
96736 |
}
|
96737 |
/**
|
96750 |
|
96751 |
if (node.scrollHeight > node.clientHeight) {
|
96752 |
// ...except when overflow is defined to be hidden or visible
|
96753 |
+
var _getComputedStyle = getComputedStyle(node),
|
96754 |
+
overflowY = _getComputedStyle.overflowY;
|
96755 |
|
96756 |
if (/(auto|scroll)/.test(overflowY)) {
|
96757 |
return node;
|
96779 |
var closestElement;
|
96780 |
|
96781 |
while (closestElement = node.parentNode) {
|
96782 |
+
if (closestElement.nodeType === closestElement.ELEMENT_NODE) {
|
96783 |
break;
|
96784 |
}
|
96785 |
}
|
96886 |
*/
|
96887 |
|
96888 |
function __unstableStripHTML(html) {
|
96889 |
+
var document = new window.DOMParser().parseFromString(html, 'text/html');
|
96890 |
return document.body.textContent || '';
|
96891 |
}
|
96892 |
+
/**
|
96893 |
+
* Given a schema, unwraps or removes nodes, attributes and classes on a node
|
96894 |
+
* list.
|
96895 |
+
*
|
96896 |
+
* @param {NodeList} nodeList The nodeList to filter.
|
96897 |
+
* @param {Document} doc The document of the nodeList.
|
96898 |
+
* @param {Object} schema An array of functions that can mutate with the provided node.
|
96899 |
+
* @param {Object} inline Whether to clean for inline mode.
|
96900 |
+
*/
|
96901 |
+
|
96902 |
+
function cleanNodeList(nodeList, doc, schema, inline) {
|
96903 |
+
Array.from(nodeList).forEach(function (node) {
|
96904 |
+
var tag = node.nodeName.toLowerCase(); // It's a valid child, if the tag exists in the schema without an isMatch
|
96905 |
+
// function, or with an isMatch function that matches the node.
|
96906 |
+
|
96907 |
+
if (schema.hasOwnProperty(tag) && (!schema[tag].isMatch || schema[tag].isMatch(node))) {
|
96908 |
+
if (node.nodeType === node.ELEMENT_NODE) {
|
96909 |
+
var _schema$tag = schema[tag],
|
96910 |
+
_schema$tag$attribute = _schema$tag.attributes,
|
96911 |
+
attributes = _schema$tag$attribute === void 0 ? [] : _schema$tag$attribute,
|
96912 |
+
_schema$tag$classes = _schema$tag.classes,
|
96913 |
+
classes = _schema$tag$classes === void 0 ? [] : _schema$tag$classes,
|
96914 |
+
children = _schema$tag.children,
|
96915 |
+
_schema$tag$require = _schema$tag.require,
|
96916 |
+
require = _schema$tag$require === void 0 ? [] : _schema$tag$require,
|
96917 |
+
allowEmpty = _schema$tag.allowEmpty; // If the node is empty and it's supposed to have children,
|
96918 |
+
// remove the node.
|
96919 |
+
|
96920 |
+
|
96921 |
+
if (children && !allowEmpty && isEmpty(node)) {
|
96922 |
+
remove(node);
|
96923 |
+
return;
|
96924 |
+
}
|
96925 |
+
|
96926 |
+
if (node.hasAttributes()) {
|
96927 |
+
// Strip invalid attributes.
|
96928 |
+
Array.from(node.attributes).forEach(function (_ref) {
|
96929 |
+
var name = _ref.name;
|
96930 |
+
|
96931 |
+
if (name !== 'class' && !Object(__WEBPACK_IMPORTED_MODULE_0_lodash__["includes"])(attributes, name)) {
|
96932 |
+
node.removeAttribute(name);
|
96933 |
+
}
|
96934 |
+
}); // Strip invalid classes.
|
96935 |
+
// In jsdom-jscore, 'node.classList' can be undefined.
|
96936 |
+
// TODO: Explore patching this in jsdom-jscore.
|
96937 |
+
|
96938 |
+
if (node.classList && node.classList.length) {
|
96939 |
+
var mattchers = classes.map(function (item) {
|
96940 |
+
if (typeof item === 'string') {
|
96941 |
+
return function (className) {
|
96942 |
+
return className === item;
|
96943 |
+
};
|
96944 |
+
} else if (item instanceof RegExp) {
|
96945 |
+
return function (className) {
|
96946 |
+
return item.test(className);
|
96947 |
+
};
|
96948 |
+
}
|
96949 |
+
|
96950 |
+
return __WEBPACK_IMPORTED_MODULE_0_lodash__["noop"];
|
96951 |
+
});
|
96952 |
+
Array.from(node.classList).forEach(function (name) {
|
96953 |
+
if (!mattchers.some(function (isMatch) {
|
96954 |
+
return isMatch(name);
|
96955 |
+
})) {
|
96956 |
+
node.classList.remove(name);
|
96957 |
+
}
|
96958 |
+
});
|
96959 |
+
|
96960 |
+
if (!node.classList.length) {
|
96961 |
+
node.removeAttribute('class');
|
96962 |
+
}
|
96963 |
+
}
|
96964 |
+
}
|
96965 |
+
|
96966 |
+
if (node.hasChildNodes()) {
|
96967 |
+
// Do not filter any content.
|
96968 |
+
if (children === '*') {
|
96969 |
+
return;
|
96970 |
+
} // Continue if the node is supposed to have children.
|
96971 |
+
|
96972 |
+
|
96973 |
+
if (children) {
|
96974 |
+
// If a parent requires certain children, but it does
|
96975 |
+
// not have them, drop the parent and continue.
|
96976 |
+
if (require.length && !node.querySelector(require.join(','))) {
|
96977 |
+
cleanNodeList(node.childNodes, doc, schema, inline);
|
96978 |
+
unwrap(node); // If the node is at the top, phrasing content, and
|
96979 |
+
// contains children that are block content, unwrap
|
96980 |
+
// the node because it is invalid.
|
96981 |
+
} else if (node.parentNode.nodeName === 'BODY' && Object(__WEBPACK_IMPORTED_MODULE_1__phrasing_content__["a" /* isPhrasingContent */])(node)) {
|
96982 |
+
cleanNodeList(node.childNodes, doc, schema, inline);
|
96983 |
+
|
96984 |
+
if (Array.from(node.childNodes).some(function (child) {
|
96985 |
+
return !Object(__WEBPACK_IMPORTED_MODULE_1__phrasing_content__["a" /* isPhrasingContent */])(child);
|
96986 |
+
})) {
|
96987 |
+
unwrap(node);
|
96988 |
+
}
|
96989 |
+
} else {
|
96990 |
+
cleanNodeList(node.childNodes, doc, children, inline);
|
96991 |
+
} // Remove children if the node is not supposed to have any.
|
96992 |
+
|
96993 |
+
} else {
|
96994 |
+
while (node.firstChild) {
|
96995 |
+
remove(node.firstChild);
|
96996 |
+
}
|
96997 |
+
}
|
96998 |
+
}
|
96999 |
+
} // Invalid child. Continue with schema at the same place and unwrap.
|
97000 |
+
|
97001 |
+
} else {
|
97002 |
+
cleanNodeList(node.childNodes, doc, schema, inline); // For inline mode, insert a line break when unwrapping nodes that
|
97003 |
+
// are not phrasing content.
|
97004 |
+
|
97005 |
+
if (inline && !Object(__WEBPACK_IMPORTED_MODULE_1__phrasing_content__["a" /* isPhrasingContent */])(node) && node.nextElementSibling) {
|
97006 |
+
insertAfter(doc.createElement('br'), node);
|
97007 |
+
}
|
97008 |
+
|
97009 |
+
unwrap(node);
|
97010 |
+
}
|
97011 |
+
});
|
97012 |
+
}
|
97013 |
+
/**
|
97014 |
+
* Recursively checks if an element is empty. An element is not empty if it
|
97015 |
+
* contains text or contains elements with attributes such as images.
|
97016 |
+
*
|
97017 |
+
* @param {Element} element The element to check.
|
97018 |
+
*
|
97019 |
+
* @return {boolean} Wether or not the element is empty.
|
97020 |
+
*/
|
97021 |
+
|
97022 |
+
|
97023 |
+
function isEmpty(element) {
|
97024 |
+
if (!element.hasChildNodes()) {
|
97025 |
+
return true;
|
97026 |
+
}
|
97027 |
+
|
97028 |
+
return Array.from(element.childNodes).every(function (node) {
|
97029 |
+
if (node.nodeType === node.TEXT_NODE) {
|
97030 |
+
return !node.nodeValue.trim();
|
97031 |
+
}
|
97032 |
+
|
97033 |
+
if (node.nodeType === node.ELEMENT_NODE) {
|
97034 |
+
if (node.nodeName === 'BR') {
|
97035 |
+
return true;
|
97036 |
+
} else if (node.hasAttributes()) {
|
97037 |
+
return false;
|
97038 |
+
}
|
97039 |
+
|
97040 |
+
return isEmpty(node);
|
97041 |
+
}
|
97042 |
+
|
97043 |
+
return true;
|
97044 |
+
});
|
97045 |
+
}
|
97046 |
+
/**
|
97047 |
+
* Given a schema, unwraps or removes nodes, attributes and classes on HTML.
|
97048 |
+
*
|
97049 |
+
* @param {string} HTML The HTML to clean up.
|
97050 |
+
* @param {Object} schema Schema for the HTML.
|
97051 |
+
* @param {Object} inline Whether to clean for inline mode.
|
97052 |
+
*
|
97053 |
+
* @return {string} The cleaned up HTML.
|
97054 |
+
*/
|
97055 |
+
|
97056 |
+
function removeInvalidHTML(HTML, schema, inline) {
|
97057 |
+
var doc = document.implementation.createHTMLDocument('');
|
97058 |
+
doc.body.innerHTML = HTML;
|
97059 |
+
cleanNodeList(doc.body.childNodes, doc, schema, inline);
|
97060 |
+
return doc.body.innerHTML;
|
97061 |
+
}
|
97062 |
//# sourceMappingURL=dom.js.map
|
97063 |
|
97064 |
/***/ }),
|
97065 |
+
/* 606 */
|
97066 |
/***/ (function(module, exports, __webpack_require__) {
|
97067 |
|
97068 |
"use strict";
|
97120 |
|
97121 |
|
97122 |
/***/ }),
|
97123 |
+
/* 607 */
|
97124 |
/***/ (function(module, exports, __webpack_require__) {
|
97125 |
|
97126 |
"use strict";
|
97158 |
|
97159 |
|
97160 |
/***/ }),
|
97161 |
+
/* 608 */
|
97162 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
97163 |
|
97164 |
"use strict";
|
97165 |
/* unused harmony export computePopoverXAxisPosition */
|
97166 |
/* unused harmony export computePopoverYAxisPosition */
|
97167 |
/* harmony export (immutable) */ __webpack_exports__["a"] = computePopoverPosition;
|
97168 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_objectSpread__ = __webpack_require__(23);
|
97169 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_slicedToArray__ = __webpack_require__(27);
|
97170 |
|
97171 |
|
97172 |
|
97331 |
//# sourceMappingURL=utils.js.map
|
97332 |
|
97333 |
/***/ }),
|
97334 |
+
/* 609 */
|
97335 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
97336 |
|
97337 |
"use strict";
|
97340 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
97341 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
97342 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
97343 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_react_click_outside__ = __webpack_require__(195);
|
97344 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5_react_click_outside___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_5_react_click_outside__);
|
97345 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_element__ = __webpack_require__(1);
|
97346 |
|
97393 |
//# sourceMappingURL=detect-outside.js.map
|
97394 |
|
97395 |
/***/ }),
|
97396 |
+
/* 610 */
|
97397 |
/***/ (function(module, exports, __webpack_require__) {
|
97398 |
|
97399 |
"use strict";
|
97464 |
return targetComponent;
|
97465 |
}
|
97466 |
|
97467 |
+
module.exports = hoistNonReactStatics;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
97468 |
|
|
|
|
|
97469 |
|
97470 |
/***/ }),
|
97471 |
+
/* 611 */
|
97472 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
97473 |
|
97474 |
"use strict";
|
97475 |
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
97476 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
97477 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
97478 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
97479 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
97480 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
97481 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__ = __webpack_require__(10);
|
97482 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7__wordpress_element__ = __webpack_require__(1);
|
97483 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash__ = __webpack_require__(2);
|
97484 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_8_lodash__);
|
97485 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_9__context__ = __webpack_require__(120);
|
|
|
|
|
|
|
|
|
|
|
97486 |
|
97487 |
|
97488 |
|
97496 |
* External dependencies
|
97497 |
*/
|
97498 |
|
|
|
97499 |
/**
|
97500 |
* WordPress dependencies
|
97501 |
*/
|
97507 |
|
97508 |
|
97509 |
|
97510 |
+
var SlotComponent =
|
|
|
97511 |
/*#__PURE__*/
|
97512 |
function (_Component) {
|
97513 |
+
Object(__WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__["a" /* default */])(SlotComponent, _Component);
|
97514 |
|
97515 |
+
function SlotComponent() {
|
97516 |
var _this;
|
97517 |
|
97518 |
+
Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__["a" /* default */])(this, SlotComponent);
|
97519 |
|
97520 |
+
_this = Object(__WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__["a" /* default */])(this, Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(SlotComponent).apply(this, arguments));
|
97521 |
+
_this.bindNode = _this.bindNode.bind(Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(Object(__WEBPACK_IMPORTED_MODULE_6__babel_runtime_helpers_esm_assertThisInitialized__["a" /* default */])(_this)));
|
|
|
|
|
97522 |
return _this;
|
97523 |
}
|
97524 |
|
97525 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__["a" /* default */])(SlotComponent, [{
|
97526 |
key: "componentDidMount",
|
97527 |
value: function componentDidMount() {
|
97528 |
+
var registerSlot = this.props.registerSlot;
|
97529 |
+
registerSlot(this.props.name, this);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
97530 |
}
|
97531 |
}, {
|
97532 |
key: "componentWillUnmount",
|
97533 |
value: function componentWillUnmount() {
|
97534 |
+
var unregisterSlot = this.props.unregisterSlot;
|
97535 |
+
unregisterSlot(this.props.name, this);
|
|
|
|
|
|
|
|
|
|
|
|
|
97536 |
}
|
97537 |
}, {
|
97538 |
+
key: "componentDidUpdate",
|
97539 |
+
value: function componentDidUpdate(prevProps) {
|
|
|
|
|
|
|
|
|
97540 |
var _this$props = this.props,
|
97541 |
+
name = _this$props.name,
|
97542 |
+
unregisterSlot = _this$props.unregisterSlot,
|
97543 |
+
registerSlot = _this$props.registerSlot;
|
|
|
|
|
|
|
|
|
|
|
97544 |
|
97545 |
+
if (prevProps.name !== name) {
|
97546 |
+
unregisterSlot(prevProps.name);
|
97547 |
+
registerSlot(name, this);
|
|
|
97548 |
}
|
97549 |
}
|
97550 |
}, {
|
97551 |
+
key: "bindNode",
|
97552 |
+
value: function bindNode(node) {
|
97553 |
+
this.node = node;
|
|
|
|
|
|
|
|
|
|
|
|
|
97554 |
}
|
97555 |
}, {
|
97556 |
key: "render",
|
97557 |
value: function render() {
|
|
|
|
|
97558 |
var _this$props2 = this.props,
|
|
|
97559 |
children = _this$props2.children,
|
97560 |
+
name = _this$props2.name,
|
97561 |
+
_this$props2$bubblesV = _this$props2.bubblesVirtually,
|
97562 |
+
bubblesVirtually = _this$props2$bubblesV === void 0 ? false : _this$props2$bubblesV,
|
97563 |
+
_this$props2$fillProp = _this$props2.fillProps,
|
97564 |
+
fillProps = _this$props2$fillProp === void 0 ? {} : _this$props2$fillProp,
|
97565 |
+
getFills = _this$props2.getFills;
|
97566 |
|
97567 |
+
if (bubblesVirtually) {
|
97568 |
+
return Object(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["h" /* createElement */])("div", {
|
97569 |
+
ref: this.bindNode
|
97570 |
+
});
|
97571 |
+
}
|
|
|
|
|
97572 |
|
97573 |
+
var fills = Object(__WEBPACK_IMPORTED_MODULE_8_lodash__["map"])(getFills(name), function (fill) {
|
97574 |
+
var fillKey = fill.occurrence;
|
97575 |
+
var fillChildren = Object(__WEBPACK_IMPORTED_MODULE_8_lodash__["isFunction"])(fill.props.children) ? fill.props.children(fillProps) : fill.props.children;
|
97576 |
+
return __WEBPACK_IMPORTED_MODULE_7__wordpress_element__["a" /* Children */].map(fillChildren, function (child, childIndex) {
|
97577 |
+
if (!child || Object(__WEBPACK_IMPORTED_MODULE_8_lodash__["isString"])(child)) {
|
97578 |
+
return child;
|
97579 |
+
}
|
97580 |
|
97581 |
+
var childKey = "".concat(fillKey, "---").concat(child.key || childIndex);
|
97582 |
+
return Object(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["e" /* cloneElement */])(child, {
|
97583 |
+
key: childKey
|
97584 |
+
});
|
97585 |
+
});
|
97586 |
+
}).filter( // In some cases fills are rendered only when some conditions apply.
|
97587 |
+
// This ensures that we only use non-empty fills when rendering, i.e.,
|
97588 |
+
// it allows us to render wrappers only when the fills are actually present.
|
97589 |
+
Object(__WEBPACK_IMPORTED_MODULE_8_lodash__["negate"])(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["l" /* isEmptyElement */]));
|
97590 |
+
return Object(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["h" /* createElement */])(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["c" /* Fragment */], null, Object(__WEBPACK_IMPORTED_MODULE_8_lodash__["isFunction"])(children) ? children(fills) : fills);
|
97591 |
}
|
97592 |
}]);
|
97593 |
|
97594 |
+
return SlotComponent;
|
97595 |
+
}(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["b" /* Component */]);
|
97596 |
|
97597 |
+
var Slot = function Slot(props) {
|
97598 |
+
return Object(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["h" /* createElement */])(__WEBPACK_IMPORTED_MODULE_9__context__["a" /* Consumer */], null, function (_ref) {
|
97599 |
+
var registerSlot = _ref.registerSlot,
|
97600 |
+
unregisterSlot = _ref.unregisterSlot,
|
97601 |
+
getFills = _ref.getFills;
|
97602 |
+
return Object(__WEBPACK_IMPORTED_MODULE_7__wordpress_element__["h" /* createElement */])(SlotComponent, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__["a" /* default */])({}, props, {
|
97603 |
+
registerSlot: registerSlot,
|
97604 |
+
unregisterSlot: unregisterSlot,
|
97605 |
+
getFills: getFills
|
97606 |
+
}));
|
97607 |
+
});
|
97608 |
+
};
|
97609 |
|
97610 |
+
/* harmony default export */ __webpack_exports__["a"] = (Slot);
|
97611 |
+
//# sourceMappingURL=slot.js.map
|
|
|
97612 |
|
97613 |
+
/***/ }),
|
97614 |
+
/* 612 */
|
97615 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
97616 |
|
97617 |
+
"use strict";
|
97618 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__ = __webpack_require__(8);
|
97619 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__ = __webpack_require__(3);
|
97620 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__ = __webpack_require__(4);
|
97621 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__ = __webpack_require__(5);
|
97622 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__ = __webpack_require__(6);
|
97623 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__ = __webpack_require__(7);
|
97624 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__wordpress_element__ = __webpack_require__(1);
|
97625 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_lodash__ = __webpack_require__(2);
|
97626 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_7_lodash___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_7_lodash__);
|
97627 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_8__context__ = __webpack_require__(120);
|
97628 |
|
|
|
|
|
97629 |
|
|
|
|
|
|
|
|
|
97630 |
|
|
|
|
|
|
|
97631 |
|
|
|
|
|
97632 |
|
|
|
|
|
|
|
97633 |
|
|
|
|
|
|
|
|
|
|
|
|
|
97634 |
|
|
|
|
|
97635 |
|
97636 |
+
/**
|
97637 |
+
* External dependencies
|
97638 |
+
*/
|
97639 |
|
97640 |
+
/**
|
97641 |
+
* WordPress dependencies
|
97642 |
+
*/
|
97643 |
|
|
|
|
|
97644 |
|
97645 |
+
/**
|
97646 |
+
* Internal dependencies
|
97647 |
+
*/
|
97648 |
|
97649 |
|
97650 |
+
var occurrences = 0;
|
|
|
|
|
97651 |
|
97652 |
+
var FillComponent =
|
97653 |
+
/*#__PURE__*/
|
97654 |
+
function (_Component) {
|
97655 |
+
Object(__WEBPACK_IMPORTED_MODULE_5__babel_runtime_helpers_esm_inherits__["a" /* default */])(FillComponent, _Component);
|
97656 |
|
97657 |
+
function FillComponent() {
|
97658 |
+
var _this;
|
|
|
97659 |
|
97660 |
+
Object(__WEBPACK_IMPORTED_MODULE_1__babel_runtime_helpers_esm_classCallCheck__["a" /* default */])(this, FillComponent);
|
|
|
|
|
|
|
97661 |
|
97662 |
+
_this = Object(__WEBPACK_IMPORTED_MODULE_3__babel_runtime_helpers_esm_possibleConstructorReturn__["a" /* default */])(this, Object(__WEBPACK_IMPORTED_MODULE_4__babel_runtime_helpers_esm_getPrototypeOf__["a" /* default */])(FillComponent).apply(this, arguments));
|
97663 |
+
_this.occurrence = ++occurrences;
|
97664 |
+
return _this;
|
97665 |
+
}
|
97666 |
|
97667 |
+
Object(__WEBPACK_IMPORTED_MODULE_2__babel_runtime_helpers_esm_createClass__["a" /* default */])(FillComponent, [{
|
97668 |
+
key: "componentDidMount",
|
97669 |
+
value: function componentDidMount() {
|
97670 |
+
var registerFill = this.props.registerFill;
|
97671 |
+
registerFill(this.props.name, this);
|
97672 |
+
}
|
97673 |
+
}, {
|
97674 |
+
key: "componentWillUpdate",
|
97675 |
+
value: function componentWillUpdate() {
|
97676 |
+
if (!this.occurrence) {
|
97677 |
+
this.occurrence = ++occurrences;
|
97678 |
+
}
|
97679 |
|
97680 |
+
var getSlot = this.props.getSlot;
|
97681 |
+
var slot = getSlot(this.props.name);
|
|
|
97682 |
|
97683 |
+
if (slot && !slot.props.bubblesVirtually) {
|
97684 |
+
slot.forceUpdate();
|
97685 |
+
}
|
97686 |
+
}
|
97687 |
+
}, {
|
97688 |
+
key: "componentWillUnmount",
|
97689 |
+
value: function componentWillUnmount() {
|
97690 |
+
var unregisterFill = this.props.unregisterFill;
|
97691 |
+
unregisterFill(this.props.name, this);
|
97692 |
+
}
|
97693 |
+
}, {
|
97694 |
+
key: "componentDidUpdate",
|
97695 |
+
value: function componentDidUpdate(prevProps) {
|
97696 |
+
var _this$props = this.props,
|
97697 |
+
name = _this$props.name,
|
97698 |
+
unregisterFill = _this$props.unregisterFill,
|
97699 |
+
registerFill = _this$props.registerFill;
|
97700 |
|
97701 |
+
if (prevProps.name !== name) {
|
97702 |
+
unregisterFill(prevProps.name, this);
|
97703 |
+
registerFill(name, this);
|
97704 |
+
}
|
97705 |
+
}
|
97706 |
+
}, {
|
97707 |
+
key: "resetOccurrence",
|
97708 |
+
value: function resetOccurrence() {
|
97709 |
+
this.occurrence = null;
|
97710 |
}
|
97711 |
+
}, {
|
97712 |
+
key: "render",
|
97713 |
+
value: function render() {
|
97714 |
+
var _this$props2 = this.props,
|
97715 |
+
name = _this$props2.name,
|
97716 |
+
getSlot = _this$props2.getSlot;
|
97717 |
+
var children = this.props.children;
|
97718 |
+
var slot = getSlot(name);
|
97719 |
|
97720 |
+
if (!slot || !slot.props.bubblesVirtually) {
|
97721 |
+
return null;
|
97722 |
+
} // If a function is passed as a child, provide it with the fillProps.
|
97723 |
|
|
|
|
|
|
|
|
|
97724 |
|
97725 |
+
if (Object(__WEBPACK_IMPORTED_MODULE_7_lodash__["isFunction"])(children)) {
|
97726 |
+
children = children(slot.props.fillProps);
|
|
|
|
|
97727 |
}
|
|
|
97728 |
|
97729 |
+
return Object(__WEBPACK_IMPORTED_MODULE_6__wordpress_element__["i" /* createPortal */])(children, slot.node);
|
97730 |
+
}
|
97731 |
+
}]);
|
97732 |
|
97733 |
+
return FillComponent;
|
97734 |
+
}(__WEBPACK_IMPORTED_MODULE_6__wordpress_element__["b" /* Component */]);
|
|
|
97735 |
|
97736 |
+
var Fill = function Fill(props) {
|
97737 |
+
return Object(__WEBPACK_IMPORTED_MODULE_6__wordpress_element__["h" /* createElement */])(__WEBPACK_IMPORTED_MODULE_8__context__["a" /* Consumer */], null, function (_ref) {
|
97738 |
+
var getSlot = _ref.getSlot,
|
97739 |
+
registerFill = _ref.registerFill,
|
97740 |
+
unregisterFill = _ref.unregisterFill;
|
97741 |
+
return Object(__WEBPACK_IMPORTED_MODULE_6__wordpress_element__["h" /* createElement */])(FillComponent, Object(__WEBPACK_IMPORTED_MODULE_0__babel_runtime_helpers_esm_extends__["a" /* default */])({}, props, {
|
97742 |
+
getSlot: getSlot,
|
97743 |
+
registerFill: registerFill,
|
97744 |
+
unregisterFill: unregisterFill
|
97745 |
+
}));
|
97746 |
+
});
|
97747 |
};
|
97748 |
|
97749 |
+
/* harmony default export */ __webpack_exports__["a"] = (Fill);
|
97750 |
+
//# sourceMappingURL=fill.js.map
|
97751 |
+
|
97752 |
+
/***/ }),
|
97753 |
+
/* 613 */
|
97754 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
97755 |
+
|
97756 |
+
"use strict";
|
97757 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = domReady;
|
97758 |
+
/**
|
97759 |
+
* @typedef {() => void} Callback
|
97760 |
+
*
|
97761 |
+
* TODO: Remove this typedef and inline `() => void` type.
|
97762 |
+
*
|
97763 |
+
* This typedef is used so that a descriptive type is provided in our
|
97764 |
+
* automatically generated documentation.
|
97765 |
+
*
|
97766 |
+
* An in-line type `() => void` would be preferable, but the generated
|
97767 |
+
* documentation is `null` in that case.
|
97768 |
+
*
|
97769 |
+
* @see https://github.com/WordPress/gutenberg/issues/18045
|
97770 |
+
*/
|
97771 |
+
|
97772 |
+
/**
|
97773 |
+
* Specify a function to execute when the DOM is fully loaded.
|
97774 |
+
*
|
97775 |
+
* @param {Callback} callback A function to execute after the DOM is ready.
|
97776 |
+
*
|
97777 |
+
* @example
|
97778 |
+
* ```js
|
97779 |
+
* import domReady from '@wordpress/dom-ready';
|
97780 |
+
*
|
97781 |
+
* domReady( function() {
|
97782 |
+
* //do something after DOM loads.
|
97783 |
+
* } );
|
97784 |
+
* ```
|
97785 |
+
*
|
97786 |
+
* @return {void}
|
97787 |
+
*/
|
97788 |
+
function domReady(callback) {
|
97789 |
+
if (document.readyState === 'complete' || // DOMContentLoaded + Images/Styles/etc loaded, so we call directly.
|
97790 |
+
document.readyState === 'interactive' // DOMContentLoaded fires at this point, so we call directly.
|
97791 |
+
) {
|
97792 |
+
return void callback();
|
97793 |
+
} // DOMContentLoaded has not fired yet, delay callback until then.
|
97794 |
|
97795 |
|
97796 |
+
document.addEventListener('DOMContentLoaded', callback);
|
97797 |
+
}
|
97798 |
+
//# sourceMappingURL=index.js.map
|
97799 |
+
|
97800 |
/***/ }),
|
97801 |
+
/* 614 */
|
97802 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
97803 |
|
97804 |
+
"use strict";
|
97805 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = addIntroText;
|
97806 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__wordpress_i18n__ = __webpack_require__(615);
|
97807 |
+
/**
|
97808 |
+
* WordPress dependencies
|
97809 |
+
*/
|
97810 |
|
97811 |
/**
|
97812 |
+
* Build the explanatory text to be placed before the aria live regions.
|
|
|
97813 |
*
|
97814 |
+
* This text is initially hidden from assistive technologies by using a `hidden`
|
97815 |
+
* HTML attribute which is then removed once a message fills the aria-live regions.
|
97816 |
+
*
|
97817 |
+
* @return {HTMLParagraphElement} The explanatory text HTML element.
|
97818 |
*/
|
|
|
|
|
|
|
|
|
97819 |
|
97820 |
+
function addIntroText() {
|
97821 |
+
var introText = document.createElement('p');
|
97822 |
+
introText.id = 'a11y-speak-intro-text';
|
97823 |
+
introText.className = 'a11y-speak-intro-text';
|
97824 |
+
introText.textContent = Object(__WEBPACK_IMPORTED_MODULE_0__wordpress_i18n__["a" /* __ */])('Notifications');
|
97825 |
+
introText.setAttribute('style', 'position: absolute;' + 'margin: -1px;' + 'padding: 0;' + 'height: 1px;' + 'width: 1px;' + 'overflow: hidden;' + 'clip: rect(1px, 1px, 1px, 1px);' + '-webkit-clip-path: inset(50%);' + 'clip-path: inset(50%);' + 'border: 0;' + 'word-wrap: normal !important;');
|
97826 |
+
introText.setAttribute('hidden', 'hidden');
|
97827 |
+
var _document = document,
|
97828 |
+
body = _document.body;
|
97829 |
|
97830 |
+
if (body) {
|
97831 |
+
body.appendChild(introText);
|
97832 |
+
}
|
97833 |
|
97834 |
+
return introText;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
97835 |
}
|
97836 |
+
//# sourceMappingURL=add-intro-text.js.map
|
97837 |
+
|
97838 |
+
/***/ }),
|
97839 |
+
/* 615 */
|
97840 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
97841 |
+
|
97842 |
+
"use strict";
|
97843 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__sprintf__ = __webpack_require__(616);
|
97844 |
+
/* unused harmony reexport sprintf */
|
97845 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__create_i18n__ = __webpack_require__(200);
|
97846 |
+
/* unused harmony namespace reexport */
|
97847 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__default_i18n__ = __webpack_require__(617);
|
97848 |
+
/* unused harmony reexport setLocaleData */
|
97849 |
+
/* harmony reexport (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __WEBPACK_IMPORTED_MODULE_2__default_i18n__["a"]; });
|
97850 |
+
/* unused harmony reexport _x */
|
97851 |
+
/* unused harmony reexport _n */
|
97852 |
+
/* unused harmony reexport _nx */
|
97853 |
+
/* unused harmony reexport isRTL */
|
97854 |
+
|
97855 |
+
|
97856 |
+
|
97857 |
+
//# sourceMappingURL=index.js.map
|
97858 |
+
|
97859 |
+
/***/ }),
|
97860 |
+
/* 616 */
|
97861 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
97862 |
|
97863 |
+
"use strict";
|
97864 |
+
/* unused harmony export sprintf */
|
97865 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_memize__ = __webpack_require__(64);
|
97866 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_memize___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_memize__);
|
97867 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_sprintf_js__ = __webpack_require__(79);
|
97868 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1_sprintf_js___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_sprintf_js__);
|
97869 |
/**
|
97870 |
+
* External dependencies
|
|
|
|
|
|
|
|
|
|
|
|
|
97871 |
*/
|
|
|
|
|
97872 |
|
|
|
|
|
|
|
|
|
|
|
|
|
97873 |
|
97874 |
/**
|
97875 |
+
* Log to console, once per message; or more precisely, per referentially equal
|
97876 |
+
* argument set. Because Jed throws errors, we log these to the console instead
|
97877 |
+
* to avoid crashing the application.
|
97878 |
*
|
97879 |
+
* @param {...*} args Arguments to pass to `console.error`
|
|
|
|
|
|
|
97880 |
*/
|
|
|
|
|
|
|
|
|
97881 |
|
97882 |
+
var logErrorOnce = __WEBPACK_IMPORTED_MODULE_0_memize___default()(console.error); // eslint-disable-line no-console
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
97883 |
|
97884 |
/**
|
97885 |
+
* Returns a formatted string. If an error occurs in applying the format, the
|
97886 |
+
* original format string is returned.
|
97887 |
*
|
97888 |
+
* @param {string} format The format of the string to generate.
|
97889 |
+
* @param {...*} args Arguments to apply to the format.
|
97890 |
+
*
|
97891 |
+
* @see http://www.diveintojavascript.com/projects/javascript-sprintf
|
97892 |
+
*
|
97893 |
+
* @return {string} The formatted string.
|
97894 |
*/
|
|
|
|
|
|
|
97895 |
|
97896 |
+
function sprintf(format) {
|
97897 |
+
try {
|
97898 |
+
for (var _len = arguments.length, args = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
|
97899 |
+
args[_key - 1] = arguments[_key];
|
97900 |
+
}
|
97901 |
|
97902 |
+
return __WEBPACK_IMPORTED_MODULE_1_sprintf_js___default.a.sprintf.apply(__WEBPACK_IMPORTED_MODULE_1_sprintf_js___default.a, [format].concat(args));
|
97903 |
+
} catch (error) {
|
97904 |
+
logErrorOnce('sprintf error: \n\n' + error.toString());
|
97905 |
+
return format;
|
97906 |
+
}
|
97907 |
+
}
|
97908 |
+
//# sourceMappingURL=sprintf.js.map
|
97909 |
|
97910 |
/***/ }),
|
97911 |
+
/* 617 */
|
97912 |
+
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
97913 |
|
97914 |
+
"use strict";
|
97915 |
+
/* unused harmony export setLocaleData */
|
97916 |
+
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return __; });
|
97917 |
+
/* unused harmony export _x */
|
97918 |
+
/* unused harmony export _n */
|
97919 |
+
/* unused harmony export _nx */
|
97920 |
+
/* unused harmony export isRTL */
|
97921 |
+
/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__create_i18n__ = __webpack_require__(200);
|
97922 |
/**
|
97923 |
+
* Internal dependencies
|
|
|
|
|
|
|
97924 |
*/
|
|
|
|
|
|
|
|
|
|
|
97925 |
|
97926 |
+
var i18n = Object(__WEBPACK_IMPORTED_MODULE_0__create_i18n__["a" /* createI18n */])();
|
97927 |
+
/*
|
97928 |
+
* Comments in this file are duplicated from ./i18n due to
|
97929 |
+
* https://github.com/WordPress/gutenberg/pull/20318#issuecomment-590837722
|
|
|
97930 |
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
97931 |
|
97932 |
/**
|
97933 |
+
* @typedef {import('./create-i18n').LocaleData} LocaleData
|
|
|
|
|
|
|
97934 |
*/
|
|
|
|
|
|
|
|
|
97935 |
|
97936 |
/**
|
97937 |
+
* Merges locale data into the Tannin instance by domain. Accepts data in a
|
97938 |
+
* Jed-formatted JSON object shape.
|
97939 |
*
|
97940 |
+
* @see http://messageformat.github.io/Jed/
|
97941 |
+
*
|
97942 |
+
* @param {LocaleData} [data] Locale data configuration.
|
97943 |
+
* @param {string} [domain] Domain for which configuration applies.
|
97944 |
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
97945 |
|
97946 |
+
var setLocaleData = i18n.setLocaleData.bind(i18n);
|
97947 |
/**
|
97948 |
+
* Retrieve the translation of text.
|
97949 |
*
|
97950 |
+
* @see https://developer.wordpress.org/reference/functions/__/
|
97951 |
+
*
|
97952 |
+
* @param {string} text Text to translate.
|
97953 |
+
* @param {string} [domain] Domain to retrieve the translated text.
|
97954 |
+
*
|
97955 |
+
* @return {string} Translated text.
|
97956 |
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
97957 |
|
97958 |
+
var __ = i18n.__.bind(i18n);
|
97959 |
/**
|
97960 |
+
* Retrieve translated string with gettext context.
|
97961 |
*
|
97962 |
+
* @see https://developer.wordpress.org/reference/functions/_x/
|
97963 |
+
*
|
97964 |
+
* @param {string} text Text to translate.
|
97965 |
+
* @param {string} context Context information for the translators.
|
97966 |
+
* @param {string} [domain] Domain to retrieve the translated text.
|
97967 |
+
*
|
97968 |
+
* @return {string} Translated context string without pipe.
|
97969 |
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
97970 |
|
97971 |
+
var _x = i18n._x.bind(i18n);
|
97972 |
/**
|
97973 |
+
* Translates and retrieves the singular or plural form based on the supplied
|
97974 |
+
* number.
|
97975 |
*
|
97976 |
+
* @see https://developer.wordpress.org/reference/functions/_n/
|
97977 |
+
*
|
97978 |
+
* @param {string} single The text to be used if the number is singular.
|
97979 |
+
* @param {string} plural The text to be used if the number is plural.
|
97980 |
+
* @param {number} number The number to compare against to use either the
|
97981 |
+
* singular or plural form.
|
97982 |
+
* @param {string} [domain] Domain to retrieve the translated text.
|
97983 |
+
*
|
97984 |
+
* @return {string} The translated singular or plural form.
|
97985 |
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
97986 |
|
97987 |
+
var _n = i18n._n.bind(i18n);
|
97988 |
/**
|
97989 |
+
* Translates and retrieves the singular or plural form based on the supplied
|
97990 |
+
* number, with gettext context.
|
97991 |
+
*
|
97992 |
+
* @see https://developer.wordpress.org/reference/functions/_nx/
|
97993 |
+
*
|
97994 |
+
* @param {string} single The text to be used if the number is singular.
|
97995 |
+
* @param {string} plural The text to be used if the number is plural.
|
97996 |
+
* @param {number} number The number to compare against to use either the
|
97997 |
+
* singular or plural form.
|
97998 |
+
* @param {string} context Context information for the translators.
|
97999 |
+
* @param {string} [domain] Domain to retrieve the translated text.
|
98000 |
+
*
|
98001 |
+
* @return {string} The translated singular or plural form.
|
98002 |
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
98003 |
|
98004 |
+
var _nx = i18n._nx.bind(i18n);
|
98005 |
/**
|
98006 |
+
* Check if current locale is RTL.
|
98007 |
*
|
98008 |
+
* **RTL (Right To Left)** is a locale property indicating that text is written from right to left.
|
98009 |
+
* For example, the `he` locale (for Hebrew) specifies right-to-left. Arabic (ar) is another common
|
98010 |
+
* language written RTL. The opposite of RTL, LTR (Left To Right) is used in other languages,
|
98011 |
+
* including English (`en`, `en-US`, `en-GB`, etc.), Spanish (`es`), and French (`fr`).
|
98012 |
+
*
|
98013 |
+
* @return {boolean} Whether locale is RTL.
|
98014 |
*/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
98015 |
|
98016 |
+
var isRTL = i18n.isRTL.bind(i18n);
|
98017 |
+
//# sourceMappingURL=default-i18n.js.map
|
98018 |
|
98019 |
/***/ }),
|
98020 |
+
/* 618 */
|
98021 |
/***/ (function(module, __webpack_exports__, __webpack_require__) {
|
98022 |
|
98023 |
"use strict";
|
98024 |
+
/* harmony export (immutable) */ __webpack_exports__["a"] = addContainer;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
98025 |
/**
|
98026 |
+
* Build the live regions markup.
|
98027 |
+
*
|
98028 |
+
* @param {string} [ariaLive] Value for the 'aria-live' attribute; default: 'polite'.
|
98029 |
+
*
|
98030 |
+
* @return {HTMLDivElement} The ARIA live region HTML element.
|
98031 |
*/
|
98032 |
+
function addContainer() {
|
98033 |
+
var ariaLive = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 'polite';
|
98034 |
+
var container = document.createElement('div');
|
98035 |
+
container.id = "a11y-speak-".concat(ariaLive);
|
98036 |
+
container.className = 'a11y-speak-region';
|
98037 |
+
container.setAttribute('style', 'position: absolute;' + 'margin: -1px;' + 'padding: 0;' + 'height: 1px;' + 'width: 1px;' + 'overflow: hidden;' + 'clip: rect(1px, 1px, 1px, 1px);' + '-webkit-clip-path: inset(50%);' + 'clip-path: inset(50%);' + 'border: 0;' + 'word-wrap: normal !important;');
|
98038 |
+
container.setAttribute('aria-live', ariaLive);
|
98039 |
+
container.setAttribute('aria-relevant', 'additions text');
|
98040 |
+
container.setAttribute('aria-atomic', 'true');
|
98041 |
+
var _document = document,
|
98042 |
+
body = _document.body;
|
98043 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|