Version Description
We update this plugin regularly so we can make it better for you. Update to the latest version for all of the available features and improvements. Thanks for using Shareaholic!
Download this release
Release Info
| Developer | shareaholic |
| Plugin |  WordPress Social Tools, Related Posts, Monetization – Shareaholic |
| Version | 9.7.0 |
| Comparing to | |
| See all releases | |
Code changes from version 9.6.3 to 9.7.0
- admin.php +5 -5
- assets/css/bootstrap.css +1 -2
- assets/css/common.css +1 -64
- assets/css/main.css +1 -612
- assets/css/reveal.css +1 -111
- assets/js/bootstrap.js +0 -2276
- assets/js/bootstrap.min.js +1 -6
- assets/js/jquery.reveal.modified.js +0 -217
- assets/js/jquery.reveal.modified.min.js +1 -0
- assets/js/jquery_custom.js +0 -9227
- assets/js/jquery_custom.min.js +1 -0
- assets/js/jquery_ui_custom.js +0 -2353
- assets/js/jquery_ui_custom.min.js +1 -0
- assets/js/main.js +0 -249
- assets/js/main.min.js +1 -7
- curl.php +2 -2
- lib/social-share-counts/share_count.php +2 -16
- readme.txt +13 -6
- shareaholic.php +3 -3
- src/css/bootstrap.css +3119 -0
admin.php
CHANGED
|
@@ -430,17 +430,17 @@ JQUERY;
|
|
| 430 |
// Exclude from React powered page
|
| 431 |
if ( isset( $_GET['page'] ) && preg_match( '/shareaholic/', $_GET['page'] ) && $_GET['page'] !== 'shareaholic-settings' ) {
|
| 432 |
wp_enqueue_style( 'shareaholic_bootstrap_css', plugins_url( 'assets/css/bootstrap.css', __FILE__ ), false, ShareaholicUtilities::get_version() );
|
| 433 |
-
wp_enqueue_script( 'shareholic_bootstrap_js',
|
| 434 |
}
|
| 435 |
|
| 436 |
if ( isset( $_GET['page'] ) && preg_match( '/shareaholic/', $_GET['page'] ) ) {
|
| 437 |
wp_enqueue_style( 'shareaholic_common_css', plugins_url( 'assets/css/common.css', __FILE__ ), false, ShareaholicUtilities::get_version() );
|
| 438 |
wp_enqueue_style( 'shareaholic_reveal_css', plugins_url( 'assets/css/reveal.css', __FILE__ ), false, ShareaholicUtilities::get_version() );
|
| 439 |
wp_enqueue_style( 'shareaholic_main_css', plugins_url( 'assets/css/main.css', __FILE__ ), false, ShareaholicUtilities::get_version() );
|
| 440 |
-
wp_enqueue_script( 'shareholic_jquery_custom_js',
|
| 441 |
-
wp_enqueue_script( 'shareholic_jquery_ui_custom_js',
|
| 442 |
-
wp_enqueue_script( 'shareholic_modified_reveal_js',
|
| 443 |
-
wp_enqueue_script( 'shareholic_main_js',
|
| 444 |
}
|
| 445 |
}
|
| 446 |
|
| 430 |
// Exclude from React powered page
|
| 431 |
if ( isset( $_GET['page'] ) && preg_match( '/shareaholic/', $_GET['page'] ) && $_GET['page'] !== 'shareaholic-settings' ) {
|
| 432 |
wp_enqueue_style( 'shareaholic_bootstrap_css', plugins_url( 'assets/css/bootstrap.css', __FILE__ ), false, ShareaholicUtilities::get_version() );
|
| 433 |
+
wp_enqueue_script( 'shareholic_bootstrap_js', ShareaholicUtilities::get_file_url_for_environment('assets/js/bootstrap.min.js', 'src/js/bootstrap.js'), false, ShareaholicUtilities::get_version() );
|
| 434 |
}
|
| 435 |
|
| 436 |
if ( isset( $_GET['page'] ) && preg_match( '/shareaholic/', $_GET['page'] ) ) {
|
| 437 |
wp_enqueue_style( 'shareaholic_common_css', plugins_url( 'assets/css/common.css', __FILE__ ), false, ShareaholicUtilities::get_version() );
|
| 438 |
wp_enqueue_style( 'shareaholic_reveal_css', plugins_url( 'assets/css/reveal.css', __FILE__ ), false, ShareaholicUtilities::get_version() );
|
| 439 |
wp_enqueue_style( 'shareaholic_main_css', plugins_url( 'assets/css/main.css', __FILE__ ), false, ShareaholicUtilities::get_version() );
|
| 440 |
+
wp_enqueue_script( 'shareholic_jquery_custom_js', ShareaholicUtilities::get_file_url_for_environment('assets/js/jquery_custom.min.js', 'src/js/jquery_custom.js'), false, ShareaholicUtilities::get_version() );
|
| 441 |
+
wp_enqueue_script( 'shareholic_jquery_ui_custom_js', ShareaholicUtilities::get_file_url_for_environment('assets/js/jquery_ui_custom.min.js', 'src/js/jquery_ui_custom.js'), array( 'shareholic_jquery_custom_js' ), ShareaholicUtilities::get_version() );
|
| 442 |
+
wp_enqueue_script( 'shareholic_modified_reveal_js', ShareaholicUtilities::get_file_url_for_environment('assets/js/jquery.reveal.modified.min.js', 'src/js/jquery.reveal.modified.js'), array( 'shareholic_jquery_custom_js', 'shareholic_jquery_ui_custom_js' ), ShareaholicUtilities::get_version() );
|
| 443 |
+
wp_enqueue_script( 'shareholic_main_js', ShareaholicUtilities::get_file_url_for_environment('assets/js/main.min.js', 'src/js/main.js'), false, ShareaholicUtilities::get_version() );
|
| 444 |
}
|
| 445 |
}
|
| 446 |
|
assets/css/bootstrap.css
CHANGED
|
@@ -3,5 +3,4 @@
|
|
| 3 |
* Copyright 2011-2019 The Bootstrap Authors
|
| 4 |
* Copyright 2011-2019 Twitter, Inc.
|
| 5 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
| 6 |
-
*/:root{--blue:#007bff;--indigo:#6610f2;--purple:#6f42c1;--pink:#e83e8c;--red:#dc3545;--orange:#fd7e14;--yellow:#ffc107;--green:#28a745;--teal:#20c997;--cyan:#17a2b8;--white:#fff;--gray:#6c757d;--gray-dark:#343a40;--primary:#007bff;--secondary:#6c757d;--success:#28a745;--info:#17a2b8;--warning:#ffc107;--danger:#dc3545;--light:#f8f9fa;--dark:#343a40;--breakpoint-xs:0;--breakpoint-sm:576px;--breakpoint-md:768px;--breakpoint-lg:992px;--breakpoint-xl:1200px;--font-family-sans-serif:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,"Noto Sans",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--font-family-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace}*,::after,::before{box-sizing:border-box}html{font-family:sans-serif;line-height:1.15;-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent}article,aside,figcaption,figure,footer,header,hgroup,main,nav,section{display:block}body{margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,"Noto Sans",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:left;background-color:#fff}[tabindex="-1"]:focus{outline:0!important}hr{box-sizing:content-box;height:0;overflow:visible}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem}p{margin-top:0;margin-bottom:1rem}abbr[data-original-title],abbr[title]{text-decoration:underline;-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;border-bottom:0;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}small{font-size:80%}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:#007bff;text-decoration:none;background-color:transparent}a:hover{color:#0056b3;text-decoration:underline}a:not([href]):not([tabindex]){color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus,a:not([href]):not([tabindex]):hover{color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus{outline:0}code,kbd,pre,samp{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;font-size:1em}pre{margin-top:0;margin-bottom:1rem;overflow:auto}figure{margin:0 0 1rem}img{vertical-align:middle;border-style:none}svg{overflow:hidden;vertical-align:middle}table{border-collapse:collapse}caption{padding-top:.75rem;padding-bottom:.75rem;color:#6c757d;text-align:left;caption-side:bottom}th{text-align:inherit}label{display:inline-block;margin-bottom:.5rem}button{border-radius:0}button:focus{outline:1px dotted;outline:5px auto -webkit-focus-ring-color}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,input{overflow:visible}button,select{text-transform:none}select{word-wrap:normal}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}[type=button]::-moz-focus-inner,[type=reset]::-moz-focus-inner,[type=submit]::-moz-focus-inner,button::-moz-focus-inner{padding:0;border-style:none}input[type=checkbox],input[type=radio]{box-sizing:border-box;padding:0}input[type=date],input[type=datetime-local],input[type=month],input[type=time]{-webkit-appearance:listbox}textarea{overflow:auto;resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{display:block;width:100%;max-width:100%;padding:0;margin-bottom:.5rem;font-size:1.5rem;line-height:inherit;color:inherit;white-space:normal}progress{vertical-align:baseline}[type=number]::-webkit-inner-spin-button,[type=number]::-webkit-outer-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:none}[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}output{display:inline-block}summary{display:list-item;cursor:pointer}template{display:none}[hidden]{display:none!important}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-bottom:.5rem;font-weight:500;line-height:1.2}.h1,h1{font-size:2.5rem}.h2,h2{font-size:2rem}.h3,h3{font-size:1.75rem}.h4,h4{font-size:1.5rem}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:6rem;font-weight:300;line-height:1.2}.display-2{font-size:5.5rem;font-weight:300;line-height:1.2}.display-3{font-size:4.5rem;font-weight:300;line-height:1.2}.display-4{font-size:3.5rem;font-weight:300;line-height:1.2}hr{margin-top:1rem;margin-bottom:1rem;border:0;border-top:1px solid rgba(0,0,0,.1)}.small,small{font-size:80%;font-weight:400}.mark,mark{padding:.2em;background-color:#fcf8e3}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:90%;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote-footer{display:block;font-size:80%;color:#6c757d}.blockquote-footer::before{content:"\2014\00A0"}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid #dee2e6;border-radius:.25rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:90%;color:#6c757d}code{font-size:87.5%;color:#e83e8c;word-break:break-word}a>code{color:inherit}kbd{padding:.2rem .4rem;font-size:87.5%;color:#fff;background-color:#212529;border-radius:.2rem}kbd kbd{padding:0;font-size:100%;font-weight:700}pre{display:block;font-size:87.5%;color:#212529}pre code{font-size:inherit;color:inherit;word-break:normal}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width:576px){.container{max-width:540px}}@media (min-width:768px){.container{max-width:720px}}@media (min-width:992px){.container{max-width:960px}}@media (min-width:1200px){.container{max-width:1140px}}.container-fluid{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}.row{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-15px;margin-left:-15px}.no-gutters{margin-right:0;margin-left:0}.no-gutters>.col,.no-gutters>[class*=col-]{padding-right:0;padding-left:0}.col,.col-1,.col-10,.col-11,.col-12,.col-2,.col-3,.col-4,.col-5,.col-6,.col-7,.col-8,.col-9,.col-auto,.col-lg,.col-lg-1,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-lg-auto,.col-md,.col-md-1,.col-md-10,.col-md-11,.col-md-12,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-md-auto,.col-sm,.col-sm-1,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-sm-auto,.col-xl,.col-xl-1,.col-xl-10,.col-xl-11,.col-xl-12,.col-xl-2,.col-xl-3,.col-xl-4,.col-xl-5,.col-xl-6,.col-xl-7,.col-xl-8,.col-xl-9,.col-xl-auto{position:relative;width:100%;padding-right:15px;padding-left:15px}.col{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:100%}.col-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-first{-ms-flex-order:-1;order:-1}.order-last{-ms-flex-order:13;order:13}.order-0{-ms-flex-order:0;order:0}.order-1{-ms-flex-order:1;order:1}.order-2{-ms-flex-order:2;order:2}.order-3{-ms-flex-order:3;order:3}.order-4{-ms-flex-order:4;order:4}.order-5{-ms-flex-order:5;order:5}.order-6{-ms-flex-order:6;order:6}.order-7{-ms-flex-order:7;order:7}.order-8{-ms-flex-order:8;order:8}.order-9{-ms-flex-order:9;order:9}.order-10{-ms-flex-order:10;order:10}.order-11{-ms-flex-order:11;order:11}.order-12{-ms-flex-order:12;order:12}.offset-1{margin-left:8.333333%}.offset-2{margin-left:16.666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.333333%}.offset-5{margin-left:41.666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.333333%}.offset-8{margin-left:66.666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.333333%}.offset-11{margin-left:91.666667%}@media (min-width:576px){.col-sm{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:100%}.col-sm-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-sm-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-sm-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-sm-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-sm-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-sm-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-sm-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-sm-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-sm-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-sm-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-sm-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-sm-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-sm-first{-ms-flex-order:-1;order:-1}.order-sm-last{-ms-flex-order:13;order:13}.order-sm-0{-ms-flex-order:0;order:0}.order-sm-1{-ms-flex-order:1;order:1}.order-sm-2{-ms-flex-order:2;order:2}.order-sm-3{-ms-flex-order:3;order:3}.order-sm-4{-ms-flex-order:4;order:4}.order-sm-5{-ms-flex-order:5;order:5}.order-sm-6{-ms-flex-order:6;order:6}.order-sm-7{-ms-flex-order:7;order:7}.order-sm-8{-ms-flex-order:8;order:8}.order-sm-9{-ms-flex-order:9;order:9}.order-sm-10{-ms-flex-order:10;order:10}.order-sm-11{-ms-flex-order:11;order:11}.order-sm-12{-ms-flex-order:12;order:12}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.333333%}.offset-sm-2{margin-left:16.666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.333333%}.offset-sm-5{margin-left:41.666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.333333%}.offset-sm-8{margin-left:66.666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.333333%}.offset-sm-11{margin-left:91.666667%}}@media (min-width:768px){.col-md{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:100%}.col-md-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-md-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-md-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-md-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-md-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-md-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-md-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-md-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-md-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-md-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-md-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-md-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-md-first{-ms-flex-order:-1;order:-1}.order-md-last{-ms-flex-order:13;order:13}.order-md-0{-ms-flex-order:0;order:0}.order-md-1{-ms-flex-order:1;order:1}.order-md-2{-ms-flex-order:2;order:2}.order-md-3{-ms-flex-order:3;order:3}.order-md-4{-ms-flex-order:4;order:4}.order-md-5{-ms-flex-order:5;order:5}.order-md-6{-ms-flex-order:6;order:6}.order-md-7{-ms-flex-order:7;order:7}.order-md-8{-ms-flex-order:8;order:8}.order-md-9{-ms-flex-order:9;order:9}.order-md-10{-ms-flex-order:10;order:10}.order-md-11{-ms-flex-order:11;order:11}.order-md-12{-ms-flex-order:12;order:12}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.333333%}.offset-md-2{margin-left:16.666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.333333%}.offset-md-5{margin-left:41.666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.333333%}.offset-md-8{margin-left:66.666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.333333%}.offset-md-11{margin-left:91.666667%}}@media (min-width:992px){.col-lg{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:100%}.col-lg-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-lg-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-lg-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-lg-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-lg-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-lg-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-lg-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-lg-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-lg-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-lg-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-lg-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-lg-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-lg-first{-ms-flex-order:-1;order:-1}.order-lg-last{-ms-flex-order:13;order:13}.order-lg-0{-ms-flex-order:0;order:0}.order-lg-1{-ms-flex-order:1;order:1}.order-lg-2{-ms-flex-order:2;order:2}.order-lg-3{-ms-flex-order:3;order:3}.order-lg-4{-ms-flex-order:4;order:4}.order-lg-5{-ms-flex-order:5;order:5}.order-lg-6{-ms-flex-order:6;order:6}.order-lg-7{-ms-flex-order:7;order:7}.order-lg-8{-ms-flex-order:8;order:8}.order-lg-9{-ms-flex-order:9;order:9}.order-lg-10{-ms-flex-order:10;order:10}.order-lg-11{-ms-flex-order:11;order:11}.order-lg-12{-ms-flex-order:12;order:12}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.333333%}.offset-lg-2{margin-left:16.666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.333333%}.offset-lg-5{margin-left:41.666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.333333%}.offset-lg-8{margin-left:66.666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.333333%}.offset-lg-11{margin-left:91.666667%}}@media (min-width:1200px){.col-xl{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:100%}.col-xl-1{-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-xl-2{-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-xl-3{-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-xl-4{-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-xl-5{-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-xl-6{-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-xl-7{-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-xl-8{-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-xl-9{-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-xl-10{-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-xl-11{-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-xl-12{-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-xl-first{-ms-flex-order:-1;order:-1}.order-xl-last{-ms-flex-order:13;order:13}.order-xl-0{-ms-flex-order:0;order:0}.order-xl-1{-ms-flex-order:1;order:1}.order-xl-2{-ms-flex-order:2;order:2}.order-xl-3{-ms-flex-order:3;order:3}.order-xl-4{-ms-flex-order:4;order:4}.order-xl-5{-ms-flex-order:5;order:5}.order-xl-6{-ms-flex-order:6;order:6}.order-xl-7{-ms-flex-order:7;order:7}.order-xl-8{-ms-flex-order:8;order:8}.order-xl-9{-ms-flex-order:9;order:9}.order-xl-10{-ms-flex-order:10;order:10}.order-xl-11{-ms-flex-order:11;order:11}.order-xl-12{-ms-flex-order:12;order:12}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.333333%}.offset-xl-2{margin-left:16.666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.333333%}.offset-xl-5{margin-left:41.666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.333333%}.offset-xl-8{margin-left:66.666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.333333%}.offset-xl-11{margin-left:91.666667%}}.table{width:100%;margin-bottom:1rem;color:#212529}.table td,.table th{padding:.75rem;vertical-align:top;border-top:1px solid #dee2e6}.table thead th{vertical-align:bottom;border-bottom:2px solid #dee2e6}.table tbody+tbody{border-top:2px solid #dee2e6}.table-sm td,.table-sm th{padding:.3rem}.table-bordered{border:1px solid #dee2e6}.table-bordered td,.table-bordered th{border:1px solid #dee2e6}.table-bordered thead td,.table-bordered thead th{border-bottom-width:2px}.table-borderless tbody+tbody,.table-borderless td,.table-borderless th,.table-borderless thead th{border:0}.table-striped tbody tr:nth-of-type(odd){background-color:rgba(0,0,0,.05)}.table-hover tbody tr:hover{color:#212529;background-color:rgba(0,0,0,.075)}.table-primary,.table-primary>td,.table-primary>th{background-color:#b8daff}.table-primary tbody+tbody,.table-primary td,.table-primary th,.table-primary thead th{border-color:#7abaff}.table-hover .table-primary:hover{background-color:#9fcdff}.table-hover .table-primary:hover>td,.table-hover .table-primary:hover>th{background-color:#9fcdff}.table-secondary,.table-secondary>td,.table-secondary>th{background-color:#d6d8db}.table-secondary tbody+tbody,.table-secondary td,.table-secondary th,.table-secondary thead th{border-color:#b3b7bb}.table-hover .table-secondary:hover{background-color:#c8cbcf}.table-hover .table-secondary:hover>td,.table-hover .table-secondary:hover>th{background-color:#c8cbcf}.table-success,.table-success>td,.table-success>th{background-color:#c3e6cb}.table-success tbody+tbody,.table-success td,.table-success th,.table-success thead th{border-color:#8fd19e}.table-hover .table-success:hover{background-color:#b1dfbb}.table-hover .table-success:hover>td,.table-hover .table-success:hover>th{background-color:#b1dfbb}.table-info,.table-info>td,.table-info>th{background-color:#bee5eb}.table-info tbody+tbody,.table-info td,.table-info th,.table-info thead th{border-color:#86cfda}.table-hover .table-info:hover{background-color:#abdde5}.table-hover .table-info:hover>td,.table-hover .table-info:hover>th{background-color:#abdde5}.table-warning,.table-warning>td,.table-warning>th{background-color:#ffeeba}.table-warning tbody+tbody,.table-warning td,.table-warning th,.table-warning thead th{border-color:#ffdf7e}.table-hover .table-warning:hover{background-color:#ffe8a1}.table-hover .table-warning:hover>td,.table-hover .table-warning:hover>th{background-color:#ffe8a1}.table-danger,.table-danger>td,.table-danger>th{background-color:#f5c6cb}.table-danger tbody+tbody,.table-danger td,.table-danger th,.table-danger thead th{border-color:#ed969e}.table-hover .table-danger:hover{background-color:#f1b0b7}.table-hover .table-danger:hover>td,.table-hover .table-danger:hover>th{background-color:#f1b0b7}.table-light,.table-light>td,.table-light>th{background-color:#fdfdfe}.table-light tbody+tbody,.table-light td,.table-light th,.table-light thead th{border-color:#fbfcfc}.table-hover .table-light:hover{background-color:#ececf6}.table-hover .table-light:hover>td,.table-hover .table-light:hover>th{background-color:#ececf6}.table-dark,.table-dark>td,.table-dark>th{background-color:#c6c8ca}.table-dark tbody+tbody,.table-dark td,.table-dark th,.table-dark thead th{border-color:#95999c}.table-hover .table-dark:hover{background-color:#b9bbbe}.table-hover .table-dark:hover>td,.table-hover .table-dark:hover>th{background-color:#b9bbbe}.table-active,.table-active>td,.table-active>th{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover>td,.table-hover .table-active:hover>th{background-color:rgba(0,0,0,.075)}.table .thead-dark th{color:#fff;background-color:#343a40;border-color:#454d55}.table .thead-light th{color:#495057;background-color:#e9ecef;border-color:#dee2e6}.table-dark{color:#fff;background-color:#343a40}.table-dark td,.table-dark th,.table-dark thead th{border-color:#454d55}.table-dark.table-bordered{border:0}.table-dark.table-striped tbody tr:nth-of-type(odd){background-color:rgba(255,255,255,.05)}.table-dark.table-hover tbody tr:hover{color:#fff;background-color:rgba(255,255,255,.075)}@media (max-width:575.98px){.table-responsive-sm{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive-sm>.table-bordered{border:0}}@media (max-width:767.98px){.table-responsive-md{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive-md>.table-bordered{border:0}}@media (max-width:991.98px){.table-responsive-lg{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive-lg>.table-bordered{border:0}}@media (max-width:1199.98px){.table-responsive-xl{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive-xl>.table-bordered{border:0}}.table-responsive{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive>.table-bordered{border:0}.form-control{display:block;width:100%;height:calc(1.5em + .75rem + 2px);padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#495057;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;border-radius:.25rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control::-ms-expand{background-color:transparent;border:0}.form-control:focus{color:#495057;background-color:#fff;border-color:#80bdff;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.form-control::-webkit-input-placeholder{color:#6c757d;opacity:1}.form-control::-moz-placeholder{color:#6c757d;opacity:1}.form-control:-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled,.form-control[readonly]{background-color:#e9ecef;opacity:1}select.form-control:focus::-ms-value{color:#495057;background-color:#fff}.form-control-file,.form-control-range{display:block;width:100%}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.25rem;line-height:1.5}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.875rem;line-height:1.5}.form-control-plaintext{display:block;width:100%;padding-top:.375rem;padding-bottom:.375rem;margin-bottom:0;line-height:1.5;color:#212529;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{height:calc(1.5em + .5rem + 2px);padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.form-control-lg{height:calc(1.5em + 1rem + 2px);padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}select.form-control[multiple],select.form-control[size]{height:auto}textarea.form-control{height:auto}.form-group{margin-bottom:1rem}.form-text{display:block;margin-top:.25rem}.form-row{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-5px;margin-left:-5px}.form-row>.col,.form-row>[class*=col-]{padding-right:5px;padding-left:5px}.form-check{position:relative;display:block;padding-left:1.25rem}.form-check-input{position:absolute;margin-top:.3rem;margin-left:-1.25rem}.form-check-input:disabled~.form-check-label{color:#6c757d}.form-check-label{margin-bottom:0}.form-check-inline{display:-ms-inline-flexbox;display:inline-flex;-ms-flex-align:center;align-items:center;padding-left:0;margin-right:.75rem}.form-check-inline .form-check-input{position:static;margin-top:0;margin-right:.3125rem;margin-left:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#28a745}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;line-height:1.5;color:#fff;background-color:rgba(40,167,69,.9);border-radius:.25rem}.form-control.is-valid,.was-validated .form-control:valid{border-color:#28a745;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:center right calc(.375em + .1875rem);background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.form-control.is-valid~.valid-feedback,.form-control.is-valid~.valid-tooltip,.was-validated .form-control:valid~.valid-feedback,.was-validated .form-control:valid~.valid-tooltip{display:block}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.custom-select.is-valid,.was-validated .custom-select:valid{border-color:#28a745;padding-right:calc((1em + .75rem) * 3 / 4 + 1.75rem);background:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right .75rem center/8px 10px,url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e") #fff no-repeat center right 1.75rem/calc(.75em + .375rem) calc(.75em + .375rem)}.custom-select.is-valid:focus,.was-validated .custom-select:valid:focus{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.custom-select.is-valid~.valid-feedback,.custom-select.is-valid~.valid-tooltip,.was-validated .custom-select:valid~.valid-feedback,.was-validated .custom-select:valid~.valid-tooltip{display:block}.form-control-file.is-valid~.valid-feedback,.form-control-file.is-valid~.valid-tooltip,.was-validated .form-control-file:valid~.valid-feedback,.was-validated .form-control-file:valid~.valid-tooltip{display:block}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#28a745}.form-check-input.is-valid~.valid-feedback,.form-check-input.is-valid~.valid-tooltip,.was-validated .form-check-input:valid~.valid-feedback,.was-validated .form-check-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid~.custom-control-label,.was-validated .custom-control-input:valid~.custom-control-label{color:#28a745}.custom-control-input.is-valid~.custom-control-label::before,.was-validated .custom-control-input:valid~.custom-control-label::before{border-color:#28a745}.custom-control-input.is-valid~.valid-feedback,.custom-control-input.is-valid~.valid-tooltip,.was-validated .custom-control-input:valid~.valid-feedback,.was-validated .custom-control-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid:checked~.custom-control-label::before,.was-validated .custom-control-input:valid:checked~.custom-control-label::before{border-color:#34ce57;background-color:#34ce57}.custom-control-input.is-valid:focus~.custom-control-label::before,.was-validated .custom-control-input:valid:focus~.custom-control-label::before{box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.custom-control-input.is-valid:focus:not(:checked)~.custom-control-label::before,.was-validated .custom-control-input:valid:focus:not(:checked)~.custom-control-label::before{border-color:#28a745}.custom-file-input.is-valid~.custom-file-label,.was-validated .custom-file-input:valid~.custom-file-label{border-color:#28a745}.custom-file-input.is-valid~.valid-feedback,.custom-file-input.is-valid~.valid-tooltip,.was-validated .custom-file-input:valid~.valid-feedback,.was-validated .custom-file-input:valid~.valid-tooltip{display:block}.custom-file-input.is-valid:focus~.custom-file-label,.was-validated .custom-file-input:valid:focus~.custom-file-label{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;line-height:1.5;color:#fff;background-color:rgba(220,53,69,.9);border-radius:.25rem}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:#dc3545;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23dc3545' viewBox='-2 -2 7 7'%3e%3cpath stroke='%23dc3545' d='M0 0l3 3m0-3L0 3'/%3e%3ccircle r='.5'/%3e%3ccircle cx='3' r='.5'/%3e%3ccircle cy='3' r='.5'/%3e%3ccircle cx='3' cy='3' r='.5'/%3e%3c/svg%3E");background-repeat:no-repeat;background-position:center right calc(.375em + .1875rem);background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.form-control.is-invalid~.invalid-feedback,.form-control.is-invalid~.invalid-tooltip,.was-validated .form-control:invalid~.invalid-feedback,.was-validated .form-control:invalid~.invalid-tooltip{display:block}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.custom-select.is-invalid,.was-validated .custom-select:invalid{border-color:#dc3545;padding-right:calc((1em + .75rem) * 3 / 4 + 1.75rem);background:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right .75rem center/8px 10px,url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23dc3545' viewBox='-2 -2 7 7'%3e%3cpath stroke='%23dc3545' d='M0 0l3 3m0-3L0 3'/%3e%3ccircle r='.5'/%3e%3ccircle cx='3' r='.5'/%3e%3ccircle cy='3' r='.5'/%3e%3ccircle cx='3' cy='3' r='.5'/%3e%3c/svg%3E") #fff no-repeat center right 1.75rem/calc(.75em + .375rem) calc(.75em + .375rem)}.custom-select.is-invalid:focus,.was-validated .custom-select:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.custom-select.is-invalid~.invalid-feedback,.custom-select.is-invalid~.invalid-tooltip,.was-validated .custom-select:invalid~.invalid-feedback,.was-validated .custom-select:invalid~.invalid-tooltip{display:block}.form-control-file.is-invalid~.invalid-feedback,.form-control-file.is-invalid~.invalid-tooltip,.was-validated .form-control-file:invalid~.invalid-feedback,.was-validated .form-control-file:invalid~.invalid-tooltip{display:block}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-input.is-invalid~.invalid-feedback,.form-check-input.is-invalid~.invalid-tooltip,.was-validated .form-check-input:invalid~.invalid-feedback,.was-validated .form-check-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid~.custom-control-label,.was-validated .custom-control-input:invalid~.custom-control-label{color:#dc3545}.custom-control-input.is-invalid~.custom-control-label::before,.was-validated .custom-control-input:invalid~.custom-control-label::before{border-color:#dc3545}.custom-control-input.is-invalid~.invalid-feedback,.custom-control-input.is-invalid~.invalid-tooltip,.was-validated .custom-control-input:invalid~.invalid-feedback,.was-validated .custom-control-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid:checked~.custom-control-label::before,.was-validated .custom-control-input:invalid:checked~.custom-control-label::before{border-color:#e4606d;background-color:#e4606d}.custom-control-input.is-invalid:focus~.custom-control-label::before,.was-validated .custom-control-input:invalid:focus~.custom-control-label::before{box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.custom-control-input.is-invalid:focus:not(:checked)~.custom-control-label::before,.was-validated .custom-control-input:invalid:focus:not(:checked)~.custom-control-label::before{border-color:#dc3545}.custom-file-input.is-invalid~.custom-file-label,.was-validated .custom-file-input:invalid~.custom-file-label{border-color:#dc3545}.custom-file-input.is-invalid~.invalid-feedback,.custom-file-input.is-invalid~.invalid-tooltip,.was-validated .custom-file-input:invalid~.invalid-feedback,.was-validated .custom-file-input:invalid~.invalid-tooltip{display:block}.custom-file-input.is-invalid:focus~.custom-file-label,.was-validated .custom-file-input:invalid:focus~.custom-file-label{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.form-inline{display:-ms-flexbox;display:flex;-ms-flex-flow:row wrap;flex-flow:row wrap;-ms-flex-align:center;align-items:center}.form-inline .form-check{width:100%}@media (min-width:576px){.form-inline label{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center;margin-bottom:0}.form-inline .form-group{display:-ms-flexbox;display:flex;-ms-flex:0 0 auto;flex:0 0 auto;-ms-flex-flow:row wrap;flex-flow:row wrap;-ms-flex-align:center;align-items:center;margin-bottom:0}.form-inline .form-control{display:inline-block;width:auto;vertical-align:middle}.form-inline .form-control-plaintext{display:inline-block}.form-inline .custom-select,.form-inline .input-group{width:auto}.form-inline .form-check{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center;width:auto;padding-left:0}.form-inline .form-check-input{position:relative;-ms-flex-negative:0;flex-shrink:0;margin-top:0;margin-right:.25rem;margin-left:0}.form-inline .custom-control{-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center}.form-inline .custom-control-label{margin-bottom:0}}.btn{display:inline-block;font-weight:400;color:#212529;text-align:center;vertical-align:middle;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;background-color:transparent;border:1px solid transparent;padding:.375rem .75rem;font-size:1rem;line-height:1.5;border-radius:.25rem;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:hover{color:#212529;text-decoration:none}.btn.focus,.btn:focus{outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.btn.disabled,.btn:disabled{opacity:.65}a.btn.disabled,fieldset:disabled a.btn{pointer-events:none}.btn-primary{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:hover{color:#fff;background-color:#0069d9;border-color:#0062cc}.btn-primary.focus,.btn-primary:focus{box-shadow:0 0 0 .2rem rgba(38,143,255,.5)}.btn-primary.disabled,.btn-primary:disabled{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:not(:disabled):not(.disabled).active,.btn-primary:not(:disabled):not(.disabled):active,.show>.btn-primary.dropdown-toggle{color:#fff;background-color:#0062cc;border-color:#005cbf}.btn-primary:not(:disabled):not(.disabled).active:focus,.btn-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(38,143,255,.5)}.btn-secondary{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:hover{color:#fff;background-color:#5a6268;border-color:#545b62}.btn-secondary.focus,.btn-secondary:focus{box-shadow:0 0 0 .2rem rgba(130,138,145,.5)}.btn-secondary.disabled,.btn-secondary:disabled{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:not(:disabled):not(.disabled).active,.btn-secondary:not(:disabled):not(.disabled):active,.show>.btn-secondary.dropdown-toggle{color:#fff;background-color:#545b62;border-color:#4e555b}.btn-secondary:not(:disabled):not(.disabled).active:focus,.btn-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(130,138,145,.5)}.btn-success{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:hover{color:#fff;background-color:#218838;border-color:#1e7e34}.btn-success.focus,.btn-success:focus{box-shadow:0 0 0 .2rem rgba(72,180,97,.5)}.btn-success.disabled,.btn-success:disabled{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:not(:disabled):not(.disabled).active,.btn-success:not(:disabled):not(.disabled):active,.show>.btn-success.dropdown-toggle{color:#fff;background-color:#1e7e34;border-color:#1c7430}.btn-success:not(:disabled):not(.disabled).active:focus,.btn-success:not(:disabled):not(.disabled):active:focus,.show>.btn-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(72,180,97,.5)}.btn-info{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:hover{color:#fff;background-color:#138496;border-color:#117a8b}.btn-info.focus,.btn-info:focus{box-shadow:0 0 0 .2rem rgba(58,176,195,.5)}.btn-info.disabled,.btn-info:disabled{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:not(:disabled):not(.disabled).active,.btn-info:not(:disabled):not(.disabled):active,.show>.btn-info.dropdown-toggle{color:#fff;background-color:#117a8b;border-color:#10707f}.btn-info:not(:disabled):not(.disabled).active:focus,.btn-info:not(:disabled):not(.disabled):active:focus,.show>.btn-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(58,176,195,.5)}.btn-warning{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:hover{color:#212529;background-color:#e0a800;border-color:#d39e00}.btn-warning.focus,.btn-warning:focus{box-shadow:0 0 0 .2rem rgba(222,170,12,.5)}.btn-warning.disabled,.btn-warning:disabled{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:not(:disabled):not(.disabled).active,.btn-warning:not(:disabled):not(.disabled):active,.show>.btn-warning.dropdown-toggle{color:#212529;background-color:#d39e00;border-color:#c69500}.btn-warning:not(:disabled):not(.disabled).active:focus,.btn-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(222,170,12,.5)}.btn-danger{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:hover{color:#fff;background-color:#c82333;border-color:#bd2130}.btn-danger.focus,.btn-danger:focus{box-shadow:0 0 0 .2rem rgba(225,83,97,.5)}.btn-danger.disabled,.btn-danger:disabled{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:not(:disabled):not(.disabled).active,.btn-danger:not(:disabled):not(.disabled):active,.show>.btn-danger.dropdown-toggle{color:#fff;background-color:#bd2130;border-color:#b21f2d}.btn-danger:not(:disabled):not(.disabled).active:focus,.btn-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(225,83,97,.5)}.btn-light{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:hover{color:#212529;background-color:#e2e6ea;border-color:#dae0e5}.btn-light.focus,.btn-light:focus{box-shadow:0 0 0 .2rem rgba(216,217,219,.5)}.btn-light.disabled,.btn-light:disabled{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:not(:disabled):not(.disabled).active,.btn-light:not(:disabled):not(.disabled):active,.show>.btn-light.dropdown-toggle{color:#212529;background-color:#dae0e5;border-color:#d3d9df}.btn-light:not(:disabled):not(.disabled).active:focus,.btn-light:not(:disabled):not(.disabled):active:focus,.show>.btn-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(216,217,219,.5)}.btn-dark{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:hover{color:#fff;background-color:#23272b;border-color:#1d2124}.btn-dark.focus,.btn-dark:focus{box-shadow:0 0 0 .2rem rgba(82,88,93,.5)}.btn-dark.disabled,.btn-dark:disabled{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:not(:disabled):not(.disabled).active,.btn-dark:not(:disabled):not(.disabled):active,.show>.btn-dark.dropdown-toggle{color:#fff;background-color:#1d2124;border-color:#171a1d}.btn-dark:not(:disabled):not(.disabled).active:focus,.btn-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(82,88,93,.5)}.btn-outline-primary{color:#007bff;border-color:#007bff}.btn-outline-primary:hover{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary.focus,.btn-outline-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-primary.disabled,.btn-outline-primary:disabled{color:#007bff;background-color:transparent}.btn-outline-primary:not(:disabled):not(.disabled).active,.btn-outline-primary:not(:disabled):not(.disabled):active,.show>.btn-outline-primary.dropdown-toggle{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary:not(:disabled):not(.disabled).active:focus,.btn-outline-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-secondary{color:#6c757d;border-color:#6c757d}.btn-outline-secondary:hover{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary.focus,.btn-outline-secondary:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-secondary.disabled,.btn-outline-secondary:disabled{color:#6c757d;background-color:transparent}.btn-outline-secondary:not(:disabled):not(.disabled).active,.btn-outline-secondary:not(:disabled):not(.disabled):active,.show>.btn-outline-secondary.dropdown-toggle{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary:not(:disabled):not(.disabled).active:focus,.btn-outline-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-success{color:#28a745;border-color:#28a745}.btn-outline-success:hover{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success.focus,.btn-outline-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-success.disabled,.btn-outline-success:disabled{color:#28a745;background-color:transparent}.btn-outline-success:not(:disabled):not(.disabled).active,.btn-outline-success:not(:disabled):not(.disabled):active,.show>.btn-outline-success.dropdown-toggle{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success:not(:disabled):not(.disabled).active:focus,.btn-outline-success:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-info{color:#17a2b8;border-color:#17a2b8}.btn-outline-info:hover{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info.focus,.btn-outline-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-info.disabled,.btn-outline-info:disabled{color:#17a2b8;background-color:transparent}.btn-outline-info:not(:disabled):not(.disabled).active,.btn-outline-info:not(:disabled):not(.disabled):active,.show>.btn-outline-info.dropdown-toggle{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info:not(:disabled):not(.disabled).active:focus,.btn-outline-info:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-warning{color:#ffc107;border-color:#ffc107}.btn-outline-warning:hover{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning.focus,.btn-outline-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-warning.disabled,.btn-outline-warning:disabled{color:#ffc107;background-color:transparent}.btn-outline-warning:not(:disabled):not(.disabled).active,.btn-outline-warning:not(:disabled):not(.disabled):active,.show>.btn-outline-warning.dropdown-toggle{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning:not(:disabled):not(.disabled).active:focus,.btn-outline-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-danger{color:#dc3545;border-color:#dc3545}.btn-outline-danger:hover{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger.focus,.btn-outline-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-danger.disabled,.btn-outline-danger:disabled{color:#dc3545;background-color:transparent}.btn-outline-danger:not(:disabled):not(.disabled).active,.btn-outline-danger:not(:disabled):not(.disabled):active,.show>.btn-outline-danger.dropdown-toggle{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger:not(:disabled):not(.disabled).active:focus,.btn-outline-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-light{color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light:hover{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light.focus,.btn-outline-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-light.disabled,.btn-outline-light:disabled{color:#f8f9fa;background-color:transparent}.btn-outline-light:not(:disabled):not(.disabled).active,.btn-outline-light:not(:disabled):not(.disabled):active,.show>.btn-outline-light.dropdown-toggle{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light:not(:disabled):not(.disabled).active:focus,.btn-outline-light:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-dark{color:#343a40;border-color:#343a40}.btn-outline-dark:hover{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark.focus,.btn-outline-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-dark.disabled,.btn-outline-dark:disabled{color:#343a40;background-color:transparent}.btn-outline-dark:not(:disabled):not(.disabled).active,.btn-outline-dark:not(:disabled):not(.disabled):active,.show>.btn-outline-dark.dropdown-toggle{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark:not(:disabled):not(.disabled).active:focus,.btn-outline-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-link{font-weight:400;color:#007bff;text-decoration:none}.btn-link:hover{color:#0056b3;text-decoration:underline}.btn-link.focus,.btn-link:focus{text-decoration:underline;box-shadow:none}.btn-link.disabled,.btn-link:disabled{color:#6c757d;pointer-events:none}.btn-group-lg>.btn,.btn-lg{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.btn-group-sm>.btn,.btn-sm{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.btn-block{display:block;width:100%}.btn-block+.btn-block{margin-top:.5rem}input[type=button].btn-block,input[type=reset].btn-block,input[type=submit].btn-block{width:100%}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{position:relative;height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.dropdown,.dropleft,.dropright,.dropup{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:10rem;padding:.5rem 0;margin:.125rem 0 0;font-size:1rem;color:#212529;text-align:left;list-style:none;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.15);border-radius:.25rem}.dropdown-menu-left{right:auto;left:0}.dropdown-menu-right{right:0;left:auto}@media (min-width:576px){.dropdown-menu-sm-left{right:auto;left:0}.dropdown-menu-sm-right{right:0;left:auto}}@media (min-width:768px){.dropdown-menu-md-left{right:auto;left:0}.dropdown-menu-md-right{right:0;left:auto}}@media (min-width:992px){.dropdown-menu-lg-left{right:auto;left:0}.dropdown-menu-lg-right{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-left{right:auto;left:0}.dropdown-menu-xl-right{right:0;left:auto}}.dropup .dropdown-menu{top:auto;bottom:100%;margin-top:0;margin-bottom:.125rem}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-menu{top:0;right:auto;left:100%;margin-top:0;margin-left:.125rem}.dropright .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropright .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-toggle::after{vertical-align:0}.dropleft .dropdown-menu{top:0;right:100%;left:auto;margin-top:0;margin-right:.125rem}.dropleft .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropleft .dropdown-toggle::after{display:none}.dropleft .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropleft .dropdown-toggle:empty::after{margin-left:0}.dropleft .dropdown-toggle::before{vertical-align:0}.dropdown-menu[x-placement^=bottom],.dropdown-menu[x-placement^=left],.dropdown-menu[x-placement^=right],.dropdown-menu[x-placement^=top]{right:auto;bottom:auto}.dropdown-divider{height:0;margin:.5rem 0;overflow:hidden;border-top:1px solid #e9ecef}.dropdown-item{display:block;width:100%;padding:.25rem 1.5rem;clear:both;font-weight:400;color:#212529;text-align:inherit;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:focus,.dropdown-item:hover{color:#16181b;text-decoration:none;background-color:#f8f9fa}.dropdown-item.active,.dropdown-item:active{color:#fff;text-decoration:none;background-color:#007bff}.dropdown-item.disabled,.dropdown-item:disabled{color:#6c757d;pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:.5rem 1.5rem;margin-bottom:0;font-size:.875rem;color:#6c757d;white-space:nowrap}.dropdown-item-text{display:block;padding:.25rem 1.5rem;color:#212529}.btn-group,.btn-group-vertical{position:relative;display:-ms-inline-flexbox;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;-ms-flex:1 1 auto;flex:1 1 auto}.btn-group-vertical>.btn:hover,.btn-group>.btn:hover{z-index:1}.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus{z-index:1}.btn-toolbar{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-pack:start;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group>.btn-group:not(:first-child),.btn-group>.btn:not(:first-child){margin-left:-1px}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropright .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropleft .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{-ms-flex-direction:column;flex-direction:column;-ms-flex-align:start;align-items:flex-start;-ms-flex-pack:center;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:-1px}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn:not(:first-child){border-top-left-radius:0;border-top-right-radius:0}.btn-group-toggle>.btn,.btn-group-toggle>.btn-group>.btn{margin-bottom:0}.btn-group-toggle>.btn input[type=checkbox],.btn-group-toggle>.btn input[type=radio],.btn-group-toggle>.btn-group>.btn input[type=checkbox],.btn-group-toggle>.btn-group>.btn input[type=radio]{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.input-group{position:relative;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-align:stretch;align-items:stretch;width:100%}.input-group>.custom-file,.input-group>.custom-select,.input-group>.form-control,.input-group>.form-control-plaintext{position:relative;-ms-flex:1 1 auto;flex:1 1 auto;width:1%;margin-bottom:0}.input-group>.custom-file+.custom-file,.input-group>.custom-file+.custom-select,.input-group>.custom-file+.form-control,.input-group>.custom-select+.custom-file,.input-group>.custom-select+.custom-select,.input-group>.custom-select+.form-control,.input-group>.form-control+.custom-file,.input-group>.form-control+.custom-select,.input-group>.form-control+.form-control,.input-group>.form-control-plaintext+.custom-file,.input-group>.form-control-plaintext+.custom-select,.input-group>.form-control-plaintext+.form-control{margin-left:-1px}.input-group>.custom-file .custom-file-input:focus~.custom-file-label,.input-group>.custom-select:focus,.input-group>.form-control:focus{z-index:3}.input-group>.custom-file .custom-file-input:focus{z-index:4}.input-group>.custom-select:not(:last-child),.input-group>.form-control:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-select:not(:first-child),.input-group>.form-control:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.custom-file{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center}.input-group>.custom-file:not(:last-child) .custom-file-label,.input-group>.custom-file:not(:last-child) .custom-file-label::after{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-file:not(:first-child) .custom-file-label{border-top-left-radius:0;border-bottom-left-radius:0}.input-group-append,.input-group-prepend{display:-ms-flexbox;display:flex}.input-group-append .btn,.input-group-prepend .btn{position:relative;z-index:2}.input-group-append .btn:focus,.input-group-prepend .btn:focus{z-index:3}.input-group-append .btn+.btn,.input-group-append .btn+.input-group-text,.input-group-append .input-group-text+.btn,.input-group-append .input-group-text+.input-group-text,.input-group-prepend .btn+.btn,.input-group-prepend .btn+.input-group-text,.input-group-prepend .input-group-text+.btn,.input-group-prepend .input-group-text+.input-group-text{margin-left:-1px}.input-group-prepend{margin-right:-1px}.input-group-append{margin-left:-1px}.input-group-text{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;padding:.375rem .75rem;margin-bottom:0;font-size:1rem;font-weight:400;line-height:1.5;color:#495057;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.25rem}.input-group-text input[type=checkbox],.input-group-text input[type=radio]{margin-top:0}.input-group-lg>.custom-select,.input-group-lg>.form-control:not(textarea){height:calc(1.5em + 1rem + 2px)}.input-group-lg>.custom-select,.input-group-lg>.form-control,.input-group-lg>.input-group-append>.btn,.input-group-lg>.input-group-append>.input-group-text,.input-group-lg>.input-group-prepend>.btn,.input-group-lg>.input-group-prepend>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.input-group-sm>.custom-select,.input-group-sm>.form-control:not(textarea){height:calc(1.5em + .5rem + 2px)}.input-group-sm>.custom-select,.input-group-sm>.form-control,.input-group-sm>.input-group-append>.btn,.input-group-sm>.input-group-append>.input-group-text,.input-group-sm>.input-group-prepend>.btn,.input-group-sm>.input-group-prepend>.input-group-text{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.input-group-lg>.custom-select,.input-group-sm>.custom-select{padding-right:1.75rem}.input-group>.input-group-append:last-child>.btn:not(:last-child):not(.dropdown-toggle),.input-group>.input-group-append:last-child>.input-group-text:not(:last-child),.input-group>.input-group-append:not(:last-child)>.btn,.input-group>.input-group-append:not(:last-child)>.input-group-text,.input-group>.input-group-prepend>.btn,.input-group>.input-group-prepend>.input-group-text{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.input-group-append>.btn,.input-group>.input-group-append>.input-group-text,.input-group>.input-group-prepend:first-child>.btn:not(:first-child),.input-group>.input-group-prepend:first-child>.input-group-text:not(:first-child),.input-group>.input-group-prepend:not(:first-child)>.btn,.input-group>.input-group-prepend:not(:first-child)>.input-group-text{border-top-left-radius:0;border-bottom-left-radius:0}.custom-control{position:relative;display:block;min-height:1.5rem;padding-left:1.5rem}.custom-control-inline{display:-ms-inline-flexbox;display:inline-flex;margin-right:1rem}.custom-control-input{position:absolute;z-index:-1;opacity:0}.custom-control-input:checked~.custom-control-label::before{color:#fff;border-color:#007bff;background-color:#007bff}.custom-control-input:focus~.custom-control-label::before{box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.custom-control-input:focus:not(:checked)~.custom-control-label::before{border-color:#80bdff}.custom-control-input:not(:disabled):active~.custom-control-label::before{color:#fff;background-color:#b3d7ff;border-color:#b3d7ff}.custom-control-input:disabled~.custom-control-label{color:#6c757d}.custom-control-input:disabled~.custom-control-label::before{background-color:#e9ecef}.custom-control-label{position:relative;margin-bottom:0;vertical-align:top}.custom-control-label::before{position:absolute;top:.25rem;left:-1.5rem;display:block;width:1rem;height:1rem;pointer-events:none;content:"";background-color:#fff;border:#adb5bd solid 1px}.custom-control-label::after{position:absolute;top:.25rem;left:-1.5rem;display:block;width:1rem;height:1rem;content:"";background:no-repeat 50%/50% 50%}.custom-checkbox .custom-control-label::before{border-radius:.25rem}.custom-checkbox .custom-control-input:checked~.custom-control-label::after{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3e%3c/svg%3e")}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::before{border-color:#007bff;background-color:#007bff}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::after{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3e%3cpath stroke='%23fff' d='M0 2h4'/%3e%3c/svg%3e")}.custom-checkbox .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-checkbox .custom-control-input:disabled:indeterminate~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-radio .custom-control-label::before{border-radius:50%}.custom-radio .custom-control-input:checked~.custom-control-label::after{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.custom-radio .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-switch{padding-left:2.25rem}.custom-switch .custom-control-label::before{left:-2.25rem;width:1.75rem;pointer-events:all;border-radius:.5rem}.custom-switch .custom-control-label::after{top:calc(.25rem + 2px);left:calc(-2.25rem + 2px);width:calc(1rem - 4px);height:calc(1rem - 4px);background-color:#adb5bd;border-radius:.5rem;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out,-webkit-transform .15s ease-in-out;transition:transform .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:transform .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out,-webkit-transform .15s ease-in-out}@media (prefers-reduced-motion:reduce){.custom-switch .custom-control-label::after{transition:none}}.custom-switch .custom-control-input:checked~.custom-control-label::after{background-color:#fff;-webkit-transform:translateX(.75rem);transform:translateX(.75rem)}.custom-switch .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-select{display:inline-block;width:100%;height:calc(1.5em + .75rem + 2px);padding:.375rem 1.75rem .375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#495057;vertical-align:middle;background:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right .75rem center/8px 10px;background-color:#fff;border:1px solid #ced4da;border-radius:.25rem;-webkit-appearance:none;-moz-appearance:none;appearance:none}.custom-select:focus{border-color:#80bdff;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.custom-select:focus::-ms-value{color:#495057;background-color:#fff}.custom-select[multiple],.custom-select[size]:not([size="1"]){height:auto;padding-right:.75rem;background-image:none}.custom-select:disabled{color:#6c757d;background-color:#e9ecef}.custom-select::-ms-expand{display:none}.custom-select-sm{height:calc(1.5em + .5rem + 2px);padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem}.custom-select-lg{height:calc(1.5em + 1rem + 2px);padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem}.custom-file{position:relative;display:inline-block;width:100%;height:calc(1.5em + .75rem + 2px);margin-bottom:0}.custom-file-input{position:relative;z-index:2;width:100%;height:calc(1.5em + .75rem + 2px);margin:0;opacity:0}.custom-file-input:focus~.custom-file-label{border-color:#80bdff;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.custom-file-input:disabled~.custom-file-label{background-color:#e9ecef}.custom-file-input:lang(en)~.custom-file-label::after{content:"Browse"}.custom-file-input~.custom-file-label[data-browse]::after{content:attr(data-browse)}.custom-file-label{position:absolute;top:0;right:0;left:0;z-index:1;height:calc(1.5em + .75rem + 2px);padding:.375rem .75rem;font-weight:400;line-height:1.5;color:#495057;background-color:#fff;border:1px solid #ced4da;border-radius:.25rem}.custom-file-label::after{position:absolute;top:0;right:0;bottom:0;z-index:3;display:block;height:calc(1.5em + .75rem);padding:.375rem .75rem;line-height:1.5;color:#495057;content:"Browse";background-color:#e9ecef;border-left:inherit;border-radius:0 .25rem .25rem 0}.custom-range{width:100%;height:calc(1rem + .4rem);padding:0;background-color:transparent;-webkit-appearance:none;-moz-appearance:none;appearance:none}.custom-range:focus{outline:0}.custom-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range:focus::-ms-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range::-moz-focus-outer{border:0}.custom-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;background-color:#007bff;border:0;border-radius:1rem;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.custom-range::-webkit-slider-thumb{transition:none}}.custom-range::-webkit-slider-thumb:active{background-color:#b3d7ff}.custom-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.custom-range::-moz-range-thumb{width:1rem;height:1rem;background-color:#007bff;border:0;border-radius:1rem;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-moz-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.custom-range::-moz-range-thumb{transition:none}}.custom-range::-moz-range-thumb:active{background-color:#b3d7ff}.custom-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.custom-range::-ms-thumb{width:1rem;height:1rem;margin-top:0;margin-right:.2rem;margin-left:.2rem;background-color:#007bff;border:0;border-radius:1rem;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;appearance:none}@media (prefers-reduced-motion:reduce){.custom-range::-ms-thumb{transition:none}}.custom-range::-ms-thumb:active{background-color:#b3d7ff}.custom-range::-ms-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:transparent;border-color:transparent;border-width:.5rem}.custom-range::-ms-fill-lower{background-color:#dee2e6;border-radius:1rem}.custom-range::-ms-fill-upper{margin-right:15px;background-color:#dee2e6;border-radius:1rem}.custom-range:disabled::-webkit-slider-thumb{background-color:#adb5bd}.custom-range:disabled::-webkit-slider-runnable-track{cursor:default}.custom-range:disabled::-moz-range-thumb{background-color:#adb5bd}.custom-range:disabled::-moz-range-track{cursor:default}.custom-range:disabled::-ms-thumb{background-color:#adb5bd}.custom-control-label::before,.custom-file-label,.custom-select{transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.custom-control-label::before,.custom-file-label,.custom-select{transition:none}}.nav{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:.5rem 1rem}.nav-link:focus,.nav-link:hover{text-decoration:none}.nav-link.disabled{color:#6c757d;pointer-events:none;cursor:default}.nav-tabs{border-bottom:1px solid #dee2e6}.nav-tabs .nav-item{margin-bottom:-1px}.nav-tabs .nav-link{border:1px solid transparent;border-top-left-radius:.25rem;border-top-right-radius:.25rem}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{border-color:#e9ecef #e9ecef #dee2e6}.nav-tabs .nav-link.disabled{color:#6c757d;background-color:transparent;border-color:transparent}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:#495057;background-color:#fff;border-color:#dee2e6 #dee2e6 #fff}.nav-tabs .dropdown-menu{margin-top:-1px;border-top-left-radius:0;border-top-right-radius:0}.nav-pills .nav-link{border-radius:.25rem}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:#fff;background-color:#007bff}.nav-fill .nav-item{-ms-flex:1 1 auto;flex:1 1 auto;text-align:center}.nav-justified .nav-item{-ms-flex-preferred-size:0;flex-basis:0;-ms-flex-positive:1;flex-grow:1;text-align:center}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{position:relative;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-align:center;align-items:center;-ms-flex-pack:justify;justify-content:space-between;padding:.5rem 1rem}.navbar>.container,.navbar>.container-fluid{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-ms-flex-align:center;align-items:center;-ms-flex-pack:justify;justify-content:space-between}.navbar-brand{display:inline-block;padding-top:.3125rem;padding-bottom:.3125rem;margin-right:1rem;font-size:1.25rem;line-height:inherit;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{text-decoration:none}.navbar-nav{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link{padding-right:0;padding-left:0}.navbar-nav .dropdown-menu{position:static;float:none}.navbar-text{display:inline-block;padding-top:.5rem;padding-bottom:.5rem}.navbar-collapse{-ms-flex-preferred-size:100%;flex-basis:100%;-ms-flex-positive:1;flex-grow:1;-ms-flex-align:center;align-items:center}.navbar-toggler{padding:.25rem .75rem;font-size:1.25rem;line-height:1;background-color:transparent;border:1px solid transparent;border-radius:.25rem}.navbar-toggler:focus,.navbar-toggler:hover{text-decoration:none}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;content:"";background:no-repeat center center;background-size:100% 100%}@media (max-width:575.98px){.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:576px){.navbar-expand-sm{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-sm .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-sm .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}}@media (max-width:767.98px){.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:768px){.navbar-expand-md{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-md .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-md .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}}@media (max-width:991.98px){.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:992px){.navbar-expand-lg{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-lg .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-lg .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}}@media (max-width:1199.98px){.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:1200px){.navbar-expand-xl{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-xl .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-xl .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}}.navbar-expand{-ms-flex-flow:row nowrap;flex-flow:row nowrap;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand>.container,.navbar-expand>.container-fluid{padding-right:0;padding-left:0}.navbar-expand .navbar-nav{-ms-flex-direction:row;flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand>.container,.navbar-expand>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand .navbar-collapse{display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-light .navbar-brand{color:rgba(0,0,0,.9)}.navbar-light .navbar-brand:focus,.navbar-light .navbar-brand:hover{color:rgba(0,0,0,.9)}.navbar-light .navbar-nav .nav-link{color:rgba(0,0,0,.5)}.navbar-light .navbar-nav .nav-link:focus,.navbar-light .navbar-nav .nav-link:hover{color:rgba(0,0,0,.7)}.navbar-light .navbar-nav .nav-link.disabled{color:rgba(0,0,0,.3)}.navbar-light .navbar-nav .active>.nav-link,.navbar-light .navbar-nav .nav-link.active,.navbar-light .navbar-nav .nav-link.show,.navbar-light .navbar-nav .show>.nav-link{color:rgba(0,0,0,.9)}.navbar-light .navbar-toggler{color:rgba(0,0,0,.5);border-color:rgba(0,0,0,.1)}.navbar-light .navbar-toggler-icon{background-image:url("data:image/svg+xml,%3csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3e%3cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.navbar-light .navbar-text{color:rgba(0,0,0,.5)}.navbar-light .navbar-text a{color:rgba(0,0,0,.9)}.navbar-light .navbar-text a:focus,.navbar-light .navbar-text a:hover{color:rgba(0,0,0,.9)}.navbar-dark .navbar-brand{color:#fff}.navbar-dark .navbar-brand:focus,.navbar-dark .navbar-brand:hover{color:#fff}.navbar-dark .navbar-nav .nav-link{color:rgba(255,255,255,.5)}.navbar-dark .navbar-nav .nav-link:focus,.navbar-dark .navbar-nav .nav-link:hover{color:rgba(255,255,255,.75)}.navbar-dark .navbar-nav .nav-link.disabled{color:rgba(255,255,255,.25)}.navbar-dark .navbar-nav .active>.nav-link,.navbar-dark .navbar-nav .nav-link.active,.navbar-dark .navbar-nav .nav-link.show,.navbar-dark .navbar-nav .show>.nav-link{color:#fff}.navbar-dark .navbar-toggler{color:rgba(255,255,255,.5);border-color:rgba(255,255,255,.1)}.navbar-dark .navbar-toggler-icon{background-image:url("data:image/svg+xml,%3csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3e%3cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.navbar-dark .navbar-text{color:rgba(255,255,255,.5)}.navbar-dark .navbar-text a{color:#fff}.navbar-dark .navbar-text a:focus,.navbar-dark .navbar-text a:hover{color:#fff}.card{position:relative;display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;word-wrap:break-word;background-color:#fff;background-clip:border-box;border:1px solid rgba(0,0,0,.125);border-radius:.25rem}.card>hr{margin-right:0;margin-left:0}.card>.list-group:first-child .list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card>.list-group:last-child .list-group-item:last-child{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1.25rem}.card-title{margin-bottom:.75rem}.card-subtitle{margin-top:-.375rem;margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link:hover{text-decoration:none}.card-link+.card-link{margin-left:1.25rem}.card-header{padding:.75rem 1.25rem;margin-bottom:0;background-color:rgba(0,0,0,.03);border-bottom:1px solid rgba(0,0,0,.125)}.card-header:first-child{border-radius:calc(.25rem - 1px) calc(.25rem - 1px) 0 0}.card-header+.list-group .list-group-item:first-child{border-top:0}.card-footer{padding:.75rem 1.25rem;background-color:rgba(0,0,0,.03);border-top:1px solid rgba(0,0,0,.125)}.card-footer:last-child{border-radius:0 0 calc(.25rem - 1px) calc(.25rem - 1px)}.card-header-tabs{margin-right:-.625rem;margin-bottom:-.75rem;margin-left:-.625rem;border-bottom:0}.card-header-pills{margin-right:-.625rem;margin-left:-.625rem}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1.25rem}.card-img{width:100%;border-radius:calc(.25rem - 1px)}.card-img-top{width:100%;border-top-left-radius:calc(.25rem - 1px);border-top-right-radius:calc(.25rem - 1px)}.card-img-bottom{width:100%;border-bottom-right-radius:calc(.25rem - 1px);border-bottom-left-radius:calc(.25rem - 1px)}.card-deck{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column}.card-deck .card{margin-bottom:15px}@media (min-width:576px){.card-deck{-ms-flex-flow:row wrap;flex-flow:row wrap;margin-right:-15px;margin-left:-15px}.card-deck .card{display:-ms-flexbox;display:flex;-ms-flex:1 0 0%;flex:1 0 0%;-ms-flex-direction:column;flex-direction:column;margin-right:15px;margin-bottom:0;margin-left:15px}}.card-group{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column}.card-group>.card{margin-bottom:15px}@media (min-width:576px){.card-group{-ms-flex-flow:row wrap;flex-flow:row wrap}.card-group>.card{-ms-flex:1 0 0%;flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.card-columns .card{margin-bottom:.75rem}@media (min-width:576px){.card-columns{-webkit-column-count:3;-moz-column-count:3;column-count:3;-webkit-column-gap:1.25rem;-moz-column-gap:1.25rem;column-gap:1.25rem;orphans:1;widows:1}.card-columns .card{display:inline-block;width:100%}}.accordion>.card{overflow:hidden}.accordion>.card:not(:first-of-type) .card-header:first-child{border-radius:0}.accordion>.card:not(:first-of-type):not(:last-of-type){border-bottom:0;border-radius:0}.accordion>.card:first-of-type{border-bottom:0;border-bottom-right-radius:0;border-bottom-left-radius:0}.accordion>.card:last-of-type{border-top-left-radius:0;border-top-right-radius:0}.accordion>.card .card-header{margin-bottom:-1px}.breadcrumb{display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;padding:.75rem 1rem;margin-bottom:1rem;list-style:none;background-color:#e9ecef;border-radius:.25rem}.breadcrumb-item+.breadcrumb-item{padding-left:.5rem}.breadcrumb-item+.breadcrumb-item::before{display:inline-block;padding-right:.5rem;color:#6c757d;content:"/"}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:underline}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:none}.breadcrumb-item.active{color:#6c757d}.pagination{display:-ms-flexbox;display:flex;padding-left:0;list-style:none;border-radius:.25rem}.page-link{position:relative;display:block;padding:.5rem .75rem;margin-left:-1px;line-height:1.25;color:#007bff;background-color:#fff;border:1px solid #dee2e6}.page-link:hover{z-index:2;color:#0056b3;text-decoration:none;background-color:#e9ecef;border-color:#dee2e6}.page-link:focus{z-index:2;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.page-item:first-child .page-link{margin-left:0;border-top-left-radius:.25rem;border-bottom-left-radius:.25rem}.page-item:last-child .page-link{border-top-right-radius:.25rem;border-bottom-right-radius:.25rem}.page-item.active .page-link{z-index:1;color:#fff;background-color:#007bff;border-color:#007bff}.page-item.disabled .page-link{color:#6c757d;pointer-events:none;cursor:auto;background-color:#fff;border-color:#dee2e6}.pagination-lg .page-link{padding:.75rem 1.5rem;font-size:1.25rem;line-height:1.5}.pagination-lg .page-item:first-child .page-link{border-top-left-radius:.3rem;border-bottom-left-radius:.3rem}.pagination-lg .page-item:last-child .page-link{border-top-right-radius:.3rem;border-bottom-right-radius:.3rem}.pagination-sm .page-link{padding:.25rem .5rem;font-size:.875rem;line-height:1.5}.pagination-sm .page-item:first-child .page-link{border-top-left-radius:.2rem;border-bottom-left-radius:.2rem}.pagination-sm .page-item:last-child .page-link{border-top-right-radius:.2rem;border-bottom-right-radius:.2rem}.badge{display:inline-block;padding:.25em .4em;font-size:75%;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.badge{transition:none}}a.badge:focus,a.badge:hover{text-decoration:none}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.badge-pill{padding-right:.6em;padding-left:.6em;border-radius:10rem}.badge-primary{color:#fff;background-color:#007bff}a.badge-primary:focus,a.badge-primary:hover{color:#fff;background-color:#0062cc}a.badge-primary.focus,a.badge-primary:focus{outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.badge-secondary{color:#fff;background-color:#6c757d}a.badge-secondary:focus,a.badge-secondary:hover{color:#fff;background-color:#545b62}a.badge-secondary.focus,a.badge-secondary:focus{outline:0;box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.badge-success{color:#fff;background-color:#28a745}a.badge-success:focus,a.badge-success:hover{color:#fff;background-color:#1e7e34}a.badge-success.focus,a.badge-success:focus{outline:0;box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.badge-info{color:#fff;background-color:#17a2b8}a.badge-info:focus,a.badge-info:hover{color:#fff;background-color:#117a8b}a.badge-info.focus,a.badge-info:focus{outline:0;box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.badge-warning{color:#212529;background-color:#ffc107}a.badge-warning:focus,a.badge-warning:hover{color:#212529;background-color:#d39e00}a.badge-warning.focus,a.badge-warning:focus{outline:0;box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.badge-danger{color:#fff;background-color:#dc3545}a.badge-danger:focus,a.badge-danger:hover{color:#fff;background-color:#bd2130}a.badge-danger.focus,a.badge-danger:focus{outline:0;box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.badge-light{color:#212529;background-color:#f8f9fa}a.badge-light:focus,a.badge-light:hover{color:#212529;background-color:#dae0e5}a.badge-light.focus,a.badge-light:focus{outline:0;box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.badge-dark{color:#fff;background-color:#343a40}a.badge-dark:focus,a.badge-dark:hover{color:#fff;background-color:#1d2124}a.badge-dark.focus,a.badge-dark:focus{outline:0;box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.jumbotron{padding:2rem 1rem;margin-bottom:2rem;background-color:#e9ecef;border-radius:.3rem}@media (min-width:576px){.jumbotron{padding:4rem 2rem}}.jumbotron-fluid{padding-right:0;padding-left:0;border-radius:0}.alert{position:relative;padding:.75rem 1.25rem;margin-bottom:1rem;border:1px solid transparent;border-radius:.25rem}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:4rem}.alert-dismissible .close{position:absolute;top:0;right:0;padding:.75rem 1.25rem;color:inherit}.alert-primary{color:#004085;background-color:#cce5ff;border-color:#b8daff}.alert-primary hr{border-top-color:#9fcdff}.alert-primary .alert-link{color:#002752}.alert-secondary{color:#383d41;background-color:#e2e3e5;border-color:#d6d8db}.alert-secondary hr{border-top-color:#c8cbcf}.alert-secondary .alert-link{color:#202326}.alert-success{color:#155724;background-color:#d4edda;border-color:#c3e6cb}.alert-success hr{border-top-color:#b1dfbb}.alert-success .alert-link{color:#0b2e13}.alert-info{color:#0c5460;background-color:#d1ecf1;border-color:#bee5eb}.alert-info hr{border-top-color:#abdde5}.alert-info .alert-link{color:#062c33}.alert-warning{color:#856404;background-color:#fff3cd;border-color:#ffeeba}.alert-warning hr{border-top-color:#ffe8a1}.alert-warning .alert-link{color:#533f03}.alert-danger{color:#721c24;background-color:#f8d7da;border-color:#f5c6cb}.alert-danger hr{border-top-color:#f1b0b7}.alert-danger .alert-link{color:#491217}.alert-light{color:#818182;background-color:#fefefe;border-color:#fdfdfe}.alert-light hr{border-top-color:#ececf6}.alert-light .alert-link{color:#686868}.alert-dark{color:#1b1e21;background-color:#d6d8d9;border-color:#c6c8ca}.alert-dark hr{border-top-color:#b9bbbe}.alert-dark .alert-link{color:#040505}@-webkit-keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}@keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}.progress{display:-ms-flexbox;display:flex;height:1rem;overflow:hidden;font-size:.75rem;background-color:#e9ecef;border-radius:.25rem}.progress-bar{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;-ms-flex-pack:center;justify-content:center;color:#fff;text-align:center;white-space:nowrap;background-color:#007bff;transition:width .6s ease}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:1rem 1rem}.progress-bar-animated{-webkit-animation:progress-bar-stripes 1s linear infinite;animation:progress-bar-stripes 1s linear infinite}@media (prefers-reduced-motion:reduce){.progress-bar-animated{-webkit-animation:none;animation:none}}.media{display:-ms-flexbox;display:flex;-ms-flex-align:start;align-items:flex-start}.media-body{-ms-flex:1;flex:1}.list-group{display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0}.list-group-item-action{width:100%;color:#495057;text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:#495057;text-decoration:none;background-color:#f8f9fa}.list-group-item-action:active{color:#212529;background-color:#e9ecef}.list-group-item{position:relative;display:block;padding:.75rem 1.25rem;margin-bottom:-1px;background-color:#fff;border:1px solid rgba(0,0,0,.125)}.list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.list-group-item:last-child{margin-bottom:0;border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.list-group-item.disabled,.list-group-item:disabled{color:#6c757d;pointer-events:none;background-color:#fff}.list-group-item.active{z-index:2;color:#fff;background-color:#007bff;border-color:#007bff}.list-group-horizontal{-ms-flex-direction:row;flex-direction:row}.list-group-horizontal .list-group-item{margin-right:-1px;margin-bottom:0}.list-group-horizontal .list-group-item:first-child{border-top-left-radius:.25rem;border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal .list-group-item:last-child{margin-right:0;border-top-right-radius:.25rem;border-bottom-right-radius:.25rem;border-bottom-left-radius:0}@media (min-width:576px){.list-group-horizontal-sm{-ms-flex-direction:row;flex-direction:row}.list-group-horizontal-sm .list-group-item{margin-right:-1px;margin-bottom:0}.list-group-horizontal-sm .list-group-item:first-child{border-top-left-radius:.25rem;border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-sm .list-group-item:last-child{margin-right:0;border-top-right-radius:.25rem;border-bottom-right-radius:.25rem;border-bottom-left-radius:0}}@media (min-width:768px){.list-group-horizontal-md{-ms-flex-direction:row;flex-direction:row}.list-group-horizontal-md .list-group-item{margin-right:-1px;margin-bottom:0}.list-group-horizontal-md .list-group-item:first-child{border-top-left-radius:.25rem;border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-md .list-group-item:last-child{margin-right:0;border-top-right-radius:.25rem;border-bottom-right-radius:.25rem;border-bottom-left-radius:0}}@media (min-width:992px){.list-group-horizontal-lg{-ms-flex-direction:row;flex-direction:row}.list-group-horizontal-lg .list-group-item{margin-right:-1px;margin-bottom:0}.list-group-horizontal-lg .list-group-item:first-child{border-top-left-radius:.25rem;border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-lg .list-group-item:last-child{margin-right:0;border-top-right-radius:.25rem;border-bottom-right-radius:.25rem;border-bottom-left-radius:0}}@media (min-width:1200px){.list-group-horizontal-xl{-ms-flex-direction:row;flex-direction:row}.list-group-horizontal-xl .list-group-item{margin-right:-1px;margin-bottom:0}.list-group-horizontal-xl .list-group-item:first-child{border-top-left-radius:.25rem;border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-xl .list-group-item:last-child{margin-right:0;border-top-right-radius:.25rem;border-bottom-right-radius:.25rem;border-bottom-left-radius:0}}.list-group-flush .list-group-item{border-right:0;border-left:0;border-radius:0}.list-group-flush .list-group-item:last-child{margin-bottom:-1px}.list-group-flush:first-child .list-group-item:first-child{border-top:0}.list-group-flush:last-child .list-group-item:last-child{margin-bottom:0;border-bottom:0}.list-group-item-primary{color:#004085;background-color:#b8daff}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{color:#004085;background-color:#9fcdff}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#004085;border-color:#004085}.list-group-item-secondary{color:#383d41;background-color:#d6d8db}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{color:#383d41;background-color:#c8cbcf}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#383d41;border-color:#383d41}.list-group-item-success{color:#155724;background-color:#c3e6cb}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{color:#155724;background-color:#b1dfbb}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#155724;border-color:#155724}.list-group-item-info{color:#0c5460;background-color:#bee5eb}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{color:#0c5460;background-color:#abdde5}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#0c5460;border-color:#0c5460}.list-group-item-warning{color:#856404;background-color:#ffeeba}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{color:#856404;background-color:#ffe8a1}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#856404;border-color:#856404}.list-group-item-danger{color:#721c24;background-color:#f5c6cb}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{color:#721c24;background-color:#f1b0b7}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#721c24;border-color:#721c24}.list-group-item-light{color:#818182;background-color:#fdfdfe}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{color:#818182;background-color:#ececf6}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#818182;border-color:#818182}.list-group-item-dark{color:#1b1e21;background-color:#c6c8ca}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{color:#1b1e21;background-color:#b9bbbe}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#1b1e21;border-color:#1b1e21}.close{float:right;font-size:1.5rem;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;opacity:.5}.close:hover{color:#000;text-decoration:none}.close:not(:disabled):not(.disabled):focus,.close:not(:disabled):not(.disabled):hover{opacity:.75}button.close{padding:0;background-color:transparent;border:0;-webkit-appearance:none;-moz-appearance:none;appearance:none}a.close.disabled{pointer-events:none}.toast{max-width:350px;overflow:hidden;font-size:.875rem;background-color:rgba(255,255,255,.85);background-clip:padding-box;border:1px solid rgba(0,0,0,.1);box-shadow:0 .25rem .75rem rgba(0,0,0,.1);-webkit-backdrop-filter:blur(10px);backdrop-filter:blur(10px);opacity:0;border-radius:.25rem}.toast:not(:last-child){margin-bottom:.75rem}.toast.showing{opacity:1}.toast.show{display:block;opacity:1}.toast.hide{display:none}.toast-header{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;padding:.25rem .75rem;color:#6c757d;background-color:rgba(255,255,255,.85);background-clip:padding-box;border-bottom:1px solid rgba(0,0,0,.05)}.toast-body{padding:.75rem}.modal-open{overflow:hidden}.modal-open .modal{overflow-x:hidden;overflow-y:auto}.modal{position:fixed;top:0;left:0;z-index:1050;display:none;width:100%;height:100%;overflow:hidden;outline:0}.modal-dialog{position:relative;width:auto;margin:.5rem;pointer-events:none}.modal.fade .modal-dialog{transition:-webkit-transform .3s ease-out;transition:transform .3s ease-out;transition:transform .3s ease-out,-webkit-transform .3s ease-out;-webkit-transform:translate(0,-50px);transform:translate(0,-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{-webkit-transform:none;transform:none}.modal-dialog-scrollable{display:-ms-flexbox;display:flex;max-height:calc(100% - 1rem)}.modal-dialog-scrollable .modal-content{max-height:calc(100vh - 1rem);overflow:hidden}.modal-dialog-scrollable .modal-footer,.modal-dialog-scrollable .modal-header{-ms-flex-negative:0;flex-shrink:0}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;min-height:calc(100% - 1rem)}.modal-dialog-centered::before{display:block;height:calc(100vh - 1rem);content:""}.modal-dialog-centered.modal-dialog-scrollable{-ms-flex-direction:column;flex-direction:column;-ms-flex-pack:center;justify-content:center;height:100%}.modal-dialog-centered.modal-dialog-scrollable .modal-content{max-height:none}.modal-dialog-centered.modal-dialog-scrollable::before{content:none}.modal-content{position:relative;display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;width:100%;pointer-events:auto;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem;outline:0}.modal-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:.5}.modal-header{display:-ms-flexbox;display:flex;-ms-flex-align:start;align-items:flex-start;-ms-flex-pack:justify;justify-content:space-between;padding:1rem 1rem;border-bottom:1px solid #dee2e6;border-top-left-radius:.3rem;border-top-right-radius:.3rem}.modal-header .close{padding:1rem 1rem;margin:-1rem -1rem -1rem auto}.modal-title{margin-bottom:0;line-height:1.5}.modal-body{position:relative;-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem}.modal-footer{display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:end;justify-content:flex-end;padding:1rem;border-top:1px solid #dee2e6;border-bottom-right-radius:.3rem;border-bottom-left-radius:.3rem}.modal-footer>:not(:first-child){margin-left:.25rem}.modal-footer>:not(:last-child){margin-right:.25rem}.modal-scrollbar-measure{position:absolute;top:-9999px;width:50px;height:50px;overflow:scroll}@media (min-width:576px){.modal-dialog{max-width:500px;margin:1.75rem auto}.modal-dialog-scrollable{max-height:calc(100% - 3.5rem)}.modal-dialog-scrollable .modal-content{max-height:calc(100vh - 3.5rem)}.modal-dialog-centered{min-height:calc(100% - 3.5rem)}.modal-dialog-centered::before{height:calc(100vh - 3.5rem)}.modal-sm{max-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{max-width:800px}}@media (min-width:1200px){.modal-xl{max-width:1140px}}.tooltip{position:absolute;z-index:1070;display:block;margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,"Noto Sans",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;opacity:0}.tooltip.show{opacity:.9}.tooltip .arrow{position:absolute;display:block;width:.8rem;height:.4rem}.tooltip .arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[x-placement^=top],.bs-tooltip-top{padding:.4rem 0}.bs-tooltip-auto[x-placement^=top] .arrow,.bs-tooltip-top .arrow{bottom:0}.bs-tooltip-auto[x-placement^=top] .arrow::before,.bs-tooltip-top .arrow::before{top:0;border-width:.4rem .4rem 0;border-top-color:#000}.bs-tooltip-auto[x-placement^=right],.bs-tooltip-right{padding:0 .4rem}.bs-tooltip-auto[x-placement^=right] .arrow,.bs-tooltip-right .arrow{left:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=right] .arrow::before,.bs-tooltip-right .arrow::before{right:0;border-width:.4rem .4rem .4rem 0;border-right-color:#000}.bs-tooltip-auto[x-placement^=bottom],.bs-tooltip-bottom{padding:.4rem 0}.bs-tooltip-auto[x-placement^=bottom] .arrow,.bs-tooltip-bottom .arrow{top:0}.bs-tooltip-auto[x-placement^=bottom] .arrow::before,.bs-tooltip-bottom .arrow::before{bottom:0;border-width:0 .4rem .4rem;border-bottom-color:#000}.bs-tooltip-auto[x-placement^=left],.bs-tooltip-left{padding:0 .4rem}.bs-tooltip-auto[x-placement^=left] .arrow,.bs-tooltip-left .arrow{right:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=left] .arrow::before,.bs-tooltip-left .arrow::before{left:0;border-width:.4rem 0 .4rem .4rem;border-left-color:#000}.tooltip-inner{max-width:200px;padding:.25rem .5rem;color:#fff;text-align:center;background-color:#000;border-radius:.25rem}.popover{position:absolute;top:0;left:0;z-index:1060;display:block;max-width:276px;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,"Noto Sans",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem}.popover .arrow{position:absolute;display:block;width:1rem;height:.5rem;margin:0 .3rem}.popover .arrow::after,.popover .arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid}.bs-popover-auto[x-placement^=top],.bs-popover-top{margin-bottom:.5rem}.bs-popover-auto[x-placement^=top]>.arrow,.bs-popover-top>.arrow{bottom:calc((.5rem + 1px) * -1)}.bs-popover-auto[x-placement^=top]>.arrow::before,.bs-popover-top>.arrow::before{bottom:0;border-width:.5rem .5rem 0;border-top-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=top]>.arrow::after,.bs-popover-top>.arrow::after{bottom:1px;border-width:.5rem .5rem 0;border-top-color:#fff}.bs-popover-auto[x-placement^=right],.bs-popover-right{margin-left:.5rem}.bs-popover-auto[x-placement^=right]>.arrow,.bs-popover-right>.arrow{left:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=right]>.arrow::before,.bs-popover-right>.arrow::before{left:0;border-width:.5rem .5rem .5rem 0;border-right-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=right]>.arrow::after,.bs-popover-right>.arrow::after{left:1px;border-width:.5rem .5rem .5rem 0;border-right-color:#fff}.bs-popover-auto[x-placement^=bottom],.bs-popover-bottom{margin-top:.5rem}.bs-popover-auto[x-placement^=bottom]>.arrow,.bs-popover-bottom>.arrow{top:calc((.5rem + 1px) * -1)}.bs-popover-auto[x-placement^=bottom]>.arrow::before,.bs-popover-bottom>.arrow::before{top:0;border-width:0 .5rem .5rem .5rem;border-bottom-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=bottom]>.arrow::after,.bs-popover-bottom>.arrow::after{top:1px;border-width:0 .5rem .5rem .5rem;border-bottom-color:#fff}.bs-popover-auto[x-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:1rem;margin-left:-.5rem;content:"";border-bottom:1px solid #f7f7f7}.bs-popover-auto[x-placement^=left],.bs-popover-left{margin-right:.5rem}.bs-popover-auto[x-placement^=left]>.arrow,.bs-popover-left>.arrow{right:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=left]>.arrow::before,.bs-popover-left>.arrow::before{right:0;border-width:.5rem 0 .5rem .5rem;border-left-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=left]>.arrow::after,.bs-popover-left>.arrow::after{right:1px;border-width:.5rem 0 .5rem .5rem;border-left-color:#fff}.popover-header{padding:.5rem .75rem;margin-bottom:0;font-size:1rem;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-top-left-radius:calc(.3rem - 1px);border-top-right-radius:calc(.3rem - 1px)}.popover-header:empty{display:none}.popover-body{padding:.5rem .75rem;color:#212529}.carousel{position:relative}.carousel.pointer-event{-ms-touch-action:pan-y;touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition:-webkit-transform .6s ease-in-out;transition:transform .6s ease-in-out;transition:transform .6s ease-in-out,-webkit-transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-right,.carousel-item-next:not(.carousel-item-left){-webkit-transform:translateX(100%);transform:translateX(100%)}.active.carousel-item-left,.carousel-item-prev:not(.carousel-item-right){-webkit-transform:translateX(-100%);transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;-webkit-transform:none;transform:none}.carousel-fade .carousel-item-next.carousel-item-left,.carousel-fade .carousel-item-prev.carousel-item-right,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-right{z-index:0;opacity:0;transition:0s .6s opacity}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-right{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:-ms-flexbox;display:flex;-ms-flex-align:center;align-items:center;-ms-flex-pack:center;justify-content:center;width:15%;color:#fff;text-align:center;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:20px;height:20px;background:no-repeat 50%/100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3e%3cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3e%3cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:15;display:-ms-flexbox;display:flex;-ms-flex-pack:center;justify-content:center;padding-left:0;margin-right:15%;margin-left:15%;list-style:none}.carousel-indicators li{box-sizing:content-box;-ms-flex:0 1 auto;flex:0 1 auto;width:30px;height:3px;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators li{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:20px;left:15%;z-index:10;padding-top:20px;padding-bottom:20px;color:#fff;text-align:center}@-webkit-keyframes spinner-border{to{-webkit-transform:rotate(360deg);transform:rotate(360deg)}}@keyframes spinner-border{to{-webkit-transform:rotate(360deg);transform:rotate(360deg)}}.spinner-border{display:inline-block;width:2rem;height:2rem;vertical-align:text-bottom;border:.25em solid currentColor;border-right-color:transparent;border-radius:50%;-webkit-animation:spinner-border .75s linear infinite;animation:spinner-border .75s linear infinite}.spinner-border-sm{width:1rem;height:1rem;border-width:.2em}@-webkit-keyframes spinner-grow{0%{-webkit-transform:scale(0);transform:scale(0)}50%{opacity:1}}@keyframes spinner-grow{0%{-webkit-transform:scale(0);transform:scale(0)}50%{opacity:1}}.spinner-grow{display:inline-block;width:2rem;height:2rem;vertical-align:text-bottom;background-color:currentColor;border-radius:50%;opacity:0;-webkit-animation:spinner-grow .75s linear infinite;animation:spinner-grow .75s linear infinite}.spinner-grow-sm{width:1rem;height:1rem}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.bg-primary{background-color:#007bff!important}a.bg-primary:focus,a.bg-primary:hover,button.bg-primary:focus,button.bg-primary:hover{background-color:#0062cc!important}.bg-secondary{background-color:#6c757d!important}a.bg-secondary:focus,a.bg-secondary:hover,button.bg-secondary:focus,button.bg-secondary:hover{background-color:#545b62!important}.bg-success{background-color:#28a745!important}a.bg-success:focus,a.bg-success:hover,button.bg-success:focus,button.bg-success:hover{background-color:#1e7e34!important}.bg-info{background-color:#17a2b8!important}a.bg-info:focus,a.bg-info:hover,button.bg-info:focus,button.bg-info:hover{background-color:#117a8b!important}.bg-warning{background-color:#ffc107!important}a.bg-warning:focus,a.bg-warning:hover,button.bg-warning:focus,button.bg-warning:hover{background-color:#d39e00!important}.bg-danger{background-color:#dc3545!important}a.bg-danger:focus,a.bg-danger:hover,button.bg-danger:focus,button.bg-danger:hover{background-color:#bd2130!important}.bg-light{background-color:#f8f9fa!important}a.bg-light:focus,a.bg-light:hover,button.bg-light:focus,button.bg-light:hover{background-color:#dae0e5!important}.bg-dark{background-color:#343a40!important}a.bg-dark:focus,a.bg-dark:hover,button.bg-dark:focus,button.bg-dark:hover{background-color:#1d2124!important}.bg-white{background-color:#fff!important}.bg-transparent{background-color:transparent!important}.border{border:1px solid #dee2e6!important}.border-top{border-top:1px solid #dee2e6!important}.border-right{border-right:1px solid #dee2e6!important}.border-bottom{border-bottom:1px solid #dee2e6!important}.border-left{border-left:1px solid #dee2e6!important}.border-0{border:0!important}.border-top-0{border-top:0!important}.border-right-0{border-right:0!important}.border-bottom-0{border-bottom:0!important}.border-left-0{border-left:0!important}.border-primary{border-color:#007bff!important}.border-secondary{border-color:#6c757d!important}.border-success{border-color:#28a745!important}.border-info{border-color:#17a2b8!important}.border-warning{border-color:#ffc107!important}.border-danger{border-color:#dc3545!important}.border-light{border-color:#f8f9fa!important}.border-dark{border-color:#343a40!important}.border-white{border-color:#fff!important}.rounded-sm{border-radius:.2rem!important}.rounded{border-radius:.25rem!important}.rounded-top{border-top-left-radius:.25rem!important;border-top-right-radius:.25rem!important}.rounded-right{border-top-right-radius:.25rem!important;border-bottom-right-radius:.25rem!important}.rounded-bottom{border-bottom-right-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-left{border-top-left-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-lg{border-radius:.3rem!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:50rem!important}.rounded-0{border-radius:0!important}.clearfix::after{display:block;clear:both;content:""}.d-none{display:none!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:-ms-flexbox!important;display:flex!important}.d-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}@media (min-width:576px){.d-sm-none{display:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:-ms-flexbox!important;display:flex!important}.d-sm-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:768px){.d-md-none{display:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:-ms-flexbox!important;display:flex!important}.d-md-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:992px){.d-lg-none{display:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:-ms-flexbox!important;display:flex!important}.d-lg-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:1200px){.d-xl-none{display:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:-ms-flexbox!important;display:flex!important}.d-xl-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}@media print{.d-print-none{display:none!important}.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:-ms-flexbox!important;display:flex!important}.d-print-inline-flex{display:-ms-inline-flexbox!important;display:inline-flex!important}}.embed-responsive{position:relative;display:block;width:100%;padding:0;overflow:hidden}.embed-responsive::before{display:block;content:""}.embed-responsive .embed-responsive-item,.embed-responsive embed,.embed-responsive iframe,.embed-responsive object,.embed-responsive video{position:absolute;top:0;bottom:0;left:0;width:100%;height:100%;border:0}.embed-responsive-21by9::before{padding-top:42.857143%}.embed-responsive-16by9::before{padding-top:56.25%}.embed-responsive-4by3::before{padding-top:75%}.embed-responsive-1by1::before{padding-top:100%}.flex-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-center{-ms-flex-align:center!important;align-items:center!important}.align-items-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}@media (min-width:576px){.flex-sm-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-sm-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-sm-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-sm-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-sm-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-sm-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-sm-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-sm-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-sm-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-sm-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-sm-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-sm-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-sm-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-sm-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-sm-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-sm-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-sm-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-sm-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-sm-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-sm-center{-ms-flex-align:center!important;align-items:center!important}.align-items-sm-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-sm-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-sm-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-sm-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-sm-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-sm-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-sm-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-sm-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-sm-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-sm-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-sm-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-sm-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-sm-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-sm-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:768px){.flex-md-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-md-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-md-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-md-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-md-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-md-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-md-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-md-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-md-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-md-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-md-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-md-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-md-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-md-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-md-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-md-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-md-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-md-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-md-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-md-center{-ms-flex-align:center!important;align-items:center!important}.align-items-md-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-md-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-md-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-md-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-md-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-md-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-md-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-md-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-md-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-md-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-md-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-md-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-md-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-md-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:992px){.flex-lg-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-lg-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-lg-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-lg-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-lg-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-lg-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-lg-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-lg-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-lg-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-lg-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-lg-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-lg-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-lg-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-lg-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-lg-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-lg-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-lg-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-lg-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-lg-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-lg-center{-ms-flex-align:center!important;align-items:center!important}.align-items-lg-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-lg-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-lg-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-lg-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-lg-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-lg-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-lg-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-lg-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-lg-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-lg-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-lg-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-lg-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-lg-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-lg-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:1200px){.flex-xl-row{-ms-flex-direction:row!important;flex-direction:row!important}.flex-xl-column{-ms-flex-direction:column!important;flex-direction:column!important}.flex-xl-row-reverse{-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-xl-column-reverse{-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-xl-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-xl-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-xl-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-xl-fill{-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-xl-grow-0{-ms-flex-positive:0!important;flex-grow:0!important}.flex-xl-grow-1{-ms-flex-positive:1!important;flex-grow:1!important}.flex-xl-shrink-0{-ms-flex-negative:0!important;flex-shrink:0!important}.flex-xl-shrink-1{-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-xl-start{-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-xl-end{-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-xl-center{-ms-flex-pack:center!important;justify-content:center!important}.justify-content-xl-between{-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-xl-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-xl-start{-ms-flex-align:start!important;align-items:flex-start!important}.align-items-xl-end{-ms-flex-align:end!important;align-items:flex-end!important}.align-items-xl-center{-ms-flex-align:center!important;align-items:center!important}.align-items-xl-baseline{-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-xl-stretch{-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-xl-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-xl-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-xl-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-xl-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-xl-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-xl-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-xl-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-xl-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-xl-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-xl-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-xl-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-xl-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}.float-left{float:left!important}.float-right{float:right!important}.float-none{float:none!important}@media (min-width:576px){.float-sm-left{float:left!important}.float-sm-right{float:right!important}.float-sm-none{float:none!important}}@media (min-width:768px){.float-md-left{float:left!important}.float-md-right{float:right!important}.float-md-none{float:none!important}}@media (min-width:992px){.float-lg-left{float:left!important}.float-lg-right{float:right!important}.float-lg-none{float:none!important}}@media (min-width:1200px){.float-xl-left{float:left!important}.float-xl-right{float:right!important}.float-xl-none{float:none!important}}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}@supports ((position:-webkit-sticky) or (position:sticky)){.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}}.sr-only{position:absolute;width:1px;height:1px;padding:0;overflow:hidden;clip:rect(0,0,0,0);white-space:nowrap;border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;overflow:visible;clip:auto;white-space:normal}.shadow-sm{box-shadow:0 .125rem .25rem rgba(0,0,0,.075)!important}.shadow{box-shadow:0 .5rem 1rem rgba(0,0,0,.15)!important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,.175)!important}.shadow-none{box-shadow:none!important}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mw-100{max-width:100%!important}.mh-100{max-height:100%!important}.min-vw-100{min-width:100vw!important}.min-vh-100{min-height:100vh!important}.vw-100{width:100vw!important}.vh-100{height:100vh!important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;pointer-events:auto;content:"";background-color:rgba(0,0,0,0)}.m-0{margin:0!important}.mt-0,.my-0{margin-top:0!important}.mr-0,.mx-0{margin-right:0!important}.mb-0,.my-0{margin-bottom:0!important}.ml-0,.mx-0{margin-left:0!important}.m-1{margin:.25rem!important}.mt-1,.my-1{margin-top:.25rem!important}.mr-1,.mx-1{margin-right:.25rem!important}.mb-1,.my-1{margin-bottom:.25rem!important}.ml-1,.mx-1{margin-left:.25rem!important}.m-2{margin:.5rem!important}.mt-2,.my-2{margin-top:.5rem!important}.mr-2,.mx-2{margin-right:.5rem!important}.mb-2,.my-2{margin-bottom:.5rem!important}.ml-2,.mx-2{margin-left:.5rem!important}.m-3{margin:1rem!important}.mt-3,.my-3{margin-top:1rem!important}.mr-3,.mx-3{margin-right:1rem!important}.mb-3,.my-3{margin-bottom:1rem!important}.ml-3,.mx-3{margin-left:1rem!important}.m-4{margin:1.5rem!important}.mt-4,.my-4{margin-top:1.5rem!important}.mr-4,.mx-4{margin-right:1.5rem!important}.mb-4,.my-4{margin-bottom:1.5rem!important}.ml-4,.mx-4{margin-left:1.5rem!important}.m-5{margin:3rem!important}.mt-5,.my-5{margin-top:3rem!important}.mr-5,.mx-5{margin-right:3rem!important}.mb-5,.my-5{margin-bottom:3rem!important}.ml-5,.mx-5{margin-left:3rem!important}.p-0{padding:0!important}.pt-0,.py-0{padding-top:0!important}.pr-0,.px-0{padding-right:0!important}.pb-0,.py-0{padding-bottom:0!important}.pl-0,.px-0{padding-left:0!important}.p-1{padding:.25rem!important}.pt-1,.py-1{padding-top:.25rem!important}.pr-1,.px-1{padding-right:.25rem!important}.pb-1,.py-1{padding-bottom:.25rem!important}.pl-1,.px-1{padding-left:.25rem!important}.p-2{padding:.5rem!important}.pt-2,.py-2{padding-top:.5rem!important}.pr-2,.px-2{padding-right:.5rem!important}.pb-2,.py-2{padding-bottom:.5rem!important}.pl-2,.px-2{padding-left:.5rem!important}.p-3{padding:1rem!important}.pt-3,.py-3{padding-top:1rem!important}.pr-3,.px-3{padding-right:1rem!important}.pb-3,.py-3{padding-bottom:1rem!important}.pl-3,.px-3{padding-left:1rem!important}.p-4{padding:1.5rem!important}.pt-4,.py-4{padding-top:1.5rem!important}.pr-4,.px-4{padding-right:1.5rem!important}.pb-4,.py-4{padding-bottom:1.5rem!important}.pl-4,.px-4{padding-left:1.5rem!important}.p-5{padding:3rem!important}.pt-5,.py-5{padding-top:3rem!important}.pr-5,.px-5{padding-right:3rem!important}.pb-5,.py-5{padding-bottom:3rem!important}.pl-5,.px-5{padding-left:3rem!important}.m-n1{margin:-.25rem!important}.mt-n1,.my-n1{margin-top:-.25rem!important}.mr-n1,.mx-n1{margin-right:-.25rem!important}.mb-n1,.my-n1{margin-bottom:-.25rem!important}.ml-n1,.mx-n1{margin-left:-.25rem!important}.m-n2{margin:-.5rem!important}.mt-n2,.my-n2{margin-top:-.5rem!important}.mr-n2,.mx-n2{margin-right:-.5rem!important}.mb-n2,.my-n2{margin-bottom:-.5rem!important}.ml-n2,.mx-n2{margin-left:-.5rem!important}.m-n3{margin:-1rem!important}.mt-n3,.my-n3{margin-top:-1rem!important}.mr-n3,.mx-n3{margin-right:-1rem!important}.mb-n3,.my-n3{margin-bottom:-1rem!important}.ml-n3,.mx-n3{margin-left:-1rem!important}.m-n4{margin:-1.5rem!important}.mt-n4,.my-n4{margin-top:-1.5rem!important}.mr-n4,.mx-n4{margin-right:-1.5rem!important}.mb-n4,.my-n4{margin-bottom:-1.5rem!important}.ml-n4,.mx-n4{margin-left:-1.5rem!important}.m-n5{margin:-3rem!important}.mt-n5,.my-n5{margin-top:-3rem!important}.mr-n5,.mx-n5{margin-right:-3rem!important}.mb-n5,.my-n5{margin-bottom:-3rem!important}.ml-n5,.mx-n5{margin-left:-3rem!important}.m-auto{margin:auto!important}.mt-auto,.my-auto{margin-top:auto!important}.mr-auto,.mx-auto{margin-right:auto!important}.mb-auto,.my-auto{margin-bottom:auto!important}.ml-auto,.mx-auto{margin-left:auto!important}@media (min-width:576px){.m-sm-0{margin:0!important}.mt-sm-0,.my-sm-0{margin-top:0!important}.mr-sm-0,.mx-sm-0{margin-right:0!important}.mb-sm-0,.my-sm-0{margin-bottom:0!important}.ml-sm-0,.mx-sm-0{margin-left:0!important}.m-sm-1{margin:.25rem!important}.mt-sm-1,.my-sm-1{margin-top:.25rem!important}.mr-sm-1,.mx-sm-1{margin-right:.25rem!important}.mb-sm-1,.my-sm-1{margin-bottom:.25rem!important}.ml-sm-1,.mx-sm-1{margin-left:.25rem!important}.m-sm-2{margin:.5rem!important}.mt-sm-2,.my-sm-2{margin-top:.5rem!important}.mr-sm-2,.mx-sm-2{margin-right:.5rem!important}.mb-sm-2,.my-sm-2{margin-bottom:.5rem!important}.ml-sm-2,.mx-sm-2{margin-left:.5rem!important}.m-sm-3{margin:1rem!important}.mt-sm-3,.my-sm-3{margin-top:1rem!important}.mr-sm-3,.mx-sm-3{margin-right:1rem!important}.mb-sm-3,.my-sm-3{margin-bottom:1rem!important}.ml-sm-3,.mx-sm-3{margin-left:1rem!important}.m-sm-4{margin:1.5rem!important}.mt-sm-4,.my-sm-4{margin-top:1.5rem!important}.mr-sm-4,.mx-sm-4{margin-right:1.5rem!important}.mb-sm-4,.my-sm-4{margin-bottom:1.5rem!important}.ml-sm-4,.mx-sm-4{margin-left:1.5rem!important}.m-sm-5{margin:3rem!important}.mt-sm-5,.my-sm-5{margin-top:3rem!important}.mr-sm-5,.mx-sm-5{margin-right:3rem!important}.mb-sm-5,.my-sm-5{margin-bottom:3rem!important}.ml-sm-5,.mx-sm-5{margin-left:3rem!important}.p-sm-0{padding:0!important}.pt-sm-0,.py-sm-0{padding-top:0!important}.pr-sm-0,.px-sm-0{padding-right:0!important}.pb-sm-0,.py-sm-0{padding-bottom:0!important}.pl-sm-0,.px-sm-0{padding-left:0!important}.p-sm-1{padding:.25rem!important}.pt-sm-1,.py-sm-1{padding-top:.25rem!important}.pr-sm-1,.px-sm-1{padding-right:.25rem!important}.pb-sm-1,.py-sm-1{padding-bottom:.25rem!important}.pl-sm-1,.px-sm-1{padding-left:.25rem!important}.p-sm-2{padding:.5rem!important}.pt-sm-2,.py-sm-2{padding-top:.5rem!important}.pr-sm-2,.px-sm-2{padding-right:.5rem!important}.pb-sm-2,.py-sm-2{padding-bottom:.5rem!important}.pl-sm-2,.px-sm-2{padding-left:.5rem!important}.p-sm-3{padding:1rem!important}.pt-sm-3,.py-sm-3{padding-top:1rem!important}.pr-sm-3,.px-sm-3{padding-right:1rem!important}.pb-sm-3,.py-sm-3{padding-bottom:1rem!important}.pl-sm-3,.px-sm-3{padding-left:1rem!important}.p-sm-4{padding:1.5rem!important}.pt-sm-4,.py-sm-4{padding-top:1.5rem!important}.pr-sm-4,.px-sm-4{padding-right:1.5rem!important}.pb-sm-4,.py-sm-4{padding-bottom:1.5rem!important}.pl-sm-4,.px-sm-4{padding-left:1.5rem!important}.p-sm-5{padding:3rem!important}.pt-sm-5,.py-sm-5{padding-top:3rem!important}.pr-sm-5,.px-sm-5{padding-right:3rem!important}.pb-sm-5,.py-sm-5{padding-bottom:3rem!important}.pl-sm-5,.px-sm-5{padding-left:3rem!important}.m-sm-n1{margin:-.25rem!important}.mt-sm-n1,.my-sm-n1{margin-top:-.25rem!important}.mr-sm-n1,.mx-sm-n1{margin-right:-.25rem!important}.mb-sm-n1,.my-sm-n1{margin-bottom:-.25rem!important}.ml-sm-n1,.mx-sm-n1{margin-left:-.25rem!important}.m-sm-n2{margin:-.5rem!important}.mt-sm-n2,.my-sm-n2{margin-top:-.5rem!important}.mr-sm-n2,.mx-sm-n2{margin-right:-.5rem!important}.mb-sm-n2,.my-sm-n2{margin-bottom:-.5rem!important}.ml-sm-n2,.mx-sm-n2{margin-left:-.5rem!important}.m-sm-n3{margin:-1rem!important}.mt-sm-n3,.my-sm-n3{margin-top:-1rem!important}.mr-sm-n3,.mx-sm-n3{margin-right:-1rem!important}.mb-sm-n3,.my-sm-n3{margin-bottom:-1rem!important}.ml-sm-n3,.mx-sm-n3{margin-left:-1rem!important}.m-sm-n4{margin:-1.5rem!important}.mt-sm-n4,.my-sm-n4{margin-top:-1.5rem!important}.mr-sm-n4,.mx-sm-n4{margin-right:-1.5rem!important}.mb-sm-n4,.my-sm-n4{margin-bottom:-1.5rem!important}.ml-sm-n4,.mx-sm-n4{margin-left:-1.5rem!important}.m-sm-n5{margin:-3rem!important}.mt-sm-n5,.my-sm-n5{margin-top:-3rem!important}.mr-sm-n5,.mx-sm-n5{margin-right:-3rem!important}.mb-sm-n5,.my-sm-n5{margin-bottom:-3rem!important}.ml-sm-n5,.mx-sm-n5{margin-left:-3rem!important}.m-sm-auto{margin:auto!important}.mt-sm-auto,.my-sm-auto{margin-top:auto!important}.mr-sm-auto,.mx-sm-auto{margin-right:auto!important}.mb-sm-auto,.my-sm-auto{margin-bottom:auto!important}.ml-sm-auto,.mx-sm-auto{margin-left:auto!important}}@media (min-width:768px){.m-md-0{margin:0!important}.mt-md-0,.my-md-0{margin-top:0!important}.mr-md-0,.mx-md-0{margin-right:0!important}.mb-md-0,.my-md-0{margin-bottom:0!important}.ml-md-0,.mx-md-0{margin-left:0!important}.m-md-1{margin:.25rem!important}.mt-md-1,.my-md-1{margin-top:.25rem!important}.mr-md-1,.mx-md-1{margin-right:.25rem!important}.mb-md-1,.my-md-1{margin-bottom:.25rem!important}.ml-md-1,.mx-md-1{margin-left:.25rem!important}.m-md-2{margin:.5rem!important}.mt-md-2,.my-md-2{margin-top:.5rem!important}.mr-md-2,.mx-md-2{margin-right:.5rem!important}.mb-md-2,.my-md-2{margin-bottom:.5rem!important}.ml-md-2,.mx-md-2{margin-left:.5rem!important}.m-md-3{margin:1rem!important}.mt-md-3,.my-md-3{margin-top:1rem!important}.mr-md-3,.mx-md-3{margin-right:1rem!important}.mb-md-3,.my-md-3{margin-bottom:1rem!important}.ml-md-3,.mx-md-3{margin-left:1rem!important}.m-md-4{margin:1.5rem!important}.mt-md-4,.my-md-4{margin-top:1.5rem!important}.mr-md-4,.mx-md-4{margin-right:1.5rem!important}.mb-md-4,.my-md-4{margin-bottom:1.5rem!important}.ml-md-4,.mx-md-4{margin-left:1.5rem!important}.m-md-5{margin:3rem!important}.mt-md-5,.my-md-5{margin-top:3rem!important}.mr-md-5,.mx-md-5{margin-right:3rem!important}.mb-md-5,.my-md-5{margin-bottom:3rem!important}.ml-md-5,.mx-md-5{margin-left:3rem!important}.p-md-0{padding:0!important}.pt-md-0,.py-md-0{padding-top:0!important}.pr-md-0,.px-md-0{padding-right:0!important}.pb-md-0,.py-md-0{padding-bottom:0!important}.pl-md-0,.px-md-0{padding-left:0!important}.p-md-1{padding:.25rem!important}.pt-md-1,.py-md-1{padding-top:.25rem!important}.pr-md-1,.px-md-1{padding-right:.25rem!important}.pb-md-1,.py-md-1{padding-bottom:.25rem!important}.pl-md-1,.px-md-1{padding-left:.25rem!important}.p-md-2{padding:.5rem!important}.pt-md-2,.py-md-2{padding-top:.5rem!important}.pr-md-2,.px-md-2{padding-right:.5rem!important}.pb-md-2,.py-md-2{padding-bottom:.5rem!important}.pl-md-2,.px-md-2{padding-left:.5rem!important}.p-md-3{padding:1rem!important}.pt-md-3,.py-md-3{padding-top:1rem!important}.pr-md-3,.px-md-3{padding-right:1rem!important}.pb-md-3,.py-md-3{padding-bottom:1rem!important}.pl-md-3,.px-md-3{padding-left:1rem!important}.p-md-4{padding:1.5rem!important}.pt-md-4,.py-md-4{padding-top:1.5rem!important}.pr-md-4,.px-md-4{padding-right:1.5rem!important}.pb-md-4,.py-md-4{padding-bottom:1.5rem!important}.pl-md-4,.px-md-4{padding-left:1.5rem!important}.p-md-5{padding:3rem!important}.pt-md-5,.py-md-5{padding-top:3rem!important}.pr-md-5,.px-md-5{padding-right:3rem!important}.pb-md-5,.py-md-5{padding-bottom:3rem!important}.pl-md-5,.px-md-5{padding-left:3rem!important}.m-md-n1{margin:-.25rem!important}.mt-md-n1,.my-md-n1{margin-top:-.25rem!important}.mr-md-n1,.mx-md-n1{margin-right:-.25rem!important}.mb-md-n1,.my-md-n1{margin-bottom:-.25rem!important}.ml-md-n1,.mx-md-n1{margin-left:-.25rem!important}.m-md-n2{margin:-.5rem!important}.mt-md-n2,.my-md-n2{margin-top:-.5rem!important}.mr-md-n2,.mx-md-n2{margin-right:-.5rem!important}.mb-md-n2,.my-md-n2{margin-bottom:-.5rem!important}.ml-md-n2,.mx-md-n2{margin-left:-.5rem!important}.m-md-n3{margin:-1rem!important}.mt-md-n3,.my-md-n3{margin-top:-1rem!important}.mr-md-n3,.mx-md-n3{margin-right:-1rem!important}.mb-md-n3,.my-md-n3{margin-bottom:-1rem!important}.ml-md-n3,.mx-md-n3{margin-left:-1rem!important}.m-md-n4{margin:-1.5rem!important}.mt-md-n4,.my-md-n4{margin-top:-1.5rem!important}.mr-md-n4,.mx-md-n4{margin-right:-1.5rem!important}.mb-md-n4,.my-md-n4{margin-bottom:-1.5rem!important}.ml-md-n4,.mx-md-n4{margin-left:-1.5rem!important}.m-md-n5{margin:-3rem!important}.mt-md-n5,.my-md-n5{margin-top:-3rem!important}.mr-md-n5,.mx-md-n5{margin-right:-3rem!important}.mb-md-n5,.my-md-n5{margin-bottom:-3rem!important}.ml-md-n5,.mx-md-n5{margin-left:-3rem!important}.m-md-auto{margin:auto!important}.mt-md-auto,.my-md-auto{margin-top:auto!important}.mr-md-auto,.mx-md-auto{margin-right:auto!important}.mb-md-auto,.my-md-auto{margin-bottom:auto!important}.ml-md-auto,.mx-md-auto{margin-left:auto!important}}@media (min-width:992px){.m-lg-0{margin:0!important}.mt-lg-0,.my-lg-0{margin-top:0!important}.mr-lg-0,.mx-lg-0{margin-right:0!important}.mb-lg-0,.my-lg-0{margin-bottom:0!important}.ml-lg-0,.mx-lg-0{margin-left:0!important}.m-lg-1{margin:.25rem!important}.mt-lg-1,.my-lg-1{margin-top:.25rem!important}.mr-lg-1,.mx-lg-1{margin-right:.25rem!important}.mb-lg-1,.my-lg-1{margin-bottom:.25rem!important}.ml-lg-1,.mx-lg-1{margin-left:.25rem!important}.m-lg-2{margin:.5rem!important}.mt-lg-2,.my-lg-2{margin-top:.5rem!important}.mr-lg-2,.mx-lg-2{margin-right:.5rem!important}.mb-lg-2,.my-lg-2{margin-bottom:.5rem!important}.ml-lg-2,.mx-lg-2{margin-left:.5rem!important}.m-lg-3{margin:1rem!important}.mt-lg-3,.my-lg-3{margin-top:1rem!important}.mr-lg-3,.mx-lg-3{margin-right:1rem!important}.mb-lg-3,.my-lg-3{margin-bottom:1rem!important}.ml-lg-3,.mx-lg-3{margin-left:1rem!important}.m-lg-4{margin:1.5rem!important}.mt-lg-4,.my-lg-4{margin-top:1.5rem!important}.mr-lg-4,.mx-lg-4{margin-right:1.5rem!important}.mb-lg-4,.my-lg-4{margin-bottom:1.5rem!important}.ml-lg-4,.mx-lg-4{margin-left:1.5rem!important}.m-lg-5{margin:3rem!important}.mt-lg-5,.my-lg-5{margin-top:3rem!important}.mr-lg-5,.mx-lg-5{margin-right:3rem!important}.mb-lg-5,.my-lg-5{margin-bottom:3rem!important}.ml-lg-5,.mx-lg-5{margin-left:3rem!important}.p-lg-0{padding:0!important}.pt-lg-0,.py-lg-0{padding-top:0!important}.pr-lg-0,.px-lg-0{padding-right:0!important}.pb-lg-0,.py-lg-0{padding-bottom:0!important}.pl-lg-0,.px-lg-0{padding-left:0!important}.p-lg-1{padding:.25rem!important}.pt-lg-1,.py-lg-1{padding-top:.25rem!important}.pr-lg-1,.px-lg-1{padding-right:.25rem!important}.pb-lg-1,.py-lg-1{padding-bottom:.25rem!important}.pl-lg-1,.px-lg-1{padding-left:.25rem!important}.p-lg-2{padding:.5rem!important}.pt-lg-2,.py-lg-2{padding-top:.5rem!important}.pr-lg-2,.px-lg-2{padding-right:.5rem!important}.pb-lg-2,.py-lg-2{padding-bottom:.5rem!important}.pl-lg-2,.px-lg-2{padding-left:.5rem!important}.p-lg-3{padding:1rem!important}.pt-lg-3,.py-lg-3{padding-top:1rem!important}.pr-lg-3,.px-lg-3{padding-right:1rem!important}.pb-lg-3,.py-lg-3{padding-bottom:1rem!important}.pl-lg-3,.px-lg-3{padding-left:1rem!important}.p-lg-4{padding:1.5rem!important}.pt-lg-4,.py-lg-4{padding-top:1.5rem!important}.pr-lg-4,.px-lg-4{padding-right:1.5rem!important}.pb-lg-4,.py-lg-4{padding-bottom:1.5rem!important}.pl-lg-4,.px-lg-4{padding-left:1.5rem!important}.p-lg-5{padding:3rem!important}.pt-lg-5,.py-lg-5{padding-top:3rem!important}.pr-lg-5,.px-lg-5{padding-right:3rem!important}.pb-lg-5,.py-lg-5{padding-bottom:3rem!important}.pl-lg-5,.px-lg-5{padding-left:3rem!important}.m-lg-n1{margin:-.25rem!important}.mt-lg-n1,.my-lg-n1{margin-top:-.25rem!important}.mr-lg-n1,.mx-lg-n1{margin-right:-.25rem!important}.mb-lg-n1,.my-lg-n1{margin-bottom:-.25rem!important}.ml-lg-n1,.mx-lg-n1{margin-left:-.25rem!important}.m-lg-n2{margin:-.5rem!important}.mt-lg-n2,.my-lg-n2{margin-top:-.5rem!important}.mr-lg-n2,.mx-lg-n2{margin-right:-.5rem!important}.mb-lg-n2,.my-lg-n2{margin-bottom:-.5rem!important}.ml-lg-n2,.mx-lg-n2{margin-left:-.5rem!important}.m-lg-n3{margin:-1rem!important}.mt-lg-n3,.my-lg-n3{margin-top:-1rem!important}.mr-lg-n3,.mx-lg-n3{margin-right:-1rem!important}.mb-lg-n3,.my-lg-n3{margin-bottom:-1rem!important}.ml-lg-n3,.mx-lg-n3{margin-left:-1rem!important}.m-lg-n4{margin:-1.5rem!important}.mt-lg-n4,.my-lg-n4{margin-top:-1.5rem!important}.mr-lg-n4,.mx-lg-n4{margin-right:-1.5rem!important}.mb-lg-n4,.my-lg-n4{margin-bottom:-1.5rem!important}.ml-lg-n4,.mx-lg-n4{margin-left:-1.5rem!important}.m-lg-n5{margin:-3rem!important}.mt-lg-n5,.my-lg-n5{margin-top:-3rem!important}.mr-lg-n5,.mx-lg-n5{margin-right:-3rem!important}.mb-lg-n5,.my-lg-n5{margin-bottom:-3rem!important}.ml-lg-n5,.mx-lg-n5{margin-left:-3rem!important}.m-lg-auto{margin:auto!important}.mt-lg-auto,.my-lg-auto{margin-top:auto!important}.mr-lg-auto,.mx-lg-auto{margin-right:auto!important}.mb-lg-auto,.my-lg-auto{margin-bottom:auto!important}.ml-lg-auto,.mx-lg-auto{margin-left:auto!important}}@media (min-width:1200px){.m-xl-0{margin:0!important}.mt-xl-0,.my-xl-0{margin-top:0!important}.mr-xl-0,.mx-xl-0{margin-right:0!important}.mb-xl-0,.my-xl-0{margin-bottom:0!important}.ml-xl-0,.mx-xl-0{margin-left:0!important}.m-xl-1{margin:.25rem!important}.mt-xl-1,.my-xl-1{margin-top:.25rem!important}.mr-xl-1,.mx-xl-1{margin-right:.25rem!important}.mb-xl-1,.my-xl-1{margin-bottom:.25rem!important}.ml-xl-1,.mx-xl-1{margin-left:.25rem!important}.m-xl-2{margin:.5rem!important}.mt-xl-2,.my-xl-2{margin-top:.5rem!important}.mr-xl-2,.mx-xl-2{margin-right:.5rem!important}.mb-xl-2,.my-xl-2{margin-bottom:.5rem!important}.ml-xl-2,.mx-xl-2{margin-left:.5rem!important}.m-xl-3{margin:1rem!important}.mt-xl-3,.my-xl-3{margin-top:1rem!important}.mr-xl-3,.mx-xl-3{margin-right:1rem!important}.mb-xl-3,.my-xl-3{margin-bottom:1rem!important}.ml-xl-3,.mx-xl-3{margin-left:1rem!important}.m-xl-4{margin:1.5rem!important}.mt-xl-4,.my-xl-4{margin-top:1.5rem!important}.mr-xl-4,.mx-xl-4{margin-right:1.5rem!important}.mb-xl-4,.my-xl-4{margin-bottom:1.5rem!important}.ml-xl-4,.mx-xl-4{margin-left:1.5rem!important}.m-xl-5{margin:3rem!important}.mt-xl-5,.my-xl-5{margin-top:3rem!important}.mr-xl-5,.mx-xl-5{margin-right:3rem!important}.mb-xl-5,.my-xl-5{margin-bottom:3rem!important}.ml-xl-5,.mx-xl-5{margin-left:3rem!important}.p-xl-0{padding:0!important}.pt-xl-0,.py-xl-0{padding-top:0!important}.pr-xl-0,.px-xl-0{padding-right:0!important}.pb-xl-0,.py-xl-0{padding-bottom:0!important}.pl-xl-0,.px-xl-0{padding-left:0!important}.p-xl-1{padding:.25rem!important}.pt-xl-1,.py-xl-1{padding-top:.25rem!important}.pr-xl-1,.px-xl-1{padding-right:.25rem!important}.pb-xl-1,.py-xl-1{padding-bottom:.25rem!important}.pl-xl-1,.px-xl-1{padding-left:.25rem!important}.p-xl-2{padding:.5rem!important}.pt-xl-2,.py-xl-2{padding-top:.5rem!important}.pr-xl-2,.px-xl-2{padding-right:.5rem!important}.pb-xl-2,.py-xl-2{padding-bottom:.5rem!important}.pl-xl-2,.px-xl-2{padding-left:.5rem!important}.p-xl-3{padding:1rem!important}.pt-xl-3,.py-xl-3{padding-top:1rem!important}.pr-xl-3,.px-xl-3{padding-right:1rem!important}.pb-xl-3,.py-xl-3{padding-bottom:1rem!important}.pl-xl-3,.px-xl-3{padding-left:1rem!important}.p-xl-4{padding:1.5rem!important}.pt-xl-4,.py-xl-4{padding-top:1.5rem!important}.pr-xl-4,.px-xl-4{padding-right:1.5rem!important}.pb-xl-4,.py-xl-4{padding-bottom:1.5rem!important}.pl-xl-4,.px-xl-4{padding-left:1.5rem!important}.p-xl-5{padding:3rem!important}.pt-xl-5,.py-xl-5{padding-top:3rem!important}.pr-xl-5,.px-xl-5{padding-right:3rem!important}.pb-xl-5,.py-xl-5{padding-bottom:3rem!important}.pl-xl-5,.px-xl-5{padding-left:3rem!important}.m-xl-n1{margin:-.25rem!important}.mt-xl-n1,.my-xl-n1{margin-top:-.25rem!important}.mr-xl-n1,.mx-xl-n1{margin-right:-.25rem!important}.mb-xl-n1,.my-xl-n1{margin-bottom:-.25rem!important}.ml-xl-n1,.mx-xl-n1{margin-left:-.25rem!important}.m-xl-n2{margin:-.5rem!important}.mt-xl-n2,.my-xl-n2{margin-top:-.5rem!important}.mr-xl-n2,.mx-xl-n2{margin-right:-.5rem!important}.mb-xl-n2,.my-xl-n2{margin-bottom:-.5rem!important}.ml-xl-n2,.mx-xl-n2{margin-left:-.5rem!important}.m-xl-n3{margin:-1rem!important}.mt-xl-n3,.my-xl-n3{margin-top:-1rem!important}.mr-xl-n3,.mx-xl-n3{margin-right:-1rem!important}.mb-xl-n3,.my-xl-n3{margin-bottom:-1rem!important}.ml-xl-n3,.mx-xl-n3{margin-left:-1rem!important}.m-xl-n4{margin:-1.5rem!important}.mt-xl-n4,.my-xl-n4{margin-top:-1.5rem!important}.mr-xl-n4,.mx-xl-n4{margin-right:-1.5rem!important}.mb-xl-n4,.my-xl-n4{margin-bottom:-1.5rem!important}.ml-xl-n4,.mx-xl-n4{margin-left:-1.5rem!important}.m-xl-n5{margin:-3rem!important}.mt-xl-n5,.my-xl-n5{margin-top:-3rem!important}.mr-xl-n5,.mx-xl-n5{margin-right:-3rem!important}.mb-xl-n5,.my-xl-n5{margin-bottom:-3rem!important}.ml-xl-n5,.mx-xl-n5{margin-left:-3rem!important}.m-xl-auto{margin:auto!important}.mt-xl-auto,.my-xl-auto{margin-top:auto!important}.mr-xl-auto,.mx-xl-auto{margin-right:auto!important}.mb-xl-auto,.my-xl-auto{margin-bottom:auto!important}.ml-xl-auto,.mx-xl-auto{margin-left:auto!important}}.text-monospace{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace!important}.text-justify{text-align:justify!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.text-left{text-align:left!important}.text-right{text-align:right!important}.text-center{text-align:center!important}@media (min-width:576px){.text-sm-left{text-align:left!important}.text-sm-right{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.text-md-left{text-align:left!important}.text-md-right{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.text-lg-left{text-align:left!important}.text-lg-right{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.text-xl-left{text-align:left!important}.text-xl-right{text-align:right!important}.text-xl-center{text-align:center!important}}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.font-weight-light{font-weight:300!important}.font-weight-lighter{font-weight:lighter!important}.font-weight-normal{font-weight:400!important}.font-weight-bold{font-weight:700!important}.font-weight-bolder{font-weight:bolder!important}.font-italic{font-style:italic!important}.text-white{color:#fff!important}.text-primary{color:#007bff!important}a.text-primary:focus,a.text-primary:hover{color:#0056b3!important}.text-secondary{color:#6c757d!important}a.text-secondary:focus,a.text-secondary:hover{color:#494f54!important}.text-success{color:#28a745!important}a.text-success:focus,a.text-success:hover{color:#19692c!important}.text-info{color:#17a2b8!important}a.text-info:focus,a.text-info:hover{color:#0f6674!important}.text-warning{color:#ffc107!important}a.text-warning:focus,a.text-warning:hover{color:#ba8b00!important}.text-danger{color:#dc3545!important}a.text-danger:focus,a.text-danger:hover{color:#a71d2a!important}.text-light{color:#f8f9fa!important}a.text-light:focus,a.text-light:hover{color:#cbd3da!important}.text-dark{color:#343a40!important}a.text-dark:focus,a.text-dark:hover{color:#121416!important}.text-body{color:#212529!important}.text-muted{color:#6c757d!important}.text-black-50{color:rgba(0,0,0,.5)!important}.text-white-50{color:rgba(255,255,255,.5)!important}.text-hide{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.text-decoration-none{text-decoration:none!important}.text-break{word-break:break-word!important;overflow-wrap:break-word!important}.text-reset{color:inherit!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media print{*,::after,::before{text-shadow:none!important;box-shadow:none!important}a:not(.btn){text-decoration:underline}abbr[title]::after{content:" (" attr(title) ")"}pre{white-space:pre-wrap!important}blockquote,pre{border:1px solid #adb5bd;page-break-inside:avoid}thead{display:table-header-group}img,tr{page-break-inside:avoid}h2,h3,p{orphans:3;widows:3}h2,h3{page-break-after:avoid}@page{size:a3}body{min-width:992px!important}.container{min-width:992px!important}.navbar{display:none}.badge{border:1px solid #000}.table{border-collapse:collapse!important}.table td,.table th{background-color:#fff!important}.table-bordered td,.table-bordered th{border:1px solid #dee2e6!important}.table-dark{color:inherit}.table-dark tbody+tbody,.table-dark td,.table-dark th,.table-dark thead th{border-color:#dee2e6}.table .thead-dark th{color:inherit;border-color:#dee2e6}}
|
| 7 |
-
/*# sourceMappingURL=bootstrap.min.css.map */
|
| 3 |
* Copyright 2011-2019 The Bootstrap Authors
|
| 4 |
* Copyright 2011-2019 Twitter, Inc.
|
| 5 |
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
| 6 |
+
*/:root{--blue:#007bff;--indigo:#6610f2;--purple:#6f42c1;--pink:#e83e8c;--red:#dc3545;--orange:#fd7e14;--yellow:#ffc107;--green:#28a745;--teal:#20c997;--cyan:#17a2b8;--white:#fff;--gray:#6c757d;--gray-dark:#343a40;--primary:#007bff;--secondary:#6c757d;--success:#28a745;--info:#17a2b8;--warning:#ffc107;--danger:#dc3545;--light:#f8f9fa;--dark:#343a40;--breakpoint-xs:0;--breakpoint-sm:576px;--breakpoint-md:768px;--breakpoint-lg:992px;--breakpoint-xl:1200px;--font-family-sans-serif:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,"Noto Sans",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--font-family-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace}*,:after,:before{box-sizing:border-box}html{-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent;font-family:sans-serif;line-height:1.15}article,aside,figcaption,figure,footer,header,hgroup,main,nav,section{display:block}body{background-color:#fff;color:#212529;font-family:-apple-system,BlinkMacSystemFont,Segoe UI,Roboto,Helvetica Neue,Arial,Noto Sans,sans-serif,Apple Color Emoji,Segoe UI Emoji,Segoe UI Symbol,Noto Color Emoji;font-size:1rem;font-weight:400;line-height:1.5;margin:0;text-align:left}[tabindex="-1"]:focus{outline:0!important}hr{box-sizing:content-box;height:0;overflow:visible}h1,h2,h3,h4,h5,h6{margin-bottom:.5rem;margin-top:0}p{margin-bottom:1rem;margin-top:0}abbr[data-original-title],abbr[title]{border-bottom:0;cursor:help;text-decoration:underline;-webkit-text-decoration:underline dotted;text-decoration:underline dotted;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}address{font-style:normal;line-height:inherit}address,dl,ol,ul{margin-bottom:1rem}dl,ol,ul{margin-top:0}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{background-color:transparent;color:#007bff;text-decoration:none}a:hover{color:#0056b3;text-decoration:underline}a:not([href]):not([tabindex]),a:not([href]):not([tabindex]):focus,a:not([href]):not([tabindex]):hover{color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus{outline:0}code,kbd,pre,samp{font-family:SFMono-Regular,Menlo,Monaco,Consolas,Liberation Mono,Courier New,monospace;font-size:1em}pre{margin-bottom:1rem;margin-top:0;overflow:auto}figure{margin:0 0 1rem}img{border-style:none}img,svg{vertical-align:middle}svg{overflow:hidden}table{border-collapse:collapse}caption{caption-side:bottom;color:#6c757d;padding-bottom:.75rem;padding-top:.75rem;text-align:left}th{text-align:inherit}label{display:inline-block;margin-bottom:.5rem}button{border-radius:0}button:focus{outline:1px dotted;outline:5px auto -webkit-focus-ring-color}button,input,optgroup,select,textarea{font-family:inherit;font-size:inherit;line-height:inherit;margin:0}button,input{overflow:visible}button,select{text-transform:none}select{word-wrap:normal}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}[type=button]::-moz-focus-inner,[type=reset]::-moz-focus-inner,[type=submit]::-moz-focus-inner,button::-moz-focus-inner{border-style:none;padding:0}input[type=checkbox],input[type=radio]{box-sizing:border-box;padding:0}input[type=date],input[type=datetime-local],input[type=month],input[type=time]{-webkit-appearance:listbox}textarea{overflow:auto;resize:vertical}fieldset{border:0;margin:0;min-width:0;padding:0}legend{color:inherit;display:block;font-size:1.5rem;line-height:inherit;margin-bottom:.5rem;max-width:100%;padding:0;white-space:normal;width:100%}progress{vertical-align:baseline}[type=number]::-webkit-inner-spin-button,[type=number]::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:none;outline-offset:-2px}[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}output{display:inline-block}summary{cursor:pointer;display:list-item}template{display:none}[hidden]{display:none!important}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{font-weight:500;line-height:1.2;margin-bottom:.5rem}.h1,h1{font-size:2.5rem}.h2,h2{font-size:2rem}.h3,h3{font-size:1.75rem}.h4,h4{font-size:1.5rem}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:6rem}.display-1,.display-2{font-weight:300;line-height:1.2}.display-2{font-size:5.5rem}.display-3{font-size:4.5rem}.display-3,.display-4{font-weight:300;line-height:1.2}.display-4{font-size:3.5rem}hr{border:0;border-top:1px solid rgba(0,0,0,.1);margin-bottom:1rem;margin-top:1rem}.small,small{font-size:80%;font-weight:400}.mark,mark{background-color:#fcf8e3;padding:.2em}.list-inline,.list-unstyled{list-style:none;padding-left:0}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:90%;text-transform:uppercase}.blockquote{font-size:1.25rem;margin-bottom:1rem}.blockquote-footer{color:#6c757d;display:block;font-size:80%}.blockquote-footer:before{content:"\2014\00A0"}.img-fluid,.img-thumbnail{height:auto;max-width:100%}.img-thumbnail{background-color:#fff;border:1px solid #dee2e6;border-radius:.25rem;padding:.25rem}.figure{display:inline-block}.figure-img{line-height:1;margin-bottom:.5rem}.figure-caption{color:#6c757d;font-size:90%}code{color:#e83e8c;font-size:87.5%;word-break:break-word}a>code{color:inherit}kbd{background-color:#212529;border-radius:.2rem;color:#fff;font-size:87.5%;padding:.2rem .4rem}kbd kbd{font-size:100%;font-weight:700;padding:0}pre{color:#212529;display:block;font-size:87.5%}pre code{color:inherit;font-size:inherit;word-break:normal}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{margin-left:auto;margin-right:auto;padding-left:15px;padding-right:15px;width:100%}@media (min-width:576px){.container{max-width:540px}}@media (min-width:768px){.container{max-width:720px}}@media (min-width:992px){.container{max-width:960px}}@media (min-width:1200px){.container{max-width:1140px}}.container-fluid{margin-left:auto;margin-right:auto;padding-left:15px;padding-right:15px;width:100%}.row{display:flex;flex-wrap:wrap;margin-left:-15px;margin-right:-15px}.no-gutters{margin-left:0;margin-right:0}.no-gutters>.col,.no-gutters>[class*=col-]{padding-left:0;padding-right:0}.col,.col-1,.col-2,.col-3,.col-4,.col-5,.col-6,.col-7,.col-8,.col-9,.col-10,.col-11,.col-12,.col-auto,.col-lg,.col-lg-1,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-auto,.col-md,.col-md-1,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-md-10,.col-md-11,.col-md-12,.col-md-auto,.col-sm,.col-sm-1,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-auto,.col-xl,.col-xl-1,.col-xl-2,.col-xl-3,.col-xl-4,.col-xl-5,.col-xl-6,.col-xl-7,.col-xl-8,.col-xl-9,.col-xl-10,.col-xl-11,.col-xl-12,.col-xl-auto{padding-left:15px;padding-right:15px;position:relative;width:100%}.col{flex-basis:0;flex-grow:1;max-width:100%}.col-auto{flex:0 0 auto;max-width:100%;width:auto}.col-1{flex:0 0 8.333333%;max-width:8.333333%}.col-2{flex:0 0 16.666667%;max-width:16.666667%}.col-3{flex:0 0 25%;max-width:25%}.col-4{flex:0 0 33.333333%;max-width:33.333333%}.col-5{flex:0 0 41.666667%;max-width:41.666667%}.col-6{flex:0 0 50%;max-width:50%}.col-7{flex:0 0 58.333333%;max-width:58.333333%}.col-8{flex:0 0 66.666667%;max-width:66.666667%}.col-9{flex:0 0 75%;max-width:75%}.col-10{flex:0 0 83.333333%;max-width:83.333333%}.col-11{flex:0 0 91.666667%;max-width:91.666667%}.col-12{flex:0 0 100%;max-width:100%}.order-first{order:-1}.order-last{order:13}.order-0{order:0}.order-1{order:1}.order-2{order:2}.order-3{order:3}.order-4{order:4}.order-5{order:5}.order-6{order:6}.order-7{order:7}.order-8{order:8}.order-9{order:9}.order-10{order:10}.order-11{order:11}.order-12{order:12}.offset-1{margin-left:8.333333%}.offset-2{margin-left:16.666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.333333%}.offset-5{margin-left:41.666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.333333%}.offset-8{margin-left:66.666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.333333%}.offset-11{margin-left:91.666667%}@media (min-width:576px){.col-sm{flex-basis:0;flex-grow:1;max-width:100%}.col-sm-auto{flex:0 0 auto;max-width:100%;width:auto}.col-sm-1{flex:0 0 8.333333%;max-width:8.333333%}.col-sm-2{flex:0 0 16.666667%;max-width:16.666667%}.col-sm-3{flex:0 0 25%;max-width:25%}.col-sm-4{flex:0 0 33.333333%;max-width:33.333333%}.col-sm-5{flex:0 0 41.666667%;max-width:41.666667%}.col-sm-6{flex:0 0 50%;max-width:50%}.col-sm-7{flex:0 0 58.333333%;max-width:58.333333%}.col-sm-8{flex:0 0 66.666667%;max-width:66.666667%}.col-sm-9{flex:0 0 75%;max-width:75%}.col-sm-10{flex:0 0 83.333333%;max-width:83.333333%}.col-sm-11{flex:0 0 91.666667%;max-width:91.666667%}.col-sm-12{flex:0 0 100%;max-width:100%}.order-sm-first{order:-1}.order-sm-last{order:13}.order-sm-0{order:0}.order-sm-1{order:1}.order-sm-2{order:2}.order-sm-3{order:3}.order-sm-4{order:4}.order-sm-5{order:5}.order-sm-6{order:6}.order-sm-7{order:7}.order-sm-8{order:8}.order-sm-9{order:9}.order-sm-10{order:10}.order-sm-11{order:11}.order-sm-12{order:12}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.333333%}.offset-sm-2{margin-left:16.666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.333333%}.offset-sm-5{margin-left:41.666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.333333%}.offset-sm-8{margin-left:66.666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.333333%}.offset-sm-11{margin-left:91.666667%}}@media (min-width:768px){.col-md{flex-basis:0;flex-grow:1;max-width:100%}.col-md-auto{flex:0 0 auto;max-width:100%;width:auto}.col-md-1{flex:0 0 8.333333%;max-width:8.333333%}.col-md-2{flex:0 0 16.666667%;max-width:16.666667%}.col-md-3{flex:0 0 25%;max-width:25%}.col-md-4{flex:0 0 33.333333%;max-width:33.333333%}.col-md-5{flex:0 0 41.666667%;max-width:41.666667%}.col-md-6{flex:0 0 50%;max-width:50%}.col-md-7{flex:0 0 58.333333%;max-width:58.333333%}.col-md-8{flex:0 0 66.666667%;max-width:66.666667%}.col-md-9{flex:0 0 75%;max-width:75%}.col-md-10{flex:0 0 83.333333%;max-width:83.333333%}.col-md-11{flex:0 0 91.666667%;max-width:91.666667%}.col-md-12{flex:0 0 100%;max-width:100%}.order-md-first{order:-1}.order-md-last{order:13}.order-md-0{order:0}.order-md-1{order:1}.order-md-2{order:2}.order-md-3{order:3}.order-md-4{order:4}.order-md-5{order:5}.order-md-6{order:6}.order-md-7{order:7}.order-md-8{order:8}.order-md-9{order:9}.order-md-10{order:10}.order-md-11{order:11}.order-md-12{order:12}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.333333%}.offset-md-2{margin-left:16.666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.333333%}.offset-md-5{margin-left:41.666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.333333%}.offset-md-8{margin-left:66.666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.333333%}.offset-md-11{margin-left:91.666667%}}@media (min-width:992px){.col-lg{flex-basis:0;flex-grow:1;max-width:100%}.col-lg-auto{flex:0 0 auto;max-width:100%;width:auto}.col-lg-1{flex:0 0 8.333333%;max-width:8.333333%}.col-lg-2{flex:0 0 16.666667%;max-width:16.666667%}.col-lg-3{flex:0 0 25%;max-width:25%}.col-lg-4{flex:0 0 33.333333%;max-width:33.333333%}.col-lg-5{flex:0 0 41.666667%;max-width:41.666667%}.col-lg-6{flex:0 0 50%;max-width:50%}.col-lg-7{flex:0 0 58.333333%;max-width:58.333333%}.col-lg-8{flex:0 0 66.666667%;max-width:66.666667%}.col-lg-9{flex:0 0 75%;max-width:75%}.col-lg-10{flex:0 0 83.333333%;max-width:83.333333%}.col-lg-11{flex:0 0 91.666667%;max-width:91.666667%}.col-lg-12{flex:0 0 100%;max-width:100%}.order-lg-first{order:-1}.order-lg-last{order:13}.order-lg-0{order:0}.order-lg-1{order:1}.order-lg-2{order:2}.order-lg-3{order:3}.order-lg-4{order:4}.order-lg-5{order:5}.order-lg-6{order:6}.order-lg-7{order:7}.order-lg-8{order:8}.order-lg-9{order:9}.order-lg-10{order:10}.order-lg-11{order:11}.order-lg-12{order:12}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.333333%}.offset-lg-2{margin-left:16.666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.333333%}.offset-lg-5{margin-left:41.666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.333333%}.offset-lg-8{margin-left:66.666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.333333%}.offset-lg-11{margin-left:91.666667%}}@media (min-width:1200px){.col-xl{flex-basis:0;flex-grow:1;max-width:100%}.col-xl-auto{flex:0 0 auto;max-width:100%;width:auto}.col-xl-1{flex:0 0 8.333333%;max-width:8.333333%}.col-xl-2{flex:0 0 16.666667%;max-width:16.666667%}.col-xl-3{flex:0 0 25%;max-width:25%}.col-xl-4{flex:0 0 33.333333%;max-width:33.333333%}.col-xl-5{flex:0 0 41.666667%;max-width:41.666667%}.col-xl-6{flex:0 0 50%;max-width:50%}.col-xl-7{flex:0 0 58.333333%;max-width:58.333333%}.col-xl-8{flex:0 0 66.666667%;max-width:66.666667%}.col-xl-9{flex:0 0 75%;max-width:75%}.col-xl-10{flex:0 0 83.333333%;max-width:83.333333%}.col-xl-11{flex:0 0 91.666667%;max-width:91.666667%}.col-xl-12{flex:0 0 100%;max-width:100%}.order-xl-first{order:-1}.order-xl-last{order:13}.order-xl-0{order:0}.order-xl-1{order:1}.order-xl-2{order:2}.order-xl-3{order:3}.order-xl-4{order:4}.order-xl-5{order:5}.order-xl-6{order:6}.order-xl-7{order:7}.order-xl-8{order:8}.order-xl-9{order:9}.order-xl-10{order:10}.order-xl-11{order:11}.order-xl-12{order:12}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.333333%}.offset-xl-2{margin-left:16.666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.333333%}.offset-xl-5{margin-left:41.666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.333333%}.offset-xl-8{margin-left:66.666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.333333%}.offset-xl-11{margin-left:91.666667%}}.table{color:#212529;margin-bottom:1rem;width:100%}.table td,.table th{border-top:1px solid #dee2e6;padding:.75rem;vertical-align:top}.table thead th{border-bottom:2px solid #dee2e6;vertical-align:bottom}.table tbody+tbody{border-top:2px solid #dee2e6}.table-sm td,.table-sm th{padding:.3rem}.table-bordered,.table-bordered td,.table-bordered th{border:1px solid #dee2e6}.table-bordered thead td,.table-bordered thead th{border-bottom-width:2px}.table-borderless tbody+tbody,.table-borderless td,.table-borderless th,.table-borderless thead th{border:0}.table-striped tbody tr:nth-of-type(odd){background-color:rgba(0,0,0,.05)}.table-hover tbody tr:hover{background-color:rgba(0,0,0,.075);color:#212529}.table-primary,.table-primary>td,.table-primary>th{background-color:#b8daff}.table-primary tbody+tbody,.table-primary td,.table-primary th,.table-primary thead th{border-color:#7abaff}.table-hover .table-primary:hover,.table-hover .table-primary:hover>td,.table-hover .table-primary:hover>th{background-color:#9fcdff}.table-secondary,.table-secondary>td,.table-secondary>th{background-color:#d6d8db}.table-secondary tbody+tbody,.table-secondary td,.table-secondary th,.table-secondary thead th{border-color:#b3b7bb}.table-hover .table-secondary:hover,.table-hover .table-secondary:hover>td,.table-hover .table-secondary:hover>th{background-color:#c8cbcf}.table-success,.table-success>td,.table-success>th{background-color:#c3e6cb}.table-success tbody+tbody,.table-success td,.table-success th,.table-success thead th{border-color:#8fd19e}.table-hover .table-success:hover,.table-hover .table-success:hover>td,.table-hover .table-success:hover>th{background-color:#b1dfbb}.table-info,.table-info>td,.table-info>th{background-color:#bee5eb}.table-info tbody+tbody,.table-info td,.table-info th,.table-info thead th{border-color:#86cfda}.table-hover .table-info:hover,.table-hover .table-info:hover>td,.table-hover .table-info:hover>th{background-color:#abdde5}.table-warning,.table-warning>td,.table-warning>th{background-color:#ffeeba}.table-warning tbody+tbody,.table-warning td,.table-warning th,.table-warning thead th{border-color:#ffdf7e}.table-hover .table-warning:hover,.table-hover .table-warning:hover>td,.table-hover .table-warning:hover>th{background-color:#ffe8a1}.table-danger,.table-danger>td,.table-danger>th{background-color:#f5c6cb}.table-danger tbody+tbody,.table-danger td,.table-danger th,.table-danger thead th{border-color:#ed969e}.table-hover .table-danger:hover,.table-hover .table-danger:hover>td,.table-hover .table-danger:hover>th{background-color:#f1b0b7}.table-light,.table-light>td,.table-light>th{background-color:#fdfdfe}.table-light tbody+tbody,.table-light td,.table-light th,.table-light thead th{border-color:#fbfcfc}.table-hover .table-light:hover,.table-hover .table-light:hover>td,.table-hover .table-light:hover>th{background-color:#ececf6}.table-dark,.table-dark>td,.table-dark>th{background-color:#c6c8ca}.table-dark tbody+tbody,.table-dark td,.table-dark th,.table-dark thead th{border-color:#95999c}.table-hover .table-dark:hover,.table-hover .table-dark:hover>td,.table-hover .table-dark:hover>th{background-color:#b9bbbe}.table-active,.table-active>td,.table-active>th,.table-hover .table-active:hover,.table-hover .table-active:hover>td,.table-hover .table-active:hover>th{background-color:rgba(0,0,0,.075)}.table .thead-dark th{background-color:#343a40;border-color:#454d55;color:#fff}.table .thead-light th{background-color:#e9ecef;border-color:#dee2e6;color:#495057}.table-dark{background-color:#343a40;color:#fff}.table-dark td,.table-dark th,.table-dark thead th{border-color:#454d55}.table-dark.table-bordered{border:0}.table-dark.table-striped tbody tr:nth-of-type(odd){background-color:hsla(0,0%,100%,.05)}.table-dark.table-hover tbody tr:hover{background-color:hsla(0,0%,100%,.075);color:#fff}@media (max-width:575.98px){.table-responsive-sm{-webkit-overflow-scrolling:touch;display:block;overflow-x:auto;width:100%}.table-responsive-sm>.table-bordered{border:0}}@media (max-width:767.98px){.table-responsive-md{-webkit-overflow-scrolling:touch;display:block;overflow-x:auto;width:100%}.table-responsive-md>.table-bordered{border:0}}@media (max-width:991.98px){.table-responsive-lg{-webkit-overflow-scrolling:touch;display:block;overflow-x:auto;width:100%}.table-responsive-lg>.table-bordered{border:0}}@media (max-width:1199.98px){.table-responsive-xl{-webkit-overflow-scrolling:touch;display:block;overflow-x:auto;width:100%}.table-responsive-xl>.table-bordered{border:0}}.table-responsive{-webkit-overflow-scrolling:touch;display:block;overflow-x:auto;width:100%}.table-responsive>.table-bordered{border:0}.form-control{background-clip:padding-box;background-color:#fff;border:1px solid #ced4da;border-radius:.25rem;color:#495057;display:block;font-size:1rem;font-weight:400;height:calc(1.5em + .75rem + 2px);line-height:1.5;padding:.375rem .75rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out;width:100%}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control::-ms-expand{background-color:transparent;border:0}.form-control:focus{background-color:#fff;border-color:#80bdff;box-shadow:0 0 0 .2rem rgba(0,123,255,.25);color:#495057;outline:0}.form-control::-moz-placeholder{color:#6c757d;opacity:1}.form-control:-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled,.form-control[readonly]{background-color:#e9ecef;opacity:1}select.form-control:focus::-ms-value{background-color:#fff;color:#495057}.form-control-file,.form-control-range{display:block;width:100%}.col-form-label{font-size:inherit;line-height:1.5;margin-bottom:0;padding-bottom:calc(.375rem + 1px);padding-top:calc(.375rem + 1px)}.col-form-label-lg{font-size:1.25rem;line-height:1.5;padding-bottom:calc(.5rem + 1px);padding-top:calc(.5rem + 1px)}.col-form-label-sm{font-size:.875rem;line-height:1.5;padding-bottom:calc(.25rem + 1px);padding-top:calc(.25rem + 1px)}.form-control-plaintext{background-color:transparent;border:solid transparent;border-width:1px 0;color:#212529;display:block;line-height:1.5;margin-bottom:0;padding-bottom:.375rem;padding-top:.375rem;width:100%}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-left:0;padding-right:0}.form-control-sm{border-radius:.2rem;font-size:.875rem;height:calc(1.5em + .5rem + 2px);line-height:1.5;padding:.25rem .5rem}.form-control-lg{border-radius:.3rem;font-size:1.25rem;height:calc(1.5em + 1rem + 2px);line-height:1.5;padding:.5rem 1rem}select.form-control[multiple],select.form-control[size],textarea.form-control{height:auto}.form-group{margin-bottom:1rem}.form-text{display:block;margin-top:.25rem}.form-row{display:flex;flex-wrap:wrap;margin-left:-5px;margin-right:-5px}.form-row>.col,.form-row>[class*=col-]{padding-left:5px;padding-right:5px}.form-check{display:block;padding-left:1.25rem;position:relative}.form-check-input{margin-left:-1.25rem;margin-top:.3rem;position:absolute}.form-check-input:disabled~.form-check-label{color:#6c757d}.form-check-label{margin-bottom:0}.form-check-inline{align-items:center;display:inline-flex;margin-right:.75rem;padding-left:0}.form-check-inline .form-check-input{margin-left:0;margin-right:.3125rem;margin-top:0;position:static}.valid-feedback{color:#28a745;display:none;font-size:80%;margin-top:.25rem;width:100%}.valid-tooltip{background-color:rgba(40,167,69,.9);border-radius:.25rem;color:#fff;display:none;font-size:.875rem;line-height:1.5;margin-top:.1rem;max-width:100%;padding:.25rem .5rem;position:absolute;top:100%;z-index:5}.form-control.is-valid,.was-validated .form-control:valid{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%2328a745' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3E%3C/svg%3E");background-position:center right calc(.375em + .1875rem);background-repeat:no-repeat;background-size:calc(.75em + .375rem) calc(.75em + .375rem);border-color:#28a745;padding-right:calc(1.5em + .75rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.form-control.is-valid~.valid-feedback,.form-control.is-valid~.valid-tooltip,.was-validated .form-control:valid~.valid-feedback,.was-validated .form-control:valid~.valid-tooltip{display:block}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem);padding-right:calc(1.5em + .75rem)}.custom-select.is-valid,.was-validated .custom-select:valid{background:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3E%3Cpath fill='%23343a40' d='M2 0 0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right .75rem center/8px 10px,url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%2328a745' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3E%3C/svg%3E") #fff no-repeat center right 1.75rem /calc(.75em + .375rem) calc(.75em + .375rem);border-color:#28a745;padding-right:calc(.75em + 2.3125rem)}.custom-select.is-valid:focus,.was-validated .custom-select:valid:focus{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.custom-select.is-valid~.valid-feedback,.custom-select.is-valid~.valid-tooltip,.was-validated .custom-select:valid~.valid-feedback,.was-validated .custom-select:valid~.valid-tooltip{display:block}.form-control-file.is-valid~.valid-feedback,.form-control-file.is-valid~.valid-tooltip,.was-validated .form-control-file:valid~.valid-feedback,.was-validated .form-control-file:valid~.valid-tooltip{display:block}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#28a745}.form-check-input.is-valid~.valid-feedback,.form-check-input.is-valid~.valid-tooltip,.was-validated .form-check-input:valid~.valid-feedback,.was-validated .form-check-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid~.custom-control-label,.was-validated .custom-control-input:valid~.custom-control-label{color:#28a745}.custom-control-input.is-valid~.custom-control-label:before,.was-validated .custom-control-input:valid~.custom-control-label:before{border-color:#28a745}.custom-control-input.is-valid~.valid-feedback,.custom-control-input.is-valid~.valid-tooltip,.was-validated .custom-control-input:valid~.valid-feedback,.was-validated .custom-control-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid:checked~.custom-control-label:before,.was-validated .custom-control-input:valid:checked~.custom-control-label:before{background-color:#34ce57;border-color:#34ce57}.custom-control-input.is-valid:focus~.custom-control-label:before,.was-validated .custom-control-input:valid:focus~.custom-control-label:before{box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.custom-control-input.is-valid:focus:not(:checked)~.custom-control-label:before,.was-validated .custom-control-input:valid:focus:not(:checked)~.custom-control-label:before{border-color:#28a745}.custom-file-input.is-valid~.custom-file-label,.was-validated .custom-file-input:valid~.custom-file-label{border-color:#28a745}.custom-file-input.is-valid~.valid-feedback,.custom-file-input.is-valid~.valid-tooltip,.was-validated .custom-file-input:valid~.valid-feedback,.was-validated .custom-file-input:valid~.valid-tooltip{display:block}.custom-file-input.is-valid:focus~.custom-file-label,.was-validated .custom-file-input:valid:focus~.custom-file-label{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.invalid-feedback{color:#dc3545;display:none;font-size:80%;margin-top:.25rem;width:100%}.invalid-tooltip{background-color:rgba(220,53,69,.9);border-radius:.25rem;color:#fff;display:none;font-size:.875rem;line-height:1.5;margin-top:.1rem;max-width:100%;padding:.25rem .5rem;position:absolute;top:100%;z-index:5}.form-control.is-invalid,.was-validated .form-control:invalid{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23dc3545' viewBox='-2 -2 7 7'%3E%3Cpath stroke='%23dc3545' d='m0 0 3 3m0-3L0 3'/%3E%3Ccircle r='.5'/%3E%3Ccircle cx='3' r='.5'/%3E%3Ccircle cy='3' r='.5'/%3E%3Ccircle cx='3' cy='3' r='.5'/%3E%3C/svg%3E");background-position:center right calc(.375em + .1875rem);background-repeat:no-repeat;background-size:calc(.75em + .375rem) calc(.75em + .375rem);border-color:#dc3545;padding-right:calc(1.5em + .75rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.form-control.is-invalid~.invalid-feedback,.form-control.is-invalid~.invalid-tooltip,.was-validated .form-control:invalid~.invalid-feedback,.was-validated .form-control:invalid~.invalid-tooltip{display:block}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem);padding-right:calc(1.5em + .75rem)}.custom-select.is-invalid,.was-validated .custom-select:invalid{background:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3E%3Cpath fill='%23343a40' d='M2 0 0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right .75rem center/8px 10px,url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23dc3545' viewBox='-2 -2 7 7'%3E%3Cpath stroke='%23dc3545' d='m0 0 3 3m0-3L0 3'/%3E%3Ccircle r='.5'/%3E%3Ccircle cx='3' r='.5'/%3E%3Ccircle cy='3' r='.5'/%3E%3Ccircle cx='3' cy='3' r='.5'/%3E%3C/svg%3E") #fff no-repeat center right 1.75rem /calc(.75em + .375rem) calc(.75em + .375rem);border-color:#dc3545;padding-right:calc(.75em + 2.3125rem)}.custom-select.is-invalid:focus,.was-validated .custom-select:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.custom-select.is-invalid~.invalid-feedback,.custom-select.is-invalid~.invalid-tooltip,.was-validated .custom-select:invalid~.invalid-feedback,.was-validated .custom-select:invalid~.invalid-tooltip{display:block}.form-control-file.is-invalid~.invalid-feedback,.form-control-file.is-invalid~.invalid-tooltip,.was-validated .form-control-file:invalid~.invalid-feedback,.was-validated .form-control-file:invalid~.invalid-tooltip{display:block}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-input.is-invalid~.invalid-feedback,.form-check-input.is-invalid~.invalid-tooltip,.was-validated .form-check-input:invalid~.invalid-feedback,.was-validated .form-check-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid~.custom-control-label,.was-validated .custom-control-input:invalid~.custom-control-label{color:#dc3545}.custom-control-input.is-invalid~.custom-control-label:before,.was-validated .custom-control-input:invalid~.custom-control-label:before{border-color:#dc3545}.custom-control-input.is-invalid~.invalid-feedback,.custom-control-input.is-invalid~.invalid-tooltip,.was-validated .custom-control-input:invalid~.invalid-feedback,.was-validated .custom-control-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid:checked~.custom-control-label:before,.was-validated .custom-control-input:invalid:checked~.custom-control-label:before{background-color:#e4606d;border-color:#e4606d}.custom-control-input.is-invalid:focus~.custom-control-label:before,.was-validated .custom-control-input:invalid:focus~.custom-control-label:before{box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.custom-control-input.is-invalid:focus:not(:checked)~.custom-control-label:before,.was-validated .custom-control-input:invalid:focus:not(:checked)~.custom-control-label:before{border-color:#dc3545}.custom-file-input.is-invalid~.custom-file-label,.was-validated .custom-file-input:invalid~.custom-file-label{border-color:#dc3545}.custom-file-input.is-invalid~.invalid-feedback,.custom-file-input.is-invalid~.invalid-tooltip,.was-validated .custom-file-input:invalid~.invalid-feedback,.was-validated .custom-file-input:invalid~.invalid-tooltip{display:block}.custom-file-input.is-invalid:focus~.custom-file-label,.was-validated .custom-file-input:invalid:focus~.custom-file-label{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.form-inline{align-items:center;display:flex;flex-flow:row wrap}.form-inline .form-check{width:100%}@media (min-width:576px){.form-inline label{justify-content:center}.form-inline .form-group,.form-inline label{align-items:center;display:flex;margin-bottom:0}.form-inline .form-group{flex:0 0 auto;flex-flow:row wrap}.form-inline .form-control{display:inline-block;vertical-align:middle;width:auto}.form-inline .form-control-plaintext{display:inline-block}.form-inline .custom-select,.form-inline .input-group{width:auto}.form-inline .form-check{align-items:center;display:flex;justify-content:center;padding-left:0;width:auto}.form-inline .form-check-input{flex-shrink:0;margin-left:0;margin-right:.25rem;margin-top:0;position:relative}.form-inline .custom-control{align-items:center;justify-content:center}.form-inline .custom-control-label{margin-bottom:0}}.btn{background-color:transparent;border:1px solid transparent;border-radius:.25rem;color:#212529;display:inline-block;font-size:1rem;font-weight:400;line-height:1.5;padding:.375rem .75rem;text-align:center;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;vertical-align:middle}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:hover{color:#212529;text-decoration:none}.btn.focus,.btn:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.25);outline:0}.btn.disabled,.btn:disabled{opacity:.65}a.btn.disabled,fieldset:disabled a.btn{pointer-events:none}.btn-primary{background-color:#007bff;border-color:#007bff;color:#fff}.btn-primary:hover{background-color:#0069d9;border-color:#0062cc;color:#fff}.btn-primary.focus,.btn-primary:focus{box-shadow:0 0 0 .2rem rgba(38,143,255,.5)}.btn-primary.disabled,.btn-primary:disabled{background-color:#007bff;border-color:#007bff;color:#fff}.btn-primary:not(:disabled):not(.disabled).active,.btn-primary:not(:disabled):not(.disabled):active,.show>.btn-primary.dropdown-toggle{background-color:#0062cc;border-color:#005cbf;color:#fff}.btn-primary:not(:disabled):not(.disabled).active:focus,.btn-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(38,143,255,.5)}.btn-secondary{background-color:#6c757d;border-color:#6c757d;color:#fff}.btn-secondary:hover{background-color:#5a6268;border-color:#545b62;color:#fff}.btn-secondary.focus,.btn-secondary:focus{box-shadow:0 0 0 .2rem hsla(208,6%,54%,.5)}.btn-secondary.disabled,.btn-secondary:disabled{background-color:#6c757d;border-color:#6c757d;color:#fff}.btn-secondary:not(:disabled):not(.disabled).active,.btn-secondary:not(:disabled):not(.disabled):active,.show>.btn-secondary.dropdown-toggle{background-color:#545b62;border-color:#4e555b;color:#fff}.btn-secondary:not(:disabled):not(.disabled).active:focus,.btn-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem hsla(208,6%,54%,.5)}.btn-success{background-color:#28a745;border-color:#28a745;color:#fff}.btn-success:hover{background-color:#218838;border-color:#1e7e34;color:#fff}.btn-success.focus,.btn-success:focus{box-shadow:0 0 0 .2rem rgba(72,180,97,.5)}.btn-success.disabled,.btn-success:disabled{background-color:#28a745;border-color:#28a745;color:#fff}.btn-success:not(:disabled):not(.disabled).active,.btn-success:not(:disabled):not(.disabled):active,.show>.btn-success.dropdown-toggle{background-color:#1e7e34;border-color:#1c7430;color:#fff}.btn-success:not(:disabled):not(.disabled).active:focus,.btn-success:not(:disabled):not(.disabled):active:focus,.show>.btn-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(72,180,97,.5)}.btn-info{background-color:#17a2b8;border-color:#17a2b8;color:#fff}.btn-info:hover{background-color:#138496;border-color:#117a8b;color:#fff}.btn-info.focus,.btn-info:focus{box-shadow:0 0 0 .2rem rgba(58,176,195,.5)}.btn-info.disabled,.btn-info:disabled{background-color:#17a2b8;border-color:#17a2b8;color:#fff}.btn-info:not(:disabled):not(.disabled).active,.btn-info:not(:disabled):not(.disabled):active,.show>.btn-info.dropdown-toggle{background-color:#117a8b;border-color:#10707f;color:#fff}.btn-info:not(:disabled):not(.disabled).active:focus,.btn-info:not(:disabled):not(.disabled):active:focus,.show>.btn-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(58,176,195,.5)}.btn-warning{background-color:#ffc107;border-color:#ffc107;color:#212529}.btn-warning:hover{background-color:#e0a800;border-color:#d39e00;color:#212529}.btn-warning.focus,.btn-warning:focus{box-shadow:0 0 0 .2rem rgba(222,170,12,.5)}.btn-warning.disabled,.btn-warning:disabled{background-color:#ffc107;border-color:#ffc107;color:#212529}.btn-warning:not(:disabled):not(.disabled).active,.btn-warning:not(:disabled):not(.disabled):active,.show>.btn-warning.dropdown-toggle{background-color:#d39e00;border-color:#c69500;color:#212529}.btn-warning:not(:disabled):not(.disabled).active:focus,.btn-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(222,170,12,.5)}.btn-danger{background-color:#dc3545;border-color:#dc3545;color:#fff}.btn-danger:hover{background-color:#c82333;border-color:#bd2130;color:#fff}.btn-danger.focus,.btn-danger:focus{box-shadow:0 0 0 .2rem rgba(225,83,97,.5)}.btn-danger.disabled,.btn-danger:disabled{background-color:#dc3545;border-color:#dc3545;color:#fff}.btn-danger:not(:disabled):not(.disabled).active,.btn-danger:not(:disabled):not(.disabled):active,.show>.btn-danger.dropdown-toggle{background-color:#bd2130;border-color:#b21f2d;color:#fff}.btn-danger:not(:disabled):not(.disabled).active:focus,.btn-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(225,83,97,.5)}.btn-light{background-color:#f8f9fa;border-color:#f8f9fa;color:#212529}.btn-light:hover{background-color:#e2e6ea;border-color:#dae0e5;color:#212529}.btn-light.focus,.btn-light:focus{box-shadow:0 0 0 .2rem hsla(220,4%,85%,.5)}.btn-light.disabled,.btn-light:disabled{background-color:#f8f9fa;border-color:#f8f9fa;color:#212529}.btn-light:not(:disabled):not(.disabled).active,.btn-light:not(:disabled):not(.disabled):active,.show>.btn-light.dropdown-toggle{background-color:#dae0e5;border-color:#d3d9df;color:#212529}.btn-light:not(:disabled):not(.disabled).active:focus,.btn-light:not(:disabled):not(.disabled):active:focus,.show>.btn-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem hsla(220,4%,85%,.5)}.btn-dark{background-color:#343a40;border-color:#343a40;color:#fff}.btn-dark:hover{background-color:#23272b;border-color:#1d2124;color:#fff}.btn-dark.focus,.btn-dark:focus{box-shadow:0 0 0 .2rem rgba(82,88,93,.5)}.btn-dark.disabled,.btn-dark:disabled{background-color:#343a40;border-color:#343a40;color:#fff}.btn-dark:not(:disabled):not(.disabled).active,.btn-dark:not(:disabled):not(.disabled):active,.show>.btn-dark.dropdown-toggle{background-color:#1d2124;border-color:#171a1d;color:#fff}.btn-dark:not(:disabled):not(.disabled).active:focus,.btn-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(82,88,93,.5)}.btn-outline-primary{border-color:#007bff;color:#007bff}.btn-outline-primary:hover{background-color:#007bff;border-color:#007bff;color:#fff}.btn-outline-primary.focus,.btn-outline-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-primary.disabled,.btn-outline-primary:disabled{background-color:transparent;color:#007bff}.btn-outline-primary:not(:disabled):not(.disabled).active,.btn-outline-primary:not(:disabled):not(.disabled):active,.show>.btn-outline-primary.dropdown-toggle{background-color:#007bff;border-color:#007bff;color:#fff}.btn-outline-primary:not(:disabled):not(.disabled).active:focus,.btn-outline-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-secondary{border-color:#6c757d;color:#6c757d}.btn-outline-secondary:hover{background-color:#6c757d;border-color:#6c757d;color:#fff}.btn-outline-secondary.focus,.btn-outline-secondary:focus{box-shadow:0 0 0 .2rem hsla(208,7%,46%,.5)}.btn-outline-secondary.disabled,.btn-outline-secondary:disabled{background-color:transparent;color:#6c757d}.btn-outline-secondary:not(:disabled):not(.disabled).active,.btn-outline-secondary:not(:disabled):not(.disabled):active,.show>.btn-outline-secondary.dropdown-toggle{background-color:#6c757d;border-color:#6c757d;color:#fff}.btn-outline-secondary:not(:disabled):not(.disabled).active:focus,.btn-outline-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem hsla(208,7%,46%,.5)}.btn-outline-success{border-color:#28a745;color:#28a745}.btn-outline-success:hover{background-color:#28a745;border-color:#28a745;color:#fff}.btn-outline-success.focus,.btn-outline-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-success.disabled,.btn-outline-success:disabled{background-color:transparent;color:#28a745}.btn-outline-success:not(:disabled):not(.disabled).active,.btn-outline-success:not(:disabled):not(.disabled):active,.show>.btn-outline-success.dropdown-toggle{background-color:#28a745;border-color:#28a745;color:#fff}.btn-outline-success:not(:disabled):not(.disabled).active:focus,.btn-outline-success:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-info{border-color:#17a2b8;color:#17a2b8}.btn-outline-info:hover{background-color:#17a2b8;border-color:#17a2b8;color:#fff}.btn-outline-info.focus,.btn-outline-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-info.disabled,.btn-outline-info:disabled{background-color:transparent;color:#17a2b8}.btn-outline-info:not(:disabled):not(.disabled).active,.btn-outline-info:not(:disabled):not(.disabled):active,.show>.btn-outline-info.dropdown-toggle{background-color:#17a2b8;border-color:#17a2b8;color:#fff}.btn-outline-info:not(:disabled):not(.disabled).active:focus,.btn-outline-info:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-warning{border-color:#ffc107;color:#ffc107}.btn-outline-warning:hover{background-color:#ffc107;border-color:#ffc107;color:#212529}.btn-outline-warning.focus,.btn-outline-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-warning.disabled,.btn-outline-warning:disabled{background-color:transparent;color:#ffc107}.btn-outline-warning:not(:disabled):not(.disabled).active,.btn-outline-warning:not(:disabled):not(.disabled):active,.show>.btn-outline-warning.dropdown-toggle{background-color:#ffc107;border-color:#ffc107;color:#212529}.btn-outline-warning:not(:disabled):not(.disabled).active:focus,.btn-outline-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-danger{border-color:#dc3545;color:#dc3545}.btn-outline-danger:hover{background-color:#dc3545;border-color:#dc3545;color:#fff}.btn-outline-danger.focus,.btn-outline-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-danger.disabled,.btn-outline-danger:disabled{background-color:transparent;color:#dc3545}.btn-outline-danger:not(:disabled):not(.disabled).active,.btn-outline-danger:not(:disabled):not(.disabled):active,.show>.btn-outline-danger.dropdown-toggle{background-color:#dc3545;border-color:#dc3545;color:#fff}.btn-outline-danger:not(:disabled):not(.disabled).active:focus,.btn-outline-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-light{border-color:#f8f9fa;color:#f8f9fa}.btn-outline-light:hover{background-color:#f8f9fa;border-color:#f8f9fa;color:#212529}.btn-outline-light.focus,.btn-outline-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-light.disabled,.btn-outline-light:disabled{background-color:transparent;color:#f8f9fa}.btn-outline-light:not(:disabled):not(.disabled).active,.btn-outline-light:not(:disabled):not(.disabled):active,.show>.btn-outline-light.dropdown-toggle{background-color:#f8f9fa;border-color:#f8f9fa;color:#212529}.btn-outline-light:not(:disabled):not(.disabled).active:focus,.btn-outline-light:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-dark{border-color:#343a40;color:#343a40}.btn-outline-dark:hover{background-color:#343a40;border-color:#343a40;color:#fff}.btn-outline-dark.focus,.btn-outline-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-dark.disabled,.btn-outline-dark:disabled{background-color:transparent;color:#343a40}.btn-outline-dark:not(:disabled):not(.disabled).active,.btn-outline-dark:not(:disabled):not(.disabled):active,.show>.btn-outline-dark.dropdown-toggle{background-color:#343a40;border-color:#343a40;color:#fff}.btn-outline-dark:not(:disabled):not(.disabled).active:focus,.btn-outline-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-link{color:#007bff;font-weight:400;text-decoration:none}.btn-link:hover{color:#0056b3;text-decoration:underline}.btn-link.focus,.btn-link:focus{box-shadow:none;text-decoration:underline}.btn-link.disabled,.btn-link:disabled{color:#6c757d;pointer-events:none}.btn-group-lg>.btn,.btn-lg{border-radius:.3rem;font-size:1.25rem;line-height:1.5;padding:.5rem 1rem}.btn-group-sm>.btn,.btn-sm{border-radius:.2rem;font-size:.875rem;line-height:1.5;padding:.25rem .5rem}.btn-block{display:block;width:100%}.btn-block+.btn-block{margin-top:.5rem}input[type=button].btn-block,input[type=reset].btn-block,input[type=submit].btn-block{width:100%}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;position:relative;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.dropdown,.dropleft,.dropright,.dropup{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle:after{border-bottom:0;border-left:.3em solid transparent;border-right:.3em solid transparent;border-top:.3em solid;content:"";display:inline-block;margin-left:.255em;vertical-align:.255em}.dropdown-toggle:empty:after{margin-left:0}.dropdown-menu{background-clip:padding-box;background-color:#fff;border:1px solid rgba(0,0,0,.15);border-radius:.25rem;color:#212529;display:none;float:left;font-size:1rem;left:0;list-style:none;margin:.125rem 0 0;min-width:10rem;padding:.5rem 0;position:absolute;text-align:left;top:100%;z-index:1000}.dropdown-menu-left{left:0;right:auto}.dropdown-menu-right{left:auto;right:0}@media (min-width:576px){.dropdown-menu-sm-left{left:0;right:auto}.dropdown-menu-sm-right{left:auto;right:0}}@media (min-width:768px){.dropdown-menu-md-left{left:0;right:auto}.dropdown-menu-md-right{left:auto;right:0}}@media (min-width:992px){.dropdown-menu-lg-left{left:0;right:auto}.dropdown-menu-lg-right{left:auto;right:0}}@media (min-width:1200px){.dropdown-menu-xl-left{left:0;right:auto}.dropdown-menu-xl-right{left:auto;right:0}}.dropup .dropdown-menu{bottom:100%;margin-bottom:.125rem;margin-top:0;top:auto}.dropup .dropdown-toggle:after{border-bottom:.3em solid;border-left:.3em solid transparent;border-right:.3em solid transparent;border-top:0;content:"";display:inline-block;margin-left:.255em;vertical-align:.255em}.dropup .dropdown-toggle:empty:after{margin-left:0}.dropright .dropdown-menu{left:100%;margin-left:.125rem;margin-top:0;right:auto;top:0}.dropright .dropdown-toggle:after{border-bottom:.3em solid transparent;border-left:.3em solid;border-right:0;border-top:.3em solid transparent;content:"";display:inline-block;margin-left:.255em;vertical-align:.255em}.dropright .dropdown-toggle:empty:after{margin-left:0}.dropright .dropdown-toggle:after{vertical-align:0}.dropleft .dropdown-menu{left:auto;margin-right:.125rem;margin-top:0;right:100%;top:0}.dropleft .dropdown-toggle:after{content:"";display:inline-block;display:none;margin-left:.255em;vertical-align:.255em}.dropleft .dropdown-toggle:before{border-bottom:.3em solid transparent;border-right:.3em solid;border-top:.3em solid transparent;content:"";display:inline-block;margin-right:.255em;vertical-align:.255em}.dropleft .dropdown-toggle:empty:after{margin-left:0}.dropleft .dropdown-toggle:before{vertical-align:0}.dropdown-menu[x-placement^=bottom],.dropdown-menu[x-placement^=left],.dropdown-menu[x-placement^=right],.dropdown-menu[x-placement^=top]{bottom:auto;right:auto}.dropdown-divider{border-top:1px solid #e9ecef;height:0;margin:.5rem 0;overflow:hidden}.dropdown-item{background-color:transparent;border:0;clear:both;color:#212529;display:block;font-weight:400;padding:.25rem 1.5rem;text-align:inherit;white-space:nowrap;width:100%}.dropdown-item:focus,.dropdown-item:hover{background-color:#f8f9fa;color:#16181b;text-decoration:none}.dropdown-item.active,.dropdown-item:active{background-color:#007bff;color:#fff;text-decoration:none}.dropdown-item.disabled,.dropdown-item:disabled{background-color:transparent;color:#6c757d;pointer-events:none}.dropdown-menu.show{display:block}.dropdown-header{color:#6c757d;display:block;font-size:.875rem;margin-bottom:0;padding:.5rem 1.5rem;white-space:nowrap}.dropdown-item-text{color:#212529;display:block;padding:.25rem 1.5rem}.btn-group,.btn-group-vertical{display:inline-flex;position:relative;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{flex:1 1 auto;position:relative}.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group>.btn-group:not(:first-child),.btn-group>.btn:not(:first-child){margin-left:-1px}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-top-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:not(:first-child){border-bottom-left-radius:0;border-top-left-radius:0}.dropdown-toggle-split{padding-left:.5625rem;padding-right:.5625rem}.dropdown-toggle-split:after,.dropright .dropdown-toggle-split:after,.dropup .dropdown-toggle-split:after{margin-left:0}.dropleft .dropdown-toggle-split:before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-left:.375rem;padding-right:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-left:.75rem;padding-right:.75rem}.btn-group-vertical{align-items:flex-start;flex-direction:column;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:-1px}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-left-radius:0;border-bottom-right-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn:not(:first-child){border-top-left-radius:0;border-top-right-radius:0}.btn-group-toggle>.btn,.btn-group-toggle>.btn-group>.btn{margin-bottom:0}.btn-group-toggle>.btn-group>.btn input[type=checkbox],.btn-group-toggle>.btn-group>.btn input[type=radio],.btn-group-toggle>.btn input[type=checkbox],.btn-group-toggle>.btn input[type=radio]{clip:rect(0,0,0,0);pointer-events:none;position:absolute}.input-group{align-items:stretch;display:flex;flex-wrap:wrap;position:relative;width:100%}.input-group>.custom-file,.input-group>.custom-select,.input-group>.form-control,.input-group>.form-control-plaintext{flex:1 1 auto;margin-bottom:0;position:relative;width:1%}.input-group>.custom-file+.custom-file,.input-group>.custom-file+.custom-select,.input-group>.custom-file+.form-control,.input-group>.custom-select+.custom-file,.input-group>.custom-select+.custom-select,.input-group>.custom-select+.form-control,.input-group>.form-control+.custom-file,.input-group>.form-control+.custom-select,.input-group>.form-control+.form-control,.input-group>.form-control-plaintext+.custom-file,.input-group>.form-control-plaintext+.custom-select,.input-group>.form-control-plaintext+.form-control{margin-left:-1px}.input-group>.custom-file .custom-file-input:focus~.custom-file-label,.input-group>.custom-select:focus,.input-group>.form-control:focus{z-index:3}.input-group>.custom-file .custom-file-input:focus{z-index:4}.input-group>.custom-select:not(:last-child),.input-group>.form-control:not(:last-child){border-bottom-right-radius:0;border-top-right-radius:0}.input-group>.custom-select:not(:first-child),.input-group>.form-control:not(:first-child){border-bottom-left-radius:0;border-top-left-radius:0}.input-group>.custom-file{align-items:center;display:flex}.input-group>.custom-file:not(:last-child) .custom-file-label,.input-group>.custom-file:not(:last-child) .custom-file-label:after{border-bottom-right-radius:0;border-top-right-radius:0}.input-group>.custom-file:not(:first-child) .custom-file-label{border-bottom-left-radius:0;border-top-left-radius:0}.input-group-append,.input-group-prepend{display:flex}.input-group-append .btn,.input-group-prepend .btn{position:relative;z-index:2}.input-group-append .btn:focus,.input-group-prepend .btn:focus{z-index:3}.input-group-append .btn+.btn,.input-group-append .btn+.input-group-text,.input-group-append .input-group-text+.btn,.input-group-append .input-group-text+.input-group-text,.input-group-prepend .btn+.btn,.input-group-prepend .btn+.input-group-text,.input-group-prepend .input-group-text+.btn,.input-group-prepend .input-group-text+.input-group-text{margin-left:-1px}.input-group-prepend{margin-right:-1px}.input-group-append{margin-left:-1px}.input-group-text{align-items:center;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.25rem;color:#495057;display:flex;font-size:1rem;font-weight:400;line-height:1.5;margin-bottom:0;padding:.375rem .75rem;text-align:center;white-space:nowrap}.input-group-text input[type=checkbox],.input-group-text input[type=radio]{margin-top:0}.input-group-lg>.custom-select,.input-group-lg>.form-control:not(textarea){height:calc(1.5em + 1rem + 2px)}.input-group-lg>.custom-select,.input-group-lg>.form-control,.input-group-lg>.input-group-append>.btn,.input-group-lg>.input-group-append>.input-group-text,.input-group-lg>.input-group-prepend>.btn,.input-group-lg>.input-group-prepend>.input-group-text{border-radius:.3rem;font-size:1.25rem;line-height:1.5;padding:.5rem 1rem}.input-group-sm>.custom-select,.input-group-sm>.form-control:not(textarea){height:calc(1.5em + .5rem + 2px)}.input-group-sm>.custom-select,.input-group-sm>.form-control,.input-group-sm>.input-group-append>.btn,.input-group-sm>.input-group-append>.input-group-text,.input-group-sm>.input-group-prepend>.btn,.input-group-sm>.input-group-prepend>.input-group-text{border-radius:.2rem;font-size:.875rem;line-height:1.5;padding:.25rem .5rem}.input-group-lg>.custom-select,.input-group-sm>.custom-select{padding-right:1.75rem}.input-group>.input-group-append:last-child>.btn:not(:last-child):not(.dropdown-toggle),.input-group>.input-group-append:last-child>.input-group-text:not(:last-child),.input-group>.input-group-append:not(:last-child)>.btn,.input-group>.input-group-append:not(:last-child)>.input-group-text,.input-group>.input-group-prepend>.btn,.input-group>.input-group-prepend>.input-group-text{border-bottom-right-radius:0;border-top-right-radius:0}.input-group>.input-group-append>.btn,.input-group>.input-group-append>.input-group-text,.input-group>.input-group-prepend:first-child>.btn:not(:first-child),.input-group>.input-group-prepend:first-child>.input-group-text:not(:first-child),.input-group>.input-group-prepend:not(:first-child)>.btn,.input-group>.input-group-prepend:not(:first-child)>.input-group-text{border-bottom-left-radius:0;border-top-left-radius:0}.custom-control{display:block;min-height:1.5rem;padding-left:1.5rem;position:relative}.custom-control-inline{display:inline-flex;margin-right:1rem}.custom-control-input{opacity:0;position:absolute;z-index:-1}.custom-control-input:checked~.custom-control-label:before{background-color:#007bff;border-color:#007bff;color:#fff}.custom-control-input:focus~.custom-control-label:before{box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.custom-control-input:focus:not(:checked)~.custom-control-label:before{border-color:#80bdff}.custom-control-input:not(:disabled):active~.custom-control-label:before{background-color:#b3d7ff;border-color:#b3d7ff;color:#fff}.custom-control-input:disabled~.custom-control-label{color:#6c757d}.custom-control-input:disabled~.custom-control-label:before{background-color:#e9ecef}.custom-control-label{margin-bottom:0;position:relative;vertical-align:top}.custom-control-label:before{background-color:#fff;border:1px solid #adb5bd;pointer-events:none}.custom-control-label:after,.custom-control-label:before{content:"";display:block;height:1rem;left:-1.5rem;position:absolute;top:.25rem;width:1rem}.custom-control-label:after{background:no-repeat 50%/50% 50%}.custom-checkbox .custom-control-label:before{border-radius:.25rem}.custom-checkbox .custom-control-input:checked~.custom-control-label:after{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='m6.564.75-3.59 3.612-1.538-1.55L0 4.26l2.974 2.99L8 2.193z'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label:before{background-color:#007bff;border-color:#007bff}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label:after{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:disabled:checked~.custom-control-label:before{background-color:rgba(0,123,255,.5)}.custom-checkbox .custom-control-input:disabled:indeterminate~.custom-control-label:before{background-color:rgba(0,123,255,.5)}.custom-radio .custom-control-label:before{border-radius:50%}.custom-radio .custom-control-input:checked~.custom-control-label:after{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E")}.custom-radio .custom-control-input:disabled:checked~.custom-control-label:before{background-color:rgba(0,123,255,.5)}.custom-switch{padding-left:2.25rem}.custom-switch .custom-control-label:before{border-radius:.5rem;left:-2.25rem;pointer-events:all;width:1.75rem}.custom-switch .custom-control-label:after{background-color:#adb5bd;border-radius:.5rem;height:calc(1rem - 4px);left:calc(-2.25rem + 2px);top:calc(.25rem + 2px);transition:transform .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;width:calc(1rem - 4px)}@media (prefers-reduced-motion:reduce){.custom-switch .custom-control-label:after{transition:none}}.custom-switch .custom-control-input:checked~.custom-control-label:after{background-color:#fff;transform:translateX(.75rem)}.custom-switch .custom-control-input:disabled:checked~.custom-control-label:before{background-color:rgba(0,123,255,.5)}.custom-select{-webkit-appearance:none;-moz-appearance:none;appearance:none;background:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3E%3Cpath fill='%23343a40' d='M2 0 0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right .75rem center/8px 10px;background-color:#fff;border:1px solid #ced4da;border-radius:.25rem;color:#495057;display:inline-block;font-size:1rem;font-weight:400;height:calc(1.5em + .75rem + 2px);line-height:1.5;padding:.375rem 1.75rem .375rem .75rem;vertical-align:middle;width:100%}.custom-select:focus{border-color:#80bdff;box-shadow:0 0 0 .2rem rgba(0,123,255,.25);outline:0}.custom-select:focus::-ms-value{background-color:#fff;color:#495057}.custom-select[multiple],.custom-select[size]:not([size="1"]){background-image:none;height:auto;padding-right:.75rem}.custom-select:disabled{background-color:#e9ecef;color:#6c757d}.custom-select::-ms-expand{display:none}.custom-select-sm{font-size:.875rem;height:calc(1.5em + .5rem + 2px);padding-bottom:.25rem;padding-left:.5rem;padding-top:.25rem}.custom-select-lg{font-size:1.25rem;height:calc(1.5em + 1rem + 2px);padding-bottom:.5rem;padding-left:1rem;padding-top:.5rem}.custom-file{display:inline-block;margin-bottom:0}.custom-file,.custom-file-input{height:calc(1.5em + .75rem + 2px);position:relative;width:100%}.custom-file-input{margin:0;opacity:0;z-index:2}.custom-file-input:focus~.custom-file-label{border-color:#80bdff;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.custom-file-input:disabled~.custom-file-label{background-color:#e9ecef}.custom-file-input:lang(en)~.custom-file-label:after{content:"Browse"}.custom-file-input~.custom-file-label[data-browse]:after{content:attr(data-browse)}.custom-file-label{background-color:#fff;border:1px solid #ced4da;border-radius:.25rem;font-weight:400;height:calc(1.5em + .75rem + 2px);left:0;z-index:1}.custom-file-label,.custom-file-label:after{color:#495057;line-height:1.5;padding:.375rem .75rem;position:absolute;right:0;top:0}.custom-file-label:after{background-color:#e9ecef;border-left:inherit;border-radius:0 .25rem .25rem 0;bottom:0;content:"Browse";display:block;height:calc(1.5em + .75rem);z-index:3}.custom-range{-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:transparent;height:1.4rem;padding:0;width:100%}.custom-range:focus{outline:0}.custom-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range:focus::-ms-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range::-moz-focus-outer{border:0}.custom-range::-webkit-slider-thumb{-webkit-appearance:none;appearance:none;background-color:#007bff;border:0;border-radius:1rem;height:1rem;margin-top:-.25rem;-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;width:1rem}@media (prefers-reduced-motion:reduce){.custom-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}.custom-range::-webkit-slider-thumb:active{background-color:#b3d7ff}.custom-range::-webkit-slider-runnable-track{background-color:#dee2e6;border-color:transparent;border-radius:1rem;color:transparent;cursor:pointer;height:.5rem;width:100%}.custom-range::-moz-range-thumb{-moz-appearance:none;appearance:none;background-color:#007bff;border:0;border-radius:1rem;height:1rem;-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;width:1rem}@media (prefers-reduced-motion:reduce){.custom-range::-moz-range-thumb{-moz-transition:none;transition:none}}.custom-range::-moz-range-thumb:active{background-color:#b3d7ff}.custom-range::-moz-range-track{background-color:#dee2e6;border-color:transparent;border-radius:1rem;color:transparent;cursor:pointer;height:.5rem;width:100%}.custom-range::-ms-thumb{appearance:none;background-color:#007bff;border:0;border-radius:1rem;height:1rem;margin-left:.2rem;margin-right:.2rem;margin-top:0;-ms-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;width:1rem}@media (prefers-reduced-motion:reduce){.custom-range::-ms-thumb{-ms-transition:none;transition:none}}.custom-range::-ms-thumb:active{background-color:#b3d7ff}.custom-range::-ms-track{background-color:transparent;border-color:transparent;border-width:.5rem;color:transparent;cursor:pointer;height:.5rem;width:100%}.custom-range::-ms-fill-lower,.custom-range::-ms-fill-upper{background-color:#dee2e6;border-radius:1rem}.custom-range::-ms-fill-upper{margin-right:15px}.custom-range:disabled::-webkit-slider-thumb{background-color:#adb5bd}.custom-range:disabled::-webkit-slider-runnable-track{cursor:default}.custom-range:disabled::-moz-range-thumb{background-color:#adb5bd}.custom-range:disabled::-moz-range-track{cursor:default}.custom-range:disabled::-ms-thumb{background-color:#adb5bd}.custom-control-label:before,.custom-file-label,.custom-select{transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.custom-control-label:before,.custom-file-label,.custom-select{transition:none}}.nav{display:flex;flex-wrap:wrap;list-style:none;margin-bottom:0;padding-left:0}.nav-link{display:block;padding:.5rem 1rem}.nav-link:focus,.nav-link:hover{text-decoration:none}.nav-link.disabled{color:#6c757d;cursor:default;pointer-events:none}.nav-tabs{border-bottom:1px solid #dee2e6}.nav-tabs .nav-item{margin-bottom:-1px}.nav-tabs .nav-link{border:1px solid transparent;border-top-left-radius:.25rem;border-top-right-radius:.25rem}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{border-color:#e9ecef #e9ecef #dee2e6}.nav-tabs .nav-link.disabled{background-color:transparent;border-color:transparent;color:#6c757d}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{background-color:#fff;border-color:#dee2e6 #dee2e6 #fff;color:#495057}.nav-tabs .dropdown-menu{border-top-left-radius:0;border-top-right-radius:0;margin-top:-1px}.nav-pills .nav-link{border-radius:.25rem}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{background-color:#007bff;color:#fff}.nav-fill .nav-item{flex:1 1 auto;text-align:center}.nav-justified .nav-item{flex-basis:0;flex-grow:1;text-align:center}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{padding:.5rem 1rem;position:relative}.navbar,.navbar>.container,.navbar>.container-fluid{align-items:center;display:flex;flex-wrap:wrap;justify-content:space-between}.navbar-brand{display:inline-block;font-size:1.25rem;line-height:inherit;margin-right:1rem;padding-bottom:.3125rem;padding-top:.3125rem;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{text-decoration:none}.navbar-nav{display:flex;flex-direction:column;list-style:none;margin-bottom:0;padding-left:0}.navbar-nav .nav-link{padding-left:0;padding-right:0}.navbar-nav .dropdown-menu{float:none;position:static}.navbar-text{display:inline-block;padding-bottom:.5rem;padding-top:.5rem}.navbar-collapse{align-items:center;flex-basis:100%;flex-grow:1}.navbar-toggler{background-color:transparent;border:1px solid transparent;border-radius:.25rem;font-size:1.25rem;line-height:1;padding:.25rem .75rem}.navbar-toggler:focus,.navbar-toggler:hover{text-decoration:none}.navbar-toggler-icon{background:no-repeat 50%;background-size:100% 100%;content:"";display:inline-block;height:1.5em;vertical-align:middle;width:1.5em}@media (max-width:575.98px){.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{padding-left:0;padding-right:0}}@media (min-width:576px){.navbar-expand-sm{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-left:.5rem;padding-right:.5rem}.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{flex-wrap:nowrap}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}}@media (max-width:767.98px){.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{padding-left:0;padding-right:0}}@media (min-width:768px){.navbar-expand-md{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-left:.5rem;padding-right:.5rem}.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{flex-wrap:nowrap}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}}@media (max-width:991.98px){.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{padding-left:0;padding-right:0}}@media (min-width:992px){.navbar-expand-lg{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-left:.5rem;padding-right:.5rem}.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{flex-wrap:nowrap}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}}@media (max-width:1199.98px){.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{padding-left:0;padding-right:0}}@media (min-width:1200px){.navbar-expand-xl{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-left:.5rem;padding-right:.5rem}.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{flex-wrap:nowrap}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}}.navbar-expand{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand>.container,.navbar-expand>.container-fluid{padding-left:0;padding-right:0}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-left:.5rem;padding-right:.5rem}.navbar-expand>.container,.navbar-expand>.container-fluid{flex-wrap:nowrap}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-light .navbar-brand,.navbar-light .navbar-brand:focus,.navbar-light .navbar-brand:hover{color:rgba(0,0,0,.9)}.navbar-light .navbar-nav .nav-link{color:rgba(0,0,0,.5)}.navbar-light .navbar-nav .nav-link:focus,.navbar-light .navbar-nav .nav-link:hover{color:rgba(0,0,0,.7)}.navbar-light .navbar-nav .nav-link.disabled{color:rgba(0,0,0,.3)}.navbar-light .navbar-nav .active>.nav-link,.navbar-light .navbar-nav .nav-link.active,.navbar-light .navbar-nav .nav-link.show,.navbar-light .navbar-nav .show>.nav-link{color:rgba(0,0,0,.9)}.navbar-light .navbar-toggler{border-color:rgba(0,0,0,.1);color:rgba(0,0,0,.5)}.navbar-light .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-light .navbar-text{color:rgba(0,0,0,.5)}.navbar-light .navbar-text a,.navbar-light .navbar-text a:focus,.navbar-light .navbar-text a:hover{color:rgba(0,0,0,.9)}.navbar-dark .navbar-brand,.navbar-dark .navbar-brand:focus,.navbar-dark .navbar-brand:hover{color:#fff}.navbar-dark .navbar-nav .nav-link{color:hsla(0,0%,100%,.5)}.navbar-dark .navbar-nav .nav-link:focus,.navbar-dark .navbar-nav .nav-link:hover{color:hsla(0,0%,100%,.75)}.navbar-dark .navbar-nav .nav-link.disabled{color:hsla(0,0%,100%,.25)}.navbar-dark .navbar-nav .active>.nav-link,.navbar-dark .navbar-nav .nav-link.active,.navbar-dark .navbar-nav .nav-link.show,.navbar-dark .navbar-nav .show>.nav-link{color:#fff}.navbar-dark .navbar-toggler{border-color:hsla(0,0%,100%,.1);color:hsla(0,0%,100%,.5)}.navbar-dark .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-dark .navbar-text{color:hsla(0,0%,100%,.5)}.navbar-dark .navbar-text a,.navbar-dark .navbar-text a:focus,.navbar-dark .navbar-text a:hover{color:#fff}.card{word-wrap:break-word;background-clip:border-box;background-color:#fff;border:1px solid rgba(0,0,0,.125);border-radius:.25rem;display:flex;flex-direction:column;min-width:0;position:relative}.card>hr{margin-left:0;margin-right:0}.card>.list-group:first-child .list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card>.list-group:last-child .list-group-item:last-child{border-bottom-left-radius:.25rem;border-bottom-right-radius:.25rem}.card-body{flex:1 1 auto;padding:1.25rem}.card-title{margin-bottom:.75rem}.card-subtitle{margin-top:-.375rem}.card-subtitle,.card-text:last-child{margin-bottom:0}.card-link:hover{text-decoration:none}.card-link+.card-link{margin-left:1.25rem}.card-header{background-color:rgba(0,0,0,.03);border-bottom:1px solid rgba(0,0,0,.125);margin-bottom:0;padding:.75rem 1.25rem}.card-header:first-child{border-radius:calc(.25rem - 1px) calc(.25rem - 1px) 0 0}.card-header+.list-group .list-group-item:first-child{border-top:0}.card-footer{background-color:rgba(0,0,0,.03);border-top:1px solid rgba(0,0,0,.125);padding:.75rem 1.25rem}.card-footer:last-child{border-radius:0 0 calc(.25rem - 1px) calc(.25rem - 1px)}.card-header-tabs{border-bottom:0;margin-bottom:-.75rem}.card-header-pills,.card-header-tabs{margin-left:-.625rem;margin-right:-.625rem}.card-img-overlay{bottom:0;left:0;padding:1.25rem;position:absolute;right:0;top:0}.card-img{border-radius:calc(.25rem - 1px);width:100%}.card-img-top{border-top-left-radius:calc(.25rem - 1px);border-top-right-radius:calc(.25rem - 1px);width:100%}.card-img-bottom{border-bottom-left-radius:calc(.25rem - 1px);border-bottom-right-radius:calc(.25rem - 1px);width:100%}.card-deck{display:flex;flex-direction:column}.card-deck .card{margin-bottom:15px}@media (min-width:576px){.card-deck{flex-flow:row wrap;margin-left:-15px;margin-right:-15px}.card-deck .card{display:flex;flex:1 0 0%;flex-direction:column;margin-bottom:0;margin-left:15px;margin-right:15px}}.card-group{display:flex;flex-direction:column}.card-group>.card{margin-bottom:15px}@media (min-width:576px){.card-group{flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{border-left:0;margin-left:0}.card-group>.card:not(:last-child){border-bottom-right-radius:0;border-top-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-bottom-left-radius:0;border-top-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.card-columns .card{margin-bottom:.75rem}@media (min-width:576px){.card-columns{-moz-column-count:3;column-count:3;-moz-column-gap:1.25rem;column-gap:1.25rem;orphans:1;widows:1}.card-columns .card{display:inline-block;width:100%}}.accordion>.card{overflow:hidden}.accordion>.card:not(:first-of-type) .card-header:first-child{border-radius:0}.accordion>.card:not(:first-of-type):not(:last-of-type){border-bottom:0;border-radius:0}.accordion>.card:first-of-type{border-bottom:0;border-bottom-left-radius:0;border-bottom-right-radius:0}.accordion>.card:last-of-type{border-top-left-radius:0;border-top-right-radius:0}.accordion>.card .card-header{margin-bottom:-1px}.breadcrumb{background-color:#e9ecef;border-radius:.25rem;display:flex;flex-wrap:wrap;list-style:none;margin-bottom:1rem;padding:.75rem 1rem}.breadcrumb-item+.breadcrumb-item{padding-left:.5rem}.breadcrumb-item+.breadcrumb-item:before{color:#6c757d;content:"/";display:inline-block;padding-right:.5rem}.breadcrumb-item+.breadcrumb-item:hover:before{text-decoration:underline;text-decoration:none}.breadcrumb-item.active{color:#6c757d}.pagination{border-radius:.25rem;display:flex;list-style:none;padding-left:0}.page-link{background-color:#fff;border:1px solid #dee2e6;color:#007bff;display:block;line-height:1.25;margin-left:-1px;padding:.5rem .75rem;position:relative}.page-link:hover{background-color:#e9ecef;border-color:#dee2e6;color:#0056b3;text-decoration:none;z-index:2}.page-link:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.25);outline:0;z-index:2}.page-item:first-child .page-link{border-bottom-left-radius:.25rem;border-top-left-radius:.25rem;margin-left:0}.page-item:last-child .page-link{border-bottom-right-radius:.25rem;border-top-right-radius:.25rem}.page-item.active .page-link{background-color:#007bff;border-color:#007bff;color:#fff;z-index:1}.page-item.disabled .page-link{background-color:#fff;border-color:#dee2e6;color:#6c757d;cursor:auto;pointer-events:none}.pagination-lg .page-link{font-size:1.25rem;line-height:1.5;padding:.75rem 1.5rem}.pagination-lg .page-item:first-child .page-link{border-bottom-left-radius:.3rem;border-top-left-radius:.3rem}.pagination-lg .page-item:last-child .page-link{border-bottom-right-radius:.3rem;border-top-right-radius:.3rem}.pagination-sm .page-link{font-size:.875rem;line-height:1.5;padding:.25rem .5rem}.pagination-sm .page-item:first-child .page-link{border-bottom-left-radius:.2rem;border-top-left-radius:.2rem}.pagination-sm .page-item:last-child .page-link{border-bottom-right-radius:.2rem;border-top-right-radius:.2rem}.badge{border-radius:.25rem;display:inline-block;font-size:75%;font-weight:700;line-height:1;padding:.25em .4em;text-align:center;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;vertical-align:baseline;white-space:nowrap}@media (prefers-reduced-motion:reduce){.badge{transition:none}}a.badge:focus,a.badge:hover{text-decoration:none}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.badge-pill{border-radius:10rem;padding-left:.6em;padding-right:.6em}.badge-primary{background-color:#007bff;color:#fff}a.badge-primary:focus,a.badge-primary:hover{background-color:#0062cc;color:#fff}a.badge-primary.focus,a.badge-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5);outline:0}.badge-secondary{background-color:#6c757d;color:#fff}a.badge-secondary:focus,a.badge-secondary:hover{background-color:#545b62;color:#fff}a.badge-secondary.focus,a.badge-secondary:focus{box-shadow:0 0 0 .2rem hsla(208,7%,46%,.5);outline:0}.badge-success{background-color:#28a745;color:#fff}a.badge-success:focus,a.badge-success:hover{background-color:#1e7e34;color:#fff}a.badge-success.focus,a.badge-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5);outline:0}.badge-info{background-color:#17a2b8;color:#fff}a.badge-info:focus,a.badge-info:hover{background-color:#117a8b;color:#fff}a.badge-info.focus,a.badge-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5);outline:0}.badge-warning{background-color:#ffc107;color:#212529}a.badge-warning:focus,a.badge-warning:hover{background-color:#d39e00;color:#212529}a.badge-warning.focus,a.badge-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5);outline:0}.badge-danger{background-color:#dc3545;color:#fff}a.badge-danger:focus,a.badge-danger:hover{background-color:#bd2130;color:#fff}a.badge-danger.focus,a.badge-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5);outline:0}.badge-light{background-color:#f8f9fa;color:#212529}a.badge-light:focus,a.badge-light:hover{background-color:#dae0e5;color:#212529}a.badge-light.focus,a.badge-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5);outline:0}.badge-dark{background-color:#343a40;color:#fff}a.badge-dark:focus,a.badge-dark:hover{background-color:#1d2124;color:#fff}a.badge-dark.focus,a.badge-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5);outline:0}.jumbotron{background-color:#e9ecef;border-radius:.3rem;margin-bottom:2rem;padding:2rem 1rem}@media (min-width:576px){.jumbotron{padding:4rem 2rem}}.jumbotron-fluid{border-radius:0;padding-left:0;padding-right:0}.alert{border:1px solid transparent;border-radius:.25rem;margin-bottom:1rem;padding:.75rem 1.25rem;position:relative}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:4rem}.alert-dismissible .close{color:inherit;padding:.75rem 1.25rem;position:absolute;right:0;top:0}.alert-primary{background-color:#cce5ff;border-color:#b8daff;color:#004085}.alert-primary hr{border-top-color:#9fcdff}.alert-primary .alert-link{color:#002752}.alert-secondary{background-color:#e2e3e5;border-color:#d6d8db;color:#383d41}.alert-secondary hr{border-top-color:#c8cbcf}.alert-secondary .alert-link{color:#202326}.alert-success{background-color:#d4edda;border-color:#c3e6cb;color:#155724}.alert-success hr{border-top-color:#b1dfbb}.alert-success .alert-link{color:#0b2e13}.alert-info{background-color:#d1ecf1;border-color:#bee5eb;color:#0c5460}.alert-info hr{border-top-color:#abdde5}.alert-info .alert-link{color:#062c33}.alert-warning{background-color:#fff3cd;border-color:#ffeeba;color:#856404}.alert-warning hr{border-top-color:#ffe8a1}.alert-warning .alert-link{color:#533f03}.alert-danger{background-color:#f8d7da;border-color:#f5c6cb;color:#721c24}.alert-danger hr{border-top-color:#f1b0b7}.alert-danger .alert-link{color:#491217}.alert-light{background-color:#fefefe;border-color:#fdfdfe;color:#818182}.alert-light hr{border-top-color:#ececf6}.alert-light .alert-link{color:#686868}.alert-dark{background-color:#d6d8d9;border-color:#c6c8ca;color:#1b1e21}.alert-dark hr{border-top-color:#b9bbbe}.alert-dark .alert-link{color:#040505}@-webkit-keyframes progress-bar-stripes{0%{background-position:1rem 0}to{background-position:0 0}}@keyframes progress-bar-stripes{0%{background-position:1rem 0}to{background-position:0 0}}.progress{background-color:#e9ecef;border-radius:.25rem;display:flex;font-size:.75rem;height:1rem;overflow:hidden}.progress-bar{background-color:#007bff;color:#fff;display:flex;flex-direction:column;justify-content:center;text-align:center;transition:width .6s ease;white-space:nowrap}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,hsla(0,0%,100%,.15) 25%,transparent 0,transparent 50%,hsla(0,0%,100%,.15) 0,hsla(0,0%,100%,.15) 75%,transparent 0,transparent);background-size:1rem 1rem}.progress-bar-animated{-webkit-animation:progress-bar-stripes 1s linear infinite;animation:progress-bar-stripes 1s linear infinite}@media (prefers-reduced-motion:reduce){.progress-bar-animated{-webkit-animation:none;animation:none}}.media{align-items:flex-start;display:flex}.media-body{flex:1}.list-group{display:flex;flex-direction:column;margin-bottom:0;padding-left:0}.list-group-item-action{color:#495057;text-align:inherit;width:100%}.list-group-item-action:focus,.list-group-item-action:hover{background-color:#f8f9fa;color:#495057;text-decoration:none;z-index:1}.list-group-item-action:active{background-color:#e9ecef;color:#212529}.list-group-item{background-color:#fff;border:1px solid rgba(0,0,0,.125);display:block;margin-bottom:-1px;padding:.75rem 1.25rem;position:relative}.list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.list-group-item:last-child{border-bottom-left-radius:.25rem;border-bottom-right-radius:.25rem;margin-bottom:0}.list-group-item.disabled,.list-group-item:disabled{background-color:#fff;color:#6c757d;pointer-events:none}.list-group-item.active{background-color:#007bff;border-color:#007bff;color:#fff;z-index:2}.list-group-horizontal{flex-direction:row}.list-group-horizontal .list-group-item{margin-bottom:0;margin-right:-1px}.list-group-horizontal .list-group-item:first-child{border-bottom-left-radius:.25rem;border-top-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal .list-group-item:last-child{border-bottom-left-radius:0;border-bottom-right-radius:.25rem;border-top-right-radius:.25rem;margin-right:0}@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm .list-group-item{margin-bottom:0;margin-right:-1px}.list-group-horizontal-sm .list-group-item:first-child{border-bottom-left-radius:.25rem;border-top-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-sm .list-group-item:last-child{border-bottom-left-radius:0;border-bottom-right-radius:.25rem;border-top-right-radius:.25rem;margin-right:0}}@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md .list-group-item{margin-bottom:0;margin-right:-1px}.list-group-horizontal-md .list-group-item:first-child{border-bottom-left-radius:.25rem;border-top-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-md .list-group-item:last-child{border-bottom-left-radius:0;border-bottom-right-radius:.25rem;border-top-right-radius:.25rem;margin-right:0}}@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg .list-group-item{margin-bottom:0;margin-right:-1px}.list-group-horizontal-lg .list-group-item:first-child{border-bottom-left-radius:.25rem;border-top-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-lg .list-group-item:last-child{border-bottom-left-radius:0;border-bottom-right-radius:.25rem;border-top-right-radius:.25rem;margin-right:0}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl .list-group-item{margin-bottom:0;margin-right:-1px}.list-group-horizontal-xl .list-group-item:first-child{border-bottom-left-radius:.25rem;border-top-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-xl .list-group-item:last-child{border-bottom-left-radius:0;border-bottom-right-radius:.25rem;border-top-right-radius:.25rem;margin-right:0}}.list-group-flush .list-group-item{border-left:0;border-radius:0;border-right:0}.list-group-flush .list-group-item:last-child{margin-bottom:-1px}.list-group-flush:first-child .list-group-item:first-child{border-top:0}.list-group-flush:last-child .list-group-item:last-child{border-bottom:0;margin-bottom:0}.list-group-item-primary{background-color:#b8daff;color:#004085}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{background-color:#9fcdff;color:#004085}.list-group-item-primary.list-group-item-action.active{background-color:#004085;border-color:#004085;color:#fff}.list-group-item-secondary{background-color:#d6d8db;color:#383d41}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{background-color:#c8cbcf;color:#383d41}.list-group-item-secondary.list-group-item-action.active{background-color:#383d41;border-color:#383d41;color:#fff}.list-group-item-success{background-color:#c3e6cb;color:#155724}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{background-color:#b1dfbb;color:#155724}.list-group-item-success.list-group-item-action.active{background-color:#155724;border-color:#155724;color:#fff}.list-group-item-info{background-color:#bee5eb;color:#0c5460}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{background-color:#abdde5;color:#0c5460}.list-group-item-info.list-group-item-action.active{background-color:#0c5460;border-color:#0c5460;color:#fff}.list-group-item-warning{background-color:#ffeeba;color:#856404}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{background-color:#ffe8a1;color:#856404}.list-group-item-warning.list-group-item-action.active{background-color:#856404;border-color:#856404;color:#fff}.list-group-item-danger{background-color:#f5c6cb;color:#721c24}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{background-color:#f1b0b7;color:#721c24}.list-group-item-danger.list-group-item-action.active{background-color:#721c24;border-color:#721c24;color:#fff}.list-group-item-light{background-color:#fdfdfe;color:#818182}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{background-color:#ececf6;color:#818182}.list-group-item-light.list-group-item-action.active{background-color:#818182;border-color:#818182;color:#fff}.list-group-item-dark{background-color:#c6c8ca;color:#1b1e21}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{background-color:#b9bbbe;color:#1b1e21}.list-group-item-dark.list-group-item-action.active{background-color:#1b1e21;border-color:#1b1e21;color:#fff}.close{color:#000;float:right;font-size:1.5rem;font-weight:700;line-height:1;opacity:.5;text-shadow:0 1px 0 #fff}.close:hover{color:#000;text-decoration:none}.close:not(:disabled):not(.disabled):focus,.close:not(:disabled):not(.disabled):hover{opacity:.75}button.close{-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:transparent;border:0;padding:0}a.close.disabled{pointer-events:none}.toast{-webkit-backdrop-filter:blur(10px);backdrop-filter:blur(10px);background-clip:padding-box;background-color:hsla(0,0%,100%,.85);border:1px solid rgba(0,0,0,.1);border-radius:.25rem;box-shadow:0 .25rem .75rem rgba(0,0,0,.1);font-size:.875rem;max-width:350px;opacity:0;overflow:hidden}.toast:not(:last-child){margin-bottom:.75rem}.toast.showing{opacity:1}.toast.show{display:block;opacity:1}.toast.hide{display:none}.toast-header{align-items:center;background-clip:padding-box;background-color:hsla(0,0%,100%,.85);border-bottom:1px solid rgba(0,0,0,.05);color:#6c757d;display:flex;padding:.25rem .75rem}.toast-body{padding:.75rem}.modal-open{overflow:hidden}.modal-open .modal{overflow-x:hidden;overflow-y:auto}.modal{display:none;height:100%;left:0;outline:0;overflow:hidden;position:fixed;top:0;width:100%;z-index:1050}.modal-dialog{margin:.5rem;pointer-events:none;position:relative;width:auto}.modal.fade .modal-dialog{transform:translateY(-50px);transition:transform .3s ease-out}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal-dialog-scrollable{display:flex;max-height:calc(100% - 1rem)}.modal-dialog-scrollable .modal-content{max-height:calc(100vh - 1rem);overflow:hidden}.modal-dialog-scrollable .modal-footer,.modal-dialog-scrollable .modal-header{flex-shrink:0}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{align-items:center;display:flex;min-height:calc(100% - 1rem)}.modal-dialog-centered:before{content:"";display:block;height:calc(100vh - 1rem)}.modal-dialog-centered.modal-dialog-scrollable{flex-direction:column;height:100%;justify-content:center}.modal-dialog-centered.modal-dialog-scrollable .modal-content{max-height:none}.modal-dialog-centered.modal-dialog-scrollable:before{content:none}.modal-content{background-clip:padding-box;background-color:#fff;border:1px solid rgba(0,0,0,.2);border-radius:.3rem;display:flex;flex-direction:column;outline:0;pointer-events:auto;position:relative;width:100%}.modal-backdrop{background-color:#000;height:100vh;left:0;position:fixed;top:0;width:100vw;z-index:1040}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:.5}.modal-header{align-items:flex-start;border-bottom:1px solid #dee2e6;border-top-left-radius:.3rem;border-top-right-radius:.3rem;display:flex;justify-content:space-between;padding:1rem}.modal-header .close{margin:-1rem -1rem -1rem auto;padding:1rem}.modal-title{line-height:1.5;margin-bottom:0}.modal-body{flex:1 1 auto;padding:1rem;position:relative}.modal-footer{align-items:center;border-bottom-left-radius:.3rem;border-bottom-right-radius:.3rem;border-top:1px solid #dee2e6;display:flex;justify-content:flex-end;padding:1rem}.modal-footer>:not(:first-child){margin-left:.25rem}.modal-footer>:not(:last-child){margin-right:.25rem}.modal-scrollbar-measure{height:50px;overflow:scroll;position:absolute;top:-9999px;width:50px}@media (min-width:576px){.modal-dialog{margin:1.75rem auto;max-width:500px}.modal-dialog-scrollable{max-height:calc(100% - 3.5rem)}.modal-dialog-scrollable .modal-content{max-height:calc(100vh - 3.5rem)}.modal-dialog-centered{min-height:calc(100% - 3.5rem)}.modal-dialog-centered:before{height:calc(100vh - 3.5rem)}.modal-sm{max-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{max-width:800px}}@media (min-width:1200px){.modal-xl{max-width:1140px}}.tooltip{word-wrap:break-word;display:block;font-family:-apple-system,BlinkMacSystemFont,Segoe UI,Roboto,Helvetica Neue,Arial,Noto Sans,sans-serif,Apple Color Emoji,Segoe UI Emoji,Segoe UI Symbol,Noto Color Emoji;font-size:.875rem;font-style:normal;font-weight:400;letter-spacing:normal;line-break:auto;line-height:1.5;margin:0;opacity:0;position:absolute;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;white-space:normal;word-break:normal;word-spacing:normal;z-index:1070}.tooltip.show{opacity:.9}.tooltip .arrow{display:block;height:.4rem;position:absolute;width:.8rem}.tooltip .arrow:before{border-color:transparent;border-style:solid;content:"";position:absolute}.bs-tooltip-auto[x-placement^=top],.bs-tooltip-top{padding:.4rem 0}.bs-tooltip-auto[x-placement^=top] .arrow,.bs-tooltip-top .arrow{bottom:0}.bs-tooltip-auto[x-placement^=top] .arrow:before,.bs-tooltip-top .arrow:before{border-top-color:#000;border-width:.4rem .4rem 0;top:0}.bs-tooltip-auto[x-placement^=right],.bs-tooltip-right{padding:0 .4rem}.bs-tooltip-auto[x-placement^=right] .arrow,.bs-tooltip-right .arrow{height:.8rem;left:0;width:.4rem}.bs-tooltip-auto[x-placement^=right] .arrow:before,.bs-tooltip-right .arrow:before{border-right-color:#000;border-width:.4rem .4rem .4rem 0;right:0}.bs-tooltip-auto[x-placement^=bottom],.bs-tooltip-bottom{padding:.4rem 0}.bs-tooltip-auto[x-placement^=bottom] .arrow,.bs-tooltip-bottom .arrow{top:0}.bs-tooltip-auto[x-placement^=bottom] .arrow:before,.bs-tooltip-bottom .arrow:before{border-bottom-color:#000;border-width:0 .4rem .4rem;bottom:0}.bs-tooltip-auto[x-placement^=left],.bs-tooltip-left{padding:0 .4rem}.bs-tooltip-auto[x-placement^=left] .arrow,.bs-tooltip-left .arrow{height:.8rem;right:0;width:.4rem}.bs-tooltip-auto[x-placement^=left] .arrow:before,.bs-tooltip-left .arrow:before{border-left-color:#000;border-width:.4rem 0 .4rem .4rem;left:0}.tooltip-inner{background-color:#000;border-radius:.25rem;color:#fff;max-width:200px;padding:.25rem .5rem;text-align:center}.popover{word-wrap:break-word;background-clip:padding-box;background-color:#fff;border:1px solid rgba(0,0,0,.2);border-radius:.3rem;font-family:-apple-system,BlinkMacSystemFont,Segoe UI,Roboto,Helvetica Neue,Arial,Noto Sans,sans-serif,Apple Color Emoji,Segoe UI Emoji,Segoe UI Symbol,Noto Color Emoji;font-size:.875rem;font-style:normal;font-weight:400;left:0;letter-spacing:normal;line-break:auto;line-height:1.5;max-width:276px;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;top:0;white-space:normal;word-break:normal;word-spacing:normal;z-index:1060}.popover,.popover .arrow{display:block;position:absolute}.popover .arrow{height:.5rem;margin:0 .3rem;width:1rem}.popover .arrow:after,.popover .arrow:before{border-color:transparent;border-style:solid;content:"";display:block;position:absolute}.bs-popover-auto[x-placement^=top],.bs-popover-top{margin-bottom:.5rem}.bs-popover-auto[x-placement^=top]>.arrow,.bs-popover-top>.arrow{bottom:calc(-.5rem + -1px)}.bs-popover-auto[x-placement^=top]>.arrow:before,.bs-popover-top>.arrow:before{border-top-color:rgba(0,0,0,.25);border-width:.5rem .5rem 0;bottom:0}.bs-popover-auto[x-placement^=top]>.arrow:after,.bs-popover-top>.arrow:after{border-top-color:#fff;border-width:.5rem .5rem 0;bottom:1px}.bs-popover-auto[x-placement^=right],.bs-popover-right{margin-left:.5rem}.bs-popover-auto[x-placement^=right]>.arrow,.bs-popover-right>.arrow{height:1rem;left:calc(-.5rem + -1px);margin:.3rem 0;width:.5rem}.bs-popover-auto[x-placement^=right]>.arrow:before,.bs-popover-right>.arrow:before{border-right-color:rgba(0,0,0,.25);border-width:.5rem .5rem .5rem 0;left:0}.bs-popover-auto[x-placement^=right]>.arrow:after,.bs-popover-right>.arrow:after{border-right-color:#fff;border-width:.5rem .5rem .5rem 0;left:1px}.bs-popover-auto[x-placement^=bottom],.bs-popover-bottom{margin-top:.5rem}.bs-popover-auto[x-placement^=bottom]>.arrow,.bs-popover-bottom>.arrow{top:calc(-.5rem + -1px)}.bs-popover-auto[x-placement^=bottom]>.arrow:before,.bs-popover-bottom>.arrow:before{border-bottom-color:rgba(0,0,0,.25);border-width:0 .5rem .5rem;top:0}.bs-popover-auto[x-placement^=bottom]>.arrow:after,.bs-popover-bottom>.arrow:after{border-bottom-color:#fff;border-width:0 .5rem .5rem;top:1px}.bs-popover-auto[x-placement^=bottom] .popover-header:before,.bs-popover-bottom .popover-header:before{border-bottom:1px solid #f7f7f7;content:"";display:block;left:50%;margin-left:-.5rem;position:absolute;top:0;width:1rem}.bs-popover-auto[x-placement^=left],.bs-popover-left{margin-right:.5rem}.bs-popover-auto[x-placement^=left]>.arrow,.bs-popover-left>.arrow{height:1rem;margin:.3rem 0;right:calc(-.5rem + -1px);width:.5rem}.bs-popover-auto[x-placement^=left]>.arrow:before,.bs-popover-left>.arrow:before{border-left-color:rgba(0,0,0,.25);border-width:.5rem 0 .5rem .5rem;right:0}.bs-popover-auto[x-placement^=left]>.arrow:after,.bs-popover-left>.arrow:after{border-left-color:#fff;border-width:.5rem 0 .5rem .5rem;right:1px}.popover-header{background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-top-left-radius:calc(.3rem - 1px);border-top-right-radius:calc(.3rem - 1px);font-size:1rem;margin-bottom:0;padding:.5rem .75rem}.popover-header:empty{display:none}.popover-body{color:#212529;padding:.5rem .75rem}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{overflow:hidden;position:relative;width:100%}.carousel-inner:after{clear:both;content:"";display:block}.carousel-item{-webkit-backface-visibility:hidden;backface-visibility:hidden;display:none;float:left;margin-right:-100%;position:relative;transition:transform .6s ease-in-out;width:100%}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-right,.carousel-item-next:not(.carousel-item-left){transform:translateX(100%)}.active.carousel-item-left,.carousel-item-prev:not(.carousel-item-right){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transform:none;transition-property:opacity}.carousel-fade .carousel-item-next.carousel-item-left,.carousel-fade .carousel-item-prev.carousel-item-right,.carousel-fade .carousel-item.active{opacity:1;z-index:1}.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-right{opacity:0;transition:opacity 0s .6s;z-index:0}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-right{transition:none}}.carousel-control-next,.carousel-control-prev{align-items:center;bottom:0;color:#fff;display:flex;justify-content:center;opacity:.5;position:absolute;text-align:center;top:0;transition:opacity .15s ease;width:15%;z-index:1}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;opacity:.9;outline:0;text-decoration:none}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{background:no-repeat 50%/100% 100%;display:inline-block;height:20px;width:20px}.carousel-control-prev-icon{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='m5.25 0-4 4 4 4 1.5-1.5L4.25 4l2.5-2.5L5.25 0z'/%3E%3C/svg%3E")}.carousel-control-next-icon{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='m2.75 0-1.5 1.5L3.75 4l-2.5 2.5L2.75 8l4-4-4-4z'/%3E%3C/svg%3E")}.carousel-indicators{bottom:0;display:flex;justify-content:center;left:0;list-style:none;margin-left:15%;margin-right:15%;padding-left:0;position:absolute;right:0;z-index:15}.carousel-indicators li{background-clip:padding-box;background-color:#fff;border-bottom:10px solid transparent;border-top:10px solid transparent;box-sizing:content-box;cursor:pointer;flex:0 1 auto;height:3px;margin-left:3px;margin-right:3px;opacity:.5;text-indent:-999px;transition:opacity .6s ease;width:30px}@media (prefers-reduced-motion:reduce){.carousel-indicators li{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{bottom:20px;color:#fff;left:15%;padding-bottom:20px;padding-top:20px;position:absolute;right:15%;text-align:center;z-index:10}@-webkit-keyframes spinner-border{to{transform:rotate(1turn)}}@keyframes spinner-border{to{transform:rotate(1turn)}}.spinner-border{-webkit-animation:spinner-border .75s linear infinite;animation:spinner-border .75s linear infinite;border:.25em solid;border-radius:50%;border-right:.25em solid transparent;display:inline-block;height:2rem;vertical-align:text-bottom;width:2rem}.spinner-border-sm{border-width:.2em;height:1rem;width:1rem}@-webkit-keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1}}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1}}.spinner-grow{-webkit-animation:spinner-grow .75s linear infinite;animation:spinner-grow .75s linear infinite;background-color:currentColor;border-radius:50%;display:inline-block;height:2rem;opacity:0;vertical-align:text-bottom;width:2rem}.spinner-grow-sm{height:1rem;width:1rem}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.bg-primary{background-color:#007bff!important}a.bg-primary:focus,a.bg-primary:hover,button.bg-primary:focus,button.bg-primary:hover{background-color:#0062cc!important}.bg-secondary{background-color:#6c757d!important}a.bg-secondary:focus,a.bg-secondary:hover,button.bg-secondary:focus,button.bg-secondary:hover{background-color:#545b62!important}.bg-success{background-color:#28a745!important}a.bg-success:focus,a.bg-success:hover,button.bg-success:focus,button.bg-success:hover{background-color:#1e7e34!important}.bg-info{background-color:#17a2b8!important}a.bg-info:focus,a.bg-info:hover,button.bg-info:focus,button.bg-info:hover{background-color:#117a8b!important}.bg-warning{background-color:#ffc107!important}a.bg-warning:focus,a.bg-warning:hover,button.bg-warning:focus,button.bg-warning:hover{background-color:#d39e00!important}.bg-danger{background-color:#dc3545!important}a.bg-danger:focus,a.bg-danger:hover,button.bg-danger:focus,button.bg-danger:hover{background-color:#bd2130!important}.bg-light{background-color:#f8f9fa!important}a.bg-light:focus,a.bg-light:hover,button.bg-light:focus,button.bg-light:hover{background-color:#dae0e5!important}.bg-dark{background-color:#343a40!important}a.bg-dark:focus,a.bg-dark:hover,button.bg-dark:focus,button.bg-dark:hover{background-color:#1d2124!important}.bg-white{background-color:#fff!important}.bg-transparent{background-color:transparent!important}.border{border:1px solid #dee2e6!important}.border-top{border-top:1px solid #dee2e6!important}.border-right{border-right:1px solid #dee2e6!important}.border-bottom{border-bottom:1px solid #dee2e6!important}.border-left{border-left:1px solid #dee2e6!important}.border-0{border:0!important}.border-top-0{border-top:0!important}.border-right-0{border-right:0!important}.border-bottom-0{border-bottom:0!important}.border-left-0{border-left:0!important}.border-primary{border-color:#007bff!important}.border-secondary{border-color:#6c757d!important}.border-success{border-color:#28a745!important}.border-info{border-color:#17a2b8!important}.border-warning{border-color:#ffc107!important}.border-danger{border-color:#dc3545!important}.border-light{border-color:#f8f9fa!important}.border-dark{border-color:#343a40!important}.border-white{border-color:#fff!important}.rounded-sm{border-radius:.2rem!important}.rounded{border-radius:.25rem!important}.rounded-top{border-top-left-radius:.25rem!important}.rounded-right,.rounded-top{border-top-right-radius:.25rem!important}.rounded-bottom,.rounded-right{border-bottom-right-radius:.25rem!important}.rounded-bottom,.rounded-left{border-bottom-left-radius:.25rem!important}.rounded-left{border-top-left-radius:.25rem!important}.rounded-lg{border-radius:.3rem!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:50rem!important}.rounded-0{border-radius:0!important}.clearfix:after{clear:both;content:"";display:block}.d-none{display:none!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}@media (min-width:576px){.d-sm-none{display:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}}@media (min-width:768px){.d-md-none{display:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}}@media (min-width:992px){.d-lg-none{display:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}}@media (min-width:1200px){.d-xl-none{display:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}}@media print{.d-print-none{display:none!important}.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}}.embed-responsive{display:block;overflow:hidden;padding:0;position:relative;width:100%}.embed-responsive:before{content:"";display:block}.embed-responsive .embed-responsive-item,.embed-responsive embed,.embed-responsive iframe,.embed-responsive object,.embed-responsive video{border:0;bottom:0;height:100%;left:0;position:absolute;top:0;width:100%}.embed-responsive-21by9:before{padding-top:42.857143%}.embed-responsive-16by9:before{padding-top:56.25%}.embed-responsive-4by3:before{padding-top:75%}.embed-responsive-1by1:before{padding-top:100%}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.flex-fill{flex:1 1 auto!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}@media (min-width:576px){.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}}@media (min-width:768px){.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}}@media (min-width:992px){.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}}@media (min-width:1200px){.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}}.float-left{float:left!important}.float-right{float:right!important}.float-none{float:none!important}@media (min-width:576px){.float-sm-left{float:left!important}.float-sm-right{float:right!important}.float-sm-none{float:none!important}}@media (min-width:768px){.float-md-left{float:left!important}.float-md-right{float:right!important}.float-md-none{float:none!important}}@media (min-width:992px){.float-lg-left{float:left!important}.float-lg-right{float:right!important}.float-lg-none{float:none!important}}@media (min-width:1200px){.float-xl-left{float:left!important}.float-xl-right{float:right!important}.float-xl-none{float:none!important}}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:sticky!important}.fixed-top{top:0}.fixed-bottom,.fixed-top{left:0;position:fixed;right:0;z-index:1030}.fixed-bottom{bottom:0}@supports (position:sticky){.sticky-top{position:sticky;top:0;z-index:1020}}.sr-only{clip:rect(0,0,0,0);border:0;height:1px;overflow:hidden;padding:0;position:absolute;white-space:nowrap;width:1px}.sr-only-focusable:active,.sr-only-focusable:focus{clip:auto;height:auto;overflow:visible;position:static;white-space:normal;width:auto}.shadow-sm{box-shadow:0 .125rem .25rem rgba(0,0,0,.075)!important}.shadow{box-shadow:0 .5rem 1rem rgba(0,0,0,.15)!important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,.175)!important}.shadow-none{box-shadow:none!important}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mw-100{max-width:100%!important}.mh-100{max-height:100%!important}.min-vw-100{min-width:100vw!important}.min-vh-100{min-height:100vh!important}.vw-100{width:100vw!important}.vh-100{height:100vh!important}.stretched-link:after{background-color:transparent;bottom:0;content:"";left:0;pointer-events:auto;position:absolute;right:0;top:0;z-index:1}.m-0{margin:0!important}.mt-0,.my-0{margin-top:0!important}.mr-0,.mx-0{margin-right:0!important}.mb-0,.my-0{margin-bottom:0!important}.ml-0,.mx-0{margin-left:0!important}.m-1{margin:.25rem!important}.mt-1,.my-1{margin-top:.25rem!important}.mr-1,.mx-1{margin-right:.25rem!important}.mb-1,.my-1{margin-bottom:.25rem!important}.ml-1,.mx-1{margin-left:.25rem!important}.m-2{margin:.5rem!important}.mt-2,.my-2{margin-top:.5rem!important}.mr-2,.mx-2{margin-right:.5rem!important}.mb-2,.my-2{margin-bottom:.5rem!important}.ml-2,.mx-2{margin-left:.5rem!important}.m-3{margin:1rem!important}.mt-3,.my-3{margin-top:1rem!important}.mr-3,.mx-3{margin-right:1rem!important}.mb-3,.my-3{margin-bottom:1rem!important}.ml-3,.mx-3{margin-left:1rem!important}.m-4{margin:1.5rem!important}.mt-4,.my-4{margin-top:1.5rem!important}.mr-4,.mx-4{margin-right:1.5rem!important}.mb-4,.my-4{margin-bottom:1.5rem!important}.ml-4,.mx-4{margin-left:1.5rem!important}.m-5{margin:3rem!important}.mt-5,.my-5{margin-top:3rem!important}.mr-5,.mx-5{margin-right:3rem!important}.mb-5,.my-5{margin-bottom:3rem!important}.ml-5,.mx-5{margin-left:3rem!important}.p-0{padding:0!important}.pt-0,.py-0{padding-top:0!important}.pr-0,.px-0{padding-right:0!important}.pb-0,.py-0{padding-bottom:0!important}.pl-0,.px-0{padding-left:0!important}.p-1{padding:.25rem!important}.pt-1,.py-1{padding-top:.25rem!important}.pr-1,.px-1{padding-right:.25rem!important}.pb-1,.py-1{padding-bottom:.25rem!important}.pl-1,.px-1{padding-left:.25rem!important}.p-2{padding:.5rem!important}.pt-2,.py-2{padding-top:.5rem!important}.pr-2,.px-2{padding-right:.5rem!important}.pb-2,.py-2{padding-bottom:.5rem!important}.pl-2,.px-2{padding-left:.5rem!important}.p-3{padding:1rem!important}.pt-3,.py-3{padding-top:1rem!important}.pr-3,.px-3{padding-right:1rem!important}.pb-3,.py-3{padding-bottom:1rem!important}.pl-3,.px-3{padding-left:1rem!important}.p-4{padding:1.5rem!important}.pt-4,.py-4{padding-top:1.5rem!important}.pr-4,.px-4{padding-right:1.5rem!important}.pb-4,.py-4{padding-bottom:1.5rem!important}.pl-4,.px-4{padding-left:1.5rem!important}.p-5{padding:3rem!important}.pt-5,.py-5{padding-top:3rem!important}.pr-5,.px-5{padding-right:3rem!important}.pb-5,.py-5{padding-bottom:3rem!important}.pl-5,.px-5{padding-left:3rem!important}.m-n1{margin:-.25rem!important}.mt-n1,.my-n1{margin-top:-.25rem!important}.mr-n1,.mx-n1{margin-right:-.25rem!important}.mb-n1,.my-n1{margin-bottom:-.25rem!important}.ml-n1,.mx-n1{margin-left:-.25rem!important}.m-n2{margin:-.5rem!important}.mt-n2,.my-n2{margin-top:-.5rem!important}.mr-n2,.mx-n2{margin-right:-.5rem!important}.mb-n2,.my-n2{margin-bottom:-.5rem!important}.ml-n2,.mx-n2{margin-left:-.5rem!important}.m-n3{margin:-1rem!important}.mt-n3,.my-n3{margin-top:-1rem!important}.mr-n3,.mx-n3{margin-right:-1rem!important}.mb-n3,.my-n3{margin-bottom:-1rem!important}.ml-n3,.mx-n3{margin-left:-1rem!important}.m-n4{margin:-1.5rem!important}.mt-n4,.my-n4{margin-top:-1.5rem!important}.mr-n4,.mx-n4{margin-right:-1.5rem!important}.mb-n4,.my-n4{margin-bottom:-1.5rem!important}.ml-n4,.mx-n4{margin-left:-1.5rem!important}.m-n5{margin:-3rem!important}.mt-n5,.my-n5{margin-top:-3rem!important}.mr-n5,.mx-n5{margin-right:-3rem!important}.mb-n5,.my-n5{margin-bottom:-3rem!important}.ml-n5,.mx-n5{margin-left:-3rem!important}.m-auto{margin:auto!important}.mt-auto,.my-auto{margin-top:auto!important}.mr-auto,.mx-auto{margin-right:auto!important}.mb-auto,.my-auto{margin-bottom:auto!important}.ml-auto,.mx-auto{margin-left:auto!important}@media (min-width:576px){.m-sm-0{margin:0!important}.mt-sm-0,.my-sm-0{margin-top:0!important}.mr-sm-0,.mx-sm-0{margin-right:0!important}.mb-sm-0,.my-sm-0{margin-bottom:0!important}.ml-sm-0,.mx-sm-0{margin-left:0!important}.m-sm-1{margin:.25rem!important}.mt-sm-1,.my-sm-1{margin-top:.25rem!important}.mr-sm-1,.mx-sm-1{margin-right:.25rem!important}.mb-sm-1,.my-sm-1{margin-bottom:.25rem!important}.ml-sm-1,.mx-sm-1{margin-left:.25rem!important}.m-sm-2{margin:.5rem!important}.mt-sm-2,.my-sm-2{margin-top:.5rem!important}.mr-sm-2,.mx-sm-2{margin-right:.5rem!important}.mb-sm-2,.my-sm-2{margin-bottom:.5rem!important}.ml-sm-2,.mx-sm-2{margin-left:.5rem!important}.m-sm-3{margin:1rem!important}.mt-sm-3,.my-sm-3{margin-top:1rem!important}.mr-sm-3,.mx-sm-3{margin-right:1rem!important}.mb-sm-3,.my-sm-3{margin-bottom:1rem!important}.ml-sm-3,.mx-sm-3{margin-left:1rem!important}.m-sm-4{margin:1.5rem!important}.mt-sm-4,.my-sm-4{margin-top:1.5rem!important}.mr-sm-4,.mx-sm-4{margin-right:1.5rem!important}.mb-sm-4,.my-sm-4{margin-bottom:1.5rem!important}.ml-sm-4,.mx-sm-4{margin-left:1.5rem!important}.m-sm-5{margin:3rem!important}.mt-sm-5,.my-sm-5{margin-top:3rem!important}.mr-sm-5,.mx-sm-5{margin-right:3rem!important}.mb-sm-5,.my-sm-5{margin-bottom:3rem!important}.ml-sm-5,.mx-sm-5{margin-left:3rem!important}.p-sm-0{padding:0!important}.pt-sm-0,.py-sm-0{padding-top:0!important}.pr-sm-0,.px-sm-0{padding-right:0!important}.pb-sm-0,.py-sm-0{padding-bottom:0!important}.pl-sm-0,.px-sm-0{padding-left:0!important}.p-sm-1{padding:.25rem!important}.pt-sm-1,.py-sm-1{padding-top:.25rem!important}.pr-sm-1,.px-sm-1{padding-right:.25rem!important}.pb-sm-1,.py-sm-1{padding-bottom:.25rem!important}.pl-sm-1,.px-sm-1{padding-left:.25rem!important}.p-sm-2{padding:.5rem!important}.pt-sm-2,.py-sm-2{padding-top:.5rem!important}.pr-sm-2,.px-sm-2{padding-right:.5rem!important}.pb-sm-2,.py-sm-2{padding-bottom:.5rem!important}.pl-sm-2,.px-sm-2{padding-left:.5rem!important}.p-sm-3{padding:1rem!important}.pt-sm-3,.py-sm-3{padding-top:1rem!important}.pr-sm-3,.px-sm-3{padding-right:1rem!important}.pb-sm-3,.py-sm-3{padding-bottom:1rem!important}.pl-sm-3,.px-sm-3{padding-left:1rem!important}.p-sm-4{padding:1.5rem!important}.pt-sm-4,.py-sm-4{padding-top:1.5rem!important}.pr-sm-4,.px-sm-4{padding-right:1.5rem!important}.pb-sm-4,.py-sm-4{padding-bottom:1.5rem!important}.pl-sm-4,.px-sm-4{padding-left:1.5rem!important}.p-sm-5{padding:3rem!important}.pt-sm-5,.py-sm-5{padding-top:3rem!important}.pr-sm-5,.px-sm-5{padding-right:3rem!important}.pb-sm-5,.py-sm-5{padding-bottom:3rem!important}.pl-sm-5,.px-sm-5{padding-left:3rem!important}.m-sm-n1{margin:-.25rem!important}.mt-sm-n1,.my-sm-n1{margin-top:-.25rem!important}.mr-sm-n1,.mx-sm-n1{margin-right:-.25rem!important}.mb-sm-n1,.my-sm-n1{margin-bottom:-.25rem!important}.ml-sm-n1,.mx-sm-n1{margin-left:-.25rem!important}.m-sm-n2{margin:-.5rem!important}.mt-sm-n2,.my-sm-n2{margin-top:-.5rem!important}.mr-sm-n2,.mx-sm-n2{margin-right:-.5rem!important}.mb-sm-n2,.my-sm-n2{margin-bottom:-.5rem!important}.ml-sm-n2,.mx-sm-n2{margin-left:-.5rem!important}.m-sm-n3{margin:-1rem!important}.mt-sm-n3,.my-sm-n3{margin-top:-1rem!important}.mr-sm-n3,.mx-sm-n3{margin-right:-1rem!important}.mb-sm-n3,.my-sm-n3{margin-bottom:-1rem!important}.ml-sm-n3,.mx-sm-n3{margin-left:-1rem!important}.m-sm-n4{margin:-1.5rem!important}.mt-sm-n4,.my-sm-n4{margin-top:-1.5rem!important}.mr-sm-n4,.mx-sm-n4{margin-right:-1.5rem!important}.mb-sm-n4,.my-sm-n4{margin-bottom:-1.5rem!important}.ml-sm-n4,.mx-sm-n4{margin-left:-1.5rem!important}.m-sm-n5{margin:-3rem!important}.mt-sm-n5,.my-sm-n5{margin-top:-3rem!important}.mr-sm-n5,.mx-sm-n5{margin-right:-3rem!important}.mb-sm-n5,.my-sm-n5{margin-bottom:-3rem!important}.ml-sm-n5,.mx-sm-n5{margin-left:-3rem!important}.m-sm-auto{margin:auto!important}.mt-sm-auto,.my-sm-auto{margin-top:auto!important}.mr-sm-auto,.mx-sm-auto{margin-right:auto!important}.mb-sm-auto,.my-sm-auto{margin-bottom:auto!important}.ml-sm-auto,.mx-sm-auto{margin-left:auto!important}}@media (min-width:768px){.m-md-0{margin:0!important}.mt-md-0,.my-md-0{margin-top:0!important}.mr-md-0,.mx-md-0{margin-right:0!important}.mb-md-0,.my-md-0{margin-bottom:0!important}.ml-md-0,.mx-md-0{margin-left:0!important}.m-md-1{margin:.25rem!important}.mt-md-1,.my-md-1{margin-top:.25rem!important}.mr-md-1,.mx-md-1{margin-right:.25rem!important}.mb-md-1,.my-md-1{margin-bottom:.25rem!important}.ml-md-1,.mx-md-1{margin-left:.25rem!important}.m-md-2{margin:.5rem!important}.mt-md-2,.my-md-2{margin-top:.5rem!important}.mr-md-2,.mx-md-2{margin-right:.5rem!important}.mb-md-2,.my-md-2{margin-bottom:.5rem!important}.ml-md-2,.mx-md-2{margin-left:.5rem!important}.m-md-3{margin:1rem!important}.mt-md-3,.my-md-3{margin-top:1rem!important}.mr-md-3,.mx-md-3{margin-right:1rem!important}.mb-md-3,.my-md-3{margin-bottom:1rem!important}.ml-md-3,.mx-md-3{margin-left:1rem!important}.m-md-4{margin:1.5rem!important}.mt-md-4,.my-md-4{margin-top:1.5rem!important}.mr-md-4,.mx-md-4{margin-right:1.5rem!important}.mb-md-4,.my-md-4{margin-bottom:1.5rem!important}.ml-md-4,.mx-md-4{margin-left:1.5rem!important}.m-md-5{margin:3rem!important}.mt-md-5,.my-md-5{margin-top:3rem!important}.mr-md-5,.mx-md-5{margin-right:3rem!important}.mb-md-5,.my-md-5{margin-bottom:3rem!important}.ml-md-5,.mx-md-5{margin-left:3rem!important}.p-md-0{padding:0!important}.pt-md-0,.py-md-0{padding-top:0!important}.pr-md-0,.px-md-0{padding-right:0!important}.pb-md-0,.py-md-0{padding-bottom:0!important}.pl-md-0,.px-md-0{padding-left:0!important}.p-md-1{padding:.25rem!important}.pt-md-1,.py-md-1{padding-top:.25rem!important}.pr-md-1,.px-md-1{padding-right:.25rem!important}.pb-md-1,.py-md-1{padding-bottom:.25rem!important}.pl-md-1,.px-md-1{padding-left:.25rem!important}.p-md-2{padding:.5rem!important}.pt-md-2,.py-md-2{padding-top:.5rem!important}.pr-md-2,.px-md-2{padding-right:.5rem!important}.pb-md-2,.py-md-2{padding-bottom:.5rem!important}.pl-md-2,.px-md-2{padding-left:.5rem!important}.p-md-3{padding:1rem!important}.pt-md-3,.py-md-3{padding-top:1rem!important}.pr-md-3,.px-md-3{padding-right:1rem!important}.pb-md-3,.py-md-3{padding-bottom:1rem!important}.pl-md-3,.px-md-3{padding-left:1rem!important}.p-md-4{padding:1.5rem!important}.pt-md-4,.py-md-4{padding-top:1.5rem!important}.pr-md-4,.px-md-4{padding-right:1.5rem!important}.pb-md-4,.py-md-4{padding-bottom:1.5rem!important}.pl-md-4,.px-md-4{padding-left:1.5rem!important}.p-md-5{padding:3rem!important}.pt-md-5,.py-md-5{padding-top:3rem!important}.pr-md-5,.px-md-5{padding-right:3rem!important}.pb-md-5,.py-md-5{padding-bottom:3rem!important}.pl-md-5,.px-md-5{padding-left:3rem!important}.m-md-n1{margin:-.25rem!important}.mt-md-n1,.my-md-n1{margin-top:-.25rem!important}.mr-md-n1,.mx-md-n1{margin-right:-.25rem!important}.mb-md-n1,.my-md-n1{margin-bottom:-.25rem!important}.ml-md-n1,.mx-md-n1{margin-left:-.25rem!important}.m-md-n2{margin:-.5rem!important}.mt-md-n2,.my-md-n2{margin-top:-.5rem!important}.mr-md-n2,.mx-md-n2{margin-right:-.5rem!important}.mb-md-n2,.my-md-n2{margin-bottom:-.5rem!important}.ml-md-n2,.mx-md-n2{margin-left:-.5rem!important}.m-md-n3{margin:-1rem!important}.mt-md-n3,.my-md-n3{margin-top:-1rem!important}.mr-md-n3,.mx-md-n3{margin-right:-1rem!important}.mb-md-n3,.my-md-n3{margin-bottom:-1rem!important}.ml-md-n3,.mx-md-n3{margin-left:-1rem!important}.m-md-n4{margin:-1.5rem!important}.mt-md-n4,.my-md-n4{margin-top:-1.5rem!important}.mr-md-n4,.mx-md-n4{margin-right:-1.5rem!important}.mb-md-n4,.my-md-n4{margin-bottom:-1.5rem!important}.ml-md-n4,.mx-md-n4{margin-left:-1.5rem!important}.m-md-n5{margin:-3rem!important}.mt-md-n5,.my-md-n5{margin-top:-3rem!important}.mr-md-n5,.mx-md-n5{margin-right:-3rem!important}.mb-md-n5,.my-md-n5{margin-bottom:-3rem!important}.ml-md-n5,.mx-md-n5{margin-left:-3rem!important}.m-md-auto{margin:auto!important}.mt-md-auto,.my-md-auto{margin-top:auto!important}.mr-md-auto,.mx-md-auto{margin-right:auto!important}.mb-md-auto,.my-md-auto{margin-bottom:auto!important}.ml-md-auto,.mx-md-auto{margin-left:auto!important}}@media (min-width:992px){.m-lg-0{margin:0!important}.mt-lg-0,.my-lg-0{margin-top:0!important}.mr-lg-0,.mx-lg-0{margin-right:0!important}.mb-lg-0,.my-lg-0{margin-bottom:0!important}.ml-lg-0,.mx-lg-0{margin-left:0!important}.m-lg-1{margin:.25rem!important}.mt-lg-1,.my-lg-1{margin-top:.25rem!important}.mr-lg-1,.mx-lg-1{margin-right:.25rem!important}.mb-lg-1,.my-lg-1{margin-bottom:.25rem!important}.ml-lg-1,.mx-lg-1{margin-left:.25rem!important}.m-lg-2{margin:.5rem!important}.mt-lg-2,.my-lg-2{margin-top:.5rem!important}.mr-lg-2,.mx-lg-2{margin-right:.5rem!important}.mb-lg-2,.my-lg-2{margin-bottom:.5rem!important}.ml-lg-2,.mx-lg-2{margin-left:.5rem!important}.m-lg-3{margin:1rem!important}.mt-lg-3,.my-lg-3{margin-top:1rem!important}.mr-lg-3,.mx-lg-3{margin-right:1rem!important}.mb-lg-3,.my-lg-3{margin-bottom:1rem!important}.ml-lg-3,.mx-lg-3{margin-left:1rem!important}.m-lg-4{margin:1.5rem!important}.mt-lg-4,.my-lg-4{margin-top:1.5rem!important}.mr-lg-4,.mx-lg-4{margin-right:1.5rem!important}.mb-lg-4,.my-lg-4{margin-bottom:1.5rem!important}.ml-lg-4,.mx-lg-4{margin-left:1.5rem!important}.m-lg-5{margin:3rem!important}.mt-lg-5,.my-lg-5{margin-top:3rem!important}.mr-lg-5,.mx-lg-5{margin-right:3rem!important}.mb-lg-5,.my-lg-5{margin-bottom:3rem!important}.ml-lg-5,.mx-lg-5{margin-left:3rem!important}.p-lg-0{padding:0!important}.pt-lg-0,.py-lg-0{padding-top:0!important}.pr-lg-0,.px-lg-0{padding-right:0!important}.pb-lg-0,.py-lg-0{padding-bottom:0!important}.pl-lg-0,.px-lg-0{padding-left:0!important}.p-lg-1{padding:.25rem!important}.pt-lg-1,.py-lg-1{padding-top:.25rem!important}.pr-lg-1,.px-lg-1{padding-right:.25rem!important}.pb-lg-1,.py-lg-1{padding-bottom:.25rem!important}.pl-lg-1,.px-lg-1{padding-left:.25rem!important}.p-lg-2{padding:.5rem!important}.pt-lg-2,.py-lg-2{padding-top:.5rem!important}.pr-lg-2,.px-lg-2{padding-right:.5rem!important}.pb-lg-2,.py-lg-2{padding-bottom:.5rem!important}.pl-lg-2,.px-lg-2{padding-left:.5rem!important}.p-lg-3{padding:1rem!important}.pt-lg-3,.py-lg-3{padding-top:1rem!important}.pr-lg-3,.px-lg-3{padding-right:1rem!important}.pb-lg-3,.py-lg-3{padding-bottom:1rem!important}.pl-lg-3,.px-lg-3{padding-left:1rem!important}.p-lg-4{padding:1.5rem!important}.pt-lg-4,.py-lg-4{padding-top:1.5rem!important}.pr-lg-4,.px-lg-4{padding-right:1.5rem!important}.pb-lg-4,.py-lg-4{padding-bottom:1.5rem!important}.pl-lg-4,.px-lg-4{padding-left:1.5rem!important}.p-lg-5{padding:3rem!important}.pt-lg-5,.py-lg-5{padding-top:3rem!important}.pr-lg-5,.px-lg-5{padding-right:3rem!important}.pb-lg-5,.py-lg-5{padding-bottom:3rem!important}.pl-lg-5,.px-lg-5{padding-left:3rem!important}.m-lg-n1{margin:-.25rem!important}.mt-lg-n1,.my-lg-n1{margin-top:-.25rem!important}.mr-lg-n1,.mx-lg-n1{margin-right:-.25rem!important}.mb-lg-n1,.my-lg-n1{margin-bottom:-.25rem!important}.ml-lg-n1,.mx-lg-n1{margin-left:-.25rem!important}.m-lg-n2{margin:-.5rem!important}.mt-lg-n2,.my-lg-n2{margin-top:-.5rem!important}.mr-lg-n2,.mx-lg-n2{margin-right:-.5rem!important}.mb-lg-n2,.my-lg-n2{margin-bottom:-.5rem!important}.ml-lg-n2,.mx-lg-n2{margin-left:-.5rem!important}.m-lg-n3{margin:-1rem!important}.mt-lg-n3,.my-lg-n3{margin-top:-1rem!important}.mr-lg-n3,.mx-lg-n3{margin-right:-1rem!important}.mb-lg-n3,.my-lg-n3{margin-bottom:-1rem!important}.ml-lg-n3,.mx-lg-n3{margin-left:-1rem!important}.m-lg-n4{margin:-1.5rem!important}.mt-lg-n4,.my-lg-n4{margin-top:-1.5rem!important}.mr-lg-n4,.mx-lg-n4{margin-right:-1.5rem!important}.mb-lg-n4,.my-lg-n4{margin-bottom:-1.5rem!important}.ml-lg-n4,.mx-lg-n4{margin-left:-1.5rem!important}.m-lg-n5{margin:-3rem!important}.mt-lg-n5,.my-lg-n5{margin-top:-3rem!important}.mr-lg-n5,.mx-lg-n5{margin-right:-3rem!important}.mb-lg-n5,.my-lg-n5{margin-bottom:-3rem!important}.ml-lg-n5,.mx-lg-n5{margin-left:-3rem!important}.m-lg-auto{margin:auto!important}.mt-lg-auto,.my-lg-auto{margin-top:auto!important}.mr-lg-auto,.mx-lg-auto{margin-right:auto!important}.mb-lg-auto,.my-lg-auto{margin-bottom:auto!important}.ml-lg-auto,.mx-lg-auto{margin-left:auto!important}}@media (min-width:1200px){.m-xl-0{margin:0!important}.mt-xl-0,.my-xl-0{margin-top:0!important}.mr-xl-0,.mx-xl-0{margin-right:0!important}.mb-xl-0,.my-xl-0{margin-bottom:0!important}.ml-xl-0,.mx-xl-0{margin-left:0!important}.m-xl-1{margin:.25rem!important}.mt-xl-1,.my-xl-1{margin-top:.25rem!important}.mr-xl-1,.mx-xl-1{margin-right:.25rem!important}.mb-xl-1,.my-xl-1{margin-bottom:.25rem!important}.ml-xl-1,.mx-xl-1{margin-left:.25rem!important}.m-xl-2{margin:.5rem!important}.mt-xl-2,.my-xl-2{margin-top:.5rem!important}.mr-xl-2,.mx-xl-2{margin-right:.5rem!important}.mb-xl-2,.my-xl-2{margin-bottom:.5rem!important}.ml-xl-2,.mx-xl-2{margin-left:.5rem!important}.m-xl-3{margin:1rem!important}.mt-xl-3,.my-xl-3{margin-top:1rem!important}.mr-xl-3,.mx-xl-3{margin-right:1rem!important}.mb-xl-3,.my-xl-3{margin-bottom:1rem!important}.ml-xl-3,.mx-xl-3{margin-left:1rem!important}.m-xl-4{margin:1.5rem!important}.mt-xl-4,.my-xl-4{margin-top:1.5rem!important}.mr-xl-4,.mx-xl-4{margin-right:1.5rem!important}.mb-xl-4,.my-xl-4{margin-bottom:1.5rem!important}.ml-xl-4,.mx-xl-4{margin-left:1.5rem!important}.m-xl-5{margin:3rem!important}.mt-xl-5,.my-xl-5{margin-top:3rem!important}.mr-xl-5,.mx-xl-5{margin-right:3rem!important}.mb-xl-5,.my-xl-5{margin-bottom:3rem!important}.ml-xl-5,.mx-xl-5{margin-left:3rem!important}.p-xl-0{padding:0!important}.pt-xl-0,.py-xl-0{padding-top:0!important}.pr-xl-0,.px-xl-0{padding-right:0!important}.pb-xl-0,.py-xl-0{padding-bottom:0!important}.pl-xl-0,.px-xl-0{padding-left:0!important}.p-xl-1{padding:.25rem!important}.pt-xl-1,.py-xl-1{padding-top:.25rem!important}.pr-xl-1,.px-xl-1{padding-right:.25rem!important}.pb-xl-1,.py-xl-1{padding-bottom:.25rem!important}.pl-xl-1,.px-xl-1{padding-left:.25rem!important}.p-xl-2{padding:.5rem!important}.pt-xl-2,.py-xl-2{padding-top:.5rem!important}.pr-xl-2,.px-xl-2{padding-right:.5rem!important}.pb-xl-2,.py-xl-2{padding-bottom:.5rem!important}.pl-xl-2,.px-xl-2{padding-left:.5rem!important}.p-xl-3{padding:1rem!important}.pt-xl-3,.py-xl-3{padding-top:1rem!important}.pr-xl-3,.px-xl-3{padding-right:1rem!important}.pb-xl-3,.py-xl-3{padding-bottom:1rem!important}.pl-xl-3,.px-xl-3{padding-left:1rem!important}.p-xl-4{padding:1.5rem!important}.pt-xl-4,.py-xl-4{padding-top:1.5rem!important}.pr-xl-4,.px-xl-4{padding-right:1.5rem!important}.pb-xl-4,.py-xl-4{padding-bottom:1.5rem!important}.pl-xl-4,.px-xl-4{padding-left:1.5rem!important}.p-xl-5{padding:3rem!important}.pt-xl-5,.py-xl-5{padding-top:3rem!important}.pr-xl-5,.px-xl-5{padding-right:3rem!important}.pb-xl-5,.py-xl-5{padding-bottom:3rem!important}.pl-xl-5,.px-xl-5{padding-left:3rem!important}.m-xl-n1{margin:-.25rem!important}.mt-xl-n1,.my-xl-n1{margin-top:-.25rem!important}.mr-xl-n1,.mx-xl-n1{margin-right:-.25rem!important}.mb-xl-n1,.my-xl-n1{margin-bottom:-.25rem!important}.ml-xl-n1,.mx-xl-n1{margin-left:-.25rem!important}.m-xl-n2{margin:-.5rem!important}.mt-xl-n2,.my-xl-n2{margin-top:-.5rem!important}.mr-xl-n2,.mx-xl-n2{margin-right:-.5rem!important}.mb-xl-n2,.my-xl-n2{margin-bottom:-.5rem!important}.ml-xl-n2,.mx-xl-n2{margin-left:-.5rem!important}.m-xl-n3{margin:-1rem!important}.mt-xl-n3,.my-xl-n3{margin-top:-1rem!important}.mr-xl-n3,.mx-xl-n3{margin-right:-1rem!important}.mb-xl-n3,.my-xl-n3{margin-bottom:-1rem!important}.ml-xl-n3,.mx-xl-n3{margin-left:-1rem!important}.m-xl-n4{margin:-1.5rem!important}.mt-xl-n4,.my-xl-n4{margin-top:-1.5rem!important}.mr-xl-n4,.mx-xl-n4{margin-right:-1.5rem!important}.mb-xl-n4,.my-xl-n4{margin-bottom:-1.5rem!important}.ml-xl-n4,.mx-xl-n4{margin-left:-1.5rem!important}.m-xl-n5{margin:-3rem!important}.mt-xl-n5,.my-xl-n5{margin-top:-3rem!important}.mr-xl-n5,.mx-xl-n5{margin-right:-3rem!important}.mb-xl-n5,.my-xl-n5{margin-bottom:-3rem!important}.ml-xl-n5,.mx-xl-n5{margin-left:-3rem!important}.m-xl-auto{margin:auto!important}.mt-xl-auto,.my-xl-auto{margin-top:auto!important}.mr-xl-auto,.mx-xl-auto{margin-right:auto!important}.mb-xl-auto,.my-xl-auto{margin-bottom:auto!important}.ml-xl-auto,.mx-xl-auto{margin-left:auto!important}}.text-monospace{font-family:SFMono-Regular,Menlo,Monaco,Consolas,Liberation Mono,Courier New,monospace!important}.text-justify{text-align:justify!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.text-left{text-align:left!important}.text-right{text-align:right!important}.text-center{text-align:center!important}@media (min-width:576px){.text-sm-left{text-align:left!important}.text-sm-right{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.text-md-left{text-align:left!important}.text-md-right{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.text-lg-left{text-align:left!important}.text-lg-right{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.text-xl-left{text-align:left!important}.text-xl-right{text-align:right!important}.text-xl-center{text-align:center!important}}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.font-weight-light{font-weight:300!important}.font-weight-lighter{font-weight:lighter!important}.font-weight-normal{font-weight:400!important}.font-weight-bold{font-weight:700!important}.font-weight-bolder{font-weight:bolder!important}.font-italic{font-style:italic!important}.text-white{color:#fff!important}.text-primary{color:#007bff!important}a.text-primary:focus,a.text-primary:hover{color:#0056b3!important}.text-secondary{color:#6c757d!important}a.text-secondary:focus,a.text-secondary:hover{color:#494f54!important}.text-success{color:#28a745!important}a.text-success:focus,a.text-success:hover{color:#19692c!important}.text-info{color:#17a2b8!important}a.text-info:focus,a.text-info:hover{color:#0f6674!important}.text-warning{color:#ffc107!important}a.text-warning:focus,a.text-warning:hover{color:#ba8b00!important}.text-danger{color:#dc3545!important}a.text-danger:focus,a.text-danger:hover{color:#a71d2a!important}.text-light{color:#f8f9fa!important}a.text-light:focus,a.text-light:hover{color:#cbd3da!important}.text-dark{color:#343a40!important}a.text-dark:focus,a.text-dark:hover{color:#121416!important}.text-body{color:#212529!important}.text-muted{color:#6c757d!important}.text-black-50{color:rgba(0,0,0,.5)!important}.text-white-50{color:hsla(0,0%,100%,.5)!important}.text-hide{background-color:transparent;border:0;color:transparent;font:0/0 a;text-shadow:none}.text-decoration-none{text-decoration:none!important}.text-break{overflow-wrap:break-word!important;word-break:break-word!important}.text-reset{color:inherit!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media print{*,:after,:before{box-shadow:none!important;text-shadow:none!important}a:not(.btn){text-decoration:underline}abbr[title]:after{content:" (" attr(title) ")"}pre{white-space:pre-wrap!important}blockquote,pre{border:1px solid #adb5bd;page-break-inside:avoid}thead{display:table-header-group}img,tr{page-break-inside:avoid}h2,h3,p{orphans:3;widows:3}h2,h3{page-break-after:avoid}@page{size:a3}.container,body{min-width:992px!important}.navbar{display:none}.badge{border:1px solid #000}.table{border-collapse:collapse!important}.table td,.table th{background-color:#fff!important}.table-bordered td,.table-bordered th{border:1px solid #dee2e6!important}.table-dark{color:inherit}.table-dark tbody+tbody,.table-dark td,.table-dark th,.table-dark thead th{border-color:#dee2e6}.table .thead-dark th{border-color:#dee2e6;color:inherit}}
|
|
|
assets/css/common.css
CHANGED
|
@@ -1,64 +1 @@
|
|
| 1 |
-
.btn-warning {
|
| 2 |
-
color: #fff !important;
|
| 3 |
-
}
|
| 4 |
-
|
| 5 |
-
.button-primary {
|
| 6 |
-
color: #fff !important;
|
| 7 |
-
}
|
| 8 |
-
|
| 9 |
-
.shareaholic-settings-h2 {
|
| 10 |
-
padding: 0 !important;
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
/* Header */
|
| 14 |
-
#shr-header {
|
| 15 |
-
position: initial !important;
|
| 16 |
-
z-index: auto !important;
|
| 17 |
-
margin-left: -20px !important;
|
| 18 |
-
width: auto !important;
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
#shr-header .shr-header-content {
|
| 22 |
-
max-width: 100% !important;
|
| 23 |
-
margin: 0 0 0 20px !important;
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
.shr-mobile {
|
| 27 |
-
z-index: 2147483647 !important;
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
#shr-header .shr-nav-2 .shr-user-menu {
|
| 31 |
-
z-index: 2147483647 !important;
|
| 32 |
-
}
|
| 33 |
-
|
| 34 |
-
#shr-header .shr-sites-container {
|
| 35 |
-
z-index: 2147483647 !important;
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
#shr-header .shr-nav-2 .shr-signup-login {
|
| 39 |
-
margin-right: 2em !important;
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
#shr-header .shr-nav-2 .shr-profile {
|
| 43 |
-
margin-right: 15px !important;
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
/* End Header */
|
| 47 |
-
|
| 48 |
-
/* Hides WP Nag Screen */
|
| 49 |
-
#update-nag, .update-nag {
|
| 50 |
-
display: none !important;
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
/*** Hides notice pollution from other plugins ***/
|
| 54 |
-
.notice {
|
| 55 |
-
display: none !important;
|
| 56 |
-
}
|
| 57 |
-
.error {
|
| 58 |
-
display: none !important;
|
| 59 |
-
}
|
| 60 |
-
/* ensure Shareaholic notices show */
|
| 61 |
-
.notice.notice-info.is-dismissible.shareaholic-review-notice {
|
| 62 |
-
display: block !important;
|
| 63 |
-
}
|
| 64 |
-
/*** Hides notice pollution ***/
|
| 1 |
+
.btn-warning,.button-primary{color:#fff!important}.shareaholic-settings-h2{padding:0!important}#shr-header{margin-left:-20px!important;position:static!important;width:auto!important;z-index:auto!important}#shr-header .shr-header-content{margin:0 0 0 20px!important;max-width:100%!important}#shr-header .shr-nav-2 .shr-user-menu,#shr-header .shr-sites-container,.shr-mobile{z-index:2147483647!important}#shr-header .shr-nav-2 .shr-signup-login{margin-right:2em!important}#shr-header .shr-nav-2 .shr-profile{margin-right:15px!important}#update-nag,.error,.notice,.update-nag{display:none!important}.notice.notice-info.is-dismissible.shareaholic-review-notice{display:block!important}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/css/main.css
CHANGED
|
@@ -1,612 +1 @@
|
|
| 1 |
-
body {
|
| 2 |
-
background: #f1f1f1 !important;
|
| 3 |
-
font-family: sans-serif;
|
| 4 |
-
font-size: 12px !important;
|
| 5 |
-
color: #666666;
|
| 6 |
-
-webkit-font-smoothing: antialiased;
|
| 7 |
-
font-smoothing: antialiased;
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
.app a, .text-muted a {
|
| 11 |
-
color: #337ab7;
|
| 12 |
-
text-decoration: none;
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
.btn-dark {
|
| 16 |
-
color: #fff !important;
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
.container-fluid {
|
| 20 |
-
padding: 0px;
|
| 21 |
-
clear: both;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
.canvas {
|
| 25 |
-
display: block;
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
h3 {
|
| 29 |
-
clear: both;
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
.clear {
|
| 33 |
-
clear: both !important;
|
| 34 |
-
height: auto !important;
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
#app_settings {
|
| 38 |
-
padding-top: 0px;
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
fieldset {
|
| 42 |
-
border: 1px solid #d8d8d8;
|
| 43 |
-
margin: 5px;
|
| 44 |
-
padding: 10px;
|
| 45 |
-
float:left;
|
| 46 |
-
}
|
| 47 |
-
|
| 48 |
-
fieldset#facebook-app.failed {
|
| 49 |
-
border: 1px solid #f44336;
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
.app {
|
| 53 |
-
width:100%;
|
| 54 |
-
margin: 15px 0 15px 0;
|
| 55 |
-
padding: 10px;
|
| 56 |
-
border: 1px solid #e5e5e5;
|
| 57 |
-
background-color: #fdfdfd;
|
| 58 |
-
box-shadow: 0 1px 1px rgba(0,0,0,.04);
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
.wide-button {
|
| 62 |
-
min-width: 200px;
|
| 63 |
-
}
|
| 64 |
-
|
| 65 |
-
.button-wrapper {
|
| 66 |
-
clear: both;
|
| 67 |
-
padding-top: 5px;
|
| 68 |
-
}
|
| 69 |
-
|
| 70 |
-
.app h2 {
|
| 71 |
-
font-size: 18px;
|
| 72 |
-
padding: 10px 10px 10px 20px;
|
| 73 |
-
margin: -10px -10px 0;
|
| 74 |
-
border-bottom: 1px solid #ccc;
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
.app-content {
|
| 78 |
-
padding: 15px 0 5px 10px;
|
| 79 |
-
}
|
| 80 |
-
|
| 81 |
-
.app label {
|
| 82 |
-
font-size: 12px;
|
| 83 |
-
display: inline;
|
| 84 |
-
line-height: 1.6em;
|
| 85 |
-
}
|
| 86 |
-
|
| 87 |
-
legend {
|
| 88 |
-
border: none;
|
| 89 |
-
width: auto;
|
| 90 |
-
font-weight: bold;
|
| 91 |
-
padding: 0px 10px;
|
| 92 |
-
color: #007bb6;
|
| 93 |
-
margin-bottom: 0;
|
| 94 |
-
font-size: 13px;
|
| 95 |
-
}
|
| 96 |
-
|
| 97 |
-
.location {
|
| 98 |
-
clear: both;
|
| 99 |
-
padding-top: 5px;
|
| 100 |
-
}
|
| 101 |
-
|
| 102 |
-
.location_item_cta {
|
| 103 |
-
margin-left: 25px;
|
| 104 |
-
}
|
| 105 |
-
|
| 106 |
-
.check {
|
| 107 |
-
position: relative;
|
| 108 |
-
}
|
| 109 |
-
|
| 110 |
-
.shr-form-item {
|
| 111 |
-
padding-bottom: 4px !important;
|
| 112 |
-
}
|
| 113 |
-
|
| 114 |
-
.shr-form-item > * {
|
| 115 |
-
display: inline-block !important;
|
| 116 |
-
max-width: 90%;
|
| 117 |
-
vertical-align: top;
|
| 118 |
-
}
|
| 119 |
-
|
| 120 |
-
.shr-form-text ~ .shr-form-text {
|
| 121 |
-
margin-top: .5rem;
|
| 122 |
-
}
|
| 123 |
-
|
| 124 |
-
.shr-form-text label {
|
| 125 |
-
margin-bottom: 0;
|
| 126 |
-
}
|
| 127 |
-
|
| 128 |
-
.regular-text{
|
| 129 |
-
margin: 1px;
|
| 130 |
-
padding: 3px 5px;
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
.label {
|
| 134 |
-
margin-right: 20px;
|
| 135 |
-
}
|
| 136 |
-
|
| 137 |
-
#iframe_container, iframe {
|
| 138 |
-
width: 100%;
|
| 139 |
-
height: 100%;
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
.bg-loading-img {
|
| 143 |
-
background-image:url(../img/ajax_loader_green_128.gif);
|
| 144 |
-
background-repeat:no-repeat;
|
| 145 |
-
background-position: center center;
|
| 146 |
-
}
|
| 147 |
-
|
| 148 |
-
#shortcode_container, #shortcode {
|
| 149 |
-
cursor: inherit;
|
| 150 |
-
width: 100%;
|
| 151 |
-
text-align: center;
|
| 152 |
-
background: white;
|
| 153 |
-
height: 30px;
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
#shortcode_container {
|
| 157 |
-
border-top: 3px solid #ccc;
|
| 158 |
-
}
|
| 159 |
-
|
| 160 |
-
#shortcode {
|
| 161 |
-
font-family: monospace;
|
| 162 |
-
}
|
| 163 |
-
|
| 164 |
-
.reveal-modal {
|
| 165 |
-
width: 720px;
|
| 166 |
-
height: 80%;
|
| 167 |
-
margin-left: -335px;
|
| 168 |
-
position: fixed;
|
| 169 |
-
/* display: none; */
|
| 170 |
-
}
|
| 171 |
-
|
| 172 |
-
.reveal-modal.has-shortcode iframe,
|
| 173 |
-
.reveal-modal.has-shortcode #iframe_container {
|
| 174 |
-
height: 100%;
|
| 175 |
-
}
|
| 176 |
-
|
| 177 |
-
.fieldset-footer {
|
| 178 |
-
clear: both;
|
| 179 |
-
overflow: hidden;
|
| 180 |
-
}
|
| 181 |
-
|
| 182 |
-
.fieldset-footer button {
|
| 183 |
-
float: left;
|
| 184 |
-
}
|
| 185 |
-
|
| 186 |
-
.fieldset-footer .app-status {
|
| 187 |
-
float: left;
|
| 188 |
-
}
|
| 189 |
-
|
| 190 |
-
#editing_modal {
|
| 191 |
-
padding: 0;
|
| 192 |
-
}
|
| 193 |
-
|
| 194 |
-
ul {
|
| 195 |
-
margin: 0px;
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
.green {
|
| 199 |
-
color: #11967a;
|
| 200 |
-
}
|
| 201 |
-
|
| 202 |
-
.red {
|
| 203 |
-
color: #f44336;
|
| 204 |
-
}
|
| 205 |
-
|
| 206 |
-
.grey {
|
| 207 |
-
color: #666666;
|
| 208 |
-
}
|
| 209 |
-
|
| 210 |
-
/**
|
| 211 |
-
* Spacing classes
|
| 212 |
-
* Should be used to modify the default spacing between objects (not between nodes of the same object)
|
| 213 |
-
* Please use judiciously. You want to be using defaults most of the time, these are exceptions!
|
| 214 |
-
* <type><location><size>
|
| 215 |
-
*/
|
| 216 |
-
/* ====== Default spacing ====== */
|
| 217 |
-
h1, h2, h3, h4, h5, h6, ol,dl, p,blockquote, .media {margin:10px;}
|
| 218 |
-
h1, h2, h3, h4, h5, h6,img{padding-bottom:0px;}
|
| 219 |
-
pre{margin: 10px;}
|
| 220 |
-
table h1,table h2,table h3, table h4, table h5, table h6, table p, table ul, table ol, table dl{padding:0;}
|
| 221 |
-
|
| 222 |
-
.blocking-modal {
|
| 223 |
-
font-family: 'Open Sans', sans-serif;
|
| 224 |
-
top:150px;
|
| 225 |
-
background: white;
|
| 226 |
-
width: 680px;
|
| 227 |
-
overflow: hidden;
|
| 228 |
-
text-align: center;
|
| 229 |
-
color: #414042;
|
| 230 |
-
font-size: 14px;
|
| 231 |
-
line-height: 1.6em;
|
| 232 |
-
box-shadow: 0px 0px 52px rgba(0,0,0,0.32);
|
| 233 |
-
padding: 0;
|
| 234 |
-
height: 495px;
|
| 235 |
-
}
|
| 236 |
-
|
| 237 |
-
.api-key-modal, .welcome-modal {
|
| 238 |
-
height: auto;
|
| 239 |
-
}
|
| 240 |
-
|
| 241 |
-
h4 {
|
| 242 |
-
background: #00aa63;
|
| 243 |
-
color: #e6e6e6;
|
| 244 |
-
font-size: 22px;
|
| 245 |
-
line-height: 1.8em;
|
| 246 |
-
height: auto;
|
| 247 |
-
font-weight: 400;
|
| 248 |
-
margin: 0;
|
| 249 |
-
}
|
| 250 |
-
|
| 251 |
-
.blocking-modal a {
|
| 252 |
-
color: #3f7792;
|
| 253 |
-
text-decoration: none;
|
| 254 |
-
}
|
| 255 |
-
|
| 256 |
-
.blocking-modal a:hover {
|
| 257 |
-
color: #0988be;
|
| 258 |
-
}
|
| 259 |
-
|
| 260 |
-
.blocking-modal h2 {
|
| 261 |
-
font-size: 28px;
|
| 262 |
-
font-weight: normal;
|
| 263 |
-
}
|
| 264 |
-
|
| 265 |
-
.blocking-modal p {
|
| 266 |
-
margin: 10px;
|
| 267 |
-
font-size: 12px;
|
| 268 |
-
line-height: 1.6em;
|
| 269 |
-
padding: 0px 10px 0px 10px;
|
| 270 |
-
}
|
| 271 |
-
|
| 272 |
-
.blocking-modal img {
|
| 273 |
-
width: 100px;
|
| 274 |
-
height: 100px;
|
| 275 |
-
}
|
| 276 |
-
|
| 277 |
-
.blocking-modal .btn_main {
|
| 278 |
-
margin-bottom: 5px;
|
| 279 |
-
position: relative;
|
| 280 |
-
cursor: pointer;
|
| 281 |
-
display: inline-block;
|
| 282 |
-
background: #FF9800;
|
| 283 |
-
color: #fff !important;
|
| 284 |
-
text-transform: uppercase;
|
| 285 |
-
text-decoration: none;
|
| 286 |
-
padding: 25px 80px;
|
| 287 |
-
font-size: 20px;
|
| 288 |
-
font-weight: 600;
|
| 289 |
-
text-shadow: 0 1px 2px rgba(0, 0, 0, 0.25);
|
| 290 |
-
border-radius: 5px;
|
| 291 |
-
-webkit-box-shadow: inset 0 -3px #14947b;
|
| 292 |
-
box-shadow: inset 0 -3px #14947b;
|
| 293 |
-
}
|
| 294 |
-
|
| 295 |
-
.blocking-modal .btn_main_busy {
|
| 296 |
-
background-image: linear-gradient(-45deg, #ff9800 28%, #b76e03 28%, #b76e03 72%, #ff9800 72%) !important;
|
| 297 |
-
animation: shr-button__busy-animation 2000ms infinite linear;
|
| 298 |
-
background-size: 200px 100%;
|
| 299 |
-
transition: none;
|
| 300 |
-
}
|
| 301 |
-
|
| 302 |
-
@keyframes shr-button__busy-animation {
|
| 303 |
-
0% {
|
| 304 |
-
background-position: 400px 0;
|
| 305 |
-
}
|
| 306 |
-
}
|
| 307 |
-
|
| 308 |
-
.blocking-modal .btn_main:active {
|
| 309 |
-
top: 1px;
|
| 310 |
-
color: white;
|
| 311 |
-
outline: none;
|
| 312 |
-
-webkit-box-shadow: none;
|
| 313 |
-
box-shadow: none;
|
| 314 |
-
}
|
| 315 |
-
|
| 316 |
-
.blocking-modal .btn_main:hover {
|
| 317 |
-
filter: brightness(1.1);
|
| 318 |
-
color: white;
|
| 319 |
-
border: none;
|
| 320 |
-
}
|
| 321 |
-
|
| 322 |
-
.blocking-modal .shr-people {
|
| 323 |
-
background-image: url(../img/happy-people-cover.png);
|
| 324 |
-
background-position: center;
|
| 325 |
-
min-height: 200px;
|
| 326 |
-
background-size: contain;
|
| 327 |
-
background-repeat: no-repeat;
|
| 328 |
-
}
|
| 329 |
-
|
| 330 |
-
.blocking-modal .small {
|
| 331 |
-
font-size: 12px;
|
| 332 |
-
color: #888888;
|
| 333 |
-
}
|
| 334 |
-
|
| 335 |
-
input[type='text'] {
|
| 336 |
-
width: 272px;
|
| 337 |
-
}
|
| 338 |
-
|
| 339 |
-
.settings_updated {
|
| 340 |
-
color: #fff;
|
| 341 |
-
text-shadow: 0px 1px 1px rgba(0,0,0,0.4);
|
| 342 |
-
font-size: 14px;
|
| 343 |
-
background-color: #45a147 !important;
|
| 344 |
-
border-color: #316632 !important;
|
| 345 |
-
}
|
| 346 |
-
|
| 347 |
-
.signuppromo {
|
| 348 |
-
padding: 20px 20px;
|
| 349 |
-
color: #45A147;
|
| 350 |
-
font-size: 14px;
|
| 351 |
-
float: right;
|
| 352 |
-
width: 250px;
|
| 353 |
-
}
|
| 354 |
-
|
| 355 |
-
.signuppromo_note {
|
| 356 |
-
font: 300 12px/20px "open sans","helvetica neue",helvetica,arial,sans-serif;
|
| 357 |
-
color: #555;
|
| 358 |
-
}
|
| 359 |
-
|
| 360 |
-
.promoh1{
|
| 361 |
-
font: 400 16px/22px "open sans","helvetica neue",helvetica,arial,sans-serif;
|
| 362 |
-
margin: 0;
|
| 363 |
-
padding: 0;
|
| 364 |
-
}
|
| 365 |
-
|
| 366 |
-
.signuppromo ul {
|
| 367 |
-
margin: 24px 0px;
|
| 368 |
-
}
|
| 369 |
-
|
| 370 |
-
.signuppromo ul li {
|
| 371 |
-
background: url(../img/bolt.png) 0 2px no-repeat;
|
| 372 |
-
background-size: 18px 18px;
|
| 373 |
-
color: #555;
|
| 374 |
-
float: left;
|
| 375 |
-
font: 400 12px/18px "open sans","helvetica neue",helvetica,arial,sans-serif;
|
| 376 |
-
list-style: none;
|
| 377 |
-
padding: 2px 0 2px 32px;
|
| 378 |
-
text-align: left;
|
| 379 |
-
}
|
| 380 |
-
|
| 381 |
-
.sidebar_links {
|
| 382 |
-
padding: 20px 20px;
|
| 383 |
-
color: #45A147;
|
| 384 |
-
font-size: 14px;
|
| 385 |
-
}
|
| 386 |
-
|
| 387 |
-
.sidebar_links ul {
|
| 388 |
-
margin: 0px 0px 0px 15px;
|
| 389 |
-
list-style-type: square;
|
| 390 |
-
}
|
| 391 |
-
|
| 392 |
-
.sidebar_links ul li {
|
| 393 |
-
color: #555;
|
| 394 |
-
font: 400 12px/18px "open sans","helvetica neue",helvetica,arial,sans-serif;
|
| 395 |
-
margin: 0 0 4px 0;
|
| 396 |
-
text-align: left;
|
| 397 |
-
}
|
| 398 |
-
|
| 399 |
-
.key-status {
|
| 400 |
-
color: #fff;
|
| 401 |
-
text-align: center;
|
| 402 |
-
font-weight: 400;
|
| 403 |
-
}
|
| 404 |
-
|
| 405 |
-
.key-description {
|
| 406 |
-
line-height: 1.6em;
|
| 407 |
-
margin-top:10px;
|
| 408 |
-
}
|
| 409 |
-
|
| 410 |
-
.key-status.failed {
|
| 411 |
-
color: #f44336;
|
| 412 |
-
}
|
| 413 |
-
|
| 414 |
-
.key-status.passed {
|
| 415 |
-
color: #45a147;
|
| 416 |
-
}
|
| 417 |
-
|
| 418 |
-
.key-status.unknown {
|
| 419 |
-
color: #666666;
|
| 420 |
-
}
|
| 421 |
-
|
| 422 |
-
.blink {
|
| 423 |
-
-webkit-animation: blinker 1.5s alternate infinite ease-in-out;
|
| 424 |
-
animation: blinker 1.5s alternate infinite ease-in-out;
|
| 425 |
-
}
|
| 426 |
-
|
| 427 |
-
@keyframes blinker {
|
| 428 |
-
from {opacity: 1.0;}
|
| 429 |
-
to {opacity: 0.0;}
|
| 430 |
-
}
|
| 431 |
-
|
| 432 |
-
i.icon.icon-share_buttons {
|
| 433 |
-
background-position: 0 0px;
|
| 434 |
-
width: 16px;
|
| 435 |
-
height: 16px;
|
| 436 |
-
}
|
| 437 |
-
|
| 438 |
-
i.icon.icon-recommendations {
|
| 439 |
-
background-position: 0 -16px;
|
| 440 |
-
width: 16px;
|
| 441 |
-
height: 16px;
|
| 442 |
-
}
|
| 443 |
-
|
| 444 |
-
i.icon.icon-affiliate {
|
| 445 |
-
background-position: 0 -160px;
|
| 446 |
-
width: 16px;
|
| 447 |
-
height: 16px;
|
| 448 |
-
}
|
| 449 |
-
|
| 450 |
-
i.icon.icon-analytics {
|
| 451 |
-
background-position: 0 -32px;
|
| 452 |
-
width: 16px;
|
| 453 |
-
height: 16px;
|
| 454 |
-
}
|
| 455 |
-
|
| 456 |
-
i.icon.icon-website {
|
| 457 |
-
background-position: 0 -96px;
|
| 458 |
-
width: 16px;
|
| 459 |
-
height: 16px;
|
| 460 |
-
}
|
| 461 |
-
|
| 462 |
-
i.icon {
|
| 463 |
-
vertical-align: middle;
|
| 464 |
-
background-image: url(../img/shareaholic-icon-sprite@2x.png);
|
| 465 |
-
background-position: 0 0;
|
| 466 |
-
background-repeat: no-repeat;
|
| 467 |
-
display: inline-block;
|
| 468 |
-
position: relative;
|
| 469 |
-
background-size: 34px;
|
| 470 |
-
width: 16px;
|
| 471 |
-
height: 16px;
|
| 472 |
-
}
|
| 473 |
-
|
| 474 |
-
|
| 475 |
-
|
| 476 |
-
// Value Section
|
| 477 |
-
// *****************************************************************************
|
| 478 |
-
|
| 479 |
-
.plugin-value-section-container {
|
| 480 |
-
margin: 25px auto;
|
| 481 |
-
width: 650px;
|
| 482 |
-
}
|
| 483 |
-
|
| 484 |
-
.plugin-value-section {
|
| 485 |
-
margin: 25px auto;
|
| 486 |
-
height: 170px;
|
| 487 |
-
width: 650px;
|
| 488 |
-
font: 400 14px/20px "open sans", "helvetica neue", helvetica, arial, sans-serif;
|
| 489 |
-
-webkit-transition: all 0.3s ease-in-out;
|
| 490 |
-
-moz-transition: all 0.3s ease-in-out;
|
| 491 |
-
-o-transition: all 0.3s ease-in-out;
|
| 492 |
-
transition: all 0.3s ease-in-out;
|
| 493 |
-
}
|
| 494 |
-
|
| 495 |
-
.plugin-value-section .plugin-value-line {
|
| 496 |
-
display: block;
|
| 497 |
-
height: 1px;
|
| 498 |
-
width: 75%;
|
| 499 |
-
max-width: 770px;
|
| 500 |
-
margin: 0 auto;
|
| 501 |
-
border-top: 4px dashed rgba(160, 163, 166, 0.35);
|
| 502 |
-
margin: 47px auto -44px;
|
| 503 |
-
}
|
| 504 |
-
|
| 505 |
-
.plugin-value-section .plugin-value {
|
| 506 |
-
padding-top: 0px;
|
| 507 |
-
}
|
| 508 |
-
|
| 509 |
-
.plugin-value-section .plugin-value li {
|
| 510 |
-
position: relative;
|
| 511 |
-
float: left;
|
| 512 |
-
width: 25%;
|
| 513 |
-
margin-right: 0;
|
| 514 |
-
filter: progid:DXImageTransform.Microsoft.Alpha(Opacity=100);
|
| 515 |
-
opacity: 1;
|
| 516 |
-
text-align: center;
|
| 517 |
-
}
|
| 518 |
-
|
| 519 |
-
.plugin-value-section .plugin-value li:last-child {
|
| 520 |
-
border-right: none;
|
| 521 |
-
}
|
| 522 |
-
|
| 523 |
-
.plugin-value-section .plugin-value li p {
|
| 524 |
-
margin: 0;
|
| 525 |
-
padding: 1em 0.5em;
|
| 526 |
-
min-height: 110px;
|
| 527 |
-
color: rgb(136, 136, 136);
|
| 528 |
-
}
|
| 529 |
-
|
| 530 |
-
.plugin-value-section .plugin-value li a {
|
| 531 |
-
position: relative;
|
| 532 |
-
display: block;
|
| 533 |
-
background: transparent;
|
| 534 |
-
margin: 0 auto;
|
| 535 |
-
padding: 0;
|
| 536 |
-
}
|
| 537 |
-
|
| 538 |
-
.plugin-value-section .plugin-value li .icon {
|
| 539 |
-
display: block;
|
| 540 |
-
overflow: hidden;
|
| 541 |
-
height: 80px;
|
| 542 |
-
width: 80px;
|
| 543 |
-
line-height: 80px;
|
| 544 |
-
-webkit-border-radius: 50%;
|
| 545 |
-
-moz-border-radius: 50%;
|
| 546 |
-
-ms-border-radius: 50%;
|
| 547 |
-
-o-border-radius: 50%;
|
| 548 |
-
border-radius: 50%;
|
| 549 |
-
color: white;
|
| 550 |
-
margin: 0 auto 12px;
|
| 551 |
-
font-size: 34px;
|
| 552 |
-
}
|
| 553 |
-
|
| 554 |
-
.plugin-value-section .plugin-value li .icon.fa-bullhorn {
|
| 555 |
-
background: #bbea76;
|
| 556 |
-
}
|
| 557 |
-
|
| 558 |
-
.plugin-value-section .plugin-value li .icon.fa-fire {
|
| 559 |
-
background: #77dd77;
|
| 560 |
-
}
|
| 561 |
-
|
| 562 |
-
.plugin-value-section .plugin-value li .icon.fa-bar-chart-o {
|
| 563 |
-
background: #5ed5a4;
|
| 564 |
-
}
|
| 565 |
-
|
| 566 |
-
.plugin-value-section .plugin-value li .icon.fa-usd {
|
| 567 |
-
background: #49c0c0;
|
| 568 |
-
}
|
| 569 |
-
|
| 570 |
-
.plugin-value-section .plugin-value li.acquire .title {
|
| 571 |
-
color: #AAD56A;
|
| 572 |
-
}
|
| 573 |
-
|
| 574 |
-
.plugin-value-section .plugin-value li.engage .title {
|
| 575 |
-
color: #77dd77;
|
| 576 |
-
}
|
| 577 |
-
|
| 578 |
-
.plugin-value-section .plugin-value li.learn .title {
|
| 579 |
-
color: #5ed5a4;
|
| 580 |
-
}
|
| 581 |
-
|
| 582 |
-
.plugin-value-section .plugin-value li.monetize .title {
|
| 583 |
-
color: #49c0c0;
|
| 584 |
-
}
|
| 585 |
-
|
| 586 |
-
.plugin-value-section .plugin-value li a:hover {
|
| 587 |
-
-webkit-transition: background 0.2s;
|
| 588 |
-
-moz-transition: background 0.2s;
|
| 589 |
-
-o-transition: background 0.2s;
|
| 590 |
-
transition: background 0.2s;
|
| 591 |
-
}
|
| 592 |
-
|
| 593 |
-
.plugin-value-section .plugin-value li .title {
|
| 594 |
-
text-transform: none;
|
| 595 |
-
text-transform: uppercase;
|
| 596 |
-
font-size: 18px;
|
| 597 |
-
margin: 0;
|
| 598 |
-
padding: 0;
|
| 599 |
-
color: #2c3440;
|
| 600 |
-
display: block;
|
| 601 |
-
position: relative;
|
| 602 |
-
width: 100%;
|
| 603 |
-
}
|
| 604 |
-
|
| 605 |
-
.plugin-value-section.in-viewport {
|
| 606 |
-
-webkit-transition: all 0.5s ease-in-out;
|
| 607 |
-
-moz-transition: all 0.5s ease-in-out;
|
| 608 |
-
-o-transition: all 0.5s ease-in-out;
|
| 609 |
-
transition: all 0.5s ease-in-out;
|
| 610 |
-
filter: progid:DXImageTransform.Microsoft.Alpha(Opacity=100);
|
| 611 |
-
opacity: 1;
|
| 612 |
-
}
|
| 1 |
+
body{-webkit-font-smoothing:antialiased;font-smoothing:antialiased;background:#f1f1f1!important;color:#666;font-family:sans-serif;font-size:12px!important}.app a,.text-muted a{color:#337ab7;text-decoration:none}.btn-dark{color:#fff!important}.container-fluid{clear:both;padding:0}.canvas{display:block}h3{clear:both}.clear{clear:both!important;height:auto!important}#app_settings{padding-top:0}fieldset{border:1px solid #d8d8d8;float:left;margin:5px;padding:10px}fieldset#facebook-app.failed{border:1px solid #f44336}.app{background-color:#fdfdfd;border:1px solid #e5e5e5;box-shadow:0 1px 1px rgba(0,0,0,.04);margin:15px 0;padding:10px;width:100%}.wide-button{min-width:200px}.button-wrapper{clear:both;padding-top:5px}.app h2{border-bottom:1px solid #ccc;font-size:18px;margin:-10px -10px 0;padding:10px 10px 10px 20px}.app-content{padding:15px 0 5px 10px}.app label{display:inline;font-size:12px;line-height:1.6em}legend{border:none;color:#007bb6;font-size:13px;font-weight:700;margin-bottom:0;padding:0 10px;width:auto}.location{clear:both;padding-top:5px}.location_item_cta{margin-left:25px}.check{position:relative}.shr-form-item{padding-bottom:4px!important}.shr-form-item>*{display:inline-block!important;max-width:90%;vertical-align:top}.shr-form-text~.shr-form-text{margin-top:.5rem}.shr-form-text label{margin-bottom:0}.regular-text{margin:1px;padding:3px 5px}.label{margin-right:20px}#iframe_container,iframe{height:100%;width:100%}.bg-loading-img{background-image:url(../img/ajax_loader_green_128.gif);background-position:50%;background-repeat:no-repeat}#shortcode,#shortcode_container{background:#fff;cursor:inherit;height:30px;text-align:center;width:100%}#shortcode_container{border-top:3px solid #ccc}#shortcode{font-family:monospace}.reveal-modal{height:80%;margin-left:-335px;position:fixed;width:720px}.reveal-modal.has-shortcode #iframe_container,.reveal-modal.has-shortcode iframe{height:100%}.fieldset-footer{clear:both;overflow:hidden}.fieldset-footer .app-status,.fieldset-footer button{float:left}#editing_modal{padding:0}ul{margin:0}.green{color:#11967a}.red{color:#f44336}.grey{color:#666}.media,blockquote,dl,h1,h2,h3,h4,h5,h6,ol,p{margin:10px}h1,h2,h3,h4,h5,h6,img{padding-bottom:0}pre{margin:10px}table dl,table h1,table h2,table h3,table h4,table h5,table h6,table ol,table p,table ul{padding:0}.blocking-modal{background:#fff;box-shadow:0 0 52px rgba(0,0,0,.32);color:#414042;font-family:Open Sans,sans-serif;font-size:14px;height:495px;line-height:1.6em;overflow:hidden;padding:0;text-align:center;top:150px;width:680px}.api-key-modal,.welcome-modal,h4{height:auto}h4{background:#00aa63;color:#e6e6e6;font-size:22px;font-weight:400;line-height:1.8em;margin:0}.blocking-modal a{color:#3f7792;text-decoration:none}.blocking-modal a:hover{color:#0988be}.blocking-modal h2{font-size:28px;font-weight:400}.blocking-modal p{font-size:12px;line-height:1.6em;margin:10px;padding:0 10px}.blocking-modal img{height:100px;width:100px}.blocking-modal .btn_main{background:#ff9800;border-radius:5px;box-shadow:inset 0 -3px #14947b;color:#fff!important;cursor:pointer;display:inline-block;font-size:20px;font-weight:600;margin-bottom:5px;padding:25px 80px;position:relative;text-decoration:none;text-shadow:0 1px 2px rgba(0,0,0,.25);text-transform:uppercase}.blocking-modal .btn_main_busy{-webkit-animation:shr-button__busy-animation 2s linear infinite;animation:shr-button__busy-animation 2s linear infinite;background-image:linear-gradient(-45deg,#ff9800 28%,#b76e03 0,#b76e03 72%,#ff9800 0)!important;background-size:200px 100%;transition:none}@-webkit-keyframes shr-button__busy-animation{0%{background-position:400px 0}}@keyframes shr-button__busy-animation{0%{background-position:400px 0}}.blocking-modal .btn_main:active{box-shadow:none;color:#fff;outline:none;top:1px}.blocking-modal .btn_main:hover{border:none;color:#fff;filter:brightness(1.1)}.blocking-modal .shr-people{background-image:url(../img/happy-people-cover.png);background-position:50%;background-repeat:no-repeat;background-size:contain;min-height:200px}.blocking-modal .small{color:#888;font-size:12px}input[type=text]{width:272px}.settings_updated{background-color:#45a147!important;border-color:#316632!important;color:#fff;font-size:14px;text-shadow:0 1px 1px rgba(0,0,0,.4)}.signuppromo{color:#45a147;float:right;font-size:14px;padding:20px;width:250px}.signuppromo_note{color:#555;font:300 12px/20px open sans,helvetica neue,helvetica,arial,sans-serif}.promoh1{font:400 16px/22px open sans,helvetica neue,helvetica,arial,sans-serif;margin:0;padding:0}.signuppromo ul{margin:24px 0}.signuppromo ul li{background:url(../img/bolt.png) 0 2px no-repeat;background-size:18px 18px;color:#555;float:left;font:400 12px/18px open sans,helvetica neue,helvetica,arial,sans-serif;list-style:none;padding:2px 0 2px 32px;text-align:left}.sidebar_links{color:#45a147;font-size:14px;padding:20px}.sidebar_links ul{list-style-type:square;margin:0 0 0 15px}.sidebar_links ul li{color:#555;font:400 12px/18px open sans,helvetica neue,helvetica,arial,sans-serif;margin:0 0 4px;text-align:left}.key-status{color:#fff;font-weight:400;text-align:center}.key-description{line-height:1.6em;margin-top:10px}.key-status.failed{color:#f44336}.key-status.passed{color:#45a147}.key-status.unknown{color:#666}.blink{-webkit-animation:blinker 1.5s ease-in-out infinite alternate;animation:blinker 1.5s ease-in-out infinite alternate}@-webkit-keyframes blinker{0%{opacity:1}to{opacity:0}}@keyframes blinker{0%{opacity:1}to{opacity:0}}i.icon.icon-share_buttons{background-position:0 0;height:16px;width:16px}i.icon.icon-recommendations{background-position:0 -16px;height:16px;width:16px}i.icon.icon-affiliate{background-position:0 -160px;height:16px;width:16px}i.icon.icon-analytics{background-position:0 -32px;height:16px;width:16px}i.icon.icon-website{background-position:0 -96px;height:16px;width:16px}i.icon{background-image:url(../img/shareaholic-icon-sprite@2x.png);background-position:0 0;background-repeat:no-repeat;background-size:34px;display:inline-block;height:16px;position:relative;vertical-align:middle;width:16px}.plugin-value-section,.plugin-value-section-container{margin:25px auto;width:650px}.plugin-value-section{font:400 14px/20px open sans,helvetica neue,helvetica,arial,sans-serif;height:170px;transition:all .3s ease-in-out}.plugin-value-section .plugin-value-line{border-top:4px dashed hsla(210,3%,64%,.35);display:block;height:1px;margin:47px auto -44px;max-width:770px;width:75%}.plugin-value-section .plugin-value{padding-top:0}.plugin-value-section .plugin-value li{filter:progid:DXImageTransform.Microsoft.Alpha(Opacity=100);float:left;margin-right:0;opacity:1;position:relative;text-align:center;width:25%}.plugin-value-section .plugin-value li:last-child{border-right:none}.plugin-value-section .plugin-value li p{color:#888;margin:0;min-height:110px;padding:1em .5em}.plugin-value-section .plugin-value li a{background:transparent;display:block;margin:0 auto;padding:0;position:relative}.plugin-value-section .plugin-value li .icon{border-radius:50%;color:#fff;display:block;font-size:34px;height:80px;line-height:80px;margin:0 auto 12px;overflow:hidden;width:80px}.plugin-value-section .plugin-value li .icon.fa-bullhorn{background:#bbea76}.plugin-value-section .plugin-value li .icon.fa-fire{background:#7d7}.plugin-value-section .plugin-value li .icon.fa-bar-chart-o{background:#5ed5a4}.plugin-value-section .plugin-value li .icon.fa-usd{background:#49c0c0}.plugin-value-section .plugin-value li.acquire .title{color:#aad56a}.plugin-value-section .plugin-value li.engage .title{color:#7d7}.plugin-value-section .plugin-value li.learn .title{color:#5ed5a4}.plugin-value-section .plugin-value li.monetize .title{color:#49c0c0}.plugin-value-section .plugin-value li a:hover{transition:background .2s}.plugin-value-section .plugin-value li .title{color:#2c3440;display:block;font-size:18px;margin:0;padding:0;position:relative;text-transform:none;text-transform:uppercase;width:100%}.plugin-value-section.in-viewport{filter:progid:DXImageTransform.Microsoft.Alpha(Opacity=100);opacity:1;transition:all .5s ease-in-out}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/css/reveal.css
CHANGED
|
@@ -1,111 +1 @@
|
|
| 1 |
-
|
| 2 |
-
Reveal Modals
|
| 3 |
-
-------------------------------------------------- */
|
| 4 |
-
|
| 5 |
-
.reveal-modal-bg {
|
| 6 |
-
position: fixed;
|
| 7 |
-
height: 100%;
|
| 8 |
-
width: 100%;
|
| 9 |
-
background: #000;
|
| 10 |
-
background: rgba(0, 0, 0, 0.8);
|
| 11 |
-
z-index: 100;
|
| 12 |
-
display: none;
|
| 13 |
-
top: 0;
|
| 14 |
-
left: 0; }
|
| 15 |
-
|
| 16 |
-
/* use super high z-index so that no other WP plugins will override */
|
| 17 |
-
.reveal-modal {
|
| 18 |
-
background: #fff url(modal-gloss.png) no-repeat -200px -80px;
|
| 19 |
-
border-radius: 5px;
|
| 20 |
-
box-shadow: 0 0 10px rgba(0, 0, 0, 0.4);
|
| 21 |
-
left: 50%;
|
| 22 |
-
margin-left: -300px;
|
| 23 |
-
position: fixed;
|
| 24 |
-
padding: 30px 20px 30px;
|
| 25 |
-
top: 150px;
|
| 26 |
-
visibility: hidden;
|
| 27 |
-
width: 500px;
|
| 28 |
-
z-index: 1000000; }
|
| 29 |
-
.reveal-modal form {
|
| 30 |
-
margin: 0; }
|
| 31 |
-
.reveal-modal h2 {
|
| 32 |
-
font: 600 18px/1 "open sans", "helvetica neue", helvetica, arial, sans-serif;
|
| 33 |
-
margin: 0 0 18px 0; }
|
| 34 |
-
.reveal-modal p {
|
| 35 |
-
font: 400 14px/1 "open sans", "helvetica neue", helvetica, arial, sans-serif;
|
| 36 |
-
margin: 0 0 14px 0; }
|
| 37 |
-
.reveal-modal p.note {
|
| 38 |
-
color: #888;
|
| 39 |
-
font-size: 12px; }
|
| 40 |
-
.reveal-modal p.signup-tos {
|
| 41 |
-
font: 400 10px/2 "open sans", "helvetica neue", helvetica, arial, sans-serif; }
|
| 42 |
-
.reveal-modal input[type="submit"] {
|
| 43 |
-
margin: 14px 0 0 0; }
|
| 44 |
-
.reveal-modal .config {
|
| 45 |
-
margin: 0 0 14px 0; }
|
| 46 |
-
.reveal-modal .config label {
|
| 47 |
-
display: block;
|
| 48 |
-
font: 600 12px/1 "open sans", "helvetica neue", helvetica, arial, sans-serif;
|
| 49 |
-
margin: 0 0 4px 0; }
|
| 50 |
-
.reveal-modal .config input[type="checkbox"] + label {
|
| 51 |
-
display: inline-block; }
|
| 52 |
-
|
| 53 |
-
.reveal-modal-iframe {
|
| 54 |
-
background: #fff;
|
| 55 |
-
border-radius: 5px;
|
| 56 |
-
padding: 0; }
|
| 57 |
-
|
| 58 |
-
.reveal-modal-iframe iframe {
|
| 59 |
-
border: 0; }
|
| 60 |
-
|
| 61 |
-
.reveal-modal.small {
|
| 62 |
-
width: 200px;
|
| 63 |
-
margin-left: -140px; }
|
| 64 |
-
|
| 65 |
-
.reveal-modal.medium {
|
| 66 |
-
width: 400px;
|
| 67 |
-
margin-left: -240px; }
|
| 68 |
-
|
| 69 |
-
.reveal-modal.large {
|
| 70 |
-
width: 600px;
|
| 71 |
-
margin-left: -340px; }
|
| 72 |
-
|
| 73 |
-
.reveal-modal.xlarge {
|
| 74 |
-
width: 800px;
|
| 75 |
-
margin-left: -440px; }
|
| 76 |
-
|
| 77 |
-
.reveal-modal .close-reveal-modal {
|
| 78 |
-
font-size: 22px;
|
| 79 |
-
line-height: .5;
|
| 80 |
-
position: absolute;
|
| 81 |
-
top: 15px;
|
| 82 |
-
right: 15px;
|
| 83 |
-
color: #aaa;
|
| 84 |
-
text-shadow: 0 -1px 1px rbga(0, 0, 0, 0.6);
|
| 85 |
-
font-weight: bold;
|
| 86 |
-
cursor: pointer; }
|
| 87 |
-
|
| 88 |
-
@media all and (max-width: 520px) {
|
| 89 |
-
.reveal-modal {
|
| 90 |
-
left: 50%;
|
| 91 |
-
margin-left: -160px;
|
| 92 |
-
padding: 30px 10px 0 10px;
|
| 93 |
-
top: 30px;
|
| 94 |
-
width: 300px; } }
|
| 95 |
-
|
| 96 |
-
/*
|
| 97 |
-
|
| 98 |
-
NOTES
|
| 99 |
-
|
| 100 |
-
Close button entity is ×
|
| 101 |
-
|
| 102 |
-
Example markup
|
| 103 |
-
|
| 104 |
-
<div id="myModal" class="reveal-modal">
|
| 105 |
-
<h2>Awesome. I have it.</h2>
|
| 106 |
-
<p class="lead">Your couch. I it's mine.</p>
|
| 107 |
-
<p>Lorem ipsum dolor sit amet, consectetur adipiscing elit. In ultrices aliquet placerat. Duis pulvinar orci et nisi euismod vitae tempus lorem consectetur. Duis at magna quis turpis mattis venenatis eget id diam. </p>
|
| 108 |
-
<a class="close-reveal-modal">×</a>
|
| 109 |
-
</div>
|
| 110 |
-
|
| 111 |
-
*/
|
| 1 |
+
.reveal-modal-bg{background:#000;background:rgba(0,0,0,.8);display:none;height:100%;left:0;position:fixed;top:0;width:100%;z-index:100}.reveal-modal{background:#fff url(modal-gloss.png) no-repeat -200px -80px;border-radius:5px;box-shadow:0 0 10px rgba(0,0,0,.4);left:50%;margin-left:-300px;padding:30px 20px;position:fixed;top:150px;visibility:hidden;width:500px;z-index:1000000}.reveal-modal form{margin:0}.reveal-modal h2{font:600 18px/1 open sans,helvetica neue,helvetica,arial,sans-serif;margin:0 0 18px}.reveal-modal p{font:400 14px/1 open sans,helvetica neue,helvetica,arial,sans-serif;margin:0 0 14px}.reveal-modal p.note{color:#888;font-size:12px}.reveal-modal p.signup-tos{font:400 10px/2 open sans,helvetica neue,helvetica,arial,sans-serif}.reveal-modal input[type=submit]{margin:14px 0 0}.reveal-modal .config{margin:0 0 14px}.reveal-modal .config label{display:block;font:600 12px/1 open sans,helvetica neue,helvetica,arial,sans-serif;margin:0 0 4px}.reveal-modal .config input[type=checkbox]+label{display:inline-block}.reveal-modal-iframe{background:#fff;border-radius:5px;padding:0}.reveal-modal-iframe iframe{border:0}.reveal-modal.small{margin-left:-140px;width:200px}.reveal-modal.medium{margin-left:-240px;width:400px}.reveal-modal.large{margin-left:-340px;width:600px}.reveal-modal.xlarge{margin-left:-440px;width:800px}.reveal-modal .close-reveal-modal{color:#aaa;cursor:pointer;font-size:22px;font-weight:700;line-height:.5;position:absolute;right:15px;text-shadow:0 -1px 1px rbga(0,0,0,.6);top:15px}@media (max-width:520px){.reveal-modal{left:50%;margin-left:-160px;padding:30px 10px 0;top:30px;width:300px}}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/js/bootstrap.js
DELETED
|
@@ -1,2276 +0,0 @@
|
|
| 1 |
-
/* ===================================================
|
| 2 |
-
* bootstrap-transition.js v2.3.1
|
| 3 |
-
* http://twitter.github.com/bootstrap/javascript.html#transitions
|
| 4 |
-
* ===================================================
|
| 5 |
-
* Copyright 2012 Twitter, Inc.
|
| 6 |
-
*
|
| 7 |
-
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 8 |
-
* you may not use this file except in compliance with the License.
|
| 9 |
-
* You may obtain a copy of the License at
|
| 10 |
-
*
|
| 11 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 12 |
-
*
|
| 13 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 14 |
-
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 15 |
-
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 16 |
-
* See the License for the specific language governing permissions and
|
| 17 |
-
* limitations under the License.
|
| 18 |
-
* ========================================================== */
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
!function ($) {
|
| 22 |
-
|
| 23 |
-
"use strict"; // jshint ;_;
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
/* CSS TRANSITION SUPPORT (http://www.modernizr.com/)
|
| 27 |
-
* ======================================================= */
|
| 28 |
-
|
| 29 |
-
$(function () {
|
| 30 |
-
|
| 31 |
-
$.support.transition = (function () {
|
| 32 |
-
|
| 33 |
-
var transitionEnd = (function () {
|
| 34 |
-
|
| 35 |
-
var el = document.createElement('bootstrap')
|
| 36 |
-
, transEndEventNames = {
|
| 37 |
-
'WebkitTransition' : 'webkitTransitionEnd'
|
| 38 |
-
, 'MozTransition' : 'transitionend'
|
| 39 |
-
, 'OTransition' : 'oTransitionEnd otransitionend'
|
| 40 |
-
, 'transition' : 'transitionend'
|
| 41 |
-
}
|
| 42 |
-
, name
|
| 43 |
-
|
| 44 |
-
for (name in transEndEventNames){
|
| 45 |
-
if (el.style[name] !== undefined) {
|
| 46 |
-
return transEndEventNames[name]
|
| 47 |
-
}
|
| 48 |
-
}
|
| 49 |
-
|
| 50 |
-
}())
|
| 51 |
-
|
| 52 |
-
return transitionEnd && {
|
| 53 |
-
end: transitionEnd
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
})()
|
| 57 |
-
|
| 58 |
-
})
|
| 59 |
-
|
| 60 |
-
}(window.jQuery);/* ==========================================================
|
| 61 |
-
* bootstrap-alert.js v2.3.1
|
| 62 |
-
* http://twitter.github.com/bootstrap/javascript.html#alerts
|
| 63 |
-
* ==========================================================
|
| 64 |
-
* Copyright 2012 Twitter, Inc.
|
| 65 |
-
*
|
| 66 |
-
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 67 |
-
* you may not use this file except in compliance with the License.
|
| 68 |
-
* You may obtain a copy of the License at
|
| 69 |
-
*
|
| 70 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 71 |
-
*
|
| 72 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 73 |
-
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 74 |
-
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 75 |
-
* See the License for the specific language governing permissions and
|
| 76 |
-
* limitations under the License.
|
| 77 |
-
* ========================================================== */
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
!function ($) {
|
| 81 |
-
|
| 82 |
-
"use strict"; // jshint ;_;
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
/* ALERT CLASS DEFINITION
|
| 86 |
-
* ====================== */
|
| 87 |
-
|
| 88 |
-
var dismiss = '[data-dismiss="alert"]'
|
| 89 |
-
, Alert = function (el) {
|
| 90 |
-
$(el).on('click', dismiss, this.close)
|
| 91 |
-
}
|
| 92 |
-
|
| 93 |
-
Alert.prototype.close = function (e) {
|
| 94 |
-
var $this = $(this)
|
| 95 |
-
, selector = $this.attr('data-target')
|
| 96 |
-
, $parent
|
| 97 |
-
|
| 98 |
-
if (!selector) {
|
| 99 |
-
selector = $this.attr('href')
|
| 100 |
-
selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
$parent = $(selector)
|
| 104 |
-
|
| 105 |
-
e && e.preventDefault()
|
| 106 |
-
|
| 107 |
-
$parent.length || ($parent = $this.hasClass('alert') ? $this : $this.parent())
|
| 108 |
-
|
| 109 |
-
$parent.trigger(e = $.Event('close'))
|
| 110 |
-
|
| 111 |
-
if (e.isDefaultPrevented()) return
|
| 112 |
-
|
| 113 |
-
$parent.removeClass('in')
|
| 114 |
-
|
| 115 |
-
function removeElement() {
|
| 116 |
-
$parent
|
| 117 |
-
.trigger('closed')
|
| 118 |
-
.remove()
|
| 119 |
-
}
|
| 120 |
-
|
| 121 |
-
$.support.transition && $parent.hasClass('fade') ?
|
| 122 |
-
$parent.on($.support.transition.end, removeElement) :
|
| 123 |
-
removeElement()
|
| 124 |
-
}
|
| 125 |
-
|
| 126 |
-
|
| 127 |
-
/* ALERT PLUGIN DEFINITION
|
| 128 |
-
* ======================= */
|
| 129 |
-
|
| 130 |
-
var old = $.fn.alert
|
| 131 |
-
|
| 132 |
-
$.fn.alert = function (option) {
|
| 133 |
-
return this.each(function () {
|
| 134 |
-
var $this = $(this)
|
| 135 |
-
, data = $this.data('alert')
|
| 136 |
-
if (!data) $this.data('alert', (data = new Alert(this)))
|
| 137 |
-
if (typeof option == 'string') data[option].call($this)
|
| 138 |
-
})
|
| 139 |
-
}
|
| 140 |
-
|
| 141 |
-
$.fn.alert.Constructor = Alert
|
| 142 |
-
|
| 143 |
-
|
| 144 |
-
/* ALERT NO CONFLICT
|
| 145 |
-
* ================= */
|
| 146 |
-
|
| 147 |
-
$.fn.alert.noConflict = function () {
|
| 148 |
-
$.fn.alert = old
|
| 149 |
-
return this
|
| 150 |
-
}
|
| 151 |
-
|
| 152 |
-
|
| 153 |
-
/* ALERT DATA-API
|
| 154 |
-
* ============== */
|
| 155 |
-
|
| 156 |
-
$(document).on('click.alert.data-api', dismiss, Alert.prototype.close)
|
| 157 |
-
|
| 158 |
-
}(window.jQuery);/* ============================================================
|
| 159 |
-
* bootstrap-button.js v2.3.1
|
| 160 |
-
* http://twitter.github.com/bootstrap/javascript.html#buttons
|
| 161 |
-
* ============================================================
|
| 162 |
-
* Copyright 2012 Twitter, Inc.
|
| 163 |
-
*
|
| 164 |
-
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 165 |
-
* you may not use this file except in compliance with the License.
|
| 166 |
-
* You may obtain a copy of the License at
|
| 167 |
-
*
|
| 168 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 169 |
-
*
|
| 170 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 171 |
-
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 172 |
-
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 173 |
-
* See the License for the specific language governing permissions and
|
| 174 |
-
* limitations under the License.
|
| 175 |
-
* ============================================================ */
|
| 176 |
-
|
| 177 |
-
|
| 178 |
-
!function ($) {
|
| 179 |
-
|
| 180 |
-
"use strict"; // jshint ;_;
|
| 181 |
-
|
| 182 |
-
|
| 183 |
-
/* BUTTON PUBLIC CLASS DEFINITION
|
| 184 |
-
* ============================== */
|
| 185 |
-
|
| 186 |
-
var Button = function (element, options) {
|
| 187 |
-
this.$element = $(element)
|
| 188 |
-
this.options = $.extend({}, $.fn.button.defaults, options)
|
| 189 |
-
}
|
| 190 |
-
|
| 191 |
-
Button.prototype.setState = function (state) {
|
| 192 |
-
var d = 'disabled'
|
| 193 |
-
, $el = this.$element
|
| 194 |
-
, data = $el.data()
|
| 195 |
-
, val = $el.is('input') ? 'val' : 'html'
|
| 196 |
-
|
| 197 |
-
state = state + 'Text'
|
| 198 |
-
data.resetText || $el.data('resetText', $el[val]())
|
| 199 |
-
|
| 200 |
-
$el[val](data[state] || this.options[state])
|
| 201 |
-
|
| 202 |
-
// push to event loop to allow forms to submit
|
| 203 |
-
setTimeout(function () {
|
| 204 |
-
state == 'loadingText' ?
|
| 205 |
-
$el.addClass(d).attr(d, d) :
|
| 206 |
-
$el.removeClass(d).removeAttr(d)
|
| 207 |
-
}, 0)
|
| 208 |
-
}
|
| 209 |
-
|
| 210 |
-
Button.prototype.toggle = function () {
|
| 211 |
-
var $parent = this.$element.closest('[data-toggle="buttons-radio"]')
|
| 212 |
-
|
| 213 |
-
$parent && $parent
|
| 214 |
-
.find('.active')
|
| 215 |
-
.removeClass('active')
|
| 216 |
-
|
| 217 |
-
this.$element.toggleClass('active')
|
| 218 |
-
}
|
| 219 |
-
|
| 220 |
-
|
| 221 |
-
/* BUTTON PLUGIN DEFINITION
|
| 222 |
-
* ======================== */
|
| 223 |
-
|
| 224 |
-
var old = $.fn.button
|
| 225 |
-
|
| 226 |
-
$.fn.button = function (option) {
|
| 227 |
-
return this.each(function () {
|
| 228 |
-
var $this = $(this)
|
| 229 |
-
, data = $this.data('button')
|
| 230 |
-
, options = typeof option == 'object' && option
|
| 231 |
-
if (!data) $this.data('button', (data = new Button(this, options)))
|
| 232 |
-
if (option == 'toggle') data.toggle()
|
| 233 |
-
else if (option) data.setState(option)
|
| 234 |
-
})
|
| 235 |
-
}
|
| 236 |
-
|
| 237 |
-
$.fn.button.defaults = {
|
| 238 |
-
loadingText: 'loading...'
|
| 239 |
-
}
|
| 240 |
-
|
| 241 |
-
$.fn.button.Constructor = Button
|
| 242 |
-
|
| 243 |
-
|
| 244 |
-
/* BUTTON NO CONFLICT
|
| 245 |
-
* ================== */
|
| 246 |
-
|
| 247 |
-
$.fn.button.noConflict = function () {
|
| 248 |
-
$.fn.button = old
|
| 249 |
-
return this
|
| 250 |
-
}
|
| 251 |
-
|
| 252 |
-
|
| 253 |
-
/* BUTTON DATA-API
|
| 254 |
-
* =============== */
|
| 255 |
-
|
| 256 |
-
$(document).on('click.button.data-api', '[data-toggle^=button]', function (e) {
|
| 257 |
-
var $btn = $(e.target)
|
| 258 |
-
if (!$btn.hasClass('btn')) $btn = $btn.closest('.btn')
|
| 259 |
-
$btn.button('toggle')
|
| 260 |
-
})
|
| 261 |
-
|
| 262 |
-
}(window.jQuery);/* ==========================================================
|
| 263 |
-
* bootstrap-carousel.js v2.3.1
|
| 264 |
-
* http://twitter.github.com/bootstrap/javascript.html#carousel
|
| 265 |
-
* ==========================================================
|
| 266 |
-
* Copyright 2012 Twitter, Inc.
|
| 267 |
-
*
|
| 268 |
-
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 269 |
-
* you may not use this file except in compliance with the License.
|
| 270 |
-
* You may obtain a copy of the License at
|
| 271 |
-
*
|
| 272 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 273 |
-
*
|
| 274 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 275 |
-
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 276 |
-
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 277 |
-
* See the License for the specific language governing permissions and
|
| 278 |
-
* limitations under the License.
|
| 279 |
-
* ========================================================== */
|
| 280 |
-
|
| 281 |
-
|
| 282 |
-
!function ($) {
|
| 283 |
-
|
| 284 |
-
"use strict"; // jshint ;_;
|
| 285 |
-
|
| 286 |
-
|
| 287 |
-
/* CAROUSEL CLASS DEFINITION
|
| 288 |
-
* ========================= */
|
| 289 |
-
|
| 290 |
-
var Carousel = function (element, options) {
|
| 291 |
-
this.$element = $(element)
|
| 292 |
-
this.$indicators = this.$element.find('.carousel-indicators')
|
| 293 |
-
this.options = options
|
| 294 |
-
this.options.pause == 'hover' && this.$element
|
| 295 |
-
.on('mouseenter', $.proxy(this.pause, this))
|
| 296 |
-
.on('mouseleave', $.proxy(this.cycle, this))
|
| 297 |
-
}
|
| 298 |
-
|
| 299 |
-
Carousel.prototype = {
|
| 300 |
-
|
| 301 |
-
cycle: function (e) {
|
| 302 |
-
if (!e) this.paused = false
|
| 303 |
-
if (this.interval) clearInterval(this.interval);
|
| 304 |
-
this.options.interval
|
| 305 |
-
&& !this.paused
|
| 306 |
-
&& (this.interval = setInterval($.proxy(this.next, this), this.options.interval))
|
| 307 |
-
return this
|
| 308 |
-
}
|
| 309 |
-
|
| 310 |
-
, getActiveIndex: function () {
|
| 311 |
-
this.$active = this.$element.find('.item.active')
|
| 312 |
-
this.$items = this.$active.parent().children()
|
| 313 |
-
return this.$items.index(this.$active)
|
| 314 |
-
}
|
| 315 |
-
|
| 316 |
-
, to: function (pos) {
|
| 317 |
-
var activeIndex = this.getActiveIndex()
|
| 318 |
-
, that = this
|
| 319 |
-
|
| 320 |
-
if (pos > (this.$items.length - 1) || pos < 0) return
|
| 321 |
-
|
| 322 |
-
if (this.sliding) {
|
| 323 |
-
return this.$element.one('slid', function () {
|
| 324 |
-
that.to(pos)
|
| 325 |
-
})
|
| 326 |
-
}
|
| 327 |
-
|
| 328 |
-
if (activeIndex == pos) {
|
| 329 |
-
return this.pause().cycle()
|
| 330 |
-
}
|
| 331 |
-
|
| 332 |
-
return this.slide(pos > activeIndex ? 'next' : 'prev', $(this.$items[pos]))
|
| 333 |
-
}
|
| 334 |
-
|
| 335 |
-
, pause: function (e) {
|
| 336 |
-
if (!e) this.paused = true
|
| 337 |
-
if (this.$element.find('.next, .prev').length && $.support.transition.end) {
|
| 338 |
-
this.$element.trigger($.support.transition.end)
|
| 339 |
-
this.cycle(true)
|
| 340 |
-
}
|
| 341 |
-
clearInterval(this.interval)
|
| 342 |
-
this.interval = null
|
| 343 |
-
return this
|
| 344 |
-
}
|
| 345 |
-
|
| 346 |
-
, next: function () {
|
| 347 |
-
if (this.sliding) return
|
| 348 |
-
return this.slide('next')
|
| 349 |
-
}
|
| 350 |
-
|
| 351 |
-
, prev: function () {
|
| 352 |
-
if (this.sliding) return
|
| 353 |
-
return this.slide('prev')
|
| 354 |
-
}
|
| 355 |
-
|
| 356 |
-
, slide: function (type, next) {
|
| 357 |
-
var $active = this.$element.find('.item.active')
|
| 358 |
-
, $next = next || $active[type]()
|
| 359 |
-
, isCycling = this.interval
|
| 360 |
-
, direction = type == 'next' ? 'left' : 'right'
|
| 361 |
-
, fallback = type == 'next' ? 'first' : 'last'
|
| 362 |
-
, that = this
|
| 363 |
-
, e
|
| 364 |
-
|
| 365 |
-
this.sliding = true
|
| 366 |
-
|
| 367 |
-
isCycling && this.pause()
|
| 368 |
-
|
| 369 |
-
$next = $next.length ? $next : this.$element.find('.item')[fallback]()
|
| 370 |
-
|
| 371 |
-
e = $.Event('slide', {
|
| 372 |
-
relatedTarget: $next[0]
|
| 373 |
-
, direction: direction
|
| 374 |
-
})
|
| 375 |
-
|
| 376 |
-
if ($next.hasClass('active')) return
|
| 377 |
-
|
| 378 |
-
if (this.$indicators.length) {
|
| 379 |
-
this.$indicators.find('.active').removeClass('active')
|
| 380 |
-
this.$element.one('slid', function () {
|
| 381 |
-
var $nextIndicator = $(that.$indicators.children()[that.getActiveIndex()])
|
| 382 |
-
$nextIndicator && $nextIndicator.addClass('active')
|
| 383 |
-
})
|
| 384 |
-
}
|
| 385 |
-
|
| 386 |
-
if ($.support.transition && this.$element.hasClass('slide')) {
|
| 387 |
-
this.$element.trigger(e)
|
| 388 |
-
if (e.isDefaultPrevented()) return
|
| 389 |
-
$next.addClass(type)
|
| 390 |
-
$next[0].offsetWidth // force reflow
|
| 391 |
-
$active.addClass(direction)
|
| 392 |
-
$next.addClass(direction)
|
| 393 |
-
this.$element.one($.support.transition.end, function () {
|
| 394 |
-
$next.removeClass([type, direction].join(' ')).addClass('active')
|
| 395 |
-
$active.removeClass(['active', direction].join(' '))
|
| 396 |
-
that.sliding = false
|
| 397 |
-
setTimeout(function () { that.$element.trigger('slid') }, 0)
|
| 398 |
-
})
|
| 399 |
-
} else {
|
| 400 |
-
this.$element.trigger(e)
|
| 401 |
-
if (e.isDefaultPrevented()) return
|
| 402 |
-
$active.removeClass('active')
|
| 403 |
-
$next.addClass('active')
|
| 404 |
-
this.sliding = false
|
| 405 |
-
this.$element.trigger('slid')
|
| 406 |
-
}
|
| 407 |
-
|
| 408 |
-
isCycling && this.cycle()
|
| 409 |
-
|
| 410 |
-
return this
|
| 411 |
-
}
|
| 412 |
-
|
| 413 |
-
}
|
| 414 |
-
|
| 415 |
-
|
| 416 |
-
/* CAROUSEL PLUGIN DEFINITION
|
| 417 |
-
* ========================== */
|
| 418 |
-
|
| 419 |
-
var old = $.fn.carousel
|
| 420 |
-
|
| 421 |
-
$.fn.carousel = function (option) {
|
| 422 |
-
return this.each(function () {
|
| 423 |
-
var $this = $(this)
|
| 424 |
-
, data = $this.data('carousel')
|
| 425 |
-
, options = $.extend({}, $.fn.carousel.defaults, typeof option == 'object' && option)
|
| 426 |
-
, action = typeof option == 'string' ? option : options.slide
|
| 427 |
-
if (!data) $this.data('carousel', (data = new Carousel(this, options)))
|
| 428 |
-
if (typeof option == 'number') data.to(option)
|
| 429 |
-
else if (action) data[action]()
|
| 430 |
-
else if (options.interval) data.pause().cycle()
|
| 431 |
-
})
|
| 432 |
-
}
|
| 433 |
-
|
| 434 |
-
$.fn.carousel.defaults = {
|
| 435 |
-
interval: 5000
|
| 436 |
-
, pause: 'hover'
|
| 437 |
-
}
|
| 438 |
-
|
| 439 |
-
$.fn.carousel.Constructor = Carousel
|
| 440 |
-
|
| 441 |
-
|
| 442 |
-
/* CAROUSEL NO CONFLICT
|
| 443 |
-
* ==================== */
|
| 444 |
-
|
| 445 |
-
$.fn.carousel.noConflict = function () {
|
| 446 |
-
$.fn.carousel = old
|
| 447 |
-
return this
|
| 448 |
-
}
|
| 449 |
-
|
| 450 |
-
/* CAROUSEL DATA-API
|
| 451 |
-
* ================= */
|
| 452 |
-
|
| 453 |
-
$(document).on('click.carousel.data-api', '[data-slide], [data-slide-to]', function (e) {
|
| 454 |
-
var $this = $(this), href
|
| 455 |
-
, $target = $($this.attr('data-target') || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7
|
| 456 |
-
, options = $.extend({}, $target.data(), $this.data())
|
| 457 |
-
, slideIndex
|
| 458 |
-
|
| 459 |
-
$target.carousel(options)
|
| 460 |
-
|
| 461 |
-
if (slideIndex = $this.attr('data-slide-to')) {
|
| 462 |
-
$target.data('carousel').pause().to(slideIndex).cycle()
|
| 463 |
-
}
|
| 464 |
-
|
| 465 |
-
e.preventDefault()
|
| 466 |
-
})
|
| 467 |
-
|
| 468 |
-
}(window.jQuery);/* =============================================================
|
| 469 |
-
* bootstrap-collapse.js v2.3.1
|
| 470 |
-
* http://twitter.github.com/bootstrap/javascript.html#collapse
|
| 471 |
-
* =============================================================
|
| 472 |
-
* Copyright 2012 Twitter, Inc.
|
| 473 |
-
*
|
| 474 |
-
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 475 |
-
* you may not use this file except in compliance with the License.
|
| 476 |
-
* You may obtain a copy of the License at
|
| 477 |
-
*
|
| 478 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 479 |
-
*
|
| 480 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 481 |
-
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 482 |
-
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 483 |
-
* See the License for the specific language governing permissions and
|
| 484 |
-
* limitations under the License.
|
| 485 |
-
* ============================================================ */
|
| 486 |
-
|
| 487 |
-
|
| 488 |
-
!function ($) {
|
| 489 |
-
|
| 490 |
-
"use strict"; // jshint ;_;
|
| 491 |
-
|
| 492 |
-
|
| 493 |
-
/* COLLAPSE PUBLIC CLASS DEFINITION
|
| 494 |
-
* ================================ */
|
| 495 |
-
|
| 496 |
-
var Collapse = function (element, options) {
|
| 497 |
-
this.$element = $(element)
|
| 498 |
-
this.options = $.extend({}, $.fn.collapse.defaults, options)
|
| 499 |
-
|
| 500 |
-
if (this.options.parent) {
|
| 501 |
-
this.$parent = $(this.options.parent)
|
| 502 |
-
}
|
| 503 |
-
|
| 504 |
-
this.options.toggle && this.toggle()
|
| 505 |
-
}
|
| 506 |
-
|
| 507 |
-
Collapse.prototype = {
|
| 508 |
-
|
| 509 |
-
constructor: Collapse
|
| 510 |
-
|
| 511 |
-
, dimension: function () {
|
| 512 |
-
var hasWidth = this.$element.hasClass('width')
|
| 513 |
-
return hasWidth ? 'width' : 'height'
|
| 514 |
-
}
|
| 515 |
-
|
| 516 |
-
, show: function () {
|
| 517 |
-
var dimension
|
| 518 |
-
, scroll
|
| 519 |
-
, actives
|
| 520 |
-
, hasData
|
| 521 |
-
|
| 522 |
-
if (this.transitioning || this.$element.hasClass('in')) return
|
| 523 |
-
|
| 524 |
-
dimension = this.dimension()
|
| 525 |
-
scroll = $.camelCase(['scroll', dimension].join('-'))
|
| 526 |
-
actives = this.$parent && this.$parent.find('> .accordion-group > .in')
|
| 527 |
-
|
| 528 |
-
if (actives && actives.length) {
|
| 529 |
-
hasData = actives.data('collapse')
|
| 530 |
-
if (hasData && hasData.transitioning) return
|
| 531 |
-
actives.collapse('hide')
|
| 532 |
-
hasData || actives.data('collapse', null)
|
| 533 |
-
}
|
| 534 |
-
|
| 535 |
-
this.$element[dimension](0)
|
| 536 |
-
this.transition('addClass', $.Event('show'), 'shown')
|
| 537 |
-
$.support.transition && this.$element[dimension](this.$element[0][scroll])
|
| 538 |
-
}
|
| 539 |
-
|
| 540 |
-
, hide: function () {
|
| 541 |
-
var dimension
|
| 542 |
-
if (this.transitioning || !this.$element.hasClass('in')) return
|
| 543 |
-
dimension = this.dimension()
|
| 544 |
-
this.reset(this.$element[dimension]())
|
| 545 |
-
this.transition('removeClass', $.Event('hide'), 'hidden')
|
| 546 |
-
this.$element[dimension](0)
|
| 547 |
-
}
|
| 548 |
-
|
| 549 |
-
, reset: function (size) {
|
| 550 |
-
var dimension = this.dimension()
|
| 551 |
-
|
| 552 |
-
this.$element
|
| 553 |
-
.removeClass('collapse')
|
| 554 |
-
[dimension](size || 'auto')
|
| 555 |
-
[0].offsetWidth
|
| 556 |
-
|
| 557 |
-
this.$element[size !== null ? 'addClass' : 'removeClass']('collapse')
|
| 558 |
-
|
| 559 |
-
return this
|
| 560 |
-
}
|
| 561 |
-
|
| 562 |
-
, transition: function (method, startEvent, completeEvent) {
|
| 563 |
-
var that = this
|
| 564 |
-
, complete = function () {
|
| 565 |
-
if (startEvent.type == 'show') that.reset()
|
| 566 |
-
that.transitioning = 0
|
| 567 |
-
that.$element.trigger(completeEvent)
|
| 568 |
-
}
|
| 569 |
-
|
| 570 |
-
this.$element.trigger(startEvent)
|
| 571 |
-
|
| 572 |
-
if (startEvent.isDefaultPrevented()) return
|
| 573 |
-
|
| 574 |
-
this.transitioning = 1
|
| 575 |
-
|
| 576 |
-
this.$element[method]('in')
|
| 577 |
-
|
| 578 |
-
$.support.transition && this.$element.hasClass('collapse') ?
|
| 579 |
-
this.$element.one($.support.transition.end, complete) :
|
| 580 |
-
complete()
|
| 581 |
-
}
|
| 582 |
-
|
| 583 |
-
, toggle: function () {
|
| 584 |
-
this[this.$element.hasClass('in') ? 'hide' : 'show']()
|
| 585 |
-
}
|
| 586 |
-
|
| 587 |
-
}
|
| 588 |
-
|
| 589 |
-
|
| 590 |
-
/* COLLAPSE PLUGIN DEFINITION
|
| 591 |
-
* ========================== */
|
| 592 |
-
|
| 593 |
-
var old = $.fn.collapse
|
| 594 |
-
|
| 595 |
-
$.fn.collapse = function (option) {
|
| 596 |
-
return this.each(function () {
|
| 597 |
-
var $this = $(this)
|
| 598 |
-
, data = $this.data('collapse')
|
| 599 |
-
, options = $.extend({}, $.fn.collapse.defaults, $this.data(), typeof option == 'object' && option)
|
| 600 |
-
if (!data) $this.data('collapse', (data = new Collapse(this, options)))
|
| 601 |
-
if (typeof option == 'string') data[option]()
|
| 602 |
-
})
|
| 603 |
-
}
|
| 604 |
-
|
| 605 |
-
$.fn.collapse.defaults = {
|
| 606 |
-
toggle: true
|
| 607 |
-
}
|
| 608 |
-
|
| 609 |
-
$.fn.collapse.Constructor = Collapse
|
| 610 |
-
|
| 611 |
-
|
| 612 |
-
/* COLLAPSE NO CONFLICT
|
| 613 |
-
* ==================== */
|
| 614 |
-
|
| 615 |
-
$.fn.collapse.noConflict = function () {
|
| 616 |
-
$.fn.collapse = old
|
| 617 |
-
return this
|
| 618 |
-
}
|
| 619 |
-
|
| 620 |
-
|
| 621 |
-
/* COLLAPSE DATA-API
|
| 622 |
-
* ================= */
|
| 623 |
-
|
| 624 |
-
$(document).on('click.collapse.data-api', '[data-toggle=collapse]', function (e) {
|
| 625 |
-
var $this = $(this), href
|
| 626 |
-
, target = $this.attr('data-target')
|
| 627 |
-
|| e.preventDefault()
|
| 628 |
-
|| (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '') //strip for ie7
|
| 629 |
-
, option = $(target).data('collapse') ? 'toggle' : $this.data()
|
| 630 |
-
$this[$(target).hasClass('in') ? 'addClass' : 'removeClass']('collapsed')
|
| 631 |
-
$(target).collapse(option)
|
| 632 |
-
})
|
| 633 |
-
|
| 634 |
-
}(window.jQuery);/* ============================================================
|
| 635 |
-
* bootstrap-dropdown.js v2.3.1
|
| 636 |
-
* http://twitter.github.com/bootstrap/javascript.html#dropdowns
|
| 637 |
-
* ============================================================
|
| 638 |
-
* Copyright 2012 Twitter, Inc.
|
| 639 |
-
*
|
| 640 |
-
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 641 |
-
* you may not use this file except in compliance with the License.
|
| 642 |
-
* You may obtain a copy of the License at
|
| 643 |
-
*
|
| 644 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 645 |
-
*
|
| 646 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 647 |
-
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 648 |
-
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 649 |
-
* See the License for the specific language governing permissions and
|
| 650 |
-
* limitations under the License.
|
| 651 |
-
* ============================================================ */
|
| 652 |
-
|
| 653 |
-
|
| 654 |
-
!function ($) {
|
| 655 |
-
|
| 656 |
-
"use strict"; // jshint ;_;
|
| 657 |
-
|
| 658 |
-
|
| 659 |
-
/* DROPDOWN CLASS DEFINITION
|
| 660 |
-
* ========================= */
|
| 661 |
-
|
| 662 |
-
var toggle = '[data-toggle=dropdown]'
|
| 663 |
-
, Dropdown = function (element) {
|
| 664 |
-
var $el = $(element).on('click.dropdown.data-api', this.toggle)
|
| 665 |
-
$('html').on('click.dropdown.data-api', function () {
|
| 666 |
-
$el.parent().removeClass('open')
|
| 667 |
-
})
|
| 668 |
-
}
|
| 669 |
-
|
| 670 |
-
Dropdown.prototype = {
|
| 671 |
-
|
| 672 |
-
constructor: Dropdown
|
| 673 |
-
|
| 674 |
-
, toggle: function (e) {
|
| 675 |
-
var $this = $(this)
|
| 676 |
-
, $parent
|
| 677 |
-
, isActive
|
| 678 |
-
|
| 679 |
-
if ($this.is('.disabled, :disabled')) return
|
| 680 |
-
|
| 681 |
-
$parent = getParent($this)
|
| 682 |
-
|
| 683 |
-
isActive = $parent.hasClass('open')
|
| 684 |
-
|
| 685 |
-
clearMenus()
|
| 686 |
-
|
| 687 |
-
if (!isActive) {
|
| 688 |
-
$parent.toggleClass('open')
|
| 689 |
-
}
|
| 690 |
-
|
| 691 |
-
$this.focus()
|
| 692 |
-
|
| 693 |
-
return false
|
| 694 |
-
}
|
| 695 |
-
|
| 696 |
-
, keydown: function (e) {
|
| 697 |
-
var $this
|
| 698 |
-
, $items
|
| 699 |
-
, $active
|
| 700 |
-
, $parent
|
| 701 |
-
, isActive
|
| 702 |
-
, index
|
| 703 |
-
|
| 704 |
-
if (!/(38|40|27)/.test(e.keyCode)) return
|
| 705 |
-
|
| 706 |
-
$this = $(this)
|
| 707 |
-
|
| 708 |
-
e.preventDefault()
|
| 709 |
-
e.stopPropagation()
|
| 710 |
-
|
| 711 |
-
if ($this.is('.disabled, :disabled')) return
|
| 712 |
-
|
| 713 |
-
$parent = getParent($this)
|
| 714 |
-
|
| 715 |
-
isActive = $parent.hasClass('open')
|
| 716 |
-
|
| 717 |
-
if (!isActive || (isActive && e.keyCode == 27)) {
|
| 718 |
-
if (e.which == 27) $parent.find(toggle).focus()
|
| 719 |
-
return $this.click()
|
| 720 |
-
}
|
| 721 |
-
|
| 722 |
-
$items = $('[role=menu] li:not(.divider):visible a', $parent)
|
| 723 |
-
|
| 724 |
-
if (!$items.length) return
|
| 725 |
-
|
| 726 |
-
index = $items.index($items.filter(':focus'))
|
| 727 |
-
|
| 728 |
-
if (e.keyCode == 38 && index > 0) index-- // up
|
| 729 |
-
if (e.keyCode == 40 && index < $items.length - 1) index++ // down
|
| 730 |
-
if (!~index) index = 0
|
| 731 |
-
|
| 732 |
-
$items
|
| 733 |
-
.eq(index)
|
| 734 |
-
.focus()
|
| 735 |
-
}
|
| 736 |
-
|
| 737 |
-
}
|
| 738 |
-
|
| 739 |
-
function clearMenus() {
|
| 740 |
-
$(toggle).each(function () {
|
| 741 |
-
getParent($(this)).removeClass('open')
|
| 742 |
-
})
|
| 743 |
-
}
|
| 744 |
-
|
| 745 |
-
function getParent($this) {
|
| 746 |
-
var selector = $this.attr('data-target')
|
| 747 |
-
, $parent
|
| 748 |
-
|
| 749 |
-
if (!selector) {
|
| 750 |
-
selector = $this.attr('href')
|
| 751 |
-
selector = selector && /#/.test(selector) && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7
|
| 752 |
-
}
|
| 753 |
-
|
| 754 |
-
$parent = selector && $(selector)
|
| 755 |
-
|
| 756 |
-
if (!$parent || !$parent.length) $parent = $this.parent()
|
| 757 |
-
|
| 758 |
-
return $parent
|
| 759 |
-
}
|
| 760 |
-
|
| 761 |
-
|
| 762 |
-
/* DROPDOWN PLUGIN DEFINITION
|
| 763 |
-
* ========================== */
|
| 764 |
-
|
| 765 |
-
var old = $.fn.dropdown
|
| 766 |
-
|
| 767 |
-
$.fn.dropdown = function (option) {
|
| 768 |
-
return this.each(function () {
|
| 769 |
-
var $this = $(this)
|
| 770 |
-
, data = $this.data('dropdown')
|
| 771 |
-
if (!data) $this.data('dropdown', (data = new Dropdown(this)))
|
| 772 |
-
if (typeof option == 'string') data[option].call($this)
|
| 773 |
-
})
|
| 774 |
-
}
|
| 775 |
-
|
| 776 |
-
$.fn.dropdown.Constructor = Dropdown
|
| 777 |
-
|
| 778 |
-
|
| 779 |
-
/* DROPDOWN NO CONFLICT
|
| 780 |
-
* ==================== */
|
| 781 |
-
|
| 782 |
-
$.fn.dropdown.noConflict = function () {
|
| 783 |
-
$.fn.dropdown = old
|
| 784 |
-
return this
|
| 785 |
-
}
|
| 786 |
-
|
| 787 |
-
|
| 788 |
-
/* APPLY TO STANDARD DROPDOWN ELEMENTS
|
| 789 |
-
* =================================== */
|
| 790 |
-
|
| 791 |
-
$(document)
|
| 792 |
-
.on('click.dropdown.data-api', clearMenus)
|
| 793 |
-
.on('click.dropdown.data-api', '.dropdown form', function (e) { e.stopPropagation() })
|
| 794 |
-
.on('click.dropdown-menu', function (e) { e.stopPropagation() })
|
| 795 |
-
.on('click.dropdown.data-api' , toggle, Dropdown.prototype.toggle)
|
| 796 |
-
.on('keydown.dropdown.data-api', toggle + ', [role=menu]' , Dropdown.prototype.keydown)
|
| 797 |
-
|
| 798 |
-
}(window.jQuery);
|
| 799 |
-
/* =========================================================
|
| 800 |
-
* bootstrap-modal.js v2.3.1
|
| 801 |
-
* http://twitter.github.com/bootstrap/javascript.html#modals
|
| 802 |
-
* =========================================================
|
| 803 |
-
* Copyright 2012 Twitter, Inc.
|
| 804 |
-
*
|
| 805 |
-
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 806 |
-
* you may not use this file except in compliance with the License.
|
| 807 |
-
* You may obtain a copy of the License at
|
| 808 |
-
*
|
| 809 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 810 |
-
*
|
| 811 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 812 |
-
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 813 |
-
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 814 |
-
* See the License for the specific language governing permissions and
|
| 815 |
-
* limitations under the License.
|
| 816 |
-
* ========================================================= */
|
| 817 |
-
|
| 818 |
-
|
| 819 |
-
!function ($) {
|
| 820 |
-
|
| 821 |
-
"use strict"; // jshint ;_;
|
| 822 |
-
|
| 823 |
-
|
| 824 |
-
/* MODAL CLASS DEFINITION
|
| 825 |
-
* ====================== */
|
| 826 |
-
|
| 827 |
-
var Modal = function (element, options) {
|
| 828 |
-
this.options = options
|
| 829 |
-
this.$element = $(element)
|
| 830 |
-
.delegate('[data-dismiss="modal"]', 'click.dismiss.modal', $.proxy(this.hide, this))
|
| 831 |
-
this.options.remote && this.$element.find('.modal-body').load(this.options.remote)
|
| 832 |
-
}
|
| 833 |
-
|
| 834 |
-
Modal.prototype = {
|
| 835 |
-
|
| 836 |
-
constructor: Modal
|
| 837 |
-
|
| 838 |
-
, toggle: function () {
|
| 839 |
-
return this[!this.isShown ? 'show' : 'hide']()
|
| 840 |
-
}
|
| 841 |
-
|
| 842 |
-
, show: function () {
|
| 843 |
-
var that = this
|
| 844 |
-
, e = $.Event('show')
|
| 845 |
-
|
| 846 |
-
this.$element.trigger(e)
|
| 847 |
-
|
| 848 |
-
if (this.isShown || e.isDefaultPrevented()) return
|
| 849 |
-
|
| 850 |
-
this.isShown = true
|
| 851 |
-
|
| 852 |
-
this.escape()
|
| 853 |
-
|
| 854 |
-
this.backdrop(function () {
|
| 855 |
-
var transition = $.support.transition && that.$element.hasClass('fade')
|
| 856 |
-
|
| 857 |
-
if (!that.$element.parent().length) {
|
| 858 |
-
that.$element.appendTo(document.body) //don't move modals dom position
|
| 859 |
-
}
|
| 860 |
-
|
| 861 |
-
that.$element.show()
|
| 862 |
-
|
| 863 |
-
if (transition) {
|
| 864 |
-
that.$element[0].offsetWidth // force reflow
|
| 865 |
-
}
|
| 866 |
-
|
| 867 |
-
that.$element
|
| 868 |
-
.addClass('in')
|
| 869 |
-
.attr('aria-hidden', false)
|
| 870 |
-
|
| 871 |
-
that.enforceFocus()
|
| 872 |
-
|
| 873 |
-
transition ?
|
| 874 |
-
that.$element.one($.support.transition.end, function () { that.$element.focus().trigger('shown') }) :
|
| 875 |
-
that.$element.focus().trigger('shown')
|
| 876 |
-
|
| 877 |
-
})
|
| 878 |
-
}
|
| 879 |
-
|
| 880 |
-
, hide: function (e) {
|
| 881 |
-
e && e.preventDefault()
|
| 882 |
-
|
| 883 |
-
var that = this
|
| 884 |
-
|
| 885 |
-
e = $.Event('hide')
|
| 886 |
-
|
| 887 |
-
this.$element.trigger(e)
|
| 888 |
-
|
| 889 |
-
if (!this.isShown || e.isDefaultPrevented()) return
|
| 890 |
-
|
| 891 |
-
this.isShown = false
|
| 892 |
-
|
| 893 |
-
this.escape()
|
| 894 |
-
|
| 895 |
-
$(document).off('focusin.modal')
|
| 896 |
-
|
| 897 |
-
this.$element
|
| 898 |
-
.removeClass('in')
|
| 899 |
-
.attr('aria-hidden', true)
|
| 900 |
-
|
| 901 |
-
$.support.transition && this.$element.hasClass('fade') ?
|
| 902 |
-
this.hideWithTransition() :
|
| 903 |
-
this.hideModal()
|
| 904 |
-
}
|
| 905 |
-
|
| 906 |
-
, enforceFocus: function () {
|
| 907 |
-
var that = this
|
| 908 |
-
$(document).on('focusin.modal', function (e) {
|
| 909 |
-
if (that.$element[0] !== e.target && !that.$element.has(e.target).length) {
|
| 910 |
-
that.$element.focus()
|
| 911 |
-
}
|
| 912 |
-
})
|
| 913 |
-
}
|
| 914 |
-
|
| 915 |
-
, escape: function () {
|
| 916 |
-
var that = this
|
| 917 |
-
if (this.isShown && this.options.keyboard) {
|
| 918 |
-
this.$element.on('keyup.dismiss.modal', function ( e ) {
|
| 919 |
-
e.which == 27 && that.hide()
|
| 920 |
-
})
|
| 921 |
-
} else if (!this.isShown) {
|
| 922 |
-
this.$element.off('keyup.dismiss.modal')
|
| 923 |
-
}
|
| 924 |
-
}
|
| 925 |
-
|
| 926 |
-
, hideWithTransition: function () {
|
| 927 |
-
var that = this
|
| 928 |
-
, timeout = setTimeout(function () {
|
| 929 |
-
that.$element.off($.support.transition.end)
|
| 930 |
-
that.hideModal()
|
| 931 |
-
}, 500)
|
| 932 |
-
|
| 933 |
-
this.$element.one($.support.transition.end, function () {
|
| 934 |
-
clearTimeout(timeout)
|
| 935 |
-
that.hideModal()
|
| 936 |
-
})
|
| 937 |
-
}
|
| 938 |
-
|
| 939 |
-
, hideModal: function () {
|
| 940 |
-
var that = this
|
| 941 |
-
this.$element.hide()
|
| 942 |
-
this.backdrop(function () {
|
| 943 |
-
that.removeBackdrop()
|
| 944 |
-
that.$element.trigger('hidden')
|
| 945 |
-
})
|
| 946 |
-
}
|
| 947 |
-
|
| 948 |
-
, removeBackdrop: function () {
|
| 949 |
-
this.$backdrop && this.$backdrop.remove()
|
| 950 |
-
this.$backdrop = null
|
| 951 |
-
}
|
| 952 |
-
|
| 953 |
-
, backdrop: function (callback) {
|
| 954 |
-
var that = this
|
| 955 |
-
, animate = this.$element.hasClass('fade') ? 'fade' : ''
|
| 956 |
-
|
| 957 |
-
if (this.isShown && this.options.backdrop) {
|
| 958 |
-
var doAnimate = $.support.transition && animate
|
| 959 |
-
|
| 960 |
-
this.$backdrop = $('<div class="modal-backdrop ' + animate + '" />')
|
| 961 |
-
.appendTo(document.body)
|
| 962 |
-
|
| 963 |
-
this.$backdrop.click(
|
| 964 |
-
this.options.backdrop == 'static' ?
|
| 965 |
-
$.proxy(this.$element[0].focus, this.$element[0])
|
| 966 |
-
: $.proxy(this.hide, this)
|
| 967 |
-
)
|
| 968 |
-
|
| 969 |
-
if (doAnimate) this.$backdrop[0].offsetWidth // force reflow
|
| 970 |
-
|
| 971 |
-
this.$backdrop.addClass('in')
|
| 972 |
-
|
| 973 |
-
if (!callback) return
|
| 974 |
-
|
| 975 |
-
doAnimate ?
|
| 976 |
-
this.$backdrop.one($.support.transition.end, callback) :
|
| 977 |
-
callback()
|
| 978 |
-
|
| 979 |
-
} else if (!this.isShown && this.$backdrop) {
|
| 980 |
-
this.$backdrop.removeClass('in')
|
| 981 |
-
|
| 982 |
-
$.support.transition && this.$element.hasClass('fade')?
|
| 983 |
-
this.$backdrop.one($.support.transition.end, callback) :
|
| 984 |
-
callback()
|
| 985 |
-
|
| 986 |
-
} else if (callback) {
|
| 987 |
-
callback()
|
| 988 |
-
}
|
| 989 |
-
}
|
| 990 |
-
}
|
| 991 |
-
|
| 992 |
-
|
| 993 |
-
/* MODAL PLUGIN DEFINITION
|
| 994 |
-
* ======================= */
|
| 995 |
-
|
| 996 |
-
var old = $.fn.modal
|
| 997 |
-
|
| 998 |
-
$.fn.modal = function (option) {
|
| 999 |
-
return this.each(function () {
|
| 1000 |
-
var $this = $(this)
|
| 1001 |
-
, data = $this.data('modal')
|
| 1002 |
-
, options = $.extend({}, $.fn.modal.defaults, $this.data(), typeof option == 'object' && option)
|
| 1003 |
-
if (!data) $this.data('modal', (data = new Modal(this, options)))
|
| 1004 |
-
if (typeof option == 'string') data[option]()
|
| 1005 |
-
else if (options.show) data.show()
|
| 1006 |
-
})
|
| 1007 |
-
}
|
| 1008 |
-
|
| 1009 |
-
$.fn.modal.defaults = {
|
| 1010 |
-
backdrop: true
|
| 1011 |
-
, keyboard: true
|
| 1012 |
-
, show: true
|
| 1013 |
-
}
|
| 1014 |
-
|
| 1015 |
-
$.fn.modal.Constructor = Modal
|
| 1016 |
-
|
| 1017 |
-
|
| 1018 |
-
/* MODAL NO CONFLICT
|
| 1019 |
-
* ================= */
|
| 1020 |
-
|
| 1021 |
-
$.fn.modal.noConflict = function () {
|
| 1022 |
-
$.fn.modal = old
|
| 1023 |
-
return this
|
| 1024 |
-
}
|
| 1025 |
-
|
| 1026 |
-
|
| 1027 |
-
/* MODAL DATA-API
|
| 1028 |
-
* ============== */
|
| 1029 |
-
|
| 1030 |
-
$(document).on('click.modal.data-api', '[data-toggle="modal"]', function (e) {
|
| 1031 |
-
var $this = $(this)
|
| 1032 |
-
, href = $this.attr('href')
|
| 1033 |
-
, $target = $($this.attr('data-target') || (href && href.replace(/.*(?=#[^\s]+$)/, ''))) //strip for ie7
|
| 1034 |
-
, option = $target.data('modal') ? 'toggle' : $.extend({ remote:!/#/.test(href) && href }, $target.data(), $this.data())
|
| 1035 |
-
|
| 1036 |
-
e.preventDefault()
|
| 1037 |
-
|
| 1038 |
-
$target
|
| 1039 |
-
.modal(option)
|
| 1040 |
-
.one('hide', function () {
|
| 1041 |
-
$this.focus()
|
| 1042 |
-
})
|
| 1043 |
-
})
|
| 1044 |
-
|
| 1045 |
-
}(window.jQuery);
|
| 1046 |
-
/* ===========================================================
|
| 1047 |
-
* bootstrap-tooltip.js v2.3.1
|
| 1048 |
-
* http://twitter.github.com/bootstrap/javascript.html#tooltips
|
| 1049 |
-
* Inspired by the original jQuery.tipsy by Jason Frame
|
| 1050 |
-
* ===========================================================
|
| 1051 |
-
* Copyright 2012 Twitter, Inc.
|
| 1052 |
-
*
|
| 1053 |
-
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 1054 |
-
* you may not use this file except in compliance with the License.
|
| 1055 |
-
* You may obtain a copy of the License at
|
| 1056 |
-
*
|
| 1057 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 1058 |
-
*
|
| 1059 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 1060 |
-
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 1061 |
-
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 1062 |
-
* See the License for the specific language governing permissions and
|
| 1063 |
-
* limitations under the License.
|
| 1064 |
-
* ========================================================== */
|
| 1065 |
-
|
| 1066 |
-
|
| 1067 |
-
!function ($) {
|
| 1068 |
-
|
| 1069 |
-
"use strict"; // jshint ;_;
|
| 1070 |
-
|
| 1071 |
-
|
| 1072 |
-
/* TOOLTIP PUBLIC CLASS DEFINITION
|
| 1073 |
-
* =============================== */
|
| 1074 |
-
|
| 1075 |
-
var Tooltip = function (element, options) {
|
| 1076 |
-
this.init('tooltip', element, options)
|
| 1077 |
-
}
|
| 1078 |
-
|
| 1079 |
-
Tooltip.prototype = {
|
| 1080 |
-
|
| 1081 |
-
constructor: Tooltip
|
| 1082 |
-
|
| 1083 |
-
, init: function (type, element, options) {
|
| 1084 |
-
var eventIn
|
| 1085 |
-
, eventOut
|
| 1086 |
-
, triggers
|
| 1087 |
-
, trigger
|
| 1088 |
-
, i
|
| 1089 |
-
|
| 1090 |
-
this.type = type
|
| 1091 |
-
this.$element = $(element)
|
| 1092 |
-
this.options = this.getOptions(options)
|
| 1093 |
-
this.enabled = true
|
| 1094 |
-
|
| 1095 |
-
triggers = this.options.trigger.split(' ')
|
| 1096 |
-
|
| 1097 |
-
for (i = triggers.length; i--;) {
|
| 1098 |
-
trigger = triggers[i]
|
| 1099 |
-
if (trigger == 'click') {
|
| 1100 |
-
this.$element.on('click.' + this.type, this.options.selector, $.proxy(this.toggle, this))
|
| 1101 |
-
} else if (trigger != 'manual') {
|
| 1102 |
-
eventIn = trigger == 'hover' ? 'mouseenter' : 'focus'
|
| 1103 |
-
eventOut = trigger == 'hover' ? 'mouseleave' : 'blur'
|
| 1104 |
-
this.$element.on(eventIn + '.' + this.type, this.options.selector, $.proxy(this.enter, this))
|
| 1105 |
-
this.$element.on(eventOut + '.' + this.type, this.options.selector, $.proxy(this.leave, this))
|
| 1106 |
-
}
|
| 1107 |
-
}
|
| 1108 |
-
|
| 1109 |
-
this.options.selector ?
|
| 1110 |
-
(this._options = $.extend({}, this.options, { trigger: 'manual', selector: '' })) :
|
| 1111 |
-
this.fixTitle()
|
| 1112 |
-
}
|
| 1113 |
-
|
| 1114 |
-
, getOptions: function (options) {
|
| 1115 |
-
options = $.extend({}, $.fn[this.type].defaults, this.$element.data(), options)
|
| 1116 |
-
|
| 1117 |
-
if (options.delay && typeof options.delay == 'number') {
|
| 1118 |
-
options.delay = {
|
| 1119 |
-
show: options.delay
|
| 1120 |
-
, hide: options.delay
|
| 1121 |
-
}
|
| 1122 |
-
}
|
| 1123 |
-
|
| 1124 |
-
return options
|
| 1125 |
-
}
|
| 1126 |
-
|
| 1127 |
-
, enter: function (e) {
|
| 1128 |
-
var defaults = $.fn[this.type].defaults
|
| 1129 |
-
, options = {}
|
| 1130 |
-
, self
|
| 1131 |
-
|
| 1132 |
-
this._options && $.each(this._options, function (key, value) {
|
| 1133 |
-
if (defaults[key] != value) options[key] = value
|
| 1134 |
-
}, this)
|
| 1135 |
-
|
| 1136 |
-
self = $(e.currentTarget)[this.type](options).data(this.type)
|
| 1137 |
-
|
| 1138 |
-
if (!self.options.delay || !self.options.delay.show) return self.show()
|
| 1139 |
-
|
| 1140 |
-
clearTimeout(this.timeout)
|
| 1141 |
-
self.hoverState = 'in'
|
| 1142 |
-
this.timeout = setTimeout(function() {
|
| 1143 |
-
if (self.hoverState == 'in') self.show()
|
| 1144 |
-
}, self.options.delay.show)
|
| 1145 |
-
}
|
| 1146 |
-
|
| 1147 |
-
, leave: function (e) {
|
| 1148 |
-
var self = $(e.currentTarget)[this.type](this._options).data(this.type)
|
| 1149 |
-
|
| 1150 |
-
if (this.timeout) clearTimeout(this.timeout)
|
| 1151 |
-
if (!self.options.delay || !self.options.delay.hide) return self.hide()
|
| 1152 |
-
|
| 1153 |
-
self.hoverState = 'out'
|
| 1154 |
-
this.timeout = setTimeout(function() {
|
| 1155 |
-
if (self.hoverState == 'out') self.hide()
|
| 1156 |
-
}, self.options.delay.hide)
|
| 1157 |
-
}
|
| 1158 |
-
|
| 1159 |
-
, show: function () {
|
| 1160 |
-
var $tip
|
| 1161 |
-
, pos
|
| 1162 |
-
, actualWidth
|
| 1163 |
-
, actualHeight
|
| 1164 |
-
, placement
|
| 1165 |
-
, tp
|
| 1166 |
-
, e = $.Event('show')
|
| 1167 |
-
|
| 1168 |
-
if (this.hasContent() && this.enabled) {
|
| 1169 |
-
this.$element.trigger(e)
|
| 1170 |
-
if (e.isDefaultPrevented()) return
|
| 1171 |
-
$tip = this.tip()
|
| 1172 |
-
this.setContent()
|
| 1173 |
-
|
| 1174 |
-
if (this.options.animation) {
|
| 1175 |
-
$tip.addClass('fade')
|
| 1176 |
-
}
|
| 1177 |
-
|
| 1178 |
-
placement = typeof this.options.placement == 'function' ?
|
| 1179 |
-
this.options.placement.call(this, $tip[0], this.$element[0]) :
|
| 1180 |
-
this.options.placement
|
| 1181 |
-
|
| 1182 |
-
$tip
|
| 1183 |
-
.detach()
|
| 1184 |
-
.css({ top: 0, left: 0, display: 'block' })
|
| 1185 |
-
|
| 1186 |
-
this.options.container ? $tip.appendTo(this.options.container) : $tip.insertAfter(this.$element)
|
| 1187 |
-
|
| 1188 |
-
pos = this.getPosition()
|
| 1189 |
-
|
| 1190 |
-
actualWidth = $tip[0].offsetWidth
|
| 1191 |
-
actualHeight = $tip[0].offsetHeight
|
| 1192 |
-
|
| 1193 |
-
switch (placement) {
|
| 1194 |
-
case 'bottom':
|
| 1195 |
-
tp = {top: pos.top + pos.height, left: pos.left + pos.width / 2 - actualWidth / 2}
|
| 1196 |
-
break
|
| 1197 |
-
case 'top':
|
| 1198 |
-
tp = {top: pos.top - actualHeight, left: pos.left + pos.width / 2 - actualWidth / 2}
|
| 1199 |
-
break
|
| 1200 |
-
case 'left':
|
| 1201 |
-
tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left - actualWidth}
|
| 1202 |
-
break
|
| 1203 |
-
case 'right':
|
| 1204 |
-
tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left + pos.width}
|
| 1205 |
-
break
|
| 1206 |
-
}
|
| 1207 |
-
|
| 1208 |
-
this.applyPlacement(tp, placement)
|
| 1209 |
-
this.$element.trigger('shown')
|
| 1210 |
-
}
|
| 1211 |
-
}
|
| 1212 |
-
|
| 1213 |
-
, applyPlacement: function(offset, placement){
|
| 1214 |
-
var $tip = this.tip()
|
| 1215 |
-
, width = $tip[0].offsetWidth
|
| 1216 |
-
, height = $tip[0].offsetHeight
|
| 1217 |
-
, actualWidth
|
| 1218 |
-
, actualHeight
|
| 1219 |
-
, delta
|
| 1220 |
-
, replace
|
| 1221 |
-
|
| 1222 |
-
$tip
|
| 1223 |
-
.offset(offset)
|
| 1224 |
-
.addClass(placement)
|
| 1225 |
-
.addClass('in')
|
| 1226 |
-
|
| 1227 |
-
actualWidth = $tip[0].offsetWidth
|
| 1228 |
-
actualHeight = $tip[0].offsetHeight
|
| 1229 |
-
|
| 1230 |
-
if (placement == 'top' && actualHeight != height) {
|
| 1231 |
-
offset.top = offset.top + height - actualHeight
|
| 1232 |
-
replace = true
|
| 1233 |
-
}
|
| 1234 |
-
|
| 1235 |
-
if (placement == 'bottom' || placement == 'top') {
|
| 1236 |
-
delta = 0
|
| 1237 |
-
|
| 1238 |
-
if (offset.left < 0){
|
| 1239 |
-
delta = offset.left * -2
|
| 1240 |
-
offset.left = 0
|
| 1241 |
-
$tip.offset(offset)
|
| 1242 |
-
actualWidth = $tip[0].offsetWidth
|
| 1243 |
-
actualHeight = $tip[0].offsetHeight
|
| 1244 |
-
}
|
| 1245 |
-
|
| 1246 |
-
this.replaceArrow(delta - width + actualWidth, actualWidth, 'left')
|
| 1247 |
-
} else {
|
| 1248 |
-
this.replaceArrow(actualHeight - height, actualHeight, 'top')
|
| 1249 |
-
}
|
| 1250 |
-
|
| 1251 |
-
if (replace) $tip.offset(offset)
|
| 1252 |
-
}
|
| 1253 |
-
|
| 1254 |
-
, replaceArrow: function(delta, dimension, position){
|
| 1255 |
-
this
|
| 1256 |
-
.arrow()
|
| 1257 |
-
.css(position, delta ? (50 * (1 - delta / dimension) + "%") : '')
|
| 1258 |
-
}
|
| 1259 |
-
|
| 1260 |
-
, setContent: function () {
|
| 1261 |
-
var $tip = this.tip()
|
| 1262 |
-
, title = this.getTitle()
|
| 1263 |
-
|
| 1264 |
-
$tip.find('.tooltip-inner')[this.options.html ? 'html' : 'text'](title)
|
| 1265 |
-
$tip.removeClass('fade in top bottom left right')
|
| 1266 |
-
}
|
| 1267 |
-
|
| 1268 |
-
, hide: function () {
|
| 1269 |
-
var that = this
|
| 1270 |
-
, $tip = this.tip()
|
| 1271 |
-
, e = $.Event('hide')
|
| 1272 |
-
|
| 1273 |
-
this.$element.trigger(e)
|
| 1274 |
-
if (e.isDefaultPrevented()) return
|
| 1275 |
-
|
| 1276 |
-
$tip.removeClass('in')
|
| 1277 |
-
|
| 1278 |
-
function removeWithAnimation() {
|
| 1279 |
-
var timeout = setTimeout(function () {
|
| 1280 |
-
$tip.off($.support.transition.end).detach()
|
| 1281 |
-
}, 500)
|
| 1282 |
-
|
| 1283 |
-
$tip.one($.support.transition.end, function () {
|
| 1284 |
-
clearTimeout(timeout)
|
| 1285 |
-
$tip.detach()
|
| 1286 |
-
})
|
| 1287 |
-
}
|
| 1288 |
-
|
| 1289 |
-
$.support.transition && this.$tip.hasClass('fade') ?
|
| 1290 |
-
removeWithAnimation() :
|
| 1291 |
-
$tip.detach()
|
| 1292 |
-
|
| 1293 |
-
this.$element.trigger('hidden')
|
| 1294 |
-
|
| 1295 |
-
return this
|
| 1296 |
-
}
|
| 1297 |
-
|
| 1298 |
-
, fixTitle: function () {
|
| 1299 |
-
var $e = this.$element
|
| 1300 |
-
if ($e.attr('title') || typeof($e.attr('data-original-title')) != 'string') {
|
| 1301 |
-
$e.attr('data-original-title', $e.attr('title') || '').attr('title', '')
|
| 1302 |
-
}
|
| 1303 |
-
}
|
| 1304 |
-
|
| 1305 |
-
, hasContent: function () {
|
| 1306 |
-
return this.getTitle()
|
| 1307 |
-
}
|
| 1308 |
-
|
| 1309 |
-
, getPosition: function () {
|
| 1310 |
-
var el = this.$element[0]
|
| 1311 |
-
return $.extend({}, (typeof el.getBoundingClientRect == 'function') ? el.getBoundingClientRect() : {
|
| 1312 |
-
width: el.offsetWidth
|
| 1313 |
-
, height: el.offsetHeight
|
| 1314 |
-
}, this.$element.offset())
|
| 1315 |
-
}
|
| 1316 |
-
|
| 1317 |
-
, getTitle: function () {
|
| 1318 |
-
var title
|
| 1319 |
-
, $e = this.$element
|
| 1320 |
-
, o = this.options
|
| 1321 |
-
|
| 1322 |
-
title = $e.attr('data-original-title')
|
| 1323 |
-
|| (typeof o.title == 'function' ? o.title.call($e[0]) : o.title)
|
| 1324 |
-
|
| 1325 |
-
return title
|
| 1326 |
-
}
|
| 1327 |
-
|
| 1328 |
-
, tip: function () {
|
| 1329 |
-
return this.$tip = this.$tip || $(this.options.template)
|
| 1330 |
-
}
|
| 1331 |
-
|
| 1332 |
-
, arrow: function(){
|
| 1333 |
-
return this.$arrow = this.$arrow || this.tip().find(".tooltip-arrow")
|
| 1334 |
-
}
|
| 1335 |
-
|
| 1336 |
-
, validate: function () {
|
| 1337 |
-
if (!this.$element[0].parentNode) {
|
| 1338 |
-
this.hide()
|
| 1339 |
-
this.$element = null
|
| 1340 |
-
this.options = null
|
| 1341 |
-
}
|
| 1342 |
-
}
|
| 1343 |
-
|
| 1344 |
-
, enable: function () {
|
| 1345 |
-
this.enabled = true
|
| 1346 |
-
}
|
| 1347 |
-
|
| 1348 |
-
, disable: function () {
|
| 1349 |
-
this.enabled = false
|
| 1350 |
-
}
|
| 1351 |
-
|
| 1352 |
-
, toggleEnabled: function () {
|
| 1353 |
-
this.enabled = !this.enabled
|
| 1354 |
-
}
|
| 1355 |
-
|
| 1356 |
-
, toggle: function (e) {
|
| 1357 |
-
var self = e ? $(e.currentTarget)[this.type](this._options).data(this.type) : this
|
| 1358 |
-
self.tip().hasClass('in') ? self.hide() : self.show()
|
| 1359 |
-
}
|
| 1360 |
-
|
| 1361 |
-
, destroy: function () {
|
| 1362 |
-
this.hide().$element.off('.' + this.type).removeData(this.type)
|
| 1363 |
-
}
|
| 1364 |
-
|
| 1365 |
-
}
|
| 1366 |
-
|
| 1367 |
-
|
| 1368 |
-
/* TOOLTIP PLUGIN DEFINITION
|
| 1369 |
-
* ========================= */
|
| 1370 |
-
|
| 1371 |
-
var old = $.fn.tooltip
|
| 1372 |
-
|
| 1373 |
-
$.fn.tooltip = function ( option ) {
|
| 1374 |
-
return this.each(function () {
|
| 1375 |
-
var $this = $(this)
|
| 1376 |
-
, data = $this.data('tooltip')
|
| 1377 |
-
, options = typeof option == 'object' && option
|
| 1378 |
-
if (!data) $this.data('tooltip', (data = new Tooltip(this, options)))
|
| 1379 |
-
if (typeof option == 'string') data[option]()
|
| 1380 |
-
})
|
| 1381 |
-
}
|
| 1382 |
-
|
| 1383 |
-
$.fn.tooltip.Constructor = Tooltip
|
| 1384 |
-
|
| 1385 |
-
$.fn.tooltip.defaults = {
|
| 1386 |
-
animation: true
|
| 1387 |
-
, placement: 'top'
|
| 1388 |
-
, selector: false
|
| 1389 |
-
, template: '<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>'
|
| 1390 |
-
, trigger: 'hover focus'
|
| 1391 |
-
, title: ''
|
| 1392 |
-
, delay: 0
|
| 1393 |
-
, html: false
|
| 1394 |
-
, container: false
|
| 1395 |
-
}
|
| 1396 |
-
|
| 1397 |
-
|
| 1398 |
-
/* TOOLTIP NO CONFLICT
|
| 1399 |
-
* =================== */
|
| 1400 |
-
|
| 1401 |
-
$.fn.tooltip.noConflict = function () {
|
| 1402 |
-
$.fn.tooltip = old
|
| 1403 |
-
return this
|
| 1404 |
-
}
|
| 1405 |
-
|
| 1406 |
-
}(window.jQuery);
|
| 1407 |
-
/* ===========================================================
|
| 1408 |
-
* bootstrap-popover.js v2.3.1
|
| 1409 |
-
* http://twitter.github.com/bootstrap/javascript.html#popovers
|
| 1410 |
-
* ===========================================================
|
| 1411 |
-
* Copyright 2012 Twitter, Inc.
|
| 1412 |
-
*
|
| 1413 |
-
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 1414 |
-
* you may not use this file except in compliance with the License.
|
| 1415 |
-
* You may obtain a copy of the License at
|
| 1416 |
-
*
|
| 1417 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 1418 |
-
*
|
| 1419 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 1420 |
-
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 1421 |
-
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 1422 |
-
* See the License for the specific language governing permissions and
|
| 1423 |
-
* limitations under the License.
|
| 1424 |
-
* =========================================================== */
|
| 1425 |
-
|
| 1426 |
-
|
| 1427 |
-
!function ($) {
|
| 1428 |
-
|
| 1429 |
-
"use strict"; // jshint ;_;
|
| 1430 |
-
|
| 1431 |
-
|
| 1432 |
-
/* POPOVER PUBLIC CLASS DEFINITION
|
| 1433 |
-
* =============================== */
|
| 1434 |
-
|
| 1435 |
-
var Popover = function (element, options) {
|
| 1436 |
-
this.init('popover', element, options)
|
| 1437 |
-
}
|
| 1438 |
-
|
| 1439 |
-
|
| 1440 |
-
/* NOTE: POPOVER EXTENDS BOOTSTRAP-TOOLTIP.js
|
| 1441 |
-
========================================== */
|
| 1442 |
-
|
| 1443 |
-
Popover.prototype = $.extend({}, $.fn.tooltip.Constructor.prototype, {
|
| 1444 |
-
|
| 1445 |
-
constructor: Popover
|
| 1446 |
-
|
| 1447 |
-
, setContent: function () {
|
| 1448 |
-
var $tip = this.tip()
|
| 1449 |
-
, title = this.getTitle()
|
| 1450 |
-
, content = this.getContent()
|
| 1451 |
-
|
| 1452 |
-
$tip.find('.popover-title')[this.options.html ? 'html' : 'text'](title)
|
| 1453 |
-
$tip.find('.popover-content')[this.options.html ? 'html' : 'text'](content)
|
| 1454 |
-
|
| 1455 |
-
$tip.removeClass('fade top bottom left right in')
|
| 1456 |
-
}
|
| 1457 |
-
|
| 1458 |
-
, hasContent: function () {
|
| 1459 |
-
return this.getTitle() || this.getContent()
|
| 1460 |
-
}
|
| 1461 |
-
|
| 1462 |
-
, getContent: function () {
|
| 1463 |
-
var content
|
| 1464 |
-
, $e = this.$element
|
| 1465 |
-
, o = this.options
|
| 1466 |
-
|
| 1467 |
-
content = (typeof o.content == 'function' ? o.content.call($e[0]) : o.content)
|
| 1468 |
-
|| $e.attr('data-content')
|
| 1469 |
-
|
| 1470 |
-
return content
|
| 1471 |
-
}
|
| 1472 |
-
|
| 1473 |
-
, tip: function () {
|
| 1474 |
-
if (!this.$tip) {
|
| 1475 |
-
this.$tip = $(this.options.template)
|
| 1476 |
-
}
|
| 1477 |
-
return this.$tip
|
| 1478 |
-
}
|
| 1479 |
-
|
| 1480 |
-
, destroy: function () {
|
| 1481 |
-
this.hide().$element.off('.' + this.type).removeData(this.type)
|
| 1482 |
-
}
|
| 1483 |
-
|
| 1484 |
-
})
|
| 1485 |
-
|
| 1486 |
-
|
| 1487 |
-
/* POPOVER PLUGIN DEFINITION
|
| 1488 |
-
* ======================= */
|
| 1489 |
-
|
| 1490 |
-
var old = $.fn.popover
|
| 1491 |
-
|
| 1492 |
-
$.fn.popover = function (option) {
|
| 1493 |
-
return this.each(function () {
|
| 1494 |
-
var $this = $(this)
|
| 1495 |
-
, data = $this.data('popover')
|
| 1496 |
-
, options = typeof option == 'object' && option
|
| 1497 |
-
if (!data) $this.data('popover', (data = new Popover(this, options)))
|
| 1498 |
-
if (typeof option == 'string') data[option]()
|
| 1499 |
-
})
|
| 1500 |
-
}
|
| 1501 |
-
|
| 1502 |
-
$.fn.popover.Constructor = Popover
|
| 1503 |
-
|
| 1504 |
-
$.fn.popover.defaults = $.extend({} , $.fn.tooltip.defaults, {
|
| 1505 |
-
placement: 'right'
|
| 1506 |
-
, trigger: 'click'
|
| 1507 |
-
, content: ''
|
| 1508 |
-
, template: '<div class="popover"><div class="arrow"></div><h3 class="popover-title"></h3><div class="popover-content"></div></div>'
|
| 1509 |
-
})
|
| 1510 |
-
|
| 1511 |
-
|
| 1512 |
-
/* POPOVER NO CONFLICT
|
| 1513 |
-
* =================== */
|
| 1514 |
-
|
| 1515 |
-
$.fn.popover.noConflict = function () {
|
| 1516 |
-
$.fn.popover = old
|
| 1517 |
-
return this
|
| 1518 |
-
}
|
| 1519 |
-
|
| 1520 |
-
}(window.jQuery);
|
| 1521 |
-
/* =============================================================
|
| 1522 |
-
* bootstrap-scrollspy.js v2.3.1
|
| 1523 |
-
* http://twitter.github.com/bootstrap/javascript.html#scrollspy
|
| 1524 |
-
* =============================================================
|
| 1525 |
-
* Copyright 2012 Twitter, Inc.
|
| 1526 |
-
*
|
| 1527 |
-
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 1528 |
-
* you may not use this file except in compliance with the License.
|
| 1529 |
-
* You may obtain a copy of the License at
|
| 1530 |
-
*
|
| 1531 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 1532 |
-
*
|
| 1533 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 1534 |
-
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 1535 |
-
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 1536 |
-
* See the License for the specific language governing permissions and
|
| 1537 |
-
* limitations under the License.
|
| 1538 |
-
* ============================================================== */
|
| 1539 |
-
|
| 1540 |
-
|
| 1541 |
-
!function ($) {
|
| 1542 |
-
|
| 1543 |
-
"use strict"; // jshint ;_;
|
| 1544 |
-
|
| 1545 |
-
|
| 1546 |
-
/* SCROLLSPY CLASS DEFINITION
|
| 1547 |
-
* ========================== */
|
| 1548 |
-
|
| 1549 |
-
function ScrollSpy(element, options) {
|
| 1550 |
-
var process = $.proxy(this.process, this)
|
| 1551 |
-
, $element = $(element).is('body') ? $(window) : $(element)
|
| 1552 |
-
, href
|
| 1553 |
-
this.options = $.extend({}, $.fn.scrollspy.defaults, options)
|
| 1554 |
-
this.$scrollElement = $element.on('scroll.scroll-spy.data-api', process)
|
| 1555 |
-
this.selector = (this.options.target
|
| 1556 |
-
|| ((href = $(element).attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7
|
| 1557 |
-
|| '') + ' .nav li > a'
|
| 1558 |
-
this.$body = $('body')
|
| 1559 |
-
this.refresh()
|
| 1560 |
-
this.process()
|
| 1561 |
-
}
|
| 1562 |
-
|
| 1563 |
-
ScrollSpy.prototype = {
|
| 1564 |
-
|
| 1565 |
-
constructor: ScrollSpy
|
| 1566 |
-
|
| 1567 |
-
, refresh: function () {
|
| 1568 |
-
var self = this
|
| 1569 |
-
, $targets
|
| 1570 |
-
|
| 1571 |
-
this.offsets = $([])
|
| 1572 |
-
this.targets = $([])
|
| 1573 |
-
|
| 1574 |
-
$targets = this.$body
|
| 1575 |
-
.find(this.selector)
|
| 1576 |
-
.map(function () {
|
| 1577 |
-
var $el = $(this)
|
| 1578 |
-
, href = $el.data('target') || $el.attr('href')
|
| 1579 |
-
, $href = /^#\w/.test(href) && $(href)
|
| 1580 |
-
return ( $href
|
| 1581 |
-
&& $href.length
|
| 1582 |
-
&& [[ $href.position().top + (!$.isWindow(self.$scrollElement.get(0)) && self.$scrollElement.scrollTop()), href ]] ) || null
|
| 1583 |
-
})
|
| 1584 |
-
.sort(function (a, b) { return a[0] - b[0] })
|
| 1585 |
-
.each(function () {
|
| 1586 |
-
self.offsets.push(this[0])
|
| 1587 |
-
self.targets.push(this[1])
|
| 1588 |
-
})
|
| 1589 |
-
}
|
| 1590 |
-
|
| 1591 |
-
, process: function () {
|
| 1592 |
-
var scrollTop = this.$scrollElement.scrollTop() + this.options.offset
|
| 1593 |
-
, scrollHeight = this.$scrollElement[0].scrollHeight || this.$body[0].scrollHeight
|
| 1594 |
-
, maxScroll = scrollHeight - this.$scrollElement.height()
|
| 1595 |
-
, offsets = this.offsets
|
| 1596 |
-
, targets = this.targets
|
| 1597 |
-
, activeTarget = this.activeTarget
|
| 1598 |
-
, i
|
| 1599 |
-
|
| 1600 |
-
if (scrollTop >= maxScroll) {
|
| 1601 |
-
return activeTarget != (i = targets.last()[0])
|
| 1602 |
-
&& this.activate ( i )
|
| 1603 |
-
}
|
| 1604 |
-
|
| 1605 |
-
for (i = offsets.length; i--;) {
|
| 1606 |
-
activeTarget != targets[i]
|
| 1607 |
-
&& scrollTop >= offsets[i]
|
| 1608 |
-
&& (!offsets[i + 1] || scrollTop <= offsets[i + 1])
|
| 1609 |
-
&& this.activate( targets[i] )
|
| 1610 |
-
}
|
| 1611 |
-
}
|
| 1612 |
-
|
| 1613 |
-
, activate: function (target) {
|
| 1614 |
-
var active
|
| 1615 |
-
, selector
|
| 1616 |
-
|
| 1617 |
-
this.activeTarget = target
|
| 1618 |
-
|
| 1619 |
-
$(this.selector)
|
| 1620 |
-
.parent('.active')
|
| 1621 |
-
.removeClass('active')
|
| 1622 |
-
|
| 1623 |
-
selector = this.selector
|
| 1624 |
-
+ '[data-target="' + target + '"],'
|
| 1625 |
-
+ this.selector + '[href="' + target + '"]'
|
| 1626 |
-
|
| 1627 |
-
active = $(selector)
|
| 1628 |
-
.parent('li')
|
| 1629 |
-
.addClass('active')
|
| 1630 |
-
|
| 1631 |
-
if (active.parent('.dropdown-menu').length) {
|
| 1632 |
-
active = active.closest('li.dropdown').addClass('active')
|
| 1633 |
-
}
|
| 1634 |
-
|
| 1635 |
-
active.trigger('activate')
|
| 1636 |
-
}
|
| 1637 |
-
|
| 1638 |
-
}
|
| 1639 |
-
|
| 1640 |
-
|
| 1641 |
-
/* SCROLLSPY PLUGIN DEFINITION
|
| 1642 |
-
* =========================== */
|
| 1643 |
-
|
| 1644 |
-
var old = $.fn.scrollspy
|
| 1645 |
-
|
| 1646 |
-
$.fn.scrollspy = function (option) {
|
| 1647 |
-
return this.each(function () {
|
| 1648 |
-
var $this = $(this)
|
| 1649 |
-
, data = $this.data('scrollspy')
|
| 1650 |
-
, options = typeof option == 'object' && option
|
| 1651 |
-
if (!data) $this.data('scrollspy', (data = new ScrollSpy(this, options)))
|
| 1652 |
-
if (typeof option == 'string') data[option]()
|
| 1653 |
-
})
|
| 1654 |
-
}
|
| 1655 |
-
|
| 1656 |
-
$.fn.scrollspy.Constructor = ScrollSpy
|
| 1657 |
-
|
| 1658 |
-
$.fn.scrollspy.defaults = {
|
| 1659 |
-
offset: 10
|
| 1660 |
-
}
|
| 1661 |
-
|
| 1662 |
-
|
| 1663 |
-
/* SCROLLSPY NO CONFLICT
|
| 1664 |
-
* ===================== */
|
| 1665 |
-
|
| 1666 |
-
$.fn.scrollspy.noConflict = function () {
|
| 1667 |
-
$.fn.scrollspy = old
|
| 1668 |
-
return this
|
| 1669 |
-
}
|
| 1670 |
-
|
| 1671 |
-
|
| 1672 |
-
/* SCROLLSPY DATA-API
|
| 1673 |
-
* ================== */
|
| 1674 |
-
|
| 1675 |
-
$(window).on('load', function () {
|
| 1676 |
-
$('[data-spy="scroll"]').each(function () {
|
| 1677 |
-
var $spy = $(this)
|
| 1678 |
-
$spy.scrollspy($spy.data())
|
| 1679 |
-
})
|
| 1680 |
-
})
|
| 1681 |
-
|
| 1682 |
-
}(window.jQuery);/* ========================================================
|
| 1683 |
-
* bootstrap-tab.js v2.3.1
|
| 1684 |
-
* http://twitter.github.com/bootstrap/javascript.html#tabs
|
| 1685 |
-
* ========================================================
|
| 1686 |
-
* Copyright 2012 Twitter, Inc.
|
| 1687 |
-
*
|
| 1688 |
-
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 1689 |
-
* you may not use this file except in compliance with the License.
|
| 1690 |
-
* You may obtain a copy of the License at
|
| 1691 |
-
*
|
| 1692 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 1693 |
-
*
|
| 1694 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 1695 |
-
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 1696 |
-
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 1697 |
-
* See the License for the specific language governing permissions and
|
| 1698 |
-
* limitations under the License.
|
| 1699 |
-
* ======================================================== */
|
| 1700 |
-
|
| 1701 |
-
|
| 1702 |
-
!function ($) {
|
| 1703 |
-
|
| 1704 |
-
"use strict"; // jshint ;_;
|
| 1705 |
-
|
| 1706 |
-
|
| 1707 |
-
/* TAB CLASS DEFINITION
|
| 1708 |
-
* ==================== */
|
| 1709 |
-
|
| 1710 |
-
var Tab = function (element) {
|
| 1711 |
-
this.element = $(element)
|
| 1712 |
-
}
|
| 1713 |
-
|
| 1714 |
-
Tab.prototype = {
|
| 1715 |
-
|
| 1716 |
-
constructor: Tab
|
| 1717 |
-
|
| 1718 |
-
, show: function () {
|
| 1719 |
-
var $this = this.element
|
| 1720 |
-
, $ul = $this.closest('ul:not(.dropdown-menu)')
|
| 1721 |
-
, selector = $this.attr('data-target')
|
| 1722 |
-
, previous
|
| 1723 |
-
, $target
|
| 1724 |
-
, e
|
| 1725 |
-
|
| 1726 |
-
if (!selector) {
|
| 1727 |
-
selector = $this.attr('href')
|
| 1728 |
-
selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7
|
| 1729 |
-
}
|
| 1730 |
-
|
| 1731 |
-
if ( $this.parent('li').hasClass('active') ) return
|
| 1732 |
-
|
| 1733 |
-
previous = $ul.find('.active:last a')[0]
|
| 1734 |
-
|
| 1735 |
-
e = $.Event('show', {
|
| 1736 |
-
relatedTarget: previous
|
| 1737 |
-
})
|
| 1738 |
-
|
| 1739 |
-
$this.trigger(e)
|
| 1740 |
-
|
| 1741 |
-
if (e.isDefaultPrevented()) return
|
| 1742 |
-
|
| 1743 |
-
$target = $(selector)
|
| 1744 |
-
|
| 1745 |
-
this.activate($this.parent('li'), $ul)
|
| 1746 |
-
this.activate($target, $target.parent(), function () {
|
| 1747 |
-
$this.trigger({
|
| 1748 |
-
type: 'shown'
|
| 1749 |
-
, relatedTarget: previous
|
| 1750 |
-
})
|
| 1751 |
-
})
|
| 1752 |
-
}
|
| 1753 |
-
|
| 1754 |
-
, activate: function ( element, container, callback) {
|
| 1755 |
-
var $active = container.find('> .active')
|
| 1756 |
-
, transition = callback
|
| 1757 |
-
&& $.support.transition
|
| 1758 |
-
&& $active.hasClass('fade')
|
| 1759 |
-
|
| 1760 |
-
function next() {
|
| 1761 |
-
$active
|
| 1762 |
-
.removeClass('active')
|
| 1763 |
-
.find('> .dropdown-menu > .active')
|
| 1764 |
-
.removeClass('active')
|
| 1765 |
-
|
| 1766 |
-
element.addClass('active')
|
| 1767 |
-
|
| 1768 |
-
if (transition) {
|
| 1769 |
-
element[0].offsetWidth // reflow for transition
|
| 1770 |
-
element.addClass('in')
|
| 1771 |
-
} else {
|
| 1772 |
-
element.removeClass('fade')
|
| 1773 |
-
}
|
| 1774 |
-
|
| 1775 |
-
if ( element.parent('.dropdown-menu') ) {
|
| 1776 |
-
element.closest('li.dropdown').addClass('active')
|
| 1777 |
-
}
|
| 1778 |
-
|
| 1779 |
-
callback && callback()
|
| 1780 |
-
}
|
| 1781 |
-
|
| 1782 |
-
transition ?
|
| 1783 |
-
$active.one($.support.transition.end, next) :
|
| 1784 |
-
next()
|
| 1785 |
-
|
| 1786 |
-
$active.removeClass('in')
|
| 1787 |
-
}
|
| 1788 |
-
}
|
| 1789 |
-
|
| 1790 |
-
|
| 1791 |
-
/* TAB PLUGIN DEFINITION
|
| 1792 |
-
* ===================== */
|
| 1793 |
-
|
| 1794 |
-
var old = $.fn.tab
|
| 1795 |
-
|
| 1796 |
-
$.fn.tab = function ( option ) {
|
| 1797 |
-
return this.each(function () {
|
| 1798 |
-
var $this = $(this)
|
| 1799 |
-
, data = $this.data('tab')
|
| 1800 |
-
if (!data) $this.data('tab', (data = new Tab(this)))
|
| 1801 |
-
if (typeof option == 'string') data[option]()
|
| 1802 |
-
})
|
| 1803 |
-
}
|
| 1804 |
-
|
| 1805 |
-
$.fn.tab.Constructor = Tab
|
| 1806 |
-
|
| 1807 |
-
|
| 1808 |
-
/* TAB NO CONFLICT
|
| 1809 |
-
* =============== */
|
| 1810 |
-
|
| 1811 |
-
$.fn.tab.noConflict = function () {
|
| 1812 |
-
$.fn.tab = old
|
| 1813 |
-
return this
|
| 1814 |
-
}
|
| 1815 |
-
|
| 1816 |
-
|
| 1817 |
-
/* TAB DATA-API
|
| 1818 |
-
* ============ */
|
| 1819 |
-
|
| 1820 |
-
$(document).on('click.tab.data-api', '[data-toggle="tab"], [data-toggle="pill"]', function (e) {
|
| 1821 |
-
e.preventDefault()
|
| 1822 |
-
$(this).tab('show')
|
| 1823 |
-
})
|
| 1824 |
-
|
| 1825 |
-
}(window.jQuery);/* =============================================================
|
| 1826 |
-
* bootstrap-typeahead.js v2.3.1
|
| 1827 |
-
* http://twitter.github.com/bootstrap/javascript.html#typeahead
|
| 1828 |
-
* =============================================================
|
| 1829 |
-
* Copyright 2012 Twitter, Inc.
|
| 1830 |
-
*
|
| 1831 |
-
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 1832 |
-
* you may not use this file except in compliance with the License.
|
| 1833 |
-
* You may obtain a copy of the License at
|
| 1834 |
-
*
|
| 1835 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 1836 |
-
*
|
| 1837 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 1838 |
-
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 1839 |
-
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 1840 |
-
* See the License for the specific language governing permissions and
|
| 1841 |
-
* limitations under the License.
|
| 1842 |
-
* ============================================================ */
|
| 1843 |
-
|
| 1844 |
-
|
| 1845 |
-
!function($){
|
| 1846 |
-
|
| 1847 |
-
"use strict"; // jshint ;_;
|
| 1848 |
-
|
| 1849 |
-
|
| 1850 |
-
/* TYPEAHEAD PUBLIC CLASS DEFINITION
|
| 1851 |
-
* ================================= */
|
| 1852 |
-
|
| 1853 |
-
var Typeahead = function (element, options) {
|
| 1854 |
-
this.$element = $(element)
|
| 1855 |
-
this.options = $.extend({}, $.fn.typeahead.defaults, options)
|
| 1856 |
-
this.matcher = this.options.matcher || this.matcher
|
| 1857 |
-
this.sorter = this.options.sorter || this.sorter
|
| 1858 |
-
this.highlighter = this.options.highlighter || this.highlighter
|
| 1859 |
-
this.updater = this.options.updater || this.updater
|
| 1860 |
-
this.source = this.options.source
|
| 1861 |
-
this.$menu = $(this.options.menu)
|
| 1862 |
-
this.shown = false
|
| 1863 |
-
this.listen()
|
| 1864 |
-
}
|
| 1865 |
-
|
| 1866 |
-
Typeahead.prototype = {
|
| 1867 |
-
|
| 1868 |
-
constructor: Typeahead
|
| 1869 |
-
|
| 1870 |
-
, select: function () {
|
| 1871 |
-
var val = this.$menu.find('.active').attr('data-value')
|
| 1872 |
-
this.$element
|
| 1873 |
-
.val(this.updater(val))
|
| 1874 |
-
.change()
|
| 1875 |
-
return this.hide()
|
| 1876 |
-
}
|
| 1877 |
-
|
| 1878 |
-
, updater: function (item) {
|
| 1879 |
-
return item
|
| 1880 |
-
}
|
| 1881 |
-
|
| 1882 |
-
, show: function () {
|
| 1883 |
-
var pos = $.extend({}, this.$element.position(), {
|
| 1884 |
-
height: this.$element[0].offsetHeight
|
| 1885 |
-
})
|
| 1886 |
-
|
| 1887 |
-
this.$menu
|
| 1888 |
-
.insertAfter(this.$element)
|
| 1889 |
-
.css({
|
| 1890 |
-
top: pos.top + pos.height
|
| 1891 |
-
, left: pos.left
|
| 1892 |
-
})
|
| 1893 |
-
.show()
|
| 1894 |
-
|
| 1895 |
-
this.shown = true
|
| 1896 |
-
return this
|
| 1897 |
-
}
|
| 1898 |
-
|
| 1899 |
-
, hide: function () {
|
| 1900 |
-
this.$menu.hide()
|
| 1901 |
-
this.shown = false
|
| 1902 |
-
return this
|
| 1903 |
-
}
|
| 1904 |
-
|
| 1905 |
-
, lookup: function (event) {
|
| 1906 |
-
var items
|
| 1907 |
-
|
| 1908 |
-
this.query = this.$element.val()
|
| 1909 |
-
|
| 1910 |
-
if (!this.query || this.query.length < this.options.minLength) {
|
| 1911 |
-
return this.shown ? this.hide() : this
|
| 1912 |
-
}
|
| 1913 |
-
|
| 1914 |
-
items = $.isFunction(this.source) ? this.source(this.query, $.proxy(this.process, this)) : this.source
|
| 1915 |
-
|
| 1916 |
-
return items ? this.process(items) : this
|
| 1917 |
-
}
|
| 1918 |
-
|
| 1919 |
-
, process: function (items) {
|
| 1920 |
-
var that = this
|
| 1921 |
-
|
| 1922 |
-
items = $.grep(items, function (item) {
|
| 1923 |
-
return that.matcher(item)
|
| 1924 |
-
})
|
| 1925 |
-
|
| 1926 |
-
items = this.sorter(items)
|
| 1927 |
-
|
| 1928 |
-
if (!items.length) {
|
| 1929 |
-
return this.shown ? this.hide() : this
|
| 1930 |
-
}
|
| 1931 |
-
|
| 1932 |
-
return this.render(items.slice(0, this.options.items)).show()
|
| 1933 |
-
}
|
| 1934 |
-
|
| 1935 |
-
, matcher: function (item) {
|
| 1936 |
-
return ~item.toLowerCase().indexOf(this.query.toLowerCase())
|
| 1937 |
-
}
|
| 1938 |
-
|
| 1939 |
-
, sorter: function (items) {
|
| 1940 |
-
var beginswith = []
|
| 1941 |
-
, caseSensitive = []
|
| 1942 |
-
, caseInsensitive = []
|
| 1943 |
-
, item
|
| 1944 |
-
|
| 1945 |
-
while (item = items.shift()) {
|
| 1946 |
-
if (!item.toLowerCase().indexOf(this.query.toLowerCase())) beginswith.push(item)
|
| 1947 |
-
else if (~item.indexOf(this.query)) caseSensitive.push(item)
|
| 1948 |
-
else caseInsensitive.push(item)
|
| 1949 |
-
}
|
| 1950 |
-
|
| 1951 |
-
return beginswith.concat(caseSensitive, caseInsensitive)
|
| 1952 |
-
}
|
| 1953 |
-
|
| 1954 |
-
, highlighter: function (item) {
|
| 1955 |
-
var query = this.query.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, '\\$&')
|
| 1956 |
-
return item.replace(new RegExp('(' + query + ')', 'ig'), function ($1, match) {
|
| 1957 |
-
return '<strong>' + match + '</strong>'
|
| 1958 |
-
})
|
| 1959 |
-
}
|
| 1960 |
-
|
| 1961 |
-
, render: function (items) {
|
| 1962 |
-
var that = this
|
| 1963 |
-
|
| 1964 |
-
items = $(items).map(function (i, item) {
|
| 1965 |
-
i = $(that.options.item).attr('data-value', item)
|
| 1966 |
-
i.find('a').html(that.highlighter(item))
|
| 1967 |
-
return i[0]
|
| 1968 |
-
})
|
| 1969 |
-
|
| 1970 |
-
items.first().addClass('active')
|
| 1971 |
-
this.$menu.html(items)
|
| 1972 |
-
return this
|
| 1973 |
-
}
|
| 1974 |
-
|
| 1975 |
-
, next: function (event) {
|
| 1976 |
-
var active = this.$menu.find('.active').removeClass('active')
|
| 1977 |
-
, next = active.next()
|
| 1978 |
-
|
| 1979 |
-
if (!next.length) {
|
| 1980 |
-
next = $(this.$menu.find('li')[0])
|
| 1981 |
-
}
|
| 1982 |
-
|
| 1983 |
-
next.addClass('active')
|
| 1984 |
-
}
|
| 1985 |
-
|
| 1986 |
-
, prev: function (event) {
|
| 1987 |
-
var active = this.$menu.find('.active').removeClass('active')
|
| 1988 |
-
, prev = active.prev()
|
| 1989 |
-
|
| 1990 |
-
if (!prev.length) {
|
| 1991 |
-
prev = this.$menu.find('li').last()
|
| 1992 |
-
}
|
| 1993 |
-
|
| 1994 |
-
prev.addClass('active')
|
| 1995 |
-
}
|
| 1996 |
-
|
| 1997 |
-
, listen: function () {
|
| 1998 |
-
this.$element
|
| 1999 |
-
.on('focus', $.proxy(this.focus, this))
|
| 2000 |
-
.on('blur', $.proxy(this.blur, this))
|
| 2001 |
-
.on('keypress', $.proxy(this.keypress, this))
|
| 2002 |
-
.on('keyup', $.proxy(this.keyup, this))
|
| 2003 |
-
|
| 2004 |
-
if (this.eventSupported('keydown')) {
|
| 2005 |
-
this.$element.on('keydown', $.proxy(this.keydown, this))
|
| 2006 |
-
}
|
| 2007 |
-
|
| 2008 |
-
this.$menu
|
| 2009 |
-
.on('click', $.proxy(this.click, this))
|
| 2010 |
-
.on('mouseenter', 'li', $.proxy(this.mouseenter, this))
|
| 2011 |
-
.on('mouseleave', 'li', $.proxy(this.mouseleave, this))
|
| 2012 |
-
}
|
| 2013 |
-
|
| 2014 |
-
, eventSupported: function(eventName) {
|
| 2015 |
-
var isSupported = eventName in this.$element
|
| 2016 |
-
if (!isSupported) {
|
| 2017 |
-
this.$element.setAttribute(eventName, 'return;')
|
| 2018 |
-
isSupported = typeof this.$element[eventName] === 'function'
|
| 2019 |
-
}
|
| 2020 |
-
return isSupported
|
| 2021 |
-
}
|
| 2022 |
-
|
| 2023 |
-
, move: function (e) {
|
| 2024 |
-
if (!this.shown) return
|
| 2025 |
-
|
| 2026 |
-
switch(e.keyCode) {
|
| 2027 |
-
case 9: // tab
|
| 2028 |
-
case 13: // enter
|
| 2029 |
-
case 27: // escape
|
| 2030 |
-
e.preventDefault()
|
| 2031 |
-
break
|
| 2032 |
-
|
| 2033 |
-
case 38: // up arrow
|
| 2034 |
-
e.preventDefault()
|
| 2035 |
-
this.prev()
|
| 2036 |
-
break
|
| 2037 |
-
|
| 2038 |
-
case 40: // down arrow
|
| 2039 |
-
e.preventDefault()
|
| 2040 |
-
this.next()
|
| 2041 |
-
break
|
| 2042 |
-
}
|
| 2043 |
-
|
| 2044 |
-
e.stopPropagation()
|
| 2045 |
-
}
|
| 2046 |
-
|
| 2047 |
-
, keydown: function (e) {
|
| 2048 |
-
this.suppressKeyPressRepeat = ~$.inArray(e.keyCode, [40,38,9,13,27])
|
| 2049 |
-
this.move(e)
|
| 2050 |
-
}
|
| 2051 |
-
|
| 2052 |
-
, keypress: function (e) {
|
| 2053 |
-
if (this.suppressKeyPressRepeat) return
|
| 2054 |
-
this.move(e)
|
| 2055 |
-
}
|
| 2056 |
-
|
| 2057 |
-
, keyup: function (e) {
|
| 2058 |
-
switch(e.keyCode) {
|
| 2059 |
-
case 40: // down arrow
|
| 2060 |
-
case 38: // up arrow
|
| 2061 |
-
case 16: // shift
|
| 2062 |
-
case 17: // ctrl
|
| 2063 |
-
case 18: // alt
|
| 2064 |
-
break
|
| 2065 |
-
|
| 2066 |
-
case 9: // tab
|
| 2067 |
-
case 13: // enter
|
| 2068 |
-
if (!this.shown) return
|
| 2069 |
-
this.select()
|
| 2070 |
-
break
|
| 2071 |
-
|
| 2072 |
-
case 27: // escape
|
| 2073 |
-
if (!this.shown) return
|
| 2074 |
-
this.hide()
|
| 2075 |
-
break
|
| 2076 |
-
|
| 2077 |
-
default:
|
| 2078 |
-
this.lookup()
|
| 2079 |
-
}
|
| 2080 |
-
|
| 2081 |
-
e.stopPropagation()
|
| 2082 |
-
e.preventDefault()
|
| 2083 |
-
}
|
| 2084 |
-
|
| 2085 |
-
, focus: function (e) {
|
| 2086 |
-
this.focused = true
|
| 2087 |
-
}
|
| 2088 |
-
|
| 2089 |
-
, blur: function (e) {
|
| 2090 |
-
this.focused = false
|
| 2091 |
-
if (!this.mousedover && this.shown) this.hide()
|
| 2092 |
-
}
|
| 2093 |
-
|
| 2094 |
-
, click: function (e) {
|
| 2095 |
-
e.stopPropagation()
|
| 2096 |
-
e.preventDefault()
|
| 2097 |
-
this.select()
|
| 2098 |
-
this.$element.focus()
|
| 2099 |
-
}
|
| 2100 |
-
|
| 2101 |
-
, mouseenter: function (e) {
|
| 2102 |
-
this.mousedover = true
|
| 2103 |
-
this.$menu.find('.active').removeClass('active')
|
| 2104 |
-
$(e.currentTarget).addClass('active')
|
| 2105 |
-
}
|
| 2106 |
-
|
| 2107 |
-
, mouseleave: function (e) {
|
| 2108 |
-
this.mousedover = false
|
| 2109 |
-
if (!this.focused && this.shown) this.hide()
|
| 2110 |
-
}
|
| 2111 |
-
|
| 2112 |
-
}
|
| 2113 |
-
|
| 2114 |
-
|
| 2115 |
-
/* TYPEAHEAD PLUGIN DEFINITION
|
| 2116 |
-
* =========================== */
|
| 2117 |
-
|
| 2118 |
-
var old = $.fn.typeahead
|
| 2119 |
-
|
| 2120 |
-
$.fn.typeahead = function (option) {
|
| 2121 |
-
return this.each(function () {
|
| 2122 |
-
var $this = $(this)
|
| 2123 |
-
, data = $this.data('typeahead')
|
| 2124 |
-
, options = typeof option == 'object' && option
|
| 2125 |
-
if (!data) $this.data('typeahead', (data = new Typeahead(this, options)))
|
| 2126 |
-
if (typeof option == 'string') data[option]()
|
| 2127 |
-
})
|
| 2128 |
-
}
|
| 2129 |
-
|
| 2130 |
-
$.fn.typeahead.defaults = {
|
| 2131 |
-
source: []
|
| 2132 |
-
, items: 8
|
| 2133 |
-
, menu: '<ul class="typeahead dropdown-menu"></ul>'
|
| 2134 |
-
, item: '<li><a href="#"></a></li>'
|
| 2135 |
-
, minLength: 1
|
| 2136 |
-
}
|
| 2137 |
-
|
| 2138 |
-
$.fn.typeahead.Constructor = Typeahead
|
| 2139 |
-
|
| 2140 |
-
|
| 2141 |
-
/* TYPEAHEAD NO CONFLICT
|
| 2142 |
-
* =================== */
|
| 2143 |
-
|
| 2144 |
-
$.fn.typeahead.noConflict = function () {
|
| 2145 |
-
$.fn.typeahead = old
|
| 2146 |
-
return this
|
| 2147 |
-
}
|
| 2148 |
-
|
| 2149 |
-
|
| 2150 |
-
/* TYPEAHEAD DATA-API
|
| 2151 |
-
* ================== */
|
| 2152 |
-
|
| 2153 |
-
$(document).on('focus.typeahead.data-api', '[data-provide="typeahead"]', function (e) {
|
| 2154 |
-
var $this = $(this)
|
| 2155 |
-
if ($this.data('typeahead')) return
|
| 2156 |
-
$this.typeahead($this.data())
|
| 2157 |
-
})
|
| 2158 |
-
|
| 2159 |
-
}(window.jQuery);
|
| 2160 |
-
/* ==========================================================
|
| 2161 |
-
* bootstrap-affix.js v2.3.1
|
| 2162 |
-
* http://twitter.github.com/bootstrap/javascript.html#affix
|
| 2163 |
-
* ==========================================================
|
| 2164 |
-
* Copyright 2012 Twitter, Inc.
|
| 2165 |
-
*
|
| 2166 |
-
* Licensed under the Apache License, Version 2.0 (the "License");
|
| 2167 |
-
* you may not use this file except in compliance with the License.
|
| 2168 |
-
* You may obtain a copy of the License at
|
| 2169 |
-
*
|
| 2170 |
-
* http://www.apache.org/licenses/LICENSE-2.0
|
| 2171 |
-
*
|
| 2172 |
-
* Unless required by applicable law or agreed to in writing, software
|
| 2173 |
-
* distributed under the License is distributed on an "AS IS" BASIS,
|
| 2174 |
-
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 2175 |
-
* See the License for the specific language governing permissions and
|
| 2176 |
-
* limitations under the License.
|
| 2177 |
-
* ========================================================== */
|
| 2178 |
-
|
| 2179 |
-
|
| 2180 |
-
!function ($) {
|
| 2181 |
-
|
| 2182 |
-
"use strict"; // jshint ;_;
|
| 2183 |
-
|
| 2184 |
-
|
| 2185 |
-
/* AFFIX CLASS DEFINITION
|
| 2186 |
-
* ====================== */
|
| 2187 |
-
|
| 2188 |
-
var Affix = function (element, options) {
|
| 2189 |
-
this.options = $.extend({}, $.fn.affix.defaults, options)
|
| 2190 |
-
this.$window = $(window)
|
| 2191 |
-
.on('scroll.affix.data-api', $.proxy(this.checkPosition, this))
|
| 2192 |
-
.on('click.affix.data-api', $.proxy(function () { setTimeout($.proxy(this.checkPosition, this), 1) }, this))
|
| 2193 |
-
this.$element = $(element)
|
| 2194 |
-
this.checkPosition()
|
| 2195 |
-
}
|
| 2196 |
-
|
| 2197 |
-
Affix.prototype.checkPosition = function () {
|
| 2198 |
-
if (!this.$element.is(':visible')) return
|
| 2199 |
-
|
| 2200 |
-
var scrollHeight = $(document).height()
|
| 2201 |
-
, scrollTop = this.$window.scrollTop()
|
| 2202 |
-
, position = this.$element.offset()
|
| 2203 |
-
, offset = this.options.offset
|
| 2204 |
-
, offsetBottom = offset.bottom
|
| 2205 |
-
, offsetTop = offset.top
|
| 2206 |
-
, reset = 'affix affix-top affix-bottom'
|
| 2207 |
-
, affix
|
| 2208 |
-
|
| 2209 |
-
if (typeof offset != 'object') offsetBottom = offsetTop = offset
|
| 2210 |
-
if (typeof offsetTop == 'function') offsetTop = offset.top()
|
| 2211 |
-
if (typeof offsetBottom == 'function') offsetBottom = offset.bottom()
|
| 2212 |
-
|
| 2213 |
-
affix = this.unpin != null && (scrollTop + this.unpin <= position.top) ?
|
| 2214 |
-
false : offsetBottom != null && (position.top + this.$element.height() >= scrollHeight - offsetBottom) ?
|
| 2215 |
-
'bottom' : offsetTop != null && scrollTop <= offsetTop ?
|
| 2216 |
-
'top' : false
|
| 2217 |
-
|
| 2218 |
-
if (this.affixed === affix) return
|
| 2219 |
-
|
| 2220 |
-
this.affixed = affix
|
| 2221 |
-
this.unpin = affix == 'bottom' ? position.top - scrollTop : null
|
| 2222 |
-
|
| 2223 |
-
this.$element.removeClass(reset).addClass('affix' + (affix ? '-' + affix : ''))
|
| 2224 |
-
}
|
| 2225 |
-
|
| 2226 |
-
|
| 2227 |
-
/* AFFIX PLUGIN DEFINITION
|
| 2228 |
-
* ======================= */
|
| 2229 |
-
|
| 2230 |
-
var old = $.fn.affix
|
| 2231 |
-
|
| 2232 |
-
$.fn.affix = function (option) {
|
| 2233 |
-
return this.each(function () {
|
| 2234 |
-
var $this = $(this)
|
| 2235 |
-
, data = $this.data('affix')
|
| 2236 |
-
, options = typeof option == 'object' && option
|
| 2237 |
-
if (!data) $this.data('affix', (data = new Affix(this, options)))
|
| 2238 |
-
if (typeof option == 'string') data[option]()
|
| 2239 |
-
})
|
| 2240 |
-
}
|
| 2241 |
-
|
| 2242 |
-
$.fn.affix.Constructor = Affix
|
| 2243 |
-
|
| 2244 |
-
$.fn.affix.defaults = {
|
| 2245 |
-
offset: 0
|
| 2246 |
-
}
|
| 2247 |
-
|
| 2248 |
-
|
| 2249 |
-
/* AFFIX NO CONFLICT
|
| 2250 |
-
* ================= */
|
| 2251 |
-
|
| 2252 |
-
$.fn.affix.noConflict = function () {
|
| 2253 |
-
$.fn.affix = old
|
| 2254 |
-
return this
|
| 2255 |
-
}
|
| 2256 |
-
|
| 2257 |
-
|
| 2258 |
-
/* AFFIX DATA-API
|
| 2259 |
-
* ============== */
|
| 2260 |
-
|
| 2261 |
-
$(window).on('load', function () {
|
| 2262 |
-
$('[data-spy="affix"]').each(function () {
|
| 2263 |
-
var $spy = $(this)
|
| 2264 |
-
, data = $spy.data()
|
| 2265 |
-
|
| 2266 |
-
data.offset = data.offset || {}
|
| 2267 |
-
|
| 2268 |
-
data.offsetBottom && (data.offset.bottom = data.offsetBottom)
|
| 2269 |
-
data.offsetTop && (data.offset.top = data.offsetTop)
|
| 2270 |
-
|
| 2271 |
-
$spy.affix(data)
|
| 2272 |
-
})
|
| 2273 |
-
})
|
| 2274 |
-
|
| 2275 |
-
|
| 2276 |
-
}(window.jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/js/bootstrap.min.js
CHANGED
|
@@ -1,6 +1 @@
|
|
| 1 |
-
/*!
|
| 2 |
-
* Bootstrap.js by @fat & @mdo
|
| 3 |
-
* Copyright 2012 Twitter, Inc.
|
| 4 |
-
* http://www.apache.org/licenses/LICENSE-2.0.txt
|
| 5 |
-
*/
|
| 6 |
-
!function(e){"use strict";e(function(){e.support.transition=function(){var e=function(){var e=document.createElement("bootstrap"),t={WebkitTransition:"webkitTransitionEnd",MozTransition:"transitionend",OTransition:"oTransitionEnd otransitionend",transition:"transitionend"},n;for(n in t)if(e.style[n]!==undefined)return t[n]}();return e&&{end:e}}()})}(window.jQuery),!function(e){"use strict";var t='[data-dismiss="alert"]',n=function(n){e(n).on("click",t,this.close)};n.prototype.close=function(t){function s(){i.trigger("closed").remove()}var n=e(this),r=n.attr("data-target"),i;r||(r=n.attr("href"),r=r&&r.replace(/.*(?=#[^\s]*$)/,"")),i=e(r),t&&t.preventDefault(),i.length||(i=n.hasClass("alert")?n:n.parent()),i.trigger(t=e.Event("close"));if(t.isDefaultPrevented())return;i.removeClass("in"),e.support.transition&&i.hasClass("fade")?i.on(e.support.transition.end,s):s()};var r=e.fn.alert;e.fn.alert=function(t){return this.each(function(){var r=e(this),i=r.data("alert");i||r.data("alert",i=new n(this)),typeof t=="string"&&i[t].call(r)})},e.fn.alert.Constructor=n,e.fn.alert.noConflict=function(){return e.fn.alert=r,this},e(document).on("click.alert.data-api",t,n.prototype.close)}(window.jQuery),!function(e){"use strict";var t=function(t,n){this.$element=e(t),this.options=e.extend({},e.fn.button.defaults,n)};t.prototype.setState=function(e){var t="disabled",n=this.$element,r=n.data(),i=n.is("input")?"val":"html";e+="Text",r.resetText||n.data("resetText",n[i]()),n[i](r[e]||this.options[e]),setTimeout(function(){e=="loadingText"?n.addClass(t).attr(t,t):n.removeClass(t).removeAttr(t)},0)},t.prototype.toggle=function(){var e=this.$element.closest('[data-toggle="buttons-radio"]');e&&e.find(".active").removeClass("active"),this.$element.toggleClass("active")};var n=e.fn.button;e.fn.button=function(n){return this.each(function(){var r=e(this),i=r.data("button"),s=typeof n=="object"&&n;i||r.data("button",i=new t(this,s)),n=="toggle"?i.toggle():n&&i.setState(n)})},e.fn.button.defaults={loadingText:"loading..."},e.fn.button.Constructor=t,e.fn.button.noConflict=function(){return e.fn.button=n,this},e(document).on("click.button.data-api","[data-toggle^=button]",function(t){var n=e(t.target);n.hasClass("btn")||(n=n.closest(".btn")),n.button("toggle")})}(window.jQuery),!function(e){"use strict";var t=function(t,n){this.$element=e(t),this.$indicators=this.$element.find(".carousel-indicators"),this.options=n,this.options.pause=="hover"&&this.$element.on("mouseenter",e.proxy(this.pause,this)).on("mouseleave",e.proxy(this.cycle,this))};t.prototype={cycle:function(t){return t||(this.paused=!1),this.interval&&clearInterval(this.interval),this.options.interval&&!this.paused&&(this.interval=setInterval(e.proxy(this.next,this),this.options.interval)),this},getActiveIndex:function(){return this.$active=this.$element.find(".item.active"),this.$items=this.$active.parent().children(),this.$items.index(this.$active)},to:function(t){var n=this.getActiveIndex(),r=this;if(t>this.$items.length-1||t<0)return;return this.sliding?this.$element.one("slid",function(){r.to(t)}):n==t?this.pause().cycle():this.slide(t>n?"next":"prev",e(this.$items[t]))},pause:function(t){return t||(this.paused=!0),this.$element.find(".next, .prev").length&&e.support.transition.end&&(this.$element.trigger(e.support.transition.end),this.cycle(!0)),clearInterval(this.interval),this.interval=null,this},next:function(){if(this.sliding)return;return this.slide("next")},prev:function(){if(this.sliding)return;return this.slide("prev")},slide:function(t,n){var r=this.$element.find(".item.active"),i=n||r[t](),s=this.interval,o=t=="next"?"left":"right",u=t=="next"?"first":"last",a=this,f;this.sliding=!0,s&&this.pause(),i=i.length?i:this.$element.find(".item")[u](),f=e.Event("slide",{relatedTarget:i[0],direction:o});if(i.hasClass("active"))return;this.$indicators.length&&(this.$indicators.find(".active").removeClass("active"),this.$element.one("slid",function(){var t=e(a.$indicators.children()[a.getActiveIndex()]);t&&t.addClass("active")}));if(e.support.transition&&this.$element.hasClass("slide")){this.$element.trigger(f);if(f.isDefaultPrevented())return;i.addClass(t),i[0].offsetWidth,r.addClass(o),i.addClass(o),this.$element.one(e.support.transition.end,function(){i.removeClass([t,o].join(" ")).addClass("active"),r.removeClass(["active",o].join(" ")),a.sliding=!1,setTimeout(function(){a.$element.trigger("slid")},0)})}else{this.$element.trigger(f);if(f.isDefaultPrevented())return;r.removeClass("active"),i.addClass("active"),this.sliding=!1,this.$element.trigger("slid")}return s&&this.cycle(),this}};var n=e.fn.carousel;e.fn.carousel=function(n){return this.each(function(){var r=e(this),i=r.data("carousel"),s=e.extend({},e.fn.carousel.defaults,typeof n=="object"&&n),o=typeof n=="string"?n:s.slide;i||r.data("carousel",i=new t(this,s)),typeof n=="number"?i.to(n):o?i[o]():s.interval&&i.pause().cycle()})},e.fn.carousel.defaults={interval:5e3,pause:"hover"},e.fn.carousel.Constructor=t,e.fn.carousel.noConflict=function(){return e.fn.carousel=n,this},e(document).on("click.carousel.data-api","[data-slide], [data-slide-to]",function(t){var n=e(this),r,i=e(n.attr("data-target")||(r=n.attr("href"))&&r.replace(/.*(?=#[^\s]+$)/,"")),s=e.extend({},i.data(),n.data()),o;i.carousel(s),(o=n.attr("data-slide-to"))&&i.data("carousel").pause().to(o).cycle(),t.preventDefault()})}(window.jQuery),!function(e){"use strict";var t=function(t,n){this.$element=e(t),this.options=e.extend({},e.fn.collapse.defaults,n),this.options.parent&&(this.$parent=e(this.options.parent)),this.options.toggle&&this.toggle()};t.prototype={constructor:t,dimension:function(){var e=this.$element.hasClass("width");return e?"width":"height"},show:function(){var t,n,r,i;if(this.transitioning||this.$element.hasClass("in"))return;t=this.dimension(),n=e.camelCase(["scroll",t].join("-")),r=this.$parent&&this.$parent.find("> .accordion-group > .in");if(r&&r.length){i=r.data("collapse");if(i&&i.transitioning)return;r.collapse("hide"),i||r.data("collapse",null)}this.$element[t](0),this.transition("addClass",e.Event("show"),"shown"),e.support.transition&&this.$element[t](this.$element[0][n])},hide:function(){var t;if(this.transitioning||!this.$element.hasClass("in"))return;t=this.dimension(),this.reset(this.$element[t]()),this.transition("removeClass",e.Event("hide"),"hidden"),this.$element[t](0)},reset:function(e){var t=this.dimension();return this.$element.removeClass("collapse")[t](e||"auto")[0].offsetWidth,this.$element[e!==null?"addClass":"removeClass"]("collapse"),this},transition:function(t,n,r){var i=this,s=function(){n.type=="show"&&i.reset(),i.transitioning=0,i.$element.trigger(r)};this.$element.trigger(n);if(n.isDefaultPrevented())return;this.transitioning=1,this.$element[t]("in"),e.support.transition&&this.$element.hasClass("collapse")?this.$element.one(e.support.transition.end,s):s()},toggle:function(){this[this.$element.hasClass("in")?"hide":"show"]()}};var n=e.fn.collapse;e.fn.collapse=function(n){return this.each(function(){var r=e(this),i=r.data("collapse"),s=e.extend({},e.fn.collapse.defaults,r.data(),typeof n=="object"&&n);i||r.data("collapse",i=new t(this,s)),typeof n=="string"&&i[n]()})},e.fn.collapse.defaults={toggle:!0},e.fn.collapse.Constructor=t,e.fn.collapse.noConflict=function(){return e.fn.collapse=n,this},e(document).on("click.collapse.data-api","[data-toggle=collapse]",function(t){var n=e(this),r,i=n.attr("data-target")||t.preventDefault()||(r=n.attr("href"))&&r.replace(/.*(?=#[^\s]+$)/,""),s=e(i).data("collapse")?"toggle":n.data();n[e(i).hasClass("in")?"addClass":"removeClass"]("collapsed"),e(i).collapse(s)})}(window.jQuery),!function(e){"use strict";function r(){e(t).each(function(){i(e(this)).removeClass("open")})}function i(t){var n=t.attr("data-target"),r;n||(n=t.attr("href"),n=n&&/#/.test(n)&&n.replace(/.*(?=#[^\s]*$)/,"")),r=n&&e(n);if(!r||!r.length)r=t.parent();return r}var t="[data-toggle=dropdown]",n=function(t){var n=e(t).on("click.dropdown.data-api",this.toggle);e("html").on("click.dropdown.data-api",function(){n.parent().removeClass("open")})};n.prototype={constructor:n,toggle:function(t){var n=e(this),s,o;if(n.is(".disabled, :disabled"))return;return s=i(n),o=s.hasClass("open"),r(),o||s.toggleClass("open"),n.focus(),!1},keydown:function(n){var r,s,o,u,a,f;if(!/(38|40|27)/.test(n.keyCode))return;r=e(this),n.preventDefault(),n.stopPropagation();if(r.is(".disabled, :disabled"))return;u=i(r),a=u.hasClass("open");if(!a||a&&n.keyCode==27)return n.which==27&&u.find(t).focus(),r.click();s=e("[role=menu] li:not(.divider):visible a",u);if(!s.length)return;f=s.index(s.filter(":focus")),n.keyCode==38&&f>0&&f--,n.keyCode==40&&f<s.length-1&&f++,~f||(f=0),s.eq(f).focus()}};var s=e.fn.dropdown;e.fn.dropdown=function(t){return this.each(function(){var r=e(this),i=r.data("dropdown");i||r.data("dropdown",i=new n(this)),typeof t=="string"&&i[t].call(r)})},e.fn.dropdown.Constructor=n,e.fn.dropdown.noConflict=function(){return e.fn.dropdown=s,this},e(document).on("click.dropdown.data-api",r).on("click.dropdown.data-api",".dropdown form",function(e){e.stopPropagation()}).on("click.dropdown-menu",function(e){e.stopPropagation()}).on("click.dropdown.data-api",t,n.prototype.toggle).on("keydown.dropdown.data-api",t+", [role=menu]",n.prototype.keydown)}(window.jQuery),!function(e){"use strict";var t=function(t,n){this.options=n,this.$element=e(t).delegate('[data-dismiss="modal"]',"click.dismiss.modal",e.proxy(this.hide,this)),this.options.remote&&this.$element.find(".modal-body").load(this.options.remote)};t.prototype={constructor:t,toggle:function(){return this[this.isShown?"hide":"show"]()},show:function(){var t=this,n=e.Event("show");this.$element.trigger(n);if(this.isShown||n.isDefaultPrevented())return;this.isShown=!0,this.escape(),this.backdrop(function(){var n=e.support.transition&&t.$element.hasClass("fade");t.$element.parent().length||t.$element.appendTo(document.body),t.$element.show(),n&&t.$element[0].offsetWidth,t.$element.addClass("in").attr("aria-hidden",!1),t.enforceFocus(),n?t.$element.one(e.support.transition.end,function(){t.$element.focus().trigger("shown")}):t.$element.focus().trigger("shown")})},hide:function(t){t&&t.preventDefault();var n=this;t=e.Event("hide"),this.$element.trigger(t);if(!this.isShown||t.isDefaultPrevented())return;this.isShown=!1,this.escape(),e(document).off("focusin.modal"),this.$element.removeClass("in").attr("aria-hidden",!0),e.support.transition&&this.$element.hasClass("fade")?this.hideWithTransition():this.hideModal()},enforceFocus:function(){var t=this;e(document).on("focusin.modal",function(e){t.$element[0]!==e.target&&!t.$element.has(e.target).length&&t.$element.focus()})},escape:function(){var e=this;this.isShown&&this.options.keyboard?this.$element.on("keyup.dismiss.modal",function(t){t.which==27&&e.hide()}):this.isShown||this.$element.off("keyup.dismiss.modal")},hideWithTransition:function(){var t=this,n=setTimeout(function(){t.$element.off(e.support.transition.end),t.hideModal()},500);this.$element.one(e.support.transition.end,function(){clearTimeout(n),t.hideModal()})},hideModal:function(){var e=this;this.$element.hide(),this.backdrop(function(){e.removeBackdrop(),e.$element.trigger("hidden")})},removeBackdrop:function(){this.$backdrop&&this.$backdrop.remove(),this.$backdrop=null},backdrop:function(t){var n=this,r=this.$element.hasClass("fade")?"fade":"";if(this.isShown&&this.options.backdrop){var i=e.support.transition&&r;this.$backdrop=e('<div class="modal-backdrop '+r+'" />').appendTo(document.body),this.$backdrop.click(this.options.backdrop=="static"?e.proxy(this.$element[0].focus,this.$element[0]):e.proxy(this.hide,this)),i&&this.$backdrop[0].offsetWidth,this.$backdrop.addClass("in");if(!t)return;i?this.$backdrop.one(e.support.transition.end,t):t()}else!this.isShown&&this.$backdrop?(this.$backdrop.removeClass("in"),e.support.transition&&this.$element.hasClass("fade")?this.$backdrop.one(e.support.transition.end,t):t()):t&&t()}};var n=e.fn.modal;e.fn.modal=function(n){return this.each(function(){var r=e(this),i=r.data("modal"),s=e.extend({},e.fn.modal.defaults,r.data(),typeof n=="object"&&n);i||r.data("modal",i=new t(this,s)),typeof n=="string"?i[n]():s.show&&i.show()})},e.fn.modal.defaults={backdrop:!0,keyboard:!0,show:!0},e.fn.modal.Constructor=t,e.fn.modal.noConflict=function(){return e.fn.modal=n,this},e(document).on("click.modal.data-api",'[data-toggle="modal"]',function(t){var n=e(this),r=n.attr("href"),i=e(n.attr("data-target")||r&&r.replace(/.*(?=#[^\s]+$)/,"")),s=i.data("modal")?"toggle":e.extend({remote:!/#/.test(r)&&r},i.data(),n.data());t.preventDefault(),i.modal(s).one("hide",function(){n.focus()})})}(window.jQuery),!function(e){"use strict";var t=function(e,t){this.init("tooltip",e,t)};t.prototype={constructor:t,init:function(t,n,r){var i,s,o,u,a;this.type=t,this.$element=e(n),this.options=this.getOptions(r),this.enabled=!0,o=this.options.trigger.split(" ");for(a=o.length;a--;)u=o[a],u=="click"?this.$element.on("click."+this.type,this.options.selector,e.proxy(this.toggle,this)):u!="manual"&&(i=u=="hover"?"mouseenter":"focus",s=u=="hover"?"mouseleave":"blur",this.$element.on(i+"."+this.type,this.options.selector,e.proxy(this.enter,this)),this.$element.on(s+"."+this.type,this.options.selector,e.proxy(this.leave,this)));this.options.selector?this._options=e.extend({},this.options,{trigger:"manual",selector:""}):this.fixTitle()},getOptions:function(t){return t=e.extend({},e.fn[this.type].defaults,this.$element.data(),t),t.delay&&typeof t.delay=="number"&&(t.delay={show:t.delay,hide:t.delay}),t},enter:function(t){var n=e.fn[this.type].defaults,r={},i;this._options&&e.each(this._options,function(e,t){n[e]!=t&&(r[e]=t)},this),i=e(t.currentTarget)[this.type](r).data(this.type);if(!i.options.delay||!i.options.delay.show)return i.show();clearTimeout(this.timeout),i.hoverState="in",this.timeout=setTimeout(function(){i.hoverState=="in"&&i.show()},i.options.delay.show)},leave:function(t){var n=e(t.currentTarget)[this.type](this._options).data(this.type);this.timeout&&clearTimeout(this.timeout);if(!n.options.delay||!n.options.delay.hide)return n.hide();n.hoverState="out",this.timeout=setTimeout(function(){n.hoverState=="out"&&n.hide()},n.options.delay.hide)},show:function(){var t,n,r,i,s,o,u=e.Event("show");if(this.hasContent()&&this.enabled){this.$element.trigger(u);if(u.isDefaultPrevented())return;t=this.tip(),this.setContent(),this.options.animation&&t.addClass("fade"),s=typeof this.options.placement=="function"?this.options.placement.call(this,t[0],this.$element[0]):this.options.placement,t.detach().css({top:0,left:0,display:"block"}),this.options.container?t.appendTo(this.options.container):t.insertAfter(this.$element),n=this.getPosition(),r=t[0].offsetWidth,i=t[0].offsetHeight;switch(s){case"bottom":o={top:n.top+n.height,left:n.left+n.width/2-r/2};break;case"top":o={top:n.top-i,left:n.left+n.width/2-r/2};break;case"left":o={top:n.top+n.height/2-i/2,left:n.left-r};break;case"right":o={top:n.top+n.height/2-i/2,left:n.left+n.width}}this.applyPlacement(o,s),this.$element.trigger("shown")}},applyPlacement:function(e,t){var n=this.tip(),r=n[0].offsetWidth,i=n[0].offsetHeight,s,o,u,a;n.offset(e).addClass(t).addClass("in"),s=n[0].offsetWidth,o=n[0].offsetHeight,t=="top"&&o!=i&&(e.top=e.top+i-o,a=!0),t=="bottom"||t=="top"?(u=0,e.left<0&&(u=e.left*-2,e.left=0,n.offset(e),s=n[0].offsetWidth,o=n[0].offsetHeight),this.replaceArrow(u-r+s,s,"left")):this.replaceArrow(o-i,o,"top"),a&&n.offset(e)},replaceArrow:function(e,t,n){this.arrow().css(n,e?50*(1-e/t)+"%":"")},setContent:function(){var e=this.tip(),t=this.getTitle();e.find(".tooltip-inner")[this.options.html?"html":"text"](t),e.removeClass("fade in top bottom left right")},hide:function(){function i(){var t=setTimeout(function(){n.off(e.support.transition.end).detach()},500);n.one(e.support.transition.end,function(){clearTimeout(t),n.detach()})}var t=this,n=this.tip(),r=e.Event("hide");this.$element.trigger(r);if(r.isDefaultPrevented())return;return n.removeClass("in"),e.support.transition&&this.$tip.hasClass("fade")?i():n.detach(),this.$element.trigger("hidden"),this},fixTitle:function(){var e=this.$element;(e.attr("title")||typeof e.attr("data-original-title")!="string")&&e.attr("data-original-title",e.attr("title")||"").attr("title","")},hasContent:function(){return this.getTitle()},getPosition:function(){var t=this.$element[0];return e.extend({},typeof t.getBoundingClientRect=="function"?t.getBoundingClientRect():{width:t.offsetWidth,height:t.offsetHeight},this.$element.offset())},getTitle:function(){var e,t=this.$element,n=this.options;return e=t.attr("data-original-title")||(typeof n.title=="function"?n.title.call(t[0]):n.title),e},tip:function(){return this.$tip=this.$tip||e(this.options.template)},arrow:function(){return this.$arrow=this.$arrow||this.tip().find(".tooltip-arrow")},validate:function(){this.$element[0].parentNode||(this.hide(),this.$element=null,this.options=null)},enable:function(){this.enabled=!0},disable:function(){this.enabled=!1},toggleEnabled:function(){this.enabled=!this.enabled},toggle:function(t){var n=t?e(t.currentTarget)[this.type](this._options).data(this.type):this;n.tip().hasClass("in")?n.hide():n.show()},destroy:function(){this.hide().$element.off("."+this.type).removeData(this.type)}};var n=e.fn.tooltip;e.fn.tooltip=function(n){return this.each(function(){var r=e(this),i=r.data("tooltip"),s=typeof n=="object"&&n;i||r.data("tooltip",i=new t(this,s)),typeof n=="string"&&i[n]()})},e.fn.tooltip.Constructor=t,e.fn.tooltip.defaults={animation:!0,placement:"top",selector:!1,template:'<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,container:!1},e.fn.tooltip.noConflict=function(){return e.fn.tooltip=n,this}}(window.jQuery),!function(e){"use strict";var t=function(e,t){this.init("popover",e,t)};t.prototype=e.extend({},e.fn.tooltip.Constructor.prototype,{constructor:t,setContent:function(){var e=this.tip(),t=this.getTitle(),n=this.getContent();e.find(".popover-title")[this.options.html?"html":"text"](t),e.find(".popover-content")[this.options.html?"html":"text"](n),e.removeClass("fade top bottom left right in")},hasContent:function(){return this.getTitle()||this.getContent()},getContent:function(){var e,t=this.$element,n=this.options;return e=(typeof n.content=="function"?n.content.call(t[0]):n.content)||t.attr("data-content"),e},tip:function(){return this.$tip||(this.$tip=e(this.options.template)),this.$tip},destroy:function(){this.hide().$element.off("."+this.type).removeData(this.type)}});var n=e.fn.popover;e.fn.popover=function(n){return this.each(function(){var r=e(this),i=r.data("popover"),s=typeof n=="object"&&n;i||r.data("popover",i=new t(this,s)),typeof n=="string"&&i[n]()})},e.fn.popover.Constructor=t,e.fn.popover.defaults=e.extend({},e.fn.tooltip.defaults,{placement:"right",trigger:"click",content:"",template:'<div class="popover"><div class="arrow"></div><h3 class="popover-title"></h3><div class="popover-content"></div></div>'}),e.fn.popover.noConflict=function(){return e.fn.popover=n,this}}(window.jQuery),!function(e){"use strict";function t(t,n){var r=e.proxy(this.process,this),i=e(t).is("body")?e(window):e(t),s;this.options=e.extend({},e.fn.scrollspy.defaults,n),this.$scrollElement=i.on("scroll.scroll-spy.data-api",r),this.selector=(this.options.target||(s=e(t).attr("href"))&&s.replace(/.*(?=#[^\s]+$)/,"")||"")+" .nav li > a",this.$body=e("body"),this.refresh(),this.process()}t.prototype={constructor:t,refresh:function(){var t=this,n;this.offsets=e([]),this.targets=e([]),n=this.$body.find(this.selector).map(function(){var n=e(this),r=n.data("target")||n.attr("href"),i=/^#\w/.test(r)&&e(r);return i&&i.length&&[[i.position().top+(!e.isWindow(t.$scrollElement.get(0))&&t.$scrollElement.scrollTop()),r]]||null}).sort(function(e,t){return e[0]-t[0]}).each(function(){t.offsets.push(this[0]),t.targets.push(this[1])})},process:function(){var e=this.$scrollElement.scrollTop()+this.options.offset,t=this.$scrollElement[0].scrollHeight||this.$body[0].scrollHeight,n=t-this.$scrollElement.height(),r=this.offsets,i=this.targets,s=this.activeTarget,o;if(e>=n)return s!=(o=i.last()[0])&&this.activate(o);for(o=r.length;o--;)s!=i[o]&&e>=r[o]&&(!r[o+1]||e<=r[o+1])&&this.activate(i[o])},activate:function(t){var n,r;this.activeTarget=t,e(this.selector).parent(".active").removeClass("active"),r=this.selector+'[data-target="'+t+'"],'+this.selector+'[href="'+t+'"]',n=e(r).parent("li").addClass("active"),n.parent(".dropdown-menu").length&&(n=n.closest("li.dropdown").addClass("active")),n.trigger("activate")}};var n=e.fn.scrollspy;e.fn.scrollspy=function(n){return this.each(function(){var r=e(this),i=r.data("scrollspy"),s=typeof n=="object"&&n;i||r.data("scrollspy",i=new t(this,s)),typeof n=="string"&&i[n]()})},e.fn.scrollspy.Constructor=t,e.fn.scrollspy.defaults={offset:10},e.fn.scrollspy.noConflict=function(){return e.fn.scrollspy=n,this},e(window).on("load",function(){e('[data-spy="scroll"]').each(function(){var t=e(this);t.scrollspy(t.data())})})}(window.jQuery),!function(e){"use strict";var t=function(t){this.element=e(t)};t.prototype={constructor:t,show:function(){var t=this.element,n=t.closest("ul:not(.dropdown-menu)"),r=t.attr("data-target"),i,s,o;r||(r=t.attr("href"),r=r&&r.replace(/.*(?=#[^\s]*$)/,""));if(t.parent("li").hasClass("active"))return;i=n.find(".active:last a")[0],o=e.Event("show",{relatedTarget:i}),t.trigger(o);if(o.isDefaultPrevented())return;s=e(r),this.activate(t.parent("li"),n),this.activate(s,s.parent(),function(){t.trigger({type:"shown",relatedTarget:i})})},activate:function(t,n,r){function o(){i.removeClass("active").find("> .dropdown-menu > .active").removeClass("active"),t.addClass("active"),s?(t[0].offsetWidth,t.addClass("in")):t.removeClass("fade"),t.parent(".dropdown-menu")&&t.closest("li.dropdown").addClass("active"),r&&r()}var i=n.find("> .active"),s=r&&e.support.transition&&i.hasClass("fade");s?i.one(e.support.transition.end,o):o(),i.removeClass("in")}};var n=e.fn.tab;e.fn.tab=function(n){return this.each(function(){var r=e(this),i=r.data("tab");i||r.data("tab",i=new t(this)),typeof n=="string"&&i[n]()})},e.fn.tab.Constructor=t,e.fn.tab.noConflict=function(){return e.fn.tab=n,this},e(document).on("click.tab.data-api",'[data-toggle="tab"], [data-toggle="pill"]',function(t){t.preventDefault(),e(this).tab("show")})}(window.jQuery),!function(e){"use strict";var t=function(t,n){this.$element=e(t),this.options=e.extend({},e.fn.typeahead.defaults,n),this.matcher=this.options.matcher||this.matcher,this.sorter=this.options.sorter||this.sorter,this.highlighter=this.options.highlighter||this.highlighter,this.updater=this.options.updater||this.updater,this.source=this.options.source,this.$menu=e(this.options.menu),this.shown=!1,this.listen()};t.prototype={constructor:t,select:function(){var e=this.$menu.find(".active").attr("data-value");return this.$element.val(this.updater(e)).change(),this.hide()},updater:function(e){return e},show:function(){var t=e.extend({},this.$element.position(),{height:this.$element[0].offsetHeight});return this.$menu.insertAfter(this.$element).css({top:t.top+t.height,left:t.left}).show(),this.shown=!0,this},hide:function(){return this.$menu.hide(),this.shown=!1,this},lookup:function(t){var n;return this.query=this.$element.val(),!this.query||this.query.length<this.options.minLength?this.shown?this.hide():this:(n=e.isFunction(this.source)?this.source(this.query,e.proxy(this.process,this)):this.source,n?this.process(n):this)},process:function(t){var n=this;return t=e.grep(t,function(e){return n.matcher(e)}),t=this.sorter(t),t.length?this.render(t.slice(0,this.options.items)).show():this.shown?this.hide():this},matcher:function(e){return~e.toLowerCase().indexOf(this.query.toLowerCase())},sorter:function(e){var t=[],n=[],r=[],i;while(i=e.shift())i.toLowerCase().indexOf(this.query.toLowerCase())?~i.indexOf(this.query)?n.push(i):r.push(i):t.push(i);return t.concat(n,r)},highlighter:function(e){var t=this.query.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g,"\\$&");return e.replace(new RegExp("("+t+")","ig"),function(e,t){return"<strong>"+t+"</strong>"})},render:function(t){var n=this;return t=e(t).map(function(t,r){return t=e(n.options.item).attr("data-value",r),t.find("a").html(n.highlighter(r)),t[0]}),t.first().addClass("active"),this.$menu.html(t),this},next:function(t){var n=this.$menu.find(".active").removeClass("active"),r=n.next();r.length||(r=e(this.$menu.find("li")[0])),r.addClass("active")},prev:function(e){var t=this.$menu.find(".active").removeClass("active"),n=t.prev();n.length||(n=this.$menu.find("li").last()),n.addClass("active")},listen:function(){this.$element.on("focus",e.proxy(this.focus,this)).on("blur",e.proxy(this.blur,this)).on("keypress",e.proxy(this.keypress,this)).on("keyup",e.proxy(this.keyup,this)),this.eventSupported("keydown")&&this.$element.on("keydown",e.proxy(this.keydown,this)),this.$menu.on("click",e.proxy(this.click,this)).on("mouseenter","li",e.proxy(this.mouseenter,this)).on("mouseleave","li",e.proxy(this.mouseleave,this))},eventSupported:function(e){var t=e in this.$element;return t||(this.$element.setAttribute(e,"return;"),t=typeof this.$element[e]=="function"),t},move:function(e){if(!this.shown)return;switch(e.keyCode){case 9:case 13:case 27:e.preventDefault();break;case 38:e.preventDefault(),this.prev();break;case 40:e.preventDefault(),this.next()}e.stopPropagation()},keydown:function(t){this.suppressKeyPressRepeat=~e.inArray(t.keyCode,[40,38,9,13,27]),this.move(t)},keypress:function(e){if(this.suppressKeyPressRepeat)return;this.move(e)},keyup:function(e){switch(e.keyCode){case 40:case 38:case 16:case 17:case 18:break;case 9:case 13:if(!this.shown)return;this.select();break;case 27:if(!this.shown)return;this.hide();break;default:this.lookup()}e.stopPropagation(),e.preventDefault()},focus:function(e){this.focused=!0},blur:function(e){this.focused=!1,!this.mousedover&&this.shown&&this.hide()},click:function(e){e.stopPropagation(),e.preventDefault(),this.select(),this.$element.focus()},mouseenter:function(t){this.mousedover=!0,this.$menu.find(".active").removeClass("active"),e(t.currentTarget).addClass("active")},mouseleave:function(e){this.mousedover=!1,!this.focused&&this.shown&&this.hide()}};var n=e.fn.typeahead;e.fn.typeahead=function(n){return this.each(function(){var r=e(this),i=r.data("typeahead"),s=typeof n=="object"&&n;i||r.data("typeahead",i=new t(this,s)),typeof n=="string"&&i[n]()})},e.fn.typeahead.defaults={source:[],items:8,menu:'<ul class="typeahead dropdown-menu"></ul>',item:'<li><a href="#"></a></li>',minLength:1},e.fn.typeahead.Constructor=t,e.fn.typeahead.noConflict=function(){return e.fn.typeahead=n,this},e(document).on("focus.typeahead.data-api",'[data-provide="typeahead"]',function(t){var n=e(this);if(n.data("typeahead"))return;n.typeahead(n.data())})}(window.jQuery),!function(e){"use strict";var t=function(t,n){this.options=e.extend({},e.fn.affix.defaults,n),this.$window=e(window).on("scroll.affix.data-api",e.proxy(this.checkPosition,this)).on("click.affix.data-api",e.proxy(function(){setTimeout(e.proxy(this.checkPosition,this),1)},this)),this.$element=e(t),this.checkPosition()};t.prototype.checkPosition=function(){if(!this.$element.is(":visible"))return;var t=e(document).height(),n=this.$window.scrollTop(),r=this.$element.offset(),i=this.options.offset,s=i.bottom,o=i.top,u="affix affix-top affix-bottom",a;typeof i!="object"&&(s=o=i),typeof o=="function"&&(o=i.top()),typeof s=="function"&&(s=i.bottom()),a=this.unpin!=null&&n+this.unpin<=r.top?!1:s!=null&&r.top+this.$element.height()>=t-s?"bottom":o!=null&&n<=o?"top":!1;if(this.affixed===a)return;this.affixed=a,this.unpin=a=="bottom"?r.top-n:null,this.$element.removeClass(u).addClass("affix"+(a?"-"+a:""))};var n=e.fn.affix;e.fn.affix=function(n){return this.each(function(){var r=e(this),i=r.data("affix"),s=typeof n=="object"&&n;i||r.data("affix",i=new t(this,s)),typeof n=="string"&&i[n]()})},e.fn.affix.Constructor=t,e.fn.affix.defaults={offset:0},e.fn.affix.noConflict=function(){return e.fn.affix=n,this},e(window).on("load",function(){e('[data-spy="affix"]').each(function(){var t=e(this),n=t.data();n.offset=n.offset||{},n.offsetBottom&&(n.offset.bottom=n.offsetBottom),n.offsetTop&&(n.offset.top=n.offsetTop),t.affix(n)})})}(window.jQuery);
|
| 1 |
+
!function(e){"use strict";e(function(){var t;e.support.transition=(t=function(){var t,e=document.createElement("bootstrap"),i={WebkitTransition:"webkitTransitionEnd",MozTransition:"transitionend",OTransition:"oTransitionEnd otransitionend",transition:"transitionend"};for(t in i)if(void 0!==e.style[t])return i[t]}())&&{end:t}})}(window.jQuery),function(o){"use strict";function n(t){o(t).on("click",e,this.close)}var e='[data-dismiss="alert"]';n.prototype.close=function(t){var e,i=o(this),n=i.attr("data-target");function s(){e.trigger("closed").remove()}n=n||(n=i.attr("href"))&&n.replace(/.*(?=#[^\s]*$)/,""),e=o(n),t&&t.preventDefault(),(e=!e.length?i.hasClass("alert")?i:i.parent():e).trigger(t=o.Event("close")),t.isDefaultPrevented()||(e.removeClass("in"),o.support.transition&&e.hasClass("fade")?e.on(o.support.transition.end,s):s())};var t=o.fn.alert;o.fn.alert=function(i){return this.each(function(){var t=o(this),e=t.data("alert");e||t.data("alert",e=new n(this)),"string"==typeof i&&e[i].call(t)})},o.fn.alert.Constructor=n,o.fn.alert.noConflict=function(){return o.fn.alert=t,this},o(document).on("click.alert.data-api",e,n.prototype.close)}(window.jQuery),function(n){"use strict";function s(t,e){this.$element=n(t),this.options=n.extend({},n.fn.button.defaults,e)}s.prototype.setState=function(t){var e="disabled",i=this.$element,n=i.data(),s=i.is("input")?"val":"html";t+="Text",n.resetText||i.data("resetText",i[s]()),i[s](n[t]||this.options[t]),setTimeout(function(){"loadingText"==t?i.addClass(e).attr(e,e):i.removeClass(e).removeAttr(e)},0)},s.prototype.toggle=function(){var t=this.$element.closest('[data-toggle="buttons-radio"]');t&&t.find(".active").removeClass("active"),this.$element.toggleClass("active")};var t=n.fn.button;n.fn.button=function(i){return this.each(function(){var t=n(this),e=t.data("button");e||t.data("button",e=new s(this,"object"==typeof i&&i)),"toggle"==i?e.toggle():i&&e.setState(i)})},n.fn.button.defaults={loadingText:"loading..."},n.fn.button.Constructor=s,n.fn.button.noConflict=function(){return n.fn.button=t,this},n(document).on("click.button.data-api","[data-toggle^=button]",function(t){t=n(t.target);(t=!t.hasClass("btn")?t.closest(".btn"):t).button("toggle")})}(window.jQuery),function(r){"use strict";function o(t,e){this.$element=r(t),this.$indicators=this.$element.find(".carousel-indicators"),this.options=e,"hover"==this.options.pause&&this.$element.on("mouseenter",r.proxy(this.pause,this)).on("mouseleave",r.proxy(this.cycle,this))}o.prototype={cycle:function(t){return t||(this.paused=!1),this.interval&&clearInterval(this.interval),this.options.interval&&!this.paused&&(this.interval=setInterval(r.proxy(this.next,this),this.options.interval)),this},getActiveIndex:function(){return this.$active=this.$element.find(".item.active"),this.$items=this.$active.parent().children(),this.$items.index(this.$active)},to:function(t){var e=this.getActiveIndex(),i=this;if(!(t>this.$items.length-1||t<0))return this.sliding?this.$element.one("slid",function(){i.to(t)}):e==t?this.pause().cycle():this.slide(e<t?"next":"prev",r(this.$items[t]))},pause:function(t){return t||(this.paused=!0),this.$element.find(".next, .prev").length&&r.support.transition.end&&(this.$element.trigger(r.support.transition.end),this.cycle(!0)),clearInterval(this.interval),this.interval=null,this},next:function(){if(!this.sliding)return this.slide("next")},prev:function(){if(!this.sliding)return this.slide("prev")},slide:function(t,e){var i=this.$element.find(".item.active"),n=e||i[t](),s=this.interval,o="next"==t?"left":"right",e="next"==t?"first":"last",a=this;if(this.sliding=!0,s&&this.pause(),n=n.length?n:this.$element.find(".item")[e](),e=r.Event("slide",{relatedTarget:n[0],direction:o}),!n.hasClass("active")){if(this.$indicators.length&&(this.$indicators.find(".active").removeClass("active"),this.$element.one("slid",function(){var t=r(a.$indicators.children()[a.getActiveIndex()]);t&&t.addClass("active")})),r.support.transition&&this.$element.hasClass("slide")){if(this.$element.trigger(e),e.isDefaultPrevented())return;n.addClass(t),n[0].offsetWidth,i.addClass(o),n.addClass(o),this.$element.one(r.support.transition.end,function(){n.removeClass([t,o].join(" ")).addClass("active"),i.removeClass(["active",o].join(" ")),a.sliding=!1,setTimeout(function(){a.$element.trigger("slid")},0)})}else{if(this.$element.trigger(e),e.isDefaultPrevented())return;i.removeClass("active"),n.addClass("active"),this.sliding=!1,this.$element.trigger("slid")}return s&&this.cycle(),this}}};var t=r.fn.carousel;r.fn.carousel=function(s){return this.each(function(){var t=r(this),e=t.data("carousel"),i=r.extend({},r.fn.carousel.defaults,"object"==typeof s&&s),n="string"==typeof s?s:i.slide;e||t.data("carousel",e=new o(this,i)),"number"==typeof s?e.to(s):n?e[n]():i.interval&&e.pause().cycle()})},r.fn.carousel.defaults={interval:5e3,pause:"hover"},r.fn.carousel.Constructor=o,r.fn.carousel.noConflict=function(){return r.fn.carousel=t,this},r(document).on("click.carousel.data-api","[data-slide], [data-slide-to]",function(t){var e=r(this),i=r(e.attr("data-target")||(n=e.attr("href"))&&n.replace(/.*(?=#[^\s]+$)/,"")),n=r.extend({},i.data(),e.data());i.carousel(n),(e=e.attr("data-slide-to"))&&i.data("carousel").pause().to(e).cycle(),t.preventDefault()})}(window.jQuery),function(o){"use strict";function s(t,e){this.$element=o(t),this.options=o.extend({},o.fn.collapse.defaults,e),this.options.parent&&(this.$parent=o(this.options.parent)),this.options.toggle&&this.toggle()}s.prototype={constructor:s,dimension:function(){return this.$element.hasClass("width")?"width":"height"},show:function(){var t,e,i,n;if(!this.transitioning&&!this.$element.hasClass("in")){if(t=this.dimension(),e=o.camelCase(["scroll",t].join("-")),(i=this.$parent&&this.$parent.find("> .accordion-group > .in"))&&i.length){if((n=i.data("collapse"))&&n.transitioning)return;i.collapse("hide"),n||i.data("collapse",null)}this.$element[t](0),this.transition("addClass",o.Event("show"),"shown"),o.support.transition&&this.$element[t](this.$element[0][e])}},hide:function(){var t;!this.transitioning&&this.$element.hasClass("in")&&(t=this.dimension(),this.reset(this.$element[t]()),this.transition("removeClass",o.Event("hide"),"hidden"),this.$element[t](0))},reset:function(t){var e=this.dimension();return this.$element.removeClass("collapse")[e](t||"auto")[0].offsetWidth,this.$element[null!==t?"addClass":"removeClass"]("collapse"),this},transition:function(t,e,i){function n(){"show"==e.type&&s.reset(),s.transitioning=0,s.$element.trigger(i)}var s=this;this.$element.trigger(e),e.isDefaultPrevented()||(this.transitioning=1,this.$element[t]("in"),o.support.transition&&this.$element.hasClass("collapse")?this.$element.one(o.support.transition.end,n):n())},toggle:function(){this[this.$element.hasClass("in")?"hide":"show"]()}};var t=o.fn.collapse;o.fn.collapse=function(n){return this.each(function(){var t=o(this),e=t.data("collapse"),i=o.extend({},o.fn.collapse.defaults,t.data(),"object"==typeof n&&n);e||t.data("collapse",e=new s(this,i)),"string"==typeof n&&e[n]()})},o.fn.collapse.defaults={toggle:!0},o.fn.collapse.Constructor=s,o.fn.collapse.noConflict=function(){return o.fn.collapse=t,this},o(document).on("click.collapse.data-api","[data-toggle=collapse]",function(t){var e=o(this),t=e.attr("data-target")||t.preventDefault()||(i=e.attr("href"))&&i.replace(/.*(?=#[^\s]+$)/,""),i=o(t).data("collapse")?"toggle":e.data();e[o(t).hasClass("in")?"addClass":"removeClass"]("collapsed"),o(t).collapse(i)})}(window.jQuery),function(s){"use strict";function n(t){var e=s(t).on("click.dropdown.data-api",this.toggle);s("html").on("click.dropdown.data-api",function(){e.parent().removeClass("open")})}var o="[data-toggle=dropdown]";function a(){s(o).each(function(){r(s(this)).removeClass("open")})}function r(t){var e=t.attr("data-target"),e=(e=e||(e=t.attr("href"))&&/#/.test(e)&&e.replace(/.*(?=#[^\s]*$)/,""))&&s(e);return e=!e||!e.length?t.parent():e}n.prototype={constructor:n,toggle:function(t){var e,i,n=s(this);if(!n.is(".disabled, :disabled"))return i=(e=r(n)).hasClass("open"),a(),i||e.toggleClass("open"),n.focus(),!1},keydown:function(t){var e,i,n;if(/(38|40|27)/.test(t.keyCode)&&(e=s(this),t.preventDefault(),t.stopPropagation(),!e.is(".disabled, :disabled"))){if(!(i=(n=r(e)).hasClass("open"))||i&&27==t.keyCode)return 27==t.which&&n.find(o).focus(),e.click();(e=s("[role=menu] li:not(.divider):visible a",n)).length&&(n=e.index(e.filter(":focus")),38==t.keyCode&&0<n&&n--,40==t.keyCode&&n<e.length-1&&n++,e.eq(n=!~n?0:n).focus())}}};var t=s.fn.dropdown;s.fn.dropdown=function(i){return this.each(function(){var t=s(this),e=t.data("dropdown");e||t.data("dropdown",e=new n(this)),"string"==typeof i&&e[i].call(t)})},s.fn.dropdown.Constructor=n,s.fn.dropdown.noConflict=function(){return s.fn.dropdown=t,this},s(document).on("click.dropdown.data-api",a).on("click.dropdown.data-api",".dropdown form",function(t){t.stopPropagation()}).on("click.dropdown-menu",function(t){t.stopPropagation()}).on("click.dropdown.data-api",o,n.prototype.toggle).on("keydown.dropdown.data-api",o+", [role=menu]",n.prototype.keydown)}(window.jQuery),function(s){"use strict";function o(t,e){this.options=e,this.$element=s(t).delegate('[data-dismiss="modal"]',"click.dismiss.modal",s.proxy(this.hide,this)),this.options.remote&&this.$element.find(".modal-body").load(this.options.remote)}o.prototype={constructor:o,toggle:function(){return this[this.isShown?"hide":"show"]()},show:function(){var e=this,t=s.Event("show");this.$element.trigger(t),this.isShown||t.isDefaultPrevented()||(this.isShown=!0,this.escape(),this.backdrop(function(){var t=s.support.transition&&e.$element.hasClass("fade");e.$element.parent().length||e.$element.appendTo(document.body),e.$element.show(),t&&e.$element[0].offsetWidth,e.$element.addClass("in").attr("aria-hidden",!1),e.enforceFocus(),t?e.$element.one(s.support.transition.end,function(){e.$element.focus().trigger("shown")}):e.$element.focus().trigger("shown")}))},hide:function(t){t&&t.preventDefault();t=s.Event("hide"),this.$element.trigger(t),this.isShown&&!t.isDefaultPrevented()&&(this.isShown=!1,this.escape(),s(document).off("focusin.modal"),this.$element.removeClass("in").attr("aria-hidden",!0),s.support.transition&&this.$element.hasClass("fade")?this.hideWithTransition():this.hideModal())},enforceFocus:function(){var e=this;s(document).on("focusin.modal",function(t){e.$element[0]===t.target||e.$element.has(t.target).length||e.$element.focus()})},escape:function(){var e=this;this.isShown&&this.options.keyboard?this.$element.on("keyup.dismiss.modal",function(t){27==t.which&&e.hide()}):this.isShown||this.$element.off("keyup.dismiss.modal")},hideWithTransition:function(){var t=this,e=setTimeout(function(){t.$element.off(s.support.transition.end),t.hideModal()},500);this.$element.one(s.support.transition.end,function(){clearTimeout(e),t.hideModal()})},hideModal:function(){var t=this;this.$element.hide(),this.backdrop(function(){t.removeBackdrop(),t.$element.trigger("hidden")})},removeBackdrop:function(){this.$backdrop&&this.$backdrop.remove(),this.$backdrop=null},backdrop:function(t){var e,i=this.$element.hasClass("fade")?"fade":"";this.isShown&&this.options.backdrop?(e=s.support.transition&&i,this.$backdrop=s('<div class="modal-backdrop '+i+'" />').appendTo(document.body),this.$backdrop.click("static"==this.options.backdrop?s.proxy(this.$element[0].focus,this.$element[0]):s.proxy(this.hide,this)),e&&this.$backdrop[0].offsetWidth,this.$backdrop.addClass("in"),t&&(e?this.$backdrop.one(s.support.transition.end,t):t())):!this.isShown&&this.$backdrop?(this.$backdrop.removeClass("in"),s.support.transition&&this.$element.hasClass("fade")?this.$backdrop.one(s.support.transition.end,t):t()):t&&t()}};var t=s.fn.modal;s.fn.modal=function(n){return this.each(function(){var t=s(this),e=t.data("modal"),i=s.extend({},s.fn.modal.defaults,t.data(),"object"==typeof n&&n);e||t.data("modal",e=new o(this,i)),"string"==typeof n?e[n]():i.show&&e.show()})},s.fn.modal.defaults={backdrop:!0,keyboard:!0,show:!0},s.fn.modal.Constructor=o,s.fn.modal.noConflict=function(){return s.fn.modal=t,this},s(document).on("click.modal.data-api",'[data-toggle="modal"]',function(t){var e=s(this),i=e.attr("href"),n=s(e.attr("data-target")||i&&i.replace(/.*(?=#[^\s]+$)/,"")),i=n.data("modal")?"toggle":s.extend({remote:!/#/.test(i)&&i},n.data(),e.data());t.preventDefault(),n.modal(i).one("hide",function(){e.focus()})})}(window.jQuery),function(r){"use strict";function n(t,e){this.init("tooltip",t,e)}n.prototype={constructor:n,init:function(t,e,i){var n,s,o,a;for(this.type=t,this.$element=r(e),this.options=this.getOptions(i),this.enabled=!0,a=(s=this.options.trigger.split(" ")).length;a--;)"click"==(o=s[a])?this.$element.on("click."+this.type,this.options.selector,r.proxy(this.toggle,this)):"manual"!=o&&(n="hover"==o?"mouseleave":"blur",this.$element.on(("hover"==o?"mouseenter":"focus")+"."+this.type,this.options.selector,r.proxy(this.enter,this)),this.$element.on(n+"."+this.type,this.options.selector,r.proxy(this.leave,this)));this.options.selector?this._options=r.extend({},this.options,{trigger:"manual",selector:""}):this.fixTitle()},getOptions:function(t){return(t=r.extend({},r.fn[this.type].defaults,this.$element.data(),t)).delay&&"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),t},enter:function(t){var e,i=r.fn[this.type].defaults,n={};if(this._options&&r.each(this._options,function(t,e){i[t]!=e&&(n[t]=e)},this),!(e=r(t.currentTarget)[this.type](n).data(this.type)).options.delay||!e.options.delay.show)return e.show();clearTimeout(this.timeout),e.hoverState="in",this.timeout=setTimeout(function(){"in"==e.hoverState&&e.show()},e.options.delay.show)},leave:function(t){var e=r(t.currentTarget)[this.type](this._options).data(this.type);if(this.timeout&&clearTimeout(this.timeout),!e.options.delay||!e.options.delay.hide)return e.hide();e.hoverState="out",this.timeout=setTimeout(function(){"out"==e.hoverState&&e.hide()},e.options.delay.hide)},show:function(){var t,e,i,n,s,o=r.Event("show");if(this.hasContent()&&this.enabled&&(this.$element.trigger(o),!o.isDefaultPrevented())){switch(t=this.tip(),this.setContent(),this.options.animation&&t.addClass("fade"),o="function"==typeof this.options.placement?this.options.placement.call(this,t[0],this.$element[0]):this.options.placement,t.detach().css({top:0,left:0,display:"block"}),this.options.container?t.appendTo(this.options.container):t.insertAfter(this.$element),e=this.getPosition(),i=t[0].offsetWidth,n=t[0].offsetHeight,o){case"bottom":s={top:e.top+e.height,left:e.left+e.width/2-i/2};break;case"top":s={top:e.top-n,left:e.left+e.width/2-i/2};break;case"left":s={top:e.top+e.height/2-n/2,left:e.left-i};break;case"right":s={top:e.top+e.height/2-n/2,left:e.left+e.width}}this.applyPlacement(s,o),this.$element.trigger("shown")}},applyPlacement:function(t,e){var i,n,s,o=this.tip(),a=o[0].offsetWidth,r=o[0].offsetHeight;o.offset(t).addClass(e).addClass("in"),i=o[0].offsetWidth,n=o[0].offsetHeight,"top"==e&&n!=r&&(t.top=t.top+r-n,s=!0),"bottom"==e||"top"==e?(t.left<(e=0)&&(e=-2*t.left,t.left=0,o.offset(t),i=o[0].offsetWidth,n=o[0].offsetHeight),this.replaceArrow(e-a+i,i,"left")):this.replaceArrow(n-r,n,"top"),s&&o.offset(t)},replaceArrow:function(t,e,i){this.arrow().css(i,t?50*(1-t/e)+"%":"")},setContent:function(){var t=this.tip(),e=this.getTitle();t.find(".tooltip-inner")[this.options.html?"html":"text"](e),t.removeClass("fade in top bottom left right")},hide:function(){var t,e=this.tip(),i=r.Event("hide");if(this.$element.trigger(i),!i.isDefaultPrevented())return e.removeClass("in"),r.support.transition&&this.$tip.hasClass("fade")?(t=setTimeout(function(){e.off(r.support.transition.end).detach()},500),e.one(r.support.transition.end,function(){clearTimeout(t),e.detach()})):e.detach(),this.$element.trigger("hidden"),this},fixTitle:function(){var t=this.$element;!t.attr("title")&&"string"==typeof t.attr("data-original-title")||t.attr("data-original-title",t.attr("title")||"").attr("title","")},hasContent:function(){return this.getTitle()},getPosition:function(){var t=this.$element[0];return r.extend({},"function"==typeof t.getBoundingClientRect?t.getBoundingClientRect():{width:t.offsetWidth,height:t.offsetHeight},this.$element.offset())},getTitle:function(){var t=this.$element,e=this.options;return t.attr("data-original-title")||("function"==typeof e.title?e.title.call(t[0]):e.title)},tip:function(){return this.$tip=this.$tip||r(this.options.template)},arrow:function(){return this.$arrow=this.$arrow||this.tip().find(".tooltip-arrow")},validate:function(){this.$element[0].parentNode||(this.hide(),this.$element=null,this.options=null)},enable:function(){this.enabled=!0},disable:function(){this.enabled=!1},toggleEnabled:function(){this.enabled=!this.enabled},toggle:function(t){t=t?r(t.currentTarget)[this.type](this._options).data(this.type):this;t.tip().hasClass("in")?t.hide():t.show()},destroy:function(){this.hide().$element.off("."+this.type).removeData(this.type)}};var t=r.fn.tooltip;r.fn.tooltip=function(i){return this.each(function(){var t=r(this),e=t.data("tooltip");e||t.data("tooltip",e=new n(this,"object"==typeof i&&i)),"string"==typeof i&&e[i]()})},r.fn.tooltip.Constructor=n,r.fn.tooltip.defaults={animation:!0,placement:"top",selector:!1,template:'<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,container:!1},r.fn.tooltip.noConflict=function(){return r.fn.tooltip=t,this}}(window.jQuery),function(n){"use strict";function s(t,e){this.init("popover",t,e)}s.prototype=n.extend({},n.fn.tooltip.Constructor.prototype,{constructor:s,setContent:function(){var t=this.tip(),e=this.getTitle(),i=this.getContent();t.find(".popover-title")[this.options.html?"html":"text"](e),t.find(".popover-content")[this.options.html?"html":"text"](i),t.removeClass("fade top bottom left right in")},hasContent:function(){return this.getTitle()||this.getContent()},getContent:function(){var t=this.$element,e=this.options;return("function"==typeof e.content?e.content.call(t[0]):e.content)||t.attr("data-content")},tip:function(){return this.$tip||(this.$tip=n(this.options.template)),this.$tip},destroy:function(){this.hide().$element.off("."+this.type).removeData(this.type)}});var t=n.fn.popover;n.fn.popover=function(i){return this.each(function(){var t=n(this),e=t.data("popover");e||t.data("popover",e=new s(this,"object"==typeof i&&i)),"string"==typeof i&&e[i]()})},n.fn.popover.Constructor=s,n.fn.popover.defaults=n.extend({},n.fn.tooltip.defaults,{placement:"right",trigger:"click",content:"",template:'<div class="popover"><div class="arrow"></div><h3 class="popover-title"></h3><div class="popover-content"></div></div>'}),n.fn.popover.noConflict=function(){return n.fn.popover=t,this}}(window.jQuery),function(s){"use strict";function n(t,e){var i=s.proxy(this.process,this),n=s(t).is("body")?s(window):s(t);this.options=s.extend({},s.fn.scrollspy.defaults,e),this.$scrollElement=n.on("scroll.scroll-spy.data-api",i),this.selector=(this.options.target||(t=s(t).attr("href"))&&t.replace(/.*(?=#[^\s]+$)/,"")||"")+" .nav li > a",this.$body=s("body"),this.refresh(),this.process()}n.prototype={constructor:n,refresh:function(){var i=this;this.offsets=s([]),this.targets=s([]),this.$body.find(this.selector).map(function(){var t=s(this),e=t.data("target")||t.attr("href"),t=/^#\w/.test(e)&&s(e);return t&&t.length?[[t.position().top+(!s.isWindow(i.$scrollElement.get(0))&&i.$scrollElement.scrollTop()),e]]:null}).sort(function(t,e){return t[0]-e[0]}).each(function(){i.offsets.push(this[0]),i.targets.push(this[1])})},process:function(){var t,e=this.$scrollElement.scrollTop()+this.options.offset,i=(this.$scrollElement[0].scrollHeight||this.$body[0].scrollHeight)-this.$scrollElement.height(),n=this.offsets,s=this.targets,o=this.activeTarget;if(i<=e)return o!=(t=s.last()[0])&&this.activate(t);for(t=n.length;t--;)o!=s[t]&&e>=n[t]&&(!n[t+1]||e<=n[t+1])&&this.activate(s[t])},activate:function(t){this.activeTarget=t,s(this.selector).parent(".active").removeClass("active"),t=this.selector+'[data-target="'+t+'"],'+this.selector+'[href="'+t+'"]',(t=(t=s(t).parent("li").addClass("active")).parent(".dropdown-menu").length?t.closest("li.dropdown").addClass("active"):t).trigger("activate")}};var t=s.fn.scrollspy;s.fn.scrollspy=function(i){return this.each(function(){var t=s(this),e=t.data("scrollspy");e||t.data("scrollspy",e=new n(this,"object"==typeof i&&i)),"string"==typeof i&&e[i]()})},s.fn.scrollspy.Constructor=n,s.fn.scrollspy.defaults={offset:10},s.fn.scrollspy.noConflict=function(){return s.fn.scrollspy=t,this},s(window).on("load",function(){s('[data-spy="scroll"]').each(function(){var t=s(this);t.scrollspy(t.data())})})}(window.jQuery),function(a){"use strict";function n(t){this.element=a(t)}n.prototype={constructor:n,show:function(){var t,e,i=this.element,n=i.closest("ul:not(.dropdown-menu)"),s=(s=i.attr("data-target"))||(s=i.attr("href"))&&s.replace(/.*(?=#[^\s]*$)/,"");i.parent("li").hasClass("active")||(t=n.find(".active:last a")[0],e=a.Event("show",{relatedTarget:t}),i.trigger(e),e.isDefaultPrevented()||(s=a(s),this.activate(i.parent("li"),n),this.activate(s,s.parent(),function(){i.trigger({type:"shown",relatedTarget:t})})))},activate:function(t,e,i){var n=e.find("> .active"),s=i&&a.support.transition&&n.hasClass("fade");function o(){n.removeClass("active").find("> .dropdown-menu > .active").removeClass("active"),t.addClass("active"),s?(t[0].offsetWidth,t.addClass("in")):t.removeClass("fade"),t.parent(".dropdown-menu")&&t.closest("li.dropdown").addClass("active"),i&&i()}s?n.one(a.support.transition.end,o):o(),n.removeClass("in")}};var t=a.fn.tab;a.fn.tab=function(i){return this.each(function(){var t=a(this),e=t.data("tab");e||t.data("tab",e=new n(this)),"string"==typeof i&&e[i]()})},a.fn.tab.Constructor=n,a.fn.tab.noConflict=function(){return a.fn.tab=t,this},a(document).on("click.tab.data-api",'[data-toggle="tab"], [data-toggle="pill"]',function(t){t.preventDefault(),a(this).tab("show")})}(window.jQuery),function(n){"use strict";function s(t,e){this.$element=n(t),this.options=n.extend({},n.fn.typeahead.defaults,e),this.matcher=this.options.matcher||this.matcher,this.sorter=this.options.sorter||this.sorter,this.highlighter=this.options.highlighter||this.highlighter,this.updater=this.options.updater||this.updater,this.source=this.options.source,this.$menu=n(this.options.menu),this.shown=!1,this.listen()}s.prototype={constructor:s,select:function(){var t=this.$menu.find(".active").attr("data-value");return this.$element.val(this.updater(t)).change(),this.hide()},updater:function(t){return t},show:function(){var t=n.extend({},this.$element.position(),{height:this.$element[0].offsetHeight});return this.$menu.insertAfter(this.$element).css({top:t.top+t.height,left:t.left}).show(),this.shown=!0,this},hide:function(){return this.$menu.hide(),this.shown=!1,this},lookup:function(t){var e;return this.query=this.$element.val(),!this.query||this.query.length<this.options.minLength?this.shown?this.hide():this:(e=n.isFunction(this.source)?this.source(this.query,n.proxy(this.process,this)):this.source)?this.process(e):this},process:function(t){var e=this;return t=n.grep(t,function(t){return e.matcher(t)}),(t=this.sorter(t)).length?this.render(t.slice(0,this.options.items)).show():this.shown?this.hide():this},matcher:function(t){return~t.toLowerCase().indexOf(this.query.toLowerCase())},sorter:function(t){for(var e,i=[],n=[],s=[];e=t.shift();)(e.toLowerCase().indexOf(this.query.toLowerCase())?~e.indexOf(this.query)?n:s:i).push(e);return i.concat(n,s)},highlighter:function(t){var e=this.query.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g,"\\$&");return t.replace(new RegExp("("+e+")","ig"),function(t,e){return"<strong>"+e+"</strong>"})},render:function(t){var i=this;return(t=n(t).map(function(t,e){return(t=n(i.options.item).attr("data-value",e)).find("a").html(i.highlighter(e)),t[0]})).first().addClass("active"),this.$menu.html(t),this},next:function(t){var e=this.$menu.find(".active").removeClass("active").next();(e=!e.length?n(this.$menu.find("li")[0]):e).addClass("active")},prev:function(t){var e=this.$menu.find(".active").removeClass("active").prev();(e=!e.length?this.$menu.find("li").last():e).addClass("active")},listen:function(){this.$element.on("focus",n.proxy(this.focus,this)).on("blur",n.proxy(this.blur,this)).on("keypress",n.proxy(this.keypress,this)).on("keyup",n.proxy(this.keyup,this)),this.eventSupported("keydown")&&this.$element.on("keydown",n.proxy(this.keydown,this)),this.$menu.on("click",n.proxy(this.click,this)).on("mouseenter","li",n.proxy(this.mouseenter,this)).on("mouseleave","li",n.proxy(this.mouseleave,this))},eventSupported:function(t){var e=t in this.$element;return e||(this.$element.setAttribute(t,"return;"),e="function"==typeof this.$element[t]),e},move:function(t){if(this.shown){switch(t.keyCode){case 9:case 13:case 27:t.preventDefault();break;case 38:t.preventDefault(),this.prev();break;case 40:t.preventDefault(),this.next()}t.stopPropagation()}},keydown:function(t){this.suppressKeyPressRepeat=~n.inArray(t.keyCode,[40,38,9,13,27]),this.move(t)},keypress:function(t){this.suppressKeyPressRepeat||this.move(t)},keyup:function(t){switch(t.keyCode){case 40:case 38:case 16:case 17:case 18:break;case 9:case 13:if(!this.shown)return;this.select();break;case 27:if(!this.shown)return;this.hide();break;default:this.lookup()}t.stopPropagation(),t.preventDefault()},focus:function(t){this.focused=!0},blur:function(t){this.focused=!1,!this.mousedover&&this.shown&&this.hide()},click:function(t){t.stopPropagation(),t.preventDefault(),this.select(),this.$element.focus()},mouseenter:function(t){this.mousedover=!0,this.$menu.find(".active").removeClass("active"),n(t.currentTarget).addClass("active")},mouseleave:function(t){this.mousedover=!1,!this.focused&&this.shown&&this.hide()}};var t=n.fn.typeahead;n.fn.typeahead=function(i){return this.each(function(){var t=n(this),e=t.data("typeahead");e||t.data("typeahead",e=new s(this,"object"==typeof i&&i)),"string"==typeof i&&e[i]()})},n.fn.typeahead.defaults={source:[],items:8,menu:'<ul class="typeahead dropdown-menu"></ul>',item:'<li><a href="#"></a></li>',minLength:1},n.fn.typeahead.Constructor=s,n.fn.typeahead.noConflict=function(){return n.fn.typeahead=t,this},n(document).on("focus.typeahead.data-api",'[data-provide="typeahead"]',function(t){var e=n(this);e.data("typeahead")||e.typeahead(e.data())})}(window.jQuery),function(a){"use strict";function n(t,e){this.options=a.extend({},a.fn.affix.defaults,e),this.$window=a(window).on("scroll.affix.data-api",a.proxy(this.checkPosition,this)).on("click.affix.data-api",a.proxy(function(){setTimeout(a.proxy(this.checkPosition,this),1)},this)),this.$element=a(t),this.checkPosition()}n.prototype.checkPosition=function(){var t,e,i,n,s,o;this.$element.is(":visible")&&(t=a(document).height(),e=this.$window.scrollTop(),i=this.$element.offset(),s=(n=this.options.offset).bottom,o=n.top,"object"!=typeof n&&(s=o=n),"function"==typeof o&&(o=n.top()),"function"==typeof s&&(s=n.bottom()),o=!(null!=this.unpin&&e+this.unpin<=i.top)&&(null!=s&&i.top+this.$element.height()>=t-s?"bottom":null!=o&&e<=o&&"top"),this.affixed!==o&&(this.affixed=o,this.unpin="bottom"==o?i.top-e:null,this.$element.removeClass("affix affix-top affix-bottom").addClass("affix"+(o?"-"+o:""))))};var t=a.fn.affix;a.fn.affix=function(i){return this.each(function(){var t=a(this),e=t.data("affix");e||t.data("affix",e=new n(this,"object"==typeof i&&i)),"string"==typeof i&&e[i]()})},a.fn.affix.Constructor=n,a.fn.affix.defaults={offset:0},a.fn.affix.noConflict=function(){return a.fn.affix=t,this},a(window).on("load",function(){a('[data-spy="affix"]').each(function(){var t=a(this),e=t.data();e.offset=e.offset||{},e.offsetBottom&&(e.offset.bottom=e.offsetBottom),e.offsetTop&&(e.offset.top=e.offsetTop),t.affix(e)})})}(window.jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/js/jquery.reveal.modified.js
DELETED
|
@@ -1,217 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
* jQuery Reveal Plugin 1.0
|
| 3 |
-
* Copyright 2010, ZURB
|
| 4 |
-
* Free to use under the MIT license.
|
| 5 |
-
* http://www.opensource.org/licenses/mit-license.php
|
| 6 |
-
*
|
| 7 |
-
* Modified : Dan Horan
|
| 8 |
-
*
|
| 9 |
-
* Added functionality to mention scrollheight in the config
|
| 10 |
-
*
|
| 11 |
-
*/
|
| 12 |
-
|
| 13 |
-
(function($) {
|
| 14 |
-
|
| 15 |
-
/*---------------------------
|
| 16 |
-
Defaults for Reveal
|
| 17 |
-
----------------------------*/
|
| 18 |
-
|
| 19 |
-
/*---------------------------
|
| 20 |
-
Listener for data-reveal-id attributes
|
| 21 |
-
----------------------------*/
|
| 22 |
-
|
| 23 |
-
$('a[data-reveal-id]').live('click', function(e) {
|
| 24 |
-
e.preventDefault();
|
| 25 |
-
var modalLocation = $(this).attr('data-reveal-id');
|
| 26 |
-
$('#'+modalLocation).reveal($(this).data());
|
| 27 |
-
});
|
| 28 |
-
|
| 29 |
-
/*---------------------------
|
| 30 |
-
Extend and Execute
|
| 31 |
-
----------------------------*/
|
| 32 |
-
|
| 33 |
-
$.widget("ui.reveal", {
|
| 34 |
-
options: {
|
| 35 |
-
animation: 'fadeAndPop' //fade, fadeAndPop, none
|
| 36 |
-
, animationspeed: 300 //how fast animtions are
|
| 37 |
-
, closeonbackgroundclick: true //if you click background will modal close?
|
| 38 |
-
, closeonesc: true //if you hit the ESC key will modal close?
|
| 39 |
-
, dismissmodalclass: 'close-reveal-modal' //the class of a button or element that will close an open modal
|
| 40 |
-
, backdrop: true //Show the modal by default or not
|
| 41 |
-
, autoshow: true //Show the modal by default or not
|
| 42 |
-
, showevent: 'show' // event to listen on the modal container to trigger show
|
| 43 |
-
, shownevent: 'shown' // event to listen on the modal container after the modal box is shown
|
| 44 |
-
, hideevent: 'hide' // event to listen on the modal container to trigger hide
|
| 45 |
-
, hiddenevent: 'hidden' // event to listen on the modal container after the modal is hidden
|
| 46 |
-
, draggable: false
|
| 47 |
-
, draghandle: null
|
| 48 |
-
, fixed: true
|
| 49 |
-
, topPosition: 150
|
| 50 |
-
//scrollHeight: <integer> This attribute if not passed will be calculated at the runtime and used
|
| 51 |
-
},
|
| 52 |
-
_create : function() {
|
| 53 |
-
var self = this, options = self.options;
|
| 54 |
-
/*---------------------------
|
| 55 |
-
Global Variables
|
| 56 |
-
----------------------------*/
|
| 57 |
-
var modal = ( self.modal = self.element.addClass('reveal-modal') ),
|
| 58 |
-
topMeasure = ( self._topMeasure = parseInt(modal.css('top')) ),
|
| 59 |
-
topOffset = ( self._topOffset = modal.height() + topMeasure ),
|
| 60 |
-
locked = ( self._locked = false ),
|
| 61 |
-
modalBG = ( self.modalBG = $('.reveal-modal-bg') );
|
| 62 |
-
|
| 63 |
-
if(!modal.attr('id')){
|
| 64 |
-
modal.attr('id', (new Date).getTime() + Math.floor((Math.random()*100)+1))
|
| 65 |
-
}
|
| 66 |
-
|
| 67 |
-
self._isOpen = false;
|
| 68 |
-
|
| 69 |
-
if(options.draggable){
|
| 70 |
-
var drag_opts = { handle : options.draghandle };
|
| 71 |
-
modal.draggable(drag_opts);
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
/*---------------------------
|
| 75 |
-
Create Modal BG
|
| 76 |
-
----------------------------*/
|
| 77 |
-
|
| 78 |
-
if(modalBG.length == 0) {
|
| 79 |
-
modalBG = ( self.modalBG = $('<div class="reveal-modal-bg" />').insertAfter(modal) );
|
| 80 |
-
}
|
| 81 |
-
|
| 82 |
-
/*---------------------------
|
| 83 |
-
Add Closing Listeners
|
| 84 |
-
----------------------------*/
|
| 85 |
-
|
| 86 |
-
//Close Modal Listeners
|
| 87 |
-
var closeButton = $('.' + options.dismissmodalclass).off('click.reveal').on('click.reveal', function () {
|
| 88 |
-
self.close();
|
| 89 |
-
});
|
| 90 |
-
|
| 91 |
-
if(options.closeonbackgroundclick) {
|
| 92 |
-
self.modalBG.css({"cursor":"pointer"})
|
| 93 |
-
self.modalBG.off('click.reveal').on('click.reveal', function () {
|
| 94 |
-
self.close();
|
| 95 |
-
});
|
| 96 |
-
}
|
| 97 |
-
|
| 98 |
-
},
|
| 99 |
-
|
| 100 |
-
_init : function(){
|
| 101 |
-
var self = this, options = self.options;
|
| 102 |
-
|
| 103 |
-
//Entrance Animations
|
| 104 |
-
self.modal.on('reveal:open ' + options.showevent, function () {
|
| 105 |
-
if(!self._isOpen){ self.open(); }
|
| 106 |
-
});
|
| 107 |
-
|
| 108 |
-
//Closing Animation
|
| 109 |
-
self.modal.on('reveal:close ' + options.hideevent, function () {
|
| 110 |
-
if(self._isOpen){ self.close(); }
|
| 111 |
-
});
|
| 112 |
-
|
| 113 |
-
//Open Modal Immediately
|
| 114 |
-
options.autoshow && self.modal.trigger('reveal:open');
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
},
|
| 118 |
-
|
| 119 |
-
open : function(){
|
| 120 |
-
var self = this, options = self.options;
|
| 121 |
-
$('.' + options.dismissmodalclass).off('click.modalEvent');
|
| 122 |
-
if(!self._locked) {
|
| 123 |
-
self.lockModal();
|
| 124 |
-
self.modal.css({left: '50%'}); // reset the left position in the event it was dragged over.
|
| 125 |
-
if(options.animation == "fadeAndPop") {
|
| 126 |
-
var h = typeof options.scrollheight !== "undefined" ? options.scrollheight : $(document).scrollTop();
|
| 127 |
-
self.modal.css({'top': options.fixed ? 0 : h -self._topOffset, 'opacity' : 0, 'visibility' : 'visible'});
|
| 128 |
-
options.backdrop && self.modalBG.fadeIn(options.animationspeed/2);
|
| 129 |
-
self.modal.show().delay(options.animationspeed/2).animate({
|
| 130 |
-
"top": options.fixed ? options.topPosition : h+self._topMeasure + 'px',
|
| 131 |
-
"opacity" : 1
|
| 132 |
-
}, options.animationspeed,self.shown());
|
| 133 |
-
}
|
| 134 |
-
if(options.animation == "fade") {
|
| 135 |
-
self.modal.css({'opacity' : 0, 'visibility' : 'visible', 'top': $(document).scrollTop()+self._topMeasure});
|
| 136 |
-
self.modalBG.fadeIn(options.animationspeed/2);
|
| 137 |
-
self.modal.show().delay(options.animationspeed/2).animate({
|
| 138 |
-
"opacity" : 1
|
| 139 |
-
}, options.animationspeed,self.shown());
|
| 140 |
-
}
|
| 141 |
-
if(options.animation == "none") {
|
| 142 |
-
self.modal.css({'visibility' : 'visible', 'top':$(document).scrollTop()+self._topMeasure});
|
| 143 |
-
self.modalBG.show();
|
| 144 |
-
self.shown()
|
| 145 |
-
}
|
| 146 |
-
}
|
| 147 |
-
if(options.closeonesc){
|
| 148 |
-
$('body').on('keyup.reveal_' + self.modal.attr('id'), function(e) {
|
| 149 |
-
if(e.which===27){ self.close(); } // 27 is the keycode for the Escape key
|
| 150 |
-
});
|
| 151 |
-
}
|
| 152 |
-
self.modal.unbind('reveal:open');
|
| 153 |
-
},
|
| 154 |
-
|
| 155 |
-
close : function(event){
|
| 156 |
-
var self = this, options = self.options;
|
| 157 |
-
if(!self._locked) {
|
| 158 |
-
self.lockModal();
|
| 159 |
-
if(options.animation == "fadeAndPop") {
|
| 160 |
-
var h = typeof options.scrollheight !== "undefined" ? options.scrollheight : $(document).scrollTop();
|
| 161 |
-
options.backdrop && self.modalBG.delay(options.animationspeed).fadeOut(options.animationspeed);
|
| 162 |
-
self.modal.animate({
|
| 163 |
-
"top": options.fixed ? 0 : h - self._topOffset + 'px',
|
| 164 |
-
"opacity" : 0
|
| 165 |
-
}, options.animationspeed/2, function() {
|
| 166 |
-
self.modal.css({'top':self._topMeasure, 'opacity' : 1, 'visibility' : 'hidden'});
|
| 167 |
-
self.hidden(event);
|
| 168 |
-
});
|
| 169 |
-
}
|
| 170 |
-
if(options.animation == "fade") {
|
| 171 |
-
self.modalBG.delay(options.animationspeed).fadeOut(options.animationspeed);
|
| 172 |
-
self.modal.animate({
|
| 173 |
-
"opacity" : 0
|
| 174 |
-
}, options.animationspeed, function() {
|
| 175 |
-
self.modal.css({'opacity' : 1, 'visibility' : 'hidden', 'top' : self._topMeasure});
|
| 176 |
-
self.hidden(event);
|
| 177 |
-
});
|
| 178 |
-
}
|
| 179 |
-
if(options.animation == "none") {
|
| 180 |
-
self.modal.css({'visibility' : 'hidden', 'top' : self._topMeasure});
|
| 181 |
-
self.modalBG.hide();
|
| 182 |
-
self.hidden(event);
|
| 183 |
-
}
|
| 184 |
-
}
|
| 185 |
-
$('body').off('keyup.reveal_' + self.modal.attr('id'));
|
| 186 |
-
self.modal.unbind('reveal:close');
|
| 187 |
-
},
|
| 188 |
-
|
| 189 |
-
shown : function() {
|
| 190 |
-
var self = this, options = self.options;
|
| 191 |
-
self.modal.trigger(options.shownevent);
|
| 192 |
-
self._isOpen = true;
|
| 193 |
-
self.unlockModal();
|
| 194 |
-
},
|
| 195 |
-
|
| 196 |
-
hidden : function(event) {
|
| 197 |
-
var self = this, options = self.options;
|
| 198 |
-
self.modal.trigger(options.hiddenevent);
|
| 199 |
-
self._trigger( "close", event );
|
| 200 |
-
self._isOpen = false;
|
| 201 |
-
self.unlockModal();
|
| 202 |
-
},
|
| 203 |
-
|
| 204 |
-
/*---------------------------
|
| 205 |
-
Animations Locks
|
| 206 |
-
----------------------------*/
|
| 207 |
-
unlockModal: function() {
|
| 208 |
-
self._locked = false;
|
| 209 |
-
},
|
| 210 |
-
|
| 211 |
-
lockModal : function() {
|
| 212 |
-
self._locked = true;
|
| 213 |
-
}
|
| 214 |
-
|
| 215 |
-
});//Widget definition
|
| 216 |
-
|
| 217 |
-
})(sQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/js/jquery.reveal.modified.min.js
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
| 1 |
+
!function(t){t("a[data-reveal-id]").live("click",function(o){o.preventDefault();o=t(this).attr("data-reveal-id");t("#"+o).reveal(t(this).data())}),t.widget("ui.reveal",{options:{animation:"fadeAndPop",animationspeed:300,closeonbackgroundclick:!0,closeonesc:!0,dismissmodalclass:"close-reveal-modal",backdrop:!0,autoshow:!0,showevent:"show",shownevent:"shown",hideevent:"hide",hiddenevent:"hidden",draggable:!1,draghandle:null,fixed:!0,topPosition:150},_create:function(){var o=this,e=o.options,a=o.modal=o.element.addClass("reveal-modal"),i=o._topMeasure=parseInt(a.css("top")),n=(o._topOffset=a.height()+i,o._locked=!1,o.modalBG=t(".reveal-modal-bg"));a.attr("id")||a.attr("id",(new Date).getTime()+Math.floor(100*Math.random()+1)),o._isOpen=!1,e.draggable&&(i={handle:e.draghandle},a.draggable(i)),0==n.length&&(o.modalBG=t('<div class="reveal-modal-bg" />').insertAfter(a));t("."+e.dismissmodalclass).off("click.reveal").on("click.reveal",function(){o.close()});e.closeonbackgroundclick&&(o.modalBG.css({cursor:"pointer"}),o.modalBG.off("click.reveal").on("click.reveal",function(){o.close()}))},_init:function(){var o=this,e=o.options;o.modal.on("reveal:open "+e.showevent,function(){o._isOpen||o.open()}),o.modal.on("reveal:close "+e.hideevent,function(){o._isOpen&&o.close()}),e.autoshow&&o.modal.trigger("reveal:open")},open:function(){var o,e=this,a=e.options;t("."+a.dismissmodalclass).off("click.modalEvent"),e._locked||(e.lockModal(),e.modal.css({left:"50%"}),"fadeAndPop"==a.animation&&(o=void 0!==a.scrollheight?a.scrollheight:t(document).scrollTop(),e.modal.css({top:a.fixed?0:o-e._topOffset,opacity:0,visibility:"visible"}),a.backdrop&&e.modalBG.fadeIn(a.animationspeed/2),e.modal.show().delay(a.animationspeed/2).animate({top:a.fixed?a.topPosition:o+e._topMeasure+"px",opacity:1},a.animationspeed,e.shown())),"fade"==a.animation&&(e.modal.css({opacity:0,visibility:"visible",top:t(document).scrollTop()+e._topMeasure}),e.modalBG.fadeIn(a.animationspeed/2),e.modal.show().delay(a.animationspeed/2).animate({opacity:1},a.animationspeed,e.shown())),"none"==a.animation&&(e.modal.css({visibility:"visible",top:t(document).scrollTop()+e._topMeasure}),e.modalBG.show(),e.shown())),a.closeonesc&&t("body").on("keyup.reveal_"+e.modal.attr("id"),function(o){27===o.which&&e.close()}),e.modal.unbind("reveal:open")},close:function(o){var e,a=this,i=a.options;a._locked||(a.lockModal(),"fadeAndPop"==i.animation&&(e=void 0!==i.scrollheight?i.scrollheight:t(document).scrollTop(),i.backdrop&&a.modalBG.delay(i.animationspeed).fadeOut(i.animationspeed),a.modal.animate({top:i.fixed?0:e-a._topOffset+"px",opacity:0},i.animationspeed/2,function(){a.modal.css({top:a._topMeasure,opacity:1,visibility:"hidden"}),a.hidden(o)})),"fade"==i.animation&&(a.modalBG.delay(i.animationspeed).fadeOut(i.animationspeed),a.modal.animate({opacity:0},i.animationspeed,function(){a.modal.css({opacity:1,visibility:"hidden",top:a._topMeasure}),a.hidden(o)})),"none"==i.animation&&(a.modal.css({visibility:"hidden",top:a._topMeasure}),a.modalBG.hide(),a.hidden(o))),t("body").off("keyup.reveal_"+a.modal.attr("id")),a.modal.unbind("reveal:close")},shown:function(){var o=this,e=o.options;o.modal.trigger(e.shownevent),o._isOpen=!0,o.unlockModal()},hidden:function(o){var e=this,a=e.options;e.modal.trigger(a.hiddenevent),e._trigger("close",o),e._isOpen=!1,e.unlockModal()},unlockModal:function(){self._locked=!1},lockModal:function(){self._locked=!0}})}(sQuery);
|
assets/js/jquery_custom.js
DELETED
|
@@ -1,9227 +0,0 @@
|
|
| 1 |
-
/*!
|
| 2 |
-
* jQuery JavaScript Library v1.8.0
|
| 3 |
-
* http://jquery.com/
|
| 4 |
-
*
|
| 5 |
-
* Includes Sizzle.js
|
| 6 |
-
* http://sizzlejs.com/
|
| 7 |
-
*
|
| 8 |
-
* Copyright 2012 jQuery Foundation and other contributors
|
| 9 |
-
* Released under the MIT license
|
| 10 |
-
* http://jquery.org/license
|
| 11 |
-
*
|
| 12 |
-
* Date: Thu Aug 09 2012 16:24:48 GMT-0400 (Eastern Daylight Time)
|
| 13 |
-
*/
|
| 14 |
-
(function( window, undefined ) {
|
| 15 |
-
var
|
| 16 |
-
// A central reference to the root jQuery(document)
|
| 17 |
-
rootjQuery,
|
| 18 |
-
|
| 19 |
-
// The deferred used on DOM ready
|
| 20 |
-
readyList,
|
| 21 |
-
|
| 22 |
-
// Use the correct document accordingly with window argument (sandbox)
|
| 23 |
-
document = window.document,
|
| 24 |
-
location = window.location,
|
| 25 |
-
navigator = window.navigator,
|
| 26 |
-
|
| 27 |
-
// Map over jQuery in case of overwrite
|
| 28 |
-
_jQuery = window.sQuery,
|
| 29 |
-
|
| 30 |
-
// Map over the $ in case of overwrite
|
| 31 |
-
_$ = window.$,
|
| 32 |
-
|
| 33 |
-
// Save a reference to some core methods
|
| 34 |
-
core_push = Array.prototype.push,
|
| 35 |
-
core_slice = Array.prototype.slice,
|
| 36 |
-
core_indexOf = Array.prototype.indexOf,
|
| 37 |
-
core_toString = Object.prototype.toString,
|
| 38 |
-
core_hasOwn = Object.prototype.hasOwnProperty,
|
| 39 |
-
core_trim = String.prototype.trim,
|
| 40 |
-
|
| 41 |
-
// Define a local copy of jQuery
|
| 42 |
-
jQuery = function( selector, context ) {
|
| 43 |
-
// The jQuery object is actually just the init constructor 'enhanced'
|
| 44 |
-
return new jQuery.fn.init( selector, context, rootjQuery );
|
| 45 |
-
},
|
| 46 |
-
|
| 47 |
-
// Used for matching numbers
|
| 48 |
-
core_pnum = /[\-+]?(?:\d*\.|)\d+(?:[eE][\-+]?\d+|)/.source,
|
| 49 |
-
|
| 50 |
-
// Used for detecting and trimming whitespace
|
| 51 |
-
core_rnotwhite = /\S/,
|
| 52 |
-
core_rspace = /\s+/,
|
| 53 |
-
|
| 54 |
-
// IE doesn't match non-breaking spaces with \s
|
| 55 |
-
rtrim = core_rnotwhite.test("\xA0") ? (/^[\s\xA0]+|[\s\xA0]+$/g) : /^\s+|\s+$/g,
|
| 56 |
-
|
| 57 |
-
// A simple way to check for HTML strings
|
| 58 |
-
// Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
|
| 59 |
-
rquickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,
|
| 60 |
-
|
| 61 |
-
// Match a standalone tag
|
| 62 |
-
rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>|)$/,
|
| 63 |
-
|
| 64 |
-
// JSON RegExp
|
| 65 |
-
rvalidchars = /^[\],:{}\s]*$/,
|
| 66 |
-
rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g,
|
| 67 |
-
rvalidescape = /\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g,
|
| 68 |
-
rvalidtokens = /"[^"\\\r\n]*"|true|false|null|-?(?:\d\d*\.|)\d+(?:[eE][\-+]?\d+|)/g,
|
| 69 |
-
|
| 70 |
-
// Matches dashed string for camelizing
|
| 71 |
-
rmsPrefix = /^-ms-/,
|
| 72 |
-
rdashAlpha = /-([\da-z])/gi,
|
| 73 |
-
|
| 74 |
-
// Used by jQuery.camelCase as callback to replace()
|
| 75 |
-
fcamelCase = function( all, letter ) {
|
| 76 |
-
return ( letter + "" ).toUpperCase();
|
| 77 |
-
},
|
| 78 |
-
|
| 79 |
-
// The ready event handler and self cleanup method
|
| 80 |
-
DOMContentLoaded = function() {
|
| 81 |
-
if ( document.addEventListener ) {
|
| 82 |
-
document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false );
|
| 83 |
-
jQuery.ready();
|
| 84 |
-
} else if ( document.readyState === "complete" ) {
|
| 85 |
-
// we're here because readyState === "complete" in oldIE
|
| 86 |
-
// which is good enough for us to call the dom ready!
|
| 87 |
-
document.detachEvent( "onreadystatechange", DOMContentLoaded );
|
| 88 |
-
jQuery.ready();
|
| 89 |
-
}
|
| 90 |
-
},
|
| 91 |
-
|
| 92 |
-
// [[Class]] -> type pairs
|
| 93 |
-
class2type = {};
|
| 94 |
-
|
| 95 |
-
jQuery.fn = jQuery.prototype = {
|
| 96 |
-
constructor: jQuery,
|
| 97 |
-
init: function( selector, context, rootjQuery ) {
|
| 98 |
-
var match, elem, ret, doc;
|
| 99 |
-
|
| 100 |
-
// Handle $(""), $(null), $(undefined), $(false)
|
| 101 |
-
if ( !selector ) {
|
| 102 |
-
return this;
|
| 103 |
-
}
|
| 104 |
-
|
| 105 |
-
// Handle $(DOMElement)
|
| 106 |
-
if ( selector.nodeType ) {
|
| 107 |
-
this.context = this[0] = selector;
|
| 108 |
-
this.length = 1;
|
| 109 |
-
return this;
|
| 110 |
-
}
|
| 111 |
-
|
| 112 |
-
// Handle HTML strings
|
| 113 |
-
if ( typeof selector === "string" ) {
|
| 114 |
-
if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) {
|
| 115 |
-
// Assume that strings that start and end with <> are HTML and skip the regex check
|
| 116 |
-
match = [ null, selector, null ];
|
| 117 |
-
|
| 118 |
-
} else {
|
| 119 |
-
match = rquickExpr.exec( selector );
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
// Match html or make sure no context is specified for #id
|
| 123 |
-
if ( match && (match[1] || !context) ) {
|
| 124 |
-
|
| 125 |
-
// HANDLE: $(html) -> $(array)
|
| 126 |
-
if ( match[1] ) {
|
| 127 |
-
context = context instanceof jQuery ? context[0] : context;
|
| 128 |
-
doc = ( context && context.nodeType ? context.ownerDocument || context : document );
|
| 129 |
-
|
| 130 |
-
// scripts is true for back-compat
|
| 131 |
-
selector = jQuery.parseHTML( match[1], doc, true );
|
| 132 |
-
if ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) {
|
| 133 |
-
this.attr.call( selector, context, true );
|
| 134 |
-
}
|
| 135 |
-
|
| 136 |
-
return jQuery.merge( this, selector );
|
| 137 |
-
|
| 138 |
-
// HANDLE: $(#id)
|
| 139 |
-
} else {
|
| 140 |
-
elem = document.getElementById( match[2] );
|
| 141 |
-
|
| 142 |
-
// Check parentNode to catch when Blackberry 4.6 returns
|
| 143 |
-
// nodes that are no longer in the document #6963
|
| 144 |
-
if ( elem && elem.parentNode ) {
|
| 145 |
-
// Handle the case where IE and Opera return items
|
| 146 |
-
// by name instead of ID
|
| 147 |
-
if ( elem.id !== match[2] ) {
|
| 148 |
-
return rootjQuery.find( selector );
|
| 149 |
-
}
|
| 150 |
-
|
| 151 |
-
// Otherwise, we inject the element directly into the jQuery object
|
| 152 |
-
this.length = 1;
|
| 153 |
-
this[0] = elem;
|
| 154 |
-
}
|
| 155 |
-
|
| 156 |
-
this.context = document;
|
| 157 |
-
this.selector = selector;
|
| 158 |
-
return this;
|
| 159 |
-
}
|
| 160 |
-
|
| 161 |
-
// HANDLE: $(expr, $(...))
|
| 162 |
-
} else if ( !context || context.jquery ) {
|
| 163 |
-
return ( context || rootjQuery ).find( selector );
|
| 164 |
-
|
| 165 |
-
// HANDLE: $(expr, context)
|
| 166 |
-
// (which is just equivalent to: $(context).find(expr)
|
| 167 |
-
} else {
|
| 168 |
-
return this.constructor( context ).find( selector );
|
| 169 |
-
}
|
| 170 |
-
|
| 171 |
-
// HANDLE: $(function)
|
| 172 |
-
// Shortcut for document ready
|
| 173 |
-
} else if ( jQuery.isFunction( selector ) ) {
|
| 174 |
-
return rootjQuery.ready( selector );
|
| 175 |
-
}
|
| 176 |
-
|
| 177 |
-
if ( selector.selector !== undefined ) {
|
| 178 |
-
this.selector = selector.selector;
|
| 179 |
-
this.context = selector.context;
|
| 180 |
-
}
|
| 181 |
-
|
| 182 |
-
return jQuery.makeArray( selector, this );
|
| 183 |
-
},
|
| 184 |
-
|
| 185 |
-
// Start with an empty selector
|
| 186 |
-
selector: "",
|
| 187 |
-
|
| 188 |
-
// The current version of jQuery being used
|
| 189 |
-
jquery: "1.8.0",
|
| 190 |
-
|
| 191 |
-
// The default length of a jQuery object is 0
|
| 192 |
-
length: 0,
|
| 193 |
-
|
| 194 |
-
// The number of elements contained in the matched element set
|
| 195 |
-
size: function() {
|
| 196 |
-
return this.length;
|
| 197 |
-
},
|
| 198 |
-
|
| 199 |
-
toArray: function() {
|
| 200 |
-
return core_slice.call( this );
|
| 201 |
-
},
|
| 202 |
-
|
| 203 |
-
// Get the Nth element in the matched element set OR
|
| 204 |
-
// Get the whole matched element set as a clean array
|
| 205 |
-
get: function( num ) {
|
| 206 |
-
return num == null ?
|
| 207 |
-
|
| 208 |
-
// Return a 'clean' array
|
| 209 |
-
this.toArray() :
|
| 210 |
-
|
| 211 |
-
// Return just the object
|
| 212 |
-
( num < 0 ? this[ this.length + num ] : this[ num ] );
|
| 213 |
-
},
|
| 214 |
-
|
| 215 |
-
// Take an array of elements and push it onto the stack
|
| 216 |
-
// (returning the new matched element set)
|
| 217 |
-
pushStack: function( elems, name, selector ) {
|
| 218 |
-
|
| 219 |
-
// Build a new jQuery matched element set
|
| 220 |
-
var ret = jQuery.merge( this.constructor(), elems );
|
| 221 |
-
|
| 222 |
-
// Add the old object onto the stack (as a reference)
|
| 223 |
-
ret.prevObject = this;
|
| 224 |
-
|
| 225 |
-
ret.context = this.context;
|
| 226 |
-
|
| 227 |
-
if ( name === "find" ) {
|
| 228 |
-
ret.selector = this.selector + ( this.selector ? " " : "" ) + selector;
|
| 229 |
-
} else if ( name ) {
|
| 230 |
-
ret.selector = this.selector + "." + name + "(" + selector + ")";
|
| 231 |
-
}
|
| 232 |
-
|
| 233 |
-
// Return the newly-formed element set
|
| 234 |
-
return ret;
|
| 235 |
-
},
|
| 236 |
-
|
| 237 |
-
// Execute a callback for every element in the matched set.
|
| 238 |
-
// (You can seed the arguments with an array of args, but this is
|
| 239 |
-
// only used internally.)
|
| 240 |
-
each: function( callback, args ) {
|
| 241 |
-
return jQuery.each( this, callback, args );
|
| 242 |
-
},
|
| 243 |
-
|
| 244 |
-
ready: function( fn ) {
|
| 245 |
-
// Add the callback
|
| 246 |
-
jQuery.ready.promise().done( fn );
|
| 247 |
-
|
| 248 |
-
return this;
|
| 249 |
-
},
|
| 250 |
-
|
| 251 |
-
eq: function( i ) {
|
| 252 |
-
i = +i;
|
| 253 |
-
return i === -1 ?
|
| 254 |
-
this.slice( i ) :
|
| 255 |
-
this.slice( i, i + 1 );
|
| 256 |
-
},
|
| 257 |
-
|
| 258 |
-
first: function() {
|
| 259 |
-
return this.eq( 0 );
|
| 260 |
-
},
|
| 261 |
-
|
| 262 |
-
last: function() {
|
| 263 |
-
return this.eq( -1 );
|
| 264 |
-
},
|
| 265 |
-
|
| 266 |
-
slice: function() {
|
| 267 |
-
return this.pushStack( core_slice.apply( this, arguments ),
|
| 268 |
-
"slice", core_slice.call(arguments).join(",") );
|
| 269 |
-
},
|
| 270 |
-
|
| 271 |
-
map: function( callback ) {
|
| 272 |
-
return this.pushStack( jQuery.map(this, function( elem, i ) {
|
| 273 |
-
return callback.call( elem, i, elem );
|
| 274 |
-
}));
|
| 275 |
-
},
|
| 276 |
-
|
| 277 |
-
end: function() {
|
| 278 |
-
return this.prevObject || this.constructor(null);
|
| 279 |
-
},
|
| 280 |
-
|
| 281 |
-
// For internal use only.
|
| 282 |
-
// Behaves like an Array's method, not like a jQuery method.
|
| 283 |
-
push: core_push,
|
| 284 |
-
sort: [].sort,
|
| 285 |
-
splice: [].splice
|
| 286 |
-
};
|
| 287 |
-
|
| 288 |
-
// Give the init function the jQuery prototype for later instantiation
|
| 289 |
-
jQuery.fn.init.prototype = jQuery.fn;
|
| 290 |
-
|
| 291 |
-
jQuery.extend = jQuery.fn.extend = function() {
|
| 292 |
-
var options, name, src, copy, copyIsArray, clone,
|
| 293 |
-
target = arguments[0] || {},
|
| 294 |
-
i = 1,
|
| 295 |
-
length = arguments.length,
|
| 296 |
-
deep = false;
|
| 297 |
-
|
| 298 |
-
// Handle a deep copy situation
|
| 299 |
-
if ( typeof target === "boolean" ) {
|
| 300 |
-
deep = target;
|
| 301 |
-
target = arguments[1] || {};
|
| 302 |
-
// skip the boolean and the target
|
| 303 |
-
i = 2;
|
| 304 |
-
}
|
| 305 |
-
|
| 306 |
-
// Handle case when target is a string or something (possible in deep copy)
|
| 307 |
-
if ( typeof target !== "object" && !jQuery.isFunction(target) ) {
|
| 308 |
-
target = {};
|
| 309 |
-
}
|
| 310 |
-
|
| 311 |
-
// extend jQuery itself if only one argument is passed
|
| 312 |
-
if ( length === i ) {
|
| 313 |
-
target = this;
|
| 314 |
-
--i;
|
| 315 |
-
}
|
| 316 |
-
|
| 317 |
-
for ( ; i < length; i++ ) {
|
| 318 |
-
// Only deal with non-null/undefined values
|
| 319 |
-
if ( (options = arguments[ i ]) != null ) {
|
| 320 |
-
// Extend the base object
|
| 321 |
-
for ( name in options ) {
|
| 322 |
-
src = target[ name ];
|
| 323 |
-
copy = options[ name ];
|
| 324 |
-
|
| 325 |
-
// Prevent never-ending loop
|
| 326 |
-
if ( target === copy ) {
|
| 327 |
-
continue;
|
| 328 |
-
}
|
| 329 |
-
|
| 330 |
-
// Recurse if we're merging plain objects or arrays
|
| 331 |
-
if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) {
|
| 332 |
-
if ( copyIsArray ) {
|
| 333 |
-
copyIsArray = false;
|
| 334 |
-
clone = src && jQuery.isArray(src) ? src : [];
|
| 335 |
-
|
| 336 |
-
} else {
|
| 337 |
-
clone = src && jQuery.isPlainObject(src) ? src : {};
|
| 338 |
-
}
|
| 339 |
-
|
| 340 |
-
// Never move original objects, clone them
|
| 341 |
-
target[ name ] = jQuery.extend( deep, clone, copy );
|
| 342 |
-
|
| 343 |
-
// Don't bring in undefined values
|
| 344 |
-
} else if ( copy !== undefined ) {
|
| 345 |
-
target[ name ] = copy;
|
| 346 |
-
}
|
| 347 |
-
}
|
| 348 |
-
}
|
| 349 |
-
}
|
| 350 |
-
|
| 351 |
-
// Return the modified object
|
| 352 |
-
return target;
|
| 353 |
-
};
|
| 354 |
-
|
| 355 |
-
jQuery.extend({
|
| 356 |
-
noConflict: function( deep ) {
|
| 357 |
-
if ( window.$ === jQuery ) {
|
| 358 |
-
window.$ = _$;
|
| 359 |
-
}
|
| 360 |
-
|
| 361 |
-
if ( deep && window.sQuery === jQuery ) {
|
| 362 |
-
window.sQuery = _jQuery;
|
| 363 |
-
}
|
| 364 |
-
|
| 365 |
-
return jQuery;
|
| 366 |
-
},
|
| 367 |
-
|
| 368 |
-
// Is the DOM ready to be used? Set to true once it occurs.
|
| 369 |
-
isReady: false,
|
| 370 |
-
|
| 371 |
-
// A counter to track how many items to wait for before
|
| 372 |
-
// the ready event fires. See #6781
|
| 373 |
-
readyWait: 1,
|
| 374 |
-
|
| 375 |
-
// Hold (or release) the ready event
|
| 376 |
-
holdReady: function( hold ) {
|
| 377 |
-
if ( hold ) {
|
| 378 |
-
jQuery.readyWait++;
|
| 379 |
-
} else {
|
| 380 |
-
jQuery.ready( true );
|
| 381 |
-
}
|
| 382 |
-
},
|
| 383 |
-
|
| 384 |
-
// Handle when the DOM is ready
|
| 385 |
-
ready: function( wait ) {
|
| 386 |
-
|
| 387 |
-
// Abort if there are pending holds or we're already ready
|
| 388 |
-
if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {
|
| 389 |
-
return;
|
| 390 |
-
}
|
| 391 |
-
|
| 392 |
-
// Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
|
| 393 |
-
if ( !document.body ) {
|
| 394 |
-
return setTimeout( jQuery.ready, 1 );
|
| 395 |
-
}
|
| 396 |
-
|
| 397 |
-
// Remember that the DOM is ready
|
| 398 |
-
jQuery.isReady = true;
|
| 399 |
-
|
| 400 |
-
// If a normal DOM Ready event fired, decrement, and wait if need be
|
| 401 |
-
if ( wait !== true && --jQuery.readyWait > 0 ) {
|
| 402 |
-
return;
|
| 403 |
-
}
|
| 404 |
-
|
| 405 |
-
// If there are functions bound, to execute
|
| 406 |
-
readyList.resolveWith( document, [ jQuery ] );
|
| 407 |
-
|
| 408 |
-
// Trigger any bound ready events
|
| 409 |
-
if ( jQuery.fn.trigger ) {
|
| 410 |
-
jQuery( document ).trigger("ready").off("ready");
|
| 411 |
-
}
|
| 412 |
-
},
|
| 413 |
-
|
| 414 |
-
// See test/unit/core.js for details concerning isFunction.
|
| 415 |
-
// Since version 1.3, DOM methods and functions like alert
|
| 416 |
-
// aren't supported. They return false on IE (#2968).
|
| 417 |
-
isFunction: function( obj ) {
|
| 418 |
-
return jQuery.type(obj) === "function";
|
| 419 |
-
},
|
| 420 |
-
|
| 421 |
-
isArray: Array.isArray || function( obj ) {
|
| 422 |
-
return jQuery.type(obj) === "array";
|
| 423 |
-
},
|
| 424 |
-
|
| 425 |
-
isWindow: function( obj ) {
|
| 426 |
-
return obj != null && obj == obj.window;
|
| 427 |
-
},
|
| 428 |
-
|
| 429 |
-
isNumeric: function( obj ) {
|
| 430 |
-
return !isNaN( parseFloat(obj) ) && isFinite( obj );
|
| 431 |
-
},
|
| 432 |
-
|
| 433 |
-
type: function( obj ) {
|
| 434 |
-
return obj == null ?
|
| 435 |
-
String( obj ) :
|
| 436 |
-
class2type[ core_toString.call(obj) ] || "object";
|
| 437 |
-
},
|
| 438 |
-
|
| 439 |
-
isPlainObject: function( obj ) {
|
| 440 |
-
// Must be an Object.
|
| 441 |
-
// Because of IE, we also have to check the presence of the constructor property.
|
| 442 |
-
// Make sure that DOM nodes and window objects don't pass through, as well
|
| 443 |
-
if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) {
|
| 444 |
-
return false;
|
| 445 |
-
}
|
| 446 |
-
|
| 447 |
-
try {
|
| 448 |
-
// Not own constructor property must be Object
|
| 449 |
-
if ( obj.constructor &&
|
| 450 |
-
!core_hasOwn.call(obj, "constructor") &&
|
| 451 |
-
!core_hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) {
|
| 452 |
-
return false;
|
| 453 |
-
}
|
| 454 |
-
} catch ( e ) {
|
| 455 |
-
// IE8,9 Will throw exceptions on certain host objects #9897
|
| 456 |
-
return false;
|
| 457 |
-
}
|
| 458 |
-
|
| 459 |
-
// Own properties are enumerated firstly, so to speed up,
|
| 460 |
-
// if last one is own, then all properties are own.
|
| 461 |
-
|
| 462 |
-
var key;
|
| 463 |
-
for ( key in obj ) {}
|
| 464 |
-
|
| 465 |
-
return key === undefined || core_hasOwn.call( obj, key );
|
| 466 |
-
},
|
| 467 |
-
|
| 468 |
-
isEmptyObject: function( obj ) {
|
| 469 |
-
var name;
|
| 470 |
-
for ( name in obj ) {
|
| 471 |
-
return false;
|
| 472 |
-
}
|
| 473 |
-
return true;
|
| 474 |
-
},
|
| 475 |
-
|
| 476 |
-
error: function( msg ) {
|
| 477 |
-
throw new Error( msg );
|
| 478 |
-
},
|
| 479 |
-
|
| 480 |
-
// data: string of html
|
| 481 |
-
// context (optional): If specified, the fragment will be created in this context, defaults to document
|
| 482 |
-
// scripts (optional): If true, will include scripts passed in the html string
|
| 483 |
-
parseHTML: function( data, context, scripts ) {
|
| 484 |
-
var parsed;
|
| 485 |
-
if ( !data || typeof data !== "string" ) {
|
| 486 |
-
return null;
|
| 487 |
-
}
|
| 488 |
-
if ( typeof context === "boolean" ) {
|
| 489 |
-
scripts = context;
|
| 490 |
-
context = 0;
|
| 491 |
-
}
|
| 492 |
-
context = context || document;
|
| 493 |
-
|
| 494 |
-
// Single tag
|
| 495 |
-
if ( (parsed = rsingleTag.exec( data )) ) {
|
| 496 |
-
return [ context.createElement( parsed[1] ) ];
|
| 497 |
-
}
|
| 498 |
-
|
| 499 |
-
parsed = jQuery.buildFragment( [ data ], context, scripts ? null : [] );
|
| 500 |
-
return jQuery.merge( [],
|
| 501 |
-
(parsed.cacheable ? jQuery.clone( parsed.fragment ) : parsed.fragment).childNodes );
|
| 502 |
-
},
|
| 503 |
-
|
| 504 |
-
parseJSON: function( data ) {
|
| 505 |
-
if ( !data || typeof data !== "string") {
|
| 506 |
-
return null;
|
| 507 |
-
}
|
| 508 |
-
|
| 509 |
-
// Make sure leading/trailing whitespace is removed (IE can't handle it)
|
| 510 |
-
data = jQuery.trim( data );
|
| 511 |
-
|
| 512 |
-
// Attempt to parse using the native JSON parser first
|
| 513 |
-
if ( window.JSON && window.JSON.parse ) {
|
| 514 |
-
return window.JSON.parse( data );
|
| 515 |
-
}
|
| 516 |
-
|
| 517 |
-
// Make sure the incoming data is actual JSON
|
| 518 |
-
// Logic borrowed from http://json.org/json2.js
|
| 519 |
-
if ( rvalidchars.test( data.replace( rvalidescape, "@" )
|
| 520 |
-
.replace( rvalidtokens, "]" )
|
| 521 |
-
.replace( rvalidbraces, "")) ) {
|
| 522 |
-
|
| 523 |
-
return ( new Function( "return " + data ) )();
|
| 524 |
-
|
| 525 |
-
}
|
| 526 |
-
jQuery.error( "Invalid JSON: " + data );
|
| 527 |
-
},
|
| 528 |
-
|
| 529 |
-
// Cross-browser xml parsing
|
| 530 |
-
parseXML: function( data ) {
|
| 531 |
-
var xml, tmp;
|
| 532 |
-
if ( !data || typeof data !== "string" ) {
|
| 533 |
-
return null;
|
| 534 |
-
}
|
| 535 |
-
try {
|
| 536 |
-
if ( window.DOMParser ) { // Standard
|
| 537 |
-
tmp = new DOMParser();
|
| 538 |
-
xml = tmp.parseFromString( data , "text/xml" );
|
| 539 |
-
} else { // IE
|
| 540 |
-
xml = new ActiveXObject( "Microsoft.XMLDOM" );
|
| 541 |
-
xml.async = "false";
|
| 542 |
-
xml.loadXML( data );
|
| 543 |
-
}
|
| 544 |
-
} catch( e ) {
|
| 545 |
-
xml = undefined;
|
| 546 |
-
}
|
| 547 |
-
if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) {
|
| 548 |
-
jQuery.error( "Invalid XML: " + data );
|
| 549 |
-
}
|
| 550 |
-
return xml;
|
| 551 |
-
},
|
| 552 |
-
|
| 553 |
-
noop: function() {},
|
| 554 |
-
|
| 555 |
-
// Evaluates a script in a global context
|
| 556 |
-
// Workarounds based on findings by Jim Driscoll
|
| 557 |
-
// http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context
|
| 558 |
-
globalEval: function( data ) {
|
| 559 |
-
if ( data && core_rnotwhite.test( data ) ) {
|
| 560 |
-
// We use execScript on Internet Explorer
|
| 561 |
-
// We use an anonymous function so that context is window
|
| 562 |
-
// rather than jQuery in Firefox
|
| 563 |
-
( window.execScript || function( data ) {
|
| 564 |
-
window[ "eval" ].call( window, data );
|
| 565 |
-
} )( data );
|
| 566 |
-
}
|
| 567 |
-
},
|
| 568 |
-
|
| 569 |
-
// Convert dashed to camelCase; used by the css and data modules
|
| 570 |
-
// Microsoft forgot to hump their vendor prefix (#9572)
|
| 571 |
-
camelCase: function( string ) {
|
| 572 |
-
return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase );
|
| 573 |
-
},
|
| 574 |
-
|
| 575 |
-
nodeName: function( elem, name ) {
|
| 576 |
-
return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase();
|
| 577 |
-
},
|
| 578 |
-
|
| 579 |
-
// args is for internal usage only
|
| 580 |
-
each: function( obj, callback, args ) {
|
| 581 |
-
var name,
|
| 582 |
-
i = 0,
|
| 583 |
-
length = obj.length,
|
| 584 |
-
isObj = length === undefined || jQuery.isFunction( obj );
|
| 585 |
-
|
| 586 |
-
if ( args ) {
|
| 587 |
-
if ( isObj ) {
|
| 588 |
-
for ( name in obj ) {
|
| 589 |
-
if ( callback.apply( obj[ name ], args ) === false ) {
|
| 590 |
-
break;
|
| 591 |
-
}
|
| 592 |
-
}
|
| 593 |
-
} else {
|
| 594 |
-
for ( ; i < length; ) {
|
| 595 |
-
if ( callback.apply( obj[ i++ ], args ) === false ) {
|
| 596 |
-
break;
|
| 597 |
-
}
|
| 598 |
-
}
|
| 599 |
-
}
|
| 600 |
-
|
| 601 |
-
// A special, fast, case for the most common use of each
|
| 602 |
-
} else {
|
| 603 |
-
if ( isObj ) {
|
| 604 |
-
for ( name in obj ) {
|
| 605 |
-
if ( callback.call( obj[ name ], name, obj[ name ] ) === false ) {
|
| 606 |
-
break;
|
| 607 |
-
}
|
| 608 |
-
}
|
| 609 |
-
} else {
|
| 610 |
-
for ( ; i < length; ) {
|
| 611 |
-
if ( callback.call( obj[ i ], i, obj[ i++ ] ) === false ) {
|
| 612 |
-
break;
|
| 613 |
-
}
|
| 614 |
-
}
|
| 615 |
-
}
|
| 616 |
-
}
|
| 617 |
-
|
| 618 |
-
return obj;
|
| 619 |
-
},
|
| 620 |
-
|
| 621 |
-
// Use native String.trim function wherever possible
|
| 622 |
-
trim: core_trim ?
|
| 623 |
-
function( text ) {
|
| 624 |
-
return text == null ?
|
| 625 |
-
"" :
|
| 626 |
-
core_trim.call( text );
|
| 627 |
-
} :
|
| 628 |
-
|
| 629 |
-
// Otherwise use our own trimming functionality
|
| 630 |
-
function( text ) {
|
| 631 |
-
return text == null ?
|
| 632 |
-
"" :
|
| 633 |
-
text.toString().replace( rtrim, "" );
|
| 634 |
-
},
|
| 635 |
-
|
| 636 |
-
// results is for internal usage only
|
| 637 |
-
makeArray: function( arr, results ) {
|
| 638 |
-
var type,
|
| 639 |
-
ret = results || [];
|
| 640 |
-
|
| 641 |
-
if ( arr != null ) {
|
| 642 |
-
// The window, strings (and functions) also have 'length'
|
| 643 |
-
// Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930
|
| 644 |
-
type = jQuery.type( arr );
|
| 645 |
-
|
| 646 |
-
if ( arr.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( arr ) ) {
|
| 647 |
-
core_push.call( ret, arr );
|
| 648 |
-
} else {
|
| 649 |
-
jQuery.merge( ret, arr );
|
| 650 |
-
}
|
| 651 |
-
}
|
| 652 |
-
|
| 653 |
-
return ret;
|
| 654 |
-
},
|
| 655 |
-
|
| 656 |
-
inArray: function( elem, arr, i ) {
|
| 657 |
-
var len;
|
| 658 |
-
|
| 659 |
-
if ( arr ) {
|
| 660 |
-
if ( core_indexOf ) {
|
| 661 |
-
return core_indexOf.call( arr, elem, i );
|
| 662 |
-
}
|
| 663 |
-
|
| 664 |
-
len = arr.length;
|
| 665 |
-
i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0;
|
| 666 |
-
|
| 667 |
-
for ( ; i < len; i++ ) {
|
| 668 |
-
// Skip accessing in sparse arrays
|
| 669 |
-
if ( i in arr && arr[ i ] === elem ) {
|
| 670 |
-
return i;
|
| 671 |
-
}
|
| 672 |
-
}
|
| 673 |
-
}
|
| 674 |
-
|
| 675 |
-
return -1;
|
| 676 |
-
},
|
| 677 |
-
|
| 678 |
-
merge: function( first, second ) {
|
| 679 |
-
var l = second.length,
|
| 680 |
-
i = first.length,
|
| 681 |
-
j = 0;
|
| 682 |
-
|
| 683 |
-
if ( typeof l === "number" ) {
|
| 684 |
-
for ( ; j < l; j++ ) {
|
| 685 |
-
first[ i++ ] = second[ j ];
|
| 686 |
-
}
|
| 687 |
-
|
| 688 |
-
} else {
|
| 689 |
-
while ( second[j] !== undefined ) {
|
| 690 |
-
first[ i++ ] = second[ j++ ];
|
| 691 |
-
}
|
| 692 |
-
}
|
| 693 |
-
|
| 694 |
-
first.length = i;
|
| 695 |
-
|
| 696 |
-
return first;
|
| 697 |
-
},
|
| 698 |
-
|
| 699 |
-
grep: function( elems, callback, inv ) {
|
| 700 |
-
var retVal,
|
| 701 |
-
ret = [],
|
| 702 |
-
i = 0,
|
| 703 |
-
length = elems.length;
|
| 704 |
-
inv = !!inv;
|
| 705 |
-
|
| 706 |
-
// Go through the array, only saving the items
|
| 707 |
-
// that pass the validator function
|
| 708 |
-
for ( ; i < length; i++ ) {
|
| 709 |
-
retVal = !!callback( elems[ i ], i );
|
| 710 |
-
if ( inv !== retVal ) {
|
| 711 |
-
ret.push( elems[ i ] );
|
| 712 |
-
}
|
| 713 |
-
}
|
| 714 |
-
|
| 715 |
-
return ret;
|
| 716 |
-
},
|
| 717 |
-
|
| 718 |
-
// arg is for internal usage only
|
| 719 |
-
map: function( elems, callback, arg ) {
|
| 720 |
-
var value, key,
|
| 721 |
-
ret = [],
|
| 722 |
-
i = 0,
|
| 723 |
-
length = elems.length,
|
| 724 |
-
// jquery objects are treated as arrays
|
| 725 |
-
isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ;
|
| 726 |
-
|
| 727 |
-
// Go through the array, translating each of the items to their
|
| 728 |
-
if ( isArray ) {
|
| 729 |
-
for ( ; i < length; i++ ) {
|
| 730 |
-
value = callback( elems[ i ], i, arg );
|
| 731 |
-
|
| 732 |
-
if ( value != null ) {
|
| 733 |
-
ret[ ret.length ] = value;
|
| 734 |
-
}
|
| 735 |
-
}
|
| 736 |
-
|
| 737 |
-
// Go through every key on the object,
|
| 738 |
-
} else {
|
| 739 |
-
for ( key in elems ) {
|
| 740 |
-
value = callback( elems[ key ], key, arg );
|
| 741 |
-
|
| 742 |
-
if ( value != null ) {
|
| 743 |
-
ret[ ret.length ] = value;
|
| 744 |
-
}
|
| 745 |
-
}
|
| 746 |
-
}
|
| 747 |
-
|
| 748 |
-
// Flatten any nested arrays
|
| 749 |
-
return ret.concat.apply( [], ret );
|
| 750 |
-
},
|
| 751 |
-
|
| 752 |
-
// A global GUID counter for objects
|
| 753 |
-
guid: 1,
|
| 754 |
-
|
| 755 |
-
// Bind a function to a context, optionally partially applying any
|
| 756 |
-
// arguments.
|
| 757 |
-
proxy: function( fn, context ) {
|
| 758 |
-
var tmp, args, proxy;
|
| 759 |
-
|
| 760 |
-
if ( typeof context === "string" ) {
|
| 761 |
-
tmp = fn[ context ];
|
| 762 |
-
context = fn;
|
| 763 |
-
fn = tmp;
|
| 764 |
-
}
|
| 765 |
-
|
| 766 |
-
// Quick check to determine if target is callable, in the spec
|
| 767 |
-
// this throws a TypeError, but we will just return undefined.
|
| 768 |
-
if ( !jQuery.isFunction( fn ) ) {
|
| 769 |
-
return undefined;
|
| 770 |
-
}
|
| 771 |
-
|
| 772 |
-
// Simulated bind
|
| 773 |
-
args = core_slice.call( arguments, 2 );
|
| 774 |
-
proxy = function() {
|
| 775 |
-
return fn.apply( context, args.concat( core_slice.call( arguments ) ) );
|
| 776 |
-
};
|
| 777 |
-
|
| 778 |
-
// Set the guid of unique handler to the same of original handler, so it can be removed
|
| 779 |
-
proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++;
|
| 780 |
-
|
| 781 |
-
return proxy;
|
| 782 |
-
},
|
| 783 |
-
|
| 784 |
-
// Multifunctional method to get and set values of a collection
|
| 785 |
-
// The value/s can optionally be executed if it's a function
|
| 786 |
-
access: function( elems, fn, key, value, chainable, emptyGet, pass ) {
|
| 787 |
-
var exec,
|
| 788 |
-
bulk = key == null,
|
| 789 |
-
i = 0,
|
| 790 |
-
length = elems.length;
|
| 791 |
-
|
| 792 |
-
// Sets many values
|
| 793 |
-
if ( key && typeof key === "object" ) {
|
| 794 |
-
for ( i in key ) {
|
| 795 |
-
jQuery.access( elems, fn, i, key[i], 1, emptyGet, value );
|
| 796 |
-
}
|
| 797 |
-
chainable = 1;
|
| 798 |
-
|
| 799 |
-
// Sets one value
|
| 800 |
-
} else if ( value !== undefined ) {
|
| 801 |
-
// Optionally, function values get executed if exec is true
|
| 802 |
-
exec = pass === undefined && jQuery.isFunction( value );
|
| 803 |
-
|
| 804 |
-
if ( bulk ) {
|
| 805 |
-
// Bulk operations only iterate when executing function values
|
| 806 |
-
if ( exec ) {
|
| 807 |
-
exec = fn;
|
| 808 |
-
fn = function( elem, key, value ) {
|
| 809 |
-
return exec.call( jQuery( elem ), value );
|
| 810 |
-
};
|
| 811 |
-
|
| 812 |
-
// Otherwise they run against the entire set
|
| 813 |
-
} else {
|
| 814 |
-
fn.call( elems, value );
|
| 815 |
-
fn = null;
|
| 816 |
-
}
|
| 817 |
-
}
|
| 818 |
-
|
| 819 |
-
if ( fn ) {
|
| 820 |
-
for (; i < length; i++ ) {
|
| 821 |
-
fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass );
|
| 822 |
-
}
|
| 823 |
-
}
|
| 824 |
-
|
| 825 |
-
chainable = 1;
|
| 826 |
-
}
|
| 827 |
-
|
| 828 |
-
return chainable ?
|
| 829 |
-
elems :
|
| 830 |
-
|
| 831 |
-
// Gets
|
| 832 |
-
bulk ?
|
| 833 |
-
fn.call( elems ) :
|
| 834 |
-
length ? fn( elems[0], key ) : emptyGet;
|
| 835 |
-
},
|
| 836 |
-
|
| 837 |
-
now: function() {
|
| 838 |
-
return ( new Date() ).getTime();
|
| 839 |
-
}
|
| 840 |
-
});
|
| 841 |
-
|
| 842 |
-
jQuery.ready.promise = function( obj ) {
|
| 843 |
-
if ( !readyList ) {
|
| 844 |
-
|
| 845 |
-
readyList = jQuery.Deferred();
|
| 846 |
-
|
| 847 |
-
// Catch cases where $(document).ready() is called after the
|
| 848 |
-
// browser event has already occurred.
|
| 849 |
-
if ( document.readyState === "complete" || ( document.readyState !== "loading" && document.addEventListener ) ) {
|
| 850 |
-
// Handle it asynchronously to allow scripts the opportunity to delay ready
|
| 851 |
-
setTimeout( jQuery.ready, 1 );
|
| 852 |
-
|
| 853 |
-
// Standards-based browsers support DOMContentLoaded
|
| 854 |
-
} else if ( document.addEventListener ) {
|
| 855 |
-
// Use the handy event callback
|
| 856 |
-
document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false );
|
| 857 |
-
|
| 858 |
-
// A fallback to window.onload, that will always work
|
| 859 |
-
window.addEventListener( "load", jQuery.ready, false );
|
| 860 |
-
|
| 861 |
-
// If IE event model is used
|
| 862 |
-
} else {
|
| 863 |
-
// Ensure firing before onload, maybe late but safe also for iframes
|
| 864 |
-
document.attachEvent( "onreadystatechange", DOMContentLoaded );
|
| 865 |
-
|
| 866 |
-
// A fallback to window.onload, that will always work
|
| 867 |
-
window.attachEvent( "onload", jQuery.ready );
|
| 868 |
-
|
| 869 |
-
// If IE and not a frame
|
| 870 |
-
// continually check to see if the document is ready
|
| 871 |
-
var top = false;
|
| 872 |
-
|
| 873 |
-
try {
|
| 874 |
-
top = window.frameElement == null && document.documentElement;
|
| 875 |
-
} catch(e) {}
|
| 876 |
-
|
| 877 |
-
if ( top && top.doScroll ) {
|
| 878 |
-
(function doScrollCheck() {
|
| 879 |
-
if ( !jQuery.isReady ) {
|
| 880 |
-
|
| 881 |
-
try {
|
| 882 |
-
// Use the trick by Diego Perini
|
| 883 |
-
// http://javascript.nwbox.com/IEContentLoaded/
|
| 884 |
-
top.doScroll("left");
|
| 885 |
-
} catch(e) {
|
| 886 |
-
return setTimeout( doScrollCheck, 50 );
|
| 887 |
-
}
|
| 888 |
-
|
| 889 |
-
// and execute any waiting functions
|
| 890 |
-
jQuery.ready();
|
| 891 |
-
}
|
| 892 |
-
})();
|
| 893 |
-
}
|
| 894 |
-
}
|
| 895 |
-
}
|
| 896 |
-
return readyList.promise( obj );
|
| 897 |
-
};
|
| 898 |
-
|
| 899 |
-
// Populate the class2type map
|
| 900 |
-
jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) {
|
| 901 |
-
class2type[ "[object " + name + "]" ] = name.toLowerCase();
|
| 902 |
-
});
|
| 903 |
-
|
| 904 |
-
// All jQuery objects should point back to these
|
| 905 |
-
rootjQuery = jQuery(document);
|
| 906 |
-
// String to Object options format cache
|
| 907 |
-
var optionsCache = {};
|
| 908 |
-
|
| 909 |
-
// Convert String-formatted options into Object-formatted ones and store in cache
|
| 910 |
-
function createOptions( options ) {
|
| 911 |
-
var object = optionsCache[ options ] = {};
|
| 912 |
-
jQuery.each( options.split( core_rspace ), function( _, flag ) {
|
| 913 |
-
object[ flag ] = true;
|
| 914 |
-
});
|
| 915 |
-
return object;
|
| 916 |
-
}
|
| 917 |
-
|
| 918 |
-
/*
|
| 919 |
-
* Create a callback list using the following parameters:
|
| 920 |
-
*
|
| 921 |
-
* options: an optional list of space-separated options that will change how
|
| 922 |
-
* the callback list behaves or a more traditional option object
|
| 923 |
-
*
|
| 924 |
-
* By default a callback list will act like an event callback list and can be
|
| 925 |
-
* "fired" multiple times.
|
| 926 |
-
*
|
| 927 |
-
* Possible options:
|
| 928 |
-
*
|
| 929 |
-
* once: will ensure the callback list can only be fired once (like a Deferred)
|
| 930 |
-
*
|
| 931 |
-
* memory: will keep track of previous values and will call any callback added
|
| 932 |
-
* after the list has been fired right away with the latest "memorized"
|
| 933 |
-
* values (like a Deferred)
|
| 934 |
-
*
|
| 935 |
-
* unique: will ensure a callback can only be added once (no duplicate in the list)
|
| 936 |
-
*
|
| 937 |
-
* stopOnFalse: interrupt callings when a callback returns false
|
| 938 |
-
*
|
| 939 |
-
*/
|
| 940 |
-
jQuery.Callbacks = function( options ) {
|
| 941 |
-
|
| 942 |
-
// Convert options from String-formatted to Object-formatted if needed
|
| 943 |
-
// (we check in cache first)
|
| 944 |
-
options = typeof options === "string" ?
|
| 945 |
-
( optionsCache[ options ] || createOptions( options ) ) :
|
| 946 |
-
jQuery.extend( {}, options );
|
| 947 |
-
|
| 948 |
-
var // Last fire value (for non-forgettable lists)
|
| 949 |
-
memory,
|
| 950 |
-
// Flag to know if list was already fired
|
| 951 |
-
fired,
|
| 952 |
-
// Flag to know if list is currently firing
|
| 953 |
-
firing,
|
| 954 |
-
// First callback to fire (used internally by add and fireWith)
|
| 955 |
-
firingStart,
|
| 956 |
-
// End of the loop when firing
|
| 957 |
-
firingLength,
|
| 958 |
-
// Index of currently firing callback (modified by remove if needed)
|
| 959 |
-
firingIndex,
|
| 960 |
-
// Actual callback list
|
| 961 |
-
list = [],
|
| 962 |
-
// Stack of fire calls for repeatable lists
|
| 963 |
-
stack = !options.once && [],
|
| 964 |
-
// Fire callbacks
|
| 965 |
-
fire = function( data ) {
|
| 966 |
-
memory = options.memory && data;
|
| 967 |
-
fired = true;
|
| 968 |
-
firingIndex = firingStart || 0;
|
| 969 |
-
firingStart = 0;
|
| 970 |
-
firingLength = list.length;
|
| 971 |
-
firing = true;
|
| 972 |
-
for ( ; list && firingIndex < firingLength; firingIndex++ ) {
|
| 973 |
-
if ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) {
|
| 974 |
-
memory = false; // To prevent further calls using add
|
| 975 |
-
break;
|
| 976 |
-
}
|
| 977 |
-
}
|
| 978 |
-
firing = false;
|
| 979 |
-
if ( list ) {
|
| 980 |
-
if ( stack ) {
|
| 981 |
-
if ( stack.length ) {
|
| 982 |
-
fire( stack.shift() );
|
| 983 |
-
}
|
| 984 |
-
} else if ( memory ) {
|
| 985 |
-
list = [];
|
| 986 |
-
} else {
|
| 987 |
-
self.disable();
|
| 988 |
-
}
|
| 989 |
-
}
|
| 990 |
-
},
|
| 991 |
-
// Actual Callbacks object
|
| 992 |
-
self = {
|
| 993 |
-
// Add a callback or a collection of callbacks to the list
|
| 994 |
-
add: function() {
|
| 995 |
-
if ( list ) {
|
| 996 |
-
// First, we save the current length
|
| 997 |
-
var start = list.length;
|
| 998 |
-
(function add( args ) {
|
| 999 |
-
jQuery.each( args, function( _, arg ) {
|
| 1000 |
-
if ( jQuery.isFunction( arg ) && ( !options.unique || !self.has( arg ) ) ) {
|
| 1001 |
-
list.push( arg );
|
| 1002 |
-
} else if ( arg && arg.length ) {
|
| 1003 |
-
// Inspect recursively
|
| 1004 |
-
add( arg );
|
| 1005 |
-
}
|
| 1006 |
-
});
|
| 1007 |
-
})( arguments );
|
| 1008 |
-
// Do we need to add the callbacks to the
|
| 1009 |
-
// current firing batch?
|
| 1010 |
-
if ( firing ) {
|
| 1011 |
-
firingLength = list.length;
|
| 1012 |
-
// With memory, if we're not firing then
|
| 1013 |
-
// we should call right away
|
| 1014 |
-
} else if ( memory ) {
|
| 1015 |
-
firingStart = start;
|
| 1016 |
-
fire( memory );
|
| 1017 |
-
}
|
| 1018 |
-
}
|
| 1019 |
-
return this;
|
| 1020 |
-
},
|
| 1021 |
-
// Remove a callback from the list
|
| 1022 |
-
remove: function() {
|
| 1023 |
-
if ( list ) {
|
| 1024 |
-
jQuery.each( arguments, function( _, arg ) {
|
| 1025 |
-
var index;
|
| 1026 |
-
while( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {
|
| 1027 |
-
list.splice( index, 1 );
|
| 1028 |
-
// Handle firing indexes
|
| 1029 |
-
if ( firing ) {
|
| 1030 |
-
if ( index <= firingLength ) {
|
| 1031 |
-
firingLength--;
|
| 1032 |
-
}
|
| 1033 |
-
if ( index <= firingIndex ) {
|
| 1034 |
-
firingIndex--;
|
| 1035 |
-
}
|
| 1036 |
-
}
|
| 1037 |
-
}
|
| 1038 |
-
});
|
| 1039 |
-
}
|
| 1040 |
-
return this;
|
| 1041 |
-
},
|
| 1042 |
-
// Control if a given callback is in the list
|
| 1043 |
-
has: function( fn ) {
|
| 1044 |
-
return jQuery.inArray( fn, list ) > -1;
|
| 1045 |
-
},
|
| 1046 |
-
// Remove all callbacks from the list
|
| 1047 |
-
empty: function() {
|
| 1048 |
-
list = [];
|
| 1049 |
-
return this;
|
| 1050 |
-
},
|
| 1051 |
-
// Have the list do nothing anymore
|
| 1052 |
-
disable: function() {
|
| 1053 |
-
list = stack = memory = undefined;
|
| 1054 |
-
return this;
|
| 1055 |
-
},
|
| 1056 |
-
// Is it disabled?
|
| 1057 |
-
disabled: function() {
|
| 1058 |
-
return !list;
|
| 1059 |
-
},
|
| 1060 |
-
// Lock the list in its current state
|
| 1061 |
-
lock: function() {
|
| 1062 |
-
stack = undefined;
|
| 1063 |
-
if ( !memory ) {
|
| 1064 |
-
self.disable();
|
| 1065 |
-
}
|
| 1066 |
-
return this;
|
| 1067 |
-
},
|
| 1068 |
-
// Is it locked?
|
| 1069 |
-
locked: function() {
|
| 1070 |
-
return !stack;
|
| 1071 |
-
},
|
| 1072 |
-
// Call all callbacks with the given context and arguments
|
| 1073 |
-
fireWith: function( context, args ) {
|
| 1074 |
-
args = args || [];
|
| 1075 |
-
args = [ context, args.slice ? args.slice() : args ];
|
| 1076 |
-
if ( list && ( !fired || stack ) ) {
|
| 1077 |
-
if ( firing ) {
|
| 1078 |
-
stack.push( args );
|
| 1079 |
-
} else {
|
| 1080 |
-
fire( args );
|
| 1081 |
-
}
|
| 1082 |
-
}
|
| 1083 |
-
return this;
|
| 1084 |
-
},
|
| 1085 |
-
// Call all the callbacks with the given arguments
|
| 1086 |
-
fire: function() {
|
| 1087 |
-
self.fireWith( this, arguments );
|
| 1088 |
-
return this;
|
| 1089 |
-
},
|
| 1090 |
-
// To know if the callbacks have already been called at least once
|
| 1091 |
-
fired: function() {
|
| 1092 |
-
return !!fired;
|
| 1093 |
-
}
|
| 1094 |
-
};
|
| 1095 |
-
|
| 1096 |
-
return self;
|
| 1097 |
-
};
|
| 1098 |
-
jQuery.extend({
|
| 1099 |
-
|
| 1100 |
-
Deferred: function( func ) {
|
| 1101 |
-
var tuples = [
|
| 1102 |
-
// action, add listener, listener list, final state
|
| 1103 |
-
[ "resolve", "done", jQuery.Callbacks("once memory"), "resolved" ],
|
| 1104 |
-
[ "reject", "fail", jQuery.Callbacks("once memory"), "rejected" ],
|
| 1105 |
-
[ "notify", "progress", jQuery.Callbacks("memory") ]
|
| 1106 |
-
],
|
| 1107 |
-
state = "pending",
|
| 1108 |
-
promise = {
|
| 1109 |
-
state: function() {
|
| 1110 |
-
return state;
|
| 1111 |
-
},
|
| 1112 |
-
always: function() {
|
| 1113 |
-
deferred.done( arguments ).fail( arguments );
|
| 1114 |
-
return this;
|
| 1115 |
-
},
|
| 1116 |
-
then: function( /* fnDone, fnFail, fnProgress */ ) {
|
| 1117 |
-
var fns = arguments;
|
| 1118 |
-
return jQuery.Deferred(function( newDefer ) {
|
| 1119 |
-
jQuery.each( tuples, function( i, tuple ) {
|
| 1120 |
-
var action = tuple[ 0 ],
|
| 1121 |
-
fn = fns[ i ];
|
| 1122 |
-
// deferred[ done | fail | progress ] for forwarding actions to newDefer
|
| 1123 |
-
deferred[ tuple[1] ]( jQuery.isFunction( fn ) ?
|
| 1124 |
-
function() {
|
| 1125 |
-
var returned = fn.apply( this, arguments );
|
| 1126 |
-
if ( returned && jQuery.isFunction( returned.promise ) ) {
|
| 1127 |
-
returned.promise()
|
| 1128 |
-
.done( newDefer.resolve )
|
| 1129 |
-
.fail( newDefer.reject )
|
| 1130 |
-
.progress( newDefer.notify );
|
| 1131 |
-
} else {
|
| 1132 |
-
newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] );
|
| 1133 |
-
}
|
| 1134 |
-
} :
|
| 1135 |
-
newDefer[ action ]
|
| 1136 |
-
);
|
| 1137 |
-
});
|
| 1138 |
-
fns = null;
|
| 1139 |
-
}).promise();
|
| 1140 |
-
},
|
| 1141 |
-
// Get a promise for this deferred
|
| 1142 |
-
// If obj is provided, the promise aspect is added to the object
|
| 1143 |
-
promise: function( obj ) {
|
| 1144 |
-
return typeof obj === "object" ? jQuery.extend( obj, promise ) : promise;
|
| 1145 |
-
}
|
| 1146 |
-
},
|
| 1147 |
-
deferred = {};
|
| 1148 |
-
|
| 1149 |
-
// Keep pipe for back-compat
|
| 1150 |
-
promise.pipe = promise.then;
|
| 1151 |
-
|
| 1152 |
-
// Add list-specific methods
|
| 1153 |
-
jQuery.each( tuples, function( i, tuple ) {
|
| 1154 |
-
var list = tuple[ 2 ],
|
| 1155 |
-
stateString = tuple[ 3 ];
|
| 1156 |
-
|
| 1157 |
-
// promise[ done | fail | progress ] = list.add
|
| 1158 |
-
promise[ tuple[1] ] = list.add;
|
| 1159 |
-
|
| 1160 |
-
// Handle state
|
| 1161 |
-
if ( stateString ) {
|
| 1162 |
-
list.add(function() {
|
| 1163 |
-
// state = [ resolved | rejected ]
|
| 1164 |
-
state = stateString;
|
| 1165 |
-
|
| 1166 |
-
// [ reject_list | resolve_list ].disable; progress_list.lock
|
| 1167 |
-
}, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock );
|
| 1168 |
-
}
|
| 1169 |
-
|
| 1170 |
-
// deferred[ resolve | reject | notify ] = list.fire
|
| 1171 |
-
deferred[ tuple[0] ] = list.fire;
|
| 1172 |
-
deferred[ tuple[0] + "With" ] = list.fireWith;
|
| 1173 |
-
});
|
| 1174 |
-
|
| 1175 |
-
// Make the deferred a promise
|
| 1176 |
-
promise.promise( deferred );
|
| 1177 |
-
|
| 1178 |
-
// Call given func if any
|
| 1179 |
-
if ( func ) {
|
| 1180 |
-
func.call( deferred, deferred );
|
| 1181 |
-
}
|
| 1182 |
-
|
| 1183 |
-
// All done!
|
| 1184 |
-
return deferred;
|
| 1185 |
-
},
|
| 1186 |
-
|
| 1187 |
-
// Deferred helper
|
| 1188 |
-
when: function( subordinate /* , ..., subordinateN */ ) {
|
| 1189 |
-
var i = 0,
|
| 1190 |
-
resolveValues = core_slice.call( arguments ),
|
| 1191 |
-
length = resolveValues.length,
|
| 1192 |
-
|
| 1193 |
-
// the count of uncompleted subordinates
|
| 1194 |
-
remaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0,
|
| 1195 |
-
|
| 1196 |
-
// the master Deferred. If resolveValues consist of only a single Deferred, just use that.
|
| 1197 |
-
deferred = remaining === 1 ? subordinate : jQuery.Deferred(),
|
| 1198 |
-
|
| 1199 |
-
// Update function for both resolve and progress values
|
| 1200 |
-
updateFunc = function( i, contexts, values ) {
|
| 1201 |
-
return function( value ) {
|
| 1202 |
-
contexts[ i ] = this;
|
| 1203 |
-
values[ i ] = arguments.length > 1 ? core_slice.call( arguments ) : value;
|
| 1204 |
-
if( values === progressValues ) {
|
| 1205 |
-
deferred.notifyWith( contexts, values );
|
| 1206 |
-
} else if ( !( --remaining ) ) {
|
| 1207 |
-
deferred.resolveWith( contexts, values );
|
| 1208 |
-
}
|
| 1209 |
-
};
|
| 1210 |
-
},
|
| 1211 |
-
|
| 1212 |
-
progressValues, progressContexts, resolveContexts;
|
| 1213 |
-
|
| 1214 |
-
// add listeners to Deferred subordinates; treat others as resolved
|
| 1215 |
-
if ( length > 1 ) {
|
| 1216 |
-
progressValues = new Array( length );
|
| 1217 |
-
progressContexts = new Array( length );
|
| 1218 |
-
resolveContexts = new Array( length );
|
| 1219 |
-
for ( ; i < length; i++ ) {
|
| 1220 |
-
if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) {
|
| 1221 |
-
resolveValues[ i ].promise()
|
| 1222 |
-
.done( updateFunc( i, resolveContexts, resolveValues ) )
|
| 1223 |
-
.fail( deferred.reject )
|
| 1224 |
-
.progress( updateFunc( i, progressContexts, progressValues ) );
|
| 1225 |
-
} else {
|
| 1226 |
-
--remaining;
|
| 1227 |
-
}
|
| 1228 |
-
}
|
| 1229 |
-
}
|
| 1230 |
-
|
| 1231 |
-
// if we're not waiting on anything, resolve the master
|
| 1232 |
-
if ( !remaining ) {
|
| 1233 |
-
deferred.resolveWith( resolveContexts, resolveValues );
|
| 1234 |
-
}
|
| 1235 |
-
|
| 1236 |
-
return deferred.promise();
|
| 1237 |
-
}
|
| 1238 |
-
});
|
| 1239 |
-
jQuery.support = (function() {
|
| 1240 |
-
|
| 1241 |
-
var support,
|
| 1242 |
-
all,
|
| 1243 |
-
a,
|
| 1244 |
-
select,
|
| 1245 |
-
opt,
|
| 1246 |
-
input,
|
| 1247 |
-
fragment,
|
| 1248 |
-
eventName,
|
| 1249 |
-
i,
|
| 1250 |
-
isSupported,
|
| 1251 |
-
clickFn,
|
| 1252 |
-
div = document.createElement("div");
|
| 1253 |
-
|
| 1254 |
-
// Preliminary tests
|
| 1255 |
-
div.setAttribute( "className", "t" );
|
| 1256 |
-
div.innerHTML = " <link/><table></table><a href='/a'>a</a><input type='checkbox'/>";
|
| 1257 |
-
|
| 1258 |
-
all = div.getElementsByTagName("*");
|
| 1259 |
-
a = div.getElementsByTagName("a")[ 0 ];
|
| 1260 |
-
a.style.cssText = "top:1px;float:left;opacity:.5";
|
| 1261 |
-
|
| 1262 |
-
// Can't get basic test support
|
| 1263 |
-
if ( !all || !all.length || !a ) {
|
| 1264 |
-
return {};
|
| 1265 |
-
}
|
| 1266 |
-
|
| 1267 |
-
// First batch of supports tests
|
| 1268 |
-
select = document.createElement("select");
|
| 1269 |
-
opt = select.appendChild( document.createElement("option") );
|
| 1270 |
-
input = div.getElementsByTagName("input")[ 0 ];
|
| 1271 |
-
|
| 1272 |
-
support = {
|
| 1273 |
-
// IE strips leading whitespace when .innerHTML is used
|
| 1274 |
-
leadingWhitespace: ( div.firstChild.nodeType === 3 ),
|
| 1275 |
-
|
| 1276 |
-
// Make sure that tbody elements aren't automatically inserted
|
| 1277 |
-
// IE will insert them into empty tables
|
| 1278 |
-
tbody: !div.getElementsByTagName("tbody").length,
|
| 1279 |
-
|
| 1280 |
-
// Make sure that link elements get serialized correctly by innerHTML
|
| 1281 |
-
// This requires a wrapper element in IE
|
| 1282 |
-
htmlSerialize: !!div.getElementsByTagName("link").length,
|
| 1283 |
-
|
| 1284 |
-
// Get the style information from getAttribute
|
| 1285 |
-
// (IE uses .cssText instead)
|
| 1286 |
-
style: /top/.test( a.getAttribute("style") ),
|
| 1287 |
-
|
| 1288 |
-
// Make sure that URLs aren't manipulated
|
| 1289 |
-
// (IE normalizes it by default)
|
| 1290 |
-
hrefNormalized: ( a.getAttribute("href") === "/a" ),
|
| 1291 |
-
|
| 1292 |
-
// Make sure that element opacity exists
|
| 1293 |
-
// (IE uses filter instead)
|
| 1294 |
-
// Use a regex to work around a WebKit issue. See #5145
|
| 1295 |
-
opacity: /^0.5/.test( a.style.opacity ),
|
| 1296 |
-
|
| 1297 |
-
// Verify style float existence
|
| 1298 |
-
// (IE uses styleFloat instead of cssFloat)
|
| 1299 |
-
cssFloat: !!a.style.cssFloat,
|
| 1300 |
-
|
| 1301 |
-
// Make sure that if no value is specified for a checkbox
|
| 1302 |
-
// that it defaults to "on".
|
| 1303 |
-
// (WebKit defaults to "" instead)
|
| 1304 |
-
checkOn: ( input.value === "on" ),
|
| 1305 |
-
|
| 1306 |
-
// Make sure that a selected-by-default option has a working selected property.
|
| 1307 |
-
// (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
|
| 1308 |
-
optSelected: opt.selected,
|
| 1309 |
-
|
| 1310 |
-
// Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7)
|
| 1311 |
-
getSetAttribute: div.className !== "t",
|
| 1312 |
-
|
| 1313 |
-
// Tests for enctype support on a form(#6743)
|
| 1314 |
-
enctype: !!document.createElement("form").enctype,
|
| 1315 |
-
|
| 1316 |
-
// Makes sure cloning an html5 element does not cause problems
|
| 1317 |
-
// Where outerHTML is undefined, this still works
|
| 1318 |
-
html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav></:nav>",
|
| 1319 |
-
|
| 1320 |
-
// jQuery.support.boxModel DEPRECATED in 1.8 since we don't support Quirks Mode
|
| 1321 |
-
boxModel: ( document.compatMode === "CSS1Compat" ),
|
| 1322 |
-
|
| 1323 |
-
// Will be defined later
|
| 1324 |
-
submitBubbles: true,
|
| 1325 |
-
changeBubbles: true,
|
| 1326 |
-
focusinBubbles: false,
|
| 1327 |
-
deleteExpando: true,
|
| 1328 |
-
noCloneEvent: true,
|
| 1329 |
-
inlineBlockNeedsLayout: false,
|
| 1330 |
-
shrinkWrapBlocks: false,
|
| 1331 |
-
reliableMarginRight: true,
|
| 1332 |
-
boxSizingReliable: true,
|
| 1333 |
-
pixelPosition: false
|
| 1334 |
-
};
|
| 1335 |
-
|
| 1336 |
-
// Make sure checked status is properly cloned
|
| 1337 |
-
input.checked = true;
|
| 1338 |
-
support.noCloneChecked = input.cloneNode( true ).checked;
|
| 1339 |
-
|
| 1340 |
-
// Make sure that the options inside disabled selects aren't marked as disabled
|
| 1341 |
-
// (WebKit marks them as disabled)
|
| 1342 |
-
select.disabled = true;
|
| 1343 |
-
support.optDisabled = !opt.disabled;
|
| 1344 |
-
|
| 1345 |
-
// Test to see if it's possible to delete an expando from an element
|
| 1346 |
-
// Fails in Internet Explorer
|
| 1347 |
-
try {
|
| 1348 |
-
delete div.test;
|
| 1349 |
-
} catch( e ) {
|
| 1350 |
-
support.deleteExpando = false;
|
| 1351 |
-
}
|
| 1352 |
-
|
| 1353 |
-
if ( !div.addEventListener && div.attachEvent && div.fireEvent ) {
|
| 1354 |
-
div.attachEvent( "onclick", clickFn = function() {
|
| 1355 |
-
// Cloning a node shouldn't copy over any
|
| 1356 |
-
// bound event handlers (IE does this)
|
| 1357 |
-
support.noCloneEvent = false;
|
| 1358 |
-
});
|
| 1359 |
-
div.cloneNode( true ).fireEvent("onclick");
|
| 1360 |
-
div.detachEvent( "onclick", clickFn );
|
| 1361 |
-
}
|
| 1362 |
-
|
| 1363 |
-
// Check if a radio maintains its value
|
| 1364 |
-
// after being appended to the DOM
|
| 1365 |
-
input = document.createElement("input");
|
| 1366 |
-
input.value = "t";
|
| 1367 |
-
input.setAttribute( "type", "radio" );
|
| 1368 |
-
support.radioValue = input.value === "t";
|
| 1369 |
-
|
| 1370 |
-
input.setAttribute( "checked", "checked" );
|
| 1371 |
-
|
| 1372 |
-
// #11217 - WebKit loses check when the name is after the checked attribute
|
| 1373 |
-
input.setAttribute( "name", "t" );
|
| 1374 |
-
|
| 1375 |
-
div.appendChild( input );
|
| 1376 |
-
fragment = document.createDocumentFragment();
|
| 1377 |
-
fragment.appendChild( div.lastChild );
|
| 1378 |
-
|
| 1379 |
-
// WebKit doesn't clone checked state correctly in fragments
|
| 1380 |
-
support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked;
|
| 1381 |
-
|
| 1382 |
-
// Check if a disconnected checkbox will retain its checked
|
| 1383 |
-
// value of true after appended to the DOM (IE6/7)
|
| 1384 |
-
support.appendChecked = input.checked;
|
| 1385 |
-
|
| 1386 |
-
fragment.removeChild( input );
|
| 1387 |
-
fragment.appendChild( div );
|
| 1388 |
-
|
| 1389 |
-
// Technique from Juriy Zaytsev
|
| 1390 |
-
// http://perfectionkills.com/detecting-event-support-without-browser-sniffing/
|
| 1391 |
-
// We only care about the case where non-standard event systems
|
| 1392 |
-
// are used, namely in IE. Short-circuiting here helps us to
|
| 1393 |
-
// avoid an eval call (in setAttribute) which can cause CSP
|
| 1394 |
-
// to go haywire. See: https://developer.mozilla.org/en/Security/CSP
|
| 1395 |
-
if ( div.attachEvent ) {
|
| 1396 |
-
for ( i in {
|
| 1397 |
-
submit: true,
|
| 1398 |
-
change: true,
|
| 1399 |
-
focusin: true
|
| 1400 |
-
}) {
|
| 1401 |
-
eventName = "on" + i;
|
| 1402 |
-
isSupported = ( eventName in div );
|
| 1403 |
-
if ( !isSupported ) {
|
| 1404 |
-
div.setAttribute( eventName, "return;" );
|
| 1405 |
-
isSupported = ( typeof div[ eventName ] === "function" );
|
| 1406 |
-
}
|
| 1407 |
-
support[ i + "Bubbles" ] = isSupported;
|
| 1408 |
-
}
|
| 1409 |
-
}
|
| 1410 |
-
|
| 1411 |
-
// Run tests that need a body at doc ready
|
| 1412 |
-
jQuery(function() {
|
| 1413 |
-
var container, div, tds, marginDiv,
|
| 1414 |
-
divReset = "padding:0;margin:0;border:0;display:block;overflow:hidden;",
|
| 1415 |
-
body = document.getElementsByTagName("body")[0];
|
| 1416 |
-
|
| 1417 |
-
if ( !body ) {
|
| 1418 |
-
// Return for frameset docs that don't have a body
|
| 1419 |
-
return;
|
| 1420 |
-
}
|
| 1421 |
-
|
| 1422 |
-
container = document.createElement("div");
|
| 1423 |
-
container.style.cssText = "visibility:hidden;border:0;width:0;height:0;position:static;top:0;margin-top:1px";
|
| 1424 |
-
body.insertBefore( container, body.firstChild );
|
| 1425 |
-
|
| 1426 |
-
// Construct the test element
|
| 1427 |
-
div = document.createElement("div");
|
| 1428 |
-
container.appendChild( div );
|
| 1429 |
-
|
| 1430 |
-
// Check if table cells still have offsetWidth/Height when they are set
|
| 1431 |
-
// to display:none and there are still other visible table cells in a
|
| 1432 |
-
// table row; if so, offsetWidth/Height are not reliable for use when
|
| 1433 |
-
// determining if an element has been hidden directly using
|
| 1434 |
-
// display:none (it is still safe to use offsets if a parent element is
|
| 1435 |
-
// hidden; don safety goggles and see bug #4512 for more information).
|
| 1436 |
-
// (only IE 8 fails this test)
|
| 1437 |
-
div.innerHTML = "<table><tr><td></td><td>t</td></tr></table>";
|
| 1438 |
-
tds = div.getElementsByTagName("td");
|
| 1439 |
-
tds[ 0 ].style.cssText = "padding:0;margin:0;border:0;display:none";
|
| 1440 |
-
isSupported = ( tds[ 0 ].offsetHeight === 0 );
|
| 1441 |
-
|
| 1442 |
-
tds[ 0 ].style.display = "";
|
| 1443 |
-
tds[ 1 ].style.display = "none";
|
| 1444 |
-
|
| 1445 |
-
// Check if empty table cells still have offsetWidth/Height
|
| 1446 |
-
// (IE <= 8 fail this test)
|
| 1447 |
-
support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 );
|
| 1448 |
-
|
| 1449 |
-
// Check box-sizing and margin behavior
|
| 1450 |
-
div.innerHTML = "";
|
| 1451 |
-
div.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;";
|
| 1452 |
-
support.boxSizing = ( div.offsetWidth === 4 );
|
| 1453 |
-
support.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== 1 );
|
| 1454 |
-
|
| 1455 |
-
// NOTE: To any future maintainer, window.getComputedStyle was used here
|
| 1456 |
-
// instead of getComputedStyle because it gave a better gzip size.
|
| 1457 |
-
// The difference between window.getComputedStyle and getComputedStyle is
|
| 1458 |
-
// 7 bytes
|
| 1459 |
-
if ( window.getComputedStyle ) {
|
| 1460 |
-
support.pixelPosition = ( window.getComputedStyle( div, null ) || {} ).top !== "1%";
|
| 1461 |
-
support.boxSizingReliable = ( window.getComputedStyle( div, null ) || { width: "4px" } ).width === "4px";
|
| 1462 |
-
|
| 1463 |
-
// Check if div with explicit width and no margin-right incorrectly
|
| 1464 |
-
// gets computed margin-right based on width of container. For more
|
| 1465 |
-
// info see bug #3333
|
| 1466 |
-
// Fails in WebKit before Feb 2011 nightlies
|
| 1467 |
-
// WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
|
| 1468 |
-
marginDiv = document.createElement("div");
|
| 1469 |
-
marginDiv.style.cssText = div.style.cssText = divReset;
|
| 1470 |
-
marginDiv.style.marginRight = marginDiv.style.width = "0";
|
| 1471 |
-
div.style.width = "1px";
|
| 1472 |
-
div.appendChild( marginDiv );
|
| 1473 |
-
support.reliableMarginRight =
|
| 1474 |
-
!parseFloat( ( window.getComputedStyle( marginDiv, null ) || {} ).marginRight );
|
| 1475 |
-
}
|
| 1476 |
-
|
| 1477 |
-
if ( typeof div.style.zoom !== "undefined" ) {
|
| 1478 |
-
// Check if natively block-level elements act like inline-block
|
| 1479 |
-
// elements when setting their display to 'inline' and giving
|
| 1480 |
-
// them layout
|
| 1481 |
-
// (IE < 8 does this)
|
| 1482 |
-
div.innerHTML = "";
|
| 1483 |
-
div.style.cssText = divReset + "width:1px;padding:1px;display:inline;zoom:1";
|
| 1484 |
-
support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 );
|
| 1485 |
-
|
| 1486 |
-
// Check if elements with layout shrink-wrap their children
|
| 1487 |
-
// (IE 6 does this)
|
| 1488 |
-
div.style.display = "block";
|
| 1489 |
-
div.style.overflow = "visible";
|
| 1490 |
-
div.innerHTML = "<div></div>";
|
| 1491 |
-
div.firstChild.style.width = "5px";
|
| 1492 |
-
support.shrinkWrapBlocks = ( div.offsetWidth !== 3 );
|
| 1493 |
-
|
| 1494 |
-
container.style.zoom = 1;
|
| 1495 |
-
}
|
| 1496 |
-
|
| 1497 |
-
// Null elements to avoid leaks in IE
|
| 1498 |
-
body.removeChild( container );
|
| 1499 |
-
container = div = tds = marginDiv = null;
|
| 1500 |
-
});
|
| 1501 |
-
|
| 1502 |
-
// Null elements to avoid leaks in IE
|
| 1503 |
-
fragment.removeChild( div );
|
| 1504 |
-
all = a = select = opt = input = fragment = div = null;
|
| 1505 |
-
|
| 1506 |
-
return support;
|
| 1507 |
-
})();
|
| 1508 |
-
var rbrace = /^(?:\{.*\}|\[.*\])$/,
|
| 1509 |
-
rmultiDash = /([A-Z])/g;
|
| 1510 |
-
|
| 1511 |
-
jQuery.extend({
|
| 1512 |
-
cache: {},
|
| 1513 |
-
|
| 1514 |
-
deletedIds: [],
|
| 1515 |
-
|
| 1516 |
-
// Please use with caution
|
| 1517 |
-
uuid: 0,
|
| 1518 |
-
|
| 1519 |
-
// Unique for each copy of jQuery on the page
|
| 1520 |
-
// Non-digits removed to match rinlinejQuery
|
| 1521 |
-
expando: "sQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ),
|
| 1522 |
-
|
| 1523 |
-
// The following elements throw uncatchable exceptions if you
|
| 1524 |
-
// attempt to add expando properties to them.
|
| 1525 |
-
noData: {
|
| 1526 |
-
"embed": true,
|
| 1527 |
-
// Ban all objects except for Flash (which handle expandos)
|
| 1528 |
-
"object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",
|
| 1529 |
-
"applet": true
|
| 1530 |
-
},
|
| 1531 |
-
|
| 1532 |
-
hasData: function( elem ) {
|
| 1533 |
-
elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ];
|
| 1534 |
-
return !!elem && !isEmptyDataObject( elem );
|
| 1535 |
-
},
|
| 1536 |
-
|
| 1537 |
-
data: function( elem, name, data, pvt /* Internal Use Only */ ) {
|
| 1538 |
-
if ( !jQuery.acceptData( elem ) ) {
|
| 1539 |
-
return;
|
| 1540 |
-
}
|
| 1541 |
-
|
| 1542 |
-
var thisCache, ret,
|
| 1543 |
-
internalKey = jQuery.expando,
|
| 1544 |
-
getByName = typeof name === "string",
|
| 1545 |
-
|
| 1546 |
-
// We have to handle DOM nodes and JS objects differently because IE6-7
|
| 1547 |
-
// can't GC object references properly across the DOM-JS boundary
|
| 1548 |
-
isNode = elem.nodeType,
|
| 1549 |
-
|
| 1550 |
-
// Only DOM nodes need the global jQuery cache; JS object data is
|
| 1551 |
-
// attached directly to the object so GC can occur automatically
|
| 1552 |
-
cache = isNode ? jQuery.cache : elem,
|
| 1553 |
-
|
| 1554 |
-
// Only defining an ID for JS objects if its cache already exists allows
|
| 1555 |
-
// the code to shortcut on the same path as a DOM node with no cache
|
| 1556 |
-
id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey;
|
| 1557 |
-
|
| 1558 |
-
// Avoid doing any more work than we need to when trying to get data on an
|
| 1559 |
-
// object that has no data at all
|
| 1560 |
-
if ( (!id || !cache[id] || (!pvt && !cache[id].data)) && getByName && data === undefined ) {
|
| 1561 |
-
return;
|
| 1562 |
-
}
|
| 1563 |
-
|
| 1564 |
-
if ( !id ) {
|
| 1565 |
-
// Only DOM nodes need a new unique ID for each element since their data
|
| 1566 |
-
// ends up in the global cache
|
| 1567 |
-
if ( isNode ) {
|
| 1568 |
-
elem[ internalKey ] = id = jQuery.deletedIds.pop() || ++jQuery.uuid;
|
| 1569 |
-
} else {
|
| 1570 |
-
id = internalKey;
|
| 1571 |
-
}
|
| 1572 |
-
}
|
| 1573 |
-
|
| 1574 |
-
if ( !cache[ id ] ) {
|
| 1575 |
-
cache[ id ] = {};
|
| 1576 |
-
|
| 1577 |
-
// Avoids exposing jQuery metadata on plain JS objects when the object
|
| 1578 |
-
// is serialized using JSON.stringify
|
| 1579 |
-
if ( !isNode ) {
|
| 1580 |
-
cache[ id ].toJSON = jQuery.noop;
|
| 1581 |
-
}
|
| 1582 |
-
}
|
| 1583 |
-
|
| 1584 |
-
// An object can be passed to jQuery.data instead of a key/value pair; this gets
|
| 1585 |
-
// shallow copied over onto the existing cache
|
| 1586 |
-
if ( typeof name === "object" || typeof name === "function" ) {
|
| 1587 |
-
if ( pvt ) {
|
| 1588 |
-
cache[ id ] = jQuery.extend( cache[ id ], name );
|
| 1589 |
-
} else {
|
| 1590 |
-
cache[ id ].data = jQuery.extend( cache[ id ].data, name );
|
| 1591 |
-
}
|
| 1592 |
-
}
|
| 1593 |
-
|
| 1594 |
-
thisCache = cache[ id ];
|
| 1595 |
-
|
| 1596 |
-
// jQuery data() is stored in a separate object inside the object's internal data
|
| 1597 |
-
// cache in order to avoid key collisions between internal data and user-defined
|
| 1598 |
-
// data.
|
| 1599 |
-
if ( !pvt ) {
|
| 1600 |
-
if ( !thisCache.data ) {
|
| 1601 |
-
thisCache.data = {};
|
| 1602 |
-
}
|
| 1603 |
-
|
| 1604 |
-
thisCache = thisCache.data;
|
| 1605 |
-
}
|
| 1606 |
-
|
| 1607 |
-
if ( data !== undefined ) {
|
| 1608 |
-
thisCache[ jQuery.camelCase( name ) ] = data;
|
| 1609 |
-
}
|
| 1610 |
-
|
| 1611 |
-
// Check for both converted-to-camel and non-converted data property names
|
| 1612 |
-
// If a data property was specified
|
| 1613 |
-
if ( getByName ) {
|
| 1614 |
-
|
| 1615 |
-
// First Try to find as-is property data
|
| 1616 |
-
ret = thisCache[ name ];
|
| 1617 |
-
|
| 1618 |
-
// Test for null|undefined property data
|
| 1619 |
-
if ( ret == null ) {
|
| 1620 |
-
|
| 1621 |
-
// Try to find the camelCased property
|
| 1622 |
-
ret = thisCache[ jQuery.camelCase( name ) ];
|
| 1623 |
-
}
|
| 1624 |
-
} else {
|
| 1625 |
-
ret = thisCache;
|
| 1626 |
-
}
|
| 1627 |
-
|
| 1628 |
-
return ret;
|
| 1629 |
-
},
|
| 1630 |
-
|
| 1631 |
-
removeData: function( elem, name, pvt /* Internal Use Only */ ) {
|
| 1632 |
-
if ( !jQuery.acceptData( elem ) ) {
|
| 1633 |
-
return;
|
| 1634 |
-
}
|
| 1635 |
-
|
| 1636 |
-
var thisCache, i, l,
|
| 1637 |
-
|
| 1638 |
-
isNode = elem.nodeType,
|
| 1639 |
-
|
| 1640 |
-
// See jQuery.data for more information
|
| 1641 |
-
cache = isNode ? jQuery.cache : elem,
|
| 1642 |
-
id = isNode ? elem[ jQuery.expando ] : jQuery.expando;
|
| 1643 |
-
|
| 1644 |
-
// If there is already no cache entry for this object, there is no
|
| 1645 |
-
// purpose in continuing
|
| 1646 |
-
if ( !cache[ id ] ) {
|
| 1647 |
-
return;
|
| 1648 |
-
}
|
| 1649 |
-
|
| 1650 |
-
if ( name ) {
|
| 1651 |
-
|
| 1652 |
-
thisCache = pvt ? cache[ id ] : cache[ id ].data;
|
| 1653 |
-
|
| 1654 |
-
if ( thisCache ) {
|
| 1655 |
-
|
| 1656 |
-
// Support array or space separated string names for data keys
|
| 1657 |
-
if ( !jQuery.isArray( name ) ) {
|
| 1658 |
-
|
| 1659 |
-
// try the string as a key before any manipulation
|
| 1660 |
-
if ( name in thisCache ) {
|
| 1661 |
-
name = [ name ];
|
| 1662 |
-
} else {
|
| 1663 |
-
|
| 1664 |
-
// split the camel cased version by spaces unless a key with the spaces exists
|
| 1665 |
-
name = jQuery.camelCase( name );
|
| 1666 |
-
if ( name in thisCache ) {
|
| 1667 |
-
name = [ name ];
|
| 1668 |
-
} else {
|
| 1669 |
-
name = name.split(" ");
|
| 1670 |
-
}
|
| 1671 |
-
}
|
| 1672 |
-
}
|
| 1673 |
-
|
| 1674 |
-
for ( i = 0, l = name.length; i < l; i++ ) {
|
| 1675 |
-
delete thisCache[ name[i] ];
|
| 1676 |
-
}
|
| 1677 |
-
|
| 1678 |
-
// If there is no data left in the cache, we want to continue
|
| 1679 |
-
// and let the cache object itself get destroyed
|
| 1680 |
-
if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) {
|
| 1681 |
-
return;
|
| 1682 |
-
}
|
| 1683 |
-
}
|
| 1684 |
-
}
|
| 1685 |
-
|
| 1686 |
-
// See jQuery.data for more information
|
| 1687 |
-
if ( !pvt ) {
|
| 1688 |
-
delete cache[ id ].data;
|
| 1689 |
-
|
| 1690 |
-
// Don't destroy the parent cache unless the internal data object
|
| 1691 |
-
// had been the only thing left in it
|
| 1692 |
-
if ( !isEmptyDataObject( cache[ id ] ) ) {
|
| 1693 |
-
return;
|
| 1694 |
-
}
|
| 1695 |
-
}
|
| 1696 |
-
|
| 1697 |
-
// Destroy the cache
|
| 1698 |
-
if ( isNode ) {
|
| 1699 |
-
jQuery.cleanData( [ elem ], true );
|
| 1700 |
-
|
| 1701 |
-
// Use delete when supported for expandos or `cache` is not a window per isWindow (#10080)
|
| 1702 |
-
} else if ( jQuery.support.deleteExpando || cache != cache.window ) {
|
| 1703 |
-
delete cache[ id ];
|
| 1704 |
-
|
| 1705 |
-
// When all else fails, null
|
| 1706 |
-
} else {
|
| 1707 |
-
cache[ id ] = null;
|
| 1708 |
-
}
|
| 1709 |
-
},
|
| 1710 |
-
|
| 1711 |
-
// For internal use only.
|
| 1712 |
-
_data: function( elem, name, data ) {
|
| 1713 |
-
return jQuery.data( elem, name, data, true );
|
| 1714 |
-
},
|
| 1715 |
-
|
| 1716 |
-
// A method for determining if a DOM node can handle the data expando
|
| 1717 |
-
acceptData: function( elem ) {
|
| 1718 |
-
var noData = elem.nodeName && jQuery.noData[ elem.nodeName.toLowerCase() ];
|
| 1719 |
-
|
| 1720 |
-
// nodes accept data unless otherwise specified; rejection can be conditional
|
| 1721 |
-
return !noData || noData !== true && elem.getAttribute("classid") === noData;
|
| 1722 |
-
}
|
| 1723 |
-
});
|
| 1724 |
-
|
| 1725 |
-
jQuery.fn.extend({
|
| 1726 |
-
data: function( key, value ) {
|
| 1727 |
-
var parts, part, attr, name, l,
|
| 1728 |
-
elem = this[0],
|
| 1729 |
-
i = 0,
|
| 1730 |
-
data = null;
|
| 1731 |
-
|
| 1732 |
-
// Gets all values
|
| 1733 |
-
if ( key === undefined ) {
|
| 1734 |
-
if ( this.length ) {
|
| 1735 |
-
data = jQuery.data( elem );
|
| 1736 |
-
|
| 1737 |
-
if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) {
|
| 1738 |
-
attr = elem.attributes;
|
| 1739 |
-
for ( l = attr.length; i < l; i++ ) {
|
| 1740 |
-
name = attr[i].name;
|
| 1741 |
-
|
| 1742 |
-
if ( name.indexOf( "data-" ) === 0 ) {
|
| 1743 |
-
name = jQuery.camelCase( name.substring(5) );
|
| 1744 |
-
|
| 1745 |
-
dataAttr( elem, name, data[ name ] );
|
| 1746 |
-
}
|
| 1747 |
-
}
|
| 1748 |
-
jQuery._data( elem, "parsedAttrs", true );
|
| 1749 |
-
}
|
| 1750 |
-
}
|
| 1751 |
-
|
| 1752 |
-
return data;
|
| 1753 |
-
}
|
| 1754 |
-
|
| 1755 |
-
// Sets multiple values
|
| 1756 |
-
if ( typeof key === "object" ) {
|
| 1757 |
-
return this.each(function() {
|
| 1758 |
-
jQuery.data( this, key );
|
| 1759 |
-
});
|
| 1760 |
-
}
|
| 1761 |
-
|
| 1762 |
-
parts = key.split( ".", 2 );
|
| 1763 |
-
parts[1] = parts[1] ? "." + parts[1] : "";
|
| 1764 |
-
part = parts[1] + "!";
|
| 1765 |
-
|
| 1766 |
-
return jQuery.access( this, function( value ) {
|
| 1767 |
-
|
| 1768 |
-
if ( value === undefined ) {
|
| 1769 |
-
data = this.triggerHandler( "getData" + part, [ parts[0] ] );
|
| 1770 |
-
|
| 1771 |
-
// Try to fetch any internally stored data first
|
| 1772 |
-
if ( data === undefined && elem ) {
|
| 1773 |
-
data = jQuery.data( elem, key );
|
| 1774 |
-
data = dataAttr( elem, key, data );
|
| 1775 |
-
}
|
| 1776 |
-
|
| 1777 |
-
return data === undefined && parts[1] ?
|
| 1778 |
-
this.data( parts[0] ) :
|
| 1779 |
-
data;
|
| 1780 |
-
}
|
| 1781 |
-
|
| 1782 |
-
parts[1] = value;
|
| 1783 |
-
this.each(function() {
|
| 1784 |
-
var self = jQuery( this );
|
| 1785 |
-
|
| 1786 |
-
self.triggerHandler( "setData" + part, parts );
|
| 1787 |
-
jQuery.data( this, key, value );
|
| 1788 |
-
self.triggerHandler( "changeData" + part, parts );
|
| 1789 |
-
});
|
| 1790 |
-
}, null, value, arguments.length > 1, null, false );
|
| 1791 |
-
},
|
| 1792 |
-
|
| 1793 |
-
removeData: function( key ) {
|
| 1794 |
-
return this.each(function() {
|
| 1795 |
-
jQuery.removeData( this, key );
|
| 1796 |
-
});
|
| 1797 |
-
}
|
| 1798 |
-
});
|
| 1799 |
-
|
| 1800 |
-
function dataAttr( elem, key, data ) {
|
| 1801 |
-
// If nothing was found internally, try to fetch any
|
| 1802 |
-
// data from the HTML5 data-* attribute
|
| 1803 |
-
if ( data === undefined && elem.nodeType === 1 ) {
|
| 1804 |
-
|
| 1805 |
-
var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase();
|
| 1806 |
-
|
| 1807 |
-
data = elem.getAttribute( name );
|
| 1808 |
-
|
| 1809 |
-
if ( typeof data === "string" ) {
|
| 1810 |
-
try {
|
| 1811 |
-
data = data === "true" ? true :
|
| 1812 |
-
data === "false" ? false :
|
| 1813 |
-
data === "null" ? null :
|
| 1814 |
-
// Only convert to a number if it doesn't change the string
|
| 1815 |
-
+data + "" === data ? +data :
|
| 1816 |
-
rbrace.test( data ) ? jQuery.parseJSON( data ) :
|
| 1817 |
-
data;
|
| 1818 |
-
} catch( e ) {}
|
| 1819 |
-
|
| 1820 |
-
// Make sure we set the data so it isn't changed later
|
| 1821 |
-
jQuery.data( elem, key, data );
|
| 1822 |
-
|
| 1823 |
-
} else {
|
| 1824 |
-
data = undefined;
|
| 1825 |
-
}
|
| 1826 |
-
}
|
| 1827 |
-
|
| 1828 |
-
return data;
|
| 1829 |
-
}
|
| 1830 |
-
|
| 1831 |
-
// checks a cache object for emptiness
|
| 1832 |
-
function isEmptyDataObject( obj ) {
|
| 1833 |
-
var name;
|
| 1834 |
-
for ( name in obj ) {
|
| 1835 |
-
|
| 1836 |
-
// if the public data object is empty, the private is still empty
|
| 1837 |
-
if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) {
|
| 1838 |
-
continue;
|
| 1839 |
-
}
|
| 1840 |
-
if ( name !== "toJSON" ) {
|
| 1841 |
-
return false;
|
| 1842 |
-
}
|
| 1843 |
-
}
|
| 1844 |
-
|
| 1845 |
-
return true;
|
| 1846 |
-
}
|
| 1847 |
-
jQuery.extend({
|
| 1848 |
-
queue: function( elem, type, data ) {
|
| 1849 |
-
var queue;
|
| 1850 |
-
|
| 1851 |
-
if ( elem ) {
|
| 1852 |
-
type = ( type || "fx" ) + "queue";
|
| 1853 |
-
queue = jQuery._data( elem, type );
|
| 1854 |
-
|
| 1855 |
-
// Speed up dequeue by getting out quickly if this is just a lookup
|
| 1856 |
-
if ( data ) {
|
| 1857 |
-
if ( !queue || jQuery.isArray(data) ) {
|
| 1858 |
-
queue = jQuery._data( elem, type, jQuery.makeArray(data) );
|
| 1859 |
-
} else {
|
| 1860 |
-
queue.push( data );
|
| 1861 |
-
}
|
| 1862 |
-
}
|
| 1863 |
-
return queue || [];
|
| 1864 |
-
}
|
| 1865 |
-
},
|
| 1866 |
-
|
| 1867 |
-
dequeue: function( elem, type ) {
|
| 1868 |
-
type = type || "fx";
|
| 1869 |
-
|
| 1870 |
-
var queue = jQuery.queue( elem, type ),
|
| 1871 |
-
fn = queue.shift(),
|
| 1872 |
-
hooks = jQuery._queueHooks( elem, type ),
|
| 1873 |
-
next = function() {
|
| 1874 |
-
jQuery.dequeue( elem, type );
|
| 1875 |
-
};
|
| 1876 |
-
|
| 1877 |
-
// If the fx queue is dequeued, always remove the progress sentinel
|
| 1878 |
-
if ( fn === "inprogress" ) {
|
| 1879 |
-
fn = queue.shift();
|
| 1880 |
-
}
|
| 1881 |
-
|
| 1882 |
-
if ( fn ) {
|
| 1883 |
-
|
| 1884 |
-
// Add a progress sentinel to prevent the fx queue from being
|
| 1885 |
-
// automatically dequeued
|
| 1886 |
-
if ( type === "fx" ) {
|
| 1887 |
-
queue.unshift( "inprogress" );
|
| 1888 |
-
}
|
| 1889 |
-
|
| 1890 |
-
// clear up the last queue stop function
|
| 1891 |
-
delete hooks.stop;
|
| 1892 |
-
fn.call( elem, next, hooks );
|
| 1893 |
-
}
|
| 1894 |
-
if ( !queue.length && hooks ) {
|
| 1895 |
-
hooks.empty.fire();
|
| 1896 |
-
}
|
| 1897 |
-
},
|
| 1898 |
-
|
| 1899 |
-
// not intended for public consumption - generates a queueHooks object, or returns the current one
|
| 1900 |
-
_queueHooks: function( elem, type ) {
|
| 1901 |
-
var key = type + "queueHooks";
|
| 1902 |
-
return jQuery._data( elem, key ) || jQuery._data( elem, key, {
|
| 1903 |
-
empty: jQuery.Callbacks("once memory").add(function() {
|
| 1904 |
-
jQuery.removeData( elem, type + "queue", true );
|
| 1905 |
-
jQuery.removeData( elem, key, true );
|
| 1906 |
-
})
|
| 1907 |
-
});
|
| 1908 |
-
}
|
| 1909 |
-
});
|
| 1910 |
-
|
| 1911 |
-
jQuery.fn.extend({
|
| 1912 |
-
queue: function( type, data ) {
|
| 1913 |
-
var setter = 2;
|
| 1914 |
-
|
| 1915 |
-
if ( typeof type !== "string" ) {
|
| 1916 |
-
data = type;
|
| 1917 |
-
type = "fx";
|
| 1918 |
-
setter--;
|
| 1919 |
-
}
|
| 1920 |
-
|
| 1921 |
-
if ( arguments.length < setter ) {
|
| 1922 |
-
return jQuery.queue( this[0], type );
|
| 1923 |
-
}
|
| 1924 |
-
|
| 1925 |
-
return data === undefined ?
|
| 1926 |
-
this :
|
| 1927 |
-
this.each(function() {
|
| 1928 |
-
var queue = jQuery.queue( this, type, data );
|
| 1929 |
-
|
| 1930 |
-
// ensure a hooks for this queue
|
| 1931 |
-
jQuery._queueHooks( this, type );
|
| 1932 |
-
|
| 1933 |
-
if ( type === "fx" && queue[0] !== "inprogress" ) {
|
| 1934 |
-
jQuery.dequeue( this, type );
|
| 1935 |
-
}
|
| 1936 |
-
});
|
| 1937 |
-
},
|
| 1938 |
-
dequeue: function( type ) {
|
| 1939 |
-
return this.each(function() {
|
| 1940 |
-
jQuery.dequeue( this, type );
|
| 1941 |
-
});
|
| 1942 |
-
},
|
| 1943 |
-
// Based off of the plugin by Clint Helfers, with permission.
|
| 1944 |
-
// http://blindsignals.com/index.php/2009/07/jquery-delay/
|
| 1945 |
-
delay: function( time, type ) {
|
| 1946 |
-
time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time;
|
| 1947 |
-
type = type || "fx";
|
| 1948 |
-
|
| 1949 |
-
return this.queue( type, function( next, hooks ) {
|
| 1950 |
-
var timeout = setTimeout( next, time );
|
| 1951 |
-
hooks.stop = function() {
|
| 1952 |
-
clearTimeout( timeout );
|
| 1953 |
-
};
|
| 1954 |
-
});
|
| 1955 |
-
},
|
| 1956 |
-
clearQueue: function( type ) {
|
| 1957 |
-
return this.queue( type || "fx", [] );
|
| 1958 |
-
},
|
| 1959 |
-
// Get a promise resolved when queues of a certain type
|
| 1960 |
-
// are emptied (fx is the type by default)
|
| 1961 |
-
promise: function( type, obj ) {
|
| 1962 |
-
var tmp,
|
| 1963 |
-
count = 1,
|
| 1964 |
-
defer = jQuery.Deferred(),
|
| 1965 |
-
elements = this,
|
| 1966 |
-
i = this.length,
|
| 1967 |
-
resolve = function() {
|
| 1968 |
-
if ( !( --count ) ) {
|
| 1969 |
-
defer.resolveWith( elements, [ elements ] );
|
| 1970 |
-
}
|
| 1971 |
-
};
|
| 1972 |
-
|
| 1973 |
-
if ( typeof type !== "string" ) {
|
| 1974 |
-
obj = type;
|
| 1975 |
-
type = undefined;
|
| 1976 |
-
}
|
| 1977 |
-
type = type || "fx";
|
| 1978 |
-
|
| 1979 |
-
while( i-- ) {
|
| 1980 |
-
if ( (tmp = jQuery._data( elements[ i ], type + "queueHooks" )) && tmp.empty ) {
|
| 1981 |
-
count++;
|
| 1982 |
-
tmp.empty.add( resolve );
|
| 1983 |
-
}
|
| 1984 |
-
}
|
| 1985 |
-
resolve();
|
| 1986 |
-
return defer.promise( obj );
|
| 1987 |
-
}
|
| 1988 |
-
});
|
| 1989 |
-
var nodeHook, boolHook, fixSpecified,
|
| 1990 |
-
rclass = /[\t\r\n]/g,
|
| 1991 |
-
rreturn = /\r/g,
|
| 1992 |
-
rtype = /^(?:button|input)$/i,
|
| 1993 |
-
rfocusable = /^(?:button|input|object|select|textarea)$/i,
|
| 1994 |
-
rclickable = /^a(?:rea|)$/i,
|
| 1995 |
-
rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,
|
| 1996 |
-
getSetAttribute = jQuery.support.getSetAttribute;
|
| 1997 |
-
|
| 1998 |
-
jQuery.fn.extend({
|
| 1999 |
-
attr: function( name, value ) {
|
| 2000 |
-
return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 );
|
| 2001 |
-
},
|
| 2002 |
-
|
| 2003 |
-
removeAttr: function( name ) {
|
| 2004 |
-
return this.each(function() {
|
| 2005 |
-
jQuery.removeAttr( this, name );
|
| 2006 |
-
});
|
| 2007 |
-
},
|
| 2008 |
-
|
| 2009 |
-
prop: function( name, value ) {
|
| 2010 |
-
return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 );
|
| 2011 |
-
},
|
| 2012 |
-
|
| 2013 |
-
removeProp: function( name ) {
|
| 2014 |
-
name = jQuery.propFix[ name ] || name;
|
| 2015 |
-
return this.each(function() {
|
| 2016 |
-
// try/catch handles cases where IE balks (such as removing a property on window)
|
| 2017 |
-
try {
|
| 2018 |
-
this[ name ] = undefined;
|
| 2019 |
-
delete this[ name ];
|
| 2020 |
-
} catch( e ) {}
|
| 2021 |
-
});
|
| 2022 |
-
},
|
| 2023 |
-
|
| 2024 |
-
addClass: function( value ) {
|
| 2025 |
-
var classNames, i, l, elem,
|
| 2026 |
-
setClass, c, cl;
|
| 2027 |
-
|
| 2028 |
-
if ( jQuery.isFunction( value ) ) {
|
| 2029 |
-
return this.each(function( j ) {
|
| 2030 |
-
jQuery( this ).addClass( value.call(this, j, this.className) );
|
| 2031 |
-
});
|
| 2032 |
-
}
|
| 2033 |
-
|
| 2034 |
-
if ( value && typeof value === "string" ) {
|
| 2035 |
-
classNames = value.split( core_rspace );
|
| 2036 |
-
|
| 2037 |
-
for ( i = 0, l = this.length; i < l; i++ ) {
|
| 2038 |
-
elem = this[ i ];
|
| 2039 |
-
|
| 2040 |
-
if ( elem.nodeType === 1 ) {
|
| 2041 |
-
if ( !elem.className && classNames.length === 1 ) {
|
| 2042 |
-
elem.className = value;
|
| 2043 |
-
|
| 2044 |
-
} else {
|
| 2045 |
-
setClass = " " + elem.className + " ";
|
| 2046 |
-
|
| 2047 |
-
for ( c = 0, cl = classNames.length; c < cl; c++ ) {
|
| 2048 |
-
if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) {
|
| 2049 |
-
setClass += classNames[ c ] + " ";
|
| 2050 |
-
}
|
| 2051 |
-
}
|
| 2052 |
-
elem.className = jQuery.trim( setClass );
|
| 2053 |
-
}
|
| 2054 |
-
}
|
| 2055 |
-
}
|
| 2056 |
-
}
|
| 2057 |
-
|
| 2058 |
-
return this;
|
| 2059 |
-
},
|
| 2060 |
-
|
| 2061 |
-
removeClass: function( value ) {
|
| 2062 |
-
var removes, className, elem, c, cl, i, l;
|
| 2063 |
-
|
| 2064 |
-
if ( jQuery.isFunction( value ) ) {
|
| 2065 |
-
return this.each(function( j ) {
|
| 2066 |
-
jQuery( this ).removeClass( value.call(this, j, this.className) );
|
| 2067 |
-
});
|
| 2068 |
-
}
|
| 2069 |
-
if ( (value && typeof value === "string") || value === undefined ) {
|
| 2070 |
-
removes = ( value || "" ).split( core_rspace );
|
| 2071 |
-
|
| 2072 |
-
for ( i = 0, l = this.length; i < l; i++ ) {
|
| 2073 |
-
elem = this[ i ];
|
| 2074 |
-
if ( elem.nodeType === 1 && elem.className ) {
|
| 2075 |
-
|
| 2076 |
-
className = (" " + elem.className + " ").replace( rclass, " " );
|
| 2077 |
-
|
| 2078 |
-
// loop over each item in the removal list
|
| 2079 |
-
for ( c = 0, cl = removes.length; c < cl; c++ ) {
|
| 2080 |
-
// Remove until there is nothing to remove,
|
| 2081 |
-
while ( className.indexOf(" " + removes[ c ] + " ") > -1 ) {
|
| 2082 |
-
className = className.replace( " " + removes[ c ] + " " , " " );
|
| 2083 |
-
}
|
| 2084 |
-
}
|
| 2085 |
-
elem.className = value ? jQuery.trim( className ) : "";
|
| 2086 |
-
}
|
| 2087 |
-
}
|
| 2088 |
-
}
|
| 2089 |
-
|
| 2090 |
-
return this;
|
| 2091 |
-
},
|
| 2092 |
-
|
| 2093 |
-
toggleClass: function( value, stateVal ) {
|
| 2094 |
-
var type = typeof value,
|
| 2095 |
-
isBool = typeof stateVal === "boolean";
|
| 2096 |
-
|
| 2097 |
-
if ( jQuery.isFunction( value ) ) {
|
| 2098 |
-
return this.each(function( i ) {
|
| 2099 |
-
jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal );
|
| 2100 |
-
});
|
| 2101 |
-
}
|
| 2102 |
-
|
| 2103 |
-
return this.each(function() {
|
| 2104 |
-
if ( type === "string" ) {
|
| 2105 |
-
// toggle individual class names
|
| 2106 |
-
var className,
|
| 2107 |
-
i = 0,
|
| 2108 |
-
self = jQuery( this ),
|
| 2109 |
-
state = stateVal,
|
| 2110 |
-
classNames = value.split( core_rspace );
|
| 2111 |
-
|
| 2112 |
-
while ( (className = classNames[ i++ ]) ) {
|
| 2113 |
-
// check each className given, space separated list
|
| 2114 |
-
state = isBool ? state : !self.hasClass( className );
|
| 2115 |
-
self[ state ? "addClass" : "removeClass" ]( className );
|
| 2116 |
-
}
|
| 2117 |
-
|
| 2118 |
-
} else if ( type === "undefined" || type === "boolean" ) {
|
| 2119 |
-
if ( this.className ) {
|
| 2120 |
-
// store className if set
|
| 2121 |
-
jQuery._data( this, "__className__", this.className );
|
| 2122 |
-
}
|
| 2123 |
-
|
| 2124 |
-
// toggle whole className
|
| 2125 |
-
this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || "";
|
| 2126 |
-
}
|
| 2127 |
-
});
|
| 2128 |
-
},
|
| 2129 |
-
|
| 2130 |
-
hasClass: function( selector ) {
|
| 2131 |
-
var className = " " + selector + " ",
|
| 2132 |
-
i = 0,
|
| 2133 |
-
l = this.length;
|
| 2134 |
-
for ( ; i < l; i++ ) {
|
| 2135 |
-
if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) {
|
| 2136 |
-
return true;
|
| 2137 |
-
}
|
| 2138 |
-
}
|
| 2139 |
-
|
| 2140 |
-
return false;
|
| 2141 |
-
},
|
| 2142 |
-
|
| 2143 |
-
val: function( value ) {
|
| 2144 |
-
var hooks, ret, isFunction,
|
| 2145 |
-
elem = this[0];
|
| 2146 |
-
|
| 2147 |
-
if ( !arguments.length ) {
|
| 2148 |
-
if ( elem ) {
|
| 2149 |
-
hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ];
|
| 2150 |
-
|
| 2151 |
-
if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) {
|
| 2152 |
-
return ret;
|
| 2153 |
-
}
|
| 2154 |
-
|
| 2155 |
-
ret = elem.value;
|
| 2156 |
-
|
| 2157 |
-
return typeof ret === "string" ?
|
| 2158 |
-
// handle most common string cases
|
| 2159 |
-
ret.replace(rreturn, "") :
|
| 2160 |
-
// handle cases where value is null/undef or number
|
| 2161 |
-
ret == null ? "" : ret;
|
| 2162 |
-
}
|
| 2163 |
-
|
| 2164 |
-
return;
|
| 2165 |
-
}
|
| 2166 |
-
|
| 2167 |
-
isFunction = jQuery.isFunction( value );
|
| 2168 |
-
|
| 2169 |
-
return this.each(function( i ) {
|
| 2170 |
-
var val,
|
| 2171 |
-
self = jQuery(this);
|
| 2172 |
-
|
| 2173 |
-
if ( this.nodeType !== 1 ) {
|
| 2174 |
-
return;
|
| 2175 |
-
}
|
| 2176 |
-
|
| 2177 |
-
if ( isFunction ) {
|
| 2178 |
-
val = value.call( this, i, self.val() );
|
| 2179 |
-
} else {
|
| 2180 |
-
val = value;
|
| 2181 |
-
}
|
| 2182 |
-
|
| 2183 |
-
// Treat null/undefined as ""; convert numbers to string
|
| 2184 |
-
if ( val == null ) {
|
| 2185 |
-
val = "";
|
| 2186 |
-
} else if ( typeof val === "number" ) {
|
| 2187 |
-
val += "";
|
| 2188 |
-
} else if ( jQuery.isArray( val ) ) {
|
| 2189 |
-
val = jQuery.map(val, function ( value ) {
|
| 2190 |
-
return value == null ? "" : value + "";
|
| 2191 |
-
});
|
| 2192 |
-
}
|
| 2193 |
-
|
| 2194 |
-
hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ];
|
| 2195 |
-
|
| 2196 |
-
// If set returns undefined, fall back to normal setting
|
| 2197 |
-
if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) {
|
| 2198 |
-
this.value = val;
|
| 2199 |
-
}
|
| 2200 |
-
});
|
| 2201 |
-
}
|
| 2202 |
-
});
|
| 2203 |
-
|
| 2204 |
-
jQuery.extend({
|
| 2205 |
-
valHooks: {
|
| 2206 |
-
option: {
|
| 2207 |
-
get: function( elem ) {
|
| 2208 |
-
// attributes.value is undefined in Blackberry 4.7 but
|
| 2209 |
-
// uses .value. See #6932
|
| 2210 |
-
var val = elem.attributes.value;
|
| 2211 |
-
return !val || val.specified ? elem.value : elem.text;
|
| 2212 |
-
}
|
| 2213 |
-
},
|
| 2214 |
-
select: {
|
| 2215 |
-
get: function( elem ) {
|
| 2216 |
-
var value, i, max, option,
|
| 2217 |
-
index = elem.selectedIndex,
|
| 2218 |
-
values = [],
|
| 2219 |
-
options = elem.options,
|
| 2220 |
-
one = elem.type === "select-one";
|
| 2221 |
-
|
| 2222 |
-
// Nothing was selected
|
| 2223 |
-
if ( index < 0 ) {
|
| 2224 |
-
return null;
|
| 2225 |
-
}
|
| 2226 |
-
|
| 2227 |
-
// Loop through all the selected options
|
| 2228 |
-
i = one ? index : 0;
|
| 2229 |
-
max = one ? index + 1 : options.length;
|
| 2230 |
-
for ( ; i < max; i++ ) {
|
| 2231 |
-
option = options[ i ];
|
| 2232 |
-
|
| 2233 |
-
// Don't return options that are disabled or in a disabled optgroup
|
| 2234 |
-
if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) &&
|
| 2235 |
-
(!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) {
|
| 2236 |
-
|
| 2237 |
-
// Get the specific value for the option
|
| 2238 |
-
value = jQuery( option ).val();
|
| 2239 |
-
|
| 2240 |
-
// We don't need an array for one selects
|
| 2241 |
-
if ( one ) {
|
| 2242 |
-
return value;
|
| 2243 |
-
}
|
| 2244 |
-
|
| 2245 |
-
// Multi-Selects return an array
|
| 2246 |
-
values.push( value );
|
| 2247 |
-
}
|
| 2248 |
-
}
|
| 2249 |
-
|
| 2250 |
-
// Fixes Bug #2551 -- select.val() broken in IE after form.reset()
|
| 2251 |
-
if ( one && !values.length && options.length ) {
|
| 2252 |
-
return jQuery( options[ index ] ).val();
|
| 2253 |
-
}
|
| 2254 |
-
|
| 2255 |
-
return values;
|
| 2256 |
-
},
|
| 2257 |
-
|
| 2258 |
-
set: function( elem, value ) {
|
| 2259 |
-
var values = jQuery.makeArray( value );
|
| 2260 |
-
|
| 2261 |
-
jQuery(elem).find("option").each(function() {
|
| 2262 |
-
this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0;
|
| 2263 |
-
});
|
| 2264 |
-
|
| 2265 |
-
if ( !values.length ) {
|
| 2266 |
-
elem.selectedIndex = -1;
|
| 2267 |
-
}
|
| 2268 |
-
return values;
|
| 2269 |
-
}
|
| 2270 |
-
}
|
| 2271 |
-
},
|
| 2272 |
-
|
| 2273 |
-
// Unused in 1.8, left in so attrFn-stabbers won't die; remove in 1.9
|
| 2274 |
-
attrFn: {},
|
| 2275 |
-
|
| 2276 |
-
attr: function( elem, name, value, pass ) {
|
| 2277 |
-
var ret, hooks, notxml,
|
| 2278 |
-
nType = elem.nodeType;
|
| 2279 |
-
|
| 2280 |
-
// don't get/set attributes on text, comment and attribute nodes
|
| 2281 |
-
if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
|
| 2282 |
-
return;
|
| 2283 |
-
}
|
| 2284 |
-
|
| 2285 |
-
if ( pass && jQuery.isFunction( jQuery.fn[ name ] ) ) {
|
| 2286 |
-
return jQuery( elem )[ name ]( value );
|
| 2287 |
-
}
|
| 2288 |
-
|
| 2289 |
-
// Fallback to prop when attributes are not supported
|
| 2290 |
-
if ( typeof elem.getAttribute === "undefined" ) {
|
| 2291 |
-
return jQuery.prop( elem, name, value );
|
| 2292 |
-
}
|
| 2293 |
-
|
| 2294 |
-
notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
|
| 2295 |
-
|
| 2296 |
-
// All attributes are lowercase
|
| 2297 |
-
// Grab necessary hook if one is defined
|
| 2298 |
-
if ( notxml ) {
|
| 2299 |
-
name = name.toLowerCase();
|
| 2300 |
-
hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook );
|
| 2301 |
-
}
|
| 2302 |
-
|
| 2303 |
-
if ( value !== undefined ) {
|
| 2304 |
-
|
| 2305 |
-
if ( value === null ) {
|
| 2306 |
-
jQuery.removeAttr( elem, name );
|
| 2307 |
-
return;
|
| 2308 |
-
|
| 2309 |
-
} else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) {
|
| 2310 |
-
return ret;
|
| 2311 |
-
|
| 2312 |
-
} else {
|
| 2313 |
-
elem.setAttribute( name, "" + value );
|
| 2314 |
-
return value;
|
| 2315 |
-
}
|
| 2316 |
-
|
| 2317 |
-
} else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) {
|
| 2318 |
-
return ret;
|
| 2319 |
-
|
| 2320 |
-
} else {
|
| 2321 |
-
|
| 2322 |
-
ret = elem.getAttribute( name );
|
| 2323 |
-
|
| 2324 |
-
// Non-existent attributes return null, we normalize to undefined
|
| 2325 |
-
return ret === null ?
|
| 2326 |
-
undefined :
|
| 2327 |
-
ret;
|
| 2328 |
-
}
|
| 2329 |
-
},
|
| 2330 |
-
|
| 2331 |
-
removeAttr: function( elem, value ) {
|
| 2332 |
-
var propName, attrNames, name, isBool,
|
| 2333 |
-
i = 0;
|
| 2334 |
-
|
| 2335 |
-
if ( value && elem.nodeType === 1 ) {
|
| 2336 |
-
|
| 2337 |
-
attrNames = value.split( core_rspace );
|
| 2338 |
-
|
| 2339 |
-
for ( ; i < attrNames.length; i++ ) {
|
| 2340 |
-
name = attrNames[ i ];
|
| 2341 |
-
|
| 2342 |
-
if ( name ) {
|
| 2343 |
-
propName = jQuery.propFix[ name ] || name;
|
| 2344 |
-
isBool = rboolean.test( name );
|
| 2345 |
-
|
| 2346 |
-
// See #9699 for explanation of this approach (setting first, then removal)
|
| 2347 |
-
// Do not do this for boolean attributes (see #10870)
|
| 2348 |
-
if ( !isBool ) {
|
| 2349 |
-
jQuery.attr( elem, name, "" );
|
| 2350 |
-
}
|
| 2351 |
-
elem.removeAttribute( getSetAttribute ? name : propName );
|
| 2352 |
-
|
| 2353 |
-
// Set corresponding property to false for boolean attributes
|
| 2354 |
-
if ( isBool && propName in elem ) {
|
| 2355 |
-
elem[ propName ] = false;
|
| 2356 |
-
}
|
| 2357 |
-
}
|
| 2358 |
-
}
|
| 2359 |
-
}
|
| 2360 |
-
},
|
| 2361 |
-
|
| 2362 |
-
attrHooks: {
|
| 2363 |
-
type: {
|
| 2364 |
-
set: function( elem, value ) {
|
| 2365 |
-
// We can't allow the type property to be changed (since it causes problems in IE)
|
| 2366 |
-
if ( rtype.test( elem.nodeName ) && elem.parentNode ) {
|
| 2367 |
-
jQuery.error( "type property can't be changed" );
|
| 2368 |
-
} else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) {
|
| 2369 |
-
// Setting the type on a radio button after the value resets the value in IE6-9
|
| 2370 |
-
// Reset value to it's default in case type is set after value
|
| 2371 |
-
// This is for element creation
|
| 2372 |
-
var val = elem.value;
|
| 2373 |
-
elem.setAttribute( "type", value );
|
| 2374 |
-
if ( val ) {
|
| 2375 |
-
elem.value = val;
|
| 2376 |
-
}
|
| 2377 |
-
return value;
|
| 2378 |
-
}
|
| 2379 |
-
}
|
| 2380 |
-
},
|
| 2381 |
-
// Use the value property for back compat
|
| 2382 |
-
// Use the nodeHook for button elements in IE6/7 (#1954)
|
| 2383 |
-
value: {
|
| 2384 |
-
get: function( elem, name ) {
|
| 2385 |
-
if ( nodeHook && jQuery.nodeName( elem, "button" ) ) {
|
| 2386 |
-
return nodeHook.get( elem, name );
|
| 2387 |
-
}
|
| 2388 |
-
return name in elem ?
|
| 2389 |
-
elem.value :
|
| 2390 |
-
null;
|
| 2391 |
-
},
|
| 2392 |
-
set: function( elem, value, name ) {
|
| 2393 |
-
if ( nodeHook && jQuery.nodeName( elem, "button" ) ) {
|
| 2394 |
-
return nodeHook.set( elem, value, name );
|
| 2395 |
-
}
|
| 2396 |
-
// Does not return so that setAttribute is also used
|
| 2397 |
-
elem.value = value;
|
| 2398 |
-
}
|
| 2399 |
-
}
|
| 2400 |
-
},
|
| 2401 |
-
|
| 2402 |
-
propFix: {
|
| 2403 |
-
tabindex: "tabIndex",
|
| 2404 |
-
readonly: "readOnly",
|
| 2405 |
-
"for": "htmlFor",
|
| 2406 |
-
"class": "className",
|
| 2407 |
-
maxlength: "maxLength",
|
| 2408 |
-
cellspacing: "cellSpacing",
|
| 2409 |
-
cellpadding: "cellPadding",
|
| 2410 |
-
rowspan: "rowSpan",
|
| 2411 |
-
colspan: "colSpan",
|
| 2412 |
-
usemap: "useMap",
|
| 2413 |
-
frameborder: "frameBorder",
|
| 2414 |
-
contenteditable: "contentEditable"
|
| 2415 |
-
},
|
| 2416 |
-
|
| 2417 |
-
prop: function( elem, name, value ) {
|
| 2418 |
-
var ret, hooks, notxml,
|
| 2419 |
-
nType = elem.nodeType;
|
| 2420 |
-
|
| 2421 |
-
// don't get/set properties on text, comment and attribute nodes
|
| 2422 |
-
if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
|
| 2423 |
-
return;
|
| 2424 |
-
}
|
| 2425 |
-
|
| 2426 |
-
notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
|
| 2427 |
-
|
| 2428 |
-
if ( notxml ) {
|
| 2429 |
-
// Fix name and attach hooks
|
| 2430 |
-
name = jQuery.propFix[ name ] || name;
|
| 2431 |
-
hooks = jQuery.propHooks[ name ];
|
| 2432 |
-
}
|
| 2433 |
-
|
| 2434 |
-
if ( value !== undefined ) {
|
| 2435 |
-
if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) {
|
| 2436 |
-
return ret;
|
| 2437 |
-
|
| 2438 |
-
} else {
|
| 2439 |
-
return ( elem[ name ] = value );
|
| 2440 |
-
}
|
| 2441 |
-
|
| 2442 |
-
} else {
|
| 2443 |
-
if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) {
|
| 2444 |
-
return ret;
|
| 2445 |
-
|
| 2446 |
-
} else {
|
| 2447 |
-
return elem[ name ];
|
| 2448 |
-
}
|
| 2449 |
-
}
|
| 2450 |
-
},
|
| 2451 |
-
|
| 2452 |
-
propHooks: {
|
| 2453 |
-
tabIndex: {
|
| 2454 |
-
get: function( elem ) {
|
| 2455 |
-
// elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
|
| 2456 |
-
// http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
|
| 2457 |
-
var attributeNode = elem.getAttributeNode("tabindex");
|
| 2458 |
-
|
| 2459 |
-
return attributeNode && attributeNode.specified ?
|
| 2460 |
-
parseInt( attributeNode.value, 10 ) :
|
| 2461 |
-
rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ?
|
| 2462 |
-
0 :
|
| 2463 |
-
undefined;
|
| 2464 |
-
}
|
| 2465 |
-
}
|
| 2466 |
-
}
|
| 2467 |
-
});
|
| 2468 |
-
|
| 2469 |
-
// Hook for boolean attributes
|
| 2470 |
-
boolHook = {
|
| 2471 |
-
get: function( elem, name ) {
|
| 2472 |
-
// Align boolean attributes with corresponding properties
|
| 2473 |
-
// Fall back to attribute presence where some booleans are not supported
|
| 2474 |
-
var attrNode,
|
| 2475 |
-
property = jQuery.prop( elem, name );
|
| 2476 |
-
return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ?
|
| 2477 |
-
name.toLowerCase() :
|
| 2478 |
-
undefined;
|
| 2479 |
-
},
|
| 2480 |
-
set: function( elem, value, name ) {
|
| 2481 |
-
var propName;
|
| 2482 |
-
if ( value === false ) {
|
| 2483 |
-
// Remove boolean attributes when set to false
|
| 2484 |
-
jQuery.removeAttr( elem, name );
|
| 2485 |
-
} else {
|
| 2486 |
-
// value is true since we know at this point it's type boolean and not false
|
| 2487 |
-
// Set boolean attributes to the same name and set the DOM property
|
| 2488 |
-
propName = jQuery.propFix[ name ] || name;
|
| 2489 |
-
if ( propName in elem ) {
|
| 2490 |
-
// Only set the IDL specifically if it already exists on the element
|
| 2491 |
-
elem[ propName ] = true;
|
| 2492 |
-
}
|
| 2493 |
-
|
| 2494 |
-
elem.setAttribute( name, name.toLowerCase() );
|
| 2495 |
-
}
|
| 2496 |
-
return name;
|
| 2497 |
-
}
|
| 2498 |
-
};
|
| 2499 |
-
|
| 2500 |
-
// IE6/7 do not support getting/setting some attributes with get/setAttribute
|
| 2501 |
-
if ( !getSetAttribute ) {
|
| 2502 |
-
|
| 2503 |
-
fixSpecified = {
|
| 2504 |
-
name: true,
|
| 2505 |
-
id: true,
|
| 2506 |
-
coords: true
|
| 2507 |
-
};
|
| 2508 |
-
|
| 2509 |
-
// Use this for any attribute in IE6/7
|
| 2510 |
-
// This fixes almost every IE6/7 issue
|
| 2511 |
-
nodeHook = jQuery.valHooks.button = {
|
| 2512 |
-
get: function( elem, name ) {
|
| 2513 |
-
var ret;
|
| 2514 |
-
ret = elem.getAttributeNode( name );
|
| 2515 |
-
return ret && ( fixSpecified[ name ] ? ret.value !== "" : ret.specified ) ?
|
| 2516 |
-
ret.value :
|
| 2517 |
-
undefined;
|
| 2518 |
-
},
|
| 2519 |
-
set: function( elem, value, name ) {
|
| 2520 |
-
// Set the existing or create a new attribute node
|
| 2521 |
-
var ret = elem.getAttributeNode( name );
|
| 2522 |
-
if ( !ret ) {
|
| 2523 |
-
ret = document.createAttribute( name );
|
| 2524 |
-
elem.setAttributeNode( ret );
|
| 2525 |
-
}
|
| 2526 |
-
return ( ret.value = value + "" );
|
| 2527 |
-
}
|
| 2528 |
-
};
|
| 2529 |
-
|
| 2530 |
-
// Set width and height to auto instead of 0 on empty string( Bug #8150 )
|
| 2531 |
-
// This is for removals
|
| 2532 |
-
jQuery.each([ "width", "height" ], function( i, name ) {
|
| 2533 |
-
jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], {
|
| 2534 |
-
set: function( elem, value ) {
|
| 2535 |
-
if ( value === "" ) {
|
| 2536 |
-
elem.setAttribute( name, "auto" );
|
| 2537 |
-
return value;
|
| 2538 |
-
}
|
| 2539 |
-
}
|
| 2540 |
-
});
|
| 2541 |
-
});
|
| 2542 |
-
|
| 2543 |
-
// Set contenteditable to false on removals(#10429)
|
| 2544 |
-
// Setting to empty string throws an error as an invalid value
|
| 2545 |
-
jQuery.attrHooks.contenteditable = {
|
| 2546 |
-
get: nodeHook.get,
|
| 2547 |
-
set: function( elem, value, name ) {
|
| 2548 |
-
if ( value === "" ) {
|
| 2549 |
-
value = "false";
|
| 2550 |
-
}
|
| 2551 |
-
nodeHook.set( elem, value, name );
|
| 2552 |
-
}
|
| 2553 |
-
};
|
| 2554 |
-
}
|
| 2555 |
-
|
| 2556 |
-
|
| 2557 |
-
// Some attributes require a special call on IE
|
| 2558 |
-
if ( !jQuery.support.hrefNormalized ) {
|
| 2559 |
-
jQuery.each([ "href", "src", "width", "height" ], function( i, name ) {
|
| 2560 |
-
jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], {
|
| 2561 |
-
get: function( elem ) {
|
| 2562 |
-
var ret = elem.getAttribute( name, 2 );
|
| 2563 |
-
return ret === null ? undefined : ret;
|
| 2564 |
-
}
|
| 2565 |
-
});
|
| 2566 |
-
});
|
| 2567 |
-
}
|
| 2568 |
-
|
| 2569 |
-
if ( !jQuery.support.style ) {
|
| 2570 |
-
jQuery.attrHooks.style = {
|
| 2571 |
-
get: function( elem ) {
|
| 2572 |
-
// Return undefined in the case of empty string
|
| 2573 |
-
// Normalize to lowercase since IE uppercases css property names
|
| 2574 |
-
return elem.style.cssText.toLowerCase() || undefined;
|
| 2575 |
-
},
|
| 2576 |
-
set: function( elem, value ) {
|
| 2577 |
-
return ( elem.style.cssText = "" + value );
|
| 2578 |
-
}
|
| 2579 |
-
};
|
| 2580 |
-
}
|
| 2581 |
-
|
| 2582 |
-
// Safari mis-reports the default selected property of an option
|
| 2583 |
-
// Accessing the parent's selectedIndex property fixes it
|
| 2584 |
-
if ( !jQuery.support.optSelected ) {
|
| 2585 |
-
jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, {
|
| 2586 |
-
get: function( elem ) {
|
| 2587 |
-
var parent = elem.parentNode;
|
| 2588 |
-
|
| 2589 |
-
if ( parent ) {
|
| 2590 |
-
parent.selectedIndex;
|
| 2591 |
-
|
| 2592 |
-
// Make sure that it also works with optgroups, see #5701
|
| 2593 |
-
if ( parent.parentNode ) {
|
| 2594 |
-
parent.parentNode.selectedIndex;
|
| 2595 |
-
}
|
| 2596 |
-
}
|
| 2597 |
-
return null;
|
| 2598 |
-
}
|
| 2599 |
-
});
|
| 2600 |
-
}
|
| 2601 |
-
|
| 2602 |
-
// IE6/7 call enctype encoding
|
| 2603 |
-
if ( !jQuery.support.enctype ) {
|
| 2604 |
-
jQuery.propFix.enctype = "encoding";
|
| 2605 |
-
}
|
| 2606 |
-
|
| 2607 |
-
// Radios and checkboxes getter/setter
|
| 2608 |
-
if ( !jQuery.support.checkOn ) {
|
| 2609 |
-
jQuery.each([ "radio", "checkbox" ], function() {
|
| 2610 |
-
jQuery.valHooks[ this ] = {
|
| 2611 |
-
get: function( elem ) {
|
| 2612 |
-
// Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
|
| 2613 |
-
return elem.getAttribute("value") === null ? "on" : elem.value;
|
| 2614 |
-
}
|
| 2615 |
-
};
|
| 2616 |
-
});
|
| 2617 |
-
}
|
| 2618 |
-
jQuery.each([ "radio", "checkbox" ], function() {
|
| 2619 |
-
jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], {
|
| 2620 |
-
set: function( elem, value ) {
|
| 2621 |
-
if ( jQuery.isArray( value ) ) {
|
| 2622 |
-
return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 );
|
| 2623 |
-
}
|
| 2624 |
-
}
|
| 2625 |
-
});
|
| 2626 |
-
});
|
| 2627 |
-
var rformElems = /^(?:textarea|input|select)$/i,
|
| 2628 |
-
rtypenamespace = /^([^\.]*|)(?:\.(.+)|)$/,
|
| 2629 |
-
rhoverHack = /(?:^|\s)hover(\.\S+|)\b/,
|
| 2630 |
-
rkeyEvent = /^key/,
|
| 2631 |
-
rmouseEvent = /^(?:mouse|contextmenu)|click/,
|
| 2632 |
-
rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
|
| 2633 |
-
hoverHack = function( events ) {
|
| 2634 |
-
return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" );
|
| 2635 |
-
};
|
| 2636 |
-
|
| 2637 |
-
/*
|
| 2638 |
-
* Helper functions for managing events -- not part of the public interface.
|
| 2639 |
-
* Props to Dean Edwards' addEvent library for many of the ideas.
|
| 2640 |
-
*/
|
| 2641 |
-
jQuery.event = {
|
| 2642 |
-
|
| 2643 |
-
add: function( elem, types, handler, data, selector ) {
|
| 2644 |
-
|
| 2645 |
-
var elemData, eventHandle, events,
|
| 2646 |
-
t, tns, type, namespaces, handleObj,
|
| 2647 |
-
handleObjIn, handlers, special;
|
| 2648 |
-
|
| 2649 |
-
// Don't attach events to noData or text/comment nodes (allow plain objects tho)
|
| 2650 |
-
if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) {
|
| 2651 |
-
return;
|
| 2652 |
-
}
|
| 2653 |
-
|
| 2654 |
-
// Caller can pass in an object of custom data in lieu of the handler
|
| 2655 |
-
if ( handler.handler ) {
|
| 2656 |
-
handleObjIn = handler;
|
| 2657 |
-
handler = handleObjIn.handler;
|
| 2658 |
-
selector = handleObjIn.selector;
|
| 2659 |
-
}
|
| 2660 |
-
|
| 2661 |
-
// Make sure that the handler has a unique ID, used to find/remove it later
|
| 2662 |
-
if ( !handler.guid ) {
|
| 2663 |
-
handler.guid = jQuery.guid++;
|
| 2664 |
-
}
|
| 2665 |
-
|
| 2666 |
-
// Init the element's event structure and main handler, if this is the first
|
| 2667 |
-
events = elemData.events;
|
| 2668 |
-
if ( !events ) {
|
| 2669 |
-
elemData.events = events = {};
|
| 2670 |
-
}
|
| 2671 |
-
eventHandle = elemData.handle;
|
| 2672 |
-
if ( !eventHandle ) {
|
| 2673 |
-
elemData.handle = eventHandle = function( e ) {
|
| 2674 |
-
// Discard the second event of a jQuery.event.trigger() and
|
| 2675 |
-
// when an event is called after a page has unloaded
|
| 2676 |
-
return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ?
|
| 2677 |
-
jQuery.event.dispatch.apply( eventHandle.elem, arguments ) :
|
| 2678 |
-
undefined;
|
| 2679 |
-
};
|
| 2680 |
-
// Add elem as a property of the handle fn to prevent a memory leak with IE non-native events
|
| 2681 |
-
eventHandle.elem = elem;
|
| 2682 |
-
}
|
| 2683 |
-
|
| 2684 |
-
// Handle multiple events separated by a space
|
| 2685 |
-
// jQuery(...).bind("mouseover mouseout", fn);
|
| 2686 |
-
types = jQuery.trim( hoverHack(types) ).split( " " );
|
| 2687 |
-
for ( t = 0; t < types.length; t++ ) {
|
| 2688 |
-
|
| 2689 |
-
tns = rtypenamespace.exec( types[t] ) || [];
|
| 2690 |
-
type = tns[1];
|
| 2691 |
-
namespaces = ( tns[2] || "" ).split( "." ).sort();
|
| 2692 |
-
|
| 2693 |
-
// If event changes its type, use the special event handlers for the changed type
|
| 2694 |
-
special = jQuery.event.special[ type ] || {};
|
| 2695 |
-
|
| 2696 |
-
// If selector defined, determine special event api type, otherwise given type
|
| 2697 |
-
type = ( selector ? special.delegateType : special.bindType ) || type;
|
| 2698 |
-
|
| 2699 |
-
// Update special based on newly reset type
|
| 2700 |
-
special = jQuery.event.special[ type ] || {};
|
| 2701 |
-
|
| 2702 |
-
// handleObj is passed to all event handlers
|
| 2703 |
-
handleObj = jQuery.extend({
|
| 2704 |
-
type: type,
|
| 2705 |
-
origType: tns[1],
|
| 2706 |
-
data: data,
|
| 2707 |
-
handler: handler,
|
| 2708 |
-
guid: handler.guid,
|
| 2709 |
-
selector: selector,
|
| 2710 |
-
namespace: namespaces.join(".")
|
| 2711 |
-
}, handleObjIn );
|
| 2712 |
-
|
| 2713 |
-
// Init the event handler queue if we're the first
|
| 2714 |
-
handlers = events[ type ];
|
| 2715 |
-
if ( !handlers ) {
|
| 2716 |
-
handlers = events[ type ] = [];
|
| 2717 |
-
handlers.delegateCount = 0;
|
| 2718 |
-
|
| 2719 |
-
// Only use addEventListener/attachEvent if the special events handler returns false
|
| 2720 |
-
if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
|
| 2721 |
-
// Bind the global event handler to the element
|
| 2722 |
-
if ( elem.addEventListener ) {
|
| 2723 |
-
elem.addEventListener( type, eventHandle, false );
|
| 2724 |
-
|
| 2725 |
-
} else if ( elem.attachEvent ) {
|
| 2726 |
-
elem.attachEvent( "on" + type, eventHandle );
|
| 2727 |
-
}
|
| 2728 |
-
}
|
| 2729 |
-
}
|
| 2730 |
-
|
| 2731 |
-
if ( special.add ) {
|
| 2732 |
-
special.add.call( elem, handleObj );
|
| 2733 |
-
|
| 2734 |
-
if ( !handleObj.handler.guid ) {
|
| 2735 |
-
handleObj.handler.guid = handler.guid;
|
| 2736 |
-
}
|
| 2737 |
-
}
|
| 2738 |
-
|
| 2739 |
-
// Add to the element's handler list, delegates in front
|
| 2740 |
-
if ( selector ) {
|
| 2741 |
-
handlers.splice( handlers.delegateCount++, 0, handleObj );
|
| 2742 |
-
} else {
|
| 2743 |
-
handlers.push( handleObj );
|
| 2744 |
-
}
|
| 2745 |
-
|
| 2746 |
-
// Keep track of which events have ever been used, for event optimization
|
| 2747 |
-
jQuery.event.global[ type ] = true;
|
| 2748 |
-
}
|
| 2749 |
-
|
| 2750 |
-
// Nullify elem to prevent memory leaks in IE
|
| 2751 |
-
elem = null;
|
| 2752 |
-
},
|
| 2753 |
-
|
| 2754 |
-
global: {},
|
| 2755 |
-
|
| 2756 |
-
// Detach an event or set of events from an element
|
| 2757 |
-
remove: function( elem, types, handler, selector, mappedTypes ) {
|
| 2758 |
-
|
| 2759 |
-
var t, tns, type, origType, namespaces, origCount,
|
| 2760 |
-
j, events, special, eventType, handleObj,
|
| 2761 |
-
elemData = jQuery.hasData( elem ) && jQuery._data( elem );
|
| 2762 |
-
|
| 2763 |
-
if ( !elemData || !(events = elemData.events) ) {
|
| 2764 |
-
return;
|
| 2765 |
-
}
|
| 2766 |
-
|
| 2767 |
-
// Once for each type.namespace in types; type may be omitted
|
| 2768 |
-
types = jQuery.trim( hoverHack( types || "" ) ).split(" ");
|
| 2769 |
-
for ( t = 0; t < types.length; t++ ) {
|
| 2770 |
-
tns = rtypenamespace.exec( types[t] ) || [];
|
| 2771 |
-
type = origType = tns[1];
|
| 2772 |
-
namespaces = tns[2];
|
| 2773 |
-
|
| 2774 |
-
// Unbind all events (on this namespace, if provided) for the element
|
| 2775 |
-
if ( !type ) {
|
| 2776 |
-
for ( type in events ) {
|
| 2777 |
-
jQuery.event.remove( elem, type + types[ t ], handler, selector, true );
|
| 2778 |
-
}
|
| 2779 |
-
continue;
|
| 2780 |
-
}
|
| 2781 |
-
|
| 2782 |
-
special = jQuery.event.special[ type ] || {};
|
| 2783 |
-
type = ( selector? special.delegateType : special.bindType ) || type;
|
| 2784 |
-
eventType = events[ type ] || [];
|
| 2785 |
-
origCount = eventType.length;
|
| 2786 |
-
namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.|)") + "(\\.|$)") : null;
|
| 2787 |
-
|
| 2788 |
-
// Remove matching events
|
| 2789 |
-
for ( j = 0; j < eventType.length; j++ ) {
|
| 2790 |
-
handleObj = eventType[ j ];
|
| 2791 |
-
|
| 2792 |
-
if ( ( mappedTypes || origType === handleObj.origType ) &&
|
| 2793 |
-
( !handler || handler.guid === handleObj.guid ) &&
|
| 2794 |
-
( !namespaces || namespaces.test( handleObj.namespace ) ) &&
|
| 2795 |
-
( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) {
|
| 2796 |
-
eventType.splice( j--, 1 );
|
| 2797 |
-
|
| 2798 |
-
if ( handleObj.selector ) {
|
| 2799 |
-
eventType.delegateCount--;
|
| 2800 |
-
}
|
| 2801 |
-
if ( special.remove ) {
|
| 2802 |
-
special.remove.call( elem, handleObj );
|
| 2803 |
-
}
|
| 2804 |
-
}
|
| 2805 |
-
}
|
| 2806 |
-
|
| 2807 |
-
// Remove generic event handler if we removed something and no more handlers exist
|
| 2808 |
-
// (avoids potential for endless recursion during removal of special event handlers)
|
| 2809 |
-
if ( eventType.length === 0 && origCount !== eventType.length ) {
|
| 2810 |
-
if ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) {
|
| 2811 |
-
jQuery.removeEvent( elem, type, elemData.handle );
|
| 2812 |
-
}
|
| 2813 |
-
|
| 2814 |
-
delete events[ type ];
|
| 2815 |
-
}
|
| 2816 |
-
}
|
| 2817 |
-
|
| 2818 |
-
// Remove the expando if it's no longer used
|
| 2819 |
-
if ( jQuery.isEmptyObject( events ) ) {
|
| 2820 |
-
delete elemData.handle;
|
| 2821 |
-
|
| 2822 |
-
// removeData also checks for emptiness and clears the expando if empty
|
| 2823 |
-
// so use it instead of delete
|
| 2824 |
-
jQuery.removeData( elem, "events", true );
|
| 2825 |
-
}
|
| 2826 |
-
},
|
| 2827 |
-
|
| 2828 |
-
// Events that are safe to short-circuit if no handlers are attached.
|
| 2829 |
-
// Native DOM events should not be added, they may have inline handlers.
|
| 2830 |
-
customEvent: {
|
| 2831 |
-
"getData": true,
|
| 2832 |
-
"setData": true,
|
| 2833 |
-
"changeData": true
|
| 2834 |
-
},
|
| 2835 |
-
|
| 2836 |
-
trigger: function( event, data, elem, onlyHandlers ) {
|
| 2837 |
-
// Don't do events on text and comment nodes
|
| 2838 |
-
if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) {
|
| 2839 |
-
return;
|
| 2840 |
-
}
|
| 2841 |
-
|
| 2842 |
-
// Event object or event type
|
| 2843 |
-
var cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType,
|
| 2844 |
-
type = event.type || event,
|
| 2845 |
-
namespaces = [];
|
| 2846 |
-
|
| 2847 |
-
// focus/blur morphs to focusin/out; ensure we're not firing them right now
|
| 2848 |
-
if ( rfocusMorph.test( type + jQuery.event.triggered ) ) {
|
| 2849 |
-
return;
|
| 2850 |
-
}
|
| 2851 |
-
|
| 2852 |
-
if ( type.indexOf( "!" ) >= 0 ) {
|
| 2853 |
-
// Exclusive events trigger only for the exact event (no namespaces)
|
| 2854 |
-
type = type.slice(0, -1);
|
| 2855 |
-
exclusive = true;
|
| 2856 |
-
}
|
| 2857 |
-
|
| 2858 |
-
if ( type.indexOf( "." ) >= 0 ) {
|
| 2859 |
-
// Namespaced trigger; create a regexp to match event type in handle()
|
| 2860 |
-
namespaces = type.split(".");
|
| 2861 |
-
type = namespaces.shift();
|
| 2862 |
-
namespaces.sort();
|
| 2863 |
-
}
|
| 2864 |
-
|
| 2865 |
-
if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) {
|
| 2866 |
-
// No jQuery handlers for this event type, and it can't have inline handlers
|
| 2867 |
-
return;
|
| 2868 |
-
}
|
| 2869 |
-
|
| 2870 |
-
// Caller can pass in an Event, Object, or just an event type string
|
| 2871 |
-
event = typeof event === "object" ?
|
| 2872 |
-
// jQuery.Event object
|
| 2873 |
-
event[ jQuery.expando ] ? event :
|
| 2874 |
-
// Object literal
|
| 2875 |
-
new jQuery.Event( type, event ) :
|
| 2876 |
-
// Just the event type (string)
|
| 2877 |
-
new jQuery.Event( type );
|
| 2878 |
-
|
| 2879 |
-
event.type = type;
|
| 2880 |
-
event.isTrigger = true;
|
| 2881 |
-
event.exclusive = exclusive;
|
| 2882 |
-
event.namespace = namespaces.join( "." );
|
| 2883 |
-
event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") : null;
|
| 2884 |
-
ontype = type.indexOf( ":" ) < 0 ? "on" + type : "";
|
| 2885 |
-
|
| 2886 |
-
// Handle a global trigger
|
| 2887 |
-
if ( !elem ) {
|
| 2888 |
-
|
| 2889 |
-
// TODO: Stop taunting the data cache; remove global events and always attach to document
|
| 2890 |
-
cache = jQuery.cache;
|
| 2891 |
-
for ( i in cache ) {
|
| 2892 |
-
if ( cache[ i ].events && cache[ i ].events[ type ] ) {
|
| 2893 |
-
jQuery.event.trigger( event, data, cache[ i ].handle.elem, true );
|
| 2894 |
-
}
|
| 2895 |
-
}
|
| 2896 |
-
return;
|
| 2897 |
-
}
|
| 2898 |
-
|
| 2899 |
-
// Clean up the event in case it is being reused
|
| 2900 |
-
event.result = undefined;
|
| 2901 |
-
if ( !event.target ) {
|
| 2902 |
-
event.target = elem;
|
| 2903 |
-
}
|
| 2904 |
-
|
| 2905 |
-
// Clone any incoming data and prepend the event, creating the handler arg list
|
| 2906 |
-
data = data != null ? jQuery.makeArray( data ) : [];
|
| 2907 |
-
data.unshift( event );
|
| 2908 |
-
|
| 2909 |
-
// Allow special events to draw outside the lines
|
| 2910 |
-
special = jQuery.event.special[ type ] || {};
|
| 2911 |
-
if ( special.trigger && special.trigger.apply( elem, data ) === false ) {
|
| 2912 |
-
return;
|
| 2913 |
-
}
|
| 2914 |
-
|
| 2915 |
-
// Determine event propagation path in advance, per W3C events spec (#9951)
|
| 2916 |
-
// Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
|
| 2917 |
-
eventPath = [[ elem, special.bindType || type ]];
|
| 2918 |
-
if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) {
|
| 2919 |
-
|
| 2920 |
-
bubbleType = special.delegateType || type;
|
| 2921 |
-
cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode;
|
| 2922 |
-
for ( old = elem; cur; cur = cur.parentNode ) {
|
| 2923 |
-
eventPath.push([ cur, bubbleType ]);
|
| 2924 |
-
old = cur;
|
| 2925 |
-
}
|
| 2926 |
-
|
| 2927 |
-
// Only add window if we got to document (e.g., not plain obj or detached DOM)
|
| 2928 |
-
if ( old === (elem.ownerDocument || document) ) {
|
| 2929 |
-
eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]);
|
| 2930 |
-
}
|
| 2931 |
-
}
|
| 2932 |
-
|
| 2933 |
-
// Fire handlers on the event path
|
| 2934 |
-
for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) {
|
| 2935 |
-
|
| 2936 |
-
cur = eventPath[i][0];
|
| 2937 |
-
event.type = eventPath[i][1];
|
| 2938 |
-
|
| 2939 |
-
handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" );
|
| 2940 |
-
if ( handle ) {
|
| 2941 |
-
handle.apply( cur, data );
|
| 2942 |
-
}
|
| 2943 |
-
// Note that this is a bare JS function and not a jQuery handler
|
| 2944 |
-
handle = ontype && cur[ ontype ];
|
| 2945 |
-
if ( handle && jQuery.acceptData( cur ) && handle.apply( cur, data ) === false ) {
|
| 2946 |
-
event.preventDefault();
|
| 2947 |
-
}
|
| 2948 |
-
}
|
| 2949 |
-
event.type = type;
|
| 2950 |
-
|
| 2951 |
-
// If nobody prevented the default action, do it now
|
| 2952 |
-
if ( !onlyHandlers && !event.isDefaultPrevented() ) {
|
| 2953 |
-
|
| 2954 |
-
if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) &&
|
| 2955 |
-
!(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) {
|
| 2956 |
-
|
| 2957 |
-
// Call a native DOM method on the target with the same name name as the event.
|
| 2958 |
-
// Can't use an .isFunction() check here because IE6/7 fails that test.
|
| 2959 |
-
// Don't do default actions on window, that's where global variables be (#6170)
|
| 2960 |
-
// IE<9 dies on focus/blur to hidden element (#1486)
|
| 2961 |
-
if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) {
|
| 2962 |
-
|
| 2963 |
-
// Don't re-trigger an onFOO event when we call its FOO() method
|
| 2964 |
-
old = elem[ ontype ];
|
| 2965 |
-
|
| 2966 |
-
if ( old ) {
|
| 2967 |
-
elem[ ontype ] = null;
|
| 2968 |
-
}
|
| 2969 |
-
|
| 2970 |
-
// Prevent re-triggering of the same event, since we already bubbled it above
|
| 2971 |
-
jQuery.event.triggered = type;
|
| 2972 |
-
elem[ type ]();
|
| 2973 |
-
jQuery.event.triggered = undefined;
|
| 2974 |
-
|
| 2975 |
-
if ( old ) {
|
| 2976 |
-
elem[ ontype ] = old;
|
| 2977 |
-
}
|
| 2978 |
-
}
|
| 2979 |
-
}
|
| 2980 |
-
}
|
| 2981 |
-
|
| 2982 |
-
return event.result;
|
| 2983 |
-
},
|
| 2984 |
-
|
| 2985 |
-
dispatch: function( event ) {
|
| 2986 |
-
|
| 2987 |
-
// Make a writable jQuery.Event from the native event object
|
| 2988 |
-
event = jQuery.event.fix( event || window.event );
|
| 2989 |
-
|
| 2990 |
-
var i, j, cur, jqcur, ret, selMatch, matched, matches, handleObj, sel, related,
|
| 2991 |
-
handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []),
|
| 2992 |
-
delegateCount = handlers.delegateCount,
|
| 2993 |
-
args = [].slice.call( arguments ),
|
| 2994 |
-
run_all = !event.exclusive && !event.namespace,
|
| 2995 |
-
special = jQuery.event.special[ event.type ] || {},
|
| 2996 |
-
handlerQueue = [];
|
| 2997 |
-
|
| 2998 |
-
// Use the fix-ed jQuery.Event rather than the (read-only) native event
|
| 2999 |
-
args[0] = event;
|
| 3000 |
-
event.delegateTarget = this;
|
| 3001 |
-
|
| 3002 |
-
// Call the preDispatch hook for the mapped type, and let it bail if desired
|
| 3003 |
-
if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {
|
| 3004 |
-
return;
|
| 3005 |
-
}
|
| 3006 |
-
|
| 3007 |
-
// Determine handlers that should run if there are delegated events
|
| 3008 |
-
// Avoid non-left-click bubbling in Firefox (#3861)
|
| 3009 |
-
if ( delegateCount && !(event.button && event.type === "click") ) {
|
| 3010 |
-
|
| 3011 |
-
// Pregenerate a single jQuery object for reuse with .is()
|
| 3012 |
-
jqcur = jQuery(this);
|
| 3013 |
-
jqcur.context = this;
|
| 3014 |
-
|
| 3015 |
-
for ( cur = event.target; cur != this; cur = cur.parentNode || this ) {
|
| 3016 |
-
|
| 3017 |
-
// Don't process clicks (ONLY) on disabled elements (#6911, #8165, #xxxx)
|
| 3018 |
-
if ( cur.disabled !== true || event.type !== "click" ) {
|
| 3019 |
-
selMatch = {};
|
| 3020 |
-
matches = [];
|
| 3021 |
-
jqcur[0] = cur;
|
| 3022 |
-
for ( i = 0; i < delegateCount; i++ ) {
|
| 3023 |
-
handleObj = handlers[ i ];
|
| 3024 |
-
sel = handleObj.selector;
|
| 3025 |
-
|
| 3026 |
-
if ( selMatch[ sel ] === undefined ) {
|
| 3027 |
-
selMatch[ sel ] = jqcur.is( sel );
|
| 3028 |
-
}
|
| 3029 |
-
if ( selMatch[ sel ] ) {
|
| 3030 |
-
matches.push( handleObj );
|
| 3031 |
-
}
|
| 3032 |
-
}
|
| 3033 |
-
if ( matches.length ) {
|
| 3034 |
-
handlerQueue.push({ elem: cur, matches: matches });
|
| 3035 |
-
}
|
| 3036 |
-
}
|
| 3037 |
-
}
|
| 3038 |
-
}
|
| 3039 |
-
|
| 3040 |
-
// Add the remaining (directly-bound) handlers
|
| 3041 |
-
if ( handlers.length > delegateCount ) {
|
| 3042 |
-
handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) });
|
| 3043 |
-
}
|
| 3044 |
-
|
| 3045 |
-
// Run delegates first; they may want to stop propagation beneath us
|
| 3046 |
-
for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) {
|
| 3047 |
-
matched = handlerQueue[ i ];
|
| 3048 |
-
event.currentTarget = matched.elem;
|
| 3049 |
-
|
| 3050 |
-
for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) {
|
| 3051 |
-
handleObj = matched.matches[ j ];
|
| 3052 |
-
|
| 3053 |
-
// Triggered event must either 1) be non-exclusive and have no namespace, or
|
| 3054 |
-
// 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace).
|
| 3055 |
-
if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) {
|
| 3056 |
-
|
| 3057 |
-
event.data = handleObj.data;
|
| 3058 |
-
event.handleObj = handleObj;
|
| 3059 |
-
|
| 3060 |
-
ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler )
|
| 3061 |
-
.apply( matched.elem, args );
|
| 3062 |
-
|
| 3063 |
-
if ( ret !== undefined ) {
|
| 3064 |
-
event.result = ret;
|
| 3065 |
-
if ( ret === false ) {
|
| 3066 |
-
event.preventDefault();
|
| 3067 |
-
event.stopPropagation();
|
| 3068 |
-
}
|
| 3069 |
-
}
|
| 3070 |
-
}
|
| 3071 |
-
}
|
| 3072 |
-
}
|
| 3073 |
-
|
| 3074 |
-
// Call the postDispatch hook for the mapped type
|
| 3075 |
-
if ( special.postDispatch ) {
|
| 3076 |
-
special.postDispatch.call( this, event );
|
| 3077 |
-
}
|
| 3078 |
-
|
| 3079 |
-
return event.result;
|
| 3080 |
-
},
|
| 3081 |
-
|
| 3082 |
-
// Includes some event props shared by KeyEvent and MouseEvent
|
| 3083 |
-
// *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 ***
|
| 3084 |
-
props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),
|
| 3085 |
-
|
| 3086 |
-
fixHooks: {},
|
| 3087 |
-
|
| 3088 |
-
keyHooks: {
|
| 3089 |
-
props: "char charCode key keyCode".split(" "),
|
| 3090 |
-
filter: function( event, original ) {
|
| 3091 |
-
|
| 3092 |
-
// Add which for key events
|
| 3093 |
-
if ( event.which == null ) {
|
| 3094 |
-
event.which = original.charCode != null ? original.charCode : original.keyCode;
|
| 3095 |
-
}
|
| 3096 |
-
|
| 3097 |
-
return event;
|
| 3098 |
-
}
|
| 3099 |
-
},
|
| 3100 |
-
|
| 3101 |
-
mouseHooks: {
|
| 3102 |
-
props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),
|
| 3103 |
-
filter: function( event, original ) {
|
| 3104 |
-
var eventDoc, doc, body,
|
| 3105 |
-
button = original.button,
|
| 3106 |
-
fromElement = original.fromElement;
|
| 3107 |
-
|
| 3108 |
-
// Calculate pageX/Y if missing and clientX/Y available
|
| 3109 |
-
if ( event.pageX == null && original.clientX != null ) {
|
| 3110 |
-
eventDoc = event.target.ownerDocument || document;
|
| 3111 |
-
doc = eventDoc.documentElement;
|
| 3112 |
-
body = eventDoc.body;
|
| 3113 |
-
|
| 3114 |
-
event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 );
|
| 3115 |
-
event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 );
|
| 3116 |
-
}
|
| 3117 |
-
|
| 3118 |
-
// Add relatedTarget, if necessary
|
| 3119 |
-
if ( !event.relatedTarget && fromElement ) {
|
| 3120 |
-
event.relatedTarget = fromElement === event.target ? original.toElement : fromElement;
|
| 3121 |
-
}
|
| 3122 |
-
|
| 3123 |
-
// Add which for click: 1 === left; 2 === middle; 3 === right
|
| 3124 |
-
// Note: button is not normalized, so don't use it
|
| 3125 |
-
if ( !event.which && button !== undefined ) {
|
| 3126 |
-
event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) );
|
| 3127 |
-
}
|
| 3128 |
-
|
| 3129 |
-
return event;
|
| 3130 |
-
}
|
| 3131 |
-
},
|
| 3132 |
-
|
| 3133 |
-
fix: function( event ) {
|
| 3134 |
-
if ( event[ jQuery.expando ] ) {
|
| 3135 |
-
return event;
|
| 3136 |
-
}
|
| 3137 |
-
|
| 3138 |
-
// Create a writable copy of the event object and normalize some properties
|
| 3139 |
-
var i, prop,
|
| 3140 |
-
originalEvent = event,
|
| 3141 |
-
fixHook = jQuery.event.fixHooks[ event.type ] || {},
|
| 3142 |
-
copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props;
|
| 3143 |
-
|
| 3144 |
-
event = jQuery.Event( originalEvent );
|
| 3145 |
-
|
| 3146 |
-
for ( i = copy.length; i; ) {
|
| 3147 |
-
prop = copy[ --i ];
|
| 3148 |
-
event[ prop ] = originalEvent[ prop ];
|
| 3149 |
-
}
|
| 3150 |
-
|
| 3151 |
-
// Fix target property, if necessary (#1925, IE 6/7/8 & Safari2)
|
| 3152 |
-
if ( !event.target ) {
|
| 3153 |
-
event.target = originalEvent.srcElement || document;
|
| 3154 |
-
}
|
| 3155 |
-
|
| 3156 |
-
// Target should not be a text node (#504, Safari)
|
| 3157 |
-
if ( event.target.nodeType === 3 ) {
|
| 3158 |
-
event.target = event.target.parentNode;
|
| 3159 |
-
}
|
| 3160 |
-
|
| 3161 |
-
// For mouse/key events, metaKey==false if it's undefined (#3368, #11328; IE6/7/8)
|
| 3162 |
-
event.metaKey = !!event.metaKey;
|
| 3163 |
-
|
| 3164 |
-
return fixHook.filter? fixHook.filter( event, originalEvent ) : event;
|
| 3165 |
-
},
|
| 3166 |
-
|
| 3167 |
-
special: {
|
| 3168 |
-
ready: {
|
| 3169 |
-
// Make sure the ready event is setup
|
| 3170 |
-
setup: jQuery.bindReady
|
| 3171 |
-
},
|
| 3172 |
-
|
| 3173 |
-
load: {
|
| 3174 |
-
// Prevent triggered image.load events from bubbling to window.load
|
| 3175 |
-
noBubble: true
|
| 3176 |
-
},
|
| 3177 |
-
|
| 3178 |
-
focus: {
|
| 3179 |
-
delegateType: "focusin"
|
| 3180 |
-
},
|
| 3181 |
-
blur: {
|
| 3182 |
-
delegateType: "focusout"
|
| 3183 |
-
},
|
| 3184 |
-
|
| 3185 |
-
beforeunload: {
|
| 3186 |
-
setup: function( data, namespaces, eventHandle ) {
|
| 3187 |
-
// We only want to do this special case on windows
|
| 3188 |
-
if ( jQuery.isWindow( this ) ) {
|
| 3189 |
-
this.onbeforeunload = eventHandle;
|
| 3190 |
-
}
|
| 3191 |
-
},
|
| 3192 |
-
|
| 3193 |
-
teardown: function( namespaces, eventHandle ) {
|
| 3194 |
-
if ( this.onbeforeunload === eventHandle ) {
|
| 3195 |
-
this.onbeforeunload = null;
|
| 3196 |
-
}
|
| 3197 |
-
}
|
| 3198 |
-
}
|
| 3199 |
-
},
|
| 3200 |
-
|
| 3201 |
-
simulate: function( type, elem, event, bubble ) {
|
| 3202 |
-
// Piggyback on a donor event to simulate a different one.
|
| 3203 |
-
// Fake originalEvent to avoid donor's stopPropagation, but if the
|
| 3204 |
-
// simulated event prevents default then we do the same on the donor.
|
| 3205 |
-
var e = jQuery.extend(
|
| 3206 |
-
new jQuery.Event(),
|
| 3207 |
-
event,
|
| 3208 |
-
{ type: type,
|
| 3209 |
-
isSimulated: true,
|
| 3210 |
-
originalEvent: {}
|
| 3211 |
-
}
|
| 3212 |
-
);
|
| 3213 |
-
if ( bubble ) {
|
| 3214 |
-
jQuery.event.trigger( e, null, elem );
|
| 3215 |
-
} else {
|
| 3216 |
-
jQuery.event.dispatch.call( elem, e );
|
| 3217 |
-
}
|
| 3218 |
-
if ( e.isDefaultPrevented() ) {
|
| 3219 |
-
event.preventDefault();
|
| 3220 |
-
}
|
| 3221 |
-
}
|
| 3222 |
-
};
|
| 3223 |
-
|
| 3224 |
-
// Some plugins are using, but it's undocumented/deprecated and will be removed.
|
| 3225 |
-
// The 1.7 special event interface should provide all the hooks needed now.
|
| 3226 |
-
jQuery.event.handle = jQuery.event.dispatch;
|
| 3227 |
-
|
| 3228 |
-
jQuery.removeEvent = document.removeEventListener ?
|
| 3229 |
-
function( elem, type, handle ) {
|
| 3230 |
-
if ( elem.removeEventListener ) {
|
| 3231 |
-
elem.removeEventListener( type, handle, false );
|
| 3232 |
-
}
|
| 3233 |
-
} :
|
| 3234 |
-
function( elem, type, handle ) {
|
| 3235 |
-
var name = "on" + type;
|
| 3236 |
-
|
| 3237 |
-
if ( elem.detachEvent ) {
|
| 3238 |
-
|
| 3239 |
-
// #8545, #7054, preventing memory leaks for custom events in IE6-8 –
|
| 3240 |
-
// detachEvent needed property on element, by name of that event, to properly expose it to GC
|
| 3241 |
-
if ( typeof elem[ name ] === "undefined" ) {
|
| 3242 |
-
elem[ name ] = null;
|
| 3243 |
-
}
|
| 3244 |
-
|
| 3245 |
-
elem.detachEvent( name, handle );
|
| 3246 |
-
}
|
| 3247 |
-
};
|
| 3248 |
-
|
| 3249 |
-
jQuery.Event = function( src, props ) {
|
| 3250 |
-
// Allow instantiation without the 'new' keyword
|
| 3251 |
-
if ( !(this instanceof jQuery.Event) ) {
|
| 3252 |
-
return new jQuery.Event( src, props );
|
| 3253 |
-
}
|
| 3254 |
-
|
| 3255 |
-
// Event object
|
| 3256 |
-
if ( src && src.type ) {
|
| 3257 |
-
this.originalEvent = src;
|
| 3258 |
-
this.type = src.type;
|
| 3259 |
-
|
| 3260 |
-
// Events bubbling up the document may have been marked as prevented
|
| 3261 |
-
// by a handler lower down the tree; reflect the correct value.
|
| 3262 |
-
this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false ||
|
| 3263 |
-
src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse;
|
| 3264 |
-
|
| 3265 |
-
// Event type
|
| 3266 |
-
} else {
|
| 3267 |
-
this.type = src;
|
| 3268 |
-
}
|
| 3269 |
-
|
| 3270 |
-
// Put explicitly provided properties onto the event object
|
| 3271 |
-
if ( props ) {
|
| 3272 |
-
jQuery.extend( this, props );
|
| 3273 |
-
}
|
| 3274 |
-
|
| 3275 |
-
// Create a timestamp if incoming event doesn't have one
|
| 3276 |
-
this.timeStamp = src && src.timeStamp || jQuery.now();
|
| 3277 |
-
|
| 3278 |
-
// Mark it as fixed
|
| 3279 |
-
this[ jQuery.expando ] = true;
|
| 3280 |
-
};
|
| 3281 |
-
|
| 3282 |
-
function returnFalse() {
|
| 3283 |
-
return false;
|
| 3284 |
-
}
|
| 3285 |
-
function returnTrue() {
|
| 3286 |
-
return true;
|
| 3287 |
-
}
|
| 3288 |
-
|
| 3289 |
-
// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
|
| 3290 |
-
// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
|
| 3291 |
-
jQuery.Event.prototype = {
|
| 3292 |
-
preventDefault: function() {
|
| 3293 |
-
this.isDefaultPrevented = returnTrue;
|
| 3294 |
-
|
| 3295 |
-
var e = this.originalEvent;
|
| 3296 |
-
if ( !e ) {
|
| 3297 |
-
return;
|
| 3298 |
-
}
|
| 3299 |
-
|
| 3300 |
-
// if preventDefault exists run it on the original event
|
| 3301 |
-
if ( e.preventDefault ) {
|
| 3302 |
-
e.preventDefault();
|
| 3303 |
-
|
| 3304 |
-
// otherwise set the returnValue property of the original event to false (IE)
|
| 3305 |
-
} else {
|
| 3306 |
-
e.returnValue = false;
|
| 3307 |
-
}
|
| 3308 |
-
},
|
| 3309 |
-
stopPropagation: function() {
|
| 3310 |
-
this.isPropagationStopped = returnTrue;
|
| 3311 |
-
|
| 3312 |
-
var e = this.originalEvent;
|
| 3313 |
-
if ( !e ) {
|
| 3314 |
-
return;
|
| 3315 |
-
}
|
| 3316 |
-
// if stopPropagation exists run it on the original event
|
| 3317 |
-
if ( e.stopPropagation ) {
|
| 3318 |
-
e.stopPropagation();
|
| 3319 |
-
}
|
| 3320 |
-
// otherwise set the cancelBubble property of the original event to true (IE)
|
| 3321 |
-
e.cancelBubble = true;
|
| 3322 |
-
},
|
| 3323 |
-
stopImmediatePropagation: function() {
|
| 3324 |
-
this.isImmediatePropagationStopped = returnTrue;
|
| 3325 |
-
this.stopPropagation();
|
| 3326 |
-
},
|
| 3327 |
-
isDefaultPrevented: returnFalse,
|
| 3328 |
-
isPropagationStopped: returnFalse,
|
| 3329 |
-
isImmediatePropagationStopped: returnFalse
|
| 3330 |
-
};
|
| 3331 |
-
|
| 3332 |
-
// Create mouseenter/leave events using mouseover/out and event-time checks
|
| 3333 |
-
jQuery.each({
|
| 3334 |
-
mouseenter: "mouseover",
|
| 3335 |
-
mouseleave: "mouseout"
|
| 3336 |
-
}, function( orig, fix ) {
|
| 3337 |
-
jQuery.event.special[ orig ] = {
|
| 3338 |
-
delegateType: fix,
|
| 3339 |
-
bindType: fix,
|
| 3340 |
-
|
| 3341 |
-
handle: function( event ) {
|
| 3342 |
-
var ret,
|
| 3343 |
-
target = this,
|
| 3344 |
-
related = event.relatedTarget,
|
| 3345 |
-
handleObj = event.handleObj,
|
| 3346 |
-
selector = handleObj.selector;
|
| 3347 |
-
|
| 3348 |
-
// For mousenter/leave call the handler if related is outside the target.
|
| 3349 |
-
// NB: No relatedTarget if the mouse left/entered the browser window
|
| 3350 |
-
if ( !related || (related !== target && !jQuery.contains( target, related )) ) {
|
| 3351 |
-
event.type = handleObj.origType;
|
| 3352 |
-
ret = handleObj.handler.apply( this, arguments );
|
| 3353 |
-
event.type = fix;
|
| 3354 |
-
}
|
| 3355 |
-
return ret;
|
| 3356 |
-
}
|
| 3357 |
-
};
|
| 3358 |
-
});
|
| 3359 |
-
|
| 3360 |
-
// IE submit delegation
|
| 3361 |
-
if ( !jQuery.support.submitBubbles ) {
|
| 3362 |
-
|
| 3363 |
-
jQuery.event.special.submit = {
|
| 3364 |
-
setup: function() {
|
| 3365 |
-
// Only need this for delegated form submit events
|
| 3366 |
-
if ( jQuery.nodeName( this, "form" ) ) {
|
| 3367 |
-
return false;
|
| 3368 |
-
}
|
| 3369 |
-
|
| 3370 |
-
// Lazy-add a submit handler when a descendant form may potentially be submitted
|
| 3371 |
-
jQuery.event.add( this, "click._submit keypress._submit", function( e ) {
|
| 3372 |
-
// Node name check avoids a VML-related crash in IE (#9807)
|
| 3373 |
-
var elem = e.target,
|
| 3374 |
-
form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined;
|
| 3375 |
-
if ( form && !jQuery._data( form, "_submit_attached" ) ) {
|
| 3376 |
-
jQuery.event.add( form, "submit._submit", function( event ) {
|
| 3377 |
-
event._submit_bubble = true;
|
| 3378 |
-
});
|
| 3379 |
-
jQuery._data( form, "_submit_attached", true );
|
| 3380 |
-
}
|
| 3381 |
-
});
|
| 3382 |
-
// return undefined since we don't need an event listener
|
| 3383 |
-
},
|
| 3384 |
-
|
| 3385 |
-
postDispatch: function( event ) {
|
| 3386 |
-
// If form was submitted by the user, bubble the event up the tree
|
| 3387 |
-
if ( event._submit_bubble ) {
|
| 3388 |
-
delete event._submit_bubble;
|
| 3389 |
-
if ( this.parentNode && !event.isTrigger ) {
|
| 3390 |
-
jQuery.event.simulate( "submit", this.parentNode, event, true );
|
| 3391 |
-
}
|
| 3392 |
-
}
|
| 3393 |
-
},
|
| 3394 |
-
|
| 3395 |
-
teardown: function() {
|
| 3396 |
-
// Only need this for delegated form submit events
|
| 3397 |
-
if ( jQuery.nodeName( this, "form" ) ) {
|
| 3398 |
-
return false;
|
| 3399 |
-
}
|
| 3400 |
-
|
| 3401 |
-
// Remove delegated handlers; cleanData eventually reaps submit handlers attached above
|
| 3402 |
-
jQuery.event.remove( this, "._submit" );
|
| 3403 |
-
}
|
| 3404 |
-
};
|
| 3405 |
-
}
|
| 3406 |
-
|
| 3407 |
-
// IE change delegation and checkbox/radio fix
|
| 3408 |
-
if ( !jQuery.support.changeBubbles ) {
|
| 3409 |
-
|
| 3410 |
-
jQuery.event.special.change = {
|
| 3411 |
-
|
| 3412 |
-
setup: function() {
|
| 3413 |
-
|
| 3414 |
-
if ( rformElems.test( this.nodeName ) ) {
|
| 3415 |
-
// IE doesn't fire change on a check/radio until blur; trigger it on click
|
| 3416 |
-
// after a propertychange. Eat the blur-change in special.change.handle.
|
| 3417 |
-
// This still fires onchange a second time for check/radio after blur.
|
| 3418 |
-
if ( this.type === "checkbox" || this.type === "radio" ) {
|
| 3419 |
-
jQuery.event.add( this, "propertychange._change", function( event ) {
|
| 3420 |
-
if ( event.originalEvent.propertyName === "checked" ) {
|
| 3421 |
-
this._just_changed = true;
|
| 3422 |
-
}
|
| 3423 |
-
});
|
| 3424 |
-
jQuery.event.add( this, "click._change", function( event ) {
|
| 3425 |
-
if ( this._just_changed && !event.isTrigger ) {
|
| 3426 |
-
this._just_changed = false;
|
| 3427 |
-
}
|
| 3428 |
-
// Allow triggered, simulated change events (#11500)
|
| 3429 |
-
jQuery.event.simulate( "change", this, event, true );
|
| 3430 |
-
});
|
| 3431 |
-
}
|
| 3432 |
-
return false;
|
| 3433 |
-
}
|
| 3434 |
-
// Delegated event; lazy-add a change handler on descendant inputs
|
| 3435 |
-
jQuery.event.add( this, "beforeactivate._change", function( e ) {
|
| 3436 |
-
var elem = e.target;
|
| 3437 |
-
|
| 3438 |
-
if ( rformElems.test( elem.nodeName ) && !jQuery._data( elem, "_change_attached" ) ) {
|
| 3439 |
-
jQuery.event.add( elem, "change._change", function( event ) {
|
| 3440 |
-
if ( this.parentNode && !event.isSimulated && !event.isTrigger ) {
|
| 3441 |
-
jQuery.event.simulate( "change", this.parentNode, event, true );
|
| 3442 |
-
}
|
| 3443 |
-
});
|
| 3444 |
-
jQuery._data( elem, "_change_attached", true );
|
| 3445 |
-
}
|
| 3446 |
-
});
|
| 3447 |
-
},
|
| 3448 |
-
|
| 3449 |
-
handle: function( event ) {
|
| 3450 |
-
var elem = event.target;
|
| 3451 |
-
|
| 3452 |
-
// Swallow native change events from checkbox/radio, we already triggered them above
|
| 3453 |
-
if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) {
|
| 3454 |
-
return event.handleObj.handler.apply( this, arguments );
|
| 3455 |
-
}
|
| 3456 |
-
},
|
| 3457 |
-
|
| 3458 |
-
teardown: function() {
|
| 3459 |
-
jQuery.event.remove( this, "._change" );
|
| 3460 |
-
|
| 3461 |
-
return rformElems.test( this.nodeName );
|
| 3462 |
-
}
|
| 3463 |
-
};
|
| 3464 |
-
}
|
| 3465 |
-
|
| 3466 |
-
// Create "bubbling" focus and blur events
|
| 3467 |
-
if ( !jQuery.support.focusinBubbles ) {
|
| 3468 |
-
jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
|
| 3469 |
-
|
| 3470 |
-
// Attach a single capturing handler while someone wants focusin/focusout
|
| 3471 |
-
var attaches = 0,
|
| 3472 |
-
handler = function( event ) {
|
| 3473 |
-
jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true );
|
| 3474 |
-
};
|
| 3475 |
-
|
| 3476 |
-
jQuery.event.special[ fix ] = {
|
| 3477 |
-
setup: function() {
|
| 3478 |
-
if ( attaches++ === 0 ) {
|
| 3479 |
-
document.addEventListener( orig, handler, true );
|
| 3480 |
-
}
|
| 3481 |
-
},
|
| 3482 |
-
teardown: function() {
|
| 3483 |
-
if ( --attaches === 0 ) {
|
| 3484 |
-
document.removeEventListener( orig, handler, true );
|
| 3485 |
-
}
|
| 3486 |
-
}
|
| 3487 |
-
};
|
| 3488 |
-
});
|
| 3489 |
-
}
|
| 3490 |
-
|
| 3491 |
-
jQuery.fn.extend({
|
| 3492 |
-
|
| 3493 |
-
on: function( types, selector, data, fn, /*INTERNAL*/ one ) {
|
| 3494 |
-
var origFn, type;
|
| 3495 |
-
|
| 3496 |
-
// Types can be a map of types/handlers
|
| 3497 |
-
if ( typeof types === "object" ) {
|
| 3498 |
-
// ( types-Object, selector, data )
|
| 3499 |
-
if ( typeof selector !== "string" ) { // && selector != null
|
| 3500 |
-
// ( types-Object, data )
|
| 3501 |
-
data = data || selector;
|
| 3502 |
-
selector = undefined;
|
| 3503 |
-
}
|
| 3504 |
-
for ( type in types ) {
|
| 3505 |
-
this.on( type, selector, data, types[ type ], one );
|
| 3506 |
-
}
|
| 3507 |
-
return this;
|
| 3508 |
-
}
|
| 3509 |
-
|
| 3510 |
-
if ( data == null && fn == null ) {
|
| 3511 |
-
// ( types, fn )
|
| 3512 |
-
fn = selector;
|
| 3513 |
-
data = selector = undefined;
|
| 3514 |
-
} else if ( fn == null ) {
|
| 3515 |
-
if ( typeof selector === "string" ) {
|
| 3516 |
-
// ( types, selector, fn )
|
| 3517 |
-
fn = data;
|
| 3518 |
-
data = undefined;
|
| 3519 |
-
} else {
|
| 3520 |
-
// ( types, data, fn )
|
| 3521 |
-
fn = data;
|
| 3522 |
-
data = selector;
|
| 3523 |
-
selector = undefined;
|
| 3524 |
-
}
|
| 3525 |
-
}
|
| 3526 |
-
if ( fn === false ) {
|
| 3527 |
-
fn = returnFalse;
|
| 3528 |
-
} else if ( !fn ) {
|
| 3529 |
-
return this;
|
| 3530 |
-
}
|
| 3531 |
-
|
| 3532 |
-
if ( one === 1 ) {
|
| 3533 |
-
origFn = fn;
|
| 3534 |
-
fn = function( event ) {
|
| 3535 |
-
// Can use an empty set, since event contains the info
|
| 3536 |
-
jQuery().off( event );
|
| 3537 |
-
return origFn.apply( this, arguments );
|
| 3538 |
-
};
|
| 3539 |
-
// Use same guid so caller can remove using origFn
|
| 3540 |
-
fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
|
| 3541 |
-
}
|
| 3542 |
-
return this.each( function() {
|
| 3543 |
-
jQuery.event.add( this, types, fn, data, selector );
|
| 3544 |
-
});
|
| 3545 |
-
},
|
| 3546 |
-
one: function( types, selector, data, fn ) {
|
| 3547 |
-
return this.on( types, selector, data, fn, 1 );
|
| 3548 |
-
},
|
| 3549 |
-
off: function( types, selector, fn ) {
|
| 3550 |
-
var handleObj, type;
|
| 3551 |
-
if ( types && types.preventDefault && types.handleObj ) {
|
| 3552 |
-
// ( event ) dispatched jQuery.Event
|
| 3553 |
-
handleObj = types.handleObj;
|
| 3554 |
-
jQuery( types.delegateTarget ).off(
|
| 3555 |
-
handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType,
|
| 3556 |
-
handleObj.selector,
|
| 3557 |
-
handleObj.handler
|
| 3558 |
-
);
|
| 3559 |
-
return this;
|
| 3560 |
-
}
|
| 3561 |
-
if ( typeof types === "object" ) {
|
| 3562 |
-
// ( types-object [, selector] )
|
| 3563 |
-
for ( type in types ) {
|
| 3564 |
-
this.off( type, selector, types[ type ] );
|
| 3565 |
-
}
|
| 3566 |
-
return this;
|
| 3567 |
-
}
|
| 3568 |
-
if ( selector === false || typeof selector === "function" ) {
|
| 3569 |
-
// ( types [, fn] )
|
| 3570 |
-
fn = selector;
|
| 3571 |
-
selector = undefined;
|
| 3572 |
-
}
|
| 3573 |
-
if ( fn === false ) {
|
| 3574 |
-
fn = returnFalse;
|
| 3575 |
-
}
|
| 3576 |
-
return this.each(function() {
|
| 3577 |
-
jQuery.event.remove( this, types, fn, selector );
|
| 3578 |
-
});
|
| 3579 |
-
},
|
| 3580 |
-
|
| 3581 |
-
bind: function( types, data, fn ) {
|
| 3582 |
-
return this.on( types, null, data, fn );
|
| 3583 |
-
},
|
| 3584 |
-
unbind: function( types, fn ) {
|
| 3585 |
-
return this.off( types, null, fn );
|
| 3586 |
-
},
|
| 3587 |
-
|
| 3588 |
-
live: function( types, data, fn ) {
|
| 3589 |
-
jQuery( this.context ).on( types, this.selector, data, fn );
|
| 3590 |
-
return this;
|
| 3591 |
-
},
|
| 3592 |
-
die: function( types, fn ) {
|
| 3593 |
-
jQuery( this.context ).off( types, this.selector || "**", fn );
|
| 3594 |
-
return this;
|
| 3595 |
-
},
|
| 3596 |
-
|
| 3597 |
-
delegate: function( selector, types, data, fn ) {
|
| 3598 |
-
return this.on( types, selector, data, fn );
|
| 3599 |
-
},
|
| 3600 |
-
undelegate: function( selector, types, fn ) {
|
| 3601 |
-
// ( namespace ) or ( selector, types [, fn] )
|
| 3602 |
-
return arguments.length == 1? this.off( selector, "**" ) : this.off( types, selector || "**", fn );
|
| 3603 |
-
},
|
| 3604 |
-
|
| 3605 |
-
trigger: function( type, data ) {
|
| 3606 |
-
return this.each(function() {
|
| 3607 |
-
jQuery.event.trigger( type, data, this );
|
| 3608 |
-
});
|
| 3609 |
-
},
|
| 3610 |
-
triggerHandler: function( type, data ) {
|
| 3611 |
-
if ( this[0] ) {
|
| 3612 |
-
return jQuery.event.trigger( type, data, this[0], true );
|
| 3613 |
-
}
|
| 3614 |
-
},
|
| 3615 |
-
|
| 3616 |
-
toggle: function( fn ) {
|
| 3617 |
-
// Save reference to arguments for access in closure
|
| 3618 |
-
var args = arguments,
|
| 3619 |
-
guid = fn.guid || jQuery.guid++,
|
| 3620 |
-
i = 0,
|
| 3621 |
-
toggler = function( event ) {
|
| 3622 |
-
// Figure out which function to execute
|
| 3623 |
-
var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i;
|
| 3624 |
-
jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 );
|
| 3625 |
-
|
| 3626 |
-
// Make sure that clicks stop
|
| 3627 |
-
event.preventDefault();
|
| 3628 |
-
|
| 3629 |
-
// and execute the function
|
| 3630 |
-
return args[ lastToggle ].apply( this, arguments ) || false;
|
| 3631 |
-
};
|
| 3632 |
-
|
| 3633 |
-
// link all the functions, so any of them can unbind this click handler
|
| 3634 |
-
toggler.guid = guid;
|
| 3635 |
-
while ( i < args.length ) {
|
| 3636 |
-
args[ i++ ].guid = guid;
|
| 3637 |
-
}
|
| 3638 |
-
|
| 3639 |
-
return this.click( toggler );
|
| 3640 |
-
},
|
| 3641 |
-
|
| 3642 |
-
hover: function( fnOver, fnOut ) {
|
| 3643 |
-
return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
|
| 3644 |
-
}
|
| 3645 |
-
});
|
| 3646 |
-
|
| 3647 |
-
jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
|
| 3648 |
-
"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
|
| 3649 |
-
"change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) {
|
| 3650 |
-
|
| 3651 |
-
// Handle event binding
|
| 3652 |
-
jQuery.fn[ name ] = function( data, fn ) {
|
| 3653 |
-
if ( fn == null ) {
|
| 3654 |
-
fn = data;
|
| 3655 |
-
data = null;
|
| 3656 |
-
}
|
| 3657 |
-
|
| 3658 |
-
return arguments.length > 0 ?
|
| 3659 |
-
this.on( name, null, data, fn ) :
|
| 3660 |
-
this.trigger( name );
|
| 3661 |
-
};
|
| 3662 |
-
|
| 3663 |
-
if ( rkeyEvent.test( name ) ) {
|
| 3664 |
-
jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks;
|
| 3665 |
-
}
|
| 3666 |
-
|
| 3667 |
-
if ( rmouseEvent.test( name ) ) {
|
| 3668 |
-
jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks;
|
| 3669 |
-
}
|
| 3670 |
-
});
|
| 3671 |
-
/*!
|
| 3672 |
-
* Sizzle CSS Selector Engine
|
| 3673 |
-
* Copyright 2012 jQuery Foundation and other contributors
|
| 3674 |
-
* Released under the MIT license
|
| 3675 |
-
* http://sizzlejs.com/
|
| 3676 |
-
*/
|
| 3677 |
-
(function( window, undefined ) {
|
| 3678 |
-
|
| 3679 |
-
var cachedruns,
|
| 3680 |
-
dirruns,
|
| 3681 |
-
sortOrder,
|
| 3682 |
-
siblingCheck,
|
| 3683 |
-
assertGetIdNotName,
|
| 3684 |
-
|
| 3685 |
-
document = window.document,
|
| 3686 |
-
docElem = document.documentElement,
|
| 3687 |
-
|
| 3688 |
-
strundefined = "undefined",
|
| 3689 |
-
hasDuplicate = false,
|
| 3690 |
-
baseHasDuplicate = true,
|
| 3691 |
-
done = 0,
|
| 3692 |
-
slice = [].slice,
|
| 3693 |
-
push = [].push,
|
| 3694 |
-
|
| 3695 |
-
expando = ( "sizcache" + Math.random() ).replace( ".", "" ),
|
| 3696 |
-
|
| 3697 |
-
// Regex
|
| 3698 |
-
|
| 3699 |
-
// Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace
|
| 3700 |
-
whitespace = "[\\x20\\t\\r\\n\\f]",
|
| 3701 |
-
// http://www.w3.org/TR/css3-syntax/#characters
|
| 3702 |
-
characterEncoding = "(?:\\\\.|[-\\w]|[^\\x00-\\xa0])+",
|
| 3703 |
-
|
| 3704 |
-
// Loosely modeled on CSS identifier characters
|
| 3705 |
-
// An unquoted value should be a CSS identifier (http://www.w3.org/TR/css3-selectors/#attribute-selectors)
|
| 3706 |
-
// Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier
|
| 3707 |
-
identifier = characterEncoding.replace( "w", "w#" ),
|
| 3708 |
-
|
| 3709 |
-
// Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors
|
| 3710 |
-
operators = "([*^$|!~]?=)",
|
| 3711 |
-
attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace +
|
| 3712 |
-
"*(?:" + operators + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]",
|
| 3713 |
-
pseudos = ":(" + characterEncoding + ")(?:\\((?:(['\"])((?:\\\\.|[^\\\\])*?)\\2|((?:[^,]|\\\\,|(?:,(?=[^\\[]*\\]))|(?:,(?=[^\\(]*\\))))*))\\)|)",
|
| 3714 |
-
pos = ":(nth|eq|gt|lt|first|last|even|odd)(?:\\((\\d*)\\)|)(?=[^-]|$)",
|
| 3715 |
-
combinators = whitespace + "*([\\x20\\t\\r\\n\\f>+~])" + whitespace + "*",
|
| 3716 |
-
groups = "(?=[^\\x20\\t\\r\\n\\f])(?:\\\\.|" + attributes + "|" + pseudos.replace( 2, 7 ) + "|[^\\\\(),])+",
|
| 3717 |
-
|
| 3718 |
-
// Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
|
| 3719 |
-
rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ),
|
| 3720 |
-
|
| 3721 |
-
rcombinators = new RegExp( "^" + combinators ),
|
| 3722 |
-
|
| 3723 |
-
// All simple (non-comma) selectors, excluding insignifant trailing whitespace
|
| 3724 |
-
rgroups = new RegExp( groups + "?(?=" + whitespace + "*,|$)", "g" ),
|
| 3725 |
-
|
| 3726 |
-
// A selector, or everything after leading whitespace
|
| 3727 |
-
// Optionally followed in either case by a ")" for terminating sub-selectors
|
| 3728 |
-
rselector = new RegExp( "^(?:(?!,)(?:(?:^|,)" + whitespace + "*" + groups + ")*?|" + whitespace + "*(.*?))(\\)|$)" ),
|
| 3729 |
-
|
| 3730 |
-
// All combinators and selector components (attribute test, tag, pseudo, etc.), the latter appearing together when consecutive
|
| 3731 |
-
rtokens = new RegExp( groups.slice( 19, -6 ) + "\\x20\\t\\r\\n\\f>+~])+|" + combinators, "g" ),
|
| 3732 |
-
|
| 3733 |
-
// Easily-parseable/retrievable ID or TAG or CLASS selectors
|
| 3734 |
-
rquickExpr = /^(?:#([\w\-]+)|(\w+)|\.([\w\-]+))$/,
|
| 3735 |
-
|
| 3736 |
-
rsibling = /[\x20\t\r\n\f]*[+~]/,
|
| 3737 |
-
rendsWithNot = /:not\($/,
|
| 3738 |
-
|
| 3739 |
-
rheader = /h\d/i,
|
| 3740 |
-
rinputs = /input|select|textarea|button/i,
|
| 3741 |
-
|
| 3742 |
-
rbackslash = /\\(?!\\)/g,
|
| 3743 |
-
|
| 3744 |
-
matchExpr = {
|
| 3745 |
-
"ID": new RegExp( "^#(" + characterEncoding + ")" ),
|
| 3746 |
-
"CLASS": new RegExp( "^\\.(" + characterEncoding + ")" ),
|
| 3747 |
-
"NAME": new RegExp( "^\\[name=['\"]?(" + characterEncoding + ")['\"]?\\]" ),
|
| 3748 |
-
"TAG": new RegExp( "^(" + characterEncoding.replace( "[-", "[-\\*" ) + ")" ),
|
| 3749 |
-
"ATTR": new RegExp( "^" + attributes ),
|
| 3750 |
-
"PSEUDO": new RegExp( "^" + pseudos ),
|
| 3751 |
-
"CHILD": new RegExp( "^:(only|nth|last|first)-child(?:\\(" + whitespace +
|
| 3752 |
-
"*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace +
|
| 3753 |
-
"*(\\d+)|))" + whitespace + "*\\)|)", "i" ),
|
| 3754 |
-
"POS": new RegExp( pos, "ig" ),
|
| 3755 |
-
// For use in libraries implementing .is()
|
| 3756 |
-
"needsContext": new RegExp( "^" + whitespace + "*[>+~]|" + pos, "i" )
|
| 3757 |
-
},
|
| 3758 |
-
|
| 3759 |
-
classCache = {},
|
| 3760 |
-
cachedClasses = [],
|
| 3761 |
-
compilerCache = {},
|
| 3762 |
-
cachedSelectors = [],
|
| 3763 |
-
|
| 3764 |
-
// Mark a function for use in filtering
|
| 3765 |
-
markFunction = function( fn ) {
|
| 3766 |
-
fn.sizzleFilter = true;
|
| 3767 |
-
return fn;
|
| 3768 |
-
},
|
| 3769 |
-
|
| 3770 |
-
// Returns a function to use in pseudos for input types
|
| 3771 |
-
createInputFunction = function( type ) {
|
| 3772 |
-
return function( elem ) {
|
| 3773 |
-
// Check the input's nodeName and type
|
| 3774 |
-
return elem.nodeName.toLowerCase() === "input" && elem.type === type;
|
| 3775 |
-
};
|
| 3776 |
-
},
|
| 3777 |
-
|
| 3778 |
-
// Returns a function to use in pseudos for buttons
|
| 3779 |
-
createButtonFunction = function( type ) {
|
| 3780 |
-
return function( elem ) {
|
| 3781 |
-
var name = elem.nodeName.toLowerCase();
|
| 3782 |
-
return (name === "input" || name === "button") && elem.type === type;
|
| 3783 |
-
};
|
| 3784 |
-
},
|
| 3785 |
-
|
| 3786 |
-
// Used for testing something on an element
|
| 3787 |
-
assert = function( fn ) {
|
| 3788 |
-
var pass = false,
|
| 3789 |
-
div = document.createElement("div");
|
| 3790 |
-
try {
|
| 3791 |
-
pass = fn( div );
|
| 3792 |
-
} catch (e) {}
|
| 3793 |
-
// release memory in IE
|
| 3794 |
-
div = null;
|
| 3795 |
-
return pass;
|
| 3796 |
-
},
|
| 3797 |
-
|
| 3798 |
-
// Check if attributes should be retrieved by attribute nodes
|
| 3799 |
-
assertAttributes = assert(function( div ) {
|
| 3800 |
-
div.innerHTML = "<select></select>";
|
| 3801 |
-
var type = typeof div.lastChild.getAttribute("multiple");
|
| 3802 |
-
// IE8 returns a string for some attributes even when not present
|
| 3803 |
-
return type !== "boolean" && type !== "string";
|
| 3804 |
-
}),
|
| 3805 |
-
|
| 3806 |
-
// Check if getElementById returns elements by name
|
| 3807 |
-
// Check if getElementsByName privileges form controls or returns elements by ID
|
| 3808 |
-
assertUsableName = assert(function( div ) {
|
| 3809 |
-
// Inject content
|
| 3810 |
-
div.id = expando + 0;
|
| 3811 |
-
div.innerHTML = "<a name='" + expando + "'></a><div name='" + expando + "'></div>";
|
| 3812 |
-
docElem.insertBefore( div, docElem.firstChild );
|
| 3813 |
-
|
| 3814 |
-
// Test
|
| 3815 |
-
var pass = document.getElementsByName &&
|
| 3816 |
-
// buggy browsers will return fewer than the correct 2
|
| 3817 |
-
document.getElementsByName( expando ).length ===
|
| 3818 |
-
// buggy browsers will return more than the correct 0
|
| 3819 |
-
2 + document.getElementsByName( expando + 0 ).length;
|
| 3820 |
-
assertGetIdNotName = !document.getElementById( expando );
|
| 3821 |
-
|
| 3822 |
-
// Cleanup
|
| 3823 |
-
docElem.removeChild( div );
|
| 3824 |
-
|
| 3825 |
-
return pass;
|
| 3826 |
-
}),
|
| 3827 |
-
|
| 3828 |
-
// Check if the browser returns only elements
|
| 3829 |
-
// when doing getElementsByTagName("*")
|
| 3830 |
-
assertTagNameNoComments = assert(function( div ) {
|
| 3831 |
-
div.appendChild( document.createComment("") );
|
| 3832 |
-
return div.getElementsByTagName("*").length === 0;
|
| 3833 |
-
}),
|
| 3834 |
-
|
| 3835 |
-
// Check if getAttribute returns normalized href attributes
|
| 3836 |
-
assertHrefNotNormalized = assert(function( div ) {
|
| 3837 |
-
div.innerHTML = "<a href='#'></a>";
|
| 3838 |
-
return div.firstChild && typeof div.firstChild.getAttribute !== strundefined &&
|
| 3839 |
-
div.firstChild.getAttribute("href") === "#";
|
| 3840 |
-
}),
|
| 3841 |
-
|
| 3842 |
-
// Check if getElementsByClassName can be trusted
|
| 3843 |
-
assertUsableClassName = assert(function( div ) {
|
| 3844 |
-
// Opera can't find a second classname (in 9.6)
|
| 3845 |
-
div.innerHTML = "<div class='hidden e'></div><div class='hidden'></div>";
|
| 3846 |
-
if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) {
|
| 3847 |
-
return false;
|
| 3848 |
-
}
|
| 3849 |
-
|
| 3850 |
-
// Safari caches class attributes, doesn't catch changes (in 3.2)
|
| 3851 |
-
div.lastChild.className = "e";
|
| 3852 |
-
return div.getElementsByClassName("e").length !== 1;
|
| 3853 |
-
});
|
| 3854 |
-
|
| 3855 |
-
var Sizzle = function( selector, context, results, seed ) {
|
| 3856 |
-
results = results || [];
|
| 3857 |
-
context = context || document;
|
| 3858 |
-
var match, elem, xml, m,
|
| 3859 |
-
nodeType = context.nodeType;
|
| 3860 |
-
|
| 3861 |
-
if ( nodeType !== 1 && nodeType !== 9 ) {
|
| 3862 |
-
return [];
|
| 3863 |
-
}
|
| 3864 |
-
|
| 3865 |
-
if ( !selector || typeof selector !== "string" ) {
|
| 3866 |
-
return results;
|
| 3867 |
-
}
|
| 3868 |
-
|
| 3869 |
-
xml = isXML( context );
|
| 3870 |
-
|
| 3871 |
-
if ( !xml && !seed ) {
|
| 3872 |
-
if ( (match = rquickExpr.exec( selector )) ) {
|
| 3873 |
-
// Speed-up: Sizzle("#ID")
|
| 3874 |
-
if ( (m = match[1]) ) {
|
| 3875 |
-
if ( nodeType === 9 ) {
|
| 3876 |
-
elem = context.getElementById( m );
|
| 3877 |
-
// Check parentNode to catch when Blackberry 4.6 returns
|
| 3878 |
-
// nodes that are no longer in the document #6963
|
| 3879 |
-
if ( elem && elem.parentNode ) {
|
| 3880 |
-
// Handle the case where IE, Opera, and Webkit return items
|
| 3881 |
-
// by name instead of ID
|
| 3882 |
-
if ( elem.id === m ) {
|
| 3883 |
-
results.push( elem );
|
| 3884 |
-
return results;
|
| 3885 |
-
}
|
| 3886 |
-
} else {
|
| 3887 |
-
return results;
|
| 3888 |
-
}
|
| 3889 |
-
} else {
|
| 3890 |
-
// Context is not a document
|
| 3891 |
-
if ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) &&
|
| 3892 |
-
contains( context, elem ) && elem.id === m ) {
|
| 3893 |
-
results.push( elem );
|
| 3894 |
-
return results;
|
| 3895 |
-
}
|
| 3896 |
-
}
|
| 3897 |
-
|
| 3898 |
-
// Speed-up: Sizzle("TAG")
|
| 3899 |
-
} else if ( match[2] ) {
|
| 3900 |
-
push.apply( results, slice.call(context.getElementsByTagName( selector ), 0) );
|
| 3901 |
-
return results;
|
| 3902 |
-
|
| 3903 |
-
// Speed-up: Sizzle(".CLASS")
|
| 3904 |
-
} else if ( (m = match[3]) && assertUsableClassName && context.getElementsByClassName ) {
|
| 3905 |
-
push.apply( results, slice.call(context.getElementsByClassName( m ), 0) );
|
| 3906 |
-
return results;
|
| 3907 |
-
}
|
| 3908 |
-
}
|
| 3909 |
-
}
|
| 3910 |
-
|
| 3911 |
-
// All others
|
| 3912 |
-
return select( selector, context, results, seed, xml );
|
| 3913 |
-
};
|
| 3914 |
-
|
| 3915 |
-
var Expr = Sizzle.selectors = {
|
| 3916 |
-
|
| 3917 |
-
// Can be adjusted by the user
|
| 3918 |
-
cacheLength: 50,
|
| 3919 |
-
|
| 3920 |
-
match: matchExpr,
|
| 3921 |
-
|
| 3922 |
-
order: [ "ID", "TAG" ],
|
| 3923 |
-
|
| 3924 |
-
attrHandle: {},
|
| 3925 |
-
|
| 3926 |
-
createPseudo: markFunction,
|
| 3927 |
-
|
| 3928 |
-
find: {
|
| 3929 |
-
"ID": assertGetIdNotName ?
|
| 3930 |
-
function( id, context, xml ) {
|
| 3931 |
-
if ( typeof context.getElementById !== strundefined && !xml ) {
|
| 3932 |
-
var m = context.getElementById( id );
|
| 3933 |
-
// Check parentNode to catch when Blackberry 4.6 returns
|
| 3934 |
-
// nodes that are no longer in the document #6963
|
| 3935 |
-
return m && m.parentNode ? [m] : [];
|
| 3936 |
-
}
|
| 3937 |
-
} :
|
| 3938 |
-
function( id, context, xml ) {
|
| 3939 |
-
if ( typeof context.getElementById !== strundefined && !xml ) {
|
| 3940 |
-
var m = context.getElementById( id );
|
| 3941 |
-
|
| 3942 |
-
return m ?
|
| 3943 |
-
m.id === id || typeof m.getAttributeNode !== strundefined && m.getAttributeNode("id").value === id ?
|
| 3944 |
-
[m] :
|
| 3945 |
-
undefined :
|
| 3946 |
-
[];
|
| 3947 |
-
}
|
| 3948 |
-
},
|
| 3949 |
-
|
| 3950 |
-
"TAG": assertTagNameNoComments ?
|
| 3951 |
-
function( tag, context ) {
|
| 3952 |
-
if ( typeof context.getElementsByTagName !== strundefined ) {
|
| 3953 |
-
return context.getElementsByTagName( tag );
|
| 3954 |
-
}
|
| 3955 |
-
} :
|
| 3956 |
-
function( tag, context ) {
|
| 3957 |
-
var results = context.getElementsByTagName( tag );
|
| 3958 |
-
|
| 3959 |
-
// Filter out possible comments
|
| 3960 |
-
if ( tag === "*" ) {
|
| 3961 |
-
var elem,
|
| 3962 |
-
tmp = [],
|
| 3963 |
-
i = 0;
|
| 3964 |
-
|
| 3965 |
-
for ( ; (elem = results[i]); i++ ) {
|
| 3966 |
-
if ( elem.nodeType === 1 ) {
|
| 3967 |
-
tmp.push( elem );
|
| 3968 |
-
}
|
| 3969 |
-
}
|
| 3970 |
-
|
| 3971 |
-
return tmp;
|
| 3972 |
-
}
|
| 3973 |
-
return results;
|
| 3974 |
-
}
|
| 3975 |
-
},
|
| 3976 |
-
|
| 3977 |
-
relative: {
|
| 3978 |
-
">": { dir: "parentNode", first: true },
|
| 3979 |
-
" ": { dir: "parentNode" },
|
| 3980 |
-
"+": { dir: "previousSibling", first: true },
|
| 3981 |
-
"~": { dir: "previousSibling" }
|
| 3982 |
-
},
|
| 3983 |
-
|
| 3984 |
-
preFilter: {
|
| 3985 |
-
"ATTR": function( match ) {
|
| 3986 |
-
match[1] = match[1].replace( rbackslash, "" );
|
| 3987 |
-
|
| 3988 |
-
// Move the given value to match[3] whether quoted or unquoted
|
| 3989 |
-
match[3] = ( match[4] || match[5] || "" ).replace( rbackslash, "" );
|
| 3990 |
-
|
| 3991 |
-
if ( match[2] === "~=" ) {
|
| 3992 |
-
match[3] = " " + match[3] + " ";
|
| 3993 |
-
}
|
| 3994 |
-
|
| 3995 |
-
return match.slice( 0, 4 );
|
| 3996 |
-
},
|
| 3997 |
-
|
| 3998 |
-
"CHILD": function( match ) {
|
| 3999 |
-
/* matches from matchExpr.CHILD
|
| 4000 |
-
1 type (only|nth|...)
|
| 4001 |
-
2 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
|
| 4002 |
-
3 xn-component of xn+y argument ([+-]?\d*n|)
|
| 4003 |
-
4 sign of xn-component
|
| 4004 |
-
5 x of xn-component
|
| 4005 |
-
6 sign of y-component
|
| 4006 |
-
7 y of y-component
|
| 4007 |
-
*/
|
| 4008 |
-
match[1] = match[1].toLowerCase();
|
| 4009 |
-
|
| 4010 |
-
if ( match[1] === "nth" ) {
|
| 4011 |
-
// nth-child requires argument
|
| 4012 |
-
if ( !match[2] ) {
|
| 4013 |
-
Sizzle.error( match[0] );
|
| 4014 |
-
}
|
| 4015 |
-
|
| 4016 |
-
// numeric x and y parameters for Expr.filter.CHILD
|
| 4017 |
-
// remember that false/true cast respectively to 0/1
|
| 4018 |
-
match[3] = +( match[3] ? match[4] + (match[5] || 1) : 2 * ( match[2] === "even" || match[2] === "odd" ) );
|
| 4019 |
-
match[4] = +( ( match[6] + match[7] ) || match[2] === "odd" );
|
| 4020 |
-
|
| 4021 |
-
// other types prohibit arguments
|
| 4022 |
-
} else if ( match[2] ) {
|
| 4023 |
-
Sizzle.error( match[0] );
|
| 4024 |
-
}
|
| 4025 |
-
|
| 4026 |
-
return match;
|
| 4027 |
-
},
|
| 4028 |
-
|
| 4029 |
-
"PSEUDO": function( match ) {
|
| 4030 |
-
var argument,
|
| 4031 |
-
unquoted = match[4];
|
| 4032 |
-
|
| 4033 |
-
if ( matchExpr["CHILD"].test( match[0] ) ) {
|
| 4034 |
-
return null;
|
| 4035 |
-
}
|
| 4036 |
-
|
| 4037 |
-
// Relinquish our claim on characters in `unquoted` from a closing parenthesis on
|
| 4038 |
-
if ( unquoted && (argument = rselector.exec( unquoted )) && argument.pop() ) {
|
| 4039 |
-
|
| 4040 |
-
match[0] = match[0].slice( 0, argument[0].length - unquoted.length - 1 );
|
| 4041 |
-
unquoted = argument[0].slice( 0, -1 );
|
| 4042 |
-
}
|
| 4043 |
-
|
| 4044 |
-
// Quoted or unquoted, we have the full argument
|
| 4045 |
-
// Return only captures needed by the pseudo filter method (type and argument)
|
| 4046 |
-
match.splice( 2, 3, unquoted || match[3] );
|
| 4047 |
-
return match;
|
| 4048 |
-
}
|
| 4049 |
-
},
|
| 4050 |
-
|
| 4051 |
-
filter: {
|
| 4052 |
-
"ID": assertGetIdNotName ?
|
| 4053 |
-
function( id ) {
|
| 4054 |
-
id = id.replace( rbackslash, "" );
|
| 4055 |
-
return function( elem ) {
|
| 4056 |
-
return elem.getAttribute("id") === id;
|
| 4057 |
-
};
|
| 4058 |
-
} :
|
| 4059 |
-
function( id ) {
|
| 4060 |
-
id = id.replace( rbackslash, "" );
|
| 4061 |
-
return function( elem ) {
|
| 4062 |
-
var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id");
|
| 4063 |
-
return node && node.value === id;
|
| 4064 |
-
};
|
| 4065 |
-
},
|
| 4066 |
-
|
| 4067 |
-
"TAG": function( nodeName ) {
|
| 4068 |
-
if ( nodeName === "*" ) {
|
| 4069 |
-
return function() { return true; };
|
| 4070 |
-
}
|
| 4071 |
-
nodeName = nodeName.replace( rbackslash, "" ).toLowerCase();
|
| 4072 |
-
|
| 4073 |
-
return function( elem ) {
|
| 4074 |
-
return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
|
| 4075 |
-
};
|
| 4076 |
-
},
|
| 4077 |
-
|
| 4078 |
-
"CLASS": function( className ) {
|
| 4079 |
-
var pattern = classCache[ className ];
|
| 4080 |
-
if ( !pattern ) {
|
| 4081 |
-
pattern = classCache[ className ] = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" );
|
| 4082 |
-
cachedClasses.push( className );
|
| 4083 |
-
// Avoid too large of a cache
|
| 4084 |
-
if ( cachedClasses.length > Expr.cacheLength ) {
|
| 4085 |
-
delete classCache[ cachedClasses.shift() ];
|
| 4086 |
-
}
|
| 4087 |
-
}
|
| 4088 |
-
return function( elem ) {
|
| 4089 |
-
return pattern.test( elem.className || (typeof elem.getAttribute !== strundefined && elem.getAttribute("class")) || "" );
|
| 4090 |
-
};
|
| 4091 |
-
},
|
| 4092 |
-
|
| 4093 |
-
"ATTR": function( name, operator, check ) {
|
| 4094 |
-
if ( !operator ) {
|
| 4095 |
-
return function( elem ) {
|
| 4096 |
-
return Sizzle.attr( elem, name ) != null;
|
| 4097 |
-
};
|
| 4098 |
-
}
|
| 4099 |
-
|
| 4100 |
-
return function( elem ) {
|
| 4101 |
-
var result = Sizzle.attr( elem, name ),
|
| 4102 |
-
value = result + "";
|
| 4103 |
-
|
| 4104 |
-
if ( result == null ) {
|
| 4105 |
-
return operator === "!=";
|
| 4106 |
-
}
|
| 4107 |
-
|
| 4108 |
-
switch ( operator ) {
|
| 4109 |
-
case "=":
|
| 4110 |
-
return value === check;
|
| 4111 |
-
case "!=":
|
| 4112 |
-
return value !== check;
|
| 4113 |
-
case "^=":
|
| 4114 |
-
return check && value.indexOf( check ) === 0;
|
| 4115 |
-
case "*=":
|
| 4116 |
-
return check && value.indexOf( check ) > -1;
|
| 4117 |
-
case "$=":
|
| 4118 |
-
return check && value.substr( value.length - check.length ) === check;
|
| 4119 |
-
case "~=":
|
| 4120 |
-
return ( " " + value + " " ).indexOf( check ) > -1;
|
| 4121 |
-
case "|=":
|
| 4122 |
-
return value === check || value.substr( 0, check.length + 1 ) === check + "-";
|
| 4123 |
-
}
|
| 4124 |
-
};
|
| 4125 |
-
},
|
| 4126 |
-
|
| 4127 |
-
"CHILD": function( type, argument, first, last ) {
|
| 4128 |
-
|
| 4129 |
-
if ( type === "nth" ) {
|
| 4130 |
-
var doneName = done++;
|
| 4131 |
-
|
| 4132 |
-
return function( elem ) {
|
| 4133 |
-
var parent, diff,
|
| 4134 |
-
count = 0,
|
| 4135 |
-
node = elem;
|
| 4136 |
-
|
| 4137 |
-
if ( first === 1 && last === 0 ) {
|
| 4138 |
-
return true;
|
| 4139 |
-
}
|
| 4140 |
-
|
| 4141 |
-
parent = elem.parentNode;
|
| 4142 |
-
|
| 4143 |
-
if ( parent && (parent[ expando ] !== doneName || !elem.sizset) ) {
|
| 4144 |
-
for ( node = parent.firstChild; node; node = node.nextSibling ) {
|
| 4145 |
-
if ( node.nodeType === 1 ) {
|
| 4146 |
-
node.sizset = ++count;
|
| 4147 |
-
if ( node === elem ) {
|
| 4148 |
-
break;
|
| 4149 |
-
}
|
| 4150 |
-
}
|
| 4151 |
-
}
|
| 4152 |
-
|
| 4153 |
-
parent[ expando ] = doneName;
|
| 4154 |
-
}
|
| 4155 |
-
|
| 4156 |
-
diff = elem.sizset - last;
|
| 4157 |
-
|
| 4158 |
-
if ( first === 0 ) {
|
| 4159 |
-
return diff === 0;
|
| 4160 |
-
|
| 4161 |
-
} else {
|
| 4162 |
-
return ( diff % first === 0 && diff / first >= 0 );
|
| 4163 |
-
}
|
| 4164 |
-
};
|
| 4165 |
-
}
|
| 4166 |
-
|
| 4167 |
-
return function( elem ) {
|
| 4168 |
-
var node = elem;
|
| 4169 |
-
|
| 4170 |
-
switch ( type ) {
|
| 4171 |
-
case "only":
|
| 4172 |
-
case "first":
|
| 4173 |
-
while ( (node = node.previousSibling) ) {
|
| 4174 |
-
if ( node.nodeType === 1 ) {
|
| 4175 |
-
return false;
|
| 4176 |
-
}
|
| 4177 |
-
}
|
| 4178 |
-
|
| 4179 |
-
if ( type === "first" ) {
|
| 4180 |
-
return true;
|
| 4181 |
-
}
|
| 4182 |
-
|
| 4183 |
-
node = elem;
|
| 4184 |
-
|
| 4185 |
-
/* falls through */
|
| 4186 |
-
case "last":
|
| 4187 |
-
while ( (node = node.nextSibling) ) {
|
| 4188 |
-
if ( node.nodeType === 1 ) {
|
| 4189 |
-
return false;
|
| 4190 |
-
}
|
| 4191 |
-
}
|
| 4192 |
-
|
| 4193 |
-
return true;
|
| 4194 |
-
}
|
| 4195 |
-
};
|
| 4196 |
-
},
|
| 4197 |
-
|
| 4198 |
-
"PSEUDO": function( pseudo, argument, context, xml ) {
|
| 4199 |
-
// pseudo-class names are case-insensitive
|
| 4200 |
-
// http://www.w3.org/TR/selectors/#pseudo-classes
|
| 4201 |
-
// Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
|
| 4202 |
-
var fn = Expr.pseudos[ pseudo ] || Expr.pseudos[ pseudo.toLowerCase() ];
|
| 4203 |
-
|
| 4204 |
-
if ( !fn ) {
|
| 4205 |
-
Sizzle.error( "unsupported pseudo: " + pseudo );
|
| 4206 |
-
}
|
| 4207 |
-
|
| 4208 |
-
// The user may set fn.sizzleFilter to indicate
|
| 4209 |
-
// that arguments are needed to create the filter function
|
| 4210 |
-
// just as Sizzle does
|
| 4211 |
-
if ( !fn.sizzleFilter ) {
|
| 4212 |
-
return fn;
|
| 4213 |
-
}
|
| 4214 |
-
|
| 4215 |
-
return fn( argument, context, xml );
|
| 4216 |
-
}
|
| 4217 |
-
},
|
| 4218 |
-
|
| 4219 |
-
pseudos: {
|
| 4220 |
-
"not": markFunction(function( selector, context, xml ) {
|
| 4221 |
-
// Trim the selector passed to compile
|
| 4222 |
-
// to avoid treating leading and trailing
|
| 4223 |
-
// spaces as combinators
|
| 4224 |
-
var matcher = compile( selector.replace( rtrim, "$1" ), context, xml );
|
| 4225 |
-
return function( elem ) {
|
| 4226 |
-
return !matcher( elem );
|
| 4227 |
-
};
|
| 4228 |
-
}),
|
| 4229 |
-
|
| 4230 |
-
"enabled": function( elem ) {
|
| 4231 |
-
return elem.disabled === false;
|
| 4232 |
-
},
|
| 4233 |
-
|
| 4234 |
-
"disabled": function( elem ) {
|
| 4235 |
-
return elem.disabled === true;
|
| 4236 |
-
},
|
| 4237 |
-
|
| 4238 |
-
"checked": function( elem ) {
|
| 4239 |
-
// In CSS3, :checked should return both checked and selected elements
|
| 4240 |
-
// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
|
| 4241 |
-
var nodeName = elem.nodeName.toLowerCase();
|
| 4242 |
-
return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected);
|
| 4243 |
-
},
|
| 4244 |
-
|
| 4245 |
-
"selected": function( elem ) {
|
| 4246 |
-
// Accessing this property makes selected-by-default
|
| 4247 |
-
// options in Safari work properly
|
| 4248 |
-
if ( elem.parentNode ) {
|
| 4249 |
-
elem.parentNode.selectedIndex;
|
| 4250 |
-
}
|
| 4251 |
-
|
| 4252 |
-
return elem.selected === true;
|
| 4253 |
-
},
|
| 4254 |
-
|
| 4255 |
-
"parent": function( elem ) {
|
| 4256 |
-
return !Expr.pseudos["empty"]( elem );
|
| 4257 |
-
},
|
| 4258 |
-
|
| 4259 |
-
"empty": function( elem ) {
|
| 4260 |
-
// http://www.w3.org/TR/selectors/#empty-pseudo
|
| 4261 |
-
// :empty is only affected by element nodes and content nodes(including text(3), cdata(4)),
|
| 4262 |
-
// not comment, processing instructions, or others
|
| 4263 |
-
// Thanks to Diego Perini for the nodeName shortcut
|
| 4264 |
-
// Greater than "@" means alpha characters (specifically not starting with "#" or "?")
|
| 4265 |
-
var nodeType;
|
| 4266 |
-
elem = elem.firstChild;
|
| 4267 |
-
while ( elem ) {
|
| 4268 |
-
if ( elem.nodeName > "@" || (nodeType = elem.nodeType) === 3 || nodeType === 4 ) {
|
| 4269 |
-
return false;
|
| 4270 |
-
}
|
| 4271 |
-
elem = elem.nextSibling;
|
| 4272 |
-
}
|
| 4273 |
-
return true;
|
| 4274 |
-
},
|
| 4275 |
-
|
| 4276 |
-
"contains": markFunction(function( text ) {
|
| 4277 |
-
return function( elem ) {
|
| 4278 |
-
return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1;
|
| 4279 |
-
};
|
| 4280 |
-
}),
|
| 4281 |
-
|
| 4282 |
-
"has": markFunction(function( selector ) {
|
| 4283 |
-
return function( elem ) {
|
| 4284 |
-
return Sizzle( selector, elem ).length > 0;
|
| 4285 |
-
};
|
| 4286 |
-
}),
|
| 4287 |
-
|
| 4288 |
-
"header": function( elem ) {
|
| 4289 |
-
return rheader.test( elem.nodeName );
|
| 4290 |
-
},
|
| 4291 |
-
|
| 4292 |
-
"text": function( elem ) {
|
| 4293 |
-
var type, attr;
|
| 4294 |
-
// IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc)
|
| 4295 |
-
// use getAttribute instead to test this case
|
| 4296 |
-
return elem.nodeName.toLowerCase() === "input" &&
|
| 4297 |
-
(type = elem.type) === "text" &&
|
| 4298 |
-
( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === type );
|
| 4299 |
-
},
|
| 4300 |
-
|
| 4301 |
-
// Input types
|
| 4302 |
-
"radio": createInputFunction("radio"),
|
| 4303 |
-
"checkbox": createInputFunction("checkbox"),
|
| 4304 |
-
"file": createInputFunction("file"),
|
| 4305 |
-
"password": createInputFunction("password"),
|
| 4306 |
-
"image": createInputFunction("image"),
|
| 4307 |
-
|
| 4308 |
-
"submit": createButtonFunction("submit"),
|
| 4309 |
-
"reset": createButtonFunction("reset"),
|
| 4310 |
-
|
| 4311 |
-
"button": function( elem ) {
|
| 4312 |
-
var name = elem.nodeName.toLowerCase();
|
| 4313 |
-
return name === "input" && elem.type === "button" || name === "button";
|
| 4314 |
-
},
|
| 4315 |
-
|
| 4316 |
-
"input": function( elem ) {
|
| 4317 |
-
return rinputs.test( elem.nodeName );
|
| 4318 |
-
},
|
| 4319 |
-
|
| 4320 |
-
"focus": function( elem ) {
|
| 4321 |
-
var doc = elem.ownerDocument;
|
| 4322 |
-
return elem === doc.activeElement && (!doc.hasFocus || doc.hasFocus()) && !!(elem.type || elem.href);
|
| 4323 |
-
},
|
| 4324 |
-
|
| 4325 |
-
"active": function( elem ) {
|
| 4326 |
-
return elem === elem.ownerDocument.activeElement;
|
| 4327 |
-
}
|
| 4328 |
-
},
|
| 4329 |
-
|
| 4330 |
-
setFilters: {
|
| 4331 |
-
"first": function( elements, argument, not ) {
|
| 4332 |
-
return not ? elements.slice( 1 ) : [ elements[0] ];
|
| 4333 |
-
},
|
| 4334 |
-
|
| 4335 |
-
"last": function( elements, argument, not ) {
|
| 4336 |
-
var elem = elements.pop();
|
| 4337 |
-
return not ? elements : [ elem ];
|
| 4338 |
-
},
|
| 4339 |
-
|
| 4340 |
-
"even": function( elements, argument, not ) {
|
| 4341 |
-
var results = [],
|
| 4342 |
-
i = not ? 1 : 0,
|
| 4343 |
-
len = elements.length;
|
| 4344 |
-
for ( ; i < len; i = i + 2 ) {
|
| 4345 |
-
results.push( elements[i] );
|
| 4346 |
-
}
|
| 4347 |
-
return results;
|
| 4348 |
-
},
|
| 4349 |
-
|
| 4350 |
-
"odd": function( elements, argument, not ) {
|
| 4351 |
-
var results = [],
|
| 4352 |
-
i = not ? 0 : 1,
|
| 4353 |
-
len = elements.length;
|
| 4354 |
-
for ( ; i < len; i = i + 2 ) {
|
| 4355 |
-
results.push( elements[i] );
|
| 4356 |
-
}
|
| 4357 |
-
return results;
|
| 4358 |
-
},
|
| 4359 |
-
|
| 4360 |
-
"lt": function( elements, argument, not ) {
|
| 4361 |
-
return not ? elements.slice( +argument ) : elements.slice( 0, +argument );
|
| 4362 |
-
},
|
| 4363 |
-
|
| 4364 |
-
"gt": function( elements, argument, not ) {
|
| 4365 |
-
return not ? elements.slice( 0, +argument + 1 ) : elements.slice( +argument + 1 );
|
| 4366 |
-
},
|
| 4367 |
-
|
| 4368 |
-
"eq": function( elements, argument, not ) {
|
| 4369 |
-
var elem = elements.splice( +argument, 1 );
|
| 4370 |
-
return not ? elements : elem;
|
| 4371 |
-
}
|
| 4372 |
-
}
|
| 4373 |
-
};
|
| 4374 |
-
|
| 4375 |
-
// Deprecated
|
| 4376 |
-
Expr.setFilters["nth"] = Expr.setFilters["eq"];
|
| 4377 |
-
|
| 4378 |
-
// Back-compat
|
| 4379 |
-
Expr.filters = Expr.pseudos;
|
| 4380 |
-
|
| 4381 |
-
// IE6/7 return a modified href
|
| 4382 |
-
if ( !assertHrefNotNormalized ) {
|
| 4383 |
-
Expr.attrHandle = {
|
| 4384 |
-
"href": function( elem ) {
|
| 4385 |
-
return elem.getAttribute( "href", 2 );
|
| 4386 |
-
},
|
| 4387 |
-
"type": function( elem ) {
|
| 4388 |
-
return elem.getAttribute("type");
|
| 4389 |
-
}
|
| 4390 |
-
};
|
| 4391 |
-
}
|
| 4392 |
-
|
| 4393 |
-
// Add getElementsByName if usable
|
| 4394 |
-
if ( assertUsableName ) {
|
| 4395 |
-
Expr.order.push("NAME");
|
| 4396 |
-
Expr.find["NAME"] = function( name, context ) {
|
| 4397 |
-
if ( typeof context.getElementsByName !== strundefined ) {
|
| 4398 |
-
return context.getElementsByName( name );
|
| 4399 |
-
}
|
| 4400 |
-
};
|
| 4401 |
-
}
|
| 4402 |
-
|
| 4403 |
-
// Add getElementsByClassName if usable
|
| 4404 |
-
if ( assertUsableClassName ) {
|
| 4405 |
-
Expr.order.splice( 1, 0, "CLASS" );
|
| 4406 |
-
Expr.find["CLASS"] = function( className, context, xml ) {
|
| 4407 |
-
if ( typeof context.getElementsByClassName !== strundefined && !xml ) {
|
| 4408 |
-
return context.getElementsByClassName( className );
|
| 4409 |
-
}
|
| 4410 |
-
};
|
| 4411 |
-
}
|
| 4412 |
-
|
| 4413 |
-
// If slice is not available, provide a backup
|
| 4414 |
-
try {
|
| 4415 |
-
slice.call( docElem.childNodes, 0 )[0].nodeType;
|
| 4416 |
-
} catch ( e ) {
|
| 4417 |
-
slice = function( i ) {
|
| 4418 |
-
var elem, results = [];
|
| 4419 |
-
for ( ; (elem = this[i]); i++ ) {
|
| 4420 |
-
results.push( elem );
|
| 4421 |
-
}
|
| 4422 |
-
return results;
|
| 4423 |
-
};
|
| 4424 |
-
}
|
| 4425 |
-
|
| 4426 |
-
var isXML = Sizzle.isXML = function( elem ) {
|
| 4427 |
-
// documentElement is verified for cases where it doesn't yet exist
|
| 4428 |
-
// (such as loading iframes in IE - #4833)
|
| 4429 |
-
var documentElement = elem && (elem.ownerDocument || elem).documentElement;
|
| 4430 |
-
return documentElement ? documentElement.nodeName !== "HTML" : false;
|
| 4431 |
-
};
|
| 4432 |
-
|
| 4433 |
-
// Element contains another
|
| 4434 |
-
var contains = Sizzle.contains = docElem.compareDocumentPosition ?
|
| 4435 |
-
function( a, b ) {
|
| 4436 |
-
return !!( a.compareDocumentPosition( b ) & 16 );
|
| 4437 |
-
} :
|
| 4438 |
-
docElem.contains ?
|
| 4439 |
-
function( a, b ) {
|
| 4440 |
-
var adown = a.nodeType === 9 ? a.documentElement : a,
|
| 4441 |
-
bup = b.parentNode;
|
| 4442 |
-
return a === bup || !!( bup && bup.nodeType === 1 && adown.contains && adown.contains(bup) );
|
| 4443 |
-
} :
|
| 4444 |
-
function( a, b ) {
|
| 4445 |
-
while ( (b = b.parentNode) ) {
|
| 4446 |
-
if ( b === a ) {
|
| 4447 |
-
return true;
|
| 4448 |
-
}
|
| 4449 |
-
}
|
| 4450 |
-
return false;
|
| 4451 |
-
};
|
| 4452 |
-
|
| 4453 |
-
/**
|
| 4454 |
-
* Utility function for retrieving the text value of an array of DOM nodes
|
| 4455 |
-
* @param {Array|Element} elem
|
| 4456 |
-
*/
|
| 4457 |
-
var getText = Sizzle.getText = function( elem ) {
|
| 4458 |
-
var node,
|
| 4459 |
-
ret = "",
|
| 4460 |
-
i = 0,
|
| 4461 |
-
nodeType = elem.nodeType;
|
| 4462 |
-
|
| 4463 |
-
if ( nodeType ) {
|
| 4464 |
-
if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {
|
| 4465 |
-
// Use textContent for elements
|
| 4466 |
-
// innerText usage removed for consistency of new lines (see #11153)
|
| 4467 |
-
if ( typeof elem.textContent === "string" ) {
|
| 4468 |
-
return elem.textContent;
|
| 4469 |
-
} else {
|
| 4470 |
-
// Traverse its children
|
| 4471 |
-
for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
|
| 4472 |
-
ret += getText( elem );
|
| 4473 |
-
}
|
| 4474 |
-
}
|
| 4475 |
-
} else if ( nodeType === 3 || nodeType === 4 ) {
|
| 4476 |
-
return elem.nodeValue;
|
| 4477 |
-
}
|
| 4478 |
-
// Do not include comment or processing instruction nodes
|
| 4479 |
-
} else {
|
| 4480 |
-
|
| 4481 |
-
// If no nodeType, this is expected to be an array
|
| 4482 |
-
for ( ; (node = elem[i]); i++ ) {
|
| 4483 |
-
// Do not traverse comment nodes
|
| 4484 |
-
ret += getText( node );
|
| 4485 |
-
}
|
| 4486 |
-
}
|
| 4487 |
-
return ret;
|
| 4488 |
-
};
|
| 4489 |
-
|
| 4490 |
-
Sizzle.attr = function( elem, name ) {
|
| 4491 |
-
var attr,
|
| 4492 |
-
xml = isXML( elem );
|
| 4493 |
-
|
| 4494 |
-
if ( !xml ) {
|
| 4495 |
-
name = name.toLowerCase();
|
| 4496 |
-
}
|
| 4497 |
-
if ( Expr.attrHandle[ name ] ) {
|
| 4498 |
-
return Expr.attrHandle[ name ]( elem );
|
| 4499 |
-
}
|
| 4500 |
-
if ( assertAttributes || xml ) {
|
| 4501 |
-
return elem.getAttribute( name );
|
| 4502 |
-
}
|
| 4503 |
-
attr = elem.getAttributeNode( name );
|
| 4504 |
-
return attr ?
|
| 4505 |
-
typeof elem[ name ] === "boolean" ?
|
| 4506 |
-
elem[ name ] ? name : null :
|
| 4507 |
-
attr.specified ? attr.value : null :
|
| 4508 |
-
null;
|
| 4509 |
-
};
|
| 4510 |
-
|
| 4511 |
-
Sizzle.error = function( msg ) {
|
| 4512 |
-
throw new Error( "Syntax error, unrecognized expression: " + msg );
|
| 4513 |
-
};
|
| 4514 |
-
|
| 4515 |
-
// Check if the JavaScript engine is using some sort of
|
| 4516 |
-
// optimization where it does not always call our comparision
|
| 4517 |
-
// function. If that is the case, discard the hasDuplicate value.
|
| 4518 |
-
// Thus far that includes Google Chrome.
|
| 4519 |
-
[0, 0].sort(function() {
|
| 4520 |
-
return (baseHasDuplicate = 0);
|
| 4521 |
-
});
|
| 4522 |
-
|
| 4523 |
-
|
| 4524 |
-
if ( docElem.compareDocumentPosition ) {
|
| 4525 |
-
sortOrder = function( a, b ) {
|
| 4526 |
-
if ( a === b ) {
|
| 4527 |
-
hasDuplicate = true;
|
| 4528 |
-
return 0;
|
| 4529 |
-
}
|
| 4530 |
-
|
| 4531 |
-
return ( !a.compareDocumentPosition || !b.compareDocumentPosition ?
|
| 4532 |
-
a.compareDocumentPosition :
|
| 4533 |
-
a.compareDocumentPosition(b) & 4
|
| 4534 |
-
) ? -1 : 1;
|
| 4535 |
-
};
|
| 4536 |
-
|
| 4537 |
-
} else {
|
| 4538 |
-
sortOrder = function( a, b ) {
|
| 4539 |
-
// The nodes are identical, we can exit early
|
| 4540 |
-
if ( a === b ) {
|
| 4541 |
-
hasDuplicate = true;
|
| 4542 |
-
return 0;
|
| 4543 |
-
|
| 4544 |
-
// Fallback to using sourceIndex (in IE) if it's available on both nodes
|
| 4545 |
-
} else if ( a.sourceIndex && b.sourceIndex ) {
|
| 4546 |
-
return a.sourceIndex - b.sourceIndex;
|
| 4547 |
-
}
|
| 4548 |
-
|
| 4549 |
-
var al, bl,
|
| 4550 |
-
ap = [],
|
| 4551 |
-
bp = [],
|
| 4552 |
-
aup = a.parentNode,
|
| 4553 |
-
bup = b.parentNode,
|
| 4554 |
-
cur = aup;
|
| 4555 |
-
|
| 4556 |
-
// If the nodes are siblings (or identical) we can do a quick check
|
| 4557 |
-
if ( aup === bup ) {
|
| 4558 |
-
return siblingCheck( a, b );
|
| 4559 |
-
|
| 4560 |
-
// If no parents were found then the nodes are disconnected
|
| 4561 |
-
} else if ( !aup ) {
|
| 4562 |
-
return -1;
|
| 4563 |
-
|
| 4564 |
-
} else if ( !bup ) {
|
| 4565 |
-
return 1;
|
| 4566 |
-
}
|
| 4567 |
-
|
| 4568 |
-
// Otherwise they're somewhere else in the tree so we need
|
| 4569 |
-
// to build up a full list of the parentNodes for comparison
|
| 4570 |
-
while ( cur ) {
|
| 4571 |
-
ap.unshift( cur );
|
| 4572 |
-
cur = cur.parentNode;
|
| 4573 |
-
}
|
| 4574 |
-
|
| 4575 |
-
cur = bup;
|
| 4576 |
-
|
| 4577 |
-
while ( cur ) {
|
| 4578 |
-
bp.unshift( cur );
|
| 4579 |
-
cur = cur.parentNode;
|
| 4580 |
-
}
|
| 4581 |
-
|
| 4582 |
-
al = ap.length;
|
| 4583 |
-
bl = bp.length;
|
| 4584 |
-
|
| 4585 |
-
// Start walking down the tree looking for a discrepancy
|
| 4586 |
-
for ( var i = 0; i < al && i < bl; i++ ) {
|
| 4587 |
-
if ( ap[i] !== bp[i] ) {
|
| 4588 |
-
return siblingCheck( ap[i], bp[i] );
|
| 4589 |
-
}
|
| 4590 |
-
}
|
| 4591 |
-
|
| 4592 |
-
// We ended someplace up the tree so do a sibling check
|
| 4593 |
-
return i === al ?
|
| 4594 |
-
siblingCheck( a, bp[i], -1 ) :
|
| 4595 |
-
siblingCheck( ap[i], b, 1 );
|
| 4596 |
-
};
|
| 4597 |
-
|
| 4598 |
-
siblingCheck = function( a, b, ret ) {
|
| 4599 |
-
if ( a === b ) {
|
| 4600 |
-
return ret;
|
| 4601 |
-
}
|
| 4602 |
-
|
| 4603 |
-
var cur = a.nextSibling;
|
| 4604 |
-
|
| 4605 |
-
while ( cur ) {
|
| 4606 |
-
if ( cur === b ) {
|
| 4607 |
-
return -1;
|
| 4608 |
-
}
|
| 4609 |
-
|
| 4610 |
-
cur = cur.nextSibling;
|
| 4611 |
-
}
|
| 4612 |
-
|
| 4613 |
-
return 1;
|
| 4614 |
-
};
|
| 4615 |
-
}
|
| 4616 |
-
|
| 4617 |
-
// Document sorting and removing duplicates
|
| 4618 |
-
Sizzle.uniqueSort = function( results ) {
|
| 4619 |
-
var elem,
|
| 4620 |
-
i = 1;
|
| 4621 |
-
|
| 4622 |
-
if ( sortOrder ) {
|
| 4623 |
-
hasDuplicate = baseHasDuplicate;
|
| 4624 |
-
results.sort( sortOrder );
|
| 4625 |
-
|
| 4626 |
-
if ( hasDuplicate ) {
|
| 4627 |
-
for ( ; (elem = results[i]); i++ ) {
|
| 4628 |
-
if ( elem === results[ i - 1 ] ) {
|
| 4629 |
-
results.splice( i--, 1 );
|
| 4630 |
-
}
|
| 4631 |
-
}
|
| 4632 |
-
}
|
| 4633 |
-
}
|
| 4634 |
-
|
| 4635 |
-
return results;
|
| 4636 |
-
};
|
| 4637 |
-
|
| 4638 |
-
function multipleContexts( selector, contexts, results, seed ) {
|
| 4639 |
-
var i = 0,
|
| 4640 |
-
len = contexts.length;
|
| 4641 |
-
for ( ; i < len; i++ ) {
|
| 4642 |
-
Sizzle( selector, contexts[i], results, seed );
|
| 4643 |
-
}
|
| 4644 |
-
}
|
| 4645 |
-
|
| 4646 |
-
function handlePOSGroup( selector, posfilter, argument, contexts, seed, not ) {
|
| 4647 |
-
var results,
|
| 4648 |
-
fn = Expr.setFilters[ posfilter.toLowerCase() ];
|
| 4649 |
-
|
| 4650 |
-
if ( !fn ) {
|
| 4651 |
-
Sizzle.error( posfilter );
|
| 4652 |
-
}
|
| 4653 |
-
|
| 4654 |
-
if ( selector || !(results = seed) ) {
|
| 4655 |
-
multipleContexts( selector || "*", contexts, (results = []), seed );
|
| 4656 |
-
}
|
| 4657 |
-
|
| 4658 |
-
return results.length > 0 ? fn( results, argument, not ) : [];
|
| 4659 |
-
}
|
| 4660 |
-
|
| 4661 |
-
function handlePOS( selector, context, results, seed, groups ) {
|
| 4662 |
-
var match, not, anchor, ret, elements, currentContexts, part, lastIndex,
|
| 4663 |
-
i = 0,
|
| 4664 |
-
len = groups.length,
|
| 4665 |
-
rpos = matchExpr["POS"],
|
| 4666 |
-
// This is generated here in case matchExpr["POS"] is extended
|
| 4667 |
-
rposgroups = new RegExp( "^" + rpos.source + "(?!" + whitespace + ")", "i" ),
|
| 4668 |
-
// This is for making sure non-participating
|
| 4669 |
-
// matching groups are represented cross-browser (IE6-8)
|
| 4670 |
-
setUndefined = function() {
|
| 4671 |
-
var i = 1,
|
| 4672 |
-
len = arguments.length - 2;
|
| 4673 |
-
for ( ; i < len; i++ ) {
|
| 4674 |
-
if ( arguments[i] === undefined ) {
|
| 4675 |
-
match[i] = undefined;
|
| 4676 |
-
}
|
| 4677 |
-
}
|
| 4678 |
-
};
|
| 4679 |
-
|
| 4680 |
-
for ( ; i < len; i++ ) {
|
| 4681 |
-
// Reset regex index to 0
|
| 4682 |
-
rpos.exec("");
|
| 4683 |
-
selector = groups[i];
|
| 4684 |
-
ret = [];
|
| 4685 |
-
anchor = 0;
|
| 4686 |
-
elements = seed;
|
| 4687 |
-
while ( (match = rpos.exec( selector )) ) {
|
| 4688 |
-
lastIndex = rpos.lastIndex = match.index + match[0].length;
|
| 4689 |
-
if ( lastIndex > anchor ) {
|
| 4690 |
-
part = selector.slice( anchor, match.index );
|
| 4691 |
-
anchor = lastIndex;
|
| 4692 |
-
currentContexts = [ context ];
|
| 4693 |
-
|
| 4694 |
-
if ( rcombinators.test(part) ) {
|
| 4695 |
-
if ( elements ) {
|
| 4696 |
-
currentContexts = elements;
|
| 4697 |
-
}
|
| 4698 |
-
elements = seed;
|
| 4699 |
-
}
|
| 4700 |
-
|
| 4701 |
-
if ( (not = rendsWithNot.test( part )) ) {
|
| 4702 |
-
part = part.slice( 0, -5 ).replace( rcombinators, "$&*" );
|
| 4703 |
-
}
|
| 4704 |
-
|
| 4705 |
-
if ( match.length > 1 ) {
|
| 4706 |
-
match[0].replace( rposgroups, setUndefined );
|
| 4707 |
-
}
|
| 4708 |
-
elements = handlePOSGroup( part, match[1], match[2], currentContexts, elements, not );
|
| 4709 |
-
}
|
| 4710 |
-
}
|
| 4711 |
-
|
| 4712 |
-
if ( elements ) {
|
| 4713 |
-
ret = ret.concat( elements );
|
| 4714 |
-
|
| 4715 |
-
if ( (part = selector.slice( anchor )) && part !== ")" ) {
|
| 4716 |
-
if ( rcombinators.test(part) ) {
|
| 4717 |
-
multipleContexts( part, ret, results, seed );
|
| 4718 |
-
} else {
|
| 4719 |
-
Sizzle( part, context, results, seed ? seed.concat(elements) : elements );
|
| 4720 |
-
}
|
| 4721 |
-
} else {
|
| 4722 |
-
push.apply( results, ret );
|
| 4723 |
-
}
|
| 4724 |
-
} else {
|
| 4725 |
-
Sizzle( selector, context, results, seed );
|
| 4726 |
-
}
|
| 4727 |
-
}
|
| 4728 |
-
|
| 4729 |
-
// Do not sort if this is a single filter
|
| 4730 |
-
return len === 1 ? results : Sizzle.uniqueSort( results );
|
| 4731 |
-
}
|
| 4732 |
-
|
| 4733 |
-
function tokenize( selector, context, xml ) {
|
| 4734 |
-
var tokens, soFar, type,
|
| 4735 |
-
groups = [],
|
| 4736 |
-
i = 0,
|
| 4737 |
-
|
| 4738 |
-
// Catch obvious selector issues: terminal ")"; nonempty fallback match
|
| 4739 |
-
// rselector never fails to match *something*
|
| 4740 |
-
match = rselector.exec( selector ),
|
| 4741 |
-
matched = !match.pop() && !match.pop(),
|
| 4742 |
-
selectorGroups = matched && selector.match( rgroups ) || [""],
|
| 4743 |
-
|
| 4744 |
-
preFilters = Expr.preFilter,
|
| 4745 |
-
filters = Expr.filter,
|
| 4746 |
-
checkContext = !xml && context !== document;
|
| 4747 |
-
|
| 4748 |
-
for ( ; (soFar = selectorGroups[i]) != null && matched; i++ ) {
|
| 4749 |
-
groups.push( tokens = [] );
|
| 4750 |
-
|
| 4751 |
-
// Need to make sure we're within a narrower context if necessary
|
| 4752 |
-
// Adding a descendant combinator will generate what is needed
|
| 4753 |
-
if ( checkContext ) {
|
| 4754 |
-
soFar = " " + soFar;
|
| 4755 |
-
}
|
| 4756 |
-
|
| 4757 |
-
while ( soFar ) {
|
| 4758 |
-
matched = false;
|
| 4759 |
-
|
| 4760 |
-
// Combinators
|
| 4761 |
-
if ( (match = rcombinators.exec( soFar )) ) {
|
| 4762 |
-
soFar = soFar.slice( match[0].length );
|
| 4763 |
-
|
| 4764 |
-
// Cast descendant combinators to space
|
| 4765 |
-
matched = tokens.push({ part: match.pop().replace( rtrim, " " ), captures: match });
|
| 4766 |
-
}
|
| 4767 |
-
|
| 4768 |
-
// Filters
|
| 4769 |
-
for ( type in filters ) {
|
| 4770 |
-
if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] ||
|
| 4771 |
-
(match = preFilters[ type ]( match, context, xml )) ) ) {
|
| 4772 |
-
|
| 4773 |
-
soFar = soFar.slice( match.shift().length );
|
| 4774 |
-
matched = tokens.push({ part: type, captures: match });
|
| 4775 |
-
}
|
| 4776 |
-
}
|
| 4777 |
-
|
| 4778 |
-
if ( !matched ) {
|
| 4779 |
-
break;
|
| 4780 |
-
}
|
| 4781 |
-
}
|
| 4782 |
-
}
|
| 4783 |
-
|
| 4784 |
-
if ( !matched ) {
|
| 4785 |
-
Sizzle.error( selector );
|
| 4786 |
-
}
|
| 4787 |
-
|
| 4788 |
-
return groups;
|
| 4789 |
-
}
|
| 4790 |
-
|
| 4791 |
-
function addCombinator( matcher, combinator, context ) {
|
| 4792 |
-
var dir = combinator.dir,
|
| 4793 |
-
doneName = done++;
|
| 4794 |
-
|
| 4795 |
-
if ( !matcher ) {
|
| 4796 |
-
// If there is no matcher to check, check against the context
|
| 4797 |
-
matcher = function( elem ) {
|
| 4798 |
-
return elem === context;
|
| 4799 |
-
};
|
| 4800 |
-
}
|
| 4801 |
-
return combinator.first ?
|
| 4802 |
-
function( elem, context ) {
|
| 4803 |
-
while ( (elem = elem[ dir ]) ) {
|
| 4804 |
-
if ( elem.nodeType === 1 ) {
|
| 4805 |
-
return matcher( elem, context ) && elem;
|
| 4806 |
-
}
|
| 4807 |
-
}
|
| 4808 |
-
} :
|
| 4809 |
-
function( elem, context ) {
|
| 4810 |
-
var cache,
|
| 4811 |
-
dirkey = doneName + "." + dirruns,
|
| 4812 |
-
cachedkey = dirkey + "." + cachedruns;
|
| 4813 |
-
while ( (elem = elem[ dir ]) ) {
|
| 4814 |
-
if ( elem.nodeType === 1 ) {
|
| 4815 |
-
if ( (cache = elem[ expando ]) === cachedkey ) {
|
| 4816 |
-
return elem.sizset;
|
| 4817 |
-
} else if ( typeof cache === "string" && cache.indexOf(dirkey) === 0 ) {
|
| 4818 |
-
if ( elem.sizset ) {
|
| 4819 |
-
return elem;
|
| 4820 |
-
}
|
| 4821 |
-
} else {
|
| 4822 |
-
elem[ expando ] = cachedkey;
|
| 4823 |
-
if ( matcher( elem, context ) ) {
|
| 4824 |
-
elem.sizset = true;
|
| 4825 |
-
return elem;
|
| 4826 |
-
}
|
| 4827 |
-
elem.sizset = false;
|
| 4828 |
-
}
|
| 4829 |
-
}
|
| 4830 |
-
}
|
| 4831 |
-
};
|
| 4832 |
-
}
|
| 4833 |
-
|
| 4834 |
-
function addMatcher( higher, deeper ) {
|
| 4835 |
-
return higher ?
|
| 4836 |
-
function( elem, context ) {
|
| 4837 |
-
var result = deeper( elem, context );
|
| 4838 |
-
return result && higher( result === true ? elem : result, context );
|
| 4839 |
-
} :
|
| 4840 |
-
deeper;
|
| 4841 |
-
}
|
| 4842 |
-
|
| 4843 |
-
// ["TAG", ">", "ID", " ", "CLASS"]
|
| 4844 |
-
function matcherFromTokens( tokens, context, xml ) {
|
| 4845 |
-
var token, matcher,
|
| 4846 |
-
i = 0;
|
| 4847 |
-
|
| 4848 |
-
for ( ; (token = tokens[i]); i++ ) {
|
| 4849 |
-
if ( Expr.relative[ token.part ] ) {
|
| 4850 |
-
matcher = addCombinator( matcher, Expr.relative[ token.part ], context );
|
| 4851 |
-
} else {
|
| 4852 |
-
token.captures.push( context, xml );
|
| 4853 |
-
matcher = addMatcher( matcher, Expr.filter[ token.part ].apply( null, token.captures ) );
|
| 4854 |
-
}
|
| 4855 |
-
}
|
| 4856 |
-
|
| 4857 |
-
return matcher;
|
| 4858 |
-
}
|
| 4859 |
-
|
| 4860 |
-
function matcherFromGroupMatchers( matchers ) {
|
| 4861 |
-
return function( elem, context ) {
|
| 4862 |
-
var matcher,
|
| 4863 |
-
j = 0;
|
| 4864 |
-
for ( ; (matcher = matchers[j]); j++ ) {
|
| 4865 |
-
if ( matcher(elem, context) ) {
|
| 4866 |
-
return true;
|
| 4867 |
-
}
|
| 4868 |
-
}
|
| 4869 |
-
return false;
|
| 4870 |
-
};
|
| 4871 |
-
}
|
| 4872 |
-
|
| 4873 |
-
var compile = Sizzle.compile = function( selector, context, xml ) {
|
| 4874 |
-
var tokens, group, i,
|
| 4875 |
-
cached = compilerCache[ selector ];
|
| 4876 |
-
|
| 4877 |
-
// Return a cached group function if already generated (context dependent)
|
| 4878 |
-
if ( cached && cached.context === context ) {
|
| 4879 |
-
return cached;
|
| 4880 |
-
}
|
| 4881 |
-
|
| 4882 |
-
// Generate a function of recursive functions that can be used to check each element
|
| 4883 |
-
group = tokenize( selector, context, xml );
|
| 4884 |
-
for ( i = 0; (tokens = group[i]); i++ ) {
|
| 4885 |
-
group[i] = matcherFromTokens( tokens, context, xml );
|
| 4886 |
-
}
|
| 4887 |
-
|
| 4888 |
-
// Cache the compiled function
|
| 4889 |
-
cached = compilerCache[ selector ] = matcherFromGroupMatchers( group );
|
| 4890 |
-
cached.context = context;
|
| 4891 |
-
cached.runs = cached.dirruns = 0;
|
| 4892 |
-
cachedSelectors.push( selector );
|
| 4893 |
-
// Ensure only the most recent are cached
|
| 4894 |
-
if ( cachedSelectors.length > Expr.cacheLength ) {
|
| 4895 |
-
delete compilerCache[ cachedSelectors.shift() ];
|
| 4896 |
-
}
|
| 4897 |
-
return cached;
|
| 4898 |
-
};
|
| 4899 |
-
|
| 4900 |
-
Sizzle.matches = function( expr, elements ) {
|
| 4901 |
-
return Sizzle( expr, null, null, elements );
|
| 4902 |
-
};
|
| 4903 |
-
|
| 4904 |
-
Sizzle.matchesSelector = function( elem, expr ) {
|
| 4905 |
-
return Sizzle( expr, null, null, [ elem ] ).length > 0;
|
| 4906 |
-
};
|
| 4907 |
-
|
| 4908 |
-
var select = function( selector, context, results, seed, xml ) {
|
| 4909 |
-
// Remove excessive whitespace
|
| 4910 |
-
selector = selector.replace( rtrim, "$1" );
|
| 4911 |
-
var elements, matcher, i, len, elem, token,
|
| 4912 |
-
type, findContext, notTokens,
|
| 4913 |
-
match = selector.match( rgroups ),
|
| 4914 |
-
tokens = selector.match( rtokens ),
|
| 4915 |
-
contextNodeType = context.nodeType;
|
| 4916 |
-
|
| 4917 |
-
// POS handling
|
| 4918 |
-
if ( matchExpr["POS"].test(selector) ) {
|
| 4919 |
-
return handlePOS( selector, context, results, seed, match );
|
| 4920 |
-
}
|
| 4921 |
-
|
| 4922 |
-
if ( seed ) {
|
| 4923 |
-
elements = slice.call( seed, 0 );
|
| 4924 |
-
|
| 4925 |
-
// To maintain document order, only narrow the
|
| 4926 |
-
// set if there is one group
|
| 4927 |
-
} else if ( match && match.length === 1 ) {
|
| 4928 |
-
|
| 4929 |
-
// Take a shortcut and set the context if the root selector is an ID
|
| 4930 |
-
if ( tokens.length > 1 && contextNodeType === 9 && !xml &&
|
| 4931 |
-
(match = matchExpr["ID"].exec( tokens[0] )) ) {
|
| 4932 |
-
|
| 4933 |
-
context = Expr.find["ID"]( match[1], context, xml )[0];
|
| 4934 |
-
if ( !context ) {
|
| 4935 |
-
return results;
|
| 4936 |
-
}
|
| 4937 |
-
|
| 4938 |
-
selector = selector.slice( tokens.shift().length );
|
| 4939 |
-
}
|
| 4940 |
-
|
| 4941 |
-
findContext = ( (match = rsibling.exec( tokens[0] )) && !match.index && context.parentNode ) || context;
|
| 4942 |
-
|
| 4943 |
-
// Get the last token, excluding :not
|
| 4944 |
-
notTokens = tokens.pop();
|
| 4945 |
-
token = notTokens.split(":not")[0];
|
| 4946 |
-
|
| 4947 |
-
for ( i = 0, len = Expr.order.length; i < len; i++ ) {
|
| 4948 |
-
type = Expr.order[i];
|
| 4949 |
-
|
| 4950 |
-
if ( (match = matchExpr[ type ].exec( token )) ) {
|
| 4951 |
-
elements = Expr.find[ type ]( (match[1] || "").replace( rbackslash, "" ), findContext, xml );
|
| 4952 |
-
|
| 4953 |
-
if ( elements == null ) {
|
| 4954 |
-
continue;
|
| 4955 |
-
}
|
| 4956 |
-
|
| 4957 |
-
if ( token === notTokens ) {
|
| 4958 |
-
selector = selector.slice( 0, selector.length - notTokens.length ) +
|
| 4959 |
-
token.replace( matchExpr[ type ], "" );
|
| 4960 |
-
|
| 4961 |
-
if ( !selector ) {
|
| 4962 |
-
push.apply( results, slice.call(elements, 0) );
|
| 4963 |
-
}
|
| 4964 |
-
}
|
| 4965 |
-
break;
|
| 4966 |
-
}
|
| 4967 |
-
}
|
| 4968 |
-
}
|
| 4969 |
-
|
| 4970 |
-
// Only loop over the given elements once
|
| 4971 |
-
// If selector is empty, we're already done
|
| 4972 |
-
if ( selector ) {
|
| 4973 |
-
matcher = compile( selector, context, xml );
|
| 4974 |
-
dirruns = matcher.dirruns++;
|
| 4975 |
-
|
| 4976 |
-
if ( elements == null ) {
|
| 4977 |
-
elements = Expr.find["TAG"]( "*", (rsibling.test( selector ) && context.parentNode) || context );
|
| 4978 |
-
}
|
| 4979 |
-
for ( i = 0; (elem = elements[i]); i++ ) {
|
| 4980 |
-
cachedruns = matcher.runs++;
|
| 4981 |
-
if ( matcher(elem, context) ) {
|
| 4982 |
-
results.push( elem );
|
| 4983 |
-
}
|
| 4984 |
-
}
|
| 4985 |
-
}
|
| 4986 |
-
|
| 4987 |
-
return results;
|
| 4988 |
-
};
|
| 4989 |
-
|
| 4990 |
-
if ( document.querySelectorAll ) {
|
| 4991 |
-
(function() {
|
| 4992 |
-
var disconnectedMatch,
|
| 4993 |
-
oldSelect = select,
|
| 4994 |
-
rescape = /'|\\/g,
|
| 4995 |
-
rattributeQuotes = /\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g,
|
| 4996 |
-
rbuggyQSA = [],
|
| 4997 |
-
// matchesSelector(:active) reports false when true (IE9/Opera 11.5)
|
| 4998 |
-
// A support test would require too much code (would include document ready)
|
| 4999 |
-
// just skip matchesSelector for :active
|
| 5000 |
-
rbuggyMatches = [":active"],
|
| 5001 |
-
matches = docElem.matchesSelector ||
|
| 5002 |
-
docElem.mozMatchesSelector ||
|
| 5003 |
-
docElem.webkitMatchesSelector ||
|
| 5004 |
-
docElem.oMatchesSelector ||
|
| 5005 |
-
docElem.msMatchesSelector;
|
| 5006 |
-
|
| 5007 |
-
// Build QSA regex
|
| 5008 |
-
// Regex strategy adopted from Diego Perini
|
| 5009 |
-
assert(function( div ) {
|
| 5010 |
-
div.innerHTML = "<select><option selected></option></select>";
|
| 5011 |
-
|
| 5012 |
-
// IE8 - Some boolean attributes are not treated correctly
|
| 5013 |
-
if ( !div.querySelectorAll("[selected]").length ) {
|
| 5014 |
-
rbuggyQSA.push( "\\[" + whitespace + "*(?:checked|disabled|ismap|multiple|readonly|selected|value)" );
|
| 5015 |
-
}
|
| 5016 |
-
|
| 5017 |
-
// Webkit/Opera - :checked should return selected option elements
|
| 5018 |
-
// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
|
| 5019 |
-
// IE8 throws error here (do not put tests after this one)
|
| 5020 |
-
if ( !div.querySelectorAll(":checked").length ) {
|
| 5021 |
-
rbuggyQSA.push(":checked");
|
| 5022 |
-
}
|
| 5023 |
-
});
|
| 5024 |
-
|
| 5025 |
-
assert(function( div ) {
|
| 5026 |
-
|
| 5027 |
-
// Opera 10-12/IE9 - ^= $= *= and empty values
|
| 5028 |
-
// Should not select anything
|
| 5029 |
-
div.innerHTML = "<p test=''></p>";
|
| 5030 |
-
if ( div.querySelectorAll("[test^='']").length ) {
|
| 5031 |
-
rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:\"\"|'')" );
|
| 5032 |
-
}
|
| 5033 |
-
|
| 5034 |
-
// FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
|
| 5035 |
-
// IE8 throws error here (do not put tests after this one)
|
| 5036 |
-
div.innerHTML = "<input type='hidden'>";
|
| 5037 |
-
if ( !div.querySelectorAll(":enabled").length ) {
|
| 5038 |
-
rbuggyQSA.push(":enabled", ":disabled");
|
| 5039 |
-
}
|
| 5040 |
-
});
|
| 5041 |
-
|
| 5042 |
-
rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("|") );
|
| 5043 |
-
|
| 5044 |
-
select = function( selector, context, results, seed, xml ) {
|
| 5045 |
-
// Only use querySelectorAll when not filtering,
|
| 5046 |
-
// when this is not xml,
|
| 5047 |
-
// and when no QSA bugs apply
|
| 5048 |
-
if ( !seed && !xml && (!rbuggyQSA || !rbuggyQSA.test( selector )) ) {
|
| 5049 |
-
if ( context.nodeType === 9 ) {
|
| 5050 |
-
try {
|
| 5051 |
-
push.apply( results, slice.call(context.querySelectorAll( selector ), 0) );
|
| 5052 |
-
return results;
|
| 5053 |
-
} catch(qsaError) {}
|
| 5054 |
-
// qSA works strangely on Element-rooted queries
|
| 5055 |
-
// We can work around this by specifying an extra ID on the root
|
| 5056 |
-
// and working up from there (Thanks to Andrew Dupont for the technique)
|
| 5057 |
-
// IE 8 doesn't work on object elements
|
| 5058 |
-
} else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) {
|
| 5059 |
-
var old = context.getAttribute("id"),
|
| 5060 |
-
nid = old || expando,
|
| 5061 |
-
newContext = rsibling.test( selector ) && context.parentNode || context;
|
| 5062 |
-
|
| 5063 |
-
if ( old ) {
|
| 5064 |
-
nid = nid.replace( rescape, "\\$&" );
|
| 5065 |
-
} else {
|
| 5066 |
-
context.setAttribute( "id", nid );
|
| 5067 |
-
}
|
| 5068 |
-
|
| 5069 |
-
try {
|
| 5070 |
-
push.apply( results, slice.call( newContext.querySelectorAll(
|
| 5071 |
-
selector.replace( rgroups, "[id='" + nid + "'] $&" )
|
| 5072 |
-
), 0 ) );
|
| 5073 |
-
return results;
|
| 5074 |
-
} catch(qsaError) {
|
| 5075 |
-
} finally {
|
| 5076 |
-
if ( !old ) {
|
| 5077 |
-
context.removeAttribute("id");
|
| 5078 |
-
}
|
| 5079 |
-
}
|
| 5080 |
-
}
|
| 5081 |
-
}
|
| 5082 |
-
|
| 5083 |
-
return oldSelect( selector, context, results, seed, xml );
|
| 5084 |
-
};
|
| 5085 |
-
|
| 5086 |
-
if ( matches ) {
|
| 5087 |
-
assert(function( div ) {
|
| 5088 |
-
// Check to see if it's possible to do matchesSelector
|
| 5089 |
-
// on a disconnected node (IE 9)
|
| 5090 |
-
disconnectedMatch = matches.call( div, "div" );
|
| 5091 |
-
|
| 5092 |
-
// This should fail with an exception
|
| 5093 |
-
// Gecko does not error, returns false instead
|
| 5094 |
-
try {
|
| 5095 |
-
matches.call( div, "[test!='']:sizzle" );
|
| 5096 |
-
rbuggyMatches.push( Expr.match.PSEUDO );
|
| 5097 |
-
} catch ( e ) {}
|
| 5098 |
-
});
|
| 5099 |
-
|
| 5100 |
-
// rbuggyMatches always contains :active, so no need for a length check
|
| 5101 |
-
rbuggyMatches = /* rbuggyMatches.length && */ new RegExp( rbuggyMatches.join("|") );
|
| 5102 |
-
|
| 5103 |
-
Sizzle.matchesSelector = function( elem, expr ) {
|
| 5104 |
-
// Make sure that attribute selectors are quoted
|
| 5105 |
-
expr = expr.replace( rattributeQuotes, "='$1']" );
|
| 5106 |
-
|
| 5107 |
-
// rbuggyMatches always contains :active, so no need for an existence check
|
| 5108 |
-
if ( !isXML( elem ) && !rbuggyMatches.test( expr ) && (!rbuggyQSA || !rbuggyQSA.test( expr )) ) {
|
| 5109 |
-
try {
|
| 5110 |
-
var ret = matches.call( elem, expr );
|
| 5111 |
-
|
| 5112 |
-
// IE 9's matchesSelector returns false on disconnected nodes
|
| 5113 |
-
if ( ret || disconnectedMatch ||
|
| 5114 |
-
// As well, disconnected nodes are said to be in a document
|
| 5115 |
-
// fragment in IE 9
|
| 5116 |
-
elem.document && elem.document.nodeType !== 11 ) {
|
| 5117 |
-
return ret;
|
| 5118 |
-
}
|
| 5119 |
-
} catch(e) {}
|
| 5120 |
-
}
|
| 5121 |
-
|
| 5122 |
-
return Sizzle( expr, null, null, [ elem ] ).length > 0;
|
| 5123 |
-
};
|
| 5124 |
-
}
|
| 5125 |
-
})();
|
| 5126 |
-
}
|
| 5127 |
-
|
| 5128 |
-
// Override sizzle attribute retrieval
|
| 5129 |
-
Sizzle.attr = jQuery.attr;
|
| 5130 |
-
jQuery.find = Sizzle;
|
| 5131 |
-
jQuery.expr = Sizzle.selectors;
|
| 5132 |
-
jQuery.expr[":"] = jQuery.expr.pseudos;
|
| 5133 |
-
jQuery.unique = Sizzle.uniqueSort;
|
| 5134 |
-
jQuery.text = Sizzle.getText;
|
| 5135 |
-
jQuery.isXMLDoc = Sizzle.isXML;
|
| 5136 |
-
jQuery.contains = Sizzle.contains;
|
| 5137 |
-
|
| 5138 |
-
|
| 5139 |
-
})( window );
|
| 5140 |
-
var runtil = /Until$/,
|
| 5141 |
-
rparentsprev = /^(?:parents|prev(?:Until|All))/,
|
| 5142 |
-
isSimple = /^.[^:#\[\.,]*$/,
|
| 5143 |
-
rneedsContext = jQuery.expr.match.needsContext,
|
| 5144 |
-
// methods guaranteed to produce a unique set when starting from a unique set
|
| 5145 |
-
guaranteedUnique = {
|
| 5146 |
-
children: true,
|
| 5147 |
-
contents: true,
|
| 5148 |
-
next: true,
|
| 5149 |
-
prev: true
|
| 5150 |
-
};
|
| 5151 |
-
|
| 5152 |
-
jQuery.fn.extend({
|
| 5153 |
-
find: function( selector ) {
|
| 5154 |
-
var i, l, length, n, r, ret,
|
| 5155 |
-
self = this;
|
| 5156 |
-
|
| 5157 |
-
if ( typeof selector !== "string" ) {
|
| 5158 |
-
return jQuery( selector ).filter(function() {
|
| 5159 |
-
for ( i = 0, l = self.length; i < l; i++ ) {
|
| 5160 |
-
if ( jQuery.contains( self[ i ], this ) ) {
|
| 5161 |
-
return true;
|
| 5162 |
-
}
|
| 5163 |
-
}
|
| 5164 |
-
});
|
| 5165 |
-
}
|
| 5166 |
-
|
| 5167 |
-
ret = this.pushStack( "", "find", selector );
|
| 5168 |
-
|
| 5169 |
-
for ( i = 0, l = this.length; i < l; i++ ) {
|
| 5170 |
-
length = ret.length;
|
| 5171 |
-
jQuery.find( selector, this[i], ret );
|
| 5172 |
-
|
| 5173 |
-
if ( i > 0 ) {
|
| 5174 |
-
// Make sure that the results are unique
|
| 5175 |
-
for ( n = length; n < ret.length; n++ ) {
|
| 5176 |
-
for ( r = 0; r < length; r++ ) {
|
| 5177 |
-
if ( ret[r] === ret[n] ) {
|
| 5178 |
-
ret.splice(n--, 1);
|
| 5179 |
-
break;
|
| 5180 |
-
}
|
| 5181 |
-
}
|
| 5182 |
-
}
|
| 5183 |
-
}
|
| 5184 |
-
}
|
| 5185 |
-
|
| 5186 |
-
return ret;
|
| 5187 |
-
},
|
| 5188 |
-
|
| 5189 |
-
has: function( target ) {
|
| 5190 |
-
var i,
|
| 5191 |
-
targets = jQuery( target, this ),
|
| 5192 |
-
len = targets.length;
|
| 5193 |
-
|
| 5194 |
-
return this.filter(function() {
|
| 5195 |
-
for ( i = 0; i < len; i++ ) {
|
| 5196 |
-
if ( jQuery.contains( this, targets[i] ) ) {
|
| 5197 |
-
return true;
|
| 5198 |
-
}
|
| 5199 |
-
}
|
| 5200 |
-
});
|
| 5201 |
-
},
|
| 5202 |
-
|
| 5203 |
-
not: function( selector ) {
|
| 5204 |
-
return this.pushStack( winnow(this, selector, false), "not", selector);
|
| 5205 |
-
},
|
| 5206 |
-
|
| 5207 |
-
filter: function( selector ) {
|
| 5208 |
-
return this.pushStack( winnow(this, selector, true), "filter", selector );
|
| 5209 |
-
},
|
| 5210 |
-
|
| 5211 |
-
is: function( selector ) {
|
| 5212 |
-
return !!selector && (
|
| 5213 |
-
typeof selector === "string" ?
|
| 5214 |
-
// If this is a positional/relative selector, check membership in the returned set
|
| 5215 |
-
// so $("p:first").is("p:last") won't return true for a doc with two "p".
|
| 5216 |
-
rneedsContext.test( selector ) ?
|
| 5217 |
-
jQuery( selector, this.context ).index( this[0] ) >= 0 :
|
| 5218 |
-
jQuery.filter( selector, this ).length > 0 :
|
| 5219 |
-
this.filter( selector ).length > 0 );
|
| 5220 |
-
},
|
| 5221 |
-
|
| 5222 |
-
closest: function( selectors, context ) {
|
| 5223 |
-
var cur,
|
| 5224 |
-
i = 0,
|
| 5225 |
-
l = this.length,
|
| 5226 |
-
ret = [],
|
| 5227 |
-
pos = rneedsContext.test( selectors ) || typeof selectors !== "string" ?
|
| 5228 |
-
jQuery( selectors, context || this.context ) :
|
| 5229 |
-
0;
|
| 5230 |
-
|
| 5231 |
-
for ( ; i < l; i++ ) {
|
| 5232 |
-
cur = this[i];
|
| 5233 |
-
|
| 5234 |
-
while ( cur && cur.ownerDocument && cur !== context && cur.nodeType !== 11 ) {
|
| 5235 |
-
if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) {
|
| 5236 |
-
ret.push( cur );
|
| 5237 |
-
break;
|
| 5238 |
-
}
|
| 5239 |
-
cur = cur.parentNode;
|
| 5240 |
-
}
|
| 5241 |
-
}
|
| 5242 |
-
|
| 5243 |
-
ret = ret.length > 1 ? jQuery.unique( ret ) : ret;
|
| 5244 |
-
|
| 5245 |
-
return this.pushStack( ret, "closest", selectors );
|
| 5246 |
-
},
|
| 5247 |
-
|
| 5248 |
-
// Determine the position of an element within
|
| 5249 |
-
// the matched set of elements
|
| 5250 |
-
index: function( elem ) {
|
| 5251 |
-
|
| 5252 |
-
// No argument, return index in parent
|
| 5253 |
-
if ( !elem ) {
|
| 5254 |
-
return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1;
|
| 5255 |
-
}
|
| 5256 |
-
|
| 5257 |
-
// index in selector
|
| 5258 |
-
if ( typeof elem === "string" ) {
|
| 5259 |
-
return jQuery.inArray( this[0], jQuery( elem ) );
|
| 5260 |
-
}
|
| 5261 |
-
|
| 5262 |
-
// Locate the position of the desired element
|
| 5263 |
-
return jQuery.inArray(
|
| 5264 |
-
// If it receives a jQuery object, the first element is used
|
| 5265 |
-
elem.jquery ? elem[0] : elem, this );
|
| 5266 |
-
},
|
| 5267 |
-
|
| 5268 |
-
add: function( selector, context ) {
|
| 5269 |
-
var set = typeof selector === "string" ?
|
| 5270 |
-
jQuery( selector, context ) :
|
| 5271 |
-
jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ),
|
| 5272 |
-
all = jQuery.merge( this.get(), set );
|
| 5273 |
-
|
| 5274 |
-
return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ?
|
| 5275 |
-
all :
|
| 5276 |
-
jQuery.unique( all ) );
|
| 5277 |
-
},
|
| 5278 |
-
|
| 5279 |
-
addBack: function( selector ) {
|
| 5280 |
-
return this.add( selector == null ?
|
| 5281 |
-
this.prevObject : this.prevObject.filter(selector)
|
| 5282 |
-
);
|
| 5283 |
-
}
|
| 5284 |
-
});
|
| 5285 |
-
|
| 5286 |
-
jQuery.fn.andSelf = jQuery.fn.addBack;
|
| 5287 |
-
|
| 5288 |
-
// A painfully simple check to see if an element is disconnected
|
| 5289 |
-
// from a document (should be improved, where feasible).
|
| 5290 |
-
function isDisconnected( node ) {
|
| 5291 |
-
return !node || !node.parentNode || node.parentNode.nodeType === 11;
|
| 5292 |
-
}
|
| 5293 |
-
|
| 5294 |
-
function sibling( cur, dir ) {
|
| 5295 |
-
do {
|
| 5296 |
-
cur = cur[ dir ];
|
| 5297 |
-
} while ( cur && cur.nodeType !== 1 );
|
| 5298 |
-
|
| 5299 |
-
return cur;
|
| 5300 |
-
}
|
| 5301 |
-
|
| 5302 |
-
jQuery.each({
|
| 5303 |
-
parent: function( elem ) {
|
| 5304 |
-
var parent = elem.parentNode;
|
| 5305 |
-
return parent && parent.nodeType !== 11 ? parent : null;
|
| 5306 |
-
},
|
| 5307 |
-
parents: function( elem ) {
|
| 5308 |
-
return jQuery.dir( elem, "parentNode" );
|
| 5309 |
-
},
|
| 5310 |
-
parentsUntil: function( elem, i, until ) {
|
| 5311 |
-
return jQuery.dir( elem, "parentNode", until );
|
| 5312 |
-
},
|
| 5313 |
-
next: function( elem ) {
|
| 5314 |
-
return sibling( elem, "nextSibling" );
|
| 5315 |
-
},
|
| 5316 |
-
prev: function( elem ) {
|
| 5317 |
-
return sibling( elem, "previousSibling" );
|
| 5318 |
-
},
|
| 5319 |
-
nextAll: function( elem ) {
|
| 5320 |
-
return jQuery.dir( elem, "nextSibling" );
|
| 5321 |
-
},
|
| 5322 |
-
prevAll: function( elem ) {
|
| 5323 |
-
return jQuery.dir( elem, "previousSibling" );
|
| 5324 |
-
},
|
| 5325 |
-
nextUntil: function( elem, i, until ) {
|
| 5326 |
-
return jQuery.dir( elem, "nextSibling", until );
|
| 5327 |
-
},
|
| 5328 |
-
prevUntil: function( elem, i, until ) {
|
| 5329 |
-
return jQuery.dir( elem, "previousSibling", until );
|
| 5330 |
-
},
|
| 5331 |
-
siblings: function( elem ) {
|
| 5332 |
-
return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem );
|
| 5333 |
-
},
|
| 5334 |
-
children: function( elem ) {
|
| 5335 |
-
return jQuery.sibling( elem.firstChild );
|
| 5336 |
-
},
|
| 5337 |
-
contents: function( elem ) {
|
| 5338 |
-
return jQuery.nodeName( elem, "iframe" ) ?
|
| 5339 |
-
elem.contentDocument || elem.contentWindow.document :
|
| 5340 |
-
jQuery.merge( [], elem.childNodes );
|
| 5341 |
-
}
|
| 5342 |
-
}, function( name, fn ) {
|
| 5343 |
-
jQuery.fn[ name ] = function( until, selector ) {
|
| 5344 |
-
var ret = jQuery.map( this, fn, until );
|
| 5345 |
-
|
| 5346 |
-
if ( !runtil.test( name ) ) {
|
| 5347 |
-
selector = until;
|
| 5348 |
-
}
|
| 5349 |
-
|
| 5350 |
-
if ( selector && typeof selector === "string" ) {
|
| 5351 |
-
ret = jQuery.filter( selector, ret );
|
| 5352 |
-
}
|
| 5353 |
-
|
| 5354 |
-
ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret;
|
| 5355 |
-
|
| 5356 |
-
if ( this.length > 1 && rparentsprev.test( name ) ) {
|
| 5357 |
-
ret = ret.reverse();
|
| 5358 |
-
}
|
| 5359 |
-
|
| 5360 |
-
return this.pushStack( ret, name, core_slice.call( arguments ).join(",") );
|
| 5361 |
-
};
|
| 5362 |
-
});
|
| 5363 |
-
|
| 5364 |
-
jQuery.extend({
|
| 5365 |
-
filter: function( expr, elems, not ) {
|
| 5366 |
-
if ( not ) {
|
| 5367 |
-
expr = ":not(" + expr + ")";
|
| 5368 |
-
}
|
| 5369 |
-
|
| 5370 |
-
return elems.length === 1 ?
|
| 5371 |
-
jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] :
|
| 5372 |
-
jQuery.find.matches(expr, elems);
|
| 5373 |
-
},
|
| 5374 |
-
|
| 5375 |
-
dir: function( elem, dir, until ) {
|
| 5376 |
-
var matched = [],
|
| 5377 |
-
cur = elem[ dir ];
|
| 5378 |
-
|
| 5379 |
-
while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) {
|
| 5380 |
-
if ( cur.nodeType === 1 ) {
|
| 5381 |
-
matched.push( cur );
|
| 5382 |
-
}
|
| 5383 |
-
cur = cur[dir];
|
| 5384 |
-
}
|
| 5385 |
-
return matched;
|
| 5386 |
-
},
|
| 5387 |
-
|
| 5388 |
-
sibling: function( n, elem ) {
|
| 5389 |
-
var r = [];
|
| 5390 |
-
|
| 5391 |
-
for ( ; n; n = n.nextSibling ) {
|
| 5392 |
-
if ( n.nodeType === 1 && n !== elem ) {
|
| 5393 |
-
r.push( n );
|
| 5394 |
-
}
|
| 5395 |
-
}
|
| 5396 |
-
|
| 5397 |
-
return r;
|
| 5398 |
-
}
|
| 5399 |
-
});
|
| 5400 |
-
|
| 5401 |
-
// Implement the identical functionality for filter and not
|
| 5402 |
-
function winnow( elements, qualifier, keep ) {
|
| 5403 |
-
|
| 5404 |
-
// Can't pass null or undefined to indexOf in Firefox 4
|
| 5405 |
-
// Set to 0 to skip string check
|
| 5406 |
-
qualifier = qualifier || 0;
|
| 5407 |
-
|
| 5408 |
-
if ( jQuery.isFunction( qualifier ) ) {
|
| 5409 |
-
return jQuery.grep(elements, function( elem, i ) {
|
| 5410 |
-
var retVal = !!qualifier.call( elem, i, elem );
|
| 5411 |
-
return retVal === keep;
|
| 5412 |
-
});
|
| 5413 |
-
|
| 5414 |
-
} else if ( qualifier.nodeType ) {
|
| 5415 |
-
return jQuery.grep(elements, function( elem, i ) {
|
| 5416 |
-
return ( elem === qualifier ) === keep;
|
| 5417 |
-
});
|
| 5418 |
-
|
| 5419 |
-
} else if ( typeof qualifier === "string" ) {
|
| 5420 |
-
var filtered = jQuery.grep(elements, function( elem ) {
|
| 5421 |
-
return elem.nodeType === 1;
|
| 5422 |
-
});
|
| 5423 |
-
|
| 5424 |
-
if ( isSimple.test( qualifier ) ) {
|
| 5425 |
-
return jQuery.filter(qualifier, filtered, !keep);
|
| 5426 |
-
} else {
|
| 5427 |
-
qualifier = jQuery.filter( qualifier, filtered );
|
| 5428 |
-
}
|
| 5429 |
-
}
|
| 5430 |
-
|
| 5431 |
-
return jQuery.grep(elements, function( elem, i ) {
|
| 5432 |
-
return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep;
|
| 5433 |
-
});
|
| 5434 |
-
}
|
| 5435 |
-
function createSafeFragment( document ) {
|
| 5436 |
-
var list = nodeNames.split( "|" ),
|
| 5437 |
-
safeFrag = document.createDocumentFragment();
|
| 5438 |
-
|
| 5439 |
-
if ( safeFrag.createElement ) {
|
| 5440 |
-
while ( list.length ) {
|
| 5441 |
-
safeFrag.createElement(
|
| 5442 |
-
list.pop()
|
| 5443 |
-
);
|
| 5444 |
-
}
|
| 5445 |
-
}
|
| 5446 |
-
return safeFrag;
|
| 5447 |
-
}
|
| 5448 |
-
|
| 5449 |
-
var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" +
|
| 5450 |
-
"header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",
|
| 5451 |
-
rinlinejQuery = / sQuery\d+="(?:null|\d+)"/g,
|
| 5452 |
-
rleadingWhitespace = /^\s+/,
|
| 5453 |
-
rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,
|
| 5454 |
-
rtagName = /<([\w:]+)/,
|
| 5455 |
-
rtbody = /<tbody/i,
|
| 5456 |
-
rhtml = /<|&#?\w+;/,
|
| 5457 |
-
rnoInnerhtml = /<(?:script|style|link)/i,
|
| 5458 |
-
rnocache = /<(?:script|object|embed|option|style)/i,
|
| 5459 |
-
rnoshimcache = new RegExp("<(?:" + nodeNames + ")[\\s/>]", "i"),
|
| 5460 |
-
rcheckableType = /^(?:checkbox|radio)$/,
|
| 5461 |
-
// checked="checked" or checked
|
| 5462 |
-
rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
|
| 5463 |
-
rscriptType = /\/(java|ecma)script/i,
|
| 5464 |
-
rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)|[\]\-]{2}>\s*$/g,
|
| 5465 |
-
wrapMap = {
|
| 5466 |
-
option: [ 1, "<select multiple='multiple'>", "</select>" ],
|
| 5467 |
-
legend: [ 1, "<fieldset>", "</fieldset>" ],
|
| 5468 |
-
thead: [ 1, "<table>", "</table>" ],
|
| 5469 |
-
tr: [ 2, "<table><tbody>", "</tbody></table>" ],
|
| 5470 |
-
td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
|
| 5471 |
-
col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ],
|
| 5472 |
-
area: [ 1, "<map>", "</map>" ],
|
| 5473 |
-
_default: [ 0, "", "" ]
|
| 5474 |
-
},
|
| 5475 |
-
safeFragment = createSafeFragment( document ),
|
| 5476 |
-
fragmentDiv = safeFragment.appendChild( document.createElement("div") );
|
| 5477 |
-
|
| 5478 |
-
wrapMap.optgroup = wrapMap.option;
|
| 5479 |
-
wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
|
| 5480 |
-
wrapMap.th = wrapMap.td;
|
| 5481 |
-
|
| 5482 |
-
// IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags,
|
| 5483 |
-
// unless wrapped in a div with non-breaking characters in front of it.
|
| 5484 |
-
if ( !jQuery.support.htmlSerialize ) {
|
| 5485 |
-
wrapMap._default = [ 1, "X<div>", "</div>" ];
|
| 5486 |
-
}
|
| 5487 |
-
|
| 5488 |
-
jQuery.fn.extend({
|
| 5489 |
-
text: function( value ) {
|
| 5490 |
-
return jQuery.access( this, function( value ) {
|
| 5491 |
-
return value === undefined ?
|
| 5492 |
-
jQuery.text( this ) :
|
| 5493 |
-
this.empty().append( ( this[0] && this[0].ownerDocument || document ).createTextNode( value ) );
|
| 5494 |
-
}, null, value, arguments.length );
|
| 5495 |
-
},
|
| 5496 |
-
|
| 5497 |
-
wrapAll: function( html ) {
|
| 5498 |
-
if ( jQuery.isFunction( html ) ) {
|
| 5499 |
-
return this.each(function(i) {
|
| 5500 |
-
jQuery(this).wrapAll( html.call(this, i) );
|
| 5501 |
-
});
|
| 5502 |
-
}
|
| 5503 |
-
|
| 5504 |
-
if ( this[0] ) {
|
| 5505 |
-
// The elements to wrap the target around
|
| 5506 |
-
var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true);
|
| 5507 |
-
|
| 5508 |
-
if ( this[0].parentNode ) {
|
| 5509 |
-
wrap.insertBefore( this[0] );
|
| 5510 |
-
}
|
| 5511 |
-
|
| 5512 |
-
wrap.map(function() {
|
| 5513 |
-
var elem = this;
|
| 5514 |
-
|
| 5515 |
-
while ( elem.firstChild && elem.firstChild.nodeType === 1 ) {
|
| 5516 |
-
elem = elem.firstChild;
|
| 5517 |
-
}
|
| 5518 |
-
|
| 5519 |
-
return elem;
|
| 5520 |
-
}).append( this );
|
| 5521 |
-
}
|
| 5522 |
-
|
| 5523 |
-
return this;
|
| 5524 |
-
},
|
| 5525 |
-
|
| 5526 |
-
wrapInner: function( html ) {
|
| 5527 |
-
if ( jQuery.isFunction( html ) ) {
|
| 5528 |
-
return this.each(function(i) {
|
| 5529 |
-
jQuery(this).wrapInner( html.call(this, i) );
|
| 5530 |
-
});
|
| 5531 |
-
}
|
| 5532 |
-
|
| 5533 |
-
return this.each(function() {
|
| 5534 |
-
var self = jQuery( this ),
|
| 5535 |
-
contents = self.contents();
|
| 5536 |
-
|
| 5537 |
-
if ( contents.length ) {
|
| 5538 |
-
contents.wrapAll( html );
|
| 5539 |
-
|
| 5540 |
-
} else {
|
| 5541 |
-
self.append( html );
|
| 5542 |
-
}
|
| 5543 |
-
});
|
| 5544 |
-
},
|
| 5545 |
-
|
| 5546 |
-
wrap: function( html ) {
|
| 5547 |
-
var isFunction = jQuery.isFunction( html );
|
| 5548 |
-
|
| 5549 |
-
return this.each(function(i) {
|
| 5550 |
-
jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html );
|
| 5551 |
-
});
|
| 5552 |
-
},
|
| 5553 |
-
|
| 5554 |
-
unwrap: function() {
|
| 5555 |
-
return this.parent().each(function() {
|
| 5556 |
-
if ( !jQuery.nodeName( this, "body" ) ) {
|
| 5557 |
-
jQuery( this ).replaceWith( this.childNodes );
|
| 5558 |
-
}
|
| 5559 |
-
}).end();
|
| 5560 |
-
},
|
| 5561 |
-
|
| 5562 |
-
append: function() {
|
| 5563 |
-
return this.domManip(arguments, true, function( elem ) {
|
| 5564 |
-
if ( this.nodeType === 1 || this.nodeType === 11 ) {
|
| 5565 |
-
this.appendChild( elem );
|
| 5566 |
-
}
|
| 5567 |
-
});
|
| 5568 |
-
},
|
| 5569 |
-
|
| 5570 |
-
prepend: function() {
|
| 5571 |
-
return this.domManip(arguments, true, function( elem ) {
|
| 5572 |
-
if ( this.nodeType === 1 || this.nodeType === 11 ) {
|
| 5573 |
-
this.insertBefore( elem, this.firstChild );
|
| 5574 |
-
}
|
| 5575 |
-
});
|
| 5576 |
-
},
|
| 5577 |
-
|
| 5578 |
-
before: function() {
|
| 5579 |
-
if ( !isDisconnected( this[0] ) ) {
|
| 5580 |
-
return this.domManip(arguments, false, function( elem ) {
|
| 5581 |
-
this.parentNode.insertBefore( elem, this );
|
| 5582 |
-
});
|
| 5583 |
-
}
|
| 5584 |
-
|
| 5585 |
-
if ( arguments.length ) {
|
| 5586 |
-
var set = jQuery.clean( arguments );
|
| 5587 |
-
return this.pushStack( jQuery.merge( set, this ), "before", this.selector );
|
| 5588 |
-
}
|
| 5589 |
-
},
|
| 5590 |
-
|
| 5591 |
-
after: function() {
|
| 5592 |
-
if ( !isDisconnected( this[0] ) ) {
|
| 5593 |
-
return this.domManip(arguments, false, function( elem ) {
|
| 5594 |
-
this.parentNode.insertBefore( elem, this.nextSibling );
|
| 5595 |
-
});
|
| 5596 |
-
}
|
| 5597 |
-
|
| 5598 |
-
if ( arguments.length ) {
|
| 5599 |
-
var set = jQuery.clean( arguments );
|
| 5600 |
-
return this.pushStack( jQuery.merge( this, set ), "after", this.selector );
|
| 5601 |
-
}
|
| 5602 |
-
},
|
| 5603 |
-
|
| 5604 |
-
// keepData is for internal use only--do not document
|
| 5605 |
-
remove: function( selector, keepData ) {
|
| 5606 |
-
var elem,
|
| 5607 |
-
i = 0;
|
| 5608 |
-
|
| 5609 |
-
for ( ; (elem = this[i]) != null; i++ ) {
|
| 5610 |
-
if ( !selector || jQuery.filter( selector, [ elem ] ).length ) {
|
| 5611 |
-
if ( !keepData && elem.nodeType === 1 ) {
|
| 5612 |
-
jQuery.cleanData( elem.getElementsByTagName("*") );
|
| 5613 |
-
jQuery.cleanData( [ elem ] );
|
| 5614 |
-
}
|
| 5615 |
-
|
| 5616 |
-
if ( elem.parentNode ) {
|
| 5617 |
-
elem.parentNode.removeChild( elem );
|
| 5618 |
-
}
|
| 5619 |
-
}
|
| 5620 |
-
}
|
| 5621 |
-
|
| 5622 |
-
return this;
|
| 5623 |
-
},
|
| 5624 |
-
|
| 5625 |
-
empty: function() {
|
| 5626 |
-
var elem,
|
| 5627 |
-
i = 0;
|
| 5628 |
-
|
| 5629 |
-
for ( ; (elem = this[i]) != null; i++ ) {
|
| 5630 |
-
// Remove element nodes and prevent memory leaks
|
| 5631 |
-
if ( elem.nodeType === 1 ) {
|
| 5632 |
-
jQuery.cleanData( elem.getElementsByTagName("*") );
|
| 5633 |
-
}
|
| 5634 |
-
|
| 5635 |
-
// Remove any remaining nodes
|
| 5636 |
-
while ( elem.firstChild ) {
|
| 5637 |
-
elem.removeChild( elem.firstChild );
|
| 5638 |
-
}
|
| 5639 |
-
}
|
| 5640 |
-
|
| 5641 |
-
return this;
|
| 5642 |
-
},
|
| 5643 |
-
|
| 5644 |
-
clone: function( dataAndEvents, deepDataAndEvents ) {
|
| 5645 |
-
dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
|
| 5646 |
-
deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
|
| 5647 |
-
|
| 5648 |
-
return this.map( function () {
|
| 5649 |
-
return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
|
| 5650 |
-
});
|
| 5651 |
-
},
|
| 5652 |
-
|
| 5653 |
-
html: function( value ) {
|
| 5654 |
-
return jQuery.access( this, function( value ) {
|
| 5655 |
-
var elem = this[0] || {},
|
| 5656 |
-
i = 0,
|
| 5657 |
-
l = this.length;
|
| 5658 |
-
|
| 5659 |
-
if ( value === undefined ) {
|
| 5660 |
-
return elem.nodeType === 1 ?
|
| 5661 |
-
elem.innerHTML.replace( rinlinejQuery, "" ) :
|
| 5662 |
-
undefined;
|
| 5663 |
-
}
|
| 5664 |
-
|
| 5665 |
-
// See if we can take a shortcut and just use innerHTML
|
| 5666 |
-
if ( typeof value === "string" && !rnoInnerhtml.test( value ) &&
|
| 5667 |
-
( jQuery.support.htmlSerialize || !rnoshimcache.test( value ) ) &&
|
| 5668 |
-
( jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value ) ) &&
|
| 5669 |
-
!wrapMap[ ( rtagName.exec( value ) || ["", ""] )[1].toLowerCase() ] ) {
|
| 5670 |
-
|
| 5671 |
-
value = value.replace( rxhtmlTag, "<$1></$2>" );
|
| 5672 |
-
|
| 5673 |
-
try {
|
| 5674 |
-
for (; i < l; i++ ) {
|
| 5675 |
-
// Remove element nodes and prevent memory leaks
|
| 5676 |
-
elem = this[i] || {};
|
| 5677 |
-
if ( elem.nodeType === 1 ) {
|
| 5678 |
-
jQuery.cleanData( elem.getElementsByTagName( "*" ) );
|
| 5679 |
-
elem.innerHTML = value;
|
| 5680 |
-
}
|
| 5681 |
-
}
|
| 5682 |
-
|
| 5683 |
-
elem = 0;
|
| 5684 |
-
|
| 5685 |
-
// If using innerHTML throws an exception, use the fallback method
|
| 5686 |
-
} catch(e) {}
|
| 5687 |
-
}
|
| 5688 |
-
|
| 5689 |
-
if ( elem ) {
|
| 5690 |
-
this.empty().append( value );
|
| 5691 |
-
}
|
| 5692 |
-
}, null, value, arguments.length );
|
| 5693 |
-
},
|
| 5694 |
-
|
| 5695 |
-
replaceWith: function( value ) {
|
| 5696 |
-
if ( !isDisconnected( this[0] ) ) {
|
| 5697 |
-
// Make sure that the elements are removed from the DOM before they are inserted
|
| 5698 |
-
// this can help fix replacing a parent with child elements
|
| 5699 |
-
if ( jQuery.isFunction( value ) ) {
|
| 5700 |
-
return this.each(function(i) {
|
| 5701 |
-
var self = jQuery(this), old = self.html();
|
| 5702 |
-
self.replaceWith( value.call( this, i, old ) );
|
| 5703 |
-
});
|
| 5704 |
-
}
|
| 5705 |
-
|
| 5706 |
-
if ( typeof value !== "string" ) {
|
| 5707 |
-
value = jQuery( value ).detach();
|
| 5708 |
-
}
|
| 5709 |
-
|
| 5710 |
-
return this.each(function() {
|
| 5711 |
-
var next = this.nextSibling,
|
| 5712 |
-
parent = this.parentNode;
|
| 5713 |
-
|
| 5714 |
-
jQuery( this ).remove();
|
| 5715 |
-
|
| 5716 |
-
if ( next ) {
|
| 5717 |
-
jQuery(next).before( value );
|
| 5718 |
-
} else {
|
| 5719 |
-
jQuery(parent).append( value );
|
| 5720 |
-
}
|
| 5721 |
-
});
|
| 5722 |
-
}
|
| 5723 |
-
|
| 5724 |
-
return this.length ?
|
| 5725 |
-
this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) :
|
| 5726 |
-
this;
|
| 5727 |
-
},
|
| 5728 |
-
|
| 5729 |
-
detach: function( selector ) {
|
| 5730 |
-
return this.remove( selector, true );
|
| 5731 |
-
},
|
| 5732 |
-
|
| 5733 |
-
domManip: function( args, table, callback ) {
|
| 5734 |
-
|
| 5735 |
-
// Flatten any nested arrays
|
| 5736 |
-
args = [].concat.apply( [], args );
|
| 5737 |
-
|
| 5738 |
-
var results, first, fragment, iNoClone,
|
| 5739 |
-
i = 0,
|
| 5740 |
-
value = args[0],
|
| 5741 |
-
scripts = [],
|
| 5742 |
-
l = this.length;
|
| 5743 |
-
|
| 5744 |
-
// We can't cloneNode fragments that contain checked, in WebKit
|
| 5745 |
-
if ( !jQuery.support.checkClone && l > 1 && typeof value === "string" && rchecked.test( value ) ) {
|
| 5746 |
-
return this.each(function() {
|
| 5747 |
-
jQuery(this).domManip( args, table, callback );
|
| 5748 |
-
});
|
| 5749 |
-
}
|
| 5750 |
-
|
| 5751 |
-
if ( jQuery.isFunction(value) ) {
|
| 5752 |
-
return this.each(function(i) {
|
| 5753 |
-
var self = jQuery(this);
|
| 5754 |
-
args[0] = value.call( this, i, table ? self.html() : undefined );
|
| 5755 |
-
self.domManip( args, table, callback );
|
| 5756 |
-
});
|
| 5757 |
-
}
|
| 5758 |
-
|
| 5759 |
-
if ( this[0] ) {
|
| 5760 |
-
results = jQuery.buildFragment( args, this, scripts );
|
| 5761 |
-
fragment = results.fragment;
|
| 5762 |
-
first = fragment.firstChild;
|
| 5763 |
-
|
| 5764 |
-
if ( fragment.childNodes.length === 1 ) {
|
| 5765 |
-
fragment = first;
|
| 5766 |
-
}
|
| 5767 |
-
|
| 5768 |
-
if ( first ) {
|
| 5769 |
-
table = table && jQuery.nodeName( first, "tr" );
|
| 5770 |
-
|
| 5771 |
-
// Use the original fragment for the last item instead of the first because it can end up
|
| 5772 |
-
// being emptied incorrectly in certain situations (#8070).
|
| 5773 |
-
// Fragments from the fragment cache must always be cloned and never used in place.
|
| 5774 |
-
for ( iNoClone = results.cacheable || l - 1; i < l; i++ ) {
|
| 5775 |
-
callback.call(
|
| 5776 |
-
table && jQuery.nodeName( this[i], "table" ) ?
|
| 5777 |
-
findOrAppend( this[i], "tbody" ) :
|
| 5778 |
-
this[i],
|
| 5779 |
-
i === iNoClone ?
|
| 5780 |
-
fragment :
|
| 5781 |
-
jQuery.clone( fragment, true, true )
|
| 5782 |
-
);
|
| 5783 |
-
}
|
| 5784 |
-
}
|
| 5785 |
-
|
| 5786 |
-
// Fix #11809: Avoid leaking memory
|
| 5787 |
-
fragment = first = null;
|
| 5788 |
-
|
| 5789 |
-
if ( scripts.length ) {
|
| 5790 |
-
jQuery.each( scripts, function( i, elem ) {
|
| 5791 |
-
if ( elem.src ) {
|
| 5792 |
-
if ( jQuery.ajax ) {
|
| 5793 |
-
jQuery.ajax({
|
| 5794 |
-
url: elem.src,
|
| 5795 |
-
type: "GET",
|
| 5796 |
-
dataType: "script",
|
| 5797 |
-
async: false,
|
| 5798 |
-
global: false,
|
| 5799 |
-
"throws": true
|
| 5800 |
-
});
|
| 5801 |
-
} else {
|
| 5802 |
-
jQuery.error("no ajax");
|
| 5803 |
-
}
|
| 5804 |
-
} else {
|
| 5805 |
-
jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "" ) );
|
| 5806 |
-
}
|
| 5807 |
-
|
| 5808 |
-
if ( elem.parentNode ) {
|
| 5809 |
-
elem.parentNode.removeChild( elem );
|
| 5810 |
-
}
|
| 5811 |
-
});
|
| 5812 |
-
}
|
| 5813 |
-
}
|
| 5814 |
-
|
| 5815 |
-
return this;
|
| 5816 |
-
}
|
| 5817 |
-
});
|
| 5818 |
-
|
| 5819 |
-
function findOrAppend( elem, tag ) {
|
| 5820 |
-
return elem.getElementsByTagName( tag )[0] || elem.appendChild( elem.ownerDocument.createElement( tag ) );
|
| 5821 |
-
}
|
| 5822 |
-
|
| 5823 |
-
function cloneCopyEvent( src, dest ) {
|
| 5824 |
-
|
| 5825 |
-
if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) {
|
| 5826 |
-
return;
|
| 5827 |
-
}
|
| 5828 |
-
|
| 5829 |
-
var type, i, l,
|
| 5830 |
-
oldData = jQuery._data( src ),
|
| 5831 |
-
curData = jQuery._data( dest, oldData ),
|
| 5832 |
-
events = oldData.events;
|
| 5833 |
-
|
| 5834 |
-
if ( events ) {
|
| 5835 |
-
delete curData.handle;
|
| 5836 |
-
curData.events = {};
|
| 5837 |
-
|
| 5838 |
-
for ( type in events ) {
|
| 5839 |
-
for ( i = 0, l = events[ type ].length; i < l; i++ ) {
|
| 5840 |
-
jQuery.event.add( dest, type, events[ type ][ i ] );
|
| 5841 |
-
}
|
| 5842 |
-
}
|
| 5843 |
-
}
|
| 5844 |
-
|
| 5845 |
-
// make the cloned public data object a copy from the original
|
| 5846 |
-
if ( curData.data ) {
|
| 5847 |
-
curData.data = jQuery.extend( {}, curData.data );
|
| 5848 |
-
}
|
| 5849 |
-
}
|
| 5850 |
-
|
| 5851 |
-
function cloneFixAttributes( src, dest ) {
|
| 5852 |
-
var nodeName;
|
| 5853 |
-
|
| 5854 |
-
// We do not need to do anything for non-Elements
|
| 5855 |
-
if ( dest.nodeType !== 1 ) {
|
| 5856 |
-
return;
|
| 5857 |
-
}
|
| 5858 |
-
|
| 5859 |
-
// clearAttributes removes the attributes, which we don't want,
|
| 5860 |
-
// but also removes the attachEvent events, which we *do* want
|
| 5861 |
-
if ( dest.clearAttributes ) {
|
| 5862 |
-
dest.clearAttributes();
|
| 5863 |
-
}
|
| 5864 |
-
|
| 5865 |
-
// mergeAttributes, in contrast, only merges back on the
|
| 5866 |
-
// original attributes, not the events
|
| 5867 |
-
if ( dest.mergeAttributes ) {
|
| 5868 |
-
dest.mergeAttributes( src );
|
| 5869 |
-
}
|
| 5870 |
-
|
| 5871 |
-
nodeName = dest.nodeName.toLowerCase();
|
| 5872 |
-
|
| 5873 |
-
if ( nodeName === "object" ) {
|
| 5874 |
-
// IE6-10 improperly clones children of object elements using classid.
|
| 5875 |
-
// IE10 throws NoModificationAllowedError if parent is null, #12132.
|
| 5876 |
-
if ( dest.parentNode ) {
|
| 5877 |
-
dest.outerHTML = src.outerHTML;
|
| 5878 |
-
}
|
| 5879 |
-
|
| 5880 |
-
// This path appears unavoidable for IE9. When cloning an object
|
| 5881 |
-
// element in IE9, the outerHTML strategy above is not sufficient.
|
| 5882 |
-
// If the src has innerHTML and the destination does not,
|
| 5883 |
-
// copy the src.innerHTML into the dest.innerHTML. #10324
|
| 5884 |
-
if ( jQuery.support.html5Clone && (src.innerHTML && !jQuery.trim(dest.innerHTML)) ) {
|
| 5885 |
-
dest.innerHTML = src.innerHTML;
|
| 5886 |
-
}
|
| 5887 |
-
|
| 5888 |
-
} else if ( nodeName === "input" && rcheckableType.test( src.type ) ) {
|
| 5889 |
-
// IE6-8 fails to persist the checked state of a cloned checkbox
|
| 5890 |
-
// or radio button. Worse, IE6-7 fail to give the cloned element
|
| 5891 |
-
// a checked appearance if the defaultChecked value isn't also set
|
| 5892 |
-
|
| 5893 |
-
dest.defaultChecked = dest.checked = src.checked;
|
| 5894 |
-
|
| 5895 |
-
// IE6-7 get confused and end up setting the value of a cloned
|
| 5896 |
-
// checkbox/radio button to an empty string instead of "on"
|
| 5897 |
-
if ( dest.value !== src.value ) {
|
| 5898 |
-
dest.value = src.value;
|
| 5899 |
-
}
|
| 5900 |
-
|
| 5901 |
-
// IE6-8 fails to return the selected option to the default selected
|
| 5902 |
-
// state when cloning options
|
| 5903 |
-
} else if ( nodeName === "option" ) {
|
| 5904 |
-
dest.selected = src.defaultSelected;
|
| 5905 |
-
|
| 5906 |
-
// IE6-8 fails to set the defaultValue to the correct value when
|
| 5907 |
-
// cloning other types of input fields
|
| 5908 |
-
} else if ( nodeName === "input" || nodeName === "textarea" ) {
|
| 5909 |
-
dest.defaultValue = src.defaultValue;
|
| 5910 |
-
|
| 5911 |
-
// IE blanks contents when cloning scripts
|
| 5912 |
-
} else if ( nodeName === "script" && dest.text !== src.text ) {
|
| 5913 |
-
dest.text = src.text;
|
| 5914 |
-
}
|
| 5915 |
-
|
| 5916 |
-
// Event data gets referenced instead of copied if the expando
|
| 5917 |
-
// gets copied too
|
| 5918 |
-
dest.removeAttribute( jQuery.expando );
|
| 5919 |
-
}
|
| 5920 |
-
|
| 5921 |
-
jQuery.buildFragment = function( args, context, scripts ) {
|
| 5922 |
-
var fragment, cacheable, cachehit,
|
| 5923 |
-
first = args[ 0 ];
|
| 5924 |
-
|
| 5925 |
-
// Set context from what may come in as undefined or a jQuery collection or a node
|
| 5926 |
-
context = context || document;
|
| 5927 |
-
context = (context[0] || context).ownerDocument || context[0] || context;
|
| 5928 |
-
|
| 5929 |
-
// Ensure that an attr object doesn't incorrectly stand in as a document object
|
| 5930 |
-
// Chrome and Firefox seem to allow this to occur and will throw exception
|
| 5931 |
-
// Fixes #8950
|
| 5932 |
-
if ( typeof context.createDocumentFragment === "undefined" ) {
|
| 5933 |
-
context = document;
|
| 5934 |
-
}
|
| 5935 |
-
|
| 5936 |
-
// Only cache "small" (1/2 KB) HTML strings that are associated with the main document
|
| 5937 |
-
// Cloning options loses the selected state, so don't cache them
|
| 5938 |
-
// IE 6 doesn't like it when you put <object> or <embed> elements in a fragment
|
| 5939 |
-
// Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache
|
| 5940 |
-
// Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501
|
| 5941 |
-
if ( args.length === 1 && typeof first === "string" && first.length < 512 && context === document &&
|
| 5942 |
-
first.charAt(0) === "<" && !rnocache.test( first ) &&
|
| 5943 |
-
(jQuery.support.checkClone || !rchecked.test( first )) &&
|
| 5944 |
-
(jQuery.support.html5Clone || !rnoshimcache.test( first )) ) {
|
| 5945 |
-
|
| 5946 |
-
// Mark cacheable and look for a hit
|
| 5947 |
-
cacheable = true;
|
| 5948 |
-
fragment = jQuery.fragments[ first ];
|
| 5949 |
-
cachehit = fragment !== undefined;
|
| 5950 |
-
}
|
| 5951 |
-
|
| 5952 |
-
if ( !fragment ) {
|
| 5953 |
-
fragment = context.createDocumentFragment();
|
| 5954 |
-
jQuery.clean( args, context, fragment, scripts );
|
| 5955 |
-
|
| 5956 |
-
// Update the cache, but only store false
|
| 5957 |
-
// unless this is a second parsing of the same content
|
| 5958 |
-
if ( cacheable ) {
|
| 5959 |
-
jQuery.fragments[ first ] = cachehit && fragment;
|
| 5960 |
-
}
|
| 5961 |
-
}
|
| 5962 |
-
|
| 5963 |
-
return { fragment: fragment, cacheable: cacheable };
|
| 5964 |
-
};
|
| 5965 |
-
|
| 5966 |
-
jQuery.fragments = {};
|
| 5967 |
-
|
| 5968 |
-
jQuery.each({
|
| 5969 |
-
appendTo: "append",
|
| 5970 |
-
prependTo: "prepend",
|
| 5971 |
-
insertBefore: "before",
|
| 5972 |
-
insertAfter: "after",
|
| 5973 |
-
replaceAll: "replaceWith"
|
| 5974 |
-
}, function( name, original ) {
|
| 5975 |
-
jQuery.fn[ name ] = function( selector ) {
|
| 5976 |
-
var elems,
|
| 5977 |
-
i = 0,
|
| 5978 |
-
ret = [],
|
| 5979 |
-
insert = jQuery( selector ),
|
| 5980 |
-
l = insert.length,
|
| 5981 |
-
parent = this.length === 1 && this[0].parentNode;
|
| 5982 |
-
|
| 5983 |
-
if ( (parent == null || parent && parent.nodeType === 11 && parent.childNodes.length === 1) && l === 1 ) {
|
| 5984 |
-
insert[ original ]( this[0] );
|
| 5985 |
-
return this;
|
| 5986 |
-
} else {
|
| 5987 |
-
for ( ; i < l; i++ ) {
|
| 5988 |
-
elems = ( i > 0 ? this.clone(true) : this ).get();
|
| 5989 |
-
jQuery( insert[i] )[ original ]( elems );
|
| 5990 |
-
ret = ret.concat( elems );
|
| 5991 |
-
}
|
| 5992 |
-
|
| 5993 |
-
return this.pushStack( ret, name, insert.selector );
|
| 5994 |
-
}
|
| 5995 |
-
};
|
| 5996 |
-
});
|
| 5997 |
-
|
| 5998 |
-
function getAll( elem ) {
|
| 5999 |
-
if ( typeof elem.getElementsByTagName !== "undefined" ) {
|
| 6000 |
-
return elem.getElementsByTagName( "*" );
|
| 6001 |
-
|
| 6002 |
-
} else if ( typeof elem.querySelectorAll !== "undefined" ) {
|
| 6003 |
-
return elem.querySelectorAll( "*" );
|
| 6004 |
-
|
| 6005 |
-
} else {
|
| 6006 |
-
return [];
|
| 6007 |
-
}
|
| 6008 |
-
}
|
| 6009 |
-
|
| 6010 |
-
// Used in clean, fixes the defaultChecked property
|
| 6011 |
-
function fixDefaultChecked( elem ) {
|
| 6012 |
-
if ( rcheckableType.test( elem.type ) ) {
|
| 6013 |
-
elem.defaultChecked = elem.checked;
|
| 6014 |
-
}
|
| 6015 |
-
}
|
| 6016 |
-
|
| 6017 |
-
jQuery.extend({
|
| 6018 |
-
clone: function( elem, dataAndEvents, deepDataAndEvents ) {
|
| 6019 |
-
var srcElements,
|
| 6020 |
-
destElements,
|
| 6021 |
-
i,
|
| 6022 |
-
clone;
|
| 6023 |
-
|
| 6024 |
-
if ( jQuery.support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test( "<" + elem.nodeName + ">" ) ) {
|
| 6025 |
-
clone = elem.cloneNode( true );
|
| 6026 |
-
|
| 6027 |
-
// IE<=8 does not properly clone detached, unknown element nodes
|
| 6028 |
-
} else {
|
| 6029 |
-
fragmentDiv.innerHTML = elem.outerHTML;
|
| 6030 |
-
fragmentDiv.removeChild( clone = fragmentDiv.firstChild );
|
| 6031 |
-
}
|
| 6032 |
-
|
| 6033 |
-
if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) &&
|
| 6034 |
-
(elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) {
|
| 6035 |
-
// IE copies events bound via attachEvent when using cloneNode.
|
| 6036 |
-
// Calling detachEvent on the clone will also remove the events
|
| 6037 |
-
// from the original. In order to get around this, we use some
|
| 6038 |
-
// proprietary methods to clear the events. Thanks to MooTools
|
| 6039 |
-
// guys for this hotness.
|
| 6040 |
-
|
| 6041 |
-
cloneFixAttributes( elem, clone );
|
| 6042 |
-
|
| 6043 |
-
// Using Sizzle here is crazy slow, so we use getElementsByTagName instead
|
| 6044 |
-
srcElements = getAll( elem );
|
| 6045 |
-
destElements = getAll( clone );
|
| 6046 |
-
|
| 6047 |
-
// Weird iteration because IE will replace the length property
|
| 6048 |
-
// with an element if you are cloning the body and one of the
|
| 6049 |
-
// elements on the page has a name or id of "length"
|
| 6050 |
-
for ( i = 0; srcElements[i]; ++i ) {
|
| 6051 |
-
// Ensure that the destination node is not null; Fixes #9587
|
| 6052 |
-
if ( destElements[i] ) {
|
| 6053 |
-
cloneFixAttributes( srcElements[i], destElements[i] );
|
| 6054 |
-
}
|
| 6055 |
-
}
|
| 6056 |
-
}
|
| 6057 |
-
|
| 6058 |
-
// Copy the events from the original to the clone
|
| 6059 |
-
if ( dataAndEvents ) {
|
| 6060 |
-
cloneCopyEvent( elem, clone );
|
| 6061 |
-
|
| 6062 |
-
if ( deepDataAndEvents ) {
|
| 6063 |
-
srcElements = getAll( elem );
|
| 6064 |
-
destElements = getAll( clone );
|
| 6065 |
-
|
| 6066 |
-
for ( i = 0; srcElements[i]; ++i ) {
|
| 6067 |
-
cloneCopyEvent( srcElements[i], destElements[i] );
|
| 6068 |
-
}
|
| 6069 |
-
}
|
| 6070 |
-
}
|
| 6071 |
-
|
| 6072 |
-
srcElements = destElements = null;
|
| 6073 |
-
|
| 6074 |
-
// Return the cloned set
|
| 6075 |
-
return clone;
|
| 6076 |
-
},
|
| 6077 |
-
|
| 6078 |
-
clean: function( elems, context, fragment, scripts ) {
|
| 6079 |
-
var j, safe, elem, tag, wrap, depth, div, hasBody, tbody, len, handleScript, jsTags,
|
| 6080 |
-
i = 0,
|
| 6081 |
-
ret = [];
|
| 6082 |
-
|
| 6083 |
-
// Ensure that context is a document
|
| 6084 |
-
if ( !context || typeof context.createDocumentFragment === "undefined" ) {
|
| 6085 |
-
context = document;
|
| 6086 |
-
}
|
| 6087 |
-
|
| 6088 |
-
// Use the already-created safe fragment if context permits
|
| 6089 |
-
for ( safe = context === document && safeFragment; (elem = elems[i]) != null; i++ ) {
|
| 6090 |
-
if ( typeof elem === "number" ) {
|
| 6091 |
-
elem += "";
|
| 6092 |
-
}
|
| 6093 |
-
|
| 6094 |
-
if ( !elem ) {
|
| 6095 |
-
continue;
|
| 6096 |
-
}
|
| 6097 |
-
|
| 6098 |
-
// Convert html string into DOM nodes
|
| 6099 |
-
if ( typeof elem === "string" ) {
|
| 6100 |
-
if ( !rhtml.test( elem ) ) {
|
| 6101 |
-
elem = context.createTextNode( elem );
|
| 6102 |
-
} else {
|
| 6103 |
-
// Ensure a safe container in which to render the html
|
| 6104 |
-
safe = safe || createSafeFragment( context );
|
| 6105 |
-
div = div || safe.appendChild( context.createElement("div") );
|
| 6106 |
-
|
| 6107 |
-
// Fix "XHTML"-style tags in all browsers
|
| 6108 |
-
elem = elem.replace(rxhtmlTag, "<$1></$2>");
|
| 6109 |
-
|
| 6110 |
-
// Go to html and back, then peel off extra wrappers
|
| 6111 |
-
tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase();
|
| 6112 |
-
wrap = wrapMap[ tag ] || wrapMap._default;
|
| 6113 |
-
depth = wrap[0];
|
| 6114 |
-
div.innerHTML = wrap[1] + elem + wrap[2];
|
| 6115 |
-
|
| 6116 |
-
// Move to the right depth
|
| 6117 |
-
while ( depth-- ) {
|
| 6118 |
-
div = div.lastChild;
|
| 6119 |
-
}
|
| 6120 |
-
|
| 6121 |
-
// Remove IE's autoinserted <tbody> from table fragments
|
| 6122 |
-
if ( !jQuery.support.tbody ) {
|
| 6123 |
-
|
| 6124 |
-
// String was a <table>, *may* have spurious <tbody>
|
| 6125 |
-
hasBody = rtbody.test(elem);
|
| 6126 |
-
tbody = tag === "table" && !hasBody ?
|
| 6127 |
-
div.firstChild && div.firstChild.childNodes :
|
| 6128 |
-
|
| 6129 |
-
// String was a bare <thead> or <tfoot>
|
| 6130 |
-
wrap[1] === "<table>" && !hasBody ?
|
| 6131 |
-
div.childNodes :
|
| 6132 |
-
[];
|
| 6133 |
-
|
| 6134 |
-
for ( j = tbody.length - 1; j >= 0 ; --j ) {
|
| 6135 |
-
if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) {
|
| 6136 |
-
tbody[ j ].parentNode.removeChild( tbody[ j ] );
|
| 6137 |
-
}
|
| 6138 |
-
}
|
| 6139 |
-
}
|
| 6140 |
-
|
| 6141 |
-
// IE completely kills leading whitespace when innerHTML is used
|
| 6142 |
-
if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
|
| 6143 |
-
div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild );
|
| 6144 |
-
}
|
| 6145 |
-
|
| 6146 |
-
elem = div.childNodes;
|
| 6147 |
-
|
| 6148 |
-
// Remember the top-level container for proper cleanup
|
| 6149 |
-
div = safe.lastChild;
|
| 6150 |
-
}
|
| 6151 |
-
}
|
| 6152 |
-
|
| 6153 |
-
if ( elem.nodeType ) {
|
| 6154 |
-
ret.push( elem );
|
| 6155 |
-
} else {
|
| 6156 |
-
ret = jQuery.merge( ret, elem );
|
| 6157 |
-
}
|
| 6158 |
-
}
|
| 6159 |
-
|
| 6160 |
-
// Fix #11356: Clear elements from safeFragment
|
| 6161 |
-
if ( div ) {
|
| 6162 |
-
safe.removeChild( div );
|
| 6163 |
-
elem = div = safe = null;
|
| 6164 |
-
}
|
| 6165 |
-
|
| 6166 |
-
// Reset defaultChecked for any radios and checkboxes
|
| 6167 |
-
// about to be appended to the DOM in IE 6/7 (#8060)
|
| 6168 |
-
if ( !jQuery.support.appendChecked ) {
|
| 6169 |
-
for ( i = 0; (elem = ret[i]) != null; i++ ) {
|
| 6170 |
-
if ( jQuery.nodeName( elem, "input" ) ) {
|
| 6171 |
-
fixDefaultChecked( elem );
|
| 6172 |
-
} else if ( typeof elem.getElementsByTagName !== "undefined" ) {
|
| 6173 |
-
jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked );
|
| 6174 |
-
}
|
| 6175 |
-
}
|
| 6176 |
-
}
|
| 6177 |
-
|
| 6178 |
-
// Append elements to a provided document fragment
|
| 6179 |
-
if ( fragment ) {
|
| 6180 |
-
// Special handling of each script element
|
| 6181 |
-
handleScript = function( elem ) {
|
| 6182 |
-
// Check if we consider it executable
|
| 6183 |
-
if ( !elem.type || rscriptType.test( elem.type ) ) {
|
| 6184 |
-
// Detach the script and store it in the scripts array (if provided) or the fragment
|
| 6185 |
-
// Return truthy to indicate that it has been handled
|
| 6186 |
-
return scripts ?
|
| 6187 |
-
scripts.push( elem.parentNode ? elem.parentNode.removeChild( elem ) : elem ) :
|
| 6188 |
-
fragment.appendChild( elem );
|
| 6189 |
-
}
|
| 6190 |
-
};
|
| 6191 |
-
|
| 6192 |
-
for ( i = 0; (elem = ret[i]) != null; i++ ) {
|
| 6193 |
-
// Check if we're done after handling an executable script
|
| 6194 |
-
if ( !( jQuery.nodeName( elem, "script" ) && handleScript( elem ) ) ) {
|
| 6195 |
-
// Append to fragment and handle embedded scripts
|
| 6196 |
-
fragment.appendChild( elem );
|
| 6197 |
-
if ( typeof elem.getElementsByTagName !== "undefined" ) {
|
| 6198 |
-
// handleScript alters the DOM, so use jQuery.merge to ensure snapshot iteration
|
| 6199 |
-
jsTags = jQuery.grep( jQuery.merge( [], elem.getElementsByTagName("script") ), handleScript );
|
| 6200 |
-
|
| 6201 |
-
// Splice the scripts into ret after their former ancestor and advance our index beyond them
|
| 6202 |
-
ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) );
|
| 6203 |
-
i += jsTags.length;
|
| 6204 |
-
}
|
| 6205 |
-
}
|
| 6206 |
-
}
|
| 6207 |
-
}
|
| 6208 |
-
|
| 6209 |
-
return ret;
|
| 6210 |
-
},
|
| 6211 |
-
|
| 6212 |
-
cleanData: function( elems, /* internal */ acceptData ) {
|
| 6213 |
-
var data, id, elem, type,
|
| 6214 |
-
i = 0,
|
| 6215 |
-
internalKey = jQuery.expando,
|
| 6216 |
-
cache = jQuery.cache,
|
| 6217 |
-
deleteExpando = jQuery.support.deleteExpando,
|
| 6218 |
-
special = jQuery.event.special;
|
| 6219 |
-
|
| 6220 |
-
for ( ; (elem = elems[i]) != null; i++ ) {
|
| 6221 |
-
|
| 6222 |
-
if ( acceptData || jQuery.acceptData( elem ) ) {
|
| 6223 |
-
|
| 6224 |
-
id = elem[ internalKey ];
|
| 6225 |
-
data = id && cache[ id ];
|
| 6226 |
-
|
| 6227 |
-
if ( data ) {
|
| 6228 |
-
if ( data.events ) {
|
| 6229 |
-
for ( type in data.events ) {
|
| 6230 |
-
if ( special[ type ] ) {
|
| 6231 |
-
jQuery.event.remove( elem, type );
|
| 6232 |
-
|
| 6233 |
-
// This is a shortcut to avoid jQuery.event.remove's overhead
|
| 6234 |
-
} else {
|
| 6235 |
-
jQuery.removeEvent( elem, type, data.handle );
|
| 6236 |
-
}
|
| 6237 |
-
}
|
| 6238 |
-
}
|
| 6239 |
-
|
| 6240 |
-
// Remove cache only if it was not already removed by jQuery.event.remove
|
| 6241 |
-
if ( cache[ id ] ) {
|
| 6242 |
-
|
| 6243 |
-
delete cache[ id ];
|
| 6244 |
-
|
| 6245 |
-
// IE does not allow us to delete expando properties from nodes,
|
| 6246 |
-
// nor does it have a removeAttribute function on Document nodes;
|
| 6247 |
-
// we must handle all of these cases
|
| 6248 |
-
if ( deleteExpando ) {
|
| 6249 |
-
delete elem[ internalKey ];
|
| 6250 |
-
|
| 6251 |
-
} else if ( elem.removeAttribute ) {
|
| 6252 |
-
elem.removeAttribute( internalKey );
|
| 6253 |
-
|
| 6254 |
-
} else {
|
| 6255 |
-
elem[ internalKey ] = null;
|
| 6256 |
-
}
|
| 6257 |
-
|
| 6258 |
-
jQuery.deletedIds.push( id );
|
| 6259 |
-
}
|
| 6260 |
-
}
|
| 6261 |
-
}
|
| 6262 |
-
}
|
| 6263 |
-
}
|
| 6264 |
-
});
|
| 6265 |
-
// Limit scope pollution from any deprecated API
|
| 6266 |
-
(function() {
|
| 6267 |
-
|
| 6268 |
-
var matched, browser;
|
| 6269 |
-
|
| 6270 |
-
// Use of jQuery.browser is frowned upon.
|
| 6271 |
-
// More details: http://api.jquery.com/jQuery.browser
|
| 6272 |
-
// jQuery.uaMatch maintained for back-compat
|
| 6273 |
-
jQuery.uaMatch = function( ua ) {
|
| 6274 |
-
ua = ua.toLowerCase();
|
| 6275 |
-
|
| 6276 |
-
var match = /(chrome)[ \/]([\w.]+)/.exec( ua ) ||
|
| 6277 |
-
/(webkit)[ \/]([\w.]+)/.exec( ua ) ||
|
| 6278 |
-
/(opera)(?:.*version|)[ \/]([\w.]+)/.exec( ua ) ||
|
| 6279 |
-
/(msie) ([\w.]+)/.exec( ua ) ||
|
| 6280 |
-
ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec( ua ) ||
|
| 6281 |
-
[];
|
| 6282 |
-
|
| 6283 |
-
return {
|
| 6284 |
-
browser: match[ 1 ] || "",
|
| 6285 |
-
version: match[ 2 ] || "0"
|
| 6286 |
-
};
|
| 6287 |
-
};
|
| 6288 |
-
|
| 6289 |
-
matched = jQuery.uaMatch( navigator.userAgent );
|
| 6290 |
-
browser = {};
|
| 6291 |
-
|
| 6292 |
-
if ( matched.browser ) {
|
| 6293 |
-
browser[ matched.browser ] = true;
|
| 6294 |
-
browser.version = matched.version;
|
| 6295 |
-
}
|
| 6296 |
-
|
| 6297 |
-
// Deprecated, use jQuery.browser.webkit instead
|
| 6298 |
-
// Maintained for back-compat only
|
| 6299 |
-
if ( browser.webkit ) {
|
| 6300 |
-
browser.safari = true;
|
| 6301 |
-
}
|
| 6302 |
-
|
| 6303 |
-
jQuery.browser = browser;
|
| 6304 |
-
|
| 6305 |
-
jQuery.sub = function() {
|
| 6306 |
-
function jQuerySub( selector, context ) {
|
| 6307 |
-
return new jQuerySub.fn.init( selector, context );
|
| 6308 |
-
}
|
| 6309 |
-
jQuery.extend( true, jQuerySub, this );
|
| 6310 |
-
jQuerySub.superclass = this;
|
| 6311 |
-
jQuerySub.fn = jQuerySub.prototype = this();
|
| 6312 |
-
jQuerySub.fn.constructor = jQuerySub;
|
| 6313 |
-
jQuerySub.sub = this.sub;
|
| 6314 |
-
jQuerySub.fn.init = function init( selector, context ) {
|
| 6315 |
-
if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) {
|
| 6316 |
-
context = jQuerySub( context );
|
| 6317 |
-
}
|
| 6318 |
-
|
| 6319 |
-
return jQuery.fn.init.call( this, selector, context, rootjQuerySub );
|
| 6320 |
-
};
|
| 6321 |
-
jQuerySub.fn.init.prototype = jQuerySub.fn;
|
| 6322 |
-
var rootjQuerySub = jQuerySub(document);
|
| 6323 |
-
return jQuerySub;
|
| 6324 |
-
};
|
| 6325 |
-
|
| 6326 |
-
})();
|
| 6327 |
-
var curCSS, iframe, iframeDoc,
|
| 6328 |
-
ralpha = /alpha\([^)]*\)/i,
|
| 6329 |
-
ropacity = /opacity=([^)]*)/,
|
| 6330 |
-
rposition = /^(top|right|bottom|left)$/,
|
| 6331 |
-
rmargin = /^margin/,
|
| 6332 |
-
rnumsplit = new RegExp( "^(" + core_pnum + ")(.*)$", "i" ),
|
| 6333 |
-
rnumnonpx = new RegExp( "^(" + core_pnum + ")(?!px)[a-z%]+$", "i" ),
|
| 6334 |
-
rrelNum = new RegExp( "^([-+])=(" + core_pnum + ")", "i" ),
|
| 6335 |
-
elemdisplay = {},
|
| 6336 |
-
|
| 6337 |
-
cssShow = { position: "absolute", visibility: "hidden", display: "block" },
|
| 6338 |
-
cssNormalTransform = {
|
| 6339 |
-
letterSpacing: 0,
|
| 6340 |
-
fontWeight: 400,
|
| 6341 |
-
lineHeight: 1
|
| 6342 |
-
},
|
| 6343 |
-
|
| 6344 |
-
cssExpand = [ "Top", "Right", "Bottom", "Left" ],
|
| 6345 |
-
cssPrefixes = [ "Webkit", "O", "Moz", "ms" ],
|
| 6346 |
-
|
| 6347 |
-
eventsToggle = jQuery.fn.toggle;
|
| 6348 |
-
|
| 6349 |
-
// return a css property mapped to a potentially vendor prefixed property
|
| 6350 |
-
function vendorPropName( style, name ) {
|
| 6351 |
-
|
| 6352 |
-
// shortcut for names that are not vendor prefixed
|
| 6353 |
-
if ( name in style ) {
|
| 6354 |
-
return name;
|
| 6355 |
-
}
|
| 6356 |
-
|
| 6357 |
-
// check for vendor prefixed names
|
| 6358 |
-
var capName = name.charAt(0).toUpperCase() + name.slice(1),
|
| 6359 |
-
origName = name,
|
| 6360 |
-
i = cssPrefixes.length;
|
| 6361 |
-
|
| 6362 |
-
while ( i-- ) {
|
| 6363 |
-
name = cssPrefixes[ i ] + capName;
|
| 6364 |
-
if ( name in style ) {
|
| 6365 |
-
return name;
|
| 6366 |
-
}
|
| 6367 |
-
}
|
| 6368 |
-
|
| 6369 |
-
return origName;
|
| 6370 |
-
}
|
| 6371 |
-
|
| 6372 |
-
function isHidden( elem, el ) {
|
| 6373 |
-
elem = el || elem;
|
| 6374 |
-
return jQuery.css( elem, "display" ) === "none" || !jQuery.contains( elem.ownerDocument, elem );
|
| 6375 |
-
}
|
| 6376 |
-
|
| 6377 |
-
function showHide( elements, show ) {
|
| 6378 |
-
var elem, display,
|
| 6379 |
-
values = [],
|
| 6380 |
-
index = 0,
|
| 6381 |
-
length = elements.length;
|
| 6382 |
-
|
| 6383 |
-
for ( ; index < length; index++ ) {
|
| 6384 |
-
elem = elements[ index ];
|
| 6385 |
-
if ( !elem.style ) {
|
| 6386 |
-
continue;
|
| 6387 |
-
}
|
| 6388 |
-
values[ index ] = jQuery._data( elem, "olddisplay" );
|
| 6389 |
-
if ( show ) {
|
| 6390 |
-
// Reset the inline display of this element to learn if it is
|
| 6391 |
-
// being hidden by cascaded rules or not
|
| 6392 |
-
if ( !values[ index ] && elem.style.display === "none" ) {
|
| 6393 |
-
elem.style.display = "";
|
| 6394 |
-
}
|
| 6395 |
-
|
| 6396 |
-
// Set elements which have been overridden with display: none
|
| 6397 |
-
// in a stylesheet to whatever the default browser style is
|
| 6398 |
-
// for such an element
|
| 6399 |
-
if ( elem.style.display === "" && isHidden( elem ) ) {
|
| 6400 |
-
values[ index ] = jQuery._data( elem, "olddisplay", css_defaultDisplay(elem.nodeName) );
|
| 6401 |
-
}
|
| 6402 |
-
} else {
|
| 6403 |
-
display = curCSS( elem, "display" );
|
| 6404 |
-
|
| 6405 |
-
if ( !values[ index ] && display !== "none" ) {
|
| 6406 |
-
jQuery._data( elem, "olddisplay", display );
|
| 6407 |
-
}
|
| 6408 |
-
}
|
| 6409 |
-
}
|
| 6410 |
-
|
| 6411 |
-
// Set the display of most of the elements in a second loop
|
| 6412 |
-
// to avoid the constant reflow
|
| 6413 |
-
for ( index = 0; index < length; index++ ) {
|
| 6414 |
-
elem = elements[ index ];
|
| 6415 |
-
if ( !elem.style ) {
|
| 6416 |
-
continue;
|
| 6417 |
-
}
|
| 6418 |
-
if ( !show || elem.style.display === "none" || elem.style.display === "" ) {
|
| 6419 |
-
elem.style.display = show ? values[ index ] || "" : "none";
|
| 6420 |
-
}
|
| 6421 |
-
}
|
| 6422 |
-
|
| 6423 |
-
return elements;
|
| 6424 |
-
}
|
| 6425 |
-
|
| 6426 |
-
jQuery.fn.extend({
|
| 6427 |
-
css: function( name, value ) {
|
| 6428 |
-
return jQuery.access( this, function( elem, name, value ) {
|
| 6429 |
-
return value !== undefined ?
|
| 6430 |
-
jQuery.style( elem, name, value ) :
|
| 6431 |
-
jQuery.css( elem, name );
|
| 6432 |
-
}, name, value, arguments.length > 1 );
|
| 6433 |
-
},
|
| 6434 |
-
show: function() {
|
| 6435 |
-
return showHide( this, true );
|
| 6436 |
-
},
|
| 6437 |
-
hide: function() {
|
| 6438 |
-
return showHide( this );
|
| 6439 |
-
},
|
| 6440 |
-
toggle: function( state, fn2 ) {
|
| 6441 |
-
var bool = typeof state === "boolean";
|
| 6442 |
-
|
| 6443 |
-
if ( jQuery.isFunction( state ) && jQuery.isFunction( fn2 ) ) {
|
| 6444 |
-
return eventsToggle.apply( this, arguments );
|
| 6445 |
-
}
|
| 6446 |
-
|
| 6447 |
-
return this.each(function() {
|
| 6448 |
-
if ( bool ? state : isHidden( this ) ) {
|
| 6449 |
-
jQuery( this ).show();
|
| 6450 |
-
} else {
|
| 6451 |
-
jQuery( this ).hide();
|
| 6452 |
-
}
|
| 6453 |
-
});
|
| 6454 |
-
}
|
| 6455 |
-
});
|
| 6456 |
-
|
| 6457 |
-
jQuery.extend({
|
| 6458 |
-
// Add in style property hooks for overriding the default
|
| 6459 |
-
// behavior of getting and setting a style property
|
| 6460 |
-
cssHooks: {
|
| 6461 |
-
opacity: {
|
| 6462 |
-
get: function( elem, computed ) {
|
| 6463 |
-
if ( computed ) {
|
| 6464 |
-
// We should always get a number back from opacity
|
| 6465 |
-
var ret = curCSS( elem, "opacity" );
|
| 6466 |
-
return ret === "" ? "1" : ret;
|
| 6467 |
-
|
| 6468 |
-
}
|
| 6469 |
-
}
|
| 6470 |
-
}
|
| 6471 |
-
},
|
| 6472 |
-
|
| 6473 |
-
// Exclude the following css properties to add px
|
| 6474 |
-
cssNumber: {
|
| 6475 |
-
"fillOpacity": true,
|
| 6476 |
-
"fontWeight": true,
|
| 6477 |
-
"lineHeight": true,
|
| 6478 |
-
"opacity": true,
|
| 6479 |
-
"orphans": true,
|
| 6480 |
-
"widows": true,
|
| 6481 |
-
"zIndex": true,
|
| 6482 |
-
"zoom": true
|
| 6483 |
-
},
|
| 6484 |
-
|
| 6485 |
-
// Add in properties whose names you wish to fix before
|
| 6486 |
-
// setting or getting the value
|
| 6487 |
-
cssProps: {
|
| 6488 |
-
// normalize float css property
|
| 6489 |
-
"float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat"
|
| 6490 |
-
},
|
| 6491 |
-
|
| 6492 |
-
// Get and set the style property on a DOM Node
|
| 6493 |
-
style: function( elem, name, value, extra ) {
|
| 6494 |
-
// Don't set styles on text and comment nodes
|
| 6495 |
-
if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
|
| 6496 |
-
return;
|
| 6497 |
-
}
|
| 6498 |
-
|
| 6499 |
-
// Make sure that we're working with the right name
|
| 6500 |
-
var ret, type, hooks,
|
| 6501 |
-
origName = jQuery.camelCase( name ),
|
| 6502 |
-
style = elem.style;
|
| 6503 |
-
|
| 6504 |
-
name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( style, origName ) );
|
| 6505 |
-
|
| 6506 |
-
// gets hook for the prefixed version
|
| 6507 |
-
// followed by the unprefixed version
|
| 6508 |
-
hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
|
| 6509 |
-
|
| 6510 |
-
// Check if we're setting a value
|
| 6511 |
-
if ( value !== undefined ) {
|
| 6512 |
-
type = typeof value;
|
| 6513 |
-
|
| 6514 |
-
// convert relative number strings (+= or -=) to relative numbers. #7345
|
| 6515 |
-
if ( type === "string" && (ret = rrelNum.exec( value )) ) {
|
| 6516 |
-
value = ( ret[1] + 1 ) * ret[2] + parseFloat( jQuery.css( elem, name ) );
|
| 6517 |
-
// Fixes bug #9237
|
| 6518 |
-
type = "number";
|
| 6519 |
-
}
|
| 6520 |
-
|
| 6521 |
-
// Make sure that NaN and null values aren't set. See: #7116
|
| 6522 |
-
if ( value == null || type === "number" && isNaN( value ) ) {
|
| 6523 |
-
return;
|
| 6524 |
-
}
|
| 6525 |
-
|
| 6526 |
-
// If a number was passed in, add 'px' to the (except for certain CSS properties)
|
| 6527 |
-
if ( type === "number" && !jQuery.cssNumber[ origName ] ) {
|
| 6528 |
-
value += "px";
|
| 6529 |
-
}
|
| 6530 |
-
|
| 6531 |
-
// If a hook was provided, use that value, otherwise just set the specified value
|
| 6532 |
-
if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value, extra )) !== undefined ) {
|
| 6533 |
-
// Wrapped to prevent IE from throwing errors when 'invalid' values are provided
|
| 6534 |
-
// Fixes bug #5509
|
| 6535 |
-
try {
|
| 6536 |
-
style[ name ] = value;
|
| 6537 |
-
} catch(e) {}
|
| 6538 |
-
}
|
| 6539 |
-
|
| 6540 |
-
} else {
|
| 6541 |
-
// If a hook was provided get the non-computed value from there
|
| 6542 |
-
if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) {
|
| 6543 |
-
return ret;
|
| 6544 |
-
}
|
| 6545 |
-
|
| 6546 |
-
// Otherwise just get the value from the style object
|
| 6547 |
-
return style[ name ];
|
| 6548 |
-
}
|
| 6549 |
-
},
|
| 6550 |
-
|
| 6551 |
-
css: function( elem, name, numeric, extra ) {
|
| 6552 |
-
var val, num, hooks,
|
| 6553 |
-
origName = jQuery.camelCase( name );
|
| 6554 |
-
|
| 6555 |
-
// Make sure that we're working with the right name
|
| 6556 |
-
name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( elem.style, origName ) );
|
| 6557 |
-
|
| 6558 |
-
// gets hook for the prefixed version
|
| 6559 |
-
// followed by the unprefixed version
|
| 6560 |
-
hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
|
| 6561 |
-
|
| 6562 |
-
// If a hook was provided get the computed value from there
|
| 6563 |
-
if ( hooks && "get" in hooks ) {
|
| 6564 |
-
val = hooks.get( elem, true, extra );
|
| 6565 |
-
}
|
| 6566 |
-
|
| 6567 |
-
// Otherwise, if a way to get the computed value exists, use that
|
| 6568 |
-
if ( val === undefined ) {
|
| 6569 |
-
val = curCSS( elem, name );
|
| 6570 |
-
}
|
| 6571 |
-
|
| 6572 |
-
//convert "normal" to computed value
|
| 6573 |
-
if ( val === "normal" && name in cssNormalTransform ) {
|
| 6574 |
-
val = cssNormalTransform[ name ];
|
| 6575 |
-
}
|
| 6576 |
-
|
| 6577 |
-
// Return, converting to number if forced or a qualifier was provided and val looks numeric
|
| 6578 |
-
if ( numeric || extra !== undefined ) {
|
| 6579 |
-
num = parseFloat( val );
|
| 6580 |
-
return numeric || jQuery.isNumeric( num ) ? num || 0 : val;
|
| 6581 |
-
}
|
| 6582 |
-
return val;
|
| 6583 |
-
},
|
| 6584 |
-
|
| 6585 |
-
// A method for quickly swapping in/out CSS properties to get correct calculations
|
| 6586 |
-
swap: function( elem, options, callback ) {
|
| 6587 |
-
var ret, name,
|
| 6588 |
-
old = {};
|
| 6589 |
-
|
| 6590 |
-
// Remember the old values, and insert the new ones
|
| 6591 |
-
for ( name in options ) {
|
| 6592 |
-
old[ name ] = elem.style[ name ];
|
| 6593 |
-
elem.style[ name ] = options[ name ];
|
| 6594 |
-
}
|
| 6595 |
-
|
| 6596 |
-
ret = callback.call( elem );
|
| 6597 |
-
|
| 6598 |
-
// Revert the old values
|
| 6599 |
-
for ( name in options ) {
|
| 6600 |
-
elem.style[ name ] = old[ name ];
|
| 6601 |
-
}
|
| 6602 |
-
|
| 6603 |
-
return ret;
|
| 6604 |
-
}
|
| 6605 |
-
});
|
| 6606 |
-
|
| 6607 |
-
// NOTE: To any future maintainer, we've used both window.getComputedStyle
|
| 6608 |
-
// and getComputedStyle here to produce a better gzip size
|
| 6609 |
-
if ( window.getComputedStyle ) {
|
| 6610 |
-
curCSS = function( elem, name ) {
|
| 6611 |
-
var ret, width, minWidth, maxWidth,
|
| 6612 |
-
computed = getComputedStyle( elem, null ),
|
| 6613 |
-
style = elem.style;
|
| 6614 |
-
|
| 6615 |
-
if ( computed ) {
|
| 6616 |
-
|
| 6617 |
-
ret = computed[ name ];
|
| 6618 |
-
if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) {
|
| 6619 |
-
ret = jQuery.style( elem, name );
|
| 6620 |
-
}
|
| 6621 |
-
|
| 6622 |
-
// A tribute to the "awesome hack by Dean Edwards"
|
| 6623 |
-
// Chrome < 17 and Safari 5.0 uses "computed value" instead of "used value" for margin-right
|
| 6624 |
-
// Safari 5.1.7 (at least) returns percentage for a larger set of values, but width seems to be reliably pixels
|
| 6625 |
-
// this is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values
|
| 6626 |
-
if ( rnumnonpx.test( ret ) && rmargin.test( name ) ) {
|
| 6627 |
-
width = style.width;
|
| 6628 |
-
minWidth = style.minWidth;
|
| 6629 |
-
maxWidth = style.maxWidth;
|
| 6630 |
-
|
| 6631 |
-
style.minWidth = style.maxWidth = style.width = ret;
|
| 6632 |
-
ret = computed.width;
|
| 6633 |
-
|
| 6634 |
-
style.width = width;
|
| 6635 |
-
style.minWidth = minWidth;
|
| 6636 |
-
style.maxWidth = maxWidth;
|
| 6637 |
-
}
|
| 6638 |
-
}
|
| 6639 |
-
|
| 6640 |
-
return ret;
|
| 6641 |
-
};
|
| 6642 |
-
} else if ( document.documentElement.currentStyle ) {
|
| 6643 |
-
curCSS = function( elem, name ) {
|
| 6644 |
-
var left, rsLeft,
|
| 6645 |
-
ret = elem.currentStyle && elem.currentStyle[ name ],
|
| 6646 |
-
style = elem.style;
|
| 6647 |
-
|
| 6648 |
-
// Avoid setting ret to empty string here
|
| 6649 |
-
// so we don't default to auto
|
| 6650 |
-
if ( ret == null && style && style[ name ] ) {
|
| 6651 |
-
ret = style[ name ];
|
| 6652 |
-
}
|
| 6653 |
-
|
| 6654 |
-
// From the awesome hack by Dean Edwards
|
| 6655 |
-
// http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
|
| 6656 |
-
|
| 6657 |
-
// If we're not dealing with a regular pixel number
|
| 6658 |
-
// but a number that has a weird ending, we need to convert it to pixels
|
| 6659 |
-
// but not position css attributes, as those are proportional to the parent element instead
|
| 6660 |
-
// and we can't measure the parent instead because it might trigger a "stacking dolls" problem
|
| 6661 |
-
if ( rnumnonpx.test( ret ) && !rposition.test( name ) ) {
|
| 6662 |
-
|
| 6663 |
-
// Remember the original values
|
| 6664 |
-
left = style.left;
|
| 6665 |
-
rsLeft = elem.runtimeStyle && elem.runtimeStyle.left;
|
| 6666 |
-
|
| 6667 |
-
// Put in the new values to get a computed value out
|
| 6668 |
-
if ( rsLeft ) {
|
| 6669 |
-
elem.runtimeStyle.left = elem.currentStyle.left;
|
| 6670 |
-
}
|
| 6671 |
-
style.left = name === "fontSize" ? "1em" : ret;
|
| 6672 |
-
ret = style.pixelLeft + "px";
|
| 6673 |
-
|
| 6674 |
-
// Revert the changed values
|
| 6675 |
-
style.left = left;
|
| 6676 |
-
if ( rsLeft ) {
|
| 6677 |
-
elem.runtimeStyle.left = rsLeft;
|
| 6678 |
-
}
|
| 6679 |
-
}
|
| 6680 |
-
|
| 6681 |
-
return ret === "" ? "auto" : ret;
|
| 6682 |
-
};
|
| 6683 |
-
}
|
| 6684 |
-
|
| 6685 |
-
function setPositiveNumber( elem, value, subtract ) {
|
| 6686 |
-
var matches = rnumsplit.exec( value );
|
| 6687 |
-
return matches ?
|
| 6688 |
-
Math.max( 0, matches[ 1 ] - ( subtract || 0 ) ) + ( matches[ 2 ] || "px" ) :
|
| 6689 |
-
value;
|
| 6690 |
-
}
|
| 6691 |
-
|
| 6692 |
-
function augmentWidthOrHeight( elem, name, extra, isBorderBox ) {
|
| 6693 |
-
var i = extra === ( isBorderBox ? "border" : "content" ) ?
|
| 6694 |
-
// If we already have the right measurement, avoid augmentation
|
| 6695 |
-
4 :
|
| 6696 |
-
// Otherwise initialize for horizontal or vertical properties
|
| 6697 |
-
name === "width" ? 1 : 0,
|
| 6698 |
-
|
| 6699 |
-
val = 0;
|
| 6700 |
-
|
| 6701 |
-
for ( ; i < 4; i += 2 ) {
|
| 6702 |
-
// both box models exclude margin, so add it if we want it
|
| 6703 |
-
if ( extra === "margin" ) {
|
| 6704 |
-
// we use jQuery.css instead of curCSS here
|
| 6705 |
-
// because of the reliableMarginRight CSS hook!
|
| 6706 |
-
val += jQuery.css( elem, extra + cssExpand[ i ], true );
|
| 6707 |
-
}
|
| 6708 |
-
|
| 6709 |
-
// From this point on we use curCSS for maximum performance (relevant in animations)
|
| 6710 |
-
if ( isBorderBox ) {
|
| 6711 |
-
// border-box includes padding, so remove it if we want content
|
| 6712 |
-
if ( extra === "content" ) {
|
| 6713 |
-
val -= parseFloat( curCSS( elem, "padding" + cssExpand[ i ] ) ) || 0;
|
| 6714 |
-
}
|
| 6715 |
-
|
| 6716 |
-
// at this point, extra isn't border nor margin, so remove border
|
| 6717 |
-
if ( extra !== "margin" ) {
|
| 6718 |
-
val -= parseFloat( curCSS( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0;
|
| 6719 |
-
}
|
| 6720 |
-
} else {
|
| 6721 |
-
// at this point, extra isn't content, so add padding
|
| 6722 |
-
val += parseFloat( curCSS( elem, "padding" + cssExpand[ i ] ) ) || 0;
|
| 6723 |
-
|
| 6724 |
-
// at this point, extra isn't content nor padding, so add border
|
| 6725 |
-
if ( extra !== "padding" ) {
|
| 6726 |
-
val += parseFloat( curCSS( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0;
|
| 6727 |
-
}
|
| 6728 |
-
}
|
| 6729 |
-
}
|
| 6730 |
-
|
| 6731 |
-
return val;
|
| 6732 |
-
}
|
| 6733 |
-
|
| 6734 |
-
function getWidthOrHeight( elem, name, extra ) {
|
| 6735 |
-
|
| 6736 |
-
// Start with offset property, which is equivalent to the border-box value
|
| 6737 |
-
var val = name === "width" ? elem.offsetWidth : elem.offsetHeight,
|
| 6738 |
-
valueIsBorderBox = true,
|
| 6739 |
-
isBorderBox = jQuery.support.boxSizing && jQuery.css( elem, "boxSizing" ) === "border-box";
|
| 6740 |
-
|
| 6741 |
-
if ( val <= 0 ) {
|
| 6742 |
-
// Fall back to computed then uncomputed css if necessary
|
| 6743 |
-
val = curCSS( elem, name );
|
| 6744 |
-
if ( val < 0 || val == null ) {
|
| 6745 |
-
val = elem.style[ name ];
|
| 6746 |
-
}
|
| 6747 |
-
|
| 6748 |
-
// Computed unit is not pixels. Stop here and return.
|
| 6749 |
-
if ( rnumnonpx.test(val) ) {
|
| 6750 |
-
return val;
|
| 6751 |
-
}
|
| 6752 |
-
|
| 6753 |
-
// we need the check for style in case a browser which returns unreliable values
|
| 6754 |
-
// for getComputedStyle silently falls back to the reliable elem.style
|
| 6755 |
-
valueIsBorderBox = isBorderBox && ( jQuery.support.boxSizingReliable || val === elem.style[ name ] );
|
| 6756 |
-
|
| 6757 |
-
// Normalize "", auto, and prepare for extra
|
| 6758 |
-
val = parseFloat( val ) || 0;
|
| 6759 |
-
}
|
| 6760 |
-
|
| 6761 |
-
// use the active box-sizing model to add/subtract irrelevant styles
|
| 6762 |
-
return ( val +
|
| 6763 |
-
augmentWidthOrHeight(
|
| 6764 |
-
elem,
|
| 6765 |
-
name,
|
| 6766 |
-
extra || ( isBorderBox ? "border" : "content" ),
|
| 6767 |
-
valueIsBorderBox
|
| 6768 |
-
)
|
| 6769 |
-
) + "px";
|
| 6770 |
-
}
|
| 6771 |
-
|
| 6772 |
-
|
| 6773 |
-
// Try to determine the default display value of an element
|
| 6774 |
-
function css_defaultDisplay( nodeName ) {
|
| 6775 |
-
if ( elemdisplay[ nodeName ] ) {
|
| 6776 |
-
return elemdisplay[ nodeName ];
|
| 6777 |
-
}
|
| 6778 |
-
|
| 6779 |
-
var elem = jQuery( "<" + nodeName + ">" ).appendTo( document.body ),
|
| 6780 |
-
display = elem.css("display");
|
| 6781 |
-
elem.remove();
|
| 6782 |
-
|
| 6783 |
-
// If the simple way fails,
|
| 6784 |
-
// get element's real default display by attaching it to a temp iframe
|
| 6785 |
-
if ( display === "none" || display === "" ) {
|
| 6786 |
-
// Use the already-created iframe if possible
|
| 6787 |
-
iframe = document.body.appendChild(
|
| 6788 |
-
iframe || jQuery.extend( document.createElement("iframe"), {
|
| 6789 |
-
frameBorder: 0,
|
| 6790 |
-
width: 0,
|
| 6791 |
-
height: 0
|
| 6792 |
-
})
|
| 6793 |
-
);
|
| 6794 |
-
|
| 6795 |
-
// Create a cacheable copy of the iframe document on first call.
|
| 6796 |
-
// IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML
|
| 6797 |
-
// document to it; WebKit & Firefox won't allow reusing the iframe document.
|
| 6798 |
-
if ( !iframeDoc || !iframe.createElement ) {
|
| 6799 |
-
iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document;
|
| 6800 |
-
iframeDoc.write("<!doctype html><html><body>");
|
| 6801 |
-
iframeDoc.close();
|
| 6802 |
-
}
|
| 6803 |
-
|
| 6804 |
-
elem = iframeDoc.body.appendChild( iframeDoc.createElement(nodeName) );
|
| 6805 |
-
|
| 6806 |
-
display = curCSS( elem, "display" );
|
| 6807 |
-
document.body.removeChild( iframe );
|
| 6808 |
-
}
|
| 6809 |
-
|
| 6810 |
-
// Store the correct default display
|
| 6811 |
-
elemdisplay[ nodeName ] = display;
|
| 6812 |
-
|
| 6813 |
-
return display;
|
| 6814 |
-
}
|
| 6815 |
-
|
| 6816 |
-
jQuery.each([ "height", "width" ], function( i, name ) {
|
| 6817 |
-
jQuery.cssHooks[ name ] = {
|
| 6818 |
-
get: function( elem, computed, extra ) {
|
| 6819 |
-
if ( computed ) {
|
| 6820 |
-
if ( elem.offsetWidth !== 0 || curCSS( elem, "display" ) !== "none" ) {
|
| 6821 |
-
return getWidthOrHeight( elem, name, extra );
|
| 6822 |
-
} else {
|
| 6823 |
-
return jQuery.swap( elem, cssShow, function() {
|
| 6824 |
-
return getWidthOrHeight( elem, name, extra );
|
| 6825 |
-
});
|
| 6826 |
-
}
|
| 6827 |
-
}
|
| 6828 |
-
},
|
| 6829 |
-
|
| 6830 |
-
set: function( elem, value, extra ) {
|
| 6831 |
-
return setPositiveNumber( elem, value, extra ?
|
| 6832 |
-
augmentWidthOrHeight(
|
| 6833 |
-
elem,
|
| 6834 |
-
name,
|
| 6835 |
-
extra,
|
| 6836 |
-
jQuery.support.boxSizing && jQuery.css( elem, "boxSizing" ) === "border-box"
|
| 6837 |
-
) : 0
|
| 6838 |
-
);
|
| 6839 |
-
}
|
| 6840 |
-
};
|
| 6841 |
-
});
|
| 6842 |
-
|
| 6843 |
-
if ( !jQuery.support.opacity ) {
|
| 6844 |
-
jQuery.cssHooks.opacity = {
|
| 6845 |
-
get: function( elem, computed ) {
|
| 6846 |
-
// IE uses filters for opacity
|
| 6847 |
-
return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ?
|
| 6848 |
-
( 0.01 * parseFloat( RegExp.$1 ) ) + "" :
|
| 6849 |
-
computed ? "1" : "";
|
| 6850 |
-
},
|
| 6851 |
-
|
| 6852 |
-
set: function( elem, value ) {
|
| 6853 |
-
var style = elem.style,
|
| 6854 |
-
currentStyle = elem.currentStyle,
|
| 6855 |
-
opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "",
|
| 6856 |
-
filter = currentStyle && currentStyle.filter || style.filter || "";
|
| 6857 |
-
|
| 6858 |
-
// IE has trouble with opacity if it does not have layout
|
| 6859 |
-
// Force it by setting the zoom level
|
| 6860 |
-
style.zoom = 1;
|
| 6861 |
-
|
| 6862 |
-
// if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652
|
| 6863 |
-
if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" &&
|
| 6864 |
-
style.removeAttribute ) {
|
| 6865 |
-
|
| 6866 |
-
// Setting style.filter to null, "" & " " still leave "filter:" in the cssText
|
| 6867 |
-
// if "filter:" is present at all, clearType is disabled, we want to avoid this
|
| 6868 |
-
// style.removeAttribute is IE Only, but so apparently is this code path...
|
| 6869 |
-
style.removeAttribute( "filter" );
|
| 6870 |
-
|
| 6871 |
-
// if there there is no filter style applied in a css rule, we are done
|
| 6872 |
-
if ( currentStyle && !currentStyle.filter ) {
|
| 6873 |
-
return;
|
| 6874 |
-
}
|
| 6875 |
-
}
|
| 6876 |
-
|
| 6877 |
-
// otherwise, set new filter values
|
| 6878 |
-
style.filter = ralpha.test( filter ) ?
|
| 6879 |
-
filter.replace( ralpha, opacity ) :
|
| 6880 |
-
filter + " " + opacity;
|
| 6881 |
-
}
|
| 6882 |
-
};
|
| 6883 |
-
}
|
| 6884 |
-
|
| 6885 |
-
// These hooks cannot be added until DOM ready because the support test
|
| 6886 |
-
// for it is not run until after DOM ready
|
| 6887 |
-
jQuery(function() {
|
| 6888 |
-
if ( !jQuery.support.reliableMarginRight ) {
|
| 6889 |
-
jQuery.cssHooks.marginRight = {
|
| 6890 |
-
get: function( elem, computed ) {
|
| 6891 |
-
// WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
|
| 6892 |
-
// Work around by temporarily setting element display to inline-block
|
| 6893 |
-
return jQuery.swap( elem, { "display": "inline-block" }, function() {
|
| 6894 |
-
if ( computed ) {
|
| 6895 |
-
return curCSS( elem, "marginRight" );
|
| 6896 |
-
}
|
| 6897 |
-
});
|
| 6898 |
-
}
|
| 6899 |
-
};
|
| 6900 |
-
}
|
| 6901 |
-
|
| 6902 |
-
// Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
|
| 6903 |
-
// getComputedStyle returns percent when specified for top/left/bottom/right
|
| 6904 |
-
// rather than make the css module depend on the offset module, we just check for it here
|
| 6905 |
-
if ( !jQuery.support.pixelPosition && jQuery.fn.position ) {
|
| 6906 |
-
jQuery.each( [ "top", "left" ], function( i, prop ) {
|
| 6907 |
-
jQuery.cssHooks[ prop ] = {
|
| 6908 |
-
get: function( elem, computed ) {
|
| 6909 |
-
if ( computed ) {
|
| 6910 |
-
var ret = curCSS( elem, prop );
|
| 6911 |
-
// if curCSS returns percentage, fallback to offset
|
| 6912 |
-
return rnumnonpx.test( ret ) ? jQuery( elem ).position()[ prop ] + "px" : ret;
|
| 6913 |
-
}
|
| 6914 |
-
}
|
| 6915 |
-
};
|
| 6916 |
-
});
|
| 6917 |
-
}
|
| 6918 |
-
|
| 6919 |
-
});
|
| 6920 |
-
|
| 6921 |
-
if ( jQuery.expr && jQuery.expr.filters ) {
|
| 6922 |
-
jQuery.expr.filters.hidden = function( elem ) {
|
| 6923 |
-
return ( elem.offsetWidth === 0 && elem.offsetHeight === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || curCSS( elem, "display" )) === "none");
|
| 6924 |
-
};
|
| 6925 |
-
|
| 6926 |
-
jQuery.expr.filters.visible = function( elem ) {
|
| 6927 |
-
return !jQuery.expr.filters.hidden( elem );
|
| 6928 |
-
};
|
| 6929 |
-
}
|
| 6930 |
-
|
| 6931 |
-
// These hooks are used by animate to expand properties
|
| 6932 |
-
jQuery.each({
|
| 6933 |
-
margin: "",
|
| 6934 |
-
padding: "",
|
| 6935 |
-
border: "Width"
|
| 6936 |
-
}, function( prefix, suffix ) {
|
| 6937 |
-
jQuery.cssHooks[ prefix + suffix ] = {
|
| 6938 |
-
expand: function( value ) {
|
| 6939 |
-
var i,
|
| 6940 |
-
|
| 6941 |
-
// assumes a single number if not a string
|
| 6942 |
-
parts = typeof value === "string" ? value.split(" ") : [ value ],
|
| 6943 |
-
expanded = {};
|
| 6944 |
-
|
| 6945 |
-
for ( i = 0; i < 4; i++ ) {
|
| 6946 |
-
expanded[ prefix + cssExpand[ i ] + suffix ] =
|
| 6947 |
-
parts[ i ] || parts[ i - 2 ] || parts[ 0 ];
|
| 6948 |
-
}
|
| 6949 |
-
|
| 6950 |
-
return expanded;
|
| 6951 |
-
}
|
| 6952 |
-
};
|
| 6953 |
-
|
| 6954 |
-
if ( !rmargin.test( prefix ) ) {
|
| 6955 |
-
jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber;
|
| 6956 |
-
}
|
| 6957 |
-
});
|
| 6958 |
-
var r20 = /%20/g,
|
| 6959 |
-
rbracket = /\[\]$/,
|
| 6960 |
-
rCRLF = /\r?\n/g,
|
| 6961 |
-
rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,
|
| 6962 |
-
rselectTextarea = /^(?:select|textarea)/i;
|
| 6963 |
-
|
| 6964 |
-
jQuery.fn.extend({
|
| 6965 |
-
serialize: function() {
|
| 6966 |
-
return jQuery.param( this.serializeArray() );
|
| 6967 |
-
},
|
| 6968 |
-
serializeArray: function() {
|
| 6969 |
-
return this.map(function(){
|
| 6970 |
-
return this.elements ? jQuery.makeArray( this.elements ) : this;
|
| 6971 |
-
})
|
| 6972 |
-
.filter(function(){
|
| 6973 |
-
return this.name && !this.disabled &&
|
| 6974 |
-
( this.checked || rselectTextarea.test( this.nodeName ) ||
|
| 6975 |
-
rinput.test( this.type ) );
|
| 6976 |
-
})
|
| 6977 |
-
.map(function( i, elem ){
|
| 6978 |
-
var val = jQuery( this ).val();
|
| 6979 |
-
|
| 6980 |
-
return val == null ?
|
| 6981 |
-
null :
|
| 6982 |
-
jQuery.isArray( val ) ?
|
| 6983 |
-
jQuery.map( val, function( val, i ){
|
| 6984 |
-
return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
|
| 6985 |
-
}) :
|
| 6986 |
-
{ name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
|
| 6987 |
-
}).get();
|
| 6988 |
-
}
|
| 6989 |
-
});
|
| 6990 |
-
|
| 6991 |
-
//Serialize an array of form elements or a set of
|
| 6992 |
-
//key/values into a query string
|
| 6993 |
-
jQuery.param = function( a, traditional ) {
|
| 6994 |
-
var prefix,
|
| 6995 |
-
s = [],
|
| 6996 |
-
add = function( key, value ) {
|
| 6997 |
-
// If value is a function, invoke it and return its value
|
| 6998 |
-
value = jQuery.isFunction( value ) ? value() : ( value == null ? "" : value );
|
| 6999 |
-
s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value );
|
| 7000 |
-
};
|
| 7001 |
-
|
| 7002 |
-
// Set traditional to true for jQuery <= 1.3.2 behavior.
|
| 7003 |
-
if ( traditional === undefined ) {
|
| 7004 |
-
traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional;
|
| 7005 |
-
}
|
| 7006 |
-
|
| 7007 |
-
// If an array was passed in, assume that it is an array of form elements.
|
| 7008 |
-
if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
|
| 7009 |
-
// Serialize the form elements
|
| 7010 |
-
jQuery.each( a, function() {
|
| 7011 |
-
add( this.name, this.value );
|
| 7012 |
-
});
|
| 7013 |
-
|
| 7014 |
-
} else {
|
| 7015 |
-
// If traditional, encode the "old" way (the way 1.3.2 or older
|
| 7016 |
-
// did it), otherwise encode params recursively.
|
| 7017 |
-
for ( prefix in a ) {
|
| 7018 |
-
buildParams( prefix, a[ prefix ], traditional, add );
|
| 7019 |
-
}
|
| 7020 |
-
}
|
| 7021 |
-
|
| 7022 |
-
// Return the resulting serialization
|
| 7023 |
-
return s.join( "&" ).replace( r20, "+" );
|
| 7024 |
-
};
|
| 7025 |
-
|
| 7026 |
-
function buildParams( prefix, obj, traditional, add ) {
|
| 7027 |
-
var name;
|
| 7028 |
-
|
| 7029 |
-
if ( jQuery.isArray( obj ) ) {
|
| 7030 |
-
// Serialize array item.
|
| 7031 |
-
jQuery.each( obj, function( i, v ) {
|
| 7032 |
-
if ( traditional || rbracket.test( prefix ) ) {
|
| 7033 |
-
// Treat each array item as a scalar.
|
| 7034 |
-
add( prefix, v );
|
| 7035 |
-
|
| 7036 |
-
} else {
|
| 7037 |
-
// If array item is non-scalar (array or object), encode its
|
| 7038 |
-
// numeric index to resolve deserialization ambiguity issues.
|
| 7039 |
-
// Note that rack (as of 1.0.0) can't currently deserialize
|
| 7040 |
-
// nested arrays properly, and attempting to do so may cause
|
| 7041 |
-
// a server error. Possible fixes are to modify rack's
|
| 7042 |
-
// deserialization algorithm or to provide an option or flag
|
| 7043 |
-
// to force array serialization to be shallow.
|
| 7044 |
-
buildParams( prefix + "[" + ( typeof v === "object" ? i : "" ) + "]", v, traditional, add );
|
| 7045 |
-
}
|
| 7046 |
-
});
|
| 7047 |
-
|
| 7048 |
-
} else if ( !traditional && jQuery.type( obj ) === "object" ) {
|
| 7049 |
-
// Serialize object item.
|
| 7050 |
-
for ( name in obj ) {
|
| 7051 |
-
buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
|
| 7052 |
-
}
|
| 7053 |
-
|
| 7054 |
-
} else {
|
| 7055 |
-
// Serialize scalar item.
|
| 7056 |
-
add( prefix, obj );
|
| 7057 |
-
}
|
| 7058 |
-
}
|
| 7059 |
-
var // Document location
|
| 7060 |
-
ajaxLocation,
|
| 7061 |
-
// Document location segments
|
| 7062 |
-
ajaxLocParts,
|
| 7063 |
-
|
| 7064 |
-
rhash = /#.*$/,
|
| 7065 |
-
rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL
|
| 7066 |
-
// #7653, #8125, #8152: local protocol detection
|
| 7067 |
-
rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,
|
| 7068 |
-
rnoContent = /^(?:GET|HEAD)$/,
|
| 7069 |
-
rprotocol = /^\/\//,
|
| 7070 |
-
rquery = /\?/,
|
| 7071 |
-
rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,
|
| 7072 |
-
rts = /([?&])_=[^&]*/,
|
| 7073 |
-
rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/,
|
| 7074 |
-
|
| 7075 |
-
// Keep a copy of the old load method
|
| 7076 |
-
_load = jQuery.fn.load,
|
| 7077 |
-
|
| 7078 |
-
/* Prefilters
|
| 7079 |
-
* 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
|
| 7080 |
-
* 2) These are called:
|
| 7081 |
-
* - BEFORE asking for a transport
|
| 7082 |
-
* - AFTER param serialization (s.data is a string if s.processData is true)
|
| 7083 |
-
* 3) key is the dataType
|
| 7084 |
-
* 4) the catchall symbol "*" can be used
|
| 7085 |
-
* 5) execution will start with transport dataType and THEN continue down to "*" if needed
|
| 7086 |
-
*/
|
| 7087 |
-
prefilters = {},
|
| 7088 |
-
|
| 7089 |
-
/* Transports bindings
|
| 7090 |
-
* 1) key is the dataType
|
| 7091 |
-
* 2) the catchall symbol "*" can be used
|
| 7092 |
-
* 3) selection will start with transport dataType and THEN go to "*" if needed
|
| 7093 |
-
*/
|
| 7094 |
-
transports = {},
|
| 7095 |
-
|
| 7096 |
-
// Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
|
| 7097 |
-
allTypes = ["*/"] + ["*"];
|
| 7098 |
-
|
| 7099 |
-
// #8138, IE may throw an exception when accessing
|
| 7100 |
-
// a field from window.location if document.domain has been set
|
| 7101 |
-
try {
|
| 7102 |
-
ajaxLocation = location.href;
|
| 7103 |
-
} catch( e ) {
|
| 7104 |
-
// Use the href attribute of an A element
|
| 7105 |
-
// since IE will modify it given document.location
|
| 7106 |
-
ajaxLocation = document.createElement( "a" );
|
| 7107 |
-
ajaxLocation.href = "";
|
| 7108 |
-
ajaxLocation = ajaxLocation.href;
|
| 7109 |
-
}
|
| 7110 |
-
|
| 7111 |
-
// Segment location into parts
|
| 7112 |
-
ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || [];
|
| 7113 |
-
|
| 7114 |
-
// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
|
| 7115 |
-
function addToPrefiltersOrTransports( structure ) {
|
| 7116 |
-
|
| 7117 |
-
// dataTypeExpression is optional and defaults to "*"
|
| 7118 |
-
return function( dataTypeExpression, func ) {
|
| 7119 |
-
|
| 7120 |
-
if ( typeof dataTypeExpression !== "string" ) {
|
| 7121 |
-
func = dataTypeExpression;
|
| 7122 |
-
dataTypeExpression = "*";
|
| 7123 |
-
}
|
| 7124 |
-
|
| 7125 |
-
var dataType, list, placeBefore,
|
| 7126 |
-
dataTypes = dataTypeExpression.toLowerCase().split( core_rspace ),
|
| 7127 |
-
i = 0,
|
| 7128 |
-
length = dataTypes.length;
|
| 7129 |
-
|
| 7130 |
-
if ( jQuery.isFunction( func ) ) {
|
| 7131 |
-
// For each dataType in the dataTypeExpression
|
| 7132 |
-
for ( ; i < length; i++ ) {
|
| 7133 |
-
dataType = dataTypes[ i ];
|
| 7134 |
-
// We control if we're asked to add before
|
| 7135 |
-
// any existing element
|
| 7136 |
-
placeBefore = /^\+/.test( dataType );
|
| 7137 |
-
if ( placeBefore ) {
|
| 7138 |
-
dataType = dataType.substr( 1 ) || "*";
|
| 7139 |
-
}
|
| 7140 |
-
list = structure[ dataType ] = structure[ dataType ] || [];
|
| 7141 |
-
// then we add to the structure accordingly
|
| 7142 |
-
list[ placeBefore ? "unshift" : "push" ]( func );
|
| 7143 |
-
}
|
| 7144 |
-
}
|
| 7145 |
-
};
|
| 7146 |
-
}
|
| 7147 |
-
|
| 7148 |
-
// Base inspection function for prefilters and transports
|
| 7149 |
-
function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR,
|
| 7150 |
-
dataType /* internal */, inspected /* internal */ ) {
|
| 7151 |
-
|
| 7152 |
-
dataType = dataType || options.dataTypes[ 0 ];
|
| 7153 |
-
inspected = inspected || {};
|
| 7154 |
-
|
| 7155 |
-
inspected[ dataType ] = true;
|
| 7156 |
-
|
| 7157 |
-
var selection,
|
| 7158 |
-
list = structure[ dataType ],
|
| 7159 |
-
i = 0,
|
| 7160 |
-
length = list ? list.length : 0,
|
| 7161 |
-
executeOnly = ( structure === prefilters );
|
| 7162 |
-
|
| 7163 |
-
for ( ; i < length && ( executeOnly || !selection ); i++ ) {
|
| 7164 |
-
selection = list[ i ]( options, originalOptions, jqXHR );
|
| 7165 |
-
// If we got redirected to another dataType
|
| 7166 |
-
// we try there if executing only and not done already
|
| 7167 |
-
if ( typeof selection === "string" ) {
|
| 7168 |
-
if ( !executeOnly || inspected[ selection ] ) {
|
| 7169 |
-
selection = undefined;
|
| 7170 |
-
} else {
|
| 7171 |
-
options.dataTypes.unshift( selection );
|
| 7172 |
-
selection = inspectPrefiltersOrTransports(
|
| 7173 |
-
structure, options, originalOptions, jqXHR, selection, inspected );
|
| 7174 |
-
}
|
| 7175 |
-
}
|
| 7176 |
-
}
|
| 7177 |
-
// If we're only executing or nothing was selected
|
| 7178 |
-
// we try the catchall dataType if not done already
|
| 7179 |
-
if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) {
|
| 7180 |
-
selection = inspectPrefiltersOrTransports(
|
| 7181 |
-
structure, options, originalOptions, jqXHR, "*", inspected );
|
| 7182 |
-
}
|
| 7183 |
-
// unnecessary when only executing (prefilters)
|
| 7184 |
-
// but it'll be ignored by the caller in that case
|
| 7185 |
-
return selection;
|
| 7186 |
-
}
|
| 7187 |
-
|
| 7188 |
-
// A special extend for ajax options
|
| 7189 |
-
// that takes "flat" options (not to be deep extended)
|
| 7190 |
-
// Fixes #9887
|
| 7191 |
-
function ajaxExtend( target, src ) {
|
| 7192 |
-
var key, deep,
|
| 7193 |
-
flatOptions = jQuery.ajaxSettings.flatOptions || {};
|
| 7194 |
-
for ( key in src ) {
|
| 7195 |
-
if ( src[ key ] !== undefined ) {
|
| 7196 |
-
( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ];
|
| 7197 |
-
}
|
| 7198 |
-
}
|
| 7199 |
-
if ( deep ) {
|
| 7200 |
-
jQuery.extend( true, target, deep );
|
| 7201 |
-
}
|
| 7202 |
-
}
|
| 7203 |
-
|
| 7204 |
-
jQuery.fn.load = function( url, params, callback ) {
|
| 7205 |
-
if ( typeof url !== "string" && _load ) {
|
| 7206 |
-
return _load.apply( this, arguments );
|
| 7207 |
-
}
|
| 7208 |
-
|
| 7209 |
-
// Don't do a request if no elements are being requested
|
| 7210 |
-
if ( !this.length ) {
|
| 7211 |
-
return this;
|
| 7212 |
-
}
|
| 7213 |
-
|
| 7214 |
-
var selector, type, response,
|
| 7215 |
-
self = this,
|
| 7216 |
-
off = url.indexOf(" ");
|
| 7217 |
-
|
| 7218 |
-
if ( off >= 0 ) {
|
| 7219 |
-
selector = url.slice( off, url.length );
|
| 7220 |
-
url = url.slice( 0, off );
|
| 7221 |
-
}
|
| 7222 |
-
|
| 7223 |
-
// If it's a function
|
| 7224 |
-
if ( jQuery.isFunction( params ) ) {
|
| 7225 |
-
|
| 7226 |
-
// We assume that it's the callback
|
| 7227 |
-
callback = params;
|
| 7228 |
-
params = undefined;
|
| 7229 |
-
|
| 7230 |
-
// Otherwise, build a param string
|
| 7231 |
-
} else if ( typeof params === "object" ) {
|
| 7232 |
-
type = "POST";
|
| 7233 |
-
}
|
| 7234 |
-
|
| 7235 |
-
// Request the remote document
|
| 7236 |
-
jQuery.ajax({
|
| 7237 |
-
url: url,
|
| 7238 |
-
|
| 7239 |
-
// if "type" variable is undefined, then "GET" method will be used
|
| 7240 |
-
type: type,
|
| 7241 |
-
dataType: "html",
|
| 7242 |
-
data: params,
|
| 7243 |
-
complete: function( jqXHR, status ) {
|
| 7244 |
-
if ( callback ) {
|
| 7245 |
-
self.each( callback, response || [ jqXHR.responseText, status, jqXHR ] );
|
| 7246 |
-
}
|
| 7247 |
-
}
|
| 7248 |
-
}).done(function( responseText ) {
|
| 7249 |
-
|
| 7250 |
-
// Save response for use in complete callback
|
| 7251 |
-
response = arguments;
|
| 7252 |
-
|
| 7253 |
-
// See if a selector was specified
|
| 7254 |
-
self.html( selector ?
|
| 7255 |
-
|
| 7256 |
-
// Create a dummy div to hold the results
|
| 7257 |
-
jQuery("<div>")
|
| 7258 |
-
|
| 7259 |
-
// inject the contents of the document in, removing the scripts
|
| 7260 |
-
// to avoid any 'Permission Denied' errors in IE
|
| 7261 |
-
.append( responseText.replace( rscript, "" ) )
|
| 7262 |
-
|
| 7263 |
-
// Locate the specified elements
|
| 7264 |
-
.find( selector ) :
|
| 7265 |
-
|
| 7266 |
-
// If not, just inject the full result
|
| 7267 |
-
responseText );
|
| 7268 |
-
|
| 7269 |
-
});
|
| 7270 |
-
|
| 7271 |
-
return this;
|
| 7272 |
-
};
|
| 7273 |
-
|
| 7274 |
-
// Attach a bunch of functions for handling common AJAX events
|
| 7275 |
-
jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){
|
| 7276 |
-
jQuery.fn[ o ] = function( f ){
|
| 7277 |
-
return this.on( o, f );
|
| 7278 |
-
};
|
| 7279 |
-
});
|
| 7280 |
-
|
| 7281 |
-
jQuery.each( [ "get", "post" ], function( i, method ) {
|
| 7282 |
-
jQuery[ method ] = function( url, data, callback, type ) {
|
| 7283 |
-
// shift arguments if data argument was omitted
|
| 7284 |
-
if ( jQuery.isFunction( data ) ) {
|
| 7285 |
-
type = type || callback;
|
| 7286 |
-
callback = data;
|
| 7287 |
-
data = undefined;
|
| 7288 |
-
}
|
| 7289 |
-
|
| 7290 |
-
return jQuery.ajax({
|
| 7291 |
-
type: method,
|
| 7292 |
-
url: url,
|
| 7293 |
-
data: data,
|
| 7294 |
-
success: callback,
|
| 7295 |
-
dataType: type
|
| 7296 |
-
});
|
| 7297 |
-
};
|
| 7298 |
-
});
|
| 7299 |
-
|
| 7300 |
-
jQuery.extend({
|
| 7301 |
-
|
| 7302 |
-
getScript: function( url, callback ) {
|
| 7303 |
-
return jQuery.get( url, undefined, callback, "script" );
|
| 7304 |
-
},
|
| 7305 |
-
|
| 7306 |
-
getJSON: function( url, data, callback ) {
|
| 7307 |
-
return jQuery.get( url, data, callback, "json" );
|
| 7308 |
-
},
|
| 7309 |
-
|
| 7310 |
-
// Creates a full fledged settings object into target
|
| 7311 |
-
// with both ajaxSettings and settings fields.
|
| 7312 |
-
// If target is omitted, writes into ajaxSettings.
|
| 7313 |
-
ajaxSetup: function( target, settings ) {
|
| 7314 |
-
if ( settings ) {
|
| 7315 |
-
// Building a settings object
|
| 7316 |
-
ajaxExtend( target, jQuery.ajaxSettings );
|
| 7317 |
-
} else {
|
| 7318 |
-
// Extending ajaxSettings
|
| 7319 |
-
settings = target;
|
| 7320 |
-
target = jQuery.ajaxSettings;
|
| 7321 |
-
}
|
| 7322 |
-
ajaxExtend( target, settings );
|
| 7323 |
-
return target;
|
| 7324 |
-
},
|
| 7325 |
-
|
| 7326 |
-
ajaxSettings: {
|
| 7327 |
-
url: ajaxLocation,
|
| 7328 |
-
isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ),
|
| 7329 |
-
global: true,
|
| 7330 |
-
type: "GET",
|
| 7331 |
-
contentType: "application/x-www-form-urlencoded; charset=UTF-8",
|
| 7332 |
-
processData: true,
|
| 7333 |
-
async: true,
|
| 7334 |
-
/*
|
| 7335 |
-
timeout: 0,
|
| 7336 |
-
data: null,
|
| 7337 |
-
dataType: null,
|
| 7338 |
-
username: null,
|
| 7339 |
-
password: null,
|
| 7340 |
-
cache: null,
|
| 7341 |
-
throws: false,
|
| 7342 |
-
traditional: false,
|
| 7343 |
-
headers: {},
|
| 7344 |
-
*/
|
| 7345 |
-
|
| 7346 |
-
accepts: {
|
| 7347 |
-
xml: "application/xml, text/xml",
|
| 7348 |
-
html: "text/html",
|
| 7349 |
-
text: "text/plain",
|
| 7350 |
-
json: "application/json, text/javascript",
|
| 7351 |
-
"*": allTypes
|
| 7352 |
-
},
|
| 7353 |
-
|
| 7354 |
-
contents: {
|
| 7355 |
-
xml: /xml/,
|
| 7356 |
-
html: /html/,
|
| 7357 |
-
json: /json/
|
| 7358 |
-
},
|
| 7359 |
-
|
| 7360 |
-
responseFields: {
|
| 7361 |
-
xml: "responseXML",
|
| 7362 |
-
text: "responseText"
|
| 7363 |
-
},
|
| 7364 |
-
|
| 7365 |
-
// List of data converters
|
| 7366 |
-
// 1) key format is "source_type destination_type" (a single space in-between)
|
| 7367 |
-
// 2) the catchall symbol "*" can be used for source_type
|
| 7368 |
-
converters: {
|
| 7369 |
-
|
| 7370 |
-
// Convert anything to text
|
| 7371 |
-
"* text": window.String,
|
| 7372 |
-
|
| 7373 |
-
// Text to html (true = no transformation)
|
| 7374 |
-
"text html": true,
|
| 7375 |
-
|
| 7376 |
-
// Evaluate text as a json expression
|
| 7377 |
-
"text json": jQuery.parseJSON,
|
| 7378 |
-
|
| 7379 |
-
// Parse text as xml
|
| 7380 |
-
"text xml": jQuery.parseXML
|
| 7381 |
-
},
|
| 7382 |
-
|
| 7383 |
-
// For options that shouldn't be deep extended:
|
| 7384 |
-
// you can add your own custom options here if
|
| 7385 |
-
// and when you create one that shouldn't be
|
| 7386 |
-
// deep extended (see ajaxExtend)
|
| 7387 |
-
flatOptions: {
|
| 7388 |
-
context: true,
|
| 7389 |
-
url: true
|
| 7390 |
-
}
|
| 7391 |
-
},
|
| 7392 |
-
|
| 7393 |
-
ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
|
| 7394 |
-
ajaxTransport: addToPrefiltersOrTransports( transports ),
|
| 7395 |
-
|
| 7396 |
-
// Main method
|
| 7397 |
-
ajax: function( url, options ) {
|
| 7398 |
-
|
| 7399 |
-
// If url is an object, simulate pre-1.5 signature
|
| 7400 |
-
if ( typeof url === "object" ) {
|
| 7401 |
-
options = url;
|
| 7402 |
-
url = undefined;
|
| 7403 |
-
}
|
| 7404 |
-
|
| 7405 |
-
// Force options to be an object
|
| 7406 |
-
options = options || {};
|
| 7407 |
-
|
| 7408 |
-
var // ifModified key
|
| 7409 |
-
ifModifiedKey,
|
| 7410 |
-
// Response headers
|
| 7411 |
-
responseHeadersString,
|
| 7412 |
-
responseHeaders,
|
| 7413 |
-
// transport
|
| 7414 |
-
transport,
|
| 7415 |
-
// timeout handle
|
| 7416 |
-
timeoutTimer,
|
| 7417 |
-
// Cross-domain detection vars
|
| 7418 |
-
parts,
|
| 7419 |
-
// To know if global events are to be dispatched
|
| 7420 |
-
fireGlobals,
|
| 7421 |
-
// Loop variable
|
| 7422 |
-
i,
|
| 7423 |
-
// Create the final options object
|
| 7424 |
-
s = jQuery.ajaxSetup( {}, options ),
|
| 7425 |
-
// Callbacks context
|
| 7426 |
-
callbackContext = s.context || s,
|
| 7427 |
-
// Context for global events
|
| 7428 |
-
// It's the callbackContext if one was provided in the options
|
| 7429 |
-
// and if it's a DOM node or a jQuery collection
|
| 7430 |
-
globalEventContext = callbackContext !== s &&
|
| 7431 |
-
( callbackContext.nodeType || callbackContext instanceof jQuery ) ?
|
| 7432 |
-
jQuery( callbackContext ) : jQuery.event,
|
| 7433 |
-
// Deferreds
|
| 7434 |
-
deferred = jQuery.Deferred(),
|
| 7435 |
-
completeDeferred = jQuery.Callbacks( "once memory" ),
|
| 7436 |
-
// Status-dependent callbacks
|
| 7437 |
-
statusCode = s.statusCode || {},
|
| 7438 |
-
// Headers (they are sent all at once)
|
| 7439 |
-
requestHeaders = {},
|
| 7440 |
-
requestHeadersNames = {},
|
| 7441 |
-
// The jqXHR state
|
| 7442 |
-
state = 0,
|
| 7443 |
-
// Default abort message
|
| 7444 |
-
strAbort = "canceled",
|
| 7445 |
-
// Fake xhr
|
| 7446 |
-
jqXHR = {
|
| 7447 |
-
|
| 7448 |
-
readyState: 0,
|
| 7449 |
-
|
| 7450 |
-
// Caches the header
|
| 7451 |
-
setRequestHeader: function( name, value ) {
|
| 7452 |
-
if ( !state ) {
|
| 7453 |
-
var lname = name.toLowerCase();
|
| 7454 |
-
name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name;
|
| 7455 |
-
requestHeaders[ name ] = value;
|
| 7456 |
-
}
|
| 7457 |
-
return this;
|
| 7458 |
-
},
|
| 7459 |
-
|
| 7460 |
-
// Raw string
|
| 7461 |
-
getAllResponseHeaders: function() {
|
| 7462 |
-
return state === 2 ? responseHeadersString : null;
|
| 7463 |
-
},
|
| 7464 |
-
|
| 7465 |
-
// Builds headers hashtable if needed
|
| 7466 |
-
getResponseHeader: function( key ) {
|
| 7467 |
-
var match;
|
| 7468 |
-
if ( state === 2 ) {
|
| 7469 |
-
if ( !responseHeaders ) {
|
| 7470 |
-
responseHeaders = {};
|
| 7471 |
-
while( ( match = rheaders.exec( responseHeadersString ) ) ) {
|
| 7472 |
-
responseHeaders[ match[1].toLowerCase() ] = match[ 2 ];
|
| 7473 |
-
}
|
| 7474 |
-
}
|
| 7475 |
-
match = responseHeaders[ key.toLowerCase() ];
|
| 7476 |
-
}
|
| 7477 |
-
return match === undefined ? null : match;
|
| 7478 |
-
},
|
| 7479 |
-
|
| 7480 |
-
// Overrides response content-type header
|
| 7481 |
-
overrideMimeType: function( type ) {
|
| 7482 |
-
if ( !state ) {
|
| 7483 |
-
s.mimeType = type;
|
| 7484 |
-
}
|
| 7485 |
-
return this;
|
| 7486 |
-
},
|
| 7487 |
-
|
| 7488 |
-
// Cancel the request
|
| 7489 |
-
abort: function( statusText ) {
|
| 7490 |
-
statusText = statusText || strAbort;
|
| 7491 |
-
if ( transport ) {
|
| 7492 |
-
transport.abort( statusText );
|
| 7493 |
-
}
|
| 7494 |
-
done( 0, statusText );
|
| 7495 |
-
return this;
|
| 7496 |
-
}
|
| 7497 |
-
};
|
| 7498 |
-
|
| 7499 |
-
// Callback for when everything is done
|
| 7500 |
-
// It is defined here because jslint complains if it is declared
|
| 7501 |
-
// at the end of the function (which would be more logical and readable)
|
| 7502 |
-
function done( status, nativeStatusText, responses, headers ) {
|
| 7503 |
-
var isSuccess, success, error, response, modified,
|
| 7504 |
-
statusText = nativeStatusText;
|
| 7505 |
-
|
| 7506 |
-
// Called once
|
| 7507 |
-
if ( state === 2 ) {
|
| 7508 |
-
return;
|
| 7509 |
-
}
|
| 7510 |
-
|
| 7511 |
-
// State is "done" now
|
| 7512 |
-
state = 2;
|
| 7513 |
-
|
| 7514 |
-
// Clear timeout if it exists
|
| 7515 |
-
if ( timeoutTimer ) {
|
| 7516 |
-
clearTimeout( timeoutTimer );
|
| 7517 |
-
}
|
| 7518 |
-
|
| 7519 |
-
// Dereference transport for early garbage collection
|
| 7520 |
-
// (no matter how long the jqXHR object will be used)
|
| 7521 |
-
transport = undefined;
|
| 7522 |
-
|
| 7523 |
-
// Cache response headers
|
| 7524 |
-
responseHeadersString = headers || "";
|
| 7525 |
-
|
| 7526 |
-
// Set readyState
|
| 7527 |
-
jqXHR.readyState = status > 0 ? 4 : 0;
|
| 7528 |
-
|
| 7529 |
-
// Get response data
|
| 7530 |
-
if ( responses ) {
|
| 7531 |
-
response = ajaxHandleResponses( s, jqXHR, responses );
|
| 7532 |
-
}
|
| 7533 |
-
|
| 7534 |
-
// If successful, handle type chaining
|
| 7535 |
-
if ( status >= 200 && status < 300 || status === 304 ) {
|
| 7536 |
-
|
| 7537 |
-
// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
|
| 7538 |
-
if ( s.ifModified ) {
|
| 7539 |
-
|
| 7540 |
-
modified = jqXHR.getResponseHeader("Last-Modified");
|
| 7541 |
-
if ( modified ) {
|
| 7542 |
-
jQuery.lastModified[ ifModifiedKey ] = modified;
|
| 7543 |
-
}
|
| 7544 |
-
modified = jqXHR.getResponseHeader("Etag");
|
| 7545 |
-
if ( modified ) {
|
| 7546 |
-
jQuery.etag[ ifModifiedKey ] = modified;
|
| 7547 |
-
}
|
| 7548 |
-
}
|
| 7549 |
-
|
| 7550 |
-
// If not modified
|
| 7551 |
-
if ( status === 304 ) {
|
| 7552 |
-
|
| 7553 |
-
statusText = "notmodified";
|
| 7554 |
-
isSuccess = true;
|
| 7555 |
-
|
| 7556 |
-
// If we have data
|
| 7557 |
-
} else {
|
| 7558 |
-
|
| 7559 |
-
isSuccess = ajaxConvert( s, response );
|
| 7560 |
-
statusText = isSuccess.state;
|
| 7561 |
-
success = isSuccess.data;
|
| 7562 |
-
error = isSuccess.error;
|
| 7563 |
-
isSuccess = !error;
|
| 7564 |
-
}
|
| 7565 |
-
} else {
|
| 7566 |
-
// We extract error from statusText
|
| 7567 |
-
// then normalize statusText and status for non-aborts
|
| 7568 |
-
error = statusText;
|
| 7569 |
-
if ( !statusText || status ) {
|
| 7570 |
-
statusText = "error";
|
| 7571 |
-
if ( status < 0 ) {
|
| 7572 |
-
status = 0;
|
| 7573 |
-
}
|
| 7574 |
-
}
|
| 7575 |
-
}
|
| 7576 |
-
|
| 7577 |
-
// Set data for the fake xhr object
|
| 7578 |
-
jqXHR.status = status;
|
| 7579 |
-
jqXHR.statusText = "" + ( nativeStatusText || statusText );
|
| 7580 |
-
|
| 7581 |
-
// Success/Error
|
| 7582 |
-
if ( isSuccess ) {
|
| 7583 |
-
deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
|
| 7584 |
-
} else {
|
| 7585 |
-
deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
|
| 7586 |
-
}
|
| 7587 |
-
|
| 7588 |
-
// Status-dependent callbacks
|
| 7589 |
-
jqXHR.statusCode( statusCode );
|
| 7590 |
-
statusCode = undefined;
|
| 7591 |
-
|
| 7592 |
-
if ( fireGlobals ) {
|
| 7593 |
-
globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ),
|
| 7594 |
-
[ jqXHR, s, isSuccess ? success : error ] );
|
| 7595 |
-
}
|
| 7596 |
-
|
| 7597 |
-
// Complete
|
| 7598 |
-
completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );
|
| 7599 |
-
|
| 7600 |
-
if ( fireGlobals ) {
|
| 7601 |
-
globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] );
|
| 7602 |
-
// Handle the global AJAX counter
|
| 7603 |
-
if ( !( --jQuery.active ) ) {
|
| 7604 |
-
jQuery.event.trigger( "ajaxStop" );
|
| 7605 |
-
}
|
| 7606 |
-
}
|
| 7607 |
-
}
|
| 7608 |
-
|
| 7609 |
-
// Attach deferreds
|
| 7610 |
-
deferred.promise( jqXHR );
|
| 7611 |
-
jqXHR.success = jqXHR.done;
|
| 7612 |
-
jqXHR.error = jqXHR.fail;
|
| 7613 |
-
jqXHR.complete = completeDeferred.add;
|
| 7614 |
-
|
| 7615 |
-
// Status-dependent callbacks
|
| 7616 |
-
jqXHR.statusCode = function( map ) {
|
| 7617 |
-
if ( map ) {
|
| 7618 |
-
var tmp;
|
| 7619 |
-
if ( state < 2 ) {
|
| 7620 |
-
for ( tmp in map ) {
|
| 7621 |
-
statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ];
|
| 7622 |
-
}
|
| 7623 |
-
} else {
|
| 7624 |
-
tmp = map[ jqXHR.status ];
|
| 7625 |
-
jqXHR.always( tmp );
|
| 7626 |
-
}
|
| 7627 |
-
}
|
| 7628 |
-
return this;
|
| 7629 |
-
};
|
| 7630 |
-
|
| 7631 |
-
// Remove hash character (#7531: and string promotion)
|
| 7632 |
-
// Add protocol if not provided (#5866: IE7 issue with protocol-less urls)
|
| 7633 |
-
// We also use the url parameter if available
|
| 7634 |
-
s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" );
|
| 7635 |
-
|
| 7636 |
-
// Extract dataTypes list
|
| 7637 |
-
s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( core_rspace );
|
| 7638 |
-
|
| 7639 |
-
// Determine if a cross-domain request is in order
|
| 7640 |
-
if ( s.crossDomain == null ) {
|
| 7641 |
-
parts = rurl.exec( s.url.toLowerCase() );
|
| 7642 |
-
s.crossDomain = !!( parts &&
|
| 7643 |
-
( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] ||
|
| 7644 |
-
( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) !=
|
| 7645 |
-
( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) )
|
| 7646 |
-
);
|
| 7647 |
-
}
|
| 7648 |
-
|
| 7649 |
-
// Convert data if not already a string
|
| 7650 |
-
if ( s.data && s.processData && typeof s.data !== "string" ) {
|
| 7651 |
-
s.data = jQuery.param( s.data, s.traditional );
|
| 7652 |
-
}
|
| 7653 |
-
|
| 7654 |
-
// Apply prefilters
|
| 7655 |
-
inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
|
| 7656 |
-
|
| 7657 |
-
// If request was aborted inside a prefilter, stop there
|
| 7658 |
-
if ( state === 2 ) {
|
| 7659 |
-
return jqXHR;
|
| 7660 |
-
}
|
| 7661 |
-
|
| 7662 |
-
// We can fire global events as of now if asked to
|
| 7663 |
-
fireGlobals = s.global;
|
| 7664 |
-
|
| 7665 |
-
// Uppercase the type
|
| 7666 |
-
s.type = s.type.toUpperCase();
|
| 7667 |
-
|
| 7668 |
-
// Determine if request has content
|
| 7669 |
-
s.hasContent = !rnoContent.test( s.type );
|
| 7670 |
-
|
| 7671 |
-
// Watch for a new set of requests
|
| 7672 |
-
if ( fireGlobals && jQuery.active++ === 0 ) {
|
| 7673 |
-
jQuery.event.trigger( "ajaxStart" );
|
| 7674 |
-
}
|
| 7675 |
-
|
| 7676 |
-
// More options handling for requests with no content
|
| 7677 |
-
if ( !s.hasContent ) {
|
| 7678 |
-
|
| 7679 |
-
// If data is available, append data to url
|
| 7680 |
-
if ( s.data ) {
|
| 7681 |
-
s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data;
|
| 7682 |
-
// #9682: remove data so that it's not used in an eventual retry
|
| 7683 |
-
delete s.data;
|
| 7684 |
-
}
|
| 7685 |
-
|
| 7686 |
-
// Get ifModifiedKey before adding the anti-cache parameter
|
| 7687 |
-
ifModifiedKey = s.url;
|
| 7688 |
-
|
| 7689 |
-
// Add anti-cache in url if needed
|
| 7690 |
-
if ( s.cache === false ) {
|
| 7691 |
-
|
| 7692 |
-
var ts = jQuery.now(),
|
| 7693 |
-
// try replacing _= if it is there
|
| 7694 |
-
ret = s.url.replace( rts, "$1_=" + ts );
|
| 7695 |
-
|
| 7696 |
-
// if nothing was replaced, add timestamp to the end
|
| 7697 |
-
s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" );
|
| 7698 |
-
}
|
| 7699 |
-
}
|
| 7700 |
-
|
| 7701 |
-
// Set the correct header, if data is being sent
|
| 7702 |
-
if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
|
| 7703 |
-
jqXHR.setRequestHeader( "Content-Type", s.contentType );
|
| 7704 |
-
}
|
| 7705 |
-
|
| 7706 |
-
// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
|
| 7707 |
-
if ( s.ifModified ) {
|
| 7708 |
-
ifModifiedKey = ifModifiedKey || s.url;
|
| 7709 |
-
if ( jQuery.lastModified[ ifModifiedKey ] ) {
|
| 7710 |
-
jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] );
|
| 7711 |
-
}
|
| 7712 |
-
if ( jQuery.etag[ ifModifiedKey ] ) {
|
| 7713 |
-
jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] );
|
| 7714 |
-
}
|
| 7715 |
-
}
|
| 7716 |
-
|
| 7717 |
-
// Set the Accepts header for the server, depending on the dataType
|
| 7718 |
-
jqXHR.setRequestHeader(
|
| 7719 |
-
"Accept",
|
| 7720 |
-
s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ?
|
| 7721 |
-
s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
|
| 7722 |
-
s.accepts[ "*" ]
|
| 7723 |
-
);
|
| 7724 |
-
|
| 7725 |
-
// Check for headers option
|
| 7726 |
-
for ( i in s.headers ) {
|
| 7727 |
-
jqXHR.setRequestHeader( i, s.headers[ i ] );
|
| 7728 |
-
}
|
| 7729 |
-
|
| 7730 |
-
// Allow custom headers/mimetypes and early abort
|
| 7731 |
-
if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) {
|
| 7732 |
-
// Abort if not done already and return
|
| 7733 |
-
return jqXHR.abort();
|
| 7734 |
-
|
| 7735 |
-
}
|
| 7736 |
-
|
| 7737 |
-
// aborting is no longer a cancellation
|
| 7738 |
-
strAbort = "abort";
|
| 7739 |
-
|
| 7740 |
-
// Install callbacks on deferreds
|
| 7741 |
-
for ( i in { success: 1, error: 1, complete: 1 } ) {
|
| 7742 |
-
jqXHR[ i ]( s[ i ] );
|
| 7743 |
-
}
|
| 7744 |
-
|
| 7745 |
-
// Get transport
|
| 7746 |
-
transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
|
| 7747 |
-
|
| 7748 |
-
// If no transport, we auto-abort
|
| 7749 |
-
if ( !transport ) {
|
| 7750 |
-
done( -1, "No Transport" );
|
| 7751 |
-
} else {
|
| 7752 |
-
jqXHR.readyState = 1;
|
| 7753 |
-
// Send global event
|
| 7754 |
-
if ( fireGlobals ) {
|
| 7755 |
-
globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
|
| 7756 |
-
}
|
| 7757 |
-
// Timeout
|
| 7758 |
-
if ( s.async && s.timeout > 0 ) {
|
| 7759 |
-
timeoutTimer = setTimeout( function(){
|
| 7760 |
-
jqXHR.abort( "timeout" );
|
| 7761 |
-
}, s.timeout );
|
| 7762 |
-
}
|
| 7763 |
-
|
| 7764 |
-
try {
|
| 7765 |
-
state = 1;
|
| 7766 |
-
transport.send( requestHeaders, done );
|
| 7767 |
-
} catch (e) {
|
| 7768 |
-
// Propagate exception as error if not done
|
| 7769 |
-
if ( state < 2 ) {
|
| 7770 |
-
done( -1, e );
|
| 7771 |
-
// Simply rethrow otherwise
|
| 7772 |
-
} else {
|
| 7773 |
-
throw e;
|
| 7774 |
-
}
|
| 7775 |
-
}
|
| 7776 |
-
}
|
| 7777 |
-
|
| 7778 |
-
return jqXHR;
|
| 7779 |
-
},
|
| 7780 |
-
|
| 7781 |
-
// Counter for holding the number of active queries
|
| 7782 |
-
active: 0,
|
| 7783 |
-
|
| 7784 |
-
// Last-Modified header cache for next request
|
| 7785 |
-
lastModified: {},
|
| 7786 |
-
etag: {}
|
| 7787 |
-
|
| 7788 |
-
});
|
| 7789 |
-
|
| 7790 |
-
/* Handles responses to an ajax request:
|
| 7791 |
-
* - sets all responseXXX fields accordingly
|
| 7792 |
-
* - finds the right dataType (mediates between content-type and expected dataType)
|
| 7793 |
-
* - returns the corresponding response
|
| 7794 |
-
*/
|
| 7795 |
-
function ajaxHandleResponses( s, jqXHR, responses ) {
|
| 7796 |
-
|
| 7797 |
-
var ct, type, finalDataType, firstDataType,
|
| 7798 |
-
contents = s.contents,
|
| 7799 |
-
dataTypes = s.dataTypes,
|
| 7800 |
-
responseFields = s.responseFields;
|
| 7801 |
-
|
| 7802 |
-
// Fill responseXXX fields
|
| 7803 |
-
for ( type in responseFields ) {
|
| 7804 |
-
if ( type in responses ) {
|
| 7805 |
-
jqXHR[ responseFields[type] ] = responses[ type ];
|
| 7806 |
-
}
|
| 7807 |
-
}
|
| 7808 |
-
|
| 7809 |
-
// Remove auto dataType and get content-type in the process
|
| 7810 |
-
while( dataTypes[ 0 ] === "*" ) {
|
| 7811 |
-
dataTypes.shift();
|
| 7812 |
-
if ( ct === undefined ) {
|
| 7813 |
-
ct = s.mimeType || jqXHR.getResponseHeader( "content-type" );
|
| 7814 |
-
}
|
| 7815 |
-
}
|
| 7816 |
-
|
| 7817 |
-
// Check if we're dealing with a known content-type
|
| 7818 |
-
if ( ct ) {
|
| 7819 |
-
for ( type in contents ) {
|
| 7820 |
-
if ( contents[ type ] && contents[ type ].test( ct ) ) {
|
| 7821 |
-
dataTypes.unshift( type );
|
| 7822 |
-
break;
|
| 7823 |
-
}
|
| 7824 |
-
}
|
| 7825 |
-
}
|
| 7826 |
-
|
| 7827 |
-
// Check to see if we have a response for the expected dataType
|
| 7828 |
-
if ( dataTypes[ 0 ] in responses ) {
|
| 7829 |
-
finalDataType = dataTypes[ 0 ];
|
| 7830 |
-
} else {
|
| 7831 |
-
// Try convertible dataTypes
|
| 7832 |
-
for ( type in responses ) {
|
| 7833 |
-
if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) {
|
| 7834 |
-
finalDataType = type;
|
| 7835 |
-
break;
|
| 7836 |
-
}
|
| 7837 |
-
if ( !firstDataType ) {
|
| 7838 |
-
firstDataType = type;
|
| 7839 |
-
}
|
| 7840 |
-
}
|
| 7841 |
-
// Or just use first one
|
| 7842 |
-
finalDataType = finalDataType || firstDataType;
|
| 7843 |
-
}
|
| 7844 |
-
|
| 7845 |
-
// If we found a dataType
|
| 7846 |
-
// We add the dataType to the list if needed
|
| 7847 |
-
// and return the corresponding response
|
| 7848 |
-
if ( finalDataType ) {
|
| 7849 |
-
if ( finalDataType !== dataTypes[ 0 ] ) {
|
| 7850 |
-
dataTypes.unshift( finalDataType );
|
| 7851 |
-
}
|
| 7852 |
-
return responses[ finalDataType ];
|
| 7853 |
-
}
|
| 7854 |
-
}
|
| 7855 |
-
|
| 7856 |
-
// Chain conversions given the request and the original response
|
| 7857 |
-
function ajaxConvert( s, response ) {
|
| 7858 |
-
|
| 7859 |
-
var conv, conv2, current, tmp,
|
| 7860 |
-
// Work with a copy of dataTypes in case we need to modify it for conversion
|
| 7861 |
-
dataTypes = s.dataTypes.slice(),
|
| 7862 |
-
prev = dataTypes[ 0 ],
|
| 7863 |
-
converters = {},
|
| 7864 |
-
i = 0;
|
| 7865 |
-
|
| 7866 |
-
// Apply the dataFilter if provided
|
| 7867 |
-
if ( s.dataFilter ) {
|
| 7868 |
-
response = s.dataFilter( response, s.dataType );
|
| 7869 |
-
}
|
| 7870 |
-
|
| 7871 |
-
// Create converters map with lowercased keys
|
| 7872 |
-
if ( dataTypes[ 1 ] ) {
|
| 7873 |
-
for ( conv in s.converters ) {
|
| 7874 |
-
converters[ conv.toLowerCase() ] = s.converters[ conv ];
|
| 7875 |
-
}
|
| 7876 |
-
}
|
| 7877 |
-
|
| 7878 |
-
// Convert to each sequential dataType, tolerating list modification
|
| 7879 |
-
for ( ; (current = dataTypes[++i]); ) {
|
| 7880 |
-
|
| 7881 |
-
// There's only work to do if current dataType is non-auto
|
| 7882 |
-
if ( current !== "*" ) {
|
| 7883 |
-
|
| 7884 |
-
// Convert response if prev dataType is non-auto and differs from current
|
| 7885 |
-
if ( prev !== "*" && prev !== current ) {
|
| 7886 |
-
|
| 7887 |
-
// Seek a direct converter
|
| 7888 |
-
conv = converters[ prev + " " + current ] || converters[ "* " + current ];
|
| 7889 |
-
|
| 7890 |
-
// If none found, seek a pair
|
| 7891 |
-
if ( !conv ) {
|
| 7892 |
-
for ( conv2 in converters ) {
|
| 7893 |
-
|
| 7894 |
-
// If conv2 outputs current
|
| 7895 |
-
tmp = conv2.split(" ");
|
| 7896 |
-
if ( tmp[ 1 ] === current ) {
|
| 7897 |
-
|
| 7898 |
-
// If prev can be converted to accepted input
|
| 7899 |
-
conv = converters[ prev + " " + tmp[ 0 ] ] ||
|
| 7900 |
-
converters[ "* " + tmp[ 0 ] ];
|
| 7901 |
-
if ( conv ) {
|
| 7902 |
-
// Condense equivalence converters
|
| 7903 |
-
if ( conv === true ) {
|
| 7904 |
-
conv = converters[ conv2 ];
|
| 7905 |
-
|
| 7906 |
-
// Otherwise, insert the intermediate dataType
|
| 7907 |
-
} else if ( converters[ conv2 ] !== true ) {
|
| 7908 |
-
current = tmp[ 0 ];
|
| 7909 |
-
dataTypes.splice( i--, 0, current );
|
| 7910 |
-
}
|
| 7911 |
-
|
| 7912 |
-
break;
|
| 7913 |
-
}
|
| 7914 |
-
}
|
| 7915 |
-
}
|
| 7916 |
-
}
|
| 7917 |
-
|
| 7918 |
-
// Apply converter (if not an equivalence)
|
| 7919 |
-
if ( conv !== true ) {
|
| 7920 |
-
|
| 7921 |
-
// Unless errors are allowed to bubble, catch and return them
|
| 7922 |
-
if ( conv && s["throws"] ) {
|
| 7923 |
-
response = conv( response );
|
| 7924 |
-
} else {
|
| 7925 |
-
try {
|
| 7926 |
-
response = conv( response );
|
| 7927 |
-
} catch ( e ) {
|
| 7928 |
-
return { state: "parsererror", error: conv ? e : "No conversion from " + prev + " to " + current };
|
| 7929 |
-
}
|
| 7930 |
-
}
|
| 7931 |
-
}
|
| 7932 |
-
}
|
| 7933 |
-
|
| 7934 |
-
// Update prev for next iteration
|
| 7935 |
-
prev = current;
|
| 7936 |
-
}
|
| 7937 |
-
}
|
| 7938 |
-
|
| 7939 |
-
return { state: "success", data: response };
|
| 7940 |
-
}
|
| 7941 |
-
var oldCallbacks = [],
|
| 7942 |
-
rquestion = /\?/,
|
| 7943 |
-
rjsonp = /(=)\?(?=&|$)|\?\?/,
|
| 7944 |
-
nonce = jQuery.now();
|
| 7945 |
-
|
| 7946 |
-
// Default jsonp settings
|
| 7947 |
-
jQuery.ajaxSetup({
|
| 7948 |
-
jsonp: "callback",
|
| 7949 |
-
jsonpCallback: function() {
|
| 7950 |
-
var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) );
|
| 7951 |
-
this[ callback ] = true;
|
| 7952 |
-
return callback;
|
| 7953 |
-
}
|
| 7954 |
-
});
|
| 7955 |
-
|
| 7956 |
-
// Detect, normalize options and install callbacks for jsonp requests
|
| 7957 |
-
jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
|
| 7958 |
-
|
| 7959 |
-
var callbackName, overwritten, responseContainer,
|
| 7960 |
-
data = s.data,
|
| 7961 |
-
url = s.url,
|
| 7962 |
-
hasCallback = s.jsonp !== false,
|
| 7963 |
-
replaceInUrl = hasCallback && rjsonp.test( url ),
|
| 7964 |
-
replaceInData = hasCallback && !replaceInUrl && typeof data === "string" &&
|
| 7965 |
-
!( s.contentType || "" ).indexOf("application/x-www-form-urlencoded") &&
|
| 7966 |
-
rjsonp.test( data );
|
| 7967 |
-
|
| 7968 |
-
// Handle iff the expected data type is "jsonp" or we have a parameter to set
|
| 7969 |
-
if ( s.dataTypes[ 0 ] === "jsonp" || replaceInUrl || replaceInData ) {
|
| 7970 |
-
|
| 7971 |
-
// Get callback name, remembering preexisting value associated with it
|
| 7972 |
-
callbackName = s.jsonpCallback = jQuery.isFunction( s.jsonpCallback ) ?
|
| 7973 |
-
s.jsonpCallback() :
|
| 7974 |
-
s.jsonpCallback;
|
| 7975 |
-
overwritten = window[ callbackName ];
|
| 7976 |
-
|
| 7977 |
-
// Insert callback into url or form data
|
| 7978 |
-
if ( replaceInUrl ) {
|
| 7979 |
-
s.url = url.replace( rjsonp, "$1" + callbackName );
|
| 7980 |
-
} else if ( replaceInData ) {
|
| 7981 |
-
s.data = data.replace( rjsonp, "$1" + callbackName );
|
| 7982 |
-
} else if ( hasCallback ) {
|
| 7983 |
-
s.url += ( rquestion.test( url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName;
|
| 7984 |
-
}
|
| 7985 |
-
|
| 7986 |
-
// Use data converter to retrieve json after script execution
|
| 7987 |
-
s.converters["script json"] = function() {
|
| 7988 |
-
if ( !responseContainer ) {
|
| 7989 |
-
jQuery.error( callbackName + " was not called" );
|
| 7990 |
-
}
|
| 7991 |
-
return responseContainer[ 0 ];
|
| 7992 |
-
};
|
| 7993 |
-
|
| 7994 |
-
// force json dataType
|
| 7995 |
-
s.dataTypes[ 0 ] = "json";
|
| 7996 |
-
|
| 7997 |
-
// Install callback
|
| 7998 |
-
window[ callbackName ] = function() {
|
| 7999 |
-
responseContainer = arguments;
|
| 8000 |
-
};
|
| 8001 |
-
|
| 8002 |
-
// Clean-up function (fires after converters)
|
| 8003 |
-
jqXHR.always(function() {
|
| 8004 |
-
// Restore preexisting value
|
| 8005 |
-
window[ callbackName ] = overwritten;
|
| 8006 |
-
|
| 8007 |
-
// Save back as free
|
| 8008 |
-
if ( s[ callbackName ] ) {
|
| 8009 |
-
// make sure that re-using the options doesn't screw things around
|
| 8010 |
-
s.jsonpCallback = originalSettings.jsonpCallback;
|
| 8011 |
-
|
| 8012 |
-
// save the callback name for future use
|
| 8013 |
-
oldCallbacks.push( callbackName );
|
| 8014 |
-
}
|
| 8015 |
-
|
| 8016 |
-
// Call if it was a function and we have a response
|
| 8017 |
-
if ( responseContainer && jQuery.isFunction( overwritten ) ) {
|
| 8018 |
-
overwritten( responseContainer[ 0 ] );
|
| 8019 |
-
}
|
| 8020 |
-
|
| 8021 |
-
responseContainer = overwritten = undefined;
|
| 8022 |
-
});
|
| 8023 |
-
|
| 8024 |
-
// Delegate to script
|
| 8025 |
-
return "script";
|
| 8026 |
-
}
|
| 8027 |
-
});
|
| 8028 |
-
// Install script dataType
|
| 8029 |
-
jQuery.ajaxSetup({
|
| 8030 |
-
accepts: {
|
| 8031 |
-
script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"
|
| 8032 |
-
},
|
| 8033 |
-
contents: {
|
| 8034 |
-
script: /javascript|ecmascript/
|
| 8035 |
-
},
|
| 8036 |
-
converters: {
|
| 8037 |
-
"text script": function( text ) {
|
| 8038 |
-
jQuery.globalEval( text );
|
| 8039 |
-
return text;
|
| 8040 |
-
}
|
| 8041 |
-
}
|
| 8042 |
-
});
|
| 8043 |
-
|
| 8044 |
-
// Handle cache's special case and global
|
| 8045 |
-
jQuery.ajaxPrefilter( "script", function( s ) {
|
| 8046 |
-
if ( s.cache === undefined ) {
|
| 8047 |
-
s.cache = false;
|
| 8048 |
-
}
|
| 8049 |
-
if ( s.crossDomain ) {
|
| 8050 |
-
s.type = "GET";
|
| 8051 |
-
s.global = false;
|
| 8052 |
-
}
|
| 8053 |
-
});
|
| 8054 |
-
|
| 8055 |
-
// Bind script tag hack transport
|
| 8056 |
-
jQuery.ajaxTransport( "script", function(s) {
|
| 8057 |
-
|
| 8058 |
-
// This transport only deals with cross domain requests
|
| 8059 |
-
if ( s.crossDomain ) {
|
| 8060 |
-
|
| 8061 |
-
var script,
|
| 8062 |
-
head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement;
|
| 8063 |
-
|
| 8064 |
-
return {
|
| 8065 |
-
|
| 8066 |
-
send: function( _, callback ) {
|
| 8067 |
-
|
| 8068 |
-
script = document.createElement( "script" );
|
| 8069 |
-
|
| 8070 |
-
script.async = "async";
|
| 8071 |
-
|
| 8072 |
-
if ( s.scriptCharset ) {
|
| 8073 |
-
script.charset = s.scriptCharset;
|
| 8074 |
-
}
|
| 8075 |
-
|
| 8076 |
-
script.src = s.url;
|
| 8077 |
-
|
| 8078 |
-
// Attach handlers for all browsers
|
| 8079 |
-
script.onload = script.onreadystatechange = function( _, isAbort ) {
|
| 8080 |
-
|
| 8081 |
-
if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) {
|
| 8082 |
-
|
| 8083 |
-
// Handle memory leak in IE
|
| 8084 |
-
script.onload = script.onreadystatechange = null;
|
| 8085 |
-
|
| 8086 |
-
// Remove the script
|
| 8087 |
-
if ( head && script.parentNode ) {
|
| 8088 |
-
head.removeChild( script );
|
| 8089 |
-
}
|
| 8090 |
-
|
| 8091 |
-
// Dereference the script
|
| 8092 |
-
script = undefined;
|
| 8093 |
-
|
| 8094 |
-
// Callback if not abort
|
| 8095 |
-
if ( !isAbort ) {
|
| 8096 |
-
callback( 200, "success" );
|
| 8097 |
-
}
|
| 8098 |
-
}
|
| 8099 |
-
};
|
| 8100 |
-
// Use insertBefore instead of appendChild to circumvent an IE6 bug.
|
| 8101 |
-
// This arises when a base node is used (#2709 and #4378).
|
| 8102 |
-
head.insertBefore( script, head.firstChild );
|
| 8103 |
-
},
|
| 8104 |
-
|
| 8105 |
-
abort: function() {
|
| 8106 |
-
if ( script ) {
|
| 8107 |
-
script.onload( 0, 1 );
|
| 8108 |
-
}
|
| 8109 |
-
}
|
| 8110 |
-
};
|
| 8111 |
-
}
|
| 8112 |
-
});
|
| 8113 |
-
var xhrCallbacks,
|
| 8114 |
-
// #5280: Internet Explorer will keep connections alive if we don't abort on unload
|
| 8115 |
-
xhrOnUnloadAbort = window.ActiveXObject ? function() {
|
| 8116 |
-
// Abort all pending requests
|
| 8117 |
-
for ( var key in xhrCallbacks ) {
|
| 8118 |
-
xhrCallbacks[ key ]( 0, 1 );
|
| 8119 |
-
}
|
| 8120 |
-
} : false,
|
| 8121 |
-
xhrId = 0;
|
| 8122 |
-
|
| 8123 |
-
// Functions to create xhrs
|
| 8124 |
-
function createStandardXHR() {
|
| 8125 |
-
try {
|
| 8126 |
-
return new window.XMLHttpRequest();
|
| 8127 |
-
} catch( e ) {}
|
| 8128 |
-
}
|
| 8129 |
-
|
| 8130 |
-
function createActiveXHR() {
|
| 8131 |
-
try {
|
| 8132 |
-
return new window.ActiveXObject( "Microsoft.XMLHTTP" );
|
| 8133 |
-
} catch( e ) {}
|
| 8134 |
-
}
|
| 8135 |
-
|
| 8136 |
-
// Create the request object
|
| 8137 |
-
// (This is still attached to ajaxSettings for backward compatibility)
|
| 8138 |
-
jQuery.ajaxSettings.xhr = window.ActiveXObject ?
|
| 8139 |
-
/* Microsoft failed to properly
|
| 8140 |
-
* implement the XMLHttpRequest in IE7 (can't request local files),
|
| 8141 |
-
* so we use the ActiveXObject when it is available
|
| 8142 |
-
* Additionally XMLHttpRequest can be disabled in IE7/IE8 so
|
| 8143 |
-
* we need a fallback.
|
| 8144 |
-
*/
|
| 8145 |
-
function() {
|
| 8146 |
-
return !this.isLocal && createStandardXHR() || createActiveXHR();
|
| 8147 |
-
} :
|
| 8148 |
-
// For all other browsers, use the standard XMLHttpRequest object
|
| 8149 |
-
createStandardXHR;
|
| 8150 |
-
|
| 8151 |
-
// Determine support properties
|
| 8152 |
-
(function( xhr ) {
|
| 8153 |
-
jQuery.extend( jQuery.support, {
|
| 8154 |
-
ajax: !!xhr,
|
| 8155 |
-
cors: !!xhr && ( "withCredentials" in xhr )
|
| 8156 |
-
});
|
| 8157 |
-
})( jQuery.ajaxSettings.xhr() );
|
| 8158 |
-
|
| 8159 |
-
// Create transport if the browser can provide an xhr
|
| 8160 |
-
if ( jQuery.support.ajax ) {
|
| 8161 |
-
|
| 8162 |
-
jQuery.ajaxTransport(function( s ) {
|
| 8163 |
-
// Cross domain only allowed if supported through XMLHttpRequest
|
| 8164 |
-
if ( !s.crossDomain || jQuery.support.cors ) {
|
| 8165 |
-
|
| 8166 |
-
var callback;
|
| 8167 |
-
|
| 8168 |
-
return {
|
| 8169 |
-
send: function( headers, complete ) {
|
| 8170 |
-
|
| 8171 |
-
// Get a new xhr
|
| 8172 |
-
var handle, i,
|
| 8173 |
-
xhr = s.xhr();
|
| 8174 |
-
|
| 8175 |
-
// Open the socket
|
| 8176 |
-
// Passing null username, generates a login popup on Opera (#2865)
|
| 8177 |
-
if ( s.username ) {
|
| 8178 |
-
xhr.open( s.type, s.url, s.async, s.username, s.password );
|
| 8179 |
-
} else {
|
| 8180 |
-
xhr.open( s.type, s.url, s.async );
|
| 8181 |
-
}
|
| 8182 |
-
|
| 8183 |
-
// Apply custom fields if provided
|
| 8184 |
-
if ( s.xhrFields ) {
|
| 8185 |
-
for ( i in s.xhrFields ) {
|
| 8186 |
-
xhr[ i ] = s.xhrFields[ i ];
|
| 8187 |
-
}
|
| 8188 |
-
}
|
| 8189 |
-
|
| 8190 |
-
// Override mime type if needed
|
| 8191 |
-
if ( s.mimeType && xhr.overrideMimeType ) {
|
| 8192 |
-
xhr.overrideMimeType( s.mimeType );
|
| 8193 |
-
}
|
| 8194 |
-
|
| 8195 |
-
// X-Requested-With header
|
| 8196 |
-
// For cross-domain requests, seeing as conditions for a preflight are
|
| 8197 |
-
// akin to a jigsaw puzzle, we simply never set it to be sure.
|
| 8198 |
-
// (it can always be set on a per-request basis or even using ajaxSetup)
|
| 8199 |
-
// For same-domain requests, won't change header if already provided.
|
| 8200 |
-
if ( !s.crossDomain && !headers["X-Requested-With"] ) {
|
| 8201 |
-
headers[ "X-Requested-With" ] = "XMLHttpRequest";
|
| 8202 |
-
}
|
| 8203 |
-
|
| 8204 |
-
// Need an extra try/catch for cross domain requests in Firefox 3
|
| 8205 |
-
try {
|
| 8206 |
-
for ( i in headers ) {
|
| 8207 |
-
xhr.setRequestHeader( i, headers[ i ] );
|
| 8208 |
-
}
|
| 8209 |
-
} catch( _ ) {}
|
| 8210 |
-
|
| 8211 |
-
// Do send the request
|
| 8212 |
-
// This may raise an exception which is actually
|
| 8213 |
-
// handled in jQuery.ajax (so no try/catch here)
|
| 8214 |
-
xhr.send( ( s.hasContent && s.data ) || null );
|
| 8215 |
-
|
| 8216 |
-
// Listener
|
| 8217 |
-
callback = function( _, isAbort ) {
|
| 8218 |
-
|
| 8219 |
-
var status,
|
| 8220 |
-
statusText,
|
| 8221 |
-
responseHeaders,
|
| 8222 |
-
responses,
|
| 8223 |
-
xml;
|
| 8224 |
-
|
| 8225 |
-
// Firefox throws exceptions when accessing properties
|
| 8226 |
-
// of an xhr when a network error occurred
|
| 8227 |
-
// http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE)
|
| 8228 |
-
try {
|
| 8229 |
-
|
| 8230 |
-
// Was never called and is aborted or complete
|
| 8231 |
-
if ( callback && ( isAbort || xhr.readyState === 4 ) ) {
|
| 8232 |
-
|
| 8233 |
-
// Only called once
|
| 8234 |
-
callback = undefined;
|
| 8235 |
-
|
| 8236 |
-
// Do not keep as active anymore
|
| 8237 |
-
if ( handle ) {
|
| 8238 |
-
xhr.onreadystatechange = jQuery.noop;
|
| 8239 |
-
if ( xhrOnUnloadAbort ) {
|
| 8240 |
-
delete xhrCallbacks[ handle ];
|
| 8241 |
-
}
|
| 8242 |
-
}
|
| 8243 |
-
|
| 8244 |
-
// If it's an abort
|
| 8245 |
-
if ( isAbort ) {
|
| 8246 |
-
// Abort it manually if needed
|
| 8247 |
-
if ( xhr.readyState !== 4 ) {
|
| 8248 |
-
xhr.abort();
|
| 8249 |
-
}
|
| 8250 |
-
} else {
|
| 8251 |
-
status = xhr.status;
|
| 8252 |
-
responseHeaders = xhr.getAllResponseHeaders();
|
| 8253 |
-
responses = {};
|
| 8254 |
-
xml = xhr.responseXML;
|
| 8255 |
-
|
| 8256 |
-
// Construct response list
|
| 8257 |
-
if ( xml && xml.documentElement /* #4958 */ ) {
|
| 8258 |
-
responses.xml = xml;
|
| 8259 |
-
}
|
| 8260 |
-
|
| 8261 |
-
// When requesting binary data, IE6-9 will throw an exception
|
| 8262 |
-
// on any attempt to access responseText (#11426)
|
| 8263 |
-
try {
|
| 8264 |
-
responses.text = xhr.responseText;
|
| 8265 |
-
} catch( _ ) {
|
| 8266 |
-
}
|
| 8267 |
-
|
| 8268 |
-
// Firefox throws an exception when accessing
|
| 8269 |
-
// statusText for faulty cross-domain requests
|
| 8270 |
-
try {
|
| 8271 |
-
statusText = xhr.statusText;
|
| 8272 |
-
} catch( e ) {
|
| 8273 |
-
// We normalize with Webkit giving an empty statusText
|
| 8274 |
-
statusText = "";
|
| 8275 |
-
}
|
| 8276 |
-
|
| 8277 |
-
// Filter status for non standard behaviors
|
| 8278 |
-
|
| 8279 |
-
// If the request is local and we have data: assume a success
|
| 8280 |
-
// (success with no data won't get notified, that's the best we
|
| 8281 |
-
// can do given current implementations)
|
| 8282 |
-
if ( !status && s.isLocal && !s.crossDomain ) {
|
| 8283 |
-
status = responses.text ? 200 : 404;
|
| 8284 |
-
// IE - #1450: sometimes returns 1223 when it should be 204
|
| 8285 |
-
} else if ( status === 1223 ) {
|
| 8286 |
-
status = 204;
|
| 8287 |
-
}
|
| 8288 |
-
}
|
| 8289 |
-
}
|
| 8290 |
-
} catch( firefoxAccessException ) {
|
| 8291 |
-
if ( !isAbort ) {
|
| 8292 |
-
complete( -1, firefoxAccessException );
|
| 8293 |
-
}
|
| 8294 |
-
}
|
| 8295 |
-
|
| 8296 |
-
// Call complete if needed
|
| 8297 |
-
if ( responses ) {
|
| 8298 |
-
complete( status, statusText, responses, responseHeaders );
|
| 8299 |
-
}
|
| 8300 |
-
};
|
| 8301 |
-
|
| 8302 |
-
if ( !s.async ) {
|
| 8303 |
-
// if we're in sync mode we fire the callback
|
| 8304 |
-
callback();
|
| 8305 |
-
} else if ( xhr.readyState === 4 ) {
|
| 8306 |
-
// (IE6 & IE7) if it's in cache and has been
|
| 8307 |
-
// retrieved directly we need to fire the callback
|
| 8308 |
-
setTimeout( callback, 0 );
|
| 8309 |
-
} else {
|
| 8310 |
-
handle = ++xhrId;
|
| 8311 |
-
if ( xhrOnUnloadAbort ) {
|
| 8312 |
-
// Create the active xhrs callbacks list if needed
|
| 8313 |
-
// and attach the unload handler
|
| 8314 |
-
if ( !xhrCallbacks ) {
|
| 8315 |
-
xhrCallbacks = {};
|
| 8316 |
-
jQuery( window ).unload( xhrOnUnloadAbort );
|
| 8317 |
-
}
|
| 8318 |
-
// Add to list of active xhrs callbacks
|
| 8319 |
-
xhrCallbacks[ handle ] = callback;
|
| 8320 |
-
}
|
| 8321 |
-
xhr.onreadystatechange = callback;
|
| 8322 |
-
}
|
| 8323 |
-
},
|
| 8324 |
-
|
| 8325 |
-
abort: function() {
|
| 8326 |
-
if ( callback ) {
|
| 8327 |
-
callback(0,1);
|
| 8328 |
-
}
|
| 8329 |
-
}
|
| 8330 |
-
};
|
| 8331 |
-
}
|
| 8332 |
-
});
|
| 8333 |
-
}
|
| 8334 |
-
var fxNow, timerId,
|
| 8335 |
-
rfxtypes = /^(?:toggle|show|hide)$/,
|
| 8336 |
-
rfxnum = new RegExp( "^(?:([-+])=|)(" + core_pnum + ")([a-z%]*)$", "i" ),
|
| 8337 |
-
rrun = /queueHooks$/,
|
| 8338 |
-
animationPrefilters = [ defaultPrefilter ],
|
| 8339 |
-
tweeners = {
|
| 8340 |
-
"*": [function( prop, value ) {
|
| 8341 |
-
var end, unit, prevScale,
|
| 8342 |
-
tween = this.createTween( prop, value ),
|
| 8343 |
-
parts = rfxnum.exec( value ),
|
| 8344 |
-
target = tween.cur(),
|
| 8345 |
-
start = +target || 0,
|
| 8346 |
-
scale = 1;
|
| 8347 |
-
|
| 8348 |
-
if ( parts ) {
|
| 8349 |
-
end = +parts[2];
|
| 8350 |
-
unit = parts[3] || ( jQuery.cssNumber[ prop ] ? "" : "px" );
|
| 8351 |
-
|
| 8352 |
-
// We need to compute starting value
|
| 8353 |
-
if ( unit !== "px" && start ) {
|
| 8354 |
-
// Iteratively approximate from a nonzero starting point
|
| 8355 |
-
// Prefer the current property, because this process will be trivial if it uses the same units
|
| 8356 |
-
// Fallback to end or a simple constant
|
| 8357 |
-
start = jQuery.css( tween.elem, prop, true ) || end || 1;
|
| 8358 |
-
|
| 8359 |
-
do {
|
| 8360 |
-
// If previous iteration zeroed out, double until we get *something*
|
| 8361 |
-
// Use a string for doubling factor so we don't accidentally see scale as unchanged below
|
| 8362 |
-
prevScale = scale = scale || ".5";
|
| 8363 |
-
|
| 8364 |
-
// Adjust and apply
|
| 8365 |
-
start = start / scale;
|
| 8366 |
-
jQuery.style( tween.elem, prop, start + unit );
|
| 8367 |
-
|
| 8368 |
-
// Update scale, tolerating zeroes from tween.cur()
|
| 8369 |
-
scale = tween.cur() / target;
|
| 8370 |
-
|
| 8371 |
-
// Stop looping if we've hit the mark or scale is unchanged
|
| 8372 |
-
} while ( scale !== 1 && scale !== prevScale );
|
| 8373 |
-
}
|
| 8374 |
-
|
| 8375 |
-
tween.unit = unit;
|
| 8376 |
-
tween.start = start;
|
| 8377 |
-
// If a +=/-= token was provided, we're doing a relative animation
|
| 8378 |
-
tween.end = parts[1] ? start + ( parts[1] + 1 ) * end : end;
|
| 8379 |
-
}
|
| 8380 |
-
return tween;
|
| 8381 |
-
}]
|
| 8382 |
-
};
|
| 8383 |
-
|
| 8384 |
-
// Animations created synchronously will run synchronously
|
| 8385 |
-
function createFxNow() {
|
| 8386 |
-
setTimeout(function() {
|
| 8387 |
-
fxNow = undefined;
|
| 8388 |
-
}, 0 );
|
| 8389 |
-
return ( fxNow = jQuery.now() );
|
| 8390 |
-
}
|
| 8391 |
-
|
| 8392 |
-
function createTweens( animation, props ) {
|
| 8393 |
-
jQuery.each( props, function( prop, value ) {
|
| 8394 |
-
var collection = ( tweeners[ prop ] || [] ).concat( tweeners[ "*" ] ),
|
| 8395 |
-
index = 0,
|
| 8396 |
-
length = collection.length;
|
| 8397 |
-
for ( ; index < length; index++ ) {
|
| 8398 |
-
if ( collection[ index ].call( animation, prop, value ) ) {
|
| 8399 |
-
|
| 8400 |
-
// we're done with this property
|
| 8401 |
-
return;
|
| 8402 |
-
}
|
| 8403 |
-
}
|
| 8404 |
-
});
|
| 8405 |
-
}
|
| 8406 |
-
|
| 8407 |
-
function Animation( elem, properties, options ) {
|
| 8408 |
-
var result,
|
| 8409 |
-
index = 0,
|
| 8410 |
-
tweenerIndex = 0,
|
| 8411 |
-
length = animationPrefilters.length,
|
| 8412 |
-
deferred = jQuery.Deferred().always( function() {
|
| 8413 |
-
// don't match elem in the :animated selector
|
| 8414 |
-
delete tick.elem;
|
| 8415 |
-
}),
|
| 8416 |
-
tick = function() {
|
| 8417 |
-
var currentTime = fxNow || createFxNow(),
|
| 8418 |
-
remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ),
|
| 8419 |
-
percent = 1 - ( remaining / animation.duration || 0 ),
|
| 8420 |
-
index = 0,
|
| 8421 |
-
length = animation.tweens.length;
|
| 8422 |
-
|
| 8423 |
-
for ( ; index < length ; index++ ) {
|
| 8424 |
-
animation.tweens[ index ].run( percent );
|
| 8425 |
-
}
|
| 8426 |
-
|
| 8427 |
-
deferred.notifyWith( elem, [ animation, percent, remaining ]);
|
| 8428 |
-
|
| 8429 |
-
if ( percent < 1 && length ) {
|
| 8430 |
-
return remaining;
|
| 8431 |
-
} else {
|
| 8432 |
-
deferred.resolveWith( elem, [ animation ] );
|
| 8433 |
-
return false;
|
| 8434 |
-
}
|
| 8435 |
-
},
|
| 8436 |
-
animation = deferred.promise({
|
| 8437 |
-
elem: elem,
|
| 8438 |
-
props: jQuery.extend( {}, properties ),
|
| 8439 |
-
opts: jQuery.extend( true, { specialEasing: {} }, options ),
|
| 8440 |
-
originalProperties: properties,
|
| 8441 |
-
originalOptions: options,
|
| 8442 |
-
startTime: fxNow || createFxNow(),
|
| 8443 |
-
duration: options.duration,
|
| 8444 |
-
tweens: [],
|
| 8445 |
-
createTween: function( prop, end, easing ) {
|
| 8446 |
-
var tween = jQuery.Tween( elem, animation.opts, prop, end,
|
| 8447 |
-
animation.opts.specialEasing[ prop ] || animation.opts.easing );
|
| 8448 |
-
animation.tweens.push( tween );
|
| 8449 |
-
return tween;
|
| 8450 |
-
},
|
| 8451 |
-
stop: function( gotoEnd ) {
|
| 8452 |
-
var index = 0,
|
| 8453 |
-
// if we are going to the end, we want to run all the tweens
|
| 8454 |
-
// otherwise we skip this part
|
| 8455 |
-
length = gotoEnd ? animation.tweens.length : 0;
|
| 8456 |
-
|
| 8457 |
-
for ( ; index < length ; index++ ) {
|
| 8458 |
-
animation.tweens[ index ].run( 1 );
|
| 8459 |
-
}
|
| 8460 |
-
|
| 8461 |
-
// resolve when we played the last frame
|
| 8462 |
-
// otherwise, reject
|
| 8463 |
-
if ( gotoEnd ) {
|
| 8464 |
-
deferred.resolveWith( elem, [ animation, gotoEnd ] );
|
| 8465 |
-
} else {
|
| 8466 |
-
deferred.rejectWith( elem, [ animation, gotoEnd ] );
|
| 8467 |
-
}
|
| 8468 |
-
return this;
|
| 8469 |
-
}
|
| 8470 |
-
}),
|
| 8471 |
-
props = animation.props;
|
| 8472 |
-
|
| 8473 |
-
propFilter( props, animation.opts.specialEasing );
|
| 8474 |
-
|
| 8475 |
-
for ( ; index < length ; index++ ) {
|
| 8476 |
-
result = animationPrefilters[ index ].call( animation, elem, props, animation.opts );
|
| 8477 |
-
if ( result ) {
|
| 8478 |
-
return result;
|
| 8479 |
-
}
|
| 8480 |
-
}
|
| 8481 |
-
|
| 8482 |
-
createTweens( animation, props );
|
| 8483 |
-
|
| 8484 |
-
if ( jQuery.isFunction( animation.opts.start ) ) {
|
| 8485 |
-
animation.opts.start.call( elem, animation );
|
| 8486 |
-
}
|
| 8487 |
-
|
| 8488 |
-
jQuery.fx.timer(
|
| 8489 |
-
jQuery.extend( tick, {
|
| 8490 |
-
anim: animation,
|
| 8491 |
-
queue: animation.opts.queue,
|
| 8492 |
-
elem: elem
|
| 8493 |
-
})
|
| 8494 |
-
);
|
| 8495 |
-
|
| 8496 |
-
// attach callbacks from options
|
| 8497 |
-
return animation.progress( animation.opts.progress )
|
| 8498 |
-
.done( animation.opts.done, animation.opts.complete )
|
| 8499 |
-
.fail( animation.opts.fail )
|
| 8500 |
-
.always( animation.opts.always );
|
| 8501 |
-
}
|
| 8502 |
-
|
| 8503 |
-
function propFilter( props, specialEasing ) {
|
| 8504 |
-
var index, name, easing, value, hooks;
|
| 8505 |
-
|
| 8506 |
-
// camelCase, specialEasing and expand cssHook pass
|
| 8507 |
-
for ( index in props ) {
|
| 8508 |
-
name = jQuery.camelCase( index );
|
| 8509 |
-
easing = specialEasing[ name ];
|
| 8510 |
-
value = props[ index ];
|
| 8511 |
-
if ( jQuery.isArray( value ) ) {
|
| 8512 |
-
easing = value[ 1 ];
|
| 8513 |
-
value = props[ index ] = value[ 0 ];
|
| 8514 |
-
}
|
| 8515 |
-
|
| 8516 |
-
if ( index !== name ) {
|
| 8517 |
-
props[ name ] = value;
|
| 8518 |
-
delete props[ index ];
|
| 8519 |
-
}
|
| 8520 |
-
|
| 8521 |
-
hooks = jQuery.cssHooks[ name ];
|
| 8522 |
-
if ( hooks && "expand" in hooks ) {
|
| 8523 |
-
value = hooks.expand( value );
|
| 8524 |
-
delete props[ name ];
|
| 8525 |
-
|
| 8526 |
-
// not quite $.extend, this wont overwrite keys already present.
|
| 8527 |
-
// also - reusing 'index' from above because we have the correct "name"
|
| 8528 |
-
for ( index in value ) {
|
| 8529 |
-
if ( !( index in props ) ) {
|
| 8530 |
-
props[ index ] = value[ index ];
|
| 8531 |
-
specialEasing[ index ] = easing;
|
| 8532 |
-
}
|
| 8533 |
-
}
|
| 8534 |
-
} else {
|
| 8535 |
-
specialEasing[ name ] = easing;
|
| 8536 |
-
}
|
| 8537 |
-
}
|
| 8538 |
-
}
|
| 8539 |
-
|
| 8540 |
-
jQuery.Animation = jQuery.extend( Animation, {
|
| 8541 |
-
|
| 8542 |
-
tweener: function( props, callback ) {
|
| 8543 |
-
if ( jQuery.isFunction( props ) ) {
|
| 8544 |
-
callback = props;
|
| 8545 |
-
props = [ "*" ];
|
| 8546 |
-
} else {
|
| 8547 |
-
props = props.split(" ");
|
| 8548 |
-
}
|
| 8549 |
-
|
| 8550 |
-
var prop,
|
| 8551 |
-
index = 0,
|
| 8552 |
-
length = props.length;
|
| 8553 |
-
|
| 8554 |
-
for ( ; index < length ; index++ ) {
|
| 8555 |
-
prop = props[ index ];
|
| 8556 |
-
tweeners[ prop ] = tweeners[ prop ] || [];
|
| 8557 |
-
tweeners[ prop ].unshift( callback );
|
| 8558 |
-
}
|
| 8559 |
-
},
|
| 8560 |
-
|
| 8561 |
-
prefilter: function( callback, prepend ) {
|
| 8562 |
-
if ( prepend ) {
|
| 8563 |
-
animationPrefilters.unshift( callback );
|
| 8564 |
-
} else {
|
| 8565 |
-
animationPrefilters.push( callback );
|
| 8566 |
-
}
|
| 8567 |
-
}
|
| 8568 |
-
});
|
| 8569 |
-
|
| 8570 |
-
function defaultPrefilter( elem, props, opts ) {
|
| 8571 |
-
var index, prop, value, length, dataShow, tween, hooks, oldfire,
|
| 8572 |
-
anim = this,
|
| 8573 |
-
style = elem.style,
|
| 8574 |
-
orig = {},
|
| 8575 |
-
handled = [],
|
| 8576 |
-
hidden = elem.nodeType && isHidden( elem );
|
| 8577 |
-
|
| 8578 |
-
// handle queue: false promises
|
| 8579 |
-
if ( !opts.queue ) {
|
| 8580 |
-
hooks = jQuery._queueHooks( elem, "fx" );
|
| 8581 |
-
if ( hooks.unqueued == null ) {
|
| 8582 |
-
hooks.unqueued = 0;
|
| 8583 |
-
oldfire = hooks.empty.fire;
|
| 8584 |
-
hooks.empty.fire = function() {
|
| 8585 |
-
if ( !hooks.unqueued ) {
|
| 8586 |
-
oldfire();
|
| 8587 |
-
}
|
| 8588 |
-
};
|
| 8589 |
-
}
|
| 8590 |
-
hooks.unqueued++;
|
| 8591 |
-
|
| 8592 |
-
anim.always(function() {
|
| 8593 |
-
// doing this makes sure that the complete handler will be called
|
| 8594 |
-
// before this completes
|
| 8595 |
-
anim.always(function() {
|
| 8596 |
-
hooks.unqueued--;
|
| 8597 |
-
if ( !jQuery.queue( elem, "fx" ).length ) {
|
| 8598 |
-
hooks.empty.fire();
|
| 8599 |
-
}
|
| 8600 |
-
});
|
| 8601 |
-
});
|
| 8602 |
-
}
|
| 8603 |
-
|
| 8604 |
-
// height/width overflow pass
|
| 8605 |
-
if ( elem.nodeType === 1 && ( "height" in props || "width" in props ) ) {
|
| 8606 |
-
// Make sure that nothing sneaks out
|
| 8607 |
-
// Record all 3 overflow attributes because IE does not
|
| 8608 |
-
// change the overflow attribute when overflowX and
|
| 8609 |
-
// overflowY are set to the same value
|
| 8610 |
-
opts.overflow = [ style.overflow, style.overflowX, style.overflowY ];
|
| 8611 |
-
|
| 8612 |
-
// Set display property to inline-block for height/width
|
| 8613 |
-
// animations on inline elements that are having width/height animated
|
| 8614 |
-
if ( jQuery.css( elem, "display" ) === "inline" &&
|
| 8615 |
-
jQuery.css( elem, "float" ) === "none" ) {
|
| 8616 |
-
|
| 8617 |
-
// inline-level elements accept inline-block;
|
| 8618 |
-
// block-level elements need to be inline with layout
|
| 8619 |
-
if ( !jQuery.support.inlineBlockNeedsLayout || css_defaultDisplay( elem.nodeName ) === "inline" ) {
|
| 8620 |
-
style.display = "inline-block";
|
| 8621 |
-
|
| 8622 |
-
} else {
|
| 8623 |
-
style.zoom = 1;
|
| 8624 |
-
}
|
| 8625 |
-
}
|
| 8626 |
-
}
|
| 8627 |
-
|
| 8628 |
-
if ( opts.overflow ) {
|
| 8629 |
-
style.overflow = "hidden";
|
| 8630 |
-
if ( !jQuery.support.shrinkWrapBlocks ) {
|
| 8631 |
-
anim.done(function() {
|
| 8632 |
-
style.overflow = opts.overflow[ 0 ];
|
| 8633 |
-
style.overflowX = opts.overflow[ 1 ];
|
| 8634 |
-
style.overflowY = opts.overflow[ 2 ];
|
| 8635 |
-
});
|
| 8636 |
-
}
|
| 8637 |
-
}
|
| 8638 |
-
|
| 8639 |
-
|
| 8640 |
-
// show/hide pass
|
| 8641 |
-
for ( index in props ) {
|
| 8642 |
-
value = props[ index ];
|
| 8643 |
-
if ( rfxtypes.exec( value ) ) {
|
| 8644 |
-
delete props[ index ];
|
| 8645 |
-
if ( value === ( hidden ? "hide" : "show" ) ) {
|
| 8646 |
-
continue;
|
| 8647 |
-
}
|
| 8648 |
-
handled.push( index );
|
| 8649 |
-
}
|
| 8650 |
-
}
|
| 8651 |
-
|
| 8652 |
-
length = handled.length;
|
| 8653 |
-
if ( length ) {
|
| 8654 |
-
dataShow = jQuery._data( elem, "fxshow" ) || jQuery._data( elem, "fxshow", {} );
|
| 8655 |
-
if ( hidden ) {
|
| 8656 |
-
jQuery( elem ).show();
|
| 8657 |
-
} else {
|
| 8658 |
-
anim.done(function() {
|
| 8659 |
-
jQuery( elem ).hide();
|
| 8660 |
-
});
|
| 8661 |
-
}
|
| 8662 |
-
anim.done(function() {
|
| 8663 |
-
var prop;
|
| 8664 |
-
jQuery.removeData( elem, "fxshow", true );
|
| 8665 |
-
for ( prop in orig ) {
|
| 8666 |
-
jQuery.style( elem, prop, orig[ prop ] );
|
| 8667 |
-
}
|
| 8668 |
-
});
|
| 8669 |
-
for ( index = 0 ; index < length ; index++ ) {
|
| 8670 |
-
prop = handled[ index ];
|
| 8671 |
-
tween = anim.createTween( prop, hidden ? dataShow[ prop ] : 0 );
|
| 8672 |
-
orig[ prop ] = dataShow[ prop ] || jQuery.style( elem, prop );
|
| 8673 |
-
|
| 8674 |
-
if ( !( prop in dataShow ) ) {
|
| 8675 |
-
dataShow[ prop ] = tween.start;
|
| 8676 |
-
if ( hidden ) {
|
| 8677 |
-
tween.end = tween.start;
|
| 8678 |
-
tween.start = prop === "width" || prop === "height" ? 1 : 0;
|
| 8679 |
-
}
|
| 8680 |
-
}
|
| 8681 |
-
}
|
| 8682 |
-
}
|
| 8683 |
-
}
|
| 8684 |
-
|
| 8685 |
-
function Tween( elem, options, prop, end, easing ) {
|
| 8686 |
-
return new Tween.prototype.init( elem, options, prop, end, easing );
|
| 8687 |
-
}
|
| 8688 |
-
jQuery.Tween = Tween;
|
| 8689 |
-
|
| 8690 |
-
Tween.prototype = {
|
| 8691 |
-
constructor: Tween,
|
| 8692 |
-
init: function( elem, options, prop, end, easing, unit ) {
|
| 8693 |
-
this.elem = elem;
|
| 8694 |
-
this.prop = prop;
|
| 8695 |
-
this.easing = easing || "swing";
|
| 8696 |
-
this.options = options;
|
| 8697 |
-
this.start = this.now = this.cur();
|
| 8698 |
-
this.end = end;
|
| 8699 |
-
this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" );
|
| 8700 |
-
},
|
| 8701 |
-
cur: function() {
|
| 8702 |
-
var hooks = Tween.propHooks[ this.prop ];
|
| 8703 |
-
|
| 8704 |
-
return hooks && hooks.get ?
|
| 8705 |
-
hooks.get( this ) :
|
| 8706 |
-
Tween.propHooks._default.get( this );
|
| 8707 |
-
},
|
| 8708 |
-
run: function( percent ) {
|
| 8709 |
-
var eased,
|
| 8710 |
-
hooks = Tween.propHooks[ this.prop ];
|
| 8711 |
-
|
| 8712 |
-
this.pos = eased = jQuery.easing[ this.easing ]( percent, this.options.duration * percent, 0, 1, this.options.duration );
|
| 8713 |
-
this.now = ( this.end - this.start ) * eased + this.start;
|
| 8714 |
-
|
| 8715 |
-
if ( this.options.step ) {
|
| 8716 |
-
this.options.step.call( this.elem, this.now, this );
|
| 8717 |
-
}
|
| 8718 |
-
|
| 8719 |
-
if ( hooks && hooks.set ) {
|
| 8720 |
-
hooks.set( this );
|
| 8721 |
-
} else {
|
| 8722 |
-
Tween.propHooks._default.set( this );
|
| 8723 |
-
}
|
| 8724 |
-
return this;
|
| 8725 |
-
}
|
| 8726 |
-
};
|
| 8727 |
-
|
| 8728 |
-
Tween.prototype.init.prototype = Tween.prototype;
|
| 8729 |
-
|
| 8730 |
-
Tween.propHooks = {
|
| 8731 |
-
_default: {
|
| 8732 |
-
get: function( tween ) {
|
| 8733 |
-
var result;
|
| 8734 |
-
|
| 8735 |
-
if ( tween.elem[ tween.prop ] != null &&
|
| 8736 |
-
(!tween.elem.style || tween.elem.style[ tween.prop ] == null) ) {
|
| 8737 |
-
return tween.elem[ tween.prop ];
|
| 8738 |
-
}
|
| 8739 |
-
|
| 8740 |
-
// passing any value as a 4th parameter to .css will automatically
|
| 8741 |
-
// attempt a parseFloat and fallback to a string if the parse fails
|
| 8742 |
-
// so, simple values such as "10px" are parsed to Float.
|
| 8743 |
-
// complex values such as "rotate(1rad)" are returned as is.
|
| 8744 |
-
result = jQuery.css( tween.elem, tween.prop, false, "" );
|
| 8745 |
-
// Empty strings, null, undefined and "auto" are converted to 0.
|
| 8746 |
-
return !result || result === "auto" ? 0 : result;
|
| 8747 |
-
},
|
| 8748 |
-
set: function( tween ) {
|
| 8749 |
-
// use step hook for back compat - use cssHook if its there - use .style if its
|
| 8750 |
-
// available and use plain properties where available
|
| 8751 |
-
if ( jQuery.fx.step[ tween.prop ] ) {
|
| 8752 |
-
jQuery.fx.step[ tween.prop ]( tween );
|
| 8753 |
-
} else if ( tween.elem.style && ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null || jQuery.cssHooks[ tween.prop ] ) ) {
|
| 8754 |
-
jQuery.style( tween.elem, tween.prop, tween.now + tween.unit );
|
| 8755 |
-
} else {
|
| 8756 |
-
tween.elem[ tween.prop ] = tween.now;
|
| 8757 |
-
}
|
| 8758 |
-
}
|
| 8759 |
-
}
|
| 8760 |
-
};
|
| 8761 |
-
|
| 8762 |
-
// Remove in 2.0 - this supports IE8's panic based approach
|
| 8763 |
-
// to setting things on disconnected nodes
|
| 8764 |
-
|
| 8765 |
-
Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
|
| 8766 |
-
set: function( tween ) {
|
| 8767 |
-
if ( tween.elem.nodeType && tween.elem.parentNode ) {
|
| 8768 |
-
tween.elem[ tween.prop ] = tween.now;
|
| 8769 |
-
}
|
| 8770 |
-
}
|
| 8771 |
-
};
|
| 8772 |
-
|
| 8773 |
-
jQuery.each([ "toggle", "show", "hide" ], function( i, name ) {
|
| 8774 |
-
var cssFn = jQuery.fn[ name ];
|
| 8775 |
-
jQuery.fn[ name ] = function( speed, easing, callback ) {
|
| 8776 |
-
return speed == null || typeof speed === "boolean" ||
|
| 8777 |
-
// special check for .toggle( handler, handler, ... )
|
| 8778 |
-
( !i && jQuery.isFunction( speed ) && jQuery.isFunction( easing ) ) ?
|
| 8779 |
-
cssFn.apply( this, arguments ) :
|
| 8780 |
-
this.animate( genFx( name, true ), speed, easing, callback );
|
| 8781 |
-
};
|
| 8782 |
-
});
|
| 8783 |
-
|
| 8784 |
-
jQuery.fn.extend({
|
| 8785 |
-
fadeTo: function( speed, to, easing, callback ) {
|
| 8786 |
-
|
| 8787 |
-
// show any hidden elements after setting opacity to 0
|
| 8788 |
-
return this.filter( isHidden ).css( "opacity", 0 ).show()
|
| 8789 |
-
|
| 8790 |
-
// animate to the value specified
|
| 8791 |
-
.end().animate({ opacity: to }, speed, easing, callback );
|
| 8792 |
-
},
|
| 8793 |
-
animate: function( prop, speed, easing, callback ) {
|
| 8794 |
-
var empty = jQuery.isEmptyObject( prop ),
|
| 8795 |
-
optall = jQuery.speed( speed, easing, callback ),
|
| 8796 |
-
doAnimation = function() {
|
| 8797 |
-
// Operate on a copy of prop so per-property easing won't be lost
|
| 8798 |
-
var anim = Animation( this, jQuery.extend( {}, prop ), optall );
|
| 8799 |
-
|
| 8800 |
-
// Empty animations resolve immediately
|
| 8801 |
-
if ( empty ) {
|
| 8802 |
-
anim.stop( true );
|
| 8803 |
-
}
|
| 8804 |
-
};
|
| 8805 |
-
|
| 8806 |
-
return empty || optall.queue === false ?
|
| 8807 |
-
this.each( doAnimation ) :
|
| 8808 |
-
this.queue( optall.queue, doAnimation );
|
| 8809 |
-
},
|
| 8810 |
-
stop: function( type, clearQueue, gotoEnd ) {
|
| 8811 |
-
var stopQueue = function( hooks ) {
|
| 8812 |
-
var stop = hooks.stop;
|
| 8813 |
-
delete hooks.stop;
|
| 8814 |
-
stop( gotoEnd );
|
| 8815 |
-
};
|
| 8816 |
-
|
| 8817 |
-
if ( typeof type !== "string" ) {
|
| 8818 |
-
gotoEnd = clearQueue;
|
| 8819 |
-
clearQueue = type;
|
| 8820 |
-
type = undefined;
|
| 8821 |
-
}
|
| 8822 |
-
if ( clearQueue && type !== false ) {
|
| 8823 |
-
this.queue( type || "fx", [] );
|
| 8824 |
-
}
|
| 8825 |
-
|
| 8826 |
-
return this.each(function() {
|
| 8827 |
-
var dequeue = true,
|
| 8828 |
-
index = type != null && type + "queueHooks",
|
| 8829 |
-
timers = jQuery.timers,
|
| 8830 |
-
data = jQuery._data( this );
|
| 8831 |
-
|
| 8832 |
-
if ( index ) {
|
| 8833 |
-
if ( data[ index ] && data[ index ].stop ) {
|
| 8834 |
-
stopQueue( data[ index ] );
|
| 8835 |
-
}
|
| 8836 |
-
} else {
|
| 8837 |
-
for ( index in data ) {
|
| 8838 |
-
if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) {
|
| 8839 |
-
stopQueue( data[ index ] );
|
| 8840 |
-
}
|
| 8841 |
-
}
|
| 8842 |
-
}
|
| 8843 |
-
|
| 8844 |
-
for ( index = timers.length; index--; ) {
|
| 8845 |
-
if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) {
|
| 8846 |
-
timers[ index ].anim.stop( gotoEnd );
|
| 8847 |
-
dequeue = false;
|
| 8848 |
-
timers.splice( index, 1 );
|
| 8849 |
-
}
|
| 8850 |
-
}
|
| 8851 |
-
|
| 8852 |
-
// start the next in the queue if the last step wasn't forced
|
| 8853 |
-
// timers currently will call their complete callbacks, which will dequeue
|
| 8854 |
-
// but only if they were gotoEnd
|
| 8855 |
-
if ( dequeue || !gotoEnd ) {
|
| 8856 |
-
jQuery.dequeue( this, type );
|
| 8857 |
-
}
|
| 8858 |
-
});
|
| 8859 |
-
}
|
| 8860 |
-
});
|
| 8861 |
-
|
| 8862 |
-
// Generate parameters to create a standard animation
|
| 8863 |
-
function genFx( type, includeWidth ) {
|
| 8864 |
-
var which,
|
| 8865 |
-
attrs = { height: type },
|
| 8866 |
-
i = 0;
|
| 8867 |
-
|
| 8868 |
-
// if we include width, step value is 1 to do all cssExpand values,
|
| 8869 |
-
// if we don't include width, step value is 2 to skip over Left and Right
|
| 8870 |
-
for( ; i < 4 ; i += 2 - includeWidth ) {
|
| 8871 |
-
which = cssExpand[ i ];
|
| 8872 |
-
attrs[ "margin" + which ] = attrs[ "padding" + which ] = type;
|
| 8873 |
-
}
|
| 8874 |
-
|
| 8875 |
-
if ( includeWidth ) {
|
| 8876 |
-
attrs.opacity = attrs.width = type;
|
| 8877 |
-
}
|
| 8878 |
-
|
| 8879 |
-
return attrs;
|
| 8880 |
-
}
|
| 8881 |
-
|
| 8882 |
-
// Generate shortcuts for custom animations
|
| 8883 |
-
jQuery.each({
|
| 8884 |
-
slideDown: genFx("show"),
|
| 8885 |
-
slideUp: genFx("hide"),
|
| 8886 |
-
slideToggle: genFx("toggle"),
|
| 8887 |
-
fadeIn: { opacity: "show" },
|
| 8888 |
-
fadeOut: { opacity: "hide" },
|
| 8889 |
-
fadeToggle: { opacity: "toggle" }
|
| 8890 |
-
}, function( name, props ) {
|
| 8891 |
-
jQuery.fn[ name ] = function( speed, easing, callback ) {
|
| 8892 |
-
return this.animate( props, speed, easing, callback );
|
| 8893 |
-
};
|
| 8894 |
-
});
|
| 8895 |
-
|
| 8896 |
-
jQuery.speed = function( speed, easing, fn ) {
|
| 8897 |
-
var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : {
|
| 8898 |
-
complete: fn || !fn && easing ||
|
| 8899 |
-
jQuery.isFunction( speed ) && speed,
|
| 8900 |
-
duration: speed,
|
| 8901 |
-
easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing
|
| 8902 |
-
};
|
| 8903 |
-
|
| 8904 |
-
opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
|
| 8905 |
-
opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default;
|
| 8906 |
-
|
| 8907 |
-
// normalize opt.queue - true/undefined/null -> "fx"
|
| 8908 |
-
if ( opt.queue == null || opt.queue === true ) {
|
| 8909 |
-
opt.queue = "fx";
|
| 8910 |
-
}
|
| 8911 |
-
|
| 8912 |
-
// Queueing
|
| 8913 |
-
opt.old = opt.complete;
|
| 8914 |
-
|
| 8915 |
-
opt.complete = function() {
|
| 8916 |
-
if ( jQuery.isFunction( opt.old ) ) {
|
| 8917 |
-
opt.old.call( this );
|
| 8918 |
-
}
|
| 8919 |
-
|
| 8920 |
-
if ( opt.queue ) {
|
| 8921 |
-
jQuery.dequeue( this, opt.queue );
|
| 8922 |
-
}
|
| 8923 |
-
};
|
| 8924 |
-
|
| 8925 |
-
return opt;
|
| 8926 |
-
};
|
| 8927 |
-
|
| 8928 |
-
jQuery.easing = {
|
| 8929 |
-
linear: function( p ) {
|
| 8930 |
-
return p;
|
| 8931 |
-
},
|
| 8932 |
-
swing: function( p ) {
|
| 8933 |
-
return 0.5 - Math.cos( p*Math.PI ) / 2;
|
| 8934 |
-
}
|
| 8935 |
-
};
|
| 8936 |
-
|
| 8937 |
-
jQuery.timers = [];
|
| 8938 |
-
jQuery.fx = Tween.prototype.init;
|
| 8939 |
-
jQuery.fx.tick = function() {
|
| 8940 |
-
var timer,
|
| 8941 |
-
timers = jQuery.timers,
|
| 8942 |
-
i = 0;
|
| 8943 |
-
|
| 8944 |
-
for ( ; i < timers.length; i++ ) {
|
| 8945 |
-
timer = timers[ i ];
|
| 8946 |
-
// Checks the timer has not already been removed
|
| 8947 |
-
if ( !timer() && timers[ i ] === timer ) {
|
| 8948 |
-
timers.splice( i--, 1 );
|
| 8949 |
-
}
|
| 8950 |
-
}
|
| 8951 |
-
|
| 8952 |
-
if ( !timers.length ) {
|
| 8953 |
-
jQuery.fx.stop();
|
| 8954 |
-
}
|
| 8955 |
-
};
|
| 8956 |
-
|
| 8957 |
-
jQuery.fx.timer = function( timer ) {
|
| 8958 |
-
if ( timer() && jQuery.timers.push( timer ) && !timerId ) {
|
| 8959 |
-
timerId = setInterval( jQuery.fx.tick, jQuery.fx.interval );
|
| 8960 |
-
}
|
| 8961 |
-
};
|
| 8962 |
-
|
| 8963 |
-
jQuery.fx.interval = 13;
|
| 8964 |
-
|
| 8965 |
-
jQuery.fx.stop = function() {
|
| 8966 |
-
clearInterval( timerId );
|
| 8967 |
-
timerId = null;
|
| 8968 |
-
};
|
| 8969 |
-
|
| 8970 |
-
jQuery.fx.speeds = {
|
| 8971 |
-
slow: 600,
|
| 8972 |
-
fast: 200,
|
| 8973 |
-
// Default speed
|
| 8974 |
-
_default: 400
|
| 8975 |
-
};
|
| 8976 |
-
|
| 8977 |
-
// Back Compat <1.8 extension point
|
| 8978 |
-
jQuery.fx.step = {};
|
| 8979 |
-
|
| 8980 |
-
if ( jQuery.expr && jQuery.expr.filters ) {
|
| 8981 |
-
jQuery.expr.filters.animated = function( elem ) {
|
| 8982 |
-
return jQuery.grep(jQuery.timers, function( fn ) {
|
| 8983 |
-
return elem === fn.elem;
|
| 8984 |
-
}).length;
|
| 8985 |
-
};
|
| 8986 |
-
}
|
| 8987 |
-
var rroot = /^(?:body|html)$/i;
|
| 8988 |
-
|
| 8989 |
-
jQuery.fn.offset = function( options ) {
|
| 8990 |
-
if ( arguments.length ) {
|
| 8991 |
-
return options === undefined ?
|
| 8992 |
-
this :
|
| 8993 |
-
this.each(function( i ) {
|
| 8994 |
-
jQuery.offset.setOffset( this, options, i );
|
| 8995 |
-
});
|
| 8996 |
-
}
|
| 8997 |
-
|
| 8998 |
-
var box, docElem, body, win, clientTop, clientLeft, scrollTop, scrollLeft, top, left,
|
| 8999 |
-
elem = this[ 0 ],
|
| 9000 |
-
doc = elem && elem.ownerDocument;
|
| 9001 |
-
|
| 9002 |
-
if ( !doc ) {
|
| 9003 |
-
return;
|
| 9004 |
-
}
|
| 9005 |
-
|
| 9006 |
-
if ( (body = doc.body) === elem ) {
|
| 9007 |
-
return jQuery.offset.bodyOffset( elem );
|
| 9008 |
-
}
|
| 9009 |
-
|
| 9010 |
-
docElem = doc.documentElement;
|
| 9011 |
-
|
| 9012 |
-
// Make sure we're not dealing with a disconnected DOM node
|
| 9013 |
-
if ( !jQuery.contains( docElem, elem ) ) {
|
| 9014 |
-
return { top: 0, left: 0 };
|
| 9015 |
-
}
|
| 9016 |
-
|
| 9017 |
-
box = elem.getBoundingClientRect();
|
| 9018 |
-
win = getWindow( doc );
|
| 9019 |
-
clientTop = docElem.clientTop || body.clientTop || 0;
|
| 9020 |
-
clientLeft = docElem.clientLeft || body.clientLeft || 0;
|
| 9021 |
-
scrollTop = win.pageYOffset || docElem.scrollTop;
|
| 9022 |
-
scrollLeft = win.pageXOffset || docElem.scrollLeft;
|
| 9023 |
-
top = box.top + scrollTop - clientTop;
|
| 9024 |
-
left = box.left + scrollLeft - clientLeft;
|
| 9025 |
-
|
| 9026 |
-
return { top: top, left: left };
|
| 9027 |
-
};
|
| 9028 |
-
|
| 9029 |
-
jQuery.offset = {
|
| 9030 |
-
|
| 9031 |
-
bodyOffset: function( body ) {
|
| 9032 |
-
var top = body.offsetTop,
|
| 9033 |
-
left = body.offsetLeft;
|
| 9034 |
-
|
| 9035 |
-
if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) {
|
| 9036 |
-
top += parseFloat( jQuery.css(body, "marginTop") ) || 0;
|
| 9037 |
-
left += parseFloat( jQuery.css(body, "marginLeft") ) || 0;
|
| 9038 |
-
}
|
| 9039 |
-
|
| 9040 |
-
return { top: top, left: left };
|
| 9041 |
-
},
|
| 9042 |
-
|
| 9043 |
-
setOffset: function( elem, options, i ) {
|
| 9044 |
-
var position = jQuery.css( elem, "position" );
|
| 9045 |
-
|
| 9046 |
-
// set position first, in-case top/left are set even on static elem
|
| 9047 |
-
if ( position === "static" ) {
|
| 9048 |
-
elem.style.position = "relative";
|
| 9049 |
-
}
|
| 9050 |
-
|
| 9051 |
-
var curElem = jQuery( elem ),
|
| 9052 |
-
curOffset = curElem.offset(),
|
| 9053 |
-
curCSSTop = jQuery.css( elem, "top" ),
|
| 9054 |
-
curCSSLeft = jQuery.css( elem, "left" ),
|
| 9055 |
-
calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1,
|
| 9056 |
-
props = {}, curPosition = {}, curTop, curLeft;
|
| 9057 |
-
|
| 9058 |
-
// need to be able to calculate position if either top or left is auto and position is either absolute or fixed
|
| 9059 |
-
if ( calculatePosition ) {
|
| 9060 |
-
curPosition = curElem.position();
|
| 9061 |
-
curTop = curPosition.top;
|
| 9062 |
-
curLeft = curPosition.left;
|
| 9063 |
-
} else {
|
| 9064 |
-
curTop = parseFloat( curCSSTop ) || 0;
|
| 9065 |
-
curLeft = parseFloat( curCSSLeft ) || 0;
|
| 9066 |
-
}
|
| 9067 |
-
|
| 9068 |
-
if ( jQuery.isFunction( options ) ) {
|
| 9069 |
-
options = options.call( elem, i, curOffset );
|
| 9070 |
-
}
|
| 9071 |
-
|
| 9072 |
-
if ( options.top != null ) {
|
| 9073 |
-
props.top = ( options.top - curOffset.top ) + curTop;
|
| 9074 |
-
}
|
| 9075 |
-
if ( options.left != null ) {
|
| 9076 |
-
props.left = ( options.left - curOffset.left ) + curLeft;
|
| 9077 |
-
}
|
| 9078 |
-
|
| 9079 |
-
if ( "using" in options ) {
|
| 9080 |
-
options.using.call( elem, props );
|
| 9081 |
-
} else {
|
| 9082 |
-
curElem.css( props );
|
| 9083 |
-
}
|
| 9084 |
-
}
|
| 9085 |
-
};
|
| 9086 |
-
|
| 9087 |
-
|
| 9088 |
-
jQuery.fn.extend({
|
| 9089 |
-
|
| 9090 |
-
position: function() {
|
| 9091 |
-
if ( !this[0] ) {
|
| 9092 |
-
return;
|
| 9093 |
-
}
|
| 9094 |
-
|
| 9095 |
-
var elem = this[0],
|
| 9096 |
-
|
| 9097 |
-
// Get *real* offsetParent
|
| 9098 |
-
offsetParent = this.offsetParent(),
|
| 9099 |
-
|
| 9100 |
-
// Get correct offsets
|
| 9101 |
-
offset = this.offset(),
|
| 9102 |
-
parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset();
|
| 9103 |
-
|
| 9104 |
-
// Subtract element margins
|
| 9105 |
-
// note: when an element has margin: auto the offsetLeft and marginLeft
|
| 9106 |
-
// are the same in Safari causing offset.left to incorrectly be 0
|
| 9107 |
-
offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0;
|
| 9108 |
-
offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0;
|
| 9109 |
-
|
| 9110 |
-
// Add offsetParent borders
|
| 9111 |
-
parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0;
|
| 9112 |
-
parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0;
|
| 9113 |
-
|
| 9114 |
-
// Subtract the two offsets
|
| 9115 |
-
return {
|
| 9116 |
-
top: offset.top - parentOffset.top,
|
| 9117 |
-
left: offset.left - parentOffset.left
|
| 9118 |
-
};
|
| 9119 |
-
},
|
| 9120 |
-
|
| 9121 |
-
offsetParent: function() {
|
| 9122 |
-
return this.map(function() {
|
| 9123 |
-
var offsetParent = this.offsetParent || document.body;
|
| 9124 |
-
while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) {
|
| 9125 |
-
offsetParent = offsetParent.offsetParent;
|
| 9126 |
-
}
|
| 9127 |
-
return offsetParent || document.body;
|
| 9128 |
-
});
|
| 9129 |
-
}
|
| 9130 |
-
});
|
| 9131 |
-
|
| 9132 |
-
|
| 9133 |
-
// Create scrollLeft and scrollTop methods
|
| 9134 |
-
jQuery.each( {scrollLeft: "pageXOffset", scrollTop: "pageYOffset"}, function( method, prop ) {
|
| 9135 |
-
var top = /Y/.test( prop );
|
| 9136 |
-
|
| 9137 |
-
jQuery.fn[ method ] = function( val ) {
|
| 9138 |
-
return jQuery.access( this, function( elem, method, val ) {
|
| 9139 |
-
var win = getWindow( elem );
|
| 9140 |
-
|
| 9141 |
-
if ( val === undefined ) {
|
| 9142 |
-
return win ? (prop in win) ? win[ prop ] :
|
| 9143 |
-
win.document.documentElement[ method ] :
|
| 9144 |
-
elem[ method ];
|
| 9145 |
-
}
|
| 9146 |
-
|
| 9147 |
-
if ( win ) {
|
| 9148 |
-
win.scrollTo(
|
| 9149 |
-
!top ? val : jQuery( win ).scrollLeft(),
|
| 9150 |
-
top ? val : jQuery( win ).scrollTop()
|
| 9151 |
-
);
|
| 9152 |
-
|
| 9153 |
-
} else {
|
| 9154 |
-
elem[ method ] = val;
|
| 9155 |
-
}
|
| 9156 |
-
}, method, val, arguments.length, null );
|
| 9157 |
-
};
|
| 9158 |
-
});
|
| 9159 |
-
|
| 9160 |
-
function getWindow( elem ) {
|
| 9161 |
-
return jQuery.isWindow( elem ) ?
|
| 9162 |
-
elem :
|
| 9163 |
-
elem.nodeType === 9 ?
|
| 9164 |
-
elem.defaultView || elem.parentWindow :
|
| 9165 |
-
false;
|
| 9166 |
-
}
|
| 9167 |
-
// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
|
| 9168 |
-
jQuery.each( { Height: "height", Width: "width" }, function( name, type ) {
|
| 9169 |
-
jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name }, function( defaultExtra, funcName ) {
|
| 9170 |
-
// margin is only for outerHeight, outerWidth
|
| 9171 |
-
jQuery.fn[ funcName ] = function( margin, value ) {
|
| 9172 |
-
var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ),
|
| 9173 |
-
extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" );
|
| 9174 |
-
|
| 9175 |
-
return jQuery.access( this, function( elem, type, value ) {
|
| 9176 |
-
var doc;
|
| 9177 |
-
|
| 9178 |
-
if ( jQuery.isWindow( elem ) ) {
|
| 9179 |
-
// As of 5/8/2012 this will yield incorrect results for Mobile Safari, but there
|
| 9180 |
-
// isn't a whole lot we can do. See pull request at this URL for discussion:
|
| 9181 |
-
// https://github.com/jquery/jquery/pull/764
|
| 9182 |
-
return elem.document.documentElement[ "client" + name ];
|
| 9183 |
-
}
|
| 9184 |
-
|
| 9185 |
-
// Get document width or height
|
| 9186 |
-
if ( elem.nodeType === 9 ) {
|
| 9187 |
-
doc = elem.documentElement;
|
| 9188 |
-
|
| 9189 |
-
// Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], whichever is greatest
|
| 9190 |
-
// unfortunately, this causes bug #3838 in IE6/8 only, but there is currently no good, small way to fix it.
|
| 9191 |
-
return Math.max(
|
| 9192 |
-
elem.body[ "scroll" + name ], doc[ "scroll" + name ],
|
| 9193 |
-
elem.body[ "offset" + name ], doc[ "offset" + name ],
|
| 9194 |
-
doc[ "client" + name ]
|
| 9195 |
-
);
|
| 9196 |
-
}
|
| 9197 |
-
|
| 9198 |
-
return value === undefined ?
|
| 9199 |
-
// Get width or height on the element, requesting but not forcing parseFloat
|
| 9200 |
-
jQuery.css( elem, type, value, extra ) :
|
| 9201 |
-
|
| 9202 |
-
// Set width or height on the element
|
| 9203 |
-
jQuery.style( elem, type, value, extra );
|
| 9204 |
-
}, type, chainable ? margin : undefined, chainable );
|
| 9205 |
-
};
|
| 9206 |
-
});
|
| 9207 |
-
});
|
| 9208 |
-
// Expose jQuery to the global object
|
| 9209 |
-
window.sQuery = jQuery;
|
| 9210 |
-
|
| 9211 |
-
// Expose jQuery as an AMD module, but only for AMD loaders that
|
| 9212 |
-
// understand the issues with loading multiple versions of jQuery
|
| 9213 |
-
// in a page that all might call define(). The loader will indicate
|
| 9214 |
-
// they have special allowances for multiple jQuery versions by
|
| 9215 |
-
// specifying define.amd.jQuery = true. Register as a named module,
|
| 9216 |
-
// since jQuery can be concatenated with other files that may use define,
|
| 9217 |
-
// but not use a proper concatenation script that understands anonymous
|
| 9218 |
-
// AMD modules. A named AMD is safest and most robust way to register.
|
| 9219 |
-
// Lowercase jquery is used because AMD module names are derived from
|
| 9220 |
-
// file names, and jQuery is normally delivered in a lowercase file name.
|
| 9221 |
-
// Do this after creating the global so that if an AMD module wants to call
|
| 9222 |
-
// noConflict to hide this version of jQuery, it will work.
|
| 9223 |
-
if ( typeof define === "function" && define.amd && define.amd.sQuery ) {
|
| 9224 |
-
define( "jquery", [], function () { return jQuery; } );
|
| 9225 |
-
}
|
| 9226 |
-
|
| 9227 |
-
})( window );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/js/jquery_custom.min.js
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
| 1 |
+
!function(ie,T){function t(e,t){return(t+"").toUpperCase()}var r,y=ie.document,e=ie.location,n=ie.navigator,i=ie.sQuery,o=ie.$,a=Array.prototype.push,c=Array.prototype.slice,s=Array.prototype.indexOf,l=Object.prototype.toString,u=Object.prototype.hasOwnProperty,f=String.prototype.trim,oe=function(e,t){return new oe.fn.init(e,t,A)},p=/[\-+]?(?:\d*\.|)\d+(?:[eE][\-+]?\d+|)/.source,d=/\S/,N=/\s+/,h=d.test(" ")?/^[\s\xA0]+|[\s\xA0]+$/g:/^\s+|\s+$/g,g=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,m=/^<(\w+)\s*\/?>(?:<\/\1>|)$/,v=/^[\],:{}\s]*$/,b=/(?:^|:|,)(?:\s*\[)+/g,x=/\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g,w=/"[^"\\\r\n]*"|true|false|null|-?(?:\d\d*\.|)\d+(?:[eE][\-+]?\d+|)/g,C=/^-ms-/,E=/-([\da-z])/gi,k=function(){y.addEventListener?(y.removeEventListener("DOMContentLoaded",k,!1),oe.ready()):"complete"===y.readyState&&(y.detachEvent("onreadystatechange",k),oe.ready())},S={};oe.fn=oe.prototype={constructor:oe,init:function(e,t,n){var r,i;if(!e)return this;if(e.nodeType)return this.context=this[0]=e,this.length=1,this;if("string"!=typeof e)return oe.isFunction(e)?n.ready(e):(e.selector!==T&&(this.selector=e.selector,this.context=e.context),oe.makeArray(e,this));if(!(r="<"===e.charAt(0)&&">"===e.charAt(e.length-1)&&3<=e.length?[null,e,null]:g.exec(e))||!r[1]&&t)return(!t||t.jquery?t||n:this.constructor(t)).find(e);if(r[1])return i=(t=t instanceof oe?t[0]:t)&&t.nodeType?t.ownerDocument||t:y,e=oe.parseHTML(r[1],i,!0),m.test(r[1])&&oe.isPlainObject(t)&&this.attr.call(e,t,!0),oe.merge(this,e);if((t=y.getElementById(r[2]))&&t.parentNode){if(t.id!==r[2])return n.find(e);this.length=1,this[0]=t}return this.context=y,this.selector=e,this},selector:"",jquery:"1.8.0",length:0,size:function(){return this.length},toArray:function(){return c.call(this)},get:function(e){return null==e?this.toArray():e<0?this[this.length+e]:this[e]},pushStack:function(e,t,n){e=oe.merge(this.constructor(),e);return e.prevObject=this,e.context=this.context,"find"===t?e.selector=this.selector+(this.selector?" ":"")+n:t&&(e.selector=this.selector+"."+t+"("+n+")"),e},each:function(e,t){return oe.each(this,e,t)},ready:function(e){return oe.ready.promise().done(e),this},eq:function(e){return-1===(e=+e)?this.slice(e):this.slice(e,e+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(c.apply(this,arguments),"slice",c.call(arguments).join(","))},map:function(n){return this.pushStack(oe.map(this,function(e,t){return n.call(e,t,e)}))},end:function(){return this.prevObject||this.constructor(null)},push:a,sort:[].sort,splice:[].splice},oe.fn.init.prototype=oe.fn,oe.extend=oe.fn.extend=function(){var e,t,n,r,i,o=arguments[0]||{},a=1,s=arguments.length,l=!1;for("boolean"==typeof o&&(l=o,o=arguments[1]||{},a=2),"object"==typeof o||oe.isFunction(o)||(o={}),s===a&&(o=this,--a);a<s;a++)if(null!=(e=arguments[a]))for(t in e)i=o[t],o!==(n=e[t])&&(l&&n&&(oe.isPlainObject(n)||(r=oe.isArray(n)))?(i=r?(r=!1,i&&oe.isArray(i)?i:[]):i&&oe.isPlainObject(i)?i:{},o[t]=oe.extend(l,i,n)):n!==T&&(o[t]=n));return o},oe.extend({noConflict:function(e){return ie.$===oe&&(ie.$=o),e&&ie.sQuery===oe&&(ie.sQuery=i),oe},isReady:!1,readyWait:1,holdReady:function(e){e?oe.readyWait++:oe.ready(!0)},ready:function(e){if(!0===e?!--oe.readyWait:!oe.isReady){if(!y.body)return setTimeout(oe.ready,1);(oe.isReady=!0)!==e&&0<--oe.readyWait||(r.resolveWith(y,[oe]),oe.fn.trigger&&oe(y).trigger("ready").off("ready"))}},isFunction:function(e){return"function"===oe.type(e)},isArray:Array.isArray||function(e){return"array"===oe.type(e)},isWindow:function(e){return null!=e&&e==e.window},isNumeric:function(e){return!isNaN(parseFloat(e))&&isFinite(e)},type:function(e){return null==e?String(e):S[l.call(e)]||"object"},isPlainObject:function(e){if(!e||"object"!==oe.type(e)||e.nodeType||oe.isWindow(e))return!1;try{if(e.constructor&&!u.call(e,"constructor")&&!u.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(e){return!1}for(var t in e);return t===T||u.call(e,t)},isEmptyObject:function(e){for(var t in e)return!1;return!0},error:function(e){throw new Error(e)},parseHTML:function(e,t,n){var r;return e&&"string"==typeof e?("boolean"==typeof t&&(n=t,t=0),t=t||y,(r=m.exec(e))?[t.createElement(r[1])]:(r=oe.buildFragment([e],t,n?null:[]),oe.merge([],(r.cacheable?oe.clone(r.fragment):r.fragment).childNodes))):null},parseJSON:function(e){return e&&"string"==typeof e?(e=oe.trim(e),ie.JSON&&ie.JSON.parse?ie.JSON.parse(e):v.test(e.replace(x,"@").replace(w,"]").replace(b,""))?new Function("return "+e)():void oe.error("Invalid JSON: "+e)):null},parseXML:function(e){var t;if(!e||"string"!=typeof e)return null;try{ie.DOMParser?t=(new DOMParser).parseFromString(e,"text/xml"):((t=new ActiveXObject("Microsoft.XMLDOM")).async="false",t.loadXML(e))}catch(e){t=T}return t&&t.documentElement&&!t.getElementsByTagName("parsererror").length||oe.error("Invalid XML: "+e),t},noop:function(){},globalEval:function(e){e&&d.test(e)&&(ie.execScript||function(e){ie.eval.call(ie,e)})(e)},camelCase:function(e){return e.replace(C,"ms-").replace(E,t)},nodeName:function(e,t){return e.nodeName&&e.nodeName.toUpperCase()===t.toUpperCase()},each:function(e,t,n){var r,i=0,o=e.length,a=o===T||oe.isFunction(e);if(n)if(a){for(r in e)if(!1===t.apply(e[r],n))break}else for(;i<o&&!1!==t.apply(e[i++],n););else if(a){for(r in e)if(!1===t.call(e[r],r,e[r]))break}else for(;i<o&&!1!==t.call(e[i],i,e[i++]););return e},trim:f?function(e){return null==e?"":f.call(e)}:function(e){return null==e?"":e.toString().replace(h,"")},makeArray:function(e,t){var n=t||[];return null!=e&&(t=oe.type(e),null==e.length||"string"===t||"function"===t||"regexp"===t||oe.isWindow(e)?a.call(n,e):oe.merge(n,e)),n},inArray:function(e,t,n){var r;if(t){if(s)return s.call(t,e,n);for(r=t.length,n=n?n<0?Math.max(0,r+n):n:0;n<r;n++)if(n in t&&t[n]===e)return n}return-1},merge:function(e,t){var n=t.length,r=e.length,i=0;if("number"==typeof n)for(;i<n;i++)e[r++]=t[i];else for(;t[i]!==T;)e[r++]=t[i++];return e.length=r,e},grep:function(e,t,n){var r=[],i=0,o=e.length;for(n=!!n;i<o;i++)n!==!!t(e[i],i)&&r.push(e[i]);return r},map:function(e,t,n){var r,i,o=[],a=0,s=e.length;if(e instanceof oe||s!==T&&"number"==typeof s&&(0<s&&e[0]&&e[s-1]||0===s||oe.isArray(e)))for(;a<s;a++)null!=(r=t(e[a],a,n))&&(o[o.length]=r);else for(i in e)null!=(r=t(e[i],i,n))&&(o[o.length]=r);return o.concat.apply([],o)},guid:1,proxy:function(e,t){var n,r;return"string"==typeof t&&(r=e[t],t=e,e=r),oe.isFunction(e)?(n=c.call(arguments,2),(r=function(){return e.apply(t,n.concat(c.call(arguments)))}).guid=e.guid=e.guid||r.guid||oe.guid++,r):T},access:function(e,t,n,r,i,o,a){var s,l=null==n,u=0,c=e.length;if(n&&"object"==typeof n){for(u in n)oe.access(e,t,u,n[u],1,o,r);i=1}else if(r!==T){if(s=a===T&&oe.isFunction(r),t=l?s?(s=t,function(e,t,n){return s.call(oe(e),n)}):(t.call(e,r),null):t)for(;u<c;u++)t(e[u],n,s?r.call(e[u],u,t(e[u],n)):r,a);i=1}return i?e:l?t.call(e):c?t(e[0],n):o},now:function(){return(new Date).getTime()}}),oe.ready.promise=function(e){if(!r)if(r=oe.Deferred(),"complete"===y.readyState||"loading"!==y.readyState&&y.addEventListener)setTimeout(oe.ready,1);else if(y.addEventListener)y.addEventListener("DOMContentLoaded",k,!1),ie.addEventListener("load",oe.ready,!1);else{y.attachEvent("onreadystatechange",k),ie.attachEvent("onload",oe.ready);var n=!1;try{n=null==ie.frameElement&&y.documentElement}catch(e){}n&&n.doScroll&&!function t(){if(!oe.isReady){try{n.doScroll("left")}catch(e){return setTimeout(t,50)}oe.ready()}}()}return r.promise(e)},oe.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(e,t){S["[object "+t+"]"]=t.toLowerCase()});var A=oe(y),j={};oe.Callbacks=function(r){var e,n;r="string"==typeof r?j[r]||(n=j[e=r]={},oe.each(e.split(N),function(e,t){n[t]=!0}),n):oe.extend({},r);var t,i,o,a,s,l,u=[],c=!r.once&&[],f=function(e){for(t=r.memory&&e,i=!0,l=a||0,a=0,s=u.length,o=!0;u&&l<s;l++)if(!1===u[l].apply(e[0],e[1])&&r.stopOnFalse){t=!1;break}o=!1,u&&(c?c.length&&f(c.shift()):t?u=[]:p.disable())},p={add:function(){var e;return u&&(e=u.length,function n(e){oe.each(e,function(e,t){!oe.isFunction(t)||r.unique&&p.has(t)?t&&t.length&&n(t):u.push(t)})}(arguments),o?s=u.length:t&&(a=e,f(t))),this},remove:function(){return u&&oe.each(arguments,function(e,t){for(var n;-1<(n=oe.inArray(t,u,n));)u.splice(n,1),o&&(n<=s&&s--,n<=l&&l--)}),this},has:function(e){return-1<oe.inArray(e,u)},empty:function(){return u=[],this},disable:function(){return u=c=t=T,this},disabled:function(){return!u},lock:function(){return c=T,t||p.disable(),this},locked:function(){return!c},fireWith:function(e,t){return t=[e,(t=t||[]).slice?t.slice():t],!u||i&&!c||(o?c.push(t):f(t)),this},fire:function(){return p.fireWith(this,arguments),this},fired:function(){return!!i}};return p},oe.extend({Deferred:function(e){var a=[["resolve","done",oe.Callbacks("once memory"),"resolved"],["reject","fail",oe.Callbacks("once memory"),"rejected"],["notify","progress",oe.Callbacks("memory")]],i="pending",o={state:function(){return i},always:function(){return s.done(arguments).fail(arguments),this},then:function(){var o=arguments;return oe.Deferred(function(i){oe.each(a,function(e,t){var n=t[0],r=o[e];s[t[1]](oe.isFunction(r)?function(){var e=r.apply(this,arguments);e&&oe.isFunction(e.promise)?e.promise().done(i.resolve).fail(i.reject).progress(i.notify):i[n+"With"](this===s?i:this,[e])}:i[n])}),o=null}).promise()},promise:function(e){return"object"==typeof e?oe.extend(e,o):o}},s={};return o.pipe=o.then,oe.each(a,function(e,t){var n=t[2],r=t[3];o[t[1]]=n.add,r&&n.add(function(){i=r},a[1^e][2].disable,a[2][2].lock),s[t[0]]=n.fire,s[t[0]+"With"]=n.fireWith}),o.promise(s),e&&e.call(s,s),s},when:function(e){function t(t,n,r){return function(e){n[t]=this,r[t]=1<arguments.length?c.call(arguments):e,r===i?u.notifyWith(n,r):--l||u.resolveWith(n,r)}}var i,n,r,o=0,a=c.call(arguments),s=a.length,l=1!==s||e&&oe.isFunction(e.promise)?s:0,u=1===l?e:oe.Deferred();if(1<s)for(i=new Array(s),n=new Array(s),r=new Array(s);o<s;o++)a[o]&&oe.isFunction(a[o].promise)?a[o].promise().done(t(o,r,a)).fail(u.reject).progress(t(o,n,i)):--l;return l||u.resolveWith(r,a),u.promise()}}),oe.support=function(){var a,e,t,n,r,i,o,s,l,u,c=y.createElement("div");if(c.setAttribute("className","t"),c.innerHTML=" <link/><table></table><a href='/a'>a</a><input type='checkbox'/>",e=c.getElementsByTagName("*"),(t=c.getElementsByTagName("a")[0]).style.cssText="top:1px;float:left;opacity:.5",!e||!e.length||!t)return{};r=(n=y.createElement("select")).appendChild(y.createElement("option")),i=c.getElementsByTagName("input")[0],a={leadingWhitespace:3===c.firstChild.nodeType,tbody:!c.getElementsByTagName("tbody").length,htmlSerialize:!!c.getElementsByTagName("link").length,style:/top/.test(t.getAttribute("style")),hrefNormalized:"/a"===t.getAttribute("href"),opacity:/^0.5/.test(t.style.opacity),cssFloat:!!t.style.cssFloat,checkOn:"on"===i.value,optSelected:r.selected,getSetAttribute:"t"!==c.className,enctype:!!y.createElement("form").enctype,html5Clone:"<:nav></:nav>"!==y.createElement("nav").cloneNode(!0).outerHTML,boxModel:"CSS1Compat"===y.compatMode,submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0,boxSizingReliable:!0,pixelPosition:!1},i.checked=!0,a.noCloneChecked=i.cloneNode(!0).checked,n.disabled=!0,a.optDisabled=!r.disabled;try{delete c.test}catch(e){a.deleteExpando=!1}if(!c.addEventListener&&c.attachEvent&&c.fireEvent&&(c.attachEvent("onclick",u=function(){a.noCloneEvent=!1}),c.cloneNode(!0).fireEvent("onclick"),c.detachEvent("onclick",u)),(i=y.createElement("input")).value="t",i.setAttribute("type","radio"),a.radioValue="t"===i.value,i.setAttribute("checked","checked"),i.setAttribute("name","t"),c.appendChild(i),(u=y.createDocumentFragment()).appendChild(c.lastChild),a.checkClone=u.cloneNode(!0).cloneNode(!0).lastChild.checked,a.appendChecked=i.checked,u.removeChild(i),u.appendChild(c),c.attachEvent)for(s in{submit:!0,change:!0,focusin:!0})(l=(o="on"+s)in c)||(c.setAttribute(o,"return;"),l="function"==typeof c[o]),a[s+"Bubbles"]=l;return oe(function(){var e,t,n,r,i="padding:0;margin:0;border:0;display:block;overflow:hidden;",o=y.getElementsByTagName("body")[0];o&&((e=y.createElement("div")).style.cssText="visibility:hidden;border:0;width:0;height:0;position:static;top:0;margin-top:1px",o.insertBefore(e,o.firstChild),t=y.createElement("div"),e.appendChild(t),t.innerHTML="<table><tr><td></td><td>t</td></tr></table>",(n=t.getElementsByTagName("td"))[0].style.cssText="padding:0;margin:0;border:0;display:none",l=0===n[0].offsetHeight,n[0].style.display="",n[1].style.display="none",a.reliableHiddenOffsets=l&&0===n[0].offsetHeight,t.innerHTML="",t.style.cssText="box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;",a.boxSizing=4===t.offsetWidth,a.doesNotIncludeMarginInBodyOffset=1!==o.offsetTop,ie.getComputedStyle&&(a.pixelPosition="1%"!==(ie.getComputedStyle(t,null)||{}).top,a.boxSizingReliable="4px"===(ie.getComputedStyle(t,null)||{width:"4px"}).width,(r=y.createElement("div")).style.cssText=t.style.cssText=i,r.style.marginRight=r.style.width="0",t.style.width="1px",t.appendChild(r),a.reliableMarginRight=!parseFloat((ie.getComputedStyle(r,null)||{}).marginRight)),void 0!==t.style.zoom&&(t.innerHTML="",t.style.cssText=i+"width:1px;padding:1px;display:inline;zoom:1",a.inlineBlockNeedsLayout=3===t.offsetWidth,t.style.display="block",t.style.overflow="visible",t.innerHTML="<div></div>",t.firstChild.style.width="5px",a.shrinkWrapBlocks=3!==t.offsetWidth,e.style.zoom=1),o.removeChild(e),e=t=n=r=null)}),u.removeChild(c),e=t=n=i=u=c=null,a}();var D=/^(?:\{.*\}|\[.*\])$/,L=/([A-Z])/g;function H(e,t,n){if(n===T&&1===e.nodeType){var r="data-"+t.replace(L,"-$1").toLowerCase();if("string"==typeof(n=e.getAttribute(r))){try{n="true"===n||"false"!==n&&("null"===n?null:+n+""===n?+n:D.test(n)?oe.parseJSON(n):n)}catch(e){}oe.data(e,t,n)}else n=T}return n}function F(e){for(var t in e)if(("data"!==t||!oe.isEmptyObject(e[t]))&&"toJSON"!==t)return!1;return!0}oe.extend({cache:{},deletedIds:[],uuid:0,expando:"sQuery"+(oe.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(e){return!!(e=e.nodeType?oe.cache[e[oe.expando]]:e[oe.expando])&&!F(e)},data:function(e,t,n,r){if(oe.acceptData(e)){var i,o=oe.expando,a="string"==typeof t,s=e.nodeType,l=s?oe.cache:e,u=s?e[o]:e[o]&&o;if(u&&l[u]&&(r||l[u].data)||!a||n!==T)return u||(s?e[o]=u=oe.deletedIds.pop()||++oe.uuid:u=o),l[u]||(l[u]={},s||(l[u].toJSON=oe.noop)),"object"!=typeof t&&"function"!=typeof t||(r?l[u]=oe.extend(l[u],t):l[u].data=oe.extend(l[u].data,t)),u=l[u],r||(u.data||(u.data={}),u=u.data),n!==T&&(u[oe.camelCase(t)]=n),a?null==(i=u[t])&&(i=u[oe.camelCase(t)]):i=u,i}},removeData:function(e,t,n){if(oe.acceptData(e)){var r,i,o,a=e.nodeType,s=a?oe.cache:e,l=a?e[oe.expando]:oe.expando;if(s[l]){if(t&&(r=n?s[l]:s[l].data)){for((i=0,o=(t=!oe.isArray(t)?t in r||(t=oe.camelCase(t))in r?[t]:t.split(" "):t).length);i<o;i++)delete r[t[i]];if(!(n?F:oe.isEmptyObject)(r))return}(n||(delete s[l].data,F(s[l])))&&(a?oe.cleanData([e],!0):oe.support.deleteExpando||s!=s.window?delete s[l]:s[l]=null)}}},_data:function(e,t,n){return oe.data(e,t,n,!0)},acceptData:function(e){var t=e.nodeName&&oe.noData[e.nodeName.toLowerCase()];return!t||!0!==t&&e.getAttribute("classid")===t}}),oe.fn.extend({data:function(n,e){var r,i,t,o,a,s=this[0],l=0,u=null;if(n!==T)return"object"==typeof n?this.each(function(){oe.data(this,n)}):((r=n.split(".",2))[1]=r[1]?"."+r[1]:"",i=r[1]+"!",oe.access(this,function(t){return t===T?((u=this.triggerHandler("getData"+i,[r[0]]))===T&&s&&(u=oe.data(s,n),u=H(s,n,u)),u===T&&r[1]?this.data(r[0]):u):(r[1]=t,void this.each(function(){var e=oe(this);e.triggerHandler("setData"+i,r),oe.data(this,n,t),e.triggerHandler("changeData"+i,r)}))},null,e,1<arguments.length,null,!1));if(this.length&&(u=oe.data(s),1===s.nodeType&&!oe._data(s,"parsedAttrs"))){for(a=(t=s.attributes).length;l<a;l++)0===(o=t[l].name).indexOf("data-")&&(o=oe.camelCase(o.substring(5)),H(s,o,u[o]));oe._data(s,"parsedAttrs",!0)}return u},removeData:function(e){return this.each(function(){oe.removeData(this,e)})}}),oe.extend({queue:function(e,t,n){var r;if(e)return r=oe._data(e,t=(t||"fx")+"queue"),n&&(!r||oe.isArray(n)?r=oe._data(e,t,oe.makeArray(n)):r.push(n)),r||[]},dequeue:function(e,t){var n=oe.queue(e,t=t||"fx"),r=n.shift(),i=oe._queueHooks(e,t);(r="inprogress"===r?n.shift():r)&&("fx"===t&&n.unshift("inprogress"),delete i.stop,r.call(e,function(){oe.dequeue(e,t)},i)),!n.length&&i&&i.empty.fire()},_queueHooks:function(e,t){var n=t+"queueHooks";return oe._data(e,n)||oe._data(e,n,{empty:oe.Callbacks("once memory").add(function(){oe.removeData(e,t+"queue",!0),oe.removeData(e,n,!0)})})}}),oe.fn.extend({queue:function(t,n){var e=2;return"string"!=typeof t&&(n=t,t="fx",e--),arguments.length<e?oe.queue(this[0],t):n===T?this:this.each(function(){var e=oe.queue(this,t,n);oe._queueHooks(this,t),"fx"===t&&"inprogress"!==e[0]&&oe.dequeue(this,t)})},dequeue:function(e){return this.each(function(){oe.dequeue(this,e)})},delay:function(r,e){return r=oe.fx&&oe.fx.speeds[r]||r,this.queue(e=e||"fx",function(e,t){var n=setTimeout(e,r);t.stop=function(){clearTimeout(n)}})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(e,t){function n(){--i||o.resolveWith(a,[a])}var r,i=1,o=oe.Deferred(),a=this,s=this.length;for("string"!=typeof e&&(t=e,e=T),e=e||"fx";s--;)(r=oe._data(a[s],e+"queueHooks"))&&r.empty&&(i++,r.empty.add(n));return n(),o.promise(t)}});var M,O,_,q=/[\t\r\n]/g,B=/\r/g,W=/^(?:button|input)$/i,P=/^(?:button|input|object|select|textarea)$/i,R=/^a(?:rea|)$/i,$=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,I=oe.support.getSetAttribute;oe.fn.extend({attr:function(e,t){return oe.access(this,oe.attr,e,t,1<arguments.length)},removeAttr:function(e){return this.each(function(){oe.removeAttr(this,e)})},prop:function(e,t){return oe.access(this,oe.prop,e,t,1<arguments.length)},removeProp:function(e){return e=oe.propFix[e]||e,this.each(function(){try{this[e]=T,delete this[e]}catch(e){}})},addClass:function(t){var e,n,r,i,o,a,s;if(oe.isFunction(t))return this.each(function(e){oe(this).addClass(t.call(this,e,this.className))});if(t&&"string"==typeof t)for(e=t.split(N),n=0,r=this.length;n<r;n++)if(1===(i=this[n]).nodeType)if(i.className||1!==e.length){for(o=" "+i.className+" ",a=0,s=e.length;a<s;a++)~o.indexOf(" "+e[a]+" ")||(o+=e[a]+" ");i.className=oe.trim(o)}else i.className=t;return this},removeClass:function(t){var e,n,r,i,o,a,s;if(oe.isFunction(t))return this.each(function(e){oe(this).removeClass(t.call(this,e,this.className))});if(t&&"string"==typeof t||t===T)for(e=(t||"").split(N),a=0,s=this.length;a<s;a++)if(1===(r=this[a]).nodeType&&r.className){for(n=(" "+r.className+" ").replace(q," "),i=0,o=e.length;i<o;i++)for(;-1<n.indexOf(" "+e[i]+" ");)n=n.replace(" "+e[i]+" "," ");r.className=t?oe.trim(n):""}return this},toggleClass:function(o,a){var s=typeof o,l="boolean"==typeof a;return oe.isFunction(o)?this.each(function(e){oe(this).toggleClass(o.call(this,e,this.className,a),a)}):this.each(function(){if("string"==s)for(var e,t=0,n=oe(this),r=a,i=o.split(N);e=i[t++];)r=l?r:!n.hasClass(e),n[r?"addClass":"removeClass"](e);else"undefined"!=s&&"boolean"!=s||(this.className&&oe._data(this,"__className__",this.className),this.className=!this.className&&!1!==o&&oe._data(this,"__className__")||"")})},hasClass:function(e){for(var t=" "+e+" ",n=0,r=this.length;n<r;n++)if(1===this[n].nodeType&&-1<(" "+this[n].className+" ").replace(q," ").indexOf(t))return!0;return!1},val:function(n){var r,e,i,t=this[0];return arguments.length?(i=oe.isFunction(n),this.each(function(e){var t=oe(this);1===this.nodeType&&(null==(t=i?n.call(this,e,t.val()):n)?t="":"number"==typeof t?t+="":oe.isArray(t)&&(t=oe.map(t,function(e){return null==e?"":e+""})),(r=oe.valHooks[this.type]||oe.valHooks[this.nodeName.toLowerCase()])&&"set"in r&&r.set(this,t,"value")!==T||(this.value=t))})):t?(r=oe.valHooks[t.type]||oe.valHooks[t.nodeName.toLowerCase()])&&"get"in r&&(e=r.get(t,"value"))!==T?e:"string"==typeof(e=t.value)?e.replace(B,""):null==e?"":e:void 0}}),oe.extend({valHooks:{option:{get:function(e){var t=e.attributes.value;return!t||t.specified?e.value:e.text}},select:{get:function(e){var t,n,r,i=e.selectedIndex,o=[],a=e.options,s="select-one"===e.type;if(i<0)return null;for(t=s?i:0,n=s?i+1:a.length;t<n;t++)if((r=a[t]).selected&&(oe.support.optDisabled?!r.disabled:null===r.getAttribute("disabled"))&&(!r.parentNode.disabled||!oe.nodeName(r.parentNode,"optgroup"))){if(r=oe(r).val(),s)return r;o.push(r)}return s&&!o.length&&a.length?oe(a[i]).val():o},set:function(e,t){var n=oe.makeArray(t);return oe(e).find("option").each(function(){this.selected=0<=oe.inArray(oe(this).val(),n)}),n.length||(e.selectedIndex=-1),n}}},attrFn:{},attr:function(e,t,n,r){var i,o,a=e.nodeType;if(e&&3!==a&&8!==a&&2!==a)return r&&oe.isFunction(oe.fn[t])?oe(e)[t](n):void 0===e.getAttribute?oe.prop(e,t,n):((a=1!==a||!oe.isXMLDoc(e))&&(t=t.toLowerCase(),o=oe.attrHooks[t]||($.test(t)?O:M)),n===T?!(o&&"get"in o&&a&&null!==(i=o.get(e,t)))&&null===(i=e.getAttribute(t))?T:i:null!==n?o&&"set"in o&&a&&(i=o.set(e,n,t))!==T?i:(e.setAttribute(t,""+n),n):void oe.removeAttr(e,t))},removeAttr:function(e,t){var n,r,i,o,a=0;if(t&&1===e.nodeType)for(r=t.split(N);a<r.length;a++)(i=r[a])&&(n=oe.propFix[i]||i,(o=$.test(i))||oe.attr(e,i,""),e.removeAttribute(I?i:n),o&&n in e&&(e[n]=!1))},attrHooks:{type:{set:function(e,t){if(W.test(e.nodeName)&&e.parentNode)oe.error("type property can't be changed");else if(!oe.support.radioValue&&"radio"===t&&oe.nodeName(e,"input")){var n=e.value;return e.setAttribute("type",t),n&&(e.value=n),t}}},value:{get:function(e,t){return M&&oe.nodeName(e,"button")?M.get(e,t):t in e?e.value:null},set:function(e,t,n){if(M&&oe.nodeName(e,"button"))return M.set(e,t,n);e.value=t}}},propFix:{tabindex:"tabIndex",readonly:"readOnly",for:"htmlFor",class:"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(e,t,n){var r,i,o=e.nodeType;if(e&&3!==o&&8!==o&&2!==o)return(1!==o||!oe.isXMLDoc(e))&&(t=oe.propFix[t]||t,i=oe.propHooks[t]),n!==T?i&&"set"in i&&(r=i.set(e,n,t))!==T?r:e[t]=n:i&&"get"in i&&null!==(r=i.get(e,t))?r:e[t]},propHooks:{tabIndex:{get:function(e){var t=e.getAttributeNode("tabindex");return t&&t.specified?parseInt(t.value,10):P.test(e.nodeName)||R.test(e.nodeName)&&e.href?0:T}}}}),O={get:function(e,t){var n,r=oe.prop(e,t);return!0===r||"boolean"!=typeof r&&(n=e.getAttributeNode(t))&&!1!==n.nodeValue?t.toLowerCase():T},set:function(e,t,n){return!1===t?oe.removeAttr(e,n):((t=oe.propFix[n]||n)in e&&(e[t]=!0),e.setAttribute(n,n.toLowerCase())),n}},I||(_={name:!0,id:!0,coords:!0},M=oe.valHooks.button={get:function(e,t){e=e.getAttributeNode(t);return e&&(_[t]?""!==e.value:e.specified)?e.value:T},set:function(e,t,n){var r=e.getAttributeNode(n);return r||(r=y.createAttribute(n),e.setAttributeNode(r)),r.value=t+""}},oe.each(["width","height"],function(e,n){oe.attrHooks[n]=oe.extend(oe.attrHooks[n],{set:function(e,t){if(""===t)return e.setAttribute(n,"auto"),t}})}),oe.attrHooks.contenteditable={get:M.get,set:function(e,t,n){M.set(e,t=""===t?"false":t,n)}}),oe.support.hrefNormalized||oe.each(["href","src","width","height"],function(e,t){oe.attrHooks[t]=oe.extend(oe.attrHooks[t],{get:function(e){e=e.getAttribute(t,2);return null===e?T:e}})}),oe.support.style||(oe.attrHooks.style={get:function(e){return e.style.cssText.toLowerCase()||T},set:function(e,t){return e.style.cssText=""+t}}),oe.support.optSelected||(oe.propHooks.selected=oe.extend(oe.propHooks.selected,{get:function(e){e=e.parentNode;return e&&(e.selectedIndex,e.parentNode&&e.parentNode.selectedIndex),null}})),oe.support.enctype||(oe.propFix.enctype="encoding"),oe.support.checkOn||oe.each(["radio","checkbox"],function(){oe.valHooks[this]={get:function(e){return null===e.getAttribute("value")?"on":e.value}}}),oe.each(["radio","checkbox"],function(){oe.valHooks[this]=oe.extend(oe.valHooks[this],{set:function(e,t){if(oe.isArray(t))return e.checked=0<=oe.inArray(oe(e).val(),t)}})});function z(e){return oe.event.special.hover?e:e.replace(Y,"mouseenter$1 mouseleave$1")}var X=/^(?:textarea|input|select)$/i,U=/^([^\.]*|)(?:\.(.+)|)$/,Y=/(?:^|\s)hover(\.\S+|)\b/,J=/^key/,V=/^(?:mouse|contextmenu)|click/,G=/^(?:focusinfocus|focusoutblur)$/;function Q(){return!1}function K(){return!0}oe.event={add:function(e,t,n,r,i){var o,a,s,l,u,c,f,p,d,h;if(3!==e.nodeType&&8!==e.nodeType&&t&&n&&(o=oe._data(e))){for(n.handler&&(n=(p=n).handler,i=p.selector),n.guid||(n.guid=oe.guid++),(s=o.events)||(o.events=s={}),(a=o.handle)||(o.handle=a=function(e){return void 0===oe||e&&oe.event.triggered===e.type?T:oe.event.dispatch.apply(a.elem,arguments)},a.elem=e),t=oe.trim(z(t)).split(" "),l=0;l<t.length;l++)u=(d=U.exec(t[l])||[])[1],c=(d[2]||"").split(".").sort(),h=oe.event.special[u]||{},u=(i?h.delegateType:h.bindType)||u,h=oe.event.special[u]||{},f=oe.extend({type:u,origType:d[1],data:r,handler:n,guid:n.guid,selector:i,namespace:c.join(".")},p),(d=s[u])||((d=s[u]=[]).delegateCount=0,h.setup&&!1!==h.setup.call(e,r,c,a)||(e.addEventListener?e.addEventListener(u,a,!1):e.attachEvent&&e.attachEvent("on"+u,a))),h.add&&(h.add.call(e,f),f.handler.guid||(f.handler.guid=n.guid)),i?d.splice(d.delegateCount++,0,f):d.push(f),oe.event.global[u]=!0;e=null}},global:{},remove:function(e,t,n,r,i){var o,a,s,l,u,c,f,p,d,h,g=oe.hasData(e)&&oe._data(e);if(g&&(f=g.events)){for(t=oe.trim(z(t||"")).split(" "),o=0;o<t.length;o++)if(a=s=(u=U.exec(t[o])||[])[1],l=u[2],a){for(p=oe.event.special[a]||{},u=(d=f[a=(r?p.delegateType:p.bindType)||a]||[]).length,l=l?new RegExp("(^|\\.)"+l.split(".").sort().join("\\.(?:.*\\.|)")+"(\\.|$)"):null,c=0;c<d.length;c++)h=d[c],!i&&s!==h.origType||n&&n.guid!==h.guid||l&&!l.test(h.namespace)||r&&r!==h.selector&&("**"!==r||!h.selector)||(d.splice(c--,1),h.selector&&d.delegateCount--,p.remove&&p.remove.call(e,h));0===d.length&&u!==d.length&&(p.teardown&&!1!==p.teardown.call(e,l,g.handle)||oe.removeEvent(e,a,g.handle),delete f[a])}else for(a in f)oe.event.remove(e,a+t[o],n,r,!0);oe.isEmptyObject(f)&&(delete g.handle,oe.removeData(e,"events",!0))}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(e,t,n,r){if(!n||3!==n.nodeType&&8!==n.nodeType){var i,o,a,s,l,u,c,f,p,d=e.type||e,h=[];if(!G.test(d+oe.event.triggered)&&(0<=d.indexOf("!")&&(d=d.slice(0,-1),o=!0),0<=d.indexOf(".")&&(d=(h=d.split(".")).shift(),h.sort()),n&&!oe.event.customEvent[d]||oe.event.global[d]))if((e="object"==typeof e?e[oe.expando]?e:new oe.Event(d,e):new oe.Event(d)).type=d,e.isTrigger=!0,e.exclusive=o,e.namespace=h.join("."),e.namespace_re=e.namespace?new RegExp("(^|\\.)"+h.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,u=d.indexOf(":")<0?"on"+d:"",n){if(e.result=T,e.target||(e.target=n),(t=null!=t?oe.makeArray(t):[]).unshift(e),!(h=oe.event.special[d]||{}).trigger||!1!==h.trigger.apply(n,t)){if(f=[[n,h.bindType||d]],!r&&!h.noBubble&&!oe.isWindow(n)){for(p=h.delegateType||d,s=G.test(p+d)?n:n.parentNode,l=n;s;s=s.parentNode)f.push([s,p]),l=s;l===(n.ownerDocument||y)&&f.push([l.defaultView||l.parentWindow||ie,p])}for(a=0;a<f.length&&!e.isPropagationStopped();a++)s=f[a][0],e.type=f[a][1],(c=(oe._data(s,"events")||{})[e.type]&&oe._data(s,"handle"))&&c.apply(s,t),(c=u&&s[u])&&oe.acceptData(s)&&!1===c.apply(s,t)&&e.preventDefault();return e.type=d,r||e.isDefaultPrevented()||h._default&&!1!==h._default.apply(n.ownerDocument,t)||"click"===d&&oe.nodeName(n,"a")||!oe.acceptData(n)||u&&n[d]&&("focus"!==d&&"blur"!==d||0!==e.target.offsetWidth)&&!oe.isWindow(n)&&((l=n[u])&&(n[u]=null),n[oe.event.triggered=d](),oe.event.triggered=T,l&&(n[u]=l)),e.result}}else for(a in i=oe.cache)i[a].events&&i[a].events[d]&&oe.event.trigger(e,t,i[a].handle.elem,!0)}},dispatch:function(e){e=oe.event.fix(e||ie.event);var t,n,r,i,o,a,s,l,u,c,f=(oe._data(this,"events")||{})[e.type]||[],p=f.delegateCount,d=[].slice.call(arguments),h=!e.exclusive&&!e.namespace,g=oe.event.special[e.type]||{},m=[];if((d[0]=e).delegateTarget=this,!g.preDispatch||!1!==g.preDispatch.call(this,e)){if(p&&(!e.button||"click"!==e.type))for((i=oe(this)).context=this,r=e.target;r!=this;r=r.parentNode||this)if(!0!==r.disabled||"click"!==e.type){for(a={},l=[],i[0]=r,t=0;t<p;t++)a[c=(u=f[t]).selector]===T&&(a[c]=i.is(c)),a[c]&&l.push(u);l.length&&m.push({elem:r,matches:l})}for(f.length>p&&m.push({elem:this,matches:f.slice(p)}),t=0;t<m.length&&!e.isPropagationStopped();t++)for(s=m[t],e.currentTarget=s.elem,n=0;n<s.matches.length&&!e.isImmediatePropagationStopped();n++)u=s.matches[n],(h||!e.namespace&&!u.namespace||e.namespace_re&&e.namespace_re.test(u.namespace))&&(e.data=u.data,e.handleObj=u,(o=((oe.event.special[u.origType]||{}).handle||u.handler).apply(s.elem,d))!==T&&!1===(e.result=o)&&(e.preventDefault(),e.stopPropagation()));return g.postDispatch&&g.postDispatch.call(this,e),e.result}},props:"attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(e,t){return null==e.which&&(e.which=null!=t.charCode?t.charCode:t.keyCode),e}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(e,t){var n,r,i=t.button,o=t.fromElement;return null==e.pageX&&null!=t.clientX&&(n=(r=e.target.ownerDocument||y).documentElement,r=r.body,e.pageX=t.clientX+(n&&n.scrollLeft||r&&r.scrollLeft||0)-(n&&n.clientLeft||r&&r.clientLeft||0),e.pageY=t.clientY+(n&&n.scrollTop||r&&r.scrollTop||0)-(n&&n.clientTop||r&&r.clientTop||0)),!e.relatedTarget&&o&&(e.relatedTarget=o===e.target?t.toElement:o),e.which||i===T||(e.which=1&i?1:2&i?3:4&i?2:0),e}},fix:function(e){if(e[oe.expando])return e;var t,n,r=e,i=oe.event.fixHooks[e.type]||{},o=i.props?this.props.concat(i.props):this.props;for(e=oe.Event(r),t=o.length;t;)e[n=o[--t]]=r[n];return e.target||(e.target=r.srcElement||y),3===e.target.nodeType&&(e.target=e.target.parentNode),e.metaKey=!!e.metaKey,i.filter?i.filter(e,r):e},special:{ready:{setup:oe.bindReady},load:{noBubble:!0},focus:{delegateType:"focusin"},blur:{delegateType:"focusout"},beforeunload:{setup:function(e,t,n){oe.isWindow(this)&&(this.onbeforeunload=n)},teardown:function(e,t){this.onbeforeunload===t&&(this.onbeforeunload=null)}}},simulate:function(e,t,n,r){e=oe.extend(new oe.Event,n,{type:e,isSimulated:!0,originalEvent:{}});r?oe.event.trigger(e,null,t):oe.event.dispatch.call(t,e),e.isDefaultPrevented()&&n.preventDefault()}},oe.event.handle=oe.event.dispatch,oe.removeEvent=y.removeEventListener?function(e,t,n){e.removeEventListener&&e.removeEventListener(t,n,!1)}:function(e,t,n){t="on"+t;e.detachEvent&&(void 0===e[t]&&(e[t]=null),e.detachEvent(t,n))},oe.Event=function(e,t){if(!(this instanceof oe.Event))return new oe.Event(e,t);e&&e.type?(this.originalEvent=e,this.type=e.type,this.isDefaultPrevented=e.defaultPrevented||!1===e.returnValue||e.getPreventDefault&&e.getPreventDefault()?K:Q):this.type=e,t&&oe.extend(this,t),this.timeStamp=e&&e.timeStamp||oe.now(),this[oe.expando]=!0},oe.Event.prototype={preventDefault:function(){this.isDefaultPrevented=K;var e=this.originalEvent;e&&(e.preventDefault?e.preventDefault():e.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=K;var e=this.originalEvent;e&&(e.stopPropagation&&e.stopPropagation(),e.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=K,this.stopPropagation()},isDefaultPrevented:Q,isPropagationStopped:Q,isImmediatePropagationStopped:Q},oe.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(e,i){oe.event.special[e]={delegateType:i,bindType:i,handle:function(e){var t,n=e.relatedTarget,r=e.handleObj;r.selector;return n&&(n===this||oe.contains(this,n))||(e.type=r.origType,t=r.handler.apply(this,arguments),e.type=i),t}}}),oe.support.submitBubbles||(oe.event.special.submit={setup:function(){if(oe.nodeName(this,"form"))return!1;oe.event.add(this,"click._submit keypress._submit",function(e){e=e.target,e=oe.nodeName(e,"input")||oe.nodeName(e,"button")?e.form:T;e&&!oe._data(e,"_submit_attached")&&(oe.event.add(e,"submit._submit",function(e){e._submit_bubble=!0}),oe._data(e,"_submit_attached",!0))})},postDispatch:function(e){e._submit_bubble&&(delete e._submit_bubble,this.parentNode&&!e.isTrigger&&oe.event.simulate("submit",this.parentNode,e,!0))},teardown:function(){if(oe.nodeName(this,"form"))return!1;oe.event.remove(this,"._submit")}}),oe.support.changeBubbles||(oe.event.special.change={setup:function(){if(X.test(this.nodeName))return"checkbox"!==this.type&&"radio"!==this.type||(oe.event.add(this,"propertychange._change",function(e){"checked"===e.originalEvent.propertyName&&(this._just_changed=!0)}),oe.event.add(this,"click._change",function(e){this._just_changed&&!e.isTrigger&&(this._just_changed=!1),oe.event.simulate("change",this,e,!0)})),!1;oe.event.add(this,"beforeactivate._change",function(e){e=e.target;X.test(e.nodeName)&&!oe._data(e,"_change_attached")&&(oe.event.add(e,"change._change",function(e){!this.parentNode||e.isSimulated||e.isTrigger||oe.event.simulate("change",this.parentNode,e,!0)}),oe._data(e,"_change_attached",!0))})},handle:function(e){var t=e.target;if(this!==t||e.isSimulated||e.isTrigger||"radio"!==t.type&&"checkbox"!==t.type)return e.handleObj.handler.apply(this,arguments)},teardown:function(){return oe.event.remove(this,"._change"),X.test(this.nodeName)}}),oe.support.focusinBubbles||oe.each({focus:"focusin",blur:"focusout"},function(e,t){function n(e){oe.event.simulate(t,e.target,oe.event.fix(e),!0)}var r=0;oe.event.special[t]={setup:function(){0==r++&&y.addEventListener(e,n,!0)},teardown:function(){0==--r&&y.removeEventListener(e,n,!0)}}}),oe.fn.extend({on:function(e,t,n,r,i){var o,a;if("object"==typeof e){for(a in"string"!=typeof t&&(n=n||t,t=T),e)this.on(a,t,n,e[a],i);return this}if(null==n&&null==r?(r=t,n=t=T):null==r&&("string"==typeof t?(r=n,n=T):(r=n,n=t,t=T)),!1===r)r=Q;else if(!r)return this;return 1===i&&(o=r,(r=function(e){return oe().off(e),o.apply(this,arguments)}).guid=o.guid||(o.guid=oe.guid++)),this.each(function(){oe.event.add(this,e,r,n,t)})},one:function(e,t,n,r){return this.on(e,t,n,r,1)},off:function(e,t,n){var r,i;if(e&&e.preventDefault&&e.handleObj)return r=e.handleObj,oe(e.delegateTarget).off(r.namespace?r.origType+"."+r.namespace:r.origType,r.selector,r.handler),this;if("object"!=typeof e)return!1!==t&&"function"!=typeof t||(n=t,t=T),!1===n&&(n=Q),this.each(function(){oe.event.remove(this,e,n,t)});for(i in e)this.off(i,t,e[i]);return this},bind:function(e,t,n){return this.on(e,null,t,n)},unbind:function(e,t){return this.off(e,null,t)},live:function(e,t,n){return oe(this.context).on(e,this.selector,t,n),this},die:function(e,t){return oe(this.context).off(e,this.selector||"**",t),this},delegate:function(e,t,n,r){return this.on(t,e,n,r)},undelegate:function(e,t,n){return 1==arguments.length?this.off(e,"**"):this.off(t,e||"**",n)},trigger:function(e,t){return this.each(function(){oe.event.trigger(e,t,this)})},triggerHandler:function(e,t){if(this[0])return oe.event.trigger(e,t,this[0],!0)},toggle:function(n){function e(e){var t=(oe._data(this,"lastToggle"+n.guid)||0)%i;return oe._data(this,"lastToggle"+n.guid,1+t),e.preventDefault(),r[t].apply(this,arguments)||!1}var r=arguments,t=n.guid||oe.guid++,i=0;for(e.guid=t;i<r.length;)r[i++].guid=t;return this.click(e)},hover:function(e,t){return this.mouseenter(e).mouseleave(t||e)}}),oe.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(e,n){oe.fn[n]=function(e,t){return null==t&&(t=e,e=null),0<arguments.length?this.on(n,null,e,t):this.trigger(n)},J.test(n)&&(oe.event.fixHooks[n]=oe.event.keyHooks),V.test(n)&&(oe.event.fixHooks[n]=oe.event.mouseHooks)}),function(N){var y,v,r,c,n,h=ie.document,i=h.documentElement,o="undefined",f=!1,a=!0,l=0,b=[].slice,C=[].push,u=("sizcache"+Math.random()).replace(".",""),E="[\\x20\\t\\r\\n\\f]",e="(?:\\\\.|[-\\w]|[^\\x00-\\xa0])+",t=e.replace("w","w#"),s="\\["+E+"*("+e+")"+E+"*(?:([*^$|!~]?=)"+E+"*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|("+t+")|)|)"+E+"*\\]",p=":("+e+")(?:\\((?:(['\"])((?:\\\\.|[^\\\\])*?)\\2|((?:[^,]|\\\\,|(?:,(?=[^\\[]*\\]))|(?:,(?=[^\\(]*\\))))*))\\)|)",d=":(nth|eq|gt|lt|first|last|even|odd)(?:\\((\\d*)\\)|)(?=[^-]|$)",g=E+"*([\\x20\\t\\r\\n\\f>+~])"+E+"*",m="(?=[^\\x20\\t\\r\\n\\f])(?:\\\\.|"+s+"|"+p.replace(2,7)+"|[^\\\\(),])+",x=new RegExp("^"+E+"+|((?:^|[^\\\\])(?:\\\\.)*)"+E+"+$","g"),k=new RegExp("^"+g),w=new RegExp(m+"?(?="+E+"*,|$)","g"),T=new RegExp("^(?:(?!,)(?:(?:^|,)"+E+"*"+m+")*?|"+E+"*(.*?))(\\)|$)"),S=new RegExp(m.slice(19,-6)+"\\x20\\t\\r\\n\\f>+~])+|"+g,"g"),A=/^(?:#([\w\-]+)|(\w+)|\.([\w\-]+))$/,j=/[\x20\t\r\n\f]*[+~]/,D=/:not\($/,L=/h\d/i,H=/input|select|textarea|button/i,F=/\\(?!\\)/g,M={ID:new RegExp("^#("+e+")"),CLASS:new RegExp("^\\.("+e+")"),NAME:new RegExp("^\\[name=['\"]?("+e+")['\"]?\\]"),TAG:new RegExp("^("+e.replace("[-","[-\\*")+")"),ATTR:new RegExp("^"+s),PSEUDO:new RegExp("^"+p),CHILD:new RegExp("^:(only|nth|last|first)-child(?:\\("+E+"*(even|odd|(([+-]|)(\\d*)n|)"+E+"*(?:([+-]|)"+E+"*(\\d+)|))"+E+"*\\)|)","i"),POS:new RegExp(d,"ig"),needsContext:new RegExp("^"+E+"*[>+~]|"+d,"i")},O={},_=[],q={},B=[],t=function(e){return e.sizzleFilter=!0,e},m=function(t){return function(e){return"input"===e.nodeName.toLowerCase()&&e.type===t}},g=function(n){return function(e){var t=e.nodeName.toLowerCase();return("input"===t||"button"===t)&&e.type===n}},e=function(e){var t=!1,n=h.createElement("div");try{t=e(n)}catch(e){}return n=null,t},W=e(function(e){e.innerHTML="<select></select>";e=typeof e.lastChild.getAttribute("multiple");return"boolean"!=e&&"string"!=e}),s=e(function(e){e.id=u+0,e.innerHTML="<a name='"+u+"'></a><div name='"+u+"'></div>",i.insertBefore(e,i.firstChild);var t=h.getElementsByName&&h.getElementsByName(u).length===2+h.getElementsByName(u+0).length;return n=!h.getElementById(u),i.removeChild(e),t}),p=e(function(e){return e.appendChild(h.createComment("")),0===e.getElementsByTagName("*").length}),d=e(function(e){return e.innerHTML="<a href='#'></a>",e.firstChild&&typeof e.firstChild.getAttribute!=o&&"#"===e.firstChild.getAttribute("href")}),P=e(function(e){return e.innerHTML="<div class='hidden e'></div><div class='hidden'></div>",!(!e.getElementsByClassName||0===e.getElementsByClassName("e").length)&&(e.lastChild.className="e",1!==e.getElementsByClassName("e").length)}),R=function(e,t,n,r){n=n||[];var i,o,a,s,l=(t=t||h).nodeType;if(1!==l&&9!==l)return[];if(!e||"string"!=typeof e)return n;if(!(a=I(t))&&!r&&(i=A.exec(e)))if(s=i[1]){if(9===l){if(!(o=t.getElementById(s))||!o.parentNode)return n;if(o.id===s)return n.push(o),n}else if(t.ownerDocument&&(o=t.ownerDocument.getElementById(s))&&z(t,o)&&o.id===s)return n.push(o),n}else{if(i[2])return C.apply(n,b.call(t.getElementsByTagName(e),0)),n;if((s=i[3])&&P&&t.getElementsByClassName)return C.apply(n,b.call(t.getElementsByClassName(s),0)),n}return re(e,t,n,r,a)},$=R.selectors={cacheLength:50,match:M,order:["ID","TAG"],attrHandle:{},createPseudo:t,find:{ID:n?function(e,t,n){if(typeof t.getElementById!=o&&!n){e=t.getElementById(e);return e&&e.parentNode?[e]:[]}}:function(e,t,n){if(typeof t.getElementById!=o&&!n){t=t.getElementById(e);return t?t.id===e||typeof t.getAttributeNode!=o&&t.getAttributeNode("id").value===e?[t]:N:[]}},TAG:p?function(e,t){if(typeof t.getElementsByTagName!=o)return t.getElementsByTagName(e)}:function(e,t){var n=t.getElementsByTagName(e);if("*"!==e)return n;for(var r,i=[],o=0;r=n[o];o++)1===r.nodeType&&i.push(r);return i}},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(F,""),e[3]=(e[4]||e[5]||"").replace(F,""),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1]?(e[2]||R.error(e[0]),e[3]=+(e[3]?e[4]+(e[5]||1):2*("even"===e[2]||"odd"===e[2])),e[4]=+(e[6]+e[7]||"odd"===e[2])):e[2]&&R.error(e[0]),e},PSEUDO:function(e){var t,n=e[4];return M.CHILD.test(e[0])?null:(n&&(t=T.exec(n))&&t.pop()&&(e[0]=e[0].slice(0,t[0].length-n.length-1),n=t[0].slice(0,-1)),e.splice(2,3,n||e[3]),e)}},filter:{ID:n?function(t){return t=t.replace(F,""),function(e){return e.getAttribute("id")===t}}:function(t){return t=t.replace(F,""),function(e){e=typeof e.getAttributeNode!=o&&e.getAttributeNode("id");return e&&e.value===t}},TAG:function(t){return"*"===t?function(){return!0}:(t=t.replace(F,"").toLowerCase(),function(e){return e.nodeName&&e.nodeName.toLowerCase()===t})},CLASS:function(e){var t=O[e];return t||(t=O[e]=new RegExp("(^|"+E+")"+e+"("+E+"|$)"),_.push(e),_.length>$.cacheLength&&delete O[_.shift()]),function(e){return t.test(e.className||typeof e.getAttribute!=o&&e.getAttribute("class")||"")}},ATTR:function(n,r,i){return r?function(e){var e=R.attr(e,n),t=e+"";if(null==e)return"!="===r;switch(r){case"=":return t===i;case"!=":return t!==i;case"^=":return i&&0===t.indexOf(i);case"*=":return i&&-1<t.indexOf(i);case"$=":return i&&t.substr(t.length-i.length)===i;case"~=":return-1<(" "+t+" ").indexOf(i);case"|=":return t===i||t.substr(0,i.length+1)===i+"-"}}:function(e){return null!=R.attr(e,n)}},CHILD:function(n,e,i,o){if("nth"!==n)return function(e){var t=e;switch(n){case"only":case"first":for(;t=t.previousSibling;)if(1===t.nodeType)return!1;if("first"===n)return!0;t=e;case"last":for(;t=t.nextSibling;)if(1===t.nodeType)return!1;return!0}};var a=l++;return function(e){var t,n=0,r=e;if(1===i&&0===o)return!0;if((t=e.parentNode)&&(t[u]!==a||!e.sizset)){for(r=t.firstChild;r&&(1!==r.nodeType||(r.sizset=++n,r!==e));r=r.nextSibling);t[u]=a}return t=e.sizset-o,0===i?0==t:t%i==0&&0<=t/i}},PSEUDO:function(e,t,n,r){var i=$.pseudos[e]||$.pseudos[e.toLowerCase()];return i||R.error("unsupported pseudo: "+e),i.sizzleFilter?i(t,n,r):i}},pseudos:{not:t(function(e,t,n){var r=V(e.replace(x,"$1"),t,n);return function(e){return!r(e)}}),enabled:function(e){return!1===e.disabled},disabled:function(e){return!0===e.disabled},checked:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&!!e.checked||"option"===t&&!!e.selected},selected:function(e){return e.parentNode&&e.parentNode.selectedIndex,!0===e.selected},parent:function(e){return!$.pseudos.empty(e)},empty:function(e){var t;for(e=e.firstChild;e;){if("@"<e.nodeName||3===(t=e.nodeType)||4===t)return!1;e=e.nextSibling}return!0},contains:t(function(t){return function(e){return-1<(e.textContent||e.innerText||X(e)).indexOf(t)}}),has:t(function(t){return function(e){return 0<R(t,e).length}}),header:function(e){return L.test(e.nodeName)},text:function(e){var t;return"input"===e.nodeName.toLowerCase()&&"text"===(t=e.type)&&(null==(e=e.getAttribute("type"))||e.toLowerCase()===t)},radio:m("radio"),checkbox:m("checkbox"),file:m("file"),password:m("password"),image:m("image"),submit:g("submit"),reset:g("reset"),button:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&"button"===e.type||"button"===t},input:function(e){return H.test(e.nodeName)},focus:function(e){var t=e.ownerDocument;return e===t.activeElement&&(!t.hasFocus||t.hasFocus())&&!(!e.type&&!e.href)},active:function(e){return e===e.ownerDocument.activeElement}},setFilters:{first:function(e,t,n){return n?e.slice(1):[e[0]]},last:function(e,t,n){var r=e.pop();return n?e:[r]},even:function(e,t,n){for(var r=[],i=n?1:0,o=e.length;i<o;i+=2)r.push(e[i]);return r},odd:function(e,t,n){for(var r=[],i=n?0:1,o=e.length;i<o;i+=2)r.push(e[i]);return r},lt:function(e,t,n){return n?e.slice(+t):e.slice(0,+t)},gt:function(e,t,n){return n?e.slice(0,+t+1):e.slice(+t+1)},eq:function(e,t,n){t=e.splice(+t,1);return n?e:t}}};$.setFilters.nth=$.setFilters.eq,$.filters=$.pseudos,d||($.attrHandle={href:function(e){return e.getAttribute("href",2)},type:function(e){return e.getAttribute("type")}}),s&&($.order.push("NAME"),$.find.NAME=function(e,t){if(typeof t.getElementsByName!=o)return t.getElementsByName(e)}),P&&($.order.splice(1,0,"CLASS"),$.find.CLASS=function(e,t,n){if(typeof t.getElementsByClassName!=o&&!n)return t.getElementsByClassName(e)});try{b.call(i.childNodes,0)[0].nodeType}catch(e){b=function(e){for(var t,n=[];t=this[e];e++)n.push(t);return n}}var I=R.isXML=function(e){e=e&&(e.ownerDocument||e).documentElement;return!!e&&"HTML"!==e.nodeName},z=R.contains=i.compareDocumentPosition?function(e,t){return!!(16&e.compareDocumentPosition(t))}:i.contains?function(e,t){var n=9===e.nodeType?e.documentElement:e,t=t.parentNode;return e===t||!!(t&&1===t.nodeType&&n.contains&&n.contains(t))}:function(e,t){for(;t=t.parentNode;)if(t===e)return!0;return!1},X=R.getText=function(e){var t,n="",r=0,i=e.nodeType;if(i){if(1===i||9===i||11===i){if("string"==typeof e.textContent)return e.textContent;for(e=e.firstChild;e;e=e.nextSibling)n+=X(e)}else if(3===i||4===i)return e.nodeValue}else for(;t=e[r];r++)n+=X(t);return n};function U(e,t,n,r){for(var i=0,o=t.length;i<o;i++)R(e,t[i],n,r)}function Y(e,t,n,r,i){function o(){for(var e=1,t=arguments.length-2;e<t;e++)arguments[e]===N&&(a[e]=N)}for(var a,s,l,u,c,f,p,d,h,g,m,y,v,b=0,x=i.length,w=M.POS,T=new RegExp("^"+w.source+"(?!"+E+")","i");b<x;b++){for(w.exec(""),e=i[b],l=[],s=0,u=r;a=w.exec(e);)s<(m=w.lastIndex=a.index+a[0].length)&&(c=e.slice(s,a.index),s=m,y=[t],k.test(c)&&(u&&(y=u),u=r),(v=D.test(c))&&(c=c.slice(0,-5).replace(k,"$&*")),1<a.length&&a[0].replace(T,o),f=c,p=a[1],d=a[2],h=y,g=u,m=v,v=y=void 0,(v=$.setFilters[p.toLowerCase()])||R.error(p),!f&&(y=g)||U(f||"*",h,y=[],g),u=0<y.length?v(y,d,m):[]);u?(l=l.concat(u),(c=e.slice(s))&&")"!==c?k.test(c)?U(c,l,n,r):R(c,t,n,r?r.concat(u):u):C.apply(n,l)):R(e,t,n,r)}return 1===x?n:R.uniqueSort(n)}function J(e,t,n){for(var r,i,o=0;r=e[o];o++)i=$.relative[r.part]?function(o,e,t){var a=e.dir,s=l++;return o=o||function(e){return e===t},e.first?function(e,t){for(;e=e[a];)if(1===e.nodeType)return o(e,t)&&e}:function(e,t){for(var n,r=s+"."+v,i=r+"."+y;e=e[a];)if(1===e.nodeType){if((n=e[u])===i)return e.sizset;if("string"==typeof n&&0===n.indexOf(r)){if(e.sizset)return e}else{if(e[u]=i,o(e,t))return e.sizset=!0,e;e.sizset=!1}}}}(i,$.relative[r.part],t):(r.captures.push(t,n),function(r,i){return r?function(e,t){var n=i(e,t);return n&&r(!0===n?e:n,t)}:i}(i,$.filter[r.part].apply(null,r.captures)));return i}R.attr=function(e,t){var n=I(e);return n||(t=t.toLowerCase()),$.attrHandle[t]?$.attrHandle[t](e):W||n?e.getAttribute(t):(n=e.getAttributeNode(t))?"boolean"==typeof e[t]?e[t]?t:null:n.specified?n.value:null:null},R.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)},[0,0].sort(function(){return a=0}),i.compareDocumentPosition?r=function(e,t){return e===t?(f=!0,0):(e.compareDocumentPosition&&t.compareDocumentPosition?4&e.compareDocumentPosition(t):e.compareDocumentPosition)?-1:1}:(r=function(e,t){if(e===t)return f=!0,0;if(e.sourceIndex&&t.sourceIndex)return e.sourceIndex-t.sourceIndex;var n=[],r=[],i=e.parentNode,o=t.parentNode,a=i;if(i===o)return c(e,t);if(!i)return-1;if(!o)return 1;for(;a;)n.unshift(a),a=a.parentNode;for(a=o;a;)r.unshift(a),a=a.parentNode;for(var s=n.length,l=r.length,u=0;u<s&&u<l;u++)if(n[u]!==r[u])return c(n[u],r[u]);return u===s?c(e,r[u],-1):c(n[u],t,1)},c=function(e,t,n){if(e===t)return n;for(var r=e.nextSibling;r;){if(r===t)return-1;r=r.nextSibling}return 1}),R.uniqueSort=function(e){var t,n=1;if(r&&(f=a,e.sort(r),f))for(;t=e[n];n++)t===e[n-1]&&e.splice(n--,1);return e};var V=R.compile=function(e,t,n){var r,i,o,a,s=q[e];if(s&&s.context===t)return s;for(i=function(e,t,n){for(var r,i,o,a=[],s=0,l=T.exec(e),u=!l.pop()&&!l.pop(),c=u&&e.match(w)||[""],f=$.preFilter,p=$.filter,d=!n&&t!==h;null!=(i=c[s])&&u;s++)for(a.push(r=[]),d&&(i=" "+i);i;){for(o in u=!1,(l=k.exec(i))&&(i=i.slice(l[0].length),u=r.push({part:l.pop().replace(x," "),captures:l})),p)!(l=M[o].exec(i))||f[o]&&!(l=f[o](l,t,n))||(i=i.slice(l.shift().length),u=r.push({part:o,captures:l}));if(!u)break}return u||R.error(e),a}(e,t,n),o=0;r=i[o];o++)i[o]=J(r,t,n);return(s=q[e]=(a=i,function(e,t){for(var n,r=0;n=a[r];r++)if(n(e,t))return!0;return!1})).context=t,s.runs=s.dirruns=0,B.push(e),B.length>$.cacheLength&&delete q[B.shift()],s};R.matches=function(e,t){return R(e,null,null,t)},R.matchesSelector=function(e,t){return 0<R(t,null,null,[e]).length};var G,Q,K,Z,ee,te,ne,re=function(e,t,n,r,i){var o,a,s,l,u,c,f,p,d,h=(e=e.replace(x,"$1")).match(w),g=e.match(S),m=t.nodeType;if(M.POS.test(e))return Y(e,t,n,r,h);if(r)o=b.call(r,0);else if(h&&1===h.length){if(1<g.length&&9===m&&!i&&(h=M.ID.exec(g[0]))){if(!(t=$.find.ID(h[1],t,i)[0]))return n;e=e.slice(g.shift().length)}for(p=(h=j.exec(g[0]))&&!h.index&&t.parentNode||t,c=(d=g.pop()).split(":not")[0],s=0,l=$.order.length;s<l;s++)if(f=$.order[s],(h=M[f].exec(c))&&null!=(o=$.find[f]((h[1]||"").replace(F,""),p,i))){c===d&&((e=e.slice(0,e.length-d.length)+c.replace(M[f],""))||C.apply(n,b.call(o,0)));break}}if(e)for(a=V(e,t,i),v=a.dirruns++,null==o&&(o=$.find.TAG("*",j.test(e)&&t.parentNode||t)),s=0;u=o[s];s++)y=a.runs++,a(u,t)&&n.push(u);return n};h.querySelectorAll&&(Q=re,K=/'|\\/g,Z=/\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g,ee=[],te=[":active"],ne=i.matchesSelector||i.mozMatchesSelector||i.webkitMatchesSelector||i.oMatchesSelector||i.msMatchesSelector,e(function(e){e.innerHTML="<select><option selected></option></select>",e.querySelectorAll("[selected]").length||ee.push("\\["+E+"*(?:checked|disabled|ismap|multiple|readonly|selected|value)"),e.querySelectorAll(":checked").length||ee.push(":checked")}),e(function(e){e.innerHTML="<p test=''></p>",e.querySelectorAll("[test^='']").length&&ee.push("[*^$]="+E+"*(?:\"\"|'')"),e.innerHTML="<input type='hidden'>",e.querySelectorAll(":enabled").length||ee.push(":enabled",":disabled")}),ee=ee.length&&new RegExp(ee.join("|")),re=function(e,t,n,r,i){if(!(r||i||ee&&ee.test(e)))if(9===t.nodeType)try{return C.apply(n,b.call(t.querySelectorAll(e),0)),n}catch(e){}else if(1===t.nodeType&&"object"!==t.nodeName.toLowerCase()){var o=t.getAttribute("id"),a=o||u,s=j.test(e)&&t.parentNode||t;o?a=a.replace(K,"\\$&"):t.setAttribute("id",a);try{return C.apply(n,b.call(s.querySelectorAll(e.replace(w,"[id='"+a+"'] $&")),0)),n}catch(e){}finally{o||t.removeAttribute("id")}}return Q(e,t,n,r,i)},ne&&(e(function(e){G=ne.call(e,"div");try{ne.call(e,"[test!='']:sizzle"),te.push($.match.PSEUDO)}catch(e){}}),te=new RegExp(te.join("|")),R.matchesSelector=function(e,t){if(t=t.replace(Z,"='$1']"),!(I(e)||te.test(t)||ee&&ee.test(t)))try{var n=ne.call(e,t);if(n||G||e.document&&11!==e.document.nodeType)return n}catch(e){}return 0<R(t,null,null,[e]).length})),R.attr=oe.attr,oe.find=R,oe.expr=R.selectors,oe.expr[":"]=oe.expr.pseudos,oe.unique=R.uniqueSort,oe.text=R.getText,oe.isXMLDoc=R.isXML,oe.contains=R.contains}();var Z=/Until$/,ee=/^(?:parents|prev(?:Until|All))/,te=/^.[^:#\[\.,]*$/,ne=oe.expr.match.needsContext,re={children:!0,contents:!0,next:!0,prev:!0};function ae(e){return!e||!e.parentNode||11===e.parentNode.nodeType}function se(e,t){for(;(e=e[t])&&1!==e.nodeType;);return e}function le(e,n,r){if(oe.isFunction(n=n||0))return oe.grep(e,function(e,t){return!!n.call(e,t,e)===r});if(n.nodeType)return oe.grep(e,function(e,t){return e===n===r});if("string"==typeof n){var t=oe.grep(e,function(e){return 1===e.nodeType});if(te.test(n))return oe.filter(n,t,!r);n=oe.filter(n,t)}return oe.grep(e,function(e,t){return 0<=oe.inArray(e,n)===r})}function ue(e){var t=fe.split("|"),n=e.createDocumentFragment();if(n.createElement)for(;t.length;)n.createElement(t.pop());return n}oe.fn.extend({find:function(e){var t,n,r,i,o,a,s=this;if("string"!=typeof e)return oe(e).filter(function(){for(t=0,n=s.length;t<n;t++)if(oe.contains(s[t],this))return!0});for(a=this.pushStack("","find",e),t=0,n=this.length;t<n;t++)if(r=a.length,oe.find(e,this[t],a),0<t)for(i=r;i<a.length;i++)for(o=0;o<r;o++)if(a[o]===a[i]){a.splice(i--,1);break}return a},has:function(e){var t,n=oe(e,this),r=n.length;return this.filter(function(){for(t=0;t<r;t++)if(oe.contains(this,n[t]))return!0})},not:function(e){return this.pushStack(le(this,e,!1),"not",e)},filter:function(e){return this.pushStack(le(this,e,!0),"filter",e)},is:function(e){return!!e&&("string"==typeof e?ne.test(e)?0<=oe(e,this.context).index(this[0]):0<oe.filter(e,this).length:0<this.filter(e).length)},closest:function(e,t){for(var n,r=0,i=this.length,o=[],a=ne.test(e)||"string"!=typeof e?oe(e,t||this.context):0;r<i;r++)for(n=this[r];n&&n.ownerDocument&&n!==t&&11!==n.nodeType;){if(a?-1<a.index(n):oe.find.matchesSelector(n,e)){o.push(n);break}n=n.parentNode}return o=1<o.length?oe.unique(o):o,this.pushStack(o,"closest",e)},index:function(e){return e?"string"==typeof e?oe.inArray(this[0],oe(e)):oe.inArray(e.jquery?e[0]:e,this):this[0]&&this[0].parentNode?this.prevAll().length:-1},add:function(e,t){t="string"==typeof e?oe(e,t):oe.makeArray(e&&e.nodeType?[e]:e),e=oe.merge(this.get(),t);return this.pushStack(ae(t[0])||ae(e[0])?e:oe.unique(e))},addBack:function(e){return this.add(null==e?this.prevObject:this.prevObject.filter(e))}}),oe.fn.andSelf=oe.fn.addBack,oe.each({parent:function(e){e=e.parentNode;return e&&11!==e.nodeType?e:null},parents:function(e){return oe.dir(e,"parentNode")},parentsUntil:function(e,t,n){return oe.dir(e,"parentNode",n)},next:function(e){return se(e,"nextSibling")},prev:function(e){return se(e,"previousSibling")},nextAll:function(e){return oe.dir(e,"nextSibling")},prevAll:function(e){return oe.dir(e,"previousSibling")},nextUntil:function(e,t,n){return oe.dir(e,"nextSibling",n)},prevUntil:function(e,t,n){return oe.dir(e,"previousSibling",n)},siblings:function(e){return oe.sibling((e.parentNode||{}).firstChild,e)},children:function(e){return oe.sibling(e.firstChild)},contents:function(e){return oe.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:oe.merge([],e.childNodes)}},function(r,i){oe.fn[r]=function(e,t){var n=oe.map(this,i,e);return(t=!Z.test(r)?e:t)&&"string"==typeof t&&(n=oe.filter(t,n)),n=1<this.length&&!re[r]?oe.unique(n):n,1<this.length&&ee.test(r)&&(n=n.reverse()),this.pushStack(n,r,c.call(arguments).join(","))}}),oe.extend({filter:function(e,t,n){return n&&(e=":not("+e+")"),1===t.length?oe.find.matchesSelector(t[0],e)?[t[0]]:[]:oe.find.matches(e,t)},dir:function(e,t,n){for(var r=[],i=e[t];i&&9!==i.nodeType&&(n===T||1!==i.nodeType||!oe(i).is(n));)1===i.nodeType&&r.push(i),i=i[t];return r},sibling:function(e,t){for(var n=[];e;e=e.nextSibling)1===e.nodeType&&e!==t&&n.push(e);return n}});var ce,fe="abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",pe=/ sQuery\d+="(?:null|\d+)"/g,de=/^\s+/,he=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,ge=/<([\w:]+)/,me=/<tbody/i,ye=/<|&#?\w+;/,ve=/<(?:script|style|link)/i,be=/<(?:script|object|embed|option|style)/i,xe=new RegExp("<(?:"+fe+")[\\s/>]","i"),we=/^(?:checkbox|radio)$/,Te=/checked\s*(?:[^=]|=\s*.checked.)/i,Ne=/\/(java|ecma)script/i,Ce=/^\s*<!(?:\[CDATA\[|\-\-)|[\]\-]{2}>\s*$/g,Ee={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]},ke=ue(y),Se=ke.appendChild(y.createElement("div"));function Ae(e,t){if(1===t.nodeType&&oe.hasData(e)){var n,r,i,o=oe._data(e),e=oe._data(t,o),a=o.events;if(a)for(n in delete e.handle,e.events={},a)for(r=0,i=a[n].length;r<i;r++)oe.event.add(t,n,a[n][r]);e.data&&(e.data=oe.extend({},e.data))}}function je(e,t){var n;1===t.nodeType&&(t.clearAttributes&&t.clearAttributes(),t.mergeAttributes&&t.mergeAttributes(e),"object"===(n=t.nodeName.toLowerCase())?(t.parentNode&&(t.outerHTML=e.outerHTML),oe.support.html5Clone&&e.innerHTML&&!oe.trim(t.innerHTML)&&(t.innerHTML=e.innerHTML)):"input"===n&&we.test(e.type)?(t.defaultChecked=t.checked=e.checked,t.value!==e.value&&(t.value=e.value)):"option"===n?t.selected=e.defaultSelected:"input"===n||"textarea"===n?t.defaultValue=e.defaultValue:"script"===n&&t.text!==e.text&&(t.text=e.text),t.removeAttribute(oe.expando))}function De(e){return void 0!==e.getElementsByTagName?e.getElementsByTagName("*"):void 0!==e.querySelectorAll?e.querySelectorAll("*"):[]}function Le(e){we.test(e.type)&&(e.defaultChecked=e.checked)}Ee.optgroup=Ee.option,Ee.tbody=Ee.tfoot=Ee.colgroup=Ee.caption=Ee.thead,Ee.th=Ee.td,oe.support.htmlSerialize||(Ee._default=[1,"X<div>","</div>"]),oe.fn.extend({text:function(e){return oe.access(this,function(e){return e===T?oe.text(this):this.empty().append((this[0]&&this[0].ownerDocument||y).createTextNode(e))},null,e,arguments.length)},wrapAll:function(t){return oe.isFunction(t)?this.each(function(e){oe(this).wrapAll(t.call(this,e))}):(this[0]&&(e=oe(t,this[0].ownerDocument).eq(0).clone(!0),this[0].parentNode&&e.insertBefore(this[0]),e.map(function(){for(var e=this;e.firstChild&&1===e.firstChild.nodeType;)e=e.firstChild;return e}).append(this)),this);var e},wrapInner:function(n){return oe.isFunction(n)?this.each(function(e){oe(this).wrapInner(n.call(this,e))}):this.each(function(){var e=oe(this),t=e.contents();t.length?t.wrapAll(n):e.append(n)})},wrap:function(t){var n=oe.isFunction(t);return this.each(function(e){oe(this).wrapAll(n?t.call(this,e):t)})},unwrap:function(){return this.parent().each(function(){oe.nodeName(this,"body")||oe(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(e){1!==this.nodeType&&11!==this.nodeType||this.appendChild(e)})},prepend:function(){return this.domManip(arguments,!0,function(e){1!==this.nodeType&&11!==this.nodeType||this.insertBefore(e,this.firstChild)})},before:function(){if(!ae(this[0]))return this.domManip(arguments,!1,function(e){this.parentNode.insertBefore(e,this)});if(arguments.length){var e=oe.clean(arguments);return this.pushStack(oe.merge(e,this),"before",this.selector)}},after:function(){if(!ae(this[0]))return this.domManip(arguments,!1,function(e){this.parentNode.insertBefore(e,this.nextSibling)});if(arguments.length){var e=oe.clean(arguments);return this.pushStack(oe.merge(this,e),"after",this.selector)}},remove:function(e,t){for(var n,r=0;null!=(n=this[r]);r++)e&&!oe.filter(e,[n]).length||(t||1!==n.nodeType||(oe.cleanData(n.getElementsByTagName("*")),oe.cleanData([n])),n.parentNode&&n.parentNode.removeChild(n));return this},empty:function(){for(var e,t=0;null!=(e=this[t]);t++)for(1===e.nodeType&&oe.cleanData(e.getElementsByTagName("*"));e.firstChild;)e.removeChild(e.firstChild);return this},clone:function(e,t){return e=null!=e&&e,t=null==t?e:t,this.map(function(){return oe.clone(this,e,t)})},html:function(e){return oe.access(this,function(e){var t=this[0]||{},n=0,r=this.length;if(e===T)return 1===t.nodeType?t.innerHTML.replace(pe,""):T;if("string"==typeof e&&!ve.test(e)&&(oe.support.htmlSerialize||!xe.test(e))&&(oe.support.leadingWhitespace||!de.test(e))&&!Ee[(ge.exec(e)||["",""])[1].toLowerCase()]){e=e.replace(he,"<$1></$2>");try{for(;n<r;n++)1===(t=this[n]||{}).nodeType&&(oe.cleanData(t.getElementsByTagName("*")),t.innerHTML=e);t=0}catch(e){}}t&&this.empty().append(e)},null,e,arguments.length)},replaceWith:function(r){return ae(this[0])?this.length?this.pushStack(oe(oe.isFunction(r)?r():r),"replaceWith",r):this:oe.isFunction(r)?this.each(function(e){var t=oe(this),n=t.html();t.replaceWith(r.call(this,e,n))}):("string"!=typeof r&&(r=oe(r).detach()),this.each(function(){var e=this.nextSibling,t=this.parentNode;oe(this).remove(),e?oe(e).before(r):oe(t).append(r)}))},detach:function(e){return this.remove(e,!0)},domManip:function(n,r,i){var e,t,o,a,s,l,u=0,c=(n=[].concat.apply([],n))[0],f=[],p=this.length;if(!oe.support.checkClone&&1<p&&"string"==typeof c&&Te.test(c))return this.each(function(){oe(this).domManip(n,r,i)});if(oe.isFunction(c))return this.each(function(e){var t=oe(this);n[0]=c.call(this,e,r?t.html():T),t.domManip(n,r,i)});if(this[0]){if(t=(o=(e=oe.buildFragment(n,this,f)).fragment).firstChild,1===o.childNodes.length&&(o=t),t)for(r=r&&oe.nodeName(t,"tr"),a=e.cacheable||p-1;u<p;u++)i.call(r&&oe.nodeName(this[u],"table")?(s=this[u],l="tbody",s.getElementsByTagName(l)[0]||s.appendChild(s.ownerDocument.createElement(l))):this[u],u===a?o:oe.clone(o,!0,!0));o=t=null,f.length&&oe.each(f,function(e,t){t.src?oe.ajax?oe.ajax({url:t.src,type:"GET",dataType:"script",async:!1,global:!1,throws:!0}):oe.error("no ajax"):oe.globalEval((t.text||t.textContent||t.innerHTML||"").replace(Ce,"")),t.parentNode&&t.parentNode.removeChild(t)})}return this}}),oe.buildFragment=function(e,t,n){var r,i,o,a=e[0];return void 0===(t=((t=t||y)[0]||t).ownerDocument||t[0]||t).createDocumentFragment&&(t=y),!(1===e.length&&"string"==typeof a&&a.length<512&&t===y&&"<"===a.charAt(0))||be.test(a)||!oe.support.checkClone&&Te.test(a)||!oe.support.html5Clone&&xe.test(a)||(i=!0,o=(r=oe.fragments[a])!==T),r||(r=t.createDocumentFragment(),oe.clean(e,t,r,n),i&&(oe.fragments[a]=o&&r)),{fragment:r,cacheable:i}},oe.fragments={},oe.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,s){oe.fn[a]=function(e){var t,n=0,r=[],i=oe(e),o=i.length,e=1===this.length&&this[0].parentNode;if((null==e||e&&11===e.nodeType&&1===e.childNodes.length)&&1===o)return i[s](this[0]),this;for(;n<o;n++)t=(0<n?this.clone(!0):this).get(),oe(i[n])[s](t),r=r.concat(t);return this.pushStack(r,a,i.selector)}}),oe.extend({clone:function(e,t,n){var r,i,o,a;if(oe.support.html5Clone||oe.isXMLDoc(e)||!xe.test("<"+e.nodeName+">")?a=e.cloneNode(!0):(Se.innerHTML=e.outerHTML,Se.removeChild(a=Se.firstChild)),!(oe.support.noCloneEvent&&oe.support.noCloneChecked||1!==e.nodeType&&11!==e.nodeType||oe.isXMLDoc(e)))for(je(e,a),r=De(e),i=De(a),o=0;r[o];++o)i[o]&&je(r[o],i[o]);if(t&&(Ae(e,a),n))for(r=De(e),i=De(a),o=0;r[o];++o)Ae(r[o],i[o]);return r=i=null,a},clean:function(e,t,n,r){for(var i,o,a,s,l,u,c,f,p,d,h=0,g=[],m=(t=!t||void 0===t.createDocumentFragment?y:t)===y&&ke;null!=(o=e[h]);h++)if("number"==typeof o&&(o+=""),o){if("string"==typeof o)if(ye.test(o)){for(m=m||ue(t),u=u||m.appendChild(t.createElement("div")),o=o.replace(he,"<$1></$2>"),a=(ge.exec(o)||["",""])[1].toLowerCase(),l=(s=Ee[a]||Ee._default)[0],u.innerHTML=s[1]+o+s[2];l--;)u=u.lastChild;if(!oe.support.tbody)for(c=me.test(o),i=(f="table"!==a||c?"<table>"!==s[1]||c?[]:u.childNodes:u.firstChild&&u.firstChild.childNodes).length-1;0<=i;--i)oe.nodeName(f[i],"tbody")&&!f[i].childNodes.length&&f[i].parentNode.removeChild(f[i]);!oe.support.leadingWhitespace&&de.test(o)&&u.insertBefore(t.createTextNode(de.exec(o)[0]),u.firstChild),o=u.childNodes,u=m.lastChild}else o=t.createTextNode(o);o.nodeType?g.push(o):g=oe.merge(g,o)}if(u&&(m.removeChild(u),o=u=m=null),!oe.support.appendChecked)for(h=0;null!=(o=g[h]);h++)oe.nodeName(o,"input")?Le(o):void 0!==o.getElementsByTagName&&oe.grep(o.getElementsByTagName("input"),Le);if(n)for(p=function(e){if(!e.type||Ne.test(e.type))return r?r.push(e.parentNode?e.parentNode.removeChild(e):e):n.appendChild(e)},h=0;null!=(o=g[h]);h++)oe.nodeName(o,"script")&&p(o)||(n.appendChild(o),void 0!==o.getElementsByTagName&&(d=oe.grep(oe.merge([],o.getElementsByTagName("script")),p),g.splice.apply(g,[h+1,0].concat(d)),h+=d.length));return g},cleanData:function(e,t){for(var n,r,i,o,a=0,s=oe.expando,l=oe.cache,u=oe.support.deleteExpando,c=oe.event.special;null!=(i=e[a]);a++)if((t||oe.acceptData(i))&&(n=(r=i[s])&&l[r])){if(n.events)for(o in n.events)c[o]?oe.event.remove(i,o):oe.removeEvent(i,o,n.handle);l[r]&&(delete l[r],u?delete i[s]:i.removeAttribute?i.removeAttribute(s):i[s]=null,oe.deletedIds.push(r))}}}),oe.uaMatch=function(e){e=e.toLowerCase();e=/(chrome)[ \/]([\w.]+)/.exec(e)||/(webkit)[ \/]([\w.]+)/.exec(e)||/(opera)(?:.*version|)[ \/]([\w.]+)/.exec(e)||/(msie) ([\w.]+)/.exec(e)||e.indexOf("compatible")<0&&/(mozilla)(?:.*? rv:([\w.]+)|)/.exec(e)||[];return{browser:e[1]||"",version:e[2]||"0"}},ce={},(n=oe.uaMatch(n.userAgent)).browser&&(ce[n.browser]=!0,ce.version=n.version),ce.webkit&&(ce.safari=!0),oe.browser=ce,oe.sub=function(){function n(e,t){return new n.fn.init(e,t)}oe.extend(!0,n,this),n.superclass=this,n.fn=n.prototype=this(),(n.fn.constructor=n).sub=this.sub,n.fn.init=function(e,t){return t&&t instanceof oe&&!(t instanceof n)&&(t=n(t)),oe.fn.init.call(this,e,t,r)},n.fn.init.prototype=n.fn;var r=n(y);return n};var He,Fe,Me,Oe=/alpha\([^)]*\)/i,_e=/opacity=([^)]*)/,qe=/^(top|right|bottom|left)$/,Be=/^margin/,We=new RegExp("^("+p+")(.*)$","i"),Pe=new RegExp("^("+p+")(?!px)[a-z%]+$","i"),Re=new RegExp("^([-+])=("+p+")","i"),$e={},Ie={position:"absolute",visibility:"hidden",display:"block"},ze={letterSpacing:0,fontWeight:400,lineHeight:1},Xe=["Top","Right","Bottom","Left"],Ue=["Webkit","O","Moz","ms"],Ye=oe.fn.toggle;function Je(e,t){if(t in e)return t;for(var n=t.charAt(0).toUpperCase()+t.slice(1),r=t,i=Ue.length;i--;)if((t=Ue[i]+n)in e)return t;return r}function Ve(e,t){return"none"===oe.css(e=t||e,"display")||!oe.contains(e.ownerDocument,e)}function Ge(e,t){for(var n,r,i=[],o=0,a=e.length;o<a;o++)(n=e[o]).style&&(i[o]=oe._data(n,"olddisplay"),t?(i[o]||"none"!==n.style.display||(n.style.display=""),""===n.style.display&&Ve(n)&&(i[o]=oe._data(n,"olddisplay",et(n.nodeName)))):(r=He(n,"display"),i[o]||"none"===r||oe._data(n,"olddisplay",r)));for(o=0;o<a;o++)(n=e[o]).style&&(t&&"none"!==n.style.display&&""!==n.style.display||(n.style.display=t?i[o]||"":"none"));return e}function Qe(e,t,n){var r=We.exec(t);return r?Math.max(0,r[1]-(n||0))+(r[2]||"px"):t}function Ke(e,t,n,r){for(var i=n===(r?"border":"content")?4:"width"===t?1:0,o=0;i<4;i+=2)"margin"===n&&(o+=oe.css(e,n+Xe[i],!0)),r?("content"===n&&(o-=parseFloat(He(e,"padding"+Xe[i]))||0),"margin"!==n&&(o-=parseFloat(He(e,"border"+Xe[i]+"Width"))||0)):(o+=parseFloat(He(e,"padding"+Xe[i]))||0,"padding"!==n&&(o+=parseFloat(He(e,"border"+Xe[i]+"Width"))||0));return o}function Ze(e,t,n){var r="width"===t?e.offsetWidth:e.offsetHeight,i=!0,o=oe.support.boxSizing&&"border-box"===oe.css(e,"boxSizing");if(r<=0){if(((r=He(e,t))<0||null==r)&&(r=e.style[t]),Pe.test(r))return r;i=o&&(oe.support.boxSizingReliable||r===e.style[t]),r=parseFloat(r)||0}return r+Ke(e,t,n||(o?"border":"content"),i)+"px"}function et(e){if($e[e])return $e[e];var t=oe("<"+e+">").appendTo(y.body),n=t.css("display");return t.remove(),"none"!==n&&""!==n||(Fe=y.body.appendChild(Fe||oe.extend(y.createElement("iframe"),{frameBorder:0,width:0,height:0})),Me&&Fe.createElement||((Me=(Fe.contentWindow||Fe.contentDocument).document).write("<!doctype html><html><body>"),Me.close()),t=Me.body.appendChild(Me.createElement(e)),n=He(t,"display"),y.body.removeChild(Fe)),$e[e]=n}oe.fn.extend({css:function(e,t){return oe.access(this,function(e,t,n){return n!==T?oe.style(e,t,n):oe.css(e,t)},e,t,1<arguments.length)},show:function(){return Ge(this,!0)},hide:function(){return Ge(this)},toggle:function(e,t){var n="boolean"==typeof e;return oe.isFunction(e)&&oe.isFunction(t)?Ye.apply(this,arguments):this.each(function(){(n?e:Ve(this))?oe(this).show():oe(this).hide()})}}),oe.extend({cssHooks:{opacity:{get:function(e,t){if(t){e=He(e,"opacity");return""===e?"1":e}}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{float:oe.support.cssFloat?"cssFloat":"styleFloat"},style:function(e,t,n,r){if(e&&3!==e.nodeType&&8!==e.nodeType&&e.style){var i,o,a,s=oe.camelCase(t),l=e.style;if(t=oe.cssProps[s]||(oe.cssProps[s]=Je(l,s)),a=oe.cssHooks[t]||oe.cssHooks[s],n===T)return a&&"get"in a&&(i=a.get(e,!1,r))!==T?i:l[t];if("string"===(o=typeof n)&&(i=Re.exec(n))&&(n=(i[1]+1)*i[2]+parseFloat(oe.css(e,t)),o="number"),!(null==n||"number"===o&&isNaN(n)||("number"!==o||oe.cssNumber[s]||(n+="px"),a&&"set"in a&&(n=a.set(e,n,r))===T)))try{l[t]=n}catch(e){}}},css:function(e,t,n,r){var i,o=oe.camelCase(t);return t=oe.cssProps[o]||(oe.cssProps[o]=Je(e.style,o)),"normal"===(i=(i=(o=oe.cssHooks[t]||oe.cssHooks[o])&&"get"in o?o.get(e,!0,r):i)===T?He(e,t):i)&&t in ze&&(i=ze[t]),n||r!==T?(r=parseFloat(i),n||oe.isNumeric(r)?r||0:i):i},swap:function(e,t,n){var r,i={};for(r in t)i[r]=e.style[r],e.style[r]=t[r];for(r in n=n.call(e),t)e.style[r]=i[r];return n}}),ie.getComputedStyle?He=function(e,t){var n,r,i=getComputedStyle(e,null),o=e.style;return i&&(""!==(n=i[t])||oe.contains(e.ownerDocument.documentElement,e)||(n=oe.style(e,t)),Pe.test(n)&&Be.test(t)&&(r=o.width,e=o.minWidth,t=o.maxWidth,o.minWidth=o.maxWidth=o.width=n,n=i.width,o.width=r,o.minWidth=e,o.maxWidth=t)),n}:y.documentElement.currentStyle&&(He=function(e,t){var n,r,i=e.currentStyle&&e.currentStyle[t],o=e.style;return null==i&&o&&o[t]&&(i=o[t]),Pe.test(i)&&!qe.test(t)&&(n=o.left,(r=e.runtimeStyle&&e.runtimeStyle.left)&&(e.runtimeStyle.left=e.currentStyle.left),o.left="fontSize"===t?"1em":i,i=o.pixelLeft+"px",o.left=n,r&&(e.runtimeStyle.left=r)),""===i?"auto":i}),oe.each(["height","width"],function(e,r){oe.cssHooks[r]={get:function(e,t,n){if(t)return 0!==e.offsetWidth||"none"!==He(e,"display")?Ze(e,r,n):oe.swap(e,Ie,function(){return Ze(e,r,n)})},set:function(e,t,n){return Qe(0,t,n?Ke(e,r,n,oe.support.boxSizing&&"border-box"===oe.css(e,"boxSizing")):0)}}}),oe.support.opacity||(oe.cssHooks.opacity={get:function(e,t){return _e.test((t&&e.currentStyle?e.currentStyle:e.style).filter||"")?.01*parseFloat(RegExp.$1)+"":t?"1":""},set:function(e,t){var n=e.style,r=e.currentStyle,i=oe.isNumeric(t)?"alpha(opacity="+100*t+")":"",e=r&&r.filter||n.filter||"";(n.zoom=1)<=t&&""===oe.trim(e.replace(Oe,""))&&n.removeAttribute&&(n.removeAttribute("filter"),r&&!r.filter)||(n.filter=Oe.test(e)?e.replace(Oe,i):e+" "+i)}}),oe(function(){oe.support.reliableMarginRight||(oe.cssHooks.marginRight={get:function(e,t){return oe.swap(e,{display:"inline-block"},function(){if(t)return He(e,"marginRight")})}}),!oe.support.pixelPosition&&oe.fn.position&&oe.each(["top","left"],function(e,n){oe.cssHooks[n]={get:function(e,t){if(t){t=He(e,n);return Pe.test(t)?oe(e).position()[n]+"px":t}}}})}),oe.expr&&oe.expr.filters&&(oe.expr.filters.hidden=function(e){return 0===e.offsetWidth&&0===e.offsetHeight||!oe.support.reliableHiddenOffsets&&"none"===(e.style&&e.style.display||He(e,"display"))},oe.expr.filters.visible=function(e){return!oe.expr.filters.hidden(e)}),oe.each({margin:"",padding:"",border:"Width"},function(i,o){oe.cssHooks[i+o]={expand:function(e){for(var t="string"==typeof e?e.split(" "):[e],n={},r=0;r<4;r++)n[i+Xe[r]+o]=t[r]||t[r-2]||t[0];return n}},Be.test(i)||(oe.cssHooks[i+o].set=Qe)});var tt=/%20/g,nt=/\[\]$/,rt=/\r?\n/g,it=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,ot=/^(?:select|textarea)/i;oe.fn.extend({serialize:function(){return oe.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?oe.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||ot.test(this.nodeName)||it.test(this.type))}).map(function(e,n){var t=oe(this).val();return null==t?null:oe.isArray(t)?oe.map(t,function(e,t){return{name:n.name,value:e.replace(rt,"\r\n")}}):{name:n.name,value:t.replace(rt,"\r\n")}}).get()}}),oe.param=function(e,t){function n(e,t){t=oe.isFunction(t)?t():null==t?"":t,i[i.length]=encodeURIComponent(e)+"="+encodeURIComponent(t)}var r,i=[];if(t===T&&(t=oe.ajaxSettings&&oe.ajaxSettings.traditional),oe.isArray(e)||e.jquery&&!oe.isPlainObject(e))oe.each(e,function(){n(this.name,this.value)});else for(r in e)!function n(r,e,i,o){if(oe.isArray(e))oe.each(e,function(e,t){i||nt.test(r)?o(r,t):n(r+"["+("object"==typeof t?e:"")+"]",t,i,o)});else if(i||"object"!==oe.type(e))o(r,e);else for(var t in e)n(r+"["+t+"]",e[t],i,o)}(r,e[r],t,n);return i.join("&").replace(tt,"+")};var at,st=/#.*$/,lt=/^(.*?):[ \t]*([^\r\n]*)\r?$/gm,ut=/^(?:GET|HEAD)$/,ct=/^\/\//,ft=/\?/,pt=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,dt=/([?&])_=[^&]*/,ht=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/,gt=oe.fn.load,mt={},yt={},vt=["*/"]+["*"];try{St=e.href}catch(e){(St=y.createElement("a")).href="",St=St.href}function bt(s){return function(e,t){"string"!=typeof e&&(t=e,e="*");var n,r,i=e.toLowerCase().split(N),o=0,a=i.length;if(oe.isFunction(t))for(;o<a;o++)n=i[o],(r=/^\+/.test(n))&&(n=n.substr(1)||"*"),(s[n]=s[n]||[])[r?"unshift":"push"](t)}}function xt(e,t,n,r,i,o){(o=o||{})[i=i||t.dataTypes[0]]=!0;for(var a,s=e[i],l=0,u=s?s.length:0,c=e===mt;l<u&&(c||!a);l++)"string"==typeof(a=s[l](t,n,r))&&(a=!c||o[a]?T:(t.dataTypes.unshift(a),xt(e,t,n,r,a,o)));return a=!(!c&&a||o["*"])?xt(e,t,n,r,"*",o):a}function wt(e,t){var n,r,i=oe.ajaxSettings.flatOptions||{};for(n in t)t[n]!==T&&((i[n]?e:r=r||{})[n]=t[n]);r&&oe.extend(!0,e,r)}at=ht.exec(St.toLowerCase())||[],oe.fn.load=function(e,t,n){if("string"!=typeof e&>)return gt.apply(this,arguments);if(!this.length)return this;var r,i,o,a=this,s=e.indexOf(" ");return 0<=s&&(r=e.slice(s,e.length),e=e.slice(0,s)),oe.isFunction(t)?(n=t,t=T):"object"==typeof t&&(i="POST"),oe.ajax({url:e,type:i,dataType:"html",data:t,complete:function(e,t){n&&a.each(n,o||[e.responseText,t,e])}}).done(function(e){o=arguments,a.html(r?oe("<div>").append(e.replace(pt,"")).find(r):e)}),this},oe.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(e,t){oe.fn[t]=function(e){return this.on(t,e)}}),oe.each(["get","post"],function(e,i){oe[i]=function(e,t,n,r){return oe.isFunction(t)&&(r=r||n,n=t,t=T),oe.ajax({type:i,url:e,data:t,success:n,dataType:r})}}),oe.extend({getScript:function(e,t){return oe.get(e,T,t,"script")},getJSON:function(e,t,n){return oe.get(e,t,n,"json")},ajaxSetup:function(e,t){return t?wt(e,oe.ajaxSettings):(t=e,e=oe.ajaxSettings),wt(e,t),e},ajaxSettings:{url:St,isLocal:/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/.test(at[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded; charset=UTF-8",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":vt},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":ie.String,"text html":!0,"text json":oe.parseJSON,"text xml":oe.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:bt(mt),ajaxTransport:bt(yt),ajax:function(e,t){"object"==typeof e&&(t=e,e=T);var u,c,n,f,p,d,r,i,h=oe.ajaxSetup({},t=t||{}),g=h.context||h,m=g!==h&&(g.nodeType||g instanceof oe)?oe(g):oe.event,y=oe.Deferred(),v=oe.Callbacks("once memory"),b=h.statusCode||{},o={},a={},x=0,s="canceled",w={readyState:0,setRequestHeader:function(e,t){var n;return x||(n=e.toLowerCase(),e=a[n]=a[n]||e,o[e]=t),this},getAllResponseHeaders:function(){return 2===x?c:null},getResponseHeader:function(e){var t;if(2===x){if(!n)for(n={};t=lt.exec(c);)n[t[1].toLowerCase()]=t[2];t=n[e.toLowerCase()]}return t===T?null:t},overrideMimeType:function(e){return x||(h.mimeType=e),this},abort:function(e){return e=e||s,f&&f.abort(e),l(0,e),this}};function l(e,t,n,r){var i,o,a,s,l=t;2!==x&&(x=2,p&&clearTimeout(p),f=T,c=r||"",w.readyState=0<e?4:0,n&&(s=function(e,t,n){var r,i,o,a,s=e.contents,l=e.dataTypes,u=e.responseFields;for(i in u)i in n&&(t[u[i]]=n[i]);for(;"*"===l[0];)l.shift(),r===T&&(r=e.mimeType||t.getResponseHeader("content-type"));if(r)for(i in s)if(s[i]&&s[i].test(r)){l.unshift(i);break}if(l[0]in n)o=l[0];else{for(i in n){if(!l[0]||e.converters[i+" "+l[0]]){o=i;break}a=a||i}o=o||a}if(o)return o!==l[0]&&l.unshift(o),n[o]}(h,w,n)),200<=e&&e<300||304===e?(h.ifModified&&((n=w.getResponseHeader("Last-Modified"))&&(oe.lastModified[u]=n),(n=w.getResponseHeader("Etag"))&&(oe.etag[u]=n)),i=304===e?(l="notmodified",!0):(l=(i=function(e,t){var n,r,i,o,a=e.dataTypes.slice(),s=a[0],l={},u=0;e.dataFilter&&(t=e.dataFilter(t,e.dataType));if(a[1])for(n in e.converters)l[n.toLowerCase()]=e.converters[n];for(;i=a[++u];)if("*"!==i){if("*"!==s&&s!==i){if(!(n=l[s+" "+i]||l["* "+i]))for(r in l)if((o=r.split(" "))[1]===i&&(n=l[s+" "+o[0]]||l["* "+o[0]])){!0===n?n=l[r]:!0!==l[r]&&(i=o[0],a.splice(u--,0,i));break}if(!0!==n)if(n&&e.throws)t=n(t);else try{t=n(t)}catch(e){return{state:"parsererror",error:n?e:"No conversion from "+s+" to "+i}}}s=i}return{state:"success",data:t}}(h,s)).state,o=i.data,!(a=i.error))):(a=l)&&!e||(l="error",e<0&&(e=0)),w.status=e,w.statusText=""+(t||l),i?y.resolveWith(g,[o,l,w]):y.rejectWith(g,[w,l,a]),w.statusCode(b),b=T,d&&m.trigger("ajax"+(i?"Success":"Error"),[w,h,i?o:a]),v.fireWith(g,[w,l]),d&&(m.trigger("ajaxComplete",[w,h]),--oe.active||oe.event.trigger("ajaxStop")))}if(y.promise(w),w.success=w.done,w.error=w.fail,w.complete=v.add,w.statusCode=function(e){if(e)if(x<2)for(var t in e)b[t]=[b[t],e[t]];else t=e[w.status],w.always(t);return this},h.url=((e||h.url)+"").replace(st,"").replace(ct,at[1]+"//"),h.dataTypes=oe.trim(h.dataType||"*").toLowerCase().split(N),null==h.crossDomain&&(i=ht.exec(h.url.toLowerCase()),h.crossDomain=!(!i||i[1]==at[1]&&i[2]==at[2]&&(i[3]||("http:"===i[1]?80:443))==(at[3]||("http:"===at[1]?80:443)))),h.data&&h.processData&&"string"!=typeof h.data&&(h.data=oe.param(h.data,h.traditional)),xt(mt,h,t,w),2===x)return w;for(r in d=h.global,h.type=h.type.toUpperCase(),h.hasContent=!ut.test(h.type),d&&0==oe.active++&&oe.event.trigger("ajaxStart"),h.hasContent||(h.data&&(h.url+=(ft.test(h.url)?"&":"?")+h.data,delete h.data),u=h.url,!1===h.cache&&(e=oe.now(),i=h.url.replace(dt,"$1_="+e),h.url=i+(i===h.url?(ft.test(h.url)?"&":"?")+"_="+e:""))),(h.data&&h.hasContent&&!1!==h.contentType||t.contentType)&&w.setRequestHeader("Content-Type",h.contentType),h.ifModified&&(u=u||h.url,oe.lastModified[u]&&w.setRequestHeader("If-Modified-Since",oe.lastModified[u]),oe.etag[u]&&w.setRequestHeader("If-None-Match",oe.etag[u])),w.setRequestHeader("Accept",h.dataTypes[0]&&h.accepts[h.dataTypes[0]]?h.accepts[h.dataTypes[0]]+("*"!==h.dataTypes[0]?", "+vt+"; q=0.01":""):h.accepts["*"]),h.headers)w.setRequestHeader(r,h.headers[r]);if(h.beforeSend&&(!1===h.beforeSend.call(g,w,h)||2===x))return w.abort();for(r in s="abort",{success:1,error:1,complete:1})w[r](h[r]);if(f=xt(yt,h,t,w)){w.readyState=1,d&&m.trigger("ajaxSend",[w,h]),h.async&&0<h.timeout&&(p=setTimeout(function(){w.abort("timeout")},h.timeout));try{x=1,f.send(o,l)}catch(e){if(!(x<2))throw e;l(-1,e)}}else l(-1,"No Transport");return w},active:0,lastModified:{},etag:{}});var Tt=[],Nt=/\?/,Ct=/(=)\?(?=&|$)|\?\?/,Et=oe.now();oe.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var e=Tt.pop()||oe.expando+"_"+Et++;return this[e]=!0,e}}),oe.ajaxPrefilter("json jsonp",function(e,t,n){var r,i,o,a=e.data,s=e.url,l=!1!==e.jsonp,u=l&&Ct.test(s),c=l&&!u&&"string"==typeof a&&!(e.contentType||"").indexOf("application/x-www-form-urlencoded")&&Ct.test(a);if("jsonp"===e.dataTypes[0]||u||c)return r=e.jsonpCallback=oe.isFunction(e.jsonpCallback)?e.jsonpCallback():e.jsonpCallback,i=ie[r],u?e.url=s.replace(Ct,"$1"+r):c?e.data=a.replace(Ct,"$1"+r):l&&(e.url+=(Nt.test(s)?"&":"?")+e.jsonp+"="+r),e.converters["script json"]=function(){return o||oe.error(r+" was not called"),o[0]},e.dataTypes[0]="json",ie[r]=function(){o=arguments},n.always(function(){ie[r]=i,e[r]&&(e.jsonpCallback=t.jsonpCallback,Tt.push(r)),o&&oe.isFunction(i)&&i(o[0]),o=i=T}),"script"}),oe.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(e){return oe.globalEval(e),e}}}),oe.ajaxPrefilter("script",function(e){e.cache===T&&(e.cache=!1),e.crossDomain&&(e.type="GET",e.global=!1)}),oe.ajaxTransport("script",function(t){if(t.crossDomain){var r,i=y.head||y.getElementsByTagName("head")[0]||y.documentElement;return{send:function(e,n){(r=y.createElement("script")).async="async",t.scriptCharset&&(r.charset=t.scriptCharset),r.src=t.url,r.onload=r.onreadystatechange=function(e,t){!t&&r.readyState&&!/loaded|complete/.test(r.readyState)||(r.onload=r.onreadystatechange=null,i&&r.parentNode&&i.removeChild(r),r=T,t||n(200,"success"))},i.insertBefore(r,i.firstChild)},abort:function(){r&&r.onload(0,1)}}}});var kt,St,At=!!ie.ActiveXObject&&function(){for(var e in kt)kt[e](0,1)},jt=0;function Dt(){try{return new ie.XMLHttpRequest}catch(e){}}oe.ajaxSettings.xhr=ie.ActiveXObject?function(){return!this.isLocal&&Dt()||function(){try{return new ie.ActiveXObject("Microsoft.XMLHTTP")}catch(e){}}()}:Dt,St=oe.ajaxSettings.xhr(),oe.extend(oe.support,{ajax:!!St,cors:!!St&&"withCredentials"in St}),oe.support.ajax&&oe.ajaxTransport(function(c){var f;if(!c.crossDomain||oe.support.cors)return{send:function(e,s){var l,t,u=c.xhr();if(c.username?u.open(c.type,c.url,c.async,c.username,c.password):u.open(c.type,c.url,c.async),c.xhrFields)for(t in c.xhrFields)u[t]=c.xhrFields[t];c.mimeType&&u.overrideMimeType&&u.overrideMimeType(c.mimeType),c.crossDomain||e["X-Requested-With"]||(e["X-Requested-With"]="XMLHttpRequest");try{for(t in e)u.setRequestHeader(t,e[t])}catch(e){}u.send(c.hasContent&&c.data||null),f=function(e,t){var n,r,i,o,a;try{if(f&&(t||4===u.readyState))if(f=T,l&&(u.onreadystatechange=oe.noop,At&&delete kt[l]),t)4!==u.readyState&&u.abort();else{n=u.status,i=u.getAllResponseHeaders(),o={},(a=u.responseXML)&&a.documentElement&&(o.xml=a);try{o.text=u.responseText}catch(e){}try{r=u.statusText}catch(e){r=""}n||!c.isLocal||c.crossDomain?1223===n&&(n=204):n=o.text?200:404}}catch(e){t||s(-1,e)}o&&s(n,r,o,i)},c.async?4===u.readyState?setTimeout(f,0):(l=++jt,At&&(kt||(kt={},oe(ie).unload(At)),kt[l]=f),u.onreadystatechange=f):f()},abort:function(){f&&f(0,1)}}});var Lt,Ht,Ft=/^(?:toggle|show|hide)$/,Mt=new RegExp("^(?:([-+])=|)("+p+")([a-z%]*)$","i"),Ot=/queueHooks$/,_t=[function(t,e,n){var r,i,o,a,s,l,u,c,f=this,p=t.style,d={},h=[],g=t.nodeType&&Ve(t);n.queue||(null==(u=oe._queueHooks(t,"fx")).unqueued&&(u.unqueued=0,c=u.empty.fire,u.empty.fire=function(){u.unqueued||c()}),u.unqueued++,f.always(function(){f.always(function(){u.unqueued--,oe.queue(t,"fx").length||u.empty.fire()})}));1===t.nodeType&&("height"in e||"width"in e)&&(n.overflow=[p.overflow,p.overflowX,p.overflowY],"inline"===oe.css(t,"display")&&"none"===oe.css(t,"float")&&(oe.support.inlineBlockNeedsLayout&&"inline"!==et(t.nodeName)?p.zoom=1:p.display="inline-block"));n.overflow&&(p.overflow="hidden",oe.support.shrinkWrapBlocks||f.done(function(){p.overflow=n.overflow[0],p.overflowX=n.overflow[1],p.overflowY=n.overflow[2]}));for(r in e)o=e[r],Ft.exec(o)&&(delete e[r],o!==(g?"hide":"show")&&h.push(r));if(a=h.length)for(s=oe._data(t,"fxshow")||oe._data(t,"fxshow",{}),g?oe(t).show():f.done(function(){oe(t).hide()}),f.done(function(){for(var e in oe.removeData(t,"fxshow",!0),d)oe.style(t,e,d[e])}),r=0;r<a;r++)i=h[r],l=f.createTween(i,g?s[i]:0),d[i]=s[i]||oe.style(t,i),i in s||(s[i]=l.start,g&&(l.end=l.start,l.start="width"===i||"height"===i?1:0))}],qt={"*":[function(e,t){var n,r,i=this.createTween(e,t),o=Mt.exec(t),a=i.cur(),s=+a||0,l=1;if(o){if(t=+o[2],"px"!==(n=o[3]||(oe.cssNumber[e]?"":"px"))&&s)for(s=oe.css(i.elem,e,!0)||t||1;r=l=l||".5",oe.style(i.elem,e,(s/=l)+n),1!==(l=i.cur()/a)&&l!==r;);i.unit=n,i.start=s,i.end=o[1]?s+(o[1]+1)*t:t}return i}]};function Bt(){return setTimeout(function(){Lt=T},0),Lt=oe.now()}function Wt(i,e,t){var n,o,r=0,a=_t.length,s=oe.Deferred().always(function(){delete l.elem}),l=function(){for(var e=Lt||Bt(),e=Math.max(0,u.startTime+u.duration-e),t=1-(e/u.duration||0),n=0,r=u.tweens.length;n<r;n++)u.tweens[n].run(t);return s.notifyWith(i,[u,t,e]),t<1&&r?e:(s.resolveWith(i,[u]),!1)},u=s.promise({elem:i,props:oe.extend({},e),opts:oe.extend(!0,{specialEasing:{}},t),originalProperties:e,originalOptions:t,startTime:Lt||Bt(),duration:t.duration,tweens:[],createTween:function(e,t,n){e=oe.Tween(i,u.opts,e,t,u.opts.specialEasing[e]||u.opts.easing);return u.tweens.push(e),e},stop:function(e){for(var t=0,n=e?u.tweens.length:0;t<n;t++)u.tweens[t].run(1);return e?s.resolveWith(i,[u,e]):s.rejectWith(i,[u,e]),this}}),c=u.props;for(!function(e,t){var n,r,i,o,a;for(n in e)if(r=oe.camelCase(n),i=t[r],o=e[n],oe.isArray(o)&&(i=o[1],o=e[n]=o[0]),n!==r&&(e[r]=o,delete e[n]),(a=oe.cssHooks[r])&&"expand"in a)for(n in o=a.expand(o),delete e[r],o)n in e||(e[n]=o[n],t[n]=i);else t[r]=i}(c,u.opts.specialEasing);r<a;r++)if(n=_t[r].call(u,i,c,u.opts))return n;return o=u,oe.each(c,function(e,t){for(var n=(qt[e]||[]).concat(qt["*"]),r=0,i=n.length;r<i;r++)if(n[r].call(o,e,t))return}),oe.isFunction(u.opts.start)&&u.opts.start.call(i,u),oe.fx.timer(oe.extend(l,{anim:u,queue:u.opts.queue,elem:i})),u.progress(u.opts.progress).done(u.opts.done,u.opts.complete).fail(u.opts.fail).always(u.opts.always)}function Pt(e,t,n,r,i){return new Pt.prototype.init(e,t,n,r,i)}function Rt(e,t){for(var n,r={height:e},i=0;i<4;i+=2-t)r["margin"+(n=Xe[i])]=r["padding"+n]=e;return t&&(r.opacity=r.width=e),r}oe.Animation=oe.extend(Wt,{tweener:function(e,t){for(var n,r=0,i=(e=oe.isFunction(e)?(t=e,["*"]):e.split(" ")).length;r<i;r++)n=e[r],qt[n]=qt[n]||[],qt[n].unshift(t)},prefilter:function(e,t){t?_t.unshift(e):_t.push(e)}}),(oe.Tween=Pt).prototype={constructor:Pt,init:function(e,t,n,r,i,o){this.elem=e,this.prop=n,this.easing=i||"swing",this.options=t,this.start=this.now=this.cur(),this.end=r,this.unit=o||(oe.cssNumber[n]?"":"px")},cur:function(){var e=Pt.propHooks[this.prop];return(e&&e.get?e:Pt.propHooks._default).get(this)},run:function(e){var t=Pt.propHooks[this.prop];return this.pos=e=oe.easing[this.easing](e,this.options.duration*e,0,1,this.options.duration),this.now=(this.end-this.start)*e+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),(t&&t.set?t:Pt.propHooks._default).set(this),this}},Pt.prototype.init.prototype=Pt.prototype,Pt.propHooks={_default:{get:function(e){var t;return null==e.elem[e.prop]||e.elem.style&&null!=e.elem.style[e.prop]?(t=oe.css(e.elem,e.prop,!1,""))&&"auto"!==t?t:0:e.elem[e.prop]},set:function(e){oe.fx.step[e.prop]?oe.fx.step[e.prop](e):e.elem.style&&(null!=e.elem.style[oe.cssProps[e.prop]]||oe.cssHooks[e.prop])?oe.style(e.elem,e.prop,e.now+e.unit):e.elem[e.prop]=e.now}}},Pt.propHooks.scrollTop=Pt.propHooks.scrollLeft={set:function(e){e.elem.nodeType&&e.elem.parentNode&&(e.elem[e.prop]=e.now)}},oe.each(["toggle","show","hide"],function(r,i){var o=oe.fn[i];oe.fn[i]=function(e,t,n){return null==e||"boolean"==typeof e||!r&&oe.isFunction(e)&&oe.isFunction(t)?o.apply(this,arguments):this.animate(Rt(i,!0),e,t,n)}}),oe.fn.extend({fadeTo:function(e,t,n,r){return this.filter(Ve).css("opacity",0).show().end().animate({opacity:t},e,n,r)},animate:function(t,e,n,r){var i=oe.isEmptyObject(t),o=oe.speed(e,n,r),r=function(){var e=Wt(this,oe.extend({},t),o);i&&e.stop(!0)};return i||!1===o.queue?this.each(r):this.queue(o.queue,r)},stop:function(i,e,o){function a(e){var t=e.stop;delete e.stop,t(o)}return"string"!=typeof i&&(o=e,e=i,i=T),e&&!1!==i&&this.queue(i||"fx",[]),this.each(function(){var e=!0,t=null!=i&&i+"queueHooks",n=oe.timers,r=oe._data(this);if(t)r[t]&&r[t].stop&&a(r[t]);else for(t in r)r[t]&&r[t].stop&&Ot.test(t)&&a(r[t]);for(t=n.length;t--;)n[t].elem!==this||null!=i&&n[t].queue!==i||(n[t].anim.stop(o),e=!1,n.splice(t,1));!e&&o||oe.dequeue(this,i)})}}),oe.each({slideDown:Rt("show"),slideUp:Rt("hide"),slideToggle:Rt("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,r){oe.fn[e]=function(e,t,n){return this.animate(r,e,t,n)}}),oe.speed=function(e,t,n){var r=e&&"object"==typeof e?oe.extend({},e):{complete:n||!n&&t||oe.isFunction(e)&&e,duration:e,easing:n&&t||t&&!oe.isFunction(t)&&t};return r.duration=oe.fx.off?0:"number"==typeof r.duration?r.duration:r.duration in oe.fx.speeds?oe.fx.speeds[r.duration]:oe.fx.speeds._default,null!=r.queue&&!0!==r.queue||(r.queue="fx"),r.old=r.complete,r.complete=function(){oe.isFunction(r.old)&&r.old.call(this),r.queue&&oe.dequeue(this,r.queue)},r},oe.easing={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2}},oe.timers=[],oe.fx=Pt.prototype.init,oe.fx.tick=function(){for(var e,t=oe.timers,n=0;n<t.length;n++)(e=t[n])()||t[n]!==e||t.splice(n--,1);t.length||oe.fx.stop()},oe.fx.timer=function(e){e()&&oe.timers.push(e)&&!Ht&&(Ht=setInterval(oe.fx.tick,oe.fx.interval))},oe.fx.interval=13,oe.fx.stop=function(){clearInterval(Ht),Ht=null},oe.fx.speeds={slow:600,fast:200,_default:400},oe.fx.step={},oe.expr&&oe.expr.filters&&(oe.expr.filters.animated=function(t){return oe.grep(oe.timers,function(e){return t===e.elem}).length});var $t=/^(?:body|html)$/i;function It(e){return oe.isWindow(e)?e:9===e.nodeType&&(e.defaultView||e.parentWindow)}oe.fn.offset=function(t){if(arguments.length)return t===T?this:this.each(function(e){oe.offset.setOffset(this,t,e)});var e,n,r,i,o=this[0],a=o&&o.ownerDocument;return a?(r=a.body)===o?oe.offset.bodyOffset(o):(i=a.documentElement,oe.contains(i,o)?(e=o.getBoundingClientRect(),n=It(a),o=i.clientTop||r.clientTop||0,a=i.clientLeft||r.clientLeft||0,r=n.pageYOffset||i.scrollTop,i=n.pageXOffset||i.scrollLeft,{top:e.top+r-o,left:e.left+i-a}):{top:0,left:0}):void 0},oe.offset={bodyOffset:function(e){var t=e.offsetTop,n=e.offsetLeft;return oe.support.doesNotIncludeMarginInBodyOffset&&(t+=parseFloat(oe.css(e,"marginTop"))||0,n+=parseFloat(oe.css(e,"marginLeft"))||0),{top:t,left:n}},setOffset:function(e,t,n){var r=oe.css(e,"position");"static"===r&&(e.style.position="relative");var i,o,a=oe(e),s=a.offset(),l=oe.css(e,"top"),u=oe.css(e,"left"),c={},u=("absolute"===r||"fixed"===r)&&-1<oe.inArray("auto",[l,u])?(o=(i=a.position()).top,i.left):(o=parseFloat(l)||0,parseFloat(u)||0);null!=(t=oe.isFunction(t)?t.call(e,n,s):t).top&&(c.top=t.top-s.top+o),null!=t.left&&(c.left=t.left-s.left+u),"using"in t?t.using.call(e,c):a.css(c)}},oe.fn.extend({position:function(){if(this[0]){var e=this[0],t=this.offsetParent(),n=this.offset(),r=$t.test(t[0].nodeName)?{top:0,left:0}:t.offset();return n.top-=parseFloat(oe.css(e,"marginTop"))||0,n.left-=parseFloat(oe.css(e,"marginLeft"))||0,r.top+=parseFloat(oe.css(t[0],"borderTopWidth"))||0,r.left+=parseFloat(oe.css(t[0],"borderLeftWidth"))||0,{top:n.top-r.top,left:n.left-r.left}}},offsetParent:function(){return this.map(function(){for(var e=this.offsetParent||y.body;e&&!$t.test(e.nodeName)&&"static"===oe.css(e,"position");)e=e.offsetParent;return e||y.body})}}),oe.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(t,i){var o=/Y/.test(i);oe.fn[t]=function(e){return oe.access(this,function(e,t,n){var r=It(e);if(n===T)return r?i in r?r[i]:r.document.documentElement[t]:e[t];r?r.scrollTo(o?oe(r).scrollLeft():n,o?n:oe(r).scrollTop()):e[t]=n},t,e,arguments.length,null)}}),oe.each({Height:"height",Width:"width"},function(o,a){oe.each({padding:"inner"+o,content:a,"":"outer"+o},function(r,e){oe.fn[e]=function(e,t){var n=arguments.length&&(r||"boolean"!=typeof e),i=r||(!0===e||!0===t?"margin":"border");return oe.access(this,function(e,t,n){var r;return oe.isWindow(e)?e.document.documentElement["client"+o]:9===e.nodeType?(r=e.documentElement,Math.max(e.body["scroll"+o],r["scroll"+o],e.body["offset"+o],r["offset"+o],r["client"+o])):n===T?oe.css(e,t,n,i):oe.style(e,t,n,i)},a,n?e:T,n)}})}),ie.sQuery=oe,"function"==typeof define&&define.amd&&define.amd.sQuery&&define("jquery",[],function(){return oe})}(window);
|
assets/js/jquery_ui_custom.js
DELETED
|
@@ -1,2353 +0,0 @@
|
|
| 1 |
-
/*! jQuery UI - v1.9.2 - 2012-12-18
|
| 2 |
-
* http://jqueryui.com
|
| 3 |
-
* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.position.js, jquery.ui.draggable.js
|
| 4 |
-
* Copyright (c) 2012 jQuery Foundation and other contributors Licensed MIT */
|
| 5 |
-
|
| 6 |
-
(function( $, undefined ) {
|
| 7 |
-
|
| 8 |
-
var uuid = 0,
|
| 9 |
-
runiqueId = /^ui-id-\d+$/;
|
| 10 |
-
|
| 11 |
-
// prevent duplicate loading
|
| 12 |
-
// this is only a problem because we proxy existing functions
|
| 13 |
-
// and we don't want to double proxy them
|
| 14 |
-
$.ui = $.ui || {};
|
| 15 |
-
if ( $.ui.version ) {
|
| 16 |
-
return;
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
$.extend( $.ui, {
|
| 20 |
-
version: "1.9.2",
|
| 21 |
-
|
| 22 |
-
keyCode: {
|
| 23 |
-
BACKSPACE: 8,
|
| 24 |
-
COMMA: 188,
|
| 25 |
-
DELETE: 46,
|
| 26 |
-
DOWN: 40,
|
| 27 |
-
END: 35,
|
| 28 |
-
ENTER: 13,
|
| 29 |
-
ESCAPE: 27,
|
| 30 |
-
HOME: 36,
|
| 31 |
-
LEFT: 37,
|
| 32 |
-
NUMPAD_ADD: 107,
|
| 33 |
-
NUMPAD_DECIMAL: 110,
|
| 34 |
-
NUMPAD_DIVIDE: 111,
|
| 35 |
-
NUMPAD_ENTER: 108,
|
| 36 |
-
NUMPAD_MULTIPLY: 106,
|
| 37 |
-
NUMPAD_SUBTRACT: 109,
|
| 38 |
-
PAGE_DOWN: 34,
|
| 39 |
-
PAGE_UP: 33,
|
| 40 |
-
PERIOD: 190,
|
| 41 |
-
RIGHT: 39,
|
| 42 |
-
SPACE: 32,
|
| 43 |
-
TAB: 9,
|
| 44 |
-
UP: 38
|
| 45 |
-
}
|
| 46 |
-
});
|
| 47 |
-
|
| 48 |
-
// plugins
|
| 49 |
-
$.fn.extend({
|
| 50 |
-
_focus: $.fn.focus,
|
| 51 |
-
focus: function( delay, fn ) {
|
| 52 |
-
return typeof delay === "number" ?
|
| 53 |
-
this.each(function() {
|
| 54 |
-
var elem = this;
|
| 55 |
-
setTimeout(function() {
|
| 56 |
-
$( elem ).focus();
|
| 57 |
-
if ( fn ) {
|
| 58 |
-
fn.call( elem );
|
| 59 |
-
}
|
| 60 |
-
}, delay );
|
| 61 |
-
}) :
|
| 62 |
-
this._focus.apply( this, arguments );
|
| 63 |
-
},
|
| 64 |
-
|
| 65 |
-
scrollParent: function() {
|
| 66 |
-
var scrollParent;
|
| 67 |
-
if (($.ui.ie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
|
| 68 |
-
scrollParent = this.parents().filter(function() {
|
| 69 |
-
return (/(relative|absolute|fixed)/).test($.css(this,'position')) && (/(auto|scroll)/).test($.css(this,'overflow')+$.css(this,'overflow-y')+$.css(this,'overflow-x'));
|
| 70 |
-
}).eq(0);
|
| 71 |
-
} else {
|
| 72 |
-
scrollParent = this.parents().filter(function() {
|
| 73 |
-
return (/(auto|scroll)/).test($.css(this,'overflow')+$.css(this,'overflow-y')+$.css(this,'overflow-x'));
|
| 74 |
-
}).eq(0);
|
| 75 |
-
}
|
| 76 |
-
|
| 77 |
-
return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
|
| 78 |
-
},
|
| 79 |
-
|
| 80 |
-
zIndex: function( zIndex ) {
|
| 81 |
-
if ( zIndex !== undefined ) {
|
| 82 |
-
return this.css( "zIndex", zIndex );
|
| 83 |
-
}
|
| 84 |
-
|
| 85 |
-
if ( this.length ) {
|
| 86 |
-
var elem = $( this[ 0 ] ), position, value;
|
| 87 |
-
while ( elem.length && elem[ 0 ] !== document ) {
|
| 88 |
-
// Ignore z-index if position is set to a value where z-index is ignored by the browser
|
| 89 |
-
// This makes behavior of this function consistent across browsers
|
| 90 |
-
// WebKit always returns auto if the element is positioned
|
| 91 |
-
position = elem.css( "position" );
|
| 92 |
-
if ( position === "absolute" || position === "relative" || position === "fixed" ) {
|
| 93 |
-
// IE returns 0 when zIndex is not specified
|
| 94 |
-
// other browsers return a string
|
| 95 |
-
// we ignore the case of nested elements with an explicit value of 0
|
| 96 |
-
// <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
|
| 97 |
-
value = parseInt( elem.css( "zIndex" ), 10 );
|
| 98 |
-
if ( !isNaN( value ) && value !== 0 ) {
|
| 99 |
-
return value;
|
| 100 |
-
}
|
| 101 |
-
}
|
| 102 |
-
elem = elem.parent();
|
| 103 |
-
}
|
| 104 |
-
}
|
| 105 |
-
|
| 106 |
-
return 0;
|
| 107 |
-
},
|
| 108 |
-
|
| 109 |
-
uniqueId: function() {
|
| 110 |
-
return this.each(function() {
|
| 111 |
-
if ( !this.id ) {
|
| 112 |
-
this.id = "ui-id-" + (++uuid);
|
| 113 |
-
}
|
| 114 |
-
});
|
| 115 |
-
},
|
| 116 |
-
|
| 117 |
-
removeUniqueId: function() {
|
| 118 |
-
return this.each(function() {
|
| 119 |
-
if ( runiqueId.test( this.id ) ) {
|
| 120 |
-
$( this ).removeAttr( "id" );
|
| 121 |
-
}
|
| 122 |
-
});
|
| 123 |
-
}
|
| 124 |
-
});
|
| 125 |
-
|
| 126 |
-
// selectors
|
| 127 |
-
function focusable( element, isTabIndexNotNaN ) {
|
| 128 |
-
var map, mapName, img,
|
| 129 |
-
nodeName = element.nodeName.toLowerCase();
|
| 130 |
-
if ( "area" === nodeName ) {
|
| 131 |
-
map = element.parentNode;
|
| 132 |
-
mapName = map.name;
|
| 133 |
-
if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
|
| 134 |
-
return false;
|
| 135 |
-
}
|
| 136 |
-
img = $( "img[usemap=#" + mapName + "]" )[0];
|
| 137 |
-
return !!img && visible( img );
|
| 138 |
-
}
|
| 139 |
-
return ( /input|select|textarea|button|object/.test( nodeName ) ?
|
| 140 |
-
!element.disabled :
|
| 141 |
-
"a" === nodeName ?
|
| 142 |
-
element.href || isTabIndexNotNaN :
|
| 143 |
-
isTabIndexNotNaN) &&
|
| 144 |
-
// the element and all of its ancestors must be visible
|
| 145 |
-
visible( element );
|
| 146 |
-
}
|
| 147 |
-
|
| 148 |
-
function visible( element ) {
|
| 149 |
-
return $.expr.filters.visible( element ) &&
|
| 150 |
-
!$( element ).parents().andSelf().filter(function() {
|
| 151 |
-
return $.css( this, "visibility" ) === "hidden";
|
| 152 |
-
}).length;
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
$.extend( $.expr[ ":" ], {
|
| 156 |
-
data: $.expr.createPseudo ?
|
| 157 |
-
$.expr.createPseudo(function( dataName ) {
|
| 158 |
-
return function( elem ) {
|
| 159 |
-
return !!$.data( elem, dataName );
|
| 160 |
-
};
|
| 161 |
-
}) :
|
| 162 |
-
// support: jQuery <1.8
|
| 163 |
-
function( elem, i, match ) {
|
| 164 |
-
return !!$.data( elem, match[ 3 ] );
|
| 165 |
-
},
|
| 166 |
-
|
| 167 |
-
focusable: function( element ) {
|
| 168 |
-
return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) );
|
| 169 |
-
},
|
| 170 |
-
|
| 171 |
-
tabbable: function( element ) {
|
| 172 |
-
var tabIndex = $.attr( element, "tabindex" ),
|
| 173 |
-
isTabIndexNaN = isNaN( tabIndex );
|
| 174 |
-
return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN );
|
| 175 |
-
}
|
| 176 |
-
});
|
| 177 |
-
|
| 178 |
-
// support
|
| 179 |
-
$(function() {
|
| 180 |
-
var body = document.body,
|
| 181 |
-
div = body.appendChild( div = document.createElement( "div" ) );
|
| 182 |
-
|
| 183 |
-
// access offsetHeight before setting the style to prevent a layout bug
|
| 184 |
-
// in IE 9 which causes the element to continue to take up space even
|
| 185 |
-
// after it is removed from the DOM (#8026)
|
| 186 |
-
div.offsetHeight;
|
| 187 |
-
|
| 188 |
-
$.extend( div.style, {
|
| 189 |
-
minHeight: "100px",
|
| 190 |
-
height: "auto",
|
| 191 |
-
padding: 0,
|
| 192 |
-
borderWidth: 0
|
| 193 |
-
});
|
| 194 |
-
|
| 195 |
-
$.support.minHeight = div.offsetHeight === 100;
|
| 196 |
-
$.support.selectstart = "onselectstart" in div;
|
| 197 |
-
|
| 198 |
-
// set display to none to avoid a layout bug in IE
|
| 199 |
-
// http://dev.jquery.com/ticket/4014
|
| 200 |
-
body.removeChild( div ).style.display = "none";
|
| 201 |
-
});
|
| 202 |
-
|
| 203 |
-
// support: jQuery <1.8
|
| 204 |
-
if ( !$( "<a>" ).outerWidth( 1 ).jquery ) {
|
| 205 |
-
$.each( [ "Width", "Height" ], function( i, name ) {
|
| 206 |
-
var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
|
| 207 |
-
type = name.toLowerCase(),
|
| 208 |
-
orig = {
|
| 209 |
-
innerWidth: $.fn.innerWidth,
|
| 210 |
-
innerHeight: $.fn.innerHeight,
|
| 211 |
-
outerWidth: $.fn.outerWidth,
|
| 212 |
-
outerHeight: $.fn.outerHeight
|
| 213 |
-
};
|
| 214 |
-
|
| 215 |
-
function reduce( elem, size, border, margin ) {
|
| 216 |
-
$.each( side, function() {
|
| 217 |
-
size -= parseFloat( $.css( elem, "padding" + this ) ) || 0;
|
| 218 |
-
if ( border ) {
|
| 219 |
-
size -= parseFloat( $.css( elem, "border" + this + "Width" ) ) || 0;
|
| 220 |
-
}
|
| 221 |
-
if ( margin ) {
|
| 222 |
-
size -= parseFloat( $.css( elem, "margin" + this ) ) || 0;
|
| 223 |
-
}
|
| 224 |
-
});
|
| 225 |
-
return size;
|
| 226 |
-
}
|
| 227 |
-
|
| 228 |
-
$.fn[ "inner" + name ] = function( size ) {
|
| 229 |
-
if ( size === undefined ) {
|
| 230 |
-
return orig[ "inner" + name ].call( this );
|
| 231 |
-
}
|
| 232 |
-
|
| 233 |
-
return this.each(function() {
|
| 234 |
-
$( this ).css( type, reduce( this, size ) + "px" );
|
| 235 |
-
});
|
| 236 |
-
};
|
| 237 |
-
|
| 238 |
-
$.fn[ "outer" + name] = function( size, margin ) {
|
| 239 |
-
if ( typeof size !== "number" ) {
|
| 240 |
-
return orig[ "outer" + name ].call( this, size );
|
| 241 |
-
}
|
| 242 |
-
|
| 243 |
-
return this.each(function() {
|
| 244 |
-
$( this).css( type, reduce( this, size, true, margin ) + "px" );
|
| 245 |
-
});
|
| 246 |
-
};
|
| 247 |
-
});
|
| 248 |
-
}
|
| 249 |
-
|
| 250 |
-
// support: jQuery 1.6.1, 1.6.2 (http://bugs.jquery.com/ticket/9413)
|
| 251 |
-
if ( $( "<a>" ).data( "a-b", "a" ).removeData( "a-b" ).data( "a-b" ) ) {
|
| 252 |
-
$.fn.removeData = (function( removeData ) {
|
| 253 |
-
return function( key ) {
|
| 254 |
-
if ( arguments.length ) {
|
| 255 |
-
return removeData.call( this, $.camelCase( key ) );
|
| 256 |
-
} else {
|
| 257 |
-
return removeData.call( this );
|
| 258 |
-
}
|
| 259 |
-
};
|
| 260 |
-
})( $.fn.removeData );
|
| 261 |
-
}
|
| 262 |
-
|
| 263 |
-
|
| 264 |
-
|
| 265 |
-
|
| 266 |
-
|
| 267 |
-
// deprecated
|
| 268 |
-
|
| 269 |
-
(function() {
|
| 270 |
-
var uaMatch = /msie ([\w.]+)/.exec( navigator.userAgent.toLowerCase() ) || [];
|
| 271 |
-
$.ui.ie = uaMatch.length ? true : false;
|
| 272 |
-
$.ui.ie6 = parseFloat( uaMatch[ 1 ], 10 ) === 6;
|
| 273 |
-
})();
|
| 274 |
-
|
| 275 |
-
$.fn.extend({
|
| 276 |
-
disableSelection: function() {
|
| 277 |
-
return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) +
|
| 278 |
-
".ui-disableSelection", function( event ) {
|
| 279 |
-
event.preventDefault();
|
| 280 |
-
});
|
| 281 |
-
},
|
| 282 |
-
|
| 283 |
-
enableSelection: function() {
|
| 284 |
-
return this.unbind( ".ui-disableSelection" );
|
| 285 |
-
}
|
| 286 |
-
});
|
| 287 |
-
|
| 288 |
-
$.extend( $.ui, {
|
| 289 |
-
// $.ui.plugin is deprecated. Use the proxy pattern instead.
|
| 290 |
-
plugin: {
|
| 291 |
-
add: function( module, option, set ) {
|
| 292 |
-
var i,
|
| 293 |
-
proto = $.ui[ module ].prototype;
|
| 294 |
-
for ( i in set ) {
|
| 295 |
-
proto.plugins[ i ] = proto.plugins[ i ] || [];
|
| 296 |
-
proto.plugins[ i ].push( [ option, set[ i ] ] );
|
| 297 |
-
}
|
| 298 |
-
},
|
| 299 |
-
call: function( instance, name, args ) {
|
| 300 |
-
var i,
|
| 301 |
-
set = instance.plugins[ name ];
|
| 302 |
-
if ( !set || !instance.element[ 0 ].parentNode || instance.element[ 0 ].parentNode.nodeType === 11 ) {
|
| 303 |
-
return;
|
| 304 |
-
}
|
| 305 |
-
|
| 306 |
-
for ( i = 0; i < set.length; i++ ) {
|
| 307 |
-
if ( instance.options[ set[ i ][ 0 ] ] ) {
|
| 308 |
-
set[ i ][ 1 ].apply( instance.element, args );
|
| 309 |
-
}
|
| 310 |
-
}
|
| 311 |
-
}
|
| 312 |
-
},
|
| 313 |
-
|
| 314 |
-
contains: $.contains,
|
| 315 |
-
|
| 316 |
-
// only used by resizable
|
| 317 |
-
hasScroll: function( el, a ) {
|
| 318 |
-
|
| 319 |
-
//If overflow is hidden, the element might have extra content, but the user wants to hide it
|
| 320 |
-
if ( $( el ).css( "overflow" ) === "hidden") {
|
| 321 |
-
return false;
|
| 322 |
-
}
|
| 323 |
-
|
| 324 |
-
var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
|
| 325 |
-
has = false;
|
| 326 |
-
|
| 327 |
-
if ( el[ scroll ] > 0 ) {
|
| 328 |
-
return true;
|
| 329 |
-
}
|
| 330 |
-
|
| 331 |
-
// TODO: determine which cases actually cause this to happen
|
| 332 |
-
// if the element doesn't have the scroll set, see if it's possible to
|
| 333 |
-
// set the scroll
|
| 334 |
-
el[ scroll ] = 1;
|
| 335 |
-
has = ( el[ scroll ] > 0 );
|
| 336 |
-
el[ scroll ] = 0;
|
| 337 |
-
return has;
|
| 338 |
-
},
|
| 339 |
-
|
| 340 |
-
// these are odd functions, fix the API or move into individual plugins
|
| 341 |
-
isOverAxis: function( x, reference, size ) {
|
| 342 |
-
//Determines when x coordinate is over "b" element axis
|
| 343 |
-
return ( x > reference ) && ( x < ( reference + size ) );
|
| 344 |
-
},
|
| 345 |
-
isOver: function( y, x, top, left, height, width ) {
|
| 346 |
-
//Determines when x, y coordinates is over "b" element
|
| 347 |
-
return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width );
|
| 348 |
-
}
|
| 349 |
-
});
|
| 350 |
-
|
| 351 |
-
})( sQuery );
|
| 352 |
-
(function( $, undefined ) {
|
| 353 |
-
|
| 354 |
-
var uuid = 0,
|
| 355 |
-
slice = Array.prototype.slice,
|
| 356 |
-
_cleanData = $.cleanData;
|
| 357 |
-
$.cleanData = function( elems ) {
|
| 358 |
-
for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
|
| 359 |
-
try {
|
| 360 |
-
$( elem ).triggerHandler( "remove" );
|
| 361 |
-
// http://bugs.jquery.com/ticket/8235
|
| 362 |
-
} catch( e ) {}
|
| 363 |
-
}
|
| 364 |
-
_cleanData( elems );
|
| 365 |
-
};
|
| 366 |
-
|
| 367 |
-
$.widget = function( name, base, prototype ) {
|
| 368 |
-
var fullName, existingConstructor, constructor, basePrototype,
|
| 369 |
-
namespace = name.split( "." )[ 0 ];
|
| 370 |
-
|
| 371 |
-
name = name.split( "." )[ 1 ];
|
| 372 |
-
fullName = namespace + "-" + name;
|
| 373 |
-
|
| 374 |
-
if ( !prototype ) {
|
| 375 |
-
prototype = base;
|
| 376 |
-
base = $.Widget;
|
| 377 |
-
}
|
| 378 |
-
|
| 379 |
-
// create selector for plugin
|
| 380 |
-
$.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) {
|
| 381 |
-
return !!$.data( elem, fullName );
|
| 382 |
-
};
|
| 383 |
-
|
| 384 |
-
$[ namespace ] = $[ namespace ] || {};
|
| 385 |
-
existingConstructor = $[ namespace ][ name ];
|
| 386 |
-
constructor = $[ namespace ][ name ] = function( options, element ) {
|
| 387 |
-
// allow instantiation without "new" keyword
|
| 388 |
-
if ( !this._createWidget ) {
|
| 389 |
-
return new constructor( options, element );
|
| 390 |
-
}
|
| 391 |
-
|
| 392 |
-
// allow instantiation without initializing for simple inheritance
|
| 393 |
-
// must use "new" keyword (the code above always passes args)
|
| 394 |
-
if ( arguments.length ) {
|
| 395 |
-
this._createWidget( options, element );
|
| 396 |
-
}
|
| 397 |
-
};
|
| 398 |
-
// extend with the existing constructor to carry over any static properties
|
| 399 |
-
$.extend( constructor, existingConstructor, {
|
| 400 |
-
version: prototype.version,
|
| 401 |
-
// copy the object used to create the prototype in case we need to
|
| 402 |
-
// redefine the widget later
|
| 403 |
-
_proto: $.extend( {}, prototype ),
|
| 404 |
-
// track widgets that inherit from this widget in case this widget is
|
| 405 |
-
// redefined after a widget inherits from it
|
| 406 |
-
_childConstructors: []
|
| 407 |
-
});
|
| 408 |
-
|
| 409 |
-
basePrototype = new base();
|
| 410 |
-
// we need to make the options hash a property directly on the new instance
|
| 411 |
-
// otherwise we'll modify the options hash on the prototype that we're
|
| 412 |
-
// inheriting from
|
| 413 |
-
basePrototype.options = $.widget.extend( {}, basePrototype.options );
|
| 414 |
-
$.each( prototype, function( prop, value ) {
|
| 415 |
-
if ( $.isFunction( value ) ) {
|
| 416 |
-
prototype[ prop ] = (function() {
|
| 417 |
-
var _super = function() {
|
| 418 |
-
return base.prototype[ prop ].apply( this, arguments );
|
| 419 |
-
},
|
| 420 |
-
_superApply = function( args ) {
|
| 421 |
-
return base.prototype[ prop ].apply( this, args );
|
| 422 |
-
};
|
| 423 |
-
return function() {
|
| 424 |
-
var __super = this._super,
|
| 425 |
-
__superApply = this._superApply,
|
| 426 |
-
returnValue;
|
| 427 |
-
|
| 428 |
-
this._super = _super;
|
| 429 |
-
this._superApply = _superApply;
|
| 430 |
-
|
| 431 |
-
returnValue = value.apply( this, arguments );
|
| 432 |
-
|
| 433 |
-
this._super = __super;
|
| 434 |
-
this._superApply = __superApply;
|
| 435 |
-
|
| 436 |
-
return returnValue;
|
| 437 |
-
};
|
| 438 |
-
})();
|
| 439 |
-
}
|
| 440 |
-
});
|
| 441 |
-
constructor.prototype = $.widget.extend( basePrototype, {
|
| 442 |
-
// TODO: remove support for widgetEventPrefix
|
| 443 |
-
// always use the name + a colon as the prefix, e.g., draggable:start
|
| 444 |
-
// don't prefix for widgets that aren't DOM-based
|
| 445 |
-
widgetEventPrefix: existingConstructor ? basePrototype.widgetEventPrefix : name
|
| 446 |
-
}, prototype, {
|
| 447 |
-
constructor: constructor,
|
| 448 |
-
namespace: namespace,
|
| 449 |
-
widgetName: name,
|
| 450 |
-
// TODO remove widgetBaseClass, see #8155
|
| 451 |
-
widgetBaseClass: fullName,
|
| 452 |
-
widgetFullName: fullName
|
| 453 |
-
});
|
| 454 |
-
|
| 455 |
-
// If this widget is being redefined then we need to find all widgets that
|
| 456 |
-
// are inheriting from it and redefine all of them so that they inherit from
|
| 457 |
-
// the new version of this widget. We're essentially trying to replace one
|
| 458 |
-
// level in the prototype chain.
|
| 459 |
-
if ( existingConstructor ) {
|
| 460 |
-
$.each( existingConstructor._childConstructors, function( i, child ) {
|
| 461 |
-
var childPrototype = child.prototype;
|
| 462 |
-
|
| 463 |
-
// redefine the child widget using the same prototype that was
|
| 464 |
-
// originally used, but inherit from the new version of the base
|
| 465 |
-
$.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor, child._proto );
|
| 466 |
-
});
|
| 467 |
-
// remove the list of existing child constructors from the old constructor
|
| 468 |
-
// so the old child constructors can be garbage collected
|
| 469 |
-
delete existingConstructor._childConstructors;
|
| 470 |
-
} else {
|
| 471 |
-
base._childConstructors.push( constructor );
|
| 472 |
-
}
|
| 473 |
-
|
| 474 |
-
$.widget.bridge( name, constructor );
|
| 475 |
-
};
|
| 476 |
-
|
| 477 |
-
$.widget.extend = function( target ) {
|
| 478 |
-
var input = slice.call( arguments, 1 ),
|
| 479 |
-
inputIndex = 0,
|
| 480 |
-
inputLength = input.length,
|
| 481 |
-
key,
|
| 482 |
-
value;
|
| 483 |
-
for ( ; inputIndex < inputLength; inputIndex++ ) {
|
| 484 |
-
for ( key in input[ inputIndex ] ) {
|
| 485 |
-
value = input[ inputIndex ][ key ];
|
| 486 |
-
if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) {
|
| 487 |
-
// Clone objects
|
| 488 |
-
if ( $.isPlainObject( value ) ) {
|
| 489 |
-
target[ key ] = $.isPlainObject( target[ key ] ) ?
|
| 490 |
-
$.widget.extend( {}, target[ key ], value ) :
|
| 491 |
-
// Don't extend strings, arrays, etc. with objects
|
| 492 |
-
$.widget.extend( {}, value );
|
| 493 |
-
// Copy everything else by reference
|
| 494 |
-
} else {
|
| 495 |
-
target[ key ] = value;
|
| 496 |
-
}
|
| 497 |
-
}
|
| 498 |
-
}
|
| 499 |
-
}
|
| 500 |
-
return target;
|
| 501 |
-
};
|
| 502 |
-
|
| 503 |
-
$.widget.bridge = function( name, object ) {
|
| 504 |
-
var fullName = object.prototype.widgetFullName || name;
|
| 505 |
-
$.fn[ name ] = function( options ) {
|
| 506 |
-
var isMethodCall = typeof options === "string",
|
| 507 |
-
args = slice.call( arguments, 1 ),
|
| 508 |
-
returnValue = this;
|
| 509 |
-
|
| 510 |
-
// allow multiple hashes to be passed on init
|
| 511 |
-
options = !isMethodCall && args.length ?
|
| 512 |
-
$.widget.extend.apply( null, [ options ].concat(args) ) :
|
| 513 |
-
options;
|
| 514 |
-
|
| 515 |
-
if ( isMethodCall ) {
|
| 516 |
-
this.each(function() {
|
| 517 |
-
var methodValue,
|
| 518 |
-
instance = $.data( this, fullName );
|
| 519 |
-
if ( !instance ) {
|
| 520 |
-
return $.error( "cannot call methods on " + name + " prior to initialization; " +
|
| 521 |
-
"attempted to call method '" + options + "'" );
|
| 522 |
-
}
|
| 523 |
-
if ( !$.isFunction( instance[options] ) || options.charAt( 0 ) === "_" ) {
|
| 524 |
-
return $.error( "no such method '" + options + "' for " + name + " widget instance" );
|
| 525 |
-
}
|
| 526 |
-
methodValue = instance[ options ].apply( instance, args );
|
| 527 |
-
if ( methodValue !== instance && methodValue !== undefined ) {
|
| 528 |
-
returnValue = methodValue && methodValue.jquery ?
|
| 529 |
-
returnValue.pushStack( methodValue.get() ) :
|
| 530 |
-
methodValue;
|
| 531 |
-
return false;
|
| 532 |
-
}
|
| 533 |
-
});
|
| 534 |
-
} else {
|
| 535 |
-
this.each(function() {
|
| 536 |
-
var instance = $.data( this, fullName );
|
| 537 |
-
if ( instance ) {
|
| 538 |
-
instance.option( options || {} )._init();
|
| 539 |
-
} else {
|
| 540 |
-
$.data( this, fullName, new object( options, this ) );
|
| 541 |
-
}
|
| 542 |
-
});
|
| 543 |
-
}
|
| 544 |
-
|
| 545 |
-
return returnValue;
|
| 546 |
-
};
|
| 547 |
-
};
|
| 548 |
-
|
| 549 |
-
$.Widget = function( /* options, element */ ) {};
|
| 550 |
-
$.Widget._childConstructors = [];
|
| 551 |
-
|
| 552 |
-
$.Widget.prototype = {
|
| 553 |
-
widgetName: "widget",
|
| 554 |
-
widgetEventPrefix: "",
|
| 555 |
-
defaultElement: "<div>",
|
| 556 |
-
options: {
|
| 557 |
-
disabled: false,
|
| 558 |
-
|
| 559 |
-
// callbacks
|
| 560 |
-
create: null
|
| 561 |
-
},
|
| 562 |
-
_createWidget: function( options, element ) {
|
| 563 |
-
element = $( element || this.defaultElement || this )[ 0 ];
|
| 564 |
-
this.element = $( element );
|
| 565 |
-
this.uuid = uuid++;
|
| 566 |
-
this.eventNamespace = "." + this.widgetName + this.uuid;
|
| 567 |
-
this.options = $.widget.extend( {},
|
| 568 |
-
this.options,
|
| 569 |
-
this._getCreateOptions(),
|
| 570 |
-
options );
|
| 571 |
-
|
| 572 |
-
this.bindings = $();
|
| 573 |
-
this.hoverable = $();
|
| 574 |
-
this.focusable = $();
|
| 575 |
-
|
| 576 |
-
if ( element !== this ) {
|
| 577 |
-
// 1.9 BC for #7810
|
| 578 |
-
// TODO remove dual storage
|
| 579 |
-
$.data( element, this.widgetName, this );
|
| 580 |
-
$.data( element, this.widgetFullName, this );
|
| 581 |
-
this._on( true, this.element, {
|
| 582 |
-
remove: function( event ) {
|
| 583 |
-
if ( event.target === element ) {
|
| 584 |
-
this.destroy();
|
| 585 |
-
}
|
| 586 |
-
}
|
| 587 |
-
});
|
| 588 |
-
this.document = $( element.style ?
|
| 589 |
-
// element within the document
|
| 590 |
-
element.ownerDocument :
|
| 591 |
-
// element is window or document
|
| 592 |
-
element.document || element );
|
| 593 |
-
this.window = $( this.document[0].defaultView || this.document[0].parentWindow );
|
| 594 |
-
}
|
| 595 |
-
|
| 596 |
-
this._create();
|
| 597 |
-
this._trigger( "create", null, this._getCreateEventData() );
|
| 598 |
-
this._init();
|
| 599 |
-
},
|
| 600 |
-
_getCreateOptions: $.noop,
|
| 601 |
-
_getCreateEventData: $.noop,
|
| 602 |
-
_create: $.noop,
|
| 603 |
-
_init: $.noop,
|
| 604 |
-
|
| 605 |
-
destroy: function() {
|
| 606 |
-
this._destroy();
|
| 607 |
-
// we can probably remove the unbind calls in 2.0
|
| 608 |
-
// all event bindings should go through this._on()
|
| 609 |
-
this.element
|
| 610 |
-
.unbind( this.eventNamespace )
|
| 611 |
-
// 1.9 BC for #7810
|
| 612 |
-
// TODO remove dual storage
|
| 613 |
-
.removeData( this.widgetName )
|
| 614 |
-
.removeData( this.widgetFullName )
|
| 615 |
-
// support: jquery <1.6.3
|
| 616 |
-
// http://bugs.jquery.com/ticket/9413
|
| 617 |
-
.removeData( $.camelCase( this.widgetFullName ) );
|
| 618 |
-
this.widget()
|
| 619 |
-
.unbind( this.eventNamespace )
|
| 620 |
-
.removeAttr( "aria-disabled" )
|
| 621 |
-
.removeClass(
|
| 622 |
-
this.widgetFullName + "-disabled " +
|
| 623 |
-
"ui-state-disabled" );
|
| 624 |
-
|
| 625 |
-
// clean up events and states
|
| 626 |
-
this.bindings.unbind( this.eventNamespace );
|
| 627 |
-
this.hoverable.removeClass( "ui-state-hover" );
|
| 628 |
-
this.focusable.removeClass( "ui-state-focus" );
|
| 629 |
-
},
|
| 630 |
-
_destroy: $.noop,
|
| 631 |
-
|
| 632 |
-
widget: function() {
|
| 633 |
-
return this.element;
|
| 634 |
-
},
|
| 635 |
-
|
| 636 |
-
option: function( key, value ) {
|
| 637 |
-
var options = key,
|
| 638 |
-
parts,
|
| 639 |
-
curOption,
|
| 640 |
-
i;
|
| 641 |
-
|
| 642 |
-
if ( arguments.length === 0 ) {
|
| 643 |
-
// don't return a reference to the internal hash
|
| 644 |
-
return $.widget.extend( {}, this.options );
|
| 645 |
-
}
|
| 646 |
-
|
| 647 |
-
if ( typeof key === "string" ) {
|
| 648 |
-
// handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } }
|
| 649 |
-
options = {};
|
| 650 |
-
parts = key.split( "." );
|
| 651 |
-
key = parts.shift();
|
| 652 |
-
if ( parts.length ) {
|
| 653 |
-
curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] );
|
| 654 |
-
for ( i = 0; i < parts.length - 1; i++ ) {
|
| 655 |
-
curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {};
|
| 656 |
-
curOption = curOption[ parts[ i ] ];
|
| 657 |
-
}
|
| 658 |
-
key = parts.pop();
|
| 659 |
-
if ( value === undefined ) {
|
| 660 |
-
return curOption[ key ] === undefined ? null : curOption[ key ];
|
| 661 |
-
}
|
| 662 |
-
curOption[ key ] = value;
|
| 663 |
-
} else {
|
| 664 |
-
if ( value === undefined ) {
|
| 665 |
-
return this.options[ key ] === undefined ? null : this.options[ key ];
|
| 666 |
-
}
|
| 667 |
-
options[ key ] = value;
|
| 668 |
-
}
|
| 669 |
-
}
|
| 670 |
-
|
| 671 |
-
this._setOptions( options );
|
| 672 |
-
|
| 673 |
-
return this;
|
| 674 |
-
},
|
| 675 |
-
_setOptions: function( options ) {
|
| 676 |
-
var key;
|
| 677 |
-
|
| 678 |
-
for ( key in options ) {
|
| 679 |
-
this._setOption( key, options[ key ] );
|
| 680 |
-
}
|
| 681 |
-
|
| 682 |
-
return this;
|
| 683 |
-
},
|
| 684 |
-
_setOption: function( key, value ) {
|
| 685 |
-
this.options[ key ] = value;
|
| 686 |
-
|
| 687 |
-
if ( key === "disabled" ) {
|
| 688 |
-
this.widget()
|
| 689 |
-
.toggleClass( this.widgetFullName + "-disabled ui-state-disabled", !!value )
|
| 690 |
-
.attr( "aria-disabled", value );
|
| 691 |
-
this.hoverable.removeClass( "ui-state-hover" );
|
| 692 |
-
this.focusable.removeClass( "ui-state-focus" );
|
| 693 |
-
}
|
| 694 |
-
|
| 695 |
-
return this;
|
| 696 |
-
},
|
| 697 |
-
|
| 698 |
-
enable: function() {
|
| 699 |
-
return this._setOption( "disabled", false );
|
| 700 |
-
},
|
| 701 |
-
disable: function() {
|
| 702 |
-
return this._setOption( "disabled", true );
|
| 703 |
-
},
|
| 704 |
-
|
| 705 |
-
_on: function( suppressDisabledCheck, element, handlers ) {
|
| 706 |
-
var delegateElement,
|
| 707 |
-
instance = this;
|
| 708 |
-
|
| 709 |
-
// no suppressDisabledCheck flag, shuffle arguments
|
| 710 |
-
if ( typeof suppressDisabledCheck !== "boolean" ) {
|
| 711 |
-
handlers = element;
|
| 712 |
-
element = suppressDisabledCheck;
|
| 713 |
-
suppressDisabledCheck = false;
|
| 714 |
-
}
|
| 715 |
-
|
| 716 |
-
// no element argument, shuffle and use this.element
|
| 717 |
-
if ( !handlers ) {
|
| 718 |
-
handlers = element;
|
| 719 |
-
element = this.element;
|
| 720 |
-
delegateElement = this.widget();
|
| 721 |
-
} else {
|
| 722 |
-
// accept selectors, DOM elements
|
| 723 |
-
element = delegateElement = $( element );
|
| 724 |
-
this.bindings = this.bindings.add( element );
|
| 725 |
-
}
|
| 726 |
-
|
| 727 |
-
$.each( handlers, function( event, handler ) {
|
| 728 |
-
function handlerProxy() {
|
| 729 |
-
// allow widgets to customize the disabled handling
|
| 730 |
-
// - disabled as an array instead of boolean
|
| 731 |
-
// - disabled class as method for disabling individual parts
|
| 732 |
-
if ( !suppressDisabledCheck &&
|
| 733 |
-
( instance.options.disabled === true ||
|
| 734 |
-
$( this ).hasClass( "ui-state-disabled" ) ) ) {
|
| 735 |
-
return;
|
| 736 |
-
}
|
| 737 |
-
return ( typeof handler === "string" ? instance[ handler ] : handler )
|
| 738 |
-
.apply( instance, arguments );
|
| 739 |
-
}
|
| 740 |
-
|
| 741 |
-
// copy the guid so direct unbinding works
|
| 742 |
-
if ( typeof handler !== "string" ) {
|
| 743 |
-
handlerProxy.guid = handler.guid =
|
| 744 |
-
handler.guid || handlerProxy.guid || $.guid++;
|
| 745 |
-
}
|
| 746 |
-
|
| 747 |
-
var match = event.match( /^(\w+)\s*(.*)$/ ),
|
| 748 |
-
eventName = match[1] + instance.eventNamespace,
|
| 749 |
-
selector = match[2];
|
| 750 |
-
if ( selector ) {
|
| 751 |
-
delegateElement.delegate( selector, eventName, handlerProxy );
|
| 752 |
-
} else {
|
| 753 |
-
element.bind( eventName, handlerProxy );
|
| 754 |
-
}
|
| 755 |
-
});
|
| 756 |
-
},
|
| 757 |
-
|
| 758 |
-
_off: function( element, eventName ) {
|
| 759 |
-
eventName = (eventName || "").split( " " ).join( this.eventNamespace + " " ) + this.eventNamespace;
|
| 760 |
-
element.unbind( eventName ).undelegate( eventName );
|
| 761 |
-
},
|
| 762 |
-
|
| 763 |
-
_delay: function( handler, delay ) {
|
| 764 |
-
function handlerProxy() {
|
| 765 |
-
return ( typeof handler === "string" ? instance[ handler ] : handler )
|
| 766 |
-
.apply( instance, arguments );
|
| 767 |
-
}
|
| 768 |
-
var instance = this;
|
| 769 |
-
return setTimeout( handlerProxy, delay || 0 );
|
| 770 |
-
},
|
| 771 |
-
|
| 772 |
-
_hoverable: function( element ) {
|
| 773 |
-
this.hoverable = this.hoverable.add( element );
|
| 774 |
-
this._on( element, {
|
| 775 |
-
mouseenter: function( event ) {
|
| 776 |
-
$( event.currentTarget ).addClass( "ui-state-hover" );
|
| 777 |
-
},
|
| 778 |
-
mouseleave: function( event ) {
|
| 779 |
-
$( event.currentTarget ).removeClass( "ui-state-hover" );
|
| 780 |
-
}
|
| 781 |
-
});
|
| 782 |
-
},
|
| 783 |
-
|
| 784 |
-
_focusable: function( element ) {
|
| 785 |
-
this.focusable = this.focusable.add( element );
|
| 786 |
-
this._on( element, {
|
| 787 |
-
focusin: function( event ) {
|
| 788 |
-
$( event.currentTarget ).addClass( "ui-state-focus" );
|
| 789 |
-
},
|
| 790 |
-
focusout: function( event ) {
|
| 791 |
-
$( event.currentTarget ).removeClass( "ui-state-focus" );
|
| 792 |
-
}
|
| 793 |
-
});
|
| 794 |
-
},
|
| 795 |
-
|
| 796 |
-
_trigger: function( type, event, data ) {
|
| 797 |
-
var prop, orig,
|
| 798 |
-
callback = this.options[ type ];
|
| 799 |
-
|
| 800 |
-
data = data || {};
|
| 801 |
-
event = $.Event( event );
|
| 802 |
-
event.type = ( type === this.widgetEventPrefix ?
|
| 803 |
-
type :
|
| 804 |
-
this.widgetEventPrefix + type ).toLowerCase();
|
| 805 |
-
// the original event may come from any element
|
| 806 |
-
// so we need to reset the target on the new event
|
| 807 |
-
event.target = this.element[ 0 ];
|
| 808 |
-
|
| 809 |
-
// copy original event properties over to the new event
|
| 810 |
-
orig = event.originalEvent;
|
| 811 |
-
if ( orig ) {
|
| 812 |
-
for ( prop in orig ) {
|
| 813 |
-
if ( !( prop in event ) ) {
|
| 814 |
-
event[ prop ] = orig[ prop ];
|
| 815 |
-
}
|
| 816 |
-
}
|
| 817 |
-
}
|
| 818 |
-
|
| 819 |
-
this.element.trigger( event, data );
|
| 820 |
-
return !( $.isFunction( callback ) &&
|
| 821 |
-
callback.apply( this.element[0], [ event ].concat( data ) ) === false ||
|
| 822 |
-
event.isDefaultPrevented() );
|
| 823 |
-
}
|
| 824 |
-
};
|
| 825 |
-
|
| 826 |
-
$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) {
|
| 827 |
-
$.Widget.prototype[ "_" + method ] = function( element, options, callback ) {
|
| 828 |
-
if ( typeof options === "string" ) {
|
| 829 |
-
options = { effect: options };
|
| 830 |
-
}
|
| 831 |
-
var hasOptions,
|
| 832 |
-
effectName = !options ?
|
| 833 |
-
method :
|
| 834 |
-
options === true || typeof options === "number" ?
|
| 835 |
-
defaultEffect :
|
| 836 |
-
options.effect || defaultEffect;
|
| 837 |
-
options = options || {};
|
| 838 |
-
if ( typeof options === "number" ) {
|
| 839 |
-
options = { duration: options };
|
| 840 |
-
}
|
| 841 |
-
hasOptions = !$.isEmptyObject( options );
|
| 842 |
-
options.complete = callback;
|
| 843 |
-
if ( options.delay ) {
|
| 844 |
-
element.delay( options.delay );
|
| 845 |
-
}
|
| 846 |
-
if ( hasOptions && $.effects && ( $.effects.effect[ effectName ] || $.uiBackCompat !== false && $.effects[ effectName ] ) ) {
|
| 847 |
-
element[ method ]( options );
|
| 848 |
-
} else if ( effectName !== method && element[ effectName ] ) {
|
| 849 |
-
element[ effectName ]( options.duration, options.easing, callback );
|
| 850 |
-
} else {
|
| 851 |
-
element.queue(function( next ) {
|
| 852 |
-
$( this )[ method ]();
|
| 853 |
-
if ( callback ) {
|
| 854 |
-
callback.call( element[ 0 ] );
|
| 855 |
-
}
|
| 856 |
-
next();
|
| 857 |
-
});
|
| 858 |
-
}
|
| 859 |
-
};
|
| 860 |
-
});
|
| 861 |
-
|
| 862 |
-
// DEPRECATED
|
| 863 |
-
if ( $.uiBackCompat !== false ) {
|
| 864 |
-
$.Widget.prototype._getCreateOptions = function() {
|
| 865 |
-
return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
|
| 866 |
-
};
|
| 867 |
-
}
|
| 868 |
-
|
| 869 |
-
})( sQuery );
|
| 870 |
-
(function( $, undefined ) {
|
| 871 |
-
|
| 872 |
-
var mouseHandled = false;
|
| 873 |
-
$( document ).mouseup( function( e ) {
|
| 874 |
-
mouseHandled = false;
|
| 875 |
-
});
|
| 876 |
-
|
| 877 |
-
$.widget("ui.mouse", {
|
| 878 |
-
version: "1.9.2",
|
| 879 |
-
options: {
|
| 880 |
-
cancel: 'input,textarea,button,select,option',
|
| 881 |
-
distance: 1,
|
| 882 |
-
delay: 0
|
| 883 |
-
},
|
| 884 |
-
_mouseInit: function() {
|
| 885 |
-
var that = this;
|
| 886 |
-
|
| 887 |
-
this.element
|
| 888 |
-
.bind('mousedown.'+this.widgetName, function(event) {
|
| 889 |
-
return that._mouseDown(event);
|
| 890 |
-
})
|
| 891 |
-
.bind('click.'+this.widgetName, function(event) {
|
| 892 |
-
if (true === $.data(event.target, that.widgetName + '.preventClickEvent')) {
|
| 893 |
-
$.removeData(event.target, that.widgetName + '.preventClickEvent');
|
| 894 |
-
event.stopImmediatePropagation();
|
| 895 |
-
return false;
|
| 896 |
-
}
|
| 897 |
-
});
|
| 898 |
-
|
| 899 |
-
this.started = false;
|
| 900 |
-
},
|
| 901 |
-
|
| 902 |
-
// TODO: make sure destroying one instance of mouse doesn't mess with
|
| 903 |
-
// other instances of mouse
|
| 904 |
-
_mouseDestroy: function() {
|
| 905 |
-
this.element.unbind('.'+this.widgetName);
|
| 906 |
-
if ( this._mouseMoveDelegate ) {
|
| 907 |
-
$(document)
|
| 908 |
-
.unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
|
| 909 |
-
.unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
|
| 910 |
-
}
|
| 911 |
-
},
|
| 912 |
-
|
| 913 |
-
_mouseDown: function(event) {
|
| 914 |
-
// don't let more than one widget handle mouseStart
|
| 915 |
-
if( mouseHandled ) { return; }
|
| 916 |
-
|
| 917 |
-
// we may have missed mouseup (out of window)
|
| 918 |
-
(this._mouseStarted && this._mouseUp(event));
|
| 919 |
-
|
| 920 |
-
this._mouseDownEvent = event;
|
| 921 |
-
|
| 922 |
-
var that = this,
|
| 923 |
-
btnIsLeft = (event.which === 1),
|
| 924 |
-
// event.target.nodeName works around a bug in IE 8 with
|
| 925 |
-
// disabled inputs (#7620)
|
| 926 |
-
elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false);
|
| 927 |
-
if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
|
| 928 |
-
return true;
|
| 929 |
-
}
|
| 930 |
-
|
| 931 |
-
this.mouseDelayMet = !this.options.delay;
|
| 932 |
-
if (!this.mouseDelayMet) {
|
| 933 |
-
this._mouseDelayTimer = setTimeout(function() {
|
| 934 |
-
that.mouseDelayMet = true;
|
| 935 |
-
}, this.options.delay);
|
| 936 |
-
}
|
| 937 |
-
|
| 938 |
-
if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
|
| 939 |
-
this._mouseStarted = (this._mouseStart(event) !== false);
|
| 940 |
-
if (!this._mouseStarted) {
|
| 941 |
-
event.preventDefault();
|
| 942 |
-
return true;
|
| 943 |
-
}
|
| 944 |
-
}
|
| 945 |
-
|
| 946 |
-
// Click event may never have fired (Gecko & Opera)
|
| 947 |
-
if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) {
|
| 948 |
-
$.removeData(event.target, this.widgetName + '.preventClickEvent');
|
| 949 |
-
}
|
| 950 |
-
|
| 951 |
-
// these delegates are required to keep context
|
| 952 |
-
this._mouseMoveDelegate = function(event) {
|
| 953 |
-
return that._mouseMove(event);
|
| 954 |
-
};
|
| 955 |
-
this._mouseUpDelegate = function(event) {
|
| 956 |
-
return that._mouseUp(event);
|
| 957 |
-
};
|
| 958 |
-
$(document)
|
| 959 |
-
.bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
|
| 960 |
-
.bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
|
| 961 |
-
|
| 962 |
-
event.preventDefault();
|
| 963 |
-
|
| 964 |
-
mouseHandled = true;
|
| 965 |
-
return true;
|
| 966 |
-
},
|
| 967 |
-
|
| 968 |
-
_mouseMove: function(event) {
|
| 969 |
-
// IE mouseup check - mouseup happened when mouse was out of window
|
| 970 |
-
if ($.ui.ie && !(document.documentMode >= 9) && !event.button) {
|
| 971 |
-
return this._mouseUp(event);
|
| 972 |
-
}
|
| 973 |
-
|
| 974 |
-
if (this._mouseStarted) {
|
| 975 |
-
this._mouseDrag(event);
|
| 976 |
-
return event.preventDefault();
|
| 977 |
-
}
|
| 978 |
-
|
| 979 |
-
if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
|
| 980 |
-
this._mouseStarted =
|
| 981 |
-
(this._mouseStart(this._mouseDownEvent, event) !== false);
|
| 982 |
-
(this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
|
| 983 |
-
}
|
| 984 |
-
|
| 985 |
-
return !this._mouseStarted;
|
| 986 |
-
},
|
| 987 |
-
|
| 988 |
-
_mouseUp: function(event) {
|
| 989 |
-
$(document)
|
| 990 |
-
.unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
|
| 991 |
-
.unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
|
| 992 |
-
|
| 993 |
-
if (this._mouseStarted) {
|
| 994 |
-
this._mouseStarted = false;
|
| 995 |
-
|
| 996 |
-
if (event.target === this._mouseDownEvent.target) {
|
| 997 |
-
$.data(event.target, this.widgetName + '.preventClickEvent', true);
|
| 998 |
-
}
|
| 999 |
-
|
| 1000 |
-
this._mouseStop(event);
|
| 1001 |
-
}
|
| 1002 |
-
|
| 1003 |
-
return false;
|
| 1004 |
-
},
|
| 1005 |
-
|
| 1006 |
-
_mouseDistanceMet: function(event) {
|
| 1007 |
-
return (Math.max(
|
| 1008 |
-
Math.abs(this._mouseDownEvent.pageX - event.pageX),
|
| 1009 |
-
Math.abs(this._mouseDownEvent.pageY - event.pageY)
|
| 1010 |
-
) >= this.options.distance
|
| 1011 |
-
);
|
| 1012 |
-
},
|
| 1013 |
-
|
| 1014 |
-
_mouseDelayMet: function(event) {
|
| 1015 |
-
return this.mouseDelayMet;
|
| 1016 |
-
},
|
| 1017 |
-
|
| 1018 |
-
// These are placeholder methods, to be overriden by extending plugin
|
| 1019 |
-
_mouseStart: function(event) {},
|
| 1020 |
-
_mouseDrag: function(event) {},
|
| 1021 |
-
_mouseStop: function(event) {},
|
| 1022 |
-
_mouseCapture: function(event) { return true; }
|
| 1023 |
-
});
|
| 1024 |
-
|
| 1025 |
-
})(sQuery);
|
| 1026 |
-
(function( $, undefined ) {
|
| 1027 |
-
|
| 1028 |
-
$.ui = $.ui || {};
|
| 1029 |
-
|
| 1030 |
-
var cachedScrollbarWidth,
|
| 1031 |
-
max = Math.max,
|
| 1032 |
-
abs = Math.abs,
|
| 1033 |
-
round = Math.round,
|
| 1034 |
-
rhorizontal = /left|center|right/,
|
| 1035 |
-
rvertical = /top|center|bottom/,
|
| 1036 |
-
roffset = /[\+\-]\d+%?/,
|
| 1037 |
-
rposition = /^\w+/,
|
| 1038 |
-
rpercent = /%$/,
|
| 1039 |
-
_position = $.fn.position;
|
| 1040 |
-
|
| 1041 |
-
function getOffsets( offsets, width, height ) {
|
| 1042 |
-
return [
|
| 1043 |
-
parseInt( offsets[ 0 ], 10 ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ),
|
| 1044 |
-
parseInt( offsets[ 1 ], 10 ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 )
|
| 1045 |
-
];
|
| 1046 |
-
}
|
| 1047 |
-
function parseCss( element, property ) {
|
| 1048 |
-
return parseInt( $.css( element, property ), 10 ) || 0;
|
| 1049 |
-
}
|
| 1050 |
-
|
| 1051 |
-
$.position = {
|
| 1052 |
-
scrollbarWidth: function() {
|
| 1053 |
-
if ( cachedScrollbarWidth !== undefined ) {
|
| 1054 |
-
return cachedScrollbarWidth;
|
| 1055 |
-
}
|
| 1056 |
-
var w1, w2,
|
| 1057 |
-
div = $( "<div style='display:block;width:50px;height:50px;overflow:hidden;'><div style='height:100px;width:auto;'></div></div>" ),
|
| 1058 |
-
innerDiv = div.children()[0];
|
| 1059 |
-
|
| 1060 |
-
$( "body" ).append( div );
|
| 1061 |
-
w1 = innerDiv.offsetWidth;
|
| 1062 |
-
div.css( "overflow", "scroll" );
|
| 1063 |
-
|
| 1064 |
-
w2 = innerDiv.offsetWidth;
|
| 1065 |
-
|
| 1066 |
-
if ( w1 === w2 ) {
|
| 1067 |
-
w2 = div[0].clientWidth;
|
| 1068 |
-
}
|
| 1069 |
-
|
| 1070 |
-
div.remove();
|
| 1071 |
-
|
| 1072 |
-
return (cachedScrollbarWidth = w1 - w2);
|
| 1073 |
-
},
|
| 1074 |
-
getScrollInfo: function( within ) {
|
| 1075 |
-
var overflowX = within.isWindow ? "" : within.element.css( "overflow-x" ),
|
| 1076 |
-
overflowY = within.isWindow ? "" : within.element.css( "overflow-y" ),
|
| 1077 |
-
hasOverflowX = overflowX === "scroll" ||
|
| 1078 |
-
( overflowX === "auto" && within.width < within.element[0].scrollWidth ),
|
| 1079 |
-
hasOverflowY = overflowY === "scroll" ||
|
| 1080 |
-
( overflowY === "auto" && within.height < within.element[0].scrollHeight );
|
| 1081 |
-
return {
|
| 1082 |
-
width: hasOverflowX ? $.position.scrollbarWidth() : 0,
|
| 1083 |
-
height: hasOverflowY ? $.position.scrollbarWidth() : 0
|
| 1084 |
-
};
|
| 1085 |
-
},
|
| 1086 |
-
getWithinInfo: function( element ) {
|
| 1087 |
-
var withinElement = $( element || window ),
|
| 1088 |
-
isWindow = $.isWindow( withinElement[0] );
|
| 1089 |
-
return {
|
| 1090 |
-
element: withinElement,
|
| 1091 |
-
isWindow: isWindow,
|
| 1092 |
-
offset: withinElement.offset() || { left: 0, top: 0 },
|
| 1093 |
-
scrollLeft: withinElement.scrollLeft(),
|
| 1094 |
-
scrollTop: withinElement.scrollTop(),
|
| 1095 |
-
width: isWindow ? withinElement.width() : withinElement.outerWidth(),
|
| 1096 |
-
height: isWindow ? withinElement.height() : withinElement.outerHeight()
|
| 1097 |
-
};
|
| 1098 |
-
}
|
| 1099 |
-
};
|
| 1100 |
-
|
| 1101 |
-
$.fn.position = function( options ) {
|
| 1102 |
-
if ( !options || !options.of ) {
|
| 1103 |
-
return _position.apply( this, arguments );
|
| 1104 |
-
}
|
| 1105 |
-
|
| 1106 |
-
// make a copy, we don't want to modify arguments
|
| 1107 |
-
options = $.extend( {}, options );
|
| 1108 |
-
|
| 1109 |
-
var atOffset, targetWidth, targetHeight, targetOffset, basePosition,
|
| 1110 |
-
target = $( options.of ),
|
| 1111 |
-
within = $.position.getWithinInfo( options.within ),
|
| 1112 |
-
scrollInfo = $.position.getScrollInfo( within ),
|
| 1113 |
-
targetElem = target[0],
|
| 1114 |
-
collision = ( options.collision || "flip" ).split( " " ),
|
| 1115 |
-
offsets = {};
|
| 1116 |
-
|
| 1117 |
-
if ( targetElem.nodeType === 9 ) {
|
| 1118 |
-
targetWidth = target.width();
|
| 1119 |
-
targetHeight = target.height();
|
| 1120 |
-
targetOffset = { top: 0, left: 0 };
|
| 1121 |
-
} else if ( $.isWindow( targetElem ) ) {
|
| 1122 |
-
targetWidth = target.width();
|
| 1123 |
-
targetHeight = target.height();
|
| 1124 |
-
targetOffset = { top: target.scrollTop(), left: target.scrollLeft() };
|
| 1125 |
-
} else if ( targetElem.preventDefault ) {
|
| 1126 |
-
// force left top to allow flipping
|
| 1127 |
-
options.at = "left top";
|
| 1128 |
-
targetWidth = targetHeight = 0;
|
| 1129 |
-
targetOffset = { top: targetElem.pageY, left: targetElem.pageX };
|
| 1130 |
-
} else {
|
| 1131 |
-
targetWidth = target.outerWidth();
|
| 1132 |
-
targetHeight = target.outerHeight();
|
| 1133 |
-
targetOffset = target.offset();
|
| 1134 |
-
}
|
| 1135 |
-
// clone to reuse original targetOffset later
|
| 1136 |
-
basePosition = $.extend( {}, targetOffset );
|
| 1137 |
-
|
| 1138 |
-
// force my and at to have valid horizontal and vertical positions
|
| 1139 |
-
// if a value is missing or invalid, it will be converted to center
|
| 1140 |
-
$.each( [ "my", "at" ], function() {
|
| 1141 |
-
var pos = ( options[ this ] || "" ).split( " " ),
|
| 1142 |
-
horizontalOffset,
|
| 1143 |
-
verticalOffset;
|
| 1144 |
-
|
| 1145 |
-
if ( pos.length === 1) {
|
| 1146 |
-
pos = rhorizontal.test( pos[ 0 ] ) ?
|
| 1147 |
-
pos.concat( [ "center" ] ) :
|
| 1148 |
-
rvertical.test( pos[ 0 ] ) ?
|
| 1149 |
-
[ "center" ].concat( pos ) :
|
| 1150 |
-
[ "center", "center" ];
|
| 1151 |
-
}
|
| 1152 |
-
pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center";
|
| 1153 |
-
pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center";
|
| 1154 |
-
|
| 1155 |
-
// calculate offsets
|
| 1156 |
-
horizontalOffset = roffset.exec( pos[ 0 ] );
|
| 1157 |
-
verticalOffset = roffset.exec( pos[ 1 ] );
|
| 1158 |
-
offsets[ this ] = [
|
| 1159 |
-
horizontalOffset ? horizontalOffset[ 0 ] : 0,
|
| 1160 |
-
verticalOffset ? verticalOffset[ 0 ] : 0
|
| 1161 |
-
];
|
| 1162 |
-
|
| 1163 |
-
// reduce to just the positions without the offsets
|
| 1164 |
-
options[ this ] = [
|
| 1165 |
-
rposition.exec( pos[ 0 ] )[ 0 ],
|
| 1166 |
-
rposition.exec( pos[ 1 ] )[ 0 ]
|
| 1167 |
-
];
|
| 1168 |
-
});
|
| 1169 |
-
|
| 1170 |
-
// normalize collision option
|
| 1171 |
-
if ( collision.length === 1 ) {
|
| 1172 |
-
collision[ 1 ] = collision[ 0 ];
|
| 1173 |
-
}
|
| 1174 |
-
|
| 1175 |
-
if ( options.at[ 0 ] === "right" ) {
|
| 1176 |
-
basePosition.left += targetWidth;
|
| 1177 |
-
} else if ( options.at[ 0 ] === "center" ) {
|
| 1178 |
-
basePosition.left += targetWidth / 2;
|
| 1179 |
-
}
|
| 1180 |
-
|
| 1181 |
-
if ( options.at[ 1 ] === "bottom" ) {
|
| 1182 |
-
basePosition.top += targetHeight;
|
| 1183 |
-
} else if ( options.at[ 1 ] === "center" ) {
|
| 1184 |
-
basePosition.top += targetHeight / 2;
|
| 1185 |
-
}
|
| 1186 |
-
|
| 1187 |
-
atOffset = getOffsets( offsets.at, targetWidth, targetHeight );
|
| 1188 |
-
basePosition.left += atOffset[ 0 ];
|
| 1189 |
-
basePosition.top += atOffset[ 1 ];
|
| 1190 |
-
|
| 1191 |
-
return this.each(function() {
|
| 1192 |
-
var collisionPosition, using,
|
| 1193 |
-
elem = $( this ),
|
| 1194 |
-
elemWidth = elem.outerWidth(),
|
| 1195 |
-
elemHeight = elem.outerHeight(),
|
| 1196 |
-
marginLeft = parseCss( this, "marginLeft" ),
|
| 1197 |
-
marginTop = parseCss( this, "marginTop" ),
|
| 1198 |
-
collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) + scrollInfo.width,
|
| 1199 |
-
collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) + scrollInfo.height,
|
| 1200 |
-
position = $.extend( {}, basePosition ),
|
| 1201 |
-
myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() );
|
| 1202 |
-
|
| 1203 |
-
if ( options.my[ 0 ] === "right" ) {
|
| 1204 |
-
position.left -= elemWidth;
|
| 1205 |
-
} else if ( options.my[ 0 ] === "center" ) {
|
| 1206 |
-
position.left -= elemWidth / 2;
|
| 1207 |
-
}
|
| 1208 |
-
|
| 1209 |
-
if ( options.my[ 1 ] === "bottom" ) {
|
| 1210 |
-
position.top -= elemHeight;
|
| 1211 |
-
} else if ( options.my[ 1 ] === "center" ) {
|
| 1212 |
-
position.top -= elemHeight / 2;
|
| 1213 |
-
}
|
| 1214 |
-
|
| 1215 |
-
position.left += myOffset[ 0 ];
|
| 1216 |
-
position.top += myOffset[ 1 ];
|
| 1217 |
-
|
| 1218 |
-
// if the browser doesn't support fractions, then round for consistent results
|
| 1219 |
-
if ( !$.support.offsetFractions ) {
|
| 1220 |
-
position.left = round( position.left );
|
| 1221 |
-
position.top = round( position.top );
|
| 1222 |
-
}
|
| 1223 |
-
|
| 1224 |
-
collisionPosition = {
|
| 1225 |
-
marginLeft: marginLeft,
|
| 1226 |
-
marginTop: marginTop
|
| 1227 |
-
};
|
| 1228 |
-
|
| 1229 |
-
$.each( [ "left", "top" ], function( i, dir ) {
|
| 1230 |
-
if ( $.ui.position[ collision[ i ] ] ) {
|
| 1231 |
-
$.ui.position[ collision[ i ] ][ dir ]( position, {
|
| 1232 |
-
targetWidth: targetWidth,
|
| 1233 |
-
targetHeight: targetHeight,
|
| 1234 |
-
elemWidth: elemWidth,
|
| 1235 |
-
elemHeight: elemHeight,
|
| 1236 |
-
collisionPosition: collisionPosition,
|
| 1237 |
-
collisionWidth: collisionWidth,
|
| 1238 |
-
collisionHeight: collisionHeight,
|
| 1239 |
-
offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ],
|
| 1240 |
-
my: options.my,
|
| 1241 |
-
at: options.at,
|
| 1242 |
-
within: within,
|
| 1243 |
-
elem : elem
|
| 1244 |
-
});
|
| 1245 |
-
}
|
| 1246 |
-
});
|
| 1247 |
-
|
| 1248 |
-
if ( $.fn.bgiframe ) {
|
| 1249 |
-
elem.bgiframe();
|
| 1250 |
-
}
|
| 1251 |
-
|
| 1252 |
-
if ( options.using ) {
|
| 1253 |
-
// adds feedback as second argument to using callback, if present
|
| 1254 |
-
using = function( props ) {
|
| 1255 |
-
var left = targetOffset.left - position.left,
|
| 1256 |
-
right = left + targetWidth - elemWidth,
|
| 1257 |
-
top = targetOffset.top - position.top,
|
| 1258 |
-
bottom = top + targetHeight - elemHeight,
|
| 1259 |
-
feedback = {
|
| 1260 |
-
target: {
|
| 1261 |
-
element: target,
|
| 1262 |
-
left: targetOffset.left,
|
| 1263 |
-
top: targetOffset.top,
|
| 1264 |
-
width: targetWidth,
|
| 1265 |
-
height: targetHeight
|
| 1266 |
-
},
|
| 1267 |
-
element: {
|
| 1268 |
-
element: elem,
|
| 1269 |
-
left: position.left,
|
| 1270 |
-
top: position.top,
|
| 1271 |
-
width: elemWidth,
|
| 1272 |
-
height: elemHeight
|
| 1273 |
-
},
|
| 1274 |
-
horizontal: right < 0 ? "left" : left > 0 ? "right" : "center",
|
| 1275 |
-
vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle"
|
| 1276 |
-
};
|
| 1277 |
-
if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) {
|
| 1278 |
-
feedback.horizontal = "center";
|
| 1279 |
-
}
|
| 1280 |
-
if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) {
|
| 1281 |
-
feedback.vertical = "middle";
|
| 1282 |
-
}
|
| 1283 |
-
if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) {
|
| 1284 |
-
feedback.important = "horizontal";
|
| 1285 |
-
} else {
|
| 1286 |
-
feedback.important = "vertical";
|
| 1287 |
-
}
|
| 1288 |
-
options.using.call( this, props, feedback );
|
| 1289 |
-
};
|
| 1290 |
-
}
|
| 1291 |
-
|
| 1292 |
-
elem.offset( $.extend( position, { using: using } ) );
|
| 1293 |
-
});
|
| 1294 |
-
};
|
| 1295 |
-
|
| 1296 |
-
$.ui.position = {
|
| 1297 |
-
fit: {
|
| 1298 |
-
left: function( position, data ) {
|
| 1299 |
-
var within = data.within,
|
| 1300 |
-
withinOffset = within.isWindow ? within.scrollLeft : within.offset.left,
|
| 1301 |
-
outerWidth = within.width,
|
| 1302 |
-
collisionPosLeft = position.left - data.collisionPosition.marginLeft,
|
| 1303 |
-
overLeft = withinOffset - collisionPosLeft,
|
| 1304 |
-
overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset,
|
| 1305 |
-
newOverRight;
|
| 1306 |
-
|
| 1307 |
-
// element is wider than within
|
| 1308 |
-
if ( data.collisionWidth > outerWidth ) {
|
| 1309 |
-
// element is initially over the left side of within
|
| 1310 |
-
if ( overLeft > 0 && overRight <= 0 ) {
|
| 1311 |
-
newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - withinOffset;
|
| 1312 |
-
position.left += overLeft - newOverRight;
|
| 1313 |
-
// element is initially over right side of within
|
| 1314 |
-
} else if ( overRight > 0 && overLeft <= 0 ) {
|
| 1315 |
-
position.left = withinOffset;
|
| 1316 |
-
// element is initially over both left and right sides of within
|
| 1317 |
-
} else {
|
| 1318 |
-
if ( overLeft > overRight ) {
|
| 1319 |
-
position.left = withinOffset + outerWidth - data.collisionWidth;
|
| 1320 |
-
} else {
|
| 1321 |
-
position.left = withinOffset;
|
| 1322 |
-
}
|
| 1323 |
-
}
|
| 1324 |
-
// too far left -> align with left edge
|
| 1325 |
-
} else if ( overLeft > 0 ) {
|
| 1326 |
-
position.left += overLeft;
|
| 1327 |
-
// too far right -> align with right edge
|
| 1328 |
-
} else if ( overRight > 0 ) {
|
| 1329 |
-
position.left -= overRight;
|
| 1330 |
-
// adjust based on position and margin
|
| 1331 |
-
} else {
|
| 1332 |
-
position.left = max( position.left - collisionPosLeft, position.left );
|
| 1333 |
-
}
|
| 1334 |
-
},
|
| 1335 |
-
top: function( position, data ) {
|
| 1336 |
-
var within = data.within,
|
| 1337 |
-
withinOffset = within.isWindow ? within.scrollTop : within.offset.top,
|
| 1338 |
-
outerHeight = data.within.height,
|
| 1339 |
-
collisionPosTop = position.top - data.collisionPosition.marginTop,
|
| 1340 |
-
overTop = withinOffset - collisionPosTop,
|
| 1341 |
-
overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset,
|
| 1342 |
-
newOverBottom;
|
| 1343 |
-
|
| 1344 |
-
// element is taller than within
|
| 1345 |
-
if ( data.collisionHeight > outerHeight ) {
|
| 1346 |
-
// element is initially over the top of within
|
| 1347 |
-
if ( overTop > 0 && overBottom <= 0 ) {
|
| 1348 |
-
newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - withinOffset;
|
| 1349 |
-
position.top += overTop - newOverBottom;
|
| 1350 |
-
// element is initially over bottom of within
|
| 1351 |
-
} else if ( overBottom > 0 && overTop <= 0 ) {
|
| 1352 |
-
position.top = withinOffset;
|
| 1353 |
-
// element is initially over both top and bottom of within
|
| 1354 |
-
} else {
|
| 1355 |
-
if ( overTop > overBottom ) {
|
| 1356 |
-
position.top = withinOffset + outerHeight - data.collisionHeight;
|
| 1357 |
-
} else {
|
| 1358 |
-
position.top = withinOffset;
|
| 1359 |
-
}
|
| 1360 |
-
}
|
| 1361 |
-
// too far up -> align with top
|
| 1362 |
-
} else if ( overTop > 0 ) {
|
| 1363 |
-
position.top += overTop;
|
| 1364 |
-
// too far down -> align with bottom edge
|
| 1365 |
-
} else if ( overBottom > 0 ) {
|
| 1366 |
-
position.top -= overBottom;
|
| 1367 |
-
// adjust based on position and margin
|
| 1368 |
-
} else {
|
| 1369 |
-
position.top = max( position.top - collisionPosTop, position.top );
|
| 1370 |
-
}
|
| 1371 |
-
}
|
| 1372 |
-
},
|
| 1373 |
-
flip: {
|
| 1374 |
-
left: function( position, data ) {
|
| 1375 |
-
var within = data.within,
|
| 1376 |
-
withinOffset = within.offset.left + within.scrollLeft,
|
| 1377 |
-
outerWidth = within.width,
|
| 1378 |
-
offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left,
|
| 1379 |
-
collisionPosLeft = position.left - data.collisionPosition.marginLeft,
|
| 1380 |
-
overLeft = collisionPosLeft - offsetLeft,
|
| 1381 |
-
overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft,
|
| 1382 |
-
myOffset = data.my[ 0 ] === "left" ?
|
| 1383 |
-
-data.elemWidth :
|
| 1384 |
-
data.my[ 0 ] === "right" ?
|
| 1385 |
-
data.elemWidth :
|
| 1386 |
-
0,
|
| 1387 |
-
atOffset = data.at[ 0 ] === "left" ?
|
| 1388 |
-
data.targetWidth :
|
| 1389 |
-
data.at[ 0 ] === "right" ?
|
| 1390 |
-
-data.targetWidth :
|
| 1391 |
-
0,
|
| 1392 |
-
offset = -2 * data.offset[ 0 ],
|
| 1393 |
-
newOverRight,
|
| 1394 |
-
newOverLeft;
|
| 1395 |
-
|
| 1396 |
-
if ( overLeft < 0 ) {
|
| 1397 |
-
newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth - outerWidth - withinOffset;
|
| 1398 |
-
if ( newOverRight < 0 || newOverRight < abs( overLeft ) ) {
|
| 1399 |
-
position.left += myOffset + atOffset + offset;
|
| 1400 |
-
}
|
| 1401 |
-
}
|
| 1402 |
-
else if ( overRight > 0 ) {
|
| 1403 |
-
newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset + atOffset + offset - offsetLeft;
|
| 1404 |
-
if ( newOverLeft > 0 || abs( newOverLeft ) < overRight ) {
|
| 1405 |
-
position.left += myOffset + atOffset + offset;
|
| 1406 |
-
}
|
| 1407 |
-
}
|
| 1408 |
-
},
|
| 1409 |
-
top: function( position, data ) {
|
| 1410 |
-
var within = data.within,
|
| 1411 |
-
withinOffset = within.offset.top + within.scrollTop,
|
| 1412 |
-
outerHeight = within.height,
|
| 1413 |
-
offsetTop = within.isWindow ? within.scrollTop : within.offset.top,
|
| 1414 |
-
collisionPosTop = position.top - data.collisionPosition.marginTop,
|
| 1415 |
-
overTop = collisionPosTop - offsetTop,
|
| 1416 |
-
overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop,
|
| 1417 |
-
top = data.my[ 1 ] === "top",
|
| 1418 |
-
myOffset = top ?
|
| 1419 |
-
-data.elemHeight :
|
| 1420 |
-
data.my[ 1 ] === "bottom" ?
|
| 1421 |
-
data.elemHeight :
|
| 1422 |
-
0,
|
| 1423 |
-
atOffset = data.at[ 1 ] === "top" ?
|
| 1424 |
-
data.targetHeight :
|
| 1425 |
-
data.at[ 1 ] === "bottom" ?
|
| 1426 |
-
-data.targetHeight :
|
| 1427 |
-
0,
|
| 1428 |
-
offset = -2 * data.offset[ 1 ],
|
| 1429 |
-
newOverTop,
|
| 1430 |
-
newOverBottom;
|
| 1431 |
-
if ( overTop < 0 ) {
|
| 1432 |
-
newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight - outerHeight - withinOffset;
|
| 1433 |
-
if ( ( position.top + myOffset + atOffset + offset) > overTop && ( newOverBottom < 0 || newOverBottom < abs( overTop ) ) ) {
|
| 1434 |
-
position.top += myOffset + atOffset + offset;
|
| 1435 |
-
}
|
| 1436 |
-
}
|
| 1437 |
-
else if ( overBottom > 0 ) {
|
| 1438 |
-
newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset + offset - offsetTop;
|
| 1439 |
-
if ( ( position.top + myOffset + atOffset + offset) > overBottom && ( newOverTop > 0 || abs( newOverTop ) < overBottom ) ) {
|
| 1440 |
-
position.top += myOffset + atOffset + offset;
|
| 1441 |
-
}
|
| 1442 |
-
}
|
| 1443 |
-
}
|
| 1444 |
-
},
|
| 1445 |
-
flipfit: {
|
| 1446 |
-
left: function() {
|
| 1447 |
-
$.ui.position.flip.left.apply( this, arguments );
|
| 1448 |
-
$.ui.position.fit.left.apply( this, arguments );
|
| 1449 |
-
},
|
| 1450 |
-
top: function() {
|
| 1451 |
-
$.ui.position.flip.top.apply( this, arguments );
|
| 1452 |
-
$.ui.position.fit.top.apply( this, arguments );
|
| 1453 |
-
}
|
| 1454 |
-
}
|
| 1455 |
-
};
|
| 1456 |
-
|
| 1457 |
-
// fraction support test
|
| 1458 |
-
(function () {
|
| 1459 |
-
var testElement, testElementParent, testElementStyle, offsetLeft, i,
|
| 1460 |
-
body = document.getElementsByTagName( "body" )[ 0 ],
|
| 1461 |
-
div = document.createElement( "div" );
|
| 1462 |
-
|
| 1463 |
-
//Create a "fake body" for testing based on method used in jQuery.support
|
| 1464 |
-
testElement = document.createElement( body ? "div" : "body" );
|
| 1465 |
-
testElementStyle = {
|
| 1466 |
-
visibility: "hidden",
|
| 1467 |
-
width: 0,
|
| 1468 |
-
height: 0,
|
| 1469 |
-
border: 0,
|
| 1470 |
-
margin: 0,
|
| 1471 |
-
background: "none"
|
| 1472 |
-
};
|
| 1473 |
-
if ( body ) {
|
| 1474 |
-
$.extend( testElementStyle, {
|
| 1475 |
-
position: "absolute",
|
| 1476 |
-
left: "-1000px",
|
| 1477 |
-
top: "-1000px"
|
| 1478 |
-
});
|
| 1479 |
-
}
|
| 1480 |
-
for ( i in testElementStyle ) {
|
| 1481 |
-
testElement.style[ i ] = testElementStyle[ i ];
|
| 1482 |
-
}
|
| 1483 |
-
testElement.appendChild( div );
|
| 1484 |
-
testElementParent = body || document.documentElement;
|
| 1485 |
-
testElementParent.insertBefore( testElement, testElementParent.firstChild );
|
| 1486 |
-
|
| 1487 |
-
div.style.cssText = "position: absolute; left: 10.7432222px;";
|
| 1488 |
-
|
| 1489 |
-
offsetLeft = $( div ).offset().left;
|
| 1490 |
-
$.support.offsetFractions = offsetLeft > 10 && offsetLeft < 11;
|
| 1491 |
-
|
| 1492 |
-
testElement.innerHTML = "";
|
| 1493 |
-
testElementParent.removeChild( testElement );
|
| 1494 |
-
})();
|
| 1495 |
-
|
| 1496 |
-
// DEPRECATED
|
| 1497 |
-
if ( $.uiBackCompat !== false ) {
|
| 1498 |
-
// offset option
|
| 1499 |
-
(function( $ ) {
|
| 1500 |
-
var _position = $.fn.position;
|
| 1501 |
-
$.fn.position = function( options ) {
|
| 1502 |
-
if ( !options || !options.offset ) {
|
| 1503 |
-
return _position.call( this, options );
|
| 1504 |
-
}
|
| 1505 |
-
var offset = options.offset.split( " " ),
|
| 1506 |
-
at = options.at.split( " " );
|
| 1507 |
-
if ( offset.length === 1 ) {
|
| 1508 |
-
offset[ 1 ] = offset[ 0 ];
|
| 1509 |
-
}
|
| 1510 |
-
if ( /^\d/.test( offset[ 0 ] ) ) {
|
| 1511 |
-
offset[ 0 ] = "+" + offset[ 0 ];
|
| 1512 |
-
}
|
| 1513 |
-
if ( /^\d/.test( offset[ 1 ] ) ) {
|
| 1514 |
-
offset[ 1 ] = "+" + offset[ 1 ];
|
| 1515 |
-
}
|
| 1516 |
-
if ( at.length === 1 ) {
|
| 1517 |
-
if ( /left|center|right/.test( at[ 0 ] ) ) {
|
| 1518 |
-
at[ 1 ] = "center";
|
| 1519 |
-
} else {
|
| 1520 |
-
at[ 1 ] = at[ 0 ];
|
| 1521 |
-
at[ 0 ] = "center";
|
| 1522 |
-
}
|
| 1523 |
-
}
|
| 1524 |
-
return _position.call( this, $.extend( options, {
|
| 1525 |
-
at: at[ 0 ] + offset[ 0 ] + " " + at[ 1 ] + offset[ 1 ],
|
| 1526 |
-
offset: undefined
|
| 1527 |
-
} ) );
|
| 1528 |
-
};
|
| 1529 |
-
}( sQuery ) );
|
| 1530 |
-
}
|
| 1531 |
-
|
| 1532 |
-
}( sQuery ) );
|
| 1533 |
-
(function( $, undefined ) {
|
| 1534 |
-
|
| 1535 |
-
$.widget("ui.draggable", $.ui.mouse, {
|
| 1536 |
-
version: "1.9.2",
|
| 1537 |
-
widgetEventPrefix: "drag",
|
| 1538 |
-
options: {
|
| 1539 |
-
addClasses: true,
|
| 1540 |
-
appendTo: "parent",
|
| 1541 |
-
axis: false,
|
| 1542 |
-
connectToSortable: false,
|
| 1543 |
-
containment: false,
|
| 1544 |
-
cursor: "auto",
|
| 1545 |
-
cursorAt: false,
|
| 1546 |
-
grid: false,
|
| 1547 |
-
handle: false,
|
| 1548 |
-
helper: "original",
|
| 1549 |
-
iframeFix: false,
|
| 1550 |
-
opacity: false,
|
| 1551 |
-
refreshPositions: false,
|
| 1552 |
-
revert: false,
|
| 1553 |
-
revertDuration: 500,
|
| 1554 |
-
scope: "default",
|
| 1555 |
-
scroll: true,
|
| 1556 |
-
scrollSensitivity: 20,
|
| 1557 |
-
scrollSpeed: 20,
|
| 1558 |
-
snap: false,
|
| 1559 |
-
snapMode: "both",
|
| 1560 |
-
snapTolerance: 20,
|
| 1561 |
-
stack: false,
|
| 1562 |
-
zIndex: false
|
| 1563 |
-
},
|
| 1564 |
-
_create: function() {
|
| 1565 |
-
|
| 1566 |
-
if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
|
| 1567 |
-
this.element[0].style.position = 'relative';
|
| 1568 |
-
|
| 1569 |
-
(this.options.addClasses && this.element.addClass("ui-draggable"));
|
| 1570 |
-
(this.options.disabled && this.element.addClass("ui-draggable-disabled"));
|
| 1571 |
-
|
| 1572 |
-
this._mouseInit();
|
| 1573 |
-
|
| 1574 |
-
},
|
| 1575 |
-
|
| 1576 |
-
_destroy: function() {
|
| 1577 |
-
this.element.removeClass( "ui-draggable ui-draggable-dragging ui-draggable-disabled" );
|
| 1578 |
-
this._mouseDestroy();
|
| 1579 |
-
},
|
| 1580 |
-
|
| 1581 |
-
_mouseCapture: function(event) {
|
| 1582 |
-
|
| 1583 |
-
var o = this.options;
|
| 1584 |
-
|
| 1585 |
-
// among others, prevent a drag on a resizable-handle
|
| 1586 |
-
if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
|
| 1587 |
-
return false;
|
| 1588 |
-
|
| 1589 |
-
//Quit if we're not on a valid handle
|
| 1590 |
-
this.handle = this._getHandle(event);
|
| 1591 |
-
if (!this.handle)
|
| 1592 |
-
return false;
|
| 1593 |
-
|
| 1594 |
-
$(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
|
| 1595 |
-
$('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
|
| 1596 |
-
.css({
|
| 1597 |
-
width: this.offsetWidth+"px", height: this.offsetHeight+"px",
|
| 1598 |
-
position: "absolute", opacity: "0.001", zIndex: 1000
|
| 1599 |
-
})
|
| 1600 |
-
.css($(this).offset())
|
| 1601 |
-
.appendTo("body");
|
| 1602 |
-
});
|
| 1603 |
-
|
| 1604 |
-
return true;
|
| 1605 |
-
|
| 1606 |
-
},
|
| 1607 |
-
|
| 1608 |
-
_mouseStart: function(event) {
|
| 1609 |
-
|
| 1610 |
-
var o = this.options;
|
| 1611 |
-
|
| 1612 |
-
//Create and append the visible helper
|
| 1613 |
-
this.helper = this._createHelper(event);
|
| 1614 |
-
|
| 1615 |
-
this.helper.addClass("ui-draggable-dragging");
|
| 1616 |
-
|
| 1617 |
-
//Cache the helper size
|
| 1618 |
-
this._cacheHelperProportions();
|
| 1619 |
-
|
| 1620 |
-
//If ddmanager is used for droppables, set the global draggable
|
| 1621 |
-
if($.ui.ddmanager)
|
| 1622 |
-
$.ui.ddmanager.current = this;
|
| 1623 |
-
|
| 1624 |
-
/*
|
| 1625 |
-
* - Position generation -
|
| 1626 |
-
* This block generates everything position related - it's the core of draggables.
|
| 1627 |
-
*/
|
| 1628 |
-
|
| 1629 |
-
//Cache the margins of the original element
|
| 1630 |
-
this._cacheMargins();
|
| 1631 |
-
|
| 1632 |
-
//Store the helper's css position
|
| 1633 |
-
this.cssPosition = this.helper.css("position");
|
| 1634 |
-
this.scrollParent = this.helper.scrollParent();
|
| 1635 |
-
|
| 1636 |
-
//The element's absolute position on the page minus margins
|
| 1637 |
-
this.offset = this.positionAbs = this.element.offset();
|
| 1638 |
-
this.offset = {
|
| 1639 |
-
top: this.offset.top - this.margins.top,
|
| 1640 |
-
left: this.offset.left - this.margins.left
|
| 1641 |
-
};
|
| 1642 |
-
|
| 1643 |
-
$.extend(this.offset, {
|
| 1644 |
-
click: { //Where the click happened, relative to the element
|
| 1645 |
-
left: event.pageX - this.offset.left,
|
| 1646 |
-
top: event.pageY - this.offset.top
|
| 1647 |
-
},
|
| 1648 |
-
parent: this._getParentOffset(),
|
| 1649 |
-
relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
|
| 1650 |
-
});
|
| 1651 |
-
|
| 1652 |
-
//Generate the original position
|
| 1653 |
-
this.originalPosition = this.position = this._generatePosition(event);
|
| 1654 |
-
this.originalPageX = event.pageX;
|
| 1655 |
-
this.originalPageY = event.pageY;
|
| 1656 |
-
|
| 1657 |
-
//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
|
| 1658 |
-
(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
|
| 1659 |
-
|
| 1660 |
-
//Set a containment if given in the options
|
| 1661 |
-
if(o.containment)
|
| 1662 |
-
this._setContainment();
|
| 1663 |
-
|
| 1664 |
-
//Trigger event + callbacks
|
| 1665 |
-
if(this._trigger("start", event) === false) {
|
| 1666 |
-
this._clear();
|
| 1667 |
-
return false;
|
| 1668 |
-
}
|
| 1669 |
-
|
| 1670 |
-
//Recache the helper size
|
| 1671 |
-
this._cacheHelperProportions();
|
| 1672 |
-
|
| 1673 |
-
//Prepare the droppable offsets
|
| 1674 |
-
if ($.ui.ddmanager && !o.dropBehaviour)
|
| 1675 |
-
$.ui.ddmanager.prepareOffsets(this, event);
|
| 1676 |
-
|
| 1677 |
-
|
| 1678 |
-
this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
|
| 1679 |
-
|
| 1680 |
-
//If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003)
|
| 1681 |
-
if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event);
|
| 1682 |
-
|
| 1683 |
-
return true;
|
| 1684 |
-
},
|
| 1685 |
-
|
| 1686 |
-
_mouseDrag: function(event, noPropagation) {
|
| 1687 |
-
|
| 1688 |
-
//Compute the helpers position
|
| 1689 |
-
this.position = this._generatePosition(event);
|
| 1690 |
-
this.positionAbs = this._convertPositionTo("absolute");
|
| 1691 |
-
|
| 1692 |
-
//Call plugins and callbacks and use the resulting position if something is returned
|
| 1693 |
-
if (!noPropagation) {
|
| 1694 |
-
var ui = this._uiHash();
|
| 1695 |
-
if(this._trigger('drag', event, ui) === false) {
|
| 1696 |
-
this._mouseUp({});
|
| 1697 |
-
return false;
|
| 1698 |
-
}
|
| 1699 |
-
this.position = ui.position;
|
| 1700 |
-
}
|
| 1701 |
-
|
| 1702 |
-
if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
|
| 1703 |
-
if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
|
| 1704 |
-
if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
|
| 1705 |
-
|
| 1706 |
-
return false;
|
| 1707 |
-
},
|
| 1708 |
-
|
| 1709 |
-
_mouseStop: function(event) {
|
| 1710 |
-
|
| 1711 |
-
//If we are using droppables, inform the manager about the drop
|
| 1712 |
-
var dropped = false;
|
| 1713 |
-
if ($.ui.ddmanager && !this.options.dropBehaviour)
|
| 1714 |
-
dropped = $.ui.ddmanager.drop(this, event);
|
| 1715 |
-
|
| 1716 |
-
//if a drop comes from outside (a sortable)
|
| 1717 |
-
if(this.dropped) {
|
| 1718 |
-
dropped = this.dropped;
|
| 1719 |
-
this.dropped = false;
|
| 1720 |
-
}
|
| 1721 |
-
|
| 1722 |
-
//if the original element is no longer in the DOM don't bother to continue (see #8269)
|
| 1723 |
-
var element = this.element[0], elementInDom = false;
|
| 1724 |
-
while ( element && (element = element.parentNode) ) {
|
| 1725 |
-
if (element == document ) {
|
| 1726 |
-
elementInDom = true;
|
| 1727 |
-
}
|
| 1728 |
-
}
|
| 1729 |
-
if ( !elementInDom && this.options.helper === "original" )
|
| 1730 |
-
return false;
|
| 1731 |
-
|
| 1732 |
-
if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
|
| 1733 |
-
var that = this;
|
| 1734 |
-
$(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
|
| 1735 |
-
if(that._trigger("stop", event) !== false) {
|
| 1736 |
-
that._clear();
|
| 1737 |
-
}
|
| 1738 |
-
});
|
| 1739 |
-
} else {
|
| 1740 |
-
if(this._trigger("stop", event) !== false) {
|
| 1741 |
-
this._clear();
|
| 1742 |
-
}
|
| 1743 |
-
}
|
| 1744 |
-
|
| 1745 |
-
return false;
|
| 1746 |
-
},
|
| 1747 |
-
|
| 1748 |
-
_mouseUp: function(event) {
|
| 1749 |
-
//Remove frame helpers
|
| 1750 |
-
$("div.ui-draggable-iframeFix").each(function() {
|
| 1751 |
-
this.parentNode.removeChild(this);
|
| 1752 |
-
});
|
| 1753 |
-
|
| 1754 |
-
//If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003)
|
| 1755 |
-
if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event);
|
| 1756 |
-
|
| 1757 |
-
return $.ui.mouse.prototype._mouseUp.call(this, event);
|
| 1758 |
-
},
|
| 1759 |
-
|
| 1760 |
-
cancel: function() {
|
| 1761 |
-
|
| 1762 |
-
if(this.helper.is(".ui-draggable-dragging")) {
|
| 1763 |
-
this._mouseUp({});
|
| 1764 |
-
} else {
|
| 1765 |
-
this._clear();
|
| 1766 |
-
}
|
| 1767 |
-
|
| 1768 |
-
return this;
|
| 1769 |
-
|
| 1770 |
-
},
|
| 1771 |
-
|
| 1772 |
-
_getHandle: function(event) {
|
| 1773 |
-
|
| 1774 |
-
var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
|
| 1775 |
-
$(this.options.handle, this.element)
|
| 1776 |
-
.find("*")
|
| 1777 |
-
.andSelf()
|
| 1778 |
-
.each(function() {
|
| 1779 |
-
if(this == event.target) handle = true;
|
| 1780 |
-
});
|
| 1781 |
-
|
| 1782 |
-
return handle;
|
| 1783 |
-
|
| 1784 |
-
},
|
| 1785 |
-
|
| 1786 |
-
_createHelper: function(event) {
|
| 1787 |
-
|
| 1788 |
-
var o = this.options;
|
| 1789 |
-
var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element);
|
| 1790 |
-
|
| 1791 |
-
if(!helper.parents('body').length)
|
| 1792 |
-
helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
|
| 1793 |
-
|
| 1794 |
-
if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
|
| 1795 |
-
helper.css("position", "absolute");
|
| 1796 |
-
|
| 1797 |
-
return helper;
|
| 1798 |
-
|
| 1799 |
-
},
|
| 1800 |
-
|
| 1801 |
-
_adjustOffsetFromHelper: function(obj) {
|
| 1802 |
-
if (typeof obj == 'string') {
|
| 1803 |
-
obj = obj.split(' ');
|
| 1804 |
-
}
|
| 1805 |
-
if ($.isArray(obj)) {
|
| 1806 |
-
obj = {left: +obj[0], top: +obj[1] || 0};
|
| 1807 |
-
}
|
| 1808 |
-
if ('left' in obj) {
|
| 1809 |
-
this.offset.click.left = obj.left + this.margins.left;
|
| 1810 |
-
}
|
| 1811 |
-
if ('right' in obj) {
|
| 1812 |
-
this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
|
| 1813 |
-
}
|
| 1814 |
-
if ('top' in obj) {
|
| 1815 |
-
this.offset.click.top = obj.top + this.margins.top;
|
| 1816 |
-
}
|
| 1817 |
-
if ('bottom' in obj) {
|
| 1818 |
-
this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
|
| 1819 |
-
}
|
| 1820 |
-
},
|
| 1821 |
-
|
| 1822 |
-
_getParentOffset: function() {
|
| 1823 |
-
|
| 1824 |
-
//Get the offsetParent and cache its position
|
| 1825 |
-
this.offsetParent = this.helper.offsetParent();
|
| 1826 |
-
var po = this.offsetParent.offset();
|
| 1827 |
-
|
| 1828 |
-
// This is a special case where we need to modify a offset calculated on start, since the following happened:
|
| 1829 |
-
// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
|
| 1830 |
-
// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
|
| 1831 |
-
// the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
|
| 1832 |
-
if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) {
|
| 1833 |
-
po.left += this.scrollParent.scrollLeft();
|
| 1834 |
-
po.top += this.scrollParent.scrollTop();
|
| 1835 |
-
}
|
| 1836 |
-
|
| 1837 |
-
if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
|
| 1838 |
-
|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.ui.ie)) //Ugly IE fix
|
| 1839 |
-
po = { top: 0, left: 0 };
|
| 1840 |
-
|
| 1841 |
-
return {
|
| 1842 |
-
top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
|
| 1843 |
-
left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
|
| 1844 |
-
};
|
| 1845 |
-
|
| 1846 |
-
},
|
| 1847 |
-
|
| 1848 |
-
_getRelativeOffset: function() {
|
| 1849 |
-
|
| 1850 |
-
if(this.cssPosition == "relative") {
|
| 1851 |
-
var p = this.element.position();
|
| 1852 |
-
return {
|
| 1853 |
-
top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
|
| 1854 |
-
left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
|
| 1855 |
-
};
|
| 1856 |
-
} else {
|
| 1857 |
-
return { top: 0, left: 0 };
|
| 1858 |
-
}
|
| 1859 |
-
|
| 1860 |
-
},
|
| 1861 |
-
|
| 1862 |
-
_cacheMargins: function() {
|
| 1863 |
-
this.margins = {
|
| 1864 |
-
left: (parseInt(this.element.css("marginLeft"),10) || 0),
|
| 1865 |
-
top: (parseInt(this.element.css("marginTop"),10) || 0),
|
| 1866 |
-
right: (parseInt(this.element.css("marginRight"),10) || 0),
|
| 1867 |
-
bottom: (parseInt(this.element.css("marginBottom"),10) || 0)
|
| 1868 |
-
};
|
| 1869 |
-
},
|
| 1870 |
-
|
| 1871 |
-
_cacheHelperProportions: function() {
|
| 1872 |
-
this.helperProportions = {
|
| 1873 |
-
width: this.helper.outerWidth(),
|
| 1874 |
-
height: this.helper.outerHeight()
|
| 1875 |
-
};
|
| 1876 |
-
},
|
| 1877 |
-
|
| 1878 |
-
_setContainment: function() {
|
| 1879 |
-
|
| 1880 |
-
var o = this.options;
|
| 1881 |
-
if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
|
| 1882 |
-
if(o.containment == 'document' || o.containment == 'window') this.containment = [
|
| 1883 |
-
o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
|
| 1884 |
-
o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top,
|
| 1885 |
-
(o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
|
| 1886 |
-
(o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
|
| 1887 |
-
];
|
| 1888 |
-
|
| 1889 |
-
if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
|
| 1890 |
-
var c = $(o.containment);
|
| 1891 |
-
var ce = c[0]; if(!ce) return;
|
| 1892 |
-
var co = c.offset();
|
| 1893 |
-
var over = ($(ce).css("overflow") != 'hidden');
|
| 1894 |
-
|
| 1895 |
-
this.containment = [
|
| 1896 |
-
(parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0),
|
| 1897 |
-
(parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0),
|
| 1898 |
-
(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right,
|
| 1899 |
-
(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom
|
| 1900 |
-
];
|
| 1901 |
-
this.relative_container = c;
|
| 1902 |
-
|
| 1903 |
-
} else if(o.containment.constructor == Array) {
|
| 1904 |
-
this.containment = o.containment;
|
| 1905 |
-
}
|
| 1906 |
-
|
| 1907 |
-
},
|
| 1908 |
-
|
| 1909 |
-
_convertPositionTo: function(d, pos) {
|
| 1910 |
-
|
| 1911 |
-
if(!pos) pos = this.position;
|
| 1912 |
-
var mod = d == "absolute" ? 1 : -1;
|
| 1913 |
-
var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
|
| 1914 |
-
|
| 1915 |
-
return {
|
| 1916 |
-
top: (
|
| 1917 |
-
pos.top // The absolute mouse position
|
| 1918 |
-
+ this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
|
| 1919 |
-
+ this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
|
| 1920 |
-
- ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
|
| 1921 |
-
),
|
| 1922 |
-
left: (
|
| 1923 |
-
pos.left // The absolute mouse position
|
| 1924 |
-
+ this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
|
| 1925 |
-
+ this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
|
| 1926 |
-
- ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
|
| 1927 |
-
)
|
| 1928 |
-
};
|
| 1929 |
-
|
| 1930 |
-
},
|
| 1931 |
-
|
| 1932 |
-
_generatePosition: function(event) {
|
| 1933 |
-
|
| 1934 |
-
var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
|
| 1935 |
-
var pageX = event.pageX;
|
| 1936 |
-
var pageY = event.pageY;
|
| 1937 |
-
|
| 1938 |
-
/*
|
| 1939 |
-
* - Position constraining -
|
| 1940 |
-
* Constrain the position to a mix of grid, containment.
|
| 1941 |
-
*/
|
| 1942 |
-
|
| 1943 |
-
if(this.originalPosition) { //If we are not dragging yet, we won't check for options
|
| 1944 |
-
var containment;
|
| 1945 |
-
if(this.containment) {
|
| 1946 |
-
if (this.relative_container){
|
| 1947 |
-
var co = this.relative_container.offset();
|
| 1948 |
-
containment = [ this.containment[0] + co.left,
|
| 1949 |
-
this.containment[1] + co.top,
|
| 1950 |
-
this.containment[2] + co.left,
|
| 1951 |
-
this.containment[3] + co.top ];
|
| 1952 |
-
}
|
| 1953 |
-
else {
|
| 1954 |
-
containment = this.containment;
|
| 1955 |
-
}
|
| 1956 |
-
|
| 1957 |
-
if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left;
|
| 1958 |
-
if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top;
|
| 1959 |
-
if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left;
|
| 1960 |
-
if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top;
|
| 1961 |
-
}
|
| 1962 |
-
|
| 1963 |
-
if(o.grid) {
|
| 1964 |
-
//Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950)
|
| 1965 |
-
var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY;
|
| 1966 |
-
pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
|
| 1967 |
-
|
| 1968 |
-
var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX;
|
| 1969 |
-
pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
|
| 1970 |
-
}
|
| 1971 |
-
|
| 1972 |
-
}
|
| 1973 |
-
|
| 1974 |
-
return {
|
| 1975 |
-
top: (
|
| 1976 |
-
pageY // The absolute mouse position
|
| 1977 |
-
- this.offset.click.top // Click offset (relative to the element)
|
| 1978 |
-
- this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
|
| 1979 |
-
- this.offset.parent.top // The offsetParent's offset without borders (offset + border)
|
| 1980 |
-
+ ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
|
| 1981 |
-
),
|
| 1982 |
-
left: (
|
| 1983 |
-
pageX // The absolute mouse position
|
| 1984 |
-
- this.offset.click.left // Click offset (relative to the element)
|
| 1985 |
-
- this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
|
| 1986 |
-
- this.offset.parent.left // The offsetParent's offset without borders (offset + border)
|
| 1987 |
-
+ ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
|
| 1988 |
-
)
|
| 1989 |
-
};
|
| 1990 |
-
|
| 1991 |
-
},
|
| 1992 |
-
|
| 1993 |
-
_clear: function() {
|
| 1994 |
-
this.helper.removeClass("ui-draggable-dragging");
|
| 1995 |
-
if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
|
| 1996 |
-
//if($.ui.ddmanager) $.ui.ddmanager.current = null;
|
| 1997 |
-
this.helper = null;
|
| 1998 |
-
this.cancelHelperRemoval = false;
|
| 1999 |
-
},
|
| 2000 |
-
|
| 2001 |
-
// From now on bulk stuff - mainly helpers
|
| 2002 |
-
|
| 2003 |
-
_trigger: function(type, event, ui) {
|
| 2004 |
-
ui = ui || this._uiHash();
|
| 2005 |
-
$.ui.plugin.call(this, type, [event, ui]);
|
| 2006 |
-
if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
|
| 2007 |
-
return $.Widget.prototype._trigger.call(this, type, event, ui);
|
| 2008 |
-
},
|
| 2009 |
-
|
| 2010 |
-
plugins: {},
|
| 2011 |
-
|
| 2012 |
-
_uiHash: function(event) {
|
| 2013 |
-
return {
|
| 2014 |
-
helper: this.helper,
|
| 2015 |
-
position: this.position,
|
| 2016 |
-
originalPosition: this.originalPosition,
|
| 2017 |
-
offset: this.positionAbs
|
| 2018 |
-
};
|
| 2019 |
-
}
|
| 2020 |
-
|
| 2021 |
-
});
|
| 2022 |
-
|
| 2023 |
-
$.ui.plugin.add("draggable", "connectToSortable", {
|
| 2024 |
-
start: function(event, ui) {
|
| 2025 |
-
|
| 2026 |
-
var inst = $(this).data("draggable"), o = inst.options,
|
| 2027 |
-
uiSortable = $.extend({}, ui, { item: inst.element });
|
| 2028 |
-
inst.sortables = [];
|
| 2029 |
-
$(o.connectToSortable).each(function() {
|
| 2030 |
-
var sortable = $.data(this, 'sortable');
|
| 2031 |
-
if (sortable && !sortable.options.disabled) {
|
| 2032 |
-
inst.sortables.push({
|
| 2033 |
-
instance: sortable,
|
| 2034 |
-
shouldRevert: sortable.options.revert
|
| 2035 |
-
});
|
| 2036 |
-
sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page).
|
| 2037 |
-
sortable._trigger("activate", event, uiSortable);
|
| 2038 |
-
}
|
| 2039 |
-
});
|
| 2040 |
-
|
| 2041 |
-
},
|
| 2042 |
-
stop: function(event, ui) {
|
| 2043 |
-
|
| 2044 |
-
//If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
|
| 2045 |
-
var inst = $(this).data("draggable"),
|
| 2046 |
-
uiSortable = $.extend({}, ui, { item: inst.element });
|
| 2047 |
-
|
| 2048 |
-
$.each(inst.sortables, function() {
|
| 2049 |
-
if(this.instance.isOver) {
|
| 2050 |
-
|
| 2051 |
-
this.instance.isOver = 0;
|
| 2052 |
-
|
| 2053 |
-
inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
|
| 2054 |
-
this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
|
| 2055 |
-
|
| 2056 |
-
//The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
|
| 2057 |
-
if(this.shouldRevert) this.instance.options.revert = true;
|
| 2058 |
-
|
| 2059 |
-
//Trigger the stop of the sortable
|
| 2060 |
-
this.instance._mouseStop(event);
|
| 2061 |
-
|
| 2062 |
-
this.instance.options.helper = this.instance.options._helper;
|
| 2063 |
-
|
| 2064 |
-
//If the helper has been the original item, restore properties in the sortable
|
| 2065 |
-
if(inst.options.helper == 'original')
|
| 2066 |
-
this.instance.currentItem.css({ top: 'auto', left: 'auto' });
|
| 2067 |
-
|
| 2068 |
-
} else {
|
| 2069 |
-
this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
|
| 2070 |
-
this.instance._trigger("deactivate", event, uiSortable);
|
| 2071 |
-
}
|
| 2072 |
-
|
| 2073 |
-
});
|
| 2074 |
-
|
| 2075 |
-
},
|
| 2076 |
-
drag: function(event, ui) {
|
| 2077 |
-
|
| 2078 |
-
var inst = $(this).data("draggable"), that = this;
|
| 2079 |
-
|
| 2080 |
-
var checkPos = function(o) {
|
| 2081 |
-
var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
|
| 2082 |
-
var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
|
| 2083 |
-
var itemHeight = o.height, itemWidth = o.width;
|
| 2084 |
-
var itemTop = o.top, itemLeft = o.left;
|
| 2085 |
-
|
| 2086 |
-
return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
|
| 2087 |
-
};
|
| 2088 |
-
|
| 2089 |
-
$.each(inst.sortables, function(i) {
|
| 2090 |
-
|
| 2091 |
-
var innermostIntersecting = false;
|
| 2092 |
-
var thisSortable = this;
|
| 2093 |
-
//Copy over some variables to allow calling the sortable's native _intersectsWith
|
| 2094 |
-
this.instance.positionAbs = inst.positionAbs;
|
| 2095 |
-
this.instance.helperProportions = inst.helperProportions;
|
| 2096 |
-
this.instance.offset.click = inst.offset.click;
|
| 2097 |
-
|
| 2098 |
-
if(this.instance._intersectsWith(this.instance.containerCache)) {
|
| 2099 |
-
innermostIntersecting = true;
|
| 2100 |
-
$.each(inst.sortables, function () {
|
| 2101 |
-
this.instance.positionAbs = inst.positionAbs;
|
| 2102 |
-
this.instance.helperProportions = inst.helperProportions;
|
| 2103 |
-
this.instance.offset.click = inst.offset.click;
|
| 2104 |
-
if (this != thisSortable
|
| 2105 |
-
&& this.instance._intersectsWith(this.instance.containerCache)
|
| 2106 |
-
&& $.ui.contains(thisSortable.instance.element[0], this.instance.element[0]))
|
| 2107 |
-
innermostIntersecting = false;
|
| 2108 |
-
return innermostIntersecting;
|
| 2109 |
-
});
|
| 2110 |
-
}
|
| 2111 |
-
|
| 2112 |
-
|
| 2113 |
-
if(innermostIntersecting) {
|
| 2114 |
-
//If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
|
| 2115 |
-
if(!this.instance.isOver) {
|
| 2116 |
-
|
| 2117 |
-
this.instance.isOver = 1;
|
| 2118 |
-
//Now we fake the start of dragging for the sortable instance,
|
| 2119 |
-
//by cloning the list group item, appending it to the sortable and using it as inst.currentItem
|
| 2120 |
-
//We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
|
| 2121 |
-
this.instance.currentItem = $(that).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true);
|
| 2122 |
-
this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
|
| 2123 |
-
this.instance.options.helper = function() { return ui.helper[0]; };
|
| 2124 |
-
|
| 2125 |
-
event.target = this.instance.currentItem[0];
|
| 2126 |
-
this.instance._mouseCapture(event, true);
|
| 2127 |
-
this.instance._mouseStart(event, true, true);
|
| 2128 |
-
|
| 2129 |
-
//Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
|
| 2130 |
-
this.instance.offset.click.top = inst.offset.click.top;
|
| 2131 |
-
this.instance.offset.click.left = inst.offset.click.left;
|
| 2132 |
-
this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
|
| 2133 |
-
this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
|
| 2134 |
-
|
| 2135 |
-
inst._trigger("toSortable", event);
|
| 2136 |
-
inst.dropped = this.instance.element; //draggable revert needs that
|
| 2137 |
-
//hack so receive/update callbacks work (mostly)
|
| 2138 |
-
inst.currentItem = inst.element;
|
| 2139 |
-
this.instance.fromOutside = inst;
|
| 2140 |
-
|
| 2141 |
-
}
|
| 2142 |
-
|
| 2143 |
-
//Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
|
| 2144 |
-
if(this.instance.currentItem) this.instance._mouseDrag(event);
|
| 2145 |
-
|
| 2146 |
-
} else {
|
| 2147 |
-
|
| 2148 |
-
//If it doesn't intersect with the sortable, and it intersected before,
|
| 2149 |
-
//we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
|
| 2150 |
-
if(this.instance.isOver) {
|
| 2151 |
-
|
| 2152 |
-
this.instance.isOver = 0;
|
| 2153 |
-
this.instance.cancelHelperRemoval = true;
|
| 2154 |
-
|
| 2155 |
-
//Prevent reverting on this forced stop
|
| 2156 |
-
this.instance.options.revert = false;
|
| 2157 |
-
|
| 2158 |
-
// The out event needs to be triggered independently
|
| 2159 |
-
this.instance._trigger('out', event, this.instance._uiHash(this.instance));
|
| 2160 |
-
|
| 2161 |
-
this.instance._mouseStop(event, true);
|
| 2162 |
-
this.instance.options.helper = this.instance.options._helper;
|
| 2163 |
-
|
| 2164 |
-
//Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
|
| 2165 |
-
this.instance.currentItem.remove();
|
| 2166 |
-
if(this.instance.placeholder) this.instance.placeholder.remove();
|
| 2167 |
-
|
| 2168 |
-
inst._trigger("fromSortable", event);
|
| 2169 |
-
inst.dropped = false; //draggable revert needs that
|
| 2170 |
-
}
|
| 2171 |
-
|
| 2172 |
-
};
|
| 2173 |
-
|
| 2174 |
-
});
|
| 2175 |
-
|
| 2176 |
-
}
|
| 2177 |
-
});
|
| 2178 |
-
|
| 2179 |
-
$.ui.plugin.add("draggable", "cursor", {
|
| 2180 |
-
start: function(event, ui) {
|
| 2181 |
-
var t = $('body'), o = $(this).data('draggable').options;
|
| 2182 |
-
if (t.css("cursor")) o._cursor = t.css("cursor");
|
| 2183 |
-
t.css("cursor", o.cursor);
|
| 2184 |
-
},
|
| 2185 |
-
stop: function(event, ui) {
|
| 2186 |
-
var o = $(this).data('draggable').options;
|
| 2187 |
-
if (o._cursor) $('body').css("cursor", o._cursor);
|
| 2188 |
-
}
|
| 2189 |
-
});
|
| 2190 |
-
|
| 2191 |
-
$.ui.plugin.add("draggable", "opacity", {
|
| 2192 |
-
start: function(event, ui) {
|
| 2193 |
-
var t = $(ui.helper), o = $(this).data('draggable').options;
|
| 2194 |
-
if(t.css("opacity")) o._opacity = t.css("opacity");
|
| 2195 |
-
t.css('opacity', o.opacity);
|
| 2196 |
-
},
|
| 2197 |
-
stop: function(event, ui) {
|
| 2198 |
-
var o = $(this).data('draggable').options;
|
| 2199 |
-
if(o._opacity) $(ui.helper).css('opacity', o._opacity);
|
| 2200 |
-
}
|
| 2201 |
-
});
|
| 2202 |
-
|
| 2203 |
-
$.ui.plugin.add("draggable", "scroll", {
|
| 2204 |
-
start: function(event, ui) {
|
| 2205 |
-
var i = $(this).data("draggable");
|
| 2206 |
-
if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
|
| 2207 |
-
},
|
| 2208 |
-
drag: function(event, ui) {
|
| 2209 |
-
|
| 2210 |
-
var i = $(this).data("draggable"), o = i.options, scrolled = false;
|
| 2211 |
-
|
| 2212 |
-
if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
|
| 2213 |
-
|
| 2214 |
-
if(!o.axis || o.axis != 'x') {
|
| 2215 |
-
if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
|
| 2216 |
-
i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
|
| 2217 |
-
else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
|
| 2218 |
-
i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
|
| 2219 |
-
}
|
| 2220 |
-
|
| 2221 |
-
if(!o.axis || o.axis != 'y') {
|
| 2222 |
-
if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
|
| 2223 |
-
i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
|
| 2224 |
-
else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
|
| 2225 |
-
i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
|
| 2226 |
-
}
|
| 2227 |
-
|
| 2228 |
-
} else {
|
| 2229 |
-
|
| 2230 |
-
if(!o.axis || o.axis != 'x') {
|
| 2231 |
-
if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
|
| 2232 |
-
scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
|
| 2233 |
-
else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
|
| 2234 |
-
scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
|
| 2235 |
-
}
|
| 2236 |
-
|
| 2237 |
-
if(!o.axis || o.axis != 'y') {
|
| 2238 |
-
if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
|
| 2239 |
-
scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
|
| 2240 |
-
else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
|
| 2241 |
-
scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
|
| 2242 |
-
}
|
| 2243 |
-
|
| 2244 |
-
}
|
| 2245 |
-
|
| 2246 |
-
if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
|
| 2247 |
-
$.ui.ddmanager.prepareOffsets(i, event);
|
| 2248 |
-
|
| 2249 |
-
}
|
| 2250 |
-
});
|
| 2251 |
-
|
| 2252 |
-
$.ui.plugin.add("draggable", "snap", {
|
| 2253 |
-
start: function(event, ui) {
|
| 2254 |
-
|
| 2255 |
-
var i = $(this).data("draggable"), o = i.options;
|
| 2256 |
-
i.snapElements = [];
|
| 2257 |
-
|
| 2258 |
-
$(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
|
| 2259 |
-
var $t = $(this); var $o = $t.offset();
|
| 2260 |
-
if(this != i.element[0]) i.snapElements.push({
|
| 2261 |
-
item: this,
|
| 2262 |
-
width: $t.outerWidth(), height: $t.outerHeight(),
|
| 2263 |
-
top: $o.top, left: $o.left
|
| 2264 |
-
});
|
| 2265 |
-
});
|
| 2266 |
-
|
| 2267 |
-
},
|
| 2268 |
-
drag: function(event, ui) {
|
| 2269 |
-
|
| 2270 |
-
var inst = $(this).data("draggable"), o = inst.options;
|
| 2271 |
-
var d = o.snapTolerance;
|
| 2272 |
-
|
| 2273 |
-
var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
|
| 2274 |
-
y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
|
| 2275 |
-
|
| 2276 |
-
for (var i = inst.snapElements.length - 1; i >= 0; i--){
|
| 2277 |
-
|
| 2278 |
-
var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
|
| 2279 |
-
t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
|
| 2280 |
-
|
| 2281 |
-
//Yes, I know, this is insane ;)
|
| 2282 |
-
if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
|
| 2283 |
-
if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
|
| 2284 |
-
inst.snapElements[i].snapping = false;
|
| 2285 |
-
continue;
|
| 2286 |
-
}
|
| 2287 |
-
|
| 2288 |
-
if(o.snapMode != 'inner') {
|
| 2289 |
-
var ts = Math.abs(t - y2) <= d;
|
| 2290 |
-
var bs = Math.abs(b - y1) <= d;
|
| 2291 |
-
var ls = Math.abs(l - x2) <= d;
|
| 2292 |
-
var rs = Math.abs(r - x1) <= d;
|
| 2293 |
-
if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
|
| 2294 |
-
if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
|
| 2295 |
-
if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
|
| 2296 |
-
if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
|
| 2297 |
-
}
|
| 2298 |
-
|
| 2299 |
-
var first = (ts || bs || ls || rs);
|
| 2300 |
-
|
| 2301 |
-
if(o.snapMode != 'outer') {
|
| 2302 |
-
var ts = Math.abs(t - y1) <= d;
|
| 2303 |
-
var bs = Math.abs(b - y2) <= d;
|
| 2304 |
-
var ls = Math.abs(l - x1) <= d;
|
| 2305 |
-
var rs = Math.abs(r - x2) <= d;
|
| 2306 |
-
if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
|
| 2307 |
-
if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
|
| 2308 |
-
if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
|
| 2309 |
-
if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
|
| 2310 |
-
}
|
| 2311 |
-
|
| 2312 |
-
if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
|
| 2313 |
-
(inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
|
| 2314 |
-
inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
|
| 2315 |
-
|
| 2316 |
-
};
|
| 2317 |
-
|
| 2318 |
-
}
|
| 2319 |
-
});
|
| 2320 |
-
|
| 2321 |
-
$.ui.plugin.add("draggable", "stack", {
|
| 2322 |
-
start: function(event, ui) {
|
| 2323 |
-
|
| 2324 |
-
var o = $(this).data("draggable").options;
|
| 2325 |
-
|
| 2326 |
-
var group = $.makeArray($(o.stack)).sort(function(a,b) {
|
| 2327 |
-
return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
|
| 2328 |
-
});
|
| 2329 |
-
if (!group.length) { return; }
|
| 2330 |
-
|
| 2331 |
-
var min = parseInt(group[0].style.zIndex) || 0;
|
| 2332 |
-
$(group).each(function(i) {
|
| 2333 |
-
this.style.zIndex = min + i;
|
| 2334 |
-
});
|
| 2335 |
-
|
| 2336 |
-
this[0].style.zIndex = min + group.length;
|
| 2337 |
-
|
| 2338 |
-
}
|
| 2339 |
-
});
|
| 2340 |
-
|
| 2341 |
-
$.ui.plugin.add("draggable", "zIndex", {
|
| 2342 |
-
start: function(event, ui) {
|
| 2343 |
-
var t = $(ui.helper), o = $(this).data("draggable").options;
|
| 2344 |
-
if(t.css("zIndex")) o._zIndex = t.css("zIndex");
|
| 2345 |
-
t.css('zIndex', o.zIndex);
|
| 2346 |
-
},
|
| 2347 |
-
stop: function(event, ui) {
|
| 2348 |
-
var o = $(this).data("draggable").options;
|
| 2349 |
-
if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
|
| 2350 |
-
}
|
| 2351 |
-
});
|
| 2352 |
-
|
| 2353 |
-
})(sQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/js/jquery_ui_custom.min.js
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
| 1 |
+
!function(a,l){var e,t,i=0,s=/^ui-id-\d+$/;function o(t,e){var i,s,o=t.nodeName.toLowerCase();return"area"===o?(s=(i=t.parentNode).name,!(!t.href||!s||"map"!==i.nodeName.toLowerCase())&&(!!(s=a("img[usemap=#"+s+"]")[0])&&n(s))):(/input|select|textarea|button|object/.test(o)?!t.disabled:"a"===o&&t.href||e)&&n(t)}function n(t){return a.expr.filters.visible(t)&&!a(t).parents().andSelf().filter(function(){return"hidden"===a.css(this,"visibility")}).length}a.ui=a.ui||{},a.ui.version||(a.extend(a.ui,{version:"1.9.2",keyCode:{BACKSPACE:8,COMMA:188,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,LEFT:37,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SPACE:32,TAB:9,UP:38}}),a.fn.extend({_focus:a.fn.focus,focus:function(e,i){return"number"==typeof e?this.each(function(){var t=this;setTimeout(function(){a(t).focus(),i&&i.call(t)},e)}):this._focus.apply(this,arguments)},scrollParent:function(){var t=(a.ui.ie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(a.css(this,"position"))&&/(auto|scroll)/.test(a.css(this,"overflow")+a.css(this,"overflow-y")+a.css(this,"overflow-x"))}):this.parents().filter(function(){return/(auto|scroll)/.test(a.css(this,"overflow")+a.css(this,"overflow-y")+a.css(this,"overflow-x"))})).eq(0);return/fixed/.test(this.css("position"))||!t.length?a(document):t},zIndex:function(t){if(t!==l)return this.css("zIndex",t);if(this.length)for(var e,i,s=a(this[0]);s.length&&s[0]!==document;){if(("absolute"===(e=s.css("position"))||"relative"===e||"fixed"===e)&&(i=parseInt(s.css("zIndex"),10),!isNaN(i)&&0!==i))return i;s=s.parent()}return 0},uniqueId:function(){return this.each(function(){this.id||(this.id="ui-id-"+ ++i)})},removeUniqueId:function(){return this.each(function(){s.test(this.id)&&a(this).removeAttr("id")})}}),a.extend(a.expr[":"],{data:a.expr.createPseudo?a.expr.createPseudo(function(e){return function(t){return!!a.data(t,e)}}):function(t,e,i){return!!a.data(t,i[3])},focusable:function(t){return o(t,!isNaN(a.attr(t,"tabindex")))},tabbable:function(t){var e=a.attr(t,"tabindex"),i=isNaN(e);return(i||0<=e)&&o(t,!i)}}),a(function(){var t=document.body,e=t.appendChild(document.createElement("div"));e.offsetHeight,a.extend(e.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0}),a.support.minHeight=100===e.offsetHeight,a.support.selectstart="onselectstart"in e,t.removeChild(e).style.display="none"}),a("<a>").outerWidth(1).jquery||a.each(["Width","Height"],function(t,i){var o="Width"===i?["Left","Right"]:["Top","Bottom"],s=i.toLowerCase(),n={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};function r(t,e,i,s){return a.each(o,function(){e-=parseFloat(a.css(t,"padding"+this))||0,i&&(e-=parseFloat(a.css(t,"border"+this+"Width"))||0),s&&(e-=parseFloat(a.css(t,"margin"+this))||0)}),e}a.fn["inner"+i]=function(t){return t===l?n["inner"+i].call(this):this.each(function(){a(this).css(s,r(this,t)+"px")})},a.fn["outer"+i]=function(t,e){return"number"!=typeof t?n["outer"+i].call(this,t):this.each(function(){a(this).css(s,r(this,t,!0,e)+"px")})}}),a("<a>").data("a-b","a").removeData("a-b").data("a-b")&&(a.fn.removeData=(e=a.fn.removeData,function(t){return arguments.length?e.call(this,a.camelCase(t)):e.call(this)})),t=/msie ([\w.]+)/.exec(navigator.userAgent.toLowerCase())||[],a.ui.ie=!!t.length,a.ui.ie6=6===parseFloat(t[1],10),a.fn.extend({disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(t){t.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}}),a.extend(a.ui,{plugin:{add:function(t,e,i){var s,o=a.ui[t].prototype;for(s in i)o.plugins[s]=o.plugins[s]||[],o.plugins[s].push([e,i[s]])},call:function(t,e,i){var s,o=t.plugins[e];if(o&&t.element[0].parentNode&&11!==t.element[0].parentNode.nodeType)for(s=0;s<o.length;s++)t.options[o[s][0]]&&o[s][1].apply(t.element,i)}},contains:a.contains,hasScroll:function(t,e){if("hidden"===a(t).css("overflow"))return!1;var i=e&&"left"===e?"scrollLeft":"scrollTop",e=!1;return 0<t[i]||(t[i]=1,e=0<t[i],t[i]=0,e)},isOverAxis:function(t,e,i){return e<t&&t<e+i},isOver:function(t,e,i,s,o,n){return a.ui.isOverAxis(t,i,o)&&a.ui.isOverAxis(e,s,n)}}))}(sQuery),function(l,a){var i=0,h=Array.prototype.slice,s=l.cleanData;l.cleanData=function(t){for(var e,i=0;null!=(e=t[i]);i++)try{l(e).triggerHandler("remove")}catch(t){}s(t)},l.widget=function(t,i,r){var e,s,o,n,a=t.split(".")[0];t=t.split(".")[1],r||(r=i,i=l.Widget),l.expr[":"][(e=a+"-"+t).toLowerCase()]=function(t){return!!l.data(t,e)},l[a]=l[a]||{},s=l[a][t],o=l[a][t]=function(t,e){if(!this._createWidget)return new o(t,e);arguments.length&&this._createWidget(t,e)},l.extend(o,s,{version:r.version,_proto:l.extend({},r),_childConstructors:[]}),(n=new i).options=l.widget.extend({},n.options),l.each(r,function(e,s){function o(){return i.prototype[e].apply(this,arguments)}function n(t){return i.prototype[e].apply(this,t)}l.isFunction(s)&&(r[e]=function(){var t,e=this._super,i=this._superApply;return this._super=o,this._superApply=n,t=s.apply(this,arguments),this._super=e,this._superApply=i,t})}),o.prototype=l.widget.extend(n,{widgetEventPrefix:s?n.widgetEventPrefix:t},r,{constructor:o,namespace:a,widgetName:t,widgetBaseClass:e,widgetFullName:e}),s?(l.each(s._childConstructors,function(t,e){var i=e.prototype;l.widget(i.namespace+"."+i.widgetName,o,e._proto)}),delete s._childConstructors):i._childConstructors.push(o),l.widget.bridge(t,o)},l.widget.extend=function(t){for(var e,i,s=h.call(arguments,1),o=0,n=s.length;o<n;o++)for(e in s[o])i=s[o][e],s[o].hasOwnProperty(e)&&i!==a&&(l.isPlainObject(i)?t[e]=l.isPlainObject(t[e])?l.widget.extend({},t[e],i):l.widget.extend({},i):t[e]=i);return t},l.widget.bridge=function(n,e){var r=e.prototype.widgetFullName||n;l.fn[n]=function(i){var t="string"==typeof i,s=h.call(arguments,1),o=this;return i=!t&&s.length?l.widget.extend.apply(null,[i].concat(s)):i,t?this.each(function(){var t,e=l.data(this,r);return e?l.isFunction(e[i])&&"_"!==i.charAt(0)?(t=e[i].apply(e,s))!==e&&t!==a?(o=t&&t.jquery?o.pushStack(t.get()):t,!1):void 0:l.error("no such method '"+i+"' for "+n+" widget instance"):l.error("cannot call methods on "+n+" prior to initialization; attempted to call method '"+i+"'")}):this.each(function(){var t=l.data(this,r);t?t.option(i||{})._init():l.data(this,r,new e(i,this))}),o}},l.Widget=function(){},l.Widget._childConstructors=[],l.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",defaultElement:"<div>",options:{disabled:!1,create:null},_createWidget:function(t,e){e=l(e||this.defaultElement||this)[0],this.element=l(e),this.uuid=i++,this.eventNamespace="."+this.widgetName+this.uuid,this.options=l.widget.extend({},this.options,this._getCreateOptions(),t),this.bindings=l(),this.hoverable=l(),this.focusable=l(),e!==this&&(l.data(e,this.widgetName,this),l.data(e,this.widgetFullName,this),this._on(!0,this.element,{remove:function(t){t.target===e&&this.destroy()}}),this.document=l(e.style?e.ownerDocument:e.document||e),this.window=l(this.document[0].defaultView||this.document[0].parentWindow)),this._create(),this._trigger("create",null,this._getCreateEventData()),this._init()},_getCreateOptions:l.noop,_getCreateEventData:l.noop,_create:l.noop,_init:l.noop,destroy:function(){this._destroy(),this.element.unbind(this.eventNamespace).removeData(this.widgetName).removeData(this.widgetFullName).removeData(l.camelCase(this.widgetFullName)),this.widget().unbind(this.eventNamespace).removeAttr("aria-disabled").removeClass(this.widgetFullName+"-disabled ui-state-disabled"),this.bindings.unbind(this.eventNamespace),this.hoverable.removeClass("ui-state-hover"),this.focusable.removeClass("ui-state-focus")},_destroy:l.noop,widget:function(){return this.element},option:function(t,e){var i,s,o,n=t;if(0===arguments.length)return l.widget.extend({},this.options);if("string"==typeof t)if(n={},t=(i=t.split(".")).shift(),i.length){for(s=n[t]=l.widget.extend({},this.options[t]),o=0;o<i.length-1;o++)s[i[o]]=s[i[o]]||{},s=s[i[o]];if(t=i.pop(),e===a)return s[t]===a?null:s[t];s[t]=e}else{if(e===a)return this.options[t]===a?null:this.options[t];n[t]=e}return this._setOptions(n),this},_setOptions:function(t){for(var e in t)this._setOption(e,t[e]);return this},_setOption:function(t,e){return this.options[t]=e,"disabled"===t&&(this.widget().toggleClass(this.widgetFullName+"-disabled ui-state-disabled",!!e).attr("aria-disabled",e),this.hoverable.removeClass("ui-state-hover"),this.focusable.removeClass("ui-state-focus")),this},enable:function(){return this._setOption("disabled",!1)},disable:function(){return this._setOption("disabled",!0)},_on:function(o,n,t){var r,a=this;"boolean"!=typeof o&&(t=n,n=o,o=!1),t?(n=r=l(n),this.bindings=this.bindings.add(n)):(t=n,n=this.element,r=this.widget()),l.each(t,function(t,e){function i(){if(o||!0!==a.options.disabled&&!l(this).hasClass("ui-state-disabled"))return("string"==typeof e?a[e]:e).apply(a,arguments)}"string"!=typeof e&&(i.guid=e.guid=e.guid||i.guid||l.guid++);var s=t.match(/^(\w+)\s*(.*)$/),t=s[1]+a.eventNamespace,s=s[2];s?r.delegate(s,t,i):n.bind(t,i)})},_off:function(t,e){e=(e||"").split(" ").join(this.eventNamespace+" ")+this.eventNamespace,t.unbind(e).undelegate(e)},_delay:function(t,e){var i=this;return setTimeout(function(){return("string"==typeof t?i[t]:t).apply(i,arguments)},e||0)},_hoverable:function(t){this.hoverable=this.hoverable.add(t),this._on(t,{mouseenter:function(t){l(t.currentTarget).addClass("ui-state-hover")},mouseleave:function(t){l(t.currentTarget).removeClass("ui-state-hover")}})},_focusable:function(t){this.focusable=this.focusable.add(t),this._on(t,{focusin:function(t){l(t.currentTarget).addClass("ui-state-focus")},focusout:function(t){l(t.currentTarget).removeClass("ui-state-focus")}})},_trigger:function(t,e,i){var s,o,n=this.options[t];if(i=i||{},(e=l.Event(e)).type=(t===this.widgetEventPrefix?t:this.widgetEventPrefix+t).toLowerCase(),e.target=this.element[0],o=e.originalEvent)for(s in o)s in e||(e[s]=o[s]);return this.element.trigger(e,i),!(l.isFunction(n)&&!1===n.apply(this.element[0],[e].concat(i))||e.isDefaultPrevented())}},l.each({show:"fadeIn",hide:"fadeOut"},function(n,r){l.Widget.prototype["_"+n]=function(e,t,i){var s=(t="string"==typeof t?{effect:t}:t)?!0!==t&&"number"!=typeof t&&t.effect||r:n,o=!l.isEmptyObject(t="number"==typeof(t=t||{})?{duration:t}:t);t.complete=i,t.delay&&e.delay(t.delay),o&&l.effects&&(l.effects.effect[s]||!1!==l.uiBackCompat&&l.effects[s])?e[n](t):s!==n&&e[s]?e[s](t.duration,t.easing,i):e.queue(function(t){l(this)[n](),i&&i.call(e[0]),t()})}}),!1!==l.uiBackCompat&&(l.Widget.prototype._getCreateOptions=function(){return l.metadata&&l.metadata.get(this.element[0])[this.widgetName]})}(sQuery),function(o){var n=!1;o(document).mouseup(function(t){n=!1}),o.widget("ui.mouse",{version:"1.9.2",options:{cancel:"input,textarea,button,select,option",distance:1,delay:0},_mouseInit:function(){var e=this;this.element.bind("mousedown."+this.widgetName,function(t){return e._mouseDown(t)}).bind("click."+this.widgetName,function(t){if(!0===o.data(t.target,e.widgetName+".preventClickEvent"))return o.removeData(t.target,e.widgetName+".preventClickEvent"),t.stopImmediatePropagation(),!1}),this.started=!1},_mouseDestroy:function(){this.element.unbind("."+this.widgetName),this._mouseMoveDelegate&&o(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate)},_mouseDown:function(t){if(!n){this._mouseStarted&&this._mouseUp(t),this._mouseDownEvent=t;var e=this,i=1===t.which,s=!("string"!=typeof this.options.cancel||!t.target.nodeName)&&o(t.target).closest(this.options.cancel).length;return i&&!s&&this._mouseCapture(t)?(this.mouseDelayMet=!this.options.delay,this.mouseDelayMet||(this._mouseDelayTimer=setTimeout(function(){e.mouseDelayMet=!0},this.options.delay)),this._mouseDistanceMet(t)&&this._mouseDelayMet(t)&&(this._mouseStarted=!1!==this._mouseStart(t),!this._mouseStarted)?(t.preventDefault(),!0):(!0===o.data(t.target,this.widgetName+".preventClickEvent")&&o.removeData(t.target,this.widgetName+".preventClickEvent"),this._mouseMoveDelegate=function(t){return e._mouseMove(t)},this._mouseUpDelegate=function(t){return e._mouseUp(t)},o(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate),t.preventDefault(),n=!0)):!0}},_mouseMove:function(t){return!o.ui.ie||9<=document.documentMode||t.button?this._mouseStarted?(this._mouseDrag(t),t.preventDefault()):(this._mouseDistanceMet(t)&&this._mouseDelayMet(t)&&(this._mouseStarted=!1!==this._mouseStart(this._mouseDownEvent,t),this._mouseStarted?this._mouseDrag(t):this._mouseUp(t)),!this._mouseStarted):this._mouseUp(t)},_mouseUp:function(t){return o(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate),this._mouseStarted&&(this._mouseStarted=!1,t.target===this._mouseDownEvent.target&&o.data(t.target,this.widgetName+".preventClickEvent",!0),this._mouseStop(t)),!1},_mouseDistanceMet:function(t){return Math.max(Math.abs(this._mouseDownEvent.pageX-t.pageX),Math.abs(this._mouseDownEvent.pageY-t.pageY))>=this.options.distance},_mouseDelayMet:function(t){return this.mouseDelayMet},_mouseStart:function(t){},_mouseDrag:function(t){},_mouseStop:function(t){},_mouseCapture:function(t){return!0}})}(sQuery),function(P){P.ui=P.ui||{};var s,o,n,x=Math.max,T=Math.abs,D=Math.round,r=/left|center|right/,a=/top|center|bottom/,l=/[\+\-]\d+%?/,h=/^\w+/,c=/%$/,e=P.fn.position;function W(t,e,i){return[parseInt(t[0],10)*(c.test(t[0])?e/100:1),parseInt(t[1],10)*(c.test(t[1])?i/100:1)]}function N(t,e){return parseInt(P.css(t,e),10)||0}P.position={scrollbarWidth:function(){if(void 0!==s)return s;var t,e=P("<div style='display:block;width:50px;height:50px;overflow:hidden;'><div style='height:100px;width:auto;'></div></div>"),i=e.children()[0];return P("body").append(e),t=i.offsetWidth,e.css("overflow","scroll"),t===(i=i.offsetWidth)&&(i=e[0].clientWidth),e.remove(),s=t-i},getScrollInfo:function(t){var e=t.isWindow?"":t.element.css("overflow-x"),i=t.isWindow?"":t.element.css("overflow-y"),e="scroll"===e||"auto"===e&&t.width<t.element[0].scrollWidth,t="scroll"===i||"auto"===i&&t.height<t.element[0].scrollHeight;return{width:e?P.position.scrollbarWidth():0,height:t?P.position.scrollbarWidth():0}},getWithinInfo:function(t){var e=P(t||window),t=P.isWindow(e[0]);return{element:e,isWindow:t,offset:e.offset()||{left:0,top:0},scrollLeft:e.scrollLeft(),scrollTop:e.scrollTop(),width:t?e.width():e.outerWidth(),height:t?e.height():e.outerHeight()}}},P.fn.position=function(p){if(!p||!p.of)return e.apply(this,arguments);p=P.extend({},p);var f,u,d,g=P(p.of),m=P.position.getWithinInfo(p.within),v=P.position.getScrollInfo(m),t=g[0],b=(p.collision||"flip").split(" "),_={},w=9===t.nodeType?(u=g.width(),d=g.height(),{top:0,left:0}):P.isWindow(t)?(u=g.width(),d=g.height(),{top:g.scrollTop(),left:g.scrollLeft()}):t.preventDefault?(p.at="left top",u=d=0,{top:t.pageY,left:t.pageX}):(u=g.outerWidth(),d=g.outerHeight(),g.offset()),y=P.extend({},w);return P.each(["my","at"],function(){var t,e,i=(p[this]||"").split(" ");(i=1===i.length?r.test(i[0])?i.concat(["center"]):a.test(i[0])?["center"].concat(i):["center","center"]:i)[0]=r.test(i[0])?i[0]:"center",i[1]=a.test(i[1])?i[1]:"center",t=l.exec(i[0]),e=l.exec(i[1]),_[this]=[t?t[0]:0,e?e[0]:0],p[this]=[h.exec(i[0])[0],h.exec(i[1])[0]]}),1===b.length&&(b[1]=b[0]),"right"===p.at[0]?y.left+=u:"center"===p.at[0]&&(y.left+=u/2),"bottom"===p.at[1]?y.top+=d:"center"===p.at[1]&&(y.top+=d/2),f=W(_.at,u,d),y.left+=f[0],y.top+=f[1],this.each(function(){var i,t,r=P(this),a=r.outerWidth(),l=r.outerHeight(),e=N(this,"marginLeft"),s=N(this,"marginTop"),o=a+e+N(this,"marginRight")+v.width,n=l+s+N(this,"marginBottom")+v.height,h=P.extend({},y),c=W(_.my,r.outerWidth(),r.outerHeight());"right"===p.my[0]?h.left-=a:"center"===p.my[0]&&(h.left-=a/2),"bottom"===p.my[1]?h.top-=l:"center"===p.my[1]&&(h.top-=l/2),h.left+=c[0],h.top+=c[1],P.support.offsetFractions||(h.left=D(h.left),h.top=D(h.top)),i={marginLeft:e,marginTop:s},P.each(["left","top"],function(t,e){P.ui.position[b[t]]&&P.ui.position[b[t]][e](h,{targetWidth:u,targetHeight:d,elemWidth:a,elemHeight:l,collisionPosition:i,collisionWidth:o,collisionHeight:n,offset:[f[0]+c[0],f[1]+c[1]],my:p.my,at:p.at,within:m,elem:r})}),P.fn.bgiframe&&r.bgiframe(),p.using&&(t=function(t){var e=w.left-h.left,i=e+u-a,s=w.top-h.top,o=s+d-l,n={target:{element:g,left:w.left,top:w.top,width:u,height:d},element:{element:r,left:h.left,top:h.top,width:a,height:l},horizontal:i<0?"left":0<e?"right":"center",vertical:o<0?"top":0<s?"bottom":"middle"};u<a&&T(e+i)<u&&(n.horizontal="center"),d<l&&T(s+o)<d&&(n.vertical="middle"),x(T(e),T(i))>x(T(s),T(o))?n.important="horizontal":n.important="vertical",p.using.call(this,t,n)}),r.offset(P.extend(h,{using:t}))})},P.ui.position={fit:{left:function(t,e){var i=e.within,s=i.isWindow?i.scrollLeft:i.offset.left,o=i.width,n=t.left-e.collisionPosition.marginLeft,r=s-n,a=n+e.collisionWidth-o-s;e.collisionWidth>o?0<r&&a<=0?(i=t.left+r+e.collisionWidth-o-s,t.left+=r-i):t.left=!(0<a&&r<=0)&&a<r?s+o-e.collisionWidth:s:0<r?t.left+=r:0<a?t.left-=a:t.left=x(t.left-n,t.left)},top:function(t,e){var i=e.within,s=i.isWindow?i.scrollTop:i.offset.top,o=e.within.height,n=t.top-e.collisionPosition.marginTop,r=s-n,a=n+e.collisionHeight-o-s;e.collisionHeight>o?0<r&&a<=0?(i=t.top+r+e.collisionHeight-o-s,t.top+=r-i):t.top=!(0<a&&r<=0)&&a<r?s+o-e.collisionHeight:s:0<r?t.top+=r:0<a?t.top-=a:t.top=x(t.top-n,t.top)}},flip:{left:function(t,e){var i=e.within,s=i.offset.left+i.scrollLeft,o=i.width,n=i.isWindow?i.scrollLeft:i.offset.left,r=t.left-e.collisionPosition.marginLeft,a=r-n,l=r+e.collisionWidth-o-n,h="left"===e.my[0]?-e.elemWidth:"right"===e.my[0]?e.elemWidth:0,i="left"===e.at[0]?e.targetWidth:"right"===e.at[0]?-e.targetWidth:0,r=-2*e.offset[0];a<0?((s=t.left+h+i+r+e.collisionWidth-o-s)<0||s<T(a))&&(t.left+=h+i+r):0<l&&(0<(n=t.left-e.collisionPosition.marginLeft+h+i+r-n)||T(n)<l)&&(t.left+=h+i+r)},top:function(t,e){var i=e.within,s=i.offset.top+i.scrollTop,o=i.height,n=i.isWindow?i.scrollTop:i.offset.top,r=t.top-e.collisionPosition.marginTop,a=r-n,l=r+e.collisionHeight-o-n,h="top"===e.my[1]?-e.elemHeight:"bottom"===e.my[1]?e.elemHeight:0,i="top"===e.at[1]?e.targetHeight:"bottom"===e.at[1]?-e.targetHeight:0,r=-2*e.offset[1];a<0?(s=t.top+h+i+r+e.collisionHeight-o-s,t.top+h+i+r>a&&(s<0||s<T(a))&&(t.top+=h+i+r)):0<l&&(n=t.top-e.collisionPosition.marginTop+h+i+r-n,t.top+h+i+r>l&&(0<n||T(n)<l)&&(t.top+=h+i+r))}},flipfit:{left:function(){P.ui.position.flip.left.apply(this,arguments),P.ui.position.fit.left.apply(this,arguments)},top:function(){P.ui.position.flip.top.apply(this,arguments),P.ui.position.fit.top.apply(this,arguments)}}},function(){var t,e=document.getElementsByTagName("body")[0],i=document.createElement("div"),s=document.createElement(e?"div":"body"),o={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"};for(t in e&&P.extend(o,{position:"absolute",left:"-1000px",top:"-1000px"}),o)s.style[t]=o[t];s.appendChild(i),(e=e||document.documentElement).insertBefore(s,e.firstChild),i.style.cssText="position: absolute; left: 10.7432222px;",i=P(i).offset().left,P.support.offsetFractions=10<i&&i<11,s.innerHTML="",e.removeChild(s)}(),!1!==P.uiBackCompat&&(o=sQuery,n=o.fn.position,o.fn.position=function(t){if(!t||!t.offset)return n.call(this,t);var e=t.offset.split(" "),i=t.at.split(" ");return 1===e.length&&(e[1]=e[0]),/^\d/.test(e[0])&&(e[0]="+"+e[0]),/^\d/.test(e[1])&&(e[1]="+"+e[1]),1===i.length&&(/left|center|right/.test(i[0])?i[1]="center":(i[1]=i[0],i[0]="center")),n.call(this,o.extend(t,{at:i[0]+e[0]+" "+i[1]+e[1],offset:void 0}))})}(sQuery),function(_){_.widget("ui.draggable",_.ui.mouse,{version:"1.9.2",widgetEventPrefix:"drag",options:{addClasses:!0,appendTo:"parent",axis:!1,connectToSortable:!1,containment:!1,cursor:"auto",cursorAt:!1,grid:!1,handle:!1,helper:"original",iframeFix:!1,opacity:!1,refreshPositions:!1,revert:!1,revertDuration:500,scope:"default",scroll:!0,scrollSensitivity:20,scrollSpeed:20,snap:!1,snapMode:"both",snapTolerance:20,stack:!1,zIndex:!1},_create:function(){"original"!=this.options.helper||/^(?:r|a|f)/.test(this.element.css("position"))||(this.element[0].style.position="relative"),this.options.addClasses&&this.element.addClass("ui-draggable"),this.options.disabled&&this.element.addClass("ui-draggable-disabled"),this._mouseInit()},_destroy:function(){this.element.removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled"),this._mouseDestroy()},_mouseCapture:function(t){var e=this.options;return!(this.helper||e.disabled||_(t.target).is(".ui-resizable-handle"))&&(this.handle=this._getHandle(t),!!this.handle&&(_(!0===e.iframeFix?"iframe":e.iframeFix).each(function(){_('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1e3}).css(_(this).offset()).appendTo("body")}),!0))},_mouseStart:function(t){var e=this.options;return this.helper=this._createHelper(t),this.helper.addClass("ui-draggable-dragging"),this._cacheHelperProportions(),_.ui.ddmanager&&(_.ui.ddmanager.current=this),this._cacheMargins(),this.cssPosition=this.helper.css("position"),this.scrollParent=this.helper.scrollParent(),this.offset=this.positionAbs=this.element.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},_.extend(this.offset,{click:{left:t.pageX-this.offset.left,top:t.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this.position=this._generatePosition(t),this.originalPageX=t.pageX,this.originalPageY=t.pageY,e.cursorAt&&this._adjustOffsetFromHelper(e.cursorAt),e.containment&&this._setContainment(),!1===this._trigger("start",t)?(this._clear(),!1):(this._cacheHelperProportions(),_.ui.ddmanager&&!e.dropBehaviour&&_.ui.ddmanager.prepareOffsets(this,t),this._mouseDrag(t,!0),_.ui.ddmanager&&_.ui.ddmanager.dragStart(this,t),!0)},_mouseDrag:function(t,e){if(this.position=this._generatePosition(t),this.positionAbs=this._convertPositionTo("absolute"),!e){e=this._uiHash();if(!1===this._trigger("drag",t,e))return this._mouseUp({}),!1;this.position=e.position}return this.options.axis&&"y"==this.options.axis||(this.helper[0].style.left=this.position.left+"px"),this.options.axis&&"x"==this.options.axis||(this.helper[0].style.top=this.position.top+"px"),_.ui.ddmanager&&_.ui.ddmanager.drag(this,t),!1},_mouseStop:function(t){var e=!1;_.ui.ddmanager&&!this.options.dropBehaviour&&(e=_.ui.ddmanager.drop(this,t)),this.dropped&&(e=this.dropped,this.dropped=!1);for(var i,s=this.element[0],o=!1;s=s&&s.parentNode;)s==document&&(o=!0);return(o||"original"!==this.options.helper)&&("invalid"==this.options.revert&&!e||"valid"==this.options.revert&&e||!0===this.options.revert||_.isFunction(this.options.revert)&&this.options.revert.call(this.element,e)?_((i=this).helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){!1!==i._trigger("stop",t)&&i._clear()}):!1!==this._trigger("stop",t)&&this._clear()),!1},_mouseUp:function(t){return _("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)}),_.ui.ddmanager&&_.ui.ddmanager.dragStop(this,t),_.ui.mouse.prototype._mouseUp.call(this,t)},cancel:function(){return this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear(),this},_getHandle:function(t){var e=!this.options.handle||!_(this.options.handle,this.element).length;return _(this.options.handle,this.element).find("*").andSelf().each(function(){this==t.target&&(e=!0)}),e},_createHelper:function(t){var e=this.options,t=_.isFunction(e.helper)?_(e.helper.apply(this.element[0],[t])):"clone"==e.helper?this.element.clone().removeAttr("id"):this.element;return t.parents("body").length||t.appendTo("parent"==e.appendTo?this.element[0].parentNode:e.appendTo),t[0]==this.element[0]||/(fixed|absolute)/.test(t.css("position"))||t.css("position","absolute"),t},_adjustOffsetFromHelper:function(t){"string"==typeof t&&(t=t.split(" ")),"left"in(t=_.isArray(t)?{left:+t[0],top:+t[1]||0}:t)&&(this.offset.click.left=t.left+this.margins.left),"right"in t&&(this.offset.click.left=this.helperProportions.width-t.right+this.margins.left),"top"in t&&(this.offset.click.top=t.top+this.margins.top),"bottom"in t&&(this.offset.click.top=this.helperProportions.height-t.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var t=this.offsetParent.offset();return"absolute"==this.cssPosition&&this.scrollParent[0]!=document&&_.contains(this.scrollParent[0],this.offsetParent[0])&&(t.left+=this.scrollParent.scrollLeft(),t.top+=this.scrollParent.scrollTop()),{top:(t=this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&"html"==this.offsetParent[0].tagName.toLowerCase()&&_.ui.ie?{top:0,left:0}:t).top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:t.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if("relative"!=this.cssPosition)return{top:0,left:0};var t=this.element.position();return{top:t.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:t.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var t,e,i=this.options;"parent"==i.containment&&(i.containment=this.helper[0].parentNode),"document"!=i.containment&&"window"!=i.containment||(this.containment=["document"==i.containment?0:_(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,"document"==i.containment?0:_(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,("document"==i.containment?0:_(window).scrollLeft())+_("document"==i.containment?document:window).width()-this.helperProportions.width-this.margins.left,("document"==i.containment?0:_(window).scrollTop())+(_("document"==i.containment?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]),/^(document|window|parent)$/.test(i.containment)||i.containment.constructor==Array?i.containment.constructor==Array&&(this.containment=i.containment):(e=(t=_(i.containment))[0])&&(t.offset(),i="hidden"!=_(e).css("overflow"),this.containment=[(parseInt(_(e).css("borderLeftWidth"),10)||0)+(parseInt(_(e).css("paddingLeft"),10)||0),(parseInt(_(e).css("borderTopWidth"),10)||0)+(parseInt(_(e).css("paddingTop"),10)||0),(i?Math.max(e.scrollWidth,e.offsetWidth):e.offsetWidth)-(parseInt(_(e).css("borderLeftWidth"),10)||0)-(parseInt(_(e).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(i?Math.max(e.scrollHeight,e.offsetHeight):e.offsetHeight)-(parseInt(_(e).css("borderTopWidth"),10)||0)-(parseInt(_(e).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom],this.relative_container=t)},_convertPositionTo:function(t,e){e=e||this.position;var i="absolute"==t?1:-1,s=(this.options,"absolute"!=this.cssPosition||this.scrollParent[0]!=document&&_.contains(this.scrollParent[0],this.offsetParent[0])?this.scrollParent:this.offsetParent),t=/(html|body)/i.test(s[0].tagName);return{top:e.top+this.offset.relative.top*i+this.offset.parent.top*i-("fixed"==this.cssPosition?-this.scrollParent.scrollTop():t?0:s.scrollTop())*i,left:e.left+this.offset.relative.left*i+this.offset.parent.left*i-("fixed"==this.cssPosition?-this.scrollParent.scrollLeft():t?0:s.scrollLeft())*i}},_generatePosition:function(t){var e,i=this.options,s="absolute"!=this.cssPosition||this.scrollParent[0]!=document&&_.contains(this.scrollParent[0],this.offsetParent[0])?this.scrollParent:this.offsetParent,o=/(html|body)/i.test(s[0].tagName),n=t.pageX,r=t.pageY;return this.originalPosition&&(this.containment&&(e=this.relative_container?(e=this.relative_container.offset(),[this.containment[0]+e.left,this.containment[1]+e.top,this.containment[2]+e.left,this.containment[3]+e.top]):this.containment,t.pageX-this.offset.click.left<e[0]&&(n=e[0]+this.offset.click.left),t.pageY-this.offset.click.top<e[1]&&(r=e[1]+this.offset.click.top),t.pageX-this.offset.click.left>e[2]&&(n=e[2]+this.offset.click.left),t.pageY-this.offset.click.top>e[3]&&(r=e[3]+this.offset.click.top)),i.grid&&(t=i.grid[1]?this.originalPageY+Math.round((r-this.originalPageY)/i.grid[1])*i.grid[1]:this.originalPageY,r=e&&(t-this.offset.click.top<e[1]||t-this.offset.click.top>e[3])?t-this.offset.click.top<e[1]?t+i.grid[1]:t-i.grid[1]:t,t=i.grid[0]?this.originalPageX+Math.round((n-this.originalPageX)/i.grid[0])*i.grid[0]:this.originalPageX,n=e&&(t-this.offset.click.left<e[0]||t-this.offset.click.left>e[2])?t-this.offset.click.left<e[0]?t+i.grid[0]:t-i.grid[0]:t)),{top:r-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+("fixed"==this.cssPosition?-this.scrollParent.scrollTop():o?0:s.scrollTop()),left:n-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+("fixed"==this.cssPosition?-this.scrollParent.scrollLeft():o?0:s.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging"),this.helper[0]==this.element[0]||this.cancelHelperRemoval||this.helper.remove(),this.helper=null,this.cancelHelperRemoval=!1},_trigger:function(t,e,i){return i=i||this._uiHash(),_.ui.plugin.call(this,t,[e,i]),"drag"==t&&(this.positionAbs=this._convertPositionTo("absolute")),_.Widget.prototype._trigger.call(this,t,e,i)},plugins:{},_uiHash:function(t){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}}),_.ui.plugin.add("draggable","connectToSortable",{start:function(e,t){var i=_(this).data("draggable"),s=i.options,o=_.extend({},t,{item:i.element});i.sortables=[],_(s.connectToSortable).each(function(){var t=_.data(this,"sortable");t&&!t.options.disabled&&(i.sortables.push({instance:t,shouldRevert:t.options.revert}),t.refreshPositions(),t._trigger("activate",e,o))})},stop:function(t,e){var i=_(this).data("draggable"),s=_.extend({},e,{item:i.element});_.each(i.sortables,function(){this.instance.isOver?(this.instance.isOver=0,i.cancelHelperRemoval=!0,this.instance.cancelHelperRemoval=!1,this.shouldRevert&&(this.instance.options.revert=!0),this.instance._mouseStop(t),this.instance.options.helper=this.instance.options._helper,"original"==i.options.helper&&this.instance.currentItem.css({top:"auto",left:"auto"})):(this.instance.cancelHelperRemoval=!1,this.instance._trigger("deactivate",t,s))})},drag:function(s,o){var n=_(this).data("draggable"),r=this;_.each(n.sortables,function(t){var e=!1,i=this;this.instance.positionAbs=n.positionAbs,this.instance.helperProportions=n.helperProportions,this.instance.offset.click=n.offset.click,this.instance._intersectsWith(this.instance.containerCache)&&(e=!0,_.each(n.sortables,function(){return this.instance.positionAbs=n.positionAbs,this.instance.helperProportions=n.helperProportions,this.instance.offset.click=n.offset.click,e=this!=i&&this.instance._intersectsWith(this.instance.containerCache)&&_.ui.contains(i.instance.element[0],this.instance.element[0])?!1:e})),e?(this.instance.isOver||(this.instance.isOver=1,this.instance.currentItem=_(r).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",!0),this.instance.options._helper=this.instance.options.helper,this.instance.options.helper=function(){return o.helper[0]},s.target=this.instance.currentItem[0],this.instance._mouseCapture(s,!0),this.instance._mouseStart(s,!0,!0),this.instance.offset.click.top=n.offset.click.top,this.instance.offset.click.left=n.offset.click.left,this.instance.offset.parent.left-=n.offset.parent.left-this.instance.offset.parent.left,this.instance.offset.parent.top-=n.offset.parent.top-this.instance.offset.parent.top,n._trigger("toSortable",s),n.dropped=this.instance.element,n.currentItem=n.element,this.instance.fromOutside=n),this.instance.currentItem&&this.instance._mouseDrag(s)):this.instance.isOver&&(this.instance.isOver=0,this.instance.cancelHelperRemoval=!0,this.instance.options.revert=!1,this.instance._trigger("out",s,this.instance._uiHash(this.instance)),this.instance._mouseStop(s,!0),this.instance.options.helper=this.instance.options._helper,this.instance.currentItem.remove(),this.instance.placeholder&&this.instance.placeholder.remove(),n._trigger("fromSortable",s),n.dropped=!1)})}}),_.ui.plugin.add("draggable","cursor",{start:function(t,e){var i=_("body"),s=_(this).data("draggable").options;i.css("cursor")&&(s._cursor=i.css("cursor")),i.css("cursor",s.cursor)},stop:function(t,e){var i=_(this).data("draggable").options;i._cursor&&_("body").css("cursor",i._cursor)}}),_.ui.plugin.add("draggable","opacity",{start:function(t,e){var i=_(e.helper),e=_(this).data("draggable").options;i.css("opacity")&&(e._opacity=i.css("opacity")),i.css("opacity",e.opacity)},stop:function(t,e){var i=_(this).data("draggable").options;i._opacity&&_(e.helper).css("opacity",i._opacity)}}),_.ui.plugin.add("draggable","scroll",{start:function(t,e){var i=_(this).data("draggable");i.scrollParent[0]!=document&&"HTML"!=i.scrollParent[0].tagName&&(i.overflowOffset=i.scrollParent.offset())},drag:function(t,e){var i=_(this).data("draggable"),s=i.options,o=!1;i.scrollParent[0]!=document&&"HTML"!=i.scrollParent[0].tagName?(s.axis&&"x"==s.axis||(i.overflowOffset.top+i.scrollParent[0].offsetHeight-t.pageY<s.scrollSensitivity?i.scrollParent[0].scrollTop=o=i.scrollParent[0].scrollTop+s.scrollSpeed:t.pageY-i.overflowOffset.top<s.scrollSensitivity&&(i.scrollParent[0].scrollTop=o=i.scrollParent[0].scrollTop-s.scrollSpeed)),s.axis&&"y"==s.axis||(i.overflowOffset.left+i.scrollParent[0].offsetWidth-t.pageX<s.scrollSensitivity?i.scrollParent[0].scrollLeft=o=i.scrollParent[0].scrollLeft+s.scrollSpeed:t.pageX-i.overflowOffset.left<s.scrollSensitivity&&(i.scrollParent[0].scrollLeft=o=i.scrollParent[0].scrollLeft-s.scrollSpeed))):(s.axis&&"x"==s.axis||(t.pageY-_(document).scrollTop()<s.scrollSensitivity?o=_(document).scrollTop(_(document).scrollTop()-s.scrollSpeed):_(window).height()-(t.pageY-_(document).scrollTop())<s.scrollSensitivity&&(o=_(document).scrollTop(_(document).scrollTop()+s.scrollSpeed))),s.axis&&"y"==s.axis||(t.pageX-_(document).scrollLeft()<s.scrollSensitivity?o=_(document).scrollLeft(_(document).scrollLeft()-s.scrollSpeed):_(window).width()-(t.pageX-_(document).scrollLeft())<s.scrollSensitivity&&(o=_(document).scrollLeft(_(document).scrollLeft()+s.scrollSpeed)))),!1!==o&&_.ui.ddmanager&&!s.dropBehaviour&&_.ui.ddmanager.prepareOffsets(i,t)}}),_.ui.plugin.add("draggable","snap",{start:function(t,e){var i=_(this).data("draggable"),s=i.options;i.snapElements=[],_(s.snap.constructor!=String?s.snap.items||":data(draggable)":s.snap).each(function(){var t=_(this),e=t.offset();this!=i.element[0]&&i.snapElements.push({item:this,width:t.outerWidth(),height:t.outerHeight(),top:e.top,left:e.left})})},drag:function(t,e){for(var i=_(this).data("draggable"),s=i.options,o=s.snapTolerance,n=e.offset.left,r=n+i.helperProportions.width,a=e.offset.top,l=a+i.helperProportions.height,h=i.snapElements.length-1;0<=h;h--){var c,p,f,u,d,g=i.snapElements[h].left,m=g+i.snapElements[h].width,v=i.snapElements[h].top,b=v+i.snapElements[h].height;g-o<n&&n<m+o&&v-o<a&&a<b+o||g-o<n&&n<m+o&&v-o<l&&l<b+o||g-o<r&&r<m+o&&v-o<a&&a<b+o||g-o<r&&r<m+o&&v-o<l&&l<b+o?("inner"!=s.snapMode&&(p=Math.abs(v-l)<=o,f=Math.abs(b-a)<=o,u=Math.abs(g-r)<=o,d=Math.abs(m-n)<=o,p&&(e.position.top=i._convertPositionTo("relative",{top:v-i.helperProportions.height,left:0}).top-i.margins.top),f&&(e.position.top=i._convertPositionTo("relative",{top:b,left:0}).top-i.margins.top),u&&(e.position.left=i._convertPositionTo("relative",{top:0,left:g-i.helperProportions.width}).left-i.margins.left),d&&(e.position.left=i._convertPositionTo("relative",{top:0,left:m}).left-i.margins.left)),c=p||f||u||d,"outer"!=s.snapMode&&(p=Math.abs(v-a)<=o,f=Math.abs(b-l)<=o,u=Math.abs(g-n)<=o,d=Math.abs(m-r)<=o,p&&(e.position.top=i._convertPositionTo("relative",{top:v,left:0}).top-i.margins.top),f&&(e.position.top=i._convertPositionTo("relative",{top:b-i.helperProportions.height,left:0}).top-i.margins.top),u&&(e.position.left=i._convertPositionTo("relative",{top:0,left:g}).left-i.margins.left),d&&(e.position.left=i._convertPositionTo("relative",{top:0,left:m-i.helperProportions.width}).left-i.margins.left)),!i.snapElements[h].snapping&&(p||f||u||d||c)&&i.options.snap.snap&&i.options.snap.snap.call(i.element,t,_.extend(i._uiHash(),{snapItem:i.snapElements[h].item})),i.snapElements[h].snapping=p||f||u||d||c):(i.snapElements[h].snapping&&i.options.snap.release&&i.options.snap.release.call(i.element,t,_.extend(i._uiHash(),{snapItem:i.snapElements[h].item})),i.snapElements[h].snapping=!1)}}}),_.ui.plugin.add("draggable","stack",{start:function(t,e){var i,s=_(this).data("draggable").options,s=_.makeArray(_(s.stack)).sort(function(t,e){return(parseInt(_(t).css("zIndex"),10)||0)-(parseInt(_(e).css("zIndex"),10)||0)});s.length&&(i=parseInt(s[0].style.zIndex)||0,_(s).each(function(t){this.style.zIndex=i+t}),this[0].style.zIndex=i+s.length)}}),_.ui.plugin.add("draggable","zIndex",{start:function(t,e){var i=_(e.helper),e=_(this).data("draggable").options;i.css("zIndex")&&(e._zIndex=i.css("zIndex")),i.css("zIndex",e.zIndex)},stop:function(t,e){var i=_(this).data("draggable").options;i._zIndex&&_(e.helper).css("zIndex",i._zIndex)}})}(sQuery);
|
assets/js/main.js
DELETED
|
@@ -1,249 +0,0 @@
|
|
| 1 |
-
(function($) {
|
| 2 |
-
window.Shareaholic = window.Shareaholic || {};
|
| 3 |
-
window.shareaholic_debug = true;
|
| 4 |
-
|
| 5 |
-
Shareaholic.bind_button_clicks = function (click_object, off) {
|
| 6 |
-
if (off) {
|
| 7 |
-
$( click_object.selector ).off( 'click.app_settings' );
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
$( click_object.selector ).off( 'click.app_settings' ).on(
|
| 11 |
-
'click.app_settings',
|
| 12 |
-
function (e) {
|
| 13 |
-
button = this;
|
| 14 |
-
e.preventDefault();
|
| 15 |
-
url = click_object.url( this );
|
| 16 |
-
if (click_object.selector == '#general_settings' || click_object.selector == '#affiliate_settings') {
|
| 17 |
-
window.open( url );
|
| 18 |
-
return false;
|
| 19 |
-
} else {
|
| 20 |
-
$frame = $( '<iframe>', { src:url } ).appendTo( '#iframe_container' );
|
| 21 |
-
if (click_object.callback) {
|
| 22 |
-
click_object.callback( this );
|
| 23 |
-
}
|
| 24 |
-
$( '#editing_modal' ).reveal(
|
| 25 |
-
{
|
| 26 |
-
topPosition:50,
|
| 27 |
-
close:function () {
|
| 28 |
-
if (click_object.close) {
|
| 29 |
-
click_object.close( button );
|
| 30 |
-
}
|
| 31 |
-
$frame.remove();
|
| 32 |
-
}
|
| 33 |
-
}
|
| 34 |
-
);
|
| 35 |
-
}
|
| 36 |
-
}
|
| 37 |
-
);
|
| 38 |
-
}
|
| 39 |
-
|
| 40 |
-
Shareaholic.click_objects = {
|
| 41 |
-
'app_settings': {
|
| 42 |
-
selector: '#app_settings button',
|
| 43 |
-
url: function(button) {
|
| 44 |
-
id = $( button ).data( 'location_id' );
|
| 45 |
-
app = $( button ).data( 'app' )
|
| 46 |
-
url = first_part_of_url + $( button ).data( 'href' ) + '?embedded=true&'
|
| 47 |
-
+ 'verification_key=' + verification_key;
|
| 48 |
-
url = url.replace( /{{id}}/, id );
|
| 49 |
-
return url;
|
| 50 |
-
},
|
| 51 |
-
callback: function(button) {
|
| 52 |
-
$modal = $( '.reveal-modal' );
|
| 53 |
-
$modal.addClass( 'has-shortcode' )
|
| 54 |
-
id = $( button ).data( 'location_id' );
|
| 55 |
-
app = $( button ).data( 'app' );
|
| 56 |
-
text = 'You can also use this shortcode to place this {{app}} App anywhere.';
|
| 57 |
-
html = "<div id='shortcode_container'> \
|
| 58 |
-
<span id='shortcode_description'></span> \
|
| 59 |
-
<textarea id='shortcode' name='widget_div' onclick='select();' readonly='readonly'></textarea> \
|
| 60 |
-
</div>"
|
| 61 |
-
$( html ).appendTo( $modal );
|
| 62 |
-
$( '#shortcode_description' ).text( text.replace( /{{app}}/, Shareaholic.titlecase( app ) ) );
|
| 63 |
-
$( '#shortcode' ).text( '[shareaholic app="' + app + '" id="' + id + '"]' );
|
| 64 |
-
},
|
| 65 |
-
close: function(button) {
|
| 66 |
-
$( '#shortcode_container' ).remove();
|
| 67 |
-
$( '.reveal-modal' ).removeClass( 'has-shortcode' );
|
| 68 |
-
}
|
| 69 |
-
},
|
| 70 |
-
|
| 71 |
-
'affiliate_settings': {
|
| 72 |
-
selector: '#affiliate_settings',
|
| 73 |
-
url: function(button) {
|
| 74 |
-
return first_part_of_url + 'websites/edit/'
|
| 75 |
-
+ '?verification_key=' + verification_key;
|
| 76 |
-
}
|
| 77 |
-
},
|
| 78 |
-
|
| 79 |
-
'general_settings': {
|
| 80 |
-
selector: '#general_settings',
|
| 81 |
-
url: function(button) {
|
| 82 |
-
return first_part_of_url + 'websites/edit/'
|
| 83 |
-
+ '?verification_key=' + verification_key;
|
| 84 |
-
}
|
| 85 |
-
},
|
| 86 |
-
'app_wide_settings': {
|
| 87 |
-
selector: '.app_wide_settings',
|
| 88 |
-
url: function(button) {
|
| 89 |
-
url = first_part_of_url + $( button ).data( 'href' ) + '?embedded=true&'
|
| 90 |
-
+ 'verification_key=' + verification_key;
|
| 91 |
-
return url
|
| 92 |
-
}
|
| 93 |
-
}
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
Shareaholic.Utils.PostMessage.receive(
|
| 97 |
-
'settings_saved',
|
| 98 |
-
{
|
| 99 |
-
success: function(data) {
|
| 100 |
-
$( 'input[type="submit"]' ).click();
|
| 101 |
-
},
|
| 102 |
-
failure: function(data) {
|
| 103 |
-
console.log( data );
|
| 104 |
-
}
|
| 105 |
-
}
|
| 106 |
-
);
|
| 107 |
-
|
| 108 |
-
Shareaholic.titlecase = function(string) {
|
| 109 |
-
return string.charAt( 0 ).toUpperCase() + string.replace(
|
| 110 |
-
/_[a-z]/g,
|
| 111 |
-
function(match) {
|
| 112 |
-
return match.toUpperCase().replace( /_/, ' ' );
|
| 113 |
-
}
|
| 114 |
-
).slice( 1 );
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
Shareaholic.disable_buttons = function() {
|
| 118 |
-
$( '#app_settings button' ).each(
|
| 119 |
-
function() {
|
| 120 |
-
if ( ! $( this ).data( 'location_id' ) && ! this.id == 'app_wide_settings') {
|
| 121 |
-
$( this ).attr( 'disabled', 'disabled' );
|
| 122 |
-
} else {
|
| 123 |
-
$( this ).removeAttr( 'disabled' );
|
| 124 |
-
}
|
| 125 |
-
}
|
| 126 |
-
);
|
| 127 |
-
}
|
| 128 |
-
|
| 129 |
-
Shareaholic.create_new_location = function(_this) {
|
| 130 |
-
button = $( _this ).siblings( 'button' )
|
| 131 |
-
app = button.data( 'app' )
|
| 132 |
-
location_id = button.data( 'location_id' )
|
| 133 |
-
if ( ! ! location_id) {
|
| 134 |
-
return;
|
| 135 |
-
}
|
| 136 |
-
|
| 137 |
-
data = {}
|
| 138 |
-
data['configuration_' + app + '_location'] = {
|
| 139 |
-
name: /.*\[(.*)\]/.exec( $( _this ).attr( 'name' ) )[1]
|
| 140 |
-
}
|
| 141 |
-
|
| 142 |
-
$.ajax(
|
| 143 |
-
{
|
| 144 |
-
url: first_part_of_url + app + '/locations.json',
|
| 145 |
-
type: 'POST',
|
| 146 |
-
data: data,
|
| 147 |
-
success: function(data, status, jqxhr) {
|
| 148 |
-
data['action'] = 'shareaholic_add_location';
|
| 149 |
-
data['nonce'] = window.shareaholic_add_location_nonce;
|
| 150 |
-
button.data( 'location_id', data['location']['id'] );
|
| 151 |
-
Shareaholic.disable_buttons();
|
| 152 |
-
Shareaholic.submit_to_admin(
|
| 153 |
-
data,
|
| 154 |
-
function(stuff) {
|
| 155 |
-
console.log( stuff );
|
| 156 |
-
}
|
| 157 |
-
);
|
| 158 |
-
},
|
| 159 |
-
failure: function(things) {
|
| 160 |
-
console.log( things );
|
| 161 |
-
},
|
| 162 |
-
xhrFields: {
|
| 163 |
-
withCredentials: true
|
| 164 |
-
}
|
| 165 |
-
}
|
| 166 |
-
);
|
| 167 |
-
}
|
| 168 |
-
|
| 169 |
-
Shareaholic.submit_to_admin = function(data, callback) {
|
| 170 |
-
$.ajax(
|
| 171 |
-
{
|
| 172 |
-
url: ajaxurl,
|
| 173 |
-
type: 'POST',
|
| 174 |
-
data: data,
|
| 175 |
-
success: function(response) {
|
| 176 |
-
try {
|
| 177 |
-
response = JSON.parse( response );
|
| 178 |
-
} catch (e) {
|
| 179 |
-
response = {};
|
| 180 |
-
}
|
| 181 |
-
callback( response );
|
| 182 |
-
},
|
| 183 |
-
failure: function(response) {
|
| 184 |
-
try {
|
| 185 |
-
response = JSON.parse( response );
|
| 186 |
-
} catch (e) {
|
| 187 |
-
response = {};
|
| 188 |
-
}
|
| 189 |
-
callback( response );
|
| 190 |
-
}
|
| 191 |
-
}
|
| 192 |
-
)
|
| 193 |
-
}
|
| 194 |
-
|
| 195 |
-
$( document ).ready(
|
| 196 |
-
function() {
|
| 197 |
-
|
| 198 |
-
Shareaholic.disable_buttons();
|
| 199 |
-
|
| 200 |
-
Shareaholic.bind_button_clicks( Shareaholic.click_objects['app_settings'] );
|
| 201 |
-
Shareaholic.bind_button_clicks( Shareaholic.click_objects['affiliate_settings'] );
|
| 202 |
-
Shareaholic.bind_button_clicks( Shareaholic.click_objects['general_settings'] );
|
| 203 |
-
Shareaholic.bind_button_clicks( Shareaholic.click_objects['app_wide_settings'] );
|
| 204 |
-
if (Shareaholic.click_objects['unverified_general_settings']) {
|
| 205 |
-
Shareaholic.bind_button_clicks( Shareaholic.click_objects['unverified_general_settings'], true );
|
| 206 |
-
}
|
| 207 |
-
|
| 208 |
-
$( '#terms_of_service_modal' ).reveal(
|
| 209 |
-
{
|
| 210 |
-
closeonbackgroundclick: false,
|
| 211 |
-
closeonescape: false,
|
| 212 |
-
topPosition: 50
|
| 213 |
-
}
|
| 214 |
-
);
|
| 215 |
-
|
| 216 |
-
$( '#failed_to_create_api_key' ).reveal(
|
| 217 |
-
{
|
| 218 |
-
closeonbackgroundclick: false,
|
| 219 |
-
closeonescape: false,
|
| 220 |
-
topPosition: 50
|
| 221 |
-
}
|
| 222 |
-
);
|
| 223 |
-
|
| 224 |
-
$( '#get_started' ).on(
|
| 225 |
-
'click',
|
| 226 |
-
function(e) {
|
| 227 |
-
e.preventDefault();
|
| 228 |
-
data = {action: 'shareaholic_accept_terms_of_service'};
|
| 229 |
-
// $('#terms_of_service_modal').trigger('reveal:close');
|
| 230 |
-
Shareaholic.submit_to_admin(
|
| 231 |
-
data,
|
| 232 |
-
function(){
|
| 233 |
-
location.reload();
|
| 234 |
-
}
|
| 235 |
-
);
|
| 236 |
-
}
|
| 237 |
-
)
|
| 238 |
-
|
| 239 |
-
$( 'form input[type=checkbox]' ).on(
|
| 240 |
-
'click',
|
| 241 |
-
function() {
|
| 242 |
-
if ($( this ).is( ':checked' ) && ! $( this ).data( 'location_id' )) {
|
| 243 |
-
Shareaholic.create_new_location( this );
|
| 244 |
-
}
|
| 245 |
-
}
|
| 246 |
-
);
|
| 247 |
-
}
|
| 248 |
-
);
|
| 249 |
-
})( sQuery );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
assets/js/main.min.js
CHANGED
|
@@ -1,7 +1 @@
|
|
| 1 |
-
|
| 2 |
-
a.close(button);$frame.remove()}})})};Shareaholic.click_objects={app_settings:{selector:"#app_settings button",url:function(a){id=b(a).data("location_id");app=b(a).data("app");url=first_part_of_url+b(a).data("href")+"?embedded=true&verification_key="+verification_key;return url=url.replace(/{{id}}/,id)},callback:function(a){id=b(a).data("location_id");app=b(a).data("app");text="You can also use this shortcode to place this {{app}} App anywhere.";html="<div id='shortcode_container'> <span id='shortcode_description'></span> <textarea id='shortcode' name='widget_div' onclick='select();' readonly='readonly'></textarea> </div>";
|
| 3 |
-
b(html).appendTo(".reveal-modal");b("#shortcode_description").text(text.replace(/{{app}}/,Shareaholic.titlecase(app)));b("#shortcode").text('[shareaholic app="'+app+'" id="'+id+'"]')},close:function(a){b("#shortcode_container").remove()}},general_settings:{selector:"#general_settings",url:function(a){return first_part_of_url+"edit?verification_key="+verification_key}}};Shareaholic.Utils.PostMessage.receive("settings_saved",{success:function(a){b('input[type="submit"]').click()},failure:function(a){console.log(a)}});
|
| 4 |
-
Shareaholic.titlecase=function(a){return a.charAt(0).toUpperCase()+a.replace(/_[a-z]/g,function(a){return a.toUpperCase().replace(/_/," ")}).slice(1)};Shareaholic.disable_buttons=function(){b("#app_settings button").each(function(){b(this).data("location_id")?b(this).removeAttr("disabled"):b(this).attr("disabled","disabled")})};Shareaholic.create_new_location=function(a){button=b(a).siblings("button");app=button.data("app");location_id=button.data("location_id");location_id||(data={},data["configuration_"+
|
| 5 |
-
app+"_location"]={name:/.*\[(.*)\]/.exec(b(a).attr("name"))[1]},b.ajax({url:first_part_of_url+app+"/locations.json",type:"POST",data:data,success:function(a,b,d){a.action="shareaholic_add_location";button.data("location_id",a.location.id);Shareaholic.disable_buttons();Shareaholic.submit_to_admin(a,function(a){console.log(a)})},failure:function(a){console.log(a)},xhrFields:{withCredentials:!0}}))};Shareaholic.submit_to_admin=function(a,c){b.ajax({url:ajaxurl,type:"POST",data:a,success:function(a){try{a=
|
| 6 |
-
JSON.parse(a)}catch(b){a={}}c(a)},failure:function(a){try{a=JSON.parse(a)}catch(b){a={}}c(a)}})};b(document).ready(function(){Shareaholic.disable_buttons();Shareaholic.bind_button_clicks(Shareaholic.click_objects.app_settings);Shareaholic.bind_button_clicks(Shareaholic.click_objects.general_settings);Shareaholic.click_objects.unverified_general_settings&&Shareaholic.bind_button_clicks(Shareaholic.click_objects.unverified_general_settings,!0);b("#terms_of_service_modal").reveal({closeonbackgroundclick:!1,
|
| 7 |
-
closeonescape:!1,topPosition:50});b("#failed_to_create_api_key").reveal({closeonbackgroundclick:!1,closeonescape:!1,topPosition:50});b("#get_started").on("click",function(a){a.preventDefault();data={action:"shareaholic_accept_terms_of_service"};Shareaholic.submit_to_admin(data,function(){location.reload()})});b("form input[type=checkbox]").on("click",function(){b(this).is(":checked")&&!b(this).data("location_id")&&Shareaholic.create_new_location(this)})})})(sQuery);
|
| 1 |
+
!function(i){window.Shareaholic=window.Shareaholic||{},window.shareaholic_debug=!0,Shareaholic.bind_button_clicks=function(t,e){e&&i(t.selector).off("click.app_settings"),i(t.selector).off("click.app_settings").on("click.app_settings",function(e){return button=this,e.preventDefault(),url=t.url(this),"#general_settings"==t.selector||"#affiliate_settings"==t.selector?(window.open(url),!1):($frame=i("<iframe>",{src:url}).appendTo("#iframe_container"),t.callback&&t.callback(this),void i("#editing_modal").reveal({topPosition:50,close:function(){t.close&&t.close(button),$frame.remove()}}))})},Shareaholic.click_objects={app_settings:{selector:"#app_settings button",url:function(e){return id=i(e).data("location_id"),app=i(e).data("app"),url=first_part_of_url+i(e).data("href")+"?embedded=true&verification_key="+verification_key,url=url.replace(/{{id}}/,id),url},callback:function(e){$modal=i(".reveal-modal"),$modal.addClass("has-shortcode"),id=i(e).data("location_id"),app=i(e).data("app"),text="You can also use this shortcode to place this {{app}} App anywhere.",html="<div id='shortcode_container'> <span id='shortcode_description'></span> <textarea id='shortcode' name='widget_div' onclick='select();' readonly='readonly'></textarea> </div>",i(html).appendTo($modal),i("#shortcode_description").text(text.replace(/{{app}}/,Shareaholic.titlecase(app))),i("#shortcode").text('[shareaholic app="'+app+'" id="'+id+'"]')},close:function(e){i("#shortcode_container").remove(),i(".reveal-modal").removeClass("has-shortcode")}},affiliate_settings:{selector:"#affiliate_settings",url:function(e){return first_part_of_url+"websites/edit/?verification_key="+verification_key}},general_settings:{selector:"#general_settings",url:function(e){return first_part_of_url+"websites/edit/?verification_key="+verification_key}},app_wide_settings:{selector:".app_wide_settings",url:function(e){return url=first_part_of_url+i(e).data("href")+"?embedded=true&verification_key="+verification_key,url}}},Shareaholic.Utils.PostMessage.receive("settings_saved",{success:function(e){i('input[type="submit"]').click()},failure:function(e){console.log(e)}}),Shareaholic.titlecase=function(e){return e.charAt(0).toUpperCase()+e.replace(/_[a-z]/g,function(e){return e.toUpperCase().replace(/_/," ")}).slice(1)},Shareaholic.disable_buttons=function(){i("#app_settings button").each(function(){i(this).data("location_id")||"app_wide_settings"!=!this.id?i(this).removeAttr("disabled"):i(this).attr("disabled","disabled")})},Shareaholic.create_new_location=function(e){button=i(e).siblings("button"),app=button.data("app"),location_id=button.data("location_id"),location_id||(data={},data["configuration_"+app+"_location"]={name:/.*\[(.*)\]/.exec(i(e).attr("name"))[1]},i.ajax({url:first_part_of_url+app+"/locations.json",type:"POST",data:data,success:function(e,t,a){e.action="shareaholic_add_location",e.nonce=window.shareaholic_add_location_nonce,button.data("location_id",e.location.id),Shareaholic.disable_buttons(),Shareaholic.submit_to_admin(e,function(e){console.log(e)})},failure:function(e){console.log(e)},xhrFields:{withCredentials:!0}}))},Shareaholic.submit_to_admin=function(e,a){i.ajax({url:ajaxurl,type:"POST",data:e,success:function(t){try{t=JSON.parse(t)}catch(e){t={}}a(t)},failure:function(t){try{t=JSON.parse(t)}catch(e){t={}}a(t)}})},i(document).ready(function(){Shareaholic.disable_buttons(),Shareaholic.bind_button_clicks(Shareaholic.click_objects.app_settings),Shareaholic.bind_button_clicks(Shareaholic.click_objects.affiliate_settings),Shareaholic.bind_button_clicks(Shareaholic.click_objects.general_settings),Shareaholic.bind_button_clicks(Shareaholic.click_objects.app_wide_settings),Shareaholic.click_objects.unverified_general_settings&&Shareaholic.bind_button_clicks(Shareaholic.click_objects.unverified_general_settings,!0),i("#terms_of_service_modal").reveal({closeonbackgroundclick:!1,closeonescape:!1,topPosition:50}),i("#failed_to_create_api_key").reveal({closeonbackgroundclick:!1,closeonescape:!1,topPosition:50}),i("#get_started").on("click",function(e){e.preventDefault(),data={action:"shareaholic_accept_terms_of_service"},Shareaholic.submit_to_admin(data,function(){location.reload()})}),i("form input[type=checkbox]").on("click",function(){i(this).is(":checked")&&!i(this).data("location_id")&&Shareaholic.create_new_location(this)})})}(sQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
curl.php
CHANGED
|
@@ -74,7 +74,7 @@ class ShareaholicCurl {
|
|
| 74 |
$url,
|
| 75 |
array(
|
| 76 |
'body' => $data,
|
| 77 |
-
'sslverify' =>
|
| 78 |
'user-agent' => $useragent,
|
| 79 |
'timeout' => $timeout,
|
| 80 |
'headers' => $request['headers'],
|
|
@@ -95,7 +95,7 @@ class ShareaholicCurl {
|
|
| 95 |
$request['headers']['Accept-Encoding'] = 'gzip, deflate';
|
| 96 |
}
|
| 97 |
$request['headers']['user-agent'] = $useragent;
|
| 98 |
-
$request['sslverify'] =
|
| 99 |
$request['timeout'] = $timeout;
|
| 100 |
$response = wp_remote_post( $url, $request );
|
| 101 |
}
|
| 74 |
$url,
|
| 75 |
array(
|
| 76 |
'body' => $data,
|
| 77 |
+
'sslverify' => true,
|
| 78 |
'user-agent' => $useragent,
|
| 79 |
'timeout' => $timeout,
|
| 80 |
'headers' => $request['headers'],
|
| 95 |
$request['headers']['Accept-Encoding'] = 'gzip, deflate';
|
| 96 |
}
|
| 97 |
$request['headers']['user-agent'] = $useragent;
|
| 98 |
+
$request['sslverify'] = true;
|
| 99 |
$request['timeout'] = $timeout;
|
| 100 |
$response = wp_remote_post( $url, $request );
|
| 101 |
}
|
lib/social-share-counts/share_count.php
CHANGED
|
@@ -34,7 +34,7 @@ abstract class ShareaholicShareCount {
|
|
| 34 |
return array(
|
| 35 |
'facebook' => array(
|
| 36 |
'url' => 'https://graph.facebook.com/?fields=og_object{engagement{count}}&id=%s',
|
| 37 |
-
'url_auth' => 'https://graph.facebook.com/?access_token=%auth%&fields=engagement&id=%s',
|
| 38 |
'method' => 'GET',
|
| 39 |
'timeout' => 1000, // in number of milliseconds
|
| 40 |
'callback' => 'facebook_count_callback',
|
|
@@ -160,21 +160,7 @@ abstract class ShareaholicShareCount {
|
|
| 160 |
}
|
| 161 |
$body = json_decode( $response['body'], true );
|
| 162 |
$count = 0;
|
| 163 |
-
|
| 164 |
-
if ( $facebook_access_token ) {
|
| 165 |
-
if ( isset( $body['engagement']['share_count'] ) ) {
|
| 166 |
-
$count += $body['engagement']['share_count'];
|
| 167 |
-
}
|
| 168 |
-
if ( isset( $body['engagement']['reaction_count'] ) ) {
|
| 169 |
-
$count += $body['engagement']['reaction_count'];
|
| 170 |
-
}
|
| 171 |
-
if ( isset( $body['engagement']['comment_count'] ) ) {
|
| 172 |
-
$count += $body['engagement']['comment_count'];
|
| 173 |
-
}
|
| 174 |
-
return $count;
|
| 175 |
-
} else {
|
| 176 |
-
return isset( $body['og_object']['engagement']['count'] ) ? intval( $body['og_object']['engagement']['count'] ) : 0;
|
| 177 |
-
}
|
| 178 |
}
|
| 179 |
|
| 180 |
|
| 34 |
return array(
|
| 35 |
'facebook' => array(
|
| 36 |
'url' => 'https://graph.facebook.com/?fields=og_object{engagement{count}}&id=%s',
|
| 37 |
+
'url_auth' => 'https://graph.facebook.com/?access_token=%auth%&fields=og_object{engagement{count}}&id=%s',
|
| 38 |
'method' => 'GET',
|
| 39 |
'timeout' => 1000, // in number of milliseconds
|
| 40 |
'callback' => 'facebook_count_callback',
|
| 160 |
}
|
| 161 |
$body = json_decode( $response['body'], true );
|
| 162 |
$count = 0;
|
| 163 |
+
return isset( $body['og_object']['engagement']['count'] ) ? intval( $body['og_object']['engagement']['count'] ) : 0;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 164 |
}
|
| 165 |
|
| 166 |
|
readme.txt
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
Contributors: shareaholic
|
| 3 |
Tags: social, social sharing, google analytics, pinterest, twitter, share buttons, content, woocommerce, typepad, amazon, analytics, arto, baidu, bitly, blogger, buffer, cookie compliance, cookie consent, delicious, digg, diigo, disqus, email button, evernote, facebook, facebook sharing, fancy, fark, feedly, flipboard, floated share buttons, floating share buttons, follow buttons, GDPR, gmail, google bookmarks, google classroom, hootsuite, houzz, instagram, instagram sharing, instapaper, kik, kindle, line, linkedin, livejournal, meneame, mix, mixi, TikTok, odnoklassniki, box.net, onenote, pinboard.in, pinterest, pinterest sharing, parler, plurk, pocket, printfriendly, recommendations, reddit, sexybookmarks, share buttons, share image, shareaholic, shareholic, sms, social bookmarking, social media, social plugin, social share buttons, spotify, stumbleupon, stumpedia, symphony, tinyurl, tumblr, twitter, viadeo, vk, wanelo, wechat, weheartit, weibo, whatsapp, wykop, xing, yahoo, yammer, ycombinator, hacker news, youtube, yummly, zillow
|
| 4 |
Requires at least: 3.7
|
| 5 |
-
Tested up to: 5.
|
| 6 |
Requires PHP: 5.3
|
| 7 |
-
Stable tag: 9.
|
| 8 |
|
| 9 |
Boost Audience Engagement with Award Winning Speed Optimized Social Tools: Share Buttons, Related Posts, Monetization & Google Analytics.
|
| 10 |
|
|
@@ -14,8 +14,6 @@ Shareaholic is the **world's leading suite of Audience Growth & Engagement tools
|
|
| 14 |
|
| 15 |
This plugin makes it easy for any website — big or small — to engage and grow their traffic, market their content, gain insight, and monetize their audience. And it all lives in one simple dashboard.
|
| 16 |
|
| 17 |
-
We combine the functionality of many -- social, content, and monetization plugins including: Contextual Related Posts (CRP), Social Warfare, Tasty Pins, Social Pug, Grow by Mediavine, Zemanta, Sassy Bookmarks, SexyBookmarks, Shariff, AddThis, AddToAny, and many others into one effecient yet powerful package.
|
| 18 |
-
|
| 19 |
We do all this in a lightweight & lightening fast package by using [advanced code optimization techniques](https://support.shareaholic.com/hc/en-us/articles/204339849-Shareaholic-and-Site-Page-Speed) such a selective and lazy loading. The plugin loads just the functionality that you have selected and when necessary.
|
| 20 |
|
| 21 |
Also, because all the tools are integrated, you'll have a set of tools on your website that are designed to work perfectly together with no conflicts, headaches or slow downs.
|
|
@@ -132,7 +130,7 @@ Shareaholic is used and trusted by hundreds of thousands of websites like yours
|
|
| 132 |
|
| 133 |
Note: The analytics portion of Shareaholic may use trusted 3rd party services like Google Analytics and AppNexus to enhance its data.
|
| 134 |
|
| 135 |
-
[Support](https://support.shareaholic.com/) | [
|
| 136 |
|
| 137 |
== Special Thanks & Credits ==
|
| 138 |
|
|
@@ -259,6 +257,8 @@ Shareaholic's paid services include Share Count Recovery, advanced analytics, pr
|
|
| 259 |
|
| 260 |
Not at all. You can manage Shareaholic without any coding using our user-friendly drag and drop interface.
|
| 261 |
|
|
|
|
|
|
|
| 262 |
= Shareaholic is not displaying for me. Why, and what should I try? =
|
| 263 |
|
| 264 |
Something on your own personal device/browser/connection is likely filtering web functionality like major social buttons. The usual cause for this uncommon issue is 3rd party browser add-on software that blocks ads and optionally filters out major social buttons. For example, some security apps and Internet connections have an option to filter social buttons. Usually a social filter option is disabled by default, but if you find that some software is inappropriately filtering Shareaholic, please [let us know](https://www.shareaholic.com/contact).
|
|
@@ -335,6 +335,13 @@ The default Shareaholic thumbnail width is 640px with dynamic height and no crop
|
|
| 335 |
Each time you change Shareaholic's thumbnail dimensions like this, you will probably want to have WordPress regenerate appropriate sized thumbnails for all of your images. We highly recommend the [Regenerate Thumbnails](https://wordpress.org/plugins/regenerate-thumbnails/) plugin for this purpose.
|
| 336 |
|
| 337 |
== Changelog ==
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 338 |
= 9.6.3 (13-April-2021) =
|
| 339 |
* Enhancement: Do not dns-prefetch in the WordPress administration interface
|
| 340 |
|
|
@@ -1127,7 +1134,7 @@ Wishing you a very Happy New Year from our family to yours! 🎉
|
|
| 1127 |
* Show Related Posts data status
|
| 1128 |
|
| 1129 |
== Upgrade Notice ==
|
| 1130 |
-
= 9.
|
| 1131 |
We update this plugin regularly so we can make it better for you. Update to the latest version for all of the available features and improvements. Thanks for using Shareaholic!
|
| 1132 |
|
| 1133 |
= 8.12.1 =
|
| 2 |
Contributors: shareaholic
|
| 3 |
Tags: social, social sharing, google analytics, pinterest, twitter, share buttons, content, woocommerce, typepad, amazon, analytics, arto, baidu, bitly, blogger, buffer, cookie compliance, cookie consent, delicious, digg, diigo, disqus, email button, evernote, facebook, facebook sharing, fancy, fark, feedly, flipboard, floated share buttons, floating share buttons, follow buttons, GDPR, gmail, google bookmarks, google classroom, hootsuite, houzz, instagram, instagram sharing, instapaper, kik, kindle, line, linkedin, livejournal, meneame, mix, mixi, TikTok, odnoklassniki, box.net, onenote, pinboard.in, pinterest, pinterest sharing, parler, plurk, pocket, printfriendly, recommendations, reddit, sexybookmarks, share buttons, share image, shareaholic, shareholic, sms, social bookmarking, social media, social plugin, social share buttons, spotify, stumbleupon, stumpedia, symphony, tinyurl, tumblr, twitter, viadeo, vk, wanelo, wechat, weheartit, weibo, whatsapp, wykop, xing, yahoo, yammer, ycombinator, hacker news, youtube, yummly, zillow
|
| 4 |
Requires at least: 3.7
|
| 5 |
+
Tested up to: 5.8
|
| 6 |
Requires PHP: 5.3
|
| 7 |
+
Stable tag: 9.7.0
|
| 8 |
|
| 9 |
Boost Audience Engagement with Award Winning Speed Optimized Social Tools: Share Buttons, Related Posts, Monetization & Google Analytics.
|
| 10 |
|
| 14 |
|
| 15 |
This plugin makes it easy for any website — big or small — to engage and grow their traffic, market their content, gain insight, and monetize their audience. And it all lives in one simple dashboard.
|
| 16 |
|
|
|
|
|
|
|
| 17 |
We do all this in a lightweight & lightening fast package by using [advanced code optimization techniques](https://support.shareaholic.com/hc/en-us/articles/204339849-Shareaholic-and-Site-Page-Speed) such a selective and lazy loading. The plugin loads just the functionality that you have selected and when necessary.
|
| 18 |
|
| 19 |
Also, because all the tools are integrated, you'll have a set of tools on your website that are designed to work perfectly together with no conflicts, headaches or slow downs.
|
| 130 |
|
| 131 |
Note: The analytics portion of Shareaholic may use trusted 3rd party services like Google Analytics and AppNexus to enhance its data.
|
| 132 |
|
| 133 |
+
[Contact Support](https://support.shareaholic.com/) | [Terms](https://www.shareaholic.com/terms/) | [APIs](https://www.shareaholic.com/api/) | [Security](https://www.shareaholic.com/security)
|
| 134 |
|
| 135 |
== Special Thanks & Credits ==
|
| 136 |
|
| 257 |
|
| 258 |
Not at all. You can manage Shareaholic without any coding using our user-friendly drag and drop interface.
|
| 259 |
|
| 260 |
+
We combine the functionality of many -- social, content, and monetization plugins including: Contextual Related Posts (CRP), Social Warfare, Tasty Pins, Social Pug, Grow Social by Mediavine, Sassy Bookmarks, SexyBookmarks, Shariff, AddThis, AddToAny, and many others into one effecient and powerful package.
|
| 261 |
+
|
| 262 |
= Shareaholic is not displaying for me. Why, and what should I try? =
|
| 263 |
|
| 264 |
Something on your own personal device/browser/connection is likely filtering web functionality like major social buttons. The usual cause for this uncommon issue is 3rd party browser add-on software that blocks ads and optionally filters out major social buttons. For example, some security apps and Internet connections have an option to filter social buttons. Usually a social filter option is disabled by default, but if you find that some software is inappropriately filtering Shareaholic, please [let us know](https://www.shareaholic.com/contact).
|
| 335 |
Each time you change Shareaholic's thumbnail dimensions like this, you will probably want to have WordPress regenerate appropriate sized thumbnails for all of your images. We highly recommend the [Regenerate Thumbnails](https://wordpress.org/plugins/regenerate-thumbnails/) plugin for this purpose.
|
| 336 |
|
| 337 |
== Changelog ==
|
| 338 |
+
= 9.7.0 (25-June-2021) =
|
| 339 |
+
* Enhancement: Minify all Admin related CSS and JavaScript
|
| 340 |
+
* Enhancement: Verify SSL
|
| 341 |
+
* Enhancement: More robust plugin Facebook Share Counts. This is a must upgrade for anyone facing "missing" share counts.
|
| 342 |
+
|
| 343 |
+
Important: Issues with Facebook's official share counts API are often resolved by using the "Scrape Again" button from Facebook's [Sharing Debugger](https://developers.facebook.com/tools/debug/sharing/).
|
| 344 |
+
|
| 345 |
= 9.6.3 (13-April-2021) =
|
| 346 |
* Enhancement: Do not dns-prefetch in the WordPress administration interface
|
| 347 |
|
| 1134 |
* Show Related Posts data status
|
| 1135 |
|
| 1136 |
== Upgrade Notice ==
|
| 1137 |
+
= 9.7.0 =
|
| 1138 |
We update this plugin regularly so we can make it better for you. Update to the latest version for all of the available features and improvements. Thanks for using Shareaholic!
|
| 1139 |
|
| 1140 |
= 8.12.1 =
|
shareaholic.php
CHANGED
|
@@ -3,7 +3,7 @@
|
|
| 3 |
Plugin Name: Shareaholic - Grow and Engage Your Audience
|
| 4 |
Plugin URI: https://www.shareaholic.com/website-tools/
|
| 5 |
Description: Shareaholic’s official WordPress plugin allows you to add Award-Winning Social Share Buttons, Related Posts, Content Analytics, Ad Monetization, and more to your website.
|
| 6 |
-
Version: 9.
|
| 7 |
Author: Shareaholic
|
| 8 |
Author URI: https://www.shareaholic.com
|
| 9 |
Text Domain: shareaholic
|
|
@@ -14,7 +14,7 @@ Domain Path: /languages
|
|
| 14 |
* The main file!
|
| 15 |
*
|
| 16 |
* @package shareaholic
|
| 17 |
-
* @version 9.
|
| 18 |
*/
|
| 19 |
|
| 20 |
/**
|
|
@@ -67,7 +67,7 @@ if ( ! class_exists( 'Shareaholic' ) ) {
|
|
| 67 |
const API_URL = 'https://web.shareaholic.com'; // uses static IPs for firewall whitelisting
|
| 68 |
const CM_API_URL = 'https://cm-web.shareaholic.com'; // uses static IPs for firewall whitelisting
|
| 69 |
|
| 70 |
-
const VERSION = '9.
|
| 71 |
|
| 72 |
/**
|
| 73 |
* Starts off as false so that ::get_instance() returns
|
| 3 |
Plugin Name: Shareaholic - Grow and Engage Your Audience
|
| 4 |
Plugin URI: https://www.shareaholic.com/website-tools/
|
| 5 |
Description: Shareaholic’s official WordPress plugin allows you to add Award-Winning Social Share Buttons, Related Posts, Content Analytics, Ad Monetization, and more to your website.
|
| 6 |
+
Version: 9.7.0
|
| 7 |
Author: Shareaholic
|
| 8 |
Author URI: https://www.shareaholic.com
|
| 9 |
Text Domain: shareaholic
|
| 14 |
* The main file!
|
| 15 |
*
|
| 16 |
* @package shareaholic
|
| 17 |
+
* @version 9.7.0
|
| 18 |
*/
|
| 19 |
|
| 20 |
/**
|
| 67 |
const API_URL = 'https://web.shareaholic.com'; // uses static IPs for firewall whitelisting
|
| 68 |
const CM_API_URL = 'https://cm-web.shareaholic.com'; // uses static IPs for firewall whitelisting
|
| 69 |
|
| 70 |
+
const VERSION = '9.7.0';
|
| 71 |
|
| 72 |
/**
|
| 73 |
* Starts off as false so that ::get_instance() returns
|
src/css/bootstrap.css
ADDED
|
@@ -0,0 +1,9189 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*!
|
| 2 |
+
* Bootstrap v4.3.1 (https://getbootstrap.com/)
|
| 3 |
+
* Copyright 2011-2019 The Bootstrap Authors
|
| 4 |
+
* Copyright 2011-2019 Twitter, Inc.
|
| 5 |
+
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
|
| 6 |
+
*/
|
| 7 |
+
:root {
|
| 8 |
+
--blue: #007bff;
|
| 9 |
+
--indigo: #6610f2;
|
| 10 |
+
--purple: #6f42c1;
|
| 11 |
+
--pink: #e83e8c;
|
| 12 |
+
--red: #dc3545;
|
| 13 |
+
--orange: #fd7e14;
|
| 14 |
+
--yellow: #ffc107;
|
| 15 |
+
--green: #28a745;
|
| 16 |
+
--teal: #20c997;
|
| 17 |
+
--cyan: #17a2b8;
|
| 18 |
+
--white: #fff;
|
| 19 |
+
--gray: #6c757d;
|
| 20 |
+
--gray-dark: #343a40;
|
| 21 |
+
--primary: #007bff;
|
| 22 |
+
--secondary: #6c757d;
|
| 23 |
+
--success: #28a745;
|
| 24 |
+
--info: #17a2b8;
|
| 25 |
+
--warning: #ffc107;
|
| 26 |
+
--danger: #dc3545;
|
| 27 |
+
--light: #f8f9fa;
|
| 28 |
+
--dark: #343a40;
|
| 29 |
+
--breakpoint-xs: 0;
|
| 30 |
+
--breakpoint-sm: 576px;
|
| 31 |
+
--breakpoint-md: 768px;
|
| 32 |
+
--breakpoint-lg: 992px;
|
| 33 |
+
--breakpoint-xl: 1200px;
|
| 34 |
+
--font-family-sans-serif: -apple-system, BlinkMacSystemFont, 'Segoe UI', Roboto,
|
| 35 |
+
'Helvetica Neue', Arial, 'Noto Sans', sans-serif, 'Apple Color Emoji',
|
| 36 |
+
'Segoe UI Emoji', 'Segoe UI Symbol', 'Noto Color Emoji';
|
| 37 |
+
--font-family-monospace: SFMono-Regular, Menlo, Monaco, Consolas, 'Liberation Mono',
|
| 38 |
+
'Courier New', monospace;
|
| 39 |
+
}
|
| 40 |
+
*,
|
| 41 |
+
::after,
|
| 42 |
+
::before {
|
| 43 |
+
box-sizing: border-box;
|
| 44 |
+
}
|
| 45 |
+
html {
|
| 46 |
+
font-family: sans-serif;
|
| 47 |
+
line-height: 1.15;
|
| 48 |
+
-webkit-text-size-adjust: 100%;
|
| 49 |
+
-webkit-tap-highlight-color: transparent;
|
| 50 |
+
}
|
| 51 |
+
article,
|
| 52 |
+
aside,
|
| 53 |
+
figcaption,
|
| 54 |
+
figure,
|
| 55 |
+
footer,
|
| 56 |
+
header,
|
| 57 |
+
hgroup,
|
| 58 |
+
main,
|
| 59 |
+
nav,
|
| 60 |
+
section {
|
| 61 |
+
display: block;
|
| 62 |
+
}
|
| 63 |
+
body {
|
| 64 |
+
margin: 0;
|
| 65 |
+
font-family: -apple-system, BlinkMacSystemFont, 'Segoe UI', Roboto, 'Helvetica Neue',
|
| 66 |
+
Arial, 'Noto Sans', sans-serif, 'Apple Color Emoji', 'Segoe UI Emoji',
|
| 67 |
+
'Segoe UI Symbol', 'Noto Color Emoji';
|
| 68 |
+
font-size: 1rem;
|
| 69 |
+
font-weight: 400;
|
| 70 |
+
line-height: 1.5;
|
| 71 |
+
color: #212529;
|
| 72 |
+
text-align: left;
|
| 73 |
+
background-color: #fff;
|
| 74 |
+
}
|
| 75 |
+
[tabindex='-1']:focus {
|
| 76 |
+
outline: 0 !important;
|
| 77 |
+
}
|
| 78 |
+
hr {
|
| 79 |
+
box-sizing: content-box;
|
| 80 |
+
height: 0;
|
| 81 |
+
overflow: visible;
|
| 82 |
+
}
|
| 83 |
+
h1,
|
| 84 |
+
h2,
|
| 85 |
+
h3,
|
| 86 |
+
h4,
|
| 87 |
+
h5,
|
| 88 |
+
h6 {
|
| 89 |
+
margin-top: 0;
|
| 90 |
+
margin-bottom: 0.5rem;
|
| 91 |
+
}
|
| 92 |
+
p {
|
| 93 |
+
margin-top: 0;
|
| 94 |
+
margin-bottom: 1rem;
|
| 95 |
+
}
|
| 96 |
+
abbr[data-original-title],
|
| 97 |
+
abbr[title] {
|
| 98 |
+
text-decoration: underline;
|
| 99 |
+
-webkit-text-decoration: underline dotted;
|
| 100 |
+
text-decoration: underline dotted;
|
| 101 |
+
cursor: help;
|
| 102 |
+
border-bottom: 0;
|
| 103 |
+
-webkit-text-decoration-skip-ink: none;
|
| 104 |
+
text-decoration-skip-ink: none;
|
| 105 |
+
}
|
| 106 |
+
address {
|
| 107 |
+
margin-bottom: 1rem;
|
| 108 |
+
font-style: normal;
|
| 109 |
+
line-height: inherit;
|
| 110 |
+
}
|
| 111 |
+
dl,
|
| 112 |
+
ol,
|
| 113 |
+
ul {
|
| 114 |
+
margin-top: 0;
|
| 115 |
+
margin-bottom: 1rem;
|
| 116 |
+
}
|
| 117 |
+
ol ol,
|
| 118 |
+
ol ul,
|
| 119 |
+
ul ol,
|
| 120 |
+
ul ul {
|
| 121 |
+
margin-bottom: 0;
|
| 122 |
+
}
|
| 123 |
+
dt {
|
| 124 |
+
font-weight: 700;
|
| 125 |
+
}
|
| 126 |
+
dd {
|
| 127 |
+
margin-bottom: 0.5rem;
|
| 128 |
+
margin-left: 0;
|
| 129 |
+
}
|
| 130 |
+
blockquote {
|
| 131 |
+
margin: 0 0 1rem;
|
| 132 |
+
}
|
| 133 |
+
b,
|
| 134 |
+
strong {
|
| 135 |
+
font-weight: bolder;
|
| 136 |
+
}
|
| 137 |
+
small {
|
| 138 |
+
font-size: 80%;
|
| 139 |
+
}
|
| 140 |
+
sub,
|
| 141 |
+
sup {
|
| 142 |
+
position: relative;
|
| 143 |
+
font-size: 75%;
|
| 144 |
+
line-height: 0;
|
| 145 |
+
vertical-align: baseline;
|
| 146 |
+
}
|
| 147 |
+
sub {
|
| 148 |
+
bottom: -0.25em;
|
| 149 |
+
}
|
| 150 |
+
sup {
|
| 151 |
+
top: -0.5em;
|
| 152 |
+
}
|
| 153 |
+
a {
|
| 154 |
+
color: #007bff;
|
| 155 |
+
text-decoration: none;
|
| 156 |
+
background-color: transparent;
|
| 157 |
+
}
|
| 158 |
+
a:hover {
|
| 159 |
+
color: #0056b3;
|
| 160 |
+
text-decoration: underline;
|
| 161 |
+
}
|
| 162 |
+
a:not([href]):not([tabindex]) {
|
| 163 |
+
color: inherit;
|
| 164 |
+
text-decoration: none;
|
| 165 |
+
}
|
| 166 |
+
a:not([href]):not([tabindex]):focus,
|
| 167 |
+
a:not([href]):not([tabindex]):hover {
|
| 168 |
+
color: inherit;
|
| 169 |
+
text-decoration: none;
|
| 170 |
+
}
|
| 171 |
+
a:not([href]):not([tabindex]):focus {
|
| 172 |
+
outline: 0;
|
| 173 |
+
}
|
| 174 |
+
code,
|
| 175 |
+
kbd,
|
| 176 |
+
pre,
|
| 177 |
+
samp {
|
| 178 |
+
font-family: SFMono-Regular, Menlo, Monaco, Consolas, 'Liberation Mono', 'Courier New',
|
| 179 |
+
monospace;
|
| 180 |
+
font-size: 1em;
|
| 181 |
+
}
|
| 182 |
+
pre {
|
| 183 |
+
margin-top: 0;
|
| 184 |
+
margin-bottom: 1rem;
|
| 185 |
+
overflow: auto;
|
| 186 |
+
}
|
| 187 |
+
figure {
|
| 188 |
+
margin: 0 0 1rem;
|
| 189 |
+
}
|
| 190 |
+
img {
|
| 191 |
+
vertical-align: middle;
|
| 192 |
+
border-style: none;
|
| 193 |
+
}
|
| 194 |
+
svg {
|
| 195 |
+
overflow: hidden;
|
| 196 |
+
vertical-align: middle;
|
| 197 |
+
}
|
| 198 |
+
table {
|
| 199 |
+
border-collapse: collapse;
|
| 200 |
+
}
|
| 201 |
+
caption {
|
| 202 |
+
padding-top: 0.75rem;
|
| 203 |
+
padding-bottom: 0.75rem;
|
| 204 |
+
color: #6c757d;
|
| 205 |
+
text-align: left;
|
| 206 |
+
caption-side: bottom;
|
| 207 |
+
}
|
| 208 |
+
th {
|
| 209 |
+
text-align: inherit;
|
| 210 |
+
}
|
| 211 |
+
label {
|
| 212 |
+
display: inline-block;
|
| 213 |
+
margin-bottom: 0.5rem;
|
| 214 |
+
}
|
| 215 |
+
button {
|
| 216 |
+
border-radius: 0;
|
| 217 |
+
}
|
| 218 |
+
button:focus {
|
| 219 |
+
outline: 1px dotted;
|
| 220 |
+
outline: 5px auto -webkit-focus-ring-color;
|
| 221 |
+
}
|
| 222 |
+
button,
|
| 223 |
+
input,
|
| 224 |
+
optgroup,
|
| 225 |
+
select,
|
| 226 |
+
textarea {
|
| 227 |
+
margin: 0;
|
| 228 |
+
font-family: inherit;
|
| 229 |
+
font-size: inherit;
|
| 230 |
+
line-height: inherit;
|
| 231 |
+
}
|
| 232 |
+
button,
|
| 233 |
+
input {
|
| 234 |
+
overflow: visible;
|
| 235 |
+
}
|
| 236 |
+
button,
|
| 237 |
+
select {
|
| 238 |
+
text-transform: none;
|
| 239 |
+
}
|
| 240 |
+
select {
|
| 241 |
+
word-wrap: normal;
|
| 242 |
+
}
|
| 243 |
+
[type='button'],
|
| 244 |
+
[type='reset'],
|
| 245 |
+
[type='submit'],
|
| 246 |
+
button {
|
| 247 |
+
-webkit-appearance: button;
|
| 248 |
+
}
|
| 249 |
+
[type='button']:not(:disabled),
|
| 250 |
+
[type='reset']:not(:disabled),
|
| 251 |
+
[type='submit']:not(:disabled),
|
| 252 |
+
button:not(:disabled) {
|
| 253 |
+
cursor: pointer;
|
| 254 |
+
}
|
| 255 |
+
[type='button']::-moz-focus-inner,
|
| 256 |
+
[type='reset']::-moz-focus-inner,
|
| 257 |
+
[type='submit']::-moz-focus-inner,
|
| 258 |
+
button::-moz-focus-inner {
|
| 259 |
+
padding: 0;
|
| 260 |
+
border-style: none;
|
| 261 |
+
}
|
| 262 |
+
input[type='checkbox'],
|
| 263 |
+
input[type='radio'] {
|
| 264 |
+
box-sizing: border-box;
|
| 265 |
+
padding: 0;
|
| 266 |
+
}
|
| 267 |
+
input[type='date'],
|
| 268 |
+
input[type='datetime-local'],
|
| 269 |
+
input[type='month'],
|
| 270 |
+
input[type='time'] {
|
| 271 |
+
-webkit-appearance: listbox;
|
| 272 |
+
}
|
| 273 |
+
textarea {
|
| 274 |
+
overflow: auto;
|
| 275 |
+
resize: vertical;
|
| 276 |
+
}
|
| 277 |
+
fieldset {
|
| 278 |
+
min-width: 0;
|
| 279 |
+
padding: 0;
|
| 280 |
+
margin: 0;
|
| 281 |
+
border: 0;
|
| 282 |
+
}
|
| 283 |
+
legend {
|
| 284 |
+
display: block;
|
| 285 |
+
width: 100%;
|
| 286 |
+
max-width: 100%;
|
| 287 |
+
padding: 0;
|
| 288 |
+
margin-bottom: 0.5rem;
|
| 289 |
+
font-size: 1.5rem;
|
| 290 |
+
line-height: inherit;
|
| 291 |
+
color: inherit;
|
| 292 |
+
white-space: normal;
|
| 293 |
+
}
|
| 294 |
+
progress {
|
| 295 |
+
vertical-align: baseline;
|
| 296 |
+
}
|
| 297 |
+
[type='number']::-webkit-inner-spin-button,
|
| 298 |
+
[type='number']::-webkit-outer-spin-button {
|
| 299 |
+
height: auto;
|
| 300 |
+
}
|
| 301 |
+
[type='search'] {
|
| 302 |
+
outline-offset: -2px;
|
| 303 |
+
-webkit-appearance: none;
|
| 304 |
+
}
|
| 305 |
+
[type='search']::-webkit-search-decoration {
|
| 306 |
+
-webkit-appearance: none;
|
| 307 |
+
}
|
| 308 |
+
::-webkit-file-upload-button {
|
| 309 |
+
font: inherit;
|
| 310 |
+
-webkit-appearance: button;
|
| 311 |
+
}
|
| 312 |
+
output {
|
| 313 |
+
display: inline-block;
|
| 314 |
+
}
|
| 315 |
+
summary {
|
| 316 |
+
display: list-item;
|
| 317 |
+
cursor: pointer;
|
| 318 |
+
}
|
| 319 |
+
template {
|
| 320 |
+
display: none;
|
| 321 |
+
}
|
| 322 |
+
[hidden] {
|
| 323 |
+
display: none !important;
|
| 324 |
+
}
|
| 325 |
+
.h1,
|
| 326 |
+
.h2,
|
| 327 |
+
.h3,
|
| 328 |
+
.h4,
|
| 329 |
+
.h5,
|
| 330 |
+
.h6,
|
| 331 |
+
h1,
|
| 332 |
+
h2,
|
| 333 |
+
h3,
|
| 334 |
+
h4,
|
| 335 |
+
h5,
|
| 336 |
+
h6 {
|
| 337 |
+
margin-bottom: 0.5rem;
|
| 338 |
+
font-weight: 500;
|
| 339 |
+
line-height: 1.2;
|
| 340 |
+
}
|
| 341 |
+
.h1,
|
| 342 |
+
h1 {
|
| 343 |
+
font-size: 2.5rem;
|
| 344 |
+
}
|
| 345 |
+
.h2,
|
| 346 |
+
h2 {
|
| 347 |
+
font-size: 2rem;
|
| 348 |
+
}
|
| 349 |
+
.h3,
|
| 350 |
+
h3 {
|
| 351 |
+
font-size: 1.75rem;
|
| 352 |
+
}
|
| 353 |
+
.h4,
|
| 354 |
+
h4 {
|
| 355 |
+
font-size: 1.5rem;
|
| 356 |
+
}
|
| 357 |
+
.h5,
|
| 358 |
+
h5 {
|
| 359 |
+
font-size: 1.25rem;
|
| 360 |
+
}
|
| 361 |
+
.h6,
|
| 362 |
+
h6 {
|
| 363 |
+
font-size: 1rem;
|
| 364 |
+
}
|
| 365 |
+
.lead {
|
| 366 |
+
font-size: 1.25rem;
|
| 367 |
+
font-weight: 300;
|
| 368 |
+
}
|
| 369 |
+
.display-1 {
|
| 370 |
+
font-size: 6rem;
|
| 371 |
+
font-weight: 300;
|
| 372 |
+
line-height: 1.2;
|
| 373 |
+
}
|
| 374 |
+
.display-2 {
|
| 375 |
+
font-size: 5.5rem;
|
| 376 |
+
font-weight: 300;
|
| 377 |
+
line-height: 1.2;
|
| 378 |
+
}
|
| 379 |
+
.display-3 {
|
| 380 |
+
font-size: 4.5rem;
|
| 381 |
+
font-weight: 300;
|
| 382 |
+
line-height: 1.2;
|
| 383 |
+
}
|
| 384 |
+
.display-4 {
|
| 385 |
+
font-size: 3.5rem;
|
| 386 |
+
font-weight: 300;
|
| 387 |
+
line-height: 1.2;
|
| 388 |
+
}
|
| 389 |
+
hr {
|
| 390 |
+
margin-top: 1rem;
|
| 391 |
+
margin-bottom: 1rem;
|
| 392 |
+
border: 0;
|
| 393 |
+
border-top: 1px solid rgba(0, 0, 0, 0.1);
|
| 394 |
+
}
|
| 395 |
+
.small,
|
| 396 |
+
small {
|
| 397 |
+
font-size: 80%;
|
| 398 |
+
font-weight: 400;
|
| 399 |
+
}
|
| 400 |
+
.mark,
|
| 401 |
+
mark {
|
| 402 |
+
padding: 0.2em;
|
| 403 |
+
background-color: #fcf8e3;
|
| 404 |
+
}
|
| 405 |
+
.list-unstyled {
|
| 406 |
+
padding-left: 0;
|
| 407 |
+
list-style: none;
|
| 408 |
+
}
|
| 409 |
+
.list-inline {
|
| 410 |
+
padding-left: 0;
|
| 411 |
+
list-style: none;
|
| 412 |
+
}
|
| 413 |
+
.list-inline-item {
|
| 414 |
+
display: inline-block;
|
| 415 |
+
}
|
| 416 |
+
.list-inline-item:not(:last-child) {
|
| 417 |
+
margin-right: 0.5rem;
|
| 418 |
+
}
|
| 419 |
+
.initialism {
|
| 420 |
+
font-size: 90%;
|
| 421 |
+
text-transform: uppercase;
|
| 422 |
+
}
|
| 423 |
+
.blockquote {
|
| 424 |
+
margin-bottom: 1rem;
|
| 425 |
+
font-size: 1.25rem;
|
| 426 |
+
}
|
| 427 |
+
.blockquote-footer {
|
| 428 |
+
display: block;
|
| 429 |
+
font-size: 80%;
|
| 430 |
+
color: #6c757d;
|
| 431 |
+
}
|
| 432 |
+
.blockquote-footer::before {
|
| 433 |
+
content: '\2014\00A0';
|
| 434 |
+
}
|
| 435 |
+
.img-fluid {
|
| 436 |
+
max-width: 100%;
|
| 437 |
+
height: auto;
|
| 438 |
+
}
|
| 439 |
+
.img-thumbnail {
|
| 440 |
+
padding: 0.25rem;
|
| 441 |
+
background-color: #fff;
|
| 442 |
+
border: 1px solid #dee2e6;
|
| 443 |
+
border-radius: 0.25rem;
|
| 444 |
+
max-width: 100%;
|
| 445 |
+
height: auto;
|
| 446 |
+
}
|
| 447 |
+
.figure {
|
| 448 |
+
display: inline-block;
|
| 449 |
+
}
|
| 450 |
+
.figure-img {
|
| 451 |
+
margin-bottom: 0.5rem;
|
| 452 |
+
line-height: 1;
|
| 453 |
+
}
|
| 454 |
+
.figure-caption {
|
| 455 |
+
font-size: 90%;
|
| 456 |
+
color: #6c757d;
|
| 457 |
+
}
|
| 458 |
+
code {
|
| 459 |
+
font-size: 87.5%;
|
| 460 |
+
color: #e83e8c;
|
| 461 |
+
word-break: break-word;
|
| 462 |
+
}
|
| 463 |
+
a > code {
|
| 464 |
+
color: inherit;
|
| 465 |
+
}
|
| 466 |
+
kbd {
|
| 467 |
+
padding: 0.2rem 0.4rem;
|
| 468 |
+
font-size: 87.5%;
|
| 469 |
+
color: #fff;
|
| 470 |
+
background-color: #212529;
|
| 471 |
+
border-radius: 0.2rem;
|
| 472 |
+
}
|
| 473 |
+
kbd kbd {
|
| 474 |
+
padding: 0;
|
| 475 |
+
font-size: 100%;
|
| 476 |
+
font-weight: 700;
|
| 477 |
+
}
|
| 478 |
+
pre {
|
| 479 |
+
display: block;
|
| 480 |
+
font-size: 87.5%;
|
| 481 |
+
color: #212529;
|
| 482 |
+
}
|
| 483 |
+
pre code {
|
| 484 |
+
font-size: inherit;
|
| 485 |
+
color: inherit;
|
| 486 |
+
word-break: normal;
|
| 487 |
+
}
|
| 488 |
+
.pre-scrollable {
|
| 489 |
+
max-height: 340px;
|
| 490 |
+
overflow-y: scroll;
|
| 491 |
+
}
|
| 492 |
+
.container {
|
| 493 |
+
width: 100%;
|
| 494 |
+
padding-right: 15px;
|
| 495 |
+
padding-left: 15px;
|
| 496 |
+
margin-right: auto;
|
| 497 |
+
margin-left: auto;
|
| 498 |
+
}
|
| 499 |
+
@media (min-width: 576px) {
|
| 500 |
+
.container {
|
| 501 |
+
max-width: 540px;
|
| 502 |
+
}
|
| 503 |
+
}
|
| 504 |
+
@media (min-width: 768px) {
|
| 505 |
+
.container {
|
| 506 |
+
max-width: 720px;
|
| 507 |
+
}
|
| 508 |
+
}
|
| 509 |
+
@media (min-width: 992px) {
|
| 510 |
+
.container {
|
| 511 |
+
max-width: 960px;
|
| 512 |
+
}
|
| 513 |
+
}
|
| 514 |
+
@media (min-width: 1200px) {
|
| 515 |
+
.container {
|
| 516 |
+
max-width: 1140px;
|
| 517 |
+
}
|
| 518 |
+
}
|
| 519 |
+
.container-fluid {
|
| 520 |
+
width: 100%;
|
| 521 |
+
padding-right: 15px;
|
| 522 |
+
padding-left: 15px;
|
| 523 |
+
margin-right: auto;
|
| 524 |
+
margin-left: auto;
|
| 525 |
+
}
|
| 526 |
+
.row {
|
| 527 |
+
display: -ms-flexbox;
|
| 528 |
+
display: flex;
|
| 529 |
+
-ms-flex-wrap: wrap;
|
| 530 |
+
flex-wrap: wrap;
|
| 531 |
+
margin-right: -15px;
|
| 532 |
+
margin-left: -15px;
|
| 533 |
+
}
|
| 534 |
+
.no-gutters {
|
| 535 |
+
margin-right: 0;
|
| 536 |
+
margin-left: 0;
|
| 537 |
+
}
|
| 538 |
+
.no-gutters > .col,
|
| 539 |
+
.no-gutters > [class*='col-'] {
|
| 540 |
+
padding-right: 0;
|
| 541 |
+
padding-left: 0;
|
| 542 |
+
}
|
| 543 |
+
.col,
|
| 544 |
+
.col-1,
|
| 545 |
+
.col-10,
|
| 546 |
+
.col-11,
|
| 547 |
+
.col-12,
|
| 548 |
+
.col-2,
|
| 549 |
+
.col-3,
|
| 550 |
+
.col-4,
|
| 551 |
+
.col-5,
|
| 552 |
+
.col-6,
|
| 553 |
+
.col-7,
|
| 554 |
+
.col-8,
|
| 555 |
+
.col-9,
|
| 556 |
+
.col-auto,
|
| 557 |
+
.col-lg,
|
| 558 |
+
.col-lg-1,
|
| 559 |
+
.col-lg-10,
|
| 560 |
+
.col-lg-11,
|
| 561 |
+
.col-lg-12,
|
| 562 |
+
.col-lg-2,
|
| 563 |
+
.col-lg-3,
|
| 564 |
+
.col-lg-4,
|
| 565 |
+
.col-lg-5,
|
| 566 |
+
.col-lg-6,
|
| 567 |
+
.col-lg-7,
|
| 568 |
+
.col-lg-8,
|
| 569 |
+
.col-lg-9,
|
| 570 |
+
.col-lg-auto,
|
| 571 |
+
.col-md,
|
| 572 |
+
.col-md-1,
|
| 573 |
+
.col-md-10,
|
| 574 |
+
.col-md-11,
|
| 575 |
+
.col-md-12,
|
| 576 |
+
.col-md-2,
|
| 577 |
+
.col-md-3,
|
| 578 |
+
.col-md-4,
|
| 579 |
+
.col-md-5,
|
| 580 |
+
.col-md-6,
|
| 581 |
+
.col-md-7,
|
| 582 |
+
.col-md-8,
|
| 583 |
+
.col-md-9,
|
| 584 |
+
.col-md-auto,
|
| 585 |
+
.col-sm,
|
| 586 |
+
.col-sm-1,
|
| 587 |
+
.col-sm-10,
|
| 588 |
+
.col-sm-11,
|
| 589 |
+
.col-sm-12,
|
| 590 |
+
.col-sm-2,
|
| 591 |
+
.col-sm-3,
|
| 592 |
+
.col-sm-4,
|
| 593 |
+
.col-sm-5,
|
| 594 |
+
.col-sm-6,
|
| 595 |
+
.col-sm-7,
|
| 596 |
+
.col-sm-8,
|
| 597 |
+
.col-sm-9,
|
| 598 |
+
.col-sm-auto,
|
| 599 |
+
.col-xl,
|
| 600 |
+
.col-xl-1,
|
| 601 |
+
.col-xl-10,
|
| 602 |
+
.col-xl-11,
|
| 603 |
+
.col-xl-12,
|
| 604 |
+
.col-xl-2,
|
| 605 |
+
.col-xl-3,
|
| 606 |
+
.col-xl-4,
|
| 607 |
+
.col-xl-5,
|
| 608 |
+
.col-xl-6,
|
| 609 |
+
.col-xl-7,
|
| 610 |
+
.col-xl-8,
|
| 611 |
+
.col-xl-9,
|
| 612 |
+
.col-xl-auto {
|
| 613 |
+
position: relative;
|
| 614 |
+
width: 100%;
|
| 615 |
+
padding-right: 15px;
|
| 616 |
+
padding-left: 15px;
|
| 617 |
+
}
|
| 618 |
+
.col {
|
| 619 |
+
-ms-flex-preferred-size: 0;
|
| 620 |
+
flex-basis: 0;
|
| 621 |
+
-ms-flex-positive: 1;
|
| 622 |
+
flex-grow: 1;
|
| 623 |
+
max-width: 100%;
|
| 624 |
+
}
|
| 625 |
+
.col-auto {
|
| 626 |
+
-ms-flex: 0 0 auto;
|
| 627 |
+
flex: 0 0 auto;
|
| 628 |
+
width: auto;
|
| 629 |
+
max-width: 100%;
|
| 630 |
+
}
|
| 631 |
+
.col-1 {
|
| 632 |
+
-ms-flex: 0 0 8.333333%;
|
| 633 |
+
flex: 0 0 8.333333%;
|
| 634 |
+
max-width: 8.333333%;
|
| 635 |
+
}
|
| 636 |
+
.col-2 {
|
| 637 |
+
-ms-flex: 0 0 16.666667%;
|
| 638 |
+
flex: 0 0 16.666667%;
|
| 639 |
+
max-width: 16.666667%;
|
| 640 |
+
}
|
| 641 |
+
.col-3 {
|
| 642 |
+
-ms-flex: 0 0 25%;
|
| 643 |
+
flex: 0 0 25%;
|
| 644 |
+
max-width: 25%;
|
| 645 |
+
}
|
| 646 |
+
.col-4 {
|
| 647 |
+
-ms-flex: 0 0 33.333333%;
|
| 648 |
+
flex: 0 0 33.333333%;
|
| 649 |
+
max-width: 33.333333%;
|
| 650 |
+
}
|
| 651 |
+
.col-5 {
|
| 652 |
+
-ms-flex: 0 0 41.666667%;
|
| 653 |
+
flex: 0 0 41.666667%;
|
| 654 |
+
max-width: 41.666667%;
|
| 655 |
+
}
|
| 656 |
+
.col-6 {
|
| 657 |
+
-ms-flex: 0 0 50%;
|
| 658 |
+
flex: 0 0 50%;
|
| 659 |
+
max-width: 50%;
|
| 660 |
+
}
|
| 661 |
+
.col-7 {
|
| 662 |
+
-ms-flex: 0 0 58.333333%;
|
| 663 |
+
flex: 0 0 58.333333%;
|
| 664 |
+
max-width: 58.333333%;
|
| 665 |
+
}
|
| 666 |
+
.col-8 {
|
| 667 |
+
-ms-flex: 0 0 66.666667%;
|
| 668 |
+
flex: 0 0 66.666667%;
|
| 669 |
+
max-width: 66.666667%;
|
| 670 |
+
}
|
| 671 |
+
.col-9 {
|
| 672 |
+
-ms-flex: 0 0 75%;
|
| 673 |
+
flex: 0 0 75%;
|
| 674 |
+
max-width: 75%;
|
| 675 |
+
}
|
| 676 |
+
.col-10 {
|
| 677 |
+
-ms-flex: 0 0 83.333333%;
|
| 678 |
+
flex: 0 0 83.333333%;
|
| 679 |
+
max-width: 83.333333%;
|
| 680 |
+
}
|
| 681 |
+
.col-11 {
|
| 682 |
+
-ms-flex: 0 0 91.666667%;
|
| 683 |
+
flex: 0 0 91.666667%;
|
| 684 |
+
max-width: 91.666667%;
|
| 685 |
+
}
|
| 686 |
+
.col-12 {
|
| 687 |
+
-ms-flex: 0 0 100%;
|
| 688 |
+
flex: 0 0 100%;
|
| 689 |
+
max-width: 100%;
|
| 690 |
+
}
|
| 691 |
+
.order-first {
|
| 692 |
+
-ms-flex-order: -1;
|
| 693 |
+
order: -1;
|
| 694 |
+
}
|
| 695 |
+
.order-last {
|
| 696 |
+
-ms-flex-order: 13;
|
| 697 |
+
order: 13;
|
| 698 |
+
}
|
| 699 |
+
.order-0 {
|
| 700 |
+
-ms-flex-order: 0;
|
| 701 |
+
order: 0;
|
| 702 |
+
}
|
| 703 |
+
.order-1 {
|
| 704 |
+
-ms-flex-order: 1;
|
| 705 |
+
order: 1;
|
| 706 |
+
}
|
| 707 |
+
.order-2 {
|
| 708 |
+
-ms-flex-order: 2;
|
| 709 |
+
order: 2;
|
| 710 |
+
}
|
| 711 |
+
.order-3 {
|
| 712 |
+
-ms-flex-order: 3;
|
| 713 |
+
order: 3;
|
| 714 |
+
}
|
| 715 |
+
.order-4 {
|
| 716 |
+
-ms-flex-order: 4;
|
| 717 |
+
order: 4;
|
| 718 |
+
}
|
| 719 |
+
.order-5 {
|
| 720 |
+
-ms-flex-order: 5;
|
| 721 |
+
order: 5;
|
| 722 |
+
}
|
| 723 |
+
.order-6 {
|
| 724 |
+
-ms-flex-order: 6;
|
| 725 |
+
order: 6;
|
| 726 |
+
}
|
| 727 |
+
.order-7 {
|
| 728 |
+
-ms-flex-order: 7;
|
| 729 |
+
order: 7;
|
| 730 |
+
}
|
| 731 |
+
.order-8 {
|
| 732 |
+
-ms-flex-order: 8;
|
| 733 |
+
order: 8;
|
| 734 |
+
}
|
| 735 |
+
.order-9 {
|
| 736 |
+
-ms-flex-order: 9;
|
| 737 |
+
order: 9;
|
| 738 |
+
}
|
| 739 |
+
.order-10 {
|
| 740 |
+
-ms-flex-order: 10;
|
| 741 |
+
order: 10;
|
| 742 |
+
}
|
| 743 |
+
.order-11 {
|
| 744 |
+
-ms-flex-order: 11;
|
| 745 |
+
order: 11;
|
| 746 |
+
}
|
| 747 |
+
.order-12 {
|
| 748 |
+
-ms-flex-order: 12;
|
| 749 |
+
order: 12;
|
| 750 |
+
}
|
| 751 |
+
.offset-1 {
|
| 752 |
+
margin-left: 8.333333%;
|
| 753 |
+
}
|
| 754 |
+
.offset-2 {
|
| 755 |
+
margin-left: 16.666667%;
|
| 756 |
+
}
|
| 757 |
+
.offset-3 {
|
| 758 |
+
margin-left: 25%;
|
| 759 |
+
}
|
| 760 |
+
.offset-4 {
|
| 761 |
+
margin-left: 33.333333%;
|
| 762 |
+
}
|
| 763 |
+
.offset-5 {
|
| 764 |
+
margin-left: 41.666667%;
|
| 765 |
+
}
|
| 766 |
+
.offset-6 {
|
| 767 |
+
margin-left: 50%;
|
| 768 |
+
}
|
| 769 |
+
.offset-7 {
|
| 770 |
+
margin-left: 58.333333%;
|
| 771 |
+
}
|
| 772 |
+
.offset-8 {
|
| 773 |
+
margin-left: 66.666667%;
|
| 774 |
+
}
|
| 775 |
+
.offset-9 {
|
| 776 |
+
margin-left: 75%;
|
| 777 |
+
}
|
| 778 |
+
.offset-10 {
|
| 779 |
+
margin-left: 83.333333%;
|
| 780 |
+
}
|
| 781 |
+
.offset-11 {
|
| 782 |
+
margin-left: 91.666667%;
|
| 783 |
+
}
|
| 784 |
+
@media (min-width: 576px) {
|
| 785 |
+
.col-sm {
|
| 786 |
+
-ms-flex-preferred-size: 0;
|
| 787 |
+
flex-basis: 0;
|
| 788 |
+
-ms-flex-positive: 1;
|
| 789 |
+
flex-grow: 1;
|
| 790 |
+
max-width: 100%;
|
| 791 |
+
}
|
| 792 |
+
.col-sm-auto {
|
| 793 |
+
-ms-flex: 0 0 auto;
|
| 794 |
+
flex: 0 0 auto;
|
| 795 |
+
width: auto;
|
| 796 |
+
max-width: 100%;
|
| 797 |
+
}
|
| 798 |
+
.col-sm-1 {
|
| 799 |
+
-ms-flex: 0 0 8.333333%;
|
| 800 |
+
flex: 0 0 8.333333%;
|
| 801 |
+
max-width: 8.333333%;
|
| 802 |
+
}
|
| 803 |
+
.col-sm-2 {
|
| 804 |
+
-ms-flex: 0 0 16.666667%;
|
| 805 |
+
flex: 0 0 16.666667%;
|
| 806 |
+
max-width: 16.666667%;
|
| 807 |
+
}
|
| 808 |
+
.col-sm-3 {
|
| 809 |
+
-ms-flex: 0 0 25%;
|
| 810 |
+
flex: 0 0 25%;
|
| 811 |
+
max-width: 25%;
|
| 812 |
+
}
|
| 813 |
+
.col-sm-4 {
|
| 814 |
+
-ms-flex: 0 0 33.333333%;
|
| 815 |
+
flex: 0 0 33.333333%;
|
| 816 |
+
max-width: 33.333333%;
|
| 817 |
+
}
|
| 818 |
+
.col-sm-5 {
|
| 819 |
+
-ms-flex: 0 0 41.666667%;
|
| 820 |
+
flex: 0 0 41.666667%;
|
| 821 |
+
max-width: 41.666667%;
|
| 822 |
+
}
|
| 823 |
+
.col-sm-6 {
|
| 824 |
+
-ms-flex: 0 0 50%;
|
| 825 |
+
flex: 0 0 50%;
|
| 826 |
+
max-width: 50%;
|
| 827 |
+
}
|
| 828 |
+
.col-sm-7 {
|
| 829 |
+
-ms-flex: 0 0 58.333333%;
|
| 830 |
+
flex: 0 0 58.333333%;
|
| 831 |
+
max-width: 58.333333%;
|
| 832 |
+
}
|
| 833 |
+
.col-sm-8 {
|
| 834 |
+
-ms-flex: 0 0 66.666667%;
|
| 835 |
+
flex: 0 0 66.666667%;
|
| 836 |
+
max-width: 66.666667%;
|
| 837 |
+
}
|
| 838 |
+
.col-sm-9 {
|
| 839 |
+
-ms-flex: 0 0 75%;
|
| 840 |
+
flex: 0 0 75%;
|
| 841 |
+
max-width: 75%;
|
| 842 |
+
}
|
| 843 |
+
.col-sm-10 {
|
| 844 |
+
-ms-flex: 0 0 83.333333%;
|
| 845 |
+
flex: 0 0 83.333333%;
|
| 846 |
+
max-width: 83.333333%;
|
| 847 |
+
}
|
| 848 |
+
.col-sm-11 {
|
| 849 |
+
-ms-flex: 0 0 91.666667%;
|
| 850 |
+
flex: 0 0 91.666667%;
|
| 851 |
+
max-width: 91.666667%;
|
| 852 |
+
}
|
| 853 |
+
.col-sm-12 {
|
| 854 |
+
-ms-flex: 0 0 100%;
|
| 855 |
+
flex: 0 0 100%;
|
| 856 |
+
max-width: 100%;
|
| 857 |
+
}
|
| 858 |
+
.order-sm-first {
|
| 859 |
+
-ms-flex-order: -1;
|
| 860 |
+
order: -1;
|
| 861 |
+
}
|
| 862 |
+
.order-sm-last {
|
| 863 |
+
-ms-flex-order: 13;
|
| 864 |
+
order: 13;
|
| 865 |
+
}
|
| 866 |
+
.order-sm-0 {
|
| 867 |
+
-ms-flex-order: 0;
|
| 868 |
+
order: 0;
|
| 869 |
+
}
|
| 870 |
+
.order-sm-1 {
|
| 871 |
+
-ms-flex-order: 1;
|
| 872 |
+
order: 1;
|
| 873 |
+
}
|
| 874 |
+
.order-sm-2 {
|
| 875 |
+
-ms-flex-order: 2;
|
| 876 |
+
order: 2;
|
| 877 |
+
}
|
| 878 |
+
.order-sm-3 {
|
| 879 |
+
-ms-flex-order: 3;
|
| 880 |
+
order: 3;
|
| 881 |
+
}
|
| 882 |
+
.order-sm-4 {
|
| 883 |
+
-ms-flex-order: 4;
|
| 884 |
+
order: 4;
|
| 885 |
+
}
|
| 886 |
+
.order-sm-5 {
|
| 887 |
+
-ms-flex-order: 5;
|
| 888 |
+
order: 5;
|
| 889 |
+
}
|
| 890 |
+
.order-sm-6 {
|
| 891 |
+
-ms-flex-order: 6;
|
| 892 |
+
order: 6;
|
| 893 |
+
}
|
| 894 |
+
.order-sm-7 {
|
| 895 |
+
-ms-flex-order: 7;
|
| 896 |
+
order: 7;
|
| 897 |
+
}
|
| 898 |
+
.order-sm-8 {
|
| 899 |
+
-ms-flex-order: 8;
|
| 900 |
+
order: 8;
|
| 901 |
+
}
|
| 902 |
+
.order-sm-9 {
|
| 903 |
+
-ms-flex-order: 9;
|
| 904 |
+
order: 9;
|
| 905 |
+
}
|
| 906 |
+
.order-sm-10 {
|
| 907 |
+
-ms-flex-order: 10;
|
| 908 |
+
order: 10;
|
| 909 |
+
}
|
| 910 |
+
.order-sm-11 {
|
| 911 |
+
-ms-flex-order: 11;
|
| 912 |
+
order: 11;
|
| 913 |
+
}
|
| 914 |
+
.order-sm-12 {
|
| 915 |
+
-ms-flex-order: 12;
|
| 916 |
+
order: 12;
|
| 917 |
+
}
|
| 918 |
+
.offset-sm-0 {
|
| 919 |
+
margin-left: 0;
|
| 920 |
+
}
|
| 921 |
+
.offset-sm-1 {
|
| 922 |
+
margin-left: 8.333333%;
|
| 923 |
+
}
|
| 924 |
+
.offset-sm-2 {
|
| 925 |
+
margin-left: 16.666667%;
|
| 926 |
+
}
|
| 927 |
+
.offset-sm-3 {
|
| 928 |
+
margin-left: 25%;
|
| 929 |
+
}
|
| 930 |
+
.offset-sm-4 {
|
| 931 |
+
margin-left: 33.333333%;
|
| 932 |
+
}
|
| 933 |
+
.offset-sm-5 {
|
| 934 |
+
margin-left: 41.666667%;
|
| 935 |
+
}
|
| 936 |
+
.offset-sm-6 {
|
| 937 |
+
margin-left: 50%;
|
| 938 |
+
}
|
| 939 |
+
.offset-sm-7 {
|
| 940 |
+
margin-left: 58.333333%;
|
| 941 |
+
}
|
| 942 |
+
.offset-sm-8 {
|
| 943 |
+
margin-left: 66.666667%;
|
| 944 |
+
}
|
| 945 |
+
.offset-sm-9 {
|
| 946 |
+
margin-left: 75%;
|
| 947 |
+
}
|
| 948 |
+
.offset-sm-10 {
|
| 949 |
+
margin-left: 83.333333%;
|
| 950 |
+
}
|
| 951 |
+
.offset-sm-11 {
|
| 952 |
+
margin-left: 91.666667%;
|
| 953 |
+
}
|
| 954 |
+
}
|
| 955 |
+
@media (min-width: 768px) {
|
| 956 |
+
.col-md {
|
| 957 |
+
-ms-flex-preferred-size: 0;
|
| 958 |
+
flex-basis: 0;
|
| 959 |
+
-ms-flex-positive: 1;
|
| 960 |
+
flex-grow: 1;
|
| 961 |
+
max-width: 100%;
|
| 962 |
+
}
|
| 963 |
+
.col-md-auto {
|
| 964 |
+
-ms-flex: 0 0 auto;
|
| 965 |
+
flex: 0 0 auto;
|
| 966 |
+
width: auto;
|
| 967 |
+
max-width: 100%;
|
| 968 |
+
}
|
| 969 |
+
.col-md-1 {
|
| 970 |
+
-ms-flex: 0 0 8.333333%;
|
| 971 |
+
flex: 0 0 8.333333%;
|
| 972 |
+
max-width: 8.333333%;
|
| 973 |
+
}
|
| 974 |
+
.col-md-2 {
|
| 975 |
+
-ms-flex: 0 0 16.666667%;
|
| 976 |
+
flex: 0 0 16.666667%;
|
| 977 |
+
max-width: 16.666667%;
|
| 978 |
+
}
|
| 979 |
+
.col-md-3 {
|
| 980 |
+
-ms-flex: 0 0 25%;
|
| 981 |
+
flex: 0 0 25%;
|
| 982 |
+
max-width: 25%;
|
| 983 |
+
}
|
| 984 |
+
.col-md-4 {
|
| 985 |
+
-ms-flex: 0 0 33.333333%;
|
| 986 |
+
flex: 0 0 33.333333%;
|
| 987 |
+
max-width: 33.333333%;
|
| 988 |
+
}
|
| 989 |
+
.col-md-5 {
|
| 990 |
+
-ms-flex: 0 0 41.666667%;
|
| 991 |
+
flex: 0 0 41.666667%;
|
| 992 |
+
max-width: 41.666667%;
|
| 993 |
+
}
|
| 994 |
+
.col-md-6 {
|
| 995 |
+
-ms-flex: 0 0 50%;
|
| 996 |
+
flex: 0 0 50%;
|
| 997 |
+
max-width: 50%;
|
| 998 |
+
}
|
| 999 |
+
.col-md-7 {
|
| 1000 |
+
-ms-flex: 0 0 58.333333%;
|
| 1001 |
+
flex: 0 0 58.333333%;
|
| 1002 |
+
max-width: 58.333333%;
|
| 1003 |
+
}
|
| 1004 |
+
.col-md-8 {
|
| 1005 |
+
-ms-flex: 0 0 66.666667%;
|
| 1006 |
+
flex: 0 0 66.666667%;
|
| 1007 |
+
max-width: 66.666667%;
|
| 1008 |
+
}
|
| 1009 |
+
.col-md-9 {
|
| 1010 |
+
-ms-flex: 0 0 75%;
|
| 1011 |
+
flex: 0 0 75%;
|
| 1012 |
+
max-width: 75%;
|
| 1013 |
+
}
|
| 1014 |
+
.col-md-10 {
|
| 1015 |
+
-ms-flex: 0 0 83.333333%;
|
| 1016 |
+
flex: 0 0 83.333333%;
|
| 1017 |
+
max-width: 83.333333%;
|
| 1018 |
+
}
|
| 1019 |
+
.col-md-11 {
|
| 1020 |
+
-ms-flex: 0 0 91.666667%;
|
| 1021 |
+
flex: 0 0 91.666667%;
|
| 1022 |
+
max-width: 91.666667%;
|
| 1023 |
+
}
|
| 1024 |
+
.col-md-12 {
|
| 1025 |
+
-ms-flex: 0 0 100%;
|
| 1026 |
+
flex: 0 0 100%;
|
| 1027 |
+
max-width: 100%;
|
| 1028 |
+
}
|
| 1029 |
+
.order-md-first {
|
| 1030 |
+
-ms-flex-order: -1;
|
| 1031 |
+
order: -1;
|
| 1032 |
+
}
|
| 1033 |
+
.order-md-last {
|
| 1034 |
+
-ms-flex-order: 13;
|
| 1035 |
+
order: 13;
|
| 1036 |
+
}
|
| 1037 |
+
.order-md-0 {
|
| 1038 |
+
-ms-flex-order: 0;
|
| 1039 |
+
order: 0;
|
| 1040 |
+
}
|
| 1041 |
+
.order-md-1 {
|
| 1042 |
+
-ms-flex-order: 1;
|
| 1043 |
+
order: 1;
|
| 1044 |
+
}
|
| 1045 |
+
.order-md-2 {
|
| 1046 |
+
-ms-flex-order: 2;
|
| 1047 |
+
order: 2;
|
| 1048 |
+
}
|
| 1049 |
+
.order-md-3 {
|
| 1050 |
+
-ms-flex-order: 3;
|
| 1051 |
+
order: 3;
|
| 1052 |
+
}
|
| 1053 |
+
.order-md-4 {
|
| 1054 |
+
-ms-flex-order: 4;
|
| 1055 |
+
order: 4;
|
| 1056 |
+
}
|
| 1057 |
+
.order-md-5 {
|
| 1058 |
+
-ms-flex-order: 5;
|
| 1059 |
+
order: 5;
|
| 1060 |
+
}
|
| 1061 |
+
.order-md-6 {
|
| 1062 |
+
-ms-flex-order: 6;
|
| 1063 |
+
order: 6;
|
| 1064 |
+
}
|
| 1065 |
+
.order-md-7 {
|
| 1066 |
+
-ms-flex-order: 7;
|
| 1067 |
+
order: 7;
|
| 1068 |
+
}
|
| 1069 |
+
.order-md-8 {
|
| 1070 |
+
-ms-flex-order: 8;
|
| 1071 |
+
order: 8;
|
| 1072 |
+
}
|
| 1073 |
+
.order-md-9 {
|
| 1074 |
+
-ms-flex-order: 9;
|
| 1075 |
+
order: 9;
|
| 1076 |
+
}
|
| 1077 |
+
.order-md-10 {
|
| 1078 |
+
-ms-flex-order: 10;
|
| 1079 |
+
order: 10;
|
| 1080 |
+
}
|
| 1081 |
+
.order-md-11 {
|
| 1082 |
+
-ms-flex-order: 11;
|
| 1083 |
+
order: 11;
|
| 1084 |
+
}
|
| 1085 |
+
.order-md-12 {
|
| 1086 |
+
-ms-flex-order: 12;
|
| 1087 |
+
order: 12;
|
| 1088 |
+
}
|
| 1089 |
+
.offset-md-0 {
|
| 1090 |
+
margin-left: 0;
|
| 1091 |
+
}
|
| 1092 |
+
.offset-md-1 {
|
| 1093 |
+
margin-left: 8.333333%;
|
| 1094 |
+
}
|
| 1095 |
+
.offset-md-2 {
|
| 1096 |
+
margin-left: 16.666667%;
|
| 1097 |
+
}
|
| 1098 |
+
.offset-md-3 {
|
| 1099 |
+
margin-left: 25%;
|
| 1100 |
+
}
|
| 1101 |
+
.offset-md-4 {
|
| 1102 |
+
margin-left: 33.333333%;
|
| 1103 |
+
}
|
| 1104 |
+
.offset-md-5 {
|
| 1105 |
+
margin-left: 41.666667%;
|
| 1106 |
+
}
|
| 1107 |
+
.offset-md-6 {
|
| 1108 |
+
margin-left: 50%;
|
| 1109 |
+
}
|
| 1110 |
+
.offset-md-7 {
|
| 1111 |
+
margin-left: 58.333333%;
|
| 1112 |
+
}
|
| 1113 |
+
.offset-md-8 {
|
| 1114 |
+
margin-left: 66.666667%;
|
| 1115 |
+
}
|
| 1116 |
+
.offset-md-9 {
|
| 1117 |
+
margin-left: 75%;
|
| 1118 |
+
}
|
| 1119 |
+
.offset-md-10 {
|
| 1120 |
+
margin-left: 83.333333%;
|
| 1121 |
+
}
|
| 1122 |
+
.offset-md-11 {
|
| 1123 |
+
margin-left: 91.666667%;
|
| 1124 |
+
}
|
| 1125 |
+
}
|
| 1126 |
+
@media (min-width: 992px) {
|
| 1127 |
+
.col-lg {
|
| 1128 |
+
-ms-flex-preferred-size: 0;
|
| 1129 |
+
flex-basis: 0;
|
| 1130 |
+
-ms-flex-positive: 1;
|
| 1131 |
+
flex-grow: 1;
|
| 1132 |
+
max-width: 100%;
|
| 1133 |
+
}
|
| 1134 |
+
.col-lg-auto {
|
| 1135 |
+
-ms-flex: 0 0 auto;
|
| 1136 |
+
flex: 0 0 auto;
|
| 1137 |
+
width: auto;
|
| 1138 |
+
max-width: 100%;
|
| 1139 |
+
}
|
| 1140 |
+
.col-lg-1 {
|
| 1141 |
+
-ms-flex: 0 0 8.333333%;
|
| 1142 |
+
flex: 0 0 8.333333%;
|
| 1143 |
+
max-width: 8.333333%;
|
| 1144 |
+
}
|
| 1145 |
+
.col-lg-2 {
|
| 1146 |
+
-ms-flex: 0 0 16.666667%;
|
| 1147 |
+
flex: 0 0 16.666667%;
|
| 1148 |
+
max-width: 16.666667%;
|
| 1149 |
+
}
|
| 1150 |
+
.col-lg-3 {
|
| 1151 |
+
-ms-flex: 0 0 25%;
|
| 1152 |
+
flex: 0 0 25%;
|
| 1153 |
+
max-width: 25%;
|
| 1154 |
+
}
|
| 1155 |
+
.col-lg-4 {
|
| 1156 |
+
-ms-flex: 0 0 33.333333%;
|
| 1157 |
+
flex: 0 0 33.333333%;
|
| 1158 |
+
max-width: 33.333333%;
|
| 1159 |
+
}
|
| 1160 |
+
.col-lg-5 {
|
| 1161 |
+
-ms-flex: 0 0 41.666667%;
|
| 1162 |
+
flex: 0 0 41.666667%;
|
| 1163 |
+
max-width: 41.666667%;
|
| 1164 |
+
}
|
| 1165 |
+
.col-lg-6 {
|
| 1166 |
+
-ms-flex: 0 0 50%;
|
| 1167 |
+
flex: 0 0 50%;
|
| 1168 |
+
max-width: 50%;
|
| 1169 |
+
}
|
| 1170 |
+
.col-lg-7 {
|
| 1171 |
+
-ms-flex: 0 0 58.333333%;
|
| 1172 |
+
flex: 0 0 58.333333%;
|
| 1173 |
+
max-width: 58.333333%;
|
| 1174 |
+
}
|
| 1175 |
+
.col-lg-8 {
|
| 1176 |
+
-ms-flex: 0 0 66.666667%;
|
| 1177 |
+
flex: 0 0 66.666667%;
|
| 1178 |
+
max-width: 66.666667%;
|
| 1179 |
+
}
|
| 1180 |
+
.col-lg-9 {
|
| 1181 |
+
-ms-flex: 0 0 75%;
|
| 1182 |
+
flex: 0 0 75%;
|
| 1183 |
+
max-width: 75%;
|
| 1184 |
+
}
|
| 1185 |
+
.col-lg-10 {
|
| 1186 |
+
-ms-flex: 0 0 83.333333%;
|
| 1187 |
+
flex: 0 0 83.333333%;
|
| 1188 |
+
max-width: 83.333333%;
|
| 1189 |
+
}
|
| 1190 |
+
.col-lg-11 {
|
| 1191 |
+
-ms-flex: 0 0 91.666667%;
|
| 1192 |
+
flex: 0 0 91.666667%;
|
| 1193 |
+
max-width: 91.666667%;
|
| 1194 |
+
}
|
| 1195 |
+
.col-lg-12 {
|
| 1196 |
+
-ms-flex: 0 0 100%;
|
| 1197 |
+
flex: 0 0 100%;
|
| 1198 |
+
max-width: 100%;
|
| 1199 |
+
}
|
| 1200 |
+
.order-lg-first {
|
| 1201 |
+
-ms-flex-order: -1;
|
| 1202 |
+
order: -1;
|
| 1203 |
+
}
|
| 1204 |
+
.order-lg-last {
|
| 1205 |
+
-ms-flex-order: 13;
|
| 1206 |
+
order: 13;
|
| 1207 |
+
}
|
| 1208 |
+
.order-lg-0 {
|
| 1209 |
+
-ms-flex-order: 0;
|
| 1210 |
+
order: 0;
|
| 1211 |
+
}
|
| 1212 |
+
.order-lg-1 {
|
| 1213 |
+
-ms-flex-order: 1;
|
| 1214 |
+
order: 1;
|
| 1215 |
+
}
|
| 1216 |
+
.order-lg-2 {
|
| 1217 |
+
-ms-flex-order: 2;
|
| 1218 |
+
order: 2;
|
| 1219 |
+
}
|
| 1220 |
+
.order-lg-3 {
|
| 1221 |
+
-ms-flex-order: 3;
|
| 1222 |
+
order: 3;
|
| 1223 |
+
}
|
| 1224 |
+
.order-lg-4 {
|
| 1225 |
+
-ms-flex-order: 4;
|
| 1226 |
+
order: 4;
|
| 1227 |
+
}
|
| 1228 |
+
.order-lg-5 {
|
| 1229 |
+
-ms-flex-order: 5;
|
| 1230 |
+
order: 5;
|
| 1231 |
+
}
|
| 1232 |
+
.order-lg-6 {
|
| 1233 |
+
-ms-flex-order: 6;
|
| 1234 |
+
order: 6;
|
| 1235 |
+
}
|
| 1236 |
+
.order-lg-7 {
|
| 1237 |
+
-ms-flex-order: 7;
|
| 1238 |
+
order: 7;
|
| 1239 |
+
}
|
| 1240 |
+
.order-lg-8 {
|
| 1241 |
+
-ms-flex-order: 8;
|
| 1242 |
+
order: 8;
|
| 1243 |
+
}
|
| 1244 |
+
.order-lg-9 {
|
| 1245 |
+
-ms-flex-order: 9;
|
| 1246 |
+
order: 9;
|
| 1247 |
+
}
|
| 1248 |
+
.order-lg-10 {
|
| 1249 |
+
-ms-flex-order: 10;
|
| 1250 |
+
order: 10;
|
| 1251 |
+
}
|
| 1252 |
+
.order-lg-11 {
|
| 1253 |
+
-ms-flex-order: 11;
|
| 1254 |
+
order: 11;
|
| 1255 |
+
}
|
| 1256 |
+
.order-lg-12 {
|
| 1257 |
+
-ms-flex-order: 12;
|
| 1258 |
+
order: 12;
|
| 1259 |
+
}
|
| 1260 |
+
.offset-lg-0 {
|
| 1261 |
+
margin-left: 0;
|
| 1262 |
+
}
|
| 1263 |
+
.offset-lg-1 {
|
| 1264 |
+
margin-left: 8.333333%;
|
| 1265 |
+
}
|
| 1266 |
+
.offset-lg-2 {
|
| 1267 |
+
margin-left: 16.666667%;
|
| 1268 |
+
}
|
| 1269 |
+
.offset-lg-3 {
|
| 1270 |
+
margin-left: 25%;
|
| 1271 |
+
}
|
| 1272 |
+
.offset-lg-4 {
|
| 1273 |
+
margin-left: 33.333333%;
|
| 1274 |
+
}
|
| 1275 |
+
.offset-lg-5 {
|
| 1276 |
+
margin-left: 41.666667%;
|
| 1277 |
+
}
|
| 1278 |
+
.offset-lg-6 {
|
| 1279 |
+
margin-left: 50%;
|
| 1280 |
+
}
|
| 1281 |
+
.offset-lg-7 {
|
| 1282 |
+
margin-left: 58.333333%;
|
| 1283 |
+
}
|
| 1284 |
+
.offset-lg-8 {
|
| 1285 |
+
margin-left: 66.666667%;
|
| 1286 |
+
}
|
| 1287 |
+
.offset-lg-9 {
|
| 1288 |
+
margin-left: 75%;
|
| 1289 |
+
}
|
| 1290 |
+
.offset-lg-10 {
|
| 1291 |
+
margin-left: 83.333333%;
|
| 1292 |
+
}
|
| 1293 |
+
.offset-lg-11 {
|
| 1294 |
+
margin-left: 91.666667%;
|
| 1295 |
+
}
|
| 1296 |
+
}
|
| 1297 |
+
@media (min-width: 1200px) {
|
| 1298 |
+
.col-xl {
|
| 1299 |
+
-ms-flex-preferred-size: 0;
|
| 1300 |
+
flex-basis: 0;
|
| 1301 |
+
-ms-flex-positive: 1;
|
| 1302 |
+
flex-grow: 1;
|
| 1303 |
+
max-width: 100%;
|
| 1304 |
+
}
|
| 1305 |
+
.col-xl-auto {
|
| 1306 |
+
-ms-flex: 0 0 auto;
|
| 1307 |
+
flex: 0 0 auto;
|
| 1308 |
+
width: auto;
|
| 1309 |
+
max-width: 100%;
|
| 1310 |
+
}
|
| 1311 |
+
.col-xl-1 {
|
| 1312 |
+
-ms-flex: 0 0 8.333333%;
|
| 1313 |
+
flex: 0 0 8.333333%;
|
| 1314 |
+
max-width: 8.333333%;
|
| 1315 |
+
}
|
| 1316 |
+
.col-xl-2 {
|
| 1317 |
+
-ms-flex: 0 0 16.666667%;
|
| 1318 |
+
flex: 0 0 16.666667%;
|
| 1319 |
+
max-width: 16.666667%;
|
| 1320 |
+
}
|
| 1321 |
+
.col-xl-3 {
|
| 1322 |
+
-ms-flex: 0 0 25%;
|
| 1323 |
+
flex: 0 0 25%;
|
| 1324 |
+
max-width: 25%;
|
| 1325 |
+
}
|
| 1326 |
+
.col-xl-4 {
|
| 1327 |
+
-ms-flex: 0 0 33.333333%;
|
| 1328 |
+
flex: 0 0 33.333333%;
|
| 1329 |
+
max-width: 33.333333%;
|
| 1330 |
+
}
|
| 1331 |
+
.col-xl-5 {
|
| 1332 |
+
-ms-flex: 0 0 41.666667%;
|
| 1333 |
+
flex: 0 0 41.666667%;
|
| 1334 |
+
max-width: 41.666667%;
|
| 1335 |
+
}
|
| 1336 |
+
.col-xl-6 {
|
| 1337 |
+
-ms-flex: 0 0 50%;
|
| 1338 |
+
flex: 0 0 50%;
|
| 1339 |
+
max-width: 50%;
|
| 1340 |
+
}
|
| 1341 |
+
.col-xl-7 {
|
| 1342 |
+
-ms-flex: 0 0 58.333333%;
|
| 1343 |
+
flex: 0 0 58.333333%;
|
| 1344 |
+
max-width: 58.333333%;
|
| 1345 |
+
}
|
| 1346 |
+
.col-xl-8 {
|
| 1347 |
+
-ms-flex: 0 0 66.666667%;
|
| 1348 |
+
flex: 0 0 66.666667%;
|
| 1349 |
+
max-width: 66.666667%;
|
| 1350 |
+
}
|
| 1351 |
+
.col-xl-9 {
|
| 1352 |
+
-ms-flex: 0 0 75%;
|
| 1353 |
+
flex: 0 0 75%;
|
| 1354 |
+
max-width: 75%;
|
| 1355 |
+
}
|
| 1356 |
+
.col-xl-10 {
|
| 1357 |
+
-ms-flex: 0 0 83.333333%;
|
| 1358 |
+
flex: 0 0 83.333333%;
|
| 1359 |
+
max-width: 83.333333%;
|
| 1360 |
+
}
|
| 1361 |
+
.col-xl-11 {
|
| 1362 |
+
-ms-flex: 0 0 91.666667%;
|
| 1363 |
+
flex: 0 0 91.666667%;
|
| 1364 |
+
max-width: 91.666667%;
|
| 1365 |
+
}
|
| 1366 |
+
.col-xl-12 {
|
| 1367 |
+
-ms-flex: 0 0 100%;
|
| 1368 |
+
flex: 0 0 100%;
|
| 1369 |
+
max-width: 100%;
|
| 1370 |
+
}
|
| 1371 |
+
.order-xl-first {
|
| 1372 |
+
-ms-flex-order: -1;
|
| 1373 |
+
order: -1;
|
| 1374 |
+
}
|
| 1375 |
+
.order-xl-last {
|
| 1376 |
+
-ms-flex-order: 13;
|
| 1377 |
+
order: 13;
|
| 1378 |
+
}
|
| 1379 |
+
.order-xl-0 {
|
| 1380 |
+
-ms-flex-order: 0;
|
| 1381 |
+
order: 0;
|
| 1382 |
+
}
|
| 1383 |
+
.order-xl-1 {
|
| 1384 |
+
-ms-flex-order: 1;
|
| 1385 |
+
order: 1;
|
| 1386 |
+
}
|
| 1387 |
+
.order-xl-2 {
|
| 1388 |
+
-ms-flex-order: 2;
|
| 1389 |
+
order: 2;
|
| 1390 |
+
}
|
| 1391 |
+
.order-xl-3 {
|
| 1392 |
+
-ms-flex-order: 3;
|
| 1393 |
+
order: 3;
|
| 1394 |
+
}
|
| 1395 |
+
.order-xl-4 {
|
| 1396 |
+
-ms-flex-order: 4;
|
| 1397 |
+
order: 4;
|
| 1398 |
+
}
|
| 1399 |
+
.order-xl-5 {
|
| 1400 |
+
-ms-flex-order: 5;
|
| 1401 |
+
order: 5;
|
| 1402 |
+
}
|
| 1403 |
+
.order-xl-6 {
|
| 1404 |
+
-ms-flex-order: 6;
|
| 1405 |
+
order: 6;
|
| 1406 |
+
}
|
| 1407 |
+
.order-xl-7 {
|
| 1408 |
+
-ms-flex-order: 7;
|
| 1409 |
+
order: 7;
|
| 1410 |
+
}
|
| 1411 |
+
.order-xl-8 {
|
| 1412 |
+
-ms-flex-order: 8;
|
| 1413 |
+
order: 8;
|
| 1414 |
+
}
|
| 1415 |
+
.order-xl-9 {
|
| 1416 |
+
-ms-flex-order: 9;
|
| 1417 |
+
order: 9;
|
| 1418 |
+
}
|
| 1419 |
+
.order-xl-10 {
|
| 1420 |
+
-ms-flex-order: 10;
|
| 1421 |
+
order: 10;
|
| 1422 |
+
}
|
| 1423 |
+
.order-xl-11 {
|
| 1424 |
+
-ms-flex-order: 11;
|
| 1425 |
+
order: 11;
|
| 1426 |
+
}
|
| 1427 |
+
.order-xl-12 {
|
| 1428 |
+
-ms-flex-order: 12;
|
| 1429 |
+
order: 12;
|
| 1430 |
+
}
|
| 1431 |
+
.offset-xl-0 {
|
| 1432 |
+
margin-left: 0;
|
| 1433 |
+
}
|
| 1434 |
+
.offset-xl-1 {
|
| 1435 |
+
margin-left: 8.333333%;
|
| 1436 |
+
}
|
| 1437 |
+
.offset-xl-2 {
|
| 1438 |
+
margin-left: 16.666667%;
|
| 1439 |
+
}
|
| 1440 |
+
.offset-xl-3 {
|
| 1441 |
+
margin-left: 25%;
|
| 1442 |
+
}
|
| 1443 |
+
.offset-xl-4 {
|
| 1444 |
+
margin-left: 33.333333%;
|
| 1445 |
+
}
|
| 1446 |
+
.offset-xl-5 {
|
| 1447 |
+
margin-left: 41.666667%;
|
| 1448 |
+
}
|
| 1449 |
+
.offset-xl-6 {
|
| 1450 |
+
margin-left: 50%;
|
| 1451 |
+
}
|
| 1452 |
+
.offset-xl-7 {
|
| 1453 |
+
margin-left: 58.333333%;
|
| 1454 |
+
}
|
| 1455 |
+
.offset-xl-8 {
|
| 1456 |
+
margin-left: 66.666667%;
|
| 1457 |
+
}
|
| 1458 |
+
.offset-xl-9 {
|
| 1459 |
+
margin-left: 75%;
|
| 1460 |
+
}
|
| 1461 |
+
.offset-xl-10 {
|
| 1462 |
+
margin-left: 83.333333%;
|
| 1463 |
+
}
|
| 1464 |
+
.offset-xl-11 {
|
| 1465 |
+
margin-left: 91.666667%;
|
| 1466 |
+
}
|
| 1467 |
+
}
|
| 1468 |
+
.table {
|
| 1469 |
+
width: 100%;
|
| 1470 |
+
margin-bottom: 1rem;
|
| 1471 |
+
color: #212529;
|
| 1472 |
+
}
|
| 1473 |
+
.table td,
|
| 1474 |
+
.table th {
|
| 1475 |
+
padding: 0.75rem;
|
| 1476 |
+
vertical-align: top;
|
| 1477 |
+
border-top: 1px solid #dee2e6;
|
| 1478 |
+
}
|
| 1479 |
+
.table thead th {
|
| 1480 |
+
vertical-align: bottom;
|
| 1481 |
+
border-bottom: 2px solid #dee2e6;
|
| 1482 |
+
}
|
| 1483 |
+
.table tbody + tbody {
|
| 1484 |
+
border-top: 2px solid #dee2e6;
|
| 1485 |
+
}
|
| 1486 |
+
.table-sm td,
|
| 1487 |
+
.table-sm th {
|
| 1488 |
+
padding: 0.3rem;
|
| 1489 |
+
}
|
| 1490 |
+
.table-bordered {
|
| 1491 |
+
border: 1px solid #dee2e6;
|
| 1492 |
+
}
|
| 1493 |
+
.table-bordered td,
|
| 1494 |
+
.table-bordered th {
|
| 1495 |
+
border: 1px solid #dee2e6;
|
| 1496 |
+
}
|
| 1497 |
+
.table-bordered thead td,
|
| 1498 |
+
.table-bordered thead th {
|
| 1499 |
+
border-bottom-width: 2px;
|
| 1500 |
+
}
|
| 1501 |
+
.table-borderless tbody + tbody,
|
| 1502 |
+
.table-borderless td,
|
| 1503 |
+
.table-borderless th,
|
| 1504 |
+
.table-borderless thead th {
|
| 1505 |
+
border: 0;
|
| 1506 |
+
}
|
| 1507 |
+
.table-striped tbody tr:nth-of-type(odd) {
|
| 1508 |
+
background-color: rgba(0, 0, 0, 0.05);
|
| 1509 |
+
}
|
| 1510 |
+
.table-hover tbody tr:hover {
|
| 1511 |
+
color: #212529;
|
| 1512 |
+
background-color: rgba(0, 0, 0, 0.075);
|
| 1513 |
+
}
|
| 1514 |
+
.table-primary,
|
| 1515 |
+
.table-primary > td,
|
| 1516 |
+
.table-primary > th {
|
| 1517 |
+
background-color: #b8daff;
|
| 1518 |
+
}
|
| 1519 |
+
.table-primary tbody + tbody,
|
| 1520 |
+
.table-primary td,
|
| 1521 |
+
.table-primary th,
|
| 1522 |
+
.table-primary thead th {
|
| 1523 |
+
border-color: #7abaff;
|
| 1524 |
+
}
|
| 1525 |
+
.table-hover .table-primary:hover {
|
| 1526 |
+
background-color: #9fcdff;
|
| 1527 |
+
}
|
| 1528 |
+
.table-hover .table-primary:hover > td,
|
| 1529 |
+
.table-hover .table-primary:hover > th {
|
| 1530 |
+
background-color: #9fcdff;
|
| 1531 |
+
}
|
| 1532 |
+
.table-secondary,
|
| 1533 |
+
.table-secondary > td,
|
| 1534 |
+
.table-secondary > th {
|
| 1535 |
+
background-color: #d6d8db;
|
| 1536 |
+
}
|
| 1537 |
+
.table-secondary tbody + tbody,
|
| 1538 |
+
.table-secondary td,
|
| 1539 |
+
.table-secondary th,
|
| 1540 |
+
.table-secondary thead th {
|
| 1541 |
+
border-color: #b3b7bb;
|
| 1542 |
+
}
|
| 1543 |
+
.table-hover .table-secondary:hover {
|
| 1544 |
+
background-color: #c8cbcf;
|
| 1545 |
+
}
|
| 1546 |
+
.table-hover .table-secondary:hover > td,
|
| 1547 |
+
.table-hover .table-secondary:hover > th {
|
| 1548 |
+
background-color: #c8cbcf;
|
| 1549 |
+
}
|
| 1550 |
+
.table-success,
|
| 1551 |
+
.table-success > td,
|
| 1552 |
+
.table-success > th {
|
| 1553 |
+
background-color: #c3e6cb;
|
| 1554 |
+
}
|
| 1555 |
+
.table-success tbody + tbody,
|
| 1556 |
+
.table-success td,
|
| 1557 |
+
.table-success th,
|
| 1558 |
+
.table-success thead th {
|
| 1559 |
+
border-color: #8fd19e;
|
| 1560 |
+
}
|
| 1561 |
+
.table-hover .table-success:hover {
|
| 1562 |
+
background-color: #b1dfbb;
|
| 1563 |
+
}
|
| 1564 |
+
.table-hover .table-success:hover > td,
|
| 1565 |
+
.table-hover .table-success:hover > th {
|
| 1566 |
+
background-color: #b1dfbb;
|
| 1567 |
+
}
|
| 1568 |
+
.table-info,
|
| 1569 |
+
.table-info > td,
|
| 1570 |
+
.table-info > th {
|
| 1571 |
+
background-color: #bee5eb;
|
| 1572 |
+
}
|
| 1573 |
+
.table-info tbody + tbody,
|
| 1574 |
+
.table-info td,
|
| 1575 |
+
.table-info th,
|
| 1576 |
+
.table-info thead th {
|
| 1577 |
+
border-color: #86cfda;
|
| 1578 |
+
}
|
| 1579 |
+
.table-hover .table-info:hover {
|
| 1580 |
+
background-color: #abdde5;
|
| 1581 |
+
}
|
| 1582 |
+
.table-hover .table-info:hover > td,
|
| 1583 |
+
.table-hover .table-info:hover > th {
|
| 1584 |
+
background-color: #abdde5;
|
| 1585 |
+
}
|
| 1586 |
+
.table-warning,
|
| 1587 |
+
.table-warning > td,
|
| 1588 |
+
.table-warning > th {
|
| 1589 |
+
background-color: #ffeeba;
|
| 1590 |
+
}
|
| 1591 |
+
.table-warning tbody + tbody,
|
| 1592 |
+
.table-warning td,
|
| 1593 |
+
.table-warning th,
|
| 1594 |
+
.table-warning thead th {
|
| 1595 |
+
border-color: #ffdf7e;
|
| 1596 |
+
}
|
| 1597 |
+
.table-hover .table-warning:hover {
|
| 1598 |
+
background-color: #ffe8a1;
|
| 1599 |
+
}
|
| 1600 |
+
.table-hover .table-warning:hover > td,
|
| 1601 |
+
.table-hover .table-warning:hover > th {
|
| 1602 |
+
background-color: #ffe8a1;
|
| 1603 |
+
}
|
| 1604 |
+
.table-danger,
|
| 1605 |
+
.table-danger > td,
|
| 1606 |
+
.table-danger > th {
|
| 1607 |
+
background-color: #f5c6cb;
|
| 1608 |
+
}
|
| 1609 |
+
.table-danger tbody + tbody,
|
| 1610 |
+
.table-danger td,
|
| 1611 |
+
.table-danger th,
|
| 1612 |
+
.table-danger thead th {
|
| 1613 |
+
border-color: #ed969e;
|
| 1614 |
+
}
|
| 1615 |
+
.table-hover .table-danger:hover {
|
| 1616 |
+
background-color: #f1b0b7;
|
| 1617 |
+
}
|
| 1618 |
+
.table-hover .table-danger:hover > td,
|
| 1619 |
+
.table-hover .table-danger:hover > th {
|
| 1620 |
+
background-color: #f1b0b7;
|
| 1621 |
+
}
|
| 1622 |
+
.table-light,
|
| 1623 |
+
.table-light > td,
|
| 1624 |
+
.table-light > th {
|
| 1625 |
+
background-color: #fdfdfe;
|
| 1626 |
+
}
|
| 1627 |
+
.table-light tbody + tbody,
|
| 1628 |
+
.table-light td,
|
| 1629 |
+
.table-light th,
|
| 1630 |
+
.table-light thead th {
|
| 1631 |
+
border-color: #fbfcfc;
|
| 1632 |
+
}
|
| 1633 |
+
.table-hover .table-light:hover {
|
| 1634 |
+
background-color: #ececf6;
|
| 1635 |
+
}
|
| 1636 |
+
.table-hover .table-light:hover > td,
|
| 1637 |
+
.table-hover .table-light:hover > th {
|
| 1638 |
+
background-color: #ececf6;
|
| 1639 |
+
}
|
| 1640 |
+
.table-dark,
|
| 1641 |
+
.table-dark > td,
|
| 1642 |
+
.table-dark > th {
|
| 1643 |
+
background-color: #c6c8ca;
|
| 1644 |
+
}
|
| 1645 |
+
.table-dark tbody + tbody,
|
| 1646 |
+
.table-dark td,
|
| 1647 |
+
.table-dark th,
|
| 1648 |
+
.table-dark thead th {
|
| 1649 |
+
border-color: #95999c;
|
| 1650 |
+
}
|
| 1651 |
+
.table-hover .table-dark:hover {
|
| 1652 |
+
background-color: #b9bbbe;
|
| 1653 |
+
}
|
| 1654 |
+
.table-hover .table-dark:hover > td,
|
| 1655 |
+
.table-hover .table-dark:hover > th {
|
| 1656 |
+
background-color: #b9bbbe;
|
| 1657 |
+
}
|
| 1658 |
+
.table-active,
|
| 1659 |
+
.table-active > td,
|
| 1660 |
+
.table-active > th {
|
| 1661 |
+
background-color: rgba(0, 0, 0, 0.075);
|
| 1662 |
+
}
|
| 1663 |
+
.table-hover .table-active:hover {
|
| 1664 |
+
background-color: rgba(0, 0, 0, 0.075);
|
| 1665 |
+
}
|
| 1666 |
+
.table-hover .table-active:hover > td,
|
| 1667 |
+
.table-hover .table-active:hover > th {
|
| 1668 |
+
background-color: rgba(0, 0, 0, 0.075);
|
| 1669 |
+
}
|
| 1670 |
+
.table .thead-dark th {
|
| 1671 |
+
color: #fff;
|
| 1672 |
+
background-color: #343a40;
|
| 1673 |
+
border-color: #454d55;
|
| 1674 |
+
}
|
| 1675 |
+
.table .thead-light th {
|
| 1676 |
+
color: #495057;
|
| 1677 |
+
background-color: #e9ecef;
|
| 1678 |
+
border-color: #dee2e6;
|
| 1679 |
+
}
|
| 1680 |
+
.table-dark {
|
| 1681 |
+
color: #fff;
|
| 1682 |
+
background-color: #343a40;
|
| 1683 |
+
}
|
| 1684 |
+
.table-dark td,
|
| 1685 |
+
.table-dark th,
|
| 1686 |
+
.table-dark thead th {
|
| 1687 |
+
border-color: #454d55;
|
| 1688 |
+
}
|
| 1689 |
+
.table-dark.table-bordered {
|
| 1690 |
+
border: 0;
|
| 1691 |
+
}
|
| 1692 |
+
.table-dark.table-striped tbody tr:nth-of-type(odd) {
|
| 1693 |
+
background-color: rgba(255, 255, 255, 0.05);
|
| 1694 |
+
}
|
| 1695 |
+
.table-dark.table-hover tbody tr:hover {
|
| 1696 |
+
color: #fff;
|
| 1697 |
+
background-color: rgba(255, 255, 255, 0.075);
|
| 1698 |
+
}
|
| 1699 |
+
@media (max-width: 575.98px) {
|
| 1700 |
+
.table-responsive-sm {
|
| 1701 |
+
display: block;
|
| 1702 |
+
width: 100%;
|
| 1703 |
+
overflow-x: auto;
|
| 1704 |
+
-webkit-overflow-scrolling: touch;
|
| 1705 |
+
}
|
| 1706 |
+
.table-responsive-sm > .table-bordered {
|
| 1707 |
+
border: 0;
|
| 1708 |
+
}
|
| 1709 |
+
}
|
| 1710 |
+
@media (max-width: 767.98px) {
|
| 1711 |
+
.table-responsive-md {
|
| 1712 |
+
display: block;
|
| 1713 |
+
width: 100%;
|
| 1714 |
+
overflow-x: auto;
|
| 1715 |
+
-webkit-overflow-scrolling: touch;
|
| 1716 |
+
}
|
| 1717 |
+
.table-responsive-md > .table-bordered {
|
| 1718 |
+
border: 0;
|
| 1719 |
+
}
|
| 1720 |
+
}
|
| 1721 |
+
@media (max-width: 991.98px) {
|
| 1722 |
+
.table-responsive-lg {
|
| 1723 |
+
display: block;
|
| 1724 |
+
width: 100%;
|
| 1725 |
+
overflow-x: auto;
|
| 1726 |
+
-webkit-overflow-scrolling: touch;
|
| 1727 |
+
}
|
| 1728 |
+
.table-responsive-lg > .table-bordered {
|
| 1729 |
+
border: 0;
|
| 1730 |
+
}
|
| 1731 |
+
}
|
| 1732 |
+
@media (max-width: 1199.98px) {
|
| 1733 |
+
.table-responsive-xl {
|
| 1734 |
+
display: block;
|
| 1735 |
+
width: 100%;
|
| 1736 |
+
overflow-x: auto;
|
| 1737 |
+
-webkit-overflow-scrolling: touch;
|
| 1738 |
+
}
|
| 1739 |
+
.table-responsive-xl > .table-bordered {
|
| 1740 |
+
border: 0;
|
| 1741 |
+
}
|
| 1742 |
+
}
|
| 1743 |
+
.table-responsive {
|
| 1744 |
+
display: block;
|
| 1745 |
+
width: 100%;
|
| 1746 |
+
overflow-x: auto;
|
| 1747 |
+
-webkit-overflow-scrolling: touch;
|
| 1748 |
+
}
|
| 1749 |
+
.table-responsive > .table-bordered {
|
| 1750 |
+
border: 0;
|
| 1751 |
+
}
|
| 1752 |
+
.form-control {
|
| 1753 |
+
display: block;
|
| 1754 |
+
width: 100%;
|
| 1755 |
+
height: calc(1.5em + 0.75rem + 2px);
|
| 1756 |
+
padding: 0.375rem 0.75rem;
|
| 1757 |
+
font-size: 1rem;
|
| 1758 |
+
font-weight: 400;
|
| 1759 |
+
line-height: 1.5;
|
| 1760 |
+
color: #495057;
|
| 1761 |
+
background-color: #fff;
|
| 1762 |
+
background-clip: padding-box;
|
| 1763 |
+
border: 1px solid #ced4da;
|
| 1764 |
+
border-radius: 0.25rem;
|
| 1765 |
+
transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
|
| 1766 |
+
}
|
| 1767 |
+
@media (prefers-reduced-motion: reduce) {
|
| 1768 |
+
.form-control {
|
| 1769 |
+
transition: none;
|
| 1770 |
+
}
|
| 1771 |
+
}
|
| 1772 |
+
.form-control::-ms-expand {
|
| 1773 |
+
background-color: transparent;
|
| 1774 |
+
border: 0;
|
| 1775 |
+
}
|
| 1776 |
+
.form-control:focus {
|
| 1777 |
+
color: #495057;
|
| 1778 |
+
background-color: #fff;
|
| 1779 |
+
border-color: #80bdff;
|
| 1780 |
+
outline: 0;
|
| 1781 |
+
box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
|
| 1782 |
+
}
|
| 1783 |
+
.form-control::-webkit-input-placeholder {
|
| 1784 |
+
color: #6c757d;
|
| 1785 |
+
opacity: 1;
|
| 1786 |
+
}
|
| 1787 |
+
.form-control::-moz-placeholder {
|
| 1788 |
+
color: #6c757d;
|
| 1789 |
+
opacity: 1;
|
| 1790 |
+
}
|
| 1791 |
+
.form-control:-ms-input-placeholder {
|
| 1792 |
+
color: #6c757d;
|
| 1793 |
+
opacity: 1;
|
| 1794 |
+
}
|
| 1795 |
+
.form-control::-ms-input-placeholder {
|
| 1796 |
+
color: #6c757d;
|
| 1797 |
+
opacity: 1;
|
| 1798 |
+
}
|
| 1799 |
+
.form-control::placeholder {
|
| 1800 |
+
color: #6c757d;
|
| 1801 |
+
opacity: 1;
|
| 1802 |
+
}
|
| 1803 |
+
.form-control:disabled,
|
| 1804 |
+
.form-control[readonly] {
|
| 1805 |
+
background-color: #e9ecef;
|
| 1806 |
+
opacity: 1;
|
| 1807 |
+
}
|
| 1808 |
+
select.form-control:focus::-ms-value {
|
| 1809 |
+
color: #495057;
|
| 1810 |
+
background-color: #fff;
|
| 1811 |
+
}
|
| 1812 |
+
.form-control-file,
|
| 1813 |
+
.form-control-range {
|
| 1814 |
+
display: block;
|
| 1815 |
+
width: 100%;
|
| 1816 |
+
}
|
| 1817 |
+
.col-form-label {
|
| 1818 |
+
padding-top: calc(0.375rem + 1px);
|
| 1819 |
+
padding-bottom: calc(0.375rem + 1px);
|
| 1820 |
+
margin-bottom: 0;
|
| 1821 |
+
font-size: inherit;
|
| 1822 |
+
line-height: 1.5;
|
| 1823 |
+
}
|
| 1824 |
+
.col-form-label-lg {
|
| 1825 |
+
padding-top: calc(0.5rem + 1px);
|
| 1826 |
+
padding-bottom: calc(0.5rem + 1px);
|
| 1827 |
+
font-size: 1.25rem;
|
| 1828 |
+
line-height: 1.5;
|
| 1829 |
+
}
|
| 1830 |
+
.col-form-label-sm {
|
| 1831 |
+
padding-top: calc(0.25rem + 1px);
|
| 1832 |
+
padding-bottom: calc(0.25rem + 1px);
|
| 1833 |
+
font-size: 0.875rem;
|
| 1834 |
+
line-height: 1.5;
|
| 1835 |
+
}
|
| 1836 |
+
.form-control-plaintext {
|
| 1837 |
+
display: block;
|
| 1838 |
+
width: 100%;
|
| 1839 |
+
padding-top: 0.375rem;
|
| 1840 |
+
padding-bottom: 0.375rem;
|
| 1841 |
+
margin-bottom: 0;
|
| 1842 |
+
line-height: 1.5;
|
| 1843 |
+
color: #212529;
|
| 1844 |
+
background-color: transparent;
|
| 1845 |
+
border: solid transparent;
|
| 1846 |
+
border-width: 1px 0;
|
| 1847 |
+
}
|
| 1848 |
+
.form-control-plaintext.form-control-lg,
|
| 1849 |
+
.form-control-plaintext.form-control-sm {
|
| 1850 |
+
padding-right: 0;
|
| 1851 |
+
padding-left: 0;
|
| 1852 |
+
}
|
| 1853 |
+
.form-control-sm {
|
| 1854 |
+
height: calc(1.5em + 0.5rem + 2px);
|
| 1855 |
+
padding: 0.25rem 0.5rem;
|
| 1856 |
+
font-size: 0.875rem;
|
| 1857 |
+
line-height: 1.5;
|
| 1858 |
+
border-radius: 0.2rem;
|
| 1859 |
+
}
|
| 1860 |
+
.form-control-lg {
|
| 1861 |
+
height: calc(1.5em + 1rem + 2px);
|
| 1862 |
+
padding: 0.5rem 1rem;
|
| 1863 |
+
font-size: 1.25rem;
|
| 1864 |
+
line-height: 1.5;
|
| 1865 |
+
border-radius: 0.3rem;
|
| 1866 |
+
}
|
| 1867 |
+
select.form-control[multiple],
|
| 1868 |
+
select.form-control[size] {
|
| 1869 |
+
height: auto;
|
| 1870 |
+
}
|
| 1871 |
+
textarea.form-control {
|
| 1872 |
+
height: auto;
|
| 1873 |
+
}
|
| 1874 |
+
.form-group {
|
| 1875 |
+
margin-bottom: 1rem;
|
| 1876 |
+
}
|
| 1877 |
+
.form-text {
|
| 1878 |
+
display: block;
|
| 1879 |
+
margin-top: 0.25rem;
|
| 1880 |
+
}
|
| 1881 |
+
.form-row {
|
| 1882 |
+
display: -ms-flexbox;
|
| 1883 |
+
display: flex;
|
| 1884 |
+
-ms-flex-wrap: wrap;
|
| 1885 |
+
flex-wrap: wrap;
|
| 1886 |
+
margin-right: -5px;
|
| 1887 |
+
margin-left: -5px;
|
| 1888 |
+
}
|
| 1889 |
+
.form-row > .col,
|
| 1890 |
+
.form-row > [class*='col-'] {
|
| 1891 |
+
padding-right: 5px;
|
| 1892 |
+
padding-left: 5px;
|
| 1893 |
+
}
|
| 1894 |
+
.form-check {
|
| 1895 |
+
position: relative;
|
| 1896 |
+
display: block;
|
| 1897 |
+
padding-left: 1.25rem;
|
| 1898 |
+
}
|
| 1899 |
+
.form-check-input {
|
| 1900 |
+
position: absolute;
|
| 1901 |
+
margin-top: 0.3rem;
|
| 1902 |
+
margin-left: -1.25rem;
|
| 1903 |
+
}
|
| 1904 |
+
.form-check-input:disabled ~ .form-check-label {
|
| 1905 |
+
color: #6c757d;
|
| 1906 |
+
}
|
| 1907 |
+
.form-check-label {
|
| 1908 |
+
margin-bottom: 0;
|
| 1909 |
+
}
|
| 1910 |
+
.form-check-inline {
|
| 1911 |
+
display: -ms-inline-flexbox;
|
| 1912 |
+
display: inline-flex;
|
| 1913 |
+
-ms-flex-align: center;
|
| 1914 |
+
align-items: center;
|
| 1915 |
+
padding-left: 0;
|
| 1916 |
+
margin-right: 0.75rem;
|
| 1917 |
+
}
|
| 1918 |
+
.form-check-inline .form-check-input {
|
| 1919 |
+
position: static;
|
| 1920 |
+
margin-top: 0;
|
| 1921 |
+
margin-right: 0.3125rem;
|
| 1922 |
+
margin-left: 0;
|
| 1923 |
+
}
|
| 1924 |
+
.valid-feedback {
|
| 1925 |
+
display: none;
|
| 1926 |
+
width: 100%;
|
| 1927 |
+
margin-top: 0.25rem;
|
| 1928 |
+
font-size: 80%;
|
| 1929 |
+
color: #28a745;
|
| 1930 |
+
}
|
| 1931 |
+
.valid-tooltip {
|
| 1932 |
+
position: absolute;
|
| 1933 |
+
top: 100%;
|
| 1934 |
+
z-index: 5;
|
| 1935 |
+
display: none;
|
| 1936 |
+
max-width: 100%;
|
| 1937 |
+
padding: 0.25rem 0.5rem;
|
| 1938 |
+
margin-top: 0.1rem;
|
| 1939 |
+
font-size: 0.875rem;
|
| 1940 |
+
line-height: 1.5;
|
| 1941 |
+
color: #fff;
|
| 1942 |
+
background-color: rgba(40, 167, 69, 0.9);
|
| 1943 |
+
border-radius: 0.25rem;
|
| 1944 |
+
}
|
| 1945 |
+
.form-control.is-valid,
|
| 1946 |
+
.was-validated .form-control:valid {
|
| 1947 |
+
border-color: #28a745;
|
| 1948 |
+
padding-right: calc(1.5em + 0.75rem);
|
| 1949 |
+
background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");
|
| 1950 |
+
background-repeat: no-repeat;
|
| 1951 |
+
background-position: center right calc(0.375em + 0.1875rem);
|
| 1952 |
+
background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
|
| 1953 |
+
}
|
| 1954 |
+
.form-control.is-valid:focus,
|
| 1955 |
+
.was-validated .form-control:valid:focus {
|
| 1956 |
+
border-color: #28a745;
|
| 1957 |
+
box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25);
|
| 1958 |
+
}
|
| 1959 |
+
.form-control.is-valid ~ .valid-feedback,
|
| 1960 |
+
.form-control.is-valid ~ .valid-tooltip,
|
| 1961 |
+
.was-validated .form-control:valid ~ .valid-feedback,
|
| 1962 |
+
.was-validated .form-control:valid ~ .valid-tooltip {
|
| 1963 |
+
display: block;
|
| 1964 |
+
}
|
| 1965 |
+
.was-validated textarea.form-control:valid,
|
| 1966 |
+
textarea.form-control.is-valid {
|
| 1967 |
+
padding-right: calc(1.5em + 0.75rem);
|
| 1968 |
+
background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem);
|
| 1969 |
+
}
|
| 1970 |
+
.custom-select.is-valid,
|
| 1971 |
+
.was-validated .custom-select:valid {
|
| 1972 |
+
border-color: #28a745;
|
| 1973 |
+
padding-right: calc((1em + 0.75rem) * 3 / 4 + 1.75rem);
|
| 1974 |
+
background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e")
|
| 1975 |
+
no-repeat right 0.75rem center/8px 10px,
|
| 1976 |
+
url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e")
|
| 1977 |
+
#fff no-repeat center right 1.75rem / calc(0.75em + 0.375rem)
|
| 1978 |
+
calc(0.75em + 0.375rem);
|
| 1979 |
+
}
|
| 1980 |
+
.custom-select.is-valid:focus,
|
| 1981 |
+
.was-validated .custom-select:valid:focus {
|
| 1982 |
+
border-color: #28a745;
|
| 1983 |
+
box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25);
|
| 1984 |
+
}
|
| 1985 |
+
.custom-select.is-valid ~ .valid-feedback,
|
| 1986 |
+
.custom-select.is-valid ~ .valid-tooltip,
|
| 1987 |
+
.was-validated .custom-select:valid ~ .valid-feedback,
|
| 1988 |
+
.was-validated .custom-select:valid ~ .valid-tooltip {
|
| 1989 |
+
display: block;
|
| 1990 |
+
}
|
| 1991 |
+
.form-control-file.is-valid ~ .valid-feedback,
|
| 1992 |
+
.form-control-file.is-valid ~ .valid-tooltip,
|
| 1993 |
+
.was-validated .form-control-file:valid ~ .valid-feedback,
|
| 1994 |
+
.was-validated .form-control-file:valid ~ .valid-tooltip {
|
| 1995 |
+
display: block;
|
| 1996 |
+
}
|
| 1997 |
+
.form-check-input.is-valid ~ .form-check-label,
|
| 1998 |
+
.was-validated .form-check-input:valid ~ .form-check-label {
|
| 1999 |
+
color: #28a745;
|
| 2000 |
+
}
|
| 2001 |
+
.form-check-input.is-valid ~ .valid-feedback,
|
| 2002 |
+
.form-check-input.is-valid ~ .valid-tooltip,
|
| 2003 |
+
.was-validated .form-check-input:valid ~ .valid-feedback,
|
| 2004 |
+
.was-validated .form-check-input:valid ~ .valid-tooltip {
|
| 2005 |
+
display: block;
|
| 2006 |
+
}
|
| 2007 |
+
.custom-control-input.is-valid ~ .custom-control-label,
|
| 2008 |
+
.was-validated .custom-control-input:valid ~ .custom-control-label {
|
| 2009 |
+
color: #28a745;
|
| 2010 |
+
}
|
| 2011 |
+
.custom-control-input.is-valid ~ .custom-control-label::before,
|
| 2012 |
+
.was-validated .custom-control-input:valid ~ .custom-control-label::before {
|
| 2013 |
+
border-color: #28a745;
|
| 2014 |
+
}
|
| 2015 |
+
.custom-control-input.is-valid ~ .valid-feedback,
|
| 2016 |
+
.custom-control-input.is-valid ~ .valid-tooltip,
|
| 2017 |
+
.was-validated .custom-control-input:valid ~ .valid-feedback,
|
| 2018 |
+
.was-validated .custom-control-input:valid ~ .valid-tooltip {
|
| 2019 |
+
display: block;
|
| 2020 |
+
}
|
| 2021 |
+
.custom-control-input.is-valid:checked ~ .custom-control-label::before,
|
| 2022 |
+
.was-validated .custom-control-input:valid:checked ~ .custom-control-label::before {
|
| 2023 |
+
border-color: #34ce57;
|
| 2024 |
+
background-color: #34ce57;
|
| 2025 |
+
}
|
| 2026 |
+
.custom-control-input.is-valid:focus ~ .custom-control-label::before,
|
| 2027 |
+
.was-validated .custom-control-input:valid:focus ~ .custom-control-label::before {
|
| 2028 |
+
box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25);
|
| 2029 |
+
}
|
| 2030 |
+
.custom-control-input.is-valid:focus:not(:checked) ~ .custom-control-label::before,
|
| 2031 |
+
.was-validated
|
| 2032 |
+
.custom-control-input:valid:focus:not(:checked)
|
| 2033 |
+
~ .custom-control-label::before {
|
| 2034 |
+
border-color: #28a745;
|
| 2035 |
+
}
|
| 2036 |
+
.custom-file-input.is-valid ~ .custom-file-label,
|
| 2037 |
+
.was-validated .custom-file-input:valid ~ .custom-file-label {
|
| 2038 |
+
border-color: #28a745;
|
| 2039 |
+
}
|
| 2040 |
+
.custom-file-input.is-valid ~ .valid-feedback,
|
| 2041 |
+
.custom-file-input.is-valid ~ .valid-tooltip,
|
| 2042 |
+
.was-validated .custom-file-input:valid ~ .valid-feedback,
|
| 2043 |
+
.was-validated .custom-file-input:valid ~ .valid-tooltip {
|
| 2044 |
+
display: block;
|
| 2045 |
+
}
|
| 2046 |
+
.custom-file-input.is-valid:focus ~ .custom-file-label,
|
| 2047 |
+
.was-validated .custom-file-input:valid:focus ~ .custom-file-label {
|
| 2048 |
+
border-color: #28a745;
|
| 2049 |
+
box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25);
|
| 2050 |
+
}
|
| 2051 |
+
.invalid-feedback {
|
| 2052 |
+
display: none;
|
| 2053 |
+
width: 100%;
|
| 2054 |
+
margin-top: 0.25rem;
|
| 2055 |
+
font-size: 80%;
|
| 2056 |
+
color: #dc3545;
|
| 2057 |
+
}
|
| 2058 |
+
.invalid-tooltip {
|
| 2059 |
+
position: absolute;
|
| 2060 |
+
top: 100%;
|
| 2061 |
+
z-index: 5;
|
| 2062 |
+
display: none;
|
| 2063 |
+
max-width: 100%;
|
| 2064 |
+
padding: 0.25rem 0.5rem;
|
| 2065 |
+
margin-top: 0.1rem;
|
| 2066 |
+
font-size: 0.875rem;
|
| 2067 |
+
line-height: 1.5;
|
| 2068 |
+
color: #fff;
|
| 2069 |
+
background-color: rgba(220, 53, 69, 0.9);
|
| 2070 |
+
border-radius: 0.25rem;
|
| 2071 |
+
}
|
| 2072 |
+
.form-control.is-invalid,
|
| 2073 |
+
.was-validated .form-control:invalid {
|
| 2074 |
+
border-color: #dc3545;
|
| 2075 |
+
padding-right: calc(1.5em + 0.75rem);
|
| 2076 |
+
background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23dc3545' viewBox='-2 -2 7 7'%3e%3cpath stroke='%23dc3545' d='M0 0l3 3m0-3L0 3'/%3e%3ccircle r='.5'/%3e%3ccircle cx='3' r='.5'/%3e%3ccircle cy='3' r='.5'/%3e%3ccircle cx='3' cy='3' r='.5'/%3e%3c/svg%3E");
|
| 2077 |
+
background-repeat: no-repeat;
|
| 2078 |
+
background-position: center right calc(0.375em + 0.1875rem);
|
| 2079 |
+
background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
|
| 2080 |
+
}
|
| 2081 |
+
.form-control.is-invalid:focus,
|
| 2082 |
+
.was-validated .form-control:invalid:focus {
|
| 2083 |
+
border-color: #dc3545;
|
| 2084 |
+
box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25);
|
| 2085 |
+
}
|
| 2086 |
+
.form-control.is-invalid ~ .invalid-feedback,
|
| 2087 |
+
.form-control.is-invalid ~ .invalid-tooltip,
|
| 2088 |
+
.was-validated .form-control:invalid ~ .invalid-feedback,
|
| 2089 |
+
.was-validated .form-control:invalid ~ .invalid-tooltip {
|
| 2090 |
+
display: block;
|
| 2091 |
+
}
|
| 2092 |
+
.was-validated textarea.form-control:invalid,
|
| 2093 |
+
textarea.form-control.is-invalid {
|
| 2094 |
+
padding-right: calc(1.5em + 0.75rem);
|
| 2095 |
+
background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem);
|
| 2096 |
+
}
|
| 2097 |
+
.custom-select.is-invalid,
|
| 2098 |
+
.was-validated .custom-select:invalid {
|
| 2099 |
+
border-color: #dc3545;
|
| 2100 |
+
padding-right: calc((1em + 0.75rem) * 3 / 4 + 1.75rem);
|
| 2101 |
+
background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e")
|
| 2102 |
+
no-repeat right 0.75rem center/8px 10px,
|
| 2103 |
+
url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23dc3545' viewBox='-2 -2 7 7'%3e%3cpath stroke='%23dc3545' d='M0 0l3 3m0-3L0 3'/%3e%3ccircle r='.5'/%3e%3ccircle cx='3' r='.5'/%3e%3ccircle cy='3' r='.5'/%3e%3ccircle cx='3' cy='3' r='.5'/%3e%3c/svg%3E")
|
| 2104 |
+
#fff no-repeat center right 1.75rem / calc(0.75em + 0.375rem)
|
| 2105 |
+
calc(0.75em + 0.375rem);
|
| 2106 |
+
}
|
| 2107 |
+
.custom-select.is-invalid:focus,
|
| 2108 |
+
.was-validated .custom-select:invalid:focus {
|
| 2109 |
+
border-color: #dc3545;
|
| 2110 |
+
box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25);
|
| 2111 |
+
}
|
| 2112 |
+
.custom-select.is-invalid ~ .invalid-feedback,
|
| 2113 |
+
.custom-select.is-invalid ~ .invalid-tooltip,
|
| 2114 |
+
.was-validated .custom-select:invalid ~ .invalid-feedback,
|
| 2115 |
+
.was-validated .custom-select:invalid ~ .invalid-tooltip {
|
| 2116 |
+
display: block;
|
| 2117 |
+
}
|
| 2118 |
+
.form-control-file.is-invalid ~ .invalid-feedback,
|
| 2119 |
+
.form-control-file.is-invalid ~ .invalid-tooltip,
|
| 2120 |
+
.was-validated .form-control-file:invalid ~ .invalid-feedback,
|
| 2121 |
+
.was-validated .form-control-file:invalid ~ .invalid-tooltip {
|
| 2122 |
+
display: block;
|
| 2123 |
+
}
|
| 2124 |
+
.form-check-input.is-invalid ~ .form-check-label,
|
| 2125 |
+
.was-validated .form-check-input:invalid ~ .form-check-label {
|
| 2126 |
+
color: #dc3545;
|
| 2127 |
+
}
|
| 2128 |
+
.form-check-input.is-invalid ~ .invalid-feedback,
|
| 2129 |
+
.form-check-input.is-invalid ~ .invalid-tooltip,
|
| 2130 |
+
.was-validated .form-check-input:invalid ~ .invalid-feedback,
|
| 2131 |
+
.was-validated .form-check-input:invalid ~ .invalid-tooltip {
|
| 2132 |
+
display: block;
|
| 2133 |
+
}
|
| 2134 |
+
.custom-control-input.is-invalid ~ .custom-control-label,
|
| 2135 |
+
.was-validated .custom-control-input:invalid ~ .custom-control-label {
|
| 2136 |
+
color: #dc3545;
|
| 2137 |
+
}
|
| 2138 |
+
.custom-control-input.is-invalid ~ .custom-control-label::before,
|
| 2139 |
+
.was-validated .custom-control-input:invalid ~ .custom-control-label::before {
|
| 2140 |
+
border-color: #dc3545;
|
| 2141 |
+
}
|
| 2142 |
+
.custom-control-input.is-invalid ~ .invalid-feedback,
|
| 2143 |
+
.custom-control-input.is-invalid ~ .invalid-tooltip,
|
| 2144 |
+
.was-validated .custom-control-input:invalid ~ .invalid-feedback,
|
| 2145 |
+
.was-validated .custom-control-input:invalid ~ .invalid-tooltip {
|
| 2146 |
+
display: block;
|
| 2147 |
+
}
|
| 2148 |
+
.custom-control-input.is-invalid:checked ~ .custom-control-label::before,
|
| 2149 |
+
.was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before {
|
| 2150 |
+
border-color: #e4606d;
|
| 2151 |
+
background-color: #e4606d;
|
| 2152 |
+
}
|
| 2153 |
+
.custom-control-input.is-invalid:focus ~ .custom-control-label::before,
|
| 2154 |
+
.was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before {
|
| 2155 |
+
box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25);
|
| 2156 |
+
}
|
| 2157 |
+
.custom-control-input.is-invalid:focus:not(:checked) ~ .custom-control-label::before,
|
| 2158 |
+
.was-validated
|
| 2159 |
+
.custom-control-input:invalid:focus:not(:checked)
|
| 2160 |
+
~ .custom-control-label::before {
|
| 2161 |
+
border-color: #dc3545;
|
| 2162 |
+
}
|
| 2163 |
+
.custom-file-input.is-invalid ~ .custom-file-label,
|
| 2164 |
+
.was-validated .custom-file-input:invalid ~ .custom-file-label {
|
| 2165 |
+
border-color: #dc3545;
|
| 2166 |
+
}
|
| 2167 |
+
.custom-file-input.is-invalid ~ .invalid-feedback,
|
| 2168 |
+
.custom-file-input.is-invalid ~ .invalid-tooltip,
|
| 2169 |
+
.was-validated .custom-file-input:invalid ~ .invalid-feedback,
|
| 2170 |
+
.was-validated .custom-file-input:invalid ~ .invalid-tooltip {
|
| 2171 |
+
display: block;
|
| 2172 |
+
}
|
| 2173 |
+
.custom-file-input.is-invalid:focus ~ .custom-file-label,
|
| 2174 |
+
.was-validated .custom-file-input:invalid:focus ~ .custom-file-label {
|
| 2175 |
+
border-color: #dc3545;
|
| 2176 |
+
box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25);
|
| 2177 |
+
}
|
| 2178 |
+
.form-inline {
|
| 2179 |
+
display: -ms-flexbox;
|
| 2180 |
+
display: flex;
|
| 2181 |
+
-ms-flex-flow: row wrap;
|
| 2182 |
+
flex-flow: row wrap;
|
| 2183 |
+
-ms-flex-align: center;
|
| 2184 |
+
align-items: center;
|
| 2185 |
+
}
|
| 2186 |
+
.form-inline .form-check {
|
| 2187 |
+
width: 100%;
|
| 2188 |
+
}
|
| 2189 |
+
@media (min-width: 576px) {
|
| 2190 |
+
.form-inline label {
|
| 2191 |
+
display: -ms-flexbox;
|
| 2192 |
+
display: flex;
|
| 2193 |
+
-ms-flex-align: center;
|
| 2194 |
+
align-items: center;
|
| 2195 |
+
-ms-flex-pack: center;
|
| 2196 |
+
justify-content: center;
|
| 2197 |
+
margin-bottom: 0;
|
| 2198 |
+
}
|
| 2199 |
+
.form-inline .form-group {
|
| 2200 |
+
display: -ms-flexbox;
|
| 2201 |
+
display: flex;
|
| 2202 |
+
-ms-flex: 0 0 auto;
|
| 2203 |
+
flex: 0 0 auto;
|
| 2204 |
+
-ms-flex-flow: row wrap;
|
| 2205 |
+
flex-flow: row wrap;
|
| 2206 |
+
-ms-flex-align: center;
|
| 2207 |
+
align-items: center;
|
| 2208 |
+
margin-bottom: 0;
|
| 2209 |
+
}
|
| 2210 |
+
.form-inline .form-control {
|
| 2211 |
+
display: inline-block;
|
| 2212 |
+
width: auto;
|
| 2213 |
+
vertical-align: middle;
|
| 2214 |
+
}
|
| 2215 |
+
.form-inline .form-control-plaintext {
|
| 2216 |
+
display: inline-block;
|
| 2217 |
+
}
|
| 2218 |
+
.form-inline .custom-select,
|
| 2219 |
+
.form-inline .input-group {
|
| 2220 |
+
width: auto;
|
| 2221 |
+
}
|
| 2222 |
+
.form-inline .form-check {
|
| 2223 |
+
display: -ms-flexbox;
|
| 2224 |
+
display: flex;
|
| 2225 |
+
-ms-flex-align: center;
|
| 2226 |
+
align-items: center;
|
| 2227 |
+
-ms-flex-pack: center;
|
| 2228 |
+
justify-content: center;
|
| 2229 |
+
width: auto;
|
| 2230 |
+
padding-left: 0;
|
| 2231 |
+
}
|
| 2232 |
+
.form-inline .form-check-input {
|
| 2233 |
+
position: relative;
|
| 2234 |
+
-ms-flex-negative: 0;
|
| 2235 |
+
flex-shrink: 0;
|
| 2236 |
+
margin-top: 0;
|
| 2237 |
+
margin-right: 0.25rem;
|
| 2238 |
+
margin-left: 0;
|
| 2239 |
+
}
|
| 2240 |
+
.form-inline .custom-control {
|
| 2241 |
+
-ms-flex-align: center;
|
| 2242 |
+
align-items: center;
|
| 2243 |
+
-ms-flex-pack: center;
|
| 2244 |
+
justify-content: center;
|
| 2245 |
+
}
|
| 2246 |
+
.form-inline .custom-control-label {
|
| 2247 |
+
margin-bottom: 0;
|
| 2248 |
+
}
|
| 2249 |
+
}
|
| 2250 |
+
.btn {
|
| 2251 |
+
display: inline-block;
|
| 2252 |
+
font-weight: 400;
|
| 2253 |
+
color: #212529;
|
| 2254 |
+
text-align: center;
|
| 2255 |
+
vertical-align: middle;
|
| 2256 |
+
-webkit-user-select: none;
|
| 2257 |
+
-moz-user-select: none;
|
| 2258 |
+
-ms-user-select: none;
|
| 2259 |
+
user-select: none;
|
| 2260 |
+
background-color: transparent;
|
| 2261 |
+
border: 1px solid transparent;
|
| 2262 |
+
padding: 0.375rem 0.75rem;
|
| 2263 |
+
font-size: 1rem;
|
| 2264 |
+
line-height: 1.5;
|
| 2265 |
+
border-radius: 0.25rem;
|
| 2266 |
+
transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out,
|
| 2267 |
+
border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
|
| 2268 |
+
}
|
| 2269 |
+
@media (prefers-reduced-motion: reduce) {
|
| 2270 |
+
.btn {
|
| 2271 |
+
transition: none;
|
| 2272 |
+
}
|
| 2273 |
+
}
|
| 2274 |
+
.btn:hover {
|
| 2275 |
+
color: #212529;
|
| 2276 |
+
text-decoration: none;
|
| 2277 |
+
}
|
| 2278 |
+
.btn.focus,
|
| 2279 |
+
.btn:focus {
|
| 2280 |
+
outline: 0;
|
| 2281 |
+
box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
|
| 2282 |
+
}
|
| 2283 |
+
.btn.disabled,
|
| 2284 |
+
.btn:disabled {
|
| 2285 |
+
opacity: 0.65;
|
| 2286 |
+
}
|
| 2287 |
+
a.btn.disabled,
|
| 2288 |
+
fieldset:disabled a.btn {
|
| 2289 |
+
pointer-events: none;
|
| 2290 |
+
}
|
| 2291 |
+
.btn-primary {
|
| 2292 |
+
color: #fff;
|
| 2293 |
+
background-color: #007bff;
|
| 2294 |
+
border-color: #007bff;
|
| 2295 |
+
}
|
| 2296 |
+
.btn-primary:hover {
|
| 2297 |
+
color: #fff;
|
| 2298 |
+
background-color: #0069d9;
|
| 2299 |
+
border-color: #0062cc;
|
| 2300 |
+
}
|
| 2301 |
+
.btn-primary.focus,
|
| 2302 |
+
.btn-primary:focus {
|
| 2303 |
+
box-shadow: 0 0 0 0.2rem rgba(38, 143, 255, 0.5);
|
| 2304 |
+
}
|
| 2305 |
+
.btn-primary.disabled,
|
| 2306 |
+
.btn-primary:disabled {
|
| 2307 |
+
color: #fff;
|
| 2308 |
+
background-color: #007bff;
|
| 2309 |
+
border-color: #007bff;
|
| 2310 |
+
}
|
| 2311 |
+
.btn-primary:not(:disabled):not(.disabled).active,
|
| 2312 |
+
.btn-primary:not(:disabled):not(.disabled):active,
|
| 2313 |
+
.show > .btn-primary.dropdown-toggle {
|
| 2314 |
+
color: #fff;
|
| 2315 |
+
background-color: #0062cc;
|
| 2316 |
+
border-color: #005cbf;
|
| 2317 |
+
}
|
| 2318 |
+
.btn-primary:not(:disabled):not(.disabled).active:focus,
|
| 2319 |
+
.btn-primary:not(:disabled):not(.disabled):active:focus,
|
| 2320 |
+
.show > .btn-primary.dropdown-toggle:focus {
|
| 2321 |
+
box-shadow: 0 0 0 0.2rem rgba(38, 143, 255, 0.5);
|
| 2322 |
+
}
|
| 2323 |
+
.btn-secondary {
|
| 2324 |
+
color: #fff;
|
| 2325 |
+
background-color: #6c757d;
|
| 2326 |
+
border-color: #6c757d;
|
| 2327 |
+
}
|
| 2328 |
+
.btn-secondary:hover {
|
| 2329 |
+
color: #fff;
|
| 2330 |
+
background-color: #5a6268;
|
| 2331 |
+
border-color: #545b62;
|
| 2332 |
+
}
|
| 2333 |
+
.btn-secondary.focus,
|
| 2334 |
+
.btn-secondary:focus {
|
| 2335 |
+
box-shadow: 0 0 0 0.2rem rgba(130, 138, 145, 0.5);
|
| 2336 |
+
}
|
| 2337 |
+
.btn-secondary.disabled,
|
| 2338 |
+
.btn-secondary:disabled {
|
| 2339 |
+
color: #fff;
|
| 2340 |
+
background-color: #6c757d;
|
| 2341 |
+
border-color: #6c757d;
|
| 2342 |
+
}
|
| 2343 |
+
.btn-secondary:not(:disabled):not(.disabled).active,
|
| 2344 |
+
.btn-secondary:not(:disabled):not(.disabled):active,
|
| 2345 |
+
.show > .btn-secondary.dropdown-toggle {
|
| 2346 |
+
color: #fff;
|
| 2347 |
+
background-color: #545b62;
|
| 2348 |
+
border-color: #4e555b;
|
| 2349 |
+
}
|
| 2350 |
+
.btn-secondary:not(:disabled):not(.disabled).active:focus,
|
| 2351 |
+
.btn-secondary:not(:disabled):not(.disabled):active:focus,
|
| 2352 |
+
.show > .btn-secondary.dropdown-toggle:focus {
|
| 2353 |
+
box-shadow: 0 0 0 0.2rem rgba(130, 138, 145, 0.5);
|
| 2354 |
+
}
|
| 2355 |
+
.btn-success {
|
| 2356 |
+
color: #fff;
|
| 2357 |
+
background-color: #28a745;
|
| 2358 |
+
border-color: #28a745;
|
| 2359 |
+
}
|
| 2360 |
+
.btn-success:hover {
|
| 2361 |
+
color: #fff;
|
| 2362 |
+
background-color: #218838;
|
| 2363 |
+
border-color: #1e7e34;
|
| 2364 |
+
}
|
| 2365 |
+
.btn-success.focus,
|
| 2366 |
+
.btn-success:focus {
|
| 2367 |
+
box-shadow: 0 0 0 0.2rem rgba(72, 180, 97, 0.5);
|
| 2368 |
+
}
|
| 2369 |
+
.btn-success.disabled,
|
| 2370 |
+
.btn-success:disabled {
|
| 2371 |
+
color: #fff;
|
| 2372 |
+
background-color: #28a745;
|
| 2373 |
+
border-color: #28a745;
|
| 2374 |
+
}
|
| 2375 |
+
.btn-success:not(:disabled):not(.disabled).active,
|
| 2376 |
+
.btn-success:not(:disabled):not(.disabled):active,
|
| 2377 |
+
.show > .btn-success.dropdown-toggle {
|
| 2378 |
+
color: #fff;
|
| 2379 |
+
background-color: #1e7e34;
|
| 2380 |
+
border-color: #1c7430;
|
| 2381 |
+
}
|
| 2382 |
+
.btn-success:not(:disabled):not(.disabled).active:focus,
|
| 2383 |
+
.btn-success:not(:disabled):not(.disabled):active:focus,
|
| 2384 |
+
.show > .btn-success.dropdown-toggle:focus {
|
| 2385 |
+
box-shadow: 0 0 0 0.2rem rgba(72, 180, 97, 0.5);
|
| 2386 |
+
}
|
| 2387 |
+
.btn-info {
|
| 2388 |
+
color: #fff;
|
| 2389 |
+
background-color: #17a2b8;
|
| 2390 |
+
border-color: #17a2b8;
|
| 2391 |
+
}
|
| 2392 |
+
.btn-info:hover {
|
| 2393 |
+
color: #fff;
|
| 2394 |
+
background-color: #138496;
|
| 2395 |
+
border-color: #117a8b;
|
| 2396 |
+
}
|
| 2397 |
+
.btn-info.focus,
|
| 2398 |
+
.btn-info:focus {
|
| 2399 |
+
box-shadow: 0 0 0 0.2rem rgba(58, 176, 195, 0.5);
|
| 2400 |
+
}
|
| 2401 |
+
.btn-info.disabled,
|
| 2402 |
+
.btn-info:disabled {
|
| 2403 |
+
color: #fff;
|
| 2404 |
+
background-color: #17a2b8;
|
| 2405 |
+
border-color: #17a2b8;
|
| 2406 |
+
}
|
| 2407 |
+
.btn-info:not(:disabled):not(.disabled).active,
|
| 2408 |
+
.btn-info:not(:disabled):not(.disabled):active,
|
| 2409 |
+
.show > .btn-info.dropdown-toggle {
|
| 2410 |
+
color: #fff;
|
| 2411 |
+
background-color: #117a8b;
|
| 2412 |
+
border-color: #10707f;
|
| 2413 |
+
}
|
| 2414 |
+
.btn-info:not(:disabled):not(.disabled).active:focus,
|
| 2415 |
+
.btn-info:not(:disabled):not(.disabled):active:focus,
|
| 2416 |
+
.show > .btn-info.dropdown-toggle:focus {
|
| 2417 |
+
box-shadow: 0 0 0 0.2rem rgba(58, 176, 195, 0.5);
|
| 2418 |
+
}
|
| 2419 |
+
.btn-warning {
|
| 2420 |
+
color: #212529;
|
| 2421 |
+
background-color: #ffc107;
|
| 2422 |
+
border-color: #ffc107;
|
| 2423 |
+
}
|
| 2424 |
+
.btn-warning:hover {
|
| 2425 |
+
color: #212529;
|
| 2426 |
+
background-color: #e0a800;
|
| 2427 |
+
border-color: #d39e00;
|
| 2428 |
+
}
|
| 2429 |
+
.btn-warning.focus,
|
| 2430 |
+
.btn-warning:focus {
|
| 2431 |
+
box-shadow: 0 0 0 0.2rem rgba(222, 170, 12, 0.5);
|
| 2432 |
+
}
|
| 2433 |
+
.btn-warning.disabled,
|
| 2434 |
+
.btn-warning:disabled {
|
| 2435 |
+
color: #212529;
|
| 2436 |
+
background-color: #ffc107;
|
| 2437 |
+
border-color: #ffc107;
|
| 2438 |
+
}
|
| 2439 |
+
.btn-warning:not(:disabled):not(.disabled).active,
|
| 2440 |
+
.btn-warning:not(:disabled):not(.disabled):active,
|
| 2441 |
+
.show > .btn-warning.dropdown-toggle {
|
| 2442 |
+
color: #212529;
|
| 2443 |
+
background-color: #d39e00;
|
| 2444 |
+
border-color: #c69500;
|
| 2445 |
+
}
|
| 2446 |
+
.btn-warning:not(:disabled):not(.disabled).active:focus,
|
| 2447 |
+
.btn-warning:not(:disabled):not(.disabled):active:focus,
|
| 2448 |
+
.show > .btn-warning.dropdown-toggle:focus {
|
| 2449 |
+
box-shadow: 0 0 0 0.2rem rgba(222, 170, 12, 0.5);
|
| 2450 |
+
}
|
| 2451 |
+
.btn-danger {
|
| 2452 |
+
color: #fff;
|
| 2453 |
+
background-color: #dc3545;
|
| 2454 |
+
border-color: #dc3545;
|
| 2455 |
+
}
|
| 2456 |
+
.btn-danger:hover {
|
| 2457 |
+
color: #fff;
|
| 2458 |
+
background-color: #c82333;
|
| 2459 |
+
border-color: #bd2130;
|
| 2460 |
+
}
|
| 2461 |
+
.btn-danger.focus,
|
| 2462 |
+
.btn-danger:focus {
|
| 2463 |
+
box-shadow: 0 0 0 0.2rem rgba(225, 83, 97, 0.5);
|
| 2464 |
+
}
|
| 2465 |
+
.btn-danger.disabled,
|
| 2466 |
+
.btn-danger:disabled {
|
| 2467 |
+
color: #fff;
|
| 2468 |
+
background-color: #dc3545;
|
| 2469 |
+
border-color: #dc3545;
|
| 2470 |
+
}
|
| 2471 |
+
.btn-danger:not(:disabled):not(.disabled).active,
|
| 2472 |
+
.btn-danger:not(:disabled):not(.disabled):active,
|
| 2473 |
+
.show > .btn-danger.dropdown-toggle {
|
| 2474 |
+
color: #fff;
|
| 2475 |
+
background-color: #bd2130;
|
| 2476 |
+
border-color: #b21f2d;
|
| 2477 |
+
}
|
| 2478 |
+
.btn-danger:not(:disabled):not(.disabled).active:focus,
|
| 2479 |
+
.btn-danger:not(:disabled):not(.disabled):active:focus,
|
| 2480 |
+
.show > .btn-danger.dropdown-toggle:focus {
|
| 2481 |
+
box-shadow: 0 0 0 0.2rem rgba(225, 83, 97, 0.5);
|
| 2482 |
+
}
|
| 2483 |
+
.btn-light {
|
| 2484 |
+
color: #212529;
|
| 2485 |
+
background-color: #f8f9fa;
|
| 2486 |
+
border-color: #f8f9fa;
|
| 2487 |
+
}
|
| 2488 |
+
.btn-light:hover {
|
| 2489 |
+
color: #212529;
|
| 2490 |
+
background-color: #e2e6ea;
|
| 2491 |
+
border-color: #dae0e5;
|
| 2492 |
+
}
|
| 2493 |
+
.btn-light.focus,
|
| 2494 |
+
.btn-light:focus {
|
| 2495 |
+
box-shadow: 0 0 0 0.2rem rgba(216, 217, 219, 0.5);
|
| 2496 |
+
}
|
| 2497 |
+
.btn-light.disabled,
|
| 2498 |
+
.btn-light:disabled {
|
| 2499 |
+
color: #212529;
|
| 2500 |
+
background-color: #f8f9fa;
|
| 2501 |
+
border-color: #f8f9fa;
|
| 2502 |
+
}
|
| 2503 |
+
.btn-light:not(:disabled):not(.disabled).active,
|
| 2504 |
+
.btn-light:not(:disabled):not(.disabled):active,
|
| 2505 |
+
.show > .btn-light.dropdown-toggle {
|
| 2506 |
+
color: #212529;
|
| 2507 |
+
background-color: #dae0e5;
|
| 2508 |
+
border-color: #d3d9df;
|
| 2509 |
+
}
|
| 2510 |
+
.btn-light:not(:disabled):not(.disabled).active:focus,
|
| 2511 |
+
.btn-light:not(:disabled):not(.disabled):active:focus,
|
| 2512 |
+
.show > .btn-light.dropdown-toggle:focus {
|
| 2513 |
+
box-shadow: 0 0 0 0.2rem rgba(216, 217, 219, 0.5);
|
| 2514 |
+
}
|
| 2515 |
+
.btn-dark {
|
| 2516 |
+
color: #fff;
|
| 2517 |
+
background-color: #343a40;
|
| 2518 |
+
border-color: #343a40;
|
| 2519 |
+
}
|
| 2520 |
+
.btn-dark:hover {
|
| 2521 |
+
color: #fff;
|
| 2522 |
+
background-color: #23272b;
|
| 2523 |
+
border-color: #1d2124;
|
| 2524 |
+
}
|
| 2525 |
+
.btn-dark.focus,
|
| 2526 |
+
.btn-dark:focus {
|
| 2527 |
+
box-shadow: 0 0 0 0.2rem rgba(82, 88, 93, 0.5);
|
| 2528 |
+
}
|
| 2529 |
+
.btn-dark.disabled,
|
| 2530 |
+
.btn-dark:disabled {
|
| 2531 |
+
color: #fff;
|
| 2532 |
+
background-color: #343a40;
|
| 2533 |
+
border-color: #343a40;
|
| 2534 |
+
}
|
| 2535 |
+
.btn-dark:not(:disabled):not(.disabled).active,
|
| 2536 |
+
.btn-dark:not(:disabled):not(.disabled):active,
|
| 2537 |
+
.show > .btn-dark.dropdown-toggle {
|
| 2538 |
+
color: #fff;
|
| 2539 |
+
background-color: #1d2124;
|
| 2540 |
+
border-color: #171a1d;
|
| 2541 |
+
}
|
| 2542 |
+
.btn-dark:not(:disabled):not(.disabled).active:focus,
|
| 2543 |
+
.btn-dark:not(:disabled):not(.disabled):active:focus,
|
| 2544 |
+
.show > .btn-dark.dropdown-toggle:focus {
|
| 2545 |
+
box-shadow: 0 0 0 0.2rem rgba(82, 88, 93, 0.5);
|
| 2546 |
+
}
|
| 2547 |
+
.btn-outline-primary {
|
| 2548 |
+
color: #007bff;
|
| 2549 |
+
border-color: #007bff;
|
| 2550 |
+
}
|
| 2551 |
+
.btn-outline-primary:hover {
|
| 2552 |
+
color: #fff;
|
| 2553 |
+
background-color: #007bff;
|
| 2554 |
+
border-color: #007bff;
|
| 2555 |
+
}
|
| 2556 |
+
.btn-outline-primary.focus,
|
| 2557 |
+
.btn-outline-primary:focus {
|
| 2558 |
+
box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5);
|
| 2559 |
+
}
|
| 2560 |
+
.btn-outline-primary.disabled,
|
| 2561 |
+
.btn-outline-primary:disabled {
|
| 2562 |
+
color: #007bff;
|
| 2563 |
+
background-color: transparent;
|
| 2564 |
+
}
|
| 2565 |
+
.btn-outline-primary:not(:disabled):not(.disabled).active,
|
| 2566 |
+
.btn-outline-primary:not(:disabled):not(.disabled):active,
|
| 2567 |
+
.show > .btn-outline-primary.dropdown-toggle {
|
| 2568 |
+
color: #fff;
|
| 2569 |
+
background-color: #007bff;
|
| 2570 |
+
border-color: #007bff;
|
| 2571 |
+
}
|
| 2572 |
+
.btn-outline-primary:not(:disabled):not(.disabled).active:focus,
|
| 2573 |
+
.btn-outline-primary:not(:disabled):not(.disabled):active:focus,
|
| 2574 |
+
.show > .btn-outline-primary.dropdown-toggle:focus {
|
| 2575 |
+
box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5);
|
| 2576 |
+
}
|
| 2577 |
+
.btn-outline-secondary {
|
| 2578 |
+
color: #6c757d;
|
| 2579 |
+
border-color: #6c757d;
|
| 2580 |
+
}
|
| 2581 |
+
.btn-outline-secondary:hover {
|
| 2582 |
+
color: #fff;
|
| 2583 |
+
background-color: #6c757d;
|
| 2584 |
+
border-color: #6c757d;
|
| 2585 |
+
}
|
| 2586 |
+
.btn-outline-secondary.focus,
|
| 2587 |
+
.btn-outline-secondary:focus {
|
| 2588 |
+
box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5);
|
| 2589 |
+
}
|
| 2590 |
+
.btn-outline-secondary.disabled,
|
| 2591 |
+
.btn-outline-secondary:disabled {
|
| 2592 |
+
color: #6c757d;
|
| 2593 |
+
background-color: transparent;
|
| 2594 |
+
}
|
| 2595 |
+
.btn-outline-secondary:not(:disabled):not(.disabled).active,
|
| 2596 |
+
.btn-outline-secondary:not(:disabled):not(.disabled):active,
|
| 2597 |
+
.show > .btn-outline-secondary.dropdown-toggle {
|
| 2598 |
+
color: #fff;
|
| 2599 |
+
background-color: #6c757d;
|
| 2600 |
+
border-color: #6c757d;
|
| 2601 |
+
}
|
| 2602 |
+
.btn-outline-secondary:not(:disabled):not(.disabled).active:focus,
|
| 2603 |
+
.btn-outline-secondary:not(:disabled):not(.disabled):active:focus,
|
| 2604 |
+
.show > .btn-outline-secondary.dropdown-toggle:focus {
|
| 2605 |
+
box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5);
|
| 2606 |
+
}
|
| 2607 |
+
.btn-outline-success {
|
| 2608 |
+
color: #28a745;
|
| 2609 |
+
border-color: #28a745;
|
| 2610 |
+
}
|
| 2611 |
+
.btn-outline-success:hover {
|
| 2612 |
+
color: #fff;
|
| 2613 |
+
background-color: #28a745;
|
| 2614 |
+
border-color: #28a745;
|
| 2615 |
+
}
|
| 2616 |
+
.btn-outline-success.focus,
|
| 2617 |
+
.btn-outline-success:focus {
|
| 2618 |
+
box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5);
|
| 2619 |
+
}
|
| 2620 |
+
.btn-outline-success.disabled,
|
| 2621 |
+
.btn-outline-success:disabled {
|
| 2622 |
+
color: #28a745;
|
| 2623 |
+
background-color: transparent;
|
| 2624 |
+
}
|
| 2625 |
+
.btn-outline-success:not(:disabled):not(.disabled).active,
|
| 2626 |
+
.btn-outline-success:not(:disabled):not(.disabled):active,
|
| 2627 |
+
.show > .btn-outline-success.dropdown-toggle {
|
| 2628 |
+
color: #fff;
|
| 2629 |
+
background-color: #28a745;
|
| 2630 |
+
border-color: #28a745;
|
| 2631 |
+
}
|
| 2632 |
+
.btn-outline-success:not(:disabled):not(.disabled).active:focus,
|
| 2633 |
+
.btn-outline-success:not(:disabled):not(.disabled):active:focus,
|
| 2634 |
+
.show > .btn-outline-success.dropdown-toggle:focus {
|
| 2635 |
+
box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5);
|
| 2636 |
+
}
|
| 2637 |
+
.btn-outline-info {
|
| 2638 |
+
color: #17a2b8;
|
| 2639 |
+
border-color: #17a2b8;
|
| 2640 |
+
}
|
| 2641 |
+
.btn-outline-info:hover {
|
| 2642 |
+
color: #fff;
|
| 2643 |
+
background-color: #17a2b8;
|
| 2644 |
+
border-color: #17a2b8;
|
| 2645 |
+
}
|
| 2646 |
+
.btn-outline-info.focus,
|
| 2647 |
+
.btn-outline-info:focus {
|
| 2648 |
+
box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
|
| 2649 |
+
}
|
| 2650 |
+
.btn-outline-info.disabled,
|
| 2651 |
+
.btn-outline-info:disabled {
|
| 2652 |
+
color: #17a2b8;
|
| 2653 |
+
background-color: transparent;
|
| 2654 |
+
}
|
| 2655 |
+
.btn-outline-info:not(:disabled):not(.disabled).active,
|
| 2656 |
+
.btn-outline-info:not(:disabled):not(.disabled):active,
|
| 2657 |
+
.show > .btn-outline-info.dropdown-toggle {
|
| 2658 |
+
color: #fff;
|
| 2659 |
+
background-color: #17a2b8;
|
| 2660 |
+
border-color: #17a2b8;
|
| 2661 |
+
}
|
| 2662 |
+
.btn-outline-info:not(:disabled):not(.disabled).active:focus,
|
| 2663 |
+
.btn-outline-info:not(:disabled):not(.disabled):active:focus,
|
| 2664 |
+
.show > .btn-outline-info.dropdown-toggle:focus {
|
| 2665 |
+
box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
|
| 2666 |
+
}
|
| 2667 |
+
.btn-outline-warning {
|
| 2668 |
+
color: #ffc107;
|
| 2669 |
+
border-color: #ffc107;
|
| 2670 |
+
}
|
| 2671 |
+
.btn-outline-warning:hover {
|
| 2672 |
+
color: #212529;
|
| 2673 |
+
background-color: #ffc107;
|
| 2674 |
+
border-color: #ffc107;
|
| 2675 |
+
}
|
| 2676 |
+
.btn-outline-warning.focus,
|
| 2677 |
+
.btn-outline-warning:focus {
|
| 2678 |
+
box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5);
|
| 2679 |
+
}
|
| 2680 |
+
.btn-outline-warning.disabled,
|
| 2681 |
+
.btn-outline-warning:disabled {
|
| 2682 |
+
color: #ffc107;
|
| 2683 |
+
background-color: transparent;
|
| 2684 |
+
}
|
| 2685 |
+
.btn-outline-warning:not(:disabled):not(.disabled).active,
|
| 2686 |
+
.btn-outline-warning:not(:disabled):not(.disabled):active,
|
| 2687 |
+
.show > .btn-outline-warning.dropdown-toggle {
|
| 2688 |
+
color: #212529;
|
| 2689 |
+
background-color: #ffc107;
|
| 2690 |
+
border-color: #ffc107;
|
| 2691 |
+
}
|
| 2692 |
+
.btn-outline-warning:not(:disabled):not(.disabled).active:focus,
|
| 2693 |
+
.btn-outline-warning:not(:disabled):not(.disabled):active:focus,
|
| 2694 |
+
.show > .btn-outline-warning.dropdown-toggle:focus {
|
| 2695 |
+
box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5);
|
| 2696 |
+
}
|
| 2697 |
+
.btn-outline-danger {
|
| 2698 |
+
color: #dc3545;
|
| 2699 |
+
border-color: #dc3545;
|
| 2700 |
+
}
|
| 2701 |
+
.btn-outline-danger:hover {
|
| 2702 |
+
color: #fff;
|
| 2703 |
+
background-color: #dc3545;
|
| 2704 |
+
border-color: #dc3545;
|
| 2705 |
+
}
|
| 2706 |
+
.btn-outline-danger.focus,
|
| 2707 |
+
.btn-outline-danger:focus {
|
| 2708 |
+
box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5);
|
| 2709 |
+
}
|
| 2710 |
+
.btn-outline-danger.disabled,
|
| 2711 |
+
.btn-outline-danger:disabled {
|
| 2712 |
+
color: #dc3545;
|
| 2713 |
+
background-color: transparent;
|
| 2714 |
+
}
|
| 2715 |
+
.btn-outline-danger:not(:disabled):not(.disabled).active,
|
| 2716 |
+
.btn-outline-danger:not(:disabled):not(.disabled):active,
|
| 2717 |
+
.show > .btn-outline-danger.dropdown-toggle {
|
| 2718 |
+
color: #fff;
|
| 2719 |
+
background-color: #dc3545;
|
| 2720 |
+
border-color: #dc3545;
|
| 2721 |
+
}
|
| 2722 |
+
.btn-outline-danger:not(:disabled):not(.disabled).active:focus,
|
| 2723 |
+
.btn-outline-danger:not(:disabled):not(.disabled):active:focus,
|
| 2724 |
+
.show > .btn-outline-danger.dropdown-toggle:focus {
|
| 2725 |
+
box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5);
|
| 2726 |
+
}
|
| 2727 |
+
.btn-outline-light {
|
| 2728 |
+
color: #f8f9fa;
|
| 2729 |
+
border-color: #f8f9fa;
|
| 2730 |
+
}
|
| 2731 |
+
.btn-outline-light:hover {
|
| 2732 |
+
color: #212529;
|
| 2733 |
+
background-color: #f8f9fa;
|
| 2734 |
+
border-color: #f8f9fa;
|
| 2735 |
+
}
|
| 2736 |
+
.btn-outline-light.focus,
|
| 2737 |
+
.btn-outline-light:focus {
|
| 2738 |
+
box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5);
|
| 2739 |
+
}
|
| 2740 |
+
.btn-outline-light.disabled,
|
| 2741 |
+
.btn-outline-light:disabled {
|
| 2742 |
+
color: #f8f9fa;
|
| 2743 |
+
background-color: transparent;
|
| 2744 |
+
}
|
| 2745 |
+
.btn-outline-light:not(:disabled):not(.disabled).active,
|
| 2746 |
+
.btn-outline-light:not(:disabled):not(.disabled):active,
|
| 2747 |
+
.show > .btn-outline-light.dropdown-toggle {
|
| 2748 |
+
color: #212529;
|
| 2749 |
+
background-color: #f8f9fa;
|
| 2750 |
+
border-color: #f8f9fa;
|
| 2751 |
+
}
|
| 2752 |
+
.btn-outline-light:not(:disabled):not(.disabled).active:focus,
|
| 2753 |
+
.btn-outline-light:not(:disabled):not(.disabled):active:focus,
|
| 2754 |
+
.show > .btn-outline-light.dropdown-toggle:focus {
|
| 2755 |
+
box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5);
|
| 2756 |
+
}
|
| 2757 |
+
.btn-outline-dark {
|
| 2758 |
+
color: #343a40;
|
| 2759 |
+
border-color: #343a40;
|
| 2760 |
+
}
|
| 2761 |
+
.btn-outline-dark:hover {
|
| 2762 |
+
color: #fff;
|
| 2763 |
+
background-color: #343a40;
|
| 2764 |
+
border-color: #343a40;
|
| 2765 |
+
}
|
| 2766 |
+
.btn-outline-dark.focus,
|
| 2767 |
+
.btn-outline-dark:focus {
|
| 2768 |
+
box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5);
|
| 2769 |
+
}
|
| 2770 |
+
.btn-outline-dark.disabled,
|
| 2771 |
+
.btn-outline-dark:disabled {
|
| 2772 |
+
color: #343a40;
|
| 2773 |
+
background-color: transparent;
|
| 2774 |
+
}
|
| 2775 |
+
.btn-outline-dark:not(:disabled):not(.disabled).active,
|
| 2776 |
+
.btn-outline-dark:not(:disabled):not(.disabled):active,
|
| 2777 |
+
.show > .btn-outline-dark.dropdown-toggle {
|
| 2778 |
+
color: #fff;
|
| 2779 |
+
background-color: #343a40;
|
| 2780 |
+
border-color: #343a40;
|
| 2781 |
+
}
|
| 2782 |
+
.btn-outline-dark:not(:disabled):not(.disabled).active:focus,
|
| 2783 |
+
.btn-outline-dark:not(:disabled):not(.disabled):active:focus,
|
| 2784 |
+
.show > .btn-outline-dark.dropdown-toggle:focus {
|
| 2785 |
+
box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5);
|
| 2786 |
+
}
|
| 2787 |
+
.btn-link {
|
| 2788 |
+
font-weight: 400;
|
| 2789 |
+
color: #007bff;
|
| 2790 |
+
text-decoration: none;
|
| 2791 |
+
}
|
| 2792 |
+
.btn-link:hover {
|
| 2793 |
+
color: #0056b3;
|
| 2794 |
+
text-decoration: underline;
|
| 2795 |
+
}
|
| 2796 |
+
.btn-link.focus,
|
| 2797 |
+
.btn-link:focus {
|
| 2798 |
+
text-decoration: underline;
|
| 2799 |
+
box-shadow: none;
|
| 2800 |
+
}
|
| 2801 |
+
.btn-link.disabled,
|
| 2802 |
+
.btn-link:disabled {
|
| 2803 |
+
color: #6c757d;
|
| 2804 |
+
pointer-events: none;
|
| 2805 |
+
}
|
| 2806 |
+
.btn-group-lg > .btn,
|
| 2807 |
+
.btn-lg {
|
| 2808 |
+
padding: 0.5rem 1rem;
|
| 2809 |
+
font-size: 1.25rem;
|
| 2810 |
+
line-height: 1.5;
|
| 2811 |
+
border-radius: 0.3rem;
|
| 2812 |
+
}
|
| 2813 |
+
.btn-group-sm > .btn,
|
| 2814 |
+
.btn-sm {
|
| 2815 |
+
padding: 0.25rem 0.5rem;
|
| 2816 |
+
font-size: 0.875rem;
|
| 2817 |
+
line-height: 1.5;
|
| 2818 |
+
border-radius: 0.2rem;
|
| 2819 |
+
}
|
| 2820 |
+
.btn-block {
|
| 2821 |
+
display: block;
|
| 2822 |
+
width: 100%;
|
| 2823 |
+
}
|
| 2824 |
+
.btn-block + .btn-block {
|
| 2825 |
+
margin-top: 0.5rem;
|
| 2826 |
+
}
|
| 2827 |
+
input[type='button'].btn-block,
|
| 2828 |
+
input[type='reset'].btn-block,
|
| 2829 |
+
input[type='submit'].btn-block {
|
| 2830 |
+
width: 100%;
|
| 2831 |
+
}
|
| 2832 |
+
.fade {
|
| 2833 |
+
transition: opacity 0.15s linear;
|
| 2834 |
+
}
|
| 2835 |
+
@media (prefers-reduced-motion: reduce) {
|
| 2836 |
+
.fade {
|
| 2837 |
+
transition: none;
|
| 2838 |
+
}
|
| 2839 |
+
}
|
| 2840 |
+
.fade:not(.show) {
|
| 2841 |
+
opacity: 0;
|
| 2842 |
+
}
|
| 2843 |
+
.collapse:not(.show) {
|
| 2844 |
+
display: none;
|
| 2845 |
+
}
|
| 2846 |
+
.collapsing {
|
| 2847 |
+
position: relative;
|
| 2848 |
+
height: 0;
|
| 2849 |
+
overflow: hidden;
|
| 2850 |
+
transition: height 0.35s ease;
|
| 2851 |
+
}
|
| 2852 |
+
@media (prefers-reduced-motion: reduce) {
|
| 2853 |
+
.collapsing {
|
| 2854 |
+
transition: none;
|
| 2855 |
+
}
|
| 2856 |
+
}
|
| 2857 |
+
.dropdown,
|
| 2858 |
+
.dropleft,
|
| 2859 |
+
.dropright,
|
| 2860 |
+
.dropup {
|
| 2861 |
+
position: relative;
|
| 2862 |
+
}
|
| 2863 |
+
.dropdown-toggle {
|
| 2864 |
+
white-space: nowrap;
|
| 2865 |
+
}
|
| 2866 |
+
.dropdown-toggle::after {
|
| 2867 |
+
display: inline-block;
|
| 2868 |
+
margin-left: 0.255em;
|
| 2869 |
+
vertical-align: 0.255em;
|
| 2870 |
+
content: '';
|
| 2871 |
+
border-top: 0.3em solid;
|
| 2872 |
+
border-right: 0.3em solid transparent;
|
| 2873 |
+
border-bottom: 0;
|
| 2874 |
+
border-left: 0.3em solid transparent;
|
| 2875 |
+
}
|
| 2876 |
+
.dropdown-toggle:empty::after {
|
| 2877 |
+
margin-left: 0;
|
| 2878 |
+
}
|
| 2879 |
+
.dropdown-menu {
|
| 2880 |
+
position: absolute;
|
| 2881 |
+
top: 100%;
|
| 2882 |
+
left: 0;
|
| 2883 |
+
z-index: 1000;
|
| 2884 |
+
display: none;
|
| 2885 |
+
float: left;
|
| 2886 |
+
min-width: 10rem;
|
| 2887 |
+
padding: 0.5rem 0;
|
| 2888 |
+
margin: 0.125rem 0 0;
|
| 2889 |
+
font-size: 1rem;
|
| 2890 |
+
color: #212529;
|
| 2891 |
+
text-align: left;
|
| 2892 |
+
list-style: none;
|
| 2893 |
+
background-color: #fff;
|
| 2894 |
+
background-clip: padding-box;
|
| 2895 |
+
border: 1px solid rgba(0, 0, 0, 0.15);
|
| 2896 |
+
border-radius: 0.25rem;
|
| 2897 |
+
}
|
| 2898 |
+
.dropdown-menu-left {
|
| 2899 |
+
right: auto;
|
| 2900 |
+
left: 0;
|
| 2901 |
+
}
|
| 2902 |
+
.dropdown-menu-right {
|
| 2903 |
+
right: 0;
|
| 2904 |
+
left: auto;
|
| 2905 |
+
}
|
| 2906 |
+
@media (min-width: 576px) {
|
| 2907 |
+
.dropdown-menu-sm-left {
|
| 2908 |
+
right: auto;
|
| 2909 |
+
left: 0;
|
| 2910 |
+
}
|
| 2911 |
+
.dropdown-menu-sm-right {
|
| 2912 |
+
right: 0;
|
| 2913 |
+
left: auto;
|
| 2914 |
+
}
|
| 2915 |
+
}
|
| 2916 |
+
@media (min-width: 768px) {
|
| 2917 |
+
.dropdown-menu-md-left {
|
| 2918 |
+
right: auto;
|
| 2919 |
+
left: 0;
|
| 2920 |
+
}
|
| 2921 |
+
.dropdown-menu-md-right {
|
| 2922 |
+
right: 0;
|
| 2923 |
+
left: auto;
|
| 2924 |
+
}
|
| 2925 |
+
}
|
| 2926 |
+
@media (min-width: 992px) {
|
| 2927 |
+
.dropdown-menu-lg-left {
|
| 2928 |
+
right: auto;
|
| 2929 |
+
left: 0;
|
| 2930 |
+
}
|
| 2931 |
+
.dropdown-menu-lg-right {
|
| 2932 |
+
right: 0;
|
| 2933 |
+
left: auto;
|
| 2934 |
+
}
|
| 2935 |
+
}
|
| 2936 |
+
@media (min-width: 1200px) {
|
| 2937 |
+
.dropdown-menu-xl-left {
|
| 2938 |
+
right: auto;
|
| 2939 |
+
left: 0;
|
| 2940 |
+
}
|
| 2941 |
+
.dropdown-menu-xl-right {
|
| 2942 |
+
right: 0;
|
| 2943 |
+
left: auto;
|
| 2944 |
+
}
|
| 2945 |
+
}
|
| 2946 |
+
.dropup .dropdown-menu {
|
| 2947 |
+
top: auto;
|
| 2948 |
+
bottom: 100%;
|
| 2949 |
+
margin-top: 0;
|
| 2950 |
+
margin-bottom: 0.125rem;
|
| 2951 |
+
}
|
| 2952 |
+
.dropup .dropdown-toggle::after {
|
| 2953 |
+
display: inline-block;
|
| 2954 |
+
margin-left: 0.255em;
|
| 2955 |
+
vertical-align: 0.255em;
|
| 2956 |
+
content: '';
|
| 2957 |
+
border-top: 0;
|
| 2958 |
+
border-right: 0.3em solid transparent;
|
| 2959 |
+
border-bottom: 0.3em solid;
|
| 2960 |
+
border-left: 0.3em solid transparent;
|
| 2961 |
+
}
|
| 2962 |
+
.dropup .dropdown-toggle:empty::after {
|
| 2963 |
+
margin-left: 0;
|
| 2964 |
+
}
|
| 2965 |
+
.dropright .dropdown-menu {
|
| 2966 |
+
top: 0;
|
| 2967 |
+
right: auto;
|
| 2968 |
+
left: 100%;
|
| 2969 |
+
margin-top: 0;
|
| 2970 |
+
margin-left: 0.125rem;
|
| 2971 |
+
}
|
| 2972 |
+
.dropright .dropdown-toggle::after {
|
| 2973 |
+
display: inline-block;
|
| 2974 |
+
margin-left: 0.255em;
|
| 2975 |
+
vertical-align: 0.255em;
|
| 2976 |
+
content: '';
|
| 2977 |
+
border-top: 0.3em solid transparent;
|
| 2978 |
+
border-right: 0;
|
| 2979 |
+
border-bottom: 0.3em solid transparent;
|
| 2980 |
+
border-left: 0.3em solid;
|
| 2981 |
+
}
|
| 2982 |
+
.dropright .dropdown-toggle:empty::after {
|
| 2983 |
+
margin-left: 0;
|
| 2984 |
+
}
|
| 2985 |
+
.dropright .dropdown-toggle::after {
|
| 2986 |
+
vertical-align: 0;
|
| 2987 |
+
}
|
| 2988 |
+
.dropleft .dropdown-menu {
|
| 2989 |
+
top: 0;
|
| 2990 |
+
right: 100%;
|
| 2991 |
+
left: auto;
|
| 2992 |
+
margin-top: 0;
|
| 2993 |
+
margin-right: 0.125rem;
|
| 2994 |
+
}
|
| 2995 |
+
.dropleft .dropdown-toggle::after {
|
| 2996 |
+
display: inline-block;
|
| 2997 |
+
margin-left: 0.255em;
|
| 2998 |
+
vertical-align: 0.255em;
|
| 2999 |
+
content: '';
|
| 3000 |
+
}
|
| 3001 |
+
.dropleft .dropdown-toggle::after {
|
| 3002 |
+
display: none;
|
| 3003 |
+
}
|
| 3004 |
+
.dropleft .dropdown-toggle::before {
|
| 3005 |
+
display: inline-block;
|
| 3006 |
+
margin-right: 0.255em;
|
| 3007 |
+
vertical-align: 0.255em;
|
| 3008 |
+
content: '';
|
| 3009 |
+
border-top: 0.3em solid transparent;
|
| 3010 |
+
border-right: 0.3em solid;
|
| 3011 |
+
border-bottom: 0.3em solid transparent;
|
| 3012 |
+
}
|
| 3013 |
+
.dropleft .dropdown-toggle:empty::after {
|
| 3014 |
+
margin-left: 0;
|
| 3015 |
+
}
|
| 3016 |
+
.dropleft .dropdown-toggle::before {
|
| 3017 |
+
vertical-align: 0;
|
| 3018 |
+
}
|
| 3019 |
+
.dropdown-menu[x-placement^='bottom'],
|
| 3020 |
+
.dropdown-menu[x-placement^='left'],
|
| 3021 |
+
.dropdown-menu[x-placement^='right'],
|
| 3022 |
+
.dropdown-menu[x-placement^='top'] {
|
| 3023 |
+
right: auto;
|
| 3024 |
+
bottom: auto;
|
| 3025 |
+
}
|
| 3026 |
+
.dropdown-divider {
|
| 3027 |
+
height: 0;
|
| 3028 |
+
margin: 0.5rem 0;
|
| 3029 |
+
overflow: hidden;
|
| 3030 |
+
border-top: 1px solid #e9ecef;
|
| 3031 |
+
}
|
| 3032 |
+
.dropdown-item {
|
| 3033 |
+
display: block;
|
| 3034 |
+
width: 100%;
|
| 3035 |
+
padding: 0.25rem 1.5rem;
|
| 3036 |
+
clear: both;
|
| 3037 |
+
font-weight: 400;
|
| 3038 |
+
color: #212529;
|
| 3039 |
+
text-align: inherit;
|
| 3040 |
+
white-space: nowrap;
|
| 3041 |
+
background-color: transparent;
|
| 3042 |
+
border: 0;
|
| 3043 |
+
}
|
| 3044 |
+
.dropdown-item:focus,
|
| 3045 |
+
.dropdown-item:hover {
|
| 3046 |
+
color: #16181b;
|
| 3047 |
+
text-decoration: none;
|
| 3048 |
+
background-color: #f8f9fa;
|
| 3049 |
+
}
|
| 3050 |
+
.dropdown-item.active,
|
| 3051 |
+
.dropdown-item:active {
|
| 3052 |
+
color: #fff;
|
| 3053 |
+
text-decoration: none;
|
| 3054 |
+
background-color: #007bff;
|
| 3055 |
+
}
|
| 3056 |
+
.dropdown-item.disabled,
|
| 3057 |
+
.dropdown-item:disabled {
|
| 3058 |
+
color: #6c757d;
|
| 3059 |
+
pointer-events: none;
|
| 3060 |
+
background-color: transparent;
|
| 3061 |
+
}
|
| 3062 |
+
.dropdown-menu.show {
|
| 3063 |
+
display: block;
|
| 3064 |
+
}
|
| 3065 |
+
.dropdown-header {
|
| 3066 |
+
display: block;
|
| 3067 |
+
padding: 0.5rem 1.5rem;
|
| 3068 |
+
margin-bottom: 0;
|
| 3069 |
+
font-size: 0.875rem;
|
| 3070 |
+
color: #6c757d;
|
| 3071 |
+
white-space: nowrap;
|
| 3072 |
+
}
|
| 3073 |
+
.dropdown-item-text {
|
| 3074 |
+
display: block;
|
| 3075 |
+
padding: 0.25rem 1.5rem;
|
| 3076 |
+
color: #212529;
|
| 3077 |
+
}
|
| 3078 |
+
.btn-group,
|
| 3079 |
+
.btn-group-vertical {
|
| 3080 |
+
position: relative;
|
| 3081 |
+
display: -ms-inline-flexbox;
|
| 3082 |
+
display: inline-flex;
|
| 3083 |
+
vertical-align: middle;
|
| 3084 |
+
}
|
| 3085 |
+
.btn-group-vertical > .btn,
|
| 3086 |
+
.btn-group > .btn {
|
| 3087 |
+
position: relative;
|
| 3088 |
+
-ms-flex: 1 1 auto;
|
| 3089 |
+
flex: 1 1 auto;
|
| 3090 |
+
}
|
| 3091 |
+
.btn-group-vertical > .btn:hover,
|
| 3092 |
+
.btn-group > .btn:hover {
|
| 3093 |
+
z-index: 1;
|
| 3094 |
+
}
|
| 3095 |
+
.btn-group-vertical > .btn.active,
|
| 3096 |
+
.btn-group-vertical > .btn:active,
|
| 3097 |
+
.btn-group-vertical > .btn:focus,
|
| 3098 |
+
.btn-group > .btn.active,
|
| 3099 |
+
.btn-group > .btn:active,
|
| 3100 |
+
.btn-group > .btn:focus {
|
| 3101 |
+
z-index: 1;
|
| 3102 |
+
}
|
| 3103 |
+
.btn-toolbar {
|
| 3104 |
+
display: -ms-flexbox;
|
| 3105 |
+
display: flex;
|
| 3106 |
+
-ms-flex-wrap: wrap;
|
| 3107 |
+
flex-wrap: wrap;
|
| 3108 |
+
-ms-flex-pack: start;
|
| 3109 |
+
justify-content: flex-start;
|
| 3110 |
+
}
|
| 3111 |
+
.btn-toolbar .input-group {
|
| 3112 |
+
width: auto;
|
| 3113 |
+
}
|
| 3114 |
+
.btn-group > .btn-group:not(:first-child),
|
| 3115 |
+
.btn-group > .btn:not(:first-child) {
|
| 3116 |
+
margin-left: -1px;
|
| 3117 |
+
}
|
| 3118 |
+
.btn-group > .btn-group:not(:last-child) > .btn,
|
| 3119 |
+
.btn-group > .btn:not(:last-child):not(.dropdown-to
|
