Version Description
- Updated screenshots
Download this release
Release Info
| Developer | shareaholic |
| Plugin |  WordPress Social Tools, Related Posts, Monetization – Shareaholic |
| Version | 6.0.0.3 |
| Comparing to | |
| See all releases | |
Code changes from version 5.0.0.0 to 6.0.0.3
- css/admin-style.css +355 -0
- css/bootstrap/bootstrap.min.css +588 -0
- css/comfeed.css +2 -0
- css/ie7-admin-style.css +20 -0
- css/reveal/modal-gloss.png +0 -0
- css/reveal/reveal.css +81 -0
- css/shareaholic-promo.css +15 -0
- css/style.css +1 -0
- css/style.dev.css +200 -0
- images/cbm.png +0 -0
- images/chart.png +0 -0
- images/circle_green.png +0 -0
- images/circle_grey.png +0 -0
- images/circle_red.png +0 -0
- images/circle_yellow.png +0 -0
- images/classicbookmark_16x16.png +0 -0
- images/classicbookmark_32x32.png +0 -0
- images/colorpicker_images/blank.gif +0 -0
- images/colorpicker_images/colorpicker_background.png +0 -0
- images/colorpicker_images/colorpicker_hex.png +0 -0
- images/colorpicker_images/colorpicker_hsb_b.png +0 -0
- images/colorpicker_images/colorpicker_hsb_h.png +0 -0
- images/colorpicker_images/colorpicker_hsb_s.png +0 -0
- images/colorpicker_images/colorpicker_indic.gif +0 -0
- images/colorpicker_images/colorpicker_overlay.png +0 -0
- images/colorpicker_images/colorpicker_rgb_b.png +0 -0
- images/colorpicker_images/colorpicker_rgb_g.png +0 -0
- images/colorpicker_images/colorpicker_rgb_r.png +0 -0
- images/colorpicker_images/colorpicker_select.gif +0 -0
- images/colorpicker_images/colorpicker_submit.png +0 -0
- images/colorpicker_images/select2.png +0 -0
- images/colorpicker_images/slider.png +0 -0
- images/comfeed.png +0 -0
- images/custom-fugue-sprite.png +0 -0
- images/error-delete.jpg +0 -0
- images/fbplusone.png +0 -0
- images/flo-head.jpg +0 -0
- images/ga-icon.png +0 -0
- images/glyphicons-halflings-white.png +0 -0
- images/glyphicons-halflings.png +0 -0
- images/googleplus.png +0 -0
- images/green-grad.png +0 -0
- images/information-delete.jpg +0 -0
- images/key.png +0 -0
- images/line-chart.png +0 -0
- images/new_badge.png +0 -0
- images/orange_arrow.gif +0 -0
- images/pinterest.png +0 -0
- images/red-grad.png +0 -0
- images/sbm.png +0 -0
- images/share-enjoy.png +0 -0
- images/share-german.png +0 -0
- images/share-knowledge.png +0 -0
- images/share-love-hearts.png +0 -0
- images/share-wealth.png +0 -0
- images/shareaholic-220.png +0 -0
- images/shareaholic_16x16.png +0 -0
- images/shareaholicmail.png +0 -0
- images/sharing-caring-hearts.png +0 -0
- images/sharing-caring.png +0 -0
- images/sharing-shr.png +0 -0
- images/shr-sprite.png +0 -0
- images/shrsb-logo.png +0 -0
- images/success-delete.jpg +0 -0
- images/thumbs-icon.png +0 -0
- images/thumbs.png +0 -0
- images/tophat.jpg +0 -0
- images/tweeth.png +0 -0
- images/tweetn.png +0 -0
- images/tweetv.png +0 -0
- images/twitter-16x16.png +0 -0
- images/warning-big.png +0 -0
- images/warning-delete.jpg +0 -0
- images/white-pix.jpg +0 -0
- includes/JSON.php +804 -0
- includes/bookmarks-data.php +452 -0
- includes/helper-functions.php +149 -0
- includes/html-helpers.php +176 -0
- includes/index.php +4 -0
- includes/mobile.php +89 -0
- includes/public.php +1279 -0
- includes/shr_pub_pro.php +52 -0
- includes/shrsb_activation_page.php +43 -0
- includes/shrsb_analytics_page.php +58 -0
- includes/shrsb_analytics_settings_page.php +255 -0
- includes/shrsb_authentication_page.php +141 -0
- includes/shrsb_classicbookmarks_page.php +59 -0
- includes/shrsb_classicbookmarks_settings_page.php +164 -0
- includes/shrsb_landing_page.php +74 -0
- includes/shrsb_recommendations_page.php +60 -0
- includes/shrsb_recommendations_settings_page.php +183 -0
- includes/shrsb_settings_page.php +636 -0
- includes/shrsb_sexybookmarks_page.php +206 -0
- includes/shrsb_sexybookmarks_settings_page.php +1066 -0
- includes/shrsb_topbar_page.php +68 -0
- includes/shrsb_topbar_settings_page.php +230 -0
- includes/widget.php +53 -0
- js/bootstrap/bootstrap.js +1733 -0
- js/bootstrap/bootstrap.min.js +7 -0
- js/index.php +6 -0
- js/reveal/jquery.reveal.js +177 -0
- js/reveal/jquery.reveal.min.js +177 -0
- js/sexy-bookmarks-public.js +82 -0
- js/sexy-bookmarks-public.min.js +4 -0
- js/shareaholic-admin.js +769 -0
- js/shareaholic-admin.min.js +53 -0
- js/shareaholic-perf.js +1 -0
- js/shareaholic-perf.min.js +1 -0
- js/shareaholic-promo.js +63 -0
- js/shareaholic-promo.min.js +5 -0
- languages/shrsb pl_PL.mo +0 -0
- languages/shrsb pl_PL.po +791 -0
- languages/shrsb-ar.mo +0 -0
- languages/shrsb-ar.po +1059 -0
- languages/shrsb-be_BY.mo +0 -0
- languages/shrsb-be_BY.po +1365 -0
- languages/shrsb-bg_BG.mo +0 -0
- languages/shrsb-bg_BG.po +804 -0
- languages/shrsb-ca.mo +0 -0
- languages/shrsb-ca.po +791 -0
- languages/shrsb-da_DK.mo +0 -0
- languages/shrsb-da_DK.po +1263 -0
- languages/shrsb-de_DE.mo +0 -0
- languages/shrsb-de_DE.po +1353 -0
- languages/shrsb-el_EL.mo +0 -0
- languages/shrsb-el_EL.po +855 -0
- languages/shrsb-es_ES.mo +0 -0
- languages/shrsb-es_ES.po +1353 -0
- languages/shrsb-fr_FR.mo +0 -0
- languages/shrsb-fr_FR.po +1035 -0
- languages/shrsb-it_IT.mo +0 -0
- languages/shrsb-it_IT.po +1138 -0
- languages/shrsb-it_IT.pot +855 -0
- languages/shrsb-lt_LT.mo +0 -0
- languages/shrsb-lt_LT.po +1005 -0
css/admin-style.css
ADDED
|
@@ -0,0 +1,355 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/* General Styles */
|
| 2 |
+
.shrsblogo{text-indent:-100.0em;height:90px;background:url('../images/shrsb-logo.png') no-repeat 0 0;position:relative;top:25px;}
|
| 3 |
+
.sh-logo{text-indent:-100.0em;height:45px;width:220px;background:url('../images/shareaholic-220.png') no-repeat 0 0;top:25px;}
|
| 4 |
+
.shebang-info{cursor:pointer;left:5px;position:relative;top:3px;}
|
| 5 |
+
.dtags-info{cursor:pointer;left:5px;position:relative;top:3px;}
|
| 6 |
+
#info-manual,#clear-warning,#custom-warning,#custom-warning-a,#mobile-warn{display:none;}
|
| 7 |
+
#defaulttags{width:40%;}
|
| 8 |
+
ul#shrsb-sortables li div.padding{color:#555;}
|
| 9 |
+
ul#shrsb-sortables div.padding h1,ul#shrsb-sortables div.padding h2,ul#shrsb-sortables div.padding h3,ul#shrsb-sortables div.padding h4,ul#shrsb-sortables div.padding h5{color:#222;font-family:Corbel,Verdana,sans-serif;}
|
| 10 |
+
#tag-info{background:#b3d3ef none;border:1px solid #8ba2df;font-style:italic;line-height:20px;padding:10px;overflow:hidden;}
|
| 11 |
+
.dtags-close{color:#4f659f;font-style:normal;float:right;display:inline;text-decoration:none;cursor:pointer;}
|
| 12 |
+
#tweetconfig{width:100% !important;height:30px !important;}
|
| 13 |
+
#twitter-defaults,#genopts{margin:1px 0;}
|
| 14 |
+
#tweetinstructions{font-size:11px;}
|
| 15 |
+
#tweetcounter{margin-left:192px;font-size:9px;position:absolute;margin:0 !important;right:10px;}
|
| 16 |
+
#tweetcounter span{}
|
| 17 |
+
#tweetoutput{margin-top:15px;}
|
| 18 |
+
.footer{font-size:11px; color: #666666;}
|
| 19 |
+
.footer a{text-decoration:none; color: #21759B;}
|
| 20 |
+
.footer a:hover {text-decoration:underline;}
|
| 21 |
+
.grey_light{color: #CCC;}
|
| 22 |
+
.fs_c_lightgrey{color:#777777}
|
| 23 |
+
.shrsb_health_icon{height:16px;width:16px;}
|
| 24 |
+
/* End General Styles */
|
| 25 |
+
/*------------------------------------------------------------------------------------------*/
|
| 26 |
+
/* Custom Classes */
|
| 27 |
+
.clear{clear:both;}
|
| 28 |
+
.clearbig{clear:both;height:15px;}
|
| 29 |
+
.hidden{display:none;}
|
| 30 |
+
.floright{clear:none;float:right;margin:0 0 0 10px;}
|
| 31 |
+
.floleft{clear:none;float:left;margin:0 10px 0 0;}
|
| 32 |
+
.padding{padding:10px;overflow:hidden;}
|
| 33 |
+
.shrsb_option{display:block;font-weight:bold;margin-top:10px;color:#444;}
|
| 34 |
+
.hide{display:none;}
|
| 35 |
+
/* End Custom Classes */
|
| 36 |
+
/*------------------------------------------------------------------------------------------*/
|
| 37 |
+
/* Background Images Section */
|
| 38 |
+
.share-care,.share-sexy,.share-care-old,.share-love,.share-wealth,.share-enjoy,.share-german,.share-knowledge{display:block;float:left;margin:10px 0 0;padding:50px 0 0 11px;width:195px;}
|
| 39 |
+
.share-care{background:url('../images/sharing-caring-hearts.png') no-repeat;}
|
| 40 |
+
.share-sexy{background:url('../images/sharing-shr.png') no-repeat;}
|
| 41 |
+
.share-care-old{background:url('../images/sharing-caring.png') no-repeat;}
|
| 42 |
+
.share-love{background:url('../images/share-love-hearts.png') no-repeat;}
|
| 43 |
+
.share-wealth{background:url('../images/share-wealth.png') no-repeat;padding:50px 0 0 25px !important;}
|
| 44 |
+
.share-enjoy{background:url('../images/share-enjoy.png') no-repeat;}
|
| 45 |
+
.share-german{background:url('../images/share-german.png') no-repeat;padding-left:25px;}
|
| 46 |
+
.share-knowledge{background:url('../images/share-knowledge.png') no-repeat;padding-left:25px;}
|
| 47 |
+
/* End Background Images Section */
|
| 48 |
+
/*------------------------------------------------------------------------------------------*/
|
| 49 |
+
/* Top Status Messages */
|
| 50 |
+
div.shrsb-success,div.shrsb-error,div.shrsb-warning,div.shrsb-information{border-width:1px;border-style:solid;font-size:14px;font-weight:bold;height:auto;overflow:hidden;margin:30px 15px 15px 0px;padding:4px 10px 6px;width:97%;line-height:30px;border-radius:4px;-moz-border-radius:4px;-webkit-border-radius:4px;}
|
| 51 |
+
div.shrsb-success{background:#b4efab;border-color:#8be57e;color:#337129;}
|
| 52 |
+
div.shrsb-error{background:#feb1b1;border-color:#fe9090;color:#820101;}
|
| 53 |
+
div.shrsb-information{background:#a3d0ff;border-color:#6ab3ff;color:#004185;}
|
| 54 |
+
div.shrsb-warning{background:#f0feb1;border-color:#d5d458;color:#7f7200;}
|
| 55 |
+
.shrsb-warning a,.shrsb-information a,.shrsb-error a,.shrsb-success a{text-decoration:underline;}
|
| 56 |
+
.shrsb-warning a{color:#6f6300;}
|
| 57 |
+
.shrsb-error a{color:#cb0000;}
|
| 58 |
+
.shrsb-information a{color:#1b466f;}
|
| 59 |
+
.shrsb-success a{color:#1d5f12;}
|
| 60 |
+
#shrsb-sortables p{margin:0.3em 0 1.6em;}
|
| 61 |
+
#shrsb-sortables .shrsb-success,#shrsb-sortables .shrsb-error,#shrsb-sortables .shrsb-warning{width:auto;margin:0 0 15px;font-weight:normal;font-size:12px;}
|
| 62 |
+
#shrsb-sortables .shrsb-success p,#shrsb-sortables .shrsb-error p,#shrsb-sortables .shrsb-warning p{margin:0;}
|
| 63 |
+
/* End Top Status Messages */
|
| 64 |
+
/*------------------------------------------------------------------------------------------*/
|
| 65 |
+
/* Individual Section Status Messages */
|
| 66 |
+
div.dialog-box-success,div.dialog-box-error,div.dialog-box-warning,div.dialog-box-information{float:left;border-width:1px;border-style:solid;font-size:10px;font-weight:bold;height:auto;overflow:hidden;margin-bottom:10px;padding:4px 10px 6px;width:97.5%;}
|
| 67 |
+
div.dialog-box-succes{background:#b4efab;border-color:#8be57e;color:#337129;}
|
| 68 |
+
div.dialog-box-error{background:#feb1b1;border-color:#fe9090;color:#820101;}
|
| 69 |
+
div.dialog-box-warning{background:#f0feb1;border-color:#d5d458;color:#7f7200;}
|
| 70 |
+
div.dialog-box-information{background:#a3d0ff;border-color:#6ab3ff;color:#004185;}
|
| 71 |
+
div.dialog-left{float:left;line-height:18px;}
|
| 72 |
+
div.dialog-left a{text-decoration:underline;}
|
| 73 |
+
div.dialog-box-information a{color:#004185;}
|
| 74 |
+
div.dialog-box-information a:hover{color:#21759b;}
|
| 75 |
+
div.dialog-box-warning a{color:#af9c00;}
|
| 76 |
+
div.dialog-box-warning a:hover{color:#af9c00;}
|
| 77 |
+
div.dialog-right{float:right;}
|
| 78 |
+
div.dialog-right form{margin-bottom: 0px;}
|
| 79 |
+
img.del-x{cursor:pointer;margin-top:7px;}
|
| 80 |
+
/* End Individual Section Status Messages */
|
| 81 |
+
/*------------------------------------------------------------------------------------------*/
|
| 82 |
+
/* Bookmarking Services Icons */
|
| 83 |
+
#shrsb-networks li{background-image:url('../images/shr-sprite.png');background-repeat:no-repeat;cursor:move;float:left;height:45px;font-size:10px;margin:12px 2px !important;text-align:center;width:60px;}
|
| 84 |
+
#shrsb-networks li input{margin-top:33px;}
|
| 85 |
+
li.shr-newsvine{background-position:left top;}
|
| 86 |
+
li.shr-linkedin{background-position:-70px top;}
|
| 87 |
+
li.shr-googlebookmarks{background-position:-140px top;}
|
| 88 |
+
li.shr-googlereader{background-position:-210px top;}
|
| 89 |
+
li.shr-scriptstyle{background-position:-280px top;}
|
| 90 |
+
li.shr-mail{background-position:-350px top;}
|
| 91 |
+
li.shr-comfeed{background-position:-420px top;}
|
| 92 |
+
li.shr-twitter{background-position:-490px top;}
|
| 93 |
+
li.shr-technorati{background-position:-560px top;}
|
| 94 |
+
li.shr-stumbleupon{background-position:-630px top;}
|
| 95 |
+
li.shr-reddit{background-position:-700px top;}
|
| 96 |
+
li.shr-myspace{background-position:-770px top;}
|
| 97 |
+
li.shr-mixx{background-position:-840px top;}
|
| 98 |
+
li.shr-diigo{background-position:-910px top;}
|
| 99 |
+
li.shr-digg{background-position:-980px top;}
|
| 100 |
+
li.shr-designfloat{background-position:-1050px top;}
|
| 101 |
+
li.shr-yahoobuzz{background-position:-1120px top;}
|
| 102 |
+
li.shr-delicious{background-position:-1190px top;}
|
| 103 |
+
li.shr-blinklist{background-position:-1260px top;}
|
| 104 |
+
li.shr-facebook{background-position:-1330px top;}
|
| 105 |
+
li.shr-misterwong{background-position:-1400px top;}
|
| 106 |
+
li.shr-izeby{background-position:-1470px top;}
|
| 107 |
+
li.shr-twittley{background-position:-1540px top;}
|
| 108 |
+
li.shr-tipd{background-position:-1610px top;}
|
| 109 |
+
li.shr-pfbuzz{background-position:-1680px top;}
|
| 110 |
+
li.shr-friendfeed{background-position:-1750px top;}
|
| 111 |
+
li.shr-blogmarks{background-position:-1820px top;}
|
| 112 |
+
li.shr-fwisp{background-position:-1890px top;}
|
| 113 |
+
li.shr-yahoomail{background-position:-1960px top;}
|
| 114 |
+
li.shr-bobrdobr{background-position:-2030px top;}
|
| 115 |
+
li.shr-memoryru{background-position:-2100px top;}
|
| 116 |
+
li.shr-100zakladok{background-position:-2170px top;}
|
| 117 |
+
li.shr-yandex{background-position:-2240px top;}
|
| 118 |
+
li.shr-moemesto{background-position:-2310px top;}
|
| 119 |
+
li.shr-marrows{background-position:-2380px top;}
|
| 120 |
+
li.shr-identica{background-position:-2450px top;}
|
| 121 |
+
li.shr-hackernews{background-position:-2520px top;}
|
| 122 |
+
li.shr-ning{background-position:-2590px top;}
|
| 123 |
+
li.shr-designbump{background-position:-2660px top;}
|
| 124 |
+
li.shr-printfriendly{background-position:-2730px top;}
|
| 125 |
+
li.shr-fleck{background-position:-2800px top !important;}
|
| 126 |
+
li.shr-netvibes{background-position:-2870px top !important;}
|
| 127 |
+
li.shr-netvouz{background-position:-2940px top !important;}
|
| 128 |
+
li.shr-nujij{background-position:-3010px top !important;}
|
| 129 |
+
li.shr-globalgrind{background-position:-3080px top !important;}
|
| 130 |
+
li.shr-wikio{background-position:-3150px top !important;}
|
| 131 |
+
li.shr-xerpi{background-position:-3220px top !important;}
|
| 132 |
+
li.shr-sphinn{background-position:-3290px top !important;}
|
| 133 |
+
li.shr-hotmail{background-position:-3360px top !important;}
|
| 134 |
+
li.shr-posterous{background-position:-3430px top !important;}
|
| 135 |
+
li.shr-techmeme{background-position:-3500px top !important;}
|
| 136 |
+
li.shr-ekudos{background-position:-3570px top !important;}
|
| 137 |
+
li.shr-pingfm{background-position:-3640px top !important;}
|
| 138 |
+
li.shr-tomuse{background-position:-3710px top !important;}
|
| 139 |
+
li.shr-webblend{background-position:-3780px top !important;}
|
| 140 |
+
li.shr-wykop{background-position:-3850px top !important;}
|
| 141 |
+
li.shr-blogengage{background-position:-3920px top !important;}
|
| 142 |
+
li.shr-hyves{background-position:-3990px top !important;}
|
| 143 |
+
li.shr-pusha{background-position:-4060px top !important;}
|
| 144 |
+
li.shr-hatena{background-position:-4130px top !important;}
|
| 145 |
+
li.shr-mylinkvault{background-position:-4200px top !important;}
|
| 146 |
+
li.shr-slashdot{background-position:-4270px top !important;}
|
| 147 |
+
li.shr-squidoo{background-position:-4340px top !important;}
|
| 148 |
+
li.shr-faqpal{background-position:-4480px top !important;}
|
| 149 |
+
li.shr-evernote{background-position:-4550px top !important;}
|
| 150 |
+
li.shr-meneame{background-position:-4620px top !important;}
|
| 151 |
+
li.shr-bitacoras{background-position:-4690px top !important;}
|
| 152 |
+
li.shr-jumptags{background-position:-4760px top !important;}
|
| 153 |
+
li.shr-bebo{background-position:-4830px top !important;}
|
| 154 |
+
li.shr-n4g{background-position:-4900px top !important;}
|
| 155 |
+
li.shr-strands{background-position:-4970px top !important;}
|
| 156 |
+
li.shr-orkut{background-position:-5040px top !important;}
|
| 157 |
+
li.shr-tumblr{background-position:-5110px top !important;}
|
| 158 |
+
li.shr-stumpedia{background-position:-5180px top !important;}
|
| 159 |
+
li.shr-current{background-position:-5250px top !important;}
|
| 160 |
+
li.shr-blogger{background-position:-5320px top !important;}
|
| 161 |
+
li.shr-plurk{background-position:-5390px top !important;}
|
| 162 |
+
li.shr-virb{background-position:-5460px top !important;}
|
| 163 |
+
li.shr-dzone{background-position:-5530px top !important;}
|
| 164 |
+
li.shr-kaevur{background-position:-5600px top !important;}
|
| 165 |
+
li.shr-box{background-position:-5670px top !important;}
|
| 166 |
+
li.shr-boxnet{background-position:-5670px top !important;}
|
| 167 |
+
li.shr-oknotizie{background-position:-5740px top !important;}
|
| 168 |
+
li.shr-bonzobox{background-position:-5810px top !important;}
|
| 169 |
+
li.shr-plaxo{background-position:-5880px top !important;}
|
| 170 |
+
li.shr-springpad{background-position:-5950px top !important;}
|
| 171 |
+
li.shr-zabox{background-position:-6020px top !important;}
|
| 172 |
+
li.shr-viadeo{background-position:-6090px top !important;}
|
| 173 |
+
li.shr-googlebuzz{background-position:-6160px top !important;}
|
| 174 |
+
li.shr-gmail{background-position:-6230px top !important;}
|
| 175 |
+
li.shr-buzzster{background-position:-6300px top !important;}
|
| 176 |
+
ul.multi-selection{list-style:none;overflow:hidden;position:absolute;top:6px;right:0;}
|
| 177 |
+
ul.multi-selection li{display:block;float:left;clear:none;margin:0 !important;}
|
| 178 |
+
ul.multi-selection li.label-faker{margin-right:10px !important;}
|
| 179 |
+
ul.multi-selection li input{}
|
| 180 |
+
|
| 181 |
+
#shrsb-networks li.shr-pinterest{background-image:url('../images/pinterest.png');height: 41px;}
|
| 182 |
+
#shrsb-networks li.shr-googleplus{background-image:url('../images/googleplus.png');height: 41px;}
|
| 183 |
+
#shrsb-networks li.shr-fastmail{background-image:url('../images/shareaholicmail.png');height: 41px;}
|
| 184 |
+
|
| 185 |
+
/* End Bookmarking Services Icons */
|
| 186 |
+
/*------------------------------------------------------------------------------------------*/
|
| 187 |
+
/* Main Structure Styles */
|
| 188 |
+
div#shrsb-col-left{float:left;margin:15px 10px 0 0;}
|
| 189 |
+
#shrsb-col-left label{margin:0 12px 0 0;}
|
| 190 |
+
ul#shrsb-sortables li{list-style-type:none;margin:0 300px 20px 0;position:relative;}
|
| 191 |
+
ul#shrsb-sortables{list-style-type:none;}
|
| 192 |
+
div.box-mid-head{background:transparent url('../images/flo-head.jpg') repeat-x scroll 0 0;border:1px solid #DBDBDB;cursor:move;height:27px;text-align:right;width:100%;}
|
| 193 |
+
div.box-mid-head h2{color:#21759b;float:left;font-family:Georgia,"Times New Roman","Bitstream Charter",Times,serif;font-size:14px;font-style:normal;font-weight:normal;height:24px;line-height:20px;margin:0;padding:3px 0 0 10px;text-align:left;}
|
| 194 |
+
div.box-mid-head a:hover{border:medium none;}
|
| 195 |
+
div.box-mid-head input{border:1px solid #ccc;}
|
| 196 |
+
div.box-mid-body{background:#fff url('../images/white-pix.jpg') repeat-x center top;border:1px solid #dbdbdb;border-top:0 none;display:table;width:100%;}
|
| 197 |
+
div.box-mid-body h3{display:block;font-size:18px;font-weight:bold;margin:8px 0;}
|
| 198 |
+
div#shrsb-col-right{clear:none;float:left;margin:5px 10px 0;position:absolute;right:1.3%;width:256px;}
|
| 199 |
+
div.box-right{float:left;margin-bottom:20px;}
|
| 200 |
+
div.box-right-head{background:transparent url('../images/flo-head.jpg') repeat-x 0 0;border:1px solid #dbdbdb;float:left;height:27px;width:256px;}
|
| 201 |
+
div.box-right-head h3{color:#21759b;float:left;font-family:Georgia,"Times New Roman","Bitstream Charter",Times,serif;font-size:14px;font-style:normal;font-weight:normal;height:24px;line-height:20px;margin:0;padding:3px 0 0 10px;text-align:left;}
|
| 202 |
+
div.box-right-body{background:#fff url('../images/white-pix.jpg') repeat-x center top;border:1px solid #dbdbdb;border-top:0 none;float:left;width:256px;}
|
| 203 |
+
div.box-right-body h4{display:block;font-size:16px;font-weight:bold;margin:8px 0;}
|
| 204 |
+
div.box-right-body ul{list-style-image:none;list-style-position:inside;list-style-type:none;margin:0;}
|
| 205 |
+
div.box-right-body ul li strong{color:#454545;font-weight:bold}
|
| 206 |
+
div.shrsbsubmit,div.shrsbreset{float:left;margin:15px 0 40px;}
|
| 207 |
+
div.shrsbreset{margin-left:15px}
|
| 208 |
+
div.shrsbsubmit input{font-size:26px !important;padding:14px 20px !important;border-radius:4px !important;-moz-border-radius:4px !important;-webkit-border-radius:4px !important;outline:0 none !important;}
|
| 209 |
+
div.shrsbreset input{font-size:16px !important;border:0;padding:14px 20px !important;outline:0 none !important;}
|
| 210 |
+
div.shrsbsubmit input{background:#3dcb36 url('../images/green-grad.png') repeat-x 0 0 !important;border:1px solid #0f8f08 !important;color:white !important;}
|
| 211 |
+
div.shrsbreset input{color:grey !important;}
|
| 212 |
+
div.shrsbsubmit input:hover,div.shrsbreset input:hover{cursor:pointer !important}
|
| 213 |
+
div.shrsbsubmit input:active,div.shrsbsubmit input:focus{background-position:left bottom !important;outline:0 none !important;}
|
| 214 |
+
div.shrsbreset input:active,div.shrsbreset input:focus{background-position:left bottom !important;outline:0 none !important;}
|
| 215 |
+
/* End Main Structure Styles */
|
| 216 |
+
/*------------------------------------------------------------------------------------------*/
|
| 217 |
+
/* Useful Links Section */
|
| 218 |
+
div.box-right-body ul.infolinks{list-style-type:none;list-style-position:outside;}
|
| 219 |
+
div.box-right-body ul.infolinks li{background:url('../images/custom-fugue-sprite.png') no-repeat 0 -2367px;text-indent:22px;line-height:15px;margin-bottom:12px;font-size:11px;}
|
| 220 |
+
div.box-right-body ul.infolinks li a{text-decoration:none;}
|
| 221 |
+
/* End Useful Links Section */
|
| 222 |
+
/*------------------------------------------------------------------------------------------*/
|
| 223 |
+
/* Credits Section */
|
| 224 |
+
div.box-right-body ul.credits{list-style-type:none;list-style-position:outside;}
|
| 225 |
+
div.box-right-body ul.credits li{background:url('../images/custom-fugue-sprite.png') no-repeat 0 -2585px;text-indent:22px;line-height:15px;margin-bottom:12px;font-size:11px;}
|
| 226 |
+
div.box-right-body ul.credits li a{text-decoration:none;}
|
| 227 |
+
/* End Credits Section */
|
| 228 |
+
/*------------------------------------------------------------------------------------------*/
|
| 229 |
+
/* Translations Section */
|
| 230 |
+
div.box-right-body ul.langs{list-style-type:none;list-style-position:outside;}
|
| 231 |
+
div.box-right-body ul.langs li{background:url('../images/custom-fugue-sprite.png') no-repeat 0 -2475px;text-indent:22px;line-height:15px;margin-bottom:12px;font-size:11px;}
|
| 232 |
+
div.box-right-body ul.langs li a{text-decoration:none;}
|
| 233 |
+
/* End Translations Section */
|
| 234 |
+
/*------------------------------------------------------------------------------------------*/
|
| 235 |
+
/* Custom Mods Warning */
|
| 236 |
+
#custom-mods-notice{padding:5px 15px;background:#ffefef;border:5px solid #ef3b3b;margin-bottom:25px;display:none;}
|
| 237 |
+
#custom-mods-notice h1{background:url('../images/warning-big.png') no-repeat 0 0;font-size:48px;height:48px;line-height:42px;text-indent:48px;width:100%;color:#ef3b3b !important;margin:20px 0;text-shadow:#cf2626 0 1px 0,#fff 0 -1px 0;}
|
| 238 |
+
.custom-mods-notice-close{cursor:pointer;float:right;color:#5c0101;font-weight:bold;display:block;line-height:14px;margin-bottom:5px;padding-left:18px !important;}
|
| 239 |
+
#custom-mods-notice h3{margin:20px 0;}
|
| 240 |
+
#custom-mods-notice p{line-height:22px;}
|
| 241 |
+
#custom-mods-notice ol li{list-style:decimal;}
|
| 242 |
+
#custom-mods-notice ul{list-style:none;list-style-position:outside;margin:15px 0 25px 15px;}
|
| 243 |
+
#custom-mods-notice ul li{margin:15px 0 0 15px;padding:0 0 0 24px;line-height:22px;}
|
| 244 |
+
#custom-mods-notice li a{color:#9f1313;}
|
| 245 |
+
#custom-mods-notice ul li.custom-mods-folder{background:url('../images/custom-fugue-sprite.png') no-repeat 0 -2020px;}
|
| 246 |
+
#custom-mods-notice ul li.custom-mods-image{background:url('../images/custom-fugue-sprite.png') no-repeat 0 -2137px;}
|
| 247 |
+
#custom-mods-notice ul li.custom-mods-code{background:url('../images/custom-fugue-sprite.png') no-repeat 0 -2253px;}
|
| 248 |
+
/* End Custom Mods Warning */
|
| 249 |
+
/*------------------------------------------------------------------------------------------*/
|
| 250 |
+
/* Custom Fugue Sprite Styles */
|
| 251 |
+
.fugue{background:url('../images/custom-fugue-sprite.png') no-repeat;padding-left:22px;}
|
| 252 |
+
.fugue.f-info{background-position:0 2px;margin:2px 10px 0 0;}
|
| 253 |
+
.fugue.f-warn{background-position:0 -83px;margin:2px 10px 0 0;}
|
| 254 |
+
.fugue.f-success{background-position:0 -178px;margin:7px 10px 0 0;}
|
| 255 |
+
.fugue.f-question{background-position:0 -295px;margin:2px 10px 0 0;width:16px;border:0;padding:0;display:inline-block;}
|
| 256 |
+
.fugue.f-info-frame{background-position:0 -411px;height:16px;line-height:16px;padding:0;position:relative;top:6px;left:10px;text-indent:25px;}
|
| 257 |
+
.fugue.f-error{background-position:0 -525px;margin:2px 10px 0 0;}
|
| 258 |
+
.fugue.f-delete{background-position:0 -640px;}
|
| 259 |
+
.fugue.f-globe-plus{background-position:0 -755px;height:16px;line-height:16px;padding:0;position:relative;top:6px;left:10px;text-indent:25px;}
|
| 260 |
+
.fugue.f-leaf-pencil{background-position:0 -871px;height:16px;line-height:16px;padding:0;position:relative;top:6px;left:10px;text-indent:25px;}
|
| 261 |
+
.fugue.f-wrench{background-position:0 -987px;height:16px;line-height:16px;padding:0;position:relative;top:6px;left:10px;text-indent:25px;}
|
| 262 |
+
.fugue.f-money{background-position:0 -1102px;height:16px;line-height:16px;padding:0;position:relative;top:6px;left:10px;text-indent:25px;}
|
| 263 |
+
.fugue.f-medal{background-position:0 -1217px;height:16px;line-height:16px;padding:0;position:relative;top:6px;left:10px;text-indent:25px;}
|
| 264 |
+
.fugue.f-pallette{background-position:0 -1332px;height:16px;line-height:16px;padding:0;position:relative;top:6px;left:10px;text-indent:25px;}
|
| 265 |
+
.fugue.f-plugin{background-position:0 -1447px;margin:5px 0 20px 0;padding-left:22px;display:block;clear:both;}
|
| 266 |
+
.fugue.f-megaphone{background-position:0 -1564px;height:16px;line-height:16px;padding:0;position:relative;top:6px;left:10px;text-indent:25px;}
|
| 267 |
+
.fugue.f-flags{background-position:0 -1680px;height:16px;line-height:16px;padding:0;position:relative;top:6px;left:10px;text-indent:25px;}
|
| 268 |
+
.fugue.f-image{background-position:0 -1794px;height:16px;line-height:16px;padding:0;position:relative;top:6px;left:10px;text-indent:25px;}
|
| 269 |
+
.fugue.f-footer{background-position:0 -1909px;height:16px;line-height:16px;padding:0;position:relative;top:6px;left:10px;text-indent:25px;}
|
| 270 |
+
.fugue.f-folder{background-position:0 -2020px;}
|
| 271 |
+
.fugue.f-doc-image{background-position:0 -2137px;}
|
| 272 |
+
.fugue.f-doc-code{background-position:0 -2253px;}
|
| 273 |
+
.fugue.f-link-small{background-position:0 -2367px;}
|
| 274 |
+
.fugue.f-globe-small{background-position:0 -2475px;}
|
| 275 |
+
.fugue.f-star-small{background-position:0 -2585px;}
|
| 276 |
+
.fugue.f-status{background-position:0 -2697px;height:16px;line-height:16px;padding:0;position:relative;top:6px;left:10px;text-indent:25px;}
|
| 277 |
+
/* End Custom Fugue Sprite Styles */
|
| 278 |
+
/*------------------------------------------------------------------------------------------*/
|
| 279 |
+
.colorpicker{width:356px;height:176px;overflow:hidden;position:absolute;background:url(../images/colorpicker_images/colorpicker_background.png);font-family:Arial,Helvetica,sans-serif;display:none;z-index: 9999;}
|
| 280 |
+
.colorpicker_color{width:150px;height:150px;left:14px;top:13px;position:absolute;background:#f00;overflow:hidden;cursor:crosshair}
|
| 281 |
+
.colorpicker_color div{position:absolute;top:0;left:0;width:150px;height:150px;background:url(../images/colorpicker_images/colorpicker_overlay.png)}
|
| 282 |
+
.colorpicker_color div div{position:absolute;top:0;left:0;width:11px;height:11px;overflow:hidden;background:url(../images/colorpicker_images/colorpicker_select.gif);margin:-5px 0 0 -5px}
|
| 283 |
+
.colorpicker_hue{position:absolute;top:13px;left:171px;width:35px;height:150px;cursor:n-resize}
|
| 284 |
+
.colorpicker_hue div{position:absolute;width:35px;height:9px;overflow:hidden;background:url(../images/colorpicker_images/colorpicker_indic.gif) left top;margin:-4px 0 0 0;left:0px}
|
| 285 |
+
.colorpicker_new_color{position:absolute;width:60px;height:30px;left:213px;top:13px;background:#f00}
|
| 286 |
+
.colorpicker_current_color{position:absolute;width:60px;height:30px;left:283px;top:13px;background:#f00}
|
| 287 |
+
.colorpicker input{background-color:transparent;border:1px solid transparent;position:absolute;font-size:10px;font-family:Arial,Helvetica,sans-serif;color:#898989;top:4px;right:11px;text-align:right;margin:0;padding:0;height:11px}
|
| 288 |
+
.colorpicker_hex{position:absolute;width:72px;height:22px;background:url(../images/colorpicker_images/colorpicker_hex.png) top;left:212px;top:142px}
|
| 289 |
+
.colorpicker_hex input{right:6px}
|
| 290 |
+
.colorpicker_field{height:22px;width:62px;background-position:top;position:absolute}
|
| 291 |
+
.colorpicker_field span{position:absolute;width:12px;height:22px;overflow:hidden;top:0;right:0;cursor:n-resize}
|
| 292 |
+
.colorpicker_rgb_r{background-image:url(../images/colorpicker_images/colorpicker_rgb_r.png);top:52px;left:212px}
|
| 293 |
+
.colorpicker_rgb_g{background-image:url(../images/colorpicker_images/colorpicker_rgb_g.png);top:82px;left:212px}
|
| 294 |
+
.colorpicker_rgb_b{background-image:url(../images/colorpicker_images/colorpicker_rgb_b.png);top:112px;left:212px}
|
| 295 |
+
.colorpicker_hsb_h{background-image:url(../images/colorpicker_images/colorpicker_hsb_h.png);top:52px;left:282px}
|
| 296 |
+
.colorpicker_hsb_s{background-image:url(../images/colorpicker_images/colorpicker_hsb_s.png);top:82px;left:282px}
|
| 297 |
+
.colorpicker_hsb_b{background-image:url(../images/colorpicker_images/colorpicker_hsb_b.png);top:112px;left:282px}
|
| 298 |
+
.colorpicker_submit{position:absolute;width:22px;height:22px;background:url(../images/colorpicker_images/colorpicker_submit.png) top;left:322px;top:142px;overflow:hidden}
|
| 299 |
+
.colorpicker_focus{background-position:center}
|
| 300 |
+
.colorpicker_hex.colorpicker_focus{background-position:bottom}
|
| 301 |
+
.colorpicker_submit.colorpicker_focus{background-position:bottom}
|
| 302 |
+
.colorpicker_slider{background-position:bottom}
|
| 303 |
+
.color_selector{display:inline;width:36px !important;height:36px !important;background:url(../images/colorpicker_images/select2.png) !important}
|
| 304 |
+
.color_selector div{position:relative !important;top:4px !important;left:4px !important;width:28px !important;height:28px !important;background:url(../images/colorpicker_images/select2.png) center}
|
| 305 |
+
/*------------------------------------------------------------------------------------------*/
|
| 306 |
+
/* Stats */
|
| 307 |
+
#bonusShareFacesUL{height:35px !important;padding-top:1px !important;margin-top:8px !important;}
|
| 308 |
+
.bonusShareLi{display:inline !important;float:left !important;margin:0px 1px 0px 1px !important;}
|
| 309 |
+
.bonusShareFaces{width:38px !important;height:38px !important;border:solid transparent;}
|
| 310 |
+
.bonusShareFaces:hover{width:38px !important;height:38px !important;border:solid grey;}
|
| 311 |
+
/* End Stats Styles */
|
| 312 |
+
/*------------------------------------------------------------------------------------------*/
|
| 313 |
+
/* Functionality options Styles*/
|
| 314 |
+
#genopts td:first-child{min-width:380px;}
|
| 315 |
+
.tab{margin-left:30px !important;}
|
| 316 |
+
.tabForTr td:first-child{padding-left:30px !important;}
|
| 317 |
+
/* End of functionality options Styles*/
|
| 318 |
+
/*------------------------------------------------------------------------------------------*/
|
| 319 |
+
.shr-fb-like-standard{background-image:url(../images/fbplusone.png);background-position:0 -5px;width:60px !important;height:35px !important;}
|
| 320 |
+
.shr-fb-like-button{background-image:url(../images/fbplusone.png);background-position:0 -37px;width:100px !important;height:30px !important;}
|
| 321 |
+
.shr-fb-like-box{background-image:url(../images/fbplusone.png);background-position:0 -72px;width:60px !important;height:70px !important;}
|
| 322 |
+
.shr-tw-button-button,.shr-tw-button-standard{background-image:url(../images/tweetn.png);background-position:0 0;width:55px !important;height:20px !important;margin-top: 6px}
|
| 323 |
+
.shr-tw-button-button-count,.shr-tw-button-standard-count{background-image:url(../images/tweeth.png);width:108px !important;height:20px !important;background-position:-0px -0px;background-repeat:no-repeat;margin-top: 7px}
|
| 324 |
+
.shr-tw-button-box,.shr-tw-button-box-count{background-image:url(../images/tweetv.png);background-position:0 0;width:55px !important;height:63px !important;margin-top: 6px;}
|
| 325 |
+
.shr-plus-one-button{background-image:url(../images/fbplusone.png);background-position:-230px -12px;width:35px !important;height:30px !important;}
|
| 326 |
+
.shr-plus-one-button-count{background-image:url(../images/fbplusone.png);background-position:-120px -12px;width:85px !important;height:30px !important;}
|
| 327 |
+
.shr-plus-one-standard{background-image:url(../images/fbplusone.png);background-position:-230px -52px;width:40px !important;height:30px !important;}
|
| 328 |
+
.shr-plus-one-standard-count{background-image:url(../images/fbplusone.png);background-position:-120px -52px;width:95px !important;height:30px !important;}
|
| 329 |
+
.shr-plus-one-box-count{background-image:url(../images/fbplusone.png);background-position:-120px -90px;width:60px !important;height:70px !important;}
|
| 330 |
+
.shr-plus-one-box{background-image:url(../images/fbplusone.png);background-position:-120px -90px;width:60px !important;height:70px !important;}
|
| 331 |
+
.shr-fb-send{background-image:url(../images/fbplusone.png);background-position:-195px -93px;width:65px !important;height:32px !important;}
|
| 332 |
+
.dropzone{border:1px dashed #999;background:#e3e3e3;-moz-border-radius:4px;-khtml-border-radius:4px;-webkit-border-radius:4px;border-radius:4px;background-image:none !important;}
|
| 333 |
+
.dropzoneNetworks{border:1px dashed #999;background:#e3e3e3;-moz-border-radius:2px;-khtml-border-radius:2px;-webkit-border-radius:2px;width:58px !important;height:43px !important;margin:10px 0px !important;border-radius:2px;background-image:none !important;}
|
| 334 |
+
#buttonPreviewsTop li,#buttonPreviewsBottom li{margin:0px 10px !important;padding:0px !important;float:left;}
|
| 335 |
+
/*------------------------------------------------------------------------------------------*/
|
| 336 |
+
/* Adjustments for bootstrap*/
|
| 337 |
+
#wpbody-content label input{float: left;}
|
| 338 |
+
#wpbody-content input{width: auto !important;height: auto;margin-right: 3px;}
|
| 339 |
+
#wpbody-content label{display: inline-block;}
|
| 340 |
+
#wpbody-content .hidden{display: none;visibility: visible;}
|
| 341 |
+
ul#shrsb-sortables li.reveal-modal{left: 25%;padding: 0;position: fixed;top:100px;}
|
| 342 |
+
#third-party-modal {top:0px !important;visibility: visible !important;}
|
| 343 |
+
/* End Adjustments for Bootstrap*/
|
| 344 |
+
/*------------------------------------------------------------------------------------------*/
|
| 345 |
+
/* Landing Page */
|
| 346 |
+
.select_product{background-color: #fff;display: block;font-family: "Helvetica Neue",Helvetica,Arial,sans-serif;border: 1px solid #DEDEDE;margin-bottom: 25px;-webkit-box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075);-moz-box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075);box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075);overflow: auto;padding-top: 10px;padding-bottom: 10px;padding-left: 20px;-webkit-border-radius: 4px;-moz-border-radius: 4px;border-radius: 4px; max-width: 800px;-webkit-transition-duration: .4s;-moz-transition-duration: .4s;}
|
| 347 |
+
.select_product h1 {padding-top: 3px;}
|
| 348 |
+
.select_product div{display: inline-block}
|
| 349 |
+
.shr-landing-product-icon{float: left; min-width: 90px;}
|
| 350 |
+
.shr-landing-product-name{float: left; width: auto;}
|
| 351 |
+
.shr-landing-product-name h2{margin-top:14px;margin-bottom: 2px;font-size: 18px;}
|
| 352 |
+
.shr-landing-product-desc {font-family: Georgia,"Times New Roman","Bitstream Charter",Times,serif;color: #505961;font-size: 12px;}
|
| 353 |
+
.shr-landing-product-configure{float: right; padding: 20px 20px 0px 10px;}
|
| 354 |
+
/* End Landing Page Styles */
|
| 355 |
+
/*------------------------------------------------------------------------------------------*/
|
css/bootstrap/bootstrap.min.css
ADDED
|
@@ -0,0 +1,588 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*!
|
| 2 |
+
* Bootstrap v2.0.0
|
| 3 |
+
*
|
| 4 |
+
* Copyright 2012 Twitter, Inc
|
| 5 |
+
* Licensed under the Apache License v2.0
|
| 6 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 7 |
+
*
|
| 8 |
+
* Designed and built with all the love in the world @twitter by @mdo and @fat.
|
| 9 |
+
*/
|
| 10 |
+
|
| 11 |
+
article,aside,details,figcaption,figure,footer,header,hgroup,nav,section{display:block;}
|
| 12 |
+
audio,canvas,video{display:inline-block;*display:inline;*zoom:1;}
|
| 13 |
+
audio:not([controls]){display:none;}
|
| 14 |
+
html{font-size:100%;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%;}
|
| 15 |
+
a:focus{outline:thin dotted;outline:5px auto -webkit-focus-ring-color;outline-offset:-2px;}
|
| 16 |
+
a:hover,a:active{outline:0;}
|
| 17 |
+
sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline;}
|
| 18 |
+
sup{top:-0.5em;}
|
| 19 |
+
sub{bottom:-0.25em;}
|
| 20 |
+
img{max-width:100%;height:auto;border:0;-ms-interpolation-mode:bicubic;}
|
| 21 |
+
button,input,select,textarea{margin:0;font-size:100%;vertical-align:middle;}
|
| 22 |
+
button,input{*overflow:visible;line-height:normal;}
|
| 23 |
+
button::-moz-focus-inner,input::-moz-focus-inner{padding:0;border:0;}
|
| 24 |
+
button,input[type="button"],input[type="reset"],input[type="submit"]{cursor:pointer;-webkit-appearance:button;}
|
| 25 |
+
input[type="search"]{-webkit-appearance:textfield;-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;}
|
| 26 |
+
input[type="search"]::-webkit-search-decoration,input[type="search"]::-webkit-search-cancel-button{-webkit-appearance:none;}
|
| 27 |
+
textarea{overflow:auto;vertical-align:top;}
|
| 28 |
+
body{margin:0;font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:13px;line-height:18px;color:#333333;background-color:#ffffff;}
|
| 29 |
+
a{color:#0088cc;text-decoration:none;}
|
| 30 |
+
a:hover{color:#005580;text-decoration:underline;}
|
| 31 |
+
.row{margin-left:-20px;*zoom:1;}.row:before,.row:after{display:table;content:"";}
|
| 32 |
+
.row:after{clear:both;}
|
| 33 |
+
[class*="span"]{float:left;margin-left:20px;}
|
| 34 |
+
.span1{width:60px;}
|
| 35 |
+
.span2{width:140px;}
|
| 36 |
+
.span3{width:220px;}
|
| 37 |
+
.span4{width:300px;}
|
| 38 |
+
.span5{width:380px;}
|
| 39 |
+
.span6{width:460px;}
|
| 40 |
+
.span7{width:540px;}
|
| 41 |
+
.span8{width:620px;}
|
| 42 |
+
.span9{width:700px;}
|
| 43 |
+
.span10{width:780px;}
|
| 44 |
+
.span11{width:860px;}
|
| 45 |
+
.span12,.container{width:940px;}
|
| 46 |
+
.offset1{margin-left:100px;}
|
| 47 |
+
.offset2{margin-left:180px;}
|
| 48 |
+
.offset3{margin-left:260px;}
|
| 49 |
+
.offset4{margin-left:340px;}
|
| 50 |
+
.offset5{margin-left:420px;}
|
| 51 |
+
.offset6{margin-left:500px;}
|
| 52 |
+
.offset7{margin-left:580px;}
|
| 53 |
+
.offset8{margin-left:660px;}
|
| 54 |
+
.offset9{margin-left:740px;}
|
| 55 |
+
.offset10{margin-left:820px;}
|
| 56 |
+
.offset11{margin-left:900px;}
|
| 57 |
+
.row-fluid{width:100%;*zoom:1;}.row-fluid:before,.row-fluid:after{display:table;content:"";}
|
| 58 |
+
.row-fluid:after{clear:both;}
|
| 59 |
+
.row-fluid>[class*="span"]{float:left;margin-left:2.127659574%;}
|
| 60 |
+
.row-fluid>[class*="span"]:first-child{margin-left:0;}
|
| 61 |
+
.row-fluid .span1{width:6.382978723%;}
|
| 62 |
+
.row-fluid .span2{width:14.89361702%;}
|
| 63 |
+
.row-fluid .span3{width:23.404255317%;}
|
| 64 |
+
.row-fluid .span4{width:31.914893614%;}
|
| 65 |
+
.row-fluid .span5{width:40.425531911%;}
|
| 66 |
+
.row-fluid .span6{width:48.93617020799999%;}
|
| 67 |
+
.row-fluid .span7{width:57.446808505%;}
|
| 68 |
+
.row-fluid .span8{width:65.95744680199999%;}
|
| 69 |
+
.row-fluid .span9{width:74.468085099%;}
|
| 70 |
+
.row-fluid .span10{width:82.97872339599999%;}
|
| 71 |
+
.row-fluid .span11{width:91.489361693%;}
|
| 72 |
+
.row-fluid .span12{width:99.99999998999999%;}
|
| 73 |
+
.container{width:940px;margin-left:auto;margin-right:auto;*zoom:1;}.container:before,.container:after{display:table;content:"";}
|
| 74 |
+
.container:after{clear:both;}
|
| 75 |
+
.container-fluid{padding-left:20px;padding-right:20px;*zoom:1;}.container-fluid:before,.container-fluid:after{display:table;content:"";}
|
| 76 |
+
.container-fluid:after{clear:both;}
|
| 77 |
+
code,pre{padding:0 3px 2px;font-family:Menlo,Monaco,"Courier New",monospace;font-size:12px;color:#333333;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;}
|
| 78 |
+
code{padding:3px 4px;color:#d14;background-color:#f7f7f9;border:1px solid #e1e1e8;}
|
| 79 |
+
pre{display:block;padding:8.5px;margin:0 0 9px;font-size:12px;line-height:18px;background-color:#f5f5f5;border:1px solid #ccc;border:1px solid rgba(0, 0, 0, 0.15);-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;white-space:pre;white-space:pre-wrap;word-break:break-all;}pre.prettyprint{margin-bottom:18px;}
|
| 80 |
+
pre code{padding:0;background-color:transparent;}
|
| 81 |
+
.label{padding:1px 3px 2px;font-size:9.75px;font-weight:bold;color:#ffffff;text-transform:uppercase;background-color:#999999;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;}
|
| 82 |
+
.label-important{background-color:#b94a48;}
|
| 83 |
+
.label-warning{background-color:#f89406;}
|
| 84 |
+
.label-success{background-color:#468847;}
|
| 85 |
+
.label-info{background-color:#3a87ad;}
|
| 86 |
+
table{max-width:100%;border-collapse:collapse;border-spacing:0;}
|
| 87 |
+
.table{width:100%;margin-bottom:18px;}.table th,.table td{padding:8px;line-height:18px;text-align:left;border-top:1px solid #ddd;}
|
| 88 |
+
.table th{font-weight:bold;vertical-align:bottom;}
|
| 89 |
+
.table td{vertical-align:top;}
|
| 90 |
+
.table thead:first-child tr th,.table thead:first-child tr td{border-top:0;}
|
| 91 |
+
.table tbody+tbody{border-top:2px solid #ddd;}
|
| 92 |
+
.table-condensed th,.table-condensed td{padding:4px 5px;}
|
| 93 |
+
.table-bordered{border:1px solid #ddd;border-collapse:separate;*border-collapse:collapsed;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;}.table-bordered th+th,.table-bordered td+td,.table-bordered th+td,.table-bordered td+th{border-left:1px solid #ddd;}
|
| 94 |
+
.table-bordered thead:first-child tr:first-child th,.table-bordered tbody:first-child tr:first-child th,.table-bordered tbody:first-child tr:first-child td{border-top:0;}
|
| 95 |
+
.table-bordered thead:first-child tr:first-child th:first-child,.table-bordered tbody:first-child tr:first-child td:first-child{-webkit-border-radius:4px 0 0 0;-moz-border-radius:4px 0 0 0;border-radius:4px 0 0 0;}
|
| 96 |
+
.table-bordered thead:first-child tr:first-child th:last-child,.table-bordered tbody:first-child tr:first-child td:last-child{-webkit-border-radius:0 4px 0 0;-moz-border-radius:0 4px 0 0;border-radius:0 4px 0 0;}
|
| 97 |
+
.table-bordered thead:last-child tr:last-child th:first-child,.table-bordered tbody:last-child tr:last-child td:first-child{-webkit-border-radius:0 0 0 4px;-moz-border-radius:0 0 0 4px;border-radius:0 0 0 4px;}
|
| 98 |
+
.table-bordered thead:last-child tr:last-child th:last-child,.table-bordered tbody:last-child tr:last-child td:last-child{-webkit-border-radius:0 0 4px 0;-moz-border-radius:0 0 4px 0;border-radius:0 0 4px 0;}
|
| 99 |
+
.table-striped tbody tr:nth-child(odd) td,.table-striped tbody tr:nth-child(odd) th{background-color:#f9f9f9;}
|
| 100 |
+
table .span1{float:none;width:44px;margin-left:0;}
|
| 101 |
+
table .span2{float:none;width:124px;margin-left:0;}
|
| 102 |
+
table .span3{float:none;width:204px;margin-left:0;}
|
| 103 |
+
table .span4{float:none;width:284px;margin-left:0;}
|
| 104 |
+
table .span5{float:none;width:364px;margin-left:0;}
|
| 105 |
+
table .span6{float:none;width:444px;margin-left:0;}
|
| 106 |
+
table .span7{float:none;width:524px;margin-left:0;}
|
| 107 |
+
table .span8{float:none;width:604px;margin-left:0;}
|
| 108 |
+
table .span9{float:none;width:684px;margin-left:0;}
|
| 109 |
+
table .span10{float:none;width:764px;margin-left:0;}
|
| 110 |
+
table .span11{float:none;width:844px;margin-left:0;}
|
| 111 |
+
table .span12{float:none;width:924px;margin-left:0;}
|
| 112 |
+
form{margin:0 0 18px;}
|
| 113 |
+
fieldset{padding:0;margin:0;border:0;}
|
| 114 |
+
legend{display:block;width:100%;padding:0;margin-bottom:27px;font-size:19.5px;line-height:36px;color:#333333;border:0;border-bottom:1px solid #eee;}
|
| 115 |
+
label,input,button,select,textarea{font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:13px;font-weight:normal;line-height:18px;}
|
| 116 |
+
label{display:block;margin-bottom:5px;color:#333333;}
|
| 117 |
+
input,textarea,select,.uneditable-input{display:inline-block;width:210px;height:18px;padding:4px;margin-bottom:9px;font-size:13px;line-height:18px;color:#555555;border:1px solid #ccc;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;}
|
| 118 |
+
.uneditable-textarea{width:auto;height:auto;}
|
| 119 |
+
label input,label textarea,label select{display:block;}
|
| 120 |
+
input[type="image"],input[type="checkbox"],input[type="radio"]{width:auto;height:auto;padding:0;margin:3px 0;*margin-top:0;line-height:normal;border:0;cursor:pointer;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0;}
|
| 121 |
+
input[type="file"]{padding:initial;line-height:initial;border:initial;background-color:#ffffff;background-color:initial;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none;}
|
| 122 |
+
input[type="button"],input[type="reset"],input[type="submit"]{width:auto;height:auto;}
|
| 123 |
+
select,input[type="file"]{height:28px;*margin-top:4px;line-height:28px;}
|
| 124 |
+
select{width:220px;background-color:#ffffff;}
|
| 125 |
+
select[multiple],select[size]{height:auto;}
|
| 126 |
+
input[type="image"]{-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none;}
|
| 127 |
+
textarea{height:auto;}
|
| 128 |
+
input[type="hidden"]{display:none;}
|
| 129 |
+
.radio,.checkbox{padding-left:18px;}
|
| 130 |
+
.radio input[type="radio"],.checkbox input[type="checkbox"]{float:left;margin-left:-18px;}
|
| 131 |
+
.controls>.radio:first-child,.controls>.checkbox:first-child{padding-top:5px;}
|
| 132 |
+
.radio.inline,.checkbox.inline{display:inline-block;margin-bottom:0;vertical-align:middle;}
|
| 133 |
+
.radio.inline+.radio.inline,.checkbox.inline+.checkbox.inline{margin-left:10px;}
|
| 134 |
+
.controls>.radio.inline:first-child,.controls>.checkbox.inline:first-child{padding-top:0;}
|
| 135 |
+
input,textarea{-webkit-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);-moz-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);-webkit-transition:border linear 0.2s,box-shadow linear 0.2s;-moz-transition:border linear 0.2s,box-shadow linear 0.2s;-ms-transition:border linear 0.2s,box-shadow linear 0.2s;-o-transition:border linear 0.2s,box-shadow linear 0.2s;transition:border linear 0.2s,box-shadow linear 0.2s;}
|
| 136 |
+
input:focus,textarea:focus{border-color:rgba(82, 168, 236, 0.8);-webkit-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075),0 0 8px rgba(82, 168, 236, 0.6);-moz-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075),0 0 8px rgba(82, 168, 236, 0.6);box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075),0 0 8px rgba(82, 168, 236, 0.6);outline:0;outline:thin dotted \9;}
|
| 137 |
+
input[type="file"]:focus,input[type="checkbox"]:focus,select:focus{-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none;outline:thin dotted;outline:5px auto -webkit-focus-ring-color;outline-offset:-2px;}
|
| 138 |
+
.input-mini{width:60px;}
|
| 139 |
+
.input-small{width:90px;}
|
| 140 |
+
.input-medium{width:150px;}
|
| 141 |
+
.input-large{width:210px;}
|
| 142 |
+
.input-xlarge{width:270px;}
|
| 143 |
+
.input-xxlarge{width:530px;}
|
| 144 |
+
input[class*="span"],select[class*="span"],textarea[class*="span"],.uneditable-input{float:none;margin-left:0;}
|
| 145 |
+
input.span1,textarea.span1,.uneditable-input.span1{width:50px;}
|
| 146 |
+
input.span2,textarea.span2,.uneditable-input.span2{width:130px;}
|
| 147 |
+
input.span3,textarea.span3,.uneditable-input.span3{width:210px;}
|
| 148 |
+
input.span4,textarea.span4,.uneditable-input.span4{width:290px;}
|
| 149 |
+
input.span5,textarea.span5,.uneditable-input.span5{width:370px;}
|
| 150 |
+
input.span6,textarea.span6,.uneditable-input.span6{width:450px;}
|
| 151 |
+
input.span7,textarea.span7,.uneditable-input.span7{width:530px;}
|
| 152 |
+
input.span8,textarea.span8,.uneditable-input.span8{width:610px;}
|
| 153 |
+
input.span9,textarea.span9,.uneditable-input.span9{width:690px;}
|
| 154 |
+
input.span10,textarea.span10,.uneditable-input.span10{width:770px;}
|
| 155 |
+
input.span11,textarea.span11,.uneditable-input.span11{width:850px;}
|
| 156 |
+
input.span12,textarea.span12,.uneditable-input.span12{width:930px;}
|
| 157 |
+
input[disabled],select[disabled],textarea[disabled],input[readonly],select[readonly],textarea[readonly]{background-color:#f5f5f5;border-color:#ddd;cursor:not-allowed;}
|
| 158 |
+
.control-group.warning>label,.control-group.warning .help-block,.control-group.warning .help-inline{color:#c09853;}
|
| 159 |
+
.control-group.warning input,.control-group.warning select,.control-group.warning textarea{color:#c09853;border-color:#c09853;}.control-group.warning input:focus,.control-group.warning select:focus,.control-group.warning textarea:focus{border-color:#a47e3c;-webkit-box-shadow:0 0 6px #dbc59e;-moz-box-shadow:0 0 6px #dbc59e;box-shadow:0 0 6px #dbc59e;}
|
| 160 |
+
.control-group.warning .input-prepend .add-on,.control-group.warning .input-append .add-on{color:#c09853;background-color:#fcf8e3;border-color:#c09853;}
|
| 161 |
+
.control-group.error>label,.control-group.error .help-block,.control-group.error .help-inline{color:#b94a48;}
|
| 162 |
+
.control-group.error input,.control-group.error select,.control-group.error textarea{color:#b94a48;border-color:#b94a48;}.control-group.error input:focus,.control-group.error select:focus,.control-group.error textarea:focus{border-color:#953b39;-webkit-box-shadow:0 0 6px #d59392;-moz-box-shadow:0 0 6px #d59392;box-shadow:0 0 6px #d59392;}
|
| 163 |
+
.control-group.error .input-prepend .add-on,.control-group.error .input-append .add-on{color:#b94a48;background-color:#f2dede;border-color:#b94a48;}
|
| 164 |
+
.control-group.success>label,.control-group.success .help-block,.control-group.success .help-inline{color:#468847;}
|
| 165 |
+
.control-group.success input,.control-group.success select,.control-group.success textarea{color:#468847;border-color:#468847;}.control-group.success input:focus,.control-group.success select:focus,.control-group.success textarea:focus{border-color:#356635;-webkit-box-shadow:0 0 6px #7aba7b;-moz-box-shadow:0 0 6px #7aba7b;box-shadow:0 0 6px #7aba7b;}
|
| 166 |
+
.control-group.success .input-prepend .add-on,.control-group.success .input-append .add-on{color:#468847;background-color:#dff0d8;border-color:#468847;}
|
| 167 |
+
input:focus:required:invalid,textarea:focus:required:invalid,select:focus:required:invalid{color:#b94a48;border-color:#ee5f5b;}input:focus:required:invalid:focus,textarea:focus:required:invalid:focus,select:focus:required:invalid:focus{border-color:#e9322d;-webkit-box-shadow:0 0 6px #f8b9b7;-moz-box-shadow:0 0 6px #f8b9b7;box-shadow:0 0 6px #f8b9b7;}
|
| 168 |
+
.form-actions{padding:17px 20px 18px;margin-top:18px;margin-bottom:18px;background-color:#f5f5f5;border-top:1px solid #ddd;}
|
| 169 |
+
.uneditable-input{display:block;background-color:#ffffff;border-color:#eee;-webkit-box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.025);-moz-box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.025);box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.025);cursor:not-allowed;}
|
| 170 |
+
:-moz-placeholder{color:#999999;}
|
| 171 |
+
::-webkit-input-placeholder{color:#999999;}
|
| 172 |
+
.help-block{margin-top:5px;margin-bottom:0;color:#999999;}
|
| 173 |
+
.help-inline{display:inline-block;*display:inline;*zoom:1;margin-bottom:9px;vertical-align:middle;padding-left:5px;}
|
| 174 |
+
.input-prepend,.input-append{margin-bottom:5px;*zoom:1;}.input-prepend:before,.input-append:before,.input-prepend:after,.input-append:after{display:table;content:"";}
|
| 175 |
+
.input-prepend:after,.input-append:after{clear:both;}
|
| 176 |
+
.input-prepend input,.input-append input,.input-prepend .uneditable-input,.input-append .uneditable-input{-webkit-border-radius:0 3px 3px 0;-moz-border-radius:0 3px 3px 0;border-radius:0 3px 3px 0;}.input-prepend input:focus,.input-append input:focus,.input-prepend .uneditable-input:focus,.input-append .uneditable-input:focus{position:relative;z-index:2;}
|
| 177 |
+
.input-prepend .uneditable-input,.input-append .uneditable-input{border-left-color:#ccc;}
|
| 178 |
+
.input-prepend .add-on,.input-append .add-on{float:left;display:block;width:auto;min-width:16px;height:18px;margin-right:-1px;padding:4px 5px;font-weight:normal;line-height:18px;color:#999999;text-align:center;text-shadow:0 1px 0 #ffffff;background-color:#f5f5f5;border:1px solid #ccc;-webkit-border-radius:3px 0 0 3px;-moz-border-radius:3px 0 0 3px;border-radius:3px 0 0 3px;}
|
| 179 |
+
.input-prepend .active,.input-append .active{background-color:#a9dba9;border-color:#46a546;}
|
| 180 |
+
.input-prepend .add-on{*margin-top:1px;}
|
| 181 |
+
.input-append input,.input-append .uneditable-input{float:left;-webkit-border-radius:3px 0 0 3px;-moz-border-radius:3px 0 0 3px;border-radius:3px 0 0 3px;}
|
| 182 |
+
.input-append .uneditable-input{border-right-color:#ccc;}
|
| 183 |
+
.input-append .add-on{margin-right:0;margin-left:-1px;-webkit-border-radius:0 3px 3px 0;-moz-border-radius:0 3px 3px 0;border-radius:0 3px 3px 0;}
|
| 184 |
+
.input-append input:first-child{*margin-left:-160px;}.input-append input:first-child+.add-on{*margin-left:-21px;}
|
| 185 |
+
.search-query{padding-left:14px;padding-right:14px;margin-bottom:0;-webkit-border-radius:14px;-moz-border-radius:14px;border-radius:14px;}
|
| 186 |
+
.form-search input,.form-inline input,.form-horizontal input,.form-search textarea,.form-inline textarea,.form-horizontal textarea,.form-search select,.form-inline select,.form-horizontal select,.form-search .help-inline,.form-inline .help-inline,.form-horizontal .help-inline,.form-search .uneditable-input,.form-inline .uneditable-input,.form-horizontal .uneditable-input{display:inline-block;margin-bottom:0;}
|
| 187 |
+
.form-search label,.form-inline label,.form-search .input-append,.form-inline .input-append,.form-search .input-prepend,.form-inline .input-prepend{display:inline-block;}
|
| 188 |
+
.form-search .input-append .add-on,.form-inline .input-prepend .add-on,.form-search .input-append .add-on,.form-inline .input-prepend .add-on{vertical-align:middle;}
|
| 189 |
+
.control-group{margin-bottom:9px;}
|
| 190 |
+
.form-horizontal legend+.control-group{margin-top:18px;-webkit-margin-top-collapse:separate;}
|
| 191 |
+
.form-horizontal .control-group{margin-bottom:18px;*zoom:1;}.form-horizontal .control-group:before,.form-horizontal .control-group:after{display:table;content:"";}
|
| 192 |
+
.form-horizontal .control-group:after{clear:both;}
|
| 193 |
+
.form-horizontal .control-group>label{float:left;width:140px;padding-top:5px;text-align:right;}
|
| 194 |
+
.form-horizontal .controls{margin-left:160px;}
|
| 195 |
+
.form-horizontal .form-actions{padding-left:160px;}
|
| 196 |
+
.btn{display:inline-block;padding:4px 10px 4px;font-size:13px;line-height:18px;color:#333333;text-align:center;text-shadow:0 1px 1px rgba(255, 255, 255, 0.75);background-color:#fafafa;background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), color-stop(25%, #ffffff), to(#e6e6e6));background-image:-webkit-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6);background-image:-moz-linear-gradient(top, #ffffff, #ffffff 25%, #e6e6e6);background-image:-ms-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6);background-image:-o-linear-gradient(#ffffff, #ffffff 25%, #e6e6e6);background-image:linear-gradient(#ffffff, #ffffff 25%, #e6e6e6);background-repeat:no-repeat;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#e6e6e6', GradientType=0);border:1px solid #ccc;border-bottom-color:#bbb;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;-webkit-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2),0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2),0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2),0 1px 2px rgba(0, 0, 0, 0.05);cursor:pointer;*margin-left:.3em;}.btn:first-child{*margin-left:0;}
|
| 197 |
+
.btn:hover{color:#333333;text-decoration:none;background-color:#e6e6e6;background-position:0 -15px;-webkit-transition:background-position 0.1s linear;-moz-transition:background-position 0.1s linear;-ms-transition:background-position 0.1s linear;-o-transition:background-position 0.1s linear;transition:background-position 0.1s linear;}
|
| 198 |
+
.btn:focus{outline:thin dotted;outline:5px auto -webkit-focus-ring-color;outline-offset:-2px;}
|
| 199 |
+
.btn.active,.btn:active{background-image:none;-webkit-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15),0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15),0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15),0 1px 2px rgba(0, 0, 0, 0.05);background-color:#e6e6e6;background-color:#d9d9d9 \9;color:rgba(0, 0, 0, 0.5);outline:0;}
|
| 200 |
+
.btn.disabled,.btn[disabled]{cursor:default;background-image:none;background-color:#e6e6e6;opacity:0.65;filter:alpha(opacity=65);-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none;}
|
| 201 |
+
.btn-large{padding:9px 14px;font-size:15px;line-height:normal;-webkit-border-radius:5px;-moz-border-radius:5px;border-radius:5px;}
|
| 202 |
+
.btn-large .icon{margin-top:1px;}
|
| 203 |
+
.btn-small{padding:5px 9px;font-size:11px;line-height:16px;}
|
| 204 |
+
.btn-small .icon{margin-top:-1px;}
|
| 205 |
+
.btn-primary,.btn-primary:hover,.btn-warning,.btn-warning:hover,.btn-danger,.btn-danger:hover,.btn-success,.btn-success:hover,.btn-info,.btn-info:hover{text-shadow:0 -1px 0 rgba(0, 0, 0, 0.25);color:#ffffff;}
|
| 206 |
+
.btn-primary.active,.btn-warning.active,.btn-danger.active,.btn-success.active,.btn-info.active{color:rgba(255, 255, 255, 0.75);}
|
| 207 |
+
.btn-primary{background-color:#006dcc;background-image:-moz-linear-gradient(top, #0088cc, #0044cc);background-image:-ms-linear-gradient(top, #0088cc, #0044cc);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#0088cc), to(#0044cc));background-image:-webkit-linear-gradient(top, #0088cc, #0044cc);background-image:-o-linear-gradient(top, #0088cc, #0044cc);background-image:linear-gradient(top, #0088cc, #0044cc);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#0088cc', endColorstr='#0044cc', GradientType=0);border-color:#0044cc #0044cc #002a80;border-color:rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);}.btn-primary:hover,.btn-primary:active,.btn-primary.active,.btn-primary.disabled,.btn-primary[disabled]{background-color:#0044cc;}
|
| 208 |
+
.btn-primary:active,.btn-primary.active{background-color:#003399 \9;}
|
| 209 |
+
.btn-warning{background-color:#faa732;background-image:-moz-linear-gradient(top, #fbb450, #f89406);background-image:-ms-linear-gradient(top, #fbb450, #f89406);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#fbb450), to(#f89406));background-image:-webkit-linear-gradient(top, #fbb450, #f89406);background-image:-o-linear-gradient(top, #fbb450, #f89406);background-image:linear-gradient(top, #fbb450, #f89406);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fbb450', endColorstr='#f89406', GradientType=0);border-color:#f89406 #f89406 #ad6704;border-color:rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);}.btn-warning:hover,.btn-warning:active,.btn-warning.active,.btn-warning.disabled,.btn-warning[disabled]{background-color:#f89406;}
|
| 210 |
+
.btn-warning:active,.btn-warning.active{background-color:#c67605 \9;}
|
| 211 |
+
.btn-danger{background-color:#da4f49;background-image:-moz-linear-gradient(top, #ee5f5b, #bd362f);background-image:-ms-linear-gradient(top, #ee5f5b, #bd362f);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#ee5f5b), to(#bd362f));background-image:-webkit-linear-gradient(top, #ee5f5b, #bd362f);background-image:-o-linear-gradient(top, #ee5f5b, #bd362f);background-image:linear-gradient(top, #ee5f5b, #bd362f);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ee5f5b', endColorstr='#bd362f', GradientType=0);border-color:#bd362f #bd362f #802420;border-color:rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);}.btn-danger:hover,.btn-danger:active,.btn-danger.active,.btn-danger.disabled,.btn-danger[disabled]{background-color:#bd362f;}
|
| 212 |
+
.btn-danger:active,.btn-danger.active{background-color:#942a25 \9;}
|
| 213 |
+
.btn-success{background-color:#5bb75b;background-image:-moz-linear-gradient(top, #62c462, #51a351);background-image:-ms-linear-gradient(top, #62c462, #51a351);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#62c462), to(#51a351));background-image:-webkit-linear-gradient(top, #62c462, #51a351);background-image:-o-linear-gradient(top, #62c462, #51a351);background-image:linear-gradient(top, #62c462, #51a351);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#62c462', endColorstr='#51a351', GradientType=0);border-color:#51a351 #51a351 #387038;border-color:rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);}.btn-success:hover,.btn-success:active,.btn-success.active,.btn-success.disabled,.btn-success[disabled]{background-color:#51a351;}
|
| 214 |
+
.btn-success:active,.btn-success.active{background-color:#408140 \9;}
|
| 215 |
+
.btn-info{background-color:#49afcd;background-image:-moz-linear-gradient(top, #5bc0de, #2f96b4);background-image:-ms-linear-gradient(top, #5bc0de, #2f96b4);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#5bc0de), to(#2f96b4));background-image:-webkit-linear-gradient(top, #5bc0de, #2f96b4);background-image:-o-linear-gradient(top, #5bc0de, #2f96b4);background-image:linear-gradient(top, #5bc0de, #2f96b4);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#5bc0de', endColorstr='#2f96b4', GradientType=0);border-color:#2f96b4 #2f96b4 #1f6377;border-color:rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);}.btn-info:hover,.btn-info:active,.btn-info.active,.btn-info.disabled,.btn-info[disabled]{background-color:#2f96b4;}
|
| 216 |
+
.btn-info:active,.btn-info.active{background-color:#24748c \9;}
|
| 217 |
+
button.btn,input[type="submit"].btn{*padding-top:2px;*padding-bottom:2px;}button.btn::-moz-focus-inner,input[type="submit"].btn::-moz-focus-inner{padding:0;border:0;}
|
| 218 |
+
button.btn.large,input[type="submit"].btn.large{*padding-top:7px;*padding-bottom:7px;}
|
| 219 |
+
button.btn.small,input[type="submit"].btn.small{*padding-top:3px;*padding-bottom:3px;}
|
| 220 |
+
[class^="icon-"]{display:inline-block;width:14px;height:14px;vertical-align:text-top;background-image:url(../../images/glyphicons-halflings.png);background-position:14px 14px;background-repeat:no-repeat;*margin-right:.3em;}[class^="icon-"]:last-child{*margin-left:0;}
|
| 221 |
+
.icon-white{background-image:url(../../images/glyphicons-halflings-white.png);}
|
| 222 |
+
.icon-glass{background-position:0 0;}
|
| 223 |
+
.icon-music{background-position:-24px 0;}
|
| 224 |
+
.icon-search{background-position:-48px 0;}
|
| 225 |
+
.icon-envelope{background-position:-72px 0;}
|
| 226 |
+
.icon-heart{background-position:-96px 0;}
|
| 227 |
+
.icon-star{background-position:-120px 0;}
|
| 228 |
+
.icon-star-empty{background-position:-144px 0;}
|
| 229 |
+
.icon-user{background-position:-168px 0;}
|
| 230 |
+
.icon-film{background-position:-192px 0;}
|
| 231 |
+
.icon-th-large{background-position:-216px 0;}
|
| 232 |
+
.icon-th{background-position:-240px 0;}
|
| 233 |
+
.icon-th-list{background-position:-264px 0;}
|
| 234 |
+
.icon-ok{background-position:-288px 0;}
|
| 235 |
+
.icon-remove{background-position:-312px 0;}
|
| 236 |
+
.icon-zoom-in{background-position:-336px 0;}
|
| 237 |
+
.icon-zoom-out{background-position:-360px 0;}
|
| 238 |
+
.icon-off{background-position:-384px 0;}
|
| 239 |
+
.icon-signal{background-position:-408px 0;}
|
| 240 |
+
.icon-cog{background-position:-432px 0;}
|
| 241 |
+
.icon-trash{background-position:-456px 0;}
|
| 242 |
+
.icon-home{background-position:0 -24px;}
|
| 243 |
+
.icon-file{background-position:-24px -24px;}
|
| 244 |
+
.icon-time{background-position:-48px -24px;}
|
| 245 |
+
.icon-road{background-position:-72px -24px;}
|
| 246 |
+
.icon-download-alt{background-position:-96px -24px;}
|
| 247 |
+
.icon-download{background-position:-120px -24px;}
|
| 248 |
+
.icon-upload{background-position:-144px -24px;}
|
| 249 |
+
.icon-inbox{background-position:-168px -24px;}
|
| 250 |
+
.icon-play-circle{background-position:-192px -24px;}
|
| 251 |
+
.icon-repeat{background-position:-216px -24px;}
|
| 252 |
+
.icon-refresh{background-position:-240px -24px;}
|
| 253 |
+
.icon-list-alt{background-position:-264px -24px;}
|
| 254 |
+
.icon-lock{background-position:-287px -24px;}
|
| 255 |
+
.icon-flag{background-position:-312px -24px;}
|
| 256 |
+
.icon-headphones{background-position:-336px -24px;}
|
| 257 |
+
.icon-volume-off{background-position:-360px -24px;}
|
| 258 |
+
.icon-volume-down{background-position:-384px -24px;}
|
| 259 |
+
.icon-volume-up{background-position:-408px -24px;}
|
| 260 |
+
.icon-qrcode{background-position:-432px -24px;}
|
| 261 |
+
.icon-barcode{background-position:-456px -24px;}
|
| 262 |
+
.icon-tag{background-position:0 -48px;}
|
| 263 |
+
.icon-tags{background-position:-25px -48px;}
|
| 264 |
+
.icon-book{background-position:-48px -48px;}
|
| 265 |
+
.icon-bookmark{background-position:-72px -48px;}
|
| 266 |
+
.icon-print{background-position:-96px -48px;}
|
| 267 |
+
.icon-camera{background-position:-120px -48px;}
|
| 268 |
+
.icon-font{background-position:-144px -48px;}
|
| 269 |
+
.icon-bold{background-position:-167px -48px;}
|
| 270 |
+
.icon-italic{background-position:-192px -48px;}
|
| 271 |
+
.icon-text-height{background-position:-216px -48px;}
|
| 272 |
+
.icon-text-width{background-position:-240px -48px;}
|
| 273 |
+
.icon-align-left{background-position:-264px -48px;}
|
| 274 |
+
.icon-align-center{background-position:-288px -48px;}
|
| 275 |
+
.icon-align-right{background-position:-312px -48px;}
|
| 276 |
+
.icon-align-justify{background-position:-336px -48px;}
|
| 277 |
+
.icon-list{background-position:-360px -48px;}
|
| 278 |
+
.icon-indent-left{background-position:-384px -48px;}
|
| 279 |
+
.icon-indent-right{background-position:-408px -48px;}
|
| 280 |
+
.icon-facetime-video{background-position:-432px -48px;}
|
| 281 |
+
.icon-picture{background-position:-456px -48px;}
|
| 282 |
+
.icon-pencil{background-position:0 -72px;}
|
| 283 |
+
.icon-map-marker{background-position:-24px -72px;}
|
| 284 |
+
.icon-adjust{background-position:-48px -72px;}
|
| 285 |
+
.icon-tint{background-position:-72px -72px;}
|
| 286 |
+
.icon-edit{background-position:-96px -72px;}
|
| 287 |
+
.icon-share{background-position:-120px -72px;}
|
| 288 |
+
.icon-check{background-position:-144px -72px;}
|
| 289 |
+
.icon-move{background-position:-168px -72px;}
|
| 290 |
+
.icon-step-backward{background-position:-192px -72px;}
|
| 291 |
+
.icon-fast-backward{background-position:-216px -72px;}
|
| 292 |
+
.icon-backward{background-position:-240px -72px;}
|
| 293 |
+
.icon-play{background-position:-264px -72px;}
|
| 294 |
+
.icon-pause{background-position:-288px -72px;}
|
| 295 |
+
.icon-stop{background-position:-312px -72px;}
|
| 296 |
+
.icon-forward{background-position:-336px -72px;}
|
| 297 |
+
.icon-fast-forward{background-position:-360px -72px;}
|
| 298 |
+
.icon-step-forward{background-position:-384px -72px;}
|
| 299 |
+
.icon-eject{background-position:-408px -72px;}
|
| 300 |
+
.icon-chevron-left{background-position:-432px -72px;}
|
| 301 |
+
.icon-chevron-right{background-position:-456px -72px;}
|
| 302 |
+
.icon-plus-sign{background-position:0 -96px;}
|
| 303 |
+
.icon-minus-sign{background-position:-24px -96px;}
|
| 304 |
+
.icon-remove-sign{background-position:-48px -96px;}
|
| 305 |
+
.icon-ok-sign{background-position:-72px -96px;}
|
| 306 |
+
.icon-question-sign{background-position:-96px -96px;}
|
| 307 |
+
.icon-info-sign{background-position:-120px -96px;}
|
| 308 |
+
.icon-screenshot{background-position:-144px -96px;}
|
| 309 |
+
.icon-remove-circle{background-position:-168px -96px;}
|
| 310 |
+
.icon-ok-circle{background-position:-192px -96px;}
|
| 311 |
+
.icon-ban-circle{background-position:-216px -96px;}
|
| 312 |
+
.icon-arrow-left{background-position:-240px -96px;}
|
| 313 |
+
.icon-arrow-right{background-position:-264px -96px;}
|
| 314 |
+
.icon-arrow-up{background-position:-289px -96px;}
|
| 315 |
+
.icon-arrow-down{background-position:-312px -96px;}
|
| 316 |
+
.icon-share-alt{background-position:-336px -96px;}
|
| 317 |
+
.icon-resize-full{background-position:-360px -96px;}
|
| 318 |
+
.icon-resize-small{background-position:-384px -96px;}
|
| 319 |
+
.icon-plus{background-position:-408px -96px;}
|
| 320 |
+
.icon-minus{background-position:-433px -96px;}
|
| 321 |
+
.icon-asterisk{background-position:-456px -96px;}
|
| 322 |
+
.icon-exclamation-sign{background-position:0 -120px;}
|
| 323 |
+
.icon-gift{background-position:-24px -120px;}
|
| 324 |
+
.icon-leaf{background-position:-48px -120px;}
|
| 325 |
+
.icon-fire{background-position:-72px -120px;}
|
| 326 |
+
.icon-eye-open{background-position:-96px -120px;}
|
| 327 |
+
.icon-eye-close{background-position:-120px -120px;}
|
| 328 |
+
.icon-warning-sign{background-position:-144px -120px;}
|
| 329 |
+
.icon-plane{background-position:-168px -120px;}
|
| 330 |
+
.icon-calendar{background-position:-192px -120px;}
|
| 331 |
+
.icon-random{background-position:-216px -120px;}
|
| 332 |
+
.icon-comment{background-position:-240px -120px;}
|
| 333 |
+
.icon-magnet{background-position:-264px -120px;}
|
| 334 |
+
.icon-chevron-up{background-position:-288px -120px;}
|
| 335 |
+
.icon-chevron-down{background-position:-313px -119px;}
|
| 336 |
+
.icon-retweet{background-position:-336px -120px;}
|
| 337 |
+
.icon-shopping-cart{background-position:-360px -120px;}
|
| 338 |
+
.icon-folder-close{background-position:-384px -120px;}
|
| 339 |
+
.icon-folder-open{background-position:-408px -120px;}
|
| 340 |
+
.icon-resize-vertical{background-position:-432px -119px;}
|
| 341 |
+
.icon-resize-horizontal{background-position:-456px -118px;}
|
| 342 |
+
.btn-group{position:relative;*zoom:1;*margin-left:.3em;}.btn-group:before,.btn-group:after{display:table;content:"";}
|
| 343 |
+
.btn-group:after{clear:both;}
|
| 344 |
+
.btn-group:first-child{*margin-left:0;}
|
| 345 |
+
.btn-group+.btn-group{margin-left:5px;}
|
| 346 |
+
.btn-toolbar{margin-top:9px;margin-bottom:9px;}.btn-toolbar .btn-group{display:inline-block;*display:inline;*zoom:1;}
|
| 347 |
+
.btn-group .btn{position:relative;float:left;margin-left:-1px;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0;}
|
| 348 |
+
.btn-group .btn:first-child{margin-left:0;-webkit-border-top-left-radius:4px;-moz-border-radius-topleft:4px;border-top-left-radius:4px;-webkit-border-bottom-left-radius:4px;-moz-border-radius-bottomleft:4px;border-bottom-left-radius:4px;}
|
| 349 |
+
.btn-group .btn:last-child,.btn-group .dropdown-toggle{-webkit-border-top-right-radius:4px;-moz-border-radius-topright:4px;border-top-right-radius:4px;-webkit-border-bottom-right-radius:4px;-moz-border-radius-bottomright:4px;border-bottom-right-radius:4px;}
|
| 350 |
+
.btn-group .btn.large:first-child{margin-left:0;-webkit-border-top-left-radius:6px;-moz-border-radius-topleft:6px;border-top-left-radius:6px;-webkit-border-bottom-left-radius:6px;-moz-border-radius-bottomleft:6px;border-bottom-left-radius:6px;}
|
| 351 |
+
.btn-group .btn.large:last-child,.btn-group .large.dropdown-toggle{-webkit-border-top-right-radius:6px;-moz-border-radius-topright:6px;border-top-right-radius:6px;-webkit-border-bottom-right-radius:6px;-moz-border-radius-bottomright:6px;border-bottom-right-radius:6px;}
|
| 352 |
+
.btn-group .btn:hover,.btn-group .btn:focus,.btn-group .btn:active,.btn-group .btn.active{z-index:2;}
|
| 353 |
+
.btn-group .dropdown-toggle:active,.btn-group.open .dropdown-toggle{outline:0;}
|
| 354 |
+
.btn-group .dropdown-toggle{padding-left:8px;padding-right:8px;-webkit-box-shadow:inset 1px 0 0 rgba(255, 255, 255, 0.125),inset 0 1px 0 rgba(255, 255, 255, 0.2),0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 1px 0 0 rgba(255, 255, 255, 0.125),inset 0 1px 0 rgba(255, 255, 255, 0.2),0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 1px 0 0 rgba(255, 255, 255, 0.125),inset 0 1px 0 rgba(255, 255, 255, 0.2),0 1px 2px rgba(0, 0, 0, 0.05);*padding-top:5px;*padding-bottom:5px;}
|
| 355 |
+
.btn-group.open{*z-index:1000;}.btn-group.open .dropdown-menu{display:block;margin-top:1px;-webkit-border-radius:5px;-moz-border-radius:5px;border-radius:5px;}
|
| 356 |
+
.btn-group.open .dropdown-toggle{background-image:none;-webkit-box-shadow:inset 0 1px 6px rgba(0, 0, 0, 0.15),0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 1px 6px rgba(0, 0, 0, 0.15),0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 1px 6px rgba(0, 0, 0, 0.15),0 1px 2px rgba(0, 0, 0, 0.05);}
|
| 357 |
+
.btn .caret{margin-top:7px;margin-left:0;}
|
| 358 |
+
.btn:hover .caret,.open.btn-group .caret{opacity:1;filter:alpha(opacity=100);}
|
| 359 |
+
.btn-primary .caret,.btn-danger .caret,.btn-info .caret,.btn-success .caret{border-top-color:#ffffff;opacity:0.75;filter:alpha(opacity=75);}
|
| 360 |
+
.btn-small .caret{margin-top:4px;}
|
| 361 |
+
.nav{margin-left:0;margin-bottom:18px;list-style:none;}
|
| 362 |
+
.nav>li>a{display:block;}
|
| 363 |
+
.nav>li>a:hover{text-decoration:none;background-color:#eeeeee;}
|
| 364 |
+
.nav-list{padding-left:14px;padding-right:14px;margin-bottom:0;}
|
| 365 |
+
.nav-list>li>a,.nav-list .nav-header{display:block;padding:3px 15px;margin-left:-15px;margin-right:-15px;text-shadow:0 1px 0 rgba(255, 255, 255, 0.5);}
|
| 366 |
+
.nav-list .nav-header{font-size:11px;font-weight:bold;line-height:18px;color:#999999;text-transform:uppercase;}
|
| 367 |
+
.nav-list>li+.nav-header{margin-top:9px;}
|
| 368 |
+
.nav-list .active>a,.nav-list .active>a:hover{color:#ffffff;text-shadow:0 -1px 0 rgba(0, 0, 0, 0.2);background-color:#0088cc;}
|
| 369 |
+
.nav-list [class^="icon-"]{margin-right:2px;}
|
| 370 |
+
.nav-tabs,.nav-pills{*zoom:1;}.nav-tabs:before,.nav-pills:before,.nav-tabs:after,.nav-pills:after{display:table;content:"";}
|
| 371 |
+
.nav-tabs:after,.nav-pills:after{clear:both;}
|
| 372 |
+
.nav-tabs>li,.nav-pills>li{float:left;}
|
| 373 |
+
.nav-tabs>li>a,.nav-pills>li>a{padding-right:12px;padding-left:12px;margin-right:2px;line-height:14px;}
|
| 374 |
+
.nav-tabs{border-bottom:1px solid #ddd;}
|
| 375 |
+
.nav-tabs>li{margin-bottom:-1px;}
|
| 376 |
+
.nav-tabs>li>a{padding-top:9px;padding-bottom:9px;border:1px solid transparent;-webkit-border-radius:4px 4px 0 0;-moz-border-radius:4px 4px 0 0;border-radius:4px 4px 0 0;}.nav-tabs>li>a:hover{border-color:#eeeeee #eeeeee #dddddd;}
|
| 377 |
+
.nav-tabs>.active>a,.nav-tabs>.active>a:hover{color:#555555;background-color:#ffffff;border:1px solid #ddd;border-bottom-color:transparent;cursor:default;}
|
| 378 |
+
.nav-pills>li>a{padding-top:8px;padding-bottom:8px;margin-top:2px;margin-bottom:2px;-webkit-border-radius:5px;-moz-border-radius:5px;border-radius:5px;}
|
| 379 |
+
.nav-pills .active>a,.nav-pills .active>a:hover{color:#ffffff;background-color:#0088cc;}
|
| 380 |
+
.nav-stacked>li{float:none;}
|
| 381 |
+
.nav-stacked>li>a{margin-right:0;}
|
| 382 |
+
.nav-tabs.nav-stacked{border-bottom:0;}
|
| 383 |
+
.nav-tabs.nav-stacked>li>a{border:1px solid #ddd;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0;}
|
| 384 |
+
.nav-tabs.nav-stacked>li:first-child>a{-webkit-border-radius:4px 4px 0 0;-moz-border-radius:4px 4px 0 0;border-radius:4px 4px 0 0;}
|
| 385 |
+
.nav-tabs.nav-stacked>li:last-child>a{-webkit-border-radius:0 0 4px 4px;-moz-border-radius:0 0 4px 4px;border-radius:0 0 4px 4px;}
|
| 386 |
+
.nav-tabs.nav-stacked>li>a:hover{border-color:#ddd;z-index:2;}
|
| 387 |
+
.nav-pills.nav-stacked>li>a{margin-bottom:3px;}
|
| 388 |
+
.nav-pills.nav-stacked>li:last-child>a{margin-bottom:1px;}
|
| 389 |
+
.nav-tabs .dropdown-menu,.nav-pills .dropdown-menu{margin-top:1px;border-width:1px;}
|
| 390 |
+
.nav-pills .dropdown-menu{-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;}
|
| 391 |
+
.nav-tabs .dropdown-toggle .caret,.nav-pills .dropdown-toggle .caret{border-top-color:#0088cc;margin-top:6px;}
|
| 392 |
+
.nav-tabs .dropdown-toggle:hover .caret,.nav-pills .dropdown-toggle:hover .caret{border-top-color:#005580;}
|
| 393 |
+
.nav-tabs .active .dropdown-toggle .caret,.nav-pills .active .dropdown-toggle .caret{border-top-color:#333333;}
|
| 394 |
+
.nav>.dropdown.active>a:hover{color:#000000;cursor:pointer;}
|
| 395 |
+
.nav-tabs .open .dropdown-toggle,.nav-pills .open .dropdown-toggle,.nav>.open.active>a:hover{color:#ffffff;background-color:#999999;border-color:#999999;}
|
| 396 |
+
.nav .open .caret,.nav .open.active .caret,.nav .open a:hover .caret{border-top-color:#ffffff;opacity:1;filter:alpha(opacity=100);}
|
| 397 |
+
.tabs-stacked .open>a:hover{border-color:#999999;}
|
| 398 |
+
.tabbable{*zoom:1;}.tabbable:before,.tabbable:after{display:table;content:"";}
|
| 399 |
+
.tabbable:after{clear:both;}
|
| 400 |
+
.tabs-below .nav-tabs,.tabs-right .nav-tabs,.tabs-left .nav-tabs{border-bottom:0;}
|
| 401 |
+
.tab-content>.tab-pane,.pill-content>.pill-pane{display:none;}
|
| 402 |
+
.tab-content>.active,.pill-content>.active{display:block;}
|
| 403 |
+
.tabs-below .nav-tabs{border-top:1px solid #ddd;}
|
| 404 |
+
.tabs-below .nav-tabs>li{margin-top:-1px;margin-bottom:0;}
|
| 405 |
+
.tabs-below .nav-tabs>li>a{-webkit-border-radius:0 0 4px 4px;-moz-border-radius:0 0 4px 4px;border-radius:0 0 4px 4px;}.tabs-below .nav-tabs>li>a:hover{border-bottom-color:transparent;border-top-color:#ddd;}
|
| 406 |
+
.tabs-below .nav-tabs .active>a,.tabs-below .nav-tabs .active>a:hover{border-color:transparent #ddd #ddd #ddd;}
|
| 407 |
+
.tabs-left .nav-tabs>li,.tabs-right .nav-tabs>li{float:none;}
|
| 408 |
+
.tabs-left .nav-tabs>li>a,.tabs-right .nav-tabs>li>a{min-width:74px;margin-right:0;margin-bottom:3px;}
|
| 409 |
+
.tabs-left .nav-tabs{float:left;margin-right:19px;border-right:1px solid #ddd;}
|
| 410 |
+
.tabs-left .nav-tabs>li>a{margin-right:-1px;-webkit-border-radius:4px 0 0 4px;-moz-border-radius:4px 0 0 4px;border-radius:4px 0 0 4px;}
|
| 411 |
+
.tabs-left .nav-tabs>li>a:hover{border-color:#eeeeee #dddddd #eeeeee #eeeeee;}
|
| 412 |
+
.tabs-left .nav-tabs .active>a,.tabs-left .nav-tabs .active>a:hover{border-color:#ddd transparent #ddd #ddd;*border-right-color:#ffffff;}
|
| 413 |
+
.tabs-right .nav-tabs{float:right;margin-left:19px;border-left:1px solid #ddd;}
|
| 414 |
+
.tabs-right .nav-tabs>li>a{margin-left:-1px;-webkit-border-radius:0 4px 4px 0;-moz-border-radius:0 4px 4px 0;border-radius:0 4px 4px 0;}
|
| 415 |
+
.tabs-right .nav-tabs>li>a:hover{border-color:#eeeeee #eeeeee #eeeeee #dddddd;}
|
| 416 |
+
.tabs-right .nav-tabs .active>a,.tabs-right .nav-tabs .active>a:hover{border-color:#ddd #ddd #ddd transparent;*border-left-color:#ffffff;}
|
| 417 |
+
.navbar{overflow:visible;margin-bottom:18px;}
|
| 418 |
+
.navbar-inner{padding-left:20px;padding-right:20px;background-color:#2c2c2c;background-image:-moz-linear-gradient(top, #333333, #222222);background-image:-ms-linear-gradient(top, #333333, #222222);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#333333), to(#222222));background-image:-webkit-linear-gradient(top, #333333, #222222);background-image:-o-linear-gradient(top, #333333, #222222);background-image:linear-gradient(top, #333333, #222222);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#333333', endColorstr='#222222', GradientType=0);-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;-webkit-box-shadow:0 1px 3px rgba(0, 0, 0, 0.25),inset 0 -1px 0 rgba(0, 0, 0, 0.1);-moz-box-shadow:0 1px 3px rgba(0, 0, 0, 0.25),inset 0 -1px 0 rgba(0, 0, 0, 0.1);box-shadow:0 1px 3px rgba(0, 0, 0, 0.25),inset 0 -1px 0 rgba(0, 0, 0, 0.1);}
|
| 419 |
+
.btn-navbar{display:none;float:right;padding:7px 10px;margin-left:5px;margin-right:5px;background-color:#2c2c2c;background-image:-moz-linear-gradient(top, #333333, #222222);background-image:-ms-linear-gradient(top, #333333, #222222);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#333333), to(#222222));background-image:-webkit-linear-gradient(top, #333333, #222222);background-image:-o-linear-gradient(top, #333333, #222222);background-image:linear-gradient(top, #333333, #222222);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#333333', endColorstr='#222222', GradientType=0);border-color:#222222 #222222 #000000;border-color:rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);-webkit-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.1),0 1px 0 rgba(255, 255, 255, 0.075);-moz-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.1),0 1px 0 rgba(255, 255, 255, 0.075);box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.1),0 1px 0 rgba(255, 255, 255, 0.075);}.btn-navbar:hover,.btn-navbar:active,.btn-navbar.active,.btn-navbar.disabled,.btn-navbar[disabled]{background-color:#222222;}
|
| 420 |
+
.btn-navbar:active,.btn-navbar.active{background-color:#080808 \9;}
|
| 421 |
+
.btn-navbar .icon-bar{display:block;width:18px;height:2px;background-color:#f5f5f5;-webkit-border-radius:1px;-moz-border-radius:1px;border-radius:1px;-webkit-box-shadow:0 1px 0 rgba(0, 0, 0, 0.25);-moz-box-shadow:0 1px 0 rgba(0, 0, 0, 0.25);box-shadow:0 1px 0 rgba(0, 0, 0, 0.25);}
|
| 422 |
+
.btn-navbar .icon-bar+.icon-bar{margin-top:3px;}
|
| 423 |
+
.nav-collapse.collapse{height:auto;}
|
| 424 |
+
.navbar .brand:hover{text-decoration:none;}
|
| 425 |
+
.navbar .brand{float:left;display:block;padding:8px 20px 12px;margin-left:-20px;font-size:20px;font-weight:200;line-height:1;color:#ffffff;}
|
| 426 |
+
.navbar .navbar-text{margin-bottom:0;line-height:40px;color:#999999;}.navbar .navbar-text a:hover{color:#ffffff;background-color:transparent;}
|
| 427 |
+
.navbar .btn,.navbar .btn-group{margin-top:5px;}
|
| 428 |
+
.navbar .btn-group .btn{margin-top:0;}
|
| 429 |
+
.navbar-form{margin-bottom:0;*zoom:1;}.navbar-form:before,.navbar-form:after{display:table;content:"";}
|
| 430 |
+
.navbar-form:after{clear:both;}
|
| 431 |
+
.navbar-form input,.navbar-form select{display:inline-block;margin-top:5px;margin-bottom:0;}
|
| 432 |
+
.navbar-form .radio,.navbar-form .checkbox{margin-top:5px;}
|
| 433 |
+
.navbar-form input[type="image"],.navbar-form input[type="checkbox"],.navbar-form input[type="radio"]{margin-top:3px;}
|
| 434 |
+
.navbar-search{position:relative;float:left;margin-top:6px;margin-bottom:0;}.navbar-search .search-query{padding:4px 9px;font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:13px;font-weight:normal;line-height:1;color:#ffffff;color:rgba(255, 255, 255, 0.75);background:#666;background:rgba(255, 255, 255, 0.3);border:1px solid #111;-webkit-box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.1),0 1px 0px rgba(255, 255, 255, 0.15);-moz-box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.1),0 1px 0px rgba(255, 255, 255, 0.15);box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.1),0 1px 0px rgba(255, 255, 255, 0.15);-webkit-transition:none;-moz-transition:none;-ms-transition:none;-o-transition:none;transition:none;}.navbar-search .search-query :-moz-placeholder{color:#eeeeee;}
|
| 435 |
+
.navbar-search .search-query::-webkit-input-placeholder{color:#eeeeee;}
|
| 436 |
+
.navbar-search .search-query:hover{color:#ffffff;background-color:#999999;background-color:rgba(255, 255, 255, 0.5);}
|
| 437 |
+
.navbar-search .search-query:focus,.navbar-search .search-query.focused{padding:5px 10px;color:#333333;text-shadow:0 1px 0 #ffffff;background-color:#ffffff;border:0;-webkit-box-shadow:0 0 3px rgba(0, 0, 0, 0.15);-moz-box-shadow:0 0 3px rgba(0, 0, 0, 0.15);box-shadow:0 0 3px rgba(0, 0, 0, 0.15);outline:0;}
|
| 438 |
+
.navbar-fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030;}
|
| 439 |
+
.navbar-fixed-top .navbar-inner{padding-left:0;padding-right:0;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0;}
|
| 440 |
+
.navbar .nav{position:relative;left:0;display:block;float:left;margin:0 10px 0 0;}
|
| 441 |
+
.navbar .nav.pull-right{float:right;}
|
| 442 |
+
.navbar .nav>li{display:block;float:left;}
|
| 443 |
+
.navbar .nav>li>a{float:none;padding:10px 10px 11px;line-height:19px;color:#999999;text-decoration:none;text-shadow:0 -1px 0 rgba(0, 0, 0, 0.25);}
|
| 444 |
+
.navbar .nav>li>a:hover{background-color:transparent;color:#ffffff;text-decoration:none;}
|
| 445 |
+
.navbar .nav .active>a,.navbar .nav .active>a:hover{color:#ffffff;text-decoration:none;background-color:#222222;background-color:rgba(0, 0, 0, 0.5);}
|
| 446 |
+
.navbar .divider-vertical{height:40px;width:1px;margin:0 9px;overflow:hidden;background-color:#222222;border-right:1px solid #333333;}
|
| 447 |
+
.navbar .nav.pull-right{margin-left:10px;margin-right:0;}
|
| 448 |
+
.navbar .dropdown-menu{margin-top:1px;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;}.navbar .dropdown-menu:before{content:'';display:inline-block;border-left:7px solid transparent;border-right:7px solid transparent;border-bottom:7px solid #ccc;border-bottom-color:rgba(0, 0, 0, 0.2);position:absolute;top:-7px;left:9px;}
|
| 449 |
+
.navbar .dropdown-menu:after{content:'';display:inline-block;border-left:6px solid transparent;border-right:6px solid transparent;border-bottom:6px solid #ffffff;position:absolute;top:-6px;left:10px;}
|
| 450 |
+
.navbar .nav .dropdown-toggle .caret,.navbar .nav .open.dropdown .caret{border-top-color:#ffffff;}
|
| 451 |
+
.navbar .nav .active .caret{opacity:1;filter:alpha(opacity=100);}
|
| 452 |
+
.navbar .nav .open>.dropdown-toggle,.navbar .nav .active>.dropdown-toggle,.navbar .nav .open.active>.dropdown-toggle{background-color:transparent;}
|
| 453 |
+
.navbar .nav .active>.dropdown-toggle:hover{color:#ffffff;}
|
| 454 |
+
.navbar .nav.pull-right .dropdown-menu{left:auto;right:0;}.navbar .nav.pull-right .dropdown-menu:before{left:auto;right:12px;}
|
| 455 |
+
.navbar .nav.pull-right .dropdown-menu:after{left:auto;right:13px;}
|
| 456 |
+
.breadcrumb{padding:7px 14px;margin:0 0 18px;background-color:#fbfbfb;background-image:-moz-linear-gradient(top, #ffffff, #f5f5f5);background-image:-ms-linear-gradient(top, #ffffff, #f5f5f5);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), to(#f5f5f5));background-image:-webkit-linear-gradient(top, #ffffff, #f5f5f5);background-image:-o-linear-gradient(top, #ffffff, #f5f5f5);background-image:linear-gradient(top, #ffffff, #f5f5f5);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#f5f5f5', GradientType=0);border:1px solid #ddd;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;-webkit-box-shadow:inset 0 1px 0 #ffffff;-moz-box-shadow:inset 0 1px 0 #ffffff;box-shadow:inset 0 1px 0 #ffffff;}.breadcrumb li{display:inline;text-shadow:0 1px 0 #ffffff;}
|
| 457 |
+
.breadcrumb .divider{padding:0 5px;color:#999999;}
|
| 458 |
+
.breadcrumb .active a{color:#333333;}
|
| 459 |
+
.pagination{height:36px;margin:18px 0;}
|
| 460 |
+
.pagination ul{display:inline-block;*display:inline;*zoom:1;margin-left:0;margin-bottom:0;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;-webkit-box-shadow:0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:0 1px 2px rgba(0, 0, 0, 0.05);}
|
| 461 |
+
.pagination li{display:inline;}
|
| 462 |
+
.pagination a{float:left;padding:0 14px;line-height:34px;text-decoration:none;border:1px solid #ddd;border-left-width:0;}
|
| 463 |
+
.pagination a:hover,.pagination .active a{background-color:#f5f5f5;}
|
| 464 |
+
.pagination .active a{color:#999999;cursor:default;}
|
| 465 |
+
.pagination .disabled a,.pagination .disabled a:hover{color:#999999;background-color:transparent;cursor:default;}
|
| 466 |
+
.pagination li:first-child a{border-left-width:1px;-webkit-border-radius:3px 0 0 3px;-moz-border-radius:3px 0 0 3px;border-radius:3px 0 0 3px;}
|
| 467 |
+
.pagination li:last-child a{-webkit-border-radius:0 3px 3px 0;-moz-border-radius:0 3px 3px 0;border-radius:0 3px 3px 0;}
|
| 468 |
+
.pagination-centered{text-align:center;}
|
| 469 |
+
.pagination-right{text-align:right;}
|
| 470 |
+
.pager{margin-left:0;margin-bottom:18px;list-style:none;text-align:center;*zoom:1;}.pager:before,.pager:after{display:table;content:"";}
|
| 471 |
+
.pager:after{clear:both;}
|
| 472 |
+
.pager li{display:inline;}
|
| 473 |
+
.pager a{display:inline-block;padding:5px 14px;background-color:#fff;border:1px solid #ddd;-webkit-border-radius:15px;-moz-border-radius:15px;border-radius:15px;}
|
| 474 |
+
.pager a:hover{text-decoration:none;background-color:#f5f5f5;}
|
| 475 |
+
.pager .next a{float:right;}
|
| 476 |
+
.pager .previous a{float:left;}
|
| 477 |
+
.thumbnails{margin-left:-20px;list-style:none;*zoom:1;}.thumbnails:before,.thumbnails:after{display:table;content:"";}
|
| 478 |
+
.thumbnails:after{clear:both;}
|
| 479 |
+
.thumbnails>li{float:left;margin:0 0 18px 20px;}
|
| 480 |
+
.thumbnail{display:block;padding:4px;line-height:1;border:1px solid #ddd;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;-webkit-box-shadow:0 1px 1px rgba(0, 0, 0, 0.075);-moz-box-shadow:0 1px 1px rgba(0, 0, 0, 0.075);box-shadow:0 1px 1px rgba(0, 0, 0, 0.075);}
|
| 481 |
+
a.thumbnail:hover{border-color:#0088cc;-webkit-box-shadow:0 1px 4px rgba(0, 105, 214, 0.25);-moz-box-shadow:0 1px 4px rgba(0, 105, 214, 0.25);box-shadow:0 1px 4px rgba(0, 105, 214, 0.25);}
|
| 482 |
+
.thumbnail>img{display:block;max-width:100%;margin-left:auto;margin-right:auto;}
|
| 483 |
+
.thumbnail .caption{padding:9px;}
|
| 484 |
+
.alert{padding:8px 35px 8px 14px;margin-bottom:18px;text-shadow:0 1px 0 rgba(255, 255, 255, 0.5);background-color:#fcf8e3;border:1px solid #fbeed5;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;}
|
| 485 |
+
.alert,.alert-heading{color:#c09853;}
|
| 486 |
+
.alert .close{position:relative;top:-2px;right:-21px;line-height:18px;}
|
| 487 |
+
.alert-success{background-color:#dff0d8;border-color:#d6e9c6;}
|
| 488 |
+
.alert-success,.alert-success .alert-heading{color:#468847;}
|
| 489 |
+
.alert-danger,.alert-error{background-color:#f2dede;border-color:#eed3d7;}
|
| 490 |
+
.alert-danger,.alert-error,.alert-danger .alert-heading,.alert-error .alert-heading{color:#b94a48;}
|
| 491 |
+
.alert-info{background-color:#d9edf7;border-color:#bce8f1;}
|
| 492 |
+
.alert-info,.alert-info .alert-heading{color:#3a87ad;}
|
| 493 |
+
.alert-block{padding-top:14px;padding-bottom:14px;}
|
| 494 |
+
.alert-block>p,.alert-block>ul{margin-bottom:0;}
|
| 495 |
+
.alert-block p+p{margin-top:5px;}
|
| 496 |
+
@-webkit-keyframes progress-bar-stripes{from{background-position:0 0;} to{background-position:40px 0;}}@-moz-keyframes progress-bar-stripes{from{background-position:0 0;} to{background-position:40px 0;}}@keyframes progress-bar-stripes{from{background-position:0 0;} to{background-position:40px 0;}}.progress{overflow:hidden;height:18px;margin-bottom:18px;background-color:#f7f7f7;background-image:-moz-linear-gradient(top, #f5f5f5, #f9f9f9);background-image:-ms-linear-gradient(top, #f5f5f5, #f9f9f9);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#f5f5f5), to(#f9f9f9));background-image:-webkit-linear-gradient(top, #f5f5f5, #f9f9f9);background-image:-o-linear-gradient(top, #f5f5f5, #f9f9f9);background-image:linear-gradient(top, #f5f5f5, #f9f9f9);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#f5f5f5', endColorstr='#f9f9f9', GradientType=0);-webkit-box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.1);-moz-box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.1);box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.1);-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;}
|
| 497 |
+
.progress .bar{width:0%;height:18px;color:#ffffff;font-size:12px;text-align:center;text-shadow:0 -1px 0 rgba(0, 0, 0, 0.25);background-color:#0e90d2;background-image:-moz-linear-gradient(top, #149bdf, #0480be);background-image:-ms-linear-gradient(top, #149bdf, #0480be);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#149bdf), to(#0480be));background-image:-webkit-linear-gradient(top, #149bdf, #0480be);background-image:-o-linear-gradient(top, #149bdf, #0480be);background-image:linear-gradient(top, #149bdf, #0480be);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#149bdf', endColorstr='#0480be', GradientType=0);-webkit-box-shadow:inset 0 -1px 0 rgba(0, 0, 0, 0.15);-moz-box-shadow:inset 0 -1px 0 rgba(0, 0, 0, 0.15);box-shadow:inset 0 -1px 0 rgba(0, 0, 0, 0.15);-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;-webkit-transition:width 0.6s ease;-moz-transition:width 0.6s ease;-ms-transition:width 0.6s ease;-o-transition:width 0.6s ease;transition:width 0.6s ease;}
|
| 498 |
+
.progress-striped .bar{background-color:#62c462;background-image:-webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent));background-image:-webkit-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:-moz-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:-ms-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:-o-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);-webkit-background-size:40px 40px;-moz-background-size:40px 40px;-o-background-size:40px 40px;background-size:40px 40px;}
|
| 499 |
+
.progress.active .bar{-webkit-animation:progress-bar-stripes 2s linear infinite;-moz-animation:progress-bar-stripes 2s linear infinite;animation:progress-bar-stripes 2s linear infinite;}
|
| 500 |
+
.progress-danger .bar{background-color:#dd514c;background-image:-moz-linear-gradient(top, #ee5f5b, #c43c35);background-image:-ms-linear-gradient(top, #ee5f5b, #c43c35);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#ee5f5b), to(#c43c35));background-image:-webkit-linear-gradient(top, #ee5f5b, #c43c35);background-image:-o-linear-gradient(top, #ee5f5b, #c43c35);background-image:linear-gradient(top, #ee5f5b, #c43c35);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ee5f5b', endColorstr='#c43c35', GradientType=0);}
|
| 501 |
+
.progress-danger.progress-striped .bar{background-color:#ee5f5b;background-image:-webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent));background-image:-webkit-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:-moz-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:-ms-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:-o-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);}
|
| 502 |
+
.progress-success .bar{background-color:#5eb95e;background-image:-moz-linear-gradient(top, #62c462, #57a957);background-image:-ms-linear-gradient(top, #62c462, #57a957);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#62c462), to(#57a957));background-image:-webkit-linear-gradient(top, #62c462, #57a957);background-image:-o-linear-gradient(top, #62c462, #57a957);background-image:linear-gradient(top, #62c462, #57a957);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#62c462', endColorstr='#57a957', GradientType=0);}
|
| 503 |
+
.progress-success.progress-striped .bar{background-color:#62c462;background-image:-webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent));background-image:-webkit-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:-moz-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:-ms-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:-o-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);}
|
| 504 |
+
.progress-info .bar{background-color:#4bb1cf;background-image:-moz-linear-gradient(top, #5bc0de, #339bb9);background-image:-ms-linear-gradient(top, #5bc0de, #339bb9);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#5bc0de), to(#339bb9));background-image:-webkit-linear-gradient(top, #5bc0de, #339bb9);background-image:-o-linear-gradient(top, #5bc0de, #339bb9);background-image:linear-gradient(top, #5bc0de, #339bb9);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#5bc0de', endColorstr='#339bb9', GradientType=0);}
|
| 505 |
+
.progress-info.progress-striped .bar{background-color:#5bc0de;background-image:-webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent));background-image:-webkit-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:-moz-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:-ms-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:-o-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-image:linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);}
|
| 506 |
+
.hero-unit{padding:60px;margin-bottom:30px;background-color:#f5f5f5;-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px;}.hero-unit h1{margin-bottom:0;font-size:60px;line-height:1;letter-spacing:-1px;}
|
| 507 |
+
.hero-unit p{font-size:18px;font-weight:200;line-height:27px;}
|
| 508 |
+
.tooltip{position:absolute;z-index:1020;display:block;visibility:visible;padding:5px;font-size:11px;opacity:0;filter:alpha(opacity=0);}.tooltip.in{opacity:0.8;filter:alpha(opacity=80);}
|
| 509 |
+
.tooltip.top{margin-top:-2px;}
|
| 510 |
+
.tooltip.right{margin-left:2px;}
|
| 511 |
+
.tooltip.bottom{margin-top:2px;}
|
| 512 |
+
.tooltip.left{margin-left:-2px;}
|
| 513 |
+
.tooltip.top .tooltip-arrow{bottom:0;left:50%;margin-left:-5px;border-left:5px solid transparent;border-right:5px solid transparent;border-top:5px solid #000000;}
|
| 514 |
+
.tooltip.left .tooltip-arrow{top:50%;right:0;margin-top:-5px;border-top:5px solid transparent;border-bottom:5px solid transparent;border-left:5px solid #000000;}
|
| 515 |
+
.tooltip.bottom .tooltip-arrow{top:0;left:50%;margin-left:-5px;border-left:5px solid transparent;border-right:5px solid transparent;border-bottom:5px solid #000000;}
|
| 516 |
+
.tooltip.right .tooltip-arrow{top:50%;left:0;margin-top:-5px;border-top:5px solid transparent;border-bottom:5px solid transparent;border-right:5px solid #000000;}
|
| 517 |
+
.tooltip-inner{max-width:200px;padding:3px 8px;color:#ffffff;text-align:center;text-decoration:none;background-color:#000000;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;}
|
| 518 |
+
.tooltip-arrow{position:absolute;width:0;height:0;}
|
| 519 |
+
.popover{position:absolute;top:0;left:0;z-index:1010;display:none;padding:5px;}.popover.top{margin-top:-5px;}
|
| 520 |
+
.popover.right{margin-left:5px;}
|
| 521 |
+
.popover.bottom{margin-top:5px;}
|
| 522 |
+
.popover.left{margin-left:-5px;}
|
| 523 |
+
.popover.top .arrow{bottom:0;left:50%;margin-left:-5px;border-left:5px solid transparent;border-right:5px solid transparent;border-top:5px solid #000000;}
|
| 524 |
+
.popover.right .arrow{top:50%;left:0;margin-top:-5px;border-top:5px solid transparent;border-bottom:5px solid transparent;border-right:5px solid #000000;}
|
| 525 |
+
.popover.bottom .arrow{top:0;left:50%;margin-left:-5px;border-left:5px solid transparent;border-right:5px solid transparent;border-bottom:5px solid #000000;}
|
| 526 |
+
.popover.left .arrow{top:50%;right:0;margin-top:-5px;border-top:5px solid transparent;border-bottom:5px solid transparent;border-left:5px solid #000000;}
|
| 527 |
+
.popover .arrow{position:absolute;width:0;height:0;}
|
| 528 |
+
.popover-inner{padding:3px;width:280px;overflow:hidden;background:#000000;background:rgba(0, 0, 0, 0.8);-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px;-webkit-box-shadow:0 3px 7px rgba(0, 0, 0, 0.3);-moz-box-shadow:0 3px 7px rgba(0, 0, 0, 0.3);box-shadow:0 3px 7px rgba(0, 0, 0, 0.3);}
|
| 529 |
+
.popover-title{padding:9px 15px;line-height:1;background-color:#f5f5f5;border-bottom:1px solid #eee;-webkit-border-radius:3px 3px 0 0;-moz-border-radius:3px 3px 0 0;border-radius:3px 3px 0 0;}
|
| 530 |
+
.popover-content{padding:14px;background-color:#ffffff;-webkit-border-radius:0 0 3px 3px;-moz-border-radius:0 0 3px 3px;border-radius:0 0 3px 3px;-webkit-background-clip:padding-box;-moz-background-clip:padding-box;background-clip:padding-box;}.popover-content p,.popover-content ul,.popover-content ol{margin-bottom:0;}
|
| 531 |
+
.modal-open .dropdown-menu{z-index:2050;}
|
| 532 |
+
.modal-open .dropdown.open{*z-index:2050;}
|
| 533 |
+
.modal-open .popover{z-index:2060;}
|
| 534 |
+
.modal-open .tooltip{z-index:2070;}
|
| 535 |
+
.modal-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1040;background-color:#000000;}.modal-backdrop.fade{opacity:0;}
|
| 536 |
+
.modal-backdrop,.modal-backdrop.fade.in{opacity:0.8;filter:alpha(opacity=80);}
|
| 537 |
+
.modal{position:fixed;top:50%;left:50%;z-index:1050;max-height:500px;overflow:auto;width:560px;margin:-250px 0 0 -280px;background-color:#ffffff;border:1px solid #999;border:1px solid rgba(0, 0, 0, 0.3);*border:1px solid #999;-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px;-webkit-box-shadow:0 3px 7px rgba(0, 0, 0, 0.3);-moz-box-shadow:0 3px 7px rgba(0, 0, 0, 0.3);box-shadow:0 3px 7px rgba(0, 0, 0, 0.3);-webkit-background-clip:padding-box;-moz-background-clip:padding-box;background-clip:padding-box;}.modal.fade{-webkit-transition:opacity .3s linear, top .3s ease-out;-moz-transition:opacity .3s linear, top .3s ease-out;-ms-transition:opacity .3s linear, top .3s ease-out;-o-transition:opacity .3s linear, top .3s ease-out;transition:opacity .3s linear, top .3s ease-out;top:-25%;}
|
| 538 |
+
.modal.fade.in{top:50%;}
|
| 539 |
+
.modal-header{padding:9px 15px;border-bottom:1px solid #eee;}.modal-header .close{margin-top:2px;}
|
| 540 |
+
.modal-body{padding:15px;}
|
| 541 |
+
.modal-footer{padding:14px 15px 15px;margin-bottom:0;background-color:#f5f5f5;border-top:1px solid #ddd;-webkit-border-radius:0 0 6px 6px;-moz-border-radius:0 0 6px 6px;border-radius:0 0 6px 6px;-webkit-box-shadow:inset 0 1px 0 #ffffff;-moz-box-shadow:inset 0 1px 0 #ffffff;box-shadow:inset 0 1px 0 #ffffff;*zoom:1;}.modal-footer:before,.modal-footer:after{display:table;content:"";}
|
| 542 |
+
.modal-footer:after{clear:both;}
|
| 543 |
+
.modal-footer .btn{float:right;margin-left:5px;margin-bottom:0;}
|
| 544 |
+
.dropdown{position:relative;}
|
| 545 |
+
.dropdown-toggle{*margin-bottom:-3px;}
|
| 546 |
+
.dropdown-toggle:active,.open .dropdown-toggle{outline:0;}
|
| 547 |
+
.caret{display:inline-block;width:0;height:0;text-indent:-99999px;*text-indent:0;vertical-align:top;border-left:4px solid transparent;border-right:4px solid transparent;border-top:4px solid #000000;opacity:0.3;filter:alpha(opacity=30);content:"\2193";}
|
| 548 |
+
.dropdown .caret{margin-top:8px;margin-left:2px;}
|
| 549 |
+
.dropdown:hover .caret,.open.dropdown .caret{opacity:1;filter:alpha(opacity=100);}
|
| 550 |
+
.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;float:left;display:none;min-width:160px;max-width:220px;_width:160px;padding:4px 0;margin:0;list-style:none;background-color:#ffffff;border-color:#ccc;border-color:rgba(0, 0, 0, 0.2);border-style:solid;border-width:1px;-webkit-border-radius:0 0 5px 5px;-moz-border-radius:0 0 5px 5px;border-radius:0 0 5px 5px;-webkit-box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);-moz-box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);-webkit-background-clip:padding-box;-moz-background-clip:padding;background-clip:padding-box;*border-right-width:2px;*border-bottom-width:2px;}.dropdown-menu.bottom-up{top:auto;bottom:100%;margin-bottom:2px;}
|
| 551 |
+
.dropdown-menu .divider{height:1px;margin:5px 1px;overflow:hidden;background-color:#e5e5e5;border-bottom:1px solid #ffffff;*width:100%;*margin:-5px 0 5px;}
|
| 552 |
+
.dropdown-menu a{display:block;padding:3px 15px;clear:both;font-weight:normal;line-height:18px;color:#555555;white-space:nowrap;}
|
| 553 |
+
.dropdown-menu li>a:hover,.dropdown-menu .active>a,.dropdown-menu .active>a:hover{color:#ffffff;text-decoration:none;background-color:#0088cc;}
|
| 554 |
+
.dropdown.open{*z-index:1000;}.dropdown.open .dropdown-toggle{color:#ffffff;background:#ccc;background:rgba(0, 0, 0, 0.3);}
|
| 555 |
+
.dropdown.open .dropdown-menu{display:block;}
|
| 556 |
+
.typeahead{margin-top:2px;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;}
|
| 557 |
+
.accordion{margin-bottom:18px;}
|
| 558 |
+
.accordion-group{margin-bottom:2px;border:1px solid #e5e5e5;-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;}
|
| 559 |
+
.accordion-heading{border-bottom:0;}
|
| 560 |
+
.accordion-heading .accordion-toggle{display:block;padding:8px 15px;}
|
| 561 |
+
.accordion-inner{padding:9px 15px;border-top:1px solid #e5e5e5;}
|
| 562 |
+
.carousel{position:relative;margin-bottom:18px;line-height:1;}
|
| 563 |
+
.carousel-inner{overflow:hidden;width:100%;position:relative;}
|
| 564 |
+
.carousel .item{display:none;position:relative;-webkit-transition:0.6s ease-in-out left;-moz-transition:0.6s ease-in-out left;-ms-transition:0.6s ease-in-out left;-o-transition:0.6s ease-in-out left;transition:0.6s ease-in-out left;}
|
| 565 |
+
.carousel .item>img{display:block;line-height:1;}
|
| 566 |
+
.carousel .active,.carousel .next,.carousel .prev{display:block;}
|
| 567 |
+
.carousel .active{left:0;}
|
| 568 |
+
.carousel .next,.carousel .prev{position:absolute;top:0;width:100%;}
|
| 569 |
+
.carousel .next{left:100%;}
|
| 570 |
+
.carousel .prev{left:-100%;}
|
| 571 |
+
.carousel .next.left,.carousel .prev.right{left:0;}
|
| 572 |
+
.carousel .active.left{left:-100%;}
|
| 573 |
+
.carousel .active.right{left:100%;}
|
| 574 |
+
.carousel-control{position:absolute;top:40%;left:15px;width:40px;height:40px;margin-top:-20px;font-size:60px;font-weight:100;line-height:30px;color:#ffffff;text-align:center;background:#222222;border:3px solid #ffffff;-webkit-border-radius:23px;-moz-border-radius:23px;border-radius:23px;opacity:0.5;filter:alpha(opacity=50);}.carousel-control.right{left:auto;right:15px;}
|
| 575 |
+
.carousel-control:hover{color:#ffffff;text-decoration:none;opacity:0.9;filter:alpha(opacity=90);}
|
| 576 |
+
.carousel-caption{position:absolute;left:0;right:0;bottom:0;padding:10px 15px 5px;background:#333333;background:rgba(0, 0, 0, 0.75);}
|
| 577 |
+
.carousel-caption h4,.carousel-caption p{color:#ffffff;}
|
| 578 |
+
.well{min-height:20px;padding:19px;margin-bottom:20px;background-color:#f5f5f5;border:1px solid #eee;border:1px solid rgba(0, 0, 0, 0.05);-webkit-border-radius:4px;-moz-border-radius:4px;border-radius:4px;-webkit-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.05);box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.05);}.well blockquote{border-color:#ddd;border-color:rgba(0, 0, 0, 0.15);}
|
| 579 |
+
.close{float:right;font-size:20px;font-weight:bold;line-height:18px;color:#000000;text-shadow:0 1px 0 #ffffff;opacity:0.2;filter:alpha(opacity=20);}.close:hover{color:#000000;text-decoration:none;opacity:0.4;filter:alpha(opacity=40);cursor:pointer;}
|
| 580 |
+
.pull-right{float:right;}
|
| 581 |
+
.pull-left{float:left;}
|
| 582 |
+
.hide{display:none;}
|
| 583 |
+
.show{display:block;}
|
| 584 |
+
.invisible{visibility:hidden;}
|
| 585 |
+
.fade{-webkit-transition:opacity 0.15s linear;-moz-transition:opacity 0.15s linear;-ms-transition:opacity 0.15s linear;-o-transition:opacity 0.15s linear;transition:opacity 0.15s linear;opacity:0;}.fade.in{opacity:1;}
|
| 586 |
+
.collapse{-webkit-transition:height 0.35s ease;-moz-transition:height 0.35s ease;-ms-transition:height 0.35s ease;-o-transition:height 0.35s ease;transition:height 0.35s ease;position:relative;overflow:hidden;height:0;}.collapse.in{height:auto;}
|
| 587 |
+
.hidden{display:none;visibility:hidden;}
|
| 588 |
+
@media (max-width:480px){.nav-collapse{-webkit-transform:translate3d(0, 0, 0);} .page-header h1 small{display:block;line-height:18px;} input[class*="span"],select[class*="span"],textarea[class*="span"],.uneditable-input{display:block;width:100%;height:28px;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;-ms-box-sizing:border-box;box-sizing:border-box;} .input-prepend input[class*="span"],.input-append input[class*="span"]{width:auto;} input[type="checkbox"],input[type="radio"]{border:1px solid #ccc;} .form-horizontal .control-group>label{float:none;width:auto;padding-top:0;text-align:left;} .form-horizontal .controls{margin-left:0;} .form-horizontal .control-list{padding-top:0;} .form-horizontal .form-actions{padding-left:10px;padding-right:10px;} .modal{position:absolute;top:10px;left:10px;right:10px;width:auto;margin:0;}.modal.fade.in{top:auto;} .modal-header .close{padding:10px;margin:-10px;} .carousel-caption{position:static;}}@media (max-width:768px){.container{width:auto;padding:0 20px;} .row-fluid{width:100%;} .row{margin-left:0;} .row>[class*="span"],.row-fluid>[class*="span"]{float:none;display:block;width:auto;margin:0;}}@media (min-width:768px) and (max-width:980px){.row{margin-left:-20px;*zoom:1;}.row:before,.row:after{display:table;content:"";} .row:after{clear:both;} [class*="span"]{float:left;margin-left:20px;} .span1{width:42px;} .span2{width:104px;} .span3{width:166px;} .span4{width:228px;} .span5{width:290px;} .span6{width:352px;} .span7{width:414px;} .span8{width:476px;} .span9{width:538px;} .span10{width:600px;} .span11{width:662px;} .span12,.container{width:724px;} .offset1{margin-left:82px;} .offset2{margin-left:144px;} .offset3{margin-left:206px;} .offset4{margin-left:268px;} .offset5{margin-left:330px;} .offset6{margin-left:392px;} .offset7{margin-left:454px;} .offset8{margin-left:516px;} .offset9{margin-left:578px;} .offset10{margin-left:640px;} .offset11{margin-left:702px;} .row-fluid{width:100%;*zoom:1;}.row-fluid:before,.row-fluid:after{display:table;content:"";} .row-fluid:after{clear:both;} .row-fluid>[class*="span"]{float:left;margin-left:2.762430939%;} .row-fluid>[class*="span"]:first-child{margin-left:0;} .row-fluid .span1{width:5.801104972%;} .row-fluid .span2{width:14.364640883%;} .row-fluid .span3{width:22.928176794%;} .row-fluid .span4{width:31.491712705%;} .row-fluid .span5{width:40.055248616%;} .row-fluid .span6{width:48.618784527%;} .row-fluid .span7{width:57.182320438000005%;} .row-fluid .span8{width:65.74585634900001%;} .row-fluid .span9{width:74.30939226%;} .row-fluid .span10{width:82.87292817100001%;} .row-fluid .span11{width:91.436464082%;} .row-fluid .span12{width:99.999999993%;} input.span1,textarea.span1,.uneditable-input.span1{width:32px;} input.span2,textarea.span2,.uneditable-input.span2{width:94px;} input.span3,textarea.span3,.uneditable-input.span3{width:156px;} input.span4,textarea.span4,.uneditable-input.span4{width:218px;} input.span5,textarea.span5,.uneditable-input.span5{width:280px;} input.span6,textarea.span6,.uneditable-input.span6{width:342px;} input.span7,textarea.span7,.uneditable-input.span7{width:404px;} input.span8,textarea.span8,.uneditable-input.span8{width:466px;} input.span9,textarea.span9,.uneditable-input.span9{width:528px;} input.span10,textarea.span10,.uneditable-input.span10{width:590px;} input.span11,textarea.span11,.uneditable-input.span11{width:652px;} input.span12,textarea.span12,.uneditable-input.span12{width:714px;}}@media (max-width:980px){body{padding-top:0;} .navbar-fixed-top{position:static;margin-bottom:18px;} .navbar-fixed-top .navbar-inner{padding:5px;} .navbar .container{width:auto;padding:0;} .navbar .brand{padding-left:10px;padding-right:10px;margin:0 0 0 -5px;} .navbar .nav-collapse{clear:left;} .navbar .nav{float:none;margin:0 0 9px;} .navbar .nav>li{float:none;} .navbar .nav>li>a{margin-bottom:2px;} .navbar .nav>.divider-vertical{display:none;} .navbar .nav>li>a,.navbar .dropdown-menu a{padding:6px 15px;font-weight:bold;color:#999999;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;} .navbar .dropdown-menu li+li a{margin-bottom:2px;} .navbar .nav>li>a:hover,.navbar .dropdown-menu a:hover{background-color:#222222;} .navbar .dropdown-menu{position:static;top:auto;left:auto;float:none;display:block;max-width:none;margin:0 15px;padding:0;background-color:transparent;border:none;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none;} .navbar .dropdown-menu:before,.navbar .dropdown-menu:after{display:none;} .navbar .dropdown-menu .divider{display:none;} .navbar-form,.navbar-search{float:none;padding:9px 15px;margin:9px 0;border-top:1px solid #222222;border-bottom:1px solid #222222;-webkit-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.1),0 1px 0 rgba(255, 255, 255, 0.1);-moz-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.1),0 1px 0 rgba(255, 255, 255, 0.1);box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.1),0 1px 0 rgba(255, 255, 255, 0.1);} .navbar .nav.pull-right{float:none;margin-left:0;} .navbar-static .navbar-inner{padding-left:10px;padding-right:10px;} .btn-navbar{display:block;} .nav-collapse{overflow:hidden;height:0;}}@media (min-width:980px){.nav-collapse.collapse{height:auto !important;}}@media (min-width:1200px){.row{margin-left:-30px;*zoom:1;}.row:before,.row:after{display:table;content:"";} .row:after{clear:both;} [class*="span"]{float:left;margin-left:30px;} .span1{width:70px;} .span2{width:170px;} .span3{width:270px;} .span4{width:370px;} .span5{width:470px;} .span6{width:570px;} .span7{width:670px;} .span8{width:770px;} .span9{width:870px;} .span10{width:970px;} .span11{width:1070px;} .span12,.container{width:1170px;} .offset1{margin-left:130px;} .offset2{margin-left:230px;} .offset3{margin-left:330px;} .offset4{margin-left:430px;} .offset5{margin-left:530px;} .offset6{margin-left:630px;} .offset7{margin-left:730px;} .offset8{margin-left:830px;} .offset9{margin-left:930px;} .offset10{margin-left:1030px;} .offset11{margin-left:1130px;} .row-fluid{width:100%;*zoom:1;}.row-fluid:before,.row-fluid:after{display:table;content:"";} .row-fluid:after{clear:both;} .row-fluid>[class*="span"]{float:left;margin-left:2.564102564%;} .row-fluid>[class*="span"]:first-child{margin-left:0;} .row-fluid .span1{width:5.982905983%;} .row-fluid .span2{width:14.529914530000001%;} .row-fluid .span3{width:23.076923077%;} .row-fluid .span4{width:31.623931624%;} .row-fluid .span5{width:40.170940171000005%;} .row-fluid .span6{width:48.717948718%;} .row-fluid .span7{width:57.264957265%;} .row-fluid .span8{width:65.81196581200001%;} .row-fluid .span9{width:74.358974359%;} .row-fluid .span10{width:82.905982906%;} .row-fluid .span11{width:91.45299145300001%;} .row-fluid .span12{width:100%;} input.span1,textarea.span1,.uneditable-input.span1{width:60px;} input.span2,textarea.span2,.uneditable-input.span2{width:160px;} input.span3,textarea.span3,.uneditable-input.span3{width:260px;} input.span4,textarea.span4,.uneditable-input.span4{width:360px;} input.span5,textarea.span5,.uneditable-input.span5{width:460px;} input.span6,textarea.span6,.uneditable-input.span6{width:560px;} input.span7,textarea.span7,.uneditable-input.span7{width:660px;} input.span8,textarea.span8,.uneditable-input.span8{width:760px;} input.span9,textarea.span9,.uneditable-input.span9{width:860px;} input.span10,textarea.span10,.uneditable-input.span10{width:960px;} input.span11,textarea.span11,.uneditable-input.span11{width:1060px;} input.span12,textarea.span12,.uneditable-input.span12{width:1160px;} .thumbnails{margin-left:-30px;} .thumbnails>li{margin-left:30px;}}
|
css/comfeed.css
ADDED
|
@@ -0,0 +1,2 @@
|
|
|
|
|
|
|
| 1 |
+
li.custom-comfeed{background-position:0px bottom !important}
|
| 2 |
+
li.custom-comfeed:hover{background-position:0px top !important}
|
css/ie7-admin-style.css
ADDED
|
@@ -0,0 +1,20 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
div#shrsb-col-left { overflow:hidden; }
|
| 2 |
+
div.box-mid-body { overflow:hidden; margin:-2px 0 0 0; }
|
| 3 |
+
div#shrsb-networks { display:block; margin:0 0 10px 0; overflow:hidden; }
|
| 4 |
+
div#shrsb-col-right { margin:40px -10px 0; right:2%; width:256px; }
|
| 5 |
+
div.box-right-head { width:256px; }
|
| 6 |
+
div.box-right-body { width:256px; overflow:hidden; }
|
| 7 |
+
div.box-right-body ul { list-style:none; padding:0; }
|
| 8 |
+
div.box-right-body ul li { list-style:none; list-style-position:outside; margin:0; padding:0; }
|
| 9 |
+
div.box-right-body ol { list-style-type:decimal !important; list-style-position:inside; }
|
| 10 |
+
div.box-right-body ol li { margin:30px 0 30px -30px; list-style-type:decimal !important; list-style-position:inside; }
|
| 11 |
+
div.box-right-body ol li:before { width:0; }
|
| 12 |
+
div.box-right-body ol li span { line-height:15px; }
|
| 13 |
+
div.dialog-box-succes { width:97.6%; }
|
| 14 |
+
div.dialog-box-error { width:97.6%; }
|
| 15 |
+
div.dialog-box-warning { width:97.6%; }
|
| 16 |
+
div.dialog-box-information { width:97.6%; }
|
| 17 |
+
img.del-x { margin-top:3px; }
|
| 18 |
+
.shebang-info { top:0; }
|
| 19 |
+
#bgimgs { display:block; overflow:hidden; padding:10px 10px 0; }
|
| 20 |
+
ul#shrsb-sortables li div.box-mid-head { width:100% !important; display:block !important; overflow:hidden !important; }
|
css/reveal/modal-gloss.png
ADDED
|
Binary file
|
css/reveal/reveal.css
ADDED
|
@@ -0,0 +1,81 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/* --------------------------------------------------
|
| 2 |
+
Reveal Modals
|
| 3 |
+
-------------------------------------------------- */
|
| 4 |
+
|
| 5 |
+
.reveal-modal-bg {
|
| 6 |
+
position: fixed;
|
| 7 |
+
height: 100%;
|
| 8 |
+
width: 100%;
|
| 9 |
+
background: #000;
|
| 10 |
+
background: rgba(0,0,0,.8);
|
| 11 |
+
z-index: 100;
|
| 12 |
+
display: none;
|
| 13 |
+
top: 0;
|
| 14 |
+
left: 0;
|
| 15 |
+
}
|
| 16 |
+
|
| 17 |
+
.reveal-modal {
|
| 18 |
+
visibility: hidden;
|
| 19 |
+
top: 100px;
|
| 20 |
+
left: 50%;
|
| 21 |
+
margin-left: -300px;
|
| 22 |
+
/* width: 520px;*/
|
| 23 |
+
background: #eee url(modal-gloss.png) no-repeat -200px -80px;
|
| 24 |
+
/* position: absolute;*/
|
| 25 |
+
position:fixed;
|
| 26 |
+
z-index: 101;
|
| 27 |
+
padding: 30px 40px 34px;
|
| 28 |
+
-moz-border-radius: 5px;
|
| 29 |
+
-webkit-border-radius: 5px;
|
| 30 |
+
border-radius: 5px;
|
| 31 |
+
-moz-box-shadow: 0 0 10px rgba(0,0,0,.4);
|
| 32 |
+
-webkit-box-shadow: 0 0 10px rgba(0,0,0,.4);
|
| 33 |
+
-box-shadow: 0 0 10px rgba(0,0,0,.4);
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
.reveal-modal-iframe {
|
| 37 |
+
border:10px solid rgba(82,82,82,0.7);
|
| 38 |
+
background:white;
|
| 39 |
+
-moz-box-shadow:3px 3px 10px #777;
|
| 40 |
+
-webkit-box-shadow:3px 3px 10px #777;
|
| 41 |
+
-webkit-border-radius:5px;
|
| 42 |
+
-moz-border-radius:5px;
|
| 43 |
+
border-radius:5px;
|
| 44 |
+
padding: 0 0 0 0;
|
| 45 |
+
}
|
| 46 |
+
.reveal-modal-iframe iframe{
|
| 47 |
+
border:0;
|
| 48 |
+
}
|
| 49 |
+
|
| 50 |
+
.reveal-modal.small { width: 200px; margin-left: -140px;}
|
| 51 |
+
.reveal-modal.medium { width: 400px; margin-left: -240px;}
|
| 52 |
+
.reveal-modal.large { width: 600px; margin-left: -340px;}
|
| 53 |
+
.reveal-modal.xlarge { width: 800px; margin-left: -440px;}
|
| 54 |
+
|
| 55 |
+
.reveal-modal .close-reveal-modal {
|
| 56 |
+
font-size: 22px;
|
| 57 |
+
line-height: .5;
|
| 58 |
+
position: absolute;
|
| 59 |
+
top: 8px;
|
| 60 |
+
right: 11px;
|
| 61 |
+
color: #aaa;
|
| 62 |
+
text-shadow: 0 -1px 1px rbga(0,0,0,.6);
|
| 63 |
+
font-weight: bold;
|
| 64 |
+
cursor: pointer;
|
| 65 |
+
}
|
| 66 |
+
/*
|
| 67 |
+
|
| 68 |
+
NOTES
|
| 69 |
+
|
| 70 |
+
Close button entity is ×
|
| 71 |
+
|
| 72 |
+
Example markup
|
| 73 |
+
|
| 74 |
+
<div id="myModal" class="reveal-modal">
|
| 75 |
+
<h2>Awesome. I have it.</h2>
|
| 76 |
+
<p class="lead">Your couch. I it's mine.</p>
|
| 77 |
+
<p>Lorem ipsum dolor sit amet, consectetur adipiscing elit. In ultrices aliquet placerat. Duis pulvinar orci et nisi euismod vitae tempus lorem consectetur. Duis at magna quis turpis mattis venenatis eget id diam. </p>
|
| 78 |
+
<a class="close-reveal-modal">×</a>
|
| 79 |
+
</div>
|
| 80 |
+
|
| 81 |
+
*/
|
css/shareaholic-promo.css
ADDED
|
@@ -0,0 +1,15 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*------------------------------------------------------------------------------------------*/
|
| 2 |
+
/* Start Ext Promo */
|
| 3 |
+
#ext-promo-prompt{display:none;position:relative;width:100%;line-height:31px;height:31px;font-size:14px;background:#ffefc6 url(https://dtym7iokkjlif.cloudfront.net/media/images/ext-promo-bg.png) repeat-x scroll 0 0;z-index:99998;/*Admin bar is 99999*/}
|
| 4 |
+
#ext-promo-prompt a{text-decoration:none;color:#0076A6;}
|
| 5 |
+
#ext-promo-prompt a:hover{color:#017FD6;}
|
| 6 |
+
#ext-promo-prompt a.close{position:relative;width:20px;float:right;margin-right:10px;margin-top:5px;width:20px;height:20px;text-indent:-9999px;background:transparent url(https://dtym7iokkjlif.cloudfront.net/media/images/ext-promo-x.png) no-repeat scroll 0 0;}
|
| 7 |
+
#ext-promo-prompt a.close:hover{background-position:0 -20px;}
|
| 8 |
+
#ext-promo-prompt a.install{position:relative;width:75px;float:right;margin-right:20px;margin-top:4px;color:black;text-align:center;line-height:19px;border:1px solid rgba(100,100,100,.4);background-image:-webkit-gradient(linear,left bottom,left top,color-stop(0.25,#bdbdbd),color-stop(0.6,#d9d9d9),color-stop(0.99,#e0dcdf));background:-moz-linear-gradient(top,#bdbdbd,#e0dcdf);}
|
| 9 |
+
#ext-promo-prompt a.install:hover{border:1px solid rgba(100,100,100,.9);}
|
| 10 |
+
/* End of functionality options Styles*/
|
| 11 |
+
/*------------------------------------------------------------------------------------------*/
|
| 12 |
+
.fs_a{font-family:Arial,Helvetica,Geneva,sans-serif;}
|
| 13 |
+
.fs_c_midgrey2{color:#555555}
|
| 14 |
+
.rounded_5{webkit-border-radius:5px;-moz-border-radius:5px;border-radius:5px;}
|
| 15 |
+
/*------------------------------------------------------------------------------------------*/
|
css/style.css
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
| 1 |
+
div.shr-bookmarks{margin:20px 0 8px;clear:both !important}div.shr-bookmarks-expand{height:32px;overflow:hidden}div.shr-bookmarks-bg-shr{padding:28px 0 0 10px !important;background:transparent url('../images/sharing-shr.png') no-repeat !important}div.shr-bookmarks-bg-caring{padding:26px 0 0 10px !important;background:transparent url('../images/sharing-caring-hearts.png') no-repeat !important}div.shr-bookmarks-bg-caring-old{padding:26px 0 0 10px !important;background:transparent url('../images/sharing-caring.png') no-repeat !important}div.shr-bookmarks-bg-love{padding:26px 0 0 10px !important;background:transparent url('../images/share-love-hearts.png') no-repeat !important}div.shr-bookmarks-bg-wealth{margin-left:15px !important;padding:35px 0 0 20px !important;background:transparent url('../images/share-wealth.png') no-repeat !important}div.shr-bookmarks-bg-enjoy{padding:26px 0 0 10px !important;background:transparent url('../images/share-enjoy.png') no-repeat !important}div.shr-bookmarks-bg-german{padding:35px 0 0 20px !important;background:transparent url('../images/share-german.png') no-repeat !important}div.shr-bookmarks-bg-knowledge{padding:35px 0 0 10px !important;background:transparent url('../images/share-knowledge.png') no-repeat !important}div.shr-bookmarks ul.socials{width:100% !important;margin:0 !important;padding:0 !important;float:left !important;background:transparent none !important;border:0 none !important;outline:0 none !important}div.shr-bookmarks ul.socials li{background-image:url('../images/shr-sprite.png') !important;background-repeat:no-repeat !important;display:inline !important;float:left !important;list-style-type:none !important;padding:0 !important;height:29px !important;width:60px !important;cursor:pointer !important;margin:3px 0 0 !important;background-color:transparent !important;border:0 none !important;outline:0 none !important;clear:none !important}div.shr-bookmarks ul.socials li:before,div.shr-bookmarks ul.socials li:after,div.shr-bookmarks ul.socials li a:before,div.shr-bookmarks ul.socials li a:after{content:'' !important}div.shr-bookmarks ul.socials a,div.shr-bookmarks ul.socials a:hover{display:block !important;width:60px !important;height:29px !important;text-indent:-9999px !important;background-color:transparent !important;text-decoration:none !important;border:0 none !important;margin:0 !important;padding:0 !important}div.shr-bookmarks div.shr-getshr{line-height:15px !important;padding-top:2px !important;padding-left:8px !important;float:left !important;}div.shr-bookmarks div.shr-getshr a{width:auto !important;font-size:10px !important;text-indent:0px !important;text-decoration:none !important;}div.shr-bookmarks ul.socials a:hover,div.shr-bookmarks ul.socials li:hover{background-color:transparent !important;border:0 none !important;outline:0 none !important}li.shr-newsvine{background-position:left bottom !important}li.shr-newsvine:hover{background-position:left top !important}li.shr-linkedin{background-position:-70px bottom !important}li.shr-linkedin:hover{background-position:-70px top !important}li.shr-googlebookmarks{background-position:-140px bottom !important}li.shr-googlebookmarks:hover{background-position:-140px top !important}li.shr-googlereader{background-position:-210px bottom !important}li.shr-googlereader:hover{background-position:-210px top !important}li.shr-scriptstyle{background-position:-280px bottom !important}li.shr-scriptstyle:hover{background-position:-280px top !important}li.shr-mail{background-position:-350px bottom !important}li.shr-mail:hover{background-position:-350px top !important}li.shr-comfeed{background-position:-420px bottom !important}li.shr-comfeed:hover{background-position:-420px top !important}li.shr-twitter{background-position:-490px bottom !important}li.shr-twitter:hover{background-position:-490px top !important}li.shr-technorati{background-position:-560px bottom !important}li.shr-technorati:hover{background-position:-560px top !important}li.shr-stumbleupon{background-position:-630px bottom !important}li.shr-stumbleupon:hover{background-position:-630px top !important}li.shr-reddit{background-position:-700px bottom !important}li.shr-reddit:hover{background-position:-700px top !important}li.shr-myspace{background-position:-770px bottom !important}li.shr-myspace:hover{background-position:-770px top !important}li.shr-mixx{background-position:-840px bottom !important}li.shr-mixx:hover{background-position:-840px top !important}li.shr-diigo{background-position:-910px bottom !important}li.shr-diigo:hover{background-position:-910px top !important}li.shr-digg{background-position:-980px bottom !important}li.shr-digg:hover{background-position:-980px top !important}li.shr-designfloat{background-position:-1050px bottom !important}li.shr-designfloat:hover{background-position:-1050px top !important}li.shr-yahoobuzz{background-position:-1120px bottom !important}li.shr-yahoobuzz:hover{background-position:-1120px top !important}li.shr-delicious{background-position:-1190px bottom !important}li.shr-delicious:hover{background-position:-1190px top !important}li.shr-blinklist{background-position:-1260px bottom !important}li.shr-blinklist:hover{background-position:-1260px top !important}li.shr-facebook{background-position:-1330px bottom !important}li.shr-facebook:hover{background-position:-1330px top !important}li.shr-misterwong{background-position:-1400px bottom !important}li.shr-misterwong:hover{background-position:-1400px top !important}li.shr-izeby{background-position:-1470px bottom !important}li.shr-izeby:hover{background-position:-1470px top !important}li.shr-twittley{background-position:-1540px bottom !important}li.shr-twittley:hover{background-position:-1540px top !important}li.shr-tipd{background-position:-1610px bottom !important}li.shr-tipd:hover{background-position:-1610px top !important}li.shr-pfbuzz{background-position:-1680px bottom !important}li.shr-pfbuzz:hover{background-position:-1680px top !important}li.shr-friendfeed{background-position:-1750px bottom !important}li.shr-friendfeed:hover{background-position:-1750px top !important}li.shr-blogmarks{background-position:-1820px bottom !important}li.shr-blogmarks:hover{background-position:-1820px top !important}li.shr-fwisp{background-position:-1890px bottom !important}li.shr-fwisp:hover{background-position:-1890px top !important}li.shr-yahoomail{background-position:-1960px bottom !important}li.shr-yahoomail:hover{background-position:-1960px top !important}li.shr-bobrdobr{background-position:-2030px bottom !important}li.shr-bobrdobr:hover{background-position:-2030px top !important}li.shr-memoryru{background-position:-2100px bottom !important}li.shr-memoryru:hover{background-position:-2100px top !important}li.shr-100zakladok{background-position:-2170px bottom !important}li.shr-100zakladok:hover{background-position:-2170px top !important}li.shr-yandex{background-position:-2240px bottom !important}li.shr-yandex:hover{background-position:-2240px top !important}li.shr-moemesto{background-position:-2310px bottom !important}li.shr-moemesto:hover{background-position:-2310px top !important}li.shr-marrows{background-position:-2380px bottom !important}li.shr-marrows:hover{background-position:-2380px top !important}li.shr-identica{background-position:-2450px bottom !important}li.shr-identica:hover{background-position:-2450px top !important}li.shr-hackernews{background-position:-2520px bottom !important}li.shr-hackernews:hover{background-position:-2520px top !important}li.shr-ning{background-position:-2590px bottom !important}li.shr-ning:hover{background-position:-2590px top !important}li.shr-designbump{background-position:-2660px bottom !important}li.shr-designbump:hover{background-position:-2660px top !important}li.shr-printfriendly{background-position:-2730px bottom !important}li.shr-printfriendly:hover{background-position:-2730px top !important}li.shr-fleck{background-position:-2800px bottom !important}li.shr-fleck:hover{background-position:-2800px top !important}li.shr-netvibes{background-position:-2870px bottom !important}li.shr-netvibes:hover{background-position:-2870px top !important}li.shr-netvouz{background-position:-2940px bottom !important}li.shr-netvouz:hover{background-position:-2940px top !important}li.shr-nujij{background-position:-3010px bottom !important}li.shr-nujij:hover{background-position:-3010px top !important}li.shr-globalgrind{background-position:-3080px bottom !important}li.shr-globalgrind:hover{background-position:-3080px top !important}li.shr-wikio{background-position:-3150px bottom !important}li.shr-wikio:hover{background-position:-3150px top !important}li.shr-xerpi{background-position:-3220px bottom !important}li.shr-xerpi:hover{background-position:-3220px top !important}li.shr-sphinn{background-position:-3290px bottom !important}li.shr-sphinn:hover{background-position:-3290px top !important}li.shr-hotmail{background-position:-3360px bottom !important}li.shr-hotmail:hover{background-position:-3360px top !important}li.shr-posterous{background-position:-3430px bottom !important}li.shr-posterous:hover{background-position:-3430px top !important}li.shr-techmeme{background-position:-3500px bottom !important}li.shr-techmeme:hover{background-position:-3500px top !important}li.shr-ekudos{background-position:-3570px bottom !important}li.shr-ekudos:hover{background-position:-3570px top !important}li.shr-pingfm{background-position:-3640px bottom !important}li.shr-pingfm:hover{background-position:-3640px top !important}li.shr-tomuse{background-position:-3710px bottom !important}li.shr-tomuse:hover{background-position:-3710px top !important}li.shr-webblend{background-position:-3780px bottom !important}li.shr-webblend:hover{background-position:-3780px top !important}li.shr-wykop{background-position:-3850px bottom !important}li.shr-wykop:hover{background-position:-3850px top !important}li.shr-blogengage{background-position:-3920px bottom !important}li.shr-blogengage:hover{background-position:-3920px top !important}li.shr-hyves{background-position:-3990px bottom !important}li.shr-hyves:hover{background-position:-3990px top !important}li.shr-pusha{background-position:-4060px bottom !important}li.shr-pusha:hover{background-position:-4060px top !important}li.shr-hatena{background-position:-4130px bottom !important}li.shr-hatena:hover{background-position:-4130px top !important}li.shr-mylinkvault{background-position:-4200px bottom !important}li.shr-mylinkvault:hover{background-position:-4200px top !important}li.shr-slashdot{background-position:-4270px bottom !important}li.shr-slashdot:hover{background-position:-4270px top !important}li.shr-squidoo{background-position:-4340px bottom !important}li.shr-squidoo:hover{background-position:-4340px top !important}li.shr-faqpal:hover{background-position:-4480px top !important}li.shr-evernote{background-position:-4550px bottom !important}li.shr-evernote:hover{background-position:-4550px top !important}li.shr-meneame{background-position:-4620px bottom !important}li.shr-meneame:hover{background-position:-4620px top !important}li.shr-bitacoras{background-position:-4690px bottom !important}li.shr-bitacoras:hover{background-position:-4690px top !important}li.shr-jumptags{background-position:-4760px bottom !important}li.shr-jumptags:hover{background-position:-4760px top !important}li.shr-bebo{background-position:-4830px bottom !important}li.shr-bebo:hover{background-position:-4830px top !important}li.shr-n4g{background-position:-4900px bottom !important}li.shr-n4g:hover{background-position:-4900px top !important}li.shr-strands{background-position:-4970px bottom !important}li.shr-strands:hover{background-position:-4970px top !important}li.shr-orkut{background-position:-5040px bottom !important}li.shr-orkut:hover{background-position:-5040px top !important}li.shr-tumblr{background-position:-5110px bottom !important}li.shr-tumblr:hover{background-position:-5110px top !important}li.shr-stumpedia{background-position:-5180px bottom !important}li.shr-stumpedia:hover{background-position:-5180px top !important}li.shr-current{background-position:-5250px bottom !important}li.shr-current:hover{background-position:-5250px top !important}li.shr-blogger{background-position:-5320px bottom !important}li.shr-blogger:hover{background-position:-5320px top !important}li.shr-plurk{background-position:-5390px bottom !important}li.shr-plurk:hover{background-position:-5390px top !important}li.shr-virb{background-position:-5460px bottom !important}li.shr-virb:hover{background-position:-5460px top !important}li.shr-dzone{background-position:-5530px bottom !important}li.shr-dzone:hover{background-position:-5530px top !important}li.shr-kaevur{background-position:-5600px bottom !important}li.shr-kaevur:hover{background-position:-5600px top !important}li.shr-box{background-position:-5670px bottom !important}li.shr-box:hover{background-position:-5670px top !important}li.shr-oknotizie{background-position:-5740px bottom !important}li.shr-oknotizie:hover{background-position:-5740px top !important}li.shr-bonzobox{background-position:-5810px bottom !important}li.shr-bonzobox:hover{background-position:-5810px top !important}li.shr-plaxo{background-position:-5880px bottom !important}li.shr-plaxo:hover{background-position:-5880px top !important}li.shr-springpad{background-position:-5950px bottom !important}li.shr-springpad:hover{background-position:-5950px top !important}li.shr-zabox{background-position:-6020px bottom !important}li.shr-zabox:hover{background-position:-6020px top !important}li.shr-viadeo{background-position:-6090px bottom !important}li.shr-viadeo:hover{background-position:-6090px top !important}li.shr-googlebuzz{background-position:-6160px bottom !important}li.shr-googlebuzz:hover{background-position:-6160px top !important}li.shr-gmail{background-position:-6230px bottom !important}li.shr-gmail:hover{background-position:-6230px top !important}li.shr-buzzster{background-position:-6300px bottom !important}li.shr-buzzster:hover{background-position:-6300px top !important}div.shr-count{font:12px bold,arial !important;position: relative !important;}div.shr-count-outline{position: absolute !important;color: white !important;}div.shr-count-center{position: absolute !important;color: blue !important;}
|
css/style.dev.css
ADDED
|
@@ -0,0 +1,200 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
div.shr-bookmarks{margin:20px 0 8px;clear:both !important}
|
| 2 |
+
div.shr-bookmarks-expand{height:32px;overflow:hidden}
|
| 3 |
+
div.shr-bookmarks-bg-shr{padding:28px 0 0 10px !important;background:transparent url('../images/sharing-shr.png') no-repeat !important}
|
| 4 |
+
div.shr-bookmarks-bg-caring{padding:26px 0 0 10px !important;background:transparent url('../images/sharing-caring-hearts.png') no-repeat !important}
|
| 5 |
+
div.shr-bookmarks-bg-caring-old{padding:26px 0 0 10px !important;background:transparent url('../images/sharing-caring.png') no-repeat !important}
|
| 6 |
+
div.shr-bookmarks-bg-love{padding:26px 0 0 10px !important;background:transparent url('../images/share-love-hearts.png') no-repeat !important}
|
| 7 |
+
div.shr-bookmarks-bg-wealth{margin-left:15px !important;padding:35px 0 0 20px !important;background:transparent url('../images/share-wealth.png') no-repeat !important}
|
| 8 |
+
div.shr-bookmarks-bg-enjoy{padding:26px 0 0 10px !important;background:transparent url('../images/share-enjoy.png') no-repeat !important}
|
| 9 |
+
div.shr-bookmarks-bg-german{padding:35px 0 0 20px !important;background:transparent url('../images/share-german.png') no-repeat !important}
|
| 10 |
+
div.shr-bookmarks-bg-knowledge{padding:35px 0 0 10px !important;background:transparent url('../images/share-knowledge.png') no-repeat !important}
|
| 11 |
+
div.shr-bookmarks ul.socials{width:100% !important;margin:0 !important;padding:0 !important;float:left !important;background:transparent none !important;border:0 none !important;outline:0 none !important}
|
| 12 |
+
div.shr-bookmarks ul.socials li{background-image:url('../images/shr-sprite.png') !important;background-repeat:no-repeat !important;display:inline !important;float:left !important;list-style-type:none !important;padding:0 !important;height:29px !important;width:60px !important;cursor:pointer !important;margin:3px 0 0 !important;background-color:transparent !important;border:0 none !important;outline:0 none !important;clear:none !important}
|
| 13 |
+
div.shr-bookmarks ul.socials li:before,div.shr-bookmarks ul.socials li:after,div.shr-bookmarks ul.socials li a:before,div.shr-bookmarks ul.socials li a:after{content:'' !important}
|
| 14 |
+
div.shr-bookmarks ul.socials a,div.shr-bookmarks ul.socials a:hover{display:block !important;width:60px !important;height:29px !important;text-indent:-9999px !important;background-color:transparent !important;text-decoration:none !important;border:0 none !important;margin:0 !important;padding:0 !important}
|
| 15 |
+
div.shr-bookmarks div.shr-getshr{line-height:15px !important;padding-top:2px !important;padding-left:8px !important;float:left !important;}
|
| 16 |
+
div.shr-bookmarks div.shr-getshr a{width:auto !important;font-size:10px !important;text-indent:0px !important;text-decoration:none !important;}
|
| 17 |
+
div.shr-bookmarks ul.socials a:hover,div.shr-bookmarks ul.socials li:hover{background-color:transparent !important;border:0 none !important;outline:0 none !important}
|
| 18 |
+
li.shr-newsvine{background-position:left bottom !important}
|
| 19 |
+
li.shr-newsvine:hover{background-position:left top !important}
|
| 20 |
+
li.shr-linkedin{background-position:-70px bottom !important}
|
| 21 |
+
li.shr-linkedin:hover{background-position:-70px top !important}
|
| 22 |
+
li.shr-googlebookmarks{background-position:-140px bottom !important}
|
| 23 |
+
li.shr-googlebookmarks:hover{background-position:-140px top !important}
|
| 24 |
+
li.shr-googlereader{background-position:-210px bottom !important}
|
| 25 |
+
li.shr-googlereader:hover{background-position:-210px top !important}
|
| 26 |
+
li.shr-scriptstyle{background-position:-280px bottom !important}
|
| 27 |
+
li.shr-scriptstyle:hover{background-position:-280px top !important}
|
| 28 |
+
li.shr-mail{background-position:-350px bottom !important}
|
| 29 |
+
li.shr-mail:hover{background-position:-350px top !important}
|
| 30 |
+
li.shr-comfeed{background-position:-420px bottom !important}
|
| 31 |
+
li.shr-comfeed:hover{background-position:-420px top !important}
|
| 32 |
+
li.shr-twitter{background-position:-490px bottom !important}
|
| 33 |
+
li.shr-twitter:hover{background-position:-490px top !important}
|
| 34 |
+
li.shr-technorati{background-position:-560px bottom !important}
|
| 35 |
+
li.shr-technorati:hover{background-position:-560px top !important}
|
| 36 |
+
li.shr-stumbleupon{background-position:-630px bottom !important}
|
| 37 |
+
li.shr-stumbleupon:hover{background-position:-630px top !important}
|
| 38 |
+
li.shr-reddit{background-position:-700px bottom !important}
|
| 39 |
+
li.shr-reddit:hover{background-position:-700px top !important}
|
| 40 |
+
li.shr-myspace{background-position:-770px bottom !important}
|
| 41 |
+
li.shr-myspace:hover{background-position:-770px top !important}
|
| 42 |
+
li.shr-mixx{background-position:-840px bottom !important}
|
| 43 |
+
li.shr-mixx:hover{background-position:-840px top !important}
|
| 44 |
+
li.shr-diigo{background-position:-910px bottom !important}
|
| 45 |
+
li.shr-diigo:hover{background-position:-910px top !important}
|
| 46 |
+
li.shr-digg{background-position:-980px bottom !important}
|
| 47 |
+
li.shr-digg:hover{background-position:-980px top !important}
|
| 48 |
+
li.shr-designfloat{background-position:-1050px bottom !important}
|
| 49 |
+
li.shr-designfloat:hover{background-position:-1050px top !important}
|
| 50 |
+
li.shr-yahoobuzz{background-position:-1120px bottom !important}
|
| 51 |
+
li.shr-yahoobuzz:hover{background-position:-1120px top !important}
|
| 52 |
+
li.shr-delicious{background-position:-1190px bottom !important}
|
| 53 |
+
li.shr-delicious:hover{background-position:-1190px top !important}
|
| 54 |
+
li.shr-blinklist{background-position:-1260px bottom !important}
|
| 55 |
+
li.shr-blinklist:hover{background-position:-1260px top !important}
|
| 56 |
+
li.shr-facebook{background-position:-1330px bottom !important}
|
| 57 |
+
li.shr-facebook:hover{background-position:-1330px top !important}
|
| 58 |
+
li.shr-misterwong{background-position:-1400px bottom !important}
|
| 59 |
+
li.shr-misterwong:hover{background-position:-1400px top !important}
|
| 60 |
+
li.shr-izeby{background-position:-1470px bottom !important}
|
| 61 |
+
li.shr-izeby:hover{background-position:-1470px top !important}
|
| 62 |
+
li.shr-twittley{background-position:-1540px bottom !important}
|
| 63 |
+
li.shr-twittley:hover{background-position:-1540px top !important}
|
| 64 |
+
li.shr-tipd{background-position:-1610px bottom !important}
|
| 65 |
+
li.shr-tipd:hover{background-position:-1610px top !important}
|
| 66 |
+
li.shr-pfbuzz{background-position:-1680px bottom !important}
|
| 67 |
+
li.shr-pfbuzz:hover{background-position:-1680px top !important}
|
| 68 |
+
li.shr-friendfeed{background-position:-1750px bottom !important}
|
| 69 |
+
li.shr-friendfeed:hover{background-position:-1750px top !important}
|
| 70 |
+
li.shr-blogmarks{background-position:-1820px bottom !important}
|
| 71 |
+
li.shr-blogmarks:hover{background-position:-1820px top !important}
|
| 72 |
+
li.shr-fwisp{background-position:-1890px bottom !important}
|
| 73 |
+
li.shr-fwisp:hover{background-position:-1890px top !important}
|
| 74 |
+
li.shr-yahoomail{background-position:-1960px bottom !important}
|
| 75 |
+
li.shr-yahoomail:hover{background-position:-1960px top !important}
|
| 76 |
+
li.shr-bobrdobr{background-position:-2030px bottom !important}
|
| 77 |
+
li.shr-bobrdobr:hover{background-position:-2030px top !important}
|
| 78 |
+
li.shr-memoryru{background-position:-2100px bottom !important}
|
| 79 |
+
li.shr-memoryru:hover{background-position:-2100px top !important}
|
| 80 |
+
li.shr-100zakladok{background-position:-2170px bottom !important}
|
| 81 |
+
li.shr-100zakladok:hover{background-position:-2170px top !important}
|
| 82 |
+
li.shr-yandex{background-position:-2240px bottom !important}
|
| 83 |
+
li.shr-yandex:hover{background-position:-2240px top !important}
|
| 84 |
+
li.shr-moemesto{background-position:-2310px bottom !important}
|
| 85 |
+
li.shr-moemesto:hover{background-position:-2310px top !important}
|
| 86 |
+
li.shr-marrows{background-position:-2380px bottom !important}
|
| 87 |
+
li.shr-marrows:hover{background-position:-2380px top !important}
|
| 88 |
+
li.shr-identica{background-position:-2450px bottom !important}
|
| 89 |
+
li.shr-identica:hover{background-position:-2450px top !important}
|
| 90 |
+
li.shr-hackernews{background-position:-2520px bottom !important}
|
| 91 |
+
li.shr-hackernews:hover{background-position:-2520px top !important}
|
| 92 |
+
li.shr-ning{background-position:-2590px bottom !important}
|
| 93 |
+
li.shr-ning:hover{background-position:-2590px top !important}
|
| 94 |
+
li.shr-designbump{background-position:-2660px bottom !important}
|
| 95 |
+
li.shr-designbump:hover{background-position:-2660px top !important}
|
| 96 |
+
li.shr-printfriendly{background-position:-2730px bottom !important}
|
| 97 |
+
li.shr-printfriendly:hover{background-position:-2730px top !important}
|
| 98 |
+
li.shr-fleck{background-position:-2800px bottom !important}
|
| 99 |
+
li.shr-fleck:hover{background-position:-2800px top !important}
|
| 100 |
+
li.shr-netvibes{background-position:-2870px bottom !important}
|
| 101 |
+
li.shr-netvibes:hover{background-position:-2870px top !important}
|
| 102 |
+
li.shr-netvouz{background-position:-2940px bottom !important}
|
| 103 |
+
li.shr-netvouz:hover{background-position:-2940px top !important}
|
| 104 |
+
li.shr-nujij{background-position:-3010px bottom !important}
|
| 105 |
+
li.shr-nujij:hover{background-position:-3010px top !important}
|
| 106 |
+
li.shr-globalgrind{background-position:-3080px bottom !important}
|
| 107 |
+
li.shr-globalgrind:hover{background-position:-3080px top !important}
|
| 108 |
+
li.shr-wikio{background-position:-3150px bottom !important}
|
| 109 |
+
li.shr-wikio:hover{background-position:-3150px top !important}
|
| 110 |
+
li.shr-xerpi{background-position:-3220px bottom !important}
|
| 111 |
+
li.shr-xerpi:hover{background-position:-3220px top !important}
|
| 112 |
+
li.shr-sphinn{background-position:-3290px bottom !important}
|
| 113 |
+
li.shr-sphinn:hover{background-position:-3290px top !important}
|
| 114 |
+
li.shr-hotmail{background-position:-3360px bottom !important}
|
| 115 |
+
li.shr-hotmail:hover{background-position:-3360px top !important}
|
| 116 |
+
li.shr-posterous{background-position:-3430px bottom !important}
|
| 117 |
+
li.shr-posterous:hover{background-position:-3430px top !important}
|
| 118 |
+
li.shr-techmeme{background-position:-3500px bottom !important}
|
| 119 |
+
li.shr-techmeme:hover{background-position:-3500px top !important}
|
| 120 |
+
li.shr-ekudos{background-position:-3570px bottom !important}
|
| 121 |
+
li.shr-ekudos:hover{background-position:-3570px top !important}
|
| 122 |
+
li.shr-pingfm{background-position:-3640px bottom !important}
|
| 123 |
+
li.shr-pingfm:hover{background-position:-3640px top !important}
|
| 124 |
+
li.shr-tomuse{background-position:-3710px bottom !important}
|
| 125 |
+
li.shr-tomuse:hover{background-position:-3710px top !important}
|
| 126 |
+
li.shr-webblend{background-position:-3780px bottom !important}
|
| 127 |
+
li.shr-webblend:hover{background-position:-3780px top !important}
|
| 128 |
+
li.shr-wykop{background-position:-3850px bottom !important}
|
| 129 |
+
li.shr-wykop:hover{background-position:-3850px top !important}
|
| 130 |
+
li.shr-blogengage{background-position:-3920px bottom !important}
|
| 131 |
+
li.shr-blogengage:hover{background-position:-3920px top !important}
|
| 132 |
+
li.shr-hyves{background-position:-3990px bottom !important}
|
| 133 |
+
li.shr-hyves:hover{background-position:-3990px top !important}
|
| 134 |
+
li.shr-pusha{background-position:-4060px bottom !important}
|
| 135 |
+
li.shr-pusha:hover{background-position:-4060px top !important}
|
| 136 |
+
li.shr-hatena{background-position:-4130px bottom !important}
|
| 137 |
+
li.shr-hatena:hover{background-position:-4130px top !important}
|
| 138 |
+
li.shr-mylinkvault{background-position:-4200px bottom !important}
|
| 139 |
+
li.shr-mylinkvault:hover{background-position:-4200px top !important}
|
| 140 |
+
li.shr-slashdot{background-position:-4270px bottom !important}
|
| 141 |
+
li.shr-slashdot:hover{background-position:-4270px top !important}
|
| 142 |
+
li.shr-squidoo{background-position:-4340px bottom !important}
|
| 143 |
+
li.shr-squidoo:hover{background-position:-4340px top !important}
|
| 144 |
+
li.shr-faqpal{background-position:-4480px bottom !important}
|
| 145 |
+
li.shr-faqpal:hover{background-position:-4480px top !important}
|
| 146 |
+
li.shr-evernote{background-position:-4550px bottom !important}
|
| 147 |
+
li.shr-evernote:hover{background-position:-4550px top !important}
|
| 148 |
+
li.shr-meneame{background-position:-4620px bottom !important}
|
| 149 |
+
li.shr-meneame:hover{background-position:-4620px top !important}
|
| 150 |
+
li.shr-bitacoras{background-position:-4690px bottom !important}
|
| 151 |
+
li.shr-bitacoras:hover{background-position:-4690px top !important}
|
| 152 |
+
li.shr-jumptags{background-position:-4760px bottom !important}
|
| 153 |
+
li.shr-jumptags:hover{background-position:-4760px top !important}
|
| 154 |
+
li.shr-bebo{background-position:-4830px bottom !important}
|
| 155 |
+
li.shr-bebo:hover{background-position:-4830px top !important}
|
| 156 |
+
li.shr-n4g{background-position:-4900px bottom !important}
|
| 157 |
+
li.shr-n4g:hover{background-position:-4900px top !important}
|
| 158 |
+
li.shr-strands{background-position:-4970px bottom !important}
|
| 159 |
+
li.shr-strands:hover{background-position:-4970px top !important}
|
| 160 |
+
li.shr-orkut{background-position:-5040px bottom !important}
|
| 161 |
+
li.shr-orkut:hover{background-position:-5040px top !important}
|
| 162 |
+
li.shr-tumblr{background-position:-5110px bottom !important}
|
| 163 |
+
li.shr-tumblr:hover{background-position:-5110px top !important}
|
| 164 |
+
li.shr-stumpedia{background-position:-5180px bottom !important}
|
| 165 |
+
li.shr-stumpedia:hover{background-position:-5180px top !important}
|
| 166 |
+
li.shr-current{background-position:-5250px bottom !important}
|
| 167 |
+
li.shr-current:hover{background-position:-5250px top !important}
|
| 168 |
+
li.shr-blogger{background-position:-5320px bottom !important}
|
| 169 |
+
li.shr-blogger:hover{background-position:-5320px top !important}
|
| 170 |
+
li.shr-plurk{background-position:-5390px bottom !important}
|
| 171 |
+
li.shr-plurk:hover{background-position:-5390px top !important}
|
| 172 |
+
li.shr-virb{background-position:-5460px bottom !important}
|
| 173 |
+
li.shr-virb:hover{background-position:-5460px top !important}
|
| 174 |
+
li.shr-dzone{background-position:-5530px bottom !important}
|
| 175 |
+
li.shr-dzone:hover{background-position:-5530px top !important}
|
| 176 |
+
li.shr-kaevur{background-position:-5600px bottom !important}
|
| 177 |
+
li.shr-kaevur:hover{background-position:-5600px top !important}
|
| 178 |
+
li.shr-box{background-position:-5670px bottom !important}
|
| 179 |
+
li.shr-box:hover{background-position:-5670px top !important}
|
| 180 |
+
li.shr-oknotizie{background-position:-5740px bottom !important}
|
| 181 |
+
li.shr-oknotizie:hover{background-position:-5740px top !important}
|
| 182 |
+
li.shr-bonzobox{background-position:-5810px bottom !important}
|
| 183 |
+
li.shr-bonzobox:hover{background-position:-5810px top !important}
|
| 184 |
+
li.shr-plaxo{background-position:-5880px bottom !important}
|
| 185 |
+
li.shr-plaxo:hover{background-position:-5880px top !important}
|
| 186 |
+
li.shr-springpad{background-position:-5950px bottom !important}
|
| 187 |
+
li.shr-springpad:hover{background-position:-5950px top !important}
|
| 188 |
+
li.shr-zabox{background-position:-6020px bottom !important}
|
| 189 |
+
li.shr-zabox:hover{background-position:-6020px top !important}
|
| 190 |
+
li.shr-viadeo{background-position:-6090px bottom !important}
|
| 191 |
+
li.shr-viadeo:hover{background-position:-6090px top !important}
|
| 192 |
+
li.shr-googlebuzz{background-position:-6160px bottom !important}
|
| 193 |
+
li.shr-googlebuzz:hover{background-position:-6160px top !important}
|
| 194 |
+
li.shr-gmail{background-position:-6230px bottom !important}
|
| 195 |
+
li.shr-gmail:hover{background-position:-6230px top !important}
|
| 196 |
+
li.shr-buzzster{background-position:-6300px bottom !important}
|
| 197 |
+
li.shr-buzzster:hover{background-position:-6300px top !important}
|
| 198 |
+
div.shr-count{font:12px bold,arial !important;position:relative !important;}
|
| 199 |
+
div.shr-count-outline{position:absolute !important;color:white !important;}
|
| 200 |
+
div.shr-count-center{position:absolute !important;color:blue !important;}
|
images/cbm.png
ADDED
|
Binary file
|
images/chart.png
ADDED
|
Binary file
|
images/circle_green.png
ADDED
|
Binary file
|
images/circle_grey.png
ADDED
|
Binary file
|
images/circle_red.png
ADDED
|
Binary file
|
images/circle_yellow.png
ADDED
|
Binary file
|
images/classicbookmark_16x16.png
ADDED
|
Binary file
|
images/classicbookmark_32x32.png
ADDED
|
Binary file
|
images/colorpicker_images/blank.gif
ADDED
|
Binary file
|
images/colorpicker_images/colorpicker_background.png
ADDED
|
Binary file
|
images/colorpicker_images/colorpicker_hex.png
ADDED
|
Binary file
|
images/colorpicker_images/colorpicker_hsb_b.png
ADDED
|
Binary file
|
images/colorpicker_images/colorpicker_hsb_h.png
ADDED
|
Binary file
|
images/colorpicker_images/colorpicker_hsb_s.png
ADDED
|
Binary file
|
images/colorpicker_images/colorpicker_indic.gif
ADDED
|
Binary file
|
images/colorpicker_images/colorpicker_overlay.png
ADDED
|
Binary file
|
images/colorpicker_images/colorpicker_rgb_b.png
ADDED
|
Binary file
|
images/colorpicker_images/colorpicker_rgb_g.png
ADDED
|
Binary file
|
images/colorpicker_images/colorpicker_rgb_r.png
ADDED
|
Binary file
|
images/colorpicker_images/colorpicker_select.gif
ADDED
|
Binary file
|
images/colorpicker_images/colorpicker_submit.png
ADDED
|
Binary file
|
images/colorpicker_images/select2.png
ADDED
|
Binary file
|
images/colorpicker_images/slider.png
ADDED
|
Binary file
|
images/comfeed.png
ADDED
|
Binary file
|
images/custom-fugue-sprite.png
ADDED
|
Binary file
|
images/error-delete.jpg
ADDED
|
Binary file
|
images/fbplusone.png
ADDED
|
Binary file
|
images/flo-head.jpg
ADDED
|
Binary file
|
images/ga-icon.png
ADDED
|
Binary file
|
images/glyphicons-halflings-white.png
ADDED
|
Binary file
|
images/glyphicons-halflings.png
ADDED
|
Binary file
|
images/googleplus.png
ADDED
|
Binary file
|
images/green-grad.png
ADDED
|
Binary file
|
images/information-delete.jpg
ADDED
|
Binary file
|
images/key.png
ADDED
|
Binary file
|
images/line-chart.png
ADDED
|
Binary file
|
images/new_badge.png
ADDED
|
Binary file
|
images/orange_arrow.gif
ADDED
|
Binary file
|
images/pinterest.png
ADDED
|
Binary file
|
images/red-grad.png
ADDED
|
Binary file
|
images/sbm.png
ADDED
|
Binary file
|
images/share-enjoy.png
ADDED
|
Binary file
|
images/share-german.png
ADDED
|
Binary file
|
images/share-knowledge.png
ADDED
|
Binary file
|
images/share-love-hearts.png
ADDED
|
Binary file
|
images/share-wealth.png
ADDED
|
Binary file
|
images/shareaholic-220.png
ADDED
|
Binary file
|
images/shareaholic_16x16.png
ADDED
|
Binary file
|
images/shareaholicmail.png
ADDED
|
Binary file
|
images/sharing-caring-hearts.png
ADDED
|
Binary file
|
images/sharing-caring.png
ADDED
|
Binary file
|
images/sharing-shr.png
ADDED
|
Binary file
|
images/shr-sprite.png
ADDED
|
Binary file
|
images/shrsb-logo.png
ADDED
|
Binary file
|
images/success-delete.jpg
ADDED
|
Binary file
|
images/thumbs-icon.png
ADDED
|
Binary file
|
images/thumbs.png
ADDED
|
Binary file
|
images/tophat.jpg
ADDED
|
Binary file
|
images/tweeth.png
ADDED
|
Binary file
|
images/tweetn.png
ADDED
|
Binary file
|
images/tweetv.png
ADDED
|
Binary file
|
images/twitter-16x16.png
ADDED
|
Binary file
|
images/warning-big.png
ADDED
|
Binary file
|
images/warning-delete.jpg
ADDED
|
Binary file
|
images/white-pix.jpg
ADDED
|
Binary file
|
includes/JSON.php
ADDED
|
@@ -0,0 +1,804 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/* vim: set expandtab tabstop=4 shiftwidth=4 softtabstop=4: */
|
| 3 |
+
|
| 4 |
+
/**
|
| 5 |
+
* Converts to and from JSON format.
|
| 6 |
+
*
|
| 7 |
+
* JSON (JavaScript Object Notation) is a lightweight data-interchange
|
| 8 |
+
* format. It is easy for humans to read and write. It is easy for machines
|
| 9 |
+
* to parse and generate. It is based on a subset of the JavaScript
|
| 10 |
+
* Programming Language, Standard ECMA-262 3rd Edition - December 1999.
|
| 11 |
+
* This feature can also be found in Python. JSON is a text format that is
|
| 12 |
+
* completely language independent but uses conventions that are familiar
|
| 13 |
+
* to programmers of the C-family of languages, including C, C++, C#, Java,
|
| 14 |
+
* JavaScript, Perl, TCL, and many others. These properties make JSON an
|
| 15 |
+
* ideal data-interchange language.
|
| 16 |
+
*
|
| 17 |
+
* This package provides a simple encoder and decoder for JSON notation. It
|
| 18 |
+
* is intended for use with client-side Javascript applications that make
|
| 19 |
+
* use of HTTPRequest to perform server communication functions - data can
|
| 20 |
+
* be encoded into JSON notation for use in a client-side javascript, or
|
| 21 |
+
* decoded from incoming Javascript requests. JSON format is native to
|
| 22 |
+
* Javascript, and can be directly eval()'ed with no further parsing
|
| 23 |
+
* overhead
|
| 24 |
+
*
|
| 25 |
+
* All strings should be in ASCII or UTF-8 format!
|
| 26 |
+
*
|
| 27 |
+
* LICENSE: Redistribution and use in source and binary forms, with or
|
| 28 |
+
* without modification, are permitted provided that the following
|
| 29 |
+
* conditions are met: Redistributions of source code must retain the
|
| 30 |
+
* above copyright notice, this list of conditions and the following
|
| 31 |
+
* disclaimer. Redistributions in binary form must reproduce the above
|
| 32 |
+
* copyright notice, this list of conditions and the following disclaimer
|
| 33 |
+
* in the documentation and/or other materials provided with the
|
| 34 |
+
* distribution.
|
| 35 |
+
*
|
| 36 |
+
* THIS SOFTWARE IS PROVIDED ``AS IS'' AND ANY EXPRESS OR IMPLIED
|
| 37 |
+
* WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
|
| 38 |
+
* MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN
|
| 39 |
+
* NO EVENT SHALL CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
|
| 40 |
+
* INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
|
| 41 |
+
* BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS
|
| 42 |
+
* OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
|
| 43 |
+
* ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR
|
| 44 |
+
* TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE
|
| 45 |
+
* USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH
|
| 46 |
+
* DAMAGE.
|
| 47 |
+
*
|
| 48 |
+
* @category
|
| 49 |
+
* @package Services_JSON
|
| 50 |
+
* @author Michal Migurski <mike-json@teczno.com>
|
| 51 |
+
* @author Matt Knapp <mdknapp[at]gmail[dot]com>
|
| 52 |
+
* @author Brett Stimmerman <brettstimmerman[at]gmail[dot]com>
|
| 53 |
+
* @copyright 2005 Michal Migurski
|
| 54 |
+
* @version CVS: $Id: JSON.php,v 1.31 2006/06/28 05:54:17 migurski Exp $
|
| 55 |
+
* @license http://www.opensource.org/licenses/bsd-license.php
|
| 56 |
+
* @link http://pear.php.net/pepr/pepr-proposal-show.php?id=198
|
| 57 |
+
*/
|
| 58 |
+
|
| 59 |
+
/**
|
| 60 |
+
* Marker constant for Services_JSON::decode(), used to flag stack state
|
| 61 |
+
*/
|
| 62 |
+
define('SERVICES_JSON_SLICE', 1);
|
| 63 |
+
|
| 64 |
+
/**
|
| 65 |
+
* Marker constant for Services_JSON::decode(), used to flag stack state
|
| 66 |
+
*/
|
| 67 |
+
define('SERVICES_JSON_IN_STR', 2);
|
| 68 |
+
|
| 69 |
+
/**
|
| 70 |
+
* Marker constant for Services_JSON::decode(), used to flag stack state
|
| 71 |
+
*/
|
| 72 |
+
define('SERVICES_JSON_IN_ARR', 3);
|
| 73 |
+
|
| 74 |
+
/**
|
| 75 |
+
* Marker constant for Services_JSON::decode(), used to flag stack state
|
| 76 |
+
*/
|
| 77 |
+
define('SERVICES_JSON_IN_OBJ', 4);
|
| 78 |
+
|
| 79 |
+
/**
|
| 80 |
+
* Marker constant for Services_JSON::decode(), used to flag stack state
|
| 81 |
+
*/
|
| 82 |
+
define('SERVICES_JSON_IN_CMT', 5);
|
| 83 |
+
|
| 84 |
+
/**
|
| 85 |
+
* Behavior switch for Services_JSON::decode()
|
| 86 |
+
*/
|
| 87 |
+
define('SERVICES_JSON_LOOSE_TYPE', 16);
|
| 88 |
+
|
| 89 |
+
/**
|
| 90 |
+
* Behavior switch for Services_JSON::decode()
|
| 91 |
+
*/
|
| 92 |
+
define('SERVICES_JSON_SUPPRESS_ERRORS', 32);
|
| 93 |
+
|
| 94 |
+
/**
|
| 95 |
+
* Converts to and from JSON format.
|
| 96 |
+
*
|
| 97 |
+
* Brief example of use:
|
| 98 |
+
*
|
| 99 |
+
* <code>
|
| 100 |
+
* // create a new instance of Services_JSON
|
| 101 |
+
* $json = new Services_JSON();
|
| 102 |
+
*
|
| 103 |
+
* // convert a complexe value to JSON notation, and send it to the browser
|
| 104 |
+
* $value = array('foo', 'bar', array(1, 2, 'baz'), array(3, array(4)));
|
| 105 |
+
* $output = $json->encode($value);
|
| 106 |
+
*
|
| 107 |
+
* print($output);
|
| 108 |
+
* // prints: ["foo","bar",[1,2,"baz"],[3,[4]]]
|
| 109 |
+
*
|
| 110 |
+
* // accept incoming POST data, assumed to be in JSON notation
|
| 111 |
+
* $input = file_get_contents('php://input', 1000000);
|
| 112 |
+
* $value = $json->decode($input);
|
| 113 |
+
* </code>
|
| 114 |
+
*/
|
| 115 |
+
|
| 116 |
+
class Services_JSON
|
| 117 |
+
{
|
| 118 |
+
/**
|
| 119 |
+
* constructs a new JSON instance
|
| 120 |
+
*
|
| 121 |
+
* @param int $use object behavior flags; combine with boolean-OR
|
| 122 |
+
*
|
| 123 |
+
* possible values:
|
| 124 |
+
* - SERVICES_JSON_LOOSE_TYPE: loose typing.
|
| 125 |
+
* "{...}" syntax creates associative arrays
|
| 126 |
+
* instead of objects in decode().
|
| 127 |
+
* - SERVICES_JSON_SUPPRESS_ERRORS: error suppression.
|
| 128 |
+
* Values which can't be encoded (e.g. resources)
|
| 129 |
+
* appear as NULL instead of throwing errors.
|
| 130 |
+
* By default, a deeply-nested resource will
|
| 131 |
+
* bubble up with an error, so all return values
|
| 132 |
+
* from encode() should be checked with isError()
|
| 133 |
+
*/
|
| 134 |
+
function Services_JSON($use = 0)
|
| 135 |
+
{
|
| 136 |
+
$this->use = $use;
|
| 137 |
+
}
|
| 138 |
+
|
| 139 |
+
/**
|
| 140 |
+
* convert a string from one UTF-16 char to one UTF-8 char
|
| 141 |
+
*
|
| 142 |
+
* Normally should be handled by mb_convert_encoding, but
|
| 143 |
+
* provides a slower PHP-only method for installations
|
| 144 |
+
* that lack the multibye string extension.
|
| 145 |
+
*
|
| 146 |
+
* @param string $utf16 UTF-16 character
|
| 147 |
+
* @return string UTF-8 character
|
| 148 |
+
* @access private
|
| 149 |
+
*/
|
| 150 |
+
function utf162utf8($utf16)
|
| 151 |
+
{
|
| 152 |
+
// oh please oh please oh please oh please oh please
|
| 153 |
+
if(function_exists('mb_convert_encoding')) {
|
| 154 |
+
return mb_convert_encoding($utf16, 'UTF-8', 'UTF-16');
|
| 155 |
+
}
|
| 156 |
+
|
| 157 |
+
$bytes = (ord($utf16{0}) << 8) | ord($utf16{1});
|
| 158 |
+
|
| 159 |
+
switch(true) {
|
| 160 |
+
case ((0x7F & $bytes) == $bytes):
|
| 161 |
+
// this case should never be reached, because we are in ASCII range
|
| 162 |
+
// see: http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 163 |
+
return chr(0x7F & $bytes);
|
| 164 |
+
|
| 165 |
+
case (0x07FF & $bytes) == $bytes:
|
| 166 |
+
// return a 2-byte UTF-8 character
|
| 167 |
+
// see: http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 168 |
+
return chr(0xC0 | (($bytes >> 6) & 0x1F))
|
| 169 |
+
. chr(0x80 | ($bytes & 0x3F));
|
| 170 |
+
|
| 171 |
+
case (0xFFFF & $bytes) == $bytes:
|
| 172 |
+
// return a 3-byte UTF-8 character
|
| 173 |
+
// see: http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 174 |
+
return chr(0xE0 | (($bytes >> 12) & 0x0F))
|
| 175 |
+
. chr(0x80 | (($bytes >> 6) & 0x3F))
|
| 176 |
+
. chr(0x80 | ($bytes & 0x3F));
|
| 177 |
+
}
|
| 178 |
+
|
| 179 |
+
// ignoring UTF-32 for now, sorry
|
| 180 |
+
return '';
|
| 181 |
+
}
|
| 182 |
+
|
| 183 |
+
/**
|
| 184 |
+
* convert a string from one UTF-8 char to one UTF-16 char
|
| 185 |
+
*
|
| 186 |
+
* Normally should be handled by mb_convert_encoding, but
|
| 187 |
+
* provides a slower PHP-only method for installations
|
| 188 |
+
* that lack the multibye string extension.
|
| 189 |
+
*
|
| 190 |
+
* @param string $utf8 UTF-8 character
|
| 191 |
+
* @return string UTF-16 character
|
| 192 |
+
* @access private
|
| 193 |
+
*/
|
| 194 |
+
function utf82utf16($utf8)
|
| 195 |
+
{
|
| 196 |
+
// oh please oh please oh please oh please oh please
|
| 197 |
+
if(function_exists('mb_convert_encoding')) {
|
| 198 |
+
return mb_convert_encoding($utf8, 'UTF-16', 'UTF-8');
|
| 199 |
+
}
|
| 200 |
+
|
| 201 |
+
switch(strlen($utf8)) {
|
| 202 |
+
case 1:
|
| 203 |
+
// this case should never be reached, because we are in ASCII range
|
| 204 |
+
// see: http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 205 |
+
return $utf8;
|
| 206 |
+
|
| 207 |
+
case 2:
|
| 208 |
+
// return a UTF-16 character from a 2-byte UTF-8 char
|
| 209 |
+
// see: http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 210 |
+
return chr(0x07 & (ord($utf8{0}) >> 2))
|
| 211 |
+
. chr((0xC0 & (ord($utf8{0}) << 6))
|
| 212 |
+
| (0x3F & ord($utf8{1})));
|
| 213 |
+
|
| 214 |
+
case 3:
|
| 215 |
+
// return a UTF-16 character from a 3-byte UTF-8 char
|
| 216 |
+
// see: http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 217 |
+
return chr((0xF0 & (ord($utf8{0}) << 4))
|
| 218 |
+
| (0x0F & (ord($utf8{1}) >> 2)))
|
| 219 |
+
. chr((0xC0 & (ord($utf8{1}) << 6))
|
| 220 |
+
| (0x7F & ord($utf8{2})));
|
| 221 |
+
}
|
| 222 |
+
|
| 223 |
+
// ignoring UTF-32 for now, sorry
|
| 224 |
+
return '';
|
| 225 |
+
}
|
| 226 |
+
|
| 227 |
+
/**
|
| 228 |
+
* encodes an arbitrary variable into JSON format
|
| 229 |
+
*
|
| 230 |
+
* @param mixed $var any number, boolean, string, array, or object to be encoded.
|
| 231 |
+
* see argument 1 to Services_JSON() above for array-parsing behavior.
|
| 232 |
+
* if var is a strng, note that encode() always expects it
|
| 233 |
+
* to be in ASCII or UTF-8 format!
|
| 234 |
+
*
|
| 235 |
+
* @return mixed JSON string representation of input var or an error if a problem occurs
|
| 236 |
+
* @access public
|
| 237 |
+
*/
|
| 238 |
+
function encode($var)
|
| 239 |
+
{
|
| 240 |
+
switch (gettype($var)) {
|
| 241 |
+
case 'boolean':
|
| 242 |
+
return $var ? 'true' : 'false';
|
| 243 |
+
|
| 244 |
+
case 'NULL':
|
| 245 |
+
return 'null';
|
| 246 |
+
|
| 247 |
+
case 'integer':
|
| 248 |
+
return (int) $var;
|
| 249 |
+
|
| 250 |
+
case 'double':
|
| 251 |
+
case 'float':
|
| 252 |
+
return (float) $var;
|
| 253 |
+
|
| 254 |
+
case 'string':
|
| 255 |
+
// STRINGS ARE EXPECTED TO BE IN ASCII OR UTF-8 FORMAT
|
| 256 |
+
$ascii = '';
|
| 257 |
+
$strlen_var = strlen($var);
|
| 258 |
+
|
| 259 |
+
/*
|
| 260 |
+
* Iterate over every character in the string,
|
| 261 |
+
* escaping with a slash or encoding to UTF-8 where necessary
|
| 262 |
+
*/
|
| 263 |
+
for ($c = 0; $c < $strlen_var; ++$c) {
|
| 264 |
+
|
| 265 |
+
$ord_var_c = ord($var{$c});
|
| 266 |
+
|
| 267 |
+
switch (true) {
|
| 268 |
+
case $ord_var_c == 0x08:
|
| 269 |
+
$ascii .= '\b';
|
| 270 |
+
break;
|
| 271 |
+
case $ord_var_c == 0x09:
|
| 272 |
+
$ascii .= '\t';
|
| 273 |
+
break;
|
| 274 |
+
case $ord_var_c == 0x0A:
|
| 275 |
+
$ascii .= '\n';
|
| 276 |
+
break;
|
| 277 |
+
case $ord_var_c == 0x0C:
|
| 278 |
+
$ascii .= '\f';
|
| 279 |
+
break;
|
| 280 |
+
case $ord_var_c == 0x0D:
|
| 281 |
+
$ascii .= '\r';
|
| 282 |
+
break;
|
| 283 |
+
|
| 284 |
+
case $ord_var_c == 0x22:
|
| 285 |
+
case $ord_var_c == 0x2F:
|
| 286 |
+
case $ord_var_c == 0x5C:
|
| 287 |
+
// double quote, slash, slosh
|
| 288 |
+
$ascii .= '\\'.$var{$c};
|
| 289 |
+
break;
|
| 290 |
+
|
| 291 |
+
case (($ord_var_c >= 0x20) && ($ord_var_c <= 0x7F)):
|
| 292 |
+
// characters U-00000000 - U-0000007F (same as ASCII)
|
| 293 |
+
$ascii .= $var{$c};
|
| 294 |
+
break;
|
| 295 |
+
|
| 296 |
+
case (($ord_var_c & 0xE0) == 0xC0):
|
| 297 |
+
// characters U-00000080 - U-000007FF, mask 110XXXXX
|
| 298 |
+
// see http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 299 |
+
$char = pack('C*', $ord_var_c, ord($var{$c + 1}));
|
| 300 |
+
$c += 1;
|
| 301 |
+
$utf16 = $this->utf82utf16($char);
|
| 302 |
+
$ascii .= sprintf('\u%04s', bin2hex($utf16));
|
| 303 |
+
break;
|
| 304 |
+
|
| 305 |
+
case (($ord_var_c & 0xF0) == 0xE0):
|
| 306 |
+
// characters U-00000800 - U-0000FFFF, mask 1110XXXX
|
| 307 |
+
// see http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 308 |
+
$char = pack('C*', $ord_var_c,
|
| 309 |
+
ord($var{$c + 1}),
|
| 310 |
+
ord($var{$c + 2}));
|
| 311 |
+
$c += 2;
|
| 312 |
+
$utf16 = $this->utf82utf16($char);
|
| 313 |
+
$ascii .= sprintf('\u%04s', bin2hex($utf16));
|
| 314 |
+
break;
|
| 315 |
+
|
| 316 |
+
case (($ord_var_c & 0xF8) == 0xF0):
|
| 317 |
+
// characters U-00010000 - U-001FFFFF, mask 11110XXX
|
| 318 |
+
// see http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 319 |
+
$char = pack('C*', $ord_var_c,
|
| 320 |
+
ord($var{$c + 1}),
|
| 321 |
+
ord($var{$c + 2}),
|
| 322 |
+
ord($var{$c + 3}));
|
| 323 |
+
$c += 3;
|
| 324 |
+
$utf16 = $this->utf82utf16($char);
|
| 325 |
+
$ascii .= sprintf('\u%04s', bin2hex($utf16));
|
| 326 |
+
break;
|
| 327 |
+
|
| 328 |
+
case (($ord_var_c & 0xFC) == 0xF8):
|
| 329 |
+
// characters U-00200000 - U-03FFFFFF, mask 111110XX
|
| 330 |
+
// see http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 331 |
+
$char = pack('C*', $ord_var_c,
|
| 332 |
+
ord($var{$c + 1}),
|
| 333 |
+
ord($var{$c + 2}),
|
| 334 |
+
ord($var{$c + 3}),
|
| 335 |
+
ord($var{$c + 4}));
|
| 336 |
+
$c += 4;
|
| 337 |
+
$utf16 = $this->utf82utf16($char);
|
| 338 |
+
$ascii .= sprintf('\u%04s', bin2hex($utf16));
|
| 339 |
+
break;
|
| 340 |
+
|
| 341 |
+
case (($ord_var_c & 0xFE) == 0xFC):
|
| 342 |
+
// characters U-04000000 - U-7FFFFFFF, mask 1111110X
|
| 343 |
+
// see http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 344 |
+
$char = pack('C*', $ord_var_c,
|
| 345 |
+
ord($var{$c + 1}),
|
| 346 |
+
ord($var{$c + 2}),
|
| 347 |
+
ord($var{$c + 3}),
|
| 348 |
+
ord($var{$c + 4}),
|
| 349 |
+
ord($var{$c + 5}));
|
| 350 |
+
$c += 5;
|
| 351 |
+
$utf16 = $this->utf82utf16($char);
|
| 352 |
+
$ascii .= sprintf('\u%04s', bin2hex($utf16));
|
| 353 |
+
break;
|
| 354 |
+
}
|
| 355 |
+
}
|
| 356 |
+
|
| 357 |
+
return '"'.$ascii.'"';
|
| 358 |
+
|
| 359 |
+
case 'array':
|
| 360 |
+
/*
|
| 361 |
+
* As per JSON spec if any array key is not an integer
|
| 362 |
+
* we must treat the the whole array as an object. We
|
| 363 |
+
* also try to catch a sparsely populated associative
|
| 364 |
+
* array with numeric keys here because some JS engines
|
| 365 |
+
* will create an array with empty indexes up to
|
| 366 |
+
* max_index which can cause memory issues and because
|
| 367 |
+
* the keys, which may be relevant, will be remapped
|
| 368 |
+
* otherwise.
|
| 369 |
+
*
|
| 370 |
+
* As per the ECMA and JSON specification an object may
|
| 371 |
+
* have any string as a property. Unfortunately due to
|
| 372 |
+
* a hole in the ECMA specification if the key is a
|
| 373 |
+
* ECMA reserved word or starts with a digit the
|
| 374 |
+
* parameter is only accessible using ECMAScript's
|
| 375 |
+
* bracket notation.
|
| 376 |
+
*/
|
| 377 |
+
|
| 378 |
+
// treat as a JSON object
|
| 379 |
+
if (is_array($var) && count($var) && (array_keys($var) !== range(0, sizeof($var) - 1))) {
|
| 380 |
+
$properties = array_map(array($this, 'name_value'),
|
| 381 |
+
array_keys($var),
|
| 382 |
+
array_values($var));
|
| 383 |
+
|
| 384 |
+
foreach($properties as $property) {
|
| 385 |
+
if(Services_JSON::isError($property)) {
|
| 386 |
+
return $property;
|
| 387 |
+
}
|
| 388 |
+
}
|
| 389 |
+
|
| 390 |
+
return '{' . join(',', $properties) . '}';
|
| 391 |
+
}
|
| 392 |
+
|
| 393 |
+
// treat it like a regular array
|
| 394 |
+
$elements = array_map(array($this, 'encode'), $var);
|
| 395 |
+
|
| 396 |
+
foreach($elements as $element) {
|
| 397 |
+
if(Services_JSON::isError($element)) {
|
| 398 |
+
return $element;
|
| 399 |
+
}
|
| 400 |
+
}
|
| 401 |
+
|
| 402 |
+
return '[' . join(',', $elements) . ']';
|
| 403 |
+
|
| 404 |
+
case 'object':
|
| 405 |
+
$vars = get_object_vars($var);
|
| 406 |
+
|
| 407 |
+
$properties = array_map(array($this, 'name_value'),
|
| 408 |
+
array_keys($vars),
|
| 409 |
+
array_values($vars));
|
| 410 |
+
|
| 411 |
+
foreach($properties as $property) {
|
| 412 |
+
if(Services_JSON::isError($property)) {
|
| 413 |
+
return $property;
|
| 414 |
+
}
|
| 415 |
+
}
|
| 416 |
+
|
| 417 |
+
return '{' . join(',', $properties) . '}';
|
| 418 |
+
|
| 419 |
+
default:
|
| 420 |
+
return ($this->use & SERVICES_JSON_SUPPRESS_ERRORS)
|
| 421 |
+
? 'null'
|
| 422 |
+
: new Services_JSON_Error(gettype($var)." can not be encoded as JSON string");
|
| 423 |
+
}
|
| 424 |
+
}
|
| 425 |
+
|
| 426 |
+
/**
|
| 427 |
+
* array-walking function for use in generating JSON-formatted name-value pairs
|
| 428 |
+
*
|
| 429 |
+
* @param string $name name of key to use
|
| 430 |
+
* @param mixed $value reference to an array element to be encoded
|
| 431 |
+
*
|
| 432 |
+
* @return string JSON-formatted name-value pair, like '"name":value'
|
| 433 |
+
* @access private
|
| 434 |
+
*/
|
| 435 |
+
function name_value($name, $value)
|
| 436 |
+
{
|
| 437 |
+
$encoded_value = $this->encode($value);
|
| 438 |
+
|
| 439 |
+
if(Services_JSON::isError($encoded_value)) {
|
| 440 |
+
return $encoded_value;
|
| 441 |
+
}
|
| 442 |
+
|
| 443 |
+
return $this->encode(strval($name)) . ':' . $encoded_value;
|
| 444 |
+
}
|
| 445 |
+
|
| 446 |
+
/**
|
| 447 |
+
* reduce a string by removing leading and trailing comments and whitespace
|
| 448 |
+
*
|
| 449 |
+
* @param $str string string value to strip of comments and whitespace
|
| 450 |
+
*
|
| 451 |
+
* @return string string value stripped of comments and whitespace
|
| 452 |
+
* @access private
|
| 453 |
+
*/
|
| 454 |
+
function reduce_string($str)
|
| 455 |
+
{
|
| 456 |
+
$str = preg_replace(array(
|
| 457 |
+
|
| 458 |
+
// eliminate single line comments in '// ...' form
|
| 459 |
+
'#^\s*//(.+)$#m',
|
| 460 |
+
|
| 461 |
+
// eliminate multi-line comments in '/* ... */' form, at start of string
|
| 462 |
+
'#^\s*/\*(.+)\*/#Us',
|
| 463 |
+
|
| 464 |
+
// eliminate multi-line comments in '/* ... */' form, at end of string
|
| 465 |
+
'#/\*(.+)\*/\s*$#Us'
|
| 466 |
+
|
| 467 |
+
), '', $str);
|
| 468 |
+
|
| 469 |
+
// eliminate extraneous space
|
| 470 |
+
return trim($str);
|
| 471 |
+
}
|
| 472 |
+
|
| 473 |
+
/**
|
| 474 |
+
* decodes a JSON string into appropriate variable
|
| 475 |
+
*
|
| 476 |
+
* @param string $str JSON-formatted string
|
| 477 |
+
*
|
| 478 |
+
* @return mixed number, boolean, string, array, or object
|
| 479 |
+
* corresponding to given JSON input string.
|
| 480 |
+
* See argument 1 to Services_JSON() above for object-output behavior.
|
| 481 |
+
* Note that decode() always returns strings
|
| 482 |
+
* in ASCII or UTF-8 format!
|
| 483 |
+
* @access public
|
| 484 |
+
*/
|
| 485 |
+
function decode($str)
|
| 486 |
+
{
|
| 487 |
+
$str = $this->reduce_string($str);
|
| 488 |
+
|
| 489 |
+
switch (strtolower($str)) {
|
| 490 |
+
case 'true':
|
| 491 |
+
return true;
|
| 492 |
+
|
| 493 |
+
case 'false':
|
| 494 |
+
return false;
|
| 495 |
+
|
| 496 |
+
case 'null':
|
| 497 |
+
return null;
|
| 498 |
+
|
| 499 |
+
default:
|
| 500 |
+
$m = array();
|
| 501 |
+
|
| 502 |
+
if (is_numeric($str)) {
|
| 503 |
+
// Lookie-loo, it's a number
|
| 504 |
+
|
| 505 |
+
// This would work on its own, but I'm trying to be
|
| 506 |
+
// good about returning integers where appropriate:
|
| 507 |
+
// return (float)$str;
|
| 508 |
+
|
| 509 |
+
// Return float or int, as appropriate
|
| 510 |
+
return ((float)$str == (integer)$str)
|
| 511 |
+
? (integer)$str
|
| 512 |
+
: (float)$str;
|
| 513 |
+
|
| 514 |
+
} elseif (preg_match('/^("|\').*(\1)$/s', $str, $m) && $m[1] == $m[2]) {
|
| 515 |
+
// STRINGS RETURNED IN UTF-8 FORMAT
|
| 516 |
+
$delim = substr($str, 0, 1);
|
| 517 |
+
$chrs = substr($str, 1, -1);
|
| 518 |
+
$utf8 = '';
|
| 519 |
+
$strlen_chrs = strlen($chrs);
|
| 520 |
+
|
| 521 |
+
for ($c = 0; $c < $strlen_chrs; ++$c) {
|
| 522 |
+
|
| 523 |
+
$substr_chrs_c_2 = substr($chrs, $c, 2);
|
| 524 |
+
$ord_chrs_c = ord($chrs{$c});
|
| 525 |
+
|
| 526 |
+
switch (true) {
|
| 527 |
+
case $substr_chrs_c_2 == '\b':
|
| 528 |
+
$utf8 .= chr(0x08);
|
| 529 |
+
++$c;
|
| 530 |
+
break;
|
| 531 |
+
case $substr_chrs_c_2 == '\t':
|
| 532 |
+
$utf8 .= chr(0x09);
|
| 533 |
+
++$c;
|
| 534 |
+
break;
|
| 535 |
+
case $substr_chrs_c_2 == '\n':
|
| 536 |
+
$utf8 .= chr(0x0A);
|
| 537 |
+
++$c;
|
| 538 |
+
break;
|
| 539 |
+
case $substr_chrs_c_2 == '\f':
|
| 540 |
+
$utf8 .= chr(0x0C);
|
| 541 |
+
++$c;
|
| 542 |
+
break;
|
| 543 |
+
case $substr_chrs_c_2 == '\r':
|
| 544 |
+
$utf8 .= chr(0x0D);
|
| 545 |
+
++$c;
|
| 546 |
+
break;
|
| 547 |
+
|
| 548 |
+
case $substr_chrs_c_2 == '\\"':
|
| 549 |
+
case $substr_chrs_c_2 == '\\\'':
|
| 550 |
+
case $substr_chrs_c_2 == '\\\\':
|
| 551 |
+
case $substr_chrs_c_2 == '\\/':
|
| 552 |
+
if (($delim == '"' && $substr_chrs_c_2 != '\\\'') ||
|
| 553 |
+
($delim == "'" && $substr_chrs_c_2 != '\\"')) {
|
| 554 |
+
$utf8 .= $chrs{++$c};
|
| 555 |
+
}
|
| 556 |
+
break;
|
| 557 |
+
|
| 558 |
+
case preg_match('/\\\u[0-9A-F]{4}/i', substr($chrs, $c, 6)):
|
| 559 |
+
// single, escaped unicode character
|
| 560 |
+
$utf16 = chr(hexdec(substr($chrs, ($c + 2), 2)))
|
| 561 |
+
. chr(hexdec(substr($chrs, ($c + 4), 2)));
|
| 562 |
+
$utf8 .= $this->utf162utf8($utf16);
|
| 563 |
+
$c += 5;
|
| 564 |
+
break;
|
| 565 |
+
|
| 566 |
+
case ($ord_chrs_c >= 0x20) && ($ord_chrs_c <= 0x7F):
|
| 567 |
+
$utf8 .= $chrs{$c};
|
| 568 |
+
break;
|
| 569 |
+
|
| 570 |
+
case ($ord_chrs_c & 0xE0) == 0xC0:
|
| 571 |
+
// characters U-00000080 - U-000007FF, mask 110XXXXX
|
| 572 |
+
//see http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 573 |
+
$utf8 .= substr($chrs, $c, 2);
|
| 574 |
+
++$c;
|
| 575 |
+
break;
|
| 576 |
+
|
| 577 |
+
case ($ord_chrs_c & 0xF0) == 0xE0:
|
| 578 |
+
// characters U-00000800 - U-0000FFFF, mask 1110XXXX
|
| 579 |
+
// see http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 580 |
+
$utf8 .= substr($chrs, $c, 3);
|
| 581 |
+
$c += 2;
|
| 582 |
+
break;
|
| 583 |
+
|
| 584 |
+
case ($ord_chrs_c & 0xF8) == 0xF0:
|
| 585 |
+
// characters U-00010000 - U-001FFFFF, mask 11110XXX
|
| 586 |
+
// see http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 587 |
+
$utf8 .= substr($chrs, $c, 4);
|
| 588 |
+
$c += 3;
|
| 589 |
+
break;
|
| 590 |
+
|
| 591 |
+
case ($ord_chrs_c & 0xFC) == 0xF8:
|
| 592 |
+
// characters U-00200000 - U-03FFFFFF, mask 111110XX
|
| 593 |
+
// see http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 594 |
+
$utf8 .= substr($chrs, $c, 5);
|
| 595 |
+
$c += 4;
|
| 596 |
+
break;
|
| 597 |
+
|
| 598 |
+
case ($ord_chrs_c & 0xFE) == 0xFC:
|
| 599 |
+
// characters U-04000000 - U-7FFFFFFF, mask 1111110X
|
| 600 |
+
// see http://www.cl.cam.ac.uk/~mgk25/unicode.html#utf-8
|
| 601 |
+
$utf8 .= substr($chrs, $c, 6);
|
| 602 |
+
$c += 5;
|
| 603 |
+
break;
|
| 604 |
+
|
| 605 |
+
}
|
| 606 |
+
|
| 607 |
+
}
|
| 608 |
+
|
| 609 |
+
return $utf8;
|
| 610 |
+
|
| 611 |
+
} elseif (preg_match('/^\[.*\]$/s', $str) || preg_match('/^\{.*\}$/s', $str)) {
|
| 612 |
+
// array, or object notation
|
| 613 |
+
|
| 614 |
+
if ($str{0} == '[') {
|
| 615 |
+
$stk = array(SERVICES_JSON_IN_ARR);
|
| 616 |
+
$arr = array();
|
| 617 |
+
} else {
|
| 618 |
+
if ($this->use & SERVICES_JSON_LOOSE_TYPE) {
|
| 619 |
+
$stk = array(SERVICES_JSON_IN_OBJ);
|
| 620 |
+
$obj = array();
|
| 621 |
+
} else {
|
| 622 |
+
$stk = array(SERVICES_JSON_IN_OBJ);
|
| 623 |
+
$obj = new stdClass();
|
| 624 |
+
}
|
| 625 |
+
}
|
| 626 |
+
|
| 627 |
+
array_push($stk, array('what' => SERVICES_JSON_SLICE,
|
| 628 |
+
'where' => 0,
|
| 629 |
+
'delim' => false));
|
| 630 |
+
|
| 631 |
+
$chrs = substr($str, 1, -1);
|
| 632 |
+
$chrs = $this->reduce_string($chrs);
|
| 633 |
+
|
| 634 |
+
if ($chrs == '') {
|
| 635 |
+
if (reset($stk) == SERVICES_JSON_IN_ARR) {
|
| 636 |
+
return $arr;
|
| 637 |
+
|
| 638 |
+
} else {
|
| 639 |
+
return $obj;
|
| 640 |
+
|
| 641 |
+
}
|
| 642 |
+
}
|
| 643 |
+
|
| 644 |
+
//print("\nparsing {$chrs}\n");
|
| 645 |
+
|
| 646 |
+
$strlen_chrs = strlen($chrs);
|
| 647 |
+
|
| 648 |
+
for ($c = 0; $c <= $strlen_chrs; ++$c) {
|
| 649 |
+
|
| 650 |
+
$top = end($stk);
|
| 651 |
+
$substr_chrs_c_2 = substr($chrs, $c, 2);
|
| 652 |
+
|
| 653 |
+
if (($c == $strlen_chrs) || (($chrs{$c} == ',') && ($top['what'] == SERVICES_JSON_SLICE))) {
|
| 654 |
+
// found a comma that is not inside a string, array, etc.,
|
| 655 |
+
// OR we've reached the end of the character list
|
| 656 |
+
$slice = substr($chrs, $top['where'], ($c - $top['where']));
|
| 657 |
+
array_push($stk, array('what' => SERVICES_JSON_SLICE, 'where' => ($c + 1), 'delim' => false));
|
| 658 |
+
//print("Found split at {$c}: ".substr($chrs, $top['where'], (1 + $c - $top['where']))."\n");
|
| 659 |
+
|
| 660 |
+
if (reset($stk) == SERVICES_JSON_IN_ARR) {
|
| 661 |
+
// we are in an array, so just push an element onto the stack
|
| 662 |
+
array_push($arr, $this->decode($slice));
|
| 663 |
+
|
| 664 |
+
} elseif (reset($stk) == SERVICES_JSON_IN_OBJ) {
|
| 665 |
+
// we are in an object, so figure
|
| 666 |
+
// out the property name and set an
|
| 667 |
+
// element in an associative array,
|
| 668 |
+
// for now
|
| 669 |
+
$parts = array();
|
| 670 |
+
|
| 671 |
+
if (preg_match('/^\s*(["\'].*[^\\\]["\'])\s*:\s*(\S.*),?$/Uis', $slice, $parts)) {
|
| 672 |
+
// "name":value pair
|
| 673 |
+
$key = $this->decode($parts[1]);
|
| 674 |
+
$val = $this->decode($parts[2]);
|
| 675 |
+
|
| 676 |
+
if ($this->use & SERVICES_JSON_LOOSE_TYPE) {
|
| 677 |
+
$obj[$key] = $val;
|
| 678 |
+
} else {
|
| 679 |
+
$obj->$key = $val;
|
| 680 |
+
}
|
| 681 |
+
} elseif (preg_match('/^\s*(\w+)\s*:\s*(\S.*),?$/Uis', $slice, $parts)) {
|
| 682 |
+
// name:value pair, where name is unquoted
|
| 683 |
+
$key = $parts[1];
|
| 684 |
+
$val = $this->decode($parts[2]);
|
| 685 |
+
|
| 686 |
+
if ($this->use & SERVICES_JSON_LOOSE_TYPE) {
|
| 687 |
+
$obj[$key] = $val;
|
| 688 |
+
} else {
|
| 689 |
+
$obj->$key = $val;
|
| 690 |
+
}
|
| 691 |
+
}
|
| 692 |
+
|
| 693 |
+
}
|
| 694 |
+
|
| 695 |
+
} elseif ((($chrs{$c} == '"') || ($chrs{$c} == "'")) && ($top['what'] != SERVICES_JSON_IN_STR)) {
|
| 696 |
+
// found a quote, and we are not inside a string
|
| 697 |
+
array_push($stk, array('what' => SERVICES_JSON_IN_STR, 'where' => $c, 'delim' => $chrs{$c}));
|
| 698 |
+
//print("Found start of string at {$c}\n");
|
| 699 |
+
|
| 700 |
+
} elseif (($chrs{$c} == $top['delim']) &&
|
| 701 |
+
($top['what'] == SERVICES_JSON_IN_STR) &&
|
| 702 |
+
((strlen(substr($chrs, 0, $c)) - strlen(rtrim(substr($chrs, 0, $c), '\\'))) % 2 != 1)) {
|
| 703 |
+
// found a quote, we're in a string, and it's not escaped
|
| 704 |
+
// we know that it's not escaped becase there is _not_ an
|
| 705 |
+
// odd number of backslashes at the end of the string so far
|
| 706 |
+
array_pop($stk);
|
| 707 |
+
//print("Found end of string at {$c}: ".substr($chrs, $top['where'], (1 + 1 + $c - $top['where']))."\n");
|
| 708 |
+
|
| 709 |
+
} elseif (($chrs{$c} == '[') &&
|
| 710 |
+
in_array($top['what'], array(SERVICES_JSON_SLICE, SERVICES_JSON_IN_ARR, SERVICES_JSON_IN_OBJ))) {
|
| 711 |
+
// found a left-bracket, and we are in an array, object, or slice
|
| 712 |
+
array_push($stk, array('what' => SERVICES_JSON_IN_ARR, 'where' => $c, 'delim' => false));
|
| 713 |
+
//print("Found start of array at {$c}\n");
|
| 714 |
+
|
| 715 |
+
} elseif (($chrs{$c} == ']') && ($top['what'] == SERVICES_JSON_IN_ARR)) {
|
| 716 |
+
// found a right-bracket, and we're in an array
|
| 717 |
+
array_pop($stk);
|
| 718 |
+
//print("Found end of array at {$c}: ".substr($chrs, $top['where'], (1 + $c - $top['where']))."\n");
|
| 719 |
+
|
| 720 |
+
} elseif (($chrs{$c} == '{') &&
|
| 721 |
+
in_array($top['what'], array(SERVICES_JSON_SLICE, SERVICES_JSON_IN_ARR, SERVICES_JSON_IN_OBJ))) {
|
| 722 |
+
// found a left-brace, and we are in an array, object, or slice
|
| 723 |
+
array_push($stk, array('what' => SERVICES_JSON_IN_OBJ, 'where' => $c, 'delim' => false));
|
| 724 |
+
//print("Found start of object at {$c}\n");
|
| 725 |
+
|
| 726 |
+
} elseif (($chrs{$c} == '}') && ($top['what'] == SERVICES_JSON_IN_OBJ)) {
|
| 727 |
+
// found a right-brace, and we're in an object
|
| 728 |
+
array_pop($stk);
|
| 729 |
+
//print("Found end of object at {$c}: ".substr($chrs, $top['where'], (1 + $c - $top['where']))."\n");
|
| 730 |
+
|
| 731 |
+
} elseif (($substr_chrs_c_2 == '/*') &&
|
| 732 |
+
in_array($top['what'], array(SERVICES_JSON_SLICE, SERVICES_JSON_IN_ARR, SERVICES_JSON_IN_OBJ))) {
|
| 733 |
+
// found a comment start, and we are in an array, object, or slice
|
| 734 |
+
array_push($stk, array('what' => SERVICES_JSON_IN_CMT, 'where' => $c, 'delim' => false));
|
| 735 |
+
$c++;
|
| 736 |
+
//print("Found start of comment at {$c}\n");
|
| 737 |
+
|
| 738 |
+
} elseif (($substr_chrs_c_2 == '*/') && ($top['what'] == SERVICES_JSON_IN_CMT)) {
|
| 739 |
+
// found a comment end, and we're in one now
|
| 740 |
+
array_pop($stk);
|
| 741 |
+
$c++;
|
| 742 |
+
|
| 743 |
+
for ($i = $top['where']; $i <= $c; ++$i)
|
| 744 |
+
$chrs = substr_replace($chrs, ' ', $i, 1);
|
| 745 |
+
|
| 746 |
+
//print("Found end of comment at {$c}: ".substr($chrs, $top['where'], (1 + $c - $top['where']))."\n");
|
| 747 |
+
|
| 748 |
+
}
|
| 749 |
+
|
| 750 |
+
}
|
| 751 |
+
|
| 752 |
+
if (reset($stk) == SERVICES_JSON_IN_ARR) {
|
| 753 |
+
return $arr;
|
| 754 |
+
|
| 755 |
+
} elseif (reset($stk) == SERVICES_JSON_IN_OBJ) {
|
| 756 |
+
return $obj;
|
| 757 |
+
|
| 758 |
+
}
|
| 759 |
+
|
| 760 |
+
}
|
| 761 |
+
}
|
| 762 |
+
}
|
| 763 |
+
|
| 764 |
+
/**
|
| 765 |
+
* @todo Ultimately, this should just call PEAR::isError()
|
| 766 |
+
*/
|
| 767 |
+
function isError($data, $code = null)
|
| 768 |
+
{
|
| 769 |
+
if (class_exists('pear')) {
|
| 770 |
+
return PEAR::isError($data, $code);
|
| 771 |
+
} elseif (is_object($data) && (get_class($data) == 'services_json_error' ||
|
| 772 |
+
is_subclass_of($data, 'services_json_error'))) {
|
| 773 |
+
return true;
|
| 774 |
+
}
|
| 775 |
+
|
| 776 |
+
return false;
|
| 777 |
+
}
|
| 778 |
+
}
|
| 779 |
+
|
| 780 |
+
if (class_exists('PEAR_Error')) {
|
| 781 |
+
|
| 782 |
+
class Services_JSON_Error extends PEAR_Error
|
| 783 |
+
{
|
| 784 |
+
function Services_JSON_Error($message = 'unknown error', $code = null,
|
| 785 |
+
$mode = null, $options = null, $userinfo = null)
|
| 786 |
+
{
|
| 787 |
+
parent::PEAR_Error($message, $code, $mode, $options, $userinfo);
|
| 788 |
+
}
|
| 789 |
+
}
|
| 790 |
+
|
| 791 |
+
} else {
|
| 792 |
+
|
| 793 |
+
/**
|
| 794 |
+
* @todo Ultimately, this class shall be descended from PEAR_Error
|
| 795 |
+
*/
|
| 796 |
+
class Services_JSON_Error
|
| 797 |
+
{
|
| 798 |
+
function Services_JSON_Error($message = 'unknown error', $code = null,
|
| 799 |
+
$mode = null, $options = null, $userinfo = null)
|
| 800 |
+
{
|
| 801 |
+
|
| 802 |
+
}
|
| 803 |
+
}
|
| 804 |
+
}
|
includes/bookmarks-data.php
ADDED
|
@@ -0,0 +1,452 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* @desc Dynamic mister wong link generator
|
| 5 |
+
*/
|
| 6 |
+
|
| 7 |
+
$wong_id = 6; //default service id
|
| 8 |
+
|
| 9 |
+
if(WPLANG == 'de_DE'){
|
| 10 |
+
$wong_id = 298;
|
| 11 |
+
}elseif(WPLANG == 'zh_CN' || WPLANG == 'zh_HK' || WPLANG == 'zh_TW'){
|
| 12 |
+
$wong_id = 299;
|
| 13 |
+
}elseif(WPLANG == 'es_CL' || WPLANG == 'es_ES' || WPLANG == 'es_PE' || WPLANG == 'es_VE'){
|
| 14 |
+
$wong_id = 300;
|
| 15 |
+
}elseif(WPLANG == 'fr_FR' || WPLANG == 'fr_BE'){
|
| 16 |
+
$wong_id = 301;
|
| 17 |
+
}elseif(WPLANG =='ru_RU' || WPLANG == 'ru_MA'){
|
| 18 |
+
$wong_id = 302;
|
| 19 |
+
}
|
| 20 |
+
|
| 21 |
+
$checkthis_text = __('Check this box to include %s in your bookmarking menu', 'shrsb');
|
| 22 |
+
|
| 23 |
+
// array of bookmarks
|
| 24 |
+
$shrsb_bookmarks_data=array(
|
| 25 |
+
'shr-scriptstyle'=>array(
|
| 26 |
+
'id' => 278,
|
| 27 |
+
'check'=>sprintf($checkthis_text, 'Script & Style'),
|
| 28 |
+
'share'=>__('Submit this to ', 'shrsb').'Script & Style'
|
| 29 |
+
),
|
| 30 |
+
'shr-blinklist'=>array(
|
| 31 |
+
'id'=>48,
|
| 32 |
+
'check'=>sprintf($checkthis_text, 'Blinklist'),
|
| 33 |
+
'share'=>__('Share this on ', 'shrsb').'Blinklist'
|
| 34 |
+
),
|
| 35 |
+
'shr-delicious'=>array(
|
| 36 |
+
'id'=>2,
|
| 37 |
+
'check'=>sprintf($checkthis_text,'Delicious'),
|
| 38 |
+
'share'=>__('Share this on ', 'shrsb').'del.icio.us'
|
| 39 |
+
),
|
| 40 |
+
'shr-digg'=>array(
|
| 41 |
+
'id'=>3,
|
| 42 |
+
'check'=>sprintf($checkthis_text,'Digg'),
|
| 43 |
+
'share'=>__('Digg this!', 'shrsb')
|
| 44 |
+
),
|
| 45 |
+
'shr-diigo'=>array(
|
| 46 |
+
'id'=>24,
|
| 47 |
+
'check'=>sprintf($checkthis_text,'Diigo'),
|
| 48 |
+
'share'=>__('Post this on ', 'shrsb').'Diigo'
|
| 49 |
+
),
|
| 50 |
+
'shr-reddit'=>array(
|
| 51 |
+
'id'=>40,
|
| 52 |
+
'check'=>sprintf($checkthis_text,'Reddit'),
|
| 53 |
+
'share'=>__('Share this on ', 'shrsb').'Reddit'
|
| 54 |
+
),
|
| 55 |
+
'shr-twittley'=>array(
|
| 56 |
+
'id'=>277,
|
| 57 |
+
'check'=>sprintf($checkthis_text,'Twittley'),
|
| 58 |
+
'share'=>__('Submit this to ', 'shrsb').'Twittley'
|
| 59 |
+
),
|
| 60 |
+
'shr-stumbleupon'=>array(
|
| 61 |
+
'id'=>38,
|
| 62 |
+
'check'=>sprintf($checkthis_text,'Stumbleupon'),
|
| 63 |
+
'share'=>__('Stumble upon something good? Share it on StumbleUpon', 'shrsb')
|
| 64 |
+
),
|
| 65 |
+
'shr-technorati'=>array(
|
| 66 |
+
'id'=>10,
|
| 67 |
+
'check'=>sprintf($checkthis_text,'Technorati'),
|
| 68 |
+
'share'=>__('Share this on ', 'shrsb').'Technorati'
|
| 69 |
+
),
|
| 70 |
+
'shr-myspace'=>array(
|
| 71 |
+
'id'=>39,
|
| 72 |
+
'check'=>sprintf($checkthis_text,'MySpace'),
|
| 73 |
+
'share'=>__('Post this to ', 'shrsb').'MySpace'
|
| 74 |
+
),
|
| 75 |
+
'shr-designfloat'=>array(
|
| 76 |
+
'id'=>106,
|
| 77 |
+
'check'=>sprintf($checkthis_text,'DesignFloat'),
|
| 78 |
+
'share'=>__('Submit this to ', 'shrsb').'DesignFloat'
|
| 79 |
+
),
|
| 80 |
+
'shr-facebook'=>array(
|
| 81 |
+
'id'=>5,
|
| 82 |
+
'check'=>sprintf($checkthis_text,'Facebook'),
|
| 83 |
+
'share'=>__('Share this on ', 'shrsb').'Facebook'
|
| 84 |
+
),
|
| 85 |
+
'shr-twitter'=>array(
|
| 86 |
+
'id'=>7,
|
| 87 |
+
'check'=>sprintf($checkthis_text,'Twitter'),
|
| 88 |
+
'share'=>__('Tweet This!', 'shrsb')
|
| 89 |
+
),
|
| 90 |
+
'shr-mail'=>array(
|
| 91 |
+
'id'=>201,
|
| 92 |
+
'check'=>sprintf($checkthis_text, __("an 'Email to a Friend' link", 'shrsb')),
|
| 93 |
+
'share'=>__('Email this to a friend?', 'shrsb')
|
| 94 |
+
),
|
| 95 |
+
'shr-tomuse'=>array(
|
| 96 |
+
'id'=>294,
|
| 97 |
+
'check'=>sprintf($checkthis_text,'ToMuse'),
|
| 98 |
+
'share'=>__('Suggest this article to ', 'shrsb').'ToMuse'
|
| 99 |
+
),
|
| 100 |
+
'shr-comfeed'=>array(
|
| 101 |
+
'id' => NULL,
|
| 102 |
+
'check'=>sprintf($checkthis_text, __("a 'Subscribe to Comments' link", 'shrsb')),
|
| 103 |
+
'share'=>__('Subscribe to the comments for this post?', 'shrsb'),
|
| 104 |
+
'baseUrl'=>'PERMALINK',
|
| 105 |
+
),
|
| 106 |
+
'shr-linkedin'=>array(
|
| 107 |
+
'id'=>88,
|
| 108 |
+
'check'=>sprintf($checkthis_text,'LinkedIn'),
|
| 109 |
+
'share'=>__('Share this on ', 'shrsb').'LinkedIn'
|
| 110 |
+
),
|
| 111 |
+
'shr-newsvine'=>array(
|
| 112 |
+
'id'=>41,
|
| 113 |
+
'check'=>sprintf($checkthis_text,'Newsvine'),
|
| 114 |
+
'share'=>__('Seed this on ', 'shrsb').'Newsvine'
|
| 115 |
+
),
|
| 116 |
+
'shr-googlebookmarks'=>array(
|
| 117 |
+
'id'=>74,
|
| 118 |
+
'check'=>sprintf($checkthis_text,'Google Bookmarks'),
|
| 119 |
+
'share'=>__('Add this to ', 'shrsb').'Google Bookmarks'
|
| 120 |
+
),
|
| 121 |
+
'shr-misterwong'=>array(
|
| 122 |
+
'id'=>$wong_id,
|
| 123 |
+
'check'=>sprintf($checkthis_text,'Mister Wong'),
|
| 124 |
+
'share'=>__('Add this to ', 'shrsb').'Mister Wong'
|
| 125 |
+
),
|
| 126 |
+
'shr-izeby'=>array(
|
| 127 |
+
'id'=>263,
|
| 128 |
+
'check'=>sprintf($checkthis_text,'Izeby'),
|
| 129 |
+
'share'=>__('Add this to ', 'shrsb').'Izeby'
|
| 130 |
+
),
|
| 131 |
+
'shr-tipd'=>array(
|
| 132 |
+
'id'=>188,
|
| 133 |
+
'check'=>sprintf($checkthis_text,'Tipd'),
|
| 134 |
+
'share'=>__('Share this on ', 'shrsb').'Tipd'
|
| 135 |
+
),
|
| 136 |
+
'shr-pfbuzz'=>array(
|
| 137 |
+
'id'=>279,
|
| 138 |
+
'check'=>sprintf($checkthis_text,'PFBuzz'),
|
| 139 |
+
'share'=>__('Share this on ', 'shrsb').'PFBuzz'
|
| 140 |
+
),
|
| 141 |
+
'shr-friendfeed'=>array(
|
| 142 |
+
'id'=>43,
|
| 143 |
+
'check'=>sprintf($checkthis_text,'FriendFeed'),
|
| 144 |
+
'share'=>__('Share this on ', 'shrsb').'FriendFeed'
|
| 145 |
+
),
|
| 146 |
+
'shr-blogmarks'=>array(
|
| 147 |
+
'id'=>27,
|
| 148 |
+
'check'=>sprintf($checkthis_text,'BlogMarks'),
|
| 149 |
+
'share'=>__('Mark this on ', 'shrsb').'BlogMarks'
|
| 150 |
+
),
|
| 151 |
+
'shr-fwisp'=>array(
|
| 152 |
+
'id'=>280,
|
| 153 |
+
'check'=>sprintf($checkthis_text,'Fwisp'),
|
| 154 |
+
'share'=>__('Share this on ', 'shrsb').'Fwisp'
|
| 155 |
+
),
|
| 156 |
+
'shr-bobrdobr'=>array(
|
| 157 |
+
'id'=>266,
|
| 158 |
+
'check'=>sprintf($checkthis_text,'BobrDobr').__(' (Russian)', 'shrsb'),
|
| 159 |
+
'share'=>__('Share this on ', 'shrsb').'BobrDobr'
|
| 160 |
+
),
|
| 161 |
+
'shr-yandex'=>array(
|
| 162 |
+
'id'=>267,
|
| 163 |
+
'check'=>sprintf($checkthis_text,'Yandex.Bookmarks').__(' (Russian)', 'shrsb'),
|
| 164 |
+
'share'=>__('Add this to ', 'shrsb').'Yandex.Bookmarks'
|
| 165 |
+
),
|
| 166 |
+
'shr-memoryru'=>array(
|
| 167 |
+
'id'=>269,
|
| 168 |
+
'check'=>sprintf($checkthis_text,'Memory.ru').__(' (Russian)', 'shrsb'),
|
| 169 |
+
'share'=>__('Add this to ', 'shrsb').'Memory.ru'
|
| 170 |
+
),
|
| 171 |
+
'shr-100zakladok'=>array(
|
| 172 |
+
'id'=>281,
|
| 173 |
+
'check'=>sprintf($checkthis_text,'100 bookmarks').__(' (Russian)', 'shrsb'),
|
| 174 |
+
'share'=>__('Add this to ', 'shrsb').'100 bookmarks'
|
| 175 |
+
),
|
| 176 |
+
'shr-moemesto'=>array(
|
| 177 |
+
'id'=>268,
|
| 178 |
+
'check'=>sprintf($checkthis_text,'MyPlace').__(' (Russian)', 'shrsb'),
|
| 179 |
+
'share'=>__('Add this to ', 'shrsb').'MyPlace'
|
| 180 |
+
),
|
| 181 |
+
'shr-hackernews'=>array(
|
| 182 |
+
'id'=>202,
|
| 183 |
+
'check'=>sprintf($checkthis_text,'Hacker News'),
|
| 184 |
+
'share'=>__('Submit this to ', 'shrsb').'Hacker News'
|
| 185 |
+
),
|
| 186 |
+
'shr-printfriendly'=>array(
|
| 187 |
+
'id'=>236,
|
| 188 |
+
'check'=>sprintf($checkthis_text,'Print Friendly'),
|
| 189 |
+
'share'=>__('Send this page to ', 'shrsb').'Print Friendly'
|
| 190 |
+
),
|
| 191 |
+
'shr-designbump'=>array(
|
| 192 |
+
'id'=>282,
|
| 193 |
+
'check'=>sprintf($checkthis_text,'Design Bump'),
|
| 194 |
+
'share'=>__('Bump this on ', 'shrsb').'DesignBump'
|
| 195 |
+
),
|
| 196 |
+
'shr-ning'=>array(
|
| 197 |
+
'id'=>264,
|
| 198 |
+
'check'=>sprintf($checkthis_text,'Ning'),
|
| 199 |
+
'share'=>__('Add this to ', 'shrsb').'Ning'
|
| 200 |
+
),
|
| 201 |
+
'shr-identica'=>array(
|
| 202 |
+
'id'=>205,
|
| 203 |
+
'check'=>sprintf($checkthis_text,'Identica'),
|
| 204 |
+
'share'=>__('Post this to ', 'shrsb').'Identica'
|
| 205 |
+
),
|
| 206 |
+
'shr-xerpi'=>array(
|
| 207 |
+
'id'=>20,
|
| 208 |
+
'check'=>sprintf($checkthis_text,'Xerpi'),
|
| 209 |
+
'share'=>__('Save this to ', 'shrsb').'Xerpi'
|
| 210 |
+
),
|
| 211 |
+
'shr-techmeme'=>array(
|
| 212 |
+
'id'=>204,
|
| 213 |
+
'check'=>sprintf($checkthis_text,'TechMeme'),
|
| 214 |
+
'share'=>__('Tip this to ', 'shrsb').'TechMeme'
|
| 215 |
+
),
|
| 216 |
+
'shr-sphinn'=>array(
|
| 217 |
+
'id'=>100,
|
| 218 |
+
'check'=>sprintf($checkthis_text,'Sphinn'),
|
| 219 |
+
'share'=>__('Sphinn this on ', 'shrsb').'Sphinn'
|
| 220 |
+
),
|
| 221 |
+
'shr-posterous'=>array(
|
| 222 |
+
'id'=>210,
|
| 223 |
+
'check'=>sprintf($checkthis_text,'Posterous'),
|
| 224 |
+
'share'=>__('Post this to ', 'shrsb').'Posterous'
|
| 225 |
+
),
|
| 226 |
+
'shr-globalgrind'=>array(
|
| 227 |
+
'id'=>89,
|
| 228 |
+
'check'=>sprintf($checkthis_text,'Global Grind'),
|
| 229 |
+
'share'=>__('Grind this! on ', 'shrsb').'Global Grind'
|
| 230 |
+
),
|
| 231 |
+
'shr-pingfm'=>array(
|
| 232 |
+
'id'=>45,
|
| 233 |
+
'check'=>sprintf($checkthis_text,'Ping.fm'),
|
| 234 |
+
'share'=>__('Ping this on ', 'shrsb').'Ping.fm'
|
| 235 |
+
),
|
| 236 |
+
'shr-nujij'=>array(
|
| 237 |
+
'id'=>238,
|
| 238 |
+
'check'=>sprintf($checkthis_text,'NUjij').__(' (Dutch)', 'shrsb'),
|
| 239 |
+
'share'=>__('Submit this to ', 'shrsb').'NUjij'
|
| 240 |
+
),
|
| 241 |
+
'shr-ekudos'=>array(
|
| 242 |
+
'id'=>283,
|
| 243 |
+
'check'=>sprintf($checkthis_text,'eKudos').__(' (Dutch)', 'shrsb'),
|
| 244 |
+
'share'=>__('Submit this to ', 'shrsb').'eKudos'
|
| 245 |
+
),
|
| 246 |
+
'shr-netvouz'=>array(
|
| 247 |
+
'id'=>21,
|
| 248 |
+
'check'=>sprintf($checkthis_text,'Netvouz'),
|
| 249 |
+
'share'=>__('Submit this to ', 'shrsb').'Netvouz'
|
| 250 |
+
),
|
| 251 |
+
'shr-webblend'=>array(
|
| 252 |
+
'id'=>284,
|
| 253 |
+
'check'=>sprintf($checkthis_text,'Web Blend'),
|
| 254 |
+
'share'=>__('Blend this!', 'shrsb')
|
| 255 |
+
),
|
| 256 |
+
'shr-wykop'=>array(
|
| 257 |
+
'id'=>285,
|
| 258 |
+
'check'=>sprintf($checkthis_text,'Wykop').__(' (Polish)', 'shrsb'),
|
| 259 |
+
'share'=>__('Add this to Wykop!', 'shrsb')
|
| 260 |
+
),
|
| 261 |
+
'shr-blogengage'=>array(
|
| 262 |
+
'id'=>286,
|
| 263 |
+
'check'=>sprintf($checkthis_text,'BlogEngage'),
|
| 264 |
+
'share'=>__('Engage with this article!', 'shrsb')
|
| 265 |
+
),
|
| 266 |
+
'shr-hyves'=>array(
|
| 267 |
+
'id'=>105,
|
| 268 |
+
'check'=>sprintf($checkthis_text,'Hyves'),
|
| 269 |
+
'share'=>__('Share this on ', 'shrsb').'Hyves'
|
| 270 |
+
),
|
| 271 |
+
'shr-pusha'=>array(
|
| 272 |
+
'id'=>59,
|
| 273 |
+
'check'=>sprintf($checkthis_text,'Pusha').__(' (Swedish)', 'shrsb'),
|
| 274 |
+
'share'=>__('Push this on ', 'shrsb').'Pusha'
|
| 275 |
+
),
|
| 276 |
+
'shr-hatena'=>array(
|
| 277 |
+
'id'=>246,
|
| 278 |
+
'check'=>sprintf($checkthis_text,'Hatena Bookmarks').__(' (Japanese)', 'shrsb'),
|
| 279 |
+
'share'=>__('Bookmarks this on ', 'shrsb').'Hatena Bookmarks'
|
| 280 |
+
),
|
| 281 |
+
'shr-mylinkvault'=>array(
|
| 282 |
+
'id'=>98,
|
| 283 |
+
'check'=>sprintf($checkthis_text,'MyLinkVault'),
|
| 284 |
+
'share'=>__('Store this link on ', 'shrsb').'MyLinkVault'
|
| 285 |
+
),
|
| 286 |
+
'shr-slashdot'=>array(
|
| 287 |
+
'id'=>61,
|
| 288 |
+
'check'=>sprintf($checkthis_text,'SlashDot'),
|
| 289 |
+
'share'=>__('Submit this to ', 'shrsb').'SlashDot'
|
| 290 |
+
),
|
| 291 |
+
'shr-squidoo'=>array(
|
| 292 |
+
'id'=>46,
|
| 293 |
+
'check'=>sprintf($checkthis_text,'Squidoo'),
|
| 294 |
+
'share'=>__('Add to a lense on ', 'shrsb').'Squidoo'
|
| 295 |
+
),
|
| 296 |
+
'shr-faqpal'=>array(
|
| 297 |
+
'id'=>287,
|
| 298 |
+
'check'=>sprintf($checkthis_text,'FAQpal'),
|
| 299 |
+
'share'=>__('Submit this to ', 'shrsb').'FAQpal'
|
| 300 |
+
),
|
| 301 |
+
'shr-evernote'=>array(
|
| 302 |
+
'id'=>191,
|
| 303 |
+
'check'=>sprintf($checkthis_text,'Evernote'),
|
| 304 |
+
'share'=>__('Clip this to ', 'shrsb').'Evernote'
|
| 305 |
+
),
|
| 306 |
+
'shr-meneame'=>array(
|
| 307 |
+
'id'=>33,
|
| 308 |
+
'check'=>sprintf($checkthis_text,'Meneame').__(' (Spanish)', 'shrsb'),
|
| 309 |
+
'share'=>__('Submit this to ', 'shrsb').'Meneame'
|
| 310 |
+
),
|
| 311 |
+
'shr-bitacoras'=>array(
|
| 312 |
+
'id'=>288,
|
| 313 |
+
'check'=>sprintf($checkthis_text,'Bitacoras').__(' (Spanish)', 'shrsb'),
|
| 314 |
+
'share'=>__('Submit this to ', 'shrsb').'Bitacoras'
|
| 315 |
+
),
|
| 316 |
+
'shr-jumptags'=>array(
|
| 317 |
+
'id'=>14,
|
| 318 |
+
'check'=>sprintf($checkthis_text,'JumpTags'),
|
| 319 |
+
'share'=>__('Submit this link to ', 'shrsb').'JumpTags'
|
| 320 |
+
),
|
| 321 |
+
'shr-bebo'=>array(
|
| 322 |
+
'id'=>196,
|
| 323 |
+
'check'=>sprintf($checkthis_text,'Bebo'),
|
| 324 |
+
'share'=>__('Share this on ', 'shrsb').'Bebo'
|
| 325 |
+
),
|
| 326 |
+
'shr-n4g'=>array(
|
| 327 |
+
'id'=>289,
|
| 328 |
+
'check'=>sprintf($checkthis_text,'N4G'),
|
| 329 |
+
'share'=>__('Submit tip to ', 'shrsb').'N4G'
|
| 330 |
+
),
|
| 331 |
+
'shr-strands'=>array(
|
| 332 |
+
'id'=>190,
|
| 333 |
+
'check'=>sprintf($checkthis_text,'Strands'),
|
| 334 |
+
'share'=>__('Submit this to ', 'shrsb').'Strands'
|
| 335 |
+
),
|
| 336 |
+
'shr-orkut'=>array(
|
| 337 |
+
'id'=>247,
|
| 338 |
+
'check'=>sprintf($checkthis_text,'Orkut'),
|
| 339 |
+
'share'=>__('Promote this on ', 'shrsb').'Orkut'
|
| 340 |
+
),
|
| 341 |
+
'shr-tumblr'=>array(
|
| 342 |
+
'id'=>78,
|
| 343 |
+
'check'=>sprintf($checkthis_text,'Tumblr'),
|
| 344 |
+
'share'=>__('Share this on ', 'shrsb').'Tumblr'
|
| 345 |
+
),
|
| 346 |
+
'shr-stumpedia'=>array(
|
| 347 |
+
'id'=>192,
|
| 348 |
+
'check'=>sprintf($checkthis_text,'Stumpedia'),
|
| 349 |
+
'share'=>__('Add this to ', 'shrsb').'Stumpedia'
|
| 350 |
+
),
|
| 351 |
+
'shr-current'=>array(
|
| 352 |
+
'id'=>80,
|
| 353 |
+
'check'=>sprintf($checkthis_text,'Current'),
|
| 354 |
+
'share'=>__('Post this to ', 'shrsb').'Current'
|
| 355 |
+
),
|
| 356 |
+
'shr-blogger'=>array(
|
| 357 |
+
'id'=>219,
|
| 358 |
+
'check'=>sprintf($checkthis_text,'Blogger'),
|
| 359 |
+
'share'=>__('Blog this on ', 'shrsb').'Blogger'
|
| 360 |
+
),
|
| 361 |
+
'shr-plurk'=>array(
|
| 362 |
+
'id'=>218,
|
| 363 |
+
'check'=>sprintf($checkthis_text,'Plurk'),
|
| 364 |
+
'share'=>__('Share this on ', 'shrsb').'Plurk'
|
| 365 |
+
),
|
| 366 |
+
'shr-dzone'=>array(
|
| 367 |
+
'id'=>102,
|
| 368 |
+
'check'=>sprintf($checkthis_text,'DZone'),
|
| 369 |
+
'share'=>__('Add this to ', 'shrsb').'DZone'
|
| 370 |
+
),
|
| 371 |
+
'shr-kaevur'=>array(
|
| 372 |
+
'id'=>290,
|
| 373 |
+
'check'=>sprintf($checkthis_text,'Kaevur').__(' (Estonian)', 'shrsb'),
|
| 374 |
+
'share'=>__('Share this on ', 'shrsb').'Kaevur'
|
| 375 |
+
),
|
| 376 |
+
'shr-virb'=>array(
|
| 377 |
+
'id'=>291,
|
| 378 |
+
'check'=>sprintf($checkthis_text,'Virb'),
|
| 379 |
+
'share'=>__('Share this on ', 'shrsb').'Virb'
|
| 380 |
+
),
|
| 381 |
+
'shr-box'=>array(
|
| 382 |
+
'id'=>240,
|
| 383 |
+
'check'=>sprintf($checkthis_text,'Box.net'),
|
| 384 |
+
'share'=>__('Add this link to ', 'shrsb').'Box.net'
|
| 385 |
+
),
|
| 386 |
+
'shr-oknotizie'=>array(
|
| 387 |
+
'id'=>243,
|
| 388 |
+
'check'=>sprintf($checkthis_text,'OkNotizie').__('(Italian)', 'shrsb'),
|
| 389 |
+
'share'=>__('Share this on ', 'shrsb').'OkNotizie'
|
| 390 |
+
),
|
| 391 |
+
'shr-bonzobox'=>array(
|
| 392 |
+
'id'=>292,
|
| 393 |
+
'check'=>sprintf($checkthis_text,'BonzoBox'),
|
| 394 |
+
'share'=>__('Add this to ', 'shrsb').'BonzoBox'
|
| 395 |
+
),
|
| 396 |
+
'shr-plaxo'=>array(
|
| 397 |
+
'id'=>44,
|
| 398 |
+
'check'=>sprintf($checkthis_text,'Plaxo'),
|
| 399 |
+
'share'=>__('Share this on ', 'shrsb').'Plaxo'
|
| 400 |
+
),
|
| 401 |
+
'shr-springpad'=>array(
|
| 402 |
+
'id'=>265,
|
| 403 |
+
'check'=>sprintf($checkthis_text,'SpringPad'),
|
| 404 |
+
'share'=>__('Spring this on ', 'shrsb').'SpringPad',
|
| 405 |
+
),
|
| 406 |
+
'shr-zabox'=>array(
|
| 407 |
+
'id'=>293,
|
| 408 |
+
'check'=>sprintf($checkthis_text,'Zabox'),
|
| 409 |
+
'share'=>__('Box this on ', 'shrsb').'Zabox'
|
| 410 |
+
),
|
| 411 |
+
'shr-viadeo'=>array(
|
| 412 |
+
'id'=>92,
|
| 413 |
+
'check'=>sprintf($checkthis_text,'Viadeo'),
|
| 414 |
+
'share'=>__('Share this on ', 'shrsb').'Viadeo'
|
| 415 |
+
),
|
| 416 |
+
'shr-gmail'=>array(
|
| 417 |
+
'id'=>52,
|
| 418 |
+
'check'=>sprintf($checkthis_text,'Gmail'),
|
| 419 |
+
'share'=>__('Email this via ', 'shrsb').'Gmail'
|
| 420 |
+
),
|
| 421 |
+
'shr-hotmail'=>array(
|
| 422 |
+
'id'=>53,
|
| 423 |
+
'check'=>sprintf($checkthis_text,'Hotmail'),
|
| 424 |
+
'share'=>__('Email this via ', 'shrsb').'Hotmail'
|
| 425 |
+
),
|
| 426 |
+
'shr-yahoomail'=>array(
|
| 427 |
+
'id'=>54,
|
| 428 |
+
'check'=>sprintf($checkthis_text,'Yahoo! Mail'),
|
| 429 |
+
'share'=>__('Email this via ', 'shrsb').'Yahoo! Mail'
|
| 430 |
+
),
|
| 431 |
+
'shr-buzzster'=>array(
|
| 432 |
+
'id'=>1,
|
| 433 |
+
'check'=>sprintf($checkthis_text,'Buzzster!'),
|
| 434 |
+
'share'=>__('Share this via ', 'shrsb').'Buzzster!'
|
| 435 |
+
),'shr-pinterest'=>array(
|
| 436 |
+
'id'=>309,
|
| 437 |
+
'check'=>sprintf($checkthis_text,'Pinterest'),
|
| 438 |
+
'share'=>__('Pin this to ', 'shrsb').'Pinterest'
|
| 439 |
+
),
|
| 440 |
+
'shr-googleplus'=>array(
|
| 441 |
+
'id'=>304,
|
| 442 |
+
'check'=>sprintf($checkthis_text, 'Google+'),
|
| 443 |
+
'share'=>__('Share this on ', 'shrsb').'Google+'
|
| 444 |
+
),
|
| 445 |
+
'shr-fastmail'=>array(
|
| 446 |
+
'id'=>313,
|
| 447 |
+
'check'=>sprintf($checkthis_text,'Email'),
|
| 448 |
+
'share'=>__('Send via ', 'shrsb').'Email'
|
| 449 |
+
),
|
| 450 |
+
);
|
| 451 |
+
ksort($shrsb_bookmarks_data, SORT_STRING); //sort array by keys
|
| 452 |
+
?>
|
includes/helper-functions.php
ADDED
|
@@ -0,0 +1,149 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* Returns the translated role of the current user. If that user has
|
| 5 |
+
* no role for the current blog, it returns false.
|
| 6 |
+
*
|
| 7 |
+
* @return string The name of the current role
|
| 8 |
+
* @notes older versions of WP return "Administrator|User role" which we strip down to "Administrator"
|
| 9 |
+
**/
|
| 10 |
+
function shrsb_get_current_user_role() {
|
| 11 |
+
global $wp_roles;
|
| 12 |
+
$current_user = wp_get_current_user();
|
| 13 |
+
$roles = $current_user->roles;
|
| 14 |
+
$role = array_shift($roles);
|
| 15 |
+
return isset($wp_roles->role_names[$role]) ? preg_replace("/\|User role$/","",$wp_roles->role_names[$role]) : false;
|
| 16 |
+
}
|
| 17 |
+
|
| 18 |
+
/**
|
| 19 |
+
* Warning : Please go through the code first before reusing the function
|
| 20 |
+
* Append the character at the end of the string.
|
| 21 |
+
* For Windows Servers, replace backward slashes to forward
|
| 22 |
+
*
|
| 23 |
+
* @param <type> $string
|
| 24 |
+
* @param <type> $char
|
| 25 |
+
* @return <type> string
|
| 26 |
+
*/
|
| 27 |
+
function shrb_addTrailingChar($string, $char){
|
| 28 |
+
// For window based servers
|
| 29 |
+
if($char == '/'){
|
| 30 |
+
$string = shrb_convertBackToForwardSlash($string);
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
//Appending the charachter at end if it already deoes not exist.
|
| 34 |
+
if(substr($string, -1) != $char){
|
| 35 |
+
$string .= $char;
|
| 36 |
+
}
|
| 37 |
+
return $string;
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
function shrb_convertBackToForwardSlash($string){
|
| 41 |
+
|
| 42 |
+
$exp = array('\\','\\/', '\\\\','///');
|
| 43 |
+
$string = str_replace($exp, '/', $string);
|
| 44 |
+
|
| 45 |
+
return $string;
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
/**
|
| 49 |
+
* Return Google Analytics for Admin Pages
|
| 50 |
+
*
|
| 51 |
+
* @return string
|
| 52 |
+
* @author Jay Meattle
|
| 53 |
+
**/
|
| 54 |
+
|
| 55 |
+
function get_googleanalytics() {
|
| 56 |
+
$google_analytics = <<<EOD
|
| 57 |
+
<script type="text/javascript">
|
| 58 |
+
var _gaq = _gaq || [];
|
| 59 |
+
_gaq.push(['_setAccount', 'UA-12964573-5']);
|
| 60 |
+
_gaq.push(['_trackPageview']);
|
| 61 |
+
(function() {
|
| 62 |
+
var ga = document.createElement('script'); ga.type = 'text/javascript'; ga.async = true;
|
| 63 |
+
ga.src = ('https:' == document.location.protocol ? 'https://ssl' : 'http://www') + '.google-analytics.com/ga.js';
|
| 64 |
+
var s = document.getElementsByTagName('script')[0]; s.parentNode.insertBefore(ga, s);
|
| 65 |
+
})();
|
| 66 |
+
</script>
|
| 67 |
+
EOD;
|
| 68 |
+
return $google_analytics;
|
| 69 |
+
}
|
| 70 |
+
|
| 71 |
+
/**
|
| 72 |
+
* @desc dump the sexybookmark settings from the database
|
| 73 |
+
**/
|
| 74 |
+
function shrsb_dump_settings(){
|
| 75 |
+
|
| 76 |
+
global $shrsb_debug;
|
| 77 |
+
//data to dump
|
| 78 |
+
$data = array(
|
| 79 |
+
"siteurl" => get_option('siteurl'),
|
| 80 |
+
"version_database" => get_option('SHRSBvNum'),
|
| 81 |
+
"version_plugin" => SHRSB_vNum,
|
| 82 |
+
"apikey" => get_option('SHRSB_apikey'),
|
| 83 |
+
"custom_sprite" => get_option('SHRSB_CustomSprite'),
|
| 84 |
+
"default_spritegen" => get_option('SHRSB_DefaultSprite'),
|
| 85 |
+
"sb_plugopts" => get_option('SexyBookmarks'),
|
| 86 |
+
"tb_plugopts" => get_option('ShareaholicTopbar')
|
| 87 |
+
);
|
| 88 |
+
|
| 89 |
+
if($shrsb_debug['dump_type'])
|
| 90 |
+
switch($shrsb_debug['dump_type']){
|
| 91 |
+
case "json":
|
| 92 |
+
echo json_encode($data);
|
| 93 |
+
break;
|
| 94 |
+
case "tree":
|
| 95 |
+
echo shrsb_displayTree($data);
|
| 96 |
+
break;
|
| 97 |
+
default :
|
| 98 |
+
var_export($data);
|
| 99 |
+
}
|
| 100 |
+
$shrsb_debug['sb_die'] && die();
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
//Change the directory path to webpath
|
| 104 |
+
function shr_dir_to_path($dir){
|
| 105 |
+
if(!$dir){
|
| 106 |
+
return false;
|
| 107 |
+
}
|
| 108 |
+
//If its is a symlink, it will be resolved to origonal dir path
|
| 109 |
+
$dir = shrb_addTrailingChar(realpath($dir), '/' );
|
| 110 |
+
$path = get_option("siteurl");
|
| 111 |
+
if(substr($path, -1) != '/'){
|
| 112 |
+
$path .= '/';
|
| 113 |
+
}
|
| 114 |
+
$path .= substr($dir , strlen(ABSPATH));
|
| 115 |
+
return $path;
|
| 116 |
+
}
|
| 117 |
+
|
| 118 |
+
/**
|
| 119 |
+
* @desc check for the attributes in the get and post
|
| 120 |
+
**/
|
| 121 |
+
function shrsb_get_value($method =NULL, $attr = NULL, $def=false){
|
| 122 |
+
if(!$method && !$attr){
|
| 123 |
+
return $def;
|
| 124 |
+
}
|
| 125 |
+
|
| 126 |
+
switch($method){
|
| 127 |
+
case "get":
|
| 128 |
+
if(isset($_GET) && isset($_GET[$attr]) )
|
| 129 |
+
return $_GET[$attr];
|
| 130 |
+
break;
|
| 131 |
+
case "post":
|
| 132 |
+
if(isset($_POST) && isset($_POST[$attr]) )
|
| 133 |
+
return $_POST[$attr];
|
| 134 |
+
break;
|
| 135 |
+
default :
|
| 136 |
+
}
|
| 137 |
+
|
| 138 |
+
return $def;
|
| 139 |
+
}
|
| 140 |
+
|
| 141 |
+
/**
|
| 142 |
+
* @desc log the message if logging is enabled
|
| 143 |
+
**/
|
| 144 |
+
function shrsb_log($msg){
|
| 145 |
+
global $shrsb_debug;
|
| 146 |
+
if(isset($shrsb_debug) && isset($shrsb_debug['sb_log']) && $shrsb_debug['sb_log'] !== false){
|
| 147 |
+
echo '<!-- log:start --><span style=color:red>'.$msg.'</span><br><!-- log:end -->';
|
| 148 |
+
}
|
| 149 |
+
}
|
includes/html-helpers.php
ADDED
|
@@ -0,0 +1,176 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
// Converts http to https iff current page is being accessed over https.
|
| 4 |
+
function shrsb_correct_protocol($url) {
|
| 5 |
+
if (is_ssl()) {
|
| 6 |
+
return preg_replace('#^http://#', 'https://', $url);
|
| 7 |
+
}
|
| 8 |
+
else {
|
| 9 |
+
return $url;
|
| 10 |
+
}
|
| 11 |
+
}
|
| 12 |
+
|
| 13 |
+
function shrsb_is_mobile_browser() {
|
| 14 |
+
$useragent=$_SERVER['HTTP_USER_AGENT'];
|
| 15 |
+
$isMobile = false;
|
| 16 |
+
if(preg_match('/android|avantgo|blackberry|blazer|compal|elaine|fennec|hiptop|iemobile|ip(hone|od)|iris|kindle|lge |maemo|midp|mmp|opera m(ob|in)i|palm( os)?|phone|p(ixi|re)\/|plucker|pocket|psp|symbian|treo|up\.(browser|link)|vodafone|wap|windows (ce|phone)|xda|xiino/i',$useragent)||preg_match('/1207|6310|6590|3gso|4thp|50[1-6]i|770s|802s|a wa|abac|ac(er|oo|s\-)|ai(ko|rn)|al(av|ca|co)|amoi|an(ex|ny|yw)|aptu|ar(ch|go)|as(te|us)|attw|au(di|\-m|r |s )|avan|be(ck|ll|nq)|bi(lb|rd)|bl(ac|az)|br(e|v)w|bumb|bw\-(n|u)|c55\/|capi|ccwa|cdm\-|cell|chtm|cldc|cmd\-|co(mp|nd)|craw|da(it|ll|ng)|dbte|dc\-s|devi|dica|dmob|do(c|p)o|ds(12|\-d)|el(49|ai)|em(l2|ul)|er(ic|k0)|esl8|ez([4-7]0|os|wa|ze)|fetc|fly(\-|_)|g1 u|g560|gene|gf\-5|g\-mo|go(\.w|od)|gr(ad|un)|haie|hcit|hd\-(m|p|t)|hei\-|hi(pt|ta)|hp( i|ip)|hs\-c|ht(c(\-| |_|a|g|p|s|t)|tp)|hu(aw|tc)|i\-(20|go|ma)|i230|iac( |\-|\/)|ibro|idea|ig01|ikom|im1k|inno|ipaq|iris|ja(t|v)a|jbro|jemu|jigs|kddi|keji|kgt( |\/)|klon|kpt |kwc\-|kyo(c|k)|le(no|xi)|lg( g|\/(k|l|u)|50|54|e\-|e\/|\-[a-w])|libw|lynx|m1\-w|m3ga|m50\/|ma(te|ui|xo)|mc(01|21|ca)|m\-cr|me(di|rc|ri)|mi(o8|oa|ts)|mmef|mo(01|02|bi|de|do|t(\-| |o|v)|zz)|mt(50|p1|v )|mwbp|mywa|n10[0-2]|n20[2-3]|n30(0|2)|n50(0|2|5)|n7(0(0|1)|10)|ne((c|m)\-|on|tf|wf|wg|wt)|nok(6|i)|nzph|o2im|op(ti|wv)|oran|owg1|p800|pan(a|d|t)|pdxg|pg(13|\-([1-8]|c))|phil|pire|pl(ay|uc)|pn\-2|po(ck|rt|se)|prox|psio|pt\-g|qa\-a|qc(07|12|21|32|60|\-[2-7]|i\-)|qtek|r380|r600|raks|rim9|ro(ve|zo)|s55\/|sa(ge|ma|mm|ms|ny|va)|sc(01|h\-|oo|p\-)|sdk\/|se(c(\-|0|1)|47|mc|nd|ri)|sgh\-|shar|sie(\-|m)|sk\-0|sl(45|id)|sm(al|ar|b3|it|t5)|so(ft|ny)|sp(01|h\-|v\-|v )|sy(01|mb)|t2(18|50)|t6(00|10|18)|ta(gt|lk)|tcl\-|tdg\-|tel(i|m)|tim\-|t\-mo|to(pl|sh)|ts(70|m\-|m3|m5)|tx\-9|up(\.b|g1|si)|utst|v400|v750|veri|vi(rg|te)|vk(40|5[0-3]|\-v)|vm40|voda|vulc|vx(52|53|60|61|70|80|81|83|85|98)|w3c(\-| )|webc|whit|wi(g |nc|nw)|wmlb|wonu|x700|xda(\-|2|g)|yas\-|your|zeto|zte\-/i',substr($useragent,0,4))) {
|
| 17 |
+
$isMobile = true;
|
| 18 |
+
}
|
| 19 |
+
return $isMobile;
|
| 20 |
+
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
+
// function to list bookmarks that have been chosen by admin
|
| 24 |
+
function bookmark_list_item($name, $opts=array()) {
|
| 25 |
+
global $shrsb_plugopts, $shrsb_bookmarks_data, $post;
|
| 26 |
+
$onclick = "";
|
| 27 |
+
$post_info = shrsb_get_params($post->ID);
|
| 28 |
+
// If Twitter, check for custom tweet configuration and modify tweet accordingly
|
| 29 |
+
if($name == 'shr-twitter') {
|
| 30 |
+
|
| 31 |
+
if(!shrsb_is_mobile_browser()) {
|
| 32 |
+
$clickHandler = '
|
| 33 |
+
if(typeof(SHR_config) == "undefined" || !SHR_config) {
|
| 34 |
+
window["SHR_config"] = {};
|
| 35 |
+
}
|
| 36 |
+
|
| 37 |
+
window["__shr_service"] = "twitter";
|
| 38 |
+
window["__shr_log"] = true;
|
| 39 |
+
window["__shr_center"] = true;
|
| 40 |
+
|
| 41 |
+
|
| 42 |
+
SHR_config["shortener"] ="'.$post_info['shortener'].'";
|
| 43 |
+
SHR_config["shortener_key"] ="'.$post_info['shortener_key'].'";
|
| 44 |
+
SHR_config["apikey"] = "'.$shrsb_plugopts['apikey'].'";
|
| 45 |
+
SHR_config["twitter_template"] = "'.$shrsb_plugopts['tweetconfig'].'";
|
| 46 |
+
SHR_config["link"] = "PERMALINK";
|
| 47 |
+
SHR_config["title"] = "TITLE";
|
| 48 |
+
SHR_config["short_link"] = "'.$post_info['short_link'].'";
|
| 49 |
+
|
| 50 |
+
if(!window.SHR || !window.SHR.Servicelet) {
|
| 51 |
+
var d = document;
|
| 52 |
+
var s=d.createElement("script");
|
| 53 |
+
s.setAttribute("language","javascript");
|
| 54 |
+
s.id="shr-servicelet";
|
| 55 |
+
s.setAttribute("src", "'.shrsb_correct_protocol($shrsb_plugopts['shrbase']).'" + "/media/js/servicelet.min.js");
|
| 56 |
+
d.body.appendChild(s);
|
| 57 |
+
} else{
|
| 58 |
+
SHR.Servicelet.show();
|
| 59 |
+
}
|
| 60 |
+
return false;
|
| 61 |
+
';
|
| 62 |
+
|
| 63 |
+
foreach ($opts as $key=>$value) {
|
| 64 |
+
$clickHandler = str_replace(strtoupper($key), $value, $clickHandler);
|
| 65 |
+
}
|
| 66 |
+
$clickHandler = str_replace('"',"'",$clickHandler);
|
| 67 |
+
$clickHandler = str_replace(array("\n","\r"),"",$clickHandler);
|
| 68 |
+
$onclick = " onclick=\"$clickHandler\"";
|
| 69 |
+
}
|
| 70 |
+
|
| 71 |
+
$url = shrsb_correct_protocol($shrsb_plugopts['shrbase']).'/api/share/?'.implode('&',array(
|
| 72 |
+
'title=TITLE',
|
| 73 |
+
'link=PERMALINK',
|
| 74 |
+
'notes='.$post_info['notes'],
|
| 75 |
+
'short_link='.$post_info['short_link'],
|
| 76 |
+
'shortener='.$post_info['shortener'],
|
| 77 |
+
'shortener_key='.$post_info['shortener_key'],
|
| 78 |
+
'v=1',
|
| 79 |
+
'apitype=1',
|
| 80 |
+
'apikey='.$shrsb_plugopts['apikey'],
|
| 81 |
+
'source=Shareaholic',
|
| 82 |
+
'template='.urlencode($shrsb_plugopts['tweetconfig']),
|
| 83 |
+
'service='.$shrsb_bookmarks_data[$name]['id'],
|
| 84 |
+
'tags='.$post_info['d_tags'],
|
| 85 |
+
'ctype='
|
| 86 |
+
));
|
| 87 |
+
}
|
| 88 |
+
else if($name == 'shr-comfeed') {// Otherwise, use default baseUrl format
|
| 89 |
+
$url=$shrsb_bookmarks_data[$name]['baseUrl'];
|
| 90 |
+
}
|
| 91 |
+
else {
|
| 92 |
+
$url = shrsb_correct_protocol($shrsb_plugopts['shrbase']).'/api/share/?'.implode('&',array(
|
| 93 |
+
'title=TITLE',
|
| 94 |
+
'link=PERMALINK',
|
| 95 |
+
'notes='.$post_info['notes'],
|
| 96 |
+
'short_link='.$post_info['short_link'],
|
| 97 |
+
'shortener='.$post_info['shortener'],
|
| 98 |
+
'shortener_key='.$post_info['shortener_key'],
|
| 99 |
+
'v=1',
|
| 100 |
+
'apitype=1',
|
| 101 |
+
'apikey='.$shrsb_plugopts['apikey'],
|
| 102 |
+
'source=Shareaholic',
|
| 103 |
+
'template=',
|
| 104 |
+
'service='.$shrsb_bookmarks_data[$name]['id'],
|
| 105 |
+
'tags='.$post_info['d_tags'],
|
| 106 |
+
'ctype='
|
| 107 |
+
));
|
| 108 |
+
}
|
| 109 |
+
|
| 110 |
+
$topt = '';
|
| 111 |
+
if($name == 'shr-facebook') {
|
| 112 |
+
$onclick = " onclick=\"window.open(this.href,'sharer','toolbar=0,status=0,width=626,height=436'); return false;\"";
|
| 113 |
+
}
|
| 114 |
+
else {
|
| 115 |
+
if($shrsb_plugopts['targetopt'] == '_blank') {
|
| 116 |
+
$topt = ' class="external"';
|
| 117 |
+
}
|
| 118 |
+
}
|
| 119 |
+
foreach ($opts as $key=>$value) {
|
| 120 |
+
$url=str_replace(strtoupper($key), $value, preg_replace('/\s+/', '%20', $url));
|
| 121 |
+
}
|
| 122 |
+
if(is_feed()) {
|
| 123 |
+
return sprintf(
|
| 124 |
+
"\t\t".'<li class="%s">'."\n\t\t\t".'<a href="%s" rel="%s"%s title="%s">%s</a>'."\n\t\t".'</li>'."\n",
|
| 125 |
+
$name,
|
| 126 |
+
$url,
|
| 127 |
+
$shrsb_plugopts['reloption'],
|
| 128 |
+
$topt,
|
| 129 |
+
$shrsb_bookmarks_data[$name]['share'],
|
| 130 |
+
$shrsb_bookmarks_data[$name]['share']
|
| 131 |
+
);
|
| 132 |
+
}
|
| 133 |
+
else {
|
| 134 |
+
return sprintf(
|
| 135 |
+
"\t\t".'<li class="%s">'."\n\t\t\t".'<a href="%s" rel="%s"%s title="%s"%s> </a>'."\n\t\t".'</li>'."\n",
|
| 136 |
+
$name,
|
| 137 |
+
$url,
|
| 138 |
+
$shrsb_plugopts['reloption'],
|
| 139 |
+
$topt,
|
| 140 |
+
$shrsb_bookmarks_data[$name]['share'],
|
| 141 |
+
$onclick
|
| 142 |
+
);
|
| 143 |
+
}
|
| 144 |
+
}
|
| 145 |
+
|
| 146 |
+
|
| 147 |
+
// Displays a multi-dimensional array as a HTML List (Tree structure).
|
| 148 |
+
function shrsb_displayTree($var) {
|
| 149 |
+
$newline = "\n";
|
| 150 |
+
$output = "";
|
| 151 |
+
foreach($var as $key => $value) {
|
| 152 |
+
if (is_array($value) || is_object($value)) {
|
| 153 |
+
$value = $newline . "<ul>" . shrsb_displayTree($value) . "</ul>";
|
| 154 |
+
}
|
| 155 |
+
|
| 156 |
+
if (is_array($var)) {
|
| 157 |
+
if (!stripos($value, "<li class=")) {
|
| 158 |
+
$output .= "<li class=\"file\">" ."$key = $value" . "</li>" . $newline;
|
| 159 |
+
}
|
| 160 |
+
else {
|
| 161 |
+
$output .= "$key = $value" . $newline;
|
| 162 |
+
}
|
| 163 |
+
|
| 164 |
+
}
|
| 165 |
+
else { // is_object
|
| 166 |
+
if (!stripos($value, "<li class=")) {
|
| 167 |
+
$value = "<ul><li class=\"file\">" . $value . "</li></ul>" . $newline;
|
| 168 |
+
}
|
| 169 |
+
|
| 170 |
+
$output .= "<li class=\"folder\">" . $key . $value . "</li>" . $newline;
|
| 171 |
+
}
|
| 172 |
+
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
return $output;
|
| 176 |
+
}
|
includes/index.php
ADDED
|
@@ -0,0 +1,4 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
//Source of plugin
|
| 3 |
+
header("Location: http://www.shareaholic.com");
|
| 4 |
+
?>
|
includes/mobile.php
ADDED
|
@@ -0,0 +1,89 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
//Checking for bots
|
| 4 |
+
function shrsb_is_bot() {
|
| 5 |
+
$ua = strtolower($_SERVER['HTTP_USER_AGENT']);
|
| 6 |
+
$ip = $_SERVER['REMOTE_ADDR'];
|
| 7 |
+
$isBot = $ip == '66.249.65.39'
|
| 8 |
+
|| strpos($ua, 'googlebot') !== false
|
| 9 |
+
|| strpos($ua, 'mediapartners') !== false
|
| 10 |
+
|| strpos($ua, 'yahooysmcm') !== false
|
| 11 |
+
|| strpos($ua, 'baiduspider') !== false
|
| 12 |
+
|| strpos($ua, 'msnbot') !== false
|
| 13 |
+
|| strpos($ua, 'slurp') !== false
|
| 14 |
+
|| strpos($ua, 'ask') !== false
|
| 15 |
+
|| strpos($ua, 'teoma') !== false
|
| 16 |
+
|| strpos($ua, 'spider') !== false
|
| 17 |
+
|| strpos($ua, 'heritrix') !== false
|
| 18 |
+
|| strpos($ua, 'attentio') !== false
|
| 19 |
+
|| strpos($ua, 'twiceler') !== false
|
| 20 |
+
|| strpos($ua, 'irlbot') !== false
|
| 21 |
+
|| strpos($ua, 'fast crawler') !== false
|
| 22 |
+
|| strpos($ua, 'fastmobilecrawl') !== false
|
| 23 |
+
|| strpos($ua, 'jumpbot') !== false
|
| 24 |
+
|| strpos($ua, 'googlebot-mobile') !== false
|
| 25 |
+
|| strpos($ua, 'yahooseeker') !== false
|
| 26 |
+
|| strpos($ua, 'motionbot') !== false
|
| 27 |
+
|| strpos($ua, 'mediobot') !== false
|
| 28 |
+
|| strpos($ua, 'chtml generic') !== false
|
| 29 |
+
|| strpos($ua, 'nokia6230i/. fast crawler') !== false
|
| 30 |
+
; // $isBot
|
| 31 |
+
return $isBot;
|
| 32 |
+
}
|
| 33 |
+
|
| 34 |
+
//Checking for mobile browsers
|
| 35 |
+
function shrsb_is_mobile() {
|
| 36 |
+
if (isset($_SERVER['HTTP_X_OPERAMINI_PHONE'])){
|
| 37 |
+
$op = strtolower($_SERVER['HTTP_X_OPERAMINI_PHONE']);
|
| 38 |
+
} else {
|
| 39 |
+
$op = '';
|
| 40 |
+
}
|
| 41 |
+
$ua = strtolower($_SERVER['HTTP_USER_AGENT']);
|
| 42 |
+
$ac = strtolower($_SERVER['HTTP_ACCEPT']);
|
| 43 |
+
$isMobile = strpos($ac, 'application/vnd.wap.xhtml+xml') !== false
|
| 44 |
+
|| $op != ''
|
| 45 |
+
|| strpos($ua, 'sony') !== false
|
| 46 |
+
|| strpos($ua, 'symbian') !== false
|
| 47 |
+
|| strpos($ua, 'nokia') !== false
|
| 48 |
+
|| strpos($ua, 'samsung') !== false
|
| 49 |
+
|| strpos($ua, 'mobile') !== false
|
| 50 |
+
|| strpos($ua, 'windows ce') !== false
|
| 51 |
+
|| strpos($ua, 'epoc') !== false
|
| 52 |
+
|| strpos($ua, 'opera mini') !== false
|
| 53 |
+
|| strpos($ua, 'nitro') !== false
|
| 54 |
+
|| strpos($ua, 'j2me') !== false
|
| 55 |
+
|| strpos($ua, 'midp-') !== false
|
| 56 |
+
|| strpos($ua, 'cldc-') !== false
|
| 57 |
+
|| strpos($ua, 'netfront') !== false
|
| 58 |
+
|| strpos($ua, 'mot') !== false
|
| 59 |
+
|| strpos($ua, 'up.browser') !== false
|
| 60 |
+
|| strpos($ua, 'up.link') !== false
|
| 61 |
+
|| strpos($ua, 'audiovox') !== false
|
| 62 |
+
|| strpos($ua, 'blackberry') !== false
|
| 63 |
+
|| strpos($ua, 'ericsson,') !== false
|
| 64 |
+
|| strpos($ua, 'panasonic') !== false
|
| 65 |
+
|| strpos($ua, 'philips') !== false
|
| 66 |
+
|| strpos($ua, 'sanyo') !== false
|
| 67 |
+
|| strpos($ua, 'sharp') !== false
|
| 68 |
+
|| strpos($ua, 'sie-') !== false
|
| 69 |
+
|| strpos($ua, 'portalmmm') !== false
|
| 70 |
+
|| strpos($ua, 'blazer') !== false
|
| 71 |
+
|| strpos($ua, 'avantgo') !== false
|
| 72 |
+
|| strpos($ua, 'danger') !== false
|
| 73 |
+
|| strpos($ua, 'palm') !== false
|
| 74 |
+
|| strpos($ua, 'series60') !== false
|
| 75 |
+
|| strpos($ua, 'palmsource') !== false
|
| 76 |
+
|| strpos($ua, 'pocketpc') !== false
|
| 77 |
+
|| strpos($ua, 'smartphone') !== false
|
| 78 |
+
|| strpos($ua, 'rover') !== false
|
| 79 |
+
|| strpos($ua, 'ipaq') !== false
|
| 80 |
+
|| strpos($ua, 'au-mic,') !== false
|
| 81 |
+
|| strpos($ua, 'alcatel') !== false
|
| 82 |
+
|| strpos($ua, 'ericy') !== false
|
| 83 |
+
|| strpos($ua, 'up.link') !== false
|
| 84 |
+
|| strpos($ua, 'vodafone/') !== false
|
| 85 |
+
|| strpos($ua, 'wap1.') !== false
|
| 86 |
+
|| strpos($ua, 'wap2.') !== false
|
| 87 |
+
; // $isMobile
|
| 88 |
+
return $isMobile;
|
| 89 |
+
}
|
includes/public.php
ADDED
|
@@ -0,0 +1,1279 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
// Functions related to mobile.
|
| 4 |
+
require_once 'mobile.php';
|
| 5 |
+
$shrsb_is_mobile = shrsb_is_mobile();
|
| 6 |
+
$shrsb_is_bot = shrsb_is_bot();
|
| 7 |
+
|
| 8 |
+
// Written in the footer if shareaholic-javascript is on
|
| 9 |
+
$shrsb_js_params = array();
|
| 10 |
+
$shrsb_tb_js_params = array();
|
| 11 |
+
$shrsb_rd_js_params = array();
|
| 12 |
+
$shrsb_cb_js_params = array();
|
| 13 |
+
|
| 14 |
+
$shrsb_bgimg_map = array(
|
| 15 |
+
'shr' => array(
|
| 16 |
+
'url' => SHRSB_PLUGPATH.'images/sharing-shr.png',
|
| 17 |
+
'padding' => '28px 0 0 10px',
|
| 18 |
+
'class' => 'shr-bookmarks-bg-shr',
|
| 19 |
+
),
|
| 20 |
+
'caring' => array(
|
| 21 |
+
'url' => SHRSB_PLUGPATH.'images/sharing-caring-hearts.png',
|
| 22 |
+
'padding' => '26px 0 0 10px',
|
| 23 |
+
'class' => 'shr-bookmarks-bg-caring',
|
| 24 |
+
),
|
| 25 |
+
'care-old' => array(
|
| 26 |
+
'url' => SHRSB_PLUGPATH.'images/sharing-caring.png',
|
| 27 |
+
'padding' => '26px 0 0 10px',
|
| 28 |
+
'class' => 'shr-bookmarks-bg-care-old',
|
| 29 |
+
),
|
| 30 |
+
'love' => array(
|
| 31 |
+
'url' => SHRSB_PLUGPATH.'images/share-love-hearts.png',
|
| 32 |
+
'padding' => '26px 0 0 10px',
|
| 33 |
+
'class' => 'shr-bookmarks-bg-love',
|
| 34 |
+
),
|
| 35 |
+
'wealth' => array(
|
| 36 |
+
'url' => SHRSB_PLUGPATH.'images/share-wealth.png',
|
| 37 |
+
'padding' => '35px 0 0 20px',
|
| 38 |
+
'class' => 'shr-bookmarks-bg-wealth',
|
| 39 |
+
),
|
| 40 |
+
'enjoy' => array(
|
| 41 |
+
'url' => SHRSB_PLUGPATH.'images/share-enjoy.png',
|
| 42 |
+
'padding' => '26px 0 0 10px',
|
| 43 |
+
'class' => 'shr-bookmarks-bg-enjoy',
|
| 44 |
+
),
|
| 45 |
+
'german' => array(
|
| 46 |
+
'url' => SHRSB_PLUGPATH.'images/share-german.png',
|
| 47 |
+
'padding' => '35px 0 0 20px',
|
| 48 |
+
'class' => 'shr-bookmarks-bg-german',
|
| 49 |
+
),
|
| 50 |
+
'knowledge' => array(
|
| 51 |
+
'url' => SHRSB_PLUGPATH.'images/share-knowledge.png',
|
| 52 |
+
'padding' => '35px 0 0 10px',
|
| 53 |
+
'class' => 'shr-bookmarks-bg-knowledge',
|
| 54 |
+
),
|
| 55 |
+
);
|
| 56 |
+
|
| 57 |
+
/**
|
| 58 |
+
* Helper method that returns array for the current post of
|
| 59 |
+
* array(
|
| 60 |
+
* 'link' => ..,
|
| 61 |
+
* 'title' => ..,
|
| 62 |
+
* 'feed_permalink' => ..,
|
| 63 |
+
* 'mail_subject' => ..
|
| 64 |
+
* )
|
| 65 |
+
*/
|
| 66 |
+
function shrsb_post_info($post) {
|
| 67 |
+
global $shrsb_plugopts, $shrsb_bgimg_map;
|
| 68 |
+
|
| 69 |
+
//Just so you don't forget, $r means "results"
|
| 70 |
+
$r = array();
|
| 71 |
+
|
| 72 |
+
// if (position == manual or (home and index)) and no post_title
|
| 73 |
+
// then we are "Outside the loop".
|
| 74 |
+
$ismanual = $shrsb_plugopts['position'] == 'manual';
|
| 75 |
+
$ishome = is_home() &&
|
| 76 |
+
false!==strpos($shrsb_plugopts['pageorpost'],"index");
|
| 77 |
+
$isemptytitle = empty($post->post_title);
|
| 78 |
+
if($ismanual || ($ishome && $isemptytitle) || !in_the_loop()) {
|
| 79 |
+
|
| 80 |
+
if(!in_the_loop()) {
|
| 81 |
+
$link= 'http://' . $_SERVER['SERVER_NAME'] . $_SERVER['REQUEST_URI'];
|
| 82 |
+
}
|
| 83 |
+
//Otherwise, it must be inside the loop
|
| 84 |
+
else {
|
| 85 |
+
if(($link = get_permalink($post->ID)) == false){
|
| 86 |
+
$link = 'http://' . $_SERVER['SERVER_NAME'] . $_SERVER['REQUEST_URI'];
|
| 87 |
+
}
|
| 88 |
+
}
|
| 89 |
+
$link = trim($link);
|
| 90 |
+
shrsb_log('Manual: Link Generation '.$link);
|
| 91 |
+
$r['link'] = $link;
|
| 92 |
+
$r['title'] = get_bloginfo('name') . wp_title('-', false);
|
| 93 |
+
$r['feed_permalink'] = strtolower('http://' . $_SERVER['SERVER_NAME'] . $_SERVER['REQUEST_URI']);
|
| 94 |
+
$r['mail_subject'] = urlencode(get_bloginfo('name') . wp_title('-', false));
|
| 95 |
+
|
| 96 |
+
}
|
| 97 |
+
//We are "in the loop"
|
| 98 |
+
else {
|
| 99 |
+
$r['link'] = trim(get_permalink($post->ID));
|
| 100 |
+
shrsb_log("Loop mode Link Generation ".$r['link']);
|
| 101 |
+
$r['title'] = $post->post_title;
|
| 102 |
+
$r['feed_permalink'] = strtolower($r['link']);
|
| 103 |
+
$r['mail_subject'] = urlencode($post->post_title);
|
| 104 |
+
}
|
| 105 |
+
|
| 106 |
+
// Determine how to handle post titles for Twitter
|
| 107 |
+
if (strlen($r['title']) >= 80) {
|
| 108 |
+
$r['short_title'] = urlencode(substr($r['title'], 0, 80)."[..]");
|
| 109 |
+
}
|
| 110 |
+
else {
|
| 111 |
+
$r['short_title'] = urlencode($r['title']);
|
| 112 |
+
}
|
| 113 |
+
return $r;
|
| 114 |
+
}
|
| 115 |
+
|
| 116 |
+
/**
|
| 117 |
+
* Returns array of values that should be used in recommendations js
|
| 118 |
+
*/
|
| 119 |
+
function shrsb_get_rd_config($post_id) {
|
| 120 |
+
|
| 121 |
+
global $shrsb_recommendations;
|
| 122 |
+
|
| 123 |
+
$r = shrsb_get_params($post_id);
|
| 124 |
+
|
| 125 |
+
$params = array(
|
| 126 |
+
'link' => $r['link'],
|
| 127 |
+
'apikey' => $r['apikey'] ? $r['apikey'] : '8afa39428933be41f8afdb8ea21a495c',
|
| 128 |
+
'number' => $shrsb_recommendations['num'],
|
| 129 |
+
'style' => $shrsb_recommendations['style']
|
| 130 |
+
);
|
| 131 |
+
|
| 132 |
+
return array_filter($params);
|
| 133 |
+
}
|
| 134 |
+
/**
|
| 135 |
+
* Returns array of values that should be used in classicbookmarks js
|
| 136 |
+
*/
|
| 137 |
+
function shrsb_get_cb_config($post_id) {
|
| 138 |
+
|
| 139 |
+
global $shrsb_cb;
|
| 140 |
+
|
| 141 |
+
$r = shrsb_get_params($post_id);
|
| 142 |
+
$params = array(
|
| 143 |
+
'link' => $r['link'],
|
| 144 |
+
'title' => $r['title'],
|
| 145 |
+
'apikey' => $r['apikey'] ? $r['apikey'] : '8afa39428933be41f8afdb8ea21a495c',
|
| 146 |
+
'size' => $shrsb_cb['size']
|
| 147 |
+
);
|
| 148 |
+
|
| 149 |
+
return array_filter($params);
|
| 150 |
+
}
|
| 151 |
+
|
| 152 |
+
/**
|
| 153 |
+
* Returns array of values that should be used in shareaholic-publishers.js
|
| 154 |
+
*/
|
| 155 |
+
function shrsb_get_publisher_config($post_id) {
|
| 156 |
+
shrsb_log("get_publisher_config started");
|
| 157 |
+
global $default_spritegen;
|
| 158 |
+
$spritegen = $default_spritegen ? 'spritegen_default' : 'spritegen';
|
| 159 |
+
$spritegen_basepath = shrsb_correct_protocol($default_spritegen ? SHRSB_PLUGPATH : SHRSB_UPLOADPATH);
|
| 160 |
+
|
| 161 |
+
$r = shrsb_get_params($post_id);
|
| 162 |
+
|
| 163 |
+
//set default values if not set
|
| 164 |
+
if (!isset($r['spriteimg'])){$r['spriteimg'] = '';}
|
| 165 |
+
if (!isset($r['bgimg-padding'])){$r['bgimg-padding'] = '';}
|
| 166 |
+
|
| 167 |
+
$params = array(
|
| 168 |
+
'link' => $r['link'],
|
| 169 |
+
'short_link' => $r['short_link'],
|
| 170 |
+
'shortener' => $r['shortener'],
|
| 171 |
+
'shortener_key' => $r['shortener_key'],
|
| 172 |
+
'title' => $r['title'],
|
| 173 |
+
'notes' => $r['notes'],
|
| 174 |
+
'service' => $r['service'],
|
| 175 |
+
'apikey' => $r['apikey'] ? $r['apikey'] : '8afa39428933be41f8afdb8ea21a495c',
|
| 176 |
+
// we need this because wordpress won't pass it at all if it's FALSE
|
| 177 |
+
// and the default value for expand is true. We convert it to boolean in javascript
|
| 178 |
+
'expand' => $r['expand'] ? true : 'false',
|
| 179 |
+
'src' => $spritegen_basepath.$spritegen,
|
| 180 |
+
'localize' => true,
|
| 181 |
+
'share_src' => shrsb_correct_protocol($r['shrbase']),
|
| 182 |
+
'rel' => $r['reloption'],
|
| 183 |
+
'target' => $r['targetopt'] == '_blank' ? '_blank' : '_top',
|
| 184 |
+
'bgimg' => $r['bgimg-url'],
|
| 185 |
+
'bgimg_padding' => $r['bgimg-padding'],
|
| 186 |
+
'center' => $r['autocenter'] == 1,
|
| 187 |
+
'spaced' => $r['autocenter'] == 2,
|
| 188 |
+
'twitter_template' => $r['tweetconfig'],
|
| 189 |
+
'mode' => 'inject',
|
| 190 |
+
'spriteimg' => $r['spriteimg'],
|
| 191 |
+
'designer_toolTips' => $r['designer_toolTips'],
|
| 192 |
+
'tip_bg_color' => $r['tip_bg_color'], // tooltip background color
|
| 193 |
+
'tip_text_color' => $r['tip_text_color'], // tooltip text color
|
| 194 |
+
'dontShowShareCount' => $r['showShareCount'] == "0",
|
| 195 |
+
'shrlink' => $r['shrlink'],
|
| 196 |
+
);
|
| 197 |
+
|
| 198 |
+
if ($r['include_comfeed']) {
|
| 199 |
+
// Shareaholic doesn't support comment rss feeds, so we add it as a custom link.
|
| 200 |
+
$params['custom_link'] = array(
|
| 201 |
+
$r['comfeed_position'] => array(
|
| 202 |
+
'li_class' => 'custom-comfeed',
|
| 203 |
+
'link' => $r['feed_link'],
|
| 204 |
+
'tooltip' => __('Subscribe to the comments for this post?', 'shrsb'),
|
| 205 |
+
'style' => 'background-image:url('.SHRSB_PLUGPATH.'images/comfeed.png);',
|
| 206 |
+
),
|
| 207 |
+
);
|
| 208 |
+
}
|
| 209 |
+
shrsb_log("get_publisher_config completed");
|
| 210 |
+
return array_filter($params);
|
| 211 |
+
}
|
| 212 |
+
|
| 213 |
+
|
| 214 |
+
function shrsb_get_shortener_settings(){
|
| 215 |
+
global $shrsb_plugopts;
|
| 216 |
+
|
| 217 |
+
|
| 218 |
+
$shorty = @$shrsb_plugopts['shorty'];
|
| 219 |
+
$shortyapi = @$shrsb_plugopts['shortyapi'];
|
| 220 |
+
$shortener_key = '';
|
| 221 |
+
|
| 222 |
+
if (isset( $shorty ) ){
|
| 223 |
+
switch( $shorty ) {
|
| 224 |
+
case 'bitly':
|
| 225 |
+
case 'awesm':
|
| 226 |
+
case 'jmp':
|
| 227 |
+
case 'supr':
|
| 228 |
+
$user = $shortyapi[$shorty]['user'];
|
| 229 |
+
$api = $shortyapi[$shorty]['key'];
|
| 230 |
+
$shortener_key = $user ? ($user.'|'.$api) : '';
|
| 231 |
+
break;
|
| 232 |
+
default:
|
| 233 |
+
}
|
| 234 |
+
}
|
| 235 |
+
|
| 236 |
+
return $shortener_key;
|
| 237 |
+
}
|
| 238 |
+
/**
|
| 239 |
+
* Returns array of all relevant information about the current post for sexy
|
| 240 |
+
*/
|
| 241 |
+
function shrsb_get_params($post_id) {
|
| 242 |
+
|
| 243 |
+
if(isset($shrsb_plugopts['sexybookmark']) && $shrsb_plugopts['sexybookmark'] != '1') {
|
| 244 |
+
return array();
|
| 245 |
+
}
|
| 246 |
+
|
| 247 |
+
shrsb_log("get_params start");
|
| 248 |
+
global $shrsb_plugopts, $shrsb_bgimg_map;
|
| 249 |
+
|
| 250 |
+
|
| 251 |
+
if($post_id >= 0){
|
| 252 |
+
$post = get_post($post_id);
|
| 253 |
+
}else{
|
| 254 |
+
//For handling the (manual mode && outside the loop)
|
| 255 |
+
$post = "";
|
| 256 |
+
}
|
| 257 |
+
|
| 258 |
+
|
| 259 |
+
// response parameters
|
| 260 |
+
$post_info = shrsb_post_info($post);
|
| 261 |
+
$r = array_merge($shrsb_plugopts, $post_info);
|
| 262 |
+
|
| 263 |
+
// Grab the short URL
|
| 264 |
+
$r['short_link'] = shrsb_get_fetch_url();
|
| 265 |
+
$r['shortener'] = $r['shorty'];
|
| 266 |
+
$r['shortener_key'] = shrsb_get_shortener_settings();
|
| 267 |
+
|
| 268 |
+
if($post_id >= 0){
|
| 269 |
+
$r['post_summary'] = urlencode(strip_tags(
|
| 270 |
+
strip_shortcodes($post->post_excerpt)));
|
| 271 |
+
|
| 272 |
+
if ($r['post_summary'] == "") {
|
| 273 |
+
$r['post_summary'] = urlencode(substr(strip_tags(strip_shortcodes($post->post_content)),0,300));
|
| 274 |
+
}
|
| 275 |
+
|
| 276 |
+
$r['shrsb_content'] = urlencode(strip_tags(strip_shortcodes($post->post_excerpt)));
|
| 277 |
+
if ($r['shrsb_content'] == "") {
|
| 278 |
+
$r['shrsb_content'] = urlencode(substr(strip_tags(strip_shortcodes($post->post_content)),0,300));
|
| 279 |
+
}
|
| 280 |
+
$r['shrsb_content'] = str_replace('+','%20',$r['shrsb_content']);
|
| 281 |
+
$r['post_summary'] = stripslashes(str_replace('+','%20',$r['post_summary']));
|
| 282 |
+
}
|
| 283 |
+
|
| 284 |
+
|
| 285 |
+
$r['site_name'] = get_bloginfo('name');
|
| 286 |
+
$r['mail_subject'] = str_replace("’","'",str_replace('+','%20',$r['mail_subject']));
|
| 287 |
+
|
| 288 |
+
// Grab post tags for Twittley tags. If there aren't any, use default tags
|
| 289 |
+
// set in plugin options page
|
| 290 |
+
$getkeywords = get_the_tags();
|
| 291 |
+
$r['d_tags'] = "";
|
| 292 |
+
$tags = array();
|
| 293 |
+
if (!empty($getkeywords) && !empty($d_tags)) {
|
| 294 |
+
foreach($getkeywords as $tag) {
|
| 295 |
+
$tags[] = $tag->name;
|
| 296 |
+
}
|
| 297 |
+
$r['d_tags'] = implode(',', $tags);
|
| 298 |
+
}
|
| 299 |
+
|
| 300 |
+
// Check permalink setup for proper feed link
|
| 301 |
+
$hasquery = false !== strpos($r['feed_permalink'],'?');
|
| 302 |
+
$isphp = false !== strpos($r['feed_permalink'],'.php',
|
| 303 |
+
max(0,strlen($r['feed_permalink']) - 4));
|
| 304 |
+
if ($hasquery || $isphp) {
|
| 305 |
+
$r['feed_structure'] = '&feed=comments-rss2';
|
| 306 |
+
}
|
| 307 |
+
else {
|
| 308 |
+
$endsinslash = '/' ==
|
| 309 |
+
$r['feed_permalink'][strlen($r['feed_permalink']) - 1];
|
| 310 |
+
if ($endsinslash) {
|
| 311 |
+
$r['feed_structure'] = 'feed';
|
| 312 |
+
}
|
| 313 |
+
else {
|
| 314 |
+
$r['feed_structure'] = '/feed';
|
| 315 |
+
}
|
| 316 |
+
}
|
| 317 |
+
$r['feed_link'] = $r['feed_permalink'].$r['feed_structure'];
|
| 318 |
+
|
| 319 |
+
if($post_id >= 0){
|
| 320 |
+
// Compatibility fix for NextGen Gallery Plugin...
|
| 321 |
+
if( (strpos($r['post_summary'], '[') || strpos($r['post_summary'], ']')) ) {
|
| 322 |
+
$r['post_summary'] = "";
|
| 323 |
+
}
|
| 324 |
+
if((strpos($r['shrsb_content'], '[') || strpos($r['shrsb_content'],']'))) {
|
| 325 |
+
$r['shrsb_content'] = "";
|
| 326 |
+
}
|
| 327 |
+
}
|
| 328 |
+
$r['bgimg-url'] = '';
|
| 329 |
+
if(isset($shrsb_plugopts['bgimg-yes'])) {
|
| 330 |
+
$r['bgimg-url'] = $shrsb_bgimg_map[$shrsb_plugopts['bgimg']]['url'];
|
| 331 |
+
$r['bgimg-padding'] = $shrsb_bgimg_map[$shrsb_plugopts['bgimg']]['padding'];
|
| 332 |
+
}
|
| 333 |
+
|
| 334 |
+
// Select the background image
|
| 335 |
+
$bclasses = array('shr-bookmarks');
|
| 336 |
+
if (isset($shrsb_plugopts['bgimg-yes'])) {
|
| 337 |
+
$bclasses[] = $shrsb_bgimg_map[$shrsb_plugopts['bgimg']]['class'];
|
| 338 |
+
}
|
| 339 |
+
if ($shrsb_plugopts['expand'] == 1) {
|
| 340 |
+
$r['expand'] = true;
|
| 341 |
+
$bclasses[] = 'shr-bookmarks-expand';
|
| 342 |
+
}
|
| 343 |
+
if ($shrsb_plugopts['autocenter'] == 1) {
|
| 344 |
+
$bclasses[] = 'shr-bookmarks-center';
|
| 345 |
+
}
|
| 346 |
+
elseif ($shrsb_plugopts['autocenter'] == 2) {
|
| 347 |
+
$bclasses[] = 'shr-bookmarks-spaced';
|
| 348 |
+
}
|
| 349 |
+
$r['bookmarks-class'] = implode(' ', $bclasses);
|
| 350 |
+
|
| 351 |
+
if($post_id >= 0){
|
| 352 |
+
$r['notes'] = $r['post_summary'];
|
| 353 |
+
}else{
|
| 354 |
+
$r['notes'] = "";
|
| 355 |
+
}
|
| 356 |
+
// see if we need comfeed
|
| 357 |
+
$position = array_search('shr-comfeed', $shrsb_plugopts['bookmark']);
|
| 358 |
+
if (is_numeric($position)) {
|
| 359 |
+
$r['include_comfeed'] = TRUE;
|
| 360 |
+
if ($position == 0) {
|
| 361 |
+
$r['comfeed_position'] = 'before_0';
|
| 362 |
+
}
|
| 363 |
+
else {
|
| 364 |
+
$r['comfeed_position'] = 'after_'.($position-1);
|
| 365 |
+
}
|
| 366 |
+
}
|
| 367 |
+
else {
|
| 368 |
+
$r['include_comfeed'] = FALSE;
|
| 369 |
+
}
|
| 370 |
+
shrsb_log("get_params completed");
|
| 371 |
+
return $r;
|
| 372 |
+
}
|
| 373 |
+
|
| 374 |
+
|
| 375 |
+
function shrsb_get_fetch_url() {
|
| 376 |
+
shrsb_log("get_fetch_url start");
|
| 377 |
+
global $post, $shrsb_plugopts, $wp_query; //globals
|
| 378 |
+
|
| 379 |
+
//get link but first check if inside or outside loop and what page it's on
|
| 380 |
+
$spost = $wp_query->post;
|
| 381 |
+
|
| 382 |
+
if($shrsb_plugopts['position'] == 'manual') {
|
| 383 |
+
//Check if outside the loop
|
| 384 |
+
if(!in_the_loop()) {
|
| 385 |
+
$perms= 'http://' . $_SERVER['SERVER_NAME'] . $_SERVER['REQUEST_URI'];
|
| 386 |
+
}
|
| 387 |
+
//Otherwise, it must be inside the loop
|
| 388 |
+
else {
|
| 389 |
+
$perms = get_permalink($post->ID);
|
| 390 |
+
}
|
| 391 |
+
}
|
| 392 |
+
//Check if index page...
|
| 393 |
+
elseif(is_home() && false!==strpos($shrsb_plugopts['pageorpost'],"index")) {
|
| 394 |
+
//Check if outside the loop
|
| 395 |
+
if(!in_the_loop()) {
|
| 396 |
+
$perms= 'http://' . $_SERVER['SERVER_NAME'] . $_SERVER['REQUEST_URI'] ;
|
| 397 |
+
}
|
| 398 |
+
//Otherwise, it must be inside the loop
|
| 399 |
+
else {
|
| 400 |
+
$perms = get_permalink($post->ID);
|
| 401 |
+
}
|
| 402 |
+
}
|
| 403 |
+
//Apparently isn't on index page...
|
| 404 |
+
else {
|
| 405 |
+
$perms = get_permalink($post->ID);
|
| 406 |
+
}
|
| 407 |
+
$perms = trim($perms);
|
| 408 |
+
shrsb_log("URL ".$perms);
|
| 409 |
+
//if is post, and post is not published then return permalink and go back
|
| 410 |
+
if($post && get_post_status($post->ID) != 'publish') {
|
| 411 |
+
return $perms;
|
| 412 |
+
}
|
| 413 |
+
//if user chose not to use shortener, return nothing
|
| 414 |
+
if($shrsb_plugopts['shorty'] == 'none') {
|
| 415 |
+
// return no short_link
|
| 416 |
+
}
|
| 417 |
+
if ($shrsb_plugopts['shorty'] == 'tflp' && function_exists('permalink_to_twitter_link')) {
|
| 418 |
+
$fetch_url = permalink_to_twitter_link($perms);
|
| 419 |
+
}
|
| 420 |
+
elseif ($shrsb_plugopts['shorty'] == 'yourls' && function_exists('wp_ozh_yourls_raw_url')) {
|
| 421 |
+
$fetch_url = wp_ozh_yourls_raw_url();
|
| 422 |
+
}
|
| 423 |
+
|
| 424 |
+
if (!empty($fetch_url)) {
|
| 425 |
+
return $fetch_url;
|
| 426 |
+
}
|
| 427 |
+
shrsb_log("get_fetch_url start completed");
|
| 428 |
+
}
|
| 429 |
+
|
| 430 |
+
|
| 431 |
+
// Create an auto-insertion function
|
| 432 |
+
function shrsb_position_menu($post_content) {
|
| 433 |
+
global $post, $shrsb_plugopts, $shrsb_is_mobile, $shrsb_is_bot, $shrsb_js_params, $shrsb_rd_js_params, $shrsb_cb_js_params;
|
| 434 |
+
|
| 435 |
+
if(isset($shrsb_plugopts['sexybookmark']) && $shrsb_plugopts['sexybookmark'] != '1') {
|
| 436 |
+
return $post_content;
|
| 437 |
+
}
|
| 438 |
+
|
| 439 |
+
shrsb_log("Content Analysis started");
|
| 440 |
+
// If user selected manual positioning, get out.
|
| 441 |
+
if ($shrsb_plugopts['position']=='manual') {
|
| 442 |
+
if ($shrsb_plugopts['shareaholic-javascript'] == '1') {
|
| 443 |
+
|
| 444 |
+
|
| 445 |
+
if(in_the_loop()){
|
| 446 |
+
$config = shrsb_get_publisher_config($post->ID);
|
| 447 |
+
$shrsb_js_params['shr-publisher-'.$post->ID] = $config;
|
| 448 |
+
}else{
|
| 449 |
+
shrsb_log("Error: the function should not be called outside the loop");
|
| 450 |
+
}
|
| 451 |
+
|
| 452 |
+
}
|
| 453 |
+
shrsb_log("Manual:Content Analysis returning ");
|
| 454 |
+
return $post_content;
|
| 455 |
+
}
|
| 456 |
+
|
| 457 |
+
// If user selected hide from mobile and is mobile, get out.
|
| 458 |
+
elseif ($shrsb_plugopts['mobile-hide']=='yes' && false!==$shrsb_is_mobile || $shrsb_plugopts['mobile-hide']=='yes' && false!==$shrsb_is_bot) {
|
| 459 |
+
shrsb_log("Not Manual:Content Analysis returning");
|
| 460 |
+
return $post_content;
|
| 461 |
+
}
|
| 462 |
+
|
| 463 |
+
$output = "";
|
| 464 |
+
$likeButtonSetTop = "";
|
| 465 |
+
$likeButtonSetBottom = "";
|
| 466 |
+
|
| 467 |
+
// Decide whether or not to generate the bookmarks.
|
| 468 |
+
if ( (is_single() && false!==strpos($shrsb_plugopts['pageorpost'],"post")) ||
|
| 469 |
+
(is_page() && false!==strpos($shrsb_plugopts['pageorpost'],"page")) ||
|
| 470 |
+
(is_home() && false!==strpos($shrsb_plugopts['pageorpost'],"index")) ||
|
| 471 |
+
(is_category() && false!==strpos($shrsb_plugopts['pageorpost'],"category") ) ||
|
| 472 |
+
(is_feed() && !empty($shrsb_plugopts['feed']))) {
|
| 473 |
+
|
| 474 |
+
// socials should be generated and added
|
| 475 |
+
if( ($hide_sexy = get_post_meta($post->ID, 'Hide SexyBookmarks', true)) != 1 ){
|
| 476 |
+
// Checking for new Mode
|
| 477 |
+
if ($shrsb_plugopts['shareaholic-javascript'] == '1') {
|
| 478 |
+
$output = '<div class="shr-publisher-'.$post->ID.'"></div>';
|
| 479 |
+
$likeButtonSetTop = get_shr_like_buttonset('Top', 1);
|
| 480 |
+
$likeButtonSetBottom = get_shr_like_buttonset('Bottom', 1);
|
| 481 |
+
$config = shrsb_get_publisher_config($post->ID);
|
| 482 |
+
|
| 483 |
+
$shrsb_js_params['shr-publisher-'.$post->ID] = $config;
|
| 484 |
+
}
|
| 485 |
+
else {
|
| 486 |
+
$output=get_sexy();
|
| 487 |
+
}
|
| 488 |
+
shrsb_log("Sexybookmark HTML here <!-- ".$output.$likeButtonSetTop.$likeButtonSetBottom."--> Inspect me check the html");
|
| 489 |
+
}
|
| 490 |
+
}
|
| 491 |
+
// Place of bookmarks and return w/ post content.
|
| 492 |
+
$r = $post_content;
|
| 493 |
+
if (!empty($output)) {
|
| 494 |
+
|
| 495 |
+
switch($shrsb_plugopts['position']) {
|
| 496 |
+
case 'above':
|
| 497 |
+
$r = $output.$post_content;
|
| 498 |
+
break;
|
| 499 |
+
case 'both':
|
| 500 |
+
$r = $output.$post_content.$output;
|
| 501 |
+
break;
|
| 502 |
+
case 'below':
|
| 503 |
+
$r = $post_content.$output;
|
| 504 |
+
break;
|
| 505 |
+
default:
|
| 506 |
+
error_log(__('An unknown error occurred in SexyBookmarks','shrsb'));
|
| 507 |
+
}
|
| 508 |
+
|
| 509 |
+
$r = $likeButtonSetTop.$r.$likeButtonSetBottom;
|
| 510 |
+
}
|
| 511 |
+
|
| 512 |
+
shrsb_log("Content Analysis Completed");
|
| 513 |
+
return $r;
|
| 514 |
+
} // End shrsb_position_menu...
|
| 515 |
+
|
| 516 |
+
|
| 517 |
+
function get_shr_like_buttonset($pos = 'Bottom', $return_type = NULL, $settings = NULL) { // $pos = 'Bottom'/'Top' Case sensitive
|
| 518 |
+
global $shrsb_plugopts, $post;
|
| 519 |
+
|
| 520 |
+
if(!$settings) $settings = $shrsb_plugopts;
|
| 521 |
+
|
| 522 |
+
$usage = "Manual";
|
| 523 |
+
if($return_type) $usage = "Automatic";
|
| 524 |
+
|
| 525 |
+
if(in_the_loop()){
|
| 526 |
+
$href = urlencode(get_permalink($post->ID));
|
| 527 |
+
$title = urlencode($post->post_title);
|
| 528 |
+
}else{
|
| 529 |
+
$href = urlencode('http://' . $_SERVER['SERVER_NAME'] . $_SERVER['REQUEST_URI']);
|
| 530 |
+
$title = urlencode(get_bloginfo('name') . wp_title('-', false));
|
| 531 |
+
}
|
| 532 |
+
|
| 533 |
+
if(empty($title)) {
|
| 534 |
+
$title = urlencode(get_bloginfo('name') . wp_title('-', false));
|
| 535 |
+
}
|
| 536 |
+
$output = "";
|
| 537 |
+
$float = "none";
|
| 538 |
+
|
| 539 |
+
if($settings['likeButtonSetAlignment'.$pos] == '1') {
|
| 540 |
+
$float = "right";
|
| 541 |
+
}
|
| 542 |
+
|
| 543 |
+
if($settings['likeButtonSet'.$pos] &&
|
| 544 |
+
($settings['fbLikeButton'.$pos] == '1' || $settings['fbSendButton'.$pos] == '1' || $settings['googlePlusOneButton'.$pos] == '1' || $settings['tweetButton'.$pos] == '1')) {
|
| 545 |
+
|
| 546 |
+
$spacer = '<div style="clear: both; min-height: 1px; height: 3px; width: 100%;"></div>';
|
| 547 |
+
$like_layout = $settings['likeButtonSetSize'.$pos];
|
| 548 |
+
$height = "";
|
| 549 |
+
switch($like_layout) {
|
| 550 |
+
case '2':
|
| 551 |
+
$height = "height:60px";
|
| 552 |
+
break;
|
| 553 |
+
default:
|
| 554 |
+
$height = "height:30px";
|
| 555 |
+
break;
|
| 556 |
+
}
|
| 557 |
+
$output .= "<div class='shareaholic-like-buttonset' style='float:$float;$height;'>";
|
| 558 |
+
$plusOneHTML = "";
|
| 559 |
+
$fbLikeHTML = "";
|
| 560 |
+
$fbSendHTML = "";
|
| 561 |
+
$tweetButtonHTML = "";
|
| 562 |
+
|
| 563 |
+
if($settings['googlePlusOneButton'.$pos] == '1') {
|
| 564 |
+
$plusoneSize = $like_layout;
|
| 565 |
+
switch($plusoneSize) {
|
| 566 |
+
case '1':
|
| 567 |
+
$plusoneSize = "medium";
|
| 568 |
+
break;
|
| 569 |
+
case '2':
|
| 570 |
+
$plusoneSize = "tall";
|
| 571 |
+
break;
|
| 572 |
+
default:
|
| 573 |
+
$plusoneSize = "standard";
|
| 574 |
+
break;
|
| 575 |
+
}
|
| 576 |
+
$plusoneCount = $settings['likeButtonSetCount'.$pos];
|
| 577 |
+
$plusOneHTML = "<a class='shareaholic-googleplusone' data-shr_size='$plusoneSize' data-shr_count='$plusoneCount' data-shr_href='$href' data-shr_title='$title'></a>";
|
| 578 |
+
}
|
| 579 |
+
|
| 580 |
+
if($settings['tweetButton'.$pos] == '1'){
|
| 581 |
+
$tweetButtonSize = $like_layout;
|
| 582 |
+
$tweetButtonCount = $settings['likeButtonSetCount'.$pos];
|
| 583 |
+
|
| 584 |
+
switch($tweetButtonSize) {
|
| 585 |
+
case '1':
|
| 586 |
+
$tweetButtonSize = "horizontal";
|
| 587 |
+
if(!$tweetButtonCount && $tweetButtonCount != "false") $tweetButtonSize = "horizontal";
|
| 588 |
+
break;
|
| 589 |
+
case '2':
|
| 590 |
+
$tweetButtonSize = "vertical";
|
| 591 |
+
break;
|
| 592 |
+
default:
|
| 593 |
+
$tweetButtonSize = "none";
|
| 594 |
+
if(!$tweetButtonCount && $tweetButtonCount != "false") $tweetButtonSize = "horizontal";
|
| 595 |
+
break;
|
| 596 |
+
}
|
| 597 |
+
|
| 598 |
+
if(!$tweetButtonCount && $tweetButtonCount != "false") $tweetButtonSize = "none";
|
| 599 |
+
|
| 600 |
+
$tweetButtonHTML = "<a class='shareaholic-tweetbutton' data-shr_count='$tweetButtonSize' data-shr_href='$href' data-shr_title='$title'></a>";
|
| 601 |
+
}
|
| 602 |
+
|
| 603 |
+
if($settings['fbLikeButton'.$pos] == '1') {
|
| 604 |
+
//$like_layout = $settings['likeButtonSetSize'.$pos];
|
| 605 |
+
switch($like_layout) {
|
| 606 |
+
case '1':
|
| 607 |
+
$like_layout = "button_count";
|
| 608 |
+
break;
|
| 609 |
+
case '2':
|
| 610 |
+
$like_layout = "box_count";
|
| 611 |
+
break;
|
| 612 |
+
default:
|
| 613 |
+
$like_layout = "standard";
|
| 614 |
+
break;
|
| 615 |
+
}
|
| 616 |
+
$fbLikeHTML = "<a class='shareaholic-fblike' data-shr_layout='$like_layout' data-shr_showfaces='false' data-shr_href='$href' data-shr_title='$title'></a>";
|
| 617 |
+
}
|
| 618 |
+
|
| 619 |
+
if($settings['fbSendButton'.$pos] == '1') {
|
| 620 |
+
$fbSendHTML = "<a class='shareaholic-fbsend' data-shr_href='$href'></a>";
|
| 621 |
+
}
|
| 622 |
+
|
| 623 |
+
foreach($settings['likeButtonOrder'.$pos] as $likeOption) {
|
| 624 |
+
switch($likeOption) {
|
| 625 |
+
case "shr-fb-like":
|
| 626 |
+
$output .= $fbLikeHTML;
|
| 627 |
+
break;
|
| 628 |
+
case "shr-plus-one":
|
| 629 |
+
$output .= $plusOneHTML;
|
| 630 |
+
break;
|
| 631 |
+
case "shr-fb-send":
|
| 632 |
+
$output .= $fbSendHTML;
|
| 633 |
+
break;
|
| 634 |
+
case "shr-tw-button":
|
| 635 |
+
$output .= $tweetButtonHTML;
|
| 636 |
+
break;
|
| 637 |
+
}
|
| 638 |
+
}
|
| 639 |
+
$output .= '</div>';
|
| 640 |
+
$output = $spacer.$output.$spacer;
|
| 641 |
+
}
|
| 642 |
+
shrsb_log("<!-- $output -->");
|
| 643 |
+
$output = "<!-- Start Shareaholic LikeButtonSet$pos $usage -->".$output."<!-- End Shareaholic LikeButtonSet$pos $usage -->";
|
| 644 |
+
|
| 645 |
+
if ($return_type == 1){
|
| 646 |
+
return $output;
|
| 647 |
+
}else{
|
| 648 |
+
echo $output;
|
| 649 |
+
}
|
| 650 |
+
}
|
| 651 |
+
|
| 652 |
+
function selfserv_topbar(){
|
| 653 |
+
shrsb_get_topbar("Manual");
|
| 654 |
+
}
|
| 655 |
+
/*
|
| 656 |
+
* Sample Html
|
| 657 |
+
* <div class="shr-toolbox" shr_form_factor="shareaholic-top-bar">
|
| 658 |
+
* <div class="shareaholic-like-buttonset" >
|
| 659 |
+
* <a class="shareaholic-fblike" data-shr_layout="button_count" data-shr_showfaces="false" data-shr_href="http%3A%2F%2Flocalhost%2Fwordpress%2F%3Fp%3D1" data-shr_title="Hello+world%21"></a>
|
| 660 |
+
* <a class="shareaholic-fbsend" data-shr_href="http%3A%2F%2Flocalhost%2Fwordpress%2F%3Fp%3D1"></a>
|
| 661 |
+
* <a class="shareaholic-googleplusone" data-shr_size="medium" data-shr_count="true" data-shr_href="http%3A%2F%2Flocalhost%2Fwordpress%2F%3Fp%3D1" data-shr_title="Hello+world%21"></a>
|
| 662 |
+
* <a class="shareaholic-tweetbutton" data-shr_count="horizontal" data-shr_href="http%3A%2F%2Flocalhost%2Fwordpress%2F%3Fp%3D1" data-shr_title="Hello+world%21"></a>
|
| 663 |
+
* </div>
|
| 664 |
+
* </div>
|
| 665 |
+
*/
|
| 666 |
+
function shrsb_get_topbar($usage = NULL){
|
| 667 |
+
|
| 668 |
+
if(empty($usage)) $usage = "Automatic";
|
| 669 |
+
|
| 670 |
+
shrsb_log("get_topbar started");
|
| 671 |
+
global $shrsb_plugopts,$shrsb_tb_plugopts;
|
| 672 |
+
|
| 673 |
+
$output = "";
|
| 674 |
+
$html = "";
|
| 675 |
+
//Decide whether to display
|
| 676 |
+
|
| 677 |
+
if ($shrsb_plugopts['shareaholic-javascript'] == '1' && isset($shrsb_tb_plugopts['topbar']) && ($shrsb_tb_plugopts['topbar'] == '1') &&(is_single() && false!==strpos($shrsb_tb_plugopts['pageorpost'],"post")) ||
|
| 678 |
+
(is_page() && false!==strpos($shrsb_tb_plugopts['pageorpost'],"page")) ||
|
| 679 |
+
(is_home() && false!==strpos($shrsb_tb_plugopts['pageorpost'],"index")) ||
|
| 680 |
+
(is_category() && false!==strpos($shrsb_tb_plugopts['pageorpost'],"category") )) {
|
| 681 |
+
$likeButtonSet = get_shr_like_buttonset('Top', 1, $shrsb_tb_plugopts);
|
| 682 |
+
$html = <<<EOH
|
| 683 |
+
<div class="shr-toolbox" shr_form_factor="shareaholic-top-bar">
|
| 684 |
+
$likeButtonSet
|
| 685 |
+
</div>
|
| 686 |
+
EOH;
|
| 687 |
+
|
| 688 |
+
}
|
| 689 |
+
shrsb_log("Topbar HTML here <!-- $html --> Inspect me check the html");
|
| 690 |
+
$output = "<!-- Start Shareaholic TopSharingBar $usage -->$html<!-- End Shareaholic TopSharingBar $usage -->";
|
| 691 |
+
shrsb_log("get_topbar completed");
|
| 692 |
+
echo $output;
|
| 693 |
+
|
| 694 |
+
}
|
| 695 |
+
|
| 696 |
+
function shrsb_get_recommendations($post_content){
|
| 697 |
+
|
| 698 |
+
if(empty($usage)) $usage = "Automatic";
|
| 699 |
+
|
| 700 |
+
shrsb_log("get_recommendations started");
|
| 701 |
+
global $shrsb_plugopts,$shrsb_recommendations,$post, $shrsb_rd_js_params;
|
| 702 |
+
|
| 703 |
+
$output = "";
|
| 704 |
+
$html = "";
|
| 705 |
+
//Decide whether to display
|
| 706 |
+
|
| 707 |
+
if ($shrsb_plugopts['shareaholic-javascript'] == '1' && isset($shrsb_recommendations['recommendations']) && ($shrsb_recommendations['recommendations'] == '1') &&(is_single() && false!==strpos($shrsb_recommendations['pageorpost'],"post")) ||
|
| 708 |
+
(is_page() && false!==strpos($shrsb_recommendations['pageorpost'],"page")) ||
|
| 709 |
+
(is_home() && false!==strpos($shrsb_recommendations['pageorpost'],"index")) ||
|
| 710 |
+
(is_category() && false!==strpos($shrsb_recommendations['pageorpost'],"category") )) {
|
| 711 |
+
|
| 712 |
+
if(in_the_loop()){
|
| 713 |
+
$shrsb_rd_js_params['shr_rd-'.$post->ID] = shrsb_get_rd_config($post->ID);
|
| 714 |
+
$shrsb_cb_js_params['shr_cb-'.$post->ID] = shrsb_get_cb_config($post->ID);
|
| 715 |
+
$html .= '<div class="shr_rd-'.$post->ID.'"></div>';
|
| 716 |
+
shrsb_log("Loop:get_sexy new mode found, returning ");
|
| 717 |
+
}else{
|
| 718 |
+
$shrsb_rd_js_params['shr_rd-'.$post->ID] = shrsb_get_rd_config($post->ID);
|
| 719 |
+
$html .= '<div class="shr_rd"></div>';
|
| 720 |
+
shrsb_log("Not Loop:get_sexy new mode found, returning ");
|
| 721 |
+
}
|
| 722 |
+
|
| 723 |
+
}
|
| 724 |
+
shrsb_log("Recommendations HTML here <!-- $html --> Inspect me check the html");
|
| 725 |
+
$output = "<!-- Start Shareaholic Recommendations $usage -->$html<!-- End Shareaholic Recommendations $usage -->";
|
| 726 |
+
|
| 727 |
+
return $post_content.$output;
|
| 728 |
+
}
|
| 729 |
+
function shrsb_get_cb($post_content){
|
| 730 |
+
|
| 731 |
+
if(empty($usage)) $usage = "Automatic";
|
| 732 |
+
|
| 733 |
+
shrsb_log("get_cb started");
|
| 734 |
+
global $shrsb_plugopts,$shrsb_cb,$post, $shrsb_cb_js_params;
|
| 735 |
+
|
| 736 |
+
$output = "";
|
| 737 |
+
$html = "";
|
| 738 |
+
//Decide whether to display
|
| 739 |
+
|
| 740 |
+
if ($shrsb_plugopts['shareaholic-javascript'] == '1' && isset($shrsb_cb['cb']) && ($shrsb_cb['cb'] == '1') &&(is_single() && false!==strpos($shrsb_cb['pageorpost'],"post")) ||
|
| 741 |
+
(is_page() && false!==strpos($shrsb_cb['pageorpost'],"page")) ||
|
| 742 |
+
(is_home() && false!==strpos($shrsb_cb['pageorpost'],"index")) ||
|
| 743 |
+
(is_category() && false!==strpos($shrsb_cb['pageorpost'],"category") )) {
|
| 744 |
+
|
| 745 |
+
$html .= "<div style='clear:both'></div>" ;
|
| 746 |
+
if(in_the_loop()){
|
| 747 |
+
//$shrsb_cb_js_params['shr_cb-'.$post->ID] = shrsb_get_cb_config($post->ID);
|
| 748 |
+
$shrsb_cb_js_params[$post->ID] = shrsb_get_cb_config($post->ID);
|
| 749 |
+
$html .= '<div class="shr_cb" data-shrpub_options_timestamp = '. $post->ID .'></div>';
|
| 750 |
+
shrsb_log("Loop:get_cb new mode found, returning ");
|
| 751 |
+
}else{
|
| 752 |
+
//$shrsb_cb_js_params['shr_cb-'.$post->ID] = shrsb_get_cb_config($post->ID);
|
| 753 |
+
$shrsb_cb_js_params[$post->ID] = shrsb_get_cb_config($post->ID);
|
| 754 |
+
$html .= '<div class="shr_cb"></div>';
|
| 755 |
+
shrsb_log("Not Loop:get_cb new mode found, returning ");
|
| 756 |
+
}
|
| 757 |
+
$html .= "<div style='clear:both'></div>" ;
|
| 758 |
+
|
| 759 |
+
|
| 760 |
+
}
|
| 761 |
+
shrsb_log("Classic Bookmarks HTML here <!-- $html --> Inspect me check the html");
|
| 762 |
+
$output = "<!-- Start Shareaholic ClassicBookmarks $usage -->$html<!-- End Shareaholic ClassicBookmarks $usage -->";
|
| 763 |
+
|
| 764 |
+
return $post_content.$output;
|
| 765 |
+
}
|
| 766 |
+
|
| 767 |
+
|
| 768 |
+
function get_sexy() {
|
| 769 |
+
shrsb_log("get_sexy started");
|
| 770 |
+
global $shrsb_plugopts, $wp_query, $post;
|
| 771 |
+
|
| 772 |
+
$output = "";
|
| 773 |
+
|
| 774 |
+
// If sexybookmark is disabled then return empty html
|
| 775 |
+
if(isset($shrsb_plugopts['sexybookmark']) && $shrsb_plugopts['sexybookmark'] != '1') {
|
| 776 |
+
return $output;
|
| 777 |
+
}
|
| 778 |
+
|
| 779 |
+
$spost = $wp_query->post;
|
| 780 |
+
|
| 781 |
+
|
| 782 |
+
if ($shrsb_plugopts['shareaholic-javascript'] == '1') {
|
| 783 |
+
|
| 784 |
+
if(in_the_loop()){
|
| 785 |
+
$output .= '<div class="shr-publisher-'.$post->ID.'"></div>';
|
| 786 |
+
shrsb_log("Loop:get_sexy new mode found, returning ");
|
| 787 |
+
return $output;
|
| 788 |
+
}else{
|
| 789 |
+
$output .= '<div class="shr_class shareaholic-show-on-load"></div>';
|
| 790 |
+
shrsb_log("Not Loop:get_sexy new mode found, returning ");
|
| 791 |
+
return $output;
|
| 792 |
+
}
|
| 793 |
+
}
|
| 794 |
+
|
| 795 |
+
//For Old Mode Only
|
| 796 |
+
if($shrsb_plugopts['position'] == 'manual') {
|
| 797 |
+
|
| 798 |
+
//Check if outside the loop
|
| 799 |
+
if(!in_the_loop()) {
|
| 800 |
+
$perms= 'http://' . $_SERVER['SERVER_NAME'] . $_SERVER['REQUEST_URI'] ;
|
| 801 |
+
//$perms = "";
|
| 802 |
+
shrsb_log("Manual:Not in Loop: ".$perms);
|
| 803 |
+
$title = urlencode(get_bloginfo('name') . wp_title('-', false));
|
| 804 |
+
$feedperms = strtolower('http://' . $_SERVER['SERVER_NAME'] . $_SERVER['REQUEST_URI']);
|
| 805 |
+
$mail_subject = urlencode(get_bloginfo('name') . wp_title('-', false));
|
| 806 |
+
}
|
| 807 |
+
|
| 808 |
+
//Otherwise, it must be inside the loop
|
| 809 |
+
else {
|
| 810 |
+
$perms = get_permalink($post->ID);
|
| 811 |
+
shrsb_log("Manual:In Loop: ".$perms);
|
| 812 |
+
$title = urlencode($post->post_title);
|
| 813 |
+
$feedperms = strtolower($perms);
|
| 814 |
+
$mail_subject = urlencode($post->post_title);
|
| 815 |
+
}
|
| 816 |
+
|
| 817 |
+
}//manual mode
|
| 818 |
+
|
| 819 |
+
//Check if index page...
|
| 820 |
+
elseif(is_home() && false!==strpos($shrsb_plugopts['pageorpost'],"index")) {
|
| 821 |
+
|
| 822 |
+
//Check if outside the loop
|
| 823 |
+
if(!in_the_loop()) {
|
| 824 |
+
$perms= 'http://' . $_SERVER['SERVER_NAME'] . $_SERVER['REQUEST_URI'];
|
| 825 |
+
//$perms= "";
|
| 826 |
+
shrsb_log("NotManualqqqq:Not in Loop: ".$perms);
|
| 827 |
+
$title = get_bloginfo('name') . wp_title('-', false);
|
| 828 |
+
$feedperms = strtolower('http://' . $_SERVER['SERVER_NAME'] . $_SERVER['REQUEST_URI'] );
|
| 829 |
+
$mail_subject = urlencode(get_bloginfo('name') . wp_title('-', false));
|
| 830 |
+
}
|
| 831 |
+
|
| 832 |
+
//Otherwise, it must be inside the loop
|
| 833 |
+
else {
|
| 834 |
+
$perms = get_permalink($post->ID);
|
| 835 |
+
shrsb_log("NotManual:In Loop: ".$perms);
|
| 836 |
+
$title = $post->post_title;
|
| 837 |
+
$feedperms = strtolower($perms);
|
| 838 |
+
$mail_subject = urlencode($post->post_title);
|
| 839 |
+
}
|
| 840 |
+
}
|
| 841 |
+
//Apparently isn't on index page...
|
| 842 |
+
else {
|
| 843 |
+
$perms = get_permalink($post->ID);
|
| 844 |
+
shrsb_log("Dont know in loop or not: ".$perms);
|
| 845 |
+
$title = $post->post_title;
|
| 846 |
+
$feedperms = strtolower($perms);
|
| 847 |
+
$mail_subject = urlencode($post->post_title);
|
| 848 |
+
}
|
| 849 |
+
|
| 850 |
+
// Grab the short URL
|
| 851 |
+
$fetch_url = shrsb_get_fetch_url();
|
| 852 |
+
|
| 853 |
+
|
| 854 |
+
//Determine how to handle post titles for Twitter
|
| 855 |
+
if (strlen($title) >= 80) {
|
| 856 |
+
$short_title = urlencode(substr($title, 0, 80)."[..]");
|
| 857 |
+
}
|
| 858 |
+
else {
|
| 859 |
+
$short_title = urlencode($title);
|
| 860 |
+
}
|
| 861 |
+
|
| 862 |
+
$title=urlencode($title);
|
| 863 |
+
|
| 864 |
+
$shrsb_content = urlencode(strip_tags(strip_shortcodes($post->post_excerpt)));
|
| 865 |
+
|
| 866 |
+
if ($shrsb_content == "") { $shrsb_content = urlencode(substr(strip_tags(strip_shortcodes($post->post_content)),0,300)); }
|
| 867 |
+
|
| 868 |
+
$shrsb_content = str_replace('+','%20',$shrsb_content);
|
| 869 |
+
$post_summary = stripslashes($shrsb_content);
|
| 870 |
+
$site_name = get_bloginfo('name');
|
| 871 |
+
$mail_subject = str_replace('+','%20',$mail_subject);
|
| 872 |
+
$mail_subject = str_replace("’","'",$mail_subject);
|
| 873 |
+
|
| 874 |
+
|
| 875 |
+
|
| 876 |
+
// Grab post tags for Twittley tags. If there aren't any, use default tags set in plugin options page
|
| 877 |
+
$getkeywords = get_the_tags();
|
| 878 |
+
if($getkeywords) {
|
| 879 |
+
foreach($getkeywords as $tag) {
|
| 880 |
+
$keywords[]=$tag->name;
|
| 881 |
+
}
|
| 882 |
+
$keywords = implode(',', $keywords);
|
| 883 |
+
if(!empty($getkeywords) && !empty($d_tags)) {
|
| 884 |
+
$d_tags=substr($d_tags, 0, count($d_tags)-2);
|
| 885 |
+
}
|
| 886 |
+
}
|
| 887 |
+
|
| 888 |
+
|
| 889 |
+
// Check permalink setup for proper feed link
|
| 890 |
+
if (false !== strpos($feedperms,'?') || false !== strpos($feedperms,'.php', max(0,strlen($feedperms) - 4))) {
|
| 891 |
+
$feedstructure = '&feed=comments-rss2';
|
| 892 |
+
}
|
| 893 |
+
else {
|
| 894 |
+
if ('/' == $feedperms[strlen($feedperms) - 1]) {
|
| 895 |
+
$feedstructure = 'feed';
|
| 896 |
+
}
|
| 897 |
+
else {
|
| 898 |
+
$feedstructure = '/feed';
|
| 899 |
+
}
|
| 900 |
+
}
|
| 901 |
+
|
| 902 |
+
|
| 903 |
+
// Compatibility fix for NextGen Gallery Plugin...
|
| 904 |
+
if( (strpos($post_summary, '[') || strpos($post_summary, ']')) ) {
|
| 905 |
+
$post_summary = "";
|
| 906 |
+
}
|
| 907 |
+
if( (strpos($shrsb_content, '[') || strpos($shrsb_content,']')) ) {
|
| 908 |
+
$shrsb_content = "";
|
| 909 |
+
}
|
| 910 |
+
|
| 911 |
+
|
| 912 |
+
// Select the background image
|
| 913 |
+
if(!isset($shrsb_plugopts['bgimg-yes'])) {
|
| 914 |
+
$bgchosen = '';
|
| 915 |
+
}
|
| 916 |
+
else {
|
| 917 |
+
$bgchosen = ' shr-bookmarks-bg-';
|
| 918 |
+
|
| 919 |
+
switch($shrsb_plugopts['bgimg']) {
|
| 920 |
+
case 'care-old':
|
| 921 |
+
$bgchosen .= 'caring-old';
|
| 922 |
+
break;
|
| 923 |
+
default:
|
| 924 |
+
$bgchosen .= $shrsb_plugopts['bgimg'];
|
| 925 |
+
}
|
| 926 |
+
}
|
| 927 |
+
|
| 928 |
+
|
| 929 |
+
$expand=$shrsb_plugopts['expand']?' shr-bookmarks-expand':'';
|
| 930 |
+
switch($shrsb_plugopts['autocenter']) {
|
| 931 |
+
case 1:
|
| 932 |
+
$autocenter = ' shr-bookmarks-center';
|
| 933 |
+
break;
|
| 934 |
+
case 2:
|
| 935 |
+
$autocenter = ' shr-bookmarks-spaced';
|
| 936 |
+
break;
|
| 937 |
+
default:
|
| 938 |
+
$autocenter = '';
|
| 939 |
+
}
|
| 940 |
+
|
| 941 |
+
|
| 942 |
+
//Write the sexybookmarks menu
|
| 943 |
+
$socials = "\n\n";
|
| 944 |
+
$socials .= '<div class="shr-bookmarks'.$expand.$autocenter.$bgchosen.'">'."\n".'<ul class="socials">'."\n";
|
| 945 |
+
foreach ($shrsb_plugopts['bookmark'] as $name) {
|
| 946 |
+
switch ($name) {
|
| 947 |
+
case 'shr-twitter':
|
| 948 |
+
$socials.=bookmark_list_item($name, array(
|
| 949 |
+
'permalink'=>$perms,
|
| 950 |
+
'title'=>$title,
|
| 951 |
+
));
|
| 952 |
+
break;
|
| 953 |
+
case 'shr-identica':
|
| 954 |
+
$socials.=bookmark_list_item($name, array(
|
| 955 |
+
'short_title'=>$short_title,
|
| 956 |
+
'fetch_url'=>$fetch_url,
|
| 957 |
+
));
|
| 958 |
+
break;
|
| 959 |
+
case 'shr-mail':
|
| 960 |
+
$socials.=bookmark_list_item($name, array(
|
| 961 |
+
'title'=>$mail_subject,
|
| 962 |
+
'post_summary'=>$post_summary,
|
| 963 |
+
'permalink'=>$perms,
|
| 964 |
+
));
|
| 965 |
+
break;
|
| 966 |
+
case 'shr-tomuse':
|
| 967 |
+
$socials.=bookmark_list_item($name, array(
|
| 968 |
+
'title'=>$mail_subject,
|
| 969 |
+
'post_summary'=>$post_summary,
|
| 970 |
+
'permalink'=>$perms,
|
| 971 |
+
));
|
| 972 |
+
break;
|
| 973 |
+
case 'shr-diigo':
|
| 974 |
+
$socials.=bookmark_list_item($name, array(
|
| 975 |
+
'sexy_teaser'=>$shrsb_content,
|
| 976 |
+
'permalink'=>$perms,
|
| 977 |
+
'title'=>$title,
|
| 978 |
+
));
|
| 979 |
+
break;
|
| 980 |
+
case 'shr-linkedin':
|
| 981 |
+
$socials.=bookmark_list_item($name, array(
|
| 982 |
+
'post_summary'=>$post_summary,
|
| 983 |
+
'site_name'=>$site_name,
|
| 984 |
+
'permalink'=>$perms,
|
| 985 |
+
'title'=>$title,
|
| 986 |
+
));
|
| 987 |
+
break;
|
| 988 |
+
case 'shr-comfeed':
|
| 989 |
+
$socials.=bookmark_list_item($name, array(
|
| 990 |
+
'permalink'=>urldecode($feedperms).$feedstructure,
|
| 991 |
+
));
|
| 992 |
+
break;
|
| 993 |
+
case 'shr-yahoobuzz':
|
| 994 |
+
$socials.=bookmark_list_item($name, array(
|
| 995 |
+
'permalink'=>$perms,
|
| 996 |
+
'title'=>$title,
|
| 997 |
+
'yahooteaser'=>$shrsb_content,
|
| 998 |
+
));
|
| 999 |
+
break;
|
| 1000 |
+
case 'shr-twittley':
|
| 1001 |
+
$socials.=bookmark_list_item($name, array(
|
| 1002 |
+
'permalink'=>urlencode($perms),
|
| 1003 |
+
'title'=>$title,
|
| 1004 |
+
'post_summary'=>$post_summary,
|
| 1005 |
+
'default_tags'=>$d_tags,
|
| 1006 |
+
));
|
| 1007 |
+
break;
|
| 1008 |
+
case 'shr-tumblr':
|
| 1009 |
+
$socials.=bookmark_list_item($name, array(
|
| 1010 |
+
'permalink'=>urlencode($perms),
|
| 1011 |
+
'title'=>$title,
|
| 1012 |
+
));
|
| 1013 |
+
break;
|
| 1014 |
+
default:
|
| 1015 |
+
$socials.=bookmark_list_item($name, array(
|
| 1016 |
+
'post_summary'=>$post_summary,
|
| 1017 |
+
'permalink'=>$perms,
|
| 1018 |
+
'title'=>$title,
|
| 1019 |
+
));
|
| 1020 |
+
break;
|
| 1021 |
+
}
|
| 1022 |
+
}
|
| 1023 |
+
$socials.='</ul>';
|
| 1024 |
+
if ($shrsb_plugopts['shrlink'] == 1) {
|
| 1025 |
+
$socials.= '<div style="clear: both;"></div>';
|
| 1026 |
+
$socials.= '<div class="shr-getshr" style="visibility:hidden;font-size:10px !important"><a target="_blank" href="http://www.shareaholic.com/?src=pub">Get Shareaholic</a></div>';
|
| 1027 |
+
}
|
| 1028 |
+
$socials.= '<div style="clear: both;"></div></div>';
|
| 1029 |
+
$socials.="\n\n";
|
| 1030 |
+
shrsb_log("get_sexy completed");
|
| 1031 |
+
return $socials;
|
| 1032 |
+
}
|
| 1033 |
+
|
| 1034 |
+
// This function is what allows people to insert the menu wherever they please rather than above/below a post... (depreciated)
|
| 1035 |
+
function selfserv_sexy() {
|
| 1036 |
+
global $post;
|
| 1037 |
+
if(($hide_sexy = get_post_meta($post->ID, 'Hide SexyBookmarks', true)) != 1 ){
|
| 1038 |
+
echo "<!-- Start Shareaholic Sexybookmarks Manual -->";
|
| 1039 |
+
echo get_sexy();
|
| 1040 |
+
echo "<!-- End Shareaholic Sexybookmarks Manual -->";
|
| 1041 |
+
}
|
| 1042 |
+
|
| 1043 |
+
|
| 1044 |
+
}
|
| 1045 |
+
|
| 1046 |
+
//Same as above function, just a diff name
|
| 1047 |
+
function selfserv_shareaholic() {
|
| 1048 |
+
global $post;
|
| 1049 |
+
|
| 1050 |
+
if(in_the_loop()){
|
| 1051 |
+
if(($hide_sexy = get_post_meta($post->ID, 'Hide SexyBookmarks', true)) != 1 )
|
| 1052 |
+
echo get_sexy();
|
| 1053 |
+
}else{
|
| 1054 |
+
echo get_sexy();
|
| 1055 |
+
}
|
| 1056 |
+
|
| 1057 |
+
}
|
| 1058 |
+
|
| 1059 |
+
// Write the <head> code only on pages that the menu is set to display
|
| 1060 |
+
function shrsb_publicStyles() {
|
| 1061 |
+
global $shrsb_plugopts, $post, $shrsb_custom_sprite;
|
| 1062 |
+
|
| 1063 |
+
// If custom field is set, do not display sexybookmarks
|
| 1064 |
+
if ($post && ($hide_sexy = get_post_meta($post->ID, 'Hide SexyBookmarks', true)) == 1) {
|
| 1065 |
+
echo "\n\n".'<!-- '.__('SexyBookmarks has been disabled on this page', 'shrsb').' -->'."\n\n";
|
| 1066 |
+
}
|
| 1067 |
+
elseif ($shrsb_plugopts['shareaholic-javascript'] != '1') {
|
| 1068 |
+
//custom mods rule over custom css
|
| 1069 |
+
if ($shrsb_plugopts['custom-mods'] != 'yes') {
|
| 1070 |
+
if($shrsb_custom_sprite != '') {
|
| 1071 |
+
$surl = $shrsb_custom_sprite;
|
| 1072 |
+
}
|
| 1073 |
+
else {
|
| 1074 |
+
$surl = SHRSB_PLUGPATH.'css/style.css';
|
| 1075 |
+
}
|
| 1076 |
+
}
|
| 1077 |
+
elseif ($shrsb_plugopts['custom-mods'] == 'yes') {
|
| 1078 |
+
$surl = WP_CONTENT_URL.'/sexy-mods/css/style.css';
|
| 1079 |
+
}
|
| 1080 |
+
wp_enqueue_style('sexy-bookmarks', $surl, false, SHRSB_vNum, 'all');
|
| 1081 |
+
}
|
| 1082 |
+
else {
|
| 1083 |
+
$position = array_search('shr-comfeed', $shrsb_plugopts['bookmark']);
|
| 1084 |
+
if (is_numeric($position)) {
|
| 1085 |
+
wp_enqueue_style('comfeed', SHRSB_PLUGPATH.'css/comfeed.css', false, SHRSB_vNum, 'all');
|
| 1086 |
+
}
|
| 1087 |
+
}
|
| 1088 |
+
}
|
| 1089 |
+
function shrsb_publicScripts() {
|
| 1090 |
+
global $shrsb_plugopts, $post, $default_spritegen, $shrsb_debug,$shrsb_tb_plugopts, $shrsb_analytics, $shrsb_recommendations, $shrsb_cb;
|
| 1091 |
+
|
| 1092 |
+
$spritegen = $default_spritegen ? 'spritegen_default' : 'spritegen';
|
| 1093 |
+
$spritegen_basepath = $default_spritegen ? SHRSB_PLUGPATH : SHRSB_UPLOADPATH;
|
| 1094 |
+
|
| 1095 |
+
//Beta script
|
| 1096 |
+
if ($shrsb_plugopts['shareaholic-javascript'] == '1' && !is_admin()){// && !get_post_meta($post->ID, 'Hide SexyBookmarks')) {
|
| 1097 |
+
$infooter = ($shrsb_plugopts['scriptInFooter'] == '1')?true:false;
|
| 1098 |
+
$localize_to = 'shareaholic-publishers-js';
|
| 1099 |
+
|
| 1100 |
+
// Enqueue the sb script only if the sexybookmark is enabled
|
| 1101 |
+
if(isset($shrsb_plugopts['sexybookmark']) && $shrsb_plugopts['sexybookmark'] == '1'){
|
| 1102 |
+
wp_enqueue_script('shareaholic-publishers-js', (empty($shrsb_debug['sb_script'])) ? shrsb_correct_protocol($spritegen_basepath.$spritegen.'/jquery.shareaholic-publishers-sb.min.js') : $shrsb_debug['sb_script'], null, SHRSB_vNum, $infooter);
|
| 1103 |
+
}
|
| 1104 |
+
|
| 1105 |
+
// Enqueue the tb script only if the topbar is enabled
|
| 1106 |
+
if(isset($shrsb_tb_plugopts) && isset($shrsb_tb_plugopts['topbar']) && $shrsb_tb_plugopts['topbar'] == '1'){
|
| 1107 |
+
wp_enqueue_script('shareaholic-share-buttons-js',(empty($shrsb_debug['tb_script'])) ? shrsb_correct_protocol($spritegen_basepath.$spritegen.'/jquery.shareaholic-share-buttons.min.js'): $shrsb_debug['tb_script'], null, SHRSB_vNum, $infooter);
|
| 1108 |
+
$localize_to = 'shareaholic-share-buttons-js';
|
| 1109 |
+
}
|
| 1110 |
+
|
| 1111 |
+
// Enqueue the recommendations script only if the recommendations is enabled
|
| 1112 |
+
if(isset($shrsb_recommendations) && isset($shrsb_recommendations['recommendations']) && $shrsb_recommendations['recommendations'] == '1'){
|
| 1113 |
+
wp_enqueue_script('shareaholic-recommendations-js',(empty($shrsb_debug['rd_script'])) ? shrsb_correct_protocol("http://dtym7iokkjlif.cloudfront.net/media/js/jquery.shareaholic-publishers-rd.min.js"): $shrsb_debug['rd_script'], null, SHRSB_vNum, $infooter);
|
| 1114 |
+
$localize_to = 'shareaholic-recommendations-js';
|
| 1115 |
+
}
|
| 1116 |
+
|
| 1117 |
+
// Enqueue the classicbookmarks script only if the recommendations is enabled
|
| 1118 |
+
if(isset($shrsb_cb) && isset($shrsb_cb['cb']) && $shrsb_cb['cb'] == '1'){
|
| 1119 |
+
//wp_enqueue_script('shareaholic-cb-js',(empty($shrsb_debug['cb_script'])) ? shrsb_correct_protocol("http://dtym7iokkjlif.cloudfront.net/media/js/jquery.shareaholic-publishers-cb.min.js"): $shrsb_debug['cb_script'], null, SHRSB_vNum, $infooter);
|
| 1120 |
+
wp_enqueue_script('shareaholic-cb-js',(empty($shrsb_debug['cb_script'])) ? shrsb_correct_protocol("http://dtym7iokkjlif.cloudfront.net/media/js/formfactors_cb.js"): $shrsb_debug['cb_script'], null, SHRSB_vNum, $infooter);
|
| 1121 |
+
$localize_to = 'shareaholic-cb-js';
|
| 1122 |
+
}
|
| 1123 |
+
|
| 1124 |
+
// Always Enqueue the global settings as it can be used by other formfactors
|
| 1125 |
+
wp_localize_script($localize_to, 'SHRSB_Globals', array(
|
| 1126 |
+
'src' => shrsb_correct_protocol($spritegen_basepath.$spritegen)
|
| 1127 |
+
, 'perfoption'=> $shrsb_plugopts['perfoption']
|
| 1128 |
+
, 'twitter_template' => $shrsb_plugopts['tweetconfig']
|
| 1129 |
+
, 'locale' => $shrsb_plugopts['locale']
|
| 1130 |
+
, 'shortener' => $shrsb_plugopts['shorty']
|
| 1131 |
+
, 'shortener_key' => shrsb_get_shortener_settings()
|
| 1132 |
+
, 'pubGaSocial' => $shrsb_analytics['pubGaSocial']
|
| 1133 |
+
, 'pubGaKey' => $shrsb_analytics['pubGaKey']
|
| 1134 |
+
));
|
| 1135 |
+
|
| 1136 |
+
} else {
|
| 1137 |
+
// If any javascript dependent options are selected, load the scripts
|
| 1138 |
+
if (($shrsb_plugopts['expand'] || $shrsb_plugopts['autocenter'] || $shrsb_plugopts['targetopt']=='_blank') && $post && (($hide_sexy = get_post_meta($post->ID, 'Hide SexyBookmarks', true)) != 1 )) {
|
| 1139 |
+
// If custom mods is selected, pull files from new location
|
| 1140 |
+
if($shrsb_plugopts['custom-mods'] == 'yes') {
|
| 1141 |
+
$surl = WP_CONTENT_URL.'/sexy-mods/js/sexy-bookmarks-public.js';
|
| 1142 |
+
} else {
|
| 1143 |
+
$surl = SHRSB_PLUGPATH.'js/sexy-bookmarks-public.min.js';
|
| 1144 |
+
}
|
| 1145 |
+
// If jQuery compatibility fix is not selected, go ahead and load jQuery
|
| 1146 |
+
$jquery = ($shrsb_plugopts['doNotIncludeJQuery'] != '1') ? array('jquery') : array();
|
| 1147 |
+
$infooter = ($shrsb_plugopts['scriptInFooter'] == '1')?true:false;
|
| 1148 |
+
wp_enqueue_script('sexy-bookmarks-public-js', $surl, $jquery, SHRSB_vNum, $infooter);
|
| 1149 |
+
}
|
| 1150 |
+
}
|
| 1151 |
+
|
| 1152 |
+
// Perf tracking for old mode only.For New mode tracking is moved to javascript
|
| 1153 |
+
if ( ($shrsb_plugopts['perfoption'] == '1' || $shrsb_plugopts['perfoption'] == '') && (!is_admin() && $shrsb_plugopts['shareaholic-javascript'] !== '1' )) {
|
| 1154 |
+
wp_enqueue_script('shareaholic-perf', SHRSB_PLUGPATH.'js/shareaholic-perf.min.js', null, SHRSB_vNum, false);
|
| 1155 |
+
wp_enqueue_script("shr_dough_recipe", shrsb_correct_protocol("http://dtym7iokkjlif.cloudfront.net/dough/1.0/recipe.js"), null, null);
|
| 1156 |
+
}
|
| 1157 |
+
}
|
| 1158 |
+
|
| 1159 |
+
/*
|
| 1160 |
+
* @desc Populate javascript settings in the footer for Sexybookmarks
|
| 1161 |
+
*/
|
| 1162 |
+
function shrsb_write_js_params() {
|
| 1163 |
+
global $shrsb_plugopts, $shrsb_js_params;
|
| 1164 |
+
|
| 1165 |
+
if(isset($shrsb_plugopts['sexybookmark']) && $shrsb_plugopts['sexybookmark'] == '1' && $shrsb_plugopts['shareaholic-javascript'] == '1') {
|
| 1166 |
+
//For manual mode, when no config is defined
|
| 1167 |
+
if($shrsb_plugopts['position'] == 'manual' && !in_the_loop()){
|
| 1168 |
+
$shrsb_js_params['shr_class'] = shrsb_get_publisher_config(-1);
|
| 1169 |
+
}
|
| 1170 |
+
|
| 1171 |
+
echo '<script type="text/javascript">var SHRSB_Settings = ';
|
| 1172 |
+
echo json_encode($shrsb_js_params);
|
| 1173 |
+
echo ';</script>';
|
| 1174 |
+
}
|
| 1175 |
+
}
|
| 1176 |
+
|
| 1177 |
+
/*
|
| 1178 |
+
* @desc Populate javascript settings in the footer for topbar
|
| 1179 |
+
*/
|
| 1180 |
+
function shrsb_tb_write_js_params() {
|
| 1181 |
+
global $shrsb_plugopts, $shrsb_tb_js_params,$shrsb_tb_plugopts;
|
| 1182 |
+
|
| 1183 |
+
if ($shrsb_plugopts['shareaholic-javascript'] == '1' && $shrsb_tb_plugopts['topbar'] == '1') {
|
| 1184 |
+
|
| 1185 |
+
$js = "";
|
| 1186 |
+
//if ($shrsb_tb_plugopts['useSbSettings'] != '1'){
|
| 1187 |
+
$shrsb_tb_js_params["topBarBgColor"] = $shrsb_tb_plugopts["tb_bg_color"];
|
| 1188 |
+
$shrsb_tb_js_params["topBarBorderColor"] = $shrsb_tb_plugopts["tb_border_color"];
|
| 1189 |
+
$shrsb_tb_js_params["showAddv"] = $shrsb_tb_plugopts["addv"];
|
| 1190 |
+
$shrsb_tb_js_params["apiKey"] = "e3c665c2eb6785741cea4515633f1d86b";
|
| 1191 |
+
$shrsb_tb_js_params["twitter_template"] = $shrsb_plugopts['tweetconfig'];
|
| 1192 |
+
|
| 1193 |
+
$js = 'var SHRTB_Settings = '.json_encode($shrsb_tb_js_params);
|
| 1194 |
+
//}
|
| 1195 |
+
|
| 1196 |
+
echo '<script type="text/javascript">';
|
| 1197 |
+
echo $js;
|
| 1198 |
+
echo ';</script>';
|
| 1199 |
+
}
|
| 1200 |
+
}
|
| 1201 |
+
|
| 1202 |
+
/*
|
| 1203 |
+
* @desc Populate javascript settings in the footer for recommendations
|
| 1204 |
+
*/
|
| 1205 |
+
function shrsb_rd_write_js_params() {
|
| 1206 |
+
global $shrsb_plugopts, $shrsb_rd_js_params,$shrsb_recommendations;
|
| 1207 |
+
|
| 1208 |
+
|
| 1209 |
+
if ($shrsb_plugopts['shareaholic-javascript'] == '1' && $shrsb_recommendations['recommendations'] == '1') {
|
| 1210 |
+
|
| 1211 |
+
$js = 'var SHRRD_Settings = '.json_encode($shrsb_rd_js_params);
|
| 1212 |
+
|
| 1213 |
+
|
| 1214 |
+
echo '<script type="text/javascript">';
|
| 1215 |
+
echo $js;
|
| 1216 |
+
echo ';</script>';
|
| 1217 |
+
}
|
| 1218 |
+
}
|
| 1219 |
+
|
| 1220 |
+
/*
|
| 1221 |
+
* @desc Populate javascript settings in the footer for classicbookmarks
|
| 1222 |
+
*/
|
| 1223 |
+
function shrsb_cb_write_js_params() {
|
| 1224 |
+
global $shrsb_plugopts, $shrsb_cb_js_params,$shrsb_cb;
|
| 1225 |
+
|
| 1226 |
+
|
| 1227 |
+
if ($shrsb_plugopts['shareaholic-javascript'] == '1' && $shrsb_cb['cb'] == '1') {
|
| 1228 |
+
|
| 1229 |
+
$js = "var _shr = _shr || [];";
|
| 1230 |
+
foreach($shrsb_cb_js_params as $key => $val){
|
| 1231 |
+
|
| 1232 |
+
$js .= '_shr.push(["SHR_CB_Settings",{
|
| 1233 |
+
options: {
|
| 1234 |
+
timestamp:' . $key .',
|
| 1235 |
+
size:' . $val['size'] .',
|
| 1236 |
+
link:"'. $val['link'] .'",
|
| 1237 |
+
title:"'. $val['title'] .'",
|
| 1238 |
+
apikey:"'. $val['apikey'] .'"
|
| 1239 |
+
}
|
| 1240 |
+
}
|
| 1241 |
+
]);';
|
| 1242 |
+
}
|
| 1243 |
+
|
| 1244 |
+
//$js = 'var SHRCB_Settings = '.json_encode($shrsb_cb_js_params);
|
| 1245 |
+
|
| 1246 |
+
|
| 1247 |
+
echo '<script type="text/javascript">';
|
| 1248 |
+
echo $js;
|
| 1249 |
+
echo ';</script>';
|
| 1250 |
+
}
|
| 1251 |
+
}
|
| 1252 |
+
|
| 1253 |
+
|
| 1254 |
+
// Add the scripts and Global setting on the page
|
| 1255 |
+
add_action('wp_print_scripts', 'shrsb_publicScripts');
|
| 1256 |
+
|
| 1257 |
+
// Add the hook only when sexybokmark is enabled
|
| 1258 |
+
if(isset($shrsb_plugopts['sexybookmark']) && $shrsb_plugopts['sexybookmark'] == '1') {
|
| 1259 |
+
add_filter('the_content', 'shrsb_position_menu');
|
| 1260 |
+
add_action('wp_print_styles', 'shrsb_publicStyles');
|
| 1261 |
+
add_action('wp_footer', 'shrsb_write_js_params');
|
| 1262 |
+
}
|
| 1263 |
+
|
| 1264 |
+
// Add the hook only when topbar is enabled
|
| 1265 |
+
if(isset($shrsb_tb_plugopts['topbar']) && ($shrsb_tb_plugopts['topbar'] == '1')){
|
| 1266 |
+
add_action('wp_footer', 'shrsb_get_topbar');
|
| 1267 |
+
add_action('wp_footer', 'shrsb_tb_write_js_params');
|
| 1268 |
+
}
|
| 1269 |
+
|
| 1270 |
+
// Add the hook only when recommendations is enabled
|
| 1271 |
+
if(isset($shrsb_recommendations['recommendations']) && ($shrsb_recommendations['recommendations'] == '1')){
|
| 1272 |
+
add_filter('the_content', 'shrsb_get_recommendations');
|
| 1273 |
+
add_action('wp_footer', 'shrsb_rd_write_js_params');
|
| 1274 |
+
}
|
| 1275 |
+
|
| 1276 |
+
if(isset($shrsb_cb['cb']) && ($shrsb_cb['cb'] == '1')){
|
| 1277 |
+
add_filter('the_content', 'shrsb_get_cb');
|
| 1278 |
+
add_action('wp_footer', 'shrsb_cb_write_js_params');
|
| 1279 |
+
}
|
includes/shr_pub_pro.php
ADDED
|
@@ -0,0 +1,52 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
class SHR_PUB_PRO {
|
| 4 |
+
protected $authenicate_url = "http://www.shareaholic.com/api/auth/apikey/";
|
| 5 |
+
protected $install_url;
|
| 6 |
+
protected $apikey;
|
| 7 |
+
protected $default_apikey = '8afa39428933be41f8afdb8ea21a495c';
|
| 8 |
+
protected static $_instance = null;
|
| 9 |
+
|
| 10 |
+
public static function getInstance() {
|
| 11 |
+
if(!self::$_instance instanceof self) {
|
| 12 |
+
self::$_instance = new self;
|
| 13 |
+
}
|
| 14 |
+
return self::$_instance;
|
| 15 |
+
}
|
| 16 |
+
|
| 17 |
+
protected function __construct() {
|
| 18 |
+
$this->apikey = get_option('SHRSB_apikey');
|
| 19 |
+
$this->install_url = get_option('siteurl');
|
| 20 |
+
}
|
| 21 |
+
|
| 22 |
+
public function set_api_key($apikey) {
|
| 23 |
+
$bRet = false;
|
| 24 |
+
if($apikey) {
|
| 25 |
+
$auth = $this->authenticate($apikey);
|
| 26 |
+
if($auth->plan_id > -2) {
|
| 27 |
+
update_option('SHRSB_apikey', $apikey);
|
| 28 |
+
$bRet = true;
|
| 29 |
+
}
|
| 30 |
+
}
|
| 31 |
+
return $bRet;
|
| 32 |
+
}
|
| 33 |
+
|
| 34 |
+
public function delete_api_key() {
|
| 35 |
+
update_option('SHRSB_apikey',$this->default_apikey);
|
| 36 |
+
$this->apikey = get_option('apikey');
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
+
public function authenticate($apikey = null) {
|
| 40 |
+
$response_obj = null;
|
| 41 |
+
$args = array('body' => array(
|
| 42 |
+
"install_url" => $this->install_url,
|
| 43 |
+
"api_key" => $apikey ? $apikey : $this->apikey
|
| 44 |
+
));
|
| 45 |
+
if(function_exists(wp_remote_post)) {
|
| 46 |
+
$response = wp_remote_post($this->authenicate_url, $args);
|
| 47 |
+
$response_obj = json_decode($response['body']);
|
| 48 |
+
}
|
| 49 |
+
return $response_obj;
|
| 50 |
+
}
|
| 51 |
+
}
|
| 52 |
+
?>
|
includes/shrsb_activation_page.php
ADDED
|
@@ -0,0 +1,43 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php function shrsb_display_activation(){ ?>
|
| 2 |
+
|
| 3 |
+
<div class="clearbig"></div>
|
| 4 |
+
<form name="activation" id="shrsb-activation" action="" method="post">
|
| 5 |
+
|
| 6 |
+
<div style="clear:both;height:10px;"></div>
|
| 7 |
+
|
| 8 |
+
<img src="<?php echo SHRSB_PLUGPATH; ?>images/shareaholic-220.png" />
|
| 9 |
+
|
| 10 |
+
<div style="clear:both;height:5px;"></div>
|
| 11 |
+
|
| 12 |
+
|
| 13 |
+
<div id="shr-activation-header">
|
| 14 |
+
<div id="shr-activation-notice" style="padding-right:10px;">
|
| 15 |
+
|
| 16 |
+
<p style="font-size: 26px; color: #454B4C; text-shadow: 0pt 1px 0pt white;"><?php _e("Your Shareaholic Plugin is almost ready!", 'shrsb'); ?></p>
|
| 17 |
+
|
| 18 |
+
<p style="font-size: 15px; line-height: 24px; color: #454B4C; text-shadow: 0pt 1px 0pt white;"><?php _e("Activate by clicking the green \"Enable\" button below. Once you’ve enabled Shareaholic, you will enjoy all the delightful goodness of Shareaholic.", 'shrsb'); ?></p>
|
| 19 |
+
</div>
|
| 20 |
+
</div>
|
| 21 |
+
|
| 22 |
+
<div style="background: url('<?php echo SHRSB_PLUGPATH; ?>images/orange_arrow.gif') no-repeat;height: 70px;width: 50px; float:left;"></div>
|
| 23 |
+
|
| 24 |
+
<input type="hidden" name="activate" value="1" />
|
| 25 |
+
<div class="shrsbsubmit" style="margin: 38px 8px 10px!important;">
|
| 26 |
+
<input type="submit" id="activate" value="<?php _e('Enable Shareaholic »', 'shrsb'); ?>" />
|
| 27 |
+
</div>
|
| 28 |
+
</form>
|
| 29 |
+
|
| 30 |
+
<div style="clear:both;height:15px;"></div>
|
| 31 |
+
|
| 32 |
+
<div style="display:block; font-size: 11px; color: #777777; width: 960px;">
|
| 33 |
+
|
| 34 |
+
<?php echo sprintf(__('<p>By enabling Shareaholic, you are accepting our %sTerms of Service%s. At times, to function our plugin sends data to trusted 3rd party services like Facebook, Twitter, Google Analytics, Quantcast, AppNexus and DataXu. Your privacy is critically important to us. Please see our %sPrivacy Promise%s for more information.</p>', 'shrsb'), '<a href="http://www.shareaholic.com/terms/" target="_new">', '</a>', '<a href="http://www.shareaholic.com/privacy/" target="_new">', '</a>'); ?>
|
| 35 |
+
|
| 36 |
+
<?php _e("<p>Shareaholic is trusted by over 200 thousand publishers and touches almost 300 million people each month. Designed and built with all the love in the world in Cambridge, Massachusetts.</p>"); ?>
|
| 37 |
+
|
| 38 |
+
</div>
|
| 39 |
+
|
| 40 |
+
<?php
|
| 41 |
+
// shrsb_getfooter();
|
| 42 |
+
}
|
| 43 |
+
?>
|
includes/shrsb_analytics_page.php
ADDED
|
@@ -0,0 +1,58 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* @desc Analytics Settings
|
| 5 |
+
*/
|
| 6 |
+
|
| 7 |
+
$shrsb_analytics = shrsb_analytics_set_options();
|
| 8 |
+
|
| 9 |
+
/*
|
| 10 |
+
* @desc Set the analytics settings either from database or default
|
| 11 |
+
*/
|
| 12 |
+
function shrsb_analytics_set_options( $action = NULL ) {
|
| 13 |
+
|
| 14 |
+
$option_name = 'ShareaholicAnalytics';
|
| 15 |
+
|
| 16 |
+
$shrsb_analytics_default = array(
|
| 17 |
+
'pubGaSocial' => 0
|
| 18 |
+
, 'pubGaKey' => ''
|
| 19 |
+
);
|
| 20 |
+
|
| 21 |
+
//Return default settings
|
| 22 |
+
if( $action == "reset" ) {
|
| 23 |
+
delete_option($option_name);
|
| 24 |
+
add_option($option_name,$shrsb_analytics_default);
|
| 25 |
+
return $shrsb_analytics_default;
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
//Get the settings from the database
|
| 29 |
+
$database_Settings = get_option($option_name);
|
| 30 |
+
|
| 31 |
+
|
| 32 |
+
if( $database_Settings ) {//got the settings in the database
|
| 33 |
+
|
| 34 |
+
// Check only when upgrading
|
| 35 |
+
if( SHRSB_UPGRADING ) {
|
| 36 |
+
$need_to_update = false;
|
| 37 |
+
|
| 38 |
+
//Check whether all the settings are present or not
|
| 39 |
+
foreach( $shrsb_analytics_default as $k => $v ){
|
| 40 |
+
if( !array_key_exists( $k, $database_Settings )) {
|
| 41 |
+
$database_Settings[$k] = $v;
|
| 42 |
+
$need_to_update = true;
|
| 43 |
+
}
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
if( $need_to_update ) update_option( $option_name, $database_Settings );
|
| 47 |
+
|
| 48 |
+
}
|
| 49 |
+
|
| 50 |
+
return $database_Settings;
|
| 51 |
+
|
| 52 |
+
} else {
|
| 53 |
+
//Add the settings to the database
|
| 54 |
+
add_option( $option_name, $shrsb_analytics_default );
|
| 55 |
+
return $shrsb_analytics_default;
|
| 56 |
+
}
|
| 57 |
+
}
|
| 58 |
+
?>
|
includes/shrsb_analytics_settings_page.php
ADDED
|
@@ -0,0 +1,255 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* @desc Topbar Settings page
|
| 5 |
+
*/
|
| 6 |
+
|
| 7 |
+
function shrsb_analytics_settings_page() {
|
| 8 |
+
global $shrsb_analytics;
|
| 9 |
+
// Add all the global varaible declarations for the $shrsb_tb_plugopts
|
| 10 |
+
echo '<div class="wrap""><div class="icon32" id="icon-options-general"><br></div><h2>'.__('Social Analytics Settings', 'shrsb').'</h2></div>';
|
| 11 |
+
//Defaults - set if not present
|
| 12 |
+
if (!isset($_POST['reset_all_options_analytics'])){$_POST['reset_all_options_analytics'] = '1';}
|
| 13 |
+
if (!isset($_POST['shrsbresetallwarn-choice'])){$_POST['shrsbresetallwarn-choice'] = 'no';}
|
| 14 |
+
|
| 15 |
+
if($_POST['reset_all_options_analytics'] == '0') {
|
| 16 |
+
echo '
|
| 17 |
+
<div id="shrsbresetallwarn" class="dialog-box-warning" style="float:none;width:97%;margin-top:20px;">
|
| 18 |
+
<div class="dialog-left fugue f-warn">
|
| 19 |
+
'.__("WARNING: You are about to reset all plugin settings to their default state! Do you wish to continue?", "shrsb").'
|
| 20 |
+
</div>
|
| 21 |
+
<div class="dialog-right">
|
| 22 |
+
<form action="" method="post" id="resetalloptionsaccept">
|
| 23 |
+
<label><input name="shrsbresetallwarn-choice" id="shrsbresetallwarn-yes" type="radio" value="yes" />'.__('Yes', 'shrsb').'</label> <label><input name="shrsbresetallwarn-choice" id="shrsbresetallwarn-cancel" type="radio" value="cancel" />'.__('Cancel', 'shrsb').'</label>
|
| 24 |
+
</form>
|
| 25 |
+
</div>
|
| 26 |
+
</div>';
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
//Reset all options to default settings if user clicks the reset button
|
| 30 |
+
if($_POST['shrsbresetallwarn-choice'] == "yes") { //check for reset button click
|
| 31 |
+
|
| 32 |
+
$shrsb_analytics = shrsb_analytics_set_options('reset');
|
| 33 |
+
|
| 34 |
+
//delete_option('SHRSB_CustomSprite');
|
| 35 |
+
echo '
|
| 36 |
+
<div id="statmessage" class="shrsb-success">
|
| 37 |
+
<div class="dialog-left fugue f-success">
|
| 38 |
+
'.__('All settings have been reset to their default values.', 'shrsb').'
|
| 39 |
+
</div>
|
| 40 |
+
<div class="dialog-right">
|
| 41 |
+
<img src="'.SHRSB_PLUGPATH.'images/success-delete.jpg" class="del-x" alt=""/>
|
| 42 |
+
</div>
|
| 43 |
+
</div>';
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
// processing form submission
|
| 47 |
+
$status_message = "";
|
| 48 |
+
$error_message = "";
|
| 49 |
+
if(isset($_POST['save_changes_sa'])) {
|
| 50 |
+
|
| 51 |
+
// Set success message
|
| 52 |
+
$status_message = __('Your changes have been saved successfully!', 'shrsb');
|
| 53 |
+
|
| 54 |
+
foreach (array(
|
| 55 |
+
'pubGaSocial', 'pubGaKey'
|
| 56 |
+
)as $field) {
|
| 57 |
+
if(isset($_POST[$field])) { // this is to prevent warning if $_POST[$field] is not defined
|
| 58 |
+
$shrsb_analytics[$field] = $_POST[$field];
|
| 59 |
+
} else {
|
| 60 |
+
$shrsb_analytics[$field] = NULL;
|
| 61 |
+
}
|
| 62 |
+
}
|
| 63 |
+
|
| 64 |
+
update_option('ShareaholicAnalytics',$shrsb_analytics);
|
| 65 |
+
|
| 66 |
+
|
| 67 |
+
}//Closed Save
|
| 68 |
+
|
| 69 |
+
//if there was an error, construct error messages
|
| 70 |
+
if ($error_message != '') {
|
| 71 |
+
echo '
|
| 72 |
+
<div id="errmessage" class="shrsb-error">
|
| 73 |
+
<div class="dialog-left fugue f-error">
|
| 74 |
+
'.$error_message.'
|
| 75 |
+
</div>
|
| 76 |
+
<div class="dialog-right">
|
| 77 |
+
<img src="'.SHRSB_PLUGPATH.'images/error-delete.jpg" class="del-x" alt=""/>
|
| 78 |
+
</div>
|
| 79 |
+
</div>';
|
| 80 |
+
} elseif ($status_message != '') {
|
| 81 |
+
echo '<style type="text/css">#update_sb{display:none !important;}</style>
|
| 82 |
+
<div id="statmessage" class="shrsb-success">
|
| 83 |
+
<div class="dialog-left fugue f-success">
|
| 84 |
+
'.$status_message.'
|
| 85 |
+
</div>
|
| 86 |
+
<div class="dialog-right">
|
| 87 |
+
<img src="'.SHRSB_PLUGPATH.'images/success-delete.jpg" class="del-x" alt=""/>
|
| 88 |
+
</div>
|
| 89 |
+
</div>';
|
| 90 |
+
}
|
| 91 |
+
?>
|
| 92 |
+
|
| 93 |
+
<form name="sexy-bookmarks" id="sexy-bookmarks" action="" method="post">
|
| 94 |
+
<div id="shrsb-col-left" style="width:100%">
|
| 95 |
+
<ul id="shrsb-sortables">
|
| 96 |
+
|
| 97 |
+
<li>
|
| 98 |
+
<div class="box-mid-head">
|
| 99 |
+
<h2 class="fugue f-status"><?php _e('Shareaholic Social Analytics - Grow Your Traffic and Referrals', 'shrsb'); ?></h2>
|
| 100 |
+
</div>
|
| 101 |
+
<div class="box-mid-body">
|
| 102 |
+
<div style="padding:8px;background:#FDF6E5;"><img src="<?php echo SHRSB_PLUGPATH; ?>images/line-chart.png" align="right" alt="New!" />
|
| 103 |
+
<?php
|
| 104 |
+
|
| 105 |
+
$parse = parse_url(get_bloginfo('url'));
|
| 106 |
+
$share_url = "https://www.shareaholic.com/api/data/".$parse['host']."/sharecount/30";
|
| 107 |
+
$top_users_url = "https://www.shareaholic.com/api/data/".$parse['host']."/topusers/16/";
|
| 108 |
+
|
| 109 |
+
echo sprintf(__('<b style="font-size:14px;line-height:22px;">Did you know that content from this website has been shared <span style="color:#CC1100;"><span id="bonusShareCount"></span> time(s)</span> in the past <span id="bonusShareTimeFrame"></span> day(s)?</b>', 'shrsb'));
|
| 110 |
+
?>
|
| 111 |
+
|
| 112 |
+
<script type ="text/javascript">
|
| 113 |
+
(function($){
|
| 114 |
+
$(document).ready( function () {
|
| 115 |
+
var url = <?php echo "'".$share_url."'";?>;
|
| 116 |
+
var top_users_url = <?php echo "'".$top_users_url."'";?>;
|
| 117 |
+
$.getJSON(url+'?callback=?', function (obj) {
|
| 118 |
+
$('#bonusShareCount').text(obj.sharecount);
|
| 119 |
+
$('#bonusShareTimeFrame').text(obj.timeframe);
|
| 120 |
+
});
|
| 121 |
+
|
| 122 |
+
$.getJSON(top_users_url+'?callback=?', function (obj) {
|
| 123 |
+
add_faces(obj);
|
| 124 |
+
});
|
| 125 |
+
});
|
| 126 |
+
|
| 127 |
+
var add_faces = function(obj) {
|
| 128 |
+
if(obj && obj.length) {
|
| 129 |
+
var shuffle = function(v){
|
| 130 |
+
//+ Jonas Raoni Soares Silva
|
| 131 |
+
//@ http://jsfromhell.com/array/shuffle [rev. #1]
|
| 132 |
+
for(var j, x, i = v.length; i; j = parseInt(Math.random() * i), x = v[--i], v[i] = v[j], v[j] = x);
|
| 133 |
+
return v;
|
| 134 |
+
};
|
| 135 |
+
obj = shuffle(obj);
|
| 136 |
+
|
| 137 |
+
$('#bonusShareTopUser').show();
|
| 138 |
+
var face_ul = $('<ul id="bonusShareFacesUL"/>');
|
| 139 |
+
for(var i=0; i<obj.length; ++i) {
|
| 140 |
+
var shr_profile_url = "http://www.shareaholic.com/" + obj[i].username;
|
| 141 |
+
face_ul.append(
|
| 142 |
+
$("<li class='bonusShareLi'>").append("<a target='_blank' href="+shr_profile_url+"><img class='bonusShareFaces' title=" + obj[i].username + " src=" + obj[i].picture_url + "></img></a>")
|
| 143 |
+
);
|
| 144 |
+
}
|
| 145 |
+
|
| 146 |
+
$('#bonusShareTopUser').append(face_ul);
|
| 147 |
+
|
| 148 |
+
}
|
| 149 |
+
};
|
| 150 |
+
})(jQuery);
|
| 151 |
+
</script>
|
| 152 |
+
<br/><br/>
|
| 153 |
+
<div id="bonusShareTopUser" style="display:none"><b><?php _e('Meet who spreads your content the most:', 'shrsb'); ?></b></div>
|
| 154 |
+
|
| 155 |
+
<br />
|
| 156 |
+
<div style="background: url(http://www.shareaholic.com/media/images/border_hr.png) repeat-x scroll left top; height: 2px;"></div>
|
| 157 |
+
<br />
|
| 158 |
+
<?php echo sprintf(__('<span style="font-size: 12px;">Shareaholic reports all of your important social media metrics including popular pages on your website, referral channels, and who are making referrals and spreading your webpages on the internet on your behalf bringing you back more traffic and new visitors for free.</span> <br><br> <b><span style="color:#CC1100;">What are you waiting for?</span> You can access detailed %ssocial engagement analytics%s about your website right now.</b>', 'shrsb'), '<a href="http://www.shareaholic.com/publishers/analytics/'.$parse['host'].'">', '</a>');
|
| 159 |
+
?>
|
| 160 |
+
|
| 161 |
+
</div>
|
| 162 |
+
</div>
|
| 163 |
+
</li>
|
| 164 |
+
|
| 165 |
+
<?php if (shrsb_get_current_user_role()=="Administrator"){ ?>
|
| 166 |
+
|
| 167 |
+
<li>
|
| 168 |
+
<div class="box-mid-head">
|
| 169 |
+
<h2><img src="<?php echo SHRSB_PLUGPATH; ?>/images/ga-icon.png" style="float:left;margin-top:2px;margin-right:10px;" alt="Google Analytics" /> <?php _e('Google Analytics', 'shrsb'); ?></h2>
|
| 170 |
+
</div>
|
| 171 |
+
<div class="box-mid-body" id="toggle5">
|
| 172 |
+
|
| 173 |
+
<div class="padding">
|
| 174 |
+
<div id="genopts">
|
| 175 |
+
<table><tbody>
|
| 176 |
+
<tr>
|
| 177 |
+
<td><span class="shrsb_option"><?php _e('Enable Google Analytics Social Tracking', 'shrsb'); ?> (<a href="http://code.google.com/apis/analytics/docs/tracking/gaTrackingSocial.html" target="_blank">?</a>)</span></td>
|
| 178 |
+
<td WIDTH="120"><label><input <?php echo ((@$shrsb_analytics['pubGaSocial'] == "1")? 'checked="checked"' : ""); ?> name="pubGaSocial" id="pubGaSocial-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label></td>
|
| 179 |
+
<td WIDTH="120"><label><input <?php echo ((@$shrsb_analytics['pubGaSocial'] == "0")? 'checked="checked"' : ""); ?> name="pubGaSocial" id="pubGaSocial-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label></td>
|
| 180 |
+
</tr>
|
| 181 |
+
|
| 182 |
+
|
| 183 |
+
<tr class="pubGaSocial_prefs" style="display:none">
|
| 184 |
+
<td><label class="tab" for="pubGaKey" style="margin-top:7px;"><?php _e('Your Google Analytics Property ID:', 'shrsb'); ?></label></td>
|
| 185 |
+
<td colspan="2"><input style="margin-top:7px;" type="text" id="pubGaKey" name="pubGaKey" size="35" placeholder="ex. UA-XXXXXXXX-X" value="<?php echo @$shrsb_analytics['pubGaKey']; ?>" /></td>
|
| 186 |
+
</tr>
|
| 187 |
+
</tbody></table>
|
| 188 |
+
</div>
|
| 189 |
+
</div>
|
| 190 |
+
</li>
|
| 191 |
+
|
| 192 |
+
<?php } ?>
|
| 193 |
+
|
| 194 |
+
</ul>
|
| 195 |
+
|
| 196 |
+
<?php if (shrsb_get_current_user_role()=="Administrator"){ ?>
|
| 197 |
+
|
| 198 |
+
<div style="clear:both;"></div>
|
| 199 |
+
<input type="hidden" name="save_changes_sa" value="1" />
|
| 200 |
+
<div class="shrsbsubmit"><input type="submit" id="save_changes_sa" value="<?php _e('Save Changes', 'shrsb'); ?>" /></div>
|
| 201 |
+
</form>
|
| 202 |
+
<form action="" method="post">
|
| 203 |
+
<input type="hidden" name="reset_all_options_analytics" id="reset_all_options_analytics" value="0" />
|
| 204 |
+
<!-- <div class="shrsbreset"><input type="submit" value="<?php _e('Reset Settings', 'shrsb'); ?>" /></div> -->
|
| 205 |
+
</form>
|
| 206 |
+
|
| 207 |
+
<?php } ?>
|
| 208 |
+
|
| 209 |
+
<?php echo shrsb_getfooter(); ?>
|
| 210 |
+
|
| 211 |
+
</div>
|
| 212 |
+
|
| 213 |
+
<?php
|
| 214 |
+
|
| 215 |
+
//Right Side helpful links
|
| 216 |
+
echo shrsb_right_side_menu();
|
| 217 |
+
//Snap Engage
|
| 218 |
+
echo get_snapengage();
|
| 219 |
+
|
| 220 |
+
}//closing brace for function "shrsb_settings_page"
|
| 221 |
+
|
| 222 |
+
|
| 223 |
+
// Old analytics Page
|
| 224 |
+
function shrsb_analytics_page() {
|
| 225 |
+
?>
|
| 226 |
+
<h2 class="shrsblogo"><span class="sh-logo"></span></h2>
|
| 227 |
+
|
| 228 |
+
<div id="shrsb-col-left" style="width:100%;">
|
| 229 |
+
|
| 230 |
+
<ul id="shrsb-sortables">
|
| 231 |
+
<li>
|
| 232 |
+
<div class="box-mid-head">
|
| 233 |
+
<h2 class="fugue f-status"><?php _e('Shareaholic Analtyics', 'shrsb'); ?></h2>
|
| 234 |
+
</div>
|
| 235 |
+
<div class="box-mid-body">
|
| 236 |
+
<div class="padding">
|
| 237 |
+
<div style="position:relative;width:80%;">
|
| 238 |
+
<p><strong>
|
| 239 |
+
<?php _e('Shareaholic Analtyics is coming soon!', 'shrsb'); ?>
|
| 240 |
+
</strong>
|
| 241 |
+
<br><br>
|
| 242 |
+
<?php _e('Register your account today to recieve update info via email.', 'shrsb'); ?>
|
| 243 |
+
<div class="shrsbsubmit">
|
| 244 |
+
<input type="button" onclick ="window.open('http://www.shareaholic.com/publishers_apps/new_publishers_app')" value="<?php _e('Get Share Pro', 'shrsb'); ?>" />
|
| 245 |
+
</div>
|
| 246 |
+
</p>
|
| 247 |
+
</div>
|
| 248 |
+
</div>
|
| 249 |
+
</div>
|
| 250 |
+
</li>
|
| 251 |
+
</ul>
|
| 252 |
+
</div>
|
| 253 |
+
<?php
|
| 254 |
+
}
|
| 255 |
+
?>
|
includes/shrsb_authentication_page.php
ADDED
|
@@ -0,0 +1,141 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
function shrsb_authentication_page($apikey = null) {
|
| 4 |
+
global $shrsb_plugopts;
|
| 5 |
+
?>
|
| 6 |
+
<script type ="text/javascript">
|
| 7 |
+
function authenticate(apikey,callback) {
|
| 8 |
+
if(!apikey) {
|
| 9 |
+
return false;
|
| 10 |
+
}
|
| 11 |
+
var args = {};
|
| 12 |
+
args["install_url"] = '<?php echo get_option('siteurl')?>';
|
| 13 |
+
args["api_key"] = apikey;
|
| 14 |
+
var validation_url = <?php echo '"'.$shrsb_plugopts['shrbase'].'"' ?> +"/api/auth/apikey/";
|
| 15 |
+
jQuery.ajax({
|
| 16 |
+
url : validation_url,
|
| 17 |
+
type: 'get',
|
| 18 |
+
data: args,
|
| 19 |
+
success: authHandler,
|
| 20 |
+
dataType:'jsonp'
|
| 21 |
+
});
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
function authHandler(obj) {
|
| 25 |
+
var imgSrc = <?php echo '"'.$shrsb_plugopts['shrbase'].'"' ?> +"/media/images/" + (obj["auth"]?"pass":"fail") + ".png";
|
| 26 |
+
var dispText = "Authentication " + (obj["auth"]?"Succeeded":"Failed") + ".";
|
| 27 |
+
if(obj["auth"]) {
|
| 28 |
+
jQuery("#sexy-bookmark-pro-authenticate").get(0).submit();
|
| 29 |
+
}
|
| 30 |
+
jQuery("#auth-status-img").get(0).src = imgSrc;
|
| 31 |
+
jQuery("#auth-status-text").text(dispText);
|
| 32 |
+
}
|
| 33 |
+
|
| 34 |
+
function submitHandler() {
|
| 35 |
+
var api = jQuery("#apikey").get(0).value;
|
| 36 |
+
authenticate(api);
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
+
</script>
|
| 40 |
+
|
| 41 |
+
<h2 class="shrsblogo"><span class="sh-logo"></span></h2>
|
| 42 |
+
<iframe style ="display:none" name ="_formtarget" id ="_formtarget"></iframe>
|
| 43 |
+
|
| 44 |
+
<div id="shrsb-col-left" style="width:100%;">
|
| 45 |
+
<ul id="shrsb-sortables">
|
| 46 |
+
<li>
|
| 47 |
+
<div class="box-mid-head">
|
| 48 |
+
<h2 class="fugue f-status"><?php _e('Shareaholic Pro', 'shrsb'); ?></h2>
|
| 49 |
+
</div>
|
| 50 |
+
<div class="box-mid-body">
|
| 51 |
+
<div class="padding">
|
| 52 |
+
<div style="position:relative;width:80%;">
|
| 53 |
+
<p><strong>
|
| 54 |
+
<?php _e('Shareaholic Professional is coming!!!!', 'shrsb'); ?>
|
| 55 |
+
</strong>
|
| 56 |
+
<br><br>
|
| 57 |
+
<?php _e('We are excited to offer you a host of features like Analytics to give you insight about your website traffic and user activity.'.
|
| 58 |
+
'Be the first one to grab the opportunity and register for a free account today!!', 'shrsb'); ?>
|
| 59 |
+
</p>
|
| 60 |
+
</div>
|
| 61 |
+
</div>
|
| 62 |
+
<div class="shrsbsubmit">
|
| 63 |
+
<input type="button" onclick ="window.open(<?php echo '\"'.$shrsb_plugopts['shrbase'].'\"' ?> +'/publishers_apps/new_publishers_app')" value="<?php _e('Get Share Pro', 'shrsb'); ?>" />
|
| 64 |
+
</div>
|
| 65 |
+
</div>
|
| 66 |
+
</li>
|
| 67 |
+
|
| 68 |
+
<li>
|
| 69 |
+
<div class="box-mid-head">
|
| 70 |
+
<h2 class="fugue f-status"><?php _e('Authenticate', 'shrsb'); ?></h2>
|
| 71 |
+
</div>
|
| 72 |
+
<div class="box-mid-body">
|
| 73 |
+
<form target="_formtarget" name="sexy-bookmark-pro-authenticate" id="sexy-bookmark-pro-authenticate" action="" method="post">
|
| 74 |
+
<div class="padding">
|
| 75 |
+
<div>
|
| 76 |
+
<strong><?php _e('Status','shrsb')?></strong>
|
| 77 |
+
<div style="padding: 2px;">
|
| 78 |
+
<div style="float: left; margin-right: 5px; padding-top: 1px;">
|
| 79 |
+
<img id="auth-status-img" alt = "" src=<?php $status = $apikey?"pass.png":"transparent.gif"; echo $shrsb_plugopts['shrbase']."/media/images/".$status?>
|
| 80 |
+
style="width: 12px; height: 12px;">
|
| 81 |
+
</div>
|
| 82 |
+
<span id="auth-status-text"><?php $status = $apikey?_e('Authenticated','shrsb'):"";?></span>
|
| 83 |
+
</div>
|
| 84 |
+
</div>
|
| 85 |
+
<br>
|
| 86 |
+
<div style="position:relative;width:80%;">
|
| 87 |
+
<label for="apikey"><?php _e('Enter the API key that you registered for your application.', 'shrsb'); ?></label><br />
|
| 88 |
+
<input type ="text" id="apikey" name="apikey" value ="<?php $status = $apikey ? $apikey : ''; echo $status;?>"/>
|
| 89 |
+
</div>
|
| 90 |
+
</div>
|
| 91 |
+
<div class="shrsbsubmit"><input type="button" onclick ="submitHandler()" value="<?php _e('Authenticate', 'shrsb'); ?>" /></div>
|
| 92 |
+
</form>
|
| 93 |
+
</div>
|
| 94 |
+
</li>
|
| 95 |
+
</ul>
|
| 96 |
+
</div>
|
| 97 |
+
|
| 98 |
+
|
| 99 |
+
|
| 100 |
+
|
| 101 |
+
<div id="shrsb-col-right">
|
| 102 |
+
<div class="box-right">
|
| 103 |
+
<div class="box-right-head">
|
| 104 |
+
<h3><?php _e('Why Register ?', 'shrsb'); ?></h3>
|
| 105 |
+
</div>
|
| 106 |
+
<div class="box-right-body">
|
| 107 |
+
<div class="padding">
|
| 108 |
+
<ul class="infolinks">
|
| 109 |
+
<li>Analytics to increase website traffic</li>
|
| 110 |
+
<li>Advance UI features</li>
|
| 111 |
+
<li>It's fast, secure, & free to signup!</li>
|
| 112 |
+
</ul>
|
| 113 |
+
</div>
|
| 114 |
+
</div>
|
| 115 |
+
</div>
|
| 116 |
+
<div class="box-right">
|
| 117 |
+
<div class="box-right-head">
|
| 118 |
+
<h3 class="fugue f-info-frame"><?php _e('Helpful Plugin Links', 'shrsb'); ?></h3>
|
| 119 |
+
</div>
|
| 120 |
+
<div class="box-right-body">
|
| 121 |
+
<div class="padding">
|
| 122 |
+
<ul class="infolinks">
|
| 123 |
+
<li><a href="http://www.shareaholic.com/tools/wordpress/usage-installation" target="_blank"><?php _e('Installation & Usage Guide', 'shrsb'); ?></a></li>
|
| 124 |
+
<li><a href="http://www.shareaholic.com/tools/wordpress/faq" target="_blank"><?php _e('Frequently Asked Questions', 'shrsb'); ?></a></li>
|
| 125 |
+
<li><a href="http://sexybookmarks.shareaholic.com/contact-forms/bug-form" target="_blank"><?php _e('Bug Submission Form', 'shrsb'); ?></a></li>
|
| 126 |
+
<li><a href="http://sexybookmarks.shareaholic.com/contact-forms/feature-request" target="_blank"><?php _e('Feature Request Form', 'shrsb'); ?></a></li>
|
| 127 |
+
<li><a href="http://sexybookmarks.shareaholic.com/contact-forms/translation-submission-form" target="_blank"><?php _e('Submit a Translation', 'shrsb'); ?></a></li>
|
| 128 |
+
<li><a href="http://www.shareaholic.com/tools/browser/" target="_blank"><?php _e('Shareaholic Browsers Add-ons', 'shrsb'); ?></a></li>
|
| 129 |
+
<li><a href="http://www.shareaholic.com/tools/wordpress/credits" target="_blank"><?php _e('Thanks & Credits', 'shrsb'); ?></a></li>
|
| 130 |
+
</ul>
|
| 131 |
+
</div>
|
| 132 |
+
</div>
|
| 133 |
+
</div>
|
| 134 |
+
|
| 135 |
+
<div style="padding:15px;"><iframe src="http://www.facebook.com/plugins/like.php?href=http%3A%2F%2Fwww.facebook.com%2FShareaholic&layout=standard&show_faces=true&width=240&action=like&font=lucida+grande&colorscheme=light&height=80" scrolling="no" frameborder="0" style="border:none; overflow:hidden; width:240px; height:80px;" allowTransparency="true"></iframe>
|
| 136 |
+
</div>
|
| 137 |
+
|
| 138 |
+
</div>
|
| 139 |
+
<?php
|
| 140 |
+
}
|
| 141 |
+
?>
|
includes/shrsb_classicbookmarks_page.php
ADDED
|
@@ -0,0 +1,59 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* @desc Classic Bookmarks Settings
|
| 5 |
+
*/
|
| 6 |
+
|
| 7 |
+
$shrsb_cb= shrsb_cb_set_options();
|
| 8 |
+
|
| 9 |
+
/*
|
| 10 |
+
* @desc Set the classicbookmarks settings either from database or default
|
| 11 |
+
*/
|
| 12 |
+
function shrsb_cb_set_options( $action = NULL ) {
|
| 13 |
+
|
| 14 |
+
$option_name = 'ShareaholicClassicBookmarks';
|
| 15 |
+
|
| 16 |
+
$shrsb_cb_default = array(
|
| 17 |
+
'cb' => '0'
|
| 18 |
+
, 'size' => '32'
|
| 19 |
+
, 'pageorpost' => 'postpageindexcategory'
|
| 20 |
+
);
|
| 21 |
+
|
| 22 |
+
//Return default settings
|
| 23 |
+
if( $action == "reset" ) {
|
| 24 |
+
delete_option($option_name);
|
| 25 |
+
add_option($option_name,$shrsb_cb_default);
|
| 26 |
+
return $shrsb_cb_default;
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
//Get the settings from the database
|
| 30 |
+
$database_Settings = get_option($option_name);
|
| 31 |
+
|
| 32 |
+
|
| 33 |
+
if( $database_Settings ) {//got the settings in the database
|
| 34 |
+
|
| 35 |
+
// Check only when upgrading
|
| 36 |
+
if( SHRSB_UPGRADING ) {
|
| 37 |
+
$need_to_update = false;
|
| 38 |
+
|
| 39 |
+
//Check whether all the settings are present or not
|
| 40 |
+
foreach( $shrsb_cb_default as $k => $v ){
|
| 41 |
+
if( !array_key_exists( $k, $database_Settings )) {
|
| 42 |
+
$database_Settings[$k] = $v;
|
| 43 |
+
$need_to_update = true;
|
| 44 |
+
}
|
| 45 |
+
}
|
| 46 |
+
|
| 47 |
+
if( $need_to_update ) update_option( $option_name, $database_Settings );
|
| 48 |
+
|
| 49 |
+
}
|
| 50 |
+
|
| 51 |
+
return $database_Settings;
|
| 52 |
+
|
| 53 |
+
} else {
|
| 54 |
+
//Add the settings to the database
|
| 55 |
+
add_option( $option_name, $shrsb_cb_default );
|
| 56 |
+
return $shrsb_cb_default;
|
| 57 |
+
}
|
| 58 |
+
}
|
| 59 |
+
?>
|
includes/shrsb_classicbookmarks_settings_page.php
ADDED
|
@@ -0,0 +1,164 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* @desc Classic Bookmarks Settings page
|
| 5 |
+
*/
|
| 6 |
+
|
| 7 |
+
function shrsb_cb_settings_page() {
|
| 8 |
+
global $shrsb_cb;
|
| 9 |
+
|
| 10 |
+
// Add all the global varaible declarations for the $shrsb_cb_plugopts
|
| 11 |
+
echo '<div class="wrap""><div class="icon32" id="icon-options-general"><br></div><h2>'.__('ClassicBookmarks Settings', 'shrsb').'</h2></div>';
|
| 12 |
+
//Defaults - set if not present
|
| 13 |
+
if (!isset($_POST['reset_all_options_cb'])){$_POST['reset_all_options_cb'] = '1';}
|
| 14 |
+
if (!isset($_POST['shrsbresetallwarn-choice'])){$_POST['shrsbresetallwarn-choice'] = 'no';}
|
| 15 |
+
|
| 16 |
+
if($_POST['reset_all_options_cb'] == '0') {
|
| 17 |
+
echo '
|
| 18 |
+
<div id="shrsbresetallwarn" class="dialog-box-warning" style="float:none;width:97%;margin-top:20px;">
|
| 19 |
+
<div class="dialog-left fugue f-warn">
|
| 20 |
+
'.__("WARNING: You are about to reset all plugin settings to their default state! Do you wish to continue?", "shrsb").'
|
| 21 |
+
</div>
|
| 22 |
+
<div class="dialog-right">
|
| 23 |
+
<form action="" method="post" id="resetalloptionsaccept">
|
| 24 |
+
<label><input name="shrsbresetallwarn-choice" id="shrsbresetallwarn-yes" type="radio" value="yes" />'.__('Yes', 'shrsb').'</label> <label><input name="shrsbresetallwarn-choice" id="shrsbresetallwarn-cancel" type="radio" value="cancel" />'.__('Cancel', 'shrsb').'</label>
|
| 25 |
+
</form>
|
| 26 |
+
</div>
|
| 27 |
+
</div>';
|
| 28 |
+
}
|
| 29 |
+
|
| 30 |
+
//Reset all options to default settings if user clicks the reset button
|
| 31 |
+
if($_POST['shrsbresetallwarn-choice'] == "yes") { //check for reset button click
|
| 32 |
+
|
| 33 |
+
$shrsb_cb = shrsb_cb_set_options('reset');
|
| 34 |
+
|
| 35 |
+
//delete_option('SHRSB_CustomSprite');
|
| 36 |
+
echo '
|
| 37 |
+
<div id="statmessage" class="shrsb-success">
|
| 38 |
+
<div class="dialog-left fugue f-success">
|
| 39 |
+
'.__('All settings have been reset to their default values.', 'shrsb').'
|
| 40 |
+
</div>
|
| 41 |
+
<div class="dialog-right">
|
| 42 |
+
<img src="'.SHRSB_PLUGPATH.'images/success-delete.jpg" class="del-x" alt=""/>
|
| 43 |
+
</div>
|
| 44 |
+
</div>';
|
| 45 |
+
}
|
| 46 |
+
|
| 47 |
+
// processing form submission
|
| 48 |
+
$status_message = "";
|
| 49 |
+
$error_message = "";
|
| 50 |
+
if(isset($_POST['save_changes_cb'])) {
|
| 51 |
+
|
| 52 |
+
// Set success message
|
| 53 |
+
$status_message = __('Your changes have been saved successfully!', 'shrsb');
|
| 54 |
+
$_POST['pageorpost'] = shrsb_set_content_type();
|
| 55 |
+
foreach (array(
|
| 56 |
+
'cb', 'size', 'pageorpost'
|
| 57 |
+
)as $field) {
|
| 58 |
+
if(isset($_POST[$field])) { // this is to prevent warning if $_POST[$field] is not defined
|
| 59 |
+
$shrsb_cb[$field] = $_POST[$field];
|
| 60 |
+
} else {
|
| 61 |
+
$shrsb_cb[$field] = NULL;
|
| 62 |
+
}
|
| 63 |
+
}
|
| 64 |
+
|
| 65 |
+
update_option('ShareaholicClassicBookmarks',$shrsb_cb);
|
| 66 |
+
|
| 67 |
+
|
| 68 |
+
}//Closed Save
|
| 69 |
+
|
| 70 |
+
//if there was an error, construct error messages
|
| 71 |
+
if ($error_message != '') {
|
| 72 |
+
echo '
|
| 73 |
+
<div id="errmessage" class="shrsb-error">
|
| 74 |
+
<div class="dialog-left fugue f-error">
|
| 75 |
+
'.$error_message.'
|
| 76 |
+
</div>
|
| 77 |
+
<div class="dialog-right">
|
| 78 |
+
<img src="'.SHRSB_PLUGPATH.'images/error-delete.jpg" class="del-x" alt=""/>
|
| 79 |
+
</div>
|
| 80 |
+
</div>';
|
| 81 |
+
} elseif ($status_message != '') {
|
| 82 |
+
echo '<style type="text/css">#update_sb{display:none !important;}</style>
|
| 83 |
+
<div id="statmessage" class="shrsb-success">
|
| 84 |
+
<div class="dialog-left fugue f-success">
|
| 85 |
+
'.$status_message.'
|
| 86 |
+
</div>
|
| 87 |
+
<div class="dialog-right">
|
| 88 |
+
<img src="'.SHRSB_PLUGPATH.'images/success-delete.jpg" class="del-x" alt=""/>
|
| 89 |
+
</div>
|
| 90 |
+
</div>';
|
| 91 |
+
}
|
| 92 |
+
?>
|
| 93 |
+
|
| 94 |
+
<form name="sexy-bookmarks" id="sexy-bookmarks" action="" method="post">
|
| 95 |
+
<div id="shrsb-col-left" style="width:100%">
|
| 96 |
+
<ul id="shrsb-sortables">
|
| 97 |
+
|
| 98 |
+
<?php if (shrsb_get_current_user_role()=="Administrator"){ ?>
|
| 99 |
+
|
| 100 |
+
<li>
|
| 101 |
+
<div class="box-mid-head">
|
| 102 |
+
<h2><img src="<?php echo SHRSB_PLUGPATH; ?>/images/thumbs-icon.png" style="float:left;margin-top:2px;margin-right:10px;" alt="cb" /> <?php _e('Classic Bookmarks', 'shrsb'); ?></h2>
|
| 103 |
+
</div>
|
| 104 |
+
|
| 105 |
+
<div class="box-mid-body" id="toggle5">
|
| 106 |
+
<div class="padding">
|
| 107 |
+
<div id="genopts">
|
| 108 |
+
<table><tbody>
|
| 109 |
+
<tr class="alert-success">
|
| 110 |
+
<td><span class="shrsb_option"><?php _e('Enable Classic Bookmarks', 'shrsb'); ?> </span></td>
|
| 111 |
+
<td WIDTH="120"><label><input <?php echo ((@$shrsb_cb['cb'] == "1")? 'checked="checked"' : ""); ?> name="cb" id="cb-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label></td>
|
| 112 |
+
<td WIDTH="120"><label><input <?php echo ((@$shrsb_cb['cb'] == "0")? 'checked="checked"' : ""); ?> name="cb" id="cb-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label></td>
|
| 113 |
+
</tr>
|
| 114 |
+
<tr class="cb_prefs" style="display:none">
|
| 115 |
+
<td><label class="tab" for="num" style="margin-top:7px;"><?php _e('Size :', 'shrsb'); ?></label></td>
|
| 116 |
+
<td WIDTH="300"><label><input <?php echo ((@$shrsb_cb['size'] == "16")? 'checked="checked"' : ""); ?> name="size" id="cb-yes" type="radio" value="16" /><img src="<?php echo SHRSB_PLUGPATH; ?>/images/classicbookmark_16x16.png" alt="cb16x16" /></label>
|
| 117 |
+
<br/>
|
| 118 |
+
<label><input <?php echo ((@$shrsb_cb['size'] == "32")? 'checked="checked"' : ""); ?> name="size" id="cb-no" type="radio" value="32" /><img src="<?php echo SHRSB_PLUGPATH; ?>/images/classicbookmark_32x32.png" alt="cb32X32" /></label></td>
|
| 119 |
+
<td></td>
|
| 120 |
+
</tr>
|
| 121 |
+
</tbody></table>
|
| 122 |
+
</div>
|
| 123 |
+
</div>
|
| 124 |
+
</li>
|
| 125 |
+
<li>
|
| 126 |
+
<div class="box-mid-head">
|
| 127 |
+
<h2 class="fugue f-footer"><?php _e('Classic Bookmarks Placement', 'shrsb'); ?></h2>
|
| 128 |
+
</div>
|
| 129 |
+
<div class="box-mid-body" id="toggle5">
|
| 130 |
+
<div class="padding">
|
| 131 |
+
<?php shrsb_options_menu_type(@$shrsb_cb['pageorpost']); ?><br />
|
| 132 |
+
</div>
|
| 133 |
+
</div>
|
| 134 |
+
</li>
|
| 135 |
+
<?php } ?>
|
| 136 |
+
</ul>
|
| 137 |
+
|
| 138 |
+
<?php if (shrsb_get_current_user_role()=="Administrator"){ ?>
|
| 139 |
+
|
| 140 |
+
<div style="clear:both;"></div>
|
| 141 |
+
<input type="hidden" name="save_changes_cb" value="1" />
|
| 142 |
+
<div class="shrsbsubmit"><input type="submit" id="save_changes_cb" value="<?php _e('Save Changes', 'shrsb'); ?>" /></div>
|
| 143 |
+
</form>
|
| 144 |
+
<form action="" method="post">
|
| 145 |
+
<input type="hidden" name="reset_all_options_cb" id="reset_all_options_cb" value="0" />
|
| 146 |
+
<!-- <div class="shrsbreset"><input type="submit" value="<?php _e('Reset Settings', 'shrsb'); ?>" /></div> -->
|
| 147 |
+
</form>
|
| 148 |
+
|
| 149 |
+
<?php } ?>
|
| 150 |
+
|
| 151 |
+
<?php echo shrsb_getfooter(); ?>
|
| 152 |
+
|
| 153 |
+
</div>
|
| 154 |
+
|
| 155 |
+
<?php
|
| 156 |
+
|
| 157 |
+
//Right Side helpful links
|
| 158 |
+
echo shrsb_right_side_menu();
|
| 159 |
+
//Snap Engage
|
| 160 |
+
echo get_snapengage();
|
| 161 |
+
|
| 162 |
+
}//closing brace for function "shrsb_settings_page"
|
| 163 |
+
|
| 164 |
+
?>
|
includes/shrsb_landing_page.php
ADDED
|
@@ -0,0 +1,74 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php function shrsb_landing_page() { ?>
|
| 2 |
+
|
| 3 |
+
<form name="sexy-bookmarks" id="sexy-bookmarks" action="" method="post">
|
| 4 |
+
|
| 5 |
+
<div class="wrap""><div class="icon32" id="icon-options-general"><br></div><h2>Shareaholic Dashboard</h2></div>
|
| 6 |
+
|
| 7 |
+
<div id="shrsb-col-left" style="width:100%;">
|
| 8 |
+
<ul id="shrsb-sortables">
|
| 9 |
+
|
| 10 |
+
<li>
|
| 11 |
+
|
| 12 |
+
<div class="page-header" style="margin-top:20px;"">
|
| 13 |
+
<h1 class="grey_light">Enable Sharing:</h1>
|
| 14 |
+
</div>
|
| 15 |
+
|
| 16 |
+
<div id="sb_box" class="select_product">
|
| 17 |
+
<img style="float:left; margin-left:-25px;margin-top:-19px;visibility:hidden;" src="<?= SHRSB_PLUGPATH."images/new_badge.png" ?>">
|
| 18 |
+
<div class="shr-landing-product-icon"><img src="<?= SHRSB_PLUGPATH."images/sbm.png" ?>"></div>
|
| 19 |
+
<div class="shr-landing-product-name"><h2>SexyBookmarks</h2><span class="shr-landing-product-desc">Have your content shared more with the sexiest sharing buttons on the web.</span></div>
|
| 20 |
+
<div class="shr-landing-product-configure"><a href="admin.php?page=shareaholic_sexybookmarks.php" class="btn btn-large <?php global $shrsb_plugopts; echo ((@$shrsb_plugopts['sexybookmark'] == "1")? '' : "btn-primary");?>"><?php echo ((@$shrsb_plugopts['sexybookmark'] == "1")? '<i class="icon-cog" style="margin-top:2px;"></i> Settings' : "Enable");?></a></div>
|
| 21 |
+
</div>
|
| 22 |
+
|
| 23 |
+
<div id="topbar_box" class="select_product">
|
| 24 |
+
<img style="float:left; margin-left:-25px;margin-top:-19px;visibility:hidden;" src="<?= SHRSB_PLUGPATH."images/new_badge.png" ?>">
|
| 25 |
+
<div class="shr-landing-product-icon"><img src="<?= SHRSB_PLUGPATH."images/tophat.jpg" ?>"></div>
|
| 26 |
+
<div class="shr-landing-product-name"><h2>Top Bar</h2><span class="shr-landing-product-desc">Make sure your readers always have a share button nearby.</span></div>
|
| 27 |
+
<div class="shr-landing-product-configure"><a href="admin.php?page=shareaholic_topbar.php" class="btn btn-large <?php global $shrsb_tb_plugopts; echo ((@$shrsb_tb_plugopts['topbar'] == "1")? '' : "btn-primary");?>"><?php echo ((@$shrsb_tb_plugopts['topbar'] == "1")? '<i class="icon-cog" style="margin-top:2px;"></i> Settings' : "Enable");?></a></div>
|
| 28 |
+
</div>
|
| 29 |
+
|
| 30 |
+
<div id="sb_box" class="select_product">
|
| 31 |
+
<img style="float:left; margin-left:-25px;margin-top:-19px;" src="<?= SHRSB_PLUGPATH."images/new_badge.png" ?>">
|
| 32 |
+
<div class="shr-landing-product-icon"><img src="<?= SHRSB_PLUGPATH."images/cbm.png" ?>"></div>
|
| 33 |
+
<div class="shr-landing-product-name"><h2>ClassicBookmarks</h2><span class="shr-landing-product-desc">Beautiful, elegant, classic styled sharing buttons.</span></div>
|
| 34 |
+
<div class="shr-landing-product-configure"><a href="admin.php?page=shareaholic_classicbookmarks.php" class="btn btn-large <?php global $shrsb_cb; echo ((@$shrsb_cb['cb'] == "1")? '' : "btn-primary");?>"><?php echo ((@$shrsb_cb['cb'] == "1")? '<i class="icon-cog" style="margin-top:2px;"></i> Settings' : "Enable");?></a></div>
|
| 35 |
+
</div>
|
| 36 |
+
|
| 37 |
+
<div class="page-header" style="margin-top:40px;">
|
| 38 |
+
<h1 class="grey_light">Enable Discovery:</h1>
|
| 39 |
+
</div>
|
| 40 |
+
|
| 41 |
+
<div id="rec_box" class="select_product">
|
| 42 |
+
<img style="float:left; margin-left:-25px;margin-top:-19px;" src="<?= SHRSB_PLUGPATH."images/new_badge.png" ?>">
|
| 43 |
+
<div class="shr-landing-product-icon"><img src="<?= SHRSB_PLUGPATH."images/thumbs.png" ?>"></div>
|
| 44 |
+
<div class="shr-landing-product-name"><h2>Recommendations</h2><span class="shr-landing-product-desc">Proven to drive more pageviews by helping your readers discover more of your amazing content.</span></div>
|
| 45 |
+
<div class="shr-landing-product-configure"><a href="admin.php?page=shareaholic_recommendations.php" class="btn btn-large <?php global $shrsb_recommendations; echo ((@$shrsb_recommendations['recommendations'] == "1")? '' : "btn-primary");?>"><?php echo ((@$shrsb_recommendations['recommendations'] == "1")? '<i class="icon-cog" style="margin-top:2px;"></i> Settings' : "Enable");?></a></div>
|
| 46 |
+
</div>
|
| 47 |
+
|
| 48 |
+
<div class="page-header" style="margin-top:40px;">
|
| 49 |
+
<h1 class="grey_light">Analyze:</h1>
|
| 50 |
+
</div>
|
| 51 |
+
|
| 52 |
+
<div id="soc_box" class="select_product">
|
| 53 |
+
<img style="float:left; margin-left:-25px;margin-top:-19px;visibility:hidden;" src="<?= SHRSB_PLUGPATH."images/new_badge.png" ?>">
|
| 54 |
+
<div class="shr-landing-product-icon"><img src="<?= SHRSB_PLUGPATH."images/chart.png" ?>"></div>
|
| 55 |
+
<div class="shr-landing-product-name"><h2>Social Analytics</h2><span class="shr-landing-product-desc">Discover and connect with who is reading and sharing your content.</span></div>
|
| 56 |
+
<div class="shr-landing-product-configure"><a href="admin.php?page=shareaholic_analytics.php" class="btn btn-large"><i class="icon-cog" style="margin-top:2px;"></i> Settings</a></div>
|
| 57 |
+
</div>
|
| 58 |
+
<div style="margin-top:45px;"></div>
|
| 59 |
+
|
| 60 |
+
<?php echo shrsb_getfooter(); ?>
|
| 61 |
+
</div>
|
| 62 |
+
|
| 63 |
+
</form>
|
| 64 |
+
|
| 65 |
+
<?php
|
| 66 |
+
|
| 67 |
+
//Right Side helpful links
|
| 68 |
+
echo shrsb_right_side_menu();
|
| 69 |
+
//Snap Engage
|
| 70 |
+
echo get_snapengage();
|
| 71 |
+
|
| 72 |
+
}//closing brace for function "shrsb_settings_page"
|
| 73 |
+
|
| 74 |
+
?>
|
includes/shrsb_recommendations_page.php
ADDED
|
@@ -0,0 +1,60 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* @desc recommendations Settings
|
| 5 |
+
*/
|
| 6 |
+
|
| 7 |
+
$shrsb_recommendations = shrsb_recommendations_set_options();
|
| 8 |
+
|
| 9 |
+
/*
|
| 10 |
+
* @desc Set the recommendations settings either from database or default
|
| 11 |
+
*/
|
| 12 |
+
function shrsb_recommendations_set_options( $action = NULL ) {
|
| 13 |
+
|
| 14 |
+
$option_name = 'ShareaholicRecommendations';
|
| 15 |
+
|
| 16 |
+
$shrsb_recommendations_default = array(
|
| 17 |
+
'recommendations' => '0'
|
| 18 |
+
, 'num' => '3'
|
| 19 |
+
, 'pageorpost' => 'postpageindexcategory'
|
| 20 |
+
, 'style' => 'image'
|
| 21 |
+
);
|
| 22 |
+
|
| 23 |
+
//Return default settings
|
| 24 |
+
if( $action == "reset" ) {
|
| 25 |
+
delete_option($option_name);
|
| 26 |
+
add_option($option_name,$shrsb_recommendations_default);
|
| 27 |
+
return $shrsb_recommendations_default;
|
| 28 |
+
}
|
| 29 |
+
|
| 30 |
+
//Get the settings from the database
|
| 31 |
+
$database_Settings = get_option($option_name);
|
| 32 |
+
|
| 33 |
+
|
| 34 |
+
if( $database_Settings ) {//got the settings in the database
|
| 35 |
+
|
| 36 |
+
// Check only when upgrading
|
| 37 |
+
if( SHRSB_UPGRADING ) {
|
| 38 |
+
$need_to_update = false;
|
| 39 |
+
|
| 40 |
+
//Check whether all the settings are present or not
|
| 41 |
+
foreach( $shrsb_recommendations_default as $k => $v ){
|
| 42 |
+
if( !array_key_exists( $k, $database_Settings )) {
|
| 43 |
+
$database_Settings[$k] = $v;
|
| 44 |
+
$need_to_update = true;
|
| 45 |
+
}
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
if( $need_to_update ) update_option( $option_name, $database_Settings );
|
| 49 |
+
|
| 50 |
+
}
|
| 51 |
+
|
| 52 |
+
return $database_Settings;
|
| 53 |
+
|
| 54 |
+
} else {
|
| 55 |
+
//Add the settings to the database
|
| 56 |
+
add_option( $option_name, $shrsb_recommendations_default );
|
| 57 |
+
return $shrsb_recommendations_default;
|
| 58 |
+
}
|
| 59 |
+
}
|
| 60 |
+
?>
|
includes/shrsb_recommendations_settings_page.php
ADDED
|
@@ -0,0 +1,183 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* @desc Recommendations Settings page
|
| 5 |
+
*/
|
| 6 |
+
|
| 7 |
+
function shrsb_recommendations_settings_page() {
|
| 8 |
+
global $shrsb_recommendations;
|
| 9 |
+
|
| 10 |
+
// Add all the global varaible declarations for the $shrsb_recommendations_plugopts
|
| 11 |
+
echo '<div class="wrap""><div class="icon32" id="icon-options-general"><br></div><h2>'.__('Recommendations Settings', 'shrsb').'</h2></div>';
|
| 12 |
+
//Defaults - set if not present
|
| 13 |
+
if (!isset($_POST['reset_all_options_recommendations'])){$_POST['reset_all_options_recommendations'] = '1';}
|
| 14 |
+
if (!isset($_POST['shrsbresetallwarn-choice'])){$_POST['shrsbresetallwarn-choice'] = 'no';}
|
| 15 |
+
|
| 16 |
+
if($_POST['reset_all_options_recommendations'] == '0') {
|
| 17 |
+
echo '
|
| 18 |
+
<div id="shrsbresetallwarn" class="dialog-box-warning" style="float:none;width:97%;margin-top:20px;">
|
| 19 |
+
<div class="dialog-left fugue f-warn">
|
| 20 |
+
'.__("WARNING: You are about to reset all plugin settings to their default state! Do you wish to continue?", "shrsb").'
|
| 21 |
+
</div>
|
| 22 |
+
<div class="dialog-right">
|
| 23 |
+
<form action="" method="post" id="resetalloptionsaccept">
|
| 24 |
+
<label><input name="shrsbresetallwarn-choice" id="shrsbresetallwarn-yes" type="radio" value="yes" />'.__('Yes', 'shrsb').'</label> <label><input name="shrsbresetallwarn-choice" id="shrsbresetallwarn-cancel" type="radio" value="cancel" />'.__('Cancel', 'shrsb').'</label>
|
| 25 |
+
</form>
|
| 26 |
+
</div>
|
| 27 |
+
</div>';
|
| 28 |
+
}
|
| 29 |
+
|
| 30 |
+
//Reset all options to default settings if user clicks the reset button
|
| 31 |
+
if($_POST['shrsbresetallwarn-choice'] == "yes") { //check for reset button click
|
| 32 |
+
|
| 33 |
+
$shrsb_recommendations = shrsb_recommendations_set_options('reset');
|
| 34 |
+
|
| 35 |
+
//delete_option('SHRSB_CustomSprite');
|
| 36 |
+
echo '
|
| 37 |
+
<div id="statmessage" class="shrsb-success">
|
| 38 |
+
<div class="dialog-left fugue f-success">
|
| 39 |
+
'.__('All settings have been reset to their default values.', 'shrsb').'
|
| 40 |
+
</div>
|
| 41 |
+
<div class="dialog-right">
|
| 42 |
+
<img src="'.SHRSB_PLUGPATH.'images/success-delete.jpg" class="del-x" alt=""/>
|
| 43 |
+
</div>
|
| 44 |
+
</div>';
|
| 45 |
+
}
|
| 46 |
+
|
| 47 |
+
// processing form submission
|
| 48 |
+
$status_message = "";
|
| 49 |
+
$error_message = "";
|
| 50 |
+
if(isset($_POST['save_changes_rd'])) {
|
| 51 |
+
|
| 52 |
+
// Set success message
|
| 53 |
+
$status_message = __('Your changes have been saved successfully!', 'shrsb');
|
| 54 |
+
$_POST['pageorpost'] = shrsb_set_content_type();
|
| 55 |
+
foreach (array(
|
| 56 |
+
'recommendations', 'num', 'pageorpost','style'
|
| 57 |
+
)as $field) {
|
| 58 |
+
if(isset($_POST[$field])) { // this is to prevent warning if $_POST[$field] is not defined
|
| 59 |
+
$shrsb_recommendations[$field] = $_POST[$field];
|
| 60 |
+
} else {
|
| 61 |
+
$shrsb_recommendations[$field] = NULL;
|
| 62 |
+
}
|
| 63 |
+
}
|
| 64 |
+
|
| 65 |
+
if($shrsb_recommendations['style']=='text')
|
| 66 |
+
$shrsb_recommendations['num']=5;
|
| 67 |
+
|
| 68 |
+
update_option('ShareaholicRecommendations',$shrsb_recommendations);
|
| 69 |
+
|
| 70 |
+
|
| 71 |
+
}//Closed Save
|
| 72 |
+
|
| 73 |
+
//if there was an error, construct error messages
|
| 74 |
+
if ($error_message != '') {
|
| 75 |
+
echo '
|
| 76 |
+
<div id="errmessage" class="shrsb-error">
|
| 77 |
+
<div class="dialog-left fugue f-error">
|
| 78 |
+
'.$error_message.'
|
| 79 |
+
</div>
|
| 80 |
+
<div class="dialog-right">
|
| 81 |
+
<img src="'.SHRSB_PLUGPATH.'images/error-delete.jpg" class="del-x" alt=""/>
|
| 82 |
+
</div>
|
| 83 |
+
</div>';
|
| 84 |
+
} elseif ($status_message != '') {
|
| 85 |
+
echo '<style type="text/css">#update_sb{display:none !important;}</style>
|
| 86 |
+
<div id="statmessage" class="shrsb-success">
|
| 87 |
+
<div class="dialog-left fugue f-success">
|
| 88 |
+
'.$status_message.'
|
| 89 |
+
</div>
|
| 90 |
+
<div class="dialog-right">
|
| 91 |
+
<img src="'.SHRSB_PLUGPATH.'images/success-delete.jpg" class="del-x" alt=""/>
|
| 92 |
+
</div>
|
| 93 |
+
</div>';
|
| 94 |
+
}
|
| 95 |
+
?>
|
| 96 |
+
|
| 97 |
+
<form name="sexy-bookmarks" id="sexy-bookmarks" action="" method="post">
|
| 98 |
+
<div id="shrsb-col-left" style="width:100%">
|
| 99 |
+
<ul id="shrsb-sortables">
|
| 100 |
+
|
| 101 |
+
<?php if (shrsb_get_current_user_role()=="Administrator"){ ?>
|
| 102 |
+
|
| 103 |
+
<li>
|
| 104 |
+
<div class="box-mid-head">
|
| 105 |
+
<h2><img src="<?php echo SHRSB_PLUGPATH; ?>/images/thumbs-icon.png" style="float:left;margin-top:2px;margin-right:10px;" alt="Recommendations" /> <?php _e('Recommendations', 'shrsb'); ?></h2>
|
| 106 |
+
</div>
|
| 107 |
+
<div class="box-mid-body" id="toggle5">
|
| 108 |
+
|
| 109 |
+
<div class="padding">
|
| 110 |
+
<div id="genopts">
|
| 111 |
+
<table><tbody>
|
| 112 |
+
<tr class="alert-success">
|
| 113 |
+
<td><span class="shrsb_option"><?php _e('Enable Recommendations', 'shrsb'); ?> </span></td>
|
| 114 |
+
<td WIDTH="120"><label><input <?php echo ((@$shrsb_recommendations['recommendations'] == "1")? 'checked="checked"' : ""); ?> name="recommendations" id="recommendations-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label></td>
|
| 115 |
+
<td WIDTH="120"><label><input <?php echo ((@$shrsb_recommendations['recommendations'] == "0")? 'checked="checked"' : ""); ?> name="recommendations" id="recommendations-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label></td>
|
| 116 |
+
</tr>
|
| 117 |
+
|
| 118 |
+
<tr class="recommendations_prefs-1" style="display:none">
|
| 119 |
+
<td><label class="tab" for="style" style="margin-top:7px;"><?php _e('Display thumbnails for each recommendation? </br>(If most posts on your blog don\'t include images, you should set this to \'No\'):', 'shrsb'); ?></label></td>
|
| 120 |
+
<td WIDTH="120"><label><input <?php echo ((@$shrsb_recommendations['style'] == "image")? 'checked="checked"' : ""); ?> name="style" id="recommendations-style-image" type="radio" value="image" /> <?php _e('Yes', 'shrsb'); ?></label></td>
|
| 121 |
+
<td WIDTH="120"><label><input <?php echo ((@$shrsb_recommendations['style'] == "text")? 'checked="checked"' : ""); ?> name="style" id="recommendations-style-text" type="radio" value="text" /> <?php _e('No', 'shrsb'); ?></label></td>
|
| 122 |
+
<!-- <td colspan="2"><input style="margin-top:7px;" type="text" id="num" name="num" size="35" placeholder="ex. UA-XXXXXXXX-X" value="<?php echo @$shrsb_recommendations['style']; ?>" /></td>-->
|
| 123 |
+
|
| 124 |
+
</tr>
|
| 125 |
+
|
| 126 |
+
<tr class="recommendations_prefs-2" style="display:none;">
|
| 127 |
+
<td><label class="tab" for="num" style="margin-top:7px;"><?php _e('Number of recommendations displayed:', 'shrsb'); ?></label></td>
|
| 128 |
+
<td WIDTH="120"><label><input <?php echo ((@$shrsb_recommendations['num'] == "3")? 'checked="checked"' : ""); ?> name="num" id="recommendations-yes" type="radio" value="3" /> <?php _e('3', 'shrsb'); ?></label></td>
|
| 129 |
+
<td WIDTH="120"><label><input <?php echo ((@$shrsb_recommendations['num'] == "4")? 'checked="checked"' : ""); ?> name="num" id="recommendations-no" type="radio" value="4" /> <?php _e('4', 'shrsb'); ?></label></td>
|
| 130 |
+
</tr>
|
| 131 |
+
|
| 132 |
+
<tr>
|
| 133 |
+
<td colspan="3"><br /><p>Once enabled, we will analyze your content and begin generating recommended posts to display. This may take up to several hours if you are a new Shareaholic user and depending on the number of posts on your blog. The quality of recommended stories will improve once we complete our crawl of your website.</p><p><span class="label label-info">Tip</span> we recommend using Shareaholic sharing tools as they help boost the quality of your recommendations.</p></td>
|
| 134 |
+
</tr>
|
| 135 |
+
</tbody></table>
|
| 136 |
+
</div>
|
| 137 |
+
</div>
|
| 138 |
+
</li>
|
| 139 |
+
<li>
|
| 140 |
+
<div class="box-mid-head">
|
| 141 |
+
<h2 class="fugue f-footer"><?php _e('Recommendations Placement', 'shrsb'); ?></h2>
|
| 142 |
+
</div>
|
| 143 |
+
<div class="box-mid-body" id="toggle5">
|
| 144 |
+
<div class="padding">
|
| 145 |
+
|
| 146 |
+
<?php shrsb_options_menu_type(@$shrsb_recommendations['pageorpost']); ?>
|
| 147 |
+
|
| 148 |
+
<br />
|
| 149 |
+
</div>
|
| 150 |
+
</div>
|
| 151 |
+
</li>
|
| 152 |
+
|
| 153 |
+
<?php } ?>
|
| 154 |
+
|
| 155 |
+
</ul>
|
| 156 |
+
|
| 157 |
+
<?php if (shrsb_get_current_user_role()=="Administrator"){ ?>
|
| 158 |
+
|
| 159 |
+
<div style="clear:both;"></div>
|
| 160 |
+
<input type="hidden" name="save_changes_rd" value="1" />
|
| 161 |
+
<div class="shrsbsubmit"><input type="submit" id="save_changes_rd" value="<?php _e('Save Changes', 'shrsb'); ?>" /></div>
|
| 162 |
+
</form>
|
| 163 |
+
<form action="" method="post">
|
| 164 |
+
<input type="hidden" name="reset_all_options_recommendations" id="reset_all_options_recommendations" value="0" />
|
| 165 |
+
<!-- <div class="shrsbreset"><input type="submit" value="<?php _e('Reset Settings', 'shrsb'); ?>" /></div> -->
|
| 166 |
+
</form>
|
| 167 |
+
|
| 168 |
+
<?php } ?>
|
| 169 |
+
|
| 170 |
+
<?php echo shrsb_getfooter(); ?>
|
| 171 |
+
|
| 172 |
+
</div>
|
| 173 |
+
|
| 174 |
+
<?php
|
| 175 |
+
|
| 176 |
+
//Right Side helpful links
|
| 177 |
+
echo shrsb_right_side_menu();
|
| 178 |
+
//Snap Engage
|
| 179 |
+
echo get_snapengage();
|
| 180 |
+
|
| 181 |
+
}//closing brace for function "shrsb_settings_page"
|
| 182 |
+
|
| 183 |
+
?>
|
includes/shrsb_settings_page.php
ADDED
|
@@ -0,0 +1,636 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* @desc Like button Set Settings
|
| 5 |
+
*/
|
| 6 |
+
|
| 7 |
+
function shrsb_likeButtonSetHTML($settings,$pos = 'Bottom') { // $pos = Bottom/Top
|
| 8 |
+
|
| 9 |
+
?>
|
| 10 |
+
|
| 11 |
+
<table><tbody style ="display:none" class="likeButtonsAvailable<?php echo $pos;?>">
|
| 12 |
+
<tr class="tabForTr">
|
| 13 |
+
<td><span class="shrsb_option"><?php _e('Include Facebook Like Button', 'shrsb'); ?></span>
|
| 14 |
+
</td>
|
| 15 |
+
<td style="width:125px"><label><input <?php echo (($settings["fbLikeButton$pos"] == "1")? 'checked="checked"' : ""); ?> name="fbLikeButton<?php echo $pos;?>" id="fbLikeButton<?php echo $pos;?>-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 16 |
+
</td><td><label><input <?php echo (($settings["fbLikeButton$pos"] == "0")? 'checked="checked"' : ""); ?> name="fbLikeButton<?php echo $pos;?>" id="fbLikeButton<?php echo $pos;?>-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 17 |
+
</td>
|
| 18 |
+
</tr>
|
| 19 |
+
<tr class="tabForTr">
|
| 20 |
+
<td><span class="shrsb_option"><?php _e('Include Facebook Send Button', 'shrsb'); ?></span>
|
| 21 |
+
</td>
|
| 22 |
+
<td style="width:125px"><label><input <?php echo (($settings["fbSendButton$pos"] == "1")? 'checked="checked"' : ""); ?> name="fbSendButton<?php echo $pos;?>" id="fbSendButton<?php echo $pos;?>-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 23 |
+
</td><td><label><input <?php echo (($settings["fbSendButton$pos"] == "0")? 'checked="checked"' : ""); ?> name="fbSendButton<?php echo $pos;?>" id="fbSendButton<?php echo $pos;?>-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 24 |
+
</td>
|
| 25 |
+
</tr>
|
| 26 |
+
<tr class="tabForTr">
|
| 27 |
+
<td><span class="shrsb_option"><?php _e('Include Google +1 Button', 'shrsb'); ?></span>
|
| 28 |
+
</td>
|
| 29 |
+
<td style="width:125px"><label><input <?php echo (($settings["googlePlusOneButton$pos"] == "1")? 'checked="checked"' : ""); ?> name="googlePlusOneButton<?php echo $pos;?>" id="googlePlusOneButton<?php echo $pos;?>-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 30 |
+
</td><td><label><input <?php echo (($settings["googlePlusOneButton$pos"] == "0")? 'checked="checked"' : ""); ?> name="googlePlusOneButton<?php echo $pos;?>" id="googlePlusOneButton<?php echo $pos;?>-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 31 |
+
</td>
|
| 32 |
+
</tr>
|
| 33 |
+
<tr class="tabForTr">
|
| 34 |
+
<td><span class="shrsb_option"><?php _e('Include Tweet Button', 'shrsb'); ?></span>
|
| 35 |
+
</td>
|
| 36 |
+
<td style="width:125px"><label><input <?php echo (($settings["tweetButton$pos"] == "1")? 'checked="checked"' : ""); ?> name="tweetButton<?php echo $pos;?>" id="tweetButton<?php echo $pos;?>-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 37 |
+
</td><td><label><input <?php echo (($settings["tweetButton$pos"] == "0")? 'checked="checked"' : ""); ?> name="tweetButton<?php echo $pos;?>" id="tweetButton<?php echo $pos;?>-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 38 |
+
</td>
|
| 39 |
+
</tr>
|
| 40 |
+
|
| 41 |
+
<tr class="tabForTr likeButtonSetOptions<?php echo $pos;?>" id="likeButtonSetAlignment<?php echo $pos;?>" style="display:none">
|
| 42 |
+
<td>
|
| 43 |
+
<span class="tab shrsb_option" style="display:block"><?php _e('Button Alignment (w.r.t post)', 'shrsb'); ?></span>
|
| 44 |
+
</td>
|
| 45 |
+
<td colspan="2">
|
| 46 |
+
<select name="likeButtonSetAlignment<?php echo $pos;?>">
|
| 47 |
+
<?php
|
| 48 |
+
print shrsb_select_option_group(
|
| 49 |
+
'likeButtonSetAlignment'.$pos,
|
| 50 |
+
array(
|
| 51 |
+
'0'=>__('Left Aligned', 'shrsb'),
|
| 52 |
+
'1'=>__('Right Aligned', 'shrsb')
|
| 53 |
+
),
|
| 54 |
+
$settings
|
| 55 |
+
);
|
| 56 |
+
?>
|
| 57 |
+
</select>
|
| 58 |
+
</td>
|
| 59 |
+
</tr>
|
| 60 |
+
<tr class ="tabForTr likeButtonSetOptions<?php echo $pos;?>" style="display:none">
|
| 61 |
+
<td>
|
| 62 |
+
<span class="tab shrsb_option" style="display:block"><?php _e('Button Style', 'shrsb'); ?></span>
|
| 63 |
+
</td>
|
| 64 |
+
<td style="width:125px">
|
| 65 |
+
<select name="likeButtonSetSize<?php echo $pos;?>">
|
| 66 |
+
<?php
|
| 67 |
+
print shrsb_select_option_group(
|
| 68 |
+
"likeButtonSetSize$pos", array(
|
| 69 |
+
'0'=>__('Standard', 'shrsb'),
|
| 70 |
+
'1'=>__('Buttons', 'shrsb'),
|
| 71 |
+
'2'=>__('Box', 'shrsb'),
|
| 72 |
+
),
|
| 73 |
+
$settings
|
| 74 |
+
);
|
| 75 |
+
?>
|
| 76 |
+
</select>
|
| 77 |
+
</td>
|
| 78 |
+
|
| 79 |
+
</tr>
|
| 80 |
+
|
| 81 |
+
<tr class ="tabForTr likeButtonSetOptions<?php echo $pos;?>" style="display:none">
|
| 82 |
+
<td>
|
| 83 |
+
<span class="tab shrsb_option" style="display:block"><?php _e('Show share counters:', 'shrsb'); ?></span>
|
| 84 |
+
</td>
|
| 85 |
+
<td style="width:125px">
|
| 86 |
+
<select name="likeButtonSetCount<?php echo $pos;?>">
|
| 87 |
+
<?php
|
| 88 |
+
print shrsb_select_option_group(
|
| 89 |
+
"likeButtonSetCount$pos", array(
|
| 90 |
+
'true'=>__('Yes', 'shrsb'),
|
| 91 |
+
'false'=>__('No', 'shrsb'),
|
| 92 |
+
),
|
| 93 |
+
$settings
|
| 94 |
+
);
|
| 95 |
+
?>
|
| 96 |
+
</select>
|
| 97 |
+
</td>
|
| 98 |
+
|
| 99 |
+
</tr>
|
| 100 |
+
|
| 101 |
+
<tr class ="tabForTr likeButtonSetOptions<?php echo $pos;?>" style="display:none">
|
| 102 |
+
<td rowspan="4" colspan="3" >
|
| 103 |
+
<small><?php _e('Drag to reorder.', 'shrsb'); ?></small>
|
| 104 |
+
|
| 105 |
+
<div style="clear: both; min-height: 1px; height: 5px; width: 100%;"></div>
|
| 106 |
+
<div id="buttonPreviews<?php echo $pos;?>" style="clear: both; max-height: 100px !important; max-width: 600px !important;"><ul>
|
| 107 |
+
<?php
|
| 108 |
+
$fbLikeHTML = '<li ><div style="display:none; cursor:move;" class="likebuttonpreview'.$pos.'">
|
| 109 |
+
<input name="likeButtonOrder'.$pos.'[]" type="hidden" value="shr-fb-like"/>
|
| 110 |
+
</div></li>';
|
| 111 |
+
$plusOneHTML = '<li><div style=" display:none; cursor:move;" class="plusonepreview'.$pos.'">
|
| 112 |
+
<input name="likeButtonOrder'.$pos.'[]" type="hidden" value="shr-plus-one"/>
|
| 113 |
+
</div></li>';
|
| 114 |
+
|
| 115 |
+
$fbSendHTML = '<li><div style = "display:none; cursor:move;" class="sendbuttonpreview'.$pos.' shr-fb-send">
|
| 116 |
+
<input name="likeButtonOrder'.$pos.'[]" type="hidden" value="shr-fb-send"/>
|
| 117 |
+
</div></li>';
|
| 118 |
+
$tweetButtonHTML = '<li><div style = "display:none; cursor:move;" class="tweetbuttonpreview'.$pos.' shr-tw-button">
|
| 119 |
+
<input name="likeButtonOrder'.$pos.'[]" type="hidden" value="shr-tw-button"/>
|
| 120 |
+
</div></li>';
|
| 121 |
+
|
| 122 |
+
foreach($settings['likeButtonOrder'.$pos] as $likeOption) {
|
| 123 |
+
switch($likeOption) {
|
| 124 |
+
case "shr-fb-like":
|
| 125 |
+
echo $fbLikeHTML;
|
| 126 |
+
break;
|
| 127 |
+
case "shr-plus-one":
|
| 128 |
+
echo $plusOneHTML;
|
| 129 |
+
break;
|
| 130 |
+
case "shr-fb-send":
|
| 131 |
+
echo $fbSendHTML;
|
| 132 |
+
break;
|
| 133 |
+
case "shr-tw-button":
|
| 134 |
+
echo $tweetButtonHTML;
|
| 135 |
+
break;
|
| 136 |
+
}
|
| 137 |
+
}
|
| 138 |
+
?>
|
| 139 |
+
</ul></div>
|
| 140 |
+
</td>
|
| 141 |
+
</tr>
|
| 142 |
+
<tr height="60px">
|
| 143 |
+
<script>
|
| 144 |
+
(function ($) {
|
| 145 |
+
var renderPlusOnes = function () {
|
| 146 |
+
var size = $('select[name$="likeButtonSetSize<?php echo $pos;?>"]').val();
|
| 147 |
+
switch(size) {
|
| 148 |
+
case '1':
|
| 149 |
+
size = "button";
|
| 150 |
+
break;
|
| 151 |
+
case '2':
|
| 152 |
+
size = "box";
|
| 153 |
+
break;
|
| 154 |
+
default:
|
| 155 |
+
size = "standard";
|
| 156 |
+
break;
|
| 157 |
+
}
|
| 158 |
+
var count = $('select[name$="likeButtonSetCount<?php echo $pos;?>"]').val();
|
| 159 |
+
switch(count) {
|
| 160 |
+
case 'false':
|
| 161 |
+
count = '';
|
| 162 |
+
break;
|
| 163 |
+
default:
|
| 164 |
+
count = '-count';
|
| 165 |
+
break;
|
| 166 |
+
}
|
| 167 |
+
var classN = 'shr-plus-one-' + size + count;
|
| 168 |
+
classN = "plusonepreview<?php echo $pos;?> " + classN;
|
| 169 |
+
$('.plusonepreview<?php echo $pos;?>').removeClass().addClass(classN);
|
| 170 |
+
|
| 171 |
+
};
|
| 172 |
+
$('select[name$="likeButtonSetCount<?php echo $pos;?>"],select[name$="likeButtonSetSize<?php echo $pos;?>"]').change(function () {
|
| 173 |
+
renderPlusOnes();
|
| 174 |
+
});
|
| 175 |
+
|
| 176 |
+
renderPlusOnes();
|
| 177 |
+
|
| 178 |
+
var renderTweetButton = function () {
|
| 179 |
+
var layout = $('select[name$="likeButtonSetSize<?php echo $pos;?>"]').val();
|
| 180 |
+
switch(layout) {
|
| 181 |
+
case '1':
|
| 182 |
+
layout = "button";
|
| 183 |
+
break;
|
| 184 |
+
case '2':
|
| 185 |
+
layout = "box";
|
| 186 |
+
break;
|
| 187 |
+
default:
|
| 188 |
+
layout = "standard";
|
| 189 |
+
break;
|
| 190 |
+
}
|
| 191 |
+
var count = $('select[name$="likeButtonSetCount<?php echo $pos;?>"]').val();
|
| 192 |
+
switch(count) {
|
| 193 |
+
case 'false':
|
| 194 |
+
count = '';
|
| 195 |
+
break;
|
| 196 |
+
default:
|
| 197 |
+
count = '-count';
|
| 198 |
+
break;
|
| 199 |
+
}
|
| 200 |
+
var classN = 'shr-tw-button-' + layout + count;
|
| 201 |
+
classN = "tweetbuttonpreview<?php echo $pos;?> " + classN;
|
| 202 |
+
$('.tweetbuttonpreview<?php echo $pos;?>').removeClass().addClass(classN);
|
| 203 |
+
};
|
| 204 |
+
|
| 205 |
+
$('select[name$="likeButtonSetCount<?php echo $pos;?>"],select[name$="likeButtonSetSize<?php echo $pos;?>"]').change(function () {
|
| 206 |
+
renderTweetButton();
|
| 207 |
+
});
|
| 208 |
+
renderTweetButton();
|
| 209 |
+
|
| 210 |
+
|
| 211 |
+
var renderLikeButtonPreview = function () {
|
| 212 |
+
var layout = $('select[name$="likeButtonSetSize<?php echo $pos;?>"]').val();
|
| 213 |
+
switch(layout) {
|
| 214 |
+
case '1':
|
| 215 |
+
layout = "button";
|
| 216 |
+
break;
|
| 217 |
+
case '2':
|
| 218 |
+
layout = "box";
|
| 219 |
+
break;
|
| 220 |
+
default:
|
| 221 |
+
layout = "standard";
|
| 222 |
+
break;
|
| 223 |
+
}
|
| 224 |
+
var classN = 'shr-fb-like-' + layout;
|
| 225 |
+
classN = "likebuttonpreview<?php echo $pos;?> " + classN;
|
| 226 |
+
$('.likebuttonpreview<?php echo $pos;?>').removeClass().addClass(classN);
|
| 227 |
+
};
|
| 228 |
+
|
| 229 |
+
$('select[name$="likeButtonSetSize<?php echo $pos;?>"]').change(function () {
|
| 230 |
+
renderLikeButtonPreview();
|
| 231 |
+
});
|
| 232 |
+
renderLikeButtonPreview();
|
| 233 |
+
})(jQuery);
|
| 234 |
+
</script>
|
| 235 |
+
</tr>
|
| 236 |
+
<tr></tr>
|
| 237 |
+
<tr></tr>
|
| 238 |
+
|
| 239 |
+
|
| 240 |
+
<?php
|
| 241 |
+
|
| 242 |
+
}
|
| 243 |
+
|
| 244 |
+
function shrsb_right_side_menu(){
|
| 245 |
+
?>
|
| 246 |
+
|
| 247 |
+
<div id="shrsb-col-right">
|
| 248 |
+
|
| 249 |
+
<h2 class="sh-logo"></h2>
|
| 250 |
+
|
| 251 |
+
<div class="box-right">
|
| 252 |
+
<div class="box-right-head">
|
| 253 |
+
<h3 class="fugue f-info-frame"><?php _e('Helpful Plugin Links', 'shrsb'); ?></h3>
|
| 254 |
+
</div>
|
| 255 |
+
<div class="box-right-body">
|
| 256 |
+
<div class="padding">
|
| 257 |
+
<ul class="infolinks">
|
| 258 |
+
<li><a href="http://www.shareaholic.com/tools/wordpress/usage-installation" target="_blank"><?php _e('Installation & Usage Guide', 'shrsb'); ?></a></li>
|
| 259 |
+
<li><a href="http://www.shareaholic.com/tools/wordpress/faq" target="_blank"><?php _e('Frequently Asked Questions', 'shrsb'); ?></a></li>
|
| 260 |
+
<li><a href="http://sexybookmarks.shareaholic.com/contact-forms/bug-form" target="_blank"><?php _e('Bug Submission Form', 'shrsb'); ?></a></li>
|
| 261 |
+
<li><a href="http://sexybookmarks.shareaholic.com/contact-forms/feature-request" target="_blank"><?php _e('Feature Request Form', 'shrsb'); ?></a></li>
|
| 262 |
+
<li><a href="http://www.shareaholic.com/tools/wordpress/translations" target="_blank"><?php _e('Submit a Translation', 'shrsb'); ?></a></li>
|
| 263 |
+
<li><a href="http://www.shareaholic.com/tools/browser/" target="_blank"><?php _e('Shareaholic Browsers Add-ons', 'shrsb'); ?></a></li>
|
| 264 |
+
<li><a href="http://www.shareaholic.com/tools/wordpress/credits" target="_blank"><?php _e('Thanks & Credits', 'shrsb'); ?></a></li>
|
| 265 |
+
</ul>
|
| 266 |
+
</div>
|
| 267 |
+
</div>
|
| 268 |
+
</div>
|
| 269 |
+
|
| 270 |
+
<div style="clear:both;"></div>
|
| 271 |
+
|
| 272 |
+
<div style="padding:15px; margin-bottom: 20px;">
|
| 273 |
+
<iframe src="http://www.facebook.com/plugins/like.php?href=http%3A%2F%2Fwww.facebook.com%2FShareaholic&layout=standard&show_faces=true&width=240&action=like&font=lucida+grande&colorscheme=light&height=80" scrolling="no" frameborder="0" style="border:none; overflow:hidden; width:240px; height:80px;" allowTransparency="true"></iframe>
|
| 274 |
+
</div>
|
| 275 |
+
|
| 276 |
+
<div id="shrsb-updates">
|
| 277 |
+
<div id="shrsb-updates-container"></div>
|
| 278 |
+
<script async="true" type="text/javascript" src="//dtym7iokkjlif.cloudfront.net/media/js/platforms/wordpress/wordpress-admin.js"></script>
|
| 279 |
+
</div>
|
| 280 |
+
|
| 281 |
+
</div>
|
| 282 |
+
|
| 283 |
+
<?php
|
| 284 |
+
}
|
| 285 |
+
|
| 286 |
+
|
| 287 |
+
|
| 288 |
+
/**
|
| 289 |
+
* Return SnapEngage Help Tab
|
| 290 |
+
*
|
| 291 |
+
* @return string
|
| 292 |
+
* @author Jay Meattle
|
| 293 |
+
**/
|
| 294 |
+
|
| 295 |
+
function get_snapengage() {
|
| 296 |
+
$snapengage = <<<EOD
|
| 297 |
+
<!-- SnapEngage -->
|
| 298 |
+
<script type="text/javascript">
|
| 299 |
+
document.write(unescape("%3Cscript src='" + ((document.location.protocol=="https:")?"https://snapabug.appspot.com":"http://www.snapengage.com") + "/snapabug.js' type='text/javascript'%3E%3C/script%3E"));</script><script type="text/javascript">
|
| 300 |
+
SnapABug.setDomain('shareaholic.com');
|
| 301 |
+
SnapABug.addButton("62fa2e8b-38a9-4304-ba5c-86503444d30c","1","85%");
|
| 302 |
+
</script>
|
| 303 |
+
<!-- SnapEngage End -->
|
| 304 |
+
EOD;
|
| 305 |
+
return $snapengage;
|
| 306 |
+
}
|
| 307 |
+
|
| 308 |
+
function shrsb_getfooter(){
|
| 309 |
+
|
| 310 |
+
?>
|
| 311 |
+
<div style="clear:both;"></div>
|
| 312 |
+
<ul id="shrsb-sortables" style="width:96%;">
|
| 313 |
+
<li style="margin:0px;">
|
| 314 |
+
<div class="footer">
|
| 315 |
+
<a href="http://www.shareaholic.com/?src=wp_admin" target="_blank">Shareaholic for WordPress <?php echo SHRSB_vNum; ?></a> <span class="grey_light">|</span> <a href="http://www.shareaholic.com/privacy/?src=wp_admin" target="_blank">Privacy Policy</a> <span class="grey_light">|</span> <a href="http://www.shareaholic.com/terms/?src=wp_admin" target="_blank">Terms of Service</a> <span class="grey_light">|</span> <a href="http://support.shareaholic.com/" target="_blank">Support</a> <span class="grey_light">|</span> <a href="http://www.shareaholic.com/api/?src=wp_admin" target="_blank">API</a> <span class="grey_light">|</span> <a href="http://www.shareaholic.com/publishers/analytics/<?php $parse = parse_url(get_bloginfo('url')); echo $parse['host']; ?>" target="_blank">Social Analytics</a> <br /> If you like this plugin and find it useful, please consider showing your support by <a href="http://wordpress.org/extend/plugins/shareaholic/" target="_blank" style="font-weight:bold;">giving us a good rating</a> on WordPress.org. Thank you for using <a href="">Shareaholic</a>.
|
| 316 |
+
</div>
|
| 317 |
+
<br />
|
| 318 |
+
<div style="display:block; font-size: 11px; color: #777777;">
|
| 319 |
+
<?php if (shrsb_get_current_user_role()=="Administrator"){ ?>
|
| 320 |
+
<?php _e("<p>Note: The analytics portion of Shareaholic may at times use trusted 3rd party services like Google Analytics and AppNexus to enhance its data. Because all of the processing and collection runs on our servers and not yours, it doesn't cause any additional load on your hosting account. In addition, our JavaScript is hosted on Amazon's CDN to make fetching it blazing fast. In fact, it's one of the fastest proven analytics system, hosted or not hosted, that you can use.</p/>"); ?>
|
| 321 |
+
<?php } ?>
|
| 322 |
+
<?php _e("Shareaholic is trusted by over 200 thousand publishers and touches almost 300 million people each month. Designed and built with all the love in the world in Cambridge, Massachusetts."); ?>
|
| 323 |
+
</div>
|
| 324 |
+
</li>
|
| 325 |
+
</ul>
|
| 326 |
+
<?php
|
| 327 |
+
}
|
| 328 |
+
|
| 329 |
+
/**
|
| 330 |
+
* Gets the contents of a url on www.shareaholic.com. We use shrbase as the
|
| 331 |
+
* URL base path. The caller is responsible for keeping track of whether the
|
| 332 |
+
* cache is up-to-date or not. If the cache is stale (because some argument
|
| 333 |
+
* has changed), then the caller should pass true as the second argument.
|
| 334 |
+
*
|
| 335 |
+
* @url - the partial url without base. ex. /publishers
|
| 336 |
+
* @path - path to cache result to, under spritegen.
|
| 337 |
+
* ex. /publishers.html
|
| 338 |
+
* pass null to use the path part of url
|
| 339 |
+
* @clearcache - force call and overwrite cache.
|
| 340 |
+
*/
|
| 341 |
+
function _shrsb_fetch_content($url, $path, $clearcache=false) {
|
| 342 |
+
global $shrsb_plugopts;
|
| 343 |
+
|
| 344 |
+
$shrbase = $shrsb_plugopts['shrbase']?$shrsb_plugopts['shrbase']:'http://www.shareaholic.com';
|
| 345 |
+
|
| 346 |
+
if (!preg_match('|^/|', $url)) {
|
| 347 |
+
@error_log("url must start with '/' in _shrsb_fetch_content");
|
| 348 |
+
return FALSE;
|
| 349 |
+
}
|
| 350 |
+
|
| 351 |
+
// default path
|
| 352 |
+
if (null === $path) {
|
| 353 |
+
$url_parts = explode('?', $url);
|
| 354 |
+
$path = rtrim($url_parts[0], '/');
|
| 355 |
+
}
|
| 356 |
+
|
| 357 |
+
$base_path = path_join(SHRSB_UPLOADDIR, 'spritegen');
|
| 358 |
+
$abs_path = $base_path.$path;
|
| 359 |
+
|
| 360 |
+
if ($clearcache || !($retval = _shrsb_read_file($abs_path))) {
|
| 361 |
+
$response = wp_remote_get($shrbase.$url);
|
| 362 |
+
if (is_wp_error($response)) {
|
| 363 |
+
@error_log("Failed to fetch ".$shrbase.$url);
|
| 364 |
+
$retval = FALSE;
|
| 365 |
+
} else {
|
| 366 |
+
$retval = $response['body'];
|
| 367 |
+
}
|
| 368 |
+
|
| 369 |
+
$write_succeed = _shrsb_write_file($abs_path, $retval);
|
| 370 |
+
if(!$write_succeed) {
|
| 371 |
+
$retval = FALSE;
|
| 372 |
+
}
|
| 373 |
+
}
|
| 374 |
+
|
| 375 |
+
return $retval;
|
| 376 |
+
}
|
| 377 |
+
|
| 378 |
+
|
| 379 |
+
//Copy the file in to the requested folder
|
| 380 |
+
function _shrsb_copy_file($des , $src){
|
| 381 |
+
if(!$des || !$src )
|
| 382 |
+
return false;
|
| 383 |
+
return _shrsb_write_file($des ,_shrsb_read_file($src));
|
| 384 |
+
}
|
| 385 |
+
|
| 386 |
+
function _shrsb_write_file($path, $content) {
|
| 387 |
+
$dir = dirname($path);
|
| 388 |
+
$return = false;
|
| 389 |
+
if(!wp_mkdir_p(dirname($path))) {
|
| 390 |
+
@error_log("Failed to create path ".dirname($path));
|
| 391 |
+
}
|
| 392 |
+
$fh = fopen($path, 'w+');
|
| 393 |
+
if (!$fh) {
|
| 394 |
+
@error_log("Failed to open ".$path);
|
| 395 |
+
}
|
| 396 |
+
else {
|
| 397 |
+
if (!fwrite($fh, $content)) {
|
| 398 |
+
@error_log("Failed to write to ".$path);
|
| 399 |
+
} else {
|
| 400 |
+
$return = true;
|
| 401 |
+
}
|
| 402 |
+
@fclose($fh);
|
| 403 |
+
}
|
| 404 |
+
return $return;
|
| 405 |
+
}
|
| 406 |
+
|
| 407 |
+
function _shrsb_read_file($path) {
|
| 408 |
+
$content = FALSE;
|
| 409 |
+
|
| 410 |
+
$fh = @fopen($path, 'r');
|
| 411 |
+
if (!$fh) {
|
| 412 |
+
@error_log("Failed to open ".$path);
|
| 413 |
+
}
|
| 414 |
+
else {
|
| 415 |
+
if (!$content = fread($fh, filesize($path))) {
|
| 416 |
+
@error_log("Failed to read from ".$path);
|
| 417 |
+
}
|
| 418 |
+
@fclose($fh);
|
| 419 |
+
}
|
| 420 |
+
|
| 421 |
+
return $content;
|
| 422 |
+
}
|
| 423 |
+
|
| 424 |
+
|
| 425 |
+
function get_sprite_file($opts, $type) {
|
| 426 |
+
global $shrsb_plugopts;
|
| 427 |
+
$shrbase = $shrsb_plugopts['shrbase']?$shrsb_plugopts['shrbase']:'http://www.shareaholic.com';
|
| 428 |
+
$spritegen = $shrbase.'/api/sprite/?v=1&apikey=8afa39428933be41f8afdb8ea21a495c&imageset=60'.$opts.'&apitype='.$type;
|
| 429 |
+
$filename = SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.'.$type;
|
| 430 |
+
$content = FALSE;
|
| 431 |
+
|
| 432 |
+
if (!is_writable(SHRSB_UPLOADDIR.'spritegen')) {
|
| 433 |
+
// the spritegen folder isn't writable. Try changing it to writable
|
| 434 |
+
@chmod(SHRSB_UPLOADDIR.'spritegen', 0775);
|
| 435 |
+
// may or may not work
|
| 436 |
+
}
|
| 437 |
+
if ( $type == 'png' ) {
|
| 438 |
+
$fp_opt = 'rb';
|
| 439 |
+
}
|
| 440 |
+
else {
|
| 441 |
+
$fp_opt = 'r';
|
| 442 |
+
}
|
| 443 |
+
|
| 444 |
+
if(function_exists('wp_remote_retrieve_body') && function_exists('wp_remote_get') && function_exists('wp_remote_retrieve_response_code')) {
|
| 445 |
+
$request = wp_remote_get(
|
| 446 |
+
$spritegen,
|
| 447 |
+
array(
|
| 448 |
+
'user-agent' => "shr-wpspritebot-fopen/v" . SHRSB_vNum,
|
| 449 |
+
'headers' => array(
|
| 450 |
+
'Referer' => get_bloginfo('url')
|
| 451 |
+
)
|
| 452 |
+
)
|
| 453 |
+
);
|
| 454 |
+
$response = wp_remote_retrieve_response_code($request);
|
| 455 |
+
if($response == 200 || $response == '200') {
|
| 456 |
+
$content = wp_remote_retrieve_body($request);
|
| 457 |
+
}
|
| 458 |
+
else {
|
| 459 |
+
$content = FALSE;
|
| 460 |
+
}
|
| 461 |
+
}
|
| 462 |
+
|
| 463 |
+
if ( $content === FALSE && function_exists('curl_init') && function_exists('curl_exec') ) {
|
| 464 |
+
$ch = curl_init();
|
| 465 |
+
curl_setopt($ch, CURLOPT_URL, $spritegen);
|
| 466 |
+
curl_setopt($ch, CURLOPT_FAILONERROR, TRUE);
|
| 467 |
+
curl_setopt($ch, CURLOPT_CONNECTTIMEOUT, 5);
|
| 468 |
+
curl_setopt($ch, CURLOPT_TIMEOUT, 6);
|
| 469 |
+
curl_setopt($ch, CURLOPT_USERAGENT, "shr-wpspritebot-cURL/v" . SHRSB_vNum);
|
| 470 |
+
curl_setopt($ch, CURLOPT_REFERER, get_bloginfo('url'));
|
| 471 |
+
curl_setopt($ch, CURLOPT_HEADER, FALSE);
|
| 472 |
+
curl_setopt($ch, CURLOPT_RETURNTRANSFER, TRUE);
|
| 473 |
+
curl_setopt($ch, CURLOPT_BINARYTRANSFER, TRUE);
|
| 474 |
+
|
| 475 |
+
$content = curl_exec($ch);
|
| 476 |
+
|
| 477 |
+
if ( curl_errno($ch) != 0 ) {
|
| 478 |
+
$content = FALSE;
|
| 479 |
+
}
|
| 480 |
+
curl_close($ch);
|
| 481 |
+
}
|
| 482 |
+
|
| 483 |
+
if ( $content !== FALSE ) {
|
| 484 |
+
if ( $type == 'png' ) {
|
| 485 |
+
$fp_opt = 'w+b';
|
| 486 |
+
}
|
| 487 |
+
else {
|
| 488 |
+
$fp_opt = 'w+';
|
| 489 |
+
}
|
| 490 |
+
|
| 491 |
+
|
| 492 |
+
$fp = @fopen($filename, $fp_opt);
|
| 493 |
+
|
| 494 |
+
if ( $fp !== FALSE ) {
|
| 495 |
+
$ret = @fwrite($fp, $content);
|
| 496 |
+
@fclose($fp);
|
| 497 |
+
}
|
| 498 |
+
else {
|
| 499 |
+
$ret = @file_put_contents($filename, $content);
|
| 500 |
+
}
|
| 501 |
+
|
| 502 |
+
if ( $ret !== FALSE ) {
|
| 503 |
+
@chmod($filename, 0666);
|
| 504 |
+
return 0;
|
| 505 |
+
}
|
| 506 |
+
else {
|
| 507 |
+
return 1;
|
| 508 |
+
}
|
| 509 |
+
}
|
| 510 |
+
else {
|
| 511 |
+
return 2;
|
| 512 |
+
}
|
| 513 |
+
}
|
| 514 |
+
|
| 515 |
+
|
| 516 |
+
function shrsb_preFlight_Checks() {
|
| 517 |
+
global $shrsb_plugopts;
|
| 518 |
+
|
| 519 |
+
//Check for the directory exists or not
|
| 520 |
+
if(!wp_mkdir_p(SHRSB_UPLOADDIR.'spritegen/')) {
|
| 521 |
+
@error_log("Failed to create path ".dirname($path));
|
| 522 |
+
}
|
| 523 |
+
if (!is_writable(SHRSB_UPLOADDIR.'spritegen')) {
|
| 524 |
+
// the spritegen folder isn't writable. Try changing it to writable
|
| 525 |
+
@chmod(SHRSB_UPLOADDIR.'spritegen/', 0775);
|
| 526 |
+
// may or may not work
|
| 527 |
+
}
|
| 528 |
+
|
| 529 |
+
if( ((function_exists('curl_init') && function_exists('curl_exec')) || function_exists('file_get_contents'))
|
| 530 |
+
&& (is_dir(SHRSB_UPLOADDIR) && is_writable(SHRSB_UPLOADDIR))
|
| 531 |
+
&& ((isset($_POST['bookmark']) && is_array($_POST['bookmark']) && sizeof($_POST['bookmark']) > 0 ) || (isset($shrsb_plugopts['bookmark']) && is_array($shrsb_plugopts['bookmark']) && sizeof($shrsb_plugopts['bookmark']) > 0 ))
|
| 532 |
+
&& (!isset($shrsb_plugopts['custom-mods']) || isset($shrsb_plugopts['custom-mods']) && $shrsb_plugopts['custom-mods'] !== 'yes') ) {
|
| 533 |
+
|
| 534 |
+
return true;
|
| 535 |
+
}
|
| 536 |
+
else {
|
| 537 |
+
return false;
|
| 538 |
+
}
|
| 539 |
+
}
|
| 540 |
+
|
| 541 |
+
/* Adds FB Namespace */
|
| 542 |
+
function shrsb_addFBNameSpace($attr) {
|
| 543 |
+
$attr .= "\n xmlns:og=\"http://opengraphprotocol.org/schema/\"";
|
| 544 |
+
$attr .= "\n xmlns:fb=\"http://www.facebook.com/2008/fbml\"";
|
| 545 |
+
return $attr;
|
| 546 |
+
}
|
| 547 |
+
|
| 548 |
+
//list all bookmarks in the plugin options page
|
| 549 |
+
function shrsb_network_input_select($name, $id, $hint) {
|
| 550 |
+
global $shrsb_plugopts;
|
| 551 |
+
return sprintf('<li class="%s" title="%s"><input %sname="bookmark[]" type="checkbox" value="%s" id="%s" /><div style="margin-top:-8px;"></div>%s</li>',
|
| 552 |
+
$name,
|
| 553 |
+
$hint,
|
| 554 |
+
@in_array($name, $shrsb_plugopts['bookmark'])?'checked="checked" ':"",
|
| 555 |
+
$name,
|
| 556 |
+
$name,
|
| 557 |
+
shrsb_truncate_text(end(explode('-', $name)), 9)
|
| 558 |
+
);
|
| 559 |
+
}
|
| 560 |
+
|
| 561 |
+
function shrsb_truncate_text($text, $nbrChar, $append='..') {
|
| 562 |
+
if(strlen($text) > $nbrChar) {
|
| 563 |
+
$text = substr($text, 0, $nbrChar);
|
| 564 |
+
$text .= $append;
|
| 565 |
+
}
|
| 566 |
+
return $text;
|
| 567 |
+
}
|
| 568 |
+
|
| 569 |
+
// returns the option tag for a form select element
|
| 570 |
+
// $opts array expecting keys: field, value, text
|
| 571 |
+
function shrsb_form_select_option($opts,$settings = NULL) {
|
| 572 |
+
global $shrsb_plugopts;
|
| 573 |
+
|
| 574 |
+
if($settings == NULL) $settings = $shrsb_plugopts;
|
| 575 |
+
|
| 576 |
+
$opts=array_merge(
|
| 577 |
+
array(
|
| 578 |
+
'field'=>'',
|
| 579 |
+
'value'=>'',
|
| 580 |
+
'text'=>'',
|
| 581 |
+
),
|
| 582 |
+
$opts
|
| 583 |
+
);
|
| 584 |
+
return sprintf('<option%s value="%s">%s</option>',
|
| 585 |
+
($settings[$opts['field']]==$opts['value'])?' selected="selected"':"",
|
| 586 |
+
$opts['value'],
|
| 587 |
+
$opts['text']
|
| 588 |
+
);
|
| 589 |
+
}
|
| 590 |
+
|
| 591 |
+
// given an array $options of data and $field to feed into shrsb_form_select_option
|
| 592 |
+
function shrsb_select_option_group($field, $options,$settings = NULL) {
|
| 593 |
+
$h='';
|
| 594 |
+
foreach ($options as $value=>$text) {
|
| 595 |
+
$h.=shrsb_form_select_option(
|
| 596 |
+
array(
|
| 597 |
+
'field'=>$field,
|
| 598 |
+
'value'=>$value,
|
| 599 |
+
'text'=>$text,
|
| 600 |
+
),
|
| 601 |
+
$settings
|
| 602 |
+
);
|
| 603 |
+
}
|
| 604 |
+
return $h;
|
| 605 |
+
}
|
| 606 |
+
|
| 607 |
+
// returns the HTML of options for menu display in type
|
| 608 |
+
function shrsb_options_menu_type($pageorpost){
|
| 609 |
+
?>
|
| 610 |
+
|
| 611 |
+
<span class="shrsb_option"><?php _e('Posts, pages, categories or the whole shebang?', 'shrsb'); ?></span>
|
| 612 |
+
<input type="checkbox" id="type_post" name="content_type[]" value="post" <?php echo (false!==strpos($pageorpost,"post"))? 'checked' : ""; ?>/><label for="type_post" class="padding"><?php _e('posts', 'shrsb'); ?></label>
|
| 613 |
+
<input type="checkbox" id="type_page" name="content_type[]" value="page" <?php echo (false!==strpos($pageorpost,"page"))? 'checked' : ""; ?>/><label for="type_page" class="padding"><?php _e('pages', 'shrsb'); ?></label>
|
| 614 |
+
<input type="checkbox" id="type_index" name="content_type[]" value="index" <?php echo (false!==strpos($pageorpost,"index"))? 'checked' : ""; ?>/><label for="type_index" class="padding"><?php _e('main index', 'shrsb'); ?></label>
|
| 615 |
+
<input type="checkbox" id="type_category" name="content_type[]" value="category" <?php echo (false!==strpos($pageorpost,"category"))? 'checked' : ""; ?>/><label for="type_category" class="padding"><?php _e('category index', 'shrsb'); ?></label>
|
| 616 |
+
|
| 617 |
+
<?php
|
| 618 |
+
}
|
| 619 |
+
|
| 620 |
+
/*
|
| 621 |
+
* @desc For setting the content type which are enabled
|
| 622 |
+
*/
|
| 623 |
+
function shrsb_set_content_type() {
|
| 624 |
+
$type = "";
|
| 625 |
+
$content = @$_POST['content_type'];
|
| 626 |
+
if(empty ($content)){
|
| 627 |
+
$type = "postpageindexcategory";
|
| 628 |
+
}else{
|
| 629 |
+
$n = count($content);
|
| 630 |
+
for($i = 0; $i < $n; $i++){
|
| 631 |
+
$type .= $content[$i];
|
| 632 |
+
}
|
| 633 |
+
}
|
| 634 |
+
return $type;
|
| 635 |
+
}
|
| 636 |
+
?>
|
includes/shrsb_sexybookmarks_page.php
ADDED
|
@@ -0,0 +1,206 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* @desc Set default options
|
| 5 |
+
*/
|
| 6 |
+
|
| 7 |
+
$shrsb_plugopts = shrsb_sb_set_options();
|
| 8 |
+
|
| 9 |
+
/*
|
| 10 |
+
* @desc Set the settings either from database or default
|
| 11 |
+
*/
|
| 12 |
+
function shrsb_sb_set_options($action = NULL){
|
| 13 |
+
|
| 14 |
+
/*
|
| 15 |
+
* @desc Most Popular Services List
|
| 16 |
+
* @note To change the most popular list also change the "Most Popular" link click handler in shareaholic-admin.js
|
| 17 |
+
*/
|
| 18 |
+
$shrsb_most_popular = array (
|
| 19 |
+
'shr-facebook',
|
| 20 |
+
'shr-twitter',
|
| 21 |
+
'shr-linkedin',
|
| 22 |
+
'shr-googleplus',
|
| 23 |
+
'shr-googlebookmarks',
|
| 24 |
+
'shr-stumbleupon',
|
| 25 |
+
'shr-fastmail',
|
| 26 |
+
'shr-printfriendly'
|
| 27 |
+
);
|
| 28 |
+
|
| 29 |
+
$defaultLikeButtonOrder = array(
|
| 30 |
+
'shr-fb-like',
|
| 31 |
+
'shr-fb-send',
|
| 32 |
+
'shr-plus-one',
|
| 33 |
+
'shr-tw-button'
|
| 34 |
+
);
|
| 35 |
+
|
| 36 |
+
$shrsb_sb_plugopts_default = array(
|
| 37 |
+
'sexybookmark' => '0',
|
| 38 |
+
'firstrun' => '1',
|
| 39 |
+
'position' => 'below', // below, above, or manual
|
| 40 |
+
'reloption' => 'nofollow', // 'nofollow', or ''
|
| 41 |
+
'targetopt' => '_blank', // 'blank' or 'self'
|
| 42 |
+
'perfoption' => '1', // Third party Content
|
| 43 |
+
'showShareCount' => '1', // fb/twit share count
|
| 44 |
+
'likeButtonSetTop' => '0', // Include like button below the Post Title
|
| 45 |
+
'fbLikeButtonTop' => '0', // Include fb like button
|
| 46 |
+
'fbSendButtonTop' => '0', // Include fb like button
|
| 47 |
+
'googlePlusOneButtonTop' => '0', // Include Google Plus One button
|
| 48 |
+
'tweetButtonTop' => '0', // Include Tweet button
|
| 49 |
+
'likeButtonSetSizeTop' => "1", // Size of like buttons
|
| 50 |
+
'likeButtonSetCountTop' => "true", // Show count with +1 button
|
| 51 |
+
'likeButtonOrderTop' => $defaultLikeButtonOrder,
|
| 52 |
+
'likeButtonSetAlignmentTop' => '0', // Alignment 0 => left, 1 => right
|
| 53 |
+
'likeButtonSetBottom' => '1', // Include like button below the Post
|
| 54 |
+
'fbLikeButtonBottom' => '0', // Include fb like button
|
| 55 |
+
'fbSendButtonBottom' => '0', // Include fb like button
|
| 56 |
+
'googlePlusOneButtonBottom' => '0', // Include Google Plus One button
|
| 57 |
+
'tweetButtonBottom' => '0', // Include Tweet button
|
| 58 |
+
'likeButtonSetSizeBottom' => "1", // Size of like buttons
|
| 59 |
+
'likeButtonSetCountBottom' => "true", // Show count with +1 button
|
| 60 |
+
'likeButtonOrderBottom' => $defaultLikeButtonOrder,
|
| 61 |
+
'likeButtonSetAlignmentBottom' => '0', // Alignment 0 => left, 1 => right
|
| 62 |
+
'locale'=> '0', //Default locale set to 0
|
| 63 |
+
'fbNameSpace' => '1', // Add fb name space to the html
|
| 64 |
+
'preventminify' => '1', // prevent wp_minify from minifying the js
|
| 65 |
+
'shrlink' => '0', // show promo link
|
| 66 |
+
'bgimg-yes' => 'yes', // 'yes' or blank
|
| 67 |
+
'mobile-hide' => '', // 'yes' or blank
|
| 68 |
+
'bgimg' => 'caring', // default bg image
|
| 69 |
+
'shorty' => 'google', // default shortener
|
| 70 |
+
'pageorpost' => 'postpageindexcategory',
|
| 71 |
+
'bookmark' => $shrsb_most_popular ,//array_keys($shrsb_bookmarks_data),
|
| 72 |
+
'feed' => '0', // 1 or 0
|
| 73 |
+
'expand' => '1',
|
| 74 |
+
'autocenter' => '1',
|
| 75 |
+
'tweetconfig' => urlencode('${title} - ${short_link} via @Shareaholic'), // Custom configuration of tweet
|
| 76 |
+
'warn-choice' => '',
|
| 77 |
+
'doNotIncludeJQuery' => '',
|
| 78 |
+
'custom-mods' => '',
|
| 79 |
+
'scriptInFooter' => '',
|
| 80 |
+
'shareaholic-javascript' => '1',
|
| 81 |
+
'shrbase' => 'http://www.shareaholic.com',
|
| 82 |
+
'apikey' => '8afa39428933be41f8afdb8ea21a495c',
|
| 83 |
+
'service' => '',
|
| 84 |
+
'designer_toolTips' => '1',
|
| 85 |
+
'tip_bg_color' => '#000000', // tooltip background color
|
| 86 |
+
'tip_text_color' => '#ffffff', // tooltip text color
|
| 87 |
+
'spritegen_path' => SHRSB_UPLOADDIR_DEFAULT,
|
| 88 |
+
'ogtags' => '1', //Open Graph Tags
|
| 89 |
+
'promo' => '1'
|
| 90 |
+
);
|
| 91 |
+
|
| 92 |
+
//Return default settings
|
| 93 |
+
if($action == "reset"){
|
| 94 |
+
delete_option("SexyBookmarks");
|
| 95 |
+
add_option("SexyBookmarks",$shrsb_sb_plugopts_default);
|
| 96 |
+
return $shrsb_sb_plugopts_default;
|
| 97 |
+
}
|
| 98 |
+
|
| 99 |
+
//Get the settings from the database
|
| 100 |
+
$database_Settings = get_option('SexyBookmarks');
|
| 101 |
+
|
| 102 |
+
|
| 103 |
+
if($database_Settings){//got the settings in the database
|
| 104 |
+
|
| 105 |
+
// Check only when upgrading
|
| 106 |
+
if(SHRSB_UPGRADING) {
|
| 107 |
+
$need_to_update = false;
|
| 108 |
+
|
| 109 |
+
if(!isset($database_Settings['sexybookmark']) ){
|
| 110 |
+
$database_Settings['sexybookmark'] = '1';
|
| 111 |
+
$database_Settings['firstrun'] = '0';
|
| 112 |
+
$need_to_update = true;
|
| 113 |
+
}
|
| 114 |
+
//For first time activation
|
| 115 |
+
update_option("SHR_activate",1);
|
| 116 |
+
|
| 117 |
+
//Check whether all the settings are present or not
|
| 118 |
+
foreach($shrsb_sb_plugopts_default as $k => $v){
|
| 119 |
+
if( !array_key_exists( $k, $database_Settings)) {
|
| 120 |
+
$database_Settings[$k] = $v;
|
| 121 |
+
$need_to_update = true;
|
| 122 |
+
}
|
| 123 |
+
}
|
| 124 |
+
//Check for the tweetbutton in likebutton set
|
| 125 |
+
if(!in_array("shr-tw-button", $database_Settings["likeButtonOrderTop"]) ) array_push($database_Settings["likeButtonOrderTop"],"shr-tw-button");
|
| 126 |
+
if(!in_array("shr-tw-button", $database_Settings["likeButtonOrderBottom"]) ) array_push($database_Settings["likeButtonOrderBottom"],"shr-tw-button");
|
| 127 |
+
|
| 128 |
+
if($need_to_update) update_option("SexyBookmarks",$database_Settings);
|
| 129 |
+
|
| 130 |
+
}
|
| 131 |
+
|
| 132 |
+
return $database_Settings;
|
| 133 |
+
|
| 134 |
+
}else{
|
| 135 |
+
//Add the settings
|
| 136 |
+
add_option('SexyBookmarks',$shrsb_sb_plugopts_default);
|
| 137 |
+
|
| 138 |
+
// Forcing the value for sexybookmark to be 1 for the first run
|
| 139 |
+
$shrsb_sb_plugopts_default['firstrun'] = '1';
|
| 140 |
+
return $shrsb_sb_plugopts_default;
|
| 141 |
+
}
|
| 142 |
+
}
|
| 143 |
+
|
| 144 |
+
|
| 145 |
+
add_option('SHRSB_apikey', $shrsb_plugopts['apikey']);
|
| 146 |
+
add_option('SHRSB_CustomSprite', '');
|
| 147 |
+
add_option('SHRSB_DefaultSprite',true);
|
| 148 |
+
|
| 149 |
+
// If plugin is upgrading
|
| 150 |
+
if(SHRSB_UPGRADING == TRUE) {
|
| 151 |
+
|
| 152 |
+
|
| 153 |
+
//Remove the Disabled Services
|
| 154 |
+
if(isset ($shrsb_plugopts) && isset($shrsb_plugopts['service'])){
|
| 155 |
+
$services = explode(',', $shrsb_plugopts['service']);
|
| 156 |
+
|
| 157 |
+
if(!empty($services)){
|
| 158 |
+
// Removing blocked services from sb services list
|
| 159 |
+
$disable_services = array( '4', '12', '68', '77', '159', '185', '186', '195', '207', '237', '257' );
|
| 160 |
+
$services = array_diff($services, $disable_services);
|
| 161 |
+
$shrsb_plugopts['service'] = implode(',', $services );
|
| 162 |
+
}
|
| 163 |
+
}
|
| 164 |
+
if(isset ($shrsb_plugopts) && isset($shrsb_plugopts['reloption']) && $shrsb_plugopts['reloption'] === "" ){
|
| 165 |
+
$shrsb_plugopts['reloption'] = '1';
|
| 166 |
+
}
|
| 167 |
+
}
|
| 168 |
+
|
| 169 |
+
/*
|
| 170 |
+
* @note Make sure spritegen_path is defined
|
| 171 |
+
*/
|
| 172 |
+
|
| 173 |
+
//Check for POST
|
| 174 |
+
if(isset($_POST['save_changes_sb']) ){
|
| 175 |
+
//Define the default path for Spritegen Directory
|
| 176 |
+
if(isset($_POST['spritegen_path']) && $_POST['spritegen_path'] != SHRSB_UPLOADDIR_DEFAULT){
|
| 177 |
+
//Create the Directory
|
| 178 |
+
$p = shrb_addTrailingChar(stripslashes($_POST['spritegen_path']),"/");
|
| 179 |
+
|
| 180 |
+
define('SHRSB_UPLOADDIR', $p);
|
| 181 |
+
define('SHRSB_UPLOADPATH', shr_dir_to_path($p));
|
| 182 |
+
}else{
|
| 183 |
+
define('SHRSB_UPLOADDIR', SHRSB_UPLOADDIR_DEFAULT);
|
| 184 |
+
define('SHRSB_UPLOADPATH', SHRSB_UPLOADPATH_DEFAULT);
|
| 185 |
+
}
|
| 186 |
+
}else{
|
| 187 |
+
if( isset($_POST['reset_all_options_sb'])|| (isset($shrsb_plugopts['spritegen_path']) && $shrsb_plugopts['spritegen_path'] == SHRSB_UPLOADDIR_DEFAULT) ){
|
| 188 |
+
// For Reseting the data Or First Time Install
|
| 189 |
+
define('SHRSB_UPLOADDIR', SHRSB_UPLOADDIR_DEFAULT);
|
| 190 |
+
define('SHRSB_UPLOADPATH', SHRSB_UPLOADPATH_DEFAULT);
|
| 191 |
+
}else{
|
| 192 |
+
$p = shrb_addTrailingChar(stripslashes($shrsb_plugopts['spritegen_path']),"/");
|
| 193 |
+
define('SHRSB_UPLOADDIR', $p);
|
| 194 |
+
define('SHRSB_UPLOADPATH', shr_dir_to_path($p));
|
| 195 |
+
}
|
| 196 |
+
}
|
| 197 |
+
|
| 198 |
+
$shrsb_plugopts['apikey'] = get_option('SHRSB_apikey');
|
| 199 |
+
$shrsb_custom_sprite = get_option('SHRSB_CustomSprite');
|
| 200 |
+
|
| 201 |
+
// Some databases got corrupted. This will set things in place.
|
| 202 |
+
if($shrsb_plugopts['shrbase'] != 'http://www.shareaholic.com'){
|
| 203 |
+
$shrsb_plugopts['shrbase'] = 'http://www.shareaholic.com';
|
| 204 |
+
}
|
| 205 |
+
|
| 206 |
+
?>
|
includes/shrsb_sexybookmarks_settings_page.php
ADDED
|
@@ -0,0 +1,1066 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
//write settings page
|
| 4 |
+
function shrsb_sb_settings_page() {
|
| 5 |
+
global $shrsb_plugopts, $shrsb_bookmarks_data, $wpdb, $shrsb_custom_sprite,$shrsb_analytics;
|
| 6 |
+
// Add all the global varaible declarations for the $shrsb_plugopts default options e.g.,
|
| 7 |
+
|
| 8 |
+
echo '<div class="wrap""><div class="icon32" id="icon-options-general"><br></div><h2>SexyBookmarks Settings</h2></div>';
|
| 9 |
+
|
| 10 |
+
//Defaults - set if not present
|
| 11 |
+
if (!isset($_POST['reset_all_options_sb'])){$_POST['reset_all_options_sb'] = '1';}
|
| 12 |
+
if (!isset($_POST['shrsbresetallwarn-choice'])){$_POST['shrsbresetallwarn-choice'] = 'no';}
|
| 13 |
+
if (!isset($_POST['custom-mods']) || $shrsb_plugopts['custom-mods'] == ""){$_POST['custom-mods'] = 'no';}
|
| 14 |
+
|
| 15 |
+
if($_POST['reset_all_options_sb'] == '0') {
|
| 16 |
+
echo '
|
| 17 |
+
<div id="shrsbresetallwarn" class="dialog-box-warning" style="float:none;width:97%;">
|
| 18 |
+
<div class="dialog-left fugue f-warn">
|
| 19 |
+
'.__("WARNING: You are about to reset all settings to their default state! Do you wish to continue?", "shrsb").'
|
| 20 |
+
</div>
|
| 21 |
+
<div class="dialog-right">
|
| 22 |
+
<form action="" method="post" id="resetalloptionsaccept">
|
| 23 |
+
<label><input name="shrsbresetallwarn-choice" id="shrsbresetallwarn-yes" type="radio" value="yes" />'.__('Yes', 'shrsb').'</label> <label><input name="shrsbresetallwarn-choice" id="shrsbresetallwarn-cancel" type="radio" value="cancel" />'.__('Cancel', 'shrsb').'</label>
|
| 24 |
+
</form>
|
| 25 |
+
</div>
|
| 26 |
+
</div>';
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
//Reset all options to default settings if user clicks the reset button
|
| 30 |
+
if($_POST['shrsbresetallwarn-choice'] == "yes") { //check for reset button click
|
| 31 |
+
|
| 32 |
+
// Resting the settings
|
| 33 |
+
$shrsb_plugopts = shrsb_sb_set_options('reset');
|
| 34 |
+
|
| 35 |
+
//$shrsb_plugopts['tweetconfig'] = urlencode($shrsb_plugopts['tweetconfig']);
|
| 36 |
+
|
| 37 |
+
if($shrsb_plugopts['preventminify'] == '1') {
|
| 38 |
+
exclude_from_minify_list();
|
| 39 |
+
}
|
| 40 |
+
|
| 41 |
+
/* Short URLs */
|
| 42 |
+
$shrsb_plugopts['shortyapi']['bitly']['user'] = "";
|
| 43 |
+
$shrsb_plugopts['shortyapi']['bitly']['key'] = "";
|
| 44 |
+
$shrsb_plugopts['shortyapi']['awesm']['user'] = "";
|
| 45 |
+
$shrsb_plugopts['shortyapi']['awesm']['key'] = "";
|
| 46 |
+
$shrsb_plugopts['shortyapi']['jmp']['user'] = "";
|
| 47 |
+
$shrsb_plugopts['shortyapi']['jmp']['key'] = "";
|
| 48 |
+
$shrsb_plugopts['shortyapi']['supr']['chk'] = "0";
|
| 49 |
+
$shrsb_plugopts['shortyapi']['supr']['user'] = "";
|
| 50 |
+
$shrsb_plugopts['shortyapi']['supr']['key'] = "";
|
| 51 |
+
/* Short URLs End */
|
| 52 |
+
|
| 53 |
+
update_option('SexyBookmarks', $shrsb_plugopts);
|
| 54 |
+
$shrsb_plugopts['tweetconfig'] = urldecode($shrsb_plugopts['tweetconfig']);
|
| 55 |
+
delete_option('SHRSB_CustomSprite');
|
| 56 |
+
|
| 57 |
+
echo '
|
| 58 |
+
<div id="statmessage" class="shrsb-success">
|
| 59 |
+
<div class="dialog-left fugue f-success">
|
| 60 |
+
'.__('All settings have been reset to their default values.', 'shrsb').'
|
| 61 |
+
</div>
|
| 62 |
+
<div class="dialog-right">
|
| 63 |
+
<img src="'.SHRSB_PLUGPATH.'images/success-delete.jpg" class="del-x" alt=""/>
|
| 64 |
+
</div>
|
| 65 |
+
</div>';
|
| 66 |
+
}
|
| 67 |
+
|
| 68 |
+
// create folders for custom mods
|
| 69 |
+
// then copy original files into new folders
|
| 70 |
+
if($_POST['custom-mods'] == 'yes' || $shrsb_plugopts['custom-mods'] == 'yes') {
|
| 71 |
+
if(is_admin() === true && !is_dir(WP_CONTENT_DIR.'/sexy-mods')) {
|
| 72 |
+
$shrsb_oldloc = SHRSB_PLUGDIR;
|
| 73 |
+
$shrsb_newloc = WP_CONTENT_DIR.'/sexy-mods/';
|
| 74 |
+
|
| 75 |
+
wp_mkdir_p(WP_CONTENT_DIR.'/sexy-mods');
|
| 76 |
+
wp_mkdir_p(WP_CONTENT_DIR.'/sexy-mods/css');
|
| 77 |
+
wp_mkdir_p(WP_CONTENT_DIR.'/sexy-mods/images');
|
| 78 |
+
wp_mkdir_p(WP_CONTENT_DIR.'/sexy-mods/js');
|
| 79 |
+
|
| 80 |
+
copy($shrsb_oldloc.'css/style.dev.css', $shrsb_newloc.'css/style.css');
|
| 81 |
+
copy($shrsb_oldloc.'js/sexy-bookmarks-public.js', $shrsb_newloc.'js/sexy-bookmarks-public.js');
|
| 82 |
+
copy($shrsb_oldloc.'images/shr-sprite.png', $shrsb_newloc.'images/shr-sprite.png');
|
| 83 |
+
copy($shrsb_oldloc.'images/share-enjoy.png', $shrsb_newloc.'images/share-enjoy.png');
|
| 84 |
+
copy($shrsb_oldloc.'images/share-german.png', $shrsb_newloc.'images/share-german.png');
|
| 85 |
+
copy($shrsb_oldloc.'images/share-love-hearts.png', $shrsb_newloc.'images/share-love-hearts.png');
|
| 86 |
+
copy($shrsb_oldloc.'images/share-wealth.png', $shrsb_newloc.'images/share-wealth.png');
|
| 87 |
+
copy($shrsb_oldloc.'images/sharing-caring-hearts.png', $shrsb_newloc.'images/sharing-caring-hearts.png');
|
| 88 |
+
copy($shrsb_oldloc.'images/sharing-caring.png', $shrsb_newloc.'images/sharing-caring.png');
|
| 89 |
+
copy($shrsb_oldloc.'images/sharing-shr.png', $shrsb_newloc.'images/sharing-shr.png');
|
| 90 |
+
}
|
| 91 |
+
}
|
| 92 |
+
|
| 93 |
+
// processing form submission
|
| 94 |
+
$status_message = "";
|
| 95 |
+
$error_message = "";
|
| 96 |
+
if(isset($_POST['save_changes_sb'])) {
|
| 97 |
+
|
| 98 |
+
if(isset($_POST['bookmark']['shr-fleck'])) {
|
| 99 |
+
unset($_POST['bookmark']['shr-fleck']);
|
| 100 |
+
}
|
| 101 |
+
$_POST['pageorpost'] = shrsb_set_content_type();
|
| 102 |
+
// Set success message
|
| 103 |
+
$status_message = __('Your changes have been saved successfully!', 'shrsb');
|
| 104 |
+
|
| 105 |
+
$errmsgmap = array(
|
| 106 |
+
'position'=>__('Please choose where you would like the menu to be displayed.', 'shrsb'),
|
| 107 |
+
'bookmark'=>__("You can't display the menu if you don't choose a few sites to add to it!", 'shrsb'),
|
| 108 |
+
'pageorpost'=>__('Please choose where you want the menu displayed.', 'shrsb'),
|
| 109 |
+
);
|
| 110 |
+
foreach ($errmsgmap as $field=>$msg) {
|
| 111 |
+
if ($_POST[$field] == '') {
|
| 112 |
+
$error_message = $msg;
|
| 113 |
+
break;
|
| 114 |
+
}
|
| 115 |
+
}
|
| 116 |
+
// Twitter friendly Links & YOURLs Plugins: check to see if they have the plugin activated
|
| 117 |
+
if ($_POST['shorty'] == 'tflp' && !function_exists('permalink_to_twitter_link')) {
|
| 118 |
+
$error_message = sprintf(__('You must first download and activate the %sTwitter Friendly Links Plugin%s before hosting your own short URLs...', 'shrsb'), '<a href="http://wordpress.org/extend/plugins/twitter-friendly-links/">', '</a>');
|
| 119 |
+
} elseif ($_POST['shorty'] == 'yourls' && !function_exists('wp_ozh_yourls_raw_url')) {
|
| 120 |
+
$error_message = sprintf(__('You must first download and activate the %sYOURLS Plugin%s before hosting your own short URLs...', 'shrsb'), '<a href="http://wordpress.org/extend/plugins/yourls-wordpress-to-twitter/">', '</a>');
|
| 121 |
+
}
|
| 122 |
+
|
| 123 |
+
if ( isset($_POST['bookmark']) && is_array($_POST['bookmark']) && sizeof($_POST['bookmark']) > 0 && $shrsb_plugopts['shareaholic-javascript'] == '1') {
|
| 124 |
+
$service_ids = array();
|
| 125 |
+
foreach ( $_POST['bookmark'] as $bm ) {
|
| 126 |
+
if ($this_id = $shrsb_bookmarks_data[$bm]['id']) {
|
| 127 |
+
$service_ids[] = $this_id;
|
| 128 |
+
}
|
| 129 |
+
}
|
| 130 |
+
$shrsb_plugopts['service'] = implode(',', $service_ids);
|
| 131 |
+
shrsb_refresh_cache();
|
| 132 |
+
_shrsb_copy_file(SHRSB_UPLOADDIR.'index.html', SHRSB_PLUGDIR.'spritegen_default/index.html');
|
| 133 |
+
_shrsb_copy_file(SHRSB_UPLOADDIR.'spritegen/index.html', SHRSB_PLUGDIR.'spritegen_default/index.html');
|
| 134 |
+
|
| 135 |
+
}
|
| 136 |
+
|
| 137 |
+
if (!$error_message) {
|
| 138 |
+
//generate a new sprite, to reduce the size of the image
|
| 139 |
+
if(shrsb_preFlight_Checks()) {
|
| 140 |
+
if ( isset($_POST['bookmark']) && is_array($_POST['bookmark']) and sizeof($_POST['bookmark']) > 0 ) {
|
| 141 |
+
$spritegen_opts = '&service=';
|
| 142 |
+
foreach ( $_POST['bookmark'] as $bm ) {
|
| 143 |
+
$spritegen_opts .= substr($bm, 4) . ',';
|
| 144 |
+
}
|
| 145 |
+
$spritegen_opts = substr($spritegen_opts,0,-1);
|
| 146 |
+
$spritegen_opts .= '&bgimg=' . $_POST['bgimg'] . '&expand=' . $_POST['expand'];
|
| 147 |
+
$save_return[0] = get_sprite_file($spritegen_opts, 'png');
|
| 148 |
+
$save_return[1] = get_sprite_file($spritegen_opts, 'css');
|
| 149 |
+
}
|
| 150 |
+
if($save_return[0] == 2 || $save_return[1] == 2) {
|
| 151 |
+
echo '<div id="warnmessage" class="shrsb-warning"><div class="dialog-left fugue f-warn">'.__('WARNING: The request for a custom sprite has timed out. Reverting to default sprite files.', 'shrsb').'</div><div class="dialog-right"><img src="'.SHRSB_PLUGPATH.'images/warning-delete.jpg" class="del-x" alt=""/></div></div><div style="clear:both;"></div>';
|
| 152 |
+
$shrsb_custom_sprite = '';
|
| 153 |
+
$status_message = __('Changes saved successfully. However, you should try to generate a custom sprite again later.', 'shrsb');
|
| 154 |
+
}
|
| 155 |
+
elseif($save_return[0] == 1 || $save_return[1] == 1) {
|
| 156 |
+
if (!is_writable(SHRSB_UPLOADDIR.'spritegen')) {
|
| 157 |
+
echo '<div id="warnmessage" class="shrsb-warning"><div class="dialog-left fugue f-warn">'.sprintf(__('WARNING: Your %sspritegen folder%s is not writeable by the server! %sNeed Help?%s', 'shrsb'), '<a href="'.SHRSB_UPLOADPATH.'spritegen" target="_blank">','</a>','<a href="http://www.shareaholic.com/tools/wordpress/usage-installation#chmodinfo" target="_blank">', '</a>').'</div><div class="dialog-right"><img src="'.SHRSB_PLUGPATH.'images/warning-delete.jpg" class="del-x" alt=""/></div></div><div style="clear:both;"></div>';
|
| 158 |
+
$shrsb_custom_sprite = '';
|
| 159 |
+
$status_message = __('Changes saved successfully. However, settings are not optimal until you resolve the issue listed above.', 'shrsb');
|
| 160 |
+
}
|
| 161 |
+
elseif(file_exists(SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.png') && is_writable(SHRSB_UPLOADDIR.'spritegen') && !is_writable(SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.png')) {
|
| 162 |
+
echo '<div id="warnmessage" class="shrsb-warning"><div class="dialog-left fugue f-warn">'.sprintf(__('WARNING: You need to delete the current custom sprite %s before the plugin can write to the folder. %sNeed Help?%s', 'shrsb'), '(<a href="'.SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.png" target="_blank">'.SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.png</a>)','<a href="http://www.shareaholic.com/tools/wordpress/usage-installation#chmodinfo" target="_blank">', '</a>').'</div><div class="dialog-right"><img src="'.SHRSB_PLUGPATH.'images/warning-delete.jpg" class="del-x" alt=""/></div></div><div style="clear:both;"></div>';
|
| 163 |
+
$shrsb_custom_sprite = '';
|
| 164 |
+
$status_message = __('Changes saved successfully. However, settings are not optimal until you resolve the issue listed above.', 'shrsb');
|
| 165 |
+
}
|
| 166 |
+
elseif(file_exists(SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.css') && is_writable(SHRSB_UPLOADDIR.'spritegen') && !is_writable(SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.css')) {
|
| 167 |
+
echo '<div id="warnmessage" class="shrsb-warning"><div class="dialog-left fugue f-warn">'.sprintf(__('WARNING: You need to delete the current custom stylesheet %s before the plugin can write to the folder. %sNeed Help?%s', 'shrsb'), '(<a href="'.SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.css" target="_blank">'.SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.css</a>)','<a href="http://www.shareaholic.com/tools/wordpress/usage-installation#chmodinfo" target="_blank">', '</a>').'</div><div class="dialog-right"><img src="'.SHRSB_PLUGPATH.'images/warning-delete.jpg" class="del-x" alt=""/></div></div><div style="clear:both;"></div>';
|
| 168 |
+
$shrsb_custom_sprite = '';
|
| 169 |
+
$status_message = __('Changes saved successfully. However, settings are not optimal until you resolve the issue listed above.', 'shrsb');
|
| 170 |
+
}
|
| 171 |
+
}
|
| 172 |
+
else {
|
| 173 |
+
$shrsb_custom_sprite = SHRSB_UPLOADPATH.'spritegen/shr-custom-sprite.css';
|
| 174 |
+
}
|
| 175 |
+
}
|
| 176 |
+
else{
|
| 177 |
+
if (!is_writable(SHRSB_UPLOADDIR.'spritegen')) {
|
| 178 |
+
echo '<div id="warnmessage" class="shrsb-warning"><div class="dialog-left fugue f-warn">'.sprintf(__('WARNING: Your %sspritegen folder%s is not writeable by the server! %sNeed Help?%s', 'shrsb'), '<a href="'.SHRSB_UPLOADPATH.'spritegen" target="_blank">','</a>','<a href="http://www.shareaholic.com/tools/wordpress/usage-installation#chmodinfo" target="_blank">', '</a>').'</div><div class="dialog-right"><img src="'.SHRSB_PLUGPATH.'images/warning-delete.jpg" class="del-x" alt=""/></div></div><div style="clear:both;"></div>';
|
| 179 |
+
$status_message = __('Changes saved successfully. However, settings are not optimal until you resolve the issue listed above.', 'shrsb');
|
| 180 |
+
}
|
| 181 |
+
elseif(file_exists(SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.png') && is_writable(SHRSB_UPLOADDIR.'spritegen') && !is_writable(SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.png')) {
|
| 182 |
+
echo '<div id="warnmessage" class="shrsb-warning"><div class="dialog-left fugue f-warn">'.sprintf(__('WARNING: You need to delete the current custom sprite %s before the plugin can write to the folder. %sNeed Help?%s', 'shrsb'), '(<a href="'.SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.png" target="_blank">'.SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.png</a>)','<a href="http://www.shareaholic.com/tools/wordpress/usage-installation#chmodinfo" target="_blank">', '</a>').'</div><div class="dialog-right"><img src="'.SHRSB_PLUGPATH.'images/warning-delete.jpg" class="del-x" alt=""/></div></div><div style="clear:both;"></div>';
|
| 183 |
+
$status_message = __('Changes saved successfully. However, settings are not optimal until you resolve the issue listed above.', 'shrsb');
|
| 184 |
+
}
|
| 185 |
+
elseif(file_exists(SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.css') && is_writable(SHRSB_UPLOADDIR.'spritegen') && !is_writable(SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.css')) {
|
| 186 |
+
echo '<div id="warnmessage" class="shrsb-warning"><div class="dialog-left fugue f-warn">'.sprintf(__('WARNING: You need to delete the current custom stylesheet %s before the plugin can write to the folder. %sNeed Help?%s', 'shrsb'), '(<a href="'.SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.css" target="_blank">'.SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.css</a>)','<a href="http://www.shareaholic.com/tools/wordpress/usage-installation#chmodinfo" target="_blank">', '</a>').'</div><div class="dialog-right"><img src="'.SHRSB_PLUGPATH.'images/warning-delete.jpg" class="del-x" alt=""/></div></div><div style="clear:both;"></div>';
|
| 187 |
+
$status_message = __('Changes saved successfully. However, settings are not optimal until you resolve the issue listed above.', 'shrsb');
|
| 188 |
+
}
|
| 189 |
+
}
|
| 190 |
+
|
| 191 |
+
foreach (array(
|
| 192 |
+
|
| 193 |
+
'sexybookmark',
|
| 194 |
+
|
| 195 |
+
'position', 'reloption', 'targetopt', 'bookmark',
|
| 196 |
+
'shorty', 'pageorpost', 'tweetconfig', 'bgimg-yes', 'mobile-hide', 'bgimg',
|
| 197 |
+
'feed', 'expand', 'doNotIncludeJQuery', 'autocenter', 'custom-mods',
|
| 198 |
+
'scriptInFooter', 'shareaholic-javascript', 'shrbase', 'showShareCount',
|
| 199 |
+
'likeButtonSetTop','fbLikeButtonTop','fbSendButtonTop','googlePlusOneButtonTop','tweetButtonTop','likeButtonSetSizeTop','likeButtonSetCountTop',
|
| 200 |
+
'likeButtonOrderTop','likeButtonSetAlignmentTop',
|
| 201 |
+
'likeButtonSetBottom','fbLikeButtonBottom','fbSendButtonBottom','googlePlusOneButtonBottom','tweetButtonBottom','likeButtonSetSizeBottom','likeButtonSetCountBottom',
|
| 202 |
+
'likeButtonOrderBottom','likeButtonSetAlignmentBottom','locale',
|
| 203 |
+
|
| 204 |
+
'fbNameSpace','designer_toolTips' , 'tip_bg_color',
|
| 205 |
+
'tip_text_color' , 'preventminify', 'shrlink', 'perfoption','spritegen_path', 'apikey','ogtags' , 'promo'
|
| 206 |
+
)as $field) {
|
| 207 |
+
if(isset($_POST[$field])) { // this is to prevent warning if $_POST[$field] is not defined
|
| 208 |
+
$shrsb_plugopts[$field] = $_POST[$field];
|
| 209 |
+
} else {
|
| 210 |
+
$shrsb_plugopts[$field] = NULL;
|
| 211 |
+
}
|
| 212 |
+
}
|
| 213 |
+
|
| 214 |
+
/*
|
| 215 |
+
* @note WordPress autoescapes (= adds slashes) to all post data. This is a workaround for that.
|
| 216 |
+
*/
|
| 217 |
+
|
| 218 |
+
$shrsb_plugopts['tweetconfig'] = stripslashes($shrsb_plugopts['tweetconfig']);
|
| 219 |
+
$shrsb_plugopts['spritegen_path'] = shrb_addTrailingChar(stripslashes($shrsb_plugopts['spritegen_path']),'/');
|
| 220 |
+
|
| 221 |
+
/* Short URLs */
|
| 222 |
+
//trim also at the same time as at times while copying, some whitespace also gets copied
|
| 223 |
+
//check fields dont need trim function
|
| 224 |
+
|
| 225 |
+
$shrsb_plugopts['shortyapi']['bitly']['user'] = trim(htmlspecialchars($_POST['shortyapiuser-bitly'], ENT_QUOTES));
|
| 226 |
+
$shrsb_plugopts['shortyapi']['bitly']['key'] = trim(htmlspecialchars($_POST['shortyapikey-bitly'], ENT_QUOTES));
|
| 227 |
+
$shrsb_plugopts['shortyapi']['awesm']['user'] = trim(htmlspecialchars($_POST['shortyapiuser-awesm'], ENT_QUOTES));
|
| 228 |
+
$shrsb_plugopts['shortyapi']['awesm']['key'] = trim(htmlspecialchars($_POST['shortyapikey-awesm'], ENT_QUOTES));
|
| 229 |
+
$shrsb_plugopts['shortyapi']['jmp']['user'] = trim(htmlspecialchars($_POST['shortyapiuser-jmp'], ENT_QUOTES));
|
| 230 |
+
$shrsb_plugopts['shortyapi']['jmp']['key'] = trim(htmlspecialchars($_POST['shortyapikey-jmp'], ENT_QUOTES));
|
| 231 |
+
$shrsb_plugopts['shortyapi']['supr']['chk'] = htmlspecialchars($_POST['shortyapichk-supr'][0], ENT_QUOTES);
|
| 232 |
+
$shrsb_plugopts['shortyapi']['supr']['user'] = trim(htmlspecialchars($_POST['shortyapiuser-supr'], ENT_QUOTES));
|
| 233 |
+
$shrsb_plugopts['shortyapi']['supr']['key'] = trim(htmlspecialchars($_POST['shortyapikey-supr'], ENT_QUOTES));
|
| 234 |
+
|
| 235 |
+
/* Short URLs End */
|
| 236 |
+
|
| 237 |
+
$shrsb_plugopts['tweetconfig'] = urlencode($shrsb_plugopts['tweetconfig']);
|
| 238 |
+
if($shrsb_plugopts['preventminify'] == '1') {
|
| 239 |
+
exclude_from_minify_list();
|
| 240 |
+
}
|
| 241 |
+
$shrsb_plugopts['firstrun'] = '0';
|
| 242 |
+
update_option('SexyBookmarks', $shrsb_plugopts);
|
| 243 |
+
$shrsb_plugopts['tweetconfig'] = urldecode($shrsb_plugopts['tweetconfig']);
|
| 244 |
+
|
| 245 |
+
update_option('SHRSB_CustomSprite', $shrsb_custom_sprite);
|
| 246 |
+
update_option('SHRSBvNum', SHRSB_vNum);
|
| 247 |
+
}
|
| 248 |
+
}//Closed Save
|
| 249 |
+
|
| 250 |
+
//if there was an error, construct error messages
|
| 251 |
+
if ($error_message != '') {
|
| 252 |
+
echo '
|
| 253 |
+
<div id="errmessage" class="shrsb-error">
|
| 254 |
+
<div class="dialog-left fugue f-error">
|
| 255 |
+
'.$error_message.'
|
| 256 |
+
</div>
|
| 257 |
+
<div class="dialog-right">
|
| 258 |
+
<img src="'.SHRSB_PLUGPATH.'images/error-delete.jpg" class="del-x" alt=""/>
|
| 259 |
+
</div>
|
| 260 |
+
</div>';
|
| 261 |
+
} elseif ($status_message != '') {
|
| 262 |
+
echo '<style type="text/css">#update_sb{display:none !important;}</style>
|
| 263 |
+
<div id="statmessage" class="shrsb-success">
|
| 264 |
+
<div class="dialog-left fugue f-success">
|
| 265 |
+
'.$status_message.'
|
| 266 |
+
</div>
|
| 267 |
+
<div class="dialog-right">
|
| 268 |
+
<img src="'.SHRSB_PLUGPATH.'images/success-delete.jpg" class="del-x" alt=""/>
|
| 269 |
+
</div>
|
| 270 |
+
</div>';
|
| 271 |
+
}
|
| 272 |
+
|
| 273 |
+
$parse = parse_url(get_bloginfo('url'));
|
| 274 |
+
?>
|
| 275 |
+
|
| 276 |
+
<form name="sexy-bookmarks" id="sexy-bookmarks" action="" method="post">
|
| 277 |
+
<div id="shrsb-col-left">
|
| 278 |
+
<ul id="shrsb-sortables">
|
| 279 |
+
|
| 280 |
+
<!--
|
| 281 |
+
<?php
|
| 282 |
+
$resave_required = shrsb_requires_resave();
|
| 283 |
+
$chmod_required = shrsb_requires_chmod($shrsb_plugopts['shareaholic-javascript']);
|
| 284 |
+
$phpupdate_required = shrsb_requires_phpupdate();
|
| 285 |
+
?>
|
| 286 |
+
-->
|
| 287 |
+
|
| 288 |
+
<li id="third-party-modal" class="">
|
| 289 |
+
<a name="3rdpartyservices"></a>
|
| 290 |
+
<div class="box-mid-head">
|
| 291 |
+
<h2 class="fugue f-wrench"><?php _e('Status', 'shrsb'); ?></h2>
|
| 292 |
+
|
| 293 |
+
</div>
|
| 294 |
+
<div class="box-mid-body" id="toggle2">
|
| 295 |
+
<div class="padding">
|
| 296 |
+
<div id="plugin_health">
|
| 297 |
+
<table>
|
| 298 |
+
<tbody>
|
| 299 |
+
<tr>
|
| 300 |
+
<td style="width: 22px;"><img class="shrsb_health_icon" src=
|
| 301 |
+
<?php
|
| 302 |
+
$color = $chmod_required ? "red":"green";
|
| 303 |
+
echo SHRSB_PLUGPATH."images/circle_$color.png";
|
| 304 |
+
?>
|
| 305 |
+
></td>
|
| 306 |
+
<td style="min-width: 240px;"><span class=""><?php _e('Directory Permissions', 'shrsb'); ?></span></td>
|
| 307 |
+
<td>
|
| 308 |
+
<?php
|
| 309 |
+
echo $chmod_required ? sprintf(__('To Fix: Please appropriately
|
| 310 |
+
%sCHMOD%s your /spritegen directory.', 'shrsb'),
|
| 311 |
+
'<a href="http://www.shareaholic.com/tools/wordpress/usage-installation#chmodinfo"
|
| 312 |
+
target = "_blank" style="color:#ca0c01">', '</a>') : "";
|
| 313 |
+
?>
|
| 314 |
+
</td>
|
| 315 |
+
</tr>
|
| 316 |
+
|
| 317 |
+
<tr>
|
| 318 |
+
<td class="" style="width: 22px;"><img class="shrsb_health_icon" src=
|
| 319 |
+
<?php
|
| 320 |
+
$color = $resave_required ? "yellow":"green";
|
| 321 |
+
echo SHRSB_PLUGPATH."images/circle_$color.png";
|
| 322 |
+
?>
|
| 323 |
+
></td>
|
| 324 |
+
<td><span class=""><?php _e('Load Time Optimized', 'shrsb'); ?></span></td>
|
| 325 |
+
<td><?php
|
| 326 |
+
echo $resave_required ? "To Fix: Simply re-save your SB settings." : "";
|
| 327 |
+
?>
|
| 328 |
+
</td>
|
| 329 |
+
</tr>
|
| 330 |
+
|
| 331 |
+
<tr>
|
| 332 |
+
<td class="" style="width: 22px;"><img class="shrsb_health_icon" src=
|
| 333 |
+
<?php
|
| 334 |
+
$color = $phpupdate_required ? "red":"green";
|
| 335 |
+
echo SHRSB_PLUGPATH."images/circle_$color.png";
|
| 336 |
+
?>
|
| 337 |
+
></td>
|
| 338 |
+
<td><span class=""><?php _e('Running PHP5+', 'shrsb'); ?></span></td>
|
| 339 |
+
<td>
|
| 340 |
+
<?php
|
| 341 |
+
echo $phpupdate_required ? 'To Fix: Upgrade to PHP 5 or higher.' : "" ;
|
| 342 |
+
?>
|
| 343 |
+
</td>
|
| 344 |
+
</tr>
|
| 345 |
+
|
| 346 |
+
</tbody>
|
| 347 |
+
</table>
|
| 348 |
+
</div>
|
| 349 |
+
<div id="genopts">
|
| 350 |
+
<table><tbody>
|
| 351 |
+
<tr class="alert-success">
|
| 352 |
+
<td><span class="shrsb_option"><?php _e('Enable the Sexybookmarks Sharing Bar?', 'shrsb'); ?> </span>
|
| 353 |
+
</td>
|
| 354 |
+
<td><label><input <?php echo (( @$shrsb_plugopts['firstrun'] == '1' || @$shrsb_plugopts['sexybookmark'] == "1") ? 'checked="checked"' : ""); ?> name="sexybookmark" id="sexybookmark-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 355 |
+
</td><td><label><input <?php echo (( @$shrsb_plugopts['firstrun'] !== '1' && $shrsb_plugopts['sexybookmark'] == "0")? 'checked="checked"' : ""); ?> name="sexybookmark" id="sexybookmark-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 356 |
+
</td>
|
| 357 |
+
</tr>
|
| 358 |
+
|
| 359 |
+
<tr>
|
| 360 |
+
<td><span class="shrsb_option"> <?php _e('Use "new mode"?') ?></span>
|
| 361 |
+
</td>
|
| 362 |
+
<td><label><input <?php echo (($shrsb_plugopts['shareaholic-javascript'] == "1")? 'checked="checked"' : ""); ?> name="shareaholic-javascript" id="shareaholic-javascript-1" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?> (recommended)</label></td>
|
| 363 |
+
<td><label><input <?php echo (($shrsb_plugopts['shareaholic-javascript'] != "1")? 'checked="checked"' : ""); ?> name="shareaholic-javascript" id="shareaholic-javascript-0" type="radio" value="" /> <?php _e('No', 'shrsb'); ?></label>
|
| 364 |
+
</td>
|
| 365 |
+
</tr>
|
| 366 |
+
|
| 367 |
+
<tr>
|
| 368 |
+
<td><span class="shrsb_option" style="padding-bottom: 10px"><?php _e('Enable 3rd Party Services to use the following features:', 'shrsb'); ?></span></td>
|
| 369 |
+
<td><label><input <?php echo (($shrsb_plugopts['perfoption'] == "1")? 'checked="checked"' : ""); ?> name="perfoption" id="perfoption-yes" type="radio" value="1" /> <?php _e('Yes (recommended)', 'shrsb'); ?></label></td>
|
| 370 |
+
<td><label><input <?php echo (($shrsb_plugopts['perfoption'] == "0")? 'checked="checked"' : ""); ?> name="perfoption" id="perfoption-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label></td>
|
| 371 |
+
</tr>
|
| 372 |
+
<tr>
|
| 373 |
+
<td><span class="tab" style="display:block; font-size: 11px; color: #666666;"><?php _e('Facebook, Twitter, LinkedIn and Delicious Share Counters', 'shrsb'); ?></span></td>
|
| 374 |
+
<td><div class="icon-ok"></div></td>
|
| 375 |
+
<td><div class="icon-remove"></div></td>
|
| 376 |
+
<td><a href="#functionality"> Configure </a></td>
|
| 377 |
+
</tr>
|
| 378 |
+
|
| 379 |
+
<!-- <tr>
|
| 380 |
+
<td><span class="tab" style="display:block; font-size: 11px; color: #666666;"><?php _e('Facebook Like & Send, Google +1 buttons', 'shrsb'); ?></span></td>
|
| 381 |
+
<td><div class="icon-ok"></div></td>
|
| 382 |
+
<td><div class="icon-remove"></div></td>
|
| 383 |
+
<td><a href="#likebuttonset">Configure</a></td>
|
| 384 |
+
</tr>-->
|
| 385 |
+
|
| 386 |
+
<tr>
|
| 387 |
+
<td><span class="tab" style="display:block; font-size: 11px; color: #666666;"><?php _e('Shareaholic Social Analytics', 'shrsb'); ?></span></td>
|
| 388 |
+
<td><div class="icon-ok"></div></td>
|
| 389 |
+
<td><div class="icon-remove"></div></td>
|
| 390 |
+
<td><a target="_blank" href="http://www.shareaholic.com/publishers/analytics/<?= $parse['host']?>">Preview</a></td>
|
| 391 |
+
</tr>
|
| 392 |
+
|
| 393 |
+
<tr>
|
| 394 |
+
<td><span class="tab" style="display:block; font-size: 11px; color: #666666;"><?php _e('Google Analytics Social Tracking', 'shrsb'); ?></span></td>
|
| 395 |
+
<td><div class="icon-ok"></div></td>
|
| 396 |
+
<td><div class="icon-remove"></div></td>
|
| 397 |
+
<td><a href="./admin.php?page=shareaholic_analytics.php">Configure</a></td>
|
| 398 |
+
</tr>
|
| 399 |
+
|
| 400 |
+
</tbody></table>
|
| 401 |
+
</div>
|
| 402 |
+
</div>
|
| 403 |
+
</div>
|
| 404 |
+
</li>
|
| 405 |
+
|
| 406 |
+
<li>
|
| 407 |
+
<div class="box-mid-head" id="iconator">
|
| 408 |
+
<h2 class="fugue f-globe-plus"><?php _e('Enabled Networks', 'shrsb'); ?></h2>
|
| 409 |
+
</div>
|
| 410 |
+
<div class="box-mid-body iconator" id="toggle1">
|
| 411 |
+
<div class="padding">
|
| 412 |
+
<p><?php _e('Select the Networks to display. Drag to reorder.', 'shrsb'); ?></p>
|
| 413 |
+
<ul class="multi-selection">
|
| 414 |
+
<li><?php _e('Select', 'shrsb'); ?>: </li>
|
| 415 |
+
<li><a id="sel-all" href="javascript:void(0);"><?php _e('All', 'shrsb'); ?></a> | </li>
|
| 416 |
+
<li><a id="sel-none" href="javascript:void(0);"><?php _e('None', 'shrsb'); ?></a> | </li>
|
| 417 |
+
<li><a id="sel-pop" href="javascript:void(0);"><?php _e('Most Popular', 'shrsb'); ?></a> </li>
|
| 418 |
+
</ul>
|
| 419 |
+
<div id="shrsb-networks"><ul>
|
| 420 |
+
<?php
|
| 421 |
+
foreach ($shrsb_plugopts['bookmark'] as $name){if(array_key_exists($name, $shrsb_bookmarks_data)) {print shrsb_network_input_select($name, $shrsb_bookmarks_data[$name]['id'], $shrsb_bookmarks_data[$name]['check']);}}
|
| 422 |
+
$unused_networks=array_diff(array_keys($shrsb_bookmarks_data), $shrsb_plugopts['bookmark']);
|
| 423 |
+
foreach ($unused_networks as $name) print shrsb_network_input_select($name, $shrsb_bookmarks_data[$name]['id'], $shrsb_bookmarks_data[$name]['check']);
|
| 424 |
+
?>
|
| 425 |
+
</ul></div>
|
| 426 |
+
</div>
|
| 427 |
+
<div style="padding:10px; float:right;color:#999999;"><?php _e('Made with Much Love, these Icons are © Shareaholic', 'shrsb'); ?></div>
|
| 428 |
+
</div>
|
| 429 |
+
</li>
|
| 430 |
+
|
| 431 |
+
|
| 432 |
+
<li>
|
| 433 |
+
<div class="box-mid-head">
|
| 434 |
+
<h2 class="fugue f-globe-plus"><?php _e('Additional Buttons', 'shrsb'); ?> <span style="color:orange;">* <?php _e('switch on "new mode" above to enable these exclusive features', 'shrsb'); ?></span></h2>
|
| 435 |
+
<a name="likebuttonset"></a>
|
| 436 |
+
</div>
|
| 437 |
+
<div class="box-mid-body" id="toggle2">
|
| 438 |
+
<div class="padding">
|
| 439 |
+
<div id="genopts">
|
| 440 |
+
|
| 441 |
+
<table><tbody>
|
| 442 |
+
<tr>
|
| 443 |
+
<td><span class="shrsb_option"><?php _e('Include Open Graph Meta Tags?', 'shrsb'); ?></span>
|
| 444 |
+
</td>
|
| 445 |
+
<td style="width:125px"><label><input <?php echo (($shrsb_plugopts['ogtags'] == "1")? 'checked="checked"' : ""); ?> name="ogtags" id="ogtags-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 446 |
+
</td><td><label><input <?php echo (($shrsb_plugopts['ogtags'] == "0")? 'checked="checked"' : ""); ?> name="ogtags" id="ogtags-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 447 |
+
</td>
|
| 448 |
+
</tr>
|
| 449 |
+
<tr>
|
| 450 |
+
<td><span class="shrsb_option"><?php _e('Include the like button-set just above the post?', 'shrsb'); ?></span>
|
| 451 |
+
</td>
|
| 452 |
+
<td style="width:125px"><label><input <?php echo (($shrsb_plugopts['likeButtonSetTop'] == "1")? 'checked="checked"' : ""); ?> name="likeButtonSetTop" id="likeButtonSetTop-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 453 |
+
</td><td><label><input <?php echo (($shrsb_plugopts['likeButtonSetTop'] == "0")? 'checked="checked"' : ""); ?> name="likeButtonSetTop" id="likeButtonSetTop-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 454 |
+
</td>
|
| 455 |
+
</tr>
|
| 456 |
+
</tbody></table>
|
| 457 |
+
|
| 458 |
+
<?php
|
| 459 |
+
shrsb_likeButtonSetHTML($shrsb_plugopts,'Top');
|
| 460 |
+
?>
|
| 461 |
+
|
| 462 |
+
<table><tbody>
|
| 463 |
+
|
| 464 |
+
<tr>
|
| 465 |
+
<td><span class="shrsb_option"><?php _e('Include the like button-set below the post?', 'shrsb'); ?></span>
|
| 466 |
+
</td>
|
| 467 |
+
<td style="width:125px"><label><input <?php echo (($shrsb_plugopts['likeButtonSetBottom'] == "1")? 'checked="checked"' : ""); ?> name="likeButtonSetBottom" id="likeButtonSetBottom-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 468 |
+
</td><td><label><input <?php echo (($shrsb_plugopts['likeButtonSetBottom'] == "0")? 'checked="checked"' : ""); ?> name="likeButtonSetBottom" id="likeButtonSetBottom-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 469 |
+
</td>
|
| 470 |
+
</tr>
|
| 471 |
+
<?php
|
| 472 |
+
shrsb_likeButtonSetHTML($shrsb_plugopts,'Bottom');
|
| 473 |
+
?>
|
| 474 |
+
|
| 475 |
+
</tbody></table>
|
| 476 |
+
|
| 477 |
+
<br />
|
| 478 |
+
|
| 479 |
+
<span style="display:block;"><?php echo sprintf(__('Check out %sour blog%s for additional customization options.', 'shrsb'), '<a target="_blank" href="http://blog.shareaholic.com/?p=1917">', '</a>'); ?></span>
|
| 480 |
+
</div>
|
| 481 |
+
</div>
|
| 482 |
+
</div>
|
| 483 |
+
|
| 484 |
+
</li>
|
| 485 |
+
|
| 486 |
+
<li>
|
| 487 |
+
<div class="box-mid-head">
|
| 488 |
+
<h2 class="fugue f-wrench"><?php _e('Functionality Settings', 'shrsb'); ?></h2>
|
| 489 |
+
<a name="functionality"></a>
|
| 490 |
+
</div>
|
| 491 |
+
<div class="box-mid-body" id="toggle2">
|
| 492 |
+
<div class="padding">
|
| 493 |
+
<div id="genopts">
|
| 494 |
+
<table><tbody>
|
| 495 |
+
<tr>
|
| 496 |
+
<td><span class="shrsb_option"><?php _e('Show Share Counters', 'shrsb'); ?> <span style="color:orange;">*</span><sup style="color:#08C;"> #</sup></span>
|
| 497 |
+
<span style="display:block; font-size: 11px; color: #666666;"><?php _e('For Facebook, LinkedIn, Twitter and Delicious', 'shrsb'); ?></span>
|
| 498 |
+
</td>
|
| 499 |
+
<td><label><input <?php echo (($shrsb_plugopts['showShareCount'] == "1")? 'checked="checked"' : ""); ?> name="showShareCount" id="showShareCount-yes" type="radio" value="1" /> <?php _e('Yes (recommended)', 'shrsb'); ?></label>
|
| 500 |
+
</td><td><label><input <?php echo (($shrsb_plugopts['showShareCount'] == "0")? 'checked="checked"' : ""); ?> name="showShareCount" id="showShareCount-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 501 |
+
</td>
|
| 502 |
+
</tr>
|
| 503 |
+
|
| 504 |
+
<tr>
|
| 505 |
+
<td><span class="shrsb_option"><?php _e('Use Designer Tooltips', 'shrsb'); ?> <span style="color:orange;">*</span></span></td>
|
| 506 |
+
<td><label><input <?php echo (($shrsb_plugopts['designer_toolTips'] == "1")? 'checked="checked"' : ""); ?> name="designer_toolTips" id="designer_toolTips-yes" type="radio" value="1" /> <?php _e('Yes (recommended)', 'shrsb'); ?></label></td>
|
| 507 |
+
<td><label><input <?php echo (($shrsb_plugopts['designer_toolTips'] == "0")? 'checked="checked"' : ""); ?> name="designer_toolTips" id="designer_toolTips-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label></td>
|
| 508 |
+
</tr>
|
| 509 |
+
|
| 510 |
+
<tr class="designer_toolTip_prefs" style="display:none">
|
| 511 |
+
<td><label class="tab" for="tip_bg_color" style="margin-top:7px;"><?php _e('Background Color for Tooltips:', 'shrsb'); ?></label></td>
|
| 512 |
+
<td><input style="margin-top:7px;" type="text" id="tip_bg_color" name="tip_bg_color" value="<?php echo $shrsb_plugopts['tip_bg_color']; ?>" /></td>
|
| 513 |
+
<td style="padding-bottom: 9px"><div id="tip_bg_color_picker" class ="color_selector">
|
| 514 |
+
<div style="background-color:<?php echo $shrsb_plugopts['tip_bg_color']; ?>; "></div>
|
| 515 |
+
</div>
|
| 516 |
+
</td>
|
| 517 |
+
<td><div id="tip_bg_color_picker_holder" style="display:none; margin-top: 5px; position: absolute;" ></div></td>
|
| 518 |
+
<td> <div id="tip_bg_color_reset" style="margin-left: 5px;"><a href="javascript:void(0);"><?php _e('reset', 'shrsb'); ?></a></div></td>
|
| 519 |
+
</tr>
|
| 520 |
+
<tr class="designer_toolTip_prefs" style="display:none">
|
| 521 |
+
<td><label class="tab" style="margin-top:7px;" for="tip_text_color"><?php _e('Text Color for Tooltips:', 'shrsb'); ?></label></td>
|
| 522 |
+
<td><input style="margin-top:7px;" type="text" id="tip_text_color" name="tip_text_color" value="<?php echo $shrsb_plugopts['tip_text_color']; ?>" /></td>
|
| 523 |
+
<td style="padding-bottom: 9px"><div id="tip_text_color_picker" class ="color_selector">
|
| 524 |
+
<div style="background-color: <?php echo $shrsb_plugopts['tip_text_color']; ?>; "></div>
|
| 525 |
+
</div>
|
| 526 |
+
</td>
|
| 527 |
+
<td><div id="tip_text_color_picker_holder" style="display:none; margin-top: 5px; position: absolute;"></div></td>
|
| 528 |
+
<td> <div id="tip_text_color_reset" style="margin-left: 5px;"><a href="javascript:void(0);"><?php _e('reset', 'shrsb'); ?></a></div></td>
|
| 529 |
+
</tr>
|
| 530 |
+
<tr class="designer_toolTip_prefs" style="display:none">
|
| 531 |
+
<td><label class="tab" style="margin-top:7px;" for="tip_text_color"><?php _e('Language for Tooltips:', 'shrsb'); ?> (<a href="http://blog.shareaholic.com/2011/05/shareaholic-for-publishers-now-features-automagic-translation/">?</a>)</label></td>
|
| 532 |
+
<td colspan="3"><select name="locale" id="locale">
|
| 533 |
+
<?php
|
| 534 |
+
$locales = array(
|
| 535 |
+
'0' => 'Automagic Translation (recommended)',
|
| 536 |
+
'en' => 'English',
|
| 537 |
+
'es' => 'Spanish',
|
| 538 |
+
'fr' => 'French',
|
| 539 |
+
'de' => 'German',
|
| 540 |
+
'tr' => 'Turkish',
|
| 541 |
+
'it' => 'Italian',
|
| 542 |
+
'pt' => 'Portugese',
|
| 543 |
+
//'pt_BR' => 'Portugese Brazil',
|
| 544 |
+
'et' => 'Estonian',
|
| 545 |
+
'hu' => 'Hungarian',
|
| 546 |
+
'bg' => 'Bulgarian',
|
| 547 |
+
'el' => 'Greek',
|
| 548 |
+
'lt' => 'Lithuanian',
|
| 549 |
+
'he' => 'Hebrew',
|
| 550 |
+
'nl' => 'Dutch'
|
| 551 |
+
);
|
| 552 |
+
|
| 553 |
+
//run translation on each value
|
| 554 |
+
foreach($locales as $value)
|
| 555 |
+
$value = __($value,'shrsb');
|
| 556 |
+
|
| 557 |
+
// output locale select options
|
| 558 |
+
print shrsb_select_option_group('locale', $locales, $shrsb_plugopts);
|
| 559 |
+
|
| 560 |
+
?>
|
| 561 |
+
|
| 562 |
+
</select></td>
|
| 563 |
+
<td style="padding-bottom: 9px"></td>
|
| 564 |
+
</tr>
|
| 565 |
+
|
| 566 |
+
<tr>
|
| 567 |
+
<td><span class="shrsb_option"><?php _e('Add Nofollow to Links', 'shrsb'); ?></span></td>
|
| 568 |
+
<td><label><input <?php echo (($shrsb_plugopts['reloption'] == "nofollow")? 'checked="checked"' : ""); ?> name="reloption" id="reloption-yes" type="radio" value="nofollow" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 569 |
+
</td><td><label><input <?php echo (($shrsb_plugopts['reloption'] == "1")? 'checked="checked"' : ""); ?> name="reloption" id="reloption-no" type="radio" value="1" /> <?php _e('No', 'shrsb'); ?></label>
|
| 570 |
+
</td>
|
| 571 |
+
</tr>
|
| 572 |
+
|
| 573 |
+
<tr>
|
| 574 |
+
<td><span class="shrsb_option"><?php _e('Open Links in New Window', 'shrsb'); ?></span></td>
|
| 575 |
+
<td><label><input <?php echo (($shrsb_plugopts['targetopt'] == "_blank")? 'checked="checked"' : ""); ?> name="targetopt" id="targetopt-blank" type="radio" value="_blank" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 576 |
+
</td><td><label><input <?php echo (($shrsb_plugopts['targetopt'] == "_self")? 'checked="checked"' : ""); ?> name="targetopt" id="targetopt-self" type="radio" value="_self" /> <?php _e('No', 'shrsb'); ?></label>
|
| 577 |
+
</td>
|
| 578 |
+
</tr>
|
| 579 |
+
|
| 580 |
+
<tr>
|
| 581 |
+
<td>
|
| 582 |
+
<span class="shrsb_option"><?php _e('Show Shareaholic Link', 'shrsb'); ?></span>
|
| 583 |
+
</td>
|
| 584 |
+
<td><label><input <?php echo (($shrsb_plugopts['shrlink'] == "1" || $shrsb_plugopts['shrlink'] == '')? 'checked="checked"' : ""); ?> name="shrlink" id="shrlink-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 585 |
+
</td><td><label><input <?php echo (($shrsb_plugopts['shrlink'] == "0")? 'checked="checked"' : ""); ?> name="shrlink" id="shrlink-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 586 |
+
</td>
|
| 587 |
+
</tr>
|
| 588 |
+
|
| 589 |
+
<tr>
|
| 590 |
+
<td><span class="shrsb_option"><?php _e('Want to know about new products?', 'shrsb'); ?></span></td>
|
| 591 |
+
<td><label><input <?php echo (($shrsb_plugopts['promo'] == "1")? 'checked="checked"' : ""); ?> name="promo" id="promo-1" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label></td>
|
| 592 |
+
<td><label><input <?php echo (($shrsb_plugopts['promo'] != "1")? 'checked="checked"' : ""); ?> name="promo" id="promo-0" type="radio" value="" /> <?php _e('No', 'shrsb'); ?></label></td>
|
| 593 |
+
</tr>
|
| 594 |
+
|
| 595 |
+
<input type="hidden" name="shrbase" value="<?php echo $shrsb_plugopts['shrbase'] ?>"/>
|
| 596 |
+
<input type="hidden" name="apikey" placeholder="8afa39428933be41f8afdb8ea21a495c" value="<?php echo $shrsb_plugopts['apikey']?$shrsb_plugopts['apikey']:'8afa39428933be41f8afdb8ea21a495c' ?>"/>
|
| 597 |
+
|
| 598 |
+
</tbody></table>
|
| 599 |
+
<br />
|
| 600 |
+
<span style="display:block;"><span style="color:orange;">* <?php _e('switch on "new" mode above to enable these exclusive features', 'shrsb'); ?></span></span>
|
| 601 |
+
<span style="display:block;"><span style="color:#08C;"># <?= sprintf( __('Click %shere%s to enable 3rd party services to use this feature', 'shrsb'), '<a href="#3rdpartyservices">', '</a>'); ?></span></span>
|
| 602 |
+
</div>
|
| 603 |
+
</div>
|
| 604 |
+
</div>
|
| 605 |
+
</li>
|
| 606 |
+
|
| 607 |
+
<li id="twitter-defaults" <?php if(!in_array('shr-twitter', $shrsb_plugopts['bookmark'])) { ?> class="hide"<?php } ?>>
|
| 608 |
+
<div class="box-mid-head" id="iconator">
|
| 609 |
+
<h2><img src="<?php echo SHRSB_PLUGPATH; ?>images/twitter-16x16.png" alt="Twitter!" align="absmiddle" style="margin-right: 8px;" /><?php _e('Twitter Options', 'shrsb'); ?></h2>
|
| 610 |
+
</div>
|
| 611 |
+
<div class="box-mid-body" id="toggle6">
|
| 612 |
+
<div class="padding">
|
| 613 |
+
|
| 614 |
+
<p id="tweetinstructions">
|
| 615 |
+
<strong><?php _e('Configuration Instructions:', 'shrsb'); ?></strong><br />
|
| 616 |
+
<?php echo sprintf(__('Using the strings %s and %s you can fully customize your tweet output.', 'shrsb'), '<strong>${title}</strong>', '<strong>${short_link}</strong>'); ?><br /><br />
|
| 617 |
+
<strong><?php _e('Example Configurations:', 'shrsb'); ?></strong><br />
|
| 618 |
+
<em>${title} - ${short_link} (via @Shareaholic)</em><br />
|
| 619 |
+
<?php _e('or', 'shrsb'); ?><br />
|
| 620 |
+
<em>RT @Shareaholic: ${title} - ${short_link}</em>
|
| 621 |
+
</p>
|
| 622 |
+
<div style="position:relative;width:80%;">
|
| 623 |
+
<label for="tweetconfig"><?php _e('Configure Custom Tweet Template:', 'shrsb'); ?></label><small id="tweetcounter"><?php _e('Characters:', 'shrsb'); ?> <span></span></small><br />
|
| 624 |
+
<textarea id="tweetconfig" name="tweetconfig"><?php if(!empty($shrsb_plugopts['tweetconfig'])) { echo urldecode($shrsb_plugopts['tweetconfig']); } else { echo '${title} - ${short_link} via @Shareaholic'; } ?></textarea>
|
| 625 |
+
</div>
|
| 626 |
+
<p id="tweetoutput"><strong><?php _e('Example Tweet Output:', 'shrsb'); ?></strong><br /><span></span></p>
|
| 627 |
+
|
| 628 |
+
<label for="shorty"><?php _e('Which URL Shortener?', 'shrsb'); ?></label><br />
|
| 629 |
+
<select name="shorty" id="shorty">
|
| 630 |
+
<?php
|
| 631 |
+
// output shorty select options
|
| 632 |
+
print shrsb_select_option_group('shorty',
|
| 633 |
+
array(
|
| 634 |
+
'none' =>__("Don't use a shortener", 'shrsb'),
|
| 635 |
+
'awesm' => 'awe.sm',
|
| 636 |
+
'bitly' => 'bit.ly',
|
| 637 |
+
'jmp' => 'j.mp',
|
| 638 |
+
'google' => 'Google (goo.gl)',
|
| 639 |
+
'supr' => 'StumbleUpon (su.pr)',
|
| 640 |
+
'tinyurl' => 'tinyurl',
|
| 641 |
+
'tflp' => 'Twitter Friendly Links WP Plugin',
|
| 642 |
+
'yourls' => 'YOURLS WP Plugin'
|
| 643 |
+
),
|
| 644 |
+
$shrsb_plugopts
|
| 645 |
+
);
|
| 646 |
+
?>
|
| 647 |
+
|
| 648 |
+
</select>
|
| 649 |
+
<div id="shortyapimdiv-bitly"<?php if($shrsb_plugopts['shorty'] != "bitly") { ?> class="hidden"<?php } ?>>
|
| 650 |
+
<div id="shortyapidiv-bitly">
|
| 651 |
+
<label for="shortyapiuser-bitly"><?php _e('User ID:', 'shrsb'); ?></label>
|
| 652 |
+
<input type="text" id="shortyapiuser-bitly" name="shortyapiuser-bitly" value="<?php echo $shrsb_plugopts['shortyapi']['bitly']['user']; ?>" />
|
| 653 |
+
<label for="shortyapikey-bitly"><?php _e('API Key:', 'shrsb'); ?></label>
|
| 654 |
+
<input type="text" id="shortyapikey-bitly" name="shortyapikey-bitly" value="<?php echo $shrsb_plugopts['shortyapi']['bitly']['key']; ?>" />
|
| 655 |
+
</div>
|
| 656 |
+
</div>
|
| 657 |
+
|
| 658 |
+
<div id="shortyapimdiv-awesm"<?php if($shrsb_plugopts['shorty'] != "awesm") { ?> class="hidden"<?php } ?>>
|
| 659 |
+
<div id="shortyapidiv-awesm">
|
| 660 |
+
<label for="shortyapiuser-awesm"><?php _e('Tool:', 'shrsb'); ?></label>
|
| 661 |
+
<input type="text" id="shortyapiuser-awesm" name="shortyapiuser-awesm" value="<?php echo $shrsb_plugopts['shortyapi']['awesm']['user']; ?>" />
|
| 662 |
+
<label for="shortyapikey-awesm"><?php _e('API Key:', 'shrsb'); ?></label>
|
| 663 |
+
<input type="text" id="shortyapikey-awesm" name="shortyapikey-awesm" value="<?php echo $shrsb_plugopts['shortyapi']['awesm']['key']; ?>" />
|
| 664 |
+
</div>
|
| 665 |
+
</div>
|
| 666 |
+
|
| 667 |
+
<div id="shortyapimdiv-jmp"<?php if($shrsb_plugopts['shorty'] != "jmp") { ?> class="hidden"<?php } ?>>
|
| 668 |
+
<div id="shortyapidiv-jmp">
|
| 669 |
+
<label for="shortyapiuser-jmp"><?php _e('User ID:', 'shrsb'); ?></label>
|
| 670 |
+
<input type="text" id="shortyapiuser-jmp" name="shortyapiuser-jmp" value="<?php echo $shrsb_plugopts['shortyapi']['jmp']['user']; ?>" />
|
| 671 |
+
<label for="shortyapikey-jmp"><?php _e('API Key:', 'shrsb'); ?></label>
|
| 672 |
+
<input type="text" id="shortyapikey-jmp" name="shortyapikey-jmp" value="<?php echo $shrsb_plugopts['shortyapi']['jmp']['key']; ?>" />
|
| 673 |
+
</div>
|
| 674 |
+
</div>
|
| 675 |
+
|
| 676 |
+
<div id="shortyapimdiv-supr" <?php if($shrsb_plugopts['shorty'] != 'supr') { ?>class="hidden"<?php } ?>>
|
| 677 |
+
<span class="shrsb_option" id="shortyapidivchk-supr">
|
| 678 |
+
<input <?php echo (($shrsb_plugopts['shortyapi']['supr']['chk'] == "1")? 'checked="true"' : ""); ?> name="shortyapichk-supr[]" id="shortyapichk-supr" type="checkbox" value="1" /> <?php _e('Track Generated Links?', 'shrsb'); ?>
|
| 679 |
+
<input type="hidden" name="shortyapichk-supr[]" type="checkbox" value="0"/>
|
| 680 |
+
</span>
|
| 681 |
+
<div class="clearbig"></div>
|
| 682 |
+
<div id="shortyapidiv-supr" <?php if(!isset($shrsb_plugopts['shortyapi']['supr']['chk'])) { ?>class="hidden"<?php } ?>>
|
| 683 |
+
<label for="shortyapiuser-supr"><?php _e('User ID:', 'shrsb'); ?></label>
|
| 684 |
+
<input type="text" id="shortyapiuser-supr" name="shortyapiuser-supr" value="<?php echo $shrsb_plugopts['shortyapi']['supr']['user']; ?>" />
|
| 685 |
+
<label for="shortyapikey-supr"><?php _e('API Key:', 'shrsb'); ?></label>
|
| 686 |
+
<input type="text" id="shortyapikey-supr" name="shortyapikey-supr" value="<?php echo $shrsb_plugopts['shortyapi']['supr']['key']; ?>" />
|
| 687 |
+
</div>
|
| 688 |
+
</div>
|
| 689 |
+
<div class="clearbig"></div>
|
| 690 |
+
|
| 691 |
+
</div>
|
| 692 |
+
</div>
|
| 693 |
+
</li>
|
| 694 |
+
|
| 695 |
+
<li>
|
| 696 |
+
<div class="box-mid-head">
|
| 697 |
+
<h2 class="fugue f-pallette"><?php _e('Plugin Aesthetics', 'shrsb'); ?></h2>
|
| 698 |
+
</div>
|
| 699 |
+
<div class="box-mid-body" id="toggle3">
|
| 700 |
+
<div class="padding">
|
| 701 |
+
<div id="custom-mods-notice">
|
| 702 |
+
<h1><?php _e('Warning!', 'shrsb'); ?></h1>
|
| 703 |
+
<p><?php echo sprintf(__('This option is intended %STRICTLY%s for users who understand how to edit CSS/JS and intend to change/edit the associated images themselves. Unfortunately, no support will be offered for this feature, as I cannot be held accountable for your coding and/or image editing mistakes.', 'shrsb'), '<strong>', '</strong>'); ?></p>
|
| 704 |
+
<h3><?php _e('How it works...', 'shrsb'); ?></h3>
|
| 705 |
+
<p><?php _e('Since you have chosen for the plugin to override the style settings with your own custom mods, it will now pull the files from the new folders it is going to create on your server as soon as you save your changes. The file/folder locations should be as follows:', 'shrsb'); ?></p>
|
| 706 |
+
<ul>
|
| 707 |
+
<li class="custom-mods-folder"><a href="<?php echo WP_CONTENT_URL.'/sexy-mods'; ?>"><?php echo WP_CONTENT_URL.'/sexy-mods'; ?></a></li>
|
| 708 |
+
<li class="custom-mods-folder"><a href="<?php echo WP_CONTENT_URL.'/sexy-mods/css'; ?>"><?php echo WP_CONTENT_URL.'/sexy-mods/css'; ?></a></li>
|
| 709 |
+
<li class="custom-mods-folder"><a href="<?php echo WP_CONTENT_URL.'/sexy-mods/js'; ?>"><?php echo WP_CONTENT_URL.'/sexy-mods/js'; ?></a></li>
|
| 710 |
+
<li class="custom-mods-folder"><a href="<?php echo WP_CONTENT_URL.'/sexy-mods/images'; ?>"><?php echo WP_CONTENT_URL.'/sexy-mods/images'; ?></a></li>
|
| 711 |
+
<li class="custom-mods-code"><a href="<?php echo WP_CONTENT_URL.'/sexy-mods/js/sexy-bookmarks-public.js'; ?>"><?php echo WP_CONTENT_URL.'/sexy-mods/js/sexy-bookmarks-public.js'; ?></a></li>
|
| 712 |
+
<li class="custom-mods-code"><a href="<?php echo WP_CONTENT_URL.'/sexy-mods/css/style.css'; ?>"><?php echo WP_CONTENT_URL.'/sexy-mods/css/style.css'; ?></a></li>
|
| 713 |
+
<li class="custom-mods-image"><a href="<?php echo WP_CONTENT_URL.'/sexy-mods/images/shr-sprite.png'; ?>"><?php echo WP_CONTENT_URL.'/sexy-mods/images/shr-sprite.png'; ?></a></li>
|
| 714 |
+
<li class="custom-mods-image"><a href="<?php echo WP_CONTENT_URL.'/sexy-mods/images/share-enjoy.png'; ?>"><?php echo WP_CONTENT_URL.'/sexy-mods/images/share-enjoy.png'; ?></a></li>
|
| 715 |
+
<li class="custom-mods-image"><a href="<?php echo WP_CONTENT_URL.'/sexy-mods/images/share-german.png'; ?>"><?php echo WP_CONTENT_URL.'/sexy-mods/images/share-german.png'; ?></a></li>
|
| 716 |
+
<li class="custom-mods-image"><a href="<?php echo WP_CONTENT_URL.'/sexy-mods/images/share-love-hearts.png'; ?>"><?php echo WP_CONTENT_URL.'/sexy-mods/images/share-love-hearts.png'; ?></a></li>
|
| 717 |
+
<li class="custom-mods-image"><a href="<?php echo WP_CONTENT_URL.'/sexy-mods/images/share-wealth.png'; ?>"><?php echo WP_CONTENT_URL.'/sexy-mods/images/share-wealth.png'; ?></a></li>
|
| 718 |
+
<li class="custom-mods-image"><a href="<?php echo WP_CONTENT_URL.'/sexy-mods/images/sharing-caring-hearts.png'; ?>"><?php echo WP_CONTENT_URL.'/sexy-mods/images/sharing-caring-hearts.png'; ?></a></li>
|
| 719 |
+
<li class="custom-mods-image"><a href="<?php echo WP_CONTENT_URL.'/sexy-mods/images/sharing-caring.png'; ?>"><?php echo WP_CONTENT_URL.'/sexy-mods/images/sharing-caring.png'; ?></a></li>
|
| 720 |
+
<li class="custom-mods-image"><a href="<?php echo WP_CONTENT_URL.'/sexy-mods/images/sharing-shr.png'; ?>"><?php echo WP_CONTENT_URL.'/sexy-mods/images/sharing-shr.png'; ?></a></li>
|
| 721 |
+
</ul>
|
| 722 |
+
<p><?php _e('Once you have saved your changes, you will be able to edit the image sprite that holds all of the icons for Shareaholic as well as the CSS which accompanies it. Just be sure that you do in fact edit the CSS if you edit the images, as it is unlikely the heights, widths, and background positions of the images will stay the same after you are done.', 'shrsb'); ?></p>
|
| 723 |
+
<p><?php _e('Just a quick note... When you edit the styles and images to include your own custom backgrounds, icons, and CSS styles, be aware that those changes will not be reflected on the plugin options page. In other words: when you select your networks to be displayed, or when you select the background image to use, it will still be displaying the images from the original plugin directory.', 'shrsb'); ?></p>
|
| 724 |
+
<h3><?php _e('In Case of Emergency', 'shrsb'); ?></h3>
|
| 725 |
+
<p><?php _e('If you happen to mess things up, you can follow these directions to reset the plugin back to normal and try again if you wish:', 'shrsb'); ?></p>
|
| 726 |
+
<ol>
|
| 727 |
+
<li><?php _e('Login to your server via FTP or SSH. (whichever you are more comfortable with)', 'shrsb'); ?></li>
|
| 728 |
+
<li><?php _e('Navigate to your wp-content directory.', 'shrsb'); ?></li>
|
| 729 |
+
<li><?php _e('Delete the directory named "sexy-mods".', 'shrsb'); ?></li>
|
| 730 |
+
<li><?php _e('Login to your WordPress dashboard.', 'shrsb'); ?></li>
|
| 731 |
+
<li><?php _e('Go to the SexyBookmarks plugin options page. (Settings->SexyBookmarks)', 'shrsb'); ?></li>
|
| 732 |
+
<li><?php _e('Deselect the "Use custom mods" option.', 'shrsb'); ?></li>
|
| 733 |
+
<li><?php _e('Save your changes.', 'shrsb'); ?></li>
|
| 734 |
+
</ol>
|
| 735 |
+
<span class="fugue f-delete custom-mods-notice-close"><?php _e('Close Message', 'shrsb'); ?></span>
|
| 736 |
+
</div>
|
| 737 |
+
<div class="custom-mod-check fugue f-plugin">
|
| 738 |
+
<label for="custom-mods" class="shrsb_option" style="display:inline;">
|
| 739 |
+
<?php _e('Override Styles With Custom Mods Instead?', 'shrsb'); ?>
|
| 740 |
+
</label>
|
| 741 |
+
<input <?php echo (($shrsb_plugopts['custom-mods'] == "yes")? 'checked' : ""); ?> name="custom-mods" id="custom-mods" type="checkbox" value="yes" />
|
| 742 |
+
</div>
|
| 743 |
+
|
| 744 |
+
<span class="shrsb_option"><?php _e('Animate-expand multi-lined bookmarks?', 'shrsb'); ?></span>
|
| 745 |
+
<label><input <?php echo (($shrsb_plugopts['expand'] == "1")? 'checked="checked"' : ""); ?> name="expand" id="expand-yes" type="radio" value="1" /><?php _e('Yes', 'shrsb'); ?></label>
|
| 746 |
+
<label><input <?php echo (($shrsb_plugopts['expand'] != "1")? 'checked="checked"' : ""); ?> name="expand" id="expand-no" type="radio" value="0" /><?php _e('No', 'shrsb'); ?></label>
|
| 747 |
+
<span class="shrsb_option"><?php _e('Auto-space/center the bookmarks?', 'shrsb'); ?></span>
|
| 748 |
+
<label><input <?php echo (($shrsb_plugopts['autocenter'] == "2")? 'checked="checked"' : ""); ?> name="autocenter" id="autospace-yes" type="radio" value="2" /><?php _e('Space', 'shrsb'); ?></label>
|
| 749 |
+
<label><input <?php echo (($shrsb_plugopts['autocenter'] == "1")? 'checked="checked"' : ""); ?> name="autocenter" id="autocenter-yes" type="radio" value="1" /><?php _e('Center', 'shrsb'); ?></label>
|
| 750 |
+
<label><input <?php echo (($shrsb_plugopts['autocenter'] == "0")? 'checked="checked"' : ""); ?> name="autocenter" id="autocenter-no" type="radio" value="0" /><?php _e('No', 'shrsb'); ?></label>
|
| 751 |
+
|
| 752 |
+
<span class="shrsb_option">
|
| 753 |
+
<?php _e('Use a background image?', 'shrsb'); ?> <input <?php echo (($shrsb_plugopts['bgimg-yes'] == "yes")? 'checked' : ""); ?> name="bgimg-yes" id="bgimg-yes" type="checkbox" value="yes" />
|
| 754 |
+
</span>
|
| 755 |
+
<div id="bgimgs" class="<?php if(!isset($shrsb_plugopts['bgimg-yes'])) { ?>hidden<?php } else { echo ''; }?>">
|
| 756 |
+
<label class="share-sexy">
|
| 757 |
+
<input <?php echo (($shrsb_plugopts['bgimg'] == "shr")? 'checked="checked"' : ""); ?> id="bgimg-sexy" name="bgimg" type="radio" value="shr" />
|
| 758 |
+
</label>
|
| 759 |
+
<label class="share-care">
|
| 760 |
+
<input <?php echo (($shrsb_plugopts['bgimg'] == "caring")? 'checked="checked"' : ""); ?> id="bgimg-caring" name="bgimg" type="radio" value="caring" />
|
| 761 |
+
</label>
|
| 762 |
+
<label class="share-care-old">
|
| 763 |
+
<input <?php echo (($shrsb_plugopts['bgimg'] == "care-old")? 'checked="checked"' : ""); ?> id="bgimg-care-old" name="bgimg" type="radio" value="care-old" />
|
| 764 |
+
</label>
|
| 765 |
+
<label class="share-love">
|
| 766 |
+
<input <?php echo (($shrsb_plugopts['bgimg'] == "love")? 'checked="checked"' : ""); ?> id="bgimg-love" name="bgimg" type="radio" value="love" />
|
| 767 |
+
</label>
|
| 768 |
+
<label class="share-wealth">
|
| 769 |
+
<input <?php echo (($shrsb_plugopts['bgimg'] == "wealth")? 'checked="checked"' : ""); ?> id="bgimg-wealth" name="bgimg" type="radio" value="wealth" />
|
| 770 |
+
</label>
|
| 771 |
+
<label class="share-enjoy">
|
| 772 |
+
<input <?php echo (($shrsb_plugopts['bgimg'] == "enjoy")? 'checked="checked"' : ""); ?> id="bgimg-enjoy" name="bgimg" type="radio" value="enjoy" />
|
| 773 |
+
</label>
|
| 774 |
+
<label class="share-german">
|
| 775 |
+
<input <?php echo (($shrsb_plugopts['bgimg'] == "german")? 'checked="checked"' : ""); ?> id="bgimg-german" name="bgimg" type="radio" value="german" />
|
| 776 |
+
</label>
|
| 777 |
+
<label class="share-knowledge">
|
| 778 |
+
<input <?php echo (($shrsb_plugopts['bgimg'] == "knowledge")? 'checked="checked"' : ""); ?> id="bgimg-knowledge" name="bgimg" type="radio" value="knowledge" />
|
| 779 |
+
</label>
|
| 780 |
+
</div>
|
| 781 |
+
</div>
|
| 782 |
+
</div>
|
| 783 |
+
</li>
|
| 784 |
+
|
| 785 |
+
<li>
|
| 786 |
+
<div class="box-mid-head">
|
| 787 |
+
<h2 class="fugue f-wrench"><?php _e('Compatibility Settings', 'shrsb'); ?></h2>
|
| 788 |
+
</div>
|
| 789 |
+
<div class="box-mid-body" id="toggle2">
|
| 790 |
+
<div class="padding">
|
| 791 |
+
|
| 792 |
+
<?php if (class_exists('WPMinify')) { ?>
|
| 793 |
+
<span class="shrsb_option"><?php _e('WP-Minify Compatibility Mode', 'shrsb'); ?></span>
|
| 794 |
+
<label><input <?php echo (($shrsb_plugopts['preventminify'] == "1")? 'checked="checked"' : ""); ?> name="preventminify" id="preventminify-yes" type="radio" value="1" /> <?php _e('Enabled (recommended)', 'shrsb'); ?></label>
|
| 795 |
+
<label><input <?php echo (($shrsb_plugopts['preventminify'] == "0")? 'checked="checked"' : ""); ?> name="preventminify" id="preventminify-no" type="radio" value="0" /> <?php _e('Disabled', 'shrsb'); ?></label>
|
| 796 |
+
<span style="display:block;"><?php _e('(SexyBookmarks may not work with this option turned off)', 'shrsb'); ?></span>
|
| 797 |
+
<?php } ?>
|
| 798 |
+
<span class="shrsb_option"><input type="checkbox" id="doNotIncludeJQuery" name="doNotIncludeJQuery" <?php echo (($shrsb_plugopts['doNotIncludeJQuery'] == "1")? 'checked' : ""); ?> value="1" /> <?php _e('jQuery Compatibility Fix', 'shrsb'); ?></span>
|
| 799 |
+
<label for="doNotIncludeJQuery"><?php _e("Check this box ONLY if you notice jQuery being loaded twice in your source code!", "shrsb"); ?></label>
|
| 800 |
+
|
| 801 |
+
<span class="shrsb_option"><input type="checkbox" id="scriptInFooter" name="scriptInFooter" <?php echo (($shrsb_plugopts['scriptInFooter'] == "1")? 'checked' : ""); ?> value="1" /> <?php _e('Load scripts in Footer', 'shrsb'); ?></span>
|
| 802 |
+
<label for="scriptInFooter"><?php _e("Check this box if you want the SexyBookmarks javascript to be loaded in your blog's footer.", 'shrsb'); ?> (<a href="http://developer.yahoo.com/performance/rules.html#js_bottom" target="_blank">?</a>)</label>
|
| 803 |
+
|
| 804 |
+
<span class="shrsb_option"><input type="checkbox" id="fbNameSpace" name="fbNameSpace" <?php echo (($shrsb_plugopts['fbNameSpace'] == "1")? 'checked' : ""); ?> value="1" /> <?php _e('Add Facebook required namespaces to your HTML tag? (recommended)', 'shrsb'); ?></span>
|
| 805 |
+
<label for="fbNameSpace"><?php _e("Check this box if you include Facebook's Like/Send buttons. These buttons may not work with this option turned off.", 'shrsb'); ?></label>
|
| 806 |
+
|
| 807 |
+
|
| 808 |
+
<span class="shrsb_option"><?php _e('Custom Path to Shareaholic File Resources', 'shrsb'); ?></span>
|
| 809 |
+
<label for="spritegen_path"><?php _e("Set Custom Path:", "shrsb"); ?>
|
| 810 |
+
<input class="span12" style="margin-top:7px; min-width: 500px;" type="text" id="spritegen_path" name="spritegen_path" value="<?php echo shrb_addTrailingChar(stripslashes($shrsb_plugopts['spritegen_path']), '/'); ?>" /></label>
|
| 811 |
+
<p><?php _e("Default Path: ", "shrsb"); echo SHRSB_UPLOADDIR_DEFAULT; ?> </p>
|
| 812 |
+
</div>
|
| 813 |
+
</div>
|
| 814 |
+
</li>
|
| 815 |
+
|
| 816 |
+
<li>
|
| 817 |
+
<div class="box-mid-head">
|
| 818 |
+
<h2 class="fugue f-footer"><?php _e('Menu Placement', 'shrsb'); ?></h2>
|
| 819 |
+
</div>
|
| 820 |
+
<div class="box-mid-body" id="toggle5">
|
| 821 |
+
<div class="padding">
|
| 822 |
+
<div class="dialog-box-information" id="info-manual">
|
| 823 |
+
<div class="dialog-left fugue f-info">
|
| 824 |
+
<?php echo sprintf(__('Need help with this? Find it in the %sofficial install guide%s.', 'shrsb'), '<a href="http://www.shareaholic.com/tools/wordpress/usage-installation">', '</a>'); ?></a>
|
| 825 |
+
</div>
|
| 826 |
+
<div class="dialog-right">
|
| 827 |
+
<img src="<?php echo SHRSB_PLUGPATH; ?>images/information-delete.jpg" class="del-x" alt=""/>
|
| 828 |
+
</div>
|
| 829 |
+
</div>
|
| 830 |
+
<span class="shrsb_option"><?php _e('Menu Location (in relation to content):', 'shrsb'); ?></span>
|
| 831 |
+
<label><input <?php echo (($shrsb_plugopts['position'] == "above")? 'checked="checked"' : ""); ?> name="position" id="position-above" type="radio" value="above" /> <?php _e('Above Content', 'shrsb'); ?></label>
|
| 832 |
+
<label><input <?php echo (($shrsb_plugopts['position'] == "below")? 'checked="checked"' : ""); ?> name="position" id="position-below" type="radio" value="below" /> <?php _e('Below Content', 'shrsb'); ?></label>
|
| 833 |
+
<label><input <?php echo (($shrsb_plugopts['position'] == "both")? 'checked="checked"' : ""); ?> name="position" id="position-both" type="radio" value="both" /> <?php _e('Above & Below Content', 'shrsb'); ?></label>
|
| 834 |
+
<label><input <?php echo (($shrsb_plugopts['position'] == "manual")? 'checked="checked"' : ""); ?> name="position" id="position-manual" type="radio" value="manual" /> <?php _e('Manual Mode', 'shrsb'); ?></label>
|
| 835 |
+
|
| 836 |
+
<?php shrsb_options_menu_type($shrsb_plugopts['pageorpost']); ?>
|
| 837 |
+
|
| 838 |
+
<span class="shebang-info fugue f-question" title="<?php _e('Click here for help with this option', 'shrsb'); ?>"> </span>
|
| 839 |
+
<span class="shrsb_option"><?php _e('Show in RSS feed?', 'shrsb'); ?></span>
|
| 840 |
+
<label><input <?php echo (($shrsb_plugopts['feed'] == "1")? 'checked="checked"' : ""); ?> name="feed" id="feed-show" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 841 |
+
<label><input <?php echo (($shrsb_plugopts['feed'] == "0" || empty($shrsb_plugopts['feed']))? 'checked="checked"' : ""); ?> name="feed" id="feed-hide" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 842 |
+
<span class="shrsb_option" style="margin-top:12px;">
|
| 843 |
+
<?php _e('Hide menu from mobile browsers?', 'shrsb'); ?> <input <?php echo (($shrsb_plugopts['mobile-hide'] == "yes")? 'checked' : ""); ?> name="mobile-hide" id="mobile-hide" type="checkbox" value="yes" />
|
| 844 |
+
</span>
|
| 845 |
+
<br />
|
| 846 |
+
</div>
|
| 847 |
+
</div>
|
| 848 |
+
</li>
|
| 849 |
+
</ul>
|
| 850 |
+
<div style="clear:both;"></div>
|
| 851 |
+
<input type="hidden" name="save_changes_sb" value="1" />
|
| 852 |
+
<div class="shrsbsubmit"><input type="submit" id="save_changes_sb" value="<?php _e('Save Changes', 'shrsb'); ?>" /></div>
|
| 853 |
+
</form>
|
| 854 |
+
<form action="" method="post">
|
| 855 |
+
<input type="hidden" name="reset_all_options_sb" id="reset_all_options_sb" value="0" />
|
| 856 |
+
<div class="shrsbreset"><input type="submit" value="<?php _e('Reset Settings', 'shrsb'); ?>" /></div>
|
| 857 |
+
|
| 858 |
+
</form>
|
| 859 |
+
|
| 860 |
+
<div id="third-party-submit-modal" class="reveal-modal" style="width: 520px;">
|
| 861 |
+
|
| 862 |
+
<a class="close-reveal-modal hide-reveal-modal">×</a>
|
| 863 |
+
|
| 864 |
+
<h3><?php _e('3rd Party Features', 'shrsb'); ?></h3>
|
| 865 |
+
|
| 866 |
+
<div class="modal-body" style="padding-left: 0px;">
|
| 867 |
+
<h3><?php _e('You have chosen to enable features that are dependent on 3rd party services like Google. What would you like to do?', 'shrsb'); ?></h3>
|
| 868 |
+
</div>
|
| 869 |
+
<p>
|
| 870 |
+
<a href="#" id="enable3rdParty" class="pull-right btn btn-primary hide-reveal-modal"><?php _e('Enable 3rd Party Features (highly recommended)', 'shrsb'); ?></a>
|
| 871 |
+
<a href="#" id="disable3rdParty" class="pull-right hide-reveal-modal" style="padding: 7px 10px 0 0;"><?php _e('Disable', 'shrsb'); ?></a>
|
| 872 |
+
</p>
|
| 873 |
+
</div>
|
| 874 |
+
|
| 875 |
+
<script type="text/javascript">
|
| 876 |
+
|
| 877 |
+
function showModal(){
|
| 878 |
+
var $= jQuery;
|
| 879 |
+
|
| 880 |
+
var o = $('#third-party-submit-modal');
|
| 881 |
+
|
| 882 |
+
$('#enable3rdParty',o).click(function(){
|
| 883 |
+
$('input:radio[name=perfoption]').removeAttr('checked');
|
| 884 |
+
$('#perfoption-yes').attr('checked',true)
|
| 885 |
+
forceSubmit();
|
| 886 |
+
});
|
| 887 |
+
|
| 888 |
+
$('#disable3rdParty',o).click(function(){
|
| 889 |
+
$('input:radio[name=perfoption]').removeAttr('checked');
|
| 890 |
+
$('#perfoption-no').attr('checked',true)
|
| 891 |
+
forceSubmit();
|
| 892 |
+
});
|
| 893 |
+
|
| 894 |
+
o.reveal({
|
| 895 |
+
scrollheight:0
|
| 896 |
+
, closeonbackgroundclick: true
|
| 897 |
+
, dismissmodalclass:"hide-reveal-modal"
|
| 898 |
+
, animation:'fadeAndPop'
|
| 899 |
+
, backdrop: true
|
| 900 |
+
});
|
| 901 |
+
|
| 902 |
+
function forceSubmit(){
|
| 903 |
+
$('#sexy-bookmarks').submit();
|
| 904 |
+
}
|
| 905 |
+
|
| 906 |
+
}
|
| 907 |
+
|
| 908 |
+
function isRadioEnabled(name){
|
| 909 |
+
return jQuery('input:radio[name='+ name + ']:checked').val() == '1';
|
| 910 |
+
}
|
| 911 |
+
|
| 912 |
+
|
| 913 |
+
function is3rdPartyDependent() {
|
| 914 |
+
|
| 915 |
+
var shrsb_analytics = <?= json_encode($shrsb_analytics) ?> ;
|
| 916 |
+
|
| 917 |
+
return (shrsb_analytics.pubGaSocial == '1') || isRadioEnabled('showShareCount') ;
|
| 918 |
+
}
|
| 919 |
+
|
| 920 |
+
function handleSubmit(){
|
| 921 |
+
|
| 922 |
+
var $= jQuery;
|
| 923 |
+
|
| 924 |
+
// $('#sexy-bookmarks').submit(function(){
|
| 925 |
+
$('#save_changes_sb').click(function(){
|
| 926 |
+
|
| 927 |
+
// If 3rd party dependent
|
| 928 |
+
if( is3rdPartyDependent() && !isRadioEnabled('perfoption') ){
|
| 929 |
+
showModal();
|
| 930 |
+
return false;
|
| 931 |
+
}
|
| 932 |
+
})
|
| 933 |
+
}
|
| 934 |
+
|
| 935 |
+
handleSubmit();
|
| 936 |
+
|
| 937 |
+
</script>
|
| 938 |
+
|
| 939 |
+
|
| 940 |
+
<?php echo shrsb_getfooter(); ?>
|
| 941 |
+
|
| 942 |
+
</div>
|
| 943 |
+
|
| 944 |
+
|
| 945 |
+
<?php
|
| 946 |
+
|
| 947 |
+
//Right Side helpful links
|
| 948 |
+
echo shrsb_right_side_menu();
|
| 949 |
+
//Snap Engage
|
| 950 |
+
echo get_snapengage();
|
| 951 |
+
|
| 952 |
+
}//closing brace for function "shrsb_settings_page"
|
| 953 |
+
|
| 954 |
+
|
| 955 |
+
/*
|
| 956 |
+
* @desc Checks to see if wp-minify is installed, if so, whitelist our files
|
| 957 |
+
*/
|
| 958 |
+
function exclude_from_minify_list() {
|
| 959 |
+
$minify_opts = get_option("wp_minify");
|
| 960 |
+
|
| 961 |
+
if(is_array($minify_opts) && is_array($minify_opts["js_exclude"])) {
|
| 962 |
+
$sbfound = false;
|
| 963 |
+
$tbfound = false;
|
| 964 |
+
$shr_dough_recipe = false;
|
| 965 |
+
foreach($minify_opts["js_exclude"] as $url) {
|
| 966 |
+
if($url == 'jquery.shareaholic-publishers-sb.min.js') {
|
| 967 |
+
$sbfound = true;
|
| 968 |
+
}
|
| 969 |
+
if($url == 'jquery.shareaholic-share-buttons.min.js') {
|
| 970 |
+
$tbfound = true;
|
| 971 |
+
}
|
| 972 |
+
if($url == 'recipe.js') {
|
| 973 |
+
$shr_dough_recipe = true;
|
| 974 |
+
}
|
| 975 |
+
}
|
| 976 |
+
if(!$sbfound) {
|
| 977 |
+
array_push($minify_opts["js_exclude"],'jquery.shareaholic-publishers-sb.min.js');
|
| 978 |
+
}
|
| 979 |
+
if(!$tbfound) {
|
| 980 |
+
array_push($minify_opts["js_exclude"],'jquery.shareaholic-share-buttons.min.js');
|
| 981 |
+
}
|
| 982 |
+
if(!$shr_dough_recipe) {
|
| 983 |
+
array_push($minify_opts["js_exclude"],'recipe.js');
|
| 984 |
+
}
|
| 985 |
+
update_option("wp_minify", $minify_opts);
|
| 986 |
+
}
|
| 987 |
+
}
|
| 988 |
+
|
| 989 |
+
function _make_params($params) {
|
| 990 |
+
$pairs = array();
|
| 991 |
+
foreach ($params as $k => $v) {
|
| 992 |
+
$pairs[] = implode('=', array(urlencode($k), urlencode($v)));
|
| 993 |
+
}
|
| 994 |
+
return implode('&', $pairs);
|
| 995 |
+
}
|
| 996 |
+
|
| 997 |
+
|
| 998 |
+
|
| 999 |
+
/**
|
| 1000 |
+
* Make a local copy of all shareaholic resources
|
| 1001 |
+
*/
|
| 1002 |
+
function shrsb_refresh_cache() {
|
| 1003 |
+
global $shrsb_plugopts, $shrsb_bgimg_map, $default_spritegen;
|
| 1004 |
+
|
| 1005 |
+
$script_sb = _shrsb_fetch_content('/media/js/jquery.shareaholic-publishers-sb.min.js', '/jquery.shareaholic-publishers-sb.min.js', true);
|
| 1006 |
+
$script_tb = _shrsb_fetch_content('/media/js/jquery.shareaholic-share-buttons.min.js', '/jquery.shareaholic-share-buttons.min.js', true);
|
| 1007 |
+
|
| 1008 |
+
// Sort services to make request more cacheable.
|
| 1009 |
+
$services = explode(',', $shrsb_plugopts['service']);
|
| 1010 |
+
sort($services, SORT_NUMERIC);
|
| 1011 |
+
$services = implode(',', $services);
|
| 1012 |
+
|
| 1013 |
+
$sprite_opts = array(
|
| 1014 |
+
'v' => 2,
|
| 1015 |
+
'apikey' => $shrsb_plugopts['apikey'],
|
| 1016 |
+
'service' => $services,
|
| 1017 |
+
'bgimg' => $shrsb_bgimg_map[$shrsb_plugopts['bgimg']]['url'],
|
| 1018 |
+
'bgimg_padding' => $shrsb_bgimg_map[$shrsb_plugopts['bgimg']]['padding']
|
| 1019 |
+
);
|
| 1020 |
+
// save as css so mime types work on normal servers
|
| 1021 |
+
$css_sb = _shrsb_fetch_content('/api/sprite/?'._make_params($sprite_opts), '/sprite.css', true);
|
| 1022 |
+
$css_tb = _shrsb_fetch_content('/media/css/shareaholic-share-button.css', '/shareaholic-share-button.css', true);
|
| 1023 |
+
|
| 1024 |
+
$sprite_opts['apitype'] = 'png';
|
| 1025 |
+
$png_sb = _shrsb_fetch_content('/api/sprite/?'._make_params($sprite_opts), '/sprite.png', true);
|
| 1026 |
+
$png_tb = _shrsb_fetch_content('/media/images/styles/tb/shareaholic-publishers-mini.png', '/shareaholic-publishers-mini.png', true);
|
| 1027 |
+
$png_tb_arrow_up = _shrsb_fetch_content('/media/images/styles/tb/arrow_up.png', '/arrow_up.png', true);
|
| 1028 |
+
$png_tb_arrow_down = _shrsb_fetch_content('/media/images/styles/tb/arrow_down.png', '/arrow_down.png', true);
|
| 1029 |
+
|
| 1030 |
+
if(!$script_sb || !$script_tb || !$css_sb || !$css_tb || !$png_sb || !$png_tb || !$png_tb_arrow_up || !$png_tb_arrow_down) {
|
| 1031 |
+
update_option('SHRSB_DefaultSprite',true);
|
| 1032 |
+
$default_spritegen = true;
|
| 1033 |
+
} else {
|
| 1034 |
+
update_option('SHRSB_DefaultSprite',false);
|
| 1035 |
+
$default_spritegen = false;
|
| 1036 |
+
}
|
| 1037 |
+
}
|
| 1038 |
+
|
| 1039 |
+
function shrsb_requires_resave() {
|
| 1040 |
+
global $shrsb_plugopts,$default_spritegen;
|
| 1041 |
+
$resave_required = false;
|
| 1042 |
+
if(($shrsb_plugopts['shareaholic-javascript'] == '1' //new mode
|
| 1043 |
+
&& $default_spritegen)
|
| 1044 |
+
|| ($shrsb_plugopts['shareaholic-javascript'] != '1' //old mode
|
| 1045 |
+
&& !(file_exists(SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.png')
|
| 1046 |
+
&& file_exists(SHRSB_UPLOADDIR.'spritegen/shr-custom-sprite.css')
|
| 1047 |
+
)
|
| 1048 |
+
)
|
| 1049 |
+
){
|
| 1050 |
+
$resave_required = true;
|
| 1051 |
+
}
|
| 1052 |
+
|
| 1053 |
+
return $resave_required;
|
| 1054 |
+
}
|
| 1055 |
+
/*
|
| 1056 |
+
* @desc Check for chmod for new-custom and old-custom mode only
|
| 1057 |
+
*/
|
| 1058 |
+
function shrsb_requires_chmod($mode = NULL) {
|
| 1059 |
+
return !(is_writable(SHRSB_UPLOADDIR.'spritegen'));
|
| 1060 |
+
}
|
| 1061 |
+
|
| 1062 |
+
function shrsb_requires_phpupdate() {
|
| 1063 |
+
return (strnatcmp(phpversion(),'5.0') < 0);
|
| 1064 |
+
}
|
| 1065 |
+
|
| 1066 |
+
?>
|
includes/shrsb_topbar_page.php
ADDED
|
@@ -0,0 +1,68 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* @desc All Topbar functions and values which are used on every page load
|
| 5 |
+
*/
|
| 6 |
+
|
| 7 |
+
//Initialing the topbar settings array
|
| 8 |
+
$shrsb_tb_plugopts = shrsb_tb_set_options();
|
| 9 |
+
|
| 10 |
+
/*
|
| 11 |
+
* @desc Set the settings either from database or default
|
| 12 |
+
*/
|
| 13 |
+
function shrsb_tb_set_options($action = NULL){
|
| 14 |
+
|
| 15 |
+
$defaultLikeButtonOrder = array(
|
| 16 |
+
'shr-fb-like',
|
| 17 |
+
'shr-fb-send',
|
| 18 |
+
'shr-plus-one',
|
| 19 |
+
'shr-tw-button'
|
| 20 |
+
);
|
| 21 |
+
|
| 22 |
+
//Default Settigs array
|
| 23 |
+
$shrsb_tb_plugopts_default = array(
|
| 24 |
+
'topbar' => '0',
|
| 25 |
+
'useSbSettings' => '1',
|
| 26 |
+
'tb_bg_color' => '#000000',
|
| 27 |
+
'tb_border_color' => '#000000',//#343434'
|
| 28 |
+
'addv' => '1',
|
| 29 |
+
'pageorpost' => 'postpageindexcategory',
|
| 30 |
+
'likeButtonSetTop' => '1', // Include like button below the Post Title
|
| 31 |
+
'fbLikeButtonTop' => '1', // Include fb like button
|
| 32 |
+
'fbSendButtonTop' => '1', // Include fb like button
|
| 33 |
+
'googlePlusOneButtonTop' => '1', // Include Google Plus One button
|
| 34 |
+
'tweetButtonTop' => '1', // Include Tweet button
|
| 35 |
+
'likeButtonSetSizeTop' => "1", // Size of like buttons
|
| 36 |
+
'likeButtonSetCountTop' => "true", // Show count with +1 button
|
| 37 |
+
'likeButtonOrderTop' => $defaultLikeButtonOrder,
|
| 38 |
+
'likeButtonSetAlignmentTop' => '0' // Alignment 0 => left, 1 => rights
|
| 39 |
+
);
|
| 40 |
+
|
| 41 |
+
//Return default settings
|
| 42 |
+
if($action == "reset"){
|
| 43 |
+
delete_option("ShareaholicTopbar");
|
| 44 |
+
add_option("ShareaholicTopbar",$shrsb_tb_plugopts_default);
|
| 45 |
+
return $shrsb_tb_plugopts_default;
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
//Get the settings from the database
|
| 49 |
+
$database_Settings = get_option('ShareaholicTopbar');
|
| 50 |
+
if($database_Settings){
|
| 51 |
+
$need_to_update = false;
|
| 52 |
+
|
| 53 |
+
//Check whether all the settings are present or not
|
| 54 |
+
foreach($shrsb_tb_plugopts_default as $k => $v){
|
| 55 |
+
if( !array_key_exists( $k, $database_Settings)) {
|
| 56 |
+
$database_Settings[$k] = $v;
|
| 57 |
+
$need_to_update = true;
|
| 58 |
+
}
|
| 59 |
+
}
|
| 60 |
+
if($need_to_update) update_option("ShareaholicTopbar",$database_Settings);
|
| 61 |
+
return $database_Settings;
|
| 62 |
+
}else{
|
| 63 |
+
//Add the settings
|
| 64 |
+
add_option('ShareaholicTopbar',$shrsb_tb_plugopts_default);
|
| 65 |
+
return $shrsb_tb_plugopts_default;
|
| 66 |
+
}
|
| 67 |
+
}
|
| 68 |
+
?>
|
includes/shrsb_topbar_settings_page.php
ADDED
|
@@ -0,0 +1,230 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* @desc Topbar Settings page
|
| 5 |
+
*/
|
| 6 |
+
|
| 7 |
+
function shrsb_tb_settings_page() {
|
| 8 |
+
global $shrsb_tb_plugopts;
|
| 9 |
+
// Add all the global varaible declarations for the $shrsb_tb_plugopts
|
| 10 |
+
echo '<div class="wrap""><div class="icon32" id="icon-options-general"><br></div><h2>Top Bar Settings</h2></div>';
|
| 11 |
+
//Defaults - set if not present
|
| 12 |
+
if (!isset($_POST['reset_all_options_tb'])){$_POST['reset_all_options_tb'] = '1';}
|
| 13 |
+
if (!isset($_POST['shrsbresetallwarn-choice'])){$_POST['shrsbresetallwarn-choice'] = 'no';}
|
| 14 |
+
|
| 15 |
+
if($_POST['reset_all_options_tb'] == '0') {
|
| 16 |
+
echo '
|
| 17 |
+
<div id="shrsbresetallwarn" class="dialog-box-warning" style="float:none;width:97%;">
|
| 18 |
+
<div class="dialog-left fugue f-warn">
|
| 19 |
+
'.__("WARNING: You are about to reset all settings to their default state! Do you wish to continue?", "shrsb").'
|
| 20 |
+
</div>
|
| 21 |
+
<div class="dialog-right">
|
| 22 |
+
<form action="" method="post" id="resetalloptionsaccept">
|
| 23 |
+
<label><input name="shrsbresetallwarn-choice" id="shrsbresetallwarn-yes" type="radio" value="yes" />'.__('Yes', 'shrsb').'</label> <label><input name="shrsbresetallwarn-choice" id="shrsbresetallwarn-cancel" type="radio" value="cancel" />'.__('Cancel', 'shrsb').'</label>
|
| 24 |
+
</form>
|
| 25 |
+
</div>
|
| 26 |
+
</div>';
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
//Reset all options to default settings if user clicks the reset button
|
| 30 |
+
if($_POST['shrsbresetallwarn-choice'] == "yes") { //check for reset button click
|
| 31 |
+
delete_option('ShareaholicTopbar');
|
| 32 |
+
$shrsb_tb_plugopts = shrsb_tb_set_options("reset");
|
| 33 |
+
|
| 34 |
+
//delete_option('SHRSB_CustomSprite');
|
| 35 |
+
echo '
|
| 36 |
+
<div id="statmessage" class="shrsb-success">
|
| 37 |
+
<div class="dialog-left fugue f-success">
|
| 38 |
+
'.__('All settings have been reset to their default values.', 'shrsb').'
|
| 39 |
+
</div>
|
| 40 |
+
<div class="dialog-right">
|
| 41 |
+
<img src="'.SHRSB_PLUGPATH.'images/success-delete.jpg" class="del-x" alt=""/>
|
| 42 |
+
</div>
|
| 43 |
+
</div>';
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
// processing form submission
|
| 47 |
+
$status_message = "";
|
| 48 |
+
$error_message = "";
|
| 49 |
+
if(isset($_POST['save_changes_tb'])) {
|
| 50 |
+
|
| 51 |
+
// Set success message
|
| 52 |
+
$status_message = __('Your changes have been saved successfully!', 'shrsb');
|
| 53 |
+
$_POST['pageorpost'] = shrsb_set_content_type();
|
| 54 |
+
foreach (array(
|
| 55 |
+
'topbar', 'useSbSettings' , 'tb_bg_color' ,'tb_border_color', 'addv',
|
| 56 |
+
|
| 57 |
+
'likeButtonSetTop','fbLikeButtonTop','fbSendButtonTop','googlePlusOneButtonTop','tweetButtonTop','likeButtonSetSizeTop','likeButtonSetCountTop',
|
| 58 |
+
'likeButtonOrderTop','likeButtonSetAlignmentTop','pageorpost'
|
| 59 |
+
|
| 60 |
+
)as $field) {
|
| 61 |
+
if(isset($_POST[$field])) { // this is to prevent warning if $_POST[$field] is not defined
|
| 62 |
+
$shrsb_tb_plugopts[$field] = $_POST[$field];
|
| 63 |
+
} else {
|
| 64 |
+
$shrsb_tb_plugopts[$field] = NULL;
|
| 65 |
+
}
|
| 66 |
+
}
|
| 67 |
+
|
| 68 |
+
update_option('ShareaholicTopbar', $shrsb_tb_plugopts);
|
| 69 |
+
|
| 70 |
+
|
| 71 |
+
}//Closed Save
|
| 72 |
+
|
| 73 |
+
//if there was an error, construct error messages
|
| 74 |
+
if ($error_message != '') {
|
| 75 |
+
echo '
|
| 76 |
+
<div id="errmessage" class="shrsb-error">
|
| 77 |
+
<div class="dialog-left fugue f-error">
|
| 78 |
+
'.$error_message.'
|
| 79 |
+
</div>
|
| 80 |
+
<div class="dialog-right">
|
| 81 |
+
<img src="'.SHRSB_PLUGPATH.'images/error-delete.jpg" class="del-x" alt=""/>
|
| 82 |
+
</div>
|
| 83 |
+
</div>';
|
| 84 |
+
} elseif ($status_message != '') {
|
| 85 |
+
echo '<style type="text/css">#update_sb{display:none !important;}</style>
|
| 86 |
+
<div id="statmessage" class="shrsb-success">
|
| 87 |
+
<div class="dialog-left fugue f-success">
|
| 88 |
+
'.$status_message.'
|
| 89 |
+
</div>
|
| 90 |
+
<div class="dialog-right">
|
| 91 |
+
<img src="'.SHRSB_PLUGPATH.'images/success-delete.jpg" class="del-x" alt=""/>
|
| 92 |
+
</div>
|
| 93 |
+
</div>';
|
| 94 |
+
}
|
| 95 |
+
?>
|
| 96 |
+
|
| 97 |
+
<form name="sexy-bookmarks" id="sexy-bookmarks" action="" method="post">
|
| 98 |
+
<div id="shrsb-col-left" style="width: 100%">
|
| 99 |
+
<ul id="shrsb-sortables">
|
| 100 |
+
|
| 101 |
+
<li>
|
| 102 |
+
<div class="box-mid-head">
|
| 103 |
+
<h2 class="fugue f-globe-plus"><?php _e('Top Bar', 'shrsb'); ?> <span style="color:orange;">* <?php _e('switch on "new mode" in the SexyBookmarks tab to enable', 'shrsb'); ?></span></h2>
|
| 104 |
+
</div>
|
| 105 |
+
<div class="box-mid-body" id="toggle2">
|
| 106 |
+
<div class="padding">
|
| 107 |
+
<div id="genopts">
|
| 108 |
+
|
| 109 |
+
<table><tbody>
|
| 110 |
+
<tr class="alert-success">
|
| 111 |
+
<td><span class="shrsb_option"><?php _e('Enable the Top Sharing Bar?', 'shrsb'); ?> </span>
|
| 112 |
+
</td>
|
| 113 |
+
<td style="width:125px"><label><input <?php echo (($shrsb_tb_plugopts['topbar'] == "1")? 'checked="checked"' : ""); ?> name="topbar" id="topbar-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 114 |
+
</td><td><label><input <?php echo (($shrsb_tb_plugopts['topbar'] == "0")? 'checked="checked"' : ""); ?> name="topbar" id="topbar-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 115 |
+
</td>
|
| 116 |
+
</tr>
|
| 117 |
+
|
| 118 |
+
<tr>
|
| 119 |
+
<td><span class="shrsb_option"><?php _e('Use Default Settings?', 'shrsb'); ?></span>
|
| 120 |
+
</td>
|
| 121 |
+
<td style="width:125px"><label><input <?php echo (($shrsb_tb_plugopts['useSbSettings'] == "1")? 'checked="checked"' : ""); ?> name="useSbSettings" id="useSbSettings-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 122 |
+
</td><td><label><input <?php echo (($shrsb_tb_plugopts['useSbSettings'] == "0")? 'checked="checked"' : ""); ?> name="useSbSettings" id="useSbSettings-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 123 |
+
</td>
|
| 124 |
+
</tr>
|
| 125 |
+
<tr class="topbar_prefs" style="display:none">
|
| 126 |
+
<td><label class="tab" for="tb_bg_color" style="margin-top:7px;"><?php _e('Background Color for Toolbar:', 'shrsb'); ?></label></td>
|
| 127 |
+
<td><input style="margin-top:7px;" type="text" id="tb_bg_color" name="tb_bg_color" value="<?php echo $shrsb_tb_plugopts['tb_bg_color']; ?>" /></td>
|
| 128 |
+
<td style="padding-bottom: 9px;"><div id="tb_bg_color_picker" class ="color_selector">
|
| 129 |
+
<div style="background-color:<?php echo $shrsb_tb_plugopts['tb_bg_color']; ?>; "></div>
|
| 130 |
+
</div>
|
| 131 |
+
</td>
|
| 132 |
+
<td><div id="tb_bg_color_picker_holder" style="display:none; margin-top: 5px; position: absolute;" ></div></td>
|
| 133 |
+
<td> <div id="tb_bg_color_reset" style="margin-left: 5px;"><a href="javascript:void(0);"><?php _e('reset', 'shrsb'); ?></a></div></td>
|
| 134 |
+
</tr>
|
| 135 |
+
<tr class="topbar_prefs" style="display:none">
|
| 136 |
+
<td><label class="tab" for="tb_border_color" style="margin-top:7px;"><?php _e('Bottom border color:', 'shrsb'); ?></label></td>
|
| 137 |
+
<td><input style="margin-top:7px;" type="text" id="tb_border_color" name="tb_border_color" value="<?php echo $shrsb_tb_plugopts['tb_border_color']; ?>" /></td>
|
| 138 |
+
<td style="padding-bottom: 9px;"><div id="tb_border_color_picker" class ="color_selector">
|
| 139 |
+
<div style="background-color:<?php echo $shrsb_tb_plugopts['tb_border_color']; ?>; "></div>
|
| 140 |
+
</div>
|
| 141 |
+
</td>
|
| 142 |
+
<td><div id="tb_border_color_picker_holder" style="display:none; margin-top: 5px; position: absolute;" ></div></td>
|
| 143 |
+
<td> <div id="tb_border_color_reset" style="margin-left: 5px;"><a href="javascript:void(0);"><?php _e('reset', 'shrsb'); ?></a></div></td>
|
| 144 |
+
</tr>
|
| 145 |
+
|
| 146 |
+
<tr>
|
| 147 |
+
<td><span class="shrsb_option"><?php _e('Show Message?', 'shrsb'); ?></span>
|
| 148 |
+
</td>
|
| 149 |
+
<td style="width:125px"><label><input <?php echo (($shrsb_tb_plugopts['addv'] == "1")? 'checked="checked"' : ""); ?> name="addv" id="addv-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 150 |
+
</td><td><label><input <?php echo (($shrsb_tb_plugopts['addv'] == "0")? 'checked="checked"' : ""); ?> name="addv" id="addv-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 151 |
+
</td>
|
| 152 |
+
</tr>
|
| 153 |
+
|
| 154 |
+
</tbody></table>
|
| 155 |
+
|
| 156 |
+
<br />
|
| 157 |
+
|
| 158 |
+
<!-- <span style="display:block;"><?php echo sprintf(__('Check out %sour blog%s for additional customization options.', 'shrsb'), '<a target="_blank" href="http://blog.shareaholic.com/?p=1917">', '</a>'); ?></span><br />-->
|
| 159 |
+
</div>
|
| 160 |
+
</div>
|
| 161 |
+
</div>
|
| 162 |
+
|
| 163 |
+
</li>
|
| 164 |
+
<li>
|
| 165 |
+
<div class="box-mid-head">
|
| 166 |
+
<h2 class="fugue f-globe-plus"><?php _e('Top Bar Sharing Buttons', 'shrsb'); ?></h2>
|
| 167 |
+
</div>
|
| 168 |
+
<div class="box-mid-body" id="toggle2">
|
| 169 |
+
<div class="padding">
|
| 170 |
+
<div id="genopts">
|
| 171 |
+
|
| 172 |
+
|
| 173 |
+
<table><tbody>
|
| 174 |
+
|
| 175 |
+
<tr>
|
| 176 |
+
<td><span class="shrsb_option"><?php _e('Customize the buttons to be shown in topbar?', 'shrsb'); ?> </span>
|
| 177 |
+
</td>
|
| 178 |
+
<td style="width:125px"><label><input <?php echo (($shrsb_tb_plugopts['likeButtonSetTop'] == "1")? 'checked="checked"' : ""); ?> name="likeButtonSetTop" id="likeButtonSetTop-yes" type="radio" value="1" /> <?php _e('Yes', 'shrsb'); ?></label>
|
| 179 |
+
</td><td><label><input <?php echo (($shrsb_tb_plugopts['likeButtonSetTop'] == "0")? 'checked="checked"' : ""); ?> name="likeButtonSetTop" id="likeButtonSetTop-no" type="radio" value="0" /> <?php _e('No', 'shrsb'); ?></label>
|
| 180 |
+
</td>
|
| 181 |
+
|
| 182 |
+
</tr>
|
| 183 |
+
<?php
|
| 184 |
+
shrsb_likeButtonSetHTML($shrsb_tb_plugopts,'Top');
|
| 185 |
+
?>
|
| 186 |
+
|
| 187 |
+
</tbody></table>
|
| 188 |
+
|
| 189 |
+
</div>
|
| 190 |
+
</div>
|
| 191 |
+
</div>
|
| 192 |
+
|
| 193 |
+
</li>
|
| 194 |
+
<li>
|
| 195 |
+
<div class="box-mid-head">
|
| 196 |
+
<h2 class="fugue f-footer"><?php _e('Top Bar Placement', 'shrsb'); ?></h2>
|
| 197 |
+
</div>
|
| 198 |
+
<div class="box-mid-body" id="toggle5">
|
| 199 |
+
<div class="padding">
|
| 200 |
+
|
| 201 |
+
<?php shrsb_options_menu_type($shrsb_tb_plugopts['pageorpost']); ?>
|
| 202 |
+
|
| 203 |
+
<br />
|
| 204 |
+
</div>
|
| 205 |
+
</div>
|
| 206 |
+
</li>
|
| 207 |
+
</ul>
|
| 208 |
+
<div style="clear:both;"></div>
|
| 209 |
+
<input type="hidden" name="save_changes_tb" value="1" />
|
| 210 |
+
<div class="shrsbsubmit"><input type="submit" id="save_changes_tb" value="<?php _e('Save Changes', 'shrsb'); ?>" /></div>
|
| 211 |
+
</form>
|
| 212 |
+
<form action="" method="post">
|
| 213 |
+
<input type="hidden" name="reset_all_options_tb" id="reset_all_options_tb" value="0" />
|
| 214 |
+
<div class="shrsbreset"><input type="submit" value="<?php _e('Reset Settings', 'shrsb'); ?>" /></div>
|
| 215 |
+
</form>
|
| 216 |
+
|
| 217 |
+
<?php echo shrsb_getfooter(); ?>
|
| 218 |
+
|
| 219 |
+
</div>
|
| 220 |
+
|
| 221 |
+
<?php
|
| 222 |
+
|
| 223 |
+
//Right Side helpful links
|
| 224 |
+
echo shrsb_right_side_menu();
|
| 225 |
+
//Snap Engage
|
| 226 |
+
echo get_snapengage();
|
| 227 |
+
|
| 228 |
+
}//closing brace for function "shrsb_settings_page"
|
| 229 |
+
|
| 230 |
+
?>
|
includes/widget.php
ADDED
|
@@ -0,0 +1,53 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/*
|
| 4 |
+
* Creating the widget for the WordPress Dashboard
|
| 5 |
+
*/
|
| 6 |
+
|
| 7 |
+
class ShareaholicWidget extends WP_Widget{
|
| 8 |
+
|
| 9 |
+
function ShareaholicWidget(){
|
| 10 |
+
//Actula Widget Code goes here
|
| 11 |
+
parent::WP_Widget(false,$name = "Shareaholic");
|
| 12 |
+
}
|
| 13 |
+
|
| 14 |
+
function top_sharers($domain){
|
| 15 |
+
echo '<script type="text/javascript" src="//shareaholic.com/media/js/topsharers.js?domain='.$domain.'"></script>';
|
| 16 |
+
}
|
| 17 |
+
|
| 18 |
+
function widget($args,$instance){
|
| 19 |
+
//Output the Widget Contet
|
| 20 |
+
extract($args);
|
| 21 |
+
$this->top_sharers($this->get_domain());
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
function update($new_instance, $old_instance){
|
| 25 |
+
//process and save the widget options
|
| 26 |
+
return $new_instance;
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
function form($instance){
|
| 30 |
+
//Output the Options for admin
|
| 31 |
+
}
|
| 32 |
+
|
| 33 |
+
function get_domain(){
|
| 34 |
+
$site_url = get_option("siteurl");
|
| 35 |
+
preg_match("/^(http?:\/\/)?([^\/]+)/i",$site_url , $matches);
|
| 36 |
+
$host = $matches[2];
|
| 37 |
+
$new_url = ereg_replace('www\.','',$host);
|
| 38 |
+
$domain = parse_url($new_url);
|
| 39 |
+
if(!empty($domain["host"])){
|
| 40 |
+
return $domain["host"];
|
| 41 |
+
}else{
|
| 42 |
+
return $domain["path"];
|
| 43 |
+
}
|
| 44 |
+
return $domain;
|
| 45 |
+
}
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
function shrsb_register_widget() {
|
| 49 |
+
register_widget('ShareaholicWidget');
|
| 50 |
+
}
|
| 51 |
+
|
| 52 |
+
add_action( 'widgets_init', 'shrsb_register_widget' );
|
| 53 |
+
?>
|
js/bootstrap/bootstrap.js
ADDED
|
@@ -0,0 +1,1733 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/* ===================================================
|
| 2 |
+
* bootstrap-transition.js v2.0.0
|
| 3 |
+
* http://twitter.github.com/bootstrap/javascript.html#transitions
|
| 4 |
+
* ===================================================
|
| 5 |
+
* Copyright 2012 Twitter, Inc.
|
| 6 |
+
*
|
| 7 |
+
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 8 |
+
* you may not use this file except in compliance with the License.
|
| 9 |
+
* You may obtain a copy of the License at
|
| 10 |
+
*
|
| 11 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 12 |
+
*
|
| 13 |
+
* Unless required by applicable law or agreed to in writing, software
|
| 14 |
+
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 15 |
+
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 16 |
+
* See the License for the specific language governing permissions and
|
| 17 |
+
* limitations under the License.
|
| 18 |
+
* ========================================================== */
|
| 19 |
+
|
| 20 |
+
!function( $ ) {
|
| 21 |
+
|
| 22 |
+
$(function () {
|
| 23 |
+
|
| 24 |
+
"use strict"
|
| 25 |
+
|
| 26 |
+
/* CSS TRANSITION SUPPORT (https://gist.github.com/373874)
|
| 27 |
+
* ======================================================= */
|
| 28 |
+
|
| 29 |
+
$.support.transition = (function () {
|
| 30 |
+
var thisBody = document.body || document.documentElement
|
| 31 |
+
, thisStyle = thisBody.style
|
| 32 |
+
, support = thisStyle.transition !== undefined || thisStyle.WebkitTransition !== undefined || thisStyle.MozTransition !== undefined || thisStyle.MsTransition !== undefined || thisStyle.OTransition !== undefined
|
| 33 |
+
|
| 34 |
+
return support && {
|
| 35 |
+
end: (function () {
|
| 36 |
+
var transitionEnd = "TransitionEnd"
|
| 37 |
+
if ( $.browser.webkit ) {
|
| 38 |
+
transitionEnd = "webkitTransitionEnd"
|
| 39 |
+
} else if ( $.browser.mozilla ) {
|
| 40 |
+
transitionEnd = "transitionend"
|
| 41 |
+
} else if ( $.browser.opera ) {
|
| 42 |
+
transitionEnd = "oTransitionEnd"
|
| 43 |
+
}
|
| 44 |
+
return transitionEnd
|
| 45 |
+
}())
|
| 46 |
+
}
|
| 47 |
+
})()
|
| 48 |
+
|
| 49 |
+
})
|
| 50 |
+
|
| 51 |
+
}( window.jQuery )
|
| 52 |
+
|
| 53 |
+
/* =========================================================
|
| 54 |
+
* bootstrap-modal.js v2.0.0
|
| 55 |
+
* http://twitter.github.com/bootstrap/javascript.html#modals
|
| 56 |
+
* =========================================================
|
| 57 |
+
* Copyright 2012 Twitter, Inc.
|
| 58 |
+
*
|
| 59 |
+
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 60 |
+
* you may not use this file except in compliance with the License.
|
| 61 |
+
* You may obtain a copy of the License at
|
| 62 |
+
*
|
| 63 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 64 |
+
*
|
| 65 |
+
* Unless required by applicable law or agreed to in writing, software
|
| 66 |
+
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 67 |
+
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 68 |
+
* See the License for the specific language governing permissions and
|
| 69 |
+
* limitations under the License.
|
| 70 |
+
* ========================================================= */
|
| 71 |
+
|
| 72 |
+
|
| 73 |
+
!function( $ ){
|
| 74 |
+
|
| 75 |
+
"use strict"
|
| 76 |
+
|
| 77 |
+
/* MODAL CLASS DEFINITION
|
| 78 |
+
* ====================== */
|
| 79 |
+
|
| 80 |
+
var Modal = function ( content, options ) {
|
| 81 |
+
this.options = $.extend({}, $.fn.modal.defaults, options)
|
| 82 |
+
this.$element = $(content)
|
| 83 |
+
.delegate('[data-dismiss="modal"]', 'click.dismiss.modal', $.proxy(this.hide, this))
|
| 84 |
+
}
|
| 85 |
+
|
| 86 |
+
Modal.prototype = {
|
| 87 |
+
|
| 88 |
+
constructor: Modal
|
| 89 |
+
|
| 90 |
+
, toggle: function () {
|
| 91 |
+
return this[!this.isShown ? 'show' : 'hide']()
|
| 92 |
+
}
|
| 93 |
+
|
| 94 |
+
, show: function () {
|
| 95 |
+
var that = this
|
| 96 |
+
|
| 97 |
+
if (this.isShown) return
|
| 98 |
+
|
| 99 |
+
$('body').addClass('modal-open')
|
| 100 |
+
|
| 101 |
+
this.isShown = true
|
| 102 |
+
this.$element.trigger('show')
|
| 103 |
+
|
| 104 |
+
escape.call(this)
|
| 105 |
+
backdrop.call(this, function () {
|
| 106 |
+
var transition = $.support.transition && that.$element.hasClass('fade')
|
| 107 |
+
|
| 108 |
+
!that.$element.parent().length && that.$element.appendTo(document.body) //don't move modals dom position
|
| 109 |
+
|
| 110 |
+
that.$element
|
| 111 |
+
.show()
|
| 112 |
+
|
| 113 |
+
if (transition) {
|
| 114 |
+
that.$element[0].offsetWidth // force reflow
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
that.$element.addClass('in')
|
| 118 |
+
|
| 119 |
+
transition ?
|
| 120 |
+
that.$element.one($.support.transition.end, function () { that.$element.trigger('shown') }) :
|
| 121 |
+
that.$element.trigger('shown')
|
| 122 |
+
|
| 123 |
+
})
|
| 124 |
+
}
|
| 125 |
+
|
| 126 |
+
, hide: function ( e ) {
|
| 127 |
+
e && e.preventDefault()
|
| 128 |
+
|
| 129 |
+
if (!this.isShown) return
|
| 130 |
+
|
| 131 |
+
var that = this
|
| 132 |
+
this.isShown = false
|
| 133 |
+
|
| 134 |
+
$('body').removeClass('modal-open')
|
| 135 |
+
|
| 136 |
+
escape.call(this)
|
| 137 |
+
|
| 138 |
+
this.$element
|
| 139 |
+
.trigger('hide')
|
| 140 |
+
.removeClass('in')
|
| 141 |
+
|
| 142 |
+
$.support.transition && this.$element.hasClass('fade') ?
|
| 143 |
+
hideWithTransition.call(this) :
|
| 144 |
+
hideModal.call(this)
|
| 145 |
+
}
|
| 146 |
+
|
| 147 |
+
}
|
| 148 |
+
|
| 149 |
+
|
| 150 |
+
/* MODAL PRIVATE METHODS
|
| 151 |
+
* ===================== */
|
| 152 |
+
|
| 153 |
+
function hideWithTransition() {
|
| 154 |
+
var that = this
|
| 155 |
+
, timeout = setTimeout(function () {
|
| 156 |
+
that.$element.off($.support.transition.end)
|
| 157 |
+
hideModal.call(that)
|
| 158 |
+
}, 500)
|
| 159 |
+
|
| 160 |
+
this.$element.one($.support.transition.end, function () {
|
| 161 |
+
clearTimeout(timeout)
|
| 162 |
+
hideModal.call(that)
|
| 163 |
+
})
|
| 164 |
+
}
|
| 165 |
+
|
| 166 |
+
function hideModal( that ) {
|
| 167 |
+
this.$element
|
| 168 |
+
.hide()
|
| 169 |
+
.trigger('hidden')
|
| 170 |
+
|
| 171 |
+
backdrop.call(this)
|
| 172 |
+
}
|
| 173 |
+
|
| 174 |
+
function backdrop( callback ) {
|
| 175 |
+
var that = this
|
| 176 |
+
, animate = this.$element.hasClass('fade') ? 'fade' : ''
|
| 177 |
+
|
| 178 |
+
if (this.isShown && this.options.backdrop) {
|
| 179 |
+
var doAnimate = $.support.transition && animate
|
| 180 |
+
|
| 181 |
+
this.$backdrop = $('<div class="modal-backdrop ' + animate + '" />')
|
| 182 |
+
.appendTo(document.body)
|
| 183 |
+
|
| 184 |
+
if (this.options.backdrop != 'static') {
|
| 185 |
+
this.$backdrop.click($.proxy(this.hide, this))
|
| 186 |
+
}
|
| 187 |
+
|
| 188 |
+
if (doAnimate) this.$backdrop[0].offsetWidth // force reflow
|
| 189 |
+
|
| 190 |
+
this.$backdrop.addClass('in')
|
| 191 |
+
|
| 192 |
+
doAnimate ?
|
| 193 |
+
this.$backdrop.one($.support.transition.end, callback) :
|
| 194 |
+
callback()
|
| 195 |
+
|
| 196 |
+
} else if (!this.isShown && this.$backdrop) {
|
| 197 |
+
this.$backdrop.removeClass('in')
|
| 198 |
+
|
| 199 |
+
$.support.transition && this.$element.hasClass('fade')?
|
| 200 |
+
this.$backdrop.one($.support.transition.end, $.proxy(removeBackdrop, this)) :
|
| 201 |
+
removeBackdrop.call(this)
|
| 202 |
+
|
| 203 |
+
} else if (callback) {
|
| 204 |
+
callback()
|
| 205 |
+
}
|
| 206 |
+
}
|
| 207 |
+
|
| 208 |
+
function removeBackdrop() {
|
| 209 |
+
this.$backdrop.remove()
|
| 210 |
+
this.$backdrop = null
|
| 211 |
+
}
|
| 212 |
+
|
| 213 |
+
function escape() {
|
| 214 |
+
var that = this
|
| 215 |
+
if (this.isShown && this.options.keyboard) {
|
| 216 |
+
$(document).on('keyup.dismiss.modal', function ( e ) {
|
| 217 |
+
e.which == 27 && that.hide()
|
| 218 |
+
})
|
| 219 |
+
} else if (!this.isShown) {
|
| 220 |
+
$(document).off('keyup.dismiss.modal')
|
| 221 |
+
}
|
| 222 |
+
}
|
| 223 |
+
|
| 224 |
+
|
| 225 |
+
/* MODAL PLUGIN DEFINITION
|
| 226 |
+
* ======================= */
|
| 227 |
+
|
| 228 |
+
$.fn.modal = function ( option ) {
|
| 229 |
+
return this.each(function () {
|
| 230 |
+
var $this = $(this)
|
| 231 |
+
, data = $this.data('modal')
|
| 232 |
+
, options = typeof option == 'object' && option
|
| 233 |
+
if (!data) $this.data('modal', (data = new Modal(this, options)))
|
| 234 |
+
if (typeof option == 'string') data[option]()
|
| 235 |
+
else data.show()
|
| 236 |
+
})
|
| 237 |
+
}
|
| 238 |
+
|
| 239 |
+
$.fn.modal.defaults = {
|
| 240 |
+
backdrop: true
|
| 241 |
+
, keyboard: true
|
| 242 |
+
}
|
| 243 |
+
|
| 244 |
+
$.fn.modal.Constructor = Modal
|
| 245 |
+
|
| 246 |
+
|
| 247 |
+
/* MODAL DATA-API
|
| 248 |
+
* ============== */
|
| 249 |
+
|
| 250 |
+
$(function () {
|
| 251 |
+
$('body').on('click.modal.data-api', '[data-toggle="modal"]', function ( e ) {
|
| 252 |
+
var $this = $(this), href
|
| 253 |
+
, $target = $($this.attr('data-target') || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7
|
| 254 |
+
, option = $target.data('modal') ? 'toggle' : $.extend({}, $target.data(), $this.data())
|
| 255 |
+
|
| 256 |
+
e.preventDefault()
|
| 257 |
+
$target.modal(option)
|
| 258 |
+
})
|
| 259 |
+
})
|
| 260 |
+
|
| 261 |
+
}( window.jQuery )
|
| 262 |
+
|
| 263 |
+
/* ============================================================
|
| 264 |
+
* bootstrap-dropdown.js v2.0.0
|
| 265 |
+
* http://twitter.github.com/bootstrap/javascript.html#dropdowns
|
| 266 |
+
* ============================================================
|
| 267 |
+
* Copyright 2012 Twitter, Inc.
|
| 268 |
+
*
|
| 269 |
+
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 270 |
+
* you may not use this file except in compliance with the License.
|
| 271 |
+
* You may obtain a copy of the License at
|
| 272 |
+
*
|
| 273 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 274 |
+
*
|
| 275 |
+
* Unless required by applicable law or agreed to in writing, software
|
| 276 |
+
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 277 |
+
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 278 |
+
* See the License for the specific language governing permissions and
|
| 279 |
+
* limitations under the License.
|
| 280 |
+
* ============================================================ */
|
| 281 |
+
|
| 282 |
+
|
| 283 |
+
!function( $ ){
|
| 284 |
+
|
| 285 |
+
"use strict"
|
| 286 |
+
|
| 287 |
+
/* DROPDOWN CLASS DEFINITION
|
| 288 |
+
* ========================= */
|
| 289 |
+
|
| 290 |
+
var toggle = '[data-toggle="dropdown"]'
|
| 291 |
+
, Dropdown = function ( element ) {
|
| 292 |
+
var $el = $(element).on('click.dropdown.data-api', this.toggle)
|
| 293 |
+
$('html').on('click.dropdown.data-api', function () {
|
| 294 |
+
$el.parent().removeClass('open')
|
| 295 |
+
})
|
| 296 |
+
}
|
| 297 |
+
|
| 298 |
+
Dropdown.prototype = {
|
| 299 |
+
|
| 300 |
+
constructor: Dropdown
|
| 301 |
+
|
| 302 |
+
, toggle: function ( e ) {
|
| 303 |
+
var $this = $(this)
|
| 304 |
+
, selector = $this.attr('data-target')
|
| 305 |
+
, $parent
|
| 306 |
+
, isActive
|
| 307 |
+
|
| 308 |
+
if (!selector) {
|
| 309 |
+
selector = $this.attr('href')
|
| 310 |
+
selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7
|
| 311 |
+
}
|
| 312 |
+
|
| 313 |
+
$parent = $(selector)
|
| 314 |
+
$parent.length || ($parent = $this.parent())
|
| 315 |
+
|
| 316 |
+
isActive = $parent.hasClass('open')
|
| 317 |
+
|
| 318 |
+
clearMenus()
|
| 319 |
+
!isActive && $parent.toggleClass('open')
|
| 320 |
+
|
| 321 |
+
return false
|
| 322 |
+
}
|
| 323 |
+
|
| 324 |
+
}
|
| 325 |
+
|
| 326 |
+
function clearMenus() {
|
| 327 |
+
$(toggle).parent().removeClass('open')
|
| 328 |
+
}
|
| 329 |
+
|
| 330 |
+
|
| 331 |
+
/* DROPDOWN PLUGIN DEFINITION
|
| 332 |
+
* ========================== */
|
| 333 |
+
|
| 334 |
+
$.fn.dropdown = function ( option ) {
|
| 335 |
+
return this.each(function () {
|
| 336 |
+
var $this = $(this)
|
| 337 |
+
, data = $this.data('dropdown')
|
| 338 |
+
if (!data) $this.data('dropdown', (data = new Dropdown(this)))
|
| 339 |
+
if (typeof option == 'string') data[option].call($this)
|
| 340 |
+
})
|
| 341 |
+
}
|
| 342 |
+
|
| 343 |
+
$.fn.dropdown.Constructor = Dropdown
|
| 344 |
+
|
| 345 |
+
|
| 346 |
+
/* APPLY TO STANDARD DROPDOWN ELEMENTS
|
| 347 |
+
* =================================== */
|
| 348 |
+
|
| 349 |
+
$(function () {
|
| 350 |
+
$('html').on('click.dropdown.data-api', clearMenus)
|
| 351 |
+
$('body').on('click.dropdown.data-api', toggle, Dropdown.prototype.toggle)
|
| 352 |
+
})
|
| 353 |
+
|
| 354 |
+
}( window.jQuery )
|
| 355 |
+
|
| 356 |
+
/* =============================================================
|
| 357 |
+
* bootstrap-scrollspy.js v2.0.0
|
| 358 |
+
* http://twitter.github.com/bootstrap/javascript.html#scrollspy
|
| 359 |
+
* =============================================================
|
| 360 |
+
* Copyright 2012 Twitter, Inc.
|
| 361 |
+
*
|
| 362 |
+
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 363 |
+
* you may not use this file except in compliance with the License.
|
| 364 |
+
* You may obtain a copy of the License at
|
| 365 |
+
*
|
| 366 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 367 |
+
*
|
| 368 |
+
* Unless required by applicable law or agreed to in writing, software
|
| 369 |
+
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 370 |
+
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 371 |
+
* See the License for the specific language governing permissions and
|
| 372 |
+
* limitations under the License.
|
| 373 |
+
* ============================================================== */
|
| 374 |
+
|
| 375 |
+
!function ( $ ) {
|
| 376 |
+
|
| 377 |
+
"use strict"
|
| 378 |
+
|
| 379 |
+
/* SCROLLSPY CLASS DEFINITION
|
| 380 |
+
* ========================== */
|
| 381 |
+
|
| 382 |
+
function ScrollSpy( element, options) {
|
| 383 |
+
var process = $.proxy(this.process, this)
|
| 384 |
+
, $element = $(element).is('body') ? $(window) : $(element)
|
| 385 |
+
, href
|
| 386 |
+
this.options = $.extend({}, $.fn.scrollspy.defaults, options)
|
| 387 |
+
this.$scrollElement = $element.on('scroll.scroll.data-api', process)
|
| 388 |
+
this.selector = (this.options.target
|
| 389 |
+
|| ((href = $(element).attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7
|
| 390 |
+
|| '') + ' .nav li > a'
|
| 391 |
+
this.$body = $('body').on('click.scroll.data-api', this.selector, process)
|
| 392 |
+
this.refresh()
|
| 393 |
+
this.process()
|
| 394 |
+
}
|
| 395 |
+
|
| 396 |
+
ScrollSpy.prototype = {
|
| 397 |
+
|
| 398 |
+
constructor: ScrollSpy
|
| 399 |
+
|
| 400 |
+
, refresh: function () {
|
| 401 |
+
this.targets = this.$body
|
| 402 |
+
.find(this.selector)
|
| 403 |
+
.map(function () {
|
| 404 |
+
var href = $(this).attr('href')
|
| 405 |
+
return /^#\w/.test(href) && $(href).length ? href : null
|
| 406 |
+
})
|
| 407 |
+
|
| 408 |
+
this.offsets = $.map(this.targets, function (id) {
|
| 409 |
+
return $(id).position().top
|
| 410 |
+
})
|
| 411 |
+
}
|
| 412 |
+
|
| 413 |
+
, process: function () {
|
| 414 |
+
var scrollTop = this.$scrollElement.scrollTop() + this.options.offset
|
| 415 |
+
, offsets = this.offsets
|
| 416 |
+
, targets = this.targets
|
| 417 |
+
, activeTarget = this.activeTarget
|
| 418 |
+
, i
|
| 419 |
+
|
| 420 |
+
for (i = offsets.length; i--;) {
|
| 421 |
+
activeTarget != targets[i]
|
| 422 |
+
&& scrollTop >= offsets[i]
|
| 423 |
+
&& (!offsets[i + 1] || scrollTop <= offsets[i + 1])
|
| 424 |
+
&& this.activate( targets[i] )
|
| 425 |
+
}
|
| 426 |
+
}
|
| 427 |
+
|
| 428 |
+
, activate: function (target) {
|
| 429 |
+
var active
|
| 430 |
+
|
| 431 |
+
this.activeTarget = target
|
| 432 |
+
|
| 433 |
+
this.$body
|
| 434 |
+
.find(this.selector).parent('.active')
|
| 435 |
+
.removeClass('active')
|
| 436 |
+
|
| 437 |
+
active = this.$body
|
| 438 |
+
.find(this.selector + '[href="' + target + '"]')
|
| 439 |
+
.parent('li')
|
| 440 |
+
.addClass('active')
|
| 441 |
+
|
| 442 |
+
if ( active.parent('.dropdown-menu') ) {
|
| 443 |
+
active.closest('li.dropdown').addClass('active')
|
| 444 |
+
}
|
| 445 |
+
}
|
| 446 |
+
|
| 447 |
+
}
|
| 448 |
+
|
| 449 |
+
|
| 450 |
+
/* SCROLLSPY PLUGIN DEFINITION
|
| 451 |
+
* =========================== */
|
| 452 |
+
|
| 453 |
+
$.fn.scrollspy = function ( option ) {
|
| 454 |
+
return this.each(function () {
|
| 455 |
+
var $this = $(this)
|
| 456 |
+
, data = $this.data('scrollspy')
|
| 457 |
+
, options = typeof option == 'object' && option
|
| 458 |
+
if (!data) $this.data('scrollspy', (data = new ScrollSpy(this, options)))
|
| 459 |
+
if (typeof option == 'string') data[option]()
|
| 460 |
+
})
|
| 461 |
+
}
|
| 462 |
+
|
| 463 |
+
$.fn.scrollspy.Constructor = ScrollSpy
|
| 464 |
+
|
| 465 |
+
$.fn.scrollspy.defaults = {
|
| 466 |
+
offset: 10
|
| 467 |
+
}
|
| 468 |
+
|
| 469 |
+
|
| 470 |
+
/* SCROLLSPY DATA-API
|
| 471 |
+
* ================== */
|
| 472 |
+
|
| 473 |
+
$(function () {
|
| 474 |
+
$('[data-spy="scroll"]').each(function () {
|
| 475 |
+
var $spy = $(this)
|
| 476 |
+
$spy.scrollspy($spy.data())
|
| 477 |
+
})
|
| 478 |
+
})
|
| 479 |
+
|
| 480 |
+
}( window.jQuery )
|
| 481 |
+
|
| 482 |
+
/* ========================================================
|
| 483 |
+
* bootstrap-tab.js v2.0.0
|
| 484 |
+
* http://twitter.github.com/bootstrap/javascript.html#tabs
|
| 485 |
+
* ========================================================
|
| 486 |
+
* Copyright 2012 Twitter, Inc.
|
| 487 |
+
*
|
| 488 |
+
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 489 |
+
* you may not use this file except in compliance with the License.
|
| 490 |
+
* You may obtain a copy of the License at
|
| 491 |
+
*
|
| 492 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 493 |
+
*
|
| 494 |
+
* Unless required by applicable law or agreed to in writing, software
|
| 495 |
+
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 496 |
+
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 497 |
+
* See the License for the specific language governing permissions and
|
| 498 |
+
* limitations under the License.
|
| 499 |
+
* ======================================================== */
|
| 500 |
+
|
| 501 |
+
|
| 502 |
+
!function( $ ){
|
| 503 |
+
|
| 504 |
+
"use strict"
|
| 505 |
+
|
| 506 |
+
/* TAB CLASS DEFINITION
|
| 507 |
+
* ==================== */
|
| 508 |
+
|
| 509 |
+
var Tab = function ( element ) {
|
| 510 |
+
this.element = $(element)
|
| 511 |
+
}
|
| 512 |
+
|
| 513 |
+
Tab.prototype = {
|
| 514 |
+
|
| 515 |
+
constructor: Tab
|
| 516 |
+
|
| 517 |
+
, show: function () {
|
| 518 |
+
var $this = this.element
|
| 519 |
+
, $ul = $this.closest('ul:not(.dropdown-menu)')
|
| 520 |
+
, selector = $this.attr('data-target')
|
| 521 |
+
, previous
|
| 522 |
+
, $target
|
| 523 |
+
|
| 524 |
+
if (!selector) {
|
| 525 |
+
selector = $this.attr('href')
|
| 526 |
+
selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7
|
| 527 |
+
}
|
| 528 |
+
|
| 529 |
+
if ( $this.parent('li').hasClass('active') ) return
|
| 530 |
+
|
| 531 |
+
previous = $ul.find('.active a').last()[0]
|
| 532 |
+
|
| 533 |
+
$this.trigger({
|
| 534 |
+
type: 'show'
|
| 535 |
+
, relatedTarget: previous
|
| 536 |
+
})
|
| 537 |
+
|
| 538 |
+
$target = $(selector)
|
| 539 |
+
|
| 540 |
+
this.activate($this.parent('li'), $ul)
|
| 541 |
+
this.activate($target, $target.parent(), function () {
|
| 542 |
+
$this.trigger({
|
| 543 |
+
type: 'shown'
|
| 544 |
+
, relatedTarget: previous
|
| 545 |
+
})
|
| 546 |
+
})
|
| 547 |
+
}
|
| 548 |
+
|
| 549 |
+
, activate: function ( element, container, callback) {
|
| 550 |
+
var $active = container.find('> .active')
|
| 551 |
+
, transition = callback
|
| 552 |
+
&& $.support.transition
|
| 553 |
+
&& $active.hasClass('fade')
|
| 554 |
+
|
| 555 |
+
function next() {
|
| 556 |
+
$active
|
| 557 |
+
.removeClass('active')
|
| 558 |
+
.find('> .dropdown-menu > .active')
|
| 559 |
+
.removeClass('active')
|
| 560 |
+
|
| 561 |
+
element.addClass('active')
|
| 562 |
+
|
| 563 |
+
if (transition) {
|
| 564 |
+
element[0].offsetWidth // reflow for transition
|
| 565 |
+
element.addClass('in')
|
| 566 |
+
} else {
|
| 567 |
+
element.removeClass('fade')
|
| 568 |
+
}
|
| 569 |
+
|
| 570 |
+
if ( element.parent('.dropdown-menu') ) {
|
| 571 |
+
element.closest('li.dropdown').addClass('active')
|
| 572 |
+
}
|
| 573 |
+
|
| 574 |
+
callback && callback()
|
| 575 |
+
}
|
| 576 |
+
|
| 577 |
+
transition ?
|
| 578 |
+
$active.one($.support.transition.end, next) :
|
| 579 |
+
next()
|
| 580 |
+
|
| 581 |
+
$active.removeClass('in')
|
| 582 |
+
}
|
| 583 |
+
}
|
| 584 |
+
|
| 585 |
+
|
| 586 |
+
/* TAB PLUGIN DEFINITION
|
| 587 |
+
* ===================== */
|
| 588 |
+
|
| 589 |
+
$.fn.tab = function ( option ) {
|
| 590 |
+
return this.each(function () {
|
| 591 |
+
var $this = $(this)
|
| 592 |
+
, data = $this.data('tab')
|
| 593 |
+
if (!data) $this.data('tab', (data = new Tab(this)))
|
| 594 |
+
if (typeof option == 'string') data[option]()
|
| 595 |
+
})
|
| 596 |
+
}
|
| 597 |
+
|
| 598 |
+
$.fn.tab.Constructor = Tab
|
| 599 |
+
|
| 600 |
+
|
| 601 |
+
/* TAB DATA-API
|
| 602 |
+
* ============ */
|
| 603 |
+
|
| 604 |
+
$(function () {
|
| 605 |
+
$('body').on('click.tab.data-api', '[data-toggle="tab"], [data-toggle="pill"]', function (e) {
|
| 606 |
+
e.preventDefault()
|
| 607 |
+
$(this).tab('show')
|
| 608 |
+
})
|
| 609 |
+
})
|
| 610 |
+
|
| 611 |
+
}( window.jQuery )
|
| 612 |
+
|
| 613 |
+
/* ===========================================================
|
| 614 |
+
* bootstrap-tooltip.js v2.0.0
|
| 615 |
+
* http://twitter.github.com/bootstrap/javascript.html#tooltips
|
| 616 |
+
* Inspired by the original jQuery.tipsy by Jason Frame
|
| 617 |
+
* ===========================================================
|
| 618 |
+
* Copyright 2012 Twitter, Inc.
|
| 619 |
+
*
|
| 620 |
+
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 621 |
+
* you may not use this file except in compliance with the License.
|
| 622 |
+
* You may obtain a copy of the License at
|
| 623 |
+
*
|
| 624 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 625 |
+
*
|
| 626 |
+
* Unless required by applicable law or agreed to in writing, software
|
| 627 |
+
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 628 |
+
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 629 |
+
* See the License for the specific language governing permissions and
|
| 630 |
+
* limitations under the License.
|
| 631 |
+
* ========================================================== */
|
| 632 |
+
|
| 633 |
+
!function( $ ) {
|
| 634 |
+
|
| 635 |
+
"use strict"
|
| 636 |
+
|
| 637 |
+
/* TOOLTIP PUBLIC CLASS DEFINITION
|
| 638 |
+
* =============================== */
|
| 639 |
+
|
| 640 |
+
var Tooltip = function ( element, options ) {
|
| 641 |
+
this.init('tooltip', element, options)
|
| 642 |
+
}
|
| 643 |
+
|
| 644 |
+
Tooltip.prototype = {
|
| 645 |
+
|
| 646 |
+
constructor: Tooltip
|
| 647 |
+
|
| 648 |
+
, init: function ( type, element, options ) {
|
| 649 |
+
var eventIn
|
| 650 |
+
, eventOut
|
| 651 |
+
|
| 652 |
+
this.type = type
|
| 653 |
+
this.$element = $(element)
|
| 654 |
+
this.options = this.getOptions(options)
|
| 655 |
+
this.enabled = true
|
| 656 |
+
|
| 657 |
+
if (this.options.trigger != 'manual') {
|
| 658 |
+
eventIn = this.options.trigger == 'hover' ? 'mouseenter' : 'focus'
|
| 659 |
+
eventOut = this.options.trigger == 'hover' ? 'mouseleave' : 'blur'
|
| 660 |
+
this.$element.on(eventIn, this.options.selector, $.proxy(this.enter, this))
|
| 661 |
+
this.$element.on(eventOut, this.options.selector, $.proxy(this.leave, this))
|
| 662 |
+
}
|
| 663 |
+
|
| 664 |
+
this.options.selector ?
|
| 665 |
+
(this._options = $.extend({}, this.options, { trigger: 'manual', selector: '' })) :
|
| 666 |
+
this.fixTitle()
|
| 667 |
+
}
|
| 668 |
+
|
| 669 |
+
, getOptions: function ( options ) {
|
| 670 |
+
options = $.extend({}, $.fn[this.type].defaults, options, this.$element.data())
|
| 671 |
+
|
| 672 |
+
if (options.delay && typeof options.delay == 'number') {
|
| 673 |
+
options.delay = {
|
| 674 |
+
show: options.delay
|
| 675 |
+
, hide: options.delay
|
| 676 |
+
}
|
| 677 |
+
}
|
| 678 |
+
|
| 679 |
+
return options
|
| 680 |
+
}
|
| 681 |
+
|
| 682 |
+
, enter: function ( e ) {
|
| 683 |
+
var self = $(e.currentTarget)[this.type](this._options).data(this.type)
|
| 684 |
+
|
| 685 |
+
if (!self.options.delay || !self.options.delay.show) {
|
| 686 |
+
self.show()
|
| 687 |
+
} else {
|
| 688 |
+
self.hoverState = 'in'
|
| 689 |
+
setTimeout(function() {
|
| 690 |
+
if (self.hoverState == 'in') {
|
| 691 |
+
self.show()
|
| 692 |
+
}
|
| 693 |
+
}, self.options.delay.show)
|
| 694 |
+
}
|
| 695 |
+
}
|
| 696 |
+
|
| 697 |
+
, leave: function ( e ) {
|
| 698 |
+
var self = $(e.currentTarget)[this.type](this._options).data(this.type)
|
| 699 |
+
|
| 700 |
+
if (!self.options.delay || !self.options.delay.hide) {
|
| 701 |
+
self.hide()
|
| 702 |
+
} else {
|
| 703 |
+
self.hoverState = 'out'
|
| 704 |
+
setTimeout(function() {
|
| 705 |
+
if (self.hoverState == 'out') {
|
| 706 |
+
self.hide()
|
| 707 |
+
}
|
| 708 |
+
}, self.options.delay.hide)
|
| 709 |
+
}
|
| 710 |
+
}
|
| 711 |
+
|
| 712 |
+
, show: function () {
|
| 713 |
+
var $tip
|
| 714 |
+
, inside
|
| 715 |
+
, pos
|
| 716 |
+
, actualWidth
|
| 717 |
+
, actualHeight
|
| 718 |
+
, placement
|
| 719 |
+
, tp
|
| 720 |
+
|
| 721 |
+
if (this.hasContent() && this.enabled) {
|
| 722 |
+
$tip = this.tip()
|
| 723 |
+
this.setContent()
|
| 724 |
+
|
| 725 |
+
if (this.options.animation) {
|
| 726 |
+
$tip.addClass('fade')
|
| 727 |
+
}
|
| 728 |
+
|
| 729 |
+
placement = typeof this.options.placement == 'function' ?
|
| 730 |
+
this.options.placement.call(this, $tip[0], this.$element[0]) :
|
| 731 |
+
this.options.placement
|
| 732 |
+
|
| 733 |
+
inside = /in/.test(placement)
|
| 734 |
+
|
| 735 |
+
$tip
|
| 736 |
+
.remove()
|
| 737 |
+
.css({ top: 0, left: 0, display: 'block' })
|
| 738 |
+
.appendTo(inside ? this.$element : document.body)
|
| 739 |
+
|
| 740 |
+
pos = this.getPosition(inside)
|
| 741 |
+
|
| 742 |
+
actualWidth = $tip[0].offsetWidth
|
| 743 |
+
actualHeight = $tip[0].offsetHeight
|
| 744 |
+
|
| 745 |
+
switch (inside ? placement.split(' ')[1] : placement) {
|
| 746 |
+
case 'bottom':
|
| 747 |
+
tp = {top: pos.top + pos.height, left: pos.left + pos.width / 2 - actualWidth / 2}
|
| 748 |
+
break
|
| 749 |
+
case 'top':
|
| 750 |
+
tp = {top: pos.top - actualHeight, left: pos.left + pos.width / 2 - actualWidth / 2}
|
| 751 |
+
break
|
| 752 |
+
case 'left':
|
| 753 |
+
tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left - actualWidth}
|
| 754 |
+
break
|
| 755 |
+
case 'right':
|
| 756 |
+
tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left + pos.width}
|
| 757 |
+
break
|
| 758 |
+
}
|
| 759 |
+
|
| 760 |
+
$tip
|
| 761 |
+
.css(tp)
|
| 762 |
+
.addClass(placement)
|
| 763 |
+
.addClass('in')
|
| 764 |
+
}
|
| 765 |
+
}
|
| 766 |
+
|
| 767 |
+
, setContent: function () {
|
| 768 |
+
var $tip = this.tip()
|
| 769 |
+
$tip.find('.tooltip-inner').html(this.getTitle())
|
| 770 |
+
$tip.removeClass('fade in top bottom left right')
|
| 771 |
+
}
|
| 772 |
+
|
| 773 |
+
, hide: function () {
|
| 774 |
+
var that = this
|
| 775 |
+
, $tip = this.tip()
|
| 776 |
+
|
| 777 |
+
$tip.removeClass('in')
|
| 778 |
+
|
| 779 |
+
function removeWithAnimation() {
|
| 780 |
+
var timeout = setTimeout(function () {
|
| 781 |
+
$tip.off($.support.transition.end).remove()
|
| 782 |
+
}, 500)
|
| 783 |
+
|
| 784 |
+
$tip.one($.support.transition.end, function () {
|
| 785 |
+
clearTimeout(timeout)
|
| 786 |
+
$tip.remove()
|
| 787 |
+
})
|
| 788 |
+
}
|
| 789 |
+
|
| 790 |
+
$.support.transition && this.$tip.hasClass('fade') ?
|
| 791 |
+
removeWithAnimation() :
|
| 792 |
+
$tip.remove()
|
| 793 |
+
}
|
| 794 |
+
|
| 795 |
+
, fixTitle: function () {
|
| 796 |
+
var $e = this.$element
|
| 797 |
+
if ($e.attr('title') || typeof($e.attr('data-original-title')) != 'string') {
|
| 798 |
+
$e.attr('data-original-title', $e.attr('title') || '').removeAttr('title')
|
| 799 |
+
}
|
| 800 |
+
}
|
| 801 |
+
|
| 802 |
+
, hasContent: function () {
|
| 803 |
+
return this.getTitle()
|
| 804 |
+
}
|
| 805 |
+
|
| 806 |
+
, getPosition: function (inside) {
|
| 807 |
+
return $.extend({}, (inside ? {top: 0, left: 0} : this.$element.offset()), {
|
| 808 |
+
width: this.$element[0].offsetWidth
|
| 809 |
+
, height: this.$element[0].offsetHeight
|
| 810 |
+
})
|
| 811 |
+
}
|
| 812 |
+
|
| 813 |
+
, getTitle: function () {
|
| 814 |
+
var title
|
| 815 |
+
, $e = this.$element
|
| 816 |
+
, o = this.options
|
| 817 |
+
|
| 818 |
+
title = $e.attr('data-original-title')
|
| 819 |
+
|| (typeof o.title == 'function' ? o.title.call($e[0]) : o.title)
|
| 820 |
+
|
| 821 |
+
title = title.toString().replace(/(^\s*|\s*$)/, "")
|
| 822 |
+
|
| 823 |
+
return title
|
| 824 |
+
}
|
| 825 |
+
|
| 826 |
+
, tip: function () {
|
| 827 |
+
return this.$tip = this.$tip || $(this.options.template)
|
| 828 |
+
}
|
| 829 |
+
|
| 830 |
+
, validate: function () {
|
| 831 |
+
if (!this.$element[0].parentNode) {
|
| 832 |
+
this.hide()
|
| 833 |
+
this.$element = null
|
| 834 |
+
this.options = null
|
| 835 |
+
}
|
| 836 |
+
}
|
| 837 |
+
|
| 838 |
+
, enable: function () {
|
| 839 |
+
this.enabled = true
|
| 840 |
+
}
|
| 841 |
+
|
| 842 |
+
, disable: function () {
|
| 843 |
+
this.enabled = false
|
| 844 |
+
}
|
| 845 |
+
|
| 846 |
+
, toggleEnabled: function () {
|
| 847 |
+
this.enabled = !this.enabled
|
| 848 |
+
}
|
| 849 |
+
|
| 850 |
+
, toggle: function () {
|
| 851 |
+
this[this.tip().hasClass('in') ? 'hide' : 'show']()
|
| 852 |
+
}
|
| 853 |
+
|
| 854 |
+
}
|
| 855 |
+
|
| 856 |
+
|
| 857 |
+
/* TOOLTIP PLUGIN DEFINITION
|
| 858 |
+
* ========================= */
|
| 859 |
+
|
| 860 |
+
$.fn.tooltip = function ( option ) {
|
| 861 |
+
return this.each(function () {
|
| 862 |
+
var $this = $(this)
|
| 863 |
+
, data = $this.data('tooltip')
|
| 864 |
+
, options = typeof option == 'object' && option
|
| 865 |
+
if (!data) $this.data('tooltip', (data = new Tooltip(this, options)))
|
| 866 |
+
if (typeof option == 'string') data[option]()
|
| 867 |
+
})
|
| 868 |
+
}
|
| 869 |
+
|
| 870 |
+
$.fn.tooltip.Constructor = Tooltip
|
| 871 |
+
|
| 872 |
+
$.fn.tooltip.defaults = {
|
| 873 |
+
animation: true
|
| 874 |
+
, delay: 0
|
| 875 |
+
, selector: false
|
| 876 |
+
, placement: 'top'
|
| 877 |
+
, trigger: 'hover'
|
| 878 |
+
, title: ''
|
| 879 |
+
, template: '<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>'
|
| 880 |
+
}
|
| 881 |
+
|
| 882 |
+
}( window.jQuery )
|
| 883 |
+
|
| 884 |
+
/* ===========================================================
|
| 885 |
+
* bootstrap-popover.js v2.0.0
|
| 886 |
+
* http://twitter.github.com/bootstrap/javascript.html#popovers
|
| 887 |
+
* ===========================================================
|
| 888 |
+
* Copyright 2012 Twitter, Inc.
|
| 889 |
+
*
|
| 890 |
+
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 891 |
+
* you may not use this file except in compliance with the License.
|
| 892 |
+
* You may obtain a copy of the License at
|
| 893 |
+
*
|
| 894 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 895 |
+
*
|
| 896 |
+
* Unless required by applicable law or agreed to in writing, software
|
| 897 |
+
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 898 |
+
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 899 |
+
* See the License for the specific language governing permissions and
|
| 900 |
+
* limitations under the License.
|
| 901 |
+
* =========================================================== */
|
| 902 |
+
|
| 903 |
+
|
| 904 |
+
!function( $ ) {
|
| 905 |
+
|
| 906 |
+
"use strict"
|
| 907 |
+
|
| 908 |
+
var Popover = function ( element, options ) {
|
| 909 |
+
this.init('popover', element, options)
|
| 910 |
+
}
|
| 911 |
+
|
| 912 |
+
/* NOTE: POPOVER EXTENDS BOOTSTRAP-TOOLTIP.js
|
| 913 |
+
========================================== */
|
| 914 |
+
|
| 915 |
+
Popover.prototype = $.extend({}, $.fn.tooltip.Constructor.prototype, {
|
| 916 |
+
|
| 917 |
+
constructor: Popover
|
| 918 |
+
|
| 919 |
+
, setContent: function () {
|
| 920 |
+
var $tip = this.tip()
|
| 921 |
+
, title = this.getTitle()
|
| 922 |
+
, content = this.getContent()
|
| 923 |
+
|
| 924 |
+
$tip.find('.popover-title')[ $.type(title) == 'object' ? 'append' : 'html' ](title)
|
| 925 |
+
$tip.find('.popover-content > *')[ $.type(content) == 'object' ? 'append' : 'html' ](content)
|
| 926 |
+
|
| 927 |
+
$tip.removeClass('fade top bottom left right in')
|
| 928 |
+
}
|
| 929 |
+
|
| 930 |
+
, hasContent: function () {
|
| 931 |
+
return this.getTitle() || this.getContent()
|
| 932 |
+
}
|
| 933 |
+
|
| 934 |
+
, getContent: function () {
|
| 935 |
+
var content
|
| 936 |
+
, $e = this.$element
|
| 937 |
+
, o = this.options
|
| 938 |
+
|
| 939 |
+
content = $e.attr('data-content')
|
| 940 |
+
|| (typeof o.content == 'function' ? o.content.call($e[0]) : o.content)
|
| 941 |
+
|
| 942 |
+
content = content.toString().replace(/(^\s*|\s*$)/, "")
|
| 943 |
+
|
| 944 |
+
return content
|
| 945 |
+
}
|
| 946 |
+
|
| 947 |
+
, tip: function() {
|
| 948 |
+
if (!this.$tip) {
|
| 949 |
+
this.$tip = $(this.options.template)
|
| 950 |
+
}
|
| 951 |
+
return this.$tip
|
| 952 |
+
}
|
| 953 |
+
|
| 954 |
+
})
|
| 955 |
+
|
| 956 |
+
|
| 957 |
+
/* POPOVER PLUGIN DEFINITION
|
| 958 |
+
* ======================= */
|
| 959 |
+
|
| 960 |
+
$.fn.popover = function ( option ) {
|
| 961 |
+
return this.each(function () {
|
| 962 |
+
var $this = $(this)
|
| 963 |
+
, data = $this.data('popover')
|
| 964 |
+
, options = typeof option == 'object' && option
|
| 965 |
+
if (!data) $this.data('popover', (data = new Popover(this, options)))
|
| 966 |
+
if (typeof option == 'string') data[option]()
|
| 967 |
+
})
|
| 968 |
+
}
|
| 969 |
+
|
| 970 |
+
$.fn.popover.Constructor = Popover
|
| 971 |
+
|
| 972 |
+
$.fn.popover.defaults = $.extend({} , $.fn.tooltip.defaults, {
|
| 973 |
+
placement: 'right'
|
| 974 |
+
, content: ''
|
| 975 |
+
, template: '<div class="popover"><div class="arrow"></div><div class="popover-inner"><h3 class="popover-title"></h3><div class="popover-content"><p></p></div></div></div>'
|
| 976 |
+
})
|
| 977 |
+
|
| 978 |
+
}( window.jQuery )
|
| 979 |
+
|
| 980 |
+
/* ==========================================================
|
| 981 |
+
* bootstrap-alert.js v2.0.0
|
| 982 |
+
* http://twitter.github.com/bootstrap/javascript.html#alerts
|
| 983 |
+
* ==========================================================
|
| 984 |
+
* Copyright 2012 Twitter, Inc.
|
| 985 |
+
*
|
| 986 |
+
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 987 |
+
* you may not use this file except in compliance with the License.
|
| 988 |
+
* You may obtain a copy of the License at
|
| 989 |
+
*
|
| 990 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 991 |
+
*
|
| 992 |
+
* Unless required by applicable law or agreed to in writing, software
|
| 993 |
+
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 994 |
+
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 995 |
+
* See the License for the specific language governing permissions and
|
| 996 |
+
* limitations under the License.
|
| 997 |
+
* ========================================================== */
|
| 998 |
+
|
| 999 |
+
|
| 1000 |
+
!function( $ ){
|
| 1001 |
+
|
| 1002 |
+
"use strict"
|
| 1003 |
+
|
| 1004 |
+
/* ALERT CLASS DEFINITION
|
| 1005 |
+
* ====================== */
|
| 1006 |
+
|
| 1007 |
+
var dismiss = '[data-dismiss="alert"]'
|
| 1008 |
+
, Alert = function ( el ) {
|
| 1009 |
+
$(el).on('click', dismiss, this.close)
|
| 1010 |
+
}
|
| 1011 |
+
|
| 1012 |
+
Alert.prototype = {
|
| 1013 |
+
|
| 1014 |
+
constructor: Alert
|
| 1015 |
+
|
| 1016 |
+
, close: function ( e ) {
|
| 1017 |
+
var $this = $(this)
|
| 1018 |
+
, selector = $this.attr('data-target')
|
| 1019 |
+
, $parent
|
| 1020 |
+
|
| 1021 |
+
if (!selector) {
|
| 1022 |
+
selector = $this.attr('href')
|
| 1023 |
+
selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7
|
| 1024 |
+
}
|
| 1025 |
+
|
| 1026 |
+
$parent = $(selector)
|
| 1027 |
+
$parent.trigger('close')
|
| 1028 |
+
|
| 1029 |
+
e && e.preventDefault()
|
| 1030 |
+
|
| 1031 |
+
$parent.length || ($parent = $this.hasClass('alert') ? $this : $this.parent())
|
| 1032 |
+
|
| 1033 |
+
$parent.removeClass('in')
|
| 1034 |
+
|
| 1035 |
+
function removeElement() {
|
| 1036 |
+
$parent.remove()
|
| 1037 |
+
$parent.trigger('closed')
|
| 1038 |
+
}
|
| 1039 |
+
|
| 1040 |
+
$.support.transition && $parent.hasClass('fade') ?
|
| 1041 |
+
$parent.on($.support.transition.end, removeElement) :
|
| 1042 |
+
removeElement()
|
| 1043 |
+
}
|
| 1044 |
+
|
| 1045 |
+
}
|
| 1046 |
+
|
| 1047 |
+
|
| 1048 |
+
/* ALERT PLUGIN DEFINITION
|
| 1049 |
+
* ======================= */
|
| 1050 |
+
|
| 1051 |
+
$.fn.alert = function ( option ) {
|
| 1052 |
+
return this.each(function () {
|
| 1053 |
+
var $this = $(this)
|
| 1054 |
+
, data = $this.data('alert')
|
| 1055 |
+
if (!data) $this.data('alert', (data = new Alert(this)))
|
| 1056 |
+
if (typeof option == 'string') data[option].call($this)
|
| 1057 |
+
})
|
| 1058 |
+
}
|
| 1059 |
+
|
| 1060 |
+
$.fn.alert.Constructor = Alert
|
| 1061 |
+
|
| 1062 |
+
|
| 1063 |
+
/* ALERT DATA-API
|
| 1064 |
+
* ============== */
|
| 1065 |
+
|
| 1066 |
+
$(function () {
|
| 1067 |
+
$('body').on('click.alert.data-api', dismiss, Alert.prototype.close)
|
| 1068 |
+
})
|
| 1069 |
+
|
| 1070 |
+
}( window.jQuery )
|
| 1071 |
+
|
| 1072 |
+
/* ============================================================
|
| 1073 |
+
* bootstrap-button.js v2.0.0
|
| 1074 |
+
* http://twitter.github.com/bootstrap/javascript.html#buttons
|
| 1075 |
+
* ============================================================
|
| 1076 |
+
* Copyright 2012 Twitter, Inc.
|
| 1077 |
+
*
|
| 1078 |
+
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 1079 |
+
* you may not use this file except in compliance with the License.
|
| 1080 |
+
* You may obtain a copy of the License at
|
| 1081 |
+
*
|
| 1082 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 1083 |
+
*
|
| 1084 |
+
* Unless required by applicable law or agreed to in writing, software
|
| 1085 |
+
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 1086 |
+
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 1087 |
+
* See the License for the specific language governing permissions and
|
| 1088 |
+
* limitations under the License.
|
| 1089 |
+
* ============================================================ */
|
| 1090 |
+
|
| 1091 |
+
!function( $ ){
|
| 1092 |
+
|
| 1093 |
+
"use strict"
|
| 1094 |
+
|
| 1095 |
+
/* BUTTON PUBLIC CLASS DEFINITION
|
| 1096 |
+
* ============================== */
|
| 1097 |
+
|
| 1098 |
+
var Button = function ( element, options ) {
|
| 1099 |
+
this.$element = $(element)
|
| 1100 |
+
this.options = $.extend({}, $.fn.button.defaults, options)
|
| 1101 |
+
}
|
| 1102 |
+
|
| 1103 |
+
Button.prototype = {
|
| 1104 |
+
|
| 1105 |
+
constructor: Button
|
| 1106 |
+
|
| 1107 |
+
, setState: function ( state ) {
|
| 1108 |
+
var d = 'disabled'
|
| 1109 |
+
, $el = this.$element
|
| 1110 |
+
, data = $el.data()
|
| 1111 |
+
, val = $el.is('input') ? 'val' : 'html'
|
| 1112 |
+
|
| 1113 |
+
state = state + 'Text'
|
| 1114 |
+
data.resetText || $el.data('resetText', $el[val]())
|
| 1115 |
+
|
| 1116 |
+
$el[val](data[state] || this.options[state])
|
| 1117 |
+
|
| 1118 |
+
// push to event loop to allow forms to submit
|
| 1119 |
+
setTimeout(function () {
|
| 1120 |
+
state == 'loadingText' ?
|
| 1121 |
+
$el.addClass(d).attr(d, d) :
|
| 1122 |
+
$el.removeClass(d).removeAttr(d)
|
| 1123 |
+
}, 0)
|
| 1124 |
+
}
|
| 1125 |
+
|
| 1126 |
+
, toggle: function () {
|
| 1127 |
+
var $parent = this.$element.parent('[data-toggle="buttons-radio"]')
|
| 1128 |
+
|
| 1129 |
+
$parent && $parent
|
| 1130 |
+
.find('.active')
|
| 1131 |
+
.removeClass('active')
|
| 1132 |
+
|
| 1133 |
+
this.$element.toggleClass('active')
|
| 1134 |
+
}
|
| 1135 |
+
|
| 1136 |
+
}
|
| 1137 |
+
|
| 1138 |
+
|
| 1139 |
+
/* BUTTON PLUGIN DEFINITION
|
| 1140 |
+
* ======================== */
|
| 1141 |
+
|
| 1142 |
+
$.fn.button = function ( option ) {
|
| 1143 |
+
return this.each(function () {
|
| 1144 |
+
var $this = $(this)
|
| 1145 |
+
, data = $this.data('button')
|
| 1146 |
+
, options = typeof option == 'object' && option
|
| 1147 |
+
if (!data) $this.data('button', (data = new Button(this, options)))
|
| 1148 |
+
if (option == 'toggle') data.toggle()
|
| 1149 |
+
else if (option) data.setState(option)
|
| 1150 |
+
})
|
| 1151 |
+
}
|
| 1152 |
+
|
| 1153 |
+
$.fn.button.defaults = {
|
| 1154 |
+
loadingText: 'loading...'
|
| 1155 |
+
}
|
| 1156 |
+
|
| 1157 |
+
$.fn.button.Constructor = Button
|
| 1158 |
+
|
| 1159 |
+
|
| 1160 |
+
/* BUTTON DATA-API
|
| 1161 |
+
* =============== */
|
| 1162 |
+
|
| 1163 |
+
$(function () {
|
| 1164 |
+
$('body').on('click.button.data-api', '[data-toggle^=button]', function ( e ) {
|
| 1165 |
+
$(e.target).button('toggle')
|
| 1166 |
+
})
|
| 1167 |
+
})
|
| 1168 |
+
|
| 1169 |
+
}( window.jQuery )
|
| 1170 |
+
|
| 1171 |
+
/* =============================================================
|
| 1172 |
+
* bootstrap-collapse.js v2.0.0
|
| 1173 |
+
* http://twitter.github.com/bootstrap/javascript.html#collapse
|
| 1174 |
+
* =============================================================
|
| 1175 |
+
* Copyright 2012 Twitter, Inc.
|
| 1176 |
+
*
|
| 1177 |
+
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 1178 |
+
* you may not use this file except in compliance with the License.
|
| 1179 |
+
* You may obtain a copy of the License at
|
| 1180 |
+
*
|
| 1181 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 1182 |
+
*
|
| 1183 |
+
* Unless required by applicable law or agreed to in writing, software
|
| 1184 |
+
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 1185 |
+
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 1186 |
+
* See the License for the specific language governing permissions and
|
| 1187 |
+
* limitations under the License.
|
| 1188 |
+
* ============================================================ */
|
| 1189 |
+
|
| 1190 |
+
!function( $ ){
|
| 1191 |
+
|
| 1192 |
+
"use strict"
|
| 1193 |
+
|
| 1194 |
+
var Collapse = function ( element, options ) {
|
| 1195 |
+
this.$element = $(element)
|
| 1196 |
+
this.options = $.extend({}, $.fn.collapse.defaults, options)
|
| 1197 |
+
|
| 1198 |
+
if (this.options["parent"]) {
|
| 1199 |
+
this.$parent = $(this.options["parent"])
|
| 1200 |
+
}
|
| 1201 |
+
|
| 1202 |
+
this.options.toggle && this.toggle()
|
| 1203 |
+
}
|
| 1204 |
+
|
| 1205 |
+
Collapse.prototype = {
|
| 1206 |
+
|
| 1207 |
+
constructor: Collapse
|
| 1208 |
+
|
| 1209 |
+
, dimension: function () {
|
| 1210 |
+
var hasWidth = this.$element.hasClass('width')
|
| 1211 |
+
return hasWidth ? 'width' : 'height'
|
| 1212 |
+
}
|
| 1213 |
+
|
| 1214 |
+
, show: function () {
|
| 1215 |
+
var dimension = this.dimension()
|
| 1216 |
+
, scroll = $.camelCase(['scroll', dimension].join('-'))
|
| 1217 |
+
, actives = this.$parent && this.$parent.find('.in')
|
| 1218 |
+
, hasData
|
| 1219 |
+
|
| 1220 |
+
if (actives && actives.length) {
|
| 1221 |
+
hasData = actives.data('collapse')
|
| 1222 |
+
actives.collapse('hide')
|
| 1223 |
+
hasData || actives.data('collapse', null)
|
| 1224 |
+
}
|
| 1225 |
+
|
| 1226 |
+
this.$element[dimension](0)
|
| 1227 |
+
this.transition('addClass', 'show', 'shown')
|
| 1228 |
+
this.$element[dimension](this.$element[0][scroll])
|
| 1229 |
+
|
| 1230 |
+
}
|
| 1231 |
+
|
| 1232 |
+
, hide: function () {
|
| 1233 |
+
var dimension = this.dimension()
|
| 1234 |
+
this.reset(this.$element[dimension]())
|
| 1235 |
+
this.transition('removeClass', 'hide', 'hidden')
|
| 1236 |
+
this.$element[dimension](0)
|
| 1237 |
+
}
|
| 1238 |
+
|
| 1239 |
+
, reset: function ( size ) {
|
| 1240 |
+
var dimension = this.dimension()
|
| 1241 |
+
|
| 1242 |
+
this.$element
|
| 1243 |
+
.removeClass('collapse')
|
| 1244 |
+
[dimension](size || 'auto')
|
| 1245 |
+
[0].offsetWidth
|
| 1246 |
+
|
| 1247 |
+
this.$element.addClass('collapse')
|
| 1248 |
+
}
|
| 1249 |
+
|
| 1250 |
+
, transition: function ( method, startEvent, completeEvent ) {
|
| 1251 |
+
var that = this
|
| 1252 |
+
, complete = function () {
|
| 1253 |
+
if (startEvent == 'show') that.reset()
|
| 1254 |
+
that.$element.trigger(completeEvent)
|
| 1255 |
+
}
|
| 1256 |
+
|
| 1257 |
+
this.$element
|
| 1258 |
+
.trigger(startEvent)
|
| 1259 |
+
[method]('in')
|
| 1260 |
+
|
| 1261 |
+
$.support.transition && this.$element.hasClass('collapse') ?
|
| 1262 |
+
this.$element.one($.support.transition.end, complete) :
|
| 1263 |
+
complete()
|
| 1264 |
+
}
|
| 1265 |
+
|
| 1266 |
+
, toggle: function () {
|
| 1267 |
+
this[this.$element.hasClass('in') ? 'hide' : 'show']()
|
| 1268 |
+
}
|
| 1269 |
+
|
| 1270 |
+
}
|
| 1271 |
+
|
| 1272 |
+
/* COLLAPSIBLE PLUGIN DEFINITION
|
| 1273 |
+
* ============================== */
|
| 1274 |
+
|
| 1275 |
+
$.fn.collapse = function ( option ) {
|
| 1276 |
+
return this.each(function () {
|
| 1277 |
+
var $this = $(this)
|
| 1278 |
+
, data = $this.data('collapse')
|
| 1279 |
+
, options = typeof option == 'object' && option
|
| 1280 |
+
if (!data) $this.data('collapse', (data = new Collapse(this, options)))
|
| 1281 |
+
if (typeof option == 'string') data[option]()
|
| 1282 |
+
})
|
| 1283 |
+
}
|
| 1284 |
+
|
| 1285 |
+
$.fn.collapse.defaults = {
|
| 1286 |
+
toggle: true
|
| 1287 |
+
}
|
| 1288 |
+
|
| 1289 |
+
$.fn.collapse.Constructor = Collapse
|
| 1290 |
+
|
| 1291 |
+
|
| 1292 |
+
/* COLLAPSIBLE DATA-API
|
| 1293 |
+
* ==================== */
|
| 1294 |
+
|
| 1295 |
+
$(function () {
|
| 1296 |
+
$('body').on('click.collapse.data-api', '[data-toggle=collapse]', function ( e ) {
|
| 1297 |
+
var $this = $(this), href
|
| 1298 |
+
, target = $this.attr('data-target')
|
| 1299 |
+
|| e.preventDefault()
|
| 1300 |
+
|| (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '') //strip for ie7
|
| 1301 |
+
, option = $(target).data('collapse') ? 'toggle' : $this.data()
|
| 1302 |
+
$(target).collapse(option)
|
| 1303 |
+
})
|
| 1304 |
+
})
|
| 1305 |
+
|
| 1306 |
+
}( window.jQuery )
|
| 1307 |
+
|
| 1308 |
+
/* ==========================================================
|
| 1309 |
+
* bootstrap-carousel.js v2.0.0
|
| 1310 |
+
* http://twitter.github.com/bootstrap/javascript.html#carousel
|
| 1311 |
+
* ==========================================================
|
| 1312 |
+
* Copyright 2012 Twitter, Inc.
|
| 1313 |
+
*
|
| 1314 |
+
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 1315 |
+
* you may not use this file except in compliance with the License.
|
| 1316 |
+
* You may obtain a copy of the License at
|
| 1317 |
+
*
|
| 1318 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 1319 |
+
*
|
| 1320 |
+
* Unless required by applicable law or agreed to in writing, software
|
| 1321 |
+
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 1322 |
+
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 1323 |
+
* See the License for the specific language governing permissions and
|
| 1324 |
+
* limitations under the License.
|
| 1325 |
+
* ========================================================== */
|
| 1326 |
+
|
| 1327 |
+
|
| 1328 |
+
!function( $ ){
|
| 1329 |
+
|
| 1330 |
+
"use strict"
|
| 1331 |
+
|
| 1332 |
+
/* CAROUSEL CLASS DEFINITION
|
| 1333 |
+
* ========================= */
|
| 1334 |
+
|
| 1335 |
+
var Carousel = function (element, options) {
|
| 1336 |
+
this.$element = $(element)
|
| 1337 |
+
this.options = $.extend({}, $.fn.carousel.defaults, options)
|
| 1338 |
+
this.options.slide && this.slide(this.options.slide)
|
| 1339 |
+
}
|
| 1340 |
+
|
| 1341 |
+
Carousel.prototype = {
|
| 1342 |
+
|
| 1343 |
+
cycle: function () {
|
| 1344 |
+
this.interval = setInterval($.proxy(this.next, this), this.options.interval)
|
| 1345 |
+
return this
|
| 1346 |
+
}
|
| 1347 |
+
|
| 1348 |
+
, to: function (pos) {
|
| 1349 |
+
var $active = this.$element.find('.active')
|
| 1350 |
+
, children = $active.parent().children()
|
| 1351 |
+
, activePos = children.index($active)
|
| 1352 |
+
, that = this
|
| 1353 |
+
|
| 1354 |
+
if (pos > (children.length - 1) || pos < 0) return
|
| 1355 |
+
|
| 1356 |
+
if (this.sliding) {
|
| 1357 |
+
return this.$element.one('slid', function () {
|
| 1358 |
+
that.to(pos)
|
| 1359 |
+
})
|
| 1360 |
+
}
|
| 1361 |
+
|
| 1362 |
+
if (activePos == pos) {
|
| 1363 |
+
return this.pause().cycle()
|
| 1364 |
+
}
|
| 1365 |
+
|
| 1366 |
+
return this.slide(pos > activePos ? 'next' : 'prev', $(children[pos]))
|
| 1367 |
+
}
|
| 1368 |
+
|
| 1369 |
+
, pause: function () {
|
| 1370 |
+
clearInterval(this.interval)
|
| 1371 |
+
return this
|
| 1372 |
+
}
|
| 1373 |
+
|
| 1374 |
+
, next: function () {
|
| 1375 |
+
if (this.sliding) return
|
| 1376 |
+
return this.slide('next')
|
| 1377 |
+
}
|
| 1378 |
+
|
| 1379 |
+
, prev: function () {
|
| 1380 |
+
if (this.sliding) return
|
| 1381 |
+
return this.slide('prev')
|
| 1382 |
+
}
|
| 1383 |
+
|
| 1384 |
+
, slide: function (type, next) {
|
| 1385 |
+
var $active = this.$element.find('.active')
|
| 1386 |
+
, $next = next || $active[type]()
|
| 1387 |
+
, isCycling = this.interval
|
| 1388 |
+
, direction = type == 'next' ? 'left' : 'right'
|
| 1389 |
+
, fallback = type == 'next' ? 'first' : 'last'
|
| 1390 |
+
, that = this
|
| 1391 |
+
|
| 1392 |
+
this.sliding = true
|
| 1393 |
+
|
| 1394 |
+
isCycling && this.pause()
|
| 1395 |
+
|
| 1396 |
+
$next = $next.length ? $next : this.$element.find('.item')[fallback]()
|
| 1397 |
+
|
| 1398 |
+
if (!$.support.transition && this.$element.hasClass('slide')) {
|
| 1399 |
+
this.$element.trigger('slide')
|
| 1400 |
+
$active.removeClass('active')
|
| 1401 |
+
$next.addClass('active')
|
| 1402 |
+
this.sliding = false
|
| 1403 |
+
this.$element.trigger('slid')
|
| 1404 |
+
} else {
|
| 1405 |
+
$next.addClass(type)
|
| 1406 |
+
$next[0].offsetWidth // force reflow
|
| 1407 |
+
$active.addClass(direction)
|
| 1408 |
+
$next.addClass(direction)
|
| 1409 |
+
this.$element.trigger('slide')
|
| 1410 |
+
this.$element.one($.support.transition.end, function () {
|
| 1411 |
+
$next.removeClass([type, direction].join(' ')).addClass('active')
|
| 1412 |
+
$active.removeClass(['active', direction].join(' '))
|
| 1413 |
+
that.sliding = false
|
| 1414 |
+
setTimeout(function () { that.$element.trigger('slid') }, 0)
|
| 1415 |
+
})
|
| 1416 |
+
}
|
| 1417 |
+
|
| 1418 |
+
isCycling && this.cycle()
|
| 1419 |
+
|
| 1420 |
+
return this
|
| 1421 |
+
}
|
| 1422 |
+
|
| 1423 |
+
}
|
| 1424 |
+
|
| 1425 |
+
|
| 1426 |
+
/* CAROUSEL PLUGIN DEFINITION
|
| 1427 |
+
* ========================== */
|
| 1428 |
+
|
| 1429 |
+
$.fn.carousel = function ( option ) {
|
| 1430 |
+
return this.each(function () {
|
| 1431 |
+
var $this = $(this)
|
| 1432 |
+
, data = $this.data('carousel')
|
| 1433 |
+
, options = typeof option == 'object' && option
|
| 1434 |
+
if (!data) $this.data('carousel', (data = new Carousel(this, options)))
|
| 1435 |
+
if (typeof option == 'number') data.to(option)
|
| 1436 |
+
else if (typeof option == 'string' || (option = options.slide)) data[option]()
|
| 1437 |
+
else data.cycle()
|
| 1438 |
+
})
|
| 1439 |
+
}
|
| 1440 |
+
|
| 1441 |
+
$.fn.carousel.defaults = {
|
| 1442 |
+
interval: 5000
|
| 1443 |
+
}
|
| 1444 |
+
|
| 1445 |
+
$.fn.carousel.Constructor = Carousel
|
| 1446 |
+
|
| 1447 |
+
|
| 1448 |
+
/* CAROUSEL DATA-API
|
| 1449 |
+
* ================= */
|
| 1450 |
+
|
| 1451 |
+
$(function () {
|
| 1452 |
+
$('body').on('click.carousel.data-api', '[data-slide]', function ( e ) {
|
| 1453 |
+
var $this = $(this), href
|
| 1454 |
+
, $target = $($this.attr('data-target') || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7
|
| 1455 |
+
, options = !$target.data('modal') && $.extend({}, $target.data(), $this.data())
|
| 1456 |
+
$target.carousel(options)
|
| 1457 |
+
e.preventDefault()
|
| 1458 |
+
})
|
| 1459 |
+
})
|
| 1460 |
+
|
| 1461 |
+
}( window.jQuery )
|
| 1462 |
+
|
| 1463 |
+
/* =============================================================
|
| 1464 |
+
* bootstrap-typeahead.js v2.0.0
|
| 1465 |
+
* http://twitter.github.com/bootstrap/javascript.html#typeahead
|
| 1466 |
+
* =============================================================
|
| 1467 |
+
* Copyright 2012 Twitter, Inc.
|
| 1468 |
+
*
|
| 1469 |
+
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 1470 |
+
* you may not use this file except in compliance with the License.
|
| 1471 |
+
* You may obtain a copy of the License at
|
| 1472 |
+
*
|
| 1473 |
+
* http://www.apache.org/licenses/LICENSE-2.0
|
| 1474 |
+
*
|
| 1475 |
+
* Unless required by applicable law or agreed to in writing, software
|
| 1476 |
+
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 1477 |
+
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 1478 |
+
* See the License for the specific language governing permissions and
|
| 1479 |
+
* limitations under the License.
|
| 1480 |
+
* ============================================================ */
|
| 1481 |
+
|
| 1482 |
+
!function( $ ){
|
| 1483 |
+
|
| 1484 |
+
"use strict"
|
| 1485 |
+
|
| 1486 |
+
var Typeahead = function ( element, options ) {
|
| 1487 |
+
this.$element = $(element)
|
| 1488 |
+
this.options = $.extend({}, $.fn.typeahead.defaults, options)
|
| 1489 |
+
this.matcher = this.options.matcher || this.matcher
|
| 1490 |
+
this.sorter = this.options.sorter || this.sorter
|
| 1491 |
+
this.highlighter = this.options.highlighter || this.highlighter
|
| 1492 |
+
this.$menu = $(this.options.menu).appendTo('body')
|
| 1493 |
+
this.source = this.options.source
|
| 1494 |
+
this.shown = false
|
| 1495 |
+
this.listen()
|
| 1496 |
+
}
|
| 1497 |
+
|
| 1498 |
+
Typeahead.prototype = {
|
| 1499 |
+
|
| 1500 |
+
constructor: Typeahead
|
| 1501 |
+
|
| 1502 |
+
, select: function () {
|
| 1503 |
+
var val = this.$menu.find('.active').attr('data-value')
|
| 1504 |
+
this.$element.val(val)
|
| 1505 |
+
return this.hide()
|
| 1506 |
+
}
|
| 1507 |
+
|
| 1508 |
+
, show: function () {
|
| 1509 |
+
var pos = $.extend({}, this.$element.offset(), {
|
| 1510 |
+
height: this.$element[0].offsetHeight
|
| 1511 |
+
})
|
| 1512 |
+
|
| 1513 |
+
this.$menu.css({
|
| 1514 |
+
top: pos.top + pos.height
|
| 1515 |
+
, left: pos.left
|
| 1516 |
+
})
|
| 1517 |
+
|
| 1518 |
+
this.$menu.show()
|
| 1519 |
+
this.shown = true
|
| 1520 |
+
return this
|
| 1521 |
+
}
|
| 1522 |
+
|
| 1523 |
+
, hide: function () {
|
| 1524 |
+
this.$menu.hide()
|
| 1525 |
+
this.shown = false
|
| 1526 |
+
return this
|
| 1527 |
+
}
|
| 1528 |
+
|
| 1529 |
+
, lookup: function (event) {
|
| 1530 |
+
var that = this
|
| 1531 |
+
, items
|
| 1532 |
+
, q
|
| 1533 |
+
|
| 1534 |
+
this.query = this.$element.val()
|
| 1535 |
+
|
| 1536 |
+
if (!this.query) {
|
| 1537 |
+
return this.shown ? this.hide() : this
|
| 1538 |
+
}
|
| 1539 |
+
|
| 1540 |
+
items = $.grep(this.source, function (item) {
|
| 1541 |
+
if (that.matcher(item)) return item
|
| 1542 |
+
})
|
| 1543 |
+
|
| 1544 |
+
items = this.sorter(items)
|
| 1545 |
+
|
| 1546 |
+
if (!items.length) {
|
| 1547 |
+
return this.shown ? this.hide() : this
|
| 1548 |
+
}
|
| 1549 |
+
|
| 1550 |
+
return this.render(items.slice(0, this.options.items)).show()
|
| 1551 |
+
}
|
| 1552 |
+
|
| 1553 |
+
, matcher: function (item) {
|
| 1554 |
+
return ~item.toLowerCase().indexOf(this.query.toLowerCase())
|
| 1555 |
+
}
|
| 1556 |
+
|
| 1557 |
+
, sorter: function (items) {
|
| 1558 |
+
var beginswith = []
|
| 1559 |
+
, caseSensitive = []
|
| 1560 |
+
, caseInsensitive = []
|
| 1561 |
+
, item
|
| 1562 |
+
|
| 1563 |
+
while (item = items.shift()) {
|
| 1564 |
+
if (!item.toLowerCase().indexOf(this.query.toLowerCase())) beginswith.push(item)
|
| 1565 |
+
else if (~item.indexOf(this.query)) caseSensitive.push(item)
|
| 1566 |
+
else caseInsensitive.push(item)
|
| 1567 |
+
}
|
| 1568 |
+
|
| 1569 |
+
return beginswith.concat(caseSensitive, caseInsensitive)
|
| 1570 |
+
}
|
| 1571 |
+
|
| 1572 |
+
, highlighter: function (item) {
|
| 1573 |
+
return item.replace(new RegExp('(' + this.query + ')', 'ig'), function ($1, match) {
|
| 1574 |
+
return '<strong>' + match + '</strong>'
|
| 1575 |
+
})
|
| 1576 |
+
}
|
| 1577 |
+
|
| 1578 |
+
, render: function (items) {
|
| 1579 |
+
var that = this
|
| 1580 |
+
|
| 1581 |
+
items = $(items).map(function (i, item) {
|
| 1582 |
+
i = $(that.options.item).attr('data-value', item)
|
| 1583 |
+
i.find('a').html(that.highlighter(item))
|
| 1584 |
+
return i[0]
|
| 1585 |
+
})
|
| 1586 |
+
|
| 1587 |
+
items.first().addClass('active')
|
| 1588 |
+
this.$menu.html(items)
|
| 1589 |
+
return this
|
| 1590 |
+
}
|
| 1591 |
+
|
| 1592 |
+
, next: function (event) {
|
| 1593 |
+
var active = this.$menu.find('.active').removeClass('active')
|
| 1594 |
+
, next = active.next()
|
| 1595 |
+
|
| 1596 |
+
if (!next.length) {
|
| 1597 |
+
next = $(this.$menu.find('li')[0])
|
| 1598 |
+
}
|
| 1599 |
+
|
| 1600 |
+
next.addClass('active')
|
| 1601 |
+
}
|
| 1602 |
+
|
| 1603 |
+
, prev: function (event) {
|
| 1604 |
+
var active = this.$menu.find('.active').removeClass('active')
|
| 1605 |
+
, prev = active.prev()
|
| 1606 |
+
|
| 1607 |
+
if (!prev.length) {
|
| 1608 |
+
prev = this.$menu.find('li').last()
|
| 1609 |
+
}
|
| 1610 |
+
|
| 1611 |
+
prev.addClass('active')
|
| 1612 |
+
}
|
| 1613 |
+
|
| 1614 |
+
, listen: function () {
|
| 1615 |
+
this.$element
|
| 1616 |
+
.on('blur', $.proxy(this.blur, this))
|
| 1617 |
+
.on('keypress', $.proxy(this.keypress, this))
|
| 1618 |
+
.on('keyup', $.proxy(this.keyup, this))
|
| 1619 |
+
|
| 1620 |
+
if ($.browser.webkit || $.browser.msie) {
|
| 1621 |
+
this.$element.on('keydown', $.proxy(this.keypress, this))
|
| 1622 |
+
}
|
| 1623 |
+
|
| 1624 |
+
this.$menu
|
| 1625 |
+
.on('click', $.proxy(this.click, this))
|
| 1626 |
+
.on('mouseenter', 'li', $.proxy(this.mouseenter, this))
|
| 1627 |
+
}
|
| 1628 |
+
|
| 1629 |
+
, keyup: function (e) {
|
| 1630 |
+
e.stopPropagation()
|
| 1631 |
+
e.preventDefault()
|
| 1632 |
+
|
| 1633 |
+
switch(e.keyCode) {
|
| 1634 |
+
case 40: // down arrow
|
| 1635 |
+
case 38: // up arrow
|
| 1636 |
+
break
|
| 1637 |
+
|
| 1638 |
+
case 9: // tab
|
| 1639 |
+
case 13: // enter
|
| 1640 |
+
if (!this.shown) return
|
| 1641 |
+
this.select()
|
| 1642 |
+
break
|
| 1643 |
+
|
| 1644 |
+
case 27: // escape
|
| 1645 |
+
this.hide()
|
| 1646 |
+
break
|
| 1647 |
+
|
| 1648 |
+
default:
|
| 1649 |
+
this.lookup()
|
| 1650 |
+
}
|
| 1651 |
+
|
| 1652 |
+
}
|
| 1653 |
+
|
| 1654 |
+
, keypress: function (e) {
|
| 1655 |
+
e.stopPropagation()
|
| 1656 |
+
if (!this.shown) return
|
| 1657 |
+
|
| 1658 |
+
switch(e.keyCode) {
|
| 1659 |
+
case 9: // tab
|
| 1660 |
+
case 13: // enter
|
| 1661 |
+
case 27: // escape
|
| 1662 |
+
e.preventDefault()
|
| 1663 |
+
break
|
| 1664 |
+
|
| 1665 |
+
case 38: // up arrow
|
| 1666 |
+
e.preventDefault()
|
| 1667 |
+
this.prev()
|
| 1668 |
+
break
|
| 1669 |
+
|
| 1670 |
+
case 40: // down arrow
|
| 1671 |
+
e.preventDefault()
|
| 1672 |
+
this.next()
|
| 1673 |
+
break
|
| 1674 |
+
}
|
| 1675 |
+
}
|
| 1676 |
+
|
| 1677 |
+
, blur: function (e) {
|
| 1678 |
+
var that = this
|
| 1679 |
+
e.stopPropagation()
|
| 1680 |
+
e.preventDefault()
|
| 1681 |
+
setTimeout(function () { that.hide() }, 150)
|
| 1682 |
+
}
|
| 1683 |
+
|
| 1684 |
+
, click: function (e) {
|
| 1685 |
+
e.stopPropagation()
|
| 1686 |
+
e.preventDefault()
|
| 1687 |
+
this.select()
|
| 1688 |
+
}
|
| 1689 |
+
|
| 1690 |
+
, mouseenter: function (e) {
|
| 1691 |
+
this.$menu.find('.active').removeClass('active')
|
| 1692 |
+
$(e.currentTarget).addClass('active')
|
| 1693 |
+
}
|
| 1694 |
+
|
| 1695 |
+
}
|
| 1696 |
+
|
| 1697 |
+
|
| 1698 |
+
/* TYPEAHEAD PLUGIN DEFINITION
|
| 1699 |
+
* =========================== */
|
| 1700 |
+
|
| 1701 |
+
$.fn.typeahead = function ( option ) {
|
| 1702 |
+
return this.each(function () {
|
| 1703 |
+
var $this = $(this)
|
| 1704 |
+
, data = $this.data('typeahead')
|
| 1705 |
+
, options = typeof option == 'object' && option
|
| 1706 |
+
if (!data) $this.data('typeahead', (data = new Typeahead(this, options)))
|
| 1707 |
+
if (typeof option == 'string') data[option]()
|
| 1708 |
+
})
|
| 1709 |
+
}
|
| 1710 |
+
|
| 1711 |
+
$.fn.typeahead.defaults = {
|
| 1712 |
+
source: []
|
| 1713 |
+
, items: 8
|
| 1714 |
+
, menu: '<ul class="typeahead dropdown-menu"></ul>'
|
| 1715 |
+
, item: '<li><a href="#"></a></li>'
|
| 1716 |
+
}
|
| 1717 |
+
|
| 1718 |
+
$.fn.typeahead.Constructor = Typeahead
|
| 1719 |
+
|
| 1720 |
+
|
| 1721 |
+
/* TYPEAHEAD DATA-API
|
| 1722 |
+
* ================== */
|
| 1723 |
+
|
| 1724 |
+
$(function () {
|
| 1725 |
+
$('body').on('focus.typeahead.data-api', '[data-provide="typeahead"]', function (e) {
|
| 1726 |
+
var $this = $(this)
|
| 1727 |
+
if ($this.data('typeahead')) return
|
| 1728 |
+
e.preventDefault()
|
| 1729 |
+
$this.typeahead($this.data())
|
| 1730 |
+
})
|
| 1731 |
+
})
|
| 1732 |
+
|
| 1733 |
+
}( window.jQuery )
|
js/bootstrap/bootstrap.min.js
ADDED
|
@@ -0,0 +1,7 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Bootstrap.js by @fat & @mdo
|
| 3 |
+
* plugins: bootstrap-transition.js, bootstrap-modal.js, bootstrap-dropdown.js, bootstrap-scrollspy.js, bootstrap-tab.js, bootstrap-tooltip.js, bootstrap-popover.js, bootstrap-alert.js, bootstrap-button.js, bootstrap-collapse.js, bootstrap-carousel.js, bootstrap-typeahead.js
|
| 4 |
+
* Copyright 2012 Twitter, Inc.
|
| 5 |
+
* http://www.apache.org/licenses/LICENSE-2.0.txt
|
| 6 |
+
*/
|
| 7 |
+
!function(a){a(function(){"use strict",a.support.transition=function(){var b=document.body||document.documentElement,c=b.style,d=c.transition!==undefined||c.WebkitTransition!==undefined||c.MozTransition!==undefined||c.MsTransition!==undefined||c.OTransition!==undefined;return d&&{end:function(){var b="TransitionEnd";return a.browser.webkit?b="webkitTransitionEnd":a.browser.mozilla?b="transitionend":a.browser.opera&&(b="oTransitionEnd"),b}()}}()})}(window.jQuery),!function(a){function c(){var b=this,c=setTimeout(function(){b.$element.off(a.support.transition.end),d.call(b)},500);this.$element.one(a.support.transition.end,function(){clearTimeout(c),d.call(b)})}function d(a){this.$element.hide().trigger("hidden"),e.call(this)}function e(b){var c=this,d=this.$element.hasClass("fade")?"fade":"";if(this.isShown&&this.options.backdrop){var e=a.support.transition&&d;this.$backdrop=a('<div class="modal-backdrop '+d+'" />').appendTo(document.body),this.options.backdrop!="static"&&this.$backdrop.click(a.proxy(this.hide,this)),e&&this.$backdrop[0].offsetWidth,this.$backdrop.addClass("in"),e?this.$backdrop.one(a.support.transition.end,b):b()}else!this.isShown&&this.$backdrop?(this.$backdrop.removeClass("in"),a.support.transition&&this.$element.hasClass("fade")?this.$backdrop.one(a.support.transition.end,a.proxy(f,this)):f.call(this)):b&&b()}function f(){this.$backdrop.remove(),this.$backdrop=null}function g(){var b=this;this.isShown&&this.options.keyboard?a(document).on("keyup.dismiss.modal",function(a){a.which==27&&b.hide()}):this.isShown||a(document).off("keyup.dismiss.modal")}"use strict";var b=function(b,c){this.options=a.extend({},a.fn.modal.defaults,c),this.$element=a(b).delegate('[data-dismiss="modal"]',"click.dismiss.modal",a.proxy(this.hide,this))};b.prototype={constructor:b,toggle:function(){return this[this.isShown?"hide":"show"]()},show:function(){var b=this;if(this.isShown)return;a("body").addClass("modal-open"),this.isShown=!0,this.$element.trigger("show"),g.call(this),e.call(this,function(){var c=a.support.transition&&b.$element.hasClass("fade");!b.$element.parent().length&&b.$element.appendTo(document.body),b.$element.show(),c&&b.$element[0].offsetWidth,b.$element.addClass("in"),c?b.$element.one(a.support.transition.end,function(){b.$element.trigger("shown")}):b.$element.trigger("shown")})},hide:function(b){b&&b.preventDefault();if(!this.isShown)return;var e=this;this.isShown=!1,a("body").removeClass("modal-open"),g.call(this),this.$element.trigger("hide").removeClass("in"),a.support.transition&&this.$element.hasClass("fade")?c.call(this):d.call(this)}},a.fn.modal=function(c){return this.each(function(){var d=a(this),e=d.data("modal"),f=typeof c=="object"&&c;e||d.data("modal",e=new b(this,f)),typeof c=="string"?e[c]():e.show()})},a.fn.modal.defaults={backdrop:!0,keyboard:!0},a.fn.modal.Constructor=b,a(function(){a("body").on("click.modal.data-api",'[data-toggle="modal"]',function(b){var c=a(this),d,e=a(c.attr("data-target")||(d=c.attr("href"))&&d.replace(/.*(?=#[^\s]+$)/,"")),f=e.data("modal")?"toggle":a.extend({},e.data(),c.data());b.preventDefault(),e.modal(f)})})}(window.jQuery),!function(a){function d(){a(b).parent().removeClass("open")}"use strict";var b='[data-toggle="dropdown"]',c=function(b){var c=a(b).on("click.dropdown.data-api",this.toggle);a("html").on("click.dropdown.data-api",function(){c.parent().removeClass("open")})};c.prototype={constructor:c,toggle:function(b){var c=a(this),e=c.attr("data-target"),f,g;return e||(e=c.attr("href"),e=e&&e.replace(/.*(?=#[^\s]*$)/,"")),f=a(e),f.length||(f=c.parent()),g=f.hasClass("open"),d(),!g&&f.toggleClass("open"),!1}},a.fn.dropdown=function(b){return this.each(function(){var d=a(this),e=d.data("dropdown");e||d.data("dropdown",e=new c(this)),typeof b=="string"&&e[b].call(d)})},a.fn.dropdown.Constructor=c,a(function(){a("html").on("click.dropdown.data-api",d),a("body").on("click.dropdown.data-api",b,c.prototype.toggle)})}(window.jQuery),!function(a){function b(b,c){var d=a.proxy(this.process,this),e=a(b).is("body")?a(window):a(b),f;this.options=a.extend({},a.fn.scrollspy.defaults,c),this.$scrollElement=e.on("scroll.scroll.data-api",d),this.selector=(this.options.target||(f=a(b).attr("href"))&&f.replace(/.*(?=#[^\s]+$)/,"")||"")+" .nav li > a",this.$body=a("body").on("click.scroll.data-api",this.selector,d),this.refresh(),this.process()}"use strict",b.prototype={constructor:b,refresh:function(){this.targets=this.$body.find(this.selector).map(function(){var b=a(this).attr("href");return/^#\w/.test(b)&&a(b).length?b:null}),this.offsets=a.map(this.targets,function(b){return a(b).position().top})},process:function(){var a=this.$scrollElement.scrollTop()+this.options.offset,b=this.offsets,c=this.targets,d=this.activeTarget,e;for(e=b.length;e--;)d!=c[e]&&a>=b[e]&&(!b[e+1]||a<=b[e+1])&&this.activate(c[e])},activate:function(a){var b;this.activeTarget=a,this.$body.find(this.selector).parent(".active").removeClass("active"),b=this.$body.find(this.selector+'[href="'+a+'"]').parent("li").addClass("active"),b.parent(".dropdown-menu")&&b.closest("li.dropdown").addClass("active")}},a.fn.scrollspy=function(c){return this.each(function(){var d=a(this),e=d.data("scrollspy"),f=typeof c=="object"&&c;e||d.data("scrollspy",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.scrollspy.Constructor=b,a.fn.scrollspy.defaults={offset:10},a(function(){a('[data-spy="scroll"]').each(function(){var b=a(this);b.scrollspy(b.data())})})}(window.jQuery),!function(a){"use strict";var b=function(b){this.element=a(b)};b.prototype={constructor:b,show:function(){var b=this.element,c=b.closest("ul:not(.dropdown-menu)"),d=b.attr("data-target"),e,f;d||(d=b.attr("href"),d=d&&d.replace(/.*(?=#[^\s]*$)/,""));if(b.parent("li").hasClass("active"))return;e=c.find(".active a").last()[0],b.trigger({type:"show",relatedTarget:e}),f=a(d),this.activate(b.parent("li"),c),this.activate(f,f.parent(),function(){b.trigger({type:"shown",relatedTarget:e})})},activate:function(b,c,d){function g(){e.removeClass("active").find("> .dropdown-menu > .active").removeClass("active"),b.addClass("active"),f?(b[0].offsetWidth,b.addClass("in")):b.removeClass("fade"),b.parent(".dropdown-menu")&&b.closest("li.dropdown").addClass("active"),d&&d()}var e=c.find("> .active"),f=d&&a.support.transition&&e.hasClass("fade");f?e.one(a.support.transition.end,g):g(),e.removeClass("in")}},a.fn.tab=function(c){return this.each(function(){var d=a(this),e=d.data("tab");e||d.data("tab",e=new b(this)),typeof c=="string"&&e[c]()})},a.fn.tab.Constructor=b,a(function(){a("body").on("click.tab.data-api",'[data-toggle="tab"], [data-toggle="pill"]',function(b){b.preventDefault(),a(this).tab("show")})})}(window.jQuery),!function(a){"use strict";var b=function(a,b){this.init("tooltip",a,b)};b.prototype={constructor:b,init:function(b,c,d){var e,f;this.type=b,this.$element=a(c),this.options=this.getOptions(d),this.enabled=!0,this.options.trigger!="manual"&&(e=this.options.trigger=="hover"?"mouseenter":"focus",f=this.options.trigger=="hover"?"mouseleave":"blur",this.$element.on(e,this.options.selector,a.proxy(this.enter,this)),this.$element.on(f,this.options.selector,a.proxy(this.leave,this))),this.options.selector?this._options=a.extend({},this.options,{trigger:"manual",selector:""}):this.fixTitle()},getOptions:function(b){return b=a.extend({},a.fn[this.type].defaults,b,this.$element.data()),b.delay&&typeof b.delay=="number"&&(b.delay={show:b.delay,hide:b.delay}),b},enter:function(b){var c=a(b.currentTarget)[this.type](this._options).data(this.type);!c.options.delay||!c.options.delay.show?c.show():(c.hoverState="in",setTimeout(function(){c.hoverState=="in"&&c.show()},c.options.delay.show))},leave:function(b){var c=a(b.currentTarget)[this.type](this._options).data(this.type);!c.options.delay||!c.options.delay.hide?c.hide():(c.hoverState="out",setTimeout(function(){c.hoverState=="out"&&c.hide()},c.options.delay.hide))},show:function(){var a,b,c,d,e,f,g;if(this.hasContent()&&this.enabled){a=this.tip(),this.setContent(),this.options.animation&&a.addClass("fade"),f=typeof this.options.placement=="function"?this.options.placement.call(this,a[0],this.$element[0]):this.options.placement,b=/in/.test(f),a.remove().css({top:0,left:0,display:"block"}).appendTo(b?this.$element:document.body),c=this.getPosition(b),d=a[0].offsetWidth,e=a[0].offsetHeight;switch(b?f.split(" ")[1]:f){case"bottom":g={top:c.top+c.height,left:c.left+c.width/2-d/2};break;case"top":g={top:c.top-e,left:c.left+c.width/2-d/2};break;case"left":g={top:c.top+c.height/2-e/2,left:c.left-d};break;case"right":g={top:c.top+c.height/2-e/2,left:c.left+c.width}}a.css(g).addClass(f).addClass("in")}},setContent:function(){var a=this.tip();a.find(".tooltip-inner").html(this.getTitle()),a.removeClass("fade in top bottom left right")},hide:function(){function d(){var b=setTimeout(function(){c.off(a.support.transition.end).remove()},500);c.one(a.support.transition.end,function(){clearTimeout(b),c.remove()})}var b=this,c=this.tip();c.removeClass("in"),a.support.transition&&this.$tip.hasClass("fade")?d():c.remove()},fixTitle:function(){var a=this.$element;(a.attr("title")||typeof a.attr("data-original-title")!="string")&&a.attr("data-original-title",a.attr("title")||"").removeAttr("title")},hasContent:function(){return this.getTitle()},getPosition:function(b){return a.extend({},b?{top:0,left:0}:this.$element.offset(),{width:this.$element[0].offsetWidth,height:this.$element[0].offsetHeight})},getTitle:function(){var a,b=this.$element,c=this.options;return a=b.attr("data-original-title")||(typeof c.title=="function"?c.title.call(b[0]):c.title),a=a.toString().replace(/(^\s*|\s*$)/,""),a},tip:function(){return this.$tip=this.$tip||a(this.options.template)},validate:function(){this.$element[0].parentNode||(this.hide(),this.$element=null,this.options=null)},enable:function(){this.enabled=!0},disable:function(){this.enabled=!1},toggleEnabled:function(){this.enabled=!this.enabled},toggle:function(){this[this.tip().hasClass("in")?"hide":"show"]()}},a.fn.tooltip=function(c){return this.each(function(){var d=a(this),e=d.data("tooltip"),f=typeof c=="object"&&c;e||d.data("tooltip",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.tooltip.Constructor=b,a.fn.tooltip.defaults={animation:!0,delay:0,selector:!1,placement:"top",trigger:"hover",title:"",template:'<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>'}}(window.jQuery),!function(a){"use strict";var b=function(a,b){this.init("popover",a,b)};b.prototype=a.extend({},a.fn.tooltip.Constructor.prototype,{constructor:b,setContent:function(){var b=this.tip(),c=this.getTitle(),d=this.getContent();b.find(".popover-title")[a.type(c)=="object"?"append":"html"](c),b.find(".popover-content > *")[a.type(d)=="object"?"append":"html"](d),b.removeClass("fade top bottom left right in")},hasContent:function(){return this.getTitle()||this.getContent()},getContent:function(){var a,b=this.$element,c=this.options;return a=b.attr("data-content")||(typeof c.content=="function"?c.content.call(b[0]):c.content),a=a.toString().replace(/(^\s*|\s*$)/,""),a},tip:function(){return this.$tip||(this.$tip=a(this.options.template)),this.$tip}}),a.fn.popover=function(c){return this.each(function(){var d=a(this),e=d.data("popover"),f=typeof c=="object"&&c;e||d.data("popover",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.popover.Constructor=b,a.fn.popover.defaults=a.extend({},a.fn.tooltip.defaults,{placement:"right",content:"",template:'<div class="popover"><div class="arrow"></div><div class="popover-inner"><h3 class="popover-title"></h3><div class="popover-content"><p></p></div></div></div>'})}(window.jQuery),!function(a){"use strict";var b='[data-dismiss="alert"]',c=function(c){a(c).on("click",b,this.close)};c.prototype={constructor:c,close:function(b){function f(){e.remove(),e.trigger("closed")}var c=a(this),d=c.attr("data-target"),e;d||(d=c.attr("href"),d=d&&d.replace(/.*(?=#[^\s]*$)/,"")),e=a(d),e.trigger("close"),b&&b.preventDefault(),e.length||(e=c.hasClass("alert")?c:c.parent()),e.removeClass("in"),a.support.transition&&e.hasClass("fade")?e.on(a.support.transition.end,f):f()}},a.fn.alert=function(b){return this.each(function(){var d=a(this),e=d.data("alert");e||d.data("alert",e=new c(this)),typeof b=="string"&&e[b].call(d)})},a.fn.alert.Constructor=c,a(function(){a("body").on("click.alert.data-api",b,c.prototype.close)})}(window.jQuery),!function(a){"use strict";var b=function(b,c){this.$element=a(b),this.options=a.extend({},a.fn.button.defaults,c)};b.prototype={constructor:b,setState:function(a){var b="disabled",c=this.$element,d=c.data(),e=c.is("input")?"val":"html";a+="Text",d.resetText||c.data("resetText",c[e]()),c[e](d[a]||this.options[a]),setTimeout(function(){a=="loadingText"?c.addClass(b).attr(b,b):c.removeClass(b).removeAttr(b)},0)},toggle:function(){var a=this.$element.parent('[data-toggle="buttons-radio"]');a&&a.find(".active").removeClass("active"),this.$element.toggleClass("active")}},a.fn.button=function(c){return this.each(function(){var d=a(this),e=d.data("button"),f=typeof c=="object"&&c;e||d.data("button",e=new b(this,f)),c=="toggle"?e.toggle():c&&e.setState(c)})},a.fn.button.defaults={loadingText:"loading..."},a.fn.button.Constructor=b,a(function(){a("body").on("click.button.data-api","[data-toggle^=button]",function(b){a(b.target).button("toggle")})})}(window.jQuery),!function(a){"use strict";var b=function(b,c){this.$element=a(b),this.options=a.extend({},a.fn.collapse.defaults,c),this.options.parent&&(this.$parent=a(this.options.parent)),this.options.toggle&&this.toggle()};b.prototype={constructor:b,dimension:function(){var a=this.$element.hasClass("width");return a?"width":"height"},show:function(){var b=this.dimension(),c=a.camelCase(["scroll",b].join("-")),d=this.$parent&&this.$parent.find(".in"),e;d&&d.length&&(e=d.data("collapse"),d.collapse("hide"),e||d.data("collapse",null)),this.$element[b](0),this.transition("addClass","show","shown"),this.$element[b](this.$element[0][c])},hide:function(){var a=this.dimension();this.reset(this.$element[a]()),this.transition("removeClass","hide","hidden"),this.$element[a](0)},reset:function(a){var b=this.dimension();this.$element.removeClass("collapse")[b](a||"auto")[0].offsetWidth,this.$element.addClass("collapse")},transition:function(b,c,d){var e=this,f=function(){c=="show"&&e.reset(),e.$element.trigger(d)};this.$element.trigger(c)[b]("in"),a.support.transition&&this.$element.hasClass("collapse")?this.$element.one(a.support.transition.end,f):f()},toggle:function(){this[this.$element.hasClass("in")?"hide":"show"]()}},a.fn.collapse=function(c){return this.each(function(){var d=a(this),e=d.data("collapse"),f=typeof c=="object"&&c;e||d.data("collapse",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.collapse.defaults={toggle:!0},a.fn.collapse.Constructor=b,a(function(){a("body").on("click.collapse.data-api","[data-toggle=collapse]",function(b){var c=a(this),d,e=c.attr("data-target")||b.preventDefault()||(d=c.attr("href"))&&d.replace(/.*(?=#[^\s]+$)/,""),f=a(e).data("collapse")?"toggle":c.data();a(e).collapse(f)})})}(window.jQuery),!function(a){"use strict";var b=function(b,c){this.$element=a(b),this.options=a.extend({},a.fn.carousel.defaults,c),this.options.slide&&this.slide(this.options.slide)};b.prototype={cycle:function(){return this.interval=setInterval(a.proxy(this.next,this),this.options.interval),this},to:function(b){var c=this.$element.find(".active"),d=c.parent().children(),e=d.index(c),f=this;if(b>d.length-1||b<0)return;return this.sliding?this.$element.one("slid",function(){f.to(b)}):e==b?this.pause().cycle():this.slide(b>e?"next":"prev",a(d[b]))},pause:function(){return clearInterval(this.interval),this},next:function(){if(this.sliding)return;return this.slide("next")},prev:function(){if(this.sliding)return;return this.slide("prev")},slide:function(b,c){var d=this.$element.find(".active"),e=c||d[b](),f=this.interval,g=b=="next"?"left":"right",h=b=="next"?"first":"last",i=this;return this.sliding=!0,f&&this.pause(),e=e.length?e:this.$element.find(".item")[h](),!a.support.transition&&this.$element.hasClass("slide")?(this.$element.trigger("slide"),d.removeClass("active"),e.addClass("active"),this.sliding=!1,this.$element.trigger("slid")):(e.addClass(b),e[0].offsetWidth,d.addClass(g),e.addClass(g),this.$element.trigger("slide"),this.$element.one(a.support.transition.end,function(){e.removeClass([b,g].join(" ")).addClass("active"),d.removeClass(["active",g].join(" ")),i.sliding=!1,setTimeout(function(){i.$element.trigger("slid")},0)})),f&&this.cycle(),this}},a.fn.carousel=function(c){return this.each(function(){var d=a(this),e=d.data("carousel"),f=typeof c=="object"&&c;e||d.data("carousel",e=new b(this,f)),typeof c=="number"?e.to(c):typeof c=="string"||(c=f.slide)?e[c]():e.cycle()})},a.fn.carousel.defaults={interval:5e3},a.fn.carousel.Constructor=b,a(function(){a("body").on("click.carousel.data-api","[data-slide]",function(b){var c=a(this),d,e=a(c.attr("data-target")||(d=c.attr("href"))&&d.replace(/.*(?=#[^\s]+$)/,"")),f=!e.data("modal")&&a.extend({},e.data(),c.data());e.carousel(f),b.preventDefault()})})}(window.jQuery),!function(a){"use strict";var b=function(b,c){this.$element=a(b),this.options=a.extend({},a.fn.typeahead.defaults,c),this.matcher=this.options.matcher||this.matcher,this.sorter=this.options.sorter||this.sorter,this.highlighter=this.options.highlighter||this.highlighter,this.$menu=a(this.options.menu).appendTo("body"),this.source=this.options.source,this.shown=!1,this.listen()};b.prototype={constructor:b,select:function(){var a=this.$menu.find(".active").attr("data-value");return this.$element.val(a),this.hide()},show:function(){var b=a.extend({},this.$element.offset(),{height:this.$element[0].offsetHeight});return this.$menu.css({top:b.top+b.height,left:b.left}),this.$menu.show(),this.shown=!0,this},hide:function(){return this.$menu.hide(),this.shown=!1,this},lookup:function(b){var c=this,d,e;return this.query=this.$element.val(),this.query?(d=a.grep(this.source,function(a){if(c.matcher(a))return a}),d=this.sorter(d),d.length?this.render(d.slice(0,this.options.items)).show():this.shown?this.hide():this):this.shown?this.hide():this},matcher:function(a){return~a.toLowerCase().indexOf(this.query.toLowerCase())},sorter:function(a){var b=[],c=[],d=[],e;while(e=a.shift())e.toLowerCase().indexOf(this.query.toLowerCase())?~e.indexOf(this.query)?c.push(e):d.push(e):b.push(e);return b.concat(c,d)},highlighter:function(a){return a.replace(new RegExp("("+this.query+")","ig"),function(a,b){return"<strong>"+b+"</strong>"})},render:function(b){var c=this;return b=a(b).map(function(b,d){return b=a(c.options.item).attr("data-value",d),b.find("a").html(c.highlighter(d)),b[0]}),b.first().addClass("active"),this.$menu.html(b),this},next:function(b){var c=this.$menu.find(".active").removeClass("active"),d=c.next();d.length||(d=a(this.$menu.find("li")[0])),d.addClass("active")},prev:function(a){var b=this.$menu.find(".active").removeClass("active"),c=b.prev();c.length||(c=this.$menu.find("li").last()),c.addClass("active")},listen:function(){this.$element.on("blur",a.proxy(this.blur,this)).on("keypress",a.proxy(this.keypress,this)).on("keyup",a.proxy(this.keyup,this)),(a.browser.webkit||a.browser.msie)&&this.$element.on("keydown",a.proxy(this.keypress,this)),this.$menu.on("click",a.proxy(this.click,this)).on("mouseenter","li",a.proxy(this.mouseenter,this))},keyup:function(a){a.stopPropagation(),a.preventDefault();switch(a.keyCode){case 40:case 38:break;case 9:case 13:if(!this.shown)return;this.select();break;case 27:this.hide();break;default:this.lookup()}},keypress:function(a){a.stopPropagation();if(!this.shown)return;switch(a.keyCode){case 9:case 13:case 27:a.preventDefault();break;case 38:a.preventDefault(),this.prev();break;case 40:a.preventDefault(),this.next()}},blur:function(a){var b=this;a.stopPropagation(),a.preventDefault(),setTimeout(function(){b.hide()},150)},click:function(a){a.stopPropagation(),a.preventDefault(),this.select()},mouseenter:function(b){this.$menu.find(".active").removeClass("active"),a(b.currentTarget).addClass("active")}},a.fn.typeahead=function(c){return this.each(function(){var d=a(this),e=d.data("typeahead"),f=typeof c=="object"&&c;e||d.data("typeahead",e=new b(this,f)),typeof c=="string"&&e[c]()})},a.fn.typeahead.defaults={source:[],items:8,menu:'<ul class="typeahead dropdown-menu"></ul>',item:'<li><a href="#"></a></li>'},a.fn.typeahead.Constructor=b,a(function(){a("body").on("focus.typeahead.data-api",'[data-provide="typeahead"]',function(b){var c=a(this);if(c.data("typeahead"))return;b.preventDefault(),c.typeahead(c.data())})})}(window.jQuery)
|
js/index.php
ADDED
|
@@ -0,0 +1,6 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
//Source of plugin
|
| 4 |
+
header("Location: http://www.shareaholic.com");
|
| 5 |
+
|
| 6 |
+
?>
|
js/reveal/jquery.reveal.js
ADDED
|
@@ -0,0 +1,177 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
* jQuery Reveal Plugin 1.0
|
| 3 |
+
* Copyright 2010, ZURB
|
| 4 |
+
* Free to use under the MIT license.
|
| 5 |
+
* http://www.opensource.org/licenses/mit-license.php
|
| 6 |
+
*
|
| 7 |
+
* Modified : Ankur Agarwal
|
| 8 |
+
*
|
| 9 |
+
* Added functionality to mention scrollheight in the config
|
| 10 |
+
*
|
| 11 |
+
*/
|
| 12 |
+
|
| 13 |
+
(function($) {
|
| 14 |
+
|
| 15 |
+
/*---------------------------
|
| 16 |
+
Defaults for Reveal
|
| 17 |
+
----------------------------*/
|
| 18 |
+
|
| 19 |
+
/*---------------------------
|
| 20 |
+
Listener for data-reveal-id attributes
|
| 21 |
+
----------------------------*/
|
| 22 |
+
|
| 23 |
+
$('a[data-reveal-id]').live('click', function(e) {
|
| 24 |
+
e.preventDefault();
|
| 25 |
+
var modalLocation = $(this).attr('data-reveal-id');
|
| 26 |
+
$('#'+modalLocation).reveal($(this).data());
|
| 27 |
+
});
|
| 28 |
+
|
| 29 |
+
/*---------------------------
|
| 30 |
+
Extend and Execute
|
| 31 |
+
----------------------------*/
|
| 32 |
+
|
| 33 |
+
$.fn.reveal = function(options) {
|
| 34 |
+
|
| 35 |
+
var defaults = {
|
| 36 |
+
animation: 'fadeAndPop' //fade, fadeAndPop, none
|
| 37 |
+
, animationspeed: 300 //how fast animtions are
|
| 38 |
+
, closeonbackgroundclick: true //if you click background will modal close?
|
| 39 |
+
, dismissmodalclass: 'close-reveal-modal' //the class of a button or element that will close an open modal
|
| 40 |
+
, backdrop: true //Show the modal by default or not
|
| 41 |
+
, autoshow: true //Show the modal by default or not
|
| 42 |
+
, showevent: 'show' // event to listen on the modal container to trigger show
|
| 43 |
+
, shownevent: 'shown' // event to listen on the modal container after the modal box is shown
|
| 44 |
+
, hideevent: 'hide' // event to listen on the modal container to trigger hide
|
| 45 |
+
, hiddenevent: 'hidden' // event to listen on the modal container after the modal is hidden
|
| 46 |
+
//scrollHeight: <integer> This attribute if not passed will be calculated at the runtime and used
|
| 47 |
+
};
|
| 48 |
+
|
| 49 |
+
//Extend dem' options
|
| 50 |
+
var options = $.extend({}, defaults, options);
|
| 51 |
+
return this.each(function() {
|
| 52 |
+
|
| 53 |
+
/*---------------------------
|
| 54 |
+
Global Variables
|
| 55 |
+
----------------------------*/
|
| 56 |
+
var modal = $(this),
|
| 57 |
+
topMeasure = parseInt(modal.css('top')),
|
| 58 |
+
topOffset = modal.height() + topMeasure,
|
| 59 |
+
locked = false,
|
| 60 |
+
modalBG = $('.reveal-modal-bg');
|
| 61 |
+
|
| 62 |
+
/*---------------------------
|
| 63 |
+
Create Modal BG
|
| 64 |
+
----------------------------*/
|
| 65 |
+
if(modalBG.length == 0) {
|
| 66 |
+
modalBG = $('<div class="reveal-modal-bg" />').insertAfter(modal);
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
/*---------------------------
|
| 70 |
+
Open & Close Animations
|
| 71 |
+
----------------------------*/
|
| 72 |
+
//Entrance Animations
|
| 73 |
+
modal.bind('reveal:open ' + options.showevent, function () {
|
| 74 |
+
$('.' + options.dismissmodalclass).unbind('click.modalEvent');
|
| 75 |
+
if(!locked) {
|
| 76 |
+
lockModal();
|
| 77 |
+
if(options.animation == "fadeAndPop") {
|
| 78 |
+
var h = typeof options.scrollheight !== "undefined" ? options.scrollheight : $(document).scrollTop();
|
| 79 |
+
modal.css({'top': h -topOffset, 'opacity' : 0, 'visibility' : 'visible'});
|
| 80 |
+
options.backdrop &&modalBG.fadeIn(options.animationspeed/2);
|
| 81 |
+
modal.delay(options.animationspeed/2).animate({
|
| 82 |
+
"top": h+topMeasure + 'px',
|
| 83 |
+
"opacity" : 1
|
| 84 |
+
}, options.animationspeed,shown());
|
| 85 |
+
}
|
| 86 |
+
if(options.animation == "fade") {
|
| 87 |
+
modal.css({'opacity' : 0, 'visibility' : 'visible', 'top': $(document).scrollTop()+topMeasure});
|
| 88 |
+
modalBG.fadeIn(options.animationspeed/2);
|
| 89 |
+
modal.delay(options.animationspeed/2).animate({
|
| 90 |
+
"opacity" : 1
|
| 91 |
+
}, options.animationspeed,shown());
|
| 92 |
+
}
|
| 93 |
+
if(options.animation == "none") {
|
| 94 |
+
modal.css({'visibility' : 'visible', 'top':$(document).scrollTop()+topMeasure});
|
| 95 |
+
modalBG.css({"display":"block"});
|
| 96 |
+
shown()
|
| 97 |
+
}
|
| 98 |
+
}
|
| 99 |
+
modal.unbind('reveal:open');
|
| 100 |
+
});
|
| 101 |
+
|
| 102 |
+
//Closing Animation
|
| 103 |
+
modal.bind('reveal:close ' + options.hideevent, function () {
|
| 104 |
+
if(!locked) {
|
| 105 |
+
lockModal();
|
| 106 |
+
if(options.animation == "fadeAndPop") {
|
| 107 |
+
var h = typeof options.scrollheight !== "undefined" ? options.scrollheight : $(document).scrollTop();
|
| 108 |
+
options.backdrop && modalBG.delay(options.animationspeed).fadeOut(options.animationspeed);
|
| 109 |
+
modal.animate({
|
| 110 |
+
"top": h - topOffset + 'px',
|
| 111 |
+
"opacity" : 0
|
| 112 |
+
}, options.animationspeed/2, function() {
|
| 113 |
+
modal.css({'top':topMeasure, 'opacity' : 1, 'visibility' : 'hidden'});
|
| 114 |
+
hidden();
|
| 115 |
+
|
| 116 |
+
});
|
| 117 |
+
}
|
| 118 |
+
if(options.animation == "fade") {
|
| 119 |
+
modalBG.delay(options.animationspeed).fadeOut(options.animationspeed);
|
| 120 |
+
modal.animate({
|
| 121 |
+
"opacity" : 0
|
| 122 |
+
}, options.animationspeed, function() {
|
| 123 |
+
modal.css({'opacity' : 1, 'visibility' : 'hidden', 'top' : topMeasure});
|
| 124 |
+
hidden();
|
| 125 |
+
});
|
| 126 |
+
}
|
| 127 |
+
if(options.animation == "none") {
|
| 128 |
+
modal.css({'visibility' : 'hidden', 'top' : topMeasure});
|
| 129 |
+
modalBG.css({'display' : 'none'});
|
| 130 |
+
}
|
| 131 |
+
}
|
| 132 |
+
modal.unbind('reveal:close');
|
| 133 |
+
});
|
| 134 |
+
|
| 135 |
+
/*---------------------------
|
| 136 |
+
Open and add Closing Listeners
|
| 137 |
+
----------------------------*/
|
| 138 |
+
//Open Modal Immediately
|
| 139 |
+
options.autoshow && modal.trigger('reveal:open')
|
| 140 |
+
|
| 141 |
+
//Close Modal Listeners
|
| 142 |
+
var closeButton = $('.' + options.dismissmodalclass).bind('click.modalEvent', function () {
|
| 143 |
+
modal.trigger('reveal:close')
|
| 144 |
+
});
|
| 145 |
+
|
| 146 |
+
if(options.closeonbackgroundclick) {
|
| 147 |
+
modalBG.css({"cursor":"pointer"})
|
| 148 |
+
modalBG.bind('click.modalEvent', function () {
|
| 149 |
+
modal.trigger(options.hideevent)
|
| 150 |
+
});
|
| 151 |
+
}
|
| 152 |
+
$('body').keyup(function(e) {
|
| 153 |
+
if(e.which===27){ modal.trigger('reveal:close'); } // 27 is the keycode for the Escape key
|
| 154 |
+
});
|
| 155 |
+
|
| 156 |
+
function shown () {
|
| 157 |
+
modal.trigger(options.shownevent);
|
| 158 |
+
unlockModal();
|
| 159 |
+
}
|
| 160 |
+
function hidden () {
|
| 161 |
+
modal.trigger(options.hiddenevent);
|
| 162 |
+
unlockModal();
|
| 163 |
+
}
|
| 164 |
+
|
| 165 |
+
/*---------------------------
|
| 166 |
+
Animations Locks
|
| 167 |
+
----------------------------*/
|
| 168 |
+
function unlockModal() {
|
| 169 |
+
locked = false;
|
| 170 |
+
}
|
| 171 |
+
function lockModal() {
|
| 172 |
+
locked = true;
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
});//each call
|
| 176 |
+
}//orbit plugin call
|
| 177 |
+
})(jQuery);
|
js/reveal/jquery.reveal.min.js
ADDED
|
@@ -0,0 +1,177 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
* jQuery Reveal Plugin 1.0
|
| 3 |
+
* Copyright 2010, ZURB
|
| 4 |
+
* Free to use under the MIT license.
|
| 5 |
+
* http://www.opensource.org/licenses/mit-license.php
|
| 6 |
+
*
|
| 7 |
+
* Modified : Ankur Agarwal
|
| 8 |
+
*
|
| 9 |
+
* Added functionality to mention scrollheight in the config
|
| 10 |
+
*
|
| 11 |
+
*/
|
| 12 |
+
|
| 13 |
+
(function($) {
|
| 14 |
+
|
| 15 |
+
/*---------------------------
|
| 16 |
+
Defaults for Reveal
|
| 17 |
+
----------------------------*/
|
| 18 |
+
|
| 19 |
+
/*---------------------------
|
| 20 |
+
Listener for data-reveal-id attributes
|
| 21 |
+
----------------------------*/
|
| 22 |
+
|
| 23 |
+
$('a[data-reveal-id]').live('click', function(e) {
|
| 24 |
+
e.preventDefault();
|
| 25 |
+
var modalLocation = $(this).attr('data-reveal-id');
|
| 26 |
+
$('#'+modalLocation).reveal($(this).data());
|
| 27 |
+
});
|
| 28 |
+
|
| 29 |
+
/*---------------------------
|
| 30 |
+
Extend and Execute
|
| 31 |
+
----------------------------*/
|
| 32 |
+
|
| 33 |
+
$.fn.reveal = function(options) {
|
| 34 |
+
|
| 35 |
+
var defaults = {
|
| 36 |
+
animation: 'fadeAndPop' //fade, fadeAndPop, none
|
| 37 |
+
, animationspeed: 300 //how fast animtions are
|
| 38 |
+
, closeonbackgroundclick: true //if you click background will modal close?
|
| 39 |
+
, dismissmodalclass: 'close-reveal-modal' //the class of a button or element that will close an open modal
|
| 40 |
+
, backdrop: true //Show the modal by default or not
|
| 41 |
+
, autoshow: true //Show the modal by default or not
|
| 42 |
+
, showevent: 'show' // event to listen on the modal container to trigger show
|
| 43 |
+
, shownevent: 'shown' // event to listen on the modal container after the modal box is shown
|
| 44 |
+
, hideevent: 'hide' // event to listen on the modal container to trigger hide
|
| 45 |
+
, hiddenevent: 'hidden' // event to listen on the modal container after the modal is hidden
|
| 46 |
+
//scrollHeight: <integer> This attribute if not passed will be calculated at the runtime and used
|
| 47 |
+
};
|
| 48 |
+
|
| 49 |
+
//Extend dem' options
|
| 50 |
+
var options = $.extend({}, defaults, options);
|
| 51 |
+
return this.each(function() {
|
| 52 |
+
|
| 53 |
+
/*---------------------------
|
| 54 |
+
Global Variables
|
| 55 |
+
----------------------------*/
|
| 56 |
+
var modal = $(this),
|
| 57 |
+
topMeasure = parseInt(modal.css('top')),
|
| 58 |
+
topOffset = modal.height() + topMeasure,
|
| 59 |
+
locked = false,
|
| 60 |
+
modalBG = $('.reveal-modal-bg');
|
| 61 |
+
|
| 62 |
+
/*---------------------------
|
| 63 |
+
Create Modal BG
|
| 64 |
+
----------------------------*/
|
| 65 |
+
if(modalBG.length == 0) {
|
| 66 |
+
modalBG = $('<div class="reveal-modal-bg" />').insertAfter(modal);
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
/*---------------------------
|
| 70 |
+
Open & Close Animations
|
| 71 |
+
----------------------------*/
|
| 72 |
+
//Entrance Animations
|
| 73 |
+
modal.bind('reveal:open ' + options.showevent, function () {
|
| 74 |
+
$('.' + options.dismissmodalclass).unbind('click.modalEvent');
|
| 75 |
+
if(!locked) {
|
| 76 |
+
lockModal();
|
| 77 |
+
if(options.animation == "fadeAndPop") {
|
| 78 |
+
var h = typeof options.scrollheight !== "undefined" ? options.scrollheight : $(document).scrollTop();
|
| 79 |
+
modal.css({'top': h -topOffset, 'opacity' : 0, 'visibility' : 'visible'});
|
| 80 |
+
options.backdrop &&modalBG.fadeIn(options.animationspeed/2);
|
| 81 |
+
modal.delay(options.animationspeed/2).animate({
|
| 82 |
+
"top": h+topMeasure + 'px',
|
| 83 |
+
"opacity" : 1
|
| 84 |
+
}, options.animationspeed,shown());
|
| 85 |
+
}
|
| 86 |
+
if(options.animation == "fade") {
|
| 87 |
+
modal.css({'opacity' : 0, 'visibility' : 'visible', 'top': $(document).scrollTop()+topMeasure});
|
| 88 |
+
modalBG.fadeIn(options.animationspeed/2);
|
| 89 |
+
modal.delay(options.animationspeed/2).animate({
|
| 90 |
+
"opacity" : 1
|
| 91 |
+
}, options.animationspeed,shown());
|
| 92 |
+
}
|
| 93 |
+
if(options.animation == "none") {
|
| 94 |
+
modal.css({'visibility' : 'visible', 'top':$(document).scrollTop()+topMeasure});
|
| 95 |
+
modalBG.css({"display":"block"});
|
| 96 |
+
shown()
|
| 97 |
+
}
|
| 98 |
+
}
|
| 99 |
+
modal.unbind('reveal:open');
|
| 100 |
+
});
|
| 101 |
+
|
| 102 |
+
//Closing Animation
|
| 103 |
+
modal.bind('reveal:close ' + options.hideevent, function () {
|
| 104 |
+
if(!locked) {
|
| 105 |
+
lockModal();
|
| 106 |
+
if(options.animation == "fadeAndPop") {
|
| 107 |
+
var h = typeof options.scrollheight !== "undefined" ? options.scrollheight : $(document).scrollTop();
|
| 108 |
+
options.backdrop && modalBG.delay(options.animationspeed).fadeOut(options.animationspeed);
|
| 109 |
+
modal.animate({
|
| 110 |
+
"top": h - topOffset + 'px',
|
| 111 |
+
"opacity" : 0
|
| 112 |
+
}, options.animationspeed/2, function() {
|
| 113 |
+
modal.css({'top':topMeasure, 'opacity' : 1, 'visibility' : 'hidden'});
|
| 114 |
+
hidden();
|
| 115 |
+
|
| 116 |
+
});
|
| 117 |
+
}
|
| 118 |
+
if(options.animation == "fade") {
|
| 119 |
+
modalBG.delay(options.animationspeed).fadeOut(options.animationspeed);
|
| 120 |
+
modal.animate({
|
| 121 |
+
"opacity" : 0
|
| 122 |
+
}, options.animationspeed, function() {
|
| 123 |
+
modal.css({'opacity' : 1, 'visibility' : 'hidden', 'top' : topMeasure});
|
| 124 |
+
hidden();
|
| 125 |
+
});
|
| 126 |
+
}
|
| 127 |
+
if(options.animation == "none") {
|
| 128 |
+
modal.css({'visibility' : 'hidden', 'top' : topMeasure});
|
| 129 |
+
modalBG.css({'display' : 'none'});
|
| 130 |
+
}
|
| 131 |
+
}
|
| 132 |
+
modal.unbind('reveal:close');
|
| 133 |
+
});
|
| 134 |
+
|
| 135 |
+
/*---------------------------
|
| 136 |
+
Open and add Closing Listeners
|
| 137 |
+
----------------------------*/
|
| 138 |
+
//Open Modal Immediately
|
| 139 |
+
options.autoshow && modal.trigger('reveal:open')
|
| 140 |
+
|
| 141 |
+
//Close Modal Listeners
|
| 142 |
+
var closeButton = $('.' + options.dismissmodalclass).bind('click.modalEvent', function () {
|
| 143 |
+
modal.trigger('reveal:close')
|
| 144 |
+
});
|
| 145 |
+
|
| 146 |
+
if(options.closeonbackgroundclick) {
|
| 147 |
+
modalBG.css({"cursor":"pointer"})
|
| 148 |
+
modalBG.bind('click.modalEvent', function () {
|
| 149 |
+
modal.trigger(options.hideevent)
|
| 150 |
+
});
|
| 151 |
+
}
|
| 152 |
+
$('body').keyup(function(e) {
|
| 153 |
+
if(e.which===27){ modal.trigger('reveal:close'); } // 27 is the keycode for the Escape key
|
| 154 |
+
});
|
| 155 |
+
|
| 156 |
+
function shown () {
|
| 157 |
+
modal.trigger(options.shownevent);
|
| 158 |
+
unlockModal();
|
| 159 |
+
}
|
| 160 |
+
function hidden () {
|
| 161 |
+
modal.trigger(options.hiddenevent);
|
| 162 |
+
unlockModal();
|
| 163 |
+
}
|
| 164 |
+
|
| 165 |
+
/*---------------------------
|
| 166 |
+
Animations Locks
|
| 167 |
+
----------------------------*/
|
| 168 |
+
function unlockModal() {
|
| 169 |
+
locked = false;
|
| 170 |
+
}
|
| 171 |
+
function lockModal() {
|
| 172 |
+
locked = true;
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
});//each call
|
| 176 |
+
}//orbit plugin call
|
| 177 |
+
})(jQuery);
|
js/sexy-bookmarks-public.js
ADDED
|
@@ -0,0 +1,82 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
jQuery(document).ready(function () {
|
| 2 |
+
jQuery(".shr-bookmarks a.external").attr("target", "_blank");
|
| 3 |
+
|
| 4 |
+
var c = jQuery(".shr-bookmarks").height(),
|
| 5 |
+
d = jQuery(".shr-bookmarks ul.socials").height(),
|
| 6 |
+
h = jQuery(".shr-bookmarks div.shr-getshr").outerHeight(true);
|
| 7 |
+
|
| 8 |
+
d > c && jQuery(".shr-bookmarks-expand").hover(function () {
|
| 9 |
+
jQuery(this).animate({
|
| 10 |
+
height: (d + h) + "px"
|
| 11 |
+
}, {
|
| 12 |
+
duration: 400,
|
| 13 |
+
queue: false
|
| 14 |
+
})
|
| 15 |
+
}, function () {
|
| 16 |
+
jQuery(this).animate({
|
| 17 |
+
height: c + "px"
|
| 18 |
+
}, {
|
| 19 |
+
duration: 400,
|
| 20 |
+
queue: false
|
| 21 |
+
})
|
| 22 |
+
});
|
| 23 |
+
if (jQuery(".shr-bookmarks-center") || jQuery(".shr-bookmarks-spaced")) {
|
| 24 |
+
var a = jQuery(".shr-bookmarks").width(),
|
| 25 |
+
b = jQuery(".shr-bookmarks:first ul.socials li").width(),
|
| 26 |
+
e = jQuery(".shr-bookmarks:first ul.socials li").length,
|
| 27 |
+
f = Math.floor(a / b);
|
| 28 |
+
b = Math.min(f, e) * b;
|
| 29 |
+
if (jQuery(".shr-bookmarks-spaced").length > 0) {
|
| 30 |
+
a = Math.floor((a - b) / (Math.min(f, e) + 1));
|
| 31 |
+
jQuery(".shr-bookmarks ul.socials li").attr("style", 'margin-left:' + a + 'px !important')
|
| 32 |
+
} else if (jQuery(true)) {
|
| 33 |
+
a = (a - b) / 2;
|
| 34 |
+
jQuery(".shr-bookmarks-center").attr("style", 'margin-left:' + a + 'px !important')
|
| 35 |
+
}
|
| 36 |
+
}
|
| 37 |
+
|
| 38 |
+
if( h > 0 && (jQuery(".shr-bookmarks-expand").length == 0
|
| 39 |
+
|| !(d>c))) {
|
| 40 |
+
jQuery(".shr-bookmarks").height(c+h);
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
var sText = getShareText();
|
| 44 |
+
if(sText != "") {
|
| 45 |
+
jQuery(".shr-bookmarks div.shr-getshr a").text(sText);
|
| 46 |
+
jQuery(".shr-bookmarks").hover(function() {
|
| 47 |
+
jQuery(".shr-bookmarks div.shr-getshr").css('visibility','visible');
|
| 48 |
+
}, function () {
|
| 49 |
+
jQuery(".shr-bookmarks div.shr-getshr").css('visibility','hidden');
|
| 50 |
+
});
|
| 51 |
+
}
|
| 52 |
+
});
|
| 53 |
+
|
| 54 |
+
function getShareText() {
|
| 55 |
+
var sName = getBrowser();
|
| 56 |
+
var sText = "";
|
| 57 |
+
if(sName != "") {
|
| 58 |
+
sText = "Get Shareaholic for " + sName;
|
| 59 |
+
}
|
| 60 |
+
return sText;
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
function getBrowser() {
|
| 64 |
+
var sUA = navigator.userAgent;
|
| 65 |
+
var sName = "";
|
| 66 |
+
if(sUA.indexOf("MSIE") != -1 ) {
|
| 67 |
+
sName = "Internet Explorer";
|
| 68 |
+
} else if(sUA.indexOf("Firefox") != -1 ) {
|
| 69 |
+
sName = "Firefox";
|
| 70 |
+
} else if(sUA.indexOf("Flock") != -1 ) {
|
| 71 |
+
sName = "Flock";
|
| 72 |
+
} else if(sUA.indexOf("Chrome") != -1 ) {
|
| 73 |
+
sName = "Google Chrome";
|
| 74 |
+
} else if(sUA.indexOf("Safari") != -1 ) {
|
| 75 |
+
sName = "Safari";
|
| 76 |
+
} else if(sUA.indexOf("Opera") != -1 ) {
|
| 77 |
+
sName = "Opera";
|
| 78 |
+
} else if(sUA.indexOf("Songbird") != -1 ) {
|
| 79 |
+
sName = "Songbird";
|
| 80 |
+
}
|
| 81 |
+
return sName;
|
| 82 |
+
}
|
js/sexy-bookmarks-public.min.js
ADDED
|
@@ -0,0 +1,4 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
jQuery(document).ready(function(){jQuery(".shr-bookmarks a.external").attr("target","_blank");var a=jQuery(".shr-bookmarks").height(),b=jQuery(".shr-bookmarks ul.socials").height(),e=jQuery(".shr-bookmarks div.shr-getshr").outerHeight(!0);b>a&&jQuery(".shr-bookmarks-expand").hover(function(){jQuery(this).animate({height:b+e+"px"},{duration:400,queue:!1})},function(){jQuery(this).animate({height:a+"px"},{duration:400,queue:!1})});if(jQuery(".shr-bookmarks-center")||jQuery(".shr-bookmarks-spaced")){var c=
|
| 2 |
+
jQuery(".shr-bookmarks").width(),d=jQuery(".shr-bookmarks:first ul.socials li").width(),f=jQuery(".shr-bookmarks:first ul.socials li").length,g=Math.floor(c/d),d=Math.min(g,f)*d;0<jQuery(".shr-bookmarks-spaced").length?(c=Math.floor((c-d)/(Math.min(g,f)+1)),jQuery(".shr-bookmarks ul.socials li").attr("style","margin-left:"+c+"px !important")):jQuery(!0)&&(c=(c-d)/2,jQuery(".shr-bookmarks-center").attr("style","margin-left:"+c+"px !important"))}0<e&&(0==jQuery(".shr-bookmarks-expand").length||!(b>
|
| 3 |
+
a))&&jQuery(".shr-bookmarks").height(a+e);c=getShareText();""!=c&&(jQuery(".shr-bookmarks div.shr-getshr a").text(c),jQuery(".shr-bookmarks").hover(function(){jQuery(".shr-bookmarks div.shr-getshr").css("visibility","visible")},function(){jQuery(".shr-bookmarks div.shr-getshr").css("visibility","hidden")}))});function getShareText(){var a=getBrowser(),b="";""!=a&&(b="Get Shareaholic for "+a);return b}
|
| 4 |
+
function getBrowser(){var a=navigator.userAgent,b="";-1!=a.indexOf("MSIE")?b="Internet Explorer":-1!=a.indexOf("Firefox")?b="Firefox":-1!=a.indexOf("Flock")?b="Flock":-1!=a.indexOf("Chrome")?b="Google Chrome":-1!=a.indexOf("Safari")?b="Safari":-1!=a.indexOf("Opera")?b="Opera":-1!=a.indexOf("Songbird")&&(b="Songbird");return b};
|
js/shareaholic-admin.js
ADDED
|
@@ -0,0 +1,769 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
jQuery(document).ready(function() {
|
| 2 |
+
if (jQuery('#iconator')) jQuery('#shrsb-networks').sortable({
|
| 3 |
+
delay: 250,
|
| 4 |
+
cursor: 'move',
|
| 5 |
+
scroll: true,
|
| 6 |
+
revert: true,
|
| 7 |
+
opacity: 0.7,
|
| 8 |
+
placeholder: 'dropzoneNetworks',
|
| 9 |
+
forcePlaceholderSize: true,
|
| 10 |
+
items: 'li'
|
| 11 |
+
});
|
| 12 |
+
if (jQuery('.shrsb-bookmarks')) { jQuery('#shrsb-sortables').sortable({
|
| 13 |
+
handle: '.box-mid-head',
|
| 14 |
+
delay: 250,
|
| 15 |
+
cursor: 'move',
|
| 16 |
+
scroll: true,
|
| 17 |
+
revert: true,
|
| 18 |
+
opacity: 0.7
|
| 19 |
+
});
|
| 20 |
+
|
| 21 |
+
|
| 22 |
+
jQuery('#buttonPreviewsTop,#buttonPreviewsBottom').sortable({
|
| 23 |
+
delay: 250,
|
| 24 |
+
cursor: 'move',
|
| 25 |
+
scroll: true,
|
| 26 |
+
revert: true,
|
| 27 |
+
opacity: 0.7,
|
| 28 |
+
placeholder: 'dropzone',
|
| 29 |
+
forcePlaceholderSize: true,
|
| 30 |
+
items: 'li'
|
| 31 |
+
});
|
| 32 |
+
|
| 33 |
+
|
| 34 |
+
//Select all icons upon clicking
|
| 35 |
+
jQuery('#sel-all').click(function() {
|
| 36 |
+
jQuery('#shrsb-networks').each(function() {
|
| 37 |
+
jQuery('#shrsb-networks input').attr('checked', 'checked');
|
| 38 |
+
});
|
| 39 |
+
});
|
| 40 |
+
|
| 41 |
+
//Deselect all icons upon clicking
|
| 42 |
+
jQuery('#sel-none').click(function() {
|
| 43 |
+
jQuery('#shrsb-networks').each(function() {
|
| 44 |
+
jQuery('#shrsb-networks input').removeAttr('checked');
|
| 45 |
+
});
|
| 46 |
+
});
|
| 47 |
+
|
| 48 |
+
//Select most popular icons upon clicking
|
| 49 |
+
jQuery('#sel-pop').click(function() {
|
| 50 |
+
jQuery('#shrsb-networks').each(function() {
|
| 51 |
+
jQuery('#shrsb-networks input').removeAttr('checked');
|
| 52 |
+
});
|
| 53 |
+
jQuery('#shrsb-networks').each(function() {
|
| 54 |
+
jQuery('#shr-facebook').attr('checked', 'checked');
|
| 55 |
+
jQuery('#shr-twitter').attr('checked', 'checked');
|
| 56 |
+
jQuery('#shr-linkedin').attr('checked', 'checked');
|
| 57 |
+
jQuery('#shr-googleplus').attr('checked', 'checked');
|
| 58 |
+
jQuery('#shr-googlebookmarks').attr('checked', 'checked');
|
| 59 |
+
jQuery('#shr-stumbleupon').attr('checked', 'checked');
|
| 60 |
+
jQuery('#shr-pinterest').attr('checked', 'checked');
|
| 61 |
+
jQuery('#shr-fastmail').attr('checked', 'checked');
|
| 62 |
+
jQuery('#shr-printfriendly').attr('checked', 'checked');
|
| 63 |
+
});
|
| 64 |
+
});
|
| 65 |
+
|
| 66 |
+
//Swap enabled/disabled between donation options onclick
|
| 67 |
+
jQuery('#preset-amounts').parent('label').click(function() {
|
| 68 |
+
jQuery('#custom-amounts').attr('disabled', 'disabled').css({'cursor':'none'});
|
| 69 |
+
jQuery('#preset-amounts').removeAttr('disabled');
|
| 70 |
+
});
|
| 71 |
+
|
| 72 |
+
//Swap enabled/disabled between donation options onclick
|
| 73 |
+
jQuery('#custom-amounts').parent('label').click(function() {
|
| 74 |
+
jQuery('#preset-amounts').attr('disabled', 'disabled').css({'cursor':'none'});
|
| 75 |
+
jQuery('#custom-amounts').removeAttr('disabled');
|
| 76 |
+
});
|
| 77 |
+
|
| 78 |
+
// Handle tiny form submission upon selecting option to hide sponsor messages
|
| 79 |
+
jQuery('#hide-sponsors').click(function() {
|
| 80 |
+
jQuery('#no-sponsors').submit();
|
| 81 |
+
});
|
| 82 |
+
|
| 83 |
+
// Create a universal click function to close status messages...
|
| 84 |
+
jQuery('.del-x').click(function() {
|
| 85 |
+
jQuery(this).parent('div').parent('div').fadeOut();
|
| 86 |
+
});
|
| 87 |
+
|
| 88 |
+
// if checkbox isn't already checked, open warning message...
|
| 89 |
+
jQuery("#custom-mods").click(function() {
|
| 90 |
+
if(jQuery(this).is(":not(:checked)")) {
|
| 91 |
+
jQuery("#custom-mods-notice").css("display", "none");
|
| 92 |
+
}
|
| 93 |
+
else {
|
| 94 |
+
jQuery("#custom-mods-notice").fadeIn("fast");
|
| 95 |
+
jQuery("#custom-mods-notice").css("display", "table");
|
| 96 |
+
}
|
| 97 |
+
});
|
| 98 |
+
|
| 99 |
+
// close custom mods warning when they click the X
|
| 100 |
+
jQuery(".custom-mods-notice-close").click(function() {
|
| 101 |
+
jQuery("#custom-mods-notice").fadeOut('fast');
|
| 102 |
+
});
|
| 103 |
+
|
| 104 |
+
// Apply "smart options" to BG image
|
| 105 |
+
jQuery('#bgimg-yes').click(function() {
|
| 106 |
+
if(jQuery(this).is(':checked')) {
|
| 107 |
+
jQuery('#bgimgs').fadeIn('slow');
|
| 108 |
+
}
|
| 109 |
+
else {
|
| 110 |
+
jQuery('#bgimgs').css('display', 'none');
|
| 111 |
+
}
|
| 112 |
+
});
|
| 113 |
+
|
| 114 |
+
// Apply "smart options" to Twitter
|
| 115 |
+
jQuery('#shr-twitter').click(function() {
|
| 116 |
+
if (jQuery(this).attr('checked')) {
|
| 117 |
+
jQuery('#twitter-defaults').fadeIn('fast');
|
| 118 |
+
}
|
| 119 |
+
else {
|
| 120 |
+
jQuery('#twitter-defaults').fadeOut();
|
| 121 |
+
}
|
| 122 |
+
});
|
| 123 |
+
|
| 124 |
+
jQuery('#shorty').change(function() {
|
| 125 |
+
jQuery('#shortyapimdiv-bitly').fadeOut('fast');
|
| 126 |
+
jQuery('#shortyapimdiv-awesm').fadeOut('fast');
|
| 127 |
+
jQuery('#shortyapimdiv-supr').fadeOut('fast');
|
| 128 |
+
jQuery('#shortyapimdiv-jmp').fadeOut('fast');
|
| 129 |
+
if(this.value=='bitly'){
|
| 130 |
+
jQuery('#shortyapimdiv-bitly').fadeIn('fast');
|
| 131 |
+
}else if(this.value=='awesm'){
|
| 132 |
+
jQuery('#shortyapimdiv-awesm').fadeIn('fast');
|
| 133 |
+
}else if(this.value=='supr'){
|
| 134 |
+
jQuery('#shortyapimdiv-supr').fadeIn('fast');
|
| 135 |
+
} else if(this.value=='jmp'){
|
| 136 |
+
jQuery('#shortyapimdiv-jmp').fadeIn('fast');
|
| 137 |
+
}
|
| 138 |
+
});
|
| 139 |
+
|
| 140 |
+
|
| 141 |
+
jQuery('#shortyapichk-supr').click(function() {
|
| 142 |
+
if (this.checked) {
|
| 143 |
+
jQuery('#shortyapidiv-supr').fadeIn('fast');
|
| 144 |
+
}
|
| 145 |
+
else {
|
| 146 |
+
jQuery('#shortyapidiv-supr').fadeOut('fast');
|
| 147 |
+
}
|
| 148 |
+
});
|
| 149 |
+
|
| 150 |
+
|
| 151 |
+
jQuery('#likeButtonSetTop-yes').click(function() {
|
| 152 |
+
if (this.checked) {
|
| 153 |
+
jQuery('.likeButtonsAvailableTop').fadeIn('fast');
|
| 154 |
+
}
|
| 155 |
+
});
|
| 156 |
+
jQuery('#likeButtonSetTop-no').click(function() {
|
| 157 |
+
if (this.checked) {
|
| 158 |
+
jQuery('.likeButtonsAvailableTop').fadeOut('fast');
|
| 159 |
+
}
|
| 160 |
+
});
|
| 161 |
+
|
| 162 |
+
jQuery('#likeButtonSetBottom-yes').click(function() {
|
| 163 |
+
if (this.checked) {
|
| 164 |
+
jQuery('.likeButtonsAvailableBottom').fadeIn('fast');
|
| 165 |
+
}
|
| 166 |
+
});
|
| 167 |
+
jQuery('#likeButtonSetBottom-no').click(function() {
|
| 168 |
+
if (this.checked) {
|
| 169 |
+
jQuery('.likeButtonsAvailableBottom').fadeOut('fast');
|
| 170 |
+
}
|
| 171 |
+
});
|
| 172 |
+
|
| 173 |
+
|
| 174 |
+
|
| 175 |
+
jQuery('#fbLikeButtonTop-yes').click(function() {
|
| 176 |
+
if (this.checked) {
|
| 177 |
+
jQuery('.likebuttonpreviewTop').fadeIn('fast');
|
| 178 |
+
}
|
| 179 |
+
});
|
| 180 |
+
jQuery('#fbLikeButtonBottom-yes').click(function() {
|
| 181 |
+
if (this.checked) {
|
| 182 |
+
jQuery('.likebuttonpreviewBottom').fadeIn('fast');
|
| 183 |
+
}
|
| 184 |
+
});
|
| 185 |
+
|
| 186 |
+
jQuery('#fbLikeButtonTop-no').click(function() {
|
| 187 |
+
if (this.checked) {
|
| 188 |
+
jQuery('.likebuttonpreviewTop').fadeOut('fast');
|
| 189 |
+
}
|
| 190 |
+
});
|
| 191 |
+
jQuery('#fbLikeButtonBottom-no').click(function() {
|
| 192 |
+
if (this.checked) {
|
| 193 |
+
jQuery('.likebuttonpreviewBottom').fadeOut('fast');
|
| 194 |
+
}
|
| 195 |
+
});
|
| 196 |
+
|
| 197 |
+
jQuery('#fbSendButtonBottom-yes').click(function() {
|
| 198 |
+
if (this.checked) {
|
| 199 |
+
jQuery('.sendbuttonpreviewBottom').fadeIn('fast');
|
| 200 |
+
}
|
| 201 |
+
});
|
| 202 |
+
jQuery('#fbSendButtonTop-yes').click(function() {
|
| 203 |
+
if (this.checked) {
|
| 204 |
+
jQuery('.sendbuttonpreviewTop').fadeIn('fast');
|
| 205 |
+
}
|
| 206 |
+
});
|
| 207 |
+
|
| 208 |
+
jQuery('#fbSendButtonTop-no').click(function() {
|
| 209 |
+
if (this.checked) {
|
| 210 |
+
jQuery('.sendbuttonpreviewTop').fadeOut('fast');
|
| 211 |
+
}
|
| 212 |
+
});
|
| 213 |
+
jQuery('#fbSendButtonBottom-no').click(function() {
|
| 214 |
+
if (this.checked) {
|
| 215 |
+
jQuery('.sendbuttonpreviewBottom').fadeOut('fast');
|
| 216 |
+
}
|
| 217 |
+
});
|
| 218 |
+
|
| 219 |
+
jQuery('#googlePlusOneButtonTop-yes').click(function() {
|
| 220 |
+
if (this.checked) {
|
| 221 |
+
jQuery('.plusonepreviewTop').fadeIn('fast');
|
| 222 |
+
}
|
| 223 |
+
});
|
| 224 |
+
|
| 225 |
+
jQuery('#googlePlusOneButtonTop-no').click(function() {
|
| 226 |
+
if (this.checked) {
|
| 227 |
+
jQuery('.plusonepreviewTop').fadeOut('fast');
|
| 228 |
+
}
|
| 229 |
+
});
|
| 230 |
+
jQuery('#googlePlusOneButtonBottom-yes').click(function() {
|
| 231 |
+
if (this.checked) {
|
| 232 |
+
jQuery('.plusonepreviewBottom').fadeIn('fast');
|
| 233 |
+
}
|
| 234 |
+
});
|
| 235 |
+
|
| 236 |
+
jQuery('#googlePlusOneButtonBottom-no').click(function() {
|
| 237 |
+
if (this.checked) {
|
| 238 |
+
jQuery('.plusonepreviewBottom').fadeOut('fast');
|
| 239 |
+
}
|
| 240 |
+
});
|
| 241 |
+
jQuery('#tweetButtonTop-yes').click(function() {
|
| 242 |
+
if (this.checked) {
|
| 243 |
+
jQuery('.tweetbuttonpreviewTop').fadeIn('fast');
|
| 244 |
+
}
|
| 245 |
+
});
|
| 246 |
+
|
| 247 |
+
jQuery('#tweetButtonTop-no').click(function() {
|
| 248 |
+
if (this.checked) {
|
| 249 |
+
jQuery('.tweetbuttonpreviewTop').fadeOut('fast');
|
| 250 |
+
}
|
| 251 |
+
});
|
| 252 |
+
jQuery('#tweetButtonBottom-yes').click(function() {
|
| 253 |
+
if (this.checked) {
|
| 254 |
+
jQuery('.tweetbuttonpreviewBottom').fadeIn('fast');
|
| 255 |
+
}
|
| 256 |
+
});
|
| 257 |
+
|
| 258 |
+
jQuery('#tweetButtonBottom-no').click(function() {
|
| 259 |
+
if (this.checked) {
|
| 260 |
+
jQuery('.tweetbuttonpreviewBottom').fadeOut('fast');
|
| 261 |
+
}
|
| 262 |
+
});
|
| 263 |
+
|
| 264 |
+
jQuery('#fbLikeButtonTop-yes,#googlePlusOneButtonTop-yes,#fbSendButtonTop-yes,,#tweetButtonTop-yes').click(function() {
|
| 265 |
+
if (this.checked) {
|
| 266 |
+
jQuery('.likeButtonSetOptionsTop').fadeIn('fast');
|
| 267 |
+
}
|
| 268 |
+
});
|
| 269 |
+
jQuery('#fbLikeButtonBottom-yes,#googlePlusOneButtonBottom-yes,#fbSendButtonBottom-yes,,#tweetButtonBottom-yes').click(function() {
|
| 270 |
+
if (this.checked) {
|
| 271 |
+
jQuery('.likeButtonSetOptionsBottom').fadeIn('fast');
|
| 272 |
+
}
|
| 273 |
+
});
|
| 274 |
+
|
| 275 |
+
jQuery('#fbLikeButtonTop-no,#googlePlusOneButtonTop-no,#fbSendButtonTop-no,#tweetButtonTop-no').click(function() {
|
| 276 |
+
if(jQuery('#fbLikeButtonTop-no').get(0).checked && jQuery('#googlePlusOneButtonTop-no').get(0).checked && jQuery('#tweetButtonTop-no').get(0).checked
|
| 277 |
+
&& jQuery('#fbSendButtonTop-no').get(0).checked) {
|
| 278 |
+
jQuery('.likeButtonSetOptionsTop').fadeOut('fast');
|
| 279 |
+
}
|
| 280 |
+
});
|
| 281 |
+
jQuery('#fbLikeButtonBottom-no,#googlePlusOneButtonBottom-no,#fbSendButtonBottom-no,#tweetButtonBottom-no').click(function() {
|
| 282 |
+
if(jQuery('#fbLikeButtonBottom-no').get(0).checked && jQuery('#googlePlusOneButtonBottom-no').get(0).checked && jQuery('#tweetButtonBottom-no').get(0).checked
|
| 283 |
+
&& jQuery('#fbSendButtonBottom-no').get(0).checked) {
|
| 284 |
+
jQuery('.likeButtonSetOptionsBottom').fadeOut('fast');
|
| 285 |
+
}
|
| 286 |
+
});
|
| 287 |
+
|
| 288 |
+
jQuery('#designer_toolTips-yes').click(function() {
|
| 289 |
+
if (this.checked) {
|
| 290 |
+
jQuery('.designer_toolTip_prefs').fadeIn('fast');
|
| 291 |
+
}
|
| 292 |
+
});
|
| 293 |
+
jQuery('#designer_toolTips-no').click(function() {
|
| 294 |
+
if (this.checked) {
|
| 295 |
+
jQuery('.designer_toolTip_prefs').fadeOut('fast');
|
| 296 |
+
}
|
| 297 |
+
});
|
| 298 |
+
|
| 299 |
+
jQuery('#pubGaSocial-yes').click(function() {
|
| 300 |
+
if (this.checked) {
|
| 301 |
+
jQuery('.pubGaSocial_prefs').fadeIn('fast');
|
| 302 |
+
}
|
| 303 |
+
});
|
| 304 |
+
jQuery('#pubGaSocial-no').click(function() {
|
| 305 |
+
if (this.checked) {
|
| 306 |
+
jQuery('.pubGaSocial_prefs').fadeOut('fast');
|
| 307 |
+
}
|
| 308 |
+
});
|
| 309 |
+
|
| 310 |
+
jQuery('#recommendations-yes').click(function() {
|
| 311 |
+
if (this.checked) {
|
| 312 |
+
jQuery('.recommendations_prefs-1').fadeIn('fast');
|
| 313 |
+
var thumbEnableChecked = jQuery('#recommendations-style-image').get(0).checked;
|
| 314 |
+
if (thumbEnableChecked) {
|
| 315 |
+
jQuery('.recommendations_prefs-2').fadeIn('fast');
|
| 316 |
+
}
|
| 317 |
+
}
|
| 318 |
+
});
|
| 319 |
+
jQuery('#recommendations-no').click(function() {
|
| 320 |
+
if (this.checked) {
|
| 321 |
+
jQuery('.recommendations_prefs-1').fadeOut('fast');
|
| 322 |
+
jQuery('.recommendations_prefs-2').fadeOut('fast');
|
| 323 |
+
}
|
| 324 |
+
});
|
| 325 |
+
jQuery('#recommendations-style-image').click(function() {
|
| 326 |
+
if (this.checked) {
|
| 327 |
+
jQuery('.recommendations_prefs-2').fadeIn('fast');
|
| 328 |
+
}
|
| 329 |
+
});
|
| 330 |
+
jQuery('#recommendations-style-text').click(function() {
|
| 331 |
+
if (this.checked) {
|
| 332 |
+
jQuery('.recommendations_prefs-2').fadeOut('fast');
|
| 333 |
+
}
|
| 334 |
+
});
|
| 335 |
+
jQuery('#cb-yes').click(function() {
|
| 336 |
+
if (this.checked) {
|
| 337 |
+
jQuery('.cb_prefs').fadeIn('fast');
|
| 338 |
+
}
|
| 339 |
+
});
|
| 340 |
+
jQuery('#cb-no').click(function() {
|
| 341 |
+
if (this.checked) {
|
| 342 |
+
jQuery('.cb_prefs').fadeOut('fast');
|
| 343 |
+
}
|
| 344 |
+
});
|
| 345 |
+
|
| 346 |
+
jQuery('#useSbSettings-yes').click(function() {
|
| 347 |
+
if (this.checked) {
|
| 348 |
+
jQuery('.topbar_prefs').fadeOut('fast');
|
| 349 |
+
}
|
| 350 |
+
});
|
| 351 |
+
jQuery('#useSbSettings-no').click(function() {
|
| 352 |
+
if (this.checked) {
|
| 353 |
+
jQuery('.topbar_prefs').fadeIn('fast');
|
| 354 |
+
}
|
| 355 |
+
});
|
| 356 |
+
|
| 357 |
+
jQuery('#position-above').click(function() {
|
| 358 |
+
if (jQuery('#info-manual').is(':visible')) {
|
| 359 |
+
jQuery('#info-manual').fadeOut();
|
| 360 |
+
}
|
| 361 |
+
});
|
| 362 |
+
|
| 363 |
+
jQuery('#position-below').click(function() {
|
| 364 |
+
if (jQuery('#info-manual').is(':visible')) {
|
| 365 |
+
jQuery('#info-manual').fadeOut();
|
| 366 |
+
}
|
| 367 |
+
});
|
| 368 |
+
|
| 369 |
+
jQuery('#position-manual').click(function() {
|
| 370 |
+
if (jQuery('#info-manual').is(':not(:visible)')) {
|
| 371 |
+
jQuery('#info-manual').fadeIn('slow');
|
| 372 |
+
}
|
| 373 |
+
});
|
| 374 |
+
|
| 375 |
+
jQuery('.dtags-info').click(function() {
|
| 376 |
+
jQuery('#tag-info').fadeIn('fast');
|
| 377 |
+
});
|
| 378 |
+
|
| 379 |
+
jQuery('.dtags-close').click(function() {
|
| 380 |
+
jQuery('#tag-info').fadeOut();
|
| 381 |
+
});
|
| 382 |
+
|
| 383 |
+
jQuery('.shebang-info').click(function() {
|
| 384 |
+
jQuery('#info-manual').fadeIn('fast');
|
| 385 |
+
});
|
| 386 |
+
|
| 387 |
+
jQuery('#shrsbresetallwarn-cancel').click(function() {
|
| 388 |
+
jQuery('#shrsbresetallwarn').fadeOut();
|
| 389 |
+
});
|
| 390 |
+
|
| 391 |
+
jQuery('#shrsbresetallwarn-yes').click(function() {
|
| 392 |
+
this.checked=jQuery('#shrsbresetallwarn').fadeOut();
|
| 393 |
+
this.checked=jQuery('#resetalloptionsaccept').submit();
|
| 394 |
+
this.checked=!this.checked;
|
| 395 |
+
});
|
| 396 |
+
|
| 397 |
+
|
| 398 |
+
// Load character count and tweet output demo onload
|
| 399 |
+
var dfaultload = 0;
|
| 400 |
+
var dfaulttitle = 8;
|
| 401 |
+
var dfaulturl = 13;
|
| 402 |
+
if(typeof(jQuery("#tweetconfig")) != "undefined" && jQuery("#tweetconfig").length > 0 ) {
|
| 403 |
+
if(jQuery("#tweetconfig").val().indexOf('${title}')!=-1) {
|
| 404 |
+
dfaultload = Math.floor(dfaultload + dfaulttitle);
|
| 405 |
+
}
|
| 406 |
+
if(jQuery("#tweetconfig").val().indexOf('${short_link}')!=-1) {
|
| 407 |
+
dfaultload = Math.floor(dfaultload + dfaulturl);
|
| 408 |
+
}
|
| 409 |
+
var mathdoneload = Math.floor(jQuery('#tweetconfig').val().length - dfaultload);
|
| 410 |
+
if(mathdoneload >= 50) {
|
| 411 |
+
jQuery('#tweetcounter span').addClass('error');
|
| 412 |
+
}
|
| 413 |
+
else {
|
| 414 |
+
jQuery('#tweetcounter span').removeClass();
|
| 415 |
+
}
|
| 416 |
+
jQuery('#tweetcounter span').html(mathdoneload);
|
| 417 |
+
var endvalueload = jQuery('#tweetconfig').val();
|
| 418 |
+
endvalueload = endvalueload.replace('${title}', 'Some fancy post title');
|
| 419 |
+
endvalueload = endvalueload.replace('${short_link}', 'http://goo.gl/dbqlx');
|
| 420 |
+
var endtweetload = endvalueload;
|
| 421 |
+
jQuery('#tweetoutput span').html(endtweetload);
|
| 422 |
+
|
| 423 |
+
|
| 424 |
+
|
| 425 |
+
jQuery('#tweetconfig').keyup(function() {
|
| 426 |
+
var dfaults = 0;
|
| 427 |
+
var title = 8;
|
| 428 |
+
var url = 13;
|
| 429 |
+
|
| 430 |
+
if(jQuery("#tweetconfig").val().indexOf('${title}')!=-1) {
|
| 431 |
+
dfaults = Math.floor(dfaults + title);
|
| 432 |
+
}
|
| 433 |
+
if(jQuery("#tweetconfig").val().indexOf('${short_link}')!=-1) {
|
| 434 |
+
dfaults = Math.floor(dfaults + url);
|
| 435 |
+
}
|
| 436 |
+
|
| 437 |
+
var mathdone = Math.floor(jQuery(this).val().length - dfaults);
|
| 438 |
+
|
| 439 |
+
if(mathdone >= 50) {
|
| 440 |
+
jQuery('#tweetcounter span').addClass('error');
|
| 441 |
+
alert("You need to leave room for the short URL and/or post title...");
|
| 442 |
+
return false;
|
| 443 |
+
}
|
| 444 |
+
else {
|
| 445 |
+
jQuery('#tweetcounter span').removeClass();
|
| 446 |
+
}
|
| 447 |
+
jQuery('#tweetcounter span').html(mathdone);
|
| 448 |
+
|
| 449 |
+
var endvalue = jQuery(this).val();
|
| 450 |
+
|
| 451 |
+
endvalue = endvalue.replace('${title}', 'Some fancy post title');
|
| 452 |
+
endvalue = endvalue.replace('${short_link}', 'http://goo.gl/dbqlx');
|
| 453 |
+
|
| 454 |
+
var endtweet = endvalue;
|
| 455 |
+
|
| 456 |
+
jQuery('#tweetoutput span').html(endtweet);
|
| 457 |
+
|
| 458 |
+
});
|
| 459 |
+
}
|
| 460 |
+
// Check if like button is included and show the position prefs
|
| 461 |
+
|
| 462 |
+
//var likeBtnChecked = jQuery('#fbLikeButton-yes').get(0).checked || jQuery('#googlePlusOneButton-yes').get(0).checked || jQuery('#fbSendButton-yes').get(0).checked;
|
| 463 |
+
|
| 464 |
+
|
| 465 |
+
if(typeof(jQuery('#likeButtonSetTop-yes')) != "undefined" && jQuery('#likeButtonSetTop-yes').length >0 ){
|
| 466 |
+
if (jQuery('#likeButtonSetTop-yes').get(0).checked) {
|
| 467 |
+
jQuery('.likeButtonsAvailableTop').fadeIn('fast');
|
| 468 |
+
}
|
| 469 |
+
|
| 470 |
+
|
| 471 |
+
if(jQuery('#fbLikeButtonTop-yes').get(0).checked
|
| 472 |
+
|| jQuery('#googlePlusOneButtonTop-yes').get(0).checked
|
| 473 |
+
|| jQuery('#tweetButtonTop-yes').get(0).checked
|
| 474 |
+
|| jQuery('#fbSendButtonTop-yes').get(0).checked) {
|
| 475 |
+
jQuery('.likeButtonSetOptionsTop').fadeIn('fast');
|
| 476 |
+
}
|
| 477 |
+
|
| 478 |
+
if(jQuery('#fbLikeButtonTop-yes').get(0).checked) {
|
| 479 |
+
jQuery('.likebuttonpreviewTop').fadeIn('fast');
|
| 480 |
+
}
|
| 481 |
+
|
| 482 |
+
if(jQuery('#fbSendButtonTop-yes').get(0).checked) {
|
| 483 |
+
jQuery('.sendbuttonpreviewTop').fadeIn('fast');
|
| 484 |
+
}
|
| 485 |
+
|
| 486 |
+
if(jQuery('#googlePlusOneButtonTop-yes').get(0).checked) {
|
| 487 |
+
jQuery('.plusonepreviewTop').fadeIn('fast');
|
| 488 |
+
}
|
| 489 |
+
|
| 490 |
+
if(jQuery('#tweetButtonTop-yes').get(0).checked) {
|
| 491 |
+
jQuery('.tweetbuttonpreviewTop').fadeIn('fast');
|
| 492 |
+
}
|
| 493 |
+
}
|
| 494 |
+
|
| 495 |
+
if(typeof(jQuery('#likeButtonSetBottom-yes')) != "undefined" && jQuery('#likeButtonSetBottom-yes').length >0 ){
|
| 496 |
+
if (jQuery('#likeButtonSetBottom-yes').get(0).checked) {
|
| 497 |
+
jQuery('.likeButtonsAvailableBottom').fadeIn('fast');
|
| 498 |
+
}
|
| 499 |
+
|
| 500 |
+
if(jQuery('#fbLikeButtonBottom-yes').get(0).checked
|
| 501 |
+
|| jQuery('#googlePlusOneButtonBottom-yes').get(0).checked
|
| 502 |
+
|| jQuery('#tweetButtonBottom-yes').get(0).checked
|
| 503 |
+
|| jQuery('#fbSendButtonBottom-yes').get(0).checked) {
|
| 504 |
+
jQuery('.likeButtonSetOptionsBottom').fadeIn('fast');
|
| 505 |
+
}
|
| 506 |
+
|
| 507 |
+
if(jQuery('#fbLikeButtonBottom-yes').get(0).checked) {
|
| 508 |
+
jQuery('.likebuttonpreviewBottom').fadeIn('fast');
|
| 509 |
+
}
|
| 510 |
+
|
| 511 |
+
if(jQuery('#fbSendButtonBottom-yes').get(0).checked) {
|
| 512 |
+
jQuery('.sendbuttonpreviewBottom').fadeIn('fast');
|
| 513 |
+
}
|
| 514 |
+
|
| 515 |
+
if(jQuery('#googlePlusOneButtonBottom-yes').get(0).checked) {
|
| 516 |
+
jQuery('.plusonepreviewBottom').fadeIn('fast');
|
| 517 |
+
}
|
| 518 |
+
if(jQuery('#tweetButtonBottom-yes').get(0).checked) {
|
| 519 |
+
jQuery('.tweetbuttonpreviewBottom').fadeIn('fast');
|
| 520 |
+
}
|
| 521 |
+
|
| 522 |
+
}
|
| 523 |
+
|
| 524 |
+
// Check if designer tooltips are included and show the color prefs
|
| 525 |
+
if(typeof(jQuery('#designer_toolTips-yes')) != "undefined" && jQuery('#designer_toolTips-yes').length >0 ){
|
| 526 |
+
var designerToolTipsChecked = jQuery('#designer_toolTips-yes').get(0).checked;
|
| 527 |
+
if (designerToolTipsChecked) {
|
| 528 |
+
jQuery('.designer_toolTip_prefs').fadeIn('fast');
|
| 529 |
+
}
|
| 530 |
+
|
| 531 |
+
jQuery('#tip_bg_color_picker_holder').ColorPicker({
|
| 532 |
+
flat: true,
|
| 533 |
+
color: jQuery("#tip_bg_color").val(),
|
| 534 |
+
onChange : function(hsb, hex, rgb, el) {
|
| 535 |
+
jQuery("#tip_bg_color").val('#' + hex);
|
| 536 |
+
jQuery('#tip_bg_color_picker div').css('backgroundColor', '#' + hex);
|
| 537 |
+
},
|
| 538 |
+
onSubmit: function(hsb, hex, rgb, el) {
|
| 539 |
+
jQuery("#tip_bg_color").val('#' + hex);
|
| 540 |
+
jQuery('#tip_bg_color_picker div').css('backgroundColor', '#' + hex);
|
| 541 |
+
jQuery('#tip_bg_color_picker_holder').toggle();
|
| 542 |
+
}
|
| 543 |
+
});
|
| 544 |
+
|
| 545 |
+
// The below lines are to prevent a nasty input form control not focussable error in chrome/safari
|
| 546 |
+
jQuery('#tip_bg_color_picker_holder').find('input').each(function(index) {
|
| 547 |
+
jQuery(this).attr("maxlength","50") ;
|
| 548 |
+
});
|
| 549 |
+
|
| 550 |
+
jQuery('#tip_bg_color_picker div').bind('click', function() {
|
| 551 |
+
jQuery('#tip_bg_color_picker_holder').toggle();
|
| 552 |
+
jQuery('#tip_bg_color_picker_holder').ColorPickerSetColor(jQuery("#tip_bg_color").val());
|
| 553 |
+
// Attach click handler to the body to hide the color picker (if visible) for clicks outside the color picker
|
| 554 |
+
jQuery('body').trigger('click');
|
| 555 |
+
if(jQuery('#tip_bg_color_picker_holder').is(':visible')) {
|
| 556 |
+
jQuery('body').bind("click",function () {
|
| 557 |
+
jQuery('#tip_bg_color_picker_holder').hide();
|
| 558 |
+
jQuery('body').unbind("click");
|
| 559 |
+
});
|
| 560 |
+
}
|
| 561 |
+
return false;
|
| 562 |
+
});
|
| 563 |
+
|
| 564 |
+
jQuery('#tip_bg_color_reset').bind('click', function() {
|
| 565 |
+
jQuery("#tip_bg_color").val('#000000');
|
| 566 |
+
jQuery('#tip_bg_color_picker div').css('backgroundColor', '#000000');
|
| 567 |
+
});
|
| 568 |
+
// Prevent the body click handler from firing if the click is inside the color picker
|
| 569 |
+
jQuery('#tip_bg_color_picker_holder').click(function() { return false;});
|
| 570 |
+
|
| 571 |
+
jQuery('#tip_text_color_picker_holder').ColorPicker({
|
| 572 |
+
flat: true,
|
| 573 |
+
color: jQuery("#tip_text_color").val(),
|
| 574 |
+
onChange : function(hsb, hex, rgb, el) {
|
| 575 |
+
jQuery("#tip_text_color").val('#' + hex);
|
| 576 |
+
jQuery('#tip_text_color_picker div').css('backgroundColor', '#' + hex);
|
| 577 |
+
},
|
| 578 |
+
onSubmit: function(hsb, hex, rgb, el) {
|
| 579 |
+
jQuery("#tip_text_color").val('#' + hex);
|
| 580 |
+
jQuery('#tip_text_color_picker div').css('backgroundColor', '#' + hex);
|
| 581 |
+
jQuery('#tip_text_color_picker_holder').toggle();
|
| 582 |
+
}
|
| 583 |
+
});
|
| 584 |
+
// The below lines are to prevent a nasty input form control not focussable error in chrome/safari
|
| 585 |
+
jQuery('#tip_text_color_picker_holder').find('input').each(function(index) {
|
| 586 |
+
jQuery(this).attr("maxlength","50") ;
|
| 587 |
+
});
|
| 588 |
+
|
| 589 |
+
jQuery('#tip_text_color_picker div').bind('click', function() {
|
| 590 |
+
jQuery('#tip_text_color_picker_holder').toggle();
|
| 591 |
+
jQuery('#tip_text_color_picker_holder').ColorPickerSetColor(jQuery("#tip_text_color").val());
|
| 592 |
+
// Attach click handler to the body to hide the color picker (if visible) for clicks outside the color picker
|
| 593 |
+
jQuery('body').trigger('click');
|
| 594 |
+
if(jQuery('#tip_text_color_picker_holder').is(':visible')) {
|
| 595 |
+
jQuery('body').bind("click",function () {
|
| 596 |
+
jQuery('#tip_text_color_picker_holder').hide();
|
| 597 |
+
jQuery('body').unbind("click");
|
| 598 |
+
});
|
| 599 |
+
}
|
| 600 |
+
return false;
|
| 601 |
+
});
|
| 602 |
+
// Prevent the body click handler from firing if the click is inside the color picker
|
| 603 |
+
jQuery('#tip_text_color_picker_holder').click(function() { return false;});
|
| 604 |
+
|
| 605 |
+
jQuery('#tip_text_color_reset').bind('click', function() {
|
| 606 |
+
jQuery("#tip_text_color").val('#ffffff');
|
| 607 |
+
jQuery('#tip_text_color_picker div').css('backgroundColor', '#ffffff');
|
| 608 |
+
});
|
| 609 |
+
|
| 610 |
+
}
|
| 611 |
+
|
| 612 |
+
// Check if social analytics is enabled or not, if enabled show the preferences
|
| 613 |
+
if(typeof(jQuery('#pubGaSocial-yes')) != "undefined" && jQuery('#pubGaSocial-yes').length >0 ){
|
| 614 |
+
var socialEnableChecked = jQuery('#pubGaSocial-yes').get(0).checked;
|
| 615 |
+
if (socialEnableChecked) {
|
| 616 |
+
jQuery('.pubGaSocial_prefs').fadeIn('fast');
|
| 617 |
+
}
|
| 618 |
+
}
|
| 619 |
+
|
| 620 |
+
// Check if social analytics is enabled or not, if enabled show the preferences
|
| 621 |
+
if(typeof(jQuery('#recommendations-yes')) != "undefined" && jQuery('#recommendations-yes').length >0 ){
|
| 622 |
+
var socialEnableChecked = jQuery('#recommendations-yes').get(0).checked;
|
| 623 |
+
if (socialEnableChecked) {
|
| 624 |
+
jQuery('.recommendations_prefs-1').fadeIn('fast');
|
| 625 |
+
var thumbEnableChecked = jQuery('#recommendations-style-image').get(0).checked;
|
| 626 |
+
if (thumbEnableChecked) {
|
| 627 |
+
jQuery('.recommendations_prefs-2').fadeIn('fast');
|
| 628 |
+
}
|
| 629 |
+
}
|
| 630 |
+
}
|
| 631 |
+
|
| 632 |
+
// Check if classic bookmarks is enabled or not, if enabled show the preferences
|
| 633 |
+
if(typeof(jQuery('#cb-yes')) != "undefined" && jQuery('#cb-yes').length >0 ){
|
| 634 |
+
var socialEnableChecked = jQuery('#cb-yes').get(0).checked;
|
| 635 |
+
if (socialEnableChecked) {
|
| 636 |
+
jQuery('.cb_prefs').fadeIn('fast');
|
| 637 |
+
}
|
| 638 |
+
}
|
| 639 |
+
|
| 640 |
+
//For the Top Sharebar custom background color option
|
| 641 |
+
if(typeof(jQuery('#useSbSettings-no')) != "undefined" && jQuery('#useSbSettings-no').length >0 ){
|
| 642 |
+
var useSbSettingsChecked = jQuery('#useSbSettings-no').get(0).checked;
|
| 643 |
+
if (useSbSettingsChecked) {
|
| 644 |
+
jQuery('.topbar_prefs').fadeIn('fast');
|
| 645 |
+
}
|
| 646 |
+
|
| 647 |
+
jQuery('#tb_bg_color_picker_holder').ColorPicker({
|
| 648 |
+
flat: true,
|
| 649 |
+
color: jQuery("#tb_bg_color").val(),
|
| 650 |
+
onChange : function(hsb, hex, rgb, el) {
|
| 651 |
+
jQuery("#tb_bg_color").val('#' + hex);
|
| 652 |
+
jQuery('#tb_bg_color_picker div').css('backgroundColor', '#' + hex);
|
| 653 |
+
},
|
| 654 |
+
onSubmit: function(hsb, hex, rgb, el) {
|
| 655 |
+
jQuery("#tb_bg_color").val('#' + hex);
|
| 656 |
+
jQuery('#tb_bg_color_picker div').css('backgroundColor', '#' + hex);
|
| 657 |
+
jQuery('#tb_bg_color_picker_holder').toggle();
|
| 658 |
+
}
|
| 659 |
+
});
|
| 660 |
+
|
| 661 |
+
// The below lines are to prevent a nasty input form control not focussable error in chrome/safari
|
| 662 |
+
jQuery('#tb_bg_color_picker_holder').find('input').each(function(index) {
|
| 663 |
+
jQuery(this).attr("maxlength","50") ;
|
| 664 |
+
});
|
| 665 |
+
|
| 666 |
+
jQuery('#tb_bg_color_picker div').bind('click', function() {
|
| 667 |
+
jQuery('#tb_bg_color_picker_holder').toggle();
|
| 668 |
+
jQuery('#tb_bg_color_picker_holder').ColorPickerSetColor(jQuery("#tb_bg_color").val());
|
| 669 |
+
// Attach click handler to the body to hide the color picker (if visible) for clicks outside the color picker
|
| 670 |
+
jQuery('body').trigger('click');
|
| 671 |
+
if(jQuery('#tb_bg_color_picker_holder').is(':visible')) {
|
| 672 |
+
jQuery('body').bind("click",function () {
|
| 673 |
+
jQuery('#tb_bg_color_picker_holder').hide();
|
| 674 |
+
jQuery('body').unbind("click");
|
| 675 |
+
});
|
| 676 |
+
}
|
| 677 |
+
return false;
|
| 678 |
+
});
|
| 679 |
+
|
| 680 |
+
jQuery('#tb_bg_color_reset').bind('click', function() {
|
| 681 |
+
jQuery("#tb_bg_color").val('#000000');
|
| 682 |
+
jQuery('#tb_bg_color_picker div').css('backgroundColor', '#000000');
|
| 683 |
+
});
|
| 684 |
+
// Prevent the body click handler from firing if the click is inside the color picker
|
| 685 |
+
jQuery('#tb_bg_color_picker_holder').click(function() { return false;});
|
| 686 |
+
|
| 687 |
+
//For the Show/Hide Button color on the toolbar
|
| 688 |
+
jQuery('#tb_border_color_picker_holder').ColorPicker({
|
| 689 |
+
flat: true,
|
| 690 |
+
color: jQuery("#tb_border_color").val(),
|
| 691 |
+
onChange : function(hsb, hex, rgb, el) {
|
| 692 |
+
jQuery("#tb_border_color").val('#' + hex);
|
| 693 |
+
jQuery('#tb_border_color_picker div').css('backgroundColor', '#' + hex);
|
| 694 |
+
},
|
| 695 |
+
onSubmit: function(hsb, hex, rgb, el) {
|
| 696 |
+
jQuery("#tb_border_color").val('#' + hex);
|
| 697 |
+
jQuery('#tb_border_color_picker div').css('backgroundColor', '#' + hex);
|
| 698 |
+
jQuery('#tb_border_color_picker_holder').toggle();
|
| 699 |
+
}
|
| 700 |
+
});
|
| 701 |
+
|
| 702 |
+
// The below lines are to prevent a nasty input form control not focussable error in chrome/safari
|
| 703 |
+
jQuery('#tb_border_color_picker_holder').find('input').each(function(index) {
|
| 704 |
+
jQuery(this).attr("maxlength","50") ;
|
| 705 |
+
});
|
| 706 |
+
|
| 707 |
+
jQuery('#tb_border_color_picker div').bind('click', function() {
|
| 708 |
+
jQuery('#tb_border_color_picker_holder').toggle();
|
| 709 |
+
jQuery('#tb_border_color_picker_holder').ColorPickerSetColor(jQuery("#tb_border_color").val());
|
| 710 |
+
// Attach click handler to the body to hide the color picker (if visible) for clicks outside the color picker
|
| 711 |
+
jQuery('body').trigger('click');
|
| 712 |
+
if(jQuery('#tb_border_color_picker_holder').is(':visible')) {
|
| 713 |
+
jQuery('body').bind("click",function () {
|
| 714 |
+
jQuery('#tb_border_color_picker_holder').hide();
|
| 715 |
+
jQuery('body').unbind("click");
|
| 716 |
+
});
|
| 717 |
+
}
|
| 718 |
+
return false;
|
| 719 |
+
});
|
| 720 |
+
|
| 721 |
+
jQuery('#tb_border_color_reset').bind('click', function() {
|
| 722 |
+
jQuery("#tb_border_color").val('#000000');
|
| 723 |
+
jQuery('#tb_border_color_picker div').css('backgroundColor', '#000000');
|
| 724 |
+
});
|
| 725 |
+
// Prevent the body click handler from firing if the click is inside the color picker
|
| 726 |
+
jQuery('#tb_border_color_picker_holder').click(function() { return false;});
|
| 727 |
+
|
| 728 |
+
}
|
| 729 |
+
}});
|
| 730 |
+
|
| 731 |
+
|
| 732 |
+
/**
|
| 733 |
+
*
|
| 734 |
+
* Color picker
|
| 735 |
+
* Author: Stefan Petre www.eyecon.ro
|
| 736 |
+
*
|
| 737 |
+
* Dual licensed under the MIT and GPL licenses
|
| 738 |
+
*
|
| 739 |
+
*/
|
| 740 |
+
(function($){var ColorPicker=function(){var
|
| 741 |
+
ids={},inAction,charMin=65,visible,tpl='<div class="colorpicker"><div class="colorpicker_color"><div><div></div></div></div><div class="colorpicker_hue"><div></div></div><div class="colorpicker_new_color"></div><div class="colorpicker_current_color"></div><div class="colorpicker_hex"><input type="text" maxlength="6" size="6" /></div><div class="colorpicker_rgb_r colorpicker_field"><input type="text" maxlength="3" size="3" /><span></span></div><div class="colorpicker_rgb_g colorpicker_field"><input type="text" maxlength="3" size="3" /><span></span></div><div class="colorpicker_rgb_b colorpicker_field"><input type="text" maxlength="3" size="3" /><span></span></div><div class="colorpicker_hsb_h colorpicker_field"><input type="text" maxlength="3" size="3" /><span></span></div><div class="colorpicker_hsb_s colorpicker_field"><input type="text" maxlength="3" size="3" /><span></span></div><div class="colorpicker_hsb_b colorpicker_field"><input type="text" maxlength="3" size="3" /><span></span></div><div class="colorpicker_submit"></div></div>',defaults={eventName:'click',onShow:function(){},onBeforeShow:function(){},onHide:function(){},onChange:function(){},onSubmit:function(){},color:'ff0000',livePreview:true,flat:false},fillRGBFields=function(hsb,cal){var rgb=HSBToRGB(hsb);$(cal).data('colorpicker').fields.eq(1).val(rgb.r).end().eq(2).val(rgb.g).end().eq(3).val(rgb.b).end();},fillHSBFields=function(hsb,cal){$(cal).data('colorpicker').fields.eq(4).val(hsb.h).end().eq(5).val(hsb.s).end().eq(6).val(hsb.b).end();},fillHexFields=function(hsb,cal){$(cal).data('colorpicker').fields.eq(0).val(HSBToHex(hsb)).end();},setSelector=function(hsb,cal){$(cal).data('colorpicker').selector.css('backgroundColor','#'+HSBToHex({h:hsb.h,s:100,b:100}));$(cal).data('colorpicker').selectorIndic.css({left:parseInt(150*hsb.s/100,10),top:parseInt(150*(100-hsb.b)/100,10)});},setHue=function(hsb,cal){$(cal).data('colorpicker').hue.css('top',parseInt(150-150*hsb.h/360,10));},setCurrentColor=function(hsb,cal){$(cal).data('colorpicker').currentColor.css('backgroundColor','#'+HSBToHex(hsb));},setNewColor=function(hsb,cal){$(cal).data('colorpicker').newColor.css('backgroundColor','#'+HSBToHex(hsb));},keyDown=function(ev){var pressedKey=ev.charCode||ev.keyCode||-1;if((pressedKey>charMin&&pressedKey<=90)||pressedKey==32){return false;}
|
| 742 |
+
var cal=$(this).parent().parent();if(cal.data('colorpicker').livePreview===true){change.apply(this);}},change=function(ev){var cal=$(this).parent().parent(),col;if(this.parentNode.className.indexOf('_hex')>0){cal.data('colorpicker').color=col=HexToHSB(fixHex(this.value));}else if(this.parentNode.className.indexOf('_hsb')>0){cal.data('colorpicker').color=col=fixHSB({h:parseInt(cal.data('colorpicker').fields.eq(4).val(),10),s:parseInt(cal.data('colorpicker').fields.eq(5).val(),10),b:parseInt(cal.data('colorpicker').fields.eq(6).val(),10)});}else{cal.data('colorpicker').color=col=RGBToHSB(fixRGB({r:parseInt(cal.data('colorpicker').fields.eq(1).val(),10),g:parseInt(cal.data('colorpicker').fields.eq(2).val(),10),b:parseInt(cal.data('colorpicker').fields.eq(3).val(),10)}));}
|
| 743 |
+
if(ev){fillRGBFields(col,cal.get(0));fillHexFields(col,cal.get(0));fillHSBFields(col,cal.get(0));}
|
| 744 |
+
setSelector(col,cal.get(0));setHue(col,cal.get(0));setNewColor(col,cal.get(0));cal.data('colorpicker').onChange.apply(cal,[col,HSBToHex(col),HSBToRGB(col)]);},blur=function(ev){var cal=$(this).parent().parent();cal.data('colorpicker').fields.parent().removeClass('colorpicker_focus');},focus=function(){charMin=this.parentNode.className.indexOf('_hex')>0?70:65;$(this).parent().parent().data('colorpicker').fields.parent().removeClass('colorpicker_focus');$(this).parent().addClass('colorpicker_focus');},downIncrement=function(ev){var field=$(this).parent().find('input').focus();var current={el:$(this).parent().addClass('colorpicker_slider'),max:this.parentNode.className.indexOf('_hsb_h')>0?360:(this.parentNode.className.indexOf('_hsb')>0?100:255),y:ev.pageY,field:field,val:parseInt(field.val(),10),preview:$(this).parent().parent().data('colorpicker').livePreview};$(document).bind('mouseup',current,upIncrement);$(document).bind('mousemove',current,moveIncrement);},moveIncrement=function(ev){ev.data.field.val(Math.max(0,Math.min(ev.data.max,parseInt(ev.data.val+ev.pageY-ev.data.y,10))));if(ev.data.preview){change.apply(ev.data.field.get(0),[true]);}
|
| 745 |
+
return false;},upIncrement=function(ev){change.apply(ev.data.field.get(0),[true]);ev.data.el.removeClass('colorpicker_slider').find('input').focus();$(document).unbind('mouseup',upIncrement);$(document).unbind('mousemove',moveIncrement);return false;},downHue=function(ev){var current={cal:$(this).parent(),y:$(this).offset().top};current.preview=current.cal.data('colorpicker').livePreview;$(document).bind('mouseup',current,upHue);$(document).bind('mousemove',current,moveHue);},moveHue=function(ev){change.apply(ev.data.cal.data('colorpicker').fields.eq(4).val(parseInt(360*(150-Math.max(0,Math.min(150,(ev.pageY-ev.data.y))))/150,10)).get(0),[ev.data.preview]);return false;},upHue=function(ev){fillRGBFields(ev.data.cal.data('colorpicker').color,ev.data.cal.get(0));fillHexFields(ev.data.cal.data('colorpicker').color,ev.data.cal.get(0));$(document).unbind('mouseup',upHue);$(document).unbind('mousemove',moveHue);return false;},downSelector=function(ev){var current={cal:$(this).parent(),pos:$(this).offset()};current.preview=current.cal.data('colorpicker').livePreview;$(document).bind('mouseup',current,upSelector);$(document).bind('mousemove',current,moveSelector);},moveSelector=function(ev){change.apply(ev.data.cal.data('colorpicker').fields.eq(6).val(parseInt(100*(150-Math.max(0,Math.min(150,(ev.pageY-ev.data.pos.top))))/150,10)).end().eq(5).val(parseInt(100*(Math.max(0,Math.min(150,(ev.pageX-ev.data.pos.left))))/150,10)).get(0),[ev.data.preview]);return false;},upSelector=function(ev){fillRGBFields(ev.data.cal.data('colorpicker').color,ev.data.cal.get(0));fillHexFields(ev.data.cal.data('colorpicker').color,ev.data.cal.get(0));$(document).unbind('mouseup',upSelector);$(document).unbind('mousemove',moveSelector);return false;},enterSubmit=function(ev){$(this).addClass('colorpicker_focus');},leaveSubmit=function(ev){$(this).removeClass('colorpicker_focus');},clickSubmit=function(ev){var cal=$(this).parent();var col=cal.data('colorpicker').color;cal.data('colorpicker').origColor=col;setCurrentColor(col,cal.get(0));cal.data('colorpicker').onSubmit(col,HSBToHex(col),HSBToRGB(col),cal.data('colorpicker').el);},show=function(ev){var cal=$('#'+$(this).data('colorpickerId'));cal.data('colorpicker').onBeforeShow.apply(this,[cal.get(0)]);var pos=$(this).offset();var viewPort=getViewport();var top=pos.top+this.offsetHeight;var left=pos.left;if(top+176>viewPort.t+viewPort.h){top-=this.offsetHeight+176;}
|
| 746 |
+
if(left+356>viewPort.l+viewPort.w){left-=356;}
|
| 747 |
+
cal.css({left:left+'px',top:top+'px'});if(cal.data('colorpicker').onShow.apply(this,[cal.get(0)])!=false){cal.show();}
|
| 748 |
+
$(document).bind('mousedown',{cal:cal},hide);return false;},hide=function(ev){if(!isChildOf(ev.data.cal.get(0),ev.target,ev.data.cal.get(0))){if(ev.data.cal.data('colorpicker').onHide.apply(this,[ev.data.cal.get(0)])!=false){ev.data.cal.hide();}
|
| 749 |
+
$(document).unbind('mousedown',hide);}},isChildOf=function(parentEl,el,container){if(parentEl==el){return true;}
|
| 750 |
+
if(parentEl.contains){return parentEl.contains(el);}
|
| 751 |
+
if(parentEl.compareDocumentPosition){return!!(parentEl.compareDocumentPosition(el)&16);}
|
| 752 |
+
var prEl=el.parentNode;while(prEl&&prEl!=container){if(prEl==parentEl)
|
| 753 |
+
return true;prEl=prEl.parentNode;}
|
| 754 |
+
return false;},getViewport=function(){var m=document.compatMode=='CSS1Compat';return{l:window.pageXOffset||(m?document.documentElement.scrollLeft:document.body.scrollLeft),t:window.pageYOffset||(m?document.documentElement.scrollTop:document.body.scrollTop),w:window.innerWidth||(m?document.documentElement.clientWidth:document.body.clientWidth),h:window.innerHeight||(m?document.documentElement.clientHeight:document.body.clientHeight)};},fixHSB=function(hsb){return{h:Math.min(360,Math.max(0,hsb.h)),s:Math.min(100,Math.max(0,hsb.s)),b:Math.min(100,Math.max(0,hsb.b))};},fixRGB=function(rgb){return{r:Math.min(255,Math.max(0,rgb.r)),g:Math.min(255,Math.max(0,rgb.g)),b:Math.min(255,Math.max(0,rgb.b))};},fixHex=function(hex){var len=6-hex.length;if(len>0){var o=[];for(var i=0;i<len;i++){o.push('0');}
|
| 755 |
+
o.push(hex);hex=o.join('');}
|
| 756 |
+
return hex;},HexToRGB=function(hex){var hex=parseInt(((hex.indexOf('#')>-1)?hex.substring(1):hex),16);return{r:hex>>16,g:(hex&0x00FF00)>>8,b:(hex&0x0000FF)};},HexToHSB=function(hex){return RGBToHSB(HexToRGB(hex));},RGBToHSB=function(rgb){var hsb={h:0,s:0,b:0};var min=Math.min(rgb.r,rgb.g,rgb.b);var max=Math.max(rgb.r,rgb.g,rgb.b);var delta=max-min;hsb.b=max;if(max!=0){}
|
| 757 |
+
hsb.s=max!=0?255*delta/max:0;if(hsb.s!=0){if(rgb.r==max){hsb.h=(rgb.g-rgb.b)/delta;}else if(rgb.g==max){hsb.h=2+(rgb.b-rgb.r)/delta;}else{hsb.h=4+(rgb.r-rgb.g)/delta;}}else{hsb.h=-1;}
|
| 758 |
+
hsb.h*=60;if(hsb.h<0){hsb.h+=360;}
|
| 759 |
+
hsb.s*=100/255;hsb.b*=100/255;return hsb;},HSBToRGB=function(hsb){var rgb={};var h=Math.round(hsb.h);var s=Math.round(hsb.s*255/100);var v=Math.round(hsb.b*255/100);if(s==0){rgb.r=rgb.g=rgb.b=v;}else{var t1=v;var t2=(255-s)*v/255;var t3=(t1-t2)*(h%60)/60;if(h==360)h=0;if(h<60){rgb.r=t1;rgb.b=t2;rgb.g=t2+t3}
|
| 760 |
+
else if(h<120){rgb.g=t1;rgb.b=t2;rgb.r=t1-t3}
|
| 761 |
+
else if(h<180){rgb.g=t1;rgb.r=t2;rgb.b=t2+t3}
|
| 762 |
+
else if(h<240){rgb.b=t1;rgb.r=t2;rgb.g=t1-t3}
|
| 763 |
+
else if(h<300){rgb.b=t1;rgb.g=t2;rgb.r=t2+t3}
|
| 764 |
+
else if(h<360){rgb.r=t1;rgb.g=t2;rgb.b=t1-t3}
|
| 765 |
+
else{rgb.r=0;rgb.g=0;rgb.b=0}}
|
| 766 |
+
return{r:Math.round(rgb.r),g:Math.round(rgb.g),b:Math.round(rgb.b)};},RGBToHex=function(rgb){var hex=[rgb.r.toString(16),rgb.g.toString(16),rgb.b.toString(16)];$.each(hex,function(nr,val){if(val.length==1){hex[nr]='0'+val;}});return hex.join('');},HSBToHex=function(hsb){return RGBToHex(HSBToRGB(hsb));},restoreOriginal=function(){var cal=$(this).parent();var col=cal.data('colorpicker').origColor;cal.data('colorpicker').color=col;fillRGBFields(col,cal.get(0));fillHexFields(col,cal.get(0));fillHSBFields(col,cal.get(0));setSelector(col,cal.get(0));setHue(col,cal.get(0));setNewColor(col,cal.get(0));};return{init:function(opt){opt=$.extend({},defaults,opt||{});if(typeof opt.color=='string'){opt.color=HexToHSB(opt.color);}else if(opt.color.r!=undefined&&opt.color.g!=undefined&&opt.color.b!=undefined){opt.color=RGBToHSB(opt.color);}else if(opt.color.h!=undefined&&opt.color.s!=undefined&&opt.color.b!=undefined){opt.color=fixHSB(opt.color);}else{return this;}
|
| 767 |
+
return this.each(function(){if(!$(this).data('colorpickerId')){var options=$.extend({},opt);options.origColor=opt.color;var id='collorpicker_'+parseInt(Math.random()*1000);$(this).data('colorpickerId',id);var cal=$(tpl).attr('id',id);if(options.flat){cal.appendTo(this).show();}else{cal.appendTo(document.body);}
|
| 768 |
+
options.fields=cal.find('input').bind('keyup',keyDown).bind('change',change).bind('blur',blur).bind('focus',focus);cal.find('span').bind('mousedown',downIncrement).end().find('>div.colorpicker_current_color').bind('click',restoreOriginal);options.selector=cal.find('div.colorpicker_color').bind('mousedown',downSelector);options.selectorIndic=options.selector.find('div div');options.el=this;options.hue=cal.find('div.colorpicker_hue div');cal.find('div.colorpicker_hue').bind('mousedown',downHue);options.newColor=cal.find('div.colorpicker_new_color');options.currentColor=cal.find('div.colorpicker_current_color');cal.data('colorpicker',options);cal.find('div.colorpicker_submit').bind('mouseenter',enterSubmit).bind('mouseleave',leaveSubmit).bind('click',clickSubmit);fillRGBFields(options.color,cal.get(0));fillHSBFields(options.color,cal.get(0));fillHexFields(options.color,cal.get(0));setHue(options.color,cal.get(0));setSelector(options.color,cal.get(0));setCurrentColor(options.color,cal.get(0));setNewColor(options.color,cal.get(0));if(options.flat){cal.css({position:'relative',display:'block'});}else{$(this).bind(options.eventName,show);}}});},showPicker:function(){return this.each(function(){if($(this).data('colorpickerId')){show.apply(this);}});},hidePicker:function(){return this.each(function(){if($(this).data('colorpickerId')){$('#'+$(this).data('colorpickerId')).hide();}});},setColor:function(col){if(typeof col=='string'){col=HexToHSB(col);}else if(col.r!=undefined&&col.g!=undefined&&col.b!=undefined){col=RGBToHSB(col);}else if(col.h!=undefined&&col.s!=undefined&&col.b!=undefined){col=fixHSB(col);}else{return this;}
|
| 769 |
+
return this.each(function(){if($(this).data('colorpickerId')){var cal=$('#'+$(this).data('colorpickerId'));cal.data('colorpicker').color=col;cal.data('colorpicker').origColor=col;fillRGBFields(col,cal.get(0));fillHSBFields(col,cal.get(0));fillHexFields(col,cal.get(0));setHue(col,cal.get(0));setSelector(col,cal.get(0));setCurrentColor(col,cal.get(0));setNewColor(col,cal.get(0));}});}};}();$.fn.extend({ColorPicker:ColorPicker.init,ColorPickerHide:ColorPicker.hidePicker,ColorPickerShow:ColorPicker.showPicker,ColorPickerSetColor:ColorPicker.setColor});})(jQuery);
|
js/shareaholic-admin.min.js
ADDED
|
@@ -0,0 +1,53 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
jQuery(document).ready(function(){jQuery("#iconator")&&jQuery("#shrsb-networks").sortable({delay:250,cursor:"move",scroll:!0,revert:!0,opacity:0.7,placeholder:"dropzoneNetworks",forcePlaceholderSize:!0,items:"li"});if(jQuery(".shrsb-bookmarks")){jQuery("#shrsb-sortables").sortable({handle:".box-mid-head",delay:250,cursor:"move",scroll:!0,revert:!0,opacity:0.7});jQuery("#buttonPreviewsTop,#buttonPreviewsBottom").sortable({delay:250,cursor:"move",scroll:!0,revert:!0,opacity:0.7,placeholder:"dropzone",
|
| 2 |
+
forcePlaceholderSize:!0,items:"li"});jQuery("#sel-all").click(function(){jQuery("#shrsb-networks").each(function(){jQuery("#shrsb-networks input").attr("checked","checked")})});jQuery("#sel-none").click(function(){jQuery("#shrsb-networks").each(function(){jQuery("#shrsb-networks input").removeAttr("checked")})});jQuery("#sel-pop").click(function(){jQuery("#shrsb-networks").each(function(){jQuery("#shrsb-networks input").removeAttr("checked")});jQuery("#shrsb-networks").each(function(){jQuery("#shr-facebook").attr("checked",
|
| 3 |
+
"checked");jQuery("#shr-twitter").attr("checked","checked");jQuery("#shr-linkedin").attr("checked","checked");jQuery("#shr-googleplus").attr("checked","checked");jQuery("#shr-googlebookmarks").attr("checked","checked");jQuery("#shr-stumbleupon").attr("checked","checked");jQuery("#shr-pinterest").attr("checked","checked");jQuery("#shr-fastmail").attr("checked","checked");jQuery("#shr-printfriendly").attr("checked","checked")})});jQuery("#preset-amounts").parent("label").click(function(){jQuery("#custom-amounts").attr("disabled",
|
| 4 |
+
"disabled").css({cursor:"none"});jQuery("#preset-amounts").removeAttr("disabled")});jQuery("#custom-amounts").parent("label").click(function(){jQuery("#preset-amounts").attr("disabled","disabled").css({cursor:"none"});jQuery("#custom-amounts").removeAttr("disabled")});jQuery("#hide-sponsors").click(function(){jQuery("#no-sponsors").submit()});jQuery(".del-x").click(function(){jQuery(this).parent("div").parent("div").fadeOut()});jQuery("#custom-mods").click(function(){jQuery(this).is(":not(:checked)")?
|
| 5 |
+
jQuery("#custom-mods-notice").css("display","none"):(jQuery("#custom-mods-notice").fadeIn("fast"),jQuery("#custom-mods-notice").css("display","table"))});jQuery(".custom-mods-notice-close").click(function(){jQuery("#custom-mods-notice").fadeOut("fast")});jQuery("#bgimg-yes").click(function(){jQuery(this).is(":checked")?jQuery("#bgimgs").fadeIn("slow"):jQuery("#bgimgs").css("display","none")});jQuery("#shr-twitter").click(function(){jQuery(this).attr("checked")?jQuery("#twitter-defaults").fadeIn("fast"):
|
| 6 |
+
jQuery("#twitter-defaults").fadeOut()});jQuery("#shorty").change(function(){jQuery("#shortyapimdiv-bitly").fadeOut("fast");jQuery("#shortyapimdiv-awesm").fadeOut("fast");jQuery("#shortyapimdiv-supr").fadeOut("fast");jQuery("#shortyapimdiv-jmp").fadeOut("fast");"bitly"==this.value?jQuery("#shortyapimdiv-bitly").fadeIn("fast"):"awesm"==this.value?jQuery("#shortyapimdiv-awesm").fadeIn("fast"):"supr"==this.value?jQuery("#shortyapimdiv-supr").fadeIn("fast"):"jmp"==this.value&&jQuery("#shortyapimdiv-jmp").fadeIn("fast")});
|
| 7 |
+
jQuery("#shortyapichk-supr").click(function(){this.checked?jQuery("#shortyapidiv-supr").fadeIn("fast"):jQuery("#shortyapidiv-supr").fadeOut("fast")});jQuery("#likeButtonSetTop-yes").click(function(){this.checked&&jQuery(".likeButtonsAvailableTop").fadeIn("fast")});jQuery("#likeButtonSetTop-no").click(function(){this.checked&&jQuery(".likeButtonsAvailableTop").fadeOut("fast")});jQuery("#likeButtonSetBottom-yes").click(function(){this.checked&&jQuery(".likeButtonsAvailableBottom").fadeIn("fast")});
|
| 8 |
+
jQuery("#likeButtonSetBottom-no").click(function(){this.checked&&jQuery(".likeButtonsAvailableBottom").fadeOut("fast")});jQuery("#fbLikeButtonTop-yes").click(function(){this.checked&&jQuery(".likebuttonpreviewTop").fadeIn("fast")});jQuery("#fbLikeButtonBottom-yes").click(function(){this.checked&&jQuery(".likebuttonpreviewBottom").fadeIn("fast")});jQuery("#fbLikeButtonTop-no").click(function(){this.checked&&jQuery(".likebuttonpreviewTop").fadeOut("fast")});jQuery("#fbLikeButtonBottom-no").click(function(){this.checked&&
|
| 9 |
+
jQuery(".likebuttonpreviewBottom").fadeOut("fast")});jQuery("#fbSendButtonBottom-yes").click(function(){this.checked&&jQuery(".sendbuttonpreviewBottom").fadeIn("fast")});jQuery("#fbSendButtonTop-yes").click(function(){this.checked&&jQuery(".sendbuttonpreviewTop").fadeIn("fast")});jQuery("#fbSendButtonTop-no").click(function(){this.checked&&jQuery(".sendbuttonpreviewTop").fadeOut("fast")});jQuery("#fbSendButtonBottom-no").click(function(){this.checked&&jQuery(".sendbuttonpreviewBottom").fadeOut("fast")});
|
| 10 |
+
jQuery("#googlePlusOneButtonTop-yes").click(function(){this.checked&&jQuery(".plusonepreviewTop").fadeIn("fast")});jQuery("#googlePlusOneButtonTop-no").click(function(){this.checked&&jQuery(".plusonepreviewTop").fadeOut("fast")});jQuery("#googlePlusOneButtonBottom-yes").click(function(){this.checked&&jQuery(".plusonepreviewBottom").fadeIn("fast")});jQuery("#googlePlusOneButtonBottom-no").click(function(){this.checked&&jQuery(".plusonepreviewBottom").fadeOut("fast")});jQuery("#tweetButtonTop-yes").click(function(){this.checked&&
|
| 11 |
+
jQuery(".tweetbuttonpreviewTop").fadeIn("fast")});jQuery("#tweetButtonTop-no").click(function(){this.checked&&jQuery(".tweetbuttonpreviewTop").fadeOut("fast")});jQuery("#tweetButtonBottom-yes").click(function(){this.checked&&jQuery(".tweetbuttonpreviewBottom").fadeIn("fast")});jQuery("#tweetButtonBottom-no").click(function(){this.checked&&jQuery(".tweetbuttonpreviewBottom").fadeOut("fast")});jQuery("#fbLikeButtonTop-yes,#googlePlusOneButtonTop-yes,#fbSendButtonTop-yes,,#tweetButtonTop-yes").click(function(){this.checked&&
|
| 12 |
+
jQuery(".likeButtonSetOptionsTop").fadeIn("fast")});jQuery("#fbLikeButtonBottom-yes,#googlePlusOneButtonBottom-yes,#fbSendButtonBottom-yes,,#tweetButtonBottom-yes").click(function(){this.checked&&jQuery(".likeButtonSetOptionsBottom").fadeIn("fast")});jQuery("#fbLikeButtonTop-no,#googlePlusOneButtonTop-no,#fbSendButtonTop-no,#tweetButtonTop-no").click(function(){jQuery("#fbLikeButtonTop-no").get(0).checked&&jQuery("#googlePlusOneButtonTop-no").get(0).checked&&jQuery("#tweetButtonTop-no").get(0).checked&&
|
| 13 |
+
jQuery("#fbSendButtonTop-no").get(0).checked&&jQuery(".likeButtonSetOptionsTop").fadeOut("fast")});jQuery("#fbLikeButtonBottom-no,#googlePlusOneButtonBottom-no,#fbSendButtonBottom-no,#tweetButtonBottom-no").click(function(){jQuery("#fbLikeButtonBottom-no").get(0).checked&&jQuery("#googlePlusOneButtonBottom-no").get(0).checked&&jQuery("#tweetButtonBottom-no").get(0).checked&&jQuery("#fbSendButtonBottom-no").get(0).checked&&jQuery(".likeButtonSetOptionsBottom").fadeOut("fast")});jQuery("#designer_toolTips-yes").click(function(){this.checked&&
|
| 14 |
+
jQuery(".designer_toolTip_prefs").fadeIn("fast")});jQuery("#designer_toolTips-no").click(function(){this.checked&&jQuery(".designer_toolTip_prefs").fadeOut("fast")});jQuery("#pubGaSocial-yes").click(function(){this.checked&&jQuery(".pubGaSocial_prefs").fadeIn("fast")});jQuery("#pubGaSocial-no").click(function(){this.checked&&jQuery(".pubGaSocial_prefs").fadeOut("fast")});jQuery("#recommendations-yes").click(function(){this.checked&&(jQuery(".recommendations_prefs-1").fadeIn("fast"),jQuery("#recommendations-style-image").get(0).checked&&
|
| 15 |
+
jQuery(".recommendations_prefs-2").fadeIn("fast"))});jQuery("#recommendations-no").click(function(){this.checked&&(jQuery(".recommendations_prefs-1").fadeOut("fast"),jQuery(".recommendations_prefs-2").fadeOut("fast"))});jQuery("#recommendations-style-image").click(function(){this.checked&&jQuery(".recommendations_prefs-2").fadeIn("fast")});jQuery("#recommendations-style-text").click(function(){this.checked&&jQuery(".recommendations_prefs-2").fadeOut("fast")});jQuery("#cb-yes").click(function(){this.checked&&
|
| 16 |
+
jQuery(".cb_prefs").fadeIn("fast")});jQuery("#cb-no").click(function(){this.checked&&jQuery(".cb_prefs").fadeOut("fast")});jQuery("#useSbSettings-yes").click(function(){this.checked&&jQuery(".topbar_prefs").fadeOut("fast")});jQuery("#useSbSettings-no").click(function(){this.checked&&jQuery(".topbar_prefs").fadeIn("fast")});jQuery("#position-above").click(function(){jQuery("#info-manual").is(":visible")&&jQuery("#info-manual").fadeOut()});jQuery("#position-below").click(function(){jQuery("#info-manual").is(":visible")&&
|
| 17 |
+
jQuery("#info-manual").fadeOut()});jQuery("#position-manual").click(function(){jQuery("#info-manual").is(":not(:visible)")&&jQuery("#info-manual").fadeIn("slow")});jQuery(".dtags-info").click(function(){jQuery("#tag-info").fadeIn("fast")});jQuery(".dtags-close").click(function(){jQuery("#tag-info").fadeOut()});jQuery(".shebang-info").click(function(){jQuery("#info-manual").fadeIn("fast")});jQuery("#shrsbresetallwarn-cancel").click(function(){jQuery("#shrsbresetallwarn").fadeOut()});jQuery("#shrsbresetallwarn-yes").click(function(){this.checked=
|
| 18 |
+
jQuery("#shrsbresetallwarn").fadeOut();this.checked=jQuery("#resetalloptionsaccept").submit();this.checked=!this.checked});var c=0;"undefined"!=typeof jQuery("#tweetconfig")&&0<jQuery("#tweetconfig").length&&(-1!=jQuery("#tweetconfig").val().indexOf("${title}")&&(c=Math.floor(c+8)),-1!=jQuery("#tweetconfig").val().indexOf("${short_link}")&&(c=Math.floor(c+13)),c=Math.floor(jQuery("#tweetconfig").val().length-c),50<=c?jQuery("#tweetcounter span").addClass("error"):jQuery("#tweetcounter span").removeClass(),
|
| 19 |
+
jQuery("#tweetcounter span").html(c),c=jQuery("#tweetconfig").val(),c=c.replace("${title}","Some fancy post title"),c=c.replace("${short_link}","http://goo.gl/dbqlx"),jQuery("#tweetoutput span").html(c),jQuery("#tweetconfig").keyup(function(){var c=0;-1!=jQuery("#tweetconfig").val().indexOf("${title}")&&(c=Math.floor(c+8));-1!=jQuery("#tweetconfig").val().indexOf("${short_link}")&&(c=Math.floor(c+13));c=Math.floor(jQuery(this).val().length-c);if(50<=c)return jQuery("#tweetcounter span").addClass("error"),
|
| 20 |
+
alert("You need to leave room for the short URL and/or post title..."),!1;jQuery("#tweetcounter span").removeClass();jQuery("#tweetcounter span").html(c);c=jQuery(this).val();c=c.replace("${title}","Some fancy post title");c=c.replace("${short_link}","http://goo.gl/dbqlx");jQuery("#tweetoutput span").html(c)}));"undefined"!=typeof jQuery("#likeButtonSetTop-yes")&&0<jQuery("#likeButtonSetTop-yes").length&&(jQuery("#likeButtonSetTop-yes").get(0).checked&&jQuery(".likeButtonsAvailableTop").fadeIn("fast"),
|
| 21 |
+
(jQuery("#fbLikeButtonTop-yes").get(0).checked||jQuery("#googlePlusOneButtonTop-yes").get(0).checked||jQuery("#tweetButtonTop-yes").get(0).checked||jQuery("#fbSendButtonTop-yes").get(0).checked)&&jQuery(".likeButtonSetOptionsTop").fadeIn("fast"),jQuery("#fbLikeButtonTop-yes").get(0).checked&&jQuery(".likebuttonpreviewTop").fadeIn("fast"),jQuery("#fbSendButtonTop-yes").get(0).checked&&jQuery(".sendbuttonpreviewTop").fadeIn("fast"),jQuery("#googlePlusOneButtonTop-yes").get(0).checked&&jQuery(".plusonepreviewTop").fadeIn("fast"),
|
| 22 |
+
jQuery("#tweetButtonTop-yes").get(0).checked&&jQuery(".tweetbuttonpreviewTop").fadeIn("fast"));"undefined"!=typeof jQuery("#likeButtonSetBottom-yes")&&0<jQuery("#likeButtonSetBottom-yes").length&&(jQuery("#likeButtonSetBottom-yes").get(0).checked&&jQuery(".likeButtonsAvailableBottom").fadeIn("fast"),(jQuery("#fbLikeButtonBottom-yes").get(0).checked||jQuery("#googlePlusOneButtonBottom-yes").get(0).checked||jQuery("#tweetButtonBottom-yes").get(0).checked||jQuery("#fbSendButtonBottom-yes").get(0).checked)&&
|
| 23 |
+
jQuery(".likeButtonSetOptionsBottom").fadeIn("fast"),jQuery("#fbLikeButtonBottom-yes").get(0).checked&&jQuery(".likebuttonpreviewBottom").fadeIn("fast"),jQuery("#fbSendButtonBottom-yes").get(0).checked&&jQuery(".sendbuttonpreviewBottom").fadeIn("fast"),jQuery("#googlePlusOneButtonBottom-yes").get(0).checked&&jQuery(".plusonepreviewBottom").fadeIn("fast"),jQuery("#tweetButtonBottom-yes").get(0).checked&&jQuery(".tweetbuttonpreviewBottom").fadeIn("fast"));"undefined"!=typeof jQuery("#designer_toolTips-yes")&&
|
| 24 |
+
0<jQuery("#designer_toolTips-yes").length&&(jQuery("#designer_toolTips-yes").get(0).checked&&jQuery(".designer_toolTip_prefs").fadeIn("fast"),jQuery("#tip_bg_color_picker_holder").ColorPicker({flat:!0,color:jQuery("#tip_bg_color").val(),onChange:function(c,d){jQuery("#tip_bg_color").val("#"+d);jQuery("#tip_bg_color_picker div").css("backgroundColor","#"+d)},onSubmit:function(c,d){jQuery("#tip_bg_color").val("#"+d);jQuery("#tip_bg_color_picker div").css("backgroundColor","#"+d);jQuery("#tip_bg_color_picker_holder").toggle()}}),
|
| 25 |
+
jQuery("#tip_bg_color_picker_holder").find("input").each(function(){jQuery(this).attr("maxlength","50")}),jQuery("#tip_bg_color_picker div").bind("click",function(){jQuery("#tip_bg_color_picker_holder").toggle();jQuery("#tip_bg_color_picker_holder").ColorPickerSetColor(jQuery("#tip_bg_color").val());jQuery("body").trigger("click");jQuery("#tip_bg_color_picker_holder").is(":visible")&&jQuery("body").bind("click",function(){jQuery("#tip_bg_color_picker_holder").hide();jQuery("body").unbind("click")});
|
| 26 |
+
return false}),jQuery("#tip_bg_color_reset").bind("click",function(){jQuery("#tip_bg_color").val("#000000");jQuery("#tip_bg_color_picker div").css("backgroundColor","#000000")}),jQuery("#tip_bg_color_picker_holder").click(function(){return false}),jQuery("#tip_text_color_picker_holder").ColorPicker({flat:!0,color:jQuery("#tip_text_color").val(),onChange:function(c,d){jQuery("#tip_text_color").val("#"+d);jQuery("#tip_text_color_picker div").css("backgroundColor","#"+d)},onSubmit:function(c,d){jQuery("#tip_text_color").val("#"+
|
| 27 |
+
d);jQuery("#tip_text_color_picker div").css("backgroundColor","#"+d);jQuery("#tip_text_color_picker_holder").toggle()}}),jQuery("#tip_text_color_picker_holder").find("input").each(function(){jQuery(this).attr("maxlength","50")}),jQuery("#tip_text_color_picker div").bind("click",function(){jQuery("#tip_text_color_picker_holder").toggle();jQuery("#tip_text_color_picker_holder").ColorPickerSetColor(jQuery("#tip_text_color").val());jQuery("body").trigger("click");jQuery("#tip_text_color_picker_holder").is(":visible")&&
|
| 28 |
+
jQuery("body").bind("click",function(){jQuery("#tip_text_color_picker_holder").hide();jQuery("body").unbind("click")});return false}),jQuery("#tip_text_color_picker_holder").click(function(){return false}),jQuery("#tip_text_color_reset").bind("click",function(){jQuery("#tip_text_color").val("#ffffff");jQuery("#tip_text_color_picker div").css("backgroundColor","#ffffff")}));"undefined"!=typeof jQuery("#pubGaSocial-yes")&&0<jQuery("#pubGaSocial-yes").length&&(c=jQuery("#pubGaSocial-yes").get(0).checked)&&
|
| 29 |
+
jQuery(".pubGaSocial_prefs").fadeIn("fast");if("undefined"!=typeof jQuery("#recommendations-yes")&&0<jQuery("#recommendations-yes").length&&(c=jQuery("#recommendations-yes").get(0).checked))jQuery(".recommendations_prefs-1").fadeIn("fast"),jQuery("#recommendations-style-image").get(0).checked&&jQuery(".recommendations_prefs-2").fadeIn("fast");"undefined"!=typeof jQuery("#cb-yes")&&0<jQuery("#cb-yes").length&&(c=jQuery("#cb-yes").get(0).checked)&&jQuery(".cb_prefs").fadeIn("fast");"undefined"!=typeof jQuery("#useSbSettings-no")&&
|
| 30 |
+
0<jQuery("#useSbSettings-no").length&&(jQuery("#useSbSettings-no").get(0).checked&&jQuery(".topbar_prefs").fadeIn("fast"),jQuery("#tb_bg_color_picker_holder").ColorPicker({flat:!0,color:jQuery("#tb_bg_color").val(),onChange:function(c,d){jQuery("#tb_bg_color").val("#"+d);jQuery("#tb_bg_color_picker div").css("backgroundColor","#"+d)},onSubmit:function(c,d){jQuery("#tb_bg_color").val("#"+d);jQuery("#tb_bg_color_picker div").css("backgroundColor","#"+d);jQuery("#tb_bg_color_picker_holder").toggle()}}),
|
| 31 |
+
jQuery("#tb_bg_color_picker_holder").find("input").each(function(){jQuery(this).attr("maxlength","50")}),jQuery("#tb_bg_color_picker div").bind("click",function(){jQuery("#tb_bg_color_picker_holder").toggle();jQuery("#tb_bg_color_picker_holder").ColorPickerSetColor(jQuery("#tb_bg_color").val());jQuery("body").trigger("click");jQuery("#tb_bg_color_picker_holder").is(":visible")&&jQuery("body").bind("click",function(){jQuery("#tb_bg_color_picker_holder").hide();jQuery("body").unbind("click")});return false}),
|
| 32 |
+
jQuery("#tb_bg_color_reset").bind("click",function(){jQuery("#tb_bg_color").val("#000000");jQuery("#tb_bg_color_picker div").css("backgroundColor","#000000")}),jQuery("#tb_bg_color_picker_holder").click(function(){return false}),jQuery("#tb_border_color_picker_holder").ColorPicker({flat:!0,color:jQuery("#tb_border_color").val(),onChange:function(c,d){jQuery("#tb_border_color").val("#"+d);jQuery("#tb_border_color_picker div").css("backgroundColor","#"+d)},onSubmit:function(c,d){jQuery("#tb_border_color").val("#"+
|
| 33 |
+
d);jQuery("#tb_border_color_picker div").css("backgroundColor","#"+d);jQuery("#tb_border_color_picker_holder").toggle()}}),jQuery("#tb_border_color_picker_holder").find("input").each(function(){jQuery(this).attr("maxlength","50")}),jQuery("#tb_border_color_picker div").bind("click",function(){jQuery("#tb_border_color_picker_holder").toggle();jQuery("#tb_border_color_picker_holder").ColorPickerSetColor(jQuery("#tb_border_color").val());jQuery("body").trigger("click");jQuery("#tb_border_color_picker_holder").is(":visible")&&
|
| 34 |
+
jQuery("body").bind("click",function(){jQuery("#tb_border_color_picker_holder").hide();jQuery("body").unbind("click")});return false}),jQuery("#tb_border_color_reset").bind("click",function(){jQuery("#tb_border_color").val("#000000");jQuery("#tb_border_color_picker div").css("backgroundColor","#000000")}),jQuery("#tb_border_color_picker_holder").click(function(){return false}))}});
|
| 35 |
+
(function(c){var i=function(){var d=65,i={eventName:"click",onShow:function(){},onBeforeShow:function(){},onHide:function(){},onChange:function(){},onSubmit:function(){},color:"ff0000",livePreview:!0,flat:!1},j=function(a,b){var f=e(a);c(b).data("colorpicker").fields.eq(1).val(f.r).end().eq(2).val(f.g).end().eq(3).val(f.b).end()},o=function(a,b){c(b).data("colorpicker").fields.eq(4).val(a.h).end().eq(5).val(a.s).end().eq(6).val(a.b).end()},l=function(a,b){c(b).data("colorpicker").fields.eq(0).val(k(e(a))).end()},
|
| 36 |
+
p=function(a,b){c(b).data("colorpicker").selector.css("backgroundColor","#"+k(e({h:a.h,s:100,b:100})));c(b).data("colorpicker").selectorIndic.css({left:parseInt(150*a.s/100,10),top:parseInt(150*(100-a.b)/100,10)})},q=function(a,b){c(b).data("colorpicker").hue.css("top",parseInt(150-150*a.h/360,10))},s=function(a,b){c(b).data("colorpicker").currentColor.css("backgroundColor","#"+k(e(a)))},r=function(a,b){c(b).data("colorpicker").newColor.css("backgroundColor","#"+k(e(a)))},E=function(a){a=a.charCode||
|
| 37 |
+
a.keyCode||-1;if(a>d&&90>=a||32==a)return!1;!0===c(this).parent().parent().data("colorpicker").livePreview&&m.apply(this)},m=function(a){var b=c(this).parent().parent(),f;if(0<this.parentNode.className.indexOf("_hex")){f=b.data("colorpicker");var g=this.value,d=6-g.length;if(0<d){for(var h=[],v=0;v<d;v++)h.push("0");h.push(g);g=h.join("")}g=n(t(g));f.color=f=g}else 0<this.parentNode.className.indexOf("_hsb")?b.data("colorpicker").color=f=u({h:parseInt(b.data("colorpicker").fields.eq(4).val(),10),
|
| 38 |
+
s:parseInt(b.data("colorpicker").fields.eq(5).val(),10),b:parseInt(b.data("colorpicker").fields.eq(6).val(),10)}):(f=b.data("colorpicker"),g=parseInt(b.data("colorpicker").fields.eq(1).val(),10),d=parseInt(b.data("colorpicker").fields.eq(2).val(),10),h=parseInt(b.data("colorpicker").fields.eq(3).val(),10),g={r:Math.min(255,Math.max(0,g)),g:Math.min(255,Math.max(0,d)),b:Math.min(255,Math.max(0,h))},f.color=f=n(g));a&&(j(f,b.get(0)),l(f,b.get(0)),o(f,b.get(0)));p(f,b.get(0));q(f,b.get(0));r(f,b.get(0));
|
| 39 |
+
b.data("colorpicker").onChange.apply(b,[f,k(e(f)),e(f)])},F=function(){c(this).parent().parent().data("colorpicker").fields.parent().removeClass("colorpicker_focus")},G=function(){d=0<this.parentNode.className.indexOf("_hex")?70:65;c(this).parent().parent().data("colorpicker").fields.parent().removeClass("colorpicker_focus");c(this).parent().addClass("colorpicker_focus")},H=function(a){var b=c(this).parent().find("input").focus(),a={el:c(this).parent().addClass("colorpicker_slider"),max:0<this.parentNode.className.indexOf("_hsb_h")?
|
| 40 |
+
360:0<this.parentNode.className.indexOf("_hsb")?100:255,y:a.pageY,field:b,val:parseInt(b.val(),10),preview:c(this).parent().parent().data("colorpicker").livePreview};c(document).bind("mouseup",a,w);c(document).bind("mousemove",a,x)},x=function(a){a.data.field.val(Math.max(0,Math.min(a.data.max,parseInt(a.data.val+a.pageY-a.data.y,10))));a.data.preview&&m.apply(a.data.field.get(0),[!0]);return!1},w=function(a){m.apply(a.data.field.get(0),[!0]);a.data.el.removeClass("colorpicker_slider").find("input").focus();
|
| 41 |
+
c(document).unbind("mouseup",w);c(document).unbind("mousemove",x);return!1},I=function(){var a={cal:c(this).parent(),y:c(this).offset().top};a.preview=a.cal.data("colorpicker").livePreview;c(document).bind("mouseup",a,y);c(document).bind("mousemove",a,z)},z=function(a){m.apply(a.data.cal.data("colorpicker").fields.eq(4).val(parseInt(360*(150-Math.max(0,Math.min(150,a.pageY-a.data.y)))/150,10)).get(0),[a.data.preview]);return!1},y=function(a){j(a.data.cal.data("colorpicker").color,a.data.cal.get(0));
|
| 42 |
+
l(a.data.cal.data("colorpicker").color,a.data.cal.get(0));c(document).unbind("mouseup",y);c(document).unbind("mousemove",z);return!1},J=function(){var a={cal:c(this).parent(),pos:c(this).offset()};a.preview=a.cal.data("colorpicker").livePreview;c(document).bind("mouseup",a,A);c(document).bind("mousemove",a,B)},B=function(a){m.apply(a.data.cal.data("colorpicker").fields.eq(6).val(parseInt(100*(150-Math.max(0,Math.min(150,a.pageY-a.data.pos.top)))/150,10)).end().eq(5).val(parseInt(100*Math.max(0,Math.min(150,
|
| 43 |
+
a.pageX-a.data.pos.left))/150,10)).get(0),[a.data.preview]);return!1},A=function(a){j(a.data.cal.data("colorpicker").color,a.data.cal.get(0));l(a.data.cal.data("colorpicker").color,a.data.cal.get(0));c(document).unbind("mouseup",A);c(document).unbind("mousemove",B);return!1},K=function(){c(this).addClass("colorpicker_focus")},L=function(){c(this).removeClass("colorpicker_focus")},M=function(){var a=c(this).parent(),b=a.data("colorpicker").color;a.data("colorpicker").origColor=b;s(b,a.get(0));a.data("colorpicker").onSubmit(b,
|
| 44 |
+
k(e(b)),e(b),a.data("colorpicker").el)},D=function(){var a,b,f,g=c("#"+c(this).data("colorpickerId"));g.data("colorpicker").onBeforeShow.apply(this,[g.get(0)]);var d=c(this).offset(),h="CSS1Compat"==document.compatMode;a=window.pageXOffset||(h?document.documentElement.scrollLeft:document.body.scrollLeft);b=window.pageYOffset||(h?document.documentElement.scrollTop:document.body.scrollTop);f=window.innerWidth||(h?document.documentElement.clientWidth:document.body.clientWidth);var e=d.top+this.offsetHeight,
|
| 45 |
+
d=d.left;e+176>b+(window.innerHeight||(h?document.documentElement.clientHeight:document.body.clientHeight))&&(e-=this.offsetHeight+176);d+356>a+f&&(d-=356);g.css({left:d+"px",top:e+"px"});!1!=g.data("colorpicker").onShow.apply(this,[g.get(0)])&&g.show();c(document).bind("mousedown",{cal:g},C);return!1},C=function(a){N(a.data.cal.get(0),a.target,a.data.cal.get(0))||(!1!=a.data.cal.data("colorpicker").onHide.apply(this,[a.data.cal.get(0)])&&a.data.cal.hide(),c(document).unbind("mousedown",C))},N=function(a,
|
| 46 |
+
b,c){if(a==b)return!0;if(a.contains)return a.contains(b);if(a.compareDocumentPosition)return!!(a.compareDocumentPosition(b)&16);for(b=b.parentNode;b&&b!=c;){if(b==a)return!0;b=b.parentNode}return!1},u=function(a){return{h:Math.min(360,Math.max(0,a.h)),s:Math.min(100,Math.max(0,a.s)),b:Math.min(100,Math.max(0,a.b))}},t=function(a){a=parseInt(-1<a.indexOf("#")?a.substring(1):a,16);return{r:a>>16,g:(a&65280)>>8,b:a&255}},n=function(a){var b={h:0,s:0,b:0},c=Math.min(a.r,a.g,a.b),d=Math.max(a.r,a.g,a.b),
|
| 47 |
+
c=d-c;b.b=d;b.s=0!=d?255*c/d:0;b.h=0!=b.s?a.r==d?(a.g-a.b)/c:a.g==d?2+(a.b-a.r)/c:4+(a.r-a.g)/c:-1;b.h*=60;0>b.h&&(b.h+=360);b.s*=100/255;b.b*=100/255;return b},e=function(a){var b,c,d;b=Math.round(a.h);var e=Math.round(255*a.s/100),a=Math.round(255*a.b/100);if(0==e)b=c=d=a;else{var e=(255-e)*a/255,h=(a-e)*(b%60)/60;360==b&&(b=0);60>b?(b=a,d=e,c=e+h):120>b?(c=a,d=e,b=a-h):180>b?(c=a,b=e,d=e+h):240>b?(d=a,b=e,c=a-h):300>b?(d=a,c=e,b=e+h):360>b?(b=a,c=e,d=a-h):d=c=b=0}return{r:Math.round(b),g:Math.round(c),
|
| 48 |
+
b:Math.round(d)}},k=function(a){var b=[a.r.toString(16),a.g.toString(16),a.b.toString(16)];c.each(b,function(a,c){1==c.length&&(b[a]="0"+c)});return b.join("")},O=function(){var a=c(this).parent(),b=a.data("colorpicker").origColor;a.data("colorpicker").color=b;j(b,a.get(0));l(b,a.get(0));o(b,a.get(0));p(b,a.get(0));q(b,a.get(0));r(b,a.get(0))};return{init:function(a){a=c.extend({},i,a||{});if("string"==typeof a.color)a.color=n(t(a.color));else if(void 0!=a.color.r&&void 0!=a.color.g&&void 0!=a.color.b)a.color=
|
| 49 |
+
n(a.color);else if(void 0!=a.color.h&&void 0!=a.color.s&&void 0!=a.color.b)a.color=u(a.color);else return this;return this.each(function(){if(!c(this).data("colorpickerId")){var b=c.extend({},a);b.origColor=a.color;var d="collorpicker_"+parseInt(1E3*Math.random());c(this).data("colorpickerId",d);d=c('<div class="colorpicker"><div class="colorpicker_color"><div><div></div></div></div><div class="colorpicker_hue"><div></div></div><div class="colorpicker_new_color"></div><div class="colorpicker_current_color"></div><div class="colorpicker_hex"><input type="text" maxlength="6" size="6" /></div><div class="colorpicker_rgb_r colorpicker_field"><input type="text" maxlength="3" size="3" /><span></span></div><div class="colorpicker_rgb_g colorpicker_field"><input type="text" maxlength="3" size="3" /><span></span></div><div class="colorpicker_rgb_b colorpicker_field"><input type="text" maxlength="3" size="3" /><span></span></div><div class="colorpicker_hsb_h colorpicker_field"><input type="text" maxlength="3" size="3" /><span></span></div><div class="colorpicker_hsb_s colorpicker_field"><input type="text" maxlength="3" size="3" /><span></span></div><div class="colorpicker_hsb_b colorpicker_field"><input type="text" maxlength="3" size="3" /><span></span></div><div class="colorpicker_submit"></div></div>').attr("id",
|
| 50 |
+
d);b.flat?d.appendTo(this).show():d.appendTo(document.body);b.fields=d.find("input").bind("keyup",E).bind("change",m).bind("blur",F).bind("focus",G);d.find("span").bind("mousedown",H).end().find(">div.colorpicker_current_color").bind("click",O);b.selector=d.find("div.colorpicker_color").bind("mousedown",J);b.selectorIndic=b.selector.find("div div");b.el=this;b.hue=d.find("div.colorpicker_hue div");d.find("div.colorpicker_hue").bind("mousedown",I);b.newColor=d.find("div.colorpicker_new_color");b.currentColor=
|
| 51 |
+
d.find("div.colorpicker_current_color");d.data("colorpicker",b);d.find("div.colorpicker_submit").bind("mouseenter",K).bind("mouseleave",L).bind("click",M);j(b.color,d.get(0));o(b.color,d.get(0));l(b.color,d.get(0));q(b.color,d.get(0));p(b.color,d.get(0));s(b.color,d.get(0));r(b.color,d.get(0));b.flat?d.css({position:"relative",display:"block"}):c(this).bind(b.eventName,D)}})},showPicker:function(){return this.each(function(){c(this).data("colorpickerId")&&D.apply(this)})},hidePicker:function(){return this.each(function(){c(this).data("colorpickerId")&&
|
| 52 |
+
c("#"+c(this).data("colorpickerId")).hide()})},setColor:function(a){if("string"==typeof a)a=n(t(a));else if(void 0!=a.r&&void 0!=a.g&&void 0!=a.b)a=n(a);else if(void 0!=a.h&&void 0!=a.s&&void 0!=a.b)a=u(a);else return this;return this.each(function(){if(c(this).data("colorpickerId")){var b=c("#"+c(this).data("colorpickerId"));b.data("colorpicker").color=a;b.data("colorpicker").origColor=a;j(a,b.get(0));o(a,b.get(0));l(a,b.get(0));q(a,b.get(0));p(a,b.get(0));s(a,b.get(0));r(a,b.get(0))}})}}}();c.fn.extend({ColorPicker:i.init,
|
| 53 |
+
ColorPickerHide:i.hidePicker,ColorPickerShow:i.showPicker,ColorPickerSetColor:i.setColor})})(jQuery);
|
js/shareaholic-perf.js
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
| 1 |
+
var _gaq=_gaq||[];_gaq.push(["_setAccount","UA-12964573-7"]);_gaq.push(["_trackPageview"]);(function(){var a=document.createElement("script");a.type="text/javascript";a.async=!0;a.src=("https:"==document.location.protocol?"https://ssl":"http://www")+".google-analytics.com/ga.js";var b=document.getElementsByTagName("script")[0];b.parentNode.insertBefore(a,b)})();
|
js/shareaholic-perf.min.js
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
| 1 |
+
var _gaq=_gaq||[];_gaq.push(["_setAccount","UA-12964573-7"]);_gaq.push(["_trackPageview"]);(function(){var a=document.createElement("script");a.type="text/javascript";a.async=!0;a.src=("https:"==document.location.protocol?"https://ssl":"http://www")+".google-analytics.com/ga.js";var b=document.getElementsByTagName("script")[0];b.parentNode.insertBefore(a,b)})();
|
js/shareaholic-promo.js
ADDED
|
@@ -0,0 +1,63 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
var shr_cdn_root = "https://dtym7iokkjlif.cloudfront.net";
|
| 2 |
+
|
| 3 |
+
function getBrowser() {
|
| 4 |
+
var sUA = navigator.userAgent;
|
| 5 |
+
var sName = "";
|
| 6 |
+
if(sUA.indexOf("MSIE") != -1 ) {
|
| 7 |
+
sName = "Internet Explorer";
|
| 8 |
+
} else if(sUA.indexOf("Firefox") != -1 ) {
|
| 9 |
+
sName = "Firefox";
|
| 10 |
+
} else if(sUA.indexOf("Flock") != -1 ) {
|
| 11 |
+
sName = "Flock";
|
| 12 |
+
} else if(sUA.indexOf("Chrome") != -1 ) {
|
| 13 |
+
sName = "Google Chrome";
|
| 14 |
+
} else if(sUA.indexOf("Safari") != -1 ) {
|
| 15 |
+
sName = "Safari";
|
| 16 |
+
} else if(sUA.indexOf("Opera") != -1 ) {
|
| 17 |
+
sName = "Opera";
|
| 18 |
+
} else if(sUA.indexOf("Songbird") != -1 ) {
|
| 19 |
+
sName = "Songbird";
|
| 20 |
+
}
|
| 21 |
+
return sName;
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
jQuery(window).load(function() {
|
| 25 |
+
jQuery.cookie=function(d,c,a){if(typeof c!="undefined"){a=a||{};if(c===null)c="",a.expires=-1;var b="";if(a.expires&&(typeof a.expires=="number"||a.expires.toUTCString))typeof a.expires=="number"?(b=new Date,b.setTime(b.getTime()+a.expires*864E5)):b=a.expires,b="; expires="+b.toUTCString();var e=a.path?"; path="+a.path:"",f=a.domain?"; domain="+a.domain:"",a=a.secure?"; secure":"";document.cookie=[d,"=",encodeURIComponent(c),b,e,f,a].join("")}else{c=null;if(document.cookie&&document.cookie!=""){a=
|
| 26 |
+
document.cookie.split(";");for(b=0;b<a.length;b++)if(e=jQuery.trim(a[b]),e.substring(0,d.length+1)==d+"="){c=decodeURIComponent(e.substring(d.length+1));break}}return c}};
|
| 27 |
+
|
| 28 |
+
var code = "";
|
| 29 |
+
var ua = getBrowser();
|
| 30 |
+
|
| 31 |
+
switch(ua){
|
| 32 |
+
case "Firefox":
|
| 33 |
+
code = '<div id="ext-promo-prompt" class="fs_a fs_c_midgrey2"><img src="' + shr_cdn_root + '/media/images/firefox_32x32.png" height=24 width=24 align="absmiddle" style="margin: -4px 8px 0 8px;" />Get the <a href="https://addons.mozilla.org/en-US/firefox/addon/5457/" target="_new">shareaholic firefox extension</a> - It is the best way to <a href="https://addons.mozilla.org/en-US/firefox/addon/5457/" target="_new">share your content, discover, and connect with the Best of the Web</a>! <a class="close" href="javascript:ext_promo_noThanks();">x</a> <a class="install rounded_5" href="https://addons.mozilla.org/en-US/firefox/addon/5457/" target="_new">Install</a></div>';
|
| 34 |
+
break;
|
| 35 |
+
case "Google Chrome":
|
| 36 |
+
code = '<div id="ext-promo-prompt" class="fs_a fs_c_midgrey2"><img src="' + shr_cdn_root + '/media/images/chrome_32x32.png" height=24 width=24 align="absmiddle" style="margin: -4px 8px 0 8px;" />Get the <a href="https://chrome.google.com/webstore/detail/kbmipnjdeifmobkhgogdnomkihhgojep" target="_new">shareaholic chrome extension</a> - It is the best way to <a href="https://chrome.google.com/webstore/detail/kbmipnjdeifmobkhgogdnomkihhgojep" target="_new">share your content, discover, and connect with the Best of the Web</a>! <a class="close" href="javascript:ext_promo_noThanks();">x</a> <a class="install rounded_5" href="https://chrome.google.com/webstore/detail/kbmipnjdeifmobkhgogdnomkihhgojep" target="_new">Install</a></div>';
|
| 37 |
+
break;
|
| 38 |
+
default:
|
| 39 |
+
}
|
| 40 |
+
|
| 41 |
+
setTimeout(function() {
|
| 42 |
+
if(jQuery('.extLives').length == 0) {
|
| 43 |
+
var extpromoPrompt = jQuery.cookie("no_cp");
|
| 44 |
+
var inFrame = (window != window.top)
|
| 45 |
+
if((extpromoPrompt != 1) && !inFrame) {
|
| 46 |
+
jQuery("body").prepend(code);
|
| 47 |
+
// Margin out the admin bar by its exact height if the admin bar is present.
|
| 48 |
+
if(jQuery('#wpadminbar').length != 0) {
|
| 49 |
+
jQuery("#ext-promo-prompt").css("margin-top", jQuery("#wpadminbar").css("height"));
|
| 50 |
+
|
| 51 |
+
// Also, remove the dead whitespace.
|
| 52 |
+
jQuery("#ext-promo-prompt").css("margin-bottom", "-" + jQuery("#ext-promo-prompt").css("height"));
|
| 53 |
+
}
|
| 54 |
+
jQuery('div#ext-promo-prompt').show();
|
| 55 |
+
}
|
| 56 |
+
}
|
| 57 |
+
}, 500);
|
| 58 |
+
});
|
| 59 |
+
|
| 60 |
+
function ext_promo_noThanks() {
|
| 61 |
+
jQuery.cookie('no_cp', '1', { expires: 60, path: '/' });
|
| 62 |
+
jQuery('div#ext-promo-prompt').hide();
|
| 63 |
+
}
|
js/shareaholic-promo.min.js
ADDED
|
@@ -0,0 +1,5 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
var shr_cdn_root="https://dtym7iokkjlif.cloudfront.net";function getBrowser(){var a=navigator.userAgent,c="";-1!=a.indexOf("MSIE")?c="Internet Explorer":-1!=a.indexOf("Firefox")?c="Firefox":-1!=a.indexOf("Flock")?c="Flock":-1!=a.indexOf("Chrome")?c="Google Chrome":-1!=a.indexOf("Safari")?c="Safari":-1!=a.indexOf("Opera")?c="Opera":-1!=a.indexOf("Songbird")&&(c="Songbird");return c}
|
| 2 |
+
jQuery(window).load(function(){jQuery.cookie=function(c,a,b){if("undefined"!=typeof a){b=b||{};null===a&&(a="",b.expires=-1);var d="";if(b.expires&&("number"==typeof b.expires||b.expires.toUTCString))"number"==typeof b.expires?(d=new Date,d.setTime(d.getTime()+864E5*b.expires)):d=b.expires,d="; expires="+d.toUTCString();var e=b.path?"; path="+b.path:"",g=b.domain?"; domain="+b.domain:"",b=b.secure?"; secure":"";document.cookie=[c,"=",encodeURIComponent(a),d,e,g,b].join("")}else{a=null;if(document.cookie&&
|
| 3 |
+
""!=document.cookie){b=document.cookie.split(";");for(d=0;d<b.length;d++)if(e=jQuery.trim(b[d]),e.substring(0,c.length+1)==c+"="){a=decodeURIComponent(e.substring(c.length+1));break}}return a}};var a="";switch(getBrowser()){case "Firefox":a='<div id="ext-promo-prompt" class="fs_a fs_c_midgrey2"><img src="'+shr_cdn_root+'/media/images/firefox_32x32.png" height=24 width=24 align="absmiddle" style="margin: -4px 8px 0 8px;" />Get the <a href="https://addons.mozilla.org/en-US/firefox/addon/5457/" target="_new">shareaholic firefox extension</a> - It is the best way to <a href="https://addons.mozilla.org/en-US/firefox/addon/5457/" target="_new">share your content, discover, and connect with the Best of the Web</a>! <a class="close" href="javascript:ext_promo_noThanks();">x</a> <a class="install rounded_5" href="https://addons.mozilla.org/en-US/firefox/addon/5457/" target="_new">Install</a></div>';
|
| 4 |
+
break;case "Google Chrome":a='<div id="ext-promo-prompt" class="fs_a fs_c_midgrey2"><img src="'+shr_cdn_root+'/media/images/chrome_32x32.png" height=24 width=24 align="absmiddle" style="margin: -4px 8px 0 8px;" />Get the <a href="https://chrome.google.com/webstore/detail/kbmipnjdeifmobkhgogdnomkihhgojep" target="_new">shareaholic chrome extension</a> - It is the best way to <a href="https://chrome.google.com/webstore/detail/kbmipnjdeifmobkhgogdnomkihhgojep" target="_new">share your content, discover, and connect with the Best of the Web</a>! <a class="close" href="javascript:ext_promo_noThanks();">x</a> <a class="install rounded_5" href="https://chrome.google.com/webstore/detail/kbmipnjdeifmobkhgogdnomkihhgojep" target="_new">Install</a></div>'}setTimeout(function(){if(0==
|
| 5 |
+
jQuery(".extLives").length){var c=jQuery.cookie("no_cp"),f=window!=window.top;1!=c&&!f&&(jQuery("body").prepend(a),0!=jQuery("#wpadminbar").length&&(jQuery("#ext-promo-prompt").css("margin-top",jQuery("#wpadminbar").css("height")),jQuery("#ext-promo-prompt").css("margin-bottom","-"+jQuery("#ext-promo-prompt").css("height"))),jQuery("div#ext-promo-prompt").show())}},500)});function ext_promo_noThanks(){jQuery.cookie("no_cp","1",{expires:60,path:"/"});jQuery("div#ext-promo-prompt").hide()};
|
languages/shrsb pl_PL.mo
ADDED
|
Binary file
|
languages/shrsb pl_PL.po
ADDED
|
@@ -0,0 +1,791 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# Copyright (C) 2010
|
| 2 |
+
# This file is distributed under the same license as the package.
|
| 3 |
+
msgid ""
|
| 4 |
+
msgstr ""
|
| 5 |
+
"Project-Id-Version: Shareaholic Polish Translation\n"
|
| 6 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/sexybookmarks\n"
|
| 7 |
+
"POT-Creation-Date: 2011-01-23 21:26:57+00:00\n"
|
| 8 |
+
"MIME-Version: 1.0\n"
|
| 9 |
+
"Content-Type: text/plain; charset=utf-8\n"
|
| 10 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 11 |
+
"PO-Revision-Date: 2012-01-10 04:08+0100\n"
|
| 12 |
+
"Last-Translator: \n"
|
| 13 |
+
"Language-Team: Bartosz Chojnacki <b.chojnacki@gmail.com>\n"
|
| 14 |
+
"X-Poedit-Language: Polish\n"
|
| 15 |
+
"X-Poedit-Country: POLAND\n"
|
| 16 |
+
|
| 17 |
+
#: sexy-bookmarks.php:138
|
| 18 |
+
msgid "NOTICE: Shareaholic was updated... Please visit the %sPlugin Options Page%s and re-save your preferences."
|
| 19 |
+
msgstr "UWAGA! Shareaholic został zaktualizowany. Przejdź do %ustawień wtyczki%s i zapisz ponownie swoje ustawienia."
|
| 20 |
+
|
| 21 |
+
#: sexy-bookmarks.php:176
|
| 22 |
+
msgid "NOTICE: Shareaholic needs to be configured... Please visit the %sPlugin Options Page%s and set your preferences."
|
| 23 |
+
msgstr "UWAGA! Skonfiguruj Shareaholic. Przejdź do %ustawień wtyczki%s i wybierz swoje preferencje."
|
| 24 |
+
|
| 25 |
+
#: sexy-bookmarks.php:228
|
| 26 |
+
msgid "WARNING: You are about to reset all settings to their default state! Do you wish to continue?"
|
| 27 |
+
msgstr "OSTRZEŻENIE: Masz zamiar przywrócić ustawienia domyślne. Kontynuować?"
|
| 28 |
+
|
| 29 |
+
#: sexy-bookmarks.php:232
|
| 30 |
+
#: sexy-bookmarks.php:480
|
| 31 |
+
#: sexy-bookmarks.php:542
|
| 32 |
+
#: sexy-bookmarks.php:633
|
| 33 |
+
#: sexy-bookmarks.php:637
|
| 34 |
+
#: sexy-bookmarks.php:641
|
| 35 |
+
#: sexy-bookmarks.php:646
|
| 36 |
+
#: sexy-bookmarks.php:707
|
| 37 |
+
#: sexy-bookmarks.php:788
|
| 38 |
+
msgid "Yes"
|
| 39 |
+
msgstr "Tak"
|
| 40 |
+
|
| 41 |
+
#: sexy-bookmarks.php:232
|
| 42 |
+
#: sexy-bookmarks.php:542
|
| 43 |
+
msgid "Cancel"
|
| 44 |
+
msgstr "Anuluj"
|
| 45 |
+
|
| 46 |
+
#: sexy-bookmarks.php:273
|
| 47 |
+
msgid "All settings have been reset to their default values."
|
| 48 |
+
msgstr "Przywrócono ustawienia fabryczne."
|
| 49 |
+
|
| 50 |
+
#: sexy-bookmarks.php:317
|
| 51 |
+
msgid "Your changes have been saved successfully!"
|
| 52 |
+
msgstr "Zmiany zostały zapisane pomyślnie."
|
| 53 |
+
|
| 54 |
+
#: sexy-bookmarks.php:320
|
| 55 |
+
msgid "Please choose where you would like the menu to be displayed."
|
| 56 |
+
msgstr "Wybierz pozycję, w której ma się wyświetlać menu."
|
| 57 |
+
|
| 58 |
+
#: sexy-bookmarks.php:321
|
| 59 |
+
msgid "You can't display the menu if you don't choose a few sites to add to it!"
|
| 60 |
+
msgstr "Nie można wyświetlić menu bez wcześniejszego dodania serwisów internetowych."
|
| 61 |
+
|
| 62 |
+
#: sexy-bookmarks.php:322
|
| 63 |
+
msgid "Please choose where you want the menu displayed."
|
| 64 |
+
msgstr "Wybierz pozycję menu."
|
| 65 |
+
|
| 66 |
+
#: sexy-bookmarks.php:332
|
| 67 |
+
msgid "You must first download and activate the %sTwitter Friendly Links Plugin%s before hosting your own short URLs..."
|
| 68 |
+
msgstr "Musisz najpierw ściągnąć i aktywować plugin %sTwitter Friendly Links Plugin%s."
|
| 69 |
+
|
| 70 |
+
#: sexy-bookmarks.php:334
|
| 71 |
+
msgid "You must first download and activate the %sYOURLS Plugin%s before hosting your own short URLs..."
|
| 72 |
+
msgstr "Musisz najpierw ściągnąć i aktywować plugin %sYOURLS Plugin%s."
|
| 73 |
+
|
| 74 |
+
#: sexy-bookmarks.php:351
|
| 75 |
+
msgid "WARNING: The request for a custom sprite has timed out. Reverting to default sprite files."
|
| 76 |
+
msgstr ""
|
| 77 |
+
|
| 78 |
+
#: sexy-bookmarks.php:353
|
| 79 |
+
msgid "Changes saved successfully. However, you should try to generate a custom sprite again later."
|
| 80 |
+
msgstr ""
|
| 81 |
+
|
| 82 |
+
#: sexy-bookmarks.php:357
|
| 83 |
+
#: sexy-bookmarks.php:379
|
| 84 |
+
msgid "WARNING: Your %sspritegen folder%s is not writeable by the server! %sNeed Help?%s"
|
| 85 |
+
msgstr ""
|
| 86 |
+
|
| 87 |
+
#: sexy-bookmarks.php:359
|
| 88 |
+
#: sexy-bookmarks.php:364
|
| 89 |
+
#: sexy-bookmarks.php:369
|
| 90 |
+
#: sexy-bookmarks.php:380
|
| 91 |
+
#: sexy-bookmarks.php:384
|
| 92 |
+
#: sexy-bookmarks.php:388
|
| 93 |
+
msgid "Changes saved successfully. However, settings are not optimal until you resolve the issue listed above."
|
| 94 |
+
msgstr "Zmiany zapisano pomyślnie. Zwróć jednak uwagę, iż ustawienia nie będą optymalne dopóki nie rozwiążesz problemów wymienionych powyżej."
|
| 95 |
+
|
| 96 |
+
#: sexy-bookmarks.php:362
|
| 97 |
+
#: sexy-bookmarks.php:383
|
| 98 |
+
msgid "WARNING: You need to delete the current custom sprite %s before the plugin can write to the folder. %sNeed Help?%s"
|
| 99 |
+
msgstr ""
|
| 100 |
+
|
| 101 |
+
#: sexy-bookmarks.php:367
|
| 102 |
+
#: sexy-bookmarks.php:387
|
| 103 |
+
msgid "WARNING: You need to delete the current custom stylesheet %s before the plugin can write to the folder. %sNeed Help?%s"
|
| 104 |
+
msgstr ""
|
| 105 |
+
|
| 106 |
+
#: sexy-bookmarks.php:394
|
| 107 |
+
msgid "Short URL(s) have been reset."
|
| 108 |
+
msgstr "Skrócone odnośniki zostały zresetowane."
|
| 109 |
+
|
| 110 |
+
#: sexy-bookmarks.php:473
|
| 111 |
+
msgid "BETA Testing"
|
| 112 |
+
msgstr "BETA testy"
|
| 113 |
+
|
| 114 |
+
#: sexy-bookmarks.php:478
|
| 115 |
+
msgid "We completely re-wrote Shareaholic from the ground up to make it faster, leaner, better."
|
| 116 |
+
msgstr "Nowy Shareaholic został napisany całkowicie od nowa, aby uczynić go szybszym, zgrabniejszym, lepszym."
|
| 117 |
+
|
| 118 |
+
#: sexy-bookmarks.php:479
|
| 119 |
+
msgid "Use the new version? (BETA)"
|
| 120 |
+
msgstr "Użyć nowej wersji? (BETA)"
|
| 121 |
+
|
| 122 |
+
#: sexy-bookmarks.php:481
|
| 123 |
+
#: sexy-bookmarks.php:634
|
| 124 |
+
#: sexy-bookmarks.php:638
|
| 125 |
+
#: sexy-bookmarks.php:642
|
| 126 |
+
#: sexy-bookmarks.php:647
|
| 127 |
+
#: sexy-bookmarks.php:651
|
| 128 |
+
#: sexy-bookmarks.php:708
|
| 129 |
+
#: sexy-bookmarks.php:712
|
| 130 |
+
#: sexy-bookmarks.php:789
|
| 131 |
+
msgid "No"
|
| 132 |
+
msgstr "Nie"
|
| 133 |
+
|
| 134 |
+
#: sexy-bookmarks.php:482
|
| 135 |
+
msgid "You can switch back at any time."
|
| 136 |
+
msgstr "Możesz zmienić tę opcję w dowolnym momencie."
|
| 137 |
+
|
| 138 |
+
#: sexy-bookmarks.php:486
|
| 139 |
+
msgid "We are anxious to hear what you think! If you would like to leave us some feedback, please follow %sthis link%s and share your thoughts and opinions with us."
|
| 140 |
+
msgstr "Czekamy z niecierpliwością na Twoją opinię. Jeśli chcesz podzielić się z nami swoimi wrażeniami, kliknij w %ten link%s i powiedz nam co myślisz."
|
| 141 |
+
|
| 142 |
+
#: sexy-bookmarks.php:492
|
| 143 |
+
msgid "Enabled Networks"
|
| 144 |
+
msgstr "Aktywne serwisy"
|
| 145 |
+
|
| 146 |
+
#: sexy-bookmarks.php:496
|
| 147 |
+
msgid "Select the Networks to display. Drag to reorder."
|
| 148 |
+
msgstr "Wybierz serwisy, których chcesz użyć. Przeciągnij aby zmienić kolejność."
|
| 149 |
+
|
| 150 |
+
#: sexy-bookmarks.php:498
|
| 151 |
+
msgid "Select"
|
| 152 |
+
msgstr "Wybierz"
|
| 153 |
+
|
| 154 |
+
#: sexy-bookmarks.php:499
|
| 155 |
+
msgid "All"
|
| 156 |
+
msgstr "Wszystkie"
|
| 157 |
+
|
| 158 |
+
#: sexy-bookmarks.php:500
|
| 159 |
+
msgid "None"
|
| 160 |
+
msgstr "Żaden"
|
| 161 |
+
|
| 162 |
+
#: sexy-bookmarks.php:501
|
| 163 |
+
msgid "Most Popular"
|
| 164 |
+
msgstr "Popularne"
|
| 165 |
+
|
| 166 |
+
#: sexy-bookmarks.php:511
|
| 167 |
+
msgid "Made with Much Love, these Icons are © Shareaholic"
|
| 168 |
+
msgstr "Ikony autorstwa © Shareaholic"
|
| 169 |
+
|
| 170 |
+
#: sexy-bookmarks.php:516
|
| 171 |
+
msgid "Functionality Settings"
|
| 172 |
+
msgstr "Ustawienia funkcjonalności"
|
| 173 |
+
|
| 174 |
+
#: sexy-bookmarks.php:522
|
| 175 |
+
msgid "Twitter Options:"
|
| 176 |
+
msgstr "Skonfiguruj Twitter:"
|
| 177 |
+
|
| 178 |
+
#: sexy-bookmarks.php:524
|
| 179 |
+
msgid "Configuration Instructions:"
|
| 180 |
+
msgstr "Jak skonfigurować:"
|
| 181 |
+
|
| 182 |
+
#: sexy-bookmarks.php:525
|
| 183 |
+
msgid "Using the strings %s and %s you can fully customize your tweet output."
|
| 184 |
+
msgstr "Możesz dostosować wygląd Tweeta używając ciągów %s i %s"
|
| 185 |
+
|
| 186 |
+
#: sexy-bookmarks.php:526
|
| 187 |
+
msgid "Example Configurations:"
|
| 188 |
+
msgstr "Przykładowe ustawienia:"
|
| 189 |
+
|
| 190 |
+
#: sexy-bookmarks.php:528
|
| 191 |
+
msgid "or"
|
| 192 |
+
msgstr "lub"
|
| 193 |
+
|
| 194 |
+
#: sexy-bookmarks.php:532
|
| 195 |
+
msgid "Configure Custom Tweet Template:"
|
| 196 |
+
msgstr "Dostosuj wygląd Tweeta:"
|
| 197 |
+
|
| 198 |
+
#: sexy-bookmarks.php:532
|
| 199 |
+
msgid "Characters:"
|
| 200 |
+
msgstr "Znaków:"
|
| 201 |
+
|
| 202 |
+
#: sexy-bookmarks.php:535
|
| 203 |
+
msgid "Example Tweet Output:"
|
| 204 |
+
msgstr "Przykładowy wygląd Tweeta:"
|
| 205 |
+
|
| 206 |
+
#: sexy-bookmarks.php:539
|
| 207 |
+
msgid "This will clear %sALL%s short URLs. - Are you sure? Note: you will also need to \"Save Changes\" to complete the reset."
|
| 208 |
+
msgstr ""
|
| 209 |
+
|
| 210 |
+
#: sexy-bookmarks.php:546
|
| 211 |
+
msgid "Which URL Shortener?"
|
| 212 |
+
msgstr "Wybierz serwis skracania odnośników:"
|
| 213 |
+
|
| 214 |
+
#: sexy-bookmarks.php:551
|
| 215 |
+
msgid "Don't use a shortener"
|
| 216 |
+
msgstr "Nie używaj skóconych odnośników"
|
| 217 |
+
|
| 218 |
+
#: sexy-bookmarks.php:565
|
| 219 |
+
msgid "Reset all Short URLs"
|
| 220 |
+
msgstr "Skasuj wszystkie skrócone odnośniki"
|
| 221 |
+
|
| 222 |
+
#: sexy-bookmarks.php:568
|
| 223 |
+
#: sexy-bookmarks.php:580
|
| 224 |
+
#: sexy-bookmarks.php:589
|
| 225 |
+
#: sexy-bookmarks.php:601
|
| 226 |
+
#: sexy-bookmarks.php:621
|
| 227 |
+
msgid "User ID:"
|
| 228 |
+
msgstr "ID Użytkownika:"
|
| 229 |
+
|
| 230 |
+
#: sexy-bookmarks.php:570
|
| 231 |
+
#: sexy-bookmarks.php:591
|
| 232 |
+
#: sexy-bookmarks.php:611
|
| 233 |
+
#: sexy-bookmarks.php:623
|
| 234 |
+
msgid "API Key:"
|
| 235 |
+
msgstr "Klucz aplikacji (API Key)"
|
| 236 |
+
|
| 237 |
+
#: sexy-bookmarks.php:576
|
| 238 |
+
#: sexy-bookmarks.php:597
|
| 239 |
+
#: sexy-bookmarks.php:607
|
| 240 |
+
#: sexy-bookmarks.php:617
|
| 241 |
+
msgid "Track Generated Links?"
|
| 242 |
+
msgstr "Śledź wygenerowane linki?"
|
| 243 |
+
|
| 244 |
+
#: sexy-bookmarks.php:582
|
| 245 |
+
msgid "Password:"
|
| 246 |
+
msgstr "Hasło:"
|
| 247 |
+
|
| 248 |
+
#: sexy-bookmarks.php:630
|
| 249 |
+
msgid "General Functionality Options:"
|
| 250 |
+
msgstr "Ustawienia ogólne:"
|
| 251 |
+
|
| 252 |
+
#: sexy-bookmarks.php:632
|
| 253 |
+
msgid "Add nofollow to the links?"
|
| 254 |
+
msgstr "Dodaj do linków atrybut nofollow?"
|
| 255 |
+
|
| 256 |
+
#: sexy-bookmarks.php:636
|
| 257 |
+
msgid "Open links in new window?"
|
| 258 |
+
msgstr "Otwórz linki w nowym oknie?"
|
| 259 |
+
|
| 260 |
+
#: sexy-bookmarks.php:640
|
| 261 |
+
msgid "Show Share Counters for Facebook and Twitter?"
|
| 262 |
+
msgstr "Pokazuj liczniki dla Facebook'a i Tweeter'a?"
|
| 263 |
+
|
| 264 |
+
#: sexy-bookmarks.php:643
|
| 265 |
+
msgid "(beta-mode exclusive feature)"
|
| 266 |
+
msgstr ""
|
| 267 |
+
|
| 268 |
+
#: sexy-bookmarks.php:645
|
| 269 |
+
msgid "Show Shareaholic Promo?"
|
| 270 |
+
msgstr "Umieszczaj link do Shareaholic?"
|
| 271 |
+
|
| 272 |
+
#: sexy-bookmarks.php:649
|
| 273 |
+
msgid "Track Performance?"
|
| 274 |
+
msgstr ""
|
| 275 |
+
|
| 276 |
+
#: sexy-bookmarks.php:650
|
| 277 |
+
msgid "Yes (recommended)"
|
| 278 |
+
msgstr "Tak (zalecane)"
|
| 279 |
+
|
| 280 |
+
#: sexy-bookmarks.php:658
|
| 281 |
+
msgid "Plugin Aesthetics"
|
| 282 |
+
msgstr "Estetyka"
|
| 283 |
+
|
| 284 |
+
#: sexy-bookmarks.php:663
|
| 285 |
+
msgid "Warning!"
|
| 286 |
+
msgstr "Ostrzeżenie!"
|
| 287 |
+
|
| 288 |
+
#: sexy-bookmarks.php:664
|
| 289 |
+
msgid "This option is intended %STRICTLY%s for users who understand how to edit CSS/JS and intend to change/edit the associated images themselves. Unfortunately, no support will be offered for this feature, as I cannot be held accountable for your coding and/or image editing mistakes."
|
| 290 |
+
msgstr "Ta opcja przeznaczona jest %JEDYNIE%s dla użytkowników zaznajomionych z metodami edycji plików CSS/JS. Shareaholic nie oferuje wsparcia technicznego dla tej opcji."
|
| 291 |
+
|
| 292 |
+
#: sexy-bookmarks.php:665
|
| 293 |
+
msgid "How it works..."
|
| 294 |
+
msgstr "Jak to działa?"
|
| 295 |
+
|
| 296 |
+
#: sexy-bookmarks.php:666
|
| 297 |
+
msgid "Since you have chosen for the plugin to override the style settings with your own custom mods, it will now pull the files from the new folders it is going to create on your server as soon as you save your changes. The file/folder locations should be as follows:"
|
| 298 |
+
msgstr ""
|
| 299 |
+
|
| 300 |
+
#: sexy-bookmarks.php:683
|
| 301 |
+
msgid "Once you have saved your changes, you will be able to edit the image sprite that holds all of the icons for Shareaholic as well as the CSS which accompanies it. Just be sure that you do in fact edit the CSS if you edit the images, as it is unlikely the heights, widths, and background positions of the images will stay the same after you are done."
|
| 302 |
+
msgstr ""
|
| 303 |
+
|
| 304 |
+
#: sexy-bookmarks.php:684
|
| 305 |
+
msgid "Just a quick note... When you edit the styles and images to include your own custom backgrounds, icons, and CSS styles, be aware that those changes will not be reflected on the plugin options page. In other words: when you select your networks to be displayed, or when you select the background image to use, it will still be displaying the images from the original plugin directory."
|
| 306 |
+
msgstr ""
|
| 307 |
+
|
| 308 |
+
#: sexy-bookmarks.php:685
|
| 309 |
+
msgid "In Case of Emergency"
|
| 310 |
+
msgstr "W razie jakicholwiek problemów:"
|
| 311 |
+
|
| 312 |
+
#: sexy-bookmarks.php:686
|
| 313 |
+
msgid "If you happen to mess things up, you can follow these directions to reset the plugin back to normal and try again if you wish:"
|
| 314 |
+
msgstr "Jeśli w ferworze walki zdarzy ci się coś popsuć, możesz zastosować poniższe kroki aby zresetować plugin i spróbować ponownie:"
|
| 315 |
+
|
| 316 |
+
#: sexy-bookmarks.php:688
|
| 317 |
+
msgid "Login to your server via FTP or SSH. (whichever you are more comfortable with)"
|
| 318 |
+
msgstr "Zaloguj się na swój serwer używając FTP lub SSH."
|
| 319 |
+
|
| 320 |
+
#: sexy-bookmarks.php:689
|
| 321 |
+
msgid "Navigate to your wp-content directory."
|
| 322 |
+
msgstr "Otwórz katalog wp-content."
|
| 323 |
+
|
| 324 |
+
#: sexy-bookmarks.php:690
|
| 325 |
+
msgid "Delete the directory named \"sexy-mods\"."
|
| 326 |
+
msgstr "Usuń katalog \"sexy-mods\"."
|
| 327 |
+
|
| 328 |
+
#: sexy-bookmarks.php:691
|
| 329 |
+
msgid "Login to your WordPress dashboard."
|
| 330 |
+
msgstr "Zaloguj się do Panelu Sterowania (Kokpit)."
|
| 331 |
+
|
| 332 |
+
#: sexy-bookmarks.php:692
|
| 333 |
+
msgid "Go to the SexyBookmarks plugin options page. (Settings->SexyBookmarks)"
|
| 334 |
+
msgstr "Przejdź do ustawień pluginu. (Ustawienia -> SexyBookmarks)"
|
| 335 |
+
|
| 336 |
+
#: sexy-bookmarks.php:693
|
| 337 |
+
msgid "Deselect the \"Use custom mods\" option."
|
| 338 |
+
msgstr "Odznacz opcję \"Użyj własnych modyfikacji\" "
|
| 339 |
+
|
| 340 |
+
#: sexy-bookmarks.php:694
|
| 341 |
+
msgid "Save your changes."
|
| 342 |
+
msgstr "Zapisz zmiany."
|
| 343 |
+
|
| 344 |
+
#: sexy-bookmarks.php:696
|
| 345 |
+
msgid "Close Message"
|
| 346 |
+
msgstr "Zamknij wiadomość."
|
| 347 |
+
|
| 348 |
+
#: sexy-bookmarks.php:700
|
| 349 |
+
msgid "Override Styles With Custom Mods Instead?"
|
| 350 |
+
msgstr "Zastąp style własnymi modyfikacjami?"
|
| 351 |
+
|
| 352 |
+
#: sexy-bookmarks.php:705
|
| 353 |
+
msgid "jQuery Related Options"
|
| 354 |
+
msgstr "Opcje jQuery "
|
| 355 |
+
|
| 356 |
+
#: sexy-bookmarks.php:706
|
| 357 |
+
msgid "Animate-expand multi-lined bookmarks?"
|
| 358 |
+
msgstr "Używaj animacji do rozwijania ukrytych ikon?"
|
| 359 |
+
|
| 360 |
+
#: sexy-bookmarks.php:709
|
| 361 |
+
msgid "Auto-space/center the bookmarks?"
|
| 362 |
+
msgstr "Rozmieszczaj/Wypośrodkuj ikony automatycznie?"
|
| 363 |
+
|
| 364 |
+
#: sexy-bookmarks.php:710
|
| 365 |
+
msgid "Space"
|
| 366 |
+
msgstr ""
|
| 367 |
+
|
| 368 |
+
#: sexy-bookmarks.php:711
|
| 369 |
+
msgid "Center"
|
| 370 |
+
msgstr ""
|
| 371 |
+
|
| 372 |
+
#: sexy-bookmarks.php:713
|
| 373 |
+
msgid "jQuery Compatibility Fix"
|
| 374 |
+
msgstr ""
|
| 375 |
+
|
| 376 |
+
#: sexy-bookmarks.php:714
|
| 377 |
+
msgid "Check this box ONLY if you notice jQuery being loaded twice in your source code!"
|
| 378 |
+
msgstr ""
|
| 379 |
+
|
| 380 |
+
#: sexy-bookmarks.php:716
|
| 381 |
+
msgid "Load scripts in Footer"
|
| 382 |
+
msgstr "Ładuj skrypty w stopce."
|
| 383 |
+
|
| 384 |
+
#: sexy-bookmarks.php:717
|
| 385 |
+
msgid "Check this box if you want the SexyBookmarks javascript to be loaded in your blog's footer."
|
| 386 |
+
msgstr "Zaznacz tę opcję, jeśli chcesz by skrypt Java pluginu Shareaholic był ładowany w stopce."
|
| 387 |
+
|
| 388 |
+
#: sexy-bookmarks.php:719
|
| 389 |
+
msgid "Background Image Options"
|
| 390 |
+
msgstr "Opcje dla obrazu tła"
|
| 391 |
+
|
| 392 |
+
#: sexy-bookmarks.php:721
|
| 393 |
+
msgid "Use a background image?"
|
| 394 |
+
msgstr "Używać obrazu tła?"
|
| 395 |
+
|
| 396 |
+
#: sexy-bookmarks.php:754
|
| 397 |
+
msgid "Menu Placement"
|
| 398 |
+
msgstr "Położenie Menu"
|
| 399 |
+
|
| 400 |
+
#: sexy-bookmarks.php:760
|
| 401 |
+
msgid "Need help with this? Find it in the %sofficial install guide%s."
|
| 402 |
+
msgstr "Potrzebujesz pomocy? Przeczytaj nasz %oficjalny przewodnik instalacji%s."
|
| 403 |
+
|
| 404 |
+
#: sexy-bookmarks.php:766
|
| 405 |
+
msgid "Menu Location (in relation to content):"
|
| 406 |
+
msgstr "Położenie menu:"
|
| 407 |
+
|
| 408 |
+
#: sexy-bookmarks.php:767
|
| 409 |
+
msgid "Above Content"
|
| 410 |
+
msgstr "Nad artykułem"
|
| 411 |
+
|
| 412 |
+
#: sexy-bookmarks.php:768
|
| 413 |
+
msgid "Below Content"
|
| 414 |
+
msgstr "Pod artykułem"
|
| 415 |
+
|
| 416 |
+
#: sexy-bookmarks.php:769
|
| 417 |
+
msgid "Above & Below Content"
|
| 418 |
+
msgstr "Pod i nad artykułem"
|
| 419 |
+
|
| 420 |
+
#: sexy-bookmarks.php:770
|
| 421 |
+
msgid "Manual Mode"
|
| 422 |
+
msgstr "Ustaw manualnie"
|
| 423 |
+
|
| 424 |
+
#: sexy-bookmarks.php:771
|
| 425 |
+
msgid "Posts, pages, or the whole shebang?"
|
| 426 |
+
msgstr "Wpisy, strony czy wszędzie?"
|
| 427 |
+
|
| 428 |
+
#: sexy-bookmarks.php:776
|
| 429 |
+
msgid "Posts Only"
|
| 430 |
+
msgstr "Tylko wpisy"
|
| 431 |
+
|
| 432 |
+
#: sexy-bookmarks.php:777
|
| 433 |
+
msgid "Pages Only"
|
| 434 |
+
msgstr "Tylko strony"
|
| 435 |
+
|
| 436 |
+
#: sexy-bookmarks.php:778
|
| 437 |
+
msgid "Index Only"
|
| 438 |
+
msgstr "Tylko Index"
|
| 439 |
+
|
| 440 |
+
#: sexy-bookmarks.php:779
|
| 441 |
+
msgid "Posts & Pages"
|
| 442 |
+
msgstr "Wpisy i strony"
|
| 443 |
+
|
| 444 |
+
#: sexy-bookmarks.php:780
|
| 445 |
+
msgid "Posts & Index"
|
| 446 |
+
msgstr "Wpisy i Index"
|
| 447 |
+
|
| 448 |
+
#: sexy-bookmarks.php:781
|
| 449 |
+
msgid "Pages & Index"
|
| 450 |
+
msgstr "Strony i Index"
|
| 451 |
+
|
| 452 |
+
#: sexy-bookmarks.php:782
|
| 453 |
+
msgid "Posts, Pages, & Index"
|
| 454 |
+
msgstr "Wpisy, Strony i Index"
|
| 455 |
+
|
| 456 |
+
#: sexy-bookmarks.php:786
|
| 457 |
+
msgid "Click here for help with this option"
|
| 458 |
+
msgstr "Kliknij aby uzyskać pomoc"
|
| 459 |
+
|
| 460 |
+
#: sexy-bookmarks.php:787
|
| 461 |
+
msgid "Show in RSS feed?"
|
| 462 |
+
msgstr "Pokazuj w kanale RSS?"
|
| 463 |
+
|
| 464 |
+
#: sexy-bookmarks.php:791
|
| 465 |
+
msgid "Hide menu from mobile browsers?"
|
| 466 |
+
msgstr "Ukryj menu w przeglądarkach mobilnych?"
|
| 467 |
+
|
| 468 |
+
#: sexy-bookmarks.php:800
|
| 469 |
+
msgid "Save Changes"
|
| 470 |
+
msgstr "Zachowaj zmiany"
|
| 471 |
+
|
| 472 |
+
#: sexy-bookmarks.php:804
|
| 473 |
+
msgid "Reset Settings"
|
| 474 |
+
msgstr "Resetuj ustawienia"
|
| 475 |
+
|
| 476 |
+
#: sexy-bookmarks.php:810
|
| 477 |
+
msgid "Helpful Plugin Links"
|
| 478 |
+
msgstr "Pomocne linki"
|
| 479 |
+
|
| 480 |
+
#: sexy-bookmarks.php:815
|
| 481 |
+
msgid "Installation & Usage Guide"
|
| 482 |
+
msgstr "Instalacja i Podręcznik Użytkownika"
|
| 483 |
+
|
| 484 |
+
#: sexy-bookmarks.php:816
|
| 485 |
+
msgid "Frequently Asked Questions"
|
| 486 |
+
msgstr "FAQ (Często zadawane pytania)"
|
| 487 |
+
|
| 488 |
+
#: sexy-bookmarks.php:817
|
| 489 |
+
msgid "Bug Submission Form"
|
| 490 |
+
msgstr "Raportuj błąd"
|
| 491 |
+
|
| 492 |
+
#: sexy-bookmarks.php:818
|
| 493 |
+
msgid "Feature Request Form"
|
| 494 |
+
msgstr "Zaproponuj rozszerzenie funkcjonalności"
|
| 495 |
+
|
| 496 |
+
#: sexy-bookmarks.php:819
|
| 497 |
+
msgid "Submit a Translation"
|
| 498 |
+
msgstr "Dodaj tłumaczenie"
|
| 499 |
+
|
| 500 |
+
#: sexy-bookmarks.php:820
|
| 501 |
+
msgid "Shareaholic Browsers Add-ons"
|
| 502 |
+
msgstr "Pluginy Shareaholic dla przeglądarek"
|
| 503 |
+
|
| 504 |
+
#: sexy-bookmarks.php:821
|
| 505 |
+
msgid "Thanks & Credits"
|
| 506 |
+
msgstr "Podziękowania i Autorzy"
|
| 507 |
+
|
| 508 |
+
#: sexy-bookmarks.php:840
|
| 509 |
+
#: sexy-bookmarks.php:843
|
| 510 |
+
msgid "SexyBookmarks (by Shareaholic)"
|
| 511 |
+
msgstr "SexyBookmarks (stworzone przez Shareaholic)"
|
| 512 |
+
|
| 513 |
+
#: sexy-bookmarks.php:840
|
| 514 |
+
msgid "Shareaholic"
|
| 515 |
+
msgstr ""
|
| 516 |
+
|
| 517 |
+
#: sexy-bookmarks.php:843
|
| 518 |
+
msgid "SexyBookmarks"
|
| 519 |
+
msgstr ""
|
| 520 |
+
|
| 521 |
+
#: sexy-bookmarks.php:879
|
| 522 |
+
msgid "Settings"
|
| 523 |
+
msgstr "Ustawienia"
|
| 524 |
+
|
| 525 |
+
#: includes/bookmarks-data.php:21
|
| 526 |
+
msgid "Check this box to include %s in your bookmarking menu"
|
| 527 |
+
msgstr ""
|
| 528 |
+
|
| 529 |
+
#: includes/bookmarks-data.php:28
|
| 530 |
+
#: includes/bookmarks-data.php:63
|
| 531 |
+
#: includes/bookmarks-data.php:88
|
| 532 |
+
#: includes/bookmarks-data.php:203
|
| 533 |
+
#: includes/bookmarks-data.php:258
|
| 534 |
+
#: includes/bookmarks-data.php:263
|
| 535 |
+
#: includes/bookmarks-data.php:268
|
| 536 |
+
#: includes/bookmarks-data.php:273
|
| 537 |
+
#: includes/bookmarks-data.php:313
|
| 538 |
+
#: includes/bookmarks-data.php:328
|
| 539 |
+
#: includes/bookmarks-data.php:338
|
| 540 |
+
#: includes/bookmarks-data.php:343
|
| 541 |
+
#: includes/bookmarks-data.php:363
|
| 542 |
+
msgid "Submit this to "
|
| 543 |
+
msgstr "Opublikuj na"
|
| 544 |
+
|
| 545 |
+
#: includes/bookmarks-data.php:33
|
| 546 |
+
#: includes/bookmarks-data.php:38
|
| 547 |
+
#: includes/bookmarks-data.php:53
|
| 548 |
+
#: includes/bookmarks-data.php:73
|
| 549 |
+
#: includes/bookmarks-data.php:78
|
| 550 |
+
#: includes/bookmarks-data.php:93
|
| 551 |
+
#: includes/bookmarks-data.php:118
|
| 552 |
+
#: includes/bookmarks-data.php:153
|
| 553 |
+
#: includes/bookmarks-data.php:158
|
| 554 |
+
#: includes/bookmarks-data.php:163
|
| 555 |
+
#: includes/bookmarks-data.php:173
|
| 556 |
+
#: includes/bookmarks-data.php:178
|
| 557 |
+
#: includes/bookmarks-data.php:293
|
| 558 |
+
#: includes/bookmarks-data.php:353
|
| 559 |
+
#: includes/bookmarks-data.php:373
|
| 560 |
+
#: includes/bookmarks-data.php:393
|
| 561 |
+
#: includes/bookmarks-data.php:403
|
| 562 |
+
#: includes/bookmarks-data.php:408
|
| 563 |
+
#: includes/bookmarks-data.php:418
|
| 564 |
+
#: includes/bookmarks-data.php:428
|
| 565 |
+
#: includes/bookmarks-data.php:443
|
| 566 |
+
msgid "Share this on "
|
| 567 |
+
msgstr "Podziel się na"
|
| 568 |
+
|
| 569 |
+
#: includes/bookmarks-data.php:43
|
| 570 |
+
msgid "Digg this!"
|
| 571 |
+
msgstr "Wykop to!"
|
| 572 |
+
|
| 573 |
+
#: includes/bookmarks-data.php:48
|
| 574 |
+
msgid "Post this on "
|
| 575 |
+
msgstr "Umieść na"
|
| 576 |
+
|
| 577 |
+
#: includes/bookmarks-data.php:58
|
| 578 |
+
msgid "Buzz up!"
|
| 579 |
+
msgstr "Buzz'nij"
|
| 580 |
+
|
| 581 |
+
#: includes/bookmarks-data.php:68
|
| 582 |
+
msgid "Stumble upon something good? Share it on StumbleUpon"
|
| 583 |
+
msgstr "Natknąłeś się na coś ciekawego? Dodaj do StumbleUpon"
|
| 584 |
+
|
| 585 |
+
#: includes/bookmarks-data.php:83
|
| 586 |
+
#: includes/bookmarks-data.php:223
|
| 587 |
+
#: includes/bookmarks-data.php:243
|
| 588 |
+
#: includes/bookmarks-data.php:383
|
| 589 |
+
msgid "Post this to "
|
| 590 |
+
msgstr "Opublikuj na"
|
| 591 |
+
|
| 592 |
+
#: includes/bookmarks-data.php:98
|
| 593 |
+
msgid "Tweet This!"
|
| 594 |
+
msgstr "Tweetnij to!"
|
| 595 |
+
|
| 596 |
+
#: includes/bookmarks-data.php:102
|
| 597 |
+
msgid "an 'Email to a Friend' link"
|
| 598 |
+
msgstr "Wyślij e-mail do znajomego"
|
| 599 |
+
|
| 600 |
+
#: includes/bookmarks-data.php:103
|
| 601 |
+
msgid "Email this to a friend?"
|
| 602 |
+
msgstr "Wysłać e-mail do znajomego?"
|
| 603 |
+
|
| 604 |
+
#: includes/bookmarks-data.php:108
|
| 605 |
+
msgid "Suggest this article to "
|
| 606 |
+
msgstr "Zaproponuj artykuł "
|
| 607 |
+
|
| 608 |
+
#: includes/bookmarks-data.php:111
|
| 609 |
+
msgid "a 'Subscribe to Comments' link"
|
| 610 |
+
msgstr "Subskrybuj komentarze"
|
| 611 |
+
|
| 612 |
+
#: includes/bookmarks-data.php:112
|
| 613 |
+
#: includes/public.php:139
|
| 614 |
+
msgid "Subscribe to the comments for this post?"
|
| 615 |
+
msgstr "Subskrybować komentarze dla tego wpisu?"
|
| 616 |
+
|
| 617 |
+
#: includes/bookmarks-data.php:123
|
| 618 |
+
msgid "Seed this on "
|
| 619 |
+
msgstr ""
|
| 620 |
+
|
| 621 |
+
#: includes/bookmarks-data.php:128
|
| 622 |
+
#: includes/bookmarks-data.php:133
|
| 623 |
+
#: includes/bookmarks-data.php:143
|
| 624 |
+
#: includes/bookmarks-data.php:148
|
| 625 |
+
#: includes/bookmarks-data.php:183
|
| 626 |
+
#: includes/bookmarks-data.php:188
|
| 627 |
+
#: includes/bookmarks-data.php:193
|
| 628 |
+
#: includes/bookmarks-data.php:198
|
| 629 |
+
#: includes/bookmarks-data.php:218
|
| 630 |
+
#: includes/bookmarks-data.php:378
|
| 631 |
+
#: includes/bookmarks-data.php:398
|
| 632 |
+
#: includes/bookmarks-data.php:423
|
| 633 |
+
msgid "Add this to "
|
| 634 |
+
msgstr "Dodaj do"
|
| 635 |
+
|
| 636 |
+
#: includes/bookmarks-data.php:138
|
| 637 |
+
msgid "Post on Google Buzz"
|
| 638 |
+
msgstr "Dodaj do Google Buzz"
|
| 639 |
+
|
| 640 |
+
#: includes/bookmarks-data.php:168
|
| 641 |
+
msgid "Mark this on "
|
| 642 |
+
msgstr ""
|
| 643 |
+
|
| 644 |
+
#: includes/bookmarks-data.php:177
|
| 645 |
+
#: includes/bookmarks-data.php:182
|
| 646 |
+
#: includes/bookmarks-data.php:187
|
| 647 |
+
#: includes/bookmarks-data.php:192
|
| 648 |
+
#: includes/bookmarks-data.php:197
|
| 649 |
+
msgid " (Russian)"
|
| 650 |
+
msgstr ""
|
| 651 |
+
|
| 652 |
+
#: includes/bookmarks-data.php:208
|
| 653 |
+
msgid "Send this page to "
|
| 654 |
+
msgstr ""
|
| 655 |
+
|
| 656 |
+
#: includes/bookmarks-data.php:213
|
| 657 |
+
msgid "Bump this on "
|
| 658 |
+
msgstr ""
|
| 659 |
+
|
| 660 |
+
#: includes/bookmarks-data.php:228
|
| 661 |
+
msgid "Save this to "
|
| 662 |
+
msgstr ""
|
| 663 |
+
|
| 664 |
+
#: includes/bookmarks-data.php:233
|
| 665 |
+
msgid "Tip this to "
|
| 666 |
+
msgstr ""
|
| 667 |
+
|
| 668 |
+
#: includes/bookmarks-data.php:238
|
| 669 |
+
msgid "Sphinn this on "
|
| 670 |
+
msgstr ""
|
| 671 |
+
|
| 672 |
+
#: includes/bookmarks-data.php:248
|
| 673 |
+
msgid "Grind this! on "
|
| 674 |
+
msgstr ""
|
| 675 |
+
|
| 676 |
+
#: includes/bookmarks-data.php:253
|
| 677 |
+
msgid "Ping this on "
|
| 678 |
+
msgstr ""
|
| 679 |
+
|
| 680 |
+
#: includes/bookmarks-data.php:257
|
| 681 |
+
#: includes/bookmarks-data.php:262
|
| 682 |
+
msgid " (Dutch)"
|
| 683 |
+
msgstr ""
|
| 684 |
+
|
| 685 |
+
#: includes/bookmarks-data.php:278
|
| 686 |
+
msgid "Blend this!"
|
| 687 |
+
msgstr ""
|
| 688 |
+
|
| 689 |
+
#: includes/bookmarks-data.php:282
|
| 690 |
+
msgid " (Polish)"
|
| 691 |
+
msgstr ""
|
| 692 |
+
|
| 693 |
+
#: includes/bookmarks-data.php:283
|
| 694 |
+
msgid "Add this to Wykop!"
|
| 695 |
+
msgstr "Dodaj na Wykop!"
|
| 696 |
+
|
| 697 |
+
#: includes/bookmarks-data.php:288
|
| 698 |
+
msgid "Engage with this article!"
|
| 699 |
+
msgstr "Skomentuj ten artykuł!"
|
| 700 |
+
|
| 701 |
+
#: includes/bookmarks-data.php:297
|
| 702 |
+
msgid " (Swedish)"
|
| 703 |
+
msgstr ""
|
| 704 |
+
|
| 705 |
+
#: includes/bookmarks-data.php:298
|
| 706 |
+
msgid "Push this on "
|
| 707 |
+
msgstr ""
|
| 708 |
+
|
| 709 |
+
#: includes/bookmarks-data.php:302
|
| 710 |
+
msgid " (Japanese)"
|
| 711 |
+
msgstr ""
|
| 712 |
+
|
| 713 |
+
#: includes/bookmarks-data.php:303
|
| 714 |
+
msgid "Bookmarks this on "
|
| 715 |
+
msgstr ""
|
| 716 |
+
|
| 717 |
+
#: includes/bookmarks-data.php:308
|
| 718 |
+
msgid "Store this link on "
|
| 719 |
+
msgstr ""
|
| 720 |
+
|
| 721 |
+
#: includes/bookmarks-data.php:318
|
| 722 |
+
msgid "Add to a lense on "
|
| 723 |
+
msgstr ""
|
| 724 |
+
|
| 725 |
+
#: includes/bookmarks-data.php:323
|
| 726 |
+
msgid "Submit this story to "
|
| 727 |
+
msgstr ""
|
| 728 |
+
|
| 729 |
+
#: includes/bookmarks-data.php:333
|
| 730 |
+
msgid "Clip this to "
|
| 731 |
+
msgstr ""
|
| 732 |
+
|
| 733 |
+
#: includes/bookmarks-data.php:337
|
| 734 |
+
#: includes/bookmarks-data.php:342
|
| 735 |
+
msgid " (Spanish)"
|
| 736 |
+
msgstr ""
|
| 737 |
+
|
| 738 |
+
#: includes/bookmarks-data.php:348
|
| 739 |
+
msgid "Submit this link to "
|
| 740 |
+
msgstr ""
|
| 741 |
+
|
| 742 |
+
#: includes/bookmarks-data.php:358
|
| 743 |
+
msgid "Submit tip to "
|
| 744 |
+
msgstr ""
|
| 745 |
+
|
| 746 |
+
#: includes/bookmarks-data.php:368
|
| 747 |
+
msgid "Promote this on "
|
| 748 |
+
msgstr ""
|
| 749 |
+
|
| 750 |
+
#: includes/bookmarks-data.php:388
|
| 751 |
+
msgid "Blog this on "
|
| 752 |
+
msgstr ""
|
| 753 |
+
|
| 754 |
+
#: includes/bookmarks-data.php:402
|
| 755 |
+
msgid " (Estonian)"
|
| 756 |
+
msgstr ""
|
| 757 |
+
|
| 758 |
+
#: includes/bookmarks-data.php:413
|
| 759 |
+
msgid "Add this link to "
|
| 760 |
+
msgstr ""
|
| 761 |
+
|
| 762 |
+
#: includes/bookmarks-data.php:417
|
| 763 |
+
msgid "(Italian)"
|
| 764 |
+
msgstr ""
|
| 765 |
+
|
| 766 |
+
#: includes/bookmarks-data.php:433
|
| 767 |
+
msgid "Spring this on "
|
| 768 |
+
msgstr ""
|
| 769 |
+
|
| 770 |
+
#: includes/bookmarks-data.php:438
|
| 771 |
+
msgid "Box this on "
|
| 772 |
+
msgstr ""
|
| 773 |
+
|
| 774 |
+
#: includes/bookmarks-data.php:448
|
| 775 |
+
#: includes/bookmarks-data.php:453
|
| 776 |
+
#: includes/bookmarks-data.php:458
|
| 777 |
+
msgid "Email this via "
|
| 778 |
+
msgstr ""
|
| 779 |
+
|
| 780 |
+
#: includes/bookmarks-data.php:463
|
| 781 |
+
msgid "Share this via "
|
| 782 |
+
msgstr ""
|
| 783 |
+
|
| 784 |
+
#: includes/public.php:549
|
| 785 |
+
msgid "An unknown error occurred in SexyBookmarks"
|
| 786 |
+
msgstr ""
|
| 787 |
+
|
| 788 |
+
#: includes/public.php:814
|
| 789 |
+
msgid "SexyBookmarks has been disabled on this page"
|
| 790 |
+
msgstr ""
|
| 791 |
+
|
languages/shrsb-ar.mo
ADDED
|
Binary file
|
languages/shrsb-ar.po
ADDED
|
@@ -0,0 +1,1059 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
msgid ""
|
| 2 |
+
msgstr ""
|
| 3 |
+
"Project-Id-Version: SexyBookmarks v3.3.6 Arabic\n"
|
| 4 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/sexybookmarks\n"
|
| 5 |
+
"POT-Creation-Date: 2011-03-02 12:48:51+00:00\n"
|
| 6 |
+
"PO-Revision-Date: 2011-03-08 13:02+0200\n"
|
| 7 |
+
"Last-Translator: Modar Soos <modarsoos@yahoo.com>\n"
|
| 8 |
+
"Language-Team: Mickey Mouse <modarsoos@yahoo.com>\n"
|
| 9 |
+
"MIME-Version: 1.0\n"
|
| 10 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
+
"X-Poedit-KeywordsList: __;_e\n"
|
| 13 |
+
"X-Poedit-Basepath: .\n"
|
| 14 |
+
"X-Poedit-Language: Arabic\n"
|
| 15 |
+
"X-Poedit-Country: SYRIAN ARAB REPUBLIC\n"
|
| 16 |
+
"X-Poedit-SearchPath-0: .\n"
|
| 17 |
+
|
| 18 |
+
#: includes/bookmarks-data.php:21
|
| 19 |
+
msgid "Check this box to include %s in your bookmarking menu"
|
| 20 |
+
msgstr "حدد هذا المربع لإظهار %s في قائمة الروابط في الموقع"
|
| 21 |
+
|
| 22 |
+
#: includes/bookmarks-data.php:28
|
| 23 |
+
#: includes/bookmarks-data.php:58
|
| 24 |
+
#: includes/bookmarks-data.php:83
|
| 25 |
+
#: includes/bookmarks-data.php:198
|
| 26 |
+
#: includes/bookmarks-data.php:253
|
| 27 |
+
#: includes/bookmarks-data.php:258
|
| 28 |
+
#: includes/bookmarks-data.php:263
|
| 29 |
+
#: includes/bookmarks-data.php:268
|
| 30 |
+
#: includes/bookmarks-data.php:308
|
| 31 |
+
#: includes/bookmarks-data.php:323
|
| 32 |
+
#: includes/bookmarks-data.php:333
|
| 33 |
+
#: includes/bookmarks-data.php:338
|
| 34 |
+
#: includes/bookmarks-data.php:358
|
| 35 |
+
msgid "Submit this to "
|
| 36 |
+
msgstr "نشر هذا الموضوع في"
|
| 37 |
+
|
| 38 |
+
#: includes/bookmarks-data.php:33
|
| 39 |
+
#: includes/bookmarks-data.php:38
|
| 40 |
+
#: includes/bookmarks-data.php:53
|
| 41 |
+
#: includes/bookmarks-data.php:68
|
| 42 |
+
#: includes/bookmarks-data.php:73
|
| 43 |
+
#: includes/bookmarks-data.php:88
|
| 44 |
+
#: includes/bookmarks-data.php:113
|
| 45 |
+
#: includes/bookmarks-data.php:148
|
| 46 |
+
#: includes/bookmarks-data.php:153
|
| 47 |
+
#: includes/bookmarks-data.php:158
|
| 48 |
+
#: includes/bookmarks-data.php:168
|
| 49 |
+
#: includes/bookmarks-data.php:173
|
| 50 |
+
#: includes/bookmarks-data.php:288
|
| 51 |
+
#: includes/bookmarks-data.php:348
|
| 52 |
+
#: includes/bookmarks-data.php:368
|
| 53 |
+
#: includes/bookmarks-data.php:388
|
| 54 |
+
#: includes/bookmarks-data.php:398
|
| 55 |
+
#: includes/bookmarks-data.php:403
|
| 56 |
+
#: includes/bookmarks-data.php:413
|
| 57 |
+
#: includes/bookmarks-data.php:423
|
| 58 |
+
#: includes/bookmarks-data.php:438
|
| 59 |
+
msgid "Share this on "
|
| 60 |
+
msgstr "شارك هذا الموضوع على"
|
| 61 |
+
|
| 62 |
+
#: includes/bookmarks-data.php:43
|
| 63 |
+
msgid "Digg this!"
|
| 64 |
+
msgstr "انشرها على Digg this!"
|
| 65 |
+
|
| 66 |
+
#: includes/bookmarks-data.php:48
|
| 67 |
+
msgid "Post this on "
|
| 68 |
+
msgstr "نشر هذا الموضوع في"
|
| 69 |
+
|
| 70 |
+
#: includes/bookmarks-data.php:63
|
| 71 |
+
msgid "Stumble upon something good? Share it on StumbleUpon"
|
| 72 |
+
msgstr "Stumble upon something good? Share it on StumbleUpon"
|
| 73 |
+
|
| 74 |
+
#: includes/bookmarks-data.php:78
|
| 75 |
+
#: includes/bookmarks-data.php:218
|
| 76 |
+
#: includes/bookmarks-data.php:238
|
| 77 |
+
#: includes/bookmarks-data.php:378
|
| 78 |
+
msgid "Post this to "
|
| 79 |
+
msgstr "نشر هذا الموضوع في"
|
| 80 |
+
|
| 81 |
+
#: includes/bookmarks-data.php:93
|
| 82 |
+
msgid "Tweet This!"
|
| 83 |
+
msgstr "انشرها في تويتر!"
|
| 84 |
+
|
| 85 |
+
#: includes/bookmarks-data.php:97
|
| 86 |
+
msgid "an 'Email to a Friend' link"
|
| 87 |
+
msgstr "رابط \"أرسل لصديق\""
|
| 88 |
+
|
| 89 |
+
#: includes/bookmarks-data.php:98
|
| 90 |
+
msgid "Email this to a friend?"
|
| 91 |
+
msgstr "إرسال هذا الموضوع لصديق؟"
|
| 92 |
+
|
| 93 |
+
#: includes/bookmarks-data.php:103
|
| 94 |
+
msgid "Suggest this article to "
|
| 95 |
+
msgstr "اقترح هذا الموضوع ل"
|
| 96 |
+
|
| 97 |
+
#: includes/bookmarks-data.php:106
|
| 98 |
+
msgid "a 'Subscribe to Comments' link"
|
| 99 |
+
msgstr "رابط \"الاشتراك بالتعليقات\""
|
| 100 |
+
|
| 101 |
+
#: includes/bookmarks-data.php:107
|
| 102 |
+
#: includes/public.php:141
|
| 103 |
+
msgid "Subscribe to the comments for this post?"
|
| 104 |
+
msgstr "الاشتراك بالتعليقات في هذا الموضوع؟"
|
| 105 |
+
|
| 106 |
+
#: includes/bookmarks-data.php:118
|
| 107 |
+
msgid "Seed this on "
|
| 108 |
+
msgstr "Seed this on "
|
| 109 |
+
|
| 110 |
+
#: includes/bookmarks-data.php:123
|
| 111 |
+
#: includes/bookmarks-data.php:128
|
| 112 |
+
#: includes/bookmarks-data.php:138
|
| 113 |
+
#: includes/bookmarks-data.php:143
|
| 114 |
+
#: includes/bookmarks-data.php:178
|
| 115 |
+
#: includes/bookmarks-data.php:183
|
| 116 |
+
#: includes/bookmarks-data.php:188
|
| 117 |
+
#: includes/bookmarks-data.php:193
|
| 118 |
+
#: includes/bookmarks-data.php:213
|
| 119 |
+
#: includes/bookmarks-data.php:373
|
| 120 |
+
#: includes/bookmarks-data.php:393
|
| 121 |
+
#: includes/bookmarks-data.php:418
|
| 122 |
+
msgid "Add this to "
|
| 123 |
+
msgstr "إضافة هذا الموضوع في"
|
| 124 |
+
|
| 125 |
+
#: includes/bookmarks-data.php:133
|
| 126 |
+
msgid "Post on Google Buzz"
|
| 127 |
+
msgstr "نشر في صدى غوغل"
|
| 128 |
+
|
| 129 |
+
#: includes/bookmarks-data.php:163
|
| 130 |
+
msgid "Mark this on "
|
| 131 |
+
msgstr "حدد في"
|
| 132 |
+
|
| 133 |
+
#: includes/bookmarks-data.php:172
|
| 134 |
+
#: includes/bookmarks-data.php:177
|
| 135 |
+
#: includes/bookmarks-data.php:182
|
| 136 |
+
#: includes/bookmarks-data.php:187
|
| 137 |
+
#: includes/bookmarks-data.php:192
|
| 138 |
+
msgid " (Russian)"
|
| 139 |
+
msgstr "(روسي)"
|
| 140 |
+
|
| 141 |
+
#: includes/bookmarks-data.php:203
|
| 142 |
+
msgid "Send this page to "
|
| 143 |
+
msgstr "أرسل هذه الصفحة لـ"
|
| 144 |
+
|
| 145 |
+
#: includes/bookmarks-data.php:208
|
| 146 |
+
msgid "Bump this on "
|
| 147 |
+
msgstr "Bump this on "
|
| 148 |
+
|
| 149 |
+
#: includes/bookmarks-data.php:223
|
| 150 |
+
msgid "Save this to "
|
| 151 |
+
msgstr "احفظ هذا الموضوع في"
|
| 152 |
+
|
| 153 |
+
#: includes/bookmarks-data.php:228
|
| 154 |
+
msgid "Tip this to "
|
| 155 |
+
msgstr "ضعها كملاحظة على"
|
| 156 |
+
|
| 157 |
+
#: includes/bookmarks-data.php:233
|
| 158 |
+
msgid "Sphinn this on "
|
| 159 |
+
msgstr "Sphinn this on "
|
| 160 |
+
|
| 161 |
+
#: includes/bookmarks-data.php:243
|
| 162 |
+
msgid "Grind this! on "
|
| 163 |
+
msgstr "Grind this! on "
|
| 164 |
+
|
| 165 |
+
#: includes/bookmarks-data.php:248
|
| 166 |
+
msgid "Ping this on "
|
| 167 |
+
msgstr "Ping this on "
|
| 168 |
+
|
| 169 |
+
#: includes/bookmarks-data.php:252
|
| 170 |
+
#: includes/bookmarks-data.php:257
|
| 171 |
+
msgid " (Dutch)"
|
| 172 |
+
msgstr "(هولندي)"
|
| 173 |
+
|
| 174 |
+
#: includes/bookmarks-data.php:273
|
| 175 |
+
msgid "Blend this!"
|
| 176 |
+
msgstr "Blend this!"
|
| 177 |
+
|
| 178 |
+
#: includes/bookmarks-data.php:277
|
| 179 |
+
msgid " (Polish)"
|
| 180 |
+
msgstr "(بولندي)"
|
| 181 |
+
|
| 182 |
+
#: includes/bookmarks-data.php:278
|
| 183 |
+
msgid "Add this to Wykop!"
|
| 184 |
+
msgstr "إضافة الموضوع إلى Wykop!"
|
| 185 |
+
|
| 186 |
+
#: includes/bookmarks-data.php:283
|
| 187 |
+
msgid "Engage with this article!"
|
| 188 |
+
msgstr "التعامل مع هذا الموضوع!"
|
| 189 |
+
|
| 190 |
+
#: includes/bookmarks-data.php:292
|
| 191 |
+
msgid " (Swedish)"
|
| 192 |
+
msgstr "(سويدي)"
|
| 193 |
+
|
| 194 |
+
#: includes/bookmarks-data.php:293
|
| 195 |
+
msgid "Push this on "
|
| 196 |
+
msgstr "ادفع هذا الموضوع إلى"
|
| 197 |
+
|
| 198 |
+
#: includes/bookmarks-data.php:297
|
| 199 |
+
msgid " (Japanese)"
|
| 200 |
+
msgstr "(ياباني)"
|
| 201 |
+
|
| 202 |
+
#: includes/bookmarks-data.php:298
|
| 203 |
+
msgid "Bookmarks this on "
|
| 204 |
+
msgstr "احفظ كمفضلة على"
|
| 205 |
+
|
| 206 |
+
#: includes/bookmarks-data.php:303
|
| 207 |
+
msgid "Store this link on "
|
| 208 |
+
msgstr "احفظ هذا الرابط على"
|
| 209 |
+
|
| 210 |
+
#: includes/bookmarks-data.php:313
|
| 211 |
+
msgid "Add to a lense on "
|
| 212 |
+
msgstr "Add to a lense on "
|
| 213 |
+
|
| 214 |
+
#: includes/bookmarks-data.php:318
|
| 215 |
+
msgid "Submit this story to "
|
| 216 |
+
msgstr "أنشر هذه القصة على"
|
| 217 |
+
|
| 218 |
+
#: includes/bookmarks-data.php:328
|
| 219 |
+
msgid "Clip this to "
|
| 220 |
+
msgstr "Clip this to "
|
| 221 |
+
|
| 222 |
+
#: includes/bookmarks-data.php:332
|
| 223 |
+
#: includes/bookmarks-data.php:337
|
| 224 |
+
msgid " (Spanish)"
|
| 225 |
+
msgstr "(إسباني)"
|
| 226 |
+
|
| 227 |
+
#: includes/bookmarks-data.php:343
|
| 228 |
+
msgid "Submit this link to "
|
| 229 |
+
msgstr "أرسل هذا الرابط إلى"
|
| 230 |
+
|
| 231 |
+
#: includes/bookmarks-data.php:353
|
| 232 |
+
msgid "Submit tip to "
|
| 233 |
+
msgstr "Submit tip to "
|
| 234 |
+
|
| 235 |
+
#: includes/bookmarks-data.php:363
|
| 236 |
+
msgid "Promote this on "
|
| 237 |
+
msgstr "Promote this on "
|
| 238 |
+
|
| 239 |
+
#: includes/bookmarks-data.php:383
|
| 240 |
+
msgid "Blog this on "
|
| 241 |
+
msgstr "انشر هذا الموضوع في"
|
| 242 |
+
|
| 243 |
+
#: includes/bookmarks-data.php:397
|
| 244 |
+
msgid " (Estonian)"
|
| 245 |
+
msgstr "(استوني)"
|
| 246 |
+
|
| 247 |
+
#: includes/bookmarks-data.php:408
|
| 248 |
+
msgid "Add this link to "
|
| 249 |
+
msgstr "إضافة هذا الرابط إلى"
|
| 250 |
+
|
| 251 |
+
#: includes/bookmarks-data.php:412
|
| 252 |
+
msgid "(Italian)"
|
| 253 |
+
msgstr "(إيطالي)"
|
| 254 |
+
|
| 255 |
+
#: includes/bookmarks-data.php:428
|
| 256 |
+
msgid "Spring this on "
|
| 257 |
+
msgstr "Spring this on "
|
| 258 |
+
|
| 259 |
+
#: includes/bookmarks-data.php:433
|
| 260 |
+
msgid "Box this on "
|
| 261 |
+
msgstr "Box this on "
|
| 262 |
+
|
| 263 |
+
#: includes/bookmarks-data.php:443
|
| 264 |
+
#: includes/bookmarks-data.php:448
|
| 265 |
+
#: includes/bookmarks-data.php:453
|
| 266 |
+
msgid "Email this via "
|
| 267 |
+
msgstr "أرسل هذا الموضوع بواسطة"
|
| 268 |
+
|
| 269 |
+
#: includes/bookmarks-data.php:458
|
| 270 |
+
msgid "Share this via "
|
| 271 |
+
msgstr "شارك هذا الموضوع بواسطة"
|
| 272 |
+
|
| 273 |
+
#: includes/shrsb_analytics_page.php:15
|
| 274 |
+
msgid "Shareaholic Analtyics"
|
| 275 |
+
msgstr "محلل الروابط الجذابة"
|
| 276 |
+
|
| 277 |
+
#: includes/shrsb_analytics_page.php:21
|
| 278 |
+
msgid "Shareaholic Analtyics is coming!!!!"
|
| 279 |
+
msgstr "نسخة محلل الروابط الجذابة قادمة!!!"
|
| 280 |
+
|
| 281 |
+
#: includes/shrsb_analytics_page.php:24
|
| 282 |
+
msgid "Register your account today to recieve update info via email."
|
| 283 |
+
msgstr "قم بعملية تسجيل لحسابك اليوم لتستقبل معلومات حول تحديثات البرنامج عن طريق بريدك الإلكتروني."
|
| 284 |
+
|
| 285 |
+
#: includes/shrsb_analytics_page.php:26
|
| 286 |
+
#: includes/shrsb_authentication_page.php:66
|
| 287 |
+
msgid "Get Share Pro"
|
| 288 |
+
msgstr "احصل على النسخة الاحترافية"
|
| 289 |
+
|
| 290 |
+
#: includes/shrsb_analytics_page.php:42
|
| 291 |
+
#: includes/shrsb_authentication_page.php:107
|
| 292 |
+
msgid "Why Register ?"
|
| 293 |
+
msgstr "لماذا عملية تسجيل البرنامج ؟"
|
| 294 |
+
|
| 295 |
+
#: includes/shrsb_analytics_page.php:56
|
| 296 |
+
#: includes/shrsb_authentication_page.php:121
|
| 297 |
+
#: sexy-bookmarks.php:792
|
| 298 |
+
msgid "Helpful Plugin Links"
|
| 299 |
+
msgstr "روابط مفيدة لإضافات أخرى"
|
| 300 |
+
|
| 301 |
+
#: includes/shrsb_analytics_page.php:61
|
| 302 |
+
#: includes/shrsb_authentication_page.php:126
|
| 303 |
+
#: sexy-bookmarks.php:797
|
| 304 |
+
msgid "Installation & Usage Guide"
|
| 305 |
+
msgstr "تثبيت البرنامج ودليل الاستخدام"
|
| 306 |
+
|
| 307 |
+
#: includes/shrsb_analytics_page.php:62
|
| 308 |
+
#: includes/shrsb_authentication_page.php:127
|
| 309 |
+
#: sexy-bookmarks.php:798
|
| 310 |
+
msgid "Frequently Asked Questions"
|
| 311 |
+
msgstr "الأسئلة الشائعة"
|
| 312 |
+
|
| 313 |
+
#: includes/shrsb_analytics_page.php:63
|
| 314 |
+
#: includes/shrsb_authentication_page.php:128
|
| 315 |
+
#: sexy-bookmarks.php:799
|
| 316 |
+
msgid "Bug Submission Form"
|
| 317 |
+
msgstr "نموذج تقديم الأخطاء"
|
| 318 |
+
|
| 319 |
+
#: includes/shrsb_analytics_page.php:64
|
| 320 |
+
#: includes/shrsb_authentication_page.php:129
|
| 321 |
+
#: sexy-bookmarks.php:800
|
| 322 |
+
msgid "Feature Request Form"
|
| 323 |
+
msgstr "نموذج طلب ميزة"
|
| 324 |
+
|
| 325 |
+
#: includes/shrsb_analytics_page.php:65
|
| 326 |
+
#: includes/shrsb_authentication_page.php:130
|
| 327 |
+
#: sexy-bookmarks.php:801
|
| 328 |
+
msgid "Submit a Translation"
|
| 329 |
+
msgstr "أرسل ترجمة"
|
| 330 |
+
|
| 331 |
+
#: includes/shrsb_analytics_page.php:66
|
| 332 |
+
#: includes/shrsb_authentication_page.php:131
|
| 333 |
+
#: sexy-bookmarks.php:802
|
| 334 |
+
msgid "Shareaholic Browsers Add-ons"
|
| 335 |
+
msgstr "إضافة الروابط الجذابة الخاصة بالمتصفحات"
|
| 336 |
+
|
| 337 |
+
#: includes/shrsb_analytics_page.php:67
|
| 338 |
+
#: includes/shrsb_authentication_page.php:132
|
| 339 |
+
#: sexy-bookmarks.php:803
|
| 340 |
+
msgid "Thanks & Credits"
|
| 341 |
+
msgstr "صفحة المساهمين"
|
| 342 |
+
|
| 343 |
+
#: includes/public.php:375
|
| 344 |
+
msgid "An unknown error occurred in SexyBookmarks"
|
| 345 |
+
msgstr "حدث خطأ غير معروف في الروابط الجذابة"
|
| 346 |
+
|
| 347 |
+
#: includes/public.php:640
|
| 348 |
+
msgid "SexyBookmarks has been disabled on this page"
|
| 349 |
+
msgstr "الروابط الجذابة ستعرض على هذه الصفحة"
|
| 350 |
+
|
| 351 |
+
#: includes/shrsb_authentication_page.php:51
|
| 352 |
+
msgid "Shareaholic Pro"
|
| 353 |
+
msgstr "النسخة الاحترافية من الروابط الجذابة"
|
| 354 |
+
|
| 355 |
+
#: includes/shrsb_authentication_page.php:57
|
| 356 |
+
msgid "Shareaholic Professional is coming!!!!"
|
| 357 |
+
msgstr "الروابط الجذابة بنسختها الاحترافية قادمة!!!"
|
| 358 |
+
|
| 359 |
+
#: includes/shrsb_authentication_page.php:73
|
| 360 |
+
#: includes/shrsb_authentication_page.php:94
|
| 361 |
+
msgid "Authenticate"
|
| 362 |
+
msgstr "المصادقة"
|
| 363 |
+
|
| 364 |
+
#: includes/shrsb_authentication_page.php:79
|
| 365 |
+
msgid "Status"
|
| 366 |
+
msgstr "الحالة"
|
| 367 |
+
|
| 368 |
+
#: includes/shrsb_authentication_page.php:85
|
| 369 |
+
msgid "Authenticated"
|
| 370 |
+
msgstr "مصادق"
|
| 371 |
+
|
| 372 |
+
#: includes/shrsb_authentication_page.php:90
|
| 373 |
+
msgid "Enter the API key that you registered for your application."
|
| 374 |
+
msgstr "أدخل مفتاح الوصلة البينية البرمجية التطبيقية الذي حصلت عليه عند التسجيل لبرنامجك."
|
| 375 |
+
|
| 376 |
+
#: sexy-bookmarks.php:162
|
| 377 |
+
msgid "NOTICE: Shareaholic was just updated... Please visit the %sPlugin Options Page%s and re-save your preferences."
|
| 378 |
+
msgstr "ملاحظة: تم تحديث برنامج الروابط الجذابة... يرجى زيارة %sصفحة الإعدادات%s وقم بإعادة حفظ التفضيلات."
|
| 379 |
+
|
| 380 |
+
#: sexy-bookmarks.php:200
|
| 381 |
+
msgid "NOTICE: Shareaholic needs to be configured... Please visit the %sPlugin Options Page%s and set your preferences."
|
| 382 |
+
msgstr "ملاحظة: يجب عليك إعداد برنامج الروابط الجذابة!... يرجى زيارة %sصفحة الإعدادات%s وقم بتعديل الخيارات."
|
| 383 |
+
|
| 384 |
+
#: sexy-bookmarks.php:252
|
| 385 |
+
msgid "WARNING: You are about to reset all settings to their default state! Do you wish to continue?"
|
| 386 |
+
msgstr "تحذير: أنت على وشك استعادة جميع الإعدادات لحالتها الافتراضية! هل تريد المتابعة؟"
|
| 387 |
+
|
| 388 |
+
#: sexy-bookmarks.php:256
|
| 389 |
+
#: sexy-bookmarks.php:492
|
| 390 |
+
#: sexy-bookmarks.php:615
|
| 391 |
+
#: sexy-bookmarks.php:619
|
| 392 |
+
#: sexy-bookmarks.php:628
|
| 393 |
+
#: sexy-bookmarks.php:689
|
| 394 |
+
#: sexy-bookmarks.php:770
|
| 395 |
+
msgid "Yes"
|
| 396 |
+
msgstr "نعم"
|
| 397 |
+
|
| 398 |
+
#: sexy-bookmarks.php:256
|
| 399 |
+
msgid "Cancel"
|
| 400 |
+
msgstr "إلغاء"
|
| 401 |
+
|
| 402 |
+
#: sexy-bookmarks.php:296
|
| 403 |
+
msgid "All settings have been reset to their default values."
|
| 404 |
+
msgstr "تم استعادة جميع الإعدادات لقيمها الافتراضية."
|
| 405 |
+
|
| 406 |
+
#: sexy-bookmarks.php:340
|
| 407 |
+
msgid "Your changes have been saved successfully!"
|
| 408 |
+
msgstr "تم حفظ التغييرات بنجاح!"
|
| 409 |
+
|
| 410 |
+
#: sexy-bookmarks.php:343
|
| 411 |
+
msgid "Please choose where you would like the menu to be displayed."
|
| 412 |
+
msgstr "الرجاء قم باختيار إظهار القائمة بالمكان الذي ترغب به لعرضها."
|
| 413 |
+
|
| 414 |
+
#: sexy-bookmarks.php:344
|
| 415 |
+
msgid "You can't display the menu if you don't choose a few sites to add to it!"
|
| 416 |
+
msgstr "لا يمكنك عرض القائمة إذا لم تقم باختيار بعض المواقع لإضافتهم!"
|
| 417 |
+
|
| 418 |
+
#: sexy-bookmarks.php:345
|
| 419 |
+
msgid "Please choose where you want the menu displayed."
|
| 420 |
+
msgstr "الرجاء قم باختيار إظهار القائمة أينما تريد."
|
| 421 |
+
|
| 422 |
+
#: sexy-bookmarks.php:355
|
| 423 |
+
msgid "You must first download and activate the %sTwitter Friendly Links Plugin%s before hosting your own short URLs..."
|
| 424 |
+
msgstr "يجب عليك أولاً تحميل إضافة %sTwitter Friendly Links Plugin%s وتفعيلها قبل استضافة روابطك القصيرة..."
|
| 425 |
+
|
| 426 |
+
#: sexy-bookmarks.php:357
|
| 427 |
+
msgid "You must first download and activate the %sYOURLS Plugin%s before hosting your own short URLs..."
|
| 428 |
+
msgstr "يجب عليك أولاً تحميل إضافة %sYOURLS Plugin%s وتفعيلها قبل استضافة روابطك القصيرة..."
|
| 429 |
+
|
| 430 |
+
#: sexy-bookmarks.php:374
|
| 431 |
+
msgid "WARNING: The request for a custom sprite has timed out. Reverting to default sprite files."
|
| 432 |
+
msgstr "تحذير: انتهت مهلة طلب الصور (sprite) المخصصة. استرجاع ملفات الصور الافتراضية."
|
| 433 |
+
|
| 434 |
+
#: sexy-bookmarks.php:376
|
| 435 |
+
msgid "Changes saved successfully. However, you should try to generate a custom sprite again later."
|
| 436 |
+
msgstr "تم حفظ الإعدادات بنجاح. على أية حال، ينبغي عليك تجربة إنشاء صور مخصصة مرة أخرى لاحقاً."
|
| 437 |
+
|
| 438 |
+
#: sexy-bookmarks.php:380
|
| 439 |
+
#: sexy-bookmarks.php:402
|
| 440 |
+
msgid "WARNING: Your %sspritegen folder%s is not writeable by the server! %sNeed Help?%s"
|
| 441 |
+
msgstr "تحذير: مجلد %sspritegen folder%s غير قابل للكتابة على الخادم! %sهل تحتاج لمساعدة؟%s"
|
| 442 |
+
|
| 443 |
+
#: sexy-bookmarks.php:382
|
| 444 |
+
#: sexy-bookmarks.php:387
|
| 445 |
+
#: sexy-bookmarks.php:392
|
| 446 |
+
#: sexy-bookmarks.php:403
|
| 447 |
+
#: sexy-bookmarks.php:407
|
| 448 |
+
#: sexy-bookmarks.php:411
|
| 449 |
+
msgid "Changes saved successfully. However, settings are not optimal until you resolve the issue listed above."
|
| 450 |
+
msgstr "تم حفظ التغييرات بنجاح. لم يتم تغيير الإعدادات حتى تتم حل المشاكل المكتوبة أعلاه."
|
| 451 |
+
|
| 452 |
+
#: sexy-bookmarks.php:385
|
| 453 |
+
#: sexy-bookmarks.php:406
|
| 454 |
+
msgid "WARNING: You need to delete the current custom sprite %s before the plugin can write to the folder. %sNeed Help?%s"
|
| 455 |
+
msgstr "تحذير: تحتاج لحذف الصور المخصصة الحالية %s قبل أن تستطيع الإضافة التعديل على المجلد. %sهل تحتاج لمساعدة؟%s"
|
| 456 |
+
|
| 457 |
+
#: sexy-bookmarks.php:390
|
| 458 |
+
#: sexy-bookmarks.php:410
|
| 459 |
+
msgid "WARNING: You need to delete the current custom stylesheet %s before the plugin can write to the folder. %sNeed Help?%s"
|
| 460 |
+
msgstr "تحذير: تحتاج لحذف القالب المخصص الحالي %s قبل أن تستطيع الإضافة التعديل على المجلد. %sهل تحتاج لمساعدة؟%s"
|
| 461 |
+
|
| 462 |
+
#: sexy-bookmarks.php:485
|
| 463 |
+
msgid "Shareaholic for Publishers [BETA]"
|
| 464 |
+
msgstr "الروابط الجذابة للناشرين [تجريبي]"
|
| 465 |
+
|
| 466 |
+
#: sexy-bookmarks.php:490
|
| 467 |
+
msgid "We completely re-wrote Shareaholic from the ground up to make it faster, smarter, better. We wanted to remind you that we will be switching over everyone to this new version soon. If you haven't already, please try out this version now to make sure it is working properly for you."
|
| 468 |
+
msgstr "لقد قمنا بإعادة كتابة إضافة الروابط الجذابة من الألف إلى الياء لجعلها تعمل بشكل أسرع وأفضل وأصغر حجماً. سنقوم بتذكيرك بأننا سنقوم بالانتقال إلى النسخة الجديدة قريباً. إذا كنت غير جاهز، يرجى تجربة هذه النسخة الآن لنتأكد بأنها تعمل بشكل جيد من أجلك."
|
| 469 |
+
|
| 470 |
+
#: sexy-bookmarks.php:491
|
| 471 |
+
msgid "Use new version?"
|
| 472 |
+
msgstr "استخدام النسخة الجديدة؟"
|
| 473 |
+
|
| 474 |
+
#: sexy-bookmarks.php:493
|
| 475 |
+
#: sexy-bookmarks.php:616
|
| 476 |
+
#: sexy-bookmarks.php:620
|
| 477 |
+
#: sexy-bookmarks.php:624
|
| 478 |
+
#: sexy-bookmarks.php:629
|
| 479 |
+
#: sexy-bookmarks.php:633
|
| 480 |
+
#: sexy-bookmarks.php:690
|
| 481 |
+
#: sexy-bookmarks.php:694
|
| 482 |
+
#: sexy-bookmarks.php:771
|
| 483 |
+
msgid "No"
|
| 484 |
+
msgstr "لا"
|
| 485 |
+
|
| 486 |
+
#: sexy-bookmarks.php:494
|
| 487 |
+
msgid "You can switch back at any time."
|
| 488 |
+
msgstr "يمكنك الرجوع لاحقاً في أي وقت."
|
| 489 |
+
|
| 490 |
+
#: sexy-bookmarks.php:498
|
| 491 |
+
msgid "**BONUS** You have been selected to preview our upcoming premium analytics add-on for a limited time for FREE. <b>%sFollow this link%s to keep on top of how your content is being shared!</b>"
|
| 492 |
+
msgstr "**إضافة** لقد تم اختيارك لمشاهدة إضافة التحليل الاحترافية الخاصة بنا لوقت محدود مجاناً. <b>%sاتبع هذا الرابط%s للاحتفاظ بمواضيع موقعك!</b>"
|
| 493 |
+
|
| 494 |
+
#: sexy-bookmarks.php:498
|
| 495 |
+
msgid "We are anxious to hear what you think. Please follow %sthis link%s to share your feedback with us!"
|
| 496 |
+
msgstr "نهتم بسماع آرائكم، إذا كنت تريد ترك تعليق، رجاء اتبع %sهذا الرابط%s لنتبادل الأفكار والآراء معاً."
|
| 497 |
+
|
| 498 |
+
#: sexy-bookmarks.php:505
|
| 499 |
+
msgid "Enabled Networks"
|
| 500 |
+
msgstr "الشبكات الاجتماعية المتوفرة"
|
| 501 |
+
|
| 502 |
+
#: sexy-bookmarks.php:509
|
| 503 |
+
msgid "Select the Networks to display. Drag to reorder."
|
| 504 |
+
msgstr "حدد الشبكات الاجتماعية لعرضها. اسحبها لإعادة الترتيب."
|
| 505 |
+
|
| 506 |
+
#: sexy-bookmarks.php:511
|
| 507 |
+
msgid "Select"
|
| 508 |
+
msgstr "حدد"
|
| 509 |
+
|
| 510 |
+
#: sexy-bookmarks.php:512
|
| 511 |
+
msgid "All"
|
| 512 |
+
msgstr "الكل"
|
| 513 |
+
|
| 514 |
+
#: sexy-bookmarks.php:513
|
| 515 |
+
msgid "None"
|
| 516 |
+
msgstr "بدون"
|
| 517 |
+
|
| 518 |
+
#: sexy-bookmarks.php:514
|
| 519 |
+
msgid "Most Popular"
|
| 520 |
+
msgstr "الأكثر شعبية"
|
| 521 |
+
|
| 522 |
+
#: sexy-bookmarks.php:524
|
| 523 |
+
msgid "Made with Much Love, these Icons are © Shareaholic"
|
| 524 |
+
msgstr "هذه الأيقونات محمية بموجب قانون حقوق الطبع والنشر من شركة Shareaholic"
|
| 525 |
+
|
| 526 |
+
#: sexy-bookmarks.php:529
|
| 527 |
+
msgid "Functionality Settings"
|
| 528 |
+
msgstr "إعدادات الوظائف"
|
| 529 |
+
|
| 530 |
+
#: sexy-bookmarks.php:535
|
| 531 |
+
msgid "Twitter Options:"
|
| 532 |
+
msgstr "خيارات تويتر:"
|
| 533 |
+
|
| 534 |
+
#: sexy-bookmarks.php:537
|
| 535 |
+
msgid "Configuration Instructions:"
|
| 536 |
+
msgstr "تعليمات الإعدادات:"
|
| 537 |
+
|
| 538 |
+
#: sexy-bookmarks.php:538
|
| 539 |
+
msgid "Using the strings %s and %s you can fully customize your tweet output."
|
| 540 |
+
msgstr "استخدم القيمة %s و %s يمكنك من تخصيص ناتج التويتر."
|
| 541 |
+
|
| 542 |
+
#: sexy-bookmarks.php:539
|
| 543 |
+
msgid "Example Configurations:"
|
| 544 |
+
msgstr "أمثلة عن الإعدادات:"
|
| 545 |
+
|
| 546 |
+
#: sexy-bookmarks.php:541
|
| 547 |
+
msgid "or"
|
| 548 |
+
msgstr "أو"
|
| 549 |
+
|
| 550 |
+
#: sexy-bookmarks.php:545
|
| 551 |
+
msgid "Configure Custom Tweet Template:"
|
| 552 |
+
msgstr "إعداد قالب مخصص لتويتر:"
|
| 553 |
+
|
| 554 |
+
#: sexy-bookmarks.php:545
|
| 555 |
+
msgid "Characters:"
|
| 556 |
+
msgstr "الأحرف:"
|
| 557 |
+
|
| 558 |
+
#: sexy-bookmarks.php:548
|
| 559 |
+
msgid "Example Tweet Output:"
|
| 560 |
+
msgstr "مثال عن ناتج التويتر:"
|
| 561 |
+
|
| 562 |
+
#: sexy-bookmarks.php:550
|
| 563 |
+
msgid "Which URL Shortener?"
|
| 564 |
+
msgstr "أي الروابط أقصر؟"
|
| 565 |
+
|
| 566 |
+
#: sexy-bookmarks.php:555
|
| 567 |
+
msgid "Don't use a shortener"
|
| 568 |
+
msgstr "لا تستخدم الروابط القصيرة"
|
| 569 |
+
|
| 570 |
+
#: sexy-bookmarks.php:569
|
| 571 |
+
#: sexy-bookmarks.php:578
|
| 572 |
+
#: sexy-bookmarks.php:591
|
| 573 |
+
#: sexy-bookmarks.php:603
|
| 574 |
+
msgid "User ID:"
|
| 575 |
+
msgstr "رقم الحساب:"
|
| 576 |
+
|
| 577 |
+
#: sexy-bookmarks.php:571
|
| 578 |
+
#: sexy-bookmarks.php:580
|
| 579 |
+
#: sexy-bookmarks.php:605
|
| 580 |
+
msgid "API Key:"
|
| 581 |
+
msgstr "مفتاح الوصلة البينية البرمجية التطبيقية:"
|
| 582 |
+
|
| 583 |
+
#: sexy-bookmarks.php:587
|
| 584 |
+
#: sexy-bookmarks.php:599
|
| 585 |
+
msgid "Track Generated Links?"
|
| 586 |
+
msgstr "تتبع الروابط المولدة؟"
|
| 587 |
+
|
| 588 |
+
#: sexy-bookmarks.php:593
|
| 589 |
+
msgid "Password:"
|
| 590 |
+
msgstr "كلمة المرور:"
|
| 591 |
+
|
| 592 |
+
#: sexy-bookmarks.php:612
|
| 593 |
+
msgid "General Functionality Options:"
|
| 594 |
+
msgstr "خيارات الأداء الوظيفي العام:"
|
| 595 |
+
|
| 596 |
+
#: sexy-bookmarks.php:614
|
| 597 |
+
msgid "Add nofollow to the links?"
|
| 598 |
+
msgstr "إضافة عدم التتبع للروابط؟"
|
| 599 |
+
|
| 600 |
+
#: sexy-bookmarks.php:618
|
| 601 |
+
msgid "Open links in new window?"
|
| 602 |
+
msgstr "فتح الروابط في نافذة جديدة؟"
|
| 603 |
+
|
| 604 |
+
#: sexy-bookmarks.php:622
|
| 605 |
+
msgid "Show Share Counters for Facebook, Twitter and Delicious?"
|
| 606 |
+
msgstr "إظهار عداد المشاركة للفيس بوك وتويتر و Delicious؟ "
|
| 607 |
+
|
| 608 |
+
#: sexy-bookmarks.php:623
|
| 609 |
+
#: sexy-bookmarks.php:632
|
| 610 |
+
msgid "Yes (recommended)"
|
| 611 |
+
msgstr "نعم (مستحسن)"
|
| 612 |
+
|
| 613 |
+
#: sexy-bookmarks.php:625
|
| 614 |
+
msgid "(beta-mode exclusive feature)"
|
| 615 |
+
msgstr "(ميزة حصرية - وضع تجريبي)"
|
| 616 |
+
|
| 617 |
+
#: sexy-bookmarks.php:627
|
| 618 |
+
msgid "Show Shareaholic Link?"
|
| 619 |
+
msgstr "إظهار إعلان شركة Shareaholic أسفل شريط الروابط الجذابة؟"
|
| 620 |
+
|
| 621 |
+
#: sexy-bookmarks.php:631
|
| 622 |
+
msgid "Track Performance?"
|
| 623 |
+
msgstr "تتبع الأداء؟"
|
| 624 |
+
|
| 625 |
+
#: sexy-bookmarks.php:640
|
| 626 |
+
msgid "Plugin Aesthetics"
|
| 627 |
+
msgstr "تخصيص جمالية الإضافة"
|
| 628 |
+
|
| 629 |
+
#: sexy-bookmarks.php:645
|
| 630 |
+
msgid "Warning!"
|
| 631 |
+
msgstr "تحذير!"
|
| 632 |
+
|
| 633 |
+
#: sexy-bookmarks.php:646
|
| 634 |
+
msgid "This option is intended %STRICTLY%s for users who understand how to edit CSS/JS and intend to change/edit the associated images themselves. Unfortunately, no support will be offered for this feature, as I cannot be held accountable for your coding and/or image editing mistakes."
|
| 635 |
+
msgstr "المقصود من هذا الخيار هو كيفية التعديل على ملف تنسيق الستايل والجافا سكريبت الموجود ضمن الإضافة، لسوء الحظ إذا واجهتك أية مشكلة في تطبيق هذا الخيار فنحن غير قادرين على دعمك بعد تغيير الصور والتنسيق. ولا نتحمل أي مسؤولية عن خطأ في الترميز أو في تحرير الصور."
|
| 636 |
+
|
| 637 |
+
#: sexy-bookmarks.php:647
|
| 638 |
+
msgid "How it works..."
|
| 639 |
+
msgstr "كيف تعمل..."
|
| 640 |
+
|
| 641 |
+
#: sexy-bookmarks.php:648
|
| 642 |
+
msgid "Since you have chosen for the plugin to override the style settings with your own custom mods, it will now pull the files from the new folders it is going to create on your server as soon as you save your changes. The file/folder locations should be as follows:"
|
| 643 |
+
msgstr "عند اختيارك لخيار \"تجاوز أنماط التنسيق مع تخصيص نمط بدلاً منه\" من القائمة فسيتم سحب الملفات من المجلدات الجديدة التي ستنشأ على الخادم الخاص بك عند حفظ التغييرات. ستظهر الملفات والمجلدات بالشكل التالي:"
|
| 644 |
+
|
| 645 |
+
#: sexy-bookmarks.php:665
|
| 646 |
+
msgid "Once you have saved your changes, you will be able to edit the image sprite that holds all of the icons for Shareaholic as well as the CSS which accompanies it. Just be sure that you do in fact edit the CSS if you edit the images, as it is unlikely the heights, widths, and background positions of the images will stay the same after you are done."
|
| 647 |
+
msgstr "وبمجرد الانتهاء من حفظ التغييرات الخاصة بك، ستصبح قادراً على تحرير ملف صورة sprite التي بداخلها جميع أيقونات برنامج الروابط الجذابة. تأكد فقط من تغيير الخيارات المناسبة في ملف CSS الجديد مثل ارتفاع وعرض الصور ومكان توضع الصورة."
|
| 648 |
+
|
| 649 |
+
#: sexy-bookmarks.php:666
|
| 650 |
+
msgid "Just a quick note... When you edit the styles and images to include your own custom backgrounds, icons, and CSS styles, be aware that those changes will not be reflected on the plugin options page. In other words: when you select your networks to be displayed, or when you select the background image to use, it will still be displaying the images from the original plugin directory."
|
| 651 |
+
msgstr "مجرد ملاحظة سريعة... عند تحرير الأنماط والصور لتشمل الخلفيات المخصصة الخاصة بك، فهذا لن يؤثر على صفحة إعدادات البرنامج. وبعبارة أخرى: عند تحديد الشبكات الاجتماعية الخاصة بك ليتم عرضها أو عند تحديد صورة جانبية، فستبقى الصور الأصلية تعرض من المجلد الأصلي."
|
| 652 |
+
|
| 653 |
+
#: sexy-bookmarks.php:667
|
| 654 |
+
msgid "In Case of Emergency"
|
| 655 |
+
msgstr "في حالة الطوارئ"
|
| 656 |
+
|
| 657 |
+
#: sexy-bookmarks.php:668
|
| 658 |
+
msgid "If you happen to mess things up, you can follow these directions to reset the plugin back to normal and try again if you wish:"
|
| 659 |
+
msgstr "في حال بقيت المشكلة قائمة، فيمكنك اتباع الخطوات التالية لاستعادة الافتراضيات للبرنامج والعودة لطبيعته. بعدها حاول مرة أخرى إذا كنت ترغب بذلك:"
|
| 660 |
+
|
| 661 |
+
#: sexy-bookmarks.php:670
|
| 662 |
+
msgid "Login to your server via FTP or SSH. (whichever you are more comfortable with)"
|
| 663 |
+
msgstr "سجل دخولك إلى الخادم المضيف لموقعك عن طريق حساب FTP أو غيره"
|
| 664 |
+
|
| 665 |
+
#: sexy-bookmarks.php:671
|
| 666 |
+
msgid "Navigate to your wp-content directory."
|
| 667 |
+
msgstr "توجه إلى مجلد wp-content داخل مجلد الووردبريس."
|
| 668 |
+
|
| 669 |
+
#: sexy-bookmarks.php:672
|
| 670 |
+
msgid "Delete the directory named \"sexy-mods\"."
|
| 671 |
+
msgstr "احذف مجلد \"sexy-mods\"."
|
| 672 |
+
|
| 673 |
+
#: sexy-bookmarks.php:673
|
| 674 |
+
msgid "Login to your WordPress dashboard."
|
| 675 |
+
msgstr "سجل الدخول لحسابك في ووردبريس."
|
| 676 |
+
|
| 677 |
+
#: sexy-bookmarks.php:674
|
| 678 |
+
msgid "Go to the SexyBookmarks plugin options page. (Settings->SexyBookmarks)"
|
| 679 |
+
msgstr "اذهب بعدها لصفحة إعدادات البرنامج في موقعك. (إعدادات->SexyBookmarks) "
|
| 680 |
+
|
| 681 |
+
#: sexy-bookmarks.php:675
|
| 682 |
+
msgid "Deselect the \"Use custom mods\" option."
|
| 683 |
+
msgstr "قم بإلغاء تحديد الخيار: \"تجاوز أنماط التنسيق مع تخصيص نمط بدلاً منه\"."
|
| 684 |
+
|
| 685 |
+
#: sexy-bookmarks.php:676
|
| 686 |
+
msgid "Save your changes."
|
| 687 |
+
msgstr "احفظ التغييرات."
|
| 688 |
+
|
| 689 |
+
#: sexy-bookmarks.php:678
|
| 690 |
+
msgid "Close Message"
|
| 691 |
+
msgstr "أغلق الرسالة"
|
| 692 |
+
|
| 693 |
+
#: sexy-bookmarks.php:682
|
| 694 |
+
msgid "Override Styles With Custom Mods Instead?"
|
| 695 |
+
msgstr "تجاوز أنماط التنسيق مع تخصيص نمط بدلاً منه؟"
|
| 696 |
+
|
| 697 |
+
#: sexy-bookmarks.php:687
|
| 698 |
+
msgid "jQuery Related Options"
|
| 699 |
+
msgstr "الخيارات المتعلقة بمكتبة jQuery"
|
| 700 |
+
|
| 701 |
+
#: sexy-bookmarks.php:688
|
| 702 |
+
msgid "Animate-expand multi-lined bookmarks?"
|
| 703 |
+
msgstr "تنشيط وتوسيع الأسطر المتعددة للروابط؟"
|
| 704 |
+
|
| 705 |
+
#: sexy-bookmarks.php:691
|
| 706 |
+
msgid "Auto-space/center the bookmarks?"
|
| 707 |
+
msgstr "مسافة تلقائية / توسيط الروابط؟"
|
| 708 |
+
|
| 709 |
+
#: sexy-bookmarks.php:692
|
| 710 |
+
msgid "Space"
|
| 711 |
+
msgstr "مسافة"
|
| 712 |
+
|
| 713 |
+
#: sexy-bookmarks.php:693
|
| 714 |
+
msgid "Center"
|
| 715 |
+
msgstr "وسط"
|
| 716 |
+
|
| 717 |
+
#: sexy-bookmarks.php:695
|
| 718 |
+
msgid "jQuery Compatibility Fix"
|
| 719 |
+
msgstr "تصحيح توافقية مكتبة jQuery"
|
| 720 |
+
|
| 721 |
+
#: sexy-bookmarks.php:696
|
| 722 |
+
msgid "Check this box ONLY if you notice jQuery being loaded twice in your source code!"
|
| 723 |
+
msgstr "حدد هذا الخيار عندما تلاحظ أن مكتبة jQuery قد حملت مرتين في كود المصدر!"
|
| 724 |
+
|
| 725 |
+
#: sexy-bookmarks.php:698
|
| 726 |
+
msgid "Load scripts in Footer"
|
| 727 |
+
msgstr "تحميل السكريبت في أسفل الصفحة"
|
| 728 |
+
|
| 729 |
+
#: sexy-bookmarks.php:699
|
| 730 |
+
msgid "Check this box if you want the SexyBookmarks javascript to be loaded in your blog's footer."
|
| 731 |
+
msgstr "حدد هذا المربع إذا كنت تريد تحميل الجافا سكريبت في فوتر موقعك."
|
| 732 |
+
|
| 733 |
+
#: sexy-bookmarks.php:701
|
| 734 |
+
msgid "Background Image Options"
|
| 735 |
+
msgstr "خيارات صورة الخلفية"
|
| 736 |
+
|
| 737 |
+
#: sexy-bookmarks.php:703
|
| 738 |
+
msgid "Use a background image?"
|
| 739 |
+
msgstr "استخدام صورة خلفية؟"
|
| 740 |
+
|
| 741 |
+
#: sexy-bookmarks.php:736
|
| 742 |
+
msgid "Menu Placement"
|
| 743 |
+
msgstr "مكان القائمة"
|
| 744 |
+
|
| 745 |
+
#: sexy-bookmarks.php:742
|
| 746 |
+
msgid "Need help with this? Find it in the %sofficial install guide%s."
|
| 747 |
+
msgstr "تريد مساعدة في ذلك؟ ابحث عنها في %sofficial install guide%s."
|
| 748 |
+
|
| 749 |
+
#: sexy-bookmarks.php:748
|
| 750 |
+
msgid "Menu Location (in relation to content):"
|
| 751 |
+
msgstr "مكان القائمة (كيفية ظهور قائمة الروابط في الموضوع):"
|
| 752 |
+
|
| 753 |
+
#: sexy-bookmarks.php:749
|
| 754 |
+
msgid "Above Content"
|
| 755 |
+
msgstr "أعلى الموضوع"
|
| 756 |
+
|
| 757 |
+
#: sexy-bookmarks.php:750
|
| 758 |
+
msgid "Below Content"
|
| 759 |
+
msgstr "أسفل الموضوع"
|
| 760 |
+
|
| 761 |
+
#: sexy-bookmarks.php:751
|
| 762 |
+
msgid "Above & Below Content"
|
| 763 |
+
msgstr "أعلى وأسفل المواضيع"
|
| 764 |
+
|
| 765 |
+
#: sexy-bookmarks.php:752
|
| 766 |
+
msgid "Manual Mode"
|
| 767 |
+
msgstr "الإعداد اليدوي"
|
| 768 |
+
|
| 769 |
+
#: sexy-bookmarks.php:753
|
| 770 |
+
msgid "Posts, pages, or the whole shebang?"
|
| 771 |
+
msgstr "المواضيع، الصفحات، أو في كل مكان؟"
|
| 772 |
+
|
| 773 |
+
#: sexy-bookmarks.php:758
|
| 774 |
+
msgid "Posts Only"
|
| 775 |
+
msgstr "المواضيع فقط"
|
| 776 |
+
|
| 777 |
+
#: sexy-bookmarks.php:759
|
| 778 |
+
msgid "Pages Only"
|
| 779 |
+
msgstr "الصفحات فقط"
|
| 780 |
+
|
| 781 |
+
#: sexy-bookmarks.php:760
|
| 782 |
+
msgid "Index Only"
|
| 783 |
+
msgstr "الصفحة الرئيسية فقط"
|
| 784 |
+
|
| 785 |
+
#: sexy-bookmarks.php:761
|
| 786 |
+
msgid "Posts & Pages"
|
| 787 |
+
msgstr "المواضيع & الصفحات"
|
| 788 |
+
|
| 789 |
+
#: sexy-bookmarks.php:762
|
| 790 |
+
msgid "Posts & Index"
|
| 791 |
+
msgstr "المواضيع & الصفحة الرئيسية"
|
| 792 |
+
|
| 793 |
+
#: sexy-bookmarks.php:763
|
| 794 |
+
msgid "Pages & Index"
|
| 795 |
+
msgstr "الصفحات & الصفحة الرئيسية"
|
| 796 |
+
|
| 797 |
+
#: sexy-bookmarks.php:764
|
| 798 |
+
msgid "Posts, Pages, & Index"
|
| 799 |
+
msgstr "المواضيع، الصفحات & الصفحة الرئيسية"
|
| 800 |
+
|
| 801 |
+
#: sexy-bookmarks.php:768
|
| 802 |
+
msgid "Click here for help with this option"
|
| 803 |
+
msgstr "اضغط هنا للحصول على المساعدة على هذا الخيار"
|
| 804 |
+
|
| 805 |
+
#: sexy-bookmarks.php:769
|
| 806 |
+
msgid "Show in RSS feed?"
|
| 807 |
+
msgstr "عرض في خلاصات المواضيع؟"
|
| 808 |
+
|
| 809 |
+
#: sexy-bookmarks.php:773
|
| 810 |
+
msgid "Hide menu from mobile browsers?"
|
| 811 |
+
msgstr "إخفاء القائمة من متصفحات الجوال؟"
|
| 812 |
+
|
| 813 |
+
#: sexy-bookmarks.php:782
|
| 814 |
+
msgid "Save Changes"
|
| 815 |
+
msgstr "حفظ التغييرات"
|
| 816 |
+
|
| 817 |
+
#: sexy-bookmarks.php:786
|
| 818 |
+
msgid "Reset Settings"
|
| 819 |
+
msgstr "استعادة الإعدادات"
|
| 820 |
+
|
| 821 |
+
#: sexy-bookmarks.php:837
|
| 822 |
+
msgid "Shareaholic for Publishers"
|
| 823 |
+
msgstr "الروابط الجذابة للناشرين"
|
| 824 |
+
|
| 825 |
+
#: sexy-bookmarks.php:837
|
| 826 |
+
msgid "Shareaholic"
|
| 827 |
+
msgstr "الروابط الجذابة"
|
| 828 |
+
|
| 829 |
+
#: sexy-bookmarks.php:840
|
| 830 |
+
msgid "SexyBookmarks"
|
| 831 |
+
msgstr "إعدادات الروابط الجذابة"
|
| 832 |
+
|
| 833 |
+
#: sexy-bookmarks.php:886
|
| 834 |
+
msgid "Settings"
|
| 835 |
+
msgstr "إعدادات"
|
| 836 |
+
|
| 837 |
+
#~ msgid "Short URL(s) have been reset."
|
| 838 |
+
#~ msgstr " تم تصفير الروابط القصيرة."
|
| 839 |
+
|
| 840 |
+
#~ msgid "BETA Testing"
|
| 841 |
+
#~ msgstr "اختبار النسخة التجريبية"
|
| 842 |
+
|
| 843 |
+
#~ msgid ""
|
| 844 |
+
#~ "We completely re-wrote Shareaholic from the ground up to make it faster, "
|
| 845 |
+
#~ "leaner, better."
|
| 846 |
+
#~ msgstr ""
|
| 847 |
+
#~ "لقد قمنا بإعادة كتابة إضافة الروابط الجذابة من الألف إلى الياء لجعلها "
|
| 848 |
+
#~ "تعمل بشكل أسرع وأفضل وأصغر حجماً."
|
| 849 |
+
|
| 850 |
+
#~ msgid ""
|
| 851 |
+
#~ "This will clear %sALL%s short URLs. - Are you sure? Note: you will also "
|
| 852 |
+
#~ "need to \"Save Changes\" to complete the reset."
|
| 853 |
+
#~ msgstr ""
|
| 854 |
+
#~ "سوف يتم حذف %sجميع%s الروابط القصيرة. - هل أنت متأكد؟ ملاحظة: ستحتاج أيضاً "
|
| 855 |
+
#~ "\"لحفظ التغييرات\" لإنهاء الاستعادة."
|
| 856 |
+
|
| 857 |
+
#~ msgid "Reset all Short URLs"
|
| 858 |
+
#~ msgstr "تصفير جميع الروابط"
|
| 859 |
+
|
| 860 |
+
#~ msgid "SexyBookmarks (by Shareaholic)"
|
| 861 |
+
#~ msgstr "الروابط الجذابة (بواسطة مضر صوص)"
|
| 862 |
+
|
| 863 |
+
#~ msgid "Buzz up!"
|
| 864 |
+
#~ msgstr "انشرها على صدى غوغل!"
|
| 865 |
+
|
| 866 |
+
#~ msgid "Yahoo! Buzz Defaults:"
|
| 867 |
+
#~ msgstr "افتراضيات صدى ياهو:"
|
| 868 |
+
|
| 869 |
+
#~ msgid "Default Content Category:"
|
| 870 |
+
#~ msgstr "تصنيف المحتويات الافتراضي:"
|
| 871 |
+
|
| 872 |
+
#~ msgid "Default Media Type:"
|
| 873 |
+
#~ msgstr "نوع الميديا الافتراضي:"
|
| 874 |
+
|
| 875 |
+
#~ msgid "Twittley Defaults:"
|
| 876 |
+
#~ msgstr "افتراضيات تويتر:"
|
| 877 |
+
|
| 878 |
+
#~ msgid "Primary Content Category:"
|
| 879 |
+
#~ msgstr "تصنيف المحتويات الرئيسي"
|
| 880 |
+
|
| 881 |
+
#~ msgid "Technology"
|
| 882 |
+
#~ msgstr "تكنولوجيا"
|
| 883 |
+
|
| 884 |
+
#~ msgid "World & Business"
|
| 885 |
+
#~ msgstr "العالم & تجارة"
|
| 886 |
+
|
| 887 |
+
#~ msgid "Science"
|
| 888 |
+
#~ msgstr "علوم"
|
| 889 |
+
|
| 890 |
+
#~ msgid "Gaming"
|
| 891 |
+
#~ msgstr "ألعاب"
|
| 892 |
+
|
| 893 |
+
#~ msgid "Lifestyle"
|
| 894 |
+
#~ msgstr "أسلوب حياة"
|
| 895 |
+
|
| 896 |
+
#~ msgid "Entertainment"
|
| 897 |
+
#~ msgstr "تسلية"
|
| 898 |
+
|
| 899 |
+
#~ msgid "Sports"
|
| 900 |
+
#~ msgstr "رياضة"
|
| 901 |
+
|
| 902 |
+
#~ msgid "Offbeat"
|
| 903 |
+
#~ msgstr "شاذ"
|
| 904 |
+
|
| 905 |
+
#~ msgid "Internet"
|
| 906 |
+
#~ msgstr "انترنت"
|
| 907 |
+
|
| 908 |
+
#~ msgid "Click here to close this message"
|
| 909 |
+
#~ msgstr "اضغط هنا لإغلاق هذه الرسالة"
|
| 910 |
+
|
| 911 |
+
#~ msgid "close"
|
| 912 |
+
#~ msgstr "إغلاق"
|
| 913 |
+
|
| 914 |
+
#~ msgid "Default Tags:"
|
| 915 |
+
#~ msgstr "أوسمة افتراضية:"
|
| 916 |
+
|
| 917 |
+
#~ msgid "(sent via shareaholic)"
|
| 918 |
+
#~ msgstr "(أرسلت بواسطة الموقع)"
|
| 919 |
+
|
| 920 |
+
#~ msgid "(sent via http://shareaholic.com)"
|
| 921 |
+
#~ msgstr "(أرسلت بواسطة الموقع)"
|
| 922 |
+
|
| 923 |
+
#~ msgid "Maybe you would consider "
|
| 924 |
+
#~ msgstr "ربما سيتوجب عليك الانتظار"
|
| 925 |
+
|
| 926 |
+
#~ msgid "donating"
|
| 927 |
+
#~ msgstr "التبرع"
|
| 928 |
+
|
| 929 |
+
#~ msgid "You must first download and activate the"
|
| 930 |
+
#~ msgstr "يجب عليك أولاً تحميل وتفعيل"
|
| 931 |
+
|
| 932 |
+
#~ msgid "Twitter Friendly Links Plugin"
|
| 933 |
+
#~ msgstr "إضافة الروابط الصديقة لتويتر"
|
| 934 |
+
|
| 935 |
+
#~ msgid "before hosting your own short URLs..."
|
| 936 |
+
#~ msgstr "قبل استضافة روابطك القصيرة..."
|
| 937 |
+
|
| 938 |
+
#~ msgid "You May Also Like:"
|
| 939 |
+
#~ msgstr "قد تحب أيضاً:"
|
| 940 |
+
|
| 941 |
+
#~ msgid ""
|
| 942 |
+
#~ "Get Shareaholic / SexyBookmarks for your web browser (Firefox, Google "
|
| 943 |
+
#~ "Chrome, etc)."
|
| 944 |
+
#~ msgstr ""
|
| 945 |
+
#~ "احصل على شريط الأدوات / الروابط الجذابة لمتصفحك (فايرفوكس, غوغل كروم, "
|
| 946 |
+
#~ "الخ)."
|
| 947 |
+
|
| 948 |
+
#~ msgid "Learn more | Download"
|
| 949 |
+
#~ msgstr "معلومات أكثر | تحميل"
|
| 950 |
+
|
| 951 |
+
#~ msgid "This option is intended "
|
| 952 |
+
#~ msgstr "القصد من هذا الخيار"
|
| 953 |
+
|
| 954 |
+
#~ msgid "STRICTLY"
|
| 955 |
+
#~ msgstr " الالتزام "
|
| 956 |
+
|
| 957 |
+
#~ msgid ""
|
| 958 |
+
#~ " for users who understand how to edit CSS/JS and intend to change/edit "
|
| 959 |
+
#~ "the associated images themselves. No support will be offered for this "
|
| 960 |
+
#~ "feature, as I cannot be held accountable for your coding/image-editing "
|
| 961 |
+
#~ "mistakes. Furthermore, this feature was implemented as a favor to the "
|
| 962 |
+
#~ "thousands of you who asked for such a feature, and as such, I would "
|
| 963 |
+
#~ "appreciate it if you could refrain from sending nasty emails when you "
|
| 964 |
+
#~ "break the plugin due to coding errors of your own."
|
| 965 |
+
#~ msgstr ""
|
| 966 |
+
#~ "بالنسبة للمستخدمين الذين يفهمون كيفية تحرير ملفات التنسيق CSS/JS وتحريرها "
|
| 967 |
+
#~ "بالنسبة للقالب الذين يستخدمونه. ولم يتم تقديم أي دعم لهذه الميزة حيث أني "
|
| 968 |
+
#~ "لا أتحمل المسؤولية من حدوث أخطاء نتيجة لتحرير خاطئ للصور. على جميع "
|
| 969 |
+
#~ "الأحوال تم تطبيق هذه الميزة لمصلحة الآلاف الذين يستخدمون هذا البرنامج، "
|
| 970 |
+
#~ "وعلى هذا النحو سوف أكون ممتناً لو امتنعتم بمراسلتي وطلب الدعم بسبب أخطاء "
|
| 971 |
+
#~ "الترميز الخاصة بكم."
|
| 972 |
+
|
| 973 |
+
#~ msgid "official install guide"
|
| 974 |
+
#~ msgstr "دليل استخدام التثبيت"
|
| 975 |
+
|
| 976 |
+
#~ msgid "This feature is still in the experimental phase, so please "
|
| 977 |
+
#~ msgstr "هذه الميزة لا تزال في مرحلة تجريبية، لذا يرجى"
|
| 978 |
+
|
| 979 |
+
#~ msgid "report any bugs"
|
| 980 |
+
#~ msgstr "أرسل تقرير عن أي خطأ"
|
| 981 |
+
|
| 982 |
+
#~ msgid "you may find"
|
| 983 |
+
#~ msgstr "سوف تجد"
|
| 984 |
+
|
| 985 |
+
#~ msgid "Support by Donating"
|
| 986 |
+
#~ msgstr "الدعم عن طريق التبرع"
|
| 987 |
+
|
| 988 |
+
#~ msgid ""
|
| 989 |
+
#~ "If you like SexyBookmarks and wish to contribute towards it's continued "
|
| 990 |
+
#~ "development, you can use the form below to do so."
|
| 991 |
+
#~ msgstr ""
|
| 992 |
+
#~ "إذا أعجبك برنامج الروابط الجذابة وتريد المساهمة في تطوير البرنامج، يمكنك "
|
| 993 |
+
#~ "ذلك عن طريق استخدام النموذج في الأسفل لتقوم بالتبرع."
|
| 994 |
+
|
| 995 |
+
#~ msgid "SexyBookmarks Development Support"
|
| 996 |
+
#~ msgstr "دعم تطوير البرنامج"
|
| 997 |
+
|
| 998 |
+
#~ msgid "Return to Your Dashboard"
|
| 999 |
+
#~ msgstr "الرجوع إلى الصفحة الرئيسية"
|
| 1000 |
+
|
| 1001 |
+
#~ msgid "Select Preset Amount? "
|
| 1002 |
+
#~ msgstr "تحديد مبلغ من القائمة؟"
|
| 1003 |
+
|
| 1004 |
+
#~ msgid "Enter Custom Amount?"
|
| 1005 |
+
#~ msgstr "ادخال مبلغ مخصص؟"
|
| 1006 |
+
|
| 1007 |
+
#~ msgid "Disable sponsor messages?"
|
| 1008 |
+
#~ msgstr "تعطيل رسائل الرعاة؟"
|
| 1009 |
+
|
| 1010 |
+
#~ msgid "Shout-Outs"
|
| 1011 |
+
#~ msgstr "نشكر أيضاً على تجربة البرنامج"
|
| 1012 |
+
|
| 1013 |
+
#~ msgid "Translation Contributors"
|
| 1014 |
+
#~ msgstr "المساهمون في الترجمة"
|
| 1015 |
+
|
| 1016 |
+
#~ msgid "RU Translation: Yuri Gribov"
|
| 1017 |
+
#~ msgstr "الترجمة الروسية: Yuri Gribov"
|
| 1018 |
+
|
| 1019 |
+
#~ msgid "FR Translation: Maitre Mo"
|
| 1020 |
+
#~ msgstr "الترجمة الفرنسية: Maitre Mo"
|
| 1021 |
+
|
| 1022 |
+
#~ msgid "RO Translation: Ghenciu Ciprian"
|
| 1023 |
+
#~ msgstr "الترجمة الرومانية: Ghenciu Ciprian"
|
| 1024 |
+
|
| 1025 |
+
#~ msgid "IT Translation: Carlo Veltri"
|
| 1026 |
+
#~ msgstr "الترجمة الإيطالية: Carlo Veltri"
|
| 1027 |
+
|
| 1028 |
+
#~ msgid "ES Translation: Javier Pimienta"
|
| 1029 |
+
#~ msgstr "الترجمة الإستونية: Javier Pimienta"
|
| 1030 |
+
|
| 1031 |
+
#~ msgid "CN Translation: Joojen"
|
| 1032 |
+
#~ msgstr "الترجمة الصينية: Joojen"
|
| 1033 |
+
|
| 1034 |
+
#~ msgid "IT Translation: Giovanni Zuccaro"
|
| 1035 |
+
#~ msgstr "الترجمة الإيطالية: Giovanni Zuccaro"
|
| 1036 |
+
|
| 1037 |
+
#~ msgid "TR Translation: Ömer Taylan Tuğut"
|
| 1038 |
+
#~ msgstr "الترجمة التركية: Ömer Taylan Tuğut"
|
| 1039 |
+
|
| 1040 |
+
#~ msgid "DE Translation: Gunther Wegner"
|
| 1041 |
+
#~ msgstr "الترجمة الألمانية: Gunther Wegner"
|
| 1042 |
+
|
| 1043 |
+
#~ msgid "da-DK Translation: Mads Floe"
|
| 1044 |
+
#~ msgstr "الترجمة الدنماركية: Mads Floe"
|
| 1045 |
+
|
| 1046 |
+
#~ msgid "NO Translation: Svend Olaf Olsen"
|
| 1047 |
+
#~ msgstr "الترجمة الدنماركية: Mads Floe"
|
| 1048 |
+
|
| 1049 |
+
#~ msgid "NL Translation: Martin van der Grond"
|
| 1050 |
+
#~ msgstr "الترجمة الدنماركية: Mads Floe"
|
| 1051 |
+
|
| 1052 |
+
#~ msgid "I thought this article might interest you."
|
| 1053 |
+
#~ msgstr "لقد وجدت هذا الموضوع مفيداً لك."
|
| 1054 |
+
|
| 1055 |
+
#~ msgid "You can read the full article here"
|
| 1056 |
+
#~ msgstr "يمكنك قراءة بقية الموضوع على الرابط التالي"
|
| 1057 |
+
|
| 1058 |
+
#~ msgid "I would like to submit this article"
|
| 1059 |
+
#~ msgstr "أريد نشر هذا الموضوع"
|
languages/shrsb-be_BY.mo
ADDED
|
Binary file
|
languages/shrsb-be_BY.po
ADDED
|
@@ -0,0 +1,1365 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
msgid ""
|
| 2 |
+
msgstr ""
|
| 3 |
+
"Project-Id-Version: SexyBookmarks v3.0\n"
|
| 4 |
+
"Report-Msgid-Bugs-To: Yuri Gribov <grib69@gmail.com> | http://www.wp-ru.ru/\n"
|
| 5 |
+
"POT-Creation-Date: 2010-02-01 07:50-0600\n"
|
| 6 |
+
"PO-Revision-Date: \n"
|
| 7 |
+
"Last-Translator: \n"
|
| 8 |
+
"Language-Team: Web Geeks\n"
|
| 9 |
+
"MIME-Version: 1.0\n"
|
| 10 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
+
"X-Poedit-Language: Belarusian\n"
|
| 13 |
+
"X-Poedit-Country: BELARUS\n"
|
| 14 |
+
"X-Poedit-KeywordsList: __;_e\n"
|
| 15 |
+
"X-Poedit-Basepath: .\n"
|
| 16 |
+
"X-Poedit-SearchPath-0: .\n"
|
| 17 |
+
|
| 18 |
+
#: sexy-bookmarks.php:167
|
| 19 |
+
msgid "Your changes have been saved successfully!"
|
| 20 |
+
msgstr "Усе змены паспяхова захаваны!"
|
| 21 |
+
|
| 22 |
+
#: sexy-bookmarks.php:167
|
| 23 |
+
#, php-format
|
| 24 |
+
msgid "Maybe you would consider <a href=\"%s\">donating</a>?"
|
| 25 |
+
msgstr "Магчыма Вы жадаеце разгледзець пытанне о <a href=\"%s\">узнагародзе</a> аўтарам?"
|
| 26 |
+
|
| 27 |
+
#: sexy-bookmarks.php:170
|
| 28 |
+
msgid "Please choose where you would like the menu to be displayed."
|
| 29 |
+
msgstr "Абярыце месца размяшчэння меню."
|
| 30 |
+
|
| 31 |
+
#: sexy-bookmarks.php:171
|
| 32 |
+
msgid "You can't display the menu if you don't choose a few sites to add to it!"
|
| 33 |
+
msgstr "Вы не зможаце выкарыстоўваць меню, не абраўшы ніводнага сэрвісу!"
|
| 34 |
+
|
| 35 |
+
#: sexy-bookmarks.php:172
|
| 36 |
+
msgid "Please choose where you want the menu displayed."
|
| 37 |
+
msgstr "Абярыце, дзе б Вы жадалі бачыць меню."
|
| 38 |
+
|
| 39 |
+
#: sexy-bookmarks.php:176
|
| 40 |
+
msgid "You need to select the primary category for any articles submitted to Twittley."
|
| 41 |
+
msgstr "Вы павінны абраць асноўную частку артыкулаў для Twittley."
|
| 42 |
+
|
| 43 |
+
#: sexy-bookmarks.php:177
|
| 44 |
+
msgid "You need to set at least 1 default tag for any articles submitted to Twittley."
|
| 45 |
+
msgstr "Вы павінны паказаць хоць бы 1 пазнаку па змаўчанні для Twittley."
|
| 46 |
+
|
| 47 |
+
#: sexy-bookmarks.php:187
|
| 48 |
+
#, php-format
|
| 49 |
+
msgid "You must first download and activate the <a href=\"%s\">Twitter Friendly Links Plugin</a> before hosting your own short URLs..."
|
| 50 |
+
msgstr "Вы павінны запампаваць і актываваць <a href=\"%s\">убудова Twitter Friendly Links</a>, перш чым выкарыстоўваць гэты варыянт."
|
| 51 |
+
|
| 52 |
+
#: sexy-bookmarks.php:189
|
| 53 |
+
#, php-format
|
| 54 |
+
msgid "You must first download and activate the <a href=\"%s\">YOURLS Plugin</a> before hosting your own short URLs..."
|
| 55 |
+
msgstr "Вы павінны запампаваць і актываваць <a href=\"%s\">убудова YOURLS</a>, перш чым выкарыстоўваць гэты варыянт."
|
| 56 |
+
|
| 57 |
+
#: sexy-bookmarks.php:209
|
| 58 |
+
#, php-format
|
| 59 |
+
msgid "WARNING: Your css and/or images folders are not writeable! <a href=\"%s\">Need Help?</a>"
|
| 60 |
+
msgstr "УВАГА: Ваш каталог з css і/ці малюначкамі недаступны на запіс! <a href=\"%s\">Патрэбна дапамога?</a>"
|
| 61 |
+
|
| 62 |
+
#: sexy-bookmarks.php:245
|
| 63 |
+
msgid "Short URL(s) have been reset."
|
| 64 |
+
msgstr "Кароткія URL былі вычышчаны."
|
| 65 |
+
|
| 66 |
+
#: sexy-bookmarks.php:285
|
| 67 |
+
msgid "Enabled Networks"
|
| 68 |
+
msgstr "Уключаныя закладкі"
|
| 69 |
+
|
| 70 |
+
#: sexy-bookmarks.php:289
|
| 71 |
+
msgid "Select the Networks to display. Drag to reorder."
|
| 72 |
+
msgstr "Абярыце закладкі, якія неабходна паказваць. Перацягвайце іх для сартавання."
|
| 73 |
+
|
| 74 |
+
#: sexy-bookmarks.php:291
|
| 75 |
+
msgid "Select"
|
| 76 |
+
msgstr "Абраць"
|
| 77 |
+
|
| 78 |
+
#: sexy-bookmarks.php:292
|
| 79 |
+
msgid "All"
|
| 80 |
+
msgstr "Усё"
|
| 81 |
+
|
| 82 |
+
#: sexy-bookmarks.php:293
|
| 83 |
+
msgid "None"
|
| 84 |
+
msgstr "Ніводнай"
|
| 85 |
+
|
| 86 |
+
#: sexy-bookmarks.php:294
|
| 87 |
+
msgid "Most Popular"
|
| 88 |
+
msgstr "Найболей папулярныя"
|
| 89 |
+
|
| 90 |
+
#: sexy-bookmarks.php:308
|
| 91 |
+
msgid "Functionality Settings"
|
| 92 |
+
msgstr "Налады асноўных функцый"
|
| 93 |
+
|
| 94 |
+
#: sexy-bookmarks.php:314
|
| 95 |
+
msgid "This will clear <u>ALL</u> short URLs. - Are you sure?"
|
| 96 |
+
msgstr "Вы сапраўды жадаеце ачысціць <u>УСЁ</u> кароткія URL?"
|
| 97 |
+
|
| 98 |
+
#: sexy-bookmarks.php:317
|
| 99 |
+
#: sexy-bookmarks.php:474
|
| 100 |
+
#: sexy-bookmarks.php:477
|
| 101 |
+
#: sexy-bookmarks.php:534
|
| 102 |
+
#: sexy-bookmarks.php:609
|
| 103 |
+
msgid "Yes"
|
| 104 |
+
msgstr "Так"
|
| 105 |
+
|
| 106 |
+
#: sexy-bookmarks.php:317
|
| 107 |
+
msgid "Cancel"
|
| 108 |
+
msgstr "Адмяніць"
|
| 109 |
+
|
| 110 |
+
#: sexy-bookmarks.php:321
|
| 111 |
+
msgid "Twitter Options:"
|
| 112 |
+
msgstr "Налады Twitter:"
|
| 113 |
+
|
| 114 |
+
#: sexy-bookmarks.php:322
|
| 115 |
+
msgid "Twitter ID:"
|
| 116 |
+
msgstr ""
|
| 117 |
+
|
| 118 |
+
#: sexy-bookmarks.php:324
|
| 119 |
+
msgid "Use a URL shortening service?"
|
| 120 |
+
msgstr "Выкарыстоўваць сэрвіс кароткіх URL?"
|
| 121 |
+
|
| 122 |
+
#: sexy-bookmarks.php:326
|
| 123 |
+
msgid "Which URL Shortener?"
|
| 124 |
+
msgstr "Які сэрвіс выкарыстоўваць?"
|
| 125 |
+
|
| 126 |
+
#: sexy-bookmarks.php:331
|
| 127 |
+
msgid "Don't use a shortener"
|
| 128 |
+
msgstr "Не выкарыстоўваць кароткія URL"
|
| 129 |
+
|
| 130 |
+
#: sexy-bookmarks.php:346
|
| 131 |
+
msgid "Reset all Short URLs"
|
| 132 |
+
msgstr "Ачысціць усе кароткія URL"
|
| 133 |
+
|
| 134 |
+
#: sexy-bookmarks.php:349
|
| 135 |
+
#: sexy-bookmarks.php:361
|
| 136 |
+
#: sexy-bookmarks.php:370
|
| 137 |
+
#: sexy-bookmarks.php:382
|
| 138 |
+
#: sexy-bookmarks.php:402
|
| 139 |
+
msgid "User ID:"
|
| 140 |
+
msgstr ""
|
| 141 |
+
|
| 142 |
+
#: sexy-bookmarks.php:351
|
| 143 |
+
#: sexy-bookmarks.php:372
|
| 144 |
+
#: sexy-bookmarks.php:392
|
| 145 |
+
#: sexy-bookmarks.php:404
|
| 146 |
+
msgid "API Key:"
|
| 147 |
+
msgstr ""
|
| 148 |
+
|
| 149 |
+
#: sexy-bookmarks.php:357
|
| 150 |
+
#: sexy-bookmarks.php:378
|
| 151 |
+
#: sexy-bookmarks.php:388
|
| 152 |
+
#: sexy-bookmarks.php:398
|
| 153 |
+
msgid "Track Generated Links?"
|
| 154 |
+
msgstr ""
|
| 155 |
+
|
| 156 |
+
#: sexy-bookmarks.php:363
|
| 157 |
+
msgid "Password:"
|
| 158 |
+
msgstr "Пароль:"
|
| 159 |
+
|
| 160 |
+
#: sexy-bookmarks.php:411
|
| 161 |
+
msgid "Yahoo! Buzz Defaults:"
|
| 162 |
+
msgstr "Налады па змаўчанні для Yahoo! Buzz:"
|
| 163 |
+
|
| 164 |
+
#: sexy-bookmarks.php:412
|
| 165 |
+
msgid "Default Content Category:"
|
| 166 |
+
msgstr "Рубрыка па змаўчанні:"
|
| 167 |
+
|
| 168 |
+
#: sexy-bookmarks.php:431
|
| 169 |
+
msgid "Default Media Type:"
|
| 170 |
+
msgstr "Фармат па змаўчанні:"
|
| 171 |
+
|
| 172 |
+
#: sexy-bookmarks.php:445
|
| 173 |
+
msgid "Twittley Defaults:"
|
| 174 |
+
msgstr "Налады па змаўчанні для Twittley:"
|
| 175 |
+
|
| 176 |
+
#: sexy-bookmarks.php:446
|
| 177 |
+
msgid "Primary Content Category:"
|
| 178 |
+
msgstr "Асноўная рубрыка:"
|
| 179 |
+
|
| 180 |
+
#: sexy-bookmarks.php:450
|
| 181 |
+
msgid "Technology"
|
| 182 |
+
msgstr ""
|
| 183 |
+
|
| 184 |
+
#: sexy-bookmarks.php:451
|
| 185 |
+
msgid "World & Business"
|
| 186 |
+
msgstr ""
|
| 187 |
+
|
| 188 |
+
#: sexy-bookmarks.php:452
|
| 189 |
+
msgid "Science"
|
| 190 |
+
msgstr ""
|
| 191 |
+
|
| 192 |
+
#: sexy-bookmarks.php:453
|
| 193 |
+
msgid "Gaming"
|
| 194 |
+
msgstr ""
|
| 195 |
+
|
| 196 |
+
#: sexy-bookmarks.php:454
|
| 197 |
+
msgid "Lifestyle"
|
| 198 |
+
msgstr ""
|
| 199 |
+
|
| 200 |
+
#: sexy-bookmarks.php:455
|
| 201 |
+
msgid "Entertainment"
|
| 202 |
+
msgstr ""
|
| 203 |
+
|
| 204 |
+
#: sexy-bookmarks.php:456
|
| 205 |
+
msgid "Sports"
|
| 206 |
+
msgstr ""
|
| 207 |
+
|
| 208 |
+
#: sexy-bookmarks.php:457
|
| 209 |
+
msgid "Offbeat"
|
| 210 |
+
msgstr ""
|
| 211 |
+
|
| 212 |
+
#: sexy-bookmarks.php:458
|
| 213 |
+
msgid "Internet"
|
| 214 |
+
msgstr ""
|
| 215 |
+
|
| 216 |
+
#: sexy-bookmarks.php:464
|
| 217 |
+
msgid "Enter a comma separated list of general tags which describe your site's posts as a whole. Try not to be too specific, as one post may fall into different *tag categories* than other posts."
|
| 218 |
+
msgstr "Увядзіце праз коску спіс пазнак, якія апісваюць Ваш сайт. Імкніцеся быць не занадта пэўнымі, бо адзін запіс можа быць прывязана да некалькімі пазнакамі."
|
| 219 |
+
|
| 220 |
+
#: sexy-bookmarks.php:465
|
| 221 |
+
msgid "This list is primarily used as a failsafe in case you forget to enter WordPress tags for a particular post, in which case this list of tags would be used so as to bring at least *somewhat* relevant search queries based on the general tags that you enter here."
|
| 222 |
+
msgstr "Дадзены спіс выкарыстоўваецца ў выпадку, калі Вы забыліся запісы прызначыць пазнакі ў WordPress."
|
| 223 |
+
|
| 224 |
+
#: sexy-bookmarks.php:465
|
| 225 |
+
msgid "Click here to close this message"
|
| 226 |
+
msgstr "Зачыніць паведамленне"
|
| 227 |
+
|
| 228 |
+
#: sexy-bookmarks.php:465
|
| 229 |
+
msgid "close"
|
| 230 |
+
msgstr "зачыніць"
|
| 231 |
+
|
| 232 |
+
#: sexy-bookmarks.php:467
|
| 233 |
+
msgid "Default Tags:"
|
| 234 |
+
msgstr "Пазнакі па змаўчанні:"
|
| 235 |
+
|
| 236 |
+
#: sexy-bookmarks.php:468
|
| 237 |
+
#: sexy-bookmarks.php:607
|
| 238 |
+
msgid "Click here for help with this option"
|
| 239 |
+
msgstr "Націсніце, што б атрымаць дапамогу па дадзенай наладзе"
|
| 240 |
+
|
| 241 |
+
#: sexy-bookmarks.php:472
|
| 242 |
+
msgid "General Functionality Options:"
|
| 243 |
+
msgstr "Асноўныя налады:"
|
| 244 |
+
|
| 245 |
+
#: sexy-bookmarks.php:473
|
| 246 |
+
msgid "Add nofollow to the links?"
|
| 247 |
+
msgstr "Дадаць nofollow да спасылак закладак?"
|
| 248 |
+
|
| 249 |
+
#: sexy-bookmarks.php:475
|
| 250 |
+
#: sexy-bookmarks.php:478
|
| 251 |
+
#: sexy-bookmarks.php:535
|
| 252 |
+
#: sexy-bookmarks.php:539
|
| 253 |
+
#: sexy-bookmarks.php:610
|
| 254 |
+
msgid "No"
|
| 255 |
+
msgstr "Не"
|
| 256 |
+
|
| 257 |
+
#: sexy-bookmarks.php:476
|
| 258 |
+
msgid "Open links in new window?"
|
| 259 |
+
msgstr "Адкрываць спасылкі ў новым акне?"
|
| 260 |
+
|
| 261 |
+
#: sexy-bookmarks.php:485
|
| 262 |
+
msgid "Plugin Aesthetics"
|
| 263 |
+
msgstr "Налады вонкавага выгляду"
|
| 264 |
+
|
| 265 |
+
#: sexy-bookmarks.php:490
|
| 266 |
+
msgid "Warning!"
|
| 267 |
+
msgstr "Увага!"
|
| 268 |
+
|
| 269 |
+
#: sexy-bookmarks.php:491
|
| 270 |
+
msgid "This option is intended "
|
| 271 |
+
msgstr "Дадзеная функцыя прызначана "
|
| 272 |
+
|
| 273 |
+
#: sexy-bookmarks.php:491
|
| 274 |
+
msgid "STRICTLY"
|
| 275 |
+
msgstr "ВЫЛУЧНА"
|
| 276 |
+
|
| 277 |
+
#: sexy-bookmarks.php:491
|
| 278 |
+
msgid " for users who understand how to edit CSS/JS and intend to change/edit the associated images themselves. No support will be offered for this feature, as I cannot be held accountable for your coding/image-editing mistakes. Furthermore, this feature was implemented as a favor to the thousands of you who asked for such a feature, and as such, I would appreciate it if you could refrain from sending nasty emails when you break the plugin due to coding errors of your own."
|
| 279 |
+
msgstr " для карыстачоў, якія разбіраюцца ў праграмаванні CSS/JS і якія змогуць адрэдагаваць злучаныя з імі малюнка. Ніякай падтрымкі карыстачоў, злучанай з працай дадзенай функцыі ажыццяўляцца не будзе, бо я не магу адказваць за памылкі, дапушчаныя Вамі падчас праграмавання. Больш таго, дадзеная функцыя была дададзена толькі па шматлікіх Вашых просьбах і я буду вельмі ўдзячны, калі Вы ўстрымаецеся ад гнеўных лістоў у мой адрас, злучаных з непрацаздольнасцю ўбудовы, пасля дапушчаных Вамі ж памылак у праграмаванні."
|
| 280 |
+
|
| 281 |
+
#: sexy-bookmarks.php:492
|
| 282 |
+
msgid "How it works..."
|
| 283 |
+
msgstr "Як гэта працуе..."
|
| 284 |
+
|
| 285 |
+
#: sexy-bookmarks.php:493
|
| 286 |
+
msgid "Since you have chosen for the plugin to override the style settings with your own custom mods, it will now pull the files from the new folders it is going to create on your server as soon as you save your changes. The file/folder locations should be as follows:"
|
| 287 |
+
msgstr "Паколькі Вы вырашылі самастойна перавызначыць выкарыстоўваныя стылі, пасля таго як Вы захаваеце ўсе зробленыя змены на Вашым серверы будуць створаны наступныя новыя каталогі і файлы:"
|
| 288 |
+
|
| 289 |
+
#: sexy-bookmarks.php:510
|
| 290 |
+
msgid "Once you have saved your changes, you will be able to edit the image sprite that holds all of the icons for SexyBookmarks as well as the CSS which accompanies it. Just be sure that you do in fact edit the CSS if you edit the images, as it is unlikely the heights, widths, and background positions of the images will stay the same after you are done."
|
| 291 |
+
msgstr "Пасля захавання змен Вы зможаце рэдагаваць малюнак утрымоўвалае ўсё абразкі закладак выкарыстоўваных у SexyBookmarks і злучаны з імі CSS. Пасля праўкі малюнка не забудзьцеся ўнесці змену ў CSS, бо ці наўрад пазіцыі абразкоў і іх зрушэнне остануться ранейшымі."
|
| 292 |
+
|
| 293 |
+
#: sexy-bookmarks.php:511
|
| 294 |
+
msgid "Just a quick note... When you edit the styles and images to include your own custom backgrounds, icons, and CSS styles, be aware that those changes will not be reflected on the plugin options page. In other words: when you select your networks to be displayed, or when you select the background image to use, it will still be displaying the images from the original plugin directory."
|
| 295 |
+
msgstr "Маленькая заўвага... Пасля таго, як Вы ўнесяце ўсе змены ў малюнкі абразкоў і ў стылі, майце на ўвазе, што яны не будуць адлюстроўвацца ў панэлі кіравання ўбудовы. Іншымі словамі, бачныя абразкі на сайце і ў панэлі кіравання супадаць не будуць. Малюнкі ў панэлі кіравання будуць па ранейшым выкарыстоўвацца з арыгінальнага каталога ўбудовы."
|
| 296 |
+
|
| 297 |
+
#: sexy-bookmarks.php:512
|
| 298 |
+
msgid "In Case of Emergency"
|
| 299 |
+
msgstr "У выпадку неабходнасці"
|
| 300 |
+
|
| 301 |
+
#: sexy-bookmarks.php:513
|
| 302 |
+
msgid "If you happen to completely screw up the code, you can follow these directions to reset the plugin back to normal and try again if you wish:"
|
| 303 |
+
msgstr "Калі ў выніку занесеных змен убудова полностю стаў непрацаздольным, для яго аднаўлення выканаеце наступныя інструкцыі:"
|
| 304 |
+
|
| 305 |
+
#: sexy-bookmarks.php:515
|
| 306 |
+
msgid "Login to your server via FTP or SSH. (whichever you are more comfortable with)"
|
| 307 |
+
msgstr "Зайдзіце на сайт па SSH, FTP ці іншым зручным для Вас спосабам."
|
| 308 |
+
|
| 309 |
+
#: sexy-bookmarks.php:516
|
| 310 |
+
msgid "Navigate to your wp-content directory."
|
| 311 |
+
msgstr "Перайдзіце ў каталог wp-content."
|
| 312 |
+
|
| 313 |
+
#: sexy-bookmarks.php:517
|
| 314 |
+
msgid "Delete the directory named \"sexy-mods\"."
|
| 315 |
+
msgstr "Выдаліце там каталог \"sexy-mods\"."
|
| 316 |
+
|
| 317 |
+
#: sexy-bookmarks.php:518
|
| 318 |
+
msgid "Login to your WordPress dashboard."
|
| 319 |
+
msgstr "Увайдзіце ў панэль кіравання WordPress."
|
| 320 |
+
|
| 321 |
+
#: sexy-bookmarks.php:519
|
| 322 |
+
msgid "Go to the SexyBookmarks plugin options page. (settings->sexybookmarks)"
|
| 323 |
+
msgstr "Перайдзіце на старонку кіравання ўбудовай SexyBookmarks (Параметры->SexyBookmarks)"
|
| 324 |
+
|
| 325 |
+
#: sexy-bookmarks.php:520
|
| 326 |
+
msgid "Deselect the \"Use custom mods\" option."
|
| 327 |
+
msgstr "Адключыце пункт \"Перавызначыць стылі самастойна\""
|
| 328 |
+
|
| 329 |
+
#: sexy-bookmarks.php:521
|
| 330 |
+
msgid "Save your changes."
|
| 331 |
+
msgstr "Захаваеце змены."
|
| 332 |
+
|
| 333 |
+
#: sexy-bookmarks.php:523
|
| 334 |
+
msgid "Close Message"
|
| 335 |
+
msgstr "Зачыніць дадзенае паведамленне"
|
| 336 |
+
|
| 337 |
+
#: sexy-bookmarks.php:527
|
| 338 |
+
msgid "Override Styles With Custom Mods Instead?"
|
| 339 |
+
msgstr "Перавызначыць стылі самастойна?"
|
| 340 |
+
|
| 341 |
+
#: sexy-bookmarks.php:532
|
| 342 |
+
msgid "jQuery Related Options"
|
| 343 |
+
msgstr "Налады jQuery"
|
| 344 |
+
|
| 345 |
+
#: sexy-bookmarks.php:533
|
| 346 |
+
msgid "Animate-expand multi-lined bookmarks?"
|
| 347 |
+
msgstr "Уключыць анімацыю, калі закладкі размешчаны ў некалькі шэрагаў?"
|
| 348 |
+
|
| 349 |
+
#: sexy-bookmarks.php:536
|
| 350 |
+
msgid "Auto-space/center the bookmarks?"
|
| 351 |
+
msgstr "Аўтаматычна выраўноўваць закладкі?"
|
| 352 |
+
|
| 353 |
+
#: sexy-bookmarks.php:537
|
| 354 |
+
msgid "Space"
|
| 355 |
+
msgstr "Расцягнуць"
|
| 356 |
+
|
| 357 |
+
#: sexy-bookmarks.php:538
|
| 358 |
+
msgid "Center"
|
| 359 |
+
msgstr "Па цэнтры"
|
| 360 |
+
|
| 361 |
+
#: sexy-bookmarks.php:540
|
| 362 |
+
msgid "jQuery Compatibility Fix"
|
| 363 |
+
msgstr "Выпраўленне праблем сумяшчальнасці jQuery"
|
| 364 |
+
|
| 365 |
+
#: sexy-bookmarks.php:541
|
| 366 |
+
msgid "Check this box ONLY if you notice jQuery being loaded twice in your source code!"
|
| 367 |
+
msgstr "Абярыце, калі Вы выявіце ў зыходным кодзе, што jQuery загружаецца двойчы!"
|
| 368 |
+
|
| 369 |
+
#: sexy-bookmarks.php:543
|
| 370 |
+
msgid "Load scripts in Footer"
|
| 371 |
+
msgstr "Загружаць скрыпты ў футере"
|
| 372 |
+
|
| 373 |
+
#: sexy-bookmarks.php:544
|
| 374 |
+
msgid "Check this box if you want the SexyBookmarks javascript to be loaded in your blog's footer."
|
| 375 |
+
msgstr "Абярыце, калі жадаеце, каб javascript SexyBookmarks загружаўся ў футере."
|
| 376 |
+
|
| 377 |
+
#: sexy-bookmarks.php:546
|
| 378 |
+
msgid "Background Image Options"
|
| 379 |
+
msgstr "Налада фонавага малюнка"
|
| 380 |
+
|
| 381 |
+
#: sexy-bookmarks.php:548
|
| 382 |
+
msgid "Use a background image?"
|
| 383 |
+
msgstr "Выкарыстоўваць фонавы малюнак?"
|
| 384 |
+
|
| 385 |
+
#: sexy-bookmarks.php:578
|
| 386 |
+
msgid "Menu Placement"
|
| 387 |
+
msgstr "Месцаванне меню"
|
| 388 |
+
|
| 389 |
+
#: sexy-bookmarks.php:584
|
| 390 |
+
#, php-format
|
| 391 |
+
msgid "Need help with this? Find it in the <a href=\"%s\">official install guide."
|
| 392 |
+
msgstr "Патрэбна дапамога? Пашукайце на <a href=\"%s\">афіцыйным сайце."
|
| 393 |
+
|
| 394 |
+
#: sexy-bookmarks.php:590
|
| 395 |
+
msgid "Menu Location (in relation to content):"
|
| 396 |
+
msgstr "Размяшчэнне меню (адносна кантэнту):"
|
| 397 |
+
|
| 398 |
+
#: sexy-bookmarks.php:591
|
| 399 |
+
msgid "Above Content"
|
| 400 |
+
msgstr "Вышэй кантэнту"
|
| 401 |
+
|
| 402 |
+
#: sexy-bookmarks.php:592
|
| 403 |
+
msgid "Below Content"
|
| 404 |
+
msgstr "Ніжэй кантэнту"
|
| 405 |
+
|
| 406 |
+
#: sexy-bookmarks.php:593
|
| 407 |
+
msgid "Manual Mode"
|
| 408 |
+
msgstr "Вызначыць самому"
|
| 409 |
+
|
| 410 |
+
#: sexy-bookmarks.php:594
|
| 411 |
+
msgid "Posts, pages, or the whole shebang?"
|
| 412 |
+
msgstr "Запісы, старонкі ці дзе яшчэ?"
|
| 413 |
+
|
| 414 |
+
#: sexy-bookmarks.php:598
|
| 415 |
+
msgid "Posts Only"
|
| 416 |
+
msgstr "Толькі ў запісах"
|
| 417 |
+
|
| 418 |
+
#: sexy-bookmarks.php:599
|
| 419 |
+
msgid "Pages Only"
|
| 420 |
+
msgstr "Толькі на старонках"
|
| 421 |
+
|
| 422 |
+
#: sexy-bookmarks.php:600
|
| 423 |
+
msgid "Index Only"
|
| 424 |
+
msgstr "Толькі на галоўнай"
|
| 425 |
+
|
| 426 |
+
#: sexy-bookmarks.php:601
|
| 427 |
+
msgid "Posts & Pages"
|
| 428 |
+
msgstr "Запісы і старонкі"
|
| 429 |
+
|
| 430 |
+
#: sexy-bookmarks.php:602
|
| 431 |
+
msgid "Posts & Index"
|
| 432 |
+
msgstr "Запісы і галоўная"
|
| 433 |
+
|
| 434 |
+
#: sexy-bookmarks.php:603
|
| 435 |
+
msgid "Pages & Index"
|
| 436 |
+
msgstr "Старонкі і галоўная"
|
| 437 |
+
|
| 438 |
+
#: sexy-bookmarks.php:604
|
| 439 |
+
msgid "Posts, Pages, & Index"
|
| 440 |
+
msgstr "Запісы, старонкі і галоўная"
|
| 441 |
+
|
| 442 |
+
#: sexy-bookmarks.php:608
|
| 443 |
+
msgid "Show in RSS feed?"
|
| 444 |
+
msgstr ""
|
| 445 |
+
|
| 446 |
+
#: sexy-bookmarks.php:612
|
| 447 |
+
msgid "Hide menu from mobile browsers?"
|
| 448 |
+
msgstr "Хаваць закладкі для мабільных прылад?"
|
| 449 |
+
|
| 450 |
+
#: sexy-bookmarks.php:620
|
| 451 |
+
msgid "Save Changes"
|
| 452 |
+
msgstr "Захаваць змены"
|
| 453 |
+
|
| 454 |
+
#: sexy-bookmarks.php:626
|
| 455 |
+
msgid "Helpful Plugin Links"
|
| 456 |
+
msgstr "Спасылкі дапамогі:"
|
| 457 |
+
|
| 458 |
+
#: sexy-bookmarks.php:631
|
| 459 |
+
msgid "Installation & Usage Guide"
|
| 460 |
+
msgstr "Усталёўка і выкарыстанне"
|
| 461 |
+
|
| 462 |
+
#: sexy-bookmarks.php:632
|
| 463 |
+
msgid "Frequently Asked Questions"
|
| 464 |
+
msgstr "ЧАВО (FAQ)"
|
| 465 |
+
|
| 466 |
+
#: sexy-bookmarks.php:633
|
| 467 |
+
msgid "Bug Submission Form"
|
| 468 |
+
msgstr "Паведаміць пра памылку"
|
| 469 |
+
|
| 470 |
+
#: sexy-bookmarks.php:634
|
| 471 |
+
msgid "Feature Request Form"
|
| 472 |
+
msgstr "Пажаданні"
|
| 473 |
+
|
| 474 |
+
#: sexy-bookmarks.php:635
|
| 475 |
+
msgid "Submit a Translation"
|
| 476 |
+
msgstr "Дадаць пераклад"
|
| 477 |
+
|
| 478 |
+
#: sexy-bookmarks.php:636
|
| 479 |
+
msgid "Other SexyBookmarks Platforms"
|
| 480 |
+
msgstr "SexyBookmarks на іншых платформах"
|
| 481 |
+
|
| 482 |
+
#: sexy-bookmarks.php:643
|
| 483 |
+
msgid "Support by Donating"
|
| 484 |
+
msgstr "Падтрымка і ўзнагароды"
|
| 485 |
+
|
| 486 |
+
#: sexy-bookmarks.php:647
|
| 487 |
+
msgid "If you like SexyBookmarks and wish to contribute towards it's continued development, you can use the form below to do so."
|
| 488 |
+
msgstr "Калі Вам спадабалася ўбудова і Вы жадаеце падтрымаць распрацоўнікаў матэрыяльна, што будзе спрыяць далейшаму развіццю ўбудовы, можаце выкарыстоўваць форму ніжэй"
|
| 489 |
+
|
| 490 |
+
#: sexy-bookmarks.php:651
|
| 491 |
+
msgid "SexyBookmarks Development Support"
|
| 492 |
+
msgstr ""
|
| 493 |
+
|
| 494 |
+
#: sexy-bookmarks.php:654
|
| 495 |
+
msgid "Please enter the URL you'd like me to link to if you are a top contributor."
|
| 496 |
+
msgstr ""
|
| 497 |
+
|
| 498 |
+
#: sexy-bookmarks.php:656
|
| 499 |
+
msgid "Return to Your Dashboard"
|
| 500 |
+
msgstr ""
|
| 501 |
+
|
| 502 |
+
#: sexy-bookmarks.php:660
|
| 503 |
+
msgid "Select Preset Amount? "
|
| 504 |
+
msgstr "Абярыце суму"
|
| 505 |
+
|
| 506 |
+
#: sexy-bookmarks.php:673
|
| 507 |
+
msgid "Enter Custom Amount?"
|
| 508 |
+
msgstr "Увядзіце суму"
|
| 509 |
+
|
| 510 |
+
#: sexy-bookmarks.php:675
|
| 511 |
+
msgid "Pay with PayPal!"
|
| 512 |
+
msgstr "Заплаціць праз PayPal!"
|
| 513 |
+
|
| 514 |
+
#: sexy-bookmarks.php:679
|
| 515 |
+
msgid "Disable sponsor messages?"
|
| 516 |
+
msgstr "Адключыць спонсарскія паведамленні"
|
| 517 |
+
|
| 518 |
+
#: sexy-bookmarks.php:689
|
| 519 |
+
msgid "Top Supporters"
|
| 520 |
+
msgstr "Лепшыя фундатары"
|
| 521 |
+
|
| 522 |
+
#: sexy-bookmarks.php:702
|
| 523 |
+
msgid "Shout-Outs"
|
| 524 |
+
msgstr "Асобнае дзякуй"
|
| 525 |
+
|
| 526 |
+
#: sexy-bookmarks.php:707
|
| 527 |
+
msgid "Fugue Icons: Pinvoke"
|
| 528 |
+
msgstr ""
|
| 529 |
+
|
| 530 |
+
#: sexy-bookmarks.php:708
|
| 531 |
+
msgid "Fugue Icon Sprite: Alison Barrett"
|
| 532 |
+
msgstr ""
|
| 533 |
+
|
| 534 |
+
#: sexy-bookmarks.php:709
|
| 535 |
+
msgid "Original Skin Icons: Function"
|
| 536 |
+
msgstr ""
|
| 537 |
+
|
| 538 |
+
#: sexy-bookmarks.php:710
|
| 539 |
+
msgid "Bug Patch: Artem Russakovskii"
|
| 540 |
+
msgstr ""
|
| 541 |
+
|
| 542 |
+
#: sexy-bookmarks.php:711
|
| 543 |
+
msgid "bit.ly bug fix: Konstantin Kovshenin"
|
| 544 |
+
msgstr ""
|
| 545 |
+
|
| 546 |
+
#: sexy-bookmarks.php:718
|
| 547 |
+
msgid "Translation Contributors"
|
| 548 |
+
msgstr "Над перакладам працавалі"
|
| 549 |
+
|
| 550 |
+
#: sexy-bookmarks.php:723
|
| 551 |
+
#: sexy-bookmarks.php:724
|
| 552 |
+
#: sexy-bookmarks.php:725
|
| 553 |
+
#: sexy-bookmarks.php:726
|
| 554 |
+
#: sexy-bookmarks.php:727
|
| 555 |
+
#: sexy-bookmarks.php:728
|
| 556 |
+
#: sexy-bookmarks.php:729
|
| 557 |
+
#: sexy-bookmarks.php:730
|
| 558 |
+
#: sexy-bookmarks.php:731
|
| 559 |
+
#: sexy-bookmarks.php:732
|
| 560 |
+
#: sexy-bookmarks.php:733
|
| 561 |
+
#: sexy-bookmarks.php:734
|
| 562 |
+
#: sexy-bookmarks.php:735
|
| 563 |
+
#: sexy-bookmarks.php:736
|
| 564 |
+
msgid "Translation"
|
| 565 |
+
msgstr "пераклад"
|
| 566 |
+
|
| 567 |
+
#: sexy-bookmarks.php:751
|
| 568 |
+
msgid "SexyBookmarks"
|
| 569 |
+
msgstr ""
|
| 570 |
+
|
| 571 |
+
#: sexy-bookmarks.php:773
|
| 572 |
+
msgid "Settings"
|
| 573 |
+
msgstr "Налады"
|
| 574 |
+
|
| 575 |
+
#: includes/bookmarks-data.php:19
|
| 576 |
+
#: includes/bookmarks-data.php:24
|
| 577 |
+
#: includes/bookmarks-data.php:29
|
| 578 |
+
#: includes/bookmarks-data.php:34
|
| 579 |
+
#: includes/bookmarks-data.php:39
|
| 580 |
+
#: includes/bookmarks-data.php:44
|
| 581 |
+
#: includes/bookmarks-data.php:49
|
| 582 |
+
#: includes/bookmarks-data.php:54
|
| 583 |
+
#: includes/bookmarks-data.php:59
|
| 584 |
+
#: includes/bookmarks-data.php:64
|
| 585 |
+
#: includes/bookmarks-data.php:69
|
| 586 |
+
#: includes/bookmarks-data.php:74
|
| 587 |
+
#: includes/bookmarks-data.php:79
|
| 588 |
+
#: includes/bookmarks-data.php:84
|
| 589 |
+
#: includes/bookmarks-data.php:89
|
| 590 |
+
#: includes/bookmarks-data.php:94
|
| 591 |
+
#: includes/bookmarks-data.php:99
|
| 592 |
+
#: includes/bookmarks-data.php:104
|
| 593 |
+
#: includes/bookmarks-data.php:109
|
| 594 |
+
#: includes/bookmarks-data.php:114
|
| 595 |
+
#: includes/bookmarks-data.php:119
|
| 596 |
+
#: includes/bookmarks-data.php:124
|
| 597 |
+
#: includes/bookmarks-data.php:129
|
| 598 |
+
#: includes/bookmarks-data.php:134
|
| 599 |
+
#: includes/bookmarks-data.php:139
|
| 600 |
+
#: includes/bookmarks-data.php:144
|
| 601 |
+
#: includes/bookmarks-data.php:149
|
| 602 |
+
#: includes/bookmarks-data.php:154
|
| 603 |
+
#: includes/bookmarks-data.php:159
|
| 604 |
+
#: includes/bookmarks-data.php:164
|
| 605 |
+
#: includes/bookmarks-data.php:169
|
| 606 |
+
#: includes/bookmarks-data.php:174
|
| 607 |
+
#: includes/bookmarks-data.php:179
|
| 608 |
+
#: includes/bookmarks-data.php:184
|
| 609 |
+
#: includes/bookmarks-data.php:189
|
| 610 |
+
#: includes/bookmarks-data.php:194
|
| 611 |
+
#: includes/bookmarks-data.php:199
|
| 612 |
+
#: includes/bookmarks-data.php:204
|
| 613 |
+
#: includes/bookmarks-data.php:209
|
| 614 |
+
#: includes/bookmarks-data.php:214
|
| 615 |
+
#: includes/bookmarks-data.php:219
|
| 616 |
+
#: includes/bookmarks-data.php:224
|
| 617 |
+
#: includes/bookmarks-data.php:229
|
| 618 |
+
#: includes/bookmarks-data.php:234
|
| 619 |
+
#: includes/bookmarks-data.php:239
|
| 620 |
+
#: includes/bookmarks-data.php:244
|
| 621 |
+
#: includes/bookmarks-data.php:249
|
| 622 |
+
#: includes/bookmarks-data.php:254
|
| 623 |
+
#: includes/bookmarks-data.php:259
|
| 624 |
+
#: includes/bookmarks-data.php:264
|
| 625 |
+
#: includes/bookmarks-data.php:269
|
| 626 |
+
#: includes/bookmarks-data.php:274
|
| 627 |
+
#: includes/bookmarks-data.php:279
|
| 628 |
+
#: includes/bookmarks-data.php:284
|
| 629 |
+
#: includes/bookmarks-data.php:289
|
| 630 |
+
#: includes/bookmarks-data.php:294
|
| 631 |
+
#: includes/bookmarks-data.php:299
|
| 632 |
+
#: includes/bookmarks-data.php:304
|
| 633 |
+
#: includes/bookmarks-data.php:309
|
| 634 |
+
#: includes/bookmarks-data.php:314
|
| 635 |
+
#: includes/bookmarks-data.php:319
|
| 636 |
+
#: includes/bookmarks-data.php:324
|
| 637 |
+
#: includes/bookmarks-data.php:329
|
| 638 |
+
#: includes/bookmarks-data.php:334
|
| 639 |
+
#: includes/bookmarks-data.php:339
|
| 640 |
+
#: includes/bookmarks-data.php:344
|
| 641 |
+
#: includes/bookmarks-data.php:349
|
| 642 |
+
#: includes/bookmarks-data.php:354
|
| 643 |
+
#: includes/bookmarks-data.php:359
|
| 644 |
+
#: includes/bookmarks-data.php:364
|
| 645 |
+
#: includes/bookmarks-data.php:369
|
| 646 |
+
#: includes/bookmarks-data.php:374
|
| 647 |
+
#: includes/bookmarks-data.php:379
|
| 648 |
+
#: includes/bookmarks-data.php:384
|
| 649 |
+
#: includes/bookmarks-data.php:389
|
| 650 |
+
#: includes/bookmarks-data.php:394
|
| 651 |
+
#: includes/bookmarks-data.php:399
|
| 652 |
+
#: includes/bookmarks-data.php:404
|
| 653 |
+
#: includes/bookmarks-data.php:409
|
| 654 |
+
#: includes/bookmarks-data.php:414
|
| 655 |
+
#: includes/bookmarks-data.php:419
|
| 656 |
+
#: includes/bookmarks-data.php:424
|
| 657 |
+
#: includes/bookmarks-data.php:429
|
| 658 |
+
#: includes/bookmarks-data.php:434
|
| 659 |
+
#: includes/bookmarks-data.php:439
|
| 660 |
+
#: includes/bookmarks-data.php:444
|
| 661 |
+
#: includes/bookmarks-data.php:449
|
| 662 |
+
#, php-format
|
| 663 |
+
msgid "Check this box to include %s in your bookmarking menu"
|
| 664 |
+
msgstr "Адзначце, што б уключыць %s у спіс адлюстроўваных закладак"
|
| 665 |
+
|
| 666 |
+
#: includes/bookmarks-data.php:19
|
| 667 |
+
#: includes/bookmarks-data.php:20
|
| 668 |
+
msgid "Script & Style"
|
| 669 |
+
msgstr ""
|
| 670 |
+
|
| 671 |
+
#: includes/bookmarks-data.php:20
|
| 672 |
+
#: includes/bookmarks-data.php:75
|
| 673 |
+
#: includes/bookmarks-data.php:155
|
| 674 |
+
#: includes/bookmarks-data.php:195
|
| 675 |
+
#: includes/bookmarks-data.php:255
|
| 676 |
+
#: includes/bookmarks-data.php:260
|
| 677 |
+
#: includes/bookmarks-data.php:265
|
| 678 |
+
#: includes/bookmarks-data.php:270
|
| 679 |
+
#: includes/bookmarks-data.php:320
|
| 680 |
+
#: includes/bookmarks-data.php:335
|
| 681 |
+
#: includes/bookmarks-data.php:345
|
| 682 |
+
#: includes/bookmarks-data.php:350
|
| 683 |
+
#: includes/bookmarks-data.php:370
|
| 684 |
+
msgid "Submit this to "
|
| 685 |
+
msgstr "Змесцаваць на "
|
| 686 |
+
|
| 687 |
+
#: includes/bookmarks-data.php:24
|
| 688 |
+
#: includes/bookmarks-data.php:25
|
| 689 |
+
msgid "Blinklist"
|
| 690 |
+
msgstr ""
|
| 691 |
+
|
| 692 |
+
#: includes/bookmarks-data.php:25
|
| 693 |
+
#: includes/bookmarks-data.php:30
|
| 694 |
+
#: includes/bookmarks-data.php:45
|
| 695 |
+
#: includes/bookmarks-data.php:60
|
| 696 |
+
#: includes/bookmarks-data.php:65
|
| 697 |
+
#: includes/bookmarks-data.php:80
|
| 698 |
+
#: includes/bookmarks-data.php:105
|
| 699 |
+
#: includes/bookmarks-data.php:135
|
| 700 |
+
#: includes/bookmarks-data.php:140
|
| 701 |
+
#: includes/bookmarks-data.php:145
|
| 702 |
+
#: includes/bookmarks-data.php:160
|
| 703 |
+
#: includes/bookmarks-data.php:170
|
| 704 |
+
#: includes/bookmarks-data.php:225
|
| 705 |
+
#: includes/bookmarks-data.php:275
|
| 706 |
+
#: includes/bookmarks-data.php:280
|
| 707 |
+
#: includes/bookmarks-data.php:300
|
| 708 |
+
#: includes/bookmarks-data.php:360
|
| 709 |
+
#: includes/bookmarks-data.php:380
|
| 710 |
+
#: includes/bookmarks-data.php:400
|
| 711 |
+
#: includes/bookmarks-data.php:410
|
| 712 |
+
#: includes/bookmarks-data.php:415
|
| 713 |
+
#: includes/bookmarks-data.php:425
|
| 714 |
+
#: includes/bookmarks-data.php:435
|
| 715 |
+
#: includes/bookmarks-data.php:450
|
| 716 |
+
msgid "Share this on "
|
| 717 |
+
msgstr "Змесцаваць на "
|
| 718 |
+
|
| 719 |
+
#: includes/bookmarks-data.php:29
|
| 720 |
+
msgid "Delicious"
|
| 721 |
+
msgstr ""
|
| 722 |
+
|
| 723 |
+
#: includes/bookmarks-data.php:30
|
| 724 |
+
msgid "del.icio.us"
|
| 725 |
+
msgstr ""
|
| 726 |
+
|
| 727 |
+
#: includes/bookmarks-data.php:34
|
| 728 |
+
msgid "Digg"
|
| 729 |
+
msgstr ""
|
| 730 |
+
|
| 731 |
+
#: includes/bookmarks-data.php:35
|
| 732 |
+
msgid "Digg this!"
|
| 733 |
+
msgstr ""
|
| 734 |
+
|
| 735 |
+
#: includes/bookmarks-data.php:39
|
| 736 |
+
#: includes/bookmarks-data.php:40
|
| 737 |
+
msgid "Diigo"
|
| 738 |
+
msgstr ""
|
| 739 |
+
|
| 740 |
+
#: includes/bookmarks-data.php:40
|
| 741 |
+
msgid "Post this on "
|
| 742 |
+
msgstr "Адправіць на "
|
| 743 |
+
|
| 744 |
+
#: includes/bookmarks-data.php:44
|
| 745 |
+
#: includes/bookmarks-data.php:45
|
| 746 |
+
msgid "Reddit"
|
| 747 |
+
msgstr ""
|
| 748 |
+
|
| 749 |
+
#: includes/bookmarks-data.php:49
|
| 750 |
+
msgid "Yahoo! Buzz"
|
| 751 |
+
msgstr ""
|
| 752 |
+
|
| 753 |
+
#: includes/bookmarks-data.php:50
|
| 754 |
+
msgid "Buzz up!"
|
| 755 |
+
msgstr ""
|
| 756 |
+
|
| 757 |
+
#: includes/bookmarks-data.php:54
|
| 758 |
+
msgid "Stumbleupon"
|
| 759 |
+
msgstr ""
|
| 760 |
+
|
| 761 |
+
#: includes/bookmarks-data.php:55
|
| 762 |
+
msgid "Stumble upon something good? Share it on StumbleUpon"
|
| 763 |
+
msgstr "Знайшлі штосьці цікавае? Падзеліцеся гэтым на StumbleUpon"
|
| 764 |
+
|
| 765 |
+
#: includes/bookmarks-data.php:59
|
| 766 |
+
#: includes/bookmarks-data.php:60
|
| 767 |
+
msgid "Technorati"
|
| 768 |
+
msgstr ""
|
| 769 |
+
|
| 770 |
+
#: includes/bookmarks-data.php:64
|
| 771 |
+
#: includes/bookmarks-data.php:65
|
| 772 |
+
msgid "Mixx"
|
| 773 |
+
msgstr ""
|
| 774 |
+
|
| 775 |
+
#: includes/bookmarks-data.php:69
|
| 776 |
+
#: includes/bookmarks-data.php:70
|
| 777 |
+
msgid "MySpace"
|
| 778 |
+
msgstr ""
|
| 779 |
+
|
| 780 |
+
#: includes/bookmarks-data.php:70
|
| 781 |
+
#: includes/bookmarks-data.php:215
|
| 782 |
+
#: includes/bookmarks-data.php:240
|
| 783 |
+
#: includes/bookmarks-data.php:390
|
| 784 |
+
msgid "Post this to "
|
| 785 |
+
msgstr "Адправіць на "
|
| 786 |
+
|
| 787 |
+
#: includes/bookmarks-data.php:74
|
| 788 |
+
#: includes/bookmarks-data.php:75
|
| 789 |
+
msgid "DesignFloat"
|
| 790 |
+
msgstr ""
|
| 791 |
+
|
| 792 |
+
#: includes/bookmarks-data.php:79
|
| 793 |
+
#: includes/bookmarks-data.php:80
|
| 794 |
+
msgid "Facebook"
|
| 795 |
+
msgstr ""
|
| 796 |
+
|
| 797 |
+
#: includes/bookmarks-data.php:84
|
| 798 |
+
msgid "Twitter"
|
| 799 |
+
msgstr ""
|
| 800 |
+
|
| 801 |
+
#: includes/bookmarks-data.php:85
|
| 802 |
+
msgid "Tweet This!"
|
| 803 |
+
msgstr ""
|
| 804 |
+
|
| 805 |
+
#: includes/bookmarks-data.php:89
|
| 806 |
+
msgid "'Email to a Friend' link"
|
| 807 |
+
msgstr "Адправіць сябру спасылку па email"
|
| 808 |
+
|
| 809 |
+
#: includes/bookmarks-data.php:90
|
| 810 |
+
msgid "Email this to a friend?"
|
| 811 |
+
msgstr "Адправіць па email сябру?"
|
| 812 |
+
|
| 813 |
+
#: includes/bookmarks-data.php:91
|
| 814 |
+
msgid "I thought this article might interest you."
|
| 815 |
+
msgstr "Я думаю, што гэты артыкул можа зацікавіць."
|
| 816 |
+
|
| 817 |
+
#: includes/bookmarks-data.php:91
|
| 818 |
+
#: includes/bookmarks-data.php:96
|
| 819 |
+
msgid "You can read the full article here"
|
| 820 |
+
msgstr "Чытаць артыкул цалкам"
|
| 821 |
+
|
| 822 |
+
#: includes/bookmarks-data.php:94
|
| 823 |
+
#: includes/bookmarks-data.php:95
|
| 824 |
+
msgid "ToMuse"
|
| 825 |
+
msgstr ""
|
| 826 |
+
|
| 827 |
+
#: includes/bookmarks-data.php:95
|
| 828 |
+
msgid "Suggest this article to "
|
| 829 |
+
msgstr ""
|
| 830 |
+
|
| 831 |
+
#: includes/bookmarks-data.php:96
|
| 832 |
+
msgid "New tip submitted via the SexyBookmarks Plugin!"
|
| 833 |
+
msgstr ""
|
| 834 |
+
|
| 835 |
+
#: includes/bookmarks-data.php:96
|
| 836 |
+
msgid "I would like to submit this article"
|
| 837 |
+
msgstr ""
|
| 838 |
+
|
| 839 |
+
#: includes/bookmarks-data.php:96
|
| 840 |
+
msgid "for possible inclusion on ToMuse."
|
| 841 |
+
msgstr ""
|
| 842 |
+
|
| 843 |
+
#: includes/bookmarks-data.php:99
|
| 844 |
+
msgid "a 'Subscribe to Comments' link"
|
| 845 |
+
msgstr "'Падпісацца на каментары'"
|
| 846 |
+
|
| 847 |
+
#: includes/bookmarks-data.php:100
|
| 848 |
+
msgid "Subscribe to the comments for this post?"
|
| 849 |
+
msgstr "Падпісацца на каментары да гэтага запісу?"
|
| 850 |
+
|
| 851 |
+
#: includes/bookmarks-data.php:104
|
| 852 |
+
#: includes/bookmarks-data.php:105
|
| 853 |
+
msgid "Linkedin"
|
| 854 |
+
msgstr ""
|
| 855 |
+
|
| 856 |
+
#: includes/bookmarks-data.php:109
|
| 857 |
+
#: includes/bookmarks-data.php:110
|
| 858 |
+
msgid "Newsvine"
|
| 859 |
+
msgstr ""
|
| 860 |
+
|
| 861 |
+
#: includes/bookmarks-data.php:110
|
| 862 |
+
msgid "Seed this on "
|
| 863 |
+
msgstr "Змесцаваць на "
|
| 864 |
+
|
| 865 |
+
#: includes/bookmarks-data.php:114
|
| 866 |
+
#: includes/bookmarks-data.php:115
|
| 867 |
+
msgid "Google Bookmarks"
|
| 868 |
+
msgstr "Закладкі Google"
|
| 869 |
+
|
| 870 |
+
#: includes/bookmarks-data.php:115
|
| 871 |
+
#: includes/bookmarks-data.php:120
|
| 872 |
+
#: includes/bookmarks-data.php:125
|
| 873 |
+
#: includes/bookmarks-data.php:130
|
| 874 |
+
#: includes/bookmarks-data.php:175
|
| 875 |
+
#: includes/bookmarks-data.php:180
|
| 876 |
+
#: includes/bookmarks-data.php:185
|
| 877 |
+
#: includes/bookmarks-data.php:190
|
| 878 |
+
#: includes/bookmarks-data.php:210
|
| 879 |
+
#: includes/bookmarks-data.php:385
|
| 880 |
+
#: includes/bookmarks-data.php:405
|
| 881 |
+
#: includes/bookmarks-data.php:430
|
| 882 |
+
msgid "Add this to "
|
| 883 |
+
msgstr "Дадаць у "
|
| 884 |
+
|
| 885 |
+
#: includes/bookmarks-data.php:119
|
| 886 |
+
#: includes/bookmarks-data.php:120
|
| 887 |
+
msgid "Google Reader"
|
| 888 |
+
msgstr ""
|
| 889 |
+
|
| 890 |
+
#: includes/bookmarks-data.php:124
|
| 891 |
+
#: includes/bookmarks-data.php:125
|
| 892 |
+
msgid "Mister Wong"
|
| 893 |
+
msgstr ""
|
| 894 |
+
|
| 895 |
+
#: includes/bookmarks-data.php:129
|
| 896 |
+
#: includes/bookmarks-data.php:130
|
| 897 |
+
msgid "Izeby"
|
| 898 |
+
msgstr ""
|
| 899 |
+
|
| 900 |
+
#: includes/bookmarks-data.php:134
|
| 901 |
+
#: includes/bookmarks-data.php:135
|
| 902 |
+
msgid "Tipd"
|
| 903 |
+
msgstr ""
|
| 904 |
+
|
| 905 |
+
#: includes/bookmarks-data.php:139
|
| 906 |
+
#: includes/bookmarks-data.php:140
|
| 907 |
+
msgid "PFBuzz"
|
| 908 |
+
msgstr ""
|
| 909 |
+
|
| 910 |
+
#: includes/bookmarks-data.php:144
|
| 911 |
+
#: includes/bookmarks-data.php:145
|
| 912 |
+
msgid "FriendFeed"
|
| 913 |
+
msgstr ""
|
| 914 |
+
|
| 915 |
+
#: includes/bookmarks-data.php:149
|
| 916 |
+
#: includes/bookmarks-data.php:150
|
| 917 |
+
msgid "BlogMarks"
|
| 918 |
+
msgstr ""
|
| 919 |
+
|
| 920 |
+
#: includes/bookmarks-data.php:150
|
| 921 |
+
msgid "Mark this on "
|
| 922 |
+
msgstr "Адзначыць на "
|
| 923 |
+
|
| 924 |
+
#: includes/bookmarks-data.php:154
|
| 925 |
+
#: includes/bookmarks-data.php:155
|
| 926 |
+
msgid "Twittley"
|
| 927 |
+
msgstr ""
|
| 928 |
+
|
| 929 |
+
#: includes/bookmarks-data.php:159
|
| 930 |
+
#: includes/bookmarks-data.php:160
|
| 931 |
+
msgid "Fwisp"
|
| 932 |
+
msgstr ""
|
| 933 |
+
|
| 934 |
+
#: includes/bookmarks-data.php:164
|
| 935 |
+
#: includes/bookmarks-data.php:165
|
| 936 |
+
msgid "DesignMoo"
|
| 937 |
+
msgstr ""
|
| 938 |
+
|
| 939 |
+
#: includes/bookmarks-data.php:165
|
| 940 |
+
msgid "Moo this on "
|
| 941 |
+
msgstr ""
|
| 942 |
+
|
| 943 |
+
#: includes/bookmarks-data.php:169
|
| 944 |
+
#: includes/bookmarks-data.php:170
|
| 945 |
+
msgid "BobrDobr"
|
| 946 |
+
msgstr ""
|
| 947 |
+
|
| 948 |
+
#: includes/bookmarks-data.php:169
|
| 949 |
+
#: includes/bookmarks-data.php:174
|
| 950 |
+
#: includes/bookmarks-data.php:179
|
| 951 |
+
#: includes/bookmarks-data.php:184
|
| 952 |
+
#: includes/bookmarks-data.php:189
|
| 953 |
+
msgid " (Russian)"
|
| 954 |
+
msgstr " (Рускі)"
|
| 955 |
+
|
| 956 |
+
#: includes/bookmarks-data.php:174
|
| 957 |
+
#: includes/bookmarks-data.php:175
|
| 958 |
+
msgid "Yandex.Bookmarks"
|
| 959 |
+
msgstr "Яндэкс.Закладкі"
|
| 960 |
+
|
| 961 |
+
#: includes/bookmarks-data.php:179
|
| 962 |
+
#: includes/bookmarks-data.php:180
|
| 963 |
+
msgid "Memory.ru"
|
| 964 |
+
msgstr ""
|
| 965 |
+
|
| 966 |
+
#: includes/bookmarks-data.php:184
|
| 967 |
+
#: includes/bookmarks-data.php:185
|
| 968 |
+
msgid "100 bookmarks"
|
| 969 |
+
msgstr "100 закладак"
|
| 970 |
+
|
| 971 |
+
#: includes/bookmarks-data.php:189
|
| 972 |
+
#: includes/bookmarks-data.php:190
|
| 973 |
+
msgid "MyPlace"
|
| 974 |
+
msgstr "Моеместо"
|
| 975 |
+
|
| 976 |
+
#: includes/bookmarks-data.php:194
|
| 977 |
+
#: includes/bookmarks-data.php:195
|
| 978 |
+
msgid "Hacker News"
|
| 979 |
+
msgstr ""
|
| 980 |
+
|
| 981 |
+
#: includes/bookmarks-data.php:199
|
| 982 |
+
#: includes/bookmarks-data.php:200
|
| 983 |
+
msgid "Print Friendly"
|
| 984 |
+
msgstr ""
|
| 985 |
+
|
| 986 |
+
#: includes/bookmarks-data.php:200
|
| 987 |
+
msgid "Send this page to "
|
| 988 |
+
msgstr ""
|
| 989 |
+
|
| 990 |
+
#: includes/bookmarks-data.php:204
|
| 991 |
+
msgid "Design Bump"
|
| 992 |
+
msgstr ""
|
| 993 |
+
|
| 994 |
+
#: includes/bookmarks-data.php:205
|
| 995 |
+
msgid "Bump this on "
|
| 996 |
+
msgstr ""
|
| 997 |
+
|
| 998 |
+
#: includes/bookmarks-data.php:205
|
| 999 |
+
msgid "DesignBump"
|
| 1000 |
+
msgstr ""
|
| 1001 |
+
|
| 1002 |
+
#: includes/bookmarks-data.php:209
|
| 1003 |
+
#: includes/bookmarks-data.php:210
|
| 1004 |
+
msgid "Ning"
|
| 1005 |
+
msgstr ""
|
| 1006 |
+
|
| 1007 |
+
#: includes/bookmarks-data.php:214
|
| 1008 |
+
#: includes/bookmarks-data.php:215
|
| 1009 |
+
msgid "Identica"
|
| 1010 |
+
msgstr ""
|
| 1011 |
+
|
| 1012 |
+
#: includes/bookmarks-data.php:219
|
| 1013 |
+
#: includes/bookmarks-data.php:220
|
| 1014 |
+
msgid "Xerpi"
|
| 1015 |
+
msgstr ""
|
| 1016 |
+
|
| 1017 |
+
#: includes/bookmarks-data.php:220
|
| 1018 |
+
msgid "Save this to "
|
| 1019 |
+
msgstr ""
|
| 1020 |
+
|
| 1021 |
+
#: includes/bookmarks-data.php:224
|
| 1022 |
+
#: includes/bookmarks-data.php:225
|
| 1023 |
+
msgid "Wikio"
|
| 1024 |
+
msgstr ""
|
| 1025 |
+
|
| 1026 |
+
#: includes/bookmarks-data.php:229
|
| 1027 |
+
#: includes/bookmarks-data.php:230
|
| 1028 |
+
msgid "TechMeme"
|
| 1029 |
+
msgstr ""
|
| 1030 |
+
|
| 1031 |
+
#: includes/bookmarks-data.php:230
|
| 1032 |
+
msgid "Tip this to "
|
| 1033 |
+
msgstr ""
|
| 1034 |
+
|
| 1035 |
+
#: includes/bookmarks-data.php:234
|
| 1036 |
+
#: includes/bookmarks-data.php:235
|
| 1037 |
+
msgid "Sphinn"
|
| 1038 |
+
msgstr ""
|
| 1039 |
+
|
| 1040 |
+
#: includes/bookmarks-data.php:235
|
| 1041 |
+
msgid "Sphinn this on "
|
| 1042 |
+
msgstr ""
|
| 1043 |
+
|
| 1044 |
+
#: includes/bookmarks-data.php:239
|
| 1045 |
+
#: includes/bookmarks-data.php:240
|
| 1046 |
+
msgid "Posterous"
|
| 1047 |
+
msgstr ""
|
| 1048 |
+
|
| 1049 |
+
#: includes/bookmarks-data.php:244
|
| 1050 |
+
#: includes/bookmarks-data.php:245
|
| 1051 |
+
msgid "Global Grind"
|
| 1052 |
+
msgstr ""
|
| 1053 |
+
|
| 1054 |
+
#: includes/bookmarks-data.php:245
|
| 1055 |
+
msgid "Grind this! on "
|
| 1056 |
+
msgstr ""
|
| 1057 |
+
|
| 1058 |
+
#: includes/bookmarks-data.php:249
|
| 1059 |
+
#: includes/bookmarks-data.php:250
|
| 1060 |
+
msgid "Ping.fm"
|
| 1061 |
+
msgstr ""
|
| 1062 |
+
|
| 1063 |
+
#: includes/bookmarks-data.php:250
|
| 1064 |
+
msgid "Ping this on "
|
| 1065 |
+
msgstr ""
|
| 1066 |
+
|
| 1067 |
+
#: includes/bookmarks-data.php:254
|
| 1068 |
+
#: includes/bookmarks-data.php:255
|
| 1069 |
+
msgid "NUjij"
|
| 1070 |
+
msgstr ""
|
| 1071 |
+
|
| 1072 |
+
#: includes/bookmarks-data.php:254
|
| 1073 |
+
#: includes/bookmarks-data.php:259
|
| 1074 |
+
msgid " (Dutch)"
|
| 1075 |
+
msgstr " (Галандскі)"
|
| 1076 |
+
|
| 1077 |
+
#: includes/bookmarks-data.php:259
|
| 1078 |
+
#: includes/bookmarks-data.php:260
|
| 1079 |
+
msgid "eKudos"
|
| 1080 |
+
msgstr ""
|
| 1081 |
+
|
| 1082 |
+
#: includes/bookmarks-data.php:264
|
| 1083 |
+
#: includes/bookmarks-data.php:265
|
| 1084 |
+
msgid "Netvouz"
|
| 1085 |
+
msgstr ""
|
| 1086 |
+
|
| 1087 |
+
#: includes/bookmarks-data.php:269
|
| 1088 |
+
#: includes/bookmarks-data.php:270
|
| 1089 |
+
msgid "Netvibes"
|
| 1090 |
+
msgstr ""
|
| 1091 |
+
|
| 1092 |
+
#: includes/bookmarks-data.php:274
|
| 1093 |
+
#: includes/bookmarks-data.php:275
|
| 1094 |
+
msgid "Fleck"
|
| 1095 |
+
msgstr ""
|
| 1096 |
+
|
| 1097 |
+
#: includes/bookmarks-data.php:279
|
| 1098 |
+
#: includes/bookmarks-data.php:280
|
| 1099 |
+
msgid "Blogosphere News"
|
| 1100 |
+
msgstr ""
|
| 1101 |
+
|
| 1102 |
+
#: includes/bookmarks-data.php:284
|
| 1103 |
+
msgid "Web Blend"
|
| 1104 |
+
msgstr ""
|
| 1105 |
+
|
| 1106 |
+
#: includes/bookmarks-data.php:285
|
| 1107 |
+
msgid "Blend this!"
|
| 1108 |
+
msgstr ""
|
| 1109 |
+
|
| 1110 |
+
#: includes/bookmarks-data.php:289
|
| 1111 |
+
msgid "Wykop"
|
| 1112 |
+
msgstr ""
|
| 1113 |
+
|
| 1114 |
+
#: includes/bookmarks-data.php:289
|
| 1115 |
+
msgid " (Polish)"
|
| 1116 |
+
msgstr " (Польскі)"
|
| 1117 |
+
|
| 1118 |
+
#: includes/bookmarks-data.php:290
|
| 1119 |
+
msgid "Add this to Wykop!"
|
| 1120 |
+
msgstr "Дадаць на Wykop!"
|
| 1121 |
+
|
| 1122 |
+
#: includes/bookmarks-data.php:294
|
| 1123 |
+
msgid "BlogEngage"
|
| 1124 |
+
msgstr ""
|
| 1125 |
+
|
| 1126 |
+
#: includes/bookmarks-data.php:295
|
| 1127 |
+
msgid "Engage with this article!"
|
| 1128 |
+
msgstr ""
|
| 1129 |
+
|
| 1130 |
+
#: includes/bookmarks-data.php:299
|
| 1131 |
+
#: includes/bookmarks-data.php:300
|
| 1132 |
+
msgid "Hyves"
|
| 1133 |
+
msgstr ""
|
| 1134 |
+
|
| 1135 |
+
#: includes/bookmarks-data.php:304
|
| 1136 |
+
#: includes/bookmarks-data.php:305
|
| 1137 |
+
msgid "Pusha"
|
| 1138 |
+
msgstr ""
|
| 1139 |
+
|
| 1140 |
+
#: includes/bookmarks-data.php:304
|
| 1141 |
+
msgid " (Swedish)"
|
| 1142 |
+
msgstr " (Швецкі)"
|
| 1143 |
+
|
| 1144 |
+
#: includes/bookmarks-data.php:305
|
| 1145 |
+
msgid "Push this on "
|
| 1146 |
+
msgstr ""
|
| 1147 |
+
|
| 1148 |
+
#: includes/bookmarks-data.php:309
|
| 1149 |
+
#: includes/bookmarks-data.php:310
|
| 1150 |
+
msgid "Hatena Bookmarks"
|
| 1151 |
+
msgstr ""
|
| 1152 |
+
|
| 1153 |
+
#: includes/bookmarks-data.php:309
|
| 1154 |
+
msgid " (Japanese)"
|
| 1155 |
+
msgstr " (Японскі)"
|
| 1156 |
+
|
| 1157 |
+
#: includes/bookmarks-data.php:310
|
| 1158 |
+
msgid "Bookmarks this on "
|
| 1159 |
+
msgstr ""
|
| 1160 |
+
|
| 1161 |
+
#: includes/bookmarks-data.php:314
|
| 1162 |
+
#: includes/bookmarks-data.php:315
|
| 1163 |
+
msgid "MyLinkVault"
|
| 1164 |
+
msgstr ""
|
| 1165 |
+
|
| 1166 |
+
#: includes/bookmarks-data.php:315
|
| 1167 |
+
msgid "Store this link on "
|
| 1168 |
+
msgstr ""
|
| 1169 |
+
|
| 1170 |
+
#: includes/bookmarks-data.php:319
|
| 1171 |
+
#: includes/bookmarks-data.php:320
|
| 1172 |
+
msgid "SlashDot"
|
| 1173 |
+
msgstr ""
|
| 1174 |
+
|
| 1175 |
+
#: includes/bookmarks-data.php:324
|
| 1176 |
+
#: includes/bookmarks-data.php:325
|
| 1177 |
+
msgid "Squidoo"
|
| 1178 |
+
msgstr ""
|
| 1179 |
+
|
| 1180 |
+
#: includes/bookmarks-data.php:325
|
| 1181 |
+
msgid "Add to a lense on "
|
| 1182 |
+
msgstr ""
|
| 1183 |
+
|
| 1184 |
+
#: includes/bookmarks-data.php:329
|
| 1185 |
+
#: includes/bookmarks-data.php:330
|
| 1186 |
+
msgid "Propeller"
|
| 1187 |
+
msgstr ""
|
| 1188 |
+
|
| 1189 |
+
#: includes/bookmarks-data.php:330
|
| 1190 |
+
msgid "Submit this story to "
|
| 1191 |
+
msgstr ""
|
| 1192 |
+
|
| 1193 |
+
#: includes/bookmarks-data.php:334
|
| 1194 |
+
#: includes/bookmarks-data.php:335
|
| 1195 |
+
msgid "FAQpal"
|
| 1196 |
+
msgstr ""
|
| 1197 |
+
|
| 1198 |
+
#: includes/bookmarks-data.php:339
|
| 1199 |
+
#: includes/bookmarks-data.php:340
|
| 1200 |
+
msgid "Evernote"
|
| 1201 |
+
msgstr ""
|
| 1202 |
+
|
| 1203 |
+
#: includes/bookmarks-data.php:340
|
| 1204 |
+
msgid "Clip this to "
|
| 1205 |
+
msgstr "Захаваць на "
|
| 1206 |
+
|
| 1207 |
+
#: includes/bookmarks-data.php:344
|
| 1208 |
+
#: includes/bookmarks-data.php:345
|
| 1209 |
+
msgid "Meneame"
|
| 1210 |
+
msgstr ""
|
| 1211 |
+
|
| 1212 |
+
#: includes/bookmarks-data.php:344
|
| 1213 |
+
#: includes/bookmarks-data.php:349
|
| 1214 |
+
msgid " (Spanish)"
|
| 1215 |
+
msgstr " (Іспанскі)"
|
| 1216 |
+
|
| 1217 |
+
#: includes/bookmarks-data.php:349
|
| 1218 |
+
#: includes/bookmarks-data.php:350
|
| 1219 |
+
msgid "Bitacoras"
|
| 1220 |
+
msgstr ""
|
| 1221 |
+
|
| 1222 |
+
#: includes/bookmarks-data.php:354
|
| 1223 |
+
#: includes/bookmarks-data.php:355
|
| 1224 |
+
msgid "JumpTags"
|
| 1225 |
+
msgstr ""
|
| 1226 |
+
|
| 1227 |
+
#: includes/bookmarks-data.php:355
|
| 1228 |
+
msgid "Submit this link to "
|
| 1229 |
+
msgstr ""
|
| 1230 |
+
|
| 1231 |
+
#: includes/bookmarks-data.php:359
|
| 1232 |
+
#: includes/bookmarks-data.php:360
|
| 1233 |
+
msgid "Bebo"
|
| 1234 |
+
msgstr ""
|
| 1235 |
+
|
| 1236 |
+
#: includes/bookmarks-data.php:364
|
| 1237 |
+
#: includes/bookmarks-data.php:365
|
| 1238 |
+
msgid "N4G"
|
| 1239 |
+
msgstr ""
|
| 1240 |
+
|
| 1241 |
+
#: includes/bookmarks-data.php:365
|
| 1242 |
+
msgid "Submit tip to "
|
| 1243 |
+
msgstr ""
|
| 1244 |
+
|
| 1245 |
+
#: includes/bookmarks-data.php:369
|
| 1246 |
+
#: includes/bookmarks-data.php:370
|
| 1247 |
+
msgid "Strands"
|
| 1248 |
+
msgstr ""
|
| 1249 |
+
|
| 1250 |
+
#: includes/bookmarks-data.php:374
|
| 1251 |
+
#: includes/bookmarks-data.php:375
|
| 1252 |
+
msgid "Orkut"
|
| 1253 |
+
msgstr ""
|
| 1254 |
+
|
| 1255 |
+
#: includes/bookmarks-data.php:375
|
| 1256 |
+
msgid "Promote this on "
|
| 1257 |
+
msgstr ""
|
| 1258 |
+
|
| 1259 |
+
#: includes/bookmarks-data.php:379
|
| 1260 |
+
#: includes/bookmarks-data.php:380
|
| 1261 |
+
msgid "Tumblr"
|
| 1262 |
+
msgstr ""
|
| 1263 |
+
|
| 1264 |
+
#: includes/bookmarks-data.php:384
|
| 1265 |
+
#: includes/bookmarks-data.php:385
|
| 1266 |
+
msgid "Stumpedia"
|
| 1267 |
+
msgstr ""
|
| 1268 |
+
|
| 1269 |
+
#: includes/bookmarks-data.php:389
|
| 1270 |
+
#: includes/bookmarks-data.php:390
|
| 1271 |
+
msgid "Current"
|
| 1272 |
+
msgstr ""
|
| 1273 |
+
|
| 1274 |
+
#: includes/bookmarks-data.php:394
|
| 1275 |
+
#: includes/bookmarks-data.php:395
|
| 1276 |
+
msgid "Blogger"
|
| 1277 |
+
msgstr ""
|
| 1278 |
+
|
| 1279 |
+
#: includes/bookmarks-data.php:395
|
| 1280 |
+
msgid "Blog this on "
|
| 1281 |
+
msgstr ""
|
| 1282 |
+
|
| 1283 |
+
#: includes/bookmarks-data.php:399
|
| 1284 |
+
#: includes/bookmarks-data.php:400
|
| 1285 |
+
msgid "Plurk"
|
| 1286 |
+
msgstr ""
|
| 1287 |
+
|
| 1288 |
+
#: includes/bookmarks-data.php:404
|
| 1289 |
+
#: includes/bookmarks-data.php:405
|
| 1290 |
+
msgid "DZone"
|
| 1291 |
+
msgstr ""
|
| 1292 |
+
|
| 1293 |
+
#: includes/bookmarks-data.php:409
|
| 1294 |
+
#: includes/bookmarks-data.php:410
|
| 1295 |
+
msgid "Kaevur"
|
| 1296 |
+
msgstr ""
|
| 1297 |
+
|
| 1298 |
+
#: includes/bookmarks-data.php:409
|
| 1299 |
+
msgid " (Estonian)"
|
| 1300 |
+
msgstr " (Эстонскі)"
|
| 1301 |
+
|
| 1302 |
+
#: includes/bookmarks-data.php:414
|
| 1303 |
+
#: includes/bookmarks-data.php:415
|
| 1304 |
+
msgid "Virb"
|
| 1305 |
+
msgstr ""
|
| 1306 |
+
|
| 1307 |
+
#: includes/bookmarks-data.php:419
|
| 1308 |
+
#: includes/bookmarks-data.php:420
|
| 1309 |
+
msgid "Box.net"
|
| 1310 |
+
msgstr ""
|
| 1311 |
+
|
| 1312 |
+
#: includes/bookmarks-data.php:420
|
| 1313 |
+
msgid "Add this link to "
|
| 1314 |
+
msgstr "Дадаць спасылку на "
|
| 1315 |
+
|
| 1316 |
+
#: includes/bookmarks-data.php:424
|
| 1317 |
+
#: includes/bookmarks-data.php:425
|
| 1318 |
+
msgid "OkNotizie"
|
| 1319 |
+
msgstr ""
|
| 1320 |
+
|
| 1321 |
+
#: includes/bookmarks-data.php:424
|
| 1322 |
+
msgid "(Italian)"
|
| 1323 |
+
msgstr " (Італьянскі)"
|
| 1324 |
+
|
| 1325 |
+
#: includes/bookmarks-data.php:429
|
| 1326 |
+
#: includes/bookmarks-data.php:430
|
| 1327 |
+
msgid "BonzoBox"
|
| 1328 |
+
msgstr ""
|
| 1329 |
+
|
| 1330 |
+
#: includes/bookmarks-data.php:434
|
| 1331 |
+
#: includes/bookmarks-data.php:435
|
| 1332 |
+
msgid "Plaxo"
|
| 1333 |
+
msgstr ""
|
| 1334 |
+
|
| 1335 |
+
#: includes/bookmarks-data.php:439
|
| 1336 |
+
#: includes/bookmarks-data.php:440
|
| 1337 |
+
msgid "SpringPad"
|
| 1338 |
+
msgstr ""
|
| 1339 |
+
|
| 1340 |
+
#: includes/bookmarks-data.php:440
|
| 1341 |
+
msgid "Spring this on "
|
| 1342 |
+
msgstr ""
|
| 1343 |
+
|
| 1344 |
+
#: includes/bookmarks-data.php:444
|
| 1345 |
+
#: includes/bookmarks-data.php:445
|
| 1346 |
+
msgid "Zabox"
|
| 1347 |
+
msgstr ""
|
| 1348 |
+
|
| 1349 |
+
#: includes/bookmarks-data.php:445
|
| 1350 |
+
msgid "Box this on "
|
| 1351 |
+
msgstr ""
|
| 1352 |
+
|
| 1353 |
+
#: includes/bookmarks-data.php:449
|
| 1354 |
+
#: includes/bookmarks-data.php:450
|
| 1355 |
+
msgid "Viadeo"
|
| 1356 |
+
msgstr ""
|
| 1357 |
+
|
| 1358 |
+
#: includes/public.php:184
|
| 1359 |
+
msgid "an error occurred in SexyBookmarks"
|
| 1360 |
+
msgstr "Памылка ў SexyBookmarks"
|
| 1361 |
+
|
| 1362 |
+
#: includes/public.php:433
|
| 1363 |
+
msgid "SexyBookmarks has been disabled on this page"
|
| 1364 |
+
msgstr "Адключыць SexyBookmarks на гэтай старонцы"
|
| 1365 |
+
|
languages/shrsb-bg_BG.mo
ADDED
|
Binary file
|
languages/shrsb-bg_BG.po
ADDED
|
@@ -0,0 +1,804 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# Copyright (C) 2010
|
| 2 |
+
# This file is distributed under the same license as the package.
|
| 3 |
+
msgid ""
|
| 4 |
+
msgstr ""
|
| 5 |
+
"Project-Id-Version: shrsb-bg_BG\n"
|
| 6 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/sexybookmarks\n"
|
| 7 |
+
"POT-Creation-Date: 2011-01-23 21:26:57+00:00\n"
|
| 8 |
+
"MIME-Version: 1.0\n"
|
| 9 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
| 10 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 11 |
+
"PO-Revision-Date: 2011-10-03 11:08+0200\n"
|
| 12 |
+
"Last-Translator: Nikolay Nikolov <statiiki@abv.bg>\n"
|
| 13 |
+
"Language-Team: Nikolay Nikolov <statiiki@abv.bg>\n"
|
| 14 |
+
"X-Poedit-Language: Bulgarian\n"
|
| 15 |
+
"X-Poedit-Country: BULGARIA\n"
|
| 16 |
+
"X-Poedit-SourceCharset: utf-8\n"
|
| 17 |
+
|
| 18 |
+
# %sPlugin Options Page%s
|
| 19 |
+
#: sexy-bookmarks.php:138
|
| 20 |
+
msgid "NOTICE: Shareaholic was updated... Please visit the %sPlugin Options Page%s and re-save your preferences."
|
| 21 |
+
msgstr "СЪОБЩЕНИЕ: Shareaholic беше обновен... Моля, посетете %sстраницата с настройките на разширението%s и запазете отново вашите настройки."
|
| 22 |
+
|
| 23 |
+
# %sPlugin Options Page%s
|
| 24 |
+
#: sexy-bookmarks.php:176
|
| 25 |
+
msgid "NOTICE: Shareaholic needs to be configured... Please visit the %sPlugin Options Page%s and set your preferences."
|
| 26 |
+
msgstr "СЪОБЩЕНИЕ: Shareaholic трябва да бъде настроен... Моля, посетете %sстраницата с настройките на разширението%s и задайте вашите настройки."
|
| 27 |
+
|
| 28 |
+
#: sexy-bookmarks.php:228
|
| 29 |
+
msgid "WARNING: You are about to reset all settings to their default state! Do you wish to continue?"
|
| 30 |
+
msgstr "ВНИМАНИЕ: На път сте да възстановите всички настройки към състоянието им по подразбиране! Желаете ли да продължите?"
|
| 31 |
+
|
| 32 |
+
#: sexy-bookmarks.php:232
|
| 33 |
+
#: sexy-bookmarks.php:480
|
| 34 |
+
#: sexy-bookmarks.php:542
|
| 35 |
+
#: sexy-bookmarks.php:633
|
| 36 |
+
#: sexy-bookmarks.php:637
|
| 37 |
+
#: sexy-bookmarks.php:641
|
| 38 |
+
#: sexy-bookmarks.php:646
|
| 39 |
+
#: sexy-bookmarks.php:707
|
| 40 |
+
#: sexy-bookmarks.php:788
|
| 41 |
+
msgid "Yes"
|
| 42 |
+
msgstr "Да"
|
| 43 |
+
|
| 44 |
+
#: sexy-bookmarks.php:232
|
| 45 |
+
#: sexy-bookmarks.php:542
|
| 46 |
+
msgid "Cancel"
|
| 47 |
+
msgstr "Отказ"
|
| 48 |
+
|
| 49 |
+
#: sexy-bookmarks.php:273
|
| 50 |
+
msgid "All settings have been reset to their default values."
|
| 51 |
+
msgstr "Всички настройки са възстановени към състоянието си по подразбиране."
|
| 52 |
+
|
| 53 |
+
#: sexy-bookmarks.php:317
|
| 54 |
+
msgid "Your changes have been saved successfully!"
|
| 55 |
+
msgstr "Промените са запазени успешно!"
|
| 56 |
+
|
| 57 |
+
#: sexy-bookmarks.php:320
|
| 58 |
+
msgid "Please choose where you would like the menu to be displayed."
|
| 59 |
+
msgstr "Моля, изберете къде да се показва менюто."
|
| 60 |
+
|
| 61 |
+
#: sexy-bookmarks.php:321
|
| 62 |
+
msgid "You can't display the menu if you don't choose a few sites to add to it!"
|
| 63 |
+
msgstr "Менюто не може да бъде показано ако не изберете поне няколко сайта за добавяне!"
|
| 64 |
+
|
| 65 |
+
#: sexy-bookmarks.php:322
|
| 66 |
+
msgid "Please choose where you want the menu displayed."
|
| 67 |
+
msgstr "Моля, изберете къде да бъде показано менюто."
|
| 68 |
+
|
| 69 |
+
# %sTwitter Friendly Links Plugin%s
|
| 70 |
+
#: sexy-bookmarks.php:332
|
| 71 |
+
msgid "You must first download and activate the %sTwitter Friendly Links Plugin%s before hosting your own short URLs..."
|
| 72 |
+
msgstr "Първо трябва да изтеглите и активирате %sразширението Twitter Friendly Links%s преди да можете да си създавате собствени кратки URL адреси..."
|
| 73 |
+
|
| 74 |
+
# %sYOURLS Plugin%s
|
| 75 |
+
#: sexy-bookmarks.php:334
|
| 76 |
+
msgid "You must first download and activate the %sYOURLS Plugin%s before hosting your own short URLs..."
|
| 77 |
+
msgstr "Първо трябва да изтеглите и активирате %sразширението YOURLS%s преди да можете да си създавате собствени кратки URL адреси..."
|
| 78 |
+
|
| 79 |
+
#: sexy-bookmarks.php:351
|
| 80 |
+
msgid "WARNING: The request for a custom sprite has timed out. Reverting to default sprite files."
|
| 81 |
+
msgstr "ВНИМАНИЕ: Времето за заявката за собствено фоново изображение от тип sprite изтече. Възстановени са sprite файловете по подразбиране."
|
| 82 |
+
|
| 83 |
+
#: sexy-bookmarks.php:353
|
| 84 |
+
msgid "Changes saved successfully. However, you should try to generate a custom sprite again later."
|
| 85 |
+
msgstr "Промените са запазени успешно. Обаче, трябва да опитате да генерирате собствено фоново изображение от тип sprite отново по-късно."
|
| 86 |
+
|
| 87 |
+
# %sspritegen folder%s
|
| 88 |
+
# %sNeed Help?%s
|
| 89 |
+
#: sexy-bookmarks.php:357
|
| 90 |
+
#: sexy-bookmarks.php:379
|
| 91 |
+
msgid "WARNING: Your %sspritegen folder%s is not writeable by the server! %sNeed Help?%s"
|
| 92 |
+
msgstr "ВНИМАНИЕ: Забранено е записването във вашата %sspritegen папка%s! %sИмате нужда от помощ?%s"
|
| 93 |
+
|
| 94 |
+
#: sexy-bookmarks.php:359
|
| 95 |
+
#: sexy-bookmarks.php:364
|
| 96 |
+
#: sexy-bookmarks.php:369
|
| 97 |
+
#: sexy-bookmarks.php:380
|
| 98 |
+
#: sexy-bookmarks.php:384
|
| 99 |
+
#: sexy-bookmarks.php:388
|
| 100 |
+
msgid "Changes saved successfully. However, settings are not optimal until you resolve the issue listed above."
|
| 101 |
+
msgstr "Промените са запазени успешно. Обаче, настройките няма да бъдат оптимални, докато не решите проблема описан отгоре."
|
| 102 |
+
|
| 103 |
+
# %sNeed Help?%s
|
| 104 |
+
#: sexy-bookmarks.php:362
|
| 105 |
+
#: sexy-bookmarks.php:383
|
| 106 |
+
msgid "WARNING: You need to delete the current custom sprite %s before the plugin can write to the folder. %sNeed Help?%s"
|
| 107 |
+
msgstr "ВНИМАНИЕ: Трябва да изтриете текущото потребителско фоново изображение от тип sprite %s преди разширението да може да записва в папката. %sИмате нужда от помощ?%s"
|
| 108 |
+
|
| 109 |
+
# %sNeed Help?%s
|
| 110 |
+
#: sexy-bookmarks.php:367
|
| 111 |
+
#: sexy-bookmarks.php:387
|
| 112 |
+
msgid "WARNING: You need to delete the current custom stylesheet %s before the plugin can write to the folder. %sNeed Help?%s"
|
| 113 |
+
msgstr "ВНИМАНИЕ: Трябва да изтриете текущия потребителски стил %s преди разширението да може да записва в папката. %sИмате нужда от помощ?%s"
|
| 114 |
+
|
| 115 |
+
#: sexy-bookmarks.php:394
|
| 116 |
+
msgid "Short URL(s) have been reset."
|
| 117 |
+
msgstr "Кратките URL адреси са нулирани."
|
| 118 |
+
|
| 119 |
+
#: sexy-bookmarks.php:473
|
| 120 |
+
msgid "BETA Testing"
|
| 121 |
+
msgstr "БЕТА тестване"
|
| 122 |
+
|
| 123 |
+
#: sexy-bookmarks.php:478
|
| 124 |
+
msgid "We completely re-wrote Shareaholic from the ground up to make it faster, leaner, better."
|
| 125 |
+
msgstr "Ние напълно пренаписахме Shareaholic от нулата, за да го направим по-бърз, по-изчистен и по-добър."
|
| 126 |
+
|
| 127 |
+
#: sexy-bookmarks.php:479
|
| 128 |
+
msgid "Use the new version? (BETA)"
|
| 129 |
+
msgstr "Използвайте новата версия? (БЕТА)"
|
| 130 |
+
|
| 131 |
+
#: sexy-bookmarks.php:481
|
| 132 |
+
#: sexy-bookmarks.php:634
|
| 133 |
+
#: sexy-bookmarks.php:638
|
| 134 |
+
#: sexy-bookmarks.php:642
|
| 135 |
+
#: sexy-bookmarks.php:647
|
| 136 |
+
#: sexy-bookmarks.php:651
|
| 137 |
+
#: sexy-bookmarks.php:708
|
| 138 |
+
#: sexy-bookmarks.php:712
|
| 139 |
+
#: sexy-bookmarks.php:789
|
| 140 |
+
msgid "No"
|
| 141 |
+
msgstr "Не"
|
| 142 |
+
|
| 143 |
+
#: sexy-bookmarks.php:482
|
| 144 |
+
msgid "You can switch back at any time."
|
| 145 |
+
msgstr "Можете да превключите обратно по-всяко време."
|
| 146 |
+
|
| 147 |
+
# %sthis link%s
|
| 148 |
+
#: sexy-bookmarks.php:486
|
| 149 |
+
msgid "We are anxious to hear what you think! If you would like to leave us some feedback, please follow %sthis link%s and share your thoughts and opinions with us."
|
| 150 |
+
msgstr "Нямаме търпение да чуем какво мислите! Ако желаете да ни предоставите малко обратна връзка, моля последвайте %sтози линк%s и споделете вашите мисли и мнения с нас."
|
| 151 |
+
|
| 152 |
+
#: sexy-bookmarks.php:492
|
| 153 |
+
msgid "Enabled Networks"
|
| 154 |
+
msgstr "Активирани социални мрежи"
|
| 155 |
+
|
| 156 |
+
#: sexy-bookmarks.php:496
|
| 157 |
+
msgid "Select the Networks to display. Drag to reorder."
|
| 158 |
+
msgstr "Изберете мрежите, които да се показват. Пренаредете ги с влачене."
|
| 159 |
+
|
| 160 |
+
#: sexy-bookmarks.php:498
|
| 161 |
+
msgid "Select"
|
| 162 |
+
msgstr "Избери"
|
| 163 |
+
|
| 164 |
+
#: sexy-bookmarks.php:499
|
| 165 |
+
msgid "All"
|
| 166 |
+
msgstr "Всички"
|
| 167 |
+
|
| 168 |
+
#: sexy-bookmarks.php:500
|
| 169 |
+
msgid "None"
|
| 170 |
+
msgstr "Никой"
|
| 171 |
+
|
| 172 |
+
#: sexy-bookmarks.php:501
|
| 173 |
+
msgid "Most Popular"
|
| 174 |
+
msgstr "Най-популярни"
|
| 175 |
+
|
| 176 |
+
#: sexy-bookmarks.php:511
|
| 177 |
+
msgid "Made with Much Love, these Icons are © Shareaholic"
|
| 178 |
+
msgstr "Направени с много любов, тези икони са © Shareaholic"
|
| 179 |
+
|
| 180 |
+
#: sexy-bookmarks.php:516
|
| 181 |
+
msgid "Functionality Settings"
|
| 182 |
+
msgstr "Функционални настройки:"
|
| 183 |
+
|
| 184 |
+
#: sexy-bookmarks.php:522
|
| 185 |
+
msgid "Twitter Options:"
|
| 186 |
+
msgstr "Twitter настройки:"
|
| 187 |
+
|
| 188 |
+
#: sexy-bookmarks.php:524
|
| 189 |
+
msgid "Configuration Instructions:"
|
| 190 |
+
msgstr "Инструкции за конфигуриране:"
|
| 191 |
+
|
| 192 |
+
#: sexy-bookmarks.php:525
|
| 193 |
+
msgid "Using the strings %s and %s you can fully customize your tweet output."
|
| 194 |
+
msgstr "Използвайки низовете %s и %s вие можете напълно да кустомизирате вида на tweet-овете."
|
| 195 |
+
|
| 196 |
+
#: sexy-bookmarks.php:526
|
| 197 |
+
msgid "Example Configurations:"
|
| 198 |
+
msgstr "Примерни конфигурации:"
|
| 199 |
+
|
| 200 |
+
#: sexy-bookmarks.php:528
|
| 201 |
+
msgid "or"
|
| 202 |
+
msgstr "или"
|
| 203 |
+
|
| 204 |
+
#: sexy-bookmarks.php:532
|
| 205 |
+
msgid "Configure Custom Tweet Template:"
|
| 206 |
+
msgstr "Конфигурирайте собствен tweet образец:"
|
| 207 |
+
|
| 208 |
+
#: sexy-bookmarks.php:532
|
| 209 |
+
msgid "Characters:"
|
| 210 |
+
msgstr "Символи:"
|
| 211 |
+
|
| 212 |
+
#: sexy-bookmarks.php:535
|
| 213 |
+
msgid "Example Tweet Output:"
|
| 214 |
+
msgstr "Примерен tweet резултат:"
|
| 215 |
+
|
| 216 |
+
# %sALL%s
|
| 217 |
+
#: sexy-bookmarks.php:539
|
| 218 |
+
msgid "This will clear %sALL%s short URLs. - Are you sure? Note: you will also need to \"Save Changes\" to complete the reset."
|
| 219 |
+
msgstr "Това ще изчисти %sВСИЧКИ%s кратки URL адреси. - Сигурни ли сте? Бележка: също ще трябва да запазите промените за да завършите операцията."
|
| 220 |
+
|
| 221 |
+
#: sexy-bookmarks.php:546
|
| 222 |
+
msgid "Which URL Shortener?"
|
| 223 |
+
msgstr "Кой сайт за съкращаване на URL адреси?"
|
| 224 |
+
|
| 225 |
+
#: sexy-bookmarks.php:551
|
| 226 |
+
msgid "Don't use a shortener"
|
| 227 |
+
msgstr "Не съкращавай URL адресите"
|
| 228 |
+
|
| 229 |
+
#: sexy-bookmarks.php:565
|
| 230 |
+
msgid "Reset all Short URLs"
|
| 231 |
+
msgstr "Нулирай всички кратки URL адреси"
|
| 232 |
+
|
| 233 |
+
#: sexy-bookmarks.php:568
|
| 234 |
+
#: sexy-bookmarks.php:580
|
| 235 |
+
#: sexy-bookmarks.php:589
|
| 236 |
+
#: sexy-bookmarks.php:601
|
| 237 |
+
#: sexy-bookmarks.php:621
|
| 238 |
+
msgid "User ID:"
|
| 239 |
+
msgstr "Потребителско ID:"
|
| 240 |
+
|
| 241 |
+
#: sexy-bookmarks.php:570
|
| 242 |
+
#: sexy-bookmarks.php:591
|
| 243 |
+
#: sexy-bookmarks.php:611
|
| 244 |
+
#: sexy-bookmarks.php:623
|
| 245 |
+
msgid "API Key:"
|
| 246 |
+
msgstr "API ключ:"
|
| 247 |
+
|
| 248 |
+
#: sexy-bookmarks.php:576
|
| 249 |
+
#: sexy-bookmarks.php:597
|
| 250 |
+
#: sexy-bookmarks.php:607
|
| 251 |
+
#: sexy-bookmarks.php:617
|
| 252 |
+
msgid "Track Generated Links?"
|
| 253 |
+
msgstr "Следи генерираните линкове?"
|
| 254 |
+
|
| 255 |
+
#: sexy-bookmarks.php:582
|
| 256 |
+
msgid "Password:"
|
| 257 |
+
msgstr "Парола:"
|
| 258 |
+
|
| 259 |
+
#: sexy-bookmarks.php:630
|
| 260 |
+
msgid "General Functionality Options:"
|
| 261 |
+
msgstr "Общи функционални настройки:"
|
| 262 |
+
|
| 263 |
+
#: sexy-bookmarks.php:632
|
| 264 |
+
msgid "Add nofollow to the links?"
|
| 265 |
+
msgstr "Да се добави nofollow към линковете?"
|
| 266 |
+
|
| 267 |
+
#: sexy-bookmarks.php:636
|
| 268 |
+
msgid "Open links in new window?"
|
| 269 |
+
msgstr "Да се отварят линковете в нов прозорец?"
|
| 270 |
+
|
| 271 |
+
#: sexy-bookmarks.php:640
|
| 272 |
+
msgid "Show Share Counters for Facebook and Twitter?"
|
| 273 |
+
msgstr "Показвай брояч на споделянията за Facebook и Twitter?"
|
| 274 |
+
|
| 275 |
+
#: sexy-bookmarks.php:643
|
| 276 |
+
msgid "(beta-mode exclusive feature)"
|
| 277 |
+
msgstr "(екстра налична само в бета режим)"
|
| 278 |
+
|
| 279 |
+
#: sexy-bookmarks.php:645
|
| 280 |
+
msgid "Show Shareaholic Promo?"
|
| 281 |
+
msgstr "Показвай Shareaholic промо?"
|
| 282 |
+
|
| 283 |
+
#: sexy-bookmarks.php:649
|
| 284 |
+
msgid "Track Performance?"
|
| 285 |
+
msgstr "Следи ефективността?"
|
| 286 |
+
|
| 287 |
+
#: sexy-bookmarks.php:650
|
| 288 |
+
msgid "Yes (recommended)"
|
| 289 |
+
msgstr "Да (препоръчва се)"
|
| 290 |
+
|
| 291 |
+
#: sexy-bookmarks.php:658
|
| 292 |
+
msgid "Plugin Aesthetics"
|
| 293 |
+
msgstr "Естетика на разширението"
|
| 294 |
+
|
| 295 |
+
#: sexy-bookmarks.php:663
|
| 296 |
+
msgid "Warning!"
|
| 297 |
+
msgstr "Внимание!"
|
| 298 |
+
|
| 299 |
+
# %STRICTLY%s
|
| 300 |
+
#: sexy-bookmarks.php:664
|
| 301 |
+
msgid "This option is intended %STRICTLY%s for users who understand how to edit CSS/JS and intend to change/edit the associated images themselves. Unfortunately, no support will be offered for this feature, as I cannot be held accountable for your coding and/or image editing mistakes."
|
| 302 |
+
msgstr "Тази настройка е предназначена %САМО%s за потребители, които разбират от редактиране на CSS/JS и смятат да променят/редактират съответните изображения. За съжаление, няма да се предлага поддръжка за тази екстра, понеже не мога да отговарям за вашите грешки при кодирането и/или редактирането на изображението."
|
| 303 |
+
|
| 304 |
+
#: sexy-bookmarks.php:665
|
| 305 |
+
msgid "How it works..."
|
| 306 |
+
msgstr "Как работи..."
|
| 307 |
+
|
| 308 |
+
#: sexy-bookmarks.php:666
|
| 309 |
+
msgid "Since you have chosen for the plugin to override the style settings with your own custom mods, it will now pull the files from the new folders it is going to create on your server as soon as you save your changes. The file/folder locations should be as follows:"
|
| 310 |
+
msgstr "Тъй като сте поискали разширението да използва ваши собствени стилови настройки, то сега ще ползва файловете от новите папки, които ще създаде на вашия сървър веднага след като запазите настройките. Разположението на файлът/папката би трябвало да бъде следното:"
|
| 311 |
+
|
| 312 |
+
#: sexy-bookmarks.php:683
|
| 313 |
+
msgid "Once you have saved your changes, you will be able to edit the image sprite that holds all of the icons for Shareaholic as well as the CSS which accompanies it. Just be sure that you do in fact edit the CSS if you edit the images, as it is unlikely the heights, widths, and background positions of the images will stay the same after you are done."
|
| 314 |
+
msgstr "След като запазите промените, ще можете да редактирате както фоновото изображение от тип sprite, съдържащо иконките на Shareholic, така и съответния CSS код. Само не забравяйте реално да редактирате и CSS-а, ако редактирате изображението, защото едва ли височините, ширините и позицията на изображенията ще останат същите след редакцията."
|
| 315 |
+
|
| 316 |
+
#: sexy-bookmarks.php:684
|
| 317 |
+
msgid "Just a quick note... When you edit the styles and images to include your own custom backgrounds, icons, and CSS styles, be aware that those changes will not be reflected on the plugin options page. In other words: when you select your networks to be displayed, or when you select the background image to use, it will still be displaying the images from the original plugin directory."
|
| 318 |
+
msgstr "Само една бърза бележка... Когато редактирате стиловете и изображенията за да включите свой собствен фон, иконки и CSS стил, имайте предвид, че тези промени няма да засегнат страницата с настройките на разширението. С други думи: когато избирате кои мрежи да се показват или когато избирате фоновото изображение, което да се използва, все още ще се показват изображенията от оригиналната папка на разширението."
|
| 319 |
+
|
| 320 |
+
#: sexy-bookmarks.php:685
|
| 321 |
+
msgid "In Case of Emergency"
|
| 322 |
+
msgstr "В случай на авария"
|
| 323 |
+
|
| 324 |
+
#: sexy-bookmarks.php:686
|
| 325 |
+
msgid "If you happen to mess things up, you can follow these directions to reset the plugin back to normal and try again if you wish:"
|
| 326 |
+
msgstr "Ако оплескате нещата, можете да следвате тези инструкции за да върнете разширението към стандартни настройки и да опитате отново ако желаете:"
|
| 327 |
+
|
| 328 |
+
#: sexy-bookmarks.php:688
|
| 329 |
+
msgid "Login to your server via FTP or SSH. (whichever you are more comfortable with)"
|
| 330 |
+
msgstr "Влезте във вашия сървър през FTP или SSH. (което ви е по-удобно)"
|
| 331 |
+
|
| 332 |
+
#: sexy-bookmarks.php:689
|
| 333 |
+
msgid "Navigate to your wp-content directory."
|
| 334 |
+
msgstr "Отворете вашата wp-content папка."
|
| 335 |
+
|
| 336 |
+
#: sexy-bookmarks.php:690
|
| 337 |
+
msgid "Delete the directory named \"sexy-mods\"."
|
| 338 |
+
msgstr "Изтрийте папката на име \"sexy-mods\"."
|
| 339 |
+
|
| 340 |
+
#: sexy-bookmarks.php:691
|
| 341 |
+
msgid "Login to your WordPress dashboard."
|
| 342 |
+
msgstr "Влезте във вашето WordPress табло."
|
| 343 |
+
|
| 344 |
+
#: sexy-bookmarks.php:692
|
| 345 |
+
msgid "Go to the SexyBookmarks plugin options page. (Settings->SexyBookmarks)"
|
| 346 |
+
msgstr "Отидете до настройките на разширението SexyBookmarks. (Настройки->SexyBookmarks)"
|
| 347 |
+
|
| 348 |
+
#: sexy-bookmarks.php:693
|
| 349 |
+
msgid "Deselect the \"Use custom mods\" option."
|
| 350 |
+
msgstr "Премахнете отметката \"Използвай стилове с потребителски модификации?\"."
|
| 351 |
+
|
| 352 |
+
#: sexy-bookmarks.php:694
|
| 353 |
+
msgid "Save your changes."
|
| 354 |
+
msgstr "Запазете промените."
|
| 355 |
+
|
| 356 |
+
#: sexy-bookmarks.php:696
|
| 357 |
+
msgid "Close Message"
|
| 358 |
+
msgstr "Затвори съобщението"
|
| 359 |
+
|
| 360 |
+
#: sexy-bookmarks.php:700
|
| 361 |
+
msgid "Override Styles With Custom Mods Instead?"
|
| 362 |
+
msgstr "Използвай стилове с потребителски модификации?"
|
| 363 |
+
|
| 364 |
+
#: sexy-bookmarks.php:705
|
| 365 |
+
msgid "jQuery Related Options"
|
| 366 |
+
msgstr "Настройки свързани с jQuery"
|
| 367 |
+
|
| 368 |
+
#: sexy-bookmarks.php:706
|
| 369 |
+
msgid "Animate-expand multi-lined bookmarks?"
|
| 370 |
+
msgstr "Анимирано разгъване на отметки по-дълги от 1 ред?"
|
| 371 |
+
|
| 372 |
+
#: sexy-bookmarks.php:709
|
| 373 |
+
msgid "Auto-space/center the bookmarks?"
|
| 374 |
+
msgstr "Автоматично подравняване на отметките?"
|
| 375 |
+
|
| 376 |
+
#: sexy-bookmarks.php:710
|
| 377 |
+
msgid "Space"
|
| 378 |
+
msgstr "Празно място"
|
| 379 |
+
|
| 380 |
+
#: sexy-bookmarks.php:711
|
| 381 |
+
msgid "Center"
|
| 382 |
+
msgstr "Център"
|
| 383 |
+
|
| 384 |
+
#: sexy-bookmarks.php:713
|
| 385 |
+
msgid "jQuery Compatibility Fix"
|
| 386 |
+
msgstr "Поправка на jQuery съвместимостта"
|
| 387 |
+
|
| 388 |
+
#: sexy-bookmarks.php:714
|
| 389 |
+
msgid "Check this box ONLY if you notice jQuery being loaded twice in your source code!"
|
| 390 |
+
msgstr "Сложете отметка САМО ако забележите, че jQuery се зарежда два пъти във вашия изходен код."
|
| 391 |
+
|
| 392 |
+
#: sexy-bookmarks.php:716
|
| 393 |
+
msgid "Load scripts in Footer"
|
| 394 |
+
msgstr "Зареждай скриптовете във футъра"
|
| 395 |
+
|
| 396 |
+
#: sexy-bookmarks.php:717
|
| 397 |
+
msgid "Check this box if you want the SexyBookmarks javascript to be loaded in your blog's footer."
|
| 398 |
+
msgstr "Сложете отметка ако желаете JavaScript кода на SexyBookmarks да се зарежда във футър файла на вашия блог."
|
| 399 |
+
|
| 400 |
+
#: sexy-bookmarks.php:719
|
| 401 |
+
msgid "Background Image Options"
|
| 402 |
+
msgstr "Настройки на фоновото изображение"
|
| 403 |
+
|
| 404 |
+
#: sexy-bookmarks.php:721
|
| 405 |
+
msgid "Use a background image?"
|
| 406 |
+
msgstr "Използване на фоново изображение?"
|
| 407 |
+
|
| 408 |
+
#: sexy-bookmarks.php:754
|
| 409 |
+
msgid "Menu Placement"
|
| 410 |
+
msgstr "Разположение на менюто"
|
| 411 |
+
|
| 412 |
+
# %sofficial install guide%s
|
| 413 |
+
#: sexy-bookmarks.php:760
|
| 414 |
+
msgid "Need help with this? Find it in the %sofficial install guide%s."
|
| 415 |
+
msgstr "Имате нужда от помощ? Намерете я в %sофициалното упътване за инсталация%s."
|
| 416 |
+
|
| 417 |
+
#: sexy-bookmarks.php:766
|
| 418 |
+
msgid "Menu Location (in relation to content):"
|
| 419 |
+
msgstr "Разположение на менюто (спрямо съдържанието):"
|
| 420 |
+
|
| 421 |
+
#: sexy-bookmarks.php:767
|
| 422 |
+
msgid "Above Content"
|
| 423 |
+
msgstr "Над съдържанието"
|
| 424 |
+
|
| 425 |
+
#: sexy-bookmarks.php:768
|
| 426 |
+
msgid "Below Content"
|
| 427 |
+
msgstr "Под съдържанието"
|
| 428 |
+
|
| 429 |
+
#: sexy-bookmarks.php:769
|
| 430 |
+
msgid "Above & Below Content"
|
| 431 |
+
msgstr "Над и под съдържанието"
|
| 432 |
+
|
| 433 |
+
#: sexy-bookmarks.php:770
|
| 434 |
+
msgid "Manual Mode"
|
| 435 |
+
msgstr "Ръчен режим"
|
| 436 |
+
|
| 437 |
+
#: sexy-bookmarks.php:771
|
| 438 |
+
msgid "Posts, pages, or the whole shebang?"
|
| 439 |
+
msgstr "Публикации, страници или навсякъде?"
|
| 440 |
+
|
| 441 |
+
#: sexy-bookmarks.php:776
|
| 442 |
+
msgid "Posts Only"
|
| 443 |
+
msgstr "Само публикации"
|
| 444 |
+
|
| 445 |
+
#: sexy-bookmarks.php:777
|
| 446 |
+
msgid "Pages Only"
|
| 447 |
+
msgstr "Само страници"
|
| 448 |
+
|
| 449 |
+
#: sexy-bookmarks.php:778
|
| 450 |
+
msgid "Index Only"
|
| 451 |
+
msgstr "Само начална страница"
|
| 452 |
+
|
| 453 |
+
#: sexy-bookmarks.php:779
|
| 454 |
+
msgid "Posts & Pages"
|
| 455 |
+
msgstr "Публикации и страници"
|
| 456 |
+
|
| 457 |
+
#: sexy-bookmarks.php:780
|
| 458 |
+
msgid "Posts & Index"
|
| 459 |
+
msgstr "Публикации и начална страница"
|
| 460 |
+
|
| 461 |
+
#: sexy-bookmarks.php:781
|
| 462 |
+
msgid "Pages & Index"
|
| 463 |
+
msgstr "Страници и начална страница"
|
| 464 |
+
|
| 465 |
+
#: sexy-bookmarks.php:782
|
| 466 |
+
msgid "Posts, Pages, & Index"
|
| 467 |
+
msgstr "Публикации, страници и начална страница"
|
| 468 |
+
|
| 469 |
+
#: sexy-bookmarks.php:786
|
| 470 |
+
msgid "Click here for help with this option"
|
| 471 |
+
msgstr "Цъкнете тук за помощ относно тази настройка"
|
| 472 |
+
|
| 473 |
+
#: sexy-bookmarks.php:787
|
| 474 |
+
msgid "Show in RSS feed?"
|
| 475 |
+
msgstr "Показвай в RSS хранилката?"
|
| 476 |
+
|
| 477 |
+
#: sexy-bookmarks.php:791
|
| 478 |
+
msgid "Hide menu from mobile browsers?"
|
| 479 |
+
msgstr "Скриване на менюто за мобилните браузъри?"
|
| 480 |
+
|
| 481 |
+
#: sexy-bookmarks.php:800
|
| 482 |
+
msgid "Save Changes"
|
| 483 |
+
msgstr "Запази настройките"
|
| 484 |
+
|
| 485 |
+
#: sexy-bookmarks.php:804
|
| 486 |
+
msgid "Reset Settings"
|
| 487 |
+
msgstr "Възстанови стандартните настройки"
|
| 488 |
+
|
| 489 |
+
#: sexy-bookmarks.php:810
|
| 490 |
+
msgid "Helpful Plugin Links"
|
| 491 |
+
msgstr "Връзки към полезни разширения"
|
| 492 |
+
|
| 493 |
+
#: sexy-bookmarks.php:815
|
| 494 |
+
msgid "Installation & Usage Guide"
|
| 495 |
+
msgstr "Упътване за инсталация и употреба"
|
| 496 |
+
|
| 497 |
+
#: sexy-bookmarks.php:816
|
| 498 |
+
msgid "Frequently Asked Questions"
|
| 499 |
+
msgstr "Често задавани въпроси"
|
| 500 |
+
|
| 501 |
+
#: sexy-bookmarks.php:817
|
| 502 |
+
msgid "Bug Submission Form"
|
| 503 |
+
msgstr "Формуляр за докладване на бъгове"
|
| 504 |
+
|
| 505 |
+
#: sexy-bookmarks.php:818
|
| 506 |
+
msgid "Feature Request Form"
|
| 507 |
+
msgstr "Формуляр за предлагане на функционалности"
|
| 508 |
+
|
| 509 |
+
#: sexy-bookmarks.php:819
|
| 510 |
+
msgid "Submit a Translation"
|
| 511 |
+
msgstr "Изпрати превод"
|
| 512 |
+
|
| 513 |
+
#: sexy-bookmarks.php:820
|
| 514 |
+
msgid "Shareaholic Browsers Add-ons"
|
| 515 |
+
msgstr "Shareaholic добавки за браузъра"
|
| 516 |
+
|
| 517 |
+
#: sexy-bookmarks.php:821
|
| 518 |
+
msgid "Thanks & Credits"
|
| 519 |
+
msgstr "Благодарности и кредити"
|
| 520 |
+
|
| 521 |
+
#: sexy-bookmarks.php:840
|
| 522 |
+
#: sexy-bookmarks.php:843
|
| 523 |
+
msgid "SexyBookmarks (by Shareaholic)"
|
| 524 |
+
msgstr "SexyBookmarks (от Shareaholic)"
|
| 525 |
+
|
| 526 |
+
#: sexy-bookmarks.php:840
|
| 527 |
+
msgid "Shareaholic"
|
| 528 |
+
msgstr "Shareaholic"
|
| 529 |
+
|
| 530 |
+
#: sexy-bookmarks.php:843
|
| 531 |
+
msgid "SexyBookmarks"
|
| 532 |
+
msgstr "SexyBookmarks"
|
| 533 |
+
|
| 534 |
+
#: sexy-bookmarks.php:879
|
| 535 |
+
msgid "Settings"
|
| 536 |
+
msgstr "Настройки"
|
| 537 |
+
|
| 538 |
+
#: includes/bookmarks-data.php:21
|
| 539 |
+
msgid "Check this box to include %s in your bookmarking menu"
|
| 540 |
+
msgstr "Сложете тази отметка за да включите %s във вашето меню с отметки"
|
| 541 |
+
|
| 542 |
+
#: includes/bookmarks-data.php:28
|
| 543 |
+
#: includes/bookmarks-data.php:63
|
| 544 |
+
#: includes/bookmarks-data.php:88
|
| 545 |
+
#: includes/bookmarks-data.php:203
|
| 546 |
+
#: includes/bookmarks-data.php:258
|
| 547 |
+
#: includes/bookmarks-data.php:263
|
| 548 |
+
#: includes/bookmarks-data.php:268
|
| 549 |
+
#: includes/bookmarks-data.php:273
|
| 550 |
+
#: includes/bookmarks-data.php:313
|
| 551 |
+
#: includes/bookmarks-data.php:328
|
| 552 |
+
#: includes/bookmarks-data.php:338
|
| 553 |
+
#: includes/bookmarks-data.php:343
|
| 554 |
+
#: includes/bookmarks-data.php:363
|
| 555 |
+
msgid "Submit this to "
|
| 556 |
+
msgstr "Изпрати това в "
|
| 557 |
+
|
| 558 |
+
#: includes/bookmarks-data.php:33
|
| 559 |
+
#: includes/bookmarks-data.php:38
|
| 560 |
+
#: includes/bookmarks-data.php:53
|
| 561 |
+
#: includes/bookmarks-data.php:73
|
| 562 |
+
#: includes/bookmarks-data.php:78
|
| 563 |
+
#: includes/bookmarks-data.php:93
|
| 564 |
+
#: includes/bookmarks-data.php:118
|
| 565 |
+
#: includes/bookmarks-data.php:153
|
| 566 |
+
#: includes/bookmarks-data.php:158
|
| 567 |
+
#: includes/bookmarks-data.php:163
|
| 568 |
+
#: includes/bookmarks-data.php:173
|
| 569 |
+
#: includes/bookmarks-data.php:178
|
| 570 |
+
#: includes/bookmarks-data.php:293
|
| 571 |
+
#: includes/bookmarks-data.php:353
|
| 572 |
+
#: includes/bookmarks-data.php:373
|
| 573 |
+
#: includes/bookmarks-data.php:393
|
| 574 |
+
#: includes/bookmarks-data.php:403
|
| 575 |
+
#: includes/bookmarks-data.php:408
|
| 576 |
+
#: includes/bookmarks-data.php:418
|
| 577 |
+
#: includes/bookmarks-data.php:428
|
| 578 |
+
#: includes/bookmarks-data.php:443
|
| 579 |
+
msgid "Share this on "
|
| 580 |
+
msgstr "Сподели това в "
|
| 581 |
+
|
| 582 |
+
#: includes/bookmarks-data.php:43
|
| 583 |
+
msgid "Digg this!"
|
| 584 |
+
msgstr "Digg-ни това!"
|
| 585 |
+
|
| 586 |
+
#: includes/bookmarks-data.php:48
|
| 587 |
+
msgid "Post this on "
|
| 588 |
+
msgstr "Публикувай това в "
|
| 589 |
+
|
| 590 |
+
#: includes/bookmarks-data.php:58
|
| 591 |
+
msgid "Buzz up!"
|
| 592 |
+
msgstr "Buzz up!"
|
| 593 |
+
|
| 594 |
+
#: includes/bookmarks-data.php:68
|
| 595 |
+
msgid "Stumble upon something good? Share it on StumbleUpon"
|
| 596 |
+
msgstr "Попаднахте на нещо добро? Споделете го в StumbleUpon"
|
| 597 |
+
|
| 598 |
+
#: includes/bookmarks-data.php:83
|
| 599 |
+
#: includes/bookmarks-data.php:223
|
| 600 |
+
#: includes/bookmarks-data.php:243
|
| 601 |
+
#: includes/bookmarks-data.php:383
|
| 602 |
+
msgid "Post this to "
|
| 603 |
+
msgstr "Публикувай това в "
|
| 604 |
+
|
| 605 |
+
#: includes/bookmarks-data.php:98
|
| 606 |
+
msgid "Tweet This!"
|
| 607 |
+
msgstr "Tweet-ни това!"
|
| 608 |
+
|
| 609 |
+
#: includes/bookmarks-data.php:102
|
| 610 |
+
msgid "an 'Email to a Friend' link"
|
| 611 |
+
msgstr "линк от тип 'Изпрати по e-mail'"
|
| 612 |
+
|
| 613 |
+
#: includes/bookmarks-data.php:103
|
| 614 |
+
msgid "Email this to a friend?"
|
| 615 |
+
msgstr "Изпрати по email на приятел?"
|
| 616 |
+
|
| 617 |
+
#: includes/bookmarks-data.php:108
|
| 618 |
+
msgid "Suggest this article to "
|
| 619 |
+
msgstr "Изпрати тази статия в "
|
| 620 |
+
|
| 621 |
+
#: includes/bookmarks-data.php:111
|
| 622 |
+
msgid "a 'Subscribe to Comments' link"
|
| 623 |
+
msgstr "линк от тип 'Абониране за коментарите'"
|
| 624 |
+
|
| 625 |
+
#: includes/bookmarks-data.php:112
|
| 626 |
+
#: includes/public.php:139
|
| 627 |
+
msgid "Subscribe to the comments for this post?"
|
| 628 |
+
msgstr "Абонирайте се за коментарите на тази публикация?"
|
| 629 |
+
|
| 630 |
+
#: includes/bookmarks-data.php:123
|
| 631 |
+
msgid "Seed this on "
|
| 632 |
+
msgstr "Изпрати това в "
|
| 633 |
+
|
| 634 |
+
#: includes/bookmarks-data.php:128
|
| 635 |
+
#: includes/bookmarks-data.php:133
|
| 636 |
+
#: includes/bookmarks-data.php:143
|
| 637 |
+
#: includes/bookmarks-data.php:148
|
| 638 |
+
#: includes/bookmarks-data.php:183
|
| 639 |
+
#: includes/bookmarks-data.php:188
|
| 640 |
+
#: includes/bookmarks-data.php:193
|
| 641 |
+
#: includes/bookmarks-data.php:198
|
| 642 |
+
#: includes/bookmarks-data.php:218
|
| 643 |
+
#: includes/bookmarks-data.php:378
|
| 644 |
+
#: includes/bookmarks-data.php:398
|
| 645 |
+
#: includes/bookmarks-data.php:423
|
| 646 |
+
msgid "Add this to "
|
| 647 |
+
msgstr "Добави това в "
|
| 648 |
+
|
| 649 |
+
#: includes/bookmarks-data.php:138
|
| 650 |
+
msgid "Post on Google Buzz"
|
| 651 |
+
msgstr "Публикувай в Google Buzz"
|
| 652 |
+
|
| 653 |
+
#: includes/bookmarks-data.php:168
|
| 654 |
+
msgid "Mark this on "
|
| 655 |
+
msgstr "Публикувай това в "
|
| 656 |
+
|
| 657 |
+
#: includes/bookmarks-data.php:177
|
| 658 |
+
#: includes/bookmarks-data.php:182
|
| 659 |
+
#: includes/bookmarks-data.php:187
|
| 660 |
+
#: includes/bookmarks-data.php:192
|
| 661 |
+
#: includes/bookmarks-data.php:197
|
| 662 |
+
msgid " (Russian)"
|
| 663 |
+
msgstr "(Руски)"
|
| 664 |
+
|
| 665 |
+
#: includes/bookmarks-data.php:208
|
| 666 |
+
msgid "Send this page to "
|
| 667 |
+
msgstr "Изпрати тази страница в "
|
| 668 |
+
|
| 669 |
+
#: includes/bookmarks-data.php:213
|
| 670 |
+
msgid "Bump this on "
|
| 671 |
+
msgstr "Сподели това в "
|
| 672 |
+
|
| 673 |
+
#: includes/bookmarks-data.php:228
|
| 674 |
+
msgid "Save this to "
|
| 675 |
+
msgstr "Запази това в "
|
| 676 |
+
|
| 677 |
+
#: includes/bookmarks-data.php:233
|
| 678 |
+
msgid "Tip this to "
|
| 679 |
+
msgstr "Сподели това в "
|
| 680 |
+
|
| 681 |
+
#: includes/bookmarks-data.php:238
|
| 682 |
+
msgid "Sphinn this on "
|
| 683 |
+
msgstr "Сподели това в "
|
| 684 |
+
|
| 685 |
+
#: includes/bookmarks-data.php:248
|
| 686 |
+
msgid "Grind this! on "
|
| 687 |
+
msgstr "Сподели това в "
|
| 688 |
+
|
| 689 |
+
#: includes/bookmarks-data.php:253
|
| 690 |
+
msgid "Ping this on "
|
| 691 |
+
msgstr "Сподели това в "
|
| 692 |
+
|
| 693 |
+
#: includes/bookmarks-data.php:257
|
| 694 |
+
#: includes/bookmarks-data.php:262
|
| 695 |
+
msgid " (Dutch)"
|
| 696 |
+
msgstr "(Холандски)"
|
| 697 |
+
|
| 698 |
+
#: includes/bookmarks-data.php:278
|
| 699 |
+
msgid "Blend this!"
|
| 700 |
+
msgstr "Сподели това!"
|
| 701 |
+
|
| 702 |
+
#: includes/bookmarks-data.php:282
|
| 703 |
+
msgid " (Polish)"
|
| 704 |
+
msgstr "(Полски)"
|
| 705 |
+
|
| 706 |
+
#: includes/bookmarks-data.php:283
|
| 707 |
+
msgid "Add this to Wykop!"
|
| 708 |
+
msgstr "Добави това в Wykop!"
|
| 709 |
+
|
| 710 |
+
#: includes/bookmarks-data.php:288
|
| 711 |
+
msgid "Engage with this article!"
|
| 712 |
+
msgstr "Сподели тази статия!"
|
| 713 |
+
|
| 714 |
+
#: includes/bookmarks-data.php:297
|
| 715 |
+
msgid " (Swedish)"
|
| 716 |
+
msgstr "(Шведски)"
|
| 717 |
+
|
| 718 |
+
#: includes/bookmarks-data.php:298
|
| 719 |
+
msgid "Push this on "
|
| 720 |
+
msgstr "Изпрати това в "
|
| 721 |
+
|
| 722 |
+
#: includes/bookmarks-data.php:302
|
| 723 |
+
msgid " (Japanese)"
|
| 724 |
+
msgstr "(Японски)"
|
| 725 |
+
|
| 726 |
+
#: includes/bookmarks-data.php:303
|
| 727 |
+
msgid "Bookmarks this on "
|
| 728 |
+
msgstr "Запази това в "
|
| 729 |
+
|
| 730 |
+
#: includes/bookmarks-data.php:308
|
| 731 |
+
msgid "Store this link on "
|
| 732 |
+
msgstr "Запази този линк в "
|
| 733 |
+
|
| 734 |
+
#: includes/bookmarks-data.php:318
|
| 735 |
+
msgid "Add to a lense on "
|
| 736 |
+
msgstr "Добави в "
|
| 737 |
+
|
| 738 |
+
#: includes/bookmarks-data.php:323
|
| 739 |
+
msgid "Submit this story to "
|
| 740 |
+
msgstr "Изпрати тази публикация в "
|
| 741 |
+
|
| 742 |
+
#: includes/bookmarks-data.php:333
|
| 743 |
+
msgid "Clip this to "
|
| 744 |
+
msgstr "Сподели това в "
|
| 745 |
+
|
| 746 |
+
#: includes/bookmarks-data.php:337
|
| 747 |
+
#: includes/bookmarks-data.php:342
|
| 748 |
+
msgid " (Spanish)"
|
| 749 |
+
msgstr "(Испански)"
|
| 750 |
+
|
| 751 |
+
#: includes/bookmarks-data.php:348
|
| 752 |
+
msgid "Submit this link to "
|
| 753 |
+
msgstr "Изпрати този линк в "
|
| 754 |
+
|
| 755 |
+
#: includes/bookmarks-data.php:358
|
| 756 |
+
msgid "Submit tip to "
|
| 757 |
+
msgstr "Изпрати в "
|
| 758 |
+
|
| 759 |
+
#: includes/bookmarks-data.php:368
|
| 760 |
+
msgid "Promote this on "
|
| 761 |
+
msgstr "Промотирай това в "
|
| 762 |
+
|
| 763 |
+
#: includes/bookmarks-data.php:388
|
| 764 |
+
msgid "Blog this on "
|
| 765 |
+
msgstr "Публикувай това в "
|
| 766 |
+
|
| 767 |
+
#: includes/bookmarks-data.php:402
|
| 768 |
+
msgid " (Estonian)"
|
| 769 |
+
msgstr "(Естонски)"
|
| 770 |
+
|
| 771 |
+
#: includes/bookmarks-data.php:413
|
| 772 |
+
msgid "Add this link to "
|
| 773 |
+
msgstr "Добави този линк в "
|
| 774 |
+
|
| 775 |
+
#: includes/bookmarks-data.php:417
|
| 776 |
+
msgid "(Italian)"
|
| 777 |
+
msgstr "(Италиански)"
|
| 778 |
+
|
| 779 |
+
#: includes/bookmarks-data.php:433
|
| 780 |
+
msgid "Spring this on "
|
| 781 |
+
msgstr "Сподели това в "
|
| 782 |
+
|
| 783 |
+
#: includes/bookmarks-data.php:438
|
| 784 |
+
msgid "Box this on "
|
| 785 |
+
msgstr "Сподели това в "
|
| 786 |
+
|
| 787 |
+
#: includes/bookmarks-data.php:448
|
| 788 |
+
#: includes/bookmarks-data.php:453
|
| 789 |
+
#: includes/bookmarks-data.php:458
|
| 790 |
+
msgid "Email this via "
|
| 791 |
+
msgstr "Изпрати по имейл чрез "
|
| 792 |
+
|
| 793 |
+
#: includes/bookmarks-data.php:463
|
| 794 |
+
msgid "Share this via "
|
| 795 |
+
msgstr "Сподели това чрез "
|
| 796 |
+
|
| 797 |
+
#: includes/public.php:549
|
| 798 |
+
msgid "An unknown error occurred in SexyBookmarks"
|
| 799 |
+
msgstr "Възникна неизвестна грешка в SexyBookmarks"
|
| 800 |
+
|
| 801 |
+
#: includes/public.php:814
|
| 802 |
+
msgid "SexyBookmarks has been disabled on this page"
|
| 803 |
+
msgstr "SexyBookmarks е изключено за тази страница"
|
| 804 |
+
|
languages/shrsb-ca.mo
ADDED
|
Binary file
|
languages/shrsb-ca.po
ADDED
|
@@ -0,0 +1,791 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# Copyright (C) 2010
|
| 2 |
+
# This file is distributed under the same license as the package.
|
| 3 |
+
msgid ""
|
| 4 |
+
msgstr ""
|
| 5 |
+
"Project-Id-Version: \n"
|
| 6 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/sexybookmarks\n"
|
| 7 |
+
"POT-Creation-Date: 2011-01-23 21:26:57+00:00\n"
|
| 8 |
+
"MIME-Version: 1.0\n"
|
| 9 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
| 10 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 11 |
+
"PO-Revision-Date: 2011-07-25 19:37+0100\n"
|
| 12 |
+
"Last-Translator: Joan Jordi <jjbs@ono.com>\n"
|
| 13 |
+
"Language-Team: Joan Jordi Berdullas <jjbs@ono.com>\n"
|
| 14 |
+
"X-Poedit-Language: Catalan\n"
|
| 15 |
+
"X-Poedit-Country: SPAIN\n"
|
| 16 |
+
|
| 17 |
+
#: sexy-bookmarks.php:138
|
| 18 |
+
msgid "NOTICE: Shareaholic was updated... Please visit the %sPlugin Options Page%s and re-save your preferences."
|
| 19 |
+
msgstr "NOTIFICACIÓ: Shareaholic ha estat actualitzat... Si us plau visita %sPàgina d'opcions del Plugin%s i torna a desar les teves preferències."
|
| 20 |
+
|
| 21 |
+
#: sexy-bookmarks.php:176
|
| 22 |
+
msgid "NOTICE: Shareaholic needs to be configured... Please visit the %sPlugin Options Page%s and set your preferences."
|
| 23 |
+
msgstr "NOTIFICACIÓ: Shareaholic necessita ser configurat... Si us plau, visita %sPàgina d'opcions del Plugin%s i escull les teves preferencies."
|
| 24 |
+
|
| 25 |
+
#: sexy-bookmarks.php:228
|
| 26 |
+
msgid "WARNING: You are about to reset all settings to their default state! Do you wish to continue?"
|
| 27 |
+
msgstr "ALERTA: Estàs a punt de reestablir les opcions als seus valors per defecte! Vols continuar?"
|
| 28 |
+
|
| 29 |
+
#: sexy-bookmarks.php:232
|
| 30 |
+
#: sexy-bookmarks.php:480
|
| 31 |
+
#: sexy-bookmarks.php:542
|
| 32 |
+
#: sexy-bookmarks.php:633
|
| 33 |
+
#: sexy-bookmarks.php:637
|
| 34 |
+
#: sexy-bookmarks.php:641
|
| 35 |
+
#: sexy-bookmarks.php:646
|
| 36 |
+
#: sexy-bookmarks.php:707
|
| 37 |
+
#: sexy-bookmarks.php:788
|
| 38 |
+
msgid "Yes"
|
| 39 |
+
msgstr "Sí"
|
| 40 |
+
|
| 41 |
+
#: sexy-bookmarks.php:232
|
| 42 |
+
#: sexy-bookmarks.php:542
|
| 43 |
+
msgid "Cancel"
|
| 44 |
+
msgstr "Cancel·la"
|
| 45 |
+
|
| 46 |
+
#: sexy-bookmarks.php:273
|
| 47 |
+
msgid "All settings have been reset to their default values."
|
| 48 |
+
msgstr "Totes els configuracions han estat resetejades als seus valors per defecte."
|
| 49 |
+
|
| 50 |
+
#: sexy-bookmarks.php:317
|
| 51 |
+
msgid "Your changes have been saved successfully!"
|
| 52 |
+
msgstr "Els teus canvis han estat desats correctament!"
|
| 53 |
+
|
| 54 |
+
#: sexy-bookmarks.php:320
|
| 55 |
+
msgid "Please choose where you would like the menu to be displayed."
|
| 56 |
+
msgstr "Si us plau, selecciona el lloc on vols que apareixi el menú"
|
| 57 |
+
|
| 58 |
+
#: sexy-bookmarks.php:321
|
| 59 |
+
msgid "You can't display the menu if you don't choose a few sites to add to it!"
|
| 60 |
+
msgstr "No pots mostrar el menú si no selecciones alguns llocs per afegir-lo!"
|
| 61 |
+
|
| 62 |
+
#: sexy-bookmarks.php:322
|
| 63 |
+
msgid "Please choose where you want the menu displayed."
|
| 64 |
+
msgstr "Si us plau, selecciona on vols que es mostri menú"
|
| 65 |
+
|
| 66 |
+
#: sexy-bookmarks.php:332
|
| 67 |
+
msgid "You must first download and activate the %sTwitter Friendly Links Plugin%s before hosting your own short URLs..."
|
| 68 |
+
msgstr "Primer has de descarregar i activar el %sPlugin de enllaços amigables de Twitter%s abans de donar les teves URL curtes... "
|
| 69 |
+
|
| 70 |
+
#: sexy-bookmarks.php:334
|
| 71 |
+
msgid "You must first download and activate the %sYOURLS Plugin%s before hosting your own short URLs..."
|
| 72 |
+
msgstr "Has des descarregar i activar primer les %sURLs dels plugins%s abans de de publicar les URLs curtes pròpies..."
|
| 73 |
+
|
| 74 |
+
#: sexy-bookmarks.php:351
|
| 75 |
+
msgid "WARNING: The request for a custom sprite has timed out. Reverting to default sprite files."
|
| 76 |
+
msgstr "ALERTA: la petició per a un sprite personalitzat ha expirat. Es torna als sprites per defecte."
|
| 77 |
+
|
| 78 |
+
#: sexy-bookmarks.php:353
|
| 79 |
+
msgid "Changes saved successfully. However, you should try to generate a custom sprite again later."
|
| 80 |
+
msgstr "Canvis enmagatzemats satisfactoriament. Encara i tot, hauríeu de generar un altre cop un sprite personalitzat."
|
| 81 |
+
|
| 82 |
+
#: sexy-bookmarks.php:357
|
| 83 |
+
#: sexy-bookmarks.php:379
|
| 84 |
+
msgid "WARNING: Your %sspritegen folder%s is not writeable by the server! %sNeed Help?%s"
|
| 85 |
+
msgstr "ALERTA: No es pot esciure al directori %sspritegen%s! %sNecessites ajuda?%s"
|
| 86 |
+
|
| 87 |
+
#: sexy-bookmarks.php:359
|
| 88 |
+
#: sexy-bookmarks.php:364
|
| 89 |
+
#: sexy-bookmarks.php:369
|
| 90 |
+
#: sexy-bookmarks.php:380
|
| 91 |
+
#: sexy-bookmarks.php:384
|
| 92 |
+
#: sexy-bookmarks.php:388
|
| 93 |
+
msgid "Changes saved successfully. However, settings are not optimal until you resolve the issue listed above."
|
| 94 |
+
msgstr "Canvis desats correctament. Per contra, les configuracions no seràn òptimes fins que no resolguis la següent incidència."
|
| 95 |
+
|
| 96 |
+
#: sexy-bookmarks.php:362
|
| 97 |
+
#: sexy-bookmarks.php:383
|
| 98 |
+
msgid "WARNING: You need to delete the current custom sprite %s before the plugin can write to the folder. %sNeed Help?%s"
|
| 99 |
+
msgstr "ALERTA: has d'esborrar l'sprite actual %s abans que el plugin pugui escriure al directori. %sNecessites ajuda?%s"
|
| 100 |
+
|
| 101 |
+
#: sexy-bookmarks.php:367
|
| 102 |
+
#: sexy-bookmarks.php:387
|
| 103 |
+
msgid "WARNING: You need to delete the current custom stylesheet %s before the plugin can write to the folder. %sNeed Help?%s"
|
| 104 |
+
msgstr "ALERTA: has d'esborrar la fulla d'estil actual %s abans que el plugin pugui escriure a la carpeta. %sNecesites ajuda?%s"
|
| 105 |
+
|
| 106 |
+
#: sexy-bookmarks.php:394
|
| 107 |
+
msgid "Short URL(s) have been reset."
|
| 108 |
+
msgstr "Les URLs curtes han estat resetejades."
|
| 109 |
+
|
| 110 |
+
#: sexy-bookmarks.php:473
|
| 111 |
+
msgid "BETA Testing"
|
| 112 |
+
msgstr "BETA Testing"
|
| 113 |
+
|
| 114 |
+
#: sexy-bookmarks.php:478
|
| 115 |
+
msgid "We completely re-wrote Shareaholic from the ground up to make it faster, leaner, better."
|
| 116 |
+
msgstr "Hem reescrit completament Shareolic des de la base per fer-lo més ràpid, lleuger, millor."
|
| 117 |
+
|
| 118 |
+
#: sexy-bookmarks.php:479
|
| 119 |
+
msgid "Use the new version? (BETA)"
|
| 120 |
+
msgstr "Vols utilitzar la nova versió? (BETA) "
|
| 121 |
+
|
| 122 |
+
#: sexy-bookmarks.php:481
|
| 123 |
+
#: sexy-bookmarks.php:634
|
| 124 |
+
#: sexy-bookmarks.php:638
|
| 125 |
+
#: sexy-bookmarks.php:642
|
| 126 |
+
#: sexy-bookmarks.php:647
|
| 127 |
+
#: sexy-bookmarks.php:651
|
| 128 |
+
#: sexy-bookmarks.php:708
|
| 129 |
+
#: sexy-bookmarks.php:712
|
| 130 |
+
#: sexy-bookmarks.php:789
|
| 131 |
+
msgid "No"
|
| 132 |
+
msgstr "No"
|
| 133 |
+
|
| 134 |
+
#: sexy-bookmarks.php:482
|
| 135 |
+
msgid "You can switch back at any time."
|
| 136 |
+
msgstr "Pots tornar enrera en qualsevol moment."
|
| 137 |
+
|
| 138 |
+
#: sexy-bookmarks.php:486
|
| 139 |
+
msgid "We are anxious to hear what you think! If you would like to leave us some feedback, please follow %sthis link%s and share your thoughts and opinions with us."
|
| 140 |
+
msgstr "Estem ansiosos de sentir el que penses! Si ens vols deixar un missatge, si us plau fes click en %saquests enllaços%s i comparteix el que penses i les teves opinions amb nosaltres."
|
| 141 |
+
|
| 142 |
+
#: sexy-bookmarks.php:492
|
| 143 |
+
msgid "Enabled Networks"
|
| 144 |
+
msgstr "Xarxes actives"
|
| 145 |
+
|
| 146 |
+
#: sexy-bookmarks.php:496
|
| 147 |
+
msgid "Select the Networks to display. Drag to reorder."
|
| 148 |
+
msgstr "Selecciona les xarxes a mostrar. Arrossega per reordenar."
|
| 149 |
+
|
| 150 |
+
#: sexy-bookmarks.php:498
|
| 151 |
+
msgid "Select"
|
| 152 |
+
msgstr "Sel·lecciona"
|
| 153 |
+
|
| 154 |
+
#: sexy-bookmarks.php:499
|
| 155 |
+
msgid "All"
|
| 156 |
+
msgstr "Tots"
|
| 157 |
+
|
| 158 |
+
#: sexy-bookmarks.php:500
|
| 159 |
+
msgid "None"
|
| 160 |
+
msgstr "Cap"
|
| 161 |
+
|
| 162 |
+
#: sexy-bookmarks.php:501
|
| 163 |
+
msgid "Most Popular"
|
| 164 |
+
msgstr "Més Popular"
|
| 165 |
+
|
| 166 |
+
#: sexy-bookmarks.php:511
|
| 167 |
+
msgid "Made with Much Love, these Icons are © Shareaholic"
|
| 168 |
+
msgstr "Realitzat amb molt de carinyo, aquestes icones són © Shareaholic"
|
| 169 |
+
|
| 170 |
+
#: sexy-bookmarks.php:516
|
| 171 |
+
msgid "Functionality Settings"
|
| 172 |
+
msgstr "Opcions funcionals"
|
| 173 |
+
|
| 174 |
+
#: sexy-bookmarks.php:522
|
| 175 |
+
msgid "Twitter Options:"
|
| 176 |
+
msgstr "Opcions del Twitter:"
|
| 177 |
+
|
| 178 |
+
#: sexy-bookmarks.php:524
|
| 179 |
+
msgid "Configuration Instructions:"
|
| 180 |
+
msgstr "Instruccions de configuració:"
|
| 181 |
+
|
| 182 |
+
#: sexy-bookmarks.php:525
|
| 183 |
+
msgid "Using the strings %s and %s you can fully customize your tweet output."
|
| 184 |
+
msgstr "Utilitzant les cadenes %s i %s pots personalitzar la sortida de les piulades."
|
| 185 |
+
|
| 186 |
+
#: sexy-bookmarks.php:526
|
| 187 |
+
msgid "Example Configurations:"
|
| 188 |
+
msgstr "Configuracions d'exemple:"
|
| 189 |
+
|
| 190 |
+
#: sexy-bookmarks.php:528
|
| 191 |
+
msgid "or"
|
| 192 |
+
msgstr "o"
|
| 193 |
+
|
| 194 |
+
#: sexy-bookmarks.php:532
|
| 195 |
+
msgid "Configure Custom Tweet Template:"
|
| 196 |
+
msgstr "Configura la plantilla personalitzada de Tweet:"
|
| 197 |
+
|
| 198 |
+
#: sexy-bookmarks.php:532
|
| 199 |
+
msgid "Characters:"
|
| 200 |
+
msgstr "Caràcters:"
|
| 201 |
+
|
| 202 |
+
#: sexy-bookmarks.php:535
|
| 203 |
+
msgid "Example Tweet Output:"
|
| 204 |
+
msgstr "Exemple de sortida de Tweet:"
|
| 205 |
+
|
| 206 |
+
#: sexy-bookmarks.php:539
|
| 207 |
+
msgid "This will clear %sALL%s short URLs. - Are you sure? Note: you will also need to \"Save Changes\" to complete the reset."
|
| 208 |
+
msgstr "Això esborrarà %sTotes%s les URLs curtes. - Estàs segur? Nota: necessitaràs fer click a \"Desar canvis\" per completar el reestabliment."
|
| 209 |
+
|
| 210 |
+
#: sexy-bookmarks.php:546
|
| 211 |
+
msgid "Which URL Shortener?"
|
| 212 |
+
msgstr "Quin adreça per crear adreces curtes vols fer servir?"
|
| 213 |
+
|
| 214 |
+
#: sexy-bookmarks.php:551
|
| 215 |
+
msgid "Don't use a shortener"
|
| 216 |
+
msgstr "No utilitzis un acurtador de URLs"
|
| 217 |
+
|
| 218 |
+
#: sexy-bookmarks.php:565
|
| 219 |
+
msgid "Reset all Short URLs"
|
| 220 |
+
msgstr "Reseteja totes les URLS curtes"
|
| 221 |
+
|
| 222 |
+
#: sexy-bookmarks.php:568
|
| 223 |
+
#: sexy-bookmarks.php:580
|
| 224 |
+
#: sexy-bookmarks.php:589
|
| 225 |
+
#: sexy-bookmarks.php:601
|
| 226 |
+
#: sexy-bookmarks.php:621
|
| 227 |
+
msgid "User ID:"
|
| 228 |
+
msgstr "ID d'usuari:"
|
| 229 |
+
|
| 230 |
+
#: sexy-bookmarks.php:570
|
| 231 |
+
#: sexy-bookmarks.php:591
|
| 232 |
+
#: sexy-bookmarks.php:611
|
| 233 |
+
#: sexy-bookmarks.php:623
|
| 234 |
+
msgid "API Key:"
|
| 235 |
+
msgstr "Clau de la API:"
|
| 236 |
+
|
| 237 |
+
#: sexy-bookmarks.php:576
|
| 238 |
+
#: sexy-bookmarks.php:597
|
| 239 |
+
#: sexy-bookmarks.php:607
|
| 240 |
+
#: sexy-bookmarks.php:617
|
| 241 |
+
msgid "Track Generated Links?"
|
| 242 |
+
msgstr "Vols generar un seguiment d'enllaços?"
|
| 243 |
+
|
| 244 |
+
#: sexy-bookmarks.php:582
|
| 245 |
+
msgid "Password:"
|
| 246 |
+
msgstr "Contrasenya:"
|
| 247 |
+
|
| 248 |
+
#: sexy-bookmarks.php:630
|
| 249 |
+
msgid "General Functionality Options:"
|
| 250 |
+
msgstr "Opcions de Funcionalitat General:"
|
| 251 |
+
|
| 252 |
+
#: sexy-bookmarks.php:632
|
| 253 |
+
msgid "Add nofollow to the links?"
|
| 254 |
+
msgstr "Afegir nofollow als enllaços?"
|
| 255 |
+
|
| 256 |
+
#: sexy-bookmarks.php:636
|
| 257 |
+
msgid "Open links in new window?"
|
| 258 |
+
msgstr "Obre links en una finestra nova?"
|
| 259 |
+
|
| 260 |
+
#: sexy-bookmarks.php:640
|
| 261 |
+
msgid "Show Share Counters for Facebook and Twitter?"
|
| 262 |
+
msgstr "Vols mostrar els comptadors per a Facebook i Twitter?"
|
| 263 |
+
|
| 264 |
+
#: sexy-bookmarks.php:643
|
| 265 |
+
msgid "(beta-mode exclusive feature)"
|
| 266 |
+
msgstr "(característica disponible en mode beta)"
|
| 267 |
+
|
| 268 |
+
#: sexy-bookmarks.php:645
|
| 269 |
+
msgid "Show Shareaholic Promo?"
|
| 270 |
+
msgstr "Mostrar la Promo de Shareaholic?"
|
| 271 |
+
|
| 272 |
+
#: sexy-bookmarks.php:649
|
| 273 |
+
msgid "Track Performance?"
|
| 274 |
+
msgstr "Vols fer un seguiment del rendiment?"
|
| 275 |
+
|
| 276 |
+
#: sexy-bookmarks.php:650
|
| 277 |
+
msgid "Yes (recommended)"
|
| 278 |
+
msgstr "Sí (recomanat)"
|
| 279 |
+
|
| 280 |
+
#: sexy-bookmarks.php:658
|
| 281 |
+
msgid "Plugin Aesthetics"
|
| 282 |
+
msgstr "Plugin Aesthetics"
|
| 283 |
+
|
| 284 |
+
#: sexy-bookmarks.php:663
|
| 285 |
+
msgid "Warning!"
|
| 286 |
+
msgstr "Alerta!"
|
| 287 |
+
|
| 288 |
+
#: sexy-bookmarks.php:664
|
| 289 |
+
msgid "This option is intended %STRICTLY%s for users who understand how to edit CSS/JS and intend to change/edit the associated images themselves. Unfortunately, no support will be offered for this feature, as I cannot be held accountable for your coding and/or image editing mistakes."
|
| 290 |
+
msgstr "Aquesta opció està destinada %sestrictament%s per als usuaris que saben com editar el codi CSS / JS, i tenen la intenció de canviar/editar les imatges associades. Per desgràcia, tampoc es donarà suport per a aquesta funció, ja que no podem ser considerats responsables de la seva codificació i/o errors d'edició d'imatges."
|
| 291 |
+
|
| 292 |
+
#: sexy-bookmarks.php:665
|
| 293 |
+
msgid "How it works..."
|
| 294 |
+
msgstr "Com funciona..."
|
| 295 |
+
|
| 296 |
+
#: sexy-bookmarks.php:666
|
| 297 |
+
msgid "Since you have chosen for the plugin to override the style settings with your own custom mods, it will now pull the files from the new folders it is going to create on your server as soon as you save your changes. The file/folder locations should be as follows:"
|
| 298 |
+
msgstr "En el moment que has escollit en el plugin que es sobreescriguin les configuracions d'estil amb les teves pròpies modificacions, s'obtindràn els fitxers a les noves carpetes tan aviat com dessis les modificacions. La localcització del fitxer/carpeta ha de ser:"
|
| 299 |
+
|
| 300 |
+
#: sexy-bookmarks.php:683
|
| 301 |
+
msgid "Once you have saved your changes, you will be able to edit the image sprite that holds all of the icons for Shareaholic as well as the CSS which accompanies it. Just be sure that you do in fact edit the CSS if you edit the images, as it is unlikely the heights, widths, and background positions of the images will stay the same after you are done."
|
| 302 |
+
msgstr "Un cop hagueu desat els canvis, podreu editar el sprite de la imatge que conté totes les icones de Shareaholic, així com el CSS que l'acompanya. Només assegureu-vos que editeu el CSS si editeu les imatges, ja que és poc probable que les altures, amples, i les posicions de fons de les imatges siguin les mateixes després d'haver acabat."
|
| 303 |
+
|
| 304 |
+
#: sexy-bookmarks.php:684
|
| 305 |
+
msgid "Just a quick note... When you edit the styles and images to include your own custom backgrounds, icons, and CSS styles, be aware that those changes will not be reflected on the plugin options page. In other words: when you select your networks to be displayed, or when you select the background image to use, it will still be displaying the images from the original plugin directory."
|
| 306 |
+
msgstr "Només un breu comentari ... En editar els estils i les imatges per incloure els seus propis fons, icones i estils CSS, heu de ser conscients que aquests canvis no es reflectiran a la pàgina de opcions de plugin. En altres paraules, quan seleccioneu les seves xarxes perquè es mostri, o quan es selecciona la imatge de fons per a l'ús, encara es mostrarà la imatge del directori de plugins original."
|
| 307 |
+
|
| 308 |
+
#: sexy-bookmarks.php:685
|
| 309 |
+
msgid "In Case of Emergency"
|
| 310 |
+
msgstr "En cas d'emergència"
|
| 311 |
+
|
| 312 |
+
#: sexy-bookmarks.php:686
|
| 313 |
+
msgid "If you happen to mess things up, you can follow these directions to reset the plugin back to normal and try again if you wish:"
|
| 314 |
+
msgstr "Si es compliquen les coses, pots seguir les direccions per reestablir el plugin al seu estat normal i intentar-ho un altre cop si ho desitges."
|
| 315 |
+
|
| 316 |
+
#: sexy-bookmarks.php:688
|
| 317 |
+
msgid "Login to your server via FTP or SSH. (whichever you are more comfortable with)"
|
| 318 |
+
msgstr "Loga't al teu servidor via FTP o SSH. (aquell amb el que estiguis més a gust)"
|
| 319 |
+
|
| 320 |
+
#: sexy-bookmarks.php:689
|
| 321 |
+
msgid "Navigate to your wp-content directory."
|
| 322 |
+
msgstr "Navega al directori wp-content."
|
| 323 |
+
|
| 324 |
+
#: sexy-bookmarks.php:690
|
| 325 |
+
msgid "Delete the directory named \"sexy-mods\"."
|
| 326 |
+
msgstr "Esborra el directori anomenat \"sexy-mods\"."
|
| 327 |
+
|
| 328 |
+
#: sexy-bookmarks.php:691
|
| 329 |
+
msgid "Login to your WordPress dashboard."
|
| 330 |
+
msgstr "Logueja't al teu tauler de Wordpress."
|
| 331 |
+
|
| 332 |
+
#: sexy-bookmarks.php:692
|
| 333 |
+
msgid "Go to the SexyBookmarks plugin options page. (Settings->SexyBookmarks)"
|
| 334 |
+
msgstr "Vés a la pàgina d'opcions del plugin SexyBookmarks. (Opcions->SexyBookmarks)"
|
| 335 |
+
|
| 336 |
+
#: sexy-bookmarks.php:693
|
| 337 |
+
msgid "Deselect the \"Use custom mods\" option."
|
| 338 |
+
msgstr "Deselecciona l'opció \"Utilitza modificacions personals\"."
|
| 339 |
+
|
| 340 |
+
#: sexy-bookmarks.php:694
|
| 341 |
+
msgid "Save your changes."
|
| 342 |
+
msgstr "Desa els teus canvis"
|
| 343 |
+
|
| 344 |
+
#: sexy-bookmarks.php:696
|
| 345 |
+
msgid "Close Message"
|
| 346 |
+
msgstr "Tanca el missatge"
|
| 347 |
+
|
| 348 |
+
#: sexy-bookmarks.php:700
|
| 349 |
+
msgid "Override Styles With Custom Mods Instead?"
|
| 350 |
+
msgstr "Sobreescriure estils en lloc de les modificacions?"
|
| 351 |
+
|
| 352 |
+
#: sexy-bookmarks.php:705
|
| 353 |
+
msgid "jQuery Related Options"
|
| 354 |
+
msgstr "Opcions realcionades amb jQuery"
|
| 355 |
+
|
| 356 |
+
#: sexy-bookmarks.php:706
|
| 357 |
+
msgid "Animate-expand multi-lined bookmarks?"
|
| 358 |
+
msgstr "Animar-expandir marcadors multi-alineats?"
|
| 359 |
+
|
| 360 |
+
#: sexy-bookmarks.php:709
|
| 361 |
+
msgid "Auto-space/center the bookmarks?"
|
| 362 |
+
msgstr "Auto-espaia/centra les adreces d'interé:s"
|
| 363 |
+
|
| 364 |
+
#: sexy-bookmarks.php:710
|
| 365 |
+
msgid "Space"
|
| 366 |
+
msgstr "Espaia"
|
| 367 |
+
|
| 368 |
+
#: sexy-bookmarks.php:711
|
| 369 |
+
msgid "Center"
|
| 370 |
+
msgstr "Centra"
|
| 371 |
+
|
| 372 |
+
#: sexy-bookmarks.php:713
|
| 373 |
+
msgid "jQuery Compatibility Fix"
|
| 374 |
+
msgstr "Correcció de compatibilitat amb jQuery"
|
| 375 |
+
|
| 376 |
+
#: sexy-bookmarks.php:714
|
| 377 |
+
msgid "Check this box ONLY if you notice jQuery being loaded twice in your source code!"
|
| 378 |
+
msgstr "Marca aquesta opció NOMÉS si te n'assabentes que jQuery s'ha carregat dues vegades en el teu codi!"
|
| 379 |
+
|
| 380 |
+
#: sexy-bookmarks.php:716
|
| 381 |
+
msgid "Load scripts in Footer"
|
| 382 |
+
msgstr "Carrega l'script al peu"
|
| 383 |
+
|
| 384 |
+
#: sexy-bookmarks.php:717
|
| 385 |
+
msgid "Check this box if you want the SexyBookmarks javascript to be loaded in your blog's footer."
|
| 386 |
+
msgstr "Marca aquesta opció si vols que es carregui el JavaScript de SexyBookmarks en el peu del teu bloc."
|
| 387 |
+
|
| 388 |
+
#: sexy-bookmarks.php:719
|
| 389 |
+
msgid "Background Image Options"
|
| 390 |
+
msgstr "Opcions de la imatge de rerefons"
|
| 391 |
+
|
| 392 |
+
#: sexy-bookmarks.php:721
|
| 393 |
+
msgid "Use a background image?"
|
| 394 |
+
msgstr "Vols utilitzar una imatge de rerefons?"
|
| 395 |
+
|
| 396 |
+
#: sexy-bookmarks.php:754
|
| 397 |
+
msgid "Menu Placement"
|
| 398 |
+
msgstr "Situació del menú"
|
| 399 |
+
|
| 400 |
+
#: sexy-bookmarks.php:760
|
| 401 |
+
msgid "Need help with this? Find it in the %sofficial install guide%s."
|
| 402 |
+
msgstr "Necessites ajuda amb això? Troba-la a %sguíes oficials d'instal·lació%s."
|
| 403 |
+
|
| 404 |
+
#: sexy-bookmarks.php:766
|
| 405 |
+
msgid "Menu Location (in relation to content):"
|
| 406 |
+
msgstr "Localització dels menú (en relació al contingut)"
|
| 407 |
+
|
| 408 |
+
#: sexy-bookmarks.php:767
|
| 409 |
+
msgid "Above Content"
|
| 410 |
+
msgstr "Per sobre de"
|
| 411 |
+
|
| 412 |
+
#: sexy-bookmarks.php:768
|
| 413 |
+
msgid "Below Content"
|
| 414 |
+
msgstr "Per sota de"
|
| 415 |
+
|
| 416 |
+
#: sexy-bookmarks.php:769
|
| 417 |
+
msgid "Above & Below Content"
|
| 418 |
+
msgstr "A sobre i sota del contingut"
|
| 419 |
+
|
| 420 |
+
#: sexy-bookmarks.php:770
|
| 421 |
+
msgid "Manual Mode"
|
| 422 |
+
msgstr "Mode manual"
|
| 423 |
+
|
| 424 |
+
#: sexy-bookmarks.php:771
|
| 425 |
+
msgid "Posts, pages, or the whole shebang?"
|
| 426 |
+
msgstr "Entrades, pàgines, o tot l'assumpte?"
|
| 427 |
+
|
| 428 |
+
#: sexy-bookmarks.php:776
|
| 429 |
+
msgid "Posts Only"
|
| 430 |
+
msgstr "Només entrades"
|
| 431 |
+
|
| 432 |
+
#: sexy-bookmarks.php:777
|
| 433 |
+
msgid "Pages Only"
|
| 434 |
+
msgstr "Només Pàgines"
|
| 435 |
+
|
| 436 |
+
#: sexy-bookmarks.php:778
|
| 437 |
+
msgid "Index Only"
|
| 438 |
+
msgstr "Només Index"
|
| 439 |
+
|
| 440 |
+
#: sexy-bookmarks.php:779
|
| 441 |
+
msgid "Posts & Pages"
|
| 442 |
+
msgstr "Entrades i Pàgines"
|
| 443 |
+
|
| 444 |
+
#: sexy-bookmarks.php:780
|
| 445 |
+
msgid "Posts & Index"
|
| 446 |
+
msgstr "Entrades i Index"
|
| 447 |
+
|
| 448 |
+
#: sexy-bookmarks.php:781
|
| 449 |
+
msgid "Pages & Index"
|
| 450 |
+
msgstr "Pàgines i Index"
|
| 451 |
+
|
| 452 |
+
#: sexy-bookmarks.php:782
|
| 453 |
+
msgid "Posts, Pages, & Index"
|
| 454 |
+
msgstr "Entrades, Pàgines i Index"
|
| 455 |
+
|
| 456 |
+
#: sexy-bookmarks.php:786
|
| 457 |
+
msgid "Click here for help with this option"
|
| 458 |
+
msgstr "Fes click aquí per obtenir ajuda sobre aquesta opció"
|
| 459 |
+
|
| 460 |
+
#: sexy-bookmarks.php:787
|
| 461 |
+
msgid "Show in RSS feed?"
|
| 462 |
+
msgstr "Mostrar a l'RSS feed?"
|
| 463 |
+
|
| 464 |
+
#: sexy-bookmarks.php:791
|
| 465 |
+
msgid "Hide menu from mobile browsers?"
|
| 466 |
+
msgstr "Amaga el menú dels navegadors per a mòbils?"
|
| 467 |
+
|
| 468 |
+
#: sexy-bookmarks.php:800
|
| 469 |
+
msgid "Save Changes"
|
| 470 |
+
msgstr "Desa canvis"
|
| 471 |
+
|
| 472 |
+
#: sexy-bookmarks.php:804
|
| 473 |
+
msgid "Reset Settings"
|
| 474 |
+
msgstr "Reestableix les opcions"
|
| 475 |
+
|
| 476 |
+
#: sexy-bookmarks.php:810
|
| 477 |
+
msgid "Helpful Plugin Links"
|
| 478 |
+
msgstr "Enllaços a plugins d'ajuda"
|
| 479 |
+
|
| 480 |
+
#: sexy-bookmarks.php:815
|
| 481 |
+
msgid "Installation & Usage Guide"
|
| 482 |
+
msgstr "Instal·lació i Manual d'ús"
|
| 483 |
+
|
| 484 |
+
#: sexy-bookmarks.php:816
|
| 485 |
+
msgid "Frequently Asked Questions"
|
| 486 |
+
msgstr "Preguntes Més Freqüents"
|
| 487 |
+
|
| 488 |
+
#: sexy-bookmarks.php:817
|
| 489 |
+
msgid "Bug Submission Form"
|
| 490 |
+
msgstr "Formulari d'enviament de bugs"
|
| 491 |
+
|
| 492 |
+
#: sexy-bookmarks.php:818
|
| 493 |
+
msgid "Feature Request Form"
|
| 494 |
+
msgstr "Formulari de petició de millores"
|
| 495 |
+
|
| 496 |
+
#: sexy-bookmarks.php:819
|
| 497 |
+
msgid "Submit a Translation"
|
| 498 |
+
msgstr "Envía una traducció"
|
| 499 |
+
|
| 500 |
+
#: sexy-bookmarks.php:820
|
| 501 |
+
msgid "Shareaholic Browsers Add-ons"
|
| 502 |
+
msgstr "Complemnts per als navegadors de Shareaholic"
|
| 503 |
+
|
| 504 |
+
#: sexy-bookmarks.php:821
|
| 505 |
+
msgid "Thanks & Credits"
|
| 506 |
+
msgstr "Gràcies i crèdits"
|
| 507 |
+
|
| 508 |
+
#: sexy-bookmarks.php:840
|
| 509 |
+
#: sexy-bookmarks.php:843
|
| 510 |
+
msgid "SexyBookmarks (by Shareaholic)"
|
| 511 |
+
msgstr "SexyBookmarks (per Shareaholic)"
|
| 512 |
+
|
| 513 |
+
#: sexy-bookmarks.php:840
|
| 514 |
+
msgid "Shareaholic"
|
| 515 |
+
msgstr "Shareaholic"
|
| 516 |
+
|
| 517 |
+
#: sexy-bookmarks.php:843
|
| 518 |
+
msgid "SexyBookmarks"
|
| 519 |
+
msgstr "SexyBookmarks"
|
| 520 |
+
|
| 521 |
+
#: sexy-bookmarks.php:879
|
| 522 |
+
msgid "Settings"
|
| 523 |
+
msgstr "Opcions"
|
| 524 |
+
|
| 525 |
+
#: includes/bookmarks-data.php:21
|
| 526 |
+
msgid "Check this box to include %s in your bookmarking menu"
|
| 527 |
+
msgstr "Activa aquesta casella per incloure %s al teu menú de bookmarking"
|
| 528 |
+
|
| 529 |
+
#: includes/bookmarks-data.php:28
|
| 530 |
+
#: includes/bookmarks-data.php:63
|
| 531 |
+
#: includes/bookmarks-data.php:88
|
| 532 |
+
#: includes/bookmarks-data.php:203
|
| 533 |
+
#: includes/bookmarks-data.php:258
|
| 534 |
+
#: includes/bookmarks-data.php:263
|
| 535 |
+
#: includes/bookmarks-data.php:268
|
| 536 |
+
#: includes/bookmarks-data.php:273
|
| 537 |
+
#: includes/bookmarks-data.php:313
|
| 538 |
+
#: includes/bookmarks-data.php:328
|
| 539 |
+
#: includes/bookmarks-data.php:338
|
| 540 |
+
#: includes/bookmarks-data.php:343
|
| 541 |
+
#: includes/bookmarks-data.php:363
|
| 542 |
+
msgid "Submit this to "
|
| 543 |
+
msgstr "Envia això a"
|
| 544 |
+
|
| 545 |
+
#: includes/bookmarks-data.php:33
|
| 546 |
+
#: includes/bookmarks-data.php:38
|
| 547 |
+
#: includes/bookmarks-data.php:53
|
| 548 |
+
#: includes/bookmarks-data.php:73
|
| 549 |
+
#: includes/bookmarks-data.php:78
|
| 550 |
+
#: includes/bookmarks-data.php:93
|
| 551 |
+
#: includes/bookmarks-data.php:118
|
| 552 |
+
#: includes/bookmarks-data.php:153
|
| 553 |
+
#: includes/bookmarks-data.php:158
|
| 554 |
+
#: includes/bookmarks-data.php:163
|
| 555 |
+
#: includes/bookmarks-data.php:173
|
| 556 |
+
#: includes/bookmarks-data.php:178
|
| 557 |
+
#: includes/bookmarks-data.php:293
|
| 558 |
+
#: includes/bookmarks-data.php:353
|
| 559 |
+
#: includes/bookmarks-data.php:373
|
| 560 |
+
#: includes/bookmarks-data.php:393
|
| 561 |
+
#: includes/bookmarks-data.php:403
|
| 562 |
+
#: includes/bookmarks-data.php:408
|
| 563 |
+
#: includes/bookmarks-data.php:418
|
| 564 |
+
#: includes/bookmarks-data.php:428
|
| 565 |
+
#: includes/bookmarks-data.php:443
|
| 566 |
+
msgid "Share this on "
|
| 567 |
+
msgstr "Comparteix això a "
|
| 568 |
+
|
| 569 |
+
#: includes/bookmarks-data.php:43
|
| 570 |
+
msgid "Digg this!"
|
| 571 |
+
msgstr "Comparteix-ho amb Digg!"
|
| 572 |
+
|
| 573 |
+
#: includes/bookmarks-data.php:48
|
| 574 |
+
msgid "Post this on "
|
| 575 |
+
msgstr "Afegir-ho a "
|
| 576 |
+
|
| 577 |
+
#: includes/bookmarks-data.php:58
|
| 578 |
+
msgid "Buzz up!"
|
| 579 |
+
msgstr "Buzz up!"
|
| 580 |
+
|
| 581 |
+
#: includes/bookmarks-data.php:68
|
| 582 |
+
msgid "Stumble upon something good? Share it on StumbleUpon"
|
| 583 |
+
msgstr "Has trobat alguna cosa bona? Comparteix-la a StumbleUpon"
|
| 584 |
+
|
| 585 |
+
#: includes/bookmarks-data.php:83
|
| 586 |
+
#: includes/bookmarks-data.php:223
|
| 587 |
+
#: includes/bookmarks-data.php:243
|
| 588 |
+
#: includes/bookmarks-data.php:383
|
| 589 |
+
msgid "Post this to "
|
| 590 |
+
msgstr "Afegir a "
|
| 591 |
+
|
| 592 |
+
#: includes/bookmarks-data.php:98
|
| 593 |
+
msgid "Tweet This!"
|
| 594 |
+
msgstr "Comparteix-ho al Twitter!"
|
| 595 |
+
|
| 596 |
+
#: includes/bookmarks-data.php:102
|
| 597 |
+
msgid "an 'Email to a Friend' link"
|
| 598 |
+
msgstr "un link a 'Email a un amic'"
|
| 599 |
+
|
| 600 |
+
#: includes/bookmarks-data.php:103
|
| 601 |
+
msgid "Email this to a friend?"
|
| 602 |
+
msgstr "Envia això per email a un amic?"
|
| 603 |
+
|
| 604 |
+
#: includes/bookmarks-data.php:108
|
| 605 |
+
msgid "Suggest this article to "
|
| 606 |
+
msgstr "Suggereix aquesta entrada a "
|
| 607 |
+
|
| 608 |
+
#: includes/bookmarks-data.php:111
|
| 609 |
+
msgid "a 'Subscribe to Comments' link"
|
| 610 |
+
msgstr "link a la 'Subscripció de comentaris'"
|
| 611 |
+
|
| 612 |
+
#: includes/bookmarks-data.php:112
|
| 613 |
+
#: includes/public.php:139
|
| 614 |
+
msgid "Subscribe to the comments for this post?"
|
| 615 |
+
msgstr "Et vols subscriure als comentaris d'aquesta entrada?"
|
| 616 |
+
|
| 617 |
+
#: includes/bookmarks-data.php:123
|
| 618 |
+
msgid "Seed this on "
|
| 619 |
+
msgstr "Seed de l'entrada a "
|
| 620 |
+
|
| 621 |
+
#: includes/bookmarks-data.php:128
|
| 622 |
+
#: includes/bookmarks-data.php:133
|
| 623 |
+
#: includes/bookmarks-data.php:143
|
| 624 |
+
#: includes/bookmarks-data.php:148
|
| 625 |
+
#: includes/bookmarks-data.php:183
|
| 626 |
+
#: includes/bookmarks-data.php:188
|
| 627 |
+
#: includes/bookmarks-data.php:193
|
| 628 |
+
#: includes/bookmarks-data.php:198
|
| 629 |
+
#: includes/bookmarks-data.php:218
|
| 630 |
+
#: includes/bookmarks-data.php:378
|
| 631 |
+
#: includes/bookmarks-data.php:398
|
| 632 |
+
#: includes/bookmarks-data.php:423
|
| 633 |
+
msgid "Add this to "
|
| 634 |
+
msgstr "Afegeix això a "
|
| 635 |
+
|
| 636 |
+
#: includes/bookmarks-data.php:138
|
| 637 |
+
msgid "Post on Google Buzz"
|
| 638 |
+
msgstr "Publica a Google Buzz"
|
| 639 |
+
|
| 640 |
+
#: includes/bookmarks-data.php:168
|
| 641 |
+
msgid "Mark this on "
|
| 642 |
+
msgstr "Marca això a "
|
| 643 |
+
|
| 644 |
+
#: includes/bookmarks-data.php:177
|
| 645 |
+
#: includes/bookmarks-data.php:182
|
| 646 |
+
#: includes/bookmarks-data.php:187
|
| 647 |
+
#: includes/bookmarks-data.php:192
|
| 648 |
+
#: includes/bookmarks-data.php:197
|
| 649 |
+
msgid " (Russian)"
|
| 650 |
+
msgstr " (Rus)"
|
| 651 |
+
|
| 652 |
+
#: includes/bookmarks-data.php:208
|
| 653 |
+
msgid "Send this page to "
|
| 654 |
+
msgstr "Envía aquesta pàgina a"
|
| 655 |
+
|
| 656 |
+
#: includes/bookmarks-data.php:213
|
| 657 |
+
msgid "Bump this on "
|
| 658 |
+
msgstr "Bump això a "
|
| 659 |
+
|
| 660 |
+
#: includes/bookmarks-data.php:228
|
| 661 |
+
msgid "Save this to "
|
| 662 |
+
msgstr "Desa això a "
|
| 663 |
+
|
| 664 |
+
#: includes/bookmarks-data.php:233
|
| 665 |
+
msgid "Tip this to "
|
| 666 |
+
msgstr "Tip això a "
|
| 667 |
+
|
| 668 |
+
#: includes/bookmarks-data.php:238
|
| 669 |
+
msgid "Sphinn this on "
|
| 670 |
+
msgstr "Sphinn això a "
|
| 671 |
+
|
| 672 |
+
#: includes/bookmarks-data.php:248
|
| 673 |
+
msgid "Grind this! on "
|
| 674 |
+
msgstr "Grind això a"
|
| 675 |
+
|
| 676 |
+
#: includes/bookmarks-data.php:253
|
| 677 |
+
msgid "Ping this on "
|
| 678 |
+
msgstr "Ping això a"
|
| 679 |
+
|
| 680 |
+
#: includes/bookmarks-data.php:257
|
| 681 |
+
#: includes/bookmarks-data.php:262
|
| 682 |
+
msgid " (Dutch)"
|
| 683 |
+
msgstr "(Alemany)"
|
| 684 |
+
|
| 685 |
+
#: includes/bookmarks-data.php:278
|
| 686 |
+
msgid "Blend this!"
|
| 687 |
+
msgstr "Blend d'això!"
|
| 688 |
+
|
| 689 |
+
#: includes/bookmarks-data.php:282
|
| 690 |
+
msgid " (Polish)"
|
| 691 |
+
msgstr "(Polonès)"
|
| 692 |
+
|
| 693 |
+
#: includes/bookmarks-data.php:283
|
| 694 |
+
msgid "Add this to Wykop!"
|
| 695 |
+
msgstr "afegeix això a Wykop!"
|
| 696 |
+
|
| 697 |
+
#: includes/bookmarks-data.php:288
|
| 698 |
+
msgid "Engage with this article!"
|
| 699 |
+
msgstr "Participa en aquest article!"
|
| 700 |
+
|
| 701 |
+
#: includes/bookmarks-data.php:297
|
| 702 |
+
msgid " (Swedish)"
|
| 703 |
+
msgstr "(Suec)"
|
| 704 |
+
|
| 705 |
+
#: includes/bookmarks-data.php:298
|
| 706 |
+
msgid "Push this on "
|
| 707 |
+
msgstr "Premeu això a "
|
| 708 |
+
|
| 709 |
+
#: includes/bookmarks-data.php:302
|
| 710 |
+
msgid " (Japanese)"
|
| 711 |
+
msgstr "(Japonés)"
|
| 712 |
+
|
| 713 |
+
#: includes/bookmarks-data.php:303
|
| 714 |
+
msgid "Bookmarks this on "
|
| 715 |
+
msgstr "Adreces d'interés a "
|
| 716 |
+
|
| 717 |
+
#: includes/bookmarks-data.php:308
|
| 718 |
+
msgid "Store this link on "
|
| 719 |
+
msgstr "Desa aquest link a"
|
| 720 |
+
|
| 721 |
+
#: includes/bookmarks-data.php:318
|
| 722 |
+
msgid "Add to a lense on "
|
| 723 |
+
msgstr "Afegir a lense on "
|
| 724 |
+
|
| 725 |
+
#: includes/bookmarks-data.php:323
|
| 726 |
+
msgid "Submit this story to "
|
| 727 |
+
msgstr "Enví aquesta histò a "
|
| 728 |
+
|
| 729 |
+
#: includes/bookmarks-data.php:333
|
| 730 |
+
msgid "Clip this to "
|
| 731 |
+
msgstr "Clip d'això a "
|
| 732 |
+
|
| 733 |
+
#: includes/bookmarks-data.php:337
|
| 734 |
+
#: includes/bookmarks-data.php:342
|
| 735 |
+
msgid " (Spanish)"
|
| 736 |
+
msgstr "(Espanyol)"
|
| 737 |
+
|
| 738 |
+
#: includes/bookmarks-data.php:348
|
| 739 |
+
msgid "Submit this link to "
|
| 740 |
+
msgstr "Envía aquest link a"
|
| 741 |
+
|
| 742 |
+
#: includes/bookmarks-data.php:358
|
| 743 |
+
msgid "Submit tip to "
|
| 744 |
+
msgstr "Envía el tip a"
|
| 745 |
+
|
| 746 |
+
#: includes/bookmarks-data.php:368
|
| 747 |
+
msgid "Promote this on "
|
| 748 |
+
msgstr "Pormociona això a "
|
| 749 |
+
|
| 750 |
+
#: includes/bookmarks-data.php:388
|
| 751 |
+
msgid "Blog this on "
|
| 752 |
+
msgstr "Fes blog d'això a "
|
| 753 |
+
|
| 754 |
+
#: includes/bookmarks-data.php:402
|
| 755 |
+
msgid " (Estonian)"
|
| 756 |
+
msgstr "(Estonià)"
|
| 757 |
+
|
| 758 |
+
#: includes/bookmarks-data.php:413
|
| 759 |
+
msgid "Add this link to "
|
| 760 |
+
msgstr "Afegeix aquest enllaç a "
|
| 761 |
+
|
| 762 |
+
#: includes/bookmarks-data.php:417
|
| 763 |
+
msgid "(Italian)"
|
| 764 |
+
msgstr "(Italià)"
|
| 765 |
+
|
| 766 |
+
#: includes/bookmarks-data.php:433
|
| 767 |
+
msgid "Spring this on "
|
| 768 |
+
msgstr "Spring d'això a "
|
| 769 |
+
|
| 770 |
+
#: includes/bookmarks-data.php:438
|
| 771 |
+
msgid "Box this on "
|
| 772 |
+
msgstr "Box d'això a "
|
| 773 |
+
|
| 774 |
+
#: includes/bookmarks-data.php:448
|
| 775 |
+
#: includes/bookmarks-data.php:453
|
| 776 |
+
#: includes/bookmarks-data.php:458
|
| 777 |
+
msgid "Email this via "
|
| 778 |
+
msgstr "Evia-ho per email via"
|
| 779 |
+
|
| 780 |
+
#: includes/bookmarks-data.php:463
|
| 781 |
+
msgid "Share this via "
|
| 782 |
+
msgstr "Comparteix-ho via"
|
| 783 |
+
|
| 784 |
+
#: includes/public.php:549
|
| 785 |
+
msgid "An unknown error occurred in SexyBookmarks"
|
| 786 |
+
msgstr "Un error desconegut ha transcorregut a SexyBookmarks"
|
| 787 |
+
|
| 788 |
+
#: includes/public.php:814
|
| 789 |
+
msgid "SexyBookmarks has been disabled on this page"
|
| 790 |
+
msgstr "SexyBookmarks ha estat deshabilitat en aquesta pàgina\""
|
| 791 |
+
|
languages/shrsb-da_DK.mo
ADDED
|
Binary file
|
languages/shrsb-da_DK.po
ADDED
|
@@ -0,0 +1,1263 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
msgid ""
|
| 2 |
+
msgstr ""
|
| 3 |
+
"Project-Id-Version: SexyBookmarks v2.6.1.2\n"
|
| 4 |
+
"Report-Msgid-Bugs-To: \n"
|
| 5 |
+
"POT-Creation-Date: 2009-12-19 14:36-0600\n"
|
| 6 |
+
"PO-Revision-Date: \n"
|
| 7 |
+
"Last-Translator: Mads <mads@hardwareblog.dk>\n"
|
| 8 |
+
"Language-Team: Josh Jones, Norman Yung\n"
|
| 9 |
+
"MIME-Version: 1.0\n"
|
| 10 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
+
"X-Poedit-Language: English\n"
|
| 13 |
+
"X-Poedit-Country: UNITED STATES\n"
|
| 14 |
+
"X-Poedit-KeywordsList: __;_e\n"
|
| 15 |
+
"X-Poedit-Basepath: .\n"
|
| 16 |
+
"X-Poedit-SearchPath-0: .\n"
|
| 17 |
+
|
| 18 |
+
#: sexy-bookmarks.php:170
|
| 19 |
+
msgid "Your changes have been saved successfully!"
|
| 20 |
+
msgstr "Dine ændinger blevet gemt korrekt!"
|
| 21 |
+
|
| 22 |
+
#: sexy-bookmarks.php:170
|
| 23 |
+
msgid "Maybe you would consider "
|
| 24 |
+
msgstr "Måske du vil overveje"
|
| 25 |
+
|
| 26 |
+
#: sexy-bookmarks.php:170
|
| 27 |
+
msgid "donating"
|
| 28 |
+
msgstr "at donere"
|
| 29 |
+
|
| 30 |
+
#: sexy-bookmarks.php:173
|
| 31 |
+
msgid "Please choose where you would like the menu to be displayed."
|
| 32 |
+
msgstr "Vælg venligst hvor du ønkser at få menu'en vist."
|
| 33 |
+
|
| 34 |
+
#: sexy-bookmarks.php:174
|
| 35 |
+
msgid "You can't display the menu if you don't choose a few sites to add to it!"
|
| 36 |
+
msgstr "Menu'en vises ikke, før du har tilføjet et par sites!"
|
| 37 |
+
|
| 38 |
+
#: sexy-bookmarks.php:175
|
| 39 |
+
msgid "Please choose where you want the menu displayed."
|
| 40 |
+
msgstr "Vælg venligst hvor du gerne vil ha' menu'en vist."
|
| 41 |
+
|
| 42 |
+
#: sexy-bookmarks.php:179
|
| 43 |
+
msgid "You need to select the primary category for any articles submitted to Twittley."
|
| 44 |
+
msgstr "Du skal vælge en primær kategori, for artikler sendt til Twittley."
|
| 45 |
+
|
| 46 |
+
#: sexy-bookmarks.php:180
|
| 47 |
+
msgid "You need to set at least 1 default tag for any articles submitted to Twittley."
|
| 48 |
+
msgstr "Du skal vælge mindst 1 standard tag, for artikler sendt til Twittley."
|
| 49 |
+
|
| 50 |
+
#: sexy-bookmarks.php:190
|
| 51 |
+
msgid "You must first download and activate the"
|
| 52 |
+
msgstr "Du skal først downloade og aktivere "
|
| 53 |
+
|
| 54 |
+
#: sexy-bookmarks.php:190
|
| 55 |
+
msgid "Twitter Friendly Links Plugin"
|
| 56 |
+
msgstr "Twitter Friendly Links Plugin'et"
|
| 57 |
+
|
| 58 |
+
#: sexy-bookmarks.php:190
|
| 59 |
+
msgid "before hosting your own short URLs..."
|
| 60 |
+
msgstr "før du kan hoste dine egen korte URL's..."
|
| 61 |
+
|
| 62 |
+
#: sexy-bookmarks.php:225
|
| 63 |
+
msgid " Short URLs have been reset."
|
| 64 |
+
msgstr "Korte URL's er blevet nulstillet."
|
| 65 |
+
|
| 66 |
+
#: sexy-bookmarks.php:265
|
| 67 |
+
msgid "Enabled Networks"
|
| 68 |
+
msgstr "Aktiverede netværk"
|
| 69 |
+
|
| 70 |
+
#: sexy-bookmarks.php:269
|
| 71 |
+
msgid "Select the Networks to display. Drag to reorder."
|
| 72 |
+
msgstr "Vælg de netværk der skal vises. Træk dem med musen, for at arrangere rækkefølgen."
|
| 73 |
+
|
| 74 |
+
#: sexy-bookmarks.php:272
|
| 75 |
+
msgid "All"
|
| 76 |
+
msgstr "Alle"
|
| 77 |
+
|
| 78 |
+
#: sexy-bookmarks.php:273
|
| 79 |
+
msgid "None"
|
| 80 |
+
msgstr "Ingen"
|
| 81 |
+
|
| 82 |
+
#: sexy-bookmarks.php:274
|
| 83 |
+
msgid "Most Popular"
|
| 84 |
+
msgstr "Mest populære"
|
| 85 |
+
|
| 86 |
+
#: sexy-bookmarks.php:275
|
| 87 |
+
msgid "Recommended"
|
| 88 |
+
msgstr "Foreslåede"
|
| 89 |
+
|
| 90 |
+
#: sexy-bookmarks.php:289
|
| 91 |
+
msgid "Functionality Settings"
|
| 92 |
+
msgstr "Indstillinger for funktioner"
|
| 93 |
+
|
| 94 |
+
#: sexy-bookmarks.php:295
|
| 95 |
+
msgid "This will clear <u>ALL</u> short URLs. - Are you sure?"
|
| 96 |
+
msgstr "Dette vil slette <u>ALLE!</u> korte URL's - Er du sikker?"
|
| 97 |
+
|
| 98 |
+
#: sexy-bookmarks.php:298
|
| 99 |
+
#: sexy-bookmarks.php:457
|
| 100 |
+
#: sexy-bookmarks.php:460
|
| 101 |
+
#: sexy-bookmarks.php:511
|
| 102 |
+
#: sexy-bookmarks.php:592
|
| 103 |
+
msgid "Yes"
|
| 104 |
+
msgstr "Ja"
|
| 105 |
+
|
| 106 |
+
#: sexy-bookmarks.php:298
|
| 107 |
+
msgid "Cancel"
|
| 108 |
+
msgstr "Annullér"
|
| 109 |
+
|
| 110 |
+
#: sexy-bookmarks.php:302
|
| 111 |
+
msgid "Twitter Options:"
|
| 112 |
+
msgstr "Twitter indtillinger:"
|
| 113 |
+
|
| 114 |
+
#: sexy-bookmarks.php:303
|
| 115 |
+
msgid "Twitter ID:"
|
| 116 |
+
msgstr "Twitter ID:"
|
| 117 |
+
|
| 118 |
+
#: sexy-bookmarks.php:306
|
| 119 |
+
msgid "Which URL Shortener?"
|
| 120 |
+
msgstr "Hvilken URL-forkorter?"
|
| 121 |
+
|
| 122 |
+
#: sexy-bookmarks.php:328
|
| 123 |
+
msgid "Reset all Short URLs"
|
| 124 |
+
msgstr "Nulstil alle korte URL's"
|
| 125 |
+
|
| 126 |
+
#: sexy-bookmarks.php:393
|
| 127 |
+
msgid "Yahoo! Buzz Defaults:"
|
| 128 |
+
msgstr "Yahoo! Buzz standarder:"
|
| 129 |
+
|
| 130 |
+
#: sexy-bookmarks.php:394
|
| 131 |
+
msgid "Default Content Category:"
|
| 132 |
+
msgstr "Standard indholdskategori:"
|
| 133 |
+
|
| 134 |
+
#: sexy-bookmarks.php:414
|
| 135 |
+
msgid "Default Media Type:"
|
| 136 |
+
msgstr "Standard media type:"
|
| 137 |
+
|
| 138 |
+
#: sexy-bookmarks.php:428
|
| 139 |
+
msgid "Twittley Defaults:"
|
| 140 |
+
msgstr "Twittley standarder:"
|
| 141 |
+
|
| 142 |
+
#: sexy-bookmarks.php:429
|
| 143 |
+
msgid "Primary Content Category:"
|
| 144 |
+
msgstr "Primær indholdskategori:"
|
| 145 |
+
|
| 146 |
+
#: sexy-bookmarks.php:447
|
| 147 |
+
msgid "Enter a comma separated list of general tags which describe your site's posts as a whole. Try not to be too specific, as one post may fall into different \"tag categories\" than other posts."
|
| 148 |
+
msgstr "Indtast en komma-sepereret liste af tags, der beskriver dit sites indlæg som helhed. Forsøg ikke at være alt for specifik, da et indlæg kan falde under forskellige \"tag kategorier\" end andre indlæg."
|
| 149 |
+
|
| 150 |
+
#: sexy-bookmarks.php:448
|
| 151 |
+
msgid "This list is primarily used as a failsafe in case you forget to enter WordPress tags for a particular post, in which case this list of tags would be used so as to bring at least *somewhat* relevant search queries based on the general tags that you enter here."
|
| 152 |
+
msgstr "Denne liste er primært en sikkerhedsanordning, i tilfælde af at du glemmer at indtaste WordPress tags for et specifikt indlæg. I sådanne tilfælde, vil denne liste bruges til at gi' et *nogenlunde* relevant generelt tag, således indlæget nemmere kan findes i søgninger."
|
| 153 |
+
|
| 154 |
+
#: sexy-bookmarks.php:448
|
| 155 |
+
msgid "Click here to close this message"
|
| 156 |
+
msgstr "Klik her for at lukke besked"
|
| 157 |
+
|
| 158 |
+
#: sexy-bookmarks.php:448
|
| 159 |
+
msgid "close"
|
| 160 |
+
msgstr "luk"
|
| 161 |
+
|
| 162 |
+
#: sexy-bookmarks.php:450
|
| 163 |
+
msgid "Default Tags:"
|
| 164 |
+
msgstr "Standard tags:"
|
| 165 |
+
|
| 166 |
+
#: sexy-bookmarks.php:451
|
| 167 |
+
#: sexy-bookmarks.php:590
|
| 168 |
+
msgid "Click here for help with this option"
|
| 169 |
+
msgstr "Klik her for at få hjælp til denne indstilling"
|
| 170 |
+
|
| 171 |
+
#: sexy-bookmarks.php:455
|
| 172 |
+
msgid "General Functionality Options:"
|
| 173 |
+
msgstr "Generelle indstillinger for funktioner:"
|
| 174 |
+
|
| 175 |
+
#: sexy-bookmarks.php:456
|
| 176 |
+
msgid "Add nofollow to the links?"
|
| 177 |
+
msgstr "Tilføj et \"nofollow! til links?"
|
| 178 |
+
|
| 179 |
+
#: sexy-bookmarks.php:458
|
| 180 |
+
#: sexy-bookmarks.php:461
|
| 181 |
+
#: sexy-bookmarks.php:512
|
| 182 |
+
#: sexy-bookmarks.php:516
|
| 183 |
+
#: sexy-bookmarks.php:593
|
| 184 |
+
msgid "No"
|
| 185 |
+
msgstr "Nej"
|
| 186 |
+
|
| 187 |
+
#: sexy-bookmarks.php:459
|
| 188 |
+
msgid "Open links in new window?"
|
| 189 |
+
msgstr "Åben links i et nyt vindue?"
|
| 190 |
+
|
| 191 |
+
#: sexy-bookmarks.php:468
|
| 192 |
+
msgid "Plugin Aesthetics"
|
| 193 |
+
msgstr "Plugin udseende"
|
| 194 |
+
|
| 195 |
+
#: sexy-bookmarks.php:473
|
| 196 |
+
msgid "Warning!"
|
| 197 |
+
msgstr "Advarsel!"
|
| 198 |
+
|
| 199 |
+
#: sexy-bookmarks.php:474
|
| 200 |
+
msgid "This option is intended "
|
| 201 |
+
msgstr "Denne indstilling er "
|
| 202 |
+
|
| 203 |
+
#: sexy-bookmarks.php:474
|
| 204 |
+
msgid "STRICTLY"
|
| 205 |
+
msgstr "UDELUKKENDE"
|
| 206 |
+
|
| 207 |
+
#: sexy-bookmarks.php:474
|
| 208 |
+
msgid " for users who understand how to edit CSS/JS and intend to change/edit the associated images themselves. No support will be offered for this feature, as I cannot be held accountable for your coding/image-editing mistakes. Furthermore, this feature was implemented as a favor to the thousands of you who asked for such a feature, and as such, I would appreciate it if you could refrain from sending nasty emails when you break the plugin due to coding errors of your own."
|
| 209 |
+
msgstr " for brugere der har forstand på at ændre CSS/JS, og som har intentioner om at ændre the associerede billeder på egen hånd. Der yders ikke support for denne feature, og jeg kan ikke holdes ansvarlig for dine kode/billede-ændrings fejl. Yderligere, så er denne feature tilføjet, som en hjælp til de tusinde brugere der har efterspurgt en sådan, og derfor vil jeg sætte stor pris på, at i ikke sender mig ubehagelige emails, når i har ødelagt plugin'et, pga. egenhændige kodefejl."
|
| 210 |
+
|
| 211 |
+
#: sexy-bookmarks.php:475
|
| 212 |
+
msgid "How it works..."
|
| 213 |
+
msgstr "Hvordan der virker..."
|
| 214 |
+
|
| 215 |
+
#: sexy-bookmarks.php:476
|
| 216 |
+
msgid "Since you have chosen for the plugin to override the style settings with your own custom mods, it will now pull the files from the new folders it is going to create on your server as soon as you save your changes. The file/folder locations should be as follows:"
|
| 217 |
+
msgstr "Eftersom du har valgt at plugin'et skal bestemme over udseenet med dine egne tilpassede mods, vil det nu hente filerne fra de nye mapper, som det vil oprette på din server, så snart du gemmer dine indstillinger. Fil/mappe stien skal være som følger:"
|
| 218 |
+
|
| 219 |
+
#: sexy-bookmarks.php:487
|
| 220 |
+
msgid "Once you have saved your changes, you will be able to edit the image sprite that holds all of the icons for SexyBookmarks as well as the CSS which accompanies it. Just be sure that you do in fact edit the CSS if you edit the images, as it is unlikely the heights, widths, and background positions of the images will stay the same after you are done."
|
| 221 |
+
msgstr "Så snart du har gemt dine indstillinger, vil du kunne redigere billedet, på trods af at det indeholder ikonerne for SexyBookmarks, såvel som CSS'en der følger det - for at være sikker på at du rent faktisk får CSS'en redigeret, hvis du redigerer billederne, da det er usansynligt at højde, brede og baggrundspositionen for billederne, vil forblive den samme efter du er færdig."
|
| 222 |
+
|
| 223 |
+
#: sexy-bookmarks.php:488
|
| 224 |
+
msgid "Just a quick note... When you edit the styles and images to include your own custom backgrounds, icons, and CSS styles, be aware that those changes will not be reflected on the plugin options page. In other words: when you select your networks to be displayed, or when you select the background image to use, it will still be displaying the images from the original plugin directory."
|
| 225 |
+
msgstr "En kort note... Når du redigerer stilen og billederne til at indeholde dine egne tilpassede ikoner og CSS styles, vær' da opmærksom på, at disse ændinger ikke vil kunne ses på plugin indstillings-siden. Med andre ord: Når du vælger de netværk der skal vises, eller når du vælger et baggrundsbillede der skal vises, vil det stadig stå som billedet fra den originale plugin sti."
|
| 226 |
+
|
| 227 |
+
#: sexy-bookmarks.php:490
|
| 228 |
+
msgid "If you happen to completely screw up the code, you can follow these directions to reset the plugin back to normal and try again if you wish:"
|
| 229 |
+
msgstr "Hvis du kommer til at lave totalt kludder i koden, kan du følge disse anvisninger til at gendanne plugin'et, så du kan førsøge igen hvis du ønsker det."
|
| 230 |
+
|
| 231 |
+
#: sexy-bookmarks.php:492
|
| 232 |
+
msgid "Login to your server via FTP or SSH. (whichever you are more comfortable with)"
|
| 233 |
+
msgstr "Login på din server via FTP eller SHH. (hvad end du har det bedst med)"
|
| 234 |
+
|
| 235 |
+
#: sexy-bookmarks.php:493
|
| 236 |
+
msgid "Navigate to your wp-content directory."
|
| 237 |
+
msgstr "Navigér til din wp-content mappe."
|
| 238 |
+
|
| 239 |
+
#: sexy-bookmarks.php:494
|
| 240 |
+
msgid "Delete the directory named \"sexy-mods\"."
|
| 241 |
+
msgstr "Slet mappen ved navn \"sexy-mods\"."
|
| 242 |
+
|
| 243 |
+
#: sexy-bookmarks.php:495
|
| 244 |
+
msgid "Login to your WordPress dashboard."
|
| 245 |
+
msgstr "Login i din WordPress admin."
|
| 246 |
+
|
| 247 |
+
#: sexy-bookmarks.php:496
|
| 248 |
+
msgid "Go to the SexyBookmarks plugin options page. (settings->sexybookmarks)"
|
| 249 |
+
msgstr "Gå til SexyBookmarks plugin indstillings-siden (indstillinger->sexybookmarks)"
|
| 250 |
+
|
| 251 |
+
#: sexy-bookmarks.php:497
|
| 252 |
+
msgid "Deselect the \"Use custom mods\" option."
|
| 253 |
+
msgstr "Fravælg \"Use custom mods\""
|
| 254 |
+
|
| 255 |
+
#: sexy-bookmarks.php:498
|
| 256 |
+
msgid "Save your changes."
|
| 257 |
+
msgstr "Gen dine ændringer"
|
| 258 |
+
|
| 259 |
+
#: sexy-bookmarks.php:504
|
| 260 |
+
msgid "Override Styles With Custom Mods Instead?"
|
| 261 |
+
msgstr "Anvend tilpassede mods, i stedet for Styles?"
|
| 262 |
+
|
| 263 |
+
#: sexy-bookmarks.php:509
|
| 264 |
+
msgid "jQuery Related Options"
|
| 265 |
+
msgstr "jQuery relaterede indstillinger"
|
| 266 |
+
|
| 267 |
+
#: sexy-bookmarks.php:510
|
| 268 |
+
msgid "Animate-expand multi-lined bookmarks?"
|
| 269 |
+
msgstr "Animér-udvid multi-linie bogmærker?"
|
| 270 |
+
|
| 271 |
+
#: sexy-bookmarks.php:513
|
| 272 |
+
msgid "Auto-space/center the bookmarks?"
|
| 273 |
+
msgstr "Auto mellemrum/centrering til bogmærker"
|
| 274 |
+
|
| 275 |
+
#: sexy-bookmarks.php:514
|
| 276 |
+
msgid "Space"
|
| 277 |
+
msgstr "Mellemrum"
|
| 278 |
+
|
| 279 |
+
#: sexy-bookmarks.php:515
|
| 280 |
+
msgid "Center"
|
| 281 |
+
msgstr "Centrering"
|
| 282 |
+
|
| 283 |
+
#: sexy-bookmarks.php:517
|
| 284 |
+
msgid "jQuery Compatibility Fix"
|
| 285 |
+
msgstr "jQuery kompatibilitet's fix"
|
| 286 |
+
|
| 287 |
+
#: sexy-bookmarks.php:518
|
| 288 |
+
msgid "Check this box ONLY if you notice jQuery being loaded twice in your source code!"
|
| 289 |
+
msgstr "Vælg KUN denne funktion, hvis du kan se jQuery bliver loaded to gange i kildekoden!"
|
| 290 |
+
|
| 291 |
+
#: sexy-bookmarks.php:521
|
| 292 |
+
msgid "Background Image Options"
|
| 293 |
+
msgstr "Indstillinger for baggrundsbillede"
|
| 294 |
+
|
| 295 |
+
#: sexy-bookmarks.php:523
|
| 296 |
+
msgid "Use a background image?"
|
| 297 |
+
msgstr "Anvend et baggrundsbillede?"
|
| 298 |
+
|
| 299 |
+
#: sexy-bookmarks.php:553
|
| 300 |
+
msgid "Menu Placement"
|
| 301 |
+
msgstr "Placering af menu'en"
|
| 302 |
+
|
| 303 |
+
#: sexy-bookmarks.php:559
|
| 304 |
+
msgid "Need help with this? Find it in the "
|
| 305 |
+
msgstr "Brug for hjælp til dette? Find det i "
|
| 306 |
+
|
| 307 |
+
#: sexy-bookmarks.php:559
|
| 308 |
+
msgid "official install guide"
|
| 309 |
+
msgstr "den officelle installationsguide"
|
| 310 |
+
|
| 311 |
+
#: sexy-bookmarks.php:567
|
| 312 |
+
msgid "This feature is still in the experimental phase, so please "
|
| 313 |
+
msgstr "Denne feature er i en experimental fase, så venligst "
|
| 314 |
+
|
| 315 |
+
#: sexy-bookmarks.php:567
|
| 316 |
+
msgid "report any bugs"
|
| 317 |
+
msgstr "rapportér fejl "
|
| 318 |
+
|
| 319 |
+
#: sexy-bookmarks.php:567
|
| 320 |
+
msgid "you may find"
|
| 321 |
+
msgstr "som du oplever"
|
| 322 |
+
|
| 323 |
+
#: sexy-bookmarks.php:573
|
| 324 |
+
msgid "Menu Location (in relevance to content):"
|
| 325 |
+
msgstr "Placering af menu'en (i relevans til indhold):"
|
| 326 |
+
|
| 327 |
+
#: sexy-bookmarks.php:574
|
| 328 |
+
msgid "Above Content"
|
| 329 |
+
msgstr "Ovenover indholdet"
|
| 330 |
+
|
| 331 |
+
#: sexy-bookmarks.php:575
|
| 332 |
+
msgid "Below Content"
|
| 333 |
+
msgstr "Under indholdet"
|
| 334 |
+
|
| 335 |
+
#: sexy-bookmarks.php:576
|
| 336 |
+
msgid "Manual Mode"
|
| 337 |
+
msgstr "Manuel indstilling"
|
| 338 |
+
|
| 339 |
+
#: sexy-bookmarks.php:577
|
| 340 |
+
msgid "Posts, pages, or the whole shebang?"
|
| 341 |
+
msgstr "Indlæg, sider, eller hele molevitten?"
|
| 342 |
+
|
| 343 |
+
#: sexy-bookmarks.php:591
|
| 344 |
+
msgid "Show in RSS feed?"
|
| 345 |
+
msgstr "Vis i RSS feed?"
|
| 346 |
+
|
| 347 |
+
#: sexy-bookmarks.php:595
|
| 348 |
+
msgid "Hide menu from mobile browsers?"
|
| 349 |
+
msgstr "Skjul menu'en for mobile browsere"
|
| 350 |
+
|
| 351 |
+
#: sexy-bookmarks.php:603
|
| 352 |
+
msgid "Save Changes"
|
| 353 |
+
msgstr "Gen ændringer"
|
| 354 |
+
|
| 355 |
+
#: sexy-bookmarks.php:609
|
| 356 |
+
msgid "Helpful Plugin Links"
|
| 357 |
+
msgstr "Nyttige plugin links"
|
| 358 |
+
|
| 359 |
+
#: sexy-bookmarks.php:614
|
| 360 |
+
msgid "Installation & Usage Guide"
|
| 361 |
+
msgstr "Intallations & brugsanvisning"
|
| 362 |
+
|
| 363 |
+
#: sexy-bookmarks.php:615
|
| 364 |
+
msgid "Frequently Asked Questions"
|
| 365 |
+
msgstr "Ofte stillede spørgsmål"
|
| 366 |
+
|
| 367 |
+
#: sexy-bookmarks.php:616
|
| 368 |
+
msgid "Bug Submission Form"
|
| 369 |
+
msgstr "Fejlrapportérings formular"
|
| 370 |
+
|
| 371 |
+
#: sexy-bookmarks.php:617
|
| 372 |
+
msgid "Feature Request Form"
|
| 373 |
+
msgstr "Feature forespørgsel formular"
|
| 374 |
+
|
| 375 |
+
#: sexy-bookmarks.php:618
|
| 376 |
+
msgid "Submit a Translation"
|
| 377 |
+
msgstr "Indsend en oversættelse"
|
| 378 |
+
|
| 379 |
+
#: sexy-bookmarks.php:619
|
| 380 |
+
msgid "Other SexyBookmarks Platforms"
|
| 381 |
+
msgstr "Andre SexyBookmarks platforme"
|
| 382 |
+
|
| 383 |
+
#: sexy-bookmarks.php:626
|
| 384 |
+
msgid "Support by Donating"
|
| 385 |
+
msgstr "Hjælp ved at donere"
|
| 386 |
+
|
| 387 |
+
#: sexy-bookmarks.php:630
|
| 388 |
+
msgid "If you like SexyBookmarks and wish to contribute towards it's continued development, you can use the form below to do so."
|
| 389 |
+
msgstr "Hvis du kan li' SexyBooksmarks, o ghvis du gerne vil bidrage til den fortsatte udviklng, kan du benytte nedenstående formular til formålet."
|
| 390 |
+
|
| 391 |
+
#: sexy-bookmarks.php:634
|
| 392 |
+
msgid "SexyBookmarks Development Support"
|
| 393 |
+
msgstr "SexyBookmarks udviklings-support"
|
| 394 |
+
|
| 395 |
+
#: sexy-bookmarks.php:637
|
| 396 |
+
msgid "Please enter the URL you'd like me to link to if you are a top contributor."
|
| 397 |
+
msgstr "Indtast venligst URL'en der skal linkes til, hvis du er en top bidrag yder."
|
| 398 |
+
|
| 399 |
+
#: sexy-bookmarks.php:639
|
| 400 |
+
msgid "Return to Your Dashboard"
|
| 401 |
+
msgstr "Vend tilbage til kontrolpanelet"
|
| 402 |
+
|
| 403 |
+
#: sexy-bookmarks.php:643
|
| 404 |
+
msgid "Select Preset Amount? "
|
| 405 |
+
msgstr "Vælg forudbestemt beløb? "
|
| 406 |
+
|
| 407 |
+
#: sexy-bookmarks.php:656
|
| 408 |
+
msgid "Enter Custom Amount?"
|
| 409 |
+
msgstr "Indtast beløb?"
|
| 410 |
+
|
| 411 |
+
#: sexy-bookmarks.php:662
|
| 412 |
+
msgid "Disable sponsor messages?"
|
| 413 |
+
msgstr "Deaktivér sponsor meddeleser?"
|
| 414 |
+
|
| 415 |
+
#: sexy-bookmarks.php:671
|
| 416 |
+
msgid "Top Supporters"
|
| 417 |
+
msgstr "Top bidrag ydere"
|
| 418 |
+
|
| 419 |
+
#: sexy-bookmarks.php:684
|
| 420 |
+
msgid "Shout-Outs"
|
| 421 |
+
msgstr "Shout-Outs"
|
| 422 |
+
|
| 423 |
+
#: sexy-bookmarks.php:689
|
| 424 |
+
msgid "Fugue Icons: Pinvoke"
|
| 425 |
+
msgstr "Fugue ikoner: Pinvoke"
|
| 426 |
+
|
| 427 |
+
#: sexy-bookmarks.php:690
|
| 428 |
+
msgid "Fugue Icon Sprite: Alison Barrett"
|
| 429 |
+
msgstr "Fugue ikon sprite: Alison Barrett"
|
| 430 |
+
|
| 431 |
+
#: sexy-bookmarks.php:691
|
| 432 |
+
msgid "Original Skin Icons: Function"
|
| 433 |
+
msgstr "Original skin ikoner: Function"
|
| 434 |
+
|
| 435 |
+
#: sexy-bookmarks.php:692
|
| 436 |
+
msgid "Bug Patch: Artem Russakovskii"
|
| 437 |
+
msgstr "Fejlretter: Artem Russakovskii"
|
| 438 |
+
|
| 439 |
+
#: sexy-bookmarks.php:693
|
| 440 |
+
msgid "Twitter encoding fix: Gautam Gupta"
|
| 441 |
+
msgstr "Twitter kodning fix: Gautam Gupta"
|
| 442 |
+
|
| 443 |
+
#: sexy-bookmarks.php:694
|
| 444 |
+
msgid "bit.ly bug fix: Konstantin Kovshenin"
|
| 445 |
+
msgstr "bit.ly fejlretter: Konstantin Kovshenin"
|
| 446 |
+
|
| 447 |
+
#: sexy-bookmarks.php:701
|
| 448 |
+
msgid "Translation Contributors"
|
| 449 |
+
msgstr "Oversættelses-hjælpere"
|
| 450 |
+
|
| 451 |
+
#: sexy-bookmarks.php:706
|
| 452 |
+
msgid "RU Translation: Yuri Gribov"
|
| 453 |
+
msgstr "RU oversættelse: Yuri Gribov"
|
| 454 |
+
|
| 455 |
+
#: sexy-bookmarks.php:707
|
| 456 |
+
msgid "FR Translation: Maitre Mo"
|
| 457 |
+
msgstr "FR oversættelse: Maitre Mo"
|
| 458 |
+
|
| 459 |
+
#: sexy-bookmarks.php:708
|
| 460 |
+
msgid "RO Translation: Ghenciu Ciprian"
|
| 461 |
+
msgstr "RO oversættelse: Ghenciu Ciprian"
|
| 462 |
+
|
| 463 |
+
#: sexy-bookmarks.php:709
|
| 464 |
+
msgid "IT Translation: Carlo Veltri"
|
| 465 |
+
msgstr "IT oversættelse: Carlo Veltri"
|
| 466 |
+
|
| 467 |
+
#: sexy-bookmarks.php:710
|
| 468 |
+
msgid "ES Translation: Javier Pimienta"
|
| 469 |
+
msgstr "ES oversættelse: Javier Pimienta"
|
| 470 |
+
|
| 471 |
+
#: sexy-bookmarks.php:711
|
| 472 |
+
msgid "CN Translation: Joojen"
|
| 473 |
+
msgstr "CN oversættelse: Joojen"
|
| 474 |
+
|
| 475 |
+
#: sexy-bookmarks.php:712
|
| 476 |
+
msgid "IT Translation: Giovanni Zuccaro"
|
| 477 |
+
msgstr "IT oversættelse: Giovanni Zuccaro"
|
| 478 |
+
|
| 479 |
+
#: sexy-bookmarks.php:713
|
| 480 |
+
msgid "TR Translation: Ömer Taylan Tuğut"
|
| 481 |
+
msgstr "TR oversættelse: Ömer Taylan Tuğut"
|
| 482 |
+
|
| 483 |
+
#: sexy-bookmarks.php:714
|
| 484 |
+
msgid "DE Translation: Gunther Wegner"
|
| 485 |
+
msgstr "DE oversættelse: Gunther Wegner"
|
| 486 |
+
|
| 487 |
+
#: sexy-bookmarks.php:715
|
| 488 |
+
msgid "da-DK Translation: Mads Floe"
|
| 489 |
+
msgstr "DK oversættelse: Mads Floe"
|
| 490 |
+
|
| 491 |
+
#: includes/bookmarks-data.php:5
|
| 492 |
+
#: includes/bookmarks-data.php:10
|
| 493 |
+
#: includes/bookmarks-data.php:15
|
| 494 |
+
#: includes/bookmarks-data.php:20
|
| 495 |
+
#: includes/bookmarks-data.php:25
|
| 496 |
+
#: includes/bookmarks-data.php:30
|
| 497 |
+
#: includes/bookmarks-data.php:35
|
| 498 |
+
#: includes/bookmarks-data.php:40
|
| 499 |
+
#: includes/bookmarks-data.php:45
|
| 500 |
+
#: includes/bookmarks-data.php:50
|
| 501 |
+
#: includes/bookmarks-data.php:55
|
| 502 |
+
#: includes/bookmarks-data.php:60
|
| 503 |
+
#: includes/bookmarks-data.php:65
|
| 504 |
+
#: includes/bookmarks-data.php:70
|
| 505 |
+
#: includes/bookmarks-data.php:85
|
| 506 |
+
#: includes/bookmarks-data.php:90
|
| 507 |
+
#: includes/bookmarks-data.php:95
|
| 508 |
+
#: includes/bookmarks-data.php:100
|
| 509 |
+
#: includes/bookmarks-data.php:105
|
| 510 |
+
#: includes/bookmarks-data.php:110
|
| 511 |
+
#: includes/bookmarks-data.php:115
|
| 512 |
+
#: includes/bookmarks-data.php:120
|
| 513 |
+
#: includes/bookmarks-data.php:125
|
| 514 |
+
#: includes/bookmarks-data.php:130
|
| 515 |
+
#: includes/bookmarks-data.php:135
|
| 516 |
+
#: includes/bookmarks-data.php:140
|
| 517 |
+
#: includes/bookmarks-data.php:145
|
| 518 |
+
#: includes/bookmarks-data.php:150
|
| 519 |
+
#: includes/bookmarks-data.php:155
|
| 520 |
+
#: includes/bookmarks-data.php:160
|
| 521 |
+
#: includes/bookmarks-data.php:165
|
| 522 |
+
#: includes/bookmarks-data.php:170
|
| 523 |
+
#: includes/bookmarks-data.php:175
|
| 524 |
+
#: includes/bookmarks-data.php:180
|
| 525 |
+
#: includes/bookmarks-data.php:185
|
| 526 |
+
#: includes/bookmarks-data.php:190
|
| 527 |
+
#: includes/bookmarks-data.php:195
|
| 528 |
+
#: includes/bookmarks-data.php:200
|
| 529 |
+
#: includes/bookmarks-data.php:205
|
| 530 |
+
#: includes/bookmarks-data.php:210
|
| 531 |
+
#: includes/bookmarks-data.php:215
|
| 532 |
+
#: includes/bookmarks-data.php:220
|
| 533 |
+
#: includes/bookmarks-data.php:225
|
| 534 |
+
#: includes/bookmarks-data.php:230
|
| 535 |
+
#: includes/bookmarks-data.php:235
|
| 536 |
+
#: includes/bookmarks-data.php:240
|
| 537 |
+
#: includes/bookmarks-data.php:245
|
| 538 |
+
#: includes/bookmarks-data.php:250
|
| 539 |
+
#: includes/bookmarks-data.php:255
|
| 540 |
+
#: includes/bookmarks-data.php:260
|
| 541 |
+
#: includes/bookmarks-data.php:265
|
| 542 |
+
#: includes/bookmarks-data.php:270
|
| 543 |
+
#: includes/bookmarks-data.php:275
|
| 544 |
+
#: includes/bookmarks-data.php:280
|
| 545 |
+
#: includes/bookmarks-data.php:285
|
| 546 |
+
#: includes/bookmarks-data.php:290
|
| 547 |
+
#: includes/bookmarks-data.php:295
|
| 548 |
+
#: includes/bookmarks-data.php:300
|
| 549 |
+
#: includes/bookmarks-data.php:305
|
| 550 |
+
#: includes/bookmarks-data.php:310
|
| 551 |
+
#: includes/bookmarks-data.php:315
|
| 552 |
+
#: includes/bookmarks-data.php:320
|
| 553 |
+
#: includes/bookmarks-data.php:325
|
| 554 |
+
#: includes/bookmarks-data.php:330
|
| 555 |
+
#: includes/bookmarks-data.php:335
|
| 556 |
+
#: includes/bookmarks-data.php:340
|
| 557 |
+
#: includes/bookmarks-data.php:345
|
| 558 |
+
#: includes/bookmarks-data.php:350
|
| 559 |
+
#: includes/bookmarks-data.php:355
|
| 560 |
+
#: includes/bookmarks-data.php:360
|
| 561 |
+
#: includes/bookmarks-data.php:365
|
| 562 |
+
#: includes/bookmarks-data.php:370
|
| 563 |
+
#: includes/bookmarks-data.php:375
|
| 564 |
+
#: includes/bookmarks-data.php:380
|
| 565 |
+
#: includes/bookmarks-data.php:385
|
| 566 |
+
msgid "Check this box to include "
|
| 567 |
+
msgstr "Vælg denne indstiling for at inkludere "
|
| 568 |
+
|
| 569 |
+
#: includes/bookmarks-data.php:5
|
| 570 |
+
#: includes/bookmarks-data.php:6
|
| 571 |
+
msgid "Script & Style"
|
| 572 |
+
msgstr "Script & Style"
|
| 573 |
+
|
| 574 |
+
#: includes/bookmarks-data.php:5
|
| 575 |
+
#: includes/bookmarks-data.php:10
|
| 576 |
+
#: includes/bookmarks-data.php:15
|
| 577 |
+
#: includes/bookmarks-data.php:20
|
| 578 |
+
#: includes/bookmarks-data.php:25
|
| 579 |
+
#: includes/bookmarks-data.php:30
|
| 580 |
+
#: includes/bookmarks-data.php:35
|
| 581 |
+
#: includes/bookmarks-data.php:40
|
| 582 |
+
#: includes/bookmarks-data.php:45
|
| 583 |
+
#: includes/bookmarks-data.php:50
|
| 584 |
+
#: includes/bookmarks-data.php:55
|
| 585 |
+
#: includes/bookmarks-data.php:60
|
| 586 |
+
#: includes/bookmarks-data.php:65
|
| 587 |
+
#: includes/bookmarks-data.php:70
|
| 588 |
+
#: includes/bookmarks-data.php:75
|
| 589 |
+
#: includes/bookmarks-data.php:80
|
| 590 |
+
#: includes/bookmarks-data.php:85
|
| 591 |
+
#: includes/bookmarks-data.php:90
|
| 592 |
+
#: includes/bookmarks-data.php:95
|
| 593 |
+
#: includes/bookmarks-data.php:100
|
| 594 |
+
#: includes/bookmarks-data.php:105
|
| 595 |
+
#: includes/bookmarks-data.php:110
|
| 596 |
+
#: includes/bookmarks-data.php:115
|
| 597 |
+
#: includes/bookmarks-data.php:120
|
| 598 |
+
#: includes/bookmarks-data.php:125
|
| 599 |
+
#: includes/bookmarks-data.php:130
|
| 600 |
+
#: includes/bookmarks-data.php:135
|
| 601 |
+
#: includes/bookmarks-data.php:140
|
| 602 |
+
#: includes/bookmarks-data.php:145
|
| 603 |
+
#: includes/bookmarks-data.php:150
|
| 604 |
+
#: includes/bookmarks-data.php:155
|
| 605 |
+
#: includes/bookmarks-data.php:160
|
| 606 |
+
#: includes/bookmarks-data.php:165
|
| 607 |
+
#: includes/bookmarks-data.php:170
|
| 608 |
+
#: includes/bookmarks-data.php:175
|
| 609 |
+
#: includes/bookmarks-data.php:180
|
| 610 |
+
#: includes/bookmarks-data.php:185
|
| 611 |
+
#: includes/bookmarks-data.php:190
|
| 612 |
+
#: includes/bookmarks-data.php:195
|
| 613 |
+
#: includes/bookmarks-data.php:200
|
| 614 |
+
#: includes/bookmarks-data.php:205
|
| 615 |
+
#: includes/bookmarks-data.php:210
|
| 616 |
+
#: includes/bookmarks-data.php:215
|
| 617 |
+
#: includes/bookmarks-data.php:220
|
| 618 |
+
#: includes/bookmarks-data.php:225
|
| 619 |
+
#: includes/bookmarks-data.php:230
|
| 620 |
+
#: includes/bookmarks-data.php:235
|
| 621 |
+
#: includes/bookmarks-data.php:240
|
| 622 |
+
#: includes/bookmarks-data.php:245
|
| 623 |
+
#: includes/bookmarks-data.php:250
|
| 624 |
+
#: includes/bookmarks-data.php:255
|
| 625 |
+
#: includes/bookmarks-data.php:260
|
| 626 |
+
#: includes/bookmarks-data.php:265
|
| 627 |
+
#: includes/bookmarks-data.php:270
|
| 628 |
+
#: includes/bookmarks-data.php:275
|
| 629 |
+
#: includes/bookmarks-data.php:280
|
| 630 |
+
#: includes/bookmarks-data.php:285
|
| 631 |
+
#: includes/bookmarks-data.php:290
|
| 632 |
+
#: includes/bookmarks-data.php:295
|
| 633 |
+
#: includes/bookmarks-data.php:300
|
| 634 |
+
#: includes/bookmarks-data.php:305
|
| 635 |
+
#: includes/bookmarks-data.php:310
|
| 636 |
+
#: includes/bookmarks-data.php:315
|
| 637 |
+
#: includes/bookmarks-data.php:320
|
| 638 |
+
#: includes/bookmarks-data.php:325
|
| 639 |
+
#: includes/bookmarks-data.php:330
|
| 640 |
+
#: includes/bookmarks-data.php:335
|
| 641 |
+
#: includes/bookmarks-data.php:340
|
| 642 |
+
#: includes/bookmarks-data.php:345
|
| 643 |
+
#: includes/bookmarks-data.php:350
|
| 644 |
+
#: includes/bookmarks-data.php:355
|
| 645 |
+
#: includes/bookmarks-data.php:360
|
| 646 |
+
#: includes/bookmarks-data.php:365
|
| 647 |
+
#: includes/bookmarks-data.php:370
|
| 648 |
+
#: includes/bookmarks-data.php:375
|
| 649 |
+
#: includes/bookmarks-data.php:380
|
| 650 |
+
#: includes/bookmarks-data.php:385
|
| 651 |
+
msgid " in your bookmarking menu"
|
| 652 |
+
msgstr " i din bogmærke menu"
|
| 653 |
+
|
| 654 |
+
#: includes/bookmarks-data.php:6
|
| 655 |
+
#: includes/bookmarks-data.php:61
|
| 656 |
+
#: includes/bookmarks-data.php:141
|
| 657 |
+
#: includes/bookmarks-data.php:181
|
| 658 |
+
#: includes/bookmarks-data.php:241
|
| 659 |
+
#: includes/bookmarks-data.php:246
|
| 660 |
+
#: includes/bookmarks-data.php:251
|
| 661 |
+
#: includes/bookmarks-data.php:256
|
| 662 |
+
#: includes/bookmarks-data.php:306
|
| 663 |
+
#: includes/bookmarks-data.php:321
|
| 664 |
+
#: includes/bookmarks-data.php:331
|
| 665 |
+
#: includes/bookmarks-data.php:336
|
| 666 |
+
#: includes/bookmarks-data.php:356
|
| 667 |
+
msgid "Submit this to "
|
| 668 |
+
msgstr "Send dette til "
|
| 669 |
+
|
| 670 |
+
#: includes/bookmarks-data.php:10
|
| 671 |
+
#: includes/bookmarks-data.php:11
|
| 672 |
+
msgid "Blinklist"
|
| 673 |
+
msgstr "Blinklist"
|
| 674 |
+
|
| 675 |
+
#: includes/bookmarks-data.php:11
|
| 676 |
+
#: includes/bookmarks-data.php:16
|
| 677 |
+
#: includes/bookmarks-data.php:31
|
| 678 |
+
#: includes/bookmarks-data.php:46
|
| 679 |
+
#: includes/bookmarks-data.php:51
|
| 680 |
+
#: includes/bookmarks-data.php:66
|
| 681 |
+
#: includes/bookmarks-data.php:91
|
| 682 |
+
#: includes/bookmarks-data.php:101
|
| 683 |
+
#: includes/bookmarks-data.php:121
|
| 684 |
+
#: includes/bookmarks-data.php:126
|
| 685 |
+
#: includes/bookmarks-data.php:131
|
| 686 |
+
#: includes/bookmarks-data.php:146
|
| 687 |
+
#: includes/bookmarks-data.php:156
|
| 688 |
+
#: includes/bookmarks-data.php:211
|
| 689 |
+
#: includes/bookmarks-data.php:261
|
| 690 |
+
#: includes/bookmarks-data.php:266
|
| 691 |
+
#: includes/bookmarks-data.php:286
|
| 692 |
+
#: includes/bookmarks-data.php:346
|
| 693 |
+
#: includes/bookmarks-data.php:366
|
| 694 |
+
#: includes/bookmarks-data.php:386
|
| 695 |
+
msgid "Share this on "
|
| 696 |
+
msgstr "Del dette på "
|
| 697 |
+
|
| 698 |
+
#: includes/bookmarks-data.php:15
|
| 699 |
+
msgid "Delicious"
|
| 700 |
+
msgstr "Delicious"
|
| 701 |
+
|
| 702 |
+
#: includes/bookmarks-data.php:16
|
| 703 |
+
msgid "del.icio.us"
|
| 704 |
+
msgstr "del.icio.us"
|
| 705 |
+
|
| 706 |
+
#: includes/bookmarks-data.php:20
|
| 707 |
+
msgid "Digg"
|
| 708 |
+
msgstr "Digg"
|
| 709 |
+
|
| 710 |
+
#: includes/bookmarks-data.php:21
|
| 711 |
+
msgid "Digg this!"
|
| 712 |
+
msgstr "Digg dette!"
|
| 713 |
+
|
| 714 |
+
#: includes/bookmarks-data.php:25
|
| 715 |
+
#: includes/bookmarks-data.php:26
|
| 716 |
+
msgid "Diigo"
|
| 717 |
+
msgstr "Diigo"
|
| 718 |
+
|
| 719 |
+
#: includes/bookmarks-data.php:26
|
| 720 |
+
msgid "Post this on "
|
| 721 |
+
msgstr "Tilføj dette på "
|
| 722 |
+
|
| 723 |
+
#: includes/bookmarks-data.php:30
|
| 724 |
+
#: includes/bookmarks-data.php:31
|
| 725 |
+
msgid "Reddit"
|
| 726 |
+
msgstr "Reddit"
|
| 727 |
+
|
| 728 |
+
#: includes/bookmarks-data.php:35
|
| 729 |
+
msgid "Yahoo! Buzz"
|
| 730 |
+
msgstr "Yahoo! Buzz"
|
| 731 |
+
|
| 732 |
+
#: includes/bookmarks-data.php:36
|
| 733 |
+
msgid "Buzz up!"
|
| 734 |
+
msgstr "Buzz up!"
|
| 735 |
+
|
| 736 |
+
#: includes/bookmarks-data.php:40
|
| 737 |
+
msgid "Stumbleupon"
|
| 738 |
+
msgstr "Stumbleupon"
|
| 739 |
+
|
| 740 |
+
#: includes/bookmarks-data.php:41
|
| 741 |
+
msgid "Stumble upon something good? Share it on StumbleUpon"
|
| 742 |
+
msgstr "Faldet over noget godt? Del det på StumbleUpon"
|
| 743 |
+
|
| 744 |
+
#: includes/bookmarks-data.php:45
|
| 745 |
+
#: includes/bookmarks-data.php:46
|
| 746 |
+
msgid "Technorati"
|
| 747 |
+
msgstr "Technorati"
|
| 748 |
+
|
| 749 |
+
#: includes/bookmarks-data.php:50
|
| 750 |
+
#: includes/bookmarks-data.php:51
|
| 751 |
+
msgid "Mixx"
|
| 752 |
+
msgstr "Mixx"
|
| 753 |
+
|
| 754 |
+
#: includes/bookmarks-data.php:55
|
| 755 |
+
#: includes/bookmarks-data.php:56
|
| 756 |
+
msgid "MySpace"
|
| 757 |
+
msgstr "MySpace"
|
| 758 |
+
|
| 759 |
+
#: includes/bookmarks-data.php:56
|
| 760 |
+
#: includes/bookmarks-data.php:201
|
| 761 |
+
#: includes/bookmarks-data.php:226
|
| 762 |
+
#: includes/bookmarks-data.php:376
|
| 763 |
+
msgid "Post this to "
|
| 764 |
+
msgstr "Tilføj dette til "
|
| 765 |
+
|
| 766 |
+
#: includes/bookmarks-data.php:60
|
| 767 |
+
#: includes/bookmarks-data.php:61
|
| 768 |
+
msgid "DesignFloat"
|
| 769 |
+
msgstr "DesignFloat"
|
| 770 |
+
|
| 771 |
+
#: includes/bookmarks-data.php:65
|
| 772 |
+
#: includes/bookmarks-data.php:66
|
| 773 |
+
msgid "Facebook"
|
| 774 |
+
msgstr "Facebook"
|
| 775 |
+
|
| 776 |
+
#: includes/bookmarks-data.php:70
|
| 777 |
+
msgid "Twitter"
|
| 778 |
+
msgstr "Twitter"
|
| 779 |
+
|
| 780 |
+
#: includes/bookmarks-data.php:71
|
| 781 |
+
msgid "Tweet This!"
|
| 782 |
+
msgstr "Tweet dette!"
|
| 783 |
+
|
| 784 |
+
#: includes/bookmarks-data.php:75
|
| 785 |
+
#: includes/bookmarks-data.php:80
|
| 786 |
+
msgid "Check this box to include the "
|
| 787 |
+
msgstr "Vælg denne indstillinge for at inkludere "
|
| 788 |
+
|
| 789 |
+
#: includes/bookmarks-data.php:75
|
| 790 |
+
msgid "\"Email to a Friend\" link"
|
| 791 |
+
msgstr "\"Email til en ven\" linket"
|
| 792 |
+
|
| 793 |
+
#: includes/bookmarks-data.php:76
|
| 794 |
+
msgid "Email this to a friend?"
|
| 795 |
+
msgstr "Email til en ven?"
|
| 796 |
+
|
| 797 |
+
#: includes/bookmarks-data.php:80
|
| 798 |
+
#: includes/bookmarks-data.php:81
|
| 799 |
+
msgid "ToMuse"
|
| 800 |
+
msgstr "ToMuse"
|
| 801 |
+
|
| 802 |
+
#: includes/bookmarks-data.php:81
|
| 803 |
+
msgid "Suggest this article to "
|
| 804 |
+
msgstr "Foreslå denne artikel til "
|
| 805 |
+
|
| 806 |
+
#: includes/bookmarks-data.php:85
|
| 807 |
+
msgid "a 'Subscribe to Comments' link"
|
| 808 |
+
msgstr "et 'abbonnér på kommentarere' link"
|
| 809 |
+
|
| 810 |
+
#: includes/bookmarks-data.php:86
|
| 811 |
+
msgid "Subscribe to the comments for this post?"
|
| 812 |
+
msgstr "Abonnér på kommenentarere til dette indlæg?"
|
| 813 |
+
|
| 814 |
+
#: includes/bookmarks-data.php:90
|
| 815 |
+
#: includes/bookmarks-data.php:91
|
| 816 |
+
msgid "Linkedin"
|
| 817 |
+
msgstr "Linkedin"
|
| 818 |
+
|
| 819 |
+
#: includes/bookmarks-data.php:95
|
| 820 |
+
#: includes/bookmarks-data.php:96
|
| 821 |
+
msgid "Newsvine"
|
| 822 |
+
msgstr "Newsvine"
|
| 823 |
+
|
| 824 |
+
#: includes/bookmarks-data.php:96
|
| 825 |
+
msgid "Seed this on "
|
| 826 |
+
msgstr "Del dette på "
|
| 827 |
+
|
| 828 |
+
#: includes/bookmarks-data.php:100
|
| 829 |
+
#: includes/bookmarks-data.php:101
|
| 830 |
+
msgid "Devmarks"
|
| 831 |
+
msgstr "Devmarks"
|
| 832 |
+
|
| 833 |
+
#: includes/bookmarks-data.php:105
|
| 834 |
+
#: includes/bookmarks-data.php:106
|
| 835 |
+
msgid "Google Bookmarks"
|
| 836 |
+
msgstr "Google Bookmarks"
|
| 837 |
+
|
| 838 |
+
#: includes/bookmarks-data.php:106
|
| 839 |
+
#: includes/bookmarks-data.php:111
|
| 840 |
+
#: includes/bookmarks-data.php:116
|
| 841 |
+
#: includes/bookmarks-data.php:161
|
| 842 |
+
#: includes/bookmarks-data.php:166
|
| 843 |
+
#: includes/bookmarks-data.php:171
|
| 844 |
+
#: includes/bookmarks-data.php:176
|
| 845 |
+
#: includes/bookmarks-data.php:196
|
| 846 |
+
#: includes/bookmarks-data.php:371
|
| 847 |
+
msgid "Add this to "
|
| 848 |
+
msgstr "Tilføj dette til "
|
| 849 |
+
|
| 850 |
+
#: includes/bookmarks-data.php:110
|
| 851 |
+
#: includes/bookmarks-data.php:111
|
| 852 |
+
msgid "Mister Wong"
|
| 853 |
+
msgstr "Mister Wong"
|
| 854 |
+
|
| 855 |
+
#: includes/bookmarks-data.php:115
|
| 856 |
+
#: includes/bookmarks-data.php:116
|
| 857 |
+
msgid "Izeby"
|
| 858 |
+
msgstr "Izeby"
|
| 859 |
+
|
| 860 |
+
#: includes/bookmarks-data.php:120
|
| 861 |
+
#: includes/bookmarks-data.php:121
|
| 862 |
+
msgid "Tipd"
|
| 863 |
+
msgstr "Tipd"
|
| 864 |
+
|
| 865 |
+
#: includes/bookmarks-data.php:125
|
| 866 |
+
#: includes/bookmarks-data.php:126
|
| 867 |
+
msgid "PFBuzz"
|
| 868 |
+
msgstr "PFBuzz"
|
| 869 |
+
|
| 870 |
+
#: includes/bookmarks-data.php:130
|
| 871 |
+
#: includes/bookmarks-data.php:131
|
| 872 |
+
msgid "FriendFeed"
|
| 873 |
+
msgstr "FriendFeed"
|
| 874 |
+
|
| 875 |
+
#: includes/bookmarks-data.php:135
|
| 876 |
+
#: includes/bookmarks-data.php:136
|
| 877 |
+
msgid "BlogMarks"
|
| 878 |
+
msgstr "BlogMarks"
|
| 879 |
+
|
| 880 |
+
#: includes/bookmarks-data.php:136
|
| 881 |
+
msgid "Mark this on "
|
| 882 |
+
msgstr "Markér dette på "
|
| 883 |
+
|
| 884 |
+
#: includes/bookmarks-data.php:140
|
| 885 |
+
#: includes/bookmarks-data.php:141
|
| 886 |
+
msgid "Twittley"
|
| 887 |
+
msgstr "Twittley"
|
| 888 |
+
|
| 889 |
+
#: includes/bookmarks-data.php:145
|
| 890 |
+
#: includes/bookmarks-data.php:146
|
| 891 |
+
msgid "Fwisp"
|
| 892 |
+
msgstr "Fwisp"
|
| 893 |
+
|
| 894 |
+
#: includes/bookmarks-data.php:150
|
| 895 |
+
#: includes/bookmarks-data.php:151
|
| 896 |
+
msgid "DesignMoo"
|
| 897 |
+
msgstr "DesignMoo"
|
| 898 |
+
|
| 899 |
+
#: includes/bookmarks-data.php:151
|
| 900 |
+
msgid "Moo this on "
|
| 901 |
+
msgstr "Moo dette på "
|
| 902 |
+
|
| 903 |
+
#: includes/bookmarks-data.php:155
|
| 904 |
+
#: includes/bookmarks-data.php:156
|
| 905 |
+
msgid "BobrDobr"
|
| 906 |
+
msgstr "BobrDobr"
|
| 907 |
+
|
| 908 |
+
#: includes/bookmarks-data.php:155
|
| 909 |
+
#: includes/bookmarks-data.php:160
|
| 910 |
+
#: includes/bookmarks-data.php:165
|
| 911 |
+
#: includes/bookmarks-data.php:170
|
| 912 |
+
#: includes/bookmarks-data.php:175
|
| 913 |
+
msgid " (Russian)"
|
| 914 |
+
msgstr " (Russisk)"
|
| 915 |
+
|
| 916 |
+
#: includes/bookmarks-data.php:160
|
| 917 |
+
#: includes/bookmarks-data.php:161
|
| 918 |
+
msgid "Yandex.Bookmarks"
|
| 919 |
+
msgstr "Yandex.Bookmarks"
|
| 920 |
+
|
| 921 |
+
#: includes/bookmarks-data.php:165
|
| 922 |
+
#: includes/bookmarks-data.php:166
|
| 923 |
+
msgid "Memory.ru"
|
| 924 |
+
msgstr "Memory.ru"
|
| 925 |
+
|
| 926 |
+
#: includes/bookmarks-data.php:170
|
| 927 |
+
#: includes/bookmarks-data.php:171
|
| 928 |
+
msgid "100 bookmarks"
|
| 929 |
+
msgstr "100 bookmarks"
|
| 930 |
+
|
| 931 |
+
#: includes/bookmarks-data.php:175
|
| 932 |
+
#: includes/bookmarks-data.php:176
|
| 933 |
+
msgid "MyPlace"
|
| 934 |
+
msgstr "MyPlace"
|
| 935 |
+
|
| 936 |
+
#: includes/bookmarks-data.php:180
|
| 937 |
+
#: includes/bookmarks-data.php:181
|
| 938 |
+
msgid "Hacker News"
|
| 939 |
+
msgstr "Hacker News"
|
| 940 |
+
|
| 941 |
+
#: includes/bookmarks-data.php:185
|
| 942 |
+
#: includes/bookmarks-data.php:186
|
| 943 |
+
msgid "Print Friendly"
|
| 944 |
+
msgstr "Print venlig udgave"
|
| 945 |
+
|
| 946 |
+
#: includes/bookmarks-data.php:186
|
| 947 |
+
msgid "Send this page to "
|
| 948 |
+
msgstr "Send dette til "
|
| 949 |
+
|
| 950 |
+
#: includes/bookmarks-data.php:190
|
| 951 |
+
msgid "Design Bump"
|
| 952 |
+
msgstr "Design Bump"
|
| 953 |
+
|
| 954 |
+
#: includes/bookmarks-data.php:191
|
| 955 |
+
msgid "Bump this on "
|
| 956 |
+
msgstr "Bump dette på "
|
| 957 |
+
|
| 958 |
+
#: includes/bookmarks-data.php:191
|
| 959 |
+
msgid "DesignBump"
|
| 960 |
+
msgstr "DesignBump"
|
| 961 |
+
|
| 962 |
+
#: includes/bookmarks-data.php:195
|
| 963 |
+
#: includes/bookmarks-data.php:196
|
| 964 |
+
msgid "Ning"
|
| 965 |
+
msgstr "Ning"
|
| 966 |
+
|
| 967 |
+
#: includes/bookmarks-data.php:200
|
| 968 |
+
#: includes/bookmarks-data.php:201
|
| 969 |
+
msgid "Identica"
|
| 970 |
+
msgstr "Identica"
|
| 971 |
+
|
| 972 |
+
#: includes/bookmarks-data.php:205
|
| 973 |
+
#: includes/bookmarks-data.php:206
|
| 974 |
+
msgid "Xerpi"
|
| 975 |
+
msgstr "Xerpi"
|
| 976 |
+
|
| 977 |
+
#: includes/bookmarks-data.php:206
|
| 978 |
+
msgid "Save this to "
|
| 979 |
+
msgstr "Gem dette på "
|
| 980 |
+
|
| 981 |
+
#: includes/bookmarks-data.php:210
|
| 982 |
+
#: includes/bookmarks-data.php:211
|
| 983 |
+
msgid "Wikio"
|
| 984 |
+
msgstr "Wikio"
|
| 985 |
+
|
| 986 |
+
#: includes/bookmarks-data.php:215
|
| 987 |
+
#: includes/bookmarks-data.php:216
|
| 988 |
+
msgid "TechMeme"
|
| 989 |
+
msgstr "TechMeme"
|
| 990 |
+
|
| 991 |
+
#: includes/bookmarks-data.php:216
|
| 992 |
+
msgid "Tip this to "
|
| 993 |
+
msgstr "Tip dette til "
|
| 994 |
+
|
| 995 |
+
#: includes/bookmarks-data.php:220
|
| 996 |
+
#: includes/bookmarks-data.php:221
|
| 997 |
+
msgid "Sphinn"
|
| 998 |
+
msgstr "Sphinn"
|
| 999 |
+
|
| 1000 |
+
#: includes/bookmarks-data.php:221
|
| 1001 |
+
msgid "Sphinn this on "
|
| 1002 |
+
msgstr "Sphinn dette til"
|
| 1003 |
+
|
| 1004 |
+
#: includes/bookmarks-data.php:225
|
| 1005 |
+
#: includes/bookmarks-data.php:226
|
| 1006 |
+
msgid "Posterous"
|
| 1007 |
+
msgstr "Posterous"
|
| 1008 |
+
|
| 1009 |
+
#: includes/bookmarks-data.php:230
|
| 1010 |
+
#: includes/bookmarks-data.php:231
|
| 1011 |
+
msgid "Global Grind"
|
| 1012 |
+
msgstr "Global Grind"
|
| 1013 |
+
|
| 1014 |
+
#: includes/bookmarks-data.php:231
|
| 1015 |
+
msgid "Grind this! on "
|
| 1016 |
+
msgstr "Grind dette på "
|
| 1017 |
+
|
| 1018 |
+
#: includes/bookmarks-data.php:235
|
| 1019 |
+
#: includes/bookmarks-data.php:236
|
| 1020 |
+
msgid "Ping.fm"
|
| 1021 |
+
msgstr "Ping.fm"
|
| 1022 |
+
|
| 1023 |
+
#: includes/bookmarks-data.php:236
|
| 1024 |
+
msgid "Ping this on "
|
| 1025 |
+
msgstr "Ping dette på "
|
| 1026 |
+
|
| 1027 |
+
#: includes/bookmarks-data.php:240
|
| 1028 |
+
#: includes/bookmarks-data.php:241
|
| 1029 |
+
msgid "NUjij"
|
| 1030 |
+
msgstr "NUjij"
|
| 1031 |
+
|
| 1032 |
+
#: includes/bookmarks-data.php:240
|
| 1033 |
+
#: includes/bookmarks-data.php:245
|
| 1034 |
+
msgid " (Dutch)"
|
| 1035 |
+
msgstr " (Hollandsk)"
|
| 1036 |
+
|
| 1037 |
+
#: includes/bookmarks-data.php:245
|
| 1038 |
+
#: includes/bookmarks-data.php:246
|
| 1039 |
+
msgid "eKudos"
|
| 1040 |
+
msgstr "eKudos"
|
| 1041 |
+
|
| 1042 |
+
#: includes/bookmarks-data.php:250
|
| 1043 |
+
#: includes/bookmarks-data.php:251
|
| 1044 |
+
msgid "Netvouz"
|
| 1045 |
+
msgstr "Netvouz"
|
| 1046 |
+
|
| 1047 |
+
#: includes/bookmarks-data.php:255
|
| 1048 |
+
#: includes/bookmarks-data.php:256
|
| 1049 |
+
msgid "Netvibes"
|
| 1050 |
+
msgstr "Netvibes"
|
| 1051 |
+
|
| 1052 |
+
#: includes/bookmarks-data.php:260
|
| 1053 |
+
#: includes/bookmarks-data.php:261
|
| 1054 |
+
msgid "Fleck"
|
| 1055 |
+
msgstr "Fleck"
|
| 1056 |
+
|
| 1057 |
+
#: includes/bookmarks-data.php:265
|
| 1058 |
+
#: includes/bookmarks-data.php:266
|
| 1059 |
+
msgid "Blogosphere News"
|
| 1060 |
+
msgstr "Blogosphere News"
|
| 1061 |
+
|
| 1062 |
+
#: includes/bookmarks-data.php:270
|
| 1063 |
+
msgid "Web Blend"
|
| 1064 |
+
msgstr "Web Blend"
|
| 1065 |
+
|
| 1066 |
+
#: includes/bookmarks-data.php:271
|
| 1067 |
+
msgid "Blend this!"
|
| 1068 |
+
msgstr "Blend dette! "
|
| 1069 |
+
|
| 1070 |
+
#: includes/bookmarks-data.php:275
|
| 1071 |
+
msgid "Wykop"
|
| 1072 |
+
msgstr "Wykop"
|
| 1073 |
+
|
| 1074 |
+
#: includes/bookmarks-data.php:275
|
| 1075 |
+
msgid " (Polish)"
|
| 1076 |
+
msgstr " (Polsk)"
|
| 1077 |
+
|
| 1078 |
+
#: includes/bookmarks-data.php:276
|
| 1079 |
+
msgid "Add this to Wykop!"
|
| 1080 |
+
msgstr "Tilføj til Wykop!"
|
| 1081 |
+
|
| 1082 |
+
#: includes/bookmarks-data.php:280
|
| 1083 |
+
msgid "BlogEngage"
|
| 1084 |
+
msgstr "BlogEngage"
|
| 1085 |
+
|
| 1086 |
+
#: includes/bookmarks-data.php:281
|
| 1087 |
+
msgid "Engage with this article!"
|
| 1088 |
+
msgstr "Engage med denne artikel!"
|
| 1089 |
+
|
| 1090 |
+
#: includes/bookmarks-data.php:285
|
| 1091 |
+
#: includes/bookmarks-data.php:286
|
| 1092 |
+
msgid "Hyves"
|
| 1093 |
+
msgstr "Hyves"
|
| 1094 |
+
|
| 1095 |
+
#: includes/bookmarks-data.php:290
|
| 1096 |
+
#: includes/bookmarks-data.php:291
|
| 1097 |
+
msgid "Pusha"
|
| 1098 |
+
msgstr "Pusha"
|
| 1099 |
+
|
| 1100 |
+
#: includes/bookmarks-data.php:290
|
| 1101 |
+
msgid " (Swedish)"
|
| 1102 |
+
msgstr " (Svensk)"
|
| 1103 |
+
|
| 1104 |
+
#: includes/bookmarks-data.php:291
|
| 1105 |
+
msgid "Push this on "
|
| 1106 |
+
msgstr "Push dette på "
|
| 1107 |
+
|
| 1108 |
+
#: includes/bookmarks-data.php:295
|
| 1109 |
+
#: includes/bookmarks-data.php:296
|
| 1110 |
+
msgid "Hatena Bookmarks"
|
| 1111 |
+
msgstr "Hatena Bookmarks"
|
| 1112 |
+
|
| 1113 |
+
#: includes/bookmarks-data.php:295
|
| 1114 |
+
msgid " (Japanese)"
|
| 1115 |
+
msgstr " (Japansk)"
|
| 1116 |
+
|
| 1117 |
+
#: includes/bookmarks-data.php:296
|
| 1118 |
+
msgid "Bookmarks this on "
|
| 1119 |
+
msgstr "Bogmærk dette på "
|
| 1120 |
+
|
| 1121 |
+
#: includes/bookmarks-data.php:300
|
| 1122 |
+
#: includes/bookmarks-data.php:301
|
| 1123 |
+
msgid "MyLinkVault"
|
| 1124 |
+
msgstr "MyLinkVault"
|
| 1125 |
+
|
| 1126 |
+
#: includes/bookmarks-data.php:301
|
| 1127 |
+
msgid "Store this link on "
|
| 1128 |
+
msgstr "Gen dette link på "
|
| 1129 |
+
|
| 1130 |
+
#: includes/bookmarks-data.php:305
|
| 1131 |
+
#: includes/bookmarks-data.php:306
|
| 1132 |
+
msgid "SlashDot"
|
| 1133 |
+
msgstr "SlashDot"
|
| 1134 |
+
|
| 1135 |
+
#: includes/bookmarks-data.php:310
|
| 1136 |
+
#: includes/bookmarks-data.php:311
|
| 1137 |
+
msgid "Squidoo"
|
| 1138 |
+
msgstr "Squidoo"
|
| 1139 |
+
|
| 1140 |
+
#: includes/bookmarks-data.php:311
|
| 1141 |
+
msgid "Add to a lense on "
|
| 1142 |
+
msgstr "Tilføj til en lense på "
|
| 1143 |
+
|
| 1144 |
+
#: includes/bookmarks-data.php:315
|
| 1145 |
+
#: includes/bookmarks-data.php:316
|
| 1146 |
+
msgid "Propeller"
|
| 1147 |
+
msgstr "Propeller"
|
| 1148 |
+
|
| 1149 |
+
#: includes/bookmarks-data.php:316
|
| 1150 |
+
msgid "Submit this story to "
|
| 1151 |
+
msgstr "Tilføj denne historie til "
|
| 1152 |
+
|
| 1153 |
+
#: includes/bookmarks-data.php:320
|
| 1154 |
+
#: includes/bookmarks-data.php:321
|
| 1155 |
+
msgid "FAQpal"
|
| 1156 |
+
msgstr "FAQpal"
|
| 1157 |
+
|
| 1158 |
+
#: includes/bookmarks-data.php:325
|
| 1159 |
+
#: includes/bookmarks-data.php:326
|
| 1160 |
+
msgid "Evernote"
|
| 1161 |
+
msgstr "Evernote"
|
| 1162 |
+
|
| 1163 |
+
#: includes/bookmarks-data.php:326
|
| 1164 |
+
msgid "Clip this to "
|
| 1165 |
+
msgstr "Klip dette til "
|
| 1166 |
+
|
| 1167 |
+
#: includes/bookmarks-data.php:330
|
| 1168 |
+
#: includes/bookmarks-data.php:331
|
| 1169 |
+
msgid "Meneame"
|
| 1170 |
+
msgstr "Meneame"
|
| 1171 |
+
|
| 1172 |
+
#: includes/bookmarks-data.php:330
|
| 1173 |
+
#: includes/bookmarks-data.php:335
|
| 1174 |
+
msgid " (Spanish)"
|
| 1175 |
+
msgstr " (Spansk)"
|
| 1176 |
+
|
| 1177 |
+
#: includes/bookmarks-data.php:335
|
| 1178 |
+
#: includes/bookmarks-data.php:336
|
| 1179 |
+
msgid "Bitacoras"
|
| 1180 |
+
msgstr "Bitacoras"
|
| 1181 |
+
|
| 1182 |
+
#: includes/bookmarks-data.php:340
|
| 1183 |
+
#: includes/bookmarks-data.php:341
|
| 1184 |
+
msgid "JumpTags"
|
| 1185 |
+
msgstr "JumpTags"
|
| 1186 |
+
|
| 1187 |
+
#: includes/bookmarks-data.php:341
|
| 1188 |
+
msgid "Submit this link to "
|
| 1189 |
+
msgstr "Send dette link til "
|
| 1190 |
+
|
| 1191 |
+
#: includes/bookmarks-data.php:345
|
| 1192 |
+
#: includes/bookmarks-data.php:346
|
| 1193 |
+
msgid "Bebo"
|
| 1194 |
+
msgstr "Bebo"
|
| 1195 |
+
|
| 1196 |
+
#: includes/bookmarks-data.php:350
|
| 1197 |
+
#: includes/bookmarks-data.php:351
|
| 1198 |
+
msgid "N4G"
|
| 1199 |
+
msgstr "N4G"
|
| 1200 |
+
|
| 1201 |
+
#: includes/bookmarks-data.php:351
|
| 1202 |
+
msgid "Submit tip to "
|
| 1203 |
+
msgstr "Send tip til "
|
| 1204 |
+
|
| 1205 |
+
#: includes/bookmarks-data.php:355
|
| 1206 |
+
#: includes/bookmarks-data.php:356
|
| 1207 |
+
msgid "Strands"
|
| 1208 |
+
msgstr "Strands"
|
| 1209 |
+
|
| 1210 |
+
#: includes/bookmarks-data.php:360
|
| 1211 |
+
#: includes/bookmarks-data.php:361
|
| 1212 |
+
msgid "Orkut"
|
| 1213 |
+
msgstr "Orkut"
|
| 1214 |
+
|
| 1215 |
+
#: includes/bookmarks-data.php:361
|
| 1216 |
+
msgid "Promote this on "
|
| 1217 |
+
msgstr "Fortæl om dette link på "
|
| 1218 |
+
|
| 1219 |
+
#: includes/bookmarks-data.php:365
|
| 1220 |
+
#: includes/bookmarks-data.php:366
|
| 1221 |
+
msgid "Tumblr"
|
| 1222 |
+
msgstr "Tumblr"
|
| 1223 |
+
|
| 1224 |
+
#: includes/bookmarks-data.php:370
|
| 1225 |
+
#: includes/bookmarks-data.php:371
|
| 1226 |
+
msgid "Stumpedia"
|
| 1227 |
+
msgstr "Stumpedia"
|
| 1228 |
+
|
| 1229 |
+
#: includes/bookmarks-data.php:375
|
| 1230 |
+
#: includes/bookmarks-data.php:376
|
| 1231 |
+
msgid "Current"
|
| 1232 |
+
msgstr "Current"
|
| 1233 |
+
|
| 1234 |
+
#: includes/bookmarks-data.php:380
|
| 1235 |
+
#: includes/bookmarks-data.php:381
|
| 1236 |
+
msgid "Blogger"
|
| 1237 |
+
msgstr "Blogger"
|
| 1238 |
+
|
| 1239 |
+
#: includes/bookmarks-data.php:381
|
| 1240 |
+
msgid "Blog this on "
|
| 1241 |
+
msgstr "Blog dette på "
|
| 1242 |
+
|
| 1243 |
+
#: includes/bookmarks-data.php:385
|
| 1244 |
+
#: includes/bookmarks-data.php:386
|
| 1245 |
+
msgid "Plurk"
|
| 1246 |
+
msgstr "Plurk"
|
| 1247 |
+
|
| 1248 |
+
#: includes/public.php:169
|
| 1249 |
+
msgid "an error occurred in SexyBookmarks"
|
| 1250 |
+
msgstr "en fejl er opstået i SexyBookmarks"
|
| 1251 |
+
|
| 1252 |
+
#: includes/public.php:504
|
| 1253 |
+
msgid "SexyBookmarks has been disabled on this page"
|
| 1254 |
+
msgstr "SexyBookmarks er blevet deaktiveret på denne side"
|
| 1255 |
+
|
| 1256 |
+
#: includes/public.php:509
|
| 1257 |
+
msgid "Start Of Code Generated By SexyBookmarks"
|
| 1258 |
+
msgstr "Start på kode genereret af SexyBookmarks"
|
| 1259 |
+
|
| 1260 |
+
#: includes/public.php:558
|
| 1261 |
+
msgid "End Of Code Generated By SexyBookmarks"
|
| 1262 |
+
msgstr "Slut på kode genereret af SexyBookmarks"
|
| 1263 |
+
|
languages/shrsb-de_DE.mo
ADDED
|
Binary file
|
languages/shrsb-de_DE.po
ADDED
|
@@ -0,0 +1,1353 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
msgid ""
|
| 2 |
+
msgstr ""
|
| 3 |
+
"Project-Id-Version: SexyBookmarks v2.5.5\n"
|
| 4 |
+
"Report-Msgid-Bugs-To: \n"
|
| 5 |
+
"POT-Creation-Date: 2009-10-04 23:14-0600\n"
|
| 6 |
+
"PO-Revision-Date: \n"
|
| 7 |
+
"Last-Translator: \n"
|
| 8 |
+
"Language-Team: Josh Jones, Norman Yung <info@sexybookmarks.net>\n"
|
| 9 |
+
"MIME-Version: 1.0\n"
|
| 10 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
+
"X-Poedit-Language: English\n"
|
| 13 |
+
"X-Poedit-Country: UNITED STATES\n"
|
| 14 |
+
"X-Poedit-KeywordsList: __;_e\n"
|
| 15 |
+
"X-Poedit-Basepath: .\n"
|
| 16 |
+
"X-Poedit-SearchPath-0: F:\\Web Development\\Projects\\SexyBookmarks\\SVN Local\\trunk\n"
|
| 17 |
+
|
| 18 |
+
#: F:\Web
|
| 19 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 20 |
+
#: Local\trunk/bookmarks-data.php:5
|
| 21 |
+
#: Local\trunk/bookmarks-data.php:10
|
| 22 |
+
#: Local\trunk/bookmarks-data.php:15
|
| 23 |
+
#: Local\trunk/bookmarks-data.php:20
|
| 24 |
+
#: Local\trunk/bookmarks-data.php:25
|
| 25 |
+
#: Local\trunk/bookmarks-data.php:30
|
| 26 |
+
#: Local\trunk/bookmarks-data.php:35
|
| 27 |
+
#: Local\trunk/bookmarks-data.php:40
|
| 28 |
+
#: Local\trunk/bookmarks-data.php:45
|
| 29 |
+
#: Local\trunk/bookmarks-data.php:50
|
| 30 |
+
#: Local\trunk/bookmarks-data.php:55
|
| 31 |
+
#: Local\trunk/bookmarks-data.php:60
|
| 32 |
+
#: Local\trunk/bookmarks-data.php:65
|
| 33 |
+
#: Local\trunk/bookmarks-data.php:70
|
| 34 |
+
#: Local\trunk/bookmarks-data.php:85
|
| 35 |
+
#: Local\trunk/bookmarks-data.php:90
|
| 36 |
+
#: Local\trunk/bookmarks-data.php:95
|
| 37 |
+
#: Local\trunk/bookmarks-data.php:100
|
| 38 |
+
#: Local\trunk/bookmarks-data.php:105
|
| 39 |
+
#: Local\trunk/bookmarks-data.php:110
|
| 40 |
+
#: Local\trunk/bookmarks-data.php:115
|
| 41 |
+
#: Local\trunk/bookmarks-data.php:120
|
| 42 |
+
#: Local\trunk/bookmarks-data.php:125
|
| 43 |
+
#: Local\trunk/bookmarks-data.php:130
|
| 44 |
+
#: Local\trunk/bookmarks-data.php:135
|
| 45 |
+
#: Local\trunk/bookmarks-data.php:140
|
| 46 |
+
#: Local\trunk/bookmarks-data.php:145
|
| 47 |
+
#: Local\trunk/bookmarks-data.php:150
|
| 48 |
+
#: Local\trunk/bookmarks-data.php:155
|
| 49 |
+
#: Local\trunk/bookmarks-data.php:160
|
| 50 |
+
#: Local\trunk/bookmarks-data.php:165
|
| 51 |
+
#: Local\trunk/bookmarks-data.php:170
|
| 52 |
+
#: Local\trunk/bookmarks-data.php:175
|
| 53 |
+
#: Local\trunk/bookmarks-data.php:180
|
| 54 |
+
#: Local\trunk/bookmarks-data.php:185
|
| 55 |
+
#: Local\trunk/bookmarks-data.php:190
|
| 56 |
+
#: Local\trunk/bookmarks-data.php:195
|
| 57 |
+
#: Local\trunk/bookmarks-data.php:200
|
| 58 |
+
#: Local\trunk/bookmarks-data.php:205
|
| 59 |
+
#: Local\trunk/bookmarks-data.php:210
|
| 60 |
+
#: Local\trunk/bookmarks-data.php:215
|
| 61 |
+
#: Local\trunk/bookmarks-data.php:220
|
| 62 |
+
#: Local\trunk/bookmarks-data.php:225
|
| 63 |
+
#: Local\trunk/bookmarks-data.php:230
|
| 64 |
+
#: Local\trunk/bookmarks-data.php:235
|
| 65 |
+
#: Local\trunk/bookmarks-data.php:240
|
| 66 |
+
#: Local\trunk/bookmarks-data.php:245
|
| 67 |
+
#: Local\trunk/bookmarks-data.php:250
|
| 68 |
+
#: Local\trunk/bookmarks-data.php:255
|
| 69 |
+
#: Local\trunk/bookmarks-data.php:260
|
| 70 |
+
#: Local\trunk/bookmarks-data.php:265
|
| 71 |
+
msgid "Check this box to include "
|
| 72 |
+
msgstr "Nimm "
|
| 73 |
+
|
| 74 |
+
#: F:\Web
|
| 75 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 76 |
+
#: Local\trunk/bookmarks-data.php:5
|
| 77 |
+
#: Local\trunk/bookmarks-data.php:6
|
| 78 |
+
msgid "Script & Style"
|
| 79 |
+
msgstr "Script & Style"
|
| 80 |
+
|
| 81 |
+
#: F:\Web
|
| 82 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 83 |
+
#: Local\trunk/bookmarks-data.php:5
|
| 84 |
+
#: Local\trunk/bookmarks-data.php:10
|
| 85 |
+
#: Local\trunk/bookmarks-data.php:15
|
| 86 |
+
#: Local\trunk/bookmarks-data.php:20
|
| 87 |
+
#: Local\trunk/bookmarks-data.php:25
|
| 88 |
+
#: Local\trunk/bookmarks-data.php:30
|
| 89 |
+
#: Local\trunk/bookmarks-data.php:35
|
| 90 |
+
#: Local\trunk/bookmarks-data.php:40
|
| 91 |
+
#: Local\trunk/bookmarks-data.php:45
|
| 92 |
+
#: Local\trunk/bookmarks-data.php:50
|
| 93 |
+
#: Local\trunk/bookmarks-data.php:55
|
| 94 |
+
#: Local\trunk/bookmarks-data.php:60
|
| 95 |
+
#: Local\trunk/bookmarks-data.php:65
|
| 96 |
+
#: Local\trunk/bookmarks-data.php:70
|
| 97 |
+
#: Local\trunk/bookmarks-data.php:75
|
| 98 |
+
#: Local\trunk/bookmarks-data.php:80
|
| 99 |
+
#: Local\trunk/bookmarks-data.php:85
|
| 100 |
+
#: Local\trunk/bookmarks-data.php:90
|
| 101 |
+
#: Local\trunk/bookmarks-data.php:95
|
| 102 |
+
#: Local\trunk/bookmarks-data.php:100
|
| 103 |
+
#: Local\trunk/bookmarks-data.php:105
|
| 104 |
+
#: Local\trunk/bookmarks-data.php:110
|
| 105 |
+
#: Local\trunk/bookmarks-data.php:115
|
| 106 |
+
#: Local\trunk/bookmarks-data.php:120
|
| 107 |
+
#: Local\trunk/bookmarks-data.php:125
|
| 108 |
+
#: Local\trunk/bookmarks-data.php:130
|
| 109 |
+
#: Local\trunk/bookmarks-data.php:135
|
| 110 |
+
#: Local\trunk/bookmarks-data.php:140
|
| 111 |
+
#: Local\trunk/bookmarks-data.php:145
|
| 112 |
+
#: Local\trunk/bookmarks-data.php:150
|
| 113 |
+
#: Local\trunk/bookmarks-data.php:155
|
| 114 |
+
#: Local\trunk/bookmarks-data.php:160
|
| 115 |
+
#: Local\trunk/bookmarks-data.php:165
|
| 116 |
+
#: Local\trunk/bookmarks-data.php:170
|
| 117 |
+
#: Local\trunk/bookmarks-data.php:175
|
| 118 |
+
#: Local\trunk/bookmarks-data.php:180
|
| 119 |
+
#: Local\trunk/bookmarks-data.php:185
|
| 120 |
+
#: Local\trunk/bookmarks-data.php:190
|
| 121 |
+
#: Local\trunk/bookmarks-data.php:195
|
| 122 |
+
#: Local\trunk/bookmarks-data.php:200
|
| 123 |
+
#: Local\trunk/bookmarks-data.php:205
|
| 124 |
+
#: Local\trunk/bookmarks-data.php:210
|
| 125 |
+
#: Local\trunk/bookmarks-data.php:215
|
| 126 |
+
#: Local\trunk/bookmarks-data.php:220
|
| 127 |
+
#: Local\trunk/bookmarks-data.php:225
|
| 128 |
+
#: Local\trunk/bookmarks-data.php:230
|
| 129 |
+
#: Local\trunk/bookmarks-data.php:235
|
| 130 |
+
#: Local\trunk/bookmarks-data.php:240
|
| 131 |
+
#: Local\trunk/bookmarks-data.php:245
|
| 132 |
+
#: Local\trunk/bookmarks-data.php:250
|
| 133 |
+
#: Local\trunk/bookmarks-data.php:255
|
| 134 |
+
#: Local\trunk/bookmarks-data.php:260
|
| 135 |
+
#: Local\trunk/bookmarks-data.php:265
|
| 136 |
+
msgid " in your bookmarking menu"
|
| 137 |
+
msgstr " in Dein Lesezeichen-Menü auf"
|
| 138 |
+
|
| 139 |
+
#: F:\Web
|
| 140 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 141 |
+
#: Local\trunk/bookmarks-data.php:6
|
| 142 |
+
#: Local\trunk/bookmarks-data.php:61
|
| 143 |
+
#: Local\trunk/bookmarks-data.php:141
|
| 144 |
+
#: Local\trunk/bookmarks-data.php:181
|
| 145 |
+
#: Local\trunk/bookmarks-data.php:241
|
| 146 |
+
#: Local\trunk/bookmarks-data.php:246
|
| 147 |
+
#: Local\trunk/bookmarks-data.php:251
|
| 148 |
+
#: Local\trunk/bookmarks-data.php:256
|
| 149 |
+
msgid "Submit this to "
|
| 150 |
+
msgstr "Empfehle diesen Artikel bei "
|
| 151 |
+
|
| 152 |
+
#: F:\Web
|
| 153 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 154 |
+
#: Local\trunk/bookmarks-data.php:10
|
| 155 |
+
#: Local\trunk/bookmarks-data.php:11
|
| 156 |
+
msgid "Blinklist"
|
| 157 |
+
msgstr "Blinklist"
|
| 158 |
+
|
| 159 |
+
#: F:\Web
|
| 160 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 161 |
+
#: Local\trunk/bookmarks-data.php:11
|
| 162 |
+
#: Local\trunk/bookmarks-data.php:16
|
| 163 |
+
#: Local\trunk/bookmarks-data.php:31
|
| 164 |
+
#: Local\trunk/bookmarks-data.php:46
|
| 165 |
+
#: Local\trunk/bookmarks-data.php:51
|
| 166 |
+
#: Local\trunk/bookmarks-data.php:66
|
| 167 |
+
#: Local\trunk/bookmarks-data.php:91
|
| 168 |
+
#: Local\trunk/bookmarks-data.php:101
|
| 169 |
+
#: Local\trunk/bookmarks-data.php:121
|
| 170 |
+
#: Local\trunk/bookmarks-data.php:126
|
| 171 |
+
#: Local\trunk/bookmarks-data.php:131
|
| 172 |
+
#: Local\trunk/bookmarks-data.php:146
|
| 173 |
+
#: Local\trunk/bookmarks-data.php:156
|
| 174 |
+
#: Local\trunk/bookmarks-data.php:211
|
| 175 |
+
#: Local\trunk/bookmarks-data.php:261
|
| 176 |
+
#: Local\trunk/bookmarks-data.php:266
|
| 177 |
+
msgid "Share this on "
|
| 178 |
+
msgstr "Empfehle diesen Artikel bei "
|
| 179 |
+
|
| 180 |
+
#: F:\Web
|
| 181 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 182 |
+
#: Local\trunk/bookmarks-data.php:15
|
| 183 |
+
msgid "Delicious"
|
| 184 |
+
msgstr "Delicious"
|
| 185 |
+
|
| 186 |
+
#: F:\Web
|
| 187 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 188 |
+
#: Local\trunk/bookmarks-data.php:16
|
| 189 |
+
msgid "del.icio.us"
|
| 190 |
+
msgstr "del.icio.us"
|
| 191 |
+
|
| 192 |
+
#: F:\Web
|
| 193 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 194 |
+
#: Local\trunk/bookmarks-data.php:20
|
| 195 |
+
msgid "Digg"
|
| 196 |
+
msgstr "Digg"
|
| 197 |
+
|
| 198 |
+
#: F:\Web
|
| 199 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 200 |
+
#: Local\trunk/bookmarks-data.php:21
|
| 201 |
+
msgid "Digg this!"
|
| 202 |
+
msgstr "Digg this!"
|
| 203 |
+
|
| 204 |
+
#: F:\Web
|
| 205 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 206 |
+
#: Local\trunk/bookmarks-data.php:25
|
| 207 |
+
#: Local\trunk/bookmarks-data.php:26
|
| 208 |
+
msgid "Diigo"
|
| 209 |
+
msgstr "Diigo"
|
| 210 |
+
|
| 211 |
+
#: F:\Web
|
| 212 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 213 |
+
#: Local\trunk/bookmarks-data.php:26
|
| 214 |
+
msgid "Post this on "
|
| 215 |
+
msgstr "Veröffentliche dies bei "
|
| 216 |
+
|
| 217 |
+
#: F:\Web
|
| 218 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 219 |
+
#: Local\trunk/bookmarks-data.php:30
|
| 220 |
+
#: Local\trunk/bookmarks-data.php:31
|
| 221 |
+
msgid "Reddit"
|
| 222 |
+
msgstr "Reddit"
|
| 223 |
+
|
| 224 |
+
#: F:\Web
|
| 225 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 226 |
+
#: Local\trunk/bookmarks-data.php:35
|
| 227 |
+
msgid "Yahoo! Buzz"
|
| 228 |
+
msgstr "Yahoo! Buzz"
|
| 229 |
+
|
| 230 |
+
#: F:\Web
|
| 231 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 232 |
+
#: Local\trunk/bookmarks-data.php:36
|
| 233 |
+
msgid "Buzz up!"
|
| 234 |
+
msgstr "Buzz up!"
|
| 235 |
+
|
| 236 |
+
#: F:\Web
|
| 237 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 238 |
+
#: Local\trunk/bookmarks-data.php:40
|
| 239 |
+
msgid "Stumbleupon"
|
| 240 |
+
msgstr "Stumbleupon"
|
| 241 |
+
|
| 242 |
+
#: F:\Web
|
| 243 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 244 |
+
#: Local\trunk/bookmarks-data.php:41
|
| 245 |
+
msgid "Stumble upon something good? Share it on StumbleUpon"
|
| 246 |
+
msgstr "Bei StumbleUpon einstellen"
|
| 247 |
+
|
| 248 |
+
#: F:\Web
|
| 249 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 250 |
+
#: Local\trunk/bookmarks-data.php:45
|
| 251 |
+
#: Local\trunk/bookmarks-data.php:46
|
| 252 |
+
msgid "Technorati"
|
| 253 |
+
msgstr "Technorati"
|
| 254 |
+
|
| 255 |
+
#: F:\Web
|
| 256 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 257 |
+
#: Local\trunk/bookmarks-data.php:50
|
| 258 |
+
#: Local\trunk/bookmarks-data.php:51
|
| 259 |
+
msgid "Mixx"
|
| 260 |
+
msgstr "Mixx"
|
| 261 |
+
|
| 262 |
+
#: F:\Web
|
| 263 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 264 |
+
#: Local\trunk/bookmarks-data.php:55
|
| 265 |
+
#: Local\trunk/bookmarks-data.php:56
|
| 266 |
+
msgid "MySpace"
|
| 267 |
+
msgstr "MySpace"
|
| 268 |
+
|
| 269 |
+
#: F:\Web
|
| 270 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 271 |
+
#: Local\trunk/bookmarks-data.php:56
|
| 272 |
+
#: Local\trunk/bookmarks-data.php:201
|
| 273 |
+
#: Local\trunk/bookmarks-data.php:226
|
| 274 |
+
msgid "Post this to "
|
| 275 |
+
msgstr "Sende dies zu "
|
| 276 |
+
|
| 277 |
+
#: F:\Web
|
| 278 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 279 |
+
#: Local\trunk/bookmarks-data.php:60
|
| 280 |
+
#: Local\trunk/bookmarks-data.php:61
|
| 281 |
+
msgid "DesignFloat"
|
| 282 |
+
msgstr "DesignFloat"
|
| 283 |
+
|
| 284 |
+
#: F:\Web
|
| 285 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 286 |
+
#: Local\trunk/bookmarks-data.php:65
|
| 287 |
+
#: Local\trunk/bookmarks-data.php:66
|
| 288 |
+
msgid "Facebook"
|
| 289 |
+
msgstr "Facebook"
|
| 290 |
+
|
| 291 |
+
#: F:\Web
|
| 292 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 293 |
+
#: Local\trunk/bookmarks-data.php:70
|
| 294 |
+
msgid "Twitter"
|
| 295 |
+
msgstr "Twitter"
|
| 296 |
+
|
| 297 |
+
#: F:\Web
|
| 298 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 299 |
+
#: Local\trunk/bookmarks-data.php:71
|
| 300 |
+
msgid "Tweet This!"
|
| 301 |
+
msgstr "Twittere diesen Artikel!"
|
| 302 |
+
|
| 303 |
+
#: F:\Web
|
| 304 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 305 |
+
#: Local\trunk/bookmarks-data.php:75
|
| 306 |
+
#: Local\trunk/bookmarks-data.php:80
|
| 307 |
+
msgid "Check this box to include the "
|
| 308 |
+
msgstr "Wähle diese Box um folgendes einzuschließen:"
|
| 309 |
+
|
| 310 |
+
#: F:\Web
|
| 311 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 312 |
+
#: Local\trunk/bookmarks-data.php:75
|
| 313 |
+
msgid "\"Email to a Friend\" link"
|
| 314 |
+
msgstr "\"Sende per Email\"-Link"
|
| 315 |
+
|
| 316 |
+
#: F:\Web
|
| 317 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 318 |
+
#: Local\trunk/bookmarks-data.php:76
|
| 319 |
+
msgid "Email this to a friend?"
|
| 320 |
+
msgstr "Sende diesen Artikel einem Freund per Email"
|
| 321 |
+
|
| 322 |
+
#: F:\Web
|
| 323 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 324 |
+
#: Local\trunk/bookmarks-data.php:80
|
| 325 |
+
#: Local\trunk/bookmarks-data.php:81
|
| 326 |
+
msgid "ToMuse"
|
| 327 |
+
msgstr "ToMuse"
|
| 328 |
+
|
| 329 |
+
#: F:\Web
|
| 330 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 331 |
+
#: Local\trunk/bookmarks-data.php:81
|
| 332 |
+
msgid "Suggest this article to "
|
| 333 |
+
msgstr "Empfehle diesen Artikel "
|
| 334 |
+
|
| 335 |
+
#: F:\Web
|
| 336 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 337 |
+
#: Local\trunk/bookmarks-data.php:85
|
| 338 |
+
msgid "a 'Subscribe to Comments' link"
|
| 339 |
+
msgstr "einen 'Abonniere die Kommentare'-Link"
|
| 340 |
+
|
| 341 |
+
#: F:\Web
|
| 342 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 343 |
+
#: Local\trunk/bookmarks-data.php:86
|
| 344 |
+
msgid "Subscribe to the comments for this post?"
|
| 345 |
+
msgstr "Abonniere die Kommentare für diesen Beitrag"
|
| 346 |
+
|
| 347 |
+
#: F:\Web
|
| 348 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 349 |
+
#: Local\trunk/bookmarks-data.php:90
|
| 350 |
+
#: Local\trunk/bookmarks-data.php:91
|
| 351 |
+
msgid "Linkedin"
|
| 352 |
+
msgstr "Linkedin"
|
| 353 |
+
|
| 354 |
+
#: F:\Web
|
| 355 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 356 |
+
#: Local\trunk/bookmarks-data.php:95
|
| 357 |
+
#: Local\trunk/bookmarks-data.php:96
|
| 358 |
+
msgid "Newsvine"
|
| 359 |
+
msgstr "Newsvine"
|
| 360 |
+
|
| 361 |
+
#: F:\Web
|
| 362 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 363 |
+
#: Local\trunk/bookmarks-data.php:96
|
| 364 |
+
msgid "Seed this on "
|
| 365 |
+
msgstr "Sende dies zu "
|
| 366 |
+
|
| 367 |
+
#: F:\Web
|
| 368 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 369 |
+
#: Local\trunk/bookmarks-data.php:100
|
| 370 |
+
#: Local\trunk/bookmarks-data.php:101
|
| 371 |
+
msgid "Devmarks"
|
| 372 |
+
msgstr "Devmarks"
|
| 373 |
+
|
| 374 |
+
#: F:\Web
|
| 375 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 376 |
+
#: Local\trunk/bookmarks-data.php:105
|
| 377 |
+
#: Local\trunk/bookmarks-data.php:106
|
| 378 |
+
msgid "Google Bookmarks"
|
| 379 |
+
msgstr "Google Bookmarks"
|
| 380 |
+
|
| 381 |
+
#: F:\Web
|
| 382 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 383 |
+
#: Local\trunk/bookmarks-data.php:106
|
| 384 |
+
#: Local\trunk/bookmarks-data.php:111
|
| 385 |
+
#: Local\trunk/bookmarks-data.php:116
|
| 386 |
+
#: Local\trunk/bookmarks-data.php:161
|
| 387 |
+
#: Local\trunk/bookmarks-data.php:166
|
| 388 |
+
#: Local\trunk/bookmarks-data.php:171
|
| 389 |
+
#: Local\trunk/bookmarks-data.php:176
|
| 390 |
+
#: Local\trunk/bookmarks-data.php:196
|
| 391 |
+
msgid "Add this to "
|
| 392 |
+
msgstr "Füge hinzu zu "
|
| 393 |
+
|
| 394 |
+
#: F:\Web
|
| 395 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 396 |
+
#: Local\trunk/bookmarks-data.php:110
|
| 397 |
+
#: Local\trunk/bookmarks-data.php:111
|
| 398 |
+
msgid "Mister Wong"
|
| 399 |
+
msgstr "Mister Wong"
|
| 400 |
+
|
| 401 |
+
#: F:\Web
|
| 402 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 403 |
+
#: Local\trunk/bookmarks-data.php:112
|
| 404 |
+
msgid "www.mister-wong.com"
|
| 405 |
+
msgstr "www.mister-wong.com"
|
| 406 |
+
|
| 407 |
+
#: F:\Web
|
| 408 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 409 |
+
#: Local\trunk/bookmarks-data.php:115
|
| 410 |
+
#: Local\trunk/bookmarks-data.php:116
|
| 411 |
+
msgid "Izeby"
|
| 412 |
+
msgstr "Izeby"
|
| 413 |
+
|
| 414 |
+
#: F:\Web
|
| 415 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 416 |
+
#: Local\trunk/bookmarks-data.php:120
|
| 417 |
+
#: Local\trunk/bookmarks-data.php:121
|
| 418 |
+
msgid "Tipd"
|
| 419 |
+
msgstr "Tipd"
|
| 420 |
+
|
| 421 |
+
#: F:\Web
|
| 422 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 423 |
+
#: Local\trunk/bookmarks-data.php:125
|
| 424 |
+
#: Local\trunk/bookmarks-data.php:126
|
| 425 |
+
msgid "PFBuzz"
|
| 426 |
+
msgstr "PFBuzz"
|
| 427 |
+
|
| 428 |
+
#: F:\Web
|
| 429 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 430 |
+
#: Local\trunk/bookmarks-data.php:130
|
| 431 |
+
#: Local\trunk/bookmarks-data.php:131
|
| 432 |
+
msgid "FriendFeed"
|
| 433 |
+
msgstr "FriendFeed"
|
| 434 |
+
|
| 435 |
+
#: F:\Web
|
| 436 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 437 |
+
#: Local\trunk/bookmarks-data.php:135
|
| 438 |
+
#: Local\trunk/bookmarks-data.php:136
|
| 439 |
+
msgid "BlogMarks"
|
| 440 |
+
msgstr "BlogMarks"
|
| 441 |
+
|
| 442 |
+
#: F:\Web
|
| 443 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 444 |
+
#: Local\trunk/bookmarks-data.php:136
|
| 445 |
+
msgid "Mark this on "
|
| 446 |
+
msgstr "Sende dies nach "
|
| 447 |
+
|
| 448 |
+
#: F:\Web
|
| 449 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 450 |
+
#: Local\trunk/bookmarks-data.php:140
|
| 451 |
+
#: Local\trunk/bookmarks-data.php:141
|
| 452 |
+
msgid "Twittley"
|
| 453 |
+
msgstr "Twittley"
|
| 454 |
+
|
| 455 |
+
#: F:\Web
|
| 456 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 457 |
+
#: Local\trunk/bookmarks-data.php:145
|
| 458 |
+
#: Local\trunk/bookmarks-data.php:146
|
| 459 |
+
msgid "Fwisp"
|
| 460 |
+
msgstr "Fwisp"
|
| 461 |
+
|
| 462 |
+
#: F:\Web
|
| 463 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 464 |
+
#: Local\trunk/bookmarks-data.php:150
|
| 465 |
+
#: Local\trunk/bookmarks-data.php:151
|
| 466 |
+
msgid "DesignMoo"
|
| 467 |
+
msgstr "DesignMoo"
|
| 468 |
+
|
| 469 |
+
#: F:\Web
|
| 470 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 471 |
+
#: Local\trunk/bookmarks-data.php:151
|
| 472 |
+
msgid "Moo this on "
|
| 473 |
+
msgstr "Moo dies bei "
|
| 474 |
+
|
| 475 |
+
#: F:\Web
|
| 476 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 477 |
+
#: Local\trunk/bookmarks-data.php:155
|
| 478 |
+
#: Local\trunk/bookmarks-data.php:156
|
| 479 |
+
msgid "BobrDobr"
|
| 480 |
+
msgstr "BobrDobr"
|
| 481 |
+
|
| 482 |
+
#: F:\Web
|
| 483 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 484 |
+
#: Local\trunk/bookmarks-data.php:155
|
| 485 |
+
#: Local\trunk/bookmarks-data.php:160
|
| 486 |
+
#: Local\trunk/bookmarks-data.php:165
|
| 487 |
+
#: Local\trunk/bookmarks-data.php:170
|
| 488 |
+
#: Local\trunk/bookmarks-data.php:175
|
| 489 |
+
msgid " (Russian)"
|
| 490 |
+
msgstr " (Russisch)"
|
| 491 |
+
|
| 492 |
+
#: F:\Web
|
| 493 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 494 |
+
#: Local\trunk/bookmarks-data.php:160
|
| 495 |
+
#: Local\trunk/bookmarks-data.php:161
|
| 496 |
+
msgid "Yandex.Bookmarks"
|
| 497 |
+
msgstr "Yandex.Bookmarks"
|
| 498 |
+
|
| 499 |
+
#: F:\Web
|
| 500 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 501 |
+
#: Local\trunk/bookmarks-data.php:165
|
| 502 |
+
#: Local\trunk/bookmarks-data.php:166
|
| 503 |
+
msgid "Memory.ru"
|
| 504 |
+
msgstr "Memory.ru"
|
| 505 |
+
|
| 506 |
+
#: F:\Web
|
| 507 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 508 |
+
#: Local\trunk/bookmarks-data.php:170
|
| 509 |
+
#: Local\trunk/bookmarks-data.php:171
|
| 510 |
+
msgid "100 bookmarks"
|
| 511 |
+
msgstr "100 bookmarks"
|
| 512 |
+
|
| 513 |
+
#: F:\Web
|
| 514 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 515 |
+
#: Local\trunk/bookmarks-data.php:175
|
| 516 |
+
#: Local\trunk/bookmarks-data.php:176
|
| 517 |
+
msgid "MyPlace"
|
| 518 |
+
msgstr "MyPlace"
|
| 519 |
+
|
| 520 |
+
#: F:\Web
|
| 521 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 522 |
+
#: Local\trunk/bookmarks-data.php:180
|
| 523 |
+
#: Local\trunk/bookmarks-data.php:181
|
| 524 |
+
msgid "Hacker News"
|
| 525 |
+
msgstr "Hacker News"
|
| 526 |
+
|
| 527 |
+
#: F:\Web
|
| 528 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 529 |
+
#: Local\trunk/bookmarks-data.php:185
|
| 530 |
+
#: Local\trunk/bookmarks-data.php:186
|
| 531 |
+
msgid "Print Friendly"
|
| 532 |
+
msgstr "Druckerfreundlich"
|
| 533 |
+
|
| 534 |
+
#: F:\Web
|
| 535 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 536 |
+
#: Local\trunk/bookmarks-data.php:186
|
| 537 |
+
msgid "Send this page to "
|
| 538 |
+
msgstr "Sende diese Seite zu "
|
| 539 |
+
|
| 540 |
+
#: F:\Web
|
| 541 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 542 |
+
#: Local\trunk/bookmarks-data.php:190
|
| 543 |
+
msgid "Design Bump"
|
| 544 |
+
msgstr "Design Bump"
|
| 545 |
+
|
| 546 |
+
#: F:\Web
|
| 547 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 548 |
+
#: Local\trunk/bookmarks-data.php:191
|
| 549 |
+
msgid "Bump this on "
|
| 550 |
+
msgstr "Bump dies bei "
|
| 551 |
+
|
| 552 |
+
#: F:\Web
|
| 553 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 554 |
+
#: Local\trunk/bookmarks-data.php:191
|
| 555 |
+
msgid "DesignBump"
|
| 556 |
+
msgstr "DesignBump"
|
| 557 |
+
|
| 558 |
+
#: F:\Web
|
| 559 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 560 |
+
#: Local\trunk/bookmarks-data.php:195
|
| 561 |
+
#: Local\trunk/bookmarks-data.php:196
|
| 562 |
+
msgid "Ning"
|
| 563 |
+
msgstr "Ning"
|
| 564 |
+
|
| 565 |
+
#: F:\Web
|
| 566 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 567 |
+
#: Local\trunk/bookmarks-data.php:200
|
| 568 |
+
#: Local\trunk/bookmarks-data.php:201
|
| 569 |
+
msgid "Identica"
|
| 570 |
+
msgstr "Identica"
|
| 571 |
+
|
| 572 |
+
#: F:\Web
|
| 573 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 574 |
+
#: Local\trunk/bookmarks-data.php:205
|
| 575 |
+
#: Local\trunk/bookmarks-data.php:206
|
| 576 |
+
msgid "Xerpi"
|
| 577 |
+
msgstr "Xerpi"
|
| 578 |
+
|
| 579 |
+
#: F:\Web
|
| 580 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 581 |
+
#: Local\trunk/bookmarks-data.php:206
|
| 582 |
+
msgid "Save this to "
|
| 583 |
+
msgstr "Speichere diese Seite bei "
|
| 584 |
+
|
| 585 |
+
#: F:\Web
|
| 586 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 587 |
+
#: Local\trunk/bookmarks-data.php:210
|
| 588 |
+
#: Local\trunk/bookmarks-data.php:211
|
| 589 |
+
msgid "Wikio"
|
| 590 |
+
msgstr "Wikio"
|
| 591 |
+
|
| 592 |
+
#: F:\Web
|
| 593 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 594 |
+
#: Local\trunk/bookmarks-data.php:215
|
| 595 |
+
#: Local\trunk/bookmarks-data.php:216
|
| 596 |
+
msgid "TechMeme"
|
| 597 |
+
msgstr "TechMeme"
|
| 598 |
+
|
| 599 |
+
#: F:\Web
|
| 600 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 601 |
+
#: Local\trunk/bookmarks-data.php:216
|
| 602 |
+
msgid "Tip this to "
|
| 603 |
+
msgstr "Empfehle diese Seite bei "
|
| 604 |
+
|
| 605 |
+
#: F:\Web
|
| 606 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 607 |
+
#: Local\trunk/bookmarks-data.php:220
|
| 608 |
+
#: Local\trunk/bookmarks-data.php:221
|
| 609 |
+
msgid "Sphinn"
|
| 610 |
+
msgstr "Sphinn"
|
| 611 |
+
|
| 612 |
+
#: F:\Web
|
| 613 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 614 |
+
#: Local\trunk/bookmarks-data.php:221
|
| 615 |
+
msgid "Sphinn this on "
|
| 616 |
+
msgstr "Empfehle diese Seite bei "
|
| 617 |
+
|
| 618 |
+
#: F:\Web
|
| 619 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 620 |
+
#: Local\trunk/bookmarks-data.php:225
|
| 621 |
+
#: Local\trunk/bookmarks-data.php:226
|
| 622 |
+
msgid "Posterous"
|
| 623 |
+
msgstr "Posterous"
|
| 624 |
+
|
| 625 |
+
#: F:\Web
|
| 626 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 627 |
+
#: Local\trunk/bookmarks-data.php:230
|
| 628 |
+
#: Local\trunk/bookmarks-data.php:231
|
| 629 |
+
msgid "Global Grind"
|
| 630 |
+
msgstr "Global Grind"
|
| 631 |
+
|
| 632 |
+
#: F:\Web
|
| 633 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 634 |
+
#: Local\trunk/bookmarks-data.php:231
|
| 635 |
+
msgid "Grind this! on "
|
| 636 |
+
msgstr "Empfehle diese Seite bei "
|
| 637 |
+
|
| 638 |
+
#: F:\Web
|
| 639 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 640 |
+
#: Local\trunk/bookmarks-data.php:235
|
| 641 |
+
#: Local\trunk/bookmarks-data.php:236
|
| 642 |
+
msgid "Ping.fm"
|
| 643 |
+
msgstr "Ping.fm"
|
| 644 |
+
|
| 645 |
+
#: F:\Web
|
| 646 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 647 |
+
#: Local\trunk/bookmarks-data.php:236
|
| 648 |
+
msgid "Ping this on "
|
| 649 |
+
msgstr "Empfehle diese Seite bei "
|
| 650 |
+
|
| 651 |
+
#: F:\Web
|
| 652 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 653 |
+
#: Local\trunk/bookmarks-data.php:240
|
| 654 |
+
#: Local\trunk/bookmarks-data.php:241
|
| 655 |
+
msgid "NUjij"
|
| 656 |
+
msgstr "NUjij"
|
| 657 |
+
|
| 658 |
+
#: F:\Web
|
| 659 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 660 |
+
#: Local\trunk/bookmarks-data.php:240
|
| 661 |
+
#: Local\trunk/bookmarks-data.php:245
|
| 662 |
+
msgid " (Dutch)"
|
| 663 |
+
msgstr "(Holländisch)"
|
| 664 |
+
|
| 665 |
+
#: F:\Web
|
| 666 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 667 |
+
#: Local\trunk/bookmarks-data.php:245
|
| 668 |
+
#: Local\trunk/bookmarks-data.php:246
|
| 669 |
+
msgid "eKudos"
|
| 670 |
+
msgstr "eKudos"
|
| 671 |
+
|
| 672 |
+
#: F:\Web
|
| 673 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 674 |
+
#: Local\trunk/bookmarks-data.php:250
|
| 675 |
+
#: Local\trunk/bookmarks-data.php:251
|
| 676 |
+
msgid "Netvouz"
|
| 677 |
+
msgstr "Netvouz"
|
| 678 |
+
|
| 679 |
+
#: F:\Web
|
| 680 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 681 |
+
#: Local\trunk/bookmarks-data.php:255
|
| 682 |
+
#: Local\trunk/bookmarks-data.php:256
|
| 683 |
+
msgid "Netvibes"
|
| 684 |
+
msgstr "Netvibes"
|
| 685 |
+
|
| 686 |
+
#: F:\Web
|
| 687 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 688 |
+
#: Local\trunk/bookmarks-data.php:260
|
| 689 |
+
#: Local\trunk/bookmarks-data.php:261
|
| 690 |
+
msgid "Fleck"
|
| 691 |
+
msgstr "Fleck"
|
| 692 |
+
|
| 693 |
+
#: F:\Web
|
| 694 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 695 |
+
#: Local\trunk/bookmarks-data.php:265
|
| 696 |
+
#: Local\trunk/bookmarks-data.php:266
|
| 697 |
+
msgid "Blogosphere News"
|
| 698 |
+
msgstr "Blogosphere News"
|
| 699 |
+
|
| 700 |
+
#: F:\Web
|
| 701 |
+
#: Development\Projects\SexyBookmarks\SVN Local\trunk/public.php:121
|
| 702 |
+
msgid "an error occurred in SexyBookmarks"
|
| 703 |
+
msgstr "ein Fehler ist in SexyBookmarks aufgetreten"
|
| 704 |
+
|
| 705 |
+
#: F:\Web
|
| 706 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 707 |
+
#: Local\trunk/sexy-bookmarks.php:94
|
| 708 |
+
msgid "Your changes have been saved successfully!"
|
| 709 |
+
msgstr "Deine Änderungen wurde erfolgreich gespeichert"
|
| 710 |
+
|
| 711 |
+
#: F:\Web
|
| 712 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 713 |
+
#: Local\trunk/sexy-bookmarks.php:94
|
| 714 |
+
msgid "Maybe you would consider "
|
| 715 |
+
msgstr "Würdest Du in Erwägung ziehen"
|
| 716 |
+
|
| 717 |
+
#: F:\Web
|
| 718 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 719 |
+
#: Local\trunk/sexy-bookmarks.php:94
|
| 720 |
+
msgid "donating"
|
| 721 |
+
msgstr "etwas zu spenden"
|
| 722 |
+
|
| 723 |
+
#: F:\Web
|
| 724 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 725 |
+
#: Local\trunk/sexy-bookmarks.php:97
|
| 726 |
+
msgid "Please choose where you would like the menu to be displayed."
|
| 727 |
+
msgstr "Wo soll das Menü angezeigt werden."
|
| 728 |
+
|
| 729 |
+
#: F:\Web
|
| 730 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 731 |
+
#: Local\trunk/sexy-bookmarks.php:98
|
| 732 |
+
msgid "You can't display the menu if you don't choose a few sites to add to it!"
|
| 733 |
+
msgstr "Du kannst kein Menü anzeigen, ohne ein paar Seiten ausgewählt zu haben"
|
| 734 |
+
|
| 735 |
+
#: F:\Web
|
| 736 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 737 |
+
#: Local\trunk/sexy-bookmarks.php:99
|
| 738 |
+
msgid "Please choose where you want the menu displayed."
|
| 739 |
+
msgstr "Bitte wähle aus, wo das Menü angezeigt werden soll"
|
| 740 |
+
|
| 741 |
+
#: F:\Web
|
| 742 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 743 |
+
#: Local\trunk/sexy-bookmarks.php:103
|
| 744 |
+
msgid "You need to select the primary category for any articles submitted to Twittley."
|
| 745 |
+
msgstr "Du musst die Primär-Kategorie setzen für die Artikel, die zu Twittley gesendet werden sollen."
|
| 746 |
+
|
| 747 |
+
#: F:\Web
|
| 748 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 749 |
+
#: Local\trunk/sexy-bookmarks.php:104
|
| 750 |
+
msgid "You need to set at least 1 default tag for any articles submitted to Twittley."
|
| 751 |
+
msgstr "Du musst mindestens einen Default-Tag setzen für die Artikel, die zu Twittley gesendet werden sollen."
|
| 752 |
+
|
| 753 |
+
#: F:\Web
|
| 754 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 755 |
+
#: Local\trunk/sexy-bookmarks.php:114
|
| 756 |
+
msgid "You must first download and activate the"
|
| 757 |
+
msgstr "Du musst zunächst folgendes Downloaden und installieren:"
|
| 758 |
+
|
| 759 |
+
#: F:\Web
|
| 760 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 761 |
+
#: Local\trunk/sexy-bookmarks.php:114
|
| 762 |
+
msgid "Twitter Friendly Links Plugin"
|
| 763 |
+
msgstr "Twitter Friendly Links Plugin"
|
| 764 |
+
|
| 765 |
+
#: F:\Web
|
| 766 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 767 |
+
#: Local\trunk/sexy-bookmarks.php:114
|
| 768 |
+
msgid "before hosting your own short URLs..."
|
| 769 |
+
msgstr " bevor Du deine eigenen Kurz-URLs verwenden kannst."
|
| 770 |
+
|
| 771 |
+
#: F:\Web
|
| 772 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 773 |
+
#: Local\trunk/sexy-bookmarks.php:132
|
| 774 |
+
msgid "Due to recent API changes by Tumblr, I can no longer offer them as a supported network in the plugin."
|
| 775 |
+
msgstr "Wegen der jüngsten API-Änderungen bei Tumblr kann ich dieses Netzwerk in dem Plugin leider nicht mehr unterstützen."
|
| 776 |
+
|
| 777 |
+
#: F:\Web
|
| 778 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 779 |
+
#: Local\trunk/sexy-bookmarks.php:137
|
| 780 |
+
msgid "We're currently working on a more sophisticated solution for the email link and will re-enable it when finished."
|
| 781 |
+
msgstr "Wir arbeiten derzeit an einer besseren Unterstützung für den EMail link und werden ihn dann wieder aktivieren."
|
| 782 |
+
|
| 783 |
+
#: F:\Web
|
| 784 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 785 |
+
#: Local\trunk/sexy-bookmarks.php:142
|
| 786 |
+
msgid " Short URLs have been reset."
|
| 787 |
+
msgstr "Die Kurz-URLs sind zurückgesetzt worden."
|
| 788 |
+
|
| 789 |
+
#: F:\Web
|
| 790 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 791 |
+
#: Local\trunk/sexy-bookmarks.php:185
|
| 792 |
+
msgid "You are using an outdated version of the plugin"
|
| 793 |
+
msgstr "Diese Version von dem Plugin ist leider veraltet."
|
| 794 |
+
|
| 795 |
+
#: F:\Web
|
| 796 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 797 |
+
#: Local\trunk/sexy-bookmarks.php:185
|
| 798 |
+
msgid "please update if you wish to enjoy all available features!"
|
| 799 |
+
msgstr "Bitte update es, damit Du alle neuen Features benutzen kannst."
|
| 800 |
+
|
| 801 |
+
#: F:\Web
|
| 802 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 803 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 804 |
+
msgid "You are using the development version of the plugin"
|
| 805 |
+
msgstr "Dies ist eine Entwickler-Version dieses Plugins."
|
| 806 |
+
|
| 807 |
+
#: F:\Web
|
| 808 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 809 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 810 |
+
msgid " beta"
|
| 811 |
+
msgstr " beta"
|
| 812 |
+
|
| 813 |
+
#: F:\Web
|
| 814 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 815 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 816 |
+
msgid "please "
|
| 817 |
+
msgstr "bitte"
|
| 818 |
+
|
| 819 |
+
#: F:\Web
|
| 820 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 821 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 822 |
+
msgid "let us know of any bugs"
|
| 823 |
+
msgstr "lass uns von etwaigen Bugs wissen"
|
| 824 |
+
|
| 825 |
+
#: F:\Web
|
| 826 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 827 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 828 |
+
msgid "you may encounter!"
|
| 829 |
+
msgstr "solltest Du welche finden!"
|
| 830 |
+
|
| 831 |
+
#: F:\Web
|
| 832 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 833 |
+
#: Local\trunk/sexy-bookmarks.php:213
|
| 834 |
+
msgid "Enabled Networks"
|
| 835 |
+
msgstr "Aktivierte Netzwerke"
|
| 836 |
+
|
| 837 |
+
#: F:\Web
|
| 838 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 839 |
+
#: Local\trunk/sexy-bookmarks.php:223
|
| 840 |
+
msgid "Select the Networks to display. Drag to reorder."
|
| 841 |
+
msgstr "Wähle die Netzwerke, die angezeigt werden sollen, ziehe sie um zu sortieren"
|
| 842 |
+
|
| 843 |
+
#: F:\Web
|
| 844 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 845 |
+
#: Local\trunk/sexy-bookmarks.php:237
|
| 846 |
+
msgid "Functionality Settings"
|
| 847 |
+
msgstr "Einstellungen zu Funktionalitäten"
|
| 848 |
+
|
| 849 |
+
#: F:\Web
|
| 850 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 851 |
+
#: Local\trunk/sexy-bookmarks.php:250
|
| 852 |
+
msgid "This will clear <u>ALL</u> short URLs. - Are you sure?"
|
| 853 |
+
msgstr "Dies wird ALLE Kurz-Urls zurücksetzen. Sicher?"
|
| 854 |
+
|
| 855 |
+
#: F:\Web
|
| 856 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 857 |
+
#: Local\trunk/sexy-bookmarks.php:253
|
| 858 |
+
#: Local\trunk/sexy-bookmarks.php:356
|
| 859 |
+
#: Local\trunk/sexy-bookmarks.php:359
|
| 860 |
+
#: Local\trunk/sexy-bookmarks.php:397
|
| 861 |
+
#: Local\trunk/sexy-bookmarks.php:517
|
| 862 |
+
msgid "Yes"
|
| 863 |
+
msgstr "Ja"
|
| 864 |
+
|
| 865 |
+
#: F:\Web
|
| 866 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 867 |
+
#: Local\trunk/sexy-bookmarks.php:253
|
| 868 |
+
msgid "Cancel"
|
| 869 |
+
msgstr "Abbruch"
|
| 870 |
+
|
| 871 |
+
#: F:\Web
|
| 872 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 873 |
+
#: Local\trunk/sexy-bookmarks.php:257
|
| 874 |
+
msgid "Twitter Options:"
|
| 875 |
+
msgstr "Twitter Einstellungen:"
|
| 876 |
+
|
| 877 |
+
#: F:\Web
|
| 878 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 879 |
+
#: Local\trunk/sexy-bookmarks.php:258
|
| 880 |
+
msgid "Twitter ID:"
|
| 881 |
+
msgstr "Twitter ID:"
|
| 882 |
+
|
| 883 |
+
#: F:\Web
|
| 884 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 885 |
+
#: Local\trunk/sexy-bookmarks.php:261
|
| 886 |
+
msgid "Which URL Shortener?"
|
| 887 |
+
msgstr "Welcher Kurz-URL-Dienst?"
|
| 888 |
+
|
| 889 |
+
#: F:\Web
|
| 890 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 891 |
+
#: Local\trunk/sexy-bookmarks.php:280
|
| 892 |
+
msgid "Reset all Short URLs"
|
| 893 |
+
msgstr "Setze alle Kurz-URLs zurück"
|
| 894 |
+
|
| 895 |
+
#: F:\Web
|
| 896 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 897 |
+
#: Local\trunk/sexy-bookmarks.php:292
|
| 898 |
+
msgid "Yahoo! Buzz Defaults:"
|
| 899 |
+
msgstr "Yahoo! Buzz Defaults:"
|
| 900 |
+
|
| 901 |
+
#: F:\Web
|
| 902 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 903 |
+
#: Local\trunk/sexy-bookmarks.php:293
|
| 904 |
+
msgid "Default Content Category:"
|
| 905 |
+
msgstr "Standard Kategorie für Inhalte:"
|
| 906 |
+
|
| 907 |
+
#: F:\Web
|
| 908 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 909 |
+
#: Local\trunk/sexy-bookmarks.php:327
|
| 910 |
+
msgid "Twittley Defaults:"
|
| 911 |
+
msgstr "Twittley Defaults:"
|
| 912 |
+
|
| 913 |
+
#: F:\Web
|
| 914 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 915 |
+
#: Local\trunk/sexy-bookmarks.php:328
|
| 916 |
+
msgid "Primary Content Category:"
|
| 917 |
+
msgstr "Kategorie für primären Inhalt:"
|
| 918 |
+
|
| 919 |
+
#: F:\Web
|
| 920 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 921 |
+
#: Local\trunk/sexy-bookmarks.php:346
|
| 922 |
+
msgid "Enter a comma separated list of general tags which describe your site's posts as a whole. Try not to be too specific, as one post may fall into different \"tag categories\" than other posts."
|
| 923 |
+
msgstr "Bitte gib eine Kommagetrennte liste von allgemeinsn Tags ein, welche Deine Beiträge insgesamt charakterisieren. Bitte sein nich zu spezifisch, da einzelne Beiträge in unterschiedliche Tag-Kategorien fallen könnten."
|
| 924 |
+
|
| 925 |
+
#: F:\Web
|
| 926 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 927 |
+
#: Local\trunk/sexy-bookmarks.php:347
|
| 928 |
+
msgid "This list is primarily used as a failsafe in case you forget to enter WordPress tags for a particular post, in which case this list of tags would be used so as to bring at least *somewhat* relevant search queries based on the general tags that you enter here."
|
| 929 |
+
msgstr "Diese liste wird vornehmlich als Fallback genutzt, falls Du vergisst, WordPress-Tags für einen speziellen Post zu setzen. In diesem Fall wird diese Liste verwendet um irgendetwas Sinnvolles einzutragen."
|
| 930 |
+
|
| 931 |
+
#: F:\Web
|
| 932 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 933 |
+
#: Local\trunk/sexy-bookmarks.php:347
|
| 934 |
+
msgid "Click here to close this message"
|
| 935 |
+
msgstr "Bitte hier klicken um diese Nachricht zu schließen"
|
| 936 |
+
|
| 937 |
+
#: F:\Web
|
| 938 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 939 |
+
#: Local\trunk/sexy-bookmarks.php:347
|
| 940 |
+
msgid "close"
|
| 941 |
+
msgstr "Schließen"
|
| 942 |
+
|
| 943 |
+
#: F:\Web
|
| 944 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 945 |
+
#: Local\trunk/sexy-bookmarks.php:349
|
| 946 |
+
msgid "Default Tags:"
|
| 947 |
+
msgstr "Standard Tags:"
|
| 948 |
+
|
| 949 |
+
#: F:\Web
|
| 950 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 951 |
+
#: Local\trunk/sexy-bookmarks.php:350
|
| 952 |
+
#: Local\trunk/sexy-bookmarks.php:515
|
| 953 |
+
msgid "Click here for help with this option"
|
| 954 |
+
msgstr "Klicke hier für Hilfe mit dieser Option"
|
| 955 |
+
|
| 956 |
+
#: F:\Web
|
| 957 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 958 |
+
#: Local\trunk/sexy-bookmarks.php:354
|
| 959 |
+
msgid "General Functionality Options:"
|
| 960 |
+
msgstr "Einstellungen für generelle Funktionen:"
|
| 961 |
+
|
| 962 |
+
#: F:\Web
|
| 963 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 964 |
+
#: Local\trunk/sexy-bookmarks.php:355
|
| 965 |
+
msgid "Add nofollow to the links?"
|
| 966 |
+
msgstr "Nofollow an die Links anhängen?"
|
| 967 |
+
|
| 968 |
+
#: F:\Web
|
| 969 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 970 |
+
#: Local\trunk/sexy-bookmarks.php:357
|
| 971 |
+
#: Local\trunk/sexy-bookmarks.php:360
|
| 972 |
+
#: Local\trunk/sexy-bookmarks.php:398
|
| 973 |
+
#: Local\trunk/sexy-bookmarks.php:402
|
| 974 |
+
#: Local\trunk/sexy-bookmarks.php:518
|
| 975 |
+
msgid "No"
|
| 976 |
+
msgstr "Nein"
|
| 977 |
+
|
| 978 |
+
#: F:\Web
|
| 979 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 980 |
+
#: Local\trunk/sexy-bookmarks.php:358
|
| 981 |
+
msgid "Open links in new window?"
|
| 982 |
+
msgstr "Links in neuem Fenster öffnen?"
|
| 983 |
+
|
| 984 |
+
#: F:\Web
|
| 985 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 986 |
+
#: Local\trunk/sexy-bookmarks.php:368
|
| 987 |
+
msgid "General Look & Feel"
|
| 988 |
+
msgstr "Allgemeines Aussehen"
|
| 989 |
+
|
| 990 |
+
#: F:\Web
|
| 991 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 992 |
+
#: Local\trunk/sexy-bookmarks.php:381
|
| 993 |
+
#: Local\trunk/sexy-bookmarks.php:390
|
| 994 |
+
msgid "This will void any custom CSS applied below."
|
| 995 |
+
msgstr "Dies überschreibt jegliches unten angegebene CSS."
|
| 996 |
+
|
| 997 |
+
#: F:\Web
|
| 998 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 999 |
+
#: Local\trunk/sexy-bookmarks.php:384
|
| 1000 |
+
#: Local\trunk/sexy-bookmarks.php:393
|
| 1001 |
+
msgid "Ok"
|
| 1002 |
+
msgstr "Ok"
|
| 1003 |
+
|
| 1004 |
+
#: F:\Web
|
| 1005 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1006 |
+
#: Local\trunk/sexy-bookmarks.php:396
|
| 1007 |
+
msgid "Animate-expand multi-lined bookmarks?"
|
| 1008 |
+
msgstr "Mehrzeilige Anzeige animieren?"
|
| 1009 |
+
|
| 1010 |
+
#: F:\Web
|
| 1011 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1012 |
+
#: Local\trunk/sexy-bookmarks.php:399
|
| 1013 |
+
msgid "Auto-space/center the bookmarks?"
|
| 1014 |
+
msgstr "Anzeige automatisch ausrichten / zentrieren?"
|
| 1015 |
+
|
| 1016 |
+
#: F:\Web
|
| 1017 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1018 |
+
#: Local\trunk/sexy-bookmarks.php:400
|
| 1019 |
+
msgid "Space"
|
| 1020 |
+
msgstr "Ausrichten (verteilen)"
|
| 1021 |
+
|
| 1022 |
+
#: F:\Web
|
| 1023 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1024 |
+
#: Local\trunk/sexy-bookmarks.php:401
|
| 1025 |
+
msgid "Center"
|
| 1026 |
+
msgstr "Zentrieren"
|
| 1027 |
+
|
| 1028 |
+
#: F:\Web
|
| 1029 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1030 |
+
#: Local\trunk/sexy-bookmarks.php:415
|
| 1031 |
+
msgid "If you see this message, please delete the contents of this textarea and click \\\"Save Changes\\\"."
|
| 1032 |
+
msgstr "Wenn Du diese Nachricht siehst, dann lösche bitte den Inhalt dieses Feldes und speichere alle Änderungen."
|
| 1033 |
+
|
| 1034 |
+
#: F:\Web
|
| 1035 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1036 |
+
#: Local\trunk/sexy-bookmarks.php:419
|
| 1037 |
+
msgid "You can style the DIV that holds the menu here:"
|
| 1038 |
+
msgstr "Du kannst das DIV, welches das Menü umschließt hier anpassen:"
|
| 1039 |
+
|
| 1040 |
+
#: F:\Web
|
| 1041 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1042 |
+
#: Local\trunk/sexy-bookmarks.php:422
|
| 1043 |
+
msgid "jQuery Compatibility Fix"
|
| 1044 |
+
msgstr "Kompatibilitäts-Fix für jQuery"
|
| 1045 |
+
|
| 1046 |
+
#: F:\Web
|
| 1047 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1048 |
+
#: Local\trunk/sexy-bookmarks.php:423
|
| 1049 |
+
msgid "Check this box ONLY if the animate-expand, auto-center, or auto-space features don't work for you!"
|
| 1050 |
+
msgstr "Checke dieses Feld NUR, wenn Du probleme mit der Animation, dem Zentrieren oder dem Ausrichten hast!"
|
| 1051 |
+
|
| 1052 |
+
#: F:\Web
|
| 1053 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1054 |
+
#: Local\trunk/sexy-bookmarks.php:431
|
| 1055 |
+
msgid "Background Image"
|
| 1056 |
+
msgstr "Hintergrundbild"
|
| 1057 |
+
|
| 1058 |
+
#: F:\Web
|
| 1059 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1060 |
+
#: Local\trunk/sexy-bookmarks.php:442
|
| 1061 |
+
msgid "Use a background image?"
|
| 1062 |
+
msgstr "Nutzen des Hintergrundbildes?"
|
| 1063 |
+
|
| 1064 |
+
#: F:\Web
|
| 1065 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1066 |
+
#: Local\trunk/sexy-bookmarks.php:470
|
| 1067 |
+
msgid "Menu Placement"
|
| 1068 |
+
msgstr "Menu-Position"
|
| 1069 |
+
|
| 1070 |
+
#: F:\Web
|
| 1071 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1072 |
+
#: Local\trunk/sexy-bookmarks.php:483
|
| 1073 |
+
msgid "Need help with this? Find it in the "
|
| 1074 |
+
msgstr "Brauchst Du Hilfe hiermit? Du bekommst sie"
|
| 1075 |
+
|
| 1076 |
+
#: F:\Web
|
| 1077 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1078 |
+
#: Local\trunk/sexy-bookmarks.php:483
|
| 1079 |
+
msgid "official install guide"
|
| 1080 |
+
msgstr "im offiziellen Installations-Leitfaden"
|
| 1081 |
+
|
| 1082 |
+
#: F:\Web
|
| 1083 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1084 |
+
#: Local\trunk/sexy-bookmarks.php:492
|
| 1085 |
+
msgid "This feature is still in the experimental phase, so please "
|
| 1086 |
+
msgstr "Diese Funktion ist noch experimentell, bitte"
|
| 1087 |
+
|
| 1088 |
+
#: F:\Web
|
| 1089 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1090 |
+
#: Local\trunk/sexy-bookmarks.php:492
|
| 1091 |
+
msgid "report any bugs"
|
| 1092 |
+
msgstr "teile uns etwaige Fehler mit, "
|
| 1093 |
+
|
| 1094 |
+
#: F:\Web
|
| 1095 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1096 |
+
#: Local\trunk/sexy-bookmarks.php:492
|
| 1097 |
+
msgid "you may find"
|
| 1098 |
+
msgstr "die Du findest"
|
| 1099 |
+
|
| 1100 |
+
#: F:\Web
|
| 1101 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1102 |
+
#: Local\trunk/sexy-bookmarks.php:498
|
| 1103 |
+
msgid "Menu Location (in relevance to content):"
|
| 1104 |
+
msgstr "Menu-Position (im Verhältnis zum Inhalt des Beitrags)"
|
| 1105 |
+
|
| 1106 |
+
#: F:\Web
|
| 1107 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1108 |
+
#: Local\trunk/sexy-bookmarks.php:499
|
| 1109 |
+
msgid "Above Content"
|
| 1110 |
+
msgstr "darüber"
|
| 1111 |
+
|
| 1112 |
+
#: F:\Web
|
| 1113 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1114 |
+
#: Local\trunk/sexy-bookmarks.php:500
|
| 1115 |
+
msgid "Below Content"
|
| 1116 |
+
msgstr "darunter"
|
| 1117 |
+
|
| 1118 |
+
#: F:\Web
|
| 1119 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1120 |
+
#: Local\trunk/sexy-bookmarks.php:501
|
| 1121 |
+
msgid "Manual Mode"
|
| 1122 |
+
msgstr "manuell"
|
| 1123 |
+
|
| 1124 |
+
#: F:\Web
|
| 1125 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1126 |
+
#: Local\trunk/sexy-bookmarks.php:502
|
| 1127 |
+
msgid "Posts, pages, or the whole shebang?"
|
| 1128 |
+
msgstr "Beiträge, Seiten oder alles?"
|
| 1129 |
+
|
| 1130 |
+
#: F:\Web
|
| 1131 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1132 |
+
#: Local\trunk/sexy-bookmarks.php:516
|
| 1133 |
+
msgid "Show in RSS feed?"
|
| 1134 |
+
msgstr "In den RSS-Feed einfügen?"
|
| 1135 |
+
|
| 1136 |
+
#: F:\Web
|
| 1137 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1138 |
+
#: Local\trunk/sexy-bookmarks.php:520
|
| 1139 |
+
msgid "Hide menu from mobile browsers?"
|
| 1140 |
+
msgstr "Menü auf mobilen Browsern entfernen?"
|
| 1141 |
+
|
| 1142 |
+
#: F:\Web
|
| 1143 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1144 |
+
#: Local\trunk/sexy-bookmarks.php:528
|
| 1145 |
+
msgid "Save Changes"
|
| 1146 |
+
msgstr "Änderungen speichern"
|
| 1147 |
+
|
| 1148 |
+
#: F:\Web
|
| 1149 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1150 |
+
#: Local\trunk/sexy-bookmarks.php:536
|
| 1151 |
+
msgid "Plugin Info"
|
| 1152 |
+
msgstr "Über dieses Plugin"
|
| 1153 |
+
|
| 1154 |
+
#: F:\Web
|
| 1155 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1156 |
+
#: Local\trunk/sexy-bookmarks.php:540
|
| 1157 |
+
msgid "Helpful Plugin Links:"
|
| 1158 |
+
msgstr "Hilfreiche Links zu diesem Plugin:"
|
| 1159 |
+
|
| 1160 |
+
#: F:\Web
|
| 1161 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1162 |
+
#: Local\trunk/sexy-bookmarks.php:542
|
| 1163 |
+
msgid "Installation & Usage Guide"
|
| 1164 |
+
msgstr "Installations-Leitfaden; Benutzer-Leitfaden"
|
| 1165 |
+
|
| 1166 |
+
#: F:\Web
|
| 1167 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1168 |
+
#: Local\trunk/sexy-bookmarks.php:543
|
| 1169 |
+
msgid "Frequently Asked Questions"
|
| 1170 |
+
msgstr "Häufig gestellte Fragen"
|
| 1171 |
+
|
| 1172 |
+
#: F:\Web
|
| 1173 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1174 |
+
#: Local\trunk/sexy-bookmarks.php:544
|
| 1175 |
+
msgid "Bug Submission Form"
|
| 1176 |
+
msgstr "Formular zum Melden von Fehlern"
|
| 1177 |
+
|
| 1178 |
+
#: F:\Web
|
| 1179 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1180 |
+
#: Local\trunk/sexy-bookmarks.php:545
|
| 1181 |
+
msgid "Feature Request Form"
|
| 1182 |
+
msgstr "Formular für Erweiterungsanfragen"
|
| 1183 |
+
|
| 1184 |
+
#: F:\Web
|
| 1185 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1186 |
+
#: Local\trunk/sexy-bookmarks.php:546
|
| 1187 |
+
msgid "Other SexyBookmarks Platforms"
|
| 1188 |
+
msgstr "SexyBookmarks auf anderen Plattformen"
|
| 1189 |
+
|
| 1190 |
+
#: F:\Web
|
| 1191 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1192 |
+
#: Local\trunk/sexy-bookmarks.php:547
|
| 1193 |
+
msgid "SexyFox Firefox Toolbar"
|
| 1194 |
+
msgstr "SexyFox Firefox Toolbar"
|
| 1195 |
+
|
| 1196 |
+
#: F:\Web
|
| 1197 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1198 |
+
#: Local\trunk/sexy-bookmarks.php:550
|
| 1199 |
+
msgid "Current Plugin Stats:"
|
| 1200 |
+
msgstr "Aktuelle Plugin-Statistiken"
|
| 1201 |
+
|
| 1202 |
+
#: F:\Web
|
| 1203 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1204 |
+
#: Local\trunk/sexy-bookmarks.php:559
|
| 1205 |
+
#, php-format
|
| 1206 |
+
msgid "%s ago"
|
| 1207 |
+
msgstr "vor %s"
|
| 1208 |
+
|
| 1209 |
+
#: F:\Web
|
| 1210 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1211 |
+
#: Local\trunk/sexy-bookmarks.php:571
|
| 1212 |
+
msgid "Stable Version:"
|
| 1213 |
+
msgstr "Stabile Version:"
|
| 1214 |
+
|
| 1215 |
+
#: F:\Web
|
| 1216 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1217 |
+
#: Local\trunk/sexy-bookmarks.php:572
|
| 1218 |
+
msgid "Last Updated:"
|
| 1219 |
+
msgstr "Letztes Update:"
|
| 1220 |
+
|
| 1221 |
+
#: F:\Web
|
| 1222 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1223 |
+
#: Local\trunk/sexy-bookmarks.php:573
|
| 1224 |
+
msgid "Downloaded:"
|
| 1225 |
+
msgstr "Heruntereladen:"
|
| 1226 |
+
|
| 1227 |
+
#: F:\Web
|
| 1228 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1229 |
+
#: Local\trunk/sexy-bookmarks.php:573
|
| 1230 |
+
msgid "times"
|
| 1231 |
+
msgstr "Male"
|
| 1232 |
+
|
| 1233 |
+
#: F:\Web
|
| 1234 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1235 |
+
#: Local\trunk/sexy-bookmarks.php:574
|
| 1236 |
+
msgid "User Rating:"
|
| 1237 |
+
msgstr "User-Bewertung:"
|
| 1238 |
+
|
| 1239 |
+
#: F:\Web
|
| 1240 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1241 |
+
#: Local\trunk/sexy-bookmarks.php:574
|
| 1242 |
+
msgid "stars - Based on"
|
| 1243 |
+
msgstr "Sterne - basierend auf"
|
| 1244 |
+
|
| 1245 |
+
#: F:\Web
|
| 1246 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1247 |
+
#: Local\trunk/sexy-bookmarks.php:574
|
| 1248 |
+
msgid "votes"
|
| 1249 |
+
msgstr "Stimmen"
|
| 1250 |
+
|
| 1251 |
+
#: F:\Web
|
| 1252 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1253 |
+
#: Local\trunk/sexy-bookmarks.php:582
|
| 1254 |
+
msgid "Plugin Sponsors"
|
| 1255 |
+
msgstr "Plugin-Sponsoren"
|
| 1256 |
+
|
| 1257 |
+
#: F:\Web
|
| 1258 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1259 |
+
#: Local\trunk/sexy-bookmarks.php:615
|
| 1260 |
+
msgid "Support by Donating"
|
| 1261 |
+
msgstr "Unterstützung durch Spenden"
|
| 1262 |
+
|
| 1263 |
+
#: F:\Web
|
| 1264 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1265 |
+
#: Local\trunk/sexy-bookmarks.php:619
|
| 1266 |
+
msgid "Surely the fact that we're making the web a sexier place one blog at a time is worth a drink or three, right?"
|
| 1267 |
+
msgstr "Die Tatsache, dass wir das Web Blog für Blog zu einem sexieren Ort machen ist doch sicherlich einen Drink oder drei wert, oder?"
|
| 1268 |
+
|
| 1269 |
+
#: F:\Web
|
| 1270 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1271 |
+
#: Local\trunk/sexy-bookmarks.php:621
|
| 1272 |
+
#: Local\trunk/sexy-bookmarks.php:624
|
| 1273 |
+
msgid "Help support the development of this plugin by donating!"
|
| 1274 |
+
msgstr "Hilf uns, dieses Plugin zu enwickeln, in dem Du spendest!"
|
| 1275 |
+
|
| 1276 |
+
#: F:\Web
|
| 1277 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1278 |
+
#: Local\trunk/sexy-bookmarks.php:634
|
| 1279 |
+
msgid "Top Supporters"
|
| 1280 |
+
msgstr "Top Unterstützer"
|
| 1281 |
+
|
| 1282 |
+
#: F:\Web
|
| 1283 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1284 |
+
#: Local\trunk/sexy-bookmarks.php:669
|
| 1285 |
+
msgid "Shout-Outs"
|
| 1286 |
+
msgstr "Shout-Outs"
|
| 1287 |
+
|
| 1288 |
+
#: F:\Web
|
| 1289 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1290 |
+
#: Local\trunk/sexy-bookmarks.php:674
|
| 1291 |
+
msgid "GUI Icons: Pinvoke"
|
| 1292 |
+
msgstr "GUI Icons: Pinvoke"
|
| 1293 |
+
|
| 1294 |
+
#: F:\Web
|
| 1295 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1296 |
+
#: Local\trunk/sexy-bookmarks.php:675
|
| 1297 |
+
msgid "Original Skin Icons: Function"
|
| 1298 |
+
msgstr "Original Skin Icons: Function"
|
| 1299 |
+
|
| 1300 |
+
#: F:\Web
|
| 1301 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1302 |
+
#: Local\trunk/sexy-bookmarks.php:676
|
| 1303 |
+
msgid "Bug Patch: Artem Russakovskii"
|
| 1304 |
+
msgstr "Bug Patch: Artem Russakovskii"
|
| 1305 |
+
|
| 1306 |
+
#: F:\Web
|
| 1307 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1308 |
+
#: Local\trunk/sexy-bookmarks.php:677
|
| 1309 |
+
msgid "Twitter encoding fix: Gautam Gupta"
|
| 1310 |
+
msgstr "Twitter encoding fix: Gautam Gupta"
|
| 1311 |
+
|
| 1312 |
+
#: F:\Web
|
| 1313 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1314 |
+
#: Local\trunk/sexy-bookmarks.php:678
|
| 1315 |
+
msgid "Russian translation: Yuri Gribov"
|
| 1316 |
+
msgstr "Russian translation: Yuri Gribov"
|
| 1317 |
+
|
| 1318 |
+
#: F:\Web
|
| 1319 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1320 |
+
#: Local\trunk/sexy-bookmarks.php:679
|
| 1321 |
+
msgid "French translation: Maitre Mo"
|
| 1322 |
+
msgstr "French translation: Maitre Mo"
|
| 1323 |
+
|
| 1324 |
+
#: F:\Web
|
| 1325 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1326 |
+
#: Local\trunk/sexy-bookmarks.php:680
|
| 1327 |
+
msgid "bit.ly bug fix: Konstantin Kovshenin"
|
| 1328 |
+
msgstr "bit.ly bug fix: Konstantin Kovshenin"
|
| 1329 |
+
|
| 1330 |
+
#: F:\Web
|
| 1331 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1332 |
+
#: Local\trunk/sexy-bookmarks.php:681
|
| 1333 |
+
msgid "Romanian translation: Ghenciu Ciprian"
|
| 1334 |
+
msgstr "Romanian translation: Ghenciu Ciprian"
|
| 1335 |
+
|
| 1336 |
+
#: F:\Web
|
| 1337 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1338 |
+
#: Local\trunk/sexy-bookmarks.php:682
|
| 1339 |
+
msgid "Italian translation: Carlo Veltri"
|
| 1340 |
+
msgstr "Italian translation: Carlo Veltri"
|
| 1341 |
+
|
| 1342 |
+
#: F:\Web
|
| 1343 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1344 |
+
#: Local\trunk/sexy-bookmarks.php:707
|
| 1345 |
+
msgid "You're using an outdated version of SexyBookmarks!"
|
| 1346 |
+
msgstr "Du benutzt eine abgelaufene Version von Sexy-Bookmarks!"
|
| 1347 |
+
|
| 1348 |
+
#: F:\Web
|
| 1349 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1350 |
+
#: Local\trunk/sexy-bookmarks.php:707
|
| 1351 |
+
msgid "Please update to the latest version"
|
| 1352 |
+
msgstr "Bitte update auf die letzte Version!"
|
| 1353 |
+
|
languages/shrsb-el_EL.mo
ADDED
|
Binary file
|
languages/shrsb-el_EL.po
ADDED
|
@@ -0,0 +1,855 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# Translation of the WordPress plugin by .
|
| 2 |
+
# Copyright (C) 2010
|
| 3 |
+
# This file is distributed under the same license as the package.
|
| 4 |
+
# FIRST AUTHOR <EMAIL@ADDRESS>, 2010.
|
| 5 |
+
#
|
| 6 |
+
msgid ""
|
| 7 |
+
msgstr ""
|
| 8 |
+
"Project-Id-Version: SexyBookmarks v3.2 - Greek Translation\n"
|
| 9 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/sexybookmarks\n"
|
| 10 |
+
"POT-Creation-Date: 2010-12-17 01:00+0000\n"
|
| 11 |
+
"PO-Revision-Date: 2010-12-23 07:40+0200\n"
|
| 12 |
+
"Last-Translator: Mouratidis Nick <mouridis@freemail.gr>\n"
|
| 13 |
+
"Language-Team: www.kepik.gr <info@kepik.gr>\n"
|
| 14 |
+
"MIME-Version: 1.0\n"
|
| 15 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
| 16 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 17 |
+
"X-Poedit-Language: Greek\n"
|
| 18 |
+
"X-Poedit-Country: GREECE\n"
|
| 19 |
+
"X-Poedit-SourceCharset: utf-8\n"
|
| 20 |
+
|
| 21 |
+
#: includes/bookmarks-data.php:21
|
| 22 |
+
#, php-format
|
| 23 |
+
msgid "Check this box to include %s in your bookmarking menu"
|
| 24 |
+
msgstr "Τσεκάρετε αυτό το κουτί για να συμπεριλάβετε το %s στο μενού συντομεύσεων"
|
| 25 |
+
|
| 26 |
+
#: includes/bookmarks-data.php:28
|
| 27 |
+
#: includes/bookmarks-data.php:94
|
| 28 |
+
#: includes/bookmarks-data.php:195
|
| 29 |
+
#: includes/bookmarks-data.php:237
|
| 30 |
+
#: includes/bookmarks-data.php:303
|
| 31 |
+
#: includes/bookmarks-data.php:309
|
| 32 |
+
#: includes/bookmarks-data.php:315
|
| 33 |
+
#: includes/bookmarks-data.php:321
|
| 34 |
+
#: includes/bookmarks-data.php:369
|
| 35 |
+
#: includes/bookmarks-data.php:387
|
| 36 |
+
#: includes/bookmarks-data.php:399
|
| 37 |
+
#: includes/bookmarks-data.php:405
|
| 38 |
+
#: includes/bookmarks-data.php:429
|
| 39 |
+
msgid "Submit this to "
|
| 40 |
+
msgstr "Στείλτο στο "
|
| 41 |
+
|
| 42 |
+
#: includes/bookmarks-data.php:34
|
| 43 |
+
#: includes/bookmarks-data.php:40
|
| 44 |
+
#: includes/bookmarks-data.php:58
|
| 45 |
+
#: includes/bookmarks-data.php:76
|
| 46 |
+
#: includes/bookmarks-data.php:82
|
| 47 |
+
#: includes/bookmarks-data.php:100
|
| 48 |
+
#: includes/bookmarks-data.php:129
|
| 49 |
+
#: includes/bookmarks-data.php:171
|
| 50 |
+
#: includes/bookmarks-data.php:177
|
| 51 |
+
#: includes/bookmarks-data.php:183
|
| 52 |
+
#: includes/bookmarks-data.php:201
|
| 53 |
+
#: includes/bookmarks-data.php:207
|
| 54 |
+
#: includes/bookmarks-data.php:345
|
| 55 |
+
#: includes/bookmarks-data.php:417
|
| 56 |
+
#: includes/bookmarks-data.php:441
|
| 57 |
+
#: includes/bookmarks-data.php:465
|
| 58 |
+
#: includes/bookmarks-data.php:477
|
| 59 |
+
#: includes/bookmarks-data.php:483
|
| 60 |
+
#: includes/bookmarks-data.php:495
|
| 61 |
+
#: includes/bookmarks-data.php:507
|
| 62 |
+
#: includes/bookmarks-data.php:525
|
| 63 |
+
msgid "Share this on "
|
| 64 |
+
msgstr "Μοιράσου το στο "
|
| 65 |
+
|
| 66 |
+
#: includes/bookmarks-data.php:46
|
| 67 |
+
msgid "Digg this!"
|
| 68 |
+
msgstr "Digg-αρέ το!"
|
| 69 |
+
|
| 70 |
+
#: includes/bookmarks-data.php:52
|
| 71 |
+
msgid "Post this on "
|
| 72 |
+
msgstr "Δημοσίευσέ το στο "
|
| 73 |
+
|
| 74 |
+
#: includes/bookmarks-data.php:64
|
| 75 |
+
msgid "Buzz up!"
|
| 76 |
+
msgstr "Buzz-αρέ το!"
|
| 77 |
+
|
| 78 |
+
#: includes/bookmarks-data.php:70
|
| 79 |
+
msgid "Stumble upon something good? Share it on StumbleUpon"
|
| 80 |
+
msgstr "Μοιράσου το στο StumbleUpon!"
|
| 81 |
+
|
| 82 |
+
#: includes/bookmarks-data.php:88
|
| 83 |
+
#: includes/bookmarks-data.php:261
|
| 84 |
+
#: includes/bookmarks-data.php:285
|
| 85 |
+
#: includes/bookmarks-data.php:453
|
| 86 |
+
msgid "Post this to "
|
| 87 |
+
msgstr "Δημοσίευσέ το στο "
|
| 88 |
+
|
| 89 |
+
#: includes/bookmarks-data.php:106
|
| 90 |
+
msgid "Tweet This!"
|
| 91 |
+
msgstr "Tweet-αρέ το!"
|
| 92 |
+
|
| 93 |
+
#: includes/bookmarks-data.php:111
|
| 94 |
+
msgid "an 'Email to a Friend' link"
|
| 95 |
+
msgstr "σύνδεσμο \"Στείλε το σε φίλo με mail\""
|
| 96 |
+
|
| 97 |
+
#: includes/bookmarks-data.php:112
|
| 98 |
+
msgid "Email this to a friend?"
|
| 99 |
+
msgstr "Στείλε το σε φίλο με mail"
|
| 100 |
+
|
| 101 |
+
#: includes/bookmarks-data.php:113
|
| 102 |
+
#: includes/bookmarks-data.php:538
|
| 103 |
+
#: includes/bookmarks-data.php:544
|
| 104 |
+
msgid "(sent via shareaholic)"
|
| 105 |
+
msgstr "(στάλθηκε μέσω shareaholic)"
|
| 106 |
+
|
| 107 |
+
#: includes/bookmarks-data.php:118
|
| 108 |
+
msgid "Suggest this article to "
|
| 109 |
+
msgstr "Πρότεινέ το στο "
|
| 110 |
+
|
| 111 |
+
#: includes/bookmarks-data.php:119
|
| 112 |
+
msgid "New tip submitted via the SexyBookmarks Plugin!"
|
| 113 |
+
msgstr "Νέα συμβουλή, καταχωρημένη μέσω του SexyBookmarks!"
|
| 114 |
+
|
| 115 |
+
#: includes/bookmarks-data.php:122
|
| 116 |
+
msgid "a 'Subscribe to Comments' link"
|
| 117 |
+
msgstr "σύνδεσμο 'Γίνε συνδρομητής στα σχόλια' "
|
| 118 |
+
|
| 119 |
+
#: includes/bookmarks-data.php:123
|
| 120 |
+
#: includes/public.php:138
|
| 121 |
+
msgid "Subscribe to the comments for this post?"
|
| 122 |
+
msgstr "Γίνε συνδρομητής στα σχόλια αυτής της δημοσίευσης"
|
| 123 |
+
|
| 124 |
+
#: includes/bookmarks-data.php:135
|
| 125 |
+
msgid "Seed this on "
|
| 126 |
+
msgstr "Τάισέ το στο "
|
| 127 |
+
|
| 128 |
+
#: includes/bookmarks-data.php:141
|
| 129 |
+
#: includes/bookmarks-data.php:147
|
| 130 |
+
#: includes/bookmarks-data.php:159
|
| 131 |
+
#: includes/bookmarks-data.php:165
|
| 132 |
+
#: includes/bookmarks-data.php:213
|
| 133 |
+
#: includes/bookmarks-data.php:219
|
| 134 |
+
#: includes/bookmarks-data.php:225
|
| 135 |
+
#: includes/bookmarks-data.php:231
|
| 136 |
+
#: includes/bookmarks-data.php:255
|
| 137 |
+
#: includes/bookmarks-data.php:447
|
| 138 |
+
#: includes/bookmarks-data.php:471
|
| 139 |
+
#: includes/bookmarks-data.php:501
|
| 140 |
+
msgid "Add this to "
|
| 141 |
+
msgstr "Πρόσθεσέ το στο "
|
| 142 |
+
|
| 143 |
+
#: includes/bookmarks-data.php:153
|
| 144 |
+
msgid "Post on Google Buzz"
|
| 145 |
+
msgstr "Buzz-αρέ το!"
|
| 146 |
+
|
| 147 |
+
#: includes/bookmarks-data.php:189
|
| 148 |
+
msgid "Mark this on "
|
| 149 |
+
msgstr "Σημείωσέ το στο "
|
| 150 |
+
|
| 151 |
+
#: includes/bookmarks-data.php:206
|
| 152 |
+
#: includes/bookmarks-data.php:212
|
| 153 |
+
#: includes/bookmarks-data.php:218
|
| 154 |
+
#: includes/bookmarks-data.php:224
|
| 155 |
+
#: includes/bookmarks-data.php:230
|
| 156 |
+
msgid " (Russian)"
|
| 157 |
+
msgstr " (Ρώσικο)"
|
| 158 |
+
|
| 159 |
+
#: includes/bookmarks-data.php:243
|
| 160 |
+
msgid "Send this page to "
|
| 161 |
+
msgstr "Στείλε τη σελίδα στο "
|
| 162 |
+
|
| 163 |
+
#: includes/bookmarks-data.php:249
|
| 164 |
+
msgid "Bump this on "
|
| 165 |
+
msgstr "Χτύπα το στο "
|
| 166 |
+
|
| 167 |
+
#: includes/bookmarks-data.php:267
|
| 168 |
+
msgid "Save this to "
|
| 169 |
+
msgstr "Αποθήκευσέ το στο "
|
| 170 |
+
|
| 171 |
+
#: includes/bookmarks-data.php:273
|
| 172 |
+
msgid "Tip this to "
|
| 173 |
+
msgstr "Συμβούλεψε γι' αυτό στο "
|
| 174 |
+
|
| 175 |
+
#: includes/bookmarks-data.php:279
|
| 176 |
+
msgid "Sphinn this on "
|
| 177 |
+
msgstr "Sphinn-αρέ το στο "
|
| 178 |
+
|
| 179 |
+
#: includes/bookmarks-data.php:291
|
| 180 |
+
msgid "Grind this! on "
|
| 181 |
+
msgstr "Grind-αρέ το στο "
|
| 182 |
+
|
| 183 |
+
#: includes/bookmarks-data.php:297
|
| 184 |
+
msgid "Ping this on "
|
| 185 |
+
msgstr "Ping-αρέ το στο "
|
| 186 |
+
|
| 187 |
+
#: includes/bookmarks-data.php:302
|
| 188 |
+
#: includes/bookmarks-data.php:308
|
| 189 |
+
msgid " (Dutch)"
|
| 190 |
+
msgstr " (Ολλανδικό)"
|
| 191 |
+
|
| 192 |
+
#: includes/bookmarks-data.php:327
|
| 193 |
+
msgid "Blend this!"
|
| 194 |
+
msgstr "Ανακάτεψέ το στο Blend!"
|
| 195 |
+
|
| 196 |
+
#: includes/bookmarks-data.php:332
|
| 197 |
+
msgid " (Polish)"
|
| 198 |
+
msgstr "(Πολωνικό)"
|
| 199 |
+
|
| 200 |
+
#: includes/bookmarks-data.php:333
|
| 201 |
+
msgid "Add this to Wykop!"
|
| 202 |
+
msgstr "Προσθεσέ το στο Wykop!"
|
| 203 |
+
|
| 204 |
+
#: includes/bookmarks-data.php:339
|
| 205 |
+
msgid "Engage with this article!"
|
| 206 |
+
msgstr "Συμπλέξου με αυτό στο BlogEngage!"
|
| 207 |
+
|
| 208 |
+
#: includes/bookmarks-data.php:350
|
| 209 |
+
msgid " (Swedish)"
|
| 210 |
+
msgstr " (Σουηδικό)"
|
| 211 |
+
|
| 212 |
+
#: includes/bookmarks-data.php:351
|
| 213 |
+
msgid "Push this on "
|
| 214 |
+
msgstr "Σπρώξ' το στο "
|
| 215 |
+
|
| 216 |
+
#: includes/bookmarks-data.php:356
|
| 217 |
+
msgid " (Japanese)"
|
| 218 |
+
msgstr " (Ιαπωνέζικο)"
|
| 219 |
+
|
| 220 |
+
#: includes/bookmarks-data.php:357
|
| 221 |
+
msgid "Bookmarks this on "
|
| 222 |
+
msgstr "Φτιάξε σελιδοδείκτη γι' αυτό στο "
|
| 223 |
+
|
| 224 |
+
#: includes/bookmarks-data.php:363
|
| 225 |
+
msgid "Store this link on "
|
| 226 |
+
msgstr "Αποθήκευσε τον σύνδεσμο για εδώ στο "
|
| 227 |
+
|
| 228 |
+
#: includes/bookmarks-data.php:375
|
| 229 |
+
msgid "Add to a lense on "
|
| 230 |
+
msgstr "Πρόσθεσέ το σ' ένα φακό στο "
|
| 231 |
+
|
| 232 |
+
#: includes/bookmarks-data.php:381
|
| 233 |
+
msgid "Submit this story to "
|
| 234 |
+
msgstr "Στείλε την ιστορία αυτή στο "
|
| 235 |
+
|
| 236 |
+
#: includes/bookmarks-data.php:393
|
| 237 |
+
msgid "Clip this to "
|
| 238 |
+
msgstr "Σύρραψέ το στο "
|
| 239 |
+
|
| 240 |
+
#: includes/bookmarks-data.php:398
|
| 241 |
+
#: includes/bookmarks-data.php:404
|
| 242 |
+
msgid " (Spanish)"
|
| 243 |
+
msgstr " (Ισπανικό)"
|
| 244 |
+
|
| 245 |
+
#: includes/bookmarks-data.php:411
|
| 246 |
+
msgid "Submit this link to "
|
| 247 |
+
msgstr "Δώσε σύνδεσμο γι' αυτό στο "
|
| 248 |
+
|
| 249 |
+
#: includes/bookmarks-data.php:423
|
| 250 |
+
msgid "Submit tip to "
|
| 251 |
+
msgstr "Συμβούλεψε γι' αυτό στο "
|
| 252 |
+
|
| 253 |
+
#: includes/bookmarks-data.php:435
|
| 254 |
+
msgid "Promote this on "
|
| 255 |
+
msgstr "Προώθησέ το στο "
|
| 256 |
+
|
| 257 |
+
#: includes/bookmarks-data.php:459
|
| 258 |
+
msgid "Blog this on "
|
| 259 |
+
msgstr "Μπλογκάρισε γι' αυτό στο "
|
| 260 |
+
|
| 261 |
+
#: includes/bookmarks-data.php:476
|
| 262 |
+
msgid " (Estonian)"
|
| 263 |
+
msgstr " (Εσθονικό)"
|
| 264 |
+
|
| 265 |
+
#: includes/bookmarks-data.php:489
|
| 266 |
+
msgid "Add this link to "
|
| 267 |
+
msgstr "Πρόσθεσε ένα σύνδεσμο στο "
|
| 268 |
+
|
| 269 |
+
#: includes/bookmarks-data.php:494
|
| 270 |
+
msgid "(Italian)"
|
| 271 |
+
msgstr " (Ιταλικό)"
|
| 272 |
+
|
| 273 |
+
#: includes/bookmarks-data.php:513
|
| 274 |
+
msgid "Spring this on "
|
| 275 |
+
msgstr "Spring-αρέ το στο "
|
| 276 |
+
|
| 277 |
+
#: includes/bookmarks-data.php:519
|
| 278 |
+
msgid "Box this on "
|
| 279 |
+
msgstr "Βάλ' το σε κουτί στο "
|
| 280 |
+
|
| 281 |
+
#: includes/bookmarks-data.php:531
|
| 282 |
+
#: includes/bookmarks-data.php:537
|
| 283 |
+
#: includes/bookmarks-data.php:543
|
| 284 |
+
msgid "Email this via "
|
| 285 |
+
msgstr "Στείλε το ως email μέσω του "
|
| 286 |
+
|
| 287 |
+
#: includes/bookmarks-data.php:532
|
| 288 |
+
msgid "(sent via http://shareaholic.com)"
|
| 289 |
+
msgstr "(απεσταλμένο μέσω του http://shareaholic.com)"
|
| 290 |
+
|
| 291 |
+
#: includes/bookmarks-data.php:549
|
| 292 |
+
msgid "Share this via "
|
| 293 |
+
msgstr "Μοιράσου το μέσω του "
|
| 294 |
+
|
| 295 |
+
#: includes/public.php:515
|
| 296 |
+
msgid "An unknown error occurred in SexyBookmarks"
|
| 297 |
+
msgstr "Ένα άγνωστο σφάλμα προέκυψε στο SexyBookmarks"
|
| 298 |
+
|
| 299 |
+
#: includes/public.php:779
|
| 300 |
+
msgid "SexyBookmarks has been disabled on this page"
|
| 301 |
+
msgstr "Το SexyBookmarks έχει απενεργοποιηθεί σε αυτή τη σελίδα"
|
| 302 |
+
|
| 303 |
+
#: sexy-bookmarks.php:142
|
| 304 |
+
#, php-format
|
| 305 |
+
msgid "NOTICE: Shareaholic needs to be configured... Please visit the %sPlugin Options Page%s and set your preferences."
|
| 306 |
+
msgstr "ΣΗΜΕΙΩΣΗ: Το Shareaholic πρέπει να ρυθμιστεί... Παρακαλώ επισκεφθείτε τη %sΣελίδα Ρυθμίσεων%s και ορίστε τις προτιμήσεις σας."
|
| 307 |
+
|
| 308 |
+
#: sexy-bookmarks.php:194
|
| 309 |
+
msgid "WARNING: You are about to reset all settings to their default state! Do you wish to continue?"
|
| 310 |
+
msgstr "ΠΡΟΣΟΧΗ: Όλες οι επιλογές θα επανέλθουν στην προκαθορισμένη τους ρύθμιση! Είστε σίγουροι ότι θέλετε να συνεχίσετε;"
|
| 311 |
+
|
| 312 |
+
#: sexy-bookmarks.php:198
|
| 313 |
+
#: sexy-bookmarks.php:460
|
| 314 |
+
#: sexy-bookmarks.php:522
|
| 315 |
+
#: sexy-bookmarks.php:673
|
| 316 |
+
#: sexy-bookmarks.php:676
|
| 317 |
+
#: sexy-bookmarks.php:733
|
| 318 |
+
#: sexy-bookmarks.php:814
|
| 319 |
+
msgid "Yes"
|
| 320 |
+
msgstr "Ναι"
|
| 321 |
+
|
| 322 |
+
#: sexy-bookmarks.php:198
|
| 323 |
+
#: sexy-bookmarks.php:522
|
| 324 |
+
msgid "Cancel"
|
| 325 |
+
msgstr "Ακύρωση"
|
| 326 |
+
|
| 327 |
+
#: sexy-bookmarks.php:240
|
| 328 |
+
msgid "All settings have been reset to their default values."
|
| 329 |
+
msgstr "Όλες οι ρυθμίσεις επανήλθαν στις προκαθορισμένες τιμές τους."
|
| 330 |
+
|
| 331 |
+
#: sexy-bookmarks.php:284
|
| 332 |
+
msgid "Your changes have been saved successfully!"
|
| 333 |
+
msgstr "Οι αλλαγές σας αποθηκεύτηκαν επιτυχώς!"
|
| 334 |
+
|
| 335 |
+
#: sexy-bookmarks.php:287
|
| 336 |
+
msgid "Please choose where you would like the menu to be displayed."
|
| 337 |
+
msgstr "Παρακαλώ επιλέξτε την θέση όπου θέλετε να εμφανίζεται το μενού."
|
| 338 |
+
|
| 339 |
+
#: sexy-bookmarks.php:288
|
| 340 |
+
msgid "You can't display the menu if you don't choose a few sites to add to it!"
|
| 341 |
+
msgstr "Η εμφάνιση του μενού δεν είναι δυνατή αν δεν επιλέξετε κάποιες από τις διαθέσιμες υπηρεσίες!"
|
| 342 |
+
|
| 343 |
+
#: sexy-bookmarks.php:289
|
| 344 |
+
msgid "Please choose where you want the menu displayed."
|
| 345 |
+
msgstr "Παρακαλώ επιλέξτε την θέση όπου θέλετε να εμφανίζεται το μενού."
|
| 346 |
+
|
| 347 |
+
#: sexy-bookmarks.php:304
|
| 348 |
+
#, php-format
|
| 349 |
+
msgid "You must first download and activate the %sTwitter Friendly Links Plugin%s before hosting your own short URLs..."
|
| 350 |
+
msgstr "Για να είστε σε θέση να εκδίδετε τα δικά σας σύντομα URL, θα πρέπει πρώτα να κατεβάσετε και να ενεργοποιήσετε το πρόσθετο %sTwitter Friendly Links%s..."
|
| 351 |
+
|
| 352 |
+
#: sexy-bookmarks.php:306
|
| 353 |
+
#, php-format
|
| 354 |
+
msgid "You must first download and activate the %sYOURLS Plugin%s before hosting your own short URLs..."
|
| 355 |
+
msgstr "Για να είστε σε θέση να εκδίδετε τα δικά σας σύντομα URL, θα πρέπει πρώτα να κατεβάσετε και να ενεργοποιήσετε το πρόσθετο %sYOURLS%s..."
|
| 356 |
+
|
| 357 |
+
#: sexy-bookmarks.php:323
|
| 358 |
+
msgid "WARNING: The request for a custom sprite has timed out. Reverting to default sprite files."
|
| 359 |
+
msgstr "ΠΡΟΣΟΧΗ: Το αίτημα για ένα προσωποποιημένο εικονίδιο καθυστέρησε υπερβολικά. Έγινε επαναφορά στα προκαθορισμένα αρχεία εικονιδίων."
|
| 360 |
+
|
| 361 |
+
#: sexy-bookmarks.php:325
|
| 362 |
+
msgid "Changes saved successfully. However, you should try to generate a custom sprite again later."
|
| 363 |
+
msgstr "Οι αλλαγές αποθηκεύτηκαν επιτυχώς. Ωστόσο, θα πρέπει να δοκιμάσετε να δημιουργήσετε ένα προσωποποιημένο εικονίδιο ξανά αργότερα."
|
| 364 |
+
|
| 365 |
+
#: sexy-bookmarks.php:329
|
| 366 |
+
#: sexy-bookmarks.php:351
|
| 367 |
+
#, php-format
|
| 368 |
+
msgid "WARNING: Your %sspritegen folder%s is not writeable by the server! %sNeed Help?%s"
|
| 369 |
+
msgstr "ΠΡΟΕΙΔΟΠΟΙΗΣΗ: Ο server δεν έχει δικαιώματα εγγραφής στον %sφάκελο spritegen%s! %sΧρειάζεστε βοήθεια;%s"
|
| 370 |
+
|
| 371 |
+
#: sexy-bookmarks.php:331
|
| 372 |
+
#: sexy-bookmarks.php:336
|
| 373 |
+
#: sexy-bookmarks.php:341
|
| 374 |
+
#: sexy-bookmarks.php:352
|
| 375 |
+
#: sexy-bookmarks.php:356
|
| 376 |
+
#: sexy-bookmarks.php:360
|
| 377 |
+
msgid "Changes saved successfully. However, settings are not optimal until you resolve the issue listed above."
|
| 378 |
+
msgstr "Οι αλλαγές αποθηκεύτηκαν με επιτυχία. Ωστόσο, οι ρυθμίσεις θα είναι προβληματικές μέχρι να λύσετε τα ζητήματα που αναφέρονται παραπάνω."
|
| 379 |
+
|
| 380 |
+
#: sexy-bookmarks.php:334
|
| 381 |
+
#: sexy-bookmarks.php:355
|
| 382 |
+
#, php-format
|
| 383 |
+
msgid "WARNING: You need to delete the current custom sprite %s before the plugin can write to the folder. %sNeed Help?%s"
|
| 384 |
+
msgstr "ΠΡΟΕΙΔΟΠΟΙΗΣΗ: Για να μπορέσει το πρόσθετο να γράψει στον φάκελο θα πρέπει πρώτα να διαγράψετε το τρέχον προσαρμοσμένο στοιχείο %s. %sΧρειάζεστε βοήθεια;%s"
|
| 385 |
+
|
| 386 |
+
#: sexy-bookmarks.php:339
|
| 387 |
+
#: sexy-bookmarks.php:359
|
| 388 |
+
#, php-format
|
| 389 |
+
msgid "WARNING: You need to delete the current custom stylesheet %s before the plugin can write to the folder. %sNeed Help?%s"
|
| 390 |
+
msgstr "ΠΡΟΕΙΔΟΠΟΙΗΣΗ: Για να μπορέσει το πρόσθετο να γράψει στον φάκελο θα πρέπει πρώτα να διαγράψετε το τρέχον προσαρμοσμένο φύλλο στυλ %s. %sΧρειάζεστε βοήθεια;%s"
|
| 391 |
+
|
| 392 |
+
#: sexy-bookmarks.php:366
|
| 393 |
+
msgid "Short URL(s) have been reset."
|
| 394 |
+
msgstr "Τα σύντομα URL επαναπροσδιορίστηκαν."
|
| 395 |
+
|
| 396 |
+
#: sexy-bookmarks.php:453
|
| 397 |
+
msgid "BETA Testing"
|
| 398 |
+
msgstr "Δοκιμή BETA"
|
| 399 |
+
|
| 400 |
+
#: sexy-bookmarks.php:458
|
| 401 |
+
msgid "We completely re-wrote SexyBookmarks from the ground up to make it faster, leaner, better."
|
| 402 |
+
msgstr "Καθίσαμε και επαναπρογραμματίσαμε το SexyBookmarks από την αρχή για να το κάνουμε ταχύτερο, καθαρότερο, καλύτερο."
|
| 403 |
+
|
| 404 |
+
#: sexy-bookmarks.php:459
|
| 405 |
+
msgid "Use the new version? (BETA)"
|
| 406 |
+
msgstr "Να χρησιμοποιηθεί η νέα έκδοση; (BETA)"
|
| 407 |
+
|
| 408 |
+
#: sexy-bookmarks.php:461
|
| 409 |
+
#: sexy-bookmarks.php:674
|
| 410 |
+
#: sexy-bookmarks.php:677
|
| 411 |
+
#: sexy-bookmarks.php:734
|
| 412 |
+
#: sexy-bookmarks.php:738
|
| 413 |
+
#: sexy-bookmarks.php:815
|
| 414 |
+
msgid "No"
|
| 415 |
+
msgstr "Όχι"
|
| 416 |
+
|
| 417 |
+
#: sexy-bookmarks.php:462
|
| 418 |
+
msgid "You can switch back at any time."
|
| 419 |
+
msgstr "Μπορείτε να αλλάξετε πάλι την επιλογή σας όποτε θέλετε."
|
| 420 |
+
|
| 421 |
+
#: sexy-bookmarks.php:466
|
| 422 |
+
#, php-format
|
| 423 |
+
msgid "We are anxious to hear what you think! If you would like to leave us some feedback, please follow %sthis link%s and share your thoughts and opinions with us."
|
| 424 |
+
msgstr "Ανυπομονούμε να ακούσουμε τη γνώμη σας! Αν θέλετε να μας αφήσετε τα σχόλιά σας, παρακαλούμε ακολουθήστε %sαυτόν τον σύνδεσμο%s για να μοιραστείτε μαζί μας τις σκέψεις και τις απόψεις σας."
|
| 425 |
+
|
| 426 |
+
#: sexy-bookmarks.php:472
|
| 427 |
+
msgid "Enabled Networks"
|
| 428 |
+
msgstr "Ενεργοποιημένες Υπηρεσίες"
|
| 429 |
+
|
| 430 |
+
#: sexy-bookmarks.php:476
|
| 431 |
+
msgid "Select the Networks to display. Drag to reorder."
|
| 432 |
+
msgstr "Επιλέξτε τις Υπηρεσίες που θέλετε να εμφανίζονται. Σύρετε τα εικονίδια για να τις ταξινομήσετε."
|
| 433 |
+
|
| 434 |
+
#: sexy-bookmarks.php:478
|
| 435 |
+
msgid "Select"
|
| 436 |
+
msgstr "Επιλογή"
|
| 437 |
+
|
| 438 |
+
#: sexy-bookmarks.php:479
|
| 439 |
+
msgid "All"
|
| 440 |
+
msgstr "Όλες"
|
| 441 |
+
|
| 442 |
+
#: sexy-bookmarks.php:480
|
| 443 |
+
msgid "None"
|
| 444 |
+
msgstr "Καμία"
|
| 445 |
+
|
| 446 |
+
#: sexy-bookmarks.php:481
|
| 447 |
+
msgid "Most Popular"
|
| 448 |
+
msgstr "Πλέον Δημοφιλείς"
|
| 449 |
+
|
| 450 |
+
#: sexy-bookmarks.php:491
|
| 451 |
+
msgid "Made with Much Love, these Icons are © Shareaholic"
|
| 452 |
+
msgstr "Φτιαγμένα με Πολλή Αγάπη, αυτά τα Εικονίδια είναι © Shareaholic"
|
| 453 |
+
|
| 454 |
+
#: sexy-bookmarks.php:496
|
| 455 |
+
msgid "Functionality Settings"
|
| 456 |
+
msgstr "Ρυθμίσεις Λειτουργικότητας"
|
| 457 |
+
|
| 458 |
+
#: sexy-bookmarks.php:502
|
| 459 |
+
msgid "Twitter Options:"
|
| 460 |
+
msgstr "Ρυθμίσεις Twitter:"
|
| 461 |
+
|
| 462 |
+
#: sexy-bookmarks.php:504
|
| 463 |
+
msgid "Configuration Instructions:"
|
| 464 |
+
msgstr "Οδηγίες Ρύθμισης:"
|
| 465 |
+
|
| 466 |
+
#: sexy-bookmarks.php:505
|
| 467 |
+
#, php-format
|
| 468 |
+
msgid "Using the strings %s and %s you can fully customize your tweet output."
|
| 469 |
+
msgstr "Χρησιμοποιώντας τα αλφαριθμητικά %s και %s μπορείτε να προσαρμόσετε πλήρως την μορφή του tweet σας."
|
| 470 |
+
|
| 471 |
+
#: sexy-bookmarks.php:506
|
| 472 |
+
msgid "Example Configurations:"
|
| 473 |
+
msgstr "Παράδειγμα Ρύθμισης:"
|
| 474 |
+
|
| 475 |
+
#: sexy-bookmarks.php:508
|
| 476 |
+
msgid "or"
|
| 477 |
+
msgstr "ή"
|
| 478 |
+
|
| 479 |
+
#: sexy-bookmarks.php:512
|
| 480 |
+
msgid "Configure Custom Tweet Template:"
|
| 481 |
+
msgstr "Ρύθμιση Προσαρμοσμένου Προτύπου Tweet:"
|
| 482 |
+
|
| 483 |
+
#: sexy-bookmarks.php:512
|
| 484 |
+
msgid "Characters:"
|
| 485 |
+
msgstr "Χαρακτήρες:"
|
| 486 |
+
|
| 487 |
+
#: sexy-bookmarks.php:515
|
| 488 |
+
msgid "Example Tweet Output:"
|
| 489 |
+
msgstr "Παράδειγμα εμφάνισης Tweet:"
|
| 490 |
+
|
| 491 |
+
#: sexy-bookmarks.php:519
|
| 492 |
+
#, php-format
|
| 493 |
+
msgid "This will clear %sALL%s short URLs. - Are you sure?"
|
| 494 |
+
msgstr "Αυτό θα διαγράψει %sΟΛΑ%s τα σύντομα URL. - Είστε σίγουρος?"
|
| 495 |
+
|
| 496 |
+
#: sexy-bookmarks.php:526
|
| 497 |
+
msgid "Which URL Shortener?"
|
| 498 |
+
msgstr "Ποιά υπηρεσία συντόμευσης URL θέλετε;"
|
| 499 |
+
|
| 500 |
+
#: sexy-bookmarks.php:531
|
| 501 |
+
msgid "Don't use a shortener"
|
| 502 |
+
msgstr "Χωρίς συντόμευση URL"
|
| 503 |
+
|
| 504 |
+
#: sexy-bookmarks.php:545
|
| 505 |
+
msgid "Reset all Short URLs"
|
| 506 |
+
msgstr "Επαναφορά όλων των συντομευμένων URL"
|
| 507 |
+
|
| 508 |
+
#: sexy-bookmarks.php:548
|
| 509 |
+
#: sexy-bookmarks.php:560
|
| 510 |
+
#: sexy-bookmarks.php:569
|
| 511 |
+
#: sexy-bookmarks.php:581
|
| 512 |
+
#: sexy-bookmarks.php:601
|
| 513 |
+
msgid "User ID:"
|
| 514 |
+
msgstr "User ID:"
|
| 515 |
+
|
| 516 |
+
#: sexy-bookmarks.php:550
|
| 517 |
+
#: sexy-bookmarks.php:571
|
| 518 |
+
#: sexy-bookmarks.php:591
|
| 519 |
+
#: sexy-bookmarks.php:603
|
| 520 |
+
msgid "API Key:"
|
| 521 |
+
msgstr "API Key:"
|
| 522 |
+
|
| 523 |
+
#: sexy-bookmarks.php:556
|
| 524 |
+
#: sexy-bookmarks.php:577
|
| 525 |
+
#: sexy-bookmarks.php:587
|
| 526 |
+
#: sexy-bookmarks.php:597
|
| 527 |
+
msgid "Track Generated Links?"
|
| 528 |
+
msgstr "Παρακολούθηση των Παραγόμενων Συνδέσμων;"
|
| 529 |
+
|
| 530 |
+
#: sexy-bookmarks.php:562
|
| 531 |
+
msgid "Password:"
|
| 532 |
+
msgstr "Συνθηματικό:"
|
| 533 |
+
|
| 534 |
+
#: sexy-bookmarks.php:610
|
| 535 |
+
msgid "Yahoo! Buzz Defaults:"
|
| 536 |
+
msgstr "Προκαθορισμένες Ρυθμίσεις Yahoo! Buzz:"
|
| 537 |
+
|
| 538 |
+
#: sexy-bookmarks.php:611
|
| 539 |
+
msgid "Default Content Category:"
|
| 540 |
+
msgstr "Προκαθορισμένη Κατηγορία Περιεχομένου:"
|
| 541 |
+
|
| 542 |
+
#: sexy-bookmarks.php:630
|
| 543 |
+
msgid "Default Media Type:"
|
| 544 |
+
msgstr "Προκαθορισμένος Τύπος Μέσου:"
|
| 545 |
+
|
| 546 |
+
#: sexy-bookmarks.php:644
|
| 547 |
+
msgid "Twittley Defaults:"
|
| 548 |
+
msgstr "Προκαθορισμένες Ρυθμίσεις Twittley:"
|
| 549 |
+
|
| 550 |
+
#: sexy-bookmarks.php:645
|
| 551 |
+
msgid "Primary Content Category:"
|
| 552 |
+
msgstr "Πρωτεύουσα Κατηγορία Περιεχομένου:"
|
| 553 |
+
|
| 554 |
+
#: sexy-bookmarks.php:649
|
| 555 |
+
msgid "Technology"
|
| 556 |
+
msgstr "Technology"
|
| 557 |
+
|
| 558 |
+
#: sexy-bookmarks.php:650
|
| 559 |
+
msgid "World & Business"
|
| 560 |
+
msgstr "World & Business"
|
| 561 |
+
|
| 562 |
+
#: sexy-bookmarks.php:651
|
| 563 |
+
msgid "Science"
|
| 564 |
+
msgstr "Science"
|
| 565 |
+
|
| 566 |
+
#: sexy-bookmarks.php:652
|
| 567 |
+
msgid "Gaming"
|
| 568 |
+
msgstr "Gaming"
|
| 569 |
+
|
| 570 |
+
#: sexy-bookmarks.php:653
|
| 571 |
+
msgid "Lifestyle"
|
| 572 |
+
msgstr "Lifestyle"
|
| 573 |
+
|
| 574 |
+
#: sexy-bookmarks.php:654
|
| 575 |
+
msgid "Entertainment"
|
| 576 |
+
msgstr "Entertainment"
|
| 577 |
+
|
| 578 |
+
#: sexy-bookmarks.php:655
|
| 579 |
+
msgid "Sports"
|
| 580 |
+
msgstr "Sports"
|
| 581 |
+
|
| 582 |
+
#: sexy-bookmarks.php:656
|
| 583 |
+
msgid "Offbeat"
|
| 584 |
+
msgstr "Offbeat"
|
| 585 |
+
|
| 586 |
+
#: sexy-bookmarks.php:657
|
| 587 |
+
msgid "Internet"
|
| 588 |
+
msgstr "Internet"
|
| 589 |
+
|
| 590 |
+
#: sexy-bookmarks.php:663
|
| 591 |
+
msgid "Enter a comma separated list of general tags which describe your site's posts as a whole. Try not to be too specific, as one post may fall into different *tag categories* than other posts."
|
| 592 |
+
msgstr "Εισάγετε μια λίστα γενικών ετικετών (χωρισμένες με κόμματα), οι οποίες περιγράφουν το σύνολο των δημοσιεύσεων του ιστοτόπου σας. Προσπαθήστε να μην είστε ιδιαίτερα συγκεκριμένος, καθώς κάποιες δημοσιεύσεις μπορεί να κατηγοριοποιούνται με διαφορετικές ετικέτες."
|
| 593 |
+
|
| 594 |
+
#: sexy-bookmarks.php:664
|
| 595 |
+
msgid "This list is primarily used as a failsafe in case you forget to enter WordPress tags for a particular post, in which case this list of tags would be used so as to bring at least *somewhat* relevant search queries based on the general tags that you enter here."
|
| 596 |
+
msgstr "Αυτή η λίστα χρησιμεύει κυρίως σαν προστασία, στην περίπτωση που ξεχάσετε να εισάγετε ετικέτες του WordPress σε κάποια δημοσίευση. Σε τέτοια περίπτωση, θα χρησιμοποιηθεί αυτή η λίστα ετικετών ώστε να δρομολογηθούν προς τη δημοσίευση έστω οι *κάπως* σχετικές αναζητήσεις."
|
| 597 |
+
|
| 598 |
+
#: sexy-bookmarks.php:664
|
| 599 |
+
msgid "Click here to close this message"
|
| 600 |
+
msgstr "Κάντε κλικ εδώ για να κλείσετε αυτό το μήνυμα"
|
| 601 |
+
|
| 602 |
+
#: sexy-bookmarks.php:664
|
| 603 |
+
msgid "close"
|
| 604 |
+
msgstr "κλείσιμο"
|
| 605 |
+
|
| 606 |
+
#: sexy-bookmarks.php:666
|
| 607 |
+
msgid "Default Tags:"
|
| 608 |
+
msgstr "Προκαθορισμένες Ετικέτες:"
|
| 609 |
+
|
| 610 |
+
#: sexy-bookmarks.php:667
|
| 611 |
+
#: sexy-bookmarks.php:812
|
| 612 |
+
msgid "Click here for help with this option"
|
| 613 |
+
msgstr "Κάντε κλικ εδώ για χρήσιμες πληροφορίες σχετικά με αυτή την επιλογή"
|
| 614 |
+
|
| 615 |
+
#: sexy-bookmarks.php:671
|
| 616 |
+
msgid "General Functionality Options:"
|
| 617 |
+
msgstr "Γενικές Ρυθμίσεις Λειτουργικότητας:"
|
| 618 |
+
|
| 619 |
+
#: sexy-bookmarks.php:672
|
| 620 |
+
msgid "Add nofollow to the links?"
|
| 621 |
+
msgstr "Προσθήκη nofollow στους συνδέσμους;"
|
| 622 |
+
|
| 623 |
+
#: sexy-bookmarks.php:675
|
| 624 |
+
msgid "Open links in new window?"
|
| 625 |
+
msgstr "Άνοιγμα συνδέσμων σε νέο παράθυρο;"
|
| 626 |
+
|
| 627 |
+
#: sexy-bookmarks.php:684
|
| 628 |
+
msgid "Plugin Aesthetics"
|
| 629 |
+
msgstr "Αισθητική Πρόσθετου"
|
| 630 |
+
|
| 631 |
+
#: sexy-bookmarks.php:689
|
| 632 |
+
msgid "Warning!"
|
| 633 |
+
msgstr "Προσοχή!"
|
| 634 |
+
|
| 635 |
+
#: sexy-bookmarks.php:690
|
| 636 |
+
msgid "This option is intended %STRICTLY%s for users who understand how to edit CSS/JS and intend to change/edit the associated images themselves. Unfortunately, no support will be offered for this feature, as I cannot be held accountable for your coding and/or image editing mistakes."
|
| 637 |
+
msgstr "Αυτή η ρύθμιση προορίζεται %ΑΥΣΤΗΡΑ%s για χρήστες που γνωρίζουν από επεξεργασία CSS/JS και επιθυμούν να αλλάξουν/επεξεργαστούν τις σχετικές εικόνες οι ίδιοι. Δυστυχώς, για αυτό το χαρακτηριστικό δεν μπορώ να προσφέρω κανενός είδους υποστήριξη, καθώς δεν μπορώ να επωμιστώ τις ευθύνες για τυχόντα δικά σας λάθη προγραμματισμού ή επεξεργασίας εικόνας."
|
| 638 |
+
|
| 639 |
+
#: sexy-bookmarks.php:691
|
| 640 |
+
msgid "How it works..."
|
| 641 |
+
msgstr "Τρόπος λειτουργίας..."
|
| 642 |
+
|
| 643 |
+
#: sexy-bookmarks.php:692
|
| 644 |
+
msgid "Since you have chosen for the plugin to override the style settings with your own custom mods, it will now pull the files from the new folders it is going to create on your server as soon as you save your changes. The file/folder locations should be as follows:"
|
| 645 |
+
msgstr "Εφόσον επιλέξατε το πρόσθετο να παρακάμπτει τις ρυθμίσεις στυλ με τις δικές σας ειδικές αλλαγές, η ανάκτηση των αρχείων θα γίνεται πλέον από τους νέους φακέλους που θα δημιουργηθούν στον διακομιστή την στιγμή που θα αποθηκεύσετε τις αλλαγές. Οι τοποθεσίες αρχείων/φακέλων θα πρέπει να είναι οι εξής:"
|
| 646 |
+
|
| 647 |
+
#: sexy-bookmarks.php:709
|
| 648 |
+
msgid "Once you have saved your changes, you will be able to edit the image sprite that holds all of the icons for SexyBookmarks as well as the CSS which accompanies it. Just be sure that you do in fact edit the CSS if you edit the images, as it is unlikely the heights, widths, and background positions of the images will stay the same after you are done."
|
| 649 |
+
msgstr "Όταν θα αποθηκεύσετε τις αλλαγές, θα μπορείτε να επεξεργαστείτε την εικόνα που περιέχει όλα τα εικονίδια του SexyBookmarks, καθώς και τον κώδικα CSS που την συνοδεύει. Απλά, κανονίστε να κάνετε όντως τις απαραίτητες αλλαγές στον κώδικα CSS, μιας και είναι αρκετά απίθανο ότι τα ύψη, τα πλάτη και οι θέσεις φόντου των εικόνων θα παραμείνουν οι ίδιες μετά τις αλλαγές."
|
| 650 |
+
|
| 651 |
+
#: sexy-bookmarks.php:710
|
| 652 |
+
msgid "Just a quick note... When you edit the styles and images to include your own custom backgrounds, icons, and CSS styles, be aware that those changes will not be reflected on the plugin options page. In other words: when you select your networks to be displayed, or when you select the background image to use, it will still be displaying the images from the original plugin directory."
|
| 653 |
+
msgstr "Μια σύντομη παρατήρηση... Όταν επεξεργαστείτε τα στυλ και τις εικόνες, ώστε να συμπεριλάβετε τα δικά σας εικονίδια και CSS στυλ, έχετε κατά νου ότι αυτές οι αλλαγές δεν θα αντικατοπτριστούν και στην σελίδα ρυθμίσεων του πρόσθετου. Με άλλα λόγια: όταν επιλέγετε τις υπηρεσίες που θέλετε να εμφανίζονται ή όταν επιλέγετε την εικόνα φόντου που θέλετε να χρησιμοποιηθεί, το πρόσθετο θα συνεχίσει να εμφανίζει τις εικόνες από τον προκαθορισμένο φάκελο του πρόσθετου."
|
| 654 |
+
|
| 655 |
+
#: sexy-bookmarks.php:711
|
| 656 |
+
msgid "In Case of Emergency"
|
| 657 |
+
msgstr "Σε Επείγουσα Περίπτωση"
|
| 658 |
+
|
| 659 |
+
#: sexy-bookmarks.php:712
|
| 660 |
+
msgid "If you happen to mess things up, you can follow these directions to reset the plugin back to normal and try again if you wish:"
|
| 661 |
+
msgstr "Αν τα κάνετε όλα άνω-κάτω, μπορείτε να ακολουθήσετε αυτές τις οδηγίες για να επαναφέρετε το πρόσθετο στην κανονική λειτουργία και -αν θέλετε- να δοκιμάσετε ξανά:"
|
| 662 |
+
|
| 663 |
+
#: sexy-bookmarks.php:714
|
| 664 |
+
msgid "Login to your server via FTP or SSH. (whichever you are more comfortable with)"
|
| 665 |
+
msgstr "Συνδεθείτε στον διακομιστή σας μέσω FTP ή SSH. (όποιο σας βολεύει)"
|
| 666 |
+
|
| 667 |
+
#: sexy-bookmarks.php:715
|
| 668 |
+
msgid "Navigate to your wp-content directory."
|
| 669 |
+
msgstr "Πλοηγηθείτε μέχρι τον φάκελο wp-content."
|
| 670 |
+
|
| 671 |
+
#: sexy-bookmarks.php:716
|
| 672 |
+
msgid "Delete the directory named \"sexy-mods\"."
|
| 673 |
+
msgstr "Διαγράψτε τον φάκελο με όνομα \"sexy-mods\"."
|
| 674 |
+
|
| 675 |
+
#: sexy-bookmarks.php:717
|
| 676 |
+
msgid "Login to your WordPress dashboard."
|
| 677 |
+
msgstr "Συνδεθείτε στον Πίνακα Ελέγχου του WordPress."
|
| 678 |
+
|
| 679 |
+
#: sexy-bookmarks.php:718
|
| 680 |
+
msgid "Go to the SexyBookmarks plugin options page. (Settings->SexyBookmarks)"
|
| 681 |
+
msgstr "Πηγαίνετε στην σελίδα ρυθμίσεων του SexyBookmarks. (Ρυθμίσεις -> SexyBookmarks)"
|
| 682 |
+
|
| 683 |
+
#: sexy-bookmarks.php:719
|
| 684 |
+
msgid "Deselect the \"Use custom mods\" option."
|
| 685 |
+
msgstr "Απενεργοποιήστε την επιλογή \"Χρήση προσωποποιημένων αλλαγών\""
|
| 686 |
+
|
| 687 |
+
#: sexy-bookmarks.php:720
|
| 688 |
+
msgid "Save your changes."
|
| 689 |
+
msgstr "Αποθηκεύστε τις αλλαγές."
|
| 690 |
+
|
| 691 |
+
#: sexy-bookmarks.php:722
|
| 692 |
+
msgid "Close Message"
|
| 693 |
+
msgstr "Κλείσιμο Μηνύματος"
|
| 694 |
+
|
| 695 |
+
#: sexy-bookmarks.php:726
|
| 696 |
+
msgid "Override Styles With Custom Mods Instead?"
|
| 697 |
+
msgstr "Παράκαμψη Στυλ με Προσωποποιημένες Αλλαγές;"
|
| 698 |
+
|
| 699 |
+
#: sexy-bookmarks.php:731
|
| 700 |
+
msgid "jQuery Related Options"
|
| 701 |
+
msgstr "Ρυθμίσεις Σχετικές με jQuery"
|
| 702 |
+
|
| 703 |
+
#: sexy-bookmarks.php:732
|
| 704 |
+
msgid "Animate-expand multi-lined bookmarks?"
|
| 705 |
+
msgstr "Επέκταση των μενού πολλαπλών γραμμών με κίνηση (animation);"
|
| 706 |
+
|
| 707 |
+
#: sexy-bookmarks.php:735
|
| 708 |
+
msgid "Auto-space/center the bookmarks?"
|
| 709 |
+
msgstr "Αυτόματη ρύθμιση διαστήματος/κεντραρίσματος των εικονιδίων;"
|
| 710 |
+
|
| 711 |
+
#: sexy-bookmarks.php:736
|
| 712 |
+
msgid "Space"
|
| 713 |
+
msgstr "Διάστημα"
|
| 714 |
+
|
| 715 |
+
#: sexy-bookmarks.php:737
|
| 716 |
+
msgid "Center"
|
| 717 |
+
msgstr "Κέντρο"
|
| 718 |
+
|
| 719 |
+
#: sexy-bookmarks.php:739
|
| 720 |
+
msgid "jQuery Compatibility Fix"
|
| 721 |
+
msgstr "Διόρθωση Συμβατότητας jQuery"
|
| 722 |
+
|
| 723 |
+
#: sexy-bookmarks.php:740
|
| 724 |
+
msgid "Check this box ONLY if you notice jQuery being loaded twice in your source code!"
|
| 725 |
+
msgstr "Κάντε την επιλογή ΜΟΝΟ αν παρατηρήσετε ότι το jQuery φορτώνεται δύο φορές στον κώδικα της σελίδας σας!"
|
| 726 |
+
|
| 727 |
+
#: sexy-bookmarks.php:742
|
| 728 |
+
msgid "Load scripts in Footer"
|
| 729 |
+
msgstr "Φόρτωση των script στο υποσέλιδο"
|
| 730 |
+
|
| 731 |
+
#: sexy-bookmarks.php:743
|
| 732 |
+
msgid "Check this box if you want the SexyBookmarks javascript to be loaded in your blog's footer."
|
| 733 |
+
msgstr "Κάντε την επιλογή αν θέλετε ο κώδικας javascript του SexyBookmarks να φορτώνεται στο υποσέλιδο του ιστολογίου σας."
|
| 734 |
+
|
| 735 |
+
#: sexy-bookmarks.php:745
|
| 736 |
+
msgid "Background Image Options"
|
| 737 |
+
msgstr "Επιλογές Εικόνας Φόντου"
|
| 738 |
+
|
| 739 |
+
#: sexy-bookmarks.php:747
|
| 740 |
+
msgid "Use a background image?"
|
| 741 |
+
msgstr "Χρήση εικόνας φόντου;"
|
| 742 |
+
|
| 743 |
+
#: sexy-bookmarks.php:780
|
| 744 |
+
msgid "Menu Placement"
|
| 745 |
+
msgstr "Τοποθέτηση Μενού"
|
| 746 |
+
|
| 747 |
+
#: sexy-bookmarks.php:786
|
| 748 |
+
#, php-format
|
| 749 |
+
msgid "Need help with this? Find it in the %sofficial install guide%s."
|
| 750 |
+
msgstr "Χρειάζεστε βοήθεια με αυτό; Βρείτε την στον %sεπίσημο οδηγό εγκατάστασης%s."
|
| 751 |
+
|
| 752 |
+
#: sexy-bookmarks.php:792
|
| 753 |
+
msgid "Menu Location (in relation to content):"
|
| 754 |
+
msgstr "Τοποθεσία Μενού (σε σχέση με το περιεχόμενο):"
|
| 755 |
+
|
| 756 |
+
#: sexy-bookmarks.php:793
|
| 757 |
+
msgid "Above Content"
|
| 758 |
+
msgstr "Πάνω από το Περιεχόμενο"
|
| 759 |
+
|
| 760 |
+
#: sexy-bookmarks.php:794
|
| 761 |
+
msgid "Below Content"
|
| 762 |
+
msgstr "Κάτω από το Περιεχόμενο"
|
| 763 |
+
|
| 764 |
+
#: sexy-bookmarks.php:795
|
| 765 |
+
msgid "Above & Below Content"
|
| 766 |
+
msgstr "Πάνω & Κάτω από το Περιεχόμενο"
|
| 767 |
+
|
| 768 |
+
#: sexy-bookmarks.php:796
|
| 769 |
+
msgid "Manual Mode"
|
| 770 |
+
msgstr "Χειροκίνητα"
|
| 771 |
+
|
| 772 |
+
#: sexy-bookmarks.php:797
|
| 773 |
+
msgid "Posts, pages, or the whole shebang?"
|
| 774 |
+
msgstr "Σε τι είδος περιεχομένου;"
|
| 775 |
+
|
| 776 |
+
#: sexy-bookmarks.php:802
|
| 777 |
+
msgid "Posts Only"
|
| 778 |
+
msgstr "Μόνο σε Άρθρα"
|
| 779 |
+
|
| 780 |
+
#: sexy-bookmarks.php:803
|
| 781 |
+
msgid "Pages Only"
|
| 782 |
+
msgstr "Μόνο σε Σελίδες"
|
| 783 |
+
|
| 784 |
+
#: sexy-bookmarks.php:804
|
| 785 |
+
msgid "Index Only"
|
| 786 |
+
msgstr "Μόνο σε Ευρετήρια"
|
| 787 |
+
|
| 788 |
+
#: sexy-bookmarks.php:805
|
| 789 |
+
msgid "Posts & Pages"
|
| 790 |
+
msgstr "Άρθρα & Σελίδες"
|
| 791 |
+
|
| 792 |
+
#: sexy-bookmarks.php:806
|
| 793 |
+
msgid "Posts & Index"
|
| 794 |
+
msgstr "Άρθρα & Ευρετήρια"
|
| 795 |
+
|
| 796 |
+
#: sexy-bookmarks.php:807
|
| 797 |
+
msgid "Pages & Index"
|
| 798 |
+
msgstr "Σελίδες & Ευρετήρια"
|
| 799 |
+
|
| 800 |
+
#: sexy-bookmarks.php:808
|
| 801 |
+
msgid "Posts, Pages, & Index"
|
| 802 |
+
msgstr "Άρθρα, Σελίδες, & Ευρετήρια"
|
| 803 |
+
|
| 804 |
+
#: sexy-bookmarks.php:813
|
| 805 |
+
msgid "Show in RSS feed?"
|
| 806 |
+
msgstr "Εμφάνιση στο RSS feed;"
|
| 807 |
+
|
| 808 |
+
#: sexy-bookmarks.php:817
|
| 809 |
+
msgid "Hide menu from mobile browsers?"
|
| 810 |
+
msgstr "Απόκρυψη του μενού από browser φορητών συσκευών;"
|
| 811 |
+
|
| 812 |
+
#: sexy-bookmarks.php:826
|
| 813 |
+
msgid "Save Changes"
|
| 814 |
+
msgstr "Αποθήκευση Αλλαγών"
|
| 815 |
+
|
| 816 |
+
#: sexy-bookmarks.php:830
|
| 817 |
+
msgid "Reset Settings"
|
| 818 |
+
msgstr "Επαναφορά Ρυθμίσεων"
|
| 819 |
+
|
| 820 |
+
#: sexy-bookmarks.php:836
|
| 821 |
+
msgid "Helpful Plugin Links"
|
| 822 |
+
msgstr "Χρήσιμοι Σύνδεσμοι Πρόσθετου"
|
| 823 |
+
|
| 824 |
+
#: sexy-bookmarks.php:841
|
| 825 |
+
msgid "Installation & Usage Guide"
|
| 826 |
+
msgstr "Οδηγός Εγκατάστασης &Χρήσης"
|
| 827 |
+
|
| 828 |
+
#: sexy-bookmarks.php:842
|
| 829 |
+
msgid "Frequently Asked Questions"
|
| 830 |
+
msgstr "Συχνές Ερωτήσεις"
|
| 831 |
+
|
| 832 |
+
#: sexy-bookmarks.php:843
|
| 833 |
+
msgid "Bug Submission Form"
|
| 834 |
+
msgstr "Φόρμα Υποβολής Προβλήματος"
|
| 835 |
+
|
| 836 |
+
#: sexy-bookmarks.php:844
|
| 837 |
+
msgid "Feature Request Form"
|
| 838 |
+
msgstr "Φόρμα Αίτησης Νέων Χαρακτηριστικών"
|
| 839 |
+
|
| 840 |
+
#: sexy-bookmarks.php:845
|
| 841 |
+
msgid "Submit a Translation"
|
| 842 |
+
msgstr "Υποβολή Μετάφρασης"
|
| 843 |
+
|
| 844 |
+
#: sexy-bookmarks.php:846
|
| 845 |
+
msgid "Shareaholic Browsers Add-ons"
|
| 846 |
+
msgstr "Πρόσθετα Browser της Shareaholic"
|
| 847 |
+
|
| 848 |
+
#: sexy-bookmarks.php:847
|
| 849 |
+
msgid "Thanks & Credits"
|
| 850 |
+
msgstr "Ευχαριστίες & Εύσημα"
|
| 851 |
+
|
| 852 |
+
#: sexy-bookmarks.php:896
|
| 853 |
+
msgid "Settings"
|
| 854 |
+
msgstr "Ρυθμίσεις"
|
| 855 |
+
|
languages/shrsb-es_ES.mo
ADDED
|
Binary file
|
languages/shrsb-es_ES.po
ADDED
|
@@ -0,0 +1,1353 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
msgid ""
|
| 2 |
+
msgstr ""
|
| 3 |
+
"Project-Id-Version: SexyBookmarks v2.5.5\n"
|
| 4 |
+
"Report-Msgid-Bugs-To: \n"
|
| 5 |
+
"POT-Creation-Date: 2009-10-04 23:14-0600\n"
|
| 6 |
+
"PO-Revision-Date: \n"
|
| 7 |
+
"Last-Translator: Javier Pimienta <javier.pimienta@cpcdisseny.net>\n"
|
| 8 |
+
"Language-Team: Josh Jones, Norman Yung <info@sexybookmarks.net>\n"
|
| 9 |
+
"MIME-Version: 1.0\n"
|
| 10 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
+
"X-Poedit-Language: English\n"
|
| 13 |
+
"X-Poedit-Country: UNITED STATES\n"
|
| 14 |
+
"X-Poedit-KeywordsList: __;_e\n"
|
| 15 |
+
"X-Poedit-Basepath: .\n"
|
| 16 |
+
"X-Poedit-SearchPath-0: F:\\Web Development\\Projects\\SexyBookmarks\\SVN Local\\trunk\n"
|
| 17 |
+
|
| 18 |
+
#: F:\Web
|
| 19 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 20 |
+
#: Local\trunk/bookmarks-data.php:5
|
| 21 |
+
#: Local\trunk/bookmarks-data.php:10
|
| 22 |
+
#: Local\trunk/bookmarks-data.php:15
|
| 23 |
+
#: Local\trunk/bookmarks-data.php:20
|
| 24 |
+
#: Local\trunk/bookmarks-data.php:25
|
| 25 |
+
#: Local\trunk/bookmarks-data.php:30
|
| 26 |
+
#: Local\trunk/bookmarks-data.php:35
|
| 27 |
+
#: Local\trunk/bookmarks-data.php:40
|
| 28 |
+
#: Local\trunk/bookmarks-data.php:45
|
| 29 |
+
#: Local\trunk/bookmarks-data.php:50
|
| 30 |
+
#: Local\trunk/bookmarks-data.php:55
|
| 31 |
+
#: Local\trunk/bookmarks-data.php:60
|
| 32 |
+
#: Local\trunk/bookmarks-data.php:65
|
| 33 |
+
#: Local\trunk/bookmarks-data.php:70
|
| 34 |
+
#: Local\trunk/bookmarks-data.php:85
|
| 35 |
+
#: Local\trunk/bookmarks-data.php:90
|
| 36 |
+
#: Local\trunk/bookmarks-data.php:95
|
| 37 |
+
#: Local\trunk/bookmarks-data.php:100
|
| 38 |
+
#: Local\trunk/bookmarks-data.php:105
|
| 39 |
+
#: Local\trunk/bookmarks-data.php:110
|
| 40 |
+
#: Local\trunk/bookmarks-data.php:115
|
| 41 |
+
#: Local\trunk/bookmarks-data.php:120
|
| 42 |
+
#: Local\trunk/bookmarks-data.php:125
|
| 43 |
+
#: Local\trunk/bookmarks-data.php:130
|
| 44 |
+
#: Local\trunk/bookmarks-data.php:135
|
| 45 |
+
#: Local\trunk/bookmarks-data.php:140
|
| 46 |
+
#: Local\trunk/bookmarks-data.php:145
|
| 47 |
+
#: Local\trunk/bookmarks-data.php:150
|
| 48 |
+
#: Local\trunk/bookmarks-data.php:155
|
| 49 |
+
#: Local\trunk/bookmarks-data.php:160
|
| 50 |
+
#: Local\trunk/bookmarks-data.php:165
|
| 51 |
+
#: Local\trunk/bookmarks-data.php:170
|
| 52 |
+
#: Local\trunk/bookmarks-data.php:175
|
| 53 |
+
#: Local\trunk/bookmarks-data.php:180
|
| 54 |
+
#: Local\trunk/bookmarks-data.php:185
|
| 55 |
+
#: Local\trunk/bookmarks-data.php:190
|
| 56 |
+
#: Local\trunk/bookmarks-data.php:195
|
| 57 |
+
#: Local\trunk/bookmarks-data.php:200
|
| 58 |
+
#: Local\trunk/bookmarks-data.php:205
|
| 59 |
+
#: Local\trunk/bookmarks-data.php:210
|
| 60 |
+
#: Local\trunk/bookmarks-data.php:215
|
| 61 |
+
#: Local\trunk/bookmarks-data.php:220
|
| 62 |
+
#: Local\trunk/bookmarks-data.php:225
|
| 63 |
+
#: Local\trunk/bookmarks-data.php:230
|
| 64 |
+
#: Local\trunk/bookmarks-data.php:235
|
| 65 |
+
#: Local\trunk/bookmarks-data.php:240
|
| 66 |
+
#: Local\trunk/bookmarks-data.php:245
|
| 67 |
+
#: Local\trunk/bookmarks-data.php:250
|
| 68 |
+
#: Local\trunk/bookmarks-data.php:255
|
| 69 |
+
#: Local\trunk/bookmarks-data.php:260
|
| 70 |
+
#: Local\trunk/bookmarks-data.php:265
|
| 71 |
+
msgid "Check this box to include "
|
| 72 |
+
msgstr "Selecciona esta casilla para utilizarlo"
|
| 73 |
+
|
| 74 |
+
#: F:\Web
|
| 75 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 76 |
+
#: Local\trunk/bookmarks-data.php:5
|
| 77 |
+
#: Local\trunk/bookmarks-data.php:6
|
| 78 |
+
msgid "Script & Style"
|
| 79 |
+
msgstr "Script & Style"
|
| 80 |
+
|
| 81 |
+
#: F:\Web
|
| 82 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 83 |
+
#: Local\trunk/bookmarks-data.php:5
|
| 84 |
+
#: Local\trunk/bookmarks-data.php:10
|
| 85 |
+
#: Local\trunk/bookmarks-data.php:15
|
| 86 |
+
#: Local\trunk/bookmarks-data.php:20
|
| 87 |
+
#: Local\trunk/bookmarks-data.php:25
|
| 88 |
+
#: Local\trunk/bookmarks-data.php:30
|
| 89 |
+
#: Local\trunk/bookmarks-data.php:35
|
| 90 |
+
#: Local\trunk/bookmarks-data.php:40
|
| 91 |
+
#: Local\trunk/bookmarks-data.php:45
|
| 92 |
+
#: Local\trunk/bookmarks-data.php:50
|
| 93 |
+
#: Local\trunk/bookmarks-data.php:55
|
| 94 |
+
#: Local\trunk/bookmarks-data.php:60
|
| 95 |
+
#: Local\trunk/bookmarks-data.php:65
|
| 96 |
+
#: Local\trunk/bookmarks-data.php:70
|
| 97 |
+
#: Local\trunk/bookmarks-data.php:75
|
| 98 |
+
#: Local\trunk/bookmarks-data.php:80
|
| 99 |
+
#: Local\trunk/bookmarks-data.php:85
|
| 100 |
+
#: Local\trunk/bookmarks-data.php:90
|
| 101 |
+
#: Local\trunk/bookmarks-data.php:95
|
| 102 |
+
#: Local\trunk/bookmarks-data.php:100
|
| 103 |
+
#: Local\trunk/bookmarks-data.php:105
|
| 104 |
+
#: Local\trunk/bookmarks-data.php:110
|
| 105 |
+
#: Local\trunk/bookmarks-data.php:115
|
| 106 |
+
#: Local\trunk/bookmarks-data.php:120
|
| 107 |
+
#: Local\trunk/bookmarks-data.php:125
|
| 108 |
+
#: Local\trunk/bookmarks-data.php:130
|
| 109 |
+
#: Local\trunk/bookmarks-data.php:135
|
| 110 |
+
#: Local\trunk/bookmarks-data.php:140
|
| 111 |
+
#: Local\trunk/bookmarks-data.php:145
|
| 112 |
+
#: Local\trunk/bookmarks-data.php:150
|
| 113 |
+
#: Local\trunk/bookmarks-data.php:155
|
| 114 |
+
#: Local\trunk/bookmarks-data.php:160
|
| 115 |
+
#: Local\trunk/bookmarks-data.php:165
|
| 116 |
+
#: Local\trunk/bookmarks-data.php:170
|
| 117 |
+
#: Local\trunk/bookmarks-data.php:175
|
| 118 |
+
#: Local\trunk/bookmarks-data.php:180
|
| 119 |
+
#: Local\trunk/bookmarks-data.php:185
|
| 120 |
+
#: Local\trunk/bookmarks-data.php:190
|
| 121 |
+
#: Local\trunk/bookmarks-data.php:195
|
| 122 |
+
#: Local\trunk/bookmarks-data.php:200
|
| 123 |
+
#: Local\trunk/bookmarks-data.php:205
|
| 124 |
+
#: Local\trunk/bookmarks-data.php:210
|
| 125 |
+
#: Local\trunk/bookmarks-data.php:215
|
| 126 |
+
#: Local\trunk/bookmarks-data.php:220
|
| 127 |
+
#: Local\trunk/bookmarks-data.php:225
|
| 128 |
+
#: Local\trunk/bookmarks-data.php:230
|
| 129 |
+
#: Local\trunk/bookmarks-data.php:235
|
| 130 |
+
#: Local\trunk/bookmarks-data.php:240
|
| 131 |
+
#: Local\trunk/bookmarks-data.php:245
|
| 132 |
+
#: Local\trunk/bookmarks-data.php:250
|
| 133 |
+
#: Local\trunk/bookmarks-data.php:255
|
| 134 |
+
#: Local\trunk/bookmarks-data.php:260
|
| 135 |
+
#: Local\trunk/bookmarks-data.php:265
|
| 136 |
+
msgid " in your bookmarking menu"
|
| 137 |
+
msgstr "en tu menú de marcadores"
|
| 138 |
+
|
| 139 |
+
#: F:\Web
|
| 140 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 141 |
+
#: Local\trunk/bookmarks-data.php:6
|
| 142 |
+
#: Local\trunk/bookmarks-data.php:61
|
| 143 |
+
#: Local\trunk/bookmarks-data.php:141
|
| 144 |
+
#: Local\trunk/bookmarks-data.php:181
|
| 145 |
+
#: Local\trunk/bookmarks-data.php:241
|
| 146 |
+
#: Local\trunk/bookmarks-data.php:246
|
| 147 |
+
#: Local\trunk/bookmarks-data.php:251
|
| 148 |
+
#: Local\trunk/bookmarks-data.php:256
|
| 149 |
+
msgid "Submit this to "
|
| 150 |
+
msgstr "Enviar a "
|
| 151 |
+
|
| 152 |
+
#: F:\Web
|
| 153 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 154 |
+
#: Local\trunk/bookmarks-data.php:10
|
| 155 |
+
#: Local\trunk/bookmarks-data.php:11
|
| 156 |
+
msgid "Blinklist"
|
| 157 |
+
msgstr "Blinklist"
|
| 158 |
+
|
| 159 |
+
#: F:\Web
|
| 160 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 161 |
+
#: Local\trunk/bookmarks-data.php:11
|
| 162 |
+
#: Local\trunk/bookmarks-data.php:16
|
| 163 |
+
#: Local\trunk/bookmarks-data.php:31
|
| 164 |
+
#: Local\trunk/bookmarks-data.php:46
|
| 165 |
+
#: Local\trunk/bookmarks-data.php:51
|
| 166 |
+
#: Local\trunk/bookmarks-data.php:66
|
| 167 |
+
#: Local\trunk/bookmarks-data.php:91
|
| 168 |
+
#: Local\trunk/bookmarks-data.php:101
|
| 169 |
+
#: Local\trunk/bookmarks-data.php:121
|
| 170 |
+
#: Local\trunk/bookmarks-data.php:126
|
| 171 |
+
#: Local\trunk/bookmarks-data.php:131
|
| 172 |
+
#: Local\trunk/bookmarks-data.php:146
|
| 173 |
+
#: Local\trunk/bookmarks-data.php:156
|
| 174 |
+
#: Local\trunk/bookmarks-data.php:211
|
| 175 |
+
#: Local\trunk/bookmarks-data.php:261
|
| 176 |
+
#: Local\trunk/bookmarks-data.php:266
|
| 177 |
+
msgid "Share this on "
|
| 178 |
+
msgstr "Compartir con "
|
| 179 |
+
|
| 180 |
+
#: F:\Web
|
| 181 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 182 |
+
#: Local\trunk/bookmarks-data.php:15
|
| 183 |
+
msgid "Delicious"
|
| 184 |
+
msgstr "Delicious"
|
| 185 |
+
|
| 186 |
+
#: F:\Web
|
| 187 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 188 |
+
#: Local\trunk/bookmarks-data.php:16
|
| 189 |
+
msgid "del.icio.us"
|
| 190 |
+
msgstr "del.icio.us"
|
| 191 |
+
|
| 192 |
+
#: F:\Web
|
| 193 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 194 |
+
#: Local\trunk/bookmarks-data.php:20
|
| 195 |
+
msgid "Digg"
|
| 196 |
+
msgstr "Digg"
|
| 197 |
+
|
| 198 |
+
#: F:\Web
|
| 199 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 200 |
+
#: Local\trunk/bookmarks-data.php:21
|
| 201 |
+
msgid "Digg this!"
|
| 202 |
+
msgstr "¡Compártelo con Digg!"
|
| 203 |
+
|
| 204 |
+
#: F:\Web
|
| 205 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 206 |
+
#: Local\trunk/bookmarks-data.php:25
|
| 207 |
+
#: Local\trunk/bookmarks-data.php:26
|
| 208 |
+
msgid "Diigo"
|
| 209 |
+
msgstr "Diigo"
|
| 210 |
+
|
| 211 |
+
#: F:\Web
|
| 212 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 213 |
+
#: Local\trunk/bookmarks-data.php:26
|
| 214 |
+
msgid "Post this on "
|
| 215 |
+
msgstr "Añadirlo a "
|
| 216 |
+
|
| 217 |
+
#: F:\Web
|
| 218 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 219 |
+
#: Local\trunk/bookmarks-data.php:30
|
| 220 |
+
#: Local\trunk/bookmarks-data.php:31
|
| 221 |
+
msgid "Reddit"
|
| 222 |
+
msgstr "Reddit"
|
| 223 |
+
|
| 224 |
+
#: F:\Web
|
| 225 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 226 |
+
#: Local\trunk/bookmarks-data.php:35
|
| 227 |
+
msgid "Yahoo! Buzz"
|
| 228 |
+
msgstr "Yahoo! Buzz"
|
| 229 |
+
|
| 230 |
+
#: F:\Web
|
| 231 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 232 |
+
#: Local\trunk/bookmarks-data.php:36
|
| 233 |
+
msgid "Buzz up!"
|
| 234 |
+
msgstr "Buzz up!"
|
| 235 |
+
|
| 236 |
+
#: F:\Web
|
| 237 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 238 |
+
#: Local\trunk/bookmarks-data.php:40
|
| 239 |
+
msgid "Stumbleupon"
|
| 240 |
+
msgstr "Stumbleupon"
|
| 241 |
+
|
| 242 |
+
#: F:\Web
|
| 243 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 244 |
+
#: Local\trunk/bookmarks-data.php:41
|
| 245 |
+
msgid "Stumble upon something good? Share it on StumbleUpon"
|
| 246 |
+
msgstr "¿Has encontrado algo bueno? Compártelo en StumbleUpon"
|
| 247 |
+
|
| 248 |
+
#: F:\Web
|
| 249 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 250 |
+
#: Local\trunk/bookmarks-data.php:45
|
| 251 |
+
#: Local\trunk/bookmarks-data.php:46
|
| 252 |
+
msgid "Technorati"
|
| 253 |
+
msgstr "Technorati"
|
| 254 |
+
|
| 255 |
+
#: F:\Web
|
| 256 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 257 |
+
#: Local\trunk/bookmarks-data.php:50
|
| 258 |
+
#: Local\trunk/bookmarks-data.php:51
|
| 259 |
+
msgid "Mixx"
|
| 260 |
+
msgstr "Mixx"
|
| 261 |
+
|
| 262 |
+
#: F:\Web
|
| 263 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 264 |
+
#: Local\trunk/bookmarks-data.php:55
|
| 265 |
+
#: Local\trunk/bookmarks-data.php:56
|
| 266 |
+
msgid "MySpace"
|
| 267 |
+
msgstr "MySpace"
|
| 268 |
+
|
| 269 |
+
#: F:\Web
|
| 270 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 271 |
+
#: Local\trunk/bookmarks-data.php:56
|
| 272 |
+
#: Local\trunk/bookmarks-data.php:201
|
| 273 |
+
#: Local\trunk/bookmarks-data.php:226
|
| 274 |
+
msgid "Post this to "
|
| 275 |
+
msgstr "Añadirlo a "
|
| 276 |
+
|
| 277 |
+
#: F:\Web
|
| 278 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 279 |
+
#: Local\trunk/bookmarks-data.php:60
|
| 280 |
+
#: Local\trunk/bookmarks-data.php:61
|
| 281 |
+
msgid "DesignFloat"
|
| 282 |
+
msgstr "DesignFloat"
|
| 283 |
+
|
| 284 |
+
#: F:\Web
|
| 285 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 286 |
+
#: Local\trunk/bookmarks-data.php:65
|
| 287 |
+
#: Local\trunk/bookmarks-data.php:66
|
| 288 |
+
msgid "Facebook"
|
| 289 |
+
msgstr "Facebook"
|
| 290 |
+
|
| 291 |
+
#: F:\Web
|
| 292 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 293 |
+
#: Local\trunk/bookmarks-data.php:70
|
| 294 |
+
msgid "Twitter"
|
| 295 |
+
msgstr "Twitter"
|
| 296 |
+
|
| 297 |
+
#: F:\Web
|
| 298 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 299 |
+
#: Local\trunk/bookmarks-data.php:71
|
| 300 |
+
msgid "Tweet This!"
|
| 301 |
+
msgstr "¡Compártelo en Twitter!"
|
| 302 |
+
|
| 303 |
+
#: F:\Web
|
| 304 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 305 |
+
#: Local\trunk/bookmarks-data.php:75
|
| 306 |
+
#: Local\trunk/bookmarks-data.php:80
|
| 307 |
+
msgid "Check this box to include the "
|
| 308 |
+
msgstr "Marca esta casilla para incluir el "
|
| 309 |
+
|
| 310 |
+
#: F:\Web
|
| 311 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 312 |
+
#: Local\trunk/bookmarks-data.php:75
|
| 313 |
+
msgid "\"Email to a Friend\" link"
|
| 314 |
+
msgstr "link de \"Enviar a un amigo\""
|
| 315 |
+
|
| 316 |
+
#: F:\Web
|
| 317 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 318 |
+
#: Local\trunk/bookmarks-data.php:76
|
| 319 |
+
msgid "Email this to a friend?"
|
| 320 |
+
msgstr "¿Enviarlo a un amigo?"
|
| 321 |
+
|
| 322 |
+
#: F:\Web
|
| 323 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 324 |
+
#: Local\trunk/bookmarks-data.php:80
|
| 325 |
+
#: Local\trunk/bookmarks-data.php:81
|
| 326 |
+
msgid "ToMuse"
|
| 327 |
+
msgstr "ToMuse"
|
| 328 |
+
|
| 329 |
+
#: F:\Web
|
| 330 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 331 |
+
#: Local\trunk/bookmarks-data.php:81
|
| 332 |
+
msgid "Suggest this article to "
|
| 333 |
+
msgstr "Sugiere este artículo a "
|
| 334 |
+
|
| 335 |
+
#: F:\Web
|
| 336 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 337 |
+
#: Local\trunk/bookmarks-data.php:85
|
| 338 |
+
msgid "a 'Subscribe to Comments' link"
|
| 339 |
+
msgstr "link para 'Suscribirse a los Comentarios'"
|
| 340 |
+
|
| 341 |
+
#: F:\Web
|
| 342 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 343 |
+
#: Local\trunk/bookmarks-data.php:86
|
| 344 |
+
msgid "Subscribe to the comments for this post?"
|
| 345 |
+
msgstr "¿Quieres suscribirte a los comentarios de este Post?"
|
| 346 |
+
|
| 347 |
+
#: F:\Web
|
| 348 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 349 |
+
#: Local\trunk/bookmarks-data.php:90
|
| 350 |
+
#: Local\trunk/bookmarks-data.php:91
|
| 351 |
+
msgid "Linkedin"
|
| 352 |
+
msgstr "Linkedit"
|
| 353 |
+
|
| 354 |
+
#: F:\Web
|
| 355 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 356 |
+
#: Local\trunk/bookmarks-data.php:95
|
| 357 |
+
#: Local\trunk/bookmarks-data.php:96
|
| 358 |
+
msgid "Newsvine"
|
| 359 |
+
msgstr "Newsvine"
|
| 360 |
+
|
| 361 |
+
#: F:\Web
|
| 362 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 363 |
+
#: Local\trunk/bookmarks-data.php:96
|
| 364 |
+
msgid "Seed this on "
|
| 365 |
+
msgstr "Seed el Post en "
|
| 366 |
+
|
| 367 |
+
#: F:\Web
|
| 368 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 369 |
+
#: Local\trunk/bookmarks-data.php:100
|
| 370 |
+
#: Local\trunk/bookmarks-data.php:101
|
| 371 |
+
msgid "Devmarks"
|
| 372 |
+
msgstr "Devmarks"
|
| 373 |
+
|
| 374 |
+
#: F:\Web
|
| 375 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 376 |
+
#: Local\trunk/bookmarks-data.php:105
|
| 377 |
+
#: Local\trunk/bookmarks-data.php:106
|
| 378 |
+
msgid "Google Bookmarks"
|
| 379 |
+
msgstr "Google Bookmarks"
|
| 380 |
+
|
| 381 |
+
#: F:\Web
|
| 382 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 383 |
+
#: Local\trunk/bookmarks-data.php:106
|
| 384 |
+
#: Local\trunk/bookmarks-data.php:111
|
| 385 |
+
#: Local\trunk/bookmarks-data.php:116
|
| 386 |
+
#: Local\trunk/bookmarks-data.php:161
|
| 387 |
+
#: Local\trunk/bookmarks-data.php:166
|
| 388 |
+
#: Local\trunk/bookmarks-data.php:171
|
| 389 |
+
#: Local\trunk/bookmarks-data.php:176
|
| 390 |
+
#: Local\trunk/bookmarks-data.php:196
|
| 391 |
+
msgid "Add this to "
|
| 392 |
+
msgstr "Añdirlo a "
|
| 393 |
+
|
| 394 |
+
#: F:\Web
|
| 395 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 396 |
+
#: Local\trunk/bookmarks-data.php:110
|
| 397 |
+
#: Local\trunk/bookmarks-data.php:111
|
| 398 |
+
msgid "Mister Wong"
|
| 399 |
+
msgstr "Mister Wong"
|
| 400 |
+
|
| 401 |
+
#: F:\Web
|
| 402 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 403 |
+
#: Local\trunk/bookmarks-data.php:112
|
| 404 |
+
msgid "www.mister-wong.com"
|
| 405 |
+
msgstr "www.mister-wong.com"
|
| 406 |
+
|
| 407 |
+
#: F:\Web
|
| 408 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 409 |
+
#: Local\trunk/bookmarks-data.php:115
|
| 410 |
+
#: Local\trunk/bookmarks-data.php:116
|
| 411 |
+
msgid "Izeby"
|
| 412 |
+
msgstr "Izeby"
|
| 413 |
+
|
| 414 |
+
#: F:\Web
|
| 415 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 416 |
+
#: Local\trunk/bookmarks-data.php:120
|
| 417 |
+
#: Local\trunk/bookmarks-data.php:121
|
| 418 |
+
msgid "Tipd"
|
| 419 |
+
msgstr "Tipd"
|
| 420 |
+
|
| 421 |
+
#: F:\Web
|
| 422 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 423 |
+
#: Local\trunk/bookmarks-data.php:125
|
| 424 |
+
#: Local\trunk/bookmarks-data.php:126
|
| 425 |
+
msgid "PFBuzz"
|
| 426 |
+
msgstr "PFBuzz"
|
| 427 |
+
|
| 428 |
+
#: F:\Web
|
| 429 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 430 |
+
#: Local\trunk/bookmarks-data.php:130
|
| 431 |
+
#: Local\trunk/bookmarks-data.php:131
|
| 432 |
+
msgid "FriendFeed"
|
| 433 |
+
msgstr "FriendFeed"
|
| 434 |
+
|
| 435 |
+
#: F:\Web
|
| 436 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 437 |
+
#: Local\trunk/bookmarks-data.php:135
|
| 438 |
+
#: Local\trunk/bookmarks-data.php:136
|
| 439 |
+
msgid "BlogMarks"
|
| 440 |
+
msgstr "BlogMarks"
|
| 441 |
+
|
| 442 |
+
#: F:\Web
|
| 443 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 444 |
+
#: Local\trunk/bookmarks-data.php:136
|
| 445 |
+
msgid "Mark this on "
|
| 446 |
+
msgstr "Mark esto en "
|
| 447 |
+
|
| 448 |
+
#: F:\Web
|
| 449 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 450 |
+
#: Local\trunk/bookmarks-data.php:140
|
| 451 |
+
#: Local\trunk/bookmarks-data.php:141
|
| 452 |
+
msgid "Twittley"
|
| 453 |
+
msgstr "Twittley"
|
| 454 |
+
|
| 455 |
+
#: F:\Web
|
| 456 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 457 |
+
#: Local\trunk/bookmarks-data.php:145
|
| 458 |
+
#: Local\trunk/bookmarks-data.php:146
|
| 459 |
+
msgid "Fwisp"
|
| 460 |
+
msgstr "Fwisp"
|
| 461 |
+
|
| 462 |
+
#: F:\Web
|
| 463 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 464 |
+
#: Local\trunk/bookmarks-data.php:150
|
| 465 |
+
#: Local\trunk/bookmarks-data.php:151
|
| 466 |
+
msgid "DesignMoo"
|
| 467 |
+
msgstr "DesignMoo"
|
| 468 |
+
|
| 469 |
+
#: F:\Web
|
| 470 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 471 |
+
#: Local\trunk/bookmarks-data.php:151
|
| 472 |
+
msgid "Moo this on "
|
| 473 |
+
msgstr "Moo esto en "
|
| 474 |
+
|
| 475 |
+
#: F:\Web
|
| 476 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 477 |
+
#: Local\trunk/bookmarks-data.php:155
|
| 478 |
+
#: Local\trunk/bookmarks-data.php:156
|
| 479 |
+
msgid "BobrDobr"
|
| 480 |
+
msgstr "BobrDobr"
|
| 481 |
+
|
| 482 |
+
#: F:\Web
|
| 483 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 484 |
+
#: Local\trunk/bookmarks-data.php:155
|
| 485 |
+
#: Local\trunk/bookmarks-data.php:160
|
| 486 |
+
#: Local\trunk/bookmarks-data.php:165
|
| 487 |
+
#: Local\trunk/bookmarks-data.php:170
|
| 488 |
+
#: Local\trunk/bookmarks-data.php:175
|
| 489 |
+
msgid " (Russian)"
|
| 490 |
+
msgstr "(Ruso)"
|
| 491 |
+
|
| 492 |
+
#: F:\Web
|
| 493 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 494 |
+
#: Local\trunk/bookmarks-data.php:160
|
| 495 |
+
#: Local\trunk/bookmarks-data.php:161
|
| 496 |
+
msgid "Yandex.Bookmarks"
|
| 497 |
+
msgstr "Yandex.Bookmarks"
|
| 498 |
+
|
| 499 |
+
#: F:\Web
|
| 500 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 501 |
+
#: Local\trunk/bookmarks-data.php:165
|
| 502 |
+
#: Local\trunk/bookmarks-data.php:166
|
| 503 |
+
msgid "Memory.ru"
|
| 504 |
+
msgstr "Memory.ru"
|
| 505 |
+
|
| 506 |
+
#: F:\Web
|
| 507 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 508 |
+
#: Local\trunk/bookmarks-data.php:170
|
| 509 |
+
#: Local\trunk/bookmarks-data.php:171
|
| 510 |
+
msgid "100 bookmarks"
|
| 511 |
+
msgstr "100 bookmarks"
|
| 512 |
+
|
| 513 |
+
#: F:\Web
|
| 514 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 515 |
+
#: Local\trunk/bookmarks-data.php:175
|
| 516 |
+
#: Local\trunk/bookmarks-data.php:176
|
| 517 |
+
msgid "MyPlace"
|
| 518 |
+
msgstr "MyPlace"
|
| 519 |
+
|
| 520 |
+
#: F:\Web
|
| 521 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 522 |
+
#: Local\trunk/bookmarks-data.php:180
|
| 523 |
+
#: Local\trunk/bookmarks-data.php:181
|
| 524 |
+
msgid "Hacker News"
|
| 525 |
+
msgstr "Hacker News"
|
| 526 |
+
|
| 527 |
+
#: F:\Web
|
| 528 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 529 |
+
#: Local\trunk/bookmarks-data.php:185
|
| 530 |
+
#: Local\trunk/bookmarks-data.php:186
|
| 531 |
+
msgid "Print Friendly"
|
| 532 |
+
msgstr "Imprimir"
|
| 533 |
+
|
| 534 |
+
#: F:\Web
|
| 535 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 536 |
+
#: Local\trunk/bookmarks-data.php:186
|
| 537 |
+
msgid "Send this page to "
|
| 538 |
+
msgstr "Envía esta página a "
|
| 539 |
+
|
| 540 |
+
#: F:\Web
|
| 541 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 542 |
+
#: Local\trunk/bookmarks-data.php:190
|
| 543 |
+
msgid "Design Bump"
|
| 544 |
+
msgstr "Design Bump"
|
| 545 |
+
|
| 546 |
+
#: F:\Web
|
| 547 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 548 |
+
#: Local\trunk/bookmarks-data.php:191
|
| 549 |
+
msgid "Bump this on "
|
| 550 |
+
msgstr "Bump esto en "
|
| 551 |
+
|
| 552 |
+
#: F:\Web
|
| 553 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 554 |
+
#: Local\trunk/bookmarks-data.php:191
|
| 555 |
+
msgid "DesignBump"
|
| 556 |
+
msgstr "DesignBump"
|
| 557 |
+
|
| 558 |
+
#: F:\Web
|
| 559 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 560 |
+
#: Local\trunk/bookmarks-data.php:195
|
| 561 |
+
#: Local\trunk/bookmarks-data.php:196
|
| 562 |
+
msgid "Ning"
|
| 563 |
+
msgstr "Ning"
|
| 564 |
+
|
| 565 |
+
#: F:\Web
|
| 566 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 567 |
+
#: Local\trunk/bookmarks-data.php:200
|
| 568 |
+
#: Local\trunk/bookmarks-data.php:201
|
| 569 |
+
msgid "Identica"
|
| 570 |
+
msgstr "Identica"
|
| 571 |
+
|
| 572 |
+
#: F:\Web
|
| 573 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 574 |
+
#: Local\trunk/bookmarks-data.php:205
|
| 575 |
+
#: Local\trunk/bookmarks-data.php:206
|
| 576 |
+
msgid "Xerpi"
|
| 577 |
+
msgstr "Xerpi"
|
| 578 |
+
|
| 579 |
+
#: F:\Web
|
| 580 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 581 |
+
#: Local\trunk/bookmarks-data.php:206
|
| 582 |
+
msgid "Save this to "
|
| 583 |
+
msgstr "Guarda esto en "
|
| 584 |
+
|
| 585 |
+
#: F:\Web
|
| 586 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 587 |
+
#: Local\trunk/bookmarks-data.php:210
|
| 588 |
+
#: Local\trunk/bookmarks-data.php:211
|
| 589 |
+
msgid "Wikio"
|
| 590 |
+
msgstr "Wikio"
|
| 591 |
+
|
| 592 |
+
#: F:\Web
|
| 593 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 594 |
+
#: Local\trunk/bookmarks-data.php:215
|
| 595 |
+
#: Local\trunk/bookmarks-data.php:216
|
| 596 |
+
msgid "TechMeme"
|
| 597 |
+
msgstr "TechMeme"
|
| 598 |
+
|
| 599 |
+
#: F:\Web
|
| 600 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 601 |
+
#: Local\trunk/bookmarks-data.php:216
|
| 602 |
+
msgid "Tip this to "
|
| 603 |
+
msgstr "Tip esto en "
|
| 604 |
+
|
| 605 |
+
#: F:\Web
|
| 606 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 607 |
+
#: Local\trunk/bookmarks-data.php:220
|
| 608 |
+
#: Local\trunk/bookmarks-data.php:221
|
| 609 |
+
msgid "Sphinn"
|
| 610 |
+
msgstr "Sphinn"
|
| 611 |
+
|
| 612 |
+
#: F:\Web
|
| 613 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 614 |
+
#: Local\trunk/bookmarks-data.php:221
|
| 615 |
+
msgid "Sphinn this on "
|
| 616 |
+
msgstr "Sphinn esto en "
|
| 617 |
+
|
| 618 |
+
#: F:\Web
|
| 619 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 620 |
+
#: Local\trunk/bookmarks-data.php:225
|
| 621 |
+
#: Local\trunk/bookmarks-data.php:226
|
| 622 |
+
msgid "Posterous"
|
| 623 |
+
msgstr "Posterous"
|
| 624 |
+
|
| 625 |
+
#: F:\Web
|
| 626 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 627 |
+
#: Local\trunk/bookmarks-data.php:230
|
| 628 |
+
#: Local\trunk/bookmarks-data.php:231
|
| 629 |
+
msgid "Global Grind"
|
| 630 |
+
msgstr "Global Grind"
|
| 631 |
+
|
| 632 |
+
#: F:\Web
|
| 633 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 634 |
+
#: Local\trunk/bookmarks-data.php:231
|
| 635 |
+
msgid "Grind this! on "
|
| 636 |
+
msgstr "¡Grind esto! en "
|
| 637 |
+
|
| 638 |
+
#: F:\Web
|
| 639 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 640 |
+
#: Local\trunk/bookmarks-data.php:235
|
| 641 |
+
#: Local\trunk/bookmarks-data.php:236
|
| 642 |
+
msgid "Ping.fm"
|
| 643 |
+
msgstr "Ping.fm"
|
| 644 |
+
|
| 645 |
+
#: F:\Web
|
| 646 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 647 |
+
#: Local\trunk/bookmarks-data.php:236
|
| 648 |
+
msgid "Ping this on "
|
| 649 |
+
msgstr "Ping esto en "
|
| 650 |
+
|
| 651 |
+
#: F:\Web
|
| 652 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 653 |
+
#: Local\trunk/bookmarks-data.php:240
|
| 654 |
+
#: Local\trunk/bookmarks-data.php:241
|
| 655 |
+
msgid "NUjij"
|
| 656 |
+
msgstr "NUjij"
|
| 657 |
+
|
| 658 |
+
#: F:\Web
|
| 659 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 660 |
+
#: Local\trunk/bookmarks-data.php:240
|
| 661 |
+
#: Local\trunk/bookmarks-data.php:245
|
| 662 |
+
msgid " (Dutch)"
|
| 663 |
+
msgstr " (Alemán)"
|
| 664 |
+
|
| 665 |
+
#: F:\Web
|
| 666 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 667 |
+
#: Local\trunk/bookmarks-data.php:245
|
| 668 |
+
#: Local\trunk/bookmarks-data.php:246
|
| 669 |
+
msgid "eKudos"
|
| 670 |
+
msgstr "eKudos"
|
| 671 |
+
|
| 672 |
+
#: F:\Web
|
| 673 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 674 |
+
#: Local\trunk/bookmarks-data.php:250
|
| 675 |
+
#: Local\trunk/bookmarks-data.php:251
|
| 676 |
+
msgid "Netvouz"
|
| 677 |
+
msgstr "Netvouz"
|
| 678 |
+
|
| 679 |
+
#: F:\Web
|
| 680 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 681 |
+
#: Local\trunk/bookmarks-data.php:255
|
| 682 |
+
#: Local\trunk/bookmarks-data.php:256
|
| 683 |
+
msgid "Netvibes"
|
| 684 |
+
msgstr "Netvibes"
|
| 685 |
+
|
| 686 |
+
#: F:\Web
|
| 687 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 688 |
+
#: Local\trunk/bookmarks-data.php:260
|
| 689 |
+
#: Local\trunk/bookmarks-data.php:261
|
| 690 |
+
msgid "Fleck"
|
| 691 |
+
msgstr "Fleck"
|
| 692 |
+
|
| 693 |
+
#: F:\Web
|
| 694 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 695 |
+
#: Local\trunk/bookmarks-data.php:265
|
| 696 |
+
#: Local\trunk/bookmarks-data.php:266
|
| 697 |
+
msgid "Blogosphere News"
|
| 698 |
+
msgstr "Blogosphere News"
|
| 699 |
+
|
| 700 |
+
#: F:\Web
|
| 701 |
+
#: Development\Projects\SexyBookmarks\SVN Local\trunk/public.php:121
|
| 702 |
+
msgid "an error occurred in SexyBookmarks"
|
| 703 |
+
msgstr "Se ha producido un error en SexyBookmarks"
|
| 704 |
+
|
| 705 |
+
#: F:\Web
|
| 706 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 707 |
+
#: Local\trunk/sexy-bookmarks.php:94
|
| 708 |
+
msgid "Your changes have been saved successfully!"
|
| 709 |
+
msgstr "¡Tus cambios se han guardado correctamente!"
|
| 710 |
+
|
| 711 |
+
#: F:\Web
|
| 712 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 713 |
+
#: Local\trunk/sexy-bookmarks.php:94
|
| 714 |
+
msgid "Maybe you would consider "
|
| 715 |
+
msgstr "Quizás deberías considerar "
|
| 716 |
+
|
| 717 |
+
#: F:\Web
|
| 718 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 719 |
+
#: Local\trunk/sexy-bookmarks.php:94
|
| 720 |
+
msgid "donating"
|
| 721 |
+
msgstr "donacián"
|
| 722 |
+
|
| 723 |
+
#: F:\Web
|
| 724 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 725 |
+
#: Local\trunk/sexy-bookmarks.php:97
|
| 726 |
+
msgid "Please choose where you would like the menu to be displayed."
|
| 727 |
+
msgstr "Por favor, selecciona el lugar en el que deseas que aparezca el menú"
|
| 728 |
+
|
| 729 |
+
#: F:\Web
|
| 730 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 731 |
+
#: Local\trunk/sexy-bookmarks.php:98
|
| 732 |
+
msgid "You can't display the menu if you don't choose a few sites to add to it!"
|
| 733 |
+
msgstr "¡No puedes mostrar el menú si no seleccionas algunos sitios para añadirlo!"
|
| 734 |
+
|
| 735 |
+
#: F:\Web
|
| 736 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 737 |
+
#: Local\trunk/sexy-bookmarks.php:99
|
| 738 |
+
msgid "Please choose where you want the menu displayed."
|
| 739 |
+
msgstr "Por favor, selecciona dónde quieres que se muestre el menú"
|
| 740 |
+
|
| 741 |
+
#: F:\Web
|
| 742 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 743 |
+
#: Local\trunk/sexy-bookmarks.php:103
|
| 744 |
+
msgid "You need to select the primary category for any articles submitted to Twittley."
|
| 745 |
+
msgstr "Necesitas seleccionar la categoría principal para los artículos enviados a Twittley."
|
| 746 |
+
|
| 747 |
+
#: F:\Web
|
| 748 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 749 |
+
#: Local\trunk/sexy-bookmarks.php:104
|
| 750 |
+
msgid "You need to set at least 1 default tag for any articles submitted to Twittley."
|
| 751 |
+
msgstr "Necesitas al menos una etiqueta por defecto para los artículos enviados a Twittley."
|
| 752 |
+
|
| 753 |
+
#: F:\Web
|
| 754 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 755 |
+
#: Local\trunk/sexy-bookmarks.php:114
|
| 756 |
+
msgid "You must first download and activate the"
|
| 757 |
+
msgstr "Primero debes descargar y activar el "
|
| 758 |
+
|
| 759 |
+
#: F:\Web
|
| 760 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 761 |
+
#: Local\trunk/sexy-bookmarks.php:114
|
| 762 |
+
msgid "Twitter Friendly Links Plugin"
|
| 763 |
+
msgstr "Plugin para los links amigables de Twitter"
|
| 764 |
+
|
| 765 |
+
#: F:\Web
|
| 766 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 767 |
+
#: Local\trunk/sexy-bookmarks.php:114
|
| 768 |
+
msgid "before hosting your own short URLs..."
|
| 769 |
+
msgstr "antes indica tus propias URLs cortas..."
|
| 770 |
+
|
| 771 |
+
#: F:\Web
|
| 772 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 773 |
+
#: Local\trunk/sexy-bookmarks.php:132
|
| 774 |
+
msgid "Due to recent API changes by Tumblr, I can no longer offer them as a supported network in the plugin."
|
| 775 |
+
msgstr "Debido a los recientes cambios en el API por Tumblr, ya no se puede ofrecer como una red soportada por el plugin."
|
| 776 |
+
|
| 777 |
+
#: F:\Web
|
| 778 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 779 |
+
#: Local\trunk/sexy-bookmarks.php:137
|
| 780 |
+
msgid "We're currently working on a more sophisticated solution for the email link and will re-enable it when finished."
|
| 781 |
+
msgstr "Actualmente estamos trabajando en una solución más sofisticada para el link de correo y lo reactivaremos cuando esté lista."
|
| 782 |
+
|
| 783 |
+
#: F:\Web
|
| 784 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 785 |
+
#: Local\trunk/sexy-bookmarks.php:142
|
| 786 |
+
msgid " Short URLs have been reset."
|
| 787 |
+
msgstr "Las URLs cortas se han inicializado."
|
| 788 |
+
|
| 789 |
+
#: F:\Web
|
| 790 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 791 |
+
#: Local\trunk/sexy-bookmarks.php:185
|
| 792 |
+
msgid "You are using an outdated version of the plugin"
|
| 793 |
+
msgstr "Estás utilizando una versión no actualizada del plugin"
|
| 794 |
+
|
| 795 |
+
#: F:\Web
|
| 796 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 797 |
+
#: Local\trunk/sexy-bookmarks.php:185
|
| 798 |
+
msgid "please update if you wish to enjoy all available features!"
|
| 799 |
+
msgstr "¡por favor, actualiza si deseas disfrutar de todas las nuevas características!"
|
| 800 |
+
|
| 801 |
+
#: F:\Web
|
| 802 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 803 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 804 |
+
msgid "You are using the development version of the plugin"
|
| 805 |
+
msgstr "Estás utilizando la versión de desarrollo del plugin"
|
| 806 |
+
|
| 807 |
+
#: F:\Web
|
| 808 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 809 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 810 |
+
msgid " beta"
|
| 811 |
+
msgstr " beta"
|
| 812 |
+
|
| 813 |
+
#: F:\Web
|
| 814 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 815 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 816 |
+
msgid "please "
|
| 817 |
+
msgstr "por favor"
|
| 818 |
+
|
| 819 |
+
#: F:\Web
|
| 820 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 821 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 822 |
+
msgid "let us know of any bugs"
|
| 823 |
+
msgstr "haznos saber si hay algún fallo"
|
| 824 |
+
|
| 825 |
+
#: F:\Web
|
| 826 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 827 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 828 |
+
msgid "you may encounter!"
|
| 829 |
+
msgstr "¡nos puedes encontrar aquí!"
|
| 830 |
+
|
| 831 |
+
#: F:\Web
|
| 832 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 833 |
+
#: Local\trunk/sexy-bookmarks.php:213
|
| 834 |
+
msgid "Enabled Networks"
|
| 835 |
+
msgstr "Redes habilitadas"
|
| 836 |
+
|
| 837 |
+
#: F:\Web
|
| 838 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 839 |
+
#: Local\trunk/sexy-bookmarks.php:223
|
| 840 |
+
msgid "Select the Networks to display. Drag to reorder."
|
| 841 |
+
msgstr "Selecciona las Redes para mostrar. Arrastra para reordenar."
|
| 842 |
+
|
| 843 |
+
#: F:\Web
|
| 844 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 845 |
+
#: Local\trunk/sexy-bookmarks.php:237
|
| 846 |
+
msgid "Functionality Settings"
|
| 847 |
+
msgstr "Configuración de funcionalidades"
|
| 848 |
+
|
| 849 |
+
#: F:\Web
|
| 850 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 851 |
+
#: Local\trunk/sexy-bookmarks.php:250
|
| 852 |
+
msgid "This will clear <u>ALL</u> short URLs. - Are you sure?"
|
| 853 |
+
msgstr "Esto limpiará <u>TODAS</u> las URLs cortas. ¿Estás segur@?"
|
| 854 |
+
|
| 855 |
+
#: F:\Web
|
| 856 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 857 |
+
#: Local\trunk/sexy-bookmarks.php:253
|
| 858 |
+
#: Local\trunk/sexy-bookmarks.php:356
|
| 859 |
+
#: Local\trunk/sexy-bookmarks.php:359
|
| 860 |
+
#: Local\trunk/sexy-bookmarks.php:397
|
| 861 |
+
#: Local\trunk/sexy-bookmarks.php:517
|
| 862 |
+
msgid "Yes"
|
| 863 |
+
msgstr "Sí"
|
| 864 |
+
|
| 865 |
+
#: F:\Web
|
| 866 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 867 |
+
#: Local\trunk/sexy-bookmarks.php:253
|
| 868 |
+
msgid "Cancel"
|
| 869 |
+
msgstr "Cancelar"
|
| 870 |
+
|
| 871 |
+
#: F:\Web
|
| 872 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 873 |
+
#: Local\trunk/sexy-bookmarks.php:257
|
| 874 |
+
msgid "Twitter Options:"
|
| 875 |
+
msgstr "Opciones de Twitter:"
|
| 876 |
+
|
| 877 |
+
#: F:\Web
|
| 878 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 879 |
+
#: Local\trunk/sexy-bookmarks.php:258
|
| 880 |
+
msgid "Twitter ID:"
|
| 881 |
+
msgstr "ID de Twitter:"
|
| 882 |
+
|
| 883 |
+
#: F:\Web
|
| 884 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 885 |
+
#: Local\trunk/sexy-bookmarks.php:261
|
| 886 |
+
msgid "Which URL Shortener?"
|
| 887 |
+
msgstr "¿Qué acortador de URLs quieres?"
|
| 888 |
+
|
| 889 |
+
#: F:\Web
|
| 890 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 891 |
+
#: Local\trunk/sexy-bookmarks.php:280
|
| 892 |
+
msgid "Reset all Short URLs"
|
| 893 |
+
msgstr "Inicializa todas las URLs cortas"
|
| 894 |
+
|
| 895 |
+
#: F:\Web
|
| 896 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 897 |
+
#: Local\trunk/sexy-bookmarks.php:292
|
| 898 |
+
msgid "Yahoo! Buzz Defaults:"
|
| 899 |
+
msgstr "Opciones por defecto de Yahoo! Buzz:"
|
| 900 |
+
|
| 901 |
+
#: F:\Web
|
| 902 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 903 |
+
#: Local\trunk/sexy-bookmarks.php:293
|
| 904 |
+
msgid "Default Content Category:"
|
| 905 |
+
msgstr "Categoría de Contenido por defecto:"
|
| 906 |
+
|
| 907 |
+
#: F:\Web
|
| 908 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 909 |
+
#: Local\trunk/sexy-bookmarks.php:327
|
| 910 |
+
msgid "Twittley Defaults:"
|
| 911 |
+
msgstr "Opciones por defecto para Twittley:"
|
| 912 |
+
|
| 913 |
+
#: F:\Web
|
| 914 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 915 |
+
#: Local\trunk/sexy-bookmarks.php:328
|
| 916 |
+
msgid "Primary Content Category:"
|
| 917 |
+
msgstr "Categoría de Contenido principal"
|
| 918 |
+
|
| 919 |
+
#: F:\Web
|
| 920 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 921 |
+
#: Local\trunk/sexy-bookmarks.php:346
|
| 922 |
+
msgid "Enter a comma separated list of general tags which describe your site's posts as a whole. Try not to be too specific, as one post may fall into different \"tag categories\" than other posts."
|
| 923 |
+
msgstr "Introduce una lista separada por comas de las etiquetas que describen tus posts en conjunto. Intenta no ser muy específic@, ya que seguro que hay \"etiquetas\" que pueden describir varios temas."
|
| 924 |
+
|
| 925 |
+
#: F:\Web
|
| 926 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 927 |
+
#: Local\trunk/sexy-bookmarks.php:347
|
| 928 |
+
msgid "This list is primarily used as a failsafe in case you forget to enter WordPress tags for a particular post, in which case this list of tags would be used so as to bring at least *somewhat* relevant search queries based on the general tags that you enter here."
|
| 929 |
+
msgstr "Esta lista se usa principalmente como salvaguarda en caso de que olvides introducir etiquetas de WordPress para un post en concreto: se usará para dar al menos algo relevante en las búsquedas basado en las etiquetas generales que has introducido aquí."
|
| 930 |
+
|
| 931 |
+
#: F:\Web
|
| 932 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 933 |
+
#: Local\trunk/sexy-bookmarks.php:347
|
| 934 |
+
msgid "Click here to close this message"
|
| 935 |
+
msgstr "Pulsa aquí para cerrar el mensaje"
|
| 936 |
+
|
| 937 |
+
#: F:\Web
|
| 938 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 939 |
+
#: Local\trunk/sexy-bookmarks.php:347
|
| 940 |
+
msgid "close"
|
| 941 |
+
msgstr "cerrar"
|
| 942 |
+
|
| 943 |
+
#: F:\Web
|
| 944 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 945 |
+
#: Local\trunk/sexy-bookmarks.php:349
|
| 946 |
+
msgid "Default Tags:"
|
| 947 |
+
msgstr "Etiquetas por defecto:"
|
| 948 |
+
|
| 949 |
+
#: F:\Web
|
| 950 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 951 |
+
#: Local\trunk/sexy-bookmarks.php:350
|
| 952 |
+
#: Local\trunk/sexy-bookmarks.php:515
|
| 953 |
+
msgid "Click here for help with this option"
|
| 954 |
+
msgstr "Pulsa aquí para ver la ayuda sobre esta opción"
|
| 955 |
+
|
| 956 |
+
#: F:\Web
|
| 957 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 958 |
+
#: Local\trunk/sexy-bookmarks.php:354
|
| 959 |
+
msgid "General Functionality Options:"
|
| 960 |
+
msgstr "Opciones de Funcionalidades Generales:"
|
| 961 |
+
|
| 962 |
+
#: F:\Web
|
| 963 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 964 |
+
#: Local\trunk/sexy-bookmarks.php:355
|
| 965 |
+
msgid "Add nofollow to the links?"
|
| 966 |
+
msgstr "¿Quieres añadir 'nofollow' a los links?"
|
| 967 |
+
|
| 968 |
+
#: F:\Web
|
| 969 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 970 |
+
#: Local\trunk/sexy-bookmarks.php:357
|
| 971 |
+
#: Local\trunk/sexy-bookmarks.php:360
|
| 972 |
+
#: Local\trunk/sexy-bookmarks.php:398
|
| 973 |
+
#: Local\trunk/sexy-bookmarks.php:402
|
| 974 |
+
#: Local\trunk/sexy-bookmarks.php:518
|
| 975 |
+
msgid "No"
|
| 976 |
+
msgstr "No"
|
| 977 |
+
|
| 978 |
+
#: F:\Web
|
| 979 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 980 |
+
#: Local\trunk/sexy-bookmarks.php:358
|
| 981 |
+
msgid "Open links in new window?"
|
| 982 |
+
msgstr "¿Quieres abrir los links en una nueva ventana?"
|
| 983 |
+
|
| 984 |
+
#: F:\Web
|
| 985 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 986 |
+
#: Local\trunk/sexy-bookmarks.php:368
|
| 987 |
+
msgid "General Look & Feel"
|
| 988 |
+
msgstr "Presentación General:"
|
| 989 |
+
|
| 990 |
+
#: F:\Web
|
| 991 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 992 |
+
#: Local\trunk/sexy-bookmarks.php:381
|
| 993 |
+
#: Local\trunk/sexy-bookmarks.php:390
|
| 994 |
+
msgid "This will void any custom CSS applied below."
|
| 995 |
+
msgstr "Esto quitará cualquier CSS personalizado aplicado a continuación."
|
| 996 |
+
|
| 997 |
+
#: F:\Web
|
| 998 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 999 |
+
#: Local\trunk/sexy-bookmarks.php:384
|
| 1000 |
+
#: Local\trunk/sexy-bookmarks.php:393
|
| 1001 |
+
msgid "Ok"
|
| 1002 |
+
msgstr "Aceptar"
|
| 1003 |
+
|
| 1004 |
+
#: F:\Web
|
| 1005 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1006 |
+
#: Local\trunk/sexy-bookmarks.php:396
|
| 1007 |
+
msgid "Animate-expand multi-lined bookmarks?"
|
| 1008 |
+
msgstr "¿Animar (expandir) los bookmarks con múltiples líneas?"
|
| 1009 |
+
|
| 1010 |
+
#: F:\Web
|
| 1011 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1012 |
+
#: Local\trunk/sexy-bookmarks.php:399
|
| 1013 |
+
msgid "Auto-space/center the bookmarks?"
|
| 1014 |
+
msgstr "¿Auto-espacio/centrar los bookmarks?"
|
| 1015 |
+
|
| 1016 |
+
#: F:\Web
|
| 1017 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1018 |
+
#: Local\trunk/sexy-bookmarks.php:400
|
| 1019 |
+
msgid "Space"
|
| 1020 |
+
msgstr "Espacio"
|
| 1021 |
+
|
| 1022 |
+
#: F:\Web
|
| 1023 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1024 |
+
#: Local\trunk/sexy-bookmarks.php:401
|
| 1025 |
+
msgid "Center"
|
| 1026 |
+
msgstr "Centrar"
|
| 1027 |
+
|
| 1028 |
+
#: F:\Web
|
| 1029 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1030 |
+
#: Local\trunk/sexy-bookmarks.php:415
|
| 1031 |
+
msgid "If you see this message, please delete the contents of this textarea and click \\\"Save Changes\\\"."
|
| 1032 |
+
msgstr "Si ves este mensaje, por favor, borra los contenidos de la área de texto y pulsa \\\"Guardar Cambios\\\"."
|
| 1033 |
+
|
| 1034 |
+
#: F:\Web
|
| 1035 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1036 |
+
#: Local\trunk/sexy-bookmarks.php:419
|
| 1037 |
+
msgid "You can style the DIV that holds the menu here:"
|
| 1038 |
+
msgstr "Aquí puedes personalizar el estilo del DIV que contiene el menú:"
|
| 1039 |
+
|
| 1040 |
+
#: F:\Web
|
| 1041 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1042 |
+
#: Local\trunk/sexy-bookmarks.php:422
|
| 1043 |
+
msgid "jQuery Compatibility Fix"
|
| 1044 |
+
msgstr "Aplicar solución para compatibilidad con JQuery"
|
| 1045 |
+
|
| 1046 |
+
#: F:\Web
|
| 1047 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1048 |
+
#: Local\trunk/sexy-bookmarks.php:423
|
| 1049 |
+
msgid "Check this box ONLY if the animate-expand, auto-center, or auto-space features don't work for you!"
|
| 1050 |
+
msgstr "¡Marca esta casilla SÓLO si la animación, auto-centrado, o auto-espacio no te funcionan!"
|
| 1051 |
+
|
| 1052 |
+
#: F:\Web
|
| 1053 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1054 |
+
#: Local\trunk/sexy-bookmarks.php:431
|
| 1055 |
+
msgid "Background Image"
|
| 1056 |
+
msgstr "Imagen de fondo"
|
| 1057 |
+
|
| 1058 |
+
#: F:\Web
|
| 1059 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1060 |
+
#: Local\trunk/sexy-bookmarks.php:442
|
| 1061 |
+
msgid "Use a background image?"
|
| 1062 |
+
msgstr "¿Quieres utilizar una imagen de fondo?"
|
| 1063 |
+
|
| 1064 |
+
#: F:\Web
|
| 1065 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1066 |
+
#: Local\trunk/sexy-bookmarks.php:470
|
| 1067 |
+
msgid "Menu Placement"
|
| 1068 |
+
msgstr "Colocación del menú"
|
| 1069 |
+
|
| 1070 |
+
#: F:\Web
|
| 1071 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1072 |
+
#: Local\trunk/sexy-bookmarks.php:483
|
| 1073 |
+
msgid "Need help with this? Find it in the "
|
| 1074 |
+
msgstr "¿Necesitas ayuda? Busca en la"
|
| 1075 |
+
|
| 1076 |
+
#: F:\Web
|
| 1077 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1078 |
+
#: Local\trunk/sexy-bookmarks.php:483
|
| 1079 |
+
msgid "official install guide"
|
| 1080 |
+
msgstr "guía oficial de instalación"
|
| 1081 |
+
|
| 1082 |
+
#: F:\Web
|
| 1083 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1084 |
+
#: Local\trunk/sexy-bookmarks.php:492
|
| 1085 |
+
msgid "This feature is still in the experimental phase, so please "
|
| 1086 |
+
msgstr "Esta funcionalidad está todavía en fase experimental"
|
| 1087 |
+
|
| 1088 |
+
#: F:\Web
|
| 1089 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1090 |
+
#: Local\trunk/sexy-bookmarks.php:492
|
| 1091 |
+
msgid "report any bugs"
|
| 1092 |
+
msgstr "informa de los fallos"
|
| 1093 |
+
|
| 1094 |
+
#: F:\Web
|
| 1095 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1096 |
+
#: Local\trunk/sexy-bookmarks.php:492
|
| 1097 |
+
msgid "you may find"
|
| 1098 |
+
msgstr "puedes encontrar"
|
| 1099 |
+
|
| 1100 |
+
#: F:\Web
|
| 1101 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1102 |
+
#: Local\trunk/sexy-bookmarks.php:498
|
| 1103 |
+
msgid "Menu Location (in relevance to content):"
|
| 1104 |
+
msgstr "Situación del Menú (en relación al contenido):"
|
| 1105 |
+
|
| 1106 |
+
#: F:\Web
|
| 1107 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1108 |
+
#: Local\trunk/sexy-bookmarks.php:499
|
| 1109 |
+
msgid "Above Content"
|
| 1110 |
+
msgstr "Por encima del Contenido"
|
| 1111 |
+
|
| 1112 |
+
#: F:\Web
|
| 1113 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1114 |
+
#: Local\trunk/sexy-bookmarks.php:500
|
| 1115 |
+
msgid "Below Content"
|
| 1116 |
+
msgstr "A continuación del Contenido"
|
| 1117 |
+
|
| 1118 |
+
#: F:\Web
|
| 1119 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1120 |
+
#: Local\trunk/sexy-bookmarks.php:501
|
| 1121 |
+
msgid "Manual Mode"
|
| 1122 |
+
msgstr "Manual"
|
| 1123 |
+
|
| 1124 |
+
#: F:\Web
|
| 1125 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1126 |
+
#: Local\trunk/sexy-bookmarks.php:502
|
| 1127 |
+
msgid "Posts, pages, or the whole shebang?"
|
| 1128 |
+
msgstr "¿Posts, páginas, o todo? "
|
| 1129 |
+
|
| 1130 |
+
#: F:\Web
|
| 1131 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1132 |
+
#: Local\trunk/sexy-bookmarks.php:516
|
| 1133 |
+
msgid "Show in RSS feed?"
|
| 1134 |
+
msgstr "¿Quieres que se muestre en el RSS?"
|
| 1135 |
+
|
| 1136 |
+
#: F:\Web
|
| 1137 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1138 |
+
#: Local\trunk/sexy-bookmarks.php:520
|
| 1139 |
+
msgid "Hide menu from mobile browsers?"
|
| 1140 |
+
msgstr "¿Quieres ocultarlo para los navegadores de móviles?"
|
| 1141 |
+
|
| 1142 |
+
#: F:\Web
|
| 1143 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1144 |
+
#: Local\trunk/sexy-bookmarks.php:528
|
| 1145 |
+
msgid "Save Changes"
|
| 1146 |
+
msgstr "Guardar Cambios"
|
| 1147 |
+
|
| 1148 |
+
#: F:\Web
|
| 1149 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1150 |
+
#: Local\trunk/sexy-bookmarks.php:536
|
| 1151 |
+
msgid "Plugin Info"
|
| 1152 |
+
msgstr "Información del Plugin"
|
| 1153 |
+
|
| 1154 |
+
#: F:\Web
|
| 1155 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1156 |
+
#: Local\trunk/sexy-bookmarks.php:540
|
| 1157 |
+
msgid "Helpful Plugin Links:"
|
| 1158 |
+
msgstr "Links de ayuda sobre el Plugin"
|
| 1159 |
+
|
| 1160 |
+
#: F:\Web
|
| 1161 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1162 |
+
#: Local\trunk/sexy-bookmarks.php:542
|
| 1163 |
+
msgid "Installation & Usage Guide"
|
| 1164 |
+
msgstr "Guía de Instalación y Uso"
|
| 1165 |
+
|
| 1166 |
+
#: F:\Web
|
| 1167 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1168 |
+
#: Local\trunk/sexy-bookmarks.php:543
|
| 1169 |
+
msgid "Frequently Asked Questions"
|
| 1170 |
+
msgstr "Preguntas Frecuentes"
|
| 1171 |
+
|
| 1172 |
+
#: F:\Web
|
| 1173 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1174 |
+
#: Local\trunk/sexy-bookmarks.php:544
|
| 1175 |
+
msgid "Bug Submission Form"
|
| 1176 |
+
msgstr "Formulario para enviar Fallos"
|
| 1177 |
+
|
| 1178 |
+
#: F:\Web
|
| 1179 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1180 |
+
#: Local\trunk/sexy-bookmarks.php:545
|
| 1181 |
+
msgid "Feature Request Form"
|
| 1182 |
+
msgstr "Formulario para proponer Funcionalidades"
|
| 1183 |
+
|
| 1184 |
+
#: F:\Web
|
| 1185 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1186 |
+
#: Local\trunk/sexy-bookmarks.php:546
|
| 1187 |
+
msgid "Other SexyBookmarks Platforms"
|
| 1188 |
+
msgstr "Otras Plataformas de SexyBookmarks"
|
| 1189 |
+
|
| 1190 |
+
#: F:\Web
|
| 1191 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1192 |
+
#: Local\trunk/sexy-bookmarks.php:547
|
| 1193 |
+
msgid "SexyFox Firefox Toolbar"
|
| 1194 |
+
msgstr "SexyFox: Barra de herramientas para Firefox"
|
| 1195 |
+
|
| 1196 |
+
#: F:\Web
|
| 1197 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1198 |
+
#: Local\trunk/sexy-bookmarks.php:550
|
| 1199 |
+
msgid "Current Plugin Stats:"
|
| 1200 |
+
msgstr "Estadísticas actuales del Plugin:"
|
| 1201 |
+
|
| 1202 |
+
#: F:\Web
|
| 1203 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1204 |
+
#: Local\trunk/sexy-bookmarks.php:559
|
| 1205 |
+
#, php-format
|
| 1206 |
+
msgid "%s ago"
|
| 1207 |
+
msgstr "hace %s"
|
| 1208 |
+
|
| 1209 |
+
#: F:\Web
|
| 1210 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1211 |
+
#: Local\trunk/sexy-bookmarks.php:571
|
| 1212 |
+
msgid "Stable Version:"
|
| 1213 |
+
msgstr "Versión Estable:"
|
| 1214 |
+
|
| 1215 |
+
#: F:\Web
|
| 1216 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1217 |
+
#: Local\trunk/sexy-bookmarks.php:572
|
| 1218 |
+
msgid "Last Updated:"
|
| 1219 |
+
msgstr "Última Actualización:"
|
| 1220 |
+
|
| 1221 |
+
#: F:\Web
|
| 1222 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1223 |
+
#: Local\trunk/sexy-bookmarks.php:573
|
| 1224 |
+
msgid "Downloaded:"
|
| 1225 |
+
msgstr "Descargas:"
|
| 1226 |
+
|
| 1227 |
+
#: F:\Web
|
| 1228 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1229 |
+
#: Local\trunk/sexy-bookmarks.php:573
|
| 1230 |
+
msgid "times"
|
| 1231 |
+
msgstr "veces"
|
| 1232 |
+
|
| 1233 |
+
#: F:\Web
|
| 1234 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1235 |
+
#: Local\trunk/sexy-bookmarks.php:574
|
| 1236 |
+
msgid "User Rating:"
|
| 1237 |
+
msgstr "Calificación de Usuarios:"
|
| 1238 |
+
|
| 1239 |
+
#: F:\Web
|
| 1240 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1241 |
+
#: Local\trunk/sexy-bookmarks.php:574
|
| 1242 |
+
msgid "stars - Based on"
|
| 1243 |
+
msgstr "estrellas - Basado en"
|
| 1244 |
+
|
| 1245 |
+
#: F:\Web
|
| 1246 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1247 |
+
#: Local\trunk/sexy-bookmarks.php:574
|
| 1248 |
+
msgid "votes"
|
| 1249 |
+
msgstr "votos"
|
| 1250 |
+
|
| 1251 |
+
#: F:\Web
|
| 1252 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1253 |
+
#: Local\trunk/sexy-bookmarks.php:582
|
| 1254 |
+
msgid "Plugin Sponsors"
|
| 1255 |
+
msgstr "Patrocinadores del Plugin"
|
| 1256 |
+
|
| 1257 |
+
#: F:\Web
|
| 1258 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1259 |
+
#: Local\trunk/sexy-bookmarks.php:615
|
| 1260 |
+
msgid "Support by Donating"
|
| 1261 |
+
msgstr "Ayúdanos con tu Donación"
|
| 1262 |
+
|
| 1263 |
+
#: F:\Web
|
| 1264 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1265 |
+
#: Local\trunk/sexy-bookmarks.php:619
|
| 1266 |
+
msgid "Surely the fact that we're making the web a sexier place one blog at a time is worth a drink or three, right?"
|
| 1267 |
+
msgstr "Sin duda, el hecho de que estames haciendo de la red un lugar más atractivo merece tomar una copa o tres, ¿verdad?"
|
| 1268 |
+
|
| 1269 |
+
#: F:\Web
|
| 1270 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1271 |
+
#: Local\trunk/sexy-bookmarks.php:621
|
| 1272 |
+
#: Local\trunk/sexy-bookmarks.php:624
|
| 1273 |
+
msgid "Help support the development of this plugin by donating!"
|
| 1274 |
+
msgstr "¡Ayúdanos a desarrollar este Plugin con tu donación!"
|
| 1275 |
+
|
| 1276 |
+
#: F:\Web
|
| 1277 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1278 |
+
#: Local\trunk/sexy-bookmarks.php:634
|
| 1279 |
+
msgid "Top Supporters"
|
| 1280 |
+
msgstr "Mayores Patrocinadores"
|
| 1281 |
+
|
| 1282 |
+
#: F:\Web
|
| 1283 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1284 |
+
#: Local\trunk/sexy-bookmarks.php:669
|
| 1285 |
+
msgid "Shout-Outs"
|
| 1286 |
+
msgstr "Shout-Outs"
|
| 1287 |
+
|
| 1288 |
+
#: F:\Web
|
| 1289 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1290 |
+
#: Local\trunk/sexy-bookmarks.php:674
|
| 1291 |
+
msgid "GUI Icons: Pinvoke"
|
| 1292 |
+
msgstr "GUI Icons: Pinvoke"
|
| 1293 |
+
|
| 1294 |
+
#: F:\Web
|
| 1295 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1296 |
+
#: Local\trunk/sexy-bookmarks.php:675
|
| 1297 |
+
msgid "Original Skin Icons: Function"
|
| 1298 |
+
msgstr "Iconos Originales: Function"
|
| 1299 |
+
|
| 1300 |
+
#: F:\Web
|
| 1301 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1302 |
+
#: Local\trunk/sexy-bookmarks.php:676
|
| 1303 |
+
msgid "Bug Patch: Artem Russakovskii"
|
| 1304 |
+
msgstr "Revisión de fallos: Artem Russakovskii"
|
| 1305 |
+
|
| 1306 |
+
#: F:\Web
|
| 1307 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1308 |
+
#: Local\trunk/sexy-bookmarks.php:677
|
| 1309 |
+
msgid "Twitter encoding fix: Gautam Gupta"
|
| 1310 |
+
msgstr "Solución para codificación de Twitter: Gautam Gupta"
|
| 1311 |
+
|
| 1312 |
+
#: F:\Web
|
| 1313 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1314 |
+
#: Local\trunk/sexy-bookmarks.php:678
|
| 1315 |
+
msgid "Russian translation: Yuri Gribov"
|
| 1316 |
+
msgstr "Traducción Rusa: Yuri Gribov"
|
| 1317 |
+
|
| 1318 |
+
#: F:\Web
|
| 1319 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1320 |
+
#: Local\trunk/sexy-bookmarks.php:679
|
| 1321 |
+
msgid "French translation: Maitre Mo"
|
| 1322 |
+
msgstr "Traducción Francesa: Maitre Mo"
|
| 1323 |
+
|
| 1324 |
+
#: F:\Web
|
| 1325 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1326 |
+
#: Local\trunk/sexy-bookmarks.php:680
|
| 1327 |
+
msgid "bit.ly bug fix: Konstantin Kovshenin"
|
| 1328 |
+
msgstr "Solución para fallo en bit.ly: Konstantin Kovshenin"
|
| 1329 |
+
|
| 1330 |
+
#: F:\Web
|
| 1331 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1332 |
+
#: Local\trunk/sexy-bookmarks.php:681
|
| 1333 |
+
msgid "Romanian translation: Ghenciu Ciprian"
|
| 1334 |
+
msgstr "Traducción Rumana: Ghenciu Ciprian"
|
| 1335 |
+
|
| 1336 |
+
#: F:\Web
|
| 1337 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1338 |
+
#: Local\trunk/sexy-bookmarks.php:682
|
| 1339 |
+
msgid "Italian translation: Carlo Veltri"
|
| 1340 |
+
msgstr "Traducción Italiana: Carlo Veltri"
|
| 1341 |
+
|
| 1342 |
+
#: F:\Web
|
| 1343 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1344 |
+
#: Local\trunk/sexy-bookmarks.php:707
|
| 1345 |
+
msgid "You're using an outdated version of SexyBookmarks!"
|
| 1346 |
+
msgstr "¡Estás utilizando una versión obsoleta de SexyBookmarks!"
|
| 1347 |
+
|
| 1348 |
+
#: F:\Web
|
| 1349 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 1350 |
+
#: Local\trunk/sexy-bookmarks.php:707
|
| 1351 |
+
msgid "Please update to the latest version"
|
| 1352 |
+
msgstr "Por favor, actualiza a la última versión"
|
| 1353 |
+
|
languages/shrsb-fr_FR.mo
ADDED
|
Binary file
|
languages/shrsb-fr_FR.po
ADDED
|
@@ -0,0 +1,1035 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
msgid ""
|
| 2 |
+
msgstr ""
|
| 3 |
+
"Project-Id-Version: SexyBookmarks\n"
|
| 4 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/sexybookmarks\n"
|
| 5 |
+
"POT-Creation-Date: 2010-12-27 17:11:55+00:00\n"
|
| 6 |
+
"PO-Revision-Date: 2011-01-02 05:27+0100\n"
|
| 7 |
+
"Last-Translator: Maître Mô <postmaster@maitremo.fr>\n"
|
| 8 |
+
"Language-Team: Maître Mô <postmaster@maitremo.fr>\n"
|
| 9 |
+
"MIME-Version: 1.0\n"
|
| 10 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
+
"Plural-Forms: nplurals=2; plural=n != 1;\n"
|
| 13 |
+
"X-Poedit-Language: French\n"
|
| 14 |
+
"X-Poedit-Country: FRANCE\n"
|
| 15 |
+
"X-Poedit-SourceCharset: utf-8\n"
|
| 16 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_ex:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2\n"
|
| 17 |
+
"X-Poedit-Basepath: ../\n"
|
| 18 |
+
"X-Textdomain-Support: yes\n"
|
| 19 |
+
"X-Poedit-SearchPath-0: .\n"
|
| 20 |
+
|
| 21 |
+
# @ shrsb
|
| 22 |
+
#: sexy-bookmarks.php:141
|
| 23 |
+
msgid "NOTICE: Shareaholic needs to be configured... Please visit the %sPlugin Options Page%s and set your preferences."
|
| 24 |
+
msgstr "NOTE : Shareaholic a besoin d'être configuré... Merci de visiter la %sPage des Options de l'Extension%s et d'y régler vos préférences."
|
| 25 |
+
|
| 26 |
+
# @ shrsb
|
| 27 |
+
#: sexy-bookmarks.php:193
|
| 28 |
+
msgid "WARNING: You are about to reset all settings to their default state! Do you wish to continue?"
|
| 29 |
+
msgstr "ATTENTION : vous êtes sur le point de remplacer tous vos réglages par ceux par défaut ! Souhaitez-vous continuer ?"
|
| 30 |
+
|
| 31 |
+
# @ shrsb
|
| 32 |
+
#: sexy-bookmarks.php:197
|
| 33 |
+
#: sexy-bookmarks.php:458
|
| 34 |
+
#: sexy-bookmarks.php:520
|
| 35 |
+
#: sexy-bookmarks.php:673
|
| 36 |
+
#: sexy-bookmarks.php:677
|
| 37 |
+
#: sexy-bookmarks.php:738
|
| 38 |
+
#: sexy-bookmarks.php:819
|
| 39 |
+
msgid "Yes"
|
| 40 |
+
msgstr "Oui"
|
| 41 |
+
|
| 42 |
+
# @ shrsb
|
| 43 |
+
#: sexy-bookmarks.php:197
|
| 44 |
+
#: sexy-bookmarks.php:520
|
| 45 |
+
msgid "Cancel"
|
| 46 |
+
msgstr "Annuler"
|
| 47 |
+
|
| 48 |
+
# @ shrsb
|
| 49 |
+
#: sexy-bookmarks.php:240
|
| 50 |
+
msgid "All settings have been reset to their default values."
|
| 51 |
+
msgstr "Tous les réglages ont été ramenés à leurs valeurs par défaut."
|
| 52 |
+
|
| 53 |
+
# @ shrsb
|
| 54 |
+
#: sexy-bookmarks.php:284
|
| 55 |
+
msgid "Your changes have been saved successfully!"
|
| 56 |
+
msgstr "Vos modifications ont été sauvegardées avec succès!"
|
| 57 |
+
|
| 58 |
+
# @ shrsb
|
| 59 |
+
#: sexy-bookmarks.php:287
|
| 60 |
+
msgid "Please choose where you would like the menu to be displayed."
|
| 61 |
+
msgstr "Veuillez s'il vous plaît choisir l'endroit où vous souhaitez que le menu soit affiché."
|
| 62 |
+
|
| 63 |
+
# @ shrsb
|
| 64 |
+
#: sexy-bookmarks.php:288
|
| 65 |
+
msgid "You can't display the menu if you don't choose a few sites to add to it!"
|
| 66 |
+
msgstr "Vous ne pouvez pas afficher le menu si vous ne choisissez pas quelques sites à lui ajouter !"
|
| 67 |
+
|
| 68 |
+
# @ shrsb
|
| 69 |
+
#: sexy-bookmarks.php:289
|
| 70 |
+
msgid "Please choose where you want the menu displayed."
|
| 71 |
+
msgstr "Veillez s'il vous plaît choisir où vous souhaitez que le menu soit affiché."
|
| 72 |
+
|
| 73 |
+
# @ shrsb
|
| 74 |
+
#: sexy-bookmarks.php:304
|
| 75 |
+
msgid "You must first download and activate the %sTwitter Friendly Links Plugin%s before hosting your own short URLs..."
|
| 76 |
+
msgstr "Vous devez d'abord télécharger et activer l'extension %sTwitter Friendly Links%s avant d'héberger vos propres URLs courtes..."
|
| 77 |
+
|
| 78 |
+
# @ shrsb
|
| 79 |
+
#: sexy-bookmarks.php:306
|
| 80 |
+
msgid "You must first download and activate the %sYOURLS Plugin%s before hosting your own short URLs..."
|
| 81 |
+
msgstr "Vous devez d'abord télécharger et activer l'extension %sYOURLS%s avant d'héberger vos propres URLs courtes..."
|
| 82 |
+
|
| 83 |
+
# @ shrsb
|
| 84 |
+
#: sexy-bookmarks.php:323
|
| 85 |
+
msgid "WARNING: The request for a custom sprite has timed out. Reverting to default sprite files."
|
| 86 |
+
msgstr "ATTENTION : la requête d'une image animée customisée a expiré. Retour aux fichiers de l'image animée par défaut."
|
| 87 |
+
|
| 88 |
+
# @ shrsb
|
| 89 |
+
#: sexy-bookmarks.php:325
|
| 90 |
+
msgid "Changes saved successfully. However, you should try to generate a custom sprite again later."
|
| 91 |
+
msgstr "Modifications enregistrées avec succès. Cependant, vous devriez réessayer de générer une image animée customisée plus tard."
|
| 92 |
+
|
| 93 |
+
# @ shrsb
|
| 94 |
+
#: sexy-bookmarks.php:329
|
| 95 |
+
#: sexy-bookmarks.php:351
|
| 96 |
+
msgid "WARNING: Your %sspritegen folder%s is not writeable by the server! %sNeed Help?%s"
|
| 97 |
+
msgstr "ATTENTION : votre %sdossier spritegen%s ne peut pas être écrit par le serveur ! %Besoin d'Aide ?%s"
|
| 98 |
+
|
| 99 |
+
# @ shrsb
|
| 100 |
+
#: sexy-bookmarks.php:331
|
| 101 |
+
#: sexy-bookmarks.php:336
|
| 102 |
+
#: sexy-bookmarks.php:341
|
| 103 |
+
#: sexy-bookmarks.php:352
|
| 104 |
+
#: sexy-bookmarks.php:356
|
| 105 |
+
#: sexy-bookmarks.php:360
|
| 106 |
+
msgid "Changes saved successfully. However, settings are not optimal until you resolve the issue listed above."
|
| 107 |
+
msgstr "Modifications sauvegardées avec succès. Cependant, vos réglages ne seront pas optimaux jusqu'à ce que vous résolviez les problèmes listés ci-dessus."
|
| 108 |
+
|
| 109 |
+
# @ shrsb
|
| 110 |
+
#: sexy-bookmarks.php:334
|
| 111 |
+
#: sexy-bookmarks.php:355
|
| 112 |
+
msgid "WARNING: You need to delete the current custom sprite %s before the plugin can write to the folder. %sNeed Help?%s"
|
| 113 |
+
msgstr "ATTENTION : vous devez détruire l'image animée customisée actuelle %s avant que l'extension puisse écrire le dossier. %sBesoin d'Aide ?%s"
|
| 114 |
+
|
| 115 |
+
# @ shrsb
|
| 116 |
+
#: sexy-bookmarks.php:339
|
| 117 |
+
#: sexy-bookmarks.php:359
|
| 118 |
+
msgid "WARNING: You need to delete the current custom stylesheet %s before the plugin can write to the folder. %sNeed Help?%s"
|
| 119 |
+
msgstr "ATTENTION : vous devez détruire la feuille de style customisée actuelle %s avant que l'extension puisse écrire le dossier. %sBesoin d'Aide ?%s"
|
| 120 |
+
|
| 121 |
+
# @ shrsb
|
| 122 |
+
#: sexy-bookmarks.php:366
|
| 123 |
+
msgid "Short URL(s) have been reset."
|
| 124 |
+
msgstr "L(es) URL(s) courte(s) a/ont été remises à zéro. "
|
| 125 |
+
|
| 126 |
+
# @ shrsb
|
| 127 |
+
#: sexy-bookmarks.php:451
|
| 128 |
+
msgid "BETA Testing"
|
| 129 |
+
msgstr "Test BETA"
|
| 130 |
+
|
| 131 |
+
# @ default
|
| 132 |
+
#: sexy-bookmarks.php:456
|
| 133 |
+
msgid "We completely re-wrote Shareaholic from the ground up to make it faster, leaner, better."
|
| 134 |
+
msgstr "Nous avons totalement réécrit Shareaholic de zéro, pour le rendre plus rapide, plus léger, meilleur."
|
| 135 |
+
|
| 136 |
+
# @ shrsb
|
| 137 |
+
#: sexy-bookmarks.php:457
|
| 138 |
+
msgid "Use the new version? (BETA)"
|
| 139 |
+
msgstr "Utiliser la nouvelle version ? (BETA)"
|
| 140 |
+
|
| 141 |
+
# @ shrsb
|
| 142 |
+
#: sexy-bookmarks.php:459
|
| 143 |
+
#: sexy-bookmarks.php:674
|
| 144 |
+
#: sexy-bookmarks.php:678
|
| 145 |
+
#: sexy-bookmarks.php:682
|
| 146 |
+
#: sexy-bookmarks.php:739
|
| 147 |
+
#: sexy-bookmarks.php:743
|
| 148 |
+
#: sexy-bookmarks.php:820
|
| 149 |
+
msgid "No"
|
| 150 |
+
msgstr "Non"
|
| 151 |
+
|
| 152 |
+
# @ shrsb
|
| 153 |
+
#: sexy-bookmarks.php:460
|
| 154 |
+
msgid "You can switch back at any time."
|
| 155 |
+
msgstr "Vous pouvez revenir en arrière n'importe quand."
|
| 156 |
+
|
| 157 |
+
# @ shrsb
|
| 158 |
+
#: sexy-bookmarks.php:464
|
| 159 |
+
msgid "We are anxious to hear what you think! If you would like to leave us some feedback, please follow %sthis link%s and share your thoughts and opinions with us."
|
| 160 |
+
msgstr "Nous sommes impatients d'entendre ce que vous en pensez ! Si vous acceptez de nous laisser un retour, merci de bien vouloir suivre %sce lien%s et de partager vos idées et opinions avec nous."
|
| 161 |
+
|
| 162 |
+
# @ shrsb
|
| 163 |
+
#: sexy-bookmarks.php:470
|
| 164 |
+
msgid "Enabled Networks"
|
| 165 |
+
msgstr "Réseaux activés"
|
| 166 |
+
|
| 167 |
+
# @ shrsb
|
| 168 |
+
#: sexy-bookmarks.php:474
|
| 169 |
+
msgid "Select the Networks to display. Drag to reorder."
|
| 170 |
+
msgstr "Sélectionnez les réseaux à afficher. Faites glisser pour réorganiser."
|
| 171 |
+
|
| 172 |
+
# @ shrsb
|
| 173 |
+
#: sexy-bookmarks.php:476
|
| 174 |
+
msgid "Select"
|
| 175 |
+
msgstr "Sélectionner"
|
| 176 |
+
|
| 177 |
+
# @ shrsb
|
| 178 |
+
#: sexy-bookmarks.php:477
|
| 179 |
+
msgid "All"
|
| 180 |
+
msgstr "Tous"
|
| 181 |
+
|
| 182 |
+
# @ shrsb
|
| 183 |
+
#: sexy-bookmarks.php:478
|
| 184 |
+
msgid "None"
|
| 185 |
+
msgstr "Aucun"
|
| 186 |
+
|
| 187 |
+
# @ shrsb
|
| 188 |
+
#: sexy-bookmarks.php:479
|
| 189 |
+
msgid "Most Popular"
|
| 190 |
+
msgstr "Plus populaires"
|
| 191 |
+
|
| 192 |
+
# @ shrsb
|
| 193 |
+
#: sexy-bookmarks.php:489
|
| 194 |
+
msgid "Made with Much Love, these Icons are © Shareaholic"
|
| 195 |
+
msgstr "Faites avec beaucoup d'amour, ces Icônes sont © Shareaholic"
|
| 196 |
+
|
| 197 |
+
# @ shrsb
|
| 198 |
+
#: sexy-bookmarks.php:494
|
| 199 |
+
msgid "Functionality Settings"
|
| 200 |
+
msgstr "Paramètres de Fonctionnalité"
|
| 201 |
+
|
| 202 |
+
# @ shrsb
|
| 203 |
+
#: sexy-bookmarks.php:500
|
| 204 |
+
msgid "Twitter Options:"
|
| 205 |
+
msgstr "Options Twitter :"
|
| 206 |
+
|
| 207 |
+
# @ shrsb
|
| 208 |
+
#: sexy-bookmarks.php:502
|
| 209 |
+
msgid "Configuration Instructions:"
|
| 210 |
+
msgstr "Instructions de Configuration :"
|
| 211 |
+
|
| 212 |
+
# @ shrsb
|
| 213 |
+
#: sexy-bookmarks.php:503
|
| 214 |
+
msgid "Using the strings %s and %s you can fully customize your tweet output."
|
| 215 |
+
msgstr "En utilisant les chaînes %s et %s vous pouvez totalement customiser vos sorties de tweets."
|
| 216 |
+
|
| 217 |
+
# @ shrsb
|
| 218 |
+
#: sexy-bookmarks.php:504
|
| 219 |
+
msgid "Example Configurations:"
|
| 220 |
+
msgstr "Exemples de Configurations :"
|
| 221 |
+
|
| 222 |
+
# @ shrsb
|
| 223 |
+
#: sexy-bookmarks.php:506
|
| 224 |
+
msgid "or"
|
| 225 |
+
msgstr "ou"
|
| 226 |
+
|
| 227 |
+
# @ shrsb
|
| 228 |
+
#: sexy-bookmarks.php:510
|
| 229 |
+
msgid "Configure Custom Tweet Template:"
|
| 230 |
+
msgstr "Configurer le Modèle de Tweets Customisé"
|
| 231 |
+
|
| 232 |
+
# @ shrsb
|
| 233 |
+
#: sexy-bookmarks.php:510
|
| 234 |
+
msgid "Characters:"
|
| 235 |
+
msgstr "Caractères :"
|
| 236 |
+
|
| 237 |
+
# @ shrsb
|
| 238 |
+
#: sexy-bookmarks.php:513
|
| 239 |
+
msgid "Example Tweet Output:"
|
| 240 |
+
msgstr "Exemple de Sortie de Tweet :"
|
| 241 |
+
|
| 242 |
+
# @ shrsb
|
| 243 |
+
#: sexy-bookmarks.php:517
|
| 244 |
+
msgid "This will clear %sALL%s short URLs. - Are you sure? Note: you will also need to \"Save Changes\" to complete the reset."
|
| 245 |
+
msgstr "Ceci écrasera %sTOUTES%s vos URLs courtes... Êtes-vous certain ? Note : vous aurez également besoin de \"Sauvegarder les Modifications\" pour terminer la mise à jour."
|
| 246 |
+
|
| 247 |
+
# @ shrsb
|
| 248 |
+
#: sexy-bookmarks.php:524
|
| 249 |
+
msgid "Which URL Shortener?"
|
| 250 |
+
msgstr "Quelle URL Raccourcie ?"
|
| 251 |
+
|
| 252 |
+
# @ shrsb
|
| 253 |
+
#: sexy-bookmarks.php:529
|
| 254 |
+
msgid "Don't use a shortener"
|
| 255 |
+
msgstr "Ne pas utiliser de raccourcisseur"
|
| 256 |
+
|
| 257 |
+
# @ shrsb
|
| 258 |
+
#: sexy-bookmarks.php:544
|
| 259 |
+
msgid "Reset all Short URLs"
|
| 260 |
+
msgstr "Reconfigurer toutes les URLs courtes"
|
| 261 |
+
|
| 262 |
+
# @ shrsb
|
| 263 |
+
#: sexy-bookmarks.php:547
|
| 264 |
+
#: sexy-bookmarks.php:559
|
| 265 |
+
#: sexy-bookmarks.php:568
|
| 266 |
+
#: sexy-bookmarks.php:580
|
| 267 |
+
#: sexy-bookmarks.php:600
|
| 268 |
+
msgid "User ID:"
|
| 269 |
+
msgstr "Identifiant :"
|
| 270 |
+
|
| 271 |
+
# @ shrsb
|
| 272 |
+
#: sexy-bookmarks.php:549
|
| 273 |
+
#: sexy-bookmarks.php:570
|
| 274 |
+
#: sexy-bookmarks.php:590
|
| 275 |
+
#: sexy-bookmarks.php:602
|
| 276 |
+
msgid "API Key:"
|
| 277 |
+
msgstr "Clé API :"
|
| 278 |
+
|
| 279 |
+
# @ shrsb
|
| 280 |
+
#: sexy-bookmarks.php:555
|
| 281 |
+
#: sexy-bookmarks.php:576
|
| 282 |
+
#: sexy-bookmarks.php:586
|
| 283 |
+
#: sexy-bookmarks.php:596
|
| 284 |
+
msgid "Track Generated Links?"
|
| 285 |
+
msgstr "Tracer les liens générés ?"
|
| 286 |
+
|
| 287 |
+
# @ shrsb
|
| 288 |
+
#: sexy-bookmarks.php:561
|
| 289 |
+
msgid "Password:"
|
| 290 |
+
msgstr "Mot de passe:"
|
| 291 |
+
|
| 292 |
+
# @ shrsb
|
| 293 |
+
#: sexy-bookmarks.php:609
|
| 294 |
+
msgid "Yahoo! Buzz Defaults:"
|
| 295 |
+
msgstr "Paramètres par défaut de Yahoo! Buzz :"
|
| 296 |
+
|
| 297 |
+
# @ shrsb
|
| 298 |
+
#: sexy-bookmarks.php:610
|
| 299 |
+
msgid "Default Content Category:"
|
| 300 |
+
msgstr "Catégorie de contenu par défaut :"
|
| 301 |
+
|
| 302 |
+
# @ shrsb
|
| 303 |
+
#: sexy-bookmarks.php:629
|
| 304 |
+
msgid "Default Media Type:"
|
| 305 |
+
msgstr "Type de média par défaut :"
|
| 306 |
+
|
| 307 |
+
# @ shrsb
|
| 308 |
+
#: sexy-bookmarks.php:643
|
| 309 |
+
msgid "Twittley Defaults:"
|
| 310 |
+
msgstr "Paramètres par défaut de Twittley :"
|
| 311 |
+
|
| 312 |
+
# @ shrsb
|
| 313 |
+
#: sexy-bookmarks.php:644
|
| 314 |
+
msgid "Primary Content Category:"
|
| 315 |
+
msgstr "Catégorie de contenu de base :"
|
| 316 |
+
|
| 317 |
+
# @ shrsb
|
| 318 |
+
#: sexy-bookmarks.php:648
|
| 319 |
+
msgid "Technology"
|
| 320 |
+
msgstr "Technologie"
|
| 321 |
+
|
| 322 |
+
# @ shrsb
|
| 323 |
+
#: sexy-bookmarks.php:649
|
| 324 |
+
msgid "World & Business"
|
| 325 |
+
msgstr "Monde & Affaires"
|
| 326 |
+
|
| 327 |
+
# @ shrsb
|
| 328 |
+
#: sexy-bookmarks.php:650
|
| 329 |
+
msgid "Science"
|
| 330 |
+
msgstr "Science"
|
| 331 |
+
|
| 332 |
+
# @ shrsb
|
| 333 |
+
#: sexy-bookmarks.php:651
|
| 334 |
+
msgid "Gaming"
|
| 335 |
+
msgstr "Jeu"
|
| 336 |
+
|
| 337 |
+
# @ shrsb
|
| 338 |
+
#: sexy-bookmarks.php:652
|
| 339 |
+
msgid "Lifestyle"
|
| 340 |
+
msgstr "Mode de vie"
|
| 341 |
+
|
| 342 |
+
# @ shrsb
|
| 343 |
+
#: sexy-bookmarks.php:653
|
| 344 |
+
msgid "Entertainment"
|
| 345 |
+
msgstr "Spectacle"
|
| 346 |
+
|
| 347 |
+
# @ shrsb
|
| 348 |
+
#: sexy-bookmarks.php:654
|
| 349 |
+
msgid "Sports"
|
| 350 |
+
msgstr "Sports"
|
| 351 |
+
|
| 352 |
+
# @ shrsb
|
| 353 |
+
#: sexy-bookmarks.php:655
|
| 354 |
+
msgid "Offbeat"
|
| 355 |
+
msgstr "Hors des sentiers battus"
|
| 356 |
+
|
| 357 |
+
# @ shrsb
|
| 358 |
+
#: sexy-bookmarks.php:656
|
| 359 |
+
msgid "Internet"
|
| 360 |
+
msgstr "Internet"
|
| 361 |
+
|
| 362 |
+
# @ shrsb
|
| 363 |
+
#: sexy-bookmarks.php:662
|
| 364 |
+
msgid "Enter a comma separated list of general tags which describe your site's posts as a whole. Try not to be too specific, as one post may fall into different *tag categories* than other posts."
|
| 365 |
+
msgstr "Entrez une liste séparée par des virgules de balises générales qui décrivent les articles de votre site dans son ensemble. Essayez de ne pas être trop spécifique, car un article peut tomber dans d'autres *catégories de tags* que les autres articles."
|
| 366 |
+
|
| 367 |
+
# @ shrsb
|
| 368 |
+
#: sexy-bookmarks.php:663
|
| 369 |
+
msgid "This list is primarily used as a failsafe in case you forget to enter WordPress tags for a particular post, in which case this list of tags would be used so as to bring at least *somewhat* relevant search queries based on the general tags that you enter here."
|
| 370 |
+
msgstr "Cette liste est principalement utilisée comme infaillible, si vous oubliez de saisir des tags WordPress pour un article particulier, auquel cas cette liste de tags serait utilisée pour ajouter au moins *un peu* de pertinence aux requêtes de recherches basées sur les balises générales que vous entrez ici."
|
| 371 |
+
|
| 372 |
+
# @ shrsb
|
| 373 |
+
#: sexy-bookmarks.php:663
|
| 374 |
+
msgid "Click here to close this message"
|
| 375 |
+
msgstr "Cliquez ici pour fermer ce message"
|
| 376 |
+
|
| 377 |
+
# @ shrsb
|
| 378 |
+
#: sexy-bookmarks.php:663
|
| 379 |
+
msgid "close"
|
| 380 |
+
msgstr "fermer"
|
| 381 |
+
|
| 382 |
+
# @ shrsb
|
| 383 |
+
#: sexy-bookmarks.php:665
|
| 384 |
+
msgid "Default Tags:"
|
| 385 |
+
msgstr "Tags par défaut :"
|
| 386 |
+
|
| 387 |
+
# @ shrsb
|
| 388 |
+
#: sexy-bookmarks.php:666
|
| 389 |
+
#: sexy-bookmarks.php:817
|
| 390 |
+
msgid "Click here for help with this option"
|
| 391 |
+
msgstr "Cliquez ici pour de l'aide sur cette option"
|
| 392 |
+
|
| 393 |
+
# @ shrsb
|
| 394 |
+
#: sexy-bookmarks.php:670
|
| 395 |
+
msgid "General Functionality Options:"
|
| 396 |
+
msgstr "Options Générales des Fonctionnalités :"
|
| 397 |
+
|
| 398 |
+
# @ shrsb
|
| 399 |
+
#: sexy-bookmarks.php:672
|
| 400 |
+
msgid "Add nofollow to the links?"
|
| 401 |
+
msgstr "Ajouter la balise \\\"nofollow\\\" sur les liens?"
|
| 402 |
+
|
| 403 |
+
# @ shrsb
|
| 404 |
+
#: sexy-bookmarks.php:676
|
| 405 |
+
msgid "Open links in new window?"
|
| 406 |
+
msgstr "Ouvrir les liens dans une nouvelle fenêtre?"
|
| 407 |
+
|
| 408 |
+
#: sexy-bookmarks.php:680
|
| 409 |
+
msgid "Track Performance?"
|
| 410 |
+
msgstr "Suivre le Rendement ?"
|
| 411 |
+
|
| 412 |
+
#: sexy-bookmarks.php:681
|
| 413 |
+
msgid "Yes (recommended)"
|
| 414 |
+
msgstr "Oui (recommandé)"
|
| 415 |
+
|
| 416 |
+
# @ shrsb
|
| 417 |
+
#: sexy-bookmarks.php:689
|
| 418 |
+
msgid "Plugin Aesthetics"
|
| 419 |
+
msgstr "Esthétique de l'extension"
|
| 420 |
+
|
| 421 |
+
# @ shrsb
|
| 422 |
+
#: sexy-bookmarks.php:694
|
| 423 |
+
msgid "Warning!"
|
| 424 |
+
msgstr "Attention !"
|
| 425 |
+
|
| 426 |
+
# @ shrsb
|
| 427 |
+
#: sexy-bookmarks.php:695
|
| 428 |
+
msgid "This option is intended %STRICTLY%s for users who understand how to edit CSS/JS and intend to change/edit the associated images themselves. Unfortunately, no support will be offered for this feature, as I cannot be held accountable for your coding and/or image editing mistakes."
|
| 429 |
+
msgstr "Cette option est %sSTRICTEMENT%s réserveé aux utilisateurs qui comprennent la façon de modifier le CSS/JS et ont l'intention de modifier/éditer les images associées eux-mêmes. Malheureusement, aucun support ne sera offert pour cette fonction, dans la mesure où je ne peux pas être tenu pour responsable de vos codages et/ou des erreurs d'édition d'image."
|
| 430 |
+
|
| 431 |
+
# @ shrsb
|
| 432 |
+
#: sexy-bookmarks.php:696
|
| 433 |
+
msgid "How it works..."
|
| 434 |
+
msgstr "Comment ça marche..."
|
| 435 |
+
|
| 436 |
+
# @ shrsb
|
| 437 |
+
#: sexy-bookmarks.php:697
|
| 438 |
+
msgid "Since you have chosen for the plugin to override the style settings with your own custom mods, it will now pull the files from the new folders it is going to create on your server as soon as you save your changes. The file/folder locations should be as follows:"
|
| 439 |
+
msgstr "Maintenant que vous avez choisi que l'extension surpasse ses régles de style avec vos propres réglages, elle va placer les nouveaux fichiers qu'elle va créer sur votre serveur dès que vous enregistrerez les modifications. Les emplacements des fichiers devraient être les suivants :"
|
| 440 |
+
|
| 441 |
+
# @ shrsb
|
| 442 |
+
#: sexy-bookmarks.php:714
|
| 443 |
+
msgid "Once you have saved your changes, you will be able to edit the image sprite that holds all of the icons for Shareaholic as well as the CSS which accompanies it. Just be sure that you do in fact edit the CSS if you edit the images, as it is unlikely the heights, widths, and background positions of the images will stay the same after you are done."
|
| 444 |
+
msgstr "Une fois que vous aurez sauvegardé vos changements, vous pourrez éditer l'image animée qui contient toutes les icônes de Shareaholic, ainsi que le CSS qui l'accompagne. Soyez simplement certains d'éditer réellement le CSS si vous éditez les images, sinon malheureusement leurs hauteurs, largeurs et positions de fonds resteront les mêmes après vos changements."
|
| 445 |
+
|
| 446 |
+
# @ shrsb
|
| 447 |
+
#: sexy-bookmarks.php:715
|
| 448 |
+
msgid "Just a quick note... When you edit the styles and images to include your own custom backgrounds, icons, and CSS styles, be aware that those changes will not be reflected on the plugin options page. In other words: when you select your networks to be displayed, or when you select the background image to use, it will still be displaying the images from the original plugin directory."
|
| 449 |
+
msgstr "Juste une petite note... Quand vous éditez les styles et images pour inclure vos propres fonds, icônes et styles CSS, ne perdez pas de vue que vos changements n'affectent pas la page des options du plugin. En d'autres termes : quand vous sélectionnez les réseaux que vous voulez afficher, ou les images de fond à utiliser, cette page continuera à afficher les images d'origine de l'extension. "
|
| 450 |
+
|
| 451 |
+
# @ shrsb
|
| 452 |
+
#: sexy-bookmarks.php:716
|
| 453 |
+
msgid "In Case of Emergency"
|
| 454 |
+
msgstr "En cas d'urgence"
|
| 455 |
+
|
| 456 |
+
# @ shrsb
|
| 457 |
+
#: sexy-bookmarks.php:717
|
| 458 |
+
msgid "If you happen to mess things up, you can follow these directions to reset the plugin back to normal and try again if you wish:"
|
| 459 |
+
msgstr "S'il vous arrive de mettre des choses en désordre, vous pouvez suivre ces instructions pour réinitialiser l'extension à la normale, et essayer à nouveau si vous le souhaitez :"
|
| 460 |
+
|
| 461 |
+
# @ shrsb
|
| 462 |
+
#: sexy-bookmarks.php:719
|
| 463 |
+
msgid "Login to your server via FTP or SSH. (whichever you are more comfortable with)"
|
| 464 |
+
msgstr "Vous connecter à votre serveur par FTP ou SSH (celui avec lequel vous êtes le plus à l'aise) ."
|
| 465 |
+
|
| 466 |
+
# @ shrsb
|
| 467 |
+
#: sexy-bookmarks.php:720
|
| 468 |
+
msgid "Navigate to your wp-content directory."
|
| 469 |
+
msgstr "Naviguer jusqu'à votre fichier wp-content."
|
| 470 |
+
|
| 471 |
+
# @ shrsb
|
| 472 |
+
#: sexy-bookmarks.php:721
|
| 473 |
+
msgid "Delete the directory named \"sexy-mods\"."
|
| 474 |
+
msgstr "Supprimer le fichier nommé \"sexy-mods\"."
|
| 475 |
+
|
| 476 |
+
# @ shrsb
|
| 477 |
+
#: sexy-bookmarks.php:722
|
| 478 |
+
msgid "Login to your WordPress dashboard."
|
| 479 |
+
msgstr "Vous connecter à votre tableau de bord WordPress."
|
| 480 |
+
|
| 481 |
+
# @ shrsb
|
| 482 |
+
#: sexy-bookmarks.php:723
|
| 483 |
+
msgid "Go to the SexyBookmarks plugin options page. (Settings->SexyBookmarks)"
|
| 484 |
+
msgstr "Aller à la page des options de l'extension SexyBookmarks. (Paramètres->SexyBookmarks)"
|
| 485 |
+
|
| 486 |
+
# @ shrsb
|
| 487 |
+
#: sexy-bookmarks.php:724
|
| 488 |
+
msgid "Deselect the \"Use custom mods\" option."
|
| 489 |
+
msgstr "Déselectionner l'option \"Utiliser le module personnalisé\""
|
| 490 |
+
|
| 491 |
+
# @ shrsb
|
| 492 |
+
#: sexy-bookmarks.php:725
|
| 493 |
+
msgid "Save your changes."
|
| 494 |
+
msgstr "Enregistrer vos modifications."
|
| 495 |
+
|
| 496 |
+
# @ shrsb
|
| 497 |
+
#: sexy-bookmarks.php:727
|
| 498 |
+
msgid "Close Message"
|
| 499 |
+
msgstr "Fermer le message"
|
| 500 |
+
|
| 501 |
+
# @ shrsb
|
| 502 |
+
#: sexy-bookmarks.php:731
|
| 503 |
+
msgid "Override Styles With Custom Mods Instead?"
|
| 504 |
+
msgstr "Ecraser les styles avec vos Options Personnalisées ?"
|
| 505 |
+
|
| 506 |
+
# @ shrsb
|
| 507 |
+
#: sexy-bookmarks.php:736
|
| 508 |
+
msgid "jQuery Related Options"
|
| 509 |
+
msgstr "Options jQuery liées"
|
| 510 |
+
|
| 511 |
+
# @ shrsb
|
| 512 |
+
#: sexy-bookmarks.php:737
|
| 513 |
+
msgid "Animate-expand multi-lined bookmarks?"
|
| 514 |
+
msgstr "Afficher les signets sur plusieurs lignes extensibles animées ?"
|
| 515 |
+
|
| 516 |
+
# @ shrsb
|
| 517 |
+
#: sexy-bookmarks.php:740
|
| 518 |
+
msgid "Auto-space/center the bookmarks?"
|
| 519 |
+
msgstr "Auto-espacer/centrer les signets?"
|
| 520 |
+
|
| 521 |
+
# @ shrsb
|
| 522 |
+
#: sexy-bookmarks.php:741
|
| 523 |
+
msgid "Space"
|
| 524 |
+
msgstr "Espacer"
|
| 525 |
+
|
| 526 |
+
# @ shrsb
|
| 527 |
+
#: sexy-bookmarks.php:742
|
| 528 |
+
msgid "Center"
|
| 529 |
+
msgstr "Centrer"
|
| 530 |
+
|
| 531 |
+
# @ shrsb
|
| 532 |
+
#: sexy-bookmarks.php:744
|
| 533 |
+
msgid "jQuery Compatibility Fix"
|
| 534 |
+
msgstr "Réparation de la compatibilité jQuery"
|
| 535 |
+
|
| 536 |
+
# @ shrsb
|
| 537 |
+
#: sexy-bookmarks.php:745
|
| 538 |
+
msgid "Check this box ONLY if you notice jQuery being loaded twice in your source code!"
|
| 539 |
+
msgstr "Cochez cette case si vous contstatez que jQuery est chargé deux fois dans votre code source !"
|
| 540 |
+
|
| 541 |
+
# @ shrsb
|
| 542 |
+
#: sexy-bookmarks.php:747
|
| 543 |
+
msgid "Load scripts in Footer"
|
| 544 |
+
msgstr "Charger les scripts dans le Footer"
|
| 545 |
+
|
| 546 |
+
# @ shrsb
|
| 547 |
+
#: sexy-bookmarks.php:748
|
| 548 |
+
msgid "Check this box if you want the SexyBookmarks javascript to be loaded in your blog's footer."
|
| 549 |
+
msgstr "Cochez cette case si vous souhaitez que le javascript SexyBookmarks soit chargé dans le pied de page de votre blog."
|
| 550 |
+
|
| 551 |
+
# @ shrsb
|
| 552 |
+
#: sexy-bookmarks.php:750
|
| 553 |
+
msgid "Background Image Options"
|
| 554 |
+
msgstr "Options de l'Image de fond"
|
| 555 |
+
|
| 556 |
+
# @ shrsb
|
| 557 |
+
#: sexy-bookmarks.php:752
|
| 558 |
+
msgid "Use a background image?"
|
| 559 |
+
msgstr "Utiliser une image de fond ?"
|
| 560 |
+
|
| 561 |
+
# @ shrsb
|
| 562 |
+
#: sexy-bookmarks.php:785
|
| 563 |
+
msgid "Menu Placement"
|
| 564 |
+
msgstr "Emplacement du menu"
|
| 565 |
+
|
| 566 |
+
# @ shrsb
|
| 567 |
+
#: sexy-bookmarks.php:791
|
| 568 |
+
msgid "Need help with this? Find it in the %sofficial install guide%s."
|
| 569 |
+
msgstr "Besoin d'aide pour cela ? Trouvez-la dans le %sguide officiels d'installation%s."
|
| 570 |
+
|
| 571 |
+
# @ shrsb
|
| 572 |
+
#: sexy-bookmarks.php:797
|
| 573 |
+
msgid "Menu Location (in relation to content):"
|
| 574 |
+
msgstr "Emplacement du Menu (par rapport au contenu) :"
|
| 575 |
+
|
| 576 |
+
# @ shrsb
|
| 577 |
+
#: sexy-bookmarks.php:798
|
| 578 |
+
msgid "Above Content"
|
| 579 |
+
msgstr "Au-dessus du corps du texte"
|
| 580 |
+
|
| 581 |
+
# @ shrsb
|
| 582 |
+
#: sexy-bookmarks.php:799
|
| 583 |
+
msgid "Below Content"
|
| 584 |
+
msgstr "Sous le corps du texte"
|
| 585 |
+
|
| 586 |
+
# @ shrsb
|
| 587 |
+
#: sexy-bookmarks.php:800
|
| 588 |
+
msgid "Above & Below Content"
|
| 589 |
+
msgstr "Au-dessus et en-dessous du contenu"
|
| 590 |
+
|
| 591 |
+
# @ shrsb
|
| 592 |
+
#: sexy-bookmarks.php:801
|
| 593 |
+
msgid "Manual Mode"
|
| 594 |
+
msgstr "Mode manuel"
|
| 595 |
+
|
| 596 |
+
# @ shrsb
|
| 597 |
+
#: sexy-bookmarks.php:802
|
| 598 |
+
msgid "Posts, pages, or the whole shebang?"
|
| 599 |
+
msgstr "Articles, pages, ou tout le tralala?"
|
| 600 |
+
|
| 601 |
+
# @ shrsb
|
| 602 |
+
#: sexy-bookmarks.php:807
|
| 603 |
+
msgid "Posts Only"
|
| 604 |
+
msgstr "Articles Uniquement"
|
| 605 |
+
|
| 606 |
+
# @ shrsb
|
| 607 |
+
#: sexy-bookmarks.php:808
|
| 608 |
+
msgid "Pages Only"
|
| 609 |
+
msgstr "Pages Uniquement"
|
| 610 |
+
|
| 611 |
+
# @ shrsb
|
| 612 |
+
#: sexy-bookmarks.php:809
|
| 613 |
+
msgid "Index Only"
|
| 614 |
+
msgstr "Index Uniquement"
|
| 615 |
+
|
| 616 |
+
# @ shrsb
|
| 617 |
+
#: sexy-bookmarks.php:810
|
| 618 |
+
msgid "Posts & Pages"
|
| 619 |
+
msgstr "Articles & Pages"
|
| 620 |
+
|
| 621 |
+
# @ shrsb
|
| 622 |
+
#: sexy-bookmarks.php:811
|
| 623 |
+
msgid "Posts & Index"
|
| 624 |
+
msgstr "Articles & Index"
|
| 625 |
+
|
| 626 |
+
# @ shrsb
|
| 627 |
+
#: sexy-bookmarks.php:812
|
| 628 |
+
msgid "Pages & Index"
|
| 629 |
+
msgstr "Pages & Index"
|
| 630 |
+
|
| 631 |
+
# @ shrsb
|
| 632 |
+
#: sexy-bookmarks.php:813
|
| 633 |
+
msgid "Posts, Pages, & Index"
|
| 634 |
+
msgstr "Articles, Pages, & Index"
|
| 635 |
+
|
| 636 |
+
# @ shrsb
|
| 637 |
+
#: sexy-bookmarks.php:818
|
| 638 |
+
msgid "Show in RSS feed?"
|
| 639 |
+
msgstr "Afficher dans le flux RSS?"
|
| 640 |
+
|
| 641 |
+
# @ shrsb
|
| 642 |
+
#: sexy-bookmarks.php:822
|
| 643 |
+
msgid "Hide menu from mobile browsers?"
|
| 644 |
+
msgstr "Masquer le menu pour les navigateurs de mobile?"
|
| 645 |
+
|
| 646 |
+
# @ shrsb
|
| 647 |
+
#: sexy-bookmarks.php:831
|
| 648 |
+
msgid "Save Changes"
|
| 649 |
+
msgstr "Enregistrer les modifications"
|
| 650 |
+
|
| 651 |
+
# @ shrsb
|
| 652 |
+
#: sexy-bookmarks.php:835
|
| 653 |
+
msgid "Reset Settings"
|
| 654 |
+
msgstr "Réinitialiser les paramètres"
|
| 655 |
+
|
| 656 |
+
# @ shrsb
|
| 657 |
+
#: sexy-bookmarks.php:841
|
| 658 |
+
msgid "Helpful Plugin Links"
|
| 659 |
+
msgstr "Liens d'aides pour l'extension :"
|
| 660 |
+
|
| 661 |
+
# @ shrsb
|
| 662 |
+
#: sexy-bookmarks.php:846
|
| 663 |
+
msgid "Installation & Usage Guide"
|
| 664 |
+
msgstr "Guide d'installation et d'utilisation"
|
| 665 |
+
|
| 666 |
+
# @ shrsb
|
| 667 |
+
#: sexy-bookmarks.php:847
|
| 668 |
+
msgid "Frequently Asked Questions"
|
| 669 |
+
msgstr "Foire Aux Questions"
|
| 670 |
+
|
| 671 |
+
# @ shrsb
|
| 672 |
+
#: sexy-bookmarks.php:848
|
| 673 |
+
msgid "Bug Submission Form"
|
| 674 |
+
msgstr "Formulaire de soumission de bug"
|
| 675 |
+
|
| 676 |
+
# @ shrsb
|
| 677 |
+
#: sexy-bookmarks.php:849
|
| 678 |
+
msgid "Feature Request Form"
|
| 679 |
+
msgstr "Formulaire de demande de fonction"
|
| 680 |
+
|
| 681 |
+
# @ shrsb
|
| 682 |
+
#: sexy-bookmarks.php:850
|
| 683 |
+
msgid "Submit a Translation"
|
| 684 |
+
msgstr "Soumettre une traduction"
|
| 685 |
+
|
| 686 |
+
# @ shrsb
|
| 687 |
+
#: sexy-bookmarks.php:851
|
| 688 |
+
msgid "Shareaholic Browsers Add-ons"
|
| 689 |
+
msgstr "Modules pour Navigateurs Shareaholic"
|
| 690 |
+
|
| 691 |
+
# @ shrsb
|
| 692 |
+
#: sexy-bookmarks.php:852
|
| 693 |
+
msgid "Thanks & Credits"
|
| 694 |
+
msgstr "Remerciements & Crédits"
|
| 695 |
+
|
| 696 |
+
# @ shrsb
|
| 697 |
+
#: sexy-bookmarks.php:901
|
| 698 |
+
msgid "Settings"
|
| 699 |
+
msgstr "Réglages"
|
| 700 |
+
|
| 701 |
+
# @ shrsb
|
| 702 |
+
#: includes/bookmarks-data.php:21
|
| 703 |
+
msgid "Check this box to include %s in your bookmarking menu"
|
| 704 |
+
msgstr "Cochez cette case pour inclure %s dans votre menu de signets"
|
| 705 |
+
|
| 706 |
+
# @ shrsb
|
| 707 |
+
#: includes/bookmarks-data.php:28
|
| 708 |
+
#: includes/bookmarks-data.php:94
|
| 709 |
+
#: includes/bookmarks-data.php:195
|
| 710 |
+
#: includes/bookmarks-data.php:237
|
| 711 |
+
#: includes/bookmarks-data.php:303
|
| 712 |
+
#: includes/bookmarks-data.php:309
|
| 713 |
+
#: includes/bookmarks-data.php:315
|
| 714 |
+
#: includes/bookmarks-data.php:321
|
| 715 |
+
#: includes/bookmarks-data.php:369
|
| 716 |
+
#: includes/bookmarks-data.php:387
|
| 717 |
+
#: includes/bookmarks-data.php:399
|
| 718 |
+
#: includes/bookmarks-data.php:405
|
| 719 |
+
#: includes/bookmarks-data.php:429
|
| 720 |
+
msgid "Submit this to "
|
| 721 |
+
msgstr "Le soumettre à "
|
| 722 |
+
|
| 723 |
+
# @ shrsb
|
| 724 |
+
#: includes/bookmarks-data.php:34
|
| 725 |
+
#: includes/bookmarks-data.php:40
|
| 726 |
+
#: includes/bookmarks-data.php:58
|
| 727 |
+
#: includes/bookmarks-data.php:76
|
| 728 |
+
#: includes/bookmarks-data.php:82
|
| 729 |
+
#: includes/bookmarks-data.php:100
|
| 730 |
+
#: includes/bookmarks-data.php:129
|
| 731 |
+
#: includes/bookmarks-data.php:171
|
| 732 |
+
#: includes/bookmarks-data.php:177
|
| 733 |
+
#: includes/bookmarks-data.php:183
|
| 734 |
+
#: includes/bookmarks-data.php:201
|
| 735 |
+
#: includes/bookmarks-data.php:207
|
| 736 |
+
#: includes/bookmarks-data.php:345
|
| 737 |
+
#: includes/bookmarks-data.php:417
|
| 738 |
+
#: includes/bookmarks-data.php:441
|
| 739 |
+
#: includes/bookmarks-data.php:465
|
| 740 |
+
#: includes/bookmarks-data.php:477
|
| 741 |
+
#: includes/bookmarks-data.php:483
|
| 742 |
+
#: includes/bookmarks-data.php:495
|
| 743 |
+
#: includes/bookmarks-data.php:507
|
| 744 |
+
#: includes/bookmarks-data.php:525
|
| 745 |
+
msgid "Share this on "
|
| 746 |
+
msgstr "Partagez-le sur "
|
| 747 |
+
|
| 748 |
+
# @ shrsb
|
| 749 |
+
#: includes/bookmarks-data.php:46
|
| 750 |
+
msgid "Digg this!"
|
| 751 |
+
msgstr "Diggez-le !"
|
| 752 |
+
|
| 753 |
+
# @ shrsb
|
| 754 |
+
#: includes/bookmarks-data.php:52
|
| 755 |
+
msgid "Post this on "
|
| 756 |
+
msgstr "Publiez-le sur "
|
| 757 |
+
|
| 758 |
+
# @ shrsb
|
| 759 |
+
#: includes/bookmarks-data.php:64
|
| 760 |
+
msgid "Buzz up!"
|
| 761 |
+
msgstr "Buzzez-le !"
|
| 762 |
+
|
| 763 |
+
# @ shrsb
|
| 764 |
+
#: includes/bookmarks-data.php:70
|
| 765 |
+
msgid "Stumble upon something good? Share it on StumbleUpon"
|
| 766 |
+
msgstr "Tomber sur un bon truc ? Partagez cet article sur StumbleUpon"
|
| 767 |
+
|
| 768 |
+
# @ shrsb
|
| 769 |
+
#: includes/bookmarks-data.php:88
|
| 770 |
+
#: includes/bookmarks-data.php:261
|
| 771 |
+
#: includes/bookmarks-data.php:285
|
| 772 |
+
#: includes/bookmarks-data.php:453
|
| 773 |
+
msgid "Post this to "
|
| 774 |
+
msgstr "Publiez-le sur "
|
| 775 |
+
|
| 776 |
+
# @ shrsb
|
| 777 |
+
#: includes/bookmarks-data.php:106
|
| 778 |
+
msgid "Tweet This!"
|
| 779 |
+
msgstr "Tweetez-le !"
|
| 780 |
+
|
| 781 |
+
# @ shrsb
|
| 782 |
+
#: includes/bookmarks-data.php:111
|
| 783 |
+
msgid "an 'Email to a Friend' link"
|
| 784 |
+
msgstr "un lien 'Envoyer par mail à un ami'"
|
| 785 |
+
|
| 786 |
+
# @ shrsb
|
| 787 |
+
#: includes/bookmarks-data.php:112
|
| 788 |
+
msgid "Email this to a friend?"
|
| 789 |
+
msgstr "Envoyer cet article à un ami ?"
|
| 790 |
+
|
| 791 |
+
#: includes/bookmarks-data.php:113
|
| 792 |
+
#: includes/bookmarks-data.php:538
|
| 793 |
+
#: includes/bookmarks-data.php:544
|
| 794 |
+
msgid "(sent via shareaholic)"
|
| 795 |
+
msgstr "(envoyé via Shareaholic)"
|
| 796 |
+
|
| 797 |
+
# @ shrsb
|
| 798 |
+
#: includes/bookmarks-data.php:118
|
| 799 |
+
msgid "Suggest this article to "
|
| 800 |
+
msgstr "Suggérer cet article à"
|
| 801 |
+
|
| 802 |
+
# @ shrsb
|
| 803 |
+
#: includes/bookmarks-data.php:119
|
| 804 |
+
msgid "New tip submitted via the SexyBookmarks Plugin!"
|
| 805 |
+
msgstr "Une nouvelle occurrence soumise via l'extension SexyBookmarks !"
|
| 806 |
+
|
| 807 |
+
# @ shrsb
|
| 808 |
+
#: includes/bookmarks-data.php:122
|
| 809 |
+
msgid "a 'Subscribe to Comments' link"
|
| 810 |
+
msgstr "un lien \\\"S'abonner aux commentaires\\\""
|
| 811 |
+
|
| 812 |
+
# @ shrsb
|
| 813 |
+
#: includes/bookmarks-data.php:123
|
| 814 |
+
#: includes/public.php:138
|
| 815 |
+
msgid "Subscribe to the comments for this post?"
|
| 816 |
+
msgstr "S'abonner aux commentaires de cet article ?"
|
| 817 |
+
|
| 818 |
+
# @ shrsb
|
| 819 |
+
#: includes/bookmarks-data.php:135
|
| 820 |
+
msgid "Seed this on "
|
| 821 |
+
msgstr "Semez-le sur "
|
| 822 |
+
|
| 823 |
+
# @ shrsb
|
| 824 |
+
#: includes/bookmarks-data.php:141
|
| 825 |
+
#: includes/bookmarks-data.php:147
|
| 826 |
+
#: includes/bookmarks-data.php:159
|
| 827 |
+
#: includes/bookmarks-data.php:165
|
| 828 |
+
#: includes/bookmarks-data.php:213
|
| 829 |
+
#: includes/bookmarks-data.php:219
|
| 830 |
+
#: includes/bookmarks-data.php:225
|
| 831 |
+
#: includes/bookmarks-data.php:231
|
| 832 |
+
#: includes/bookmarks-data.php:255
|
| 833 |
+
#: includes/bookmarks-data.php:447
|
| 834 |
+
#: includes/bookmarks-data.php:471
|
| 835 |
+
#: includes/bookmarks-data.php:501
|
| 836 |
+
msgid "Add this to "
|
| 837 |
+
msgstr "Ajoutez-le à "
|
| 838 |
+
|
| 839 |
+
# @ shrsb
|
| 840 |
+
#: includes/bookmarks-data.php:153
|
| 841 |
+
msgid "Post on Google Buzz"
|
| 842 |
+
msgstr "Postez-le sur Google Buzz"
|
| 843 |
+
|
| 844 |
+
# @ shrsb
|
| 845 |
+
#: includes/bookmarks-data.php:189
|
| 846 |
+
msgid "Mark this on "
|
| 847 |
+
msgstr "Marquez-le sur "
|
| 848 |
+
|
| 849 |
+
# @ shrsb
|
| 850 |
+
#: includes/bookmarks-data.php:206
|
| 851 |
+
#: includes/bookmarks-data.php:212
|
| 852 |
+
#: includes/bookmarks-data.php:218
|
| 853 |
+
#: includes/bookmarks-data.php:224
|
| 854 |
+
#: includes/bookmarks-data.php:230
|
| 855 |
+
msgid " (Russian)"
|
| 856 |
+
msgstr "(Russe)"
|
| 857 |
+
|
| 858 |
+
# @ shrsb
|
| 859 |
+
#: includes/bookmarks-data.php:243
|
| 860 |
+
msgid "Send this page to "
|
| 861 |
+
msgstr "Envoyer cet article à"
|
| 862 |
+
|
| 863 |
+
# @ shrsb
|
| 864 |
+
#: includes/bookmarks-data.php:249
|
| 865 |
+
msgid "Bump this on "
|
| 866 |
+
msgstr "Bumpez cet article sur"
|
| 867 |
+
|
| 868 |
+
# @ shrsb
|
| 869 |
+
#: includes/bookmarks-data.php:267
|
| 870 |
+
msgid "Save this to "
|
| 871 |
+
msgstr "Sauvegardez cet article sur"
|
| 872 |
+
|
| 873 |
+
# @ shrsb
|
| 874 |
+
#: includes/bookmarks-data.php:273
|
| 875 |
+
msgid "Tip this to "
|
| 876 |
+
msgstr "Postez cette astuce sur"
|
| 877 |
+
|
| 878 |
+
# @ shrsb
|
| 879 |
+
#: includes/bookmarks-data.php:279
|
| 880 |
+
msgid "Sphinn this on "
|
| 881 |
+
msgstr "Sphinnez cet article sur"
|
| 882 |
+
|
| 883 |
+
# @ shrsb
|
| 884 |
+
#: includes/bookmarks-data.php:291
|
| 885 |
+
msgid "Grind this! on "
|
| 886 |
+
msgstr "Grindez cet article sur"
|
| 887 |
+
|
| 888 |
+
# @ shrsb
|
| 889 |
+
#: includes/bookmarks-data.php:297
|
| 890 |
+
msgid "Ping this on "
|
| 891 |
+
msgstr "Pinguez cet article sur"
|
| 892 |
+
|
| 893 |
+
# @ shrsb
|
| 894 |
+
#: includes/bookmarks-data.php:302
|
| 895 |
+
#: includes/bookmarks-data.php:308
|
| 896 |
+
msgid " (Dutch)"
|
| 897 |
+
msgstr "(Néerlandais)"
|
| 898 |
+
|
| 899 |
+
# @ shrsb
|
| 900 |
+
#: includes/bookmarks-data.php:327
|
| 901 |
+
msgid "Blend this!"
|
| 902 |
+
msgstr "Mixez cet article !"
|
| 903 |
+
|
| 904 |
+
# @ shrsb
|
| 905 |
+
#: includes/bookmarks-data.php:332
|
| 906 |
+
msgid " (Polish)"
|
| 907 |
+
msgstr "(Polonais)"
|
| 908 |
+
|
| 909 |
+
# @ shrsb
|
| 910 |
+
#: includes/bookmarks-data.php:333
|
| 911 |
+
msgid "Add this to Wykop!"
|
| 912 |
+
msgstr "Ajoutez cet article à Wykop !"
|
| 913 |
+
|
| 914 |
+
# @ shrsb
|
| 915 |
+
#: includes/bookmarks-data.php:339
|
| 916 |
+
msgid "Engage with this article!"
|
| 917 |
+
msgstr "Enagegez-vous avec cet article !"
|
| 918 |
+
|
| 919 |
+
# @ shrsb
|
| 920 |
+
#: includes/bookmarks-data.php:350
|
| 921 |
+
msgid " (Swedish)"
|
| 922 |
+
msgstr "(Suédois)"
|
| 923 |
+
|
| 924 |
+
# @ shrsb
|
| 925 |
+
#: includes/bookmarks-data.php:351
|
| 926 |
+
msgid "Push this on "
|
| 927 |
+
msgstr "Poussez cet article sur"
|
| 928 |
+
|
| 929 |
+
# @ shrsb
|
| 930 |
+
#: includes/bookmarks-data.php:356
|
| 931 |
+
msgid " (Japanese)"
|
| 932 |
+
msgstr "(Japonais)"
|
| 933 |
+
|
| 934 |
+
# @ shrsb
|
| 935 |
+
#: includes/bookmarks-data.php:357
|
| 936 |
+
msgid "Bookmarks this on "
|
| 937 |
+
msgstr "Marquez cet article sur"
|
| 938 |
+
|
| 939 |
+
# @ shrsb
|
| 940 |
+
#: includes/bookmarks-data.php:363
|
| 941 |
+
msgid "Store this link on "
|
| 942 |
+
msgstr "Mettez ce lien en ligne sur"
|
| 943 |
+
|
| 944 |
+
# @ shrsb
|
| 945 |
+
#: includes/bookmarks-data.php:375
|
| 946 |
+
msgid "Add to a lense on "
|
| 947 |
+
msgstr "Ajoutez cet article à la vitrine sur"
|
| 948 |
+
|
| 949 |
+
# @ shrsb
|
| 950 |
+
#: includes/bookmarks-data.php:381
|
| 951 |
+
msgid "Submit this story to "
|
| 952 |
+
msgstr "Soummetez cette histoire à"
|
| 953 |
+
|
| 954 |
+
# @ shrsb
|
| 955 |
+
#: includes/bookmarks-data.php:393
|
| 956 |
+
msgid "Clip this to "
|
| 957 |
+
msgstr "Postez cette astuce sur"
|
| 958 |
+
|
| 959 |
+
# @ shrsb
|
| 960 |
+
#: includes/bookmarks-data.php:398
|
| 961 |
+
#: includes/bookmarks-data.php:404
|
| 962 |
+
msgid " (Spanish)"
|
| 963 |
+
msgstr "(Espagnol)"
|
| 964 |
+
|
| 965 |
+
# @ shrsb
|
| 966 |
+
#: includes/bookmarks-data.php:411
|
| 967 |
+
msgid "Submit this link to "
|
| 968 |
+
msgstr "Soumettez ce lien à"
|
| 969 |
+
|
| 970 |
+
# @ shrsb
|
| 971 |
+
#: includes/bookmarks-data.php:423
|
| 972 |
+
msgid "Submit tip to "
|
| 973 |
+
msgstr "Soumettre ce truc à"
|
| 974 |
+
|
| 975 |
+
# @ shrsb
|
| 976 |
+
#: includes/bookmarks-data.php:435
|
| 977 |
+
msgid "Promote this on "
|
| 978 |
+
msgstr "Promouvez cet article sur"
|
| 979 |
+
|
| 980 |
+
# @ shrsb
|
| 981 |
+
#: includes/bookmarks-data.php:459
|
| 982 |
+
msgid "Blog this on "
|
| 983 |
+
msgstr "Bloguez cet article sur"
|
| 984 |
+
|
| 985 |
+
# @ shrsb
|
| 986 |
+
#: includes/bookmarks-data.php:476
|
| 987 |
+
msgid " (Estonian)"
|
| 988 |
+
msgstr "(Estonien)"
|
| 989 |
+
|
| 990 |
+
# @ shrsb
|
| 991 |
+
#: includes/bookmarks-data.php:489
|
| 992 |
+
msgid "Add this link to "
|
| 993 |
+
msgstr "Ajoutez ce lien à "
|
| 994 |
+
|
| 995 |
+
# @ shrsb
|
| 996 |
+
#: includes/bookmarks-data.php:494
|
| 997 |
+
msgid "(Italian)"
|
| 998 |
+
msgstr "(Italien)"
|
| 999 |
+
|
| 1000 |
+
# @ shrsb
|
| 1001 |
+
#: includes/bookmarks-data.php:513
|
| 1002 |
+
msgid "Spring this on "
|
| 1003 |
+
msgstr "Propulsez cet article sur"
|
| 1004 |
+
|
| 1005 |
+
# @ shrsb
|
| 1006 |
+
#: includes/bookmarks-data.php:519
|
| 1007 |
+
msgid "Box this on "
|
| 1008 |
+
msgstr "Mettez-le en boite sur"
|
| 1009 |
+
|
| 1010 |
+
# @ shrsb
|
| 1011 |
+
#: includes/bookmarks-data.php:531
|
| 1012 |
+
#: includes/bookmarks-data.php:537
|
| 1013 |
+
#: includes/bookmarks-data.php:543
|
| 1014 |
+
msgid "Email this via "
|
| 1015 |
+
msgstr "Mailez-le via "
|
| 1016 |
+
|
| 1017 |
+
#: includes/bookmarks-data.php:532
|
| 1018 |
+
msgid "(sent via http://shareaholic.com)"
|
| 1019 |
+
msgstr "(envoyé via http://shareaholic.com)"
|
| 1020 |
+
|
| 1021 |
+
# @ shrsb
|
| 1022 |
+
#: includes/bookmarks-data.php:549
|
| 1023 |
+
msgid "Share this via "
|
| 1024 |
+
msgstr "Partagez-le via "
|
| 1025 |
+
|
| 1026 |
+
# @ shrsb
|
| 1027 |
+
#: includes/public.php:556
|
| 1028 |
+
msgid "An unknown error occurred in SexyBookmarks"
|
| 1029 |
+
msgstr "Une erreur inconnue s'est produite dans SexyBookmarks"
|
| 1030 |
+
|
| 1031 |
+
# @ shrsb
|
| 1032 |
+
#: includes/public.php:827
|
| 1033 |
+
msgid "SexyBookmarks has been disabled on this page"
|
| 1034 |
+
msgstr "SexyBookmarks a été désactivé sur cette page"
|
| 1035 |
+
|
languages/shrsb-it_IT.mo
ADDED
|
Binary file
|
languages/shrsb-it_IT.po
ADDED
|
@@ -0,0 +1,1138 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
msgid ""
|
| 2 |
+
msgstr ""
|
| 3 |
+
"Project-Id-Version: SexyBookmarks v4.0.4.1\n"
|
| 4 |
+
"Report-Msgid-Bugs-To: \n"
|
| 5 |
+
"POT-Creation-Date: 2011-07-11 13:43+0100\n"
|
| 6 |
+
"PO-Revision-Date: 2011-07-11 14:04+0100\n"
|
| 7 |
+
"Last-Translator: Damjan Gerl <damjan@damjan.net>\n"
|
| 8 |
+
"Language-Team: Shareaholic, Inc. <support@shareaholic.com>\n"
|
| 9 |
+
"MIME-Version: 1.0\n"
|
| 10 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
+
"X-Poedit-Language: Italian\n"
|
| 13 |
+
"X-Poedit-Country: ITALY\n"
|
| 14 |
+
"X-Poedit-KeywordsList: __;_e\n"
|
| 15 |
+
"X-Poedit-Basepath: .\n"
|
| 16 |
+
"Plural-Forms: nplurals=2; plural=n != 1;\n"
|
| 17 |
+
"X-Poedit-SourceCharset: utf-8\n"
|
| 18 |
+
"X-Poedit-SearchPath-0: .\n"
|
| 19 |
+
|
| 20 |
+
#: sexy-bookmarks.php:287
|
| 21 |
+
#, php-format
|
| 22 |
+
msgid "NOTICE: Shareaholic was just updated... Please visit the %sPlugin Options Page%s and re-save your preferences."
|
| 23 |
+
msgstr "AVVISO: Shareaholic è stato appena aggiornato... Si prega di visitare la %sPagina opzioni del plugin%s ed impostare le preferenze."
|
| 24 |
+
|
| 25 |
+
#: sexy-bookmarks.php:298
|
| 26 |
+
#, php-format
|
| 27 |
+
msgid "NOTICE: Your spritegen directory isn't writable... Please %sCHMOD%s your spritegen directory to ensure that Shareaholic remains working like a charm..."
|
| 28 |
+
msgstr "AVVISO: La vostra cartella spritegen non è scrivibile... Si prega di impostare le protezioni della cartella spritegen con %sCHMOD%s per garantire che Shareaholic funzioni bene..."
|
| 29 |
+
|
| 30 |
+
#: sexy-bookmarks.php:335
|
| 31 |
+
#, php-format
|
| 32 |
+
msgid "NOTICE: Shareaholic needs to be configured... Please visit the %sPlugin Options Page%s and set your preferences."
|
| 33 |
+
msgstr "AVVISO: Shareaholic deve essere configurato... Si prega di visitare la %sPagina opzioni del plugin%s ed impostare le preferenze."
|
| 34 |
+
|
| 35 |
+
#: sexy-bookmarks.php:342
|
| 36 |
+
#: sexy-bookmarks.php:343
|
| 37 |
+
#: sexy-bookmarks.php:1572
|
| 38 |
+
msgid "Shareaholic"
|
| 39 |
+
msgstr "Shareaholic"
|
| 40 |
+
|
| 41 |
+
#: sexy-bookmarks.php:356
|
| 42 |
+
msgid "Disable SexyBookmarks on this page."
|
| 43 |
+
msgstr "Disattiva SexyBookmarks in questa pagina."
|
| 44 |
+
|
| 45 |
+
#: sexy-bookmarks.php:470
|
| 46 |
+
msgid "WARNING: You are about to reset all settings to their default state! Do you wish to continue?"
|
| 47 |
+
msgstr "ATTENZIONE: stai per ripristinare tutte le impostazioni predefinite! Vuoi continuare?"
|
| 48 |
+
|
| 49 |
+
#: sexy-bookmarks.php:474
|
| 50 |
+
#: sexy-bookmarks.php:925
|
| 51 |
+
#: sexy-bookmarks.php:933
|
| 52 |
+
#: sexy-bookmarks.php:941
|
| 53 |
+
#: sexy-bookmarks.php:975
|
| 54 |
+
#: sexy-bookmarks.php:1178
|
| 55 |
+
#: sexy-bookmarks.php:1185
|
| 56 |
+
#: sexy-bookmarks.php:1194
|
| 57 |
+
#: sexy-bookmarks.php:1217
|
| 58 |
+
#: sexy-bookmarks.php:1351
|
| 59 |
+
#: sexy-bookmarks.php:1454
|
| 60 |
+
msgid "Yes"
|
| 61 |
+
msgstr "Si"
|
| 62 |
+
|
| 63 |
+
#: sexy-bookmarks.php:474
|
| 64 |
+
msgid "Cancel"
|
| 65 |
+
msgstr "Annulla"
|
| 66 |
+
|
| 67 |
+
#: sexy-bookmarks.php:547
|
| 68 |
+
msgid "All settings have been reset to their default values."
|
| 69 |
+
msgstr "Sono state ripristinate tutte le impostazioni predefinite."
|
| 70 |
+
|
| 71 |
+
#: sexy-bookmarks.php:591
|
| 72 |
+
msgid "Your changes have been saved successfully!"
|
| 73 |
+
msgstr "Le tue modifiche sono state salvate con successo!"
|
| 74 |
+
|
| 75 |
+
#: sexy-bookmarks.php:594
|
| 76 |
+
msgid "Please choose where you would like the menu to be displayed."
|
| 77 |
+
msgstr "Scegli dove vorresti visualizzare il menu."
|
| 78 |
+
|
| 79 |
+
#: sexy-bookmarks.php:595
|
| 80 |
+
msgid "You can't display the menu if you don't choose a few sites to add to it!"
|
| 81 |
+
msgstr "Non è possibile visualizzare il menu, se non scegli qualche sito da aggiungere ad esso!"
|
| 82 |
+
|
| 83 |
+
#: sexy-bookmarks.php:596
|
| 84 |
+
msgid "Please choose where you want the menu displayed."
|
| 85 |
+
msgstr "Scegli dove vorresti visualizzare il menu."
|
| 86 |
+
|
| 87 |
+
#: sexy-bookmarks.php:606
|
| 88 |
+
#, php-format
|
| 89 |
+
msgid "You must first download and activate the %sTwitter Friendly Links Plugin%s before hosting your own short URLs..."
|
| 90 |
+
msgstr "Devi scaricare ed attivare %sTwitter Friendly Links Plugin%s prima di usare i tuoi URL semplificati..."
|
| 91 |
+
|
| 92 |
+
#: sexy-bookmarks.php:608
|
| 93 |
+
#, php-format
|
| 94 |
+
msgid "You must first download and activate the %sYOURLS Plugin%s before hosting your own short URLs..."
|
| 95 |
+
msgstr "Devi scaricare ed attivare %sYOURLS Plugin%s prima di usare i tuoi URL semplificati..."
|
| 96 |
+
|
| 97 |
+
#: sexy-bookmarks.php:625
|
| 98 |
+
msgid "WARNING: The request for a custom sprite has timed out. Reverting to default sprite files."
|
| 99 |
+
msgstr "ATTENZIONE: La richiesta di uno sprite personalizzato è scaduta. Ripristino dei file di sprite predefiniti."
|
| 100 |
+
|
| 101 |
+
#: sexy-bookmarks.php:627
|
| 102 |
+
msgid "Changes saved successfully. However, you should try to generate a custom sprite again later."
|
| 103 |
+
msgstr "Modifiche salvate con successo. Tuttavia, più tardi puoi cercare di generare un nuovo sprite personalizzato."
|
| 104 |
+
|
| 105 |
+
#: sexy-bookmarks.php:631
|
| 106 |
+
#: sexy-bookmarks.php:653
|
| 107 |
+
#, php-format
|
| 108 |
+
msgid "WARNING: Your %sspritegen folder%s is not writeable by the server! %sNeed Help?%s"
|
| 109 |
+
msgstr "ATTENZIONE:la tua cartella %sspritegen%s non è scrivibile dal server! %sServe aiuto?%s"
|
| 110 |
+
|
| 111 |
+
#: sexy-bookmarks.php:633
|
| 112 |
+
#: sexy-bookmarks.php:638
|
| 113 |
+
#: sexy-bookmarks.php:643
|
| 114 |
+
#: sexy-bookmarks.php:654
|
| 115 |
+
#: sexy-bookmarks.php:658
|
| 116 |
+
#: sexy-bookmarks.php:662
|
| 117 |
+
msgid "Changes saved successfully. However, settings are not optimal until you resolve the issue listed above."
|
| 118 |
+
msgstr "Modifiche salvate con successo. Tuttavia, le impostazioni non sono ottimali fino a che non risolvi il problema di cui sopra."
|
| 119 |
+
|
| 120 |
+
#: sexy-bookmarks.php:636
|
| 121 |
+
#: sexy-bookmarks.php:657
|
| 122 |
+
#, php-format
|
| 123 |
+
msgid "WARNING: You need to delete the current custom sprite %s before the plugin can write to the folder. %sNeed Help?%s"
|
| 124 |
+
msgstr "ATTENZIONE: è necessario eliminare l'attuale %s sprite personalizzato prima che il plugin sia in grado di scrivere nella cartella. %sServe aiuto?%s"
|
| 125 |
+
|
| 126 |
+
#: sexy-bookmarks.php:641
|
| 127 |
+
#: sexy-bookmarks.php:661
|
| 128 |
+
#, php-format
|
| 129 |
+
msgid "WARNING: You need to delete the current custom stylesheet %s before the plugin can write to the folder. %sNeed Help?%s"
|
| 130 |
+
msgstr "ATTENZIONE: è necessario eliminare l'attuale %s stylesheet personalizzato prima che il plugin sia in grado di scrivere nella cartella. %sServe aiuto?%s"
|
| 131 |
+
|
| 132 |
+
#: sexy-bookmarks.php:754
|
| 133 |
+
msgid "Plugin Health Status"
|
| 134 |
+
msgstr "Stato di salute del plugin"
|
| 135 |
+
|
| 136 |
+
#: sexy-bookmarks.php:773
|
| 137 |
+
msgid "Directory Permissions"
|
| 138 |
+
msgstr "Permessi cartella"
|
| 139 |
+
|
| 140 |
+
#: sexy-bookmarks.php:776
|
| 141 |
+
#, php-format
|
| 142 |
+
msgid ""
|
| 143 |
+
"To Fix: Please appropriately \n"
|
| 144 |
+
" %sCHMOD%s your /spritegen directory."
|
| 145 |
+
msgstr ""
|
| 146 |
+
"Per correggere: cambiate propriamente \n"
|
| 147 |
+
" con %sCHMOD%s la vostra cartella /spritegen."
|
| 148 |
+
|
| 149 |
+
#: sexy-bookmarks.php:791
|
| 150 |
+
msgid "Load Time Optimized"
|
| 151 |
+
msgstr "Tempo di caricamento ottimizato"
|
| 152 |
+
|
| 153 |
+
#: sexy-bookmarks.php:805
|
| 154 |
+
msgid "Running PHP5+"
|
| 155 |
+
msgstr "PHP5+ in uso"
|
| 156 |
+
|
| 157 |
+
#: sexy-bookmarks.php:824
|
| 158 |
+
msgid "Shareaholic Social Engagement Analytics"
|
| 159 |
+
msgstr "Shareaholic Social Engagement Analytics"
|
| 160 |
+
|
| 161 |
+
#: sexy-bookmarks.php:833
|
| 162 |
+
msgid "<b style=\"font-size:14px;line-height:22px;\">Did you know that content from this website has been shared <span style=\"color:#CC1100;\"><span id=\"bonusShareCount\"></span> time(s)</span> in the past <span id=\"bonusShareTimeFrame\"></span> day(s)?</b>"
|
| 163 |
+
msgstr "<b style=\"font-size:14px;line-height:22px;\">Sapete che il contenuto di questo sito è stato condiviso <span style=\"color:#CC1100;\"><span id=\"bonusShareCount\"></span> volta/-e</span> nel/-i passato/-i <span id=\"bonusShareTimeFrame\"></span> giorno/-i?</b>"
|
| 164 |
+
|
| 165 |
+
#: sexy-bookmarks.php:877
|
| 166 |
+
msgid "Meet the people who spread your content the most:"
|
| 167 |
+
msgstr "Incontra le persone che maggiormente diffondono i contenuti:"
|
| 168 |
+
|
| 169 |
+
#: sexy-bookmarks.php:882
|
| 170 |
+
#, php-format
|
| 171 |
+
msgid "What are you waiting for? <b>Access detailed %ssocial engagement analytics%s about your website for FREE right now!</b><br><br>You have been selected to preview the upcoming premium analytics add-on for SexyBookmarks for FREE for a limited time - so hurry before it is too late! These analytics are designed to help you grow your traffic and referrals."
|
| 172 |
+
msgstr "Cosa state aspettando? <b>Accedete GRATIS a dettagliate %ssocial engagement analytics%s per il vostro sito!</b><br><br>Siete stato selezionato per visualizzare in anteprima e GRATUITAMENTE per un tempo limitato il nostro imminente add-on per SexyBookmarks premium analytics. Queste analisi hanno lo scopo di aiutarvi a farvi aumentare il traffico ed i rinvii. Quindi affrettatevi!"
|
| 173 |
+
|
| 174 |
+
#: sexy-bookmarks.php:891
|
| 175 |
+
msgid "Enabled Networks"
|
| 176 |
+
msgstr "Network abilitati"
|
| 177 |
+
|
| 178 |
+
#: sexy-bookmarks.php:895
|
| 179 |
+
msgid "Select the Networks to display. Drag to reorder."
|
| 180 |
+
msgstr "Seleziona i network da mostrare. Trascina per riordinare."
|
| 181 |
+
|
| 182 |
+
#: sexy-bookmarks.php:897
|
| 183 |
+
msgid "Select"
|
| 184 |
+
msgstr "Seleziona"
|
| 185 |
+
|
| 186 |
+
#: sexy-bookmarks.php:898
|
| 187 |
+
msgid "All"
|
| 188 |
+
msgstr "Tutti"
|
| 189 |
+
|
| 190 |
+
#: sexy-bookmarks.php:899
|
| 191 |
+
msgid "None"
|
| 192 |
+
msgstr "Nessuno"
|
| 193 |
+
|
| 194 |
+
#: sexy-bookmarks.php:900
|
| 195 |
+
msgid "Most Popular"
|
| 196 |
+
msgstr "I più popolari"
|
| 197 |
+
|
| 198 |
+
#: sexy-bookmarks.php:910
|
| 199 |
+
msgid "Made with Much Love, these Icons are © Shareaholic"
|
| 200 |
+
msgstr "Realizzata con tanto amore, queste icone sono © Shareaholic"
|
| 201 |
+
|
| 202 |
+
#: sexy-bookmarks.php:916
|
| 203 |
+
msgid "Additional Buttons"
|
| 204 |
+
msgstr "Bottoni aggiuntivi"
|
| 205 |
+
|
| 206 |
+
#: sexy-bookmarks.php:923
|
| 207 |
+
msgid "Include Facebook Like Button"
|
| 208 |
+
msgstr "Includi il pulsante Mi piace di Facebook"
|
| 209 |
+
|
| 210 |
+
#: sexy-bookmarks.php:926
|
| 211 |
+
#: sexy-bookmarks.php:934
|
| 212 |
+
#: sexy-bookmarks.php:942
|
| 213 |
+
#: sexy-bookmarks.php:976
|
| 214 |
+
#: sexy-bookmarks.php:1138
|
| 215 |
+
#: sexy-bookmarks.php:1145
|
| 216 |
+
#: sexy-bookmarks.php:1172
|
| 217 |
+
#: sexy-bookmarks.php:1179
|
| 218 |
+
#: sexy-bookmarks.php:1186
|
| 219 |
+
#: sexy-bookmarks.php:1195
|
| 220 |
+
#: sexy-bookmarks.php:1218
|
| 221 |
+
#: sexy-bookmarks.php:1352
|
| 222 |
+
#: sexy-bookmarks.php:1356
|
| 223 |
+
#: sexy-bookmarks.php:1455
|
| 224 |
+
msgid "No"
|
| 225 |
+
msgstr "No"
|
| 226 |
+
|
| 227 |
+
#: sexy-bookmarks.php:931
|
| 228 |
+
msgid "Include Facebook Send Button"
|
| 229 |
+
msgstr "Includi il pulsante di invio a Facebook"
|
| 230 |
+
|
| 231 |
+
#: sexy-bookmarks.php:939
|
| 232 |
+
msgid "Include Google +1 Button"
|
| 233 |
+
msgstr "Includi il bottone Google +1"
|
| 234 |
+
|
| 235 |
+
#: sexy-bookmarks.php:948
|
| 236 |
+
msgid "Button Style"
|
| 237 |
+
msgstr "Stile dei bottoni"
|
| 238 |
+
|
| 239 |
+
#: sexy-bookmarks.php:955
|
| 240 |
+
msgid "Standard"
|
| 241 |
+
msgstr "Standard"
|
| 242 |
+
|
| 243 |
+
#: sexy-bookmarks.php:956
|
| 244 |
+
msgid "Buttons"
|
| 245 |
+
msgstr "Pulsanti"
|
| 246 |
+
|
| 247 |
+
#: sexy-bookmarks.php:957
|
| 248 |
+
msgid "Box"
|
| 249 |
+
msgstr "Box"
|
| 250 |
+
|
| 251 |
+
#: sexy-bookmarks.php:968
|
| 252 |
+
msgid "Show counter for +1 Button:"
|
| 253 |
+
msgstr "Mostra contatore pe il bottone +1:"
|
| 254 |
+
|
| 255 |
+
#: sexy-bookmarks.php:987
|
| 256 |
+
msgid "Drag to reorder."
|
| 257 |
+
msgstr "Trascina per riordinare."
|
| 258 |
+
|
| 259 |
+
#: sexy-bookmarks.php:1095
|
| 260 |
+
msgid "Placement Location:"
|
| 261 |
+
msgstr "Posizionamento:"
|
| 262 |
+
|
| 263 |
+
#: sexy-bookmarks.php:1102
|
| 264 |
+
msgid "Above bookmarks to the Left"
|
| 265 |
+
msgstr "Sopra i preferiti a sinistra"
|
| 266 |
+
|
| 267 |
+
#: sexy-bookmarks.php:1103
|
| 268 |
+
msgid "Above bookmarks to the Right"
|
| 269 |
+
msgstr "Sopra i preferiti a destra"
|
| 270 |
+
|
| 271 |
+
#: sexy-bookmarks.php:1104
|
| 272 |
+
msgid "Below bookmarks to the Left"
|
| 273 |
+
msgstr "Sotto i preferiti a sinistra"
|
| 274 |
+
|
| 275 |
+
#: sexy-bookmarks.php:1105
|
| 276 |
+
msgid "Below bookmarks to the Right"
|
| 277 |
+
msgstr "Sotto i preferiti a destra"
|
| 278 |
+
|
| 279 |
+
#: sexy-bookmarks.php:1116
|
| 280 |
+
#, php-format
|
| 281 |
+
msgid "Check out %sour blog%s for additional customization options."
|
| 282 |
+
msgstr "Vai al %snostro blog%s per maggiori opzioni di customizzazione."
|
| 283 |
+
|
| 284 |
+
#: sexy-bookmarks.php:1117
|
| 285 |
+
#: sexy-bookmarks.php:1201
|
| 286 |
+
msgid "switch on \"new\" mode below to enable these exclusive features"
|
| 287 |
+
msgstr "seleziona il \"nuovo\" modo qui sotto per l'abilitazione delle opzione esclusive"
|
| 288 |
+
|
| 289 |
+
#: sexy-bookmarks.php:1127
|
| 290 |
+
msgid "Functionality Settings"
|
| 291 |
+
msgstr "Impostazioni funzionali"
|
| 292 |
+
|
| 293 |
+
#: sexy-bookmarks.php:1134
|
| 294 |
+
msgid "Show Share Counters"
|
| 295 |
+
msgstr "Mostra i contatori di condivisione"
|
| 296 |
+
|
| 297 |
+
#: sexy-bookmarks.php:1135
|
| 298 |
+
msgid "For Facebook, Twitter, Google Buzz and Delicious"
|
| 299 |
+
msgstr "Per Facebook, Twitter, Google Buzz e Delicious"
|
| 300 |
+
|
| 301 |
+
#: sexy-bookmarks.php:1137
|
| 302 |
+
#: sexy-bookmarks.php:1144
|
| 303 |
+
#: sexy-bookmarks.php:1171
|
| 304 |
+
msgid "Yes (recommended)"
|
| 305 |
+
msgstr "Si (raccomandato)"
|
| 306 |
+
|
| 307 |
+
#: sexy-bookmarks.php:1143
|
| 308 |
+
msgid "Use Designer Tooltips"
|
| 309 |
+
msgstr "Utilizza i Designer Tooltips"
|
| 310 |
+
|
| 311 |
+
#: sexy-bookmarks.php:1149
|
| 312 |
+
msgid "Background Color for Tooltips:"
|
| 313 |
+
msgstr "Colore di sfondo per i Tooltips:"
|
| 314 |
+
|
| 315 |
+
#: sexy-bookmarks.php:1156
|
| 316 |
+
#: sexy-bookmarks.php:1166
|
| 317 |
+
msgid "reset"
|
| 318 |
+
msgstr "resetta"
|
| 319 |
+
|
| 320 |
+
#: sexy-bookmarks.php:1159
|
| 321 |
+
msgid "Text Color for Tooltips:"
|
| 322 |
+
msgstr "Colore del testo per i Tooltips:"
|
| 323 |
+
|
| 324 |
+
#: sexy-bookmarks.php:1170
|
| 325 |
+
msgid "Track Performance"
|
| 326 |
+
msgstr "Tenere traccia delle prestazioni"
|
| 327 |
+
|
| 328 |
+
#: sexy-bookmarks.php:1177
|
| 329 |
+
msgid "Add Nofollow to Links"
|
| 330 |
+
msgstr "Aggiungi la proprietà 'nofollow' per i link"
|
| 331 |
+
|
| 332 |
+
#: sexy-bookmarks.php:1184
|
| 333 |
+
msgid "Open Links in New Window"
|
| 334 |
+
msgstr "Apri i link in una nuova finestra"
|
| 335 |
+
|
| 336 |
+
#: sexy-bookmarks.php:1192
|
| 337 |
+
msgid "Show Shareaholic Link"
|
| 338 |
+
msgstr "Mostra link a Shareaholic"
|
| 339 |
+
|
| 340 |
+
#: sexy-bookmarks.php:1210
|
| 341 |
+
msgid "Shareaholic for Publishers [BETA]"
|
| 342 |
+
msgstr "Shareaholic per gli editori [BETA]"
|
| 343 |
+
|
| 344 |
+
#: sexy-bookmarks.php:1215
|
| 345 |
+
msgid "Switch on \"new mode\" to enable exclusive advanced features:"
|
| 346 |
+
msgstr "Seleziona il \"nuovo\" modo per l'abilitazione delle opzione esclusive:"
|
| 347 |
+
|
| 348 |
+
#: sexy-bookmarks.php:1216
|
| 349 |
+
msgid "Use new version?"
|
| 350 |
+
msgstr "Usare la nouva versione?"
|
| 351 |
+
|
| 352 |
+
#: sexy-bookmarks.php:1219
|
| 353 |
+
msgid "You can switch back at any time."
|
| 354 |
+
msgstr "È possibile tornare indietro in qualsiasi momento."
|
| 355 |
+
|
| 356 |
+
#: sexy-bookmarks.php:1228
|
| 357 |
+
msgid "Twitter Options"
|
| 358 |
+
msgstr "Opzioni di Twitter"
|
| 359 |
+
|
| 360 |
+
#: sexy-bookmarks.php:1234
|
| 361 |
+
msgid "Configuration Instructions:"
|
| 362 |
+
msgstr "Istruzioni di configurazione:"
|
| 363 |
+
|
| 364 |
+
#: sexy-bookmarks.php:1235
|
| 365 |
+
#, php-format
|
| 366 |
+
msgid "Using the strings %s and %s you can fully customize your tweet output."
|
| 367 |
+
msgstr "Utilizzando le stringhe %s e %s è possibile personalizzare completamente l'output di tweet."
|
| 368 |
+
|
| 369 |
+
#: sexy-bookmarks.php:1236
|
| 370 |
+
msgid "Example Configurations:"
|
| 371 |
+
msgstr "Configurazioni di esempio:"
|
| 372 |
+
|
| 373 |
+
#: sexy-bookmarks.php:1238
|
| 374 |
+
msgid "or"
|
| 375 |
+
msgstr "o"
|
| 376 |
+
|
| 377 |
+
#: sexy-bookmarks.php:1242
|
| 378 |
+
msgid "Configure Custom Tweet Template:"
|
| 379 |
+
msgstr "Configura template personalizzato di Tweet:"
|
| 380 |
+
|
| 381 |
+
#: sexy-bookmarks.php:1242
|
| 382 |
+
msgid "Characters:"
|
| 383 |
+
msgstr "Caratteri:"
|
| 384 |
+
|
| 385 |
+
#: sexy-bookmarks.php:1245
|
| 386 |
+
msgid "Example Tweet Output:"
|
| 387 |
+
msgstr "Esempio output di Tweet:"
|
| 388 |
+
|
| 389 |
+
#: sexy-bookmarks.php:1247
|
| 390 |
+
msgid "Which URL Shortener?"
|
| 391 |
+
msgstr "Quale servizio usi per semplificare gli URL?"
|
| 392 |
+
|
| 393 |
+
#: sexy-bookmarks.php:1252
|
| 394 |
+
msgid "Don't use a shortener"
|
| 395 |
+
msgstr "Non usare gli URL semplificati"
|
| 396 |
+
|
| 397 |
+
#: sexy-bookmarks.php:1266
|
| 398 |
+
#: sexy-bookmarks.php:1275
|
| 399 |
+
#: sexy-bookmarks.php:1289
|
| 400 |
+
msgid "User ID:"
|
| 401 |
+
msgstr "User ID:"
|
| 402 |
+
|
| 403 |
+
#: sexy-bookmarks.php:1268
|
| 404 |
+
#: sexy-bookmarks.php:1277
|
| 405 |
+
#: sexy-bookmarks.php:1291
|
| 406 |
+
msgid "API Key:"
|
| 407 |
+
msgstr "API Key:"
|
| 408 |
+
|
| 409 |
+
#: sexy-bookmarks.php:1284
|
| 410 |
+
msgid "Track Generated Links?"
|
| 411 |
+
msgstr "Traccia i link generati?"
|
| 412 |
+
|
| 413 |
+
#: sexy-bookmarks.php:1303
|
| 414 |
+
msgid "Plugin Aesthetics"
|
| 415 |
+
msgstr "Impostazioni grafiche"
|
| 416 |
+
|
| 417 |
+
#: sexy-bookmarks.php:1308
|
| 418 |
+
msgid "Warning!"
|
| 419 |
+
msgstr "Attenzione!"
|
| 420 |
+
|
| 421 |
+
#: sexy-bookmarks.php:1309
|
| 422 |
+
msgid "This option is intended %STRICTLY%s for users who understand how to edit CSS/JS and intend to change/edit the associated images themselves. Unfortunately, no support will be offered for this feature, as I cannot be held accountable for your coding and/or image editing mistakes."
|
| 423 |
+
msgstr "Questa opzione è destinata %sRIGOROSAMENTE%s per gli utenti che sanno come modificare il CSS/JS e intendono cambiare/modificare da soli le immagini associate. Nessun supporto verrà offerto per questa funzione, in quanto non posso essere ritenuto responsabile per i vostri errori di codifica e/o editing delle immagini."
|
| 424 |
+
|
| 425 |
+
#: sexy-bookmarks.php:1310
|
| 426 |
+
msgid "How it works..."
|
| 427 |
+
msgstr "Come funziona..."
|
| 428 |
+
|
| 429 |
+
#: sexy-bookmarks.php:1311
|
| 430 |
+
msgid "Since you have chosen for the plugin to override the style settings with your own custom mods, it will now pull the files from the new folders it is going to create on your server as soon as you save your changes. The file/folder locations should be as follows:"
|
| 431 |
+
msgstr "Hai scelto di sovrascrivere le impostazioni predefinite di stile con le tue modifiche che saranno scritte su file non appena le salverai. I percorsi file/cartella dovrebbero essere i seguenti:"
|
| 432 |
+
|
| 433 |
+
#: sexy-bookmarks.php:1328
|
| 434 |
+
msgid "Once you have saved your changes, you will be able to edit the image sprite that holds all of the icons for Shareaholic as well as the CSS which accompanies it. Just be sure that you do in fact edit the CSS if you edit the images, as it is unlikely the heights, widths, and background positions of the images will stay the same after you are done."
|
| 435 |
+
msgstr "Una volta salvate le modifiche, potrai ritoccare il set di icone di SexyBookmarks e il codice CSS che lo gestisce. Assicurati di aggiornare le proprietà CSS come width, heigth e background-position in maniera opportuna o potresti riscontrare errori nella visualizzazione delle animazioni."
|
| 436 |
+
|
| 437 |
+
#: sexy-bookmarks.php:1329
|
| 438 |
+
msgid "Just a quick note... When you edit the styles and images to include your own custom backgrounds, icons, and CSS styles, be aware that those changes will not be reflected on the plugin options page. In other words: when you select your networks to be displayed, or when you select the background image to use, it will still be displaying the images from the original plugin directory."
|
| 439 |
+
msgstr "Una breve nota: non ci sarà alcuna traccia delle tue eventuali modifiche allo stile CSS ed alle immagini. In altre parole, nelle voci successive (Network da mostrare o Immagine di sfondo) vedrai sempre le immagini originali del plugin."
|
| 440 |
+
|
| 441 |
+
#: sexy-bookmarks.php:1330
|
| 442 |
+
msgid "In Case of Emergency"
|
| 443 |
+
msgstr "In caso di emergenza"
|
| 444 |
+
|
| 445 |
+
#: sexy-bookmarks.php:1331
|
| 446 |
+
msgid "If you happen to mess things up, you can follow these directions to reset the plugin back to normal and try again if you wish:"
|
| 447 |
+
msgstr "Se vengono generati degli errori inaspettati, puoi seguire le seguenti istruzioni per ripristinare la versione originale del plugin e ricominciare a modificarlo:"
|
| 448 |
+
|
| 449 |
+
#: sexy-bookmarks.php:1333
|
| 450 |
+
msgid "Login to your server via FTP or SSH. (whichever you are more comfortable with)"
|
| 451 |
+
msgstr "Connettiti al tuo server via FTP o SSH (scegli il protocollo più comodo)."
|
| 452 |
+
|
| 453 |
+
#: sexy-bookmarks.php:1334
|
| 454 |
+
msgid "Navigate to your wp-content directory."
|
| 455 |
+
msgstr "Raggiungi la cartella wp-content."
|
| 456 |
+
|
| 457 |
+
#: sexy-bookmarks.php:1335
|
| 458 |
+
msgid "Delete the directory named \"sexy-mods\"."
|
| 459 |
+
msgstr "Elimina la cartella \"sexy-mods\"."
|
| 460 |
+
|
| 461 |
+
#: sexy-bookmarks.php:1336
|
| 462 |
+
msgid "Login to your WordPress dashboard."
|
| 463 |
+
msgstr "Accedi al pannello di amministrazione di WordPress."
|
| 464 |
+
|
| 465 |
+
#: sexy-bookmarks.php:1337
|
| 466 |
+
msgid "Go to the SexyBookmarks plugin options page. (Settings->SexyBookmarks)"
|
| 467 |
+
msgstr "Vai alla pagina delle impostazioni di SexyBookmarks (Impostazioni->SexyBookmarks)."
|
| 468 |
+
|
| 469 |
+
#: sexy-bookmarks.php:1338
|
| 470 |
+
msgid "Deselect the \"Use custom mods\" option."
|
| 471 |
+
msgstr "Togli la spunta alla voce \"Usa le modifiche personali\"."
|
| 472 |
+
|
| 473 |
+
#: sexy-bookmarks.php:1339
|
| 474 |
+
msgid "Save your changes."
|
| 475 |
+
msgstr "Salva le modifiche."
|
| 476 |
+
|
| 477 |
+
#: sexy-bookmarks.php:1341
|
| 478 |
+
msgid "Close Message"
|
| 479 |
+
msgstr "Chiudi messaggio"
|
| 480 |
+
|
| 481 |
+
#: sexy-bookmarks.php:1345
|
| 482 |
+
msgid "Override Styles With Custom Mods Instead?"
|
| 483 |
+
msgstr "Applicare le modifiche allo stile di default?"
|
| 484 |
+
|
| 485 |
+
#: sexy-bookmarks.php:1350
|
| 486 |
+
msgid "Animate-expand multi-lined bookmarks?"
|
| 487 |
+
msgstr "Mostra l'animazione per i preferiti su più linee?"
|
| 488 |
+
|
| 489 |
+
#: sexy-bookmarks.php:1353
|
| 490 |
+
msgid "Auto-space/center the bookmarks?"
|
| 491 |
+
msgstr "Centra-spazia automaticamente i preferiti?"
|
| 492 |
+
|
| 493 |
+
#: sexy-bookmarks.php:1354
|
| 494 |
+
msgid "Space"
|
| 495 |
+
msgstr "Spazia"
|
| 496 |
+
|
| 497 |
+
#: sexy-bookmarks.php:1355
|
| 498 |
+
msgid "Center"
|
| 499 |
+
msgstr "Centra"
|
| 500 |
+
|
| 501 |
+
#: sexy-bookmarks.php:1359
|
| 502 |
+
msgid "Use a background image?"
|
| 503 |
+
msgstr "Usare un'immagine di sfondo?"
|
| 504 |
+
|
| 505 |
+
#: sexy-bookmarks.php:1393
|
| 506 |
+
msgid "Compatibility Settings"
|
| 507 |
+
msgstr "Impostazioni di compatibilità"
|
| 508 |
+
|
| 509 |
+
#: sexy-bookmarks.php:1399
|
| 510 |
+
msgid "WP-Minify Compatibility Mode"
|
| 511 |
+
msgstr "Modalità compatibile di WP-Minify"
|
| 512 |
+
|
| 513 |
+
#: sexy-bookmarks.php:1400
|
| 514 |
+
msgid "Enabled (recommended)"
|
| 515 |
+
msgstr "Abilitato (raccomandato)"
|
| 516 |
+
|
| 517 |
+
#: sexy-bookmarks.php:1401
|
| 518 |
+
msgid "Disabled"
|
| 519 |
+
msgstr "Disabilitato"
|
| 520 |
+
|
| 521 |
+
#: sexy-bookmarks.php:1402
|
| 522 |
+
msgid "(SexyBookmarks may not work with this option turned off)"
|
| 523 |
+
msgstr "(SexyBookmarks potrebbe non funzionare con questa opzione disattivata)"
|
| 524 |
+
|
| 525 |
+
#: sexy-bookmarks.php:1404
|
| 526 |
+
msgid "jQuery Compatibility Fix"
|
| 527 |
+
msgstr "Patch per la compatibilità con jQuery"
|
| 528 |
+
|
| 529 |
+
#: sexy-bookmarks.php:1405
|
| 530 |
+
msgid "Check this box ONLY if you notice jQuery being loaded twice in your source code!"
|
| 531 |
+
msgstr "Seleziona questa voce solo se noti che il codice jQuery viene caricato due volte nel codice sorgente della pagina!"
|
| 532 |
+
|
| 533 |
+
#: sexy-bookmarks.php:1407
|
| 534 |
+
msgid "Load scripts in Footer"
|
| 535 |
+
msgstr "Carica script nel footer"
|
| 536 |
+
|
| 537 |
+
#: sexy-bookmarks.php:1408
|
| 538 |
+
msgid "Check this box if you want the SexyBookmarks javascript to be loaded in your blog's footer."
|
| 539 |
+
msgstr "Seleziona questa opzione se vuoi che il codice javascript di SexyBookmarks venga caricato nel footer del tuo blog."
|
| 540 |
+
|
| 541 |
+
#: sexy-bookmarks.php:1410
|
| 542 |
+
msgid "Add Facebook required namespaces to your HTML tag? (recommended)"
|
| 543 |
+
msgstr "Aggiungere i namespaces Facebook necessari ai vostri tag HTML? (consigliato)"
|
| 544 |
+
|
| 545 |
+
#: sexy-bookmarks.php:1411
|
| 546 |
+
msgid "Check this box if you include Facebook's Like/Send buttons. These buttons may not work with this option turned off."
|
| 547 |
+
msgstr "Selezionare questa casella se si includono i pulsanti Mi piace/Invio di Facebook. Questi pulsanti potrebbero non funzionare con questa opzione disattivata."
|
| 548 |
+
|
| 549 |
+
#: sexy-bookmarks.php:1420
|
| 550 |
+
msgid "Menu Placement"
|
| 551 |
+
msgstr "Posizionamento del menu"
|
| 552 |
+
|
| 553 |
+
#: sexy-bookmarks.php:1426
|
| 554 |
+
#, php-format
|
| 555 |
+
msgid "Need help with this? Find it in the %sofficial install guide%s."
|
| 556 |
+
msgstr "Hai bisogno di supporto? Cerca nella %sguida ufficiale di installazione%s."
|
| 557 |
+
|
| 558 |
+
#: sexy-bookmarks.php:1432
|
| 559 |
+
msgid "Menu Location (in relation to content):"
|
| 560 |
+
msgstr "Posizione del menu (rispetto al contenuto):"
|
| 561 |
+
|
| 562 |
+
#: sexy-bookmarks.php:1433
|
| 563 |
+
msgid "Above Content"
|
| 564 |
+
msgstr "Sopra al contenuto"
|
| 565 |
+
|
| 566 |
+
#: sexy-bookmarks.php:1434
|
| 567 |
+
msgid "Below Content"
|
| 568 |
+
msgstr "Sotto al contenuto"
|
| 569 |
+
|
| 570 |
+
#: sexy-bookmarks.php:1435
|
| 571 |
+
msgid "Above & Below Content"
|
| 572 |
+
msgstr "Sopra e sotto al contenuto"
|
| 573 |
+
|
| 574 |
+
#: sexy-bookmarks.php:1436
|
| 575 |
+
msgid "Manual Mode"
|
| 576 |
+
msgstr "Posizionamento manuale"
|
| 577 |
+
|
| 578 |
+
#: sexy-bookmarks.php:1437
|
| 579 |
+
msgid "Posts, pages, or the whole shebang?"
|
| 580 |
+
msgstr "Articoli, pagine o tutto?"
|
| 581 |
+
|
| 582 |
+
#: sexy-bookmarks.php:1442
|
| 583 |
+
msgid "Posts Only"
|
| 584 |
+
msgstr "Solo articoli"
|
| 585 |
+
|
| 586 |
+
#: sexy-bookmarks.php:1443
|
| 587 |
+
msgid "Pages Only"
|
| 588 |
+
msgstr "Solo pagine"
|
| 589 |
+
|
| 590 |
+
#: sexy-bookmarks.php:1444
|
| 591 |
+
msgid "Index Only"
|
| 592 |
+
msgstr "Solo indici"
|
| 593 |
+
|
| 594 |
+
#: sexy-bookmarks.php:1445
|
| 595 |
+
msgid "Posts & Pages"
|
| 596 |
+
msgstr "Articoli e pagine"
|
| 597 |
+
|
| 598 |
+
#: sexy-bookmarks.php:1446
|
| 599 |
+
msgid "Posts & Index"
|
| 600 |
+
msgstr "Articoli e indici"
|
| 601 |
+
|
| 602 |
+
#: sexy-bookmarks.php:1447
|
| 603 |
+
msgid "Pages & Index"
|
| 604 |
+
msgstr "Pagine e indici"
|
| 605 |
+
|
| 606 |
+
#: sexy-bookmarks.php:1448
|
| 607 |
+
msgid "Posts, Pages, & Index"
|
| 608 |
+
msgstr "Articoli, pagine e indici"
|
| 609 |
+
|
| 610 |
+
#: sexy-bookmarks.php:1452
|
| 611 |
+
msgid "Click here for help with this option"
|
| 612 |
+
msgstr "Supporto per questa opzione"
|
| 613 |
+
|
| 614 |
+
#: sexy-bookmarks.php:1453
|
| 615 |
+
msgid "Show in RSS feed?"
|
| 616 |
+
msgstr "Mostrare nei feed RSS?"
|
| 617 |
+
|
| 618 |
+
#: sexy-bookmarks.php:1457
|
| 619 |
+
msgid "Hide menu from mobile browsers?"
|
| 620 |
+
msgstr "Nascondi il menu nei browser per dispositivi mobili?"
|
| 621 |
+
|
| 622 |
+
#: sexy-bookmarks.php:1466
|
| 623 |
+
msgid "Save Changes"
|
| 624 |
+
msgstr "Salva le modifiche"
|
| 625 |
+
|
| 626 |
+
#: sexy-bookmarks.php:1470
|
| 627 |
+
msgid "Reset Settings"
|
| 628 |
+
msgstr "Resetta impostazioni"
|
| 629 |
+
|
| 630 |
+
#: sexy-bookmarks.php:1479
|
| 631 |
+
#: includes/shrsb_analytics_page.php:56
|
| 632 |
+
#: includes/shrsb_authentication_page.php:121
|
| 633 |
+
msgid "Helpful Plugin Links"
|
| 634 |
+
msgstr "Link utili:"
|
| 635 |
+
|
| 636 |
+
#: sexy-bookmarks.php:1484
|
| 637 |
+
#: includes/shrsb_analytics_page.php:61
|
| 638 |
+
#: includes/shrsb_authentication_page.php:126
|
| 639 |
+
msgid "Installation & Usage Guide"
|
| 640 |
+
msgstr "Installazione e guida all'uso"
|
| 641 |
+
|
| 642 |
+
#: sexy-bookmarks.php:1485
|
| 643 |
+
#: includes/shrsb_analytics_page.php:62
|
| 644 |
+
#: includes/shrsb_authentication_page.php:127
|
| 645 |
+
msgid "Frequently Asked Questions"
|
| 646 |
+
msgstr "Domande frequenti"
|
| 647 |
+
|
| 648 |
+
#: sexy-bookmarks.php:1486
|
| 649 |
+
#: includes/shrsb_analytics_page.php:63
|
| 650 |
+
#: includes/shrsb_authentication_page.php:128
|
| 651 |
+
msgid "Bug Submission Form"
|
| 652 |
+
msgstr "Form per la segnalazione dei bug"
|
| 653 |
+
|
| 654 |
+
#: sexy-bookmarks.php:1487
|
| 655 |
+
#: includes/shrsb_analytics_page.php:64
|
| 656 |
+
#: includes/shrsb_authentication_page.php:129
|
| 657 |
+
msgid "Feature Request Form"
|
| 658 |
+
msgstr "Form per la richiesta di nuove caratteristiche"
|
| 659 |
+
|
| 660 |
+
#: sexy-bookmarks.php:1488
|
| 661 |
+
#: includes/shrsb_analytics_page.php:65
|
| 662 |
+
#: includes/shrsb_authentication_page.php:130
|
| 663 |
+
msgid "Submit a Translation"
|
| 664 |
+
msgstr "Spedisci una traduzione"
|
| 665 |
+
|
| 666 |
+
#: sexy-bookmarks.php:1489
|
| 667 |
+
#: includes/shrsb_analytics_page.php:66
|
| 668 |
+
#: includes/shrsb_authentication_page.php:131
|
| 669 |
+
msgid "Shareaholic Browsers Add-ons"
|
| 670 |
+
msgstr "Browser Add-ons da Shareaholic"
|
| 671 |
+
|
| 672 |
+
#: sexy-bookmarks.php:1490
|
| 673 |
+
#: includes/shrsb_analytics_page.php:67
|
| 674 |
+
#: includes/shrsb_authentication_page.php:132
|
| 675 |
+
msgid "Thanks & Credits"
|
| 676 |
+
msgstr "Ringraziamenti e crediti"
|
| 677 |
+
|
| 678 |
+
#: sexy-bookmarks.php:1518
|
| 679 |
+
msgid "NOTICE: We have noticed that you are using an old version of PHP. It is highly recommended that you upgrade to PHP 5 or higher to avail certain advanced Shareaholic features. Also, if you do not upgrade to PHP 5 you will not be able to run WordPress 3.2+"
|
| 680 |
+
msgstr "AVVISO: Abbiamo notato che si sta utilizzando una vecchia versione di PHP. Si consiglia vivamente di eseguire l'aggiornamento a PHP 5 o superiori per avvalersi di alcune caratteristiche avanzate di Shareaholic. Inoltre, se non si esegue l'aggiornamento a PHP 5 non si sarà in grado di usare WordPress 3.2 +"
|
| 681 |
+
|
| 682 |
+
#: sexy-bookmarks.php:1572
|
| 683 |
+
msgid "Shareaholic for Publishers"
|
| 684 |
+
msgstr "Shareaholic per gli editori"
|
| 685 |
+
|
| 686 |
+
#: sexy-bookmarks.php:1575
|
| 687 |
+
msgid "SexyBookmarks"
|
| 688 |
+
msgstr "SexyBookmarks"
|
| 689 |
+
|
| 690 |
+
#: sexy-bookmarks.php:1621
|
| 691 |
+
msgid "Settings"
|
| 692 |
+
msgstr "Impostazioni"
|
| 693 |
+
|
| 694 |
+
#: includes/bookmarks-data.php:21
|
| 695 |
+
#, php-format
|
| 696 |
+
msgid "Check this box to include %s in your bookmarking menu"
|
| 697 |
+
msgstr "Selezionare questa opzione per includere %s nel tuo bookmarking menu"
|
| 698 |
+
|
| 699 |
+
#: includes/bookmarks-data.php:28
|
| 700 |
+
#: includes/bookmarks-data.php:58
|
| 701 |
+
#: includes/bookmarks-data.php:83
|
| 702 |
+
#: includes/bookmarks-data.php:199
|
| 703 |
+
#: includes/bookmarks-data.php:254
|
| 704 |
+
#: includes/bookmarks-data.php:259
|
| 705 |
+
#: includes/bookmarks-data.php:264
|
| 706 |
+
#: includes/bookmarks-data.php:269
|
| 707 |
+
#: includes/bookmarks-data.php:309
|
| 708 |
+
#: includes/bookmarks-data.php:324
|
| 709 |
+
#: includes/bookmarks-data.php:334
|
| 710 |
+
#: includes/bookmarks-data.php:339
|
| 711 |
+
#: includes/bookmarks-data.php:359
|
| 712 |
+
msgid "Submit this to "
|
| 713 |
+
msgstr "Invia a "
|
| 714 |
+
|
| 715 |
+
#: includes/bookmarks-data.php:33
|
| 716 |
+
#: includes/bookmarks-data.php:38
|
| 717 |
+
#: includes/bookmarks-data.php:53
|
| 718 |
+
#: includes/bookmarks-data.php:68
|
| 719 |
+
#: includes/bookmarks-data.php:73
|
| 720 |
+
#: includes/bookmarks-data.php:88
|
| 721 |
+
#: includes/bookmarks-data.php:114
|
| 722 |
+
#: includes/bookmarks-data.php:149
|
| 723 |
+
#: includes/bookmarks-data.php:154
|
| 724 |
+
#: includes/bookmarks-data.php:159
|
| 725 |
+
#: includes/bookmarks-data.php:169
|
| 726 |
+
#: includes/bookmarks-data.php:174
|
| 727 |
+
#: includes/bookmarks-data.php:289
|
| 728 |
+
#: includes/bookmarks-data.php:349
|
| 729 |
+
#: includes/bookmarks-data.php:369
|
| 730 |
+
#: includes/bookmarks-data.php:389
|
| 731 |
+
#: includes/bookmarks-data.php:399
|
| 732 |
+
#: includes/bookmarks-data.php:404
|
| 733 |
+
#: includes/bookmarks-data.php:414
|
| 734 |
+
#: includes/bookmarks-data.php:424
|
| 735 |
+
#: includes/bookmarks-data.php:439
|
| 736 |
+
msgid "Share this on "
|
| 737 |
+
msgstr "Condividi su "
|
| 738 |
+
|
| 739 |
+
#: includes/bookmarks-data.php:43
|
| 740 |
+
msgid "Digg this!"
|
| 741 |
+
msgstr "Diggalo!"
|
| 742 |
+
|
| 743 |
+
#: includes/bookmarks-data.php:48
|
| 744 |
+
msgid "Post this on "
|
| 745 |
+
msgstr "Pubblicalo su "
|
| 746 |
+
|
| 747 |
+
#: includes/bookmarks-data.php:63
|
| 748 |
+
msgid "Stumble upon something good? Share it on StumbleUpon"
|
| 749 |
+
msgstr "Hai trovato qualcosa di buono? Condividilo su StumbleUpon"
|
| 750 |
+
|
| 751 |
+
#: includes/bookmarks-data.php:78
|
| 752 |
+
#: includes/bookmarks-data.php:219
|
| 753 |
+
#: includes/bookmarks-data.php:239
|
| 754 |
+
#: includes/bookmarks-data.php:379
|
| 755 |
+
msgid "Post this to "
|
| 756 |
+
msgstr "Pubblicalo su "
|
| 757 |
+
|
| 758 |
+
#: includes/bookmarks-data.php:93
|
| 759 |
+
msgid "Tweet This!"
|
| 760 |
+
msgstr "Tweetalo!"
|
| 761 |
+
|
| 762 |
+
#: includes/bookmarks-data.php:97
|
| 763 |
+
msgid "an 'Email to a Friend' link"
|
| 764 |
+
msgstr "il solito link 'Segnala ad un amico via mail'"
|
| 765 |
+
|
| 766 |
+
#: includes/bookmarks-data.php:98
|
| 767 |
+
msgid "Email this to a friend?"
|
| 768 |
+
msgstr "Vuoi segnalarlo via mail ad un amico?"
|
| 769 |
+
|
| 770 |
+
#: includes/bookmarks-data.php:103
|
| 771 |
+
msgid "Suggest this article to "
|
| 772 |
+
msgstr "Suggerisci questo articolo a "
|
| 773 |
+
|
| 774 |
+
#: includes/bookmarks-data.php:107
|
| 775 |
+
msgid "a 'Subscribe to Comments' link"
|
| 776 |
+
msgstr "il solito link 'Sottoscrivi i commenti'"
|
| 777 |
+
|
| 778 |
+
#: includes/bookmarks-data.php:108
|
| 779 |
+
#: includes/public.php:151
|
| 780 |
+
msgid "Subscribe to the comments for this post?"
|
| 781 |
+
msgstr "Vuoi iscriverti ai commenti per questo post?"
|
| 782 |
+
|
| 783 |
+
#: includes/bookmarks-data.php:119
|
| 784 |
+
msgid "Seed this on "
|
| 785 |
+
msgstr "Seeddalo su "
|
| 786 |
+
|
| 787 |
+
#: includes/bookmarks-data.php:124
|
| 788 |
+
#: includes/bookmarks-data.php:129
|
| 789 |
+
#: includes/bookmarks-data.php:139
|
| 790 |
+
#: includes/bookmarks-data.php:144
|
| 791 |
+
#: includes/bookmarks-data.php:179
|
| 792 |
+
#: includes/bookmarks-data.php:184
|
| 793 |
+
#: includes/bookmarks-data.php:189
|
| 794 |
+
#: includes/bookmarks-data.php:194
|
| 795 |
+
#: includes/bookmarks-data.php:214
|
| 796 |
+
#: includes/bookmarks-data.php:374
|
| 797 |
+
#: includes/bookmarks-data.php:394
|
| 798 |
+
#: includes/bookmarks-data.php:419
|
| 799 |
+
msgid "Add this to "
|
| 800 |
+
msgstr "Aggiungilo a "
|
| 801 |
+
|
| 802 |
+
#: includes/bookmarks-data.php:134
|
| 803 |
+
msgid "Post on Google Buzz"
|
| 804 |
+
msgstr "Pubblicalo su Google Buzz"
|
| 805 |
+
|
| 806 |
+
#: includes/bookmarks-data.php:164
|
| 807 |
+
msgid "Mark this on "
|
| 808 |
+
msgstr "Segnalo su "
|
| 809 |
+
|
| 810 |
+
#: includes/bookmarks-data.php:173
|
| 811 |
+
#: includes/bookmarks-data.php:178
|
| 812 |
+
#: includes/bookmarks-data.php:183
|
| 813 |
+
#: includes/bookmarks-data.php:188
|
| 814 |
+
#: includes/bookmarks-data.php:193
|
| 815 |
+
msgid " (Russian)"
|
| 816 |
+
msgstr " (Russo)"
|
| 817 |
+
|
| 818 |
+
#: includes/bookmarks-data.php:204
|
| 819 |
+
msgid "Send this page to "
|
| 820 |
+
msgstr "Invia questa pagina a "
|
| 821 |
+
|
| 822 |
+
#: includes/bookmarks-data.php:209
|
| 823 |
+
msgid "Bump this on "
|
| 824 |
+
msgstr "Bumpalo su "
|
| 825 |
+
|
| 826 |
+
#: includes/bookmarks-data.php:224
|
| 827 |
+
msgid "Save this to "
|
| 828 |
+
msgstr "Salvalo su "
|
| 829 |
+
|
| 830 |
+
#: includes/bookmarks-data.php:229
|
| 831 |
+
msgid "Tip this to "
|
| 832 |
+
msgstr "Suggeriscilo su "
|
| 833 |
+
|
| 834 |
+
#: includes/bookmarks-data.php:234
|
| 835 |
+
msgid "Sphinn this on "
|
| 836 |
+
msgstr "Sphinnalo su "
|
| 837 |
+
|
| 838 |
+
#: includes/bookmarks-data.php:244
|
| 839 |
+
msgid "Grind this! on "
|
| 840 |
+
msgstr "Grinddalo su "
|
| 841 |
+
|
| 842 |
+
#: includes/bookmarks-data.php:249
|
| 843 |
+
msgid "Ping this on "
|
| 844 |
+
msgstr "Notificalo su "
|
| 845 |
+
|
| 846 |
+
#: includes/bookmarks-data.php:253
|
| 847 |
+
#: includes/bookmarks-data.php:258
|
| 848 |
+
msgid " (Dutch)"
|
| 849 |
+
msgstr " (Tedesco)"
|
| 850 |
+
|
| 851 |
+
#: includes/bookmarks-data.php:274
|
| 852 |
+
msgid "Blend this!"
|
| 853 |
+
msgstr "Blenddalo!"
|
| 854 |
+
|
| 855 |
+
#: includes/bookmarks-data.php:278
|
| 856 |
+
msgid " (Polish)"
|
| 857 |
+
msgstr " (Polacco)"
|
| 858 |
+
|
| 859 |
+
#: includes/bookmarks-data.php:279
|
| 860 |
+
msgid "Add this to Wykop!"
|
| 861 |
+
msgstr "Aggiungilo a Wykop!"
|
| 862 |
+
|
| 863 |
+
#: includes/bookmarks-data.php:284
|
| 864 |
+
msgid "Engage with this article!"
|
| 865 |
+
msgstr "Engage con questo articolo!"
|
| 866 |
+
|
| 867 |
+
#: includes/bookmarks-data.php:293
|
| 868 |
+
msgid " (Swedish)"
|
| 869 |
+
msgstr " (Svedese)"
|
| 870 |
+
|
| 871 |
+
#: includes/bookmarks-data.php:294
|
| 872 |
+
msgid "Push this on "
|
| 873 |
+
msgstr "Sparalo in "
|
| 874 |
+
|
| 875 |
+
#: includes/bookmarks-data.php:298
|
| 876 |
+
msgid " (Japanese)"
|
| 877 |
+
msgstr " (Giapponese)"
|
| 878 |
+
|
| 879 |
+
#: includes/bookmarks-data.php:299
|
| 880 |
+
msgid "Bookmarks this on "
|
| 881 |
+
msgstr "Aggiungilo in "
|
| 882 |
+
|
| 883 |
+
#: includes/bookmarks-data.php:304
|
| 884 |
+
msgid "Store this link on "
|
| 885 |
+
msgstr "Memorizzalo in "
|
| 886 |
+
|
| 887 |
+
#: includes/bookmarks-data.php:314
|
| 888 |
+
msgid "Add to a lense on "
|
| 889 |
+
msgstr "Aggiungilo in "
|
| 890 |
+
|
| 891 |
+
#: includes/bookmarks-data.php:319
|
| 892 |
+
msgid "Submit this story to "
|
| 893 |
+
msgstr "Invia questa storia a "
|
| 894 |
+
|
| 895 |
+
#: includes/bookmarks-data.php:329
|
| 896 |
+
msgid "Clip this to "
|
| 897 |
+
msgstr "Ritaglialo per "
|
| 898 |
+
|
| 899 |
+
#: includes/bookmarks-data.php:333
|
| 900 |
+
#: includes/bookmarks-data.php:338
|
| 901 |
+
msgid " (Spanish)"
|
| 902 |
+
msgstr " (Spagnolo)"
|
| 903 |
+
|
| 904 |
+
#: includes/bookmarks-data.php:344
|
| 905 |
+
msgid "Submit this link to "
|
| 906 |
+
msgstr "Sottomettilo in "
|
| 907 |
+
|
| 908 |
+
#: includes/bookmarks-data.php:354
|
| 909 |
+
msgid "Submit tip to "
|
| 910 |
+
msgstr "Suggeriscilo in "
|
| 911 |
+
|
| 912 |
+
#: includes/bookmarks-data.php:364
|
| 913 |
+
msgid "Promote this on "
|
| 914 |
+
msgstr "Pubblicizzalo su "
|
| 915 |
+
|
| 916 |
+
#: includes/bookmarks-data.php:384
|
| 917 |
+
msgid "Blog this on "
|
| 918 |
+
msgstr "Bloggalo con "
|
| 919 |
+
|
| 920 |
+
#: includes/bookmarks-data.php:398
|
| 921 |
+
msgid " (Estonian)"
|
| 922 |
+
msgstr " (Estone)"
|
| 923 |
+
|
| 924 |
+
#: includes/bookmarks-data.php:409
|
| 925 |
+
msgid "Add this link to "
|
| 926 |
+
msgstr "Aggi il link a"
|
| 927 |
+
|
| 928 |
+
#: includes/bookmarks-data.php:413
|
| 929 |
+
msgid "(Italian)"
|
| 930 |
+
msgstr "(Italiano)"
|
| 931 |
+
|
| 932 |
+
#: includes/bookmarks-data.php:429
|
| 933 |
+
msgid "Spring this on "
|
| 934 |
+
msgstr "Springalo su "
|
| 935 |
+
|
| 936 |
+
#: includes/bookmarks-data.php:434
|
| 937 |
+
msgid "Box this on "
|
| 938 |
+
msgstr "Boxalo su "
|
| 939 |
+
|
| 940 |
+
#: includes/bookmarks-data.php:444
|
| 941 |
+
#: includes/bookmarks-data.php:449
|
| 942 |
+
#: includes/bookmarks-data.php:454
|
| 943 |
+
msgid "Email this via "
|
| 944 |
+
msgstr "Manda email con "
|
| 945 |
+
|
| 946 |
+
#: includes/bookmarks-data.php:459
|
| 947 |
+
msgid "Share this via "
|
| 948 |
+
msgstr "Condividi con "
|
| 949 |
+
|
| 950 |
+
#: includes/public.php:475
|
| 951 |
+
msgid "An unknown error occurred in SexyBookmarks"
|
| 952 |
+
msgstr "È stato rilevato un errore in SexyBookmarks"
|
| 953 |
+
|
| 954 |
+
#: includes/public.php:828
|
| 955 |
+
msgid "SexyBookmarks has been disabled on this page"
|
| 956 |
+
msgstr "SexyBookmarks è stato disattivato in questa pagina"
|
| 957 |
+
|
| 958 |
+
#: includes/shrsb_analytics_page.php:15
|
| 959 |
+
msgid "Shareaholic Analtyics"
|
| 960 |
+
msgstr "Shareaholic Analtyics"
|
| 961 |
+
|
| 962 |
+
#: includes/shrsb_analytics_page.php:21
|
| 963 |
+
msgid "Shareaholic Analtyics is coming!!!!"
|
| 964 |
+
msgstr "Sta arrivando Shareaholic Analytics!!!!"
|
| 965 |
+
|
| 966 |
+
#: includes/shrsb_analytics_page.php:24
|
| 967 |
+
msgid "Register your account today to recieve update info via email."
|
| 968 |
+
msgstr "Registra oggi il tuo account per ricevere via e-mail info su aggiornamenti."
|
| 969 |
+
|
| 970 |
+
#: includes/shrsb_analytics_page.php:26
|
| 971 |
+
#: includes/shrsb_authentication_page.php:66
|
| 972 |
+
msgid "Get Share Pro"
|
| 973 |
+
msgstr "Scarica Share Pro"
|
| 974 |
+
|
| 975 |
+
#: includes/shrsb_analytics_page.php:42
|
| 976 |
+
#: includes/shrsb_authentication_page.php:107
|
| 977 |
+
msgid "Why Register ?"
|
| 978 |
+
msgstr "Perché registrarsi?"
|
| 979 |
+
|
| 980 |
+
#: includes/shrsb_authentication_page.php:51
|
| 981 |
+
msgid "Shareaholic Pro"
|
| 982 |
+
msgstr "Shareaholic Pro"
|
| 983 |
+
|
| 984 |
+
#: includes/shrsb_authentication_page.php:57
|
| 985 |
+
msgid "Shareaholic Professional is coming!!!!"
|
| 986 |
+
msgstr "Sta arrivando Shareaholic Professional!!!!"
|
| 987 |
+
|
| 988 |
+
#: includes/shrsb_authentication_page.php:60
|
| 989 |
+
msgid "We are excited to offer you a host of features like Analytics to give you insight about your website traffic and user activity.Be the first one to grab the opportunity and register for a free account today!!"
|
| 990 |
+
msgstr "Siamo entusiasti di offrirvi una serie di funzioni come Analytics per farvi vedere il traffico sul vostro sito web e l'attività degli. Siate il primo ad afferrare l'occasione e registrarsi per un account gratuito, oggi!"
|
| 991 |
+
|
| 992 |
+
#: includes/shrsb_authentication_page.php:73
|
| 993 |
+
#: includes/shrsb_authentication_page.php:94
|
| 994 |
+
msgid "Authenticate"
|
| 995 |
+
msgstr "Autenticati"
|
| 996 |
+
|
| 997 |
+
#: includes/shrsb_authentication_page.php:79
|
| 998 |
+
msgid "Status"
|
| 999 |
+
msgstr "Stato"
|
| 1000 |
+
|
| 1001 |
+
#: includes/shrsb_authentication_page.php:85
|
| 1002 |
+
msgid "Authenticated"
|
| 1003 |
+
msgstr "Autenticato"
|
| 1004 |
+
|
| 1005 |
+
#: includes/shrsb_authentication_page.php:90
|
| 1006 |
+
msgid "Enter the API key that you registered for your application."
|
| 1007 |
+
msgstr "Inserire la chiave API che avete registrato per l'applicazione."
|
| 1008 |
+
|
| 1009 |
+
#~ msgid "Password:"
|
| 1010 |
+
#~ msgstr "Password:"
|
| 1011 |
+
|
| 1012 |
+
#~ msgid ""
|
| 1013 |
+
#~ "We completely re-wrote Shareaholic from the ground up to make it faster, "
|
| 1014 |
+
#~ "smarter, better. We wanted to remind you that we will be switching over "
|
| 1015 |
+
#~ "everyone to this new version soon. If you haven't already, please try out "
|
| 1016 |
+
#~ "this version now to make sure it is working properly for you."
|
| 1017 |
+
#~ msgstr ""
|
| 1018 |
+
#~ "Abbiamo completamente ri-scritto Shareaholic per renderlo più veloce, più "
|
| 1019 |
+
#~ "intelligente, migliore. Volevamo ricordarvi che presto ci sarà il "
|
| 1020 |
+
#~ "passaggio di tutti a questa nuova versione. Se non lo avete ancora fatto, "
|
| 1021 |
+
#~ "provate questa versione ora per assicurarvi che per voi funzioni "
|
| 1022 |
+
#~ "correttamente."
|
| 1023 |
+
|
| 1024 |
+
#~ msgid "General Functionality Options:"
|
| 1025 |
+
#~ msgstr "Impostazioni generali:"
|
| 1026 |
+
|
| 1027 |
+
#~ msgid "(beta-mode exclusive feature)"
|
| 1028 |
+
#~ msgstr "(caratteristica esclusiva beta-mode)"
|
| 1029 |
+
|
| 1030 |
+
#~ msgid "jQuery Related Options"
|
| 1031 |
+
#~ msgstr "Opzioni di jQuery"
|
| 1032 |
+
|
| 1033 |
+
#~ msgid "Background Image Options"
|
| 1034 |
+
#~ msgstr "Opzioni per l'immagine di sfondo"
|
| 1035 |
+
|
| 1036 |
+
#~ msgid ""
|
| 1037 |
+
#~ "**BONUS** You have been selected to preview our upcoming premium "
|
| 1038 |
+
#~ "analytics add-on for a limited time for FREE. <b>%sFollow this link%s to "
|
| 1039 |
+
#~ "keep on top of how your content is being shared!</b>"
|
| 1040 |
+
#~ msgstr ""
|
| 1041 |
+
#~ "**BONUS** Siete stato selezionato per visualizzare in anteprima e "
|
| 1042 |
+
#~ "GRATUITAMENTE per un tempo limitato il nostro imminente add-on premium "
|
| 1043 |
+
#~ "analytics. <b>%sSegiuite questo collegamento%s per restare "
|
| 1044 |
+
#~ "all'avanguardia con il modo di condividere i contenuti!</ b>"
|
| 1045 |
+
|
| 1046 |
+
#~ msgid ""
|
| 1047 |
+
#~ "We are anxious to hear what you think. Please follow %sthis link%s to "
|
| 1048 |
+
#~ "share your feedback with us!"
|
| 1049 |
+
#~ msgstr ""
|
| 1050 |
+
#~ "Siamo ansiosi di sentire cosa ne pensate. Si prega di seguire %squesto "
|
| 1051 |
+
#~ "scollegamento%s per condividere con noi i vostri commenti!"
|
| 1052 |
+
|
| 1053 |
+
#~ msgid "Buzz up!"
|
| 1054 |
+
#~ msgstr "Buzz up!"
|
| 1055 |
+
|
| 1056 |
+
#~ msgid "New tip submitted via the SexyBookmarks Plugin!"
|
| 1057 |
+
#~ msgstr "Nuovo suggerimento presentato attraverso il Plugin SexyBookmarks!"
|
| 1058 |
+
|
| 1059 |
+
#~ msgid "Short URL(s) have been reset."
|
| 1060 |
+
#~ msgstr "Gli URL semplificati sono stati cancellati."
|
| 1061 |
+
|
| 1062 |
+
#~ msgid "This will clear %sALL%s short URLs. - Are you sure?"
|
| 1063 |
+
#~ msgstr ""
|
| 1064 |
+
#~ "Questo cancellerà %sTUTTI%s gli URL semplificati. - Sei sicuro?"
|
| 1065 |
+
|
| 1066 |
+
#~ msgid "Reset all Short URLs"
|
| 1067 |
+
#~ msgstr "Cancella tutti gli URL semplificati"
|
| 1068 |
+
|
| 1069 |
+
#~ msgid "Yahoo! Buzz Defaults:"
|
| 1070 |
+
#~ msgstr "Default per Yahoo! Buzz:"
|
| 1071 |
+
|
| 1072 |
+
#~ msgid "Default Content Category:"
|
| 1073 |
+
#~ msgstr "Categoria di default:"
|
| 1074 |
+
|
| 1075 |
+
#~ msgid "Default Media Type:"
|
| 1076 |
+
#~ msgstr "Media di default:"
|
| 1077 |
+
|
| 1078 |
+
#~ msgid "Twittley Defaults:"
|
| 1079 |
+
#~ msgstr "Default per Twittley:"
|
| 1080 |
+
|
| 1081 |
+
#~ msgid "Primary Content Category:"
|
| 1082 |
+
#~ msgstr "Categoria principale:"
|
| 1083 |
+
|
| 1084 |
+
#~ msgid "Technology"
|
| 1085 |
+
#~ msgstr "Tecnologia"
|
| 1086 |
+
|
| 1087 |
+
#~ msgid "World & Business"
|
| 1088 |
+
#~ msgstr "Mondo e affari"
|
| 1089 |
+
|
| 1090 |
+
#~ msgid "Science"
|
| 1091 |
+
#~ msgstr "Scienza"
|
| 1092 |
+
|
| 1093 |
+
#~ msgid "Gaming"
|
| 1094 |
+
#~ msgstr "Gaming"
|
| 1095 |
+
|
| 1096 |
+
#~ msgid "Lifestyle"
|
| 1097 |
+
#~ msgstr "Stile di vita"
|
| 1098 |
+
|
| 1099 |
+
#~ msgid "Entertainment"
|
| 1100 |
+
#~ msgstr "Intrattenimento"
|
| 1101 |
+
|
| 1102 |
+
#~ msgid "Sports"
|
| 1103 |
+
#~ msgstr "Sport"
|
| 1104 |
+
|
| 1105 |
+
#~ msgid "Offbeat"
|
| 1106 |
+
#~ msgstr "Anticonformista"
|
| 1107 |
+
|
| 1108 |
+
#~ msgid "Internet"
|
| 1109 |
+
#~ msgstr "Internet"
|
| 1110 |
+
|
| 1111 |
+
#~ msgid ""
|
| 1112 |
+
#~ "Enter a comma separated list of general tags which describe your site's "
|
| 1113 |
+
#~ "posts as a whole. Try not to be too specific, as one post may fall into "
|
| 1114 |
+
#~ "different *tag categories* than other posts."
|
| 1115 |
+
#~ msgstr ""
|
| 1116 |
+
#~ "Inserire un elencodi tag generali, separati da virgole, che descrivono "
|
| 1117 |
+
#~ "gli argomenti generali dei tuoi articoli. Cerca di non essere troppo "
|
| 1118 |
+
#~ "specifico; un tag può essere usato per più articoli."
|
| 1119 |
+
|
| 1120 |
+
#~ msgid ""
|
| 1121 |
+
#~ "This list is primarily used as a failsafe in case you forget to enter "
|
| 1122 |
+
#~ "WordPress tags for a particular post, in which case this list of tags "
|
| 1123 |
+
#~ "would be used so as to bring at least *somewhat* relevant search queries "
|
| 1124 |
+
#~ "based on the general tags that you enter here."
|
| 1125 |
+
#~ msgstr ""
|
| 1126 |
+
#~ "Questo elenco verrà utilizzato principalmente come impostazione "
|
| 1127 |
+
#~ "predefinita, nel caso in cui ci si dimentichi di inserire almeno un tag "
|
| 1128 |
+
#~ "per un articolo pubblicato. I tag inseriti verranno usati per indicizzare "
|
| 1129 |
+
#~ "gli articoli senza tag e restituire comunque risultati pertinenti."
|
| 1130 |
+
|
| 1131 |
+
#~ msgid "Click here to close this message"
|
| 1132 |
+
#~ msgstr "Clicca qui per chiudere questo messaggio"
|
| 1133 |
+
|
| 1134 |
+
#~ msgid "close"
|
| 1135 |
+
#~ msgstr "chiudi"
|
| 1136 |
+
|
| 1137 |
+
#~ msgid "Default Tags:"
|
| 1138 |
+
#~ msgstr "Tag di default:"
|
languages/shrsb-it_IT.pot
ADDED
|
@@ -0,0 +1,855 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# SOME DESCRIPTIVE TITLE.
|
| 2 |
+
# This file is put in the public domain.
|
| 3 |
+
# FIRST AUTHOR <EMAIL@ADDRESS>, YEAR.
|
| 4 |
+
#
|
| 5 |
+
msgid ""
|
| 6 |
+
msgstr ""
|
| 7 |
+
"Project-Id-Version: PACKAGE VERSION\n"
|
| 8 |
+
"Report-Msgid-Bugs-To: http://wordpress.org/tag/sexybookmarks\n"
|
| 9 |
+
"POT-Creation-Date: 2009-08-23 07:46+0000\n"
|
| 10 |
+
"PO-Revision-Date: 2009-10-03 13:06+0100\n"
|
| 11 |
+
"Last-Translator: Carlo Veltri <carlo.veltri79@yahoo.it>\n"
|
| 12 |
+
"Language-Team: LANGUAGE <LL@li.org>\n"
|
| 13 |
+
"MIME-Version: 1.0\n"
|
| 14 |
+
"Content-Type: text/plain; charset=utf-8\n"
|
| 15 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 16 |
+
|
| 17 |
+
#: bookmarks-data.php:5
|
| 18 |
+
#: bookmarks-data.php:10
|
| 19 |
+
#: bookmarks-data.php:15
|
| 20 |
+
#: bookmarks-data.php:20
|
| 21 |
+
#: bookmarks-data.php:25
|
| 22 |
+
#: bookmarks-data.php:30
|
| 23 |
+
#: bookmarks-data.php:35
|
| 24 |
+
#: bookmarks-data.php:40
|
| 25 |
+
#: bookmarks-data.php:45
|
| 26 |
+
#: bookmarks-data.php:50
|
| 27 |
+
#: bookmarks-data.php:55
|
| 28 |
+
#: bookmarks-data.php:60
|
| 29 |
+
#: bookmarks-data.php:65
|
| 30 |
+
#: bookmarks-data.php:70
|
| 31 |
+
#: bookmarks-data.php:80
|
| 32 |
+
#: bookmarks-data.php:85
|
| 33 |
+
#: bookmarks-data.php:90
|
| 34 |
+
#: bookmarks-data.php:95
|
| 35 |
+
#: bookmarks-data.php:100
|
| 36 |
+
#: bookmarks-data.php:105
|
| 37 |
+
#: bookmarks-data.php:110
|
| 38 |
+
#: bookmarks-data.php:115
|
| 39 |
+
#: bookmarks-data.php:120
|
| 40 |
+
#: bookmarks-data.php:125
|
| 41 |
+
#: bookmarks-data.php:130
|
| 42 |
+
#: bookmarks-data.php:135
|
| 43 |
+
#: bookmarks-data.php:140
|
| 44 |
+
#: bookmarks-data.php:145
|
| 45 |
+
#: bookmarks-data.php:150
|
| 46 |
+
#: bookmarks-data.php:155
|
| 47 |
+
#: bookmarks-data.php:160
|
| 48 |
+
#: bookmarks-data.php:165
|
| 49 |
+
#: bookmarks-data.php:170
|
| 50 |
+
msgid "Check this box to include "
|
| 51 |
+
msgstr "Seleziona questa casella per includere "
|
| 52 |
+
|
| 53 |
+
#: bookmarks-data.php:5
|
| 54 |
+
#: bookmarks-data.php:6
|
| 55 |
+
msgid "Script & Style"
|
| 56 |
+
msgstr "Script e Stile"
|
| 57 |
+
|
| 58 |
+
#: bookmarks-data.php:5
|
| 59 |
+
#: bookmarks-data.php:10
|
| 60 |
+
#: bookmarks-data.php:15
|
| 61 |
+
#: bookmarks-data.php:20
|
| 62 |
+
#: bookmarks-data.php:25
|
| 63 |
+
#: bookmarks-data.php:30
|
| 64 |
+
#: bookmarks-data.php:35
|
| 65 |
+
#: bookmarks-data.php:40
|
| 66 |
+
#: bookmarks-data.php:45
|
| 67 |
+
#: bookmarks-data.php:50
|
| 68 |
+
#: bookmarks-data.php:55
|
| 69 |
+
#: bookmarks-data.php:60
|
| 70 |
+
#: bookmarks-data.php:65
|
| 71 |
+
#: bookmarks-data.php:70
|
| 72 |
+
#: bookmarks-data.php:80
|
| 73 |
+
#: bookmarks-data.php:85
|
| 74 |
+
#: bookmarks-data.php:90
|
| 75 |
+
#: bookmarks-data.php:95
|
| 76 |
+
#: bookmarks-data.php:100
|
| 77 |
+
#: bookmarks-data.php:105
|
| 78 |
+
#: bookmarks-data.php:110
|
| 79 |
+
#: bookmarks-data.php:115
|
| 80 |
+
#: bookmarks-data.php:120
|
| 81 |
+
#: bookmarks-data.php:125
|
| 82 |
+
#: bookmarks-data.php:130
|
| 83 |
+
#: bookmarks-data.php:135
|
| 84 |
+
#: bookmarks-data.php:140
|
| 85 |
+
#: bookmarks-data.php:145
|
| 86 |
+
#: bookmarks-data.php:150
|
| 87 |
+
#: bookmarks-data.php:155
|
| 88 |
+
#: bookmarks-data.php:160
|
| 89 |
+
#: bookmarks-data.php:165
|
| 90 |
+
#: bookmarks-data.php:170
|
| 91 |
+
msgid " in your bookmarking menu"
|
| 92 |
+
msgstr "nel tuo bookmarking menu"
|
| 93 |
+
|
| 94 |
+
#: bookmarks-data.php:6
|
| 95 |
+
#: bookmarks-data.php:61
|
| 96 |
+
#: bookmarks-data.php:136
|
| 97 |
+
msgid "Submit this to "
|
| 98 |
+
msgstr "Inoltralo a"
|
| 99 |
+
|
| 100 |
+
#: bookmarks-data.php:10
|
| 101 |
+
#: bookmarks-data.php:11
|
| 102 |
+
msgid "Blinklist"
|
| 103 |
+
msgstr "Blinklist"
|
| 104 |
+
|
| 105 |
+
#: bookmarks-data.php:11
|
| 106 |
+
#: bookmarks-data.php:16
|
| 107 |
+
#: bookmarks-data.php:31
|
| 108 |
+
#: bookmarks-data.php:46
|
| 109 |
+
#: bookmarks-data.php:51
|
| 110 |
+
#: bookmarks-data.php:66
|
| 111 |
+
#: bookmarks-data.php:86
|
| 112 |
+
#: bookmarks-data.php:96
|
| 113 |
+
#: bookmarks-data.php:116
|
| 114 |
+
#: bookmarks-data.php:121
|
| 115 |
+
#: bookmarks-data.php:126
|
| 116 |
+
#: bookmarks-data.php:141
|
| 117 |
+
#: bookmarks-data.php:151
|
| 118 |
+
msgid "Share this on "
|
| 119 |
+
msgstr "Condividilo in"
|
| 120 |
+
|
| 121 |
+
#: bookmarks-data.php:15
|
| 122 |
+
msgid "Delicious"
|
| 123 |
+
msgstr "Delicious"
|
| 124 |
+
|
| 125 |
+
#: bookmarks-data.php:16
|
| 126 |
+
msgid "del.icio.us"
|
| 127 |
+
msgstr "del.icio.us"
|
| 128 |
+
|
| 129 |
+
#: bookmarks-data.php:20
|
| 130 |
+
msgid "Digg"
|
| 131 |
+
msgstr "Digg"
|
| 132 |
+
|
| 133 |
+
#: bookmarks-data.php:21
|
| 134 |
+
msgid "Digg this!"
|
| 135 |
+
msgstr "Diggalo!"
|
| 136 |
+
|
| 137 |
+
#: bookmarks-data.php:25
|
| 138 |
+
#: bookmarks-data.php:26
|
| 139 |
+
msgid "Diigo"
|
| 140 |
+
msgstr "Diigo"
|
| 141 |
+
|
| 142 |
+
#: bookmarks-data.php:26
|
| 143 |
+
msgid "Post this on "
|
| 144 |
+
msgstr "Pubblicalo su"
|
| 145 |
+
|
| 146 |
+
#: bookmarks-data.php:30
|
| 147 |
+
#: bookmarks-data.php:31
|
| 148 |
+
msgid "Reddit"
|
| 149 |
+
msgstr "Reddit"
|
| 150 |
+
|
| 151 |
+
#: bookmarks-data.php:35
|
| 152 |
+
msgid "Yahoo! Buzz"
|
| 153 |
+
msgstr "Yahoo! Buzz"
|
| 154 |
+
|
| 155 |
+
#: bookmarks-data.php:36
|
| 156 |
+
msgid "Buzz up!"
|
| 157 |
+
msgstr "Buzz up!"
|
| 158 |
+
|
| 159 |
+
#: bookmarks-data.php:40
|
| 160 |
+
msgid "Stumbleupon"
|
| 161 |
+
msgstr "Stumbleupon"
|
| 162 |
+
|
| 163 |
+
#: bookmarks-data.php:41
|
| 164 |
+
msgid "Stumble upon something good? Share it on StumbleUpon"
|
| 165 |
+
msgstr "Stumble upon è buono? Condividilo su StumbleUpon"
|
| 166 |
+
|
| 167 |
+
#: bookmarks-data.php:45
|
| 168 |
+
#: bookmarks-data.php:46
|
| 169 |
+
msgid "Technorati"
|
| 170 |
+
msgstr "Technorati"
|
| 171 |
+
|
| 172 |
+
#: bookmarks-data.php:50
|
| 173 |
+
#: bookmarks-data.php:51
|
| 174 |
+
msgid "Mixx"
|
| 175 |
+
msgstr "Mixx"
|
| 176 |
+
|
| 177 |
+
#: bookmarks-data.php:55
|
| 178 |
+
#: bookmarks-data.php:56
|
| 179 |
+
msgid "MySpace"
|
| 180 |
+
msgstr "MySpace"
|
| 181 |
+
|
| 182 |
+
#: bookmarks-data.php:56
|
| 183 |
+
msgid "Post this to "
|
| 184 |
+
msgstr "Pubblicalo su"
|
| 185 |
+
|
| 186 |
+
#: bookmarks-data.php:60
|
| 187 |
+
#: bookmarks-data.php:61
|
| 188 |
+
msgid "DesignFloat"
|
| 189 |
+
msgstr "DesignFloat"
|
| 190 |
+
|
| 191 |
+
#: bookmarks-data.php:65
|
| 192 |
+
#: bookmarks-data.php:66
|
| 193 |
+
msgid "Facebook"
|
| 194 |
+
msgstr "Facebook"
|
| 195 |
+
|
| 196 |
+
#: bookmarks-data.php:70
|
| 197 |
+
msgid "Twitter"
|
| 198 |
+
msgstr "Twitter"
|
| 199 |
+
|
| 200 |
+
#: bookmarks-data.php:71
|
| 201 |
+
msgid "Tweet This!"
|
| 202 |
+
msgstr "Tweetalo!"
|
| 203 |
+
|
| 204 |
+
#: bookmarks-data.php:80
|
| 205 |
+
msgid "a 'Subscribe to Comments' link"
|
| 206 |
+
msgstr "un 'Subscribe to Comments' link"
|
| 207 |
+
|
| 208 |
+
#: bookmarks-data.php:81
|
| 209 |
+
msgid "Subscribe to the comments for this post?"
|
| 210 |
+
msgstr "Iscriviti ai commenti per questo post?"
|
| 211 |
+
|
| 212 |
+
#: bookmarks-data.php:85
|
| 213 |
+
#: bookmarks-data.php:86
|
| 214 |
+
msgid "Linkedin"
|
| 215 |
+
msgstr "Linkedin"
|
| 216 |
+
|
| 217 |
+
#: bookmarks-data.php:90
|
| 218 |
+
#: bookmarks-data.php:91
|
| 219 |
+
msgid "Newsvine"
|
| 220 |
+
msgstr "Newsvine"
|
| 221 |
+
|
| 222 |
+
#: bookmarks-data.php:91
|
| 223 |
+
msgid "Seed this on "
|
| 224 |
+
msgstr "Seminalo su"
|
| 225 |
+
|
| 226 |
+
#: bookmarks-data.php:95
|
| 227 |
+
#: bookmarks-data.php:96
|
| 228 |
+
msgid "Devmarks"
|
| 229 |
+
msgstr "Devmarks"
|
| 230 |
+
|
| 231 |
+
#: bookmarks-data.php:100
|
| 232 |
+
#: bookmarks-data.php:101
|
| 233 |
+
msgid "Google Bookmarks"
|
| 234 |
+
msgstr "Google Bookmarks"
|
| 235 |
+
|
| 236 |
+
#: bookmarks-data.php:101
|
| 237 |
+
#: bookmarks-data.php:106
|
| 238 |
+
#: bookmarks-data.php:111
|
| 239 |
+
#: bookmarks-data.php:156
|
| 240 |
+
#: bookmarks-data.php:161
|
| 241 |
+
#: bookmarks-data.php:166
|
| 242 |
+
#: bookmarks-data.php:171
|
| 243 |
+
msgid "Add this to "
|
| 244 |
+
msgstr "Aggiungilo a"
|
| 245 |
+
|
| 246 |
+
#: bookmarks-data.php:105
|
| 247 |
+
#: bookmarks-data.php:106
|
| 248 |
+
msgid "Mister Wong"
|
| 249 |
+
msgstr "Mister Wong"
|
| 250 |
+
|
| 251 |
+
#: bookmarks-data.php:107
|
| 252 |
+
msgid "www.mister-wong.com"
|
| 253 |
+
msgstr "www.mister-wong.com"
|
| 254 |
+
|
| 255 |
+
#: bookmarks-data.php:110
|
| 256 |
+
#: bookmarks-data.php:111
|
| 257 |
+
msgid "Izeby"
|
| 258 |
+
msgstr "Izeby"
|
| 259 |
+
|
| 260 |
+
#: bookmarks-data.php:115
|
| 261 |
+
#: bookmarks-data.php:116
|
| 262 |
+
msgid "Tipd"
|
| 263 |
+
msgstr "Tipd"
|
| 264 |
+
|
| 265 |
+
#: bookmarks-data.php:120
|
| 266 |
+
#: bookmarks-data.php:121
|
| 267 |
+
msgid "PFBuzz"
|
| 268 |
+
msgstr "PFBuzz"
|
| 269 |
+
|
| 270 |
+
#: bookmarks-data.php:125
|
| 271 |
+
#: bookmarks-data.php:126
|
| 272 |
+
msgid "FriendFeed"
|
| 273 |
+
msgstr "FriendFeed"
|
| 274 |
+
|
| 275 |
+
#: bookmarks-data.php:130
|
| 276 |
+
#: bookmarks-data.php:131
|
| 277 |
+
msgid "BlogMarks"
|
| 278 |
+
msgstr "BlogMarks"
|
| 279 |
+
|
| 280 |
+
#: bookmarks-data.php:131
|
| 281 |
+
msgid "Mark this on "
|
| 282 |
+
msgstr "Segnalo su"
|
| 283 |
+
|
| 284 |
+
#: bookmarks-data.php:135
|
| 285 |
+
#: bookmarks-data.php:136
|
| 286 |
+
msgid "Twittley"
|
| 287 |
+
msgstr "Twittley"
|
| 288 |
+
|
| 289 |
+
#: bookmarks-data.php:140
|
| 290 |
+
#: bookmarks-data.php:141
|
| 291 |
+
msgid "Fwisp"
|
| 292 |
+
msgstr "Fwisp"
|
| 293 |
+
|
| 294 |
+
#: bookmarks-data.php:145
|
| 295 |
+
#: bookmarks-data.php:146
|
| 296 |
+
msgid "DesignMoo"
|
| 297 |
+
msgstr "DesignMoo"
|
| 298 |
+
|
| 299 |
+
#: bookmarks-data.php:146
|
| 300 |
+
msgid "Moo this on "
|
| 301 |
+
msgstr "Mooccalo"
|
| 302 |
+
|
| 303 |
+
#: bookmarks-data.php:150
|
| 304 |
+
#: bookmarks-data.php:151
|
| 305 |
+
msgid "BobrDobr"
|
| 306 |
+
msgstr "BobrDobr"
|
| 307 |
+
|
| 308 |
+
#: bookmarks-data.php:150
|
| 309 |
+
#: bookmarks-data.php:155
|
| 310 |
+
#: bookmarks-data.php:160
|
| 311 |
+
#: bookmarks-data.php:165
|
| 312 |
+
#: bookmarks-data.php:170
|
| 313 |
+
msgid " (Russian)"
|
| 314 |
+
msgstr " (Russo)"
|
| 315 |
+
|
| 316 |
+
#: bookmarks-data.php:155
|
| 317 |
+
#: bookmarks-data.php:156
|
| 318 |
+
msgid "Yandex.Bookmarks"
|
| 319 |
+
msgstr "Yandex.Bookmarks"
|
| 320 |
+
|
| 321 |
+
#: bookmarks-data.php:160
|
| 322 |
+
#: bookmarks-data.php:161
|
| 323 |
+
msgid "Memory.ru"
|
| 324 |
+
msgstr "Memory.ru"
|
| 325 |
+
|
| 326 |
+
#: bookmarks-data.php:165
|
| 327 |
+
#: bookmarks-data.php:166
|
| 328 |
+
msgid "100 bookmarks"
|
| 329 |
+
msgstr "100 bookmarks"
|
| 330 |
+
|
| 331 |
+
#: bookmarks-data.php:170
|
| 332 |
+
#: bookmarks-data.php:171
|
| 333 |
+
msgid "MyPlace"
|
| 334 |
+
msgstr "MyPlace"
|
| 335 |
+
|
| 336 |
+
#: sexy-bookmarks.php:95
|
| 337 |
+
msgid "Your changes have been saved successfully!"
|
| 338 |
+
msgstr "Le tue modifiche sono state salvate con successo!"
|
| 339 |
+
|
| 340 |
+
#: sexy-bookmarks.php:95
|
| 341 |
+
msgid "Maybe you would consider "
|
| 342 |
+
msgstr "Potresti considerare"
|
| 343 |
+
|
| 344 |
+
#: sexy-bookmarks.php:95
|
| 345 |
+
msgid "donating"
|
| 346 |
+
msgstr "donare"
|
| 347 |
+
|
| 348 |
+
#: sexy-bookmarks.php:98
|
| 349 |
+
msgid "Please choose where you would like the menu to be displayed."
|
| 350 |
+
msgstr "Scegliere dove vorresti visualizzare il menu."
|
| 351 |
+
|
| 352 |
+
#: sexy-bookmarks.php:99
|
| 353 |
+
msgid "You can't display the menu if you don't choose a few sites to add to it!"
|
| 354 |
+
msgstr "Non è possibile visualizzare il menu, se non scegli qualche sito da aggiungere ad esso!"
|
| 355 |
+
|
| 356 |
+
#: sexy-bookmarks.php:100
|
| 357 |
+
msgid "Please choose where you want the menu displayed."
|
| 358 |
+
msgstr "Scegli dove vuoi visualizzare il menu."
|
| 359 |
+
|
| 360 |
+
#: sexy-bookmarks.php:104
|
| 361 |
+
msgid "You need to select the primary category for any articles submitted to Twittley."
|
| 362 |
+
msgstr "È necessario selezionare la categoria principale per gli articoli presentati a Twittley."
|
| 363 |
+
|
| 364 |
+
#: sexy-bookmarks.php:105
|
| 365 |
+
msgid "You need to set at least 1 default tag for any articles submitted to Twittley."
|
| 366 |
+
msgstr "È necessario selezionare almeno un tag di default per gli articoli presentati a Twittley."
|
| 367 |
+
|
| 368 |
+
#: sexy-bookmarks.php:115
|
| 369 |
+
msgid "You must first download and activate the"
|
| 370 |
+
msgstr "Devi prima scaricare ed attivare il"
|
| 371 |
+
|
| 372 |
+
#: sexy-bookmarks.php:115
|
| 373 |
+
#: sexy-bookmarks.php:260
|
| 374 |
+
msgid "Twitter Friendly Links Plugin"
|
| 375 |
+
msgstr "Twitter Friendly Links Plugin"
|
| 376 |
+
|
| 377 |
+
#: sexy-bookmarks.php:115
|
| 378 |
+
msgid "before hosting your own short URLs..."
|
| 379 |
+
msgstr "prima di ospitare i tuoi 'short URLs'..."
|
| 380 |
+
|
| 381 |
+
#: sexy-bookmarks.php:129
|
| 382 |
+
msgid "Due to recent API changes by Tumblr, I can no longer offer them as a supported network in the plugin."
|
| 383 |
+
msgstr "A causa dei recenti cambiamenti sulle API di Tumblr, non si può più offrire loro una rete di supporto nel plugin."
|
| 384 |
+
|
| 385 |
+
#: sexy-bookmarks.php:133
|
| 386 |
+
msgid "We're currently working on a more sophisticated solution for the email link and will re-enable it when finished."
|
| 387 |
+
msgstr "Stiamo attualmente lavorando ad una soluzione più sofisticata per il collegamento e-mail e li riattiveremo una volta terminato."
|
| 388 |
+
|
| 389 |
+
#: sexy-bookmarks.php:139
|
| 390 |
+
msgid " Short URLs have been reset."
|
| 391 |
+
msgstr "Gli 'Short URLs' sono stati cancellati."
|
| 392 |
+
|
| 393 |
+
#: sexy-bookmarks.php:182
|
| 394 |
+
msgid "You are using an outdated version of the plugin"
|
| 395 |
+
msgstr "Stai usando una versione passata del plugin"
|
| 396 |
+
|
| 397 |
+
#: sexy-bookmarks.php:182
|
| 398 |
+
msgid "please update if you wish to enjoy all available features!"
|
| 399 |
+
msgstr "aggiornalo se vuoi usufruire delle nuove feature!"
|
| 400 |
+
|
| 401 |
+
#: sexy-bookmarks.php:193
|
| 402 |
+
msgid "You are using the development version of the plugin"
|
| 403 |
+
msgstr "Stai usando la versione di sviluppo del plugin"
|
| 404 |
+
|
| 405 |
+
#: sexy-bookmarks.php:193
|
| 406 |
+
msgid " beta"
|
| 407 |
+
msgstr " beta"
|
| 408 |
+
|
| 409 |
+
#: sexy-bookmarks.php:193
|
| 410 |
+
msgid "please "
|
| 411 |
+
msgstr "per favore"
|
| 412 |
+
|
| 413 |
+
#: sexy-bookmarks.php:193
|
| 414 |
+
msgid "let us know of any bugs"
|
| 415 |
+
msgstr "segnalaci la presenza di bug"
|
| 416 |
+
|
| 417 |
+
#: sexy-bookmarks.php:193
|
| 418 |
+
msgid "you may encounter!"
|
| 419 |
+
msgstr "in caso ne trovi!"
|
| 420 |
+
|
| 421 |
+
#: sexy-bookmarks.php:210
|
| 422 |
+
msgid "Enabled Networks"
|
| 423 |
+
msgstr "Networks abilitati"
|
| 424 |
+
|
| 425 |
+
#: sexy-bookmarks.php:220
|
| 426 |
+
msgid "Select the Networks to display. Drag to reorder."
|
| 427 |
+
msgstr "Seleziona i Network da mostrare. Trascina per riordinare"
|
| 428 |
+
|
| 429 |
+
#: sexy-bookmarks.php:234
|
| 430 |
+
msgid "Functionality Settings"
|
| 431 |
+
msgstr "Impostazioni"
|
| 432 |
+
|
| 433 |
+
#: sexy-bookmarks.php:247
|
| 434 |
+
msgid "This will clear <u>ALL</u> short URLs. - Are you sure?"
|
| 435 |
+
msgstr "Questo cancellera' <u>TUTTI</u> gli 'short URLs'. Sei sicuro?"
|
| 436 |
+
|
| 437 |
+
#: sexy-bookmarks.php:250
|
| 438 |
+
#: sexy-bookmarks.php:325
|
| 439 |
+
#: sexy-bookmarks.php:328
|
| 440 |
+
#: sexy-bookmarks.php:357
|
| 441 |
+
#: sexy-bookmarks.php:360
|
| 442 |
+
#: sexy-bookmarks.php:462
|
| 443 |
+
msgid "Yes"
|
| 444 |
+
msgstr "Si"
|
| 445 |
+
|
| 446 |
+
#: sexy-bookmarks.php:250
|
| 447 |
+
msgid "Cancel"
|
| 448 |
+
msgstr "Cancella"
|
| 449 |
+
|
| 450 |
+
#: sexy-bookmarks.php:254
|
| 451 |
+
msgid "Twitter Options:"
|
| 452 |
+
msgstr "Opzioni di Twitter:"
|
| 453 |
+
|
| 454 |
+
#: sexy-bookmarks.php:255
|
| 455 |
+
msgid "Twitter ID:"
|
| 456 |
+
msgstr "Twitter ID:"
|
| 457 |
+
|
| 458 |
+
#: sexy-bookmarks.php:258
|
| 459 |
+
msgid "Which URL Shortener?"
|
| 460 |
+
msgstr "Quale servizio usi per 'accorciare' gli URL?"
|
| 461 |
+
|
| 462 |
+
#: sexy-bookmarks.php:271
|
| 463 |
+
msgid "Reset all Short URLs"
|
| 464 |
+
msgstr "Cancella tutti gli 'short URLs'"
|
| 465 |
+
|
| 466 |
+
#: sexy-bookmarks.php:275
|
| 467 |
+
msgid "Yahoo! Buzz Defaults:"
|
| 468 |
+
msgstr "Yahoo! Buzz Defaults:"
|
| 469 |
+
|
| 470 |
+
#: sexy-bookmarks.php:276
|
| 471 |
+
msgid "Default Content Category:"
|
| 472 |
+
msgstr "La categoria di default:"
|
| 473 |
+
|
| 474 |
+
#: sexy-bookmarks.php:278
|
| 475 |
+
#: sexy-bookmarks.php:308
|
| 476 |
+
msgid "Entertainment"
|
| 477 |
+
msgstr "Intrattenimento"
|
| 478 |
+
|
| 479 |
+
#: sexy-bookmarks.php:279
|
| 480 |
+
#: sexy-bookmarks.php:307
|
| 481 |
+
msgid "Lifestyle"
|
| 482 |
+
msgstr "Lifestyle"
|
| 483 |
+
|
| 484 |
+
#: sexy-bookmarks.php:280
|
| 485 |
+
msgid "Health"
|
| 486 |
+
msgstr "Salute"
|
| 487 |
+
|
| 488 |
+
#: sexy-bookmarks.php:281
|
| 489 |
+
msgid "U.S. News"
|
| 490 |
+
msgstr "News"
|
| 491 |
+
|
| 492 |
+
#: sexy-bookmarks.php:282
|
| 493 |
+
msgid "Business"
|
| 494 |
+
msgstr "Affari"
|
| 495 |
+
|
| 496 |
+
#: sexy-bookmarks.php:283
|
| 497 |
+
msgid "Politics"
|
| 498 |
+
msgstr "Politica"
|
| 499 |
+
|
| 500 |
+
#: sexy-bookmarks.php:284
|
| 501 |
+
msgid "Sci/Tech"
|
| 502 |
+
msgstr "Scienza/Tecnologia"
|
| 503 |
+
|
| 504 |
+
#: sexy-bookmarks.php:285
|
| 505 |
+
msgid "World"
|
| 506 |
+
msgstr "Mondo"
|
| 507 |
+
|
| 508 |
+
#: sexy-bookmarks.php:286
|
| 509 |
+
#: sexy-bookmarks.php:309
|
| 510 |
+
msgid "Sports"
|
| 511 |
+
msgstr "Sport"
|
| 512 |
+
|
| 513 |
+
#: sexy-bookmarks.php:287
|
| 514 |
+
msgid "Travel"
|
| 515 |
+
msgstr "Viaggi"
|
| 516 |
+
|
| 517 |
+
#: sexy-bookmarks.php:292
|
| 518 |
+
msgid "Text"
|
| 519 |
+
msgstr "Testo"
|
| 520 |
+
|
| 521 |
+
#: sexy-bookmarks.php:293
|
| 522 |
+
msgid "Image"
|
| 523 |
+
msgstr "Immagine"
|
| 524 |
+
|
| 525 |
+
#: sexy-bookmarks.php:294
|
| 526 |
+
msgid "Audio"
|
| 527 |
+
msgstr "Audio"
|
| 528 |
+
|
| 529 |
+
#: sexy-bookmarks.php:295
|
| 530 |
+
msgid "Video"
|
| 531 |
+
msgstr "Video"
|
| 532 |
+
|
| 533 |
+
#: sexy-bookmarks.php:300
|
| 534 |
+
msgid "Twittley Defaults:"
|
| 535 |
+
msgstr "Twittley Defaults:"
|
| 536 |
+
|
| 537 |
+
#: sexy-bookmarks.php:301
|
| 538 |
+
msgid "Primary Content Category:"
|
| 539 |
+
msgstr "La categoria principale:"
|
| 540 |
+
|
| 541 |
+
#: sexy-bookmarks.php:303
|
| 542 |
+
msgid "Technology"
|
| 543 |
+
msgstr "Tecnologia"
|
| 544 |
+
|
| 545 |
+
#: sexy-bookmarks.php:304
|
| 546 |
+
msgid "World & Business"
|
| 547 |
+
msgstr "Mondo e Affari"
|
| 548 |
+
|
| 549 |
+
#: sexy-bookmarks.php:305
|
| 550 |
+
msgid "Science"
|
| 551 |
+
msgstr "Scienza"
|
| 552 |
+
|
| 553 |
+
#: sexy-bookmarks.php:306
|
| 554 |
+
msgid "Gaming"
|
| 555 |
+
msgstr "Gioco"
|
| 556 |
+
|
| 557 |
+
#: sexy-bookmarks.php:310
|
| 558 |
+
msgid "Offbeat"
|
| 559 |
+
msgstr "Alternativo"
|
| 560 |
+
|
| 561 |
+
#: sexy-bookmarks.php:311
|
| 562 |
+
msgid "Internet"
|
| 563 |
+
msgstr "Internet"
|
| 564 |
+
|
| 565 |
+
#: sexy-bookmarks.php:315
|
| 566 |
+
msgid "Enter a comma separated list of general tags which describe your site's posts as a whole. Try not to be too specific, as one post may fall into different \"tag categories\" than other posts."
|
| 567 |
+
msgstr "Inserire un elenco, separato da virgole, di tag generali che descrivono i post del tuo sito nel suo complesso. Cerca di non essere troppo specifico; un post può rientrare in \ \"tag categorie \" di altri post."
|
| 568 |
+
|
| 569 |
+
#: sexy-bookmarks.php:316
|
| 570 |
+
msgid "This list is primarily used as a failsafe in case you forget to enter WordPress tags for a particular post, in which case this list of tags would be used so as to bring at least *somewhat* relevant search queries based on the general tags that you enter here."
|
| 571 |
+
msgstr "Questo elenco è utilizzato principalmente come misura di sicurezza nel caso in cui si dimentica di inserire un tag di WordPress per un post particolare, nel qual caso questo elenco di tag sarebbe utilizzato in modo da portare almeno un po' di pertinenza nelle query di ricerca basato sui tag generali che si immettono."
|
| 572 |
+
|
| 573 |
+
#: sexy-bookmarks.php:316
|
| 574 |
+
msgid "Click here to close this message"
|
| 575 |
+
msgstr "Clicca qui per chiudere questo messaggio"
|
| 576 |
+
|
| 577 |
+
#: sexy-bookmarks.php:316
|
| 578 |
+
msgid "close"
|
| 579 |
+
msgstr "Chiudi"
|
| 580 |
+
|
| 581 |
+
#: sexy-bookmarks.php:318
|
| 582 |
+
msgid "Default Tags:"
|
| 583 |
+
msgstr "Tags di default:"
|
| 584 |
+
|
| 585 |
+
#: sexy-bookmarks.php:319
|
| 586 |
+
#: sexy-bookmarks.php:460
|
| 587 |
+
msgid "Click here for help with this option"
|
| 588 |
+
msgstr "Clicca qui per un aiuto su questa opzione"
|
| 589 |
+
|
| 590 |
+
#: sexy-bookmarks.php:323
|
| 591 |
+
msgid "General Functionality Options:"
|
| 592 |
+
msgstr "Impostazioni generali:"
|
| 593 |
+
|
| 594 |
+
#: sexy-bookmarks.php:324
|
| 595 |
+
msgid "Add nofollow to the links?"
|
| 596 |
+
msgstr "Aggiungi 'nofollow' per i links?"
|
| 597 |
+
|
| 598 |
+
#: sexy-bookmarks.php:326
|
| 599 |
+
#: sexy-bookmarks.php:329
|
| 600 |
+
#: sexy-bookmarks.php:358
|
| 601 |
+
#: sexy-bookmarks.php:361
|
| 602 |
+
#: sexy-bookmarks.php:463
|
| 603 |
+
msgid "No"
|
| 604 |
+
msgstr "No"
|
| 605 |
+
|
| 606 |
+
#: sexy-bookmarks.php:327
|
| 607 |
+
msgid "Open links in new window?"
|
| 608 |
+
msgstr "Apri i link in una nuova finestra?"
|
| 609 |
+
|
| 610 |
+
#: sexy-bookmarks.php:337
|
| 611 |
+
msgid "General Look & Feel"
|
| 612 |
+
msgstr "Look e Feel generale"
|
| 613 |
+
|
| 614 |
+
#: sexy-bookmarks.php:350
|
| 615 |
+
msgid "This will void any custom CSS applied below."
|
| 616 |
+
msgstr "Questo renderà nullo il CSS personalizzato applicato."
|
| 617 |
+
|
| 618 |
+
#: sexy-bookmarks.php:353
|
| 619 |
+
msgid "Ok"
|
| 620 |
+
msgstr "Ok"
|
| 621 |
+
|
| 622 |
+
#: sexy-bookmarks.php:356
|
| 623 |
+
msgid "Animate-expand multi-lined bookmarks?"
|
| 624 |
+
msgstr "Bookmarks multi-linee animato?"
|
| 625 |
+
|
| 626 |
+
#: sexy-bookmarks.php:359
|
| 627 |
+
msgid "Auto-center the bookmarks?"
|
| 628 |
+
msgstr "Auto-centra i bookmarks?"
|
| 629 |
+
|
| 630 |
+
#: sexy-bookmarks.php:364
|
| 631 |
+
msgid "You can style the DIV that holds the menu here:"
|
| 632 |
+
msgstr "È possibile modificare lo stile del DIV che contiene il menu qui:"
|
| 633 |
+
|
| 634 |
+
#: sexy-bookmarks.php:374
|
| 635 |
+
msgid "If you see this message, please delete the contents of this textarea and click \\\"Save Changes\\\"."
|
| 636 |
+
msgstr "Se vedi questo messaggio, si prega di eliminare il contenuto di questa area di testo e fare clic su \ \ \ \"Salva modifiche \ \ \"."
|
| 637 |
+
|
| 638 |
+
#: sexy-bookmarks.php:383
|
| 639 |
+
msgid "Background Image"
|
| 640 |
+
msgstr "Immagine di sfondo"
|
| 641 |
+
|
| 642 |
+
#: sexy-bookmarks.php:394
|
| 643 |
+
msgid "Use a background image?"
|
| 644 |
+
msgstr "Usare una immagine di sfondo?"
|
| 645 |
+
|
| 646 |
+
#: sexy-bookmarks.php:419
|
| 647 |
+
msgid "Menu Placement"
|
| 648 |
+
msgstr "Posizionamento del menu"
|
| 649 |
+
|
| 650 |
+
#: sexy-bookmarks.php:432
|
| 651 |
+
msgid "Need help with this? Find it in the "
|
| 652 |
+
msgstr "Hai bisogno di aiuto? Cerca nella"
|
| 653 |
+
|
| 654 |
+
#: sexy-bookmarks.php:432
|
| 655 |
+
msgid "official install guide"
|
| 656 |
+
msgstr "guida ufficiale d'installazione"
|
| 657 |
+
|
| 658 |
+
#: sexy-bookmarks.php:441
|
| 659 |
+
msgid "This feature is still in the experimental phase, so please "
|
| 660 |
+
msgstr "Questa caratteristica è ancora in fase sperimentale, perciò per favore"
|
| 661 |
+
|
| 662 |
+
#: sexy-bookmarks.php:441
|
| 663 |
+
msgid "report any bugs"
|
| 664 |
+
msgstr "comunica l'eventuale presenza di bug"
|
| 665 |
+
|
| 666 |
+
#: sexy-bookmarks.php:441
|
| 667 |
+
msgid "you may find"
|
| 668 |
+
msgstr "si può trovare"
|
| 669 |
+
|
| 670 |
+
#: sexy-bookmarks.php:447
|
| 671 |
+
msgid "Menu Location (in relevance to content):"
|
| 672 |
+
msgstr "Posizione del menu (in base al contenuto):"
|
| 673 |
+
|
| 674 |
+
#: sexy-bookmarks.php:448
|
| 675 |
+
msgid "Above Content"
|
| 676 |
+
msgstr "Sopra i contenuti"
|
| 677 |
+
|
| 678 |
+
#: sexy-bookmarks.php:449
|
| 679 |
+
msgid "Below Content"
|
| 680 |
+
msgstr "Sotto i contenuti"
|
| 681 |
+
|
| 682 |
+
#: sexy-bookmarks.php:450
|
| 683 |
+
msgid "Manual Mode"
|
| 684 |
+
msgstr "Modo manuale"
|
| 685 |
+
|
| 686 |
+
#: sexy-bookmarks.php:451
|
| 687 |
+
msgid "Posts, pages, or the whole shebang?"
|
| 688 |
+
msgstr "Post, Pagine o tutto?"
|
| 689 |
+
|
| 690 |
+
#: sexy-bookmarks.php:453
|
| 691 |
+
msgid "Posts Only"
|
| 692 |
+
msgstr "Solo posts"
|
| 693 |
+
|
| 694 |
+
#: sexy-bookmarks.php:454
|
| 695 |
+
msgid "Pages Only"
|
| 696 |
+
msgstr "Solo pagine"
|
| 697 |
+
|
| 698 |
+
#: sexy-bookmarks.php:455
|
| 699 |
+
msgid "Index Only"
|
| 700 |
+
msgstr "Solo indice"
|
| 701 |
+
|
| 702 |
+
#: sexy-bookmarks.php:456
|
| 703 |
+
msgid "Posts & Pages"
|
| 704 |
+
msgstr "Post e Pagine"
|
| 705 |
+
|
| 706 |
+
#: sexy-bookmarks.php:457
|
| 707 |
+
msgid "Posts & Index"
|
| 708 |
+
msgstr "Post e Indice"
|
| 709 |
+
|
| 710 |
+
#: sexy-bookmarks.php:458
|
| 711 |
+
msgid "Pages & Index"
|
| 712 |
+
msgstr "Pagine e Indice"
|
| 713 |
+
|
| 714 |
+
#: sexy-bookmarks.php:459
|
| 715 |
+
msgid "THE WHOLE SHEBANG!"
|
| 716 |
+
msgstr "TUTTO!"
|
| 717 |
+
|
| 718 |
+
#: sexy-bookmarks.php:459
|
| 719 |
+
msgid "Posts, Pages, & Index"
|
| 720 |
+
msgstr "Post, Pagine e Indice"
|
| 721 |
+
|
| 722 |
+
#: sexy-bookmarks.php:461
|
| 723 |
+
msgid "Show in RSS feed?"
|
| 724 |
+
msgstr "Mostrare i feed RSS?"
|
| 725 |
+
|
| 726 |
+
#: sexy-bookmarks.php:464
|
| 727 |
+
msgid "Hide menu from mobile browsers?"
|
| 728 |
+
msgstr "Nascondi il menu nei mobile browser?"
|
| 729 |
+
|
| 730 |
+
#: sexy-bookmarks.php:470
|
| 731 |
+
msgid "Save Changes"
|
| 732 |
+
msgstr "Salva le modifiche"
|
| 733 |
+
|
| 734 |
+
#: sexy-bookmarks.php:478
|
| 735 |
+
msgid "Plugin Info"
|
| 736 |
+
msgstr "Informazioni sul plugin"
|
| 737 |
+
|
| 738 |
+
#: sexy-bookmarks.php:482
|
| 739 |
+
msgid "Helpful Plugin Links:"
|
| 740 |
+
msgstr "Links utili:"
|
| 741 |
+
|
| 742 |
+
#: sexy-bookmarks.php:484
|
| 743 |
+
msgid "Installation & Usage Guide"
|
| 744 |
+
msgstr "Installazione e Guida all'uso"
|
| 745 |
+
|
| 746 |
+
#: sexy-bookmarks.php:485
|
| 747 |
+
msgid "Frequently Asked Questions"
|
| 748 |
+
msgstr "Domande frequenti"
|
| 749 |
+
|
| 750 |
+
#: sexy-bookmarks.php:486
|
| 751 |
+
msgid "Bug Submission Form"
|
| 752 |
+
msgstr "Form per la denuncia dei bug"
|
| 753 |
+
|
| 754 |
+
#: sexy-bookmarks.php:487
|
| 755 |
+
msgid "Feature Request Form"
|
| 756 |
+
msgstr "Form per la richiesta di nuove features"
|
| 757 |
+
|
| 758 |
+
#: sexy-bookmarks.php:488
|
| 759 |
+
msgid "Other SexyBookmarks Platforms"
|
| 760 |
+
msgstr "Altre SexyBookmarks Platforms"
|
| 761 |
+
|
| 762 |
+
#: sexy-bookmarks.php:489
|
| 763 |
+
msgid "SexyFox Firefox Toolbar"
|
| 764 |
+
msgstr "SexyFox Firefox Toolbar"
|
| 765 |
+
|
| 766 |
+
#: sexy-bookmarks.php:492
|
| 767 |
+
msgid "Current Plugin Stats:"
|
| 768 |
+
msgstr "Statistiche del plugin:"
|
| 769 |
+
|
| 770 |
+
#: sexy-bookmarks.php:501
|
| 771 |
+
#, php-format
|
| 772 |
+
msgid "%s ago"
|
| 773 |
+
msgstr "%s fa"
|
| 774 |
+
|
| 775 |
+
#: sexy-bookmarks.php:526
|
| 776 |
+
msgid "Stable Version:"
|
| 777 |
+
msgstr "Versione stabile:"
|
| 778 |
+
|
| 779 |
+
#: sexy-bookmarks.php:527
|
| 780 |
+
msgid "Last Updated:"
|
| 781 |
+
msgstr "L'ultimo aggiornamento:"
|
| 782 |
+
|
| 783 |
+
#: sexy-bookmarks.php:528
|
| 784 |
+
msgid "Downloaded:"
|
| 785 |
+
msgstr "Scaricato:"
|
| 786 |
+
|
| 787 |
+
#: sexy-bookmarks.php:528
|
| 788 |
+
msgid "times"
|
| 789 |
+
msgstr "volte"
|
| 790 |
+
|
| 791 |
+
#: sexy-bookmarks.php:529
|
| 792 |
+
msgid "User Rating:"
|
| 793 |
+
msgstr "Valutazione degli User:"
|
| 794 |
+
|
| 795 |
+
#: sexy-bookmarks.php:529
|
| 796 |
+
msgid "stars - Based on"
|
| 797 |
+
msgstr "stelle - Basato su"
|
| 798 |
+
|
| 799 |
+
#: sexy-bookmarks.php:529
|
| 800 |
+
msgid "votes"
|
| 801 |
+
msgstr "voti"
|
| 802 |
+
|
| 803 |
+
#: sexy-bookmarks.php:537
|
| 804 |
+
msgid "Plugin Sponsors"
|
| 805 |
+
msgstr "Sponsor del Plugin"
|
| 806 |
+
|
| 807 |
+
#: sexy-bookmarks.php:564
|
| 808 |
+
msgid "Support by Donating"
|
| 809 |
+
msgstr "Suppartaci con donazioni"
|
| 810 |
+
|
| 811 |
+
#: sexy-bookmarks.php:568
|
| 812 |
+
msgid "Surely the fact that we're making the web a sexier place one blog at a time is worth a drink or three, right?"
|
| 813 |
+
msgstr "Sicuramente il fatto che noi stiamo facendo del Web un posto più sexy, vale il costo di un drink o tre, giusto?"
|
| 814 |
+
|
| 815 |
+
#: sexy-bookmarks.php:570
|
| 816 |
+
#: sexy-bookmarks.php:573
|
| 817 |
+
msgid "Help support the development of this plugin by donating!"
|
| 818 |
+
msgstr "Aiutaci supportando lo sviluppo di questo plugin con le donazioni!"
|
| 819 |
+
|
| 820 |
+
#: sexy-bookmarks.php:583
|
| 821 |
+
msgid "Top Supporters"
|
| 822 |
+
msgstr "I maggiori supporters"
|
| 823 |
+
|
| 824 |
+
#: sexy-bookmarks.php:618
|
| 825 |
+
msgid "Shout-Outs"
|
| 826 |
+
msgstr "Shout-Outs"
|
| 827 |
+
|
| 828 |
+
#: sexy-bookmarks.php:623
|
| 829 |
+
msgid "GUI Icons by Pinvoke"
|
| 830 |
+
msgstr "GUI Icons by Pinvoke"
|
| 831 |
+
|
| 832 |
+
#: sexy-bookmarks.php:624
|
| 833 |
+
msgid "Original Skin Icons by Function"
|
| 834 |
+
msgstr "Original Skin Icons by Function"
|
| 835 |
+
|
| 836 |
+
#: sexy-bookmarks.php:625
|
| 837 |
+
msgid "Bug Patch by Artem Russakovskii"
|
| 838 |
+
msgstr "Correzione dei bug by Artem Russakovskii"
|
| 839 |
+
|
| 840 |
+
#: sexy-bookmarks.php:626
|
| 841 |
+
msgid "Twitter encoding fix by Gautam Gupta"
|
| 842 |
+
msgstr "Twitter encoding fix by Gautam Gupta"
|
| 843 |
+
|
| 844 |
+
#: sexy-bookmarks.php:627
|
| 845 |
+
msgid "i18n support and Russian translation by Grib"
|
| 846 |
+
msgstr "i18n support e traduzione dal Russo by Grib"
|
| 847 |
+
|
| 848 |
+
#: sexy-bookmarks.php:741
|
| 849 |
+
msgid "an error occurred in SexyBookmarks"
|
| 850 |
+
msgstr "è accaduto un errore in Sexybookmarks"
|
| 851 |
+
|
| 852 |
+
#: sexy-bookmarks.php:880
|
| 853 |
+
msgid "xtrastyle"
|
| 854 |
+
msgstr "xtrastyle"
|
| 855 |
+
|
languages/shrsb-lt_LT.mo
ADDED
|
Binary file
|
languages/shrsb-lt_LT.po
ADDED
|
@@ -0,0 +1,1353 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
msgid ""
|
| 2 |
+
msgstr ""
|
| 3 |
+
"Project-Id-Version: SexyBookmarks v2.5.5\n"
|
| 4 |
+
"Report-Msgid-Bugs-To: \n"
|
| 5 |
+
"POT-Creation-Date: 2009-10-04 23:14-0600\n"
|
| 6 |
+
"PO-Revision-Date: \n"
|
| 7 |
+
"Last-Translator: \n"
|
| 8 |
+
"Language-Team: Nata Strazda <nata@epastas.lt>\n"
|
| 9 |
+
"MIME-Version: 1.0\n"
|
| 10 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
| 11 |
+
"Content-Transfer-Encoding: 8bit\n"
|
| 12 |
+
"X-Poedit-Language: Lithuanian\n"
|
| 13 |
+
"X-Poedit-Country: LITHUANIA\n"
|
| 14 |
+
"X-Poedit-KeywordsList: __;_e\n"
|
| 15 |
+
"X-Poedit-Basepath: .\n"
|
| 16 |
+
"X-Poedit-SearchPath-0: F:\\Web Development\\Projects\\SexyBookmarks\\SVN Local\\trunk\n"
|
| 17 |
+
|
| 18 |
+
#: F:\Web
|
| 19 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 20 |
+
#: Local\trunk/bookmarks-data.php:5
|
| 21 |
+
#: Local\trunk/bookmarks-data.php:10
|
| 22 |
+
#: Local\trunk/bookmarks-data.php:15
|
| 23 |
+
#: Local\trunk/bookmarks-data.php:20
|
| 24 |
+
#: Local\trunk/bookmarks-data.php:25
|
| 25 |
+
#: Local\trunk/bookmarks-data.php:30
|
| 26 |
+
#: Local\trunk/bookmarks-data.php:35
|
| 27 |
+
#: Local\trunk/bookmarks-data.php:40
|
| 28 |
+
#: Local\trunk/bookmarks-data.php:45
|
| 29 |
+
#: Local\trunk/bookmarks-data.php:50
|
| 30 |
+
#: Local\trunk/bookmarks-data.php:55
|
| 31 |
+
#: Local\trunk/bookmarks-data.php:60
|
| 32 |
+
#: Local\trunk/bookmarks-data.php:65
|
| 33 |
+
#: Local\trunk/bookmarks-data.php:70
|
| 34 |
+
#: Local\trunk/bookmarks-data.php:85
|
| 35 |
+
#: Local\trunk/bookmarks-data.php:90
|
| 36 |
+
#: Local\trunk/bookmarks-data.php:95
|
| 37 |
+
#: Local\trunk/bookmarks-data.php:100
|
| 38 |
+
#: Local\trunk/bookmarks-data.php:105
|
| 39 |
+
#: Local\trunk/bookmarks-data.php:110
|
| 40 |
+
#: Local\trunk/bookmarks-data.php:115
|
| 41 |
+
#: Local\trunk/bookmarks-data.php:120
|
| 42 |
+
#: Local\trunk/bookmarks-data.php:125
|
| 43 |
+
#: Local\trunk/bookmarks-data.php:130
|
| 44 |
+
#: Local\trunk/bookmarks-data.php:135
|
| 45 |
+
#: Local\trunk/bookmarks-data.php:140
|
| 46 |
+
#: Local\trunk/bookmarks-data.php:145
|
| 47 |
+
#: Local\trunk/bookmarks-data.php:150
|
| 48 |
+
#: Local\trunk/bookmarks-data.php:155
|
| 49 |
+
#: Local\trunk/bookmarks-data.php:160
|
| 50 |
+
#: Local\trunk/bookmarks-data.php:165
|
| 51 |
+
#: Local\trunk/bookmarks-data.php:170
|
| 52 |
+
#: Local\trunk/bookmarks-data.php:175
|
| 53 |
+
#: Local\trunk/bookmarks-data.php:180
|
| 54 |
+
#: Local\trunk/bookmarks-data.php:185
|
| 55 |
+
#: Local\trunk/bookmarks-data.php:190
|
| 56 |
+
#: Local\trunk/bookmarks-data.php:195
|
| 57 |
+
#: Local\trunk/bookmarks-data.php:200
|
| 58 |
+
#: Local\trunk/bookmarks-data.php:205
|
| 59 |
+
#: Local\trunk/bookmarks-data.php:210
|
| 60 |
+
#: Local\trunk/bookmarks-data.php:215
|
| 61 |
+
#: Local\trunk/bookmarks-data.php:220
|
| 62 |
+
#: Local\trunk/bookmarks-data.php:225
|
| 63 |
+
#: Local\trunk/bookmarks-data.php:230
|
| 64 |
+
#: Local\trunk/bookmarks-data.php:235
|
| 65 |
+
#: Local\trunk/bookmarks-data.php:240
|
| 66 |
+
#: Local\trunk/bookmarks-data.php:245
|
| 67 |
+
#: Local\trunk/bookmarks-data.php:250
|
| 68 |
+
#: Local\trunk/bookmarks-data.php:255
|
| 69 |
+
#: Local\trunk/bookmarks-data.php:260
|
| 70 |
+
#: Local\trunk/bookmarks-data.php:265
|
| 71 |
+
msgid "Check this box to include "
|
| 72 |
+
msgstr "Pažymėkite šį langelį, jei norite įtraukti"
|
| 73 |
+
|
| 74 |
+
#: F:\Web
|
| 75 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 76 |
+
#: Local\trunk/bookmarks-data.php:5
|
| 77 |
+
#: Local\trunk/bookmarks-data.php:6
|
| 78 |
+
msgid "Script & Style"
|
| 79 |
+
msgstr "Scenarijus ir stilius"
|
| 80 |
+
|
| 81 |
+
#: F:\Web
|
| 82 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 83 |
+
#: Local\trunk/bookmarks-data.php:5
|
| 84 |
+
#: Local\trunk/bookmarks-data.php:10
|
| 85 |
+
#: Local\trunk/bookmarks-data.php:15
|
| 86 |
+
#: Local\trunk/bookmarks-data.php:20
|
| 87 |
+
#: Local\trunk/bookmarks-data.php:25
|
| 88 |
+
#: Local\trunk/bookmarks-data.php:30
|
| 89 |
+
#: Local\trunk/bookmarks-data.php:35
|
| 90 |
+
#: Local\trunk/bookmarks-data.php:40
|
| 91 |
+
#: Local\trunk/bookmarks-data.php:45
|
| 92 |
+
#: Local\trunk/bookmarks-data.php:50
|
| 93 |
+
#: Local\trunk/bookmarks-data.php:55
|
| 94 |
+
#: Local\trunk/bookmarks-data.php:60
|
| 95 |
+
#: Local\trunk/bookmarks-data.php:65
|
| 96 |
+
#: Local\trunk/bookmarks-data.php:70
|
| 97 |
+
#: Local\trunk/bookmarks-data.php:75
|
| 98 |
+
#: Local\trunk/bookmarks-data.php:80
|
| 99 |
+
#: Local\trunk/bookmarks-data.php:85
|
| 100 |
+
#: Local\trunk/bookmarks-data.php:90
|
| 101 |
+
#: Local\trunk/bookmarks-data.php:95
|
| 102 |
+
#: Local\trunk/bookmarks-data.php:100
|
| 103 |
+
#: Local\trunk/bookmarks-data.php:105
|
| 104 |
+
#: Local\trunk/bookmarks-data.php:110
|
| 105 |
+
#: Local\trunk/bookmarks-data.php:115
|
| 106 |
+
#: Local\trunk/bookmarks-data.php:120
|
| 107 |
+
#: Local\trunk/bookmarks-data.php:125
|
| 108 |
+
#: Local\trunk/bookmarks-data.php:130
|
| 109 |
+
#: Local\trunk/bookmarks-data.php:135
|
| 110 |
+
#: Local\trunk/bookmarks-data.php:140
|
| 111 |
+
#: Local\trunk/bookmarks-data.php:145
|
| 112 |
+
#: Local\trunk/bookmarks-data.php:150
|
| 113 |
+
#: Local\trunk/bookmarks-data.php:155
|
| 114 |
+
#: Local\trunk/bookmarks-data.php:160
|
| 115 |
+
#: Local\trunk/bookmarks-data.php:165
|
| 116 |
+
#: Local\trunk/bookmarks-data.php:170
|
| 117 |
+
#: Local\trunk/bookmarks-data.php:175
|
| 118 |
+
#: Local\trunk/bookmarks-data.php:180
|
| 119 |
+
#: Local\trunk/bookmarks-data.php:185
|
| 120 |
+
#: Local\trunk/bookmarks-data.php:190
|
| 121 |
+
#: Local\trunk/bookmarks-data.php:195
|
| 122 |
+
#: Local\trunk/bookmarks-data.php:200
|
| 123 |
+
#: Local\trunk/bookmarks-data.php:205
|
| 124 |
+
#: Local\trunk/bookmarks-data.php:210
|
| 125 |
+
#: Local\trunk/bookmarks-data.php:215
|
| 126 |
+
#: Local\trunk/bookmarks-data.php:220
|
| 127 |
+
#: Local\trunk/bookmarks-data.php:225
|
| 128 |
+
#: Local\trunk/bookmarks-data.php:230
|
| 129 |
+
#: Local\trunk/bookmarks-data.php:235
|
| 130 |
+
#: Local\trunk/bookmarks-data.php:240
|
| 131 |
+
#: Local\trunk/bookmarks-data.php:245
|
| 132 |
+
#: Local\trunk/bookmarks-data.php:250
|
| 133 |
+
#: Local\trunk/bookmarks-data.php:255
|
| 134 |
+
#: Local\trunk/bookmarks-data.php:260
|
| 135 |
+
#: Local\trunk/bookmarks-data.php:265
|
| 136 |
+
msgid " in your bookmarking menu"
|
| 137 |
+
msgstr "Jūsų žymėjimas meniu"
|
| 138 |
+
|
| 139 |
+
#: F:\Web
|
| 140 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 141 |
+
#: Local\trunk/bookmarks-data.php:6
|
| 142 |
+
#: Local\trunk/bookmarks-data.php:61
|
| 143 |
+
#: Local\trunk/bookmarks-data.php:141
|
| 144 |
+
#: Local\trunk/bookmarks-data.php:181
|
| 145 |
+
#: Local\trunk/bookmarks-data.php:241
|
| 146 |
+
#: Local\trunk/bookmarks-data.php:246
|
| 147 |
+
#: Local\trunk/bookmarks-data.php:251
|
| 148 |
+
#: Local\trunk/bookmarks-data.php:256
|
| 149 |
+
msgid "Submit this to "
|
| 150 |
+
msgstr "Pateikia ją"
|
| 151 |
+
|
| 152 |
+
#: F:\Web
|
| 153 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 154 |
+
#: Local\trunk/bookmarks-data.php:10
|
| 155 |
+
#: Local\trunk/bookmarks-data.php:11
|
| 156 |
+
msgid "Blinklist"
|
| 157 |
+
msgstr "Blinklist"
|
| 158 |
+
|
| 159 |
+
#: F:\Web
|
| 160 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 161 |
+
#: Local\trunk/bookmarks-data.php:11
|
| 162 |
+
#: Local\trunk/bookmarks-data.php:16
|
| 163 |
+
#: Local\trunk/bookmarks-data.php:31
|
| 164 |
+
#: Local\trunk/bookmarks-data.php:46
|
| 165 |
+
#: Local\trunk/bookmarks-data.php:51
|
| 166 |
+
#: Local\trunk/bookmarks-data.php:66
|
| 167 |
+
#: Local\trunk/bookmarks-data.php:91
|
| 168 |
+
#: Local\trunk/bookmarks-data.php:101
|
| 169 |
+
#: Local\trunk/bookmarks-data.php:121
|
| 170 |
+
#: Local\trunk/bookmarks-data.php:126
|
| 171 |
+
#: Local\trunk/bookmarks-data.php:131
|
| 172 |
+
#: Local\trunk/bookmarks-data.php:146
|
| 173 |
+
#: Local\trunk/bookmarks-data.php:156
|
| 174 |
+
#: Local\trunk/bookmarks-data.php:211
|
| 175 |
+
#: Local\trunk/bookmarks-data.php:261
|
| 176 |
+
#: Local\trunk/bookmarks-data.php:266
|
| 177 |
+
msgid "Share this on "
|
| 178 |
+
msgstr "Dalytis šiuo"
|
| 179 |
+
|
| 180 |
+
#: F:\Web
|
| 181 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 182 |
+
#: Local\trunk/bookmarks-data.php:15
|
| 183 |
+
msgid "Delicious"
|
| 184 |
+
msgstr "Delicious"
|
| 185 |
+
|
| 186 |
+
#: F:\Web
|
| 187 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 188 |
+
#: Local\trunk/bookmarks-data.php:16
|
| 189 |
+
msgid "del.icio.us"
|
| 190 |
+
msgstr "del.icio.us"
|
| 191 |
+
|
| 192 |
+
#: F:\Web
|
| 193 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 194 |
+
#: Local\trunk/bookmarks-data.php:20
|
| 195 |
+
msgid "Digg"
|
| 196 |
+
msgstr "Digg"
|
| 197 |
+
|
| 198 |
+
#: F:\Web
|
| 199 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 200 |
+
#: Local\trunk/bookmarks-data.php:21
|
| 201 |
+
msgid "Digg this!"
|
| 202 |
+
msgstr "Digg this!"
|
| 203 |
+
|
| 204 |
+
#: F:\Web
|
| 205 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 206 |
+
#: Local\trunk/bookmarks-data.php:25
|
| 207 |
+
#: Local\trunk/bookmarks-data.php:26
|
| 208 |
+
msgid "Diigo"
|
| 209 |
+
msgstr "Diigo"
|
| 210 |
+
|
| 211 |
+
#: F:\Web
|
| 212 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 213 |
+
#: Local\trunk/bookmarks-data.php:26
|
| 214 |
+
msgid "Post this on "
|
| 215 |
+
msgstr "Paštu šį"
|
| 216 |
+
|
| 217 |
+
#: F:\Web
|
| 218 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 219 |
+
#: Local\trunk/bookmarks-data.php:30
|
| 220 |
+
#: Local\trunk/bookmarks-data.php:31
|
| 221 |
+
msgid "Reddit"
|
| 222 |
+
msgstr "Reddit"
|
| 223 |
+
|
| 224 |
+
#: F:\Web
|
| 225 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 226 |
+
#: Local\trunk/bookmarks-data.php:35
|
| 227 |
+
msgid "Yahoo! Buzz"
|
| 228 |
+
msgstr "Yahoo! Buzz"
|
| 229 |
+
|
| 230 |
+
#: F:\Web
|
| 231 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 232 |
+
#: Local\trunk/bookmarks-data.php:36
|
| 233 |
+
msgid "Buzz up!"
|
| 234 |
+
msgstr "Buzz up!"
|
| 235 |
+
|
| 236 |
+
#: F:\Web
|
| 237 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 238 |
+
#: Local\trunk/bookmarks-data.php:40
|
| 239 |
+
msgid "Stumbleupon"
|
| 240 |
+
msgstr "Stumbleupon"
|
| 241 |
+
|
| 242 |
+
#: F:\Web
|
| 243 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 244 |
+
#: Local\trunk/bookmarks-data.php:41
|
| 245 |
+
msgid "Stumble upon something good? Share it on StumbleUpon"
|
| 246 |
+
msgstr "Stumble Upon kažką gero? Pasidalinkite apie StumbleUpon"
|
| 247 |
+
|
| 248 |
+
#: F:\Web
|
| 249 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 250 |
+
#: Local\trunk/bookmarks-data.php:45
|
| 251 |
+
#: Local\trunk/bookmarks-data.php:46
|
| 252 |
+
msgid "Technorati"
|
| 253 |
+
msgstr "Technorati"
|
| 254 |
+
|
| 255 |
+
#: F:\Web
|
| 256 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 257 |
+
#: Local\trunk/bookmarks-data.php:50
|
| 258 |
+
#: Local\trunk/bookmarks-data.php:51
|
| 259 |
+
msgid "Mixx"
|
| 260 |
+
msgstr "Mixx"
|
| 261 |
+
|
| 262 |
+
#: F:\Web
|
| 263 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 264 |
+
#: Local\trunk/bookmarks-data.php:55
|
| 265 |
+
#: Local\trunk/bookmarks-data.php:56
|
| 266 |
+
msgid "MySpace"
|
| 267 |
+
msgstr "MySpace"
|
| 268 |
+
|
| 269 |
+
#: F:\Web
|
| 270 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 271 |
+
#: Local\trunk/bookmarks-data.php:56
|
| 272 |
+
#: Local\trunk/bookmarks-data.php:201
|
| 273 |
+
#: Local\trunk/bookmarks-data.php:226
|
| 274 |
+
msgid "Post this to "
|
| 275 |
+
msgstr "Nusiųsti šią žinutę į"
|
| 276 |
+
|
| 277 |
+
#: F:\Web
|
| 278 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 279 |
+
#: Local\trunk/bookmarks-data.php:60
|
| 280 |
+
#: Local\trunk/bookmarks-data.php:61
|
| 281 |
+
msgid "DesignFloat"
|
| 282 |
+
msgstr "DesignFloat"
|
| 283 |
+
|
| 284 |
+
#: F:\Web
|
| 285 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 286 |
+
#: Local\trunk/bookmarks-data.php:65
|
| 287 |
+
#: Local\trunk/bookmarks-data.php:66
|
| 288 |
+
msgid "Facebook"
|
| 289 |
+
msgstr "Facebook"
|
| 290 |
+
|
| 291 |
+
#: F:\Web
|
| 292 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 293 |
+
#: Local\trunk/bookmarks-data.php:70
|
| 294 |
+
msgid "Twitter"
|
| 295 |
+
msgstr "Twitter"
|
| 296 |
+
|
| 297 |
+
#: F:\Web
|
| 298 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 299 |
+
#: Local\trunk/bookmarks-data.php:71
|
| 300 |
+
msgid "Tweet This!"
|
| 301 |
+
msgstr "Tweet This!"
|
| 302 |
+
|
| 303 |
+
#: F:\Web
|
| 304 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 305 |
+
#: Local\trunk/bookmarks-data.php:75
|
| 306 |
+
#: Local\trunk/bookmarks-data.php:80
|
| 307 |
+
msgid "Check this box to include the "
|
| 308 |
+
msgstr "Pažymėkite šį langelį, jei norite įtraukti"
|
| 309 |
+
|
| 310 |
+
#: F:\Web
|
| 311 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 312 |
+
#: Local\trunk/bookmarks-data.php:75
|
| 313 |
+
msgid "\"Email to a Friend\" link"
|
| 314 |
+
msgstr "\ \"Siųsti draugui \""
|
| 315 |
+
|
| 316 |
+
#: F:\Web
|
| 317 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 318 |
+
#: Local\trunk/bookmarks-data.php:76
|
| 319 |
+
msgid "Email this to a friend?"
|
| 320 |
+
msgstr "Siųsti šį draugui?"
|
| 321 |
+
|
| 322 |
+
#: F:\Web
|
| 323 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 324 |
+
#: Local\trunk/bookmarks-data.php:80
|
| 325 |
+
#: Local\trunk/bookmarks-data.php:81
|
| 326 |
+
msgid "ToMuse"
|
| 327 |
+
msgstr "ToMuse"
|
| 328 |
+
|
| 329 |
+
#: F:\Web
|
| 330 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 331 |
+
#: Local\trunk/bookmarks-data.php:81
|
| 332 |
+
msgid "Suggest this article to "
|
| 333 |
+
msgstr "Pasiūlyti šį straipsnį"
|
| 334 |
+
|
| 335 |
+
#: F:\Web
|
| 336 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 337 |
+
#: Local\trunk/bookmarks-data.php:85
|
| 338 |
+
msgid "a 'Subscribe to Comments' link"
|
| 339 |
+
msgstr "\"Prenumeruoti Pastabos\" nurodo"
|
| 340 |
+
|
| 341 |
+
#: F:\Web
|
| 342 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 343 |
+
#: Local\trunk/bookmarks-data.php:86
|
| 344 |
+
msgid "Subscribe to the comments for this post?"
|
| 345 |
+
msgstr "Prenumeruoti į komentarus šiam įrašui?"
|
| 346 |
+
|
| 347 |
+
#: F:\Web
|
| 348 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 349 |
+
#: Local\trunk/bookmarks-data.php:90
|
| 350 |
+
#: Local\trunk/bookmarks-data.php:91
|
| 351 |
+
msgid "Linkedin"
|
| 352 |
+
msgstr "Linkedin"
|
| 353 |
+
|
| 354 |
+
#: F:\Web
|
| 355 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 356 |
+
#: Local\trunk/bookmarks-data.php:95
|
| 357 |
+
#: Local\trunk/bookmarks-data.php:96
|
| 358 |
+
msgid "Newsvine"
|
| 359 |
+
msgstr "Newsvine"
|
| 360 |
+
|
| 361 |
+
#: F:\Web
|
| 362 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 363 |
+
#: Local\trunk/bookmarks-data.php:96
|
| 364 |
+
msgid "Seed this on "
|
| 365 |
+
msgstr "Sėkla šį"
|
| 366 |
+
|
| 367 |
+
#: F:\Web
|
| 368 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 369 |
+
#: Local\trunk/bookmarks-data.php:100
|
| 370 |
+
#: Local\trunk/bookmarks-data.php:101
|
| 371 |
+
msgid "Devmarks"
|
| 372 |
+
msgstr "Devmarks"
|
| 373 |
+
|
| 374 |
+
#: F:\Web
|
| 375 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 376 |
+
#: Local\trunk/bookmarks-data.php:105
|
| 377 |
+
#: Local\trunk/bookmarks-data.php:106
|
| 378 |
+
msgid "Google Bookmarks"
|
| 379 |
+
msgstr "Google Bookmarks"
|
| 380 |
+
|
| 381 |
+
#: F:\Web
|
| 382 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 383 |
+
#: Local\trunk/bookmarks-data.php:106
|
| 384 |
+
#: Local\trunk/bookmarks-data.php:111
|
| 385 |
+
#: Local\trunk/bookmarks-data.php:116
|
| 386 |
+
#: Local\trunk/bookmarks-data.php:161
|
| 387 |
+
#: Local\trunk/bookmarks-data.php:166
|
| 388 |
+
#: Local\trunk/bookmarks-data.php:171
|
| 389 |
+
#: Local\trunk/bookmarks-data.php:176
|
| 390 |
+
#: Local\trunk/bookmarks-data.php:196
|
| 391 |
+
msgid "Add this to "
|
| 392 |
+
msgstr "Pridėti šį į"
|
| 393 |
+
|
| 394 |
+
#: F:\Web
|
| 395 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 396 |
+
#: Local\trunk/bookmarks-data.php:110
|
| 397 |
+
#: Local\trunk/bookmarks-data.php:111
|
| 398 |
+
msgid "Mister Wong"
|
| 399 |
+
msgstr "Mister Wong"
|
| 400 |
+
|
| 401 |
+
#: F:\Web
|
| 402 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 403 |
+
#: Local\trunk/bookmarks-data.php:112
|
| 404 |
+
msgid "www.mister-wong.com"
|
| 405 |
+
msgstr "www.mister-wong.com"
|
| 406 |
+
|
| 407 |
+
#: F:\Web
|
| 408 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 409 |
+
#: Local\trunk/bookmarks-data.php:115
|
| 410 |
+
#: Local\trunk/bookmarks-data.php:116
|
| 411 |
+
msgid "Izeby"
|
| 412 |
+
msgstr "Izeby"
|
| 413 |
+
|
| 414 |
+
#: F:\Web
|
| 415 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 416 |
+
#: Local\trunk/bookmarks-data.php:120
|
| 417 |
+
#: Local\trunk/bookmarks-data.php:121
|
| 418 |
+
msgid "Tipd"
|
| 419 |
+
msgstr "Tipd"
|
| 420 |
+
|
| 421 |
+
#: F:\Web
|
| 422 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 423 |
+
#: Local\trunk/bookmarks-data.php:125
|
| 424 |
+
#: Local\trunk/bookmarks-data.php:126
|
| 425 |
+
msgid "PFBuzz"
|
| 426 |
+
msgstr "PFBuzz"
|
| 427 |
+
|
| 428 |
+
#: F:\Web
|
| 429 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 430 |
+
#: Local\trunk/bookmarks-data.php:130
|
| 431 |
+
#: Local\trunk/bookmarks-data.php:131
|
| 432 |
+
msgid "FriendFeed"
|
| 433 |
+
msgstr "FriendFeed"
|
| 434 |
+
|
| 435 |
+
#: F:\Web
|
| 436 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 437 |
+
#: Local\trunk/bookmarks-data.php:135
|
| 438 |
+
#: Local\trunk/bookmarks-data.php:136
|
| 439 |
+
msgid "BlogMarks"
|
| 440 |
+
msgstr "BlogMarks"
|
| 441 |
+
|
| 442 |
+
#: F:\Web
|
| 443 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 444 |
+
#: Local\trunk/bookmarks-data.php:136
|
| 445 |
+
msgid "Mark this on "
|
| 446 |
+
msgstr "Pažymėti šį"
|
| 447 |
+
|
| 448 |
+
#: F:\Web
|
| 449 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 450 |
+
#: Local\trunk/bookmarks-data.php:140
|
| 451 |
+
#: Local\trunk/bookmarks-data.php:141
|
| 452 |
+
msgid "Twittley"
|
| 453 |
+
msgstr "Twittley"
|
| 454 |
+
|
| 455 |
+
#: F:\Web
|
| 456 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 457 |
+
#: Local\trunk/bookmarks-data.php:145
|
| 458 |
+
#: Local\trunk/bookmarks-data.php:146
|
| 459 |
+
msgid "Fwisp"
|
| 460 |
+
msgstr "Fwisp"
|
| 461 |
+
|
| 462 |
+
#: F:\Web
|
| 463 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 464 |
+
#: Local\trunk/bookmarks-data.php:150
|
| 465 |
+
#: Local\trunk/bookmarks-data.php:151
|
| 466 |
+
msgid "DesignMoo"
|
| 467 |
+
msgstr "DesignMoo"
|
| 468 |
+
|
| 469 |
+
#: F:\Web
|
| 470 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 471 |
+
#: Local\trunk/bookmarks-data.php:151
|
| 472 |
+
msgid "Moo this on "
|
| 473 |
+
msgstr "Moo šį"
|
| 474 |
+
|
| 475 |
+
#: F:\Web
|
| 476 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 477 |
+
#: Local\trunk/bookmarks-data.php:155
|
| 478 |
+
#: Local\trunk/bookmarks-data.php:156
|
| 479 |
+
msgid "BobrDobr"
|
| 480 |
+
msgstr "BobrDobr"
|
| 481 |
+
|
| 482 |
+
#: F:\Web
|
| 483 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 484 |
+
#: Local\trunk/bookmarks-data.php:155
|
| 485 |
+
#: Local\trunk/bookmarks-data.php:160
|
| 486 |
+
#: Local\trunk/bookmarks-data.php:165
|
| 487 |
+
#: Local\trunk/bookmarks-data.php:170
|
| 488 |
+
#: Local\trunk/bookmarks-data.php:175
|
| 489 |
+
msgid " (Russian)"
|
| 490 |
+
msgstr " (Russian)"
|
| 491 |
+
|
| 492 |
+
#: F:\Web
|
| 493 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 494 |
+
#: Local\trunk/bookmarks-data.php:160
|
| 495 |
+
#: Local\trunk/bookmarks-data.php:161
|
| 496 |
+
msgid "Yandex.Bookmarks"
|
| 497 |
+
msgstr "Yandex.Bookmarks"
|
| 498 |
+
|
| 499 |
+
#: F:\Web
|
| 500 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 501 |
+
#: Local\trunk/bookmarks-data.php:165
|
| 502 |
+
#: Local\trunk/bookmarks-data.php:166
|
| 503 |
+
msgid "Memory.ru"
|
| 504 |
+
msgstr "Memory.ru"
|
| 505 |
+
|
| 506 |
+
#: F:\Web
|
| 507 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 508 |
+
#: Local\trunk/bookmarks-data.php:170
|
| 509 |
+
#: Local\trunk/bookmarks-data.php:171
|
| 510 |
+
msgid "100 bookmarks"
|
| 511 |
+
msgstr "100 bookmarks"
|
| 512 |
+
|
| 513 |
+
#: F:\Web
|
| 514 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 515 |
+
#: Local\trunk/bookmarks-data.php:175
|
| 516 |
+
#: Local\trunk/bookmarks-data.php:176
|
| 517 |
+
msgid "MyPlace"
|
| 518 |
+
msgstr "MyPlace"
|
| 519 |
+
|
| 520 |
+
#: F:\Web
|
| 521 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 522 |
+
#: Local\trunk/bookmarks-data.php:180
|
| 523 |
+
#: Local\trunk/bookmarks-data.php:181
|
| 524 |
+
msgid "Hacker News"
|
| 525 |
+
msgstr "Hacker News"
|
| 526 |
+
|
| 527 |
+
#: F:\Web
|
| 528 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 529 |
+
#: Local\trunk/bookmarks-data.php:185
|
| 530 |
+
#: Local\trunk/bookmarks-data.php:186
|
| 531 |
+
msgid "Print Friendly"
|
| 532 |
+
msgstr "spausdinimo"
|
| 533 |
+
|
| 534 |
+
#: F:\Web
|
| 535 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 536 |
+
#: Local\trunk/bookmarks-data.php:186
|
| 537 |
+
msgid "Send this page to "
|
| 538 |
+
msgstr "Siųsti šį puslapį"
|
| 539 |
+
|
| 540 |
+
#: F:\Web
|
| 541 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 542 |
+
#: Local\trunk/bookmarks-data.php:190
|
| 543 |
+
msgid "Design Bump"
|
| 544 |
+
msgstr "Design Bump"
|
| 545 |
+
|
| 546 |
+
#: F:\Web
|
| 547 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 548 |
+
#: Local\trunk/bookmarks-data.php:191
|
| 549 |
+
msgid "Bump this on "
|
| 550 |
+
msgstr "Guzas šį"
|
| 551 |
+
|
| 552 |
+
#: F:\Web
|
| 553 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 554 |
+
#: Local\trunk/bookmarks-data.php:191
|
| 555 |
+
msgid "DesignBump"
|
| 556 |
+
msgstr "DesignBump"
|
| 557 |
+
|
| 558 |
+
#: F:\Web
|
| 559 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 560 |
+
#: Local\trunk/bookmarks-data.php:195
|
| 561 |
+
#: Local\trunk/bookmarks-data.php:196
|
| 562 |
+
msgid "Ning"
|
| 563 |
+
msgstr "Ning"
|
| 564 |
+
|
| 565 |
+
#: F:\Web
|
| 566 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 567 |
+
#: Local\trunk/bookmarks-data.php:200
|
| 568 |
+
#: Local\trunk/bookmarks-data.php:201
|
| 569 |
+
msgid "Identica"
|
| 570 |
+
msgstr "Identica"
|
| 571 |
+
|
| 572 |
+
#: F:\Web
|
| 573 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 574 |
+
#: Local\trunk/bookmarks-data.php:205
|
| 575 |
+
#: Local\trunk/bookmarks-data.php:206
|
| 576 |
+
msgid "Xerpi"
|
| 577 |
+
msgstr "Xerpi"
|
| 578 |
+
|
| 579 |
+
#: F:\Web
|
| 580 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 581 |
+
#: Local\trunk/bookmarks-data.php:206
|
| 582 |
+
msgid "Save this to "
|
| 583 |
+
msgstr "Išsaugoti šį į"
|
| 584 |
+
|
| 585 |
+
#: F:\Web
|
| 586 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 587 |
+
#: Local\trunk/bookmarks-data.php:210
|
| 588 |
+
#: Local\trunk/bookmarks-data.php:211
|
| 589 |
+
msgid "Wikio"
|
| 590 |
+
msgstr "Wikio"
|
| 591 |
+
|
| 592 |
+
#: F:\Web
|
| 593 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 594 |
+
#: Local\trunk/bookmarks-data.php:215
|
| 595 |
+
#: Local\trunk/bookmarks-data.php:216
|
| 596 |
+
msgid "TechMeme"
|
| 597 |
+
msgstr "TechMeme"
|
| 598 |
+
|
| 599 |
+
#: F:\Web
|
| 600 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 601 |
+
#: Local\trunk/bookmarks-data.php:216
|
| 602 |
+
msgid "Tip this to "
|
| 603 |
+
msgstr "Patarimas Tai į"
|
| 604 |
+
|
| 605 |
+
#: F:\Web
|
| 606 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 607 |
+
#: Local\trunk/bookmarks-data.php:220
|
| 608 |
+
#: Local\trunk/bookmarks-data.php:221
|
| 609 |
+
msgid "Sphinn"
|
| 610 |
+
msgstr "Sphinn"
|
| 611 |
+
|
| 612 |
+
#: F:\Web
|
| 613 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 614 |
+
#: Local\trunk/bookmarks-data.php:221
|
| 615 |
+
msgid "Sphinn this on "
|
| 616 |
+
msgstr "Sphinn šį"
|
| 617 |
+
|
| 618 |
+
#: F:\Web
|
| 619 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 620 |
+
#: Local\trunk/bookmarks-data.php:225
|
| 621 |
+
#: Local\trunk/bookmarks-data.php:226
|
| 622 |
+
msgid "Posterous"
|
| 623 |
+
msgstr "Posterous"
|
| 624 |
+
|
| 625 |
+
#: F:\Web
|
| 626 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 627 |
+
#: Local\trunk/bookmarks-data.php:230
|
| 628 |
+
#: Local\trunk/bookmarks-data.php:231
|
| 629 |
+
msgid "Global Grind"
|
| 630 |
+
msgstr "Global Grind"
|
| 631 |
+
|
| 632 |
+
#: F:\Web
|
| 633 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 634 |
+
#: Local\trunk/bookmarks-data.php:231
|
| 635 |
+
msgid "Grind this! on "
|
| 636 |
+
msgstr "Grind šį!apie"
|
| 637 |
+
|
| 638 |
+
#: F:\Web
|
| 639 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 640 |
+
#: Local\trunk/bookmarks-data.php:235
|
| 641 |
+
#: Local\trunk/bookmarks-data.php:236
|
| 642 |
+
msgid "Ping.fm"
|
| 643 |
+
msgstr "Ping.fm"
|
| 644 |
+
|
| 645 |
+
#: F:\Web
|
| 646 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 647 |
+
#: Local\trunk/bookmarks-data.php:236
|
| 648 |
+
msgid "Ping this on "
|
| 649 |
+
msgstr "Empfehle diese Seite bei "
|
| 650 |
+
|
| 651 |
+
#: F:\Web
|
| 652 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 653 |
+
#: Local\trunk/bookmarks-data.php:240
|
| 654 |
+
#: Local\trunk/bookmarks-data.php:241
|
| 655 |
+
msgid "NUjij"
|
| 656 |
+
msgstr "NUjij"
|
| 657 |
+
|
| 658 |
+
#: F:\Web
|
| 659 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 660 |
+
#: Local\trunk/bookmarks-data.php:240
|
| 661 |
+
#: Local\trunk/bookmarks-data.php:245
|
| 662 |
+
msgid " (Dutch)"
|
| 663 |
+
msgstr " (Dutch)"
|
| 664 |
+
|
| 665 |
+
#: F:\Web
|
| 666 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 667 |
+
#: Local\trunk/bookmarks-data.php:245
|
| 668 |
+
#: Local\trunk/bookmarks-data.php:246
|
| 669 |
+
msgid "eKudos"
|
| 670 |
+
msgstr "eKudos"
|
| 671 |
+
|
| 672 |
+
#: F:\Web
|
| 673 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 674 |
+
#: Local\trunk/bookmarks-data.php:250
|
| 675 |
+
#: Local\trunk/bookmarks-data.php:251
|
| 676 |
+
msgid "Netvouz"
|
| 677 |
+
msgstr "Netvouz"
|
| 678 |
+
|
| 679 |
+
#: F:\Web
|
| 680 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 681 |
+
#: Local\trunk/bookmarks-data.php:255
|
| 682 |
+
#: Local\trunk/bookmarks-data.php:256
|
| 683 |
+
msgid "Netvibes"
|
| 684 |
+
msgstr "Netvibes"
|
| 685 |
+
|
| 686 |
+
#: F:\Web
|
| 687 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 688 |
+
#: Local\trunk/bookmarks-data.php:260
|
| 689 |
+
#: Local\trunk/bookmarks-data.php:261
|
| 690 |
+
msgid "Fleck"
|
| 691 |
+
msgstr "Fleck"
|
| 692 |
+
|
| 693 |
+
#: F:\Web
|
| 694 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 695 |
+
#: Local\trunk/bookmarks-data.php:265
|
| 696 |
+
#: Local\trunk/bookmarks-data.php:266
|
| 697 |
+
msgid "Blogosphere News"
|
| 698 |
+
msgstr "Blogosphere News"
|
| 699 |
+
|
| 700 |
+
#: F:\Web
|
| 701 |
+
#: Development\Projects\SexyBookmarks\SVN Local\trunk/public.php:121
|
| 702 |
+
msgid "an error occurred in SexyBookmarks"
|
| 703 |
+
msgstr "Įvyko klaida, SexyBookmarks"
|
| 704 |
+
|
| 705 |
+
#: F:\Web
|
| 706 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 707 |
+
#: Local\trunk/sexy-bookmarks.php:94
|
| 708 |
+
msgid "Your changes have been saved successfully!"
|
| 709 |
+
msgstr "Jūsų pakeitimai sėkmingai išsaugoti!"
|
| 710 |
+
|
| 711 |
+
#: F:\Web
|
| 712 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 713 |
+
#: Local\trunk/sexy-bookmarks.php:94
|
| 714 |
+
msgid "Maybe you would consider "
|
| 715 |
+
msgstr "Gal galėtumėte apsvarstyti"
|
| 716 |
+
|
| 717 |
+
#: F:\Web
|
| 718 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 719 |
+
#: Local\trunk/sexy-bookmarks.php:94
|
| 720 |
+
msgid "donating"
|
| 721 |
+
msgstr "donoras"
|
| 722 |
+
|
| 723 |
+
#: F:\Web
|
| 724 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 725 |
+
#: Local\trunk/sexy-bookmarks.php:97
|
| 726 |
+
msgid "Please choose where you would like the menu to be displayed."
|
| 727 |
+
msgstr "Prašome pasirinkti kur norėtumėte būti rodomas meniu."
|
| 728 |
+
|
| 729 |
+
#: F:\Web
|
| 730 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 731 |
+
#: Local\trunk/sexy-bookmarks.php:98
|
| 732 |
+
msgid "You can't display the menu if you don't choose a few sites to add to it!"
|
| 733 |
+
msgstr "Jūs negalite rodyti meniu, jei jūs neturite pasirinkti kelias svetaines pridėti!"
|
| 734 |
+
|
| 735 |
+
#: F:\Web
|
| 736 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 737 |
+
#: Local\trunk/sexy-bookmarks.php:99
|
| 738 |
+
msgid "Please choose where you want the menu displayed."
|
| 739 |
+
msgstr "Prašome pasirinkti, kur norite meniu."
|
| 740 |
+
|
| 741 |
+
#: F:\Web
|
| 742 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 743 |
+
#: Local\trunk/sexy-bookmarks.php:103
|
| 744 |
+
msgid "You need to select the primary category for any articles submitted to Twittley."
|
| 745 |
+
msgstr "Jums reikia pasirinkti pirminė kategorija Twittley pateikti jokių straipsnių."
|
| 746 |
+
|
| 747 |
+
#: F:\Web
|
| 748 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 749 |
+
#: Local\trunk/sexy-bookmarks.php:104
|
| 750 |
+
msgid "You need to set at least 1 default tag for any articles submitted to Twittley."
|
| 751 |
+
msgstr "Jums reikia nustatyti ne mažiau kaip 1 nutylėjimą tegus jokių straipsnių, pateiktų Twittley."
|
| 752 |
+
|
| 753 |
+
#: F:\Web
|
| 754 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 755 |
+
#: Local\trunk/sexy-bookmarks.php:114
|
| 756 |
+
msgid "You must first download and activate the"
|
| 757 |
+
msgstr "Pirmiausia turite atsisiųsti ir aktyvinti"
|
| 758 |
+
|
| 759 |
+
#: F:\Web
|
| 760 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 761 |
+
#: Local\trunk/sexy-bookmarks.php:114
|
| 762 |
+
msgid "Twitter Friendly Links Plugin"
|
| 763 |
+
msgstr "\"Twitter\" Draugiški Nuorodos Įskiepis"
|
| 764 |
+
|
| 765 |
+
#: F:\Web
|
| 766 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 767 |
+
#: Local\trunk/sexy-bookmarks.php:114
|
| 768 |
+
msgid "before hosting your own short URLs..."
|
| 769 |
+
msgstr "prieš prieglobos savo trumpą URL ..."
|
| 770 |
+
|
| 771 |
+
#: F:\Web
|
| 772 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 773 |
+
#: Local\trunk/sexy-bookmarks.php:132
|
| 774 |
+
msgid "Due to recent API changes by Tumblr, I can no longer offer them as a supported network in the plugin."
|
| 775 |
+
msgstr "Dėl neseniai API pakeitimus Tumblr, aš nebegali jiems pasiūlyti, kaip palaikoma tinklo įskiepiai."
|
| 776 |
+
|
| 777 |
+
#: F:\Web
|
| 778 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 779 |
+
#: Local\trunk/sexy-bookmarks.php:137
|
| 780 |
+
msgid "We're currently working on a more sophisticated solution for the email link and will re-enable it when finished."
|
| 781 |
+
msgstr "Mes šiuo metu dirba daugiau sudėtingas sprendimas elektroninio pašto adreso, ir bus vėl įjungti, kai baigsite."
|
| 782 |
+
|
| 783 |
+
#: F:\Web
|
| 784 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 785 |
+
#: Local\trunk/sexy-bookmarks.php:142
|
| 786 |
+
msgid " Short URLs have been reset."
|
| 787 |
+
msgstr "Trumpas URL buvo atstatyti."
|
| 788 |
+
|
| 789 |
+
#: F:\Web
|
| 790 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 791 |
+
#: Local\trunk/sexy-bookmarks.php:185
|
| 792 |
+
msgid "You are using an outdated version of the plugin"
|
| 793 |
+
msgstr "Jūs naudojate pasenusią versiją Įskiepiai"
|
| 794 |
+
|
| 795 |
+
#: F:\Web
|
| 796 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 797 |
+
#: Local\trunk/sexy-bookmarks.php:185
|
| 798 |
+
msgid "please update if you wish to enjoy all available features!"
|
| 799 |
+
msgstr "prašome atnaujinti, jei norite naudotis visomis turimomis savybėmis!"
|
| 800 |
+
|
| 801 |
+
#: F:\Web
|
| 802 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 803 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 804 |
+
msgid "You are using the development version of the plugin"
|
| 805 |
+
msgstr "Jūs esate naudojant įskiepiai plėtros versija"
|
| 806 |
+
|
| 807 |
+
#: F:\Web
|
| 808 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 809 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 810 |
+
msgid " beta"
|
| 811 |
+
msgstr " beta"
|
| 812 |
+
|
| 813 |
+
#: F:\Web
|
| 814 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 815 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 816 |
+
msgid "please "
|
| 817 |
+
msgstr "Prašom"
|
| 818 |
+
|
| 819 |
+
#: F:\Web
|
| 820 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 821 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 822 |
+
msgid "let us know of any bugs"
|
| 823 |
+
msgstr "leiskite mums žinoti, bet klaidas"
|
| 824 |
+
|
| 825 |
+
#: F:\Web
|
| 826 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 827 |
+
#: Local\trunk/sexy-bookmarks.php:196
|
| 828 |
+
msgid "you may encounter!"
|
| 829 |
+
msgstr "su kuriomis galite susidurti!"
|
| 830 |
+
|
| 831 |
+
#: F:\Web
|
| 832 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 833 |
+
#: Local\trunk/sexy-bookmarks.php:213
|
| 834 |
+
msgid "Enabled Networks"
|
| 835 |
+
msgstr "įjungta tinklai"
|
| 836 |
+
|
| 837 |
+
#: F:\Web
|
| 838 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 839 |
+
#: Local\trunk/sexy-bookmarks.php:223
|
| 840 |
+
msgid "Select the Networks to display. Drag to reorder."
|
| 841 |
+
msgstr "Pasirinkite tinklus, kuriuos būtų galima parodyti. Vilkite pertvarkyti."
|
| 842 |
+
|
| 843 |
+
#: F:\Web
|
| 844 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 845 |
+
#: Local\trunk/sexy-bookmarks.php:237
|
| 846 |
+
msgid "Functionality Settings"
|
| 847 |
+
msgstr "funkcionalumas Nustatymai"
|
| 848 |
+
|
| 849 |
+
#: F:\Web
|
| 850 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 851 |
+
#: Local\trunk/sexy-bookmarks.php:250
|
| 852 |
+
msgid "This will clear <u>ALL</u> short URLs. - Are you sure?"
|
| 853 |
+
msgstr "Tai bus aišku <u> visi </u> Trumpi URL. - Ar tikrai?"
|
| 854 |
+
|
| 855 |
+
#: F:\Web
|
| 856 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 857 |
+
#: Local\trunk/sexy-bookmarks.php:253
|
| 858 |
+
#: Local\trunk/sexy-bookmarks.php:356
|
| 859 |
+
#: Local\trunk/sexy-bookmarks.php:359
|
| 860 |
+
#: Local\trunk/sexy-bookmarks.php:397
|
| 861 |
+
#: Local\trunk/sexy-bookmarks.php:517
|
| 862 |
+
msgid "Yes"
|
| 863 |
+
msgstr "taip"
|
| 864 |
+
|
| 865 |
+
#: F:\Web
|
| 866 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 867 |
+
#: Local\trunk/sexy-bookmarks.php:253
|
| 868 |
+
msgid "Cancel"
|
| 869 |
+
msgstr "atšaukti"
|
| 870 |
+
|
| 871 |
+
#: F:\Web
|
| 872 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 873 |
+
#: Local\trunk/sexy-bookmarks.php:257
|
| 874 |
+
msgid "Twitter Options:"
|
| 875 |
+
msgstr "\"Twitter\" Pasirinktys:"
|
| 876 |
+
|
| 877 |
+
#: F:\Web
|
| 878 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 879 |
+
#: Local\trunk/sexy-bookmarks.php:258
|
| 880 |
+
msgid "Twitter ID:"
|
| 881 |
+
msgstr "Twitter ID:"
|
| 882 |
+
|
| 883 |
+
#: F:\Web
|
| 884 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 885 |
+
#: Local\trunk/sexy-bookmarks.php:261
|
| 886 |
+
msgid "Which URL Shortener?"
|
| 887 |
+
msgstr "Kuris URL Shortener?"
|
| 888 |
+
|
| 889 |
+
#: F:\Web
|
| 890 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 891 |
+
#: Local\trunk/sexy-bookmarks.php:280
|
| 892 |
+
msgid "Reset all Short URLs"
|
| 893 |
+
msgstr "Atstatyti viską Trumpa URL"
|
| 894 |
+
|
| 895 |
+
#: F:\Web
|
| 896 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 897 |
+
#: Local\trunk/sexy-bookmarks.php:292
|
| 898 |
+
msgid "Yahoo! Buzz Defaults:"
|
| 899 |
+
msgstr "Yahoo! Buzz Defaults:"
|
| 900 |
+
|
| 901 |
+
#: F:\Web
|
| 902 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 903 |
+
#: Local\trunk/sexy-bookmarks.php:293
|
| 904 |
+
msgid "Default Content Category:"
|
| 905 |
+
msgstr "Numatytasis turinio kategorijos:"
|
| 906 |
+
|
| 907 |
+
#: F:\Web
|
| 908 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 909 |
+
#: Local\trunk/sexy-bookmarks.php:327
|
| 910 |
+
msgid "Twittley Defaults:"
|
| 911 |
+
msgstr "Twittley Defaults:"
|
| 912 |
+
|
| 913 |
+
#: F:\Web
|
| 914 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 915 |
+
#: Local\trunk/sexy-bookmarks.php:328
|
| 916 |
+
msgid "Primary Content Category:"
|
| 917 |
+
msgstr "Pagrindinis turinys Kategorija:"
|
| 918 |
+
|
| 919 |
+
#: F:\Web
|
| 920 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 921 |
+
#: Local\trunk/sexy-bookmarks.php:346
|
| 922 |
+
msgid "Enter a comma separated list of general tags which describe your site's posts as a whole. Try not to be too specific, as one post may fall into different \"tag categories\" than other posts."
|
| 923 |
+
msgstr "Įveskite atskirti kableliais apibūdinti jūsų svetainę pranešimų, kaip visumos bendrąsias žymes, kurias. Stenkitės ne per daug konkretus, kaip vienas pranešimas gali patekti į skirtingų kategorijų \ \"tag \", negu kitų pranešimų."
|
| 924 |
+
|
| 925 |
+
#: F:\Web
|
| 926 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 927 |
+
#: Local\trunk/sexy-bookmarks.php:347
|
| 928 |
+
msgid "This list is primarily used as a failsafe in case you forget to enter WordPress tags for a particular post, in which case this list of tags would be used so as to bring at least *somewhat* relevant search queries based on the general tags that you enter here."
|
| 929 |
+
msgstr "Šis sąrašas visų pirma naudojama kaip saugia, jei pamiršite patekti į WordPress Tags tam tikrą postą, tokiu atveju šiame sąraše žymeles būtų naudojami taip, kad bent * šiek tiek * atitinkamų paieškos užklausų pagal bendrąsias žymes, kad jūsĮveskite čia."
|
| 930 |
+
|
| 931 |
+
#: F:\Web
|
| 932 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 933 |
+
#: Local\trunk/sexy-bookmarks.php:347
|
| 934 |
+
msgid "Click here to close this message"
|
| 935 |
+
msgstr "Spauskite čia, jei norite uždaryti šį pranešimą"
|
| 936 |
+
|
| 937 |
+
#: F:\Web
|
| 938 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 939 |
+
#: Local\trunk/sexy-bookmarks.php:347
|
| 940 |
+
msgid "close"
|
| 941 |
+
msgstr "arti"
|
| 942 |
+
|
| 943 |
+
#: F:\Web
|
| 944 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 945 |
+
#: Local\trunk/sexy-bookmarks.php:349
|
| 946 |
+
msgid "Default Tags:"
|
| 947 |
+
msgstr "Numatytasis Žymos:"
|
| 948 |
+
|
| 949 |
+
#: F:\Web
|
| 950 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 951 |
+
#: Local\trunk/sexy-bookmarks.php:350
|
| 952 |
+
#: Local\trunk/sexy-bookmarks.php:515
|
| 953 |
+
msgid "Click here for help with this option"
|
| 954 |
+
msgstr "Spauskite čia norėdami padėti su šiuo pasirinkimu"
|
| 955 |
+
|
| 956 |
+
#: F:\Web
|
| 957 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 958 |
+
#: Local\trunk/sexy-bookmarks.php:354
|
| 959 |
+
msgid "General Functionality Options:"
|
| 960 |
+
msgstr "Bendrosios Funkcionalumas parinktys:"
|
| 961 |
+
|
| 962 |
+
#: F:\Web
|
| 963 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 964 |
+
#: Local\trunk/sexy-bookmarks.php:355
|
| 965 |
+
msgid "Add nofollow to the links?"
|
| 966 |
+
msgstr "Pridėti nofollow nuorodos?"
|
| 967 |
+
|
| 968 |
+
#: F:\Web
|
| 969 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 970 |
+
#: Local\trunk/sexy-bookmarks.php:357
|
| 971 |
+
#: Local\trunk/sexy-bookmarks.php:360
|
| 972 |
+
#: Local\trunk/sexy-bookmarks.php:398
|
| 973 |
+
#: Local\trunk/sexy-bookmarks.php:402
|
| 974 |
+
#: Local\trunk/sexy-bookmarks.php:518
|
| 975 |
+
msgid "No"
|
| 976 |
+
msgstr "ne"
|
| 977 |
+
|
| 978 |
+
#: F:\Web
|
| 979 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 980 |
+
#: Local\trunk/sexy-bookmarks.php:358
|
| 981 |
+
msgid "Open links in new window?"
|
| 982 |
+
msgstr "Atidaryti nuorodas naujame lange?"
|
| 983 |
+
|
| 984 |
+
#: F:\Web
|
| 985 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 986 |
+
#: Local\trunk/sexy-bookmarks.php:368
|
| 987 |
+
msgid "General Look & Feel"
|
| 988 |
+
msgstr "Bendra Galite & Feel"
|
| 989 |
+
|
| 990 |
+
#: F:\Web
|
| 991 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 992 |
+
#: Local\trunk/sexy-bookmarks.php:381
|
| 993 |
+
#: Local\trunk/sexy-bookmarks.php:390
|
| 994 |
+
msgid "This will void any custom CSS applied below."
|
| 995 |
+
msgstr "Tai negalioja jokios užsakymą CSS taikomos toliau."
|
| 996 |
+
|
| 997 |
+
#: F:\Web
|
| 998 |
+
#: Development\Projects\SexyBookmarks\SVN
|
| 999 |
+
#: Local\trunk/sexy-bookmarks.php:384
|
| 1000 |
+
#: Local\trunk/sexy-bookmarks.php:393
|
| 1001 |
+
msgid "Ok"
|
| 1002 |
+
msgstr "Ok"
|
| 1003 |
+
|
| 1004 |
+
#: F:\Web
|
| 1005 |
+
#: Development\Projects\SexyBookmarks
|
