Version Description
= 0.3 =
We've removed the compatibility shim for the magical content
attribute. If you were using this to support editing inner content, you'll need to change your UI registration to use inner_content
.
Download this release
Release Info
Developer | danielbachhuber |
Plugin | Shortcake (Shortcode UI) |
Version | 0.3.0 |
Comparing to | |
See all releases |
Code changes from version 0.2.3 to 0.3.0
- Gruntfile.js +59 -34
- composer.json +9 -1
- css/sass/shortcode-ui-editor-styles.scss +4 -38
- css/shortcode-ui-editor-styles.css +9 -36
- css/shortcode-ui-editor-styles.css.map +1 -1
- inc/class-shortcode-ui.php +55 -62
- inc/fields/class-field-attachment.php +6 -6
- inc/fields/class-field-color.php +6 -5
- inc/fields/class-field-post-select.php +166 -0
- inc/fields/class-shortcode-ui-fields.php +11 -2
- inc/templates/edit-form.tpl.php +24 -21
- js/build/field-attachment.js +65 -20
- js/build/field-color.js +60 -15
- js/build/field-post-select.js +202 -0
- js/build/shortcode-ui.js +169 -78
- js/{collections → src/collections}/shortcode-attributes.js +0 -0
- js/{collections → src/collections}/shortcodes.js +0 -0
- js/{controllers → src/controllers}/media-controller.js +2 -1
- js/{field-attachment.js → src/field-attachment.js} +7 -7
- js/{field-color.js → src/field-color.js} +2 -2
- js/src/field-post-select.js +199 -0
- js/{models → src/models}/inner-content.js +6 -1
- js/{models → src/models}/shortcode-attribute.js +4 -1
- js/{models → src/models}/shortcode.js +7 -6
- js/{shortcode-ui.js → src/shortcode-ui.js} +3 -3
- js/{utils → src/utils}/shortcode-view-constructor.js +43 -38
- js/{utils → src/utils}/sui.js +0 -0
- js/{views → src/views}/edit-attribute-field.js +41 -5
- js/{views → src/views}/edit-shortcode-form.js +24 -3
- js/{views → src/views}/insert-shortcode-list-item.js +0 -0
- js/{views → src/views}/insert-shortcode-list.js +0 -0
- js/{views → src/views}/media-frame.js +19 -5
- js/{views → src/views}/media-toolbar.js +0 -0
- js/{views → src/views}/search-shortcode.js +0 -0
- js/{views → src/views}/shortcode-preview.js +14 -10
- js/{views → src/views}/shortcode-ui.js +3 -3
- js/{views → src/views}/tabbed-view.js +2 -1
- languages/shortcode-ui-nl_NL.mo +0 -0
- languages/shortcode-ui-nl_NL.po +95 -0
- languages/shortcode-ui.pot +21 -13
- lib/select2/select2-spinner.gif +0 -0
- lib/select2/select2.css +704 -0
- lib/select2/select2.js +3541 -0
- lib/select2/select2.min.js +23 -0
- lib/select2/select2.png +0 -0
- lib/select2/select2x2.png +0 -0
- package.json +2 -0
- readme.txt +33 -5
- screenshot-1.png +0 -0
- screenshot-2.png +0 -0
- screenshot-3.png +0 -0
- screenshot-4.png +0 -0
- shortcode-ui.php +4 -2
Gruntfile.js
CHANGED
@@ -33,7 +33,7 @@ module.exports = function( grunt ) {
|
|
33 |
},
|
34 |
|
35 |
scripts: {
|
36 |
-
files: ['js/**/*.js', 'js-tests/src/**/*.js', '!js/build/**/*'],
|
37 |
tasks: ['scripts'],
|
38 |
options: {
|
39 |
debounceDelay: 500,
|
@@ -44,6 +44,16 @@ module.exports = function( grunt ) {
|
|
44 |
|
45 |
},
|
46 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
47 |
browserify : {
|
48 |
|
49 |
options: {
|
@@ -51,27 +61,27 @@ module.exports = function( grunt ) {
|
|
51 |
|
52 |
b.plugin(remapify, [
|
53 |
{
|
54 |
-
cwd: 'js/models',
|
55 |
src: '**/*.js',
|
56 |
expose: 'sui-models'
|
57 |
},
|
58 |
{
|
59 |
-
cwd: 'js/controllers',
|
60 |
src: '**/*.js',
|
61 |
expose: 'sui-controllers'
|
62 |
},
|
63 |
{
|
64 |
-
cwd: 'js/collections',
|
65 |
src: '**/*.js',
|
66 |
expose: 'sui-collections'
|
67 |
},
|
68 |
{
|
69 |
-
cwd: 'js/views',
|
70 |
src: '**/*.js',
|
71 |
expose: 'sui-views'
|
72 |
},
|
73 |
{
|
74 |
-
cwd: 'js/utils',
|
75 |
src: '**/*.js',
|
76 |
expose: 'sui-utils'
|
77 |
}
|
@@ -82,9 +92,10 @@ module.exports = function( grunt ) {
|
|
82 |
|
83 |
dist: {
|
84 |
files : {
|
85 |
-
'js/build/shortcode-ui.js' : ['js/shortcode-ui.js'],
|
86 |
-
'js/build/field-attachment.js' : ['js/field-attachment.js'],
|
87 |
-
'js/build/field-color.js' : ['js/field-color.js'],
|
|
|
88 |
},
|
89 |
options: {
|
90 |
transform: ['browserify-shim']
|
@@ -121,43 +132,57 @@ module.exports = function( grunt ) {
|
|
121 |
},
|
122 |
|
123 |
addtextdomain: {
|
124 |
-
|
125 |
-
|
126 |
-
|
127 |
-
|
128 |
-
|
129 |
-
|
130 |
-
|
131 |
-
|
132 |
}, //addtextdomain
|
133 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
134 |
makepot: {
|
135 |
-
|
136 |
-
|
137 |
-
|
138 |
-
|
139 |
-
|
140 |
-
|
141 |
-
|
142 |
-
|
143 |
-
|
144 |
-
|
145 |
-
|
146 |
-
|
147 |
-
|
148 |
}, //makepot
|
149 |
} );
|
150 |
|
151 |
grunt.loadNpmTasks( 'grunt-sass' );
|
152 |
grunt.loadNpmTasks( 'grunt-contrib-watch' );
|
153 |
grunt.loadNpmTasks( 'grunt-browserify' );
|
154 |
-
|
155 |
-
|
|
|
|
|
156 |
|
157 |
-
|
158 |
-
|
159 |
grunt.registerTask( 'default', [ 'scripts', 'styles' ] );
|
160 |
grunt.registerTask( 'i18n', ['addtextdomain', 'makepot'] );
|
|
|
161 |
|
162 |
grunt.util.linefeed = '\n';
|
163 |
|
33 |
},
|
34 |
|
35 |
scripts: {
|
36 |
+
files: ['js/src/**/*.js', 'js-tests/src/**/*.js', '!js/build/**/*'],
|
37 |
tasks: ['scripts'],
|
38 |
options: {
|
39 |
debounceDelay: 500,
|
44 |
|
45 |
},
|
46 |
|
47 |
+
phpcs: {
|
48 |
+
plugin: {
|
49 |
+
src: './'
|
50 |
+
},
|
51 |
+
options: {
|
52 |
+
bin: "vendor/bin/phpcs --extensions=php --ignore=\"*/vendor/*,*/node_modules/*,dev.php\"",
|
53 |
+
standard: "phpcs.ruleset.xml"
|
54 |
+
}
|
55 |
+
},
|
56 |
+
|
57 |
browserify : {
|
58 |
|
59 |
options: {
|
61 |
|
62 |
b.plugin(remapify, [
|
63 |
{
|
64 |
+
cwd: 'js/src/models',
|
65 |
src: '**/*.js',
|
66 |
expose: 'sui-models'
|
67 |
},
|
68 |
{
|
69 |
+
cwd: 'js/src/controllers',
|
70 |
src: '**/*.js',
|
71 |
expose: 'sui-controllers'
|
72 |
},
|
73 |
{
|
74 |
+
cwd: 'js/src/collections',
|
75 |
src: '**/*.js',
|
76 |
expose: 'sui-collections'
|
77 |
},
|
78 |
{
|
79 |
+
cwd: 'js/src/views',
|
80 |
src: '**/*.js',
|
81 |
expose: 'sui-views'
|
82 |
},
|
83 |
{
|
84 |
+
cwd: 'js/src/utils',
|
85 |
src: '**/*.js',
|
86 |
expose: 'sui-utils'
|
87 |
}
|
92 |
|
93 |
dist: {
|
94 |
files : {
|
95 |
+
'js/build/shortcode-ui.js' : ['js/src/shortcode-ui.js'],
|
96 |
+
'js/build/field-attachment.js' : ['js/src/field-attachment.js'],
|
97 |
+
'js/build/field-color.js' : ['js/src/field-color.js'],
|
98 |
+
'js/build/field-post-select.js' : ['js/src/field-post-select.js'],
|
99 |
},
|
100 |
options: {
|
101 |
transform: ['browserify-shim']
|
132 |
},
|
133 |
|
134 |
addtextdomain: {
|
135 |
+
options: {
|
136 |
+
textdomain: 'shortcode-ui', // Project text domain.
|
137 |
+
},
|
138 |
+
target: {
|
139 |
+
files: {
|
140 |
+
src: [ '*.php', '**/*.php', '!node_modules/**', '!php-tests/**', '!bin/**' ]
|
141 |
+
}
|
142 |
+
}
|
143 |
}, //addtextdomain
|
144 |
|
145 |
+
wp_readme_to_markdown: {
|
146 |
+
your_target: {
|
147 |
+
files: {
|
148 |
+
'README.md': 'readme.txt'
|
149 |
+
},
|
150 |
+
options: {
|
151 |
+
screenshot_url: 'http://s.wordpress.org/extend/plugins/shortcode-ui/{screenshot}.png',
|
152 |
+
}
|
153 |
+
},
|
154 |
+
},
|
155 |
+
|
156 |
makepot: {
|
157 |
+
target: {
|
158 |
+
options: {
|
159 |
+
domainPath: '/languages',
|
160 |
+
mainFile: 'shortcode-ui.php',
|
161 |
+
potFilename: 'shortcode-ui.pot',
|
162 |
+
potHeaders: {
|
163 |
+
poedit: true,
|
164 |
+
'x-poedit-keywordslist': true
|
165 |
+
},
|
166 |
+
type: 'wp-plugin',
|
167 |
+
updateTimestamp: true
|
168 |
+
}
|
169 |
+
}
|
170 |
}, //makepot
|
171 |
} );
|
172 |
|
173 |
grunt.loadNpmTasks( 'grunt-sass' );
|
174 |
grunt.loadNpmTasks( 'grunt-contrib-watch' );
|
175 |
grunt.loadNpmTasks( 'grunt-browserify' );
|
176 |
+
grunt.loadNpmTasks( 'grunt-phpcs' );
|
177 |
+
grunt.loadNpmTasks( 'grunt-wp-i18n' );
|
178 |
+
grunt.loadNpmTasks( 'grunt-wp-readme-to-markdown' );
|
179 |
+
grunt.loadNpmTasks( 'grunt-contrib-jasmine' );
|
180 |
|
181 |
+
grunt.registerTask( 'scripts', [ 'browserify', 'jasmine' ] );
|
182 |
+
grunt.registerTask( 'styles', [ 'sass' ] );
|
183 |
grunt.registerTask( 'default', [ 'scripts', 'styles' ] );
|
184 |
grunt.registerTask( 'i18n', ['addtextdomain', 'makepot'] );
|
185 |
+
grunt.registerTask( 'readme', ['wp_readme_to_markdown']);
|
186 |
|
187 |
grunt.util.linefeed = '\n';
|
188 |
|
composer.json
CHANGED
@@ -9,5 +9,13 @@
|
|
9 |
"email": "tech@fusion.net",
|
10 |
"homepage": "http://fusion.net"
|
11 |
}
|
12 |
-
]
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
13 |
}
|
|
9 |
"email": "tech@fusion.net",
|
10 |
"homepage": "http://fusion.net"
|
11 |
}
|
12 |
+
],
|
13 |
+
"require-dev": {
|
14 |
+
"wp-coding-standards/wpcs": "dev-develop"
|
15 |
+
},
|
16 |
+
"scripts": {
|
17 |
+
"post-install-cmd": "\"vendor/bin/phpcs\" --config-set installed_paths vendor/wp-coding-standards/wpcs",
|
18 |
+
"post-update-cmd" : "\"vendor/bin/phpcs\" --config-set installed_paths vendor/wp-coding-standards/wpcs"
|
19 |
+
}
|
20 |
}
|
21 |
+
|
css/sass/shortcode-ui-editor-styles.scss
CHANGED
@@ -1,8 +1,6 @@
|
|
1 |
.wpview-wrap {
|
2 |
-
min-height: 48px;
|
3 |
|
4 |
&.wp-mce-view-show-toolbar {
|
5 |
-
|
6 |
.toolbar {
|
7 |
display: block;
|
8 |
}
|
@@ -13,42 +11,10 @@
|
|
13 |
font-weight: bold;
|
14 |
}
|
15 |
|
16 |
-
|
17 |
-
|
18 |
-
|
19 |
-
|
20 |
-
width: 60px;
|
21 |
-
height: 5px;
|
22 |
-
overflow: hidden;
|
23 |
-
background-color: transparent;
|
24 |
-
margin: 10px auto 0;
|
25 |
-
|
26 |
-
ins {
|
27 |
-
background-color: #333;
|
28 |
-
margin: 0 0 0 -60px;
|
29 |
-
width: 60px;
|
30 |
-
height: 5px;
|
31 |
-
display: block;
|
32 |
-
-webkit-animation: preview-loading 1.3s infinite 1s linear;
|
33 |
-
animation: preview-loading 1.3s infinite 1s linear;
|
34 |
-
}
|
35 |
}
|
36 |
-
}
|
37 |
|
38 |
-
@-webkit-keyframes preview-loading {
|
39 |
-
0% {
|
40 |
-
margin-left: -60px;
|
41 |
-
}
|
42 |
-
100% {
|
43 |
-
margin-left: 60px;
|
44 |
-
}
|
45 |
-
}
|
46 |
-
|
47 |
-
@keyframes preview-loading {
|
48 |
-
0% {
|
49 |
-
margin-left: -60px;
|
50 |
-
}
|
51 |
-
100% {
|
52 |
-
margin-left: 60px;
|
53 |
-
}
|
54 |
}
|
1 |
.wpview-wrap {
|
|
|
2 |
|
3 |
&.wp-mce-view-show-toolbar {
|
|
|
4 |
.toolbar {
|
5 |
display: block;
|
6 |
}
|
11 |
font-weight: bold;
|
12 |
}
|
13 |
|
14 |
+
.shortcake-empty {
|
15 |
+
font-family: Consolas, Monaco, monospace;
|
16 |
+
color: #666;
|
17 |
+
font-size: 14px;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
18 |
}
|
|
|
19 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
20 |
}
|
css/shortcode-ui-editor-styles.css
CHANGED
@@ -1,38 +1,11 @@
|
|
1 |
-
.wpview-wrap {
|
2 |
-
|
3 |
-
|
4 |
-
|
5 |
-
|
6 |
-
|
7 |
-
|
8 |
-
|
9 |
-
|
10 |
-
width: 60px;
|
11 |
-
height: 5px;
|
12 |
-
overflow: hidden;
|
13 |
-
background-color: transparent;
|
14 |
-
margin: 10px auto 0; }
|
15 |
-
.shortcake-preview .loading-placeholder .wpview-loading ins {
|
16 |
-
background-color: #333;
|
17 |
-
margin: 0 0 0 -60px;
|
18 |
-
width: 60px;
|
19 |
-
height: 5px;
|
20 |
-
display: block;
|
21 |
-
-webkit-animation: preview-loading 1.3s infinite 1s linear;
|
22 |
-
animation: preview-loading 1.3s infinite 1s linear; }
|
23 |
-
|
24 |
-
@-webkit-keyframes preview-loading {
|
25 |
-
0% {
|
26 |
-
margin-left: -60px; }
|
27 |
-
|
28 |
-
100% {
|
29 |
-
margin-left: 60px; } }
|
30 |
-
|
31 |
-
@keyframes preview-loading {
|
32 |
-
0% {
|
33 |
-
margin-left: -60px; }
|
34 |
-
|
35 |
-
100% {
|
36 |
-
margin-left: 60px; } }
|
37 |
|
38 |
/*# sourceMappingURL=shortcode-ui-editor-styles.css.map */
|
1 |
+
.wpview-wrap.wp-mce-view-show-toolbar .toolbar {
|
2 |
+
display: block; }
|
3 |
+
.wpview-wrap .shortcake-error {
|
4 |
+
color: red;
|
5 |
+
font-weight: bold; }
|
6 |
+
.wpview-wrap .shortcake-empty {
|
7 |
+
font-family: Consolas, Monaco, monospace;
|
8 |
+
color: #666;
|
9 |
+
font-size: 14px; }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
10 |
|
11 |
/*# sourceMappingURL=shortcode-ui-editor-styles.css.map */
|
css/shortcode-ui-editor-styles.css.map
CHANGED
@@ -5,6 +5,6 @@
|
|
5 |
"../shortcode-ui-editor-styles.scss"
|
6 |
],
|
7 |
"sourcesContent": [],
|
8 |
-
"mappings": "
|
9 |
"names": []
|
10 |
}
|
5 |
"../shortcode-ui-editor-styles.scss"
|
6 |
],
|
7 |
"sourcesContent": [],
|
8 |
+
"mappings": "AAGA,AAAY,AAA0B;EACnC,AAAS;AAIZ,AAAa;EACX,AAAO;EACP,AAAa;AAGf,AAAa;EACX,AAAa;EACb,AAAO;EACP,AAAW",
|
9 |
"names": []
|
10 |
}
|
inc/class-shortcode-ui.php
CHANGED
@@ -7,10 +7,10 @@ class Shortcode_UI {
|
|
7 |
|
8 |
private $shortcodes = array();
|
9 |
|
10 |
-
private static $instance
|
11 |
|
12 |
public static function get_instance() {
|
13 |
-
if (
|
14 |
self::$instance = new self;
|
15 |
self::$instance->setup_actions();
|
16 |
}
|
@@ -27,25 +27,15 @@ class Shortcode_UI {
|
|
27 |
}
|
28 |
|
29 |
private function setup_actions() {
|
30 |
-
$this
|
31 |
-
add_action( 'wp_enqueue_editor',
|
32 |
-
add_action( 'wp_ajax_do_shortcode',
|
33 |
}
|
34 |
|
35 |
public function register_shortcode_ui( $shortcode_tag, $args = array() ) {
|
36 |
|
37 |
-
$defaults = array(
|
38 |
-
'label' => '',
|
39 |
-
'attrs' => array(),
|
40 |
-
'listItemImage' => '', // src or 'dashicons-' - used in insert list.
|
41 |
-
'inner_content' => false,
|
42 |
-
);
|
43 |
-
|
44 |
-
$args = wp_parse_args( $args, $defaults );
|
45 |
-
|
46 |
-
|
47 |
// inner_content=true is a valid argument, but we want more detail
|
48 |
-
if (
|
49 |
$args['inner_content'] = array(
|
50 |
'label' => esc_html__( 'Inner Content', 'shortcode-ui' ),
|
51 |
'description' => '',
|
@@ -53,33 +43,8 @@ class Shortcode_UI {
|
|
53 |
);
|
54 |
}
|
55 |
|
56 |
-
|
57 |
-
|
58 |
-
$num_attrs = count( $args['attrs'] );
|
59 |
-
for ( $i = 0; $i < $num_attrs; $i++ ) {
|
60 |
-
if ( ! isset( $args['attrs'][ $i ]['attr'] ) || $args['attrs'][ $i ]['attr'] !== 'content' ) {
|
61 |
-
continue;
|
62 |
-
}
|
63 |
-
|
64 |
-
$args['inner_content'] = array();
|
65 |
-
foreach ( $args['attrs'][ $i ] as $key => $value ) {
|
66 |
-
if ( $key == 'attr' ) {
|
67 |
-
continue;
|
68 |
-
}
|
69 |
-
$args['inner_content'][ $key ] = $value;
|
70 |
-
}
|
71 |
-
|
72 |
-
$index = $i;
|
73 |
-
}
|
74 |
-
if ( isset( $index ) ) {
|
75 |
-
array_splice( $args['attrs'], $index, 1 );
|
76 |
-
}
|
77 |
-
|
78 |
-
// strip invalid
|
79 |
-
foreach ( $args as $key => $value ) {
|
80 |
-
if ( ! array_key_exists( $key, $defaults ) ) {
|
81 |
-
unset( $args[ $key ] );
|
82 |
-
}
|
83 |
}
|
84 |
|
85 |
$args['shortcode_tag'] = $shortcode_tag;
|
@@ -99,7 +64,11 @@ class Shortcode_UI {
|
|
99 |
|
100 |
}
|
101 |
|
102 |
-
|
|
|
|
|
|
|
|
|
103 |
add_editor_style( $this->plugin_url . '/css/shortcode-ui-editor-styles.css' );
|
104 |
}
|
105 |
|
@@ -113,22 +82,37 @@ class Shortcode_UI {
|
|
113 |
wp_enqueue_media();
|
114 |
|
115 |
$shortcodes = array_values( $this->shortcodes );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
116 |
usort( $shortcodes, array( $this, 'compare_shortcodes_by_label' ) );
|
117 |
|
118 |
wp_enqueue_script( 'shortcode-ui', $this->plugin_url . 'js/build/shortcode-ui.js', array( 'jquery', 'backbone', 'mce-view' ), $this->plugin_version );
|
119 |
wp_enqueue_style( 'shortcode-ui', $this->plugin_url . 'css/shortcode-ui.css', array(), $this->plugin_version );
|
120 |
wp_localize_script( 'shortcode-ui', ' shortcodeUIData', array(
|
121 |
-
'shortcodes'
|
122 |
-
'strings'
|
123 |
-
'media_frame_title'
|
124 |
-
'media_frame_menu_insert_label'
|
125 |
-
'media_frame_menu_update_label'
|
126 |
-
'media_frame_toolbar_insert_label'
|
127 |
-
'media_frame_toolbar_update_label'
|
128 |
-
'
|
129 |
-
'
|
130 |
-
'
|
131 |
-
'
|
|
|
|
|
132 |
),
|
133 |
'nonces' => array(
|
134 |
'preview' => wp_create_nonce( 'shortcode-ui-preview' ),
|
@@ -158,9 +142,9 @@ class Shortcode_UI {
|
|
158 |
* @return null
|
159 |
*/
|
160 |
public function action_admin_print_footer_scripts() {
|
161 |
-
echo $this->get_view( 'media-frame' );
|
162 |
-
echo $this->get_view( 'list-item' );
|
163 |
-
echo $this->get_view( 'edit-form' );
|
164 |
|
165 |
do_action( 'print_shortcode_ui_templates' );
|
166 |
}
|
@@ -182,7 +166,6 @@ class Shortcode_UI {
|
|
182 |
if ( ! file_exists( $template ) ) {
|
183 |
return '';
|
184 |
}
|
185 |
-
|
186 |
}
|
187 |
|
188 |
ob_start();
|
@@ -211,8 +194,16 @@ class Shortcode_UI {
|
|
211 |
public function handle_ajax_do_shortcode() {
|
212 |
|
213 |
// Don't sanitize shortcodes — can contain HTML kses doesn't allow (e.g. sourcecode shortcode)
|
214 |
-
|
215 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
216 |
|
217 |
if ( ! current_user_can( 'edit_post', $post_id ) || ! wp_verify_nonce( $_POST['nonce'], 'shortcode-ui-preview' ) ) {
|
218 |
echo esc_html__( "Something's rotten in the state of Denmark", 'shortcode-ui' );
|
@@ -220,14 +211,16 @@ class Shortcode_UI {
|
|
220 |
}
|
221 |
|
222 |
if ( ! empty( $post_id ) ) {
|
|
|
223 |
global $post;
|
224 |
$post = get_post( $post_id );
|
225 |
setup_postdata( $post );
|
|
|
226 |
}
|
227 |
|
228 |
ob_start();
|
229 |
do_action( 'shortcode_ui_before_do_shortcode', $shortcode );
|
230 |
-
echo do_shortcode( $shortcode );
|
231 |
do_action( 'shortcode_ui_after_do_shortcode', $shortcode );
|
232 |
|
233 |
wp_send_json_success( ob_get_clean() );
|
7 |
|
8 |
private $shortcodes = array();
|
9 |
|
10 |
+
private static $instance;
|
11 |
|
12 |
public static function get_instance() {
|
13 |
+
if ( ! isset( self::$instance ) ) {
|
14 |
self::$instance = new self;
|
15 |
self::$instance->setup_actions();
|
16 |
}
|
27 |
}
|
28 |
|
29 |
private function setup_actions() {
|
30 |
+
add_action( 'admin_enqueue_scripts', array( $this, 'action_admin_enqueue_scripts' ) );
|
31 |
+
add_action( 'wp_enqueue_editor', array( $this, 'action_wp_enqueue_editor' ) );
|
32 |
+
add_action( 'wp_ajax_do_shortcode', array( $this, 'handle_ajax_do_shortcode' ) );
|
33 |
}
|
34 |
|
35 |
public function register_shortcode_ui( $shortcode_tag, $args = array() ) {
|
36 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
37 |
// inner_content=true is a valid argument, but we want more detail
|
38 |
+
if ( isset( $args['inner_content'] ) && true === $args['inner_content'] ) {
|
39 |
$args['inner_content'] = array(
|
40 |
'label' => esc_html__( 'Inner Content', 'shortcode-ui' ),
|
41 |
'description' => '',
|
43 |
);
|
44 |
}
|
45 |
|
46 |
+
if ( ! isset( $args['attrs'] ) ) {
|
47 |
+
$args['attrs'] = array();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
48 |
}
|
49 |
|
50 |
$args['shortcode_tag'] = $shortcode_tag;
|
64 |
|
65 |
}
|
66 |
|
67 |
+
/**
|
68 |
+
* Action admin scripts.
|
69 |
+
*/
|
70 |
+
public function action_admin_enqueue_scripts() {
|
71 |
+
// Editor styles needs to be added before wp_enqueue_editor
|
72 |
add_editor_style( $this->plugin_url . '/css/shortcode-ui-editor-styles.css' );
|
73 |
}
|
74 |
|
82 |
wp_enqueue_media();
|
83 |
|
84 |
$shortcodes = array_values( $this->shortcodes );
|
85 |
+
$screen = get_current_screen();
|
86 |
+
if ( $screen && ! empty( $screen->post_type ) ) {
|
87 |
+
foreach ( $shortcodes as $key => $args ) {
|
88 |
+
if ( ! empty( $args['post_type'] ) && ! in_array( $screen->post_type, $args['post_type'] ) ) {
|
89 |
+
unset( $shortcodes[ $key ] );
|
90 |
+
}
|
91 |
+
}
|
92 |
+
}
|
93 |
+
|
94 |
+
if ( empty( $shortcodes ) ) {
|
95 |
+
return;
|
96 |
+
}
|
97 |
+
|
98 |
usort( $shortcodes, array( $this, 'compare_shortcodes_by_label' ) );
|
99 |
|
100 |
wp_enqueue_script( 'shortcode-ui', $this->plugin_url . 'js/build/shortcode-ui.js', array( 'jquery', 'backbone', 'mce-view' ), $this->plugin_version );
|
101 |
wp_enqueue_style( 'shortcode-ui', $this->plugin_url . 'css/shortcode-ui.css', array(), $this->plugin_version );
|
102 |
wp_localize_script( 'shortcode-ui', ' shortcodeUIData', array(
|
103 |
+
'shortcodes' => $shortcodes,
|
104 |
+
'strings' => array(
|
105 |
+
'media_frame_title' => esc_html__( 'Insert Post Element', 'shortcode-ui' ),
|
106 |
+
'media_frame_menu_insert_label' => esc_html__( 'Insert Post Element', 'shortcode-ui' ),
|
107 |
+
'media_frame_menu_update_label' => esc_html__( '%s Details', 'shortcode-ui' ), // Substituted in JS
|
108 |
+
'media_frame_toolbar_insert_label' => esc_html__( 'Insert Element', 'shortcode-ui' ),
|
109 |
+
'media_frame_toolbar_update_label' => esc_html__( 'Update', 'shortcode-ui' ),
|
110 |
+
'media_frame_no_attributes_message' => esc_html__( 'There are no attributes to configure for this Post Element.', 'shortcode-ui' ),
|
111 |
+
'edit_tab_label' => esc_html__( 'Edit', 'shortcode-ui' ),
|
112 |
+
'preview_tab_label' => esc_html__( 'Preview', 'shortcode-ui' ),
|
113 |
+
'mce_view_error' => esc_html__( 'Failed to load preview', 'shortcode-ui' ),
|
114 |
+
'search_placeholder' => esc_html__( 'Search', 'shortcode-ui' ),
|
115 |
+
'insert_content_label' => esc_html__( 'Insert Content', 'shortcode-ui' ),
|
116 |
),
|
117 |
'nonces' => array(
|
118 |
'preview' => wp_create_nonce( 'shortcode-ui-preview' ),
|
142 |
* @return null
|
143 |
*/
|
144 |
public function action_admin_print_footer_scripts() {
|
145 |
+
echo $this->get_view( 'media-frame' ); // WPCS: xss ok
|
146 |
+
echo $this->get_view( 'list-item' ); // WPCS: xss ok
|
147 |
+
echo $this->get_view( 'edit-form' ); // WPCS: xss ok
|
148 |
|
149 |
do_action( 'print_shortcode_ui_templates' );
|
150 |
}
|
166 |
if ( ! file_exists( $template ) ) {
|
167 |
return '';
|
168 |
}
|
|
|
169 |
}
|
170 |
|
171 |
ob_start();
|
194 |
public function handle_ajax_do_shortcode() {
|
195 |
|
196 |
// Don't sanitize shortcodes — can contain HTML kses doesn't allow (e.g. sourcecode shortcode)
|
197 |
+
if ( ! empty( $_POST['shortcode'] ) ) {
|
198 |
+
$shortcode = stripslashes( $_POST['shortcode'] );
|
199 |
+
} else {
|
200 |
+
$shortcode = null;
|
201 |
+
}
|
202 |
+
if ( isset( $_POST['post_id'] ) ) {
|
203 |
+
$post_id = intval( $_POST['post_id'] );
|
204 |
+
} else {
|
205 |
+
$post_id = null;
|
206 |
+
}
|
207 |
|
208 |
if ( ! current_user_can( 'edit_post', $post_id ) || ! wp_verify_nonce( $_POST['nonce'], 'shortcode-ui-preview' ) ) {
|
209 |
echo esc_html__( "Something's rotten in the state of Denmark", 'shortcode-ui' );
|
211 |
}
|
212 |
|
213 |
if ( ! empty( $post_id ) ) {
|
214 |
+
// @codingStandardsIgnoreStart
|
215 |
global $post;
|
216 |
$post = get_post( $post_id );
|
217 |
setup_postdata( $post );
|
218 |
+
// @codingStandardsIgnoreStart
|
219 |
}
|
220 |
|
221 |
ob_start();
|
222 |
do_action( 'shortcode_ui_before_do_shortcode', $shortcode );
|
223 |
+
echo do_shortcode( $shortcode ); // WPCS: xss ok
|
224 |
do_action( 'shortcode_ui_after_do_shortcode', $shortcode );
|
225 |
|
226 |
wp_send_json_success( ob_get_clean() );
|
inc/fields/class-field-attachment.php
CHANGED
@@ -2,7 +2,7 @@
|
|
2 |
|
3 |
class Shortcake_Field_Attachment {
|
4 |
|
5 |
-
private static $instance
|
6 |
|
7 |
// All registered post fields.
|
8 |
private $post_fields = array();
|
@@ -16,7 +16,7 @@ class Shortcake_Field_Attachment {
|
|
16 |
);
|
17 |
|
18 |
public static function get_instance() {
|
19 |
-
if (
|
20 |
self::$instance = new self;
|
21 |
self::$instance->setup_actions();
|
22 |
}
|
@@ -26,7 +26,7 @@ class Shortcake_Field_Attachment {
|
|
26 |
private function setup_actions() {
|
27 |
|
28 |
add_filter( 'shortcode_ui_fields', array( $this, 'filter_shortcode_ui_fields' ) );
|
29 |
-
add_action( '
|
30 |
add_action( 'shortcode_ui_loaded_editor', array( $this, 'action_shortcode_ui_loaded_editor' ) );
|
31 |
|
32 |
}
|
@@ -35,13 +35,13 @@ class Shortcake_Field_Attachment {
|
|
35 |
return array_merge( $fields, $this->fields );
|
36 |
}
|
37 |
|
38 |
-
public function
|
39 |
|
40 |
-
$script = plugins_url( '
|
41 |
|
42 |
wp_enqueue_script( 'shortcake-field-attachment', $script, array( 'shortcode-ui' ) );
|
43 |
|
44 |
-
wp_localize_script( 'shortcake-field-attachment', '
|
45 |
'defaultArgs' => array(
|
46 |
'libraryType' => null, // array of mime types. eg image, image/jpg, application, application/pdf.
|
47 |
'addButton' => __( 'Select Attachment', 'shortcode-ui' ),
|
2 |
|
3 |
class Shortcake_Field_Attachment {
|
4 |
|
5 |
+
private static $instance;
|
6 |
|
7 |
// All registered post fields.
|
8 |
private $post_fields = array();
|
16 |
);
|
17 |
|
18 |
public static function get_instance() {
|
19 |
+
if ( ! isset( self::$instance ) ) {
|
20 |
self::$instance = new self;
|
21 |
self::$instance->setup_actions();
|
22 |
}
|
26 |
private function setup_actions() {
|
27 |
|
28 |
add_filter( 'shortcode_ui_fields', array( $this, 'filter_shortcode_ui_fields' ) );
|
29 |
+
add_action( 'enqueue_shortcode_ui', array( $this, 'action_enqueue_shortcode_ui' ) );
|
30 |
add_action( 'shortcode_ui_loaded_editor', array( $this, 'action_shortcode_ui_loaded_editor' ) );
|
31 |
|
32 |
}
|
35 |
return array_merge( $fields, $this->fields );
|
36 |
}
|
37 |
|
38 |
+
public function action_enqueue_shortcode_ui() {
|
39 |
|
40 |
+
$script = plugins_url( 'js/build/field-attachment.js', dirname( dirname( __FILE__ ) ) );
|
41 |
|
42 |
wp_enqueue_script( 'shortcake-field-attachment', $script, array( 'shortcode-ui' ) );
|
43 |
|
44 |
+
wp_localize_script( 'shortcake-field-attachment', 'ShortcakeImageFieldData', array(
|
45 |
'defaultArgs' => array(
|
46 |
'libraryType' => null, // array of mime types. eg image, image/jpg, application, application/pdf.
|
47 |
'addButton' => __( 'Select Attachment', 'shortcode-ui' ),
|
inc/fields/class-field-color.php
CHANGED
@@ -2,7 +2,7 @@
|
|
2 |
|
3 |
class Shortcake_Field_Color {
|
4 |
|
5 |
-
private static $instance
|
6 |
|
7 |
// All registered post fields.
|
8 |
private $post_fields = array();
|
@@ -16,7 +16,7 @@ class Shortcake_Field_Color {
|
|
16 |
);
|
17 |
|
18 |
public static function get_instance() {
|
19 |
-
if (
|
20 |
self::$instance = new self;
|
21 |
self::$instance->setup_actions();
|
22 |
}
|
@@ -33,7 +33,8 @@ class Shortcake_Field_Color {
|
|
33 |
|
34 |
private function color_attribute_present() {
|
35 |
|
36 |
-
foreach( Shortcode_UI::get_instance()->get_shortcodes() as $shortcode ) {
|
|
|
37 |
if ( empty( $shortcode['attrs'] ) ) {
|
38 |
continue;
|
39 |
}
|
@@ -43,7 +44,7 @@ class Shortcake_Field_Color {
|
|
43 |
continue;
|
44 |
}
|
45 |
|
46 |
-
if ( $attribute['type']
|
47 |
return true;
|
48 |
}
|
49 |
}
|
@@ -63,7 +64,7 @@ class Shortcake_Field_Color {
|
|
63 |
return;
|
64 |
}
|
65 |
|
66 |
-
$script = plugins_url( '
|
67 |
|
68 |
wp_enqueue_script( 'shortcake-field-color', $script, array( 'shortcode-ui' ) );
|
69 |
|
2 |
|
3 |
class Shortcake_Field_Color {
|
4 |
|
5 |
+
private static $instance;
|
6 |
|
7 |
// All registered post fields.
|
8 |
private $post_fields = array();
|
16 |
);
|
17 |
|
18 |
public static function get_instance() {
|
19 |
+
if ( ! isset( self::$instance ) ) {
|
20 |
self::$instance = new self;
|
21 |
self::$instance->setup_actions();
|
22 |
}
|
33 |
|
34 |
private function color_attribute_present() {
|
35 |
|
36 |
+
foreach ( Shortcode_UI::get_instance()->get_shortcodes() as $shortcode ) {
|
37 |
+
|
38 |
if ( empty( $shortcode['attrs'] ) ) {
|
39 |
continue;
|
40 |
}
|
44 |
continue;
|
45 |
}
|
46 |
|
47 |
+
if ( 'color' === $attribute['type'] ) {
|
48 |
return true;
|
49 |
}
|
50 |
}
|
64 |
return;
|
65 |
}
|
66 |
|
67 |
+
$script = plugins_url( 'js/build/field-color.js', dirname( dirname( __FILE__ ) ) );
|
68 |
|
69 |
wp_enqueue_script( 'shortcake-field-color', $script, array( 'shortcode-ui' ) );
|
70 |
|
inc/fields/class-field-post-select.php
ADDED
@@ -0,0 +1,166 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
|
3 |
+
class Shortcode_UI_Field_Post_Select {
|
4 |
+
|
5 |
+
private static $instance;
|
6 |
+
|
7 |
+
// All registered post fields.
|
8 |
+
private $post_fields = array();
|
9 |
+
|
10 |
+
// Field Settings.
|
11 |
+
private $fields = array(
|
12 |
+
'post_select' => array(
|
13 |
+
'template' => 'shortcode-ui-field-post-select',
|
14 |
+
'view' => 'editAttributeFieldPostSelect',
|
15 |
+
),
|
16 |
+
);
|
17 |
+
|
18 |
+
public static function get_instance() {
|
19 |
+
if ( ! isset( self::$instance ) ) {
|
20 |
+
self::$instance = new self;
|
21 |
+
self::$instance->setup_actions();
|
22 |
+
}
|
23 |
+
return self::$instance;
|
24 |
+
}
|
25 |
+
|
26 |
+
private function setup_actions() {
|
27 |
+
|
28 |
+
add_filter( 'shortcode_ui_fields', array( $this, 'filter_shortcode_ui_fields' ) );
|
29 |
+
add_action( 'enqueue_shortcode_ui', array( $this, 'action_enqueue_shortcode_ui' ) );
|
30 |
+
add_action( 'wp_ajax_shortcode_ui_post_field', array( $this, 'action_wp_ajax_shortcode_ui_post_field' ) );
|
31 |
+
add_action( 'shortcode_ui_loaded_editor', array( $this, 'action_shortcode_ui_loaded_editor' ) );
|
32 |
+
|
33 |
+
}
|
34 |
+
|
35 |
+
public function filter_shortcode_ui_fields( $fields ) {
|
36 |
+
return array_merge( $fields, $this->fields );
|
37 |
+
}
|
38 |
+
|
39 |
+
public function action_enqueue_shortcode_ui() {
|
40 |
+
|
41 |
+
$plugin_dir = dirname( dirname( __FILE__ ) );
|
42 |
+
|
43 |
+
wp_enqueue_script(
|
44 |
+
'shortcode-ui-field-post-select',
|
45 |
+
plugins_url( 'js/build/field-post-select.js', $plugin_dir ),
|
46 |
+
array( 'shortcode-ui', 'select2' )
|
47 |
+
);
|
48 |
+
|
49 |
+
wp_enqueue_script( 'select2', plugins_url( 'lib/select2/select2.min.js', $plugin_dir ) , array( 'jquery', 'jquery-ui-sortable' ), '3.5.2' );
|
50 |
+
wp_enqueue_style( 'select2', plugins_url( 'lib/select2/select2.css', $plugin_dir ), null, '3.5.2' );
|
51 |
+
|
52 |
+
wp_localize_script( 'shortcode-ui-field-post-select', 'shortcodeUiPostFieldData', array(
|
53 |
+
'nonce' => wp_create_nonce( 'shortcode_ui_field_post_select' ),
|
54 |
+
) );
|
55 |
+
|
56 |
+
}
|
57 |
+
|
58 |
+
/**
|
59 |
+
* Output styles and templates used by post select field.
|
60 |
+
*/
|
61 |
+
// public function action_print_media_templates() {
|
62 |
+
public function action_shortcode_ui_loaded_editor() {
|
63 |
+
|
64 |
+
?>
|
65 |
+
|
66 |
+
<style>
|
67 |
+
|
68 |
+
.edit-shortcode-form .select2-container {
|
69 |
+
min-width: 300px;
|
70 |
+
}
|
71 |
+
|
72 |
+
.edit-shortcode-form .select2-container a {
|
73 |
+
transition: none;
|
74 |
+
-webkit-transition: none;
|
75 |
+
}
|
76 |
+
|
77 |
+
.wp-admin .select2-drop {
|
78 |
+
z-index: 160001;
|
79 |
+
}
|
80 |
+
|
81 |
+
</style>
|
82 |
+
|
83 |
+
<script type="text/html" id="tmpl-shortcode-ui-field-post-select">
|
84 |
+
<div class="field-block">
|
85 |
+
<label for="{{ data.id }}">{{ data.label }}</label>
|
86 |
+
<input type="text" name="{{ data.attr }}" id="{{ data.id }}" value="{{ data.value }}" class="shortcode-ui-post-select" />
|
87 |
+
</div>
|
88 |
+
</script>
|
89 |
+
|
90 |
+
<?php
|
91 |
+
}
|
92 |
+
|
93 |
+
/**
|
94 |
+
* Ajax handler for select2 post field queries.
|
95 |
+
* Output JSON containing post data.
|
96 |
+
* Requires that shortcode, attr and nonce are passed.
|
97 |
+
* Requires that the field has been correctly registred and can be found in $this->post_fields
|
98 |
+
* Supports passing page number and search query string.
|
99 |
+
*
|
100 |
+
* @return null
|
101 |
+
*/
|
102 |
+
public function action_wp_ajax_shortcode_ui_post_field() {
|
103 |
+
|
104 |
+
$nonce = isset( $_GET['nonce'] ) ? sanitize_text_field( $_GET['nonce'] ) : null;
|
105 |
+
$requested_shortcode = isset( $_GET['shortcode'] ) ? sanitize_text_field( $_GET['shortcode'] ) : null;
|
106 |
+
$requested_attr = isset( $_GET['attr'] ) ? sanitize_text_field( $_GET['attr'] ) : null;
|
107 |
+
$response = array( 'posts' => array(), 'found_posts' => 0, 'posts_per_page' => 0 );
|
108 |
+
|
109 |
+
$shortcodes = Shortcode_UI::get_instance()->get_shortcodes();
|
110 |
+
|
111 |
+
if ( ! wp_verify_nonce( $nonce, 'shortcode_ui_field_post_select' ) ) {
|
112 |
+
wp_send_json_error( $response );
|
113 |
+
}
|
114 |
+
|
115 |
+
// Shortcode not found.
|
116 |
+
if ( ! isset( $shortcodes[ $requested_shortcode ] ) ) {
|
117 |
+
wp_send_json_error( $response );
|
118 |
+
die;
|
119 |
+
}
|
120 |
+
|
121 |
+
$shortcode = $shortcodes[ $requested_shortcode ];
|
122 |
+
|
123 |
+
foreach ( $shortcode['attrs'] as $attr ) {
|
124 |
+
if ( $attr['attr'] === $requested_attr && isset( $attr['query'] ) ) {
|
125 |
+
$query_args = $attr['query'];
|
126 |
+
}
|
127 |
+
}
|
128 |
+
|
129 |
+
// Query not found.
|
130 |
+
if ( empty( $query_args ) ) {
|
131 |
+
wp_send_json_error( $response );
|
132 |
+
die;
|
133 |
+
}
|
134 |
+
|
135 |
+
// Hardcoded query args.
|
136 |
+
$query_args['fields'] = 'ids';
|
137 |
+
$query_args['perm'] = 'readable';
|
138 |
+
|
139 |
+
if ( isset( $_GET['page'] ) ) {
|
140 |
+
$query_args['paged'] = sanitize_text_field( $_GET['page'] );
|
141 |
+
}
|
142 |
+
|
143 |
+
if ( ! empty( $_GET['s'] ) ) {
|
144 |
+
$query_args['s'] = sanitize_text_field( $_GET['s'] );
|
145 |
+
}
|
146 |
+
|
147 |
+
if ( ! empty( $_GET['post__in'] ) ) {
|
148 |
+
$post__in = is_array( $_GET['post__in'] ) ? $_GET['post__in'] : explode( ',', $_GET['post__in'] );
|
149 |
+
$query_args['post__in'] = array_map( 'intval', $post__in );
|
150 |
+
$query_args['orderby'] = 'post__in';
|
151 |
+
}
|
152 |
+
|
153 |
+
$query = new WP_Query( $query_args );
|
154 |
+
|
155 |
+
foreach ( $query->posts as $post_id ) {
|
156 |
+
array_push( $response['posts'], array( 'id' => $post_id, 'text' => html_entity_decode( get_the_title( $post_id ) ) ) );
|
157 |
+
}
|
158 |
+
|
159 |
+
$response['found_posts'] = $query->found_posts;
|
160 |
+
$response['posts_per_page'] = $query->query_vars['posts_per_page'];
|
161 |
+
|
162 |
+
wp_send_json_success( $response );
|
163 |
+
|
164 |
+
}
|
165 |
+
|
166 |
+
}
|
inc/fields/class-shortcode-ui-fields.php
CHANGED
@@ -2,7 +2,7 @@
|
|
2 |
|
3 |
class Shortcode_UI_Fields {
|
4 |
|
5 |
-
private static $instance
|
6 |
|
7 |
// Default Field Settings.
|
8 |
private $field_defaults = array(
|
@@ -40,7 +40,7 @@ class Shortcode_UI_Fields {
|
|
40 |
);
|
41 |
|
42 |
public static function get_instance() {
|
43 |
-
if (
|
44 |
self::$instance = new self;
|
45 |
self::$instance->setup_actions();
|
46 |
}
|
@@ -72,6 +72,15 @@ class Shortcode_UI_Fields {
|
|
72 |
|
73 |
}
|
74 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
75 |
public function action_enqueue_shortcode_ui() {
|
76 |
|
77 |
wp_localize_script( 'shortcode-ui', 'shortcodeUIFieldData', $this->fields );
|
2 |
|
3 |
class Shortcode_UI_Fields {
|
4 |
|
5 |
+
private static $instance;
|
6 |
|
7 |
// Default Field Settings.
|
8 |
private $field_defaults = array(
|
40 |
);
|
41 |
|
42 |
public static function get_instance() {
|
43 |
+
if ( ! isset( self::$instance ) ) {
|
44 |
self::$instance = new self;
|
45 |
self::$instance->setup_actions();
|
46 |
}
|
72 |
|
73 |
}
|
74 |
|
75 |
+
/**
|
76 |
+
* Get all registered fields
|
77 |
+
*
|
78 |
+
* @return array
|
79 |
+
*/
|
80 |
+
public function get_fields() {
|
81 |
+
return $this->fields;
|
82 |
+
}
|
83 |
+
|
84 |
public function action_enqueue_shortcode_ui() {
|
85 |
|
86 |
wp_localize_script( 'shortcode-ui', 'shortcodeUIFieldData', $this->fields );
|
inc/templates/edit-form.tpl.php
CHANGED
@@ -17,8 +17,8 @@
|
|
17 |
|
18 |
<script type="text/html" id="tmpl-shortcode-ui-field-text">
|
19 |
<div class="field-block">
|
20 |
-
<label for="{{ data.
|
21 |
-
<input type="text" name="{{ data.attr }}" id="{{ data.
|
22 |
<# if ( typeof data.description == 'string' ) { #>
|
23 |
<p class="description">{{ data.description }}</p>
|
24 |
<# } #>
|
@@ -27,8 +27,8 @@
|
|
27 |
|
28 |
<script type="text/html" id="tmpl-shortcode-ui-field-url">
|
29 |
<div class="field-block">
|
30 |
-
<label for="{{ data.
|
31 |
-
<input type="url" name="{{ data.attr }}" id="{{ data.
|
32 |
<# if ( typeof data.description == 'string' ) { #>
|
33 |
<p class="description">{{ data.description }}</p>
|
34 |
<# } #>
|
@@ -37,8 +37,8 @@
|
|
37 |
|
38 |
<script type="text/html" id="tmpl-shortcode-ui-field-textarea">
|
39 |
<div class="field-block">
|
40 |
-
<label for="{{ data.
|
41 |
-
<textarea name="{{ data.attr }}" id="{{ data.
|
42 |
<# if ( typeof data.description == 'string' ) { #>
|
43 |
<p class="description">{{ data.description }}</p>
|
44 |
<# } #>
|
@@ -47,8 +47,8 @@
|
|
47 |
|
48 |
<script type="text/html" id="tmpl-shortcode-ui-field-select">
|
49 |
<div class="field-block">
|
50 |
-
<label for="{{ data.
|
51 |
-
<select name="{{ data.attr }}" id="{{ data.
|
52 |
<# _.each( data.options, function( label, value ) { #>
|
53 |
<option value="{{ value }}" <# if ( value == data.value ){ print('selected'); } #>>{{ label }}</option>
|
54 |
<# }); #>
|
@@ -61,9 +61,12 @@
|
|
61 |
|
62 |
<script type="text/html" id="tmpl-shortcode-ui-field-radio">
|
63 |
<div class="field-block">
|
64 |
-
<label
|
65 |
<# _.each( data.options, function( label, value ) { #>
|
66 |
-
<
|
|
|
|
|
|
|
67 |
<# }); #>
|
68 |
<# if ( typeof data.description == 'string' ) { #>
|
69 |
<p class="description">{{ data.description }}</p>
|
@@ -73,8 +76,8 @@
|
|
73 |
|
74 |
<script type="text/html" id="tmpl-shortcode-ui-field-checkbox">
|
75 |
<div class="field-block">
|
76 |
-
<label for="{{ data.
|
77 |
-
<input type="checkbox" name="{{ data.attr }}" id="{{ data.
|
78 |
{{ data.label }}
|
79 |
</label>
|
80 |
<# if ( typeof data.description == 'string' ) { #>
|
@@ -85,8 +88,8 @@
|
|
85 |
|
86 |
<script type="text/html" id="tmpl-shortcode-ui-field-email">
|
87 |
<div class="field-block">
|
88 |
-
<label for="{{ data.
|
89 |
-
<input type="email" name="{{ data.attr }}" id="{{ data.
|
90 |
<# if ( typeof data.description == 'string' ) { #>
|
91 |
<p class="description">{{ data.description }}</p>
|
92 |
<# } #>
|
@@ -95,8 +98,8 @@
|
|
95 |
|
96 |
<script type="text/html" id="tmpl-shortcode-ui-field-number">
|
97 |
<div class="field-block">
|
98 |
-
<label for="{{ data.
|
99 |
-
<input type="number" name="{{ data.attr }}" id="{{ data.
|
100 |
<# if ( typeof data.description == 'string' ) { #>
|
101 |
<p class="description">{{ data.description }}</p>
|
102 |
<# } #>
|
@@ -105,8 +108,8 @@
|
|
105 |
|
106 |
<script type="text/html" id="tmpl-shortcode-ui-field-hidden">
|
107 |
<div class="field-block">
|
108 |
-
<label for="{{ data.
|
109 |
-
<input type="hidden" name="{{ data.attr }}" id="{{ data.
|
110 |
<# if ( typeof data.description == 'string' ) { #>
|
111 |
<p class="description">{{ data.description }}</p>
|
112 |
<# } #>
|
@@ -115,8 +118,8 @@
|
|
115 |
|
116 |
<script type="text/html" id="tmpl-shortcode-ui-field-date">
|
117 |
<div class="field-block">
|
118 |
-
<label for="{{ data.
|
119 |
-
<input type="date" name="{{ data.attr }}" id="{{ data.
|
120 |
<# if ( typeof data.description == 'string' ) { #>
|
121 |
<p class="description">{{ data.description }}</p>
|
122 |
<# } #>
|
@@ -126,7 +129,7 @@
|
|
126 |
<script type="text/html" id="tmpl-shortcode-ui-content">
|
127 |
<div class="field-block">
|
128 |
<label for="inner_content">{{ data.label }}</label>
|
129 |
-
<textarea id="inner_content" name="inner_content" class="content-edit">{{ data.value }}</textarea>
|
130 |
<# if ( typeof data.description == 'string' ) { #>
|
131 |
<p class="description">{{ data.description }}</p>
|
132 |
<# } #>
|
17 |
|
18 |
<script type="text/html" id="tmpl-shortcode-ui-field-text">
|
19 |
<div class="field-block">
|
20 |
+
<label for="{{ data.id }}">{{ data.label }}</label>
|
21 |
+
<input type="text" name="{{ data.attr }}" id="{{ data.id }}" value="{{ data.value }}" {{{ data.meta }}}/>
|
22 |
<# if ( typeof data.description == 'string' ) { #>
|
23 |
<p class="description">{{ data.description }}</p>
|
24 |
<# } #>
|
27 |
|
28 |
<script type="text/html" id="tmpl-shortcode-ui-field-url">
|
29 |
<div class="field-block">
|
30 |
+
<label for="{{ data.id }}">{{ data.label }}</label>
|
31 |
+
<input type="url" name="{{ data.attr }}" id="{{ data.id }}" value="{{ data.value }}" class="code" {{{ data.meta }}}/>
|
32 |
<# if ( typeof data.description == 'string' ) { #>
|
33 |
<p class="description">{{ data.description }}</p>
|
34 |
<# } #>
|
37 |
|
38 |
<script type="text/html" id="tmpl-shortcode-ui-field-textarea">
|
39 |
<div class="field-block">
|
40 |
+
<label for="{{ data.id }}">{{ data.label }}</label>
|
41 |
+
<textarea name="{{ data.attr }}" id="{{ data.id }}" {{{ data.meta }}}>{{ data.value }}</textarea>
|
42 |
<# if ( typeof data.description == 'string' ) { #>
|
43 |
<p class="description">{{ data.description }}</p>
|
44 |
<# } #>
|
47 |
|
48 |
<script type="text/html" id="tmpl-shortcode-ui-field-select">
|
49 |
<div class="field-block">
|
50 |
+
<label for="{{ data.id }}">{{ data.label }}</label>
|
51 |
+
<select name="{{ data.attr }}" id="{{ data.id }}" {{{ data.meta }}}>
|
52 |
<# _.each( data.options, function( label, value ) { #>
|
53 |
<option value="{{ value }}" <# if ( value == data.value ){ print('selected'); } #>>{{ label }}</option>
|
54 |
<# }); #>
|
61 |
|
62 |
<script type="text/html" id="tmpl-shortcode-ui-field-radio">
|
63 |
<div class="field-block">
|
64 |
+
<label>{{ data.label }}</label>
|
65 |
<# _.each( data.options, function( label, value ) { #>
|
66 |
+
<label>
|
67 |
+
<input type="radio" name="{{ data.attr }}" value="{{ value }}" <# if ( value == data.value ) { print('checked'); } #> />
|
68 |
+
{{ label }}
|
69 |
+
</label>
|
70 |
<# }); #>
|
71 |
<# if ( typeof data.description == 'string' ) { #>
|
72 |
<p class="description">{{ data.description }}</p>
|
76 |
|
77 |
<script type="text/html" id="tmpl-shortcode-ui-field-checkbox">
|
78 |
<div class="field-block">
|
79 |
+
<label for="{{ data.id }}">
|
80 |
+
<input type="checkbox" name="{{ data.attr }}" id="{{ data.id }}" value="{{ data.value }}" <# if ( 'true' == data.value ){ print('checked'); } #>>
|
81 |
{{ data.label }}
|
82 |
</label>
|
83 |
<# if ( typeof data.description == 'string' ) { #>
|
88 |
|
89 |
<script type="text/html" id="tmpl-shortcode-ui-field-email">
|
90 |
<div class="field-block">
|
91 |
+
<label for="{{ data.id }}">{{ data.label }}</label>
|
92 |
+
<input type="email" name="{{ data.attr }}" id="{{ data.id }}" value="{{ data.value}}" {{{ data.meta }}}/>
|
93 |
<# if ( typeof data.description == 'string' ) { #>
|
94 |
<p class="description">{{ data.description }}</p>
|
95 |
<# } #>
|
98 |
|
99 |
<script type="text/html" id="tmpl-shortcode-ui-field-number">
|
100 |
<div class="field-block">
|
101 |
+
<label for="{{ data.id }}">{{ data.label }}</label>
|
102 |
+
<input type="number" name="{{ data.attr }}" id="{{ data.id }}" value="{{ data.value}}" {{{ data.meta }}}/>
|
103 |
<# if ( typeof data.description == 'string' ) { #>
|
104 |
<p class="description">{{ data.description }}</p>
|
105 |
<# } #>
|
108 |
|
109 |
<script type="text/html" id="tmpl-shortcode-ui-field-hidden">
|
110 |
<div class="field-block">
|
111 |
+
<label for="{{ data.id }}">{{ data.label }}</label>
|
112 |
+
<input type="hidden" name="{{ data.attr }}" id="{{ data.id }}" value="true" {{{ data.meta }}}/>
|
113 |
<# if ( typeof data.description == 'string' ) { #>
|
114 |
<p class="description">{{ data.description }}</p>
|
115 |
<# } #>
|
118 |
|
119 |
<script type="text/html" id="tmpl-shortcode-ui-field-date">
|
120 |
<div class="field-block">
|
121 |
+
<label for="{{ data.id }}">{{ data.label }}</label>
|
122 |
+
<input type="date" name="{{ data.attr }}" id="{{ data.id }}" value="{{ data.value }}" {{{ data.meta }}}/>
|
123 |
<# if ( typeof data.description == 'string' ) { #>
|
124 |
<p class="description">{{ data.description }}</p>
|
125 |
<# } #>
|
129 |
<script type="text/html" id="tmpl-shortcode-ui-content">
|
130 |
<div class="field-block">
|
131 |
<label for="inner_content">{{ data.label }}</label>
|
132 |
+
<textarea id="inner_content" name="inner_content" class="content-edit" {{{ data.meta }}}>{{ data.value }}</textarea>
|
133 |
<# if ( typeof data.description == 'string' ) { #>
|
134 |
<p class="description">{{ data.description }}</p>
|
135 |
<# } #>
|
js/build/field-attachment.js
CHANGED
@@ -36,7 +36,7 @@ module.exports = Shortcodes;
|
|
36 |
(function (global){
|
37 |
var sui = require('./utils/sui.js'),
|
38 |
editAttributeField = require('./views/edit-attribute-field.js'),
|
39 |
-
|
40 |
|
41 |
// Cache attachment IDs for quicker loading.
|
42 |
var iDCache = {};
|
@@ -48,9 +48,9 @@ sui.views.editAttributeFieldAttachment = editAttributeField.extend( {
|
|
48 |
var model = this.model;
|
49 |
|
50 |
// Set model default values.
|
51 |
-
for ( var arg in
|
52 |
if ( ! model.get( arg ) ) {
|
53 |
-
model.set( arg,
|
54 |
}
|
55 |
}
|
56 |
|
@@ -108,23 +108,23 @@ sui.views.editAttributeFieldAttachment = editAttributeField.extend( {
|
|
108 |
*/
|
109 |
var renderPreview = function( attachment ) {
|
110 |
|
111 |
-
var $thumbnail =
|
112 |
|
113 |
if ( 'image' !== attachment.type ) {
|
114 |
|
115 |
-
|
116 |
src: attachment.icon,
|
117 |
alt: attachment.title,
|
118 |
} ).appendTo( $thumbnail );
|
119 |
|
120 |
-
|
121 |
class: 'filename',
|
122 |
html: '<div>' + attachment.title + '</div>',
|
123 |
} ).appendTo( $thumbnail );
|
124 |
|
125 |
} else {
|
126 |
|
127 |
-
|
128 |
src: attachment.sizes.thumbnail.url,
|
129 |
width: attachment.sizes.thumbnail.width,
|
130 |
height: attachment.sizes.thumbnail.height,
|
@@ -192,7 +192,12 @@ var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global
|
|
192 |
* Shortcode Attribute Model.
|
193 |
*/
|
194 |
var InnerContent = Backbone.Model.extend({
|
195 |
-
defaults :
|
|
|
|
|
|
|
|
|
|
|
196 |
});
|
197 |
|
198 |
module.exports = InnerContent;
|
@@ -208,7 +213,10 @@ var ShortcodeAttribute = Backbone.Model.extend({
|
|
208 |
label: '',
|
209 |
type: '',
|
210 |
value: '',
|
211 |
-
|
|
|
|
|
|
|
212 |
},
|
213 |
});
|
214 |
|
@@ -227,7 +235,6 @@ Shortcode = Backbone.Model.extend({
|
|
227 |
label: '',
|
228 |
shortcode_tag: '',
|
229 |
attrs: new ShortcodeAttributes,
|
230 |
-
inner_content: new InnerContent,
|
231 |
},
|
232 |
|
233 |
/**
|
@@ -240,7 +247,7 @@ Shortcode = Backbone.Model.extend({
|
|
240 |
attributes.attrs = new ShortcodeAttributes( attributes.attrs );
|
241 |
}
|
242 |
|
243 |
-
if ( attributes.inner_content
|
244 |
attributes.inner_content = new InnerContent( attributes.inner_content );
|
245 |
}
|
246 |
|
@@ -253,10 +260,10 @@ Shortcode = Backbone.Model.extend({
|
|
253 |
*/
|
254 |
toJSON: function( options ) {
|
255 |
options = Backbone.Model.prototype.toJSON.call(this, options);
|
256 |
-
if ( options.attrs
|
257 |
options.attrs = options.attrs.toJSON();
|
258 |
}
|
259 |
-
if ( options.inner_content
|
260 |
options.inner_content = options.inner_content.toJSON();
|
261 |
}
|
262 |
return options;
|
@@ -269,7 +276,9 @@ Shortcode = Backbone.Model.extend({
|
|
269 |
clone: function() {
|
270 |
var clone = Backbone.Model.prototype.clone.call( this );
|
271 |
clone.set( 'attrs', clone.get( 'attrs' ).clone() );
|
272 |
-
|
|
|
|
|
273 |
return clone;
|
274 |
},
|
275 |
|
@@ -293,7 +302,7 @@ Shortcode = Backbone.Model.extend({
|
|
293 |
|
294 |
} );
|
295 |
|
296 |
-
if (
|
297 |
content = this.get( 'inner_content' ).get( 'value' );
|
298 |
}
|
299 |
|
@@ -329,8 +338,9 @@ module.exports = window.Shortcode_UI;
|
|
329 |
|
330 |
},{"./../collections/shortcodes.js":2}],8:[function(require,module,exports){
|
331 |
(function (global){
|
332 |
-
var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null)
|
333 |
-
sui = require('./../utils/sui.js')
|
|
|
334 |
|
335 |
var editAttributeField = Backbone.View.extend( {
|
336 |
|
@@ -349,7 +359,42 @@ var editAttributeField = Backbone.View.extend( {
|
|
349 |
},
|
350 |
|
351 |
render: function() {
|
352 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
353 |
return this
|
354 |
},
|
355 |
|
@@ -362,9 +407,9 @@ var editAttributeField = Backbone.View.extend( {
|
|
362 |
updateValue: function( e ) {
|
363 |
|
364 |
if ( this.model.get( 'attr' ) ) {
|
365 |
-
var $el =
|
366 |
} else {
|
367 |
-
var $el =
|
368 |
}
|
369 |
|
370 |
if ( 'radio' === this.model.attributes.type ) {
|
36 |
(function (global){
|
37 |
var sui = require('./utils/sui.js'),
|
38 |
editAttributeField = require('./views/edit-attribute-field.js'),
|
39 |
+
$ = (typeof window !== "undefined" ? window.jQuery : typeof global !== "undefined" ? global.jQuery : null);
|
40 |
|
41 |
// Cache attachment IDs for quicker loading.
|
42 |
var iDCache = {};
|
48 |
var model = this.model;
|
49 |
|
50 |
// Set model default values.
|
51 |
+
for ( var arg in ShortcakeImageFieldData.defaultArgs ) {
|
52 |
if ( ! model.get( arg ) ) {
|
53 |
+
model.set( arg, ShortcakeImageFieldData.defaultArgs[ arg ] );
|
54 |
}
|
55 |
}
|
56 |
|
108 |
*/
|
109 |
var renderPreview = function( attachment ) {
|
110 |
|
111 |
+
var $thumbnail = $('<div class="thumbnail"></div>');
|
112 |
|
113 |
if ( 'image' !== attachment.type ) {
|
114 |
|
115 |
+
$( '<img/>', {
|
116 |
src: attachment.icon,
|
117 |
alt: attachment.title,
|
118 |
} ).appendTo( $thumbnail );
|
119 |
|
120 |
+
$( '<div/>', {
|
121 |
class: 'filename',
|
122 |
html: '<div>' + attachment.title + '</div>',
|
123 |
} ).appendTo( $thumbnail );
|
124 |
|
125 |
} else {
|
126 |
|
127 |
+
$( '<img/>', {
|
128 |
src: attachment.sizes.thumbnail.url,
|
129 |
width: attachment.sizes.thumbnail.width,
|
130 |
height: attachment.sizes.thumbnail.height,
|
192 |
* Shortcode Attribute Model.
|
193 |
*/
|
194 |
var InnerContent = Backbone.Model.extend({
|
195 |
+
defaults : {
|
196 |
+
label: shortcodeUIData.strings.insert_content_label,
|
197 |
+
type: 'textarea',
|
198 |
+
value: '',
|
199 |
+
placeholder: '',
|
200 |
+
},
|
201 |
});
|
202 |
|
203 |
module.exports = InnerContent;
|
213 |
label: '',
|
214 |
type: '',
|
215 |
value: '',
|
216 |
+
description: '',
|
217 |
+
meta: {
|
218 |
+
placeholder: '',
|
219 |
+
}
|
220 |
},
|
221 |
});
|
222 |
|
235 |
label: '',
|
236 |
shortcode_tag: '',
|
237 |
attrs: new ShortcodeAttributes,
|
|
|
238 |
},
|
239 |
|
240 |
/**
|
247 |
attributes.attrs = new ShortcodeAttributes( attributes.attrs );
|
248 |
}
|
249 |
|
250 |
+
if ( attributes.inner_content && ! ( attributes.inner_content instanceof InnerContent ) ) {
|
251 |
attributes.inner_content = new InnerContent( attributes.inner_content );
|
252 |
}
|
253 |
|
260 |
*/
|
261 |
toJSON: function( options ) {
|
262 |
options = Backbone.Model.prototype.toJSON.call(this, options);
|
263 |
+
if ( options.attrs && ( options.attrs instanceof ShortcodeAttributes ) ) {
|
264 |
options.attrs = options.attrs.toJSON();
|
265 |
}
|
266 |
+
if ( options.inner_content && ( options.inner_content instanceof InnerContent ) ) {
|
267 |
options.inner_content = options.inner_content.toJSON();
|
268 |
}
|
269 |
return options;
|
276 |
clone: function() {
|
277 |
var clone = Backbone.Model.prototype.clone.call( this );
|
278 |
clone.set( 'attrs', clone.get( 'attrs' ).clone() );
|
279 |
+
if ( clone.get( 'inner_content' ) ) {
|
280 |
+
clone.set( 'inner_content', clone.get( 'inner_content' ).clone() );
|
281 |
+
}
|
282 |
return clone;
|
283 |
},
|
284 |
|
302 |
|
303 |
} );
|
304 |
|
305 |
+
if ( this.get( 'inner_content' ) ) {
|
306 |
content = this.get( 'inner_content' ).get( 'value' );
|
307 |
}
|
308 |
|
338 |
|
339 |
},{"./../collections/shortcodes.js":2}],8:[function(require,module,exports){
|
340 |
(function (global){
|
341 |
+
var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null),
|
342 |
+
sui = require('./../utils/sui.js'),
|
343 |
+
$ = (typeof window !== "undefined" ? window.jQuery : typeof global !== "undefined" ? global.jQuery : null);
|
344 |
|
345 |
var editAttributeField = Backbone.View.extend( {
|
346 |
|
359 |
},
|
360 |
|
361 |
render: function() {
|
362 |
+
|
363 |
+
var data = jQuery.extend( {
|
364 |
+
id: 'shortcode-ui-' + this.model.get( 'attr' ) + '-' + this.model.cid,
|
365 |
+
}, this.model.toJSON() );
|
366 |
+
|
367 |
+
// Handle legacy custom meta.
|
368 |
+
// Can be removed in 0.4.
|
369 |
+
if ( data.placeholder ) {
|
370 |
+
data.meta.placeholder = data.placeholder;
|
371 |
+
delete data.placeholder;
|
372 |
+
}
|
373 |
+
|
374 |
+
// Convert meta JSON to attribute string.
|
375 |
+
var _meta = [];
|
376 |
+
for ( var key in data.meta ) {
|
377 |
+
|
378 |
+
// Boolean attributes can only require attribute key, not value.
|
379 |
+
if ( 'boolean' === typeof( data.meta[ key ] ) ) {
|
380 |
+
|
381 |
+
// Only set truthy boolean attributes.
|
382 |
+
if ( data.meta[ key ] ) {
|
383 |
+
_meta.push( _.escape( key ) );
|
384 |
+
}
|
385 |
+
|
386 |
+
} else {
|
387 |
+
|
388 |
+
_meta.push( _.escape( key ) + '="' + _.escape( data.meta[ key ] ) + '"' );
|
389 |
+
|
390 |
+
}
|
391 |
+
|
392 |
+
}
|
393 |
+
|
394 |
+
data.meta = _meta.join( ' ' );
|
395 |
+
|
396 |
+
this.$el.html( this.template( data ) );
|
397 |
+
|
398 |
return this
|
399 |
},
|
400 |
|
407 |
updateValue: function( e ) {
|
408 |
|
409 |
if ( this.model.get( 'attr' ) ) {
|
410 |
+
var $el = $( this.el ).find( '[name=' + this.model.get( 'attr' ) + ']' );
|
411 |
} else {
|
412 |
+
var $el = $( this.el ).find( '[name="inner_content"]' );
|
413 |
}
|
414 |
|
415 |
if ( 'radio' === this.model.attributes.type ) {
|
js/build/field-color.js
CHANGED
@@ -36,7 +36,7 @@ module.exports = Shortcodes;
|
|
36 |
(function (global){
|
37 |
var sui = require('./utils/sui.js'),
|
38 |
editAttributeField = require('./views/edit-attribute-field.js'),
|
39 |
-
|
40 |
|
41 |
sui.views.editAttributeFieldColor = editAttributeField.extend( {
|
42 |
|
@@ -45,7 +45,7 @@ sui.views.editAttributeFieldColor = editAttributeField.extend( {
|
|
45 |
|
46 |
this.$el.find('input[type="text"]:not(.wp-color-picker)').wpColorPicker({
|
47 |
change: function() {
|
48 |
-
|
49 |
}
|
50 |
});
|
51 |
|
@@ -63,7 +63,12 @@ var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global
|
|
63 |
* Shortcode Attribute Model.
|
64 |
*/
|
65 |
var InnerContent = Backbone.Model.extend({
|
66 |
-
defaults :
|
|
|
|
|
|
|
|
|
|
|
67 |
});
|
68 |
|
69 |
module.exports = InnerContent;
|
@@ -79,7 +84,10 @@ var ShortcodeAttribute = Backbone.Model.extend({
|
|
79 |
label: '',
|
80 |
type: '',
|
81 |
value: '',
|
82 |
-
|
|
|
|
|
|
|
83 |
},
|
84 |
});
|
85 |
|
@@ -98,7 +106,6 @@ Shortcode = Backbone.Model.extend({
|
|
98 |
label: '',
|
99 |
shortcode_tag: '',
|
100 |
attrs: new ShortcodeAttributes,
|
101 |
-
inner_content: new InnerContent,
|
102 |
},
|
103 |
|
104 |
/**
|
@@ -111,7 +118,7 @@ Shortcode = Backbone.Model.extend({
|
|
111 |
attributes.attrs = new ShortcodeAttributes( attributes.attrs );
|
112 |
}
|
113 |
|
114 |
-
if ( attributes.inner_content
|
115 |
attributes.inner_content = new InnerContent( attributes.inner_content );
|
116 |
}
|
117 |
|
@@ -124,10 +131,10 @@ Shortcode = Backbone.Model.extend({
|
|
124 |
*/
|
125 |
toJSON: function( options ) {
|
126 |
options = Backbone.Model.prototype.toJSON.call(this, options);
|
127 |
-
if ( options.attrs
|
128 |
options.attrs = options.attrs.toJSON();
|
129 |
}
|
130 |
-
if ( options.inner_content
|
131 |
options.inner_content = options.inner_content.toJSON();
|
132 |
}
|
133 |
return options;
|
@@ -140,7 +147,9 @@ Shortcode = Backbone.Model.extend({
|
|
140 |
clone: function() {
|
141 |
var clone = Backbone.Model.prototype.clone.call( this );
|
142 |
clone.set( 'attrs', clone.get( 'attrs' ).clone() );
|
143 |
-
|
|
|
|
|
144 |
return clone;
|
145 |
},
|
146 |
|
@@ -164,7 +173,7 @@ Shortcode = Backbone.Model.extend({
|
|
164 |
|
165 |
} );
|
166 |
|
167 |
-
if (
|
168 |
content = this.get( 'inner_content' ).get( 'value' );
|
169 |
}
|
170 |
|
@@ -200,8 +209,9 @@ module.exports = window.Shortcode_UI;
|
|
200 |
|
201 |
},{"./../collections/shortcodes.js":2}],8:[function(require,module,exports){
|
202 |
(function (global){
|
203 |
-
var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null)
|
204 |
-
sui = require('./../utils/sui.js')
|
|
|
205 |
|
206 |
var editAttributeField = Backbone.View.extend( {
|
207 |
|
@@ -220,7 +230,42 @@ var editAttributeField = Backbone.View.extend( {
|
|
220 |
},
|
221 |
|
222 |
render: function() {
|
223 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
224 |
return this
|
225 |
},
|
226 |
|
@@ -233,9 +278,9 @@ var editAttributeField = Backbone.View.extend( {
|
|
233 |
updateValue: function( e ) {
|
234 |
|
235 |
if ( this.model.get( 'attr' ) ) {
|
236 |
-
var $el =
|
237 |
} else {
|
238 |
-
var $el =
|
239 |
}
|
240 |
|
241 |
if ( 'radio' === this.model.attributes.type ) {
|
36 |
(function (global){
|
37 |
var sui = require('./utils/sui.js'),
|
38 |
editAttributeField = require('./views/edit-attribute-field.js'),
|
39 |
+
$ = (typeof window !== "undefined" ? window.jQuery : typeof global !== "undefined" ? global.jQuery : null);
|
40 |
|
41 |
sui.views.editAttributeFieldColor = editAttributeField.extend( {
|
42 |
|
45 |
|
46 |
this.$el.find('input[type="text"]:not(.wp-color-picker)').wpColorPicker({
|
47 |
change: function() {
|
48 |
+
$(this).trigger('keyup');
|
49 |
}
|
50 |
});
|
51 |
|
63 |
* Shortcode Attribute Model.
|
64 |
*/
|
65 |
var InnerContent = Backbone.Model.extend({
|
66 |
+
defaults : {
|
67 |
+
label: shortcodeUIData.strings.insert_content_label,
|
68 |
+
type: 'textarea',
|
69 |
+
value: '',
|
70 |
+
placeholder: '',
|
71 |
+
},
|
72 |
});
|
73 |
|
74 |
module.exports = InnerContent;
|
84 |
label: '',
|
85 |
type: '',
|
86 |
value: '',
|
87 |
+
description: '',
|
88 |
+
meta: {
|
89 |
+
placeholder: '',
|
90 |
+
}
|
91 |
},
|
92 |
});
|
93 |
|
106 |
label: '',
|
107 |
shortcode_tag: '',
|
108 |
attrs: new ShortcodeAttributes,
|
|
|
109 |
},
|
110 |
|
111 |
/**
|
118 |
attributes.attrs = new ShortcodeAttributes( attributes.attrs );
|
119 |
}
|
120 |
|
121 |
+
if ( attributes.inner_content && ! ( attributes.inner_content instanceof InnerContent ) ) {
|
122 |
attributes.inner_content = new InnerContent( attributes.inner_content );
|
123 |
}
|
124 |
|
131 |
*/
|
132 |
toJSON: function( options ) {
|
133 |
options = Backbone.Model.prototype.toJSON.call(this, options);
|
134 |
+
if ( options.attrs && ( options.attrs instanceof ShortcodeAttributes ) ) {
|
135 |
options.attrs = options.attrs.toJSON();
|
136 |
}
|
137 |
+
if ( options.inner_content && ( options.inner_content instanceof InnerContent ) ) {
|
138 |
options.inner_content = options.inner_content.toJSON();
|
139 |
}
|
140 |
return options;
|
147 |
clone: function() {
|
148 |
var clone = Backbone.Model.prototype.clone.call( this );
|
149 |
clone.set( 'attrs', clone.get( 'attrs' ).clone() );
|
150 |
+
if ( clone.get( 'inner_content' ) ) {
|
151 |
+
clone.set( 'inner_content', clone.get( 'inner_content' ).clone() );
|
152 |
+
}
|
153 |
return clone;
|
154 |
},
|
155 |
|
173 |
|
174 |
} );
|
175 |
|
176 |
+
if ( this.get( 'inner_content' ) ) {
|
177 |
content = this.get( 'inner_content' ).get( 'value' );
|
178 |
}
|
179 |
|
209 |
|
210 |
},{"./../collections/shortcodes.js":2}],8:[function(require,module,exports){
|
211 |
(function (global){
|
212 |
+
var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null),
|
213 |
+
sui = require('./../utils/sui.js'),
|
214 |
+
$ = (typeof window !== "undefined" ? window.jQuery : typeof global !== "undefined" ? global.jQuery : null);
|
215 |
|
216 |
var editAttributeField = Backbone.View.extend( {
|
217 |
|
230 |
},
|
231 |
|
232 |
render: function() {
|
233 |
+
|
234 |
+
var data = jQuery.extend( {
|
235 |
+
id: 'shortcode-ui-' + this.model.get( 'attr' ) + '-' + this.model.cid,
|
236 |
+
}, this.model.toJSON() );
|
237 |
+
|
238 |
+
// Handle legacy custom meta.
|
239 |
+
// Can be removed in 0.4.
|
240 |
+
if ( data.placeholder ) {
|
241 |
+
data.meta.placeholder = data.placeholder;
|
242 |
+
delete data.placeholder;
|
243 |
+
}
|
244 |
+
|
245 |
+
// Convert meta JSON to attribute string.
|
246 |
+
var _meta = [];
|
247 |
+
for ( var key in data.meta ) {
|
248 |
+
|
249 |
+
// Boolean attributes can only require attribute key, not value.
|
250 |
+
if ( 'boolean' === typeof( data.meta[ key ] ) ) {
|
251 |
+
|
252 |
+
// Only set truthy boolean attributes.
|
253 |
+
if ( data.meta[ key ] ) {
|
254 |
+
_meta.push( _.escape( key ) );
|
255 |
+
}
|
256 |
+
|
257 |
+
} else {
|
258 |
+
|
259 |
+
_meta.push( _.escape( key ) + '="' + _.escape( data.meta[ key ] ) + '"' );
|
260 |
+
|
261 |
+
}
|
262 |
+
|
263 |
+
}
|
264 |
+
|
265 |
+
data.meta = _meta.join( ' ' );
|
266 |
+
|
267 |
+
this.$el.html( this.template( data ) );
|
268 |
+
|
269 |
return this
|
270 |
},
|
271 |
|
278 |
updateValue: function( e ) {
|
279 |
|
280 |
if ( this.model.get( 'attr' ) ) {
|
281 |
+
var $el = $( this.el ).find( '[name=' + this.model.get( 'attr' ) + ']' );
|
282 |
} else {
|
283 |
+
var $el = $( this.el ).find( '[name="inner_content"]' );
|
284 |
}
|
285 |
|
286 |
if ( 'radio' === this.model.attributes.type ) {
|
js/build/field-post-select.js
ADDED
@@ -0,0 +1,202 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
(function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s})({1:[function(require,module,exports){
|
2 |
+
( function( $ ) {
|
3 |
+
|
4 |
+
var sui = window.Shortcode_UI;
|
5 |
+
|
6 |
+
// Cached Data.
|
7 |
+
var postSelectCache = {};
|
8 |
+
|
9 |
+
sui.views.editAttributeFieldPostSelect = sui.views.editAttributeField.extend( {
|
10 |
+
|
11 |
+
events: {
|
12 |
+
'change .shortcode-ui-post-select': 'updateValue',
|
13 |
+
},
|
14 |
+
|
15 |
+
render: function() {
|
16 |
+
|
17 |
+
var self = this,
|
18 |
+
defaults = { multiple: false };
|
19 |
+
|
20 |
+
for ( var arg in defaults ) {
|
21 |
+
if ( ! this.model.get( arg ) ) {
|
22 |
+
this.model.set( arg, defaults[ arg ] );
|
23 |
+
}
|
24 |
+
}
|
25 |
+
|
26 |
+
var data = this.model.toJSON();
|
27 |
+
data.id = 'shortcode-ui-' + this.model.get( 'attr' ) + '-' + this.model.cid;
|
28 |
+
|
29 |
+
this.$el.html( this.template( data ) );
|
30 |
+
|
31 |
+
var ajaxData = {
|
32 |
+
action : 'shortcode_ui_post_field',
|
33 |
+
nonce : shortcodeUiPostFieldData.nonce,
|
34 |
+
shortcode : this.shortcode.get( 'shortcode_tag'),
|
35 |
+
attr : this.model.get( 'attr' )
|
36 |
+
};
|
37 |
+
|
38 |
+
var $field = this.$el.find( '.shortcode-ui-post-select' );
|
39 |
+
|
40 |
+
$field.select2({
|
41 |
+
|
42 |
+
placeholder: "Search",
|
43 |
+
multiple: this.model.get( 'multiple' ),
|
44 |
+
ajax: {
|
45 |
+
url: ajaxurl,
|
46 |
+
dataType: 'json',
|
47 |
+
quietMillis: 250,
|
48 |
+
data: function (term, page) {
|
49 |
+
ajaxData.s = term;
|
50 |
+
ajaxData.page = page;
|
51 |
+
return ajaxData;
|
52 |
+
},
|
53 |
+
results: function ( response, page ) {
|
54 |
+
|
55 |
+
if ( ! response.success ) {
|
56 |
+
return { results: {}, more: false };
|
57 |
+
}
|
58 |
+
|
59 |
+
// Cache data for quicker rendering later.
|
60 |
+
postSelectCache = $.extend( postSelectCache, response.data.posts );
|
61 |
+
|
62 |
+
var more = ( page * response.data.posts_per_page ) < response.data.found_posts; // whether or not there are more results available
|
63 |
+
return { results: response.data.posts, more: more };
|
64 |
+
|
65 |
+
},
|
66 |
+
},
|
67 |
+
|
68 |
+
/**
|
69 |
+
* Initialize Callback
|
70 |
+
* Used to set render the initial value.
|
71 |
+
* Has to make a request to get the title for the current ID.
|
72 |
+
*/
|
73 |
+
initSelection: function(element, callback) {
|
74 |
+
|
75 |
+
var ids, parsedData = [], cached;
|
76 |
+
|
77 |
+
// Convert stored value to array of IDs (int).
|
78 |
+
ids = $(element)
|
79 |
+
.val()
|
80 |
+
.split(',')
|
81 |
+
.map( function (str) { return str.trim(); } )
|
82 |
+
.map( function (str) { return parseInt( str ); } )
|
83 |
+
|
84 |
+
if ( ids.length < 1 ) {
|
85 |
+
return;
|
86 |
+
}
|
87 |
+
|
88 |
+
// Check if there is already cached data.
|
89 |
+
for ( var i = 0; i < ids.length; i++ ) {
|
90 |
+
if ( cached = _.find( postSelectCache, _.matches( { id: ids[i] } ) ) ) {
|
91 |
+
parsedData.push( cached );
|
92 |
+
}
|
93 |
+
};
|
94 |
+
|
95 |
+
// If not multiple - return single value if we have one.
|
96 |
+
if ( parsedData.length && ! self.model.get( 'multiple' ) ) {
|
97 |
+
callback( parsedData[0] );
|
98 |
+
return;
|
99 |
+
}
|
100 |
+
|
101 |
+
var uncachedIds = _.difference( ids, _.pluck( parsedData, 'id' ) );
|
102 |
+
|
103 |
+
if ( ! uncachedIds.length ) {
|
104 |
+
|
105 |
+
callback( parsedData );
|
106 |
+
|
107 |
+
} else {
|
108 |
+
|
109 |
+
var initAjaxData = jQuery.extend( true, {}, ajaxData );
|
110 |
+
initAjaxData.action = 'shortcode_ui_post_field';
|
111 |
+
initAjaxData.post__in = uncachedIds;
|
112 |
+
|
113 |
+
$.get( ajaxurl, initAjaxData ).done( function( response ) {
|
114 |
+
|
115 |
+
if ( ! response.success ) {
|
116 |
+
return { results: {}, more: false };
|
117 |
+
}
|
118 |
+
|
119 |
+
postSelectCache = $.extend( postSelectCache, response.data.posts );
|
120 |
+
|
121 |
+
// If not multi-select, expects single object, not array of objects.
|
122 |
+
if ( ! self.model.get( 'multiple' ) ) {
|
123 |
+
callback( response.data.posts[0] );
|
124 |
+
return;
|
125 |
+
}
|
126 |
+
|
127 |
+
// Append new data to cached data.
|
128 |
+
// Sort by original order.
|
129 |
+
parsedData = parsedData
|
130 |
+
.concat( response.data.posts )
|
131 |
+
.sort(function (a, b) {
|
132 |
+
if ( ids.indexOf( a.id ) > ids.indexOf( b.id ) ) return 1;
|
133 |
+
if ( ids.indexOf( a.id ) < ids.indexOf( b.id ) ) return -1;
|
134 |
+
return 0;
|
135 |
+
});
|
136 |
+
|
137 |
+
callback( parsedData );
|
138 |
+
return;
|
139 |
+
|
140 |
+
} );
|
141 |
+
|
142 |
+
}
|
143 |
+
|
144 |
+
},
|
145 |
+
|
146 |
+
} );
|
147 |
+
|
148 |
+
// Make multiple values sortable.
|
149 |
+
if ( this.model.get( 'multiple' ) ) {
|
150 |
+
$field.select2('container').find('ul.select2-choices').sortable({
|
151 |
+
containment: 'parent',
|
152 |
+
start: function() { $('.shortcode-ui-post-select').select2('onSortStart'); },
|
153 |
+
update: function() { $('.shortcode-ui-post-select').select2('onSortEnd'); }
|
154 |
+
});
|
155 |
+
}
|
156 |
+
|
157 |
+
return this;
|
158 |
+
|
159 |
+
}
|
160 |
+
|
161 |
+
} );
|
162 |
+
|
163 |
+
/**
|
164 |
+
* Extending SUI Media Controller to hide Select2 UI Drop-Down when menu
|
165 |
+
* changes in Meida modal
|
166 |
+
* 1. going back/forth between different shortcakes (refresh)
|
167 |
+
* 2. changing the menu in left column (deactivate)
|
168 |
+
* 3. @TODO closing the modal.
|
169 |
+
*/
|
170 |
+
var mediaController = sui.controllers.MediaController;
|
171 |
+
sui.controllers.MediaController = mediaController.extend({
|
172 |
+
|
173 |
+
refresh: function(){
|
174 |
+
mediaController.prototype.refresh.apply( this, arguments );
|
175 |
+
this.destroySelect2UI();
|
176 |
+
},
|
177 |
+
|
178 |
+
//doesn't need to call parent as it already an "abstract" method in parent to provide callback
|
179 |
+
deactivate: function() {
|
180 |
+
this.destroySelect2UI();
|
181 |
+
},
|
182 |
+
|
183 |
+
destroySelect2UI: function() {
|
184 |
+
$('.shortcode-ui-post-select.select2-container').select2( "close" );
|
185 |
+
}
|
186 |
+
|
187 |
+
});
|
188 |
+
|
189 |
+
/**
|
190 |
+
* Extending the SUI Tabbed View to hide Select2 UI dropdown when previewing the shortcake
|
191 |
+
*/
|
192 |
+
var tabbedView = sui.views.TabbedView;
|
193 |
+
sui.views.TabbedView = tabbedView.extend({
|
194 |
+
tabSwitcher: function() {
|
195 |
+
tabbedView.prototype.tabSwitcher.apply( this, arguments );
|
196 |
+
$('.shortcode-ui-post-select.select2-container').select2( "close" );
|
197 |
+
}
|
198 |
+
});
|
199 |
+
|
200 |
+
} )( jQuery );
|
201 |
+
|
202 |
+
},{}]},{},[1]);
|
js/build/shortcode-ui.js
CHANGED
@@ -35,7 +35,8 @@ module.exports = Shortcodes;
|
|
35 |
},{"./../models/shortcode.js":6}],3:[function(require,module,exports){
|
36 |
(function (global){
|
37 |
var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null),
|
38 |
-
wp = (typeof window !== "undefined" ? window.wp : typeof global !== "undefined" ? global.wp : null)
|
|
|
39 |
Shortcodes = require('./../collections/shortcodes.js');
|
40 |
|
41 |
var MediaController = wp.media.controller.State.extend({
|
@@ -87,7 +88,7 @@ sui.controllers.MediaController = MediaController;
|
|
87 |
module.exports = MediaController;
|
88 |
|
89 |
}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
|
90 |
-
},{"./../collections/shortcodes.js":2}],4:[function(require,module,exports){
|
91 |
(function (global){
|
92 |
var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null);
|
93 |
|
@@ -95,7 +96,12 @@ var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global
|
|
95 |
* Shortcode Attribute Model.
|
96 |
*/
|
97 |
var InnerContent = Backbone.Model.extend({
|
98 |
-
defaults :
|
|
|
|
|
|
|
|
|
|
|
99 |
});
|
100 |
|
101 |
module.exports = InnerContent;
|
@@ -111,7 +117,10 @@ var ShortcodeAttribute = Backbone.Model.extend({
|
|
111 |
label: '',
|
112 |
type: '',
|
113 |
value: '',
|
114 |
-
|
|
|
|
|
|
|
115 |
},
|
116 |
});
|
117 |
|
@@ -130,7 +139,6 @@ Shortcode = Backbone.Model.extend({
|
|
130 |
label: '',
|
131 |
shortcode_tag: '',
|
132 |
attrs: new ShortcodeAttributes,
|
133 |
-
inner_content: new InnerContent,
|
134 |
},
|
135 |
|
136 |
/**
|
@@ -143,7 +151,7 @@ Shortcode = Backbone.Model.extend({
|
|
143 |
attributes.attrs = new ShortcodeAttributes( attributes.attrs );
|
144 |
}
|
145 |
|
146 |
-
if ( attributes.inner_content
|
147 |
attributes.inner_content = new InnerContent( attributes.inner_content );
|
148 |
}
|
149 |
|
@@ -156,10 +164,10 @@ Shortcode = Backbone.Model.extend({
|
|
156 |
*/
|
157 |
toJSON: function( options ) {
|
158 |
options = Backbone.Model.prototype.toJSON.call(this, options);
|
159 |
-
if ( options.attrs
|
160 |
options.attrs = options.attrs.toJSON();
|
161 |
}
|
162 |
-
if ( options.inner_content
|
163 |
options.inner_content = options.inner_content.toJSON();
|
164 |
}
|
165 |
return options;
|
@@ -172,7 +180,9 @@ Shortcode = Backbone.Model.extend({
|
|
172 |
clone: function() {
|
173 |
var clone = Backbone.Model.prototype.clone.call( this );
|
174 |
clone.set( 'attrs', clone.get( 'attrs' ).clone() );
|
175 |
-
|
|
|
|
|
176 |
return clone;
|
177 |
},
|
178 |
|
@@ -196,7 +206,7 @@ Shortcode = Backbone.Model.extend({
|
|
196 |
|
197 |
} );
|
198 |
|
199 |
-
if (
|
200 |
content = this.get( 'inner_content' ).get( 'value' );
|
201 |
}
|
202 |
|
@@ -226,9 +236,9 @@ var sui = require('./utils/sui.js'),
|
|
226 |
shortcodeViewConstructor = require('./utils/shortcode-view-constructor.js'),
|
227 |
mediaFrame = require('./views/media-frame.js'),
|
228 |
wp = (typeof window !== "undefined" ? window.wp : typeof global !== "undefined" ? global.wp : null),
|
229 |
-
|
230 |
|
231 |
-
|
232 |
|
233 |
// Create collection of shortcode models from data.
|
234 |
sui.shortcodes.add( shortcodeUIData.shortcodes );
|
@@ -242,7 +252,7 @@ jQuery(document).ready(function(){
|
|
242 |
shortcode.get('shortcode_tag'),
|
243 |
// Must extend for 4.1.
|
244 |
// This is handled by wp.mce.views.register in 4.2.
|
245 |
-
|
246 |
);
|
247 |
}
|
248 |
} );
|
@@ -252,9 +262,9 @@ jQuery(document).ready(function(){
|
|
252 |
}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
|
253 |
},{"./collections/shortcodes.js":2,"./utils/shortcode-view-constructor.js":8,"./utils/sui.js":9,"./views/media-frame.js":14}],8:[function(require,module,exports){
|
254 |
(function (global){
|
255 |
-
sui = require('./sui.js')
|
256 |
-
wp = (typeof window !== "undefined" ? window.wp : typeof global !== "undefined" ? global.wp : null)
|
257 |
-
|
258 |
|
259 |
/**
|
260 |
* Generic shortcode mce view constructor.
|
@@ -264,6 +274,7 @@ var shortcodeViewConstructor = {
|
|
264 |
|
265 |
initialize: function( options ) {
|
266 |
this.shortcodeModel = this.getShortcodeModel( this.shortcode );
|
|
|
267 |
},
|
268 |
|
269 |
/**
|
@@ -293,28 +304,17 @@ var shortcodeViewConstructor = {
|
|
293 |
}
|
294 |
);
|
295 |
|
296 |
-
if ('content' in options) {
|
297 |
-
var
|
298 |
-
|
|
|
|
|
299 |
}
|
300 |
|
301 |
return shortcodeModel;
|
302 |
|
303 |
},
|
304 |
|
305 |
-
/**
|
306 |
-
* Return the preview HTML.
|
307 |
-
* If empty, fetches data.
|
308 |
-
*
|
309 |
-
* @return string
|
310 |
-
*/
|
311 |
-
getContent : function() {
|
312 |
-
if ( ! this.content ) {
|
313 |
-
this.fetch();
|
314 |
-
}
|
315 |
-
return this.content;
|
316 |
-
},
|
317 |
-
|
318 |
/**
|
319 |
* Fetch preview.
|
320 |
* Async. Sets this.content and calls this.render.
|
@@ -330,16 +330,22 @@ var shortcodeViewConstructor = {
|
|
330 |
this.fetching = true;
|
331 |
|
332 |
wp.ajax.post( 'do_shortcode', {
|
333 |
-
post_id:
|
334 |
shortcode: this.shortcodeModel.formatShortcode(),
|
335 |
nonce: shortcodeUIData.nonces.preview,
|
336 |
}).done( function( response ) {
|
337 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
338 |
}).fail( function() {
|
339 |
self.content = '<span class="shortcake-error">' + shortcodeUIData.strings.mce_view_error + '</span>';
|
340 |
} ).always( function() {
|
341 |
delete self.fetching;
|
342 |
-
self.render();
|
343 |
} );
|
344 |
|
345 |
}
|
@@ -357,7 +363,7 @@ var shortcodeViewConstructor = {
|
|
357 |
|
358 |
// Backwards compatability for WP pre-4.2
|
359 |
if ( 'object' === typeof( shortcodeString ) ) {
|
360 |
-
shortcodeString = decodeURIComponent(
|
361 |
}
|
362 |
|
363 |
currentShortcode = this.parseShortcodeString( shortcodeString );
|
@@ -409,22 +415,33 @@ var shortcodeViewConstructor = {
|
|
409 |
|
410 |
if ( matches[2] ) {
|
411 |
|
412 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
413 |
|
414 |
// convert attribute strings to object.
|
415 |
for ( var i = 0; i < attributeMatches.length; i++ ) {
|
416 |
|
417 |
-
var bitsRegEx = /(\S+?)=
|
418 |
var bits = bitsRegEx.exec( attributeMatches[i] );
|
419 |
|
420 |
-
|
421 |
-
attr : bits[1]
|
422 |
-
});
|
423 |
|
424 |
-
|
425 |
-
|
426 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
427 |
|
|
|
428 |
}
|
429 |
|
430 |
}
|
@@ -445,6 +462,7 @@ var shortcodeViewConstructor = {
|
|
445 |
|
446 |
initialize: function( options ) {
|
447 |
this.shortcode = this.getShortcode( options );
|
|
|
448 |
},
|
449 |
|
450 |
getShortcode: function( options ) {
|
@@ -472,7 +490,9 @@ var shortcodeViewConstructor = {
|
|
472 |
|
473 |
if ('content' in options.shortcode) {
|
474 |
var inner_content = shortcode.get('inner_content');
|
475 |
-
|
|
|
|
|
476 |
}
|
477 |
|
478 |
return shortcode;
|
@@ -486,7 +506,7 @@ var shortcodeViewConstructor = {
|
|
486 |
if ( ! this.parsed ) {
|
487 |
|
488 |
wp.ajax.post( 'do_shortcode', {
|
489 |
-
post_id:
|
490 |
shortcode: this.shortcode.formatShortcode(),
|
491 |
nonce: shortcodeUIData.nonces.preview,
|
492 |
}).done( function( response ) {
|
@@ -514,11 +534,6 @@ var shortcodeViewConstructor = {
|
|
514 |
* @return string html
|
515 |
*/
|
516 |
getHtml : function() {
|
517 |
-
|
518 |
-
if ( ! this.parsed ) {
|
519 |
-
this.fetch();
|
520 |
-
}
|
521 |
-
|
522 |
return this.parsed;
|
523 |
},
|
524 |
|
@@ -571,8 +586,9 @@ module.exports = window.Shortcode_UI;
|
|
571 |
|
572 |
},{"./../collections/shortcodes.js":2}],10:[function(require,module,exports){
|
573 |
(function (global){
|
574 |
-
var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null)
|
575 |
-
sui = require('./../utils/sui.js')
|
|
|
576 |
|
577 |
var editAttributeField = Backbone.View.extend( {
|
578 |
|
@@ -591,7 +607,42 @@ var editAttributeField = Backbone.View.extend( {
|
|
591 |
},
|
592 |
|
593 |
render: function() {
|
594 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
595 |
return this
|
596 |
},
|
597 |
|
@@ -604,9 +655,9 @@ var editAttributeField = Backbone.View.extend( {
|
|
604 |
updateValue: function( e ) {
|
605 |
|
606 |
if ( this.model.get( 'attr' ) ) {
|
607 |
-
var $el =
|
608 |
} else {
|
609 |
-
var $el =
|
610 |
}
|
611 |
|
612 |
if ( 'radio' === this.model.attributes.type ) {
|
@@ -628,6 +679,7 @@ module.exports = editAttributeField;
|
|
628 |
(function (global){
|
629 |
var wp = (typeof window !== "undefined" ? window.wp : typeof global !== "undefined" ? global.wp : null),
|
630 |
sui = require('./../utils/sui.js'),
|
|
|
631 |
editAttributeField = require('./edit-attribute-field.js');
|
632 |
|
633 |
/**
|
@@ -641,7 +693,7 @@ var EditShortcodeForm = wp.Backbone.View.extend({
|
|
641 |
var t = this;
|
642 |
|
643 |
var innerContent = this.model.get( 'inner_content' );
|
644 |
-
if ( typeof innerContent.attributes.type !== 'undefined' ) {
|
645 |
|
646 |
// add UI for inner_content
|
647 |
var view = new editAttributeField( {
|
@@ -663,17 +715,37 @@ var EditShortcodeForm = wp.Backbone.View.extend({
|
|
663 |
return;
|
664 |
}
|
665 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
666 |
var viewObjName = shortcodeUIFieldData[ type ].view;
|
667 |
var tmplName = shortcodeUIFieldData[ type ].template;
|
668 |
|
669 |
-
var view
|
670 |
-
view.template
|
671 |
view.shortcode = t.model;
|
672 |
|
673 |
t.views.add( '.edit-shortcode-form-fields', view );
|
674 |
|
675 |
} );
|
676 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
677 |
},
|
678 |
|
679 |
});
|
@@ -764,6 +836,7 @@ module.exports = insertShortcodeList;
|
|
764 |
},{"./../collections/shortcodes.js":2,"./insert-shortcode-list-item.js":12}],14:[function(require,module,exports){
|
765 |
(function (global){
|
766 |
var wp = (typeof window !== "undefined" ? window.wp : typeof global !== "undefined" ? global.wp : null),
|
|
|
767 |
MediaController = require('./../controllers/media-controller.js'),
|
768 |
Shortcode_UI = require('./shortcode-ui'),
|
769 |
Toolbar = require('./media-toolbar');
|
@@ -790,17 +863,17 @@ var mediaFrame = postMediaFrame.extend( {
|
|
790 |
};
|
791 |
|
792 |
if ( 'currentShortcode' in this.options ) {
|
793 |
-
opts.title = shortcodeUIData.strings.media_frame_menu_update_label;
|
794 |
}
|
795 |
|
796 |
-
|
797 |
|
798 |
if ( 'currentShortcode' in this.options ) {
|
799 |
-
|
800 |
-
|
801 |
}
|
802 |
|
803 |
-
this.states.add([
|
804 |
|
805 |
this.on( 'content:render:' + id + '-content-insert', _.bind( this.contentRender, this, 'shortcode-ui', 'insert' ) );
|
806 |
this.on( 'toolbar:create:' + id + '-toolbar', this.toolbarCreate, this );
|
@@ -809,6 +882,19 @@ var mediaFrame = postMediaFrame.extend( {
|
|
809 |
|
810 |
},
|
811 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
812 |
contentRender : function( id, tab ) {
|
813 |
this.content.set(
|
814 |
new Shortcode_UI( {
|
@@ -955,7 +1041,8 @@ module.exports = SearchShortcode;
|
|
955 |
}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
|
956 |
},{"./../utils/sui.js":9}],17:[function(require,module,exports){
|
957 |
(function (global){
|
958 |
-
var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null)
|
|
|
959 |
|
960 |
/**
|
961 |
* Preview of rendered shortcode.
|
@@ -1018,8 +1105,10 @@ var ShortcodePreview = Backbone.View.extend({
|
|
1018 |
|
1019 |
_.defaults( params || {}, { 'head': '', 'body': '', 'body_classes': 'shortcake shortcake-preview' });
|
1020 |
|
1021 |
-
|
1022 |
-
|
|
|
|
|
1023 |
frameBorder: '0',
|
1024 |
allowTransparency: 'true',
|
1025 |
scrolling: 'no',
|
@@ -1033,10 +1122,10 @@ var ShortcodePreview = Backbone.View.extend({
|
|
1033 |
*/
|
1034 |
$iframe.load( function() {
|
1035 |
|
1036 |
-
self.autoresizeIframe(
|
1037 |
|
1038 |
-
var head =
|
1039 |
-
body =
|
1040 |
|
1041 |
head.html( params.head );
|
1042 |
body.html( params.body );
|
@@ -1052,7 +1141,7 @@ var ShortcodePreview = Backbone.View.extend({
|
|
1052 |
* Watch for mutations in iFrame content.
|
1053 |
* resize iFrame height on change.
|
1054 |
*
|
1055 |
-
* @param
|
1056 |
*/
|
1057 |
autoresizeIframe: function( $iframe ) {
|
1058 |
|
@@ -1099,7 +1188,7 @@ var ShortcodePreview = Backbone.View.extend({
|
|
1099 |
fetchShortcode: function( callback ) {
|
1100 |
|
1101 |
wp.ajax.post( 'do_shortcode', {
|
1102 |
-
post_id:
|
1103 |
shortcode: this.model.formatShortcode(),
|
1104 |
nonce: shortcodeUIData.nonces.preview,
|
1105 |
}).done( function( response ) {
|
@@ -1119,7 +1208,8 @@ var ShortcodePreview = Backbone.View.extend({
|
|
1119 |
getEditorStyles: function() {
|
1120 |
var styles = {};
|
1121 |
|
1122 |
-
|
|
|
1123 |
_.each( editor.dom.$( 'link[rel="stylesheet"]', editor.getDoc().head ), function( link ) {
|
1124 |
var href;
|
1125 |
( href = link.href ) && ( styles[href] = true ); // Poor man's de-duping.
|
@@ -1127,7 +1217,7 @@ var ShortcodePreview = Backbone.View.extend({
|
|
1127 |
});
|
1128 |
|
1129 |
styles = _.map( _.keys( styles ), function( href ) {
|
1130 |
-
return
|
1131 |
});
|
1132 |
|
1133 |
return styles;
|
@@ -1146,8 +1236,8 @@ var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global
|
|
1146 |
EditShortcodeForm = require('./edit-shortcode-form.js'),
|
1147 |
Toolbar = require('./media-toolbar.js'),
|
1148 |
SearchShortcode = require('./search-shortcode.js'),
|
1149 |
-
sui = require('./../utils/sui.js')
|
1150 |
-
|
1151 |
|
1152 |
var Shortcode_UI = Backbone.View.extend({
|
1153 |
|
@@ -1247,7 +1337,7 @@ var Shortcode_UI = Backbone.View.extend({
|
|
1247 |
|
1248 |
select: function(e) {
|
1249 |
this.controller.props.set( 'action', 'insert' );
|
1250 |
-
var target =
|
1251 |
var shortcode = sui.shortcodes.findWhere( { shortcode_tag: target.attr( 'data-shortcode' ) } );
|
1252 |
|
1253 |
if ( ! shortcode ) {
|
@@ -1269,6 +1359,7 @@ module.exports = Shortcode_UI;
|
|
1269 |
(function (global){
|
1270 |
var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null);
|
1271 |
var sui = require('./../utils/sui.js');
|
|
|
1272 |
|
1273 |
/**
|
1274 |
* Abstraction to manage tabbed content. Tab parameters (e.g., label) along with
|
@@ -1341,7 +1432,7 @@ var TabbedView = Backbone.View.extend({
|
|
1341 |
event.stopPropagation();
|
1342 |
event.preventDefault();
|
1343 |
|
1344 |
-
var target =
|
1345 |
|
1346 |
this.select(target);
|
1347 |
},
|
35 |
},{"./../models/shortcode.js":6}],3:[function(require,module,exports){
|
36 |
(function (global){
|
37 |
var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null),
|
38 |
+
wp = (typeof window !== "undefined" ? window.wp : typeof global !== "undefined" ? global.wp : null),
|
39 |
+
sui = require('./../utils/sui.js'),
|
40 |
Shortcodes = require('./../collections/shortcodes.js');
|
41 |
|
42 |
var MediaController = wp.media.controller.State.extend({
|
88 |
module.exports = MediaController;
|
89 |
|
90 |
}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
|
91 |
+
},{"./../collections/shortcodes.js":2,"./../utils/sui.js":9}],4:[function(require,module,exports){
|
92 |
(function (global){
|
93 |
var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null);
|
94 |
|
96 |
* Shortcode Attribute Model.
|
97 |
*/
|
98 |
var InnerContent = Backbone.Model.extend({
|
99 |
+
defaults : {
|
100 |
+
label: shortcodeUIData.strings.insert_content_label,
|
101 |
+
type: 'textarea',
|
102 |
+
value: '',
|
103 |
+
placeholder: '',
|
104 |
+
},
|
105 |
});
|
106 |
|
107 |
module.exports = InnerContent;
|
117 |
label: '',
|
118 |
type: '',
|
119 |
value: '',
|
120 |
+
description: '',
|
121 |
+
meta: {
|
122 |
+
placeholder: '',
|
123 |
+
}
|
124 |
},
|
125 |
});
|
126 |
|
139 |
label: '',
|
140 |
shortcode_tag: '',
|
141 |
attrs: new ShortcodeAttributes,
|
|
|
142 |
},
|
143 |
|
144 |
/**
|
151 |
attributes.attrs = new ShortcodeAttributes( attributes.attrs );
|
152 |
}
|
153 |
|
154 |
+
if ( attributes.inner_content && ! ( attributes.inner_content instanceof InnerContent ) ) {
|
155 |
attributes.inner_content = new InnerContent( attributes.inner_content );
|
156 |
}
|
157 |
|
164 |
*/
|
165 |
toJSON: function( options ) {
|
166 |
options = Backbone.Model.prototype.toJSON.call(this, options);
|
167 |
+
if ( options.attrs && ( options.attrs instanceof ShortcodeAttributes ) ) {
|
168 |
options.attrs = options.attrs.toJSON();
|
169 |
}
|
170 |
+
if ( options.inner_content && ( options.inner_content instanceof InnerContent ) ) {
|
171 |
options.inner_content = options.inner_content.toJSON();
|
172 |
}
|
173 |
return options;
|
180 |
clone: function() {
|
181 |
var clone = Backbone.Model.prototype.clone.call( this );
|
182 |
clone.set( 'attrs', clone.get( 'attrs' ).clone() );
|
183 |
+
if ( clone.get( 'inner_content' ) ) {
|
184 |
+
clone.set( 'inner_content', clone.get( 'inner_content' ).clone() );
|
185 |
+
}
|
186 |
return clone;
|
187 |
},
|
188 |
|
206 |
|
207 |
} );
|
208 |
|
209 |
+
if ( this.get( 'inner_content' ) ) {
|
210 |
content = this.get( 'inner_content' ).get( 'value' );
|
211 |
}
|
212 |
|
236 |
shortcodeViewConstructor = require('./utils/shortcode-view-constructor.js'),
|
237 |
mediaFrame = require('./views/media-frame.js'),
|
238 |
wp = (typeof window !== "undefined" ? window.wp : typeof global !== "undefined" ? global.wp : null),
|
239 |
+
$ = (typeof window !== "undefined" ? window.jQuery : typeof global !== "undefined" ? global.jQuery : null);
|
240 |
|
241 |
+
$(document).ready(function(){
|
242 |
|
243 |
// Create collection of shortcode models from data.
|
244 |
sui.shortcodes.add( shortcodeUIData.shortcodes );
|
252 |
shortcode.get('shortcode_tag'),
|
253 |
// Must extend for 4.1.
|
254 |
// This is handled by wp.mce.views.register in 4.2.
|
255 |
+
$.extend( true, {}, shortcodeViewConstructor )
|
256 |
);
|
257 |
}
|
258 |
} );
|
262 |
}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
|
263 |
},{"./collections/shortcodes.js":2,"./utils/shortcode-view-constructor.js":8,"./utils/sui.js":9,"./views/media-frame.js":14}],8:[function(require,module,exports){
|
264 |
(function (global){
|
265 |
+
var sui = require('./sui.js'),
|
266 |
+
wp = (typeof window !== "undefined" ? window.wp : typeof global !== "undefined" ? global.wp : null),
|
267 |
+
$ = (typeof window !== "undefined" ? window.jQuery : typeof global !== "undefined" ? global.jQuery : null);
|
268 |
|
269 |
/**
|
270 |
* Generic shortcode mce view constructor.
|
274 |
|
275 |
initialize: function( options ) {
|
276 |
this.shortcodeModel = this.getShortcodeModel( this.shortcode );
|
277 |
+
this.fetch();
|
278 |
},
|
279 |
|
280 |
/**
|
304 |
}
|
305 |
);
|
306 |
|
307 |
+
if ( 'content' in options ) {
|
308 |
+
var innerContent = shortcodeModel.get('inner_content');
|
309 |
+
if ( innerContent ) {
|
310 |
+
innerContent.set('value', options.content)
|
311 |
+
}
|
312 |
}
|
313 |
|
314 |
return shortcodeModel;
|
315 |
|
316 |
},
|
317 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
318 |
/**
|
319 |
* Fetch preview.
|
320 |
* Async. Sets this.content and calls this.render.
|
330 |
this.fetching = true;
|
331 |
|
332 |
wp.ajax.post( 'do_shortcode', {
|
333 |
+
post_id: $( '#post_ID' ).val(),
|
334 |
shortcode: this.shortcodeModel.formatShortcode(),
|
335 |
nonce: shortcodeUIData.nonces.preview,
|
336 |
}).done( function( response ) {
|
337 |
+
|
338 |
+
if ( '' === response ) {
|
339 |
+
self.content = '<span class="shortcake-notice shortcake-empty">' + self.shortcodeModel.formatShortcode() + '</span>';
|
340 |
+
} else {
|
341 |
+
self.content = response;
|
342 |
+
}
|
343 |
+
|
344 |
}).fail( function() {
|
345 |
self.content = '<span class="shortcake-error">' + shortcodeUIData.strings.mce_view_error + '</span>';
|
346 |
} ).always( function() {
|
347 |
delete self.fetching;
|
348 |
+
self.render( null, true );
|
349 |
} );
|
350 |
|
351 |
}
|
363 |
|
364 |
// Backwards compatability for WP pre-4.2
|
365 |
if ( 'object' === typeof( shortcodeString ) ) {
|
366 |
+
shortcodeString = decodeURIComponent( $(shortcodeString).attr('data-wpview-text') );
|
367 |
}
|
368 |
|
369 |
currentShortcode = this.parseShortcodeString( shortcodeString );
|
415 |
|
416 |
if ( matches[2] ) {
|
417 |
|
418 |
+
var attributeRegex = /(\w+)\s*=\s*"([^"]*)"(?:\s|$)|(\w+)\s*=\s*\'([^\']*)\'(?:\s|$)|(\w+)\s*=\s*([^\s\'"]+)(?:\s|$)|"([^"]*)"(?:\s|$)|(\S+)(?:\s|$)/gmi;
|
419 |
+
attributeMatches = matches[2].match( attributeRegex ) || [];
|
420 |
+
|
421 |
+
// Trim whitespace from matches.
|
422 |
+
attributeMatches = attributeMatches.map( function( match ) {
|
423 |
+
return match.replace( /^\s+|\s+$/g, '' );
|
424 |
+
} );
|
425 |
|
426 |
// convert attribute strings to object.
|
427 |
for ( var i = 0; i < attributeMatches.length; i++ ) {
|
428 |
|
429 |
+
var bitsRegEx = /(\S+?)=(.*)/g;
|
430 |
var bits = bitsRegEx.exec( attributeMatches[i] );
|
431 |
|
432 |
+
if ( bits && bits[1] ) {
|
|
|
|
|
433 |
|
434 |
+
attr = currentShortcode.get( 'attrs' ).findWhere({
|
435 |
+
attr : bits[1]
|
436 |
+
});
|
437 |
+
|
438 |
+
// If attribute found - set value.
|
439 |
+
// Trim quotes from beginning and end.
|
440 |
+
if ( attr ) {
|
441 |
+
attr.set( 'value', bits[2].replace( /^"|^'|"$|'$/gmi, "" ) );
|
442 |
+
}
|
443 |
|
444 |
+
}
|
445 |
}
|
446 |
|
447 |
}
|
462 |
|
463 |
initialize: function( options ) {
|
464 |
this.shortcode = this.getShortcode( options );
|
465 |
+
this.fetch();
|
466 |
},
|
467 |
|
468 |
getShortcode: function( options ) {
|
490 |
|
491 |
if ('content' in options.shortcode) {
|
492 |
var inner_content = shortcode.get('inner_content');
|
493 |
+
if ( inner_content ) {
|
494 |
+
inner_content.set('value', options.shortcode.content)
|
495 |
+
}
|
496 |
}
|
497 |
|
498 |
return shortcode;
|
506 |
if ( ! this.parsed ) {
|
507 |
|
508 |
wp.ajax.post( 'do_shortcode', {
|
509 |
+
post_id: $( '#post_ID' ).val(),
|
510 |
shortcode: this.shortcode.formatShortcode(),
|
511 |
nonce: shortcodeUIData.nonces.preview,
|
512 |
}).done( function( response ) {
|
534 |
* @return string html
|
535 |
*/
|
536 |
getHtml : function() {
|
|
|
|
|
|
|
|
|
|
|
537 |
return this.parsed;
|
538 |
},
|
539 |
|
586 |
|
587 |
},{"./../collections/shortcodes.js":2}],10:[function(require,module,exports){
|
588 |
(function (global){
|
589 |
+
var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null),
|
590 |
+
sui = require('./../utils/sui.js'),
|
591 |
+
$ = (typeof window !== "undefined" ? window.jQuery : typeof global !== "undefined" ? global.jQuery : null);
|
592 |
|
593 |
var editAttributeField = Backbone.View.extend( {
|
594 |
|
607 |
},
|
608 |
|
609 |
render: function() {
|
610 |
+
|
611 |
+
var data = jQuery.extend( {
|
612 |
+
id: 'shortcode-ui-' + this.model.get( 'attr' ) + '-' + this.model.cid,
|
613 |
+
}, this.model.toJSON() );
|
614 |
+
|
615 |
+
// Handle legacy custom meta.
|
616 |
+
// Can be removed in 0.4.
|
617 |
+
if ( data.placeholder ) {
|
618 |
+
data.meta.placeholder = data.placeholder;
|
619 |
+
delete data.placeholder;
|
620 |
+
}
|
621 |
+
|
622 |
+
// Convert meta JSON to attribute string.
|
623 |
+
var _meta = [];
|
624 |
+
for ( var key in data.meta ) {
|
625 |
+
|
626 |
+
// Boolean attributes can only require attribute key, not value.
|
627 |
+
if ( 'boolean' === typeof( data.meta[ key ] ) ) {
|
628 |
+
|
629 |
+
// Only set truthy boolean attributes.
|
630 |
+
if ( data.meta[ key ] ) {
|
631 |
+
_meta.push( _.escape( key ) );
|
632 |
+
}
|
633 |
+
|
634 |
+
} else {
|
635 |
+
|
636 |
+
_meta.push( _.escape( key ) + '="' + _.escape( data.meta[ key ] ) + '"' );
|
637 |
+
|
638 |
+
}
|
639 |
+
|
640 |
+
}
|
641 |
+
|
642 |
+
data.meta = _meta.join( ' ' );
|
643 |
+
|
644 |
+
this.$el.html( this.template( data ) );
|
645 |
+
|
646 |
return this
|
647 |
},
|
648 |
|
655 |
updateValue: function( e ) {
|
656 |
|
657 |
if ( this.model.get( 'attr' ) ) {
|
658 |
+
var $el = $( this.el ).find( '[name=' + this.model.get( 'attr' ) + ']' );
|
659 |
} else {
|
660 |
+
var $el = $( this.el ).find( '[name="inner_content"]' );
|
661 |
}
|
662 |
|
663 |
if ( 'radio' === this.model.attributes.type ) {
|
679 |
(function (global){
|
680 |
var wp = (typeof window !== "undefined" ? window.wp : typeof global !== "undefined" ? global.wp : null),
|
681 |
sui = require('./../utils/sui.js'),
|
682 |
+
backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null),
|
683 |
editAttributeField = require('./edit-attribute-field.js');
|
684 |
|
685 |
/**
|
693 |
var t = this;
|
694 |
|
695 |
var innerContent = this.model.get( 'inner_content' );
|
696 |
+
if ( innerContent && typeof innerContent.attributes.type !== 'undefined' ) {
|
697 |
|
698 |
// add UI for inner_content
|
699 |
var view = new editAttributeField( {
|
715 |
return;
|
716 |
}
|
717 |
|
718 |
+
var templateData = {
|
719 |
+
value: attr.get('value'),
|
720 |
+
attr_raw: {
|
721 |
+
name: attr.get('value')
|
722 |
+
}
|
723 |
+
}
|
724 |
+
|
725 |
var viewObjName = shortcodeUIFieldData[ type ].view;
|
726 |
var tmplName = shortcodeUIFieldData[ type ].template;
|
727 |
|
728 |
+
var view = new sui.views[viewObjName]( { model: attr } );
|
729 |
+
view.template = wp.media.template( tmplName );
|
730 |
view.shortcode = t.model;
|
731 |
|
732 |
t.views.add( '.edit-shortcode-form-fields', view );
|
733 |
|
734 |
} );
|
735 |
|
736 |
+
if ( 0 == this.model.get( 'attrs' ).length && ( ! innerContent || typeof innerContent == 'undefined' ) ) {
|
737 |
+
var messageView = new Backbone.View({
|
738 |
+
tagName: 'div',
|
739 |
+
className: 'notice updated',
|
740 |
+
});
|
741 |
+
messageView.render = function() {
|
742 |
+
this.$el.append( '<p>' );
|
743 |
+
this.$el.find('p').text( shortcodeUIData.strings.media_frame_no_attributes_message );
|
744 |
+
return this;
|
745 |
+
};
|
746 |
+
t.views.add( '.edit-shortcode-form-fields', messageView );
|
747 |
+
}
|
748 |
+
|
749 |
},
|
750 |
|
751 |
});
|
836 |
},{"./../collections/shortcodes.js":2,"./insert-shortcode-list-item.js":12}],14:[function(require,module,exports){
|
837 |
(function (global){
|
838 |
var wp = (typeof window !== "undefined" ? window.wp : typeof global !== "undefined" ? global.wp : null),
|
839 |
+
$ = (typeof window !== "undefined" ? window.jQuery : typeof global !== "undefined" ? global.jQuery : null),
|
840 |
MediaController = require('./../controllers/media-controller.js'),
|
841 |
Shortcode_UI = require('./shortcode-ui'),
|
842 |
Toolbar = require('./media-toolbar');
|
863 |
};
|
864 |
|
865 |
if ( 'currentShortcode' in this.options ) {
|
866 |
+
opts.title = shortcodeUIData.strings.media_frame_menu_update_label.replace( /%s/, this.options.currentShortcode.attributes.label );
|
867 |
}
|
868 |
|
869 |
+
this.mediaController = new MediaController( opts );
|
870 |
|
871 |
if ( 'currentShortcode' in this.options ) {
|
872 |
+
this.mediaController.props.set( 'currentShortcode', arguments[0].currentShortcode );
|
873 |
+
this.mediaController.props.set( 'action', 'update' );
|
874 |
}
|
875 |
|
876 |
+
this.states.add([ this.mediaController ]);
|
877 |
|
878 |
this.on( 'content:render:' + id + '-content-insert', _.bind( this.contentRender, this, 'shortcode-ui', 'insert' ) );
|
879 |
this.on( 'toolbar:create:' + id + '-toolbar', this.toolbarCreate, this );
|
882 |
|
883 |
},
|
884 |
|
885 |
+
events: function() {
|
886 |
+
return _.extend( {}, postMediaFrame.prototype.events, {
|
887 |
+
'click .media-menu-item' : 'resetMediaController',
|
888 |
+
} );
|
889 |
+
},
|
890 |
+
|
891 |
+
resetMediaController: function( event ) {
|
892 |
+
if ( this.state().props.get('currentShortcode') ) {
|
893 |
+
this.mediaController.reset();
|
894 |
+
this.contentRender( 'shortcode-ui', 'insert' );
|
895 |
+
}
|
896 |
+
},
|
897 |
+
|
898 |
contentRender : function( id, tab ) {
|
899 |
this.content.set(
|
900 |
new Shortcode_UI( {
|
1041 |
}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
|
1042 |
},{"./../utils/sui.js":9}],17:[function(require,module,exports){
|
1043 |
(function (global){
|
1044 |
+
var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null),
|
1045 |
+
$ = (typeof window !== "undefined" ? window.jQuery : typeof global !== "undefined" ? global.jQuery : null);
|
1046 |
|
1047 |
/**
|
1048 |
* Preview of rendered shortcode.
|
1105 |
|
1106 |
_.defaults( params || {}, { 'head': '', 'body': '', 'body_classes': 'shortcake shortcake-preview' });
|
1107 |
|
1108 |
+
var isIE = typeof tinymce != 'undefined' ? tinymce.Env.ie : false;
|
1109 |
+
|
1110 |
+
$iframe = $( '<iframe/>', {
|
1111 |
+
src: isIE ? 'javascript:""' : '',
|
1112 |
frameBorder: '0',
|
1113 |
allowTransparency: 'true',
|
1114 |
scrolling: 'no',
|
1122 |
*/
|
1123 |
$iframe.load( function() {
|
1124 |
|
1125 |
+
self.autoresizeIframe( $(this) );
|
1126 |
|
1127 |
+
var head = $(this).contents().find('head'),
|
1128 |
+
body = $(this).contents().find('body');
|
1129 |
|
1130 |
head.html( params.head );
|
1131 |
body.html( params.body );
|
1141 |
* Watch for mutations in iFrame content.
|
1142 |
* resize iFrame height on change.
|
1143 |
*
|
1144 |
+
* @param $ object $iframe
|
1145 |
*/
|
1146 |
autoresizeIframe: function( $iframe ) {
|
1147 |
|
1188 |
fetchShortcode: function( callback ) {
|
1189 |
|
1190 |
wp.ajax.post( 'do_shortcode', {
|
1191 |
+
post_id: $( '#post_ID' ).val(),
|
1192 |
shortcode: this.model.formatShortcode(),
|
1193 |
nonce: shortcodeUIData.nonces.preview,
|
1194 |
}).done( function( response ) {
|
1208 |
getEditorStyles: function() {
|
1209 |
var styles = {};
|
1210 |
|
1211 |
+
var editors = typeof tinymce != 'undefined' ? tinymce.editors : [];
|
1212 |
+
_.each( editors, function( editor ) {
|
1213 |
_.each( editor.dom.$( 'link[rel="stylesheet"]', editor.getDoc().head ), function( link ) {
|
1214 |
var href;
|
1215 |
( href = link.href ) && ( styles[href] = true ); // Poor man's de-duping.
|
1217 |
});
|
1218 |
|
1219 |
styles = _.map( _.keys( styles ), function( href ) {
|
1220 |
+
return $( '<link rel="stylesheet" type="text/css">' ).attr( 'href', href )[0].outerHTML;
|
1221 |
});
|
1222 |
|
1223 |
return styles;
|
1236 |
EditShortcodeForm = require('./edit-shortcode-form.js'),
|
1237 |
Toolbar = require('./media-toolbar.js'),
|
1238 |
SearchShortcode = require('./search-shortcode.js'),
|
1239 |
+
sui = require('./../utils/sui.js'),
|
1240 |
+
$ = (typeof window !== "undefined" ? window.jQuery : typeof global !== "undefined" ? global.jQuery : null);
|
1241 |
|
1242 |
var Shortcode_UI = Backbone.View.extend({
|
1243 |
|
1337 |
|
1338 |
select: function(e) {
|
1339 |
this.controller.props.set( 'action', 'insert' );
|
1340 |
+
var target = $(e.currentTarget).closest( '.shortcode-list-item' );
|
1341 |
var shortcode = sui.shortcodes.findWhere( { shortcode_tag: target.attr( 'data-shortcode' ) } );
|
1342 |
|
1343 |
if ( ! shortcode ) {
|
1359 |
(function (global){
|
1360 |
var Backbone = (typeof window !== "undefined" ? window.Backbone : typeof global !== "undefined" ? global.Backbone : null);
|
1361 |
var sui = require('./../utils/sui.js');
|
1362 |
+
var $ = (typeof window !== "undefined" ? window.jQuery : typeof global !== "undefined" ? global.jQuery : null);
|
1363 |
|
1364 |
/**
|
1365 |
* Abstraction to manage tabbed content. Tab parameters (e.g., label) along with
|
1432 |
event.stopPropagation();
|
1433 |
event.preventDefault();
|
1434 |
|
1435 |
+
var target = $(event.currentTarget).attr('data-target');
|
1436 |
|
1437 |
this.select(target);
|
1438 |
},
|
js/{collections → src/collections}/shortcode-attributes.js
RENAMED
File without changes
|
js/{collections → src/collections}/shortcodes.js
RENAMED
File without changes
|
js/{controllers → src/controllers}/media-controller.js
RENAMED
@@ -1,5 +1,6 @@
|
|
1 |
var Backbone = require('backbone'),
|
2 |
-
wp = require('wp')
|
|
|
3 |
Shortcodes = require('sui-collections/shortcodes');
|
4 |
|
5 |
var MediaController = wp.media.controller.State.extend({
|
1 |
var Backbone = require('backbone'),
|
2 |
+
wp = require('wp'),
|
3 |
+
sui = require('sui-utils/sui'),
|
4 |
Shortcodes = require('sui-collections/shortcodes');
|
5 |
|
6 |
var MediaController = wp.media.controller.State.extend({
|
js/{field-attachment.js → src/field-attachment.js}
RENAMED
@@ -1,6 +1,6 @@
|
|
1 |
var sui = require('sui-utils/sui'),
|
2 |
editAttributeField = require( 'sui-views/edit-attribute-field' ),
|
3 |
-
|
4 |
|
5 |
// Cache attachment IDs for quicker loading.
|
6 |
var iDCache = {};
|
@@ -12,9 +12,9 @@ sui.views.editAttributeFieldAttachment = editAttributeField.extend( {
|
|
12 |
var model = this.model;
|
13 |
|
14 |
// Set model default values.
|
15 |
-
for ( var arg in
|
16 |
if ( ! model.get( arg ) ) {
|
17 |
-
model.set( arg,
|
18 |
}
|
19 |
}
|
20 |
|
@@ -72,23 +72,23 @@ sui.views.editAttributeFieldAttachment = editAttributeField.extend( {
|
|
72 |
*/
|
73 |
var renderPreview = function( attachment ) {
|
74 |
|
75 |
-
var $thumbnail =
|
76 |
|
77 |
if ( 'image' !== attachment.type ) {
|
78 |
|
79 |
-
|
80 |
src: attachment.icon,
|
81 |
alt: attachment.title,
|
82 |
} ).appendTo( $thumbnail );
|
83 |
|
84 |
-
|
85 |
class: 'filename',
|
86 |
html: '<div>' + attachment.title + '</div>',
|
87 |
} ).appendTo( $thumbnail );
|
88 |
|
89 |
} else {
|
90 |
|
91 |
-
|
92 |
src: attachment.sizes.thumbnail.url,
|
93 |
width: attachment.sizes.thumbnail.width,
|
94 |
height: attachment.sizes.thumbnail.height,
|
1 |
var sui = require('sui-utils/sui'),
|
2 |
editAttributeField = require( 'sui-views/edit-attribute-field' ),
|
3 |
+
$ = require('jquery');
|
4 |
|
5 |
// Cache attachment IDs for quicker loading.
|
6 |
var iDCache = {};
|
12 |
var model = this.model;
|
13 |
|
14 |
// Set model default values.
|
15 |
+
for ( var arg in ShortcakeImageFieldData.defaultArgs ) {
|
16 |
if ( ! model.get( arg ) ) {
|
17 |
+
model.set( arg, ShortcakeImageFieldData.defaultArgs[ arg ] );
|
18 |
}
|
19 |
}
|
20 |
|
72 |
*/
|
73 |
var renderPreview = function( attachment ) {
|
74 |
|
75 |
+
var $thumbnail = $('<div class="thumbnail"></div>');
|
76 |
|
77 |
if ( 'image' !== attachment.type ) {
|
78 |
|
79 |
+
$( '<img/>', {
|
80 |
src: attachment.icon,
|
81 |
alt: attachment.title,
|
82 |
} ).appendTo( $thumbnail );
|
83 |
|
84 |
+
$( '<div/>', {
|
85 |
class: 'filename',
|
86 |
html: '<div>' + attachment.title + '</div>',
|
87 |
} ).appendTo( $thumbnail );
|
88 |
|
89 |
} else {
|
90 |
|
91 |
+
$( '<img/>', {
|
92 |
src: attachment.sizes.thumbnail.url,
|
93 |
width: attachment.sizes.thumbnail.width,
|
94 |
height: attachment.sizes.thumbnail.height,
|
js/{field-color.js → src/field-color.js}
RENAMED
@@ -1,6 +1,6 @@
|
|
1 |
var sui = require('sui-utils/sui'),
|
2 |
editAttributeField = require( 'sui-views/edit-attribute-field' ),
|
3 |
-
|
4 |
|
5 |
sui.views.editAttributeFieldColor = editAttributeField.extend( {
|
6 |
|
@@ -9,7 +9,7 @@ sui.views.editAttributeFieldColor = editAttributeField.extend( {
|
|
9 |
|
10 |
this.$el.find('input[type="text"]:not(.wp-color-picker)').wpColorPicker({
|
11 |
change: function() {
|
12 |
-
|
13 |
}
|
14 |
});
|
15 |
|
1 |
var sui = require('sui-utils/sui'),
|
2 |
editAttributeField = require( 'sui-views/edit-attribute-field' ),
|
3 |
+
$ = require('jquery');
|
4 |
|
5 |
sui.views.editAttributeFieldColor = editAttributeField.extend( {
|
6 |
|
9 |
|
10 |
this.$el.find('input[type="text"]:not(.wp-color-picker)').wpColorPicker({
|
11 |
change: function() {
|
12 |
+
$(this).trigger('keyup');
|
13 |
}
|
14 |
});
|
15 |
|
js/src/field-post-select.js
ADDED
@@ -0,0 +1,199 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
( function( $ ) {
|
2 |
+
|
3 |
+
var sui = window.Shortcode_UI;
|
4 |
+
|
5 |
+
// Cached Data.
|
6 |
+
var postSelectCache = {};
|
7 |
+
|
8 |
+
sui.views.editAttributeFieldPostSelect = sui.views.editAttributeField.extend( {
|
9 |
+
|
10 |
+
events: {
|
11 |
+
'change .shortcode-ui-post-select': 'updateValue',
|
12 |
+
},
|
13 |
+
|
14 |
+
render: function() {
|
15 |
+
|
16 |
+
var self = this,
|
17 |
+
defaults = { multiple: false };
|
18 |
+
|
19 |
+
for ( var arg in defaults ) {
|
20 |
+
if ( ! this.model.get( arg ) ) {
|
21 |
+
this.model.set( arg, defaults[ arg ] );
|
22 |
+
}
|
23 |
+
}
|
24 |
+
|
25 |
+
var data = this.model.toJSON();
|
26 |
+
data.id = 'shortcode-ui-' + this.model.get( 'attr' ) + '-' + this.model.cid;
|
27 |
+
|
28 |
+
this.$el.html( this.template( data ) );
|
29 |
+
|
30 |
+
var ajaxData = {
|
31 |
+
action : 'shortcode_ui_post_field',
|
32 |
+
nonce : shortcodeUiPostFieldData.nonce,
|
33 |
+
shortcode : this.shortcode.get( 'shortcode_tag'),
|
34 |
+
attr : this.model.get( 'attr' )
|
35 |
+
};
|
36 |
+
|
37 |
+
var $field = this.$el.find( '.shortcode-ui-post-select' );
|
38 |
+
|
39 |
+
$field.select2({
|
40 |
+
|
41 |
+
placeholder: "Search",
|
42 |
+
multiple: this.model.get( 'multiple' ),
|
43 |
+
ajax: {
|
44 |
+
url: ajaxurl,
|
45 |
+
dataType: 'json',
|
46 |
+
quietMillis: 250,
|
47 |
+
data: function (term, page) {
|
48 |
+
ajaxData.s = term;
|
49 |
+
ajaxData.page = page;
|
50 |
+
return ajaxData;
|
51 |
+
},
|
52 |
+
results: function ( response, page ) {
|
53 |
+
|
54 |
+
if ( ! response.success ) {
|
55 |
+
return { results: {}, more: false };
|
56 |
+
}
|
57 |
+
|
58 |
+
// Cache data for quicker rendering later.
|
59 |
+
postSelectCache = $.extend( postSelectCache, response.data.posts );
|
60 |
+
|
61 |
+
var more = ( page * response.data.posts_per_page ) < response.data.found_posts; // whether or not there are more results available
|
62 |
+
return { results: response.data.posts, more: more };
|
63 |
+
|
64 |
+
},
|
65 |
+
},
|
66 |
+
|
67 |
+
/**
|
68 |
+
* Initialize Callback
|
69 |
+
* Used to set render the initial value.
|
70 |
+
* Has to make a request to get the title for the current ID.
|
71 |
+
*/
|
72 |
+
initSelection: function(element, callback) {
|
73 |
+
|
74 |
+
var ids, parsedData = [], cached;
|
75 |
+
|
76 |
+
// Convert stored value to array of IDs (int).
|
77 |
+
ids = $(element)
|
78 |
+
.val()
|
79 |
+
.split(',')
|
80 |
+
.map( function (str) { return str.trim(); } )
|
81 |
+
.map( function (str) { return parseInt( str ); } )
|
82 |
+
|
83 |
+
if ( ids.length < 1 ) {
|
84 |
+
return;
|
85 |
+
}
|
86 |
+
|
87 |
+
// Check if there is already cached data.
|
88 |
+
for ( var i = 0; i < ids.length; i++ ) {
|
89 |
+
if ( cached = _.find( postSelectCache, _.matches( { id: ids[i] } ) ) ) {
|
90 |
+
parsedData.push( cached );
|
91 |
+
}
|
92 |
+
};
|
93 |
+
|
94 |
+
// If not multiple - return single value if we have one.
|
95 |
+
if ( parsedData.length && ! self.model.get( 'multiple' ) ) {
|
96 |
+
callback( parsedData[0] );
|
97 |
+
return;
|
98 |
+
}
|
99 |
+
|
100 |
+
var uncachedIds = _.difference( ids, _.pluck( parsedData, 'id' ) );
|
101 |
+
|
102 |
+
if ( ! uncachedIds.length ) {
|
103 |
+
|
104 |
+
callback( parsedData );
|
105 |
+
|
106 |
+
} else {
|
107 |
+
|
108 |
+
var initAjaxData = jQuery.extend( true, {}, ajaxData );
|
109 |
+
initAjaxData.action = 'shortcode_ui_post_field';
|
110 |
+
initAjaxData.post__in = uncachedIds;
|
111 |
+
|
112 |
+
$.get( ajaxurl, initAjaxData ).done( function( response ) {
|
113 |
+
|
114 |
+
if ( ! response.success ) {
|
115 |
+
return { results: {}, more: false };
|
116 |
+
}
|
117 |
+
|
118 |
+
postSelectCache = $.extend( postSelectCache, response.data.posts );
|
119 |
+
|
120 |
+
// If not multi-select, expects single object, not array of objects.
|
121 |
+
if ( ! self.model.get( 'multiple' ) ) {
|
122 |
+
callback( response.data.posts[0] );
|
123 |
+
return;
|
124 |
+
}
|
125 |
+
|
126 |
+
// Append new data to cached data.
|
127 |
+
// Sort by original order.
|
128 |
+
parsedData = parsedData
|
129 |
+
.concat( response.data.posts )
|
130 |
+
.sort(function (a, b) {
|
131 |
+
if ( ids.indexOf( a.id ) > ids.indexOf( b.id ) ) return 1;
|
132 |
+
if ( ids.indexOf( a.id ) < ids.indexOf( b.id ) ) return -1;
|
133 |
+
return 0;
|
134 |
+
});
|
135 |
+
|
136 |
+
callback( parsedData );
|
137 |
+
return;
|
138 |
+
|
139 |
+
} );
|
140 |
+
|
141 |
+
}
|
142 |
+
|
143 |
+
},
|
144 |
+
|
145 |
+
} );
|
146 |
+
|
147 |
+
// Make multiple values sortable.
|
148 |
+
if ( this.model.get( 'multiple' ) ) {
|
149 |
+
$field.select2('container').find('ul.select2-choices').sortable({
|
150 |
+
containment: 'parent',
|
151 |
+
start: function() { $('.shortcode-ui-post-select').select2('onSortStart'); },
|
152 |
+
update: function() { $('.shortcode-ui-post-select').select2('onSortEnd'); }
|
153 |
+
});
|
154 |
+
}
|
155 |
+
|
156 |
+
return this;
|
157 |
+
|
158 |
+
}
|
159 |
+
|
160 |
+
} );
|
161 |
+
|
162 |
+
/**
|
163 |
+
* Extending SUI Media Controller to hide Select2 UI Drop-Down when menu
|
164 |
+
* changes in Meida modal
|
165 |
+
* 1. going back/forth between different shortcakes (refresh)
|
166 |
+
* 2. changing the menu in left column (deactivate)
|
167 |
+
* 3. @TODO closing the modal.
|
168 |
+
*/
|
169 |
+
var mediaController = sui.controllers.MediaController;
|
170 |
+
sui.controllers.MediaController = mediaController.extend({
|
171 |
+
|
172 |
+
refresh: function(){
|
173 |
+
mediaController.prototype.refresh.apply( this, arguments );
|
174 |
+
this.destroySelect2UI();
|
175 |
+
},
|
176 |
+
|
177 |
+
//doesn't need to call parent as it already an "abstract" method in parent to provide callback
|
178 |
+
deactivate: function() {
|
179 |
+
this.destroySelect2UI();
|
180 |
+
},
|
181 |
+
|
182 |
+
destroySelect2UI: function() {
|
183 |
+
$('.shortcode-ui-post-select.select2-container').select2( "close" );
|
184 |
+
}
|
185 |
+
|
186 |
+
});
|
187 |
+
|
188 |
+
/**
|
189 |
+
* Extending the SUI Tabbed View to hide Select2 UI dropdown when previewing the shortcake
|
190 |
+
*/
|
191 |
+
var tabbedView = sui.views.TabbedView;
|
192 |
+
sui.views.TabbedView = tabbedView.extend({
|
193 |
+
tabSwitcher: function() {
|
194 |
+
tabbedView.prototype.tabSwitcher.apply( this, arguments );
|
195 |
+
$('.shortcode-ui-post-select.select2-container').select2( "close" );
|
196 |
+
}
|
197 |
+
});
|
198 |
+
|
199 |
+
} )( jQuery );
|
js/{models → src/models}/inner-content.js
RENAMED
@@ -4,7 +4,12 @@ var Backbone = require('backbone');
|
|
4 |
* Shortcode Attribute Model.
|
5 |
*/
|
6 |
var InnerContent = Backbone.Model.extend({
|
7 |
-
defaults :
|
|
|
|
|
|
|
|
|
|
|
8 |
});
|
9 |
|
10 |
module.exports = InnerContent;
|
4 |
* Shortcode Attribute Model.
|
5 |
*/
|
6 |
var InnerContent = Backbone.Model.extend({
|
7 |
+
defaults : {
|
8 |
+
label: shortcodeUIData.strings.insert_content_label,
|
9 |
+
type: 'textarea',
|
10 |
+
value: '',
|
11 |
+
placeholder: '',
|
12 |
+
},
|
13 |
});
|
14 |
|
15 |
module.exports = InnerContent;
|
js/{models → src/models}/shortcode-attribute.js
RENAMED
@@ -6,7 +6,10 @@ var ShortcodeAttribute = Backbone.Model.extend({
|
|
6 |
label: '',
|
7 |
type: '',
|
8 |
value: '',
|
9 |
-
|
|
|
|
|
|
|
10 |
},
|
11 |
});
|
12 |
|
6 |
label: '',
|
7 |
type: '',
|
8 |
value: '',
|
9 |
+
description: '',
|
10 |
+
meta: {
|
11 |
+
placeholder: '',
|
12 |
+
}
|
13 |
},
|
14 |
});
|
15 |
|
js/{models → src/models}/shortcode.js
RENAMED
@@ -8,7 +8,6 @@ Shortcode = Backbone.Model.extend({
|
|
8 |
label: '',
|
9 |
shortcode_tag: '',
|
10 |
attrs: new ShortcodeAttributes,
|
11 |
-
inner_content: new InnerContent,
|
12 |
},
|
13 |
|
14 |
/**
|
@@ -21,7 +20,7 @@ Shortcode = Backbone.Model.extend({
|
|
21 |
attributes.attrs = new ShortcodeAttributes( attributes.attrs );
|
22 |
}
|
23 |
|
24 |
-
if ( attributes.inner_content
|
25 |
attributes.inner_content = new InnerContent( attributes.inner_content );
|
26 |
}
|
27 |
|
@@ -34,10 +33,10 @@ Shortcode = Backbone.Model.extend({
|
|
34 |
*/
|
35 |
toJSON: function( options ) {
|
36 |
options = Backbone.Model.prototype.toJSON.call(this, options);
|
37 |
-
if ( options.attrs
|
38 |
options.attrs = options.attrs.toJSON();
|
39 |
}
|
40 |
-
if ( options.inner_content
|
41 |
options.inner_content = options.inner_content.toJSON();
|
42 |
}
|
43 |
return options;
|
@@ -50,7 +49,9 @@ Shortcode = Backbone.Model.extend({
|
|
50 |
clone: function() {
|
51 |
var clone = Backbone.Model.prototype.clone.call( this );
|
52 |
clone.set( 'attrs', clone.get( 'attrs' ).clone() );
|
53 |
-
|
|
|
|
|
54 |
return clone;
|
55 |
},
|
56 |
|
@@ -74,7 +75,7 @@ Shortcode = Backbone.Model.extend({
|
|
74 |
|
75 |
} );
|
76 |
|
77 |
-
if (
|
78 |
content = this.get( 'inner_content' ).get( 'value' );
|
79 |
}
|
80 |
|
8 |
label: '',
|
9 |
shortcode_tag: '',
|
10 |
attrs: new ShortcodeAttributes,
|
|
|
11 |
},
|
12 |
|
13 |
/**
|
20 |
attributes.attrs = new ShortcodeAttributes( attributes.attrs );
|
21 |
}
|
22 |
|
23 |
+
if ( attributes.inner_content && ! ( attributes.inner_content instanceof InnerContent ) ) {
|
24 |
attributes.inner_content = new InnerContent( attributes.inner_content );
|
25 |
}
|
26 |
|
33 |
*/
|
34 |
toJSON: function( options ) {
|
35 |
options = Backbone.Model.prototype.toJSON.call(this, options);
|
36 |
+
if ( options.attrs && ( options.attrs instanceof ShortcodeAttributes ) ) {
|
37 |
options.attrs = options.attrs.toJSON();
|
38 |
}
|
39 |
+
if ( options.inner_content && ( options.inner_content instanceof InnerContent ) ) {
|
40 |
options.inner_content = options.inner_content.toJSON();
|
41 |
}
|
42 |
return options;
|
49 |
clone: function() {
|
50 |
var clone = Backbone.Model.prototype.clone.call( this );
|
51 |
clone.set( 'attrs', clone.get( 'attrs' ).clone() );
|
52 |
+
if ( clone.get( 'inner_content' ) ) {
|
53 |
+
clone.set( 'inner_content', clone.get( 'inner_content' ).clone() );
|
54 |
+
}
|
55 |
return clone;
|
56 |
},
|
57 |
|
75 |
|
76 |
} );
|
77 |
|
78 |
+
if ( this.get( 'inner_content' ) ) {
|
79 |
content = this.get( 'inner_content' ).get( 'value' );
|
80 |
}
|
81 |
|
js/{shortcode-ui.js → src/shortcode-ui.js}
RENAMED
@@ -3,9 +3,9 @@ var sui = require('sui-utils/sui'),
|
|
3 |
shortcodeViewConstructor = require('sui-utils/shortcode-view-constructor'),
|
4 |
mediaFrame = require('sui-views/media-frame'),
|
5 |
wp = require('wp'),
|
6 |
-
|
7 |
|
8 |
-
|
9 |
|
10 |
// Create collection of shortcode models from data.
|
11 |
sui.shortcodes.add( shortcodeUIData.shortcodes );
|
@@ -19,7 +19,7 @@ jQuery(document).ready(function(){
|
|
19 |
shortcode.get('shortcode_tag'),
|
20 |
// Must extend for 4.1.
|
21 |
// This is handled by wp.mce.views.register in 4.2.
|
22 |
-
|
23 |
);
|
24 |
}
|
25 |
} );
|
3 |
shortcodeViewConstructor = require('sui-utils/shortcode-view-constructor'),
|
4 |
mediaFrame = require('sui-views/media-frame'),
|
5 |
wp = require('wp'),
|
6 |
+
$ = require('jquery');
|
7 |
|
8 |
+
$(document).ready(function(){
|
9 |
|
10 |
// Create collection of shortcode models from data.
|
11 |
sui.shortcodes.add( shortcodeUIData.shortcodes );
|
19 |
shortcode.get('shortcode_tag'),
|
20 |
// Must extend for 4.1.
|
21 |
// This is handled by wp.mce.views.register in 4.2.
|
22 |
+
$.extend( true, {}, shortcodeViewConstructor )
|
23 |
);
|
24 |
}
|
25 |
} );
|
js/{utils → src/utils}/shortcode-view-constructor.js
RENAMED
@@ -1,6 +1,6 @@
|
|
1 |
-
sui = require('sui-utils/sui')
|
2 |
-
wp = require('wp')
|
3 |
-
|
4 |
|
5 |
/**
|
6 |
* Generic shortcode mce view constructor.
|
@@ -10,6 +10,7 @@ var shortcodeViewConstructor = {
|
|
10 |
|
11 |
initialize: function( options ) {
|
12 |
this.shortcodeModel = this.getShortcodeModel( this.shortcode );
|
|
|
13 |
},
|
14 |
|
15 |
/**
|
@@ -39,28 +40,17 @@ var shortcodeViewConstructor = {
|
|
39 |
}
|
40 |
);
|
41 |
|
42 |
-
if ('content' in options) {
|
43 |
-
var
|
44 |
-
|
|
|
|
|
45 |
}
|
46 |
|
47 |
return shortcodeModel;
|
48 |
|
49 |
},
|
50 |
|
51 |
-
/**
|
52 |
-
* Return the preview HTML.
|
53 |
-
* If empty, fetches data.
|
54 |
-
*
|
55 |
-
* @return string
|
56 |
-
*/
|
57 |
-
getContent : function() {
|
58 |
-
if ( ! this.content ) {
|
59 |
-
this.fetch();
|
60 |
-
}
|
61 |
-
return this.content;
|
62 |
-
},
|
63 |
-
|
64 |
/**
|
65 |
* Fetch preview.
|
66 |
* Async. Sets this.content and calls this.render.
|
@@ -76,16 +66,22 @@ var shortcodeViewConstructor = {
|
|
76 |
this.fetching = true;
|
77 |
|
78 |
wp.ajax.post( 'do_shortcode', {
|
79 |
-
post_id:
|
80 |
shortcode: this.shortcodeModel.formatShortcode(),
|
81 |
nonce: shortcodeUIData.nonces.preview,
|
82 |
}).done( function( response ) {
|
83 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
84 |
}).fail( function() {
|
85 |
self.content = '<span class="shortcake-error">' + shortcodeUIData.strings.mce_view_error + '</span>';
|
86 |
} ).always( function() {
|
87 |
delete self.fetching;
|
88 |
-
self.render();
|
89 |
} );
|
90 |
|
91 |
}
|
@@ -103,7 +99,7 @@ var shortcodeViewConstructor = {
|
|
103 |
|
104 |
// Backwards compatability for WP pre-4.2
|
105 |
if ( 'object' === typeof( shortcodeString ) ) {
|
106 |
-
shortcodeString = decodeURIComponent(
|
107 |
}
|
108 |
|
109 |
currentShortcode = this.parseShortcodeString( shortcodeString );
|
@@ -155,22 +151,33 @@ var shortcodeViewConstructor = {
|
|
155 |
|
156 |
if ( matches[2] ) {
|
157 |
|
158 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
159 |
|
160 |
// convert attribute strings to object.
|
161 |
for ( var i = 0; i < attributeMatches.length; i++ ) {
|
162 |
|
163 |
-
var bitsRegEx = /(\S+?)=
|
164 |
var bits = bitsRegEx.exec( attributeMatches[i] );
|
165 |
|
166 |
-
|
167 |
-
attr : bits[1]
|
168 |
-
});
|
169 |
|
170 |
-
|
171 |
-
|
172 |
-
|
173 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
174 |
}
|
175 |
|
176 |
}
|
@@ -191,6 +198,7 @@ var shortcodeViewConstructor = {
|
|
191 |
|
192 |
initialize: function( options ) {
|
193 |
this.shortcode = this.getShortcode( options );
|
|
|
194 |
},
|
195 |
|
196 |
getShortcode: function( options ) {
|
@@ -218,7 +226,9 @@ var shortcodeViewConstructor = {
|
|
218 |
|
219 |
if ('content' in options.shortcode) {
|
220 |
var inner_content = shortcode.get('inner_content');
|
221 |
-
|
|
|
|
|
222 |
}
|
223 |
|
224 |
return shortcode;
|
@@ -232,7 +242,7 @@ var shortcodeViewConstructor = {
|
|
232 |
if ( ! this.parsed ) {
|
233 |
|
234 |
wp.ajax.post( 'do_shortcode', {
|
235 |
-
post_id:
|
236 |
shortcode: this.shortcode.formatShortcode(),
|
237 |
nonce: shortcodeUIData.nonces.preview,
|
238 |
}).done( function( response ) {
|
@@ -260,11 +270,6 @@ var shortcodeViewConstructor = {
|
|
260 |
* @return string html
|
261 |
*/
|
262 |
getHtml : function() {
|
263 |
-
|
264 |
-
if ( ! this.parsed ) {
|
265 |
-
this.fetch();
|
266 |
-
}
|
267 |
-
|
268 |
return this.parsed;
|
269 |
},
|
270 |
|
1 |
+
var sui = require('sui-utils/sui'),
|
2 |
+
wp = require('wp'),
|
3 |
+
$ = require('jquery');
|
4 |
|
5 |
/**
|
6 |
* Generic shortcode mce view constructor.
|
10 |
|
11 |
initialize: function( options ) {
|
12 |
this.shortcodeModel = this.getShortcodeModel( this.shortcode );
|
13 |
+
this.fetch();
|
14 |
},
|
15 |
|
16 |
/**
|
40 |
}
|
41 |
);
|
42 |
|
43 |
+
if ( 'content' in options ) {
|
44 |
+
var innerContent = shortcodeModel.get('inner_content');
|
45 |
+
if ( innerContent ) {
|
46 |
+
innerContent.set('value', options.content)
|
47 |
+
}
|
48 |
}
|
49 |
|
50 |
return shortcodeModel;
|
51 |
|
52 |
},
|
53 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
54 |
/**
|
55 |
* Fetch preview.
|
56 |
* Async. Sets this.content and calls this.render.
|
66 |
this.fetching = true;
|
67 |
|
68 |
wp.ajax.post( 'do_shortcode', {
|
69 |
+
post_id: $( '#post_ID' ).val(),
|
70 |
shortcode: this.shortcodeModel.formatShortcode(),
|
71 |
nonce: shortcodeUIData.nonces.preview,
|
72 |
}).done( function( response ) {
|
73 |
+
|
74 |
+
if ( '' === response ) {
|
75 |
+
self.content = '<span class="shortcake-notice shortcake-empty">' + self.shortcodeModel.formatShortcode() + '</span>';
|
76 |
+
} else {
|
77 |
+
self.content = response;
|
78 |
+
}
|
79 |
+
|
80 |
}).fail( function() {
|
81 |
self.content = '<span class="shortcake-error">' + shortcodeUIData.strings.mce_view_error + '</span>';
|
82 |
} ).always( function() {
|
83 |
delete self.fetching;
|
84 |
+
self.render( null, true );
|
85 |
} );
|
86 |
|
87 |
}
|
99 |
|
100 |
// Backwards compatability for WP pre-4.2
|
101 |
if ( 'object' === typeof( shortcodeString ) ) {
|
102 |
+
shortcodeString = decodeURIComponent( $(shortcodeString).attr('data-wpview-text') );
|
103 |
}
|
104 |
|
105 |
currentShortcode = this.parseShortcodeString( shortcodeString );
|
151 |
|
152 |
if ( matches[2] ) {
|
153 |
|
154 |
+
var attributeRegex = /(\w+)\s*=\s*"([^"]*)"(?:\s|$)|(\w+)\s*=\s*\'([^\']*)\'(?:\s|$)|(\w+)\s*=\s*([^\s\'"]+)(?:\s|$)|"([^"]*)"(?:\s|$)|(\S+)(?:\s|$)/gmi;
|
155 |
+
attributeMatches = matches[2].match( attributeRegex ) || [];
|
156 |
+
|
157 |
+
// Trim whitespace from matches.
|
158 |
+
attributeMatches = attributeMatches.map( function( match ) {
|
159 |
+
return match.replace( /^\s+|\s+$/g, '' );
|
160 |
+
} );
|
161 |
|
162 |
// convert attribute strings to object.
|
163 |
for ( var i = 0; i < attributeMatches.length; i++ ) {
|
164 |
|
165 |
+
var bitsRegEx = /(\S+?)=(.*)/g;
|
166 |
var bits = bitsRegEx.exec( attributeMatches[i] );
|
167 |
|
168 |
+
if ( bits && bits[1] ) {
|
|
|
|
|
169 |
|
170 |
+
attr = currentShortcode.get( 'attrs' ).findWhere({
|
171 |
+
attr : bits[1]
|
172 |
+
});
|
173 |
|
174 |
+
// If attribute found - set value.
|
175 |
+
// Trim quotes from beginning and end.
|
176 |
+
if ( attr ) {
|
177 |
+
attr.set( 'value', bits[2].replace( /^"|^'|"$|'$/gmi, "" ) );
|
178 |
+
}
|
179 |
+
|
180 |
+
}
|
181 |
}
|
182 |
|
183 |
}
|
198 |
|
199 |
initialize: function( options ) {
|
200 |
this.shortcode = this.getShortcode( options );
|
201 |
+
this.fetch();
|
202 |
},
|
203 |
|
204 |
getShortcode: function( options ) {
|
226 |
|
227 |
if ('content' in options.shortcode) {
|
228 |
var inner_content = shortcode.get('inner_content');
|
229 |
+
if ( inner_content ) {
|
230 |
+
inner_content.set('value', options.shortcode.content)
|
231 |
+
}
|
232 |
}
|
233 |
|
234 |
return shortcode;
|
242 |
if ( ! this.parsed ) {
|
243 |
|
244 |
wp.ajax.post( 'do_shortcode', {
|
245 |
+
post_id: $( '#post_ID' ).val(),
|
246 |
shortcode: this.shortcode.formatShortcode(),
|
247 |
nonce: shortcodeUIData.nonces.preview,
|
248 |
}).done( function( response ) {
|
270 |
* @return string html
|
271 |
*/
|
272 |
getHtml : function() {
|
|
|
|
|
|
|
|
|
|
|
273 |
return this.parsed;
|
274 |
},
|
275 |
|
js/{utils → src/utils}/sui.js
RENAMED
File without changes
|
js/{views → src/views}/edit-attribute-field.js
RENAMED
@@ -1,5 +1,6 @@
|
|
1 |
-
var Backbone = require('backbone')
|
2 |
-
sui = require('sui-utils/sui')
|
|
|
3 |
|
4 |
var editAttributeField = Backbone.View.extend( {
|
5 |
|
@@ -18,7 +19,42 @@ var editAttributeField = Backbone.View.extend( {
|
|
18 |
},
|
19 |
|
20 |
render: function() {
|
21 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
22 |
return this
|
23 |
},
|
24 |
|
@@ -31,9 +67,9 @@ var editAttributeField = Backbone.View.extend( {
|
|
31 |
updateValue: function( e ) {
|
32 |
|
33 |
if ( this.model.get( 'attr' ) ) {
|
34 |
-
var $el =
|
35 |
} else {
|
36 |
-
var $el =
|
37 |
}
|
38 |
|
39 |
if ( 'radio' === this.model.attributes.type ) {
|
1 |
+
var Backbone = require('backbone'),
|
2 |
+
sui = require('sui-utils/sui'),
|
3 |
+
$ = require('jquery');
|
4 |
|
5 |
var editAttributeField = Backbone.View.extend( {
|
6 |
|
19 |
},
|
20 |
|
21 |
render: function() {
|
22 |
+
|
23 |
+
var data = jQuery.extend( {
|
24 |
+
id: 'shortcode-ui-' + this.model.get( 'attr' ) + '-' + this.model.cid,
|
25 |
+
}, this.model.toJSON() );
|
26 |
+
|
27 |
+
// Handle legacy custom meta.
|
28 |
+
// Can be removed in 0.4.
|
29 |
+
if ( data.placeholder ) {
|
30 |
+
data.meta.placeholder = data.placeholder;
|
31 |
+
delete data.placeholder;
|
32 |
+
}
|
33 |
+
|
34 |
+
// Convert meta JSON to attribute string.
|
35 |
+
var _meta = [];
|
36 |
+
for ( var key in data.meta ) {
|
37 |
+
|
38 |
+
// Boolean attributes can only require attribute key, not value.
|
39 |
+
if ( 'boolean' === typeof( data.meta[ key ] ) ) {
|
40 |
+
|
41 |
+
// Only set truthy boolean attributes.
|
42 |
+
if ( data.meta[ key ] ) {
|
43 |
+
_meta.push( _.escape( key ) );
|
44 |
+
}
|
45 |
+
|
46 |
+
} else {
|
47 |
+
|
48 |
+
_meta.push( _.escape( key ) + '="' + _.escape( data.meta[ key ] ) + '"' );
|
49 |
+
|
50 |
+
}
|
51 |
+
|
52 |
+
}
|
53 |
+
|
54 |
+
data.meta = _meta.join( ' ' );
|
55 |
+
|
56 |
+
this.$el.html( this.template( data ) );
|
57 |
+
|
58 |
return this
|
59 |
},
|
60 |
|
67 |
updateValue: function( e ) {
|
68 |
|
69 |
if ( this.model.get( 'attr' ) ) {
|
70 |
+
var $el = $( this.el ).find( '[name=' + this.model.get( 'attr' ) + ']' );
|
71 |
} else {
|
72 |
+
var $el = $( this.el ).find( '[name="inner_content"]' );
|
73 |
}
|
74 |
|
75 |
if ( 'radio' === this.model.attributes.type ) {
|
js/{views → src/views}/edit-shortcode-form.js
RENAMED
@@ -1,5 +1,6 @@
|
|
1 |
var wp = require('wp'),
|
2 |
sui = require('sui-utils/sui'),
|
|
|
3 |
editAttributeField = require( 'sui-views/edit-attribute-field' );
|
4 |
|
5 |
/**
|
@@ -13,7 +14,7 @@ var EditShortcodeForm = wp.Backbone.View.extend({
|
|
13 |
var t = this;
|
14 |
|
15 |
var innerContent = this.model.get( 'inner_content' );
|
16 |
-
if ( typeof innerContent.attributes.type !== 'undefined' ) {
|
17 |
|
18 |
// add UI for inner_content
|
19 |
var view = new editAttributeField( {
|
@@ -35,17 +36,37 @@ var EditShortcodeForm = wp.Backbone.View.extend({
|
|
35 |
return;
|
36 |
}
|
37 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
38 |
var viewObjName = shortcodeUIFieldData[ type ].view;
|
39 |
var tmplName = shortcodeUIFieldData[ type ].template;
|
40 |
|
41 |
-
var view
|
42 |
-
view.template
|
43 |
view.shortcode = t.model;
|
44 |
|
45 |
t.views.add( '.edit-shortcode-form-fields', view );
|
46 |
|
47 |
} );
|
48 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
49 |
},
|
50 |
|
51 |
});
|
1 |
var wp = require('wp'),
|
2 |
sui = require('sui-utils/sui'),
|
3 |
+
backbone = require('backbone'),
|
4 |
editAttributeField = require( 'sui-views/edit-attribute-field' );
|
5 |
|
6 |
/**
|
14 |
var t = this;
|
15 |
|
16 |
var innerContent = this.model.get( 'inner_content' );
|
17 |
+
if ( innerContent && typeof innerContent.attributes.type !== 'undefined' ) {
|
18 |
|
19 |
// add UI for inner_content
|
20 |
var view = new editAttributeField( {
|
36 |
return;
|
37 |
}
|
38 |
|
39 |
+
var templateData = {
|
40 |
+
value: attr.get('value'),
|
41 |
+
attr_raw: {
|
42 |
+
name: attr.get('value')
|
43 |
+
}
|
44 |
+
}
|
45 |
+
|
46 |
var viewObjName = shortcodeUIFieldData[ type ].view;
|
47 |
var tmplName = shortcodeUIFieldData[ type ].template;
|
48 |
|
49 |
+
var view = new sui.views[viewObjName]( { model: attr } );
|
50 |
+
view.template = wp.media.template( tmplName );
|
51 |
view.shortcode = t.model;
|
52 |
|
53 |
t.views.add( '.edit-shortcode-form-fields', view );
|
54 |
|
55 |
} );
|
56 |
|
57 |
+
if ( 0 == this.model.get( 'attrs' ).length && ( ! innerContent || typeof innerContent == 'undefined' ) ) {
|
58 |
+
var messageView = new Backbone.View({
|
59 |
+
tagName: 'div',
|
60 |
+
className: 'notice updated',
|
61 |
+
});
|
62 |
+
messageView.render = function() {
|
63 |
+
this.$el.append( '<p>' );
|
64 |
+
this.$el.find('p').text( shortcodeUIData.strings.media_frame_no_attributes_message );
|
65 |
+
return this;
|
66 |
+
};
|
67 |
+
t.views.add( '.edit-shortcode-form-fields', messageView );
|
68 |
+
}
|
69 |
+
|
70 |
},
|
71 |
|
72 |
});
|
js/{views → src/views}/insert-shortcode-list-item.js
RENAMED
File without changes
|
js/{views → src/views}/insert-shortcode-list.js
RENAMED
File without changes
|
js/{views → src/views}/media-frame.js
RENAMED
@@ -1,4 +1,5 @@
|
|
1 |
var wp = require('wp'),
|
|
|
2 |
MediaController = require('sui-controllers/media-controller'),
|
3 |
Shortcode_UI = require('./shortcode-ui'),
|
4 |
Toolbar = require('./media-toolbar');
|
@@ -25,17 +26,17 @@ var mediaFrame = postMediaFrame.extend( {
|
|
25 |
};
|
26 |
|
27 |
if ( 'currentShortcode' in this.options ) {
|
28 |
-
opts.title = shortcodeUIData.strings.media_frame_menu_update_label;
|
29 |
}
|
30 |
|
31 |
-
|
32 |
|
33 |
if ( 'currentShortcode' in this.options ) {
|
34 |
-
|
35 |
-
|
36 |
}
|
37 |
|
38 |
-
this.states.add([
|
39 |
|
40 |
this.on( 'content:render:' + id + '-content-insert', _.bind( this.contentRender, this, 'shortcode-ui', 'insert' ) );
|
41 |
this.on( 'toolbar:create:' + id + '-toolbar', this.toolbarCreate, this );
|
@@ -44,6 +45,19 @@ var mediaFrame = postMediaFrame.extend( {
|
|
44 |
|
45 |
},
|
46 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
47 |
contentRender : function( id, tab ) {
|
48 |
this.content.set(
|
49 |
new Shortcode_UI( {
|
1 |
var wp = require('wp'),
|
2 |
+
$ = require('jquery'),
|
3 |
MediaController = require('sui-controllers/media-controller'),
|
4 |
Shortcode_UI = require('./shortcode-ui'),
|
5 |
Toolbar = require('./media-toolbar');
|
26 |
};
|
27 |
|
28 |
if ( 'currentShortcode' in this.options ) {
|
29 |
+
opts.title = shortcodeUIData.strings.media_frame_menu_update_label.replace( /%s/, this.options.currentShortcode.attributes.label );
|
30 |
}
|
31 |
|
32 |
+
this.mediaController = new MediaController( opts );
|
33 |
|
34 |
if ( 'currentShortcode' in this.options ) {
|
35 |
+
this.mediaController.props.set( 'currentShortcode', arguments[0].currentShortcode );
|
36 |
+
this.mediaController.props.set( 'action', 'update' );
|
37 |
}
|
38 |
|
39 |
+
this.states.add([ this.mediaController ]);
|
40 |
|
41 |
this.on( 'content:render:' + id + '-content-insert', _.bind( this.contentRender, this, 'shortcode-ui', 'insert' ) );
|
42 |
this.on( 'toolbar:create:' + id + '-toolbar', this.toolbarCreate, this );
|
45 |
|
46 |
},
|
47 |
|
48 |
+
events: function() {
|
49 |
+
return _.extend( {}, postMediaFrame.prototype.events, {
|
50 |
+
'click .media-menu-item' : 'resetMediaController',
|
51 |
+
} );
|
52 |
+
},
|
53 |
+
|
54 |
+
resetMediaController: function( event ) {
|
55 |
+
if ( this.state().props.get('currentShortcode') ) {
|
56 |
+
this.mediaController.reset();
|
57 |
+
this.contentRender( 'shortcode-ui', 'insert' );
|
58 |
+
}
|
59 |
+
},
|
60 |
+
|
61 |
contentRender : function( id, tab ) {
|
62 |
this.content.set(
|
63 |
new Shortcode_UI( {
|
js/{views → src/views}/media-toolbar.js
RENAMED
File without changes
|
js/{views → src/views}/search-shortcode.js
RENAMED
File without changes
|
js/{views → src/views}/shortcode-preview.js
RENAMED
@@ -1,4 +1,5 @@
|
|
1 |
-
var Backbone = require('backbone')
|
|
|
2 |
|
3 |
/**
|
4 |
* Preview of rendered shortcode.
|
@@ -61,8 +62,10 @@ var ShortcodePreview = Backbone.View.extend({
|
|
61 |
|
62 |
_.defaults( params || {}, { 'head': '', 'body': '', 'body_classes': 'shortcake shortcake-preview' });
|
63 |
|
64 |
-
|
65 |
-
|
|
|
|
|
66 |
frameBorder: '0',
|
67 |
allowTransparency: 'true',
|
68 |
scrolling: 'no',
|
@@ -76,10 +79,10 @@ var ShortcodePreview = Backbone.View.extend({
|
|
76 |
*/
|
77 |
$iframe.load( function() {
|
78 |
|
79 |
-
self.autoresizeIframe(
|
80 |
|
81 |
-
var head =
|
82 |
-
body =
|
83 |
|
84 |
head.html( params.head );
|
85 |
body.html( params.body );
|
@@ -95,7 +98,7 @@ var ShortcodePreview = Backbone.View.extend({
|
|
95 |
* Watch for mutations in iFrame content.
|
96 |
* resize iFrame height on change.
|
97 |
*
|
98 |
-
* @param
|
99 |
*/
|
100 |
autoresizeIframe: function( $iframe ) {
|
101 |
|
@@ -142,7 +145,7 @@ var ShortcodePreview = Backbone.View.extend({
|
|
142 |
fetchShortcode: function( callback ) {
|
143 |
|
144 |
wp.ajax.post( 'do_shortcode', {
|
145 |
-
post_id:
|
146 |
shortcode: this.model.formatShortcode(),
|
147 |
nonce: shortcodeUIData.nonces.preview,
|
148 |
}).done( function( response ) {
|
@@ -162,7 +165,8 @@ var ShortcodePreview = Backbone.View.extend({
|
|
162 |
getEditorStyles: function() {
|
163 |
var styles = {};
|
164 |
|
165 |
-
|
|
|
166 |
_.each( editor.dom.$( 'link[rel="stylesheet"]', editor.getDoc().head ), function( link ) {
|
167 |
var href;
|
168 |
( href = link.href ) && ( styles[href] = true ); // Poor man's de-duping.
|
@@ -170,7 +174,7 @@ var ShortcodePreview = Backbone.View.extend({
|
|
170 |
});
|
171 |
|
172 |
styles = _.map( _.keys( styles ), function( href ) {
|
173 |
-
return
|
174 |
});
|
175 |
|
176 |
return styles;
|
1 |
+
var Backbone = require('backbone'),
|
2 |
+
$ = require('jquery');
|
3 |
|
4 |
/**
|
5 |
* Preview of rendered shortcode.
|
62 |
|
63 |
_.defaults( params || {}, { 'head': '', 'body': '', 'body_classes': 'shortcake shortcake-preview' });
|
64 |
|
65 |
+
var isIE = typeof tinymce != 'undefined' ? tinymce.Env.ie : false;
|
66 |
+
|
67 |
+
$iframe = $( '<iframe/>', {
|
68 |
+
src: isIE ? 'javascript:""' : '',
|
69 |
frameBorder: '0',
|
70 |
allowTransparency: 'true',
|
71 |
scrolling: 'no',
|
79 |
*/
|
80 |
$iframe.load( function() {
|
81 |
|
82 |
+
self.autoresizeIframe( $(this) );
|
83 |
|
84 |
+
var head = $(this).contents().find('head'),
|
85 |
+
body = $(this).contents().find('body');
|
86 |
|
87 |
head.html( params.head );
|
88 |
body.html( params.body );
|
98 |
* Watch for mutations in iFrame content.
|
99 |
* resize iFrame height on change.
|
100 |
*
|
101 |
+
* @param $ object $iframe
|
102 |
*/
|
103 |
autoresizeIframe: function( $iframe ) {
|
104 |
|
145 |
fetchShortcode: function( callback ) {
|
146 |
|
147 |
wp.ajax.post( 'do_shortcode', {
|
148 |
+
post_id: $( '#post_ID' ).val(),
|
149 |
shortcode: this.model.formatShortcode(),
|
150 |
nonce: shortcodeUIData.nonces.preview,
|
151 |
}).done( function( response ) {
|
165 |
getEditorStyles: function() {
|
166 |
var styles = {};
|
167 |
|
168 |
+
var editors = typeof tinymce != 'undefined' ? tinymce.editors : [];
|
169 |
+
_.each( editors, function( editor ) {
|
170 |
_.each( editor.dom.$( 'link[rel="stylesheet"]', editor.getDoc().head ), function( link ) {
|
171 |
var href;
|
172 |
( href = link.href ) && ( styles[href] = true ); // Poor man's de-duping.
|
174 |
});
|
175 |
|
176 |
styles = _.map( _.keys( styles ), function( href ) {
|
177 |
+
return $( '<link rel="stylesheet" type="text/css">' ).attr( 'href', href )[0].outerHTML;
|
178 |
});
|
179 |
|
180 |
return styles;
|
js/{views → src/views}/shortcode-ui.js
RENAMED
@@ -5,8 +5,8 @@ var Backbone = require('backbone'),
|
|
5 |
EditShortcodeForm = require('sui-views/edit-shortcode-form'),
|
6 |
Toolbar = require('sui-views/media-toolbar'),
|
7 |
SearchShortcode = require('sui-views/search-shortcode'),
|
8 |
-
sui = require('sui-utils/sui')
|
9 |
-
|
10 |
|
11 |
var Shortcode_UI = Backbone.View.extend({
|
12 |
|
@@ -106,7 +106,7 @@ var Shortcode_UI = Backbone.View.extend({
|
|
106 |
|
107 |
select: function(e) {
|
108 |
this.controller.props.set( 'action', 'insert' );
|
109 |
-
var target =
|
110 |
var shortcode = sui.shortcodes.findWhere( { shortcode_tag: target.attr( 'data-shortcode' ) } );
|
111 |
|
112 |
if ( ! shortcode ) {
|
5 |
EditShortcodeForm = require('sui-views/edit-shortcode-form'),
|
6 |
Toolbar = require('sui-views/media-toolbar'),
|
7 |
SearchShortcode = require('sui-views/search-shortcode'),
|
8 |
+
sui = require('sui-utils/sui'),
|
9 |
+
$ = require('jquery');
|
10 |
|
11 |
var Shortcode_UI = Backbone.View.extend({
|
12 |
|
106 |
|
107 |
select: function(e) {
|
108 |
this.controller.props.set( 'action', 'insert' );
|
109 |
+
var target = $(e.currentTarget).closest( '.shortcode-list-item' );
|
110 |
var shortcode = sui.shortcodes.findWhere( { shortcode_tag: target.attr( 'data-shortcode' ) } );
|
111 |
|
112 |
if ( ! shortcode ) {
|
js/{views → src/views}/tabbed-view.js
RENAMED
@@ -1,5 +1,6 @@
|
|
1 |
var Backbone = require('backbone');
|
2 |
var sui = require('sui-utils/sui');
|
|
|
3 |
|
4 |
/**
|
5 |
* Abstraction to manage tabbed content. Tab parameters (e.g., label) along with
|
@@ -72,7 +73,7 @@ var TabbedView = Backbone.View.extend({
|
|
72 |
event.stopPropagation();
|
73 |
event.preventDefault();
|
74 |
|
75 |
-
var target =
|
76 |
|
77 |
this.select(target);
|
78 |
},
|
1 |
var Backbone = require('backbone');
|
2 |
var sui = require('sui-utils/sui');
|
3 |
+
var $ = require('jquery');
|
4 |
|
5 |
/**
|
6 |
* Abstraction to manage tabbed content. Tab parameters (e.g., label) along with
|
73 |
event.stopPropagation();
|
74 |
event.preventDefault();
|
75 |
|
76 |
+
var target = $(event.currentTarget).attr('data-target');
|
77 |
|
78 |
this.select(target);
|
79 |
},
|
languages/shortcode-ui-nl_NL.mo
ADDED
Binary file
|
languages/shortcode-ui-nl_NL.po
ADDED
@@ -0,0 +1,95 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
msgid ""
|
2 |
+
msgstr ""
|
3 |
+
"Project-Id-Version: Shortcode UI vv0.3-beta1\n"
|
4 |
+
"Report-Msgid-Bugs-To: \n"
|
5 |
+
"POT-Creation-Date: \n"
|
6 |
+
"PO-Revision-Date: 2015-04-27 19:20:49+0000\n"
|
7 |
+
"Last-Translator: youssou <youssouhaagsman@gmail.com>\n"
|
8 |
+
"Language-Team: \n"
|
9 |
+
"MIME-Version: 1.0\n"
|
10 |
+
"Content-Type: text/plain; charset=UTF-8\n"
|
11 |
+
"Content-Transfer-Encoding: 8bit\n"
|
12 |
+
"Plural-Forms: nplurals=2; plural=n != 1;\n"
|
13 |
+
"X-Generator: CSL v1.x\n"
|
14 |
+
"X-Poedit-Language: Dutch\n"
|
15 |
+
"X-Poedit-Country: NETHERLANDS\n"
|
16 |
+
"X-Poedit-SourceCharset: utf-8\n"
|
17 |
+
"X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_ex:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2;\n"
|
18 |
+
"X-Poedit-Basepath: ../\n"
|
19 |
+
"X-Poedit-Bookmarks: \n"
|
20 |
+
"X-Poedit-SearchPath-0: .\n"
|
21 |
+
"X-Textdomain-Support: yes"
|
22 |
+
|
23 |
+
#: inc/class-shortcode-ui.php:40
|
24 |
+
#@ shortcode-ui
|
25 |
+
msgid "Inner Content"
|
26 |
+
msgstr "Ingesloten inhoud"
|
27 |
+
|
28 |
+
#: inc/class-shortcode-ui.php:105
|
29 |
+
#: inc/class-shortcode-ui.php:106
|
30 |
+
#@ shortcode-ui
|
31 |
+
msgid "Insert Post Element"
|
32 |
+
msgstr "Berichtelement invoegen"
|
33 |
+
|
34 |
+
#: inc/class-shortcode-ui.php:107
|
35 |
+
#, php-format
|
36 |
+
#@ shortcode-ui
|
37 |
+
msgid "%s Details"
|
38 |
+
msgstr "%s details"
|
39 |
+
|
40 |
+
#: inc/class-shortcode-ui.php:108
|
41 |
+
#@ shortcode-ui
|
42 |
+
msgid "Insert Element"
|
43 |
+
msgstr "Element invoegen"
|
44 |
+
|
45 |
+
#: inc/class-shortcode-ui.php:109
|
46 |
+
#@ shortcode-ui
|
47 |
+
msgid "Update"
|
48 |
+
msgstr "Updaten"
|
49 |
+
|
50 |
+
#: inc/class-shortcode-ui.php:110
|
51 |
+
#@ shortcode-ui
|
52 |
+
msgid "There are no attributes to configure for this Post Element."
|
53 |
+
msgstr "Er zijn geen attributen die bewerkt kunnen worden voor dit berichtelement."
|
54 |
+
|
55 |
+
#: inc/class-shortcode-ui.php:111
|
56 |
+
#@ shortcode-ui
|
57 |
+
msgid "Edit"
|
58 |
+
msgstr "Bewerken"
|
59 |
+
|
60 |
+
#: inc/class-shortcode-ui.php:112
|
61 |
+
#@ shortcode-ui
|
62 |
+
msgid "Preview"
|
63 |
+
msgstr "Voorbeeld"
|
64 |
+
|
65 |
+
#: inc/class-shortcode-ui.php:113
|
66 |
+
#@ shortcode-ui
|
67 |
+
msgid "Failed to load preview"
|
68 |
+
msgstr "Laden van voorbeeld mislukt"
|
69 |
+
|
70 |
+
#: inc/class-shortcode-ui.php:114
|
71 |
+
#@ shortcode-ui
|
72 |
+
msgid "Search"
|
73 |
+
msgstr "Zoeken"
|
74 |
+
|
75 |
+
#: inc/class-shortcode-ui.php:115
|
76 |
+
#@ shortcode-ui
|
77 |
+
msgid "Insert Content"
|
78 |
+
msgstr "Inhoud invoegen"
|
79 |
+
|
80 |
+
#: inc/class-shortcode-ui.php:209
|
81 |
+
#@ shortcode-ui
|
82 |
+
msgid "Something's rotten in the state of Denmark"
|
83 |
+
msgstr "Iets is er rot in Denemarkens staat"
|
84 |
+
|
85 |
+
#: inc/fields/class-field-attachment.php:47
|
86 |
+
#: inc/fields/class-field-attachment.php:48
|
87 |
+
#@ shortcode-ui
|
88 |
+
msgid "Select Attachment"
|
89 |
+
msgstr "Selecteer bijlage"
|
90 |
+
|
91 |
+
#: inc/templates/edit-form.tpl.php:3
|
92 |
+
#@ shortcode-ui
|
93 |
+
msgid "Back to list"
|
94 |
+
msgstr "Terug naar lijst"
|
95 |
+
|
languages/shortcode-ui.pot
CHANGED
@@ -2,9 +2,9 @@
|
|
2 |
# This file is distributed under the GPL v2 or later.
|
3 |
msgid ""
|
4 |
msgstr ""
|
5 |
-
"Project-Id-Version: Shortcode UI v0.
|
6 |
"Report-Msgid-Bugs-To: http://wordpress.org/support/plugin/shortcode-ui\n"
|
7 |
-
"POT-Creation-Date: 2015-
|
8 |
"MIME-Version: 1.0\n"
|
9 |
"Content-Type: text/plain; charset=utf-8\n"
|
10 |
"Content-Transfer-Encoding: 8bit\n"
|
@@ -24,43 +24,51 @@ msgstr ""
|
|
24 |
"X-Poedit-Bookmarks: \n"
|
25 |
"X-Textdomain-Support: yes\n"
|
26 |
|
27 |
-
#: inc/class-shortcode-ui.php:
|
28 |
msgid "Inner Content"
|
29 |
msgstr ""
|
30 |
|
31 |
-
#: inc/class-shortcode-ui.php:
|
32 |
msgid "Insert Post Element"
|
33 |
msgstr ""
|
34 |
|
35 |
-
#: inc/class-shortcode-ui.php:
|
36 |
-
msgid "
|
37 |
msgstr ""
|
38 |
|
39 |
-
#: inc/class-shortcode-ui.php:
|
40 |
msgid "Insert Element"
|
41 |
msgstr ""
|
42 |
|
43 |
-
#: inc/class-shortcode-ui.php:
|
44 |
msgid "Update"
|
45 |
msgstr ""
|
46 |
|
47 |
-
#: inc/class-shortcode-ui.php:
|
|
|
|
|
|
|
|
|
48 |
msgid "Edit"
|
49 |
msgstr ""
|
50 |
|
51 |
-
#: inc/class-shortcode-ui.php:
|
52 |
msgid "Preview"
|
53 |
msgstr ""
|
54 |
|
55 |
-
#: inc/class-shortcode-ui.php:
|
56 |
msgid "Failed to load preview"
|
57 |
msgstr ""
|
58 |
|
59 |
-
#: inc/class-shortcode-ui.php:
|
60 |
msgid "Search"
|
61 |
msgstr ""
|
62 |
|
63 |
-
#: inc/class-shortcode-ui.php:
|
|
|
|
|
|
|
|
|
64 |
msgid "Something's rotten in the state of Denmark"
|
65 |
msgstr ""
|
66 |
|
2 |
# This file is distributed under the GPL v2 or later.
|
3 |
msgid ""
|
4 |
msgstr ""
|
5 |
+
"Project-Id-Version: Shortcode UI v0.3-alpha\n"
|
6 |
"Report-Msgid-Bugs-To: http://wordpress.org/support/plugin/shortcode-ui\n"
|
7 |
+
"POT-Creation-Date: 2015-04-22 16:48:40+00:00\n"
|
8 |
"MIME-Version: 1.0\n"
|
9 |
"Content-Type: text/plain; charset=utf-8\n"
|
10 |
"Content-Transfer-Encoding: 8bit\n"
|
24 |
"X-Poedit-Bookmarks: \n"
|
25 |
"X-Textdomain-Support: yes\n"
|
26 |
|
27 |
+
#: inc/class-shortcode-ui.php:40
|
28 |
msgid "Inner Content"
|
29 |
msgstr ""
|
30 |
|
31 |
+
#: inc/class-shortcode-ui.php:101 inc/class-shortcode-ui.php:102
|
32 |
msgid "Insert Post Element"
|
33 |
msgstr ""
|
34 |
|
35 |
+
#: inc/class-shortcode-ui.php:103
|
36 |
+
msgid "%s Details"
|
37 |
msgstr ""
|
38 |
|
39 |
+
#: inc/class-shortcode-ui.php:104
|
40 |
msgid "Insert Element"
|
41 |
msgstr ""
|
42 |
|
43 |
+
#: inc/class-shortcode-ui.php:105
|
44 |
msgid "Update"
|
45 |
msgstr ""
|
46 |
|
47 |
+
#: inc/class-shortcode-ui.php:106
|
48 |
+
msgid "There are no attributes to configure for this Post Element."
|
49 |
+
msgstr ""
|
50 |
+
|
51 |
+
#: inc/class-shortcode-ui.php:107
|
52 |
msgid "Edit"
|
53 |
msgstr ""
|
54 |
|
55 |
+
#: inc/class-shortcode-ui.php:108
|
56 |
msgid "Preview"
|
57 |
msgstr ""
|
58 |
|
59 |
+
#: inc/class-shortcode-ui.php:109
|
60 |
msgid "Failed to load preview"
|
61 |
msgstr ""
|
62 |
|
63 |
+
#: inc/class-shortcode-ui.php:110
|
64 |
msgid "Search"
|
65 |
msgstr ""
|
66 |
|
67 |
+
#: inc/class-shortcode-ui.php:111
|
68 |
+
msgid "Insert Content"
|
69 |
+
msgstr ""
|
70 |
+
|
71 |
+
#: inc/class-shortcode-ui.php:205
|
72 |
msgid "Something's rotten in the state of Denmark"
|
73 |
msgstr ""
|
74 |
|
lib/select2/select2-spinner.gif
ADDED
Binary file
|
lib/select2/select2.css
ADDED
@@ -0,0 +1,704 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*
|
2 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
3 |
+
*/
|
4 |
+
.select2-container {
|
5 |
+
margin: 0;
|
6 |
+
position: relative;
|
7 |
+
display: inline-block;
|
8 |
+
/* inline-block for ie7 */
|
9 |
+
zoom: 1;
|
10 |
+
*display: inline;
|
11 |
+
vertical-align: middle;
|
12 |
+
}
|
13 |
+
|
14 |
+
.select2-container,
|
15 |
+
.select2-drop,
|
16 |
+
.select2-search,
|
17 |
+
.select2-search input {
|
18 |
+
/*
|
19 |
+
Force border-box so that % widths fit the parent
|
20 |
+
container without overlap because of margin/padding.
|
21 |
+
More Info : http://www.quirksmode.org/css/box.html
|
22 |
+
*/
|
23 |
+
-webkit-box-sizing: border-box; /* webkit */
|
24 |
+
-moz-box-sizing: border-box; /* firefox */
|
25 |
+
box-sizing: border-box; /* css3 */
|
26 |
+
}
|
27 |
+
|
28 |
+
.select2-container .select2-choice {
|
29 |
+
display: block;
|
30 |
+
height: 26px;
|
31 |
+
padding: 0 0 0 8px;
|
32 |
+
overflow: hidden;
|
33 |
+
position: relative;
|
34 |
+
|
35 |
+
border: 1px solid #aaa;
|
36 |
+
white-space: nowrap;
|
37 |
+
line-height: 26px;
|
38 |
+
color: #444;
|
39 |
+
text-decoration: none;
|
40 |
+
|
41 |
+
border-radius: 4px;
|
42 |
+
|
43 |
+
background-clip: padding-box;
|
44 |
+
|
45 |
+
-webkit-touch-callout: none;
|
46 |
+
-webkit-user-select: none;
|
47 |
+
-moz-user-select: none;
|
48 |
+
-ms-user-select: none;
|
49 |
+
user-select: none;
|
50 |
+
|
51 |
+
background-color: #fff;
|
52 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
53 |
+
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
54 |
+
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
55 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
56 |
+
background-image: linear-gradient(to top, #eee 0%, #fff 50%);
|
57 |
+
}
|
58 |
+
|
59 |
+
html[dir="rtl"] .select2-container .select2-choice {
|
60 |
+
padding: 0 8px 0 0;
|
61 |
+
}
|
62 |
+
|
63 |
+
.select2-container.select2-drop-above .select2-choice {
|
64 |
+
border-bottom-color: #aaa;
|
65 |
+
|
66 |
+
border-radius: 0 0 4px 4px;
|
67 |
+
|
68 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
|
69 |
+
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
70 |
+
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
71 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
72 |
+
background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
|
73 |
+
}
|
74 |
+
|
75 |
+
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
76 |
+
margin-right: 42px;
|
77 |
+
}
|
78 |
+
|
79 |
+
.select2-container .select2-choice > .select2-chosen {
|
80 |
+
margin-right: 26px;
|
81 |
+
display: block;
|
82 |
+
overflow: hidden;
|
83 |
+
|
84 |
+
white-space: nowrap;
|
85 |
+
|
86 |
+
text-overflow: ellipsis;
|
87 |
+
float: none;
|
88 |
+
width: auto;
|
89 |
+
}
|
90 |
+
|
91 |
+
html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
|
92 |
+
margin-left: 26px;
|
93 |
+
margin-right: 0;
|
94 |
+
}
|
95 |
+
|
96 |
+
.select2-container .select2-choice abbr {
|
97 |
+
display: none;
|
98 |
+
width: 12px;
|
99 |
+
height: 12px;
|
100 |
+
position: absolute;
|
101 |
+
right: 24px;
|
102 |
+
top: 8px;
|
103 |
+
|
104 |
+
font-size: 1px;
|
105 |
+
text-decoration: none;
|
106 |
+
|
107 |
+
border: 0;
|
108 |
+
background: url('select2.png') right top no-repeat;
|
109 |
+
cursor: pointer;
|
110 |
+
outline: 0;
|
111 |
+
}
|
112 |
+
|
113 |
+
.select2-container.select2-allowclear .select2-choice abbr {
|
114 |
+
display: inline-block;
|
115 |
+
}
|
116 |
+
|
117 |
+
.select2-container .select2-choice abbr:hover {
|
118 |
+
background-position: right -11px;
|
119 |
+
cursor: pointer;
|
120 |
+
}
|
121 |
+
|
122 |
+
.select2-drop-mask {
|
123 |
+
border: 0;
|
124 |
+
margin: 0;
|
125 |
+
padding: 0;
|
126 |
+
position: fixed;
|
127 |
+
left: 0;
|
128 |
+
top: 0;
|
129 |
+
min-height: 100%;
|
130 |
+
min-width: 100%;
|
131 |
+
height: auto;
|
132 |
+
width: auto;
|
133 |
+
opacity: 0;
|
134 |
+
z-index: 9998;
|
135 |
+
/* styles required for IE to work */
|
136 |
+
background-color: #fff;
|
137 |
+
filter: alpha(opacity=0);
|
138 |
+
}
|
139 |
+
|
140 |
+
.select2-drop {
|
141 |
+
width: 100%;
|
142 |
+
margin-top: -1px;
|
143 |
+
position: absolute;
|
144 |
+
z-index: 9999;
|
145 |
+
top: 100%;
|
146 |
+
|
147 |
+
background: #fff;
|
148 |
+
color: #000;
|
149 |
+
border: 1px solid #aaa;
|
150 |
+
border-top: 0;
|
151 |
+
|
152 |
+
border-radius: 0 0 4px 4px;
|
153 |
+
|
154 |
+
-webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
155 |
+
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
156 |
+
}
|
157 |
+
|
158 |
+
.select2-drop.select2-drop-above {
|
159 |
+
margin-top: 1px;
|
160 |
+
border-top: 1px solid #aaa;
|
161 |
+
border-bottom: 0;
|
162 |
+
|
163 |
+
border-radius: 4px 4px 0 0;
|
164 |
+
|
165 |
+
-webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
166 |
+
box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
167 |
+
}
|
168 |
+
|
169 |
+
.select2-drop-active {
|
170 |
+
border: 1px solid #5897fb;
|
171 |
+
border-top: none;
|
172 |
+
}
|
173 |
+
|
174 |
+
.select2-drop.select2-drop-above.select2-drop-active {
|
175 |
+
border-top: 1px solid #5897fb;
|
176 |
+
}
|
177 |
+
|
178 |
+
.select2-drop-auto-width {
|
179 |
+
border-top: 1px solid #aaa;
|
180 |
+
width: auto;
|
181 |
+
}
|
182 |
+
|
183 |
+
.select2-drop-auto-width .select2-search {
|
184 |
+
padding-top: 4px;
|
185 |
+
}
|
186 |
+
|
187 |
+
.select2-container .select2-choice .select2-arrow {
|
188 |
+
display: inline-block;
|
189 |
+
width: 18px;
|
190 |
+
height: 100%;
|
191 |
+
position: absolute;
|
192 |
+
right: 0;
|
193 |
+
top: 0;
|
194 |
+
|
195 |
+
border-left: 1px solid #aaa;
|
196 |
+
border-radius: 0 4px 4px 0;
|
197 |
+
|
198 |
+
background-clip: padding-box;
|
199 |
+
|
200 |
+
background: #ccc;
|
201 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
|
202 |
+
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
203 |
+
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
204 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
205 |
+
background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
|
206 |
+
}
|
207 |
+
|
208 |
+
html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
|
209 |
+
left: 0;
|
210 |
+
right: auto;
|
211 |
+
|
212 |
+
border-left: none;
|
213 |
+
border-right: 1px solid #aaa;
|
214 |
+
border-radius: 4px 0 0 4px;
|
215 |
+
}
|
216 |
+
|
217 |
+
.select2-container .select2-choice .select2-arrow b {
|
218 |
+
display: block;
|
219 |
+
width: 100%;
|
220 |
+
height: 100%;
|
221 |
+
background: url('select2.png') no-repeat 0 1px;
|
222 |
+
}
|
223 |
+
|
224 |
+
html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
|
225 |
+
background-position: 2px 1px;
|
226 |
+
}
|
227 |
+
|
228 |
+
.select2-search {
|
229 |
+
display: inline-block;
|
230 |
+
width: 100%;
|
231 |
+
min-height: 26px;
|
232 |
+
margin: 0;
|
233 |
+
padding-left: 4px;
|
234 |
+
padding-right: 4px;
|
235 |
+
|
236 |
+
position: relative;
|
237 |
+
z-index: 10000;
|
238 |
+
|
239 |
+
white-space: nowrap;
|
240 |
+
}
|
241 |
+
|
242 |
+
.select2-search input {
|
243 |
+
width: 100%;
|
244 |
+
height: auto !important;
|
245 |
+
min-height: 26px;
|
246 |
+
padding: 4px 20px 4px 5px;
|
247 |
+
margin: 0;
|
248 |
+
|
249 |
+
outline: 0;
|
250 |
+
font-family: sans-serif;
|
251 |
+
font-size: 1em;
|
252 |
+
|
253 |
+
border: 1px solid #aaa;
|
254 |
+
border-radius: 0;
|
255 |
+
|
256 |
+
-webkit-box-shadow: none;
|
257 |
+
box-shadow: none;
|
258 |
+
|
259 |
+
background: #fff url('select2.png') no-repeat 100% -22px;
|
260 |
+
background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
261 |
+
background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
262 |
+
background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
263 |
+
background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
264 |
+
}
|
265 |
+
|
266 |
+
html[dir="rtl"] .select2-search input {
|
267 |
+
padding: 4px 5px 4px 20px;
|
268 |
+
|
269 |
+
background: #fff url('select2.png') no-repeat -37px -22px;
|
270 |
+
background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
271 |
+
background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
272 |
+
background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
273 |
+
background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
274 |
+
}
|
275 |
+
|
276 |
+
.select2-drop.select2-drop-above .select2-search input {
|
277 |
+
margin-top: 4px;
|
278 |
+
}
|
279 |
+
|
280 |
+
.select2-search input.select2-active {
|
281 |
+
background: #fff url('select2-spinner.gif') no-repeat 100%;
|
282 |
+
background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
283 |
+
background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
284 |
+
background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
285 |
+
background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
286 |
+
}
|
287 |
+
|
288 |
+
.select2-container-active .select2-choice,
|
289 |
+
.select2-container-active .select2-choices {
|
290 |
+
border: 1px solid #5897fb;
|
291 |
+
outline: none;
|
292 |
+
|
293 |
+
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
294 |
+
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
295 |
+
}
|
296 |
+
|
297 |
+
.select2-dropdown-open .select2-choice {
|
298 |
+
border-bottom-color: transparent;
|
299 |
+
-webkit-box-shadow: 0 1px 0 #fff inset;
|
300 |
+
box-shadow: 0 1px 0 #fff inset;
|
301 |
+
|
302 |
+
border-bottom-left-radius: 0;
|
303 |
+
border-bottom-right-radius: 0;
|
304 |
+
|
305 |
+
background-color: #eee;
|
306 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
|
307 |
+
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
308 |
+
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
309 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
310 |
+
background-image: linear-gradient(to top, #fff 0%, #eee 50%);
|
311 |
+
}
|
312 |
+
|
313 |
+
.select2-dropdown-open.select2-drop-above .select2-choice,
|
314 |
+
.select2-dropdown-open.select2-drop-above .select2-choices {
|
315 |
+
border: 1px solid #5897fb;
|
316 |
+
border-top-color: transparent;
|
317 |
+
|
318 |
+
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
319 |
+
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
320 |
+
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
321 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
322 |
+
background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
|
323 |
+
}
|
324 |
+
|
325 |
+
.select2-dropdown-open .select2-choice .select2-arrow {
|
326 |
+
background: transparent;
|
327 |
+
border-left: none;
|
328 |
+
filter: none;
|
329 |
+
}
|
330 |
+
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
|
331 |
+
border-right: none;
|
332 |
+
}
|
333 |
+
|
334 |
+
.select2-dropdown-open .select2-choice .select2-arrow b {
|
335 |
+
background-position: -18px 1px;
|
336 |
+
}
|
337 |
+
|
338 |
+
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
|
339 |
+
background-position: -16px 1px;
|
340 |
+
}
|
341 |
+
|
342 |
+
.select2-hidden-accessible {
|
343 |
+
border: 0;
|
344 |
+
clip: rect(0 0 0 0);
|
345 |
+
height: 1px;
|
346 |
+
margin: -1px;
|
347 |
+
overflow: hidden;
|
348 |
+
padding: 0;
|
349 |
+
position: absolute;
|
350 |
+
width: 1px;
|
351 |
+
}
|
352 |
+
|
353 |
+
/* results */
|
354 |
+
.select2-results {
|
355 |
+
max-height: 200px;
|
356 |
+
padding: 0 0 0 4px;
|
357 |
+
margin: 4px 4px 4px 0;
|
358 |
+
position: relative;
|
359 |
+
overflow-x: hidden;
|
360 |
+
overflow-y: auto;
|
361 |
+
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
362 |
+
}
|
363 |
+
|
364 |
+
html[dir="rtl"] .select2-results {
|
365 |
+
padding: 0 4px 0 0;
|
366 |
+
margin: 4px 0 4px 4px;
|
367 |
+
}
|
368 |
+
|
369 |
+
.select2-results ul.select2-result-sub {
|
370 |
+
margin: 0;
|
371 |
+
padding-left: 0;
|
372 |
+
}
|
373 |
+
|
374 |
+
.select2-results li {
|
375 |
+
list-style: none;
|
376 |
+
display: list-item;
|
377 |
+
background-image: none;
|
378 |
+
}
|
379 |
+
|
380 |
+
.select2-results li.select2-result-with-children > .select2-result-label {
|
381 |
+
font-weight: bold;
|
382 |
+
}
|
383 |
+
|
384 |
+
.select2-results .select2-result-label {
|
385 |
+
padding: 3px 7px 4px;
|
386 |
+
margin: 0;
|
387 |
+
cursor: pointer;
|
388 |
+
|
389 |
+
min-height: 1em;
|
390 |
+
|
391 |
+
-webkit-touch-callout: none;
|
392 |
+
-webkit-user-select: none;
|
393 |
+
-moz-user-select: none;
|
394 |
+
-ms-user-select: none;
|
395 |
+
user-select: none;
|
396 |
+
}
|
397 |
+
|
398 |
+
.select2-results-dept-1 .select2-result-label { padding-left: 20px }
|
399 |
+
.select2-results-dept-2 .select2-result-label { padding-left: 40px }
|
400 |
+
.select2-results-dept-3 .select2-result-label { padding-left: 60px }
|
401 |
+
.select2-results-dept-4 .select2-result-label { padding-left: 80px }
|
402 |
+
.select2-results-dept-5 .select2-result-label { padding-left: 100px }
|
403 |
+
.select2-results-dept-6 .select2-result-label { padding-left: 110px }
|
404 |
+
.select2-results-dept-7 .select2-result-label { padding-left: 120px }
|
405 |
+
|
406 |
+
.select2-results .select2-highlighted {
|
407 |
+
background: #3875d7;
|
408 |
+
color: #fff;
|
409 |
+
}
|
410 |
+
|
411 |
+
.select2-results li em {
|
412 |
+
background: #feffde;
|
413 |
+
font-style: normal;
|
414 |
+
}
|
415 |
+
|
416 |
+
.select2-results .select2-highlighted em {
|
417 |
+
background: transparent;
|
418 |
+
}
|
419 |
+
|
420 |
+
.select2-results .select2-highlighted ul {
|
421 |
+
background: #fff;
|
422 |
+
color: #000;
|
423 |
+
}
|
424 |
+
|
425 |
+
.select2-results .select2-no-results,
|
426 |
+
.select2-results .select2-searching,
|
427 |
+
.select2-results .select2-ajax-error,
|
428 |
+
.select2-results .select2-selection-limit {
|
429 |
+
background: #f4f4f4;
|
430 |
+
display: list-item;
|
431 |
+
padding-left: 5px;
|
432 |
+
}
|
433 |
+
|
434 |
+
/*
|
435 |
+
disabled look for disabled choices in the results dropdown
|
436 |
+
*/
|
437 |
+
.select2-results .select2-disabled.select2-highlighted {
|
438 |
+
color: #666;
|
439 |
+
background: #f4f4f4;
|
440 |
+
display: list-item;
|
441 |
+
cursor: default;
|
442 |
+
}
|
443 |
+
.select2-results .select2-disabled {
|
444 |
+
background: #f4f4f4;
|
445 |
+
display: list-item;
|
446 |
+
cursor: default;
|
447 |
+
}
|
448 |
+
|
449 |
+
.select2-results .select2-selected {
|
450 |
+
display: none;
|
451 |
+
}
|
452 |
+
|
453 |
+
.select2-more-results.select2-active {
|
454 |
+
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
455 |
+
}
|
456 |
+
|
457 |
+
.select2-results .select2-ajax-error {
|
458 |
+
background: rgba(255, 50, 50, .2);
|
459 |
+
}
|
460 |
+
|
461 |
+
.select2-more-results {
|
462 |
+
background: #f4f4f4;
|
463 |
+
display: list-item;
|
464 |
+
}
|
465 |
+
|
466 |
+
/* disabled styles */
|
467 |
+
|
468 |
+
.select2-container.select2-container-disabled .select2-choice {
|
469 |
+
background-color: #f4f4f4;
|
470 |
+
background-image: none;
|
471 |
+
border: 1px solid #ddd;
|
472 |
+
cursor: default;
|
473 |
+
}
|
474 |
+
|
475 |
+
.select2-container.select2-container-disabled .select2-choice .select2-arrow {
|
476 |
+
background-color: #f4f4f4;
|
477 |
+
background-image: none;
|
478 |
+
border-left: 0;
|
479 |
+
}
|
480 |
+
|
481 |
+
.select2-container.select2-container-disabled .select2-choice abbr {
|
482 |
+
display: none;
|
483 |
+
}
|
484 |
+
|
485 |
+
|
486 |
+
/* multiselect */
|
487 |
+
|
488 |
+
.select2-container-multi .select2-choices {
|
489 |
+
height: auto !important;
|
490 |
+
height: 1%;
|
491 |
+
margin: 0;
|
492 |
+
padding: 0 5px 0 0;
|
493 |
+
position: relative;
|
494 |
+
|
495 |
+
border: 1px solid #aaa;
|
496 |
+
cursor: text;
|
497 |
+
overflow: hidden;
|
498 |
+
|
499 |
+
background-color: #fff;
|
500 |
+
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
|
501 |
+
background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
|
502 |
+
background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
|
503 |
+
background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
|
504 |
+
}
|
505 |
+
|
506 |
+
html[dir="rtl"] .select2-container-multi .select2-choices {
|
507 |
+
padding: 0 0 0 5px;
|
508 |
+
}
|
509 |
+
|
510 |
+
.select2-locked {
|
511 |
+
padding: 3px 5px 3px 5px !important;
|
512 |
+
}
|
513 |
+
|
514 |
+
.select2-container-multi .select2-choices {
|
515 |
+
min-height: 26px;
|
516 |
+
}
|
517 |
+
|
518 |
+
.select2-container-multi.select2-container-active .select2-choices {
|
519 |
+
border: 1px solid #5897fb;
|
520 |
+
outline: none;
|
521 |
+
|
522 |
+
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
523 |
+
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
524 |
+
}
|
525 |
+
.select2-container-multi .select2-choices li {
|
526 |
+
float: left;
|
527 |
+
list-style: none;
|
528 |
+
}
|
529 |
+
html[dir="rtl"] .select2-container-multi .select2-choices li
|
530 |
+
{
|
531 |
+
float: right;
|
532 |
+
}
|
533 |
+
.select2-container-multi .select2-choices .select2-search-field {
|
534 |
+
margin: 0;
|
535 |
+
padding: 0;
|
536 |
+
white-space: nowrap;
|
537 |
+
}
|
538 |
+
|
539 |
+
.select2-container-multi .select2-choices .select2-search-field input {
|
540 |
+
padding: 5px;
|
541 |
+
margin: 1px 0;
|
542 |
+
|
543 |
+
font-family: sans-serif;
|
544 |
+
font-size: 100%;
|
545 |
+
color: #666;
|
546 |
+
outline: 0;
|
547 |
+
border: 0;
|
548 |
+
-webkit-box-shadow: none;
|
549 |
+
box-shadow: none;
|
550 |
+
background: transparent !important;
|
551 |
+
}
|
552 |
+
|
553 |
+
.select2-container-multi .select2-choices .select2-search-field input.select2-active {
|
554 |
+
background: #fff url('select2-spinner.gif') no-repeat 100% !important;
|
555 |
+
}
|
556 |
+
|
557 |
+
.select2-default {
|
558 |
+
color: #999 !important;
|
559 |
+
}
|
560 |
+
|
561 |
+
.select2-container-multi .select2-choices .select2-search-choice {
|
562 |
+
padding: 3px 5px 3px 18px;
|
563 |
+
margin: 3px 0 3px 5px;
|
564 |
+
position: relative;
|
565 |
+
|
566 |
+
line-height: 13px;
|
567 |
+
color: #333;
|
568 |
+
cursor: default;
|
569 |
+
border: 1px solid #aaaaaa;
|
570 |
+
|
571 |
+
border-radius: 3px;
|
572 |
+
|
573 |
+
-webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
574 |
+
box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
575 |
+
|
576 |
+
background-clip: padding-box;
|
577 |
+
|
578 |
+
-webkit-touch-callout: none;
|
579 |
+
-webkit-user-select: none;
|
580 |
+
-moz-user-select: none;
|
581 |
+
-ms-user-select: none;
|
582 |
+
user-select: none;
|
583 |
+
|
584 |
+
background-color: #e4e4e4;
|
585 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
|
586 |
+
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
|
587 |
+
background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
588 |
+
background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
589 |
+
background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
590 |
+
}
|
591 |
+
html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
|
592 |
+
{
|
593 |
+
margin: 3px 5px 3px 0;
|
594 |
+
padding: 3px 18px 3px 5px;
|
595 |
+
}
|
596 |
+
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
597 |
+
cursor: default;
|
598 |
+
}
|
599 |
+
.select2-container-multi .select2-choices .select2-search-choice-focus {
|
600 |
+
background: #d4d4d4;
|
601 |
+
}
|
602 |
+
|
603 |
+
.select2-search-choice-close {
|
604 |
+
display: block;
|
605 |
+
width: 12px;
|
606 |
+
height: 13px;
|
607 |
+
position: absolute;
|
608 |
+
right: 3px;
|
609 |
+
top: 4px;
|
610 |
+
|
611 |
+
font-size: 1px;
|
612 |
+
outline: none;
|
613 |
+
background: url('select2.png') right top no-repeat;
|
614 |
+
}
|
615 |
+
html[dir="rtl"] .select2-search-choice-close {
|
616 |
+
right: auto;
|
617 |
+
left: 3px;
|
618 |
+
}
|
619 |
+
|
620 |
+
.select2-container-multi .select2-search-choice-close {
|
621 |
+
left: 3px;
|
622 |
+
}
|
623 |
+
|
624 |
+
html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
|
625 |
+
left: auto;
|
626 |
+
right: 2px;
|
627 |
+
}
|
628 |
+
|
629 |
+
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
630 |
+
background-position: right -11px;
|
631 |
+
}
|
632 |
+
.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
|
633 |
+
background-position: right -11px;
|
634 |
+
}
|
635 |
+
|
636 |
+
/* disabled styles */
|
637 |
+
.select2-container-multi.select2-container-disabled .select2-choices {
|
638 |
+
background-color: #f4f4f4;
|
639 |
+
background-image: none;
|
640 |
+
border: 1px solid #ddd;
|
641 |
+
cursor: default;
|
642 |
+
}
|
643 |
+
|
644 |
+
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
|
645 |
+
padding: 3px 5px 3px 5px;
|
646 |
+
border: 1px solid #ddd;
|
647 |
+
background-image: none;
|
648 |
+
background-color: #f4f4f4;
|
649 |
+
}
|
650 |
+
|
651 |
+
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
|
652 |
+
background: none;
|
653 |
+
}
|
654 |
+
/* end multiselect */
|
655 |
+
|
656 |
+
|
657 |
+
.select2-result-selectable .select2-match,
|
658 |
+
.select2-result-unselectable .select2-match {
|
659 |
+
text-decoration: underline;
|
660 |
+
}
|
661 |
+
|
662 |
+
.select2-offscreen, .select2-offscreen:focus {
|
663 |
+
clip: rect(0 0 0 0) !important;
|
664 |
+
width: 1px !important;
|
665 |
+
height: 1px !important;
|
666 |
+
border: 0 !important;
|
667 |
+
margin: 0 !important;
|
668 |
+
padding: 0 !important;
|
669 |
+
overflow: hidden !important;
|
670 |
+
position: absolute !important;
|
671 |
+
outline: 0 !important;
|
672 |
+
left: 0px !important;
|
673 |
+
top: 0px !important;
|
674 |
+
}
|
675 |
+
|
676 |
+
.select2-display-none {
|
677 |
+
display: none;
|
678 |
+
}
|
679 |
+
|
680 |
+
.select2-measure-scrollbar {
|
681 |
+
position: absolute;
|
682 |
+
top: -10000px;
|
683 |
+
left: -10000px;
|
684 |
+
width: 100px;
|
685 |
+
height: 100px;
|
686 |
+
overflow: scroll;
|
687 |
+
}
|
688 |
+
|
689 |
+
/* Retina-ize icons */
|
690 |
+
|
691 |
+
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
|
692 |
+
.select2-search input,
|
693 |
+
.select2-search-choice-close,
|
694 |
+
.select2-container .select2-choice abbr,
|
695 |
+
.select2-container .select2-choice .select2-arrow b {
|
696 |
+
background-image: url('select2x2.png') !important;
|
697 |
+
background-repeat: no-repeat !important;
|
698 |
+
background-size: 60px 40px !important;
|
699 |
+
}
|
700 |
+
|
701 |
+
.select2-search input {
|
702 |
+
background-position: 100% -21px !important;
|
703 |
+
}
|
704 |
+
}
|
lib/select2/select2.js
ADDED
@@ -0,0 +1,3541 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*
|
2 |
+
Copyright 2012 Igor Vaynberg
|
3 |
+
|
4 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
5 |
+
|
6 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
7 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
8 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
9 |
+
License or the GPL License.
|
10 |
+
|
11 |
+
You may obtain a copy of the Apache License and the GPL License at:
|
12 |
+
|
13 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
14 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
15 |
+
|
16 |
+
Unless required by applicable law or agreed to in writing, software distributed under the
|
17 |
+
Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
|
18 |
+
CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
|
19 |
+
the specific language governing permissions and limitations under the Apache License and the GPL License.
|
20 |
+
*/
|
21 |
+
(function ($) {
|
22 |
+
if(typeof $.fn.each2 == "undefined") {
|
23 |
+
$.extend($.fn, {
|
24 |
+
/*
|
25 |
+
* 4-10 times faster .each replacement
|
26 |
+
* use it carefully, as it overrides jQuery context of element on each iteration
|
27 |
+
*/
|
28 |
+
each2 : function (c) {
|
29 |
+
var j = $([0]), i = -1, l = this.length;
|
30 |
+
while (
|
31 |
+
++i < l
|
32 |
+
&& (j.context = j[0] = this[i])
|
33 |
+
&& c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
|
34 |
+
);
|
35 |
+
return this;
|
36 |
+
}
|
37 |
+
});
|
38 |
+
}
|
39 |
+
})(jQuery);
|
40 |
+
|
41 |
+
(function ($, undefined) {
|
42 |
+
"use strict";
|
43 |
+
/*global document, window, jQuery, console */
|
44 |
+
|
45 |
+
if (window.Select2 !== undefined) {
|
46 |
+
return;
|
47 |
+
}
|
48 |
+
|
49 |
+
var AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
|
50 |
+
lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
|
51 |
+
|
52 |
+
KEY = {
|
53 |
+
TAB: 9,
|
54 |
+
ENTER: 13,
|
55 |
+
ESC: 27,
|
56 |
+
SPACE: 32,
|
57 |
+
LEFT: 37,
|
58 |
+
UP: 38,
|
59 |
+
RIGHT: 39,
|
60 |
+
DOWN: 40,
|
61 |
+
SHIFT: 16,
|
62 |
+
CTRL: 17,
|
63 |
+
ALT: 18,
|
64 |
+
PAGE_UP: 33,
|
65 |
+
PAGE_DOWN: 34,
|
66 |
+
HOME: 36,
|
67 |
+
END: 35,
|
68 |
+
BACKSPACE: 8,
|
69 |
+
DELETE: 46,
|
70 |
+
isArrow: function (k) {
|
71 |
+
k = k.which ? k.which : k;
|
72 |
+
switch (k) {
|
73 |
+
case KEY.LEFT:
|
74 |
+
case KEY.RIGHT:
|
75 |
+
case KEY.UP:
|
76 |
+
case KEY.DOWN:
|
77 |
+
return true;
|
78 |
+
}
|
79 |
+
return false;
|
80 |
+
},
|
81 |
+
isControl: function (e) {
|
82 |
+
var k = e.which;
|
83 |
+
switch (k) {
|
84 |
+
case KEY.SHIFT:
|
85 |
+
case KEY.CTRL:
|
86 |
+
case KEY.ALT:
|
87 |
+
return true;
|
88 |
+
}
|
89 |
+
|
90 |
+
if (e.metaKey) return true;
|
91 |
+
|
92 |
+
return false;
|
93 |
+
},
|
94 |
+
isFunctionKey: function (k) {
|
95 |
+
k = k.which ? k.which : k;
|
96 |
+
return k >= 112 && k <= 123;
|
97 |
+
}
|
98 |
+
},
|
99 |
+
MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
|
100 |
+
|
101 |
+
DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
|
102 |
+
|
103 |
+
$document = $(document);
|
104 |
+
|
105 |
+
nextUid=(function() { var counter=1; return function() { return counter++; }; }());
|
106 |
+
|
107 |
+
|
108 |
+
function reinsertElement(element) {
|
109 |
+
var placeholder = $(document.createTextNode(''));
|
110 |
+
|
111 |
+
element.before(placeholder);
|
112 |
+
placeholder.before(element);
|
113 |
+
placeholder.remove();
|
114 |
+
}
|
115 |
+
|
116 |
+
function stripDiacritics(str) {
|
117 |
+
// Used 'uni range + named function' from http://jsperf.com/diacritics/18
|
118 |
+
function match(a) {
|
119 |
+
return DIACRITICS[a] || a;
|
120 |
+
}
|
121 |
+
|
122 |
+
return str.replace(/[^\u0000-\u007E]/g, match);
|
123 |
+
}
|
124 |
+
|
125 |
+
function indexOf(value, array) {
|
126 |
+
var i = 0, l = array.length;
|
127 |
+
for (; i < l; i = i + 1) {
|
128 |
+
if (equal(value, array[i])) return i;
|
129 |
+
}
|
130 |
+
return -1;
|
131 |
+
}
|
132 |
+
|
133 |
+
function measureScrollbar () {
|
134 |
+
var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
|
135 |
+
$template.appendTo(document.body);
|
136 |
+
|
137 |
+
var dim = {
|
138 |
+
width: $template.width() - $template[0].clientWidth,
|
139 |
+
height: $template.height() - $template[0].clientHeight
|
140 |
+
};
|
141 |
+
$template.remove();
|
142 |
+
|
143 |
+
return dim;
|
144 |
+
}
|
145 |
+
|
146 |
+
/**
|
147 |
+
* Compares equality of a and b
|
148 |
+
* @param a
|
149 |
+
* @param b
|
150 |
+
*/
|
151 |
+
function equal(a, b) {
|
152 |
+
if (a === b) return true;
|
153 |
+
if (a === undefined || b === undefined) return false;
|
154 |
+
if (a === null || b === null) return false;
|
155 |
+
// Check whether 'a' or 'b' is a string (primitive or object).
|
156 |
+
// The concatenation of an empty string (+'') converts its argument to a string's primitive.
|
157 |
+
if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
|
158 |
+
if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
|
159 |
+
return false;
|
160 |
+
}
|
161 |
+
|
162 |
+
/**
|
163 |
+
* Splits the string into an array of values, transforming each value. An empty array is returned for nulls or empty
|
164 |
+
* strings
|
165 |
+
* @param string
|
166 |
+
* @param separator
|
167 |
+
*/
|
168 |
+
function splitVal(string, separator, transform) {
|
169 |
+
var val, i, l;
|
170 |
+
if (string === null || string.length < 1) return [];
|
171 |
+
val = string.split(separator);
|
172 |
+
for (i = 0, l = val.length; i < l; i = i + 1) val[i] = transform(val[i]);
|
173 |
+
return val;
|
174 |
+
}
|
175 |
+
|
176 |
+
function getSideBorderPadding(element) {
|
177 |
+
return element.outerWidth(false) - element.width();
|
178 |
+
}
|
179 |
+
|
180 |
+
function installKeyUpChangeEvent(element) {
|
181 |
+
var key="keyup-change-value";
|
182 |
+
element.on("keydown", function () {
|
183 |
+
if ($.data(element, key) === undefined) {
|
184 |
+
$.data(element, key, element.val());
|
185 |
+
}
|
186 |
+
});
|
187 |
+
element.on("keyup", function () {
|
188 |
+
var val= $.data(element, key);
|
189 |
+
if (val !== undefined && element.val() !== val) {
|
190 |
+
$.removeData(element, key);
|
191 |
+
element.trigger("keyup-change");
|
192 |
+
}
|
193 |
+
});
|
194 |
+
}
|
195 |
+
|
196 |
+
|
197 |
+
/**
|
198 |
+
* filters mouse events so an event is fired only if the mouse moved.
|
199 |
+
*
|
200 |
+
* filters out mouse events that occur when mouse is stationary but
|
201 |
+
* the elements under the pointer are scrolled.
|
202 |
+
*/
|
203 |
+
function installFilteredMouseMove(element) {
|
204 |
+
element.on("mousemove", function (e) {
|
205 |
+
var lastpos = lastMousePosition;
|
206 |
+
if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
|
207 |
+
$(e.target).trigger("mousemove-filtered", e);
|
208 |
+
}
|
209 |
+
});
|
210 |
+
}
|
211 |
+
|
212 |
+
/**
|
213 |
+
* Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
|
214 |
+
* within the last quietMillis milliseconds.
|
215 |
+
*
|
216 |
+
* @param quietMillis number of milliseconds to wait before invoking fn
|
217 |
+
* @param fn function to be debounced
|
218 |
+
* @param ctx object to be used as this reference within fn
|
219 |
+
* @return debounced version of fn
|
220 |
+
*/
|
221 |
+
function debounce(quietMillis, fn, ctx) {
|
222 |
+
ctx = ctx || undefined;
|
223 |
+
var timeout;
|
224 |
+
return function () {
|
225 |
+
var args = arguments;
|
226 |
+
window.clearTimeout(timeout);
|
227 |
+
timeout = window.setTimeout(function() {
|
228 |
+
fn.apply(ctx, args);
|
229 |
+
}, quietMillis);
|
230 |
+
};
|
231 |
+
}
|
232 |
+
|
233 |
+
function installDebouncedScroll(threshold, element) {
|
234 |
+
var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
|
235 |
+
element.on("scroll", function (e) {
|
236 |
+
if (indexOf(e.target, element.get()) >= 0) notify(e);
|
237 |
+
});
|
238 |
+
}
|
239 |
+
|
240 |
+
function focus($el) {
|
241 |
+
if ($el[0] === document.activeElement) return;
|
242 |
+
|
243 |
+
/* set the focus in a 0 timeout - that way the focus is set after the processing
|
244 |
+
of the current event has finished - which seems like the only reliable way
|
245 |
+
to set focus */
|
246 |
+
window.setTimeout(function() {
|
247 |
+
var el=$el[0], pos=$el.val().length, range;
|
248 |
+
|
249 |
+
$el.focus();
|
250 |
+
|
251 |
+
/* make sure el received focus so we do not error out when trying to manipulate the caret.
|
252 |
+
sometimes modals or others listeners may steal it after its set */
|
253 |
+
var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
|
254 |
+
if (isVisible && el === document.activeElement) {
|
255 |
+
|
256 |
+
/* after the focus is set move the caret to the end, necessary when we val()
|
257 |
+
just before setting focus */
|
258 |
+
if(el.setSelectionRange)
|
259 |
+
{
|
260 |
+
el.setSelectionRange(pos, pos);
|
261 |
+
}
|
262 |
+
else if (el.createTextRange) {
|
263 |
+
range = el.createTextRange();
|
264 |
+
range.collapse(false);
|
265 |
+
range.select();
|
266 |
+
}
|
267 |
+
}
|
268 |
+
}, 0);
|
269 |
+
}
|
270 |
+
|
271 |
+
function getCursorInfo(el) {
|
272 |
+
el = $(el)[0];
|
273 |
+
var offset = 0;
|
274 |
+
var length = 0;
|
275 |
+
if ('selectionStart' in el) {
|
276 |
+
offset = el.selectionStart;
|
277 |
+
length = el.selectionEnd - offset;
|
278 |
+
} else if ('selection' in document) {
|
279 |
+
el.focus();
|
280 |
+
var sel = document.selection.createRange();
|
281 |
+
length = document.selection.createRange().text.length;
|
282 |
+
sel.moveStart('character', -el.value.length);
|
283 |
+
offset = sel.text.length - length;
|
284 |
+
}
|
285 |
+
return { offset: offset, length: length };
|
286 |
+
}
|
287 |
+
|
288 |
+
function killEvent(event) {
|
289 |
+
event.preventDefault();
|
290 |
+
event.stopPropagation();
|
291 |
+
}
|
292 |
+
function killEventImmediately(event) {
|
293 |
+
event.preventDefault();
|
294 |
+
event.stopImmediatePropagation();
|
295 |
+
}
|
296 |
+
|
297 |
+
function measureTextWidth(e) {
|
298 |
+
if (!sizer){
|
299 |
+
var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
|
300 |
+
sizer = $(document.createElement("div")).css({
|
301 |
+
position: "absolute",
|
302 |
+
left: "-10000px",
|
303 |
+
top: "-10000px",
|
304 |
+
display: "none",
|
305 |
+
fontSize: style.fontSize,
|
306 |
+
fontFamily: style.fontFamily,
|
307 |
+
fontStyle: style.fontStyle,
|
308 |
+
fontWeight: style.fontWeight,
|
309 |
+
letterSpacing: style.letterSpacing,
|
310 |
+
textTransform: style.textTransform,
|
311 |
+
whiteSpace: "nowrap"
|
312 |
+
});
|
313 |
+
sizer.attr("class","select2-sizer");
|
314 |
+
$(document.body).append(sizer);
|
315 |
+
}
|
316 |
+
sizer.text(e.val());
|
317 |
+
return sizer.width();
|
318 |
+
}
|
319 |
+
|
320 |
+
function syncCssClasses(dest, src, adapter) {
|
321 |
+
var classes, replacements = [], adapted;
|
322 |
+
|
323 |
+
classes = $.trim(dest.attr("class"));
|
324 |
+
|
325 |
+
if (classes) {
|
326 |
+
classes = '' + classes; // for IE which returns object
|
327 |
+
|
328 |
+
$(classes.split(/\s+/)).each2(function() {
|
329 |
+
if (this.indexOf("select2-") === 0) {
|
330 |
+
replacements.push(this);
|
331 |
+
}
|
332 |
+
});
|
333 |
+
}
|
334 |
+
|
335 |
+
classes = $.trim(src.attr("class"));
|
336 |
+
|
337 |
+
if (classes) {
|
338 |
+
classes = '' + classes; // for IE which returns object
|
339 |
+
|
340 |
+
$(classes.split(/\s+/)).each2(function() {
|
341 |
+
if (this.indexOf("select2-") !== 0) {
|
342 |
+
adapted = adapter(this);
|
343 |
+
|
344 |
+
if (adapted) {
|
345 |
+
replacements.push(adapted);
|
346 |
+
}
|
347 |
+
}
|
348 |
+
});
|
349 |
+
}
|
350 |
+
|
351 |
+
dest.attr("class", replacements.join(" "));
|
352 |
+
}
|
353 |
+
|
354 |
+
|
355 |
+
function markMatch(text, term, markup, escapeMarkup) {
|
356 |
+
var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
|
357 |
+
tl=term.length;
|
358 |
+
|
359 |
+
if (match<0) {
|
360 |
+
markup.push(escapeMarkup(text));
|
361 |
+
return;
|
362 |
+
}
|
363 |
+
|
364 |
+
markup.push(escapeMarkup(text.substring(0, match)));
|
365 |
+
markup.push("<span class='select2-match'>");
|
366 |
+
markup.push(escapeMarkup(text.substring(match, match + tl)));
|
367 |
+
markup.push("</span>");
|
368 |
+
markup.push(escapeMarkup(text.substring(match + tl, text.length)));
|
369 |
+
}
|
370 |
+
|
371 |
+
function defaultEscapeMarkup(markup) {
|
372 |
+
var replace_map = {
|
373 |
+
'\\': '\',
|
374 |
+
'&': '&',
|
375 |
+
'<': '<',
|
376 |
+
'>': '>',
|
377 |
+
'"': '"',
|
378 |
+
"'": ''',
|
379 |
+
"/": '/'
|
380 |
+
};
|
381 |
+
|
382 |
+
return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
|
383 |
+
return replace_map[match];
|
384 |
+
});
|
385 |
+
}
|
386 |
+
|
387 |
+
/**
|
388 |
+
* Produces an ajax-based query function
|
389 |
+
*
|
390 |
+
* @param options object containing configuration parameters
|
391 |
+
* @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
|
392 |
+
* @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
|
393 |
+
* @param options.url url for the data
|
394 |
+
* @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
|
395 |
+
* @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
|
396 |
+
* @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
|
397 |
+
* @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
|
398 |
+
* The expected format is an object containing the following keys:
|
399 |
+
* results array of objects that will be used as choices
|
400 |
+
* more (optional) boolean indicating whether there are more results available
|
401 |
+
* Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
|
402 |
+
*/
|
403 |
+
function ajax(options) {
|
404 |
+
var timeout, // current scheduled but not yet executed request
|
405 |
+
handler = null,
|
406 |
+
quietMillis = options.quietMillis || 100,
|
407 |
+
ajaxUrl = options.url,
|
408 |
+
self = this;
|
409 |
+
|
410 |
+
return function (query) {
|
411 |
+
window.clearTimeout(timeout);
|
412 |
+
timeout = window.setTimeout(function () {
|
413 |
+
var data = options.data, // ajax data function
|
414 |
+
url = ajaxUrl, // ajax url string or function
|
415 |
+
transport = options.transport || $.fn.select2.ajaxDefaults.transport,
|
416 |
+
// deprecated - to be removed in 4.0 - use params instead
|
417 |
+
deprecated = {
|
418 |
+
type: options.type || 'GET', // set type of request (GET or POST)
|
419 |
+
cache: options.cache || false,
|
420 |
+
jsonpCallback: options.jsonpCallback||undefined,
|
421 |
+
dataType: options.dataType||"json"
|
422 |
+
},
|
423 |
+
params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
|
424 |
+
|
425 |
+
data = data ? data.call(self, query.term, query.page, query.context) : null;
|
426 |
+
url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
|
427 |
+
|
428 |
+
if (handler && typeof handler.abort === "function") { handler.abort(); }
|
429 |
+
|
430 |
+
if (options.params) {
|
431 |
+
if ($.isFunction(options.params)) {
|
432 |
+
$.extend(params, options.params.call(self));
|
433 |
+
} else {
|
434 |
+
$.extend(params, options.params);
|
435 |
+
}
|
436 |
+
}
|
437 |
+
|
438 |
+
$.extend(params, {
|
439 |
+
url: url,
|
440 |
+
dataType: options.dataType,
|
441 |
+
data: data,
|
442 |
+
success: function (data) {
|
443 |
+
// TODO - replace query.page with query so users have access to term, page, etc.
|
444 |
+
// added query as third paramter to keep backwards compatibility
|
445 |
+
var results = options.results(data, query.page, query);
|
446 |
+
query.callback(results);
|
447 |
+
},
|
448 |
+
error: function(jqXHR, textStatus, errorThrown){
|
449 |
+
var results = {
|
450 |
+
hasError: true,
|
451 |
+
jqXHR: jqXHR,
|
452 |
+
textStatus: textStatus,
|
453 |
+
errorThrown: errorThrown
|
454 |
+
};
|
455 |
+
|
456 |
+
query.callback(results);
|
457 |
+
}
|
458 |
+
});
|
459 |
+
handler = transport.call(self, params);
|
460 |
+
}, quietMillis);
|
461 |
+
};
|
462 |
+
}
|
463 |
+
|
464 |
+
/**
|
465 |
+
* Produces a query function that works with a local array
|
466 |
+
*
|
467 |
+
* @param options object containing configuration parameters. The options parameter can either be an array or an
|
468 |
+
* object.
|
469 |
+
*
|
470 |
+
* If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
|
471 |
+
*
|
472 |
+
* If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
|
473 |
+
* an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
|
474 |
+
* key can either be a String in which case it is expected that each element in the 'data' array has a key with the
|
475 |
+
* value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
|
476 |
+
* the text.
|
477 |
+
*/
|
478 |
+
function local(options) {
|
479 |
+
var data = options, // data elements
|
480 |
+
dataText,
|
481 |
+
tmp,
|
482 |
+
text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
|
483 |
+
|
484 |
+
if ($.isArray(data)) {
|
485 |
+
tmp = data;
|
486 |
+
data = { results: tmp };
|
487 |
+
}
|
488 |
+
|
489 |
+
if ($.isFunction(data) === false) {
|
490 |
+
tmp = data;
|
491 |
+
data = function() { return tmp; };
|
492 |
+
}
|
493 |
+
|
494 |
+
var dataItem = data();
|
495 |
+
if (dataItem.text) {
|
496 |
+
text = dataItem.text;
|
497 |
+
// if text is not a function we assume it to be a key name
|
498 |
+
if (!$.isFunction(text)) {
|
499 |
+
dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
|
500 |
+
text = function (item) { return item[dataText]; };
|
501 |
+
}
|
502 |
+
}
|
503 |
+
|
504 |
+
return function (query) {
|
505 |
+
var t = query.term, filtered = { results: [] }, process;
|
506 |
+
if (t === "") {
|
507 |
+
query.callback(data());
|
508 |
+
return;
|
509 |
+
}
|
510 |
+
|
511 |
+
process = function(datum, collection) {
|
512 |
+
var group, attr;
|
513 |
+
datum = datum[0];
|
514 |
+
if (datum.children) {
|
515 |
+
group = {};
|
516 |
+
for (attr in datum) {
|
517 |
+
if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
|
518 |
+
}
|
519 |
+
group.children=[];
|
520 |
+
$(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
|
521 |
+
if (group.children.length || query.matcher(t, text(group), datum)) {
|
522 |
+
collection.push(group);
|
523 |
+
}
|
524 |
+
} else {
|
525 |
+
if (query.matcher(t, text(datum), datum)) {
|
526 |
+
collection.push(datum);
|
527 |
+
}
|
528 |
+
}
|
529 |
+
};
|
530 |
+
|
531 |
+
$(data().results).each2(function(i, datum) { process(datum, filtered.results); });
|
532 |
+
query.callback(filtered);
|
533 |
+
};
|
534 |
+
}
|
535 |
+
|
536 |
+
// TODO javadoc
|
537 |
+
function tags(data) {
|
538 |
+
var isFunc = $.isFunction(data);
|
539 |
+
return function (query) {
|
540 |
+
var t = query.term, filtered = {results: []};
|
541 |
+
var result = isFunc ? data(query) : data;
|
542 |
+
if ($.isArray(result)) {
|
543 |
+
$(result).each(function () {
|
544 |
+
var isObject = this.text !== undefined,
|
545 |
+
text = isObject ? this.text : this;
|
546 |
+
if (t === "" || query.matcher(t, text)) {
|
547 |
+
filtered.results.push(isObject ? this : {id: this, text: this});
|
548 |
+
}
|
549 |
+
});
|
550 |
+
query.callback(filtered);
|
551 |
+
}
|
552 |
+
};
|
553 |
+
}
|
554 |
+
|
555 |
+
/**
|
556 |
+
* Checks if the formatter function should be used.
|
557 |
+
*
|
558 |
+
* Throws an error if it is not a function. Returns true if it should be used,
|
559 |
+
* false if no formatting should be performed.
|
560 |
+
*
|
561 |
+
* @param formatter
|
562 |
+
*/
|
563 |
+
function checkFormatter(formatter, formatterName) {
|
564 |
+
if ($.isFunction(formatter)) return true;
|
565 |
+
if (!formatter) return false;
|
566 |
+
if (typeof(formatter) === 'string') return true;
|
567 |
+
throw new Error(formatterName +" must be a string, function, or falsy value");
|
568 |
+
}
|
569 |
+
|
570 |
+
/**
|
571 |
+
* Returns a given value
|
572 |
+
* If given a function, returns its output
|
573 |
+
*
|
574 |
+
* @param val string|function
|
575 |
+
* @param context value of "this" to be passed to function
|
576 |
+
* @returns {*}
|
577 |
+
*/
|
578 |
+
function evaluate(val, context) {
|
579 |
+
if ($.isFunction(val)) {
|
580 |
+
var args = Array.prototype.slice.call(arguments, 2);
|
581 |
+
return val.apply(context, args);
|
582 |
+
}
|
583 |
+
return val;
|
584 |
+
}
|
585 |
+
|
586 |
+
function countResults(results) {
|
587 |
+
var count = 0;
|
588 |
+
$.each(results, function(i, item) {
|
589 |
+
if (item.children) {
|
590 |
+
count += countResults(item.children);
|
591 |
+
} else {
|
592 |
+
count++;
|
593 |
+
}
|
594 |
+
});
|
595 |
+
return count;
|
596 |
+
}
|
597 |
+
|
598 |
+
/**
|
599 |
+
* Default tokenizer. This function uses breaks the input on substring match of any string from the
|
600 |
+
* opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
|
601 |
+
* two options have to be defined in order for the tokenizer to work.
|
602 |
+
*
|
603 |
+
* @param input text user has typed so far or pasted into the search field
|
604 |
+
* @param selection currently selected choices
|
605 |
+
* @param selectCallback function(choice) callback tho add the choice to selection
|
606 |
+
* @param opts select2's opts
|
607 |
+
* @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
|
608 |
+
*/
|
609 |
+
function defaultTokenizer(input, selection, selectCallback, opts) {
|
610 |
+
var original = input, // store the original so we can compare and know if we need to tell the search to update its text
|
611 |
+
dupe = false, // check for whether a token we extracted represents a duplicate selected choice
|
612 |
+
token, // token
|
613 |
+
index, // position at which the separator was found
|
614 |
+
i, l, // looping variables
|
615 |
+
separator; // the matched separator
|
616 |
+
|
617 |
+
if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
|
618 |
+
|
619 |
+
while (true) {
|
620 |
+
index = -1;
|
621 |
+
|
622 |
+
for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
|
623 |
+
separator = opts.tokenSeparators[i];
|
624 |
+
index = input.indexOf(separator);
|
625 |
+
if (index >= 0) break;
|
626 |
+
}
|
627 |
+
|
628 |
+
if (index < 0) break; // did not find any token separator in the input string, bail
|
629 |
+
|
630 |
+
token = input.substring(0, index);
|
631 |
+
input = input.substring(index + separator.length);
|
632 |
+
|
633 |
+
if (token.length > 0) {
|
634 |
+
token = opts.createSearchChoice.call(this, token, selection);
|
635 |
+
if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
|
636 |
+
dupe = false;
|
637 |
+
for (i = 0, l = selection.length; i < l; i++) {
|
638 |
+
if (equal(opts.id(token), opts.id(selection[i]))) {
|
639 |
+
dupe = true; break;
|
640 |
+
}
|
641 |
+
}
|
642 |
+
|
643 |
+
if (!dupe) selectCallback(token);
|
644 |
+
}
|
645 |
+
}
|
646 |
+
}
|
647 |
+
|
648 |
+
if (original!==input) return input;
|
649 |
+
}
|
650 |
+
|
651 |
+
function cleanupJQueryElements() {
|
652 |
+
var self = this;
|
653 |
+
|
654 |
+
$.each(arguments, function (i, element) {
|
655 |
+
self[element].remove();
|
656 |
+
self[element] = null;
|
657 |
+
});
|
658 |
+
}
|
659 |
+
|
660 |
+
/**
|
661 |
+
* Creates a new class
|
662 |
+
*
|
663 |
+
* @param superClass
|
664 |
+
* @param methods
|
665 |
+
*/
|
666 |
+
function clazz(SuperClass, methods) {
|
667 |
+
var constructor = function () {};
|
668 |
+
constructor.prototype = new SuperClass;
|
669 |
+
constructor.prototype.constructor = constructor;
|
670 |
+
constructor.prototype.parent = SuperClass.prototype;
|
671 |
+
constructor.prototype = $.extend(constructor.prototype, methods);
|
672 |
+
return constructor;
|
673 |
+
}
|
674 |
+
|
675 |
+
AbstractSelect2 = clazz(Object, {
|
676 |
+
|
677 |
+
// abstract
|
678 |
+
bind: function (func) {
|
679 |
+
var self = this;
|
680 |
+
return function () {
|
681 |
+
func.apply(self, arguments);
|
682 |
+
};
|
683 |
+
},
|
684 |
+
|
685 |
+
// abstract
|
686 |
+
init: function (opts) {
|
687 |
+
var results, search, resultsSelector = ".select2-results";
|
688 |
+
|
689 |
+
// prepare options
|
690 |
+
this.opts = opts = this.prepareOpts(opts);
|
691 |
+
|
692 |
+
this.id=opts.id;
|
693 |
+
|
694 |
+
// destroy if called on an existing component
|
695 |
+
if (opts.element.data("select2") !== undefined &&
|
696 |
+
opts.element.data("select2") !== null) {
|
697 |
+
opts.element.data("select2").destroy();
|
698 |
+
}
|
699 |
+
|
700 |
+
this.container = this.createContainer();
|
701 |
+
|
702 |
+
this.liveRegion = $('.select2-hidden-accessible');
|
703 |
+
if (this.liveRegion.length == 0) {
|
704 |
+
this.liveRegion = $("<span>", {
|
705 |
+
role: "status",
|
706 |
+
"aria-live": "polite"
|
707 |
+
})
|
708 |
+
.addClass("select2-hidden-accessible")
|
709 |
+
.appendTo(document.body);
|
710 |
+
}
|
711 |
+
|
712 |
+
this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
|
713 |
+
this.containerEventName= this.containerId
|
714 |
+
.replace(/([.])/g, '_')
|
715 |
+
.replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
|
716 |
+
this.container.attr("id", this.containerId);
|
717 |
+
|
718 |
+
this.container.attr("title", opts.element.attr("title"));
|
719 |
+
|
720 |
+
this.body = $(document.body);
|
721 |
+
|
722 |
+
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
723 |
+
|
724 |
+
this.container.attr("style", opts.element.attr("style"));
|
725 |
+
this.container.css(evaluate(opts.containerCss, this.opts.element));
|
726 |
+
this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
|
727 |
+
|
728 |
+
this.elementTabIndex = this.opts.element.attr("tabindex");
|
729 |
+
|
730 |
+
// swap container for the element
|
731 |
+
this.opts.element
|
732 |
+
.data("select2", this)
|
733 |
+
.attr("tabindex", "-1")
|
734 |
+
.before(this.container)
|
735 |
+
.on("click.select2", killEvent); // do not leak click events
|
736 |
+
|
737 |
+
this.container.data("select2", this);
|
738 |
+
|
739 |
+
this.dropdown = this.container.find(".select2-drop");
|
740 |
+
|
741 |
+
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
742 |
+
|
743 |
+
this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
|
744 |
+
this.dropdown.data("select2", this);
|
745 |
+
this.dropdown.on("click", killEvent);
|
746 |
+
|
747 |
+
this.results = results = this.container.find(resultsSelector);
|
748 |
+
this.search = search = this.container.find("input.select2-input");
|
749 |
+
|
750 |
+
this.queryCount = 0;
|
751 |
+
this.resultsPage = 0;
|
752 |
+
this.context = null;
|
753 |
+
|
754 |
+
// initialize the container
|
755 |
+
this.initContainer();
|
756 |
+
|
757 |
+
this.container.on("click", killEvent);
|
758 |
+
|
759 |
+
installFilteredMouseMove(this.results);
|
760 |
+
|
761 |
+
this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
|
762 |
+
this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
|
763 |
+
this._touchEvent = true;
|
764 |
+
this.highlightUnderEvent(event);
|
765 |
+
}));
|
766 |
+
this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
|
767 |
+
this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
|
768 |
+
|
769 |
+
// Waiting for a click event on touch devices to select option and hide dropdown
|
770 |
+
// otherwise click will be triggered on an underlying element
|
771 |
+
this.dropdown.on('click', this.bind(function (event) {
|
772 |
+
if (this._touchEvent) {
|
773 |
+
this._touchEvent = false;
|
774 |
+
this.selectHighlighted();
|
775 |
+
}
|
776 |
+
}));
|
777 |
+
|
778 |
+
installDebouncedScroll(80, this.results);
|
779 |
+
this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
|
780 |
+
|
781 |
+
// do not propagate change event from the search field out of the component
|
782 |
+
$(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
783 |
+
$(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
784 |
+
|
785 |
+
// if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
|
786 |
+
if ($.fn.mousewheel) {
|
787 |
+
results.mousewheel(function (e, delta, deltaX, deltaY) {
|
788 |
+
var top = results.scrollTop();
|
789 |
+
if (deltaY > 0 && top - deltaY <= 0) {
|
790 |
+
results.scrollTop(0);
|
791 |
+
killEvent(e);
|
792 |
+
} else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
|
793 |
+
results.scrollTop(results.get(0).scrollHeight - results.height());
|
794 |
+
killEvent(e);
|
795 |
+
}
|
796 |
+
});
|
797 |
+
}
|
798 |
+
|
799 |
+
installKeyUpChangeEvent(search);
|
800 |
+
search.on("keyup-change input paste", this.bind(this.updateResults));
|
801 |
+
search.on("focus", function () { search.addClass("select2-focused"); });
|
802 |
+
search.on("blur", function () { search.removeClass("select2-focused");});
|
803 |
+
|
804 |
+
this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
|
805 |
+
if ($(e.target).closest(".select2-result-selectable").length > 0) {
|
806 |
+
this.highlightUnderEvent(e);
|
807 |
+
this.selectHighlighted(e);
|
808 |
+
}
|
809 |
+
}));
|
810 |
+
|
811 |
+
// trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
|
812 |
+
// for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
|
813 |
+
// dom it will trigger the popup close, which is not what we want
|
814 |
+
// focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
|
815 |
+
this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
|
816 |
+
|
817 |
+
this.nextSearchTerm = undefined;
|
818 |
+
|
819 |
+
if ($.isFunction(this.opts.initSelection)) {
|
820 |
+
// initialize selection based on the current value of the source element
|
821 |
+
this.initSelection();
|
822 |
+
|
823 |
+
// if the user has provided a function that can set selection based on the value of the source element
|
824 |
+
// we monitor the change event on the element and trigger it, allowing for two way synchronization
|
825 |
+
this.monitorSource();
|
826 |
+
}
|
827 |
+
|
828 |
+
if (opts.maximumInputLength !== null) {
|
829 |
+
this.search.attr("maxlength", opts.maximumInputLength);
|
830 |
+
}
|
831 |
+
|
832 |
+
var disabled = opts.element.prop("disabled");
|
833 |
+
if (disabled === undefined) disabled = false;
|
834 |
+
this.enable(!disabled);
|
835 |
+
|
836 |
+
var readonly = opts.element.prop("readonly");
|
837 |
+
if (readonly === undefined) readonly = false;
|
838 |
+
this.readonly(readonly);
|
839 |
+
|
840 |
+
// Calculate size of scrollbar
|
841 |
+
scrollBarDimensions = scrollBarDimensions || measureScrollbar();
|
842 |
+
|
843 |
+
this.autofocus = opts.element.prop("autofocus");
|
844 |
+
opts.element.prop("autofocus", false);
|
845 |
+
if (this.autofocus) this.focus();
|
846 |
+
|
847 |
+
this.search.attr("placeholder", opts.searchInputPlaceholder);
|
848 |
+
},
|
849 |
+
|
850 |
+
// abstract
|
851 |
+
destroy: function () {
|
852 |
+
var element=this.opts.element, select2 = element.data("select2"), self = this;
|
853 |
+
|
854 |
+
this.close();
|
855 |
+
|
856 |
+
if (element.length && element[0].detachEvent && self._sync) {
|
857 |
+
element.each(function () {
|
858 |
+
if (self._sync) {
|
859 |
+
this.detachEvent("onpropertychange", self._sync);
|
860 |
+
}
|
861 |
+
});
|
862 |
+
}
|
863 |
+
if (this.propertyObserver) {
|
864 |
+
this.propertyObserver.disconnect();
|
865 |
+
this.propertyObserver = null;
|
866 |
+
}
|
867 |
+
this._sync = null;
|
868 |
+
|
869 |
+
if (select2 !== undefined) {
|
870 |
+
select2.container.remove();
|
871 |
+
select2.liveRegion.remove();
|
872 |
+
select2.dropdown.remove();
|
873 |
+
element
|
874 |
+
.show()
|
875 |
+
.removeData("select2")
|
876 |
+
.off(".select2")
|
877 |
+
.prop("autofocus", this.autofocus || false);
|
878 |
+
if (this.elementTabIndex) {
|
879 |
+
element.attr({tabindex: this.elementTabIndex});
|
880 |
+
} else {
|
881 |
+
element.removeAttr("tabindex");
|
882 |
+
}
|
883 |
+
element.show();
|
884 |
+
}
|
885 |
+
|
886 |
+
cleanupJQueryElements.call(this,
|
887 |
+
"container",
|
888 |
+
"liveRegion",
|
889 |
+
"dropdown",
|
890 |
+
"results",
|
891 |
+
"search"
|
892 |
+
);
|
893 |
+
},
|
894 |
+
|
895 |
+
// abstract
|
896 |
+
optionToData: function(element) {
|
897 |
+
if (element.is("option")) {
|
898 |
+
return {
|
899 |
+
id:element.prop("value"),
|
900 |
+
text:element.text(),
|
901 |
+
element: element.get(),
|
902 |
+
css: element.attr("class"),
|
903 |
+
disabled: element.prop("disabled"),
|
904 |
+
locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
|
905 |
+
};
|
906 |
+
} else if (element.is("optgroup")) {
|
907 |
+
return {
|
908 |
+
text:element.attr("label"),
|
909 |
+
children:[],
|
910 |
+
element: element.get(),
|
911 |
+
css: element.attr("class")
|
912 |
+
};
|
913 |
+
}
|
914 |
+
},
|
915 |
+
|
916 |
+
// abstract
|
917 |
+
prepareOpts: function (opts) {
|
918 |
+
var element, select, idKey, ajaxUrl, self = this;
|
919 |
+
|
920 |
+
element = opts.element;
|
921 |
+
|
922 |
+
if (element.get(0).tagName.toLowerCase() === "select") {
|
923 |
+
this.select = select = opts.element;
|
924 |
+
}
|
925 |
+
|
926 |
+
if (select) {
|
927 |
+
// these options are not allowed when attached to a select because they are picked up off the element itself
|
928 |
+
$.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
|
929 |
+
if (this in opts) {
|
930 |
+
throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
|
931 |
+
}
|
932 |
+
});
|
933 |
+
}
|
934 |
+
|
935 |
+
opts = $.extend({}, {
|
936 |
+
populateResults: function(container, results, query) {
|
937 |
+
var populate, id=this.opts.id, liveRegion=this.liveRegion;
|
938 |
+
|
939 |
+
populate=function(results, container, depth) {
|
940 |
+
|
941 |
+
var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
|
942 |
+
|
943 |
+
results = opts.sortResults(results, container, query);
|
944 |
+
|
945 |
+
// collect the created nodes for bulk append
|
946 |
+
var nodes = [];
|
947 |
+
for (i = 0, l = results.length; i < l; i = i + 1) {
|
948 |
+
|
949 |
+
result=results[i];
|
950 |
+
|
951 |
+
disabled = (result.disabled === true);
|
952 |
+
selectable = (!disabled) && (id(result) !== undefined);
|
953 |
+
|
954 |
+
compound=result.children && result.children.length > 0;
|
955 |
+
|
956 |
+
node=$("<li></li>");
|
957 |
+
node.addClass("select2-results-dept-"+depth);
|
958 |
+
node.addClass("select2-result");
|
959 |
+
node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
|
960 |
+
if (disabled) { node.addClass("select2-disabled"); }
|
961 |
+
if (compound) { node.addClass("select2-result-with-children"); }
|
962 |
+
node.addClass(self.opts.formatResultCssClass(result));
|
963 |
+
node.attr("role", "presentation");
|
964 |
+
|
965 |
+
label=$(document.createElement("div"));
|
966 |
+
label.addClass("select2-result-label");
|
967 |
+
label.attr("id", "select2-result-label-" + nextUid());
|
968 |
+
label.attr("role", "option");
|
969 |
+
|
970 |
+
formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
|
971 |
+
if (formatted!==undefined) {
|
972 |
+
label.html(formatted);
|
973 |
+
node.append(label);
|
974 |
+
}
|
975 |
+
|
976 |
+
|
977 |
+
if (compound) {
|
978 |
+
|
979 |
+
innerContainer=$("<ul></ul>");
|
980 |
+
innerContainer.addClass("select2-result-sub");
|
981 |
+
populate(result.children, innerContainer, depth+1);
|
982 |
+
node.append(innerContainer);
|
983 |
+
}
|
984 |
+
|
985 |
+
node.data("select2-data", result);
|
986 |
+
nodes.push(node[0]);
|
987 |
+
}
|
988 |
+
|
989 |
+
// bulk append the created nodes
|
990 |
+
container.append(nodes);
|
991 |
+
liveRegion.text(opts.formatMatches(results.length));
|
992 |
+
};
|
993 |
+
|
994 |
+
populate(results, container, 0);
|
995 |
+
}
|
996 |
+
}, $.fn.select2.defaults, opts);
|
997 |
+
|
998 |
+
if (typeof(opts.id) !== "function") {
|
999 |
+
idKey = opts.id;
|
1000 |
+
opts.id = function (e) { return e[idKey]; };
|
1001 |
+
}
|
1002 |
+
|
1003 |
+
if ($.isArray(opts.element.data("select2Tags"))) {
|
1004 |
+
if ("tags" in opts) {
|
1005 |
+
throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
|
1006 |
+
}
|
1007 |
+
opts.tags=opts.element.data("select2Tags");
|
1008 |
+
}
|
1009 |
+
|
1010 |
+
if (select) {
|
1011 |
+
opts.query = this.bind(function (query) {
|
1012 |
+
var data = { results: [], more: false },
|
1013 |
+
term = query.term,
|
1014 |
+
children, placeholderOption, process;
|
1015 |
+
|
1016 |
+
process=function(element, collection) {
|
1017 |
+
var group;
|
1018 |
+
if (element.is("option")) {
|
1019 |
+
if (query.matcher(term, element.text(), element)) {
|
1020 |
+
collection.push(self.optionToData(element));
|
1021 |
+
}
|
1022 |
+
} else if (element.is("optgroup")) {
|
1023 |
+
group=self.optionToData(element);
|
1024 |
+
element.children().each2(function(i, elm) { process(elm, group.children); });
|
1025 |
+
if (group.children.length>0) {
|
1026 |
+
collection.push(group);
|
1027 |
+
}
|
1028 |
+
}
|
1029 |
+
};
|
1030 |
+
|
1031 |
+
children=element.children();
|
1032 |
+
|
1033 |
+
// ignore the placeholder option if there is one
|
1034 |
+
if (this.getPlaceholder() !== undefined && children.length > 0) {
|
1035 |
+
placeholderOption = this.getPlaceholderOption();
|
1036 |
+
if (placeholderOption) {
|
1037 |
+
children=children.not(placeholderOption);
|
1038 |
+
}
|
1039 |
+
}
|
1040 |
+
|
1041 |
+
children.each2(function(i, elm) { process(elm, data.results); });
|
1042 |
+
|
1043 |
+
query.callback(data);
|
1044 |
+
});
|
1045 |
+
// this is needed because inside val() we construct choices from options and their id is hardcoded
|
1046 |
+
opts.id=function(e) { return e.id; };
|
1047 |
+
} else {
|
1048 |
+
if (!("query" in opts)) {
|
1049 |
+
|
1050 |
+
if ("ajax" in opts) {
|
1051 |
+
ajaxUrl = opts.element.data("ajax-url");
|
1052 |
+
if (ajaxUrl && ajaxUrl.length > 0) {
|
1053 |
+
opts.ajax.url = ajaxUrl;
|
1054 |
+
}
|
1055 |
+
opts.query = ajax.call(opts.element, opts.ajax);
|
1056 |
+
} else if ("data" in opts) {
|
1057 |
+
opts.query = local(opts.data);
|
1058 |
+
} else if ("tags" in opts) {
|
1059 |
+
opts.query = tags(opts.tags);
|
1060 |
+
if (opts.createSearchChoice === undefined) {
|
1061 |
+
opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
|
1062 |
+
}
|
1063 |
+
if (opts.initSelection === undefined) {
|
1064 |
+
opts.initSelection = function (element, callback) {
|
1065 |
+
var data = [];
|
1066 |
+
$(splitVal(element.val(), opts.separator, opts.transformVal)).each(function () {
|
1067 |
+
var obj = { id: this, text: this },
|
1068 |
+
tags = opts.tags;
|
1069 |
+
if ($.isFunction(tags)) tags=tags();
|
1070 |
+
$(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
|
1071 |
+
data.push(obj);
|
1072 |
+
});
|
1073 |
+
|
1074 |
+
callback(data);
|
1075 |
+
};
|
1076 |
+
}
|
1077 |
+
}
|
1078 |
+
}
|
1079 |
+
}
|
1080 |
+
if (typeof(opts.query) !== "function") {
|
1081 |
+
throw "query function not defined for Select2 " + opts.element.attr("id");
|
1082 |
+
}
|
1083 |
+
|
1084 |
+
if (opts.createSearchChoicePosition === 'top') {
|
1085 |
+
opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
|
1086 |
+
}
|
1087 |
+
else if (opts.createSearchChoicePosition === 'bottom') {
|
1088 |
+
opts.createSearchChoicePosition = function(list, item) { list.push(item); };
|
1089 |
+
}
|
1090 |
+
else if (typeof(opts.createSearchChoicePosition) !== "function") {
|
1091 |
+
throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
|
1092 |
+
}
|
1093 |
+
|
1094 |
+
return opts;
|
1095 |
+
},
|
1096 |
+
|
1097 |
+
/**
|
1098 |
+
* Monitor the original element for changes and update select2 accordingly
|
1099 |
+
*/
|
1100 |
+
// abstract
|
1101 |
+
monitorSource: function () {
|
1102 |
+
var el = this.opts.element, observer, self = this;
|
1103 |
+
|
1104 |
+
el.on("change.select2", this.bind(function (e) {
|
1105 |
+
if (this.opts.element.data("select2-change-triggered") !== true) {
|
1106 |
+
this.initSelection();
|
1107 |
+
}
|
1108 |
+
}));
|
1109 |
+
|
1110 |
+
this._sync = this.bind(function () {
|
1111 |
+
|
1112 |
+
// sync enabled state
|
1113 |
+
var disabled = el.prop("disabled");
|
1114 |
+
if (disabled === undefined) disabled = false;
|
1115 |
+
this.enable(!disabled);
|
1116 |
+
|
1117 |
+
var readonly = el.prop("readonly");
|
1118 |
+
if (readonly === undefined) readonly = false;
|
1119 |
+
this.readonly(readonly);
|
1120 |
+
|
1121 |
+
if (this.container) {
|
1122 |
+
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
1123 |
+
this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
|
1124 |
+
}
|
1125 |
+
|
1126 |
+
if (this.dropdown) {
|
1127 |
+
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
1128 |
+
this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
|
1129 |
+
}
|
1130 |
+
|
1131 |
+
});
|
1132 |
+
|
1133 |
+
// IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
|
1134 |
+
if (el.length && el[0].attachEvent) {
|
1135 |
+
el.each(function() {
|
1136 |
+
this.attachEvent("onpropertychange", self._sync);
|
1137 |
+
});
|
1138 |
+
}
|
1139 |
+
|
1140 |
+
// safari, chrome, firefox, IE11
|
1141 |
+
observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
|
1142 |
+
if (observer !== undefined) {
|
1143 |
+
if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
|
1144 |
+
this.propertyObserver = new observer(function (mutations) {
|
1145 |
+
$.each(mutations, self._sync);
|
1146 |
+
});
|
1147 |
+
this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
|
1148 |
+
}
|
1149 |
+
},
|
1150 |
+
|
1151 |
+
// abstract
|
1152 |
+
triggerSelect: function(data) {
|
1153 |
+
var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
|
1154 |
+
this.opts.element.trigger(evt);
|
1155 |
+
return !evt.isDefaultPrevented();
|
1156 |
+
},
|
1157 |
+
|
1158 |
+
/**
|
1159 |
+
* Triggers the change event on the source element
|
1160 |
+
*/
|
1161 |
+
// abstract
|
1162 |
+
triggerChange: function (details) {
|
1163 |
+
|
1164 |
+
details = details || {};
|
1165 |
+
details= $.extend({}, details, { type: "change", val: this.val() });
|
1166 |
+
// prevents recursive triggering
|
1167 |
+
this.opts.element.data("select2-change-triggered", true);
|
1168 |
+
this.opts.element.trigger(details);
|
1169 |
+
this.opts.element.data("select2-change-triggered", false);
|
1170 |
+
|
1171 |
+
// some validation frameworks ignore the change event and listen instead to keyup, click for selects
|
1172 |
+
// so here we trigger the click event manually
|
1173 |
+
this.opts.element.click();
|
1174 |
+
|
1175 |
+
// ValidationEngine ignores the change event and listens instead to blur
|
1176 |
+
// so here we trigger the blur event manually if so desired
|
1177 |
+
if (this.opts.blurOnChange)
|
1178 |
+
this.opts.element.blur();
|
1179 |
+
},
|
1180 |
+
|
1181 |
+
//abstract
|
1182 |
+
isInterfaceEnabled: function()
|
1183 |
+
{
|
1184 |
+
return this.enabledInterface === true;
|
1185 |
+
},
|
1186 |
+
|
1187 |
+
// abstract
|
1188 |
+
enableInterface: function() {
|
1189 |
+
var enabled = this._enabled && !this._readonly,
|
1190 |
+
disabled = !enabled;
|
1191 |
+
|
1192 |
+
if (enabled === this.enabledInterface) return false;
|
1193 |
+
|
1194 |
+
this.container.toggleClass("select2-container-disabled", disabled);
|
1195 |
+
this.close();
|
1196 |
+
this.enabledInterface = enabled;
|
1197 |
+
|
1198 |
+
return true;
|
1199 |
+
},
|
1200 |
+
|
1201 |
+
// abstract
|
1202 |
+
enable: function(enabled) {
|
1203 |
+
if (enabled === undefined) enabled = true;
|
1204 |
+
if (this._enabled === enabled) return;
|
1205 |
+
this._enabled = enabled;
|
1206 |
+
|
1207 |
+
this.opts.element.prop("disabled", !enabled);
|
1208 |
+
this.enableInterface();
|
1209 |
+
},
|
1210 |
+
|
1211 |
+
// abstract
|
1212 |
+
disable: function() {
|
1213 |
+
this.enable(false);
|
1214 |
+
},
|
1215 |
+
|
1216 |
+
// abstract
|
1217 |
+
readonly: function(enabled) {
|
1218 |
+
if (enabled === undefined) enabled = false;
|
1219 |
+
if (this._readonly === enabled) return;
|
1220 |
+
this._readonly = enabled;
|
1221 |
+
|
1222 |
+
this.opts.element.prop("readonly", enabled);
|
1223 |
+
this.enableInterface();
|
1224 |
+
},
|
1225 |
+
|
1226 |
+
// abstract
|
1227 |
+
opened: function () {
|
1228 |
+
return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
|
1229 |
+
},
|
1230 |
+
|
1231 |
+
// abstract
|
1232 |
+
positionDropdown: function() {
|
1233 |
+
var $dropdown = this.dropdown,
|
1234 |
+
container = this.container,
|
1235 |
+
offset = container.offset(),
|
1236 |
+
height = container.outerHeight(false),
|
1237 |
+
width = container.outerWidth(false),
|
1238 |
+
dropHeight = $dropdown.outerHeight(false),
|
1239 |
+
$window = $(window),
|
1240 |
+
windowWidth = $window.width(),
|
1241 |
+
windowHeight = $window.height(),
|
1242 |
+
viewPortRight = $window.scrollLeft() + windowWidth,
|
1243 |
+
viewportBottom = $window.scrollTop() + windowHeight,
|
1244 |
+
dropTop = offset.top + height,
|
1245 |
+
dropLeft = offset.left,
|
1246 |
+
enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
|
1247 |
+
enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
|
1248 |
+
dropWidth = $dropdown.outerWidth(false),
|
1249 |
+
enoughRoomOnRight = function() {
|
1250 |
+
return dropLeft + dropWidth <= viewPortRight;
|
1251 |
+
},
|
1252 |
+
enoughRoomOnLeft = function() {
|
1253 |
+
return offset.left + viewPortRight + container.outerWidth(false) > dropWidth;
|
1254 |
+
},
|
1255 |
+
aboveNow = $dropdown.hasClass("select2-drop-above"),
|
1256 |
+
bodyOffset,
|
1257 |
+
above,
|
1258 |
+
changeDirection,
|
1259 |
+
css,
|
1260 |
+
resultsListNode;
|
1261 |
+
|
1262 |
+
// always prefer the current above/below alignment, unless there is not enough room
|
1263 |
+
if (aboveNow) {
|
1264 |
+
above = true;
|
1265 |
+
if (!enoughRoomAbove && enoughRoomBelow) {
|
1266 |
+
changeDirection = true;
|
1267 |
+
above = false;
|
1268 |
+
}
|
1269 |
+
} else {
|
1270 |
+
above = false;
|
1271 |
+
if (!enoughRoomBelow && enoughRoomAbove) {
|
1272 |
+
changeDirection = true;
|
1273 |
+
above = true;
|
1274 |
+
}
|
1275 |
+
}
|
1276 |
+
|
1277 |
+
//if we are changing direction we need to get positions when dropdown is hidden;
|
1278 |
+
if (changeDirection) {
|
1279 |
+
$dropdown.hide();
|
1280 |
+
offset = this.container.offset();
|
1281 |
+
height = this.container.outerHeight(false);
|
1282 |
+
width = this.container.outerWidth(false);
|
1283 |
+
dropHeight = $dropdown.outerHeight(false);
|
1284 |
+
viewPortRight = $window.scrollLeft() + windowWidth;
|
1285 |
+
viewportBottom = $window.scrollTop() + windowHeight;
|
1286 |
+
dropTop = offset.top + height;
|
1287 |
+
dropLeft = offset.left;
|
1288 |
+
dropWidth = $dropdown.outerWidth(false);
|
1289 |
+
$dropdown.show();
|
1290 |
+
|
1291 |
+
// fix so the cursor does not move to the left within the search-textbox in IE
|
1292 |
+
this.focusSearch();
|
1293 |
+
}
|
1294 |
+
|
1295 |
+
if (this.opts.dropdownAutoWidth) {
|
1296 |
+
resultsListNode = $('.select2-results', $dropdown)[0];
|
1297 |
+
$dropdown.addClass('select2-drop-auto-width');
|
1298 |
+
$dropdown.css('width', '');
|
1299 |
+
// Add scrollbar width to dropdown if vertical scrollbar is present
|
1300 |
+
dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
|
1301 |
+
dropWidth > width ? width = dropWidth : dropWidth = width;
|
1302 |
+
dropHeight = $dropdown.outerHeight(false);
|
1303 |
+
}
|
1304 |
+
else {
|
1305 |
+
this.container.removeClass('select2-drop-auto-width');
|
1306 |
+
}
|
1307 |
+
|
1308 |
+
//console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
|
1309 |
+
//console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
|
1310 |
+
|
1311 |
+
// fix positioning when body has an offset and is not position: static
|
1312 |
+
if (this.body.css('position') !== 'static') {
|
1313 |
+
bodyOffset = this.body.offset();
|
1314 |
+
dropTop -= bodyOffset.top;
|
1315 |
+
dropLeft -= bodyOffset.left;
|
1316 |
+
}
|
1317 |
+
|
1318 |
+
if (!enoughRoomOnRight() && enoughRoomOnLeft()) {
|
1319 |
+
dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
|
1320 |
+
}
|
1321 |
+
|
1322 |
+
css = {
|
1323 |
+
left: dropLeft,
|
1324 |
+
width: width
|
1325 |
+
};
|
1326 |
+
|
1327 |
+
if (above) {
|
1328 |
+
css.top = offset.top - dropHeight;
|
1329 |
+
css.bottom = 'auto';
|
1330 |
+
this.container.addClass("select2-drop-above");
|
1331 |
+
$dropdown.addClass("select2-drop-above");
|
1332 |
+
}
|
1333 |
+
else {
|
1334 |
+
css.top = dropTop;
|
1335 |
+
css.bottom = 'auto';
|
1336 |
+
this.container.removeClass("select2-drop-above");
|
1337 |
+
$dropdown.removeClass("select2-drop-above");
|
1338 |
+
}
|
1339 |
+
css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
|
1340 |
+
|
1341 |
+
$dropdown.css(css);
|
1342 |
+
},
|
1343 |
+
|
1344 |
+
// abstract
|
1345 |
+
shouldOpen: function() {
|
1346 |
+
var event;
|
1347 |
+
|
1348 |
+
if (this.opened()) return false;
|
1349 |
+
|
1350 |
+
if (this._enabled === false || this._readonly === true) return false;
|
1351 |
+
|
1352 |
+
event = $.Event("select2-opening");
|
1353 |
+
this.opts.element.trigger(event);
|
1354 |
+
return !event.isDefaultPrevented();
|
1355 |
+
},
|
1356 |
+
|
1357 |
+
// abstract
|
1358 |
+
clearDropdownAlignmentPreference: function() {
|
1359 |
+
// clear the classes used to figure out the preference of where the dropdown should be opened
|
1360 |
+
this.container.removeClass("select2-drop-above");
|
1361 |
+
this.dropdown.removeClass("select2-drop-above");
|
1362 |
+
},
|
1363 |
+
|
1364 |
+
/**
|
1365 |
+
* Opens the dropdown
|
1366 |
+
*
|
1367 |
+
* @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
|
1368 |
+
* the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
|
1369 |
+
*/
|
1370 |
+
// abstract
|
1371 |
+
open: function () {
|
1372 |
+
|
1373 |
+
if (!this.shouldOpen()) return false;
|
1374 |
+
|
1375 |
+
this.opening();
|
1376 |
+
|
1377 |
+
// Only bind the document mousemove when the dropdown is visible
|
1378 |
+
$document.on("mousemove.select2Event", function (e) {
|
1379 |
+
lastMousePosition.x = e.pageX;
|
1380 |
+
lastMousePosition.y = e.pageY;
|
1381 |
+
});
|
1382 |
+
|
1383 |
+
return true;
|
1384 |
+
},
|
1385 |
+
|
1386 |
+
/**
|
1387 |
+
* Performs the opening of the dropdown
|
1388 |
+
*/
|
1389 |
+
// abstract
|
1390 |
+
opening: function() {
|
1391 |
+
var cid = this.containerEventName,
|
1392 |
+
scroll = "scroll." + cid,
|
1393 |
+
resize = "resize."+cid,
|
1394 |
+
orient = "orientationchange."+cid,
|
1395 |
+
mask;
|
1396 |
+
|
1397 |
+
this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
|
1398 |
+
|
1399 |
+
this.clearDropdownAlignmentPreference();
|
1400 |
+
|
1401 |
+
if(this.dropdown[0] !== this.body.children().last()[0]) {
|
1402 |
+
this.dropdown.detach().appendTo(this.body);
|
1403 |
+
}
|
1404 |
+
|
1405 |
+
// create the dropdown mask if doesn't already exist
|
1406 |
+
mask = $("#select2-drop-mask");
|
1407 |
+
if (mask.length === 0) {
|
1408 |
+
mask = $(document.createElement("div"));
|
1409 |
+
mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
|
1410 |
+
mask.hide();
|
1411 |
+
mask.appendTo(this.body);
|
1412 |
+
mask.on("mousedown touchstart click", function (e) {
|
1413 |
+
// Prevent IE from generating a click event on the body
|
1414 |
+
reinsertElement(mask);
|
1415 |
+
|
1416 |
+
var dropdown = $("#select2-drop"), self;
|
1417 |
+
if (dropdown.length > 0) {
|
1418 |
+
self=dropdown.data("select2");
|
1419 |
+
if (self.opts.selectOnBlur) {
|
1420 |
+
self.selectHighlighted({noFocus: true});
|
1421 |
+
}
|
1422 |
+
self.close();
|
1423 |
+
e.preventDefault();
|
1424 |
+
e.stopPropagation();
|
1425 |
+
}
|
1426 |
+
});
|
1427 |
+
}
|
1428 |
+
|
1429 |
+
// ensure the mask is always right before the dropdown
|
1430 |
+
if (this.dropdown.prev()[0] !== mask[0]) {
|
1431 |
+
this.dropdown.before(mask);
|
1432 |
+
}
|
1433 |
+
|
1434 |
+
// move the global id to the correct dropdown
|
1435 |
+
$("#select2-drop").removeAttr("id");
|
1436 |
+
this.dropdown.attr("id", "select2-drop");
|
1437 |
+
|
1438 |
+
// show the elements
|
1439 |
+
mask.show();
|
1440 |
+
|
1441 |
+
this.positionDropdown();
|
1442 |
+
this.dropdown.show();
|
1443 |
+
this.positionDropdown();
|
1444 |
+
|
1445 |
+
this.dropdown.addClass("select2-drop-active");
|
1446 |
+
|
1447 |
+
// attach listeners to events that can change the position of the container and thus require
|
1448 |
+
// the position of the dropdown to be updated as well so it does not come unglued from the container
|
1449 |
+
var that = this;
|
1450 |
+
this.container.parents().add(window).each(function () {
|
1451 |
+
$(this).on(resize+" "+scroll+" "+orient, function (e) {
|
1452 |
+
if (that.opened()) that.positionDropdown();
|
1453 |
+
});
|
1454 |
+
});
|
1455 |
+
|
1456 |
+
|
1457 |
+
},
|
1458 |
+
|
1459 |
+
// abstract
|
1460 |
+
close: function () {
|
1461 |
+
if (!this.opened()) return;
|
1462 |
+
|
1463 |
+
var cid = this.containerEventName,
|
1464 |
+
scroll = "scroll." + cid,
|
1465 |
+
resize = "resize."+cid,
|
1466 |
+
orient = "orientationchange."+cid;
|
1467 |
+
|
1468 |
+
// unbind event listeners
|
1469 |
+
this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
|
1470 |
+
|
1471 |
+
this.clearDropdownAlignmentPreference();
|
1472 |
+
|
1473 |
+
$("#select2-drop-mask").hide();
|
1474 |
+
this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
|
1475 |
+
this.dropdown.hide();
|
1476 |
+
this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
|
1477 |
+
this.results.empty();
|
1478 |
+
|
1479 |
+
// Now that the dropdown is closed, unbind the global document mousemove event
|
1480 |
+
$document.off("mousemove.select2Event");
|
1481 |
+
|
1482 |
+
this.clearSearch();
|
1483 |
+
this.search.removeClass("select2-active");
|
1484 |
+
this.opts.element.trigger($.Event("select2-close"));
|
1485 |
+
},
|
1486 |
+
|
1487 |
+
/**
|
1488 |
+
* Opens control, sets input value, and updates results.
|
1489 |
+
*/
|
1490 |
+
// abstract
|
1491 |
+
externalSearch: function (term) {
|
1492 |
+
this.open();
|
1493 |
+
this.search.val(term);
|
1494 |
+
this.updateResults(false);
|
1495 |
+
},
|
1496 |
+
|
1497 |
+
// abstract
|
1498 |
+
clearSearch: function () {
|
1499 |
+
|
1500 |
+
},
|
1501 |
+
|
1502 |
+
//abstract
|
1503 |
+
getMaximumSelectionSize: function() {
|
1504 |
+
return evaluate(this.opts.maximumSelectionSize, this.opts.element);
|
1505 |
+
},
|
1506 |
+
|
1507 |
+
// abstract
|
1508 |
+
ensureHighlightVisible: function () {
|
1509 |
+
var results = this.results, children, index, child, hb, rb, y, more, topOffset;
|
1510 |
+
|
1511 |
+
index = this.highlight();
|
1512 |
+
|
1513 |
+
if (index < 0) return;
|
1514 |
+
|
1515 |
+
if (index == 0) {
|
1516 |
+
|
1517 |
+
// if the first element is highlighted scroll all the way to the top,
|
1518 |
+
// that way any unselectable headers above it will also be scrolled
|
1519 |
+
// into view
|
1520 |
+
|
1521 |
+
results.scrollTop(0);
|
1522 |
+
return;
|
1523 |
+
}
|
1524 |
+
|
1525 |
+
children = this.findHighlightableChoices().find('.select2-result-label');
|
1526 |
+
|
1527 |
+
child = $(children[index]);
|
1528 |
+
|
1529 |
+
topOffset = (child.offset() || {}).top || 0;
|
1530 |
+
|
1531 |
+
hb = topOffset + child.outerHeight(true);
|
1532 |
+
|
1533 |
+
// if this is the last child lets also make sure select2-more-results is visible
|
1534 |
+
if (index === children.length - 1) {
|
1535 |
+
more = results.find("li.select2-more-results");
|
1536 |
+
if (more.length > 0) {
|
1537 |
+
hb = more.offset().top + more.outerHeight(true);
|
1538 |
+
}
|
1539 |
+
}
|
1540 |
+
|
1541 |
+
rb = results.offset().top + results.outerHeight(false);
|
1542 |
+
if (hb > rb) {
|
1543 |
+
results.scrollTop(results.scrollTop() + (hb - rb));
|
1544 |
+
}
|
1545 |
+
y = topOffset - results.offset().top;
|
1546 |
+
|
1547 |
+
// make sure the top of the element is visible
|
1548 |
+
if (y < 0 && child.css('display') != 'none' ) {
|
1549 |
+
results.scrollTop(results.scrollTop() + y); // y is negative
|
1550 |
+
}
|
1551 |
+
},
|
1552 |
+
|
1553 |
+
// abstract
|
1554 |
+
findHighlightableChoices: function() {
|
1555 |
+
return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
|
1556 |
+
},
|
1557 |
+
|
1558 |
+
// abstract
|
1559 |
+
moveHighlight: function (delta) {
|
1560 |
+
var choices = this.findHighlightableChoices(),
|
1561 |
+
index = this.highlight();
|
1562 |
+
|
1563 |
+
while (index > -1 && index < choices.length) {
|
1564 |
+
index += delta;
|
1565 |
+
var choice = $(choices[index]);
|
1566 |
+
if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
|
1567 |
+
this.highlight(index);
|
1568 |
+
break;
|
1569 |
+
}
|
1570 |
+
}
|
1571 |
+
},
|
1572 |
+
|
1573 |
+
// abstract
|
1574 |
+
highlight: function (index) {
|
1575 |
+
var choices = this.findHighlightableChoices(),
|
1576 |
+
choice,
|
1577 |
+
data;
|
1578 |
+
|
1579 |
+
if (arguments.length === 0) {
|
1580 |
+
return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
|
1581 |
+
}
|
1582 |
+
|
1583 |
+
if (index >= choices.length) index = choices.length - 1;
|
1584 |
+
if (index < 0) index = 0;
|
1585 |
+
|
1586 |
+
this.removeHighlight();
|
1587 |
+
|
1588 |
+
choice = $(choices[index]);
|
1589 |
+
choice.addClass("select2-highlighted");
|
1590 |
+
|
1591 |
+
// ensure assistive technology can determine the active choice
|
1592 |
+
this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
|
1593 |
+
|
1594 |
+
this.ensureHighlightVisible();
|
1595 |
+
|
1596 |
+
this.liveRegion.text(choice.text());
|
1597 |
+
|
1598 |
+
data = choice.data("select2-data");
|
1599 |
+
if (data) {
|
1600 |
+
this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
|
1601 |
+
}
|
1602 |
+
},
|
1603 |
+
|
1604 |
+
removeHighlight: function() {
|
1605 |
+
this.results.find(".select2-highlighted").removeClass("select2-highlighted");
|
1606 |
+
},
|
1607 |
+
|
1608 |
+
touchMoved: function() {
|
1609 |
+
this._touchMoved = true;
|
1610 |
+
},
|
1611 |
+
|
1612 |
+
clearTouchMoved: function() {
|
1613 |
+
this._touchMoved = false;
|
1614 |
+
},
|
1615 |
+
|
1616 |
+
// abstract
|
1617 |
+
countSelectableResults: function() {
|
1618 |
+
return this.findHighlightableChoices().length;
|
1619 |
+
},
|
1620 |
+
|
1621 |
+
// abstract
|
1622 |
+
highlightUnderEvent: function (event) {
|
1623 |
+
var el = $(event.target).closest(".select2-result-selectable");
|
1624 |
+
if (el.length > 0 && !el.is(".select2-highlighted")) {
|
1625 |
+
var choices = this.findHighlightableChoices();
|
1626 |
+
this.highlight(choices.index(el));
|
1627 |
+
} else if (el.length == 0) {
|
1628 |
+
// if we are over an unselectable item remove all highlights
|
1629 |
+
this.removeHighlight();
|
1630 |
+
}
|
1631 |
+
},
|
1632 |
+
|
1633 |
+
// abstract
|
1634 |
+
loadMoreIfNeeded: function () {
|
1635 |
+
var results = this.results,
|
1636 |
+
more = results.find("li.select2-more-results"),
|
1637 |
+
below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
|
1638 |
+
page = this.resultsPage + 1,
|
1639 |
+
self=this,
|
1640 |
+
term=this.search.val(),
|
1641 |
+
context=this.context;
|
1642 |
+
|
1643 |
+
if (more.length === 0) return;
|
1644 |
+
below = more.offset().top - results.offset().top - results.height();
|
1645 |
+
|
1646 |
+
if (below <= this.opts.loadMorePadding) {
|
1647 |
+
more.addClass("select2-active");
|
1648 |
+
this.opts.query({
|
1649 |
+
element: this.opts.element,
|
1650 |
+
term: term,
|
1651 |
+
page: page,
|
1652 |
+
context: context,
|
1653 |
+
matcher: this.opts.matcher,
|
1654 |
+
callback: this.bind(function (data) {
|
1655 |
+
|
1656 |
+
// ignore a response if the select2 has been closed before it was received
|
1657 |
+
if (!self.opened()) return;
|
1658 |
+
|
1659 |
+
|
1660 |
+
self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
|
1661 |
+
self.postprocessResults(data, false, false);
|
1662 |
+
|
1663 |
+
if (data.more===true) {
|
1664 |
+
more.detach().appendTo(results).html(self.opts.escapeMarkup(evaluate(self.opts.formatLoadMore, self.opts.element, page+1)));
|
1665 |
+
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
1666 |
+
} else {
|
1667 |
+
more.remove();
|
1668 |
+
}
|
1669 |
+
self.positionDropdown();
|
1670 |
+
self.resultsPage = page;
|
1671 |
+
self.context = data.context;
|
1672 |
+
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
1673 |
+
})});
|
1674 |
+
}
|
1675 |
+
},
|
1676 |
+
|
1677 |
+
/**
|
1678 |
+
* Default tokenizer function which does nothing
|
1679 |
+
*/
|
1680 |
+
tokenize: function() {
|
1681 |
+
|
1682 |
+
},
|
1683 |
+
|
1684 |
+
/**
|
1685 |
+
* @param initial whether or not this is the call to this method right after the dropdown has been opened
|
1686 |
+
*/
|
1687 |
+
// abstract
|
1688 |
+
updateResults: function (initial) {
|
1689 |
+
var search = this.search,
|
1690 |
+
results = this.results,
|
1691 |
+
opts = this.opts,
|
1692 |
+
data,
|
1693 |
+
self = this,
|
1694 |
+
input,
|
1695 |
+
term = search.val(),
|
1696 |
+
lastTerm = $.data(this.container, "select2-last-term"),
|
1697 |
+
// sequence number used to drop out-of-order responses
|
1698 |
+
queryNumber;
|
1699 |
+
|
1700 |
+
// prevent duplicate queries against the same term
|
1701 |
+
if (initial !== true && lastTerm && equal(term, lastTerm)) return;
|
1702 |
+
|
1703 |
+
$.data(this.container, "select2-last-term", term);
|
1704 |
+
|
1705 |
+
// if the search is currently hidden we do not alter the results
|
1706 |
+
if (initial !== true && (this.showSearchInput === false || !this.opened())) {
|
1707 |
+
return;
|
1708 |
+
}
|
1709 |
+
|
1710 |
+
function postRender() {
|
1711 |
+
search.removeClass("select2-active");
|
1712 |
+
self.positionDropdown();
|
1713 |
+
if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
|
1714 |
+
self.liveRegion.text(results.text());
|
1715 |
+
}
|
1716 |
+
else {
|
1717 |
+
self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable:not(".select2-selected")').length));
|
1718 |
+
}
|
1719 |
+
}
|
1720 |
+
|
1721 |
+
function render(html) {
|
1722 |
+
results.html(html);
|
1723 |
+
postRender();
|
1724 |
+
}
|
1725 |
+
|
1726 |
+
queryNumber = ++this.queryCount;
|
1727 |
+
|
1728 |
+
var maxSelSize = this.getMaximumSelectionSize();
|
1729 |
+
if (maxSelSize >=1) {
|
1730 |
+
data = this.data();
|
1731 |
+
if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
|
1732 |
+
render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
|
1733 |
+
return;
|
1734 |
+
}
|
1735 |
+
}
|
1736 |
+
|
1737 |
+
if (search.val().length < opts.minimumInputLength) {
|
1738 |
+
if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
|
1739 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
|
1740 |
+
} else {
|
1741 |
+
render("");
|
1742 |
+
}
|
1743 |
+
if (initial && this.showSearch) this.showSearch(true);
|
1744 |
+
return;
|
1745 |
+
}
|
1746 |
+
|
1747 |
+
if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
|
1748 |
+
if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
|
1749 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
|
1750 |
+
} else {
|
1751 |
+
render("");
|
1752 |
+
}
|
1753 |
+
return;
|
1754 |
+
}
|
1755 |
+
|
1756 |
+
if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
|
1757 |
+
render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
|
1758 |
+
}
|
1759 |
+
|
1760 |
+
search.addClass("select2-active");
|
1761 |
+
|
1762 |
+
this.removeHighlight();
|
1763 |
+
|
1764 |
+
// give the tokenizer a chance to pre-process the input
|
1765 |
+
input = this.tokenize();
|
1766 |
+
if (input != undefined && input != null) {
|
1767 |
+
search.val(input);
|
1768 |
+
}
|
1769 |
+
|
1770 |
+
this.resultsPage = 1;
|
1771 |
+
|
1772 |
+
opts.query({
|
1773 |
+
element: opts.element,
|
1774 |
+
term: search.val(),
|
1775 |
+
page: this.resultsPage,
|
1776 |
+
context: null,
|
1777 |
+
matcher: opts.matcher,
|
1778 |
+
callback: this.bind(function (data) {
|
1779 |
+
var def; // default choice
|
1780 |
+
|
1781 |
+
// ignore old responses
|
1782 |
+
if (queryNumber != this.queryCount) {
|
1783 |
+
return;
|
1784 |
+
}
|
1785 |
+
|
1786 |
+
// ignore a response if the select2 has been closed before it was received
|
1787 |
+
if (!this.opened()) {
|
1788 |
+
this.search.removeClass("select2-active");
|
1789 |
+
return;
|
1790 |
+
}
|
1791 |
+
|
1792 |
+
// handle ajax error
|
1793 |
+
if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
|
1794 |
+
render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
|
1795 |
+
return;
|
1796 |
+
}
|
1797 |
+
|
1798 |
+
// save context, if any
|
1799 |
+
this.context = (data.context===undefined) ? null : data.context;
|
1800 |
+
// create a default choice and prepend it to the list
|
1801 |
+
if (this.opts.createSearchChoice && search.val() !== "") {
|
1802 |
+
def = this.opts.createSearchChoice.call(self, search.val(), data.results);
|
1803 |
+
if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
|
1804 |
+
if ($(data.results).filter(
|
1805 |
+
function () {
|
1806 |
+
return equal(self.id(this), self.id(def));
|
1807 |
+
}).length === 0) {
|
1808 |
+
this.opts.createSearchChoicePosition(data.results, def);
|
1809 |
+
}
|
1810 |
+
}
|
1811 |
+
}
|
1812 |
+
|
1813 |
+
if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
|
1814 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
|
1815 |
+
return;
|
1816 |
+
}
|
1817 |
+
|
1818 |
+
results.empty();
|
1819 |
+
self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
|
1820 |
+
|
1821 |
+
if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
|
1822 |
+
results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
|
1823 |
+
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
1824 |
+
}
|
1825 |
+
|
1826 |
+
this.postprocessResults(data, initial);
|
1827 |
+
|
1828 |
+
postRender();
|
1829 |
+
|
1830 |
+
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
1831 |
+
})});
|
1832 |
+
},
|
1833 |
+
|
1834 |
+
// abstract
|
1835 |
+
cancel: function () {
|
1836 |
+
this.close();
|
1837 |
+
},
|
1838 |
+
|
1839 |
+
// abstract
|
1840 |
+
blur: function () {
|
1841 |
+
// if selectOnBlur == true, select the currently highlighted option
|
1842 |
+
if (this.opts.selectOnBlur)
|
1843 |
+
this.selectHighlighted({noFocus: true});
|
1844 |
+
|
1845 |
+
this.close();
|
1846 |
+
this.container.removeClass("select2-container-active");
|
1847 |
+
// synonymous to .is(':focus'), which is available in jquery >= 1.6
|
1848 |
+
if (this.search[0] === document.activeElement) { this.search.blur(); }
|
1849 |
+
this.clearSearch();
|
1850 |
+
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
1851 |
+
},
|
1852 |
+
|
1853 |
+
// abstract
|
1854 |
+
focusSearch: function () {
|
1855 |
+
focus(this.search);
|
1856 |
+
},
|
1857 |
+
|
1858 |
+
// abstract
|
1859 |
+
selectHighlighted: function (options) {
|
1860 |
+
if (this._touchMoved) {
|
1861 |
+
this.clearTouchMoved();
|
1862 |
+
return;
|
1863 |
+
}
|
1864 |
+
var index=this.highlight(),
|
1865 |
+
highlighted=this.results.find(".select2-highlighted"),
|
1866 |
+
data = highlighted.closest('.select2-result').data("select2-data");
|
1867 |
+
|
1868 |
+
if (data) {
|
1869 |
+
this.highlight(index);
|
1870 |
+
this.onSelect(data, options);
|
1871 |
+
} else if (options && options.noFocus) {
|
1872 |
+
this.close();
|
1873 |
+
}
|
1874 |
+
},
|
1875 |
+
|
1876 |
+
// abstract
|
1877 |
+
getPlaceholder: function () {
|
1878 |
+
var placeholderOption;
|
1879 |
+
return this.opts.element.attr("placeholder") ||
|
1880 |
+
this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
|
1881 |
+
this.opts.element.data("placeholder") ||
|
1882 |
+
this.opts.placeholder ||
|
1883 |
+
((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
|
1884 |
+
},
|
1885 |
+
|
1886 |
+
// abstract
|
1887 |
+
getPlaceholderOption: function() {
|
1888 |
+
if (this.select) {
|
1889 |
+
var firstOption = this.select.children('option').first();
|
1890 |
+
if (this.opts.placeholderOption !== undefined ) {
|
1891 |
+
//Determine the placeholder option based on the specified placeholderOption setting
|
1892 |
+
return (this.opts.placeholderOption === "first" && firstOption) ||
|
1893 |
+
(typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
|
1894 |
+
} else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
|
1895 |
+
//No explicit placeholder option specified, use the first if it's blank
|
1896 |
+
return firstOption;
|
1897 |
+
}
|
1898 |
+
}
|
1899 |
+
},
|
1900 |
+
|
1901 |
+
/**
|
1902 |
+
* Get the desired width for the container element. This is
|
1903 |
+
* derived first from option `width` passed to select2, then
|
1904 |
+
* the inline 'style' on the original element, and finally
|
1905 |
+
* falls back to the jQuery calculated element width.
|
1906 |
+
*/
|
1907 |
+
// abstract
|
1908 |
+
initContainerWidth: function () {
|
1909 |
+
function resolveContainerWidth() {
|
1910 |
+
var style, attrs, matches, i, l, attr;
|
1911 |
+
|
1912 |
+
if (this.opts.width === "off") {
|
1913 |
+
return null;
|
1914 |
+
} else if (this.opts.width === "element"){
|
1915 |
+
return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
|
1916 |
+
} else if (this.opts.width === "copy" || this.opts.width === "resolve") {
|
1917 |
+
// check if there is inline style on the element that contains width
|
1918 |
+
style = this.opts.element.attr('style');
|
1919 |
+
if (style !== undefined) {
|
1920 |
+
attrs = style.split(';');
|
1921 |
+
for (i = 0, l = attrs.length; i < l; i = i + 1) {
|
1922 |
+
attr = attrs[i].replace(/\s/g, '');
|
1923 |
+
matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
|
1924 |
+
if (matches !== null && matches.length >= 1)
|
1925 |
+
return matches[1];
|
1926 |
+
}
|
1927 |
+
}
|
1928 |
+
|
1929 |
+
if (this.opts.width === "resolve") {
|
1930 |
+
// next check if css('width') can resolve a width that is percent based, this is sometimes possible
|
1931 |
+
// when attached to input type=hidden or elements hidden via css
|
1932 |
+
style = this.opts.element.css('width');
|
1933 |
+
if (style.indexOf("%") > 0) return style;
|
1934 |
+
|
1935 |
+
// finally, fallback on the calculated width of the element
|
1936 |
+
return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
|
1937 |
+
}
|
1938 |
+
|
1939 |
+
return null;
|
1940 |
+
} else if ($.isFunction(this.opts.width)) {
|
1941 |
+
return this.opts.width();
|
1942 |
+
} else {
|
1943 |
+
return this.opts.width;
|
1944 |
+
}
|
1945 |
+
};
|
1946 |
+
|
1947 |
+
var width = resolveContainerWidth.call(this);
|
1948 |
+
if (width !== null) {
|
1949 |
+
this.container.css("width", width);
|
1950 |
+
}
|
1951 |
+
}
|
1952 |
+
});
|
1953 |
+
|
1954 |
+
SingleSelect2 = clazz(AbstractSelect2, {
|
1955 |
+
|
1956 |
+
// single
|
1957 |
+
|
1958 |
+
createContainer: function () {
|
1959 |
+
var container = $(document.createElement("div")).attr({
|
1960 |
+
"class": "select2-container"
|
1961 |
+
}).html([
|
1962 |
+
"<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
|
1963 |
+
" <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>",
|
1964 |
+
" <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
|
1965 |
+
"</a>",
|
1966 |
+
"<label for='' class='select2-offscreen'></label>",
|
1967 |
+
"<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
|
1968 |
+
"<div class='select2-drop select2-display-none'>",
|
1969 |
+
" <div class='select2-search'>",
|
1970 |
+
" <label for='' class='select2-offscreen'></label>",
|
1971 |
+
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
|
1972 |
+
" aria-autocomplete='list' />",
|
1973 |
+
" </div>",
|
1974 |
+
" <ul class='select2-results' role='listbox'>",
|
1975 |
+
" </ul>",
|
1976 |
+
"</div>"].join(""));
|
1977 |
+
return container;
|
1978 |
+
},
|
1979 |
+
|
1980 |
+
// single
|
1981 |
+
enableInterface: function() {
|
1982 |
+
if (this.parent.enableInterface.apply(this, arguments)) {
|
1983 |
+
this.focusser.prop("disabled", !this.isInterfaceEnabled());
|
1984 |
+
}
|
1985 |
+
},
|
1986 |
+
|
1987 |
+
// single
|
1988 |
+
opening: function () {
|
1989 |
+
var el, range, len;
|
1990 |
+
|
1991 |
+
if (this.opts.minimumResultsForSearch >= 0) {
|
1992 |
+
this.showSearch(true);
|
1993 |
+
}
|
1994 |
+
|
1995 |
+
this.parent.opening.apply(this, arguments);
|
1996 |
+
|
1997 |
+
if (this.showSearchInput !== false) {
|
1998 |
+
// IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
|
1999 |
+
// all other browsers handle this just fine
|
2000 |
+
|
2001 |
+
this.search.val(this.focusser.val());
|
2002 |
+
}
|
2003 |
+
if (this.opts.shouldFocusInput(this)) {
|
2004 |
+
this.search.focus();
|
2005 |
+
// move the cursor to the end after focussing, otherwise it will be at the beginning and
|
2006 |
+
// new text will appear *before* focusser.val()
|
2007 |
+
el = this.search.get(0);
|
2008 |
+
if (el.createTextRange) {
|
2009 |
+
range = el.createTextRange();
|
2010 |
+
range.collapse(false);
|
2011 |
+
range.select();
|
2012 |
+
} else if (el.setSelectionRange) {
|
2013 |
+
len = this.search.val().length;
|
2014 |
+
el.setSelectionRange(len, len);
|
2015 |
+
}
|
2016 |
+
}
|
2017 |
+
|
2018 |
+
// initializes search's value with nextSearchTerm (if defined by user)
|
2019 |
+
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
2020 |
+
if(this.search.val() === "") {
|
2021 |
+
if(this.nextSearchTerm != undefined){
|
2022 |
+
this.search.val(this.nextSearchTerm);
|
2023 |
+
this.search.select();
|
2024 |
+
}
|
2025 |
+
}
|
2026 |
+
|
2027 |
+
this.focusser.prop("disabled", true).val("");
|
2028 |
+
this.updateResults(true);
|
2029 |
+
this.opts.element.trigger($.Event("select2-open"));
|
2030 |
+
},
|
2031 |
+
|
2032 |
+
// single
|
2033 |
+
close: function () {
|
2034 |
+
if (!this.opened()) return;
|
2035 |
+
this.parent.close.apply(this, arguments);
|
2036 |
+
|
2037 |
+
this.focusser.prop("disabled", false);
|
2038 |
+
|
2039 |
+
if (this.opts.shouldFocusInput(this)) {
|
2040 |
+
this.focusser.focus();
|
2041 |
+
}
|
2042 |
+
},
|
2043 |
+
|
2044 |
+
// single
|
2045 |
+
focus: function () {
|
2046 |
+
if (this.opened()) {
|
2047 |
+
this.close();
|
2048 |
+
} else {
|
2049 |
+
this.focusser.prop("disabled", false);
|
2050 |
+
if (this.opts.shouldFocusInput(this)) {
|
2051 |
+
this.focusser.focus();
|
2052 |
+
}
|
2053 |
+
}
|
2054 |
+
},
|
2055 |
+
|
2056 |
+
// single
|
2057 |
+
isFocused: function () {
|
2058 |
+
return this.container.hasClass("select2-container-active");
|
2059 |
+
},
|
2060 |
+
|
2061 |
+
// single
|
2062 |
+
cancel: function () {
|
2063 |
+
this.parent.cancel.apply(this, arguments);
|
2064 |
+
this.focusser.prop("disabled", false);
|
2065 |
+
|
2066 |
+
if (this.opts.shouldFocusInput(this)) {
|
2067 |
+
this.focusser.focus();
|
2068 |
+
}
|
2069 |
+
},
|
2070 |
+
|
2071 |
+
// single
|
2072 |
+
destroy: function() {
|
2073 |
+
$("label[for='" + this.focusser.attr('id') + "']")
|
2074 |
+
.attr('for', this.opts.element.attr("id"));
|
2075 |
+
this.parent.destroy.apply(this, arguments);
|
2076 |
+
|
2077 |
+
cleanupJQueryElements.call(this,
|
2078 |
+
"selection",
|
2079 |
+
"focusser"
|
2080 |
+
);
|
2081 |
+
},
|
2082 |
+
|
2083 |
+
// single
|
2084 |
+
initContainer: function () {
|
2085 |
+
|
2086 |
+
var selection,
|
2087 |
+
container = this.container,
|
2088 |
+
dropdown = this.dropdown,
|
2089 |
+
idSuffix = nextUid(),
|
2090 |
+
elementLabel;
|
2091 |
+
|
2092 |
+
if (this.opts.minimumResultsForSearch < 0) {
|
2093 |
+
this.showSearch(false);
|
2094 |
+
} else {
|
2095 |
+
this.showSearch(true);
|
2096 |
+
}
|
2097 |
+
|
2098 |
+
this.selection = selection = container.find(".select2-choice");
|
2099 |
+
|
2100 |
+
this.focusser = container.find(".select2-focusser");
|
2101 |
+
|
2102 |
+
// add aria associations
|
2103 |
+
selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
|
2104 |
+
this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
|
2105 |
+
this.results.attr("id", "select2-results-"+idSuffix);
|
2106 |
+
this.search.attr("aria-owns", "select2-results-"+idSuffix);
|
2107 |
+
|
2108 |
+
// rewrite labels from original element to focusser
|
2109 |
+
this.focusser.attr("id", "s2id_autogen"+idSuffix);
|
2110 |
+
|
2111 |
+
elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
|
2112 |
+
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
2113 |
+
|
2114 |
+
this.focusser.prev()
|
2115 |
+
.text(elementLabel.text())
|
2116 |
+
.attr('for', this.focusser.attr('id'));
|
2117 |
+
|
2118 |
+
// Ensure the original element retains an accessible name
|
2119 |
+
var originalTitle = this.opts.element.attr("title");
|
2120 |
+
this.opts.element.attr("title", (originalTitle || elementLabel.text()));
|
2121 |
+
|
2122 |
+
this.focusser.attr("tabindex", this.elementTabIndex);
|
2123 |
+
|
2124 |
+
// write label for search field using the label from the focusser element
|
2125 |
+
this.search.attr("id", this.focusser.attr('id') + '_search');
|
2126 |
+
|
2127 |
+
this.search.prev()
|
2128 |
+
.text($("label[for='" + this.focusser.attr('id') + "']").text())
|
2129 |
+
.attr('for', this.search.attr('id'));
|
2130 |
+
|
2131 |
+
this.search.on("keydown", this.bind(function (e) {
|
2132 |
+
if (!this.isInterfaceEnabled()) return;
|
2133 |
+
|
2134 |
+
// filter 229 keyCodes (input method editor is processing key input)
|
2135 |
+
if (229 == e.keyCode) return;
|
2136 |
+
|
2137 |
+
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
2138 |
+
// prevent the page from scrolling
|
2139 |
+
killEvent(e);
|
2140 |
+
return;
|
2141 |
+
}
|
2142 |
+
|
2143 |
+
switch (e.which) {
|
2144 |
+
case KEY.UP:
|
2145 |
+
case KEY.DOWN:
|
2146 |
+
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
2147 |
+
killEvent(e);
|
2148 |
+
return;
|
2149 |
+
case KEY.ENTER:
|
2150 |
+
this.selectHighlighted();
|
2151 |
+
killEvent(e);
|
2152 |
+
return;
|
2153 |
+
case KEY.TAB:
|
2154 |
+
this.selectHighlighted({noFocus: true});
|
2155 |
+
return;
|
2156 |
+
case KEY.ESC:
|
2157 |
+
this.cancel(e);
|
2158 |
+
killEvent(e);
|
2159 |
+
return;
|
2160 |
+
}
|
2161 |
+
}));
|
2162 |
+
|
2163 |
+
this.search.on("blur", this.bind(function(e) {
|
2164 |
+
// a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
|
2165 |
+
// without this the search field loses focus which is annoying
|
2166 |
+
if (document.activeElement === this.body.get(0)) {
|
2167 |
+
window.setTimeout(this.bind(function() {
|
2168 |
+
if (this.opened()) {
|
2169 |
+
this.search.focus();
|
2170 |
+
}
|
2171 |
+
}), 0);
|
2172 |
+
}
|
2173 |
+
}));
|
2174 |
+
|
2175 |
+
this.focusser.on("keydown", this.bind(function (e) {
|
2176 |
+
if (!this.isInterfaceEnabled()) return;
|
2177 |
+
|
2178 |
+
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
|
2179 |
+
return;
|
2180 |
+
}
|
2181 |
+
|
2182 |
+
if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
|
2183 |
+
killEvent(e);
|
2184 |
+
return;
|
2185 |
+
}
|
2186 |
+
|
2187 |
+
if (e.which == KEY.DOWN || e.which == KEY.UP
|
2188 |
+
|| (e.which == KEY.ENTER && this.opts.openOnEnter)) {
|
2189 |
+
|
2190 |
+
if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
|
2191 |
+
|
2192 |
+
this.open();
|
2193 |
+
killEvent(e);
|
2194 |
+
return;
|
2195 |
+
}
|
2196 |
+
|
2197 |
+
if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
|
2198 |
+
if (this.opts.allowClear) {
|
2199 |
+
this.clear();
|
2200 |
+
}
|
2201 |
+
killEvent(e);
|
2202 |
+
return;
|
2203 |
+
}
|
2204 |
+
}));
|
2205 |
+
|
2206 |
+
|
2207 |
+
installKeyUpChangeEvent(this.focusser);
|
2208 |
+
this.focusser.on("keyup-change input", this.bind(function(e) {
|
2209 |
+
if (this.opts.minimumResultsForSearch >= 0) {
|
2210 |
+
e.stopPropagation();
|
2211 |
+
if (this.opened()) return;
|
2212 |
+
this.open();
|
2213 |
+
}
|
2214 |
+
}));
|
2215 |
+
|
2216 |
+
selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
|
2217 |
+
if (!this.isInterfaceEnabled()) {
|
2218 |
+
return;
|
2219 |
+
}
|
2220 |
+
|
2221 |
+
this.clear();
|
2222 |
+
killEventImmediately(e);
|
2223 |
+
this.close();
|
2224 |
+
|
2225 |
+
if (this.selection) {
|
2226 |
+
this.selection.focus();
|
2227 |
+
}
|
2228 |
+
}));
|
2229 |
+
|
2230 |
+
selection.on("mousedown touchstart", this.bind(function (e) {
|
2231 |
+
// Prevent IE from generating a click event on the body
|
2232 |
+
reinsertElement(selection);
|
2233 |
+
|
2234 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2235 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2236 |
+
}
|
2237 |
+
|
2238 |
+
if (this.opened()) {
|
2239 |
+
this.close();
|
2240 |
+
} else if (this.isInterfaceEnabled()) {
|
2241 |
+
this.open();
|
2242 |
+
}
|
2243 |
+
|
2244 |
+
killEvent(e);
|
2245 |
+
}));
|
2246 |
+
|
2247 |
+
dropdown.on("mousedown touchstart", this.bind(function() {
|
2248 |
+
if (this.opts.shouldFocusInput(this)) {
|
2249 |
+
this.search.focus();
|
2250 |
+
}
|
2251 |
+
}));
|
2252 |
+
|
2253 |
+
selection.on("focus", this.bind(function(e) {
|
2254 |
+
killEvent(e);
|
2255 |
+
}));
|
2256 |
+
|
2257 |
+
this.focusser.on("focus", this.bind(function(){
|
2258 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2259 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2260 |
+
}
|
2261 |
+
this.container.addClass("select2-container-active");
|
2262 |
+
})).on("blur", this.bind(function() {
|
2263 |
+
if (!this.opened()) {
|
2264 |
+
this.container.removeClass("select2-container-active");
|
2265 |
+
this.opts.element.trigger($.Event("select2-blur"));
|
2266 |
+
}
|
2267 |
+
}));
|
2268 |
+
this.search.on("focus", this.bind(function(){
|
2269 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2270 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2271 |
+
}
|
2272 |
+
this.container.addClass("select2-container-active");
|
2273 |
+
}));
|
2274 |
+
|
2275 |
+
this.initContainerWidth();
|
2276 |
+
this.opts.element.hide();
|
2277 |
+
this.setPlaceholder();
|
2278 |
+
|
2279 |
+
},
|
2280 |
+
|
2281 |
+
// single
|
2282 |
+
clear: function(triggerChange) {
|
2283 |
+
var data=this.selection.data("select2-data");
|
2284 |
+
if (data) { // guard against queued quick consecutive clicks
|
2285 |
+
var evt = $.Event("select2-clearing");
|
2286 |
+
this.opts.element.trigger(evt);
|
2287 |
+
if (evt.isDefaultPrevented()) {
|
2288 |
+
return;
|
2289 |
+
}
|
2290 |
+
var placeholderOption = this.getPlaceholderOption();
|
2291 |
+
this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
|
2292 |
+
this.selection.find(".select2-chosen").empty();
|
2293 |
+
this.selection.removeData("select2-data");
|
2294 |
+
this.setPlaceholder();
|
2295 |
+
|
2296 |
+
if (triggerChange !== false){
|
2297 |
+
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
2298 |
+
this.triggerChange({removed:data});
|
2299 |
+
}
|
2300 |
+
}
|
2301 |
+
},
|
2302 |
+
|
2303 |
+
/**
|
2304 |
+
* Sets selection based on source element's value
|
2305 |
+
*/
|
2306 |
+
// single
|
2307 |
+
initSelection: function () {
|
2308 |
+
var selected;
|
2309 |
+
if (this.isPlaceholderOptionSelected()) {
|
2310 |
+
this.updateSelection(null);
|
2311 |
+
this.close();
|
2312 |
+
this.setPlaceholder();
|
2313 |
+
} else {
|
2314 |
+
var self = this;
|
2315 |
+
this.opts.initSelection.call(null, this.opts.element, function(selected){
|
2316 |
+
if (selected !== undefined && selected !== null) {
|
2317 |
+
self.updateSelection(selected);
|
2318 |
+
self.close();
|
2319 |
+
self.setPlaceholder();
|
2320 |
+
self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
|
2321 |
+
}
|
2322 |
+
});
|
2323 |
+
}
|
2324 |
+
},
|
2325 |
+
|
2326 |
+
isPlaceholderOptionSelected: function() {
|
2327 |
+
var placeholderOption;
|
2328 |
+
if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
|
2329 |
+
return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
|
2330 |
+
|| (this.opts.element.val() === "")
|
2331 |
+
|| (this.opts.element.val() === undefined)
|
2332 |
+
|| (this.opts.element.val() === null);
|
2333 |
+
},
|
2334 |
+
|
2335 |
+
// single
|
2336 |
+
prepareOpts: function () {
|
2337 |
+
var opts = this.parent.prepareOpts.apply(this, arguments),
|
2338 |
+
self=this;
|
2339 |
+
|
2340 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
2341 |
+
// install the selection initializer
|
2342 |
+
opts.initSelection = function (element, callback) {
|
2343 |
+
var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
|
2344 |
+
// a single select box always has a value, no need to null check 'selected'
|
2345 |
+
callback(self.optionToData(selected));
|
2346 |
+
};
|
2347 |
+
} else if ("data" in opts) {
|
2348 |
+
// install default initSelection when applied to hidden input and data is local
|
2349 |
+
opts.initSelection = opts.initSelection || function (element, callback) {
|
2350 |
+
var id = element.val();
|
2351 |
+
//search in data by id, storing the actual matching item
|
2352 |
+
var match = null;
|
2353 |
+
opts.query({
|
2354 |
+
matcher: function(term, text, el){
|
2355 |
+
var is_match = equal(id, opts.id(el));
|
2356 |
+
if (is_match) {
|
2357 |
+
match = el;
|
2358 |
+
}
|
2359 |
+
return is_match;
|
2360 |
+
},
|
2361 |
+
callback: !$.isFunction(callback) ? $.noop : function() {
|
2362 |
+
callback(match);
|
2363 |
+
}
|
2364 |
+
});
|
2365 |
+
};
|
2366 |
+
}
|
2367 |
+
|
2368 |
+
return opts;
|
2369 |
+
},
|
2370 |
+
|
2371 |
+
// single
|
2372 |
+
getPlaceholder: function() {
|
2373 |
+
// if a placeholder is specified on a single select without a valid placeholder option ignore it
|
2374 |
+
if (this.select) {
|
2375 |
+
if (this.getPlaceholderOption() === undefined) {
|
2376 |
+
return undefined;
|
2377 |
+
}
|
2378 |
+
}
|
2379 |
+
|
2380 |
+
return this.parent.getPlaceholder.apply(this, arguments);
|
2381 |
+
},
|
2382 |
+
|
2383 |
+
// single
|
2384 |
+
setPlaceholder: function () {
|
2385 |
+
var placeholder = this.getPlaceholder();
|
2386 |
+
|
2387 |
+
if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
|
2388 |
+
|
2389 |
+
// check for a placeholder option if attached to a select
|
2390 |
+
if (this.select && this.getPlaceholderOption() === undefined) return;
|
2391 |
+
|
2392 |
+
this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
|
2393 |
+
|
2394 |
+
this.selection.addClass("select2-default");
|
2395 |
+
|
2396 |
+
this.container.removeClass("select2-allowclear");
|
2397 |
+
}
|
2398 |
+
},
|
2399 |
+
|
2400 |
+
// single
|
2401 |
+
postprocessResults: function (data, initial, noHighlightUpdate) {
|
2402 |
+
var selected = 0, self = this, showSearchInput = true;
|
2403 |
+
|
2404 |
+
// find the selected element in the result list
|
2405 |
+
|
2406 |
+
this.findHighlightableChoices().each2(function (i, elm) {
|
2407 |
+
if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
|
2408 |
+
selected = i;
|
2409 |
+
return false;
|
2410 |
+
}
|
2411 |
+
});
|
2412 |
+
|
2413 |
+
// and highlight it
|
2414 |
+
if (noHighlightUpdate !== false) {
|
2415 |
+
if (initial === true && selected >= 0) {
|
2416 |
+
this.highlight(selected);
|
2417 |
+
} else {
|
2418 |
+
this.highlight(0);
|
2419 |
+
}
|
2420 |
+
}
|
2421 |
+
|
2422 |
+
// hide the search box if this is the first we got the results and there are enough of them for search
|
2423 |
+
|
2424 |
+
if (initial === true) {
|
2425 |
+
var min = this.opts.minimumResultsForSearch;
|
2426 |
+
if (min >= 0) {
|
2427 |
+
this.showSearch(countResults(data.results) >= min);
|
2428 |
+
}
|
2429 |
+
}
|
2430 |
+
},
|
2431 |
+
|
2432 |
+
// single
|
2433 |
+
showSearch: function(showSearchInput) {
|
2434 |
+
if (this.showSearchInput === showSearchInput) return;
|
2435 |
+
|
2436 |
+
this.showSearchInput = showSearchInput;
|
2437 |
+
|
2438 |
+
this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
|
2439 |
+
this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
|
2440 |
+
//add "select2-with-searchbox" to the container if search box is shown
|
2441 |
+
$(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
|
2442 |
+
},
|
2443 |
+
|
2444 |
+
// single
|
2445 |
+
onSelect: function (data, options) {
|
2446 |
+
|
2447 |
+
if (!this.triggerSelect(data)) { return; }
|
2448 |
+
|
2449 |
+
var old = this.opts.element.val(),
|
2450 |
+
oldData = this.data();
|
2451 |
+
|
2452 |
+
this.opts.element.val(this.id(data));
|
2453 |
+
this.updateSelection(data);
|
2454 |
+
|
2455 |
+
this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
|
2456 |
+
|
2457 |
+
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
2458 |
+
this.close();
|
2459 |
+
|
2460 |
+
if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
|
2461 |
+
this.focusser.focus();
|
2462 |
+
}
|
2463 |
+
|
2464 |
+
if (!equal(old, this.id(data))) {
|
2465 |
+
this.triggerChange({ added: data, removed: oldData });
|
2466 |
+
}
|
2467 |
+
},
|
2468 |
+
|
2469 |
+
// single
|
2470 |
+
updateSelection: function (data) {
|
2471 |
+
|
2472 |
+
var container=this.selection.find(".select2-chosen"), formatted, cssClass;
|
2473 |
+
|
2474 |
+
this.selection.data("select2-data", data);
|
2475 |
+
|
2476 |
+
container.empty();
|
2477 |
+
if (data !== null) {
|
2478 |
+
formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
|
2479 |
+
}
|
2480 |
+
if (formatted !== undefined) {
|
2481 |
+
container.append(formatted);
|
2482 |
+
}
|
2483 |
+
cssClass=this.opts.formatSelectionCssClass(data, container);
|
2484 |
+
if (cssClass !== undefined) {
|
2485 |
+
container.addClass(cssClass);
|
2486 |
+
}
|
2487 |
+
|
2488 |
+
this.selection.removeClass("select2-default");
|
2489 |
+
|
2490 |
+
if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
|
2491 |
+
this.container.addClass("select2-allowclear");
|
2492 |
+
}
|
2493 |
+
},
|
2494 |
+
|
2495 |
+
// single
|
2496 |
+
val: function () {
|
2497 |
+
var val,
|
2498 |
+
triggerChange = false,
|
2499 |
+
data = null,
|
2500 |
+
self = this,
|
2501 |
+
oldData = this.data();
|
2502 |
+
|
2503 |
+
if (arguments.length === 0) {
|
2504 |
+
return this.opts.element.val();
|
2505 |
+
}
|
2506 |
+
|
2507 |
+
val = arguments[0];
|
2508 |
+
|
2509 |
+
if (arguments.length > 1) {
|
2510 |
+
triggerChange = arguments[1];
|
2511 |
+
}
|
2512 |
+
|
2513 |
+
if (this.select) {
|
2514 |
+
this.select
|
2515 |
+
.val(val)
|
2516 |
+
.find("option").filter(function() { return this.selected }).each2(function (i, elm) {
|
2517 |
+
data = self.optionToData(elm);
|
2518 |
+
return false;
|
2519 |
+
});
|
2520 |
+
this.updateSelection(data);
|
2521 |
+
this.setPlaceholder();
|
2522 |
+
if (triggerChange) {
|
2523 |
+
this.triggerChange({added: data, removed:oldData});
|
2524 |
+
}
|
2525 |
+
} else {
|
2526 |
+
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
2527 |
+
if (!val && val !== 0) {
|
2528 |
+
this.clear(triggerChange);
|
2529 |
+
return;
|
2530 |
+
}
|
2531 |
+
if (this.opts.initSelection === undefined) {
|
2532 |
+
throw new Error("cannot call val() if initSelection() is not defined");
|
2533 |
+
}
|
2534 |
+
this.opts.element.val(val);
|
2535 |
+
this.opts.initSelection(this.opts.element, function(data){
|
2536 |
+
self.opts.element.val(!data ? "" : self.id(data));
|
2537 |
+
self.updateSelection(data);
|
2538 |
+
self.setPlaceholder();
|
2539 |
+
if (triggerChange) {
|
2540 |
+
self.triggerChange({added: data, removed:oldData});
|
2541 |
+
}
|
2542 |
+
});
|
2543 |
+
}
|
2544 |
+
},
|
2545 |
+
|
2546 |
+
// single
|
2547 |
+
clearSearch: function () {
|
2548 |
+
this.search.val("");
|
2549 |
+
this.focusser.val("");
|
2550 |
+
},
|
2551 |
+
|
2552 |
+
// single
|
2553 |
+
data: function(value) {
|
2554 |
+
var data,
|
2555 |
+
triggerChange = false;
|
2556 |
+
|
2557 |
+
if (arguments.length === 0) {
|
2558 |
+
data = this.selection.data("select2-data");
|
2559 |
+
if (data == undefined) data = null;
|
2560 |
+
return data;
|
2561 |
+
} else {
|
2562 |
+
if (arguments.length > 1) {
|
2563 |
+
triggerChange = arguments[1];
|
2564 |
+
}
|
2565 |
+
if (!value) {
|
2566 |
+
this.clear(triggerChange);
|
2567 |
+
} else {
|
2568 |
+
data = this.data();
|
2569 |
+
this.opts.element.val(!value ? "" : this.id(value));
|
2570 |
+
this.updateSelection(value);
|
2571 |
+
if (triggerChange) {
|
2572 |
+
this.triggerChange({added: value, removed:data});
|
2573 |
+
}
|
2574 |
+
}
|
2575 |
+
}
|
2576 |
+
}
|
2577 |
+
});
|
2578 |
+
|
2579 |
+
MultiSelect2 = clazz(AbstractSelect2, {
|
2580 |
+
|
2581 |
+
// multi
|
2582 |
+
createContainer: function () {
|
2583 |
+
var container = $(document.createElement("div")).attr({
|
2584 |
+
"class": "select2-container select2-container-multi"
|
2585 |
+
}).html([
|
2586 |
+
"<ul class='select2-choices'>",
|
2587 |
+
" <li class='select2-search-field'>",
|
2588 |
+
" <label for='' class='select2-offscreen'></label>",
|
2589 |
+
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
|
2590 |
+
" </li>",
|
2591 |
+
"</ul>",
|
2592 |
+
"<div class='select2-drop select2-drop-multi select2-display-none'>",
|
2593 |
+
" <ul class='select2-results'>",
|
2594 |
+
" </ul>",
|
2595 |
+
"</div>"].join(""));
|
2596 |
+
return container;
|
2597 |
+
},
|
2598 |
+
|
2599 |
+
// multi
|
2600 |
+
prepareOpts: function () {
|
2601 |
+
var opts = this.parent.prepareOpts.apply(this, arguments),
|
2602 |
+
self=this;
|
2603 |
+
|
2604 |
+
// TODO validate placeholder is a string if specified
|
2605 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
2606 |
+
// install the selection initializer
|
2607 |
+
opts.initSelection = function (element, callback) {
|
2608 |
+
|
2609 |
+
var data = [];
|
2610 |
+
|
2611 |
+
element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
|
2612 |
+
data.push(self.optionToData(elm));
|
2613 |
+
});
|
2614 |
+
callback(data);
|
2615 |
+
};
|
2616 |
+
} else if ("data" in opts) {
|
2617 |
+
// install default initSelection when applied to hidden input and data is local
|
2618 |
+
opts.initSelection = opts.initSelection || function (element, callback) {
|
2619 |
+
var ids = splitVal(element.val(), opts.separator, opts.transformVal);
|
2620 |
+
//search in data by array of ids, storing matching items in a list
|
2621 |
+
var matches = [];
|
2622 |
+
opts.query({
|
2623 |
+
matcher: function(term, text, el){
|
2624 |
+
var is_match = $.grep(ids, function(id) {
|
2625 |
+
return equal(id, opts.id(el));
|
2626 |
+
}).length;
|
2627 |
+
if (is_match) {
|
2628 |
+
matches.push(el);
|
2629 |
+
}
|
2630 |
+
return is_match;
|
2631 |
+
},
|
2632 |
+
callback: !$.isFunction(callback) ? $.noop : function() {
|
2633 |
+
// reorder matches based on the order they appear in the ids array because right now
|
2634 |
+
// they are in the order in which they appear in data array
|
2635 |
+
var ordered = [];
|
2636 |
+
for (var i = 0; i < ids.length; i++) {
|
2637 |
+
var id = ids[i];
|
2638 |
+
for (var j = 0; j < matches.length; j++) {
|
2639 |
+
var match = matches[j];
|
2640 |
+
if (equal(id, opts.id(match))) {
|
2641 |
+
ordered.push(match);
|
2642 |
+
matches.splice(j, 1);
|
2643 |
+
break;
|
2644 |
+
}
|
2645 |
+
}
|
2646 |
+
}
|
2647 |
+
callback(ordered);
|
2648 |
+
}
|
2649 |
+
});
|
2650 |
+
};
|
2651 |
+
}
|
2652 |
+
|
2653 |
+
return opts;
|
2654 |
+
},
|
2655 |
+
|
2656 |
+
// multi
|
2657 |
+
selectChoice: function (choice) {
|
2658 |
+
|
2659 |
+
var selected = this.container.find(".select2-search-choice-focus");
|
2660 |
+
if (selected.length && choice && choice[0] == selected[0]) {
|
2661 |
+
|
2662 |
+
} else {
|
2663 |
+
if (selected.length) {
|
2664 |
+
this.opts.element.trigger("choice-deselected", selected);
|
2665 |
+
}
|
2666 |
+
selected.removeClass("select2-search-choice-focus");
|
2667 |
+
if (choice && choice.length) {
|
2668 |
+
this.close();
|
2669 |
+
choice.addClass("select2-search-choice-focus");
|
2670 |
+
this.opts.element.trigger("choice-selected", choice);
|
2671 |
+
}
|
2672 |
+
}
|
2673 |
+
},
|
2674 |
+
|
2675 |
+
// multi
|
2676 |
+
destroy: function() {
|
2677 |
+
$("label[for='" + this.search.attr('id') + "']")
|
2678 |
+
.attr('for', this.opts.element.attr("id"));
|
2679 |
+
this.parent.destroy.apply(this, arguments);
|
2680 |
+
|
2681 |
+
cleanupJQueryElements.call(this,
|
2682 |
+
"searchContainer",
|
2683 |
+
"selection"
|
2684 |
+
);
|
2685 |
+
},
|
2686 |
+
|
2687 |
+
// multi
|
2688 |
+
initContainer: function () {
|
2689 |
+
|
2690 |
+
var selector = ".select2-choices", selection;
|
2691 |
+
|
2692 |
+
this.searchContainer = this.container.find(".select2-search-field");
|
2693 |
+
this.selection = selection = this.container.find(selector);
|
2694 |
+
|
2695 |
+
var _this = this;
|
2696 |
+
this.selection.on("click", ".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)", function (e) {
|
2697 |
+
_this.search[0].focus();
|
2698 |
+
_this.selectChoice($(this));
|
2699 |
+
});
|
2700 |
+
|
2701 |
+
// rewrite labels from original element to focusser
|
2702 |
+
this.search.attr("id", "s2id_autogen"+nextUid());
|
2703 |
+
|
2704 |
+
this.search.prev()
|
2705 |
+
.text($("label[for='" + this.opts.element.attr("id") + "']").text())
|
2706 |
+
.attr('for', this.search.attr('id'));
|
2707 |
+
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
2708 |
+
|
2709 |
+
this.search.on("input paste", this.bind(function() {
|
2710 |
+
if (this.search.attr('placeholder') && this.search.val().length == 0) return;
|
2711 |
+
if (!this.isInterfaceEnabled()) return;
|
2712 |
+
if (!this.opened()) {
|
2713 |
+
this.open();
|
2714 |
+
}
|
2715 |
+
}));
|
2716 |
+
|
2717 |
+
this.search.attr("tabindex", this.elementTabIndex);
|
2718 |
+
|
2719 |
+
this.keydowns = 0;
|
2720 |
+
this.search.on("keydown", this.bind(function (e) {
|
2721 |
+
if (!this.isInterfaceEnabled()) return;
|
2722 |
+
|
2723 |
+
++this.keydowns;
|
2724 |
+
var selected = selection.find(".select2-search-choice-focus");
|
2725 |
+
var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
|
2726 |
+
var next = selected.next(".select2-search-choice:not(.select2-locked)");
|
2727 |
+
var pos = getCursorInfo(this.search);
|
2728 |
+
|
2729 |
+
if (selected.length &&
|
2730 |
+
(e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
|
2731 |
+
var selectedChoice = selected;
|
2732 |
+
if (e.which == KEY.LEFT && prev.length) {
|
2733 |
+
selectedChoice = prev;
|
2734 |
+
}
|
2735 |
+
else if (e.which == KEY.RIGHT) {
|
2736 |
+
selectedChoice = next.length ? next : null;
|
2737 |
+
}
|
2738 |
+
else if (e.which === KEY.BACKSPACE) {
|
2739 |
+
if (this.unselect(selected.first())) {
|
2740 |
+
this.search.width(10);
|
2741 |
+
selectedChoice = prev.length ? prev : next;
|
2742 |
+
}
|
2743 |
+
} else if (e.which == KEY.DELETE) {
|
2744 |
+
if (this.unselect(selected.first())) {
|
2745 |
+
this.search.width(10);
|
2746 |
+
selectedChoice = next.length ? next : null;
|
2747 |
+
}
|
2748 |
+
} else if (e.which == KEY.ENTER) {
|
2749 |
+
selectedChoice = null;
|
2750 |
+
}
|
2751 |
+
|
2752 |
+
this.selectChoice(selectedChoice);
|
2753 |
+
killEvent(e);
|
2754 |
+
if (!selectedChoice || !selectedChoice.length) {
|
2755 |
+
this.open();
|
2756 |
+
}
|
2757 |
+
return;
|
2758 |
+
} else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
|
2759 |
+
|| e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
|
2760 |
+
|
2761 |
+
this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
|
2762 |
+
killEvent(e);
|
2763 |
+
return;
|
2764 |
+
} else {
|
2765 |
+
this.selectChoice(null);
|
2766 |
+
}
|
2767 |
+
|
2768 |
+
if (this.opened()) {
|
2769 |
+
switch (e.which) {
|
2770 |
+
case KEY.UP:
|
2771 |
+
case KEY.DOWN:
|
2772 |
+
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
2773 |
+
killEvent(e);
|
2774 |
+
return;
|
2775 |
+
case KEY.ENTER:
|
2776 |
+
this.selectHighlighted();
|
2777 |
+
killEvent(e);
|
2778 |
+
return;
|
2779 |
+
case KEY.TAB:
|
2780 |
+
this.selectHighlighted({noFocus:true});
|
2781 |
+
this.close();
|
2782 |
+
return;
|
2783 |
+
case KEY.ESC:
|
2784 |
+
this.cancel(e);
|
2785 |
+
killEvent(e);
|
2786 |
+
return;
|
2787 |
+
}
|
2788 |
+
}
|
2789 |
+
|
2790 |
+
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
|
2791 |
+
|| e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
|
2792 |
+
return;
|
2793 |
+
}
|
2794 |
+
|
2795 |
+
if (e.which === KEY.ENTER) {
|
2796 |
+
if (this.opts.openOnEnter === false) {
|
2797 |
+
return;
|
2798 |
+
} else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
|
2799 |
+
return;
|
2800 |
+
}
|
2801 |
+
}
|
2802 |
+
|
2803 |
+
this.open();
|
2804 |
+
|
2805 |
+
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
2806 |
+
// prevent the page from scrolling
|
2807 |
+
killEvent(e);
|
2808 |
+
}
|
2809 |
+
|
2810 |
+
if (e.which === KEY.ENTER) {
|
2811 |
+
// prevent form from being submitted
|
2812 |
+
killEvent(e);
|
2813 |
+
}
|
2814 |
+
|
2815 |
+
}));
|
2816 |
+
|
2817 |
+
this.search.on("keyup", this.bind(function (e) {
|
2818 |
+
this.keydowns = 0;
|
2819 |
+
this.resizeSearch();
|
2820 |
+
})
|
2821 |
+
);
|
2822 |
+
|
2823 |
+
this.search.on("blur", this.bind(function(e) {
|
2824 |
+
this.container.removeClass("select2-container-active");
|
2825 |
+
this.search.removeClass("select2-focused");
|
2826 |
+
this.selectChoice(null);
|
2827 |
+
if (!this.opened()) this.clearSearch();
|
2828 |
+
e.stopImmediatePropagation();
|
2829 |
+
this.opts.element.trigger($.Event("select2-blur"));
|
2830 |
+
}));
|
2831 |
+
|
2832 |
+
this.container.on("click", selector, this.bind(function (e) {
|
2833 |
+
if (!this.isInterfaceEnabled()) return;
|
2834 |
+
if ($(e.target).closest(".select2-search-choice").length > 0) {
|
2835 |
+
// clicked inside a select2 search choice, do not open
|
2836 |
+
return;
|
2837 |
+
}
|
2838 |
+
this.selectChoice(null);
|
2839 |
+
this.clearPlaceholder();
|
2840 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2841 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2842 |
+
}
|
2843 |
+
this.open();
|
2844 |
+
this.focusSearch();
|
2845 |
+
e.preventDefault();
|
2846 |
+
}));
|
2847 |
+
|
2848 |
+
this.container.on("focus", selector, this.bind(function () {
|
2849 |
+
if (!this.isInterfaceEnabled()) return;
|
2850 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2851 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2852 |
+
}
|
2853 |
+
this.container.addClass("select2-container-active");
|
2854 |
+
this.dropdown.addClass("select2-drop-active");
|
2855 |
+
this.clearPlaceholder();
|
2856 |
+
}));
|
2857 |
+
|
2858 |
+
this.initContainerWidth();
|
2859 |
+
this.opts.element.hide();
|
2860 |
+
|
2861 |
+
// set the placeholder if necessary
|
2862 |
+
this.clearSearch();
|
2863 |
+
},
|
2864 |
+
|
2865 |
+
// multi
|
2866 |
+
enableInterface: function() {
|
2867 |
+
if (this.parent.enableInterface.apply(this, arguments)) {
|
2868 |
+
this.search.prop("disabled", !this.isInterfaceEnabled());
|
2869 |
+
}
|
2870 |
+
},
|
2871 |
+
|
2872 |
+
// multi
|
2873 |
+
initSelection: function () {
|
2874 |
+
var data;
|
2875 |
+
if (this.opts.element.val() === "" && this.opts.element.text() === "") {
|
2876 |
+
this.updateSelection([]);
|
2877 |
+
this.close();
|
2878 |
+
// set the placeholder if necessary
|
2879 |
+
this.clearSearch();
|
2880 |
+
}
|
2881 |
+
if (this.select || this.opts.element.val() !== "") {
|
2882 |
+
var self = this;
|
2883 |
+
this.opts.initSelection.call(null, this.opts.element, function(data){
|
2884 |
+
if (data !== undefined && data !== null) {
|
2885 |
+
self.updateSelection(data);
|
2886 |
+
self.close();
|
2887 |
+
// set the placeholder if necessary
|
2888 |
+
self.clearSearch();
|
2889 |
+
}
|
2890 |
+
});
|
2891 |
+
}
|
2892 |
+
},
|
2893 |
+
|
2894 |
+
// multi
|
2895 |
+
clearSearch: function () {
|
2896 |
+
var placeholder = this.getPlaceholder(),
|
2897 |
+
maxWidth = this.getMaxSearchWidth();
|
2898 |
+
|
2899 |
+
if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
|
2900 |
+
this.search.val(placeholder).addClass("select2-default");
|
2901 |
+
// stretch the search box to full width of the container so as much of the placeholder is visible as possible
|
2902 |
+
// we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
|
2903 |
+
this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
|
2904 |
+
} else {
|
2905 |
+
this.search.val("").width(10);
|
2906 |
+
}
|
2907 |
+
},
|
2908 |
+
|
2909 |
+
// multi
|
2910 |
+
clearPlaceholder: function () {
|
2911 |
+
if (this.search.hasClass("select2-default")) {
|
2912 |
+
this.search.val("").removeClass("select2-default");
|
2913 |
+
}
|
2914 |
+
},
|
2915 |
+
|
2916 |
+
// multi
|
2917 |
+
opening: function () {
|
2918 |
+
this.clearPlaceholder(); // should be done before super so placeholder is not used to search
|
2919 |
+
this.resizeSearch();
|
2920 |
+
|
2921 |
+
this.parent.opening.apply(this, arguments);
|
2922 |
+
|
2923 |
+
this.focusSearch();
|
2924 |
+
|
2925 |
+
// initializes search's value with nextSearchTerm (if defined by user)
|
2926 |
+
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
2927 |
+
if(this.search.val() === "") {
|
2928 |
+
if(this.nextSearchTerm != undefined){
|
2929 |
+
this.search.val(this.nextSearchTerm);
|
2930 |
+
this.search.select();
|
2931 |
+
}
|
2932 |
+
}
|
2933 |
+
|
2934 |
+
this.updateResults(true);
|
2935 |
+
if (this.opts.shouldFocusInput(this)) {
|
2936 |
+
this.search.focus();
|
2937 |
+
}
|
2938 |
+
this.opts.element.trigger($.Event("select2-open"));
|
2939 |
+
},
|
2940 |
+
|
2941 |
+
// multi
|
2942 |
+
close: function () {
|
2943 |
+
if (!this.opened()) return;
|
2944 |
+
this.parent.close.apply(this, arguments);
|
2945 |
+
},
|
2946 |
+
|
2947 |
+
// multi
|
2948 |
+
focus: function () {
|
2949 |
+
this.close();
|
2950 |
+
this.search.focus();
|
2951 |
+
},
|
2952 |
+
|
2953 |
+
// multi
|
2954 |
+
isFocused: function () {
|
2955 |
+
return this.search.hasClass("select2-focused");
|
2956 |
+
},
|
2957 |
+
|
2958 |
+
// multi
|
2959 |
+
updateSelection: function (data) {
|
2960 |
+
var ids = [], filtered = [], self = this;
|
2961 |
+
|
2962 |
+
// filter out duplicates
|
2963 |
+
$(data).each(function () {
|
2964 |
+
if (indexOf(self.id(this), ids) < 0) {
|
2965 |
+
ids.push(self.id(this));
|
2966 |
+
filtered.push(this);
|
2967 |
+
}
|
2968 |
+
});
|
2969 |
+
data = filtered;
|
2970 |
+
|
2971 |
+
this.selection.find(".select2-search-choice").remove();
|
2972 |
+
$(data).each(function () {
|
2973 |
+
self.addSelectedChoice(this);
|
2974 |
+
});
|
2975 |
+
self.postprocessResults();
|
2976 |
+
},
|
2977 |
+
|
2978 |
+
// multi
|
2979 |
+
tokenize: function() {
|
2980 |
+
var input = this.search.val();
|
2981 |
+
input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
|
2982 |
+
if (input != null && input != undefined) {
|
2983 |
+
this.search.val(input);
|
2984 |
+
if (input.length > 0) {
|
2985 |
+
this.open();
|
2986 |
+
}
|
2987 |
+
}
|
2988 |
+
|
2989 |
+
},
|
2990 |
+
|
2991 |
+
// multi
|
2992 |
+
onSelect: function (data, options) {
|
2993 |
+
|
2994 |
+
if (!this.triggerSelect(data) || data.text === "") { return; }
|
2995 |
+
|
2996 |
+
this.addSelectedChoice(data);
|
2997 |
+
|
2998 |
+
this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
|
2999 |
+
|
3000 |
+
// keep track of the search's value before it gets cleared
|
3001 |
+
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
3002 |
+
|
3003 |
+
this.clearSearch();
|
3004 |
+
this.updateResults();
|
3005 |
+
|
3006 |
+
if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
|
3007 |
+
|
3008 |
+
if (this.opts.closeOnSelect) {
|
3009 |
+
this.close();
|
3010 |
+
this.search.width(10);
|
3011 |
+
} else {
|
3012 |
+
if (this.countSelectableResults()>0) {
|
3013 |
+
this.search.width(10);
|
3014 |
+
this.resizeSearch();
|
3015 |
+
if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
|
3016 |
+
// if we reached max selection size repaint the results so choices
|
3017 |
+
// are replaced with the max selection reached message
|
3018 |
+
this.updateResults(true);
|
3019 |
+
} else {
|
3020 |
+
// initializes search's value with nextSearchTerm and update search result
|
3021 |
+
if(this.nextSearchTerm != undefined){
|
3022 |
+
this.search.val(this.nextSearchTerm);
|
3023 |
+
this.updateResults();
|
3024 |
+
this.search.select();
|
3025 |
+
}
|
3026 |
+
}
|
3027 |
+
this.positionDropdown();
|
3028 |
+
} else {
|
3029 |
+
// if nothing left to select close
|
3030 |
+
this.close();
|
3031 |
+
this.search.width(10);
|
3032 |
+
}
|
3033 |
+
}
|
3034 |
+
|
3035 |
+
// since its not possible to select an element that has already been
|
3036 |
+
// added we do not need to check if this is a new element before firing change
|
3037 |
+
this.triggerChange({ added: data });
|
3038 |
+
|
3039 |
+
if (!options || !options.noFocus)
|
3040 |
+
this.focusSearch();
|
3041 |
+
},
|
3042 |
+
|
3043 |
+
// multi
|
3044 |
+
cancel: function () {
|
3045 |
+
this.close();
|
3046 |
+
this.focusSearch();
|
3047 |
+
},
|
3048 |
+
|
3049 |
+
addSelectedChoice: function (data) {
|
3050 |
+
var enableChoice = !data.locked,
|
3051 |
+
enabledItem = $(
|
3052 |
+
"<li class='select2-search-choice'>" +
|
3053 |
+
" <div></div>" +
|
3054 |
+
" <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
|
3055 |
+
"</li>"),
|
3056 |
+
disabledItem = $(
|
3057 |
+
"<li class='select2-search-choice select2-locked'>" +
|
3058 |
+
"<div></div>" +
|
3059 |
+
"</li>");
|
3060 |
+
var choice = enableChoice ? enabledItem : disabledItem,
|
3061 |
+
id = this.id(data),
|
3062 |
+
val = this.getVal(),
|
3063 |
+
formatted,
|
3064 |
+
cssClass;
|
3065 |
+
|
3066 |
+
formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
|
3067 |
+
if (formatted != undefined) {
|
3068 |
+
choice.find("div").replaceWith($("<div></div>").html(formatted));
|
3069 |
+
}
|
3070 |
+
cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
|
3071 |
+
if (cssClass != undefined) {
|
3072 |
+
choice.addClass(cssClass);
|
3073 |
+
}
|
3074 |
+
|
3075 |
+
if(enableChoice){
|
3076 |
+
choice.find(".select2-search-choice-close")
|
3077 |
+
.on("mousedown", killEvent)
|
3078 |
+
.on("click dblclick", this.bind(function (e) {
|
3079 |
+
if (!this.isInterfaceEnabled()) return;
|
3080 |
+
|
3081 |
+
this.unselect($(e.target));
|
3082 |
+
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
3083 |
+
killEvent(e);
|
3084 |
+
this.close();
|
3085 |
+
this.focusSearch();
|
3086 |
+
})).on("focus", this.bind(function () {
|
3087 |
+
if (!this.isInterfaceEnabled()) return;
|
3088 |
+
this.container.addClass("select2-container-active");
|
3089 |
+
this.dropdown.addClass("select2-drop-active");
|
3090 |
+
}));
|
3091 |
+
}
|
3092 |
+
|
3093 |
+
choice.data("select2-data", data);
|
3094 |
+
choice.insertBefore(this.searchContainer);
|
3095 |
+
|
3096 |
+
val.push(id);
|
3097 |
+
this.setVal(val);
|
3098 |
+
},
|
3099 |
+
|
3100 |
+
// multi
|
3101 |
+
unselect: function (selected) {
|
3102 |
+
var val = this.getVal(),
|
3103 |
+
data,
|
3104 |
+
index;
|
3105 |
+
selected = selected.closest(".select2-search-choice");
|
3106 |
+
|
3107 |
+
if (selected.length === 0) {
|
3108 |
+
throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
|
3109 |
+
}
|
3110 |
+
|
3111 |
+
data = selected.data("select2-data");
|
3112 |
+
|
3113 |
+
if (!data) {
|
3114 |
+
// prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
|
3115 |
+
// and invoked on an element already removed
|
3116 |
+
return;
|
3117 |
+
}
|
3118 |
+
|
3119 |
+
var evt = $.Event("select2-removing");
|
3120 |
+
evt.val = this.id(data);
|
3121 |
+
evt.choice = data;
|
3122 |
+
this.opts.element.trigger(evt);
|
3123 |
+
|
3124 |
+
if (evt.isDefaultPrevented()) {
|
3125 |
+
return false;
|
3126 |
+
}
|
3127 |
+
|
3128 |
+
while((index = indexOf(this.id(data), val)) >= 0) {
|
3129 |
+
val.splice(index, 1);
|
3130 |
+
this.setVal(val);
|
3131 |
+
if (this.select) this.postprocessResults();
|
3132 |
+
}
|
3133 |
+
|
3134 |
+
selected.remove();
|
3135 |
+
|
3136 |
+
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
3137 |
+
this.triggerChange({ removed: data });
|
3138 |
+
|
3139 |
+
return true;
|
3140 |
+
},
|
3141 |
+
|
3142 |
+
// multi
|
3143 |
+
postprocessResults: function (data, initial, noHighlightUpdate) {
|
3144 |
+
var val = this.getVal(),
|
3145 |
+
choices = this.results.find(".select2-result"),
|
3146 |
+
compound = this.results.find(".select2-result-with-children"),
|
3147 |
+
self = this;
|
3148 |
+
|
3149 |
+
choices.each2(function (i, choice) {
|
3150 |
+
var id = self.id(choice.data("select2-data"));
|
3151 |
+
if (indexOf(id, val) >= 0) {
|
3152 |
+
choice.addClass("select2-selected");
|
3153 |
+
// mark all children of the selected parent as selected
|
3154 |
+
choice.find(".select2-result-selectable").addClass("select2-selected");
|
3155 |
+
}
|
3156 |
+
});
|
3157 |
+
|
3158 |
+
compound.each2(function(i, choice) {
|
3159 |
+
// hide an optgroup if it doesn't have any selectable children
|
3160 |
+
if (!choice.is('.select2-result-selectable')
|
3161 |
+
&& choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
|
3162 |
+
choice.addClass("select2-selected");
|
3163 |
+
}
|
3164 |
+
});
|
3165 |
+
|
3166 |
+
if (this.highlight() == -1 && noHighlightUpdate !== false && this.opts.closeOnSelect === true){
|
3167 |
+
self.highlight(0);
|
3168 |
+
}
|
3169 |
+
|
3170 |
+
//If all results are chosen render formatNoMatches
|
3171 |
+
if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
|
3172 |
+
if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
|
3173 |
+
if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
|
3174 |
+
this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
|
3175 |
+
}
|
3176 |
+
}
|
3177 |
+
}
|
3178 |
+
|
3179 |
+
},
|
3180 |
+
|
3181 |
+
// multi
|
3182 |
+
getMaxSearchWidth: function() {
|
3183 |
+
return this.selection.width() - getSideBorderPadding(this.search);
|
3184 |
+
},
|
3185 |
+
|
3186 |
+
// multi
|
3187 |
+
resizeSearch: function () {
|
3188 |
+
var minimumWidth, left, maxWidth, containerLeft, searchWidth,
|
3189 |
+
sideBorderPadding = getSideBorderPadding(this.search);
|
3190 |
+
|
3191 |
+
minimumWidth = measureTextWidth(this.search) + 10;
|
3192 |
+
|
3193 |
+
left = this.search.offset().left;
|
3194 |
+
|
3195 |
+
maxWidth = this.selection.width();
|
3196 |
+
containerLeft = this.selection.offset().left;
|
3197 |
+
|
3198 |
+
searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
|
3199 |
+
|
3200 |
+
if (searchWidth < minimumWidth) {
|
3201 |
+
searchWidth = maxWidth - sideBorderPadding;
|
3202 |
+
}
|
3203 |
+
|
3204 |
+
if (searchWidth < 40) {
|
3205 |
+
searchWidth = maxWidth - sideBorderPadding;
|
3206 |
+
}
|
3207 |
+
|
3208 |
+
if (searchWidth <= 0) {
|
3209 |
+
searchWidth = minimumWidth;
|
3210 |
+
}
|
3211 |
+
|
3212 |
+
this.search.width(Math.floor(searchWidth));
|
3213 |
+
},
|
3214 |
+
|
3215 |
+
// multi
|
3216 |
+
getVal: function () {
|
3217 |
+
var val;
|
3218 |
+
if (this.select) {
|
3219 |
+
val = this.select.val();
|
3220 |
+
return val === null ? [] : val;
|
3221 |
+
} else {
|
3222 |
+
val = this.opts.element.val();
|
3223 |
+
return splitVal(val, this.opts.separator, this.opts.transformVal);
|
3224 |
+
}
|
3225 |
+
},
|
3226 |
+
|
3227 |
+
// multi
|
3228 |
+
setVal: function (val) {
|
3229 |
+
var unique;
|
3230 |
+
if (this.select) {
|
3231 |
+
this.select.val(val);
|
3232 |
+
} else {
|
3233 |
+
unique = [];
|
3234 |
+
// filter out duplicates
|
3235 |
+
$(val).each(function () {
|
3236 |
+
if (indexOf(this, unique) < 0) unique.push(this);
|
3237 |
+
});
|
3238 |
+
this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
|
3239 |
+
}
|
3240 |
+
},
|
3241 |
+
|
3242 |
+
// multi
|
3243 |
+
buildChangeDetails: function (old, current) {
|
3244 |
+
var current = current.slice(0),
|
3245 |
+
old = old.slice(0);
|
3246 |
+
|
3247 |
+
// remove intersection from each array
|
3248 |
+
for (var i = 0; i < current.length; i++) {
|
3249 |
+
for (var j = 0; j < old.length; j++) {
|
3250 |
+
if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
|
3251 |
+
current.splice(i, 1);
|
3252 |
+
if(i>0){
|
3253 |
+
i--;
|
3254 |
+
}
|
3255 |
+
old.splice(j, 1);
|
3256 |
+
j--;
|
3257 |
+
}
|
3258 |
+
}
|
3259 |
+
}
|
3260 |
+
|
3261 |
+
return {added: current, removed: old};
|
3262 |
+
},
|
3263 |
+
|
3264 |
+
|
3265 |
+
// multi
|
3266 |
+
val: function (val, triggerChange) {
|
3267 |
+
var oldData, self=this;
|
3268 |
+
|
3269 |
+
if (arguments.length === 0) {
|
3270 |
+
return this.getVal();
|
3271 |
+
}
|
3272 |
+
|
3273 |
+
oldData=this.data();
|
3274 |
+
if (!oldData.length) oldData=[];
|
3275 |
+
|
3276 |
+
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
3277 |
+
if (!val && val !== 0) {
|
3278 |
+
this.opts.element.val("");
|
3279 |
+
this.updateSelection([]);
|
3280 |
+
this.clearSearch();
|
3281 |
+
if (triggerChange) {
|
3282 |
+
this.triggerChange({added: this.data(), removed: oldData});
|
3283 |
+
}
|
3284 |
+
return;
|
3285 |
+
}
|
3286 |
+
|
3287 |
+
// val is a list of ids
|
3288 |
+
this.setVal(val);
|
3289 |
+
|
3290 |
+
if (this.select) {
|
3291 |
+
this.opts.initSelection(this.select, this.bind(this.updateSelection));
|
3292 |
+
if (triggerChange) {
|
3293 |
+
this.triggerChange(this.buildChangeDetails(oldData, this.data()));
|
3294 |
+
}
|
3295 |
+
} else {
|
3296 |
+
if (this.opts.initSelection === undefined) {
|
3297 |
+
throw new Error("val() cannot be called if initSelection() is not defined");
|
3298 |
+
}
|
3299 |
+
|
3300 |
+
this.opts.initSelection(this.opts.element, function(data){
|
3301 |
+
var ids=$.map(data, self.id);
|
3302 |
+
self.setVal(ids);
|
3303 |
+
self.updateSelection(data);
|
3304 |
+
self.clearSearch();
|
3305 |
+
if (triggerChange) {
|
3306 |
+
self.triggerChange(self.buildChangeDetails(oldData, self.data()));
|
3307 |
+
}
|
3308 |
+
});
|
3309 |
+
}
|
3310 |
+
this.clearSearch();
|
3311 |
+
},
|
3312 |
+
|
3313 |
+
// multi
|
3314 |
+
onSortStart: function() {
|
3315 |
+
if (this.select) {
|
3316 |
+
throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
|
3317 |
+
}
|
3318 |
+
|
3319 |
+
// collapse search field into 0 width so its container can be collapsed as well
|
3320 |
+
this.search.width(0);
|
3321 |
+
// hide the container
|
3322 |
+
this.searchContainer.hide();
|
3323 |
+
},
|
3324 |
+
|
3325 |
+
// multi
|
3326 |
+
onSortEnd:function() {
|
3327 |
+
|
3328 |
+
var val=[], self=this;
|
3329 |
+
|
3330 |
+
// show search and move it to the end of the list
|
3331 |
+
this.searchContainer.show();
|
3332 |
+
// make sure the search container is the last item in the list
|
3333 |
+
this.searchContainer.appendTo(this.searchContainer.parent());
|
3334 |
+
// since we collapsed the width in dragStarted, we resize it here
|
3335 |
+
this.resizeSearch();
|
3336 |
+
|
3337 |
+
// update selection
|
3338 |
+
this.selection.find(".select2-search-choice").each(function() {
|
3339 |
+
val.push(self.opts.id($(this).data("select2-data")));
|
3340 |
+
});
|
3341 |
+
this.setVal(val);
|
3342 |
+
this.triggerChange();
|
3343 |
+
},
|
3344 |
+
|
3345 |
+
// multi
|
3346 |
+
data: function(values, triggerChange) {
|
3347 |
+
var self=this, ids, old;
|
3348 |
+
if (arguments.length === 0) {
|
3349 |
+
return this.selection
|
3350 |
+
.children(".select2-search-choice")
|
3351 |
+
.map(function() { return $(this).data("select2-data"); })
|
3352 |
+
.get();
|
3353 |
+
} else {
|
3354 |
+
old = this.data();
|
3355 |
+
if (!values) { values = []; }
|
3356 |
+
ids = $.map(values, function(e) { return self.opts.id(e); });
|
3357 |
+
this.setVal(ids);
|
3358 |
+
this.updateSelection(values);
|
3359 |
+
this.clearSearch();
|
3360 |
+
if (triggerChange) {
|
3361 |
+
this.triggerChange(this.buildChangeDetails(old, this.data()));
|
3362 |
+
}
|
3363 |
+
}
|
3364 |
+
}
|
3365 |
+
});
|
3366 |
+
|
3367 |
+
$.fn.select2 = function () {
|
3368 |
+
|
3369 |
+
var args = Array.prototype.slice.call(arguments, 0),
|
3370 |
+
opts,
|
3371 |
+
select2,
|
3372 |
+
method, value, multiple,
|
3373 |
+
allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
|
3374 |
+
valueMethods = ["opened", "isFocused", "container", "dropdown"],
|
3375 |
+
propertyMethods = ["val", "data"],
|
3376 |
+
methodsMap = { search: "externalSearch" };
|
3377 |
+
|
3378 |
+
this.each(function () {
|
3379 |
+
if (args.length === 0 || typeof(args[0]) === "object") {
|
3380 |
+
opts = args.length === 0 ? {} : $.extend({}, args[0]);
|
3381 |
+
opts.element = $(this);
|
3382 |
+
|
3383 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
3384 |
+
multiple = opts.element.prop("multiple");
|
3385 |
+
} else {
|
3386 |
+
multiple = opts.multiple || false;
|
3387 |
+
if ("tags" in opts) {opts.multiple = multiple = true;}
|
3388 |
+
}
|
3389 |
+
|
3390 |
+
select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
|
3391 |
+
select2.init(opts);
|
3392 |
+
} else if (typeof(args[0]) === "string") {
|
3393 |
+
|
3394 |
+
if (indexOf(args[0], allowedMethods) < 0) {
|
3395 |
+
throw "Unknown method: " + args[0];
|
3396 |
+
}
|
3397 |
+
|
3398 |
+
value = undefined;
|
3399 |
+
select2 = $(this).data("select2");
|
3400 |
+
if (select2 === undefined) return;
|
3401 |
+
|
3402 |
+
method=args[0];
|
3403 |
+
|
3404 |
+
if (method === "container") {
|
3405 |
+
value = select2.container;
|
3406 |
+
} else if (method === "dropdown") {
|
3407 |
+
value = select2.dropdown;
|
3408 |
+
} else {
|
3409 |
+
if (methodsMap[method]) method = methodsMap[method];
|
3410 |
+
|
3411 |
+
value = select2[method].apply(select2, args.slice(1));
|
3412 |
+
}
|
3413 |
+
if (indexOf(args[0], valueMethods) >= 0
|
3414 |
+
|| (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
|
3415 |
+
return false; // abort the iteration, ready to return first matched value
|
3416 |
+
}
|
3417 |
+
} else {
|
3418 |
+
throw "Invalid arguments to select2 plugin: " + args;
|
3419 |
+
}
|
3420 |
+
});
|
3421 |
+
return (value === undefined) ? this : value;
|
3422 |
+
};
|
3423 |
+
|
3424 |
+
// plugin defaults, accessible to users
|
3425 |
+
$.fn.select2.defaults = {
|
3426 |
+
width: "copy",
|
3427 |
+
loadMorePadding: 0,
|
3428 |
+
closeOnSelect: true,
|
3429 |
+
openOnEnter: true,
|
3430 |
+
containerCss: {},
|
3431 |
+
dropdownCss: {},
|
3432 |
+
containerCssClass: "",
|
3433 |
+
dropdownCssClass: "",
|
3434 |
+
formatResult: function(result, container, query, escapeMarkup) {
|
3435 |
+
var markup=[];
|
3436 |
+
markMatch(this.text(result), query.term, markup, escapeMarkup);
|
3437 |
+
return markup.join("");
|
3438 |
+
},
|
3439 |
+
transformVal: function(val) {
|
3440 |
+
return $.trim(val);
|
3441 |
+
},
|
3442 |
+
formatSelection: function (data, container, escapeMarkup) {
|
3443 |
+
return data ? escapeMarkup(this.text(data)) : undefined;
|
3444 |
+
},
|
3445 |
+
sortResults: function (results, container, query) {
|
3446 |
+
return results;
|
3447 |
+
},
|
3448 |
+
formatResultCssClass: function(data) {return data.css;},
|
3449 |
+
formatSelectionCssClass: function(data, container) {return undefined;},
|
3450 |
+
minimumResultsForSearch: 0,
|
3451 |
+
minimumInputLength: 0,
|
3452 |
+
maximumInputLength: null,
|
3453 |
+
maximumSelectionSize: 0,
|
3454 |
+
id: function (e) { return e == undefined ? null : e.id; },
|
3455 |
+
text: function (e) {
|
3456 |
+
if (e && this.data && this.data.text) {
|
3457 |
+
if ($.isFunction(this.data.text)) {
|
3458 |
+
return this.data.text(e);
|
3459 |
+
} else {
|
3460 |
+
return e[this.data.text];
|
3461 |
+
}
|
3462 |
+
} else {
|
3463 |
+
return e.text;
|
3464 |
+
}
|
3465 |
+
},
|
3466 |
+
matcher: function(term, text) {
|
3467 |
+
return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
|
3468 |
+
},
|
3469 |
+
separator: ",",
|
3470 |
+
tokenSeparators: [],
|
3471 |
+
tokenizer: defaultTokenizer,
|
3472 |
+
escapeMarkup: defaultEscapeMarkup,
|
3473 |
+
blurOnChange: false,
|
3474 |
+
selectOnBlur: false,
|
3475 |
+
adaptContainerCssClass: function(c) { return c; },
|
3476 |
+
adaptDropdownCssClass: function(c) { return null; },
|
3477 |
+
nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
|
3478 |
+
searchInputPlaceholder: '',
|
3479 |
+
createSearchChoicePosition: 'top',
|
3480 |
+
shouldFocusInput: function (instance) {
|
3481 |
+
// Attempt to detect touch devices
|
3482 |
+
var supportsTouchEvents = (('ontouchstart' in window) ||
|
3483 |
+
(navigator.msMaxTouchPoints > 0));
|
3484 |
+
|
3485 |
+
// Only devices which support touch events should be special cased
|
3486 |
+
if (!supportsTouchEvents) {
|
3487 |
+
return true;
|
3488 |
+
}
|
3489 |
+
|
3490 |
+
// Never focus the input if search is disabled
|
3491 |
+
if (instance.opts.minimumResultsForSearch < 0) {
|
3492 |
+
return false;
|
3493 |
+
}
|
3494 |
+
|
3495 |
+
return true;
|
3496 |
+
}
|
3497 |
+
};
|
3498 |
+
|
3499 |
+
$.fn.select2.locales = [];
|
3500 |
+
|
3501 |
+
$.fn.select2.locales['en'] = {
|
3502 |
+
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
3503 |
+
formatNoMatches: function () { return "No matches found"; },
|
3504 |
+
formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
|
3505 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
3506 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
3507 |
+
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
3508 |
+
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
3509 |
+
formatSearching: function () { return "Searching…"; }
|
3510 |
+
};
|
3511 |
+
|
3512 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
3513 |
+
|
3514 |
+
$.fn.select2.ajaxDefaults = {
|
3515 |
+
transport: $.ajax,
|
3516 |
+
params: {
|
3517 |
+
type: "GET",
|
3518 |
+
cache: false,
|
3519 |
+
dataType: "json"
|
3520 |
+
}
|
3521 |
+
};
|
3522 |
+
|
3523 |
+
// exports
|
3524 |
+
window.Select2 = {
|
3525 |
+
query: {
|
3526 |
+
ajax: ajax,
|
3527 |
+
local: local,
|
3528 |
+
tags: tags
|
3529 |
+
}, util: {
|
3530 |
+
debounce: debounce,
|
3531 |
+
markMatch: markMatch,
|
3532 |
+
escapeMarkup: defaultEscapeMarkup,
|
3533 |
+
stripDiacritics: stripDiacritics
|
3534 |
+
}, "class": {
|
3535 |
+
"abstract": AbstractSelect2,
|
3536 |
+
"single": SingleSelect2,
|
3537 |
+
"multi": MultiSelect2
|
3538 |
+
}
|
3539 |
+
};
|
3540 |
+
|
3541 |
+
}(jQuery));
|
lib/select2/select2.min.js
ADDED
@@ -0,0 +1,23 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*
|
2 |
+
Copyright 2014 Igor Vaynberg
|
3 |
+
|
4 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
5 |
+
|
6 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
7 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
8 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
9 |
+
License or the GPL License.
|
10 |
+
|
11 |
+
You may obtain a copy of the Apache License and the GPL License at:
|
12 |
+
|
13 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
14 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
15 |
+
|
16 |
+
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
17 |
+
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
18 |
+
either express or implied. See the Apache License and the GPL License for the specific language governing
|
19 |
+
permissions and limitations under the Apache License and the GPL License.
|
20 |
+
*/
|
21 |
+
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;
|
22 |
+
var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
|
23 |
+
},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
|
lib/select2/select2.png
ADDED
Binary file
|
lib/select2/select2x2.png
ADDED
Binary file
|
package.json
CHANGED
@@ -12,8 +12,10 @@
|
|
12 |
"grunt-contrib-jasmine": "^0.8.2",
|
13 |
"grunt-contrib-jshint": "^0.11.0",
|
14 |
"grunt-contrib-watch": "^0.6.1",
|
|
|
15 |
"grunt-sass": "^0.18.0",
|
16 |
"grunt-wp-i18n": "^0.5.0",
|
|
|
17 |
"remapify": "1.4.3"
|
18 |
},
|
19 |
"browserify": {
|
12 |
"grunt-contrib-jasmine": "^0.8.2",
|
13 |
"grunt-contrib-jshint": "^0.11.0",
|
14 |
"grunt-contrib-watch": "^0.6.1",
|
15 |
+
"grunt-phpcs": "^0.4.0",
|
16 |
"grunt-sass": "^0.18.0",
|
17 |
"grunt-wp-i18n": "^0.5.0",
|
18 |
+
"grunt-wp-readme-to-markdown": "~0.9.0",
|
19 |
"remapify": "1.4.3"
|
20 |
},
|
21 |
"browserify": {
|
readme.txt
CHANGED
@@ -1,9 +1,9 @@
|
|
1 |
=== Shortcake (Shortcode UI) ===
|
2 |
-
Contributors: mattheu, danielbachhuber, jitendraharpalani, sanchothefat, bfintal, davisshaver
|
3 |
Tags: shortcodes
|
4 |
Requires at least: 4.1
|
5 |
-
Tested up to: 4.2
|
6 |
-
Stable tag: 0.
|
7 |
License: GPLv2 or later
|
8 |
License URI: http://www.gnu.org/licenses/gpl-2.0.html
|
9 |
|
@@ -13,11 +13,15 @@ Shortcake makes using WordPress shortcodes a piece of cake.
|
|
13 |
|
14 |
Used alongside `add_shortcode`, Shortcake supplies a user-friendly interface for adding a shortcode to a post, and viewing and editing it from within the content editor.
|
15 |
|
16 |
-
|
|
|
|
|
17 |
|
18 |
== Installation ==
|
19 |
|
20 |
-
Shortcake can be installed like any other WordPress plugin.
|
|
|
|
|
21 |
|
22 |
== Screenshots ==
|
23 |
|
@@ -26,8 +30,32 @@ Shortcake can be installed like any other WordPress plugin. Once you've done so,
|
|
26 |
3. And add a user-friendly UI to edit shortcode content and attributes.
|
27 |
4. Add new shortcodes to your post through "Add Media".
|
28 |
|
|
|
|
|
|
|
|
|
|
|
|
|
29 |
== Changelog ==
|
30 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
31 |
= 0.2.3 (April 8, 2015) =
|
32 |
* Fix WP 4.1 backwards compatibility issue by restoring arguments passed to TinyMCE view compatibility shim.
|
33 |
|
1 |
=== Shortcake (Shortcode UI) ===
|
2 |
+
Contributors: fusionengineering, mattheu, danielbachhuber, zebulonj, jitendraharpalani, sanchothefat, bfintal, davisshaver
|
3 |
Tags: shortcodes
|
4 |
Requires at least: 4.1
|
5 |
+
Tested up to: 4.2.1
|
6 |
+
Stable tag: 0.3.0
|
7 |
License: GPLv2 or later
|
8 |
License URI: http://www.gnu.org/licenses/gpl-2.0.html
|
9 |
|
13 |
|
14 |
Used alongside `add_shortcode`, Shortcake supplies a user-friendly interface for adding a shortcode to a post, and viewing and editing it from within the content editor.
|
15 |
|
16 |
+
Once you've installed the plugin, you'll need to [register UI for your shortcodes](https://github.com/fusioneng/Shortcake/wiki/Registering-Shortcode-UI). For inspiration, check out [examples of Shortcake in the wild](https://github.com/fusioneng/Shortcake/wiki/Shortcode-UI-Examples).
|
17 |
+
|
18 |
+
To report bugs or feature requests, [please use Github issues](https://github.com/fusioneng/Shortcake/issues).
|
19 |
|
20 |
== Installation ==
|
21 |
|
22 |
+
Shortcake can be installed like any other WordPress plugin.
|
23 |
+
|
24 |
+
Once you've done so, you'll need to [register the UI for your code](https://github.com/fusioneng/Shortcake/wiki/Registering-Shortcode-UI).
|
25 |
|
26 |
== Screenshots ==
|
27 |
|
30 |
3. And add a user-friendly UI to edit shortcode content and attributes.
|
31 |
4. Add new shortcodes to your post through "Add Media".
|
32 |
|
33 |
+
== Upgrade Notice ==
|
34 |
+
|
35 |
+
= 0.3 =
|
36 |
+
|
37 |
+
We've removed the compatibility shim for the magical `content` attribute. If you were using this to support editing inner content, you'll need to change your UI registration to use `inner_content`.
|
38 |
+
|
39 |
== Changelog ==
|
40 |
|
41 |
+
= 0.3 (April 27, 2015) =
|
42 |
+
* **Breaking change**: We've removed the compatibility shim for the magical `content` attribute. If you were using this to support editing inner content, you'll need to change your UI registration to use `inner_content`.
|
43 |
+
* New `post_select` field type for selecting from a list of posts. Supports an additional `query` parameter to modify the search query.
|
44 |
+
* Using a new `post_type` argument, shortcode UI can be registered for specific post types. This is helpful if you want the UI for a given shortcode to only appear on specific post types.
|
45 |
+
* For each shortcode attribute, a `meta` argument can be specified to add arbitrary HTML attributes to the field. We've added a compatibility shim for the existing `placeholder` argument. This compatibility shim will be removed in v0.4.
|
46 |
+
* When inserting a shortcode, UI shows a helpful message when the shortcode doesn't have attributes to configure. Previously, the user was presented with a relatively blank screen.
|
47 |
+
* Our example plugin can be activated through the WordPress admin.
|
48 |
+
* Clicking "Insert Post Element" in the left menu effectively acts as back button to selecting a shortcode.
|
49 |
+
* Language around the editing experience reflects the shortcode you're editing. For instance, with a pullquote shortcode, "Edit Post Element" becomes "Edit Pullquote".
|
50 |
+
* Added Dutch translation.
|
51 |
+
* Source JavaScript files moved to `js/src` for clarity between source and built JavaScript.
|
52 |
+
* PHP files are scanned using PHP_CodeSniffer.
|
53 |
+
* Bug fix: Unquoted shortcode attributes are properly supported.
|
54 |
+
* Bug fix: Attachment field properly registers dependencies.
|
55 |
+
* Bug fix: "Insert Post Element" experience should work when visual editor is disabled. Shortcake is only loosely coupled with TinyMCE.
|
56 |
+
* Bug fix: Editor styles are loaded on `after_setup_theme` to prevent fatals.
|
57 |
+
* [Full release notes](http://fusion.net/story/126834/introducing-shortcake-v0-3-0-butter/).
|
58 |
+
|
59 |
= 0.2.3 (April 8, 2015) =
|
60 |
* Fix WP 4.1 backwards compatibility issue by restoring arguments passed to TinyMCE view compatibility shim.
|
61 |
|
screenshot-1.png
CHANGED
Binary file
|
screenshot-2.png
CHANGED
Binary file
|
screenshot-3.png
CHANGED
Binary file
|
screenshot-4.png
CHANGED
Binary file
|
shortcode-ui.php
CHANGED
@@ -1,7 +1,7 @@
|
|
1 |
<?php
|
2 |
/**
|
3 |
* Plugin Name: Shortcode UI
|
4 |
-
* Version:
|
5 |
* Description: User Interface for adding shortcodes.
|
6 |
* Author: Fusion Engineering and community
|
7 |
* Author URI: http://next.fusion.net/tag/shortcode-ui/
|
@@ -19,12 +19,13 @@
|
|
19 |
* GNU General Public License for more details.
|
20 |
*/
|
21 |
|
22 |
-
define( 'SHORTCODE_UI_VERSION', '0.
|
23 |
|
24 |
require_once dirname( __FILE__ ) . '/inc/class-shortcode-ui.php';
|
25 |
require_once dirname( __FILE__ ) . '/inc/fields/class-shortcode-ui-fields.php';
|
26 |
require_once dirname( __FILE__ ) . '/inc/fields/class-field-attachment.php';
|
27 |
require_once dirname( __FILE__ ) . '/inc/fields/class-field-color.php';
|
|
|
28 |
|
29 |
add_action( 'init', 'shortcode_ui_load_textdomain' );
|
30 |
|
@@ -34,6 +35,7 @@ add_action( 'init', function() {
|
|
34 |
$fields = Shortcode_UI_Fields::get_instance();
|
35 |
$attachment_field = Shortcake_Field_Attachment::get_instance();
|
36 |
$color_field = Shortcake_Field_Color::get_instance();
|
|
|
37 |
|
38 |
}, 5 );
|
39 |
|
1 |
<?php
|
2 |
/**
|
3 |
* Plugin Name: Shortcode UI
|
4 |
+
* Version: 0.3.0
|
5 |
* Description: User Interface for adding shortcodes.
|
6 |
* Author: Fusion Engineering and community
|
7 |
* Author URI: http://next.fusion.net/tag/shortcode-ui/
|
19 |
* GNU General Public License for more details.
|
20 |
*/
|
21 |
|
22 |
+
define( 'SHORTCODE_UI_VERSION', '0.3.0' );
|
23 |
|
24 |
require_once dirname( __FILE__ ) . '/inc/class-shortcode-ui.php';
|
25 |
require_once dirname( __FILE__ ) . '/inc/fields/class-shortcode-ui-fields.php';
|
26 |
require_once dirname( __FILE__ ) . '/inc/fields/class-field-attachment.php';
|
27 |
require_once dirname( __FILE__ ) . '/inc/fields/class-field-color.php';
|
28 |
+
require_once dirname( __FILE__ ) . '/inc/fields/class-field-post-select.php';
|
29 |
|
30 |
add_action( 'init', 'shortcode_ui_load_textdomain' );
|
31 |
|
35 |
$fields = Shortcode_UI_Fields::get_instance();
|
36 |
$attachment_field = Shortcake_Field_Attachment::get_instance();
|
37 |
$color_field = Shortcake_Field_Color::get_instance();
|
38 |
+
$post_field = Shortcode_UI_Field_Post_Select::get_instance();
|
39 |
|
40 |
}, 5 );
|
41 |
|