Version Description
(September 2018) =
- Always show time and sometimes date before each event, in addition to the relative date. Fixes https://wordpress.org/support/topic/feature-request-granular-settings-changes-detailed-timestamp/.
- Use WordPress own function (
wp_privacy_anonymize_ip, available since WordPress version 4.9.6) to anonymize IP addresses, instead of our own class. - Update timeago.js
Download this release
Release Info
| Developer | eskapism |
| Plugin | |
| Version | 2.28 |
| Comparing to | |
| See all releases | |
Code changes from version 2.27 to 2.28
- composer.json +1 -1
- freemius/assets/img/simple-history.svg +6 -0
- inc/SimpleHistory.php +0 -1
- inc/SimpleHistoryIpAnonymizer.php +0 -71
- index.php +23 -26
- js/scripts.js +694 -763
- js/select2-3.5.1-old/LICENSE +0 -18
- js/select2-3.5.1-old/README.md +0 -99
- js/select2-3.5.1-old/bower.json +0 -8
- js/select2-3.5.1-old/component.json +0 -66
- js/select2-3.5.1-old/composer.json +0 -29
- js/select2-3.5.1-old/package.json +0 -20
- js/select2-3.5.1-old/release.sh +0 -79
- js/select2-3.5.1-old/select2-bootstrap.css +0 -87
- js/select2-3.5.1-old/select2-spinner.gif +0 -0
- js/select2-3.5.1-old/select2.css +0 -704
- js/select2-3.5.1-old/select2.jquery.json +0 -36
- js/select2-3.5.1-old/select2.js +0 -3508
- js/select2-3.5.1-old/select2.min.js +0 -23
- js/select2-3.5.1-old/select2.png +0 -0
- js/select2-3.5.1-old/select2_locale_ar.js +0 -19
- js/select2-3.5.1-old/select2_locale_az.js +0 -20
- js/select2-3.5.1-old/select2_locale_bg.js +0 -20
- js/select2-3.5.1-old/select2_locale_ca.js +0 -19
- js/select2-3.5.1-old/select2_locale_cs.js +0 -51
- js/select2-3.5.1-old/select2_locale_da.js +0 -19
- js/select2-3.5.1-old/select2_locale_de.js +0 -18
- js/select2-3.5.1-old/select2_locale_el.js +0 -19
- js/select2-3.5.1-old/select2_locale_en.js.template +0 -20
- js/select2-3.5.1-old/select2_locale_es.js +0 -17
- js/select2-3.5.1-old/select2_locale_et.js +0 -19
- js/select2-3.5.1-old/select2_locale_eu.js +0 -45
- js/select2-3.5.1-old/select2_locale_fa.js +0 -21
- js/select2-3.5.1-old/select2_locale_fi.js +0 -30
- js/select2-3.5.1-old/select2_locale_fr.js +0 -18
- js/select2-3.5.1-old/select2_locale_gl.js +0 -45
- js/select2-3.5.1-old/select2_locale_he.js +0 -19
- js/select2-3.5.1-old/select2_locale_hr.js +0 -24
- js/select2-3.5.1-old/select2_locale_hu.js +0 -17
- js/select2-3.5.1-old/select2_locale_id.js +0 -19
- js/select2-3.5.1-old/select2_locale_is.js +0 -17
- js/select2-3.5.1-old/select2_locale_it.js +0 -17
- js/select2-3.5.1-old/select2_locale_ja.js +0 -17
- js/select2-3.5.1-old/select2_locale_ka.js +0 -19
- js/select2-3.5.1-old/select2_locale_ko.js +0 -19
- js/select2-3.5.1-old/select2_locale_lt.js +0 -26
- js/select2-3.5.1-old/select2_locale_lv.js +0 -19
- js/select2-3.5.1-old/select2_locale_mk.js +0 -19
- js/select2-3.5.1-old/select2_locale_ms.js +0 -19
- js/select2-3.5.1-old/select2_locale_nl.js +0 -17
- js/select2-3.5.1-old/select2_locale_no.js +0 -20
- js/select2-3.5.1-old/select2_locale_pl.js +0 -25
- js/select2-3.5.1-old/select2_locale_pt-BR.js +0 -17
- js/select2-3.5.1-old/select2_locale_pt-PT.js +0 -17
- js/select2-3.5.1-old/select2_locale_ro.js +0 -17
- js/select2-3.5.1-old/select2_locale_rs.js +0 -19
- js/select2-3.5.1-old/select2_locale_ru.js +0 -23
- js/select2-3.5.1-old/select2_locale_sk.js +0 -50
- js/select2-3.5.1-old/select2_locale_sv.js +0 -19
- js/select2-3.5.1-old/select2_locale_th.js +0 -19
- js/select2-3.5.1-old/select2_locale_tr.js +0 -19
- js/select2-3.5.1-old/select2_locale_ug-CN.js +0 -16
- js/select2-3.5.1-old/select2_locale_uk.js +0 -25
- js/select2-3.5.1-old/select2_locale_vi.js +0 -20
- js/select2-3.5.1-old/select2_locale_zh-CN.js +0 -16
- js/select2-3.5.1-old/select2_locale_zh-TW.js +0 -16
- js/select2-3.5.1-old/select2x2.png +0 -0
- js/timeago/jquery.timeago.js +124 -117
- loggers/SimpleLogger.php +43 -29
- loggers/SimpleUserLogger.php +3 -3
- readme.txt +23 -4
composer.json
CHANGED
|
@@ -13,7 +13,7 @@
|
|
| 13 |
"require": {
|
| 14 |
"php": ">=5.3.0"
|
| 15 |
},
|
| 16 |
-
"version": "2.
|
| 17 |
"authors": [
|
| 18 |
{
|
| 19 |
"name": "Pär Thernström",
|
| 13 |
"require": {
|
| 14 |
"php": ">=5.3.0"
|
| 15 |
},
|
| 16 |
+
"version": "2.28",
|
| 17 |
"authors": [
|
| 18 |
{
|
| 19 |
"name": "Pär Thernström",
|
freemius/assets/img/simple-history.svg
ADDED
|
@@ -0,0 +1,6 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<svg width="48" height="48" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 48 48">
|
| 2 |
+
<g>
|
| 3 |
+
<path stroke="null" id="svg_1" fill="none" d="m0,0l48,0l0,48l-48,0l0,-48z"/>
|
| 4 |
+
<path fill="#3f9349" id="svg_2" d="m25.99,6c-9.949999,0 -17.99,8.06 -17.99,18l-6,0l7.79,7.790001l0.14,0.290001l8.07,-8.080002l-6,0c0,-7.73 6.27,-14 14,-14s14,6.27 14,14s-6.27,14 -14,14c-3.870001,0 -7.360001,-1.580002 -9.889999,-4.110001l-2.830001,2.830002c3.250001,3.259998 7.740001,5.279999 12.71,5.279999c9.949999,0 18.01,-8.060001 18.01,-18s-8.060001,-18 -18.01,-18zm-1.99,10l0,10l8.560001,5.08l1.439999,-2.43l-7,-4.15l0,-8.5l-3,0z" opacity="0.9"/>
|
| 5 |
+
</g>
|
| 6 |
+
</svg>
|
inc/SimpleHistory.php
CHANGED
|
@@ -2424,7 +2424,6 @@ Because Simple History was just recently installed, this feed does not contain m
|
|
| 2424 |
$logger = $this->instantiatedLoggers[ $row_logger ]['instance'];
|
| 2425 |
|
| 2426 |
return $logger->getLogRowPlainTextOutput( $row );
|
| 2427 |
-
|
| 2428 |
}
|
| 2429 |
|
| 2430 |
/**
|
| 2424 |
$logger = $this->instantiatedLoggers[ $row_logger ]['instance'];
|
| 2425 |
|
| 2426 |
return $logger->getLogRowPlainTextOutput( $row );
|
|
|
|
| 2427 |
}
|
| 2428 |
|
| 2429 |
/**
|
inc/SimpleHistoryIpAnonymizer.php
DELETED
|
@@ -1,71 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* IpAnonymizer class from https://github.com/geertw/php-ip-anonymizer
|
| 4 |
-
*
|
| 5 |
-
* Modified by removing namespace to make it work on PHP < 5.3 and renaming it
|
| 6 |
-
* to minimize multiple classes with same name.
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
class SimpleHistoryIpAnonymizer {
|
| 10 |
-
/**
|
| 11 |
-
* @var string IPv4 netmask used to anonymize IPv4 address.
|
| 12 |
-
*/
|
| 13 |
-
public $ipv4NetMask = "255.255.255.0";
|
| 14 |
-
|
| 15 |
-
/**
|
| 16 |
-
* @var string IPv6 netmask used to anonymize IPv6 address.
|
| 17 |
-
*/
|
| 18 |
-
public $ipv6NetMask = "ffff:ffff:ffff:ffff:0000:0000:0000:0000";
|
| 19 |
-
|
| 20 |
-
/**
|
| 21 |
-
* Anonymize an IPv4 or IPv6 address.
|
| 22 |
-
*
|
| 23 |
-
* @param $address string IP address that must be anonymized
|
| 24 |
-
* @return string The anonymized IP address. Returns an empty string when the IP address is invalid.
|
| 25 |
-
*/
|
| 26 |
-
public static function anonymizeIp($address) {
|
| 27 |
-
$anonymizer = new SimpleHistoryIpAnonymizer();
|
| 28 |
-
return $anonymizer->anonymize($address);
|
| 29 |
-
}
|
| 30 |
-
|
| 31 |
-
/**
|
| 32 |
-
* Anonymize an IPv4 or IPv6 address.
|
| 33 |
-
*
|
| 34 |
-
* @param $address string IP address that must be anonymized
|
| 35 |
-
* @return string The anonymized IP address. Returns an empty string when the IP address is invalid.
|
| 36 |
-
*/
|
| 37 |
-
public function anonymize($address) {
|
| 38 |
-
|
| 39 |
-
if (empty($address)) {
|
| 40 |
-
return "";
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
$packedAddress = inet_pton($address);
|
| 44 |
-
|
| 45 |
-
if (strlen($packedAddress) == 4) {
|
| 46 |
-
return $this->anonymizeIPv4($address);
|
| 47 |
-
} elseif (strlen($packedAddress) == 16) {
|
| 48 |
-
return $this->anonymizeIPv6($address);
|
| 49 |
-
} else {
|
| 50 |
-
return "";
|
| 51 |
-
}
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
/**
|
| 55 |
-
* Anonymize an IPv4 address
|
| 56 |
-
* @param $address string IPv4 address
|
| 57 |
-
* @return string Anonymized address
|
| 58 |
-
*/
|
| 59 |
-
public function anonymizeIPv4($address) {
|
| 60 |
-
return inet_ntop(inet_pton($address) & inet_pton($this->ipv4NetMask));
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
/**
|
| 64 |
-
* Anonymize an IPv6 address
|
| 65 |
-
* @param $address string IPv6 address
|
| 66 |
-
* @return string Anonymized address
|
| 67 |
-
*/
|
| 68 |
-
public function anonymizeIPv6($address) {
|
| 69 |
-
return inet_ntop(inet_pton($address) & inet_pton($this->ipv6NetMask));
|
| 70 |
-
}
|
| 71 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
index.php
CHANGED
|
@@ -5,7 +5,7 @@
|
|
| 5 |
* Text Domain: simple-history
|
| 6 |
* Domain Path: /languages
|
| 7 |
* Description: Plugin that logs various things that occur in WordPress and then presents those events in a very nice GUI.
|
| 8 |
-
* Version: 2.
|
| 9 |
* Author: Pär Thernström
|
| 10 |
* Author URI: http://simple-history.com/
|
| 11 |
* License: GPL2
|
|
@@ -34,7 +34,7 @@ if ( ! defined( 'WPINC' ) ) {
|
|
| 34 |
|
| 35 |
// Plugin requires at least WordPress version "4.5.1", because usage of functions like wp_get_raw_referer.
|
| 36 |
// true if version ok, false if too old version.
|
| 37 |
-
$ok_wp_version = version_compare( $GLOBALS['wp_version'],
|
| 38 |
$ok_php_version = version_compare( phpversion(), '5.3', '>=' );
|
| 39 |
|
| 40 |
if ( $ok_php_version && $ok_wp_version ) {
|
|
@@ -47,7 +47,7 @@ if ( $ok_php_version && $ok_wp_version ) {
|
|
| 47 |
*/
|
| 48 |
|
| 49 |
if ( ! defined( 'SIMPLE_HISTORY_VERSION' ) ) {
|
| 50 |
-
define( 'SIMPLE_HISTORY_VERSION', '2.
|
| 51 |
}
|
| 52 |
|
| 53 |
if ( ! defined( 'SIMPLE_HISTORY_PATH' ) ) {
|
|
@@ -69,7 +69,6 @@ if ( $ok_php_version && $ok_wp_version ) {
|
|
| 69 |
/** Load required files */
|
| 70 |
require_once( __DIR__ . '/inc/SimpleHistory.php' );
|
| 71 |
require_once( __DIR__ . '/inc/SimpleHistoryLogQuery.php' );
|
| 72 |
-
require_once( __DIR__ . '/inc/SimpleHistoryIpAnonymizer.php' );
|
| 73 |
|
| 74 |
/**
|
| 75 |
Constants will be like:
|
|
@@ -93,33 +92,31 @@ if ( $ok_php_version && $ok_wp_version ) {
|
|
| 93 |
* Show an admin message if old PHP version.
|
| 94 |
*/
|
| 95 |
function simple_history_old_version_admin_notice() {
|
| 96 |
-
$ok_wp_version
|
| 97 |
$ok_php_version = version_compare( phpversion(), '5.3', '>=' );
|
| 98 |
|
| 99 |
?>
|
| 100 |
<div class="updated error">
|
| 101 |
<?php
|
| 102 |
-
|
| 103 |
-
|
| 104 |
-
|
| 105 |
-
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
|
| 109 |
-
|
| 110 |
-
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
|
| 118 |
-
|
| 119 |
-
|
| 120 |
-
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
?>
|
| 124 |
</div>
|
| 125 |
<?php
|
| 5 |
* Text Domain: simple-history
|
| 6 |
* Domain Path: /languages
|
| 7 |
* Description: Plugin that logs various things that occur in WordPress and then presents those events in a very nice GUI.
|
| 8 |
+
* Version: 2.28
|
| 9 |
* Author: Pär Thernström
|
| 10 |
* Author URI: http://simple-history.com/
|
| 11 |
* License: GPL2
|
| 34 |
|
| 35 |
// Plugin requires at least WordPress version "4.5.1", because usage of functions like wp_get_raw_referer.
|
| 36 |
// true if version ok, false if too old version.
|
| 37 |
+
$ok_wp_version = version_compare( $GLOBALS['wp_version'], '4.5.1', '>=' );
|
| 38 |
$ok_php_version = version_compare( phpversion(), '5.3', '>=' );
|
| 39 |
|
| 40 |
if ( $ok_php_version && $ok_wp_version ) {
|
| 47 |
*/
|
| 48 |
|
| 49 |
if ( ! defined( 'SIMPLE_HISTORY_VERSION' ) ) {
|
| 50 |
+
define( 'SIMPLE_HISTORY_VERSION', '2.28' );
|
| 51 |
}
|
| 52 |
|
| 53 |
if ( ! defined( 'SIMPLE_HISTORY_PATH' ) ) {
|
| 69 |
/** Load required files */
|
| 70 |
require_once( __DIR__ . '/inc/SimpleHistory.php' );
|
| 71 |
require_once( __DIR__ . '/inc/SimpleHistoryLogQuery.php' );
|
|
|
|
| 72 |
|
| 73 |
/**
|
| 74 |
Constants will be like:
|
| 92 |
* Show an admin message if old PHP version.
|
| 93 |
*/
|
| 94 |
function simple_history_old_version_admin_notice() {
|
| 95 |
+
$ok_wp_version = version_compare( $GLOBALS['wp_version'], '4.5.1', '>=' );
|
| 96 |
$ok_php_version = version_compare( phpversion(), '5.3', '>=' );
|
| 97 |
|
| 98 |
?>
|
| 99 |
<div class="updated error">
|
| 100 |
<?php
|
| 101 |
+
if ( ! $ok_php_version ) {
|
| 102 |
+
echo '<p>';
|
| 103 |
+
printf(
|
| 104 |
+
/* translators: 1: PHP version */
|
| 105 |
+
esc_html( __( 'Simple History is a great plugin, but to use it your server must have at least PHP 5.3 installed (you have version %s).', 'simple-history' ) ),
|
| 106 |
+
phpversion() // 1
|
| 107 |
+
);
|
| 108 |
+
echo '</p>';
|
| 109 |
+
}
|
| 110 |
+
|
| 111 |
+
if ( ! $ok_wp_version ) {
|
| 112 |
+
echo '<p>';
|
| 113 |
+
printf(
|
| 114 |
+
/* translators: 1: WordPress version */
|
| 115 |
+
esc_html( __( 'Simple History requires WordPress version 4.5.1 or higher (you have version %s).', 'simple-history' ) ),
|
| 116 |
+
$GLOBALS['wp_version'] // 1
|
| 117 |
+
);
|
| 118 |
+
echo '</p>';
|
| 119 |
+
}
|
|
|
|
|
|
|
| 120 |
?>
|
| 121 |
</div>
|
| 122 |
<?php
|
js/scripts.js
CHANGED
|
@@ -1,774 +1,705 @@
|
|
| 1 |
-
/*jshint multistr: true */
|
| 2 |
-
|
| 3 |
-
var simple_history = (function($) {
|
| 4 |
-
|
| 5 |
-
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
|
| 27 |
-
|
| 28 |
-
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
|
| 33 |
-
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
|
| 37 |
-
|
| 38 |
-
|
| 39 |
-
|
| 40 |
-
|
| 41 |
-
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
|
| 46 |
-
|
| 47 |
-
|
| 48 |
-
|
| 49 |
-
|
| 50 |
-
|
| 51 |
-
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
|
| 55 |
-
|
| 56 |
-
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
|
| 60 |
-
|
| 61 |
-
|
| 62 |
-
|
| 63 |
-
|
| 64 |
-
|
| 65 |
-
|
| 66 |
-
|
| 67 |
-
|
| 68 |
-
|
| 69 |
-
|
| 70 |
-
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
|
| 74 |
-
|
| 75 |
-
|
| 76 |
-
|
| 77 |
-
|
| 78 |
-
|
| 79 |
-
|
| 80 |
-
|
| 81 |
-
|
| 82 |
-
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
|
| 88 |
-
|
| 89 |
-
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
|
| 97 |
-
|
| 98 |
-
|
| 99 |
-
|
| 100 |
-
|
| 101 |
-
|
| 102 |
-
|
| 103 |
-
|
| 104 |
-
|
| 105 |
-
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
|
| 109 |
-
|
| 110 |
-
|
| 111 |
-
|
| 112 |
-
|
| 113 |
-
|
| 114 |
-
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
|
| 118 |
-
|
| 119 |
-
|
| 120 |
-
|
| 121 |
-
|
| 122 |
-
|
| 123 |
-
|
| 124 |
-
|
| 125 |
-
|
| 126 |
-
|
| 127 |
-
|
| 128 |
-
|
| 129 |
-
|
| 130 |
-
|
| 131 |
-
|
| 132 |
-
|
| 133 |
-
|
| 134 |
-
|
| 135 |
-
|
| 136 |
-
|
| 137 |
-
|
| 138 |
-
|
| 139 |
-
|
| 140 |
-
|
| 141 |
-
|
| 142 |
-
|
| 143 |
-
|
| 144 |
-
|
| 145 |
-
|
| 146 |
-
|
| 147 |
-
|
| 148 |
-
|
| 149 |
-
|
| 150 |
-
|
| 151 |
-
|
| 152 |
-
|
| 153 |
-
|
| 154 |
-
|
| 155 |
-
|
| 156 |
-
|
| 157 |
-
|
| 158 |
-
|
| 159 |
-
|
| 160 |
-
|
| 161 |
-
|
| 162 |
-
|
| 163 |
-
|
| 164 |
-
|
| 165 |
-
|
| 166 |
-
|
| 167 |
-
|
| 168 |
-
|
| 169 |
-
|
| 170 |
-
|
| 171 |
-
|
| 172 |
-
|
| 173 |
-
|
| 174 |
-
|
| 175 |
-
|
| 176 |
-
|
| 177 |
-
|
| 178 |
-
|
| 179 |
-
|
| 180 |
-
|
| 181 |
-
|
| 182 |
-
|
| 183 |
-
|
| 184 |
-
|
| 185 |
-
|
| 186 |
-
|
| 187 |
-
|
| 188 |
-
|
| 189 |
-
|
| 190 |
-
|
| 191 |
-
|
| 192 |
-
|
| 193 |
-
|
| 194 |
-
|
| 195 |
-
|
| 196 |
-
|
| 197 |
-
|
| 198 |
-
|
| 199 |
-
|
| 200 |
-
|
| 201 |
-
|
| 202 |
-
|
| 203 |
-
|
| 204 |
-
|
| 205 |
-
|
| 206 |
-
|
| 207 |
-
|
| 208 |
-
|
| 209 |
-
|
| 210 |
-
|
| 211 |
-
|
| 212 |
-
|
| 213 |
-
|
| 214 |
-
|
| 215 |
-
|
| 216 |
-
|
| 217 |
-
|
| 218 |
-
|
| 219 |
-
|
| 220 |
-
|
| 221 |
-
|
| 222 |
-
|
| 223 |
-
|
| 224 |
-
|
| 225 |
-
|
| 226 |
-
|
| 227 |
-
|
| 228 |
-
|
| 229 |
-
|
| 230 |
-
|
| 231 |
-
|
| 232 |
-
|
| 233 |
-
|
| 234 |
-
|
| 235 |
-
|
| 236 |
-
|
| 237 |
-
|
| 238 |
-
|
| 239 |
-
|
| 240 |
-
|
| 241 |
-
|
| 242 |
-
|
| 243 |
-
|
| 244 |
-
|
| 245 |
-
|
| 246 |
-
|
| 247 |
-
|
| 248 |
-
|
| 249 |
-
|
| 250 |
-
|
| 251 |
-
|
| 252 |
-
|
| 253 |
-
|
| 254 |
-
|
| 255 |
-
|
| 256 |
-
|
| 257 |
-
|
| 258 |
-
|
| 259 |
-
|
| 260 |
-
|
| 261 |
-
|
| 262 |
-
|
| 263 |
-
|
| 264 |
-
|
| 265 |
-
|
| 266 |
-
|
| 267 |
-
|
| 268 |
-
|
| 269 |
-
|
| 270 |
-
|
| 271 |
-
|
| 272 |
-
|
| 273 |
-
|
| 274 |
-
|
| 275 |
-
|
| 276 |
-
|
| 277 |
-
|
| 278 |
-
|
| 279 |
-
|
| 280 |
-
|
| 281 |
-
|
| 282 |
-
|
| 283 |
-
|
| 284 |
-
|
| 285 |
-
|
| 286 |
-
|
| 287 |
-
|
| 288 |
-
|
| 289 |
-
|
| 290 |
-
|
| 291 |
-
|
| 292 |
-
|
| 293 |
-
|
| 294 |
-
|
| 295 |
-
|
| 296 |
-
|
| 297 |
-
|
| 298 |
-
|
| 299 |
-
|
| 300 |
-
|
| 301 |
-
|
| 302 |
-
|
| 303 |
-
|
| 304 |
-
|
| 305 |
-
|
| 306 |
-
|
| 307 |
-
|
| 308 |
-
|
| 309 |
-
|
| 310 |
-
|
| 311 |
-
|
| 312 |
-
|
| 313 |
-
|
| 314 |
-
|
| 315 |
-
|
| 316 |
-
|
| 317 |
-
|
| 318 |
-
|
| 319 |
-
|
| 320 |
-
|
| 321 |
-
|
| 322 |
-
|
| 323 |
-
|
| 324 |
-
|
| 325 |
-
|
| 326 |
-
|
| 327 |
-
|
| 328 |
-
|
| 329 |
-
|
| 330 |
-
|
| 331 |
-
|
| 332 |
-
|
| 333 |
-
|
| 334 |
-
|
| 335 |
-
|
| 336 |
-
|
| 337 |
-
|
| 338 |
-
|
| 339 |
-
|
| 340 |
-
|
| 341 |
-
|
| 342 |
-
|
| 343 |
-
|
| 344 |
-
|
| 345 |
-
|
| 346 |
-
|
| 347 |
-
|
| 348 |
-
|
| 349 |
-
|
| 350 |
-
|
| 351 |
-
|
| 352 |
-
|
| 353 |
-
|
| 354 |
-
|
| 355 |
-
|
| 356 |
-
|
| 357 |
-
|
| 358 |
-
|
| 359 |
-
|
| 360 |
-
|
| 361 |
-
|
| 362 |
-
|
| 363 |
-
|
| 364 |
-
|
| 365 |
-
|
| 366 |
-
|
| 367 |
-
|
| 368 |
-
|
| 369 |
-
|
| 370 |
-
|
| 371 |
-
|
| 372 |
-
|
| 373 |
-
|
| 374 |
-
|
| 375 |
-
|
| 376 |
-
|
| 377 |
-
|
| 378 |
-
|
| 379 |
-
|
| 380 |
-
|
| 381 |
-
|
| 382 |
-
|
| 383 |
-
|
| 384 |
-
|
| 385 |
-
|
| 386 |
-
|
| 387 |
-
|
| 388 |
-
|
| 389 |
-
|
| 390 |
-
|
| 391 |
-
|
| 392 |
-
|
| 393 |
-
|
| 394 |
-
|
| 395 |
-
|
| 396 |
-
|
| 397 |
-
|
| 398 |
-
|
| 399 |
-
|
| 400 |
-
|
| 401 |
-
|
| 402 |
-
|
| 403 |
-
|
| 404 |
-
|
| 405 |
-
|
| 406 |
-
|
| 407 |
-
|
| 408 |
-
|
| 409 |
-
|
| 410 |
-
|
| 411 |
-
|
| 412 |
-
|
| 413 |
-
|
| 414 |
-
|
| 415 |
-
|
| 416 |
-
|
| 417 |
-
|
| 418 |
-
|
| 419 |
-
|
| 420 |
-
|
| 421 |
-
|
| 422 |
-
|
| 423 |
-
|
| 424 |
-
|
| 425 |
-
|
| 426 |
-
|
| 427 |
-
|
| 428 |
-
|
| 429 |
-
|
| 430 |
-
|
| 431 |
-
|
| 432 |
-
|
| 433 |
-
|
| 434 |
-
|
| 435 |
-
|
| 436 |
-
|
| 437 |
-
|
| 438 |
-
|
| 439 |
-
|
| 440 |
-
|
| 441 |
-
|
| 442 |
-
|
| 443 |
-
|
| 444 |
-
|
| 445 |
-
|
| 446 |
-
|
| 447 |
-
|
| 448 |
-
|
| 449 |
-
|
| 450 |
-
|
| 451 |
-
|
| 452 |
-
|
| 453 |
-
|
| 454 |
-
|
| 455 |
-
|
| 456 |
-
|
| 457 |
-
|
| 458 |
-
|
| 459 |
-
|
| 460 |
-
|
| 461 |
-
|
| 462 |
-
|
| 463 |
-
|
| 464 |
-
|
| 465 |
-
|
| 466 |
-
|
| 467 |
-
|
| 468 |
-
|
| 469 |
-
|
| 470 |
-
|
| 471 |
-
|
| 472 |
-
|
| 473 |
-
|
| 474 |
-
|
| 475 |
-
|
| 476 |
-
|
| 477 |
-
|
| 478 |
-
|
| 479 |
-
|
| 480 |
-
|
| 481 |
-
|
| 482 |
-
|
| 483 |
-
|
| 484 |
-
|
| 485 |
-
|
| 486 |
-
|
| 487 |
-
|
| 488 |
-
|
| 489 |
-
|
| 490 |
-
|
| 491 |
-
|
| 492 |
-
|
| 493 |
-
|
| 494 |
-
|
| 495 |
-
|
| 496 |
-
|
| 497 |
-
|
| 498 |
-
|
| 499 |
-
|
| 500 |
-
|
| 501 |
-
|
| 502 |
-
|
| 503 |
-
|
| 504 |
-
|
| 505 |
-
|
| 506 |
-
|
| 507 |
-
|
| 508 |
-
|
| 509 |
-
|
| 510 |
-
|
| 511 |
-
|
| 512 |
-
|
| 513 |
-
|
| 514 |
-
|
| 515 |
-
|
| 516 |
-
|
| 517 |
-
|
| 518 |
-
|
| 519 |
-
|
| 520 |
-
|
| 521 |
-
|
| 522 |
-
|
| 523 |
-
|
| 524 |
-
|
| 525 |
-
|
| 526 |
-
|
| 527 |
-
|
| 528 |
-
|
| 529 |
-
|
| 530 |
-
|
| 531 |
-
|
| 532 |
-
|
| 533 |
-
|
| 534 |
-
|
| 535 |
-
|
| 536 |
-
|
| 537 |
-
|
| 538 |
-
|
| 539 |
-
|
| 540 |
-
|
| 541 |
-
|
| 542 |
-
|
| 543 |
-
|
| 544 |
-
|
| 545 |
-
|
| 546 |
-
|
| 547 |
-
|
| 548 |
-
|
| 549 |
-
|
| 550 |
-
|
| 551 |
-
|
| 552 |
-
|
| 553 |
-
|
| 554 |
-
|
| 555 |
-
|
| 556 |
-
|
| 557 |
-
|
| 558 |
-
|
| 559 |
-
|
| 560 |
-
|
| 561 |
-
|
| 562 |
-
|
| 563 |
-
|
| 564 |
-
|
| 565 |
-
|
| 566 |
-
|
| 567 |
-
|
| 568 |
-
|
| 569 |
-
|
| 570 |
-
|
| 571 |
-
|
| 572 |
-
|
| 573 |
-
|
| 574 |
-
|
| 575 |
-
|
| 576 |
-
|
| 577 |
-
|
| 578 |
-
|
| 579 |
-
|
| 580 |
-
|
| 581 |
-
|
| 582 |
-
|
| 583 |
-
|
| 584 |
-
|
| 585 |
-
|
| 586 |
-
|
| 587 |
-
|
| 588 |
-
|
| 589 |
-
|
| 590 |
-
|
| 591 |
-
|
| 592 |
-
|
| 593 |
-
|
| 594 |
-
|
| 595 |
-
|
| 596 |
-
|
| 597 |
-
|
| 598 |
-
|
| 599 |
-
|
| 600 |
-
|
| 601 |
-
|
| 602 |
-
|
| 603 |
-
|
| 604 |
-
|
| 605 |
-
|
| 606 |
-
|
| 607 |
-
|
| 608 |
-
|
| 609 |
-
|
| 610 |
-
|
| 611 |
-
|
| 612 |
-
|
| 613 |
-
|
| 614 |
-
|
| 615 |
-
|
| 616 |
-
|
| 617 |
-
|
| 618 |
-
|
| 619 |
-
|
| 620 |
-
|
| 621 |
-
|
| 622 |
-
|
| 623 |
-
|
| 624 |
-
|
| 625 |
-
|
| 626 |
-
|
| 627 |
-
|
| 628 |
-
|
| 629 |
-
|
| 630 |
-
|
| 631 |
-
|
| 632 |
-
|
| 633 |
-
|
| 634 |
-
|
| 635 |
-
|
| 636 |
-
|
| 637 |
-
|
| 638 |
-
|
| 639 |
-
|
| 640 |
-
|
| 641 |
-
|
| 642 |
-
|
| 643 |
-
|
| 644 |
-
|
| 645 |
-
|
| 646 |
-
|
| 647 |
-
|
| 648 |
-
|
| 649 |
-
|
| 650 |
-
|
| 651 |
-
|
| 652 |
-
|
| 653 |
-
|
| 654 |
-
|
| 655 |
-
|
| 656 |
-
|
| 657 |
-
|
| 658 |
-
|
| 659 |
-
|
| 660 |
-
|
| 661 |
-
|
| 662 |
-
|
| 663 |
-
|
| 664 |
-
|
| 665 |
-
|
| 666 |
-
|
| 667 |
-
|
| 668 |
-
|
| 669 |
-
|
| 670 |
-
|
| 671 |
-
|
| 672 |
-
|
| 673 |
-
|
| 674 |
-
|
| 675 |
-
|
| 676 |
-
|
| 677 |
-
mainView: this
|
| 678 |
-
}
|
| 679 |
-
});
|
| 680 |
-
|
| 681 |
-
$(document).trigger("SimpleHistory:init");
|
| 682 |
-
|
| 683 |
-
},
|
| 684 |
-
|
| 685 |
-
/**
|
| 686 |
-
* Add the elements needed for the GUI
|
| 687 |
-
*/
|
| 688 |
-
addNeededElements: function() {
|
| 689 |
-
|
| 690 |
-
var template = $("#tmpl-simple-history-base").html();
|
| 691 |
-
this.$el.html( template );
|
| 692 |
-
|
| 693 |
-
},
|
| 694 |
-
|
| 695 |
-
|
| 696 |
-
});
|
| 697 |
-
|
| 698 |
-
var LogRouter = Backbone.Router.extend({
|
| 699 |
-
|
| 700 |
-
routes: {
|
| 701 |
-
"item/:number": "item",
|
| 702 |
-
'*default': 'default'
|
| 703 |
-
},
|
| 704 |
-
|
| 705 |
-
item: function(logRowID) {
|
| 706 |
-
|
| 707 |
-
var detailsModel = new DetailsModel({
|
| 708 |
-
id: logRowID
|
| 709 |
-
});
|
| 710 |
-
|
| 711 |
-
var detailsView = new DetailsView({
|
| 712 |
-
model: detailsModel
|
| 713 |
-
});
|
| 714 |
-
|
| 715 |
-
},
|
| 716 |
-
|
| 717 |
-
default: function() {
|
| 718 |
-
|
| 719 |
-
return false;
|
| 720 |
-
|
| 721 |
-
}
|
| 722 |
-
|
| 723 |
-
});
|
| 724 |
-
|
| 725 |
-
var mainView = new MainView();
|
| 726 |
-
|
| 727 |
-
// Init MainView on domReady
|
| 728 |
-
// This is to make sure dropins and plugins have been loaded
|
| 729 |
-
$(document).ready(function() {
|
| 730 |
-
|
| 731 |
-
mainView.manualInitialize();
|
| 732 |
-
|
| 733 |
-
});
|
| 734 |
-
|
| 735 |
-
return mainView;
|
| 736 |
-
|
| 737 |
-
})(jQuery);
|
| 738 |
|
| 739 |
/**
|
| 740 |
* When the clear-log-button in admin is clicked then check that users really wants to clear the log
|
| 741 |
*/
|
| 742 |
-
jQuery(
|
| 743 |
-
|
| 744 |
-
|
| 745 |
-
|
| 746 |
-
|
| 747 |
-
e.preventDefault();
|
| 748 |
-
}
|
| 749 |
-
|
| 750 |
});
|
| 751 |
|
| 752 |
/**
|
| 753 |
-
* Add support for TimeAgo
|
| 754 |
*/
|
| 755 |
-
(function($) {
|
| 756 |
-
|
| 757 |
-
var $document = $(document);
|
| 758 |
-
|
| 759 |
-
// called on first load + on pagination
|
| 760 |
-
$document.on("SimpleHistory:logLoaded", addTimeAgo);
|
| 761 |
-
|
| 762 |
-
// when log is loaded and when occassions are loaded
|
| 763 |
-
$document.on("SimpleHistory:logRowsCollectionOccasionsLoaded", addTimeAgo);
|
| 764 |
-
|
| 765 |
-
|
| 766 |
-
function addTimeAgo() {
|
| 767 |
-
|
| 768 |
-
$(".SimpleHistoryLogitem__when time").timeago();
|
| 769 |
-
|
| 770 |
-
}
|
| 771 |
|
|
|
|
|
|
|
| 772 |
|
| 773 |
-
|
|
|
|
| 774 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/* jshint multistr: true */
|
| 2 |
+
|
| 3 |
+
var simple_history = (function ($) {
|
| 4 |
+
var api_base_url = window.ajaxurl
|
| 5 |
+
|
| 6 |
+
// Plugins may have modified the Ajax URL so it already contains query params
|
| 7 |
+
if (api_base_url.indexOf('?') >= 0) {
|
| 8 |
+
api_base_url += '&'
|
| 9 |
+
} else {
|
| 10 |
+
api_base_url += '?'
|
| 11 |
+
}
|
| 12 |
+
|
| 13 |
+
api_base_url += 'action=simple_history_api'
|
| 14 |
+
|
| 15 |
+
var debug = function (what) {
|
| 16 |
+
if (typeof what === 'object') {
|
| 17 |
+
var newWhat = ''
|
| 18 |
+
|
| 19 |
+
_.each(what, function (val, key) {
|
| 20 |
+
newWhat += key + ': ' + val + '\n'
|
| 21 |
+
})
|
| 22 |
+
|
| 23 |
+
what = newWhat
|
| 24 |
+
}
|
| 25 |
+
|
| 26 |
+
$('.SimpleHistoryLogitems__debug').append('<br>' + what)
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
var LogRowsCollection = Backbone.Collection.extend({
|
| 30 |
+
initialize: function (models, options) {
|
| 31 |
+
this.mainView = options.mainView
|
| 32 |
+
|
| 33 |
+
$(document).trigger('SimpleHistory:logRowsCollectionInitialize')
|
| 34 |
+
},
|
| 35 |
+
|
| 36 |
+
reload: function () {
|
| 37 |
+
this.trigger('reload')
|
| 38 |
+
$(document).trigger('SimpleHistory:logRowsCollectionReload')
|
| 39 |
+
|
| 40 |
+
var pager_size = this.mainView.$el.data('pagerSize')
|
| 41 |
+
this.url = api_base_url + '&type=overview&format=html'
|
| 42 |
+
this.url += '&posts_per_page=' + pager_size
|
| 43 |
+
|
| 44 |
+
// Reset some vars
|
| 45 |
+
this.api_args = null
|
| 46 |
+
this.max_id = null
|
| 47 |
+
this.min_id = null
|
| 48 |
+
this.pages_count = null
|
| 49 |
+
this.total_row_count = null
|
| 50 |
+
this.page_rows_from = null
|
| 51 |
+
this.page_rows_to = null
|
| 52 |
+
this.max_id_first_page = null
|
| 53 |
+
|
| 54 |
+
// Get first page
|
| 55 |
+
// We don't have max_id yet
|
| 56 |
+
var that = this
|
| 57 |
+
var url_data = {
|
| 58 |
+
paged: 1
|
| 59 |
+
// here we want to append custom args/data for filters
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
// trigger so plugins can modify url parameters
|
| 63 |
+
this.trigger('before_fetch', this, url_data)
|
| 64 |
+
|
| 65 |
+
this.fetch({
|
| 66 |
+
reset: true,
|
| 67 |
+
data: url_data,
|
| 68 |
+
// called on 404 and similar
|
| 69 |
+
error: function (collection, response, options) {
|
| 70 |
+
collection.trigger('reloadError', [response, options])
|
| 71 |
+
$(document).trigger('SimpleHistory:logRowsCollectionReloadError', [
|
| 72 |
+
response,
|
| 73 |
+
options
|
| 74 |
+
])
|
| 75 |
+
},
|
| 76 |
+
success: function (collection, response, options) {
|
| 77 |
+
collection.trigger('reloadDone', [response, options])
|
| 78 |
+
$(document).trigger('SimpleHistory:logRowsCollectionReloadDone', [
|
| 79 |
+
response,
|
| 80 |
+
options
|
| 81 |
+
])
|
| 82 |
+
}
|
| 83 |
+
})
|
| 84 |
+
},
|
| 85 |
+
|
| 86 |
+
/*
|
| 87 |
+
* Parse ajax response to make it fit to format used by backbone
|
| 88 |
+
*/
|
| 89 |
+
parse: function (resp, xhr) {
|
| 90 |
+
if (!resp || !resp.data) {
|
| 91 |
+
alert('Error in response, could not parse')
|
| 92 |
+
return
|
| 93 |
+
}
|
| 94 |
+
|
| 95 |
+
this.api_args = resp.data.api_args
|
| 96 |
+
this.max_id = resp.data.max_id
|
| 97 |
+
this.min_id = resp.data.min_id
|
| 98 |
+
this.pages_count = resp.data.pages_count
|
| 99 |
+
this.total_row_count = resp.data.total_row_count
|
| 100 |
+
this.page_rows_from = resp.data.page_rows_from
|
| 101 |
+
this.page_rows_to = resp.data.page_rows_to
|
| 102 |
+
|
| 103 |
+
// Store first max_id found, since that's the max id we use for
|
| 104 |
+
// all subsequent paginations
|
| 105 |
+
if (!this.max_id_first_page) {
|
| 106 |
+
this.max_id_first_page = this.max_id
|
| 107 |
+
$(document).trigger('SimpleHistory:logRowsCollectionFirstLoad')
|
| 108 |
+
|
| 109 |
+
$('.SimpleHistory__waitingForFirstLoad').addClass(
|
| 110 |
+
'SimpleHistory__waitingForFirstLoad--isLoaded'
|
| 111 |
+
)
|
| 112 |
+
|
| 113 |
+
// Add class to body to so we can catch loaded log everywhere in CSS
|
| 114 |
+
$('body').addClass('SimpleHistory--isLoaded')
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
var arrRows = []
|
| 118 |
+
_.each(resp.data.log_rows, function (row) {
|
| 119 |
+
arrRows.push({
|
| 120 |
+
html: row
|
| 121 |
+
})
|
| 122 |
+
})
|
| 123 |
+
|
| 124 |
+
return arrRows
|
| 125 |
+
}
|
| 126 |
+
})
|
| 127 |
+
|
| 128 |
+
var OccasionsLogRowsCollection = Backbone.Collection.extend({
|
| 129 |
+
initialize: function (models, options) {
|
| 130 |
+
this.url = api_base_url + '&type=occasions&format=html'
|
| 131 |
+
|
| 132 |
+
this.fetch({
|
| 133 |
+
reset: true,
|
| 134 |
+
data: {
|
| 135 |
+
logRowID: options.logRowID,
|
| 136 |
+
occasionsID: options.occasionsID,
|
| 137 |
+
occasionsCount: options.occasionsCount,
|
| 138 |
+
occasionsCountMaxReturn: options.occasionsCountMaxReturn
|
| 139 |
+
}
|
| 140 |
+
})
|
| 141 |
+
},
|
| 142 |
+
|
| 143 |
+
parse: function (resp, xhr) {
|
| 144 |
+
this.api_args = resp.data.api_args
|
| 145 |
+
this.max_id = resp.data.max_id
|
| 146 |
+
this.min_id = resp.data.min_id
|
| 147 |
+
this.pages_count = resp.data.pages_count
|
| 148 |
+
this.total_row_count = resp.data.total_row_count
|
| 149 |
+
this.page_rows_from = resp.data.page_rows_from
|
| 150 |
+
this.page_rows_to = resp.data.page_rows_to
|
| 151 |
+
|
| 152 |
+
var arrRows = []
|
| 153 |
+
_.each(resp.data.log_rows, function (row) {
|
| 154 |
+
arrRows.push({
|
| 155 |
+
html: row
|
| 156 |
+
})
|
| 157 |
+
})
|
| 158 |
+
|
| 159 |
+
return arrRows
|
| 160 |
+
}
|
| 161 |
+
})
|
| 162 |
+
|
| 163 |
+
var OccasionsView = Backbone.View.extend({
|
| 164 |
+
initialize: function () {
|
| 165 |
+
var logRowID = this.attributes.logRow.data('rowId')
|
| 166 |
+
var occasionsCount = this.attributes.logRow.data('occasionsCount')
|
| 167 |
+
var occasionsCountMaxReturn = 15
|
| 168 |
+
this.occasionsCountMaxReturn = occasionsCountMaxReturn
|
| 169 |
+
var occasionsID = this.attributes.logRow.data('occasionsId')
|
| 170 |
+
|
| 171 |
+
this.attributes.logRow.addClass('SimpleHistoryLogitem--occasionsOpening')
|
| 172 |
+
|
| 173 |
+
this.logRows = new OccasionsLogRowsCollection([], {
|
| 174 |
+
logRow: this.attributes.logRow,
|
| 175 |
+
logRowID: logRowID,
|
| 176 |
+
occasionsID: occasionsID,
|
| 177 |
+
occasionsCount: occasionsCount,
|
| 178 |
+
occasionsCountMaxReturn: occasionsCountMaxReturn
|
| 179 |
+
})
|
| 180 |
+
|
| 181 |
+
this.logRows.on('reset', this.render, this)
|
| 182 |
+
|
| 183 |
+
// Trigger event for plugins
|
| 184 |
+
this.logRows.on(
|
| 185 |
+
'reset',
|
| 186 |
+
function () {
|
| 187 |
+
$(document).trigger('SimpleHistory:logRowsCollectionOccasionsLoaded')
|
| 188 |
+
},
|
| 189 |
+
this
|
| 190 |
+
)
|
| 191 |
+
},
|
| 192 |
+
|
| 193 |
+
render: function () {
|
| 194 |
+
var $html = $([])
|
| 195 |
+
|
| 196 |
+
this.logRows.each(function (model) {
|
| 197 |
+
var $li = $(model.get('html'))
|
| 198 |
+
$li.addClass('SimpleHistoryLogitem--occasion')
|
| 199 |
+
$html = $html.add($li)
|
| 200 |
+
})
|
| 201 |
+
|
| 202 |
+
// If occasionsCount is more than occasionsCountMaxReturn then show a message
|
| 203 |
+
var occasionsCount = this.attributes.logRow.data('occasionsCount')
|
| 204 |
+
if (occasionsCount > this.occasionsCountMaxReturn) {
|
| 205 |
+
var templateTooMany = wp.template('simple-history-occasions-too-many')
|
| 206 |
+
$html = $html.add(
|
| 207 |
+
templateTooMany({
|
| 208 |
+
occasionsCount: occasionsCount,
|
| 209 |
+
occasionsCountMaxReturn: this.occasionsCountMaxReturn
|
| 210 |
+
})
|
| 211 |
+
)
|
| 212 |
+
}
|
| 213 |
+
|
| 214 |
+
this.$el.html($html)
|
| 215 |
+
|
| 216 |
+
this.attributes.logRow
|
| 217 |
+
.removeClass('SimpleHistoryLogitem--occasionsOpening')
|
| 218 |
+
.addClass('SimpleHistoryLogitem--occasionsOpened')
|
| 219 |
+
|
| 220 |
+
this.$el.addClass('haveOccasionsAdded')
|
| 221 |
+
}
|
| 222 |
+
})
|
| 223 |
+
|
| 224 |
+
var DetailsModel = Backbone.Model.extend({
|
| 225 |
+
url: api_base_url + '&type=single&format=html'
|
| 226 |
+
})
|
| 227 |
+
|
| 228 |
+
/**
|
| 229 |
+
* DetailsView is a modal popup thingie with all info about a LogRow
|
| 230 |
+
*/
|
| 231 |
+
var DetailsView = Backbone.View.extend({
|
| 232 |
+
initialize: function (attributes) {
|
| 233 |
+
this.model.fetch({
|
| 234 |
+
data: {
|
| 235 |
+
id: this.model.get('id')
|
| 236 |
+
}
|
| 237 |
+
})
|
| 238 |
+
|
| 239 |
+
this.template = $('#tmpl-simple-history-logitems-modal').html()
|
| 240 |
+
this.show()
|
| 241 |
+
|
| 242 |
+
this.listenTo(this.model, 'change', this.render)
|
| 243 |
+
|
| 244 |
+
// also close on esc
|
| 245 |
+
var view = this
|
| 246 |
+
$(document).on('keydown.simplehistory.modal', function (e) {
|
| 247 |
+
if (e.keyCode == 27) {
|
| 248 |
+
view.close()
|
| 249 |
+
}
|
| 250 |
+
})
|
| 251 |
+
},
|
| 252 |
+
|
| 253 |
+
events: {
|
| 254 |
+
'click .SimpleHistory-modal__background': 'close',
|
| 255 |
+
'click .SimpleHistory-modal__contentClose': 'close'
|
| 256 |
+
},
|
| 257 |
+
|
| 258 |
+
show: function () {
|
| 259 |
+
var $modalEl = $('.SimpleHistory-modal')
|
| 260 |
+
|
| 261 |
+
if (!$modalEl.length) {
|
| 262 |
+
$modalEl = $(this.template)
|
| 263 |
+
$modalEl.appendTo('body')
|
| 264 |
+
}
|
| 265 |
+
|
| 266 |
+
this.setElement($modalEl)
|
| 267 |
+
|
| 268 |
+
var $modalContentEl = $modalEl.find('.SimpleHistory-modal__content')
|
| 269 |
+
$modalContentEl.addClass('SimpleHistory-modal__content--enter')
|
| 270 |
+
|
| 271 |
+
// Force repaint before adding active class
|
| 272 |
+
var offsetHeight = $modalContentEl.get(0).offsetHeight
|
| 273 |
+
$modalContentEl.addClass('SimpleHistory-modal__content--enter-active')
|
| 274 |
+
},
|
| 275 |
+
|
| 276 |
+
close: function () {
|
| 277 |
+
var $modalContentEl = this.$el.find('.SimpleHistory-modal__content')
|
| 278 |
+
$modalContentEl.addClass('SimpleHistory-modal__content--leave')
|
| 279 |
+
|
| 280 |
+
// Force repaint before adding active class
|
| 281 |
+
var offsetHeight = $modalContentEl.get(0).offsetHeight
|
| 282 |
+
|
| 283 |
+
$modalContentEl.addClass('SimpleHistory-modal__content--leave-active')
|
| 284 |
+
this.$el.addClass('SimpleHistory-modal__leave-active')
|
| 285 |
+
|
| 286 |
+
// Cleanup
|
| 287 |
+
var view = this
|
| 288 |
+
setTimeout(function () {
|
| 289 |
+
view.$el.remove()
|
| 290 |
+
$(document).off('keyup.simplehistory.modal')
|
| 291 |
+
view.remove()
|
| 292 |
+
Backbone.history.navigate('overview')
|
| 293 |
+
}, 400)
|
| 294 |
+
},
|
| 295 |
+
|
| 296 |
+
render: function () {
|
| 297 |
+
var $modalContentInnerEl = this.$el.find(
|
| 298 |
+
'.SimpleHistory-modal__contentInner'
|
| 299 |
+
)
|
| 300 |
+
var logRowLI = this.model.get('data').log_rows[0]
|
| 301 |
+
$modalContentInnerEl.html(logRowLI)
|
| 302 |
+
}
|
| 303 |
+
})
|
| 304 |
+
|
| 305 |
+
var RowsView = Backbone.View.extend({
|
| 306 |
+
initialize: function () {
|
| 307 |
+
this.collection.on('reset', this.render, this)
|
| 308 |
+
this.collection.on('reload', this.onReload, this)
|
| 309 |
+
this.collection.on('reloadDone', this.onReloadDone, this)
|
| 310 |
+
this.collection.on('reloadError', this.onReloadError, this)
|
| 311 |
+
|
| 312 |
+
// Trigger event for plugins
|
| 313 |
+
this.collection.on(
|
| 314 |
+
'reset',
|
| 315 |
+
function () {
|
| 316 |
+
$(document).trigger('SimpleHistory:logLoaded')
|
| 317 |
+
},
|
| 318 |
+
this
|
| 319 |
+
)
|
| 320 |
+
},
|
| 321 |
+
|
| 322 |
+
onReloadError: function (args) {
|
| 323 |
+
// If we get an error while loading the log it can be because the AJAX response
|
| 324 |
+
// is returning parts of HTML because of plugins giving errors
|
| 325 |
+
// not our fault, but instead of just ajax spinning forever we can
|
| 326 |
+
// tell the user about this perhaps and they can do something about it
|
| 327 |
+
// or else they will uninstall the plugin (worst) or post in support forum (better)
|
| 328 |
+
// or we can help them solve it here (best)
|
| 329 |
+
var response = args[0]
|
| 330 |
+
|
| 331 |
+
if (response && response.responseText) {
|
| 332 |
+
// console.log( response.responseText );
|
| 333 |
+
$('html').removeClass('SimpleHistory-isLoadingPage')
|
| 334 |
+
$('.SimpleHistory__waitingForFirstLoad').addClass(
|
| 335 |
+
'SimpleHistory__waitingForFirstLoad--isLoaded'
|
| 336 |
+
)
|
| 337 |
+
|
| 338 |
+
var $mainViewElm = this.collection.mainView.$el
|
| 339 |
+
$mainViewElm.addClass('SimpleHistory--ajaxHasErrors')
|
| 340 |
+
|
| 341 |
+
var noHitsClass = 'SimpleHistoryLogitems__ajaxError'
|
| 342 |
+
|
| 343 |
+
// Remove maybe previous div with message
|
| 344 |
+
$mainViewElm.find('.' + noHitsClass).remove()
|
| 345 |
+
|
| 346 |
+
// Add div with message
|
| 347 |
+
var $noHitsElm = $('<div />')
|
| 348 |
+
.html(
|
| 349 |
+
"<div class='SimpleHistoryLogitems__ajaxError__infoMessage'>" +
|
| 350 |
+
simple_history_script_vars.ajaxLoadError +
|
| 351 |
+
'</div>' +
|
| 352 |
+
response.responseText
|
| 353 |
+
)
|
| 354 |
+
.addClass(noHitsClass)
|
| 355 |
+
.appendTo($mainViewElm.find('.SimpleHistoryLogitems__above'))
|
| 356 |
+
}
|
| 357 |
+
},
|
| 358 |
+
|
| 359 |
+
onReload: function () {
|
| 360 |
+
$(document).trigger('SimpleHistory:logReloadStart')
|
| 361 |
+
|
| 362 |
+
$('html').addClass('SimpleHistory-isLoadingPage')
|
| 363 |
+
},
|
| 364 |
+
|
| 365 |
+
onReloadDone: function () {
|
| 366 |
+
$('html').removeClass('SimpleHistory-isLoadingPage')
|
| 367 |
+
|
| 368 |
+
var $mainViewElm = this.collection.mainView.$el
|
| 369 |
+
|
| 370 |
+
// Remove maybe previous div with ajax error message
|
| 371 |
+
$mainViewElm.find('.SimpleHistoryLogitems__ajaxError').remove()
|
| 372 |
+
|
| 373 |
+
// Add message if no hits
|
| 374 |
+
$mainViewElm.removeClass('SimpleHistory--hasNoHits')
|
| 375 |
+
if (!this.collection.length) {
|
| 376 |
+
$mainViewElm.addClass('SimpleHistory--hasNoHits')
|
| 377 |
+
|
| 378 |
+
var noHitsClass = 'SimpleHistoryLogitems__noHits'
|
| 379 |
+
|
| 380 |
+
// Remove maybe previous div with message
|
| 381 |
+
$mainViewElm.find('.' + noHitsClass).remove()
|
| 382 |
+
|
| 383 |
+
// Add div with message
|
| 384 |
+
var $noHitsElm = $('<div />')
|
| 385 |
+
.html(simple_history_script_vars.logNoHits)
|
| 386 |
+
.addClass(noHitsClass)
|
| 387 |
+
.appendTo($mainViewElm.find('.SimpleHistoryLogitems__above'))
|
| 388 |
+
} // add msg
|
| 389 |
+
},
|
| 390 |
+
|
| 391 |
+
events: {
|
| 392 |
+
'click .SimpleHistoryLogitem__occasions a': 'showOccasions',
|
| 393 |
+
'click .SimpleHistoryLogitem__permalink': 'permalink'
|
| 394 |
+
},
|
| 395 |
+
|
| 396 |
+
permalink: function (e) {
|
| 397 |
+
// If cmd is pressed then don't show modal because then user wants
|
| 398 |
+
// to open modal in new window/tab
|
| 399 |
+
if (e.metaKey) {
|
| 400 |
+
return true
|
| 401 |
+
}
|
| 402 |
+
|
| 403 |
+
e.preventDefault()
|
| 404 |
+
|
| 405 |
+
var $target = $(e.target)
|
| 406 |
+
var $logRow = $target.closest('.SimpleHistoryLogitem')
|
| 407 |
+
var logRowID = $logRow.data('rowId')
|
| 408 |
+
|
| 409 |
+
Backbone.history.navigate('item/' + logRowID, { trigger: true })
|
| 410 |
+
},
|
| 411 |
+
|
| 412 |
+
showOccasions: function (e) {
|
| 413 |
+
e.preventDefault()
|
| 414 |
+
|
| 415 |
+
var $target = $(e.target)
|
| 416 |
+
var $logRow = $target.closest('.SimpleHistoryLogitem')
|
| 417 |
+
var $occasionsElm = $(
|
| 418 |
+
"<li class='SimpleHistoryLogitem__occasionsItemsWrap'><ul class='SimpleHistoryLogitem__occasionsItems'/></li>"
|
| 419 |
+
)
|
| 420 |
+
|
| 421 |
+
$logRow.after($occasionsElm)
|
| 422 |
+
|
| 423 |
+
this.occasionsView = new OccasionsView({
|
| 424 |
+
el: $occasionsElm.find('.SimpleHistoryLogitem__occasionsItems'),
|
| 425 |
+
attributes: {
|
| 426 |
+
logRow: $logRow
|
| 427 |
+
}
|
| 428 |
+
})
|
| 429 |
+
},
|
| 430 |
+
|
| 431 |
+
render: function () {
|
| 432 |
+
var html = ''
|
| 433 |
+
this.collection.each(function (model) {
|
| 434 |
+
html += model.get('html')
|
| 435 |
+
})
|
| 436 |
+
|
| 437 |
+
this.$el.html(html)
|
| 438 |
+
|
| 439 |
+
// Rendering of log rows items is done
|
| 440 |
+
this.trigger('renderDone')
|
| 441 |
+
}
|
| 442 |
+
})
|
| 443 |
+
|
| 444 |
+
var PaginationView = Backbone.View.extend({
|
| 445 |
+
initialize: function () {
|
| 446 |
+
$(document).keydown({ view: this }, this.keyboardNav)
|
| 447 |
+
|
| 448 |
+
this.collection.on('reset', this.render, this)
|
| 449 |
+
},
|
| 450 |
+
|
| 451 |
+
events: {
|
| 452 |
+
'click .SimpleHistoryPaginationLink': 'navigateArrow',
|
| 453 |
+
'keyup .SimpleHistoryPaginationCurrentPage': 'navigateToPage',
|
| 454 |
+
keydown: 'keydown'
|
| 455 |
+
},
|
| 456 |
+
|
| 457 |
+
keyboardNav: function (e) {
|
| 458 |
+
// if modal with details is open then don't nav away
|
| 459 |
+
if ($('.SimpleHistory-modal').length) {
|
| 460 |
+
return
|
| 461 |
+
}
|
| 462 |
+
|
| 463 |
+
// Only go on if on own page
|
| 464 |
+
if (!$('.dashboard_page_simple_history_page').length) {
|
| 465 |
+
return
|
| 466 |
+
}
|
| 467 |
+
|
| 468 |
+
// Don't nav away if a text input (like the search box) is selected
|
| 469 |
+
var $target = $(e.target)
|
| 470 |
+
if ($target.is('input')) {
|
| 471 |
+
return
|
| 472 |
+
}
|
| 473 |
+
|
| 474 |
+
var paged
|
| 475 |
+
|
| 476 |
+
if (e.keyCode == 37) {
|
| 477 |
+
// prev page
|
| 478 |
+
paged = +e.data.view.collection.api_args.paged - 1
|
| 479 |
+
} else if (e.keyCode == 39) {
|
| 480 |
+
// next page
|
| 481 |
+
paged = +e.data.view.collection.api_args.paged + 1
|
| 482 |
+
}
|
| 483 |
+
|
| 484 |
+
if (paged) {
|
| 485 |
+
e.data.view.fetchPage(paged)
|
| 486 |
+
}
|
| 487 |
+
},
|
| 488 |
+
|
| 489 |
+
navigateToPage: function (e) {
|
| 490 |
+
// keycode 13 = enter
|
| 491 |
+
if (e.keyCode == 13) {
|
| 492 |
+
var $target = $(e.target)
|
| 493 |
+
var paged = parseInt($target.val())
|
| 494 |
+
|
| 495 |
+
// We must go to a page more than zero and max total_row_count
|
| 496 |
+
if (paged < 1) {
|
| 497 |
+
paged = 1
|
| 498 |
+
}
|
| 499 |
+
|
| 500 |
+
if (paged > this.collection.pages_count) {
|
| 501 |
+
paged = this.collection.pages_count
|
| 502 |
+
}
|
| 503 |
+
|
| 504 |
+
this.fetchPage(paged)
|
| 505 |
+
}
|
| 506 |
+
},
|
| 507 |
+
|
| 508 |
+
navigateArrow: function (e) {
|
| 509 |
+
e.preventDefault()
|
| 510 |
+
var $target = $(e.target)
|
| 511 |
+
|
| 512 |
+
// if link has class disabled then don't nav away
|
| 513 |
+
if ($target.is('.disabled')) {
|
| 514 |
+
return
|
| 515 |
+
}
|
| 516 |
+
|
| 517 |
+
// direction = first|prev|next|last
|
| 518 |
+
var direction = $target.data('direction')
|
| 519 |
+
|
| 520 |
+
var paged
|
| 521 |
+
switch (direction) {
|
| 522 |
+
case 'first':
|
| 523 |
+
paged = 1
|
| 524 |
+
break
|
| 525 |
+
|
| 526 |
+
case 'last':
|
| 527 |
+
paged = this.collection.pages_count
|
| 528 |
+
break
|
| 529 |
+
|
| 530 |
+
case 'prev':
|
| 531 |
+
paged = +this.collection.api_args.paged - 1
|
| 532 |
+
break
|
| 533 |
+
|
| 534 |
+
case 'next':
|
| 535 |
+
paged = +this.collection.api_args.paged + 1
|
| 536 |
+
break
|
| 537 |
+
}
|
| 538 |
+
|
| 539 |
+
this.fetchPage(paged)
|
| 540 |
+
},
|
| 541 |
+
|
| 542 |
+
/**
|
| 543 |
+
* Fetch a page from the server
|
| 544 |
+
* Calls collection.fetch with the page we want to view as argument
|
| 545 |
+
*/
|
| 546 |
+
fetchPage: function (paged) {
|
| 547 |
+
$(document).trigger('SimpleHistory:logReloadStart')
|
| 548 |
+
|
| 549 |
+
$('html').addClass('SimpleHistory-isLoadingPage')
|
| 550 |
+
|
| 551 |
+
var url_data = {
|
| 552 |
+
paged: paged,
|
| 553 |
+
max_id_first_page: this.collection.max_id_first_page
|
| 554 |
+
}
|
| 555 |
+
|
| 556 |
+
this.collection.trigger('before_fetch', this.collection, url_data)
|
| 557 |
+
|
| 558 |
+
// nav = fetch collection items again
|
| 559 |
+
this.collection.fetch({
|
| 560 |
+
reset: true,
|
| 561 |
+
data: url_data,
|
| 562 |
+
success: function () {
|
| 563 |
+
$('html').removeClass('SimpleHistory-isLoadingPage')
|
| 564 |
+
}
|
| 565 |
+
})
|
| 566 |
+
|
| 567 |
+
// Scroll to top of el
|
| 568 |
+
$('html, body').animate(
|
| 569 |
+
{
|
| 570 |
+
scrollTop: this.attributes.mainView.$el.offset().top - 85
|
| 571 |
+
},
|
| 572 |
+
350
|
| 573 |
+
)
|
| 574 |
+
},
|
| 575 |
+
|
| 576 |
+
render: function () {
|
| 577 |
+
var compiled = wp.template('simple-history-logitems-pagination')
|
| 578 |
+
|
| 579 |
+
this.$el.html(
|
| 580 |
+
compiled({
|
| 581 |
+
min_id: this.collection.min_id,
|
| 582 |
+
max_id: this.collection.max_id,
|
| 583 |
+
pages_count: this.collection.pages_count,
|
| 584 |
+
total_row_count: this.collection.total_row_count,
|
| 585 |
+
page_rows_from: this.collection.page_rows_from,
|
| 586 |
+
page_rows_to: this.collection.page_rows_to,
|
| 587 |
+
api_args: this.collection.api_args,
|
| 588 |
+
strings: simple_history_script_vars.pagination
|
| 589 |
+
})
|
| 590 |
+
)
|
| 591 |
+
}
|
| 592 |
+
})
|
| 593 |
+
|
| 594 |
+
var MainView = Backbone.View.extend({
|
| 595 |
+
el: '.SimpleHistoryGui',
|
| 596 |
+
|
| 597 |
+
initialize: function () {
|
| 598 |
+
this.addNeededElements()
|
| 599 |
+
},
|
| 600 |
+
|
| 601 |
+
manualInitialize: function () {
|
| 602 |
+
// Don't try to init if our element does not exist
|
| 603 |
+
if (!this.$el.length) {
|
| 604 |
+
return
|
| 605 |
+
}
|
| 606 |
+
|
| 607 |
+
this.logRouter = new LogRouter()
|
| 608 |
+
Backbone.history.start()
|
| 609 |
+
|
| 610 |
+
this.logRowsCollection = new LogRowsCollection([], {
|
| 611 |
+
mainView: this
|
| 612 |
+
})
|
| 613 |
+
|
| 614 |
+
this.rowsView = new RowsView({
|
| 615 |
+
el: this.$el.find('.SimpleHistoryLogitems'),
|
| 616 |
+
collection: this.logRowsCollection
|
| 617 |
+
})
|
| 618 |
+
|
| 619 |
+
$(document).trigger('SimpleHistory:mainViewInitBeforeLoadRows')
|
| 620 |
+
|
| 621 |
+
// Load log first time
|
| 622 |
+
this.logRowsCollection.reload()
|
| 623 |
+
|
| 624 |
+
$(document).trigger('SimpleHistory:mainViewInitAfterLoadRows')
|
| 625 |
+
|
| 626 |
+
this.paginationView = new PaginationView({
|
| 627 |
+
el: this.$el.find('.SimpleHistoryLogitems__pagination'),
|
| 628 |
+
collection: this.logRowsCollection,
|
| 629 |
+
attributes: {
|
| 630 |
+
mainView: this
|
| 631 |
+
}
|
| 632 |
+
})
|
| 633 |
+
|
| 634 |
+
$(document).trigger('SimpleHistory:init')
|
| 635 |
+
},
|
| 636 |
+
|
| 637 |
+
/**
|
| 638 |
+
* Add the elements needed for the GUI
|
| 639 |
+
*/
|
| 640 |
+
addNeededElements: function () {
|
| 641 |
+
var template = $('#tmpl-simple-history-base').html()
|
| 642 |
+
this.$el.html(template)
|
| 643 |
+
}
|
| 644 |
+
})
|
| 645 |
+
|
| 646 |
+
var LogRouter = Backbone.Router.extend({
|
| 647 |
+
routes: {
|
| 648 |
+
'item/:number': 'item',
|
| 649 |
+
'*default': 'default'
|
| 650 |
+
},
|
| 651 |
+
|
| 652 |
+
item: function (logRowID) {
|
| 653 |
+
var detailsModel = new DetailsModel({
|
| 654 |
+
id: logRowID
|
| 655 |
+
})
|
| 656 |
+
|
| 657 |
+
var detailsView = new DetailsView({
|
| 658 |
+
model: detailsModel
|
| 659 |
+
})
|
| 660 |
+
},
|
| 661 |
+
|
| 662 |
+
default: function () {
|
| 663 |
+
return false
|
| 664 |
+
}
|
| 665 |
+
})
|
| 666 |
+
|
| 667 |
+
var mainView = new MainView()
|
| 668 |
+
|
| 669 |
+
// Init MainView on domReady
|
| 670 |
+
// This is to make sure dropins and plugins have been loaded
|
| 671 |
+
$(document).ready(function () {
|
| 672 |
+
mainView.manualInitialize()
|
| 673 |
+
})
|
| 674 |
+
|
| 675 |
+
return mainView
|
| 676 |
+
})(jQuery)
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 677 |
|
| 678 |
/**
|
| 679 |
* When the clear-log-button in admin is clicked then check that users really wants to clear the log
|
| 680 |
*/
|
| 681 |
+
jQuery('.js-SimpleHistory-Settings-ClearLog').on('click', function (e) {
|
| 682 |
+
if (confirm(simple_history_script_vars.settingsConfirmClearLog)) {
|
| 683 |
+
} else {
|
| 684 |
+
e.preventDefault()
|
| 685 |
+
}
|
|
|
|
|
|
|
|
|
|
| 686 |
});
|
| 687 |
|
| 688 |
/**
|
| 689 |
+
* Add support for TimeAgo.
|
| 690 |
*/
|
| 691 |
+
(function ($) {
|
| 692 |
+
var $document = $(document)
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 693 |
|
| 694 |
+
// Called on first load + on pagination.
|
| 695 |
+
$document.on('SimpleHistory:logLoaded', addTimeAgo)
|
| 696 |
|
| 697 |
+
// Called log is loaded and when occassions are loaded.
|
| 698 |
+
$document.on('SimpleHistory:logRowsCollectionOccasionsLoaded', addTimeAgo)
|
| 699 |
|
| 700 |
+
function addTimeAgo () {
|
| 701 |
+
$(
|
| 702 |
+
'.SimpleHistoryLogitem__when time.SimpleHistoryLogitem__when__liveRelative'
|
| 703 |
+
).timeago()
|
| 704 |
+
}
|
| 705 |
+
})(jQuery)
|
js/select2-3.5.1-old/LICENSE
DELETED
|
@@ -1,18 +0,0 @@
|
|
| 1 |
-
Copyright 2014 Igor Vaynberg
|
| 2 |
-
|
| 3 |
-
Version: @@ver@@ Timestamp: @@timestamp@@
|
| 4 |
-
|
| 5 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 6 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 7 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 8 |
-
License or the GPL License.
|
| 9 |
-
|
| 10 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
| 11 |
-
|
| 12 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
| 13 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
| 14 |
-
|
| 15 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
| 16 |
-
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
| 17 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
| 18 |
-
permissions and limitations under the Apache License and the GPL License.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/README.md
DELETED
|
@@ -1,99 +0,0 @@
|
|
| 1 |
-
Select2
|
| 2 |
-
=======
|
| 3 |
-
|
| 4 |
-
Select2 is a jQuery-based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.
|
| 5 |
-
|
| 6 |
-
To get started, checkout examples and documentation at http://ivaynberg.github.com/select2
|
| 7 |
-
|
| 8 |
-
Use cases
|
| 9 |
-
---------
|
| 10 |
-
|
| 11 |
-
* Enhancing native selects with search.
|
| 12 |
-
* Enhancing native selects with a better multi-select interface.
|
| 13 |
-
* Loading data from JavaScript: easily load items via ajax and have them searchable.
|
| 14 |
-
* Nesting optgroups: native selects only support one level of nested. Select2 does not have this restriction.
|
| 15 |
-
* Tagging: ability to add new items on the fly.
|
| 16 |
-
* Working with large, remote datasets: ability to partially load a dataset based on the search term.
|
| 17 |
-
* Paging of large datasets: easy support for loading more pages when the results are scrolled to the end.
|
| 18 |
-
* Templating: support for custom rendering of results and selections.
|
| 19 |
-
|
| 20 |
-
Browser compatibility
|
| 21 |
-
---------------------
|
| 22 |
-
* IE 8+
|
| 23 |
-
* Chrome 8+
|
| 24 |
-
* Firefox 10+
|
| 25 |
-
* Safari 3+
|
| 26 |
-
* Opera 10.6+
|
| 27 |
-
|
| 28 |
-
Usage
|
| 29 |
-
-----
|
| 30 |
-
You can source Select2 directly from a [CDN like JSDliver](http://www.jsdelivr.com/#!select2), [download it from this GitHub repo](https://github.com/ivaynberg/select2/tags), or use one of the integrations below.
|
| 31 |
-
|
| 32 |
-
Integrations
|
| 33 |
-
------------
|
| 34 |
-
|
| 35 |
-
* [Wicket-Select2](https://github.com/ivaynberg/wicket-select2) (Java / [Apache Wicket](http://wicket.apache.org))
|
| 36 |
-
* [select2-rails](https://github.com/argerim/select2-rails) (Ruby on Rails)
|
| 37 |
-
* [AngularUI](http://angular-ui.github.com/#directives-select2) ([AngularJS](angularjs.org))
|
| 38 |
-
* [Django](https://github.com/applegrew/django-select2)
|
| 39 |
-
* [Symfony](https://github.com/19Gerhard85/sfSelect2WidgetsPlugin)
|
| 40 |
-
* [Symfony2](https://github.com/avocode/FormExtensions)
|
| 41 |
-
* [Bootstrap 2](https://github.com/t0m/select2-bootstrap-css) and [Bootstrap 3](https://github.com/t0m/select2-bootstrap-css/tree/bootstrap3) (CSS skins)
|
| 42 |
-
* [Meteor](https://github.com/nate-strauser/meteor-select2) (modern reactive JavaScript framework; + [Bootstrap 3 skin](https://github.com/esperadomedia/meteor-select2-bootstrap3-css/))
|
| 43 |
-
* [Meteor](https://jquery-select2.meteor.com)
|
| 44 |
-
* [Yii 2.x](http://demos.krajee.com/widgets#select2)
|
| 45 |
-
* [Yii 1.x](https://github.com/tonybolzan/yii-select2)
|
| 46 |
-
* [AtmosphereJS](https://atmospherejs.com/package/jquery-select2)
|
| 47 |
-
|
| 48 |
-
### Example Integrations
|
| 49 |
-
|
| 50 |
-
* [Knockout.js](https://github.com/ivaynberg/select2/wiki/Knockout.js-Integration)
|
| 51 |
-
* [Socket.IO](https://github.com/ivaynberg/select2/wiki/Socket.IO-Integration)
|
| 52 |
-
* [PHP](https://github.com/ivaynberg/select2/wiki/PHP-Example)
|
| 53 |
-
* [.Net MVC] (https://github.com/ivaynberg/select2/wiki/.Net-MVC-Example)
|
| 54 |
-
|
| 55 |
-
Internationalization (i18n)
|
| 56 |
-
---------------------------
|
| 57 |
-
|
| 58 |
-
Select2 supports multiple languages by simply including the right language JS
|
| 59 |
-
file (`select2_locale_it.js`, `select2_locale_nl.js`, etc.) after `select2.js`.
|
| 60 |
-
|
| 61 |
-
Missing a language? Just copy `select2_locale_en.js.template`, translate
|
| 62 |
-
it, and make a pull request back to Select2 here on GitHub.
|
| 63 |
-
|
| 64 |
-
Bug tracker
|
| 65 |
-
-----------
|
| 66 |
-
|
| 67 |
-
Have a bug? Please create an issue here on GitHub!
|
| 68 |
-
|
| 69 |
-
https://github.com/ivaynberg/select2/issues
|
| 70 |
-
|
| 71 |
-
Mailing list
|
| 72 |
-
------------
|
| 73 |
-
|
| 74 |
-
Have a question? Ask on our mailing list!
|
| 75 |
-
|
| 76 |
-
select2@googlegroups.com
|
| 77 |
-
|
| 78 |
-
https://groups.google.com/d/forum/select2
|
| 79 |
-
|
| 80 |
-
|
| 81 |
-
Copyright and license
|
| 82 |
-
---------------------
|
| 83 |
-
|
| 84 |
-
Copyright 2012 Igor Vaynberg
|
| 85 |
-
|
| 86 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 87 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 88 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 89 |
-
License or the GPL License.
|
| 90 |
-
|
| 91 |
-
You may obtain a copy of the Apache License and the GPL License in the LICENSE file, or at:
|
| 92 |
-
|
| 93 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
| 94 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
| 95 |
-
|
| 96 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
| 97 |
-
or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
| 98 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
| 99 |
-
permissions and limitations under the Apache License and the GPL License.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/bower.json
DELETED
|
@@ -1,8 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"name": "select2",
|
| 3 |
-
"version": "3.5.1",
|
| 4 |
-
"main": ["select2.js", "select2.css", "select2.png", "select2x2.png", "select2-spinner.gif"],
|
| 5 |
-
"dependencies": {
|
| 6 |
-
"jquery": ">= 1.7.1"
|
| 7 |
-
}
|
| 8 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/component.json
DELETED
|
@@ -1,66 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"name": "select2",
|
| 3 |
-
"repo": "ivaynberg/select2",
|
| 4 |
-
"description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
|
| 5 |
-
"version": "3.5.1",
|
| 6 |
-
"demo": "http://ivaynberg.github.io/select2/",
|
| 7 |
-
"keywords": [
|
| 8 |
-
"jquery"
|
| 9 |
-
],
|
| 10 |
-
"main": "select2.js",
|
| 11 |
-
"styles": [
|
| 12 |
-
"select2.css",
|
| 13 |
-
"select2-bootstrap.css"
|
| 14 |
-
],
|
| 15 |
-
"scripts": [
|
| 16 |
-
"select2.js",
|
| 17 |
-
"select2_locale_ar.js",
|
| 18 |
-
"select2_locale_bg.js",
|
| 19 |
-
"select2_locale_ca.js",
|
| 20 |
-
"select2_locale_cs.js",
|
| 21 |
-
"select2_locale_da.js",
|
| 22 |
-
"select2_locale_de.js",
|
| 23 |
-
"select2_locale_el.js",
|
| 24 |
-
"select2_locale_es.js",
|
| 25 |
-
"select2_locale_et.js",
|
| 26 |
-
"select2_locale_eu.js",
|
| 27 |
-
"select2_locale_fa.js",
|
| 28 |
-
"select2_locale_fi.js",
|
| 29 |
-
"select2_locale_fr.js",
|
| 30 |
-
"select2_locale_gl.js",
|
| 31 |
-
"select2_locale_he.js",
|
| 32 |
-
"select2_locale_hr.js",
|
| 33 |
-
"select2_locale_hu.js",
|
| 34 |
-
"select2_locale_id.js",
|
| 35 |
-
"select2_locale_is.js",
|
| 36 |
-
"select2_locale_it.js",
|
| 37 |
-
"select2_locale_ja.js",
|
| 38 |
-
"select2_locale_ka.js",
|
| 39 |
-
"select2_locale_ko.js",
|
| 40 |
-
"select2_locale_lt.js",
|
| 41 |
-
"select2_locale_lv.js",
|
| 42 |
-
"select2_locale_mk.js",
|
| 43 |
-
"select2_locale_ms.js",
|
| 44 |
-
"select2_locale_nl.js",
|
| 45 |
-
"select2_locale_no.js",
|
| 46 |
-
"select2_locale_pl.js",
|
| 47 |
-
"select2_locale_pt-BR.js",
|
| 48 |
-
"select2_locale_pt-PT.js",
|
| 49 |
-
"select2_locale_ro.js",
|
| 50 |
-
"select2_locale_ru.js",
|
| 51 |
-
"select2_locale_sk.js",
|
| 52 |
-
"select2_locale_sv.js",
|
| 53 |
-
"select2_locale_th.js",
|
| 54 |
-
"select2_locale_tr.js",
|
| 55 |
-
"select2_locale_uk.js",
|
| 56 |
-
"select2_locale_vi.js",
|
| 57 |
-
"select2_locale_zh-CN.js",
|
| 58 |
-
"select2_locale_zh-TW.js"
|
| 59 |
-
],
|
| 60 |
-
"images": [
|
| 61 |
-
"select2-spinner.gif",
|
| 62 |
-
"select2.png",
|
| 63 |
-
"select2x2.png"
|
| 64 |
-
],
|
| 65 |
-
"license": "MIT"
|
| 66 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/composer.json
DELETED
|
@@ -1,29 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"name":
|
| 3 |
-
"ivaynberg/select2",
|
| 4 |
-
"description": "Select2 is a jQuery based replacement for select boxes.",
|
| 5 |
-
"version": "3.5.1",
|
| 6 |
-
"type": "component",
|
| 7 |
-
"homepage": "http://ivaynberg.github.io/select2/",
|
| 8 |
-
"license": "Apache-2.0",
|
| 9 |
-
"require": {
|
| 10 |
-
"robloach/component-installer": "*",
|
| 11 |
-
"components/jquery": ">=1.7.1"
|
| 12 |
-
},
|
| 13 |
-
"extra": {
|
| 14 |
-
"component": {
|
| 15 |
-
"scripts": [
|
| 16 |
-
"select2.js"
|
| 17 |
-
],
|
| 18 |
-
"files": [
|
| 19 |
-
"select2.js",
|
| 20 |
-
"select2_locale_*.js",
|
| 21 |
-
"select2.css",
|
| 22 |
-
"select2-bootstrap.css",
|
| 23 |
-
"select2-spinner.gif",
|
| 24 |
-
"select2.png",
|
| 25 |
-
"select2x2.png"
|
| 26 |
-
]
|
| 27 |
-
}
|
| 28 |
-
}
|
| 29 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/package.json
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"name" : "Select2",
|
| 3 |
-
"description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
|
| 4 |
-
"homepage": "http://ivaynberg.github.io/select2",
|
| 5 |
-
"author": "Igor Vaynberg",
|
| 6 |
-
"repository": {"type": "git", "url": "git://github.com/ivaynberg/select2.git"},
|
| 7 |
-
"main": "select2.js",
|
| 8 |
-
"version": "3.5.1",
|
| 9 |
-
"jspm": {
|
| 10 |
-
"main": "select2",
|
| 11 |
-
"files": ["select2.js", "select2.png", "select2.css", "select2-spinner.gif"],
|
| 12 |
-
"shim": {
|
| 13 |
-
"select2": {
|
| 14 |
-
"imports": ["jquery", "./select2.css!"],
|
| 15 |
-
"exports": "$"
|
| 16 |
-
}
|
| 17 |
-
},
|
| 18 |
-
"buildConfig": { "uglify": true }
|
| 19 |
-
}
|
| 20 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/release.sh
DELETED
|
@@ -1,79 +0,0 @@
|
|
| 1 |
-
#!/bin/bash
|
| 2 |
-
set -e
|
| 3 |
-
|
| 4 |
-
echo -n "Enter the version for this release: "
|
| 5 |
-
|
| 6 |
-
read ver
|
| 7 |
-
|
| 8 |
-
if [ ! $ver ]; then
|
| 9 |
-
echo "Invalid version."
|
| 10 |
-
exit
|
| 11 |
-
fi
|
| 12 |
-
|
| 13 |
-
name="select2"
|
| 14 |
-
js="$name.js"
|
| 15 |
-
mini="$name.min.js"
|
| 16 |
-
css="$name.css"
|
| 17 |
-
release="$name-$ver"
|
| 18 |
-
tag="$ver"
|
| 19 |
-
branch="build-$ver"
|
| 20 |
-
curbranch=`git branch | grep "*" | sed "s/* //"`
|
| 21 |
-
timestamp=$(date)
|
| 22 |
-
tokens="s/@@ver@@/$ver/g;s/\@@timestamp@@/$timestamp/g"
|
| 23 |
-
remote="github"
|
| 24 |
-
|
| 25 |
-
echo "Pulling from origin"
|
| 26 |
-
|
| 27 |
-
git pull
|
| 28 |
-
|
| 29 |
-
echo "Updating Version Identifiers"
|
| 30 |
-
|
| 31 |
-
sed -E -e "s/\"version\": \"([0-9\.]+)\",/\"version\": \"$ver\",/g" -i -- bower.json select2.jquery.json component.json composer.json package.json
|
| 32 |
-
|
| 33 |
-
git add bower.json
|
| 34 |
-
git add select2.jquery.json
|
| 35 |
-
git add component.json
|
| 36 |
-
git add composer.json
|
| 37 |
-
git add package.json
|
| 38 |
-
|
| 39 |
-
git commit -m "modified version identifiers in descriptors for release $ver"
|
| 40 |
-
git push
|
| 41 |
-
|
| 42 |
-
git branch "$branch"
|
| 43 |
-
git checkout "$branch"
|
| 44 |
-
|
| 45 |
-
echo "Tokenizing..."
|
| 46 |
-
|
| 47 |
-
find . -name "$js" | xargs -I{} sed -e "$tokens" -i -- {}
|
| 48 |
-
find . -name "$css" | xargs -I{} sed -e "$tokens" -i -- {}
|
| 49 |
-
|
| 50 |
-
sed -e "s/latest/$ver/g" -i -- bower.json
|
| 51 |
-
|
| 52 |
-
git add "$js"
|
| 53 |
-
git add "$css"
|
| 54 |
-
|
| 55 |
-
echo "Minifying..."
|
| 56 |
-
|
| 57 |
-
echo "/*" > "$mini"
|
| 58 |
-
cat LICENSE | sed "$tokens" >> "$mini"
|
| 59 |
-
echo "*/" >> "$mini"
|
| 60 |
-
|
| 61 |
-
curl -s \
|
| 62 |
-
--data-urlencode "js_code@$js" \
|
| 63 |
-
http://marijnhaverbeke.nl/uglifyjs \
|
| 64 |
-
>> "$mini"
|
| 65 |
-
|
| 66 |
-
git add "$mini"
|
| 67 |
-
|
| 68 |
-
git commit -m "release $ver"
|
| 69 |
-
|
| 70 |
-
echo "Tagging..."
|
| 71 |
-
git tag -a "$tag" -m "tagged version $ver"
|
| 72 |
-
git push "$remote" --tags
|
| 73 |
-
|
| 74 |
-
echo "Cleaning Up..."
|
| 75 |
-
|
| 76 |
-
git checkout "$curbranch"
|
| 77 |
-
git branch -D "$branch"
|
| 78 |
-
|
| 79 |
-
echo "Done"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2-bootstrap.css
DELETED
|
@@ -1,87 +0,0 @@
|
|
| 1 |
-
.form-control .select2-choice {
|
| 2 |
-
border: 0;
|
| 3 |
-
border-radius: 2px;
|
| 4 |
-
}
|
| 5 |
-
|
| 6 |
-
.form-control .select2-choice .select2-arrow {
|
| 7 |
-
border-radius: 0 2px 2px 0;
|
| 8 |
-
}
|
| 9 |
-
|
| 10 |
-
.form-control.select2-container {
|
| 11 |
-
height: auto !important;
|
| 12 |
-
padding: 0;
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
.form-control.select2-container.select2-dropdown-open {
|
| 16 |
-
border-color: #5897FB;
|
| 17 |
-
border-radius: 3px 3px 0 0;
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
.form-control .select2-container.select2-dropdown-open .select2-choices {
|
| 21 |
-
border-radius: 3px 3px 0 0;
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
.form-control.select2-container .select2-choices {
|
| 25 |
-
border: 0 !important;
|
| 26 |
-
border-radius: 3px;
|
| 27 |
-
}
|
| 28 |
-
|
| 29 |
-
.control-group.warning .select2-container .select2-choice,
|
| 30 |
-
.control-group.warning .select2-container .select2-choices,
|
| 31 |
-
.control-group.warning .select2-container-active .select2-choice,
|
| 32 |
-
.control-group.warning .select2-container-active .select2-choices,
|
| 33 |
-
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 34 |
-
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 35 |
-
.control-group.warning .select2-container-multi.select2-container-active .select2-choices {
|
| 36 |
-
border: 1px solid #C09853 !important;
|
| 37 |
-
}
|
| 38 |
-
|
| 39 |
-
.control-group.warning .select2-container .select2-choice div {
|
| 40 |
-
border-left: 1px solid #C09853 !important;
|
| 41 |
-
background: #FCF8E3 !important;
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
.control-group.error .select2-container .select2-choice,
|
| 45 |
-
.control-group.error .select2-container .select2-choices,
|
| 46 |
-
.control-group.error .select2-container-active .select2-choice,
|
| 47 |
-
.control-group.error .select2-container-active .select2-choices,
|
| 48 |
-
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 49 |
-
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 50 |
-
.control-group.error .select2-container-multi.select2-container-active .select2-choices {
|
| 51 |
-
border: 1px solid #B94A48 !important;
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
.control-group.error .select2-container .select2-choice div {
|
| 55 |
-
border-left: 1px solid #B94A48 !important;
|
| 56 |
-
background: #F2DEDE !important;
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
.control-group.info .select2-container .select2-choice,
|
| 60 |
-
.control-group.info .select2-container .select2-choices,
|
| 61 |
-
.control-group.info .select2-container-active .select2-choice,
|
| 62 |
-
.control-group.info .select2-container-active .select2-choices,
|
| 63 |
-
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 64 |
-
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 65 |
-
.control-group.info .select2-container-multi.select2-container-active .select2-choices {
|
| 66 |
-
border: 1px solid #3A87AD !important;
|
| 67 |
-
}
|
| 68 |
-
|
| 69 |
-
.control-group.info .select2-container .select2-choice div {
|
| 70 |
-
border-left: 1px solid #3A87AD !important;
|
| 71 |
-
background: #D9EDF7 !important;
|
| 72 |
-
}
|
| 73 |
-
|
| 74 |
-
.control-group.success .select2-container .select2-choice,
|
| 75 |
-
.control-group.success .select2-container .select2-choices,
|
| 76 |
-
.control-group.success .select2-container-active .select2-choice,
|
| 77 |
-
.control-group.success .select2-container-active .select2-choices,
|
| 78 |
-
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 79 |
-
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 80 |
-
.control-group.success .select2-container-multi.select2-container-active .select2-choices {
|
| 81 |
-
border: 1px solid #468847 !important;
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
.control-group.success .select2-container .select2-choice div {
|
| 85 |
-
border-left: 1px solid #468847 !important;
|
| 86 |
-
background: #DFF0D8 !important;
|
| 87 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2-spinner.gif
DELETED
|
Binary file
|
js/select2-3.5.1-old/select2.css
DELETED
|
@@ -1,704 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
Version: 3.5.1 Timestamp: Tue Jul 22 18:58:56 EDT 2014
|
| 3 |
-
*/
|
| 4 |
-
.select2-container {
|
| 5 |
-
margin: 0;
|
| 6 |
-
position: relative;
|
| 7 |
-
display: inline-block;
|
| 8 |
-
/* inline-block for ie7 */
|
| 9 |
-
zoom: 1;
|
| 10 |
-
*display: inline;
|
| 11 |
-
vertical-align: middle;
|
| 12 |
-
}
|
| 13 |
-
|
| 14 |
-
.select2-container,
|
| 15 |
-
.select2-drop,
|
| 16 |
-
.select2-search,
|
| 17 |
-
.select2-search input {
|
| 18 |
-
/*
|
| 19 |
-
Force border-box so that % widths fit the parent
|
| 20 |
-
container without overlap because of margin/padding.
|
| 21 |
-
More Info : http://www.quirksmode.org/css/box.html
|
| 22 |
-
*/
|
| 23 |
-
-webkit-box-sizing: border-box; /* webkit */
|
| 24 |
-
-moz-box-sizing: border-box; /* firefox */
|
| 25 |
-
box-sizing: border-box; /* css3 */
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
.select2-container .select2-choice {
|
| 29 |
-
display: block;
|
| 30 |
-
height: 26px;
|
| 31 |
-
padding: 0 0 0 8px;
|
| 32 |
-
overflow: hidden;
|
| 33 |
-
position: relative;
|
| 34 |
-
|
| 35 |
-
border: 1px solid #aaa;
|
| 36 |
-
white-space: nowrap;
|
| 37 |
-
line-height: 26px;
|
| 38 |
-
color: #444;
|
| 39 |
-
text-decoration: none;
|
| 40 |
-
|
| 41 |
-
border-radius: 4px;
|
| 42 |
-
|
| 43 |
-
background-clip: padding-box;
|
| 44 |
-
|
| 45 |
-
-webkit-touch-callout: none;
|
| 46 |
-
-webkit-user-select: none;
|
| 47 |
-
-moz-user-select: none;
|
| 48 |
-
-ms-user-select: none;
|
| 49 |
-
user-select: none;
|
| 50 |
-
|
| 51 |
-
background-color: #fff;
|
| 52 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
| 53 |
-
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 54 |
-
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 55 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
| 56 |
-
background-image: linear-gradient(to top, #eee 0%, #fff 50%);
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
html[dir="rtl"] .select2-container .select2-choice {
|
| 60 |
-
padding: 0 8px 0 0;
|
| 61 |
-
}
|
| 62 |
-
|
| 63 |
-
.select2-container.select2-drop-above .select2-choice {
|
| 64 |
-
border-bottom-color: #aaa;
|
| 65 |
-
|
| 66 |
-
border-radius: 0 0 4px 4px;
|
| 67 |
-
|
| 68 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
|
| 69 |
-
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 70 |
-
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 71 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
| 72 |
-
background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
|
| 73 |
-
}
|
| 74 |
-
|
| 75 |
-
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
| 76 |
-
margin-right: 42px;
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
.select2-container .select2-choice > .select2-chosen {
|
| 80 |
-
margin-right: 26px;
|
| 81 |
-
display: block;
|
| 82 |
-
overflow: hidden;
|
| 83 |
-
|
| 84 |
-
white-space: nowrap;
|
| 85 |
-
|
| 86 |
-
text-overflow: ellipsis;
|
| 87 |
-
float: none;
|
| 88 |
-
width: auto;
|
| 89 |
-
}
|
| 90 |
-
|
| 91 |
-
html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
|
| 92 |
-
margin-left: 26px;
|
| 93 |
-
margin-right: 0;
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
.select2-container .select2-choice abbr {
|
| 97 |
-
display: none;
|
| 98 |
-
width: 12px;
|
| 99 |
-
height: 12px;
|
| 100 |
-
position: absolute;
|
| 101 |
-
right: 24px;
|
| 102 |
-
top: 8px;
|
| 103 |
-
|
| 104 |
-
font-size: 1px;
|
| 105 |
-
text-decoration: none;
|
| 106 |
-
|
| 107 |
-
border: 0;
|
| 108 |
-
background: url('select2.png') right top no-repeat;
|
| 109 |
-
cursor: pointer;
|
| 110 |
-
outline: 0;
|
| 111 |
-
}
|
| 112 |
-
|
| 113 |
-
.select2-container.select2-allowclear .select2-choice abbr {
|
| 114 |
-
display: inline-block;
|
| 115 |
-
}
|
| 116 |
-
|
| 117 |
-
.select2-container .select2-choice abbr:hover {
|
| 118 |
-
background-position: right -11px;
|
| 119 |
-
cursor: pointer;
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
.select2-drop-mask {
|
| 123 |
-
border: 0;
|
| 124 |
-
margin: 0;
|
| 125 |
-
padding: 0;
|
| 126 |
-
position: fixed;
|
| 127 |
-
left: 0;
|
| 128 |
-
top: 0;
|
| 129 |
-
min-height: 100%;
|
| 130 |
-
min-width: 100%;
|
| 131 |
-
height: auto;
|
| 132 |
-
width: auto;
|
| 133 |
-
opacity: 0;
|
| 134 |
-
z-index: 9998;
|
| 135 |
-
/* styles required for IE to work */
|
| 136 |
-
background-color: #fff;
|
| 137 |
-
filter: alpha(opacity=0);
|
| 138 |
-
}
|
| 139 |
-
|
| 140 |
-
.select2-drop {
|
| 141 |
-
width: 100%;
|
| 142 |
-
margin-top: -1px;
|
| 143 |
-
position: absolute;
|
| 144 |
-
z-index: 9999;
|
| 145 |
-
top: 100%;
|
| 146 |
-
|
| 147 |
-
background: #fff;
|
| 148 |
-
color: #000;
|
| 149 |
-
border: 1px solid #aaa;
|
| 150 |
-
border-top: 0;
|
| 151 |
-
|
| 152 |
-
border-radius: 0 0 4px 4px;
|
| 153 |
-
|
| 154 |
-
-webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 155 |
-
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 156 |
-
}
|
| 157 |
-
|
| 158 |
-
.select2-drop.select2-drop-above {
|
| 159 |
-
margin-top: 1px;
|
| 160 |
-
border-top: 1px solid #aaa;
|
| 161 |
-
border-bottom: 0;
|
| 162 |
-
|
| 163 |
-
border-radius: 4px 4px 0 0;
|
| 164 |
-
|
| 165 |
-
-webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
| 166 |
-
box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
| 167 |
-
}
|
| 168 |
-
|
| 169 |
-
.select2-drop-active {
|
| 170 |
-
border: 1px solid #5897fb;
|
| 171 |
-
border-top: none;
|
| 172 |
-
}
|
| 173 |
-
|
| 174 |
-
.select2-drop.select2-drop-above.select2-drop-active {
|
| 175 |
-
border-top: 1px solid #5897fb;
|
| 176 |
-
}
|
| 177 |
-
|
| 178 |
-
.select2-drop-auto-width {
|
| 179 |
-
border-top: 1px solid #aaa;
|
| 180 |
-
width: auto;
|
| 181 |
-
}
|
| 182 |
-
|
| 183 |
-
.select2-drop-auto-width .select2-search {
|
| 184 |
-
padding-top: 4px;
|
| 185 |
-
}
|
| 186 |
-
|
| 187 |
-
.select2-container .select2-choice .select2-arrow {
|
| 188 |
-
display: inline-block;
|
| 189 |
-
width: 18px;
|
| 190 |
-
height: 100%;
|
| 191 |
-
position: absolute;
|
| 192 |
-
right: 0;
|
| 193 |
-
top: 0;
|
| 194 |
-
|
| 195 |
-
border-left: 1px solid #aaa;
|
| 196 |
-
border-radius: 0 4px 4px 0;
|
| 197 |
-
|
| 198 |
-
background-clip: padding-box;
|
| 199 |
-
|
| 200 |
-
background: #ccc;
|
| 201 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
|
| 202 |
-
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 203 |
-
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 204 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
| 205 |
-
background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
|
| 206 |
-
}
|
| 207 |
-
|
| 208 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
|
| 209 |
-
left: 0;
|
| 210 |
-
right: auto;
|
| 211 |
-
|
| 212 |
-
border-left: none;
|
| 213 |
-
border-right: 1px solid #aaa;
|
| 214 |
-
border-radius: 4px 0 0 4px;
|
| 215 |
-
}
|
| 216 |
-
|
| 217 |
-
.select2-container .select2-choice .select2-arrow b {
|
| 218 |
-
display: block;
|
| 219 |
-
width: 100%;
|
| 220 |
-
height: 100%;
|
| 221 |
-
background: url('select2.png') no-repeat 0 1px;
|
| 222 |
-
}
|
| 223 |
-
|
| 224 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
|
| 225 |
-
background-position: 2px 1px;
|
| 226 |
-
}
|
| 227 |
-
|
| 228 |
-
.select2-search {
|
| 229 |
-
display: inline-block;
|
| 230 |
-
width: 100%;
|
| 231 |
-
min-height: 26px;
|
| 232 |
-
margin: 0;
|
| 233 |
-
padding-left: 4px;
|
| 234 |
-
padding-right: 4px;
|
| 235 |
-
|
| 236 |
-
position: relative;
|
| 237 |
-
z-index: 10000;
|
| 238 |
-
|
| 239 |
-
white-space: nowrap;
|
| 240 |
-
}
|
| 241 |
-
|
| 242 |
-
.select2-search input {
|
| 243 |
-
width: 100%;
|
| 244 |
-
height: auto !important;
|
| 245 |
-
min-height: 26px;
|
| 246 |
-
padding: 4px 20px 4px 5px;
|
| 247 |
-
margin: 0;
|
| 248 |
-
|
| 249 |
-
outline: 0;
|
| 250 |
-
font-family: sans-serif;
|
| 251 |
-
font-size: 1em;
|
| 252 |
-
|
| 253 |
-
border: 1px solid #aaa;
|
| 254 |
-
border-radius: 0;
|
| 255 |
-
|
| 256 |
-
-webkit-box-shadow: none;
|
| 257 |
-
box-shadow: none;
|
| 258 |
-
|
| 259 |
-
background: #fff url('select2.png') no-repeat 100% -22px;
|
| 260 |
-
background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 261 |
-
background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 262 |
-
background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 263 |
-
background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 264 |
-
}
|
| 265 |
-
|
| 266 |
-
html[dir="rtl"] .select2-search input {
|
| 267 |
-
padding: 4px 5px 4px 20px;
|
| 268 |
-
|
| 269 |
-
background: #fff url('select2.png') no-repeat -37px -22px;
|
| 270 |
-
background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 271 |
-
background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 272 |
-
background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 273 |
-
background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 274 |
-
}
|
| 275 |
-
|
| 276 |
-
.select2-drop.select2-drop-above .select2-search input {
|
| 277 |
-
margin-top: 4px;
|
| 278 |
-
}
|
| 279 |
-
|
| 280 |
-
.select2-search input.select2-active {
|
| 281 |
-
background: #fff url('select2-spinner.gif') no-repeat 100%;
|
| 282 |
-
background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 283 |
-
background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 284 |
-
background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 285 |
-
background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 286 |
-
}
|
| 287 |
-
|
| 288 |
-
.select2-container-active .select2-choice,
|
| 289 |
-
.select2-container-active .select2-choices {
|
| 290 |
-
border: 1px solid #5897fb;
|
| 291 |
-
outline: none;
|
| 292 |
-
|
| 293 |
-
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 294 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 295 |
-
}
|
| 296 |
-
|
| 297 |
-
.select2-dropdown-open .select2-choice {
|
| 298 |
-
border-bottom-color: transparent;
|
| 299 |
-
-webkit-box-shadow: 0 1px 0 #fff inset;
|
| 300 |
-
box-shadow: 0 1px 0 #fff inset;
|
| 301 |
-
|
| 302 |
-
border-bottom-left-radius: 0;
|
| 303 |
-
border-bottom-right-radius: 0;
|
| 304 |
-
|
| 305 |
-
background-color: #eee;
|
| 306 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 307 |
-
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 308 |
-
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 309 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 310 |
-
background-image: linear-gradient(to top, #fff 0%, #eee 50%);
|
| 311 |
-
}
|
| 312 |
-
|
| 313 |
-
.select2-dropdown-open.select2-drop-above .select2-choice,
|
| 314 |
-
.select2-dropdown-open.select2-drop-above .select2-choices {
|
| 315 |
-
border: 1px solid #5897fb;
|
| 316 |
-
border-top-color: transparent;
|
| 317 |
-
|
| 318 |
-
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 319 |
-
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 320 |
-
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 321 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 322 |
-
background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
|
| 323 |
-
}
|
| 324 |
-
|
| 325 |
-
.select2-dropdown-open .select2-choice .select2-arrow {
|
| 326 |
-
background: transparent;
|
| 327 |
-
border-left: none;
|
| 328 |
-
filter: none;
|
| 329 |
-
}
|
| 330 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
|
| 331 |
-
border-right: none;
|
| 332 |
-
}
|
| 333 |
-
|
| 334 |
-
.select2-dropdown-open .select2-choice .select2-arrow b {
|
| 335 |
-
background-position: -18px 1px;
|
| 336 |
-
}
|
| 337 |
-
|
| 338 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
|
| 339 |
-
background-position: -16px 1px;
|
| 340 |
-
}
|
| 341 |
-
|
| 342 |
-
.select2-hidden-accessible {
|
| 343 |
-
border: 0;
|
| 344 |
-
clip: rect(0 0 0 0);
|
| 345 |
-
height: 1px;
|
| 346 |
-
margin: -1px;
|
| 347 |
-
overflow: hidden;
|
| 348 |
-
padding: 0;
|
| 349 |
-
position: absolute;
|
| 350 |
-
width: 1px;
|
| 351 |
-
}
|
| 352 |
-
|
| 353 |
-
/* results */
|
| 354 |
-
.select2-results {
|
| 355 |
-
max-height: 200px;
|
| 356 |
-
padding: 0 0 0 4px;
|
| 357 |
-
margin: 4px 4px 4px 0;
|
| 358 |
-
position: relative;
|
| 359 |
-
overflow-x: hidden;
|
| 360 |
-
overflow-y: auto;
|
| 361 |
-
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
| 362 |
-
}
|
| 363 |
-
|
| 364 |
-
html[dir="rtl"] .select2-results {
|
| 365 |
-
padding: 0 4px 0 0;
|
| 366 |
-
margin: 4px 0 4px 4px;
|
| 367 |
-
}
|
| 368 |
-
|
| 369 |
-
.select2-results ul.select2-result-sub {
|
| 370 |
-
margin: 0;
|
| 371 |
-
padding-left: 0;
|
| 372 |
-
}
|
| 373 |
-
|
| 374 |
-
.select2-results li {
|
| 375 |
-
list-style: none;
|
| 376 |
-
display: list-item;
|
| 377 |
-
background-image: none;
|
| 378 |
-
}
|
| 379 |
-
|
| 380 |
-
.select2-results li.select2-result-with-children > .select2-result-label {
|
| 381 |
-
font-weight: bold;
|
| 382 |
-
}
|
| 383 |
-
|
| 384 |
-
.select2-results .select2-result-label {
|
| 385 |
-
padding: 3px 7px 4px;
|
| 386 |
-
margin: 0;
|
| 387 |
-
cursor: pointer;
|
| 388 |
-
|
| 389 |
-
min-height: 1em;
|
| 390 |
-
|
| 391 |
-
-webkit-touch-callout: none;
|
| 392 |
-
-webkit-user-select: none;
|
| 393 |
-
-moz-user-select: none;
|
| 394 |
-
-ms-user-select: none;
|
| 395 |
-
user-select: none;
|
| 396 |
-
}
|
| 397 |
-
|
| 398 |
-
.select2-results-dept-1 .select2-result-label { padding-left: 20px }
|
| 399 |
-
.select2-results-dept-2 .select2-result-label { padding-left: 40px }
|
| 400 |
-
.select2-results-dept-3 .select2-result-label { padding-left: 60px }
|
| 401 |
-
.select2-results-dept-4 .select2-result-label { padding-left: 80px }
|
| 402 |
-
.select2-results-dept-5 .select2-result-label { padding-left: 100px }
|
| 403 |
-
.select2-results-dept-6 .select2-result-label { padding-left: 110px }
|
| 404 |
-
.select2-results-dept-7 .select2-result-label { padding-left: 120px }
|
| 405 |
-
|
| 406 |
-
.select2-results .select2-highlighted {
|
| 407 |
-
background: #3875d7;
|
| 408 |
-
color: #fff;
|
| 409 |
-
}
|
| 410 |
-
|
| 411 |
-
.select2-results li em {
|
| 412 |
-
background: #feffde;
|
| 413 |
-
font-style: normal;
|
| 414 |
-
}
|
| 415 |
-
|
| 416 |
-
.select2-results .select2-highlighted em {
|
| 417 |
-
background: transparent;
|
| 418 |
-
}
|
| 419 |
-
|
| 420 |
-
.select2-results .select2-highlighted ul {
|
| 421 |
-
background: #fff;
|
| 422 |
-
color: #000;
|
| 423 |
-
}
|
| 424 |
-
|
| 425 |
-
.select2-results .select2-no-results,
|
| 426 |
-
.select2-results .select2-searching,
|
| 427 |
-
.select2-results .select2-ajax-error,
|
| 428 |
-
.select2-results .select2-selection-limit {
|
| 429 |
-
background: #f4f4f4;
|
| 430 |
-
display: list-item;
|
| 431 |
-
padding-left: 5px;
|
| 432 |
-
}
|
| 433 |
-
|
| 434 |
-
/*
|
| 435 |
-
disabled look for disabled choices in the results dropdown
|
| 436 |
-
*/
|
| 437 |
-
.select2-results .select2-disabled.select2-highlighted {
|
| 438 |
-
color: #666;
|
| 439 |
-
background: #f4f4f4;
|
| 440 |
-
display: list-item;
|
| 441 |
-
cursor: default;
|
| 442 |
-
}
|
| 443 |
-
.select2-results .select2-disabled {
|
| 444 |
-
background: #f4f4f4;
|
| 445 |
-
display: list-item;
|
| 446 |
-
cursor: default;
|
| 447 |
-
}
|
| 448 |
-
|
| 449 |
-
.select2-results .select2-selected {
|
| 450 |
-
display: none;
|
| 451 |
-
}
|
| 452 |
-
|
| 453 |
-
.select2-more-results.select2-active {
|
| 454 |
-
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
| 455 |
-
}
|
| 456 |
-
|
| 457 |
-
.select2-results .select2-ajax-error {
|
| 458 |
-
background: rgba(255, 50, 50, .2);
|
| 459 |
-
}
|
| 460 |
-
|
| 461 |
-
.select2-more-results {
|
| 462 |
-
background: #f4f4f4;
|
| 463 |
-
display: list-item;
|
| 464 |
-
}
|
| 465 |
-
|
| 466 |
-
/* disabled styles */
|
| 467 |
-
|
| 468 |
-
.select2-container.select2-container-disabled .select2-choice {
|
| 469 |
-
background-color: #f4f4f4;
|
| 470 |
-
background-image: none;
|
| 471 |
-
border: 1px solid #ddd;
|
| 472 |
-
cursor: default;
|
| 473 |
-
}
|
| 474 |
-
|
| 475 |
-
.select2-container.select2-container-disabled .select2-choice .select2-arrow {
|
| 476 |
-
background-color: #f4f4f4;
|
| 477 |
-
background-image: none;
|
| 478 |
-
border-left: 0;
|
| 479 |
-
}
|
| 480 |
-
|
| 481 |
-
.select2-container.select2-container-disabled .select2-choice abbr {
|
| 482 |
-
display: none;
|
| 483 |
-
}
|
| 484 |
-
|
| 485 |
-
|
| 486 |
-
/* multiselect */
|
| 487 |
-
|
| 488 |
-
.select2-container-multi .select2-choices {
|
| 489 |
-
height: auto !important;
|
| 490 |
-
height: 1%;
|
| 491 |
-
margin: 0;
|
| 492 |
-
padding: 0 5px 0 0;
|
| 493 |
-
position: relative;
|
| 494 |
-
|
| 495 |
-
border: 1px solid #aaa;
|
| 496 |
-
cursor: text;
|
| 497 |
-
overflow: hidden;
|
| 498 |
-
|
| 499 |
-
background-color: #fff;
|
| 500 |
-
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
|
| 501 |
-
background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
|
| 502 |
-
background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
|
| 503 |
-
background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
|
| 504 |
-
}
|
| 505 |
-
|
| 506 |
-
html[dir="rtl"] .select2-container-multi .select2-choices {
|
| 507 |
-
padding: 0 0 0 5px;
|
| 508 |
-
}
|
| 509 |
-
|
| 510 |
-
.select2-locked {
|
| 511 |
-
padding: 3px 5px 3px 5px !important;
|
| 512 |
-
}
|
| 513 |
-
|
| 514 |
-
.select2-container-multi .select2-choices {
|
| 515 |
-
min-height: 26px;
|
| 516 |
-
}
|
| 517 |
-
|
| 518 |
-
.select2-container-multi.select2-container-active .select2-choices {
|
| 519 |
-
border: 1px solid #5897fb;
|
| 520 |
-
outline: none;
|
| 521 |
-
|
| 522 |
-
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 523 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 524 |
-
}
|
| 525 |
-
.select2-container-multi .select2-choices li {
|
| 526 |
-
float: left;
|
| 527 |
-
list-style: none;
|
| 528 |
-
}
|
| 529 |
-
html[dir="rtl"] .select2-container-multi .select2-choices li
|
| 530 |
-
{
|
| 531 |
-
float: right;
|
| 532 |
-
}
|
| 533 |
-
.select2-container-multi .select2-choices .select2-search-field {
|
| 534 |
-
margin: 0;
|
| 535 |
-
padding: 0;
|
| 536 |
-
white-space: nowrap;
|
| 537 |
-
}
|
| 538 |
-
|
| 539 |
-
.select2-container-multi .select2-choices .select2-search-field input {
|
| 540 |
-
padding: 5px;
|
| 541 |
-
margin: 1px 0;
|
| 542 |
-
|
| 543 |
-
font-family: sans-serif;
|
| 544 |
-
font-size: 100%;
|
| 545 |
-
color: #666;
|
| 546 |
-
outline: 0;
|
| 547 |
-
border: 0;
|
| 548 |
-
-webkit-box-shadow: none;
|
| 549 |
-
box-shadow: none;
|
| 550 |
-
background: transparent !important;
|
| 551 |
-
}
|
| 552 |
-
|
| 553 |
-
.select2-container-multi .select2-choices .select2-search-field input.select2-active {
|
| 554 |
-
background: #fff url('select2-spinner.gif') no-repeat 100% !important;
|
| 555 |
-
}
|
| 556 |
-
|
| 557 |
-
.select2-default {
|
| 558 |
-
color: #999 !important;
|
| 559 |
-
}
|
| 560 |
-
|
| 561 |
-
.select2-container-multi .select2-choices .select2-search-choice {
|
| 562 |
-
padding: 3px 5px 3px 18px;
|
| 563 |
-
margin: 3px 0 3px 5px;
|
| 564 |
-
position: relative;
|
| 565 |
-
|
| 566 |
-
line-height: 13px;
|
| 567 |
-
color: #333;
|
| 568 |
-
cursor: default;
|
| 569 |
-
border: 1px solid #aaaaaa;
|
| 570 |
-
|
| 571 |
-
border-radius: 3px;
|
| 572 |
-
|
| 573 |
-
-webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
| 574 |
-
box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
| 575 |
-
|
| 576 |
-
background-clip: padding-box;
|
| 577 |
-
|
| 578 |
-
-webkit-touch-callout: none;
|
| 579 |
-
-webkit-user-select: none;
|
| 580 |
-
-moz-user-select: none;
|
| 581 |
-
-ms-user-select: none;
|
| 582 |
-
user-select: none;
|
| 583 |
-
|
| 584 |
-
background-color: #e4e4e4;
|
| 585 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
|
| 586 |
-
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
|
| 587 |
-
background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 588 |
-
background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 589 |
-
background-image: linear-gradient(to top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 590 |
-
}
|
| 591 |
-
html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
|
| 592 |
-
{
|
| 593 |
-
margin: 3px 5px 3px 0;
|
| 594 |
-
padding: 3px 18px 3px 5px;
|
| 595 |
-
}
|
| 596 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
| 597 |
-
cursor: default;
|
| 598 |
-
}
|
| 599 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus {
|
| 600 |
-
background: #d4d4d4;
|
| 601 |
-
}
|
| 602 |
-
|
| 603 |
-
.select2-search-choice-close {
|
| 604 |
-
display: block;
|
| 605 |
-
width: 12px;
|
| 606 |
-
height: 13px;
|
| 607 |
-
position: absolute;
|
| 608 |
-
right: 3px;
|
| 609 |
-
top: 4px;
|
| 610 |
-
|
| 611 |
-
font-size: 1px;
|
| 612 |
-
outline: none;
|
| 613 |
-
background: url('select2.png') right top no-repeat;
|
| 614 |
-
}
|
| 615 |
-
html[dir="rtl"] .select2-search-choice-close {
|
| 616 |
-
right: auto;
|
| 617 |
-
left: 3px;
|
| 618 |
-
}
|
| 619 |
-
|
| 620 |
-
.select2-container-multi .select2-search-choice-close {
|
| 621 |
-
left: 3px;
|
| 622 |
-
}
|
| 623 |
-
|
| 624 |
-
html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
|
| 625 |
-
left: auto;
|
| 626 |
-
right: 2px;
|
| 627 |
-
}
|
| 628 |
-
|
| 629 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
| 630 |
-
background-position: right -11px;
|
| 631 |
-
}
|
| 632 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
|
| 633 |
-
background-position: right -11px;
|
| 634 |
-
}
|
| 635 |
-
|
| 636 |
-
/* disabled styles */
|
| 637 |
-
.select2-container-multi.select2-container-disabled .select2-choices {
|
| 638 |
-
background-color: #f4f4f4;
|
| 639 |
-
background-image: none;
|
| 640 |
-
border: 1px solid #ddd;
|
| 641 |
-
cursor: default;
|
| 642 |
-
}
|
| 643 |
-
|
| 644 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
|
| 645 |
-
padding: 3px 5px 3px 5px;
|
| 646 |
-
border: 1px solid #ddd;
|
| 647 |
-
background-image: none;
|
| 648 |
-
background-color: #f4f4f4;
|
| 649 |
-
}
|
| 650 |
-
|
| 651 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
|
| 652 |
-
background: none;
|
| 653 |
-
}
|
| 654 |
-
/* end multiselect */
|
| 655 |
-
|
| 656 |
-
|
| 657 |
-
.select2-result-selectable .select2-match,
|
| 658 |
-
.select2-result-unselectable .select2-match {
|
| 659 |
-
text-decoration: underline;
|
| 660 |
-
}
|
| 661 |
-
|
| 662 |
-
.select2-offscreen, .select2-offscreen:focus {
|
| 663 |
-
clip: rect(0 0 0 0) !important;
|
| 664 |
-
width: 1px !important;
|
| 665 |
-
height: 1px !important;
|
| 666 |
-
border: 0 !important;
|
| 667 |
-
margin: 0 !important;
|
| 668 |
-
padding: 0 !important;
|
| 669 |
-
overflow: hidden !important;
|
| 670 |
-
position: absolute !important;
|
| 671 |
-
outline: 0 !important;
|
| 672 |
-
left: 0px !important;
|
| 673 |
-
top: 0px !important;
|
| 674 |
-
}
|
| 675 |
-
|
| 676 |
-
.select2-display-none {
|
| 677 |
-
display: none;
|
| 678 |
-
}
|
| 679 |
-
|
| 680 |
-
.select2-measure-scrollbar {
|
| 681 |
-
position: absolute;
|
| 682 |
-
top: -10000px;
|
| 683 |
-
left: -10000px;
|
| 684 |
-
width: 100px;
|
| 685 |
-
height: 100px;
|
| 686 |
-
overflow: scroll;
|
| 687 |
-
}
|
| 688 |
-
|
| 689 |
-
/* Retina-ize icons */
|
| 690 |
-
|
| 691 |
-
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
|
| 692 |
-
.select2-search input,
|
| 693 |
-
.select2-search-choice-close,
|
| 694 |
-
.select2-container .select2-choice abbr,
|
| 695 |
-
.select2-container .select2-choice .select2-arrow b {
|
| 696 |
-
background-image: url('select2x2.png') !important;
|
| 697 |
-
background-repeat: no-repeat !important;
|
| 698 |
-
background-size: 60px 40px !important;
|
| 699 |
-
}
|
| 700 |
-
|
| 701 |
-
.select2-search input {
|
| 702 |
-
background-position: 100% -21px !important;
|
| 703 |
-
}
|
| 704 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2.jquery.json
DELETED
|
@@ -1,36 +0,0 @@
|
|
| 1 |
-
{
|
| 2 |
-
"name": "select2",
|
| 3 |
-
"title": "Select2",
|
| 4 |
-
"description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
|
| 5 |
-
"keywords": [
|
| 6 |
-
"select",
|
| 7 |
-
"autocomplete",
|
| 8 |
-
"typeahead",
|
| 9 |
-
"dropdown",
|
| 10 |
-
"multiselect",
|
| 11 |
-
"tag",
|
| 12 |
-
"tagging"
|
| 13 |
-
],
|
| 14 |
-
"version": "3.5.1",
|
| 15 |
-
"author": {
|
| 16 |
-
"name": "Igor Vaynberg",
|
| 17 |
-
"url": "https://github.com/ivaynberg"
|
| 18 |
-
},
|
| 19 |
-
"licenses": [
|
| 20 |
-
{
|
| 21 |
-
"type": "Apache",
|
| 22 |
-
"url": "http://www.apache.org/licenses/LICENSE-2.0"
|
| 23 |
-
},
|
| 24 |
-
{
|
| 25 |
-
"type": "GPL v2",
|
| 26 |
-
"url": "http://www.gnu.org/licenses/gpl-2.0.html"
|
| 27 |
-
}
|
| 28 |
-
],
|
| 29 |
-
"bugs": "https://github.com/ivaynberg/select2/issues",
|
| 30 |
-
"homepage": "http://ivaynberg.github.com/select2",
|
| 31 |
-
"docs": "http://ivaynberg.github.com/select2/",
|
| 32 |
-
"download": "https://github.com/ivaynberg/select2/tags",
|
| 33 |
-
"dependencies": {
|
| 34 |
-
"jquery": ">=1.7.1"
|
| 35 |
-
}
|
| 36 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2.js
DELETED
|
@@ -1,3508 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
Copyright 2012 Igor Vaynberg
|
| 3 |
-
|
| 4 |
-
Version: 3.5.1 Timestamp: Tue Jul 22 18:58:56 EDT 2014
|
| 5 |
-
|
| 6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
-
License or the GPL License.
|
| 10 |
-
|
| 11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
-
|
| 13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
-
|
| 16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the
|
| 17 |
-
Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
|
| 18 |
-
CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
|
| 19 |
-
the specific language governing permissions and limitations under the Apache License and the GPL License.
|
| 20 |
-
*/
|
| 21 |
-
(function ($) {
|
| 22 |
-
if(typeof $.fn.each2 == "undefined") {
|
| 23 |
-
$.extend($.fn, {
|
| 24 |
-
/*
|
| 25 |
-
* 4-10 times faster .each replacement
|
| 26 |
-
* use it carefully, as it overrides jQuery context of element on each iteration
|
| 27 |
-
*/
|
| 28 |
-
each2 : function (c) {
|
| 29 |
-
var j = $([0]), i = -1, l = this.length;
|
| 30 |
-
while (
|
| 31 |
-
++i < l
|
| 32 |
-
&& (j.context = j[0] = this[i])
|
| 33 |
-
&& c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
|
| 34 |
-
);
|
| 35 |
-
return this;
|
| 36 |
-
}
|
| 37 |
-
});
|
| 38 |
-
}
|
| 39 |
-
})(jQuery);
|
| 40 |
-
|
| 41 |
-
(function ($, undefined) {
|
| 42 |
-
"use strict";
|
| 43 |
-
/*global document, window, jQuery, console */
|
| 44 |
-
|
| 45 |
-
if (window.Select2 !== undefined) {
|
| 46 |
-
return;
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
var KEY, AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
|
| 50 |
-
lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
|
| 51 |
-
|
| 52 |
-
KEY = {
|
| 53 |
-
TAB: 9,
|
| 54 |
-
ENTER: 13,
|
| 55 |
-
ESC: 27,
|
| 56 |
-
SPACE: 32,
|
| 57 |
-
LEFT: 37,
|
| 58 |
-
UP: 38,
|
| 59 |
-
RIGHT: 39,
|
| 60 |
-
DOWN: 40,
|
| 61 |
-
SHIFT: 16,
|
| 62 |
-
CTRL: 17,
|
| 63 |
-
ALT: 18,
|
| 64 |
-
PAGE_UP: 33,
|
| 65 |
-
PAGE_DOWN: 34,
|
| 66 |
-
HOME: 36,
|
| 67 |
-
END: 35,
|
| 68 |
-
BACKSPACE: 8,
|
| 69 |
-
DELETE: 46,
|
| 70 |
-
isArrow: function (k) {
|
| 71 |
-
k = k.which ? k.which : k;
|
| 72 |
-
switch (k) {
|
| 73 |
-
case KEY.LEFT:
|
| 74 |
-
case KEY.RIGHT:
|
| 75 |
-
case KEY.UP:
|
| 76 |
-
case KEY.DOWN:
|
| 77 |
-
return true;
|
| 78 |
-
}
|
| 79 |
-
return false;
|
| 80 |
-
},
|
| 81 |
-
isControl: function (e) {
|
| 82 |
-
var k = e.which;
|
| 83 |
-
switch (k) {
|
| 84 |
-
case KEY.SHIFT:
|
| 85 |
-
case KEY.CTRL:
|
| 86 |
-
case KEY.ALT:
|
| 87 |
-
return true;
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
if (e.metaKey) return true;
|
| 91 |
-
|
| 92 |
-
return false;
|
| 93 |
-
},
|
| 94 |
-
isFunctionKey: function (k) {
|
| 95 |
-
k = k.which ? k.which : k;
|
| 96 |
-
return k >= 112 && k <= 123;
|
| 97 |
-
}
|
| 98 |
-
},
|
| 99 |
-
MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
|
| 100 |
-
|
| 101 |
-
DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
|
| 102 |
-
|
| 103 |
-
$document = $(document);
|
| 104 |
-
|
| 105 |
-
nextUid=(function() { var counter=1; return function() { return counter++; }; }());
|
| 106 |
-
|
| 107 |
-
|
| 108 |
-
function reinsertElement(element) {
|
| 109 |
-
var placeholder = $(document.createTextNode(''));
|
| 110 |
-
|
| 111 |
-
element.before(placeholder);
|
| 112 |
-
placeholder.before(element);
|
| 113 |
-
placeholder.remove();
|
| 114 |
-
}
|
| 115 |
-
|
| 116 |
-
function stripDiacritics(str) {
|
| 117 |
-
// Used 'uni range + named function' from http://jsperf.com/diacritics/18
|
| 118 |
-
function match(a) {
|
| 119 |
-
return DIACRITICS[a] || a;
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
return str.replace(/[^\u0000-\u007E]/g, match);
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
function indexOf(value, array) {
|
| 126 |
-
var i = 0, l = array.length;
|
| 127 |
-
for (; i < l; i = i + 1) {
|
| 128 |
-
if (equal(value, array[i])) return i;
|
| 129 |
-
}
|
| 130 |
-
return -1;
|
| 131 |
-
}
|
| 132 |
-
|
| 133 |
-
function measureScrollbar () {
|
| 134 |
-
var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
|
| 135 |
-
$template.appendTo('body');
|
| 136 |
-
|
| 137 |
-
var dim = {
|
| 138 |
-
width: $template.width() - $template[0].clientWidth,
|
| 139 |
-
height: $template.height() - $template[0].clientHeight
|
| 140 |
-
};
|
| 141 |
-
$template.remove();
|
| 142 |
-
|
| 143 |
-
return dim;
|
| 144 |
-
}
|
| 145 |
-
|
| 146 |
-
/**
|
| 147 |
-
* Compares equality of a and b
|
| 148 |
-
* @param a
|
| 149 |
-
* @param b
|
| 150 |
-
*/
|
| 151 |
-
function equal(a, b) {
|
| 152 |
-
if (a === b) return true;
|
| 153 |
-
if (a === undefined || b === undefined) return false;
|
| 154 |
-
if (a === null || b === null) return false;
|
| 155 |
-
// Check whether 'a' or 'b' is a string (primitive or object).
|
| 156 |
-
// The concatenation of an empty string (+'') converts its argument to a string's primitive.
|
| 157 |
-
if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
|
| 158 |
-
if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
|
| 159 |
-
return false;
|
| 160 |
-
}
|
| 161 |
-
|
| 162 |
-
/**
|
| 163 |
-
* Splits the string into an array of values, trimming each value. An empty array is returned for nulls or empty
|
| 164 |
-
* strings
|
| 165 |
-
* @param string
|
| 166 |
-
* @param separator
|
| 167 |
-
*/
|
| 168 |
-
function splitVal(string, separator) {
|
| 169 |
-
var val, i, l;
|
| 170 |
-
if (string === null || string.length < 1) return [];
|
| 171 |
-
val = string.split(separator);
|
| 172 |
-
for (i = 0, l = val.length; i < l; i = i + 1) val[i] = $.trim(val[i]);
|
| 173 |
-
return val;
|
| 174 |
-
}
|
| 175 |
-
|
| 176 |
-
function getSideBorderPadding(element) {
|
| 177 |
-
return element.outerWidth(false) - element.width();
|
| 178 |
-
}
|
| 179 |
-
|
| 180 |
-
function installKeyUpChangeEvent(element) {
|
| 181 |
-
var key="keyup-change-value";
|
| 182 |
-
element.on("keydown", function () {
|
| 183 |
-
if ($.data(element, key) === undefined) {
|
| 184 |
-
$.data(element, key, element.val());
|
| 185 |
-
}
|
| 186 |
-
});
|
| 187 |
-
element.on("keyup", function () {
|
| 188 |
-
var val= $.data(element, key);
|
| 189 |
-
if (val !== undefined && element.val() !== val) {
|
| 190 |
-
$.removeData(element, key);
|
| 191 |
-
element.trigger("keyup-change");
|
| 192 |
-
}
|
| 193 |
-
});
|
| 194 |
-
}
|
| 195 |
-
|
| 196 |
-
|
| 197 |
-
/**
|
| 198 |
-
* filters mouse events so an event is fired only if the mouse moved.
|
| 199 |
-
*
|
| 200 |
-
* filters out mouse events that occur when mouse is stationary but
|
| 201 |
-
* the elements under the pointer are scrolled.
|
| 202 |
-
*/
|
| 203 |
-
function installFilteredMouseMove(element) {
|
| 204 |
-
element.on("mousemove", function (e) {
|
| 205 |
-
var lastpos = lastMousePosition;
|
| 206 |
-
if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
|
| 207 |
-
$(e.target).trigger("mousemove-filtered", e);
|
| 208 |
-
}
|
| 209 |
-
});
|
| 210 |
-
}
|
| 211 |
-
|
| 212 |
-
/**
|
| 213 |
-
* Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
|
| 214 |
-
* within the last quietMillis milliseconds.
|
| 215 |
-
*
|
| 216 |
-
* @param quietMillis number of milliseconds to wait before invoking fn
|
| 217 |
-
* @param fn function to be debounced
|
| 218 |
-
* @param ctx object to be used as this reference within fn
|
| 219 |
-
* @return debounced version of fn
|
| 220 |
-
*/
|
| 221 |
-
function debounce(quietMillis, fn, ctx) {
|
| 222 |
-
ctx = ctx || undefined;
|
| 223 |
-
var timeout;
|
| 224 |
-
return function () {
|
| 225 |
-
var args = arguments;
|
| 226 |
-
window.clearTimeout(timeout);
|
| 227 |
-
timeout = window.setTimeout(function() {
|
| 228 |
-
fn.apply(ctx, args);
|
| 229 |
-
}, quietMillis);
|
| 230 |
-
};
|
| 231 |
-
}
|
| 232 |
-
|
| 233 |
-
function installDebouncedScroll(threshold, element) {
|
| 234 |
-
var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
|
| 235 |
-
element.on("scroll", function (e) {
|
| 236 |
-
if (indexOf(e.target, element.get()) >= 0) notify(e);
|
| 237 |
-
});
|
| 238 |
-
}
|
| 239 |
-
|
| 240 |
-
function focus($el) {
|
| 241 |
-
if ($el[0] === document.activeElement) return;
|
| 242 |
-
|
| 243 |
-
/* set the focus in a 0 timeout - that way the focus is set after the processing
|
| 244 |
-
of the current event has finished - which seems like the only reliable way
|
| 245 |
-
to set focus */
|
| 246 |
-
window.setTimeout(function() {
|
| 247 |
-
var el=$el[0], pos=$el.val().length, range;
|
| 248 |
-
|
| 249 |
-
$el.focus();
|
| 250 |
-
|
| 251 |
-
/* make sure el received focus so we do not error out when trying to manipulate the caret.
|
| 252 |
-
sometimes modals or others listeners may steal it after its set */
|
| 253 |
-
var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
|
| 254 |
-
if (isVisible && el === document.activeElement) {
|
| 255 |
-
|
| 256 |
-
/* after the focus is set move the caret to the end, necessary when we val()
|
| 257 |
-
just before setting focus */
|
| 258 |
-
if(el.setSelectionRange)
|
| 259 |
-
{
|
| 260 |
-
el.setSelectionRange(pos, pos);
|
| 261 |
-
}
|
| 262 |
-
else if (el.createTextRange) {
|
| 263 |
-
range = el.createTextRange();
|
| 264 |
-
range.collapse(false);
|
| 265 |
-
range.select();
|
| 266 |
-
}
|
| 267 |
-
}
|
| 268 |
-
}, 0);
|
| 269 |
-
}
|
| 270 |
-
|
| 271 |
-
function getCursorInfo(el) {
|
| 272 |
-
el = $(el)[0];
|
| 273 |
-
var offset = 0;
|
| 274 |
-
var length = 0;
|
| 275 |
-
if ('selectionStart' in el) {
|
| 276 |
-
offset = el.selectionStart;
|
| 277 |
-
length = el.selectionEnd - offset;
|
| 278 |
-
} else if ('selection' in document) {
|
| 279 |
-
el.focus();
|
| 280 |
-
var sel = document.selection.createRange();
|
| 281 |
-
length = document.selection.createRange().text.length;
|
| 282 |
-
sel.moveStart('character', -el.value.length);
|
| 283 |
-
offset = sel.text.length - length;
|
| 284 |
-
}
|
| 285 |
-
return { offset: offset, length: length };
|
| 286 |
-
}
|
| 287 |
-
|
| 288 |
-
function killEvent(event) {
|
| 289 |
-
event.preventDefault();
|
| 290 |
-
event.stopPropagation();
|
| 291 |
-
}
|
| 292 |
-
function killEventImmediately(event) {
|
| 293 |
-
event.preventDefault();
|
| 294 |
-
event.stopImmediatePropagation();
|
| 295 |
-
}
|
| 296 |
-
|
| 297 |
-
function measureTextWidth(e) {
|
| 298 |
-
if (!sizer){
|
| 299 |
-
var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
|
| 300 |
-
sizer = $(document.createElement("div")).css({
|
| 301 |
-
position: "absolute",
|
| 302 |
-
left: "-10000px",
|
| 303 |
-
top: "-10000px",
|
| 304 |
-
display: "none",
|
| 305 |
-
fontSize: style.fontSize,
|
| 306 |
-
fontFamily: style.fontFamily,
|
| 307 |
-
fontStyle: style.fontStyle,
|
| 308 |
-
fontWeight: style.fontWeight,
|
| 309 |
-
letterSpacing: style.letterSpacing,
|
| 310 |
-
textTransform: style.textTransform,
|
| 311 |
-
whiteSpace: "nowrap"
|
| 312 |
-
});
|
| 313 |
-
sizer.attr("class","select2-sizer");
|
| 314 |
-
$("body").append(sizer);
|
| 315 |
-
}
|
| 316 |
-
sizer.text(e.val());
|
| 317 |
-
return sizer.width();
|
| 318 |
-
}
|
| 319 |
-
|
| 320 |
-
function syncCssClasses(dest, src, adapter) {
|
| 321 |
-
var classes, replacements = [], adapted;
|
| 322 |
-
|
| 323 |
-
classes = $.trim(dest.attr("class"));
|
| 324 |
-
|
| 325 |
-
if (classes) {
|
| 326 |
-
classes = '' + classes; // for IE which returns object
|
| 327 |
-
|
| 328 |
-
$(classes.split(/\s+/)).each2(function() {
|
| 329 |
-
if (this.indexOf("select2-") === 0) {
|
| 330 |
-
replacements.push(this);
|
| 331 |
-
}
|
| 332 |
-
});
|
| 333 |
-
}
|
| 334 |
-
|
| 335 |
-
classes = $.trim(src.attr("class"));
|
| 336 |
-
|
| 337 |
-
if (classes) {
|
| 338 |
-
classes = '' + classes; // for IE which returns object
|
| 339 |
-
|
| 340 |
-
$(classes.split(/\s+/)).each2(function() {
|
| 341 |
-
if (this.indexOf("select2-") !== 0) {
|
| 342 |
-
adapted = adapter(this);
|
| 343 |
-
|
| 344 |
-
if (adapted) {
|
| 345 |
-
replacements.push(adapted);
|
| 346 |
-
}
|
| 347 |
-
}
|
| 348 |
-
});
|
| 349 |
-
}
|
| 350 |
-
|
| 351 |
-
dest.attr("class", replacements.join(" "));
|
| 352 |
-
}
|
| 353 |
-
|
| 354 |
-
|
| 355 |
-
function markMatch(text, term, markup, escapeMarkup) {
|
| 356 |
-
var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
|
| 357 |
-
tl=term.length;
|
| 358 |
-
|
| 359 |
-
if (match<0) {
|
| 360 |
-
markup.push(escapeMarkup(text));
|
| 361 |
-
return;
|
| 362 |
-
}
|
| 363 |
-
|
| 364 |
-
markup.push(escapeMarkup(text.substring(0, match)));
|
| 365 |
-
markup.push("<span class='select2-match'>");
|
| 366 |
-
markup.push(escapeMarkup(text.substring(match, match + tl)));
|
| 367 |
-
markup.push("</span>");
|
| 368 |
-
markup.push(escapeMarkup(text.substring(match + tl, text.length)));
|
| 369 |
-
}
|
| 370 |
-
|
| 371 |
-
function defaultEscapeMarkup(markup) {
|
| 372 |
-
var replace_map = {
|
| 373 |
-
'\\': '\',
|
| 374 |
-
'&': '&',
|
| 375 |
-
'<': '<',
|
| 376 |
-
'>': '>',
|
| 377 |
-
'"': '"',
|
| 378 |
-
"'": ''',
|
| 379 |
-
"/": '/'
|
| 380 |
-
};
|
| 381 |
-
|
| 382 |
-
return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
|
| 383 |
-
return replace_map[match];
|
| 384 |
-
});
|
| 385 |
-
}
|
| 386 |
-
|
| 387 |
-
/**
|
| 388 |
-
* Produces an ajax-based query function
|
| 389 |
-
*
|
| 390 |
-
* @param options object containing configuration parameters
|
| 391 |
-
* @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
|
| 392 |
-
* @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
|
| 393 |
-
* @param options.url url for the data
|
| 394 |
-
* @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
|
| 395 |
-
* @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
|
| 396 |
-
* @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
|
| 397 |
-
* @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
|
| 398 |
-
* The expected format is an object containing the following keys:
|
| 399 |
-
* results array of objects that will be used as choices
|
| 400 |
-
* more (optional) boolean indicating whether there are more results available
|
| 401 |
-
* Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
|
| 402 |
-
*/
|
| 403 |
-
function ajax(options) {
|
| 404 |
-
var timeout, // current scheduled but not yet executed request
|
| 405 |
-
handler = null,
|
| 406 |
-
quietMillis = options.quietMillis || 100,
|
| 407 |
-
ajaxUrl = options.url,
|
| 408 |
-
self = this;
|
| 409 |
-
|
| 410 |
-
return function (query) {
|
| 411 |
-
window.clearTimeout(timeout);
|
| 412 |
-
timeout = window.setTimeout(function () {
|
| 413 |
-
var data = options.data, // ajax data function
|
| 414 |
-
url = ajaxUrl, // ajax url string or function
|
| 415 |
-
transport = options.transport || $.fn.select2.ajaxDefaults.transport,
|
| 416 |
-
// deprecated - to be removed in 4.0 - use params instead
|
| 417 |
-
deprecated = {
|
| 418 |
-
type: options.type || 'GET', // set type of request (GET or POST)
|
| 419 |
-
cache: options.cache || false,
|
| 420 |
-
jsonpCallback: options.jsonpCallback||undefined,
|
| 421 |
-
dataType: options.dataType||"json"
|
| 422 |
-
},
|
| 423 |
-
params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
|
| 424 |
-
|
| 425 |
-
data = data ? data.call(self, query.term, query.page, query.context) : null;
|
| 426 |
-
url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
|
| 427 |
-
|
| 428 |
-
if (handler && typeof handler.abort === "function") { handler.abort(); }
|
| 429 |
-
|
| 430 |
-
if (options.params) {
|
| 431 |
-
if ($.isFunction(options.params)) {
|
| 432 |
-
$.extend(params, options.params.call(self));
|
| 433 |
-
} else {
|
| 434 |
-
$.extend(params, options.params);
|
| 435 |
-
}
|
| 436 |
-
}
|
| 437 |
-
|
| 438 |
-
$.extend(params, {
|
| 439 |
-
url: url,
|
| 440 |
-
dataType: options.dataType,
|
| 441 |
-
data: data,
|
| 442 |
-
success: function (data) {
|
| 443 |
-
// TODO - replace query.page with query so users have access to term, page, etc.
|
| 444 |
-
// added query as third paramter to keep backwards compatibility
|
| 445 |
-
var results = options.results(data, query.page, query);
|
| 446 |
-
query.callback(results);
|
| 447 |
-
},
|
| 448 |
-
error: function(jqXHR, textStatus, errorThrown){
|
| 449 |
-
var results = {
|
| 450 |
-
hasError: true,
|
| 451 |
-
jqXHR: jqXHR,
|
| 452 |
-
textStatus: textStatus,
|
| 453 |
-
errorThrown: errorThrown,
|
| 454 |
-
};
|
| 455 |
-
|
| 456 |
-
query.callback(results);
|
| 457 |
-
}
|
| 458 |
-
});
|
| 459 |
-
handler = transport.call(self, params);
|
| 460 |
-
}, quietMillis);
|
| 461 |
-
};
|
| 462 |
-
}
|
| 463 |
-
|
| 464 |
-
/**
|
| 465 |
-
* Produces a query function that works with a local array
|
| 466 |
-
*
|
| 467 |
-
* @param options object containing configuration parameters. The options parameter can either be an array or an
|
| 468 |
-
* object.
|
| 469 |
-
*
|
| 470 |
-
* If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
|
| 471 |
-
*
|
| 472 |
-
* If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
|
| 473 |
-
* an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
|
| 474 |
-
* key can either be a String in which case it is expected that each element in the 'data' array has a key with the
|
| 475 |
-
* value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
|
| 476 |
-
* the text.
|
| 477 |
-
*/
|
| 478 |
-
function local(options) {
|
| 479 |
-
var data = options, // data elements
|
| 480 |
-
dataText,
|
| 481 |
-
tmp,
|
| 482 |
-
text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
|
| 483 |
-
|
| 484 |
-
if ($.isArray(data)) {
|
| 485 |
-
tmp = data;
|
| 486 |
-
data = { results: tmp };
|
| 487 |
-
}
|
| 488 |
-
|
| 489 |
-
if ($.isFunction(data) === false) {
|
| 490 |
-
tmp = data;
|
| 491 |
-
data = function() { return tmp; };
|
| 492 |
-
}
|
| 493 |
-
|
| 494 |
-
var dataItem = data();
|
| 495 |
-
if (dataItem.text) {
|
| 496 |
-
text = dataItem.text;
|
| 497 |
-
// if text is not a function we assume it to be a key name
|
| 498 |
-
if (!$.isFunction(text)) {
|
| 499 |
-
dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
|
| 500 |
-
text = function (item) { return item[dataText]; };
|
| 501 |
-
}
|
| 502 |
-
}
|
| 503 |
-
|
| 504 |
-
return function (query) {
|
| 505 |
-
var t = query.term, filtered = { results: [] }, process;
|
| 506 |
-
if (t === "") {
|
| 507 |
-
query.callback(data());
|
| 508 |
-
return;
|
| 509 |
-
}
|
| 510 |
-
|
| 511 |
-
process = function(datum, collection) {
|
| 512 |
-
var group, attr;
|
| 513 |
-
datum = datum[0];
|
| 514 |
-
if (datum.children) {
|
| 515 |
-
group = {};
|
| 516 |
-
for (attr in datum) {
|
| 517 |
-
if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
|
| 518 |
-
}
|
| 519 |
-
group.children=[];
|
| 520 |
-
$(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
|
| 521 |
-
if (group.children.length || query.matcher(t, text(group), datum)) {
|
| 522 |
-
collection.push(group);
|
| 523 |
-
}
|
| 524 |
-
} else {
|
| 525 |
-
if (query.matcher(t, text(datum), datum)) {
|
| 526 |
-
collection.push(datum);
|
| 527 |
-
}
|
| 528 |
-
}
|
| 529 |
-
};
|
| 530 |
-
|
| 531 |
-
$(data().results).each2(function(i, datum) { process(datum, filtered.results); });
|
| 532 |
-
query.callback(filtered);
|
| 533 |
-
};
|
| 534 |
-
}
|
| 535 |
-
|
| 536 |
-
// TODO javadoc
|
| 537 |
-
function tags(data) {
|
| 538 |
-
var isFunc = $.isFunction(data);
|
| 539 |
-
return function (query) {
|
| 540 |
-
var t = query.term, filtered = {results: []};
|
| 541 |
-
var result = isFunc ? data(query) : data;
|
| 542 |
-
if ($.isArray(result)) {
|
| 543 |
-
$(result).each(function () {
|
| 544 |
-
var isObject = this.text !== undefined,
|
| 545 |
-
text = isObject ? this.text : this;
|
| 546 |
-
if (t === "" || query.matcher(t, text)) {
|
| 547 |
-
filtered.results.push(isObject ? this : {id: this, text: this});
|
| 548 |
-
}
|
| 549 |
-
});
|
| 550 |
-
query.callback(filtered);
|
| 551 |
-
}
|
| 552 |
-
};
|
| 553 |
-
}
|
| 554 |
-
|
| 555 |
-
/**
|
| 556 |
-
* Checks if the formatter function should be used.
|
| 557 |
-
*
|
| 558 |
-
* Throws an error if it is not a function. Returns true if it should be used,
|
| 559 |
-
* false if no formatting should be performed.
|
| 560 |
-
*
|
| 561 |
-
* @param formatter
|
| 562 |
-
*/
|
| 563 |
-
function checkFormatter(formatter, formatterName) {
|
| 564 |
-
if ($.isFunction(formatter)) return true;
|
| 565 |
-
if (!formatter) return false;
|
| 566 |
-
if (typeof(formatter) === 'string') return true;
|
| 567 |
-
throw new Error(formatterName +" must be a string, function, or falsy value");
|
| 568 |
-
}
|
| 569 |
-
|
| 570 |
-
/**
|
| 571 |
-
* Returns a given value
|
| 572 |
-
* If given a function, returns its output
|
| 573 |
-
*
|
| 574 |
-
* @param val string|function
|
| 575 |
-
* @param context value of "this" to be passed to function
|
| 576 |
-
* @returns {*}
|
| 577 |
-
*/
|
| 578 |
-
function evaluate(val, context) {
|
| 579 |
-
if ($.isFunction(val)) {
|
| 580 |
-
var args = Array.prototype.slice.call(arguments, 2);
|
| 581 |
-
return val.apply(context, args);
|
| 582 |
-
}
|
| 583 |
-
return val;
|
| 584 |
-
}
|
| 585 |
-
|
| 586 |
-
function countResults(results) {
|
| 587 |
-
var count = 0;
|
| 588 |
-
$.each(results, function(i, item) {
|
| 589 |
-
if (item.children) {
|
| 590 |
-
count += countResults(item.children);
|
| 591 |
-
} else {
|
| 592 |
-
count++;
|
| 593 |
-
}
|
| 594 |
-
});
|
| 595 |
-
return count;
|
| 596 |
-
}
|
| 597 |
-
|
| 598 |
-
/**
|
| 599 |
-
* Default tokenizer. This function uses breaks the input on substring match of any string from the
|
| 600 |
-
* opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
|
| 601 |
-
* two options have to be defined in order for the tokenizer to work.
|
| 602 |
-
*
|
| 603 |
-
* @param input text user has typed so far or pasted into the search field
|
| 604 |
-
* @param selection currently selected choices
|
| 605 |
-
* @param selectCallback function(choice) callback tho add the choice to selection
|
| 606 |
-
* @param opts select2's opts
|
| 607 |
-
* @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
|
| 608 |
-
*/
|
| 609 |
-
function defaultTokenizer(input, selection, selectCallback, opts) {
|
| 610 |
-
var original = input, // store the original so we can compare and know if we need to tell the search to update its text
|
| 611 |
-
dupe = false, // check for whether a token we extracted represents a duplicate selected choice
|
| 612 |
-
token, // token
|
| 613 |
-
index, // position at which the separator was found
|
| 614 |
-
i, l, // looping variables
|
| 615 |
-
separator; // the matched separator
|
| 616 |
-
|
| 617 |
-
if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
|
| 618 |
-
|
| 619 |
-
while (true) {
|
| 620 |
-
index = -1;
|
| 621 |
-
|
| 622 |
-
for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
|
| 623 |
-
separator = opts.tokenSeparators[i];
|
| 624 |
-
index = input.indexOf(separator);
|
| 625 |
-
if (index >= 0) break;
|
| 626 |
-
}
|
| 627 |
-
|
| 628 |
-
if (index < 0) break; // did not find any token separator in the input string, bail
|
| 629 |
-
|
| 630 |
-
token = input.substring(0, index);
|
| 631 |
-
input = input.substring(index + separator.length);
|
| 632 |
-
|
| 633 |
-
if (token.length > 0) {
|
| 634 |
-
token = opts.createSearchChoice.call(this, token, selection);
|
| 635 |
-
if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
|
| 636 |
-
dupe = false;
|
| 637 |
-
for (i = 0, l = selection.length; i < l; i++) {
|
| 638 |
-
if (equal(opts.id(token), opts.id(selection[i]))) {
|
| 639 |
-
dupe = true; break;
|
| 640 |
-
}
|
| 641 |
-
}
|
| 642 |
-
|
| 643 |
-
if (!dupe) selectCallback(token);
|
| 644 |
-
}
|
| 645 |
-
}
|
| 646 |
-
}
|
| 647 |
-
|
| 648 |
-
if (original!==input) return input;
|
| 649 |
-
}
|
| 650 |
-
|
| 651 |
-
function cleanupJQueryElements() {
|
| 652 |
-
var self = this;
|
| 653 |
-
|
| 654 |
-
$.each(arguments, function (i, element) {
|
| 655 |
-
self[element].remove();
|
| 656 |
-
self[element] = null;
|
| 657 |
-
});
|
| 658 |
-
}
|
| 659 |
-
|
| 660 |
-
/**
|
| 661 |
-
* Creates a new class
|
| 662 |
-
*
|
| 663 |
-
* @param superClass
|
| 664 |
-
* @param methods
|
| 665 |
-
*/
|
| 666 |
-
function clazz(SuperClass, methods) {
|
| 667 |
-
var constructor = function () {};
|
| 668 |
-
constructor.prototype = new SuperClass;
|
| 669 |
-
constructor.prototype.constructor = constructor;
|
| 670 |
-
constructor.prototype.parent = SuperClass.prototype;
|
| 671 |
-
constructor.prototype = $.extend(constructor.prototype, methods);
|
| 672 |
-
return constructor;
|
| 673 |
-
}
|
| 674 |
-
|
| 675 |
-
AbstractSelect2 = clazz(Object, {
|
| 676 |
-
|
| 677 |
-
// abstract
|
| 678 |
-
bind: function (func) {
|
| 679 |
-
var self = this;
|
| 680 |
-
return function () {
|
| 681 |
-
func.apply(self, arguments);
|
| 682 |
-
};
|
| 683 |
-
},
|
| 684 |
-
|
| 685 |
-
// abstract
|
| 686 |
-
init: function (opts) {
|
| 687 |
-
var results, search, resultsSelector = ".select2-results";
|
| 688 |
-
|
| 689 |
-
// prepare options
|
| 690 |
-
this.opts = opts = this.prepareOpts(opts);
|
| 691 |
-
|
| 692 |
-
this.id=opts.id;
|
| 693 |
-
|
| 694 |
-
// destroy if called on an existing component
|
| 695 |
-
if (opts.element.data("select2") !== undefined &&
|
| 696 |
-
opts.element.data("select2") !== null) {
|
| 697 |
-
opts.element.data("select2").destroy();
|
| 698 |
-
}
|
| 699 |
-
|
| 700 |
-
this.container = this.createContainer();
|
| 701 |
-
|
| 702 |
-
this.liveRegion = $("<span>", {
|
| 703 |
-
role: "status",
|
| 704 |
-
"aria-live": "polite"
|
| 705 |
-
})
|
| 706 |
-
.addClass("select2-hidden-accessible")
|
| 707 |
-
.appendTo(document.body);
|
| 708 |
-
|
| 709 |
-
this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
|
| 710 |
-
this.containerEventName= this.containerId
|
| 711 |
-
.replace(/([.])/g, '_')
|
| 712 |
-
.replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
|
| 713 |
-
this.container.attr("id", this.containerId);
|
| 714 |
-
|
| 715 |
-
this.container.attr("title", opts.element.attr("title"));
|
| 716 |
-
|
| 717 |
-
this.body = $("body");
|
| 718 |
-
|
| 719 |
-
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
| 720 |
-
|
| 721 |
-
this.container.attr("style", opts.element.attr("style"));
|
| 722 |
-
this.container.css(evaluate(opts.containerCss, this.opts.element));
|
| 723 |
-
this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
|
| 724 |
-
|
| 725 |
-
this.elementTabIndex = this.opts.element.attr("tabindex");
|
| 726 |
-
|
| 727 |
-
// swap container for the element
|
| 728 |
-
this.opts.element
|
| 729 |
-
.data("select2", this)
|
| 730 |
-
.attr("tabindex", "-1")
|
| 731 |
-
.before(this.container)
|
| 732 |
-
.on("click.select2", killEvent); // do not leak click events
|
| 733 |
-
|
| 734 |
-
this.container.data("select2", this);
|
| 735 |
-
|
| 736 |
-
this.dropdown = this.container.find(".select2-drop");
|
| 737 |
-
|
| 738 |
-
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
| 739 |
-
|
| 740 |
-
this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
|
| 741 |
-
this.dropdown.data("select2", this);
|
| 742 |
-
this.dropdown.on("click", killEvent);
|
| 743 |
-
|
| 744 |
-
this.results = results = this.container.find(resultsSelector);
|
| 745 |
-
this.search = search = this.container.find("input.select2-input");
|
| 746 |
-
|
| 747 |
-
this.queryCount = 0;
|
| 748 |
-
this.resultsPage = 0;
|
| 749 |
-
this.context = null;
|
| 750 |
-
|
| 751 |
-
// initialize the container
|
| 752 |
-
this.initContainer();
|
| 753 |
-
|
| 754 |
-
this.container.on("click", killEvent);
|
| 755 |
-
|
| 756 |
-
installFilteredMouseMove(this.results);
|
| 757 |
-
|
| 758 |
-
this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
|
| 759 |
-
this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
|
| 760 |
-
this._touchEvent = true;
|
| 761 |
-
this.highlightUnderEvent(event);
|
| 762 |
-
}));
|
| 763 |
-
this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
|
| 764 |
-
this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
|
| 765 |
-
|
| 766 |
-
// Waiting for a click event on touch devices to select option and hide dropdown
|
| 767 |
-
// otherwise click will be triggered on an underlying element
|
| 768 |
-
this.dropdown.on('click', this.bind(function (event) {
|
| 769 |
-
if (this._touchEvent) {
|
| 770 |
-
this._touchEvent = false;
|
| 771 |
-
this.selectHighlighted();
|
| 772 |
-
}
|
| 773 |
-
}));
|
| 774 |
-
|
| 775 |
-
installDebouncedScroll(80, this.results);
|
| 776 |
-
this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
|
| 777 |
-
|
| 778 |
-
// do not propagate change event from the search field out of the component
|
| 779 |
-
$(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
| 780 |
-
$(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
| 781 |
-
|
| 782 |
-
// if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
|
| 783 |
-
if ($.fn.mousewheel) {
|
| 784 |
-
results.mousewheel(function (e, delta, deltaX, deltaY) {
|
| 785 |
-
var top = results.scrollTop();
|
| 786 |
-
if (deltaY > 0 && top - deltaY <= 0) {
|
| 787 |
-
results.scrollTop(0);
|
| 788 |
-
killEvent(e);
|
| 789 |
-
} else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
|
| 790 |
-
results.scrollTop(results.get(0).scrollHeight - results.height());
|
| 791 |
-
killEvent(e);
|
| 792 |
-
}
|
| 793 |
-
});
|
| 794 |
-
}
|
| 795 |
-
|
| 796 |
-
installKeyUpChangeEvent(search);
|
| 797 |
-
search.on("keyup-change input paste", this.bind(this.updateResults));
|
| 798 |
-
search.on("focus", function () { search.addClass("select2-focused"); });
|
| 799 |
-
search.on("blur", function () { search.removeClass("select2-focused");});
|
| 800 |
-
|
| 801 |
-
this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
|
| 802 |
-
if ($(e.target).closest(".select2-result-selectable").length > 0) {
|
| 803 |
-
this.highlightUnderEvent(e);
|
| 804 |
-
this.selectHighlighted(e);
|
| 805 |
-
}
|
| 806 |
-
}));
|
| 807 |
-
|
| 808 |
-
// trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
|
| 809 |
-
// for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
|
| 810 |
-
// dom it will trigger the popup close, which is not what we want
|
| 811 |
-
// focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
|
| 812 |
-
this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
|
| 813 |
-
|
| 814 |
-
this.nextSearchTerm = undefined;
|
| 815 |
-
|
| 816 |
-
if ($.isFunction(this.opts.initSelection)) {
|
| 817 |
-
// initialize selection based on the current value of the source element
|
| 818 |
-
this.initSelection();
|
| 819 |
-
|
| 820 |
-
// if the user has provided a function that can set selection based on the value of the source element
|
| 821 |
-
// we monitor the change event on the element and trigger it, allowing for two way synchronization
|
| 822 |
-
this.monitorSource();
|
| 823 |
-
}
|
| 824 |
-
|
| 825 |
-
if (opts.maximumInputLength !== null) {
|
| 826 |
-
this.search.attr("maxlength", opts.maximumInputLength);
|
| 827 |
-
}
|
| 828 |
-
|
| 829 |
-
var disabled = opts.element.prop("disabled");
|
| 830 |
-
if (disabled === undefined) disabled = false;
|
| 831 |
-
this.enable(!disabled);
|
| 832 |
-
|
| 833 |
-
var readonly = opts.element.prop("readonly");
|
| 834 |
-
if (readonly === undefined) readonly = false;
|
| 835 |
-
this.readonly(readonly);
|
| 836 |
-
|
| 837 |
-
// Calculate size of scrollbar
|
| 838 |
-
scrollBarDimensions = scrollBarDimensions || measureScrollbar();
|
| 839 |
-
|
| 840 |
-
this.autofocus = opts.element.prop("autofocus");
|
| 841 |
-
opts.element.prop("autofocus", false);
|
| 842 |
-
if (this.autofocus) this.focus();
|
| 843 |
-
|
| 844 |
-
this.search.attr("placeholder", opts.searchInputPlaceholder);
|
| 845 |
-
},
|
| 846 |
-
|
| 847 |
-
// abstract
|
| 848 |
-
destroy: function () {
|
| 849 |
-
var element=this.opts.element, select2 = element.data("select2"), self = this;
|
| 850 |
-
|
| 851 |
-
this.close();
|
| 852 |
-
|
| 853 |
-
if (element.length && element[0].detachEvent) {
|
| 854 |
-
element.each(function () {
|
| 855 |
-
this.detachEvent("onpropertychange", self._sync);
|
| 856 |
-
});
|
| 857 |
-
}
|
| 858 |
-
if (this.propertyObserver) {
|
| 859 |
-
this.propertyObserver.disconnect();
|
| 860 |
-
this.propertyObserver = null;
|
| 861 |
-
}
|
| 862 |
-
this._sync = null;
|
| 863 |
-
|
| 864 |
-
if (select2 !== undefined) {
|
| 865 |
-
select2.container.remove();
|
| 866 |
-
select2.liveRegion.remove();
|
| 867 |
-
select2.dropdown.remove();
|
| 868 |
-
element
|
| 869 |
-
.removeClass("select2-offscreen")
|
| 870 |
-
.removeData("select2")
|
| 871 |
-
.off(".select2")
|
| 872 |
-
.prop("autofocus", this.autofocus || false);
|
| 873 |
-
if (this.elementTabIndex) {
|
| 874 |
-
element.attr({tabindex: this.elementTabIndex});
|
| 875 |
-
} else {
|
| 876 |
-
element.removeAttr("tabindex");
|
| 877 |
-
}
|
| 878 |
-
element.show();
|
| 879 |
-
}
|
| 880 |
-
|
| 881 |
-
cleanupJQueryElements.call(this,
|
| 882 |
-
"container",
|
| 883 |
-
"liveRegion",
|
| 884 |
-
"dropdown",
|
| 885 |
-
"results",
|
| 886 |
-
"search"
|
| 887 |
-
);
|
| 888 |
-
},
|
| 889 |
-
|
| 890 |
-
// abstract
|
| 891 |
-
optionToData: function(element) {
|
| 892 |
-
if (element.is("option")) {
|
| 893 |
-
return {
|
| 894 |
-
id:element.prop("value"),
|
| 895 |
-
text:element.text(),
|
| 896 |
-
element: element.get(),
|
| 897 |
-
css: element.attr("class"),
|
| 898 |
-
disabled: element.prop("disabled"),
|
| 899 |
-
locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
|
| 900 |
-
};
|
| 901 |
-
} else if (element.is("optgroup")) {
|
| 902 |
-
return {
|
| 903 |
-
text:element.attr("label"),
|
| 904 |
-
children:[],
|
| 905 |
-
element: element.get(),
|
| 906 |
-
css: element.attr("class")
|
| 907 |
-
};
|
| 908 |
-
}
|
| 909 |
-
},
|
| 910 |
-
|
| 911 |
-
// abstract
|
| 912 |
-
prepareOpts: function (opts) {
|
| 913 |
-
var element, select, idKey, ajaxUrl, self = this;
|
| 914 |
-
|
| 915 |
-
element = opts.element;
|
| 916 |
-
|
| 917 |
-
if (element.get(0).tagName.toLowerCase() === "select") {
|
| 918 |
-
this.select = select = opts.element;
|
| 919 |
-
}
|
| 920 |
-
|
| 921 |
-
if (select) {
|
| 922 |
-
// these options are not allowed when attached to a select because they are picked up off the element itself
|
| 923 |
-
$.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
|
| 924 |
-
if (this in opts) {
|
| 925 |
-
throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
|
| 926 |
-
}
|
| 927 |
-
});
|
| 928 |
-
}
|
| 929 |
-
|
| 930 |
-
opts = $.extend({}, {
|
| 931 |
-
populateResults: function(container, results, query) {
|
| 932 |
-
var populate, id=this.opts.id, liveRegion=this.liveRegion;
|
| 933 |
-
|
| 934 |
-
populate=function(results, container, depth) {
|
| 935 |
-
|
| 936 |
-
var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
|
| 937 |
-
|
| 938 |
-
results = opts.sortResults(results, container, query);
|
| 939 |
-
|
| 940 |
-
// collect the created nodes for bulk append
|
| 941 |
-
var nodes = [];
|
| 942 |
-
for (i = 0, l = results.length; i < l; i = i + 1) {
|
| 943 |
-
|
| 944 |
-
result=results[i];
|
| 945 |
-
|
| 946 |
-
disabled = (result.disabled === true);
|
| 947 |
-
selectable = (!disabled) && (id(result) !== undefined);
|
| 948 |
-
|
| 949 |
-
compound=result.children && result.children.length > 0;
|
| 950 |
-
|
| 951 |
-
node=$("<li></li>");
|
| 952 |
-
node.addClass("select2-results-dept-"+depth);
|
| 953 |
-
node.addClass("select2-result");
|
| 954 |
-
node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
|
| 955 |
-
if (disabled) { node.addClass("select2-disabled"); }
|
| 956 |
-
if (compound) { node.addClass("select2-result-with-children"); }
|
| 957 |
-
node.addClass(self.opts.formatResultCssClass(result));
|
| 958 |
-
node.attr("role", "presentation");
|
| 959 |
-
|
| 960 |
-
label=$(document.createElement("div"));
|
| 961 |
-
label.addClass("select2-result-label");
|
| 962 |
-
label.attr("id", "select2-result-label-" + nextUid());
|
| 963 |
-
label.attr("role", "option");
|
| 964 |
-
|
| 965 |
-
formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
|
| 966 |
-
if (formatted!==undefined) {
|
| 967 |
-
label.html(formatted);
|
| 968 |
-
node.append(label);
|
| 969 |
-
}
|
| 970 |
-
|
| 971 |
-
|
| 972 |
-
if (compound) {
|
| 973 |
-
|
| 974 |
-
innerContainer=$("<ul></ul>");
|
| 975 |
-
innerContainer.addClass("select2-result-sub");
|
| 976 |
-
populate(result.children, innerContainer, depth+1);
|
| 977 |
-
node.append(innerContainer);
|
| 978 |
-
}
|
| 979 |
-
|
| 980 |
-
node.data("select2-data", result);
|
| 981 |
-
nodes.push(node[0]);
|
| 982 |
-
}
|
| 983 |
-
|
| 984 |
-
// bulk append the created nodes
|
| 985 |
-
container.append(nodes);
|
| 986 |
-
liveRegion.text(opts.formatMatches(results.length));
|
| 987 |
-
};
|
| 988 |
-
|
| 989 |
-
populate(results, container, 0);
|
| 990 |
-
}
|
| 991 |
-
}, $.fn.select2.defaults, opts);
|
| 992 |
-
|
| 993 |
-
if (typeof(opts.id) !== "function") {
|
| 994 |
-
idKey = opts.id;
|
| 995 |
-
opts.id = function (e) { return e[idKey]; };
|
| 996 |
-
}
|
| 997 |
-
|
| 998 |
-
if ($.isArray(opts.element.data("select2Tags"))) {
|
| 999 |
-
if ("tags" in opts) {
|
| 1000 |
-
throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
|
| 1001 |
-
}
|
| 1002 |
-
opts.tags=opts.element.data("select2Tags");
|
| 1003 |
-
}
|
| 1004 |
-
|
| 1005 |
-
if (select) {
|
| 1006 |
-
opts.query = this.bind(function (query) {
|
| 1007 |
-
var data = { results: [], more: false },
|
| 1008 |
-
term = query.term,
|
| 1009 |
-
children, placeholderOption, process;
|
| 1010 |
-
|
| 1011 |
-
process=function(element, collection) {
|
| 1012 |
-
var group;
|
| 1013 |
-
if (element.is("option")) {
|
| 1014 |
-
if (query.matcher(term, element.text(), element)) {
|
| 1015 |
-
collection.push(self.optionToData(element));
|
| 1016 |
-
}
|
| 1017 |
-
} else if (element.is("optgroup")) {
|
| 1018 |
-
group=self.optionToData(element);
|
| 1019 |
-
element.children().each2(function(i, elm) { process(elm, group.children); });
|
| 1020 |
-
if (group.children.length>0) {
|
| 1021 |
-
collection.push(group);
|
| 1022 |
-
}
|
| 1023 |
-
}
|
| 1024 |
-
};
|
| 1025 |
-
|
| 1026 |
-
children=element.children();
|
| 1027 |
-
|
| 1028 |
-
// ignore the placeholder option if there is one
|
| 1029 |
-
if (this.getPlaceholder() !== undefined && children.length > 0) {
|
| 1030 |
-
placeholderOption = this.getPlaceholderOption();
|
| 1031 |
-
if (placeholderOption) {
|
| 1032 |
-
children=children.not(placeholderOption);
|
| 1033 |
-
}
|
| 1034 |
-
}
|
| 1035 |
-
|
| 1036 |
-
children.each2(function(i, elm) { process(elm, data.results); });
|
| 1037 |
-
|
| 1038 |
-
query.callback(data);
|
| 1039 |
-
});
|
| 1040 |
-
// this is needed because inside val() we construct choices from options and their id is hardcoded
|
| 1041 |
-
opts.id=function(e) { return e.id; };
|
| 1042 |
-
} else {
|
| 1043 |
-
if (!("query" in opts)) {
|
| 1044 |
-
|
| 1045 |
-
if ("ajax" in opts) {
|
| 1046 |
-
ajaxUrl = opts.element.data("ajax-url");
|
| 1047 |
-
if (ajaxUrl && ajaxUrl.length > 0) {
|
| 1048 |
-
opts.ajax.url = ajaxUrl;
|
| 1049 |
-
}
|
| 1050 |
-
opts.query = ajax.call(opts.element, opts.ajax);
|
| 1051 |
-
} else if ("data" in opts) {
|
| 1052 |
-
opts.query = local(opts.data);
|
| 1053 |
-
} else if ("tags" in opts) {
|
| 1054 |
-
opts.query = tags(opts.tags);
|
| 1055 |
-
if (opts.createSearchChoice === undefined) {
|
| 1056 |
-
opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
|
| 1057 |
-
}
|
| 1058 |
-
if (opts.initSelection === undefined) {
|
| 1059 |
-
opts.initSelection = function (element, callback) {
|
| 1060 |
-
var data = [];
|
| 1061 |
-
$(splitVal(element.val(), opts.separator)).each(function () {
|
| 1062 |
-
var obj = { id: this, text: this },
|
| 1063 |
-
tags = opts.tags;
|
| 1064 |
-
if ($.isFunction(tags)) tags=tags();
|
| 1065 |
-
$(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
|
| 1066 |
-
data.push(obj);
|
| 1067 |
-
});
|
| 1068 |
-
|
| 1069 |
-
callback(data);
|
| 1070 |
-
};
|
| 1071 |
-
}
|
| 1072 |
-
}
|
| 1073 |
-
}
|
| 1074 |
-
}
|
| 1075 |
-
if (typeof(opts.query) !== "function") {
|
| 1076 |
-
throw "query function not defined for Select2 " + opts.element.attr("id");
|
| 1077 |
-
}
|
| 1078 |
-
|
| 1079 |
-
if (opts.createSearchChoicePosition === 'top') {
|
| 1080 |
-
opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
|
| 1081 |
-
}
|
| 1082 |
-
else if (opts.createSearchChoicePosition === 'bottom') {
|
| 1083 |
-
opts.createSearchChoicePosition = function(list, item) { list.push(item); };
|
| 1084 |
-
}
|
| 1085 |
-
else if (typeof(opts.createSearchChoicePosition) !== "function") {
|
| 1086 |
-
throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
|
| 1087 |
-
}
|
| 1088 |
-
|
| 1089 |
-
return opts;
|
| 1090 |
-
},
|
| 1091 |
-
|
| 1092 |
-
/**
|
| 1093 |
-
* Monitor the original element for changes and update select2 accordingly
|
| 1094 |
-
*/
|
| 1095 |
-
// abstract
|
| 1096 |
-
monitorSource: function () {
|
| 1097 |
-
var el = this.opts.element, observer, self = this;
|
| 1098 |
-
|
| 1099 |
-
el.on("change.select2", this.bind(function (e) {
|
| 1100 |
-
if (this.opts.element.data("select2-change-triggered") !== true) {
|
| 1101 |
-
this.initSelection();
|
| 1102 |
-
}
|
| 1103 |
-
}));
|
| 1104 |
-
|
| 1105 |
-
this._sync = this.bind(function () {
|
| 1106 |
-
|
| 1107 |
-
// sync enabled state
|
| 1108 |
-
var disabled = el.prop("disabled");
|
| 1109 |
-
if (disabled === undefined) disabled = false;
|
| 1110 |
-
this.enable(!disabled);
|
| 1111 |
-
|
| 1112 |
-
var readonly = el.prop("readonly");
|
| 1113 |
-
if (readonly === undefined) readonly = false;
|
| 1114 |
-
this.readonly(readonly);
|
| 1115 |
-
|
| 1116 |
-
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
| 1117 |
-
this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
|
| 1118 |
-
|
| 1119 |
-
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
| 1120 |
-
this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
|
| 1121 |
-
|
| 1122 |
-
});
|
| 1123 |
-
|
| 1124 |
-
// IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
|
| 1125 |
-
if (el.length && el[0].attachEvent) {
|
| 1126 |
-
el.each(function() {
|
| 1127 |
-
this.attachEvent("onpropertychange", self._sync);
|
| 1128 |
-
});
|
| 1129 |
-
}
|
| 1130 |
-
|
| 1131 |
-
// safari, chrome, firefox, IE11
|
| 1132 |
-
observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
|
| 1133 |
-
if (observer !== undefined) {
|
| 1134 |
-
if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
|
| 1135 |
-
this.propertyObserver = new observer(function (mutations) {
|
| 1136 |
-
$.each(mutations, self._sync);
|
| 1137 |
-
});
|
| 1138 |
-
this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
|
| 1139 |
-
}
|
| 1140 |
-
},
|
| 1141 |
-
|
| 1142 |
-
// abstract
|
| 1143 |
-
triggerSelect: function(data) {
|
| 1144 |
-
var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
|
| 1145 |
-
this.opts.element.trigger(evt);
|
| 1146 |
-
return !evt.isDefaultPrevented();
|
| 1147 |
-
},
|
| 1148 |
-
|
| 1149 |
-
/**
|
| 1150 |
-
* Triggers the change event on the source element
|
| 1151 |
-
*/
|
| 1152 |
-
// abstract
|
| 1153 |
-
triggerChange: function (details) {
|
| 1154 |
-
|
| 1155 |
-
details = details || {};
|
| 1156 |
-
details= $.extend({}, details, { type: "change", val: this.val() });
|
| 1157 |
-
// prevents recursive triggering
|
| 1158 |
-
this.opts.element.data("select2-change-triggered", true);
|
| 1159 |
-
this.opts.element.trigger(details);
|
| 1160 |
-
this.opts.element.data("select2-change-triggered", false);
|
| 1161 |
-
|
| 1162 |
-
// some validation frameworks ignore the change event and listen instead to keyup, click for selects
|
| 1163 |
-
// so here we trigger the click event manually
|
| 1164 |
-
this.opts.element.click();
|
| 1165 |
-
|
| 1166 |
-
// ValidationEngine ignores the change event and listens instead to blur
|
| 1167 |
-
// so here we trigger the blur event manually if so desired
|
| 1168 |
-
if (this.opts.blurOnChange)
|
| 1169 |
-
this.opts.element.blur();
|
| 1170 |
-
},
|
| 1171 |
-
|
| 1172 |
-
//abstract
|
| 1173 |
-
isInterfaceEnabled: function()
|
| 1174 |
-
{
|
| 1175 |
-
return this.enabledInterface === true;
|
| 1176 |
-
},
|
| 1177 |
-
|
| 1178 |
-
// abstract
|
| 1179 |
-
enableInterface: function() {
|
| 1180 |
-
var enabled = this._enabled && !this._readonly,
|
| 1181 |
-
disabled = !enabled;
|
| 1182 |
-
|
| 1183 |
-
if (enabled === this.enabledInterface) return false;
|
| 1184 |
-
|
| 1185 |
-
this.container.toggleClass("select2-container-disabled", disabled);
|
| 1186 |
-
this.close();
|
| 1187 |
-
this.enabledInterface = enabled;
|
| 1188 |
-
|
| 1189 |
-
return true;
|
| 1190 |
-
},
|
| 1191 |
-
|
| 1192 |
-
// abstract
|
| 1193 |
-
enable: function(enabled) {
|
| 1194 |
-
if (enabled === undefined) enabled = true;
|
| 1195 |
-
if (this._enabled === enabled) return;
|
| 1196 |
-
this._enabled = enabled;
|
| 1197 |
-
|
| 1198 |
-
this.opts.element.prop("disabled", !enabled);
|
| 1199 |
-
this.enableInterface();
|
| 1200 |
-
},
|
| 1201 |
-
|
| 1202 |
-
// abstract
|
| 1203 |
-
disable: function() {
|
| 1204 |
-
this.enable(false);
|
| 1205 |
-
},
|
| 1206 |
-
|
| 1207 |
-
// abstract
|
| 1208 |
-
readonly: function(enabled) {
|
| 1209 |
-
if (enabled === undefined) enabled = false;
|
| 1210 |
-
if (this._readonly === enabled) return;
|
| 1211 |
-
this._readonly = enabled;
|
| 1212 |
-
|
| 1213 |
-
this.opts.element.prop("readonly", enabled);
|
| 1214 |
-
this.enableInterface();
|
| 1215 |
-
},
|
| 1216 |
-
|
| 1217 |
-
// abstract
|
| 1218 |
-
opened: function () {
|
| 1219 |
-
return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
|
| 1220 |
-
},
|
| 1221 |
-
|
| 1222 |
-
// abstract
|
| 1223 |
-
positionDropdown: function() {
|
| 1224 |
-
var $dropdown = this.dropdown,
|
| 1225 |
-
offset = this.container.offset(),
|
| 1226 |
-
height = this.container.outerHeight(false),
|
| 1227 |
-
width = this.container.outerWidth(false),
|
| 1228 |
-
dropHeight = $dropdown.outerHeight(false),
|
| 1229 |
-
$window = $(window),
|
| 1230 |
-
windowWidth = $window.width(),
|
| 1231 |
-
windowHeight = $window.height(),
|
| 1232 |
-
viewPortRight = $window.scrollLeft() + windowWidth,
|
| 1233 |
-
viewportBottom = $window.scrollTop() + windowHeight,
|
| 1234 |
-
dropTop = offset.top + height,
|
| 1235 |
-
dropLeft = offset.left,
|
| 1236 |
-
enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
|
| 1237 |
-
enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
|
| 1238 |
-
dropWidth = $dropdown.outerWidth(false),
|
| 1239 |
-
enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight,
|
| 1240 |
-
aboveNow = $dropdown.hasClass("select2-drop-above"),
|
| 1241 |
-
bodyOffset,
|
| 1242 |
-
above,
|
| 1243 |
-
changeDirection,
|
| 1244 |
-
css,
|
| 1245 |
-
resultsListNode;
|
| 1246 |
-
|
| 1247 |
-
// always prefer the current above/below alignment, unless there is not enough room
|
| 1248 |
-
if (aboveNow) {
|
| 1249 |
-
above = true;
|
| 1250 |
-
if (!enoughRoomAbove && enoughRoomBelow) {
|
| 1251 |
-
changeDirection = true;
|
| 1252 |
-
above = false;
|
| 1253 |
-
}
|
| 1254 |
-
} else {
|
| 1255 |
-
above = false;
|
| 1256 |
-
if (!enoughRoomBelow && enoughRoomAbove) {
|
| 1257 |
-
changeDirection = true;
|
| 1258 |
-
above = true;
|
| 1259 |
-
}
|
| 1260 |
-
}
|
| 1261 |
-
|
| 1262 |
-
//if we are changing direction we need to get positions when dropdown is hidden;
|
| 1263 |
-
if (changeDirection) {
|
| 1264 |
-
$dropdown.hide();
|
| 1265 |
-
offset = this.container.offset();
|
| 1266 |
-
height = this.container.outerHeight(false);
|
| 1267 |
-
width = this.container.outerWidth(false);
|
| 1268 |
-
dropHeight = $dropdown.outerHeight(false);
|
| 1269 |
-
viewPortRight = $window.scrollLeft() + windowWidth;
|
| 1270 |
-
viewportBottom = $window.scrollTop() + windowHeight;
|
| 1271 |
-
dropTop = offset.top + height;
|
| 1272 |
-
dropLeft = offset.left;
|
| 1273 |
-
dropWidth = $dropdown.outerWidth(false);
|
| 1274 |
-
enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight;
|
| 1275 |
-
$dropdown.show();
|
| 1276 |
-
|
| 1277 |
-
// fix so the cursor does not move to the left within the search-textbox in IE
|
| 1278 |
-
this.focusSearch();
|
| 1279 |
-
}
|
| 1280 |
-
|
| 1281 |
-
if (this.opts.dropdownAutoWidth) {
|
| 1282 |
-
resultsListNode = $('.select2-results', $dropdown)[0];
|
| 1283 |
-
$dropdown.addClass('select2-drop-auto-width');
|
| 1284 |
-
$dropdown.css('width', '');
|
| 1285 |
-
// Add scrollbar width to dropdown if vertical scrollbar is present
|
| 1286 |
-
dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
|
| 1287 |
-
dropWidth > width ? width = dropWidth : dropWidth = width;
|
| 1288 |
-
dropHeight = $dropdown.outerHeight(false);
|
| 1289 |
-
enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight;
|
| 1290 |
-
}
|
| 1291 |
-
else {
|
| 1292 |
-
this.container.removeClass('select2-drop-auto-width');
|
| 1293 |
-
}
|
| 1294 |
-
|
| 1295 |
-
//console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
|
| 1296 |
-
//console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
|
| 1297 |
-
|
| 1298 |
-
// fix positioning when body has an offset and is not position: static
|
| 1299 |
-
if (this.body.css('position') !== 'static') {
|
| 1300 |
-
bodyOffset = this.body.offset();
|
| 1301 |
-
dropTop -= bodyOffset.top;
|
| 1302 |
-
dropLeft -= bodyOffset.left;
|
| 1303 |
-
}
|
| 1304 |
-
|
| 1305 |
-
if (!enoughRoomOnRight) {
|
| 1306 |
-
dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
|
| 1307 |
-
}
|
| 1308 |
-
|
| 1309 |
-
css = {
|
| 1310 |
-
left: dropLeft,
|
| 1311 |
-
width: width
|
| 1312 |
-
};
|
| 1313 |
-
|
| 1314 |
-
if (above) {
|
| 1315 |
-
css.top = offset.top - dropHeight;
|
| 1316 |
-
css.bottom = 'auto';
|
| 1317 |
-
this.container.addClass("select2-drop-above");
|
| 1318 |
-
$dropdown.addClass("select2-drop-above");
|
| 1319 |
-
}
|
| 1320 |
-
else {
|
| 1321 |
-
css.top = dropTop;
|
| 1322 |
-
css.bottom = 'auto';
|
| 1323 |
-
this.container.removeClass("select2-drop-above");
|
| 1324 |
-
$dropdown.removeClass("select2-drop-above");
|
| 1325 |
-
}
|
| 1326 |
-
css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
|
| 1327 |
-
|
| 1328 |
-
$dropdown.css(css);
|
| 1329 |
-
},
|
| 1330 |
-
|
| 1331 |
-
// abstract
|
| 1332 |
-
shouldOpen: function() {
|
| 1333 |
-
var event;
|
| 1334 |
-
|
| 1335 |
-
if (this.opened()) return false;
|
| 1336 |
-
|
| 1337 |
-
if (this._enabled === false || this._readonly === true) return false;
|
| 1338 |
-
|
| 1339 |
-
event = $.Event("select2-opening");
|
| 1340 |
-
this.opts.element.trigger(event);
|
| 1341 |
-
return !event.isDefaultPrevented();
|
| 1342 |
-
},
|
| 1343 |
-
|
| 1344 |
-
// abstract
|
| 1345 |
-
clearDropdownAlignmentPreference: function() {
|
| 1346 |
-
// clear the classes used to figure out the preference of where the dropdown should be opened
|
| 1347 |
-
this.container.removeClass("select2-drop-above");
|
| 1348 |
-
this.dropdown.removeClass("select2-drop-above");
|
| 1349 |
-
},
|
| 1350 |
-
|
| 1351 |
-
/**
|
| 1352 |
-
* Opens the dropdown
|
| 1353 |
-
*
|
| 1354 |
-
* @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
|
| 1355 |
-
* the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
|
| 1356 |
-
*/
|
| 1357 |
-
// abstract
|
| 1358 |
-
open: function () {
|
| 1359 |
-
|
| 1360 |
-
if (!this.shouldOpen()) return false;
|
| 1361 |
-
|
| 1362 |
-
this.opening();
|
| 1363 |
-
|
| 1364 |
-
// Only bind the document mousemove when the dropdown is visible
|
| 1365 |
-
$document.on("mousemove.select2Event", function (e) {
|
| 1366 |
-
lastMousePosition.x = e.pageX;
|
| 1367 |
-
lastMousePosition.y = e.pageY;
|
| 1368 |
-
});
|
| 1369 |
-
|
| 1370 |
-
return true;
|
| 1371 |
-
},
|
| 1372 |
-
|
| 1373 |
-
/**
|
| 1374 |
-
* Performs the opening of the dropdown
|
| 1375 |
-
*/
|
| 1376 |
-
// abstract
|
| 1377 |
-
opening: function() {
|
| 1378 |
-
var cid = this.containerEventName,
|
| 1379 |
-
scroll = "scroll." + cid,
|
| 1380 |
-
resize = "resize."+cid,
|
| 1381 |
-
orient = "orientationchange."+cid,
|
| 1382 |
-
mask;
|
| 1383 |
-
|
| 1384 |
-
this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
|
| 1385 |
-
|
| 1386 |
-
this.clearDropdownAlignmentPreference();
|
| 1387 |
-
|
| 1388 |
-
if(this.dropdown[0] !== this.body.children().last()[0]) {
|
| 1389 |
-
this.dropdown.detach().appendTo(this.body);
|
| 1390 |
-
}
|
| 1391 |
-
|
| 1392 |
-
// create the dropdown mask if doesn't already exist
|
| 1393 |
-
mask = $("#select2-drop-mask");
|
| 1394 |
-
if (mask.length == 0) {
|
| 1395 |
-
mask = $(document.createElement("div"));
|
| 1396 |
-
mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
|
| 1397 |
-
mask.hide();
|
| 1398 |
-
mask.appendTo(this.body);
|
| 1399 |
-
mask.on("mousedown touchstart click", function (e) {
|
| 1400 |
-
// Prevent IE from generating a click event on the body
|
| 1401 |
-
reinsertElement(mask);
|
| 1402 |
-
|
| 1403 |
-
var dropdown = $("#select2-drop"), self;
|
| 1404 |
-
if (dropdown.length > 0) {
|
| 1405 |
-
self=dropdown.data("select2");
|
| 1406 |
-
if (self.opts.selectOnBlur) {
|
| 1407 |
-
self.selectHighlighted({noFocus: true});
|
| 1408 |
-
}
|
| 1409 |
-
self.close();
|
| 1410 |
-
e.preventDefault();
|
| 1411 |
-
e.stopPropagation();
|
| 1412 |
-
}
|
| 1413 |
-
});
|
| 1414 |
-
}
|
| 1415 |
-
|
| 1416 |
-
// ensure the mask is always right before the dropdown
|
| 1417 |
-
if (this.dropdown.prev()[0] !== mask[0]) {
|
| 1418 |
-
this.dropdown.before(mask);
|
| 1419 |
-
}
|
| 1420 |
-
|
| 1421 |
-
// move the global id to the correct dropdown
|
| 1422 |
-
$("#select2-drop").removeAttr("id");
|
| 1423 |
-
this.dropdown.attr("id", "select2-drop");
|
| 1424 |
-
|
| 1425 |
-
// show the elements
|
| 1426 |
-
mask.show();
|
| 1427 |
-
|
| 1428 |
-
this.positionDropdown();
|
| 1429 |
-
this.dropdown.show();
|
| 1430 |
-
this.positionDropdown();
|
| 1431 |
-
|
| 1432 |
-
this.dropdown.addClass("select2-drop-active");
|
| 1433 |
-
|
| 1434 |
-
// attach listeners to events that can change the position of the container and thus require
|
| 1435 |
-
// the position of the dropdown to be updated as well so it does not come unglued from the container
|
| 1436 |
-
var that = this;
|
| 1437 |
-
this.container.parents().add(window).each(function () {
|
| 1438 |
-
$(this).on(resize+" "+scroll+" "+orient, function (e) {
|
| 1439 |
-
if (that.opened()) that.positionDropdown();
|
| 1440 |
-
});
|
| 1441 |
-
});
|
| 1442 |
-
|
| 1443 |
-
|
| 1444 |
-
},
|
| 1445 |
-
|
| 1446 |
-
// abstract
|
| 1447 |
-
close: function () {
|
| 1448 |
-
if (!this.opened()) return;
|
| 1449 |
-
|
| 1450 |
-
var cid = this.containerEventName,
|
| 1451 |
-
scroll = "scroll." + cid,
|
| 1452 |
-
resize = "resize."+cid,
|
| 1453 |
-
orient = "orientationchange."+cid;
|
| 1454 |
-
|
| 1455 |
-
// unbind event listeners
|
| 1456 |
-
this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
|
| 1457 |
-
|
| 1458 |
-
this.clearDropdownAlignmentPreference();
|
| 1459 |
-
|
| 1460 |
-
$("#select2-drop-mask").hide();
|
| 1461 |
-
this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
|
| 1462 |
-
this.dropdown.hide();
|
| 1463 |
-
this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
|
| 1464 |
-
this.results.empty();
|
| 1465 |
-
|
| 1466 |
-
// Now that the dropdown is closed, unbind the global document mousemove event
|
| 1467 |
-
$document.off("mousemove.select2Event");
|
| 1468 |
-
|
| 1469 |
-
this.clearSearch();
|
| 1470 |
-
this.search.removeClass("select2-active");
|
| 1471 |
-
this.opts.element.trigger($.Event("select2-close"));
|
| 1472 |
-
},
|
| 1473 |
-
|
| 1474 |
-
/**
|
| 1475 |
-
* Opens control, sets input value, and updates results.
|
| 1476 |
-
*/
|
| 1477 |
-
// abstract
|
| 1478 |
-
externalSearch: function (term) {
|
| 1479 |
-
this.open();
|
| 1480 |
-
this.search.val(term);
|
| 1481 |
-
this.updateResults(false);
|
| 1482 |
-
},
|
| 1483 |
-
|
| 1484 |
-
// abstract
|
| 1485 |
-
clearSearch: function () {
|
| 1486 |
-
|
| 1487 |
-
},
|
| 1488 |
-
|
| 1489 |
-
//abstract
|
| 1490 |
-
getMaximumSelectionSize: function() {
|
| 1491 |
-
return evaluate(this.opts.maximumSelectionSize, this.opts.element);
|
| 1492 |
-
},
|
| 1493 |
-
|
| 1494 |
-
// abstract
|
| 1495 |
-
ensureHighlightVisible: function () {
|
| 1496 |
-
var results = this.results, children, index, child, hb, rb, y, more, topOffset;
|
| 1497 |
-
|
| 1498 |
-
index = this.highlight();
|
| 1499 |
-
|
| 1500 |
-
if (index < 0) return;
|
| 1501 |
-
|
| 1502 |
-
if (index == 0) {
|
| 1503 |
-
|
| 1504 |
-
// if the first element is highlighted scroll all the way to the top,
|
| 1505 |
-
// that way any unselectable headers above it will also be scrolled
|
| 1506 |
-
// into view
|
| 1507 |
-
|
| 1508 |
-
results.scrollTop(0);
|
| 1509 |
-
return;
|
| 1510 |
-
}
|
| 1511 |
-
|
| 1512 |
-
children = this.findHighlightableChoices().find('.select2-result-label');
|
| 1513 |
-
|
| 1514 |
-
child = $(children[index]);
|
| 1515 |
-
|
| 1516 |
-
topOffset = (child.offset() || {}).top || 0;
|
| 1517 |
-
|
| 1518 |
-
hb = topOffset + child.outerHeight(true);
|
| 1519 |
-
|
| 1520 |
-
// if this is the last child lets also make sure select2-more-results is visible
|
| 1521 |
-
if (index === children.length - 1) {
|
| 1522 |
-
more = results.find("li.select2-more-results");
|
| 1523 |
-
if (more.length > 0) {
|
| 1524 |
-
hb = more.offset().top + more.outerHeight(true);
|
| 1525 |
-
}
|
| 1526 |
-
}
|
| 1527 |
-
|
| 1528 |
-
rb = results.offset().top + results.outerHeight(true);
|
| 1529 |
-
if (hb > rb) {
|
| 1530 |
-
results.scrollTop(results.scrollTop() + (hb - rb));
|
| 1531 |
-
}
|
| 1532 |
-
y = topOffset - results.offset().top;
|
| 1533 |
-
|
| 1534 |
-
// make sure the top of the element is visible
|
| 1535 |
-
if (y < 0 && child.css('display') != 'none' ) {
|
| 1536 |
-
results.scrollTop(results.scrollTop() + y); // y is negative
|
| 1537 |
-
}
|
| 1538 |
-
},
|
| 1539 |
-
|
| 1540 |
-
// abstract
|
| 1541 |
-
findHighlightableChoices: function() {
|
| 1542 |
-
return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
|
| 1543 |
-
},
|
| 1544 |
-
|
| 1545 |
-
// abstract
|
| 1546 |
-
moveHighlight: function (delta) {
|
| 1547 |
-
var choices = this.findHighlightableChoices(),
|
| 1548 |
-
index = this.highlight();
|
| 1549 |
-
|
| 1550 |
-
while (index > -1 && index < choices.length) {
|
| 1551 |
-
index += delta;
|
| 1552 |
-
var choice = $(choices[index]);
|
| 1553 |
-
if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
|
| 1554 |
-
this.highlight(index);
|
| 1555 |
-
break;
|
| 1556 |
-
}
|
| 1557 |
-
}
|
| 1558 |
-
},
|
| 1559 |
-
|
| 1560 |
-
// abstract
|
| 1561 |
-
highlight: function (index) {
|
| 1562 |
-
var choices = this.findHighlightableChoices(),
|
| 1563 |
-
choice,
|
| 1564 |
-
data;
|
| 1565 |
-
|
| 1566 |
-
if (arguments.length === 0) {
|
| 1567 |
-
return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
|
| 1568 |
-
}
|
| 1569 |
-
|
| 1570 |
-
if (index >= choices.length) index = choices.length - 1;
|
| 1571 |
-
if (index < 0) index = 0;
|
| 1572 |
-
|
| 1573 |
-
this.removeHighlight();
|
| 1574 |
-
|
| 1575 |
-
choice = $(choices[index]);
|
| 1576 |
-
choice.addClass("select2-highlighted");
|
| 1577 |
-
|
| 1578 |
-
// ensure assistive technology can determine the active choice
|
| 1579 |
-
this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
|
| 1580 |
-
|
| 1581 |
-
this.ensureHighlightVisible();
|
| 1582 |
-
|
| 1583 |
-
this.liveRegion.text(choice.text());
|
| 1584 |
-
|
| 1585 |
-
data = choice.data("select2-data");
|
| 1586 |
-
if (data) {
|
| 1587 |
-
this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
|
| 1588 |
-
}
|
| 1589 |
-
},
|
| 1590 |
-
|
| 1591 |
-
removeHighlight: function() {
|
| 1592 |
-
this.results.find(".select2-highlighted").removeClass("select2-highlighted");
|
| 1593 |
-
},
|
| 1594 |
-
|
| 1595 |
-
touchMoved: function() {
|
| 1596 |
-
this._touchMoved = true;
|
| 1597 |
-
},
|
| 1598 |
-
|
| 1599 |
-
clearTouchMoved: function() {
|
| 1600 |
-
this._touchMoved = false;
|
| 1601 |
-
},
|
| 1602 |
-
|
| 1603 |
-
// abstract
|
| 1604 |
-
countSelectableResults: function() {
|
| 1605 |
-
return this.findHighlightableChoices().length;
|
| 1606 |
-
},
|
| 1607 |
-
|
| 1608 |
-
// abstract
|
| 1609 |
-
highlightUnderEvent: function (event) {
|
| 1610 |
-
var el = $(event.target).closest(".select2-result-selectable");
|
| 1611 |
-
if (el.length > 0 && !el.is(".select2-highlighted")) {
|
| 1612 |
-
var choices = this.findHighlightableChoices();
|
| 1613 |
-
this.highlight(choices.index(el));
|
| 1614 |
-
} else if (el.length == 0) {
|
| 1615 |
-
// if we are over an unselectable item remove all highlights
|
| 1616 |
-
this.removeHighlight();
|
| 1617 |
-
}
|
| 1618 |
-
},
|
| 1619 |
-
|
| 1620 |
-
// abstract
|
| 1621 |
-
loadMoreIfNeeded: function () {
|
| 1622 |
-
var results = this.results,
|
| 1623 |
-
more = results.find("li.select2-more-results"),
|
| 1624 |
-
below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
|
| 1625 |
-
page = this.resultsPage + 1,
|
| 1626 |
-
self=this,
|
| 1627 |
-
term=this.search.val(),
|
| 1628 |
-
context=this.context;
|
| 1629 |
-
|
| 1630 |
-
if (more.length === 0) return;
|
| 1631 |
-
below = more.offset().top - results.offset().top - results.height();
|
| 1632 |
-
|
| 1633 |
-
if (below <= this.opts.loadMorePadding) {
|
| 1634 |
-
more.addClass("select2-active");
|
| 1635 |
-
this.opts.query({
|
| 1636 |
-
element: this.opts.element,
|
| 1637 |
-
term: term,
|
| 1638 |
-
page: page,
|
| 1639 |
-
context: context,
|
| 1640 |
-
matcher: this.opts.matcher,
|
| 1641 |
-
callback: this.bind(function (data) {
|
| 1642 |
-
|
| 1643 |
-
// ignore a response if the select2 has been closed before it was received
|
| 1644 |
-
if (!self.opened()) return;
|
| 1645 |
-
|
| 1646 |
-
|
| 1647 |
-
self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
|
| 1648 |
-
self.postprocessResults(data, false, false);
|
| 1649 |
-
|
| 1650 |
-
if (data.more===true) {
|
| 1651 |
-
more.detach().appendTo(results).text(evaluate(self.opts.formatLoadMore, self.opts.element, page+1));
|
| 1652 |
-
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
| 1653 |
-
} else {
|
| 1654 |
-
more.remove();
|
| 1655 |
-
}
|
| 1656 |
-
self.positionDropdown();
|
| 1657 |
-
self.resultsPage = page;
|
| 1658 |
-
self.context = data.context;
|
| 1659 |
-
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
| 1660 |
-
})});
|
| 1661 |
-
}
|
| 1662 |
-
},
|
| 1663 |
-
|
| 1664 |
-
/**
|
| 1665 |
-
* Default tokenizer function which does nothing
|
| 1666 |
-
*/
|
| 1667 |
-
tokenize: function() {
|
| 1668 |
-
|
| 1669 |
-
},
|
| 1670 |
-
|
| 1671 |
-
/**
|
| 1672 |
-
* @param initial whether or not this is the call to this method right after the dropdown has been opened
|
| 1673 |
-
*/
|
| 1674 |
-
// abstract
|
| 1675 |
-
updateResults: function (initial) {
|
| 1676 |
-
var search = this.search,
|
| 1677 |
-
results = this.results,
|
| 1678 |
-
opts = this.opts,
|
| 1679 |
-
data,
|
| 1680 |
-
self = this,
|
| 1681 |
-
input,
|
| 1682 |
-
term = search.val(),
|
| 1683 |
-
lastTerm = $.data(this.container, "select2-last-term"),
|
| 1684 |
-
// sequence number used to drop out-of-order responses
|
| 1685 |
-
queryNumber;
|
| 1686 |
-
|
| 1687 |
-
// prevent duplicate queries against the same term
|
| 1688 |
-
if (initial !== true && lastTerm && equal(term, lastTerm)) return;
|
| 1689 |
-
|
| 1690 |
-
$.data(this.container, "select2-last-term", term);
|
| 1691 |
-
|
| 1692 |
-
// if the search is currently hidden we do not alter the results
|
| 1693 |
-
if (initial !== true && (this.showSearchInput === false || !this.opened())) {
|
| 1694 |
-
return;
|
| 1695 |
-
}
|
| 1696 |
-
|
| 1697 |
-
function postRender() {
|
| 1698 |
-
search.removeClass("select2-active");
|
| 1699 |
-
self.positionDropdown();
|
| 1700 |
-
if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
|
| 1701 |
-
self.liveRegion.text(results.text());
|
| 1702 |
-
}
|
| 1703 |
-
else {
|
| 1704 |
-
self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable').length));
|
| 1705 |
-
}
|
| 1706 |
-
}
|
| 1707 |
-
|
| 1708 |
-
function render(html) {
|
| 1709 |
-
results.html(html);
|
| 1710 |
-
postRender();
|
| 1711 |
-
}
|
| 1712 |
-
|
| 1713 |
-
queryNumber = ++this.queryCount;
|
| 1714 |
-
|
| 1715 |
-
var maxSelSize = this.getMaximumSelectionSize();
|
| 1716 |
-
if (maxSelSize >=1) {
|
| 1717 |
-
data = this.data();
|
| 1718 |
-
if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
|
| 1719 |
-
render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
|
| 1720 |
-
return;
|
| 1721 |
-
}
|
| 1722 |
-
}
|
| 1723 |
-
|
| 1724 |
-
if (search.val().length < opts.minimumInputLength) {
|
| 1725 |
-
if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
|
| 1726 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
|
| 1727 |
-
} else {
|
| 1728 |
-
render("");
|
| 1729 |
-
}
|
| 1730 |
-
if (initial && this.showSearch) this.showSearch(true);
|
| 1731 |
-
return;
|
| 1732 |
-
}
|
| 1733 |
-
|
| 1734 |
-
if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
|
| 1735 |
-
if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
|
| 1736 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
|
| 1737 |
-
} else {
|
| 1738 |
-
render("");
|
| 1739 |
-
}
|
| 1740 |
-
return;
|
| 1741 |
-
}
|
| 1742 |
-
|
| 1743 |
-
if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
|
| 1744 |
-
render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
|
| 1745 |
-
}
|
| 1746 |
-
|
| 1747 |
-
search.addClass("select2-active");
|
| 1748 |
-
|
| 1749 |
-
this.removeHighlight();
|
| 1750 |
-
|
| 1751 |
-
// give the tokenizer a chance to pre-process the input
|
| 1752 |
-
input = this.tokenize();
|
| 1753 |
-
if (input != undefined && input != null) {
|
| 1754 |
-
search.val(input);
|
| 1755 |
-
}
|
| 1756 |
-
|
| 1757 |
-
this.resultsPage = 1;
|
| 1758 |
-
|
| 1759 |
-
opts.query({
|
| 1760 |
-
element: opts.element,
|
| 1761 |
-
term: search.val(),
|
| 1762 |
-
page: this.resultsPage,
|
| 1763 |
-
context: null,
|
| 1764 |
-
matcher: opts.matcher,
|
| 1765 |
-
callback: this.bind(function (data) {
|
| 1766 |
-
var def; // default choice
|
| 1767 |
-
|
| 1768 |
-
// ignore old responses
|
| 1769 |
-
if (queryNumber != this.queryCount) {
|
| 1770 |
-
return;
|
| 1771 |
-
}
|
| 1772 |
-
|
| 1773 |
-
// ignore a response if the select2 has been closed before it was received
|
| 1774 |
-
if (!this.opened()) {
|
| 1775 |
-
this.search.removeClass("select2-active");
|
| 1776 |
-
return;
|
| 1777 |
-
}
|
| 1778 |
-
|
| 1779 |
-
// handle ajax error
|
| 1780 |
-
if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
|
| 1781 |
-
render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
|
| 1782 |
-
return;
|
| 1783 |
-
}
|
| 1784 |
-
|
| 1785 |
-
// save context, if any
|
| 1786 |
-
this.context = (data.context===undefined) ? null : data.context;
|
| 1787 |
-
// create a default choice and prepend it to the list
|
| 1788 |
-
if (this.opts.createSearchChoice && search.val() !== "") {
|
| 1789 |
-
def = this.opts.createSearchChoice.call(self, search.val(), data.results);
|
| 1790 |
-
if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
|
| 1791 |
-
if ($(data.results).filter(
|
| 1792 |
-
function () {
|
| 1793 |
-
return equal(self.id(this), self.id(def));
|
| 1794 |
-
}).length === 0) {
|
| 1795 |
-
this.opts.createSearchChoicePosition(data.results, def);
|
| 1796 |
-
}
|
| 1797 |
-
}
|
| 1798 |
-
}
|
| 1799 |
-
|
| 1800 |
-
if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
|
| 1801 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
|
| 1802 |
-
return;
|
| 1803 |
-
}
|
| 1804 |
-
|
| 1805 |
-
results.empty();
|
| 1806 |
-
self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
|
| 1807 |
-
|
| 1808 |
-
if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
|
| 1809 |
-
results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
|
| 1810 |
-
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
| 1811 |
-
}
|
| 1812 |
-
|
| 1813 |
-
this.postprocessResults(data, initial);
|
| 1814 |
-
|
| 1815 |
-
postRender();
|
| 1816 |
-
|
| 1817 |
-
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
| 1818 |
-
})});
|
| 1819 |
-
},
|
| 1820 |
-
|
| 1821 |
-
// abstract
|
| 1822 |
-
cancel: function () {
|
| 1823 |
-
this.close();
|
| 1824 |
-
},
|
| 1825 |
-
|
| 1826 |
-
// abstract
|
| 1827 |
-
blur: function () {
|
| 1828 |
-
// if selectOnBlur == true, select the currently highlighted option
|
| 1829 |
-
if (this.opts.selectOnBlur)
|
| 1830 |
-
this.selectHighlighted({noFocus: true});
|
| 1831 |
-
|
| 1832 |
-
this.close();
|
| 1833 |
-
this.container.removeClass("select2-container-active");
|
| 1834 |
-
// synonymous to .is(':focus'), which is available in jquery >= 1.6
|
| 1835 |
-
if (this.search[0] === document.activeElement) { this.search.blur(); }
|
| 1836 |
-
this.clearSearch();
|
| 1837 |
-
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
| 1838 |
-
},
|
| 1839 |
-
|
| 1840 |
-
// abstract
|
| 1841 |
-
focusSearch: function () {
|
| 1842 |
-
focus(this.search);
|
| 1843 |
-
},
|
| 1844 |
-
|
| 1845 |
-
// abstract
|
| 1846 |
-
selectHighlighted: function (options) {
|
| 1847 |
-
if (this._touchMoved) {
|
| 1848 |
-
this.clearTouchMoved();
|
| 1849 |
-
return;
|
| 1850 |
-
}
|
| 1851 |
-
var index=this.highlight(),
|
| 1852 |
-
highlighted=this.results.find(".select2-highlighted"),
|
| 1853 |
-
data = highlighted.closest('.select2-result').data("select2-data");
|
| 1854 |
-
|
| 1855 |
-
if (data) {
|
| 1856 |
-
this.highlight(index);
|
| 1857 |
-
this.onSelect(data, options);
|
| 1858 |
-
} else if (options && options.noFocus) {
|
| 1859 |
-
this.close();
|
| 1860 |
-
}
|
| 1861 |
-
},
|
| 1862 |
-
|
| 1863 |
-
// abstract
|
| 1864 |
-
getPlaceholder: function () {
|
| 1865 |
-
var placeholderOption;
|
| 1866 |
-
return this.opts.element.attr("placeholder") ||
|
| 1867 |
-
this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
|
| 1868 |
-
this.opts.element.data("placeholder") ||
|
| 1869 |
-
this.opts.placeholder ||
|
| 1870 |
-
((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
|
| 1871 |
-
},
|
| 1872 |
-
|
| 1873 |
-
// abstract
|
| 1874 |
-
getPlaceholderOption: function() {
|
| 1875 |
-
if (this.select) {
|
| 1876 |
-
var firstOption = this.select.children('option').first();
|
| 1877 |
-
if (this.opts.placeholderOption !== undefined ) {
|
| 1878 |
-
//Determine the placeholder option based on the specified placeholderOption setting
|
| 1879 |
-
return (this.opts.placeholderOption === "first" && firstOption) ||
|
| 1880 |
-
(typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
|
| 1881 |
-
} else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
|
| 1882 |
-
//No explicit placeholder option specified, use the first if it's blank
|
| 1883 |
-
return firstOption;
|
| 1884 |
-
}
|
| 1885 |
-
}
|
| 1886 |
-
},
|
| 1887 |
-
|
| 1888 |
-
/**
|
| 1889 |
-
* Get the desired width for the container element. This is
|
| 1890 |
-
* derived first from option `width` passed to select2, then
|
| 1891 |
-
* the inline 'style' on the original element, and finally
|
| 1892 |
-
* falls back to the jQuery calculated element width.
|
| 1893 |
-
*/
|
| 1894 |
-
// abstract
|
| 1895 |
-
initContainerWidth: function () {
|
| 1896 |
-
function resolveContainerWidth() {
|
| 1897 |
-
var style, attrs, matches, i, l, attr;
|
| 1898 |
-
|
| 1899 |
-
if (this.opts.width === "off") {
|
| 1900 |
-
return null;
|
| 1901 |
-
} else if (this.opts.width === "element"){
|
| 1902 |
-
return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
|
| 1903 |
-
} else if (this.opts.width === "copy" || this.opts.width === "resolve") {
|
| 1904 |
-
// check if there is inline style on the element that contains width
|
| 1905 |
-
style = this.opts.element.attr('style');
|
| 1906 |
-
if (style !== undefined) {
|
| 1907 |
-
attrs = style.split(';');
|
| 1908 |
-
for (i = 0, l = attrs.length; i < l; i = i + 1) {
|
| 1909 |
-
attr = attrs[i].replace(/\s/g, '');
|
| 1910 |
-
matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
|
| 1911 |
-
if (matches !== null && matches.length >= 1)
|
| 1912 |
-
return matches[1];
|
| 1913 |
-
}
|
| 1914 |
-
}
|
| 1915 |
-
|
| 1916 |
-
if (this.opts.width === "resolve") {
|
| 1917 |
-
// next check if css('width') can resolve a width that is percent based, this is sometimes possible
|
| 1918 |
-
// when attached to input type=hidden or elements hidden via css
|
| 1919 |
-
style = this.opts.element.css('width');
|
| 1920 |
-
if (style.indexOf("%") > 0) return style;
|
| 1921 |
-
|
| 1922 |
-
// finally, fallback on the calculated width of the element
|
| 1923 |
-
return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
|
| 1924 |
-
}
|
| 1925 |
-
|
| 1926 |
-
return null;
|
| 1927 |
-
} else if ($.isFunction(this.opts.width)) {
|
| 1928 |
-
return this.opts.width();
|
| 1929 |
-
} else {
|
| 1930 |
-
return this.opts.width;
|
| 1931 |
-
}
|
| 1932 |
-
};
|
| 1933 |
-
|
| 1934 |
-
var width = resolveContainerWidth.call(this);
|
| 1935 |
-
if (width !== null) {
|
| 1936 |
-
this.container.css("width", width);
|
| 1937 |
-
}
|
| 1938 |
-
}
|
| 1939 |
-
});
|
| 1940 |
-
|
| 1941 |
-
SingleSelect2 = clazz(AbstractSelect2, {
|
| 1942 |
-
|
| 1943 |
-
// single
|
| 1944 |
-
|
| 1945 |
-
createContainer: function () {
|
| 1946 |
-
var container = $(document.createElement("div")).attr({
|
| 1947 |
-
"class": "select2-container"
|
| 1948 |
-
}).html([
|
| 1949 |
-
"<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
|
| 1950 |
-
" <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>",
|
| 1951 |
-
" <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
|
| 1952 |
-
"</a>",
|
| 1953 |
-
"<label for='' class='select2-offscreen'></label>",
|
| 1954 |
-
"<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
|
| 1955 |
-
"<div class='select2-drop select2-display-none'>",
|
| 1956 |
-
" <div class='select2-search'>",
|
| 1957 |
-
" <label for='' class='select2-offscreen'></label>",
|
| 1958 |
-
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
|
| 1959 |
-
" aria-autocomplete='list' />",
|
| 1960 |
-
" </div>",
|
| 1961 |
-
" <ul class='select2-results' role='listbox'>",
|
| 1962 |
-
" </ul>",
|
| 1963 |
-
"</div>"].join(""));
|
| 1964 |
-
return container;
|
| 1965 |
-
},
|
| 1966 |
-
|
| 1967 |
-
// single
|
| 1968 |
-
enableInterface: function() {
|
| 1969 |
-
if (this.parent.enableInterface.apply(this, arguments)) {
|
| 1970 |
-
this.focusser.prop("disabled", !this.isInterfaceEnabled());
|
| 1971 |
-
}
|
| 1972 |
-
},
|
| 1973 |
-
|
| 1974 |
-
// single
|
| 1975 |
-
opening: function () {
|
| 1976 |
-
var el, range, len;
|
| 1977 |
-
|
| 1978 |
-
if (this.opts.minimumResultsForSearch >= 0) {
|
| 1979 |
-
this.showSearch(true);
|
| 1980 |
-
}
|
| 1981 |
-
|
| 1982 |
-
this.parent.opening.apply(this, arguments);
|
| 1983 |
-
|
| 1984 |
-
if (this.showSearchInput !== false) {
|
| 1985 |
-
// IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
|
| 1986 |
-
// all other browsers handle this just fine
|
| 1987 |
-
|
| 1988 |
-
this.search.val(this.focusser.val());
|
| 1989 |
-
}
|
| 1990 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 1991 |
-
this.search.focus();
|
| 1992 |
-
// move the cursor to the end after focussing, otherwise it will be at the beginning and
|
| 1993 |
-
// new text will appear *before* focusser.val()
|
| 1994 |
-
el = this.search.get(0);
|
| 1995 |
-
if (el.createTextRange) {
|
| 1996 |
-
range = el.createTextRange();
|
| 1997 |
-
range.collapse(false);
|
| 1998 |
-
range.select();
|
| 1999 |
-
} else if (el.setSelectionRange) {
|
| 2000 |
-
len = this.search.val().length;
|
| 2001 |
-
el.setSelectionRange(len, len);
|
| 2002 |
-
}
|
| 2003 |
-
}
|
| 2004 |
-
|
| 2005 |
-
// initializes search's value with nextSearchTerm (if defined by user)
|
| 2006 |
-
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
| 2007 |
-
if(this.search.val() === "") {
|
| 2008 |
-
if(this.nextSearchTerm != undefined){
|
| 2009 |
-
this.search.val(this.nextSearchTerm);
|
| 2010 |
-
this.search.select();
|
| 2011 |
-
}
|
| 2012 |
-
}
|
| 2013 |
-
|
| 2014 |
-
this.focusser.prop("disabled", true).val("");
|
| 2015 |
-
this.updateResults(true);
|
| 2016 |
-
this.opts.element.trigger($.Event("select2-open"));
|
| 2017 |
-
},
|
| 2018 |
-
|
| 2019 |
-
// single
|
| 2020 |
-
close: function () {
|
| 2021 |
-
if (!this.opened()) return;
|
| 2022 |
-
this.parent.close.apply(this, arguments);
|
| 2023 |
-
|
| 2024 |
-
this.focusser.prop("disabled", false);
|
| 2025 |
-
|
| 2026 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2027 |
-
this.focusser.focus();
|
| 2028 |
-
}
|
| 2029 |
-
},
|
| 2030 |
-
|
| 2031 |
-
// single
|
| 2032 |
-
focus: function () {
|
| 2033 |
-
if (this.opened()) {
|
| 2034 |
-
this.close();
|
| 2035 |
-
} else {
|
| 2036 |
-
this.focusser.prop("disabled", false);
|
| 2037 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2038 |
-
this.focusser.focus();
|
| 2039 |
-
}
|
| 2040 |
-
}
|
| 2041 |
-
},
|
| 2042 |
-
|
| 2043 |
-
// single
|
| 2044 |
-
isFocused: function () {
|
| 2045 |
-
return this.container.hasClass("select2-container-active");
|
| 2046 |
-
},
|
| 2047 |
-
|
| 2048 |
-
// single
|
| 2049 |
-
cancel: function () {
|
| 2050 |
-
this.parent.cancel.apply(this, arguments);
|
| 2051 |
-
this.focusser.prop("disabled", false);
|
| 2052 |
-
|
| 2053 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2054 |
-
this.focusser.focus();
|
| 2055 |
-
}
|
| 2056 |
-
},
|
| 2057 |
-
|
| 2058 |
-
// single
|
| 2059 |
-
destroy: function() {
|
| 2060 |
-
$("label[for='" + this.focusser.attr('id') + "']")
|
| 2061 |
-
.attr('for', this.opts.element.attr("id"));
|
| 2062 |
-
this.parent.destroy.apply(this, arguments);
|
| 2063 |
-
|
| 2064 |
-
cleanupJQueryElements.call(this,
|
| 2065 |
-
"selection",
|
| 2066 |
-
"focusser"
|
| 2067 |
-
);
|
| 2068 |
-
},
|
| 2069 |
-
|
| 2070 |
-
// single
|
| 2071 |
-
initContainer: function () {
|
| 2072 |
-
|
| 2073 |
-
var selection,
|
| 2074 |
-
container = this.container,
|
| 2075 |
-
dropdown = this.dropdown,
|
| 2076 |
-
idSuffix = nextUid(),
|
| 2077 |
-
elementLabel;
|
| 2078 |
-
|
| 2079 |
-
if (this.opts.minimumResultsForSearch < 0) {
|
| 2080 |
-
this.showSearch(false);
|
| 2081 |
-
} else {
|
| 2082 |
-
this.showSearch(true);
|
| 2083 |
-
}
|
| 2084 |
-
|
| 2085 |
-
this.selection = selection = container.find(".select2-choice");
|
| 2086 |
-
|
| 2087 |
-
this.focusser = container.find(".select2-focusser");
|
| 2088 |
-
|
| 2089 |
-
// add aria associations
|
| 2090 |
-
selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
|
| 2091 |
-
this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
|
| 2092 |
-
this.results.attr("id", "select2-results-"+idSuffix);
|
| 2093 |
-
this.search.attr("aria-owns", "select2-results-"+idSuffix);
|
| 2094 |
-
|
| 2095 |
-
// rewrite labels from original element to focusser
|
| 2096 |
-
this.focusser.attr("id", "s2id_autogen"+idSuffix);
|
| 2097 |
-
|
| 2098 |
-
elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
|
| 2099 |
-
|
| 2100 |
-
this.focusser.prev()
|
| 2101 |
-
.text(elementLabel.text())
|
| 2102 |
-
.attr('for', this.focusser.attr('id'));
|
| 2103 |
-
|
| 2104 |
-
// Ensure the original element retains an accessible name
|
| 2105 |
-
var originalTitle = this.opts.element.attr("title");
|
| 2106 |
-
this.opts.element.attr("title", (originalTitle || elementLabel.text()));
|
| 2107 |
-
|
| 2108 |
-
this.focusser.attr("tabindex", this.elementTabIndex);
|
| 2109 |
-
|
| 2110 |
-
// write label for search field using the label from the focusser element
|
| 2111 |
-
this.search.attr("id", this.focusser.attr('id') + '_search');
|
| 2112 |
-
|
| 2113 |
-
this.search.prev()
|
| 2114 |
-
.text($("label[for='" + this.focusser.attr('id') + "']").text())
|
| 2115 |
-
.attr('for', this.search.attr('id'));
|
| 2116 |
-
|
| 2117 |
-
this.search.on("keydown", this.bind(function (e) {
|
| 2118 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2119 |
-
|
| 2120 |
-
// filter 229 keyCodes (input method editor is processing key input)
|
| 2121 |
-
if (229 == e.keyCode) return;
|
| 2122 |
-
|
| 2123 |
-
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
| 2124 |
-
// prevent the page from scrolling
|
| 2125 |
-
killEvent(e);
|
| 2126 |
-
return;
|
| 2127 |
-
}
|
| 2128 |
-
|
| 2129 |
-
switch (e.which) {
|
| 2130 |
-
case KEY.UP:
|
| 2131 |
-
case KEY.DOWN:
|
| 2132 |
-
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
| 2133 |
-
killEvent(e);
|
| 2134 |
-
return;
|
| 2135 |
-
case KEY.ENTER:
|
| 2136 |
-
this.selectHighlighted();
|
| 2137 |
-
killEvent(e);
|
| 2138 |
-
return;
|
| 2139 |
-
case KEY.TAB:
|
| 2140 |
-
this.selectHighlighted({noFocus: true});
|
| 2141 |
-
return;
|
| 2142 |
-
case KEY.ESC:
|
| 2143 |
-
this.cancel(e);
|
| 2144 |
-
killEvent(e);
|
| 2145 |
-
return;
|
| 2146 |
-
}
|
| 2147 |
-
}));
|
| 2148 |
-
|
| 2149 |
-
this.search.on("blur", this.bind(function(e) {
|
| 2150 |
-
// a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
|
| 2151 |
-
// without this the search field loses focus which is annoying
|
| 2152 |
-
if (document.activeElement === this.body.get(0)) {
|
| 2153 |
-
window.setTimeout(this.bind(function() {
|
| 2154 |
-
if (this.opened()) {
|
| 2155 |
-
this.search.focus();
|
| 2156 |
-
}
|
| 2157 |
-
}), 0);
|
| 2158 |
-
}
|
| 2159 |
-
}));
|
| 2160 |
-
|
| 2161 |
-
this.focusser.on("keydown", this.bind(function (e) {
|
| 2162 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2163 |
-
|
| 2164 |
-
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
|
| 2165 |
-
return;
|
| 2166 |
-
}
|
| 2167 |
-
|
| 2168 |
-
if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
|
| 2169 |
-
killEvent(e);
|
| 2170 |
-
return;
|
| 2171 |
-
}
|
| 2172 |
-
|
| 2173 |
-
if (e.which == KEY.DOWN || e.which == KEY.UP
|
| 2174 |
-
|| (e.which == KEY.ENTER && this.opts.openOnEnter)) {
|
| 2175 |
-
|
| 2176 |
-
if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
|
| 2177 |
-
|
| 2178 |
-
this.open();
|
| 2179 |
-
killEvent(e);
|
| 2180 |
-
return;
|
| 2181 |
-
}
|
| 2182 |
-
|
| 2183 |
-
if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
|
| 2184 |
-
if (this.opts.allowClear) {
|
| 2185 |
-
this.clear();
|
| 2186 |
-
}
|
| 2187 |
-
killEvent(e);
|
| 2188 |
-
return;
|
| 2189 |
-
}
|
| 2190 |
-
}));
|
| 2191 |
-
|
| 2192 |
-
|
| 2193 |
-
installKeyUpChangeEvent(this.focusser);
|
| 2194 |
-
this.focusser.on("keyup-change input", this.bind(function(e) {
|
| 2195 |
-
if (this.opts.minimumResultsForSearch >= 0) {
|
| 2196 |
-
e.stopPropagation();
|
| 2197 |
-
if (this.opened()) return;
|
| 2198 |
-
this.open();
|
| 2199 |
-
}
|
| 2200 |
-
}));
|
| 2201 |
-
|
| 2202 |
-
selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
|
| 2203 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2204 |
-
this.clear();
|
| 2205 |
-
killEventImmediately(e);
|
| 2206 |
-
this.close();
|
| 2207 |
-
this.selection.focus();
|
| 2208 |
-
}));
|
| 2209 |
-
|
| 2210 |
-
selection.on("mousedown touchstart", this.bind(function (e) {
|
| 2211 |
-
// Prevent IE from generating a click event on the body
|
| 2212 |
-
reinsertElement(selection);
|
| 2213 |
-
|
| 2214 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2215 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2216 |
-
}
|
| 2217 |
-
|
| 2218 |
-
if (this.opened()) {
|
| 2219 |
-
this.close();
|
| 2220 |
-
} else if (this.isInterfaceEnabled()) {
|
| 2221 |
-
this.open();
|
| 2222 |
-
}
|
| 2223 |
-
|
| 2224 |
-
killEvent(e);
|
| 2225 |
-
}));
|
| 2226 |
-
|
| 2227 |
-
dropdown.on("mousedown touchstart", this.bind(function() {
|
| 2228 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2229 |
-
this.search.focus();
|
| 2230 |
-
}
|
| 2231 |
-
}));
|
| 2232 |
-
|
| 2233 |
-
selection.on("focus", this.bind(function(e) {
|
| 2234 |
-
killEvent(e);
|
| 2235 |
-
}));
|
| 2236 |
-
|
| 2237 |
-
this.focusser.on("focus", this.bind(function(){
|
| 2238 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2239 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2240 |
-
}
|
| 2241 |
-
this.container.addClass("select2-container-active");
|
| 2242 |
-
})).on("blur", this.bind(function() {
|
| 2243 |
-
if (!this.opened()) {
|
| 2244 |
-
this.container.removeClass("select2-container-active");
|
| 2245 |
-
this.opts.element.trigger($.Event("select2-blur"));
|
| 2246 |
-
}
|
| 2247 |
-
}));
|
| 2248 |
-
this.search.on("focus", this.bind(function(){
|
| 2249 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2250 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2251 |
-
}
|
| 2252 |
-
this.container.addClass("select2-container-active");
|
| 2253 |
-
}));
|
| 2254 |
-
|
| 2255 |
-
this.initContainerWidth();
|
| 2256 |
-
this.opts.element.addClass("select2-offscreen");
|
| 2257 |
-
this.setPlaceholder();
|
| 2258 |
-
|
| 2259 |
-
},
|
| 2260 |
-
|
| 2261 |
-
// single
|
| 2262 |
-
clear: function(triggerChange) {
|
| 2263 |
-
var data=this.selection.data("select2-data");
|
| 2264 |
-
if (data) { // guard against queued quick consecutive clicks
|
| 2265 |
-
var evt = $.Event("select2-clearing");
|
| 2266 |
-
this.opts.element.trigger(evt);
|
| 2267 |
-
if (evt.isDefaultPrevented()) {
|
| 2268 |
-
return;
|
| 2269 |
-
}
|
| 2270 |
-
var placeholderOption = this.getPlaceholderOption();
|
| 2271 |
-
this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
|
| 2272 |
-
this.selection.find(".select2-chosen").empty();
|
| 2273 |
-
this.selection.removeData("select2-data");
|
| 2274 |
-
this.setPlaceholder();
|
| 2275 |
-
|
| 2276 |
-
if (triggerChange !== false){
|
| 2277 |
-
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
| 2278 |
-
this.triggerChange({removed:data});
|
| 2279 |
-
}
|
| 2280 |
-
}
|
| 2281 |
-
},
|
| 2282 |
-
|
| 2283 |
-
/**
|
| 2284 |
-
* Sets selection based on source element's value
|
| 2285 |
-
*/
|
| 2286 |
-
// single
|
| 2287 |
-
initSelection: function () {
|
| 2288 |
-
var selected;
|
| 2289 |
-
if (this.isPlaceholderOptionSelected()) {
|
| 2290 |
-
this.updateSelection(null);
|
| 2291 |
-
this.close();
|
| 2292 |
-
this.setPlaceholder();
|
| 2293 |
-
} else {
|
| 2294 |
-
var self = this;
|
| 2295 |
-
this.opts.initSelection.call(null, this.opts.element, function(selected){
|
| 2296 |
-
if (selected !== undefined && selected !== null) {
|
| 2297 |
-
self.updateSelection(selected);
|
| 2298 |
-
self.close();
|
| 2299 |
-
self.setPlaceholder();
|
| 2300 |
-
self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
|
| 2301 |
-
}
|
| 2302 |
-
});
|
| 2303 |
-
}
|
| 2304 |
-
},
|
| 2305 |
-
|
| 2306 |
-
isPlaceholderOptionSelected: function() {
|
| 2307 |
-
var placeholderOption;
|
| 2308 |
-
if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
|
| 2309 |
-
return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
|
| 2310 |
-
|| (this.opts.element.val() === "")
|
| 2311 |
-
|| (this.opts.element.val() === undefined)
|
| 2312 |
-
|| (this.opts.element.val() === null);
|
| 2313 |
-
},
|
| 2314 |
-
|
| 2315 |
-
// single
|
| 2316 |
-
prepareOpts: function () {
|
| 2317 |
-
var opts = this.parent.prepareOpts.apply(this, arguments),
|
| 2318 |
-
self=this;
|
| 2319 |
-
|
| 2320 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 2321 |
-
// install the selection initializer
|
| 2322 |
-
opts.initSelection = function (element, callback) {
|
| 2323 |
-
var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
|
| 2324 |
-
// a single select box always has a value, no need to null check 'selected'
|
| 2325 |
-
callback(self.optionToData(selected));
|
| 2326 |
-
};
|
| 2327 |
-
} else if ("data" in opts) {
|
| 2328 |
-
// install default initSelection when applied to hidden input and data is local
|
| 2329 |
-
opts.initSelection = opts.initSelection || function (element, callback) {
|
| 2330 |
-
var id = element.val();
|
| 2331 |
-
//search in data by id, storing the actual matching item
|
| 2332 |
-
var match = null;
|
| 2333 |
-
opts.query({
|
| 2334 |
-
matcher: function(term, text, el){
|
| 2335 |
-
var is_match = equal(id, opts.id(el));
|
| 2336 |
-
if (is_match) {
|
| 2337 |
-
match = el;
|
| 2338 |
-
}
|
| 2339 |
-
return is_match;
|
| 2340 |
-
},
|
| 2341 |
-
callback: !$.isFunction(callback) ? $.noop : function() {
|
| 2342 |
-
callback(match);
|
| 2343 |
-
}
|
| 2344 |
-
});
|
| 2345 |
-
};
|
| 2346 |
-
}
|
| 2347 |
-
|
| 2348 |
-
return opts;
|
| 2349 |
-
},
|
| 2350 |
-
|
| 2351 |
-
// single
|
| 2352 |
-
getPlaceholder: function() {
|
| 2353 |
-
// if a placeholder is specified on a single select without a valid placeholder option ignore it
|
| 2354 |
-
if (this.select) {
|
| 2355 |
-
if (this.getPlaceholderOption() === undefined) {
|
| 2356 |
-
return undefined;
|
| 2357 |
-
}
|
| 2358 |
-
}
|
| 2359 |
-
|
| 2360 |
-
return this.parent.getPlaceholder.apply(this, arguments);
|
| 2361 |
-
},
|
| 2362 |
-
|
| 2363 |
-
// single
|
| 2364 |
-
setPlaceholder: function () {
|
| 2365 |
-
var placeholder = this.getPlaceholder();
|
| 2366 |
-
|
| 2367 |
-
if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
|
| 2368 |
-
|
| 2369 |
-
// check for a placeholder option if attached to a select
|
| 2370 |
-
if (this.select && this.getPlaceholderOption() === undefined) return;
|
| 2371 |
-
|
| 2372 |
-
this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
|
| 2373 |
-
|
| 2374 |
-
this.selection.addClass("select2-default");
|
| 2375 |
-
|
| 2376 |
-
this.container.removeClass("select2-allowclear");
|
| 2377 |
-
}
|
| 2378 |
-
},
|
| 2379 |
-
|
| 2380 |
-
// single
|
| 2381 |
-
postprocessResults: function (data, initial, noHighlightUpdate) {
|
| 2382 |
-
var selected = 0, self = this, showSearchInput = true;
|
| 2383 |
-
|
| 2384 |
-
// find the selected element in the result list
|
| 2385 |
-
|
| 2386 |
-
this.findHighlightableChoices().each2(function (i, elm) {
|
| 2387 |
-
if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
|
| 2388 |
-
selected = i;
|
| 2389 |
-
return false;
|
| 2390 |
-
}
|
| 2391 |
-
});
|
| 2392 |
-
|
| 2393 |
-
// and highlight it
|
| 2394 |
-
if (noHighlightUpdate !== false) {
|
| 2395 |
-
if (initial === true && selected >= 0) {
|
| 2396 |
-
this.highlight(selected);
|
| 2397 |
-
} else {
|
| 2398 |
-
this.highlight(0);
|
| 2399 |
-
}
|
| 2400 |
-
}
|
| 2401 |
-
|
| 2402 |
-
// hide the search box if this is the first we got the results and there are enough of them for search
|
| 2403 |
-
|
| 2404 |
-
if (initial === true) {
|
| 2405 |
-
var min = this.opts.minimumResultsForSearch;
|
| 2406 |
-
if (min >= 0) {
|
| 2407 |
-
this.showSearch(countResults(data.results) >= min);
|
| 2408 |
-
}
|
| 2409 |
-
}
|
| 2410 |
-
},
|
| 2411 |
-
|
| 2412 |
-
// single
|
| 2413 |
-
showSearch: function(showSearchInput) {
|
| 2414 |
-
if (this.showSearchInput === showSearchInput) return;
|
| 2415 |
-
|
| 2416 |
-
this.showSearchInput = showSearchInput;
|
| 2417 |
-
|
| 2418 |
-
this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
|
| 2419 |
-
this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
|
| 2420 |
-
//add "select2-with-searchbox" to the container if search box is shown
|
| 2421 |
-
$(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
|
| 2422 |
-
},
|
| 2423 |
-
|
| 2424 |
-
// single
|
| 2425 |
-
onSelect: function (data, options) {
|
| 2426 |
-
|
| 2427 |
-
if (!this.triggerSelect(data)) { return; }
|
| 2428 |
-
|
| 2429 |
-
var old = this.opts.element.val(),
|
| 2430 |
-
oldData = this.data();
|
| 2431 |
-
|
| 2432 |
-
this.opts.element.val(this.id(data));
|
| 2433 |
-
this.updateSelection(data);
|
| 2434 |
-
|
| 2435 |
-
this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
|
| 2436 |
-
|
| 2437 |
-
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
| 2438 |
-
this.close();
|
| 2439 |
-
|
| 2440 |
-
if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
|
| 2441 |
-
this.focusser.focus();
|
| 2442 |
-
}
|
| 2443 |
-
|
| 2444 |
-
if (!equal(old, this.id(data))) {
|
| 2445 |
-
this.triggerChange({ added: data, removed: oldData });
|
| 2446 |
-
}
|
| 2447 |
-
},
|
| 2448 |
-
|
| 2449 |
-
// single
|
| 2450 |
-
updateSelection: function (data) {
|
| 2451 |
-
|
| 2452 |
-
var container=this.selection.find(".select2-chosen"), formatted, cssClass;
|
| 2453 |
-
|
| 2454 |
-
this.selection.data("select2-data", data);
|
| 2455 |
-
|
| 2456 |
-
container.empty();
|
| 2457 |
-
if (data !== null) {
|
| 2458 |
-
formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
|
| 2459 |
-
}
|
| 2460 |
-
if (formatted !== undefined) {
|
| 2461 |
-
container.append(formatted);
|
| 2462 |
-
}
|
| 2463 |
-
cssClass=this.opts.formatSelectionCssClass(data, container);
|
| 2464 |
-
if (cssClass !== undefined) {
|
| 2465 |
-
container.addClass(cssClass);
|
| 2466 |
-
}
|
| 2467 |
-
|
| 2468 |
-
this.selection.removeClass("select2-default");
|
| 2469 |
-
|
| 2470 |
-
if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
|
| 2471 |
-
this.container.addClass("select2-allowclear");
|
| 2472 |
-
}
|
| 2473 |
-
},
|
| 2474 |
-
|
| 2475 |
-
// single
|
| 2476 |
-
val: function () {
|
| 2477 |
-
var val,
|
| 2478 |
-
triggerChange = false,
|
| 2479 |
-
data = null,
|
| 2480 |
-
self = this,
|
| 2481 |
-
oldData = this.data();
|
| 2482 |
-
|
| 2483 |
-
if (arguments.length === 0) {
|
| 2484 |
-
return this.opts.element.val();
|
| 2485 |
-
}
|
| 2486 |
-
|
| 2487 |
-
val = arguments[0];
|
| 2488 |
-
|
| 2489 |
-
if (arguments.length > 1) {
|
| 2490 |
-
triggerChange = arguments[1];
|
| 2491 |
-
}
|
| 2492 |
-
|
| 2493 |
-
if (this.select) {
|
| 2494 |
-
this.select
|
| 2495 |
-
.val(val)
|
| 2496 |
-
.find("option").filter(function() { return this.selected }).each2(function (i, elm) {
|
| 2497 |
-
data = self.optionToData(elm);
|
| 2498 |
-
return false;
|
| 2499 |
-
});
|
| 2500 |
-
this.updateSelection(data);
|
| 2501 |
-
this.setPlaceholder();
|
| 2502 |
-
if (triggerChange) {
|
| 2503 |
-
this.triggerChange({added: data, removed:oldData});
|
| 2504 |
-
}
|
| 2505 |
-
} else {
|
| 2506 |
-
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
| 2507 |
-
if (!val && val !== 0) {
|
| 2508 |
-
this.clear(triggerChange);
|
| 2509 |
-
return;
|
| 2510 |
-
}
|
| 2511 |
-
if (this.opts.initSelection === undefined) {
|
| 2512 |
-
throw new Error("cannot call val() if initSelection() is not defined");
|
| 2513 |
-
}
|
| 2514 |
-
this.opts.element.val(val);
|
| 2515 |
-
this.opts.initSelection(this.opts.element, function(data){
|
| 2516 |
-
self.opts.element.val(!data ? "" : self.id(data));
|
| 2517 |
-
self.updateSelection(data);
|
| 2518 |
-
self.setPlaceholder();
|
| 2519 |
-
if (triggerChange) {
|
| 2520 |
-
self.triggerChange({added: data, removed:oldData});
|
| 2521 |
-
}
|
| 2522 |
-
});
|
| 2523 |
-
}
|
| 2524 |
-
},
|
| 2525 |
-
|
| 2526 |
-
// single
|
| 2527 |
-
clearSearch: function () {
|
| 2528 |
-
this.search.val("");
|
| 2529 |
-
this.focusser.val("");
|
| 2530 |
-
},
|
| 2531 |
-
|
| 2532 |
-
// single
|
| 2533 |
-
data: function(value) {
|
| 2534 |
-
var data,
|
| 2535 |
-
triggerChange = false;
|
| 2536 |
-
|
| 2537 |
-
if (arguments.length === 0) {
|
| 2538 |
-
data = this.selection.data("select2-data");
|
| 2539 |
-
if (data == undefined) data = null;
|
| 2540 |
-
return data;
|
| 2541 |
-
} else {
|
| 2542 |
-
if (arguments.length > 1) {
|
| 2543 |
-
triggerChange = arguments[1];
|
| 2544 |
-
}
|
| 2545 |
-
if (!value) {
|
| 2546 |
-
this.clear(triggerChange);
|
| 2547 |
-
} else {
|
| 2548 |
-
data = this.data();
|
| 2549 |
-
this.opts.element.val(!value ? "" : this.id(value));
|
| 2550 |
-
this.updateSelection(value);
|
| 2551 |
-
if (triggerChange) {
|
| 2552 |
-
this.triggerChange({added: value, removed:data});
|
| 2553 |
-
}
|
| 2554 |
-
}
|
| 2555 |
-
}
|
| 2556 |
-
}
|
| 2557 |
-
});
|
| 2558 |
-
|
| 2559 |
-
MultiSelect2 = clazz(AbstractSelect2, {
|
| 2560 |
-
|
| 2561 |
-
// multi
|
| 2562 |
-
createContainer: function () {
|
| 2563 |
-
var container = $(document.createElement("div")).attr({
|
| 2564 |
-
"class": "select2-container select2-container-multi"
|
| 2565 |
-
}).html([
|
| 2566 |
-
"<ul class='select2-choices'>",
|
| 2567 |
-
" <li class='select2-search-field'>",
|
| 2568 |
-
" <label for='' class='select2-offscreen'></label>",
|
| 2569 |
-
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
|
| 2570 |
-
" </li>",
|
| 2571 |
-
"</ul>",
|
| 2572 |
-
"<div class='select2-drop select2-drop-multi select2-display-none'>",
|
| 2573 |
-
" <ul class='select2-results'>",
|
| 2574 |
-
" </ul>",
|
| 2575 |
-
"</div>"].join(""));
|
| 2576 |
-
return container;
|
| 2577 |
-
},
|
| 2578 |
-
|
| 2579 |
-
// multi
|
| 2580 |
-
prepareOpts: function () {
|
| 2581 |
-
var opts = this.parent.prepareOpts.apply(this, arguments),
|
| 2582 |
-
self=this;
|
| 2583 |
-
|
| 2584 |
-
// TODO validate placeholder is a string if specified
|
| 2585 |
-
|
| 2586 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 2587 |
-
// install the selection initializer
|
| 2588 |
-
opts.initSelection = function (element, callback) {
|
| 2589 |
-
|
| 2590 |
-
var data = [];
|
| 2591 |
-
|
| 2592 |
-
element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
|
| 2593 |
-
data.push(self.optionToData(elm));
|
| 2594 |
-
});
|
| 2595 |
-
callback(data);
|
| 2596 |
-
};
|
| 2597 |
-
} else if ("data" in opts) {
|
| 2598 |
-
// install default initSelection when applied to hidden input and data is local
|
| 2599 |
-
opts.initSelection = opts.initSelection || function (element, callback) {
|
| 2600 |
-
var ids = splitVal(element.val(), opts.separator);
|
| 2601 |
-
//search in data by array of ids, storing matching items in a list
|
| 2602 |
-
var matches = [];
|
| 2603 |
-
opts.query({
|
| 2604 |
-
matcher: function(term, text, el){
|
| 2605 |
-
var is_match = $.grep(ids, function(id) {
|
| 2606 |
-
return equal(id, opts.id(el));
|
| 2607 |
-
}).length;
|
| 2608 |
-
if (is_match) {
|
| 2609 |
-
matches.push(el);
|
| 2610 |
-
}
|
| 2611 |
-
return is_match;
|
| 2612 |
-
},
|
| 2613 |
-
callback: !$.isFunction(callback) ? $.noop : function() {
|
| 2614 |
-
// reorder matches based on the order they appear in the ids array because right now
|
| 2615 |
-
// they are in the order in which they appear in data array
|
| 2616 |
-
var ordered = [];
|
| 2617 |
-
for (var i = 0; i < ids.length; i++) {
|
| 2618 |
-
var id = ids[i];
|
| 2619 |
-
for (var j = 0; j < matches.length; j++) {
|
| 2620 |
-
var match = matches[j];
|
| 2621 |
-
if (equal(id, opts.id(match))) {
|
| 2622 |
-
ordered.push(match);
|
| 2623 |
-
matches.splice(j, 1);
|
| 2624 |
-
break;
|
| 2625 |
-
}
|
| 2626 |
-
}
|
| 2627 |
-
}
|
| 2628 |
-
callback(ordered);
|
| 2629 |
-
}
|
| 2630 |
-
});
|
| 2631 |
-
};
|
| 2632 |
-
}
|
| 2633 |
-
|
| 2634 |
-
return opts;
|
| 2635 |
-
},
|
| 2636 |
-
|
| 2637 |
-
// multi
|
| 2638 |
-
selectChoice: function (choice) {
|
| 2639 |
-
|
| 2640 |
-
var selected = this.container.find(".select2-search-choice-focus");
|
| 2641 |
-
if (selected.length && choice && choice[0] == selected[0]) {
|
| 2642 |
-
|
| 2643 |
-
} else {
|
| 2644 |
-
if (selected.length) {
|
| 2645 |
-
this.opts.element.trigger("choice-deselected", selected);
|
| 2646 |
-
}
|
| 2647 |
-
selected.removeClass("select2-search-choice-focus");
|
| 2648 |
-
if (choice && choice.length) {
|
| 2649 |
-
this.close();
|
| 2650 |
-
choice.addClass("select2-search-choice-focus");
|
| 2651 |
-
this.opts.element.trigger("choice-selected", choice);
|
| 2652 |
-
}
|
| 2653 |
-
}
|
| 2654 |
-
},
|
| 2655 |
-
|
| 2656 |
-
// multi
|
| 2657 |
-
destroy: function() {
|
| 2658 |
-
$("label[for='" + this.search.attr('id') + "']")
|
| 2659 |
-
.attr('for', this.opts.element.attr("id"));
|
| 2660 |
-
this.parent.destroy.apply(this, arguments);
|
| 2661 |
-
|
| 2662 |
-
cleanupJQueryElements.call(this,
|
| 2663 |
-
"searchContainer",
|
| 2664 |
-
"selection"
|
| 2665 |
-
);
|
| 2666 |
-
},
|
| 2667 |
-
|
| 2668 |
-
// multi
|
| 2669 |
-
initContainer: function () {
|
| 2670 |
-
|
| 2671 |
-
var selector = ".select2-choices", selection;
|
| 2672 |
-
|
| 2673 |
-
this.searchContainer = this.container.find(".select2-search-field");
|
| 2674 |
-
this.selection = selection = this.container.find(selector);
|
| 2675 |
-
|
| 2676 |
-
var _this = this;
|
| 2677 |
-
this.selection.on("click", ".select2-search-choice:not(.select2-locked)", function (e) {
|
| 2678 |
-
//killEvent(e);
|
| 2679 |
-
_this.search[0].focus();
|
| 2680 |
-
_this.selectChoice($(this));
|
| 2681 |
-
});
|
| 2682 |
-
|
| 2683 |
-
// rewrite labels from original element to focusser
|
| 2684 |
-
this.search.attr("id", "s2id_autogen"+nextUid());
|
| 2685 |
-
|
| 2686 |
-
this.search.prev()
|
| 2687 |
-
.text($("label[for='" + this.opts.element.attr("id") + "']").text())
|
| 2688 |
-
.attr('for', this.search.attr('id'));
|
| 2689 |
-
|
| 2690 |
-
this.search.on("input paste", this.bind(function() {
|
| 2691 |
-
if (this.search.attr('placeholder') && this.search.val().length == 0) return;
|
| 2692 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2693 |
-
if (!this.opened()) {
|
| 2694 |
-
this.open();
|
| 2695 |
-
}
|
| 2696 |
-
}));
|
| 2697 |
-
|
| 2698 |
-
this.search.attr("tabindex", this.elementTabIndex);
|
| 2699 |
-
|
| 2700 |
-
this.keydowns = 0;
|
| 2701 |
-
this.search.on("keydown", this.bind(function (e) {
|
| 2702 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2703 |
-
|
| 2704 |
-
++this.keydowns;
|
| 2705 |
-
var selected = selection.find(".select2-search-choice-focus");
|
| 2706 |
-
var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
|
| 2707 |
-
var next = selected.next(".select2-search-choice:not(.select2-locked)");
|
| 2708 |
-
var pos = getCursorInfo(this.search);
|
| 2709 |
-
|
| 2710 |
-
if (selected.length &&
|
| 2711 |
-
(e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
|
| 2712 |
-
var selectedChoice = selected;
|
| 2713 |
-
if (e.which == KEY.LEFT && prev.length) {
|
| 2714 |
-
selectedChoice = prev;
|
| 2715 |
-
}
|
| 2716 |
-
else if (e.which == KEY.RIGHT) {
|
| 2717 |
-
selectedChoice = next.length ? next : null;
|
| 2718 |
-
}
|
| 2719 |
-
else if (e.which === KEY.BACKSPACE) {
|
| 2720 |
-
if (this.unselect(selected.first())) {
|
| 2721 |
-
this.search.width(10);
|
| 2722 |
-
selectedChoice = prev.length ? prev : next;
|
| 2723 |
-
}
|
| 2724 |
-
} else if (e.which == KEY.DELETE) {
|
| 2725 |
-
if (this.unselect(selected.first())) {
|
| 2726 |
-
this.search.width(10);
|
| 2727 |
-
selectedChoice = next.length ? next : null;
|
| 2728 |
-
}
|
| 2729 |
-
} else if (e.which == KEY.ENTER) {
|
| 2730 |
-
selectedChoice = null;
|
| 2731 |
-
}
|
| 2732 |
-
|
| 2733 |
-
this.selectChoice(selectedChoice);
|
| 2734 |
-
killEvent(e);
|
| 2735 |
-
if (!selectedChoice || !selectedChoice.length) {
|
| 2736 |
-
this.open();
|
| 2737 |
-
}
|
| 2738 |
-
return;
|
| 2739 |
-
} else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
|
| 2740 |
-
|| e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
|
| 2741 |
-
|
| 2742 |
-
this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
|
| 2743 |
-
killEvent(e);
|
| 2744 |
-
return;
|
| 2745 |
-
} else {
|
| 2746 |
-
this.selectChoice(null);
|
| 2747 |
-
}
|
| 2748 |
-
|
| 2749 |
-
if (this.opened()) {
|
| 2750 |
-
switch (e.which) {
|
| 2751 |
-
case KEY.UP:
|
| 2752 |
-
case KEY.DOWN:
|
| 2753 |
-
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
| 2754 |
-
killEvent(e);
|
| 2755 |
-
return;
|
| 2756 |
-
case KEY.ENTER:
|
| 2757 |
-
this.selectHighlighted();
|
| 2758 |
-
killEvent(e);
|
| 2759 |
-
return;
|
| 2760 |
-
case KEY.TAB:
|
| 2761 |
-
this.selectHighlighted({noFocus:true});
|
| 2762 |
-
this.close();
|
| 2763 |
-
return;
|
| 2764 |
-
case KEY.ESC:
|
| 2765 |
-
this.cancel(e);
|
| 2766 |
-
killEvent(e);
|
| 2767 |
-
return;
|
| 2768 |
-
}
|
| 2769 |
-
}
|
| 2770 |
-
|
| 2771 |
-
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
|
| 2772 |
-
|| e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
|
| 2773 |
-
return;
|
| 2774 |
-
}
|
| 2775 |
-
|
| 2776 |
-
if (e.which === KEY.ENTER) {
|
| 2777 |
-
if (this.opts.openOnEnter === false) {
|
| 2778 |
-
return;
|
| 2779 |
-
} else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
|
| 2780 |
-
return;
|
| 2781 |
-
}
|
| 2782 |
-
}
|
| 2783 |
-
|
| 2784 |
-
this.open();
|
| 2785 |
-
|
| 2786 |
-
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
| 2787 |
-
// prevent the page from scrolling
|
| 2788 |
-
killEvent(e);
|
| 2789 |
-
}
|
| 2790 |
-
|
| 2791 |
-
if (e.which === KEY.ENTER) {
|
| 2792 |
-
// prevent form from being submitted
|
| 2793 |
-
killEvent(e);
|
| 2794 |
-
}
|
| 2795 |
-
|
| 2796 |
-
}));
|
| 2797 |
-
|
| 2798 |
-
this.search.on("keyup", this.bind(function (e) {
|
| 2799 |
-
this.keydowns = 0;
|
| 2800 |
-
this.resizeSearch();
|
| 2801 |
-
})
|
| 2802 |
-
);
|
| 2803 |
-
|
| 2804 |
-
this.search.on("blur", this.bind(function(e) {
|
| 2805 |
-
this.container.removeClass("select2-container-active");
|
| 2806 |
-
this.search.removeClass("select2-focused");
|
| 2807 |
-
this.selectChoice(null);
|
| 2808 |
-
if (!this.opened()) this.clearSearch();
|
| 2809 |
-
e.stopImmediatePropagation();
|
| 2810 |
-
this.opts.element.trigger($.Event("select2-blur"));
|
| 2811 |
-
}));
|
| 2812 |
-
|
| 2813 |
-
this.container.on("click", selector, this.bind(function (e) {
|
| 2814 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2815 |
-
if ($(e.target).closest(".select2-search-choice").length > 0) {
|
| 2816 |
-
// clicked inside a select2 search choice, do not open
|
| 2817 |
-
return;
|
| 2818 |
-
}
|
| 2819 |
-
this.selectChoice(null);
|
| 2820 |
-
this.clearPlaceholder();
|
| 2821 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2822 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2823 |
-
}
|
| 2824 |
-
this.open();
|
| 2825 |
-
this.focusSearch();
|
| 2826 |
-
e.preventDefault();
|
| 2827 |
-
}));
|
| 2828 |
-
|
| 2829 |
-
this.container.on("focus", selector, this.bind(function () {
|
| 2830 |
-
if (!this.isInterfaceEnabled()) return;
|
| 2831 |
-
if (!this.container.hasClass("select2-container-active")) {
|
| 2832 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
| 2833 |
-
}
|
| 2834 |
-
this.container.addClass("select2-container-active");
|
| 2835 |
-
this.dropdown.addClass("select2-drop-active");
|
| 2836 |
-
this.clearPlaceholder();
|
| 2837 |
-
}));
|
| 2838 |
-
|
| 2839 |
-
this.initContainerWidth();
|
| 2840 |
-
this.opts.element.addClass("select2-offscreen");
|
| 2841 |
-
|
| 2842 |
-
// set the placeholder if necessary
|
| 2843 |
-
this.clearSearch();
|
| 2844 |
-
},
|
| 2845 |
-
|
| 2846 |
-
// multi
|
| 2847 |
-
enableInterface: function() {
|
| 2848 |
-
if (this.parent.enableInterface.apply(this, arguments)) {
|
| 2849 |
-
this.search.prop("disabled", !this.isInterfaceEnabled());
|
| 2850 |
-
}
|
| 2851 |
-
},
|
| 2852 |
-
|
| 2853 |
-
// multi
|
| 2854 |
-
initSelection: function () {
|
| 2855 |
-
var data;
|
| 2856 |
-
if (this.opts.element.val() === "" && this.opts.element.text() === "") {
|
| 2857 |
-
this.updateSelection([]);
|
| 2858 |
-
this.close();
|
| 2859 |
-
// set the placeholder if necessary
|
| 2860 |
-
this.clearSearch();
|
| 2861 |
-
}
|
| 2862 |
-
if (this.select || this.opts.element.val() !== "") {
|
| 2863 |
-
var self = this;
|
| 2864 |
-
this.opts.initSelection.call(null, this.opts.element, function(data){
|
| 2865 |
-
if (data !== undefined && data !== null) {
|
| 2866 |
-
self.updateSelection(data);
|
| 2867 |
-
self.close();
|
| 2868 |
-
// set the placeholder if necessary
|
| 2869 |
-
self.clearSearch();
|
| 2870 |
-
}
|
| 2871 |
-
});
|
| 2872 |
-
}
|
| 2873 |
-
},
|
| 2874 |
-
|
| 2875 |
-
// multi
|
| 2876 |
-
clearSearch: function () {
|
| 2877 |
-
var placeholder = this.getPlaceholder(),
|
| 2878 |
-
maxWidth = this.getMaxSearchWidth();
|
| 2879 |
-
|
| 2880 |
-
if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
|
| 2881 |
-
this.search.val(placeholder).addClass("select2-default");
|
| 2882 |
-
// stretch the search box to full width of the container so as much of the placeholder is visible as possible
|
| 2883 |
-
// we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
|
| 2884 |
-
this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
|
| 2885 |
-
} else {
|
| 2886 |
-
this.search.val("").width(10);
|
| 2887 |
-
}
|
| 2888 |
-
},
|
| 2889 |
-
|
| 2890 |
-
// multi
|
| 2891 |
-
clearPlaceholder: function () {
|
| 2892 |
-
if (this.search.hasClass("select2-default")) {
|
| 2893 |
-
this.search.val("").removeClass("select2-default");
|
| 2894 |
-
}
|
| 2895 |
-
},
|
| 2896 |
-
|
| 2897 |
-
// multi
|
| 2898 |
-
opening: function () {
|
| 2899 |
-
this.clearPlaceholder(); // should be done before super so placeholder is not used to search
|
| 2900 |
-
this.resizeSearch();
|
| 2901 |
-
|
| 2902 |
-
this.parent.opening.apply(this, arguments);
|
| 2903 |
-
|
| 2904 |
-
this.focusSearch();
|
| 2905 |
-
|
| 2906 |
-
// initializes search's value with nextSearchTerm (if defined by user)
|
| 2907 |
-
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
| 2908 |
-
if(this.search.val() === "") {
|
| 2909 |
-
if(this.nextSearchTerm != undefined){
|
| 2910 |
-
this.search.val(this.nextSearchTerm);
|
| 2911 |
-
this.search.select();
|
| 2912 |
-
}
|
| 2913 |
-
}
|
| 2914 |
-
|
| 2915 |
-
this.updateResults(true);
|
| 2916 |
-
if (this.opts.shouldFocusInput(this)) {
|
| 2917 |
-
this.search.focus();
|
| 2918 |
-
}
|
| 2919 |
-
this.opts.element.trigger($.Event("select2-open"));
|
| 2920 |
-
},
|
| 2921 |
-
|
| 2922 |
-
// multi
|
| 2923 |
-
close: function () {
|
| 2924 |
-
if (!this.opened()) return;
|
| 2925 |
-
this.parent.close.apply(this, arguments);
|
| 2926 |
-
},
|
| 2927 |
-
|
| 2928 |
-
// multi
|
| 2929 |
-
focus: function () {
|
| 2930 |
-
this.close();
|
| 2931 |
-
this.search.focus();
|
| 2932 |
-
},
|
| 2933 |
-
|
| 2934 |
-
// multi
|
| 2935 |
-
isFocused: function () {
|
| 2936 |
-
return this.search.hasClass("select2-focused");
|
| 2937 |
-
},
|
| 2938 |
-
|
| 2939 |
-
// multi
|
| 2940 |
-
updateSelection: function (data) {
|
| 2941 |
-
var ids = [], filtered = [], self = this;
|
| 2942 |
-
|
| 2943 |
-
// filter out duplicates
|
| 2944 |
-
$(data).each(function () {
|
| 2945 |
-
if (indexOf(self.id(this), ids) < 0) {
|
| 2946 |
-
ids.push(self.id(this));
|
| 2947 |
-
filtered.push(this);
|
| 2948 |
-
}
|
| 2949 |
-
});
|
| 2950 |
-
data = filtered;
|
| 2951 |
-
|
| 2952 |
-
this.selection.find(".select2-search-choice").remove();
|
| 2953 |
-
$(data).each(function () {
|
| 2954 |
-
self.addSelectedChoice(this);
|
| 2955 |
-
});
|
| 2956 |
-
self.postprocessResults();
|
| 2957 |
-
},
|
| 2958 |
-
|
| 2959 |
-
// multi
|
| 2960 |
-
tokenize: function() {
|
| 2961 |
-
var input = this.search.val();
|
| 2962 |
-
input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
|
| 2963 |
-
if (input != null && input != undefined) {
|
| 2964 |
-
this.search.val(input);
|
| 2965 |
-
if (input.length > 0) {
|
| 2966 |
-
this.open();
|
| 2967 |
-
}
|
| 2968 |
-
}
|
| 2969 |
-
|
| 2970 |
-
},
|
| 2971 |
-
|
| 2972 |
-
// multi
|
| 2973 |
-
onSelect: function (data, options) {
|
| 2974 |
-
|
| 2975 |
-
if (!this.triggerSelect(data) || data.text === "") { return; }
|
| 2976 |
-
|
| 2977 |
-
this.addSelectedChoice(data);
|
| 2978 |
-
|
| 2979 |
-
this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
|
| 2980 |
-
|
| 2981 |
-
// keep track of the search's value before it gets cleared
|
| 2982 |
-
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
| 2983 |
-
|
| 2984 |
-
this.clearSearch();
|
| 2985 |
-
this.updateResults();
|
| 2986 |
-
|
| 2987 |
-
if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
|
| 2988 |
-
|
| 2989 |
-
if (this.opts.closeOnSelect) {
|
| 2990 |
-
this.close();
|
| 2991 |
-
this.search.width(10);
|
| 2992 |
-
} else {
|
| 2993 |
-
if (this.countSelectableResults()>0) {
|
| 2994 |
-
this.search.width(10);
|
| 2995 |
-
this.resizeSearch();
|
| 2996 |
-
if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
|
| 2997 |
-
// if we reached max selection size repaint the results so choices
|
| 2998 |
-
// are replaced with the max selection reached message
|
| 2999 |
-
this.updateResults(true);
|
| 3000 |
-
} else {
|
| 3001 |
-
// initializes search's value with nextSearchTerm and update search result
|
| 3002 |
-
if(this.nextSearchTerm != undefined){
|
| 3003 |
-
this.search.val(this.nextSearchTerm);
|
| 3004 |
-
this.updateResults();
|
| 3005 |
-
this.search.select();
|
| 3006 |
-
}
|
| 3007 |
-
}
|
| 3008 |
-
this.positionDropdown();
|
| 3009 |
-
} else {
|
| 3010 |
-
// if nothing left to select close
|
| 3011 |
-
this.close();
|
| 3012 |
-
this.search.width(10);
|
| 3013 |
-
}
|
| 3014 |
-
}
|
| 3015 |
-
|
| 3016 |
-
// since its not possible to select an element that has already been
|
| 3017 |
-
// added we do not need to check if this is a new element before firing change
|
| 3018 |
-
this.triggerChange({ added: data });
|
| 3019 |
-
|
| 3020 |
-
if (!options || !options.noFocus)
|
| 3021 |
-
this.focusSearch();
|
| 3022 |
-
},
|
| 3023 |
-
|
| 3024 |
-
// multi
|
| 3025 |
-
cancel: function () {
|
| 3026 |
-
this.close();
|
| 3027 |
-
this.focusSearch();
|
| 3028 |
-
},
|
| 3029 |
-
|
| 3030 |
-
addSelectedChoice: function (data) {
|
| 3031 |
-
var enableChoice = !data.locked,
|
| 3032 |
-
enabledItem = $(
|
| 3033 |
-
"<li class='select2-search-choice'>" +
|
| 3034 |
-
" <div></div>" +
|
| 3035 |
-
" <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
|
| 3036 |
-
"</li>"),
|
| 3037 |
-
disabledItem = $(
|
| 3038 |
-
"<li class='select2-search-choice select2-locked'>" +
|
| 3039 |
-
"<div></div>" +
|
| 3040 |
-
"</li>");
|
| 3041 |
-
var choice = enableChoice ? enabledItem : disabledItem,
|
| 3042 |
-
id = this.id(data),
|
| 3043 |
-
val = this.getVal(),
|
| 3044 |
-
formatted,
|
| 3045 |
-
cssClass;
|
| 3046 |
-
|
| 3047 |
-
formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
|
| 3048 |
-
if (formatted != undefined) {
|
| 3049 |
-
choice.find("div").replaceWith("<div>"+formatted+"</div>");
|
| 3050 |
-
}
|
| 3051 |
-
cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
|
| 3052 |
-
if (cssClass != undefined) {
|
| 3053 |
-
choice.addClass(cssClass);
|
| 3054 |
-
}
|
| 3055 |
-
|
| 3056 |
-
if(enableChoice){
|
| 3057 |
-
choice.find(".select2-search-choice-close")
|
| 3058 |
-
.on("mousedown", killEvent)
|
| 3059 |
-
.on("click dblclick", this.bind(function (e) {
|
| 3060 |
-
if (!this.isInterfaceEnabled()) return;
|
| 3061 |
-
|
| 3062 |
-
this.unselect($(e.target));
|
| 3063 |
-
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
| 3064 |
-
killEvent(e);
|
| 3065 |
-
this.close();
|
| 3066 |
-
this.focusSearch();
|
| 3067 |
-
})).on("focus", this.bind(function () {
|
| 3068 |
-
if (!this.isInterfaceEnabled()) return;
|
| 3069 |
-
this.container.addClass("select2-container-active");
|
| 3070 |
-
this.dropdown.addClass("select2-drop-active");
|
| 3071 |
-
}));
|
| 3072 |
-
}
|
| 3073 |
-
|
| 3074 |
-
choice.data("select2-data", data);
|
| 3075 |
-
choice.insertBefore(this.searchContainer);
|
| 3076 |
-
|
| 3077 |
-
val.push(id);
|
| 3078 |
-
this.setVal(val);
|
| 3079 |
-
},
|
| 3080 |
-
|
| 3081 |
-
// multi
|
| 3082 |
-
unselect: function (selected) {
|
| 3083 |
-
var val = this.getVal(),
|
| 3084 |
-
data,
|
| 3085 |
-
index;
|
| 3086 |
-
selected = selected.closest(".select2-search-choice");
|
| 3087 |
-
|
| 3088 |
-
if (selected.length === 0) {
|
| 3089 |
-
throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
|
| 3090 |
-
}
|
| 3091 |
-
|
| 3092 |
-
data = selected.data("select2-data");
|
| 3093 |
-
|
| 3094 |
-
if (!data) {
|
| 3095 |
-
// prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
|
| 3096 |
-
// and invoked on an element already removed
|
| 3097 |
-
return;
|
| 3098 |
-
}
|
| 3099 |
-
|
| 3100 |
-
var evt = $.Event("select2-removing");
|
| 3101 |
-
evt.val = this.id(data);
|
| 3102 |
-
evt.choice = data;
|
| 3103 |
-
this.opts.element.trigger(evt);
|
| 3104 |
-
|
| 3105 |
-
if (evt.isDefaultPrevented()) {
|
| 3106 |
-
return false;
|
| 3107 |
-
}
|
| 3108 |
-
|
| 3109 |
-
while((index = indexOf(this.id(data), val)) >= 0) {
|
| 3110 |
-
val.splice(index, 1);
|
| 3111 |
-
this.setVal(val);
|
| 3112 |
-
if (this.select) this.postprocessResults();
|
| 3113 |
-
}
|
| 3114 |
-
|
| 3115 |
-
selected.remove();
|
| 3116 |
-
|
| 3117 |
-
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
| 3118 |
-
this.triggerChange({ removed: data });
|
| 3119 |
-
|
| 3120 |
-
return true;
|
| 3121 |
-
},
|
| 3122 |
-
|
| 3123 |
-
// multi
|
| 3124 |
-
postprocessResults: function (data, initial, noHighlightUpdate) {
|
| 3125 |
-
var val = this.getVal(),
|
| 3126 |
-
choices = this.results.find(".select2-result"),
|
| 3127 |
-
compound = this.results.find(".select2-result-with-children"),
|
| 3128 |
-
self = this;
|
| 3129 |
-
|
| 3130 |
-
choices.each2(function (i, choice) {
|
| 3131 |
-
var id = self.id(choice.data("select2-data"));
|
| 3132 |
-
if (indexOf(id, val) >= 0) {
|
| 3133 |
-
choice.addClass("select2-selected");
|
| 3134 |
-
// mark all children of the selected parent as selected
|
| 3135 |
-
choice.find(".select2-result-selectable").addClass("select2-selected");
|
| 3136 |
-
}
|
| 3137 |
-
});
|
| 3138 |
-
|
| 3139 |
-
compound.each2(function(i, choice) {
|
| 3140 |
-
// hide an optgroup if it doesn't have any selectable children
|
| 3141 |
-
if (!choice.is('.select2-result-selectable')
|
| 3142 |
-
&& choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
|
| 3143 |
-
choice.addClass("select2-selected");
|
| 3144 |
-
}
|
| 3145 |
-
});
|
| 3146 |
-
|
| 3147 |
-
if (this.highlight() == -1 && noHighlightUpdate !== false){
|
| 3148 |
-
self.highlight(0);
|
| 3149 |
-
}
|
| 3150 |
-
|
| 3151 |
-
//If all results are chosen render formatNoMatches
|
| 3152 |
-
if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
|
| 3153 |
-
if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
|
| 3154 |
-
if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
|
| 3155 |
-
this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
|
| 3156 |
-
}
|
| 3157 |
-
}
|
| 3158 |
-
}
|
| 3159 |
-
|
| 3160 |
-
},
|
| 3161 |
-
|
| 3162 |
-
// multi
|
| 3163 |
-
getMaxSearchWidth: function() {
|
| 3164 |
-
return this.selection.width() - getSideBorderPadding(this.search);
|
| 3165 |
-
},
|
| 3166 |
-
|
| 3167 |
-
// multi
|
| 3168 |
-
resizeSearch: function () {
|
| 3169 |
-
var minimumWidth, left, maxWidth, containerLeft, searchWidth,
|
| 3170 |
-
sideBorderPadding = getSideBorderPadding(this.search);
|
| 3171 |
-
|
| 3172 |
-
minimumWidth = measureTextWidth(this.search) + 10;
|
| 3173 |
-
|
| 3174 |
-
left = this.search.offset().left;
|
| 3175 |
-
|
| 3176 |
-
maxWidth = this.selection.width();
|
| 3177 |
-
containerLeft = this.selection.offset().left;
|
| 3178 |
-
|
| 3179 |
-
searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
|
| 3180 |
-
|
| 3181 |
-
if (searchWidth < minimumWidth) {
|
| 3182 |
-
searchWidth = maxWidth - sideBorderPadding;
|
| 3183 |
-
}
|
| 3184 |
-
|
| 3185 |
-
if (searchWidth < 40) {
|
| 3186 |
-
searchWidth = maxWidth - sideBorderPadding;
|
| 3187 |
-
}
|
| 3188 |
-
|
| 3189 |
-
if (searchWidth <= 0) {
|
| 3190 |
-
searchWidth = minimumWidth;
|
| 3191 |
-
}
|
| 3192 |
-
|
| 3193 |
-
this.search.width(Math.floor(searchWidth));
|
| 3194 |
-
},
|
| 3195 |
-
|
| 3196 |
-
// multi
|
| 3197 |
-
getVal: function () {
|
| 3198 |
-
var val;
|
| 3199 |
-
if (this.select) {
|
| 3200 |
-
val = this.select.val();
|
| 3201 |
-
return val === null ? [] : val;
|
| 3202 |
-
} else {
|
| 3203 |
-
val = this.opts.element.val();
|
| 3204 |
-
return splitVal(val, this.opts.separator);
|
| 3205 |
-
}
|
| 3206 |
-
},
|
| 3207 |
-
|
| 3208 |
-
// multi
|
| 3209 |
-
setVal: function (val) {
|
| 3210 |
-
var unique;
|
| 3211 |
-
if (this.select) {
|
| 3212 |
-
this.select.val(val);
|
| 3213 |
-
} else {
|
| 3214 |
-
unique = [];
|
| 3215 |
-
// filter out duplicates
|
| 3216 |
-
$(val).each(function () {
|
| 3217 |
-
if (indexOf(this, unique) < 0) unique.push(this);
|
| 3218 |
-
});
|
| 3219 |
-
this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
|
| 3220 |
-
}
|
| 3221 |
-
},
|
| 3222 |
-
|
| 3223 |
-
// multi
|
| 3224 |
-
buildChangeDetails: function (old, current) {
|
| 3225 |
-
var current = current.slice(0),
|
| 3226 |
-
old = old.slice(0);
|
| 3227 |
-
|
| 3228 |
-
// remove intersection from each array
|
| 3229 |
-
for (var i = 0; i < current.length; i++) {
|
| 3230 |
-
for (var j = 0; j < old.length; j++) {
|
| 3231 |
-
if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
|
| 3232 |
-
current.splice(i, 1);
|
| 3233 |
-
if(i>0){
|
| 3234 |
-
i--;
|
| 3235 |
-
}
|
| 3236 |
-
old.splice(j, 1);
|
| 3237 |
-
j--;
|
| 3238 |
-
}
|
| 3239 |
-
}
|
| 3240 |
-
}
|
| 3241 |
-
|
| 3242 |
-
return {added: current, removed: old};
|
| 3243 |
-
},
|
| 3244 |
-
|
| 3245 |
-
|
| 3246 |
-
// multi
|
| 3247 |
-
val: function (val, triggerChange) {
|
| 3248 |
-
var oldData, self=this;
|
| 3249 |
-
|
| 3250 |
-
if (arguments.length === 0) {
|
| 3251 |
-
return this.getVal();
|
| 3252 |
-
}
|
| 3253 |
-
|
| 3254 |
-
oldData=this.data();
|
| 3255 |
-
if (!oldData.length) oldData=[];
|
| 3256 |
-
|
| 3257 |
-
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
| 3258 |
-
if (!val && val !== 0) {
|
| 3259 |
-
this.opts.element.val("");
|
| 3260 |
-
this.updateSelection([]);
|
| 3261 |
-
this.clearSearch();
|
| 3262 |
-
if (triggerChange) {
|
| 3263 |
-
this.triggerChange({added: this.data(), removed: oldData});
|
| 3264 |
-
}
|
| 3265 |
-
return;
|
| 3266 |
-
}
|
| 3267 |
-
|
| 3268 |
-
// val is a list of ids
|
| 3269 |
-
this.setVal(val);
|
| 3270 |
-
|
| 3271 |
-
if (this.select) {
|
| 3272 |
-
this.opts.initSelection(this.select, this.bind(this.updateSelection));
|
| 3273 |
-
if (triggerChange) {
|
| 3274 |
-
this.triggerChange(this.buildChangeDetails(oldData, this.data()));
|
| 3275 |
-
}
|
| 3276 |
-
} else {
|
| 3277 |
-
if (this.opts.initSelection === undefined) {
|
| 3278 |
-
throw new Error("val() cannot be called if initSelection() is not defined");
|
| 3279 |
-
}
|
| 3280 |
-
|
| 3281 |
-
this.opts.initSelection(this.opts.element, function(data){
|
| 3282 |
-
var ids=$.map(data, self.id);
|
| 3283 |
-
self.setVal(ids);
|
| 3284 |
-
self.updateSelection(data);
|
| 3285 |
-
self.clearSearch();
|
| 3286 |
-
if (triggerChange) {
|
| 3287 |
-
self.triggerChange(self.buildChangeDetails(oldData, self.data()));
|
| 3288 |
-
}
|
| 3289 |
-
});
|
| 3290 |
-
}
|
| 3291 |
-
this.clearSearch();
|
| 3292 |
-
},
|
| 3293 |
-
|
| 3294 |
-
// multi
|
| 3295 |
-
onSortStart: function() {
|
| 3296 |
-
if (this.select) {
|
| 3297 |
-
throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
|
| 3298 |
-
}
|
| 3299 |
-
|
| 3300 |
-
// collapse search field into 0 width so its container can be collapsed as well
|
| 3301 |
-
this.search.width(0);
|
| 3302 |
-
// hide the container
|
| 3303 |
-
this.searchContainer.hide();
|
| 3304 |
-
},
|
| 3305 |
-
|
| 3306 |
-
// multi
|
| 3307 |
-
onSortEnd:function() {
|
| 3308 |
-
|
| 3309 |
-
var val=[], self=this;
|
| 3310 |
-
|
| 3311 |
-
// show search and move it to the end of the list
|
| 3312 |
-
this.searchContainer.show();
|
| 3313 |
-
// make sure the search container is the last item in the list
|
| 3314 |
-
this.searchContainer.appendTo(this.searchContainer.parent());
|
| 3315 |
-
// since we collapsed the width in dragStarted, we resize it here
|
| 3316 |
-
this.resizeSearch();
|
| 3317 |
-
|
| 3318 |
-
// update selection
|
| 3319 |
-
this.selection.find(".select2-search-choice").each(function() {
|
| 3320 |
-
val.push(self.opts.id($(this).data("select2-data")));
|
| 3321 |
-
});
|
| 3322 |
-
this.setVal(val);
|
| 3323 |
-
this.triggerChange();
|
| 3324 |
-
},
|
| 3325 |
-
|
| 3326 |
-
// multi
|
| 3327 |
-
data: function(values, triggerChange) {
|
| 3328 |
-
var self=this, ids, old;
|
| 3329 |
-
if (arguments.length === 0) {
|
| 3330 |
-
return this.selection
|
| 3331 |
-
.children(".select2-search-choice")
|
| 3332 |
-
.map(function() { return $(this).data("select2-data"); })
|
| 3333 |
-
.get();
|
| 3334 |
-
} else {
|
| 3335 |
-
old = this.data();
|
| 3336 |
-
if (!values) { values = []; }
|
| 3337 |
-
ids = $.map(values, function(e) { return self.opts.id(e); });
|
| 3338 |
-
this.setVal(ids);
|
| 3339 |
-
this.updateSelection(values);
|
| 3340 |
-
this.clearSearch();
|
| 3341 |
-
if (triggerChange) {
|
| 3342 |
-
this.triggerChange(this.buildChangeDetails(old, this.data()));
|
| 3343 |
-
}
|
| 3344 |
-
}
|
| 3345 |
-
}
|
| 3346 |
-
});
|
| 3347 |
-
|
| 3348 |
-
$.fn.select2 = function () {
|
| 3349 |
-
|
| 3350 |
-
var args = Array.prototype.slice.call(arguments, 0),
|
| 3351 |
-
opts,
|
| 3352 |
-
select2,
|
| 3353 |
-
method, value, multiple,
|
| 3354 |
-
allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
|
| 3355 |
-
valueMethods = ["opened", "isFocused", "container", "dropdown"],
|
| 3356 |
-
propertyMethods = ["val", "data"],
|
| 3357 |
-
methodsMap = { search: "externalSearch" };
|
| 3358 |
-
|
| 3359 |
-
this.each(function () {
|
| 3360 |
-
if (args.length === 0 || typeof(args[0]) === "object") {
|
| 3361 |
-
opts = args.length === 0 ? {} : $.extend({}, args[0]);
|
| 3362 |
-
opts.element = $(this);
|
| 3363 |
-
|
| 3364 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 3365 |
-
multiple = opts.element.prop("multiple");
|
| 3366 |
-
} else {
|
| 3367 |
-
multiple = opts.multiple || false;
|
| 3368 |
-
if ("tags" in opts) {opts.multiple = multiple = true;}
|
| 3369 |
-
}
|
| 3370 |
-
|
| 3371 |
-
select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
|
| 3372 |
-
select2.init(opts);
|
| 3373 |
-
} else if (typeof(args[0]) === "string") {
|
| 3374 |
-
|
| 3375 |
-
if (indexOf(args[0], allowedMethods) < 0) {
|
| 3376 |
-
throw "Unknown method: " + args[0];
|
| 3377 |
-
}
|
| 3378 |
-
|
| 3379 |
-
value = undefined;
|
| 3380 |
-
select2 = $(this).data("select2");
|
| 3381 |
-
if (select2 === undefined) return;
|
| 3382 |
-
|
| 3383 |
-
method=args[0];
|
| 3384 |
-
|
| 3385 |
-
if (method === "container") {
|
| 3386 |
-
value = select2.container;
|
| 3387 |
-
} else if (method === "dropdown") {
|
| 3388 |
-
value = select2.dropdown;
|
| 3389 |
-
} else {
|
| 3390 |
-
if (methodsMap[method]) method = methodsMap[method];
|
| 3391 |
-
|
| 3392 |
-
value = select2[method].apply(select2, args.slice(1));
|
| 3393 |
-
}
|
| 3394 |
-
if (indexOf(args[0], valueMethods) >= 0
|
| 3395 |
-
|| (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
|
| 3396 |
-
return false; // abort the iteration, ready to return first matched value
|
| 3397 |
-
}
|
| 3398 |
-
} else {
|
| 3399 |
-
throw "Invalid arguments to select2 plugin: " + args;
|
| 3400 |
-
}
|
| 3401 |
-
});
|
| 3402 |
-
return (value === undefined) ? this : value;
|
| 3403 |
-
};
|
| 3404 |
-
|
| 3405 |
-
// plugin defaults, accessible to users
|
| 3406 |
-
$.fn.select2.defaults = {
|
| 3407 |
-
width: "copy",
|
| 3408 |
-
loadMorePadding: 0,
|
| 3409 |
-
closeOnSelect: true,
|
| 3410 |
-
openOnEnter: true,
|
| 3411 |
-
containerCss: {},
|
| 3412 |
-
dropdownCss: {},
|
| 3413 |
-
containerCssClass: "",
|
| 3414 |
-
dropdownCssClass: "",
|
| 3415 |
-
formatResult: function(result, container, query, escapeMarkup) {
|
| 3416 |
-
var markup=[];
|
| 3417 |
-
markMatch(result.text, query.term, markup, escapeMarkup);
|
| 3418 |
-
return markup.join("");
|
| 3419 |
-
},
|
| 3420 |
-
formatSelection: function (data, container, escapeMarkup) {
|
| 3421 |
-
return data ? escapeMarkup(data.text) : undefined;
|
| 3422 |
-
},
|
| 3423 |
-
sortResults: function (results, container, query) {
|
| 3424 |
-
return results;
|
| 3425 |
-
},
|
| 3426 |
-
formatResultCssClass: function(data) {return data.css;},
|
| 3427 |
-
formatSelectionCssClass: function(data, container) {return undefined;},
|
| 3428 |
-
minimumResultsForSearch: 0,
|
| 3429 |
-
minimumInputLength: 0,
|
| 3430 |
-
maximumInputLength: null,
|
| 3431 |
-
maximumSelectionSize: 0,
|
| 3432 |
-
id: function (e) { return e == undefined ? null : e.id; },
|
| 3433 |
-
matcher: function(term, text) {
|
| 3434 |
-
return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
|
| 3435 |
-
},
|
| 3436 |
-
separator: ",",
|
| 3437 |
-
tokenSeparators: [],
|
| 3438 |
-
tokenizer: defaultTokenizer,
|
| 3439 |
-
escapeMarkup: defaultEscapeMarkup,
|
| 3440 |
-
blurOnChange: false,
|
| 3441 |
-
selectOnBlur: false,
|
| 3442 |
-
adaptContainerCssClass: function(c) { return c; },
|
| 3443 |
-
adaptDropdownCssClass: function(c) { return null; },
|
| 3444 |
-
nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
|
| 3445 |
-
searchInputPlaceholder: '',
|
| 3446 |
-
createSearchChoicePosition: 'top',
|
| 3447 |
-
shouldFocusInput: function (instance) {
|
| 3448 |
-
// Attempt to detect touch devices
|
| 3449 |
-
var supportsTouchEvents = (('ontouchstart' in window) ||
|
| 3450 |
-
(navigator.msMaxTouchPoints > 0));
|
| 3451 |
-
|
| 3452 |
-
// Only devices which support touch events should be special cased
|
| 3453 |
-
if (!supportsTouchEvents) {
|
| 3454 |
-
return true;
|
| 3455 |
-
}
|
| 3456 |
-
|
| 3457 |
-
// Never focus the input if search is disabled
|
| 3458 |
-
if (instance.opts.minimumResultsForSearch < 0) {
|
| 3459 |
-
return false;
|
| 3460 |
-
}
|
| 3461 |
-
|
| 3462 |
-
return true;
|
| 3463 |
-
}
|
| 3464 |
-
};
|
| 3465 |
-
|
| 3466 |
-
$.fn.select2.locales = [];
|
| 3467 |
-
|
| 3468 |
-
$.fn.select2.locales['en'] = {
|
| 3469 |
-
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
| 3470 |
-
formatNoMatches: function () { return "No matches found"; },
|
| 3471 |
-
formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
|
| 3472 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
| 3473 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
| 3474 |
-
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
| 3475 |
-
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
| 3476 |
-
formatSearching: function () { return "Searching…"; },
|
| 3477 |
-
};
|
| 3478 |
-
|
| 3479 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
| 3480 |
-
|
| 3481 |
-
$.fn.select2.ajaxDefaults = {
|
| 3482 |
-
transport: $.ajax,
|
| 3483 |
-
params: {
|
| 3484 |
-
type: "GET",
|
| 3485 |
-
cache: false,
|
| 3486 |
-
dataType: "json"
|
| 3487 |
-
}
|
| 3488 |
-
};
|
| 3489 |
-
|
| 3490 |
-
// exports
|
| 3491 |
-
window.Select2 = {
|
| 3492 |
-
query: {
|
| 3493 |
-
ajax: ajax,
|
| 3494 |
-
local: local,
|
| 3495 |
-
tags: tags
|
| 3496 |
-
}, util: {
|
| 3497 |
-
debounce: debounce,
|
| 3498 |
-
markMatch: markMatch,
|
| 3499 |
-
escapeMarkup: defaultEscapeMarkup,
|
| 3500 |
-
stripDiacritics: stripDiacritics
|
| 3501 |
-
}, "class": {
|
| 3502 |
-
"abstract": AbstractSelect2,
|
| 3503 |
-
"single": SingleSelect2,
|
| 3504 |
-
"multi": MultiSelect2
|
| 3505 |
-
}
|
| 3506 |
-
};
|
| 3507 |
-
|
| 3508 |
-
}(jQuery));
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2.min.js
DELETED
|
@@ -1,23 +0,0 @@
|
|
| 1 |
-
/*
|
| 2 |
-
Copyright 2014 Igor Vaynberg
|
| 3 |
-
|
| 4 |
-
Version: 3.5.1 Timestamp: Tue Jul 22 18:58:56 EDT 2014
|
| 5 |
-
|
| 6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
-
License or the GPL License.
|
| 10 |
-
|
| 11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
-
|
| 13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
-
|
| 16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
| 17 |
-
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
| 18 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
| 19 |
-
permissions and limitations under the Apache License and the GPL License.
|
| 20 |
-
*/
|
| 21 |
-
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo("body");var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(b,c){var d,e,f;if(null===b||b.length<1)return[];for(d=b.split(c),e=0,f=d.length;f>e;e+=1)d[e]=a.trim(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=i;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!h){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);h=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),h.attr("class","select2-sizer"),a("body").append(h)}return h.text(b.val()),h.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,h,j,k,i={x:0,y:0},c={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case c.LEFT:case c.RIGHT:case c.UP:case c.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case c.SHIFT:case c.CTRL:case c.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};j=a(document),g=function(){var a=1;return function(){return a++}}(),d=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,f=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+g()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a("body"),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(f),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",f,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",f,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",f,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",f,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",f,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",f,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),k=k||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&a.each(function(){this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.removeClass("select2-offscreen").removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,f,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,f){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,f);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+g()),t.attr("role","option"),v=c.formatResult(o,t,f,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(f=c.id,c.id=function(a){return a[f]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element)),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var t,u,v,w,x,b=this.dropdown,c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),g=a(window),h=g.width(),i=g.height(),j=g.scrollLeft()+h,l=g.scrollTop()+i,m=c.top+d,n=c.left,o=l>=m+f,p=c.top-f>=g.scrollTop(),q=b.outerWidth(!1),r=j>=n+q,s=b.hasClass("select2-drop-above");s?(u=!0,!p&&o&&(v=!0,u=!1)):(u=!1,!o&&p&&(v=!0,u=!0)),v&&(b.hide(),c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),j=g.scrollLeft()+h,l=g.scrollTop()+i,m=c.top+d,n=c.left,q=b.outerWidth(!1),r=j>=n+q,b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(x=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),q=b.outerWidth(!1)+(x.scrollHeight===x.clientHeight?0:k.width),q>e?e=q:q=e,f=b.outerHeight(!1),r=j>=n+q):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(t=this.body.offset(),m-=t.top,n-=t.left),r||(n=c.left+this.container.outerWidth(!1)-q),w={left:n,width:e},u?(w.top=c.top-f,w.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(w.top=m,w.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),w=a.extend(w,K(this.opts.dropdownCss,this.opts.element)),b.css(w)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),j.on("mousemove.select2Event",function(a){i.x=a.pageX,i.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0==f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),j.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!0),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);
|
| 22 |
-
break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).text(K(e.opts.formatLoadMore,e.opts.element,d+1)),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find(".select2-result-selectable").length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),e=O(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,h,d=this.container,e=this.dropdown,f=g();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=d.find(".select2-choice"),this.focusser=d.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+f),this.focusser.attr("aria-labelledby","select2-chosen-"+f),this.results.attr("id","select2-results-"+f),this.search.attr("aria-owns","select2-results-"+f),this.focusser.attr("id","s2id_autogen"+f),h=a("label[for='"+this.opts.element.attr("id")+"']"),this.focusser.prev().text(h.text()).attr("for",this.focusser.attr("id"));var i=this.opts.element.attr("title");this.opts.element.attr("title",i||h.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)return A(a),void 0;switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case c.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.ESC){if(this.opts.openOnEnter===!1&&a.which===c.ENTER)return A(a),void 0;if(a.which==c.DOWN||a.which==c.UP||a.which==c.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==c.DELETE||a.which==c.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),e.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),f=O(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var d,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=d=this.container.find(b);var e=this;this.selection.on("click",".select2-search-choice:not(.select2-locked)",function(){e.search[0].focus(),e.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+g()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=d.find(".select2-search-choice-focus"),e=b.prev(".select2-search-choice:not(.select2-locked)"),f=b.next(".select2-search-choice:not(.select2-locked)"),g=z(this.search);if(b.length&&(a.which==c.LEFT||a.which==c.RIGHT||a.which==c.BACKSPACE||a.which==c.DELETE||a.which==c.ENTER)){var h=b;return a.which==c.LEFT&&e.length?h=e:a.which==c.RIGHT?h=f.length?f:null:a.which===c.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),h=e.length?e:f):a.which==c.DELETE?this.unselect(b.first())&&(this.search.width(10),h=f.length?f:null):a.which==c.ENTER&&(h=null),this.selectChoice(h),A(a),h&&h.length||this.open(),void 0}if((a.which===c.BACKSPACE&&1==this.keydowns||a.which==c.LEFT)&&0==g.offset&&!g.length)return this.selectChoice(d.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),A(a),void 0;case c.ENTER:return this.selectHighlighted(),A(a),void 0;case c.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case c.ESC:return this.cancel(a),A(a),void 0}if(a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.BACKSPACE&&a.which!==c.ESC){if(a.which===c.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)&&A(a),a.which===c.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith("<div>"+j+"</div>"),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(a.text,c.term,e,d),e.join("")},formatSelection:function(a,c,d){return a?d(a.text):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."
|
| 23 |
-
},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":d,single:e,multi:f}}}}(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2.png
DELETED
|
Binary file
|
js/select2-3.5.1-old/select2_locale_ar.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Arabic translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Adel KEDJOUR <adel@kedjour.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['ar'] = {
|
| 10 |
-
formatNoMatches: function () { return "لم يتم العثور على مطابقات"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; if (n == 1){ return "الرجاء إدخال حرف واحد على الأكثر"; } return n == 2 ? "الرجاء إدخال حرفين على الأكثر" : "الرجاء إدخال " + n + " على الأكثر"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; if (n == 1){ return "الرجاء إدخال حرف واحد على الأقل"; } return n == 2 ? "الرجاء إدخال حرفين على الأقل" : "الرجاء إدخال " + n + " على الأقل "; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { if (n == 1){ return "يمكنك أن تختار إختيار واحد فقط"; } return n == 2 ? "يمكنك أن تختار إختيارين فقط" : "يمكنك أن تختار " + n + " إختيارات فقط"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "تحميل المزيد من النتائج…"; },
|
| 15 |
-
formatSearching: function () { return "البحث…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ar']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_az.js
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Azerbaijani translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Farhad Safarov <farhad.safarov@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['az'] = {
|
| 10 |
-
formatMatches: function (matches) { return matches + " nəticə mövcuddur, hərəkət etdirmək üçün yuxarı və aşağı düymələrindən istifadə edin."; },
|
| 11 |
-
formatNoMatches: function () { return "Nəticə tapılmadı"; },
|
| 12 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return n + " simvol daxil edin"; },
|
| 13 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return n + " simvol silin"; },
|
| 14 |
-
formatSelectionTooBig: function (limit) { return "Sadəcə " + limit + " element seçə bilərsiniz"; },
|
| 15 |
-
formatLoadMore: function (pageNumber) { return "Daha çox nəticə yüklənir…"; },
|
| 16 |
-
formatSearching: function () { return "Axtarılır…"; }
|
| 17 |
-
};
|
| 18 |
-
|
| 19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['az']);
|
| 20 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_bg.js
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Bulgarian translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Lubomir Vikev <lubomirvikev@gmail.com>
|
| 5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
-
*/
|
| 7 |
-
(function ($) {
|
| 8 |
-
"use strict";
|
| 9 |
-
|
| 10 |
-
$.fn.select2.locales['bg'] = {
|
| 11 |
-
formatNoMatches: function () { return "Няма намерени съвпадения"; },
|
| 12 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n > 1 ? "а" : ""); },
|
| 13 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n > 1 ? "а" : ""); },
|
| 14 |
-
formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit > 1 ? " избора" : " избор"); },
|
| 15 |
-
formatLoadMore: function (pageNumber) { return "Зареждат се още…"; },
|
| 16 |
-
formatSearching: function () { return "Търсене…"; }
|
| 17 |
-
};
|
| 18 |
-
|
| 19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['bg']);
|
| 20 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_ca.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Catalan translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: David Planella <david.planella@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['ca'] = {
|
| 10 |
-
formatNoMatches: function () { return "No s'ha trobat cap coincidència"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats…"; },
|
| 15 |
-
formatSearching: function () { return "S'està cercant…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ca']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_cs.js
DELETED
|
@@ -1,51 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Czech translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Michal Marek <ahoj@michal-marek.cz>
|
| 5 |
-
* Author - sklonovani: David Vallner <david@vallner.net>
|
| 6 |
-
*/
|
| 7 |
-
(function ($) {
|
| 8 |
-
"use strict";
|
| 9 |
-
// use text for the numbers 2 through 4
|
| 10 |
-
var smallNumbers = {
|
| 11 |
-
2: function(masc) { return (masc ? "dva" : "dvě"); },
|
| 12 |
-
3: function() { return "tři"; },
|
| 13 |
-
4: function() { return "čtyři"; }
|
| 14 |
-
}
|
| 15 |
-
$.fn.select2.locales['cs'] = {
|
| 16 |
-
formatNoMatches: function () { return "Nenalezeny žádné položky"; },
|
| 17 |
-
formatInputTooShort: function (input, min) {
|
| 18 |
-
var n = min - input.length;
|
| 19 |
-
if (n == 1) {
|
| 20 |
-
return "Prosím zadejte ještě jeden znak";
|
| 21 |
-
} else if (n <= 4) {
|
| 22 |
-
return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky";
|
| 23 |
-
} else {
|
| 24 |
-
return "Prosím zadejte ještě dalších "+n+" znaků";
|
| 25 |
-
}
|
| 26 |
-
},
|
| 27 |
-
formatInputTooLong: function (input, max) {
|
| 28 |
-
var n = input.length - max;
|
| 29 |
-
if (n == 1) {
|
| 30 |
-
return "Prosím zadejte o jeden znak méně";
|
| 31 |
-
} else if (n <= 4) {
|
| 32 |
-
return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně";
|
| 33 |
-
} else {
|
| 34 |
-
return "Prosím zadejte o "+n+" znaků méně";
|
| 35 |
-
}
|
| 36 |
-
},
|
| 37 |
-
formatSelectionTooBig: function (limit) {
|
| 38 |
-
if (limit == 1) {
|
| 39 |
-
return "Můžete zvolit jen jednu položku";
|
| 40 |
-
} else if (limit <= 4) {
|
| 41 |
-
return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky";
|
| 42 |
-
} else {
|
| 43 |
-
return "Můžete zvolit maximálně "+limit+" položek";
|
| 44 |
-
}
|
| 45 |
-
},
|
| 46 |
-
formatLoadMore: function (pageNumber) { return "Načítají se další výsledky…"; },
|
| 47 |
-
formatSearching: function () { return "Vyhledávání…"; }
|
| 48 |
-
};
|
| 49 |
-
|
| 50 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['cs']);
|
| 51 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_da.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Danish translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Anders Jenbo <anders@jenbo.dk>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['da'] = {
|
| 10 |
-
formatNoMatches: function () { return "Ingen resultater fundet"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; },
|
| 15 |
-
formatSearching: function () { return "Søger…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['da']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_de.js
DELETED
|
@@ -1,18 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 German translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['de'] = {
|
| 8 |
-
formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse…"; },
|
| 13 |
-
formatSearching: function () { return "Suche…"; },
|
| 14 |
-
formatMatches: function (matches) { return matches + " Ergebnis " + (matches > 1 ? "se" : "") + " verfügbar, zum Navigieren die Hoch-/Runter-Pfeiltasten verwenden."; }
|
| 15 |
-
};
|
| 16 |
-
|
| 17 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['de']);
|
| 18 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_el.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Greek translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['el'] = {
|
| 10 |
-
formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερο" + (n > 1 ? "υς" : "") + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμεν" + (limit > 1 ? "α" : "ο"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων…"; },
|
| 15 |
-
formatSearching: function () { return "Αναζήτηση…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['el']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_en.js.template
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 <Language> translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Your Name <your@email>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['en'] = {
|
| 10 |
-
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
| 11 |
-
formatNoMatches: function () { return "No matches found"; },
|
| 12 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
| 13 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
| 14 |
-
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
| 15 |
-
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
| 16 |
-
formatSearching: function () { return "Searching…"; }
|
| 17 |
-
};
|
| 18 |
-
|
| 19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
| 20 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_es.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Spanish translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['es'] = {
|
| 8 |
-
formatNoMatches: function () { return "No se encontraron resultados"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "ácter" : "acteres"); },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "ácter" : "acteres"); },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Cargando más resultados…"; },
|
| 13 |
-
formatSearching: function () { return "Buscando…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['es']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_et.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Estonian translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Kuldar Kalvik <kuldar@kalvik.ee>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['et'] = {
|
| 10 |
-
formatNoMatches: function () { return "Tulemused puuduvad"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; },
|
| 15 |
-
formatSearching: function () { return "Otsin.."; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['et']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_eu.js
DELETED
|
@@ -1,45 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Basque translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Julen Ruiz Aizpuru <julenx at gmail dot com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['eu'] = {
|
| 10 |
-
formatNoMatches: function () {
|
| 11 |
-
return "Ez da bat datorrenik aurkitu";
|
| 12 |
-
},
|
| 13 |
-
formatInputTooShort: function (input, min) {
|
| 14 |
-
var n = min - input.length;
|
| 15 |
-
if (n === 1) {
|
| 16 |
-
return "Idatzi karaktere bat gehiago";
|
| 17 |
-
} else {
|
| 18 |
-
return "Idatzi " + n + " karaktere gehiago";
|
| 19 |
-
}
|
| 20 |
-
},
|
| 21 |
-
formatInputTooLong: function (input, max) {
|
| 22 |
-
var n = input.length - max;
|
| 23 |
-
if (n === 1) {
|
| 24 |
-
return "Idatzi karaktere bat gutxiago";
|
| 25 |
-
} else {
|
| 26 |
-
return "Idatzi " + n + " karaktere gutxiago";
|
| 27 |
-
}
|
| 28 |
-
},
|
| 29 |
-
formatSelectionTooBig: function (limit) {
|
| 30 |
-
if (limit === 1 ) {
|
| 31 |
-
return "Elementu bakarra hauta dezakezu";
|
| 32 |
-
} else {
|
| 33 |
-
return limit + " elementu hauta ditzakezu soilik";
|
| 34 |
-
}
|
| 35 |
-
},
|
| 36 |
-
formatLoadMore: function (pageNumber) {
|
| 37 |
-
return "Emaitza gehiago kargatzen…";
|
| 38 |
-
},
|
| 39 |
-
formatSearching: function () {
|
| 40 |
-
return "Bilatzen…";
|
| 41 |
-
}
|
| 42 |
-
};
|
| 43 |
-
|
| 44 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['eu']);
|
| 45 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_fa.js
DELETED
|
@@ -1,21 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Persian translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Ali Choopan <choopan@arsh.co>
|
| 5 |
-
* Author: Ebrahim Byagowi <ebrahim@gnu.org>
|
| 6 |
-
*/
|
| 7 |
-
(function ($) {
|
| 8 |
-
"use strict";
|
| 9 |
-
|
| 10 |
-
$.fn.select2.locales['fa'] = {
|
| 11 |
-
formatMatches: function (matches) { return matches + " نتیجه موجود است، کلیدهای جهت بالا و پایین را برای گشتن استفاده کنید."; },
|
| 12 |
-
formatNoMatches: function () { return "نتیجهای یافت نشد."; },
|
| 13 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "لطفاً " + n + " نویسه بیشتر وارد نمایید"; },
|
| 14 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "لطفاً " + n + " نویسه را حذف کنید."; },
|
| 15 |
-
formatSelectionTooBig: function (limit) { return "شما فقط میتوانید " + limit + " مورد را انتخاب کنید"; },
|
| 16 |
-
formatLoadMore: function (pageNumber) { return "در حال بارگیری موارد بیشتر…"; },
|
| 17 |
-
formatSearching: function () { return "در حال جستجو…"; }
|
| 18 |
-
};
|
| 19 |
-
|
| 20 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['fa']);
|
| 21 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_fi.js
DELETED
|
@@ -1,30 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Finnish translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
$.fn.select2.locales['fi'] = {
|
| 7 |
-
formatNoMatches: function () {
|
| 8 |
-
return "Ei tuloksia";
|
| 9 |
-
},
|
| 10 |
-
formatInputTooShort: function (input, min) {
|
| 11 |
-
var n = min - input.length;
|
| 12 |
-
return "Ole hyvä ja anna " + n + " merkkiä lisää";
|
| 13 |
-
},
|
| 14 |
-
formatInputTooLong: function (input, max) {
|
| 15 |
-
var n = input.length - max;
|
| 16 |
-
return "Ole hyvä ja anna " + n + " merkkiä vähemmän";
|
| 17 |
-
},
|
| 18 |
-
formatSelectionTooBig: function (limit) {
|
| 19 |
-
return "Voit valita ainoastaan " + limit + " kpl";
|
| 20 |
-
},
|
| 21 |
-
formatLoadMore: function (pageNumber) {
|
| 22 |
-
return "Ladataan lisää tuloksia…";
|
| 23 |
-
},
|
| 24 |
-
formatSearching: function () {
|
| 25 |
-
return "Etsitään…";
|
| 26 |
-
}
|
| 27 |
-
};
|
| 28 |
-
|
| 29 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['fi']);
|
| 30 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_fr.js
DELETED
|
@@ -1,18 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 French translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['fr'] = {
|
| 8 |
-
formatMatches: function (matches) { return matches + " résultats sont disponibles, utilisez les flèches haut et bas pour naviguer."; },
|
| 9 |
-
formatNoMatches: function () { return "Aucun résultat trouvé"; },
|
| 10 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Saisissez " + n + " caractère" + (n == 1? "" : "s") + " supplémentaire" + (n == 1? "" : "s") ; },
|
| 11 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Supprimez " + n + " caractère" + (n == 1? "" : "s"); },
|
| 12 |
-
formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); },
|
| 13 |
-
formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires…"; },
|
| 14 |
-
formatSearching: function () { return "Recherche en cours…"; }
|
| 15 |
-
};
|
| 16 |
-
|
| 17 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['fr']);
|
| 18 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_gl.js
DELETED
|
@@ -1,45 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Galician translation
|
| 3 |
-
*
|
| 4 |
-
* Author: Leandro Regueiro <leandro.regueiro@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['gl'] = {
|
| 10 |
-
formatNoMatches: function () {
|
| 11 |
-
return "Non se atoparon resultados";
|
| 12 |
-
},
|
| 13 |
-
formatInputTooShort: function (input, min) {
|
| 14 |
-
var n = min - input.length;
|
| 15 |
-
if (n === 1) {
|
| 16 |
-
return "Engada un carácter";
|
| 17 |
-
} else {
|
| 18 |
-
return "Engada " + n + " caracteres";
|
| 19 |
-
}
|
| 20 |
-
},
|
| 21 |
-
formatInputTooLong: function (input, max) {
|
| 22 |
-
var n = input.length - max;
|
| 23 |
-
if (n === 1) {
|
| 24 |
-
return "Elimine un carácter";
|
| 25 |
-
} else {
|
| 26 |
-
return "Elimine " + n + " caracteres";
|
| 27 |
-
}
|
| 28 |
-
},
|
| 29 |
-
formatSelectionTooBig: function (limit) {
|
| 30 |
-
if (limit === 1 ) {
|
| 31 |
-
return "Só pode seleccionar un elemento";
|
| 32 |
-
} else {
|
| 33 |
-
return "Só pode seleccionar " + limit + " elementos";
|
| 34 |
-
}
|
| 35 |
-
},
|
| 36 |
-
formatLoadMore: function (pageNumber) {
|
| 37 |
-
return "Cargando máis resultados…";
|
| 38 |
-
},
|
| 39 |
-
formatSearching: function () {
|
| 40 |
-
return "Buscando…";
|
| 41 |
-
}
|
| 42 |
-
};
|
| 43 |
-
|
| 44 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['gl']);
|
| 45 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_he.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Hebrew translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Yakir Sitbon <http://www.yakirs.net/>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['he'] = {
|
| 10 |
-
formatNoMatches: function () { return "לא נמצאו התאמות"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות…"; },
|
| 15 |
-
formatSearching: function () { return "מחפש…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['he']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_hr.js
DELETED
|
@@ -1,24 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Croatian translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Edi Modrić <edi.modric@gmail.com>
|
| 5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
-
*/
|
| 7 |
-
(function ($) {
|
| 8 |
-
"use strict";
|
| 9 |
-
|
| 10 |
-
$.fn.select2.locales['hr'] = {
|
| 11 |
-
formatNoMatches: function () { return "Nema rezultata"; },
|
| 12 |
-
formatInputTooShort: function (input, min) { return "Unesite još" + character(min - input.length); },
|
| 13 |
-
formatInputTooLong: function (input, max) { return "Unesite" + character(input.length - max) + " manje"; },
|
| 14 |
-
formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; },
|
| 15 |
-
formatLoadMore: function (pageNumber) { return "Učitavanje rezultata…"; },
|
| 16 |
-
formatSearching: function () { return "Pretraga…"; }
|
| 17 |
-
};
|
| 18 |
-
|
| 19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['hr']);
|
| 20 |
-
|
| 21 |
-
function character (n) {
|
| 22 |
-
return " " + n + " znak" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "a" : "" : "ova");
|
| 23 |
-
}
|
| 24 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_hu.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Hungarian translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['hu'] = {
|
| 8 |
-
formatNoMatches: function () { return "Nincs találat."; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " karakterrel több, mint kellene."; },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Töltés…"; },
|
| 13 |
-
formatSearching: function () { return "Keresés…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['hu']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_id.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Indonesian translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Ibrahim Yusuf <ibrahim7usuf@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['id'] = {
|
| 10 |
-
formatNoMatches: function () { return "Tidak ada data yang sesuai"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Mengambil data…"; },
|
| 15 |
-
formatSearching: function () { return "Mencari…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['id']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_is.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Icelandic translation.
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['is'] = {
|
| 8 |
-
formatNoMatches: function () { return "Ekkert fannst"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n > 1 ? "i" : "") + " í viðbót"; },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n > 1 ? "i" : ""); },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður…"; },
|
| 13 |
-
formatSearching: function () { return "Leita…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['is']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_it.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Italian translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['it'] = {
|
| 8 |
-
formatNoMatches: function () { return "Nessuna corrispondenza trovata"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Caricamento in corso…"; },
|
| 13 |
-
formatSearching: function () { return "Ricerca…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['it']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_ja.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Japanese translation.
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['ja'] = {
|
| 8 |
-
formatNoMatches: function () { return "該当なし"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "読込中・・・"; },
|
| 13 |
-
formatSearching: function () { return "検索中・・・"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ja']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_ka.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Georgian (Kartuli) translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Dimitri Kurashvili dimakura@gmail.com
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['ka'] = {
|
| 10 |
-
formatNoMatches: function () { return "ვერ მოიძებნა"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "გთხოვთ შეიყვანოთ კიდევ " + n + " სიმბოლო"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "გთხოვთ წაშალოთ " + n + " სიმბოლო"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "თქვენ შეგიძლიათ მხოლოდ " + limit + " ჩანაწერის მონიშვნა"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "შედეგის ჩატვირთვა…"; },
|
| 15 |
-
formatSearching: function () { return "ძებნა…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ka']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_ko.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Korean translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Swen Mun <longfinfunnel@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['ko'] = {
|
| 10 |
-
formatNoMatches: function () { return "결과 없음"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "불러오는 중…"; },
|
| 15 |
-
formatSearching: function () { return "검색 중…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ko']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_lt.js
DELETED
|
@@ -1,26 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Lithuanian translation.
|
| 3 |
-
*
|
| 4 |
-
* @author CRONUS Karmalakas <cronus dot karmalakas at gmail dot com>
|
| 5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
-
*/
|
| 7 |
-
(function ($) {
|
| 8 |
-
"use strict";
|
| 9 |
-
|
| 10 |
-
$.fn.select2.locales['lt'] = {
|
| 11 |
-
formatNoMatches: function () { return "Atitikmenų nerasta"; },
|
| 12 |
-
formatInputTooShort: function (input, min) { return "Įrašykite dar" + character(min - input.length); },
|
| 13 |
-
formatInputTooLong: function (input, max) { return "Pašalinkite" + character(input.length - max); },
|
| 14 |
-
formatSelectionTooBig: function (limit) {
|
| 15 |
-
return "Jūs galite pasirinkti tik " + limit + " element" + ((limit%100 > 9 && limit%100 < 21) || limit%10 == 0 ? "ų" : limit%10 > 1 ? "us" : "ą");
|
| 16 |
-
},
|
| 17 |
-
formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų…"; },
|
| 18 |
-
formatSearching: function () { return "Ieškoma…"; }
|
| 19 |
-
};
|
| 20 |
-
|
| 21 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['lt']);
|
| 22 |
-
|
| 23 |
-
function character (n) {
|
| 24 |
-
return " " + n + " simbol" + ((n%100 > 9 && n%100 < 21) || n%10 == 0 ? "ių" : n%10 > 1 ? "ius" : "į");
|
| 25 |
-
}
|
| 26 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_lv.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Latvian translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['lv'] = {
|
| 10 |
-
formatNoMatches: function () { return "Sakritību nav"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : n%10 == 1 ? "u" : "us"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : n%10 == 1 ? "u" : "iem") + " mazāk"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : limit%10 == 1 ? "u" : "us"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Datu ielāde…"; },
|
| 15 |
-
formatSearching: function () { return "Meklēšana…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['lv']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_mk.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Macedonian translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Marko Aleksic <psybaron@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['mk'] = {
|
| 10 |
-
formatNoMatches: function () { return "Нема пронајдено совпаѓања"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Вчитување резултати…"; },
|
| 15 |
-
formatSearching: function () { return "Пребарување…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['mk']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_ms.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Malay translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Kepoweran <kepoweran@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['ms'] = {
|
| 10 |
-
formatNoMatches: function () { return "Tiada padanan yang ditemui"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan…"; },
|
| 15 |
-
formatSearching: function () { return "Mencari…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ms']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_nl.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Dutch translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['nl'] = {
|
| 8 |
-
formatNoMatches: function () { return "Geen resultaten gevonden"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul nog " + n + " karakter" + (n == 1? "" : "s") + " in"; },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Haal " + n + " karakter" + (n == 1? "" : "s") + " weg"; },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Meer resultaten laden…"; },
|
| 13 |
-
formatSearching: function () { return "Zoeken…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['nl']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_no.js
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Norwegian translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Torgeir Veimo <torgeir.veimo@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['no'] = {
|
| 10 |
-
formatNoMatches: function () { return "Ingen treff"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Laster flere resultater…"; },
|
| 15 |
-
formatSearching: function () { return "Søker…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['no']);
|
| 19 |
-
})(jQuery);
|
| 20 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_pl.js
DELETED
|
@@ -1,25 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Polish translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Jan Kondratowicz <jan@kondratowicz.pl>
|
| 5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
-
* @author Michał Połtyn <mike@poltyn.com>
|
| 7 |
-
*/
|
| 8 |
-
(function ($) {
|
| 9 |
-
"use strict";
|
| 10 |
-
|
| 11 |
-
$.fn.select2.locales['pl'] = {
|
| 12 |
-
formatNoMatches: function () { return "Brak wyników"; },
|
| 13 |
-
formatInputTooShort: function (input, min) { return "Wpisz co najmniej" + character(min - input.length, "znak", "i"); },
|
| 14 |
-
formatInputTooLong: function (input, max) { return "Wpisana fraza jest za długa o" + character(input.length - max, "znak", "i"); },
|
| 15 |
-
formatSelectionTooBig: function (limit) { return "Możesz zaznaczyć najwyżej" + character(limit, "element", "y"); },
|
| 16 |
-
formatLoadMore: function (pageNumber) { return "Ładowanie wyników…"; },
|
| 17 |
-
formatSearching: function () { return "Szukanie…"; }
|
| 18 |
-
};
|
| 19 |
-
|
| 20 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['pl']);
|
| 21 |
-
|
| 22 |
-
function character (n, word, pluralSuffix) {
|
| 23 |
-
return " " + n + " " + word + (n == 1 ? "" : n%10 < 5 && n%10 > 1 && (n%100 < 5 || n%100 > 20) ? pluralSuffix : "ów");
|
| 24 |
-
}
|
| 25 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_pt-BR.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Brazilian Portuguese translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['pt-BR'] = {
|
| 8 |
-
formatNoMatches: function () { return "Nenhum resultado encontrado"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Digite mais " + n + " caracter" + (n == 1? "" : "es"); },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1? "" : "es"); },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Carregando mais resultados…"; },
|
| 13 |
-
formatSearching: function () { return "Buscando…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['pt-BR']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_pt-PT.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Portuguese (Portugal) translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['pt-PT'] = {
|
| 8 |
-
formatNoMatches: function () { return "Nenhum resultado encontrado"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "A carregar mais resultados…"; },
|
| 13 |
-
formatSearching: function () { return "A pesquisar…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['pt-PT']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_ro.js
DELETED
|
@@ -1,17 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Romanian translation.
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
|
| 7 |
-
$.fn.select2.locales['ro'] = {
|
| 8 |
-
formatNoMatches: function () { return "Nu a fost găsit nimic"; },
|
| 9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); },
|
| 10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); },
|
| 11 |
-
formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); },
|
| 12 |
-
formatLoadMore: function (pageNumber) { return "Se încarcă…"; },
|
| 13 |
-
formatSearching: function () { return "Căutare…"; }
|
| 14 |
-
};
|
| 15 |
-
|
| 16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ro']);
|
| 17 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_rs.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Serbian translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Limon Monte <limon.monte@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['rs'] = {
|
| 10 |
-
formatNoMatches: function () { return "Ništa nije pronađeno"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Ukucajte bar još " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Obrišite " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Možete izabrati samo " + limit + " stavk" + (limit % 10 == 1 && limit % 100 != 11 ? "u" : (limit % 10 >= 2 && limit % 10 <= 4 && (limit % 100 < 12 || limit % 100 > 14)? "e" : "i")); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Preuzimanje još rezultata…"; },
|
| 15 |
-
formatSearching: function () { return "Pretraga…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['rs']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_ru.js
DELETED
|
@@ -1,23 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Russian translation.
|
| 3 |
-
*
|
| 4 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['ru'] = {
|
| 10 |
-
formatNoMatches: function () { return "Совпадений не найдено"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { return "Пожалуйста, введите еще хотя бы" + character(min - input.length); },
|
| 12 |
-
formatInputTooLong: function (input, max) { return "Пожалуйста, введите на" + character(input.length - max) + " меньше"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit%10 == 1 && limit%100 != 11 ? "а" : "ов"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Загрузка данных…"; },
|
| 15 |
-
formatSearching: function () { return "Поиск…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ru']);
|
| 19 |
-
|
| 20 |
-
function character (n) {
|
| 21 |
-
return " " + n + " символ" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 20) ? n%10 > 1 ? "a" : "" : "ов");
|
| 22 |
-
}
|
| 23 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_sk.js
DELETED
|
@@ -1,50 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Slovak translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: David Vallner <david@vallner.net>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
// use text for the numbers 2 through 4
|
| 9 |
-
var smallNumbers = {
|
| 10 |
-
2: function(masc) { return (masc ? "dva" : "dve"); },
|
| 11 |
-
3: function() { return "tri"; },
|
| 12 |
-
4: function() { return "štyri"; }
|
| 13 |
-
};
|
| 14 |
-
$.fn.select2.locales['sk'] = {
|
| 15 |
-
formatNoMatches: function () { return "Nenašli sa žiadne položky"; },
|
| 16 |
-
formatInputTooShort: function (input, min) {
|
| 17 |
-
var n = min - input.length;
|
| 18 |
-
if (n == 1) {
|
| 19 |
-
return "Prosím, zadajte ešte jeden znak";
|
| 20 |
-
} else if (n <= 4) {
|
| 21 |
-
return "Prosím, zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky";
|
| 22 |
-
} else {
|
| 23 |
-
return "Prosím, zadajte ešte ďalších "+n+" znakov";
|
| 24 |
-
}
|
| 25 |
-
},
|
| 26 |
-
formatInputTooLong: function (input, max) {
|
| 27 |
-
var n = input.length - max;
|
| 28 |
-
if (n == 1) {
|
| 29 |
-
return "Prosím, zadajte o jeden znak menej";
|
| 30 |
-
} else if (n <= 4) {
|
| 31 |
-
return "Prosím, zadajte o "+smallNumbers[n](true)+" znaky menej";
|
| 32 |
-
} else {
|
| 33 |
-
return "Prosím, zadajte o "+n+" znakov menej";
|
| 34 |
-
}
|
| 35 |
-
},
|
| 36 |
-
formatSelectionTooBig: function (limit) {
|
| 37 |
-
if (limit == 1) {
|
| 38 |
-
return "Môžete zvoliť len jednu položku";
|
| 39 |
-
} else if (limit <= 4) {
|
| 40 |
-
return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky";
|
| 41 |
-
} else {
|
| 42 |
-
return "Môžete zvoliť najviac "+limit+" položiek";
|
| 43 |
-
}
|
| 44 |
-
},
|
| 45 |
-
formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky…"; },
|
| 46 |
-
formatSearching: function () { return "Vyhľadávanie…"; }
|
| 47 |
-
};
|
| 48 |
-
|
| 49 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['sk']);
|
| 50 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_sv.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Swedish translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Jens Rantil <jens.rantil@telavox.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['sv'] = {
|
| 10 |
-
formatNoMatches: function () { return "Inga träffar"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Laddar fler resultat…"; },
|
| 15 |
-
formatSearching: function () { return "Söker…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['sv']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_th.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Thai translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Atsawin Chaowanakritsanakul <joke@nakhon.net>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['th'] = {
|
| 10 |
-
formatNoMatches: function () { return "ไม่พบข้อมูล"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม…"; },
|
| 15 |
-
formatSearching: function () { return "กำลังค้นข้อมูล…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['th']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_tr.js
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Turkish translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Salim KAYABAŞI <salim.kayabasi@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['tr'] = {
|
| 10 |
-
formatNoMatches: function () { return "Sonuç bulunamadı"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Daha fazla…"; },
|
| 15 |
-
formatSearching: function () { return "Aranıyor…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['tr']);
|
| 19 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_ug-CN.js
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Uyghur translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
$.fn.select2.locales['ug-CN'] = {
|
| 7 |
-
formatNoMatches: function () { return "ماس كېلىدىغان ئۇچۇر تېپىلمىدى"; },
|
| 8 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "يەنە " + n + " ھەرپ كىرگۈزۈڭ";},
|
| 9 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "" + n + "ھەرپ ئۆچۈرۈڭ";},
|
| 10 |
-
formatSelectionTooBig: function (limit) { return "ئەڭ كۆپ بولغاندا" + limit + " تال ئۇچۇر تاللىيالايسىز"; },
|
| 11 |
-
formatLoadMore: function (pageNumber) { return "ئۇچۇرلار ئوقۇلىۋاتىدۇ…"; },
|
| 12 |
-
formatSearching: function () { return "ئىزدەۋاتىدۇ…"; }
|
| 13 |
-
};
|
| 14 |
-
|
| 15 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ug-CN']);
|
| 16 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_uk.js
DELETED
|
@@ -1,25 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Ukrainian translation.
|
| 3 |
-
*
|
| 4 |
-
* @author bigmihail <bigmihail@bigmir.net>
|
| 5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
-
*/
|
| 7 |
-
(function ($) {
|
| 8 |
-
"use strict";
|
| 9 |
-
|
| 10 |
-
$.fn.select2.locales['uk'] = {
|
| 11 |
-
formatMatches: function (matches) { return character(matches, "результат") + " знайдено, використовуйте клавіші зі стрілками вверх та вниз для навігації."; },
|
| 12 |
-
formatNoMatches: function () { return "Нічого не знайдено"; },
|
| 13 |
-
formatInputTooShort: function (input, min) { return "Введіть буль ласка ще " + character(min - input.length, "символ"); },
|
| 14 |
-
formatInputTooLong: function (input, max) { return "Введіть буль ласка на " + character(input.length - max, "символ") + " менше"; },
|
| 15 |
-
formatSelectionTooBig: function (limit) { return "Ви можете вибрати лише " + character(limit, "елемент"); },
|
| 16 |
-
formatLoadMore: function (pageNumber) { return "Завантаження даних…"; },
|
| 17 |
-
formatSearching: function () { return "Пошук…"; }
|
| 18 |
-
};
|
| 19 |
-
|
| 20 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['uk']);
|
| 21 |
-
|
| 22 |
-
function character (n, word) {
|
| 23 |
-
return n + " " + word + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "и" : "" : "ів");
|
| 24 |
-
}
|
| 25 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_vi.js
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Vietnamese translation.
|
| 3 |
-
*
|
| 4 |
-
* Author: Long Nguyen <olragon@gmail.com>
|
| 5 |
-
*/
|
| 6 |
-
(function ($) {
|
| 7 |
-
"use strict";
|
| 8 |
-
|
| 9 |
-
$.fn.select2.locales['vi'] = {
|
| 10 |
-
formatNoMatches: function () { return "Không tìm thấy kết quả"; },
|
| 11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); },
|
| 12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); },
|
| 13 |
-
formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); },
|
| 14 |
-
formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả…"; },
|
| 15 |
-
formatSearching: function () { return "Đang tìm…"; }
|
| 16 |
-
};
|
| 17 |
-
|
| 18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['vi']);
|
| 19 |
-
})(jQuery);
|
| 20 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_zh-CN.js
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Chinese translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
$.fn.select2.locales['zh-CN'] = {
|
| 7 |
-
formatNoMatches: function () { return "没有找到匹配项"; },
|
| 8 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";},
|
| 9 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";},
|
| 10 |
-
formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; },
|
| 11 |
-
formatLoadMore: function (pageNumber) { return "加载结果中…"; },
|
| 12 |
-
formatSearching: function () { return "搜索中…"; }
|
| 13 |
-
};
|
| 14 |
-
|
| 15 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['zh-CN']);
|
| 16 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2_locale_zh-TW.js
DELETED
|
@@ -1,16 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Select2 Traditional Chinese translation
|
| 3 |
-
*/
|
| 4 |
-
(function ($) {
|
| 5 |
-
"use strict";
|
| 6 |
-
$.fn.select2.locales['zh-TW'] = {
|
| 7 |
-
formatNoMatches: function () { return "沒有找到相符的項目"; },
|
| 8 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";},
|
| 9 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";},
|
| 10 |
-
formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; },
|
| 11 |
-
formatLoadMore: function (pageNumber) { return "載入中…"; },
|
| 12 |
-
formatSearching: function () { return "搜尋中…"; }
|
| 13 |
-
};
|
| 14 |
-
|
| 15 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['zh-TW']);
|
| 16 |
-
})(jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
js/select2-3.5.1-old/select2x2.png
DELETED
|
Binary file
|
js/timeago/jquery.timeago.js
CHANGED
|
@@ -3,7 +3,7 @@
|
|
| 3 |
* updating fuzzy timestamps (e.g. "4 minutes ago" or "about 1 day ago").
|
| 4 |
*
|
| 5 |
* @name timeago
|
| 6 |
-
* @version 1.
|
| 7 |
* @requires jQuery v1.2.3+
|
| 8 |
* @author Ryan McGeary
|
| 9 |
* @license MIT License - http://www.opensource.org/licenses/mit-license.php
|
|
@@ -11,32 +11,32 @@
|
|
| 11 |
* For usage and examples, visit:
|
| 12 |
* http://timeago.yarp.com/
|
| 13 |
*
|
| 14 |
-
* Copyright (c) 2008-
|
| 15 |
*/
|
| 16 |
|
| 17 |
(function (factory) {
|
| 18 |
if (typeof define === 'function' && define.amd) {
|
| 19 |
// AMD. Register as an anonymous module.
|
| 20 |
-
define(['jquery'], factory)
|
| 21 |
} else if (typeof module === 'object' && typeof module.exports === 'object') {
|
| 22 |
-
factory(require('jquery'))
|
| 23 |
} else {
|
| 24 |
// Browser globals
|
| 25 |
-
factory(jQuery)
|
| 26 |
}
|
| 27 |
}(function ($) {
|
| 28 |
-
$.timeago = function(timestamp) {
|
| 29 |
if (timestamp instanceof Date) {
|
| 30 |
-
return inWords(timestamp)
|
| 31 |
-
} else if (typeof timestamp ===
|
| 32 |
-
return inWords($.timeago.parse(timestamp))
|
| 33 |
-
} else if (typeof timestamp ===
|
| 34 |
-
return inWords(new Date(timestamp))
|
| 35 |
} else {
|
| 36 |
-
return inWords($.timeago.datetime(timestamp))
|
| 37 |
}
|
| 38 |
-
}
|
| 39 |
-
var $t = $.timeago
|
| 40 |
|
| 41 |
$.extend($.timeago, {
|
| 42 |
settings: {
|
|
@@ -49,54 +49,54 @@
|
|
| 49 |
strings: {
|
| 50 |
prefixAgo: null,
|
| 51 |
prefixFromNow: null,
|
| 52 |
-
suffixAgo:
|
| 53 |
-
suffixFromNow:
|
| 54 |
inPast: 'any moment now',
|
| 55 |
-
seconds:
|
| 56 |
-
minute:
|
| 57 |
-
minutes:
|
| 58 |
-
hour:
|
| 59 |
-
hours:
|
| 60 |
-
day:
|
| 61 |
-
days:
|
| 62 |
-
month:
|
| 63 |
-
months:
|
| 64 |
-
year:
|
| 65 |
-
years:
|
| 66 |
-
wordSeparator:
|
| 67 |
numbers: []
|
| 68 |
}
|
| 69 |
},
|
| 70 |
|
| 71 |
-
inWords: function(distanceMillis) {
|
| 72 |
-
if (!this.settings.allowPast && !
|
| 73 |
-
|
| 74 |
}
|
| 75 |
|
| 76 |
-
var $l = this.settings.strings
|
| 77 |
-
var prefix = $l.prefixAgo
|
| 78 |
-
var suffix = $l.suffixAgo
|
| 79 |
if (this.settings.allowFuture) {
|
| 80 |
if (distanceMillis < 0) {
|
| 81 |
-
prefix = $l.prefixFromNow
|
| 82 |
-
suffix = $l.suffixFromNow
|
| 83 |
}
|
| 84 |
}
|
| 85 |
|
| 86 |
if (!this.settings.allowPast && distanceMillis >= 0) {
|
| 87 |
-
return this.settings.strings.inPast
|
| 88 |
}
|
| 89 |
|
| 90 |
-
var seconds = Math.abs(distanceMillis) / 1000
|
| 91 |
-
var minutes = seconds / 60
|
| 92 |
-
var hours = minutes / 60
|
| 93 |
-
var days = hours / 24
|
| 94 |
-
var years = days / 365
|
| 95 |
|
| 96 |
-
function substitute(stringOrFunction, number) {
|
| 97 |
-
var string = $.isFunction(stringOrFunction) ? stringOrFunction(number, distanceMillis) : stringOrFunction
|
| 98 |
-
var value = ($l.numbers && $l.numbers[number]) || number
|
| 99 |
-
return string.replace(/%d/i, value)
|
| 100 |
}
|
| 101 |
|
| 102 |
var words = seconds < 45 && substitute($l.seconds, Math.round(seconds)) ||
|
|
@@ -109,117 +109,124 @@
|
|
| 109 |
days < 45 && substitute($l.month, 1) ||
|
| 110 |
days < 365 && substitute($l.months, Math.round(days / 30)) ||
|
| 111 |
years < 1.5 && substitute($l.year, 1) ||
|
| 112 |
-
substitute($l.years, Math.round(years))
|
| 113 |
|
| 114 |
-
var separator = $l.wordSeparator ||
|
| 115 |
-
if ($l.wordSeparator === undefined) { separator =
|
| 116 |
-
return $.trim([prefix, words, suffix].join(separator))
|
| 117 |
},
|
| 118 |
|
| 119 |
-
parse: function(iso8601) {
|
| 120 |
-
var s = $.trim(iso8601)
|
| 121 |
-
s = s.replace(/\.\d+/,
|
| 122 |
-
s = s.replace(/-/,
|
| 123 |
-
s = s.replace(/T/,
|
| 124 |
-
s = s.replace(/([\+\-]\d\d)\:?(\d\d)/,
|
| 125 |
-
s = s.replace(/([\+\-]\d\d)$/,
|
| 126 |
-
return new Date(s)
|
| 127 |
},
|
| 128 |
-
datetime: function(elem) {
|
| 129 |
-
var iso8601 = $t.isTime(elem) ? $(elem).attr(
|
| 130 |
-
return $t.parse(iso8601)
|
| 131 |
},
|
| 132 |
-
isTime: function(elem) {
|
| 133 |
// jQuery's `is()` doesn't play well with HTML5 in IE
|
| 134 |
-
return $(elem).get(0).tagName.toLowerCase() ===
|
| 135 |
}
|
| 136 |
-
})
|
| 137 |
|
| 138 |
// functions that can be called via $(el).timeago('action')
|
| 139 |
// init is default when no action is given
|
| 140 |
// functions are called with context of a single element
|
| 141 |
var functions = {
|
| 142 |
-
init: function() {
|
| 143 |
-
|
| 144 |
-
refresh_el()
|
| 145 |
-
|
|
|
|
| 146 |
if ($s.refreshMillis > 0) {
|
| 147 |
-
this._timeagoInterval = setInterval(refresh_el, $s.refreshMillis)
|
| 148 |
}
|
| 149 |
},
|
| 150 |
-
update: function(timestamp) {
|
| 151 |
-
var date = (timestamp instanceof Date) ? timestamp : $t.parse(timestamp)
|
| 152 |
-
$(this).data('timeago', { datetime: date })
|
| 153 |
-
if ($t.settings.localeTitle)
|
| 154 |
-
|
|
|
|
|
|
|
| 155 |
},
|
| 156 |
-
updateFromDOM: function() {
|
| 157 |
-
$(this).data('timeago', { datetime: $t.parse(
|
| 158 |
-
refresh.apply(this)
|
| 159 |
},
|
| 160 |
dispose: function () {
|
| 161 |
if (this._timeagoInterval) {
|
| 162 |
-
window.clearInterval(this._timeagoInterval)
|
| 163 |
-
this._timeagoInterval = null
|
| 164 |
}
|
| 165 |
}
|
| 166 |
-
}
|
| 167 |
|
| 168 |
-
$.fn.timeago = function(action, options) {
|
| 169 |
-
var fn = action ? functions[action] : functions.init
|
| 170 |
if (!fn) {
|
| 171 |
-
throw new Error("Unknown function name '"+ action +"' for timeago")
|
| 172 |
}
|
| 173 |
// each over objects here and call the requested function
|
| 174 |
-
this.each(function() {
|
| 175 |
-
fn.call(this, options)
|
| 176 |
-
})
|
| 177 |
-
return this
|
| 178 |
-
}
|
| 179 |
-
|
| 180 |
-
function refresh() {
|
| 181 |
-
var $s = $t.settings
|
| 182 |
-
|
| 183 |
-
//check if it's still visible
|
| 184 |
-
if ($s.autoDispose && !$.contains(document.documentElement,this)) {
|
| 185 |
-
//stop if it has been removed
|
| 186 |
-
$(this).timeago(
|
| 187 |
-
return this
|
| 188 |
}
|
| 189 |
|
| 190 |
-
var data = prepareData(this)
|
| 191 |
|
| 192 |
if (!isNaN(data.datetime)) {
|
| 193 |
-
if (
|
| 194 |
-
$(this).text(inWords(data.datetime))
|
|
|
|
|
|
|
|
|
|
|
|
|
| 195 |
}
|
| 196 |
}
|
| 197 |
-
return this
|
| 198 |
}
|
| 199 |
|
| 200 |
-
function prepareData(element) {
|
| 201 |
-
element = $(element)
|
| 202 |
-
if (!element.data(
|
| 203 |
-
element.data(
|
| 204 |
-
var text = $.trim(element.text())
|
| 205 |
if ($t.settings.localeTitle) {
|
| 206 |
-
element.attr(
|
| 207 |
-
} else if (text.length > 0 && !($t.isTime(element) && element.attr(
|
| 208 |
-
element.attr(
|
| 209 |
}
|
| 210 |
}
|
| 211 |
-
return element.data(
|
| 212 |
}
|
| 213 |
|
| 214 |
-
function inWords(date) {
|
| 215 |
-
return $t.inWords(distance(date))
|
| 216 |
}
|
| 217 |
|
| 218 |
-
function distance(date) {
|
| 219 |
-
return (new Date().getTime() - date.getTime())
|
| 220 |
}
|
| 221 |
|
| 222 |
// fix for IE6 suckage
|
| 223 |
-
document.createElement(
|
| 224 |
-
document.createElement(
|
| 225 |
-
}))
|
| 3 |
* updating fuzzy timestamps (e.g. "4 minutes ago" or "about 1 day ago").
|
| 4 |
*
|
| 5 |
* @name timeago
|
| 6 |
+
* @version 1.6.3
|
| 7 |
* @requires jQuery v1.2.3+
|
| 8 |
* @author Ryan McGeary
|
| 9 |
* @license MIT License - http://www.opensource.org/licenses/mit-license.php
|
| 11 |
* For usage and examples, visit:
|
| 12 |
* http://timeago.yarp.com/
|
| 13 |
*
|
| 14 |
+
* Copyright (c) 2008-2017, Ryan McGeary (ryan -[at]- mcgeary [*dot*] org)
|
| 15 |
*/
|
| 16 |
|
| 17 |
(function (factory) {
|
| 18 |
if (typeof define === 'function' && define.amd) {
|
| 19 |
// AMD. Register as an anonymous module.
|
| 20 |
+
define(['jquery'], factory)
|
| 21 |
} else if (typeof module === 'object' && typeof module.exports === 'object') {
|
| 22 |
+
factory(require('jquery'))
|
| 23 |
} else {
|
| 24 |
// Browser globals
|
| 25 |
+
factory(jQuery)
|
| 26 |
}
|
| 27 |
}(function ($) {
|
| 28 |
+
$.timeago = function (timestamp) {
|
| 29 |
if (timestamp instanceof Date) {
|
| 30 |
+
return inWords(timestamp)
|
| 31 |
+
} else if (typeof timestamp === 'string') {
|
| 32 |
+
return inWords($.timeago.parse(timestamp))
|
| 33 |
+
} else if (typeof timestamp === 'number') {
|
| 34 |
+
return inWords(new Date(timestamp))
|
| 35 |
} else {
|
| 36 |
+
return inWords($.timeago.datetime(timestamp))
|
| 37 |
}
|
| 38 |
+
}
|
| 39 |
+
var $t = $.timeago
|
| 40 |
|
| 41 |
$.extend($.timeago, {
|
| 42 |
settings: {
|
| 49 |
strings: {
|
| 50 |
prefixAgo: null,
|
| 51 |
prefixFromNow: null,
|
| 52 |
+
suffixAgo: 'ago',
|
| 53 |
+
suffixFromNow: 'from now',
|
| 54 |
inPast: 'any moment now',
|
| 55 |
+
seconds: 'less than a minute',
|
| 56 |
+
minute: 'about a minute',
|
| 57 |
+
minutes: '%d minutes',
|
| 58 |
+
hour: 'about an hour',
|
| 59 |
+
hours: 'about %d hours',
|
| 60 |
+
day: 'a day',
|
| 61 |
+
days: '%d days',
|
| 62 |
+
month: 'about a month',
|
| 63 |
+
months: '%d months',
|
| 64 |
+
year: 'about a year',
|
| 65 |
+
years: '%d years',
|
| 66 |
+
wordSeparator: ' ',
|
| 67 |
numbers: []
|
| 68 |
}
|
| 69 |
},
|
| 70 |
|
| 71 |
+
inWords: function (distanceMillis) {
|
| 72 |
+
if (!this.settings.allowPast && !this.settings.allowFuture) {
|
| 73 |
+
throw 'timeago allowPast and allowFuture settings can not both be set to false.'
|
| 74 |
}
|
| 75 |
|
| 76 |
+
var $l = this.settings.strings
|
| 77 |
+
var prefix = $l.prefixAgo
|
| 78 |
+
var suffix = $l.suffixAgo
|
| 79 |
if (this.settings.allowFuture) {
|
| 80 |
if (distanceMillis < 0) {
|
| 81 |
+
prefix = $l.prefixFromNow
|
| 82 |
+
suffix = $l.suffixFromNow
|
| 83 |
}
|
| 84 |
}
|
| 85 |
|
| 86 |
if (!this.settings.allowPast && distanceMillis >= 0) {
|
| 87 |
+
return this.settings.strings.inPast
|
| 88 |
}
|
| 89 |
|
| 90 |
+
var seconds = Math.abs(distanceMillis) / 1000
|
| 91 |
+
var minutes = seconds / 60
|
| 92 |
+
var hours = minutes / 60
|
| 93 |
+
var days = hours / 24
|
| 94 |
+
var years = days / 365
|
| 95 |
|
| 96 |
+
function substitute (stringOrFunction, number) {
|
| 97 |
+
var string = $.isFunction(stringOrFunction) ? stringOrFunction(number, distanceMillis) : stringOrFunction
|
| 98 |
+
var value = ($l.numbers && $l.numbers[number]) || number
|
| 99 |
+
return string.replace(/%d/i, value)
|
| 100 |
}
|
| 101 |
|
| 102 |
var words = seconds < 45 && substitute($l.seconds, Math.round(seconds)) ||
|
| 109 |
days < 45 && substitute($l.month, 1) ||
|
| 110 |
days < 365 && substitute($l.months, Math.round(days / 30)) ||
|
| 111 |
years < 1.5 && substitute($l.year, 1) ||
|
| 112 |
+
substitute($l.years, Math.round(years))
|
| 113 |
|
| 114 |
+
var separator = $l.wordSeparator || ''
|
| 115 |
+
if ($l.wordSeparator === undefined) { separator = ' ' }
|
| 116 |
+
return $.trim([prefix, words, suffix].join(separator))
|
| 117 |
},
|
| 118 |
|
| 119 |
+
parse: function (iso8601) {
|
| 120 |
+
var s = $.trim(iso8601)
|
| 121 |
+
s = s.replace(/\.\d+/, '') // remove milliseconds
|
| 122 |
+
s = s.replace(/-/, '/').replace(/-/, '/')
|
| 123 |
+
s = s.replace(/T/, ' ').replace(/Z/, ' UTC')
|
| 124 |
+
s = s.replace(/([\+\-]\d\d)\:?(\d\d)/, ' $1$2') // -04:00 -> -0400
|
| 125 |
+
s = s.replace(/([\+\-]\d\d)$/, ' $100') // +09 -> +0900
|
| 126 |
+
return new Date(s)
|
| 127 |
},
|
| 128 |
+
datetime: function (elem) {
|
| 129 |
+
var iso8601 = $t.isTime(elem) ? $(elem).attr('datetime') : $(elem).attr('title')
|
| 130 |
+
return $t.parse(iso8601)
|
| 131 |
},
|
| 132 |
+
isTime: function (elem) {
|
| 133 |
// jQuery's `is()` doesn't play well with HTML5 in IE
|
| 134 |
+
return $(elem).get(0).tagName.toLowerCase() === 'time' // $(elem).is("time");
|
| 135 |
}
|
| 136 |
+
})
|
| 137 |
|
| 138 |
// functions that can be called via $(el).timeago('action')
|
| 139 |
// init is default when no action is given
|
| 140 |
// functions are called with context of a single element
|
| 141 |
var functions = {
|
| 142 |
+
init: function () {
|
| 143 |
+
functions.dispose.call(this)
|
| 144 |
+
var refresh_el = $.proxy(refresh, this)
|
| 145 |
+
refresh_el()
|
| 146 |
+
var $s = $t.settings
|
| 147 |
if ($s.refreshMillis > 0) {
|
| 148 |
+
this._timeagoInterval = setInterval(refresh_el, $s.refreshMillis)
|
| 149 |
}
|
| 150 |
},
|
| 151 |
+
update: function (timestamp) {
|
| 152 |
+
var date = (timestamp instanceof Date) ? timestamp : $t.parse(timestamp)
|
| 153 |
+
$(this).data('timeago', { datetime: date })
|
| 154 |
+
if ($t.settings.localeTitle) {
|
| 155 |
+
$(this).attr('title', date.toLocaleString())
|
| 156 |
+
}
|
| 157 |
+
refresh.apply(this)
|
| 158 |
},
|
| 159 |
+
updateFromDOM: function () {
|
| 160 |
+
$(this).data('timeago', { datetime: $t.parse($t.isTime(this) ? $(this).attr('datetime') : $(this).attr('title')) })
|
| 161 |
+
refresh.apply(this)
|
| 162 |
},
|
| 163 |
dispose: function () {
|
| 164 |
if (this._timeagoInterval) {
|
| 165 |
+
window.clearInterval(this._timeagoInterval)
|
| 166 |
+
this._timeagoInterval = null
|
| 167 |
}
|
| 168 |
}
|
| 169 |
+
}
|
| 170 |
|
| 171 |
+
$.fn.timeago = function (action, options) {
|
| 172 |
+
var fn = action ? functions[action] : functions.init
|
| 173 |
if (!fn) {
|
| 174 |
+
throw new Error("Unknown function name '" + action + "' for timeago")
|
| 175 |
}
|
| 176 |
// each over objects here and call the requested function
|
| 177 |
+
this.each(function () {
|
| 178 |
+
fn.call(this, options)
|
| 179 |
+
})
|
| 180 |
+
return this
|
| 181 |
+
}
|
| 182 |
+
|
| 183 |
+
function refresh () {
|
| 184 |
+
var $s = $t.settings
|
| 185 |
+
|
| 186 |
+
// check if it's still visible
|
| 187 |
+
if ($s.autoDispose && !$.contains(document.documentElement, this)) {
|
| 188 |
+
// stop if it has been removed
|
| 189 |
+
$(this).timeago('dispose')
|
| 190 |
+
return this
|
| 191 |
}
|
| 192 |
|
| 193 |
+
var data = prepareData(this)
|
| 194 |
|
| 195 |
if (!isNaN(data.datetime)) {
|
| 196 |
+
if ($s.cutoff === 0 || Math.abs(distance(data.datetime)) < $s.cutoff) {
|
| 197 |
+
$(this).text(inWords(data.datetime))
|
| 198 |
+
} else {
|
| 199 |
+
if ($(this).attr('title').length > 0) {
|
| 200 |
+
$(this).text($(this).attr('title'))
|
| 201 |
+
}
|
| 202 |
}
|
| 203 |
}
|
| 204 |
+
return this
|
| 205 |
}
|
| 206 |
|
| 207 |
+
function prepareData (element) {
|
| 208 |
+
element = $(element)
|
| 209 |
+
if (!element.data('timeago')) {
|
| 210 |
+
element.data('timeago', { datetime: $t.datetime(element) })
|
| 211 |
+
var text = $.trim(element.text())
|
| 212 |
if ($t.settings.localeTitle) {
|
| 213 |
+
element.attr('title', element.data('timeago').datetime.toLocaleString())
|
| 214 |
+
} else if (text.length > 0 && !($t.isTime(element) && element.attr('title'))) {
|
| 215 |
+
element.attr('title', text)
|
| 216 |
}
|
| 217 |
}
|
| 218 |
+
return element.data('timeago')
|
| 219 |
}
|
| 220 |
|
| 221 |
+
function inWords (date) {
|
| 222 |
+
return $t.inWords(distance(date))
|
| 223 |
}
|
| 224 |
|
| 225 |
+
function distance (date) {
|
| 226 |
+
return (new Date().getTime() - date.getTime())
|
| 227 |
}
|
| 228 |
|
| 229 |
// fix for IE6 suckage
|
| 230 |
+
document.createElement('abbr')
|
| 231 |
+
document.createElement('time')
|
| 232 |
+
}))
|
loggers/SimpleLogger.php
CHANGED
|
@@ -230,13 +230,12 @@ class SimpleLogger {
|
|
| 230 |
|
| 231 |
// wp_user = wordpress uses, but user may have been deleted since log entry was added
|
| 232 |
case 'wp_user':
|
| 233 |
-
|
| 234 |
$user_id = isset( $row->context['_user_id'] ) ? $row->context['_user_id'] : null;
|
| 235 |
|
| 236 |
if ( $user_id > 0 && $user = get_user_by( 'id', $user_id ) ) {
|
| 237 |
|
| 238 |
// Sender is user and user still exists
|
| 239 |
-
$is_current_user = (
|
| 240 |
|
| 241 |
// get user role, as done in user-edit.php
|
| 242 |
$wp_roles = $GLOBALS['wp_roles'];
|
|
@@ -285,11 +284,11 @@ class SimpleLogger {
|
|
| 285 |
|
| 286 |
$initiator_html .= sprintf(
|
| 287 |
$tmpl_initiator_html,
|
| 288 |
-
esc_html( $user->user_login ),
|
| 289 |
-
esc_html( $user->user_email ),
|
| 290 |
-
esc_html( $user_display_name ),
|
| 291 |
-
$user_role,
|
| 292 |
-
_x( 'You', 'header output when initiator is the currently logged in user', 'simple-history' ),
|
| 293 |
get_edit_user_link( $user_id ) // 6
|
| 294 |
);
|
| 295 |
|
|
@@ -315,7 +314,6 @@ class SimpleLogger {
|
|
| 315 |
break;
|
| 316 |
|
| 317 |
case 'web_user':
|
| 318 |
-
|
| 319 |
/*
|
| 320 |
Note: server_remote_addr may not show visiting/attacking ip, if server is behind...stuff..
|
| 321 |
Can be behind varnish cashe, or browser can for example use compression in chrome mobile
|
|
@@ -348,8 +346,8 @@ class SimpleLogger {
|
|
| 348 |
print_r($arr_found_additional_ip_headers);
|
| 349 |
Array
|
| 350 |
(
|
| 351 |
-
|
| 352 |
-
|
| 353 |
)
|
| 354 |
*/
|
| 355 |
|
|
@@ -431,24 +429,30 @@ class SimpleLogger {
|
|
| 431 |
$time_ago_just_now_max_time = 30;
|
| 432 |
$time_ago_just_now_max_time = apply_filters( 'simple_history/header_just_now_max_time', $time_ago_just_now_max_time );
|
| 433 |
|
| 434 |
-
|
|
|
|
|
|
|
| 435 |
|
| 436 |
-
|
| 437 |
-
|
| 438 |
|
| 439 |
-
|
|
|
|
|
|
|
|
|
|
| 440 |
|
| 441 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 442 |
$datef = __( 'M j, Y \a\t G:i', 'simple-history' );
|
| 443 |
$str_when = date_i18n( $datef, strtotime( get_date_from_gmt( $row->date ) ) );
|
| 444 |
-
|
| 445 |
} else {
|
| 446 |
-
|
| 447 |
// Show "nn minutes ago" when event is xx seconds ago or earlier
|
| 448 |
$date_human_time_diff = human_time_diff( $date_datetime->getTimestamp(), $time_current );
|
| 449 |
-
/*
|
| 450 |
$str_when = sprintf( __( '%1$s ago', 'simple-history' ), $date_human_time_diff );
|
| 451 |
-
|
| 452 |
}
|
| 453 |
|
| 454 |
$item_permalink = admin_url( 'index.php?page=simple_history_page' );
|
|
@@ -456,25 +460,35 @@ class SimpleLogger {
|
|
| 456 |
$item_permalink .= "#item/{$row->id}";
|
| 457 |
}
|
| 458 |
|
| 459 |
-
|
| 460 |
$str_datetime_title = sprintf(
|
| 461 |
__( '%1$s local time %3$s (%2$s GMT time)', 'simple-history' ),
|
| 462 |
-
get_date_from_gmt( $date_datetime->format( 'Y-m-d H:i:s' ), $
|
| 463 |
-
$date_datetime->format( $
|
| 464 |
PHP_EOL // 3, new line
|
| 465 |
);
|
| 466 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 467 |
$date_html = "<span class='SimpleHistoryLogitem__permalink SimpleHistoryLogitem__when SimpleHistoryLogitem__inlineDivided'>";
|
| 468 |
$date_html .= "<a class='' href='{$item_permalink}'>";
|
| 469 |
$date_html .= sprintf(
|
| 470 |
-
'<
|
| 471 |
esc_attr( $str_datetime_title ), // 1 datetime attribute
|
| 472 |
-
esc_html( $str_when ), // 2 date text, visible in log
|
| 473 |
-
$date_datetime->format( DateTime::RFC3339 ) // 3
|
|
|
|
| 474 |
);
|
| 475 |
$date_html .= '</a>';
|
| 476 |
$date_html .= '</span>';
|
| 477 |
|
|
|
|
|
|
|
| 478 |
/**
|
| 479 |
* Filter the output of the date section of the header.
|
| 480 |
*
|
|
@@ -1224,8 +1238,8 @@ class SimpleLogger {
|
|
| 1224 |
*/
|
| 1225 |
$anonymize_ip_address = apply_filters( 'simple_history/privacy/anonymize_ip_address', true );
|
| 1226 |
|
| 1227 |
-
if ( $anonymize_ip_address ) {
|
| 1228 |
-
$remote_addr =
|
| 1229 |
}
|
| 1230 |
|
| 1231 |
$context['_server_remote_addr'] = $remote_addr;
|
|
@@ -1258,8 +1272,8 @@ class SimpleLogger {
|
|
| 1258 |
// valid, add to context, with loop index appended so we can store many IPs.
|
| 1259 |
$key_lower = strtolower( $key );
|
| 1260 |
|
| 1261 |
-
if ( $anonymize_ip_address ) {
|
| 1262 |
-
$ip =
|
| 1263 |
}
|
| 1264 |
|
| 1265 |
$context[ "_server_{$key_lower}_{$ip_loop_num}" ] = $ip;
|
| 230 |
|
| 231 |
// wp_user = wordpress uses, but user may have been deleted since log entry was added
|
| 232 |
case 'wp_user':
|
|
|
|
| 233 |
$user_id = isset( $row->context['_user_id'] ) ? $row->context['_user_id'] : null;
|
| 234 |
|
| 235 |
if ( $user_id > 0 && $user = get_user_by( 'id', $user_id ) ) {
|
| 236 |
|
| 237 |
// Sender is user and user still exists
|
| 238 |
+
$is_current_user = ( get_current_user_id() == $user_id ) ? true : false;
|
| 239 |
|
| 240 |
// get user role, as done in user-edit.php
|
| 241 |
$wp_roles = $GLOBALS['wp_roles'];
|
| 284 |
|
| 285 |
$initiator_html .= sprintf(
|
| 286 |
$tmpl_initiator_html,
|
| 287 |
+
esc_html( $user->user_login ), // 1
|
| 288 |
+
esc_html( $user->user_email ), // 2
|
| 289 |
+
esc_html( $user_display_name ), // 3
|
| 290 |
+
$user_role, // 4
|
| 291 |
+
_x( 'You', 'header output when initiator is the currently logged in user', 'simple-history' ), // 5
|
| 292 |
get_edit_user_link( $user_id ) // 6
|
| 293 |
);
|
| 294 |
|
| 314 |
break;
|
| 315 |
|
| 316 |
case 'web_user':
|
|
|
|
| 317 |
/*
|
| 318 |
Note: server_remote_addr may not show visiting/attacking ip, if server is behind...stuff..
|
| 319 |
Can be behind varnish cashe, or browser can for example use compression in chrome mobile
|
| 346 |
print_r($arr_found_additional_ip_headers);
|
| 347 |
Array
|
| 348 |
(
|
| 349 |
+
[_server_http_x_forwarded_for_0] => 5.35.187.212
|
| 350 |
+
[_server_http_x_forwarded_for_1] => 83.251.97.21
|
| 351 |
)
|
| 352 |
*/
|
| 353 |
|
| 429 |
$time_ago_just_now_max_time = 30;
|
| 430 |
$time_ago_just_now_max_time = apply_filters( 'simple_history/header_just_now_max_time', $time_ago_just_now_max_time );
|
| 431 |
|
| 432 |
+
$date_format = get_option( 'date_format' );
|
| 433 |
+
$time_format = get_option( 'time_format' );
|
| 434 |
+
$date_and_time_format = $date_format . ' - ' . $time_format;
|
| 435 |
|
| 436 |
+
// Show local time as hours an minutes when event is recent.
|
| 437 |
+
$local_date_format = $time_format;
|
| 438 |
|
| 439 |
+
// Show local time as date and hours when event is a bit older.
|
| 440 |
+
if ( ( $time_current - HOUR_IN_SECONDS * 6 ) > $date_datetime->getTimestamp() ) {
|
| 441 |
+
$local_date_format = $date_and_time_format;
|
| 442 |
+
}
|
| 443 |
|
| 444 |
+
if ( $time_current - $date_datetime->getTimestamp() <= $time_ago_just_now_max_time ) {
|
| 445 |
+
// Show "just now" if event is very recent.
|
| 446 |
+
$str_when = __( 'Just now', 'simple-history' );
|
| 447 |
+
} elseif ( $time_current - $date_datetime->getTimestamp() > $time_ago_max_time ) {
|
| 448 |
+
/* Translators: Date format for log row header, see http://php.net/date */
|
| 449 |
$datef = __( 'M j, Y \a\t G:i', 'simple-history' );
|
| 450 |
$str_when = date_i18n( $datef, strtotime( get_date_from_gmt( $row->date ) ) );
|
|
|
|
| 451 |
} else {
|
|
|
|
| 452 |
// Show "nn minutes ago" when event is xx seconds ago or earlier
|
| 453 |
$date_human_time_diff = human_time_diff( $date_datetime->getTimestamp(), $time_current );
|
| 454 |
+
/* Translators: 1: last modified date and time in human time diff-format */
|
| 455 |
$str_when = sprintf( __( '%1$s ago', 'simple-history' ), $date_human_time_diff );
|
|
|
|
| 456 |
}
|
| 457 |
|
| 458 |
$item_permalink = admin_url( 'index.php?page=simple_history_page' );
|
| 460 |
$item_permalink .= "#item/{$row->id}";
|
| 461 |
}
|
| 462 |
|
| 463 |
+
// Datetime attribute on <time> element.
|
| 464 |
$str_datetime_title = sprintf(
|
| 465 |
__( '%1$s local time %3$s (%2$s GMT time)', 'simple-history' ),
|
| 466 |
+
get_date_from_gmt( $date_datetime->format( 'Y-m-d H:i:s' ), $date_and_time_format ), // 1 local time
|
| 467 |
+
$date_datetime->format( $date_and_time_format ), // GMT time
|
| 468 |
PHP_EOL // 3, new line
|
| 469 |
);
|
| 470 |
|
| 471 |
+
// Time and date before live updated relative date.
|
| 472 |
+
$str_datetime_local = sprintf(
|
| 473 |
+
'%1$s',
|
| 474 |
+
get_date_from_gmt( $date_datetime->format( 'Y-m-d H:i:s' ), $local_date_format ) // 1 local time
|
| 475 |
+
);
|
| 476 |
+
|
| 477 |
+
// HTML for whole span with date info.
|
| 478 |
$date_html = "<span class='SimpleHistoryLogitem__permalink SimpleHistoryLogitem__when SimpleHistoryLogitem__inlineDivided'>";
|
| 479 |
$date_html .= "<a class='' href='{$item_permalink}'>";
|
| 480 |
$date_html .= sprintf(
|
| 481 |
+
'<span title="%1$s">%4$s (<time datetime="%3$s" class="SimpleHistoryLogitem__when__liveRelative">%2$s</time>)</span>',
|
| 482 |
esc_attr( $str_datetime_title ), // 1 datetime attribute
|
| 483 |
+
esc_html( $str_when ), // 2 date text, visible in log, but overridden by JS relative date script.
|
| 484 |
+
$date_datetime->format( DateTime::RFC3339 ), // 3
|
| 485 |
+
esc_html( $str_datetime_local ) // 4
|
| 486 |
);
|
| 487 |
$date_html .= '</a>';
|
| 488 |
$date_html .= '</span>';
|
| 489 |
|
| 490 |
+
sh_error_log('$date_html', $date_html);
|
| 491 |
+
|
| 492 |
/**
|
| 493 |
* Filter the output of the date section of the header.
|
| 494 |
*
|
| 1238 |
*/
|
| 1239 |
$anonymize_ip_address = apply_filters( 'simple_history/privacy/anonymize_ip_address', true );
|
| 1240 |
|
| 1241 |
+
if ( $anonymize_ip_address && function_exists('wp_privacy_anonymize_ip') ) {
|
| 1242 |
+
$remote_addr = wp_privacy_anonymize_ip( $remote_addr );
|
| 1243 |
}
|
| 1244 |
|
| 1245 |
$context['_server_remote_addr'] = $remote_addr;
|
| 1272 |
// valid, add to context, with loop index appended so we can store many IPs.
|
| 1273 |
$key_lower = strtolower( $key );
|
| 1274 |
|
| 1275 |
+
if ( $anonymize_ip_address && function_exists('wp_privacy_anonymize_ip') ) {
|
| 1276 |
+
$ip = wp_privacy_anonymize_ip( $ip );
|
| 1277 |
}
|
| 1278 |
|
| 1279 |
$context[ "_server_{$key_lower}_{$ip_loop_num}" ] = $ip;
|
loggers/SimpleUserLogger.php
CHANGED
|
@@ -814,9 +814,9 @@ class SimpleUserLogger extends SimpleLogger {
|
|
| 814 |
'title' => _x( 'Jabber / Google Talk ', 'User logger', 'simple-history' ),
|
| 815 |
),
|
| 816 |
/*
|
| 817 |
-
|
| 818 |
-
|
| 819 |
-
|
| 820 |
'user_email' => array(
|
| 821 |
'title' => _x( 'Email', 'User logger', 'simple-history' ),
|
| 822 |
),
|
| 814 |
'title' => _x( 'Jabber / Google Talk ', 'User logger', 'simple-history' ),
|
| 815 |
),
|
| 816 |
/*
|
| 817 |
+
"user_nicename" => array(
|
| 818 |
+
"title" => _x("Nicename", "User logger", "simple-history")
|
| 819 |
+
),*/
|
| 820 |
'user_email' => array(
|
| 821 |
'title' => _x( 'Email', 'User logger', 'simple-history' ),
|
| 822 |
),
|
readme.txt
CHANGED
|
@@ -1,11 +1,11 @@
|
|
| 1 |
=== Simple History ===
|
| 2 |
Contributors: eskapism
|
| 3 |
Donate link: http://eskapism.se/sida/donate/
|
| 4 |
-
Tags: history, log, changes, changelog, audit, trail, pages, attachments, users, dashboard, admin, syslog, feed, activity, stream, audit trail, brute-force
|
| 5 |
Requires at least: 4.5.1
|
| 6 |
Tested up to: 4.9
|
| 7 |
Requires PHP: 5.3
|
| 8 |
-
Stable tag: 2.
|
| 9 |
|
| 10 |
View changes made by users within WordPress. See who created a page, uploaded an attachment or approved an comment, and more.
|
| 11 |
|
|
@@ -57,8 +57,7 @@ In Simple History you will see what Jetpack modules that are activated and deact
|
|
| 57 |
|
| 58 |
**Advanced Custom Fields (ACF)**<br>
|
| 59 |
[ACF](https://www.advancedcustomfields.com/) adds fields to your posts and pages.
|
| 60 |
-
Simple History will log changes made to the field groups and the fields inside field groups. Your will
|
| 61 |
-
see when both field groups and fields are created and modified.
|
| 62 |
|
| 63 |
**User Switching**<br>
|
| 64 |
The [User Switching plugin](https://wordpress.org/plugins/user-switching/) allows you to quickly swap between user accounts in WordPress at the click of a button.
|
|
@@ -149,6 +148,16 @@ https://github.com/bonny/WordPress-Simple-History
|
|
| 149 |
|
| 150 |
* If you like this plugin please consider [donating to support the development](https://www.paypal.me/eskapism).
|
| 151 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 152 |
== Screenshots ==
|
| 153 |
|
| 154 |
1. The log view + it also shows the filter function in use - the log only shows event that
|
|
@@ -172,7 +181,14 @@ A simple way to see any uncommon activity, for example an increased number of lo
|
|
| 172 |
|
| 173 |
## Changelog
|
| 174 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 175 |
= 2.27 (August 2018) =
|
|
|
|
| 176 |
- Fix notice errors when syncing an ACF field group. Fixes https://github.com/bonny/WordPress-Simple-History/issues/150.
|
| 177 |
- Fix notice error when trying to read plugin info for a plugin that no longer exists or has changed name. Fixes https://github.com/bonny/WordPress-Simple-History/issues/146.
|
| 178 |
- Always load the SimpleLogger logger. Fixes https://github.com/bonny/WordPress-Simple-History/issues/129.
|
|
@@ -181,15 +197,18 @@ A simple way to see any uncommon activity, for example an increased number of lo
|
|
| 181 |
- Group translation updates in the log. Useful because sometimes you update a lot of translations at the same time and the log is full of just those messages.
|
| 182 |
|
| 183 |
= 2.26.1 (July 2018) =
|
|
|
|
| 184 |
- Fix 5.3 compatibility.
|
| 185 |
|
| 186 |
= 2.26 (July 2018) =
|
|
|
|
| 187 |
- Add support for the [Jetpack plugin](https://wordpress.org/plugins/jetpack/). To begin with, activation and deactivation of Jetpack modules is logged.
|
| 188 |
- Add logging of translation updates, so now you can see when a plugin or a theme has gotten new translations. Fixes https://github.com/bonny/WordPress-Simple-History/issues/147.
|
| 189 |
- Fix notice in Advanced Custom Fields logger when saving an ACF options page.
|
| 190 |
Fixes https://wordpress.org/support/topic/problem-with-acf-options-pages/, https://wordpress.org/support/topic/problem-with-recent-version-and-acf/, https://github.com/bonny/WordPress-Simple-History/issues/145.
|
| 191 |
|
| 192 |
= 2.25 (July 2018) =
|
|
|
|
| 193 |
- Add `wp_cron_current_filter` to event context when something is logged during a cron job. This can help debugging thing like posts being added or deleted by some plugin and you're trying to figure out which plugin it is.
|
| 194 |
- Fix for event details not always being shown.
|
| 195 |
- Fix for sometimes missing user name and user email in export file.
|
| 1 |
=== Simple History ===
|
| 2 |
Contributors: eskapism
|
| 3 |
Donate link: http://eskapism.se/sida/donate/
|
| 4 |
+
Tags: history, log, changes, changelog, audit, audit log, event log, user tracking, trail, pages, attachments, users, dashboard, admin, syslog, feed, activity, stream, audit trail, brute-force
|
| 5 |
Requires at least: 4.5.1
|
| 6 |
Tested up to: 4.9
|
| 7 |
Requires PHP: 5.3
|
| 8 |
+
Stable tag: 2.28
|
| 9 |
|
| 10 |
View changes made by users within WordPress. See who created a page, uploaded an attachment or approved an comment, and more.
|
| 11 |
|
| 57 |
|
| 58 |
**Advanced Custom Fields (ACF)**<br>
|
| 59 |
[ACF](https://www.advancedcustomfields.com/) adds fields to your posts and pages.
|
| 60 |
+
Simple History will log changes made to the field groups and the fields inside field groups. Your will see when both field groups and fields are created and modified.
|
|
|
|
| 61 |
|
| 62 |
**User Switching**<br>
|
| 63 |
The [User Switching plugin](https://wordpress.org/plugins/user-switching/) allows you to quickly swap between user accounts in WordPress at the click of a button.
|
| 148 |
|
| 149 |
* If you like this plugin please consider [donating to support the development](https://www.paypal.me/eskapism).
|
| 150 |
|
| 151 |
+
== Frequently Asked Questions ==
|
| 152 |
+
|
| 153 |
+
= Can I add my own events to the log? =
|
| 154 |
+
|
| 155 |
+
Yes. See the [examples file](https://github.com/bonny/WordPress-Simple-History/blob/master/examples/examples.php).
|
| 156 |
+
|
| 157 |
+
= For how long are events stored? =
|
| 158 |
+
|
| 159 |
+
Events in the log are stored for 60 days by default. Events older than this will be removed.
|
| 160 |
+
|
| 161 |
== Screenshots ==
|
| 162 |
|
| 163 |
1. The log view + it also shows the filter function in use - the log only shows event that
|
| 181 |
|
| 182 |
## Changelog
|
| 183 |
|
| 184 |
+
= 2.28 (September 2018) =
|
| 185 |
+
|
| 186 |
+
- Always show time and sometimes date before each event, in addition to the relative date. Fixes https://wordpress.org/support/topic/feature-request-granular-settings-changes-detailed-timestamp/.
|
| 187 |
+
- Use WordPress own function (`wp_privacy_anonymize_ip`, available since WordPress version 4.9.6) to anonymize IP addresses, instead of our own class.
|
| 188 |
+
- Update timeago.js
|
| 189 |
+
|
| 190 |
= 2.27 (August 2018) =
|
| 191 |
+
|
| 192 |
- Fix notice errors when syncing an ACF field group. Fixes https://github.com/bonny/WordPress-Simple-History/issues/150.
|
| 193 |
- Fix notice error when trying to read plugin info for a plugin that no longer exists or has changed name. Fixes https://github.com/bonny/WordPress-Simple-History/issues/146.
|
| 194 |
- Always load the SimpleLogger logger. Fixes https://github.com/bonny/WordPress-Simple-History/issues/129.
|
| 197 |
- Group translation updates in the log. Useful because sometimes you update a lot of translations at the same time and the log is full of just those messages.
|
| 198 |
|
| 199 |
= 2.26.1 (July 2018) =
|
| 200 |
+
|
| 201 |
- Fix 5.3 compatibility.
|
| 202 |
|
| 203 |
= 2.26 (July 2018) =
|
| 204 |
+
|
| 205 |
- Add support for the [Jetpack plugin](https://wordpress.org/plugins/jetpack/). To begin with, activation and deactivation of Jetpack modules is logged.
|
| 206 |
- Add logging of translation updates, so now you can see when a plugin or a theme has gotten new translations. Fixes https://github.com/bonny/WordPress-Simple-History/issues/147.
|
| 207 |
- Fix notice in Advanced Custom Fields logger when saving an ACF options page.
|
| 208 |
Fixes https://wordpress.org/support/topic/problem-with-acf-options-pages/, https://wordpress.org/support/topic/problem-with-recent-version-and-acf/, https://github.com/bonny/WordPress-Simple-History/issues/145.
|
| 209 |
|
| 210 |
= 2.25 (July 2018) =
|
| 211 |
+
|
| 212 |
- Add `wp_cron_current_filter` to event context when something is logged during a cron job. This can help debugging thing like posts being added or deleted by some plugin and you're trying to figure out which plugin it is.
|
| 213 |
- Fix for event details not always being shown.
|
| 214 |
- Fix for sometimes missing user name and user email in export file.
|
